Datasets:

timaeus
/

pile-dm_mathematics

Dataset card Data Studio Files Files and versions Community

Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
t is 690 minutes before 7:55 PM? 8:25 AM How many minutes are there between 11:21 PM and 6:21 AM? 420 How many minutes are there between 12:08 PM and 2:37 PM? 149 How many minutes are there between 8:14 AM and 9:44 AM? 90 How many minutes are there between 5:19 AM and 11:57 AM? 398 What is 676 minutes before 3:14 AM? 3:58 PM What is 292 minutes before 1:25 PM? 8:33 AM How many minutes are there between 6:51 PM and 12:14 AM? 323 What is 289 minutes after 7:45 AM? 12:34 PM How many minutes are there between 1:35 AM and 2:23 AM? 48 How many minutes are there between 3:47 PM and 5:55 PM? 128 How many minutes are there between 9:32 AM and 8:50 PM? 678 How many minutes are there between 12:09 AM and 7:17 AM? 428 How many minutes are there between 10:21 AM and 5:30 PM? 429 How many minutes are there between 8:20 PM and 4:03 AM? 463 How many minutes are there between 8:16 AM and 3:20 PM? 424 What is 443 minutes after 5:01 PM? 12:24 AM How many minutes are there between 4:10 PM and 12:00 AM? 470 What is 20 minutes after 10:19 AM? 10:39 AM How many minutes are there between 1:59 PM and 4:45 PM? 166 How many minutes are there between 5:37 AM and 4:23 PM? 646 What is 678 minutes after 12:33 PM? 11:51 PM How many minutes are there between 4:51 PM and 12:00 AM? 429 How many minutes are there between 5:29 AM and 7:51 AM? 142 What is 418 minutes after 2:54 PM? 9:52 PM How many minutes are there between 3:52 AM and 9:47 AM? 355 What is 678 minutes before 9:32 AM? 10:14 PM What is 6 minutes after 1:33 AM? 1:39 AM How many minutes are there between 3:03 AM and 7:15 AM? 252 What is 89 minutes after 10:19 AM? 11:48 AM What is 366 minutes before 2:15 PM? 8:09 AM What is 453 minutes after 9:29 AM? 5:02 PM What is 341 minutes after 1:02 AM? 6:43 AM What is 491 minutes before 1:22 PM? 5:11 AM What is 421 minutes after 10:56 PM? 5:57 AM How many minutes are there between 10:07 AM and 5:33 PM? 446 What is 582 minutes before 7:43 AM? 10:01 PM How many minutes are there between 3:57 AM and 8:12 AM? 255 What is 207 minutes after 1:42 PM? 5:09 PM How many minutes are there between 11:34 PM and 10:43 AM? 669 How many minutes are there between 11:47 AM and 2:15 PM? 148 What is 120 minutes before 10:56 PM? 8:56 PM How many minutes are there between 2:05 AM and 3:08 AM? 63 How many minutes are there between 11:08 AM and 12:36 PM? 88 What is 646 minutes before 1:13 PM? 2:27 AM What is 293 minutes before 11:35 AM? 6:42 AM What is 587 minutes before 11:42 PM? 1:55 PM How many minutes are there between 2:51 PM and 9:41 PM? 410 What is 191 minutes after 12:34 AM? 3:45 AM What is 69 minutes after 10:01 AM? 11:10 AM What is 458 minutes before 8:00 AM? 12:22 AM What is 679 minutes before 4:21 AM? 5:02 PM What is 634 minutes after 6:49 PM? 5:23 AM What is 128 minutes before 11:48 AM? 9:40 AM How many minutes are there between 4:31 AM and 5:11 AM? 40 What is 391 minutes after 7:09 PM? 1:40 AM What is 130 minutes before 7:32 AM? 5:22 AM What is 366 minutes before 11:18 AM? 5:12 AM How many minutes are there between 2:39 PM and 2:16 AM? 697 What is 39 minutes before 10:29 PM? 9:50 PM How many minutes are there between 10:17 AM and 6:40 PM? 503 How many minutes are there between 3:42 PM and 1:26 AM? 584 What is 459 minutes before 6:03 PM? 10:24 AM What is 107 minutes after 6:49 PM? 8:36 PM How many minutes are there between 9:11 PM and 8:33 AM? 682 What is 332 minutes after 6:24 AM? 11:56 AM What is 387 minutes after 1:14 AM? 7:41 AM How many minutes are there between 1:08 PM and 3:55 PM? 167 What is 568 minutes after 11:32 PM? 9:00 AM How many minutes are there between 3:01 AM and 1:06 PM? 605 How many minutes are there between 10:40 PM and 1:04 AM? 144 How many minutes are there between 11:28 AM and 2:06 PM? 158 How many minutes are there between 10:26 AM and 3:39 PM? 313 What is 144 minutes before 1:18 AM? 10:54 PM What is 172 minutes before 3:59 AM? 1:07 AM What is 628 minutes before 9:25 AM? 10:57 PM How many minutes are there between 10:54 AM and 12:55 PM? 121 How many minutes are there between 9:09 AM and 8:10 PM? 661 How many minutes are there between 12:55 AM and 5:46 AM? 291 How many minutes are there between 10:44 AM and 2:47 PM? 243 How many minutes are there between 11:16 PM and 8:52 AM? 576 How many minutes are there between 10:25 AM and 10:05 PM? 700 How many minutes are there between 5:04 PM and 1:26 AM? 502 What is 410 minutes after 8:58 PM? 3:48 AM What is 676 minutes before 12:19 PM? 1:03 AM What is 323 minutes before 3:26 AM? 10:03 PM How many minutes are there between 5:03 PM and 2:55 AM? 592 What is 155 minutes before 6:15 AM? 3:40 AM How many minutes are there between 8:06 AM and 7:54 PM? 708 What is 54 minutes after 3:50 AM? 4:44 AM How many minutes are there between 1:42 AM and 2:32 AM? 50 How many minutes are there between 7:13 PM and 1:06 AM? 353 What is 102 minutes before 11:16 AM? 9:34 AM What is 328 minutes before 10:40 PM? 5:12 PM What is 490 minutes before 6:07 AM? 9:57 PM What is 324 minutes after 1:11 PM? 6:35 PM What is 373 minutes before 8:47 PM? 2:34 PM What is 231 minutes after 8:56 PM? 12:47 AM How many minutes are there between 11:48 PM and 2:09 AM? 141 What is 419 minutes after 6:55 PM? 1:54 AM What is 549 minutes after 4:03 AM? 1:12 PM How many minutes are there between 11:55 PM and 7:57 AM? 482 How many minutes are there between 6:29 AM and 2:22 PM? 473 How many minutes are there between 3:22 AM and 11:24 AM? 482 What is 54 minutes before 10:58 PM? 10:04 PM What is 581 minutes after 7:45 AM? 5:26 PM What is 702 minutes after 11:35 AM? 11:17 PM What is 643 minutes after 2:16 AM? 12:59 PM What is 115 minutes before 10:32 PM? 8:37 PM What is 589 minutes before 5:33 AM? 7:44 PM How many minutes are there between 2:14 AM and 6:17 AM? 243 How many minutes are there between 2:36 AM and 7:10 AM? 274 What is 11 minutes before 9:02 AM? 8:51 AM What is 39 minutes after 10:37 AM? 11:16 AM What is 342 minutes after 4:43 AM? 10:25 AM What is 332 minutes before 3:31 PM? 9:59 AM What is 353 minutes after 9:30 PM? 3:23 AM What is 714 minutes before 8:22 AM? 8:28 PM What is 160 minutes after 3:21 PM? 6:01 PM What is 514 minutes after 6:52 PM? 3:26 AM What is 679 minutes before 4:43 AM? 5:24 PM What is 623 minutes after 5:35 PM? 3:58 AM How many minutes are there between 8:47 PM and 2:04 AM? 317 How many minutes are there between 9:57 AM and 1:08 PM? 191 How many minutes are there between 11:29 AM and 2:24 PM? 175 What is 636 minutes before 4:17 AM? 5:41 PM How many minutes are there between 6:53 AM and 9:22 AM? 149 What is 705 minutes after 6:09 PM? 5:54 AM What is 277 minutes before 3:52 PM? 11:15 AM How many minutes are there between 6:33 PM and 2:41 AM? 488 What is 444 minutes after 4:05 PM? 11:29 PM What is 292 minutes after 2:28 PM? 7:20 PM What is 681 minutes after 10:17 AM? 9:38 PM How many minutes are there between 4:40 AM and 8:52 AM? 252 How many minutes are there between 11:53 PM and 8:59 AM? 546 What is 564 minutes after 10:34 AM? 7:58 PM How many minutes are there between 9:48 AM and 11:19 AM? 91 How many minutes are there between 1:01 AM and 11:47 AM? 646 What is 402 minutes before 3:10 PM? 8:28 AM What is 323 minutes after 9:57 AM? 3:20 PM How many minutes are there between 12:51 PM and 1:42 PM? 51 What is 588 minutes before 4:28 AM? 6:40 PM What is 195 minutes after 1:39 PM? 4:54 PM How many minutes are there between 7:08 PM and 7:14 PM? 6 How many minutes are there between 3:45 PM and 3:39 AM? 714 How many minutes are there between 1:03 AM and 10:06 AM? 543 How many minutes are there between 12:35 PM and 1:25 PM? 50 How many minutes are there between 6:00 AM and 6:11 AM? 11 What is 456 minutes before 11:00 PM? 3:24 PM What is 388 minutes after 6:53 PM? 1:21 AM How many minutes are there between 9:28 PM and 7:52 AM? 624 What is 107 minutes after 7:51 AM? 9:38 AM What is 445 minutes after 11:36 PM? 7:01 AM What is 104 minutes before 9:12 PM? 7:28 PM How many minutes are there between 3:04 AM and 3:14 AM? 10 How many minutes are there between 6:06 AM and 12:37 PM? 391 How many minutes are there between 12:09 AM and 10:05 AM? 596 How many minutes are there between 2:46 AM and 8:18 AM? 332 How many minutes are there between 8:18 PM and 6:34 AM? 616	{ "pile_set_name": "DM Mathematics" }
inder when x(16) is divided by p. 6 Let o = -4339 - -4403. What is the remainder when 437 is divided by o? 53 Suppose j + 1516 = 4b, -13b + 1130 = -10b + j. Calculate the remainder when b is divided by 366. 12 Let s(g) = 4g*2 - 6g + 28. Let a be s(10). Suppose -10p - a = -18p. What is the remainder when p is divided by 10? 6 Let d(u) = -u*2 + 4u + 3. Let q be d(4). Suppose qk - m = 4m + 100, -k = -5m - 30. Let w = -492 + 503. Calculate the remainder when k is divided by w. 2 Let r = -99 - -32. Let u = r - -140. Suppose -23 - u = -4b. What is the remainder when 45 is divided by b? 21 Let u(g) = 3g2 + 201g + 1128. What is the remainder when 2007 is divided by u(-6)? 27 Let m(x) = 2x2 - 102x + 690. Calculate the remainder when m(89) is divided by 113. 109 Let i = -2308 - -2327. What is the remainder when 5337 is divided by i? 17 Let f(o) = 24o2 - 1. Let r be f(1). Let b = r + -14. Let i = -2241 - -2293. What is the remainder when i is divided by b? 7 Suppose 4b = 2p + 378, -5p - 567 = -2p + 4b. Suppose -36g + 279 = -27g. What is the remainder when g is divided by (-4)/3p/14? 13 Let j(u) = u + 71. What is the remainder when 2183 is divided by j(-19)? 51 Let x(w) = -1105w + 6755. What is the remainder when 4624 is divided by x(6)? 124 Suppose 76a = 73a + 123. What is the remainder when 320 is divided by a? 33 Suppose 4s - 44d - 1001 = -43d, 5d - 971 = -4s. What is the remainder when s is divided by 212? 37 Let a(m) = 1 - 2m + 96m2 - 100m2 - m3 - 5. Let g be a(-4). Calculate the remainder when 4 - g - -37 - 4 is divided by 9. 6 Let t(i) be the third derivative of i6/120 - i5/4 + 5i4/12 + 61i3/6 + i2 + 35. What is the remainder when 52 is divided by t(14)? 2 Let d(z) = 616z - 2832. Calculate the remainder when d(5) is divided by 64. 56 What is the remainder when (10 - (-522)/(-45))-1315 is divided by 62? 58 Let s(x) be the second derivative of x*3 - 9x*2/2 - 7x + 81. Suppose 6 = 2z - 2. What is the remainder when 41 is divided by s(z)? 11 Suppose -5u + 24 = u. Suppose -3g + 245 = -uq, -277 = -3g - q - 3q. Suppose g = 3w - 60. What is the remainder when w is divided by 25? 24 Let x(f) be the second derivative of f5/10 - 19f*4/4 + 14f*3/3 + 9f*2 - 14f. Calculate the remainder when 66 is divided by x(28). 12 Let z = 841 - 354. Calculate the remainder when z is divided by 19. 12 Suppose n + 40 = 5k + 2n, 2n = 5k - 25. Suppose kl = 10l + 51. Let w(f) = f*2 + 16f + 10. What is the remainder when w(l) is divided by 6? 3 Suppose -12j + 16j + 248 = 0. Let r = 11 + j. Let v = -22 - r. What is the remainder when 84 is divided by v? 26 Suppose 0 = -18h + 19h - 4g - 60, 2h - 3g = 95. What is the remainder when 4/6-3 - -200 is divided by h? 38 Let w = -14 - -98. Let r = 88 - w. Calculate the remainder when 213 + (-16)/r + 4 is divided by 22. 19 Suppose 0 = -12g + 3g + 162. Suppose -40 = 14i - gi. Suppose -4b - 13 + i = 5l, 0 = 5b + 5l. What is the remainder when 9 is divided by b? 0 Let j(n) = n - 6. Let c(y) = -y + 7. Let z(r) = 3c(r) + 2j(r). Let i be z(6). Suppose -8d + id = -120. Calculate the remainder when 90 is divided by d. 18 Suppose 1147c + 388 - 1837 = 1078c. Calculate the remainder when 334 is divided by c. 19 Suppose -2s = 5w + 115, -w - 65 = 2s - 6w. Let g = s + 49. Suppose 0 = -2a, -4a - a + 360 = gh. What is the remainder when h is divided by 23? 21 Let x be 0 - (-2)/2-1. Let a = x + 5. What is the remainder when 117 is divided by (130/(-13))/((-1)/a)? 37 Suppose -5x + 1 = 11. Let b(w) = -10w - 74 + 5w + 71 - 9w. What is the remainder when 95 is divided by b(x)? 20 Suppose 3q + 1422 = 5o, 10o = q + 6o + 481. Let n = q - -511. Calculate the remainder when n is divided by 44/8(3 + -1). 9 Let l(r) = 1. Let k(m) = m*2 + 4m - 7. Let i(j) = k(j) + 4l(j). What is the remainder when 64 is divided by i(-6)? 1 Suppose 6012 = 3o + 5b + 2117, 3o - 3903 = 3b. What is the remainder when o is divided by 6? 4 Suppose 87g - 91g - 60 = 0. Let k(c) be the third derivative of c5/60 + 5c*4/8 + 25c*3/6 - 33c*2. What is the remainder when k(g) is divided by 15? 10 Suppose r + 4y = 26, -72y + 77y = -25. Calculate the remainder when 2206 is divided by r. 44 Let c = 655 + -603. What is the remainder when (408/9)/(c/12 - 4) is divided by 20? 16 Let n = 8 - -6. Calculate the remainder when n is divided by -26 + 46 - (3 - -3). 0 Suppose 2 = -0x + x. Let k(g) = 2g*3 - 4g*2 + 4g - 3. Suppose 0 = 480r - 465r - 360. What is the remainder when r is divided by k(x)? 4 Let j(o) = -o*2 - 24o + 39. Let r be j(-38). Let h = -461 - r. Calculate the remainder when h is divided by 9. 5 Suppose -2b - d + 35 = b, -4d = -b - 10. Let g be (-4)/b + (-1804)/(-110). Suppose gh - 108 = 10h. What is the remainder when 49 is divided by h? 13 Let k be 4/(-3)(-7)/((-28)/12). Let h be 4 - 0(k - -5). Suppose 0 = -hr + 13 + 47. What is the remainder when 87 is divided by r? 12 Let j(r) be the first derivative of 2r*3/3 - 31r*2/2 - 17r + 34. Calculate the remainder when j(17) is divided by 18. 16 Suppose 26u - 6050 = 2393 - 1137. Calculate the remainder when u is divided by 71. 68 Let t = -392 + 395. Suppose 3g - 7g + 96 = to, -5o + g = -183. What is the remainder when 143 is divided by o? 35 Let r be (-2 - 16)(-2)/6. Calculate the remainder when 262 is divided by 36/r + -5 + 11. 10 Let a be (7 + 1)9/((-54)/(-15)). Suppose 8r - a = 60. Calculate the remainder when 34 is divided by r. 4 Let r(b) = b*3 + 11b*2 - 4b - 16. Suppose 6t + 4t - 190 = 0. Suppose tm - 200 = -6m. What is the remainder when r(-11) is divided by m? 4 Let g(d) = -d*3 - 16d*2 - 17d - 25. Let n(f) = f*2 + 11f + 13. Let u be n(-4). What is the remainder when 43 is divided by g(u)? 3 Let s = -211 - -304. Suppose -4r + 99 = -37. What is the remainder when s is divided by r? 25 Calculate the remainder when 1351 is divided by (-8 + -18)(-1 - (-22)/(-4)). 168 Let y(x) = x*3 + 13x*2 + 26x - 69. What is the remainder when y(-6) is divided by 20? 7 Let o be (1406/296)/((-2)/(-16)). Let a = o + -11. What is the remainder when 401 is divided by a? 23 Suppose 41z - 3718 = 19z. Calculate the remainder when 30925 is divided by z. 167 Suppose 5u - 11 - 9 = 0. Let m = -33 + 37. Suppose 5s + 3w - 42 = 0, 0 = 4s - w + mw - 36. What is the remainder when s is divided by u? 2 Let o = 301 - 73. Suppose -130i = -134i + o. Calculate the remainder when 108 is divided by i. 51 What is the remainder when ((-18732)/60 + 11)-5 is divided by 304? 290 Suppose 369m = 381m - 3032 + 632. Suppose 2 = -4a + 118. Calculate the remainder when m is divided by a. 26 Let i(a) = 183a*2 - 17a - 1. Let z be i(-3). Let m = 2624 - z. Calculate the remainder when m is divided by 32. 31 What is the remainder when 10/(-6) - 116137/(-987) is divided by 115? 1 Suppose -2b - q - 44 = -142, -2q - 126 = -3b. What is the remainder when 2299 is divided by b? 45 Suppose -4g = -5d + 278 + 38, -d + 2g + 68 = 0. Calculate the remainder when d is divided by 31. 29 Let z be -480(8 - (-90)/(-12)). Calculate the remainder when 114 is divided by (2/(-3))/(4/z). 34 Let r(k) = -19k - 57. Suppose -n - 18 = -7. What is the remainder when r(n) is divided by 14? 12 Let o = -2856 + 2891. Calculate the remainder when 239 is divided by o. 29 Suppose -46u + 39u = -28. Suppose 0 = 3c - 6c + us + 180, 240 = 4c - 2s. Calculate the remainder when c is divided by 18. 6 Let u(n) = n3 - 11n*2 + 11n - 7. Let c be u(10). Suppose -cr + 1529 = 5f, 3r = 4f - 2f - 620. What is the remainder when f is divided by 28? 27 Suppose -42j + 43j + 8 = -4b, -2b + 18 = -5j. Calculate the remainder when j + (-5 + 3 - -1 - -154) is divided by 12. 5 Suppose 58 = c - 4h, -105 = -3c - h + 17. Let d = -10 - 12. Calculate the remainder when c is divided by (30/8)/(d/(-88)). 12 Suppose g + h = 85, 35g + 171 = 37g + 3h. Suppose -12 = -t - 4. What is the remainder when g is divided by t? 4 Suppose -761645 - 698741 = -245l + 54l. Calculate the remainder when l is divided by 18. 14 Calculate the remainder when 171 is divided by 35/(-28)(-324)/9. 36 Suppose -4d - 40 = 2c, 2d + 13c - 15*	{ "pile_set_name": "DM Mathematics" }
te prob of picking 2 s when two letters picked without replacement from ssmmssssmsm. 21/55 Four letters picked without replacement from btbrrakprbrbr. What is prob of picking 2 r, 1 k, and 1 a? 2/143 What is prob of picking 3 p when three letters picked without replacement from ppppmmpmmspmmpmppmmm? 7/95 Three letters picked without replacement from {a: 3, f: 4}. Give prob of picking 2 f and 1 a. 18/35 Three letters picked without replacement from {r: 1, o: 3, u: 5}. What is prob of picking 2 u and 1 o? 5/14 Three letters picked without replacement from {v: 1, x: 1, b: 1, p: 1, g: 2, m: 1}. What is prob of picking 1 m, 1 x, and 1 p? 1/35 Three letters picked without replacement from {p: 1, y: 1, a: 1, e: 1, l: 3}. Give prob of picking 1 e, 1 y, and 1 l. 3/35 Calculate prob of picking 2 k, 1 u, and 1 q when four letters picked without replacement from ckakakquaqek. 4/165 Calculate prob of picking 1 o and 1 h when two letters picked without replacement from {l: 1, g: 1, h: 2, u: 1, o: 2, i: 2}. 1/9 What is prob of picking 1 s and 1 n when two letters picked without replacement from {n: 1, s: 5, h: 4}? 1/9 Calculate prob of picking 1 r, 1 m, and 1 f when three letters picked without replacement from {m: 9, r: 2, f: 2}. 18/143 Calculate prob of picking 1 i and 1 w when two letters picked without replacement from {g: 2, w: 3, j: 1, d: 3, i: 1}. 1/15 Three letters picked without replacement from {n: 4}. What is prob of picking 3 n? 1 What is prob of picking 4 a when four letters picked without replacement from {n: 3, a: 9}? 14/55 What is prob of picking 4 m when four letters picked without replacement from memmmem? 1/7 Two letters picked without replacement from {p: 6, o: 4}. Give prob of picking 2 o. 2/15 Three letters picked without replacement from hpypypphpjypbbpbpybp. Give prob of picking 1 h and 2 y. 1/95 Three letters picked without replacement from dwtwwhwhwtwwtcwhtdw. What is prob of picking 1 t and 2 h? 4/323 Two letters picked without replacement from eeeyeyyyyyye. Give prob of picking 1 y and 1 e. 35/66 What is prob of picking 1 x and 1 e when two letters picked without replacement from {e: 2, m: 1, x: 1}? 1/3 What is prob of picking 1 p and 3 n when four letters picked without replacement from {w: 8, p: 3, o: 1, q: 4, n: 3}? 1/1292 What is prob of picking 3 d when three letters picked without replacement from {d: 9, t: 5}? 3/13 What is prob of picking 2 d when two letters picked without replacement from dddd? 1 Calculate prob of picking 1 d and 2 v when three letters picked without replacement from ddydhyvddhydh. 0 Three letters picked without replacement from {q: 3, t: 2, f: 1, r: 1, c: 4}. What is prob of picking 2 t and 1 c? 4/165 Calculate prob of picking 2 m when two letters picked without replacement from {m: 3, a: 9}. 1/22 What is prob of picking 1 a, 2 p, and 1 r when four letters picked without replacement from {p: 3, o: 7, a: 1, r: 1}? 1/165 Four letters picked without replacement from mlhlxmg. What is prob of picking 2 l, 1 m, and 1 g? 2/35 What is prob of picking 1 z and 1 j when two letters picked without replacement from hjzj? 1/3 Four letters picked without replacement from {j: 1, d: 3, t: 1, g: 2, k: 1, u: 3}. Give prob of picking 1 d, 2 g, and 1 t. 1/110 Calculate prob of picking 1 a and 2 c when three letters picked without replacement from csggscsascgssssag. 3/340 Calculate prob of picking 1 l and 1 n when two letters picked without replacement from lhnununluu. 2/15 Calculate prob of picking 2 g when two letters picked without replacement from qqjjjqxzqqzvzvjggggq. 3/95 Calculate prob of picking 1 m and 1 t when two letters picked without replacement from imyymt. 2/15 Four letters picked without replacement from dwddxdddwdxd. Give prob of picking 4 d. 14/99 What is prob of picking 1 z and 2 p when three letters picked without replacement from azpp? 1/4 Calculate prob of picking 1 p, 1 w, and 1 n when three letters picked without replacement from neezwneeezzennp. 4/455 What is prob of picking 1 r and 1 g when two letters picked without replacement from {w: 2, g: 3, r: 1, z: 1}? 1/7 Calculate prob of picking 1 t, 1 q, and 2 i when four letters picked without replacement from {t: 1, q: 1, f: 4, p: 1, i: 2}. 1/126 Four letters picked without replacement from {l: 4, o: 3, t: 2, q: 6, y: 4, i: 1}. Give prob of picking 3 l and 1 o. 4/1615 Calculate prob of picking 3 c and 1 r when four letters picked without replacement from ccrccccc. 1/2 Calculate prob of picking 1 b and 2 o when three letters picked without replacement from okooiobbkioo. 3/22 Three letters picked without replacement from uvbbqducuqcu. Give prob of picking 1 c, 1 u, and 1 v. 2/55 Two letters picked without replacement from yykyyyyyyyyyyyyyyy. What is prob of picking 1 k and 1 y? 1/9 Three letters picked without replacement from ffufs. Give prob of picking 2 f and 1 u. 3/10 Three letters picked without replacement from thtttth. What is prob of picking 2 h and 1 t? 1/7 Four letters picked without replacement from {u: 2, m: 2, n: 8, a: 1, j: 1, h: 3}. What is prob of picking 1 u and 3 n? 4/85 What is prob of picking 4 e when four letters picked without replacement from {h: 13, e: 5}? 1/612 Two letters picked without replacement from dyddyd. Give prob of picking 1 d and 1 y. 8/15 Calculate prob of picking 1 i and 1 t when two letters picked without replacement from {i: 2, t: 1, a: 2, s: 1}. 2/15 Four letters picked without replacement from fkkfjjjjjjkkjjjj. Give prob of picking 2 j, 1 f, and 1 k. 18/91 Four letters picked without replacement from vvvttvvtwtwvtwtwt. Give prob of picking 3 t and 1 w. 1/17 What is prob of picking 1 g and 1 i when two letters picked without replacement from uuughyiihugivuu? 2/35 Calculate prob of picking 4 r when four letters picked without replacement from {e: 1, j: 2, r: 11}. 30/91 Calculate prob of picking 1 w and 1 n when two letters picked without replacement from nnnnwnnn. 1/4 Three letters picked without replacement from yyggyg. Give prob of picking 2 g and 1 y. 9/20 Three letters picked without replacement from {p: 1, k: 3, c: 2, i: 1, o: 2, b: 3}. Give prob of picking 1 c and 2 o. 1/110 Two letters picked without replacement from vvpvprpvv. What is prob of picking 1 v and 1 r? 5/36 What is prob of picking 1 b and 2 d when three letters picked without replacement from {z: 4, a: 2, v: 2, d: 2, r: 2, b: 2}? 1/182 Two letters picked without replacement from qkkiikkicirqbqibqri. What is prob of picking 1 r and 1 q? 8/171 Calculate prob of picking 3 g when three letters picked without replacement from {z: 5, g: 8}. 28/143 Four letters picked without replacement from fefffefeeeff. What is prob of picking 1 e and 3 f? 35/99 Four letters picked without replacement from wmwmwmwhwmwwmmmwmmm. Give prob of picking 1 w, 1 h, and 2 m. 30/323 Three letters picked without replacement from gxzgx. Give prob of picking 2 x and 1 z. 1/10 What is prob of picking 1 q and 2 b when three letters picked without replacement from {y: 2, q: 7, b: 3, j: 1, t: 5}? 7/272 Calculate prob of picking 1 g, 2 d, and 1 k when four letters picked without replacement from {d: 5, s: 1, k: 3, p: 1, j: 6, g: 1}. 3/238 What is prob of picking 1 b and 1 r when two letters picked without replacement from xxxbibbbrxrixxxxxi? 8/153 Four letters picked without replacement from {k: 3, v: 1, n: 1, w: 2}. What is prob of picking 1 v, 1 n, 1 k, and 1 w? 6/35 Four letters picked without replacement from {o: 1, w: 3, t: 3, n: 1, k: 1, e: 2}. Give prob of picking 1 o, 1 n, 1 e, and 1 w. 1/55 What is prob of picking 1 a, 2 r, and 1 n when four letters picked without replacement from {t: 6, n: 1, a: 6, r: 3, s: 1}? 9/1190 Two letters picked without replacement from llccll. What is prob of picking 1 c and 1 l? 8/15 Four letters picked without replacement from ggggggg. Give prob of picking 4 g. 1 Two letters picked without replacement from {y: 1, f: 1, w: 1, o: 1, q: 3}. What is prob of picking 1 w and 1 o? 1/21 Two letters picked without replacement from lllulllllllll. What is prob of picking 1 l and 1 u? 2/13 Four letters picked without replacement from wpppppwpwpp. What is prob of picking 1 w and 3 p? 28/55 Four letters picked without replacement from {r: 1, c: 2, o: 13, j:	{ "pile_set_name": "DM Mathematics" }
cked without replacement from ddiddfbddindcinbbdn. 1/323 Two letters picked without replacement from {g: 4, d: 2, z: 4}. What is prob of picking 1 d and 1 z? 8/45 What is prob of picking 1 o, 1 m, and 1 s when three letters picked without replacement from {o: 1, s: 11, m: 2}? 11/182 What is prob of picking 2 y and 1 s when three letters picked without replacement from {s: 5, y: 5, k: 2}? 5/22 Four letters picked without replacement from {y: 9, i: 7}. Give prob of picking 2 y and 2 i. 27/65 Two letters picked without replacement from {v: 2, p: 1, t: 1}. What is prob of picking 1 p and 1 t? 1/6 Calculate prob of picking 1 m and 1 j when two letters picked without replacement from {e: 4, m: 1, i: 3, j: 10, w: 1}. 10/171 What is prob of picking 2 a and 1 w when three letters picked without replacement from {w: 1, a: 3}? 3/4 What is prob of picking 1 n and 1 h when two letters picked without replacement from hnhnhhn? 4/7 Three letters picked without replacement from xsmmpxpsmmmp. What is prob of picking 2 p and 1 s? 3/110 Calculate prob of picking 2 x and 1 k when three letters picked without replacement from {t: 1, x: 1, k: 2, p: 2}. 0 Calculate prob of picking 2 q when two letters picked without replacement from {u: 12, q: 3}. 1/35 What is prob of picking 2 g and 1 n when three letters picked without replacement from nccggxoxxgggxnnnocpn? 5/114 Two letters picked without replacement from llllll. Give prob of picking 2 l. 1 Two letters picked without replacement from rprrwrrrrw. Give prob of picking 1 p and 1 w. 2/45 Four letters picked without replacement from vhgvgvavgvvggxg. Give prob of picking 4 v. 1/91 Calculate prob of picking 2 j and 2 k when four letters picked without replacement from {z: 4, k: 2, j: 3}. 1/42 Calculate prob of picking 1 c and 1 z when two letters picked without replacement from {z: 2, i: 2, g: 1, v: 1, e: 1, c: 2}. 1/9 Two letters picked without replacement from vvq. Give prob of picking 2 v. 1/3 Four letters picked without replacement from {e: 5, l: 2, x: 7}. What is prob of picking 2 e and 2 l? 10/1001 Two letters picked without replacement from yyyyppyrpyry. What is prob of picking 1 p and 1 y? 7/22 Four letters picked without replacement from {u: 5, a: 2, g: 1, f: 1}. What is prob of picking 4 u? 5/126 Four letters picked without replacement from hhhhhhhhhh. Give prob of picking 4 h. 1 Calculate prob of picking 1 l and 2 y when three letters picked without replacement from iyyillyylll. 2/11 Two letters picked without replacement from fffzaaafxffafafzafa. Give prob of picking 1 z and 1 a. 14/171 What is prob of picking 2 j, 1 s, and 1 o when four letters picked without replacement from {j: 5, a: 3, s: 5, o: 1, m: 4}? 5/306 Two letters picked without replacement from {a: 1, i: 2, t: 2, e: 1, y: 5, f: 2}. What is prob of picking 2 f? 1/78 Calculate prob of picking 1 b, 1 h, and 1 p when three letters picked without replacement from {f: 2, b: 2, h: 5, e: 2, p: 7}. 35/408 What is prob of picking 1 f and 3 z when four letters picked without replacement from ffzgfzgzgzstsnzzstf? 20/969 Three letters picked without replacement from {l: 1, m: 1, c: 2, d: 1}. Give prob of picking 2 c and 1 d. 1/10 Calculate prob of picking 2 m when two letters picked without replacement from {m: 7, x: 7}. 3/13 Two letters picked without replacement from {f: 1, b: 2, l: 1, y: 1, h: 1, q: 1}. Give prob of picking 1 b and 1 h. 2/21 What is prob of picking 1 m, 1 j, and 1 s when three letters picked without replacement from sdfsmdjfjssmjfsdjffj? 5/114 Two letters picked without replacement from mmvmcccvc. What is prob of picking 2 v? 1/36 What is prob of picking 3 l when three letters picked without replacement from {l: 3, j: 1}? 1/4 Four letters picked without replacement from {m: 6, f: 4, h: 4}. What is prob of picking 1 m, 2 f, and 1 h? 144/1001 What is prob of picking 1 j and 1 m when two letters picked without replacement from {m: 1, j: 3}? 1/2 Four letters picked without replacement from {i: 1, f: 5, l: 3}. What is prob of picking 1 i, 1 f, and 2 l? 5/42 What is prob of picking 3 v and 1 j when four letters picked without replacement from {j: 6, v: 4, h: 1}? 4/55 Two letters picked without replacement from {c: 1, i: 1, y: 1, d: 1, s: 1}. What is prob of picking 1 d and 1 s? 1/10 Two letters picked without replacement from ryryyryyyrrrrrrrrrr. What is prob of picking 2 r? 26/57 Calculate prob of picking 1 m and 1 f when two letters picked without replacement from {b: 2, r: 1, x: 2, i: 6, m: 3, f: 6}. 9/95 What is prob of picking 2 g, 1 h, and 1 z when four letters picked without replacement from gzzghzg? 9/35 Three letters picked without replacement from {s: 1, w: 2, t: 3, h: 3, c: 1}. What is prob of picking 1 c, 1 t, and 1 h? 3/40 What is prob of picking 1 r, 1 a, and 1 j when three letters picked without replacement from jajqrjjjjqr? 4/55 What is prob of picking 1 a and 2 x when three letters picked without replacement from axxj? 1/4 What is prob of picking 2 o and 1 m when three letters picked without replacement from omkmoqm? 3/35 Three letters picked without replacement from {k: 1, f: 5, w: 2, c: 5, h: 5}. Give prob of picking 3 h. 5/408 Four letters picked without replacement from qyqyiqixq. Give prob of picking 1 i and 3 q. 4/63 Calculate prob of picking 1 k and 1 g when two letters picked without replacement from jxgojxk. 1/21 Two letters picked without replacement from pyyfjkjpkplppjypk. What is prob of picking 1 k and 1 p? 9/68 Three letters picked without replacement from shkhhhsssshkhhllhhsh. Give prob of picking 1 k, 1 l, and 1 s. 2/95 Four letters picked without replacement from eeqeqeeeeqqeee. What is prob of picking 1 e and 3 q? 40/1001 What is prob of picking 1 a and 1 o when two letters picked without replacement from oalrlllrjolxoxo? 4/105 Calculate prob of picking 1 j and 3 m when four letters picked without replacement from {m: 11, j: 1}. 1/3 Two letters picked without replacement from {w: 13, h: 5}. Give prob of picking 2 h. 10/153 Calculate prob of picking 1 k and 1 z when two letters picked without replacement from {o: 1, d: 4, z: 2, k: 3}. 2/15 Calculate prob of picking 1 g and 2 j when three letters picked without replacement from {g: 2, j: 3}. 3/5 Calculate prob of picking 1 y, 1 l, and 1 z when three letters picked without replacement from yyzylllylfo. 16/165 Three letters picked without replacement from {e: 4}. What is prob of picking 3 e? 1 Three letters picked without replacement from {n: 4, c: 2, v: 3}. What is prob of picking 2 c and 1 n? 1/21 Calculate prob of picking 2 m when two letters picked without replacement from mmmzzmmxmmmmxm. 45/91 What is prob of picking 1 r and 2 k when three letters picked without replacement from {w: 3, k: 5, r: 4, n: 1}? 20/143 Three letters picked without replacement from {p: 2, k: 4, c: 1, w: 1, s: 2}. Give prob of picking 2 k and 1 c. 1/20 Calculate prob of picking 1 v, 1 c, and 1 i when three letters picked without replacement from {v: 2, i: 3, n: 1, c: 3, l: 1}. 3/20 Calculate prob of picking 1 l and 1 v when two letters picked without replacement from lllvvfvl. 3/7 Two letters picked without replacement from mccmmmmmcmccm. What is prob of picking 2 c? 5/39 What is prob of picking 2 l and 2 s when four letters picked without replacement from slssssslsss? 6/55 What is prob of picking 1 j and 2 x when three letters picked without replacement from xxxjxjjjxxx? 28/55 Two letters picked without replacement from {z: 1, t: 1, w: 2, s: 1}. Give prob of picking 1 t and 1 w. 1/5 Calculate prob of picking 2 x and 2 i when four letters picked without replacement from ixikkkiaxxkxxaikkik. 25/969 Calculate prob of picking 2 a when two letters picked without replacement from {w: 6, f: 4, a: 7}. 21/136 What is prob of picking 1 j and 1 v when two letters picked without replacement from {j: 2, v: 6}? 3/7 Four letters picked without replacement from nnanayennnaan. Give prob of picking 1 y and 3 a. 4/715 Three letters picked without replacement from {z: 1, o: 9, r: 4}. Give prob of picking 3 o. 3/13 Calculate prob of picking 1 g, 1 o, and 1 s when three letters picked without replacement from mosagmu. 1/35 What is prob of picking 2 l and 2 z when four letters picked without replacement	{ "pile_set_name": "DM Mathematics" }
(-10). What is the smallest value in -0.5, 5, 3, c? c Suppose -4z = -4l - 24, -3z + 20 = -0z - 5l. Let y = 72.971 + -73. Let b = y - -1.229. What is the smallest value in 0.1, z, b? 0.1 Let a = 370/21 + -52/3. Let f = -2.3 + 1.6. Let n = f - -0.4. What is the second smallest value in -0.4, a, n? n Let m = -36513308378/1407 - -25951180. Let a = m - 2/469. Let h = -93 - -89. What is the biggest value in a, h, 2/21? a Let d = 1.33 - 1.43. Which is the second biggest value? (a) 0.04 (b) 2 (c) d a Let a = 9.7 + -9.6. Let v = 0.6 - a. Let s be 3/112/(-3). What is the third biggest value in 3, s, v? s Let h = -37 + 16. Let s be (12/9)/((-98)/h). What is the second smallest value in 0.5, s, -2/11? s Let m = -19.047 + 0.147. Let v = m + 19. What is the smallest value in 2, -5, v? -5 Let j be (-105)/336((-16)/10)/4. Which is the biggest value? (a) 1/2 (b) -5 (c) j a Let z = -63 + 60. Let g be 22(-3)/(-30) + 2/(-1). Let q = 0.44 - -0.06. What is the biggest value in g, q, z? q Let i = -90 + 179/2. What is the smallest value in i, 3/4, 1? i Let f = 18.5 + -18.6. What is the biggest value in f, -2, -4, 7? 7 Let m = -16.64 - -1.04. Let p = m - -16. Let z be (-2 - 4)(-10)/(-45). Which is the third biggest value? (a) p (b) 0.1 (c) z c Suppose -83r + 145 = -112r. Which is the third biggest value? (a) r (b) -0.3 (c) -0.4 a Let i = 35 + -26.7. Let u = i - 13.3. What is the fourth biggest value in 2/15, u, 5, 0.08? u Let m be 27/(-45) + (-466)/(-10). Let a be m/(-14) - (-8)/28. Let p(r) = r2 + r - 4. Let h be p(a). What is the biggest value in -1/3, 1/2, h? h Let s be 113/(-226)12. What is the third biggest value in 1/6, 1, -2, s? s Let k = -41.1 - -41.13. Which is the fourth biggest value? (a) -2/7 (b) k (c) 0 (d) -5 d Let w = -7220/9 - -802. What is the third biggest value in -1, w, -1/4? -1 Let g = 0.002 - -3.798. Let r = g - 5.8. Which is the biggest value? (a) 0.5 (b) r (c) 4 c Let q = -32 - -30. Let y be (q/(-1))/(-22 + 11). Which is the biggest value? (a) 1 (b) y (c) -0.2 a Let k = -3.3 + 0.3. Let v be (((-4)/(-30))/2)/(378/(-1260)). Which is the biggest value? (a) -2 (b) v (c) k b Let l be (-3 - -4)(-1)/(7/4). What is the third smallest value in 3/19, -7, l? 3/19 Let w = 1031.8 - 1032. Which is the third smallest value? (a) w (b) 14.7 (c) -3 b Let j = -0.33 + 13.83. Let y = j + -13. What is the third biggest value in 0.2, y, -4? -4 Let d = 8.54 - 8.94. What is the fourth biggest value in d, -4/9, 0.05, -3/4? -3/4 Let i = 175/2 - 3667/42. Let l = i - 5/14. What is the third biggest value in l, 2/7, 3/7? l Let y = -1/824 - 405/5768. What is the smallest value in y, -4, -0.3? -4 Let g = 5.4 - 5. Let u = 31 - 44. Let q = u + 25/2. Which is the biggest value? (a) 2 (b) q (c) g a Suppose -2l + 4 = 2. Let z = 37 - 42. Which is the second smallest value? (a) 0.2 (b) -2/5 (c) l (d) z b Let j = 0.05 - 0.35. Let c = -2.02 - -0.02. Let t = 233 + -237. What is the biggest value in c, t, j? j Let k = 70.8 + -70.66. What is the smallest value in -0.3, k, -0.1? -0.3 Let i = 774 + -777. What is the biggest value in i, 5, 1/2? 5 Let d = 446 - 3118/7. Let z be 1/3(-12)/8. What is the second smallest value in z, -2, d? z Let y = 2088 + -2088. Let x = -19.1 - -3.1. What is the third biggest value in y, x, -3? x Let t = -39.9 + 40. Let o be (-1)/5 - 1/(-55). Which is the third biggest value? (a) -2/5 (b) -1 (c) o (d) t a Let m be -4 + (-1 - -1)/(-2). Let x = -17/26 - 16/65. Let w = x + 83/70. What is the second biggest value in w, m, -0.1? -0.1 Let j = 3.5 - -0.5. Let o(n) = -n*3 - 3n*2 + 3n + 3. Let t be o(-3). Let p be 12/t(-1)/6. Which is the third biggest value? (a) p (b) j (c) -4 c Let j = -207 + 67. Let p = 139 + j. Which is the fourth biggest value? (a) -4 (b) 1.2 (c) 5 (d) p a Let n = 31 - 2. Let f = -28.9 + n. Which is the second biggest value? (a) -3 (b) f (c) 1 (d) -1 b Let o = -7 + 7.034. Let z = o + -2.934. Let q = z + 3. Which is the smallest value? (a) q (b) 4 (c) -0.1 c Let j = -6.1 - 1.9. Let y(x) = x2 - 5. Let t(d) = -3d*2 + 14. Let k(h) = -6t(h) - 17y(h). Let v be k(2). What is the third biggest value in v, 0, j? j Let c be -3 + 2 - 4/(-6). Let s = -1483 - -1477. What is the smallest value in c, -1/4, -2, s? s Let d = 29 - 24. Let t = -9 + 8.3. Let w = t + -2.3. What is the biggest value in d, w, -8? d Let h = 3.51 + -0.51. What is the second biggest value in 0.06, h, 1, -2/15? 1 Let j be (-1 - 1)/(1 - 0). Let u = -74.848 - 0.152. Let k = 75.2 + u. Which is the second smallest value? (a) k (b) 2 (c) j a Let k = 0.133 + 0.067. Which is the smallest value? (a) 4 (b) k (c) -2/7 (d) -0.03 c Let b = 5/6 + -1. Suppose -6n + 4 = -2. Let v(h) = -2h + 1. Let m be v(n). What is the smallest value in b, m, 0? m Let d be 48/(-170) + (-12)/102. What is the biggest value in 3/2, -13, d? 3/2 Let j = 762 - 765. What is the third biggest value in j, 0, 13? j Let r = -103 - -103.06. Which is the smallest value? (a) r (b) 3 (c) 5 a Let f = 0.02 + -0.01. Let u = f + 0.05. Let m = -1.94 - u. What is the biggest value in 0.1, 0, m? 0.1 Let v = 8.5 + 6.5. Which is the biggest value? (a) -0.4 (b) v (c) -0.2 b Let l = -458 + 459. Which is the fourth biggest value? (a) 0.1 (b) -11 (c) l (d) -2/5 b Let s = -5.1 + 5. Let h = -100/1989 - 1/117. Let i = 19.5 - 20. What is the second biggest value in s, i, h? s Let g = -48.65 + 0.65. Let n = 47.8 + g. Which is the fourth biggest value? (a) 2/5 (b) 1/9 (c) n (d) 1 c Let q = 10 + 16. Let l = -29 + q. Which is the second biggest value? (a) 5 (b) l (c) 4 (d) -4 c Let y = 863/35 + -124/5. Which is the third biggest value? (a) y (b) 0.0496 (c) 1 a Let u(f) = -10f*2 - 66f + 23. Let s be u(-7). What is the fourth biggest value in -3, 0, s, 9? s Let q = -19/12 + 9/4. Let x = 9 + -7. Let k be (-4)/(-1) + 26/(-6). What is the biggest value in k, x, q? x Let r = -12880.2 + 12880. Let u be 1/(1 - 1/(-3)). Which is the fourth smallest value? (a) r (b) -1/9 (c) u (d) 0.3 c Let h = 1.09 + -1.09. What is the biggest value in 1/5, h, -9? 1/5 Let m = -48 - -16. Let i = -37 - m. Let x = 0.3 - 0.1. Which is the third smallest value? (a) -2 (b) x (c) i b Let d be (-80)/(-12) - (-2 + 56/7). What is the second biggest value in -5, 3, 0.3, d? d Let g = 296 - 291. Which is the smallest value? (a) 0 (b) -2/39 (c) g (d) -0.2 d Let y be ((-14)/(-8) + -1)/(1740/(-928)). Suppose -25 = a + 5u, 5a + 3u = -2u - 25. What is the third biggest value in 1, a, y? y Let x be (-3)/2(13 - 27 - -15). Which is the fourth smallest value? (a) 0.42 (b) 1 (c) 2/5 (d) x b Let j = 744 + -735. What is the biggest value in -4/5, 1, 5, j? j Let i = -1892.3 - -1893. Which is the third biggest value? (a) 5 (b) -0.5 (c) i b Let k = 14 - 17. Let s = 46 - 42. Which is the second biggest value? (a) -1/10 (b) s (c) k a Let u be 0/(-1) + 2 + 682/(-31). Let v be 388/(-20) - 4/(-10). Let z = u - v. What is the third smallest value in 1/4, -0.3, z? 1/4 Let t = 124 + -128. Let i be (-3)/21-17 - t/(-2). What is the second biggest value in i, 5, -0.5, -2/9? i Let y = 4/147 + 15/49. Let g = -6 + 0. Let f = g - -6.04. What is the third biggest value in f, y, -3? -3 Let k = 5.8 - 5.5. Let u = 551/6 + -92. What is the smallest value in -5, u, k? -5 Let a = -5.6 + 6. Let l = 734/9 - 1459/18. What is the second biggest value in l, 11, a? l Let p = -0.075 - 0.125. Let i = -1/72 - -11/24. What is the biggest value in i, -9, p, 3? 3 Let w = 403 + -396. Which is the fourth biggest value? (a) w (b) -4 (c) 1 (d) -11 d Let j = -143/2 - -71. Let c = -14 + 24. What is the second smallest value in 2/17, j, c? 2/17 Let v be (16/(-40))/(7 + -6). What is the third smallest value in 134, v, -0.3? 134 Let x = -1888 - -47198/25. What is the fourth biggest value in -0.2, -3, -2/5, x? -3 Let j = 38 + -79. Let l = 40 + j. Which is the biggest value? (a) -3/2 (b) 0 (c) l b Let s = -2.1 - -2.045. Let z = s - -0.155. What is the third smallest value in 2, 5, z? 5 Let y = -22 + 17. Let r = -0.2 - 0. Let f = -12.27 + 12.47. What is the smallest value in r, y, f? y Let i = 83.05 + -83. Let v = i + 0.45. What is the third biggest value in 2/19, v, 5? 2/19 Let v be (2/10)/((-2)/10*2).	{ "pile_set_name": "DM Mathematics" }
p(h) + b(h). Let i(u) = 3u2. Determine i(y(n)). 12n*4 Let o(r) = 30r2. Let u(g) = g2 - 120906g. Determine u(o(h)). 900h*4 - 3627180h*2 Let k(o) = -721o + 3. Let w(h) = -64h + 10. What is k(w(v))? 46144v - 7207 Let j(x) = -5x. Let f(h) = 2507263h. Determine j(f(t)). -12536315t Let o(w) = w2 - 418. Let k(s) = 3407s + s*2 - 3407s. Determine o(k(z)). z*4 - 418 Let c(u) = 1731u*2 - 10u - 30. Let k(s) = -3s. Determine c(k(g)). 15579g*2 + 30g - 30 Let h(g) = -g*2. Let a(q) be the second derivative of -117q - 85/12q4 + 0q*3 + 0 + 0q*2. Calculate h(a(s)). -7225s*4 Let q(a) = -10a - 19a - 62 + 62 - 2a. Let k(m) = m*3 + 7m*2 + 5m + 2. Let o be k(-6). Let i(r) = -33r + 16r + or + 8r. Calculate i(q(v)). 31v Let g(b) = 325b. Let f(k) = -31k. Let y(t) = -52f(t) - 5g(t). Let w = 15 + -3. Let z(n) = -wn - 2n + 19n - n. Give z(y(s)). -52s Let w(i) = -630i2. Let f(r) be the second derivative of r4/6 + 177r + 1. Give f(w(g)). 793800g4 Let u(d) be the first derivative of -d2 + 6420d + 1326. Let j(l) = -2l*2. Determine j(u(s)). -8s*2 + 51360s - 82432800 Let p(k) = -23k + 7. Let l(r) = -r + 34. Let u(y) = y + 17. Let s(n) = l(n) - 2u(n). Give s(p(o)). 69o - 21 Suppose -2b = -5g - 1, -6 = -4b + 6. Let f(l) = 8l - 5. Let m(a) = -a + 1. Let p(h) = gf(h) + 5m(h). Let d(o) = -3o + 31165 - 31165. What is p(d(i))? -9i Let n = 90 - 108. Let a(s) = -11s - 73. Let u be a(n). Let l(d) = 125d - 26d*2 - ud - 55d2. Let i(t) = -2t*2. Give l(i(w)). -324w*4 Let w(q) = 17q*2 - 2q. Let c be 6(-3)/(-18) + 123. Let g(a) = -124 - 2a*2 + c. What is g(w(n))? -578n*4 + 136n*3 - 8n*2 Let z(o) = 6o - 10. Let y(q) = -2q + 3q + 2q - 13q + 4 + 7q. Let g(m) = 5y(m) + 2z(m). Let a(w) = 82w*2. Determine a(g(f)). 738f*2 Let s(k) = -292 + 123 + 2k - k + 49. Let a(g) = -g. Determine s(a(n)). -n - 120 Let o(w) = 5w. Let z(j) = 16642102j*2. Determine z(o(n)). 416052550n*2 Let x(z) = -3z. Let t(a) = 6306a - 760. Let m(d) = -3153d + 434. Let w(c) = -7m(c) - 4t(c). What is w(x(i))? 9459i + 2 Let m(k) be the second derivative of -23k*4/4 - 2k + 167. Let s(v) = 4v2 + 0v2 - v2. Determine s(m(b)). 14283b4 Let w be 42/6 - (-2)/(-2). Let n(z) = -wz*2 + 4z*2 + 0z*2 - 3z2. Let l(b) be the second derivative of -b4/4 - 15b. Determine n(l(c)). -45c*4 Let x(o) = -48o - 44. Let c(h) = -2h - 2. Suppose 3d - 3 = -4f - 1, -d - 8 = -3f. Let k(r) = fx(r) - 44c(r). Let v(q) = 6q - 2q - q. Determine k(v(i)). -24i Let g(p) be the first derivative of -29p*3/3 + 1500. Let d(f) = -25f*2 - 6. Give g(d(v)). -18125v*4 - 8700v*2 - 1044 Let p(w) = w + 4. Let j(c) = -16c + 10 - 9c - 15c + 43c. Let l(i) = 2j(i) - 5p(i). Let v(y) = -10y. Give v(l(s)). -10s Let c(k) be the second derivative of -7 + 1/6k*4 + k + 0k*2 + 0k*3. Let a(z) = 2z - 13. Give a(c(n)). 4n2 - 13 Let l(o) = -3o*2 - 146o. Let p(k) = -3115711 + k + 3115711. Give l(p(u)). -3u2 - 146u Let k(z) = -3z. Let w(g) = 2385096g + 75. What is w(k(s))? -7155288s + 75 Let m(w) = 3w - 12. Let i be m(20). Let r(x) = -97x + ix + 51x. Let c(h) = 9h*2 + 20h*2 + 3h*2. Calculate r(c(f)). 64f*2 Let t(k) = -73k*2. Let d(a) = -3a - 1354. What is d(t(n))? 219n2 - 1354 Let u(v) = -9v - 3. Let k(s) = 37s + 12. Let z(y) = k(y) + 4u(y). Let n(c) = -455c2 + 1. Calculate n(z(m)). -455m*2 + 1 Let l(b) = -4b*2 - 3b. Let t(c) = -2c2 - 2c. Let j(a) = -2l(a) + 3t(a). Let x(v) = 32v2 + v - v - 19v*2 - 2. What is x(j(u))? 52u*4 - 2 Let w(d) = 530824d. Let r(g) = -64g2. Determine w(r(v)). -33972736v*2 Let g(l) = -1285840l. Let m(a) = 496a2. What is m(g(z))? 820078714777600z*2 Let v(n) = 40773n. Let r(t) = 1250t. Give r(v(x)). 50966250x Suppose -1635 = -2s - 449. Let d(x) = -1224x + 565x + sx. Let m(t) = -2t. Calculate d(m(r)). 132r Let x(b) be the third derivative of 3b5/20 + 3b*4/8 + 4b*2 + 12b + 8. Let p(k) = 9k2. Give x(p(g)). 729g*4 + 81g*2 Let j(k) = 924376k*2 - 36. Let h(w) = 2w. Calculate j(h(t)). 3697504t2 - 36 Let s(b) = 2b*2. Let w(h) be the second derivative of -7h - 7 + 0h2 - 29/12h*4 + 0h*3. What is s(w(v))? 1682v*4 Let l be -6 - (-117)/45 - 2/(-5). Let f(x) = 2x - 4. Let z(q) = q - 3. Let w(m) = lf(m) + 4z(m). Let g(k) = 10k. Calculate g(w(s)). -20s Let t(i) be the third derivative of i*6/360 + 97i*3/6 + 152i2. Let v(q) be the first derivative of t(q). Let u(l) = -l. Calculate v(u(m)). m2 Let p(z) = 5z2. Let c(d) = -12058d - 4. Determine c(p(t)). -60290t2 - 4 Let y(r) = -2r2 - r - r2 + 8108149 - 8108149. Let f(g) = -72g. Calculate f(y(p)). 216p*2 + 72p Let z(q) = -18 + q*2 - 8 + 49 - 23. Let j(v) be the first derivative of -269v*3/3 + 2v + 24. What is j(z(f))? -269f4 + 2 Let w(s) = 53s + 8. Let h(j) = -17j - 3. Let y(m) = -8h(m) - 3w(m). Let o(u) = -40u*2. What is y(o(z))? 920z*2 Let f(h) = 7h*2 + h + 6. Let p(j) = 21j*2 + 4j + 20. Let t(b) = -10f(b) + 3p(b). Let g(u) = 12u2. What is g(t(x))? 588x*4 - 336x*3 + 48x*2 Let v(l) = 367l - 3. Let d(y) = -2y2 - 30y - 12. Let p(k) = 5k + 2. Let q(m) = d(m) + 6p(m). What is v(q(b))? -734b2 - 3 Let u(h) = -20h + 105. Let w(t) = 3t - 14. Let r(a) = -4u(a) - 30w(a). Let y(q) = 3 - 1 - 2 + 11q. Give y(r(l)). -110l Let y(x) = -2x*2 + 55x. Let n(v) = 31175v. What is n(y(r))? -62350r*2 + 1714625r Let y(z) be the first derivative of z*5/30 - 4z*2 - z - 60. Let s(b) be the second derivative of y(b). Let n(p) = -41p. Give n(s(v)). -82v2 Let b(o) = 4o*2. Let h(c) be the second derivative of 69c3/2 + c2/2 - 10856c. Give h(b(d)). 828d*2 + 1 Let m(w) = -12w*2. Let f(l) = 16519310l*2. What is f(m(g))? 2378780640g*4 Let j = 4 - -26. Let d be 48/j - (-2)/5. Let m(t) = -2t*2 - 5t*2 + 7t*2 + dt2. Let l(f) = f2 + 4f. What is m(l(v))? 2v*4 + 16v*3 + 32v*2 Suppose 0 = 12r + 42 - 66. Let l(k) be the second derivative of 0kr - 1/3k*3 + 15k + 0. Let m(d) = -3d. Determine m(l(u)). 6u Let x(c) = 89c. Let m(w) be the third derivative of 8w*2 + 0w*3 + 0 + 2w + 1/8w4. Determine x(m(y)). 267y Let f be 33/6 + -83 + 89. Let t(w) be the second derivative of -fw3 - 20w + 0w2 + 0. Let n(g) = -g2. Determine t(n(a)). 69a*2 Let q = -17412 + 17435. Let c(j) be the third derivative of 1/3j*4 + 0 + 0j + 0j3 - qj*2. Let n(g) = 7g. Give n(c(l)). 56l Let p(w) = 0w*2 - 8w*2 - 3w*2 + 12w*2. Let n(r) = -12r*2. Let b(c) = 2n(c) + 20p(c). Let t(v) be the second derivative of v3/2 + v. Give t(b(s)). -12s*2 Let h(l) = -4l. Let r(v) = -4v - 6. Suppose 5f + 4t = 5 - 15, f - 3t + 2 = 0. Let x be r(f). Let c(y) = -1145 + 1145 + xy2. Give c(h(b)). 32b*2 Let g(i) = 581524i*2 - 67i - 2. Let d(b) = -b. Give g(d(q)). 581524q2 + 67q - 2 Let u(d) = 3d2 + 3565537d. Let v(x) = -6x2. What is u(v(s))? 108s*4 - 21393222s*2 Let u(s) = 2s*2. Let i(o) = -7549826o*2. Give i(u(g)). -30199304g*4 Let i(a) = 31a - 34. Let f(h) = 11h - 12. Let s(g) = -17f(g) + 6i(g). Let o(q) = 963q*2. Determine o(s(z)). 963z*2 Let q(p) = 3p2 - 2. Let y(j) be the first derivative of -j2 + 471. What is q(y(m))? 12m2 - 2 Let i(h) = 49h - 8h - 21h - 22h. Let l(k) = -k + 117. Determine l(i(p)). 2p + 117 Let b(r) = -64r. Let v(g) = -5g*2 + 3g - 9. Let z(d) = 11d2 - 7d + 21. Let f(j) = -14v(j) - 6z(j). What is f(b(w))? 16384w2 Let h(n) be the third derivative of -97n5/30 - n4/12 + 3n2 - 77n. Let m(b) = 6b. Give m(h(q)). -1164q*2 - 12q Let l(j) = -j. Let n(o) = -88o2 + 4o + 12. Let i(s) = 86s2 - 3s - 13. Let w(c) = -4i(c) - 3n(c). Calculate w(l(k)). -80k2 + 16 Let l(a) = 115a*2 - 2a - 4. Let x(q) = -1232q + 1. Give x(l(m)). -141680m*2 + 2464m + 4929 Let i(j) = -272384j2. Let o(r) = 84r. Calculate o(i(p)). -22880256p2 Let k(c) = -4c*2 - 64. Let z(o) = -2o + 3252. Give z(k(p)). 8p2 + 3380 Let q(t) = -45t*2 - 34t - 17. Let y(i) = -16i2 - 12i - 6. Let x(h) = -6q(h) + 17y(h). Let l(d) = -260d - 1. Give x(l(k)). -135200k*2 - 1040k - 2 Let q(p) be	{ "pile_set_name": "DM Mathematics" }
hat is the z'th term of -75901, -75902, -75903, -75904? -z - 75900 What is the t'th term of -1362, -5600, -12664, -22554, -35270, -50812, -69180? -1413t2 + t + 50 What is the b'th term of -5171, -10337, -15503, -20669? -5166b - 5 What is the t'th term of -385, -567, -749? -182t - 203 What is the u'th term of -113, 115, 495, 1027? 76u*2 - 189 What is the a'th term of -645, -564, -483, -402, -321, -240? 81a - 726 What is the v'th term of -960, -3840, -8642, -15366? -961v2 + 3v - 2 What is the h'th term of -1999, -7955, -17897, -31837, -49787, -71759, -97765? -2h3 - 1981h*2 + h - 17 What is the p'th term of -74078, -148152, -222226? -74074p - 4 What is the r'th term of 2347, 4694, 7041, 9388, 11735, 14082? 2347r What is the r'th term of 400, 1152, 2408, 4168, 6432, 9200, 12472? 252r*2 - 4r + 152 What is the o'th term of -4221, -4377, -4533, -4689, -4845, -5001? -156o - 4065 What is the a'th term of -228, -845, -1872, -3309, -5156, -7413? -205a*2 - 2a - 21 What is the n'th term of -146, -400, -758, -1166, -1570, -1916, -2150? 9n3 - 106n*2 + n - 50 What is the n'th term of 693, 3329, 10479, 24399, 47345, 81573? 376n3 + n2 + n + 315 What is the u'th term of -29586, -29556, -29526, -29496? 30u - 29616 What is the m'th term of -557, -751, -951, -1157, -1369, -1587? -3m*2 - 185m - 369 What is the b'th term of -3076, -6162, -9254, -12352? -3b2 - 3077b + 4 What is the k'th term of -18056, -18061, -18066, -18071, -18076, -18081? -5k - 18051 What is the w'th term of -40551, -162222, -365015, -648936, -1013991, -1460186, -1987527, -2596020? -w3 - 40555w2 + w + 4 What is the d'th term of 72, 223, 444, 729, 1072? -d3 + 41d2 + 35d - 3 What is the l'th term of -37621, -37622, -37623, -37624, -37625? -l - 37620 What is the l'th term of 865, 3385, 7589, 13477, 21049, 30305, 41245? 842l2 - 6l + 29 What is the g'th term of -1920, -3839, -5758, -7677? -1919g - 1 What is the d'th term of -203, -162, -135, -128, -147, -198, -287? -d3 - d2 + 51d - 252 What is the q'th term of 628, 715, 876, 1123, 1468, 1923? 2q3 + 25q*2 - 2q + 603 What is the f'th term of 309, 1566, 3769, 6918, 11013, 16054, 22041? 473f2 - 162f - 2 What is the i'th term of -229, -379, -791, -1597, -2929, -4919, -7699, -11401? -22i3 + i2 + i - 209 What is the j'th term of -42843, -42842, -42841, -42840? j - 42844 What is the g'th term of 75, 233, 487, 837, 1283, 1825, 2463? 48g*2 + 14g + 13 What is the h'th term of 1, -45, -151, -317, -543, -829, -1175? -30h2 + 44h - 13 What is the t'th term of 31, 705, 1823, 3385, 5391, 7841? 222t2 + 8t - 199 What is the v'th term of -127511, -127508, -127507, -127508, -127511, -127516? -v*2 + 6v - 127516 What is the z'th term of -2146196, -2146195, -2146194, -2146193? z - 2146197 What is the i'th term of 68175, 68175, 68177, 68181, 68187, 68195, 68205? i*2 - 3i + 68177 What is the s'th term of 18826, 37622, 56388, 75130, 93854, 112566, 131272, 149978? s*3 - 21s*2 + 18852s - 6 What is the q'th term of 46091, 46089, 46073, 46037, 45975, 45881? -q3 - q2 + 8q + 46085 What is the n'th term of 81, 295, 657, 1167, 1825, 2631? 74n*2 - 8n + 15 What is the l'th term of -949, -939, -907, -841, -729, -559, -319? 2l3 - l2 - l - 949 What is the g'th term of -5439, -5487, -5535, -5583? -48g - 5391 What is the m'th term of 254, 341, 486, 689, 950, 1269, 1646? 29m2 + 225 What is the n'th term of 2083, 4168, 6249, 8326, 10399, 12468, 14533? -2n*2 + 2091n - 6 What is the i'th term of 14140, 28281, 42422, 56563, 70704, 84845? 14141i - 1 What is the d'th term of 6, -332, -1262, -3078, -6074, -10544, -16782, -25082? -49d*3 - 2d*2 + 11d + 46 What is the p'th term of -156389, -156390, -156391, -156392, -156393? -p - 156388 What is the l'th term of 792, 614, 332, -48, -520? l*3 - 58l*2 - 11l + 860 What is the j'th term of -1003, -1957, -2869, -3739, -4567? 21j2 - 1017j - 7 What is the z'th term of -471, -1015, -1547, -2061, -2551, -3011, -3435, -3817? z*3 - 551z + 79 What is the q'th term of 879, 973, 1127, 1341, 1615? 30q2 + 4q + 845 What is the h'th term of -6347, -6364, -6385, -6404, -6415, -6412, -6389? h*3 - 8h2 - 6340 What is the s'th term of 698521, 1397037, 2095551, 2794063, 3492573, 4191081? -s2 + 698519s + 3 What is the d'th term of -147, -203, -305, -453, -647, -887? -23d*2 + 13d - 137 What is the d'th term of -29, -108, -243, -446, -729? -2d3 - 16d*2 - 17d + 6 What is the y'th term of 57, 95, 129, 159, 185, 207, 225? -2y2 + 44y + 15 What is the n'th term of -16350, -16347, -16344, -16341? 3n - 16353 What is the u'th term of -339232, -339231, -339230? u - 339233 What is the n'th term of 13465, 13464, 13463, 13462, 13461? -n + 13466 What is the y'th term of -6366, -6395, -6444, -6513, -6602, -6711, -6840? -10y*2 + y - 6357 What is the f'th term of 457438, 914878, 1372318, 1829758, 2287198, 2744638? 457440f - 2 What is the m'th term of -14247, -14241, -14235? 6m - 14253 What is the y'th term of -61, -178, -293, -406, -517, -626, -733? y2 - 120y + 58 What is the a'th term of 2583, 2580, 2579, 2580, 2583? a*2 - 6a + 2588 What is the j'th term of 231, 344, 533, 798, 1139? 38j2 - j + 194 What is the d'th term of 1028, 1676, 2324, 2972, 3620? 648d + 380 What is the a'th term of -12693, -50780, -114265, -203148, -317429, -457108? -12699a2 + 10a - 4 What is the a'th term of -1688, -6584, -14720, -26096, -40712, -58568? -1620a2 - 36a - 32 What is the w'th term of 4945, 4921, 4897, 4873, 4849, 4825? -24w + 4969 What is the j'th term of -237, -306, -381, -462? -3j*2 - 60j - 174 What is the v'th term of 268, 841, 1798, 3139, 4864, 6973? 192v2 - 3v + 79 What is the m'th term of -760, -812, -878, -964, -1076, -1220, -1402? -m3 - m2 - 42m - 716 What is the m'th term of 1939, 3784, 5629, 7474, 9319? 1845m + 94 What is the c'th term of -150, -45, 60? 105c - 255 What is the b'th term of 613079, 613066, 613045, 613016, 612979? -4b2 - b + 613084 What is the i'th term of -28, -19, -22, -43, -88, -163? -i3 + 16i - 43 What is the r'th term of -25076, -25102, -25136, -25184, -25252, -25346, -25472, -25636? -r3 + 2r*2 - 25r - 25052 What is the o'th term of 1230, 1169, 1044, 837, 530? -3o3 - 14o*2 + 2o + 1245 What is the l'th term of -495, -669, -843, -1017? -174l - 321 What is the j'th term of 1838, 1686, 1536, 1388, 1242, 1098, 956? j2 - 155j + 1992 What is the u'th term of 75, -2059, -7843, -19101, -37657, -65335, -103959, -155353? -304u3 - u2 - 3u + 383 What is the t'th term of -13998, -27990, -41982? -13992t - 6 What is the i'th term of 14, 112, 362, 842, 1630, 2804, 4442? 13i*3 - 2i*2 + 13i - 10 What is the g'th term of 6564, 6559, 6564, 6591, 6652, 6759, 6924? 2g3 - 7g*2 + 2g + 6567 What is the m'th term of -270, -306, -252, -60, 318, 930, 1824, 3048? 8m3 - 3m*2 - 83m - 192 What is the j'th term of 655, 882, 1109, 1336, 1563? 227j + 428 What is the c'th term of 241, 370, 585, 886? 43c2 + 198 What is the u'th term of 34132, 68262, 102390, 136516, 170640? -u2 + 34133u What is the b'th term of -2149, -2139, -2129, -2119, -2109, -2099? 10b - 2159 What is the r'th term of 2206, 2183, 2148, 2107, 2066, 2031? r*3 - 12r*2 + 6r + 2211 What is the b'th term of 18139, 36251, 54363, 72475? 18112b + 27 What is the n'th term of -1397869, -1397868, -1397867, -1397866? n - 1397870 What is the c'th term of 4710, 37504, 126508, 299826, 585562, 1011820, 1606704, 2398318? 4684c3 + c2 + 3c + 22 What is the r'th term of 5310, 10604, 15894, 21186, 26486? r3 - 8r*2 + 5311r + 6 What is the f'th term of 29930, 29924, 29914, 29900? -2f2 + 29932 What is the s'th term of 482, 478, 478, 488, 514? s3 - 4s2 + s + 484 What is the j'th term of 16683, 16699, 16703, 16689, 16651, 16583? -j3 + 23j + 16661 What is the c'th term of 179, 671, 1479, 2603, 4043, 5799? 158c*2 + 18c + 3 What is the o'th term of 3018, 24150, 81494, 193152, 377226? 3017o3 + 4o2 + o - 4 What is the j'th term of -21, 370, 747, 1104, 1435, 1734? -j3 - j*2 + 401j - 420 What is the p'th term of -4962219, -4962193, -4962153, -4962093, -4962007, -4961889, -4961733, -4961533? p**3	{ "pile_set_name": "DM Mathematics" }
e y(2). Suppose r - x = zr. What is r rounded to the nearest 1000? -9000 Let w = -35.4 + 32. Let c = w + -0.4. What is c rounded to the nearest integer? -4 Let v = -0.52 + 1.19. Let u = -0.733 + v. Let b = -0.0552 - u. What is b rounded to 3 dps? 0.008 Let j = -3.1226 - 2.8759. Let y = j + 0.1285. Let q = 0.47 + y. What is q rounded to the nearest integer? -5 Let v(i) = 2798i - 6. Let d be v(-3). What is d rounded to the nearest one thousand? -8000 Let i = -36.31 - -36. Let k = 94.22939 - 94.54. Let y = i - k. Round y to four decimal places. 0.0006 Let g = 11294.64 - 11305.64018. Let d = 11 + g. Round d to four decimal places. -0.0002 Let j = -3.2 + -15.8. Let h = j + 5. Let w = 13.58 + h. What is w rounded to 1 dp? -0.4 Suppose 9q + 4o + 2 = 4q, -2o - 8 = -q. Let m be -800(-1750)/(2/q). What is m rounded to the nearest one million? 1000000 Let q = -118 - -116.69. Let c = -1.9 - q. Let h = 0.01 - c. What is h rounded to the nearest integer? 1 Let n = -10.6725 + -6.32805. Let j = 43 + -60. Let z = n - j. Round z to four dps. -0.0006 Let u = 6945.110112 - 6945. Let k = u + -0.11. Round k to five decimal places. 0.00011 Let c be -8400(-20)/(2 + -4). Round c to the nearest 10000. -80000 Let u = 19.12597876 + -19.889814. Let j = u - -0.803835. Let z = -0.04 + j. Round z to seven dps. -0.0000002 Let k = -49.99999964 + 50. What is k rounded to seven dps? 0.0000004 Let o(d) be the third derivative of -d*4/24 + 3d3/2 - d2. Let q be o(7). Let l be q + (30 - (2 + -4)). Round l to the nearest 10. 30 Suppose -3z + 48 = -117. Suppose -7d + 2d - z = 0. Let i = 47 + d. What is i rounded to the nearest 10? 40 Let g = 1.1 - 0.87. Let o = 1159.7612 + -1160. Let w = o + g. Round w to three dps. -0.009 Suppose 3c - 10c + 112 = 0. Round c to the nearest ten. 20 Let a = 3.8 - 3. Let j = a + -0.87. Let m = -0.07028 - j. Round m to four dps. -0.0003 Let i = -0.64 - -0.586. What is i rounded to 2 dps? -0.05 Let c = -34218 - -33730.06. Let v = c + 495. Let n = v - 8. Round n to one dp. -0.9 Let l(c) = -23c + 12. Let b be l(11). Round b to the nearest 10. -240 Suppose 358 = -4y - 150. Let u = -78 - y. What is u rounded to the nearest 10? 50 Let s = 2351617 + -2351577.00068. Let i = s - 40. Round i to 4 decimal places. -0.0007 Suppose -61o = -60o + 410000. Round o to the nearest one hundred thousand. -400000 Let z = -71 + 43. Let m = -27.917 - z. Round m to 2 decimal places. 0.08 Let z = -374916.93 - -374919.8300031. Let u = -4.5 + 1.6. Let h = u + z. Round h to six dps. 0.000003 Suppose 3 = -b, 3l = 7l - b + 103997. Round l to the nearest 100000. 0 Let p = 20.2999585 + -20.3. Round p to 5 dps. -0.00004 Let o = 43 - 10. Suppose 0 = -2s + o + 159. Round s to the nearest ten. 100 Suppose 4s - c - 16 = 0, 0 = -s - 4c + c + 4. Suppose 5j - j + 2280000 = 4n, -sn + j + 2280000 = 0. What is n rounded to the nearest 100000? 600000 Let v = -43.345067 + 24.444924. Let n = v - -18.9. What is n rounded to 5 decimal places? -0.00014 Let o = -218308.15 + 213497. Let j = -4842.14963 - o. Let r = j - -31. Round r to 4 decimal places. 0.0004 Let s = 3.07 - 3. Let w = -1.3 + 1.4. Let o = w - s. Round o to 1 dp. 0 Let o = 0.024 - 0.024057. What is o rounded to 5 dps? -0.00006 Let z = -43.999974 - -44. Round z to 6 dps. 0.000026 Let u = 236 + -236.0119. What is u rounded to three dps? -0.012 Let j = 39.57 + -40. Let v = j - -0.381. What is v rounded to two dps? -0.05 Suppose -3z - 27299985 = 5h, 4h = 3h + 3. Round z to the nearest one million. -9000000 Let c = -3.5 - -1.5. Let a = c + 2.000072. What is a rounded to five decimal places? 0.00007 Let w = -1.34 - -1.2. Let y = -205 + 204.8548. Let o = w - y. What is o rounded to three dps? 0.005 Let a = 4683794 - 183794. What is a rounded to the nearest 1000000? 5000000 Let f = -17 + 16.91. Let n = -5.91 + f. Let z = n + 5.99999968. Round z to seven dps. -0.0000003 Let t = 1 + 0. Let l be ((-4)/10)/(t/5). Let c be 561 - (-1 + l/(-1)). What is c rounded to the nearest one hundred? 600 Let f be -3 + 3 + -4 + 127. Suppose 2c - 77 = f. Round c to the nearest 100. 100 Let g = -102 - -102.00775. What is g rounded to 3 dps? 0.008 Let k(v) = v*2 + 995. Let c be k(0). Suppose 0 = 5m + 355 + c. Round m to the nearest 100. -300 Let l = 249.87 - 251. Round l to one dp. -1.1 Let n = -34.6 + 210.6. Let l = -179.075 + n. Let b = -3 - l. What is b rounded to two dps? 0.08 Let r(t) = -7t + 0t*2 - 5t*2 + 4t*2 - 6. Let o be r(-5). Suppose i - oi = 1500000. What is i rounded to the nearest 1000000? -1000000 Let u(l) be the second derivative of 97l3/6 - l2/2 + 4l. Let s be u(1). Let p be ((-16250)/3)/(4/s). Round p to the nearest 100000. -100000 Let q = -30.567269 - -18.5672775. Let z = q - -12. Round z to six decimal places. 0.000009 Let l = 5.36 + -6. Let v = -0.7 - l. Let f = 0.27 - v. What is f rounded to one decimal place? 0.3 Let q = 47 + -34. Let h be 3252/q - 8/52. What is h rounded to the nearest one hundred? 300 Let x(t) = 4t2 - 2t - 5. Let p be x(-7). Suppose 11j = 6j - p. What is j rounded to the nearest 10? -40 Let o(c) = c*2 + 12c + 15. Let h be o(-11). Suppose -68 = hx + 292. What is x rounded to the nearest 100? -100 Let u = 171 - 62. Let w = 68 - u. Let h = w + 40.9942. Round h to 3 dps. -0.006 Let b = -0.075 + 6.175. What is b rounded to 0 decimal places? 6 Let a = 28.28 + -1418.28. Let s = a - -1388.9194. Let r = -1.07 - s. What is r rounded to three decimal places? 0.011 Let v = -1.567 + 1.04. Round v to 1 dp. -0.5 Let p = -0.223 - -0.21268. Let x = p - -0.01. Let s = x - 0. What is s rounded to four dps? -0.0003 Let h(q) = 1282q*2 + 5q - 8. Let a be h(-8). What is a rounded to the nearest ten thousand? 80000 Let s = -49.8 + 49.800201. Round s to 5 dps. 0.0002 Suppose v = 4b + 180135 - 15620135, -4v - 11580000 = -3b. Round b to the nearest one million. 4000000 Let k = 9 + -9. Let v = -0.00118 - k. Round v to 4 decimal places. -0.0012 Suppose -3v - 71051 = -5o, 5v - 3o + 118413 = -0v. Let u = -2682 - v. Round u to the nearest ten thousand. 20000 Suppose -2s = -i + 26800004, 2s - 5i + 67000020 = -3s. Round s to the nearest one million. -13000000 Let t = -6481.498442411 - 3.101553589. Let q = 6484.4 + t. Let k = q + 0.2. What is k rounded to five decimal places? 0 Let l = 143.34 + -141. Let z = l - 96.34. Let f = 94.47 + z. What is f rounded to 1 decimal place? 0.5 Let s = -1.5 + 1.500008. Round s to six dps. 0.000008 Let q = -37.00000135 + 37. Round q to 7 decimal places. -0.0000014 Let t be 16469994/27 + 2/9. Round t to the nearest one hundred thousand. 600000 Let q = -3 - -2.95. Let b = -0.44 + q. What is b rounded to 1 decimal place? -0.5 Let h be 36/9 - 0/1. Suppose 2j - 5s - 16 = 5, -3s + 3 = hj. Let x(i) = 1332i + 4. Let q be x(j). What is q rounded to the nearest ten thousand? 0 Let o = 15 + 186. Let c = -86 + o. Let t = -114.9909 + c. What is t rounded to three dps? 0.009 Let g = 1386.09 - 1380. Let a = -0.09 + g. Let r = a + -5.999934. What is r rounded to 5 dps? 0.00007 Let h = -3.3 - -15.8. Round h to zero decimal places. 13 Let m = -0.7 - -37.7. Let q = m - 22. Let h = q + -14.999973. What is h rounded to five decimal places? 0.00003 Let u = 0.021 + -0.021147. Round u to five dps. -0.00015 Let n = 2857693 - 2857679.00007. Let k = n + -14. What is k rounded to 5 decimal places? -0.00007 Let l = -6 - -6. Let p be l + 0 - -24661099 - 0. Let g = p + -12561099. Round g to the nearest 1000000. 12000000 Let r = -9960 + 9959.50088. Let k = 3 - 2.5. Let h = k + r. What is h rounded to 4 decimal places? 0.0009 Suppose -u - 12 = -4r, -2r = 4u - 3r + 18. Let a = 8 + u. Let b(h) = 9h - 4. Let s be b(a). What is s rounded to the nearest 10? 30 Let x = -13.2 - 2.8. Let c = -192 - -201.3. Let s = x + c. Round s to the nearest integer. -7 Let l = -9717.353996 + 98.39205. Let v = 9619 + l. Let o = v + -0.038. What is o rounded to five dps? 0.00005 Let k = 53.9893 - 54. What is k rounded to three decimal places? -0.011 Suppose -x = -4s + 3x, 5x = 3s - 6. Let f be s/(-6) - 720001/2. What is f rounded to the nearest 100000? -400000 Suppose 5m - m - 62516 = -2v, -3v + 93762 = 3m. Let s be (4-31 - 4)v. Round s to the nearest 1000000. -4000000 Let g = 13 + -14.	{ "pile_set_name": "DM Mathematics" }
f - f + (-3f - 2f + 3f)(2 - 4 + 3))(1 + 1 - 1 + (3 - 5 + 1)(1 + 1 - 4) + 2 - 6 + 3 - 8 + 14 + 3)(3 - 4 + 0). -33f Expand (-l + 0 + 0)(1 - 1 - l3) + l4 - 7l4 - l4 + (-1 + 1 + 2l)(-3l3 - l3 + 6l3) + 5l*4 - 42l + 42l. 3l*4 Expand (165 - 19m - 165)(0m - 2m - m). 57m*2 Expand (4 - 2 - 4)(-6642m3 + 6642m*3 + 178m*5). -356m*5 Expand (-2s + 5 + 10 - 22)((0s + 2s + 0s)(2s*3 + 3s*3 - 3s3) + s - s4 - s + 2s4 + 1 - 1). -10s*5 - 35s*4 Expand (-346h + 173h + 15 + 172h)(0h*2 + 0h*2 + 2h*2). -2h*3 + 30h*2 Expand (2 - 2 - 2z)(3370z - 1687z - 1681z + 500)(1 + 1 - 1). -4z*2 - 1000z Expand (-18f3 + 26f*3 + 40f*3)(2 + 4 - 3) + (-2f2 + 2f2 + f2)(5f - 6f - 5f). 138f3 Expand (-5 - u + 5)(u*2 - 4 + 4) + 18 + 3u*3 - 18 + 5 - 10u*3 - 5. -8u*3 Expand (-154l*2 - 90l*2 + 26l*2)(-2l + 4 - 4)(4 + 1 - 7). -872l3 Expand (-2y - 2y + 5y)(4 + 0 - 3)(-2y - 5y + 2y)(-6 - 12 + 10)(-13 + 13 - 6y). -240y3 Expand -2m + 2m - 2m*5 - 9m*5 - 9m*2 + 9m*2 + (-2m2 + m3 + 2m2)(-3m + 2m*2 + 3m) + 0m4 + 0m4 + m5 + 36m4 - 36m*4 - 9m*5. -17m*5 Expand 2x*4 - 2x4 + x3 + 2x4 + (2 - 2 + 42x*2)(4 + 2x2 - 4) + 0x*4 + 2x*4 + 0x*4. 88x4 + x3 Expand (z - 25z - 24z)(1 - 2z - 1)(-3z + 3z - z). -96z*3 Expand -4n + 5n - 3n + (5n + 0n - 3n)(-1 + 32 + 36) - 2n + 4 - 2n + 5n. 133n + 4 Expand (553 - 1775 - 31)((-3z + 3z - z2)(5 + z - 5) + z*3 + 0z3 + z3). -1253z3 Expand (43l + 75l - 34l)(2 - 2 - 2) + (-l + 5l - 3l)(1 + 0 + 1). -166l Expand (-5 + 5 - 17a)(0a - a + 0a)(0a + a + 4 - 7). 17a*3 - 51a*2 Expand (-3o + 4 - 4)(83 - 71 - 68). 168o Expand (-6l2 + 8l*2 + l - 11l)(-2l - l + l) + 4l3 - 5l*3 - 2l*3. -7l*3 + 20l*2 Expand (697202y + 1 - 697214y + 1)(-4y + 0y + 6y). -24y*2 + 4y Expand (-7 + 6 - 11 + 1 + 1 - 3 + (-4 + 1 + 4)(-2 + 0 + 1))(f - 4f - 3f). 84f Expand (21 - 21 + 38)(-4 - 4 + 5)(-t + 4t - 2t). -114t Expand ((0 + m + 0)(4m + 22m - 4m) - m*2 + 4m - 4m - 3m*2 - 5m*2 + 4m*2)(-m*2 + m - m). -17m*4 Expand (4 + 0 + 0)(5 - 8l - 3 + 3l)(-1 + 5l - 3l + 3l). -100l2 + 60l - 8 Expand (-3t - t + 2t)(-t + t - t) + 10t2 + t2 + 11t2. 24t2 Expand (c2 + 0c2 + 0c*2)(-12c2 + 2c*2 + 0c*2) + (-9 + 9 - 5c*3)((c - 2 + 2)(-2 - 1 + 4) - c - c + 3c). -20c4 Expand (-h2 + 6h2 - h2)(-70 - 5h + 0h + 3h). -8h3 - 280h*2 Expand (-164x*3 - 135x*3 + 55x*3)(-2x - 2x + 5x + 1). -244x*4 - 244x*3 Expand (3 - 14 + 8)(-2k - k - 5k). 24k Expand -k + k5 + k + (0k + 11k + 11k)(-4k*3 - 2k*4 + 4k*3) + 2k5 - k5 - 6k5. -48k*5 Expand (-2h*2 + 3 - 3)(241 + 289 - 145) + 2h2 + 2h*2 - 2h*2 + (-h + 0h - h)(0h - h + 3h). -772h*2 Expand (-4x*3 + 3x*3 + 0x*3)(-3 + 5 - 1) + 3x + 1572x*2 - 1574x*2 - 2x*3 + 6 - 25. -3x*3 - 2x*2 + 3x - 19 Expand (4q - q - 2q)(15q*4 + 34 - 34) - 4q*5 + 4q + 16 - 19 - 2q. 11q*5 + 2q - 3 Expand -x3 + x3 + x*5 + (186 + 115 + 151)(4 - 3 - 3)(x5 + 0x5 + x5). -1807x5 Expand (-5c*3 + 0c3 + c3)(-1130 + 1130 + 42c*2). -168c*5 Expand (8c - 13c - 8c + (-2c + 2c - 2c)(-4 + 2 + 0))(474c*3 - 4c*4 - 474c*3 - 4). 36c*5 + 36c Expand (3 + 1 - 5)(-79g*3 - 8g*3 - 25g*3). 112g*3 Expand (l - 4l + 2l)(-l*2 - 2l*2 + 5l*2) + 905l + 2l2 - 907l - 3l3 + 0l*2 - 5. -5l*3 + 2l*2 - 2l - 5 Expand (r*2 - 2r*2 + 2r*2)(-3 + 6 + 4)(3r + 6r - 5r). 28r3 Expand (-37 + 24q*4 + 37)(-6 + 3q + 6). 72q5 Expand -z4 + 4z4 - 2z*4 + (85z*2 - 55z*2 + 16z - 34z2)(-4z2 + 4z*2 - 2z*2). 9z*4 - 32z*3 Expand (-783 + 110 + 11)(-3a + 3a - 2a) + (1 + 1 - 1)(a - 2a - a) - a - a + a - a + 0a - a. 1319a Expand (2p*2 - 5p*2 + 2p*2 + (10p - 3p + p)(2p - 5p + 5p))(-9 + 6p3 + 9). 90p*5 Expand (-4s - 3s + 5s)(4s*3 - 2s3 - s3 - 82 + 21s3 + 82 + (s3 + 2s*3 - 4s*3)(0 + 4 - 5)). -46s4 Expand (-9y + y + 2y - 4 - y + 4 + 3y + 3y - 7y - y + 3 - 3 + (-1 + 4 - 1)(-4y + 2y + 0y) + 0y - 5y + 4y - 1 + 1 - 2y)(2y - 3y - 2y). 48y2 Expand (3 - 1 - 1)(5s - 11s - 2s) + (7s - 2s - 3s)(0 + 1 + 1) + 0s - 4s + 3s. -5s Expand (-t - t + t - 2t - 2t - 2t + (-3t - t - 2t)(-1 - 1 - 1))(-5 + 2 + 1 + (-1 + 0 - 1)(1 - 3 + 3) + 5 - 2 - 2 + 2 + 2 - 2). -11t Expand ((2 - 1 + 0)(-j2 - 2 + 2) - 4j*2 + 0j*2 + 2j2 - j + j2 + j + j2 - j2 - j*2 + 9j*2 + 6j*2 + 6j*2)(4j2 - 4j*2 - 2j*2). -36j*4 Expand (0v*3 + 0v3 + v3)(-v + 8v + 4v)(-6 + 41 - 9). 286v4 Expand (-3 + 1 + 0)(15x + 4x*2 - 15x)(-1 + 4 - 7). 32x2 Expand -3 + y3 - 2y3 + 4 + (47y*2 - 25y*2 + 20y*2)(-y - 4y + 3y). -85y3 + 1 Expand 4v*2 - 5v2 - v2 + (-3v + 2v + 0v)(41v + 69v - 34v). -78v2 Expand (-j3 + 0 + 0)(-1 - 3 - 1) - 462j + 11j3 + 462j. 16j3 Expand (2l*2 - 1 + 1)(-2l3 + 3l*3 - 3l*3) + 314l*5 + 4l*2 - 13l*2 - 2l - 313l5. -3l*5 - 9l*2 - 2l Expand -23q5 + 22q*2 - 4q*5 - 21q*2 + (3q*3 - 2q3 + q3)(-2 + 2 - 2q*2) - 6q*5 + 10q - 10q. -37q5 + q2 Expand (-5m - 3 + 3)(5 + 136 + 35). -880m Expand (2m - 3m + 0m)(-75m - 43m - 109m). 227m2 Expand (-64n*2 + 103n*2 + 90n*2)(0 + 0 + 3n)(-3 + 4 + 1). 774n3 Expand (0m*3 - 7m*3 - 2m*3)(-18m + 7m + 66m). -495m*4 Expand -2m*2 + 4m*2 - 3m*2 + ((1 - 1 + m)(m + 3m - 2m) + 4m2 + m2 - m2)((3 - 1 - 3)(1 - 1 - 2) + 8 - 2 + 0). 47m*2 Expand (22t*3 - 22t*3 - 4t*4)(-2 - 4t + 2) + (t2 + 3t*2 - 6t*2)(-t*3 - 2t*2 + 2t*2). 18t*5 Expand ((-12c + 26c + 47c)(2c + 2c - 3c) - c*2 + 0c + 2c - c2)(-7 - c*2 + 7). -59c*4 - 2c*3 Expand ((1 - 3 + 4)(-2v2 - 2v*2 + 2v*2) - 3v + 3v - v2 + 4v + 4v2 - 4v + 2v2 - 4v*2 + 0v*2)(6 - 1 - 4). -3v2 Expand (39b + 23b - 17b + (3 - 2 - 2)(-4 + 1 + 2)(66 - 9b - 66))(-2b3 + 2b*3 - 2b*3). -72b*4 Expand ((-4x + 5x - 3x)(-4x + 4x + 3x) + x*2 - 2x + 2x)(-9x3 - 7x*3 + 2x*3). 70x*5 Expand (-j - j + j)(-1 - 5 - 27) + (0 + 0 - 1)(-4j + 4j + j) + (-1 + 4 + 1)(-j + 2j + 0j) + 2j + 0j - 4j. 34j Expand 4c2 - 2c*2 + 3c2 + c2 + 2c2 - 4c*2 + ((4c + 0c - 3c)(2c + 0 + 0) + c*2 + 4c*2 + 4c*2)(-3 + 6 - 1). 26c2 Expand (-24 + 24 + 8z*2 + (-5 - 3 + 2)(5z2 - 2z*2 - 2z*2))(2z - 4z + 3z) - 3z*3 + 2z*3 + 3z*3. 4z*3 Expand -2b*5 + 3b*5 - 2b*5 - 2b*5 + 4b*5 + 0b*5 + (2 + 0 - 4)(3b5 + 3b*5 - 2b*5) + 0b*4 + 0b4 - b5. -8b5 Expand (-3w - 2w + 3w)(-11 + 8 - 5)(1 - 4 + 2). -16w Expand (4h*2 - 3h*2 - 3h*2)(-29h - 25h + 10h)(3h + 6h - 4h). 440h*4 Expand (-3p - 3p + 5p)(142 + 76 - 42). -176p Expand (-a*2 - 2a*2 + 2a*2)(147a2 - 247 + 247). -147a*4 Expand (-1 + 2 + 0)(-2w + 1 - 1)(-4w - 6w + 14w)(2w + 9w*2 - 2w + (-2w + w - w)(-2w + 2w - w)). -88w4 Expand -3c*4 + 5c*4 + 13c4 + 1 - 1 + c4 + (-c*3 + 11c*3 + 2c*3)(-2 + 2 - 2c). -8c*4 Expand 2t*2 - 2t*2 - 4t*2 + (-2t + 4t + 0t)(1 - 2t - 1) + (-1 + 1 - 2t)(15t - 478 + 478). -38t2 Expand (i3 - 8i3 + 2i*3)(4 + 9i - 13i + 7i). -15i*4 - 20i*3 Expand (0q + 5q - 3q)(61 + 698 + 13). 1544q Expand (36 - 9l - 36)(2l2 - l2 + l2)(l*2 - 11l*2 + 6l*2). 72l*5 Expand -18m*5 + 34m*5 - 28m*5 + (2m + 0m - 4m)(-2m*3 + 2m*3 - 3m*4). -6m*5 Expand -121r*2 + 8r*3 + 121r*2 + (2r + 0r + 0r)(7r2 - r2 - r*2). 18r*3 Expand (41 - 55 - 55)(-2z + z2 + 2z). -69z2 Expand 3 - c - 3 + (-3c - c + 3c + (-5 + 1 + 3)(5c - 2c - c) - c - c + 0c - c + 2c + 0c)(-737 + 1656 - 704). -861c Expand (-4w*4 + 87w*3 - 87w*3)(5w - 7w + 4w) - 2w*2 + 2w2 + w5. -7w5 Expand (5 - 4 + 0)(56w - 48w*3 - 57w - 6w3). -54w*3 - w Expand (-4l + 5l + 0l - 2)(-3l*2 + 89 - 192 + 106). -3l*3 + 6l	{ "pile_set_name": "DM Mathematics" }
u + 5 = 0. Determine ux(d) + 6g(d). d2 - 1 Let s(j) = -9j - 1. Let c(a) be the first derivative of a4/6 + a3/6 + 9a2/2 - 1. Let l(y) be the second derivative of c(y). What is 5l(w) + 2s(w)? 2w + 3 Let a(b) = -3b3 + 3b - 2. Let m(g) = -3g3 - 4g*2 + 3g - 3. Let s(f) = 2f3 + 3f*2 - 2f + 2. Let d(p) = -3m(p) - 4s(p). Determine a(n) + d(n). -2n3 + 2n - 1 Let x(l) = -l*3 - 13l*2 + 15l + 17. Let n be x(-14). Let r(d) = 4d3 + 3d*2 - 5. Let u(s) = -6s2 + s2 - 8s3 + 9 + s3. What is nu(a) + 5r(a)? -a3 + 2 Suppose 28 = -5s + 2d, -5s + 0s = 4d + 4. Let x(z) = -6z + 3. Let n(i) = -7i + 4. What is sn(p) + 5x(p)? -2p - 1 Let o(j) = 2j*2 - 2j - 1. Let r(i) = i*2 + 1. Determine -o(g) - 3r(g). -5g2 + 2g - 2 Let a(i) = -13i - 3. Let w(m) = 25m + 6. What is 11a(b) + 6w(b)? 7b + 3 Let b(n) = -4n + 13. Let l be (14/(-4))/((-1)/2). Let a(g) = -l + 0g + 3 + g. Determine 7a(x) + 2b(x). -x - 2 Let u(i) = -40i*2 + 5i + 5. Let r(h) = -20h2 + 3h + 3. Calculate -5r(v) + 3u(v). -20v2 Let k(s) = -s2 + 2s - 3. Let u(p) = 5p2 - 8p + 11. Determine 9k(c) + 2u(c). c*2 + 2c - 5 Let h(q) = 13q - 4q - 1 - 8q. Let k(n) = 2. What is 2h(x) + k(x)? 2x Let q(l) = -3l + 1. Let r(m) = -m*2 - m + 1. Let y be r(-4). Let i(v) = -36v + 6 + 6v + 14v. Calculate yq(b) + 2i(b). b + 1 Let r(n) = n + 5. Let h(w) = w. Calculate 2h(t) - r(t). t - 5 Let o(s) = -4s. Suppose 4b - 32 = z, -22 = -b + 5z + 5. Let y(j) = j + bj - j. Determine -11o(m) - 6y(m). 2m Let h(x) = x*2 + 3x + 6. Let a be (-43)/(-7) - (-7)/(-49). Let p(c) = -3c2 - 8c - 17. Determine ap(k) + 17h(k). -k*2 + 3k Let m(u) = -9u - 11. Let a(h) = 3h + 5 + 4h - 3h. Let g(j) = -4j + 30. Let t be g(6). Determine tm(l) + 13a(l). -2l - 1 Let a(w) = -2w3 + 6w*2 + 8w + 9. Let o(n) = n*2 + n + 1. What is -a(y) + 6o(y)? 2y3 - 2y - 3 Let h(x) = -x + 1. Let s(b) = -b - 7. Give -2h(l) - s(l). 3l + 5 Let j(p) be the first derivative of 5p3/3 - 3p + 9. Let q(m) = m*2 - 1. Calculate -2j(t) + 6q(t). -4t*2 Let h(g) = -6g*3 + 8g*2 - 8g + 8. Let a(p) = p3 + p2 - p + 1. Calculate -24a(k) + 3h(k). -42k3 Let q(g) = -5g2 + 3. Let z(a) = a2 - 1. Suppose -4p = 5o + 11, -3p + 3 + 12 = -4o. What is pq(c) + 3z(c)? -2c2 Let q(k) be the first derivative of -k3/3 + 4. Let h(c) = 5c*2 - 2c. Determine -h(d) - 6q(d). d2 + 2d Let s(c) = -3c. Let h(i) be the second derivative of -i3/6 - 5i. What is -11h(w) + 4s(w)? -w Let r(m) = -m + 9. Let j(n) = -2n + 8. Determine -3j(t) + 2r(t). 4t - 6 Let w(h) = -1. Let g(a) = 5a2 - 2a. What is -g(t) + 3w(t)? -5t*2 + 2t - 3 Let i(x) = -x - 7. Let f(j) be the third derivative of -j4/24 - j3/2 + 3j2. Calculate -7f(c) + 3i(c). 4c Let u(z) = 88z. Let l(s) = -59s. Determine -8l(m) - 5u(m). 32m Let u(g) = -g3 + g2 + 3g - 2. Let q(x) = -382x3 - x + 3 - 4x + 0x2 - 2x*2 + 384x*3. Let k = 9 + -6. What is kq(i) + 5u(i)? i3 - i2 - 1 Let n = -2 - -16. Let d = 13 - n. Let m(h) = -2h*3 - 3h. Let l(y) = y + y*3 + 0y*3 + 0y*3. Give dm(g) - 3l(g). -g3 Suppose -28i + 30 = -34i. Suppose -w = 5b + 17, -2 = 5b - 5w + 3. Let g(n) = -3n - 7. Let u(p) = 2p + 4. Calculate bg(v) + iu(v). -v + 1 Let f(l) = -4l2 - 2l - 3. Let x(s) = 17s2 + 8s + 12. Let k(o) = -9f(o) - 2x(o). Let q(p) = 1. Determine -k(n) + 2q(n). -2n*2 - 2n - 1 Suppose l = -5o - 17, -7o + 1 = -6o - 2l. Let c(f) = -f*2 - 3f. Let g(b) = 4 - b - b*2 - 4. Give og(v) + c(v). 2v2 Let t(n) = -22n - 7. Let z(r) = -5r - 2. Calculate -6t(g) + 22z(g). 22g - 2 Let u(j) = -3j2 - 8j - 5. Let o(h) = -4h2 - 9h - 6. Let v(i) = -4o(i) + 5u(i). Let f(p) = -p*2 + 3p + 1. What is -6f(t) - 5v(t)? t*2 + 2t - 1 Let d(h) = 1. Let k be -22/(-4) + 0. Let t(c) = 1. Let a(z) = -z + 1. Let j(f) = ka(f) - 5t(f). Let m = -3 - -2. What is mj(i) - 6d(i)? i - 2 Let l(g) = -32g*3 - 10g*2 + 10g. Let c(j) = j3 + j2 - j. Determine -20c(s) - 2l(s). 44s3 Let c(l) = 13l2 - 9. Let k(v) = v3 - 3v2 + 4v - 3. Let j be k(3). Let x(y) be the second derivative of -y4/4 + y2 + 2y. Give jx(f) + 2c(f). -f2 Let r(o) = 3o + 25. Let j(n) = 2n + 13. Calculate 5j(f) - 3r(f). f - 10 Let a(q) = 2q*2 - 3q. Let n(o) = -2o2 + 2o. Let c(w) = -7w - 2. Let s be c(-1). Determine sn(k) + 4a(k). -2k*2 - 2k Let y(q) = -8q + 5. Let m(v) be the third derivative of -v4/24 + v3/6 - 6v*2. Let t be (5 - 2) + -2 - -5. Calculate tm(i) - y(i). 2i + 1 Let v(t) = -t2 - t - 1. Let p = -24 + 23. Let q(x) = 4x*2 + 6x + 6. Calculate pq(o) - 6v(o). 2o2 Let q(d) = 2d. Let g(h) = -33h2 + 54h. Determine 2g(s) - 54q(s). -66s2 Let r(f) = -6f*2 - 4f - 4. Let v(a) = -a*2 - a - 1. Suppose 135 - 115 = -5c. Determine cv(i) + r(i). -2i*2 Let j = -6 + 9. Let y(g) = -4g - 7. Let w(h) = -2h - 3. Calculate jy(m) - 7w(m). 2m Let c(w) = -3w3 - 3w*2 - 4w + 1. Let k(i) = i3 + i2 + i - 1. Determine c(z) + k(z). -2z3 - 2z*2 - 3z Suppose 52 = -5r + b, 2r + 2b + 39 = -r. Let p(v) = 2v*3 + 5v*2 - 4v + 2. Let s(c) = -6c3 - 14c*2 + 11c - 6. Give rp(k) - 4s(k). 2k3 + k2 + 2 Let a(n) = 10n - 1. Let p(w) = -5w + 1. Calculate 3a(c) + 5p(c). 5c + 2 Let h(u) = -u + 1. Let f(l) = l*3 - 4l*2 - 2l + 2. Let x be f(5). Let m = x + -9. Let n(t) = -3t - 3 + 0 + 5. What is mh(q) - 3n(q)? q + 2 Suppose -4b = -5l + 42, -l + 7 = -2b - 5. Let d(y) = -3y2 + 5y + 7. Let m(c) = -4c2 + 6c + 8. Calculate ld(w) - 5m(w). 2w2 + 2 Let b(t) = -11t*2 - 3t + 5. Let r be (-20)/(-8)((-8)/2)/(-2). Let s(u) = -7u*2 - 2u + 3. Calculate rb(n) - 8s(n). n*2 + n + 1 Suppose -8 = 2v - 34. Let o = -14 + v. Let d(z) = 4z - 2. Let j(i) = i - 1. Calculate od(w) + 3j(w). -w - 1 Let g(k) = k. Let r be g(3). Let z(j) = 7j - 4j + r + 0j*2 + 2j*2. Let o(s) = -2s*2 - 2s - 2. Determine 3o(t) + 2z(t). -2t2 Let k(a) = 1. Let v = -4 - -8. Suppose 0 = -5t + 3h - 3, 3t - 13 = 2t + vh. Let w(f) = -f - 8. Determine tw(c) - 24k(c). 3c Let a(t) = t - 1. Let c be (-9)/(-6) + 2/(-4). Suppose -d + c = 4q + 10, 2q = 4d + 18. Let i(y) = -2y2 + 5y - 5. Determine da(k) + i(k). -2k*2 Let d be (4/(-10))/(4/40). Let t(s) = -4s*3 - 7s*2 + 7. Let y(n) = -2n*3 - 4n*2 + 4. What is dt(b) + 7y(b)? 2b*3 Let a(k) = -16k + 40. Let v(j) = 5j - 13. Let m(o) = -3a(o) - 10v(o). Let c(i) = i - 4. Calculate -12c(b) - 5m(b). -2b - 2 Let l(w) = 4w2 + w. Let a(m) = -6m*2 - 9 + 9 + 9m*2. Give 6a(c) - 4l(c). 2c*2 - 4c Let y = -17 - -22. Let g(c) = -22c2 + 16. Let s(a) be the first derivative of 7a*3/3 - 5a + 1. Give yg(p) + 16s(p). 2p2 Let t(x) = -x - 1. Let p(o) be the first derivative of -o4/4 + 2o3/3 + o2 + 4o - 15. Give p(z) + 2t(z). -z*3 + 2z*2 + 2 Suppose 2 = n + v, 2n + 0n - v = 13. Let u(b) = -3b - 2. Let w(p) be the third derivative of p4/6 + p3/2 - 7p2 - 3p. Calculate nw(l) + 7u(l). -l + 1 Let f(u) = -5u2 + u + 6. Let w(g) = -17g + 6g + 5 - 4g*2 + 12g. Let d = -8 - -5. What is df(i) + 4w(i)? -i2 + i + 2 Let b(c) be the third derivative of c5/15 - 5c4/24 + 22c*2. Let i(v) = -3v*2 + 4v. Let k be 0 - (0 - (-2 - 3)). Give kb(f) - 6i(f). -2f2 + f Let r(v) = 9v - 14. Let g(m) = -3m + 5. Give 17g(b) + 6r(b). 3b + 1 Let o(q) = 7q - 7. Let n(z) = -14 + 2 + 15z - 3. Let w be (1/(-1))/(6/(-36)). Determine wn(i) - 13o(i). -i + 1 Let p(c) = c*3 - 2c*2 + 6c + 2. Let h(b) = b*3 - 2b*2 + 7b + 2. Determine 6h(u) - 7p(u). -u*3 + 2u*2 - 2 Suppose -5l - 13 = 4w, -3l + l - 22 = 4w. Let o(b) = -5b*2 - 2b + 1. Let d(k) = -9k2 - 4k + 2. Calculate wo(u) + 4d(u). -u*2 - 2u + 1 Let f(g) = -3g - 5. Let n(o) = 8o + 15. Determine -17f(y) - 6n(y). 3y - 5 Let j(f) = -16f + 43. Let q(b) = 11b - 29. Calculate -5j(g) - 7q(g). 3g - 12 Let u(k) = -4k2 + 9k + 13. Let r(z) = 2z2 - 5z - 6. Calculate -5r(v) - 3u(v). 2v2 - 2v - 9 Let v(y) = y - 7. Let o(c) = -c + 7. Give -5o(m) - 6v(m). -m + 7 Let f(d) = 7d - 4. Let n(z) = -15z + 7. Give 7*f	{ "pile_set_name": "DM Mathematics" }
s in -21h2 + 34h + 46h2 - 25h*2 + 28h*3. 28h*3 + 34h Collect the terms in 52u2 + 20u*2 - 60u*2 - 229u*2 - 193u*2. -410u*2 Collect the terms in -64b - 31b - 2b. -97b Collect the terms in 161 - 43d*2 - 162 + 4d*2 - 11d*2. -50d*2 - 1 Collect the terms in 156804 - 156804 + 2u*2 - 10u*2 - 18u*2. -26u*2 Collect the terms in -2477 + 3t*3 + 2477. 3t*3 Collect the terms in 32 + 37 + 13 + 17 - p. -p + 99 Collect the terms in 347t*2 + 386t*2 + 77t*2 - 194t*2. 616t*2 Collect the terms in -2w + 3w + 11 - 59. w - 48 Collect the terms in -790z*3 + 300z*3 + 462z*3. -28z*3 Collect the terms in 7 - 4n + 9 + 7 - 30 + 4. -4n - 3 Collect the terms in 26p*2 + 13p + 4p - 20p + 3p. 26p*2 Collect the terms in -7c*2 - 59353959c + 59353959c. -7c2 Collect the terms in v2 - 1493 - 16v2 + 3000 - 7v*2 - 1486. -22v*2 + 21 Collect the terms in -50n*3 - 46n*3 - 59n*3 + 186n*3 - 50n*3. -19n*3 Collect the terms in -2z*2 + 2z*2 + 1291z*3 - 1297z*3 + 26 - 18. -6z*3 + 8 Collect the terms in 356t*2 - 661t*2 + 321t*2. 16t*2 Collect the terms in 18 - 7 + 9834v - 9867v. -33v + 11 Collect the terms in -3j + 48j*2 + 27j*2 - 10j*2. 65j*2 - 3j Collect the terms in -33j2 + 4j - 109j2 - j3 - 2j*3 + 2j3. -j3 - 142j2 + 4j Collect the terms in -46v + 13v - 192v. -225v Collect the terms in -208 - 210 - 29u + 422. -29u + 4 Collect the terms in -1389r - 112r - 345r - 82r. -1928r Collect the terms in 269v + 47v + 17v. 333v Collect the terms in -2k*2 + 143 - 6k + 9k - 5k. -2k2 - 2k + 143 Collect the terms in 103z + 156z + 81z. 340z Collect the terms in 13k3 - 409855505 - 19k*3 + 409855505. -6k*3 Collect the terms in -l - 4l + 571l3 - 605l*3 + 5l + 0l. -34l*3 Collect the terms in 114 - 400f + 401f - 114. f Collect the terms in -9c*2 + 0c*3 - 39c*2 + 32c*2 + 2c*3. 2c*3 - 16c*2 Collect the terms in -1018q*2 - 795q*2 + 1834q*2. 21q*2 Collect the terms in 3 + 174w + 188w - 71w. 291w + 3 Collect the terms in 3l*2 + 9354633 - 4677318 - 4677315. 3l*2 Collect the terms in 83o*2 + 21891 + 67o*2 - 21891. 150o*2 Collect the terms in 8g - 1889 + 1889 + 4g. 12g Collect the terms in 23t + 3165t*2 - 6t - 17t + 3171t*2 - 6338t*2. -2t*2 Collect the terms in -21179x*2 + 42385x*2 - 21187x*2. 19x*2 Collect the terms in -9b - 9b + 18b + 1716b2. 1716b*2 Collect the terms in 4787x*2 - 2125x*2 - 6x*3 - 2662x*2. -6x*3 Collect the terms in 239t - 92t - 2t*2 + 332t. -2t2 + 479t Collect the terms in 453269 - 453269 - j. -j Collect the terms in 903o3 - 457o*3 - 451o*3. -5o*3 Collect the terms in 45h - 149h - 104h - 60h - 7h. -275h Collect the terms in -847 + 897n + 847. 897n Collect the terms in 3979 - 7954 + 3975 - p. -p Collect the terms in 3 + 745s - 1 - 897s + 438s. 286s + 2 Collect the terms in 608a - 3 + 619a - 1215a. 12a - 3 Collect the terms in -12f3 + f3 - 12f3 + 21f*3 + 11 - 11. -2f*3 Collect the terms in -630z*3 - 1163z*3 + 412z*3 - 1103z*3. -2484z*3 Collect the terms in -26872499 + 26872499 - 3b - 8b. -11b Collect the terms in 364d + 46 - 324d + 6. 40d + 52 Collect the terms in -1759 + 1759 + a2 + 90a. a*2 + 90a Collect the terms in 74329y3 + 74254y*3 - 148578y*3. 5y*3 Collect the terms in 479m*2 + 2494m*2 - 279m*2. 2694m*2 Collect the terms in -1241j + 25j2 + 1241j + 102j2. 127j*2 Collect the terms in -488c*3 + 182c*3 + 127c*3 + 177c*3. -2c*3 Collect the terms in 1195o*3 - 324o*3 - 874o*3. -3o*3 Collect the terms in 700q*3 - 140q*3 + 3623q*3. 4183q*3 Collect the terms in 10r*2 - 32r*2 - 11r*2 + 40r*2. 7r*2 Collect the terms in 21c - 5c + 7c + 3 - 2 + 22c. 45c + 1 Collect the terms in -27v - 11v + 5v + 13 - 13. -33v Collect the terms in -308p - 305p + 610p. -3p Collect the terms in 93s3 - 79s*3 + 46s*3 + 108s*3. 168s*3 Collect the terms in 37 + 11t*3 + 2 - 39 - t + 14t*2 - 14t*2. 11t*3 - t Collect the terms in -28w*2 - 18w*2 + 13w*2 - 26w*2 + 60w2. w2 Collect the terms in 226m3 + 159 + 113m*3 - 50m*3 - 159. 289m*3 Collect the terms in -3 - 19k + 5 - 48k - 22k. -89k + 2 Collect the terms in 17l2 + l3 - 46l2 + 29l*2 - 6l*3. -5l*3 Collect the terms in -21q*2 + 5 - 635q + 99q - 5. -21q*2 - 536q Collect the terms in -5p - 568 + 5p + 5p - 400. 5p - 968 Collect the terms in 21j2 - 4j*2 + 24j*2 + 16j*2. 57j*2 Collect the terms in 2 + 4 - 5v + 77v2 + 2v - 72v2. 5v*2 - 3v + 6 Collect the terms in -588807c - 5 + 588820c + 5. 13c Collect the terms in 18l*2 + 1668l - 1 - 626l + 1 - 1042l. 18l2 Collect the terms in 624b + 98b + 450b - 40b. 1132b Collect the terms in 135y + 5y*3 - 2y*3 - 118y - 650y. 3y*3 - 633y Collect the terms in 16y + 1269 - 14y - 1269 - 80y2. -80y*2 + 2y Collect the terms in 3222k3 + 169k*2 - 168k*2 + 4k - 4k. 3222k3 + k2 Collect the terms in -4 - 10b2 - 2 + 6. -10b2 Collect the terms in 2582 - 1299 + z3 - 1283. z*3 Collect the terms in 9m*3 - 117m*2 + 6m*3 + 454m*2. 15m*3 + 337m*2 Collect the terms in 120p*3 - 87p*3 + 124p*3 + 54p*3 + 98p*3. 309p*3 Collect the terms in -14 + 380x*2 - 59x*2 - 10 + 24. 321x*2 Collect the terms in -84 + 65 - 313x + 310x. -3x - 19 Collect the terms in -1147j - 233j*3 + 234j*3 + 1147j. j*3 Collect the terms in 32d + 247d + 3d*2 - 35d. 3d2 + 244d Collect the terms in 162 + 6608x - 162 - 6610x. -2x Collect the terms in -2o - 200 - o + 145. -3o - 55 Collect the terms in -4349362 + 4349362 + 2c*3. 2c*3 Collect the terms in -203l*3 - 24l + 202l3 + 24l. -l*3 Collect the terms in 130t*2 - 48t*2 - 18t*3 - 83t*2. -18t3 - t2 Collect the terms in -834 + 1673 + 24841v - 839. 24841v Collect the terms in -5629s + 2820s + 2800s. -9s Collect the terms in 3318811 - 3318811 + 58g. 58g Collect the terms in 5998 + 0o + 3o + 14o - 11987 + 5989. 17o Collect the terms in -348a + 776a + 228a. 656a Collect the terms in 519u3 + 250u*3 - 770u3 - 1. -u3 - 1 Collect the terms in -2x + 34 + 0x + 54 + 50 - 48. -2x + 90 Collect the terms in -3o*2 + 187o*3 - 383o*3 - 346o*3. -542o*3 - 3o*2 Collect the terms in 5492 - 16d - 5492 + 3d + 14d. d Collect the terms in -2b + 0b - 20b - 3b + 26b + b. 2b Collect the terms in 18185v - 18185v - v*2 - 9v*2. -10v*2 Collect the terms in -227j*3 + 64j*3 + 82j*3 + 83j*3. 2j*3 Collect the terms in -3 + 897t3 - t3 + 4. 896t3 + 1 Collect the terms in 5y + 14 - 99 + 85. 5y Collect the terms in 6265b*2 - 40664b*2 - 19289b*2. -53688b*2 Collect the terms in 512s*3 - 483s*3 - 32s*3. -3s*3 Collect the terms in 2l - l - l*2 + 195 - 5l + 225. -l*2 - 4l + 420 Collect the terms in 52i - 36i*2 + 41i*2 - 9i*2 - 52i. -4i2 Collect the terms in -3 + 3 + 85p - 4 + 21p. 106p - 4 Collect the terms in -6n2 + 6n*2 - 29n*3 - 26n*3 - 5n*2 + 5n*2. -55n*3 Collect the terms in -19570n - 19636n + 39200n. -6n Collect the terms in 1383r - 698r - 680r. 5r Collect the terms in -57407d*3 + 114806d*3 - 57402d*3. -3d*3 Collect the terms in 5543a*3 + 5187a*3 - 10691a*3. 39a*3 Collect the terms in 1265m - 1265m - 28m*3 + 26m*3. -2m*3 Collect the terms in -116i + 9i + 53i - 191i. -245i Collect the terms in 262n - 2781 + 2781. 262n Collect the terms in 112c + 110c + 113c + 110c - 540c + 110c. 15c Collect the terms in -2027w*2 - 126w*3 + 2028w*2 + 22w*3. -104w3 + w2 Collect the terms in -579l2 - 947l*2 - 1354l*2. -2880l*2 Collect the terms in -9 + 6 - 37v*2 - 2 + 5. -37v*2 Collect the terms in 28 - 19n + 9n + 24n*3 + 9n - 28. 24n3 - n Collect the terms in -576x*2 + 2 - 573x*2 - 570x*2 + 1710x*2. -9x*2 + 2 Collect the terms in -17j*2 - 12j - 5j - 9 + 17j. -17j2 - 9 Collect the terms in -67 + 63 - 10h - 19h. -29h - 4 Collect the terms in -134w + 22w	{ "pile_set_name": "DM Mathematics" }
igit of d? 9 Let q(c) = -2c2 + 4c + 2. Let g be q(2). What is the units digit of -41/g + 1107? 5 Suppose -18k + 51588 = -3366. What is the tens digit of k? 5 Let c be (-1)/(1/2) + 6. Suppose -12 = -2f - 3w, cf - 7 - 29 = -3w. What is the tens digit of 126/f - (-1)/2? 1 Let r(k) = -9k*2 + 6k + 6. Let m(f) = 4f2 - 3f - 3. Let u(j) = -13m(j) - 6r(j). What is the units digit of u(-2)? 5 Let f = -453 - -479. What is the tens digit of f? 2 Let a be (9/2 - -1)-2. Let x = 14 + a. Suppose -xy = -17 + 2. What is the units digit of y? 5 Let j = -782 + 1266. Suppose -2y + j = 2d, -4y + 3d + 324 = -623. What is the tens digit of y? 3 Suppose -9m + 626 + 643 = 0. Let u = -78 + m. What is the tens digit of u? 6 Let a = 4 + -2. Suppose -25 = 8u - 89. Suppose -am - u = -6m. What is the units digit of m? 2 Suppose 0 = 6c - 4c - 4. Suppose 0 = -h - 2x - 3x + 89, -ch - 5x = -163. What is the tens digit of h? 7 Suppose 13 = 3z + 1. Suppose 3k + 8 = -r + 6k, -zk = 5r - 36. Suppose -ri + 1 = -27. What is the units digit of i? 7 Suppose -9o - 14 = -16o. What is the units digit of (1/o)/(5/260)? 6 Let s(m) be the second derivative of -m*5/30 - 5m4/24 + m3 - 4m. Let y(g) be the second derivative of s(g). What is the units digit of y(-3)? 7 Let j be (-12)/(-54) - 210/(-27). Let y be (-9)/((-252)/j)14. Suppose -88 = 2a - ya. What is the tens digit of a? 4 Let v be 8 - 18 - (0 + 1). Suppose 0 = -4d + 29 + 99. Let t = d + v. What is the tens digit of t? 2 Let p(s) = -4s*3 - 17s*2 - 86s - 4. What is the units digit of p(-8)? 4 Suppose -20r + 40907 = -46753. What is the hundreds digit of r? 3 What is the tens digit of (0 - (-1 + 55))(-1392)/96? 8 Suppose 0 = -2j + 4j - 4. Let w be (j/6)/(2/996). Suppose w = 6t - 56. What is the tens digit of t? 3 Suppose -2k = -63 + 7. Suppose -48 = -2q + k. What is the units digit of q? 8 Let k be -6 + 6 + (-13 - -2). Let g(l) = -l3 - 9l*2 + 16l - 1. What is the tens digit of g(k)? 6 Let w(y) = y*2 + 2y. Suppose 6x - 4 = 8x. Let v be w(x). Suppose 7 = -h + 2, v = r + 2h - 10. What is the units digit of r? 0 Suppose 16f - 3485 = 13f - 5x, -4x = -3f + 3503. What is the units digit of f? 5 Suppose -9m + 94 + 59 = 0. Let c(o) = 4 + mo - 7o - 12o. What is the units digit of c(-2)? 8 Let k(h) = -10h3 - h2 + 3h + 10. What is the hundreds digit of k(-3)? 2 Let t(s) = 4s2. Suppose 4u - 9u + 5 = 0. Let y be t(u). Suppose 0 = -yh - 3f + 31, -2h = -0h - 4f - 32. What is the tens digit of h? 1 Let x(a) = a + 6. Suppose 7z = 8z - 4. Suppose -2j = -zj. What is the units digit of x(j)? 6 What is the hundreds digit of (-4 - 5) + 11 - (-318 + 0)? 3 Let p(t) = t*3 + 25t*2 + 26t + 157. What is the thousands digit of p(-22)? 1 Let t = -8 + 11. Suppose -8o = -to. Suppose 2x - 4p - 40 = o, p = 4x - p - 68. What is the tens digit of x? 1 Let y = 102 - 122. What is the tens digit of (-7)/((-56)/y)-6? 1 Let t(b) = -b*3 + 7b*2 - 8b + 1. Let x be 24/(-9)(-9)/6. What is the tens digit of t(x)? 1 Let h be 114/(-15) - 10/25. What is the tens digit of 115/2 - 4/h? 5 Suppose -12j + 6799 + 401 = 0. Let w = j - 296. What is the units digit of w? 4 Let x be (-1)/(9/10 - 4/10). What is the units digit of -21x - (-5 + -3)? 2 Suppose -5a + 4 = -2z, 4a + 8 = -3z + 25. Let x be a/(-6) - (-260)/(-12). Let i = 39 + x. What is the units digit of i? 7 Let q = 115 - 206. What is the tens digit of (-4 - -3)(q + -1)? 9 Suppose -4b + 199 + 2361 = 0. Suppose -2j - 2c - b = -4j, -5j + 3c = -1610. What is the tens digit of j? 2 Let y(x) = x3 + 7x*2 + 2x. Let w be y(-7). Let t be 44/77 - 580/w. Let o = t - 25. What is the tens digit of o? 1 Suppose -n = 4g + 8, 3n + g + 2 = -0g. Suppose n = -3a + 8a. Suppose u - 19 + a = 0. What is the tens digit of u? 1 Suppose -6y + 2y = 0. Suppose y = -5i + 135 + 95. What is the units digit of i? 6 Let w be 1(-1 + -1 + -1). Let f(x) = -28x + 12. What is the units digit of f(w)? 6 Suppose 2t - 9 + 5 = 0. Let i be -111 + 2/t. What is the units digit of i-223/12? 5 Let t(v) = 3v2 - 5v + 6. Let a(x) = -3x2 + 5x - 6. Let l(q) = -4a(q) - 3t(q). What is the units digit of l(4)? 4 Suppose 240 + 255 = 5n. Suppose 2u = -u + n. What is the tens digit of u? 3 Let v be ((-4)/(-3) + (1 - 4))-3. Suppose 3r + 186 = 2d, d = vd + 2r - 404. What is the units digit of d? 9 Let i = 4693 - -118. What is the thousands digit of i? 4 Suppose 5p = 4t + 1021, -3t - 3p - 1013 = t. Let k = -74 - t. What is the units digit of k? 0 Suppose 53n - 61n = -192. Let k be -2 + 4 + -3 + -1. Let f = k + n. What is the tens digit of f? 2 Suppose -4k - 23 = -5b, -k + 10b - 17 = 5b. Let a be (-1)/(k(-3)/(-18)). Let n(m) = 2m2 + 4m - 7. What is the tens digit of n(a)? 2 Let m = 63 - 17. What is the tens digit of m? 4 Let a = 241 + -165. Suppose -2q = 2, 5k + 134 = -9q + 5q. Let c = k + a. What is the tens digit of c? 5 Let u(t) = -18t - 8. Let o(m) = 19m + 7. Let q(i) = -3o(i) - 4u(i). What is the units digit of q(3)? 6 Let u be (-4)/(-18) - 100/(-36) - 13. Let k(a) = -a*3 - 8a*2 + 5a - 20. What is the units digit of k(u)? 0 What is the thousands digit of (2/(-4) - 10)(-1636)/3? 5 What is the tens digit of ((-3)/(-7))/(41/3731)? 3 Suppose 5c - 2x - 53 = 993, -3x = c - 216. Suppose -10f + c = -4f. Suppose 2b + 3b - 4o = 166, -o = b - f. What is the tens digit of b? 3 Let n(p) = 2p*3 + 2p*2 - 10p - 4. Let g be -41/6-6. What is the tens digit of n(g)? 1 Let l = 45 - 37. Suppose 3v - 2f - 2f - 56 = 0, v = -4f - l. What is the tens digit of v? 1 Suppose -11p + 16p = -2x + 11337, 2p + 22662 = 4x. What is the hundreds digit of x? 6 Let s = -4 - -7. Let i be -3 + (0 - (-9 - 4)). Suppose i = sh - 5. What is the units digit of h? 5 Let j(n) = -n - 17. Let l(o) = -3o + 15. Let b be l(9). Let i be j(b). Let s(x) = -x3 - 4x*2 - x + 5. What is the tens digit of s(i)? 3 Suppose -9643 = -5g - 1023. What is the hundreds digit of g? 7 Let y = -36 + 43. Let t be (y/(-14))/(1/10). Let x = 49 - t. What is the tens digit of x? 5 Suppose 0 = 3g - 4f - 23, -3g - 3f + 21 = -g. Let o(m) = 18m + gm - 13m. What is the tens digit of o(2)? 2 Suppose 0 = 2s + 2s - 2v - 66, 0 = 2s + 2v - 36. Suppose sp = 18p - 264. What is the hundreds digit of p? 2 Let i = -219 - -283. What is the units digit of i? 4 Suppose 4u - 3301 = -w, -3u - 13166 = -4w - 0u. What is the tens digit of w? 9 Let f = -29 - -32. What is the units digit of 154/f + (-7)/21? 1 Let y(a) = 3 + 3a + 3a - 5a. Let g be y(6). Suppose 3s + g + 53 = 2n, 4s = n - 41. What is the tens digit of n? 2 Let p(g) = -6 - g*2 + 5g*2 - 3g*2 - 3g. Suppose -12 = u + 3u. What is the tens digit of p(u)? 1 Let w(g) = 102g*3 - 3g*2 + 7. What is the tens digit of w(2)? 1 Let k(b) = 6b*2 + 2b + 1. Let x be k(-1). Suppose o = -x, 4o - o - 3 = 2d. What is the units digit of (-83)/d + 4/(-18)? 9 Let w = -224 - -313. Suppose 0 = 2n - 2d - 202, 5n - 4n = -3d + w. What is the units digit of n? 8 Let v = 5 - -6. Suppose -c = 3x - v, 4 = c + x - 17. What is the units digit of c? 6 Suppose 0 = -3j + 8 - 2. Suppose 3d = 12w - 10w - 23, -5w + 2d + 30 = 0. Suppose jf - wf = -94. What is the units digit of f? 7 What is the hundreds digit of (-964)/5(-8)/((-128)/(-40))? 4 Let h be 0 + -5(4 - 3). What is the units digit of (-1)/(-2) + ((-1065)/6)/h? 6 Let o = 28 - 9. What is the units digit of ((-2)/4)/(o/(-2204))? 8 Let y(f) = -2f2 - 10. Let v be y(-7). Let u = v - -178. What is the units digit of u? 0 Let k(t) = t2 + 2t - 3. Let j be k(-3). Suppose j = 4y + 16, -4y - 70 - 96 = 5n. Let d = n + 55. What is the units digit of d? 5 Suppose 15 = -2y + 7y. Let s be y/(-9)(-36)/4. What is the units digit of 3 + (-1)/(s - 4)? 4 Suppose -5p = 3g + 24 - 4, p + 4 = -4g. Suppose g = -18u + 17u + 92. What is the units digit of u? 2 Suppose 1529 = 3q - l - 4l, 5q - 2535 = 5l. What is the hundreds digit of q? 5 Suppose -2k + 3j - 180 = 0, -4j - 156 - 131 = 3k. Let i = k - -190. What is the tens digit of i? 9 Let w(x) = -3x*2 + 13x + 4. Let o be w(10). Let a = o + 293. Suppose -4*g + 73 + a = 0. What is th	{ "pile_set_name": "DM Mathematics" }
le of 1662? False Does 195 divide 42443879? False Is 10281964 a multiple of 29? False Is 20771931 a multiple of 1393? False Is 2693675376 a multiple of 4396? True Is 7 a factor of 1188598705? True Does 7 divide 3374744? False Does 1409 divide 64305351? True Is 1909960610 a multiple of 33? False Does 2 divide 32682673? False Is 55288384 a multiple of 49? False Is 3029 a factor of 90927551? True Is 153 a factor of 19472157? True Does 2383 divide 511402958? False Is 8 a factor of 734440? True Is 7 a factor of 749131144? False Is 55024398 a multiple of 117? True Is 8 a factor of 55688026? False Is 8 a factor of 521676756? False Is 103 a factor of 80630048? True Is 93 a factor of 18509855? False Is 15 a factor of 175289745? True Does 866 divide 1149602010? True Does 2336 divide 185958606? False Does 542 divide 2912929? False Is 369 a factor of 207839184? False Is 331 a factor of 27716593? False Is 983579245 a multiple of 14? False Does 21 divide 2721142074? True Is 64 a factor of 1539503658? False Is 34 a factor of 1196222? True Does 183 divide 243552687? True Is 11575352 a multiple of 8? True Is 15 a factor of 17709375? True Is 193282213 a multiple of 13? False Does 5889 divide 416558547? False Is 1109 a factor of 380833927? True Is 248600716 a multiple of 196? True Does 1893 divide 18842285? False Does 4 divide 10522524? True Is 1734 a factor of 142220490? False Is 4 a factor of 274670884? True Is 796538349 a multiple of 17? True Is 1184010387 a multiple of 7? True Is 159 a factor of 763792911? True Is 58197711 a multiple of 33? True Is 256 a factor of 8708654? False Is 356866601 a multiple of 7? True Is 3965786 a multiple of 178? False Does 914 divide 1374173408? True Is 89 a factor of 8781661? False Does 40 divide 323440680? True Is 8 a factor of 18812197? False Does 4 divide 692302324? True Does 2412 divide 5496948? True Is 6 a factor of 44098434? True Is 45927204 a multiple of 32? False Is 2349 a factor of 103024791? True Is 8 a factor of 1866965898? False Is 7068825 even? False Is 17 a factor of 118432124? False Does 84 divide 17223444? True Is 236 a factor of 2811633? False Is 3 a factor of 11983233? True Is 594 a factor of 159320493? False Is 8608448 a multiple of 64? True Is 703772312 a multiple of 5024? False Is 94 a factor of 208066400? False Does 681 divide 118302696? False Is 14 a factor of 298785788? True Is 216940925 a multiple of 71? False Is 651 a factor of 370487853? False Does 11 divide 2358884? True Does 301 divide 133776664? False Does 388 divide 11326414? False Is 86181249 a multiple of 717? True Is 28886550 a multiple of 308? False Does 281 divide 427347891? True Does 8 divide 6272399? False Is 710263308 a multiple of 2705? False Is 58927 a multiple of 173? False Does 14 divide 21504546? True Is 670571407 a multiple of 332? False Is 57 a factor of 16556448? True Is 1672 a factor of 1474082016? True Is 3185952 a multiple of 84? True Is 98 a factor of 15354248? True Is 2 a factor of 2837081? False Is 348 a factor of 576633991? False Is 268 a factor of 695745420? True Does 7 divide 22527085? True Is 83 a factor of 26569047? True Is 257074977 a multiple of 142? False Is 46296060 a multiple of 3126? True Is 2928 a factor of 136060432? False Is 49 a factor of 55508545? False Is 1515424033 a multiple of 41? False Does 63 divide 88748100? True Is 52 a factor of 14984372? True Does 235 divide 120713083? False Is 287 a factor of 105174174? False Is 185 a factor of 357511040? False Is 20862239 a multiple of 6138? False Does 49 divide 78822188? False Does 116 divide 19810828? True Is 382 a factor of 814640652? False Is 845 a factor of 18119335? True Is 6 a factor of 539879106? True Does 9 divide 628451975? False Is 8 a factor of 3548906808? True Is 42081534 a multiple of 24? False Is 36429642 a multiple of 388? False Is 4516 a factor of 754405057? False Does 3122 divide 1507467521? False Does 342 divide 153062780? False Is 784014 a multiple of 33? True Does 9 divide 4057219567? False Is 1264209854 a multiple of 212? False Is 12646491 a multiple of 21? False Is 477741174 a multiple of 17? True Is 16 a factor of 329997779? False Is 35 a factor of 98264740? True Does 163 divide 363502388? True Does 47 divide 11944441? False Is 37 a factor of 117059712? True Does 76 divide 35689676? True Does 11 divide 459781080? True Is 10 a factor of 221479400? True Does 15 divide 2557947004? False Is 326151187 a multiple of 29? False Does 495 divide 344008170? True Does 116 divide 119248116? True Is 567030737 a multiple of 19? True Is 675 a factor of 244564876? False Is 46974762 a multiple of 1503? True Is 26 a factor of 113329866? True Is 113 a factor of 285854008? False Is 2816 a factor of 3450948661? False Does 401 divide 8687264? True Does 3 divide 10344710? False Is 40 a factor of 686304560? True Does 2155 divide 26129375? True Is 7483564 a multiple of 44? True Is 618 a factor of 269648850? True Is 13641092 a multiple of 94? True Is 19 a factor of 2556376544? False Is 8950 a factor of 251530800? True Does 40 divide 1431200? True Is 40654096 a multiple of 1539? False Does 47 divide 306552706? True Does 863 divide 107373597? True Is 723587112 a multiple of 18? True Is 132477384 a multiple of 12? True Is 1453 a factor of 208819348? True Is 47 a factor of 26541699? True Does 348 divide 77376060? True Does 9612 divide 2021605452? True Is 3 a factor of 483227? False Does 13 divide 676869088? False Is 822 a factor of 20512150? False Is 375 a factor of 242400000? True Is 38999164 a multiple of 194? False Is 203221593 a multiple of 360? False Is 11 a factor of 17953353? True Does 7 divide 63419594? True Is 3157 a factor of 1260113393? True Does 532 divide 38243352? True Is 26 a factor of 54423746? True Is 47101342 a multiple of 13? False Does 15 divide 16705140? True Is 205853925 a multiple of 6? False Is 220 a factor of 7300920? True Is 72837241 a multiple of 16? False Is 300274225 a multiple of 3? False Is 421856770 a multiple of 34? False Is 526 a factor of 4776606? True Does 4998 divide 655002894? True Does 3891 divide 2504675610? True Does 4 divide 93800448? True Does 150 divide 809716502? False Is 9316346 even? True Is 2166608972 a multiple of 244? False Does 92 divide 105942632? False Does 5 divide 629300? True Does 41 divide 434229319? True Does 15 divide 260021850? True Is 25 a factor of 626494825? True Is 95801188 a multiple of 119? True Is 221443972 a multiple of 4? True Is 83667334 a multiple of 334? True Is 192159636 a multiple of 545? False Is 1056538658 a multiple of 6126? False Is 414 a factor of 134228736? True Is 2454 a factor of 2082727533? False Is 157 a factor of 37054644? False Is 97330080 a multiple of 1266? True Is 83904171 a multiple of 597? True Is 422243204 a multiple of 5? False Is 4 a factor of 6066258? False Is 3798578735 a multiple of 245? True Is 350 a factor of 287062312? False Does 291 divide 1683435? True Is 14 a factor of 35319816? True Does 55 divide 7409797? False Is 4 a factor of 688575862? False Does 598 divide 236387102? False Is 2030 a factor of 421764980? True Is 1882 a factor of 1102344? False Is 9039065 a multiple of 287? True Is 52 a factor of 206317488? True Is 532219883 a multiple of 79? False Is 167392551 a multiple of 2553? True Is 415 a factor of 248550555? True Is 225 a factor of 45924300? True Does 194 divide 31984711? False Is 3143050011 a multiple of 10? False Does 4988 divide 3038790516? False Does 101 divide 554761843? False Does 24 divide 32605073? False Is 812866380 a multiple of 20? True Is 103985348 a multiple of 2084? True Is 72 a factor of 42055272? True Does 22 divide 698338454? True Is 143048880 a multiple of 930? True Is 192 a factor of 210412292? False Is 985 a factor of 845987935? True Is 172026624 a multiple of 28? True Is 61 a factor of 238035073? False Is 25 a factor of 224630044? False Does 50 divide 1860247100? True Is 830913315 a multiple of 107? True Does 299 divide 42713944? True Is 374605922 a multiple of 150? False Is 16735461 a multiple of 139? True Is 79528134 a multiple of 40? False Does 260 divide 405717000? True Is 25380172 a multiple of 4? True Is 7 a factor of 177519048? True Is 5149778 a multiple of 44? False Is 1123358747 a multiple of 455? False Is 234 a factor of 29	{ "pile_set_name": "DM Mathematics" }
nearest 100? 64600 What is -0.21556187 rounded to four decimal places? -0.2156 What is 14.079945 rounded to zero decimal places? 14 What is -4545067 rounded to the nearest one hundred thousand? -4500000 What is -0.5279926 rounded to three decimal places? -0.528 What is 0.05046199 rounded to two dps? 0.05 Round 30.942013 to the nearest integer. 31 Round 4256.41 to the nearest 1000. 4000 What is 34.65117 rounded to the nearest 10? 30 Round -4708538000 to the nearest 1000000. -4709000000 What is 695.804 rounded to the nearest 100? 700 What is -530.35343 rounded to zero dps? -530 What is -0.0005449107 rounded to 5 dps? -0.00054 What is 8909.964 rounded to the nearest one hundred? 8900 What is -5931200 rounded to the nearest 1000000? -6000000 Round 298.446 to 0 decimal places. 298 Round 0.0007356153 to five decimal places. 0.00074 Round -96.615 to the nearest 100. -100 Round 298271000 to the nearest 1000000. 298000000 Round 13905227 to the nearest one million. 14000000 What is 354586 rounded to the nearest one hundred thousand? 400000 Round -229.892 to the nearest 10. -230 Round 0.00001059 to five dps. 0.00001 Round 1823.5207 to the nearest 10. 1820 What is 0.0248149 rounded to three decimal places? 0.025 What is -1.025943 rounded to two decimal places? -1.03 Round 2308960 to the nearest 1000000. 2000000 What is -5515.03 rounded to the nearest one hundred? -5500 Round 562.5435 to zero decimal places. 563 What is 0.0000005767388 rounded to 7 decimal places? 0.0000006 Round -0.0000495135 to 6 decimal places. -0.00005 What is 7267.4 rounded to the nearest one thousand? 7000 Round 0.00001610068 to 5 decimal places. 0.00002 Round 0.0371013 to 4 decimal places. 0.0371 What is -14.82982 rounded to the nearest integer? -15 Round -13659.58 to the nearest 100. -13700 What is 0.0000156846 rounded to 6 dps? 0.000016 What is -1.2584201 rounded to two dps? -1.26 Round -50567.09 to the nearest 10. -50570 Round -0.05170902 to 4 dps. -0.0517 What is 15621.92 rounded to the nearest ten? 15620 Round 21.786248 to 2 decimal places. 21.79 Round 0.000733676 to five dps. 0.00073 Round -77356.19 to the nearest one hundred. -77400 What is 416279 rounded to the nearest one hundred thousand? 400000 What is 55.95396 rounded to one dp? 56 What is 715.843 rounded to the nearest 10? 720 What is -492614 rounded to the nearest one thousand? -493000 Round 0.0000806533 to 5 dps. 0.00008 Round -0.0000237474 to 6 dps. -0.000024 Round 0.0011152 to four dps. 0.0011 What is -56388230 rounded to the nearest ten thousand? -56390000 Round -0.0001815958 to 5 dps. -0.00018 Round 8252.564 to the nearest 100. 8300 Round 11002734 to the nearest ten thousand. 11000000 What is 0.00061572 rounded to 5 dps? 0.00062 Round 239.01478 to one dp. 239 Round 0.0000084093 to six decimal places. 0.000008 Round 237450 to the nearest 10000. 240000 Round -0.00116326 to five decimal places. -0.00116 Round 0.0000016209 to five decimal places. 0 Round -8316.049 to the nearest ten. -8320 What is -325512.6 rounded to the nearest 100000? -300000 Round 242878900 to the nearest one hundred thousand. 242900000 What is -0.08622 rounded to 3 decimal places? -0.086 Round 15318.696 to the nearest 1000. 15000 Round 0.00075585 to four dps. 0.0008 Round -116906.418 to the nearest one thousand. -117000 Round -0.000608527 to five dps. -0.00061 What is -22.616636 rounded to 0 decimal places? -23 Round 0.000000374251 to seven decimal places. 0.0000004 Round 582556100 to the nearest 1000000. 583000000 Round -1038160 to the nearest ten thousand. -1040000 What is 742.7491 rounded to the nearest 10? 740 Round -167592300 to the nearest 100000. -167600000 Round 0.00009929665 to six dps. 0.000099 Round 0.00006455188 to seven dps. 0.0000646 What is 54061.8 rounded to the nearest 100? 54100 Round -0.7159345 to two decimal places. -0.72 Round 450.71111 to the nearest integer. 451 Round -0.7265441 to 3 decimal places. -0.727 Round 1255.771 to the nearest ten. 1260 Round 7.366502 to 3 decimal places. 7.367 Round 94.025099 to the nearest 10. 90 What is 120.533 rounded to the nearest integer? 121 What is 0.0013879747 rounded to four decimal places? 0.0014 What is -260803 rounded to the nearest ten thousand? -260000 Round 1173300 to the nearest one million. 1000000 What is -17.48859 rounded to the nearest integer? -17 What is -10.70994 rounded to three decimal places? -10.71 What is -4104.94 rounded to the nearest ten? -4100 Round 114766.9 to the nearest one hundred. 114800 Round -0.000637794 to 3 decimal places. -0.001 Round -0.0003302088 to seven dps. -0.0003302 What is -4999.784 rounded to the nearest integer? -5000 What is 0.03575284 rounded to 2 decimal places? 0.04 Round -1116.826 to the nearest integer. -1117 What is 0.0001433263 rounded to seven decimal places? 0.0001433 Round 63425.9 to the nearest one hundred. 63400 What is -0.1180992 rounded to 2 decimal places? -0.12 Round -0.00000886559 to six dps. -0.000009 What is 0.1909296 rounded to 4 dps? 0.1909 What is 11420.604 rounded to the nearest 1000? 11000 What is -0.000038385062 rounded to five decimal places? -0.00004 Round -6617.19 to the nearest one hundred. -6600 What is -0.000013006143 rounded to 7 decimal places? -0.000013 Round 377.96937 to the nearest 10. 380 Round 43980.6 to the nearest 10000. 40000 Round 2.5765033 to one decimal place. 2.6 What is 0.25203987 rounded to two dps? 0.25 Round 795.354 to the nearest 100. 800 Round 0.0041913 to 4 dps. 0.0042 Round -26168070 to the nearest 10000. -26170000 What is 5835240 rounded to the nearest 1000000? 6000000 What is 7737.13 rounded to the nearest ten? 7740 What is -99.6325 rounded to one decimal place? -99.6 What is -0.0114695333 rounded to three decimal places? -0.011 What is 110.0231 rounded to 1 decimal place? 110 Round -53.4873 to 0 dps. -53 Round 47290700 to the nearest one hundred thousand. 47300000 What is 0.2279182 rounded to 3 dps? 0.228 Round 2571.98 to the nearest one hundred. 2600 What is -843235 rounded to the nearest one thousand? -843000 What is 571324 rounded to the nearest 1000? 571000 What is 0.000390837 rounded to 4 dps? 0.0004 What is 422.6626 rounded to zero dps? 423 Round 346435440 to the nearest 100000. 346400000 What is -268913600 rounded to the nearest one hundred thousand? -268900000 What is 214.527 rounded to the nearest 100? 200 What is 85128850 rounded to the nearest 1000000? 85000000 What is -4093607 rounded to the nearest one hundred thousand? -4100000 What is -2600799000 rounded to the nearest 1000000? -2601000000 What is -0.0000003137968 rounded to 7 dps? -0.0000003 Round 304071.11 to the nearest one thousand. 304000 What is 1077056000 rounded to the nearest 1000000? 1077000000 Round 0.00207497 to four dps. 0.0021 What is 11482750 rounded to the nearest one thousand? 11483000 Round 575796 to the nearest ten thousand. 580000 What is -0.014169075 rounded to 5 dps? -0.01417 What is -0.04781268 rounded to three dps? -0.048 What is 637.09 rounded to the nearest 100? 600 Round 164.1427 to the nearest 10. 160 Round -0.0000412652 to 6 dps. -0.000041 What is 2204204 rounded to the nearest 1000? 2204000 What is 993.8139 rounded to the nearest 100? 1000 What is 919417.6 rounded to the nearest one hundred thousand? 900000 Round 21679.601 to the nearest one hundred. 21700 Round 209521.56 to the nearest 1000. 210000 Round -505646.6 to the nearest one thousand. -506000 What is 8.35342 rounded to one decimal place? 8.4 Round -0.6425597 to 2 decimal places. -0.64 What is -193.50328 rounded to the nearest ten? -190 What is 0.0372721 rounded to two decimal places? 0.04 What is -0.0000142811 rounded to seven dps? -0.0000143 Round 632.189 to the nearest one hundred. 600 What is 18297500 rounded to the nearest 1000000? 18000000 What is -7.090021 rounded to 3 decimal places? -7.09 Round 13589.635 to the nearest integer. 13590 Round -39939.1 to the nearest 10000. -40000 Round 0.36087103 to 3 decimal places. 0.361 Round 0.017992 to 3 dps. 0.018 Round -32651 to the nearest ten thousand. -30000 What is 0.000145952 rounded to 6 decimal places? 0.000146 Round -0.06448366 to four dps. -0.0645 What is 1.789326 rounded to 3 decimal places? 1.789 What is 0.0610545 rounded to three dps? 0.061 What is 531924000 rounded to the	{ "pile_set_name": "DM Mathematics" }
o the nearest 1000000? 5000000 Let j = -293801 + 166401. Let v = 345600 - j. Round v to the nearest 10000. 470000 Let k = -22 - -27. Suppose 0 = kb + 13037847 + 9312153. Round b to the nearest 100000. -4500000 Let p = -16.42 - -151.72. Let y = 128.196 + -0.196. Let b = y - p. What is b rounded to the nearest integer? -7 Suppose -5i = g + 7, -1 = -3g - 5i - 2. Let j = -1841 - -9049. Suppose -4a = -2r - ga - 14396, -r - 2a - j = 0. Round r to the nearest 1000. -7000 Let g = -145.29196043725 + 0.29195925525. Let d = g - -145. Round d to 7 dps. -0.0000012 Let a = 771 - 13. Let o be (-126)/(-26) - (-26)/169 - a. Round o to the nearest one hundred. -800 Let r = -81656 + 22450. Round r to the nearest 100. -59200 Suppose 0 = -k, 4o + 9326000 = -136k + 137k. Round o to the nearest one million. -2000000 Let t = -209 + 208.762. Let x = t + -0.457. Let n = x - -0.56. Round n to two decimal places. -0.14 Let c = -97.0582 - -97. Let s = c - 81.3418. Round s to the nearest integer. -81 Let j = 117925 - 117925.0050011. What is j rounded to four decimal places? -0.005 Suppose 2p - 4 = 0, 4i - 13477 - 8933 = 3p. Let b be (-1)/((-4)/i) + 2. Suppose 3o + b = 3563. What is o rounded to the nearest 100? 700 Let a = -312 - -293.8. Let v = -26.59 - a. What is v rounded to 1 dp? -8.4 Let a = -2531.9976284 - -2532. Round a to three dps. 0.002 Let u(i) be the third derivative of i5/60 - 17i*4/24 + 47i*3/6 - 157i*2. Let d be u(7). Round d to zero dps. -23 Let h = 38375.88962 + -0.88962. Let l = h + -38371.3629. Let i = -3.61 + l. Round i to three dps. 0.027 Suppose 2a + 31 = -3c, -3a + c = -4 + 45. Let t be (-2111)/(-3 + (-44)/a) + -3. What is t rounded to the nearest 1000? -15000 Let y = 3562.2236 + -3562. What is y rounded to two dps? 0.22 Let p = -1377911.3 - -1378669.03373. Let m = -757.7 + p. What is m rounded to three dps? 0.034 Let o = 0.066392 + -0.066356597. What is o rounded to 7 decimal places? 0.0000354 Let o = 691 - 690.99990546. Round o to five decimal places. 0.00009 Let r(s) = -5s + 33. Let u be r(6). Suppose 6x = -ux + 48150. Round x to the nearest 100. 5400 Let g = -83 - 364. Let k = g + 447.00463. Round k to 4 decimal places. 0.0046 Let j(t) = -t3 - 8t*2 - 7t. Let o be j(-7). Suppose -19n + 17n = 2m - 862392, 4n + 16 = o. What is m rounded to the nearest one hundred thousand? 400000 Let v = -0.39 + 0.27. Let y = 29.12 + v. Let s = -28.99999991 + y. Round s to 7 decimal places. 0.0000001 Let f = -0.3543 - -0.359562. Round f to four decimal places. 0.0053 Let y = 423 + -1019. Let n = y + 587.94. Let p = -51.04 + n. What is p rounded to the nearest integer? -59 Let y = -2621 + -686. Suppose -5t = 8243 - 778. Let q = y + t. What is q rounded to the nearest 1000? -5000 Let a = 73.9 - 80. Let r = 212.1 + a. Let l = -206.000322 + r. What is l rounded to four decimal places? -0.0003 Let w = -2713.19 - -2719. Round w to 0 decimal places. 6 Let i = -1.03509 + -56.87391. Let o = i + 58. Round o to one decimal place. 0.1 Let c = 14690 - 14690.087626. Round c to 3 decimal places. -0.088 Let k = 25606.304161 + -25606.2. What is k rounded to 3 dps? 0.104 Let k = 742.63 + -873.3. What is k rounded to the nearest ten? -130 Suppose -150m - 519579 = 133869 - 84648. Round m to the nearest one thousand. -4000 Let a = -14814 - -14813.85871. What is a rounded to three dps? -0.141 Let g = -0.08774 + 0.35919. Round g to three decimal places. 0.271 Let j = 3973.64 + -3991. Round j to the nearest ten. -20 Let r = 87.32 - 87.320070393. Round r to 5 dps. -0.00007 Let k = -1084864.8589 + 1084938. Let r = 73.1 - k. Round r to 3 decimal places. -0.041 Let i be 4 + 13 + -2 + 1 + -1. Let x be (1865/i + 3)9/3. Round x to the nearest 100. 400 Let c = -62755472282 + 62806123901.851. Let j = c - 50652034.85099347. Let q = 415 + j. What is q rounded to 6 dps? 0.000007 Let j = 0.15 + -0.33. Let y = j + 0.48. Let f = -0.2999929 + y. What is f rounded to six dps? 0.000007 Let t = -84.9575 - 0.0425. Let o = -28.7 - t. What is o rounded to the nearest ten? 60 Let o = -10585004 + 13557514.8. Let g = -2972489.800009 + o. Let s = -21 + g. What is s rounded to 5 dps? -0.00001 Let h = -99999.9 + 95664. What is h rounded to the nearest one hundred? -4300 Let n = 3317395.95200251 - 3317451.252. Let p = n + 55.3. What is p rounded to seven decimal places? 0.0000025 Let f be (-1)/(-7) - (2912416/(-28) - -1). Let l(p) = 1504p*3 + 4p + 6. Let k be l(-5). Let j = f + k. What is j rounded to the nearest ten thousand? -80000 Suppose -7p = -3p, 6376011 = 5s + 5p - 3746489. Round s to the nearest 100000. 2000000 Let n = -23 + 12.7. Let o = n - -7.4. Let c = 2.9179 + o. What is c rounded to three dps? 0.018 Let c = 111 + -195. Let r = -84.93 - c. Let j = r - 12.47. Round j to zero decimal places. -13 Suppose 5a - 77i - 212729998 = -78i, 2i + 4 = 0. Round a to the nearest 100000. 42500000 Let t = 29772 - 29772.034291. Round t to 4 decimal places. -0.0343 Let g(i) = 2613i2 - 9i + 11. Let d be g(-5). Let x = d + -230098. Let k = x - -24717. What is k rounded to the nearest one hundred thousand? -100000 Suppose 6n - n = 3p - 20, 5 = p. Let z be (-2 - (n - -127))/(6/(-204375)). Round z to the nearest one million. 4000000 Let w = -340.970038958 - -340.97. Round w to six dps. -0.000039 Let d = -100.5 + 99.11. Let q = -0.35 + 0.1. Let p = d - q. What is p rounded to 1 decimal place? -1.1 Let s = 453 + -453.382. Let c = -0.3665 - s. What is c rounded to two decimal places? 0.02 Let q = -1044 + 1042.122. Let z = q - -0.078. Let c = -1.824 - z. What is c rounded to 1 dp? 0 Let n(d) be the first derivative of 3d + d2 - 2400001/3d*3 + 27. Let m be n(-1). Round m to the nearest 1000000. -2000000 Let q = 0.331232 - 0.324. What is q rounded to three dps? 0.007 Let j = 233317 + -232913.666. Let g = j + -2.734. Round g to the nearest 10. 400 Suppose 0s - 4s = -3h + 84181326, -s + 28060449 = h. Suppose -h = o + 27939554. Round o to the nearest one million. -56000000 Let o = -816 + 1362. Suppose -2r = 4n - 2n - o, 2r - 268 = -n. Let b be (435 - -21)(n/3 - 1). Round b to the nearest 10000. 40000 Suppose -14 = -p - 11. Let m(k) = -k3 + 4k*2 - 2k - 1. Let a be m(p). Suppose as = 4g + s - 191995, -2s - 239990 = -5g. Round g to the nearest 10000. 50000 Let n = -37689 - -37688.63337. Round n to two decimal places. -0.37 Let q = -297 + 296.8808. Let s = 1.204 - q. Let f = s + -1.29. What is f rounded to three dps? 0.033 Let b = 618700.9023 + -619212. Let m = 395.9889 - b. Let v = m + -907. Round v to two decimal places. 0.09 Let u = 334 + -191. Let z = u - 145.03. What is z rounded to 1 decimal place? -2 Let m = 0.6101 + 69.9799. Let c = 62.171 + 8.829. Let i = c - m. What is i rounded to 1 decimal place? 0.4 Let z = -35.35 - -1285.45. Round z to the nearest 10. 1250 Let g = -0.125 + -0.705. Let w = g + 0.8300057. Round w to six decimal places. 0.000006 Let y = 455.44316 + -0.17316. What is y rounded to the nearest ten? 460 Let i = 108 - 106.08. Let w = i + -169.92. Let j = w - -168.0568. Round j to two decimal places. 0.06 Let r = -550137.106 - -550890. Let d = -753 + r. Round d to two decimal places. -0.11 Let w(v) = 2885v2 + 7v + 140. Let d be w(-20). What is d rounded to the nearest 100000? 1200000 Let a = -427.6995 + 440. Let l = a - 12.3. What is l rounded to 4 dps? 0.0005 Let m(c) = -c + 16. Let q = -242 - -248. Let h be m(q). What is h rounded to the nearest 10? 10 Suppose -1471043707 - 5092006293 = 65n. Round n to the nearest one million. -101000000 Let x(f) = 57f + 34. Let z be x(9). Suppose z = -10j - 333. What is j rounded to the nearest 10? -90 Let u = 710.355253 + -10.411953. Let w = u + -700. Round w to two decimal places. -0.06 Let a(v) = -3v*3 - 7v*2 + 19v + 52. Let d be a(-8). Round d to the nearest 1000. 1000 Let k = -1.78 + 40.88. Let d = k + -38.525. What is d rounded to two dps? 0.58 Let r be (-56)/8 + (-2)/(-1). Let a(q) = -q*3 - 4q*2 + 2q - 12. Let u be a(r). Let p be -5 + 3 - u - 237. Round p to the nearest ten. -240 Let h = -23805.0000050915 + 23805. What is h rounded to 7 dps? -0.0000051 Let x = -7471 - -6710.6. What is x rounded to the nearest 10? -760 Let l = 2955 + -2956.0738. What is l rounded to 2 dps? -1.07	{ "pile_set_name": "DM Mathematics" }
- 2k4/3 + 2k*3/3 + 4k*2/3 - 8k/3 + 3. Find w, given that n(w) = 0. -1, 1, 2 Let r = -440/3 - -148. Let p(z) be the first derivative of -1 + 2/3z3 - 1/3z*2 - rz. Find u, given that p(u) = 0. -2/3, 1 Let y(w) be the first derivative of -w*3 - 3w*2 - 2. Solve y(x) = 0. -2, 0 Let s(y) = 10y*2 - 18y - 6. Let d(j) = -10j2 + 19j + 5. Let f(i) = -2d(i) - 3s(i). Determine h so that f(h) = 0. -2/5, 2 Let c be (56/9 - 1) + (7 - 12). Factor -8/9u2 + 0 - 16/9u*3 - 10/9u*4 + 0u - cu5. -2u*2(u + 1)(u + 2)2/9 Let g(u) = -u3 - 6u*2 - 3u + 3. Let j be g(-6). Let v be j/(-27)(-4 - -1). Find t, given that 7/3t - vt3 + 2/3 - 2/3t*2 = 0. -1, -2/7, 1 Suppose 3l = -o - o + 4, o = -1. Let i(y) be the second derivative of y - 1/3y3 + 1/6y*4 + 0 - ly*2. Solve i(c) = 0 for c. -1, 2 Let o be 4/(-160)194-4. Let k = o - 19. Let 6/5y*2 + 6/5y + 2/5y3 + k = 0. Calculate y. -1 Let q = 16 - 10. Factor 7i*4 + 0i2 + i3 + 0i4 - qi4 - i5 - i2. -i2(i - 1)2(i + 1) Let l(o) = -o + 2. Let m be l(-2). Suppose 2/3i3 + 1/3i*m + 1/3i*2 + 0 + 0i = 0. What is i? -1, 0 Let f = -26 - -30. Let x(u) be the first derivative of -1/6u3 + 0u - 1/16uf - 2 - 1/8u*2. Factor x(v). -v(v + 1)*2/4 Factor -1/2t*2 + 1/2t*4 + 0t*3 + 0t + 0. t*2(t - 1)(t + 1)/2 Let l(f) be the first derivative of f5/20 + 13f*4/60 + 2f*3/15 - 2f*2/5 + 3f - 4. Let k(g) be the first derivative of l(g). Find m such that k(m) = 0. -2, -1, 2/5 Let s(t) = -5t - 13. Let c be s(-3). Factor 4/7 + 10/7f*2 + cf. 2(f + 1)(5f + 2)/7 Solve -1/4o*3 + 0 + 0o*2 + 0o = 0 for o. 0 Let s(k) be the third derivative of -k*5/12 - 5k*4/24 + 29k*2. What is w in s(w) = 0? -1, 0 Let o(w) be the third derivative of -3w*2 - 1/48w*5 - 1/12w*4 + 1/6w*3 + 0 + 0w. Let o(j) = 0. What is j? -2, 2/5 Let k(g) be the second derivative of 2g6/45 + 2g*5/15 - 4g*3/9 - 2g*2/3 + 28g. Factor k(a). 4(a - 1)(a + 1)*3/3 Let a(r) be the first derivative of 2/3r*3 + 0r*2 + 6 + 1/5r*5 + 0r - 3/4r4. Determine i, given that a(i) = 0. 0, 1, 2 Let c = -2/275 - -829/550. Determine i so that -ci*2 - i - 1/4 - 1/4i4 - i3 = 0. -1 Let y(g) be the second derivative of -g*4/48 + 5g*3/24 + 3g*2/4 - 5g. Factor y(d). -(d - 6)(d + 1)/4 Let c(q) = -q3 - q2 - 3q - 2. Let v be c(-2). Let a be (-100)/(-126) - v/36. Factor -a + 2/7y + 4/7y*2 - 2/7y*3. -2(y - 2)(y - 1)(y + 1)/7 Let c = 15 - 12. Factor 0 + 0t + 2/5t*4 - 4/5t*c + 0t*2. 2t*3(t - 2)/5 Let x(t) be the first derivative of 8 + 0t - 1/9t*2 + 1/27t*3. Factor x(c). c(c - 2)/9 Let z(y) = -y*3 - 7y2 + 3. Let t(s) = -s3 - s*2 + 1. Let q(j) = -3t(j) + z(j). Factor q(h). 2h2(h - 2) Let m be ((-200)/(-24))/(1/3). Suppose 2f + 3f = m. Solve -1/4w3 + 0w + 0w2 - 1/4w*f + 1/2w4 + 0 = 0 for w. 0, 1 Let v(y) be the first derivative of y3/7 + 3y2/14 - 18y/7 + 19. Factor v(o). 3(o - 2)(o + 3)/7 Suppose 7d + 4h - 8 = 6d, -4h = -8. Let 1/3m5 - 1/3m*3 + dm*2 + 0 + 0m + 0m4 = 0. Calculate m. -1, 0, 1 Let p(z) = -z - 3. Let c be 1/(((-4)/(-5))/(-4)). Let f be p(c). Find q, given that 1/2q - 1/2qf + 0 = 0. 0, 1 Let k(j) = -5j*2 + 6j - 3. Let a(x) = -x*2 - 1. Let d(g) = 3a(g) - k(g). What is z in d(z) = 0? 0, 3 Suppose 0 = -4q - 0q + 12. Suppose -4 = f - qf. Factor 6j*4 + 9j*4 - 3 - 6j*f - 12j*3 - 6j*4 + 12j. 3(j - 1)2(j + 1)(3j - 1) Let t = 1 + 3. Let c be t + 3 + -2 + -2. Factor q*2 + 4q*2 - 4q - 2qc + 2 + 0 - 1. -(q - 1)2(2q - 1) Let z(k) = -5k*2 + 26k - 45. Let n(h) = -5h2 + 27h - 45. Let c(d) = -4n(d) + 3z(d). Determine w so that c(w) = 0. 3 Let g be ((-15)/10)/(6/(-8)). Let j be 5 - 3/(3/g). Factor -5a3 + a + a5 + 3a*3 + 0a*j. a(a - 1)*2(a + 1)2 Let a(y) be the second derivative of -y7/42 + 2y6/15 - 3y5/10 + y4/3 - y*3/6 - 4y. Factor a(j). -j(j - 1)4 Let b(q) be the first derivative of q3/9 - q2/6 - 2q/3 - 22. Find d, given that b(d) = 0. -1, 2 Let b(o) be the second derivative of 5o4/12 + 5o*3/2 + 5o*2 + 30o. Factor b(h). 5(h + 1)(h + 2) Let r(f) be the first derivative of f*7/63 + 2f6/45 - f5/10 - 2f4/9 + 4f*3/9 + 9f + 4. Let q(l) be the first derivative of r(l). Factor q(p). 2p(p - 1)*2(p + 2)2/3 Let f(d) be the third derivative of -d8/10080 - d7/1260 - d6/360 - d*5/15 - 3d*2. Let x(k) be the third derivative of f(k). Factor x(p). -2(p + 1)*2 Let n = 451 - 4055/9. Factor -10/9f - 4/9 + 10/9f3 + nf*2. 2(f - 1)(f + 1)(5f + 2)/9 Let v(d) = d3 - 14d*2 + 13d + 2. Let t be v(13). Let o(m) be the first derivative of m*t + 1 - 2/3m*3 + 2/5m*5 + 0m - 1/2m4. Factor o(f). 2f(f - 1)2(f + 1) Let q be 3/(2 - (0 + 1)). Determine a, given that 2 - qa3 + a + a2 - 3 + 2a*3 = 0. -1, 1 Let w = -71 + 74. Find z such that 2z*w + 11/2z + 1 + 13/2z2 = 0. -2, -1, -1/4 Let y(v) be the second derivative of v4/16 - v3/4 + 3v*2/8 - 5v - 6. Factor y(o). 3(o - 1)2/4 Let q be (-7)/60(-26)/637. Let r(a) be the third derivative of 0a3 + 0 + 0a + a*2 + 0a*4 + 0a*6 + qa*7 - 1/60a*5. Suppose r(g) = 0. Calculate g. -1, 0, 1 Let i(w) be the second derivative of 3w*5/5 + 5w4/12 - w3/3 + 3w. Let i(l) = 0. What is l? -2/3, 0, 1/4 Suppose 0 = -2z + 5 + 9. Let t = z + -11. Let a(c) = 5c2 - 4c. Let i(r) = 6r2 - 5r. Let q(p) = ti(p) + 5a(p). Factor q(w). w2 Let w(c) be the second derivative of -c10/45360 + c8/5040 - c6/1080 + c*4/12 - 2c. Let j(i) be the third derivative of w(i). Let j(s) = 0. Calculate s. -1, 0, 1 Let t(q) = 49q4 - 64q*3 + 20q*2 + 4q - 4. Let y(x) = 50x4 - 65x*3 + 20x*2 + 5x - 5. Let o(u) = -5t(u) + 4y(u). Factor o(r). -5r2(3r - 2)2 Let b(u) be the first derivative of -1/9u*2 - 4/9u + 1 + 2/9u3. Determine t so that b(t) = 0. -2/3, 1 Let f be -135/405-3. Let h(x) be the first derivative of -1/6x2 + 0x + 3 - fx3 + 1/15x*5 + 1/12x4. Solve h(n) = 0 for n. -1, 0, 1 Let s(l) be the third derivative of -l7/280 - l6/160 + l5/80 + l*4/32 - 4l*2. Factor s(a). -3a(a - 1)(a + 1)*2/4 Let x be 44/5 - 8 - 2-2. Factor xq + 21/5q*3 - 57/5q*2 + 12/5. 3(q - 2)(q - 1)(7q + 2)/5 Let o(a) be the second derivative of -a6/10 + 3a*5/20 + 3a*4/4 - 5a*3/2 + 3a*2 + 4a. Factor o(c). -3(c - 1)3(c + 2) Suppose -2s + 9 = -5j, 5j + 0j + 15 = 5s. Factor -3ps - p3 - p*2 + 3p2. -p2(p + 1) Determine h, given that 0 - h4 - 1/3h*3 + 2/3h + h*2 - 1/3h5 = 0. -2, -1, 0, 1 Let u(l) be the third derivative of -l6/150 + l5/25 - l4/15 - 5l2. Find q, given that u(q) = 0. 0, 1, 2 Let t(n) = -n3 + 11n*2 + 12n. Let o be t(12). Factor 1/2y2 - 1/2y + o. y(y - 1)/2 Let h(l) be the first derivative of -l4/34 - 4l*3/51 + 3l2/17 - 25. What is y in h(y) = 0? -3, 0, 1 Let m(c) be the third derivative of c8/10080 - c*6/2160 + 2c*3/3 + 4c*2. Let q(a) be the first derivative of m(a). Determine p so that q(p) = 0. -1, 0, 1 Suppose -3p = q + 2q + 9, 3p - 4q = 26. Suppose -3s = ps - 15. Factor -3j*2 + 6j2 + js - 3j2 - j. j(j - 1)(j + 1) Let i be (-1)/212/(-2). Let t(o) be the third derivative of -o*2 + 0o*i - 1/300o*6 + 0o + 1/60o4 + 0o*5 + 0. Suppose t(f) = 0. What is f? -1, 0, 1 Let n = -276/5 + 2007/35. Let t = -31/21 + n. Factor 0 + 4/3i*3 - 2/3i*2 + 0i - ti4. -2i*2(i - 1)*2/3 Let k be ((-3)/3 - 0)-3. Let v(q) be the first derivative of 4/3q - 14/3q*2 + 1 + 49/9q*k. Factor v(i). (7i - 2)*2/3 Suppose -4b + 0 = -8. Factor 2u3 - 12u*4 + 2u*2 - bu5 + u3 + 2u5 + 7u5. u2(u - 1)2(7u + 2) Let j = 46 - 12. Factor -26 - 6w - 38 + 4w - 4w*2 + jw. -4(w - 4)2 Let q(j) be the third derivative of -j6/780 - j5/390 + j4/156 + j3/39 + 26j*2. Solve q(m) = 0 for m. -1, 1 What is l in -2/3l*3 + 4/3 + 1/3l4 - l2 + 4/3l = 0? -1, 2 Determine y so that 67/5y*3 - 108/5 - 13/5y*4 + 1/5y*5 - 171/5y*2 + 216/5y = 0. 2, 3 Suppose 0j - 12 = -6j. Let x(t) be the third derivative of 0 - 1/30t5 - jt*2 + 0t*3 + 0t - 1/60t*6 + 1	{ "pile_set_name": "DM Mathematics" }
n divisor of 6171 and 1215687? 6171 Calculate the highest common factor of 2196 and 31859019. 549 What is the highest common divisor of 2035 and 377474? 37 What is the highest common divisor of 20 and 30422060? 20 Calculate the greatest common factor of 48 and 389458720. 16 Calculate the highest common divisor of 263039 and 2385. 53 Calculate the highest common divisor of 65843131 and 157. 157 Calculate the greatest common divisor of 4343 and 79937. 43 Calculate the highest common divisor of 250880 and 68608. 1024 What is the highest common divisor of 5451051 and 6? 3 Calculate the greatest common divisor of 5034 and 1386028. 1678 What is the highest common divisor of 1539783 and 81? 27 What is the greatest common factor of 2200 and 4203400? 200 Calculate the greatest common factor of 41465964 and 6072. 276 What is the greatest common factor of 144276755 and 38360? 4795 Calculate the greatest common divisor of 2295571 and 9784. 1223 What is the greatest common divisor of 109500 and 1022? 146 Calculate the greatest common factor of 9625000 and 381150. 3850 Calculate the highest common factor of 243024 and 4301232. 2928 What is the greatest common divisor of 42536205 and 6? 3 Calculate the greatest common factor of 743586 and 5868. 6 Calculate the highest common divisor of 6006 and 107318211. 3003 Calculate the greatest common divisor of 98166325 and 993. 331 What is the highest common factor of 5847958 and 29257? 1721 Calculate the greatest common divisor of 12176497 and 33431. 331 Calculate the greatest common divisor of 5530153 and 899635. 1487 What is the highest common divisor of 52 and 210337868? 52 What is the greatest common factor of 7 and 766648? 1 What is the greatest common divisor of 6902570 and 15515? 535 What is the highest common divisor of 6012 and 2696048? 668 What is the greatest common divisor of 152 and 143947268? 76 What is the greatest common factor of 4205289 and 1444? 361 What is the highest common factor of 144 and 634716? 36 Calculate the highest common divisor of 65096 and 261311. 103 Calculate the highest common divisor of 605964 and 39. 3 Calculate the greatest common factor of 3519494 and 275. 11 What is the highest common divisor of 14262 and 182986214? 4754 Calculate the greatest common divisor of 519274745 and 17655. 5885 What is the greatest common divisor of 458420833 and 26? 13 What is the highest common divisor of 1157 and 265794139? 1157 Calculate the highest common divisor of 23837 and 5742. 11 What is the greatest common divisor of 175959 and 240639? 147 Calculate the highest common factor of 1420 and 251900. 20 Calculate the highest common divisor of 1440 and 2874160. 80 What is the greatest common divisor of 443211 and 33? 3 Calculate the greatest common factor of 44295546 and 139046. 3758 Calculate the greatest common divisor of 83350175 and 50. 25 Calculate the highest common factor of 79357481 and 497. 497 Calculate the greatest common factor of 316 and 1670771. 79 What is the greatest common divisor of 18101324 and 13128? 2188 Calculate the greatest common factor of 271835125 and 29000. 3625 What is the greatest common factor of 1379 and 351335119? 197 Calculate the highest common factor of 51423 and 169443. 843 What is the greatest common factor of 485087 and 8131? 47 Calculate the highest common divisor of 3831740 and 3740. 220 What is the greatest common divisor of 119246 and 53606? 1094 What is the highest common factor of 10330434 and 5842? 254 What is the highest common factor of 685 and 19473865? 685 Calculate the greatest common factor of 101694 and 650454. 102 What is the greatest common divisor of 4601 and 16531049? 43 What is the greatest common divisor of 6660 and 44638650? 3330 Calculate the greatest common factor of 2322 and 159983220. 258 Calculate the greatest common factor of 314 and 37539485. 157 Calculate the highest common factor of 17395 and 136175515. 2485 What is the greatest common divisor of 12669283 and 88? 11 Calculate the highest common factor of 164187 and 29919. 3 What is the greatest common factor of 273 and 135354072? 21 Calculate the greatest common divisor of 2756 and 481676. 52 What is the greatest common factor of 137 and 44035499? 137 What is the greatest common factor of 10746 and 147456? 18 Calculate the highest common factor of 2174 and 36100357. 1087 Calculate the greatest common factor of 1664556 and 20128. 148 What is the highest common factor of 9796 and 53? 1 What is the highest common divisor of 177762 and 19875? 159 What is the greatest common divisor of 16 and 56015264? 16 What is the greatest common divisor of 587 and 28876291? 587 Calculate the greatest common factor of 809 and 44020117. 809 What is the greatest common factor of 129583 and 25654? 101 Calculate the highest common factor of 16375794 and 887. 887 What is the greatest common divisor of 3480 and 51794? 58 What is the highest common factor of 97 and 531277924? 97 What is the greatest common divisor of 1308 and 26737488? 12 What is the highest common divisor of 3295 and 771108421? 659 Calculate the greatest common divisor of 8950697 and 21. 7 Calculate the highest common factor of 727936 and 59104. 32 What is the greatest common factor of 1620 and 32950? 10 Calculate the greatest common divisor of 1308207 and 487635. 3363 Calculate the greatest common factor of 2716 and 12108607. 679 What is the greatest common divisor of 496 and 46820912? 496 What is the greatest common factor of 230480 and 1111980? 860 Calculate the highest common factor of 330 and 249670. 10 What is the greatest common factor of 24961760 and 160? 160 What is the greatest common divisor of 14940 and 250660? 1660 What is the highest common factor of 51261705 and 58? 29 What is the greatest common divisor of 1503631 and 33439? 281 Calculate the greatest common factor of 550547 and 140925. 1879 Calculate the highest common divisor of 18921056 and 9702. 1078 Calculate the highest common divisor of 7785 and 13067955. 45 Calculate the highest common factor of 269 and 33181150. 269 Calculate the greatest common factor of 53590 and 37228973. 5359 What is the greatest common factor of 63921 and 103818? 429 What is the highest common divisor of 120091675 and 3100? 775 What is the highest common divisor of 3712 and 574606? 58 Calculate the highest common factor of 38144 and 725034. 298 What is the highest common divisor of 3221930 and 370? 10 Calculate the highest common factor of 776 and 68396. 4 What is the greatest common factor of 5248570 and 4610? 10 Calculate the highest common divisor of 1311724 and 71928. 148 Calculate the greatest common divisor of 33341346 and 161226. 954 What is the greatest common divisor of 274791 and 10527? 363 Calculate the highest common divisor of 31275 and 25500. 75 Calculate the highest common divisor of 290 and 112352960. 290 Calculate the greatest common factor of 1190096748 and 3144. 1572 What is the greatest common divisor of 799 and 16189949? 47 What is the greatest common factor of 4055125 and 250? 125 What is the highest common factor of 18 and 2465874? 18 Calculate the highest common divisor of 2 and 4559649. 1 Calculate the highest common factor of 7685368 and 984. 328 Calculate the greatest common divisor of 49579206 and 1977. 1977 Calculate the greatest common factor of 21965202 and 378. 378 Calculate the greatest common divisor of 21 and 56230188. 21 Calculate the highest common factor of 5622 and 125852218. 1874 What is the greatest common divisor of 30684417 and 3? 3 What is the highest common divisor of 2030 and 399529984? 406 Calculate the greatest common factor of 29757 and 118739586. 2289 Calculate the greatest common divisor of 14456 and 98744. 8 What is the greatest common divisor of 46164550 and 885? 295 What is the greatest common factor of 696895 and 498020? 185 What is the greatest common divisor of 8213722 and 3146? 242 What is the greatest common divisor of 1926477 and 21? 21 What is the greatest common factor of 756010 and 4255? 115 What is the highest common divisor of 67424 and 60466? 98 What is the greatest common divisor of 139890792 and 24? 24 Calculate the highest common divisor of 48456 and 139032. 72 What is the greatest common factor of 1685476 and 923? 13	{ "pile_set_name": "DM Mathematics" }
-25 in ascending order. -28, -25, 0, 3, 115 Put 3/11, -3, -1892 in decreasing order. 3/11, -3, -1892 Put -1, 4, -765, 15, -3 in increasing order. -765, -3, -1, 4, 15 Put 2, -4/9, -7, 0, -20.5 in descending order. 2, 0, -4/9, -7, -20.5 Put 269, -294, 20 in decreasing order. 269, 20, -294 Sort -32, 619, 2, -1, 3, -2 in descending order. 619, 3, 2, -1, -2, -32 Sort 19179, 1/5, -2. -2, 1/5, 19179 Sort 4, -0.3, -0.1, 144, -76 in increasing order. -76, -0.3, -0.1, 4, 144 Sort -5, -0.1, -10, 3, -201 in decreasing order. 3, -0.1, -5, -10, -201 Sort -0.2, 3/22, 0.303, -2/21 in descending order. 0.303, 3/22, -2/21, -0.2 Sort 1, -3, 2, -5672, -5. -5672, -5, -3, 1, 2 Sort -2, -1, -70, 2, -11 in increasing order. -70, -11, -2, -1, 2 Put 0, -35, -75, -15 in descending order. 0, -15, -35, -75 Sort 2, -13, -7, 8 in decreasing order. 8, 2, -7, -13 Sort 3, 17, 2, -49. -49, 2, 3, 17 Sort -19, -15, 2, -16 in descending order. 2, -15, -16, -19 Sort -5, 2/3, 0.5, -631, -7, -1 in increasing order. -631, -7, -5, -1, 0.5, 2/3 Sort -5, 1183, 5, -4, 2, 14. -5, -4, 2, 5, 14, 1183 Sort -85, 7, -3, 114, -2. -85, -3, -2, 7, 114 Sort 2, 64, 0.3, 1, 2/3 in descending order. 64, 2, 1, 2/3, 0.3 Sort 10, -60, 2, 7. -60, 2, 7, 10 Sort -238, 1, 7, 1/5, -0.04, 0.4 in descending order. 7, 1, 0.4, 1/5, -0.04, -238 Sort 15/7, -1, 13/94, -1/2. -1, -1/2, 13/94, 15/7 Put 8, 5, 3, -89, 2, -1 in ascending order. -89, -1, 2, 3, 5, 8 Sort 4, 3, -37, -5, -44 in descending order. 4, 3, -5, -37, -44 Sort -1.448, 2, 1 in decreasing order. 2, 1, -1.448 Sort -1, -3, 5, -69 in descending order. 5, -1, -3, -69 Sort -2, 4, -141, 1, -1 in decreasing order. 4, 1, -1, -2, -141 Put -6/25, 2/29, -3, -1, 4 in descending order. 4, 2/29, -6/25, -1, -3 Put 15, 4, 5, -25 in decreasing order. 15, 5, 4, -25 Sort -0.062, -5, -356.6 in descending order. -0.062, -5, -356.6 Sort -4, -2/11, 1/10, 1/6, -5, 74/5. -5, -4, -2/11, 1/10, 1/6, 74/5 Sort 6, 5, -727, -13 in decreasing order. 6, 5, -13, -727 Sort -4, -1660, -12, 3 in ascending order. -1660, -12, -4, 3 Sort 2, -54651, -10 in decreasing order. 2, -10, -54651 Sort 166/7, 0.2, -5/2, -1/4, -1 in ascending order. -5/2, -1, -1/4, 0.2, 166/7 Sort 2, 1, 20214, -3/2 in decreasing order. 20214, 2, 1, -3/2 Sort 2/25, 11, 4/9, -1/8 in descending order. 11, 4/9, 2/25, -1/8 Sort 18, 2070, 1, 0 in decreasing order. 2070, 18, 1, 0 Sort 0.158, -0.039, -4/7, 0.1, 10 in ascending order. -4/7, -0.039, 0.1, 0.158, 10 Sort 4/7, 2/113, 7 in descending order. 7, 4/7, 2/113 Put -65, -270, 1, 5, -5 in descending order. 5, 1, -5, -65, -270 Sort -1, -194974, -3, 4 in decreasing order. 4, -1, -3, -194974 Sort 9, -4/9, -1, 5, 0.06 in decreasing order. 9, 5, 0.06, -4/9, -1 Sort -9406, -2, 4. -9406, -2, 4 Sort 3, -460, -2/15, 5 in descending order. 5, 3, -2/15, -460 Sort -4, -319, -9, 3, 2, -3 in increasing order. -319, -9, -4, -3, 2, 3 Put -2, 1, 5, 4, 0, 487 in decreasing order. 487, 5, 4, 1, 0, -2 Sort 3/5, 7.07, -2 in decreasing order. 7.07, 3/5, -2 Put -1, -2, -3, 286, -4 in increasing order. -4, -3, -2, -1, 286 Sort 127, 3, -12, 0.3 in decreasing order. 127, 3, 0.3, -12 Sort -632, 9, 1, -24, 0 in decreasing order. 9, 1, 0, -24, -632 Put -4, -3620332, 0 in increasing order. -3620332, -4, 0 Put -11129, -7, 5 in decreasing order. 5, -7, -11129 Sort -4/5, 19316, 7 in increasing order. -4/5, 7, 19316 Sort 0.92, 0, 235/2, 3 in ascending order. 0, 0.92, 3, 235/2 Put 63, 2, 5, -522 in descending order. 63, 5, 2, -522 Sort -5/8, 76/23, 0.08 in descending order. 76/23, 0.08, -5/8 Sort 3, 919, 84. 3, 84, 919 Put 3, 4, 20, 1, -13 in descending order. 20, 4, 3, 1, -13 Sort 147, 0, 29 in decreasing order. 147, 29, 0 Put 26, 17, -422 in decreasing order. 26, 17, -422 Put 5, -2, -1924, 0, -5 in increasing order. -1924, -5, -2, 0, 5 Sort -4, -18, -399, -3, 4, 0 in ascending order. -399, -18, -4, -3, 0, 4 Put 8, -18, 2, -23, 5 in increasing order. -23, -18, 2, 5, 8 Sort 1, -1.51, -287, 0.3. -287, -1.51, 0.3, 1 Sort 12, 60, -8, -3, 5, 2 in descending order. 60, 12, 5, 2, -3, -8 Sort 12, 5, 3.113, -6, 1 in decreasing order. 12, 5, 3.113, 1, -6 Sort -2, -4, 4, 19811. -4, -2, 4, 19811 Put -18, 4715, 4 in decreasing order. 4715, 4, -18 Sort 11, -5, -6, -47 in decreasing order. 11, -5, -6, -47 Sort 5, 412, 1, 6 in decreasing order. 412, 6, 5, 1 Sort 2, -1, -2, -4051, -3 in decreasing order. 2, -1, -2, -3, -4051 Put -9, 1/4, 2/9, -1/4, 22.1 in descending order. 22.1, 1/4, 2/9, -1/4, -9 Put 3, -3, -4, 2, -104 in descending order. 3, 2, -3, -4, -104 Sort 0.3, -2, -3030, 4, -9. -3030, -9, -2, 0.3, 4 Put 0, -8846, -4 in ascending order. -8846, -4, 0 Put -2, 16, 3, 446, 5, -5 in decreasing order. 446, 16, 5, 3, -2, -5 Put -3/8, -5, -4, 0.1, 1/6101 in decreasing order. 0.1, 1/6101, -3/8, -4, -5 Put -5, -4, -1355 in descending order. -4, -5, -1355 Put 5, 0, 4/31, -1/7, -9.9 in increasing order. -9.9, -1/7, 0, 4/31, 5 Sort 136, 2, -4, -5, 0.7 in decreasing order. 136, 2, 0.7, -4, -5 Put 2, 7, 1626 in decreasing order. 1626, 7, 2 Put 0.4, -0.4, 57, 1076 in ascending order. -0.4, 0.4, 57, 1076 Put 65, 13, -15, 0 in increasing order. -15, 0, 13, 65 Sort -5, 4, 3358, -4/7, -3, 0.5 in ascending order. -5, -3, -4/7, 0.5, 4, 3358 Sort 2, 6, -0.5, 64/9, 4/5 in ascending order. -0.5, 4/5, 2, 6, 64/9 Sort 1, -12, 56, 12. -12, 1, 12, 56 Sort -0.03, -1, 0.5, -0.1, 0.0075. -1, -0.1, -0.03, 0.0075, 0.5 Sort 1/2, 104, -2, -10 in increasing order. -10, -2, 1/2, 104 Sort -5, 0.075, -9, 0.05. -9, -5, 0.05, 0.075 Sort 2, 3, 4, -37369, -2 in increasing order. -37369, -2, 2, 3, 4 Put -0.2, -1103, 5, -46 in decreasing order. 5, -0.2, -46, -1103 Put -11.7, 12, 26, -5 in decreasing order. 26, 12, -5, -11.7 Sort 2, -5, -1, -5/116 in descending order. 2, -5/116, -1, -5 Put 5, -1/5, 2, 0.5, 0.134, -4 in increasing order. -4, -1/5, 0.134, 0.5, 2, 5 Put 2, 21429, 9 in descending order. 21429, 9, 2 Put 2.44, -1/3, 18, -2 in increasing order. -2, -1/3, 2.44, 18 Sort -18, -5, -3, 2, 0.1, 28 in increasing order. -18, -5, -3, 0.1, 2, 28 Sort -0.1, -34, -2, 2/11. -34, -2, -0.1, 2/11 Put -3, 3, -1, 35206, -5 in ascending order. -5, -3, -1, 3, 35206 Put -5, 3, 255, 9 in decreasing order. 255, 9, 3, -5 Put -598, -39, 4, -1, 3 in increasing order. -598, -39, -1, 3, 4 Put 3/7, -0.5, 0.003, -1/13 in descending order. 3/7, 0.003, -1/13, -0.5 Sort -1, 1, -11, 2, 238 in descending order. 238, 2, 1, -1, -11 Sort 17, 4, -7, -3 in increasing order. -7, -3, 4, 17 Sort -35, 11391, 2 in decreasing order. 11391, 2, -35 Sort 4, 0.3, 108, -1/64 in decreasing order. 108, 4, 0.3, -1/64 Put -0.5, 3, -354/7, -1/3, -4 in increasing order. -354/7, -4, -0.5, -1/3, 3 Sort 5, -21, -126, -5. -126, -21, -5, 5 Put 1, -30179, -38 in decreasing order. 1, -38, -30179 Put -4/3, 0.1, -0.7, -1, 2, -0.11 in decreasing order. 2, 0.1, -0.11, -0.7, -1, -4/3 Sort 28, 0.31, -77 in decreasing order. 28, 0.31, -77 Put -4, 1, -1, -5119 in decreasing order. 1, -1, -4, -5119 Put -2, -4, -19, -8, -5, -117 in ascending order. -117, -19, -8, -5, -4, -2 Put -4, -1057, 3, 5, -8 in ascending order. -1057, -8, -4, 3, 5 Put 718, -2/3, -6, 7, 0.4, -2 in descending order. 718, 7, 0.4, -2/3, -2, -6 Sort -0.2, -717, -0.3, 0.48, 0.3, 0 in increasing order. -717, -0.3, -0.2, 0, 0.3, 0.48 Put 11, 51, -2, -9 in descending order. 51, 11, -2, -9 Sort 6, -3093, -4, -5. -3093, -5, -4, 6 Sort -2/7, 5, -3.61, -13.2, -0.5 in increasing order. -13.2, -3.61, -0.5, -2/7, 5 Put -339, -2, -4/7, 2/7, 19 in descending order. 19, 2/7, -4/7, -2, -339 Put -2, 4, 1, -388, -3, 0 in increasing order. -388, -3, -2, 0, 1, 4 Put 1, -3/16, 6.94, 0, -0.2 in decreasing order. 6.94, 1, 0, -3/16, -0.2 Sort 33, 2, 6431 in increasing order. 2, 33, 6431 Put -1/11, 2, 1, 0, -2022 in descending order. 2, 1, 0, -1/11, -2022 Put 0, 3, -0.3, -0.4, 0.4, -1.1 in ascending order. -1.1, -0.4, -0.3, 0, 0.4, 3 Sort 2, -364467, -5, 3 in increasing order. -364467, -5, 2, 3 Sort 61, 1619/6, -0.2. -0.2, 61, 1619/6 Put 5, 517, -152 in ascending order. -152, 5, 517 Put 8, 4607, 1, -7 in descending order. 4607, 8, 1, -7 Put 14, 3, 271, -2, 5 in descending order. 271, 14, 5, 3, -2 Put 5, 10, -1232 in ascending order. -1232, 5, 10 Put 0.09, -2/11, 58502 in ascending order. -2/11, 0.09, 58502 Put 87, 3, -2, 59, 0.5 in descending order. 87, 59, 3, 0.5, -2 Sort	{ "pile_set_name": "DM Mathematics" }
? 12 Let i(x) = -10x3 + 2x*2 - 31. Let n(j) = 8j*3 - 2j*2 + 32. Let v(z) = -7i(z) - 6n(z). Find the third derivative of v(g) wrt g. 132 Suppose -2d + 1 = -3. What is the third derivative of j*d - 7j*5 + 7j*5 + 3j*5 wrt j? 180j*2 Let z(q) be the second derivative of -4q*5/5 + 13q*2/2 - 9q. Find the first derivative of z(c) wrt c. -48c2 Let r(u) = -u + 1. Let s(l) be the first derivative of -l3 - 5l*2/2 + 4l - 4. Let m(z) = 4r(z) - s(z). What is the second derivative of m(x) wrt x? 6 Let u(i) be the third derivative of 7i6/60 + i3 - 13i2. What is the derivative of u(l) wrt l? 42l*2 Let d be (1 - -3 - 0) + -3 + -1. Let k(j) be the third derivative of d + 4j*2 - 1/12j*4 - 1/3j*3 + 0j. Differentiate k(b) wrt b. -2 Let z(n) = n*2 + 14n + 3. Let k be z(-14). Let u be 2/3 + (-12)/(-9). Find the first derivative of -k - r + r + ur + 0r wrt r. 2 Let w(s) be the second derivative of -s*4/3 - 19s*2/2 + 3s. Find the first derivative of w(q) wrt q. -8q Let z(m) be the second derivative of 5m*4/12 - 2m*2 + 21m. Differentiate z(y) wrt y. 10y Let x(s) = 85s - 175. Let l(p) = -21p + 44. Let o(y) = 15l(y) + 4x(y). What is the derivative of o(n) wrt n? 25 Suppose j - 5j + 19 = -3d, 3d = -3j - 12. Let u be -1 + d/((-10)/8). What is the derivative of ub4 - 1 + 2 - b4 wrt b? 8b3 Let g(w) be the second derivative of -4w*3 - 8w*2 + 7w - 3. Find the first derivative of g(q) wrt q. -24 Let w(v) be the first derivative of 4 + 0v3 + 0v*4 - 6v + 0v2 - 2/5v*5. Differentiate w(m) wrt m. -8m3 Find the first derivative of -l4 - 8l4 + 3l*4 + 27 wrt l. -24l*3 Differentiate 3b*3 - 3b*3 - 6b*3 - 13 - 6b*3 with respect to b. -36b2 Let r(v) be the first derivative of v4/2 + 2v3/3 + 17v*2/2 - 31. What is the second derivative of r(y) wrt y? 12y + 4 Let u = -2 - -4. Differentiate 0 + g*2 + 1 - 4 + 3g*u with respect to g. 8g Let t be 1/(8/7 - 1). Let v(u) = 3u - 3. Let g be v(2). Find the third derivative of -2b*2 + t - 7 + 2b*g wrt b. 12 Let g be (-82)/6 - 1/3. Let h be (-4)/g + (-2)/7. Find the second derivative of 3j*5 + hj + 2j - 2j*5 wrt j. 20j*3 Let w = 0 - 6. Let j be (-8)/1421/w. Find the third derivative of -2p2 + 0p*2 + jp6 + p2 wrt p. 240p3 Let u(o) = -o3 + o2 + o - 1. Let a(q) = 10 + 0q*3 - 4 - 9q - 9q2 + 12q*3. Let x(l) = a(l) + 9u(l). Find the first derivative of x(y) wrt y. 9y2 Let r = -5 + 4. Let l(f) = 6f*2 + 2f + 1. Let a be l(r). Find the second derivative of 0ca - c - 3c*5 + 0c - 2c wrt c. -60c3 Let w(o) = -o3 + o. Let t(h) = -13h4 - h3 - 29h. Let r(c) = -t(c) + w(c). Find the second derivative of r(z) wrt z. 156z2 Let f(i) be the third derivative of -5i*2 - 2/105i*7 + 1/20i*5 + 0 + 0i*4 + 0i + 0i3 + 0i*6. What is the third derivative of f(x) wrt x? -96x What is the second derivative of -10m5 + 8m5 - m5 + m wrt m? -60m3 Let i(j) = j - 6. Let d be i(6). What is the third derivative of n2 - 3n*2 + dn*4 - 3n*4 + 2n*4 wrt n? -24n Let x(f) be the second derivative of -f8/1680 + f5/40 - f*4/3 - f. Let j(h) be the third derivative of x(h). What is the first derivative of j(a) wrt a? -12a*2 Suppose -22 = -5a - 2i, 5i - 5 + 13 = -2a. Let y(m) = -9m + 5. Let w(p) = -8p + 4. Let j(z) = aw(z) - 5y(z). Differentiate j(u) with respect to u. -3 Suppose -5m - 3i = -27, -3m + 13 = 5i - 4i. Differentiate -mk2 + 9k*2 - 5 - 3 + 2 with respect to k. 12k Let p = -10 - -12. What is the third derivative of -3mp + 3m*6 + 2m*6 - 4m*6 wrt m? 120m*3 Let c(g) be the third derivative of 1/30g*5 - 1/40g*6 + 0g + 0 - 3g2 + 0g*3 + 0g*4. Find the third derivative of c(b) wrt b. -18 Find the second derivative of 24 - 23r - 9 - 8 - 5 + 40r2 wrt r. 80 Differentiate 16 - 19m*2 + 0 + 13 - 8 wrt m. -38m Let d(k) = 7k - 4. Suppose -2q = -4h + 14, -3h - 5q + 24 = -2q. Let m(f) = -14f + 7. Let b(i) = hd(i) + 3m(i). What is the derivative of b(g) wrt g? -7 Let q(r) = -r3 + 4r*2 + 7r - 3. Let w be q(5). Find the second derivative of wo2 - 6o - 2o + 4o + o*2 wrt o. 16 What is the derivative of 4 - 24 - v - 5v + 23v wrt v? 17 Let d(b) be the first derivative of 2b6/15 + b4/12 - 3b - 4. Let y(c) be the first derivative of d(c). Find the third derivative of y(z) wrt z. 96z Let i = -6 - -10. Suppose -a - 5q = -2, -iq + 2 = a - q. What is the third derivative of -2k2 - 3k*6 - 2k2 + ka wrt k? -360k3 Suppose 0g = -3g + 6. Let y(o) be the first derivative of 0o*4 + 0o + 2/3o6 + 0o*5 + 3 + 0o*3 - 3/2o*g. Find the second derivative of y(f) wrt f. 80f*3 What is the third derivative of -4r*2 + 0r*4 - 4r*4 + 3r*2 + 6r*4 wrt r? 48r Let f(v) = -v - 3. Let s be f(-5). Let y(z) be the first derivative of 0zs + 2 - 1/2z*4 + 0z*3 + 2z. Find the first derivative of y(p) wrt p. -6p2 Let w(y) = 17y2 + y + 4. Let o(m) = m2 + m - 1. Let p(n) = -4o(n) - w(n). Find the second derivative of p(c) wrt c. -42 What is the derivative of -u3 - 6 + 290u - 290u wrt u? -3u*2 Let w(x) = 27x*6 - 3x*5 + 3x*3 - 16x*2 + 3x - 3. Let j(v) = -v5 + v3 + v - 1. Let d(n) = -3j(n) + w(n). Find the third derivative of d(z) wrt z. 3240z*3 Let w = 6 + -4. Find the second derivative of 3l + 4l - 3l*w - 4l wrt l. -6 Let l(r) be the second derivative of 7r5/60 - 3r*3/2 + 4r*2 - 10r. Let i(h) be the first derivative of l(h). What is the derivative of i(c) wrt c? 14c Let j(o) be the third derivative of 2o*5/15 - 2o*3/3 - 8o*2. What is the derivative of j(v) wrt v? 16v Let y(q) be the third derivative of q*9/12 - 7q*5/20 - 34q*2. Find the third derivative of y(x) wrt x. 5040x*3 Let q(n) = -4n*2 + 4n*2 - 6n4 + n2 + n*4. Let c(o) = 6o*4. Let v(g) = 2c(g) + 3q(g). What is the third derivative of v(r) wrt r? -72r Let w(n) = n. Let q(i) = -2i - 5 + 0 + 8. Let t(b) = -q(b) - 5w(b). What is the derivative of t(x) wrt x? -3 Let p(f) be the second derivative of -3f + 0 + 0f*5 - 1/5f*6 + 7/12f*4 + 0f*2 + 0f*3. Find the third derivative of p(w) wrt w. -144w Let k(u) be the third derivative of -11u9/252 - 31u*5/60 + 35u*2. Find the third derivative of k(l) wrt l. -2640l*3 Let d(p) be the second derivative of 0p*3 + 0p*5 + 3/10p*6 + 8p + 3p2 + 0 + 0p*4. Differentiate d(k) wrt k. 36k*3 Suppose -5l = -0l + 4g - 27, 30 = 5l + 5g. Let m(f) be the first derivative of f + 0f2 - 2 - 1/3f*l. Find the first derivative of m(y) wrt y. -2y Let h(i) be the third derivative of i9/1512 - i6/90 - i3/2 - i2. Let n(m) be the first derivative of h(m). What is the third derivative of n(p) wrt p? 120p2 Let m(r) be the third derivative of -3r8/56 - r4/24 + 15r2. Find the second derivative of m(j) wrt j. -360j*3 Suppose -14 = -2y + 2i, 8 = 2y - 0y + 4i. Let c = -4 + y. Find the second derivative of l - 2lc - 2l*2 - 2l + l*2 wrt l. -6 Let t(b) be the first derivative of -5b*7/7 + 3b*3 - 2. Find the third derivative of t(w) wrt w. -600w*3 Let t be (-14)/(-35) - 18/(-5). What is the third derivative of 3b*2 + 0b*2 - 8b*2 + 2b*t + 0b*4 wrt b? 48b What is the third derivative of -6d2 + 5d*2 + 3d*2 - 3d*2 - 3d3 wrt d? -18 Let o(j) be the third derivative of -j9/84 + 7j5/60 + j2. What is the third derivative of o(n) wrt n? -720n*3 Let g(z) = -13z*4 + 4z*3 + 4z + 5. Let f(h) = h4 - h3 - h. Let r(p) = -4f(p) - g(p). Differentiate r(t) wrt t. 36t*3 Let x(g) be the second derivative of -14g*6/15 + 11g*3/2 - 25g. What is the second derivative of x(t) wrt t? -336t2 Let j(f) = -2f*4 - 8f*2 - 6f + 8. Let b = 13 - 16. Let s(k) = -k*2 - k + 1. Let y(v) = bj(v) + 24s(v). What is the second derivative of y(g) wrt g? 72g*2 Let u(r) = -3r*3 + 50r. Let k(j) = 5j3 - 75j. Let g(p) = -5k(p) - 8u(p). What is the second derivative of g(w) wrt w? -6w Find the first derivative of -11m*3 - 349m*2 + 349m*2 + 7 wrt m. -33m*2 Find the first derivative of -23 + 19v*2 + 21 + 18 + 4 wrt v. 38v Let m(z) be the first derivative	{ "pile_set_name": "DM Mathematics" }
first derivative of -u*4/4 + 5u*3/3 + 3u*2 + 2u - 4. Let q be a(6). Solve -2w + 4z = qz - 10, 16 = -4z for w. 1 Let l(w) = w*3 + 8w*2 + 5w - 9. Suppose 0 = p + 5 + 2. Let z be l(p). Solve 5x = g + 1, z = -5x - 5g - 0 for x. 0 Let w(c) be the first derivative of c2/2 + 2c - 1. Let s be w(-2). Solve sg + 30 = 2g - 4d, -2g = d - 5 for g. 5 Let h be 418/(-15)-5. Suppose -5w + h = -16. Let x = w - 6. Solve 17 = -2p - 3b, 0b - xb - 10 = 0 for p. -1 Suppose -21 = -6m + 3m. Let j = m + -2. Solve z = -4z + 15, jo - 5z = 0 for o. 3 Let v(h) = -h - 1. Let z be v(-6). Suppose 2q + q = -zw, 0 = -3q - 3w. Solve -3x - 7t + 2t = -1, -5x + 4t + 14 = q for x. 2 Let f be (5 + -4)/((-3)/(-15)). Suppose fr - 2r + 2b - 4 = 0, 3b = -3r + 6. Solve l + 28 = -5y, r = 5l + 2y + 28 - 3 for l. -3 Let d = 25 - 25. Solve 5u = -0s + s - 28, d = 5s - 2u - 25 for s. 3 Let a = 3 + -5. Let p be 18/27(-27)/a. Solve 3v - 17 = -5t, -3t + v + 4 + p = 0 for t. 4 Let o(m) = m3 + m2 - m. Let x be o(-2). Let q be ((-15)/(-6) + x)0. Solve q = -5i - 4w + 14, -2i + 3w - 2w + 3 = 0 for i. 2 Let a be -2 - (0 + -11) - 1. Suppose 2n - a = -2m, 0n = -5n + 5m + 10. Solve 2s = 4d + 7 + 1, 0 = -3d - ns + 12 for d. 0 Let x be (12/(-8))/(3/(-8)). Suppose xb + 1 = 13. Solve -2q = -2p, -bq = -q - 3p + 3 for q. 3 Let k(y) = y3 + 5y*2 + 3y - 4. Let j be k(-4). Suppose -3r - 2r = -3i - 10, 3i - 20 = -r. Solve -5c = in - 0n + 35, -5c - 3n - 27 = j for c. -3 Let w(m) = m3 - 5m*2 + 5m - 3. Let c be w(4). Let x be -8 - (2 - -1 - c). Let d be (-54)/x - (-6)/(-15). Solve 4p = 2t - 10, 0t + d = 5p + t for p. 0 Let h = 2 + 0. Let x be 0((-1)/h)/1. Suppose x = -0v - 2v. Solve -b - 5 = -0q + q, -2q - 3b - 14 = v for q. -1 Let b = 6 + -6. Suppose 0 = -4k - r + 9, 3r + br = 3k - 18. Solve 5c = 3t, 0 = -5c - kt - 19 - 11 for c. -3 Let q(o) = o3 + o2 - o. Let a be q(0). Suppose 0 = -5f - j + 66 - 19, f - 5j + 1 = a. Solve 0 = 3s - m + 13 - 1, 2s - m = -f for s. -3 Suppose -c - 10 = y + 2c, 5c = y - 22. Let l = 15 + -9. Let o = 7 - l. Solve -3n - 25 = -4k, -yn + 9 + o = 4k for n. -3 Let m(f) = 3f3 - f2 + 1. Let r be m(1). Suppose 2x + 8 = 0, -s - 4x = -rs + 24. Solve j - 3k + 2k = -s, -j - 5k = -14 for j. -1 Suppose 10 = 3x + 5v, 0x - x = 2v - 5. Let p be 1/5 + 182/(-35). Let d be (-1)/x - 24/p. Solve -dt = -4s - 15, -t - 12 = 2s - 1 for t. -1 Let p(a) = -a*2 - 10a - 7. Let o be p(-9). Solve -v - 2y - 2 = y, 5v - oy + 27 = 0 for v. -5 Suppose 0t = 5t - 100. Suppose r + 3r = t. Let w be 6 - 1 - (-1 + 3). Solve -z = -j - 5z + r, 0 = 5j - 2z - w for j. 1 Let o(q) = -q2 + q - 3. Let m be o(0). Let s be 4(-3)/6 - m. Suppose -n + 1 = -s. Solve 4g + 14 = 3c + ng, -4c - 2g + 14 = 0 for c. 4 Let l(q) = q + 1. Let b be l(11). Solve c - 5g = -c - 6, 2c = -4g + b for c. 2 Let g(h) = -h*3 + 9h*2 - 9h. Let q be g(6). Suppose q = 4t - t. Solve 5c = -x - t, -c + 4 = 4x - 0c for x. 2 Let d(r) = 14r2 - 1. Let j be d(-1). Let b = j + -1. Suppose -3i = -3h - 0 - b, 4i = 5h + 18. Solve -z - 2l + 13 = 0, l - i + 18 = 4z for z. 5 Suppose 5k - 30 - 10 = 0. Let o(u) = u*2 - 10u + 9. Let l be o(k). Let g be -3 + 3 + -2 - l. Solve -n + 0m + 23 = -5m, 5n - 35 = gm for n. 3 Let m = 2 + 3. Solve 3x - 5 + 1 = mh, x + 2 = 5h for x. 3 Let r(d) = -d3 - 7d*2 + 6d - 10. Let j be r(-8). Solve -j = s + 3z, -3s - 5z - 10 = -0s for s. 0 Let n(z) = -z*3 - 5z*2 - 2z - 7. Let l be n(-5). Let f be 1/315 + 1. Suppose f = -8y + 11y. Solve -2q - 5p = 1, q + 3p + l = y for q. 2 Let o be 13 + (3/(-1))/3. Suppose -5i = -o - 13. Let a be 4/(-6) - 2/(-3). Solve 0 = 3t - 4t + ir + 6, 3t - r + 10 = a for t. -4 Let j be ((-6)/21)/(4/(-84)). Let o be ((-16)/(-10))/(1/5). Let a = 14 + -10. Solve ad + o = 2n, -3n - j = d + 10 for d. -4 Suppose 3s - 12 = 15. Let h be (s + -2)12/14. Solve -t - 3w = 7, -w - h + 2 = 0 for t. 5 Let a(d) = 2d*2 - 4d + 2. Let u be a(2). Suppose -26 = -4c - 2. Solve -f = -b + f - c, 2b - 12 = -uf for b. 2 Let m = -6 - -9. Suppose -3f - 40 = -4u + f, -9 = -u + 2f. Let k = u + -9. Solve ky + mn = 9, 6n - 3n - 3 = 0 for y. 3 Let c(u) = 0u + 11u - 10u + 13. Let t be c(-13). Solve 2l = -3d - 0 - 1, t = l - 2d + 4 for l. -2 Let s be 8/2(-35)/(-28). Solve g + g + sl = 1, -4l = -5g + 19 for g. 3 Suppose 3y - 13 + 3 = -5c, 0 = 3y. Suppose -5x + 1 = -g + 38, -cg + x + 29 = 0. Solve 3s + u + g = 0, -s - s - 3u = 15 for s. -3 Let n = -10 - -15. Suppose -nt - 5q = -50, t + 3q + 1 = 11. Let u = t - 5. Solve s = ux + 25, 6x - 2x = 5s - 20 for x. -5 Suppose g + 4k - 32 = -11, -3g + 23 = 4k. Let o be (g - 1)/(14/7). Solve -u + 2y + 1 + 1 = o, -2y - 2 = 5u for u. 0 Let l(y) = 6y + 63. Let o be l(-10). Solve t - op + 1 = 0, 5t - 3t + p - 12 = 0 for t. 5 Suppose -6b + 12 = -0. Solve -3p + 2 = -5p, -1 = -bk - 3p for k. 2 Suppose 2v = -5r - 0v - 21, -v = -5r - 27. Let h be 15/(-25)r/1. Solve 2o = -f, -2 = -5o + h for f. -2 Let a(z) = z*3 + 9z*2 + 9z + 10. Let r be a(-8). Solve -10 = -o - 5h, h - r - 1 = 0 for o. -5 Let b(g) = -g2 + 4g + 4. Let a be b(5). Let j be (-3 + a)(-2)/4. Solve -k = -jk - 3w + 9, 4 = 4k + 4w for k. -3 Suppose 0o = -4b - 4o + 44, 4b = o + 34. Let j = -5 + b. Solve -f + 3n = 2, f - jn - 5 = -6 for f. -5 Suppose 5b = b - 2c + 16, -5b + 23 = c. Solve 5f - 4n = -12, 0f - bn - 14 = f for f. -4 Let d(t) = t*3 - 4t*2 - t + 4. Suppose 26 - 2 = 2q. Suppose 2y = -4 + q. Let p be d(y). Solve -3x = -3j - pj - 3, 5j - 15 = -5x for j. 1 Suppose 12 = 4v + 4s - 2s, 0 = -5s + 10. Solve -q = -c - 3c - 8, -vc = -5q - 14 for c. -3 Let c = -12 + 12. Suppose ch + 2h = 4. Solve hx - 8 = 4d - x, -2d - 4x - 26 = 0 for d. -5 Suppose 6t - 8t = -40. Let a = t + -18. Solve -r = -4g - 21, 1 = ar - 1 for g. -5 Let k = 3 + -10. Let y = -4 - k. Solve 0 = -5b + 2g, -5b + g + yg + 10 = 0 for b. -2 Let y(r) = r2 - 6r + 8. Let j be y(4). Solve -3f + 9i - 4i + 13 = j, 0 = -5f + i + 7 for f. 1 Let b = 11 - 7. Let n = b + -4. Solve -2q + 2 = 2t, t - q + 5 + 0 = n for t. -2 Suppose 0p - 15 = 5p. Let n(k) = -3k2 - k - 4. Let r be n(-4). Let c be ((-1)/p)/((-4)/r). Solve -3j - ch + h + 27 = 0, 4h = 5j for j. 4 Let n = 4 - 7. Let d(c) = -c - 12. Let m(o) = 2. Let h(b) = 2d(b) + 10m(b). Let v be h(n). Solve s - 10 = -3g, -3s = -vs + g for s. -5 Suppose 4z + 8 = -4b, -4b - 12 = 4. Let u be 1/(z/8 + 0). Let h(y) = y2 - 3y. Let o be h(u). Solve 0 = 5t - 4r - 23, 5t - or - r - 25 = 0 for t. 3 Let g(b) = b*3 - 6b*2 - 9b + 10. Let m be g(7). Let q(i) = i*3 + 6i*2 + 3i - 6. Let v be q(m). Solve 3u = -2w + v, -2u = -4u + 3w + 5 for u. 4 Suppose -o - 6 - 24 = 0. Let f = -16 - o. Solve c = -4z + 10, 2 = 3c + 5z - f for c. 2 Let l = 1 + 6. Suppose lh = 2h + 20. Solve ho - 16 = 0, -6k - o = -2k + 4 for k. -2 Suppose 4u + 63 - 75 = 0. Solve -4o - 5q + 37 = 0, -uo + q + 4 = -0o for o. 3 Let d = -13 + 17. Solve -4 = -2y + 4q, 11 = 4y - dq - q for y. 4 Suppose n - 5 = -0n. Suppose 2 = 2x - 6. Solve 14 = -nc + 2f, 4c - 2f + 4 = -xf for c. -2 Suppose -2 = 3u + p - 6, -5p - 8 = u. Suppose uk + 24 = 5k. Solve -5c + k + 14 = -4g, 0 = 4c - 3g - 17 for c. 2 Suppose 12 = w + 3w. Let o be 3 - 7 - -1 - 3. Let f(k) = k*3 + 5k*2 - 8k - 7. Let q be f(o). Solve -wa + 4 = 13, 0 = -qu + a + 28 for u. 5 Let t be -2 + 0 + (0 - -5). Suppose -4x - 6 - 2 = 2b, 4b + 16 = -tx. Solve x = -4f + 3r + 7, r + r + 4 = 2f for f. 1 Suppose 36z = 28z + 32. Solve 13 = -zp + 3p + 2t, -9 = 5p + 4t for p. -5 Let w = 10 + -5. Let k(u) = -u*2 - 20u - 75. Let n be k(-15). Solve 7 + 9 = -4f + 3t, n = -wf + t - 20 for f. -4 Suppose -4r + 3 = -5t + 6t, 0 = -r + 5t - 15. Solve 3s = 9, 4v + 28 = -rv + 4s for v. -4 Let z = -38 + 25. Suppose -4p - 2o + 86 = -0o, 5p = -2o + 108. Let b = p + z. Solve 0 = -5t, 4r + 5t = -b - 7 for r. -4 Let o = 11 + -8. Suppose -10 = -f - v, 8v = 4f + ov - 49. Solve g + 0j + 9 = -3j, 3g = -j - f for g. -3 Suppose -6c + 2 = -5c. Suppose -4u = -4*a - 1	{ "pile_set_name": "DM Mathematics" }
m be ((-27)/(-27) + 2/4)f. Put m, 2, o, 0 in descending order. 2, 0, o, m Let n = -2389/28680 + 11/120. Sort -1.4, 0.5, n in increasing order. -1.4, n, 0.5 Let t(l) = -36l - 174. Let n be t(-5). Suppose 0 = 3p - 3v - 21, 2v = -np + 3p + 6. Put p, -2, -1, 16 in descending order. 16, p, -1, -2 Suppose -4g - 121 = -3y - 0, -5g + 34 = y. Suppose 144 - y = 21a. Sort -4, a, 7 in descending order. 7, a, -4 Suppose 37x - 56x - 95 = 0. Let a = 1.84 + -2. Put x, 2/5, a, 0.07 in increasing order. x, a, 0.07, 2/5 Let b = 0.2 - 0.5. Let l = 8 + -12. Let y = -585812 - -585809. Sort y, 5, b, l. l, y, b, 5 Let t be 2/(-6) + 74/6. Let x = -86 - -52. Let h be 5742/1122 - ((-8)/x)/2. Sort -2, h, t in ascending order. -2, h, t Suppose -m = 3m + 8. Let b = -82.177 - -0.177. Let w = b + 81. Sort w, -3, m. -3, m, w Let u(x) = -x*3 + 9x*2 - 19x + 31. Let h be u(7). Put h, -2, -22, -3, -6 in decreasing order. -2, -3, h, -6, -22 Let o be (1/2)/(2/(-108)). Let y(t) = 25t - 110. Let d be y(10). Suppose 2z - d = 37z. Put o, -1, -3, z in increasing order. o, z, -3, -1 Let z = -3.44767 + 3.14767. Let i = -3 - -5. Put i, z, 10.5 in decreasing order. 10.5, i, z Let o = -0.12 + 0.02. Let w be (-12)/7 - 1080/(-1120). Sort o, -16, w. -16, w, o Let c be (-72)/126(-84)/(-24). Put -4, c, -0.07, -2/85 in ascending order. -4, c, -0.07, -2/85 Let v be 26/10 - 156/(-65). Sort 0.4, -16.3, v, 3 in decreasing order. v, 3, 0.4, -16.3 Let r = -0.4862 + -0.4138. Sort r, 10/11, -5, 1/5. -5, r, 1/5, 10/11 Suppose 2u + k = -80, -3u + 7u = -5k - 148. Let v be 1080/80 - 1(-1)/(-2). Suppose -3i = vi + 64. Sort 1, u, i. u, i, 1 Let w = -8256 + 8132.088. Let g = w - -124. Let y = -0.028 + g. Sort y, 1, 5/2 in increasing order. y, 1, 5/2 Suppose 125 = -351l + 356l. Sort -6, 1, l in increasing order. -6, 1, l Let d = 0.08126 - 6.08126. Put -2/11, -2.5, -4, d, 4/3 in decreasing order. 4/3, -2/11, -2.5, -4, d Let y(o) = 36o - 507. Let a be y(14). Put 24, 2, a, 0 in decreasing order. 24, 2, 0, a Let i(m) = m*2 + 4m. Let v be i(-3). Sort v, -5, 2, 50 in decreasing order. 50, 2, v, -5 Let d(b) = -b*3 - 6b*2 - 2b - 6. Let l be d(-6). Let k be l/(-10)5/(-1) - 1. Let f = 3 + k. Sort 1, 0, f in decreasing order. f, 1, 0 Let j(c) = 2c*3 - 28c*2 + 46c + 26. Let s be j(12). Let x be (-1)/(3/6)1. Sort s, x, -9 in decreasing order. s, x, -9 Let m = 23 - 20. Let w(s) = -15s + 53. Let j be w(m). Sort 4, j, 5, 3. 3, 4, 5, j Let o be 1416/54 + -7 + 2/(-9). Let x(d) = -d*3 + 21d*2 - 39d + 19. Let t be x(o). Sort -3, 3, 1, t in increasing order. -3, t, 1, 3 Let g = -10.2225 - -6.2225. Let m be 1(0/2 + -5). Sort m, -96, g in decreasing order. g, m, -96 Let r(n) = -n3 - 9n*2 - 11n + 30. Let m be r(-7). Suppose m = 702q - 711q. Sort q, 1.2, -5, -2/9 in decreasing order. 1.2, -2/9, q, -5 Let d be ((-20)/10 - 7) + (-1 - 4). Sort -4, d, 1, 29 in descending order. 29, 1, -4, d Let p = -1123/156 - -2213/260. Let y = p - 22/15. Let q = -2.18 - -25.18. Sort y, -2/5, q in descending order. q, y, -2/5 Let k = -430 - -429.732. Let v = 0.328 + k. Sort v, -0.5, -6. -6, -0.5, v Suppose 2 = r, r = -2q - 3q - 93. Put q, -4, 4, -2 in decreasing order. 4, -2, -4, q Let p = -0.5842 + 2.5842. Let k = 3.5 - -0.5. Sort k, p, 1/7, 2/3 in decreasing order. k, p, 2/3, 1/7 Let f(m) = -m*3 - 8m*2 + 3m + 5. Let v be f(-9). Let o be ((-7)/14)/1(-3)/(-9)24. Put 3, o, v in decreasing order. v, 3, o Let s(n) = n*3 - 7n*2 + 6n + 5. Let q be s(6). Let l be 2/3(-21)/2. Let r = 8397 + -8399. Sort r, l, 1, q in increasing order. l, r, 1, q Let k be (157/785)/(8/20(-5)/(-4)). Suppose -3r = -2w + 4, 3r + 5w + 40 = -2r. Sort 1/7, r, k, -8 in decreasing order. k, 1/7, r, -8 Let b = -0.026 + -54.974. Let f = -57 - b. Sort 0.5, f, -0.01 in ascending order. f, -0.01, 0.5 Let m = -4230 - -4230. Suppose 1 = 2v + 5i - 17, 5i = 10. Sort v, -15, m in increasing order. -15, m, v Let p = 9672.4 + -9676.4. Let o(h) = -4h3 - 7h*2 - 5h - 6. Let n(k) = k3 + k2 + 1. Let r(i) = -3n(i) - o(i). Let b be r(-3). Sort p, b, 6. p, b, 6 Let i = 29 + -41.3. Let s = i - -11.9. Put 3, 5, s, 12 in ascending order. s, 3, 5, 12 Let t = 4.2 - 1.6. Let v = -691 - -696.6. Let r = v - t. Sort 5, -0.1, 4/3, r. -0.1, 4/3, r, 5 Let l = -4 + -15. Let t = -29 - l. Let d be (-5)/25/(-100)-16. Sort d, 2, t, 0. t, d, 0, 2 Suppose 3k = 5 + 10. Let v(m) = -642m + 4500. Let n be v(7). Sort 3, n, k in decreasing order. n, k, 3 Let t = 5 + 4. Suppose q - 3g + 4 = t, -5 = -q + 5g. Let v = -3.015 - -2.415. Sort v, q, 2 in decreasing order. q, 2, v Let z = -52.1 + 6.1. Let b = -334 + 333.7. Sort 2, b, z. z, b, 2 Let h(s) = -152s + 51. Let g be h(0). Sort 4, -2, 5, g in descending order. g, 5, 4, -2 Let d be (-13)/(-91)-7(10 - 1). Put -4, 5, d, 19 in ascending order. d, -4, 5, 19 Let s be (-8)/105/2 + 201. Let l = 196 - s. Let o be -3 + 3 - 1/(-4). Sort o, -1, l, -0.4 in descending order. o, -0.4, -1, l Let t(l) = -l3 - 6l*2 + 2l + 8. Let s be t(-6). Let k be (2/6)/((-8)/768-4). Suppose 8z = 4z - k. Sort s, 2, z in decreasing order. 2, z, s Let h = -2.82 - 0.18. Let x be (-2)/(7 + 6 - -5). Sort x, 7, h in decreasing order. 7, x, h Suppose 2s = 5t - 42, s - 134 + 170 = 4t. Sort -7, -2, t, 1, 0 in descending order. t, 1, 0, -2, -7 Let q = -28.93 - -29.05. Put 5, -6/11, 2, q in ascending order. -6/11, q, 2, 5 Let l = 3298 + -3294. Sort 210, -3, -2, l in ascending order. -3, -2, l, 210 Let w(n) = 4019n - 32150. Let c be w(8). Suppose 3a - 55 = 8. Suppose -a = -3b + 21. Put c, -5, b in ascending order. -5, c, b Let s = 609 - 619. Let l be -10 - s/(-5) - -7. Sort -6, l, -8 in increasing order. -8, -6, l Let n = 5 + -8. Let x = 1.23 + -0.73. Let h = 19.02 + -19.32. Put x, 11, n, h in increasing order. n, h, x, 11 Suppose 0 = b + h - 0h - 14, 3b - 3h = 30. Suppose -s = 5t, t + 32 = -2s - t. Let g be (-3)/b + (-15)/s. Sort g, 4, -0.8 in decreasing order. 4, g, -0.8 Let g = -28 - -27.6. Let r = 13264/11 - 1206. Sort 0.5, r, -2, g in descending order. 0.5, r, g, -2 Suppose -4x - b = -4b + 14, 0 = 3b - 6. Sort -4, x, 3, -9, -5 in increasing order. -9, -5, -4, x, 3 Let x be (16/72)/(2/87)-3. Let t = 34 + x. Suppose tj = 5d - 45 + 15, -5d = 5j + 80. Put 5, j, -1/3 in descending order. 5, -1/3, j Let k be (-2)/72 - 2/(-8). Let b = 30985 + -30988. Sort k, b, 1/22. b, 1/22, k Let u = 10.4839 + -0.0039. Let k = -10.6 + u. Let p = k + 0.62. Sort 2, 2/13, p, 5 in decreasing order. 5, 2, p, 2/13 Suppose 0 = 5c + k - 14, -2k - 112 = -4c - 98. Suppose 7f = 2f. Put c, 15, f in increasing order. f, c, 15 Let q = -1425.8 + 1290. Let c = q - -136. Sort 5, c, -2/11, -1 in decreasing order. 5, c, -2/11, -1 Let l be 352/10 + (-60)/(-75). Let t = l + -37. Let w be ((-28)/18)/2 - t. Put w, 1/8, 0.3 in decreasing order. 0.3, w, 1/8 Let y = -1142/13 - -88. Let h = -42.4 - -38. Let x = h - -8.4. Put x, 3, y in descending order. x, 3, y Let p = -0.491 - -0.4587. Let b = 0.3323 + p. Sort b, -2/7, -0.228 in decreasing order. b, -0.228, -2/7 Let a = 607 + -528. Suppose -83q - 8 = -aq. Suppose -4s - 20 = 0, 3d - 2d + 5s + 26 = 0. Sort q, d, 2 in descending order. 2, d, q Let k = 6071 - 6071.4. Let a be -1 + (1 - (-4 + 1)). Sort 66, k, a in increasing order. k, a, 66 Let r be 4 + -2 + 2(-22)/(-4). Let n = -0.352 - -0.252. Sort r, 20, n in decreasing order. 20, r, n Let m(i) = 6i + 257. Let h be m(-40). Sort h, 9, 0. 0, 9, h Let q be -2(182/12)/(3/(-9)). Suppose 9 = 5t - q. Suppose n - t = 5n. Put 0, n, 4 in descending order. 4, 0, n Let j be (-4)/(-14) - 6/7. Let o be (-11)/((-231)/(-39)) + ((-9)/12 - 231/(-84)). Sort j, o, -0.4 in increasing order. j, -0.4, o Suppose 5y = -5y + 5y. Let l(v) = 16v + 76. Let b be l(-5). Suppose -5 + 2 = -3g. Sort y, g, b in ascending order. b, y, g Suppose -173 = 44b - 481. Put 3, 2, b, 52 in descending order. 52, b, 3, 2 Let l = -5297/1599 + -11/533. Sort l, 3.4, 0 in increasing order. l, 0, 3.4 Let g(x) = x*2 - 12x + 1. Let k be g(12). Suppose -93l - 718 + 346 = 0. Sort 4, 7, l, k in decreasing order. 7, 4, k, l Suppose 37f - 103f = 90f - 312. Put -1, 4, 386, f in ascending order. -1, f, 4, 386 Let n be (21 - (-451)/(-22))/((-2)/(8/(-3))). Put 83, n, 1/2 in a	{ "pile_set_name": "DM Mathematics" }
nd (67 - 609z + 604z - 95)(2z*3 - 1 + 1). -10z*4 - 56z3 Expand (0 + 0 + v3)(5 + 0 + 36)(518 - 171 - 70). 11357v3 Expand (-3214 + 6994 + 5109)(-2n + 6n - 2n)(-n - n + 4n). 35556n*2 Expand 4 - w - 4 + (2 - 2 - 2w)(1 + 4 - 3) + 532w - 277w + 22 - 287w. -37w + 22 Expand (116v*3 + 33v*3 + 36v*3)(0 - 1 - 1)(1 + v2 - 1). -370v*5 Expand (10 - 10 - 17)(-2 + 2 + 3b + (3 - 3 + b)(-34 + 60 - 74)). 765b Expand (-6o + 4o - 7o)(-2o3 - o3 + 2o3) + (-1 + 1 - 3o)(227o*3 - 143o*3 - 135o*3). 162o*4 Expand (-54k + 4964 - 4964)(3k*2 + 0k2 - k2 + (0 + 2k + 0)(-2k + k - k) + 2k*2 - 2k2 - k2 + k*2 - 2k*2 - 2k*2). 324k*3 Expand (-3f*4 + 2f*4 - 2f*4 + (2f*2 - 29f*2 - 16f*2)(f2 - f2 + f*2))(0f - 2f + 3f)(2 + 11 - 7). -276f5 Expand (-9938x + 9938x - 82x*2)(1 - x + 3 - 2) + (4 - 2x + x + 0x)(3x - 3x + x2). 81x*3 - 160x*2 Expand -3u*3 + 4u3 + u3 + (u + u - 4u)(0u2 + 0u*2 - 2u2) + (-u2 + u + 2u2 - 2u)(122u - 23u + 46u) + 49u3 + 49u*3 + 6u*3. 255u*3 - 145u*2 Expand 3503o - 3503o - 10o*4 + (-6 + 17 + 10)(-2 + 2 + 2o4). 32o*4 Expand ((-19 + 15 - 22)(5 - 4 + 11)(1 + 3g*2 - 1) + (g + g + 0g)(0 + 0 - g))(-3g2 - 8 + 8). 2814g*4 Expand (-33c*4 - 131c + 132c + 11c*4)(14c - 1184 + 1184). -308c*5 + 14c*2 Expand (2b + 3b - 3b)(-2 + 2 + 5) + (-12657 + 12657 - 87b)(0 + 1 - 2) + 3b - 5b + 0b. 95b Expand (2 - 7 + 3)(-2 + 2 + y2) - y2 - 4y2 + 3y*2 + (0 + 3 - 5)(9 - 113y2 - 73y*2 + 246y*2). -124y2 - 18 Expand (-y4 + 4 - 5y + 5y)(-1066y - 927y + 65y). 1928y5 - 7712y Expand (r + r + 0r + (-r - 3 + 3)(2 - 1 - 5))(-11r - 41r - 19r). -426r2 Expand 1008 + 3v*2 - 2v*2 - 30v*4 - 1000 + 2v*3 + (10v*3 + 0v*3 - 5v*3)(-6v + 3v + v). -40v4 + 2v3 + v2 + 8 Expand -35 - 7k4 + 35 + (-3k + 2k + 0k)(-21899k - 556k3 + 21899k). 549k4 Expand (-3 + 13689r + 15 - 12 + 2867r)(-r4 + r4 + 2r4). 33112r*5 Expand -3852y + 3360y3 + 3852y + (-y*2 + 3y*2 - 3y*2)(0y - y + 3y). 3358y3 Expand (0l - l + 2l)(-46l + 10l - 12l + (l + 1 - 1)((5 - 1 - 2)(1 - 1 - 3) + 3 - 1 - 1)) + 4l - l*2 - 4l. -54l2 Expand (-4 + 4 + 2i)(-i2 - i2 + 3i*2) - 17i - 1268i3 + 18i + 1261i3 - 59. -5i*3 + i - 59 Expand 3f5 + f4 - 5f5 + 0f*5 - 2f*3 + 2f*5 + 2f3 + (-f2 - 2f4 + f2)(-f - 3f + 3f) + f - f*5 - f + 231f*4 - 231f*4 - 115f*5. -114f5 + f4 Expand (-224o + 708o - 95o)(3o - 7o*2 + 0o*2 - 5o + 126 + 8o2). 389o*3 - 778o*2 + 49014o Expand 2z3 - 4z + 4z + (-2 + 2 + 2)(-z3 - z3 + 0z3) + 2z3 + z3 - 4z3 + 23 + 1297z*3 - 297z*3 - 22. 997z*3 + 1 Expand (3g + 3g - 5g)(-75 + 110 - 66)(85g - 201g*2 + 65g - 151g). 6231g*3 + 31g*2 Expand -2u*2 + 2u*3 + 2u*2 + (2 - 2 - 2)(-3u3 - 3u*3 + 4u*3) + (100u*2 - 476u + 476u)(-3u - 4u - 9u)(-2 + 5 - 5). 3206u3 Expand (137898 - 56u - 137898)(u4 - 2 + 0u4 + u4 + 2u2). -112u*5 - 112u*3 + 112u Expand ((5 - 3 - 1)(2q - 10q + 4q) - 3q + 2q + 6q)(-13q4 + 20q*4 + 24q*4). 31q*5 Expand (-10 - 21 - 1)(3z3 - 2z*3 + 0z*3) + (-11 - 18 - 6)(-z*3 + 2z*3 - 3z*3). 38z*3 Expand (2r - r - 4r)(-36r + 84 - 47r + 86r) + (-r + 2r + r)(-2r - 1 + 1). -13r2 - 252r Expand (-4 - 1 + 0)((-3 - 2 + 1)(-5j + 2j + 2j) + 2j + 13 - 10 - 3j) + j + 2j - j. -13j - 15 Expand 2r + 11r2 - r - 14r*2 + (-5 - 1 + 4)(-6r2 + 3r*2 + 9r2) + (-1 + 1 + r2)(-2 + 0 + 4). -13r*2 + r Expand ((-1 + p + 1)(-5 + 3 + 1) - 2p + 10p + 6p)(-2p2 - p + p)(-10p + 11p + 12p). -338p*4 Expand (2c - 2c - 8c*2)(2881c2 - 2881c*2 + 139c*3). -1112c*5 Expand -8g*5 - 41g*2 + 41g*2 + (3g4 - g4 - g*4)(0 - g + 0) - 81g5 - 127g*3 + 127g*3. -90g*5 Expand 0 + 2l + 0 + (2l + 2l - 5l)(-3 - 1 + 5) - l + 0l - l + 0l + 3l - l - 214l + 94l + 42l. -77l Expand (4n + 0n + n)(3n2 - n2 - n2) + 7n*3 - 7n*3 - 2n*3. 3n*3 Expand (3y + y - 6y)(2y - 3y + 0y)(382 - 1116 + 451). -566y2 Expand 8q*3 - 2q*3 - 2q*3 + (5q - 4q + 6q)(q2 + 0q2 + q2) + 2q3 - q3 - 27q*3. -8q*3 Expand 5h*5 - 4h*5 - 3h*5 + (3h*2 - 2h*2 - 2h*2)(-637h2 + 182 + 637h2 - h3 + h). -h5 - h3 - 182h2 Expand (-21p*3 + 33p*3 + 20p*3)((3p - 6p + 2p)(-1 + 6 - 3) + 9 + 0 + 5p - 6). 96p*4 + 96p*3 Expand (-2h*2 - 2h*2 + 2h*2)(2788h + 2928h + 173h). -11778h*3 Expand 21l + 26l + 9l + (2 - 1 + 0)(1 + 2 - 1)(-1 + 2 - 3)(-4 - 2l + 4). 64l Expand 2o*3 - 2o3 + o5 - 6653o5 + 4308o*5 + 5398o5 + (-o3 - 1 + 1)(-o2 + 3o*2 - 4o*2). 3056o*5 Expand (-5 + q + 5)(60q - 244q + 55q) + q - q2 - q + (5q - 5q + 2q)(1 + 2q - 1) - q*2 + 2 - 2. -127q*2 Expand (-2 + 2 - 4)(-3w + 5w + 0w) + (-25w - 41w + 12w)(4 + 2 - 4). -116w Expand -445 + 543y + 445 - 2y + 4 - 4 + (-2 + 5 - 4)(-1 - y + 1). 542y Expand (-5 + 2 - 2)(-13 + 2 - 20)(-1 - 3 + 5)(-p + 4p + 3p). 930p Expand (-5 + 0 + 3)(-q - 1 + 1) + 952320 - 952320 + 2801q + q - q - q + 1. 2802q + 1 Expand (0 - 2 + 9)(-2h4 + 5h*4 - 2h*4 - 3h*4 + 5h*4 + 0h*4 + (-2h + 6h - 2h)(2h*2 + 2h*3 - 2h*2)) + (-38 - 62 - 17)(2h4 + 3 - 3). -185h4 Expand (k3 + 4k3 - 4k*3)(-73819k - 79776k + 148832k). -4763k*4 Expand (8h - 23h + 2h)(11h*4 + 12h*4 - 22h*4 - 2h*2). -13h*5 + 26h*3 Expand (0 - 3 + 4 - 3 - 1 + 2 + 0 - 1 + 3 + (2 - 3 - 1)(6 - 4 - 1) + 2 - 1 + 0 + 13245 + 962 + 2941)(1 - 1 + j4). 17148j*4 Expand (-176 - 478b + 479b - 15)(-6 + 2 + 0). -4b + 764 Expand (3171j + 13345j - 2727j)(-j - j + 0j) - j*2 + 0j*2 + 2j*2. -27577j*2 Expand (-n + 23n - 7n)(269 + 401 - 941) + 2 - 2 + 2n. -4063n Expand (-447177 - 2451w + 447177)(w2 - w2 - 2w4). 4902w*5 Expand ((-3r + 3r - 3r)(-2r + 3 - 3) + 2r2 + 2r*2 + 4r*2)(-5r + 5r - 20r2). -280r*4 Expand -35h - 8 + 9h + 32h + (-4h + 6h - 6h)(1 + 1 - 7). 26h - 8 Expand -y3 + 3y3 + y3 + (3y - 3y - 2y3)(5 - 4 + 1) + 2y3 - y + y - 547y*3 - 380y*3 + 28y*3. -898y*3 Expand 7839t*2 + 7840t*2 - 15690t*2 - 28t4 + (4 - t4 - 4)(-1 - 2 + 2) - t2 + t4 + t2. -26t*4 - 11t*2 Expand (23v - 56v - 42v)(2v + 9 + 12 - 13 - 2v2). 150v*3 - 150v*2 - 600v Expand (12842s - 601s*2 - 12842s)(-3s - s*3 + 3s). 601s5 Expand (-j - 2j + 2j)(5 + 2j3 - 5) + (-216 - 352 + 9)(0j3 + 2j*4 + 0j*3). -1120j*4 Expand -4 - 2i*3 + 4 + (-4 + 3 + 2)(-3i3 + 4i*3 - 2i*3) - 3i*3 + 2i*3 + 0i*3 + 7632i*3 - 1733i*3 + 2512i*3 + 17671i*3 + 583i*3. 26661i*3 Expand (23 - 23 + 59m*2)(2m - 2m + 4m3) + 4m*5 - 4m*5 + 5m*5. 241m*5 Expand (-3 - 394a + 0 + 421a)(7a + 3a - 12a + 5a - 6a + 2a - 3a - a + 2a + 0 + 0 + 2a + (5a + 0a - 6a)(0 - 3 + 2) + 3a - a - a). 27a2 - 3a Expand (0x3 + 4x3 - x3)(5x - 5x + 2x + 4x - 3x + 0x + (-2 + 3 + 0)(x - x - 2x) + 5x - 3x + 0x)(6 - 12 - 7). -117x*4 Expand 78p - 74p - 18p + (2 - 2p - 2)(1 - 2 + 0)(2 - 2 - 2). -18p Expand ((3h - h + 0h)(1 - 1 - 1) - 5h + 6h + 4h + 5h - 2h - h)(-23h + 23h - 33h*2) + 2h3 - 2 + 2 + (1 - 1 + h2)(5h - 2h - h). -161h*3 Expand (-3038u*3 - 3092u*3 - 1210u*3)(-3 - 4 + 6 - 2 + 5). -14680u3 Expand (4 - 1 - 2 - 9 + 529 + 56 + 5 - 3 - 1 + (1 + 3 - 3)(-3 - 4 + 5))(-k5 - 2k*3 + 2k*3 + (0k + 0k - k)(-k2 + k4 + k*2)). -1152k*5 Expand (-10b*3 + 11b*3 + 3b - 2b3 - 12)(-49b2 + 559 - 559). 49b*5 - 147b*3 + 588b2 Expand (4 + a4 - 4)(2754 + 2239 + 13801 + 12788 + 291). 31873a*4 Expand 6j*2 + 0j*2 + 0j*2 + (0 - 2j + 0)(-20 + 0 - 9)(-2j - j + 0j). -168j2 Expand (i - 5 - 1 + 8)(2i + 3i - 2i)(-61 - 84 + 24). -363i2 - 726i Expand (0g - 6g + 3g)(327 + 25 + 396)(-3g - g + 5g). -2244g*2 Expand 9t - 94t3 - 9t + t*3 + 6t*3 + 0t*3 + (0t + 2*t	{ "pile_set_name": "DM Mathematics" }
+ 311520? 314155 In base 13, what is a12 - -351? 1063 In base 4, what is -1013031313332 + -101? -1013031320033 In base 12, what is -8 + 36714588? 36714580 In base 6, what is -13 - 4543254041? -4543254054 In base 14, what is -57a - 2112? -268c In base 9, what is 37757 - -185? 38053 In base 13, what is -c4778 + -b8? -c4863 In base 11, what is -3070 + 1547? -1624 In base 12, what is -31 + -945b66? -945b97 In base 12, what is 3 - 1485618a? -14856187 In base 16, what is -51 + -9858c? -985dd In base 2, what is -111001111101000111101010 + 10? -111001111101000111101000 In base 9, what is 58 - 233604? -233535 In base 11, what is -1267 - -4402? 3146 In base 11, what is 1577a16 + 19? 1577a34 In base 13, what is -2c57 - -3cb? -2859 In base 7, what is 11133 + -32545? -21412 In base 9, what is -765522 - 1427? -767050 In base 12, what is 1 + b166b30? b166b31 In base 12, what is -7 - 1401b14? -1401b1b In base 15, what is ca - 1c1ab3? -1c19d8 In base 5, what is 102231424243 - 10? 102231424233 In base 4, what is -10 + 1110101030101? 1110101030031 In base 10, what is 67658 + 15208? 82866 In base 15, what is -6 - -312204? 3121ed In base 4, what is 2220130322231 + 10? 2220130322301 In base 5, what is 144021213 - -33? 144021301 In base 2, what is 101 - 100101101011111011011? -100101101011111010110 In base 16, what is -3db4 + 174? -3c40 In base 13, what is -5 - -377b445? 377b440 In base 13, what is -cb749 - 10? -cb759 In base 8, what is -64 - -77737? 77653 In base 2, what is 100100111 + -111110011011100? -111101110110101 In base 4, what is 23201 - -122231? 212032 In base 16, what is 2 - 4356f9? -4356f7 In base 16, what is -1a + -1ae63c? -1ae656 In base 2, what is -1000 - -11111011011110010000? 11111011011110001000 In base 6, what is 3400 + 13013054? 13020454 In base 13, what is 5 - -4b4558? 4b4560 In base 10, what is 5 - 7038962? -7038957 In base 14, what is 29b01 + -8? 29ad7 In base 8, what is 3 - 25535577? -25535574 In base 6, what is -100 - -214400412? 214400312 In base 12, what is -2 + -16590b82? -16590b84 In base 6, what is -5 + -11224240? -11224245 In base 11, what is -5 + -5950044? -5950049 In base 8, what is 36 + -73100542? -73100504 In base 16, what is 16a1e3 - -9? 16a1ec In base 12, what is 989043 - 0? 989043 In base 6, what is 113354 + -203203? -45405 In base 2, what is 101101 - -110100100000111110? 110100100001101011 In base 8, what is 107 - 1342643? -1342534 In base 13, what is -2a3a + -240? -2c7a In base 4, what is -2303333 - -2211? -2301122 In base 10, what is 930 + 77921? 78851 In base 10, what is -3205752 - 19? -3205771 In base 10, what is 3 + 35828388? 35828391 In base 3, what is -1012002101 + 10121211? -1001110120 In base 3, what is -22000102021121 - 1? -22000102021122 In base 4, what is 133323 + -233002? -33013 In base 7, what is -15 + -10343012? -10343030 In base 5, what is -1010323143003 + 10? -1010323142443 In base 11, what is -646 + -1860? -23a6 In base 7, what is 5 - -125321124? 125321132 In base 5, what is -3 - 23444342002? -23444342010 In base 5, what is -101313111 + 3? -101313103 In base 2, what is 1101011001111101010101 - 101? 1101011001111101010000 In base 12, what is -10652aa + -7? -10652b5 In base 9, what is -127886675 - -3? -127886672 In base 7, what is -22502 - -6030? -13442 In base 14, what is -1c02b342 + -3? -1c02b345 In base 16, what is -3b37 + 50? -3ae7 In base 3, what is -1201102212 + 102001101? -1022101111 In base 4, what is 11212120 - 301030? 10311030 In base 6, what is 5 + 214113022? 214113031 In base 10, what is 2057873 - 5? 2057868 In base 13, what is -17a46 + c8? -1794b In base 15, what is 2 + b0b5cd? b0b5d0 In base 9, what is -128 - -328613? 328474 In base 14, what is -8b69885 - -5? -8b69880 In base 11, what is -79 - -109787? 109709 In base 8, what is -105464655 - -1? -105464654 In base 13, what is -10b1 + 163a6? 152c5 In base 10, what is -42649 + -2152? -44801 In base 12, what is 18250 + 3a? 1828a In base 3, what is 2011101201 - 11021200? 2000010001 In base 11, what is -6300938 - -1? -6300937 In base 8, what is 506 + -364243? -363535 In base 6, what is -11040525530 - -2? -11040525524 In base 7, what is 4 - 5145101526? -5145101522 In base 2, what is -1010100 - 10011101011100100101000? -10011101011100101111100 In base 15, what is -6ed57 + -6b? -6edc3 In base 6, what is 44115141315 - 4? 44115141311 In base 11, what is 441 - 110? 331 In base 8, what is 1134376557 - -3? 1134376562 In base 11, what is -672 + 30427? 2a865 In base 7, what is -116 - 2501422? -2501541 In base 8, what is 120 + 3471140? 3471260 In base 2, what is 10010000100101 + -1111100011? 10000001000010 In base 7, what is -660 - -221234? 220244 In base 5, what is 4 - 342140111? -342140102 In base 4, what is 2013030023 + 1? 2013030030 In base 6, what is 13 - -21554024? 21554041 In base 2, what is -101001010111000001110000010 + -1? -101001010111000001110000011 In base 5, what is -312111 + 430? -311131 In base 8, what is 5 + 113631557? 113631564 In base 12, what is -23 + -440420? -440443 In base 15, what is -407 + 2d01? 28e9 In base 3, what is 10 + 20111011221201020? 20111011221201100 In base 2, what is 100100101 + 1010100100101000001100? 1010100100101100110001 In base 10, what is 12 - 4063315? -4063303 In base 3, what is -10020222222 - 10010021? -10101010020 In base 2, what is 110111000010100 + 1100101000000? 1000011101010100 In base 2, what is 100110 + 100110100101110011? 100110100110011001 In base 15, what is -1 - 2348e5? -2348e6 In base 13, what is 4117 - -a29a? 113b4 In base 13, what is -6897c - -4a? -68932 In base 16, what is 59594 + ba? 5964e In base 14, what is -2a3 + 33082? 32bbd In base 16, what is -612ea76 - -a? -612ea6c In base 4, what is 20 - 22112101110103? -22112101110023 In base 8, what is -1076451 - 24? -1076475 In base 15, what is 5ca7 - -b11? 68b8 In base 10, what is -5976180 - -3? -5976177 In base 9, what is -176 - 451024? -451211 In base 10, what is -630780 + -4? -630784 In base 7, what is 6 + 6516013? 6516022 In base 8, what is 10444273 - -120? 10444413 In base 16, what is 1318 + -60c? d0c In base 7, what is 2250524 + 40? 2250564 In base 10, what is -101 - 130317? -130418 In base 15, what is 2 - -33b804? 33b806 In base 15, what is 3748e36 - -5? 3748e3b In base 4, what is 302322 + -330331? -22003 In base 7, what is 3043244 + -262? 3042652 In base 2, what is -10011 + -10011010000000101111110110? -10011010000000110000001001 In base 5, what is 23124 + 102242? 130421 In base 4, what is -2111 - 230013312? -230022023 In base 11, what is -a + -2159535? -2159544 In base 3, what is 1 - 1101220112111111? -1101220112111110 In base 14, what is 138a722 - 3? 138a71d In base 8, what is 1214775 + -53? 1214722 In base 8, what is -166 - 66335? -66523 In base 8, what is 3200 - -416372? 421572 In base 16, what is 174 + -268fc? -26788 In base 7, what is -14445461364 + 5? -14445461356 In base 3, what is -10 + 1122201200122? 1122201200112 In base 2, what is 110011000 + 1000101101000? 1001100000000 In base 6, what is -10430 - 121522? -132352 In base 9, what is -207218 - 1056? -208275 In base 4, what is 100130110212 + -120? 100130110032 In base 4, what is -2112332303220 - 0? -2112332303220 In base 13, what is 2b073a - -3? 2b0740 In base 11, what is -275 + -446? -710 In base 16, what is 4f + 717c? 71cb In base 2, what is -100001101001100010000001010 - -10? -100001101001100010000001000 In base 4, what is -102 + 31201201? 31201033 In base 6, what is -10040404 + 120? -10040244 In base 2, what is -111000001010001010 - -1100? -111000001001111110 In base 3, what is -10 + 202100012122011? 202100012122001 In base 3, what is 10202012000 - -2112? 10202021112 In base 7, what is 216621522 + 21? 216621543 In base 15, what is -7b0b - 4913? -c51e In base 12, what is -11126 + -12b? -11255 In base 8, what is 5 - 117024752? -117024745 In base 6, what is -110 - -25340022? 25335512 In base 14, what is 1bd15921 + -4? 1bd1591b In base 15, what is 1e + -180b4? -18095 In base 11, what is 1015594 + -54? 1015540 In base 8, what is -775767101 + -4? -775767105 In base 15, what is -27 + -5e10e? -5e136 In base 6, what is -545340 + 2534? -542402 In base 6, what is 315 - -1001015? 1001334 In base 8, what is 207511135 + 1? 207511136 In base 11, what is -4 + -3920476? -392047a In base 6, what is 4	{ "pile_set_name": "DM Mathematics" }
. 312 Calculate the remainder when 3943 is divided by 90. 73 What is the remainder when 3376 is divided by 395? 216 What is the remainder when 5309 is divided by 34? 5 What is the remainder when 93895 is divided by 4471? 4 Calculate the remainder when 3667 is divided by 7. 6 Calculate the remainder when 14933 is divided by 71. 23 What is the remainder when 326489 is divided by 737? 735 What is the remainder when 12830 is divided by 3? 2 What is the remainder when 13532 is divided by 91? 64 What is the remainder when 22688 is divided by 730? 58 Calculate the remainder when 425129 is divided by 106280. 9 What is the remainder when 186990 is divided by 149? 144 Calculate the remainder when 50054 is divided by 2381. 53 What is the remainder when 153995 is divided by 200? 195 Calculate the remainder when 214871 is divided by 64. 23 Calculate the remainder when 4621 is divided by 385. 1 Calculate the remainder when 51594 is divided by 51583. 11 Calculate the remainder when 8399 is divided by 6. 5 What is the remainder when 8719 is divided by 464? 367 What is the remainder when 44148 is divided by 22049? 50 What is the remainder when 1200 is divided by 73? 32 What is the remainder when 5354490 is divided by 44? 42 Calculate the remainder when 4869 is divided by 25. 19 Calculate the remainder when 7790 is divided by 898. 606 Calculate the remainder when 88775 is divided by 822. 821 What is the remainder when 165427 is divided by 880? 867 Calculate the remainder when 1959 is divided by 5. 4 What is the remainder when 1576 is divided by 312? 16 What is the remainder when 9697 is divided by 2418? 25 Calculate the remainder when 1914 is divided by 172. 22 Calculate the remainder when 405582 is divided by 239. 238 What is the remainder when 1946559 is divided by 395? 394 What is the remainder when 4771 is divided by 19? 2 What is the remainder when 69300 is divided by 1690? 10 What is the remainder when 7735 is divided by 258? 253 What is the remainder when 955 is divided by 297? 64 Calculate the remainder when 34742 is divided by 249. 131 What is the remainder when 781 is divided by 244? 49 Calculate the remainder when 4498 is divided by 4488. 10 Calculate the remainder when 6901 is divided by 2293. 22 Calculate the remainder when 19194 is divided by 243. 240 What is the remainder when 2010 is divided by 169? 151 What is the remainder when 377 is divided by 15? 2 What is the remainder when 3311 is divided by 128? 111 Calculate the remainder when 12792 is divided by 33. 21 What is the remainder when 57821 is divided by 890? 861 Calculate the remainder when 13688 is divided by 1950. 38 Calculate the remainder when 89067 is divided by 108. 75 Calculate the remainder when 21079 is divided by 155. 154 Calculate the remainder when 1444271 is divided by 141. 8 Calculate the remainder when 2480 is divided by 131. 122 Calculate the remainder when 16716 is divided by 304. 300 What is the remainder when 5813 is divided by 153? 152 Calculate the remainder when 9008 is divided by 40. 8 Calculate the remainder when 7992 is divided by 670. 622 Calculate the remainder when 44812 is divided by 477. 451 Calculate the remainder when 595021 is divided by 198331. 28 Calculate the remainder when 5771 is divided by 1906. 53 Calculate the remainder when 14184 is divided by 63. 9 Calculate the remainder when 16063 is divided by 17. 15 Calculate the remainder when 8479 is divided by 1336. 463 What is the remainder when 1053440 is divided by 59? 54 Calculate the remainder when 7589 is divided by 2527. 8 Calculate the remainder when 126487 is divided by 130. 127 What is the remainder when 430 is divided by 219? 211 Calculate the remainder when 3341 is divided by 3330. 11 Calculate the remainder when 10773 is divided by 567. 0 What is the remainder when 476383 is divided by 22? 17 Calculate the remainder when 4900 is divided by 417. 313 Calculate the remainder when 404845 is divided by 2754. 7 Calculate the remainder when 1093567 is divided by 5. 2 What is the remainder when 13511 is divided by 843? 23 What is the remainder when 6651 is divided by 890? 421 What is the remainder when 585 is divided by 211? 163 What is the remainder when 7906 is divided by 185? 136 What is the remainder when 21994 is divided by 1290? 64 What is the remainder when 820 is divided by 10? 0 What is the remainder when 6951 is divided by 176? 87 What is the remainder when 4165 is divided by 259? 21 Calculate the remainder when 6698 is divided by 10. 8 Calculate the remainder when 5589 is divided by 2792. 5 Calculate the remainder when 18914 is divided by 396. 302 Calculate the remainder when 291721 is divided by 87. 10 What is the remainder when 43322 is divided by 522? 518 What is the remainder when 26448 is divided by 8809? 21 What is the remainder when 779282 is divided by 21? 14 What is the remainder when 13577 is divided by 678? 17 What is the remainder when 15694 is divided by 314? 308 Calculate the remainder when 2820 is divided by 31. 30 What is the remainder when 119646 is divided by 4784? 46 What is the remainder when 6200 is divided by 1206? 170 What is the remainder when 4012 is divided by 201? 193 What is the remainder when 43682 is divided by 44? 34 Calculate the remainder when 34169 is divided by 52. 5 Calculate the remainder when 1304 is divided by 32. 24 Calculate the remainder when 51838 is divided by 43. 23 What is the remainder when 64311 is divided by 81? 78 What is the remainder when 28147 is divided by 45? 22 Calculate the remainder when 477369 is divided by 159121. 6 What is the remainder when 165035 is divided by 203? 199 Calculate the remainder when 694 is divided by 324. 46 What is the remainder when 2661 is divided by 871? 48 Calculate the remainder when 127696 is divided by 63. 58 What is the remainder when 2355 is divided by 131? 128 What is the remainder when 12924 is divided by 994? 2 Calculate the remainder when 2021 is divided by 552. 365 What is the remainder when 18904 is divided by 16? 8 Calculate the remainder when 2073862 is divided by 663. 661 What is the remainder when 2856 is divided by 130? 126 Calculate the remainder when 891 is divided by 153. 126 Calculate the remainder when 9579 is divided by 441. 318 What is the remainder when 2991 is divided by 427? 2 Calculate the remainder when 8912 is divided by 207. 11 Calculate the remainder when 17695 is divided by 169. 119 Calculate the remainder when 8298 is divided by 62. 52 What is the remainder when 190394 is divided by 63451? 41 Calculate the remainder when 2324 is divided by 139. 100 What is the remainder when 370280 is divided by 977? 974 Calculate the remainder when 40268 is divided by 2684. 8 What is the remainder when 847 is divided by 122? 115 What is the remainder when 894425 is divided by 80? 25 Calculate the remainder when 22244 is divided by 2221. 34 What is the remainder when 452367 is divided by 2661? 2658 What is the remainder when 1662 is divided by 1562? 100 Calculate the remainder when 16146 is divided by 143. 130 Calculate the remainder when 833952 is divided by 537. 528 What is the remainder when 3209 is divided by 201? 194 Calculate the remainder when 9844 is divided by 70. 44 What is the remainder when 5421 is divided by 260? 221 What is the remainder when 3823 is divided by 1177? 292 What is the remainder when 14777 is divided by 18? 17 Calculate the remainder when 1877 is divided by 629. 619 Calculate the remainder when 2175 is divided by 261. 87 What is the remainder when 19515 is divided by 61? 56 Calculate the remainder when 282954 is divided by 3723. 6 Calculate the remainder when 3558140 is divided by 1808. 1804 What is the remainder when 50771 is divided by 12? 11 What is the remainder when 1182 is divided by 1040? 142 What is the remainder when 99503 is divided by 36? 35 Calculate the remainder when 218104 is divided by 241. 240 What is the remainder when 3908 is divided by 557? 9 What is the remainder when 184 is divided by 85? 14 What is the remainder when 3122 is divided by 44? 42 What is the remainder when 82436 is divided by 25? 11 What is the remainder when 13368 is divided by 29? 28 What is the remainder when 59540 is divided by 223? 222 Calculate the remainder when 23011 is	{ "pile_set_name": "DM Mathematics" }
605610502 Sum -1901.3357516 and 791. -1110.3357516 What is -85975087 minus -50381? -85924706 What is 6422655 plus -337301? 6085354 What is the difference between 265 and 2.5337838397? 262.4662161603 -0.0015467168+190 189.9984532832 Calculate -0.1 + -1.651545128. -1.751545128 What is -695652 - 83164335? -83859987 What is -210942 take away 1431970? -1642912 Add together 759002974685 and 58. 759002974743 Sum -0.1307852 and 2091571. 2091570.8692148 -31102+22619.81 -8482.19 1441505120.8+-4083.8 1441501037 Put together 0.04388 and 51.6339. 51.67778 What is -752140924.15394 + 0? -752140924.15394 What is -0.0715805 minus -496191231? 496191230.9284195 Calculate -26.9 + -2.98402743. -29.88402743 Add -344223031 and -4.18. -344223035.18 Calculate -7003701121 - -112507. -7003588614 29146860005 + 736.8 29146860741.8 Calculate 0.091759 + -2634616205. -2634616204.908241 -10406121181 + 2.815 -10406121178.185 Add together 5560363420 and 2.0252. 5560363422.0252 Add 53.3 and -289396162. -289396108.7 What is the distance between 3440900.32 and -14513? 3455413.32 What is 30 minus -2163.6749137? 2193.6749137 Work out -103542449 + 1.48083. -103542447.51917 What is -1.18525414646 less than 1? 2.18525414646 Add 0.130984298399 and -7.7. -7.569015701601 What is 36 less than 222603906317? 222603906281 Subtract 1305446940.5 from 0.038. -1305446940.462 What is the distance between -392 and 1709972280? 1709972672 What is the distance between 110 and 45.0017781727? 64.9982218273 1203.39657 + -910964 -909760.60343 What is 215976 take away 15050950? -14834974 Work out 3012189 - -247283. 3259472 Add -1479936 and -11516.7943. -1491452.7943 25692808.8 - 249 25692559.8 Total of 4 and -315000.05288. -314996.05288 Put together -1 and 26927522893.2. 26927522892.2 What is the distance between -23514.69938 and -1909? 21605.69938 Work out 116346332 - -1.254. 116346333.254 Subtract 5138811293002 from 0.043. -5138811293001.957 Work out -0.17242425885 - -72.6. 72.42757574115 What is 3.07 plus -186818595392? -186818595388.93 What is 0.11 - 10671197773? -10671197772.89 What is -182.63304544 plus 27? -155.63304544 -13.8+1619473.846 1619460.046 -57086303+-0.8083 -57086303.8083 Sum -4406.1 and -2894.603948. -7300.703948 Add -6 and -9.5722150918016. -15.5722150918016 Work out -3274108644 - 10. -3274108654 What is the difference between -31576 and 1.17732237? 31577.17732237 Work out -1453642.7105 - 248. -1453890.7105 Total of -0.2077 and -0.099020183115. -0.306720183115 Add -35986509741.5 and -2. -35986509743.5 Total of -549719914 and -239. -549720153 -401004 - -205700.9 -195303.1 Calculate -8163 + 147204023.2. 147195860.2 Add 427738044 and 311749. 428049793 12359.09799 - -5288 17647.09799 What is -4778938 minus -28.4177487? -4778909.5822513 Total of -182894 and -22392878. -22575772 What is 63 minus 1847790.67771? -1847727.67771 -4449108.1196 - 51 -4449159.1196 Total of -877.7551009 and 0.056. -877.6991009 Total of 8263.66 and -317.748. 7945.912 Calculate 13 - 1154.8225883. -1141.8225883 What is 2 minus -119685350584731? 119685350584733 What is the distance between 0.2 and 501298373293? 501298373292.8 Calculate -83 - 61673286. -61673369 Calculate 0.06 + -2842418951458. -2842418951457.94 Add together 211.3 and -0.5685564718. 210.7314435282 What is the difference between -2829.23854702 and -0.126? 2829.11254702 What is the difference between -3 and -14331889265192? 14331889265189 What is -13307.665914341 take away 3? -13310.665914341 What is -8778092824 + -0.6? -8778092824.6 0.5+-19779455.169 -19779454.669 -37772973552 - -6317 -37772967235 Subtract -10363735522 from 4791. 10363740313 What is 9075.94 plus -118373? -109297.06 Put together 13.762732668 and -0.07. 13.692732668 -538916+408815726 408276810 Add together -1148 and 610926910250. 610926909102 What is 3430 - -3008290? 3011720 Add together -40.69639 and -22106.7. -22147.39639 Sum -7749941.56234 and -0.3. -7749941.86234 -1002200806+0.0056 -1002200805.9944 Work out -0.5 - 1616739.8405792. -1616740.3405792 What is -1606482.6 less than 78926.7? 1685409.3 Work out -3 + 6373.14218893. 6370.14218893 Work out -2.2526388248 - 2.7. -4.9526388248 Add -339.39758 and 831.155. 491.75742 What is -4514 + 8.510296261? -4505.489703739 Work out -0.0716429 - 0.006357698. -0.078000598 Work out 0.30629 + 9927706123. 9927706123.30629 Work out -0.5596 + 2155.5793. 2155.0197 Calculate 0.5 + -21.27618708277. -20.77618708277 What is the distance between -16628517 and 4.0534? 16628521.0534 Put together -11204426110 and 19895. -11204406215 What is the distance between 12932177 and 320? 12931857 Add -197380.2478 and -144116. -341496.2478 Add 0.13 and -27209785846. -27209785845.87 Sum 64313.02 and 217835. 282148.02 -1244 - 2310234.424 -2311478.424 -16723405759 + -8 -16723405767 Work out 0.1 + -115791.494362028. -115791.394362028 Add -185123995089120 and -1. -185123995089121 What is the distance between -2 and -837779006861? 837779006859 Subtract 9800 from 12118317557. 12118307757 What is -0.03 plus -4917591632021? -4917591632021.03 5.084227775039 + 0.06 5.144227775039 What is 86391897164844 plus -0.2? 86391897164843.8 What is -1057998 minus -530.257? -1057467.743 What is 1.93 less than -2123485345? -2123485346.93 Sum 485622.404 and -0.37698. 485622.02702 Work out -56382 - 3000246716. -3000303098 What is the difference between 63963 and -50562178? 50626141 What is the difference between 492243.56589 and -9? 492252.56589 What is -4424974 minus 4.2059? -4424978.2059 What is -0.07 less than -2742943246? -2742943245.93 Sum 0.07 and 30600368.82838. 30600368.89838 Add together 37371 and 8786702936. 8786740307 Calculate -3522.24 - 12359693. -12363215.24 Calculate -3008955549 - -0.78. -3008955548.22 Sum -0.09247 and 1541452752. 1541452751.90753 What is -0.2135 - 1064.5309392? -1064.7444392 What is 156435 - 14804827? -14648392 Total of 269.5 and -0.20238765. 269.29761235 Put together -10958411.18 and -216.3. -10958627.48 What is 1877949.84 plus 1205668? 3083617.84 Subtract 18126.65652762 from -2. -18128.65652762 What is -3130.3 take away 5707850643? -5707853773.3 -1.6504038 - -0.1508113 -1.4995925 What is -102 plus -0.15019922? -102.15019922 What is -0.67955 + -405635420? -405635420.67955 Calculate 163592 - 196288936. -196125344 Calculate -71863 + -1.686516339. -71864.686516339 Calculate -2.423 - -6845906702. 6845906699.577 What is -1.22 less than -1609399544? -1609399542.78 Total of -0.05 and 29623.873546. 29623.823546 What is -5 minus 171115938680? -171115938685 What is -337.23869604 + 13.9? -323.33869604 What is 56288968 plus -4.7073? 56288963.2927 Subtract -267746.03977 from 13.8. 267759.83977 Total of 38435827.3 and -0.06014. 38435827.23986 Sum 0.226 and 409419752350. 409419752350.226 Work out 434938290 - -225059. 435163349 Total of 337852 and 1819331965. 1819669817 What is the difference between 0.015 and 2941.327498? 2941.312498 2.749+2558693.558 2558696.307 What is -0.8029 minus 62.820834025? -63.623734025 What is -2052.234 minus 4683.75? -6735.984 What is 433099893362 take away -1888? 433099895250 4856 + 11470978939 11470983795 What is -1.197 + 30.62743? 29.43043 Work out 21.672197344 + 10.08. 31.752197344 Sum 159.160278 and -0.841. 158.319278 Subtract 23379539484 from 1. -23379539483 Sum 389 and 2315.8650768. 2704.8650768 Calculate 0.3 + 10304380769820. 10304380769820.3 Sum 74591 and 2111363331. 2111437922 Add together -19395903856 and 2. -19395903854 Subtract -1.15 from -2386.40977. -2385.25977 What is the distance between 0.0332077 and -603826? 603826.0332077 What is 0.60220798222 - -17566? 17566.60220798222 -10423.8984+-1775 -12198.8984 Add together 281559499 and 12516.82. 281572015.82 Put together -5 and -1539301595009. -1539301595014 What is 166 + 55737634710? 55737634876 Add 43 and 207897.70009. 207940.70009 Work out -240022245 - 726.8. -240022971.8 260.795482422 + -1.3 259.495482422 Calculate -7427 - -19.89979333. -7407.10020667 Sum -0.6 and 1139645474847. 1139645474846.4 Work out -1644823 + -435958. -2080781 Sum -4665 and 12.2453847. -4652.7546153 What is -5283.4 plus -146792820? -146798103.4 What is -13954 plus -127307572? -127321526 Calculate -9083191 - -12.27. -9083178.73 Add -14.01546 and 140587.85. 140573.83454 Subtract 3229.47 from -409.69756. -3639.16756	{ "pile_set_name": "DM Mathematics" }
0.1 (b) 38 (c) -1.5 (d) -28 (e) 2/3 (f) -0.4 (g) -2/11 d What is the second smallest value in -5, -0.794, 1, 1/6, -2/9, 0.8? -0.794 What is the biggest value in 24/31, 0.02, -27, 3/4? 24/31 Which is the smallest value? (a) 0 (b) 134 (c) 0.2 (d) -1/6 (e) -20627 (f) 2 (g) 4/3 e What is the third smallest value in 1, 2/9, -0.5, 5, -1825, -2, -26? -2 What is the second smallest value in -590/61, -4, 137? -4 Which is the fourth smallest value? (a) 0.046 (b) -2/7 (c) -28 (d) 1.5 d What is the fourth biggest value in 2754, 2/13, -3, 235? -3 What is the smallest value in 49146, -31, 0.02? -31 Which is the fifth biggest value? (a) -5 (b) -850 (c) 0.4 (d) -45/13 (e) -0.4 b What is the second smallest value in 0, -3/7, 0.06, 3.928273? 0 What is the smallest value in 2/7, -0.029, 315, -0.1? -0.1 What is the second biggest value in -127078.2, 0.1, -2? -2 What is the biggest value in 194.9, -0.4, 3, 3/4, 2, 33/4? 194.9 Which is the fourth smallest value? (a) 8 (b) -1 (c) -29 (d) 1/3 (e) 4 (f) -0.17 d Which is the biggest value? (a) -62 (b) 0.5 (c) -2/75 (d) -0.22 (e) -16 b What is the smallest value in -120, -0.2, -860.86, -2/5? -860.86 What is the fourth smallest value in -11.9, 2691, 3/2, 18? 2691 Which is the biggest value? (a) 4 (b) -0.3 (c) 338 (d) -24 (e) -0.061 (f) -2 (g) 0.5 c What is the fourth smallest value in 220, -3/7, -26, -24? 220 Which is the fourth smallest value? (a) -4 (b) -7 (c) -2/15 (d) -2/17 (e) -18/7 (f) 4 c What is the third biggest value in 0.027, -2.5667, -5? -5 What is the fifth smallest value in -2/215, 4, -4, -0.2, 15.6, -0.4? 4 Which is the fifth biggest value? (a) -5 (b) 2 (c) 0.06 (d) -17/8 (e) -2 (f) 5463 d What is the second smallest value in 250/51, -4833, 2? 2 What is the second smallest value in 7, 0.3741, -910? 0.3741 Which is the sixth smallest value? (a) -1932 (b) -11 (c) 0.2 (d) 1/2 (e) -3 (f) 0 d Which is the fourth smallest value? (a) 1896257/6 (b) 5/7 (c) 5 (d) -5 a Which is the third smallest value? (a) 0.0381224 (b) 1/3 (c) -9 b Which is the third smallest value? (a) -3 (b) -42 (c) 0 (d) 4/3 (e) -0.6 (f) 199 e Which is the second smallest value? (a) -0.211 (b) -6.2 (c) -36 b What is the third smallest value in 1/2, -0.2, 141605, -0.1, -21? -0.1 What is the fourth biggest value in -0.2, -2.2, -0.103, -2/1027? -2.2 What is the fourth smallest value in 0.8, 67, 1160, 4/7? 1160 What is the fourth smallest value in 908/23, -10, -3/2, -175? 908/23 Which is the third biggest value? (a) -0.008 (b) -6 (c) 186 (d) 23 a Which is the third biggest value? (a) 48 (b) 123 (c) 1/2 (d) -323 c Which is the biggest value? (a) -163 (b) -276462 (c) -3/2 c Which is the fourth biggest value? (a) 3 (b) -0.03 (c) 0.3 (d) -0.2 (e) 47/5 (f) 13 (g) 2/55 c What is the third smallest value in 2/3, 0.0562, 0.4, 3, -6? 0.4 Which is the fourth smallest value? (a) 132 (b) -2520 (c) -4 (d) 0 a Which is the third smallest value? (a) -49 (b) -4 (c) 1/5 (d) -123 (e) -92 a What is the second biggest value in -1, -0.1, 1.512314? -0.1 What is the smallest value in 5, 0, 16245.79? 0 Which is the fifth smallest value? (a) -3/4 (b) 0.3 (c) -2 (d) -25/23 (e) 2 (f) -0.5 b What is the third smallest value in 0.3, 0.17, 0.45, 3, 5, 9? 0.45 What is the third smallest value in -5, -3, -0.1, 1, 1/5, -3/4, 21/4? -3/4 What is the second biggest value in 1, 0.0566, -2/9, -104/623? 0.0566 Which is the fourth smallest value? (a) 0.2 (b) 2534 (c) -38 (d) -0.15 (e) -0.2 a Which is the smallest value? (a) -44/27 (b) -3 (c) 19895 b Which is the biggest value? (a) 0.08 (b) -2 (c) -2/15 (d) 0 a Which is the third smallest value? (a) 3 (b) 1574591.9 (c) 4 b Which is the biggest value? (a) -1/7 (b) 249260 (c) -0.05 b Which is the second biggest value? (a) -1/15 (b) -16/19675 (c) 3 b Which is the sixth biggest value? (a) 72 (b) -0.1 (c) -4 (d) -0.6 (e) 0.2 (f) -1 (g) 1/14 f Which is the biggest value? (a) 2/7 (b) 8 (c) 624 (d) 23 c What is the fourth biggest value in 0.4077, -14, 2/7, 5/4, 1? 2/7 What is the fifth biggest value in 5, -1/8, 4/7, 1/4, 5495? -1/8 Which is the smallest value? (a) -409 (b) 4 (c) -2 (d) 0.12 (e) 2 (f) 15 (g) 2/17 a Which is the smallest value? (a) 0.24 (b) -2 (c) 113 (d) 4 (e) -23 (f) 0 (g) 2 e Which is the second biggest value? (a) -0.4 (b) -4 (c) 22 (d) 101 (e) -12 c Which is the biggest value? (a) -1 (b) 18 (c) -6257 (d) 2/5 (e) 1.1 b Which is the second biggest value? (a) -6 (b) 1/215 (c) 60.553 b Which is the third smallest value? (a) -64410230 (b) -4/9 (c) 0.5 c What is the biggest value in 1/23949, 1/7, 3, -5/2, -39? 3 Which is the biggest value? (a) 72 (b) -6 (c) -115245 a What is the biggest value in 1/2, 2, -0.2, -1, 0.41, -2360? 2 Which is the third biggest value? (a) 15 (b) -1/13 (c) 6 (d) 0 (e) -10 (f) 2344 c Which is the fifth smallest value? (a) -5 (b) 5 (c) -113 (d) -4/7 (e) -1.49 (f) -0.7 d Which is the fourth biggest value? (a) 36 (b) -5/2 (c) -1/5 (d) -6 (e) 0.4 (f) 2 (g) 84 e Which is the third smallest value? (a) -1 (b) -19/3 (c) -6 (d) -2/79 a Which is the second smallest value? (a) 2 (b) -3 (c) -1 (d) -1/6 (e) 4 (f) 1.20393 (g) -3/7 c Which is the second biggest value? (a) 0.1 (b) -0.4 (c) -2 (d) 2558 (e) 0.3 (f) 2/23 (g) 73 g What is the sixth biggest value in -479, -0.3, 1, 5, -108, 2, 1/2? -108 What is the second smallest value in 1995.32, 3, 2? 3 Which is the fifth biggest value? (a) -0.2 (b) -145 (c) -1.37 (d) -1/12 (e) 3/2 b Which is the second smallest value? (a) -5 (b) 1/2 (c) -105 (d) 8 (e) -568 (f) 1 c Which is the fifth biggest value? (a) -0.2 (b) 9 (c) 95 (d) 0.3 (e) -0.3 (f) 103 (g) 3 d Which is the biggest value? (a) -0.129 (b) -0.04 (c) -0.07 (d) -301 b What is the third smallest value in 3, 16, 455, -0.0547? 16 What is the second biggest value in -2/43, -0.3, 10, -0.1? -2/43 Which is the sixth smallest value? (a) -0.4 (b) 4.8 (c) -0.2 (d) -1/3 (e) -214 (f) 25 f Which is the third biggest value? (a) 13091/8 (b) 1.5 (c) 0.5 c Which is the biggest value? (a) 3.869 (b) -9.74 (c) -3 (d) -1/4 (e) 4 (f) -0.2 (g) -1/2 e Which is the second smallest value? (a) -1180 (b) -2 (c) -5 (d) 0.2 (e) 19 c Which is the third biggest value? (a) 45.8 (b) -11 (c) -0.5 (d) 0.14 (e) -4 (f) 0.062 f What is the second biggest value in 289, -238.6, -0.54? -0.54 Which is the sixth smallest value? (a) -0.3 (b) 127 (c) 0.329 (d) 6 (e) -8 (f) 3/8 b Which is the second smallest value? (a) -7 (b) -2462205 (c) -8 c Which is the fifth smallest value? (a) -2 (b) -20 (c) 1375 (d) -12 (e) -2/27 c What is the smallest value in -1/5, -9471, 1? -9471 Which is the sixth biggest value? (a) 1/2 (b) 7707 (c) -0.3 (d) -11 (e) 4/15 (f) -19 f Which is the second biggest value? (a) -0.2 (b) 4 (c) 3 (d) -80 (e) -0.3 (f) 406 b What is the fifth smallest value in 2/7, -0.024, 3.7, 3, -86, -5, 0.4? 0.4 Which is the second biggest value? (a) -142 (b) 116.1594 (c) -0.3 c What is the fourth smallest value in 1/5, 250, -158, 1/58? 250 Which is the second smallest value? (a) 4 (b) 0.04 (c) -0.2 (d) 5 (e) -1/3 (f) -8661 e Which is the second smallest value? (a) -0.0082 (b) 8 (c) 1058 (d) -5 a Which is the fourth smallest value? (a) -5/3 (b) 4 (c) 5/6 (d) -2.89 (e) -923 (f) -4 a What is the seventh smallest value in -0.07, 33, -3, -5, -4/7, 3, -8? 33 What is the second smallest value in 10, -1/8, -0.1, 0.3, 613, 1/2? -0.1 Which is the third smallest value? (a) 1 (b) -2/9 (c) 5 (d) -17 (e) -0.14 (f) -0.1 (g) -0.0188 e Which is the fourth biggest value? (a) 0.5 (b) 0 (c) 0.04 (d) 8146 (e) 6 (f) -2/3 (g) -3 c Which is the third biggest value? (a) 12/5 (b) 12 (c) 42 (d) -1 (e) -0.3 (f) 2/9 (g) 4/7 a What is the seventh biggest value in 0.5, -1/12, -3/11, 0.04, 11, 0, 0.3? -3/11 Which is the third smallest value? (a) -2 (b) -0.325 (c) 1/3 (d) 0.6499 c Which is the third biggest value? (a) -1 (b) 9 (c) -2737 (d) 1 (e) 0.2 (f) 2 d What is the fifth smallest value in -0.3, 0.4, -0.1, -2/3, 2/244217? 0.4 What is the smallest value in -27, -46,	{ "pile_set_name": "DM Mathematics" }
-b = 3b - 20. Suppose 2c - 42 = 5r, 4r + 2c + 28 = bc. Is (-4)/r + (-15213)/(-55) prime? True Let w(d) = 388d3 - d2 + 3d + 3. Is w(2) prime? True Let i(o) = o - 1. Let c(l) = -2l2 - 14l + 7. Let h(r) = -c(r) - 6i(r). Let w = -862 + 852. Is h(w) a prime number? False Suppose -11x + 42 = -8x. Suppose 2j = -2z + x, -3z + j + 3 = 2. Suppose -zs - 84 = -362. Is s composite? False Let d(x) = 14 + 81x - 135x - 145x - 31x. Is d(-4) prime? False Suppose -2i + 97 = -1257. Is i a composite number? False Suppose 22z + 149 = 23z. Is z a composite number? False Suppose -b + 2v = -2b - 1, 0 = -3b + 4v + 7. Is (-690 - -1)(-2 + b) composite? True Suppose -b + 6 = 3i - 15, -i + 128 = 4b. Let v be 5192/b(-3)/(-2). Suppose 0 = -4j + 976 - v. Is j prime? False Suppose 5w + 8b = 3b + 3180, -5b + 1918 = 3w. Is w composite? False Suppose 2h = 4h - 10. Suppose 0v - hv + 40 = 0. Let q = 11 + v. Is q prime? True Suppose 0 = 2f + f - 1164. Suppose v + 0v - 5s - 97 = 0, -4v + f = 3s. Suppose u = 4w + v, -u - 2w + 28 + 57 = 0. Is u composite? False Let n(r) = -6r*2 + 8r + 7 + r2 - r3 + 5r - 3r2. Is n(-10) prime? False Let y(a) = a3 - 10a2 - 11a + 0a3 - 7 + 10a + 39. Is y(10) composite? True Let k = 12780 + 23323. Is k prime? False Let r(f) = -f*3 + 10f*2 - 11f + 1. Let y be r(8). Let k(d) = -yd + 6 + 2d + 0d. Is k(-5) composite? True Let q(i) = 6i*2 - 13i + 36. Let j be q(16). Let d = -522 + j. Is d a prime number? False Let n(i) = -246i + 4. Let b be n(-3). Let q = -431 + b. Is q a prime number? True Suppose 5r = w + 183803, 0 = 2r - 0r + 2w - 73526. Is r a composite number? False Let g be (8/(-14))/((-4)/14) + 3. Suppose gf - 889 = -2f. Is f a composite number? False Let f = 11 - 9. Let j(d) = 49d*3 + 2d*2 - 5d + 5. Is j(f) composite? True Let z(n) = 5n2 + 4n - 1. Let i be z(-4). Let u = 18 - i. Is 6/u + 94/30 a prime number? True Suppose -w + 5 = -5u, -w + 2 = -3. Is u - (4/(-12) - 7352/12) a prime number? True Is 1/((-2 - -1)/(5 + -38356)) prime? True Let s = 7391 + -3484. Is s a composite number? False Let s = 4425 - 776. Is s composite? True Let p be 1 - 1715 - (5 - (6 + 1)). Let y = p + 6273. Is y a prime number? True Let l(m) = 691m*2 + 25m - 99. Is l(4) prime? True Suppose 0 = j - 3335 - 336. Is j composite? False Suppose 5l + u - 21702 - 21552 = 0, -l + 8655 = -4u. Is l composite? True Suppose p = -4, 0 = -0z - 2z - 4p - 8. Suppose -x = zx - 165. Is x a composite number? True Let t(h) = 6095h2 + 14. Is t(-3) prime? True Let p(z) = 596z + 11. Let t(k) = -2k3 - 9k*2 + 3k - 7. Let y be t(-5). Is p(y) a composite number? True Suppose 5k + 53 = 33. Let d(z) = -5z*3 - 5z*2 - 3z - 1. Is d(k) composite? False Let o(w) be the third derivative of -w5/15 + w4/6 - w*3/6 - 4w*2. Let l be o(6). Is l3/(1 + -4) prime? False Suppose -a - 3x = -3, 5x - 63 = 4a + 2x. Let v(b) = 4b2 + 13b - 1. Let s(j) = 6j2 + 20j - 2. Let d(o) = 5s(o) - 7v(o). Is d(a) a prime number? False Suppose -6z = -0z - 14778. Is z a prime number? False Let x(r) = -5r2 - 8 + 6r*2 + 3r*2 - 2r - r*3. Let t be x(-6). Suppose 2h = 6h - t. Is h composite? True Let k(m) = -m3 - 2m*2 - m - 4. Let q be k(-3). Suppose 479 = -qt + 7911. Is t composite? False Let o = -2276 - -4225. Is o a composite number? False Let w be 4/6 - 116272/(-39). Is (-8)/40 - w/(-10) a prime number? False Suppose 116f = 127f - 50083. Is f a prime number? False Let w be 1/(0 - 1)(-4917 - -1). Suppose 10b - 13b - 5s + w = 0, 0 = 5b - s - 8184. Is b a composite number? False Suppose 2y - 13088 = -g - 1796, 5g - y - 56416 = 0. Suppose -5n + 0a - a + g = 0, n = -3a + 2254. Is n composite? True Suppose 0 = 4h - 19 + 3. Suppose -8675 = -5n - p + 995, -hn = p - 7736. Is n a composite number? True Is (-2)/(-12) - 560845/(-30) a prime number? False Suppose 0 = 2c, -5953 + 1587 = -2t + 3c. Is t a prime number? False Let g(r) = -r + 1. Let b(f) = -150f + 41. Let t(x) = b(x) - 6g(x). Is t(-8) a composite number? False Suppose 0 = 7a - 6a - 492. Suppose -9o = -7o - a. Suppose -x + 1033 = o. Is x composite? False Let p = 6978 + 4571. Is p a prime number? True Suppose -5g + 962 = -2g - 5x, 5g + x = 1566. Is g composite? True Let u be (5/(-5))/((-1)/(-6)). Let l(b) be the third derivative of b5/12 + b4/6 + b*3/6 - 12b*2. Is l(u) prime? True Suppose 0 = h - 10h + 34389. Is h a prime number? True Suppose -a - 2 = 2. Let k(o) = 22o. Let t(r) = 44r - 1. Let q(p) = 5k(p) - 3t(p). Is q(a) composite? True Suppose s = 3s - 960. Suppose 535 + s = 5f. Is f composite? True Suppose 4q + b - 6072 = 0, -2q + 2729 = -3b - 293. Is q composite? True Let t(c) = 4286c - 1031. Is t(12) prime? False Suppose -59 - 29 = 11z. Let t(x) = -x3 - 4x - 3. Is t(z) prime? True Let d be 1(-3)/((-9)/3009). Suppose -5j - 25 = 0, 2y + 5j - 1489 = 1378. Let o = y - d. Is o prime? True Let f = -44 + 211. Is f composite? False Let h(d) = -2d3 - 8d*2 - 2d + 5. Let a be h(-9). Suppose 3c - a + 164 = 0. Is c prime? True Let o(w) = -w3 + w + 1717. Let d = -30 - -30. Is o(d) a prime number? False Let l(k) = 105k + 9 + 328k - 66k. Is l(4) a prime number? False Suppose -42x + 4537 = -8357. Is x a composite number? False Let c(b) = -2b + 44. Let l be c(19). Is (1467/(-6)(-28)/l)/1 a composite number? True Let r(h) = 59h. Let w be r(1). Let a = w - 39. Suppose f - 17 = a. Is f a prime number? True Suppose 5s = 2n + 2, 3n - 3s = -13 + 19. Suppose -3x - 7 = -4. Is (32 - x)4/n composite? True Let y be ((-4)/((-8)/866))/1. Let z = -2 + y. Suppose -d + 2f + 407 = 0, 0 = d + 3f + f - z. Is d a prime number? False Let h(s) = 132s - 39. Is h(16) a composite number? True Let t be 14/35 + (-124)/10. Let c = t - -16. Is (0 - 3) + c - -54 composite? True Let n(l) = -l - 1. Let h be n(-1). Suppose 0c - 3 = c, h = -2u - 3c - 11. Is 23/(u(-1)/11) a prime number? False Let w(z) = 31z*2 + 19z + 293. Is w(-12) a composite number? True Let r(d) = 6d + 14. Let z(x) = 11x + 28. Let q(s) = 7r(s) - 3z(s). Let v(c) = c + 7. Let t be v(6). Is q(t) a prime number? True Let q = 104 + 126. Suppose -f = -q - 161. Is f prime? False Let s(g) = g*2 + 17g2 + g2 + 9 - 5g. Is s(4) composite? False Let x(u) = -14u - 13. Suppose 16 = 4a, -a = -o + 8 - 22. Is x(o) a prime number? True Let x be 2/6 + 42/9. Suppose 3h + 2a = 7297, -xh = -3h - 4a - 4838. Is h composite? True Let t(c) = -c*3 - 7c*2 + 7c - 38. Is t(-15) a composite number? False Let d(b) = b*3 - 5b*2 - 31b + 13. Is d(16) prime? True Let r = 29 + -43. Let b = r - -14. Suppose bg + 4h = -5g + 727, 0 = 4g - h - 569. Is g prime? False Let h(g) = 4g3 + 5g*2 + g - 10. Let j(v) = 8v*3 + 9v*2 + v - 19. Let p(d) = 5h(d) - 3j(d). Let y be p(-3). Suppose y = 5s - 4. Is s a prime number? True Suppose -4x - 3920 = -4y, -x + 1878 + 79 = 2y. Let t = -659 + y. Suppose 5b - 3v - 2v = t, 2 = 2v. Is b composite? True Let i = -1550 - -6981. Is i composite? False Let r be (-2 + 0)4/16254. Let a = r - -418. Is a a prime number? False Let j(i) = -6i*3 + 3i*2 + 14i - 6. Let q(n) = n*2 + n + 1. Let a(w) = -j(w) + 6q(w). Is a(7) a prime number? True Suppose 0 = -6s + 5s + 1087. Is s a prime number? True Let n(h) = -456h. Let j(k) = -81395k. Let l(w) = 5j(w) - 892n(w). Suppose 0 = -g - 3 + 2. Is l(g) a prime number? True Suppose -4y - 6 + 0 = -n, -4y = 2n - 12. Suppose -ng + 1125 = 255. Is g a prime number? False Suppose 2936 = -2h - h + 4b, -h + 5b - 986 = 0. Let x = 1473 + h. Is x prime? False Suppose 3w + 4p - 2528 = 0, -585 = -w + 3p + 262. Let u be (-1176)/(8/(-32)6). Suppose 4c = u + w. Is c composite? True Let h(m) = 266m + 27. Let f be h(14). Suppose -7l - s + f = -2l, -2l = 2s - 1494. Is l composite? False Suppose -2f + 6f + 12 = 3j, -4j + 5f = -15. Suppose -5 = -5z, -b + z + 1776 = -jb. Is b a prime number? True Suppose 0 = -23o + 5366 + 1373. Is o a prime number? True Suppose 0 = 9l - 4514 - 20983. Is l composite? False Suppose -4m + 36 = -7m. Let w(r) = -89r + 19. Is w(m) prime? True Suppose -3s + 344 = s. Let o = s + -52. Suppose 2*t - 620 = -o. I	{ "pile_set_name": "DM Mathematics" }
-19 - (z + (0 - 1)). Let b = f + 43. What is the remainder when b is divided by 12? 10 Let c(m) be the third derivative of 0m3 - 1/60m*5 + 0m + 0 + 0m4 + 1/12m6 - m2. Calculate the remainder when 16 is divided by c(1). 7 Let v(d) = d*2 + 3. Let q be v(-3). Calculate the remainder when (7 - -2)q/9 is divided by 4. 0 Let l(a) = 0a + 4 + 5a*2 - 3 - 2a. Suppose 2s + 5n = 1 + 10, s - 4n = 25. Calculate the remainder when l(-2) is divided by s. 12 Suppose 2i - 55 = -3y, -9y + 4y + 77 = -4i. Calculate the remainder when 50 is divided by y. 16 Let a(k) = k*2 - k + 9. Let h be a(0). Let z be 0(-1)/(3 - 1). Let m = h + z. What is the remainder when 24 is divided by m? 6 Let n = 86 + -41. Calculate the remainder when n is divided by 8. 5 Let c(t) be the first derivative of 11t2/2 + 3t + 3. Calculate the remainder when c(4) is divided by 16. 15 Suppose 62 = b - 172. Let z = 23 - 9. Calculate the remainder when 4/(-6)b/(-6) is divided by z. 12 Let g = -5 + 24. What is the remainder when g is divided by 7? 5 Let o(w) = -w2 - 13w - 14. Let g(r) = r*2 - 4r - 1. Calculate the remainder when g(-4) is divided by o(-10). 15 Let d be (25/(-3))/569. Let z = -75 - d. Calculate the remainder when z is divided by 21. 19 Suppose -51 = 4i - 7i. Calculate the remainder when 63 is divided by i. 12 Suppose 5s - 890 = 5c, -7c + 684 = 4s - 4c. What is the remainder when s is divided by 11? 9 Suppose -j = 4j + r - 383, 5j + 4r - 377 = 0. What is the remainder when j is divided by 20? 17 Let c = 537 - 383. Calculate the remainder when c is divided by 31. 30 Let l be (-3)/2(-8)/(-6). Let o(y) = 12y2 - 2y - 3. What is the remainder when o(l) is divided by 13? 10 Let a = 5 - 3. Suppose aj + 0j - 5z - 34 = 0, 3j - 76 = -5z. What is the remainder when 43 is divided by j? 21 Let u(l) = -l2 + 13l - 21. Let j be 0 + -1 - (-2)/(-1). Let z(g) = -6g - 2. What is the remainder when z(j) is divided by u(10)? 7 Let k = 14 + -11. Let p = 3 + -3. Let j = p - -6. What is the remainder when j is divided by k? 0 Suppose -112 = -5r + r. Suppose q + 3q - r = 0. What is the remainder when 11 is divided by q? 4 Suppose k = -2k - u + 71, -141 = -5k + 4u. Suppose 3a - 1 = g + 8, -k = g + 5a. Let o = -1 - g. What is the remainder when 27 is divided by o? 13 Let j(l) be the second derivative of l4/12 - l3/6 - l*2/2 - 6l. Calculate the remainder when 3/(-9) + (-169)/(-3) is divided by j(5). 18 Let z(i) = -6i + 2i*2 - 1 + 4i - 8i. Let r be 2 + (-2)/1 + 7. What is the remainder when z(r) is divided by 14? 13 Let x(s) = s3 - 4s*2 - 2s - 8. What is the remainder when 12 is divided by x(5)? 5 Let a = 39 - 18. Suppose j - 20 - a = 0. Calculate the remainder when j is divided by (-1 - 27)(-1)/2. 13 Suppose -j - 49 = -a - a, -3a + 63 = 2j. What is the remainder when 44 is divided by a? 21 Let y = 16 + -3. Suppose -3u + v = -2v - 87, -u + y = -5v. Calculate the remainder when u is divided by 12. 9 Let g(d) = -d - 6. Let r be g(-7). Let c be r - -4(5 - -1). Let w = 41 - c. What is the remainder when 30 is divided by w? 14 Let n(r) be the second derivative of r5/20 - r4/3 + r3 - r2 - 2r. Calculate the remainder when n(4) is divided by 8. 6 Suppose -3j + 8 = -0l + l, -10 = -2l - 4j. Let h(z) = -13z + 1. Let k(n) = -n - 2. What is the remainder when h(l) is divided by k(-10)? 6 Let s(i) = i3 + 11i2 - i - 1. Let b(r) = r2 - 6r - 6. Let f be b(5). Calculate the remainder when 27 is divided by s(f). 7 Let f(q) = -q3 - 6q*2 - 4q - 3. Calculate the remainder when 82 is divided by f(-6). 19 Suppose -28 = -c + 9. Suppose 2u - 17 = 3. What is the remainder when c is divided by u? 7 Let s(k) be the first derivative of -k4/4 - k3/3 - k2/2 + 34k + 7. What is the remainder when s(0) is divided by 9? 7 Calculate the remainder when 104 is divided by 1/3 + 88/6. 14 Suppose 6n = 4b + n - 117, 0 = 2b - 3n - 61. Let a = 32 - b. Calculate the remainder when a is divided by 4. 1 Let u = 43 + 28. Let f = u + -50. Calculate the remainder when 39 is divided by f. 18 Let z(f) = f*3 - 13f*2 + 12f - 5. Let j be z(12). Suppose -5w + 22 = -13. Let g = w + j. Calculate the remainder when 3 is divided by g. 1 Suppose 4o - 4b = -84, 3o + 66 = -o - 2b. Let l = 42 + o. Let q = 25 + 22. Calculate the remainder when q is divided by l. 23 Let y = -45 + 70. Calculate the remainder when y is divided by 9. 7 Suppose 3d - 3z - 33 = 0, 0z - 15 = 3z. Suppose -4v = -133 + 45. What is the remainder when v is divided by d? 4 What is the remainder when (1 - 10/8 - -1)32 is divided by 15? 9 What is the remainder when ((-3)/5)/(34/(-3570)) is divided by 6? 3 Let s = 5 + -1. Suppose 0z + sz - 88 = 0. Let c = -77 - -141. What is the remainder when c is divided by z? 20 Let b(n) = -n2 - 15n + 13. What is the remainder when b(-13) is divided by 10? 9 Let k(w) = -4 - 13w + 8w + 6w. What is the remainder when 4 is divided by k(7)? 1 Suppose 3s = 4t + 124, 0 = -2s + 2t + 3t + 85. Let d = s - 23. Let p(k) = k + 9. Calculate the remainder when d is divided by p(0). 8 Suppose 3q + 6 = 0, j + 2q + 16 = 4j. Suppose -y + 130 = jy. Calculate the remainder when y is divided by 10. 6 Let w(i) be the second derivative of i*4/6 + 11i3/6 + i2/2 + 2i. What is the remainder when w(-8) is divided by 14? 13 Suppose 2w = -u + 36, w + 4u = -w + 42. Suppose -33 = -5t + 2h + w, 4h = t - 10. Calculate the remainder when t is divided by 4. 2 Suppose -3o = -5l - 0o + 187, 5 = 5o. Calculate the remainder when l is divided by (-45)/(-12)(-16)/(-6). 8 Let m = -7 + 11. Let t = -1 + m. Let b = -2 + 10. What is the remainder when b is divided by t? 2 Let p(v) = -22v - 2. Suppose 5j + 15 + 20 = 0. Let b(g) = -7g - 1. Let l(o) = jb(o) + 2p(o). What is the remainder when l(3) is divided by 10? 8 Let o(j) = j*2 + 2j - 5. Let y = 15 - -2. What is the remainder when y is divided by o(-5)? 7 Suppose -d = 3i - 5, 5i = -d + 1 - 2. Suppose 0q - 120 = -5q. Calculate the remainder when q is divided by d. 10 Let u(p) = -5p2 + 3p - 7. Let i be u(-6). Let w be 4/16 + i/4. Calculate the remainder when 25 is divided by w/(-4) - 5/(-20). 12 Suppose 4w - 9w = 0. Suppose 2q - 13 + 7 = w. Calculate the remainder when -47(0/q + -1) is divided by 12. 11 Let w = -10 + 6. Let j be 44/3 + w/6. Calculate the remainder when 60/j + 6/(-21) is divided by 3. 1 Suppose 2l - 4g = 4, -5g - 12 = -3l - 3. What is the remainder when l is divided by (-6)/4(2 + -4)? 2 Suppose 2z + 16 = 4z. Let k(r) = r3 - 10r*2 - 9r - 13. Let u be k(11). Suppose -3f = -0f - u. Calculate the remainder when z is divided by f. 2 Suppose -3d + 6 + 9 = 0. Let j(i) be the second derivative of i4/6 - i3 - 5i*2/2 + 2i. Calculate the remainder when 28 is divided by j(d). 13 What is the remainder when 62 is divided by (24/(-10))/((-3)/(-8))-5? 30 Suppose 0 = l, -4l - 16 - 8 = 3w. Let m = 28 - -4. Calculate the remainder when m is divided by ((-55)/20)/(2/w). 10 Let w = 0 - -6. What is the remainder when ((-56)/w)/((-2)/6) is divided by (20/(-14))/((-2)/14)? 8 Suppose 8o = o + 105. Calculate the remainder when o is divided by 6. 3 Suppose -4c - 2x + 134 = -0c, -5c - 2x + 168 = 0. Let i = 66 - c. What is the remainder when i is divided by 11? 10 Suppose 107 + 4 = 3t. Let u be (-6)/3 - t-1. Let l = u - 24. What is the remainder when 32 is divided by l? 10 Let o = 4 - 6. Let a be 1/(o2/8). Calculate the remainder when 47 is divided by 228/14 - a/(-7). 15 Let b = -18 - -10. What is the remainder when (-4)/b + 37/2 is divided by 7? 5 Let u = -8 - -8. Suppose s + 5j = 15, -2s - 4j + 0j + 54 = u. What is the remainder when s is divided by 12? 11 Let t = 10 - 10. Suppose 4k + 8 = 0, 4k + t = -s + 23. Suppose 5o + 5b = 2b + s, -o + 2b = -14. What is the remainder when 14 is divided by o? 6 Calculate the remainder when 134 is divided by (34/6)/(4/24). 32 Let r(n) = -12n2 - 2n - 1. Let t be r(-1). Let m = t - -18. Suppose m + 6 = p. Calculate the remainder when p is divided by 5. 3 Let j = 120 + -43. What is the remainder when j is divided by 20? 17 Let k be (2/(-4))/(1/(-10)). Suppose -3s - k = -4s. What is the remainder w	{ "pile_set_name": "DM Mathematics" }
) - x(q). 1601q2 Let t(j) = 2j - 2. Suppose 0 = -b + 7b + 84. Let o(p) be the third derivative of -5p*4/12 + 5p*3/3 + 34p*2. Give bt(l) - 3o(l). 2l - 2 Let o(g) = -g*3 - 2g. Let y be -2 - (-36)/(-10) - (-30)/(-75). Let r(x) = x*3 + 2x. Give yr(v) - 7o(v). v*3 + 2v Let b be (1/(2/14))/1. Let x(h) = -17h + 9. Let t(o) = -72o + 38. Let i(s) = 2t(s) - 9x(s). Let c(q) = 13q - 7. Give bi(u) - 5c(u). -2u Let t(k) = -1 + 1 - 1. Let c(r) = -r2 - r + 7. Let m(s) = s3 - s*2 - s + 2. Let a be m(1). Let p be (17 + -13)/(4a). Calculate pc(o) + 5t(o). -o2 - o + 2 Let j(q) = -q2 - q - 1. Let o(y) = 3y2 + 3y - 4. Let h(w) = j(w) + o(w). Let p(b) = 4 - 2 - 3. Let k be 11/(-33) - (-16)/12. Calculate kh(a) - 6p(a). 2a2 + 2a + 1 Suppose 6 + 15 = -3r. Let c(y) = -10y + 6. Let v(x) = 4 + 1326x - 444x - 443x - 446x. Determine rv(l) + 5c(l). -l + 2 Let g(j) = -31j2 + 20j + 20. Let r(a) = 11a2 - 7a - 7. Let h(o) = -6g(o) - 17r(o). Let b = 1 + -7. Let u(z) = 6z2 + 3z + 3. Give bh(l) - 2u(l). -6l2 Let c(i) be the third derivative of i4/24 - 7i*3/6 + 40i*2 + 3. Let x(l) = 3l - 14. What is -5c(b) + 2x(b)? b + 7 Let c(o) = -3o2 + 25o - 6. Let i(t) = 2t2 - 13t + 3. Calculate 3c(l) + 5i(l). l*2 + 10l - 3 Let t(g) = 3g - 3. Let p(h) be the second derivative of h3/6 - h2/2 - 18h. What is -8p(x) + 3t(x)? x - 1 Suppose 0 = 4g - 6 - 2. Let h(o) = 11o*2 - 16o*g - 2o2 - 4. Let z(c) = c2 + 1. What is -h(q) - 4z(q)? 3q*2 Let t(i) = -7i*3 + 6i*2. Let w(p) = -19p*3 + 14p*2 + 10. Let m(r) = 9r*3 - 7r*2 - 4. Let z(n) = -5m(n) - 2w(n). Give -7t(y) + 6z(y). 7y*3 Let w(h) = 7h*3 - 6h*2 + 6h + 6. Let p(f) be the first derivative of f4/4 - f3/3 + f*2/2 + f - 1. Let o = 2189 - 2183. Give op(u) - w(u). -u*3 Let i(v) = 4v*2 + 3v - 4. Let u(h) = -3h2 - 3h + 2. What is 2i(n) + 3u(n)? -n*2 - 3n - 2 Let l(k) = 5k3 + 9k*2 + 209k + 3. Let x(b) = -13b3 - 24b*2 - 627b - 8. What is -8l(f) - 3x(f)? -f*3 + 209f Let i(l) = -3l2. Let h(t) be the third derivative of -15t*2 + 0t + 0t4 + 0 + 7/60t*5 + 0t*3. Determine 6h(r) + 15i(r). -3r*2 Let v(l) = 5l*2 + 1. Let a(j) = 2j*2 + 227083j - 227083j. What is 7a(z) - 3v(z)? -z2 - 3 Let x(f) = f. Let c(t) = -3. Let k(q) = -13. Let a(d) = 9c(d) - 2k(d). Determine -a(y) - 5x(y). -5y + 1 Let f(s) = -2s + 1. Let h(o) be the first derivative of -o*2/2 - 48. Determine f(g) - 3h(g). g + 1 Suppose 5a = -0a. Suppose 5b + 1 - 16 = a. Let d(s) = 6s*3 + 8s*2 - 8s. Let j(m) = -m*3 + 3m - 3m2 + 0m3 - m3. Determine bd(y) + 8j(y). 2y3 Let k(h) = h2 - 3h + 2. Let j(w) = 4w - 13. Let z be j(6). Let c(b) = -1 + 742b - 758b + 12 + 6b*2. Give zk(n) - 2c(n). -n2 - n Let u(c) = 2c*2 + c + 2. Let x = 4 + -7. Let i(j) = 2j*2 + 2j + 3. Suppose 0g + 4b + 14 = g, 6 = -3g - 4b. Give gi(y) + xu(y). -2y2 + y Let l(y) = 3y + 40. Let x = 1 + -13. Let r be l(x). Let k(i) = 2i2 + i + 3. Let h(n) = -3n*2 - n - 4. Give rk(j) + 3h(j). -j2 + j Let a(o) = 13o*3 - 6o*2 + 7o - 4. Let d(c) = -24c3 + 11c*2 - 13c + 7. What is -7a(i) - 4d(i)? 5i3 - 2i*2 + 3i Let q(f) = -4f3 - 3f - 2. Let w(d) = -2d2 - 30d - 18. Let y be w(-14). Let o(g) = -yg + 14g + 1 + 5g3 + 1. Determine -5o(r) - 6q(r). -r3 - 2r + 2 Suppose -23m = -86 - 98. Let x(w) = w3 + 3w*2 - 5w - 1. Let d(z) = 2z3 + 8z*2 - 14z - 3. What is mx(k) - 3d(k)? 2k3 + 2k + 1 Let q(k) = -8k2 - 4k. Let l(j) be the second derivative of 1/6j3 + 0j*2 + 0 + 7j + 1/12j4. Give -4l(n) - q(n). 4n2 Let d(n) = 4n2 - n - 2. Let r(s) = s2 - s - 1. Suppose 6v = 29 - 5. Suppose vu - 8 = -4. What is ud(x) - 2r(x)? 2x2 + x Let f(w) = 458w - 3. Let n(c) = -33896c + 223. Calculate 223f(l) + 3n(l). 446l Let t(s) = 4s - 1. Let w(n) = -7n + 3. Calculate -10t(x) - 6w(x). 2x - 8 Let l(t) = 6t*3 + 7t + 7. Let j(h) = 5h3 + 7h + 6. Let b be (-336)/(-72)(-6)/4. Give bj(s) + 6l(s). s3 - 7s Let n(y) = -35y2 + 28y. Let g(t) be the third derivative of -t5/15 + t4/8 - 2t2 + 206. Determine -28g(w) + 3n(w). 7w*2 Let i(j) = 550j + 15. Let a(t) = 550t + 20. Give 3a(p) - 4i(p). -550p Let p(z) be the third derivative of -z4/24 + z3/6 + 14z2. Let r = 43 + -44. Let l(b) = b2 - 4b + 6. Give rl(o) + 6p(o). -o*2 - 2o Let m = -7 + 20. Let h(k) = 2k + 15. Let a(l) = -l - 7. Suppose -7p - 45 - 25 = 0. Let f be 3/(3 - p/(-4)). Give fh(w) + ma(w). -w - 1 Let m(c) = -c - 4. Suppose v = 5v + 4. Let w(l) be the first derivative of -l - 5. Calculate vw(t) + m(t). -t - 3 Let s(d) = -12d3 - d2 + 2d + 18. Let g(l) = -19l3 - 2l*2 + 3l + 37. What is -3g(k) + 5s(k)? -3k3 + k2 + k - 21 Suppose -r - 3n - 8 = 13, -5r - 40 = 2n. Let b(u) = 5u + 12 + 15 + u2 - 22. Let m(l) = 6l + 6. Calculate rb(z) + 5m(z). -6z2 Let i(m) = -m - 1. Let c(s) = -5s + 7. Let o(l) = c(l) - 6i(l). Let t(w) = 6. Let a(r) = 4o(r) - 9t(r). Let d(k) = -4k + 3. Determine -3a(q) - 2d(q). -4q Let d(x) = -7x + 2. Let r(j) be the third derivative of -j4/8 + j3/6 - 7j2 + 15j. Give -2d(v) + 5r(v). -v + 1 Suppose -74r + 94r - 60 = 0. Let n = 2 - -1. Let d be ((-5)/n)/((-2)/(-6)). Let f(h) = -h3 + 5. Let g(s) = -s3 + 3. What is dg(q) + rf(q)? 2q3 Let v(s) = s3 + 2s*2 + 4s + 2. Let x(w) = -7w - 3 - 12w3 + w3 + 10w3 - 3w*2. What is 7v(d) + 4x(d)? 3d*3 + 2d*2 + 2 Let p(g) = -10g*3 + 5g - 5. Let r(d) = 23d3 - 4d + 4. Let t(z) = 25z3 - 3z + 3. Let f(u) = -5r(u) + 4t(u). What is 5f(n) - 8p(n)? 5n3 Let o(v) = v2. Let r = -16 - -2. Let l = 47 + -45. Let t(a) = -a3 + 7a*2. What is lt(j) + ro(j)? -2j*3 Let m(v) = -v - 2. Let j be m(-5). Suppose -jf + 3i - 6 = 0, -5i - 42 + 2 = 5f. Let k(u) = u - 1. Let b(w) = w2 + 5w - 5. Calculate fk(l) + b(l). l2 Let h(a) = a3 + 5a*2 - 16a + 5. Suppose -6t - 14 = 16. Let l(n) = -2n*3 - 12n*2 + 40n - 12. Give tl(v) - 12h(v). -2v3 - 8v Let z(i) = i*2 - 5i - 3. Let v be z(5). Let u = -2 + 21. Let y(b) = -4b + u - 5 - 5b. Let a(k) = -3k + 5. Calculate vy(p) + 8a(p). 3p - 2 Let j(z) = -12z2 - 3z - 17. Let t(d) = -4d2 - d - 6. Let n = 344 - 361. What is nt(b) + 6j(b)? -4b2 - b Let z(d) = d - 1. Let c(x) be the second derivative of x3/3 + 7x2/2 - 8x. Let q(j) be the first derivative of c(j). What is -q(k) - 2z(k)? -2k Suppose -55s + 10 = -50s. Let n(j) = 2j - 5. Let o(m) = m - 5. Calculate sn(g) - 3o(g). g + 5 Let o(j) = j2 + 1. Suppose 0 = -5v + 7 + 8. Let i(a) = -2a2 + 2a - 3. Determine vo(x) + i(x). x2 + 2x Let q(k) = 5k3 + 36k2 + 17. Let l(b) = -b3 - 7b2 - 3. Give 11l(u) + 2q(u). -u3 - 5u*2 + 1 Let x be (-2)/5 + (-418)/(-95). Let r(h) = 10h*3 - 4h*2. Let f(j) = 20j*3 - 9j*2. What is xf(w) - 9r(w)? -10w*3 Let j(s) = -141s - 2. Let u(h) = -3h - 1. Determine j(v) - u(v). -138v - 1 Let j(h) be the third derivative of 5h6/24 + 11h*4/24 + 35h*2. Let d(p) = -13p*3 - 6p. What is 11d(w) + 6j(w)? 7w3 Let w(z) = 115z*3 - 6z*2 + 2z - 4. Let d(p) = -116p3 + 7p*2 - 2p + 5. Calculate 4d(j) + 5w(j). 111j3 - 2j*2 + 2j Let v be (5/4)/((-1)/4). Let s(t) be the third derivative of -t4/6 + t3/3 + 13t2 + t. Let l(w) = -9w + 3. What is vs(m) + 2l(m)? 2m - 4 Let u(b) = 6b*2 - b - 5. Let x(o) = 2o*2 + 2o - 1. Give -u(d) + x(d). -4d2 + 3d + 4 Suppose o + 37 = 16. Let k(h) = -3h2 - h2 + 3h*2 - h. Let i(z) = 6z*2 + 7z. What is ok(c) - 3i(c)? 3c2 Let w(b) = 7b*3 - 4b + 6. Let r(v) = -57v3 + 33v - 48. Give -4r(m) - 33w(m). -3m3 - 6 Let x = -6 - -12. Let t(y) = 5y - 3. Let c(u) = -4u - 21. Let o be c(-9). Suppose 0 = -5r + 8r + o. Let b(l) = 4l - 2. Give rt(j) + xb(j). -j + 3 Let a(m) = -3m2 - 5m + 110. Let c(b) = 3b2 + 6b - 109. Determine 6a(y) + 5c(y). -3y2 + 115 Suppose -4r = -x + 7, -3r = -4x - 4r - 23. Let j(k) = k2 - k - 1. Let d(v) = -7v*3 - 5v*2 + 5v + 5. Give xj(t) - d(t). 7t*3 Let i(y) = -3y - 3. Let w(k) = 15k2 + 45k +	{ "pile_set_name": "DM Mathematics" }
alculate the highest common factor of 35 and 945. 35 What is the greatest common factor of 15 and 555? 15 What is the highest common factor of 3017 and 49? 7 What is the greatest common factor of 156 and 72? 12 What is the highest common factor of 109 and 8938? 109 What is the greatest common divisor of 171 and 494? 19 What is the highest common divisor of 55608 and 84? 84 Calculate the greatest common factor of 54047 and 49. 49 What is the greatest common factor of 24 and 136? 8 Calculate the greatest common factor of 68 and 2074. 34 What is the greatest common divisor of 9 and 720? 9 What is the greatest common divisor of 148 and 16724? 148 Calculate the highest common factor of 135 and 1647. 27 Calculate the highest common divisor of 3344 and 272. 16 What is the greatest common divisor of 40 and 4840? 40 Calculate the highest common factor of 576 and 256. 64 Calculate the highest common divisor of 208 and 26. 26 Calculate the greatest common factor of 180 and 36. 36 What is the highest common divisor of 176 and 143? 11 What is the highest common divisor of 957 and 44? 11 What is the highest common divisor of 22 and 473? 11 Calculate the greatest common factor of 24 and 18. 6 Calculate the greatest common divisor of 224 and 84. 28 Calculate the greatest common factor of 637 and 273. 91 Calculate the highest common factor of 464 and 48. 16 What is the highest common factor of 192 and 168? 24 Calculate the highest common divisor of 826 and 70. 14 Calculate the greatest common divisor of 8 and 736. 8 Calculate the greatest common divisor of 2576 and 42. 14 Calculate the greatest common factor of 3 and 39. 3 Calculate the highest common factor of 80 and 496. 16 Calculate the highest common factor of 4 and 16. 4 Calculate the greatest common factor of 3886 and 1340. 134 Calculate the greatest common divisor of 54 and 5778. 54 What is the highest common divisor of 242 and 4719? 121 What is the greatest common divisor of 374 and 55? 11 What is the greatest common divisor of 2813 and 29? 29 Calculate the greatest common factor of 42 and 6153. 21 What is the greatest common divisor of 2499 and 147? 147 What is the greatest common factor of 154 and 957? 11 What is the highest common factor of 928 and 406? 58 Calculate the highest common factor of 345 and 2208. 69 Calculate the greatest common factor of 1929 and 9. 3 What is the greatest common divisor of 3223 and 11? 11 Calculate the greatest common factor of 9 and 2592. 9 Calculate the highest common divisor of 831 and 7202. 277 Calculate the greatest common factor of 20 and 490. 10 Calculate the highest common factor of 2688 and 21. 21 Calculate the greatest common divisor of 1727 and 33. 11 What is the highest common divisor of 7 and 63? 7 Calculate the greatest common divisor of 396 and 3300. 132 What is the greatest common factor of 56 and 1316? 28 Calculate the highest common divisor of 15 and 33135. 15 Calculate the greatest common divisor of 21 and 119. 7 What is the greatest common factor of 3649 and 890? 89 What is the highest common divisor of 699 and 3? 3 Calculate the greatest common divisor of 1520 and 320. 80 What is the greatest common factor of 1176 and 360? 24 Calculate the greatest common divisor of 816 and 48. 48 Calculate the highest common divisor of 161 and 851. 23 What is the greatest common factor of 228 and 304? 76 What is the highest common factor of 1691 and 304? 19 Calculate the highest common factor of 75 and 240. 15 Calculate the greatest common divisor of 1178 and 124. 62 What is the greatest common factor of 1746 and 18? 18 What is the highest common factor of 351 and 45? 9 Calculate the greatest common factor of 55 and 4565. 55 What is the highest common factor of 7215 and 130? 65 Calculate the greatest common factor of 7515 and 60. 15 What is the highest common divisor of 136 and 425? 17 What is the greatest common divisor of 11 and 5? 1 What is the greatest common divisor of 2 and 54? 2 Calculate the greatest common factor of 1066 and 26. 26 What is the greatest common divisor of 828 and 2196? 36 What is the greatest common factor of 1898 and 52? 26 What is the greatest common factor of 8181 and 45? 9 What is the greatest common divisor of 11 and 11? 11 What is the greatest common divisor of 468 and 12? 12 What is the greatest common divisor of 3509 and 605? 121 Calculate the greatest common divisor of 50350 and 50. 50 Calculate the highest common divisor of 97 and 2716. 97 What is the greatest common divisor of 136 and 1224? 136 Calculate the highest common divisor of 9 and 81. 9 Calculate the highest common divisor of 46 and 2231. 23 Calculate the highest common factor of 5217 and 423. 141 Calculate the highest common factor of 1755 and 39. 39 What is the greatest common divisor of 1512 and 392? 56 What is the greatest common divisor of 343 and 1519? 49 What is the highest common factor of 1738 and 7268? 158 What is the highest common divisor of 52 and 3666? 26 What is the highest common factor of 765 and 90? 45 Calculate the greatest common factor of 58 and 754. 58 Calculate the greatest common factor of 14 and 49. 7 Calculate the highest common divisor of 38 and 5035. 19 Calculate the highest common factor of 1990 and 50. 10 What is the highest common factor of 21770 and 14? 14 What is the highest common divisor of 50 and 188? 2 Calculate the greatest common divisor of 480 and 180. 60 Calculate the highest common factor of 55741 and 7. 7 What is the highest common factor of 50 and 30? 10 Calculate the highest common divisor of 4584 and 8. 8 Calculate the highest common divisor of 34 and 1598. 34 What is the greatest common factor of 104 and 650? 26 Calculate the highest common divisor of 437 and 703. 19 Calculate the greatest common factor of 16 and 5896. 8 Calculate the greatest common factor of 9 and 927. 9 What is the highest common divisor of 63 and 14? 7 Calculate the highest common factor of 17913 and 21. 21 Calculate the highest common divisor of 184 and 230. 46 What is the highest common factor of 731 and 85? 17 Calculate the highest common factor of 1008 and 56. 56 Calculate the greatest common divisor of 105 and 119. 7 What is the highest common divisor of 247 and 13? 13 What is the highest common divisor of 60 and 380? 20 Calculate the greatest common divisor of 2205 and 45. 45 Calculate the highest common factor of 583 and 11. 11 What is the greatest common divisor of 13 and 214? 1 What is the greatest common divisor of 21 and 609? 21 What is the greatest common factor of 25 and 670? 5 What is the greatest common divisor of 896 and 7? 7 Calculate the highest common factor of 54 and 24894. 54 Calculate the highest common factor of 7825 and 313. 313 Calculate the highest common divisor of 7015 and 460. 115 Calculate the greatest common divisor of 156 and 10356. 12 Calculate the highest common divisor of 608 and 19. 19 Calculate the greatest common factor of 721 and 1545. 103 What is the greatest common divisor of 1441 and 11? 11 What is the highest common divisor of 5986 and 738? 82 Calculate the highest common factor of 783 and 216. 27 Calculate the greatest common factor of 1584 and 66. 66 Calculate the greatest common divisor of 60 and 24. 12 What is the greatest common factor of 29 and 232? 29 Calculate the highest common divisor of 1276 and 16. 4 Calculate the highest common divisor of 200 and 304. 8 Calculate the highest common divisor of 745 and 10. 5 Calculate the highest common factor of 26 and 2483. 13 What is the highest common divisor of 36 and 198? 18 What is the greatest common divisor of 357 and 459? 51 Calculate the greatest common factor of 245 and 6517. 49 What is the greatest common factor of 225 and 81? 9 What is the highest common factor of 11 and 154? 11 What is the highest common divisor of 1703 and 39? 13 What is the greatest common divisor of 12 and 12? 12 Calculate the greatest common factor of 95 and 1045. 95 What is the greatest common divisor of 133 and 171? 19 Calculate the greatest common divisor of 446 and 4. 2 Calculate the highest common factor of 8 and 52. 4 What is the highest common factor of 24233 and 22? 11 Calculate the highest common factor of 90 and 240. 30 What is the greatest common factor of 266 and 406	{ "pile_set_name": "DM Mathematics" }
-5l = -25, -5l - 61 - 14 = -5z. Suppose -w = -6w + z. Let p(h) = -h*2 - 6h + 47. Let k be p(-10). Solve 23 = -wg + k for g. -4 Let n(s) = s3 + 8s*2 + 2. Let j be n(-8). Suppose 2d - 17 = -4f + 1, jf = 3d - 3. Solve r - 8 + d = 0 for r. 5 Suppose 5g + 23 = c + 2c, -16 = 4g. Solve 5j + 9 = -c for j. -2 Let h(l) = -3l3 - l2 - l - 2. Let f be h(-2). Let c(t) = 6t - 10. Let i be c(3). Let z be (-5)/(-2) - (-4)/i. Solve -2g = zg + f for g. -4 Suppose 2h - 18 - 2 = 0. Let w(m) = 2m3 + 5m*2 + 11. Let s be w(-3). Suppose -h - s = -3z. Solve 0 = q - 1 + z for q. -3 Let c(i) = 4i2 + 56i + 52. Let m be c(-13). Solve -9s + 21s = m for s. 0 Let c(i) = -i*3 - 9i2 + i + 11. Let u(w) = -w3 - 11w2 - 2w - 2. Let b be u(-11). Let y = 11 - b. Let j be c(y). Solve m + jm = -12 for m. -4 Let g be (-16)/(-10) + (-12)/(-5) + -2. Let c be ((-64)/(-80))/(g/10). Solve 5d = c + 6 for d. 2 Let p(h) be the first derivative of h*2/2 + 23h + 8. Let q be p(-17). Solve 5d + 1 = q for d. 1 Suppose -3s - 109 = -4o, 2o - s - 68 + 15 = 0. Solve -2a = -7a + o for a. 5 Let z(h) = -h*3 + 2h*2 + h + 8. Let k(a) = 2a*3 - 5a*2 - 2a - 17. Let x(v) = -6k(v) - 13z(v). Let u be x(-4). Solve 3l + u = 4l for l. 2 Let y = 286 + -283. Solve 0m - ym = -7m for m. 0 Let x = 215 + -207. Solve 16 = 4h - xh for h. -4 Let r be 2/8 + 272/(-64). Let j be (13/5 + -3)/(r/120). Solve -2l + j = -5l for l. -4 Let w = -31 + 66. Suppose -3i + 142 = 2v + 2v, -4i = 2v - 66. Let y = v - w. Solve 2 = 4q - y for q. 1 Suppose -v - 2l + 5l = -43, -3v - l = -159. Solve -vx - 15 = -67x for x. 1 Suppose -51h - 973 = -3268. Solve -5p - h = 4p for p. -5 Suppose 11o = -18o + 3o. Solve u = -ou + 4 for u. 4 Let q = -91 - -98. Solve -4h + qh = 6 for h. 2 Let v(b) be the second derivative of b5/20 - b4 + 13b*3/6 - 17b*2/2 - 3b. Let u be v(11). Solve ur = -4 - 11 for r. -3 Let a = 3 + -3. Let u be ((-2)/4a)/(-1). Suppose -1259 = 3o - 1265. Solve u = -oq - 9 - 1 for q. -5 Let d = 399 + -379. Solve dk = 18k + 10 for k. 5 Let m = -338 + 343. Solve -m + 7 = -b for b. -2 Suppose 90i - 12 = 12 + 66. Let z(o) = -o + 5. Let a be z(0). Solve -i = -an - 6 for n. -1 Let s(o) = -o*2 + 6o - 4. Let f be s(4). Let x = -546 - -555. Solve -z - x = -fz for z. 3 Let w be (-2)/32-44. Let l be w/4 + 1/(-4). Solve lx + x = 4 for x. 4 Let u be (0 - 1)0(-6)/(-36). Solve u + 1 = -o for o. -1 Suppose -8 = j - 4j + f, 4f = -5j + 2. Let x = 24 - 20. Solve -jn + x + 2 = 0 for n. 3 Let o be -1(-24)/(-9)-3. Solve 0 = -12d + 10d + o for d. 4 Let b(o) = 16o + 458. Let g be b(-27). Solve -23r - 3 = -gr for r. 1 Suppose -73d = -24d - 343. Solve 0 = -14m + dm + 28 for m. 4 Suppose 2n = 5n. Suppose h = 3x + 15, nh - 3h = -2x - 17. Let u(g) = -g2 - 2g + 38. Let m be u(5). Solve m = hy - 3 for y. 2 Let l(m) = -m2 + 8m + 243. Let q be l(-12). Solve -5 = -qw - 2 for w. 1 Let n = -8 - -8. Suppose 4z - 4p - 7 = -5p, z - 5p - 7 = n. Suppose -12 = -2y - zy. Solve 2x = yx for x. 0 Let n(t) be the second derivative of -t4/12 - 2t*3/3 + 3t*2/2 + 9t. Let y be n(-4). Solve 7 - 1 = -yd for d. -2 Suppose 101x - 107x = -18. Solve -3 = xr - 6 for r. 1 Suppose 5r = -3y + 15, 5y = -3r + 67 - 26. Solve -7u + yu + 9 = 0 for u. -3 Let i(r) = -r*3 + 8r*2 - 12r - 1. Let b be i(3). Solve b = -0t + 4t for t. 2 Suppose 4q = -4t + 35 + 49, -4q + 79 = -t. Suppose 4 = 12j - q. Solve 0 = -jp - 3p for p. 0 Let y = -58 - -68. Solve -y = b - 3b for b. 5 Let g = -24 + 84. Suppose r = 4r - g. Let c = r - 12. Solve 2o - c = -2o for o. 2 Let n(c) = -2c2 + 4. Suppose -s + 0 = -3b - 2, -5s - 28 = 4b. Let a be n(b). Let d = 6 + a. Solve -dk = -1 - 3 for k. 2 Let m = -2 - 6. Let r be 2/((-28)/(-21)(-3)/m). Solve -u - ru + 20 = 0 for u. 4 Let b(t) = t2 - 3t - 199. Let j be b(16). Solve jw - 7w = -4 for w. -2 Let b = -8 - -15. Suppose 5p + 22 = 3o, p = 7o - 6o - 6. Let z be (-4)/(-20) + (-64)/(-5). Solve -ov - b = z for v. -5 Suppose 0 = -5l + 43 + 77. Suppose 11a - 9a = l. Suppose -2 - 10 = -3y - h, -4h = -3y + a. Solve d - 1 = y for d. 5 Let x(u) = -4u + 25. Let l be x(4). Solve -5s + ls - 8 = 0 for s. 2 Suppose 0 = 5t - 10t. Solve 7z + 28 = -tz for z. -4 Suppose -5x = -2c + 11 + 14, 0 = -3c - 5x. Suppose -2k + 3j + c = 4j, 3k = -j + 9. Suppose 5f - 9 = 2f. Solve -k = -fq + 5 for q. 3 Suppose 2r - 3x - 5 = 0, -38 = -2r + x - 23. Solve -36 = rb + 2b for b. -3 Suppose -5x = -0 - 5. Suppose 0 = 5f - 3f - 2l - 18, -l - 13 = -2f. Let i be 6/f-26(-4)/12. Solve x - i = -3h for h. 4 Suppose -4 = 2r - 3r. Let x = 7 - 8. Let c(g) = -g3 - g2 - g - 1. Let h be c(x). Solve -2t + 8 - r = h for t. 2 Let a = 28 - 10. Suppose -8g - 2 = -a. Suppose -n + 57 = gn. Solve -4c - 1 = n for c. -5 Suppose -5c - 9 - 11 = 0. Suppose 3m - 311 + 323 = 0. Let f = m - c. Solve fb + 4b = 0 for b. 0 Let o be 6/5(-40)/(-6). Suppose 2c - 8 = 2i - i, 4i + o = 2c. Solve -2z = -4z + c for z. 2 Let g = -45 + 48. Let w be (g/(-2) + 108/8)/2. Solve -4k + w = 2 for k. 1 Let t(r) = -3r3 - 10r*2 + 7r + 9. Let b be t(-4). Solve 4z - b = -21 for z. -2 Suppose 8 = -14o + 16o. Suppose 0 = -ot + 9 + 11. Solve 0y + 5y + t = 0 for y. -1 Let i(a) = -7a - 3. Let s be i(-2). Suppose -y - n = y - s, -3y = -4n - 11. Solve 0 = 3z - yz - 6 for z. -3 Suppose c = 5g - 13, c - 2 = 3c - 2g. Let f be (64/(-16))/(-1(4 - c)). Solve 5 - f = -k for k. -3 Let x = 12 + -6. Suppose -30 = -5t + 5u, -3t + 25 = 2u + 22. Solve xd - 15 = td for d. 5 Suppose -2 = 3x - 8, 3s - 2x - 8 = 0. Let i = -332 - -352. Suppose -4v = -4b + 16, v = -5b - sv + i. Solve b = -4y + 2y for y. -2 Suppose 5 = -4n + 33. Suppose -5 = -4d - s, -4d + 16 = -5s - n. Solve 8 = 2y - d for y. 5 Suppose 7r - 11 = -4o + 8r, -21 = o - 5r. Suppose k + 2k - 5n + 20 = 0, 3k + o = n. Solve 4u + 0 + 4 = k for u. -1 Suppose -5y = -0y - 65. Suppose 2s - 2k + 6 = 0, -s - k = 2k - y. Solve 0p = p - s for p. 1 Suppose 4n + y = 39, 5y = -n + 2y - 4. Solve -nw = 12 - 34 for w. 2 Let b = 326 - 326. Solve 5n - 3n = b for n. 0 Let j be (-9)/(-6) - 3/(-2). Suppose ji - 85 = -13. Suppose -5b - 2x + i = -3x, -3b + 10 = -5x. Solve bz = -7 + 17 for z. 2 Let w(a) = -a3 - a2 - 7a + 25. Let d be w(5). Let c = d - -168. Let n(x) = 29x - 1. Let h be n(1). Solve h - c = 4p for p. 5 Suppose -12y + 7y = 30. Let a be 3/(y/(-2)) + 0. Let g be ((-28)/(-12) - a)3. Solve gj - 15 = 1 for j. 4 Suppose 12f - 14 = 46. Let x(a) = 2a3 - 12a*2 + 10a + 3. Let n be x(f). Solve 0 = j - 0 + n for j. -3 Let u = 126 + -126. Suppose 0 = -5x + 2x. Solve x = -ur + r + 5 for r. -5 Let x = 230 - 226. Solve 0 = -5p + 3p + x for p. 2 Let m = 46 - 43. Solve -3j - m = 6 for j. -3 Let v be (-55)/20(-21 - -1). Let t be (-9)/(-2) - 2/(-4). Suppose 2 = n, -3n - v = -tp - 8n. Solve -pk = -4k + 5 for k. -1 Let c = -57 - -192. Let p be (-27)/c - (-1 + (-12)/10). Solve 3 + p = n for n. 5 Let x be -4 - (-1 - (-9 + 0)). Let d be (36/10)/(x/(-40)). Let t be (-4)/d - (-13)/3. Solve -tm - 5 - 7 = 0 for m. -3 Let u be (-4)/(-2)1 + 2. Let p be (-3)/6 - (-4 + (-695)/10). Suppose -7 - p = -4m. Solve 0 = -un - n - m for n. -4 Let q = 4 + -4. Suppose -3j - n = 3, j + 0n = -n - 3. Let w be (-9)/(-1)(1 + j). Solve -2m - m + w = q for m. 3 Let m = 13 + -9. Let g(u) = u*3 + 3u*2 + 2u + 2. Let k be g(-3). Let q be (34 - k)(-1)/(-2). Solve m = -3j + q for j. 5 Suppose s = 3 + 3. Let x be -18 + 4 + (2 - -2). Let z be 34/10 - (-4)/x. Solve zc + s = -3 for c. -3 Let u(s) = -s2 - 2s + 4. Let n be u(1). Suppose -7b + n = -34. Solve -o + b = -0 for o. 5 Let r be 1((-3 - -4)1 + 11). Let g be 4/6 - (-52)/r. Solve 5f = 15 + g for f. 4 Suppose 2 = t - 1. Let f be (t + 0 + -5)-2. Solve s = fs for s. 0 Let g be (1 + -1 + 2)/(20/30). Solve 5c = g + 12 for c. 3 Suppose 128y - 2056 = 632. Solve 0 = 15v - 66 + y for v. 3 Suppose -2p - 14 = b, 0 = -5b + 2p + p - 70. Let w(o) = o*3 + 13o*2 - 14o + 3. Let v be w(b). Let i = 5 - -1. Solve 6r = vr - i for r. -2 Let h = -6 + 12. Suppose -5g + 3z = -44, 4*g	{ "pile_set_name": "DM Mathematics" }
mon factor of 44 and 55? 11 Calculate the highest common factor of 130 and 494. 26 What is the highest common factor of 245 and 5? 5 Calculate the greatest common factor of 106 and 265. 53 Calculate the greatest common divisor of 95 and 57. 19 What is the highest common divisor of 1963 and 13? 13 Calculate the highest common factor of 88 and 96. 8 What is the greatest common factor of 4 and 16876? 4 What is the greatest common divisor of 207 and 72? 9 Calculate the highest common divisor of 5 and 320. 5 Calculate the highest common factor of 435 and 87. 87 What is the greatest common divisor of 13 and 2119? 13 Calculate the greatest common divisor of 6 and 1194. 6 Calculate the greatest common divisor of 212 and 12. 4 Calculate the greatest common factor of 41 and 11357. 41 Calculate the highest common divisor of 308 and 3476. 44 What is the greatest common factor of 306 and 72? 18 What is the highest common divisor of 140 and 182? 14 What is the highest common divisor of 37 and 1? 1 What is the highest common divisor of 80 and 15? 5 Calculate the highest common factor of 84 and 28. 28 Calculate the greatest common divisor of 36 and 1548. 36 What is the greatest common divisor of 64 and 688? 16 Calculate the highest common factor of 3264 and 255. 51 Calculate the highest common factor of 2662 and 22. 22 Calculate the highest common factor of 704 and 264. 88 What is the greatest common factor of 40 and 64840? 40 What is the highest common factor of 812 and 252? 28 Calculate the greatest common factor of 119 and 2516. 17 What is the highest common factor of 3 and 21? 3 Calculate the greatest common divisor of 476 and 3052. 28 Calculate the greatest common divisor of 14842 and 82. 82 Calculate the greatest common factor of 56 and 308. 28 Calculate the highest common factor of 1264 and 16. 16 What is the highest common divisor of 754 and 234? 26 What is the highest common divisor of 1702 and 629? 37 What is the greatest common factor of 119 and 35? 7 Calculate the highest common factor of 1022 and 378. 14 Calculate the highest common factor of 3024 and 231. 21 What is the greatest common factor of 1189 and 123? 41 What is the highest common divisor of 2810 and 10? 10 What is the greatest common divisor of 136 and 1139? 17 Calculate the highest common divisor of 6897 and 33. 33 What is the highest common factor of 16 and 872? 8 What is the highest common factor of 6 and 15? 3 What is the highest common divisor of 124 and 1984? 124 What is the greatest common factor of 80 and 200? 40 Calculate the greatest common factor of 18 and 324. 18 Calculate the highest common factor of 84 and 36. 12 Calculate the highest common factor of 148 and 370. 74 Calculate the greatest common factor of 285 and 24985. 95 What is the greatest common divisor of 322 and 7? 7 Calculate the greatest common divisor of 124 and 31. 31 Calculate the highest common factor of 606 and 59691. 303 Calculate the highest common divisor of 328 and 56. 8 Calculate the highest common factor of 580 and 15. 5 What is the highest common factor of 68 and 28492? 68 What is the greatest common divisor of 5439 and 1036? 259 What is the highest common divisor of 60 and 60? 60 Calculate the greatest common divisor of 64 and 2. 2 What is the greatest common factor of 1540 and 1980? 220 Calculate the highest common divisor of 40 and 1220. 20 Calculate the highest common divisor of 18 and 300. 6 Calculate the highest common factor of 7 and 1. 1 What is the highest common divisor of 2840 and 120? 40 Calculate the highest common factor of 31862 and 178. 178 What is the highest common divisor of 632 and 237? 79 Calculate the greatest common divisor of 19664 and 48. 16 What is the highest common divisor of 10 and 415? 5 Calculate the highest common divisor of 37362 and 52. 26 What is the highest common factor of 55 and 649? 11 What is the greatest common factor of 56 and 308? 28 What is the highest common divisor of 429 and 78? 39 Calculate the greatest common divisor of 2448 and 88. 8 Calculate the greatest common divisor of 91 and 52. 13 Calculate the greatest common divisor of 30 and 165. 15 Calculate the highest common divisor of 1194 and 24. 6 What is the highest common divisor of 15 and 135? 15 Calculate the highest common factor of 44 and 3454. 22 What is the greatest common divisor of 625 and 1625? 125 What is the highest common factor of 256 and 1600? 64 What is the highest common divisor of 45 and 355? 5 What is the highest common factor of 14 and 728? 14 Calculate the highest common factor of 132 and 3102. 66 Calculate the greatest common divisor of 4 and 7132. 4 What is the greatest common factor of 1786 and 658? 94 Calculate the highest common divisor of 286 and 44. 22 What is the highest common divisor of 31 and 124? 31 What is the highest common factor of 390 and 65130? 390 What is the greatest common factor of 209 and 418? 209 What is the greatest common divisor of 4876 and 1908? 212 Calculate the highest common divisor of 66 and 2266. 22 Calculate the highest common factor of 192 and 54. 6 Calculate the greatest common factor of 6252 and 12. 12 Calculate the highest common factor of 528 and 432. 48 Calculate the greatest common divisor of 1495 and 13. 13 What is the greatest common factor of 64 and 240? 16 Calculate the greatest common divisor of 708 and 12. 12 What is the highest common divisor of 186 and 155? 31 What is the greatest common divisor of 8998 and 66? 22 Calculate the highest common divisor of 105 and 49. 7 Calculate the greatest common divisor of 18 and 63. 9 What is the highest common factor of 54 and 972? 54 What is the highest common divisor of 23 and 1219? 23 What is the greatest common factor of 696 and 261? 87 Calculate the highest common divisor of 170 and 646. 34 Calculate the highest common divisor of 345 and 135. 15 Calculate the greatest common factor of 139 and 1. 1 What is the greatest common factor of 108 and 81? 27 Calculate the greatest common divisor of 15 and 8145. 15 Calculate the highest common factor of 452 and 11978. 226 Calculate the greatest common divisor of 5200 and 832. 208 What is the highest common factor of 3185 and 65? 65 What is the highest common divisor of 70 and 30? 10 What is the greatest common divisor of 68 and 1156? 68 What is the greatest common divisor of 96 and 84? 12 Calculate the greatest common divisor of 34 and 13957. 17 Calculate the greatest common divisor of 1281 and 793. 61 Calculate the highest common divisor of 78 and 1339. 13 What is the highest common divisor of 396 and 108? 36 Calculate the greatest common factor of 88 and 3208. 8 Calculate the greatest common factor of 312 and 24. 24 Calculate the greatest common divisor of 16 and 1264. 16 Calculate the highest common divisor of 952 and 1288. 56 Calculate the highest common factor of 1521 and 1170. 117 What is the highest common divisor of 315 and 60? 15 What is the greatest common factor of 7 and 623? 7 Calculate the greatest common factor of 32 and 128. 32 What is the highest common factor of 34 and 272? 34 What is the greatest common factor of 7464 and 24? 24 What is the highest common factor of 1066 and 410? 82 What is the highest common factor of 136 and 8296? 136 Calculate the greatest common factor of 144288 and 36. 36 Calculate the highest common divisor of 640 and 736. 32 What is the greatest common divisor of 72463 and 311? 311 Calculate the highest common divisor of 221 and 234. 13 Calculate the greatest common factor of 3297 and 21. 21 Calculate the highest common factor of 9 and 3. 3 What is the highest common divisor of 22 and 275? 11 Calculate the highest common factor of 64 and 304. 16 Calculate the highest common divisor of 232 and 29. 29 What is the highest common divisor of 286 and 11? 11 What is the greatest common factor of 182 and 77? 7 What is the highest common factor of 668 and 20? 4 Calculate the greatest common divisor of 133 and 76. 19 What is the greatest common divisor of 6 and 226? 2 Calculate the highest common factor of 416 and 533. 13 Calculate the greatest common factor of 11886 and 42. 42 Calculate the greatest common factor of 12863 and 19. 19 What is the greatest common factor of 20100 and 900? 300 What is the highest common	{ "pile_set_name": "DM Mathematics" }
3. -43v3 Collect the terms in 16r + 6 - 14r - 6. 2r Collect the terms in 48d2 - 23d*2 - 27d*2. -2d*2 Collect the terms in -251 + 41g*2 + 251. 41g*2 Collect the terms in 17d*2 + 35d*2 + 22d*2. 74d*2 Collect the terms in -13p*2 + 865p - 865p. -13p*2 Collect the terms in 13r*2 - 23r*3 - 13r*2. -23r*3 Collect the terms in -2v*3 - 8v*2 + 13v*2 + 2v*2 + 20v*2. -2v*3 + 27v*2 Collect the terms in 3k*2 + 16 - 10 - 6. 3k*2 Collect the terms in -35o*3 + 13o*3 - 4 + 4. -22o*3 Collect the terms in -18i - 12i - 3i*2 + 30i. -3i2 Collect the terms in 64 + 53 - 219 - j. -j - 102 Collect the terms in -1529 - 41l*3 + 1529 + 14l*3. -27l*3 Collect the terms in 7 + 8 + 3l - 41. 3l - 26 Collect the terms in 29n2 - n2 + 8n2 + n2. 37n*2 Collect the terms in 9a*2 + 0a*2 + 0a*2 - 15a2 + a2. -5a2 Collect the terms in -18g*2 - 26g*2 + 61g2 - g3 - 17g2. -g3 Collect the terms in 72q*3 - 151q*3 + 83q*3. 4q*3 Collect the terms in 15i*3 + 15i*3 - 18i*3 + 13i*3. 25i*3 Collect the terms in 26 - 3v*2 - 49 - 8v*2 + 23. -11v*2 Collect the terms in -23p + 3p - 2p. -22p Collect the terms in 8 + 11l*2 + 0 - 2 + 0. 11l*2 + 6 Collect the terms in -10z + 7z - 78z. -81z Collect the terms in 0 + 0 - 8h - 47h3. -47h*3 - 8h Collect the terms in -2m2 - 4m*2 - 5m*2 - 2m*2. -13m*2 Collect the terms in 224a*3 - 112a*3 - 131a*3. -19a*3 Collect the terms in 4c*3 + 182c*2 - 325c*2 - 3c*3 + 143c2. c3 Collect the terms in 29 - 64 - 3m + 35. -3m Collect the terms in -32 - 2d + 32. -2d Collect the terms in -2 + 5z + 0 - 4 + 4. 5z - 2 Collect the terms in 2750h - 2750h - 10h3. -10h*3 Collect the terms in -8 + 7 + 30l + 4. 30l + 3 Collect the terms in -4k*2 + 10k*2 + 2k*2. 8k*2 Collect the terms in 2736q - 2736q - 4q*2. -4q*2 Collect the terms in 284g - 105 + 105. 284g Collect the terms in 9z*2 + 4z*2 + 9z*2. 22z*2 Collect the terms in 6d*2 - 5d2 - d2 + 4d2 - 5d2. -d2 Collect the terms in 155 - 155 + 5i3. 5i*3 Collect the terms in 1 - 1 - 767f. -767f Collect the terms in 2 + 11 - 5t + 8t. 3t + 13 Collect the terms in -3f2 + 0f*2 - 6f - 2f. -3f*2 - 8f Collect the terms in 94804 - 94804 + 3s. 3s Collect the terms in 6d2 + 11d*2 - 23d*2. -6d*2 Collect the terms in 16954076c - 16954076c - 2c*3. -2c*3 Collect the terms in 10f - 3f + 8f - 5f. 10f Collect the terms in -o*2 - 6o*2 - 9o*2. -16o*2 Collect the terms in -24b + 4 + 103b - 4. 79b Collect the terms in 2h2 - 2h*2 + 188h*3 - 186h*3. 2h*3 Collect the terms in -242c + c*3 + 2c*3 + 242c. 3c3 Collect the terms in 29z - 61z + 33z + 45z. 46z Collect the terms in -1045j + 641j + 405j. j Collect the terms in 42 - 42 + 13k*2. 13k*2 Collect the terms in 15 + 12 - 14y*3 - 27. -14y*3 Collect the terms in -6n*3 - 28n + 28n. -6n*3 Collect the terms in -229h + 115h - 5h*2 + 114h. -5h2 Collect the terms in 58 - 24n + 26n - 58. 2n Collect the terms in 8s3 + s3 - 3s*3. 6s*3 Collect the terms in -2 - 17x + 3 - 1. -17x Collect the terms in 216v - 113v - 106v. -3v Collect the terms in -4 + 48l - 3 + 7. 48l Collect the terms in 0w - 6 + 2w + 2 + 2w. 4w - 4 Collect the terms in -70n + 23n + 21n + 26n - 2n*2. -2n*2 Collect the terms in 37p*3 - 30p*3 + 77p*3. 84p*3 Collect the terms in 251475d*2 - 251475d2 - d3. -d*3 Collect the terms in -1 + 5 - 3 + w - 2w. -w + 1 Collect the terms in -62t3 + 113t*3 - 69t*3. -18t*3 Collect the terms in -88i*3 + 189i*3 - 95i*3. 6i*3 Collect the terms in 65 - 7q*3 - 65. -7q*3 Collect the terms in 3278r*2 + 3270r*2 - 6552r*2. -4r*2 Collect the terms in 111j*2 - 36j*2 - 32j*2 - 41j*2. 2j*2 Collect the terms in 33 - 33 - 413s*3. -413s*3 Collect the terms in 3o*2 - 98 + 98 - 13o*3. -13o*3 + 3o*2 Collect the terms in 717 - 8d*3 - 717 + 10d*3. 2d*3 Collect the terms in -36 + 0 - 8p + 17p. 9p - 36 Collect the terms in 2c3 - 3c*3 - 9c*3 - 20c*3. -30c*3 Collect the terms in -14v*3 + 4v*3 + 14v*3. 4v*3 Collect the terms in -43n + 18n + 7n*2 + 25n. 7n2 Collect the terms in l + 3111047 - 3111047. l Collect the terms in 5 - 4 - 877l - 1. -877l Collect the terms in 50b - 50b - 5b*3. -5b*3 Collect the terms in 454251 + 0o - 454251 + 0o - 2o*2. -2o*2 Collect the terms in 51l*2 - 105l*2 + 49l*2 - 4l. -5l2 - 4l Collect the terms in m2 - m2 + 2m2 + m2. 3m*2 Collect the terms in 6g*3 + 5g2 - g3 + 5g3 - 5g*2. 10g*3 Collect the terms in -45b*3 + 51b*3 - 117b*3. -111b*3 Collect the terms in -12o*3 + 9o*2 + 16o*2 - 25o*2. -12o*3 Collect the terms in -8a + 23a - 19a. -4a Collect the terms in -176r*3 - 350r*3 - 182r*3. -708r*3 Collect the terms in 1349a*3 - 677a*3 - 685a*3. -13a*3 Collect the terms in -317 + 15b + 159 + 158. 15b Collect the terms in -98n*2 + 45n*2 + 51n*2. -2n*2 Collect the terms in -2z*2 + 2z*2 + 119z*3. 119z*3 Collect the terms in -3k*3 - 519 + 175 + 170 + 174. -3k3 Collect the terms in -t2 + 75t - 75t. -t*2 Collect the terms in 70p*2 - 135p*2 + 51p*2. -14p*2 Collect the terms in 67g*3 - 34g*3 - 34g3. -g3 Collect the terms in -32h + 22h - 6h - 28h. -44h Collect the terms in -2u*3 + 6u*3 + 2u*3 + 6u*3. 12u*3 Collect the terms in 21s*2 + 114s*2 + 21s*2. 156s*2 Collect the terms in 908v + v*2 - 908v. v*2 Collect the terms in 2v - 12v + 5v. -5v Collect the terms in -17o*3 - 10o*3 - 15o*3 + 38o*3. -4o*3 Collect the terms in -554o - 554o + 21o*3 + 1108o. 21o3 Collect the terms in 0q + 2q - 18q. -16q Collect the terms in 982 - 247q*2 - 982. -247q*2 Collect the terms in 5g + 12g + 7g + 7g2 - 8g2. -g2 + 24g Collect the terms in c2 + 11c*2 + 23c*2. 35c*2 Collect the terms in -44261i + 44261i + 84i*2. 84i*2 Collect the terms in -12t*2 + 3t*2 - 4t3 - t2 + 6t3. 2t*3 - 10t*2 Collect the terms in 0c2 + c2 + 6c2 - 2c*2. 5c*2 Collect the terms in 2w*2 + 6w*2 + 6w*2 - 19w*2. -5w*2 Collect the terms in -1 + 1 - 11696j*2. -11696j*2 Collect the terms in -36775o + 2o3 + 36775o. 2o3 Collect the terms in -15600 + 15600 - 3k*2. -3k*2 Collect the terms in 945j*2 - 210j*2 + 315j*2. 1050j*2 Collect the terms in -8b*3 - 22b + 6b + 16b. -8b3 Collect the terms in -2i + i*2 + 32i*2 + 13i*2 + 3i*2. 49i*2 - 2i Collect the terms in 0a - 2a - 27 + 40 - 13. -2a Collect the terms in 108m - 29m + 88m + 9m - 2. 176m - 2 Collect the terms in 27c2 + 25c*2 + 24c*2. 76c2 Collect the terms in -n2 + 30n - 62n + 32n. -n2 Collect the terms in -1 - 5 + 5 - 69y*2. -69y2 - 1 Collect the terms in -q2 - 18 - 3q2 + 18. -4q*2 Collect the terms in 5y*2 - 2659y + 1331y + 1328y - 2y2. 3y*2 Collect the terms in -22s + 7s - 12s. -27s Collect the terms in -9 - 410d*2 + 16 - 7. -410d2 Collect the terms in -4 + l2 - l + l*2 + l. 2l*2 - 4 Collect the terms in -25 + 25 + 83y - 79y. 4y Collect the terms in 7j - 7j*2 - 7j - 5j2. -12j2 Collect the terms in g3 + 4g3 + 6g*3. 11g*3 Collect the terms in -2s*3 + 25223s + 6 - 25223s. -2s*3 + 6 Collect the terms in 4z + 120 - 317 + z2 - 185. z2 + 4z - 382 Collect the terms in 736x*2 + x + 3x - 4x. 736x*2 Collect the terms in -1216778 - 2z*2 + 1216778. -2z2 Collect the terms in p2 + 235p - 235p. p*2 Collect the terms in 0u - 5u + 3u - 157u3. -157u*3 - 2u Collect the terms in -q*3 - 11q*3 + 89q*2 + 79q*2 - 168q*2. -12q*3 Collect the terms in 0k*2 - 3k - 2k2 - 5k. -2k2 - 8k Collect the terms in -3 - 2q + q + 24. -q + 21 Collect the terms in 10q*2 + 14q*2 + 5q*2 - 10q*2. 19q*2 Collect the terms in -20 + 2 + 10 + 9 - 13h. -13h + 1 Collect the terms in 37v + 4 - 4 - 14v - 21v. 2v Collect the terms in -53h*2 - 61h*2 - 56h*2 + 168h*2. -2h**2 Coll	{ "pile_set_name": "DM Mathematics" }
-2l - 47 = j, 4j - 5l - 1392 + 1307 = 0 for j. -5 Solve 0 = -6z + 2z - 165n + 168n + 19, 95 = 2z - 11n for z. -2 Solve -28d + 8 = -20d, 25d + 0 - 34 = -2l + d + 6 for l. 8 Solve -3d + 317p + 309p - 621p + 132 + 5 = 0, 4d - p = 41 for d. 4 Solve 19l - 3l = -6q + 2q - 40, q + 3l + 9 = 0 for q. -6 Solve 13t - 8 = 10x + 626, -17t + 20t + 4 + 2 = 0 for x. -66 Solve 0 = -3r + 3z - 12, 12r + 116z - 119z + 48 = 0 for r. -4 Solve 4y - 501 = -2f - 483, -f = 2y + 2f - 19 for y. 2 Solve 3k - 35 = -620m + 615m, -5k + 5m - 27 = -12k + 8 for k. 0 Solve -2m - 184 = 4c - 178, -m - 32c - 2c = 131 for m. 5 Solve 216o = 2u + 251o - 136, 0 = 2u + o for u. -2 Solve 29d - 27d = 18b - 31b + 45, b + 2d - 9 = 0 for b. 3 Solve -328r + 18 = -2h - 323r, -85 = 7h - 23r for h. 1 Solve 0t + r = 5t - 32, 4t - 44707r - 329 = -44698r for t. -1 Solve -7c - 7c - 2v - 60 = -6v, 31c - 3v + 23 = -23c + 49c for c. -4 Solve 39233g - 39229g = -4v + 48, -14g + 5v + 35 = 0 for g. 5 Solve 0 = -5v + b + 78, 742658b - 742663b = -2v + 22 for v. 16 Solve 0 = 2c - 4j + 5997 - 6001, -3c + 8j - 16j = -34 for c. 6 Solve 2895 = -5i + 5u + 2595, -4i + 200 = 4u for i. -5 Solve -2018k + 2024k - 24 = 0, 3k = 2d - 108 for d. 60 Solve -2n + 19 + 24 + 27 = -3i - 2i - 17, 24 = 8n - 4n for i. -15 Solve -3032k + 3036k - 8u + 120 = 0, 0 = 4k + u + 111 for k. -28 Solve 0 = 5n + 7a + 2, 26n - 31n + 28a = -33 for n. 1 Solve 0 = 7c - s + 492, -2c - 167 = -525s + 530s for c. -71 Solve 214n - 337n + 5j = -120n - 4, 10n + 5j = 100 for n. 8 Solve 2k = -2r + 58, -164r + 170r + 245 = 5k + 56 for r. -4 Solve -h + 4630 - 4824 = 49q, -2h = -0q + q for h. 2 Solve 2f - 3s - 4s = f - 5s, -f - 10s = 0 for f. 0 Solve 20886s + 77 = 20881s + 7z, 0 = s - 5z + 55 for s. 0 Solve 0 = j + 3u + 9, -93j - 614 = -u - 360 + 583 for j. -9 Solve 0 = -2o + 61g - 307, -5g - 103 = 5o - 123 for o. -1 Solve -5y + 90 = -3a, 0 = -109043a + 109045a - 5y + 90 for a. 0 Solve 38n - 41n + 54 = -5r, 4r - 3 = 6n - 111 for n. 18 Solve 909263n = 909261n - 5i + 175, 2n = -26i + 238 for n. 80 Solve k - 75185i + 75188i - 10 = 0, 0 = 8k + i + 12 for k. -2 Solve -12r - 85u + 105 = -82u, 5u - 23 = -r for r. 8 Solve -470j - 2r + 1818 = -524, -15r + 19 = 3j - 16r for j. 5 Solve -o - 42 = 18m, 358m - 1081m + 363m + 364m - 134 = 2o - 7o for m. -4 Solve -4u + 2l + 216 = 0, 2l - 280 = -15141u + 15137u - 48 for u. 56 Solve 0 = -4a + 3k + 11, 2426 - 2399 = 13a - k for a. 2 Solve -2w + 2 = 3l, -20l - 3w + 2 = -15l for l. -2 Solve -4o + 5s + 64 = 0, -o + 108s - 216s - 23 = -106s for o. 1 Solve -4f - 25 = 5j, 75j + 23f - 102 + 407 = 14j + 25f for j. -5 Solve -423 = -47h + 3l - 817, h + 9l - 8l - 30 = 4h for h. -8 Solve 5v + 0v + 6 - 32 = 7u - 12 - 8, 2u = v - 3 for v. -3 Solve -3d - 4603438 + 4603643 = 5n, -2n - 3d = -199 for n. 2 Solve 5b + 3l - 100 = 0, b + 20l = 24l + 20 for b. 20 Solve -z + 27284w = 27285w - 6, 0 = -95z - 52z - 2w + 1027 for z. 7 Solve 5j + 50 = -3312r + 3307r, 3r + 4j = -35 for r. -5 Solve -4f + p + 9 = 0, 163588p + 9 = -f + 163586p for f. 1 Solve -374r + 3f - 18 = -377r, -14f - 10f - 126 = -3r for r. 10 Solve 4q + 5o + 148 = -2o + o + 2o, 0 = -173q - 5o - 5729 for q. -33 Solve 0 = -2v + 4x + 18, -4v + 243x + 247x = 488x - 24 for v. 5 Solve 2i + 3z - 24 = 0, 3075 = -820i - 5z + 3115 for i. 0 Solve 2k + 48 = -4d - 41 - 13, 3k = -d - 126 - 17 for d. -2 Solve 0 = -4b + 2w + 42, -781b = -786b - 4w + 46 for b. 10 Solve 36k - 1452 + 1416 = 0, -2p = -2k + 14 for p. -6 Solve 3q + 3211r - 3207r = -24, 4r + 160 = -20q for q. -8 Solve 3a - 2x + 7x = 15, -3x + 31 = 2a + 7 + 13 for a. 10 Solve 1056v - 530v - 520v = -4n + 72, -5v + 0v = -3n + 16 for v. 4 Solve 400 - 345 = 13w + 4f - 587, 202 = 4w - f for w. 50 Solve t + 2c - c = -2c + 1, 0 = 1087c - 1070c for t. 1 Solve -16g + 3k + 11 = -20g + 4k, 41g + 26g - k = 178 for g. 3 Solve -3h - 20z = 62, 226h - 227h - 2z - 2 = 0 for h. 6 Solve 81u - 4z - 104 = -78u - 438, -6u - z = -3u + 2 for u. -2 Solve -241v - 9w - 725 = -8w, -5v = 4w + 12 + 11 for v. -3 Solve -5b + a + 28 = 0, -5b - 10a + 8 + 11 = -8a for b. 5 Solve 0i = -11b - 2i - 12 + 190, -3b - 170 - 147 = -i - 364 for b. 16 Solve 23u - 15u + 2z - 104 = 0, -4z = -2u + 26 for u. 13 Solve -13l = 6q + 64, -1450q - 4l = -1454q + 8 for q. -2 Solve -p - p = p - 15, 21q - 9q + p = 77 for q. 6 Solve 4o - m = -131, 2o + 4m + 146668 = 8m + 146130 for o. 1 Solve 3z - 119 = 13r, 11r - 492 = z - 585 for z. 5 Solve -4s + 5n - 18 + 1 - 31 = 0, 5s - 309n + 133n = 193n + 1391 for s. -17 Solve -5z + 55r - 18r = 35r - 19, 0 = -z - 4r - 27 for z. 1 Solve 5k - 190 = 4n - 155, 7k - 40 = -3k + 2n for k. 3 Solve -r = x - 28 - 25, -2r = -53x + 52x - 121 for x. -5 Solve -112w = 4z - 264, 4w + 0 - 17 = -3z + 19 + 2 for w. 2 Solve 250v + 12 = 2l + 246v, -l + 36v - 33v + 8 = 0 for l. 2 Solve 3r - 18 = 6d, 9897r - 36 = -2d + 9895r for d. 4 Solve -1 = 8n - 5n - 5j, 14 - 1 = -2n - 9j for n. -2 Solve 4a = 76h + 400, -25 = 17a - 35a + 15a + 2h for a. 5 Solve -3z = 5m + 41, 50527z = -11m + 50521z - 83 for m. -1 Solve 3k + 2j = -2j - 73, k + 7k - 12k - 100 = 6j for k. -19 Solve -4v + 8 = -19w - 1, 6w - 2w + 369v - 368v = 11 for w. 1 Solve -10971p + 10975p + 12k = -108, k + 81 = -3p for p. -27 Solve 20p - 3f - 37 = 27p, 11p + 50 = -2f for p. -4 Solve -47 = a + 2w, -2a = 6w + 11747602 - 11747466 for a. -5 Solve 0 = 5z - 5d - 140, 437z - 64 = 218z + 221z + 3d for z. 4 Solve -9b = 5u - 14, 0 = -5b + 2u + 307 - 304 for b. 1 Solve -m - 2m + 3y - 8y - 35 = 0, -35 = -8m + 5y for m. 0 Solve -6l + 28 = 2m, 5m + 6556 - 6578 = -3l for l. 4 Solve 0 = -4f - 13m + 10m - 21 - 34, 5f - 19 = 3m for f. -4 Solve -57o - 468 = -5l - 101, 3o + 4l + 0l + 3 = l for o. -6 Solve -185 = -7t + 2n, -58t - 50t - 509 = -189t + 62t + 2n for t. 27 Solve -4f - 3u = 62, 148f = 242f - 151f - 5u - 808 for f. -14 Solve -137750t - 339 = -137755t - 4k, 3t - 200 = k for t. 67 Solve -25 = -5a, 14i + 13i - 2a - 2 = 3i + 36 for i. 2 Solve 129594m - 129598m - b + 55 = 0, -4b - 35 = -m for m. 15 Solve 17q - 1167 = 3h, h + 85 = 7h - 4h + 6h + q for h. 2 Solve -105o + 106o + 2q - 10 = 0, -5q - 227 = -29o for o. 8 Solve -4359 + 537 = 755g + c, -2g - 2c - 104 = 0 for g. -5 Solve -4m + 6k = -30, -37m = -4m - 28m - 7k + 2k - 25 for m. 0 Solve -8z - 5p - 154 = 0, 2z - 3p + 86635 = 86707 for z. -3 Solve 6i = 2z - 2z, -5z - 10z - 2i - 3 = -14z for z. -3 Solve 2l + 88 + 86 = -3t + 9l, -5t - 3 = -3l + 261 for t. -51 Solve -k + 3o = k - 128, -3k + 65o = 4o - 2791 for k. -5 Solve 352o + 74 = -2b, 110o + 4b + 0b = 113o - 148 for o. 0 Solve 973g + c - 93 = 969g, -g - 2c - 12 = -2g for g. 22 Solve -3f = 2x + 9, -10f + 410919x - 47 = 410920x for f. -5 Solve l + 0l - b + 46990 = 46977, -l - 26 = -5b + 43 for l. 1 Solve 3b + 8 = -2b + 3g, b + 3g = -386 + 370 for b. -4 Solve 3y - 2s = 44, -37s - 26 = -2y - 35s for y. 18 Solve 4x - 106 = -3542p + 3548p, -4p - 78 = x for x. -2 Solve -7y - 19 = 3f, -39 = -27f + 20f + 5y + 2 for f. 3 Solve 165009 = -5x + 164944, 0 = m - 3x - 42 for m. 3 Solve 7n + 98 = -5j, -j - 3j - 8n + 265 = -9j + 227 for j. -14 Solve -34c + 21 = -3o - 35c, 0 = o - 2c - 0 + 14 for o. -8 Solve -4t = -2n - 230, 893n = 898n + t - 41 for n. -3 Solve 6y + 23 = y + x, -42x = 50y - 45y - 751 for y. -1 Solve 1482m - 527 = -z + 1530m, -2z - 3m = 35 for z. -1 Solve 5i + 10 = -b, -3i - 30 = -319b + 318b - 8 + 8 for i. -5 Solve -2u = -l - 2l - 17, -250506u + 250511u - 25 = 6l - l for l. -7 Solve -3o = -4d + 85, d = 11o + 108 - 56 for d. 19 Solve -4f + 6f + 413 = 14c + 67c, -4f - 2c = 6 for f. -4 Solve 5n - 2y - 100 + 174 = 0, 7n - 13n - 592 = -16y for n. 0 Solve -9x = -12m - 27, 20m - 24m - 39 = 3x for m. -6 Solve 3k = -2w - 23, -18w - k = -25w - 0*k - 23 for w. -4 Solve 11	{ "pile_set_name": "DM Mathematics" }
(3) Simplify sqrt(152)/(sqrt(8)1 - sqrt(8) - sqrt(8) - sqrt(8))1. -sqrt(19)/2 Simplify (sqrt(77) + (sqrt(77) - sqrt(77)2)-2)/(-4sqrt(7)2). -3sqrt(11)/8 Simplify 5 + (-3sqrt(5))*2 + sqrt(80) + -5. 4sqrt(5) + 45 Simplify 1 + (sqrt(2) + 1 - sqrt(2))3 + sqrt(32) + 2. 4sqrt(2) + 6 Simplify -3 + (sqrt(38)/(4sqrt(18))4)*2. -8/9 Simplify 2 + ((-2sqrt(35))/sqrt(7))*2. 22 Simplify ((sqrt(65)1 + sqrt(65) + sqrt(65) - sqrt(65))-2)/(sqrt(10)/sqrt(2)2). -2sqrt(13) Simplify -4 + (sqrt(13) + (sqrt(26)/sqrt(2))2 + sqrt(13) - sqrt(13)) + -5. sqrt(13) + 4 Simplify (sqrt(45)/(-1sqrt(9)) + 5 - sqrt(10)/(sqrt(32)/sqrt(4)))*2. -15sqrt(5) + 145/4 Simplify -4 + (2-1sqrt(117) + -5)*2. 60sqrt(13) + 489 Simplify sqrt(128) + -1 + (sqrt(8) + -1 + 1 - sqrt(8)) + sqrt(8). -1 + 10sqrt(2) Simplify -1((-2 + (sqrt(51)/sqrt(3) - sqrt(17)) - sqrt(17)) + sqrt(17))*2 + -2. -6 Simplify (sqrt(128) + -3(-1 + sqrt(128)) + -2 + -5)*2. 128sqrt(2) + 528 Simplify 35((sqrt(126)1)/sqrt(6))/sqrt(3). 15sqrt(7) Simplify sqrt(2736) + 0 + sqrt(228)/(sqrt(12) - sqrt(192)) + sqrt(19). 38sqrt(19)/3 Simplify ((sqrt(130) - sqrt(130)-3)/sqrt(10) - 3(sqrt(13) - (-2 + sqrt(13))2)) + 2. -11sqrt(13) + 53 Simplify (sqrt(18) + sqrt(198)/sqrt(99))*2 + ((-3sqrt(216))/sqrt(12))*2. 194 Simplify 4sqrt(484)/(sqrt(11) + sqrt(55)/sqrt(5) + sqrt(11)). 8sqrt(11)/3 Simplify (sqrt(76) - (sqrt(76) - (42sqrt(76) + sqrt(76))) - sqrt(76))/(-5(sqrt(4) - (sqrt(4) - sqrt(8)/sqrt(2)))). -8sqrt(19)/5 Simplify 5(-4 + -1 + ((sqrt(208))*2 - sqrt(13))). -5sqrt(13) + 1015 Simplify 6(2(-1 + sqrt(2448))*2 + 1). -288sqrt(17) + 29394 Simplify ((sqrt(304)1 + sqrt(304) - sqrt(304))1)*22. 608 Simplify (sqrt(84) - (sqrt(84) - 2sqrt(84)2))/sqrt(12) + 3-2sqrt(7) + (sqrt(112)5)2. -2sqrt(7) + 2800 Simplify (sqrt(68) + -1sqrt(68))2-3. 0 Simplify (sqrt(1500)3)/(-1sqrt(320)). -15sqrt(3)/4 Simplify (((-1sqrt(78))/sqrt(2) - sqrt(39))/((sqrt(72)/sqrt(2))/sqrt(12)))*2. 52 Simplify sqrt(80)-1 - (5 + -2sqrt(5)). -5 - 2sqrt(5) Simplify (sqrt(216)/(2sqrt(12)))/sqrt(6). sqrt(3)/2 Simplify (14sqrt(91))/sqrt(7) + 0. 4sqrt(13) Simplify sqrt(216)/sqrt(12) + -5 + -2. -7 + 3sqrt(2) Simplify -5sqrt(832) - (3 + sqrt(13) + 3). -41sqrt(13) - 6 Simplify (sqrt(76) - sqrt(76)-1)/sqrt(4) + (sqrt(684)2 - sqrt(684)). 8sqrt(19) Simplify -2 + (-1sqrt(170))/sqrt(10) + 6sqrt(51)/sqrt(3)-1. -7sqrt(17) - 2 Simplify (((sqrt(252) - sqrt(252)-1) + sqrt(252))-2)*2. 9072 Simplify ((0 + sqrt(72) + sqrt(10)/(sqrt(45) + sqrt(5)))-2)*2. 625/2 Simplify -1(sqrt(1620) + 0). -18sqrt(5) Simplify (4(sqrt(175) + 1sqrt(175) + 5 - (sqrt(175) - -3(sqrt(175) + 0))))*2. -1600sqrt(7) + 11600 Simplify sqrt(30)/(sqrt(6) + sqrt(18)/sqrt(3)5). sqrt(5)/6 Simplify (sqrt(1100) + sqrt(1100) + -4 + sqrt(1100))2 + 1(sqrt(11) + 3). -239sqrt(11) + 9919 Simplify (1(sqrt(684) + 0 + sqrt(684) + -4 + sqrt(684)))*23. -432sqrt(19) + 18516 Simplify sqrt(343)5 + 4. 4 + 35sqrt(7) Simplify sqrt(20)-5 - sqrt(180)/sqrt(4). -13sqrt(5) Simplify (sqrt(19)1-6)2-3. -2052 Simplify (sqrt(35)/sqrt(125))*2 - (0 + sqrt(448)). -8sqrt(7) + 7/25 Simplify ((-2 + -4 + sqrt(448))6)2. -3456sqrt(7) + 17424 Simplify sqrt(14)/((sqrt(8) - sqrt(72))/sqrt(4)). -sqrt(7)/2 Simplify (0 + (sqrt(76) - 5-2sqrt(76))/sqrt(4))*2. 2299 Simplify (-1sqrt(33)4)/(1sqrt(75)). -4sqrt(11)/5 Simplify (sqrt(5) + 5 + sqrt(5) + 0)3. 6sqrt(5) + 15 Simplify 1(-3 + (sqrt(12)/(sqrt(4)-2))2 + sqrt(3)). -9/4 + sqrt(3) Simplify (4sqrt(42)5)/sqrt(6). 20sqrt(7) Simplify ((sqrt(91) - (sqrt(91)-2 + sqrt(91)))6)/(sqrt(7) + sqrt(252)-1). -12sqrt(13)/5 Simplify (5(sqrt(405) + sqrt(405) + 0))2. 40500 Simplify 0 + (sqrt(250)/sqrt(5) - sqrt(50)). 0 Simplify -4 + 1(2sqrt(17) + 5)2. 20sqrt(17) + 89 Simplify sqrt(77)/(sqrt(7)-2)5. -5sqrt(11)/2 Simplify -4(0 + sqrt(320)). -32sqrt(5) Simplify (1sqrt(1872) + sqrt(1872))/(-1sqrt(16) + sqrt(4)). -12sqrt(13) Simplify sqrt(20)/(6sqrt(4)) + sqrt(15)/sqrt(3) + sqrt(5) + -1. -1 + 13sqrt(5)/6 Simplify (4 + sqrt(3))*2-11. -19 - 8sqrt(3) Simplify (-5 + (sqrt(1700) + 0)-2)2. 200sqrt(17) + 6825 Simplify (((sqrt(152) + 2sqrt(152))/sqrt(4))/sqrt(2))2. 171 Simplify sqrt(22)/sqrt(11) + 1 - ((sqrt(2) - sqrt(72))-5)*2. -1249 + sqrt(2) Simplify -1((sqrt(252) - sqrt(63)) + sqrt(63) - (-2 + (sqrt(7) - sqrt(112)))). -9sqrt(7) - 2 Simplify -43-5sqrt(2)2. 120sqrt(2) Simplify ((sqrt(480)/(sqrt(24)/sqrt(3)))/sqrt(12))*2. 5 Simplify (sqrt(208) + -1sqrt(208) - sqrt(208))/sqrt(4). -2sqrt(13) Simplify sqrt(12) - (1 + sqrt(48)/sqrt(4)). -1 Simplify ((sqrt(275)/sqrt(176) + sqrt(25))/sqrt(5)4)*2. 125 Simplify 3 + sqrt(99) + -1. 2 + 3sqrt(11) Simplify 3 + ((2 + sqrt(720) + sqrt(720) - sqrt(720)) + sqrt(720))*2 + 3 + 5. 96sqrt(5) + 2895 Simplify (1 + 2 + (sqrt(2) - (sqrt(8) + 1) - sqrt(2)) + 3)*2. -20sqrt(2) + 33 Simplify 5 + (sqrt(128) - (sqrt(128)1)2) + sqrt(128) + sqrt(128) + 4 + sqrt(128). -119 + 32sqrt(2) Simplify ((sqrt(10) + (-2sqrt(10) - sqrt(10)) + sqrt(10))-6 - sqrt(10))/(sqrt(128) - (sqrt(128) - (sqrt(128) - 2sqrt(128)))). -5sqrt(5)/8 Simplify (5(sqrt(1700) + -3))2. -1500sqrt(17) + 42725 Simplify sqrt(76)/(sqrt(4) - sqrt(44)/(sqrt(88)/sqrt(8)) - sqrt(4)) + -5. -5 - sqrt(19) Simplify (sqrt(38)/sqrt(2))*2-1-4. 76 Simplify 6(sqrt(162) - (sqrt(162) + -1 + sqrt(162))*2). -3894 + 270sqrt(2) Simplify (sqrt(35) + sqrt(140)/sqrt(4))/sqrt(7)-3. -6sqrt(5) Simplify (2sqrt(27)2)*2. 432 Simplify -4(5-1sqrt(84))/sqrt(12). 20sqrt(7) Simplify (3 + sqrt(52))2 + sqrt(52)/(-1sqrt(4)). 11sqrt(13) + 61 Simplify ((0 + sqrt(304) + -3 - ((sqrt(304) - 1sqrt(304)) + 2 - sqrt(304))) + -2)*2. -112sqrt(19) + 1265 Simplify (sqrt(187) - sqrt(187)1 - sqrt(187))/sqrt(11) - (5(3 + sqrt(17)))*2. -650 - 151sqrt(17) Simplify sqrt(187)/(-4sqrt(11)) - (sqrt(2057) + 3)2. -2066 - 265sqrt(17)/4 Simplify (sqrt(1300)6 + 5 - sqrt(1300) - sqrt(1300))2 + -1. 400sqrt(13) + 20824 Simplify (5 + 1 + sqrt(684) + (sqrt(684) - 2sqrt(684))3)*2. -144sqrt(19) + 2772 Simplify sqrt(39)/(sqrt(18)/(sqrt(12)/sqrt(2) + sqrt(6))). 2sqrt(13) Simplify (sqrt(288) - -1sqrt(288)) + -2. -2 + 24sqrt(2) Simplify (sqrt(65) + sqrt(65)3)/sqrt(5) + -1. -1 + 4sqrt(13) Simplify ((1sqrt(143) + sqrt(143))-3)/((sqrt(22) + sqrt(44)/sqrt(2))/sqrt(2)). -3sqrt(13) Simplify (-2(sqrt(13) + 0)5)*2. 1300 Simplify (5(-2 + -4-1sqrt(2)))*2 + -4. -400sqrt(2) + 896 Simplify (4 + (-3 + sqrt(50) - (2sqrt(288) + sqrt(288) - sqrt(2))))2. -60sqrt(2) + 1801 Simplify (sqrt(315) - (sqrt(315) + (sqrt(315) + 1sqrt(315))-4 + sqrt(315) - sqrt(315)))/sqrt(5) + 4. 4 + 24sqrt(7) Simplify (sqrt(133) - (sqrt(133) + (sqrt(133)-1 + sqrt(133) + sqrt(133) - sqrt(133) - sqrt(133))3 + sqrt(133) + sqrt(133)))/(1(sqrt(7) + sqrt(35)/sqrt(5))). sqrt(19)/2 Simplify sqrt(19) + -2 + sqrt(19) + 4 + 4 + -3. 3 + 2sqrt(19) Simplify 2 + 6(1 + sqrt(5)). 8 + 6sqrt(5) Simplify -1(sqrt(153) + -1). -3sqrt(17) + 1 Simplify (-1 + -1 + sqrt(33)/sqrt(3) + 0)4. -8 + 4sqrt(11) Simplify (-2 + sqrt(468) + 2 + 3)-6. -36sqrt(13) - 18 Simplify -5(1sqrt(119) - sqrt(119))/sqrt(7)5. 0 Simplify (sqrt(102)26)/sqrt(6). 12sqrt(17) Simplify 6(-3 + 2sqrt(272)-6). -288sqrt(17) - 18 Simplify ((sqrt(3584) + sqrt(3584)-1 + sqrt(3584) - sqrt(3584)) + sqrt(3584) - sqrt(3584))/sqrt(8). 0 Simplify 4 + 1 + sqrt(847). 5 + 11sqrt(7) Simplify (3(sqrt(76) + (sqrt(76) - sqrt(76)-2 - sqrt(76)) + sqrt(76) + sqrt(76)))/(sqrt(484)-1). -15sqrt(19)/11 Simplify (-2 + (0 + sqrt(567))2)6. 3390 Simplify 2 + sqrt(112) + 1 + sqrt(28)/sqrt(4) + sqrt(7). 3 + 6sqrt(7) Simplify ((sqrt(684) + 3sqrt(684))*2 + sqrt(684))3. 18sqrt(19) + 32832 Simplify (2sqrt(448)2)2. 7168 Simplify -3 + -1sqrt(1573) + -2. -11sqrt(13) - 5 Simplify 5 + 2((sqrt(363)-3)2 + sqrt(3)). 2sqrt(3) + 6539 Simplify ((sqrt(17) + 0)-3 - (sqrt(17) + sqrt(51)/sqrt(48)))2 - (5(sqrt(2448) - sqrt(2448)-1 - sqrt(2448)))2. -974287/16 Simplify 1(sqrt(637)3)23. 17199 Simplify (sqrt(1872)2)2 - 6sqrt(117). -18sqrt(13) + 7488 Simplify -5(sqrt(5) - (-4 + sqrt(10)/sqrt(2))) + (-3 + sqrt(5) + sqrt(5) + -1 - (0 + sqrt(20))). -24 Simplify (sqrt(605)-15 -	{ "pile_set_name": "DM Mathematics" }
er of 1/9, to the nearest integer? 6 What is the square root of 4197225 to the nearest integer? 2049 What is 451496 to the power of 1/6, to the nearest integer? 9 What is 797865 to the power of 1/2, to the nearest integer? 893 What is 2490481 to the power of 1/2, to the nearest integer? 1578 What is the square root of 8923703 to the nearest integer? 2987 What is the cube root of 94020 to the nearest integer? 45 What is the cube root of 6426095 to the nearest integer? 186 What is the cube root of 2975723 to the nearest integer? 144 What is 237926 to the power of 1/2, to the nearest integer? 488 What is 27651316 to the power of 1/9, to the nearest integer? 7 What is the eighth root of 7728850 to the nearest integer? 7 What is the cube root of 44866 to the nearest integer? 36 What is the cube root of 1733329 to the nearest integer? 120 What is the cube root of 105829 to the nearest integer? 47 What is 239694 to the power of 1/2, to the nearest integer? 490 What is the seventh root of 1062026 to the nearest integer? 7 What is 604604 to the power of 1/6, to the nearest integer? 9 What is the square root of 1031601 to the nearest integer? 1016 What is the seventh root of 7430769 to the nearest integer? 10 What is the seventh root of 2428266 to the nearest integer? 8 What is the eighth root of 993425 to the nearest integer? 6 What is 401384 to the power of 1/6, to the nearest integer? 9 What is the third root of 3246562 to the nearest integer? 148 What is 3528080 to the power of 1/10, to the nearest integer? 5 What is the ninth root of 581607 to the nearest integer? 4 What is 3031643 to the power of 1/2, to the nearest integer? 1741 What is 2638143 to the power of 1/8, to the nearest integer? 6 What is 17221279 to the power of 1/2, to the nearest integer? 4150 What is 9951565 to the power of 1/4, to the nearest integer? 56 What is the sixth root of 192806 to the nearest integer? 8 What is the cube root of 57159 to the nearest integer? 39 What is 688399 to the power of 1/2, to the nearest integer? 830 What is the third root of 39531233 to the nearest integer? 341 What is the third root of 10841 to the nearest integer? 22 What is 15554891 to the power of 1/2, to the nearest integer? 3944 What is 1249572 to the power of 1/2, to the nearest integer? 1118 What is 8597519 to the power of 1/6, to the nearest integer? 14 What is the eighth root of 12571338 to the nearest integer? 8 What is 629823 to the power of 1/10, to the nearest integer? 4 What is the cube root of 2480555 to the nearest integer? 135 What is the seventh root of 519879 to the nearest integer? 7 What is 3613839 to the power of 1/8, to the nearest integer? 7 What is the third root of 1183811 to the nearest integer? 106 What is the third root of 90700 to the nearest integer? 45 What is the square root of 3593635 to the nearest integer? 1896 What is 468379 to the power of 1/2, to the nearest integer? 684 What is the cube root of 3042373 to the nearest integer? 145 What is the seventh root of 1773447 to the nearest integer? 8 What is the square root of 10776201 to the nearest integer? 3283 What is the third root of 2130811 to the nearest integer? 129 What is the eighth root of 642246 to the nearest integer? 5 What is the eighth root of 780633 to the nearest integer? 5 What is the square root of 831029 to the nearest integer? 912 What is 210840 to the power of 1/3, to the nearest integer? 60 What is the square root of 2836 to the nearest integer? 53 What is 1343843 to the power of 1/3, to the nearest integer? 110 What is the fifth root of 2636877 to the nearest integer? 19 What is the square root of 167136 to the nearest integer? 409 What is the third root of 997094 to the nearest integer? 100 What is the square root of 3706284 to the nearest integer? 1925 What is 2250857 to the power of 1/2, to the nearest integer? 1500 What is 20538040 to the power of 1/2, to the nearest integer? 4532 What is the eighth root of 5967087 to the nearest integer? 7 What is the fifth root of 10694668 to the nearest integer? 25 What is 644813 to the power of 1/2, to the nearest integer? 803 What is the third root of 542280 to the nearest integer? 82 What is 365318 to the power of 1/4, to the nearest integer? 25 What is the square root of 527467 to the nearest integer? 726 What is 200915 to the power of 1/2, to the nearest integer? 448 What is the ninth root of 498407 to the nearest integer? 4 What is 466699 to the power of 1/3, to the nearest integer? 78 What is 83570 to the power of 1/10, to the nearest integer? 3 What is 1491603 to the power of 1/2, to the nearest integer? 1221 What is 2012383 to the power of 1/2, to the nearest integer? 1419 What is 1281207 to the power of 1/4, to the nearest integer? 34 What is 401286 to the power of 1/6, to the nearest integer? 9 What is the sixth root of 729861 to the nearest integer? 9 What is 3203169 to the power of 1/7, to the nearest integer? 8 What is 12968091 to the power of 1/8, to the nearest integer? 8 What is the cube root of 1605282 to the nearest integer? 117 What is 10392338 to the power of 1/4, to the nearest integer? 57 What is 4602888 to the power of 1/5, to the nearest integer? 22 What is the square root of 268525 to the nearest integer? 518 What is 745775 to the power of 1/10, to the nearest integer? 4 What is 93543 to the power of 1/2, to the nearest integer? 306 What is the cube root of 389620 to the nearest integer? 73 What is the ninth root of 274242 to the nearest integer? 4 What is the square root of 2167928 to the nearest integer? 1472 What is 1792832 to the power of 1/5, to the nearest integer? 18 What is 1031250 to the power of 1/3, to the nearest integer? 101 What is the eighth root of 5182185 to the nearest integer? 7 What is the square root of 646469 to the nearest integer? 804 What is the square root of 3631255 to the nearest integer? 1906 What is the square root of 19341950 to the nearest integer? 4398 What is 8158339 to the power of 1/3, to the nearest integer? 201 What is the eighth root of 194932 to the nearest integer? 5 What is 294156 to the power of 1/2, to the nearest integer? 542 What is 3073485 to the power of 1/7, to the nearest integer? 8 What is 10796 to the power of 1/2, to the nearest integer? 104 What is 312910 to the power of 1/7, to the nearest integer? 6 What is 220586 to the power of 1/3, to the nearest integer? 60 What is 4186463 to the power of 1/2, to the nearest integer? 2046 What is 784290 to the power of 1/2, to the nearest integer? 886 What is the fifth root of 5256386 to the nearest integer? 22 What is 468902 to the power of 1/2, to the nearest integer? 685 What is the square root of 1610413 to the nearest integer? 1269 What is the cube root of 78451 to the nearest integer? 43 What is 162156 to the power of 1/4, to the nearest integer? 20 What is the square root of 12665164 to the nearest integer? 3559 What is 5791771 to the power of 1/10, to the nearest integer? 5 What is the cube root of 1817410 to the nearest integer? 122 What is the seventh root of 205401 to the nearest integer? 6 What is 482285 to the power of 1/2, to the nearest integer? 694 What is the sixth root of 3645099 to the nearest integer? 12 What is 881565 to the power of 1/7, to the nearest integer? 7 What is the square root of 13946981 to the nearest integer? 3735 What is the cube root of 15280143 to the nearest integer? 248 What is the square root of 7592443 to the nearest integer? 2755 What is 29397969 to the power of 1/8, to the nearest integer? 9 What is the fifth root of 561204 to the nearest integer? 14 What is the cube root of 461956 to the nearest integer? 77 What is 18140009 to the power of 1/7, to the nearest integer? 11 What is the third root of 3842617 to the nearest integer? 157 What is 34644864 to the power of 1/2, to the nearest integer? 5886 What is 920195 to the power of 1/8, to the nearest integer? 6 What is the cube root of 4283877 to the nearest integer? 162 What is 2035018 to the power of 1/8, to the nearest integer? 6 What is 462334 to the power of 1/3, to the nearest integer? 77 What is 172723 to the power of 1/3, to the nearest integer? 56 What is 1659 to the power of 1/2, to the nearest integer? 41 What is the third root	{ "pile_set_name": "DM Mathematics" }
-9835 + 9859. Calculate the smallest common multiple of 480 and j. 480 Let f(d) = d3 - d2 - 5d + 9. What is the least common multiple of 14(9/15 + (-108)/(-420)) and f(3)? 12 What is the common denominator of 49/810 and ((-5)/((-1050)/12))/((-1044)/(-4727))? 5670 Suppose -b + 35 = c, 4c + 45 = -3b + 185. Let q = 504 - 364. What is the least common multiple of q and c? 140 Suppose r + 0r = -2v + 43828, -2v + 43828 = -4r. Let p = 34777517/1587 - v. Let d = p + -147589/3174. Calculate the common denominator of 23/10 and d. 10 Calculate the common denominator of 12/((-100800)/3610) - (-3)/(-5) and 45/1274. 15288 Let p = -63 + -490. Let q = p - -1075/2. Let c = -95/18 + 208/9. What is the common denominator of q and c? 6 Let v be (11 + 0 + 1)7/28. Let p = -14781/3934 - 8/281. Calculate the common denominator of 57/(-12)v/15 and p. 140 Let a = -144059 - -234383975/1627. Let c = a + 17491/3198682. Calculate the common denominator of 25/12 and c. 11796 Let f = 54/1579 - 147555/574756. Find the common denominator of -9/77 and f. 4004 Suppose -10d = 60 - 190. Find the common denominator of -143/6 and ((9516/(-8))/d)/(-6). 12 Let r(v) = v3 - 52v*2 + 93v + 390. What is the lowest common multiple of r(50) and 890? 3560 Suppose 2g = -3b + 708, b + 3g - 236 = -g. What is the lowest common multiple of b and ((-9)/(-2) - 5)/(7 - 339/48)? 472 Let y(c) = c + 29. Let k = 77 + -85. Let r be k + 1 + (-5)/(-25)0. Calculate the lowest common multiple of 66 and y(r). 66 Let w = -143 - -273. Suppose 2f + 12 = 0, -d = 1811f - 1807f - 21. What is the least common multiple of w and d? 1170 Let s = 701 - 774574/1105. Find the common denominator of -71/26 and s. 2210 Let t = -3781974/2669 - -1417. Let s = t + 136160/109429. What is the common denominator of -7/10 and s? 410 Let s = 40088/15 - 2672. Let l = -47767/4854 + 6/809. Calculate the common denominator of l and s. 30 Let b(m) = -m2 + m + 40. Let a be b(0). Let k = a - 34. What is the common denominator of (k - 3)484/(-240) and -31/50? 100 Suppose 0 = u - 4k - 13, 3u = -2u + k + 8. Suppose c - 8s = -29, -3c - 79 + 106 = -5s. What is the lowest common multiple of u and c? 19 Suppose 0 = 34c - 68 - 34. What is the least common multiple of c and 29? 87 Let j(h) = -6h*3 - 5h*2 + 10h + 23. Let n be j(-3). Suppose 124 = a + n. Calculate the smallest common multiple of 238 and a. 238 Let z be (-18370)/78 - (13 + -19). Let h = -229 - z. What is the common denominator of h and -64/39? 39 Let y = 13734241/169884 + -9778/121. What is the common denominator of y and 23/1404? 1404 Let b(t) = -7t - 2. Let u be b(22). Find the common denominator of 91/2 and 6/2u/(-56). 14 Let c = 21877 - 393907/18. Calculate the common denominator of 11/18 and c. 18 Let h(j) = 7j3 + 3j*2 - 47j + 231. Calculate the smallest common multiple of 430 and h(5). 4730 Let w = 186389/3135 + -34/627. Let d = w + -60. Calculate the common denominator of d and 3/1 + (-8 - 369/(-60)). 20 Let w(n) = -38162n + 16. Let v be w(-6). Let x be -2 - (v/48 - -4). Let t = x + 4781. What is the common denominator of -38/5 and t? 60 Let q = 1566 - 1559. Calculate the least common multiple of 2750 and q. 19250 Let x = -62405/18 - -3468. Let p = -44188 - -2651123/60. What is the common denominator of p and x? 180 Suppose -4z + p = -74, 2z = -5p + 3 + 23. Suppose 23w - zw - 140 = 0. Calculate the least common multiple of 10 and w. 140 Suppose 0 = -2o + 2b + 2278, -2o - 3b + 26 + 2277 = 0. What is the lowest common multiple of o and 2184? 24024 Let d be (-165)/9 + (-8)/(-6). Let c = 41 + d. Find the common denominator of (-347)/312 + c/156 and -4/3. 24 Let c be (-530390)/103740 + (-4)/38. Let a = 86/13 - c. Calculate the common denominator of -12/20 - 0 and a. 30 Let m(h) = -3h. Let x(b) = -b + 1. Let g(o) = -2o2 + 18o - 11. Let q be g(8). Let l be x(q). Calculate the lowest common multiple of m(l) and 24. 24 Suppose 0 = -2j - 4t - 8, -66j - 16t = -13t - 1026. What is the smallest common multiple of (1 - 0 - 3)-10 and j? 80 Suppose 2i = 97 - 73. Let l = -163117/15 + 10880. Calculate the common denominator of (-167)/8i/45 and l. 30 Let x = -19052 - -37747. Let d = x - 224189/12. Find the common denominator of d and -11/9. 36 Let g = -10773/8 - -1341. Find the common denominator of g and 3-2 - (-3182)/481. 104 Suppose 10z - 693 = -11z. Calculate the smallest common multiple of (-8)/(-1) - (195/(-15) - -12) and z. 99 Calculate the smallest common multiple of ((-27)/18)/((-91)/23270) + (-6)/(-14) and 12. 384 Let l(d) = -d2 + 21d + 24. Let p be l(-3). Let w be (-2)/(-6) + 242/3. Let a = w + p. What is the least common multiple of a and 30? 330 Let o = 743469 + -904058373/1216. Find the common denominator of o and -121/1368. 10944 Let x(n) be the first derivative of 5n3/3 + 31n*2/2 - n - 57. What is the smallest common multiple of 11 and x(-8)? 781 Let f = -1/1129 - -4717/226929. Find the common denominator of f and 44/63. 4221 Let c = 875/120132 - -6512608813/300330. Let u = 21690 - c. Find the common denominator of 9/5 and u. 20 Let o(l) = 9l*3 + 26l*2 + 19l + 73. Calculate the smallest common multiple of o(-3) and 3390. 23730 Let z(t) = t*3 + 9t*2 - 32t - 9. Let s(n) = n*3 + 10n*2 - 32n - 9. Let v(q) = -3s(q) + 4z(q). What is the least common multiple of v(-9) and 36? 36 What is the lowest common multiple of 75 and -17 + (-17 - -13) + 339? 7950 Let j = 624329951 - 7497202133/12. Let k = j - -437172. Let c = -276 + k. Find the common denominator of -17/108 and c. 108 Suppose -l + 4t = -40, -4l + t + 160 = -0t. Let c = -34 + l. What is the lowest common multiple of 6 and (c/7)/((-5)/(-35))? 6 Let w(u) = 5u*3 - 4u*2 - u + 4. Let l be w(-2). Let p = 71 + l. What is the smallest common multiple of 18 and p? 126 Suppose 8x + 103 = 103. Suppose 4n + 36 - 116 = x. Let g = 9 + 9. What is the lowest common multiple of g and n? 180 Let v be (88 - 93) + 2049 + 1. What is the common denominator of -133/12 and v/1350 - -4(-5)/(-25)? 108 Suppose 0 = -2u - 156 - 1012. Let l = u + 1239/2. Find the common denominator of 39/2 and l. 2 Let t = 647/2 + -335. Suppose -22k + 26k + 12144 = 0. Find the common denominator of (1/151)/((-176)/k) and t. 20 Let y(v) = v*3 - 4v*2 - 9. Let f be y(5). Let j = f - -98. Calculate the least common multiple of 15 and j. 570 Let g = -228242/9 - -25356. What is the common denominator of 37/(-36) - (-1)/(-3) and g? 36 Let o = 841/212 + -38/53. Let v = 188 - 775/4. Calculate the common denominator of o and v. 4 Calculate the least common multiple of 99 and 21400/24 - (-12)/(-18). 891 Let l = 37 + -30. Suppose 0 = -3m + lm - 24. Suppose 3 + 3 = v. What is the smallest common multiple of m and v? 6 Let r(k) = -3k - 56. Let f be r(-19). Let i be (-1 + f - (4 + -2)) + -6. What is the lowest common multiple of (12/i)/1112/(-12) and 106? 742 Let j = 4/22879 - -1532689/1166829. What is the common denominator of j and ((-28727)/(-336))/23 - (-48)/256? 357 Suppose -5a + 7 = -x - 29, -4a - 5x = -52. Let f = -216 - -220. Calculate the lowest common multiple of a and f. 8 Let q(m) = -5m - 4m - 116 + 26 - 8m + 23m. What is the lowest common multiple of q(16) and 11/(-2)-38? 114 Suppose 3n = -6n + 189. Suppose -2k - c - 3c = -6, c + n = 2k. Calculate the lowest common multiple of k and 3. 9 Suppose 3c - 32u = -36u + 7428, -u = -4c + 9904. What is the least common multiple of 22 and c? 27236 Let q(l) = 66l*2 - 66l + 378. What is the lowest common multiple of 8 and q(6)? 9432 Let c = -32715149/3140652 + 2/261721. Let f(n) = -3n2 + 2n + 1. Let q be f(-2). What is the common denominator of (q + 1)(-22)/120 and c? 60 Let l = 16 - 22. Let y be (l/(-4) - 9/(-18))-2. Calculate the lowest common multiple of 12 and 8 + y + 0/1. 12 Let c = 66770/37949 + -129628526333/1821552. Let g = 71165 + c. Find the common denominator of -9/8 and g. 48 Let a(c) = -4c3 + 2c*3 - 9c*2 - 5 + 7 + 12c + 7. Let l be a(-9). Calculate the common denominator of -63/10 and 6/(-27) - (-761)/l. 70 Suppose c = 4c - 255. Suppose -4n + 14 = -3q, -2q + 938n = 934n + 20. What is the least common multiple of c and q? 510 Suppose 3j = -4t - 97550, -4t + 3j = -	{ "pile_set_name": "DM Mathematics" }
+ x*2/2 - 2x. What is g(i) - 2u(i)? -3i*3 + i Let l(a) = 5a*3 - 5a + 7. Let p(m) = -11m3 + 11m - 15. Let f(x) = -13l(x) - 6p(x). Let k(h) = 2 - h + 4h - h. Give -2f(s) - k(s). -2s3 Suppose 0 = -u - c + 5, 23 - 7 = 4c. Let f(o) = -u + 19o - 44o + 26o. Let p(s) = 3s - 3. Calculate -7f(b) + 3p(b). 2b - 2 Suppose -3w = -2a + 15 + 1, -5a - 3w = 2. Let k(b) = -b + b + 2b - 4ba. Let s(z) = z3 + 9z*2 - 5z + 1. Calculate 5k(c) + 2s(c). 2c3 - 2c*2 + 2 Let v(c) = 1. Let y(q) = -2q*2 - 1. Calculate -2v(r) - 2y(r). 4r2 Let k(w) = w2 - w. Let q(u) = -u. Determine 4k(s) - 4q(s). 4s2 Let u(d) = -5d*3 - 6d*2 - 6d + 6. Let a(f) = -44f3 - 55f*2 - 55f + 55. Calculate -6a(x) + 55u(x). -11x3 Let v(m) = 3m + 5. Let x(r) = 4r + 6. Let c(h) = -6v(h) + 5x(h). Let w be c(2). Let g(y) = -2y + 7. Let a(i) = i - 3. What is wg(t) + 10a(t)? 2t - 2 Let s(j) = -j3 + j - 1. Let c(a) = -5a*3 + 2a - 2. Determine -2c(v) + 4s(v). 6v3 Let x(q) = q3 + q2 + q + 1. Let o(b) = -43b3 + b2 + b + 1. Give o(j) - x(j). -44j3 Let f(j) = -j2 + j. Let h(l) = -5l*2 + 4l. Calculate 6f(a) - h(a). -a2 + 2a Let f(b) = b. Let i(k) = -k + 1. Give -6f(m) - i(m). -5m - 1 Let b(a) = -8a2 + 5a + 6. Let j(i) = -i2 + i + 1. Let q(f) = -f3 - f*2 - f - 3. Let o be q(0). Let d = -9 - o. Calculate dj(n) + b(n). -2n2 - n Let x(k) = 5k*2 - k - 12. Let f(g) = 11g*2 - 2g - 25. Calculate -4f(u) + 9x(u). u*2 - u - 8 Suppose 2h + 4b = 8, 2h = h + b - 8. Let j(k) = -3k3 + 4k*2 - 2k. Suppose 5f + 14 = -11. Let n(o) = 2o*3 - 3o*2 + 2o. What is fn(r) + hj(r)? 2r3 - r2 - 2r Let o(t) = t. Let x = -1 + 0. Let h(r) = 1. Let k(i) = xh(i) + o(i). Suppose -17w + 14w + 3 = 0. Let b(m) = -3m + 4. Give wb(a) + 4k(a). a Let m = 94 + -98. Let k(s) = -4s + 3. Let q(b) = -4b + 4. Give mk(j) + 3q(j). 4j Let x(k) = k2 + 2k + 7. Let s(g) = -g*2 - 2g - 6. Determine 5s(z) + 4x(z). -z*2 - 2z - 2 Let o(i) be the third derivative of -i5/15 - i4/12 + i*2. Let z(q) be the first derivative of -5q*3/3 - 3q*2/2 + 7. Calculate -3o(y) + 2z(y). 2y*2 Let i(m) = 14m + 1. Let n(f) = 13f + 1. Determine 4i(u) - 3n(u). 17u + 1 Let f(r) = 13r3 + 7r*2 - 7. Let y(g) = 4g*3 - 3g*2 - 5g - 2. Let c(j) = 4j3 - 2j*2 - 4j - 2. Let w(u) = -5c(u) + 4y(u). Give -2f(a) - 7w(a). 2a3 Let k(t) = -6t*3 + 10t*2 + 11t - 8. Let r(z) = -2z3 + 3z*2 + 4z - 3. What is 3k(w) - 8r(w)? -2w3 + 6w*2 + w Let v(q) = -6q - 34. Let b(a) = a + 7. What is -16b(f) - 3v(f)? 2f - 10 Let m(i) = 3i*3 + 4i*2 - 4. Let t(c) = 0c + 15c3 + 2c*2 + 0c + 19c2 - 21. What is 21m(q) - 4t(q)? 3q*3 Let j(y) = 23y + 2. Let q(n) = 45n + 4. Calculate 5j(x) - 2q(x). 25x + 2 Let x(u) = 5u2 - 2u + 10. Let v(c) = -2c2 + c - 3. Give 8v(m) + 3x(m). -m2 + 2m + 6 Let n(z) = -z*2 - z. Let k(b) = -3b*2 - 2b - 3. Let j(r) = -k(r) + 2n(r). Let a = 11 - 6. Let u(s) = -2 + 4s - 2s2 - 4s - 3. Give aj(v) + 3u(v). -v*2 Let o(z) = -4z*3 + 18z*2 + 6z + 6. Let c(v) = -3v3 + 17v*2 + 5v + 5. Give -6c(l) + 5o(l). -2l3 - 12l*2 Let p(s) = 5s + s - 3s - 1. Let o(v) be the first derivative of -v3/3 + 2v*2 - v - 77. Give -2o(i) + 3p(i). 2i2 + i - 1 Let f(d) be the third derivative of -d4/6 - 35d2. Let n(u) = -u. Let j(k) = -k3 - 2k*2 - 2k + 1. Let y be j(-2). What is yn(v) - f(v)? -v Let p(n) = n2 + 2n + 1. Let i(a) = a. What is 4i(b) + p(b)? b2 + 6b + 1 Let z(j) = 10j2. Let q(i) = -20i*2 + i. What is 3q(t) + 5z(t)? -10t*2 + 3t Let j(l) = 5l2 + 3l - 5. Let c(u) = -26u2 - 16u + 26. Suppose 0 = -4k - 0k + 64. Calculate kj(t) + 3c(t). 2t2 - 2 Suppose 18 = 8z - 6. Let c(s) = -5s. Let x(f) = -16f. Determine zx(p) - 10c(p). 2p Let x(a) = -13a*2 - 6a - 13. Let j = -15 - -13. Let o(g) = 3g2 + 6 - 2 + g2 + 2g. Calculate jx(m) - 7o(m). -2m2 - 2m - 2 Let j(r) = -r*2 - 5r - 4. Let p(l) = 2l2 + 5l + 5. Give -3j(b) - 2p(b). -b*2 + 5b + 2 Let w(k) = -k - 3. Let u(r) = 1. Determine -2u(a) - w(a). a + 1 Let w(g) = 9g - 10. Let u(k) = 14k - 15. What is 5u(f) - 8w(f)? -2f + 5 Let b be 0 - ((-27)/3)/1. Let a(l) = 4l2 - 8l - 5. Let d(h) = h*2 - 2h - 1. Suppose 4 + 6 = -5q. What is bd(g) + qa(g)? g2 - 2g + 1 Let m(k) = -2k3 - 5k*2 - 5. Suppose -r - 2 = -u + 4, -10 = 5r. Let h = 10 - u. Let d(c) = 2c3 + 6c*2 + 6. Give hm(g) + 5d(g). -2g*3 Let x(q) = 15 - 17q + 12q - 22q. Let d(z) = 7z - 4. Let u be (20/8)/(3 + (-19)/6). Give ud(v) - 4x(v). 3v Let m(a) = a*2 + a. Suppose 0 = -j + 3, 5f - 3j - 4 = -j. Let k be (-27)/21 - 4/(-14). Let y = f - k. Let c(b) = -2b*3 - 2b*2 - 3b. Give ym(n) + c(n). -2n3 + n2 Let t(f) = -f*3. Let o(q) = -14q*3 - 4q. Give -o(y) + 6t(y). 8y*3 + 4y Let k(h) = -h2 + 1. Let f(x) be the first derivative of x4/4 + x*3/3 - x - 20. Calculate 2f(w) + 2k(w). 2w*3 Let c(v) = -v + 3. Let p(s) = -1. Give -c(t) + 3p(t). t - 6 Let r be 3/18 + 0 + 74/(-12). Let p(i) = -i*3 + 5i. Let q(f) = -f*3 + 6f. What is rp(u) + 5q(u)? u3 Let a(v) = v2 + v*2 - 2 - 5v - 3v3 + 2v. Let z(u) = -u3 + u2 - u - 1. Let i = 1 + 0. Calculate ia(o) - 2z(o). -o*3 - o Let a(w) = -12w*2 + 7w - 6. Let t(g) = -13g2 + 8g - 7. Calculate -6a(m) + 5t(m). 7m2 - 2m + 1 Let f(p) = -p - 1. Let d(g) = -g*2 - 5. Calculate -d(u) + 3f(u). u*2 - 3u + 2 Let w(p) = -11p2 - p + 2. Let i(a) = -10a*2 - a + 1. Determine -3i(d) + 2w(d). 8d*2 + d + 1 Let n(c) = -2c. Let m(k) = k. What is 8m(o) + 3n(o)? 2o Let o(r) = -8r*2 - 5r + 4. Let a(d) = 17d2 + 11d - 9. Suppose -6h = -9 - 15. What is ha(g) + 9o(g)? -4g*2 - g Let h(f) = 8f*3 - 8f*2 - 9f - 9. Let o(m) = m3 - m2 - m - 1. Give -2h(s) + 18o(s). 2s3 - 2s*2 Let b(c) = 3c*2 - 2c + 1. Let p(j) = -j*2 + j - 1. Suppose -5v - 4k + 146 - 29 = 0, -12 = -v + 3k. Suppose -25t - 8 = -vt. Give tb(x) - 4p(x). -2x2 + 2 Let c(g) = -g. Let h(v) = -v2 + 4. Give 2c(l) - h(l). l*2 - 2l - 4 Let c(r) = -2r - 1. Suppose -f + 54 = 59. Let m(i) = -3i - 2. Give fc(k) + 4m(k). -2k - 3 Let n(o) = -28o*3 + 7o*2 - 7o. Let z(w) = -9w3 + 2w*2 - 2w. Calculate 2n(b) - 7z(b). 7b3 Let o(b) be the first derivative of 7b3/3 + b2/2 + 8b - 2. Suppose x + 32 - 38 = 0. Let f(y) = 15y*2 + 2y + 17. Give xf(c) - 13o(c). -c*2 - c - 2 Suppose 0h = 2h + 5f + 32, -5f + 32 = -2h. Let a = -11 - h. Let k(z) = 6z + 4. Let g(v) = 4v + 3. What is ak(s) - 7g(s)? 2s - 1 Let x(z) = -33z*3 - 5z*2 - 5z + 5. Let h(k) = 1007k3 + 152k*2 + 152k - 152. Calculate 5h(v) + 152x(v). 19v3 Let l(x) = x2 + x. Let f(u) = 7u*2 + 13u. What is f(o) - 6l(o)? o2 + 7o Let h(z) = -6z2 + 13z. Let b(d) = -d*2 + 9d. Let x(v) = -9v. Let r(g) = 4b(g) + 3x(g). Give -5h(a) + 7r(a). 2a*2 - 2a Let n(r) = 1. Let y(l) = 41l - 4. Determine -4n(z) - y(z). -41z Let y(f) be the third derivative of -f5/20 - f3/3 + 7f*2. Let u(q) = -12q*2 - 9. What is -2u(k) + 9y(k)? -3k2 Let l(y) = y2 - y. Let b(r) = 2r2 - 7r - 1. Let c(u) = -b(u) + 3l(u). Let m(s) = -3s*2 - 3 - 8s - s + 0. Determine 5c(j) + 2m(j). -j*2 + 2j - 1 Let m(z) = -2z + 1. Let u(n) = 21n - 10. Let q(t) = 5m(t) + u(t). Let r(k) = 17k - 8. What is 8q(y) - 5r(y)? 3y Let t(s) = -20s - 23. Let r(y) = -10y - 11. Let i(l) = -9r(l) + 4t(l). Let x(c) = -c + 2 + 0c + 4c + 0c. Give -4i(v) + 14x(v). 2v Let l(c) be the first derivative of 21c*2/2 + 1. Suppose 33 + 27 = 4m. Let v(o) = -3o. Give mv(z) + 2l(z). -3z Let x(p) = -665p3 - 209p*2 - 209p - 209. Let z(w) = -19w3 - 6w*2 - 6w - 6. Determine 6x(m) - 209z(m). -19m3 Let j(u) = -31u*3 + 6u*2 + 7u. Let b(n) = -10n3 + 2n*2 + 2n. What is -7b(w) + 2j(w)? 8w3 - 2w*2 Let v(j) be the second derivative of 7j*3/6 + 3j*2/2 - j. Let t(a) = 8a + 4. Calculate 4t(o) - 5v(o). -3o + 1 Let w(u) = -u - 1. Suppose 0 = -d - 1 + 2. Let n(b) = -2b3 - b2. Let j be n(1). Let h(m) = -2m3 - 2m*2 - m - 3. Determine dh(v) + j*w(	{ "pile_set_name": "DM Mathematics" }
ii(i/(ii(-3/13)i))/i)/(i0)(-17/3) assuming i is positive. i(-119/104) Simplify (b(-4)/(b*(-4/33)b))(-44) assuming b is positive. b(644/3) Simplify ((aa/a(-15/7)a)/a(-17))(-2) assuming a is positive. a(-310/7) Simplify ((u/(u(-1)uuuu))/u)17/(u(-6)u(-5)) assuming u is positive. u(-40) Simplify (q/(q3q)q(-9/5)q*(2/7)q(-1/10))(-4) assuming q is positive. q(646/35) Simplify (q7/qqqq/(qq/(qq/(qq*(-13)q))qq))/(((qq(-12)/q)/q)/qq/((qq(1/4))/q)) assuming q is positive. q(125/4) Simplify (dd*(-45)d37)32 assuming d is positive. d*(-224) Simplify (ii/i*(-3/2)i(-2/27))/(i(-5)ii(-1/8)/i) assuming i is positive. i(1847/216) Simplify q(7/10)/q30(q(((q*23/q)/q)/q)/qq)/(q/(q1/q)) assuming q is positive. q(-93/10) Simplify (w/w*11w)*(-29)ww(10/11)ww(1/6) assuming w is positive. w(17429/66) Simplify ((h/h(-8/11))50)(-2) assuming h is positive. h(-1900/11) Simplify ((r(-5/4)r)/r*(-15))/(rr*(-4)r(r(-7/4)/r)/rr) assuming r is positive. r*(39/2) Simplify ((bb*4b)/(bb(-7)/b))/(b(-3/4))(-27/4) assuming b is positive. b(127/16) Simplify ((b(-1))(-29)(b*1b)(-3/11))(-5) assuming b is positive. b(-1565/11) Simplify (v1)*(-1/30)((v/(v*(-3/13)v))/v)(1/9) assuming v is positive. v(-139/1170) Simplify (ss(-27)s(-3/7))12 assuming s is positive. s*(-2220/7) Simplify (w/((ww/((w(((w/w(1/5))/w)/w)/w)/w)w)/w)ww(-2))/(w/(w/(w/(w(-4/5)/w))w)ww/(ww(-11))) assuming w is positive. w(-18) Simplify (((t/t22)(-1/5))(2/3))(-6) assuming t is positive. t*(-84/5) Simplify (jjj10)(3/7)/(jj*6/jjjjj(1/12)j) assuming j is positive. j*(-415/84) Simplify k/(k/(kk/(k/(k*(-2/19)k))))k(2/25)(k(-2/11)/k)(19/2) assuming k is positive. k(-96689/10450) Simplify (c(1/5)cc*(1/2)c*3/(cc(1/8)))(16/3) assuming c is positive. c(286/15) Simplify ((l(-23)/ll)(3/19))(-11/2) assuming l is positive. l(759/38) Simplify ((ff/((fff/(f*14/f)ff)/f))/f)/(f16f)f(-1/11)f/((f*(-3/4)/ff)/f) assuming f is positive. f(-191/44) Simplify (w2w)(-1/68)w*(7/6)(w/(w/(w/((w*(-12)/w)/ww))))/ww assuming w is positive. w(3085/204) Simplify (b/b(2/61))/(bbb(-1))(b/b*16)/(bb21/b) assuming b is positive. b(-2198/61) Simplify ((z/(z*(-1/6)z))/z3)/(z7/zz(2/15)) assuming z is positive. z(-269/30) Simplify (z/(z/(zz*(-6))z))/(z/((zz/(z/z17))/z))(zz0)(1/4) assuming z is positive. z(41/4) Simplify ((f(2/13)f)/fffff)*(-28)(f*3f)(19/3) assuming f is positive. f(-3548/39) Simplify (z(-1/17))(-46)/(zz9)(13/7) assuming z is positive. z(-1888/119) Simplify d(2/5)/((d/(dd*14/ddd))/dd)(d(-3/4))(4/5) assuming d is positive. d(74/5) Simplify ((z/z(-2)zz3z)/((z/(z6/z))/z(4/7)))(-4/23) assuming z is positive. z(-352/161) Simplify (q*(-8)q*25/q)/(q/(qq*(-5/6))q/q(-12)) assuming q is positive. q(13/6) Simplify (((q/(qq(qq(16/3))/qqq))/q)/q)(-30)(q/(q*29/q)q)/(q/(qq23)) assuming q is positive. q307 Simplify (((b(1/2)b)/bbb2)/(b0)(-16/5))41 assuming b is positive. b*(287/2) Simplify (ll*(-3/4)/l)/ll*(1/44)(l*(4/5)l)(-2/43) assuming l is positive. l(-4283/2365) Simplify (d(-1))(43/3)/((d11/d)/(d(4/3)d)) assuming d is positive. d(-22) Simplify ((((((ii/(i/(i/(i/(ii(-7))))))/i)/i)/i)43)(-26))(-5) assuming i is positive. i(-44720) Simplify (g((gg/(g(-1)gg))/g)/gg)(9/4)/(g/g(5/6)g(-5/6)) assuming g is positive. g(35/12) Simplify u(4/5)u*(-18)(u/(u*20uu))/(uu(-1/19)) assuming u is positive. u(-3719/95) Simplify (a*(-13)(aa/(((a/(aa*(-2)))/a)/a))/a)/(aa(-2/3))43 assuming a is positive. a*(-79/3) Simplify ((ccc/c(-13)c)/c(-8))/(c4)(1/24) assuming c is positive. c(149/6) Simplify ((s*(-2/3)s)/(ss(1/5)s))(3/7) assuming s is positive. s(-4/5) Simplify (l*(-5/6)ll(-1/10))2 assuming l is positive. l(2/15) Simplify (h(-5)h*(2/47))/((((hh*13)/h)/hh)/hh(1/13)) assuming h is positive. h(-10408/611) Simplify ((k6)(-2/5))18 assuming k is positive. k(-216/5) Simplify (ccc6c*(6/5))/(cc*(-2/17)cc/(c/c(-7))) assuming c is positive. c(1217/85) Simplify (ll*(-1/7)/llll)/lll*10l(l2)21 assuming l is positive. l(391/7) Simplify (z(-1/3))7zzz*(2/3)(z/(zz/(z/z(-1))z)zz)/z assuming z is positive. z(4/3) Simplify ((a/(a/a(1/18)a))/aa)(-1/40)/(a12)(-41) assuming a is positive. a(354257/720) Simplify (k6)12/(k21/k(-1/11)) assuming k is positive. k*(560/11) Simplify (((fff/f(-10)f)/f)/(f/f(-4)))/(f(-1/20)ff/(f(-13/3)/f)) assuming f is positive. f(43/60) Simplify (h*(1/18)hhhh(h/h*(-23)h)/hhh)/(hhh*(4/7)hh)(-39) assuming h is positive. h(26251/126) Simplify ((n/n(-4)n*(3/5)/n)/(nn(-1/5))8)(1/3) assuming n is positive. n(-3/5) Simplify oo(1/2)oo(-27)o(o/(o18/o))/oo*15o assuming o is positive. o(-49/2) Simplify (x(9/4))*(2/55)(xx(xxx*(-25)/x)/xx)/(x/(xx(-1/3))) assuming x is positive. x(-7343/330) Simplify j3/j(-2/7)(j(-3/5)/j)(7/13) assuming j is positive. j(1103/455) Simplify a(3/4)/a*(3/5)(aa(-7/5)aa)/(a(-4/5)/a) assuming a is positive. a(71/20) Simplify ((r18r)/r(-24/5))/((r/(r/(r8/r)r))/r)(5/14) assuming r is positive. r(1541/70) Simplify (i(-26)ii(-7/5)i)(2/7) assuming i is positive. i(-254/35) Simplify vv(-4/13)/vv/(vv7)v/((v*15/vv)/vv)v(v(-2/63)vv)/vv assuming v is positive. v(-15020/819) Simplify ((n11/n(-9))(-5))(-17/2) assuming n is positive. n850 Simplify (jj(-5/4)/jjj/(jjjj/(j*6j))j)/(j/j(3/8)j(-4)) assuming j is positive. j(65/8) Simplify ((t/((t*(1/9)/t)/t)t)/(t*(-6/7)/t)t*3t*(-4/5)t)3 assuming t is positive. t(2818/105) Simplify ((m*(19/5)m)/(m/(m14/m)))/(m(-11)/(m*(-11)m)) assuming m is positive. m(89/5) Simplify ((g(-17)/g)(-38))(-15) assuming g is positive. g(-10260) Simplify g10gg/g*(4/7)g(g/((gg(gg(gg*(-1/6)gg)/g)/g)/g))/g(-4/3) assuming g is positive. g(153/14) Simplify ((cc*(3/7)((c*(6/7)cc)/c)/c)(-4))(2/5) assuming c is positive. c(-128/35) Simplify (r21/(r(-2/31)rrr))/(rr9r(rr*(-14))/rr) assuming r is positive. r*(622/31) Simplify ((dd/(d*2d)d)43d*(1/13)/(dd*(1/2)dd))(-1/2) assuming d is positive. d(89/52) Simplify ((((h/h(-7)h)/hh)/h)/(h(-7)/h))/(h(-8/11)/(h(3/10)h)) assuming h is positive. h(1983/110) Simplify (b12)*(-4/3)/(bb/(b(bb*(-8/3)b)/bbb)b)(-42) assuming b is positive. b54 Simplify (((a(2/3))(-43))(-30))(4/27) assuming a is positive. a(3440/27) Simplify (x/(x/x(5/4)))38x13/(x4x) assuming x is positive. x(111/2) Simplify ((s/(s/(sss(1/4)s)))*(-14/9)(((s/(s/s(-1/4)))/s)/s)/s7)(1/16) assuming s is positive. s(-515/576) Simplify (s2)36/((s/s(-2/3))/s5) assuming s is positive. s*(226/3) Simplify ((i/(ii*(-23)i))(2/7))9 assuming i is positive. i*(396/7) Simplify ((oo/(o*(4/9)/o)oo)/o)/o14o*23/(oo(-17)) assuming o is positive. o(257/9) Simplify (tt(-1/18))(-48)/(t/(t/t4t)t(-6/5)) assuming t is positive. t(-707/15) Simplify (m(7/2)mmmm(-1/5)/m(m2/m)/(((m/m(2/5))/m)/m))(-22/7) assuming m is positive. m(-121/5) Simplify (o/(o/((o*(2/3)o)/oo)o))/(((oo(1/16))/o)/o)(oo10)/(o/((o/o(-1/7))/o)) assuming o is positive. o(3947/336) Simplify (a6a/(a*(1/14)a)aa((a/(aa*(-2/7)a)a)/a)/aaa/a5)(-17/5) assuming a is positive. a(-153/14) Simplify (x(-4/5)/x)/(x/(x(-2/9)x))xx*(1/12)x*(-1/6)x assuming x is positive. x(-19/180) Simplify ((z24z)/z(-6))18 assuming z is positive. z558 Simplify (((s(-1/4))(-44/5))(11/3))17 assuming s is positive. s(2057/15) Simplify (u/u(-1/7)u(-13))/((u(-2/21)u)/u(-6/13)) assuming u is positive. u(-3610/273) Simplify (d/(d/d(-5)d)d)39d/d*(-4)dd(6/13)ddd assuming d is	{ "pile_set_name": "DM Mathematics" }
rs of 4556863. 41, 111143 What are the prime factors of 4468247? 7, 31, 59, 349 What are the prime factors of 354627? 3, 7, 13, 433 List the prime factors of 418153. 271, 1543 What are the prime factors of 9741373? 557, 17489 List the prime factors of 4130893. 13, 197, 1613 List the prime factors of 4037218. 2, 37, 89, 613 What are the prime factors of 17935061? 859, 20879 List the prime factors of 23586555. 3, 5, 71, 22147 List the prime factors of 67542. 2, 3, 11257 What are the prime factors of 107776? 2, 421 What are the prime factors of 254730? 2, 3, 5, 7, 1213 List the prime factors of 26357062. 2, 359, 36709 List the prime factors of 309253. 7, 44179 What are the prime factors of 435694? 2, 7, 31121 List the prime factors of 254563. 277, 919 List the prime factors of 44394. 2, 3, 7, 151 What are the prime factors of 1081347? 3, 19, 61, 311 What are the prime factors of 4296071? 13, 19, 17393 List the prime factors of 319467. 3, 83, 1283 What are the prime factors of 635904? 2, 3, 23 What are the prime factors of 3511736? 2, 438967 What are the prime factors of 1205318? 2, 41, 14699 What are the prime factors of 2072953? 2072953 List the prime factors of 4032664. 2, 53, 9511 List the prime factors of 6052155. 3, 5, 29, 13913 What are the prime factors of 182030? 2, 5, 109, 167 List the prime factors of 325517. 325517 List the prime factors of 699449. 699449 List the prime factors of 377995. 5, 17, 4447 List the prime factors of 28599758. 2, 11, 1299989 List the prime factors of 5818013. 5818013 List the prime factors of 8077576. 2, 13, 101, 769 List the prime factors of 154027. 154027 What are the prime factors of 212336? 2, 23, 577 List the prime factors of 236101. 179, 1319 List the prime factors of 148370. 2, 5, 37, 401 What are the prime factors of 3467691? 3, 31, 1381 What are the prime factors of 23503? 19, 1237 List the prime factors of 302175. 3, 5, 17, 79 List the prime factors of 16563195. 3, 5, 11, 33461 What are the prime factors of 7256471? 47, 181, 853 What are the prime factors of 5802774? 2, 3, 967129 List the prime factors of 18950141. 7, 2707163 What are the prime factors of 17227226? 2, 53, 331, 491 List the prime factors of 17507003. 17507003 What are the prime factors of 42075529? 157, 263, 1019 What are the prime factors of 10570885? 5, 13, 162629 What are the prime factors of 34405101? 3, 107, 11909 What are the prime factors of 21167073? 3, 2351897 What are the prime factors of 15725017? 7, 11, 17, 41, 293 What are the prime factors of 499926? 2, 3, 7, 11903 List the prime factors of 405539. 283, 1433 What are the prime factors of 17993379? 3, 103, 58231 List the prime factors of 1934871. 3, 43, 53, 283 What are the prime factors of 401234? 2, 17, 11801 List the prime factors of 33545462. 2, 41, 313, 1307 List the prime factors of 7338735. 3, 5, 54361 What are the prime factors of 304380? 2, 3, 5, 19, 89 List the prime factors of 120967. 7, 11, 1571 What are the prime factors of 8345997? 3, 11, 17, 19, 29 What are the prime factors of 282488? 2, 35311 What are the prime factors of 1214385? 3, 5, 19, 4261 List the prime factors of 321100. 2, 5, 13, 19 What are the prime factors of 454860? 2, 3, 5, 7, 19 List the prime factors of 577657. 19, 30403 What are the prime factors of 3762089? 677, 5557 List the prime factors of 4206566. 2, 7, 13, 29, 797 List the prime factors of 357461. 13, 31, 887 What are the prime factors of 36756980? 2, 5, 13, 109, 1297 List the prime factors of 11666688. 2, 3, 11, 1381 What are the prime factors of 7788450? 2, 3, 5, 137, 379 List the prime factors of 71408. 2, 4463 List the prime factors of 2395795. 5, 23, 83, 251 What are the prime factors of 370915? 5, 31, 2393 What are the prime factors of 522140? 2, 5, 26107 List the prime factors of 184267. 103, 1789 List the prime factors of 13368381. 3, 13, 19, 18041 List the prime factors of 136980. 2, 3, 5, 761 What are the prime factors of 86989? 7, 17, 43 List the prime factors of 6287921. 6287921 What are the prime factors of 13693027? 23, 47, 53, 239 What are the prime factors of 15364878? 2, 3, 1153, 2221 What are the prime factors of 20471887? 439, 46633 What are the prime factors of 47353? 47353 What are the prime factors of 268079? 7, 5471 What are the prime factors of 1596985? 5, 13, 79, 311 What are the prime factors of 6101462? 2, 409, 7459 What are the prime factors of 1871503? 1871503 What are the prime factors of 458968? 2, 103, 557 List the prime factors of 2965898. 2, 13, 114073 What are the prime factors of 103839? 3, 34613 What are the prime factors of 1844197? 19, 29, 3347 List the prime factors of 51385. 5, 43, 239 What are the prime factors of 104450? 2, 5, 2089 What are the prime factors of 10894888? 2, 31, 197, 223 What are the prime factors of 338069? 37, 9137 List the prime factors of 114613. 114613 List the prime factors of 29478345. 3, 5, 13, 151171 List the prime factors of 932747. 53, 17599 List the prime factors of 279586. 2, 43, 3251 List the prime factors of 2921021. 101, 28921 List the prime factors of 219828. 2, 3, 7, 2617 List the prime factors of 25361508. 2, 3, 2113459 List the prime factors of 6161720. 2, 5, 154043 What are the prime factors of 7355989? 7355989 What are the prime factors of 141042? 2, 3, 11, 2137 List the prime factors of 634148. 2, 158537 What are the prime factors of 941646? 2, 3, 156941 What are the prime factors of 377264? 2, 17, 19, 73 List the prime factors of 376747. 7, 107, 503 List the prime factors of 692667. 3, 76963 What are the prime factors of 672278? 2, 29, 67, 173 What are the prime factors of 29249027? 17, 31, 55501 What are the prime factors of 1107589? 7, 158227 What are the prime factors of 1798912? 2, 7027 List the prime factors of 428809. 428809 List the prime factors of 475342. 2, 7, 19, 1787 What are the prime factors of 141783? 3, 167, 283 What are the prime factors of 956882? 2, 478441 What are the prime factors of 1942333? 29, 66977 List the prime factors of 16493835. 3, 5, 1099589 List the prime factors of 845476. 2, 211369 What are the prime factors of 84753? 3, 43, 73 List the prime factors of 229223. 229223 What are the prime factors of 5283651? 3, 17, 211, 491 What are the prime factors of 1978664? 2, 17, 14549 List the prime factors of 114629. 79, 1451 What are the prime factors of 1318610? 2, 5, 131861 List the prime factors of 151908. 2, 3, 12659 What are the prime factors of 43247? 59, 733 What are the prime factors of 454605? 3, 5, 30307 What are the prime factors of 1900656? 2, 3, 67, 197 List the prime factors of 391750. 2, 5, 1567 What are the prime factors of 168254? 2, 84127 List the prime factors of 11946806. 2, 5973403 List the prime factors of 382523. 179, 2137 List the prime factors of 1967077. 7, 151, 1861 What are the prime factors of 149139? 3, 73, 227 What are the prime factors of 10345844? 2, 61, 109, 389 What are the prime factors of 17793236? 2, 89, 151, 331 List the prime factors of 103027. 269, 383 What are the prime factors of 19923966? 2, 3, 17, 65111 List the prime factors of 1173131. 137, 8563 List the prime factors of 251876. 2, 62969 What are the prime factors of 26811? 3, 331 List the prime factors of 26383659. 3, 61, 144173 List the prime factors of 653540. 2, 5, 41, 797 What are the prime factors of 1651928? 2, 31, 6661 List the prime factors of 768262. 2, 11, 47, 743 What are the prime factors of 20259188? 2, 1871, 2707 List the prime factors of 184027. 163, 1129 List the prime factors of 181054. 2, 90527 List the prime factors of 5697109. 11, 517919 What are the prime factors of 2059886? 2, 1029943 List the prime factors of 249655. 5, 7, 1019 What are the prime factors of 152485? 5, 30497 List the prime factors of 7733029. 1223, 6323 List the prime factors of 1360363. 59, 23057 What are the prime factors of 586792? 2, 41, 1789 List the prime factors of 8177438. 2, 313, 13063 List the prime factors of 6791500. 2, 5, 17, 47 What are the prime factors of 438745? 5, 47, 1867 List the prime factors of 312977. 7, 44711 What are the prime factors of 42640? 2, 5, 13, 41 What are the prime factors of 166228? 2, 29, 1433 What are the prime factors of 854024? 2, 106753 List the prime factors of 29290541. 7, 17, 47, 5237 What are	{ "pile_set_name": "DM Mathematics" }
posite number? False Let d be 1/(-5) - 11556/(-30). Suppose 3w - d = -2w. Is w composite? True Let a(p) be the second derivative of p4/12 - p3/3 + 11p2/2 + p. Is a(8) a prime number? True Let k = 3 - 1. Suppose 8 = 2w + 2. Suppose 0 = -3l + kz + 59, l + l = wz + 36. Is l prime? False Let s = -1602 - -2693. Is s prime? True Let u = 16 - 8. Let c(i) = 43i + 11. Is c(u) composite? True Let x = -464 + 929. Suppose -3l - 3 = 0, -4q + 4l = -l - x. Is q a composite number? True Let p(b) = -2b3 + b2 - 1. Is p(-2) prime? True Suppose -3v = -4d - 150, -2v + 44 = 2d - 42. Is ((-2)/4)/((-1)/v) prime? True Suppose n + 0n = 0. Suppose -186 = -nk - 3k. Is k composite? True Suppose -k + 252 + 79 = 0. Is k a composite number? False Suppose -3i = 3g - 2i - 101, -15 = -3i. Suppose 0 = -2s - 5j + 91, 0 = -2s + 5j + 109 + g. Is s a prime number? False Let i(u) = u2 + 4u + 3. Let c be i(-6). Let h = 18 + c. Suppose 2w - w - h = 0. Is w prime? False Suppose -3f + 1 = -2p - 2, 0 = -5p + 3f + 6. Suppose pj = 80 + 34. Is (j/(-3))/((-2)/3) a prime number? True Suppose n + 4 = -4. Let s be -34/6 - n. Suppose -3r + s = -2r. Is r a prime number? False Let h = 139 + -60. Is (h/(-4))/((-4)/16) prime? True Let n = -6 - -12. Suppose t + 0 = n. Is (-2)/(8/(-6))t composite? True Suppose s + 0s - 395 = 0. Suppose 7l = 2l + 2g + 894, 2l - 5g - 345 = 0. Suppose s + l = 5i. Is i composite? True Let o be (-2 - -2)/(0 + 1). Let x(s) = 6s + 13 - s - s - 5s. Is x(o) prime? True Let n = -5 + 7. Is n/(-7) - (-247)/7 prime? False Let x(d) = -67d*3 - 3d*2 - 3d - 1. Is x(-2) a prime number? False Suppose 5398 = 5l + v + 2v, -4v - 1075 = -l. Is l composite? True Let g(s) = s - 4. Let b(y) = -1. Let d(h) = -2b(h) + g(h). Let j be d(6). Let v(l) = -l*3 + 4l*2 + l. Is v(j) a composite number? True Let s(z) = 11z - 3. Let y be s(4). Suppose 4c = 107 + y. Is c a composite number? False Let y be 39/6 - 6/4. Suppose -4i + 2 = s - 2, -ys + 20 = -2i. Suppose -sb + 27 = -305. Is b composite? False Suppose 0 = 3r - 2531 - 922. Is r composite? False Let o(s) = s*2 - 2s - 22. Is o(-9) prime? False Let s = 0 + 0. Suppose 0 = -6n - 12 + 42. Suppose -na + 626 + 189 = s. Is a a prime number? True Let n be 3 + (-4)/(8/4). Let a(v) = 2 + 7v + 51v - 1. Is a(n) a composite number? False Suppose -3g - 3v + 60 = -0g, -5g = 4v - 97. Suppose -5 = 3b - g. Suppose z = bz - 93. Is z prime? True Suppose 3f - 875 = -x, -3x + 1683 = 4f + 523. Is f composite? False Suppose -v - 5g = 26, 5v - 2g + 6g = -25. Let h = v + 5. Let p(k) = 7k2 + 2k - 1. Is p(h) a prime number? False Let y = -9 - -13. Let w(s) = s*3 - 6s*2 - 7 + y - 5 - 2s. Is w(9) a composite number? True Let u(i) = i*2 + i - 8. Let m(r) = -2r3 + r2 + r. Let v be m(2). Is u(v) a composite number? True Let f = 6 - 8. Let w be 1 + 10 + -3 + f. Is (-4)/(-2)159/w prime? True Suppose -2c + 289 = -1081. Is c prime? False Let f(u) = 12u + 4. Let q be f(-4). Let h = q + 80. Let s = 59 - h. Is s a composite number? False Suppose -4x + x + 981 = 0. Is x a prime number? False Let t(n) = n + 2. Let p be t(2). Let l(m) = m2 + m2 - 2 + 1 - 4m. Is l(p) a prime number? False Suppose 4o + 2d = -d + 2197, 3d + 1121 = 2o. Suppose 4j + o = 5t, -2t + 0j = 3j - 235. Is t a prime number? True Suppose -6c + 5x = -c - 14710, -2c + 4x + 5890 = 0. Let n = c + -2086. Is n a composite number? False Suppose 0 = -q - 2d + 2, -2d = -q + 2d + 2. Suppose -23 = -qz + z + 2t, 3z - 67 = 5t. Is z a prime number? True Let o(l) = -l + 1. Let v be o(-3). Suppose n - 500 = -5p - 2n, vn - 20 = 0. Is p prime? True Suppose 638 = -t + 3t. Is t composite? True Let x = -188 - -301. Suppose -v + 6 - x = -5c, 0 = 2v + 4. Is c prime? False Suppose 5x - 10485 = 5l, -3x - 4l + 11 = -6266. Is x prime? False Suppose -2m = 4j - 2040, 4m + 3j = 1674 + 2396. Suppose m = 3o - 5o. Is o/(-12)13 composite? False Suppose 0 = 4v - 430 + 90. Is v composite? True Is 4/6 + (-2666)/(-6) composite? True Let j(i) = 2i2 - i + 4507. Is j(0) prime? True Let f(d) = -d2 - d + 2. Let o be f(0). Let p be 1 + (-1)/((-3)/783). Suppose -2v - p = -4h, h + oh = -5v + 216. Is h composite? False Let c(o) = 4o*2 + 3. Let j(q) = -8q - 17. Let r(v) = -3v - 6. Let u(i) = 4j(i) - 11r(i). Let g be u(6). Is c(g) prime? True Let l be (2/(-4))/((-1)/(-8)). Let r(q) = q2 + 2q - 4. Let f be r(l). Is 2/f4 - -1 a prime number? True Is (4/(-6))/((-12)/(-21078))-1 composite? False Suppose 6t - 2t - 20 = 0. Suppose 9 = 3k + 3. Suppose t = u + 2j - 7, -ku = -5j + 12. Is u composite? True Let s(k) = 27k - 15. Is s(4) a prime number? False Let b(w) = -w2 - w + 46. Let s be b(0). Suppose -s = -2x - 0x. Is x a composite number? False Suppose -4q = -q - 663. Is q composite? True Let g(w) = 137w - 5. Is g(2) a prime number? True Let g(f) = -5f. Let s be g(-1). Let l = -5 + s. Suppose -2r - 3a - a = -104, l = 2r - 4a - 128. Is r prime? False Suppose 3j + 12 = 0, 2j - 2615 = -5q + 2422. Is q a prime number? True Let t be (-2 + -3 + 2)/(-1). Suppose -t - 6 = -r. Let c = r - -2. Is c a composite number? False Let x be (-2 - -4)/(2/(-1)). Let g be -2(-2 + 6/4). Is -1 + (17 + x - g) a prime number? False Suppose 12i - 9i - 2121 = 0. Is i a prime number? False Let b be 3 + 2 - 2 - -484. Let m = b + -342. Is m a composite number? True Let d(p) = p*3 + 6p*2 - p + 2. Let m be d(-6). Let b(i) = -22i - 9. Let g be b(11). Let v = m - g. Is v composite? True Suppose 0 = 3m + 3q + 12, m + 5q - 12 = -36. Let o(d) = 114d*2 + d. Is o(m) composite? True Let z = 0 - -2. Suppose zw - 3 + 9 = 0. Let b = w + 22. Is b a composite number? False Suppose 4q + 1267 = 5q. Is q a prime number? False Suppose 0 = -d + 3 - 1. Suppose 0 = u - k - 106, -k = du + 2k - 227. Let h = -76 + u. Is h a composite number? True Let z = 2 + -6. Let b be (-1352)/9 - z/18. Is b/(-4) - 3/6 a prime number? True Let c(h) = 36h2 - 3. Is c(-2) prime? False Let j(y) be the second derivative of y5/10 + 5y*4/12 - 3y*3/2 + 11y*2/2 - 2y. Is j(5) a prime number? False Let m(l) be the first derivative of -l*2 + 2l + 2. Let g be m(-3). Suppose f - g = 45. Is f composite? False Let u be (1(-2 - -2))/2. Suppose 0 = -3d - u + 6. Is d a composite number? False Suppose 3k - 455 = 454. Is k prime? False Suppose 0 = 3x - 4x. Suppose xv - 2v = 0. Suppose 5c - 417 - 128 = v. Is c composite? False Let y be (-4)/3 + (-678)/(-9). Suppose -y = -2x + 12. Is x a prime number? True Suppose -2d - d = 2w + 31, 0 = -2d - 3w - 19. Is (-4 - d)/(1 + 0) a prime number? True Suppose 255 = f - 439. Is f a prime number? False Suppose m + 2716 = 5m. Is m a prime number? False Let r(j) = 46j + 1. Let g(d) = -2d - d - d*2 - 1 - 2d*3 + 2d. Let a be g(-1). Is r(a) composite? False Let m be 4/((-16)/(-18))2. Suppose m = -3t - 0t. Is (10/t)/((-8)/132) prime? False Suppose -5h + 14721 = -2h. Is h composite? True Let i(m) = 9m - 15. Let y be i(5). Let x(n) = -5n - 1. Let a be x(-1). Let s = y - a. Is s a composite number? True Suppose 156 = -w + p, -2w + 0p - 318 = p. Let j = w - -285. Is j a prime number? True Let p(y) = 42y*3 - 2y*2 + y. Let b be p(2). Let l = b - 233. Is l composite? False Let u(b) = -9b*3 - 3b*2 + b - 2. Let t be u(-3). Suppose 3k - 39 - 182 = 4v, 2v = 3k - t. Is k prime? True Suppose k + 2939 = 2z, 2z - 4z + 4k = -2930. Is z a composite number? False Suppose -3w + 2 = -4. Suppose -2g = 3g - 3d - 15, 2g - wd - 10 = 0. Let a(v) = v3 + 11. Is a(g) a prime number? True Suppose -8j = -959 - 297. Is j composite? False Let b be 191(3 - (-3 + 5)). Suppose 0 = z - b - 110. Is z a composite number? True Let g(x) = 3x*2 + 3x + 1. Suppose j + 17 - 1 = 5a, 36 = -3j + 3a. Is g(j) prime? True Is (-3)/(1 + (-528)/524) a prime number? False Let n be ((-2)/4)/(2/(-12)). Suppose -9 = -4t + 3. Suppose -2u + 90 = nq, -8u = -3u - tq - 267. Is u composite? True Let r be (-1 - 5)40/30. Let a(q) = -10q - 1. Is a(r) a prime number? True Let b be ((-20)/(-30))/(2/93). Suppose -2o = -o - b. Is o prime? True Suppose 4a - 3 = 9. Suppose 2r - 587 - 526 = -au, 3u + 5*r	{ "pile_set_name": "DM Mathematics" }
22. Let d(a) = -a*2 + 4a - 1. Let p be d(i). Solve h + o = p, 0 = 4h - 5o - 3 for h. 2 Let z be (-4 - -151)1/3. Let s = -44 + z. Solve -j - c = 3j - 5, -j - sc = -6 for j. 1 Let a(f) be the second derivative of -1/12f*4 + 2f*2 - 1/3f*3 + f + 0. Let h be a(0). Solve -i - 2n - h = 0, 2i + 2i = -5n - 16 for i. -4 Suppose -n - 17 = 4g - 82, 0 = 4g - 5n - 35. Solve 3f = -4x + 10, -3f + x + 5 = g for f. -2 Suppose q - 17 + 4 = 0. Let i be 1(0/9)/(-2). Suppose 0v = 5v - 15. Solve -3 = -c - n, -4c - 5n + v + q = i for c. -1 Let a(s) = -5s + 5. Let t be a(1). Suppose 3k = 4j - 3, t = -0k + k - 5j + 12. Suppose 0 = 2f - 6 - 6. Solve -u + h = -3, -fu + u = kh - 23 for u. 4 Suppose -2o = 3o + 10, t = 4o. Let f(g) = g3 + 9g*2 + 7g - 4. Let p be f(t). Solve 5v + 14 = u - 8, pu + 32 = -4v for v. -5 Suppose 2f - 9 = -5m, 3m + 5f - 1 + 7 = 0. Solve 4k = 4l, -2k - 2 - m = -3l for l. 5 Let d be ((-2)/4)/(5/150). Let b = -11 - d. Suppose bi - 2p = 24, 3i - 4p - 33 = -2i. Solve iu = 2j + 33 - 0, 0 = 4u + 3j - 8 for u. 5 Let g = 16 + -11. Let c = 6 + 3. Suppose 0 = -ck + 4k + 40. Solve k = -2o - 4u, -gu = -0u for o. -4 Let c = -512 - -504. Let u = -72 - -117. Let l be (c/(-5))/(6/u). Solve -2 = 2r + 3s, r + r = 4s + l for r. 2 Suppose -3t + 84 = -3v, 0v - 5v = 2t + 147. Let w = -27 - v. Suppose 0 = 5p - wi - 2, 2 - 1 = -5p - i. Solve 5f - 4z - 6 = p, -z - 8 = f - 2 for f. -2 Suppose 13u - 220 = -31u. Solve -ud + c - 24 = 0, 4d - 4c + 15 = -1 for d. -5 Let n = 55 + -50. Suppose 3j = 4w + w - 23, 15 = 5w + nj. Solve 0 = 4o - 4y - w, 2o + 7y - 4y - 7 = 0 for o. 2 Let s(t) = t3 + t2 - 4t - 1. Let u be s(-6). Let v = u - -159. Solve 0 = a - va - r + 5, 0 = 3a + 4r - 15 for a. 5 Let h = -924 - -928. Solve 5z = hs - 2s - 7, 0 = -3s - z + 2 for s. 1 Let n be 1 + (1 + -5)-1 + -5. Solve -5f + nw - w + 20 = 0, -f = 2w - 13 for f. 3 Let c(w) = -w - 5. Let d be c(-4). Let m be 1 + d + 11 + 1. Suppose -95j + 28 = -88j. Solve -3a - m = -3h, a - 10 - 1 = -jh for h. 3 Let m(x) = x*2 + 5x - 20. Let i be m(-9). Suppose -4s = 2p - i, -2s + s + 5 = p. Solve -5a + 3 = -pu + 2, -4u + 4a + 4 = 0 for u. 2 Suppose o - 45 = -4. Let n = o - 38. Solve 0m - y = -2m - n, 4y - 12 = 0 for m. 0 Suppose -6b = -4b. Let x be 2 + ((-3)/(-3))/1 + b. Solve -o - 2o = -3r + x, 0 = -r + 1 for o. 0 Let j(a) = a*3 - 9a*2 - 12a + 28. Let p be j(10). Let q = -8 + p. Solve -2i + l = -qi - 7, -i + l + 3 = 0 for i. 4 Let o be 10/(-20) - 18/(-4). Suppose 3 = -oz - 17. Let t = -1 - z. Solve tx = 2v, 3 = -5x + 3v + 1 for x. 2 Suppose 0 = 8v + 156 + 212. Let z = -46 - v. Solve -2b - 5n = 2b + 21, -3b + 2n - 10 = z for b. -4 Suppose 4 = 2d - 2u, 2d - 3d + 2 = 5u. Solve 4z = -i - 3i - 4, 3z = di + 17 for i. -4 Suppose -3h = -5h + 6. Let p(l) = -l*2 - 13l + 4. Let j(g) = 18g + 60. Let i be j(-4). Let f be p(i). Solve hy = -2y + k + 15, -f = y - 4k for y. 4 Let a(s) = -5s - 146. Let x be a(-30). Solve 2y = 3f - 7, 0 = 5f + 4y - 1 + x for f. 1 Let s be 2/4 + 22/(-4). Let v be 7/2 - (-7)/(-19 - s). Solve -5 = -5d - 5g, vd - 2g + 3g = 1 for d. 0 Let u(z) = -4z + 18. Let q be u(5). Let c be 93/6 + 2 + q/4. Solve -j + c = -3t, 5j = 5t + 2j + 31 for t. -5 Suppose 17p - 22p = -11p. Solve 5i - 8i + 8 = -2j, 3i - 6 = p for j. -1 Let j be -1(2 + -1) - -8. Let z = 0 + j. Let a = z - 2. Solve -h + 5h = u, 21 = -h - au for h. -1 Let z be 2/(-31) + (-5418)/(-1333). Solve -10 = -m - zm, 0 = 2i + 4m - 2 for i. -3 Let v = 12 + -10. Suppose -17 = -y - 4z, -3z + 29 = 6y - vy. Suppose 25 = yf - 0f. Solve 5c = 5w - f, 2c - 6 = -w - 2c for w. 2 Suppose 54 = -97n + 115n. Solve -5z - 16 = -nf, 4z - f + 3f + 4 = 0 for z. -2 Suppose 15d - 17d + 54 = 0. Let b be ((-3)/d3)/((-3)/144). Solve -x - 3x = f + b, -8 = -2f + 2x for f. 0 Suppose -4r + f = 3f + 112, 4r = 2f - 96. Let v = r + 28. Solve -vn - 3 = 3l - 0n, 2n - 15 = 3l for l. -3 Let d(s) = -s3 + 7s*2 - 6s + 4. Let m be d(6). Let w be (0/(-2))/(-2 - -4). Suppose w - m = -j. Solve f + 15 = ju, f - 2u + 10 = u for f. 5 Suppose x = 2x + 4, 0 = s + 5x + 91. Let u = -71 - s. Solve -3y + 2w + uw + 20 = 0, -2y = w - 4 for y. 4 Let l(r) = -r*3 - 2r*2 + r - 3. Let b be l(-3). Let v be (12 - 12)/(2/(-2)). Suppose -f + vf + 21 = 0. Solve -ba + 2o - 21 = -8a, -3o + f = 4a for a. 3 Suppose -7 = 3m - 10. Solve g = y + 1, -6g - 3y = -11g + m for g. -1 Suppose -3w - 4 = 2u - 23, u - 22 = -4w. Let y = 92 + -94. Let p be (-20)/y1/u. Solve 11 = px + 4v, -v + 7 + 1 = -4x for x. -1 Let q(b) = b*3 + 5b*2 + 6b. Let r be q(-3). Solve -3w - 8 = i, -5i + 11 = -2w - rw for i. 1 Suppose -1 - 1 = 2t. Let j be (-1 + t)(-9)/6. Suppose 0 = 3v - 6, -jv + 4v = 5s - 18. Solve 5l = 3i, -2l + 4l + si + 26 = 0 for l. -3 Let c = 1235 + -1231. Solve -4l + 8 = ck, 0 = 4k + k for l. 2 Suppose 6d - 66 = -5d. Solve -5w = -y - 13, 2w - 4y - 4 = dw for w. 2 Suppose 5b - 193 = 7. Let s = b - 37. Solve 2l - 6 = 3t, sl + 7 = -3t + 1 for t. -2 Let g = -346 - -358. Solve 2p + g = 3p + 4y, -y = -3p - 3 for p. 0 Let p be -3 + -326/(-2). Suppose -a - 2a + 23 = i, -4a + 4i + p = 0. Suppose 5u + 2t = a, 6 = 2u - t + 1. Solve 0 = w + 3, -2w = ub - 4w - 14 for b. 4 Let u = 251 - 29. Suppose 0 = -3f + 5f + u. Let y be 4/(-14) + f/(-21). Solve -2t - 18 = -4h, 0 - 22 = 3t - yh for t. 1 Suppose 27 = 15c - 33. Solve -2f = 5i + 9, -3 = f + ci - 2i for f. 3 Suppose 4r = -0r + 12. Suppose 0 = 17i - 58 - 10. Solve ry + ip - 28 = -p, -9 = y - 2p for y. 1 Suppose -2u + 210 = -5u. Let m = 44 + u. Let z be 2/((-82)/m + -3). Solve -f = -5p - 14 + 43, -3f - 5p = -z for f. -4 Suppose -4y = 5f + 12, 2f + 4y = y - 2. Let v = f + 24. Solve 2o - v = -5s, 2 = s - 0 for o. 5 Let u = 25 + -25. Suppose u = -0c + 3c + 5i + 10, -2c - i = 2. Solve -2 = -2m - 4l, cm - 5l = 5m - 10 for m. 3 Suppose -5v - 10 = 0, p - 2v + 8 = 22. Let k(t) be the third derivative of t5/60 + t4/12 - 3t2. Let s be k(-3). Solve -m - 3 = l, -4 = sl - p for m. -5 Let j = 131 + -129. Solve 5x = jd + 4 - 37, -3x + 3d - 27 = 0 for x. -5 Let t be 25 + 2/(0 + 2). Suppose 31x - tx - 20 = 0. Solve 0d + 8 = xd - 2l, -4d - 2l + 24 = 0 for d. 4 Suppose 3p = -5d + 37, p - 2d = -3d + 9. Solve 5k + 4 = 2q, pk + q = -0q - 11 for k. -2 Let c = -59 + 62. Let d(h) = -h3 + 4h*2 - 3h + 5. Let n be d(c). Solve 0z + n = 2r - 5z, -5r = z - 26 for r. 5 Let f(o) = o*3 - 7o*2 + 5o - 7. Let a be f(6). Let z = -35 - -22. Let p = z - a. Solve 5h + 25 = -x, -h = -4x - px + 5 for x. 0 Let v = 245 - 240. Solve 0 = -b - 3, 3q - 4 = 3b + v for q. 0 Suppose 28f - 32f + 20 = 0. Let i = -1 + 4. Let z be (-6)/(-3) + 18 - i. Solve fq + z = -4w, -4 = -2q + 3w - w for q. -1 Suppose 4q + 8 = -2u - 8, 0 = u - 5q - 20. Suppose 2o - 10 = -u. Solve -on - v = -n + 1, 2n = 3v + 17 for n. 1 Let x = 1988 + -1983. Solve -12z + 7z = 4k - 16, -xk = -z - 20 for k. 4 Let r = 265 + -262. Solve d - 2i = r, 0 = -d - 4d + 4i + 3 for d. -1 Let d be 686/22 - (-2)/(-11). Let f = -29 + d. Solve -fj + 14 = 4c, 4j = 5c + 5 - 3 for c. 2 Let n(w) = w3 + 5w*2 - 5w + 6. Let a be n(-6). Let t(c) = -10c - 138. Let o be t(-14). Solve -ob + aq - 12 = -4q, 0 = -3b + q - 8 for b. -2 Suppose 2x - 14 + 6 = 0. Suppose 4p + 34 = 5v + 2, 0 = -3v - xp. Solve -w = -5n - 24, -2n = -6n - vw for n. -4 Let y(q) = -2q3 - 2q*2 + 3q + 2. Let x(d) = -d*3 - 4d*2 + 4d - 7. Let p be x(-5). Let k be y(p). Solve 5i - 4j - 1 = -0, -ki = 5j - 9 for i. 1 Let n = -4 + 10. Let w be 0 - (n/(-3) + 2). Let k = 1045 + -1035. Solve w = -5j - 5i - k, j - 5j - 2i - 14 = 0 for j. -5 Suppose -837 = -28j - 3j. Solve q - 26 = 5g, -5g - j + 6 = 4q for q. 1 Suppose 92p - 469 = 175. Solve 2o = 5g - 6, po - 8o - 3 = g for o. -3 Let g(q) = -q*2 + 12q + 6. Suppose 60 = 6j - j. Let c be g(j). Suppose 12 = -2z + cz. Solve 5v + 5t - 25 = 0, zt - 14 = 1 for v. 0 Let f be 11 - (2 - 0/(-3)). Let o be 0 + 1 - (-11 + f). Solve 4l + 25 = -8p + 3p, 0 = op -	{ "pile_set_name": "DM Mathematics" }
90w + 1146 = 306w - 42 for w. 3 Solve 597r - 5599 = -6607 - 7947 for r. -15 Solve 0 = 2320p + 5431 - 130711 for p. 54 Solve -779p + 6025 - 14840 = 22345 for p. -40 Solve -167v = -58v + 5893 + 2378 - 1949 for v. -58 Solve 7877o - 7901o - 72 = 0 for o. -3 Solve -2054o + 1927o - 426588 = -4128o - 1612o for o. 76 Solve 267l - 176 = -4194 - 1000 - 589 for l. -21 Solve -12h + 17h + 24h - 32533 = -31025 for h. 52 Solve -57b - 2606 = 20b + 32b + 1754 for b. -40 Solve 1593g - 13154g - 163847 - 321715 = -104049 for g. -33 Solve 713s + 185s - 69760 = -192s for s. 64 Solve -9097t + 20222 - 11250 = 5535 - 160309 for t. 18 Solve 5291z + 7z - 39298 = 2043 + 1043 for z. 8 Solve 403s - 159s - 2376s = -74620 for s. 35 Solve -174r + 1031054 = 1042538 for r. -66 Solve 151825 = -98k + 152609 for k. 8 Solve -705t - 550t - 189t = 388t - 58624 for t. 32 Solve 1230z + 98606 - 24427 + 11921 = 0 for z. -70 Solve 715800 = 3838w + 6997w - 3677w for w. 100 Solve -384g + 508 + 391 = -600 - 421 for g. 5 Solve 2096n = 21n + 13231 + 11669 for n. 12 Solve -19i + 0i - 69 = -5i + 1 for i. -5 Solve -25m + 241m - 19220 = -259m - 145m for m. 31 Solve 107v - 1593 = 2698 + 952 for v. 49 Solve -219x - 9x + 16709 = 311x for x. 31 Solve 5372d = 14876 - 79340 for d. -12 Solve -25079 - 39929 = -1787c + 10046 for c. 42 Solve 9210 - 4457 = 47b - 144b for b. -49 Solve 43t + 55t = 197t + 2t - 7777 for t. 77 Solve -888i - 23166 = -566 - 1288 for i. -24 Solve 361r + 614410 + 250316 = 7978r + 141111 for r. 95 Solve -330t = 293t - 181t - 26962 for t. 61 Solve -516u = 439u + 711u - 83300 for u. 50 Solve -46929 - 233017 - 46022 = -11729b + 2444 for b. 28 Solve -11w + 69 - 25 = -8w - 46 for w. 30 Solve 30l + 6l - 14l + 187 = -275 for l. -21 Solve 974 + 2916 = 389m for m. 10 Solve -1786h = -181h + 13633 + 8837 for h. -14 Solve 1263j + 42147 - 81968 = 52378 for j. 73 Solve -693y = -718y - 250 for y. -10 Solve -711z = -3693 + 44220 for z. -57 Solve 139y - 1948 + 1721 = 2275 for y. 18 Solve -43r - 1255 + 570 = -1588 for r. 21 Solve 1521x + 305x - 44110 + 15526 = 37152 for x. 36 Solve -110947 = -4i - 17i - 110296 for i. 31 Solve 6568u = 2175u - 39537 for u. -9 Solve 0 = -6367t + 37t + 75960 for t. 12 Solve -108c + 5113c = -2541c - 166012 for c. -22 Solve -k + 95 = 3k + 46k - 5 for k. 2 Solve -319a + 19166 + 567 = -2229 - 13447 for a. 111 Solve 5960 - 977 + 4892 = -125v for v. -79 Solve 378 - 1594 = -112q + 431 + 705 for q. 21 Solve -216u - 30960 = 267u + 549u for u. -30 Solve 0 = 17626i - 5710i - 59003 - 107821 for i. 14 Solve 53o + 406o - 4023 = 310o for o. 27 Solve 172p + 27417 = 93p - 624p for p. -39 Solve -51992f = -50517f + 119475 for f. -81 Solve -80431p + 80197p + 20358 = 0 for p. 87 Solve 29x + 574x + 15075 = 0 for x. -25 Solve -606 + 9067 + 95139 = 2800h for h. 37 Solve -685j - 1136j + 88j - 991j + 16344 = 0 for j. 6 Solve -167n - 5193 = 281n - 830n + 8177 for n. 35 Solve -2704f - 59719 - 14241 = 19104 + 134072 for f. -84 Solve 0 = 2440o + 4587o - 107o - 705840 for o. 102 Solve 38x + 665 = 894 - 571 for x. -9 Solve 4354797 = 69l + 4352520 for l. 33 Solve 0 = -19w + 19518 - 19651 for w. -7 Solve -749g - 129291 = 214g + 404g + 454g for g. -71 Solve -3f - 35f - 133 = -1159 for f. 27 Solve 261m + 299 = -134 - 175 + 86 for m. -2 Solve -99 = -2129l - 12620 - 14718 + 1691 for l. -12 Solve 30963 - 9241 = -2613g - 12247 for g. -13 Solve -3585y + 89328 = 1161y + 837y for y. 16 Solve -190r = -1426 + 7126 for r. -30 Solve -414 = 182m - 4992 - 4591 - 5573 for m. 81 Solve 68f - 6203 - 3877 = 76f - 368f for f. 28 Solve 9464c - 9530c + 2866 = -3536 for c. 97 Solve 2142n + 451n + 518n - 6186 = 18n for n. 2 Solve -1341j = 561j + 136944 for j. -72 Solve 0 = 1610l + 1065503 - 1030083 for l. -22 Solve 1204o + 3572o + 238322 = 667o for o. -58 Solve 57g + 15626 = -544g for g. -26 Solve 0 = 30257m - 1479000 - 1970533 - 181307 for m. 120 Solve -379i - 406i = -118i + 277i + 41536 for i. -44 Solve -35774505q + 21218 = -35774711q for q. -103 Solve 28725 - 38552 = 2465t + 103563 for t. -46 Solve 47r + 391 - 592 = 10r + 2093 for r. 62 Solve 69498055i = 69498335i - 280 for i. 1 Solve -31292 = -2d - 58d - 24572 for d. 112 Solve 24942j + 3429 = 25069j for j. 27 Solve 1736a - 262650 = 6886a for a. -51 Solve 0 = 372o + 8762723 - 8754539 for o. -22 Solve 6h + 14439495 - 14439597 = 0 for h. 17 Solve 0 = -216i - 27729 + 26001 for i. -8 Solve 0 = 38172o - 38180o - 352 for o. -44 Solve -1005h + 46161 = -271h + 754h - 2943 for h. 33 Solve -718c + 231c = 31872 + 808 + 14559 for c. -97 Solve 11090v + 520543 - 448371 = -1125548 for v. -108 Solve -886 + 7798 = 192x for x. 36 Solve -3978z = -225098 - 25516 for z. 63 Solve 0 = -25820s + 25839s - 190 for s. 10 Solve -84n = -1986 + 3834 for n. -22 Solve -189r + 4582 = -3167 for r. 41 Solve 1221z + 12305 = 496z + 563z - 817 for z. -81 Solve -53n + 166 = -32n - 233 for n. 19 Solve 112n = 280745 - 282761 for n. -18 Solve -801i - 6632i = 871455 - 31859 + 7766 for i. -114 Solve 108r + 163r - 1610 = -257r + 49606 for r. 97 Solve -88i - 73i - 16i + 3030 = 126i for i. 10 Solve 4497f - 641222 + 151049 = 0 for f. 109 Solve 89r + 8561 = -235r + 25409 for r. 52 Solve 1524d + 21622 + 66179 = -849d for d. -37 Solve -269f - 223f + 3714 + 3245 = -3865 for f. 22 Solve 2439k + 79579 + 47249 = 0 for k. -52 Solve 92u - 35u + 154u = 2215 + 2216 for u. 21 Solve -1580063a - 44400 = -1580655a for a. 75 Solve 1309v + 102008 - 24403 = -538v + 436v for v. -55 Solve 5193p + 36247 - 99403 = 100180 + 309227 for p. 91 Solve 41h - 1047 = -3h - 4083 for h. -69 Solve 439a + 47523 + 10668 = 13852 for a. -101 Solve -384y + 2255600 = 2271344 for y. -41 Solve 299w - 5444 - 9722 - 6758 = -3087 for w. 63 Solve -9528 - 7708 + 6228 = 1376h for h. -8 Solve -88h = 6h - 1688 + 5968 + 984 for h. -56 Solve -1373k + 6408 = -1729k for k. -18 Solve -101m = -9525m - 310992 for m. -33 Solve -291608 - 77923 = 32836h + 420419 + 589162 for h. -42 Solve 416h - 806h - 146 = -380h - 766 for h. 62 Solve -2m + 58m + 48485 = 48933 for m. 8 Solve 157275j - 155152j - 212300 = 0 for j. 100 Solve 1807 + 1656 + 1487 + 2425 = -125u for u. -59 Solve -17805v = -10405v + 495800 for v. -67 Solve -2069 - 1219 = 165s + 591 + 81 for s. -24 Solve -30426 = 15x - 30966 for x. 36 Solve -102r - 847 = 1770 + 1404 - 145 for r. -38 Solve -168 = 199i + 4608 for i. -24 Solve 11435 + 10789 = -463n for n. -48 Solve 1169 = -11l + 883 for l. -26 Solve -28q = -47026098 + 47026602 for q. -18 Solve 0 = 6031c - 158716 + 78313 - 353829 for c. 72 Solve -15346j - 493428 = -307j + 3939j for j. -26 Solve -5103 = -61i + 576i + 5821 - 3199 for i. -15 Solve -124c - 1699 = 3385 for c. -41 Solve 134n = -1117 - 970 - 907 - 222 for n. -24 Solve 64953 - 60857 = -128j for j. -32 Solve 30n = -32n + 1761 - 797 + 1268 for n. 36 Solve -73f + 637 = 112f - 136f for f. 13 Solve -2132i - 3614 + 1261 = -11471 - 5806 for i. 7 Solve 338005h - 337913h = 6808 for h. 74 Solve -1469y + 8031 = 1701y - 6563 - 1256 for y. 5 Solve 153s - 50225 = -497s - 375s for s. 49 Solve 8990j - 2437j + 3688j = -92169 for j. -9 Solve -570x + 20910 + 5876 = -8784 - 3760 for x. 69 Solve 865s - 675s + 1653s = 22116 for s. 12 Solve 2072 = -106734s + 106697s for s. -56 Solve -1168y - 78079 = -1889y - 1751y + 62825 for y. 57 Solve 634 = 51l + 2368 for l. -34 Solve 19y - 6y - 100y = 102y - 6804 for y. 36 Solve -1871t - 12025 = -542t - 3971 + 18526 for t. -20 Solve 37a + 4496 = 780a - 5906 for a. 14 Solve -138i + 279224 = 6208i for i. 44 Solve 1123s - 61287 = -1253s + 399s for s. 31 Solve 2764 + 15384 = 992q - 294q for q. 26 Solve -106738 + 25774 = -2076h for h. 39 Solve 167h - 35h - 8432 = -140h for h. 31 Solve 6986k = 7191k - 17630 for k. 86 Solve -6u + 130 = 2u - 39 - 55 for u. 28 Solve -258z + 459z + 529z - 5110 = 0 for z. 7 Solve -1615x + 1396 - 2425 = 3816 for x. -3 Solve 5216d = 5360d - 576 for d. 4 Solve 4137560q = 4137507q - 1749 for q. -33 Solve 4024r + 16987r - 3810824 = 7006r - 11571*r for r. 149	{ "pile_set_name": "DM Mathematics" }
58 Solve -5z - 15 = 87h - 92h, 42 = -13h + 9h - 5z for h. -3 Solve 3w = 34h + 21h - 60h - 65, -14w + 90w - 332 = -3h for w. 5 Solve -3x - t + 19 = -0, -x - 1630t + 54 = -1626t for x. 2 Solve 0 = 4l - 4r - 188, 105l + r = -257l + 5r + 16656 for l. 46 Solve -w + 9l + 34 = 3l, -7w + w + 3l = -48 - 123 for w. 28 Solve 7f = n - 27, 0 = 3f + 3n - 15 - 48 + 6 for f. -1 Solve 4v - 185 = 12v - 5y, 5601y - 5603y = 2v + 3v + 90 for v. -20 Solve 913n + 4m - 12 - 8 = 918n, 0 = 48n - 5m + 192 for n. -4 Solve 8y - 5j + 49 = 0, 0 = 3y - 2j + 2732 - 2713 for y. -3 Solve 10024u + 2k - 3 = 10019u + 1, 0 = -u + 3k - 23 for u. -2 Solve -s + 93x = -6s - 99x + 184x - 69, 36 = -4s - 4x for s. -1 Solve -5t + 24 = 2y, -2t - 69 = -0t + 4y - 85 for t. 4 Solve -68964p - 68 = -68966p + 16s, 3s = -2p - 8 for p. 2 Solve 3q - q = 4q + 5b - 59, 28b = -8q + 15b + 19b - 50 for q. 2 Solve 0 = -4g - 6h + 10, 202h + 214h - 24 + 1 = -5g + 419h for g. 4 Solve 3s - 5s + 17d = -s - 3s - 17, -16d = -11d + 5 for s. 0 Solve -5r + 9r - 62 = l, -8l + 5r = -5l + 81 for l. -2 Solve -2505 + 2491 = x + 2l, -16x = -l - 73 for x. 4 Solve -24 = -5q - 2x, -q + 151 - 117 = 8q - x for q. 4 Solve -2f + 11829748 - 11829646 = 2d, 5f - 159 = -7d + 98 for d. 1 Solve 2t - 95 = 13w, 0 = -t - 8w - 103 + 78 for t. 15 Solve 42z = 13z + 32z + 2d - 6, 6d + 2 = z for z. 2 Solve 5p + 1079 = 4d + 1090, 2d + 0d + 6 = 2p for p. -1 Solve 3o - 5t + 98 = 0, -127t - 91 = 15o - 131t for o. -1 Solve -5d - 13 = 4s, 5s + 2184 = 3d + 2177 for d. -1 Solve 0k + 4k - 77t - 12t - 2059 = 0, 24 = 3t + 93 for k. 3 Solve 4q - 18l - 17l + 32l - 195 = 0, -189 = -4q - 3l for q. 48 Solve -7s + 310l - 328 = s + 308l, -4s - 4l = 184 for s. -42 Solve 14d = -5y - 900, 548y - 270y + d = 282y - 73 for y. 2 Solve q + 4a + 27 = 0, -2366q - 2a - 18 = -2370q for q. 1 Solve -m = 4y - 1, m - 7707 = 4y - 7698 for y. -1 Solve -5j = -10u + 1350 - 875, -10j - 200 = -5u for j. 5 Solve 3k + 25 = 2z, 3z + 357 - 334 = -k for k. -11 Solve v = 2m - 35, 131m - 130m + 4v = -113 for m. 3 Solve -3510 + 3290 = -4j + 2g, 284 = 5j + 2g for j. 56 Solve -5w + 280 = 60m, 5m + 21192w - 52 = 21188w for m. 4 Solve 5a - 3p = 39, -13541a + 6p = -13543a - 42 for a. 3 Solve 573j = -3x + 1148j - 572j, 4x + j + 18 = -x - 0j for x. -3 Solve -2z = 2c - 4z - 14, 4c - 88 = 9c - 15c + z for c. 9 Solve a + 5 = -0a - 3p + 3, 3p - 19 = 3967a - 3971a for a. 7 Solve -12d + 5g + 2880 = -10d + 2968, -4d - 87 = -4g - 7 for d. -4 Solve -5r - 22 - 567 = -9h, -3h + 46 = 16r - 168 for h. 66 Solve 2403 = 35x + 11y + 891 - 1288, 4x + 4y - 117 - 203 = 0 for x. 80 Solve -49g + 25g + 26g + 6 = 0, -7o + 23 = -9o - g for o. -10 Solve -80 = -4687q + 2343q + 2347q + 2w, 3q = 3w - 90 for q. -28 Solve -2v + y = 17, 0 = 2v + 16y - 26525 + 26457 for v. -6 Solve 2c - 3393i - 3394i + 6780i = 59, 4c + 4i = -8 for c. 5 Solve 518a - 515a + 11 = -5z, -2z = 5a + 12 for z. -1 Solve 2r - 4 = -4q + 46, -12q - 1049 + 1186 = -7r for r. 1 Solve 0 = -218v + 3s + 493 - 57, -17v + 8 = -13v + 3s for v. 2 Solve 2y + 3 + 7 = -3c, 717y - 13 = 2c + 712y for c. -4 Solve 3q - 39 = -4t, 5q = -t - 195 + 260 for q. 13 Solve -5p + 2 = p - 4p + 2f, -233970 = -p - 2f - 233974 for p. 6 Solve r + 23 = -4w + 4, w = -2w + 8w + 4r + 21 for w. -5 Solve -13178r + 13181r - 5g = 103, -5r = 5g - 105 for r. 26 Solve 4a - 4t = 7a + 42, 3a - 21t + 9 = 192 for a. -2 Solve 77l - d + 328 = 0, 20l - 5d - 77 + 165 = -92 for l. -4 Solve z + 4 = -5c, -c + 452 = 2z + 5z + 446 for c. -1 Solve 41h = 44h - 3r + 51, 0 = 18h + 5r - 39 for h. -2 Solve -215 = -5i - 5k, 0 = -2187i + 2182i + 3k - 113 for i. 2 Solve -17a = -2o + 3, -o - 1 = -7a + 3a + 2 for o. -7 Solve 3p - 5c = -165, -1 = -4586p + 4582p - c + 9 for p. -5 Solve 2m + 67f + 95 = 7m + 63f, 52m + 4f + 320 = 2f for m. -5 Solve 4m - 32 = 2x - 14 - 23 + 37, 2x - 18m + 144 = 0 for x. 0 Solve 2k - 14 = l, 3l + 6k = 43743 - 43737 for l. -6 Solve -8532 = -3h - 5g - 8772, -3h + 2g + 117 = 0 for h. 5 Solve -4a + 14 = 2d, 28a = -3d - 27 + 4 for d. 11 Solve -t + 4t + 56 = -0o - 5o, 3t = -3o - 30 for t. 3 Solve -27l + 8n - 24 - 37 = 0, 2l - 3n + 31 = 0 for l. 1 Solve -z + 2w + 115 = 77, 0z - 2z = -3w - 81 for z. 48 Solve 7h + 7h + 4b - 172 = 13h - 173, 3b = 3h - 12 for h. 3 Solve f + 9w + 15w = 4f + 207 - 261, -5w + 45 = 5f for f. 10 Solve -5x + 20 = -5z + 9z, 4z + 0 = 6x - 68 for z. -5 Solve 0 = -9c - 3c - 8c - 80, -4c + 64 = 9p - 25p for p. -5 Solve 1727649z = 1727644z + 45, 12c + 5z + 5 = 2 for c. -4 Solve -20c + 18c - 56c = -o + 809, -3o + 2c + 61 = -2c - c for o. -3 Solve -d + 3 = -0d, -20o + 242d - 654 = -16o for o. 18 Solve 0 = 59l - 57l + 10, -4g + 60l + 21 = 55l for g. -1 Solve -70v - 407 = 3y, -131y + 134y = 4v - 37 for v. -5 Solve -37 = -3z + 10q - 2q - 212, -4z + 20 = 2q for z. -5 Solve -6l - 30q = -37q - 10, -1 = -l + q for l. -3 Solve -d + q = -269 - 283 + 539, -2q - 92 = 20d for d. -3 Solve -13w = 3p + 47, -3w + 30 = -2p - 22 + 79 for p. 6 Solve -4b + b + 24 = -3o, -4041o + 4045o = 3b - 35 for b. -3 Solve -34 = -v - 4w, -11v = -66w + 137w - 66w - 218 for v. 18 Solve -4h = -8, 1386k + 4 = 696k + 691k + 4h for k. -4 Solve 994 = -y - 10n - 87n + 218, 4n + 32 = 0 for y. 0 Solve g + 796 = 4t + 723, -3g = t - 2 for g. -5 Solve 5d + 91 = 2w, -9d + 19d = -5d - 5w - 240 for d. -17 Solve -4b + 8 = -4g, -2b + 5g - 1736175 + 1736188 = 0 for b. -1 Solve 328112b = -s + 328115b + 79, 4s - 284 = 4b for s. 67 Solve -4c - 34 = -2o, 67c - 67c - 28o = -15o - 9o - 12 for c. -7 Solve -220o - 337 = -219o + 66q - 12, o = 4q + 13 + 12 for o. 5 Solve -5m = -5, -8n - 30m + 54m = 25m + 5 + 9 + 9 for n. -3 Solve 5v - 44 = -4t, 2t - 24 = -3436v + 3433v for v. 4 Solve -5t + 5o = 35, 0 = 919t - 917t - 5o + 23 for t. -4 Solve 8988n - 8993n = 3b - 228, 13b - n = -32 for b. 1 Solve -3v + 10 = -1901z + 1895z - 80, 2z + 5v = 150 for z. 0 Solve 3x = 4d + 113, 14x + 5d + 2421 = 2901 for x. 35 Solve -5302x = -2f - 5322x + 74, -f - 4x + 22 = -21 for f. 47 Solve -154 + 179 = -5g, -w + 8g + 54 = -0w for w. 14 Solve 0 = 2t + 3h - 89, 86h - 89h - 86 = -3t - 64 + 104 for t. 43 Solve 285 - 85 = -8o + 4o + 3r, 0 = 3o + 41r - 2445 for o. -5 Solve 8o + v = 5v - 12, -7o - 3v = -2o - 0v + 2 for o. -1 Solve -5o = 3z - 104, -z + 1798 = 4o + 1754 for o. 4 Solve -565y = 3g - 564y + 47, 4y + 18 = -2g for g. -17 Solve -4x + 902h - 898h + 24 = 0, 1 - 49 = 2x + 4h for x. -4 Solve -38473m + 4l + 13 = -38480m, m + 7 = 2l for m. -3 Solve -2t - 3o = 74, 138903 = -13t + 5o + 138324 for t. -43 Solve -5s + 4c - 38 = 0, 2s + 93 + 79 = c + 161 for s. -2 Solve 0 = -3i - 2l - 46, -5i + 3l - 93 + 94 = -87 for i. 2 Solve -238n + 239n + 110 = 5u, -2u + 3u = -3n - 0n + 22 for n. 0 Solve -11h - 30h + 4z + 2733 - 1597 = 0, 0 = 2z - 6 for h. 28 Solve 2s - 2s = s - 46, w - 78s + 286 = -3307 for w. -5 Solve -7n + 68 = 5d - 2d, -699n + 60d - 675 = -702n for n. 5 Solve -4m = 4, 2m - 5 = -14k + 100 + 75 for k. 13 Solve 18x = 365m - 368m - 66, 4x - 8 = 5m for m. -4 Solve 4a + t = -0a + 13, -180t - 769 = -4a + 71t for a. 4 Solve 1171c = 2j + 2328c - 1155c + 16, 3j - 2c + 1 + 3 = 0 for j. -4 Solve -7i - 19a = -138, 9i + 26 = 8a + 8a - 15a for i. -2 Solve -3d = -5633c + 5629c + 59, 127 = 2c - 9d for c. 5 Solve t - 535 + 518 = -2l, 5t - 37 = 2l for l. 4 Solve 5w = -5l - 60, -l - 74 + 31 + 31 = -2w for w. 0 Solve -u - 19j + 17j + 75 = 0, -28j = 2u - 1110 for u. -5 Solve -30c + 17c - 35q - 71 = -16c, 2c - 26 = 2q for c. 12 Solve 4o - 3530q = -3534q + 64, 5o + 3q - 84 = 0 for o. 18 Solve 11g - 53 = 5s + 13g + 119, 9g = -29s + 28s - 774 for s. 0 Solve -37d + 113 = -0z - 5z - 35d, 7d - 313 = -10z for z. -3 Solve c - 3x - 2x = -6x - 17, -3c + 46x = -194 for c. -12 Solve -3x - 10a = 200, -27088 = -x - 4*a	{ "pile_set_name": "DM Mathematics" }
-36)/(-112). Let w = i - 13/28. Which is the biggest value? (a) 0.3 (b) -1 (c) w a Suppose -40 = 4u - 5d, 3 = -4u + d - 21. Which is the second biggest value? (a) -19 (b) u (c) 4 b Let l = -3.23 - -0.23. What is the biggest value in -0.07, -4, l? -0.07 Let o = -28 + 14. What is the smallest value in -0.1, o, -1? o Let r(f) = 8f*3 + f - 1. Let c be r(1). Let h = c + -6. Let u be (h/(-3))/((-30)/9). What is the third smallest value in -1/8, u, -5? u Let a = 6.6 - 5. Let k = 3 + -1. Let d = k - a. What is the third biggest value in -0.5, -1, d? -1 Let y = 39.3 + -39. Let p be (9/4)/32. What is the biggest value in 2, y, p? 2 Let u = -0.49 - -0.09. What is the second biggest value in 0.2, 2, u? 0.2 Let i be ((-19)/228)/((-2)/18). Which is the biggest value? (a) 1 (b) i (c) 0 a Suppose 4m = -5q + 10, -28 = -3m - m + 4q. What is the third biggest value in 0.05, 3, m, 2/11? 2/11 Let i = 3 - 8. Let p = -21 + 65/3. Which is the third smallest value? (a) i (b) 0.5 (c) p c Let x = 104.1 - 104. Let k be (1/2)/((-3)/(-18)). What is the biggest value in x, 2, k? k Let v = -111/7 - -1429/91. Which is the second smallest value? (a) -0.5 (b) v (c) -19 (d) -2 d Let j = -5 + 4.9. Let u = -0.02 - -0.02. Which is the biggest value? (a) u (b) -2/13 (c) j a Let x = -0.6 + -0.9. Let a = 4.5 - x. Let j = -5.6 + a. What is the third biggest value in -2, j, 0.5? -2 Let z = -288/745 - 2/149. Let c = -1 - -1.4. What is the smallest value in z, -1/2, c? -1/2 Suppose -j - 28 = -5j - 4i, -2j + i + 29 = 0. Suppose -3n + j = n. Let m be ((-2)/3)/((-5)/n). What is the smallest value in 0.3, -1/2, m? -1/2 Let t = 1.3 - 0.3. Let i = 2 - t. Which is the smallest value? (a) i (b) -0.2 (c) 1/3 b Let k = 4 - 3. Let w = 0.4 - 1.6. Let y = w + k. What is the biggest value in y, -0.5, -1? y Let k = 58.5 - 58. Let y = -7 - -1. Let l be (3/y)/((-10)/(-12)). Which is the third biggest value? (a) l (b) k (c) 1 a Let x = 54 - 52. What is the smallest value in 4, -0.4, -5/2, x? -5/2 Let s = -1/82 - -171/574. Let n = 0.2 - 0.3. What is the third biggest value in n, 5, s? n Let m = -778/35 - -156/7. Let y be 6/(-14) + 36/210. Let n = m + y. What is the third smallest value in 0.4, -1, n? 0.4 Suppose a = -4l + 10, 2l + l = -5a - 1. Let h = -1/80 + -317/240. What is the third biggest value in l, h, -0.3? h Suppose -u = -5v + 2u + 3, v - u = -1. Let p = -0.1 - 0.1. Which is the second biggest value? (a) v (b) 2/13 (c) p b Suppose -4k + 3m + 27 = 0, k = -m - 1 - 1. Let f = 2 - 16. Let v = f + 14. Which is the smallest value? (a) -1/5 (b) v (c) k a Let f be 0/14 + 1/2. Which is the second biggest value? (a) 5 (b) 0.11 (c) -1/3 (d) f d Let u = -123 + 123.3. What is the third smallest value in -0.2, 0, 5, u? u Let v = -257/17 - -15. Let z = -0.164 - -0.064. What is the smallest value in 0.5, v, z? v Let n = -8 - -19. Let h = n - 16. Let v = 0.1 - 0.1. What is the third smallest value in v, 2/7, h? 2/7 Let u = 2 + -1.6. Which is the second smallest value? (a) u (b) 5 (c) -1/2 a Let w = -61/782 - -830007/3910. Suppose 4x - 4k = 527 + 333, -k - 854 = -4x. Let i = w - x. Which is the biggest value? (a) -1/4 (b) i (c) -5 a Let v = -0.09 - -5.09. Let z = 1328/7 - 190. Which is the biggest value? (a) 2/7 (b) v (c) z b Let z be (-7 - 1)(-2)/(-4). Let x be (-2)/332(-12)/(-9). Let w = x - 1241/498. Which is the second smallest value? (a) z (b) -0.1 (c) w c Let p = 4 - 3.7. Suppose t - 3 = 2. Suppose 14i - 9i - t = 0. Which is the second biggest value? (a) i (b) 0.5 (c) p b Let f = 12 + -17. Let r = -167/123 - -1/41. Which is the biggest value? (a) 1 (b) f (c) r a Suppose -9x = -5x. Which is the second smallest value? (a) x (b) -1 (c) -20 b Let r be 3(-3 - (-31)/9). What is the third smallest value in 0.5, -0.3, r? r Let g = 0 + 0.1. What is the third biggest value in -4, 3, g? -4 Let x = -147/5 + 3097/105. Suppose 6v = v + 2l - 27, -l + 1 = 0. Which is the third biggest value? (a) v (b) -2 (c) x a Let s be (-19 + 20)2/(-7). What is the smallest value in 10, s, -0.4? -0.4 Let h = -7 - -19. Let j = 14 - h. Which is the third biggest value? (a) 0 (b) 3/4 (c) j a Let a = 0.02 - -2.98. Let g = -2.8 + a. Let k = g - 0.5. What is the second smallest value in k, 2, 1/4? 1/4 Let l = -0.048 - 3.052. Let d = -3 - l. Let m = -31.8 - -32. Which is the second smallest value? (a) d (b) m (c) 4 b Let i = -66 - -65.9. What is the biggest value in i, -2/7, -13? i Let u = 4 - 6. Let z = -0.3 - -0.4. Let l = 0.1 + z. Which is the third smallest value? (a) 3 (b) l (c) u a Let f = -0.153 - 0.047. Let k = -1.8 + 2. What is the biggest value in f, k, 1/8? k Let t = -92/3 - -31. Let z be 4 + 1 - (0 + 3). Which is the second smallest value? (a) z (b) 1 (c) t b Let k = 2 - -3. Let n = k - 7. Let r = 3 - 3.3. What is the second smallest value in 0.4, n, r? r Let i = 4/5 - 13/10. What is the third smallest value in -5, 3, i? 3 Let m(d) be the first derivative of -d*2/2 - 10d - 3. Let g be m(-5). What is the second smallest value in g, 4, -0.2? -0.2 Let c be ((-2)/(-5) + 0)-25. What is the biggest value in 0.2, -1/3, c? 0.2 Let z(f) = f2 - 1. Let s(j) = j3 + 5j*2 + j - 7. Let k(t) = s(t) - 5z(t). Let a be k(0). What is the second biggest value in a, 3/2, -1? -1 Let u = 2435/29 - 84. Which is the biggest value? (a) u (b) -4 (c) 3 (d) 4 d Let y = 4 - 2. Let n = y + -1.8. What is the second smallest value in n, -4/5, -2? -4/5 Suppose 0 = -d - d - 6. Suppose -5a = -0a - 75. Let f = a + -31/2. What is the second smallest value in f, 0.1, d? f Let c be (40/(-22) + 2)/(1 - 0). What is the fourth biggest value in -1/4, c, 2/3, -3/5? -3/5 Let i(r) = 2r2 + 5r + 5. Let v be i(-2). Which is the biggest value? (a) v (b) -2 (c) -5 a Suppose -5 = -y - 3. Which is the third biggest value? (a) y (b) 2/11 (c) 5 b Let v = -31 - -25.9. Let j = 0.1 + v. What is the second biggest value in j, 1, -2? -2 Let j be ((-1)/4)/(1 - 1 - -1). Let w = 0.03 - -1.97. Let k = w + -5. Which is the smallest value? (a) j (b) k (c) -4 c Let p = -18.33 + 21.2. Let q = 0.13 + p. Which is the biggest value? (a) -4/5 (b) 0.5 (c) q c Let t(m) = -m*2 + m + 1. Let l = -2 - -2. Let v be t(l). Which is the smallest value? (a) -4/7 (b) 1/7 (c) v a Let q(n) = -3n + 40. Let v be q(12). What is the fourth smallest value in 1, -0.01, -0.4, v? v Let x = 41 + -286/7. Let c = -0.06 + 2.06. Let f = c + -2.02. What is the third smallest value in 3, f, x? 3 Let m be (-3)/(-2)20/15. Let p(k) = k3 - 2k*2 + 4k - 3. Let h be p(m). Which is the third smallest value? (a) -4 (b) h (c) 3 b Let r = 17 - 13. What is the smallest value in -3/8, r, -4? -4 Let s = 1.74 - -0.26. Which is the third smallest value? (a) 1.1 (b) -2 (c) s c Suppose -2d - 4 = -0. Let s be (-5)/7 - d/2. Which is the third smallest value? (a) s (b) 2/11 (c) -3 a Let f = 132.3 + 5.7. Let k = 135.98 - f. Let y = k - -0.02. Which is the second biggest value? (a) y (b) 0 (c) 1 b Let k be 0 - ((-147)/164)/(-3). Let v = -2/41 - k. Let w = 0 - -0.1. Which is the biggest value? (a) 3 (b) v (c) w a Let m = -32.9 + 31. Let k = -2 - m. Which is the biggest value? (a) k (b) -5 (c) 4 c Let p = 0.9 + 3.1. Let r(b) = 2b*2 - b - 1. Let c be r(-1). What is the biggest value in p, c, 0.5? p Let u = 45 - 41. Which is the biggest value? (a) -0.1 (b) 1/3 (c) u (d) 0.2 c Let c = 55 + -59.8. Let u = -0.1 + 0.9. Let q = u + c. What is the third biggest value in q, 5, 1? q Let h = -0.04 - -0.01. Let f = h + 0.03. Which is the second biggest value? (a) 3/4 (b) 2 (c) f a Let h = -5.3 + 5. What is the second biggest value in -0.6, h, -2/11? h Let h = 1.2 + 0.8. Let q = h - 5. What is the second biggest value in q, 0.4, -2? -2 Let z = 0.8 + -53.8. Let g = 48.1 + z. Let o = g - -5. What is the second smallest value in o, 4/3, 1? 1 Let x = -13 - -14. What is the third biggest value in x, 3/2, 0? 0 Let x = -1.1 - 0.4. Let p = x - -2. What is the second biggest value in p, -3/2, 5? p Let i = -2.44 + 0.44. Let j = 3 - -2. What is the third smallest value in i, j, -0.2? j Suppose -g - n = 2n + 8, -2n + 18 = -4g. Let z(k) = k*2 - 3k - 36. Let i be z(8). Which is the smallest value? (a) i	{ "pile_set_name": "DM Mathematics" }
j + 25 = 4j for c. -2 Solve -5l = 3j + 18, -3l - 19 = 2l + 4j for l. -3 Solve b + 137 = -5v + 121, -b - 1 = 2v for v. -5 Solve 4m - 3o = -o - 4, 0 = -2m - 3o - 18 for m. -3 Solve -2g + 5n + 5 = -8, -3g = 2n + 9 for g. -1 Solve -9 = 3d - 5z, 4z - 3 = -3d + 5z for d. 2 Solve 5f = -3w + 26, 24 = -2f + 3w + 26 for f. 4 Solve 0 = 4a - 4m + 8, 0 = -a - 5m - 13 - 7 for a. -5 Solve -a + 5 = 4t - 0a, -2t + 2a - 10 = 0 for t. 0 Solve -3n + 6n = -4q - 9, -2n = -q + 6 for n. -3 Solve 0d = 4k + 3d - 5, 0 = 2k - 2d - 20 for k. 5 Solve 4g = 3t - 24 + 38, -3t + 3g = 12 for t. -2 Solve 4i - 1 = 3j - 10, 4i - 4j = -12 for i. 0 Solve -4b - 12 = -p, -p + 2b + 0 = -6 for p. 0 Solve -h = h - 6, -i - 5h + 16 = 0 for i. 1 Solve -4b + 7 + 7 = -3q, 0 = -2q + 2b - 8 for q. -2 Solve 14 = -2m - 2m - 3q, 0 = -m + 4q + 6 for m. -2 Solve 5v - 19 + 54 = -4z, 3v + 3z + 24 = 0 for v. -3 Solve 3n + 13 = -2n - 3t, 3n + 2t = -7 for n. -5 Solve -4s = 2h + 2, 2s - h - 7 = -2s for s. 1 Solve 5y + 3f = -37, 4f - 2f = y - 3 for y. -5 Solve 9u + 122 - 86 = 5f, -2u - 8 = 4f for f. 0 Solve 66l + 4b + 16 = 69l, -12 = 3b for l. 0 Solve -3z + b = -1, -5z + 4b + 4 = -0z for z. 0 Solve 0 = -4v - 10 - 10, -5 = -5q + v for q. 0 Solve -3i + 5y = i + 18, -5i - 2y = 6 for i. -2 Solve 27 = -33z + 36z + 4f, -f - 22 = -5z for z. 5 Solve -109d + 2x = -105d, 0 = 2d + 2x + 6 for d. -1 Solve 3g = 5a + 22, -20 = -3g - 8 for a. -2 Solve 0 = -0t + 3t - 4z - 17, 0 = 4t - 2z - 6 for t. -1 Solve 2x - 5 = -3v, 0v - v - 5 = -x for x. 4 Solve 3n - 6 = h, -4n + 4h = -0 - 8 for n. 2 Solve -4t = -110j + 114j + 8, 5t - 4j = -28 for t. -4 Solve 0 = -3u + 3o, 17u + 30 = 21u + 2o for u. 5 Solve -3c = d - 0 - 1, 5 = 5c for d. -2 Solve -p = 3q + 3, -24q + 12 = -4p - 27q for p. -3 Solve 2v = -3h - 8, -3v - 5h - 4 = 10 for v. 2 Solve -s - 9 = 3m, s - 3m + 4 = 19 for s. 3 Solve -5c + 16 = -4s + 21, 2s - 5c = -5 for s. 5 Solve -15 = -3h - 7l + 9l, 0 = 5h + 5l - 25 for h. 5 Solve -u = -2u - 5, t - 5u - 20 = 0 for t. -5 Solve -2t + 16 = -4y, 0 = 3y - 5y + 4t - 14 for y. -3 Solve -5i - 16 = -3z, 0z + 5z = -2i + 6 for z. 2 Solve -l + 0l = 5n + 5, 4l + 2n - 16 = 0 for l. 5 Solve 19r - 17r - b = 8, -b + 2 = 3r for r. 2 Solve -5a - 21 = 2q, -a + 17 = q - 4a for q. 2 Solve 14k = 9k + 15, -1 = p - k for p. 2 Solve 16m = 3c + 9m - 20, 0 = 3c - 3m - 12 for c. 2 Solve 13 = 114y - 115y - 4v, -4y = -4v + 12 for y. -5 Solve 3p - 27 = -3l, 0l - 22 = -2l - 3p for l. 5 Solve -16o - v = -12o - 20, -5 = -o - 4v for o. 5 Solve 3f - 1 = -l, 41f + 2l = 42f + 9 for f. -1 Solve -3h = -5h + 4m - 14, 3m = 4h + 18 for h. -3 Solve -18 = -4g - 2r - 12, g + 5r = -21 for g. 4 Solve -2g + 28 = 5a, -56g = -53g - 3a for g. 4 Solve -4t + 0t = -3x - 1, t + 16 = 4x for x. 5 Solve 3w = 5d - 35, 8 = 3w + 2d + 15 for w. -5 Solve t + 4p + 23 = 0, 3 = -t - 5p - 25 for t. -3 Solve 22x = 21x, 15 = 5y + 3x for y. 3 Solve 2z + 5 = z + 2p, -5p = -5z - 5 for z. 3 Solve 0v + 1 = -3v - 2u, -2u = -2v + 16 for v. 3 Solve -t = -26p + 25p + 1, 4t = -4p - 20 for t. -3 Solve -3m = -5z + 14, 5m - 3z + 0 + 2 = 0 for m. 2 Solve 3x = -3d + 3, -1 = 4d + 2x + 3 for d. -3 Solve -6 = 3t + v, 4t + 10v + 8 = 5v for t. -2 Solve -o + t = 0, o - 3 = -19t + 17t for o. 1 Solve 3p = -2h - 3 - 12, -5p = 3h + 25 for p. -5 Solve 7 = -2v + 2l + 1, 4v + 14 = 3l for v. -5 Solve 0 = s - j + 2, 33s - 26 = 38s + 3j for s. -4 Solve a + 125k + 9 = 122k, 0 = -3a - k - 3 for a. 0 Solve 5w + 4 = 3q + 2, -4q - 5w - 9 = 0 for q. -1 Solve 0 = 4s + 4i - 24, 0 = -2i - 3 + 9 for s. 3 Solve -3g - 2c + 17 = 0, 3g + 4c - 36 = -11 for g. 3 Solve -4 - 2 = -2h, 0 = u - 2h + 11 for u. -5 Solve -2v - 3 = 3i, 0 = -2i - 3v + 2v - 1 for i. 1 Solve -2g - 16 = -4w, 4w + 4 = g + 18 for w. 3 Solve -2 = -2w - 3m, 2w + 0w = 2m + 12 for w. 4 Solve 4d - 107g + 102g = 4, -4d - 4g - 32 = 0 for d. -4 Solve 0 = 4h - 12h - 8, -4h - 14 = -2b for b. 5 Solve -11g = -12g + 2b + 11, -4 = 4g + 4b for g. 3 Solve -2w = -4r, -14 = r + 3w - 0w for r. -2 Solve -5v - 10 = 3r, 7v - r + 6 = -8 for v. -2 Solve 15p - z + 17 = 11p, 10 = 2z for p. -3 Solve y - 5y - 5l + 30 = 0, -2y - 4l = -18 for y. 5 Solve j + 5d = 21, j + 10d = 14d - 15 for j. 1 Solve 2w - 3n - 11 = 0, 5w - 3n + 5n + 20 = 0 for w. -2 Solve 0 = -5k - 5, 5q - 4k + 2k - 7 = 0 for q. 1 Solve t - 8 = 2h, -2h - 2t - 8 = -0 for h. -4 Solve 0 = 4c + 12, 3r = 19c - 20c - 3 for r. 0 Solve -5s - 17x = -21x - 3, -4s - x = -15 for s. 3 Solve -2r = -3g + 10, 234r + 7 = g + 237r for g. 4 Solve -22g - 10 = -27g - 2b, -b = 5g - 15 for g. 4 Solve -4y + 4t = -12, -63y - 5t + 9 = -60y for y. 3 Solve -h - w = -2, 2h + 3h = 5w + 40 for h. 5 Solve 2p = -10, -2s + p + p + 4 = 0 for s. -3 Solve 3z - 6z - 3l - 6 = 0, 0 = -4z + l - 8 for z. -2 Solve 5v + 0v = 2w - 18, 4v + 2w + 18 = 0 for v. -4 Solve 3g - 15 - 3 = n, 29 = -3n + 4g for n. -3 Solve 4u - 5m = -2, 139m = -4u + 135m - 20 for u. -3 Solve 5o + d + 1 = 18, 2d = 4o - 8 for o. 3 Solve -2q = -3q - 4t - 16, 0 = 5q + 3t + 12 for q. 0 Solve -30 = -3a - 0y + 3y, -3y = 5a - 10 for a. 5 Solve -4q = p + 2p - 34, p = 4q - 26 for p. 2 Solve 5r - 2b + 2 = 0, -57r + 4b = -53r - 8 for r. -2 Solve 0 = 8v - 5l - 41, -3l - 25 = 2l for v. 2 Solve 5p - 13 = -4h, 4p - 67h + 66h + 19 = 0 for p. -3 Solve 6z + 4r = -17 + 37, 10 = 2r for z. 0 Solve 9y - 5s - 33 = 0, -y - 4s + 50 = 60 for y. 2 Solve -p - 3 = -g, -5g + 114p - 110p + 16 = 0 for g. 4 Solve -3l - 47 + 53 = -2q, q = 2l - 3 for l. 0 Solve 0d = 3d - 4a - 21, a = -5d + 12 for d. 3 Solve 4k - 4g + 8 = 0, -8g + 10g = 4 for k. 0 Solve 35 - 41 = -2g - 2i, -5g = 2i - 18 for g. 4 Solve 3j - 2j = -6f + 15, 3j = 2f + 5 for f. 2 Solve z - 3 = -r, -3r - 2z = -4z + 1 for r. 1 Solve 5g + 27 = g + 3x, 5g - x + 20 = 0 for g. -3 Solve 5 = -5t - 3w, 4t + 2w = 10 - 14 for t. -1 Solve a = -5g - 8, -19a + 15a - 5g = 17 for a. -3 Solve -3x = -3z - x - 3, -5z - 5 = -2x for z. -1 Solve -2x = -5d - 35, -2x = -11 + 1 for d. -5 Solve 0 = 4p - 4, 0 = -5m - 24p + 22p + 12 for m. 2 Solve -3x + 8x - 23 = 3g, -12 = -2x + 4g for x. 4 Solve -4n = 2w - 2, 0 = 2n - w - 3w + 4 for n. 0 Solve s - f = 3, 0 = -2s - s + 2f + 6 for s. 0 Solve -7o = -3j - 4o - 3, -3o - 12 = 0 for j. -5 Solve x - 2 = 3b - 0x, 0 = 3b + 2x + 5 for b. -1 Solve -c + 9 = 4c + 4a, 2a - 7 = -5c for c. 1 Solve 4x - 5z - 8 = -28, -4x = 3z + 20 for x. -5 Solve -5l = -2q - 11, 5l - 2l = -q for q. -3 Solve -2x = -2 + 8, 14r - 4x = -30 for r. -3 Solve 2w + 1533q - 1529q = 8, 0 = 4w + 4q - 12 for w. 2 Solve -t + 4b = 4t + 2, -2t - b - 6 = 0 for t. -2 Solve -y = -2y - 5j + 6, -5y + 5j = 30 for y. -4 Solve -4z - 2j - 6 = 0, 0j - 15 = 5z - 5j for z. -2 Solve n - 3r = 11, -r + 6r = -2n - 11 for n. 2 Solve -h = -5d - 7, 8d + 8 = 4d for h. -3 Solve -2y - 8 = 3p, -2p + y + 1 = -4y for p. -2 Solve 28 = 4w + 3u, -w - 2w - 2u = -20 for w. 4 Solve 9 = -2w - 5a - 13, -3w = -a - 1 for w. -1 Solve i + 2k = 11, 0k + 13 = 3i + 2k for i. 1 Solve 0 = -2o + 5l + 21, -3o + 5l - 10 + 34 = 0 for o. 3 Solve 2t = -4g - 14, 26t = 30t + 5g + 25 for t. -5 Solve -5b - 4j + 6 = 0, -b - 2 = 3j - 1 for b. 2 Solve 2l = -5v - 31, 2l + 7 = 5v + 26 for v. -5 Solve 0 = -f - 2, 4h + 2f = -0f - 8 for h. -1 Solve -w + o = 6, -4w + 26o - 24o - 18 = 0 for w. -3 Solve 5s + 4n = -21, 4s + n - 9 = -17 for s. -1 Solve 5k + 5g + 25 = 0, -51k + 50k + 3g + 15 = 0 for k. 0 Solve -3a - 15 = -8a - 4x, -2x = -a + 3 for a. 3 Solve 5t = 20, -3w + 199 = 2t + 185 for w. 2 Solve -4d - 8 = 4s, 4d + d - 18 = 2s for d. 2 Solve -27b + 22b = i + 21, 27 = -2i - 5b for i. -6 Solve 5b - r = 13, 4b + r = -3r - 4 for b. 2 Solve 3m = -5d + 30, 13d + m - 11 = 11d for d. 3 Solve 4p - 14s - 8 = -16s, 8 = 2p + 2s for p. 0 Solve -8j + 4f - 27 = -5j, 12 = 4*f for j. -5 Solve -y = 3,	{ "pile_set_name": "DM Mathematics" }
Let u(g) = 8g3 - 3g*2 + 165g - 639. Determine u(4). 485 Let x(z) = 248z + 2225. Give x(-9). -7 Let k(u) = 2u*3 + 173u*2 - 108u - 1831. Determine k(-87). -4 Let s(z) = -1303z + 23448. Give s(18). -6 Let j(l) = -18l*3 + 2l*2 + 323l + 322. Determine j(-1). 19 Let n(z) = 877z + 8760. What is n(-10)? -10 Let m(a) = -54a + 2820. Give m(50). 120 Let f(b) = 403b - 1490. Calculate f(4). 122 Let y(c) = -58c*2 + 458c + 49. Calculate y(8). 1 Let s(n) = -4937n + 93803. Give s(19). 0 Let u(h) = 774h - 1060. Calculate u(2). 488 Let a(o) = -7o2 - 3o + 138. What is a(5)? -52 Let y(v) = v*2 + 23v - 16. Calculate y(-18). -106 Let d(s) = -s*2 - 38s + 541. Give d(-49). 2 Let q(w) = -w - 120. What is q(-59)? -61 Let q(k) = 4749k + 14242. What is q(-3)? -5 Let b(t) = t3 + 6t*2 - 82t - 526. Calculate b(-7). -1 Let c(w) = -w*2 + 15w + 96. Calculate c(20). -4 Let r(c) = 716c + 5009. What is r(-7)? -3 Let o(u) = -49u*3 - 6u*2 + 16u - 4. Determine o(2). -388 Let j(k) = 2k3 - 20k*2 + 8k - 13. Calculate j(10). 67 Let i(b) = -b*3 + 31b*2 + 31b + 95. Determine i(32). 63 Let l(m) = -88m + 3140. Give l(36). -28 Let z(q) = 2q*3 + 4q*2 - 8q + 2. Determine z(-4). -30 Let t(m) = -16m2 - 48m + 106. Determine t(2). -54 Let y(p) = p*3 - 52p*2 + 677p - 57. Give y(27). -3 Let h(c) = -10c3 + 19c*2 - 38c + 74. Calculate h(2). -6 Let z(v) = v*3 + 16v*2 + 54v - 7. Calculate z(-11). 4 Let g(i) = -125i3 - 2i*2 + 4i + 5. Give g(-1). 124 Let o(i) = i*2 + 324i + 6659. What is o(-22)? 15 Let k(b) = -b*2 - 138b - 1380. What is k(-127)? 17 Let r(w) = w*3 + 7w*2 + 24w + 185. Determine r(-8). -71 Let g(c) = -c*3 - 32c*2 - 260c - 89. Determine g(-17). -4 Let o(p) = -p*2 + 3p + 136. Calculate o(13). 6 Let c(j) = 6640j + 39832. What is c(-6)? -8 Let p(i) = 4i. Give p(7). 28 Let q(z) = z*2 + 60z + 317. Determine q(-53). -54 Let f(b) = -b*2 + 22b + 9879. What is f(111)? 0 Let h(b) = -2b3 + 88b*2 + 105b - 641. Calculate h(45). 34 Let m(r) = -7r2 + 116r + 428. Give m(20). -52 Let j(l) = l*2 + 17l - 101. What is j(-14)? -143 Let p(l) = -3l2 + 145l + 62. Calculate p(50). -188 Let v(y) = -21y - 1491. Calculate v(-57). -294 Let k(s) = -s2 + 11s - 40. Determine k(7). -12 Let l(w) = -w*3 - 10w*2 - 18w - 22. What is l(-8)? -6 Let y(c) = c*2 - 12c - 1972. Give y(-34). -408 Let s(z) = z*2 + 35z + 315. Calculate s(-18). 9 Let c(d) = 2d3 - 5d*2 - 294d + 870. Determine c(3). -3 Let j(c) = -10c2 - 18c - 58. Give j(-3). -94 Let t(b) = b*3 - 6b*2 - 161b + 1104. What is t(7)? 26 Let m(o) = 239o2 + 6o + 1. What is m(-1)? 234 Let p(a) = -2a3 - 28a*2 - 65a - 3. Give p(-11). -14 Let r(a) = -6a + 82. Determine r(7). 40 Let d(j) = 2j*2 + 15j + 8. Calculate d(-15). 233 Let x(t) = 77t - 8911. Determine x(116). 21 Let q(k) = 19k + 492. What is q(-27)? -21 Let k(n) = 9n2 - 25n + 6. Determine k(3). 12 Let q(p) = -p*3 + 125p - 54. Determine q(11). -10 Let u(y) = -323y + 10883. Determine u(34). -99 Let w(m) = 81m + 68. Give w(2). 230 Let l(k) = -59k + 8075. Calculate l(137). -8 Let q(p) = -p2 - 546p - 3788. Determine q(-7). -15 Let y(u) = -4u3 + 157u*2 + 116u + 175. Determine y(40). 15 Let n(b) = 160b - 6008. Calculate n(38). 72 Let w(m) = -2m*2 + 72m - 69. Give w(35). 1 Let d(n) = 24n + 34. Give d(-2). -14 Let w(k) = -17k - 104. Calculate w(-8). 32 Let t(i) = -21i2 + 188i + 11. Calculate t(9). 2 Let u(o) = 9o3 - 58o*2 + 16o - 27. Give u(6). -75 Let d(x) = -6x - 37. Give d(-5). -7 Let j(x) = 10707x - 21417. Calculate j(2). -3 Let d(p) = -p*3 + 157p*2 - 491p + 4426. Give d(154). -40 Let g(w) = 383w - 158186. Calculate g(413). -7 Let h(a) = -2a*2 + 24a - 83. Give h(7). -13 Let q(n) = -n*2 - 25n - 221. Calculate q(-11). -67 Let r(d) = -5d3 - 30d*2 - 55d - 330. What is r(-6)? 0 Let h(y) = y*2 - 82y + 1578. Give h(31). -3 Let t(b) = b*3 - 4b*2 - 56b + 207. Calculate t(7). -38 Let y(b) = 2b2 - 32b + 253. Calculate y(6). 133 Let u(v) = 2015v - 2022. Give u(1). -7 Let t(u) = -3u - 123. Calculate t(-23). -54 Let k(s) = 4s3 - 60s*2 + 99s + 10. Give k(13). -55 Let g(a) = a*2 - 13a + 41. What is g(10)? 11 Let f(l) = -8l2 - 45l. What is f(-9)? -243 Let y(p) = p*3 - 5p*2 + 34p - 80. Calculate y(3). 4 Let t(a) = -a*3 - 35a*2 + 1588a + 132. Give t(-61). 10 Let w(v) = -v*3 - 83v*2 + 98v + 8126. Determine w(-83). -8 Let x(j) = 13538j - 81229. What is x(6)? -1 Let t(x) = -x3 + 8x*2 + 100x - 96. Determine t(15). -171 Let h(m) = 3m2 - 14m + 44. Give h(4). 36 Let s(p) = -306p2 + 74p - 74. Give s(1). -306 Let d(r) = 5r3 + 24r*2 - 14r - 98. Calculate d(-5). -53 Let o(q) = -q - 17. Determine o(-65). 48 Let j(l) = -l*3 + 29l*2 - 77l - 9. Give j(26). 17 Let y(f) = f*3 - 2f*2 - 550f + 2176. Give y(4). 8 Let c(g) = 15g3 + g2 - 6g. What is c(2)? 112 Let r(h) = h*3 + 90h*2 + 870h + 62. Calculate r(-79). -17 Let b(k) = -k + 70. Calculate b(13). 57 Let z(t) = -48t + 3448. Calculate z(72). -8 Let z(v) = -v3 + 8v*2 - 329v + 1893. Determine z(6). -9 Let w(c) = -210c + 17009. Give w(81). -1 Let d(y) = 20y + 1067. Calculate d(-60). -133 Let o(c) = -c*2 + 30c + 6279. Determine o(-66). -57 Let v(d) = 26d + 279. Give v(-6). 123 Let m(l) = -l3 - 8l*2 - 29l - 6. Calculate m(-5). 64 Let o(p) = -6p3 + 515p*2 + 74p + 1035. Give o(86). 3 Let o(p) = p*3 + 2p*2 - 24p + 3. Calculate o(-7). -74 Let n(a) = 438a + 5706. What is n(-13)? 12 Let r(i) = -395i - 14613. Give r(-37). 2 Let b(m) = -27m - 242. Calculate b(-14). 136 Let f(j) = -5j*2 + 5j + 294. What is f(13)? -486 Let x(i) = 3i2 - 337i + 438. Determine x(111). -6 Let k(b) = b*2 - 66b - 26. Give k(67). 41 Let m(s) = s*3 + 86s*2 + 881s - 522. Determine m(-74). -4 Let z(h) = h*3 + 13h*2 + 37h - 9. What is z(-4)? -13 Let c(y) = 102y + 307. Give c(-4). -101 Let m(d) = d3 - 52d*2 + 313d - 20. Calculate m(7). -34 Let v(h) = -h*3 - 14h*2 + 398h + 186. Determine v(-28). 18 Let t(m) = -59m + 296. Give t(4). 60 Let x(p) = -32p*2 - 81p - 303. Determine x(-4). -491 Let m(u) = 2u2 + 70u + 93. Calculate m(-32). -99 Let j(l) = l*3 + 76l*2 + 216l - 41. Determine j(-73). 178 Let c(s) = -10955s - 197194. Give c(-18). -4 Let k(f) = -2f*2 - 144f + 1083. Give k(7). -23 Let z(s) = 4s2 - 141s - 35. Calculate z(36). 73 Let b(u) = -836u2 - 15047u + 19. Give b(-18). 1 Let s(o) = 24o - 307. Calculate s(13). 5 Let x(z) = -z2 + 47z + 261. Calculate x(51). 57 Let m(h) = h*2 + 85h - 1308. What is m(13)? -34 Let o(d) = -2d3 + 18d*2 - 12d - 8. What is o(9)? -116 Let u(f) = -f*3 - 65f*2 - 124f + 116. What is u(-63)? -10 Let h(x) = 3x3 - 16x*2 - 62x + 237. Calculate h(4). -75 Let p(g) = -g*3 - 5g*2 + 3g - 8. What is p(0)? -8 Let s(i) = -9i2 + 50i + 10. Give s(6). -14 Let y(v) = v*3 - 18v*2 + 3v - 64. Give y(16). -528 Let m(s) = -s*2 - 50s + 401. Calculate m(7). 2 Let u(f) = -f*3 - 101f*2 + 1104f - 680. Give u(-111). -14 Let i(c) = -c*3 - 12c*2 - 4c - 87. Determine i(-14). 361 Let u(q) = -26q + 1235. What is u(48)? -13 Let w(f) = f3 - 10f2 - f + 50. Give w(3). -16 Let h(v) = v3 + 11v2 + 10v - 16. Determine h(-8). 96 Let s(o) = o*2 - 4o + 90. Calculate s(10). 150 Let i(q) = 37q + 1208. What is i(-32)? 24 Let x(u) = 395u - 51352. What is x(130)? -2 Let t(b) = -3b2 + 17b + 237. Give t(-16). -803 Let h(n) = -39n + 2027. Calculate h(56). -157 Let a(f) = 299f - 3910. What is a(13)? -23 Let v(m) = 3m2 + 41m - 1644. Give v(-31). -32 Let g(a) = 5a2 + 8a - 71. Give g(3). -2 Let z(k) = 1400k + 8376. What is z(-6)? -24 Let l(d) = 8d*2 - 32d + 93. Give l(3). 69 Let r(w) = 1069w + 5387. What is r(-5)? 42 Let s(p) = -2p*3 - 68p*2 + 5p + 199. What is s(-34)? 29 Let i(j) = -j*3 - 3j*2 - 19j - 63. Give i(-3). -6 Let x(z) = -13z + 62. Calculate x(-1). 75 Let v(f) = 44f - 3634. Determine v(83). 18 Let t(f) = 11f3 - 130f*2 - 29f + 79. What is t(12)? 19 Let f(d) = -201d3 + 2013d*2 - 32d + 19. Determine f(10). -1 Let v(w) = 68w + 965. Determine v(-13). 81 Let s(z) = 7z*2 + 526z - 12. Calculate s(-75). -87 Let f(x)	{ "pile_set_name": "DM Mathematics" }
tens digit of o? 1 Let p be (-16)/20 + (-93)/15. Let v(d) = -d*3 - 6d*2 - 4d + 12. What is the tens digit of v(p)? 8 Suppose -2p - 16 + 20 = 0. Suppose -z = -ph - 162, 750 = 4z + z + 2h. What is the units digit of z? 2 Let l = -2221 - -3407. What is the thousands digit of l? 1 Let a(f) = f*2 - 8f - 7. Let i be a(9). Suppose -ib + 267 = -3q, -9 = 5b - 5q - 674. Suppose -b = -6n + 234. What is the units digit of n? 1 Let d = -69 - -527. What is the units digit of d? 8 Let h(o) = -o3 + 6o*2 + 65. What is the units digit of h(6)? 5 Suppose -3s - 4y = -2470, 5s - 20y = -17y + 4165. What is the units digit of s? 0 Suppose 3k + 105 = 1023. What is the units digit of k? 6 Let g = -5681 - -10621. What is the thousands digit of g? 4 Let o = 29 + -35. What is the units digit of (-3)/o-2 - 272/(-4)? 7 Let j(u) = -4u3 + u - 1. Suppose -7 = 4k - 15. Let r be k/15 - 128/60. What is the tens digit of j(r)? 2 Let z be (30/18 + 1)/((-1)/3). What is the hundreds digit of (3 - (-28)/z) + (-307)/(-2)? 1 Suppose -5y - 2a - 60 + 296 = 0, 5y - 215 = 5a. Suppose y = 5z + 16. Suppose 0v - z = -v + q, v + 3q = 2. What is the units digit of v? 5 Suppose 0 = j - 4j. Let l = 3 - j. Suppose la - 7a = -20. What is the units digit of a? 5 Let c(q) be the second derivative of -q5/60 - q4/4 - q*3/3 + 5q. Let m(o) be the second derivative of c(o). What is the units digit of m(-4)? 2 Let k(x) = x*3 - 12x*2 + 5x + 2. Let w = -103 - -115. What is the tens digit of k(w)? 6 Let q(k) = k*2 - 3k + 3. Suppose -4v + 2v = -16. Suppose g - 3g = -v. What is the units digit of q(g)? 7 Let n(a) = a2 - 7a - 5. Suppose 9b - 8 = 11b. Let o = 4 - b. What is the units digit of n(o)? 3 Let t be (2 - 0)/(-2) - (1 - 2). Suppose 4k + t = 72. What is the units digit of k? 8 Let i be (82/(-6))/(3/(-9)). Suppose -44w + 183 = -iw. What is the units digit of w? 1 Let m(x) = -2x*3 - 4x*2 - x + 22. What is the hundreds digit of m(-7)? 5 Suppose 9q = -5q + 4q. Suppose 4x + 2p - 122 = q, p = 4x + 2p - 123. What is the tens digit of x? 3 Suppose 3s - 6 = -0, s - 5637 = -5q. What is the units digit of q? 7 Let b = 201 - 101. What is the tens digit of b? 0 Let d(h) = -259h + 79. What is the units digit of d(-6)? 3 Suppose 5c + 24 = 7c. Let d = c - -5. What is the units digit of d? 7 Let q = -56 + 84. Suppose 0m - 20 = -4r + 2m, 5r - 4m - q = 0. Suppose -169 = -3x - s, 9x - rx - 263 = 3s. What is the units digit of x? 5 Suppose w - 14w + 15275 = 0. What is the tens digit of w? 7 Let i be ((-2)/(-4))/((-1)/(-8)). Suppose -92 = -iz + 164. Let p = 118 - z. What is the units digit of p? 4 Suppose -4g + 3k + 9180 = 0, -7g = -3g - 5k - 9188. What is the units digit of g? 2 Let k(m) = -m3 - m2 + m - 50. Let z be k(0). Let b be z/(-8) + 6/8. Let x(f) = 3f - 7. What is the units digit of x(b)? 4 Let f = 205 + 974. What is the tens digit of f? 7 Suppose 3u - 197 = -5t, -t + 0u + 33 = -u. Let q = -14 + t. Suppose -2w + 8 = -3f + 1, -3w + q = -2f. What is the units digit of w? 1 What is the tens digit of (3150/135)/((-4)/(-90))? 2 Suppose 252 = -j + 4j. Suppose -2v = 8, w = 5v - 3v + j. What is the units digit of w? 6 Suppose -16y = -5i - 11y + 170, -2i - 5y = -47. What is the tens digit of i? 3 Let u(b) = b*3 + 4b*2 - 5b + 1. Let l(v) = -v - 8. Let t be l(-5). What is the tens digit of u(t)? 2 Suppose -20t = -19t - 955. What is the hundreds digit of t? 9 Let v(c) = -22c2 - 3c. Let h(z) = 67z2 + 9z. Let p(x) = 6h(x) + 17v(x). What is the tens digit of p(-3)? 4 Suppose -k = -4j - 624, 3 = -5j + 28. Suppose -3n = n - k. What is the units digit of n? 1 Suppose -108r - 12948 = -111r. What is the tens digit of r? 1 Let n = -31 + 34. Let l be n - 404/(3 + -5). Let a = l - 145. What is the units digit of a? 0 Suppose i - 2i = 3o - 8743, -2i + 2916 = o. What is the thousands digit of o? 2 Suppose 0 = -j - 4w + 24, -2w - 3w = -5j + 170. Let d = 55 - j. Suppose -6 = h + 3u, u = 2h - 0h - d. What is the units digit of h? 9 Let t(b) = 65b*2. Let y be t(1). Let l = y + -23. What is the units digit of l? 2 Let y = 52 + -52. Suppose w + 2r + 1 = 11, y = -2w - 5r + 19. What is the units digit of w? 2 Let f be 4((-10)/4 - -3). Suppose 4w + 2z + fz = 0, -w - 4z - 15 = 0. Suppose 0 = -4i + wi - 30. What is the tens digit of i? 3 Let g(c) = 3c + 111. Let a be g(6). Let r = -29 + -35. Let k = a + r. What is the tens digit of k? 6 Let v = 944 + -509. What is the hundreds digit of v? 4 Let a(j) = -7j - 23. Let v be a(-3). Suppose -4f + 6z = z + 29, 0 = 2f + z - 3. What is the tens digit of fv56/4? 2 Suppose 9z = 8z - 47. Let k = 76 + z. Let b = 65 - k. What is the units digit of b? 6 Suppose 9j - 4j - 15 = 0. Suppose -36 - 9 = -js. What is the tens digit of s? 1 Let v(n) = n3 - 2n2 + n. Let h be v(2). Let r(d) = -d2 + 6d - 2. Let q be r(-5). What is the units digit of q/(-2)h/3? 9 Suppose 0 = -2q - 4n + 2086, -q + 35n = 32n - 1028. What is the tens digit of q? 3 Suppose -2b + 1634 = 3t - 3b, -5t = -4b - 2735. What is the units digit of t? 3 Suppose 3i - 80 = -8. Let z = -18 + i. Suppose 0j - zj = -30. What is the units digit of j? 5 Let j(t) = -44t + 3. Let m(x) = -x3 - 12x*2 + 13x - 4. Let c be m(-13). What is the units digit of j(c)? 9 Suppose 0 = 63b - 43144 - 76745. What is the tens digit of b? 0 Let s = 191 + 93. Suppose -s = 6j - 968. What is the hundreds digit of j? 1 Let n(p) = 2p2 - 6p + 11. Let i = 17 + -12. What is the units digit of n(i)? 1 Let t(v) = -v*3 - 6v*2 + 4v - 50. What is the tens digit of t(-11)? 1 Suppose -2t - 18 = -2l, -5l - 95 = 4t + t. Let r be (-16)/40 + t/(-10). What is the units digit of (r + -2)(-15 + 5)? 0 Suppose 3d - 1 = -5l, -5l = 6 - 1. Suppose 2o + 5j = 27, 18 = do - 0j + 2j. What is the tens digit of (30/o)/(2/4)? 1 Suppose 0q - 45 = -5q. Let p = -254 - -265. Suppose 0 = -h + q + p. What is the units digit of h? 0 Suppose -32k + 26890 + 19734 = 0. What is the hundreds digit of k? 4 Let i = -1268 - -1974. What is the tens digit of i? 0 Let i = -17 - -36. Let q be 12/9(3 + 3). Let h = i + q. What is the units digit of h? 7 Let j be 5 + -1 + -3 + -1. Suppose j = 26d - 24d - 232. What is the tens digit of d? 1 Suppose -5a - 7d = -3d - 18392, -3a = -5d - 11050. What is the thousands digit of a? 3 Let n(s) = -s*3 - 2s2 + s - 16. What is the units digit of n(-6)? 2 Let q(y) be the first derivative of y4/4 - 2y3 - y2/2 + 13y + 8. What is the units digit of q(6)? 7 Let a = -6 - -10. What is the tens digit of (-401)/(-6) + 7/168a? 6 Let c = 587 - 301. What is the hundreds digit of c? 2 Let u(y) = -11y*2 - 33y - 31. Let r(m) = 4m2 + 11m + 10. Let c(j) = -8r(j) - 3u(j). What is the units digit of c(-16)? 3 Suppose 0 = 6s - 11 - 7. Suppose 7d = sd + 1132. What is the units digit of d? 3 Let o(k) = -5k. Let f be o(2). Let c = f - -14. Suppose 0y - cy = -104. What is the units digit of y? 6 Suppose -3d + 89 - 23 = 0. Let b = d - -13. What is the units digit of b? 5 Suppose -7349 = -15w + 16441. What is the units digit of w? 6 Let s(l) = 37l - 76. What is the tens digit of s(24)? 1 What is the units digit of (-9)/(-5 + 2) - -2623? 9 Let j = -10 + 30. Suppose -k + 0k + b - 1 = 0, 4b = j. What is the units digit of k? 4 Let y be 94/6 + (-2)/(-6). Let f = 177 + -174. Let p = f + y. What is the tens digit of p? 1 Let w(r) = 6r2 - 246 + 210 + 5r*2 + 10r - r*3. What is the units digit of w(11)? 4 Suppose -42 = -8u - 2. Suppose -4y + uz + 132 + 131 = 0, 15 = -5z. What is the tens digit of y? 6 What is the units digit of (-1)/(6/1042/(-36))? 2 Suppose 316 = -3w - t, 3t + 20 = 7t. Let h = 152 + w. What is the tens digit of h? 4 Let h(q) = -q3 - 3q*2 - 2q - 3. Let l be h(-3). Suppose 0o - 2o - 260 = -4r, -525 = 4o - lr. What is the units digit of o/(-4) + -12? 1 Let h(x) = -x*3 - 6x - 8. Let k be h(-2). Suppose -540 = 9f - kf. What is the units digit of f? 0 Suppose -19q + 21537 = -10q. What is the hundreds digit of q? 3 Suppose 59p + 4148 = 63p. What is the hundreds digit of p? 0 Let a be (-290)/22 + (-4)/(-22). Let o = a + 34. What is	{ "pile_set_name": "DM Mathematics" }
base 9, what is -188876 - 435? -200422 In base 14, what is 614 - -6ddbc? 705d2 In base 16, what is 3eb3e8 + 1f? 3eb407 In base 12, what is 32a1 + 631? 3912 In base 9, what is -734387 - -400? -733887 In base 11, what is 96 - 104944? -104859 In base 5, what is -4 + 23333301102? 23333301043 In base 4, what is -113332211013 - -3? -113332211010 In base 2, what is 0 - 1110000100001010001000? -1110000100001010001000 In base 7, what is -306 - -610660? 610351 In base 5, what is 14313130 - -423? 14314103 In base 11, what is -4 + -41426847? -41426850 In base 13, what is cb22 + 83? cba5 In base 11, what is 54628882 + 2? 54628884 In base 10, what is -136 + -73656? -73792 In base 4, what is -112233122 - 1113300? -120013022 In base 15, what is 25d9 + -32a77? -3048d In base 7, what is -10 - 6312134? -6312144 In base 6, what is -30315 + 503245? 432530 In base 16, what is -12b9 + 37aa? 24f1 In base 7, what is -2056 + -11142123? -11144212 In base 2, what is 1110101010101111111011000111 - 100? 1110101010101111111011000011 In base 11, what is -1431a728 - -7? -1431a721 In base 4, what is -2300 - 131211302200? -131211311100 In base 4, what is 230110 - -23210033? 30100203 In base 5, what is 11243412 + -14242? 11224120 In base 4, what is -323200 + 232010? -31130 In base 7, what is -32630 - -56404? 23444 In base 12, what is 13a32900 - -3? 13a32903 In base 9, what is -2 - 1568017? -1568020 In base 10, what is -11 - 1306230? -1306241 In base 2, what is -110010100011 - 1001000101001? -1111011001100 In base 7, what is -3 - -14322116? 14322113 In base 8, what is -5647716 - -130? -5647566 In base 6, what is 335401 - -532? 340333 In base 10, what is -1787474 + 4? -1787470 In base 14, what is 410 - 1c1b? -180b In base 4, what is -2 - -2323012013312? 2323012013310 In base 9, what is 75 - -1676384? 1676470 In base 16, what is -148d8f - 2? -148d91 In base 7, what is -34 - 10264142? -10264206 In base 12, what is 85 - 75825? -75760 In base 3, what is 12 + -11201102021020202? -11201102021020120 In base 15, what is -deb07 - 94? -deb9b In base 14, what is -1 - 3524b34? -3524b35 In base 11, what is -554 + -1097? -1640 In base 7, what is 5 + 161163150? 161163155 In base 2, what is -11000110110110100010101 + -11110100? -11000110110111000001001 In base 10, what is 52225 - -2742? 54967 In base 15, what is 7 - 654082? -65407a In base 5, what is -2 + -22431311043? -22431311100 In base 12, what is -1b077 - -70? -1b007 In base 9, what is -1213 - -668042? 666728 In base 9, what is -76705 - 2? -76707 In base 9, what is 2554 + -10667? -7113 In base 5, what is 3244121 - 12403? 3231213 In base 13, what is 406289a + 3? 40628a0 In base 3, what is 121220 + 20022002? 20220222 In base 15, what is 17 + -b5b03d? -b5b026 In base 15, what is -55 - -2d854d? 2d84e8 In base 9, what is -3108646 + -5? -3108652 In base 14, what is 9b138a + -45? 9b1345 In base 14, what is 2 + 1b2406a? 1b2406c In base 10, what is -313 + -400815? -401128 In base 3, what is -10120012001021210 + 10? -10120012001021200 In base 2, what is 10110000 - -1101100110? 10000010110 In base 14, what is 41c - -56? 474 In base 14, what is 1c0 - -34aa? 368a In base 7, what is 664230 - 11404? 652523 In base 4, what is 1132322013103 - -3? 1132322013112 In base 2, what is -110010 - -110001110110111? 110001110000101 In base 13, what is -3b2b9008 - 0? -3b2b9008 In base 4, what is 112203 + -203220? -31011 In base 14, what is -53 + 25dc63? 25dc10 In base 10, what is 135 - -1660327? 1660462 In base 7, what is 5 + 16263624? 16263632 In base 3, what is 2011200111220 - -1? 2011200111221 In base 12, what is 174525 - -a5? 17460a In base 5, what is 2424022402 + -3? 2424022344 In base 9, what is 53101 - -3341? 56442 In base 2, what is -1000010001100 + 1011010011111100? 1010010001110000 In base 14, what is -c - 2c6cad? -2c6cbb In base 14, what is -88 - -25b84? 25ada In base 5, what is 134432 - 3143? 131234 In base 10, what is 21671 + 723? 22394 In base 13, what is -1 - 43303? -43304 In base 6, what is -3501151 - -155? -3500552 In base 15, what is -1698bb4 + -1? -1698bb5 In base 6, what is 1 - -30444434? 30444435 In base 2, what is -111001100100001101 - 110? -111001100100010011 In base 3, what is 102112120122 + -22220? 102112020202 In base 8, what is 10260 + -1744? 6314 In base 15, what is -6 + 381e4? 381dd In base 2, what is -11001001011000010 + -110111101? -11001010001111111 In base 15, what is -d + 919dec? 919dde In base 14, what is -15bb62 - 67? -15bbc9 In base 4, what is 203322 - -110203? 320131 In base 5, what is 2004120 + -231? 2003334 In base 15, what is -87 - 128461? -1284e8 In base 9, what is 1106015 + 368? 1106384 In base 7, what is 3 + 1130561411? 1130561414 In base 5, what is -4243 - -111013423? 111004130 In base 7, what is -53215131 + 5? -53215123 In base 9, what is 856 - -22414? 23371 In base 11, what is -19 - 1595a5? -159613 In base 8, what is -1104455415 + 6? -1104455407 In base 8, what is 333121 + 10? 333131 In base 8, what is 66 + 23707? 23775 In base 7, what is -130526144 + 1? -130526143 In base 2, what is 100100000101011 + 111101111101? 101011110101000 In base 12, what is -b2a9b63a + 1? -b2a9b639 In base 15, what is 2c + 185224? 185251 In base 6, what is 11115033 - -202? 11115235 In base 3, what is -200222101221212 + 10? -200222101221202 In base 10, what is -30 - -805335? 805305 In base 3, what is -120112110111100200 - -1? -120112110111100122 In base 5, what is -1332242 + 124? -1332113 In base 13, what is -1a13 - -98b1? 7b9b In base 11, what is 3126658 + 2? 312665a In base 16, what is -3f - -a5e02d? a5dfee In base 15, what is -9 - 249309? -249313 In base 10, what is -6 + -1791082? -1791088 In base 10, what is 9479396 + -3? 9479393 In base 14, what is -3 - 123c6dc? -123c701 In base 12, what is -1400a - 1b542? -33550 In base 12, what is -299690a5 - -4? -299690a1 In base 4, what is 30123 - -1221221223? 1221312012 In base 11, what is -37880 - -59? -37822 In base 10, what is 616270 - 129? 616141 In base 7, what is -3 + 152214052? 152214046 In base 4, what is -121332 + 311331? 123333 In base 6, what is 105123333 - -343? 105124120 In base 3, what is -200212200 + -1101120? -202021020 In base 9, what is 4 + -8841825? -8841821 In base 8, what is 0 - -516641252? 516641252 In base 4, what is -1211113 + 131031? -1020022 In base 9, what is -103045 + 326? -102618 In base 4, what is -210312103201 - -10? -210312103131 In base 13, what is 867527c + -5? 8675277 In base 12, what is b421 - -231? b652 In base 10, what is 42234741 + 15? 42234756 In base 9, what is 0 - -332844045? 332844045 In base 2, what is 11011000000001111 - 10100001011010? 11000011110110101 In base 3, what is 1222111110 - 1001211? 1221102122 In base 8, what is 500221674 + 1? 500221675 In base 10, what is -2255308 - 1? -2255309 In base 14, what is 0 - -6b3d599? 6b3d599 In base 9, what is 2306 + -10120? -6713 In base 3, what is 122011 + 2221202210? 2222101221 In base 10, what is -1 + 80501331? 80501330 In base 15, what is d54 + 3dd8e? 3ebe3 In base 5, what is 4123301 + 240? 4124041 In base 6, what is 5 + 551525541? 551525550 In base 2, what is 10011 + 10110010110001101001111? 10110010110001101100010 In base 4, what is -302322130 - -103? -302322021 In base 14, what is -1863 + -a88? -250b In base 15, what is -22 - -59eb9? 59e97 In base 7, what is 2214556 + -44? 2214512 In base 4, what is 1103302210 - 2201? 1103300003 In base 5, what is -3 - 33122322024? -33122322032 In base 13, what is -930060 - -10? -930050 In base 4, what is 10121 + 102222033? 102232220 In base 15, what is -28770 - -70? -28700 In base 4, what is -1201 + -121023120? -121030321 In base 10, what is 78 + -364991? -364913 In base 11, what is 243 + -a6643? -a6400 In base 9, what is 1 + 5162000? 5162001 In base 6, what is -251140 + 35? -251101 In base 4, what is 21102 + 1033101133? 1033122301 In base 7, what is -2465 + -64400? -100165 In base 15, what is -4470 + 466? -4009 In base 11, what is 4915 - 614? 4301 In base 5, what is 1 - -410302222? 410302223 In base 16, what is 73 + d7d? df0 In base 14, what is 7d3c54 - -2? 7d3c56 In base 16, what is 1e56 + -147? 1d0f In base 4, what is 111333112330222 + 0? 111333112330222 In base 12, what is -3bb1b6 - 70? -3bb266 In base 10, what is -10530908 + -2? -10530910 In base 5, what is 32 + 1002	{ "pile_set_name": "DM Mathematics" }
to n in 1.5, -1, v? v Let s = 656 - 655.5. What is the nearest to 0 in -0.01, -3, s? -0.01 Let k = 35.2 + -2.2. Let j = -33 + k. Which is the nearest to 1/2? (a) j (b) -1 (c) 3/2 a Let q = 12 - 16. Let i = 5.013 + -0.013. What is the nearest to -2/11 in 1, q, i? 1 Let u(p) = -p*2 + 11p - 13. Let w be u(10). Suppose x - 1 = -4. Let q = x + 0. Which is the nearest to w? (a) 0.1 (b) 0 (c) q c Let f = 0.74 - -0.93. Let g = -0.03 - f. What is the nearest to g in 1, -3, 0.3? -3 Let j = -27.4 - -27.5. Which is the closest to j? (a) -1/9 (b) 0 (c) -3 b Let d = 0.25 + -0.35. Let c = 161 - 801/5. Let m be (-64)/(-44) - (1 + 1). What is the closest to d in -4, m, c? m Suppose -2h - 38 = -3u, 5u + 2h - 58 = -0h. Suppose 2w + u = -4y - 8, -2y - 5w = 18. Which is the closest to 1/2? (a) 0.4 (b) -2 (c) y a Let w = 0.8 + 0.2. Suppose g = -40 + 115. Let h be (-3)/25/g. Which is the nearest to 1? (a) -2 (b) h (c) w c Let z(f) = -1. Let k(r) = -r - 9. Let v(m) = -2k(m) + 6z(m). Let g be v(-5). Suppose 0 = -9d + 8d + 1. What is the closest to g in 0.05, 4, d? d Let p = -124 - -623/5. Which is the closest to 0.2? (a) -2/7 (b) p (c) -0.3 b Let y = -5 - -3.3. Let o = 1.6 + y. Which is the closest to o? (a) -2 (b) -1 (c) -4 b Suppose 0 = -11m + 13m + 304. Let i = m - -147. Let q be 5((-12)/5)/2. Which is the nearest to 0? (a) 4 (b) q (c) i a Suppose -2n + 2q - 60 = -0n, -58 = 2n - 3q. Let h be (-2)/(-8) - 24/n. Let r = -3 + 2. Which is the nearest to h? (a) -0.1 (b) 5 (c) r a Let l = 6.2 - 0.2. Let j = 6.4 - l. Let k = 31.2 - 31. Which is the nearest to -0.1? (a) 0 (b) k (c) j a Let f(m) = -m*2 - 10m - 12. Let p be f(-9). Let g be 23((-2 - p) + -2). Let z = -22 - g. Which is the closest to z? (a) -3/7 (b) -4 (c) -0.4 c Suppose 0 = 40o - 1067 + 387. Which is the closest to -1? (a) 5/2 (b) o (c) -0.5 (d) 1 c Let d = -3.5 - -3. Let n be (-2 - 66/(-28))(-8)/(-10). Which is the nearest to 0? (a) d (b) n (c) -1 b Let n = 147 - 147.2. What is the nearest to n in 5, 7/8, -2? 7/8 Let f = -34 + 37.8. Let h = f - 0.8. Let r = 5.1278 + -0.1278. Which is the nearest to r? (a) 0.1 (b) h (c) -2/13 b Let o(l) = 15l - 91. Let p be o(6). Which is the nearest to p? (a) 0.4 (b) -3 (c) 1/87 (d) 2/11 c Let j = 0.112 + 0.288. Let r = 0.008 - -0.992. What is the closest to r in j, -1, 4/3? 4/3 Let d = -17.82 - -14.82. Let l = 2.4 - 0.4. What is the nearest to 2/9 in -5/3, l, d? l Let m be 31(-2)/(-18). Let i(l) = 3l2 - 71l - 14. Let x be i(24). What is the closest to 0.1 in x, -2/9, m? m Let h = 34.039 + -0.039. Let v = -35 + h. What is the closest to -0.1 in v, 2/3, 4? 2/3 Let g = 1.12 - 8.42. Let l = -5.3 - g. What is the closest to l in 2/15, -1/9, 3/5? 3/5 Let k = -0.22 - -3.72. Let d = k + -2.9. Let n = -0.4 + d. What is the closest to -1 in -0.1, n, 1/2? -0.1 Let u = -0.3 + -1.7. Let s be 5/20(-258)/10. Let f = s - -31/5. Which is the nearest to u? (a) f (b) 0.3 (c) -4 a Suppose -24 = -3v + 5n, -3v + 2v = -6n - 21. Let i = 1 + -1.3. Which is the closest to 0? (a) -0.4 (b) i (c) v b Let k = -38 - -34. Which is the closest to -1? (a) 7/5 (b) 1/3 (c) 4 (d) k b Let r = -69554 - -627766/9. Let j = r + -198. Let l = 85 + -89. Which is the closest to -1? (a) j (b) l (c) -0.1 a Let d be (-1 + 4/1)10/(-3). Let o(j) = -j3 - 9j*2 + 9j - 3. Let t be o(d). Which is the nearest to 0? (a) -4 (b) t (c) 0 c Let f = -3/47 - 26/329. Let a = 2.0031 + -0.0031. What is the closest to -1 in a, f, 4? f Let a = -177.1 - -177. What is the closest to 1/5 in 0.01, 5, a? 0.01 Suppose 34t + 27 - 1149 = 0. Which is the closest to t? (a) 1/2 (b) 2/5 (c) 4 c Let i = 9518 + -9517.9. Let x = 102643/1563 + -2/521. Let v = -65 + x. What is the closest to i in 5, 2, v? v Let o = 41 + -40.992. Let u = -0.292 - o. What is the closest to 0.2 in u, -2, -1? u Let s = -305 - -3967/13. Suppose m + 5d = 5, 3d = -m + 7d - 13. Let k = 7 + m. Which is the closest to s? (a) -4 (b) k (c) -0.3 c Let h be (2/(-228))/(3/(-30)). Let f = h - -59/627. What is the nearest to 0.1 in f, 1/4, -0.4? f Let g = 2729/10 + -273. What is the closest to 2/9 in -4, 0.6, g? g Let o = 288 - 288. Let l = 0 + 0.1. What is the closest to -1 in -1, o, l? -1 Let v = -3.11 + 1.11. Let t = 6.5 - 6. Which is the closest to t? (a) 0 (b) -3 (c) v a Let z = -11981/4 + 2995. What is the nearest to -2/5 in z, -4, 0.4? z Suppose -36u + 38u + 10 = 0. What is the nearest to -0.4 in u, 0.5, 0? 0 Let d = 0.16 + 7.84. Which is the closest to -1? (a) d (b) -1/5 (c) 0.1 b Let n = 0.1 + 0.1. Let h = 476 - 476. Let r = h - n. What is the closest to r in 1/2, 2, -5? 1/2 Let r = -2235.5 - -2235. Which is the nearest to 1? (a) r (b) -6/409 (c) -4 b Let v = 4.1172 - 0.1172. Let m = -1.1 - -0.1. Which is the nearest to m? (a) 0 (b) v (c) 3/7 a Let q(n) = -n*2 + 8n + 34. Let r be q(-3). What is the closest to -0.1 in 7, r, 0.2, 5? 0.2 Let q = -1.2 - -1.2. Let s = 92.9 + -93. Which is the nearest to s? (a) -51 (b) -0.4 (c) q c Let v = 35.1 - 36. Let l = -5.9 - v. Which is the nearest to -0.9? (a) 1/4 (b) l (c) -3 a Let d = 81/553 + -2/553. What is the closest to d in 1/3, -3, 0.07? 0.07 Let m be ((-20)/14)/(-4 - 64/(-14)). Let r = 129/2 + -63. Which is the closest to m? (a) -0.3 (b) -2 (c) r b Let k = -333.9 - -334. Let t(y) = y*2 + y. Let j be t(-2). Which is the closest to -1/9? (a) k (b) -2 (c) j a Let t be (-32)/(-80)(-20)/36. What is the nearest to -399 in t, 2/3, -0.5? -0.5 Suppose -s + 3p = 3, 7 + 9 = 4s + 2p. Suppose -3g + 0 - s = 0. Let w = 58 + -59. What is the nearest to w in -18, g, 2/3? g Let a = -87 - -263/3. Let x = -51 - -48.9. Let i = -2.4 - x. What is the closest to 0.2 in a, 0.4, i? 0.4 Let j = -613 - -612.7. What is the closest to j in -0.3, -0.06, 0.5, 2? -0.3 Let c(r) = 62r - 10. Let l be c(3). Let y = l + -1230/7. What is the nearest to y in 5, 0, 2? 0 Let h be (2/(-7))/(6 - 7). Suppose m + 2m - 3 = 0. Let s = -28 - -29. Which is the nearest to m? (a) 4/7 (b) s (c) h b Let u = -0.062 + 33.062. Let h = u + -28. What is the closest to 1/3 in h, -4, -2/15? -2/15 Let z = 1 + -1. Let o = 1.451 + -1.53. Let j = o + -0.121. Which is the nearest to z? (a) j (b) -2/13 (c) 5 b Let l be -7 + 224/35 - 82/(-70). Let z = 0.3 + 0.7. Let f = 0.8 - z. What is the closest to l in f, -2, 1? 1 Let g = 2 + -2.1. Let w = 0 - 0. Let j(r) = r*3 - 6r*2 + 10r - 61. Let t be j(6). What is the nearest to g in 1, t, w? w Let i = -0.16 + 0.26. Let z(r) = -3r2 + 9r - 3. Let m be z(2). Which is the nearest to i? (a) m (b) 9 (c) 0.3 c Let g = 6 - 9. Let q = -65 - -67. Suppose 5p = 15, n + 4p + q - 14 = 0. What is the nearest to n in g, -5, 1? 1 Let d = -0.43 + 0.03. Let f = 2282.7 - 2283. What is the nearest to -1/9 in d, -2/9, f? -2/9 Let h = -2222/15 - -148. Which is the nearest to h? (a) -27 (b) 4 (c) -1/6 c Let q = -0.922 - -4.112. Which is the nearest to q? (a) 1 (b) -2/9 (c) 2 c Let m = -10007/1334 - -1/667. Which is the nearest to 0.1? (a) m (b) -5 (c) 5 c Let i = 4.2 + -2.1. Let x = 56 - 54.9. Let f = x - i. Which is the closest to f? (a) 2/7 (b) -2/13 (c) 5/3 b Let r be (1/(-3))/((-5)/6). Let q be 2/(3(-4)/(-6)). Let n = 0 + q. What is the nearest to 0.2 in 3, r, n? r Let z = -4.54 - -4.64. What is the nearest to z in -0.044, 2/9, 2/11? 2/11 Let i = -9 + 24. Let u = -22 + i. Which is the closest to -2/3? (a) 5 (b) -4/7 (c) u b Let z = -9.1 + 9. Let i = -5 + 4.76. Let h = i - -5.24. Which is the closest to -2? (a) 0.2 (b) z (c) h b Let s = 9 - 15. Let g = -5 - s. Let i = g - 5. What is the closest to -1/3 in -1/2, i, -3? -1/2 Let d = 25 + -33. Let w = -0.207 + -11.693. Let i = 12 + w. Which is the closest to i? (a) -3 (b) d (c) -0.2 c Let w be 02/(-2 + -2). Let g = -12618/5 + 2523. Let s = -0.08 + -4.92. Which is the nearest to -0.1? (a) g (b) s (c) w c Let o = -94/3 + 32. Let s = -1/279 + 842/1395. Which is the nearest to o? (a) s (b) 1/4 (c) 5 a Let l = -86 - -90. Let o be (-17 - -21)(0 + l). Which is the nearest to 2/5? (a) o (b) -1 (c) 0 c Let u = -0.5 + 0.1. Let x = 895/4 + -208527/932. Let o = x - 243/1165. Which is the closest to 1? (a) 4 (b) u (c) o c Suppose -2u	{ "pile_set_name": "DM Mathematics" }
= -2i2 - 4i - 2. Determine k(l). -2 Let v = -20 + 17. Let q be -12/v36/8. Let d(f) = -f*2 - 3f + 3. Calculate d(q). -15 Let k(i) = -i + 32. Let g(n) = n - 30. Let r(l) = -5g(l) - 4k(l). Determine r(10). 12 Let v(a) = 24 - 6a + 38a - 15a - 6a - 12a. Give v(8). 16 Let w = -1 - 1. Let c(s) be the second derivative of -s4/6 - s3/2 - s2/2 + 113s. Give c(w). -3 Let a(m) = m*2 + 2m - 3. Suppose 5n - l = 2, -4 = -3n + 5l - 16. Let z(f) = -6f3 + f2 - f. Let v be z(n). Let w be (v/8)/(4/(-16)). Determine a(w). 12 Let c(z) = -5z + 1. Let r(s) = 22s - 5. Let i(u) = 9c(u) + 2r(u). Let p be 6/((3/3)/1). Suppose -3k + pk = -3. Determine i(k). 0 Let l be (1/(-1) - 33)/(-2). Let w(x) = -x - 13x2 + lx*2 + 5 - 4. Suppose 0 = -r + 3r - 2. What is w(r)? 4 Let h(x) = -6x - 2. Let w be h(-1). Suppose p + 4p - 19 = wg, -2g + 3p = 9. Let i(n) = -n2 - 8n. Determine i(g). 12 Suppose 32 = 4d + 4p, 25 = -d + 3d + 5p. Let v(q) be the third derivative of 0 - 5/6q3 + 1/10q*5 + 0q - 1/4q4 - 1/120q*6 - 12q2. What is v(d)? -10 Let u(y) = -y3 - 35y2 + 3y + 106. Let d be u(-35). Let k(q) be the first derivative of -7q3/3 + q2/2 - q + 2. What is k(d)? -7 Let g(s) = 3s*2 + 3s - 6. Let b(i) = -i*2 - i + 2. Let q(c) = -4b(c) - g(c). Determine q(3). 10 Let l = 3 - 6. Let q(z) = -5z. Let v(c) = 26c. Let p be 22/(5 - 3). Let g(f) = pv(f) + 11q(f). Determine g(l). 9 Let x(c) = -2c*3 - 2c*2 + 4c + 7. Let r be x(-1). Let k(w) = w*3 - 6w*2 + 5w - 2. Determine k(r). -14 Let w(m) = m*2 + 2m - 5. Let u be w(-4). Let f = 2 + -1. Let k(d) = u - f - 1 + d. Calculate k(-2). -1 Suppose 5t - 5 = -0a - a, a = -3t - 1. Let v = a + 7. Let c(w) = -w - 4. Determine c(v). -1 Let b(p) = -p2 + 4p - 2. Let z be b(5). Suppose -2f - 62 = -2w, -3w + 57 + 30 = 3f. Let x(q) = -29q + wq + 6 + 4 - 2. Give x(z). 1 Let p(r) = r*3 + 5r*2 - 6r - 5. Suppose 0 = 3h + o - 7, 0o + 4 = -2h - 5o. Suppose -1 = -2x - hd, 0 = -3d - 5 - 4. Let v = -11 + x. Give p(v). -5 Let v(q) = 2q*3 - 6q*2 + 3q - 6. Suppose 4z = 92k - 93k - 8, 2k - z - 11 = 0. Calculate v(k). 38 Let t(v) be the second derivative of v*5/20 - 7v*4/6 + 3v*2 + 5v - 7. Give t(14). 6 Let u(p) = p*2 + 9p - 1. Suppose 95g + 312 = 43g. Give u(g). -19 Let l(c) = -c*2 + 7c - 2. Let i(y) = y*2 - 9y + 2. Let j(v) = 5i(v) + 6l(v). What is j(4)? -30 Let g(k) be the third derivative of -k6/120 + k5/10 - k4/24 + k3/2 + 36k2. Give g(6). -3 Let i be 232/(-7) + (-19)/(-133). Let q = i - -30. Let o(v) = 2v - 1. Give o(q). -7 Let r(b) = b*3 + 4b*2 + b + 3. Let m be r(-4). Let t(n) = -4n + 3. Let j(v) = v. Let g(w) = mt(w) - 6j(w). Give g(-5). 7 Let y(c) = -60c - 34c + 3 + 3 + 61c - 5. What is y(1)? -32 Let g(x) = 3x*2 + 2x + 15. Let d(z) = 2z2 + z + 14. Let p(y) = 4d(y) - 3g(y). What is p(-5)? -4 Let m(h) = -6h - h*3 - 7h*2 - 13 - 5h - 3h2. Give m(-9). 5 Let v be (0/1)/(5 - 4). Let q = v - -1. Let g(t) = -14t*2 + 7t + 5. Let c(f) = -f*2 + f + 1. Let j(r) = -6c(r) + g(r). Give j(q). -8 Suppose 7 = 3r + s + s, 2s = 4. Suppose 3c = -4g - 7, 8 = 2g - c - r. Let k(j) = -3j*3 + 3j - 1. Calculate k(g). -19 Suppose i - 5k - 9 = 5i, 5i + k = -27. Let r(z) = z3 + 3z*2 - 8z - 7. Determine r(i). -67 Let j(y) = 2y2 - 6y - 2. Suppose 3k + 3c - 15 = 6c, 4k + c - 20 = 0. Determine j(k). 18 Let u(g) = -99g + 97g - 1 + 1 - 4g2 - 2g3. Give u(-2). 4 Let k(b) = b2 - 8b + 13. Suppose -t + 30 = 4t. Let h be k(t). Let x(o) = 0 + 2o - 1 - 4 + h + o2. Calculate x(-4). 4 Let a(x) = x2 + 10x + 6. Let l(h) = -4h3 + 4h*2 - 4h - 1. Let o be l(1). Calculate a(o). -19 Let g = -38 - -37. Suppose 2p = 3f - 1 - 6, -2p - 2 = 2f. Let r(w) = 4w2 - 5w*2 + 10w*2 + 2w + f + 0w2. Calculate r(g). 8 Let x(r) = -r3 - 8r*2 - 7r. Let i = -114 + 80. Let s be -54(-1 + (-3)/(-2)). Let t = i - s. Determine x(t). 0 Let z(b) = b3 + b2 - 2b + 1. Let r(c) be the first derivative of -c*2 - 41c + 1. Let d be r(-22). Calculate z(d). 31 Let q(l) be the second derivative of -l5/60 + l4/4 - l*3 + 7l*2 + 9l. Let t(y) be the first derivative of q(y). Give t(4). 2 Let k(y) = -y + 2. Suppose -5n - 24 - 36 = 0. Let o be (4/(-16))/(1/n). Suppose w = 4w - o. What is k(w)? 1 Let u(k) = k3 - k2. Suppose 6v = 7v - 19. Suppose 7w = vw - 12. Determine u(w). 0 Suppose -27u = -3g - 28u - 5, 0 = g - 4u + 19. Let w(d) be the second derivative of 0 - 1/2d2 - 1/6d*3 - 2d. What is w(g)? 2 Suppose 4p = 2l + 12, -16l - p = -23l - 55. Let m(f) = -f - 3. Let j(h) = -3h - 9. Let o(d) = 4j(d) - 11m(d). Calculate o(l). 5 Suppose 3b - 4n - 52 = 0, b - 17 = -0n + n. Let a = b + -17. Let r(s) = -13s - 3. Let j(v) = -v - 1. Let l(u) = ar(u) + 4j(u). Calculate l(-1). -10 Let y(p) be the first derivative of -p2/2 + 22p + 144. What is y(0)? 22 Let t(r) = -2r + 24. Let u be t(6). Suppose 5j = 7 - u. Let f(n) = 13n - 1. Give f(j). -14 Let w(h) be the first derivative of -h4/24 - h3/3 - 9h2/2 + 3. Let r(v) be the second derivative of w(v). Give r(5). -7 Let p(y) = -y3 - 31y2 - y - 37. Let u be p(-31). Let d(f) = f + 3. Give d(u). -3 Let m be (-4)/18 + 33/27. Let w(r) = 4r*2 - m + 2r - r - r. Let u be 2(-3)/61. Calculate w(u). 3 Let w(k) be the second derivative of 2k2 - 5k - 1/6k3 + 0. What is w(4)? 0 Let z(r) = r2 - 9r - 10. Let n be z(-1). Let o(p) = -6p. Give o(n). 0 Suppose -10d = 126 + 454. Let f = 58 + d. Let w(n) = -n + 1. Calculate w(f). 1 Let z(a) = 6a + 1. Let s be (-2)/(6/(-3)) - 0. Suppose 0 = -4m + 33 - s. Let q be 12/16m/6. Calculate z(q). 7 Let y(w) = -w3 + 5w*2 - 4w - 5. Let c(f) = -f*3 - 20f*2 - 17f + 42. Let t be c(-19). Calculate y(t). -5 Let c(d) = -d - 2. Let j(i) = -i - 3. Let a(w) = 8c(w) - 5j(w). Let x be (-150)/39 + (-12)/78. Give a(x). 11 Let p(n) be the first derivative of n4/4 + n3/3 + n - 1. Let y = 5 + -8. What is p(y)? -17 Suppose 0 = -19r + 3r - 528. Let z(s) = s*3 + 33s*2 + s + 33. Determine z(r). 0 Let i be (-66)/(-3 - -6 - (-27)/(-6)). Suppose -i = a - 46. Let h(l) = 2l*2 - 2l - 1. Calculate h(a). 3 Suppose 5c + 24 = 39. Let i(v) = 8 - v3 + 3 - 13 + 2v. Determine i(c). -23 Let i(u) = -2u3 + 8u*2 + 12u - 8. Let y(j) = j*3 - 4j*2 - 6j + 4. Let t(p) = -3i(p) - 5y(p). Give t(5). -1 Let r = -6 - -11. Suppose -v + rv - 100 = 0. Suppose -a = -b - 5, -b + 0b = -5a + v. Let m(z) = -z2 + z - 19. Calculate m(b). -19 Suppose -109f + 37f - 1008 = 0. Let v(q) = -3q - 36. Give v(f). 6 Suppose -3t - 10h - 14 = -14h, -5t = 2h + 6. Let o(m) = 6m*2 - m + 1. Calculate o(t). 27 Let p(w) = 5w*2 + 17w - 3w2 - 1 + 2w*3 - 6w - 11w. Suppose -2a - 3a - 10 = 0. Determine p(a). -9 Let j(d) = d3 - 6d*2 - 5d + 5. Let x be j(7). Let z = x + -12. Let v(f) = 3 + 6f + z - 2 - 12. Determine v(3). 14 Let u(n) = 3 - 2 + n + n + 0n. Let s(z) = 2z2 - 41z - 26. Let k be s(21). Give u(k). -9 Let b(s) = 2s3 + 2s*2 - 2s - 1. Let t(i) = 7i3 + 5i*2 - 5i - 4. Let n(r) = 3b(r) - t(r). Let m(z) = z2 - z + 1. Let a be m(1). Give n(a). 0 Let r(y) be the second derivative of 2y3/3 + y2/2 - 173y. Calculate r(1). 5 Let x(r) be the second derivative of -r3/6 - r2 + 19r. Suppose 6t = 2a + 11t + 25, 2a - 15 = 3t. Determine x(a). -2 Let s be (-7 + 9 - 2)/(-3 + -1). Let b(t) = -3t*3 + 0t + t + 2t3. What is b(s)? 0 Let d(x) = -6x2. Let s(r) = r2 - 2r - 10. Let h be s(0). Let b = h - -12. Let u be (-2)/b(7 - 6). Calculate d(u). -6 Let j(g) = 2g - 11. Let k(a) = -a + 15. Let m(z) = -3j(z) - 2k(z). Determine m(0). 3 Let y(d) = -3d*3 + 6d*2 + 11d - 4. Let w(h) = 2h3 - 5h*2 - 9h + 3. Let i(q) = -4w(q) - 3y(q). Determine i(-2). -6 Suppose 0 = 2t + 10. Let i(j) = -j2 - 4j + 4. Let q(v) = 2v2 + 9v - 7. Let b(x) = ti(x) - 3q(x). What is b(-7)? 1 Let l(w) = 2w2 - 2w + 1. Suppose -10t + 11t = 1. Let x be (t + 4/(-6))/((-5)/(-45)). What is l(x)? 13 Let h(l) be the second derivative of -l*3/3 + 29l*2/2 + 11l - 1. Calculate h(12). 5 Let h(x) = x + 4. Let k be (-666)/(-21) + 8/28. Suppose -k = 2m - w, 4w = -m - 0*	{ "pile_set_name": "DM Mathematics" }
7 for r. -4 Let u(y) = 5y2 - 3y - 6. Let x be u(-2). Suppose 0f + x = 5f. Solve 3p + 2 = -f for p. -2 Let b = 874 + -869. Solve 41 - 56 = -bf for f. 3 Suppose 4s = -163 + 11. Let r be (52/(-14) - -4) + s/(-14). Solve 1 = -2t + rt for t. 1 Suppose z = -219 + 233. Solve 3m = 8 - z for m. -2 Let v = -3 - -7. Suppose 0 = vw + g - 15, 2w = 4g - 0g + 30. Suppose -q = -3u - 7, -3q = -u - 8 - w. Solve 2 = n + q for n. -2 Let a(z) = z*2 + 2z + 23. Let h be a(7). Let c be h/10 + 5/(75/(-9)). Solve -cv - 9 = -5v for v. -3 Suppose 0 = -7o + 7 + 119. Solve o = -14a + 8a for a. -3 Suppose -1 + 4 = j. Suppose 5d = -5t, 0d - 3t = -2d. Solve v + j = -dv for v. -3 Let l = 32 + -20. Let h be l/(-42) + (-37)/(-7). Solve 12 = -ho + 2 for o. -2 Suppose 0 = 7o - 2o. Suppose -4r + or + 100 = 0. Suppose b - r = -4b. Solve -bd + 9 = -2d for d. 3 Let k(a) be the first derivative of a4/4 + 17a*3/3 + 17a*2/2 + 19a + 1. Let w be k(-16). Solve -w - 1 = 4o for o. -1 Let x be (-7 + 1)(-1)/2. Suppose 0 = -4k - 4, 3k + 5 = 5t - x. Suppose 12 = 4q + 4h, -2q + 5h - 3 = -2. Solve -q + t = -v for v. 1 Let x(c) = -c - 3. Let s be x(-6). Suppose h = 3j - 15, -17h = 3j - 21h - 24. Solve -2 = -sw + jw for w. -2 Suppose 8a + 246 = 294. Solve 45 = ay + 3y for y. 5 Let t be (-9)/27 + 1 + 38/6. Solve -12i = -ti + 20 for i. -4 Let y(u) = u*2 - 8u - 19. Let i be y(11). Suppose 0 = -id + 9d. Solve 2b - 6b = d for b. 0 Let u = -29 + 31. Let j be u - -2(-2)/(-4). Solve 2k + j = -1 for k. -2 Suppose 2o + 35x = 39x + 42, -o - 4x + 27 = 0. Solve -16p - 7 + o = 0 for p. 1 Let k = -15 - -23. Let q(x) = 2x - 9. Let v be q(k). Let b = 9 - v. Solve h - 3 = bh for h. -3 Suppose -4i = -6i - 3c + 47, -21 = -i - 4c. Solve -5y = -10 + i for y. -3 Suppose 3q - 2q = -7. Let y = q - -4. Let x be y - -2 - (1 - 6). Solve xc = c - 6 for c. -2 Let t(b) = -b3 - b2 + b + 1. Let h be t(-2). Suppose -5j - 8 = -hl - l, 4l + 4j - 8 = 0. Solve -23 = -5x + l for x. 5 Suppose -3c - 4t - 11 = 0, -c + 23 = -3t - t. Suppose -3s - 3z = -18, 3s - 213 = 4z - 223. Solve -4 = cj + s for j. -2 Let l = 862 - 859. Solve ls + 1 + 14 = 0 for s. -5 Let t(c) = c2 + c. Let x(i) = -2i*2 - 3i. Let s be ((-2)/(-3))/((-9)/(-27)). Let r(u) = sx(u) + 5t(u). Let q be r(0). Solve q = k + 1 - 5 for k. 4 Suppose -4j + 4 - 16 = 0. Let g(n) = -3n - 3. Let t be g(j). Solve -16 = -2h + th for h. -4 Let q = 3023 - 3011. Solve u = q - 16 for u. -4 Let p(w) = w - 29. Let s be p(-8). Let t = 47 + s. Solve 4 = 2j + t for j. -3 Suppose 32 = 23d - 15d. Solve -16 = 4h - d for h. -3 Let g = -92 - -76. Let b be 15/(-2)(g/(-6))/(-4). Solve br + 2 = -13 for r. -3 Suppose -4r + 38 = 5z - 27, -2z = -2r + 46. Solve 0 = 12o - ro + 24 for o. 3 Suppose -3f = 3w - 21, -4w + 8w - f - 23 = 0. Solve -wk + 20 = -2k for k. 5 Suppose -3w = f - 15, -15 = 13f - 12f - 3w. Solve f = -124o + 132o + 16 for o. -2 Suppose 0 = m - 0b + b - 7, 0 = 4m - 3b - 7. Let c = 8 - m. Solve 0n = -n + c for n. 4 Suppose -5h + l = 4l - 94, 2h - 46 = -4l. Let k be h + -3 + 3 + 3. Suppose -9y - k = -14y. Solve -yp = 4 + 12 for p. -4 Suppose -s + 19 = 3v, -9s - 4v + 37 = -6s. Solve sk = k + 6 for k. 1 Let u = 11 + -5. Suppose 2x - 4 = -3g - 1, 3g + x = u. Suppose 5r + 41 - 46 = 0. Solve r = -gc + 16 for c. 5 Let f = 1 - -3. Solve 8 = -3m - f for m. -4 Let c be (-46)/(-14) + 4/(-14). Let b = -4093 + 4093. Solve -ct = -bt for t. 0 Suppose -4a = 5r - 83, r - 27 + 11 = -a. Let g = -3 + 4. Solve g = -5b - r for b. -4 Let o = 2 - -1. Let h = -5 - -6. Solve -z = h + o for z. -4 Suppose 64v - 52v - 120 = 0. Solve 3a - v = a for a. 5 Let o(l) = -l*2 + 12l - 8. Let f be o(11). Let g(k) = -k*2 - 6k. Let i be g(-6). Let p be (1 + (-6)/3)/(1/(-1)). Solve -n + p + f = i for n. 4 Suppose 4w - x = -0w - 11, 2w + 4x - 8 = 0. Let g be 7/5 + w/5. Solve 3s + 7 = g for s. -2 Let r = 358 + -353. Solve -2l + 7 = rl for l. 1 Let s(o) = -o3 - 1. Let f be s(-1). Suppose -2k + 4k = 5n + 31, f = 4k - 3n - 41. Let q be k/(-44) + (-24)/(-11). Solve 3 - q = u for u. 1 Let x be (-34)/255 - (-2644)/30. Solve 0 = -3y + 91 - x for y. 1 Suppose -4z - z = -l - 23, 2l = 4z - 22. Solve zp = -0p - 12 for p. -3 Let y = -34 + 25. Let q(s) = 3s + 31. Let b be q(y). Let f = 11 + -8. Solve -16 + b = fm for m. -4 Suppose 6 = -2l + 5l. Let n(m) be the third derivative of -m*6/120 - 11m*5/60 - 5m4/12 + m3 - 12m2. Let h be n(-10). Solve -lg - h = -4g for g. 3 Suppose -p - 18 = -22. Suppose -3o + po = -5z + 9, -3z - 4o = -2. Solve w + 12 = -zw for w. -4 Let j(i) = -15i + 3i - 4 + 0. Let a be j(-5). Suppose k + 3k = a. Solve -5p - k = 11 for p. -5 Suppose 5p + 28 = c + 9p, 0 = -2c - 4p + 36. Solve 0 = -2v - 6 + c for v. 1 Suppose -4y - 20 = -4, -4y + 44 = -3h. Let l = 21 + h. Solve 8 + l = 3i for i. 3 Let r be (-1356)/(-226) - (5 - (1 - 0)). Solve -l = -rl + 4 for l. 4 Let j(m) = -m3 + 15m*2 + 17m - 12. Let i be j(16). Suppose -d - 6 = -3d. Suppose -du = -3b - 15, -2b + 10 = iu - 4b. Solve 0 = -2x - u + 10 for x. 5 Let z = 505 + -490. Solve -z = -4o - o for o. 3 Let t = -635 + 635. Solve -76a + 74a + 2 = t for a. 1 Suppose 0 = 4v - 2v - 4p - 44, 0 = -3p - 6. Let x = 22 - v. Solve 5 = -xn - n for n. -1 Let v(d) = d - 16. Let p be v(14). Let u be (-3 - (3 - 6))/p. Suppose 0 = 11g - 15g + 12. Solve ui = gi for i. 0 Let v(i) = 2i*2 - 8i - 3. Let h(q) = -3q2 + 8q + 4. Let f(l) = 3h(l) + 4v(l). Let m be f(-8). Let x be 100/(-6)30/(-25). Solve m = -4u - u + x for u. 4 Suppose 275y = 239y + 2340. Solve 0 = 19t - 6t + y for t. -5 Let v(k) = 7k2 + 15k + 1. Let n be v(-4). Let a = 53 - n. Solve 3p + 6 = -a for p. -2 Let o = 17 - 15. Suppose -m - om - 8 = 2r, 2m - 12 = 3r. Solve 3n = -mn - 9 for n. -3 Let x be ((-8)/16)/((-1)/(-6)). Let z be 0 + (6/x - -3). Let o = 0 + z. Solve -2 = -c - o for c. 1 Suppose 5 = 5q - 10. Let u be (35/7)/((-1)/14). Let n be (u/25 - -2)15/(-6). Solve qg - 10 = n for g. 4 Let n(x) be the second derivative of x*4/12 - 11x*3/6 - 9x*2/2 + 3x. Let w be n(12). Solve -wl - 9 = -0l for l. -3 Let p(x) = -x*2 + 7x - 5. Let z be p(4). Suppose 24t + 399 = 5t. Let y be (z/t)/(2/(-18)). Solve 0 = -0h - yh for h. 0 Suppose 8t - 7t + 1 = 0. Let h be (t - (-22)/18) + 592/333. Solve -2m - hm + 16 = 0 for m. 4 Suppose 104 = k - 52. Let s = -156 + k. Suppose 3x = 2x + 4. Solve s = -xq - 2 - 10 for q. -3 Suppose -9h + 7h + 32 = 0. Let b = -9 + h. Let d be 2/40 + 1. Solve 2l - b = -d for l. 3 Let t = -27 + -11. Let c = -36 - t. Solve c = -q - 0q for q. -2 Suppose -2n = 21n - 46. Solve 5 = c + n for c. 3 Let u(q) = -29q - 23q + 49q. Let c be u(-6). Solve -c = -3y - 6 for y. 4 Let f(v) = 7v2 - 70v + 3. Let c be f(10). Solve -cw + 18 = 3 for w. 5 Let l(u) = u2 - 4u + 3. Let w be l(4). Solve wh = -8 - 4 for h. -4 Let u = 7 - 7. Suppose 6z - 30 = -uz. Solve h + 4h = z for h. 1 Let n be (-4 - 172)/(-8) + 5. Solve -nc = -29c - 6 for c. -3 Let s be ((-4)/6)/(3/(-36)). Suppose -s - 4 = -2c. Let p = 6 - c. Solve 0 = 4b - pb - 16 for b. 4 Suppose r = 5b + 15, 3r = 4r - 2b - 6. Solve -v = -rv for v. 0 Let y = 777 + -773. Solve -1 - 11 = -yq for q. 3 Let g = 4 - 2. Suppose 17 = gt - 3. Solve -t = -3k + k for k. 5 Let o be (1/2)/((-1)/2). Let f = 5 + o. Suppose -3n = -f - 2. Solve -2 = -2h + n for h. 2 Suppose -4t - 4m + 76 = -128, 4m = 5t - 282. Solve 20p = -26 - t for p. -4 Suppose -k - 2k = 15. Let b be (-52)/(-65)k/(-2). Let w = 51 + -26. Solve -bi + w = 3i for i. 5 Suppose 2y - 3 - 1 = 0. Let o(x) = xy - 5x*3 + 4x*3 - 6x*2 + 0x*3 - 7 - 2x. Let l be o(-5). Solve ls = 2s - 2 for s. -2 Suppose 2j + 7 = 3x, -2j - 2x + 9 + 9 = 0. Suppose -y = -5b + 15, 4b + 3y - 11 = jy. Solve -q = 3q + b for q. -1 Let q = -910 + 919. Solve qw = 11w - 6 for w. 3 Let h(c) = c2 + 8c + 8. Let o be h(-8). Let y = -40 - -42. Suppose -3g - 15 = -a, 3a + 2a = yg + 23. Solve -ad = -od for d. 0 Suppose -5a = r - 20, 4r = 4a - a - 12. Solve 8o - 3o = r for o. 0 Suppose -4b + 5a = -144, -4b + 11 + 133 =	{ "pile_set_name": "DM Mathematics" }
tive of -a*4/6 + 2a. What is j(q(z))? -2z4 Let w(r) = 6r*2 + 3r. Let d(z) = 0z - 3z - 3z - z2 + 6z. Determine w(d(p)). 6p4 - 3p2 Let m(g) = g2. Let o(c) = -158c + 2. Let j(x) = 159x - 2. Let v(r) = -4j(r) - 3o(r). Calculate m(v(i)). 26244i2 - 648i + 4 Let o(g) = 7128g2 - 7124g*2 - 1 + 1. Let k(x) = -69x. Calculate k(o(f)). -276f2 Let h(c) = c2 + c - 3. Let n(w) = 5w*2 + 3w - 9. Let z(a) = -3h(a) + n(a). Let v(p) = 6p + 3. What is z(v(j))? 72j2 + 72j + 18 Let d(g) = 7g. Let q(a) = -22a*2 + 6a*2 + 6 + 10a*2 - 6a + 10a2. Let k(m) = 8m*2 - 13m + 13. Let t(c) = -6k(c) + 13q(c). Give d(t(f)). 28f2 Let o(h) = -h. Let a(b) = 2b - 73699. Give a(o(n)). -2n - 73699 Let c(x) = 2x. Let l(d) be the second derivative of -d*7/280 + 7d*4/6 + d. Let j(h) be the third derivative of l(h). Determine c(j(v)). -18v*2 Let b(r) = 2638r. Let t(o) = 12o2. Calculate t(b(c)). 83508528c*2 Let q(s) = -2s*2 + s - 1. Let t(w) = -13w*2 + 5w - 35. Let z(o) = 5q(o) - t(o). Let u(y) = 3y*2. What is z(u(k))? 27k*4 + 30 Let m(g) = 22g*2. Let j(d) = -10601d. Calculate j(m(f)). -233222f2 Let z be -1 + -2 + 2 + 3. Let p(f) = 2 + 9f - z - 13f. Let u(r) be the third derivative of r5/30 - r2. Give p(u(x)). -8x*2 Let o = 62 - 60. Let g(y) = -788 + 788 - 6yo. Let z(q) = -q2 - q*2 + 0q*2. Give g(z(x)). -24x4 Let d(b) = -b2. Let i(o) = 91o - 3. Let l(y) = 3366y - 110. Let s(v) = 220i(v) - 6l(v). Calculate d(s(p)). -30976p2 Let y(h) = -6h*2. Let z(q) = -22q*2 + 6q - 6. Let o(b) = 23b2 - 5b + 5. Let p(g) = 6o(g) + 5z(g). Calculate y(p(k)). -4704k4 Let j(h) = h - 8. Let c(v) = -14v + 4. Let y(o) = c(o) + 12j(o). Let u(p) = 5p*2. Calculate u(y(z)). 20z*2 + 1840z + 42320 Let h be (-46)/6 - 2/(-3). Let d(s) = -3s - 4. Let v(a) = -6a - 7. Let m(c) = hd(c) + 4v(c). Let b(j) = -8j2. What is m(b(z))? 24z*2 Let f(y) = -172y*2 + 35. Let k(u) = -246u. Give f(k(t)). -10408752t2 + 35 Let v(a) = a. Let y be v(2). Let x(u) = -3u*2 + 0u*y + 0u*2 - 2u2. Let b(c) be the third derivative of c4/12 - 29c2 + 2. Calculate x(b(d)). -20d2 Let o(u) = u. Let t(n) be the second derivative of n4/3 + 19n2/2 - 16n. Let l(c) be the first derivative of t(c). Give l(o(a)). 8a Suppose -v + 9 = -0v. Let a(w) = vw - 5w - 3w - 6w. Let g(x) = 2x. What is a(g(q))? -10q Let k(a) = -11a2. Let c(w) = w + 195. Give k(c(r)). -11r*2 - 4290r - 418275 Let j(o) = 8o2. Let d(s) be the second derivative of 5s*3/2 - s + 18. Determine d(j(h)). 120h*2 Let x(z) = -17z*2. Let b(h) = -53h*2 + 3h + 164. Calculate b(x(d)). -15317d4 - 51d*2 + 164 Let u(p) = -3p. Let a(o) = -145o - 1. Calculate u(a(m)). 435m + 3 Let b = -13 + 15. Let f(u) = -bu - 2u - u + 3u. Let s(y) = -y2 + y. Let q(w) = 4w*2 - 6w. Let g(k) = -q(k) - 6s(k). Give g(f(x)). 8x*2 Suppose 6z - 17 = 49. Let p(v) = -5v - zv - 5v + 9v. Let n(j) = -j*2. Determine p(n(w)). 12w*2 Let y(p) = 3p - 12p + 8p. Let h(c) be the second derivative of -2c5/15 - 2c*2 - 5c. Let b(x) be the first derivative of h(x). What is y(b(j))? 8j2 Let i(b) = b. Let p be 3((-1)/(-3)-8 + 2). Let r(j) = -4j. Let h = -13 + 6. Let s(y) = y. Let l(c) = hs(c) + pr(c). Determine i(l(a)). a Let y(n) = 1892n + 7. Let p(q) = 5q. Give p(y(v)). 9460v + 35 Let t(p) be the second derivative of -6p + 0 + 0p2 - 1/3p*3. Let h(v) = -4v*2. What is t(h(a))? 8a*2 Let p(v) = -2v. Let d(x) = -2x - 1163738. What is p(d(i))? 4i + 2327476 Let b(t) = 7t. Let u(d) = -51d + 107. Let y(f) = -22f + 53. Let j(s) = 3u(s) - 7y(s). Calculate j(b(r)). 7r - 50 Let j(g) be the third derivative of -g*4/3 + 3g*2 + 8g. Let c(f) be the first derivative of f*2/2 - 4. What is j(c(s))? -8s Let a(k) = k*2. Let o = 212 + -194. Let i(x) be the second derivative of -37x*3/6 - x. Let v(n) = -9n. Let u(h) = ov(h) - 4i(h). What is a(u(d))? 196d2 Let f(p) = -3p*2. Let c(n) = -200n - 196n + 601n - 195n. What is c(f(g))? -30g2 Let h(g) = -g2. Let a(t) = -109t - 23t*2 + 21t*2 + 89t. Determine h(a(d)). -4d4 - 80d*3 - 400d2 Let p(a) = a2 - 31. Let d(q) = -554q. Calculate p(d(o)). 306916o*2 - 31 Let v(f) = -4f*2. Let o = 53 - 50. Let q(g) = -4g*2 - 3g*2 - 3g*2 + og*2. Give v(q(b)). -196b*4 Let l(p) = -p. Let x(i) be the second derivative of 5i*4/12 + 20i*2 - 2i + 339. What is x(l(t))? 5t2 + 40 Let h(o) = o - 18. Let v(d) be the second derivative of -d3/6 + 27d. Give h(v(p)). -p - 18 Let o(h) = 4h2. Let i(f) = -186f*2 - 120f + 2. Determine i(o(s)). -2976s4 - 480s*2 + 2 Let v(c) = -17c. Let a = -25 - -47. Let t(y) = -2y - 3. Let p(h) = -7h - 11. Let n(g) = at(g) - 6p(g). Determine v(n(u)). 34u Let n(l) = 905l + 1. Let o(y) = -12087 + y + 12087. Determine n(o(a)). 905a + 1 Let a(m) = -32m - 5. Let h(x) = -47x - 7. Let w(k) = -7a(k) + 5h(k). Let i = 6 + -4. Let j(f) = f2 - 4f2 + fi. What is j(w(c))? -242c2 Let j = 4 + -11. Let z(m) = -5m - 2. Let h be z(j). Let b(p) = -2p2 + h - 33. Let o(s) = -2s. Calculate b(o(u)). -8u2 Let c(g) = 11g + 2. Let f(v) = -60v - 11. Let z(l) = -33c(l) - 6f(l). Let d(h) = 8h + 2. Determine z(d(m)). -24m - 6 Let b(h) = -34h*2. Let w(k) = -32k. Let f(c) = 44c. Let x(d) = -3f(d) - 4w(d). Give b(x(p)). -544p*2 Let o(g) = -g. Let v(a) = 14a*2 + 4a + 10. Let u(h) = 30h2 + 9h + 21. Let p(w) = 4u(w) - 9v(w). What is p(o(f))? -6f2 - 6 Let y(n) be the second derivative of n4/6 - 5n + 45. Let d(f) = 1016f. Calculate y(d(z)). 2064512z*2 Let x(l) = -6l - 3 + 7l + 4 - 1. Let n(d) = 283d*2. What is n(x(g))? 283g*2 Let j(v) = -v + 0 + 1 - 1. Let h(c) be the third derivative of 7c*5/20 + 6c*2. What is h(j(p))? 21p2 Let y(z) = -z2. Let b(g) = -g - 8688. Calculate y(b(i)). -i*2 - 17376i - 75481344 Let y(o) = -8o + 29. Let x(h) be the third derivative of 11h*4/12 - 29h*3/2 + 3h*2 - 3. Let u(f) = -3x(f) - 8y(f). Let i(l) = -2l. Give u(i(p)). 4p + 29 Let y(i) be the third derivative of i4/24 - 7i*2. Let b be (2 + 1 + -5)-1. Let v(u) = bu2 + 8u2 - u2. Give y(v(n)). 9n2 Let f(u) = u2. Let m(h) = -11h. Let s(t) = -12t. Let k(l) = 3m(l) - 4s(l). Let i(b) = 16b. Let p(c) = 5i(c) - 6k(c). What is p(f(n))? -10n2 Let i(a) = 263a*2 - 140a*2 - 139a*2 + 2. Let g(f) = -2f*2. Give i(g(y)). -64y4 + 2 Let k(l) be the second derivative of -l4/3 + 17l + 11. Let o(d) = -118d*2. Give k(o(q)). -55696q*4 Let f = 14 - 22. Let q = f - -10. Let s(o) = -o - qo + o. Let m(r) = r. Give s(m(c)). -2c Let i(z) = 4z2. Let k(r) be the second derivative of r3/2 - 33r2/2 - 113r. Give k(i(a)). 12a2 - 33 Let q(b) = 11b. Let h(l) = -15l2 + 9. Let d(f) = -7f*2 + 4. Let t(v) = -9d(v) + 4h(v). What is t(q(k))? 363k*2 Suppose -33o + 60 = 60. Let b(j) be the third derivative of oj3 + 0j + 0j4 + 0 + 6j*2 - 3/20j*5. Let a(d) = 3d. What is a(b(l))? -27l2 Let l(b) = 0b + 3b - b - 3b. Let s(y) = -7y2 + 16y - 16y. Determine s(l(a)). -7a*2 Let w(y) = -15y*2. Let o(b) = -13b*2 + 4b*2 + 0b*2 + 7b*2 + 33b*2. Give o(w(r)). 6975r*4 Suppose 5a - 6a + 27 = 0. Let m(i) = -16i - 15i + ai. Let u(f) = -4f. Give u(m(k)). 16k Let h(q) = -3q + 5. Let p(i) = 6i. Let a(u) = 2u. Let j(f) = 4a(f) - p(f). What is h(j(z))? -6z + 5 Let f(r) = -2r. Let o be (0 + -1)0/(4 - -4). Let y(q) be the second derivative of 1/6q*3 + 5q + 0 + oq2. What is y(f(n))? -2n Let h(j) = 5j2. Let u(d) = d. Let z(x) = -x. Let t be 2 - (-2 - (3 + -2)). Let a = 18 + -12. Let y(f) = au(f) + tz(f). What is h(y(p))? 5p*2 Let s(a) = 6a*2 + 218a + 4a2 - 218a - 6a2. Let v(c) = 20c*2. What is s(v(p))? 1600p*4 Let d(i) = 5i*2. Let u(v) = 2v + 13919. Determine d(u(j)). 20j2 + 278380j + 968692805 Let h(l) = -78l. Let i(f) = 8135f. Give h(i(n)). -634530n Let b(z) = -7z. Let f(i) = 292i + 36. What is b(f(a))? -2044a - 252 Let r(t) = -13t - 2. Let x(m) = -m + 9117. Determine x(r(d)). 13d + 9119 Let u(q) = -q*2 - 7865q. Let c(v) = 9v. Determine u(c(t)). -81t*2 - 70785	{ "pile_set_name": "DM Mathematics" }
, 16, 46, 98, 178? 292 What is the next term in 0, 10, 26, 48, 76, 110? 150 What is next in -78, -151, -222, -291, -358, -423? -486 What is the next term in -78, -74, -72, -72, -74, -78? -84 What comes next: 2445, 4904, 7377, 9870, 12389, 14940? 17529 What comes next: 472, 482, 506, 550, 620, 722? 862 What comes next: -23, -9, 3, 13, 21, 27, 31? 33 What is next in 326, 315, 288, 239, 162? 51 What is the next term in -60, -83, -116, -165, -236, -335? -468 What comes next: 38, 40, 50, 74, 118, 188, 290? 430 What is next in 43, 66, 97, 136, 183? 238 What comes next: -310, -112, 88, 290? 494 What is next in 126, 133, 150, 183, 238, 321, 438? 595 What is next in 32, 121, 372, 869, 1696, 2937? 4676 What comes next: 27, 30, 31, 30, 27? 22 What is the next term in 47, 62, 77, 92, 107? 122 What is next in 9, -16, -69, -162, -307, -516, -801? -1174 What comes next: -30, -31, -32, -33, -34? -35 What is the next term in -5882, -11767, -17652, -23537? -29422 What comes next: 63, 90, 129, 174, 219? 258 What is next in -2, -7, -16, -29? -46 What comes next: 1519, 1520, 1521, 1522, 1523, 1524? 1525 What is next in -9804, -19609, -29414, -39219, -49024, -58829? -68634 What is the next term in -1813, -1804, -1783, -1744, -1681, -1588, -1459? -1288 What is next in 92, 197, 314, 449, 608, 797, 1022, 1289? 1604 What is next in -15, -41, -67, -93, -119, -145? -171 What comes next: 13, -2, -29, -68, -119, -182? -257 What is the next term in 464, 465, 466? 467 What is the next term in 140, 272, 404, 536, 668? 800 What is the next term in -13669, -13676, -13687, -13702? -13721 What comes next: 255, 274, 313, 378, 475, 610, 789? 1018 What comes next: 8814, 8815, 8816, 8817, 8818? 8819 What is the next term in 87, 156, 215, 258, 279, 272, 231, 150? 23 What is next in 497, 1041, 1585? 2129 What is next in -68, -66, -64? -62 What is next in 53, 54, 55, 56? 57 What is the next term in 3874, 7745, 11616, 15487, 19358, 23229? 27100 What is the next term in 200, 414, 640, 884, 1152? 1450 What comes next: 7, 3, -1, -5? -9 What comes next: -2279, -2276, -2277, -2288, -2315, -2364, -2441, -2552? -2703 What is next in 14, 27, 44, 65, 90, 119, 152? 189 What is the next term in -94, -92, -90, -88, -86, -84? -82 What comes next: -21, -29, -35, -39? -41 What is next in -5, -10, -17, -26, -37? -50 What comes next: 52, 135, 264, 433, 636, 867, 1120? 1389 What is next in 316, 327, 362, 433, 552, 731, 982? 1317 What is next in 5026, 5027, 5028? 5029 What is the next term in 11, 15, 23, 41, 75, 131, 215, 333? 491 What is next in 548, 560, 586, 632, 704, 808, 950, 1136? 1372 What is next in -37, -128, -295, -550, -905, -1372? -1963 What comes next: 21, 17, 13, 9, 5, 1? -3 What is the next term in 20, 36, 44, 38, 12, -40? -124 What comes next: -456, -457, -458, -459? -460 What is next in 1974, 1972, 1970? 1968 What is next in -614, -2434, -5468, -9716, -15178, -21854? -29744 What comes next: 1134, 2276, 3424, 4578, 5738? 6904 What is next in -39, -70, -79, -54, 17, 146, 345, 626? 1001 What is next in 9, 7, 3, -3, -11? -21 What comes next: 124, 133, 142, 151, 160? 169 What comes next: -854, -862, -870, -878, -886? -894 What comes next: -1901, -1907, -1915, -1925? -1937 What is the next term in 721, 1424, 2127, 2830, 3533? 4236 What is next in -37, 85, 295, 599, 1003, 1513, 2135, 2875? 3739 What comes next: 796, 799, 802, 805, 808? 811 What is the next term in 4, -3, -10, -17, -24? -31 What comes next: -25229, -25217, -25191, -25145, -25073, -24969, -24827? -24641 What is next in 9, 9, 7, 3, -3, -11? -21 What is the next term in -50, -350, -1132, -2636, -5102, -8770, -13880? -20672 What is next in -2768, -5534, -8300, -11066, -13832, -16598? -19364 What is next in 2, 0, -6, -16, -30, -48? -70 What comes next: 557, 622, 687, 752? 817 What is the next term in 35, 73, 111, 149? 187 What is the next term in -68, -228, -498, -884, -1392, -2028? -2798 What is the next term in 237, 485, 733, 981, 1229? 1477 What is the next term in 135, 253, 349, 411, 427, 385, 273, 79? -209 What comes next: -74, -57, -30, 7, 54, 111? 178 What is next in 39, 90, 151, 228, 327? 454 What is next in 5841, 5846, 5855, 5868? 5885 What is the next term in -1344, -2691, -4038, -5385, -6732? -8079 What is next in -57, -61, -69, -81, -97, -117? -141 What is the next term in -52, -73, -90, -103, -112? -117 What comes next: -146, -291, -436, -581, -726, -871? -1016 What is next in -175, -196, -217, -238, -259? -280 What comes next: 32, -72, -162, -232, -276? -288 What is next in 726, 742, 748, 738, 706, 646, 552, 418? 238 What comes next: 34, 55, 92, 151, 238, 359, 520, 727? 986 What is the next term in -4, -5, 2, 23, 64, 131, 230? 367 What is the next term in 13, 64, 199, 460, 889, 1528, 2419? 3604 What comes next: -3, -2, -1, 0, 1? 2 What is the next term in 405, 818, 1231, 1644, 2057? 2470 What is next in 31, 55, 95, 151, 223, 311, 415? 535 What is next in -336, -333, -330, -327, -324? -321 What is next in 136, 139, 160, 211, 304, 451, 664? 955 What is the next term in 30, 58, 72, 66, 34? -30 What is the next term in 7798, 15595, 23390, 31183, 38974, 46763? 54550 What is next in 9, 18, 41, 84, 153? 254 What is the next term in 35, 37, 29, 5, -41, -115, -223, -371? -565 What comes next: -4, -107, -210, -313, -416? -519 What is the next term in -295, -591, -887, -1183? -1479 What is the next term in 21601, 21610, 21633, 21676, 21745? 21846 What is next in -104, -96, -88, -80, -72? -64 What comes next: 6, -9, -24, -39, -54, -69? -84 What is the next term in 132, 200, 254, 288, 296, 272, 210, 104? -52 What is the next term in 54, 196, 426, 738, 1126? 1584 What is next in -213, -211, -209, -207, -205, -203? -201 What comes next: -63, -135, -211, -291, -375, -463? -555 What comes next: -7798, -15599, -23400? -31201 What is the next term in -3, -27, -99, -243, -483, -843, -1347? -2019 What is next in -46, -101, -136, -139, -98, -1? 164 What is the next term in 1309, 1182, 1065, 964, 885, 834? 817 What is next in -122, -249, -386, -539, -714, -917, -1154? -1431 What is next in -84, -129, -186, -261, -360, -489, -654? -861 What comes next: -15, -15, -3, 27, 81, 165, 285? 447 What comes next: -394, -387, -404, -457, -558, -719, -952, -1269? -1682 What is next in -4193, -8382, -12571, -16760, -20949, -25138? -29327 What is the next term in 8, 8, 4, -4? -16 What is next in -3097, -3096, -3095, -3094, -3093, -3092? -3091 What comes next: 854, 857, 862, 869, 878? 889 What is the next term in -198, -774, -1734, -3078, -4806, -6918? -9414 What comes next: -11603, -11600, -11597? -11594 What comes next: -76, -122, -226, -412, -704? -1126 What is next in -67, -59, -51, -43? -35 What is next in 79, 74, 69? 64 What comes next: 1235, 1252, 1303, 1406, 1579, 1840, 2207? 2698 What is next in 9, -8, -33, -66, -107, -156? -213 What comes next: 36, 64, 92? 120 What is the next term in -548, -1084, -1620, -2156? -2692 What is next in -45, -40, -31, -18? -1 What is the next term in 106, 125, 164, 229, 326? 461 What is the next term in -133, -268, -401, -532, -661, -788, -913? -1036 What comes next: -58, -212, -468, -826, -1286? -1848 What comes next: -21, -40, -47, -36, -1? 64 What comes next: -2034, -2008, -1958, -1878, -1762? -1604 What is next in -50, -100, -150, -200, -250? -300 What is the next term in 81, 162, 245, 330? 417 What comes next: -846, -843, -840, -837? -834 What comes next: -17, -20, -23, -26, -29, -32? -35 What is the next term in 503, 1016, 1545, 2096, 2675? 3288 What comes next: -12, -50, -114, -204, -320? -462 What is the next term in 9011, 9012, 9013? 9014 What is the next term in 1831, 3665, 5499, 7333, 9167, 11001? 12835 What comes next: -151, -149, -147, -145, -143, -141? -139 What is next in -9, -22, -51, -102, -181? -294 What is next in -8, 3, 14? 25 What comes next: 581, 1148, 1705, 2246, 2765, 3256? 3713 What is the next term in -205, -203, -201? -199 What is the next term in -66, -59, -50, -39? -26 What is the next term in 223, 225, 227, 229, 231, 233? 235 What comes next: -38, -67, -96? -125 What is the next term in -13, -21, -29, -37? -45 What is next in 239, 417, 713, 1127, 1659, 2309? 3077 What is the next term in 18, 66, 208, 492, 966, 1678, 2676, 4008? 5722 What comes next: -813, -816, -819? -822 What is next	{ "pile_set_name": "DM Mathematics" }
3 Let l = 27 + -1. Let o = -68 + 21. Let v = -41 - o. Solve -5p - v = -l for p. 4 Let b(i) = 30i + 4480. Let c be b(-149). Solve 11u = cu + 8 for u. 8 Let o(x) = -6x + 56. Let m be o(9). Suppose -2a + 5c = -22, a + 3c = -mc - 4. Solve -2 - a = 4h for h. -2 Let o(b) = b + 27. Let d be o(5). Let n be ((-20)/(-11))/(d/176). Solve -6g - n = -g for g. -2 Let n be 100-1-1(-5)/(-20). Suppose 7i + n = 53. Let y = -1 + 1. Solve ih - 2h - 10 = y for h. 5 Let r be (-12)/(-96)-8 + 24. Solve 37u + 14 = ru for u. -1 Let o = -48 + 52. Suppose oh + 13 = 5t + 3h, 4t - 2 = 5h. Solve 4l + 17 + t = 0 for l. -5 Let i be (9/(-6) + 1)/((-3)/72). Let n(c) = -c*2 + 14c - 16. Let b be n(i). Suppose -f = b - 11. Solve -l + fl = -2 for l. -1 Let u be (-1212)/(-29694) - 2399/(-49). Solve -7y - 35 = -u for y. 2 Let m(f) = 25f2 - f - 1. Let z be m(-1). Let h = z + -24. Let n be (-2 - -3) + h - (4 + -2). Solve d + 3d - 20 = n for d. 5 Let c be (39/18)/((-8)/(-48)). Solve -8a - 35 = -ca for a. 7 Suppose -123f + 12f = -12765. Solve 43v - 57 = f for v. 4 Let b be 500/(-40)(-18)/27(4 + -1). Solve 8 = bj - 67 for j. 3 Suppose 45761 = 160g - 2879. Solve gv - 302v = -10 for v. -5 Suppose -18p - 13p = -p. Suppose -3o + 24 = 3g, -g - 23 = -5g - o. Suppose gn + 4 = 14. Solve nw - 5w + 3 = p for w. 1 Let j(b) = -69b + 6. Let i be j(-1). Suppose u = 4t + 32, 5t = -3u + 6u - i. Suppose -3d + 15 = 5x, u = 2d + 2d. Solve -3c - 3 = -x for c. -1 Suppose 0 = -2y - 2s + 82, -265 = 47y - s - 2000. Solve -yi - 32 = -32 for i. 0 Let t(u) = -22u + 12u + 135 + 26 + 44 - 14u. Let f be t(7). Solve f = 8g + 5 for g. 4 Let x = -29430 + 30789. Solve -5m - x = -1379 for m. 4 Suppose 27j - 7268 = -19j. Let w = 158 - j. Solve -14p + 11p - 15 = w for p. -5 Let k be (55 - 5) + 5 + 0. Solve 156v - 167v = -k for v. 5 Suppose 3h = 7h - 5i - 5, 2h - 3i = 1. Suppose 5p - 3k - 2 = 49, p = -hk + 27. Solve -2 = 2o - p for o. 5 Let u be 55/(-10) + 372/8. Solve -n - 10n = -u for n. 4 Let k be ((-45)/27)/(1/(-129)). Let b = -215 + k. Solve b = -2l - l for l. 0 Suppose f + 3 = 2f. Suppose -21a = 46a - 134. Suppose 3b = av - 59, 12v + 90 = 15v - 5b. Solve -fp - 2p = v for p. -5 Suppose -94 = -12s - 334. Let q be 21/18(-2 - s). Solve 0 = -j - q + 22 for j. 1 Suppose 2u - k = -554, -2u + 5k - 278 = 268. Let o = -247 - u. Solve -8 = -ol + 33l for l. -4 Let y(p) = -p3 + 15p*2 - 16p + 38. Suppose -8x - 15 + 127 = 0. Let l be y(x). Solve -3t = 2t - l for t. 2 Let i(g) = 54g - 695. Let b be i(13). Solve 0 = -bs + 9s - 4 for s. 2 Suppose 4f + d - 20 = 0, -4f + 10d = 6d - 40. Suppose -u - 4c + 2 = -c, 5c = 4u - 25. Suppose -8 = -us + 7. Solve fz + 9 = sz for z. -3 Suppose 75s = 4499 + 6601. Solve -8l + 188 = s for l. 5 Let j = 408 + -199. Let w = 211 - j. Let y be (2 - -4)(3 + -2). Solve -y + w = 2n for n. -2 Let o = 4943 - 4642. Solve -o = -94d - 19 for d. 3 Suppose 2 = 3p - 10. Suppose 2g - g + 11 = -pm, -g = m - 1. Solve 0 = -0k - gk - 10 for k. -2 Let z = -17196 - -17356. Solve -171y + 77 = -zy for y. 7 Suppose 3g + i = -0g + 14, 5g + 2i - 23 = 0. Suppose 0 = 4p + 5y - 5, -gp + 4y = -0 + 4. Let o be (p + 0)3/6. Solve o + 12 = -3l for l. -4 Let j(n) = -n + 2. Let z be j(0). Suppose 5 = 139m - 142m + l, 5 = 2m + l. Suppose 4a + 20 = zq, ma - 10 = -q - 4a. Solve -w + 3w + q = 0 for w. -5 Let u = -12900 + 12905. Solve 44 - 34 = ux for x. 2 Let k(o) = 49o + 117. Let x(l) = -47l - 117. Let m(h) = -6k(h) - 7x(h). Let b be m(-3). Solve -3i + b = i for i. 3 Suppose 0 = -3a + 3n + 306, 3a - 140 - 166 = -n. Suppose 6x - 6 = a. Let s be x/(-1)(-1)/3. Solve -2d = -4d - s for d. -3 Let i = -2716 - -5337. Solve -8y - i + 2661 = 0 for y. 5 Suppose 5h = 6h + 4. Let a be (48/4)/((-6)/h). Let k = a + -4. Solve 0s = -2s + k for s. 2 Let j be -6 + -2(28/(-8) + 3). Let x be 2(4/j)/((-14)/35). Suppose -5i = -29 + x. Solve -4g = -7 - i for g. 3 Suppose 2t = w - 145, -91t + 688 = 4w - 87t. Solve -167q + wq + 36 = 0 for q. 9 Let z(k) be the third derivative of -5k4/4 + k3 - 4k*2. Let o be z(1). Let r = -21 - o. Solve -rx = -2x for x. 0 Let b(s) = -2425s + 4. Let i be b(0). Suppose -5p + 4 + 26 = 0. Solve 0 = ph - i - 2 for h. 1 Suppose -4c = 5z - 66, -26c - 3 = -29c + 4z. Solve -cn = -15n for n. 0 Suppose 0j - 2 = 2j, -3i + 19 = 2j. Suppose -g + 42 = -ig. Let b(o) = -o - 3. Let w be b(g). Solve -x = x + w for x. -2 Let k(b) = b*2 - 3b + 20. Let z be (3/1 + -3)/(-4 - -8). Let x be k(z). Solve 2c + 3c + x = 0 for c. -4 Suppose 0 = 2x - 3m - 71, 0 = 135x - 130x + 4m - 120. Solve xq - 165 = -5q for q. 5 Let o(c) = -5c - 37. Let d be o(-9). Let a be 2/d3(-440)/(-66). Solve at + 31 = 6 for t. -5 Suppose -o = -3m - m - 25, -100 = -5o - 5m. Suppose 3k - 3 + o = 3h, 0 = 2h - 3k - 15. Solve 21 = -hs + 36 for s. 5 Let q(t) = -t3 + 42t*2 - 5t - 114. Let y be q(42). Let a be y/(-243) + (-8)/6. Solve -16n + 19n = a for n. 0 Suppose -43509 = -72r + 8475. Solve -21y - r = -575 for y. -7 Suppose -2c + 0 + 6 = -j, 0 = 5j + 3c - 35. Let b be (0 - j/12)0. Suppose -3r + 15 = -b. Solve -rp = -p for p. 0 Suppose -3v + 6v - 2y = 18, -3y - 1 = 2v. Let u(s) = -s2 - 17s - 65. Let b be (-155)/15 + 2/6. Let w be u(b). Solve vz + 5 = wz for z. 5 Suppose 2x + 5k = 23, k + k - 14 = 4x. Let f be 32/(-48)(x - 8). Solve 4d - 7d = -f for d. 2 Suppose 6c + 7 = 19. Suppose 3r - 3 + 2 = cb, -5b = 3r - 29. Suppose v - 3 = 0, 5j + 4 + 0 = 3v. Solve -bo = 3 + j for o. -1 Suppose -171m - 9880 = -301m. Solve -s + m = 79 for s. -3 Let y(u) = -7u2 + 39u + 14. Let g be y(6). Let s be 74/14 + g + 234/63. Solve 11 - 6 = -sl for l. -1 Let k be (3 - -2) + (3 - -1)1. Let f be ((-4)/k)/((-38)/(-95))-9. Solve -3y = -1 + f for y. -3 Let n(w) = 4w2 - 93w + 392. Let m be n(18). Solve 411 - 481 = -mi for i. 5 Suppose 0 = 5p - 25, -4d + 453 = -2p + 463. Solve 7u + 5u - 6u = d for u. 0 Let w(d) = -d3 + 10d*2 - 9d + 4. Let m be w(8). Let x be (480/128)/(9/m). Suppose 5a + 2 - 20 = -2u, 4 = 2a. Solve -k - uk + x = 0 for k. 5 Let s be 14/(-35) + 8/30 - 910/(-75). Solve -s = 7a + 9 for a. -3 Let r = 110 - 186. Let l = 70 + r. Let x be (1 + (-8)/4)l/3. Solve xm + 5 - 13 = 0 for m. 4 Let s(q) = 2q*2 - 6q + 4. Suppose -7j - 49 + 70 = 0. Let o be s(j). Solve 0 = -on + 5 + 11 for n. 4 Let d = -261 + 268. Suppose -2a + 0h = -5h - d, 3h - 3 = 0. Solve 1 - a = 5v for v. -1 Suppose -j + 20 = 3p, -10j = 3p - 13j. Suppose -pw = 99 - 159. Solve -r + w = 3r for r. 3 Suppose -3f + 252 = -2f. Suppose -u + f = -2u. Let j be (-1)/(-4) - u/16. Solve -j = l - 5l for l. 4 Let v be ((-73224)/810 - 11/(-1))-5. Solve -vk = -404k + 49 for k. 7 Suppose -z - 5b = -49, -24 = -2z + 5b - 1. Let p be 3(z/42)/(12/14). Let i be (1 + -3)/20. Solve ig = -pg - 6 for g. -3 Let z = -5860 + 5873. Solve 31f = zf - 108 for f. -6 Let b = 21 + -19. Let d be (4/6)/(85/(-45) + b). Solve -3 = -3m + d for m. 3 Let t be (3/(-5))/(14/(280/(-6))). Let s be (-2)/30-3 + t/(-10). Solve sa + 2a - 10 = 0 for a. 5 Let r be ((-7)/(7/(-2)))/((-22)/(-33)) - 1. Solve -279x + 280x = r for x. 2 Suppose -s + 4 = l, 5s - 8s = l - 8. Let u be (20/24)/(l/12). Solve -7b - u = -2b for b. -1 Let f = 525 + -517. Suppose -4w = -5h - 32, 6h = w + 4h - f. Solve wa + 45 = 5 for a. -5 Suppose -19u + 25 = 177. Let w be u/(-12)(-3)/1 + 2. Solve -2v = -wv + 4 for v. -2 Let b(n) = 12n3 + 4n*2 + 132n - 409. Let l be b(3). Solve -75j = -l - 28 for j. 5 Let z(t) = 5t*2 - 4t + 5. Let n be z(1). Suppose 5d = -b - 9, -nd + 2d = 12. Let j(h) = -8h - 36. Let y be j(-5). Solve ys - b = 2s for s. 3 Let g(q) = 5q + 5. Let r(l) = -11l - 10. Let o(t) = -9g(t) - 4r(t). Let w be o(-11). Solve -15 = -wj + j for j. 3 Suppose 29 = 5a - f, -3a - 33f = -31f - 20. Let o(s) = -s2 - 7s - 5. Let i be o(-6). Let h = -1 + i. Solve h = 2q - 0q + a for q. -3 Let i = 19481 - 16766. Solve -5g + 2690 - i = 0 for g. -5 Let w(u) = 2u*3 - 2u*2 - u + 4. Let y be w(2). Suppose -212 = -yj - 32. Suppose q + 29 = 4g - j, -3q = g - 2. Sol	{ "pile_set_name": "DM Mathematics" }
third derivative of 19617803q3 + 5467234q*2 wrt q? 117706818 What is the third derivative of mo*3w*2 + 403867mo2w*3 - 4mo2 - 2mow*3 + 4623735o*3w*3 wrt o? 6mw2 + 27742410w*3 What is the second derivative of -127348933o*2z*2 - 18220oz2 + oz - 7z - 5 wrt o? -254697866z*2 What is the third derivative of 7k*5 - 7212k*4 + 521k*3 - 307k*2 - 2k + 3565? 420k2 - 173088k + 3126 Find the third derivative of 2565266c4 - 2c*2 - c + 14144 wrt c. 61566384c Find the first derivative of 98lm*3 + 7656lr3 - 3028649m*3r*3 + mr*3 wrt l. 98m*3 + 7656r*3 Find the first derivative of -24639026x*2 + 12213834. -49278052x Differentiate 60476167k2 - 34601335 wrt k. 120952334k Find the first derivative of 166553257u2 - 92534345 wrt u. 333106514u Differentiate 17df*3t*3 - 3183951dft*3 - 3f*3t*3 - 21462234f*2t*3 with respect to d. 17f*3t*3 - 3183951ft3 What is the second derivative of -790x*5 + 4506x*3 - 91543637x wrt x? -15800x3 + 27036x What is the first derivative of 2c4r - 658c4 + 414c*2r - 17347r - 138 wrt c? 8c*3r - 2632c3 + 828cr What is the third derivative of -96155x*4 + 274x*3 + 410831x*2 + 2x? -2307720x + 1644 What is the third derivative of 469494138u*5 - 3u*2 + 15218u - 333? 28169648280u2 Find the third derivative of -2110141n*6 - 22167187n*2. -253216920n*3 Find the third derivative of -4a*3t*2z*2 + 47668008a*3z*2 - 3a*2t*2z*2 + 3a*2t + 54a2z - 2az*2 + 12664tz2 wrt a. -24t*2z*2 + 286008048z*2 Find the second derivative of 308n*3 + 16339n*2 + 128847591n wrt n. 1848n + 32678 Differentiate i4 + 1129862i + 619135 with respect to i. 4i3 + 1129862 What is the second derivative of -2838461k*4 - 8740451k? -34061532k2 What is the first derivative of -113279n*3u + 3733n3 - 214n*2u + 2u + 551 wrt u? -113279n*3 - 214n*2 + 2 Differentiate -242308v*3w2 - v3 + 2v2 - vw*2 + 43v - 834 with respect to w. -484616v3w - 2vw Find the third derivative of -1622658n5 + 2n*2 + 258926n + 2. -97359480n2 Find the third derivative of -29676323u*2v*3 + 3u*2v*2 + 2u*2v + uv2 - u - 33v*2 - 77 wrt v. -178057938u*2 What is the third derivative of 36a*2x*3 + 3a*2x*2 - 111a*2x - a*2 - 47776ax3 - 859a + 2x2 wrt x? 216a*2 - 286656a What is the third derivative of -24cq*5 + 56860cq3 - 7cq2 + 23cq - 25q*3 - 170849q*2 wrt q? -1440cq2 + 341160c - 150 What is the second derivative of 31556at*3 + at*2 + 281aw2 + 9aw + 55923t*3w3 - t3 wrt w? 562a + 335538t*3w Find the second derivative of -70187712l2 - 70589808l + 1. -140375424 Differentiate 9i2 - 317983i + 12177128 wrt i. 18i - 317983 Find the third derivative of 559802572gq3 - 87gq2 + gq - 4g - 4q*2 + 3q - 269 wrt q. 3358815432g What is the second derivative of -54123t*2v*3 - 11t*2vx2 + tv*3x*2 + tv*3x + 12tvx - 66tv - 2v*2x + 110vx wrt t? -108246v3 - 22vx2 Find the second derivative of -100993320mx2 - 2mx - 4m + x*4 + 951409x - 10 wrt x. -201986640m + 12x*2 What is the second derivative of 144778850m*2 - 60787m + 175 wrt m? 289557700 What is the derivative of -3j4 - 520j*3 - 1217j + 7108896 wrt j? -12j3 - 1560j*2 - 1217 What is the second derivative of -16g*2p*2 + 2723118g*2pq - 3g*2 - 12gp2 + 32gpq - 197gp - gq + 8p*2q - 4pq wrt g? -32p2 + 5446236pq - 6 Find the third derivative of 4470478i*4 + 29984i*2 + i + 6 wrt i. 107291472i Differentiate 100f3 - 63f*2 + 1508f + 167324530. 300f2 - 126f + 1508 Find the third derivative of 93150941t5 + 2455137t*2 + 3t. 5589056460t2 Find the third derivative of 12847023r*3 + 6071362r*2 + 2 wrt r. 77082138 Find the second derivative of -184009247k*2 + 264319588k wrt k. -368018494 Find the third derivative of 316140l6 - 2l*4 + 4744460l*2. 37936800l*3 - 48l What is the third derivative of -1094624x4 - 20x*2 + 22101x wrt x? -26270976x What is the second derivative of 34906671c*3n - 5cn + c - 16n - 1564 wrt c? 209440026cn What is the third derivative of -6349365a*6 + 2a*4 + 420a*2 + 900? -761923800a*3 + 48a What is the third derivative of 13o5 + 1389o*4 - 6o*3 - 2848531o*2? 780o*2 + 33336o - 36 Find the second derivative of 103bl*3 + 5bl2 + 3bl - 2l*3 - 43214l*2 + 37600565l wrt l. 618bl + 10b - 12l - 86428 What is the first derivative of 36ci*2k + 31cik - 79ck - c + 481i*2k - 533i2 wrt c? 36i*2k + 31ik - 79k - 1 What is the second derivative of -23879743g*2 - 10930312g wrt g? -47759486 Find the third derivative of -68o4x*3 + 21545o*4 - 630o*2x*3 + 22096o*2 wrt o. -1632ox3 + 517080o Find the second derivative of 29582677d3k*2l - d*3kl + 10d*3l*2 - 49d*2kl2 + 22d*2l*2 - 3dk2l*2 - 4k wrt k. 59165354d3l - 6dl*2 Find the third derivative of -886830987f*4 + 658501583f*2 wrt f. -21283943688f Find the first derivative of -646893d2 - d - 305671821 wrt d. -1293786d - 1 Find the second derivative of b*2l*2u + 3b2ls2u + 3bs*3u - 91l2s*3 - 50879l*2u + 1485ls*3u + 4l + 6s wrt l. 2b2u - 182s3 - 101758u What is the derivative of -63604068j3 - 63930677 wrt j? -190812204j*2 What is the derivative of -1052c*2m*2 - 960339c2 + c - m2 + 382m wrt m? -2104c*2m - 2m + 382 Differentiate 71668907ijx*2 - 3ix2 - 3933530jx2 + 23j wrt i. 71668907jx*2 - 3x*2 Find the third derivative of 9011538t*3 + 11499t*2 + 301t. 54069228 Find the second derivative of 33431652c4 + 59463360c. 401179824c2 What is the second derivative of -470205751v*3y - 3850vy - 7128v wrt v? -2821234506vy What is the second derivative of 2f*5 - 1167912f*3o*2 - 2f - 13o2 + 16416o - 7 wrt f? 40f3 - 7007472fo2 Find the second derivative of -1492n*3 - 249336n*2 - 659195131n. -8952n - 498672 What is the second derivative of 149710799s*3 - 10s - 958111 wrt s? 898264794s What is the second derivative of z5 + 102625z4 + z2 + 30151446z wrt z? 20z*3 + 1231500z*2 + 2 Differentiate -9307n*3p - 1101np3 - p3 - 332p2 - 5p + 204 wrt n. -27921n2p - 1101p3 Differentiate 5ch3 + 2ch + 8314ct - 49h*3t - 90395h3 + h2 with respect to t. 8314c - 49h3 What is the first derivative of 1343775k*3r - 2574035k3 wrt r? 1343775k*3 What is the derivative of 2359as2 - a + 224s*2 + 19248120 wrt s? 4718as + 448s Find the second derivative of 3r3 + 1909933r*2 - 3115578r - 2 wrt r. 18r + 3819866 What is the second derivative of -27os5w + 183os - 4ow + 54354s5w + 9s + 2w wrt s? -540os*3w + 1087080s3w Find the third derivative of 1824400l4 - 49288l*2 - 48 wrt l. 43785600l Find the first derivative of 95h3x + 11h2 + 2hx - 2808h + 43164768x wrt h. 285h*2x + 22h + 2x - 2808 What is the second derivative of 3t5 + 87t*3 + 10392t*2 - 2t - 16929772? 60t3 + 522t + 20784 What is the second derivative of -84201t3z*4 + 3t*3z + t*2z + 303tz - 4t - 376z*2 + 4z - 6 wrt z? -1010412t3z*2 - 752 Find the second derivative of -257451354j*2 + 39990j + 1684 wrt j. -514902708 Find the second derivative of 11696686t3 - 5107t - 496 wrt t. 70180116t Find the third derivative of -h5 + 19h*4 + 1101000h*3 + 118082h*2 - 10 wrt h. -60h*2 + 456h + 6606000 What is the second derivative of 2t4 + 7776224t*2 - 7665762t? 24t2 + 15552448 What is the second derivative of 24104205l*3w*2 + 2l*3w + 5l3 + 157lw - 3280w wrt w? 48208410l3 Find the third derivative of -19231254hk4 - 8hk3m + 6hm - 32925730k2m wrt k. -461550096hk - 48hm What is the third derivative of 294438188p5 - 11p*2 + 6718063p wrt p? 17666291280p2 Find the first derivative of -5446719j*2 + 20074108. -10893438j Find the first derivative of 1921t4 + 3t*3 + 3t*2 - 211t - 410735040. 7684t3 + 9t*2 + 6t - 211	{ "pile_set_name": "DM Mathematics" }
= -4u - 2b - 231. Is u greater than or equal to -101? True Suppose -5a - 40 = 5g, -7a = -3a + g + 17. Let v be ((-2)/a)/(6/(-9)). Which is smaller: 0 or v? v Let x(g) = g - 5. Let n be x(4). Let w be 5/(-12)(-21)/(-70). Do n and w have the same value? False Let d be 452/40. Let h(r) = r2. Let a be h(-1). Let i be 3 + -1 + a/3. Which is smaller: i or d? d Let g(z) = -z - 5. Let b(y) = -y3 + 5y*2 - 2y + 5. Let f be b(5). Let u be g(f). Does 2/7 = u? False Let b = -5 - -7. Let l(i) = i + 2. Let j be l(0). Suppose 6 = -0g - 2g, bc + 6 = -jg. Is c equal to -1? False Let x = -3 + 2.98. Is x at most -4? False Let o(l) = 2l2 - 33l - 8. Let s be o(16). Is s at most as big as -24? True Let w = 112.2 + -112. Is w bigger than 38? False Let x(m) = -m*3 - 6m*2 - 5m - 2. Let j be x(-4). Let a be 1 + 2 + j/4. Which is smaller: a or -2? -2 Let a be 0/((-100)/(-45) + 4/(-18)). Is a at least 1/61? False Let o = -5.9 + 3.9. Which is greater: o or -10? o Let t = -151/44 + 24/11. Let c(w) = w*2 + 5w - 8. Let y be c(-6). Let a = -4 - y. Which is smaller: a or t? a Suppose -3g = 3n + 15, 2g - 14 = -0n + 4n. Let p be ((-2)/n)/(126/8). Let y = 16/63 + p. Is -4 at least y? False Let o(w) = -w3 + 5w*2 + 6. Let k be o(6). Let m = 23 + k. Is -8 not equal to m? True Suppose 2c = 5w + 24, 3c - 5w = -0w + 26. Let d be (2 + -6)/c + 2. Let r = -235/4 - -59. Which is smaller: d or r? d Let x be -1 + 38/(-1 + -1). Let b be (-3 - 52/x)/2. Is b smaller than -1? False Suppose 5l + v = 54, 0 = -5l + 3l + 2v + 24. Let h = -10 + 19. Let g = l - h. Does 3 = g? False Let y be (234/(-45))/(4/(-10)). Suppose -4n + 9 = y. Which is greater: -3/7 or n? -3/7 Let w be 2 + 0 + (-3 - 0). Which is bigger: -2/35 or w? -2/35 Suppose 4q + 65 = 25. Let d(k) = k*2 + 11k + 9. Let a be d(q). Which is bigger: 2/11 or a? 2/11 Suppose -2b = b + 9. Let c be 80/15 - 2/b. Let v be c/10 + (-196)/35. Which is smaller: v or -1? v Let j be 2/(-20)625/50. Which is smaller: -0.9 or j? j Let s = -3 + 1. Let v = -1.9 + 2.3. Let k = v + 0.6. Which is smaller: k or s? s Let q be (1/(-1) + 0)-1. Let u be q + -1 + 3 - 3. Which is smaller: u or -1? -1 Let o be (-1 - (-158)/7) + (-24)/(-56). Is o at most 21? False Let v = 3 - -39. Let a be (-259)/v - (-1)/6. Which is smaller: a or -7? -7 Let o be (-177)/1278 - (-2)/12. Is -1 <= o? True Let j be (0 - 1) + 0 + -11. Which is bigger: j or -13? j Let f(g) = -6g - 31. Let i be f(-5). Which is smaller: -1/130 or i? i Let u(b) = 3b2 - 9b*2 - 6b*2 - 7 - 12b - b*3 + 0b*2. Let r be u(-11). Which is bigger: 5 or r? 5 Let c = -1.3 + 0.3. Let x = 1 + c. Suppose 2 = -168w + 170w. Is x >= w? False Let u(r) = 4r - 5r + 7 - 5. Let l be u(1). Let y be l/((11/4)/1). Is 1 bigger than y? True Let x = -1.4 - -1.5. Is 1 greater than x? True Let z = -2 + 5/3. Let o = -545 + 546. Is o greater than or equal to z? True Let u(w) = -w2 - 7w - 9. Let t be u(-7). Is t > -11? True Suppose d - 4d + 10 = -2c, 5c + 15 = 5d. Let u = -23 - -22. Is d >= u? True Let z = 1.12 + -4.12. Let i be 0 - 3/(21/2). Are z and i nonequal? True Let v = -13 + 11. Let i = -5 - -7. Let r = v + i. Which is bigger: r or -0.2? r Let i be ((-88)/(-10))/(4 + (-57)/15). Which is greater: i or 45? 45 Suppose 2z = -4x + x + 7, -4 = -2z. Suppose -5q = -2r - 13, -2q + 5q = -2r + 11. Suppose -x = m - q. Is m > 3? False Let u be (5 + -9)2/4. Which is greater: -2/3 or u? -2/3 Let r be 1/((-91)/(-93)) + -1. Is 0 < r? True Suppose 3i = 4i. Let u = 1 - 1. Let p = u + 1. Is i at most p? True Let m(o) = 9o + 36. Let y be m(-5). Which is bigger: y or -10? y Suppose -3d - 2p = -d - 8, 3p = -4d + 21. Suppose 2b - d = i, -b + 16 = -2i + b. Let l(g) = -g*2 - 6g + 4. Let u be l(i). Which is smaller: -2 or u? u Let c = 4/53 - 203/583. Let k = 3 - 3. Which is smaller: k or c? c Let v = 20 - 14. Suppose -2l + vl + 8 = 0. Do -2 and l have different values? False Suppose 3q - 4 - 2 = 0. Suppose -5p - 22 = -q. Let g be (-8)/(-12) - p/(-6). Do g and 2/9 have different values? True Let b(f) = -3f + 1. Let s be b(3). Let j be (1 + -2)(-2)/s. Suppose 0 = 5k + 26 - 11, -2k = -4n + 6. Which is smaller: j or n? j Let a = 6 + -5. Is -4 less than or equal to a? True Let w be ((-4)/(-6))/(24/36). Let d be 0/(3/(w - 2)). Let u = -0.7 + 1.3. Which is bigger: d or u? u Suppose 2d + 8 = -0d. Let o be d - -2 - (-16)/6. Which is greater: 2 or o? 2 Let l = 1/203 + 144/203. Which is smaller: l or 0? 0 Let i = -46 - -40. Which is smaller: -5 or i? i Suppose 4d - r = -2r + 14, 2r + 20 = 4d. Let b(g) = g2 - 4g. Let w be b(d). Is w bigger than 0? False Let a(i) = -i + 11. Let y be a(11). Let c(k) = k*2 + 7k + 8. Let f be c(-6). Suppose 3m + f - 5 = y. Which is smaller: m or -2? -2 Let j = 2 - 4. Let m be (-9)/4 - j/8. Is -5 at most m? True Let u be 15/(-9)6/4. Let h be 1/(-1)15/(-3). Let l(c) = c - 7. Let z be l(h). Which is bigger: z or u? z Let z(w) = w2 - 18w - 21. Let g be z(19). Do g and -11 have the same value? False Let k = -127.1 + 122. Let j = k - -5. Let v = j - -1.1. Are 0 and v unequal? True Let q(k) be the third derivative of k6/120 + k5/15 - k4/24 - k3/2 - 2k2. Let s be q(-4). Let d = 2/45 - 4/15. Which is bigger: s or d? s Let k(y) = -y3 - 7y*2 + 8y. Let x be k(-8). Let q = -0.09 + 4.09. Which is bigger: x or q? q Suppose -40 + 62 = -j. Is j less than -21? True Let i = -0.2 - -0.4. Let s = 0.38 + 0.02. Let l = s - i. Which is smaller: -1 or l? -1 Let m = 5/739 - 8953/12563. Is m > -1? True Suppose 0 = -2n + 3h + 19, -3n - 2h + 1 = 5. Let z be n/((-39)/(-15) - 3). Suppose 3y + 19 = 1. Is z smaller than y? False Let o be (14 - 13) + 0 + 0. Is 1 at least o? True Let m = -0.06 - -0.06. Let y = 0.1 - m. Which is smaller: y or 3? y Let t = 14 + -5. Which is smaller: 11 or t? t Let i = -3/22 + 17/44. Let h be (-3)/(-15) - (-18)/(-40). Is h equal to i? False Suppose -17 = -3s - s + o, -4o = 20. Suppose 3w - 18 = 3q, -q - 2q = -w + 8. Suppose -wg = -6g + 2i - 10, -3g - 4i + 20 = 0. Is g smaller than s? True Let i = -8/7 - -25/28. Let m be 1 + (-2)/(-2) + 0. Suppose -3j - 2o = m + 1, o - 1 = -4j. Is i < j? True Let g = 0.23 + -0.13. Which is bigger: g or 2/7? 2/7 Suppose 4t = 2c - 28, 2t - 4t - 2 = c. Let g be c/(-4) + (-1 - -2). Let z be 0 - (-2 + 2)/1. Is z at least g? True Let l(o) = -o - 14. Let k be l(-14). Let a be 30/(-42) - (0 + k). Which is bigger: a or 0? 0 Let t be (5-2)/((-2)/11) + 2. Is t equal to 58? False Let m = 22 + -43/2. Suppose 15w + 7 = 3p + 13w, 5p - 4w - 15 = 0. Is m less than or equal to p? False Let w(a) = -1 - a*2 + 5a - 9a + 2a*2 + 3a. Let k be w(0). Is 2/5 >= k? True Let k be (2 + (-34)/16)-2. Let t = -7 - -7.1. Is k at most as big as t? False Let l = -0.1 - -1.1. Let o = 5 - l. Let i = o - 8. Which is smaller: -0.1 or i? i Suppose 4 = -3p + 7p. Is p greater than or equal to -5/19? True Suppose 0y - 5q - 28 = -3y, 0 = y + q + 4. Let c = 0 + y. Is c at least 1/5? True Let r = 4.7 + -0.7. Let f = 0.1 - -6. Let k = f + -6. Which is greater: k or r? r Suppose -4h + 0h = -3t + 1, 4h + 2t = 14. Suppose l - hl - 3 = 0. Let d be (6/4)/((-6)/16). Which is smaller: d or l? d Let n = -4 - -11. Let w(b) = -8b - 5b*3 + 3b*3 + 4b*3 + nb2 - b3. Let k be w(-8). Which is smaller: k or 2/15? k Suppose 2p + 8 = 2y + 6p, 4y = 5p + 81. Suppose 0b = 4b + 3h - 14, 3b = -4h + y. Which is smaller: b or 3? b Suppose 12 = -4l + l, -3l - 9 = -3b. Are -24/11 and b non-equal? True Let q(r) = -r2 + 6r - 4. Let m be q(8). Let g be m/(-16) - (-3)/12. Is 3 < g? False Suppose a - 2 = 5j, a - j = 2j. Let s(b) = 2b + 2. Let k be s(a). Which is smaller: 0 or k? k Let r be -2 - -23/6. Let h be 4 + (-4)/5251. Which is smaller: h or r? r Let p be 0/(-3 + (1 - -1)). Let d = -3.4 + -0.6. Is p smaller than d? False Let g = -5/108 + 547/2484. Is g at least 0? True Let k = 0.8 + -0.3. Let s = -12.6 + 12. Let c = k + s. Is 2 equal to c? False Let g = -5 - -5. Let h be 3 + -2 + 3 + g. Is h less than or equal to 4? True Let l be (-1 + 1)/((-2)/(-2)). Suppose -10 + 4 = -2i. Suppose -id - 5 = -8. Is l bigger than d? False Let i(y) be the first derivative of y4/4 + 5y**3/3	{ "pile_set_name": "DM Mathematics" }
1106 - 2i - 325. -13i - 1488 Collect the terms in -1247o2 - 750o*2 - 1814o*2. -3811o*2 Collect the terms in 2 + 22234o - 4833o + 2259o. 19660o + 2 Collect the terms in 12n - 31n - 2282 - 2281 - 2217 + 18n + 6780. -n Collect the terms in -618k2 + 606k*2 + 14k*2 + 26k*2. 28k*2 Collect the terms in 7907g - 4709g + 10106g. 13304g Collect the terms in 80 - 40o - 252 - 5o3 + 82 + 85. -5o*3 - 40o - 5 Collect the terms in -9j - 14 - 35 + 23 - 46 + 8j. -j - 72 Collect the terms in -t + 5616 - 2828 - 2806 - 2t. -3t - 18 Collect the terms in 14168 - y + 14165 - y3 - 28333. -y3 - y Collect the terms in 6g - 892g*2 + 4478g*2 - 919g*2 - 892g*2 - 887g*2 - 891g*2. -3g*2 + 6g Collect the terms in 328r + 3r*2 + 84 - 84 - 365r - 733r. 3r*2 - 770r Collect the terms in 1228o + 1244o - 4946o + 1232o + 1223o. -19o Collect the terms in 2878 + 279x - 2867 - 280x. -x + 11 Collect the terms in -14x2 - 630 + 630 + 744x. -14x2 + 744x Collect the terms in -61 - 31q - 11q - 15q - 1 + 62 + 54q. -3q Collect the terms in 11063n - 22779n + 11427n - 5. -289n - 5 Collect the terms in 1863u - 116 - 18 - 1871u. -8u - 134 Collect the terms in 4b2 - 235b*2 + 27b*2 + 21b*2. -183b*2 Collect the terms in -38y - 3 + 0 + 45 + 141y. 103y + 42 Collect the terms in -15c3 + 51c*2 + 50c*2 - 15c*3 + 44c*2 - 145c*2. -30c*3 Collect the terms in 187t*3 + 152t*2 + 473t*3 - 403t*2. 660t*3 - 251t*2 Collect the terms in -296y - 1542 + 295y - 68491. -y - 70033 Collect the terms in 2697 - 1031g*2 - 2697 + g. -1031g*2 + g Collect the terms in 11162z - 22577z + 11449z. 34z Collect the terms in -32t*2 - 33t*2 - 33t*2 + 210t*2 - 38t*2 - 35t*2 - 42t*2. -3t*2 Collect the terms in -4957 + 2535 + 2422 - 2490x + 2527x. 37x Collect the terms in 32 - 483w + 219w + 115w + 157w + 158w. 166w + 32 Collect the terms in -y + 74y2 + 12y - 332y2 + 36y. -258y2 + 47y Collect the terms in 8c2 + 0c*2 - 8c*2 - 6366771 + 119c*3 + 6366774. 119c*3 + 3 Collect the terms in 2031l + 2027l + 2038l - 8119l + 2032l - 2l2. -2l*2 + 9l Collect the terms in -193 + 3693o + 1886o + 148o. 5727o - 193 Collect the terms in -1385z + 3804z + 2053z. 4472z Collect the terms in -23t + 272759 - 136291 - 136459. -23t + 9 Collect the terms in -37947o - 37950o - 3o2 + 7o*2 + 75901o. 4o2 + 4o Collect the terms in -9681d2 + 1190d*2 - 4088d*2. -12579d*2 Collect the terms in -1 - 5 + 15o*2 + 7 + 13993o - 1 - 13993o. 15o*2 Collect the terms in -841 + 156 + m - 324 - 739 - 963. m - 2711 Collect the terms in -34v - 45v - 531v + 624v. 14v Collect the terms in -6 - 4457n - 2265n + 9 - 3. -6722n Collect the terms in 4458p + 9213p + 3653p. 17324p Collect the terms in -1982x*3 + 3978x*3 - 2025x*3 - 2x*2 - 923x*3. -952x*3 - 2x*2 Collect the terms in -657823a + 657823a - 3731a*2. -3731a*2 Collect the terms in -10 - 87t*2 + 89t*2 - 11 - 49 + 91 - 12. 2t*2 + 9 Collect the terms in -4 + 228p*3 - 115p*3 + 1 + 3 + 69p*3. 182p*3 Collect the terms in 1618 - 3282 + 1664 - 40896a*3. -40896a*3 Collect the terms in 166956i + 33 + 2i2 - 166956i. 2i2 + 33 Collect the terms in 5012q - 2525q - 2487q + 9q3 + 1143. 9q*3 + 1143 Collect the terms in -16143t*2 + 14438t - 14438t. -16143t*2 Collect the terms in -81937214h*2 + 9h + 163874416h2 - 81937200h*2. 2h*2 + 9h Collect the terms in -575k2 - 581k*2 - 24 - 563k*2 + 1720k2. k2 - 24 Collect the terms in -128 - 29 - 130 + 287 - 4716j2. -4716j*2 Collect the terms in 162 - 52 - 59 - 4474y*2 - 51. -4474y*2 Collect the terms in 54 - 8912f*3 - 54 - 5657f + 5657f. -8912f*3 Collect the terms in 18552b - 4058 - 6185b - 6185b - 6183b. -b - 4058 Collect the terms in -15p + 31p - 16p - 1510012p2. -1510012p*2 Collect the terms in 130o*2 + 66o*2 + 89 - 205o*2 - 103. -9o*2 - 14 Collect the terms in 11599p*3 + 62p - 64p + p2 - p2. 11599p*3 - 2p Collect the terms in 299d3 - 576d*3 + 11301d + 279d3 - 11301d. 2d3 Collect the terms in -6924 + 3p - p - p - 2752 - 3p. -2p - 9676 Collect the terms in 19t2 - 72148 + t - 72372 + 144520 - t. 19t*2 Collect the terms in -18m + 2 + m + 41 + 10m + 36. -7m + 79 Collect the terms in 659 - 288 - 298 + 5z - z. 4z + 73 Collect the terms in -24d3 + 12819d + 12820d - 38465d + 12826d. -24d*3 Collect the terms in 30 + 36 + 1011j + 36 - 91. 1011j + 11 Collect the terms in 24k*2 - 8k*2 - 11923k*3 - 20k*2. -11923k*3 - 4k*2 Collect the terms in -13905n*2 + 2683n*2 + 11224n*2. 2n*2 Collect the terms in 484 + 482 - 8g + 488 + 484 - 1938. -8g Collect the terms in -1 - 4 + a + 155446a*2 + 12 - 5. 155446a*2 + a + 2 Collect the terms in 2l - 99103 - 324919 - 4l. -2l - 424022 Collect the terms in 6 + 255946m2 - 5 - 85m*3 - 1 - 255946m*2 - 2m. -85m3 - 2m Collect the terms in -76d3 + 1173045 - 2346093 + 1173050. -76d*3 + 2 Collect the terms in -180n*2 - 250n*2 + n + 1051n*2 + 1. 621n*2 + n + 1 Collect the terms in -x - 11x*2 - 10x + 9x2 + x - x2 - 26x. -3x2 - 36x Collect the terms in 253d3 + 596d*3 - 13504d*3 - 5220d*3. -17875d*3 Collect the terms in 0q - 19520 + 53971 + 37317 + 2q + 45196. 2q + 116964 Collect the terms in -48511q + 33797q - 50494q. -65208q Collect the terms in 122738i3 - 245548i*3 + 122807i*3. -3i*3 Collect the terms in 999f*2 - 1987f*2 + 490f + 991f2 + 2. 3f*2 + 490f + 2 Collect the terms in -83986d - 83986d - 83979d + 251946d. -5d Collect the terms in 1681j*2 + 2285j*2 + 1624j*2 - 5592j*2. -2j*2 Collect the terms in -349 + 392 + 176 + 16l*2 - 103 - 116. 16l*2 Collect the terms in 2922 - 5860 - 577w*3 + 2938. -577w*3 Collect the terms in -66v*2 + 384v*2 + 0 - 1084v*2 + 410v*2 + 412v*2 + 0. 56v*2 Collect the terms in -1 - 11628v + 61213v + 1. 49585v Collect the terms in -31552 + b + 10b3 + 31290 - b. 10b*3 - 262 Collect the terms in 1749r*3 + 8 + 1622r*3 - 3368r*3. 3r*3 + 8 Collect the terms in -289a*2 - 193a*2 - 226a*2. -708a*2 Collect the terms in -336u - 520u + 7u*2 - 38u*2 + 57u*2 - 25u2. u2 - 856u Collect the terms in 6640 + 111j + 6662 - 13306. 111j - 4 Collect the terms in -828438 - 112x + 99x + 828466. -13x + 28 Collect the terms in -6f + 6263f*2 + 4f + 6110f2 - 12360f*2. 13f*2 - 2f Collect the terms in -640465d + 1280925d - 2d2 - 640460d. -2d2 Collect the terms in -251986 + 251986 + 58x + 60x - 115x. 3x Collect the terms in -2782u - 2u2 - 2794u + 4u3 + 1068 + 5576u. 4u3 - 2u*2 + 1068 Collect the terms in -809x*2 - 625x - 167x + 792x. -809x2 Collect the terms in -4461p - 391616p2 + 4461p. -391616p2 Collect the terms in 404594j*2 - 2j - 134783j2 - 134874j*2 - 134854j*2. 83j*2 - 2j Collect the terms in 4101p - 246p + 290p + 2296p - 306p. 6135p Collect the terms in -1577x2 + 3299x*2 - 1613x*2 - 14. 109x*2 - 14 Collect the terms in -1626 + 1626 - 1001t - 2616t. -3617t Collect the terms in -269666u + 67416u + 67417u + 67413u + 67415u. -5u Collect the terms in -3w + 4w - 258183w3 - 2w. -258183w3 - w Collect the terms in -518w + 124w3 + 58w*3 + 323w + 197w. 182w*3 + 2w Collect the terms in -63687s2 - 63687s*2 + 191074s*2 - 63689s*2. 11s*2 Collect the terms in -5d - 248d2 - 37d*2 + 278d*2 + 5d. -7d2 Collect the terms in 694m*3 + 0m*2 + 71161m*3 + 0m*2. 71855m*3 Collect the terms in -473f*2 - 1151f*2 + 270f*2 - 122f*2. -1476f*2 Collect the terms in -1108 - 1975 + 77b + 6b2 - 7b*2 - 75b. -b*2 + 2b - 3083 Collect the terms in -35m3 + 1853m*2 + 1782m*2 - 3512m*2 + 1. -35m*3 + 123m*2 + 1 Collect the terms in -746 + 203n - 147n - 96n. -40n - 746 Collect the terms in 167203887 + 5u + 167203968 - 334407855. 5u Collect the terms in 3 - 2 - 335t + 5 + 4 - 11. -335t - 1 Collect the terms in 1359v*3 - 4 - 3v*2 + 1327v*3 - 2687v*3 + 4 + 3v**	{ "pile_set_name": "DM Mathematics" }
d biggest value in -2, 0, -0.39, 3, -2.2, -4/7? 0 What is the second smallest value in -11/3, -5, 0.4, -2/5, -1? -11/3 What is the sixth smallest value in 0.5, 5, 394, -14, -2, -1/3? 394 What is the biggest value in -1/7, 3, 0.082, 0.8, 0.3? 3 What is the smallest value in -10, 5, -4, -1/2, 1? -10 Which is the smallest value? (a) -17 (b) 4 (c) 1 (d) -2.5 (e) -5 a Which is the second smallest value? (a) -0.21 (b) -1980 (c) -3 c Which is the third biggest value? (a) -717 (b) 0.139 (c) -2 a What is the fifth biggest value in -2/15, -0.1, 5, 1/2, -1315, 0.4? -2/15 What is the fourth smallest value in -10, -0.06, -2/5, -2, -12? -2/5 What is the fifth biggest value in -3/4, -1/8, 1, 0.467, -2? -2 What is the second smallest value in -5, 5, -33, 0.1, 3, -10/39? -5 What is the third biggest value in -2/11, 3/16, -70? -70 Which is the fourth smallest value? (a) -41 (b) -4 (c) 2 (d) -3 (e) -0.3 (f) -13 d What is the second biggest value in 2, -0.05, 2/2547, 2/15, -1/7? 2/15 Which is the second smallest value? (a) 5 (b) -1.7 (c) 4 (d) -1 (e) -1/3 (f) 1 d What is the fifth smallest value in 0.3, 2/11, -6/11, -0.2, 5? 5 Which is the biggest value? (a) -1.51 (b) -89 (c) 7 c Which is the second biggest value? (a) 11/8 (b) 12 (c) 23 b What is the fifth smallest value in -1/2, 0.1, 10, -5, 0? 10 What is the second biggest value in 0.4, 9/17, -8, -0.2? 0.4 Which is the third smallest value? (a) -0.4 (b) 35 (c) -13 (d) 7/36 d What is the smallest value in -0.4, -0.3, 1388, -3, 0.06? -3 Which is the third smallest value? (a) 42/19 (b) 1 (c) -0.3 (d) 42 (e) 2 e What is the second smallest value in -0.1, 1039, -1/9? -0.1 Which is the third biggest value? (a) -5 (b) 773 (c) -2/7 a What is the smallest value in 1, 4, 1/7, -0.05, -0.01, 0.1? -0.05 What is the smallest value in -0.1, 5610, -5, -1/5, 1/10? -5 What is the smallest value in -1/2, -0.692, -0.01? -0.692 What is the second smallest value in -99, 12, -59? -59 Which is the third smallest value? (a) 0 (b) 76 (c) 12715 c Which is the fifth biggest value? (a) 1 (b) 5 (c) -1/9 (d) 0.3 (e) -0.09 (f) 7 e Which is the smallest value? (a) 6427 (b) -86 (c) 0.4 b Which is the fifth biggest value? (a) -2 (b) -0.1 (c) -6 (d) 19 (e) -62 e Which is the second biggest value? (a) -0.111 (b) 15 (c) 328 b What is the biggest value in -1, 1/3, -12, -18/11, -1/10? 1/3 Which is the third smallest value? (a) 18 (b) 0.1 (c) -1 (d) -32 (e) 3 (f) 35 b What is the second biggest value in -0.4, 80, 2/3, -6.4, -1? 2/3 Which is the second smallest value? (a) -27 (b) -2/5 (c) -4 (d) -3 (e) 1/9 (f) -2 c What is the second smallest value in -6, -6/23, -108, 0.3, 0.5? -6 Which is the third smallest value? (a) 26 (b) -4/7 (c) -0.8 (d) 0.4 (e) -1 b What is the second biggest value in 5, 2.087, 19? 5 What is the biggest value in 574, 0, 1/4, 4, 0.1? 574 Which is the smallest value? (a) -3 (b) 5/6 (c) 41705 a What is the third biggest value in 2655, -2/11, 0, -2, -1.8? -2/11 What is the fourth smallest value in 5, 1309, -2/11, -2? 1309 What is the biggest value in -52, -46, -3, 0? 0 Which is the second biggest value? (a) 1/14 (b) -9 (c) 5 (d) 6 c Which is the second smallest value? (a) 8 (b) 1/20 (c) -18 b Which is the fifth smallest value? (a) 1/10 (b) 1 (c) 3/8 (d) -56 (e) 0.4 (f) -0.3 e What is the third smallest value in 533, 2.2, 1? 533 What is the biggest value in -0.6, 0.13, 1040, -2/9? 1040 What is the smallest value in -99605, -1/3, -2/9, 4/7? -99605 Which is the sixth smallest value? (a) -3 (b) 1.1 (c) -2 (d) -1 (e) 3 (f) -1.3 e Which is the third biggest value? (a) 0.067 (b) 35 (c) -4/15 (d) -4 c What is the sixth smallest value in -2, 1, -2/15, 4/5, -8, 6/19? 1 What is the second biggest value in 2.7, 62, -3, -0.3, -5/12, -5? 2.7 What is the fourth biggest value in -4, -0.1, 3, -4/51, 2.3? -0.1 What is the biggest value in 8, 1/3, 10292? 10292 Which is the fourth biggest value? (a) -8 (b) -2281 (c) -1/3 (d) -4 (e) 3 (f) -2 d What is the biggest value in 10, 1/20, -2/13, 2? 10 What is the third biggest value in -0.2, 3, 5, 13, -26/9? 3 Which is the smallest value? (a) -4 (b) 0.07 (c) 2.0684 (d) 0.3 a Which is the second biggest value? (a) -6/5 (b) 4 (c) -3 (d) 1647 b What is the second biggest value in -10, 870/77, 0.3? 0.3 What is the biggest value in 30/43, 4/7, -1.1, 2? 2 What is the third biggest value in -0.322, 24, -2/5, 1? -0.322 Which is the biggest value? (a) -1/44 (b) -0.1 (c) 35 (d) -9/5 c What is the second biggest value in 2/7, -0.3, 3/77, 0.2, 0.5? 2/7 What is the third biggest value in -0.81, 3, 0.06, 0.7? 0.06 What is the biggest value in 2/7, 1, 2, -5, -283? 2 What is the fourth smallest value in 0.3, 48126.2, 2, 1? 48126.2 What is the third biggest value in 4, -1/3, 17/3, -178, -4, -0.08? -0.08 Which is the fifth smallest value? (a) -2 (b) -212/7 (c) -0.3 (d) 0.2 (e) 16 (f) -0.2 d Which is the fourth biggest value? (a) 2/5 (b) -0.17 (c) -1/13 (d) -2 d Which is the second biggest value? (a) -1.6 (b) 3/4 (c) 12 (d) 3/29 b What is the fifth smallest value in 0.1, 1, -5, 1/4, 1541? 1541 What is the fourth smallest value in -2/5, 0.4, 7/8, -1/3? 7/8 What is the third biggest value in -2/13, 0.2, 1.1, -30/13? -2/13 What is the smallest value in 252/13, 0.8, -0.09? -0.09 Which is the biggest value? (a) 0.1 (b) -3 (c) -135697/7 a What is the fourth biggest value in 1/11, 2/11, 1585, 16? 1/11 What is the second smallest value in -2/9, -6057, 2, 3? -2/9 Which is the fourth biggest value? (a) -0.1 (b) -3 (c) -9 (d) -4 (e) -4/9 (f) -0.431 b What is the fifth smallest value in -2/11, 11, 1, 5, -1/13, -0.03? 5 What is the smallest value in 0, -1/2, -5/3, -0.3? -5/3 Which is the fifth smallest value? (a) 2/7 (b) -1/13 (c) -3 (d) -0.5 (e) -4 a Which is the second smallest value? (a) 1/2 (b) -25/3 (c) -5 (d) 2/5 (e) 4/3 c What is the biggest value in -165, -1/5, -0.11? -0.11 What is the fifth biggest value in 2/7, -2/63, 2, -7, -0.5? -7 What is the smallest value in -754, 5, -2/17, 1/4, -5? -754 Which is the second smallest value? (a) 2 (b) -3/10 (c) 32 (d) 16 a What is the second biggest value in -2, 5/2, 4, 29803? 4 What is the smallest value in 5/9, -1, 1/5? -1 Which is the second smallest value? (a) -3 (b) -58 (c) 3/31 a Which is the fourth smallest value? (a) -5 (b) 3/7 (c) 0.168 (d) 4 (e) -2 b What is the smallest value in 1/2, 30400, -0.3? -0.3 What is the biggest value in -4, 3580, 1? 3580 Which is the fifth smallest value? (a) 0.1 (b) 0.012 (c) -4 (d) 2 (e) -142 (f) 0.3 f What is the biggest value in -5, 0.05, -3, 2/99? 0.05 What is the third biggest value in -0.6, -2/7, 2132? -0.6 Which is the third smallest value? (a) 0.03 (b) -4 (c) -29 (d) -719 b What is the fifth smallest value in -3/4, -5, 3, 0.06, 5, -5.4? 3 Which is the second biggest value? (a) 19 (b) -5 (c) -3 (d) -2/3 d Which is the second biggest value? (a) -4 (b) -402 (c) -0.206 a Which is the smallest value? (a) 0.02 (b) 2.3 (c) -4 c What is the fifth biggest value in 278, 0.3, -15, -0.3, -56? -56 Which is the sixth biggest value? (a) 0.2 (b) -136 (c) 5 (d) -150 (e) 0.5 (f) -1 d Which is the fifth smallest value? (a) -0.5 (b) -0.04 (c) 2/13 (d) 5 (e) -215 d Which is the second smallest value? (a) -0.55 (b) 4 (c) 12 (d) 4/3 d What is the third smallest value in 2/11, -5/3, 11389? 11389 Which is the fourth biggest value? (a) -0.4 (b) -2.5 (c) 357 (d) -1 b Which is the fourth biggest value? (a) 1 (b) 48 (c) -0.5 (d) 2/13 (e) 2 d What is the fifth smallest value in -2/17, 0.3, 4, 3, -250? 4 Which is the second smallest value? (a) 3/5 (b) 0.13 (c) 1 (d) -5 (e) -1 e Which is the second smallest value? (a) -3/781 (b) 18 (c) -12 a Which is the biggest value? (a) -12855 (b) 5 (c) 1 (d) 4/9 b What is the fourth smallest value in -0.02, -43, -1/7, 0? 0 Which is the third biggest value? (a) -3 (b) 1.6 (c) -6 (d) -158 c What is the third biggest value in -987, 1/5, -1/3? -987 What is the second biggest value in 7/3, 316, -3? 7/3 Which is the second biggest value? (a) -0.5 (b) -12 (c) 1/2 (d) -6 (e) 4 c Which is the fourth smallest value? (a)	{ "pile_set_name": "DM Mathematics" }
Suppose 2s + u + 6 = -s, 0 = -s - 4u - 13. Let c be 42/(-63) - (2 + s). What is the smallest value in -5, -37, c? -37 Let v(g) = 38g + 228. Let n = 729 + -735. Let x be v(n). Let m = 0.8 + 0.2. What is the smallest value in -0.2, x, -4/11, m? -4/11 Let s = 0 - 3. Let v = 6906 + -303867/44. What is the second smallest value in 0.2, s, v? v Let l = 88 - 80. Let j be (-336)/88 + l/(-44). Let y = 2 - 2. Which is the fourth smallest value? (a) j (b) 5 (c) 4 (d) y b Let t = -0.02 - -0.14. Let j = -1.88 - t. Let h = -127/212 - 1/1060. Which is the fourth biggest value? (a) j (b) -5 (c) -1/5 (d) h b Let i = 7 + 2. Suppose -3g + i = -2g. Let k be 4/18 + (-29)/g. Which is the second smallest value? (a) 18 (b) k (c) -4 b Let j = -455.997 - -456. Let n = -0.203 + j. Which is the biggest value? (a) n (b) -4 (c) 3.4 (d) 0.3 c Let x = -495.5 + 53.5. Let t = -441 - x. Which is the third biggest value? (a) 0.1 (b) -4 (c) t b Let z(s) = -61s - 1472. Let t be z(-24). Which is the third biggest value? (a) 2/19 (b) t (c) -65 c Let s = -187.99 - -188.29. Let f = 10 + -5. Let n = 2 - f. Which is the smallest value? (a) s (b) n (c) -3/2 (d) 1 b Let d = 1043 - 1574.3. Let m = d - -530. What is the second biggest value in m, 2, -5, -2/7? -2/7 Let d be 4/(-3) + 1 + 1. Let x = -132.8 + 958.8. Let n = x + -825.95. What is the third biggest value in 3/4, d, n, -1/3? n Let p = -6843 - -6828.5. Which is the fourth biggest value? (a) 1/7 (b) p (c) 0 (d) -2/13 b Let l = -84.9 + 88.37. Let h = l - -0.53. Which is the second smallest value? (a) h (b) 2 (c) 3 c Let k = -15.1 + 15. Let v = -0.1 - -0.5. Which is the fourth smallest value? (a) v (b) k (c) -5 (d) -0.05 a Let k = 819.07 + -814. Let z = k - 4.57. What is the third biggest value in -4, 2, z? -4 Let r = -18 + 4. Suppose 391 - 369 = 11i. Which is the second biggest value? (a) i (b) 3 (c) r a Let o = -361.36 + 360. Which is the second smallest value? (a) -1 (b) o (c) -1/3 a Let d = -449 + 271. Let a = d + 58. Let s = 117 + a. What is the second biggest value in 1, -6, s, 0? 0 Let r be 102/(-18) - -6 - (-104)/(-6). Suppose 4c + 72 = 4x, -18 = c + 4x - 0x. Let s = r - c. What is the biggest value in 0.2, s, -4? s Let l be (0 - 10/(-7))(-658)/(-376). Which is the fifth smallest value? (a) 1/3 (b) -2 (c) l (d) 36 (e) -7 d Let r = 72.79 + -74.09. What is the third smallest value in r, -2/9, 155? 155 Let h = 74 + -71. Let v be (-3 - -7)(h - (-6)/(-4)). Let y = -32/35 + 5/7. What is the second biggest value in y, -5, v? y Let z = -7511 + 7513. What is the third biggest value in 1.31, 13, z, -0.1? 1.31 Let t(x) = x3 + 178x*2 - 34519x - 1187. Let l be t(-295). Let d be (3/10)/(6/8). Which is the third biggest value? (a) d (b) l (c) -1 b Let z = 2.7544 - -1.2456. Let k = -7/5 + 51/40. Let y = -3/109 + -185/1199. Which is the fourth smallest value? (a) y (b) z (c) 3/5 (d) k b Let z = -137.5 + 138. Let u = 56 - 842/15. Let d(h) = -h*2 - 5h + 9. Let y be d(-7). Which is the second biggest value? (a) z (b) y (c) u c Let w be -6 + (-216)/(-2) + 2. Let m be ((-6)/9)/(w/78). What is the smallest value in 1, m, 2/15? m Let m = -21125.5 - -21125. Let h = 10 + -25. Which is the smallest value? (a) 0.1 (b) h (c) 2 (d) m b Let o = 0.64 - 7.29. Let j = o + 6.55. Which is the third biggest value? (a) 2 (b) 1/5 (c) j (d) 31 b Let i = 15.017 - 15.217. What is the biggest value in i, 2, 0.09, 5? 5 Let f(i) = -i + 9. Let h be f(6). Let y = 642 + -640. Which is the smallest value? (a) -0.3 (b) 18 (c) h (d) y a Let k = 51668/7 - 7381. What is the fourth biggest value in 0.07, 4, k, -3? -3 Let j = 6432 + -6431.2. What is the fourth biggest value in 0.2, j, -0.36, 0.1? -0.36 Suppose 0 = 5y + f - 1335, 3y - 6y + 5f + 801 = 0. Let k = y + -284. Suppose -6q = -q. Which is the third biggest value? (a) -2/5 (b) q (c) -4 (d) k c Let l = -15707 + 15709. What is the second smallest value in -3, 76, -10, l? -3 Suppose 3l + 4 = -2m, 2l - 5l + 5m - 11 = 0. Let d(h) = 9h - 835. Let k be d(93). Which is the second biggest value? (a) k (b) 3 (c) l a Let w = 15 + 31. Let p = -1631 - -1586. Let v = w + p. What is the third biggest value in v, -1/6, 0, -0.1? -0.1 Let p = -1993 - -1977. Which is the fourth biggest value? (a) -3/2 (b) -2 (c) p (d) -5 c Let g = -6680/30141 - 2/3349. Let t = -29 + 32.4. What is the biggest value in -2/3, t, g? t Let t be (3 - 2) + 87/3. Let r = -485.7 - -485.3. Which is the second smallest value? (a) -5 (b) r (c) 0.1 (d) t b Let b = 6 - 9. Let q = 321/253 + -1907/506. What is the fourth biggest value in q, -3/8, 2, b? b Let u be -3 + (-12)/20 + (-492)/205. Let f = -0.2 - -0.3. Which is the third biggest value? (a) f (b) u (c) -0.2 (d) -4 d Let d = 10/2433 + 8006963/9732. Let w = d + -830. Let j = 189/1313 + 1/101. Which is the smallest value? (a) -2 (b) j (c) w c Let p = 0.17 + -0.57. Suppose 11 = 3q - 2w, 0w - 17 = -5q + 4w. Suppose -13 = -qu + 12. Which is the biggest value? (a) 1 (b) u (c) p b Suppose -442d + 533 = 46d - 1419. Suppose 4y - 2y - 90 = 0. Let v be (12/y)/((-2)/(-3)). What is the third biggest value in d, -7, v, -2/9? -2/9 Let z be 4/(-6) + (-880)/(-1122). Let h = 133/936 + -2/117. Which is the third biggest value? (a) -0.5 (b) z (c) h a Let v be 257/(-1028)(18/195 - 4/10). What is the third smallest value in -1/4, v, 67? 67 Suppose -92x = 396 + 248. What is the biggest value in x, -9, 0? 0 Let s be (-7)/(-441) - 4/9. Let f = -0.98 - -1. Let y = 0.1042 + -5.1042. Which is the smallest value? (a) f (b) s (c) y (d) 5/4 c Let k = -6.18 + 63.18. What is the fourth smallest value in k, -0.3, 2, 4? k Let l be ((-4)/32)/((-1)/(-2)). What is the biggest value in 3, l, 9? 9 Let g = 59.83 + -63.03. Which is the third biggest value? (a) 0.01 (b) 2/7 (c) g c Let y = -287 - -288.49. Let f = y + -1.29. Which is the third smallest value? (a) -0.8 (b) f (c) -19 (d) -3 a Let r = -0.7239 - -0.8239. Let l = -0.39 + 0.17. Let k = l + 0.02. What is the smallest value in -3/8, r, k, -3? -3 Suppose -2j + 5b + 177 = 0, -4j - 2b + 267 = -27. What is the third smallest value in -1/2, -2/19, j? j Let t = 1 - -23. Let f = -3 - t. Let s = f - -21. Which is the second biggest value? (a) -3 (b) -5 (c) s b Let i = 2.007 - 1.307. Let v = 12.5 - 13. What is the second biggest value in v, i, -4? v Let l = 3167/54 - 58. Let f = l + -4/27. What is the second biggest value in f, 0.15, -0.2? 0.15 Let x = -3.69 - 1.31. Let n = -0.027 - -1.027. Which is the fourth biggest value? (a) n (b) -0.4 (c) x (d) -7/6 c Let u be 1-3 + 2/(-19) - -3. Let z = 13/57 - u. What is the second smallest value in -1, 10, z? z Let u = -4333/132 - -296/11. Let l = u + 79/12. What is the third smallest value in -2, l, 2/17? l Let m = 1279.8 + -1280. Let j = -211/5184 + -1/162. Let o = j + 137/192. What is the smallest value in o, 0.4, m? m Let m = -47224 - -47230. Let c = -9 + 5. What is the second biggest value in c, 0.1, -3/8, m? 0.1 Let n = -560.356 + -7.644. What is the smallest value in 1/10, n, 5, -0.4? n Let m = -1 - -0.7. Let p = 12784 + -63924/5. Which is the second smallest value? (a) m (b) p (c) 25 (d) 1/3 a Let g = -0.539 + -0.146. Let o = 0.785 + g. What is the second smallest value in o, 0.2, 23? 0.2 Let k = -22923/5 + 4585. Which is the biggest value? (a) -0.03 (b) k (c) 25 c Let y = -292 - -302. Suppose -10 + 10 = yw. Let x = -1 + -4. Which is the biggest value? (a) w (b) 0.1 (c) 1 (d) x c Let d be 3627/(-62)7/6. Let u = 69 + d. Which is the second biggest value? (a) -5 (b) 0.2 (c) u b Let o = -1.47087 + 0.17087. Which is the second biggest value? (a) -5 (b) 0.1 (c) -1/4 (d) 2/21 (e) o d Let w = 68 + -54. Let z = 2 - w. Let t be (z/15)/4*45/(-12). What is the second biggest value in 3, t, 0.3? t Let m = -4.81 + 0.81. Let k = -186 + 183.4. Let h = 0.4 - k. Which is the second smallest value? (a) m (b) h (c) 12 b Let i(o) = -o - 10. Let v be i(-9). Let x = 3.21 + -1.21. Let j = -1.6 + 2. Which is the biggest value? (a) v (b) j (c) 1/7 (d) x d Let j = 13019 - 12920.435. Let k = -99 + j. Let g = -0.065 + k. Which is the second smallest value? (a) -4 (b) g (c) -3 c Let s = 95 - 94.9	{ "pile_set_name": "DM Mathematics" }
- 2r - 74 = -0d for d. 5 Solve 18w - 1461x = -1460x + 74, -3w + 3x + 26 = 2w for w. 4 Solve 3h + 5u = 29, 872514u - 872515u + 10 = 2h for h. 3 Solve 4i - 4q - 1053 = -545 - 472, -2q = -4i + 28 for i. 5 Solve -8q + 88 = -6i, 2q - 137023 = -5i - 137105 for i. -16 Solve -4f = -2z - 2, 26911z + 4f - 68 = 26891z for z. 3 Solve 6j + c = -9j - 7j + 20j - 157, 21j = 5c - 1664 for j. -79 Solve -4p - 205 = 11t, -p + 12t + 677 - 448 = 0 for p. 1 Solve s + 132 = 2l + 2s - 134 + 99 + 18, 15 = 3s for l. 72 Solve -5w + 658h - 1314h = -661h - 50, 4w = -5h - 5 for w. 5 Solve -3h + 6h + 20 = r, -4h + 598 - 570 = -15r for r. -4 Solve -23 + 10 = k + h, 4k + 104h = -1744 + 392 for k. 0 Solve 2j = -3h - 20, 335h + 5j - 65 = 339h for h. -10 Solve w + b = 47, 6453b - 6457b + 32 = w for w. 52 Solve -2r - 210i + 211i + 8 = 0, r = 18i + 74 for r. 2 Solve -3t = -4g + 51, 0 = 2g + 287t - 144t - 145t - 32 for g. 3 Solve -30w - 130 = 4b, 2b - 68w = 4w + 22 for b. -25 Solve -31v - 316 = -5r, 26236r - 2v = 26242r + 52 for r. -5 Solve -o - 616782f = -616778f + 12, -o = -3f - 5 - 4 for o. 0 Solve -45z - 33z + q - 4 = -79z, 4z + 14q - 16 = 17q for z. 4 Solve 30x + 3g + 105 = 0, -4g = 96 + 4 for x. -1 Solve -25o - 34o - 191 = -62o - 5h, -14h = -6h - 296 for o. 2 Solve 3s - 29 = -3y + 19, -4s = 5y - 76 for y. 12 Solve 5u + 2o - 7o = 60, 0 = -2u + 6o + o - 3o + 26 for u. 11 Solve -31i + 5t = 325, -1138i + 1141i = 4t - 21 - 21 for i. -10 Solve -6o + 3x - 64 = -11o, 3x + 20 = o for o. 14 Solve 4b + 51 = -3z, -2z + 5 = 2z - 3b - 10 - 17 for z. -1 Solve 4p - 4 = 92517x - 92510x, -3p - 4x = -3 for p. 1 Solve 4p + 1543 = 70x + 1843, 0p - p - 11 = 4x for p. 5 Solve -1316k = -1312k + 4o - 124, 0 = 3k - 5o - 69 for k. 28 Solve 30c = -3a + 693, 45152a - 45147a + 2c - 51 = 0 for a. 1 Solve 5o + 27 = -94a + 92a, 0 = 168o - 5a + 113 for o. -1 Solve -239z + 476z - 241z = -0c + 19c - 97, -3z - 5c = -8 for z. -9 Solve x - 881 + 884 = 3h + h, 0x - 3h - 53 = -5x for x. 13 Solve 4l + 480g - 476g - 16 = 3l, g - 116 = -5l - g for l. 24 Solve 5f + 12h + 9h - 22h - 25 = 0, -7h = 3f + 175 for f. 0 Solve 0 = -2a + 2r - 20, -268 = -5a - 4r - 228 for a. 0 Solve 5y = -9v - 382, y + 85 = -171v + 169v for v. -43 Solve 5q + 21 = 4s - 21 + 7, -2s + 2q = -7s - 47 for s. -5 Solve 6f + 23m - 9m = 9m - 5 - 67, m = 31f + 372 for f. -12 Solve 4k + 349a + 336a = 671a - 50, -3k + 4a + 35 = 0 for k. 5 Solve -12a + 9a - 1 + 13 = -6a, 13 = o + a for o. 17 Solve 17y = 13y - 4f + 60, 2f + 12 = -f for y. 19 Solve -6f = -6r - 3f, -4f = -13r + 17r - 24 for r. 2 Solve 1096u - 1092u - d = 218, -2d = -15u + 814 for u. 54 Solve 5d - 4d - 22j - 10 = -3d, 6 + 4 = -2d - 2d + 2j for d. -3 Solve -z + 14410 = 3m + 14335, 240 = 9m - 3z + z for m. 26 Solve -l + w + 694 - 692 = 0, 23 = 4l + w for l. 5 Solve 18h = 5n + 601, -h - 275n + 37 = -276n for h. 32 Solve -s + 2800 = -4h + 2772, s + 2h + 8 = 0 for s. 4 Solve -4p + x - 19 = -8 + 48, 0 = 5p + x - 32 for p. -3 Solve 2b + 5l - 19 = -l - 1, -5l = -5b + 45 for b. 9 Solve -2m + 46 = -5c, -4c + c - 10m + m = 14c + 188 for c. -10 Solve 0 = 2x + 15x - 13x - 5q - 36, 0 = x + 7q + 24 for x. 4 Solve 9f - 332 = k - 358, 5f + 107 = 6k for k. 17 Solve 4h + 106 = -5y, 4h - 4y + 85557 - 85433 = 0 for h. -29 Solve 5u - 2n + 139 = 6, 101u + 238u - 3n = -n - 8483 for u. -25 Solve -2v - 2455206o + 2455218o = -982, 3v = -2v - o - 56 for v. 5 Solve 4l = -2k + 156, 5l + 0l - 794 + 526 = -39k for l. 38 Solve 21958l - 5p = 21957l + 189, p = -4l - 42 for l. -1 Solve 0 = 4x + 2v - 24, 1555x - 2v - 33 = 1553x - 9 for x. 8 Solve -2j - 14 = 4i, 3i = -2j - 123 + 68 + 42 for i. -1 Solve -12 = -19f + 8v - 6v, 7f - v + 9 = 5f for f. 2 Solve 5s = 40, -46d - 40 - 7 = -41d - 2s - 2s for d. -3 Solve 15h + 6 = -4b + 17h, -110b + 108b - 24 = 2h for b. -5 Solve 5 = -i - t, 24505i - 24514i = -2t + 100 for i. -10 Solve -119 + 364 = 5j, 0 = -3d + 4j - 211 for d. -5 Solve 42 = -3o + 9, -4q + 8q + 0q = 6o + 62 for q. -1 Solve -1322k - 15 = -1327k - 5m, 67 = -8k + 5m for k. -4 Solve -o - 4o + 9j + 22 = 0, -295o - 3j - 14 = -144o - 146o for o. -1 Solve 4z + 9w - 98 = 5z, 914w + 43 - 14 = 40z + 913w for z. 1 Solve 7943c = 7942c + t + 20, t = -2c + 43 for c. 21 Solve 148m + 8y + 38 = 68m + 74m, 8 = 2m + 3m + y for m. 3 Solve -12t + 2n = 41 + 25, -11t - 346n = -359n + 27 for t. -6 Solve 4u - 2u = 10, 0g - 6u - 13 + 49 = g - 4g for g. -2 Solve -3p - 11z + 91 = 0, -19z + 0 = 8p - 17z - 24 for p. 1 Solve -1346 = 3h - 8v - 1219, 0 = -4h + 4v - 156 for h. -37 Solve 0n = -5213t + 5212t + 4n, 6n - 24 = 4t - 4t for t. 16 Solve 0 = -4x + p + 135, 4x - 152p = 258 - 878 for x. 35 Solve 0 = 5t + 266u - 261u + 20, 0 = -3t + 3u - 63 + 99 for t. 4 Solve -2k + 24 = -c, 2k + 16 = -1979c + 1978c for c. -20 Solve -3g - 6g + 12g - 105 + 311 = 5g - 2j, -7j = 700 for g. 3 Solve 3a - 7a + 5m - 9 = -37, 3m + 7 = -2a - 23 for a. -3 Solve 4t = 123g + 385, 2t - g + 245 - 256 = 0 for t. 4 Solve -26w = -3b - 286 + 318, 1 = 3b + 5w for b. 2 Solve -v + 58 = 4w, 367274 = -2w + 3v + 367114 for w. 1 Solve 84 = -2d + 14i, 0 = 2d - 4d - 444i + 448i - 24 for d. 0 Solve -2s - 17 = -h, -46 = -4h + 47s + 295 for h. 3 Solve -388 = 17w - 3y, 3y - 61 - 58 = -181 + 59 for w. -23 Solve 3h + 24l = -21l + 49l + 18, -5h - l + 4 = l for h. 2 Solve 4d - 56 = 3d - d - 5x + 59, -7d = 3x - 417 for d. 60 Solve -38 = i + 3n, -29598876i + 17 = -29598875i - 2n for i. -5 Solve 4f = 21h - 356, -191240h - f - 89 = -191236h for h. 0 Solve 0 = r - 3n + 8 - 20, 169r + 3 = 172r + 2n for r. 3 Solve 11b = -i + 115, b - 28415i - 30 = -28419i for b. 10 Solve -3n + 2r - 18 = -2n - 5n, -6n + 71 = 4n - 2n + 11r for n. 2 Solve -128h + 125h - 4k + 0k = -135, -3h = 2k - 15 - 120 for h. 45 Solve -2q - 3s + 7s + 451 - 559 = 0, -6s = 24 for q. -62 Solve 248152o - 4y = 248155o - 64, 23 = -o + y for o. -4 Solve -55c - 3l = -53c - 23, -34c - 2l + 440 = 0 for c. 13 Solve 0 = -2g - 2x - 34, 4x - 81056 = 5g - 80971 for g. -17 Solve 4w - 348p + 16 = -344p, 2w - 6p = -36 for w. 3 Solve 0 = -45480d + 45484d + n - 4, 0 = 4d - 5n - 76 for d. 4 Solve 799m - 801m + 66 = -72c, 2m - 8c = 2 for m. -3 Solve u - 1 = -2y - 0u + 3, -5y - 10u + 98 - 28 = 0 for y. -2 Solve -4v - 2o - 30 = 0, v - 518885 + 518891 = -2o for v. -8 Solve -5f - 24 = 4o, -53239o - 28 = -53231o + 5f for o. -1 Solve 0q - 12 = -3q + 4v + 1, 0q = -0q + 3q + 83v - 448 for q. 11 Solve 6253t = 3133t + 3116t + g + 25, 2g = -2t + 30 for t. 8 Solve 5514 = 2t + 2g + 5524, 3t - 18g - 90 = 0 for t. 0 Solve 6j - 7j + 2787x - 2791x = -6 - 0, 4j + 6 = -31x for j. 14 Solve 29 + 26 = -11w, 35w - 38w + 1 = -4a for a. -4 Solve 16 = -5t + q, -5q + 920 = -5t + 840 for t. 0 Solve 5p - 22p - 2l + l - 2 = 31, -66 = -2l - 234 for p. 3 Solve -4u + 319j - 157j - 9 = 167j, 0 = 3u + 3j + 6 for u. -1 Solve 8z - 15z + 3z + 17h + 213 = -130, 3z = 2h + 225 for z. 73 Solve -77u - 9x + 166 = 3x - 9x, 5u = 4u + 4x - 14 for u. 2 Solve -5g + 5t + 91 = 2g - 10g + 17, -5g - 2t = 22 for g. 2 Solve 4y + 70 = -7s, -6s - 40 = 7y + 12y - 17y for y. -14 Solve 133j = 399, y + 2y - 2j - 86 + 12 - 58 = 0 for y. 46 Solve 0 = -2k - 2d + 56, -2127k + 280 = -2118k - 5d for k. 30 Solve -144s = 5r - 1228 + 1050, 0s = 3r + 5s + 56 for r. -22 Solve 8i = -5o - 51 - 78, -1515o - 18 = i - 1514o for i. -13 Solve -5c = 5d - 1 - 134, 0c - 162 = 5c - 6d for c. 0 Solve -55l + 68l + 3b - 53 = 0, -2l + 26 = -4b for l. 5 Solve -n - 1343k + 133 = -6n - 1340k, 0 = -5n + 2k - 87 for n. 1 Solve 9120i - 9120i + 2n = -4, 9i + 3i - 3n = 59 - 5 for i. 4 Solve 0 = -2i - 59v - 218, 15476v = i + 15473v - 21 for i. 9 Solve 24j - 18k = 22j + 78, 25 - 15 = -5j - 4k + 9 for j. 3 Solve 3j = w + 17, 5w + 5j + 1367709 = 1367704 for w. -5 Solve 2s + 2*x - 1	{ "pile_set_name": "DM Mathematics" }
n -533131, -1066392, -1599653, -2132914? -2666175 What is the next term in 303217, 303194, 303165, 303130, 303089, 303042, 302989? 302930 What comes next: -7492, -29686, -66608, -118270, -184684? -265862 What is the next term in 3784, 3891, 4040, 4231? 4464 What is next in 1340, -3398, -11294, -22348? -36560 What is the next term in -816316, -816315, -816314, -816313? -816312 What is next in 76728, 153452, 230176? 306900 What comes next: -311789, -311853, -311919, -311987? -312057 What is the next term in -2688260, -10753041, -24194342, -43012163, -67206504, -96777365, -131724746? -172048647 What is the next term in 5740, 11688, 17650, 23620, 29592, 35560? 41518 What is next in 504, 954, 1408, 1872, 2352? 2854 What is next in -147, -289, -119, 693, 2477? 5563 What comes next: 50814, 51576, 52334, 53088, 53838, 54584? 55326 What is the next term in -1019574, -1019175, -1018772, -1018365, -1017954, -1017539? -1017120 What comes next: -226163, -452344, -678541, -904754, -1130983? -1357228 What comes next: 29556, 116808, 261778, 464466, 724872, 1042996? 1418838 What comes next: 1553062, 3106546, 4660030, 6213514, 7766998? 9320482 What is next in 55725, 222919, 501551, 891609, 1393081, 2005955, 2730219, 3565861? 4512869 What is the next term in -8058165, -8058164, -8058163, -8058162, -8058161? -8058160 What is the next term in -24759, -48988, -73219, -97452, -121687? -145924 What is the next term in 44, 9, -46, -127, -240, -391? -586 What comes next: -125995, -252907, -379821, -506737, -633655, -760575? -887497 What is next in 35808, 143079, 321820, 572031, 893712? 1286863 What comes next: -64870311, -64870313, -64870315, -64870317? -64870319 What is next in 88989, 178018, 267047, 356076, 445105? 534134 What comes next: 3377846, 6755692, 10133538, 13511384? 16889230 What comes next: 931, 3821, 8853, 16219, 26111, 38721, 54241? 72863 What is next in 15051141, 30102282, 45153423, 60204564? 75255705 What is the next term in -429199, -858165, -1287131? -1716097 What is next in -2305, -2215, -2111, -1987, -1837, -1655, -1435, -1171? -857 What is next in -41600605, -41600606, -41600607? -41600608 What comes next: 17949, 17973, 18003, 18039? 18081 What comes next: 2644, 11326, 26028, 46744, 73468? 106194 What is the next term in -103004, -411897, -926708, -1647437, -2574084, -3706649? -5045132 What is the next term in -65705, -127616, -189527, -251438, -313349, -375260? -437171 What is the next term in 1946782, 1946755, 1946716, 1946671, 1946626, 1946587, 1946560, 1946551? 1946566 What is next in -1742, -5629, -12108, -21173, -32818, -47037, -63824? -83173 What is next in 168845, 337574, 506303? 675032 What is the next term in 2132, 5121, 8976, 13697, 19284? 25737 What is the next term in 344, 420, 546, 704, 876? 1044 What is next in -39061, -57376, -87903, -130642? -185593 What is the next term in 3065207, 6130501, 9195795, 12261089, 15326383? 18391677 What is next in -277467, -554955, -832433, -1109895, -1387335, -1664747? -1942125 What is the next term in 4454629, 4454621, 4454613, 4454605, 4454597? 4454589 What comes next: -111890, -223819, -335748, -447677? -559606 What is the next term in -8533967, -17068065, -25602163, -34136261? -42670359 What comes next: -1080551, -1080591, -1080673, -1080815, -1081035? -1081351 What comes next: -54691, -109370, -164051, -218734, -273419? -328106 What is next in -3315725, -3315724, -3315719, -3315710, -3315697? -3315680 What is next in -64166, -256601, -577314, -1026305, -1603574, -2309121, -3142946? -4105049 What is next in 141, 923, 2751, 6147, 11633, 19731? 30963 What comes next: -3137, -13307, -30529, -54809, -86153, -124567, -170057? -222629 What comes next: 35407, 71523, 107641, 143761? 179883 What comes next: -74800, -74412, -74024, -73636, -73248? -72860 What comes next: -73340, -582898, -1965986, -4659368, -9099808, -15724070, -24968918? -37271116 What is the next term in 1916, 500, -3344, -10840, -23212, -41684, -67480, -101824? -145940 What is the next term in 1187, 4504, 10059, 17852, 27883, 40152, 54659? 71404 What comes next: -33351, -10317, 28073, 81819, 150921, 235379? 335193 What is next in -1070, -4259, -9572, -17009, -26570? -38255 What is the next term in -62215, -62248, -62269, -62272, -62251, -62200, -62113? -61984 What is next in 1111, 4697, 10753, 19345, 30539, 44401? 60997 What is next in -119382, -238717, -358004, -477243? -596434 What is next in 90247, 164383, 238519, 312655, 386791? 460927 What comes next: -49998, -48300, -45486, -41568, -36558, -30468, -23310, -15096? -5838 What is next in -656, -5287, -17834, -42233, -82420, -142331, -225902? -337069 What comes next: 467883, 467867, 467851, 467835, 467819, 467803? 467787 What is the next term in 31489, 63101, 94713, 126325, 157937? 189549 What is the next term in -189174, -756715, -1702620, -3026889, -4729522, -6810519, -9269880? -12107605 What is next in 20687368, 41374740, 62062112, 82749484? 103436856 What is the next term in -805, -3165, -6935, -11977, -18153, -25325? -33355 What comes next: 45996, 45756, 45364, 44826, 44148, 43336, 42396, 41334? 40156 What is the next term in 18632, 74243, 166826, 296387, 462932, 666467, 906998? 1184531 What is the next term in -72517, -72485, -72441, -72385, -72317, -72237? -72145 What is next in -303647285, -303647286, -303647287, -303647288, -303647289? -303647290 What is the next term in -7939, -63170, -212995, -504712, -985619, -1703014, -2704195, -4036460? -5747107 What is the next term in -39047, -32153, -25259? -18365 What is the next term in -107643779, -107643778, -107643777, -107643776? -107643775 What comes next: -86647366, -173294731, -259942096, -346589461? -433236826 What comes next: -2125, -95, 5415, 16145, 33835? 60225 What comes next: 6260, 50028, 168848, 400256, 781788, 1350980, 2145368, 3202488? 4559876 What is the next term in 4507, 17000, 37647, 66448, 103403, 148512, 201775? 263192 What is the next term in -40933, -82389, -123845? -165301 What is the next term in -174022, -174018, -174018, -174028, -174054, -174102, -174178? -174288 What comes next: -386411, -772589, -1158767, -1544945, -1931123, -2317301? -2703479 What is the next term in -47987, -50472, -52957? -55442 What is the next term in -21249, -19169, -17089, -15009, -12929? -10849 What comes next: 30278, 30253, 30212, 30155? 30082 What comes next: 12539, 23501, 34295, 44837, 55043, 64829? 74111 What is the next term in 1792, 2345, 2896, 3445? 3992 What is the next term in -90366566, -90366564, -90366562? -90366560 What is the next term in -5162, -20101, -45014, -79919, -124834? -179777 What comes next: 9331733, 9331731, 9331729, 9331727, 9331725, 9331723? 9331721 What comes next: 5875, 23924, 54001, 96106, 150239, 216400, 294589? 384806 What is next in 10874415, 10874413, 10874411, 10874409, 10874407, 10874405? 10874403 What is the next term in -3748, -588, 8016, 24794, 52476? 93792 What comes next: -41088, -40540, -39608, -38286, -36568? -34448 What is the next term in -136258, -272533, -408816, -545101, -681382, -817653, -953908? -1090141 What is next in 41853, 83348, 124843, 166338, 207833? 249328 What comes next: -77390336, -309561347, -696513034, -1238245397, -1934758436, -2786052151, -3792126542? -4952981609 What is the next term in 472416, 473397, 474378, 475359, 476340, 477321? 478302 What comes next: -1392, -1836, -2352, -2934, -3576? -4272 What is next in -18224978, -36449963, -54674948, -72899933? -91124918 What is next in -53860, -53797, -53734, -53671, -53608? -53545 What is next in 1974286, 1974289, 1974292? 1974295 What comes next: -2940, -3941, -3014, -165, 4600? 11275 What comes next: -4039, -4140, -4443, -5050, -6063? -7584 What is the next term in -3960, -7919, -11888, -15855, -19808? -23735 What is the next term in 30829, 61615, 92465, 123379? 154357 What is next in 61309, 242572, 543779, 964924, 1506001, 2167004, 2947927, 3848764? 4869509 What comes next: 39914541, 79829084, 119743627? 159658170 What is next in 294939363, 294939367, 294939383, 294939417, 294939475, 294939563? 294939687 What is next in -65640986, -65640981, -65640974, -65640965? -65640954 What comes next: 14953, 59490, 133813, 237928, 371841, 535558, 729085, 952428? 1205593 What comes next: -682, 70, 2042, 5840, 12070, 21	{ "pile_set_name": "DM Mathematics" }
alculate cx(o) + kg(o). 2o2 - 2o Let c(x) = -72x2 + 4x - 5. Let u(f) = -2f2 + f - 1. Calculate -c(d) + 4u(d). 64d2 + 1 Let t(f) = 16f2. Let v be 0 - 1/((-28)/(-16) - 2). Let c(r) = -r2. What is vt(q) + 72c(q)? -8q2 Let i(z) = z. Let x(h) = h2 + h. Let j be ((-6)/((-48)/(-20)))/((-5)/2). Calculate ji(u) - x(u). -u*2 Let p(n) = -9n + 5 + 8n - 2n. Let x(v) = 1. What is p(o) - 3x(o)? -3o + 2 Let w(a) = -9086a. Let z(o) = -233o. What is 3w(n) - 118z(n)? 236n Let a be -1(292/(-18) + 2/9). Let c(n) = -10n3 - 16n*2 + 16. Let h(v) = 2v*3 + 3v*2 - 3. Determine ah(f) + 3c(f). 2f*3 Let d(x) = -9x. Let q(r) = -494r. Determine -22d(t) + 2q(t). -790t Let s(m) be the first derivative of -m*5/8 + 13m*4/24 - 3m*3 - 14. Let p(c) be the third derivative of s(c). Let t(a) = 8a - 7. What is 6p(j) + 11t(j)? -2j + 1 Let k(n) = -52n - 3. Let v(l) = -13l - 1. Give 2k(s) - 9v(s). 13s + 3 Let p(l) = -38l2 + 2l - 3. Let k be p(1). Let d = -36 - k. Let a(w) = 3w + 4. Let u(s) = -3s - 3. What is da(g) + 4u(g)? -3g Let u be 2/(-9) - 340/90. Let s(c) = 10c*3 - 7c*2 + 7. Let h(w) be the first derivative of 3w*4/4 - 2w*3/3 + 2w + 1. Calculate us(k) + 14h(k). 2k3 Let t be (-11)/((-11)/33). Suppose 0x = tx - 9. Let u(p) = -xp2 - 5 - 12p + 5p + 2p. Let s(l) = 3l2 + 4l + 4. Calculate -5s(h) - 4u(h). -3h2 Let k(p) = -18 + 6p - 5p3 + p2 + 3 + 8 + 6. Let q(j) = 9j*3 - 2j*2 - 11j + 2. Give 11k(g) + 6q(g). -g3 - g2 + 1 Let a(p) = -9p3 - 3p*2 - 9p + 5. Let f(y) = -13y3 - 4y*2 - 13y + 7. Suppose 0 = -3j - 2b + 27, -9 + 3 = -2b. Give ja(n) - 5f(n). 2n3 - n2 + 2n Let z(l) = -5l*2 - 3l - 3. Let b be 50/15 + (-8)/24. Let h(t) = -14t2 - 8t - 8. What is bh(n) - 8z(n)? -2n2 Let h(m) = -m - 2. Let i(b) = 2b*3 + 11b*2 - 9b - 15. Let a be i(-6). Let y(o) = -o*3 - o - 2. Give ay(z) - 4h(z). -3z*3 + z + 2 Suppose 0 = -5s + 3m - 37 + 29, -4 = -s + 2m. Let p(h) = -h. Let z(a) = 4a - 1. Let j = 24 - 38. Calculate jp(n) + sz(n). -2n + 4 Let d(g) = 7g + 7. Suppose -3l - 16 = a, 5l + 8 = -2a - 20. Let r(p) = -6p - 6. What is ld(n) - 5r(n)? 2n + 2 Let l(n) = 9n3 + 32n*2 + 11n - 1. Let i(g) = -3g3 - 11g*2 - 4g. Calculate -8i(s) - 3l(s). -3s3 - 8s2 - s + 3 Let o = -879 + 884. Let r(n) = -n2 - n + 1. Let i(c) = 8c2 + 3c - 5. What is or(p) + i(p)? 3p*2 - 2p Let q be 13/(26/(-8)) + -2. Let h(r) = 3r2 - 6r + 6. Let c(j) = 4j2 - 7j + 7. What is qc(u) + 7h(u)? -3u2 Let g(f) = -3f + 4. Let u(l) = -l + 2. Let z(b) = b*2 - 51b + 275. Let i be z(45). Let w(p) = p + 1. Let m be w(-3). Calculate iu(r) + mg(r). r + 2 Let m(w) = 39 + 10w - 81w + 0w - 137w. Let i(s) = -11s + 2. Calculate -39i(l) + 2m(l). 13l Let s(m) = m + 1. Let q(x) = 25x2 + 8x + 8. What is 5q(a) - 40s(a)? 125a2 Let a = -47 + 51. Let g(o) = -29o + a + 1 + 23o - 4. Let b(c) be the first derivative of c2/2 - 1. Determine 5b(h) + g(h). -h + 1 Let l(c) = -3c2 - 2c - 2. Let s(v) = -56v - 20v + v*2 + 76v + 1. Let m be 5 + ((-2)/2)/1. Give ms(z) + 2l(z). -2z2 - 4z Let y(u) = -8u + 9. Let z(h) = 14h - 16. Calculate -5y(o) - 3z(o). -2o + 3 Let o(k) = -k3 - k2 + 7k + 1. Let u be o(-3). Let h(c) = -4c + 3. Let s(t) = 1. What is us(q) + h(q)? -4q + 1 Let y(t) = -361t*2 + 3t + 5. Let f(c) = -363c2 + 2c + 3. Determine 3f(z) - 2y(z). -367z2 - 1 Let h(f) = -23f*2 + 6. Let g(z) = -68z*2 + 17. Let a = 782 + -765. Calculate ah(d) - 6g(d). 17d*2 Let u = -4 + -7. Let m(y) = 6y*2 + 2y + 11. Let w(z) = -2z3 - 4z*2 - 3z. Let s be w(-2). Let j(g) = 3g2 + g + 6. Give sm(n) + uj(n). 3n*2 + n Let s = 1876 - 1871. Let j(z) = 7z*2 + 8z + 5. Let m(r) = -6r2 - 7r - 4. Calculate sj(a) + 6m(a). -a*2 - 2a + 1 Let d(r) = r + 31. Let y(l) = -2l - 60. Calculate -10d(g) - 4y(g). -2g - 70 Let i(o) = o - 5. Let l(u) = 6u - 7. Give 3i(v) - l(v). -3v - 8 Let c(a) be the third derivative of a5/60 + a4/24 + a3/6 - 2a*2 + 32. Let j(d) = -2d - d*2 + 1 - 2d3 + d3 + 2d3. Determine -c(n) - j(n). -n3 + n - 2 Let f(x) = -x + 1. Suppose 0 = 5s - 76 + 66. Let r(q) = -22q + 18. Calculate sr(m) - 36f(m). -8m Let g(r) = -549r3 + 13r*2 - 14r + 7. Let l(f) = -183f3 + 4f*2 - 4f + 2. Determine -2g(v) + 7l(v). -183v3 + 2v2 Let i(p) = -p2. Suppose -255 = -25m - 80. Let h(c) = c2. What is mi(f) + 4h(f)? -3f*2 Let g(m) = -m + 1. Let s be (-1)/2 - (-35)/14. Let t = -1 - -1. Let r(x) = t - sx + x + 3x - 1. Determine 4g(p) + 3r(p). 2p + 1 Let q(w) = 1. Let j(o) be the third derivative of o7/5040 - o6/360 - o*5/30 + 9o*2. Let c(m) be the third derivative of j(m). What is 2c(r) + 5q(r)? 2r + 1 Let h(t) = -8t - 9. Let g be -2 + (-4)/(20/(-25)). Let p(m) = -4m - 4. What is gh(j) - 7p(j)? 4j + 1 Let y(k) = -5k. Let m = -69 - -18. Let r = -49 - m. Let h(q) = 6q. What is rh(x) + 3y(x)? -3x Let s(c) = 2c3 - 3c*2 + 13c. Let d be (22/8)/((-14)/56). Let z(u) = u3 - 2u*2 + 12u. Give ds(l) + 3z(l). -l*3 + 10l Let b(u) = -3u. Let q(c) = 283c*2 + 1698c. Calculate -566b(m) - q(m). -283m*2 Let f(d) = -68d*3 + 15d*2 + 5d - 7. Let c(n) = 33n3 - 7n*2 - 2n + 3. What is -7c(b) - 3f(b)? -27b3 + 4b2 - b Let h(v) = -v3 - 5v2 - 3v - 4. Let j(d) = -5 - 3d2 - d - d3 - 3d*2 + 12d - 15d. Determine 5h(a) - 4j(a). -a3 - a2 + a Let c(n) = -6n*3 + 2n2 + 1. Let p(b) = -b3 + 4b2 + 6b. Let s(j) = -j*2 - 2j. Let o(x) = -p(x) - 3s(x). What is c(w) + 2o(w)? -4w3 + 1 Let v(a) = -1. Let s(p) = -8p + 3. Let b be (-357)/952 + ((-74)/16 - 0). Give bv(k) - s(k). 8k + 2 Let f(v) = -9v3 + 8v - 8. Let p(u) = -u*3 + u - 1. Suppose 4g = 118 - 98. Determine gf(a) - 40p(a). -5a3 Let j = 60 - 57. Let g(y) = 6 + y2 + 2 - j - 4. Let o(x) = -2x*3 - 4x*2 - x - 6. Calculate 6g(d) + o(d). -2d3 + 2d*2 - d Let d(y) = 2y - 3. Let f be (0 - 8/(-4))/(-2). Let q(c) = -1. Determine fd(r) - 2q(r). -2r + 5 Let t(y) = 2y*2 - 4y + 4. Let n = 858 + -885. Let u(o) = 15o2 - 27o + 27. What is nt(k) + 4u(k)? 6k2 Let j(t) = -t2 - 4t - 4. Let x(n) = 25n2 - n2 + 11 - 15n*2 - 6n*2 + 11n. What is 11j(q) + 4x(q)? q*2 Let h(t) = 2t3 + t2 - 3t + 9. Let z(m) = 2m*3 - 2m + 8. Let w be (-96)/(-54) - (-2)/9. Determine wh(u) - 3z(u). -2u3 + 2u*2 - 6 Let d(h) = -5h*3 - 15h*2 - 7h + 1. Let j(z) = z3 - z2 + 3z - 1. Determine d(m) + 3j(m). -2m3 - 18m*2 + 2m - 2 Let k(w) = -2w3 + 33w*2 + 19w - 31. Let n be k(17). Let t(a) = a*3 + 2a*2 + 3a + 6. Let v(f) = f*2 + 2f + 5. Determine nv(h) - 2t(h). -2h3 - h2 + 3 Let u(f) = -f. Let z = -5 + 17. Suppose 2p - 4t = -z, -p - 10 = 2p - 4t. Suppose -pr - 4 - 2 = 0. Let a(h) = 2. What is ru(l) - a(l)? 3l - 2 Let a(q) = -3q3 + q2 - 3q - 3. Let u be (7/2 + -3)-10. Let y(n) = 6n*3 - 2n*2 + 5n + 5. Calculate ua(j) - 3y(j). -3j3 + j2 Let o = -5 + 4. Let u be o - (8 - 2)-2. Let j(x) = x*2 + 12x - ux + 1 + 0x*2. Let c(f) = -5f*2 - 5f - 6. Give -c(t) - 4j(t). t2 + t + 2 Let j(f) = -4f + 9. Let g(l) = l*2 - 9l + 20. Determine -4g(p) + 9j(p). -4p2 + 1 Let m(a) = 37a - 14. Let s(u) = 111u - 38. Calculate -11m(o) + 4s(o). 37o + 2 Let g(a) = 1179a3 + 5a*2 + 2a + 5. Let y(r) = 590r3 + 2r*2 + r + 2. Determine -2g(q) + 5y(q). 592q3 + q Let l(n) = n2 - 5n - 17. Let c = -25 + 32. Let x be l(c). Let q(z) = 2z*3 + 3z*2 - 4. Let a(t) = -3t*3 - 5t*2 + 7. What is xa(r) - 5q(r)? -r3 - 1 Let u(x) = 4x*3 - 3x*2 - 2x. Let a(b) = 4b3 - 4b*2 - 2b. What is 6a(m) - 7u(m)? -4m3 - 3m*2 + 2m Let z(u) = -11u2 + 13u. Let x(n) = -5n2 + 6n. Let y = 308 - 305. Calculate yz(d) - 7x(d). 2d2 - 3d Let r(t) = 37t + 4. Let v(k) = 9k + 1. Calculate 2r(l) - 9v(l). -7l - 1 Let k(r) = 59r - 8. Let d(c) = -5c. Determine 5d(y) + k(y). 34y - 8 Suppose 4l + l = 25. Let g(c) = 2c + 1. Let s(d) = -2d - 1. Suppose 0w = -w + 20. Suppose 8 = -2v + w. Give ls(a) + vg(a). 2*a + 1 Let s(z) = -z. Let l(	{ "pile_set_name": "DM Mathematics" }
*5/5 - 109n*4/3 + 36n*3 + 961n. Let h(u) = 0. Calculate u. 0, 1, 54 Let s(w) be the first derivative of -4/9w6 - 68/3w - 164/15w5 - 172/3w*2 - 632/9w*3 - 128/3w*4 - 152. Find v such that s(v) = 0. -17, -1, -1/2 Factor -4n*2 + 19n*2 + 427n*3 + 21n*2 + 4n*4 - 47 - 471n*3 + 44n + 7. 4(n - 10)(n - 1)*2(n + 1) Let y(c) be the first derivative of -15/4c4 - 2c*3 + 0c - 12/5c5 - 1/2c*6 + 0c*2 + 11. Suppose y(x) = 0. What is x? -2, -1, 0 Let x(t) be the first derivative of 0t + 1/6t3 + 187 - 9/4t*2. Factor x(u). u(u - 9)/2 Let v be ((-1272)/(-5))/((-90)/100). Let x = v - -283. Solve d + 2/3 + xd2 = 0 for d. -2, -1 Let s be (8 + -965 + 4/2)1. Let m = 6689/7 + s. Factor -4/7q4 + 0 + mq*3 + 16/7q*2 - 16/7q. -4q(q - 2)(q - 1)(q + 2)/7 Let t be (-1 + (-3 - -23))(3 - 8). Let p = 146 + t. Factor -107b + 51b + pb + 10 - 5b2. -5(b - 1)(b + 2) Let j(n) be the third derivative of -7n*2 + 65/96n*4 - 1/48n*5 + 35/12n*3 - 3n + 0. Determine a, given that j(a) = 0. -1, 14 Let w(o) be the third derivative of -1/240o6 + 2o*2 + 5/48o*4 + 0o*3 - 1/30o*5 + 0o + 146. Factor w(z). -z(z - 1)(z + 5)/2 Let f = -110 - -112. Solve 94s2 - 98s*f + 8s - 28s + 24 = 0 for s. -6, 1 Let w be ((-98)/735)/(372/(-45) + 8). Factor -6 - 13/2l - wl2. -(l + 1)(l + 12)/2 Let f(n) be the second derivative of -n*5/10 + 11n*4/2 + 70n*3/3 + 12n - 20. Factor f(x). -2x(x - 35)(x + 2) Suppose 5b + 600 = 5t, 31t = 33t + 4b - 210. Let l be 110 - t - 2-4. Factor -3/8a*l + 1/2 + 0a - 7/8a2. -(a + 1)(a + 2)(3a - 2)/8 Let l(w) be the second derivative of 5w4/48 + 685w*3/4 + 844605w*2/8 - 339w. Factor l(z). 5(z + 411)2/4 Suppose -2y = 5w - 21, -4w = -y - 0w - 9. Suppose -ym = 4l - 11, -3m = m - 3l - 23. Factor m + 0 - 5v*3 - 15v*2 + 15. -5(v - 1)(v + 2)2 Let m(c) be the third derivative of c7/42 - c6/8 - c5/4 + 55c*4/24 - 5c*3 - 23c*2 + 22. Factor m(s). 5(s - 3)(s - 1)2(s + 2) Determine d, given that -26/3 + 25/3d + 1/3d*2 = 0. -26, 1 Let z = 3057 + -9139/3. Let y(f) be the first derivative of 4f*2 + 10 - 2f*5 + 0f + 17/2f4 - zf*3. What is r in y(r) = 0? 0, 2/5, 1, 2 Suppose 0 = r - 20 + 14. Let h be ((-22)/r)/(9/(-27)). Find x, given that 7x + 4x2 + 16 - hx - 12x + 0x = 0. 2 Let t(q) be the second derivative of -q*4/8 - 7q*3/4 + 276q*2 + 4q + 306. Factor t(w). -3(w - 16)(w + 23)/2 Determine m so that 1184/9m3 + 1024/9m + 214/9m4 - 2560/9 + 14/9m*5 + 2624/9m*2 = 0. -4, 5/7 Let d be (15/50)/(9273/28100). Factor 32/11 + 32/11x + dx2 + 1/11x*3. (x + 2)(x + 4)2/11 Let c(r) be the first derivative of r3/12 + 9r2/2 - 117r/4 + 890. Let c(q) = 0. What is q? -39, 3 Let v(m) = -8m - 133. Let x be v(-15). Let d be 2/5 + 0/x. Factor dn - 1/5n2 - 1/5. -(n - 1)2/5 Let u(q) be the second derivative of -5/3q*3 - 63q - 1/12q4 + 0q*2 + 0. Factor u(b). -b(b + 10) Let k(g) = -44g2 + 45g - 71. Let j(p) = -23p2 + 19p - 36. Let d(l) = -11j(l) + 6k(l). Factor d(r). -(r - 5)(11r - 6) Let r = -76733 + 76735. What is o in -1/3o4 - or - 1/3o + 0 - o*3 = 0? -1, 0 Let c(k) = 32k + 14. Let n be c(2). Let a = 83 - n. Factor 0 + 5/3u2 - 1/3u*a + 2/3u - 1/3u4 + u3. -u(u - 2)(u + 1)3/3 Let y(v) = -3v - 16. Let h be y(-6). Suppose hm - 2 = -0c + c, c + 4m = 10. Factor 16 + 4g*4 + 52gc - g3 + 26g + 22g + 33g3 - 8g*3. 4(g + 1)*2(g + 2)*2 Let p(m) be the first derivative of 0m*5 + 0m*3 + 0m - 1 - 1/2m2 + 0m*4 + 1/280m*6. Let w(k) be the second derivative of p(k). Factor w(f). 3f3/7 Let s(w) be the first derivative of w3/18 + 41w2/12 + 44w + 4628. Factor s(f). (f + 8)(f + 33)/6 Suppose 541g = 39 + 2125. Factor -5/2o3 + 5/2o + 5/6o2 - 5/6o*g + 0. -5o(o - 1)(o + 1)(o + 3)/6 Let j be -2 + 3/6 + (-1089)/(-6). Factor -539 - 21f*2 - jf - 19f2 + 35f*2 - 1081. -5(f + 18)*2 Let n(d) be the first derivative of 8/27d*3 + 1/54d*4 + 7/9d*2 - 21d - 21. Let p(w) be the first derivative of n(w). Determine f, given that p(f) = 0. -7, -1 Factor -s*4 + 39s*3 + 1334s*2 + 2s*4 - 68s*3 + 8575 - 10290s + 458s2 - 49s3. (s - 35)2(s - 7)(s - 1) Let s(y) = 30y2 - 855y - 831. Let u(r) = -23r2 + 642r + 623. Let n(t) = 7s(t) + 9u(t). Suppose n(x) = 0. What is x? -1, 70 Let l(h) be the third derivative of -h*6/180 - 47h*5/90 - 511h*4/36 - 539h*3/3 - 56h*2 - 29h. Factor l(c). -2(c + 7)2(c + 33)/3 Factor -34/7h3 + 40/7 - 118/7h + 114/7h2 - 2/7h*4. -2(h - 1)*3(h + 20)/7 Let q(k) be the second derivative of 11k4/18 + 41k*3/3 + 22k*2/3 + 1293k. Factor q(o). 2(o + 11)(11o + 2)/3 Let t(i) be the third derivative of i6/40 - 41i*5/20 - 177i*4/8 - 135i3/2 - i2. Factor t(s). 3(s - 45)(s + 1)(s + 3) Let y(g) be the first derivative of -g6/1080 + g5/90 - g4/24 - 194g*3/3 - 186. Let l(i) be the third derivative of y(i). Solve l(m) = 0 for m. 1, 3 Let o(b) = 12b*2 + 2296b + 108132. Let c(k) = -4k2 - 766k - 36037. Let w(m) = -8c(m) - 3o(m). Factor w(i). -4(i + 95)2 Let h(p) be the third derivative of -p6/40 - 41p*5/10 - 239p*4/8 - 79p*3 + 8p*2 + 294. Factor h(o). -3(o + 1)(o + 2)(o + 79) Let d = -403 - -407. Factor -5q2 - 25 + 5q*3 - 4q*d + 25 - 5q*5 + 9q*4. -5q*2(q - 1)*2(q + 1) Let k be 0 - ((-74)/19 - 10/95). Factor 11z2 + 16 - k + 8z + 2z2 - 17z*2. -4(z - 3)(z + 1) Let z = 158398/17265 - -88/3453. Factor -46/5b*2 - 1/5b*3 + 1/5b + z. -(b - 1)(b + 1)(b + 46)/5 Let k(t) be the first derivative of 3/10t3 - 52 + 1/5t - 1/8t4 - 7/20t*2 + 1/50t*5. Factor k(s). (s - 2)(s - 1)*3/10 Let m be (((-9)/3)/(-1))/((-1)/7). Let f = m + 24. Let 9c + 7c3 - 8c*3 - 2c*3 - 3c*2 - fc = 0. Calculate c. -2, 0, 1 Let f(q) be the second derivative of -q7/14 + q6/5 - q4/2 + q3/2 - 3q + 113. Let f(r) = 0. Calculate r. -1, 0, 1 Let u(a) be the third derivative of 1/735a*7 + 0 - 5a*2 + 0a*6 - 1/70a*5 - 1/42a*4 + 0a*3 + 7a. Factor u(g). 2g(g - 2)(g + 1)2/7 Let g(a) = 23a - 181. Let l be g(8). Let s be -5 - (l + -2 + -9). Factor 0k + 4/9k*2 + 0 + 2/9k*s - 2/9k*4. -2k*2(k - 2)(k + 1)/9 Suppose 0 = 9g - 8g + 2n, 0 = 2g - 2n + 5n. Suppose -22v + 26v - 8 = 0. Solve 7/2u*5 + 6u4 - uv + g + 3/2u3 + 0u = 0. -1, 0, 2/7 Let k = -807 + 832. Let d be (-30)/k(-3)/65. Suppose -4/3l4 - 22l + 20/3ld + 16/3l*2 + 12 - 2/3l*5 = 0. What is l? -3, 1, 2 Suppose 5i - 3g = 4 - 10, -9i = 2g - 4. Suppose 2/3q*2 - 5/6q*3 + 0 + iq + 1/6q4 = 0. Calculate q. 0, 1, 4 Let y(l) be the second derivative of -5l7/42 + l6 + 14l5 + 5l*4/2 - 995l*3/6 + 330l*2 + 1274l. Solve y(f) = 0 for f. -4, -3, 1, 11 Let j(r) be the first derivative of -166/3r3 + 1/2r*4 - 3362r + 1763r2 - 185. What is c in j(c) = 0? 1, 41 Let h(d) = 3d*2 - 78d + 423. Let m(l) = -l - 1. Let f(u) = h(u) + 3m(u). Find x, given that f(x) = 0. 7, 20 Let c = 1157 - 8097/7. Suppose -3l = -3z + 12, -8 = -8z + 5z + l. Factor -2/7 - co*z + 4/7o. -2(o - 1)2/7 Let a(x) be the third derivative of -13x*5/150 + 5x*4/3 + 32x*3/15 + 1423x*2. Factor a(v). -2(v - 8)(13v + 4)/5 Let q(f) = -332f + 38182. Let s be q(115). Factor 6 + 1/4h*s + 25/4h. (h + 1)(h + 24)/4 Let f = 40 - 37. Suppose 0k = fk - 6. Factor -7 - 5 - 100z - 124zk - 64z*3 - 51z*2 - 49z*2. -4(z + 3)(4z + 1)*2 Let m(r) be the first derivative of -5r*4/28 + 9r*3/14 + 103r + 35. Let v(h) be the first derivative of m(h). Find p, given that v(p) = 0. 0, 9/5 Suppose -759s = -357s - 374s - 168. Let 0 - 3n + sn4 + 17/4n*3 - 9/4n*5 - 5n*2 = 0. Calculate n. -2/3, 0, 1, 3 Let r = -7/181936 - -3274883/909680. Find u, given that -352/5 - 150u*3 + ru*4 - 280u - 1816/5u2 = 0. -1, -2/3, 44 Let n be 3 + (3/(-6))/(5/10). Factor -2b*n - 12b + 10b4 - 278b*3 + 290b*3 - 2b*2 - 6b*4. 4b(b - 1)(b + 1)(b + 3) Let d(g) be the first derivative of g6/2 - 41g*5/5 - 107g*4/4 - 79g*3/3 - 8g**2 + 4514. Solve d(p) = 0 for p. -1, -1/3, 0, 16 Le	{ "pile_set_name": "DM Mathematics" }
z Let v = -1451/5 + 291. Let f(j) = -4j - 2. Let c be f(-4). Suppose 0 = 3n + d - 4, 3n = -4d + 8d + c. Put n, 2/3, v in descending order. n, v, 2/3 Let x = -0.1467 - -0.1497. Put x, 0.4, 1 in increasing order. x, 0.4, 1 Let m = 94747 - 94737. Let k = 0.6 - 1. Let t = 0.3 + -2.3. Sort m, t, k in descending order. m, k, t Let v = 72.3 - 68.3. Let b = 2 + -3. Sort v, 5, b, 1/7. b, 1/7, v, 5 Let g be 0 + 1 + (-14)/18. Let y = 6.064 + -4.664. Sort 2, y, g. g, y, 2 Let i be 5 + 1 - (8 - 5). Put 0, i, 6, -2 in increasing order. -2, 0, i, 6 Let j = -11 - -8. Let f(t) = t2 - 9t + 8. Let o be f(8). Let z = 0.21 - -0.09. Put o, j, z in descending order. z, o, j Let v be 0/(7 - 2)-11. Let b = 4 + -2. Suppose v = -q - bq. Sort 5, -5, q. -5, q, 5 Suppose -6s - 9s + 30 = 0. Let g be (-3(-3)/(-9))/(s/(-8)). Let o be (-1 - 5/(-2))-2. Sort o, g, 5. o, g, 5 Let r = 661 - 661.1. Put 0.02, r, 0.2 in descending order. 0.2, 0.02, r Let v be (-1 + 2)(2 - 29). Let l(i) = 3i3 + 29i*2 - 7i + 5. Let o be l(-10). Let h = o - v. Put h, -1, -5 in ascending order. -5, -1, h Suppose 7h = -7h - 56. Put 3, 5, h, 19 in descending order. 19, 5, 3, h Suppose 0d - 15 = d - 5m, -4m = -4d - 12. Let n be -43/21 - 21/49. Sort -10, n, d in decreasing order. d, n, -10 Let z = 24 - 12. Let c be 137((-10)/z - -1). Let a = -23 + c. Sort a, 4, -4. -4, a, 4 Let c(r) = 2r3 + r + 2. Let u be c(2). Suppose n - 15 = -3v, -4n = v + v - u. Sort n, 10, -1. -1, n, 10 Let i(s) = -s3 - 3s*2 + s - 8. Let a be i(-4). Sort 20, a, 3. 3, a, 20 Suppose -15x = 899 + 241. Let p = x - -74. Let d = -1 + 1. Sort p, 3, d in ascending order. p, d, 3 Let o(w) = -w + 5. Let p = -8 - -8. Let v be o(p). Suppose -2s = -5d - 4, 0 = -vd + 3s - 1 - 5. Sort 5, 1, d in ascending order. d, 1, 5 Let u = -90.3 - 20.4. Let v = -111 - u. Sort v, -2/13, 1/4, -3 in increasing order. -3, v, -2/13, 1/4 Let y = -214 + 213.5. Sort 2/3, 8, y, -2/11. y, -2/11, 2/3, 8 Let f = 1.6 + -36.6. Let c = f + 35.04. Let j = -0.36 - c. Sort j, -1, -0.04. -1, j, -0.04 Let j = -39.4 + 37. Let d = -2.9 - j. Put d, -8, -3 in increasing order. -8, -3, d Suppose 0 = -2f + 2u + 16, -76u + 73u - 30 = -4f. Suppose 0 = -3t - 6. Sort f, -1, t. t, -1, f Let n be 638/57(-5)/(-4). Sort -4, -1, n, -2. -4, -2, -1, n Suppose 0 = -l + 2c + 1 + 3, 2l = -c + 3. Let t(h) = -2h - 6. Let s be t(-4). Suppose -lr = w + 3 - s, w - 2r = -1. Sort w, 4, -4 in decreasing order. 4, w, -4 Let z(m) = -2m - 15. Let b be z(-10). Suppose -2n - 10 = 4q - bn, -3n + 2 = 4q. Sort q, -3, -4 in increasing order. -4, -3, q Let z(v) = v3 - 4v*2 - 4v + 1. Let q be z(5). Let d be 9/(3/6-9). Put d, 3, q, 5 in increasing order. d, 3, 5, q Let v = -1.76 - 20.24. Let d(p) = -2p + 5. Let m be d(5). Put v, -2, m in decreasing order. -2, m, v Let y = 2.4 + -11.4. Let p = y + 12. Put 17, -3/7, p in descending order. 17, p, -3/7 Let q(v) = 17v - 190. Let p be q(11). Let b be (4/6)/((-24)/36). Put b, -25, p in decreasing order. b, p, -25 Let o be 6/3 - (-13 + 13). Sort -8, -4, o. -8, -4, o Let v = 3 + 2. Let f = -14786 + 59141/4. Sort f, v, -3, 1 in ascending order. -3, f, 1, v Suppose 32 - 71 + 16 = -23m. Let o = -1 - -1. Let t = o - 1. Sort m, 3, t in descending order. 3, m, t Let y = -0.17 + 0.07. Let m = -0.01 + 4.01. Let j = -6 + m. Sort y, j, 0.07 in descending order. 0.07, y, j Suppose u + 4i - 544 = 0, -u + 2i = 28 - 572. Put 4, -2, u, 0 in increasing order. -2, 0, 4, u Let z(v) = v*3 + 5v*2 + v. Let s be z(-5). Let m = -126 - -128. Put -13, s, m in decreasing order. m, s, -13 Let o(t) = -23t3 - t2 - t - 1. Let a be o(-1). Let s be 20/7 - 5/(-105)3. Put a, s, -3 in ascending order. -3, s, a Let m = -696 + 41761/60. Let q = m + 11/60. Sort 1/4, q, -1, 6 in ascending order. -1, q, 1/4, 6 Suppose 5u - 6 = 4x, -42 + 51 = 3u + 3x. Sort -46, -4, u in decreasing order. u, -4, -46 Suppose 5h - 35 = -0h. Let o(y) = -727 + 365 + 426 + y + y. Let r be o(-30). Sort 0, h, r in decreasing order. h, r, 0 Suppose -18 = 7x - 9x - 4h, -h = -2. Sort 22, -1, x. -1, x, 22 Let c(m) be the first derivative of m*4/4 + 5m*3 + 27m*2/2 + 8m - 50. Let l be c(-13). Put l, -2, 5, 1 in ascending order. l, -2, 1, 5 Let a = 622 - 620. Sort -29, -5, a in decreasing order. a, -5, -29 Let w = -32365 - -2912431/90. Let i = w + 41/9. Let j = 3 - 1. Sort i, j, -0.2. -0.2, i, j Let g be ((-32)/(-510))/(-4) - (-44)/330. Put -4/3, 13, g in descending order. 13, g, -4/3 Let p = -15 - -12. Put 4, -85, p in increasing order. -85, p, 4 Let u = 208 - 211. Let v be (2 + 38/(-10))-5. Suppose r = -2r + v. Sort -5, r, u in ascending order. -5, u, r Let a = 80 + -106. Let w = a - -39. Put -4, -3, 3, w in descending order. w, 3, -3, -4 Let t = -39 - -17. Let x = -18 - t. Put x, 2, 16 in decreasing order. 16, x, 2 Let v = 757 + -758. Put v, -6, -2, 5 in increasing order. -6, -2, v, 5 Let w = 66 - 66. Sort 3/7, w, -3, -3/5 in ascending order. -3, -3/5, w, 3/7 Let u(r) = r*3 - 3r*2 - 4r + 5. Let s be u(4). Suppose -3q + 3l = -9 + 3, -4l + 4 = -q. Suppose 0 - 4 = -qk. Sort s, -5, k in increasing order. -5, k, s Let t = -4.62 - -1.62. Sort t, -0.1, -3.1, 2/3 in descending order. 2/3, -0.1, t, -3.1 Let r = 3/698 - -1381/3490. Sort -2/7, r, -1/3, -29 in descending order. r, -2/7, -1/3, -29 Let v = 12 - 13. Let n be (-4)/45v. Suppose -4q = -q + 3c + 9, -2q = nc + 21. Sort 0.3, q, 2/7 in ascending order. 2/7, 0.3, q Suppose -83 + 71 = 6x. Let f be (1 + 1 - -3)1. Sort 0, x, f. x, 0, f Suppose -n = -0n - 5w + 358158, 0 = -2n + 2w - 716316. Let t = n - -109238332/305. Let v = t - 4/61. Put 1, v, 1/2 in increasing order. v, 1/2, 1 Let u(m) = 2m2 - 4m. Let f be u(3). Suppose l + f = 5q, l - 12 = -2l. Suppose 2p + 2g = 16, 8 = p + qg - 3. Put -5, 2, p in ascending order. -5, 2, p Let r(m) = m - 7. Let o be r(7). Let a be -4 + (0/(-2) - o). Let d(q) = -3q + 3. Let t be d(2). Put a, 0, t in descending order. 0, t, a Let a = -398 + 398.1. Sort -17/5, 3, a in decreasing order. 3, a, -17/5 Let b(c) = -8c2 - 5c - 4. Let h be b(-1). Put -2, h, 2, 3 in descending order. 3, 2, -2, h Let w be 7185/9 - (-1 + 12/9). Let x be (42/w)/(0 - 2/(-4)). Sort 3, -3, x in ascending order. -3, x, 3 Let r = 19.6 + -20. Let y = 4.4 + r. Put 1, -4, y in decreasing order. y, 1, -4 Let m = 12 + 24. Suppose -m = -8k + 5k. Suppose z - 5z = 2w + 22, 2z + k = -2w. Put -5, 0, w in decreasing order. 0, w, -5 Suppose 2z = -4, n + z - 4z - 8 = 0. Let f = -0.43 - 0.07. Put 0.4, f, -5, n in decreasing order. n, 0.4, f, -5 Let s(a) = a*2 + 12a - 364. Let b be s(-26). Let c = -9 - -6. Sort 1, b, 2, c. c, b, 1, 2 Suppose -5i = -2h + 408, -2i + 3h + 167 = -4i. Let x = i + 86. Let c = 0.2 + 0.8. Put x, c, -0.2 in descending order. x, c, -0.2 Let k = -0.09 - 35.01. Let l = -35 - k. Sort -0.5, l, 0.5, 5 in decreasing order. 5, 0.5, l, -0.5 Let u be (7 - 2) + (-1 - 4)2. Sort 0, 3, -434, u. -434, u, 0, 3 Let p = 3.7 + -0.7. Suppose -4x = x - 25, 0 = 3g + x - 8. Put -3, p, g in descending order. p, g, -3 Suppose -4p - 2t + 4t = -294, t = -3. Suppose -p = -25y + 17y. Put y, -2, 5 in descending order. y, 5, -2 Let b = 1.7 + -2. Let c = b + 3.3. Suppose 0 = -3m - 2m - 10. Put m, c, 6 in decreasing order. 6, c, m Let z = 0.04 + -4.04. Let x = 9.3 + -53.3. Sort z, -0.5, x. x, z, -0.5 Let o = 218 - 217. Sort 0.1, 6, o, -5. -5, 0.1, o, 6 Let p = -0.09 + 6.09. Sort p, 2/7, 0.02 in decreasing order. p, 2/7, 0.02 Suppose -5v + 2a = -0v - 32, 2v = -a + 11. Sort 2/11, -3, v, 1/4 in ascending order. -3, 2/11, 1/4, v Let i = 64.7 - 58. Let v = -19.7 + i. Put -0.1, 0.4, v in ascending order. v, -0.1, 0.4 Let l(q) = 14q + 336. Let c be l(-24). Suppose 4n + 8 = 0, 4x - 16 - 4 = 2n. Sort -27, c, x, -1 in descending order. x, c, -1, -27 Let h = -9.5 - -9.41. Let l = -0.258 - -1.548. Let q = h + l. Sort 4, -0.5, q in increasing order. -0.5, q, 4 Let x = -567 - -573. Let d = -2 - -2. Put 3, d, -1, x in descending order. x, 3, d, -1 Let k = -37 + 110/3. Let y = 0.078 - 152.078. Let d = y + 151.1. Sort d, 4, k in ascending order. d, k, 4 Let f be 5/3342/(-190). Sort f, -420, -1, -5. -420, -5, f, -1 Let g(r) = 2*r + 9. Let v be g(-7). Let u = 412 - 406. Put u, v	{ "pile_set_name": "DM Mathematics" }
culate the least common multiple of 1250 and 2000. 10000 Find the common denominator of -53/1656 and 39/1472. 13248 Calculate the least common multiple of 81 and 1. 81 What is the smallest common multiple of 1141 and 6? 6846 What is the common denominator of -107/36 and -76/27? 108 What is the common denominator of -47/222 and 137/12? 444 Calculate the least common multiple of 18 and 12. 36 Find the common denominator of -15/2 and -17/471. 942 Calculate the common denominator of -7/288 and 139/12. 288 Find the common denominator of -68/1575 and -167/150. 3150 Calculate the common denominator of 121/1152 and -91/1152. 1152 Calculate the smallest common multiple of 96 and 72. 288 What is the lowest common multiple of 756 and 1092? 9828 What is the least common multiple of 804 and 36? 2412 Calculate the common denominator of 37/560 and -50. 560 Find the common denominator of -29/8 and 3/112. 112 What is the common denominator of -193/780 and -107/120? 1560 What is the common denominator of -17/8 and -53/440? 440 Calculate the common denominator of -31/460 and -22/215. 19780 Find the common denominator of -103/30 and 53/55. 330 Calculate the common denominator of 29/8 and 56/45. 360 What is the least common multiple of 174 and 14? 1218 What is the common denominator of 43/1680 and 97/28? 1680 Find the common denominator of 57/260 and -92/105. 5460 What is the common denominator of -39/23 and 27/92? 92 Calculate the smallest common multiple of 244 and 14091. 56364 What is the common denominator of 19/10 and 123/100? 100 What is the lowest common multiple of 30 and 11610? 11610 Find the common denominator of 35/207 and -75/46. 414 What is the common denominator of 1/1080 and -63/88? 11880 Calculate the smallest common multiple of 2192 and 1370. 10960 What is the smallest common multiple of 1075 and 45? 9675 Calculate the smallest common multiple of 672 and 336. 672 Calculate the least common multiple of 216 and 81. 648 What is the lowest common multiple of 6 and 35? 210 What is the common denominator of 33/650 and -17/585? 5850 Calculate the smallest common multiple of 36 and 12. 36 What is the common denominator of -29/65 and -85/9568? 47840 What is the common denominator of -48/2485 and -26/55? 27335 Calculate the smallest common multiple of 6 and 2002. 6006 What is the common denominator of 11/53 and -56/3? 159 What is the least common multiple of 962 and 260? 9620 Find the common denominator of -93/560 and 19/880. 6160 Find the common denominator of -109/710 and 37/1136. 5680 Calculate the least common multiple of 16 and 4. 16 What is the common denominator of -41/30 and -52/235? 1410 Find the common denominator of 31/49 and 59/609. 4263 Calculate the smallest common multiple of 18 and 4. 36 Calculate the lowest common multiple of 48 and 1029. 16464 Calculate the smallest common multiple of 27 and 171. 513 What is the smallest common multiple of 504 and 180? 2520 Calculate the lowest common multiple of 130 and 25. 650 Calculate the lowest common multiple of 80 and 1120. 1120 Calculate the least common multiple of 10282 and 12. 61692 What is the least common multiple of 15 and 215? 645 Calculate the common denominator of -14/11 and 49/33. 33 What is the common denominator of 21/32 and -133/60? 480 Calculate the least common multiple of 30 and 100. 300 What is the least common multiple of 3 and 26? 78 Calculate the lowest common multiple of 1230 and 22. 13530 What is the lowest common multiple of 4 and 158? 316 Calculate the smallest common multiple of 3471 and 234. 20826 Find the common denominator of 23/114 and -51/38. 114 Find the common denominator of -91/15 and -61/39. 195 Calculate the lowest common multiple of 8 and 2. 8 Find the common denominator of -23/36 and 43/36. 36 Calculate the least common multiple of 16 and 236. 944 Calculate the common denominator of -18/11 and 71/12. 132 What is the common denominator of 49/4176 and -51/29? 4176 Find the common denominator of -87/470 and -41/94. 470 What is the lowest common multiple of 49 and 70? 490 Calculate the common denominator of -65/1576 and -109/10. 7880 What is the lowest common multiple of 1195 and 2629? 13145 Calculate the common denominator of -89/20 and 87/17774. 177740 Calculate the common denominator of -41/16 and -109/15704. 31408 Find the common denominator of -40/3 and 7/82. 246 Calculate the least common multiple of 644 and 736. 5152 What is the common denominator of -71/24 and 187/60? 120 What is the least common multiple of 6752 and 3376? 6752 Find the common denominator of -41/152 and 85/984. 18696 Calculate the smallest common multiple of 44 and 60. 660 Calculate the least common multiple of 2025 and 2025. 2025 Calculate the least common multiple of 84 and 644. 1932 Find the common denominator of 5/297 and -91/198. 594 Find the common denominator of -69/40 and -49/88. 440 Calculate the least common multiple of 77 and 594. 4158 What is the smallest common multiple of 20 and 480? 480 Find the common denominator of 11/9 and 21/202. 1818 Find the common denominator of 17/366 and -62/15. 1830 Calculate the smallest common multiple of 108 and 225. 2700 What is the lowest common multiple of 14 and 581? 1162 Find the common denominator of 79/1704 and 11/1704. 1704 Calculate the common denominator of -163/1056 and -51/4. 1056 Find the common denominator of -73/225 and -41/50. 450 Calculate the least common multiple of 9 and 63. 63 Calculate the lowest common multiple of 378 and 42. 378 What is the common denominator of 25/612 and 71/1530? 3060 Calculate the lowest common multiple of 12 and 1470. 2940 What is the lowest common multiple of 18 and 8? 72 Calculate the smallest common multiple of 273 and 70. 2730 Find the common denominator of -93/20872 and 33/40. 104360 What is the common denominator of -43/24 and -11/100? 600 What is the common denominator of 5/4869 and -48/3787? 34083 What is the common denominator of -79/4 and 31/7740? 7740 Find the common denominator of 121/450 and 71/12. 900 What is the lowest common multiple of 16 and 724? 2896 What is the smallest common multiple of 42 and 189? 378 Calculate the lowest common multiple of 763 and 609. 66381 Calculate the common denominator of 89/736 and 93/44. 8096 What is the common denominator of 163/1176 and 97/784? 2352 Calculate the least common multiple of 198 and 154. 1386 Calculate the least common multiple of 132 and 20. 660 Calculate the common denominator of 97/32 and -111/56. 224 Calculate the least common multiple of 26 and 7. 182 What is the common denominator of -65/24 and 65/1484? 8904 Find the common denominator of 107/414 and 13/27. 1242 Find the common denominator of -24/421 and 27/23. 9683 What is the least common multiple of 16 and 78? 624 What is the smallest common multiple of 2 and 470? 470 What is the lowest common multiple of 1260 and 504? 2520 Calculate the least common multiple of 10 and 16. 80 What is the smallest common multiple of 3360 and 60? 3360 Find the common denominator of 3/128 and -41/764. 24448 Find the common denominator of -1/99 and 25/121. 1089 What is the least common multiple of 14 and 80? 560 Calculate the common denominator of 39/2800 and -9/2000. 14000 What is the common denominator of 7/16 and -3/484? 1936 Calculate the least common multiple of 48 and 42. 336 Find the common denominator of 9/934 and 81/8. 3736 Calculate the lowest common multiple of 105 and 30. 210 Calculate the smallest common multiple of 477 and 371. 3339 What is the smallest common multiple of 1573 and 5929? 77077 What is the smallest common multiple of 8 and 17416? 17416 Calculate the least common multiple of 12 and 2. 12 What is the common denominator of -85/24 and -109/6? 24 Calculate the common denominator of -95/16 and 105/962. 7696 Calculate the smallest common multiple of 3 and 5. 15 What is the common denominator of -5/792 and -71/32? 3168 What is the common denominator of 13/209 and 9/28? 5852 What is the common denominator of -101/4 and 7/48? 48 Calculate the common denominator of -13/227 and 79/4. 908 Find the common denominator of -21/1406 and 23/518. 9842 Calculate the common denominator of -43/550 and 53/20. 1100 Calculate the lowest common multiple of 469 and 12. 5628 Calculate the lowest co	{ "pile_set_name": "DM Mathematics" }
between 5:03 AM and 2:46 PM? 583 How many minutes are there between 5:06 AM and 3:24 PM? 618 What is 662 minutes after 8:17 PM? 7:19 AM What is 583 minutes before 1:49 PM? 4:06 AM What is 616 minutes before 12:19 AM? 2:03 PM What is 687 minutes before 1:15 PM? 1:48 AM How many minutes are there between 4:28 AM and 11:02 AM? 394 How many minutes are there between 1:13 AM and 2:30 AM? 77 What is 676 minutes before 1:22 PM? 2:06 AM What is 532 minutes after 4:09 AM? 1:01 PM How many minutes are there between 3:22 AM and 6:13 AM? 171 What is 490 minutes after 3:36 AM? 11:46 AM How many minutes are there between 9:33 AM and 11:50 AM? 137 What is 556 minutes after 6:39 AM? 3:55 PM How many minutes are there between 5:34 PM and 4:04 AM? 630 How many minutes are there between 6:17 PM and 1:05 AM? 408 What is 588 minutes after 9:06 PM? 6:54 AM What is 524 minutes after 12:18 PM? 9:02 PM How many minutes are there between 12:17 PM and 10:22 PM? 605 How many minutes are there between 3:45 AM and 6:41 AM? 176 What is 204 minutes before 12:00 AM? 8:36 PM How many minutes are there between 11:44 AM and 10:18 PM? 634 How many minutes are there between 5:43 AM and 11:56 AM? 373 How many minutes are there between 5:02 AM and 5:53 AM? 51 How many minutes are there between 7:54 PM and 3:42 AM? 468 What is 549 minutes after 1:28 PM? 10:37 PM How many minutes are there between 8:47 AM and 10:19 AM? 92 What is 243 minutes before 2:34 AM? 10:31 PM How many minutes are there between 4:06 AM and 11:45 AM? 459 What is 12 minutes after 9:18 PM? 9:30 PM What is 560 minutes after 5:26 AM? 2:46 PM What is 675 minutes before 7:55 PM? 8:40 AM How many minutes are there between 1:38 PM and 9:31 PM? 473 What is 292 minutes after 4:04 AM? 8:56 AM How many minutes are there between 12:35 PM and 6:48 PM? 373 How many minutes are there between 3:23 AM and 12:35 PM? 552 How many minutes are there between 11:47 AM and 11:59 AM? 12 What is 353 minutes before 5:19 PM? 11:26 AM How many minutes are there between 1:49 PM and 3:11 PM? 82 How many minutes are there between 2:32 AM and 7:37 AM? 305 What is 165 minutes after 9:08 AM? 11:53 AM What is 67 minutes after 11:29 PM? 12:36 AM How many minutes are there between 5:36 AM and 3:21 PM? 585 How many minutes are there between 2:19 AM and 8:35 AM? 376 How many minutes are there between 4:47 AM and 6:55 AM? 128 What is 142 minutes after 8:05 PM? 10:27 PM How many minutes are there between 7:22 AM and 7:42 AM? 20 What is 286 minutes before 9:13 PM? 4:27 PM How many minutes are there between 7:40 AM and 10:35 AM? 175 How many minutes are there between 9:31 AM and 4:29 PM? 418 What is 428 minutes after 1:32 AM? 8:40 AM How many minutes are there between 6:48 AM and 1:36 PM? 408 How many minutes are there between 2:10 PM and 6:35 PM? 265 What is 35 minutes after 9:20 PM? 9:55 PM How many minutes are there between 11:00 PM and 9:23 AM? 623 What is 714 minutes before 8:42 AM? 8:48 PM What is 581 minutes after 6:43 PM? 4:24 AM How many minutes are there between 9:53 AM and 2:30 PM? 277 What is 688 minutes after 6:28 PM? 5:56 AM How many minutes are there between 11:22 AM and 3:32 PM? 250 How many minutes are there between 12:41 PM and 10:40 PM? 599 How many minutes are there between 6:09 PM and 6:18 PM? 9 What is 303 minutes before 11:53 AM? 6:50 AM What is 504 minutes before 10:06 PM? 1:42 PM How many minutes are there between 1:24 PM and 8:12 PM? 408 What is 419 minutes before 2:27 AM? 7:28 PM How many minutes are there between 3:30 PM and 2:59 AM? 689 How many minutes are there between 11:23 PM and 4:50 AM? 327 How many minutes are there between 4:35 AM and 12:46 PM? 491 What is 101 minutes after 7:57 AM? 9:38 AM What is 360 minutes before 2:30 AM? 8:30 PM What is 166 minutes before 8:27 PM? 5:41 PM What is 59 minutes before 8:17 PM? 7:18 PM What is 243 minutes after 10:10 AM? 2:13 PM How many minutes are there between 11:51 PM and 4:00 AM? 249 How many minutes are there between 7:42 PM and 8:23 PM? 41 What is 543 minutes after 12:42 PM? 9:45 PM How many minutes are there between 4:39 PM and 2:30 AM? 591 How many minutes are there between 3:19 PM and 5:41 PM? 142 How many minutes are there between 3:13 AM and 6:37 AM? 204 What is 586 minutes before 1:28 AM? 3:42 PM How many minutes are there between 1:22 PM and 10:35 PM? 553 How many minutes are there between 7:44 AM and 8:11 AM? 27 What is 41 minutes before 5:17 PM? 4:36 PM What is 592 minutes before 11:11 PM? 1:19 PM How many minutes are there between 9:08 AM and 4:36 PM? 448 What is 676 minutes after 4:28 PM? 3:44 AM How many minutes are there between 2:26 AM and 3:33 AM? 67 How many minutes are there between 5:08 PM and 3:36 AM? 628 What is 706 minutes after 5:28 AM? 5:14 PM What is 283 minutes before 8:37 AM? 3:54 AM What is 526 minutes after 7:12 AM? 3:58 PM What is 309 minutes before 5:59 AM? 12:50 AM How many minutes are there between 3:23 AM and 8:36 AM? 313 How many minutes are there between 11:29 AM and 10:00 PM? 631 What is 209 minutes before 12:44 AM? 9:15 PM What is 414 minutes after 4:23 AM? 11:17 AM What is 111 minutes before 1:57 PM? 12:06 PM What is 628 minutes before 8:00 AM? 9:32 PM What is 160 minutes before 11:41 PM? 9:01 PM What is 586 minutes after 6:01 PM? 3:47 AM What is 60 minutes after 9:03 AM? 10:03 AM How many minutes are there between 3:30 AM and 12:10 PM? 520 What is 408 minutes after 12:11 AM? 6:59 AM What is 82 minutes after 10:54 AM? 12:16 PM What is 102 minutes before 7:35 AM? 5:53 AM What is 420 minutes after 1:13 PM? 8:13 PM How many minutes are there between 7:38 PM and 2:04 AM? 386 What is 466 minutes after 10:28 AM? 6:14 PM How many minutes are there between 1:44 AM and 10:11 AM? 507 How many minutes are there between 7:01 AM and 9:01 AM? 120 What is 657 minutes before 6:40 AM? 7:43 PM What is 374 minutes before 12:19 AM? 6:05 PM What is 641 minutes after 2:43 PM? 1:24 AM What is 36 minutes before 9:42 PM? 9:06 PM How many minutes are there between 3:24 PM and 7:15 PM? 231 How many minutes are there between 11:57 PM and 4:49 AM? 292 What is 706 minutes after 5:37 PM? 5:23 AM What is 292 minutes before 10:40 PM? 5:48 PM How many minutes are there between 11:40 AM and 2:18 PM? 158 What is 679 minutes before 1:10 AM? 1:51 PM What is 482 minutes after 2:44 AM? 10:46 AM What is 564 minutes after 11:09 AM? 8:33 PM What is 592 minutes before 3:56 AM? 6:04 PM How many minutes are there between 8:19 AM and 9:28 AM? 69 What is 323 minutes before 4:46 AM? 11:23 PM How many minutes are there between 9:05 AM and 11:34 AM? 149 How many minutes are there between 9:52 PM and 4:20 AM? 388 How many minutes are there between 10:11 PM and 10:25 PM? 14 What is 532 minutes before 6:48 AM? 9:56 PM How many minutes are there between 3:36 PM and 11:28 PM? 472 What is 51 minutes after 6:26 PM? 7:17 PM How many minutes are there between 10:48 AM and 1:13 PM? 145 What is 296 minutes before 2:17 AM? 9:21 PM What is 584 minutes after 8:16 AM? 6:00 PM How many minutes are there between 3:34 AM and 4:45 AM? 71 What is 501 minutes after 11:32 PM? 7:53 AM How many minutes are there between 8:41 AM and 11:47 AM? 186 How many minutes are there between 4:56 PM and 1:19 AM? 503 How many minutes are there between 7:12 AM and 5:09 PM? 597 What is 677 minutes before 11:25 AM? 12:08 AM What is 454 minutes before 2:23 PM? 6:49 AM What is 217 minutes after 4:50 AM? 8:27 AM How many minutes are there between 8:11 PM and 3:20 AM? 429 How many minutes are there between 9:30 AM and 10:14 AM? 44 How many minutes are there between 7:36 AM and 5:53 PM? 617 What is 149 minutes after 9:30 AM? 11:59 AM How many minutes are there between 4:35 AM and 4:46 AM? 11 What is 639 minutes after 11:41 PM? 10:20 AM How many minutes are there between 2:31 AM and 9:19 AM? 408 How many minutes are there between 2:53 PM and 3:07 PM? 14 What is 588 minutes after 4:45 PM? 2:33 AM What is 321 minutes before 6:35 AM? 1:14 AM What is 126 minutes before 12:13 PM? 10:07 AM How many minutes are there between 3:33 AM and 2:38 PM? 665 How many minutes are there between 7:49 AM and 6:56 PM? 667 How many minutes are there between 9:29 PM and 10:51 PM? 82 What is 102 minutes before 3:05 AM? 1:23 AM How many minutes are there be	{ "pile_set_name": "DM Mathematics" }
se -22v + 5 = -17v. Suppose -5g = -19 - v. Which is greater: 1 or g? g Let r be (-9)/((-999)/(-530))-204. Let b = -974 + r. Which is bigger: 0 or b? b Suppose 0 = 3d - 11 - 1. Suppose 20 = dk + k. Suppose 3y - 6y = 4t + k, 0 = 4y. Which is greater: t or 1/5? 1/5 Let a = 0 - -0.18. Let f = 10.18 - a. Let j = 11 - f. Are -0.4 and j nonequal? True Let n = -11207921/68706 + 260/3123. Let v = n - -163. Which is smaller: v or -1? -1 Let a = -9 - -16. Let t = a - 18. Let v = t + 11. Which is bigger: 3 or v? 3 Let b = -2.2 - 0.8. Let j = b + 2. Let o be 12(4 + 60/(-16)). Which is smaller: j or o? j Let d = 10201/39 + -785/3. Let s = -106/273 - d. Let q = 3 + -2.8. Do q and s have different values? True Let i = -3 - 5. Let f(t) = t3 + 8t*2 - t - 7. Let v be f(i). Which is greater: v or -9? v Suppose -5p + 5d + 1 = -19, 33 = 2p + 3d. Which is smaller: p or 139? p Let g(d) = -d2 - 2d + 3. Let o be g(-5). Suppose -65 = -4r - 17. Let m = o + r. Which is greater: 1/12 or m? 1/12 Let k(b) = b - 3. Let t be k(2). Let z(i) = -i2 - 2i. Let x be z(-2). Suppose w - 1 = x, -j - 1 = -4w + 4. Is t less than j? False Let r be -2(-2 + 3) - -1. Let c = -341 + 341.19. Is c less than or equal to r? False Let h be (-2)/3(3 - (-3003)/(-980)). Which is greater: h or -1? h Let j = 24 - 8. Let s = -12 + j. Let q = 23 + -16. Is q at most as big as s? False Let z = -3 - -2. Let q = -115 - -60. Let h = q + 716/13. Which is smaller: h or z? z Let h be (-32)/(-14) - (-12)/(-42). Suppose -s - 3s + 5l + 18 = 0, 3l = -4s + h. Let w = -6 + s. Do -6 and w have the same value? False Let z = -490 - -490. Which is greater: z or 133? 133 Let a = 1 + 2. Let l be (0 - 1) + -1a. Let u = 1 - 4. Which is smaller: u or l? l Let g be ((-3)/(-2))/(-3)2. Let t = -1520/7 + 217. Which is greater: g or t? t Suppose -24 = 12k - 10k. Let d be k/(-28)(-6)/(-9). Let w = 0.4 - 0.4. Which is bigger: w or d? d Let a be ((-2)/4)/((-153)/36). Let n = 0.74 - 0.94. Which is greater: a or n? a Let v = -1222 + 76984/63. Let o(x) be the third derivative of x*5/60 + 11x*4/24 + 5x*3 + 21x*2. Let d be o(-6). Is v smaller than d? True Suppose -2t = -8, -o = -6o + t + 191. Let a be (-1)/((-22)/71520/24 - 0). Do a and o have the same value? True Let z = 5 - 0. Suppose 10y - z = 5y. Let o = 32 - 97/3. Which is bigger: o or y? y Let g(z) = -z + 18. Let n be g(13). Suppose 3v = 5l + 108, -2l - 32 = v - nv. Let i = -55 - -32. Which is smaller: l or i? l Suppose 4o = -4x - x - 83, -5x - 3o = 81. Let n be (-10)/x3(-11 + -2). Is -26 <= n? True Suppose 0 = 5r - 5, -6r + r + 10 = 5w. Let p = 12 - 13.8. Is w at least as big as p? True Let q = 36 + -28. Let h = 5 - 5. Suppose -33 = -3b - 4n + 4, h = 3n - 12. Do b and q have different values? True Suppose 3o + 25 = 3i - 8i, -5o - 3i - 15 = 0. Is 2/59 at most as big as o? False Let r be 7668/84 - 0 - 4/14. Is 91 at least as big as r? True Let j = -3 - 0. Let t(d) be the second derivative of d3/3 - 12d*2 + 7d. Let r be t(11). Is r bigger than j? True Let d = 3.5 + -3.16. Let a = d - -1.66. Let u = -1/23 + -17/138. Are u and a equal? False Suppose 4w - 51 + 11 = 0. Let d be 314/(-10) + 4/w. Is d less than or equal to -32? False Suppose n + 5v = -6, 2n + 0v - 2v - 12 = 0. Suppose 4f - 3x + 21 = -f, -5x = 2f - n. Let h = 43 + -42. Is f > h? False Let u = -36.4 + 43.6. Is u >= -0.2? True Suppose -197r = -165r. Let l = 2099/39480 - -2/4935. Which is greater: l or r? l Let c = 325235595472/991431349 - -2/23056543. Let i = -328 + c. Which is smaller: 0 or i? 0 Let z(f) = 5f. Suppose 5x + 4s = 70, -2s + 25 = 2x - s. Let y be z(x). Suppose -2n = -7n - y. Is -10 bigger than n? False Suppose 3y + 17 = -3c - 19, -3y = -c. Is -25 at most as big as c? True Let b be 260/39 + (-4)/6. Suppose -bt - 5w = -2t + 10, -t + 6 = -3w. Which is greater: 3/32 or t? 3/32 Let r(d) = -d3 - 6d*2 + 6d + 4. Let a be r(-7). Suppose aj - 3j - 48 = 0. Let l = 2 + 3. Which is smaller: j or l? l Let c be (-5)/35-7 - (-15)/(-21). Is -2.61 at most c? True Let a be 21/35 - 33/5. Let q be (-2 + (-15)/a)64. Let c = -24 + q. Is 8 equal to c? True Let v be 256(-2)/(-20). Suppose 3w - 3q = -0q + 12, 3q + 11 = 4w. Let n be w/(-2)10/v. Is n equal to 0.2? False Let t = 60/119 - 1063/2142. Is 0 at least as big as t? False Let w be (-3)/(-9) - 322/(-18). Let k = 18 - w. Let t(y) = 84y + 336. Let n be t(-4). Which is smaller: n or k? k Let i(m) = m - 14. Let l be i(13). Let c be (l - 2)/(3/4). Let a be (1/2)/(c/(-12)). Is 3 at most a? False Let h(i) be the first derivative of -i3/3 + 3i*2 - 3i - 18. Suppose -3z - c + 2c + 23 = 0, 3c + 13 = 2z. Let v be h(z). Are v and -18 non-equal? True Suppose 1054q - 1055q = -1189. Are 1188 and q equal? False Suppose -x - 4b = -b + 18, -3b = -2x + 9. Which is smaller: x or -0.1? x Let m(j) = 16j - 16. Let c be m(1). Let b(p) = -p*3 + 4p2 + 2. Let k be b(4). Which is smaller: k or c? c Let f(x) = -x3 + 2x2 + 4x + 61. Let s be f(0). Let u = -61 + s. Is u greater than or equal to 9? False Let m = 9 + -5. Let f = m + -3. Suppose -4 = 3k - f. Is -1/13 at least k? True Suppose 0 = -10b + 161 - 711. Which is greater: b or -53? -53 Let w = -8440 - -5772959/684. Is 0 bigger than w? True Let g be (24/(-2))/3 - (-40474)/10143. Is g at most as big as -8? False Let u(p) = -p*3 - 8p*2 - 7p + 7. Let g be u(-7). Let k(v) = 4v - 11. Let z be k(g). Is 17 greater than or equal to z? True Suppose 4 + 0 = 2c. Let t be -1c + 615/(-25). Let n = t - -547/20. Do n and -0.1 have different values? True Let v(q) = -q2 + 3q + 12. Let k be v(5). Suppose -10 = -3u - 3b + 59, ku - 37 = -5b. Is u smaller than 27? True Let m = -948 - -958. Which is bigger: -2 or m? m Suppose 8y = 4y - 92. Which is smaller: y or 6? y Let f be 3 - ((-22)/(-264))/((-1)/(-38)). Let b be 6/(-21) - 4/(-14). Which is smaller: f or b? f Let j = -38 - 16. Let a = j - -53.94. Is -2/3 >= a? False Let x = -10 - -19. Let t = -11 + x. Which is bigger: 3.1 or t? 3.1 Suppose 3m + m = -t - 35, 65 = -5m + 3t. Let b be (-2)/(m/(-3 + 5)). Let h = -9 - -10. Is b at most h? True Suppose 0 = n - 2, 3n = -4a + 1912 + 914. Which is bigger: 704 or a? a Let a(p) = p2 - 1 - 2p*2 - 2 + 26 - 17p. Let h be a(-19). Which is greater: -13 or h? -13 Let c = -3411/3653 + 3/281. Is 0 > c? True Let m be ((-6)/(-1) + -1)-1. Let w = 45471/10 - 4547. Is m >= w? False Suppose n - 6 + 5 = 0. Let l be ((-18)/225)/(n/(-5)). Let j = -3.2 + 0.2. Which is bigger: l or j? l Suppose -3o = h - 7, -4o + 2o + 4h = 0. Suppose 10 = 3b - 4s, -os = 2b + 2 - 4. Suppose -bx + 3 = -g, 5x + 3g - 6 = 4g. Is x at most as big as 2/39? False Let u = -12533/8 + 1564. Is -2/13 at least u? True Suppose 4r + 2d + 5 = 3, -5d - 27 = -r. Let t(s) = 0s - 2s2 - r + s2 + 1 - 5s. Let k be t(-5). Are -3 and k nonequal? True Let r be 7((-4)/6)/(84/(-18)). Which is greater: r or 15/7? 15/7 Suppose 0q - 20 = 5q. Let x(m) = m*2 + 4m + 6. Let s be x(q). Suppose -f - s + 4 = 0. Is -3 greater than f? False Let g = 1 + -1. Suppose g = 8o - 12o - 440. Let j be o/68 - (-12)/8. Which is smaller: j or 1? j Let x = 19/3 - 6. Let o = -12 - -16. Let r be 1 - o - (-178)/58. Which is smaller: r or x? r Let f = 5 + 1. Suppose -3l + 6 = -9. Suppose lg - 12 = -k, -g + 2k + 5 = -4. Which is smaller: g or f? g Let q(c) = -3c. Let i be q(-6). Let s = i + -18. Suppose -3l - 9 = -2r - sr, 7 = 2l + 3r. Is -1 at least as big as l? True Let c = 26 - 22. Let m be 1/(-4 - (2 + -5)). Let d be (-2 + m)c/12. Is d bigger than -6/5? True Suppose 398 = -4g + 394. Which is smaller: -318 or g? -318 Let w(p) = p2 - 6p + 9. Let c be w(8). Let r = -8 - -4. Let u be (10/c)/(r/(-10)). Is u > 1.3? False Let v = -15.3 - -13. Let i = -2.16 - v. Let l = 7.14 - i. Which is smaller: l or -1? -1 Let p = 2486 + -2608. Are p and -116 unequal? True Let t be 2 + 1/30. Suppose 2 = -tr - 2r - 2w, -r + 5w + 16 = 0. Is r at least as big as -9? True Let d = -8 + -1. Let c = d - -10. Is 1 < c? False Suppose 2k + k - 529 = -2q, -4k + 534 = 2q. Which is smaller: 258 or q? q Suppose 0 = 7g - 85 - 328. Which is smaller: g or 117/2? 117/2 Suppose 0 = -o + 5*c +	{ "pile_set_name": "DM Mathematics" }
82/49 Simplify ((sqrt(896) - sqrt(1694)-2)/((sqrt(196)/sqrt(4))/sqrt(7) + sqrt(7) + (sqrt(21) - 1sqrt(21))/sqrt(3)) + -1)-4. -60sqrt(2) + 4 Simplify 0 + ((0 + sqrt(1008) + -2 + sqrt(1008) - sqrt(1008)) + sqrt(1008))*2 + (sqrt(700) + 2 - sqrt(700) - (-4sqrt(7) + 4)). -92sqrt(7) + 4034 Simplify (3sqrt(72) + sqrt(72))/(sqrt(729)3) + ((-2sqrt(128) - sqrt(128))5 - ((sqrt(128)-1)*2 + sqrt(2) + (sqrt(2) - sqrt(2)2-2))). -3394sqrt(2)/27 - 128 Simplify (1(sqrt(144) + sqrt(144) + (sqrt(144) + -6(sqrt(144)-4 + sqrt(144)) + sqrt(144) - sqrt(144)) - sqrt(144)))/(sqrt(48)5-3). -4sqrt(3)/3 Simplify (sqrt(162)-1 - sqrt(72)/(-1sqrt(4)))/((sqrt(99) - (sqrt(99)1 - sqrt(99))5)/(sqrt(11) + sqrt(11) + sqrt(110)/(sqrt(20)/sqrt(2)))). -6sqrt(2) Simplify ((sqrt(130)-36)/((1sqrt(90))/sqrt(9)))*2 + ((-1sqrt(52) - sqrt(13)) + sqrt(13) + 1 + 0 + sqrt(13))*21 + -1. -2sqrt(13) + 4225 Simplify 4((sqrt(891) + -3 + (sqrt(891) - (sqrt(891) + -1)) + sqrt(891))*2 + -3) + -5 + -1 + 4. -288sqrt(11) + 14258 Simplify (3(-3((sqrt(1300) - sqrt(1300)4) + -4)56 + -5))2. 17253000sqrt(13) + 854064225 Simplify (-1sqrt(68)/sqrt(4)4 + -1 + 4 + (sqrt(68) + 2 + sqrt(68) + -3 - sqrt(68)))*2. -8sqrt(17) + 72 Simplify (-1(sqrt(20)/(sqrt(10)-1) + sqrt(50) + -4 + sqrt(2) + sqrt(128) + (-6(sqrt(128) + -3))2) + -1)3. -14787 + 5145sqrt(2) Simplify (-5((-5sqrt(156)3-1)/(sqrt(768) - (1sqrt(768) - sqrt(768))3) + 5))2. 1875sqrt(13)/4 + 113125/64 Simplify 5(4 + (sqrt(8)5)*2) - (2 + (sqrt(32)-1 - sqrt(32)) + (-2sqrt(128))/sqrt(4))2. 64sqrt(2) + 504 Simplify (-5sqrt(104)4 - -5(3sqrt(104) - sqrt(104)))/(-5sqrt(288)2)5. 5sqrt(13)/6 Simplify (-22sqrt(2448) - (sqrt(2448) + 1sqrt(2448) + 0) - (-4 + 5(sqrt(2448) - (sqrt(2448) - (1sqrt(2448) + sqrt(2448)))) + -2))2-6. -3760344 + 13824sqrt(17) Simplify (-2 + (-2sqrt(76)1 + 0 + sqrt(76) + 1 + sqrt(76) + sqrt(76) + 1 - ((sqrt(76) - sqrt(76)-1)6 + 3sqrt(76)-2 + 2)))2. 40sqrt(19) + 1904 Simplify 4 + (-1sqrt(1573))2 + 5 - ((-5(sqrt(91) - 2sqrt(91) - sqrt(91)))/((sqrt(28) + sqrt(7))-4))*2. 56627/36 Simplify ((sqrt(21)/(sqrt(21)/sqrt(3)) + sqrt(27) + -2 - (4 + (sqrt(3) - sqrt(6)/sqrt(2)) + (sqrt(30) - sqrt(120))/sqrt(10)))6)*2. -2160sqrt(3) + 3996 Simplify ((sqrt(1573)1 + -1)-4 + -1(sqrt(1573) + 3 + 5))26. 2640sqrt(13) + 236046 Simplify (1 + (sqrt(2548)-1 + sqrt(52) + sqrt(832)4)/(sqrt(256)2 + sqrt(64)2))-3. -5sqrt(13)/4 - 3 Simplify -3 + (2(sqrt(2) + 3 + (sqrt(2) - sqrt(2)-2) - sqrt(2)) + -2 + sqrt(162) + sqrt(162) + sqrt(2) + (sqrt(2) + sqrt(2) + 1)-4)2. -3 + 34sqrt(2) Simplify (-4 + (1 + -1sqrt(891) + sqrt(891))2 - ((sqrt(99) - (sqrt(99)2)*2) + -5 + -2))6. -18sqrt(11) + 2400 Simplify -1(-1 + (0 + -61sqrt(605) + sqrt(605))*2 + ((sqrt(605) - ((sqrt(605) + 0 + sqrt(605))6 + sqrt(605) + sqrt(605))) + -1sqrt(605)-2)*25). -381149 Simplify (-2(sqrt(120) - (6(sqrt(120) + 2sqrt(120)) + sqrt(120) + sqrt(120) + sqrt(120) - sqrt(120)))/sqrt(10))216. 103968 Simplify (5-3(sqrt(704)2 - sqrt(704)) + (sqrt(704)2 + 5 - sqrt(704)-23) + -1)2. -448sqrt(11) + 34512 Simplify 4 + (sqrt(90)2-6)/(sqrt(16)/(sqrt(80)/sqrt(250))). -36sqrt(5)/5 + 4 Simplify -2((sqrt(156) + -4(sqrt(156) + sqrt(156)-1))-5)/(sqrt(60)/(-3(sqrt(5) + (sqrt(5) - sqrt(5)-2 - sqrt(5))) + sqrt(5))). -80sqrt(13) Simplify (((-1 + sqrt(325) - sqrt(325)) + -2 + sqrt(325) - (0 + sqrt(325) + 0))*2 - (sqrt(52) + (sqrt(52) - sqrt(6292)2))/(sqrt(4) - sqrt(64))) + 0. -20sqrt(13)/3 + 9 Simplify -3(-4(-2sqrt(171) + sqrt(19) + (sqrt(19) - (-5 + 2sqrt(19))))-1 + 0)*2. -34032 + 2880sqrt(19) Simplify (1sqrt(304) + -4 - (sqrt(304) - (((1sqrt(304) - sqrt(304)) + 3)*2 + sqrt(304))))-4 + (-1 + 3 + sqrt(304) - (sqrt(304)1 + 1 - sqrt(304))2). -12sqrt(19) - 19 Simplify (-3(sqrt(1216) - 3(sqrt(1216)2 - sqrt(1216)) - (sqrt(1216) - -6(sqrt(1216) - (2sqrt(1216) + sqrt(1216))) - sqrt(1216)))1-2)2-6. -26265600 Simplify ((-1 + -4 + sqrt(3)-3 + -1 + sqrt(363) + sqrt(363) + 3)-3)*2. -1026sqrt(3) + 9828 Simplify -4(-4(5(sqrt(3) + sqrt(363) + 0) - (sqrt(36)/sqrt(3) + sqrt(12))3))*26. -2654208 Simplify (-3 + 6(-3(2 + sqrt(405) - sqrt(405)) + sqrt(5) + sqrt(45)/(sqrt(225) - sqrt(9)) + sqrt(5) + 1))*2. -891sqrt(5) + 8001/4 Simplify ((sqrt(144)-22)/sqrt(12))*2 + 2sqrt(48) + (sqrt(12)-3)/sqrt(4) + -4. 5sqrt(3) + 188 Simplify ((sqrt(540) - 5-2sqrt(540))/(-3sqrt(108)))/((sqrt(54)/sqrt(2))/sqrt(3) - (sqrt(90)/sqrt(160) - sqrt(9))). -44sqrt(5)/63 Simplify (4 + 0 + -6sqrt(7) + -1 - (sqrt(567)5 + sqrt(7) + sqrt(63)-6))1. -34sqrt(7) + 3 Simplify ((sqrt(114) - (1sqrt(114)-2 + sqrt(114))) + sqrt(114) + sqrt(114)1-2)/((1sqrt(72))/sqrt(12) + (sqrt(54) + sqrt(486) - sqrt(6))) + -3. -3 + sqrt(19)/12 Simplify 5 + -3(sqrt(288) + -1(sqrt(288) - (sqrt(288) - ((-1sqrt(288) - sqrt(288)) + sqrt(288)))) - 3(1 + sqrt(288)))*2-23. 1296sqrt(2) + 5351 Simplify 1(-3 + -2(4 + sqrt(38)/sqrt(2) - sqrt(19)) + (-2sqrt(304) + sqrt(19) + sqrt(19))-5 + 4)*2. -420sqrt(19) + 17149 Simplify (-2(sqrt(864)3 + sqrt(24))4)/((sqrt(56) - -2sqrt(168)/sqrt(3))/(6sqrt(112))). -1216sqrt(3) Simplify 5 + -1sqrt(605)-2 + 5 - (3 + 4(sqrt(15)/sqrt(3) + -4) + -3). 26 + 18sqrt(5) Simplify 4((((sqrt(468) - sqrt(468)-2) + sqrt(468))2 - sqrt(468) - -1sqrt(468)-2)6)*2 + 1 + 1. 1684802 Simplify (-5sqrt(300)6)2 + -5 - ((sqrt(3) + 0)-3 - (-3(-3 + sqrt(3) - sqrt(3)) + sqrt(3)))2. -72sqrt(3) + 269866 Simplify 3 + -4 + -1(5 + (2 + (-1 + sqrt(108) - sqrt(108)))2). -7 Simplify ((sqrt(78) + (6(sqrt(78) + (sqrt(78) - (sqrt(78) - sqrt(78)-5)) + sqrt(78)) - sqrt(78)))5)/(sqrt(54)/(sqrt(108)/(sqrt(12) + 3sqrt(12)))). -45sqrt(13)/2 Simplify 1(3 + (2sqrt(18))*2 + -2) - (-4sqrt(36)2)/(sqrt(2) - (sqrt(128) - (sqrt(128)1 + sqrt(128)))). 8sqrt(2)/3 + 73 Simplify -3 + ((sqrt(54)/sqrt(144) + sqrt(6))/(sqrt(98)-2)-2 - (((sqrt(108) + (sqrt(108) - 1sqrt(108)) + sqrt(108))-4 + 0)6)*2). -248835 + 5sqrt(3)/28 Simplify -1 + (sqrt(175) - 1(1 + sqrt(175)))-1 + ((sqrt(7) - 2sqrt(7)1) + (1 + sqrt(7))-6)3. -21sqrt(7) - 18 Simplify -1 + ((-2sqrt(162))*2 + 0 - 6(1 + sqrt(162))) - (-6(sqrt(162) + (sqrt(162) - (0 + 1sqrt(162)))) + 0)*2. -5191 - 54sqrt(2) Simplify -3 + (5 + 2 + sqrt(891) + 3 - (-1sqrt(891)1 + 1))*2. 324sqrt(11) + 3642 Simplify (sqrt(343)/(sqrt(7)-4)-2)/((sqrt(7) - sqrt(21)/sqrt(3)-4)3) + 2. sqrt(7)/30 + 2 Simplify 2(-3 + -3(sqrt(700) + 2) + (1 + (sqrt(700) - sqrt(700)-3))2 + -5) + 0. 100sqrt(7) + 22374 Simplify 6((1sqrt(132) - sqrt(132))12)/((sqrt(432) + sqrt(432)2 + sqrt(432))5)-4. 0 Simplify ((3(sqrt(76) - (1sqrt(76)2 - sqrt(76) - sqrt(76)) - (-4sqrt(76)-1 + sqrt(76))))/((sqrt(160)/sqrt(4)-5 + sqrt(40))/(-1sqrt(360))))2. 6156 Simplify (0 + -4 + (sqrt(3) + sqrt(48) + -2)2)3 + 6-4(-1 + sqrt(432)). -348sqrt(3) + 249 Simplify 5(-4-1sqrt(66))/sqrt(6) + 3 - ((3(sqrt(275) + -1) - sqrt(275)) + -2(sqrt(275) + 1))-6. -27 + 20sqrt(11) Simplify -4 + (5 + -4 + sqrt(425) + 2 + ((0 + sqrt(425))-5 - sqrt(425)) + 4)*2. -350sqrt(17) + 10670 Simplify 3(-1 + (sqrt(1764) - (sqrt(1764) + 1sqrt(1764)2 + sqrt(1764) + sqrt(1764)))/(sqrt(14)/(-2sqrt(128) - sqrt(2)))). -3 + 1224sqrt(7) Simplify (34sqrt(132))/(6sqrt(108)) - ((3 + sqrt(110)/(sqrt(10) - (sqrt(40)3 + sqrt(10))))2 + -4). -191/36 + 5sqrt(11)/3 Simplify -2(-3(4 + sqrt(13)) + sqrt(13) + sqrt(13)2 + -3 - (sqrt(117) + 1sqrt(117)-1)/(sqrt(63)/sqrt(175))). 30 Simplify (6sqrt(18)-1 + sqrt(162)-1)/(3(sqrt(6) + sqrt(6) + sqrt(60)/(1sqrt(10) + sqrt(10)))3)-3. 6sqrt(3)/5 Simplify (-1sqrt(198)54)/(sqrt(2592) + (sqrt(2592) + sqrt(2592)1 + sqrt(2592))6) + 5. -5sqrt(11)/57 + 5 Simplify -3((sqrt(800) - (2 + sqrt(800)2))6 - ((sqrt(800) - (1 + sqrt(800) + 2)) + -1)). 24 + 360sqrt(2) Simplify (((-5sqrt(550) + sqrt(550))-2)/sqrt(11))/((sqrt(640) - 6sqrt(640))-4 + sqrt(640)). sqrt(5)/21 Simplify (5 + (sqrt(3) - (sqrt(24)/sqrt(8) + -1)) + sqrt(432) + 1 + -5)2 + 0. 48sqrt(3) + 436 Simplify 1(-5(sqrt(11) + 1) + sqrt(11) + sqrt(11) + -3sqrt(11)-1 + 2 + sqrt(44)6). -3 + 12sqrt(11) Simplify (-2 + -1 + 2(1 + sqrt(17))2 + ((3*sqrt(68	{ "pile_set_name": "DM Mathematics" }
o 6 decimal places? -0.000006 Suppose -3p - 3i = 3915690, -i - 2035766 - 1879916 = 3p. Let j = -4474492 + 2079266. Let u = j - p. Round u to the nearest 100000. -1100000 Let x = -480.78 - -480.7864911. What is x rounded to 5 decimal places? 0.00649 Let u be (-9)/(-3)-3(-8)/36. Suppose 5o + 3v = -32, -3o + uo = v + 8. Let i be ((-27750)/o)/(3 + 28791/(-9600)). Round i to the nearest 1000000. 7000000 Let n = 26438.57 - 25939. What is n rounded to the nearest 10? 500 Let b(s) = -20532s + 6 + 6 - 105359s + 1562s. Let d be b(6). Let n = 2145962 + d. Round n to the nearest one hundred thousand. 1400000 Let w = 27160.995534 - 27161. Round w to three dps. -0.004 Let o = -2757658 + 2757658.04439364. Let m = o - 0.0444. What is m rounded to 6 decimal places? -0.000006 Let p = -16403.8695 + 16399. Let d = 73.1 + -78. Let l = d - p. What is l rounded to 3 dps? -0.031 Let q = -2.3034 - -2.44558. Round q to one dp. 0.1 Suppose -336v = -332v. Suppose vk - 4k = 5o + 7300, 3k + 5444 = 4o. What is k rounded to the nearest one thousand? -2000 Let n = 804330365 - 804329898.999683. Let w = 466 - n. Round w to 4 dps. -0.0003 Let m = 5.591 - 0.241. Let l = 5.349006 - m. What is l rounded to 4 dps? -0.001 Suppose -3j - f = -8, 0 = -3j + 8j + 3f - 16. Suppose jy - 474 - 176 = 0. Let l = 3275 - y. What is l rounded to the nearest one hundred? 3000 Let y = 844.5 - 556. Round y to 0 decimal places. 289 Let f = -2.4 - -2.31. Let y = 0.26 - f. Let z = -0.34964 + y. What is z rounded to four decimal places? 0.0004 Let h = 29489.19153 - 29489. What is h rounded to three decimal places? 0.192 Suppose -8k = -3k - 145. Suppose 34r = kr - 40. Let t(q) = 9q3 - 10q*2 + 4q + 10. Let s be t(r). Round s to the nearest 100. -5300 Let l = 21 + -21.079. Let k = 98.914 + -99. Let p = k - l. Round p to three dps. -0.007 Let f = -393 - -68. Let s = 325.0718 + f. Round s to 3 dps. 0.072 Let c(i) = 3i2 + 18i + 31. Let x be c(-5). Let t be x/32046/(-44). What is t rounded to the nearest one hundred? -200 Suppose -2q + 2x + 91 = 3x, 4q = -4x + 172. Suppose 0 = 18a - 44a + 2990. Let h = q - a. Round h to the nearest ten. -70 Let g(k) = 20k - 205. Let r be g(-6). Let m be 18329996/26 - (-10)/r-5. Round m to the nearest one hundred thousand. 700000 Let v = 0.111 - -5.549. Let u = -0.31 + v. Round u to one dp. 5.4 Let o = -1.19 - 166.81. Let g = 106 + o. Let c = g - -61.812. Round c to 2 decimal places. -0.19 Let j = -7.469 + -0.431. Let d = -69.8 + j. What is d rounded to the nearest 10? -80 Let v = -313.9957 + 314. Let p = v - 0.5403. What is p rounded to one dp? -0.5 Let s = 3.8204 - 20.2676. Let q = s + 16.5. Round q to 3 decimal places. 0.053 Let y be -6 - ((-5929 - 2) + 6). Suppose -r - 1486 = n, -y = -25r + 29r - n. What is r rounded to the nearest one hundred? -1500 Let f(l) = -3l3 - 10l*2 - 5l + 13. Let k be f(-11). Let g = k + -7069. Let p = g + -7782. What is p rounded to the nearest 1000? -12000 Suppose -2954100 = 31564v - 31614v. What is v rounded to the nearest one thousand? 59000 Suppose -3c + 5y = 216005, -302c + 303c - y = -72001. What is c rounded to the nearest 10000? -70000 Let h = 36707 + -19259. What is h rounded to the nearest one thousand? 17000 Let j = -3253.024 + 3246. What is j rounded to zero dps? -7 Let j = -329.95000049415 - -329.95. What is j rounded to seven decimal places? -0.0000005 Let d = 0.1937476 + -0.19766. Round d to four dps. -0.0039 Let l = -6.21348 + 6.29. Round l to 3 decimal places. 0.077 Let r = 11929.7777 - 11933. Let y = 3.2 + r. What is y rounded to 3 decimal places? -0.022 Let t(g) = -821210g + 940. Let k be t(14). What is k rounded to the nearest one hundred thousand? -11500000 Let l = -52.76 + 57.566. Let d = 5.064 - 0.164. Let k = l - d. Round k to 2 decimal places. -0.09 Let s = -28779 + 28776.7287. Round s to two dps. -2.27 Let u = -2.69 + -5.02. Let y = u + 7.8. Let h = y + -0.09000272. Round h to 7 dps. -0.0000027 Let g = 10.74129914701 - 10.7413. What is g rounded to seven dps? -0.0000009 Let d = -0.472177 + 0.4741. Round d to four decimal places. 0.0019 Let d = 0.84 + 72.42. Let x = -67 + d. What is x rounded to the nearest integer? 6 Let p = 4.94 - -251.06. Let d = p + -255.99999795. What is d rounded to six dps? 0.000002 Let s be (-3 + 1)/((-2)/11). Suppose -31b = -21b - 70. Suppose -4k + b = s. Round k to the nearest ten. 0 Let a = 100 - 115. Let s = a + -126.2. Round s to the nearest ten. -140 Let q = 3338.1 + -1218.6. What is q rounded to the nearest 10? 2120 Let h(q) = 4374997q + 7. Let t be h(5). Let b = -4575383 - -9000391. Let f = b + t. What is f rounded to the nearest one million? 26000000 Let u = -61562.999950133 - -61563. What is u rounded to 5 dps? 0.00005 Let t be 6(-120)/5465025/2. Round t to the nearest 10000. -430000 Let t = 531.20743732877 + -0.20742336877. Let n = 531 - t. What is n rounded to six decimal places? -0.000014 Let n = -0.011701 - -0.011677547. What is n rounded to 7 decimal places? -0.0000235 Let g be (-7218)/54(345 + 0). Let p = g + 82167. Let o = p + 128948. What is o rounded to the nearest ten thousand? 170000 Let h = -123.308 - -0.308. Let u = 122.999999881 + h. Round u to 7 dps. -0.0000001 Let i = 0.1176453 + -0.11827. Round i to five dps. -0.00062 Let i = -0.229 - -0.019. Let a = -0.20999591 - i. Round a to seven dps. 0.0000041 Let s = 123231482066 - 123232626653.10362. Let i = -1144391.1 - s. Let b = 196 - i. Round b to 4 dps. -0.0036 Let c = -373.859 + 0.859. Let k = c + 362.43. What is k rounded to 0 decimal places? -11 Let n = 26.20079027 + -26.201. What is n rounded to 5 dps? -0.00021 Let o(d) = -23331d + 7. Let y be (-1908)/(-63) + 2/(-7). Suppose -34v + yv = 12. Let i be o(v). What is i rounded to the nearest one hundred thousand? 100000 Let i = -1338.57183 - -1312.97. Let t = -25.6 - i. What is t rounded to three dps? 0.002 Let x = -33273 - -33271.80792. Round x to 2 dps. -1.19 Let a = -580 - -353. Let k = 226.39 + a. Round k to 1 dp. -0.6 Let z = 275.0578 - -0.9294. Let p = 276 - z. What is p rounded to three decimal places? 0.013 Let y = 223 + -223.0415. Let n = y + 0.040862. What is n rounded to 5 decimal places? -0.00064 Let i = 8040.46 + -8253. Let b = i + 214. What is b rounded to 1 decimal place? 1.5 Let f = -13.9 - 4. Let o = f - -0.9. Let n = -16.9925 - o. Round n to three dps. 0.008 Suppose 31 = -3d - 137. Let k = d + 51. Let b(y) = 1120y2 + y + 5. Let g be b(k). What is g rounded to the nearest 10000? 30000 Suppose -l = 5j + 8, -j = 2l - 1 - 1. Suppose -17t + 19t = 10. Suppose -lb = -0b + tr - 10475, 5224 = b - 2r. Round b to the nearest 100. 5200 Let t(r) = r2 + 2r - 3500. Suppose 3s = -2c - 10, -5 + 3 = s + c. Let i be s/2 + (-4 - -7). Let f be t(i). Round f to the nearest one thousand. -4000 Let d = -8.64 + 8.6405588. What is d rounded to 5 decimal places? 0.00056 Suppose -35h + 245119601 + 113280399 = 0. Suppose 8t = 4t + h. What is t rounded to the nearest 1000000? 3000000 Let b(l) = -662l*3 - 6l*2 + 7l + 25. Let f be b(5). What is f rounded to the nearest ten thousand? -80000 Let c = -351 - -134. Let p = c + 216.9999744. Round p to five dps. -0.00003 Let o = 38 + -38.04. Let q = o + -3.76. Let f = 3.8025 + q. What is f rounded to three dps? 0.003 Let s = 92065301 - 63672301. What is s rounded to the nearest 1000000? 28000000 Let h(m) = m*3 - 4m*2 + m + 117400000. Let f be h(0). Let g be (21/14)/(30/f). Round g to the nearest 100000. 5900000 Let b(s) = -246s*2 - 504s - 144. Let h be b(53). Round h to the nearest 100000. -700000 Let f = 6977.563172 - 7065.06316797. Let g = 87.5 + f. Round g to seven decimal places. 0.000004 Let p(m) = -2548m + 242. Let g be p(-3). Suppose 64 = 5f - g. Round f to the nearest 1000. 2000 Let f = -4640 + 4640.0000010137. What is f rounded to seven decimal places? 0.000001 Let w = -19.3 + -68.7. Let u = w + 87.959. Let o = u + 0.043. Round o to 2 dps. 0 Let u = -0.11 - -0.10997753. Round u to 6 dps. -0.000022 Let j be (0 - (-131)/3) + 2/6. Suppose -7s + 3s + j = 0. Suppose sl - 53000000 = 16l. What is l rounded to the nearest 1000000? -11000000 Let a = -23785 - -23794.597. Let p = a - 9.6. Round p to 2 decimal places. 0 Let l = 292.027 -	{ "pile_set_name": "DM Mathematics" }
+ 1 - 1)(0 + 1 + 0)((-n + 3n - n)(5 - 4 - 3) - 3n + n + n). 24n Expand (0 - 1 + 3)(-4w*5 + 3w*5 + 3w*5 + (-5w*2 + 0 + 0)(0w3 + 0w*3 - 2w*3)). 24w*5 Expand (2l + l - l)(4l + 0l - 2l) - 4l2 + 4l*2 - 2l*2 - 2l*2 + 3l*2 + 5l*2. 8l*2 Expand (5k2 - k2 - 2k2)(0 + 9 + 2)(0 - 3 + 2). -22k*2 Expand (2o - 2 - o - 3o)(19o2 + 51 - 51). -38o*3 - 38o*2 Expand (-2t + 0t + t)(-4 + 0 + 2) - 10 - 9t + 10. -7t Expand (-2v + 2v - 1 + v)(-2v4 - v4 + 4v4). v5 - v4 Expand (j - j + j2)(4 + 2j - 4) + j3 + 0j3 + j3 - 7j3 - j3 + 3j*3 + (-j + 2 - 2)(4j2 - 4j*2 + 2j*2). -3j*3 Expand (0 - 1 + 3)(1 + 0 + 3)(-w + w - 2w). -16w Expand (2s*2 - 3s + 3s)(8 - 26 - 24). -84s2 Expand 0p*2 + 0p*2 + 3p*3 + (-2 + 0 + 0 + p)(0p2 - 2p*2 - 11p*2). -10p*3 + 26p*2 Expand (0a*3 + 6a*3 - 4a*3)(4a2 + 0a2 - a2). 6a5 Expand (3 - 3 - 2u)(u + 2u - 6u) + u2 - u2 + u2 - u - 2u*2 + u + (2u - u + u)(1 - 1 - 2u) - 4 + 4 + 2u2. 3u*2 Expand (-4 + 6r - 4r + 3)(2 - 2 + 3r). 6r*2 - 3r Expand (-z + 2z + 0z)(z3 + 27 + 82 + 1348z*4 - 1349z4). -z5 + z*4 + 109z Expand (0 + 0 - 1)(2 + 3 - 3)(t + t - 3t)(0 - 2 + 1). -2t Expand (z2 - z2 - z2)(3z2 + 2z*2 - 3z*2) + 2z*4 - 6z*4 - 3z*4. -9z4 Expand (d2 + 4d3 - d2)(-3d - 2d + 7d). 8d*4 Expand 2n*4 - 5n + 5n + 4 - 4 - n4 + (2n - n + 0n)(2n - 2n*3 - 2n) + 0n4 + 0n4 - n4 + n*4 + 0n*4 - 2n*4. -3n*4 Expand (2 + 2b - 2)(7b*2 - 2 + 3b*2 + 1). 20b*3 - 2b Expand 0a + 0a - 2a3 + (1 - 1 - 1)(1 + 5 + 7a3 - 4). -9a*3 - 2 Expand (-7g + 3g + 2g)(-3g + 6g + 0g - 7). -6g2 + 14g Expand -3o3 + 0o3 + o3 + 55 - 4o3 - 55 + (o - o + o2)(0o - o - o) + (-3o - o + 2o)(0o2 + 2o*2 - 3o*2). -6o*3 Expand (-25k*2 + 1211 - 1211)(-3 + 0 + 5). -50k2 Expand (0 + 1 - 11q + 9q)(-5 + 5 - 2). 4q - 2 Expand (3 + 0 - 2)(-d*3 - 2d*3 + 5d*3) + 0d*3 - 2d*3 + 6d3 + 1 - d3 - 6 + 6. 5d3 + 1 Expand 2i*4 - 2i4 + i5 + (-3 + 3 - 2i4)(-i + 2i + 0i) - 10i5 + 2i*5 - 15i*5. -24i*5 Expand (-6g*2 + 0g*2 + 4g*2)(-g - g + g) - g*3 + 5g*3 + 0g3 + g2 - g*2 - 2g*3 - 3g*3 + 0g*3 + 5g*3. 6g*3 Expand (-2z + 5z - 2z + 3z - 2z + 2z + (3z + 0z - z)(1 - 3 + 1))(-11 + 0 + 4). -14z Expand (1 + 3 - 1)(q - 6q + 11q). 18q Expand (-4 + 2 + 3)(-6q*2 + 3q*2 + 4q2). q2 Expand (-3 + 3 + d)(-3 + 7 - 2)(1 + 1 + 0)(4 + 0 - 2). 8d Expand (-h - h*2 + 4h - h)(10 - 2 - 1). -7h*2 + 14h Expand -5m2 + 0m*2 + 3m*2 + 0m*2 + 4m*2 + 2m*2 - 2 + 2 + 2m*2 + (m + 4 - 4)(-6m + 4m + 0m) - 1 - m2 + 1. 3m*2 Expand -7g*2 + 0g*2 + 2g*2 + (1 + 2 - 5)(3g2 + 2g*2 - 4g*2 - 4g*2 + 4g*2 + 2g2 + (-g2 - 2g2 + 2g*2)(-1 - 4 + 4)). -13g2 Expand (n - 3n + 3 + 0n)(-2 - 1 + 2). 2n - 3 Expand (-6 - 23 + 2)(3r3 - 6r3 + r3)(-4 + 3 + 0). -54r*3 Expand (0r - 3r + 2r)(1 + 2 - 1)(3r - 3r - 5r4). 10r*5 Expand (11 + 1 - 3)(-1 + 9o - o2 - 9o). -9o2 - 9 Expand (1 + 1 + 0)(7p5 + 18 - 18) + 3p*5 + 2 - 2. 17p*5 Expand -3z - 2z + 2z - 2z + 5 - 5 + (0 + 2z + 0)(-1 + 3 - 1) - z + 3z + 0z. -z Expand 6v*4 + 2v4 + v4 + (-2v3 + 0 + 0)(2v + 0 + 0) + v4 + 2v*4 - 6v*4. 2v*4 Expand (-3 + 3 + 1)(0 + 0 + w)(4w - 4w - 2w). -2w2 Expand (7b + 0b + 4b)(2 - 2 - b). -11b*2 Expand v + 4v - 3v + (-3v + 5v + 0v)(-5 + 3 + 1) - 4v + v + 0v. -3v Expand (-3h5 + 0h5 + h5)(-4 + 1 + 0) + (-2h*4 + 4h*4 + 0h*4)(3h - 5h + 3h). 8h*5 Expand (2 + 2 - 6)(-n + 5n - 3n) + 3n + n - 3n + n + 4 - 4 + (-5n + 3n + n)(-1 + 5 + 1). -5n Expand ((-1 + 4 - 1)(-4r + 0r + 2r) - 4r + 5r - 2r)(0r3 + 5r*3 - 3r*3 + (0r2 + r2 + r*2)(1 + r - 1) + 23r3 - 33r + 33r). -135r*4 Expand (4g - 3g + g)(4 - 4 - 2g) - 2g*2 + 7g*2 - 3g2 - g2 - g*2 + 3g*2 + (-2g + 3g - 3g)(3g + g - 2g) - 2g*2 - 4g + 4g. -7g2 Expand w2 - 3w2 - w2 + (-2w + 4w + 0w + w + 3w - 5w + 3w - 6w + 5w + (3 - 1 - 3)(0w - 2w + 0w))(-1 - 2w + 1) - 3w + 3w - 2w*2. -15w*2 Expand (0d - 2d + 3d)(1 - 1 - d) + (4d - 3d - 33d)(3d - 4d + 2d). -33d2 Expand -2c*3 + 2c*3 - 2c*3 + (0 - 2c + 0)(-3c*2 + 2 + 5c*2 - 4c*2). 2c*3 - 4c Expand (-3z2 - 2z2 - z2)(-4 + 4 - 3z). 18z3 Expand (-8 + 26 + 32)(3 - 3 - 2l)(2 + 2 - 6). 200l Expand (0a - 2a + 3a)(2 - 5 + 2) + 10a + 15 - 15. 9a Expand 3g*5 - 2g*5 - 3g*5 + 2g*5 - 5g*5 + 2g*5 - 2g4 + g5 + 2g4 - 2g*2 - 4g*5 + 2g2 + (g2 + 6g2 - 5g*2)(-g*3 + 2 - 2). -8g*5 Expand (-2 + 2 + 2)(-6 + 6 - 2)(0 - 2 - 1)(a3 + a3 - 3a3). -12a*3 Expand (-3d + 3d + 6d*3)(d - 2d - d). -12d*4 Expand (0 - 1 + 0)(7 + 5 - 20c + 18c). 2c - 12 Expand 7h*2 - 6h*2 + 9h*2 + (h + 0h + h)(0h + h + h). 14h2 Expand (-2o*3 + 2o3 - o3)(-19o + 64o - 28o - 23o). 6o*4 Expand (-4 + 4 + 3l*4)(1 - 2 + 2) + 2l + l3 - 3l*3 + 0l*3 - 2l4. l4 - 2l3 + 2l Expand (8n2 - 5n*2 + 2n*2)(-8n2 + 2n - 2n). -40n*4 Expand (2n*4 + 0n4 + n4)(-4n - 3n + 4n + (n + 2 - 2)(-6 + 3 + 2)) + 2n*5 - 7n*5 + 2n*5. -15n5 Expand (-i4 + 5i4 - 8i*4 + (-i - 2i + 2i)(3i3 + i3 - 2i*3))(-3 + 2 + 3). -12i4 Expand (-s + s - s)(4 + 41 + 5). -50s Expand (-v + 5v - 3v)(5 + 3v - 5)(2 + 4 + 3). 27v2 Expand (1 - 5 + 3)(-9 + 2 - 1)(-3s*5 + 3s5 + s5). 8s5 Expand (-4n + 4 - 2 + 0)(-n2 + 0n2 - n2). 8n3 - 4n2 Expand s3 - s3 + s4 - 3s4 + s4 + 0s*4 + (-6s*4 + 2s*4 + 2s*4)(3 - 5 + 0) - 2s + 4s*4 - 2s*4 - 2s + s*4 - 3 + 3. 6s*4 - 4s Expand (2y - 2 + 2)(-7y4 + 3y*4 + 3y*4) + 0y*5 + 0y*5 + 3y5 - y5 + y*5 - 3y*5 - 3y*5 + 4y*5 - 2y*5. -3y*5 Expand (-6 - 2 + 5)(4 - 3 + 0)(3y + 0y - 6y). 9y Expand (-3u*3 - 3u3 - u3)(13u*2 - 20u*2 + 11u*2). -28u*5 Expand -2h3 - h2 + h*2 + 4h*2 - 4h2 + h3 + (-4h + 2h + h)(-2h2 + 0 + 0). h3 Expand n*4 + 23n - 4n4 - 20n - n*2 + 2n*4 + 2n*4 - 5n*4 + (0 - 3 + 2)(4n4 - 4n*4 + 2n4) + n3 - n3 - n4. -7n4 - n2 + 3n Expand (-m - m - 3m)(3m - m - m). -5m*2 Expand (-2s + 4s - 3s)(2s*2 - 6s*2 + 3s*2)(-4 + 1 + 1). -2s3 Expand (-2h*4 + 3h4 + h4)(-1 + h + 1) + 3h*5 - 4h*2 + 4h2 + 2 - 2 - h5. 4h5 Expand (1 + 1 + 2)(10g - 9g + 14g) + g - 4g + 4g. 61g Expand (-3 - 2b + 3)(-3b - 7b + 2b). 16b*2 Expand (-8v*2 - 21v*3 + 7v*2 + 2v*2)(-5 + 4 + 0). 21v3 - v2 Expand (2 - 2z - 2)(5 - 1 - 1)(4z + 0z - 4 - z). -18z2 + 24z Expand (-5 + 4 - 5)(-2g*3 + 8 - 8). 12g*3 Expand (-y - 2y + y)(-1 - 1 + 1) + (3 + 2 - 4)(6y - y - y) - 5y + y + y. 3y Expand (0 + 3 - 1)(0l2 - 2l*2 + 0l*2 - 2l - l*2 + 2l + (2l - 4l + l)(-3l - 2l + 3l) - 2l2 + 4l*2 - 4l2 - 3 - l2 + 3). -8l2 Expand ((-3 + 4 - 2)(5 - 4 - 3) + 4 - 4 + 2)(4w + 3w - 6w). 4w Expand (b + 0b - 3b)(8 + 0 + 0 + (-2 + 0 + 1)(1 + 1 + 0)). -12b Expand (28t2 + 51t - 51t)(2t + 3 - 3). 56t*3 Expand (-2i*2 + 0 + 0)(-1 + 4 - 1) - 2i2 + 2i*2 + 2i*2 + (-2i - i + i)(1 + i - 1) + i2 + 0i*2 - 2i2 - i2 - 2i2 + i2. -7i*2 Expand (6b + 7 + 14 - 19)(2 + b - 2 + (0 - 1 - 1)(-b + 4b - 5b)). 30b2 + 10b Expand -k*5 + 3k*5 + 2k*5 + (4k - 5k + 2k)(-k4 + k4 + k4). 5k5 Expand -z + z + z5 + (-3 + 0 - 1 + (-4 - 1 + 3)(5 - 3 - 3))(2z2 - 2z*2 + 3z*5). -5z*5 Expand (-2r + 1 - 1)(r + 3r - 3r) + (-4 + 1 - 8)(-3 + 3r2 + 3 - 1). -35r*2 + 11 Expand (3j - 3j + j2)(3 - 2 + 0) + 216 - 218 + 0j2 + 3j*2. 4j*2 - 2 Expand (1 - 2u - 1)(10 - 4 + 6) + 3u - 3u - 2u - 4u + 2u + 4u. -24u Expand 2q2 - 4q2 - q2 + (-2q + 0 + 0)(-3q + 4q - 3q) + (2 - 1 + 1)(-4q2 + 16q*2 + 4q*2). 33q*2 Expand (-6 - 15 - 19)(1 - 1 - f). 40f Expand (-2h + 0h + 0	{ "pile_set_name": "DM Mathematics" }
+ 0. n(n - 2)(n + 6)/5 Suppose 3b = -0b + 3w - 6, 0 = -w + 3. Let b + 2p2 - p3 + 343p - 336p + 3 = 0. What is p? -1, 4 Factor 1008 + 1200/7g + 4/7g*2. 4(g + 6)(g + 294)/7 Let h(g) be the third derivative of -g6/60 + 11g*5/6 + 113g*4/12 + 19g*3 + 939g2. Find q, given that h(q) = 0. -1, 57 Let o(y) = y3 - 7y2 + 4. Let p be o(7). Let h be (0/4)/(2 + -4). Suppose -3q*4 - 8q2 + q4 + 8q3 + hq*p = 0. Calculate q. 0, 2 Let u(h) be the first derivative of 6h*3/5 - 71h*2/5 + 112h/5 + 550. Factor u(j). 2(j - 7)(9j - 8)/5 Factor 2294/17j - 8214/17 + 2/17j3 + 142/17j*2. 2(j - 3)(j + 37)2/17 Let d be (-2)/3 - 70/(-6). What is i in -20 + 14 + 3i*3 - 6i*2 - 2i*3 + di = 0? 1, 2, 3 Let s(m) = 2m4 + m3 + m2 - 2m - 1. Let w(b) = -3b4 + 75b*3 - 82b*2 - 152b + 2. Let l(o) = 10s(o) + 5w(o). Factor l(h). 5h(h - 2)(h + 1)(h + 78) Suppose 40t + 19t = -279t. Let j(p) be the third derivative of 1/80p*5 + 17p*2 + 0p - 3/16p4 + 9/8p*3 + t. Factor j(o). 3(o - 3)*2/4 Suppose 4l = 288 + 1404. Suppose -430d + ld = 0. Factor d + 2/7m4 + 6/7m*2 + 10/7m*3 - 18/7m. 2m(m - 1)(m + 3)2/7 Let t = 1935/16 - 1905/16. Let k(u) be the first derivative of -1/2u*5 + 25/4u*2 + 15/2u*3 + 0u + tu4 - 9. Find c, given that k(c) = 0. -1, 0, 5 Let p be (-110)/3(-63288)/45. Factor -48h - p + 51568 - 28h*3 + 64h*2 + 4h*4. 4h(h - 3)(h - 2)2 Let g(j) = j3 + 54j2 - 2207j + 542. Let u be g(27). Factor 3/2k + 75/2k*u - 3/2k*3 - 75/2. -3(k - 25)(k - 1)(k + 1)/2 Let p be (7/3)/(26/468). Let 6o3 - 1080 + 540o + po2 - 132o*2 + 5o*3 - 6o*3 = 0. Calculate o. 6 Let j = 29118 + -262061/9. Let n(f) be the first derivative of 7 - 4/9f - 2/9f2 + jf*4 + 4/27f*3. Factor n(v). 4(v - 1)(v + 1)2/9 Let s = 2697 + -2691. Let p(w) be the second derivative of 3/230w*5 + 2/345w*s + 1/138w*4 + 21w + 0w2 + 0 + 0w*3. Determine d so that p(d) = 0. -1, -1/2, 0 Factor -72 - 248/7s + 2/7s2. 2(s - 126)(s + 2)/7 Suppose -111 = 29v + 10503. Let p be (-4)/6v/122. Factor 2/7q*4 - 4/7q - 2/7qp + 0 + 4/7q*3. 2q(q - 1)(q + 1)(q + 2)/7 Let p(o) be the first derivative of 9o*5/25 + 87o*4/20 + 13o*3 - 15o*2/2 - 3691. Factor p(w). 3w(w + 5)2(3w - 1)/5 Let w(z) be the third derivative of -7z*4/24 + 53z*3/6 - 32z*2. Let l be w(7). Factor 157v + 2v3 - 169v - 36vl + 68v*2 - 86v*3. -4v(v + 3)(3v - 1)2 Suppose 0 = 8a - 12a + 56. Suppose 3f = 3u - 12, a = 4u + 2f - 8. Suppose 835n*2 - 843n*2 + 8n*4 - 6n*3 - 2n*u + 8n + 0n5 = 0. What is n? -1, 0, 1, 2 Suppose -21t + 88t - 158 = -12t. What is q in -3/7qt + 18 + 3/7q = 0? -6, 7 Factor -2s2 + 3770/7s - 1076/7. -2(s - 269)(7s - 2)/7 Let n = 90 + -58. Let m = n - 30. Factor -44p*m + 2p*5 + 2 + 12p*4 + 20p*3 + 23p*2 + 41p*2 + 10p - 2p4. 2(p + 1)*5 Let v be 22/(-4)(3 + -5) + -11. Let x(l) be the third derivative of 19l2 + vl - 1/105l7 - 5/6l4 - l3 - 2/5l5 - 1/10l*6 + 0. Factor x(y). -2(y + 1)*3(y + 3) Solve 1142/5a - 2/15a*2 - 3424/15 = 0 for a. 1, 1712 Let l(i) = 35i*4 - 8160i*3 - 8345i*2 + 50i - 150. Let q(z) = 2z4 - 480z*3 - 491z*2 + 3z - 9. Let a(c) = -3l(c) + 50q(c). Factor a(m). -5m2(m - 97)(m + 1) Let s be ((-301)/8729)/((-11)/29). Factor -sn*2 + 12/11n - 36/11. -(n - 6)*2/11 Let a = 173 + -149. Let b = -24 + a. Factor 2/7x*3 + bx + 0 + 2/7x2. 2x*2(x + 1)/7 Let t(y) = -64y2 + 844y - 232. Let f(s) = 3s2 - 2s. Suppose 52 = -4r + m, 0 = 5r + 5m - 1 + 41. Let g(x) = rf(x) - t(x). Factor g(q). 4(q - 29)(7q - 2) Let j be (-6216)/24 + 12/3. Let i = j - -260. Factor 2/7y*2 + 2y*4 + 6/7y*i + 0y + 10/7y3 + 0. 2y*2(y + 1)*2(3y + 1)/7 Let n be 15 - (2 + 7 - 1)/2. Let i be (-11 + n)(-4)/((-24)/(-3)). Factor -1/2o5 + 0o + 0o2 + i + 1/3o*3 - 5/6o4. -o3(o + 2)(3o - 1)/6 Suppose 55 = -5b + q, -3q + 28 = -2b - 7. Let p be 35/b-2 - (-10)/(-2). Factor 0k + 1/3kp - 1/3. (k - 1)(k + 1)/3 Let p(j) = -j*3 + 13j*2 - 25j - 28. Let u be p(12). Let d = u + 373/2. Factor 0 - 10/3h2 + 5/6h*3 + dh. 5h(h - 3)(h - 1)/6 Determine f, given that -14f*3 - 10/7f*5 + 8/7f*2 + 76/7f*4 + 0 + 24/7f = 0. -2/5, 0, 1, 6 Let x(g) be the first derivative of -12g2 + 4 - 1/5g*3 + 0g - 1/450g5 - 1/30g*4. Let h(a) be the second derivative of x(a). Factor h(u). -2(u + 3)*2/15 Let b(p) = 10p*2 + 1045p + 1040. Let m(z) = 19z2 + 2091z + 2081. Let f(a) = 9b(a) - 5m(a). Factor f(o). -5(o + 1)(o + 209) Let r(g) be the first derivative of 2g6/3 + 36g*5/5 + 7g*4 - 92g*3 - 304g*2 - 336g - 3257. Solve r(j) = 0 for j. -7, -2, -1, 3 Let o(k) be the first derivative of -2k3/3 + 57k*2 - 112k + 1272. Determine j, given that o(j) = 0. 1, 56 Let p(r) be the second derivative of 11r4/30 + 14r*3/15 - 24r*2 - 1188r. Factor p(s). 2(s + 4)(11s - 30)/5 Let q = -1465229 + 1465231. Solve -495h - 5/2hq - 49005/2 = 0 for h. -99 Let f(x) be the third derivative of 1/30x*6 - 1/210x*7 + 0x*3 + 45x*2 + 0x*4 - 1/20x*5 + 0 + 0x. Solve f(m) = 0. 0, 1, 3 Suppose -98 - 1/2x3 - 53/2x*2 - 100x = 0. What is x? -49, -2 Let g = 30547 - 153606/5. Let b = 175 + g. Let -16/5 + bc2 - 16/5c + 4/5c3 = 0. What is c? -2, -1, 2 Suppose 0 = 121q - 64q - 61q - 4, 4s = 2q + 2. Determine o, given that 2/3o3 + 8/3o*2 + 8/3o + s = 0. -2, 0 Determine i, given that 1120i2 - 8i*4 - 387i - 16i5 - 36 + 236i*3 + 1411i + 4i4 + 228 + 148i3 = 0. -2, -1/4, 6 Let w(b) = b3 - 16b2 - b - 4. Let a(i) = -7i - 41. Let x be a(-6). Let q(h) = 3h2 + h + 1. Let f(s) = xw(s) + 4q(s). Suppose f(y) = 0. Calculate y. 0, 1, 3 Let m be 2/4(16/(-6))/(7636/(-22410)). Suppose -6t - 50/23t*2 + 36/23 + mt*3 + 54/23t*4 + 8/23t*5 = 0. Calculate t. -3, -2, 1/4, 1 Suppose 3d + 4c - 22 = -0d, -4d + 4c + 20 = 0. Suppose dg + 3g - 18 = 0. Factor -14 - 35 + 6n3 - 63n + 0ng - 15n*2 - 7n*3. -(n + 1)(n + 7)*2 Determine p so that -291 - 1167/2p + 9/8p4 - 303/4p*2 + 1743/8p*3 = 0. -194, -1, -2/3, 2 Let 0 + 2/13q*5 - 800/13q - 80/13q2 + 798/13q*3 + 80/13q*4 = 0. What is q? -20, -1, 0, 1 Suppose 4s + f + 1 = 0, 4s + 0s = -3f - 11. Let i be ((-30)/451)/(s/(-3)). Suppose -12 - 12g4 - 3/2g*5 - 75/2g*3 - 57g*i - 42g = 0. Calculate g. -2, -1 Let b(c) be the second derivative of c*4/3 - 176c*3/3 - 178c*2 + 255c + 7. What is d in b(d) = 0? -1, 89 Find l such that 4/3l3 + 1916/3l + 424 + 216l2 = 0. -159, -2, -1 Let s = -24614/27 + 123178/135. Factor -sz*2 + 176/5z + 0. -4z(z - 44)/5 Factor 3r3 + 3r*3 + 19r*2 + 50 + 18 - 143r*2 + 166r + 12r2. 2(r - 17)(r - 2)(3r + 1) Factor -22162968 - 346585324h - 669573h3 - 2986h*4 - 2h*5 - 818447h*3 - 223363978 - 130172644h - 15777978h - 248494036h*2. -2(h + 1)*2(h + 497)*3 Solve -357/4r*2 + 705/4r - 351/4 + 3/4r3 = 0. 1, 117 Factor 2/7a*5 + 40/7a*2 + 8/7 - 20/7a*3 - 30/7a + 0a4. 2(a - 1)*4(a + 4)/7 Suppose 330667 = 5033j - 295485 - 506273. Factor -69/4x*2 + 3/4x*3 + 120x - j. 3(x - 10)2(x - 3)/4 Let i(o) = -o*3 + 3o*2 - 4o. Let d(t) = -t*4 + 80t*3 + 357t*2 - 12t. Let w(u) = d(u) - 3i(u). Suppose w(j) = 0. Calculate j. -4, 0, 87 Suppose 2/13l*2 + 528/13 - 530/13l = 0. Calculate l. 1, 264 Let z(y) = -47y2 + 72y - 25. Suppose 2p + 3 = 3x, 2x - 3p = 5 + 2. Let h(g) = -g*2 - g. Let r(a) = xz(a) - 2h(a). Factor r(n). (7n - 5)2 Let y(p) = p3 - 1511p2 - 21p + 7. Let n(r) = r*3 - 755r*2 - 9r + 3. Let k(s) = 7n(s) - 3y(s). Factor k(m). 4m2(m - 188) Let x(c) be the first derivative of -4/5c5 + 0c*2 + 0c - 1/8c6 + 162 + 7/6c*3 + 37/16c*4. Suppose x(f) = 0. Calculate f. -7, -1/3, 0, 2 Let q(n) = -2n*3 - 10n*2 - 19n - 12. Let r be q(-4). Factor ry2 + 693y + 4y2 + 820 + 204 - 309y + y*3. (y + 4)(y + 16)2 Let m(n) be the third derivative of -n6/1440 - n*5/160 - 3n*3 - 11n**2 + 7. Let k(x) be the first derivative of m(x). Determine l, given that k(l) = 0.	{ "pile_set_name": "DM Mathematics" }
? 83188800 Calculate the lowest common multiple of 1 and 3257805. 3257805 What is the common denominator of -95/224 and -69/495772? 27763232 What is the lowest common multiple of 696473 and 7661203? 7661203 What is the smallest common multiple of 12840024 and 546384? 25680048 What is the least common multiple of 2128 and 66? 70224 Find the common denominator of -51/424 and 89/153539092. 307078184 Calculate the least common multiple of 14806374 and 562980. 148063740 Find the common denominator of 99/73664 and -93/189440. 218045440 Calculate the common denominator of -77/1022260 and 111/25880. 2044520 Calculate the smallest common multiple of 237541 and 289. 4038197 What is the smallest common multiple of 15686 and 76659? 4752858 What is the smallest common multiple of 2176 and 6391184? 51129472 Calculate the common denominator of -109/9951978 and 131/79615824. 79615824 Calculate the common denominator of 113/24588 and 7/1129776. 2314911024 Calculate the smallest common multiple of 141 and 11839083. 556436901 What is the lowest common multiple of 355356 and 283? 100565748 Calculate the smallest common multiple of 1296680 and 261744120. 1832208840 What is the common denominator of -127/2328 and 143/1602828? 3205656 Calculate the lowest common multiple of 838780 and 42. 17614380 What is the common denominator of 41/4 and 83/1545832? 1545832 Calculate the lowest common multiple of 14000226 and 28956. 28000452 Find the common denominator of -55/9832124 and -21/212. 521102572 What is the common denominator of 113/262835820 and -89/51106965? 1839850740 What is the smallest common multiple of 9277 and 190216? 1764633832 What is the least common multiple of 829034880 and 22? 9119383680 What is the least common multiple of 40 and 13754153? 550166120 Find the common denominator of 123/425590 and -20/28046381. 280463810 Calculate the smallest common multiple of 1036 and 1092784. 40433008 Calculate the common denominator of -121/512676 and -59/1014. 86642244 What is the least common multiple of 855518 and 215956? 22243468 Calculate the least common multiple of 8723 and 66352. 4047472 What is the common denominator of 17/50958 and -91/73302? 32765994 What is the common denominator of 91/1556838 and 125/2826? 244423566 What is the least common multiple of 6850446 and 929? 6850446 Calculate the common denominator of 61/8604232 and 16/117. 77438088 Calculate the common denominator of -19/255 and -92/7150425. 121557225 What is the smallest common multiple of 2289 and 92214? 645498 What is the common denominator of 13/4396 and 7/5485580? 38399060 What is the common denominator of 64/41607483 and -5/117? 1622691837 What is the common denominator of 25/12217849 and 59/6185? 61089245 Calculate the smallest common multiple of 1156 and 14703. 16996668 Find the common denominator of -13/10167980 and 31/4067192. 20335960 Calculate the common denominator of -25/20169108 and -55/32494674. 584904132 Calculate the common denominator of 15/44678764 and 59/16. 178715056 What is the common denominator of 31/3345 and 65/316437? 1582185 Find the common denominator of 109/6 and -91/114738618. 114738618 What is the common denominator of -41/6815 and -103/248530? 11680910 Find the common denominator of -57/216865 and 35/18194. 358694710 Find the common denominator of 49/430050 and 13/117575670. 587878350 Find the common denominator of 25/1585044 and -51/38. 30115836 What is the common denominator of -35/1422672 and 7/161473272? 322946544 Calculate the smallest common multiple of 19326 and 166158. 535194918 Calculate the common denominator of -199/330 and -29/1093935. 24066570 Calculate the smallest common multiple of 10417 and 14136. 147254712 Calculate the common denominator of 31/232 and 26/20674361. 165394888 What is the common denominator of -28/3091313 and -39/407? 34004443 What is the smallest common multiple of 1342640 and 15492? 4027920 What is the common denominator of 31/3039328 and 91/6512? 33432608 Calculate the lowest common multiple of 38361960 and 4095. 38361960 What is the common denominator of -19/2576 and 15/35144? 492016 Calculate the lowest common multiple of 133713 and 3466872. 287750376 What is the common denominator of -109/12 and -13/29901996? 29901996 What is the common denominator of 131/2451276 and 61/120? 24512760 Calculate the common denominator of 25/442453 and 113/1914. 2654718 What is the common denominator of -101/1127392 and -62/77? 12401312 What is the least common multiple of 85590486 and 28530162? 85590486 What is the smallest common multiple of 1564010 and 420? 9384060 Find the common denominator of -51/66326 and -53/28127326. 365655238 Calculate the lowest common multiple of 25108560 and 65282256. 326411280 Calculate the smallest common multiple of 13932 and 77787. 933444 Calculate the smallest common multiple of 9608641 and 32943912. 230607384 Calculate the least common multiple of 183117 and 45229899. 45229899 What is the common denominator of -13/72577165 and -28/5? 72577165 What is the least common multiple of 690 and 29153673? 291536730 What is the smallest common multiple of 11335440 and 4534176? 22670880 Find the common denominator of -52/1043 and -34/7301. 7301 Calculate the least common multiple of 443226 and 538203. 7534842 What is the least common multiple of 8528 and 1330778? 138400912 Calculate the least common multiple of 6272005 and 2508802. 12544010 Find the common denominator of 83/2204226 and 57/8. 8816904 Calculate the common denominator of -73/11689488 and -29/649416. 11689488 Calculate the smallest common multiple of 209576 and 323. 3981944 Calculate the least common multiple of 430 and 706920. 706920 Calculate the lowest common multiple of 650 and 29623880. 148119400 What is the lowest common multiple of 13265 and 4499488? 22497440 Calculate the smallest common multiple of 8 and 1213868. 2427736 Calculate the common denominator of -43/4 and 51/131463214. 262926428 Find the common denominator of -71/8126 and -1/27671898. 470422266 What is the least common multiple of 1058070 and 1904526? 9522630 Calculate the lowest common multiple of 409728 and 5864232. 93827712 Calculate the common denominator of -9/200 and -27/1070710. 21414200 Calculate the common denominator of 34/43475859 and -61/21. 43475859 What is the common denominator of -71/1636400 and 67/880? 18000400 What is the lowest common multiple of 3965 and 1295213? 84188845 Calculate the lowest common multiple of 1364448 and 216. 12280032 What is the least common multiple of 10270 and 2519140? 199012060 What is the least common multiple of 1587955 and 25089689? 125448445 What is the least common multiple of 210 and 17178? 85890 Calculate the lowest common multiple of 10908270 and 3999699. 119990970 What is the least common multiple of 2652850 and 31990250? 543834250 What is the common denominator of 28/61685941 and 75/8? 493487528 Find the common denominator of 25/5730956 and 37/4. 5730956 What is the smallest common multiple of 6858 and 3744? 1426464 Calculate the common denominator of -33/140 and 75/5939164. 29695820 Find the common denominator of -25/112 and 79/231216. 1618512 What is the lowest common multiple of 10364172 and 265748? 10364172 Calculate the lowest common multiple of 22274 and 1823458. 67467946 What is the lowest common multiple of 251832 and 1427048? 4281144 What is the common denominator of -40/5636779 and -75/26? 146556254 Calculate the smallest common multiple of 1726412 and 98. 84594188 What is the lowest common multiple of 161772 and 453596? 23133396 What is the least common multiple of 96 and 27300704? 81902112 Calculate the lowest common multiple of 166865832 and 1620. 834329160 What is the lowest common multiple of 11498800 and 2720? 22997600 What is the least common multiple of 865 and 620315? 107314495 Calculate the smallest common multiple of 8442 and 45560. 2870280 Calculate the smallest common multiple of 69541122 and 11. 764952342 Calculate the lowest common multiple of 8233932 and 65238. 1078645092 Calculate the common denominator of -129/39730580 and 63/158922320. 158922320 What is the common denominator of -79/524353935 and -40/104870787? 524353935 What is the least common multiple of 5728 and 1416? 1013856 What is the common d	{ "pile_set_name": "DM Mathematics" }
(a) = -960a - 66. Calculate l(0). -66 Let z(c) = c3 - 13c*2 + 60c - 89. What is z(5)? 11 Let m(k) = -k*2 + 26k - 24. Determine m(25). 1 Let f(c) = -15c2 - 77c. Calculate f(-6). -78 Let h(i) = -3i3 + 9i*2 - 11i - 17. Calculate h(2). -27 Let b(c) = c*3 + 48c*2 + 32c - 123. What is b(-47)? 582 Let i(n) = 3n2 - 122n + 246. Calculate i(2). 14 Let p(d) = -3d2 - 118d - 1177. Determine p(-19). -18 Let z(n) = -1525n - 39668. What is z(-26)? -18 Let h(r) = -31r*2 + 131r + 17. Calculate h(4). 45 Let y(w) = -23w - 696. Give y(-17). -305 Let n(x) = 6x*2 + 137x - 15. Give n(-23). 8 Let o(y) = -y*3 - 23y*2 - 15y - 349. Give o(-23). -4 Let c(y) = 2y3 + 133y*2 + 540y - 1113. What is c(-62)? 3 Let t(z) = 50z - 971. Give t(20). 29 Let f(b) = 1129b + 10165. Determine f(-9). 4 Let u(a) = -60a3 + 24a*2 + 24a - 1. Determine u(-1). 59 Let t(x) = 157x - 1891. Give t(12). -7 Let f(n) = 2n*3 - 195n*2 - 104n + 603. Determine f(98). 15 Let a(l) = 42l + 596. Give a(-14). 8 Let b(w) = -90w + 4239. Give b(47). 9 Let d(g) = g*2 + 22g - 103. Calculate d(-33). 260 Let s(v) = -211v + 2092. Give s(10). -18 Let m(k) = -291k + 2318. Determine m(8). -10 Let y(d) = d*2 + 4d - 231. Determine y(-17). -10 Let c(r) = -37r + 1992. Calculate c(54). -6 Let z(f) = -f2 - 43f + 128. Give z(-46). -10 Let c(n) = 3n2 - 42n - 41. Calculate c(18). 175 Let n(v) = v*3 + 17v*2 + 73v + 33. Calculate n(-7). 12 Let n(x) = x*3 + 132x*2 + 3868x - 181. Calculate n(-44). -5 Let a(l) = 415l - 8269. What is a(20)? 31 Let g(a) = a2 + 886a - 34180. Determine g(37). -29 Let k(g) = -930g + 59516. Determine k(64). -4 Let j(o) = -129o + 1197. What is j(9)? 36 Let k(h) = 201h + 800. Give k(-4). -4 Let x(q) = -q3 + 10q*2 + 338q - 20. Determine x(24). 28 Let f(z) = -1784z + 19650. What is f(11)? 26 Let w(f) = -29f*2 - 20f - 102. Calculate w(-4). -486 Let o(p) = -2p2 + 5p + 105. Calculate o(0). 105 Let d(p) = -p*3 - 13p*2 - 17p - 16. Calculate d(-11). -71 Let n(z) = z*3 + 2z - 7. Calculate n(2). 5 Let p(t) = -15t2 - 227t + 216. Give p(-16). 8 Let s(b) = -2b3 - 13b*2 + 38b + 241. Calculate s(-7). 24 Let r(g) = 59g + 179. What is r(0)? 179 Let a(u) = -30u - 13. Calculate a(1). -43 Let s(n) = 16n2 - 301n - 1773. What is s(-6)? 609 Let n(s) = -8s3 - 7s*2 + s + 10. Determine n(3). -266 Let u(p) = 33p - 165. What is u(8)? 99 Let t(v) = 99v + 597. Calculate t(-6). 3 Let h(w) = 3w*2 + 49w - 321. Calculate h(-21). -27 Let i(p) = 144p + 4053. What is i(-28)? 21 Let u(v) = 546v - 3857. Determine u(7). -35 Let l(u) = 3u + 65. Give l(-23). -4 Let t(u) = -3u*3 + 79u*2 - 71u + 1176. Give t(26). 6 Let b(t) = t*3 + 28t*2 - 503t - 13700. What is b(-29)? 46 Let f(m) = 50m + 272. Calculate f(3). 422 Let q(w) = -196w - 9986. Determine q(-51). 10 Let o(h) = -2h2 - 4h + 15. Calculate o(7). -111 Let w(x) = 18x3 + 32x*2 + 30x - 2. Give w(-1). -18 Let h(s) = s*2 - 13s + 44. Give h(5). 4 Let p(f) = 9f3 + 96f*2 - 39f - 70. Give p(-11). -4 Let n(v) = v*2 + 55v + 660. What is n(-17)? 14 Let n(w) = 3w3 - 47w*2 - 3w + 374. Determine n(15). -121 Let f(w) = 186w - 900. Determine f(5). 30 Let x(q) = q3 + 42q*2 - 186q - 44. Determine x(-46). 48 Let v(y) = -4y2 - 118y + 235. Determine v(2). -17 Let w(m) = -951m - 5681. What is w(-6)? 25 Let o(w) = -331w + 302. What is o(1)? -29 Let q(z) = 6z2 - 55z - 2. Determine q(9). -11 Let m(d) = 13d - 502. Give m(41). 31 Let f(n) = -2n*2 + 270n + 814. Calculate f(-3). -14 Let f(z) = 1408z - 43633. Give f(31). 15 Let k(l) = 8l*2 - 98l + 6. Determine k(9). -228 Let m(i) = 9i2 + 454i - 740. Give m(-52). -12 Let t(g) = -895g - 15185. Give t(-17). 30 Let k(a) = -8a*2 - 16a + 41. Give k(-3). 17 Let t(h) = 10h3 + 52h*2 - 340h - 1753. Give t(-5). -3 Let j(d) = -d*2 - 11d + 132. Calculate j(7). 6 Let j(u) = -20u2 - u + 5. Calculate j(-2). -73 Let d(i) = i - 40. Give d(-8). -48 Let v(a) = a3 + 13a*2 - 36a - 97. Give v(-15). -7 Let m(u) = u*3 - 2u*2 - 10u + 7. Give m(-2). 11 Let d(h) = 127h - 1022. Give d(8). -6 Let m(d) = -d3 - 144d*2 + 889d - 1644. Give m(-150). 6 Let v(p) = -2p2 + 113p + 548. What is v(61)? -1 Let m(l) = -3l3 - 87l*2 - 27l - 44. Give m(-29). 739 Let t(f) = -f*2 - 37f - 9. What is t(-37)? -9 Let y(r) = -570r + 3373. Give y(6). -47 Let x(v) = -v3 - 56v*2 - 55v + 14. What is x(-55)? 14 Let k(f) = 539f - 25868. What is k(48)? 4 Let b(s) = -464s*2 + 2325s - 19. Determine b(5). 6 Let y(b) = 136b - 45680. Give y(336). 16 Let u(x) = -x3 + 28x*2 - 37x - 408. What is u(26)? -18 Let m(g) = -824g + 9059. What is m(11)? -5 Let r(i) = 11i - 195. Determine r(17). -8 Let a(z) = -63z2 + 666z + 303. Give a(11). 6 Let z(o) = o*3 - 36o*2 - 54o - 172. What is z(38)? 664 Let z(p) = 18p3 + 109p*2 - 9p - 90. Calculate z(-6). 0 Let p(k) = -20k + 146. Calculate p(8). -14 Let u(p) = 23p*2 + 1057p - 34. Calculate u(-46). 12 Let k(w) = -371w + 1314. Give k(3). 201 Let w(h) = h3 - h2 + 2h. Give w(-3). -42 Let f(i) = i*3 - 70i*2 + 64i + 540. Calculate f(69). 195 Let r(i) = i*3 - 22i*2 - 24. What is r(22)? -24 Let q(j) = -136j + 54. Calculate q(1). -82 Let c(m) = -2m3 - 56m*2 + 58m - 12. Calculate c(-29). -12 Let i(t) = 2t2 + 38t - 328. Calculate i(-28). 176 Let v(t) = -t*2 - 105t - 168. What is v(-103)? 38 Let z(n) = n*2 - 38n + 293. Give z(17). -64 Let j(g) = 4g - 22. Give j(41). 142 Let y(z) = -z3 - 6z*2 + 56z + 258. What is y(-4)? 2 Let i(y) = 5y2 - 124y - 429. Determine i(-3). -12 Let t(j) = -j*3 + 37j*2 - 106j + 117. What is t(34)? -19 Let i(h) = -672h - 28893. Calculate i(-43). 3 Let q(h) = -859h - 139162. Calculate q(-162). -4 Let l(b) = -5b2 - 1045b + 22912. Calculate l(20). 12 Let f(n) = 2n3 + 139n*2 - 280n + 3. Determine f(2). 15 Let d(c) = -2c3 - 164c*2 - 163c + 6. Calculate d(-81). 87 Let u(a) = 292a - 6719. Calculate u(23). -3 Let a(m) = -2492m + 14958. Calculate a(6). 6 Let d(z) = 103z + 1098. Give d(-11). -35 Let q(v) = -5v*2 - 39v - 108. Calculate q(-6). -54 Let j(t) = -t3 - t2 + 19. Determine j(0). 19 Let b(y) = 2y3 - 12y*2 - 103y + 4. Determine b(-5). -31 Let t(p) = 8p2 - 40p - 8. Calculate t(6). 40 Let y(j) = -j*2 - 134j - 389. Determine y(-131). 4 Let f(j) = j*3 + 16j*2 + 37j - 23. Give f(-13). 3 Let s(w) = 343w + 33261. What is s(-97)? -10 Let z(o) = o3 - 156o*2 + 138o + 2619. Calculate z(155). -16 Let s(d) = -286d + 915. What is s(3)? 57 Let q(y) = 48y - 603. Determine q(13). 21 Let h(k) = -94k - 884. Calculate h(-8). -132 Let r(c) = -2c*3 - 148c*2 - 142c + 297. Determine r(-73). 5 Let t(i) = -10278i - 30829. Determine t(-3). 5 Let a(j) = j3 + 3j*2 - 22j - 49. What is a(-7)? -91 Let p(q) = -3q2 - 41q - 1. Calculate p(-11). 87 Let u(f) = -2f - 48. Determine u(50). -148 Let k(g) = g2 + 3g - 306. Calculate k(-19). -2 Let o(r) = r*3 + 50r*2 - 63r - 619. Determine o(-51). -7 Let m(c) = 3c2 - 11c - 146. Determine m(10). 44 Let j(o) = -78o - 794. Give j(-10). -14 Let v(h) = 2h*3 - 52h*2 + 316h - 6. Give v(9). 84 Let o(y) = -y*3 + 9y*2 - 163y + 1242. Determine o(8). 2 Let v(y) = -3y2 + 120y - 348. Calculate v(41). -471 Let k(p) = -118p - 795. Determine k(-7). 31 Let u(g) = g2 + g - 15. Determine u(-4). -3 Let u(w) = -w3 - 69w*2 + 73w + 468. Determine u(-70). 258 Let x(m) = -m*3 - 92m*2 - 1220m - 291. Give x(-76). 13 Let i(b) = 6b3 - b2 + 4280b + 4282. What is i(-1)? -5 Let l(r) = r*3 + 74r*2 + 134r - 281. Give l(-72). 439 Let l(a) = -17a + 506. Give l(39). -157 Let f(c) = -c3 - 236c*2 - 3917c + 1525. Give f(-218). -1 Let z(f) = -1373f + 9606. What is z(7)? -5 Let l(t) = t3 - 11t*2 + 13t + 2. Give l(10). 32 Let o(m) = -2m3 - 56m*2 - 145m + 86. Determine o(-25). -39 Let h(l) = -l*3 - 18l*2 - 40l - 1120. What is h(-19)? 1 Let q(t) = 248t + 501. Determine q(-2). 5 Let p(c) = 143c + 3450. Calculate p(-24). 18 Let d(s) = -s*3 - 2s*2 - 4s + 23. Calculate d(0). 23 Let v(i) = 2i3 - 118i*2 - i - 31. Calculate v(59). -90 Let r(z) = 4z - 111. Calculate r(13). -59 Le	{ "pile_set_name": "DM Mathematics" }
the third derivative of 65/2d3 - 7/6d*6 + 0d*5 + 171d*2 + 0 + 0d + 0d4. Find the first derivative of q(u) wrt u. -420u*2 Let g = 123 + -136. Let h = 229 + g. Differentiate 174x - 12 - hx + 51 with respect to x. -42 Let w(o) = 4. Let f(g) = -25. Let i(j) = f(j) + 6w(j). Let a(d) = -8d2 - 67d + 4. Let u(n) = -a(n) - 4i(n). Find the second derivative of u(z) wrt z. 16 Let x be (-66)/18 + 3 - (-411)/9. Suppose 5u - x = -5q, -3u + 3q + 3 = -0. Find the third derivative of 18h*u - 15h*2 + 2h*2 - 50h*5 wrt h. -1920h*2 Let y = 12 + -12. Suppose 4n - 6 + 2 = y. What is the derivative of 10 - 12b3 - 3 + 0b*3 + n wrt b? -36b*2 Let g(w) = -3129w*3 - 7w*2 + 1530w + 5. Let t(h) = -3126h3 - 5h*2 + 1529h + 4. Let r(x) = -2g(x) + 3t(x). Find the third derivative of r(a) wrt a. -18720 What is the first derivative of 165s + 499 - 265s + 256 + 209s + 387s wrt s? 496 Let q(y) be the third derivative of -239y4/24 - 82y3/3 - y2 - 140. What is the derivative of q(t) wrt t? -239 Let c(p) be the third derivative of 0p4 + 0p - 300p2 + 0 - 77/6p*3 - 11/30p*7 - 1/40p*6 + 0p*5. What is the first derivative of c(n) wrt n? -308n*3 - 9n*2 What is the third derivative of 78204z*2 + 19z - 20z - 80706z*2 - 5850z*3 wrt z? -35100 Let a = -3 - -5. Suppose -14q + 26754 = -q. Find the third derivative of 2058j - qj - 27ja - 13j*4 wrt j. -312j Find the first derivative of -726 + 2o + 2951o*3 - 418 - 2382o*3 wrt o. 1707o*2 + 2 Let s(t) be the third derivative of -953t*4/8 - 2225t*3/6 - 502t*2. Find the first derivative of s(z) wrt z. -2859 Let i(f) be the third derivative of 503f*8/112 + 208f*4/3 - 301f*2. Find the second derivative of i(w) wrt w. 30180w*3 What is the second derivative of -4101k - 30531k2 - 19k*3 + 61013k*2 - 30545k*2 wrt k? -114k - 126 Let c(b) = -b + 12. Let a be c(10). Suppose -2q = 2l - 4, -al + 12 = 5q - 1. Find the second derivative of 14g - q - 2 + 5 + 13g*3 wrt g. 78g Let x(g) be the second derivative of 0 + 204g + 0g*6 + 0g*3 + 1/12g*4 + 0g*5 - 1/2g*8 + 0g*2 + 0g*7. Find the third derivative of x(y) wrt y. -3360y*3 Let l be (4/5)/(414/1035). Let g(h) be the first derivative of -7h*3 + 0h + 9 + 0h4 - 3/5h*5 + 0h*l. Find the third derivative of g(r) wrt r. -72r Suppose s = -x + 2s, 0 = -3s + 6. What is the second derivative of -24604c3 + x - 92c - 2 + 24455c3 + 2c*4 wrt c? 24c*2 - 894c Let u(h) be the third derivative of -311h7/15 - 734h*4/3 + 427h*2. What is the second derivative of u(t) wrt t? -52248t*2 Let j(o) = 93o*2 - 3o - 3. Let n be j(-1). Find the first derivative of -ns + 255 - 156 - 170 wrt s. -93 Let t(c) be the second derivative of 7/4c*4 + 9/10c*6 - 1/2c*2 + 2c + 0c5 + 0c*3 - 18. Find the third derivative of t(i) wrt i. 648i Let h(i) be the first derivative of -i*7/70 - 3i*6/40 + 5i*3 - 13i*2/2 - i - 51. Let n(y) be the second derivative of h(y). Differentiate n(m) wrt m. -12m*3 - 27m*2 Let n(p) be the first derivative of 9p*5/5 + 3p*4/4 - 814p*3/3 - 25. Find the third derivative of n(g) wrt g. 216g + 18 Suppose -3j + 2b + 133 = 0, 4b + 102 = j + j. Let f = -23 + j. Differentiate -10w + fw3 + 4w + 6w + 41 with respect to w. 54w*2 Suppose 8t = 5t - 9. Let p be t/3 + -2 + (1380 - 1). Differentiate pu + 19u3 - 2 - 1376u with respect to u. 57u2 Find the third derivative of 279h*2 + 26h - 1319h4 + 1902h*4 - 26h - 57h2 wrt h. 13992h Let g(p) = -17p3 - 13p. Let i = -39 + 43. Let v(n) = n*3 + 3n - in + 3n - 3n. Let u(h) = g(h) + 4v(h). What is the second derivative of u(m) wrt m? -78m Let x(p) = 42p. Let i be (2/2)/(0 - -1). Let g be x(i). What is the second derivative of 4a4 - 12a + a + ga wrt a? 48a*2 What is the second derivative of 7 - 42f + 95f2 - 12 + 148f + 178f wrt f? 190 Let h(k) be the second derivative of -3k*4 + 7k*3/6 + 34k*2 - 40k - 4. Let d(b) be the first derivative of h(b). Find the first derivative of d(j) wrt j. -72 Let z(p) = -p + 19. Let g be z(16). What is the derivative of -16r3 + 161 - 11r*g + 3r*2 - 108 wrt r? -81r*2 + 6r Let h(m) be the first derivative of -m*6/6 - 693m4/4 + m3/3 - 2247m2/2 - 3422. Find the third derivative of h(j) wrt j. -60j*2 - 4158 Let n(h) = -15h + 62. Let t be n(4). Find the third derivative of 576x2 + 3x*5 - 664x*t - 4x*5 + 27x*6 wrt x. 3240x*3 - 60x*2 Let u(o) = -284o - 1157. Let p(k) = 2k + 4. Let l(j) = 6p(j) + u(j). Differentiate l(n) with respect to n. -272 Let j(g) be the second derivative of 1283g6/30 + 2859g*2/2 - g - 42. What is the derivative of j(o) wrt o? 5132o*3 Let c be 6(26/(-4))/(-13). Let a(b) be the second derivative of 0bc + 39b + 15b2 - 29/12b*4 + 0. Differentiate a(y) with respect to y. -58y Let k(n) = -23n2 - n + 45. Let f(i) = -18 - 133i*2 - 98i*2 + 209i*2 + 62. Let s(l) = 3f(l) - 2k(l). Find the second derivative of s(c) wrt c. -40 Let y(c) be the second derivative of -679c5/20 + c4/6 + 503c3/6 + 2c + 1000. Find the third derivative of y(w) wrt w. -4074 Let w(t) be the first derivative of -t*6/3 + 11t*5/5 - 9t*4/2 + 39t*3 - 7t*2/2 - 12226. Find the third derivative of w(a) wrt a. -120a*2 + 264a - 108 Let u be 2-2(13 + (-324)/24). Find the third derivative of -131i3 + 88i - 4iu - 38i*2 - 88i wrt i. -786 Let w(z) be the third derivative of -11z7/840 + 49z4/24 - z3/6 + 10z2 - 2. Let u(n) be the first derivative of w(n). Differentiate u(l) wrt l. -33l*2 Let d(c) be the second derivative of 1597c*5/10 - 4655c*2/2 - 5077c. Differentiate d(t) wrt t. 9582t2 Let q(z) be the third derivative of 905z*9/168 + 7z5/20 + z4/24 + 15z2 + 70z. Find the third derivative of q(f) wrt f. 325800f3 Suppose 12m = 20m - 32. Find the third derivative of 113l*m + l - 60l4 - l3 - 5l2 - 40l*4 + 3l*3 wrt l. 312l + 12 Let a(j) be the third derivative of -181j9/504 - j8/56 - 277j*5/30 - 4j*2 + 395j. What is the third derivative of a(n) wrt n? -21720n3 - 360n*2 Let y(d) be the third derivative of 529d*8/336 - 1023d*4/8 - 307d*2. Find the second derivative of y(c) wrt c. 10580c*3 Suppose 0 = -5w + 18 + 72. Suppose -w = -10r + r. What is the second derivative of -l2 + 144l - 3lr - 114l wrt l? -8 Let h be (-10)/6(0/(-4) + 3). Let s be (-399)/(-12) + h + 1/(-4). Find the second derivative of 2c - 42c5 - sc*2 + 25c + 28c2 wrt c. -840c*3 Find the third derivative of 5339s*5 - 4649s*2 + 1263s*2 + 699291 - 699291 wrt s. 320340s*2 Find the first derivative of -16957t + 8528t - 9t*3 + 834 + 8466t wrt t. -27t2 + 37 Let q(a) be the second derivative of 0a*3 + 0a*2 - 49/4a*4 - 7a - 13/20a5 + 5. Find the third derivative of q(v) wrt v. -78 Let o be (-46(-8)/32)/(2/380). What is the third derivative of oi4 - 191i*2 - 4369i*4 - 166i*5 + 2184i*4 wrt i? -9960i*2 Let q(u) be the first derivative of -23u + 27/7u7 + 0u*2 - 50 + 0u*6 + 0u*4 + 0u*5 - 1/3u*3. Find the third derivative of q(v) wrt v. 3240v*3 Let v = 42 + -39. Suppose 2f = -s - 4, -vs = -0f + 4f + 12. What is the first derivative of -7h*3 - 24 + 14h*3 + fh*3 - 4h*3 wrt h? 9h*2 Let g(h) = -5h*2 + 52h - 17. Let q be g(10). What is the first derivative of -20w - 10w - 6wq + 57 + 12w wrt w? -18w2 - 18 Let w = 11 + 1. Suppose 0 = f - 2t - w, -t + 4 = -2t. What is the third derivative of 31i*3 + fi*2 + 18i*2 + 5i*2 wrt i? 186 Let s(n) = 41n*3 - 2n*2 + 10n - 9. Let p be s(1). Find the third derivative of -py3 + 57y*2 - 12y*2 - 105y*2 + 3y*4 wrt y. 72y - 240 Let x(a) = -a*2 + 8a - 18. Let p(u) = -1. Let b(c) = 5p(c) - x(c). Let y be b(8). What is the derivative of yh*2 - 15 - 11 + 16 wrt h? 26h Suppose -i = 2i + i. Suppose 10b - 3o = 9b + 10, i = b - 4o - 7. Find the second derivative of -12f*3 - 8f3 + f3 + bf wrt f. -114f Let x = -101 + 104. What is the second derivative of -19l + xl*5 - 4l - 49l + 7l*5 wrt l? 200l**3 Let c(m) be the second derivative of	{ "pile_set_name": "DM Mathematics" }
hat is n(k(m))? -3219741m4 - 20139m*2 Let h(q) = -1673q*2. Let v(p) = 2959p. Give h(v(m)). -14648254313m2 Let p(i) = 2i. Let y be (-2)/4 - (1 - (-715)/(-2)). Let r(q) = -177 - 179 + y - 20q. Calculate r(p(d)). -40d Let k(h) = -14h. Let t(s) = 9s - 4. Let d(g) = -20g. Let c(r) = 2r + 1. Let l(y) = 5c(y) + d(y). Let p(f) = -4l(f) - 5t(f). Calculate p(k(u)). 70u Let c(f) = 1244f - 4f*2 + 1246f - 2490f. Let b(g) be the second derivative of -3g*3/2 + 5g. Give c(b(m)). -324m2 Let u(d) = -11d. Suppose -2i = -h - 3, -3i - i + 5 = -3h. Let w(j) = 60j*i + 55j*2 - 132j*2. Give w(u(o)). -2057o*2 Let r be (247/(-104) - (-3)/8) + 3. Let f(x) = -66x*2 - 99x. Let c(s) = -s*2 - 3s. Let v(l) = rf(l) - 33c(l). Let q(g) = -2g2. Give q(v(o)). -2178o4 Let q(z) = -z2. Let m(o) = -13o2 - 283o + 100. Let j(u) = 4u2 + 94u - 30. Let h(a) = -10j(a) - 3m(a). Give h(q(y)). -y*4 + 91y*2 Let k(z) be the third derivative of -22z*2 + 0 + 0z - 5/3z3 - 1/12z*4. Let h(r) = 4r. Let w(u) = -5u. Let q(o) = 6h(o) + 5w(o). What is q(k(a))? 2a + 10 Let l(i) = 34390580i2 - 2. Let n(d) = 2d. Give n(l(p)). 68781160p2 - 4 Let j(h) = -2386h. Let s(u) = 837u2. What is s(j(p))? 4765037652p*2 Let i(t) = 2048t. Let g(x) = -22x - 967. Give g(i(o)). -45056o - 967 Let v(w) = -2w. Let p be (16/(-40))/((-5)/25). Let r(b) = -697b*2 + 9b + 27. Let o(y) = -174y2 + 2y + 6. Let g(n) = pr(n) - 9o(n). Give v(g(d)). -344d2 Let f(w) = -3w*2. Let d(m) be the first derivative of -5/3m*3 + 154 + 0m + 0m2. Calculate d(f(g)). -45g*4 Let q(i) = -2i - 9. Let f(a) = 2a + 12. Let x(p) = 3f(p) + 4q(p). Let j(l) be the first derivative of l2/2 + 55l + 416. Give j(x(s)). -2s + 55 Let q(b) = 2b*2. Let f(o) = -4o*2 - 18o*2 + 3o2. Let n(z) be the first derivative of -z3/3 + 622. Let k(r) = 2f(r) - 14n(r). Calculate k(q(a)). -96a4 Let u(b) be the second derivative of b3/3 - 1926b. Let a(j) = -293j. Give a(u(h)). -586h Let i(q) be the first derivative of -q*2 - 7. Suppose 13x = 6x + 14. Let g(w) = 7w*2 - 2w*2 + 4 + 2w*2 - 6w*x. Calculate i(g(c)). -2c*2 - 8 Let n(k) = -62k + 9. Let g(l) = 30l - 4. Let j(v) = 9g(v) + 4n(v). Let t(u) be the third derivative of -u5/60 - 5u*2. Give j(t(c)). -22c*2 Let u(d) = 5d. Let g(p) be the first derivative of 125 + 6539p - 4p*3 - 6539p. Calculate u(g(n)). -60n2 Let o(f) = f2. Let q(h) be the third derivative of 0h + 0h3 + 75h*2 + 0 - 1/4h*4. Determine o(q(n)). 36n*2 Let y(f) = -3f. Let o = 134 + -118. Let v(c) = oc + 23c - 3c - 5c. Give y(v(x)). -93x Let g(m) = -8m*2. Let j(y) = 34738476y. Calculate j(g(n)). -277907808n2 Suppose -3r + 65 = 2r. Let k(s) = 15 - 15 - rs2. Let c(i) be the first derivative of i2/2 - 76. What is k(c(x))? -13x2 Let d be ((179 + -1)/2)/(27/81). Let o(l) = 132l - dl + 136l. Let k(t) = 2t2. What is k(o(q))? 2q*2 Let t(p) = -265748p - 8. Let x(o) = -o. Calculate t(x(k)). 265748k - 8 Let y(u) = u. Let z(x) = x - 7. Let h(q) = -21q + 37. Let j(s) = 5h(s) + 20z(s). Let o(f) = 2f - 4 + 2 + 1. Let r(v) = -2j(v) - 90o(v). Calculate y(r(b)). -10b Let b(p) = 3p. Let u(y) = -2110y*2 - 15y - 475. Give b(u(i)). -6330i2 - 45i - 1425 Let p(a) = 20a2. Suppose -17b + 4 = -16b. Let z be (-2788)/(-238) + b/14. Let n(d) = -zd - 9d + 24d. Determine n(p(f)). 60f2 Suppose 18 = 3b + 3a, -b + 6 = -0a - 3a. Let v be 33((-4)/(-3) - 4/b). Let m(y) = -3y + v - 22. Let c(z) = 2z*2. What is m(c(l))? -6l*2 Let c(j) = 77j + 49. Let o(m) = -6745m. Determine c(o(x)). -519365x + 49 Let m(k) = -31k2 - 2k + 2k - 53 + 53. Let q(c) = -11c*2 - 5. Let r(s) = -16s*2 - 8. Let v(h) = -8q(h) + 5r(h). Give v(m(d)). 7688d*4 Let w(x) = -38x - 109154 + 109233 + 41x. Let h(n) = -8n*2. What is w(h(t))? -24t*2 + 79 Let r(w) = 465458084w2. Let u(z) = z2. What is r(u(o))? 465458084o4 Suppose 11i - 18 = 5i. Let x(m) = -423 + im + 423. Let y(k) be the first derivative of -7k2/2 - 4. Calculate y(x(p)). -21p Let y(v) = 45v. Suppose 12o + 155 = 7o. Let q = o - -33. Let n(f) = 3f*2 - 3f - 4fq + 3f. Determine y(n(r)). -45r2 Let j(t) = 5t*2. Let d(m) be the second derivative of -62m*3 + 9m + 3. Determine j(d(g)). 691920g2 Let d(a) = 2a. Let n(c) = -c*2 - 266c - 46c + 37c + 21c. What is d(n(x))? -2x*2 - 508x Let w(v) = 20v2. Let f(u) = 23235236u. Give f(w(q)). 464704720q2 Let m(t) = 7t*2 + 5t - 6. Let v(r) = 2r + 540. What is m(v(a))? 28a*2 + 15130a + 2043894 Let n(i) = 6i2 + 3i. Suppose -18j + 15 = -39. Let x(f) = -5f*2 - 2f. Let b(p) = jx(p) + 2n(p). Let m(k) = 11k. Give b(m(h)). -363h*2 Let h(k) = -1067962k. Let b(t) = -16t. Calculate h(b(m)). 17087392m Let w(u) = 9u. Let v(o) be the third derivative of o8/3360 + 2o5/15 + o4/6 - 2o2 + 8. Let c(a) be the third derivative of v(a). What is w(c(y))? 54y*2 Let t(f) = -11f*2 - 33031066. Let b(k) = -k. What is t(b(z))? -11z*2 - 33031066 Let i(o) = 5o*2 + 14o. Let u(n) = 33n - 15. Let j(r) = 6r - 3. Let s(a) = 15j(a) - 3u(a). Calculate i(s(m)). 405m2 - 126m Let o(d) = 32562d2 + d - 15. Let s(r) = -17r*2. What is o(s(m))? 9410418m*4 - 17m*2 - 15 Let k(s) = 3s. Let y = -569 - -578. Let d(b) = 39b + 0 + 0 + yb - 3b. What is d(k(c))? 135c Let j(d) = d2 - d + 2125314. Let x(l) = -l. What is j(x(r))? r2 + r + 2125314 Let d(q) = -q*2. Let k(c) = -21c*2 - 32c - 320. Let y(r) = 13r2 + 20r + 213. Let m(t) = 5k(t) + 8y(t). Calculate m(d(h)). -h*4 + 104 Let m(v) = 40v - 66. Let x(w) = -21w + 36. Let d(o) = -6m(o) - 11x(o). Let r(l) = 295l. Calculate r(d(k)). -2655k Let a(s) = 278s. Let b(j) = 2j - 1415. Determine a(b(m)). 556m - 393370 Let d(g) be the first derivative of g*3/3 + 312. Let k(i) = -3822i*2. Determine d(k(m)). 14607684m*4 Let g(o) = -9 - 4 - 1 + 14 - 106o*2 + 75o*2. Let f(s) = -4s + s - 4s. Calculate g(f(l)). -1519l*2 Let m(c) = -44964c. Let t(g) = 9g2 + 7g. Give t(m(s)). 18195851664s2 - 314748s Let p(g) = -5g2. Let a(i) = 1270i*2 - 50i - 2. Determine a(p(b)). 31750b4 + 250b2 - 2 Let y(n) = -n3 - 18n2 - 15n + 34. Let r be y(-17). Let w = -8 - -13. Let g(z) = r + 2z + wz + 0. Let f(q) = q*2. What is g(f(t))? 7t*2 Let w(t) = -t. Let i(y) = -842414y. Give i(w(b)). 842414b Let k(w) = 4w*2. Let z = 4606 - 1872. Let n(y) = 27y - z + 2734. Determine n(k(h)). 108h2 Let h(c) = -152c. Let l(i) be the second derivative of 2i3/3 - 9i + 15. Give h(l(n)). -608n Let d(z) = 4z. Let a(y) = -93y2 + 27224. Determine a(d(u)). -1488u*2 + 27224 Let u(x) = 19x*2. Let w be (-4)/14 - (-4 - (-375)/35). Let b(j) = -j - 6. Let l(q) = -2q - 14. Let t(f) = wb(f) + 3l(f). What is u(t(z))? 19z2 Let y(k) = 99k*2. Let m(b) = -324b*2 - 3b + 18. Give m(y(i)). -3175524i4 - 297i*2 + 18 Suppose 0 = -100r + 14 + 186. Let l(o) = -4o. Let q be l(-3). Let b(w) = 6w*2 - qw*2 + 5w*r. Let x(f) = 3f*2. What is x(b(d))? 3d*4 Let g(q) be the third derivative of -29q5/5 + q3/3 + 195q2 + 2. Let h(t) = 3t*2. Calculate g(h(m)). -3132m4 + 2 Let g(k) be the second derivative of -k4/4 - 2k3/3 + 13k. Let n(z) = 6 + 373z - 374z - 6. Calculate n(g(p)). 3p2 + 4p Let z(v) = v*2 + 6v - 3. Let j(x) = 4x2 + 16x - 8. Suppose -10l + 17 = -63. Let u(o) = lz(o) - 3j(o). Let i(b) = 3b. Determine u(i(r)). -36r2 Let r(d) be the third derivative of -8d*5/15 + 4d*2 - 2d. Let x(m) be the third derivative of -m4/24 + m2. What is x(r(h))? 32h2 Let k(u) be the first derivative of 0u + 0u2 - 10/3u*3 - 11. Let x(n) = 2n*2 - 2n. Let p(a) = a*2 + a. Let r(i) = -2p(i) - x(i). Give k(r(j)). -160j4 Let o(g) = -71 + 14g2 + 71. Let r = -24 - -26. Let q(k) = k2 + 2k2 - k2 + kr. Give q(o(i)). 588i*4 Let y(o) = 20o - 6779. Let x(k) = -26k. Give x(y(v)). -520v + 176254 Let z(a) = -370a. Let m(i) = 10503i. Give m(z(w)). -3886110w Let q(x) = -11953x - 6. Let w(u) = 42u. Give w(q(b)). -502026b - 252 Let n(f) = -21f2 + f. Let y(a) = 11a. Suppose -22*w + 113 = -349. Let	{ "pile_set_name": "DM Mathematics" }
*w + 4u*3 with respect to u. 3u*2 Suppose x = -2 - 8. Let y be (14/35)/((-1)/x). Find the third derivative of 3v*2 + 4 - 2v3 - y - v3 wrt v. -18 Let q(o) be the second derivative of -o8/560 - o5/40 + o*3/3 + o. Let b(c) be the second derivative of q(c). What is the second derivative of b(y) wrt y? -36y*2 Let a(u) = -2u2 + 2. Let r be a(2). Let q = r - -10. Find the third derivative of -2 + 1 - v2 - v*q + 1 wrt v. -24v Let x be -5((-15)/3 + 0). Suppose 5 = p + 4g, -2g = -5p - 6g + x. Find the second derivative of 4j*p - 3j*5 + 2j + 2j5 + j wrt j. 60j*3 Let g = -23/3 + 8. Let a(l) be the third derivative of -3l*2 + 0l*6 - gl*3 + 0 - 1/210l*7 + 0l + 0l4 + 0l*5. Differentiate a(b) wrt b. -4b*3 Let w(f) = f - 4. Let a be w(4). Let r be a + 2 - 4/(-2). What is the first derivative of 3q2 + 2 - q2 - 2q2 + 4q*r wrt q? 16q*3 Let j(v) be the second derivative of 7/6v*3 + 2v + 0v4 + 0 + 0v*2 - 9/20v*5. Find the second derivative of j(t) wrt t. -54t Let o(m) = -25m2 + 12m + 13. Let u(x) = 12x2 - 6x - 6. Let n(k) = -6o(k) - 13u(k). What is the second derivative of n(f) wrt f? -12 Let z be (8/(-10))/((-8)/20). What is the third derivative of -2gz + 7g3 - g3 + g*3 wrt g? 42 Let z(h) be the third derivative of -5h*8/336 + 17h*5/60 - 12h*2. What is the third derivative of z(y) wrt y? -300y2 Let w be 2/(-6) - (-154)/21. Let y = 8 - w. What is the first derivative of -h + y - 2 + 0 wrt h? -1 Let t(l) = l4 + l3 - l2 + l. Let f(v) = 14v4 + 6v*3 - 6v*2 - v. Let i(y) = f(y) - 6t(y). What is the second derivative of i(o) wrt o? 96o2 Let l(x) = 9x*4 + 4x*3 + 16x - 4. Let j(g) = -8g4 - 5g*3 - 16g + 5. Let v(p) = -4j(p) - 5l(p). Find the second derivative of v(i) wrt i. -156i2 Let g be 8/843 - 2/7. Let n(w) = w*3 + 5w*2 + w + 7. Let j be n(-5). What is the first derivative of j + s + 2s*3 - s + g wrt s? 6s2 Let p(z) be the third derivative of z9/42 + 7z5/30 - 7z*2. What is the third derivative of p(b) wrt b? 1440b3 Let o(f) be the third derivative of f8/336 - f7/70 + f5/20 + f*4/12 + 56f*2. What is the third derivative of o(t) wrt t? 60t*2 - 72t Let m(t) = -t*3 - 1. Let d be m(-1). Differentiate 0c + 0c - 3 + dc*2 + 2c*2 wrt c. 4c What is the second derivative of 48o2 - 111o*2 + 23o + 45o2 wrt o? -36 Suppose 13 = 4g - 3. Let i(m) = -7 - m*2 + 7m + 2 - 4m. Let p(x) = -x2 + 4x - 6. Let o(u) = gi(u) - 3p(u). Differentiate o(d) with respect to d. -2d Let d(t) = 61t*4 - 5t*3 - 5t*2 - 59. Let y(j) = -31j*4 + 3j*3 + 3j*2 + 30. Let b(w) = -3d(w) - 5y(w). Find the first derivative of b(o) wrt o. -112o*3 Suppose 12 - 4 = 4r + 5c, r - 2 = 3c. Let z(y) be the first derivative of -y*2 + 0y - 1/2y4 + 0y*3 + r. Find the second derivative of z(w) wrt w. -12w Let d(s) be the first derivative of 0s - 2/3s*3 + 0s*4 + 0s*6 - 3 + 0s*2 - 1/7s*7 + 0s*5. Find the third derivative of d(x) wrt x. -120x*3 Suppose -4 = -2f + f. Suppose 5n - 4d = -1, 2d - 5d = 5n - 27. Find the second derivative of fg*3 + ng - g*3 - 3g*3 + 2g*5 wrt g. 40g*3 Let u be (-2)/7 + 8/28. Suppose 2d + 2d - 56 = u. What is the derivative of 2 - 14g + 2g3 + dg wrt g? 6g2 What is the first derivative of -6r*2 - 1 + 5r*2 - 12r*2 + 10 wrt r? -26r Differentiate -2o2 - 4 - 4o*2 + 3 + 6 wrt o. -12o Let g(u) = 2u3 - 4u + 7u3 + 3 - 3u*3. Let k(w) = 7w*3 - 5w + 4. Let s(d) = -4g(d) + 3k(d). What is the second derivative of s(c) wrt c? -18c Let z = 82 - 79. Let r(a) be the first derivative of 0a + 0a3 + 2/5a5 + a2 - z + 0a4. Find the second derivative of r(w) wrt w. 24w2 Let g be 2/4 + 27/6. Let n(t) = -t3 + 6t2 - 4t. Let a be n(g). Find the second derivative of 5h - ha - 8h + 4h wrt h. -20h3 Differentiate -6 + 0 + g3 - 19g3 with respect to g. -54g*2 Let s(f) be the first derivative of -9f*2/2 + 10f - 8. Find the first derivative of s(o) wrt o. -9 Let r(u) = -u*2 - 3u + 3. Let t be r(-3). What is the third derivative of w*2 + 3w - 2w2 - tw + 2w4 wrt w? 48w Suppose 2p + 4b + 8 = 0, -8 = -p - 2p - b. What is the third derivative of -9 + 3 + 6 - 5v*p - 5v*2 wrt v? -120v Find the second derivative of 241x3 - 249x*3 - 3x - x wrt x. -48x What is the third derivative of -23i*2 - 1787i*4 + 14i*6 + 1787i*4 wrt i? 1680i*3 Let z(j) be the second derivative of -5j*7/21 + 5j*3/3 - 8j. What is the second derivative of z(f) wrt f? -200f3 Let s(o) = o3 - 6o*2 + 6o - 1. Let q be s(5). Find the second derivative of -4v + 0v*q + 3v - 2v4 wrt v. -24v*2 Let o(v) = -v - 1. Let m(x) = 5x + 4. Let w(t) = m(t) - 5o(t). What is the derivative of w(s) wrt s? 10 Let n = -1 - -2. Suppose 4 = m + n. What is the third derivative of -2g*6 + 7g*6 + 2g*2 - mg*2 - 3g*6 wrt g? 240g*3 Let s be (-3)/2 + 7/2. Find the third derivative of 0k*2 - 3k*3 - 5k*3 + 5k*3 + 2k*s wrt k. -18 Suppose 0 = -2m - 2m - 4. Let w = m + 4. What is the derivative of 2 + wy4 - y4 - 3y4 wrt y? -4y*3 Let s be -9 - -7 - -25. Find the second derivative of 18p - 27p - p*5 + sp*5 wrt p. 140p*3 Let r = -32 + 97/3. Let h(q) be the first derivative of 0q + 2 + q*2 - rq*3. Find the second derivative of h(k) wrt k. -2 What is the third derivative of -25q*2 - 22q*6 - 19q*2 + 36q*2 + 62q*6 wrt q? 4800q*3 Find the second derivative of 2i*2 - 5i + i*2 - 3i*2 - 7i*4 wrt i. -84i2 Let y(p) be the first derivative of p9/1512 + p6/180 + p3 - 2. Let s(f) be the third derivative of y(f). Find the third derivative of s(n) wrt n. 120n2 Let z(i) be the first derivative of 11i*6/6 + 2i*3 + 7. Find the third derivative of z(t) wrt t. 660t*2 Suppose 7 + 3 = 5f. Suppose 0 = -fl + 8, -5q - 1 + 17 = -l. What is the third derivative of -3j4 + j2 + j2 + jq wrt j? -48j Let o(x) = x - 1. Let c(m) = 12m2 - 20m + 4. Let h(k) = c(k) + 4o(k). What is the second derivative of h(u) wrt u? 24 Let x = 14 - 11. Let m(f) be the second derivative of 0f*4 + 0 + 0f*x - 1/10f5 + f2 - 3f. Find the first derivative of m(n) wrt n. -6n*2 Let k(n) be the first derivative of -n + 0n*4 + 0n*2 + 6 + 0n*3 + 9/5n*5. Find the first derivative of k(s) wrt s. 36s*3 Let d(t) be the second derivative of -3t + 0t3 + 0 + 7/30t*6 - 7/2t*2 + 0t*4 + 0t*5. What is the first derivative of d(v) wrt v? 28v*3 Let c be (-1 - -28)10/15. What is the third derivative of 8g2 + 3g*5 + cg*6 - 3g*5 - 23g*6 wrt g? -600g*3 Let w = -149/42 - -26/7. Let o(f) be the second derivative of 0 + 0f*3 + wf*4 - 2f + f*2. Find the first derivative of o(b) wrt b. 4b Let u(w) be the second derivative of w8/1680 + w6/360 + w*3/2 - 2w. Let g(m) be the second derivative of u(m). What is the third derivative of g(s) wrt s? 24s Let m(q) = -q2 - 10q + 14. Let r be m(-11). What is the second derivative of 4xr + x3 - x - x3 + 2x wrt x? 24x Suppose 0 = -i + 4 + 2. Find the second derivative of -8b - ib2 + 89 - 89 wrt b. -12 Let b(y) be the first derivative of y5 - 7y + 5. What is the first derivative of b(v) wrt v? 20v3 Find the third derivative of 9s*2 + 0s4 - s4 + 6s4 + 0s*4 wrt s. 120s Let g(j) = -3j - 3 + j + 6j - 2j. Let r(a) = -a. Let y(k) = -g(k) + 2r(k). Differentiate y(w) wrt w. -4 Let u(t) be the first derivative of -t7/280 + t6/120 - t*3 - 3. Let d(x) be the third derivative of u(x). Find the third derivative of d(n) wrt n. -18 Let w be 8/6(-3)/(-2). Let s = -7 + 9. What is the derivative of 4y2 - 3y*2 + w - 4y*s + 6y*2 wrt y? 6y Let c(x) = 17x + 16. Let l(k) = 18k + 17. Let s(h) = -2c(h) + 3l(h). Differentiate s(w) with respect to w. 20 Let j(u) = 134u4 - 11u*3 + 11u - 141. Let q(a) = -27a4 + 2a*3 - 2a + 28. Let c(i) = 2j(i) + 11q(i). What is the first derivative of c(f) wrt f? -116f3 Let t(v) = -57v*3 + 58v*2 - 11v - 11. Let c(u) = 28u3 - 29u*2 + 6u + 6. Let f(k) = -11c(k) - 6t(k). Find the third derivative of f(d) wrt d. 204 Let g(u) be the	{ "pile_set_name": "DM Mathematics" }
s x? -1, -1/5, 12 Factor -u*2/4 - 7u/2 - 49/4. -(u + 7)2/4 Factor p3 + 446p2 + 445p. p(p + 1)(p + 445) Determine k, given that -k*3/3 - 9k*2 + 52k - 128/3 = 0. -32, 1, 4 What is i in 34i5 + 132i*4 - 16i*3 - 544i*2 - 480i + 64 = 0? -2, 2/17, 2 Solve 2a2 - 6256a + 4892192 = 0. 1564 Factor 45n3 - 190n*2 + 220n - 40. 5(n - 2)2(9n - 2) Factor 4o*3/7 - 92o*2 + 26240o/7 - 25600/7. 4(o - 80)2(o - 1)/7 Suppose -l*3/3 + 404l*2/3 + l/3 - 404/3 = 0. Calculate l. -1, 1, 404 Let 15p*5 + 695p*4 - 1925p*3 + 1705p*2 - 490p = 0. Calculate p. -49, 0, 2/3, 1 Determine n so that -2n2/9 - 2566n/9 = 0. -1283, 0 Suppose 8o2/5 - 167o/5 - 21/5 = 0. Calculate o. -1/8, 21 What is q in 80q5 - 720q*4 - 805q*3 + 45q*2 + 50q = 0? -1, -1/4, 0, 1/4, 10 Find w, given that 2w4/11 - 6w*3 + 42w*2 - 734w/11 + 336/11 = 0. 1, 7, 24 Find u such that 5u3/6 - 25u*2/2 - 5u/6 + 25/2 = 0. -1, 1, 15 Factor -5x2 - 90x - 85. -5(x + 1)(x + 17) Factor -t*2/4 - 11t/2 + 23/4. -(t - 1)(t + 23)/4 Find i, given that 2401i*2 + 784i + 64 = 0. -8/49 Solve -2i2/5 + 6i = 0. 0, 15 Let -u*3/4 - 9u*2 - 60u + 400 = 0. Calculate u. -20, 4 Factor -q*3/4 - 5q*2 - 37q/4 - 9/2. -(q + 1)*2(q + 18)/4 What is x in x*4/2 - 9x*2 - 16x - 15/2 = 0? -3, -1, 5 Factor o*5/2 - 5o*4 + 39o*3/2 - 37o*2 + 34o - 12. (o - 3)(o - 2)3(o - 1)/2 Solve -2r2/3 - 5108r - 9784374 = 0. -3831 What is m in 3m5 + 129m*4 + 93m*3 - 1413m*2 - 1080m + 2268 = 0? -42, -3, -2, 1, 3 Factor -j*4 - 42j*3 - 35j*2 + 246j. -j(j - 2)(j + 3)(j + 41) Solve -9w*4 - 303w*3 - 474w*2 + 192w = 0. -32, -2, 0, 1/3 Factor -4q3 + 304q*2 - 1168q + 1152. -4(q - 72)(q - 2)*2 Factor -8q*4 - 452q*3 + 228q*2. -4q*2(q + 57)(2q - 1) Factor 2h2/15 + 8h/5 + 18/5. 2(h + 3)(h + 9)/15 Let 2x2/7 + 4x/7 - 30/7 = 0. Calculate x. -5, 3 Factor -f*2/2 - 3f/2. -f(f + 3)/2 Factor -10q*3 - 254q*2 - 340q - 96. -2(q + 1)(q + 24)(5q + 2) Solve 4x4 - 1280x*3 + 102396x*2 + 1280x - 102400 = 0. -1, 1, 160 Suppose a*4/3 + 7a*3 - 23a*2/3 - 7a + 22/3 = 0. Calculate a. -22, -1, 1 Suppose t*3/8 + 507t*2/4 + 85683t/2 + 4826809 = 0. Calculate t. -338 Suppose -h*5/2 + 17h*4/2 - 39h*3 + 70h*2 - 44h = 0. Calculate h. 0, 2, 11 Factor t*2/5 - 822t/5 + 168921/5. (t - 411)*2/5 Determine h so that 2h*5/7 - 104h*4/7 + 194h*3/7 + 316h*2/7 - 808h/7 + 400/7 = 0. -2, 1, 2, 50 Find n such that n*5/8 - 133n*4/8 + 869n*3/4 - 4365n*2/4 + 19413n/8 - 16065/8 = 0. 3, 5, 119 Determine x, given that 6x5 - 111x*4 + 45x*3 + 165x*2 - 51x - 54 = 0. -1, -1/2, 1, 18 Let -n*3/7 - 19n*2 - 1016n/7 - 2000/7 = 0. Calculate n. -125, -4 Find b such that 45b5/2 + 385b*4/4 - 45b*3 - 1735b*2/4 - 105b + 45 = 0. -3, -1/2, 2/9, 2 Determine c, given that -c*5/3 + 4c*4 - 20c*3/3 - 2c*2/3 + 7c - 10/3 = 0. -1, 1, 10 Factor -10i3/3 - 14i*2 + 40i/3. -2i(i + 5)(5i - 4)/3 Factor -x*2/4 + 51x/2 - 98. -(x - 98)(x - 4)/4 Factor p4/6 + 43p*3/3 - 451p*2/6 + 182p/3. p(p - 4)(p - 1)(p + 91)/6 Suppose -3n*3/4 + 27n*2/2 + 495n + 2850 = 0. What is n? -10, 38 Factor -4t2 - 320t - 3900. -4(t + 15)(t + 65) Find p, given that -6p3 + p2 + 6p - 1 = 0. -1, 1/6, 1 Factor -3o3 + 75o*2 - 558o + 1080. -3(o - 12)(o - 10)(o - 3) Factor -f4 - 25f*3 - 126f*2 - 236f - 152. -(f + 2)*3(f + 19) Factor -4x2/3 - 91x/6 - 11/2. -(x + 11)(8x + 3)/6 What is w in 2w3/7 - 18w*2/7 + 40w/7 - 24/7 = 0? 1, 2, 6 Let -2p2/5 + 24p - 360 = 0. Calculate p. 30 Determine y, given that -4y2 - 216y - 212 = 0. -53, -1 Factor 2y4 + 16y*3 - 2y*2 - 16y. 2y(y - 1)(y + 1)(y + 8) Factor 2x2/7 - 4x + 66/7. 2(x - 11)(x - 3)/7 Find o, given that o*2/5 + 2o/5 - 48/5 = 0. -8, 6 Find p such that 3p4 - 127p*3/2 + 247p*2/2 + 2p - 38 = 0. -1/2, 2/3, 2, 19 Solve 7f2 + 51f + 14 = 0 for f. -7, -2/7 Find y such that 2y3/7 + 32y*2/7 - 114y/7 = 0. -19, 0, 3 Factor 3t2/4 - 1587t - 6351/4. 3(t - 2117)(t + 1)/4 Factor -t*2/4 + 39t/2 - 1521/4. -(t - 39)*2/4 Solve -2c*5/15 - 22c*4/15 - 2c*3/5 + 262c*2/15 - 112c/15 - 24 = 0 for c. -9, -5, -1, 2 Find j such that 2j4/7 - 26j*3/7 - 96j*2/7 - 8j/7 + 128/7 = 0. -2, 1, 16 Factor -30b3/11 - 58b*2/11 + 4b/11. -2b(b + 2)(15b - 1)/11 What is d in -5d4 - 30d*3 - 35d*2 + 30d + 40 = 0? -4, -2, -1, 1 Factor a*5/2 - 18a*4 - 20a*3 + 53a*2 + 183a/2 + 37. (a - 37)(a - 2)(a + 1)3/2 Solve r4 + 190r3/3 - 531r*2 + 952r + 1136/3 = 0. -71, -1/3, 4 Factor x*4/2 + 5x*3 - 14x*2 - 20x + 48. (x - 2)*2(x + 2)(x + 12)/2 Find c such that -9c*2 - 43c + 10 = 0. -5, 2/9 Let v*2/2 - 139v/2 - 70 = 0. What is v? -1, 140 Factor 2q2 - 3216q + 1292832. 2(q - 804)2 Suppose q4/3 - 550q*3 - 2204q*2 - 6616q/3 = 0. Calculate q. -2, 0, 1654 Find t such that 5t2 + 20940t + 21924180 = 0. -2094 Factor -2i3 + 258i*2 - 1006i + 750. -2(i - 125)(i - 3)(i - 1) Factor -i3 - 456i*2 - 51984i. -i(i + 228)2 Let 4n*4 + 416n*3 = 0. What is n? -104, 0 Factor 3p*2 - 1476p + 181548. 3(p - 246)2 Factor 3g*4 + 48g*3 + 72g*2 - 960g + 1200. 3(g - 2)2(g + 10)*2 Factor 2k*4 - 30k*3 + 112k*2 - 120k. 2k(k - 10)(k - 3)(k - 2) Find a such that a4/8 + a3/4 - 9a2/8 - a/4 + 1 = 0. -4, -1, 1, 2 Determine j, given that -2j*2/3 - 1100j/3 - 151250/3 = 0. -275 What is y in y*4/2 - 3y*3 + 4y*2 = 0? 0, 2, 4 Factor 4x*2 + 48568x + 147428164. 4(x + 6071)2 Factor -40l*2 + 562l/7 - 4/7. -2(l - 2)(140l - 1)/7 Suppose -2t*5 + 54t*4/5 - 10t*3 - 38t*2/5 + 12t - 16/5 = 0. What is t? -1, 2/5, 1, 4 Determine q, given that q*5 - 25q*4 + 190q*3 - 430q*2 + 385q - 121 = 0. 1, 11 Determine j so that 4j3 - 1344j*2 + 150528j - 5619712 = 0. 112 What is p in -5p3 - 190p*2 + 395p - 200 = 0? -40, 1 Factor -3u2 - 81u + 714. -3(u - 7)(u + 34) Factor s*4/7 - 2s*3 + 60s*2/7 - 82s/7 + 5. (s - 7)(s - 5)(s - 1)2/7 Find r such that -r2/3 - 3r + 220/3 = 0. -20, 11 Let 3n*4/7 - 9n*2/7 + 6n/7 = 0. What is n? -2, 0, 1 Factor 16b4/5 - 4144b*3/5 + 255604b*2/5 + 329448b + 505620. 4(b + 3)2(2b - 265)2/5 Suppose -3b*2/2 - 93b/2 + 48 = 0. Calculate b. -32, 1 Solve q*2/6 - 3038q + 13844166 = 0. 9114 Factor 5i2 - 1915i - 1920. 5(i - 384)(i + 1) Factor w*5 - 81w*4 + 389w*3 - 691w*2 + 534w - 152. (w - 76)(w - 2)(w - 1)3 Factor -m3/4 + 5m2/2 - 23m/4 + 7/2. -(m - 7)(m - 2)(m - 1)/4 Solve -o*2 - 18o + 19 = 0. -19, 1 Factor 5c3 - 595c*2 + 1740c. 5c(c - 116)(c - 3) Solve 5z*4 - 10z*2 + 5 = 0 for z. -1, 1 Solve 2g*3 + 86g*2 + 830g - 918 = 0 for g. -27, -17, 1 Factor -5b3 + 30b*2 + 135b. -5b(b - 9)(b + 3) Factor -2g*2/5 + 32g - 640. -2(g - 40)2/5 Factor -2t*3/3 + 146t*2/3. -2t*2(t - 73)/3 Find f such that -237f3 + 1893f*2 - 2820f - 36 = 0. -1/79, 2, 6 Factor -v*2/6 + v/6 + 2. -(v - 4)(v + 3)/6 Suppose -j*5/5 + 13j*4/5 - 42j*3/5 + 58j*2/5 - 37j/5 + 9/5 = 0. What is j? 1, 9 Determine a so that -3a2 - 21a - 36 = 0. -4, -3 Determine r, given that -4r3/3 + 7r*2/3 - 2r/3 - 1/3 = 0. -1/4, 1 Suppose -2v5/5 + 716v*4/5 - 13240v*3 + 380176v*2/5 - 749056v/5 + 495616/5 = 0. Calculate v. 2, 176 Factor -50k3 + 120k*2 + 918k + 972. -2(k - 6)(5k + 9)2 Solve -4s*2 + 120s + 124 = 0 for s. -1, 31 Let -66y4 - 334y*3 + 376y*2 + 24y = 0. What is y? -6, -2/33, 0, 1 Determine n so that -4n5 + 12n*4 + 20n*3 - 60n*2 - 16n + 48 = 0. -2, -1, 1, 2, 3 Determine i, given that -2i5/21 - 20i*4/7 + 344i*3/21 - 76i*2/7 - 30i = 0. -35, -1, 0, 3 Let 4l3 + 104l*2 + 332l - 440 = 0. What is l? -22, -5, 1 Factor -y*2/7 - 34y/7 - 64/7. -(y + 2)(y + 32)/7 Factor -n5/2 - 17n*4/2 - 29n*3 - 41n*2 - 53n/2 - 13/2. -(n + 1)*4(n + 13)/2 Factor r*2/7 + 62r/7 + 120/7. (r + 2)(r + 60)/7 Solve -d2 - 339d + 1026 = 0 for d. -342, 3 Determine o so that o*5/3 - 5o*4/3 + 5o*3/3 + 5o*2/3 - 2o = 0. -1, 0, 1, 2, 3 Factor -2v2 + 18v + 44. -2(v - 11)	{ "pile_set_name": "DM Mathematics" }
1 + 3)) + (12 - 22). 0 What is the value of (-9 - -16) + (-14 - -3) - -2? -2 Evaluate 11 - (-37 + 25 - (8 - 36)). -5 What is the value of (18 + -33 - -25) + -22? -12 -171 - -180 - (1 + 0) 8 Calculate (-1 + 13 - (4 + -2)) + -2 - 27. -19 6 + 5 + -24 + -10 - -7 -16 Calculate (2 - (5 + (-5 - 1))) + -12. -9 Calculate (43 - 34) + -25 - 10. -26 Calculate -7 + (-13 - -4) - -2. -14 What is the value of -33 + -3 + -11 - -9? -38 -4 - (1 + -4 + -7) 6 Calculate -13 + 5 + 10 + 3. 5 What is -11 + 3 - (3 - 8)? -3 Calculate -11 - -11 - (0 + (-2 + -2 - 5)). 9 Calculate (1 - -27) + (26 - (30 - -4)). 20 Calculate (-2 - 2) + 2 + -13 + (17 - 6). -4 Evaluate -12 - (1 + (7 - 17) + 15 - -7). -25 Evaluate -34 + (-16 - 2 - -8 - (-12 + -2)). -30 -4 + 1 + (-4 - -12) + 11 16 Calculate -2 - (0 + 25 + -39 + 8 + 33). -29 What is (-3 - -11) + -8 + 0 - 16? -16 What is the value of -8 + 3 - (-1 - -22 - (-52 + 42))? -36 What is the value of 4 + -2 + (-12 - -8 - -8)? 6 Evaluate -7 + -4 + (-6 - -4). -13 -3 - (-1 + 2) - (0 - -4 - -4) -12 Evaluate (0 - (-13 + 18)) + -17 + 4. -18 What is the value of -27 - (-6 + -5 - (2 - 3))? -17 Calculate 20 + -4 + -21 - (-5 - 1). 1 What is the value of -20 + (31 - (29 - 15))? -3 Evaluate 1 + -19 + (44 - 37) - (-41 - 4). 34 What is 40 - (16 - (21 - 25))? 20 What is -14 + 4 + 0 - -15? 5 Evaluate 28 + (-21 - 11) - -1. -3 What is 10 + (12 - 20) + -2? 0 Calculate -13 + -1 + -82 + 87. -9 8 + -27 - (6 + -46) 21 -13 - (-12 - 6 - -4) 1 What is (1 - (39 - 3)) + -203 + 209? -29 Evaluate -20 - (-32 + -36 - (-10 - 1)). 37 What is the value of (40 - 32 - (1 + -1)) + -1 + 9? 16 What is -2 + 7 + (-12 + 38 - 22)? 9 -6 + (0 - -1) + -1 - (-21 + -1) 16 What is the value of (16 - -13) + -11 + -30? -12 What is -387 + 388 - (-22 + 2)? 21 Evaluate -2 + 3 + 15 + 8 + 0. 24 Evaluate (8 - (9 + -12)) + 14 + -4. 21 Evaluate (-2245 - -2250) + (0 - (4 + -2 - 20)). 23 Evaluate 2 + (-3 + (5 + 3 - 14) - -3). -4 (-6 - -17) + (31 - 53) -11 Calculate (-60 - (0 - 15)) + 23. -22 Calculate -8 - 1 - (-193 - -196) - (-25 + 1). 12 14 - ((0 - 2) + 4 + -3) 15 10 + (-6 - -7) - 4 7 Evaluate -15 - (3 + -8 + -8). -2 Evaluate -6 - -8 - (2 + -1 + 1) - 5. -5 What is -23 + -7 + 8 + 12? -10 Calculate (-2 - -4) + 1 + -31 - (-46 - -45). -27 What is 9 + 11 + -3 + -3 - (19 - 11)? 6 Evaluate 17 + (-16 + 23 - 8). 16 Evaluate (18 - (-6 - -10)) + -10 + 0. 4 -43 + 29 + 28 + -32 -18 What is the value of (-47 - -69) + (-2 - -1) + -10? 11 Evaluate 14 + 0 + 0 - (-6 + 12) - 7. 1 What is -4 + -14 - (-2 + -30)? 14 What is the value of 4 - (5 + (-15 - -32))? -18 14 + -5 - (-2 + 1) - 13 -3 (2 - 6) + (3 - 7 - (23 - 32)) 1 What is the value of 0 - -18 - (37 - 58 - -32)? 7 Calculate (7 - -27) + -26 + (-5 - -1) + -12. -8 What is 17 + 1 - (-245 - -254)? 9 Calculate 7 + (-9 - (-2 + 14)) + 11. -3 Evaluate (-5 - (26 - (-30 - -53))) + -1 + 13. 4 What is the value of (-2 - -1 - 1 - (-255 + 225)) + -7? 21 Evaluate -11 + (11 - (-9 + 7)). 2 9 + 0 - (345 + -336) 0 Evaluate (23 - (-26 - -88)) + 7. -32 What is the value of -6 + (12 - 10) - -5? 1 What is the value of -12 - (5 + -13) - 8? -12 -4 + -1 + 11 + 2 + 3 11 Evaluate -27 + 5 - -14 - (7 - (0 + 0)). -15 1 + -8 + 3 + (-5 + 5 - 5) -9 Calculate -15 + (-5 - (-7 + (-4 - -1))). -10 What is the value of (5 + -2 - (-33 - -35)) + -4? -3 What is -183 + 186 - (-5 + 3 + (-9 - -1))? 13 Calculate (-13 - 5 - 3) + 16. -5 What is 4 - (-20 + (3 - (2 - 6)))? 17 Evaluate -1 + 1 + -108 + 101. -7 12 + -21 + (-1 - 15) + -4 + 1 -28 Calculate -35 + 35 + (5 - (-1 - (-1 + 12))). 17 Calculate (1 - 8) + -1 + (-7 - -14). -1 What is the value of 22 - (-4 - (9 - 47))? -12 Calculate -2 + (-1 - 3 - (-2 - 9)) + 5. 10 (-10 - (-9 + (5 - 0))) + -6 -12 Evaluate (-1 + -1 - -2) + (25 - 34) + 18. 9 Evaluate 4 + (-1 + -2 + 3 - (6 + -7)). 5 Evaluate (50 - (20 + 6)) + -19. 5 254 + -245 + (-11 - -1) -1 What is -1 + -13 + -94 + 95? -13 What is the value of 1 + -8 - (-42 + 29 - 3)? 9 Calculate 2 - 17 - (-11 + 13 + -10). -7 Calculate 1 - ((-10 - -15) + -20). 16 What is 9 - (1 + -13) - 15? 6 What is 12 + 3 + -7 - 20 - -1? -11 Calculate (-19 - -23) + -2 + -7. -5 What is the value of 23 - (16 + -14) - 17? 4 Evaluate -25 + (-3 - -3 - 4 - -4). -25 Calculate 10 + -12 - (-7 + -17 + 0 + -3). 25 What is (-19 - -40) + -19 + (0 - -23) - -2? 27 What is the value of -3 + (9 - (5 - (-1 + 5))) + 5? 10 What is the value of -1 + -2 - (53 - 51)? -5 Evaluate -661 - -663 - (-1 + 19). -16 What is the value of (82 - 56) + (-27 - -5)? 4 (14 + -15 - (-1 + -1 - 1)) + 5 7 Evaluate -6 + (30 - -2) + -26. 0 -6 - (29 + 10 - 37) -8 Calculate 7 + 0 + -10 + (-2 - -3). -2 (12 - 2 - 20) + (-4 - 0 - -35) 21 Evaluate 1 + (-15 + -7 - -20). -1 (-7 - 1) + -78 + 104 + -8 - 6 4 Evaluate (7 - 4) + -2 - (1 + 5 + 2). -7 What is the value of (10 - 18 - 2) + -3 + -1? -14 Calculate 0 - -11 - (11 + (-9 - (4 - 5))). 8 What is 1 + (0 - -5) + (-3 - (-18 - -5))? 16 Evaluate -22 + 25 + (-1 - 4) - 1 - 2. -5 What is (1 + -4 - (-10 + 0 + 11)) + -10? -14 Calculate -3 + -1 + -7 + -4 + 10 + -5. -10 29 - 48 - (26 - (-5 - -11)) -39 What is 8 + -22 + 6 + -1 + (17 - 43)? -35 (5 - -8 - 25 - -3) + -7 -16 Evaluate -13 + -6 + -6 + 7 + (2 - -4). -12 What is (-16 - (18 + -41)) + -10 + 0? -3 What is the value of 7 + (3 - ((-6 - 3) + 5))? 14 What is 8 + -10 + -1 + 7 + 16? 20 Calculate -2 + (9 - (-6 + 7) - 2). 4 What is the value of (7 - 5) + -5 + 0 + -8? -11 (-11 - 33) + 17 + (0 - 3) -30 Calculate -15 - (16 - 18) - -10. -3 What is (4 - -10) + 3 + -1 + 41 + -45? 12 Calculate -1 - (1 - 10) - (-26 + 33). 1 What is the value of -2 + 0 + 283 + -262? 19 -1 - -2 - (-10 - (-17 - -7)) 1 Calculate 274 + -276 + (-1 - -1) + -4 - 2. -8 What is the value of (-7 + 0 - -1) + -9 + (69 - 63)? -9 What is -1 + 1 - (-156 - -149)? 7 (-64 - -30) + 29 - (1 + 2) -8 Calculate (0 - (-4 - 4 - (8 + -11))) + 11. 16 What is 63 + (5 - 38) + -25? 5 Calculate 5 + (-3 - 8 - -29) + 3 - 8. 18 Evaluate -32 + 27 - 1 - -22. 16 Evaluate 6 + 14 + -23 - (2 - (-1 - -6)). 0 What is the value of -12 + (-3 - -10 - (-10 - (12 + -24)))? -7 Evaluate (11 - 3 - (-10 + (-8 - -8))) + 9. 27 Evaluate (-6 - 1 - -4) + (-46 - -36). -13 Evaluate -3 + (0 - (0 - (-3 - -9 - 9))). -6 What is -3 + 6 + (-17 - (0 + 6 + -9))? -11 What is 9 - ((12 - (43 + -12)) + 3)? 25 Calculate -5 + -5 - (-11 - 2). 3 -42 - (-35 + 9 + -11) -5 What is -23 + 6 + -4 - (6 - 16)? -11 What is the value of (0 + 8 - -2) + 6 + (-2 - 6)? 8 Evaluate 8 + (-36 - (-23 + -4 + 8)). -9 Calculate -1 + -2 - (-1 - (24 + -15)). 7 Calculate 1 - (1 + 1 - -5) - (18 - 9). -15 What is the value of -8 + (-6 - 0) + 4 + 4 + -9? -15 (31 - (25 + -14)) + -10 - (0 + 6) 4 What is the value of 12 - (-2 + (30 + -2 - -16))? -30 What is 1 + (8 - 1) + -227 + 220 - 26? -25 Evaluate 18 - (-3 - (-28 - -15)). 8 What is the value of -1 + -4 + -1 - (-2 + 8 - 6)? -6 Calculate 3 + (-23 + 15 - -3) - -28. 26 What is the value of (2 - -6) + (-6 - (3 + 0)) + 16? 15 What is the value of -11 + -8 + 17 - -18? 16 What is (90 - 91) + 2 + 0? 1 Calculate -20 + (-7 - -11) + 4. -12 What is (24 - -1) + (-70 - (-34 - 41))? 30 What is the value of 13 + ((4 - 0) + -3 - (20 + -21))? 15 What is the value of -29 + (25 - 3) + 18? 11 What is the value of -2 + -1 - (0 - (16 + 6) - -9)? 10 What is -1 + 7 + -10 + -6? -10 What is the value of 4 - 2 - -1 - (-7 - (15 + -5))? 20 Evaluate -22 + 1 + 0 + 10 + -3 + 3. -11 Evaluate 4 + (8 - (19 + 9) - (-2 - -5)). -19 What is 52 + -63 - (2 - 0)? -13 Evaluate 5 + -15 + 31 + -4. 17 11 + (0 - 11 - (-16 + -11 + 10)) 17 What is the value of -18 - (-67 - -82 - (15 - 2))? -20 Calculate (43 + -1 - -2) + -29. 15 What is the value of -566 + 603 - (1 - -23)? 13 Evaluate 45 + -22 + -3 + 11. 31 Calculate (2 - 9) + (2 + -1 - (12 - 5)). -13 (-3 - 0) + (26 - 24) - -4 3 Calculate 37 - (-31 - -8 - -48). 12 -49 + 59 - (1 - -7) 2 Evaluate 84 + -54 + -5 + 0. 25 Calculate 5 - 17 - 19 - -60. 29 -117 + 124 + (2 - 24 - (0 - -1)) -16 Evaluate 1 - ((-351 - -309) + (0 - -14)). 29 What is (13 - 5) + 23 + -41? -10 What is the value of (16 - 3) + -14 + (-3 - 1) - 0? -5 What is (-8 - 1) + (2 + 1 - 0)? -6 What is 1637 + -1617 - (-1 - -29)? -8 Evaluate -3 - (25 + (-1 - 0)) - (-372 - -373). -28 What is the value of 2 + -1 + (6 - 2) - -7? 12 -19 + 1 + 296 + -283 -5 10 + -12 + -2 + 2 -2 What is the value of -36 + 30 + (5 - (1 - -12))? -14 What i	{ "pile_set_name": "DM Mathematics" }
her -0.329175 and -11.5129796. -11.8421546 Put together 709.5092543399 and -33. 676.5092543399 Total of 233721.1058214 and -5. 233716.1058214 What is -0.867 minus 440517564? -440517564.867 What is 9164.1226 + 0.0195? 9164.1421 What is 7837931.03 less than 13181? -7824750.03 0.153947+13.2280404 13.3819874 Add together 161466227732520 and -0.13. 161466227732519.87 Put together 1142.688242456 and 4. 1146.688242456 Sum 1 and -271900114.16. -271900113.16 What is -4.38789 minus -716247.7? 716243.31211 Put together 2311318496039 and -0.6. 2311318496038.4 What is 47 + 513335534252? 513335534299 -55806208906411 - -0.2 -55806208906410.8 What is 77.278 - 3065624057? -3065623979.722 What is 454.575 less than 1.982637? -452.592363 Work out -14439 - 16822157. -16836596 What is -486800520 - 1.205? -486800521.205 Work out -17081.947 - 135. -17216.947 Subtract 27898 from 102005.038. 74107.038 What is 11490.1 less than 573196464? 573184973.9 What is -31 take away 519972394672? -519972394703 Total of -0.276857875 and 1.901. 1.624142125 Work out 0.049 - 20134160912. -20134160911.951 Work out -10088871 + 2.0931. -10088868.9069 What is -3548.910918 take away 0.04749? -3548.958408 Add 0.00904 and 156431.863. 156431.87204 -2.623 - 0.5422401 -3.1652401 What is 4076669 minus 258659248? -254582579 Work out -0.4 - -14409129681418. 14409129681417.6 Work out -2328 - 98652012. -98654340 Total of 6 and 18345730.49464. 18345736.49464 What is -48380 take away -17.613103? -48362.386897 Calculate -109657977180 - 0.01. -109657977180.01 What is -244292769 plus -173.8? -244292942.8 What is -0.5860202 plus 8808799? 8808798.4139798 Add together 594722562 and -67.7. 594722494.3 What is -193966012 plus -0.03? -193966012.03 Work out 4 + 103.51778763525. 107.51778763525 Calculate 2.8744422082229 - -0.3. 3.1744422082229 Work out 931.983 + -804858. -803926.017 Add -79319703 and -0.01975. -79319703.01975 Calculate -2.9334749743239 - 0.5. -3.4334749743239 Put together 0.11 and 1165972821852. 1165972821852.11 What is -2 - 12039314509? -12039314511 What is 0.12237033076 minus -0.02061? 0.14298033076 Calculate -61864957170 + -1611. -61864958781 What is the distance between -385340634 and 0.0457? 385340634.0457 What is 33 less than 465373372102? 465373372069 Put together 210820957577 and 2. 210820957579 What is -1966663919941 - 3? -1966663919944 Work out -1357.1493 - -3592.4. 2235.2507 What is -3.99 + -4.46718144? -8.45718144 Put together 1401526 and 0.0021538. 1401526.0021538 Calculate -2272763789 - -0.068. -2272763788.932 -14.80449 - -4446 4431.19551 -8748.157065872 - 0.001 -8748.158065872 Total of -63.85955 and 4973.1. 4909.24045 -220142388519 + 2 -220142388517 Total of -1.3674 and -1.7290334. -3.0964334 Put together -68 and -3360.643463. -3428.643463 What is 1.11 minus -693521284005? 693521284006.11 Work out 0.5822 - -7099462. 7099462.5822 What is 459993869930 less than 0.41? -459993869929.59 What is -3.113494576 take away -12541? 12537.886505424 Add together -87975 and -572988. -660963 Work out 17892314589847 + -0.063. 17892314589846.937 Put together -58.01 and -84712206492. -84712206550.01 Total of 1091521435 and 1586.83. 1091523021.83 Add -23952 and 4144130.2. 4120178.2 What is -1009551837459 - -2? -1009551837457 Work out -4992231039477 - -0.1. -4992231039476.9 What is the difference between 0.5 and -33931454921? 33931454921.5 -15958363089000 - -13 -15958363088987 Calculate 10.38484 + 3591702.63. 3591713.01484 What is 2362.6789 plus -40020? -37657.3211 Sum -20592 and 12856428. 12835836 What is the difference between -102 and -65689.3074? 65587.3074 What is the distance between -61651957 and 5557112? 67209069 Calculate 21 + -582159093189. -582159093168 Sum -18.319 and 12881207. 12881188.681 Subtract 0.6205 from -173161.64. -173162.2605 What is -105710596 - 1557222? -107267818 Subtract 48855017101 from -5084. -48855022185 Total of -544054 and -971980815. -972524869 Calculate -34 + -4167861362573. -4167861362607 What is 8285607178618 + 0.4? 8285607178618.4 Add 22 and 48618246648. 48618246670 Put together -0.02 and -757329395589.5. -757329395589.52 Subtract 591382304 from -0.0783. -591382304.0783 Calculate 4164.25 + 4446802. 4450966.25 20.4 - 264188347 -264188326.6 69665848 + -23 69665825 What is 397783636 less than -7053.3? -397790689.3 Total of 35077009700 and -24.4. 35077009675.6 What is -312618277 take away -42.22? -312618234.78 -190.715154+1.4 -189.315154 548520603.33 - -94 548520697.33 What is -3.2 - -1229436336494? 1229436336490.8 What is -42.06032485226 minus 0? -42.06032485226 -22446194440 + 53.2 -22446194386.8 Calculate -22256320 - -1967.34. -22254352.66 Sum -0.22804 and -133193527. -133193527.22804 Add -0.053 and -364976.24069. -364976.29369 Put together 1352902275 and -208.93. 1352902066.07 What is -0.2257243 + 71510? 71509.7742757 What is -1327014 plus -2.09474? -1327016.09474 What is the distance between -0.2 and -1566425932269? 1566425932268.8 What is the difference between -11713506630 and -33? 11713506597 What is the difference between -11.8 and 428.1499787? 439.9499787 What is -9658256 + 28869? -9629387 What is -5264 + 188183.7? 182919.7 Work out -0.65 - 5520434544. -5520434544.65 5.3 + -14385193647 -14385193641.7 What is 3 - 156.986114619? -153.986114619 What is -3928132485209 take away -0.2? -3928132485208.8 Put together 11290873 and -7657977. 3632896 What is -159754387 less than 4611? 159758998 What is -2257 + 3231100.3? 3228843.3 39602 - -3343.217797 42945.217797 Work out -0.05 - 11072995381491. -11072995381491.05 What is -0.0213 minus 4745703903? -4745703903.0213 Calculate -105817 + 3384787. 3278970 What is 2765420508 + 0.95991? 2765420508.95991 Work out -0.55046 + -87438246.93. -87438247.48046 Subtract -0.03538445 from -586737. -586736.96461555 What is -73.8435 minus -75.9846? 2.1411 What is 13142650717 take away 2502? 13142648215 -70288 + 2235.29466 -68052.70534 Add -5 and -687297660129. -687297660134 What is the distance between 378 and -6529556948? 6529557326 Sum -5.5686048 and -4.179258. -9.7478628 What is -26177820.5 take away 147? -26177967.5 -9085796941+-44.2 -9085796985.2 What is -668577753050 less than -0.1? 668577753049.9 39 + 22290155907 22290155946 Work out 13.21646113523 - -0.6. 13.81646113523 What is 0.0980867 take away -624.852? 624.9500867 Add -4552691358698.08 and 0.2. -4552691358697.88 Add together -0.224040158669 and 0.0264. -0.197640158669 Work out -8496338436 + -42. -8496338478 Work out -1895 - 962460.683. -964355.683 What is -4 minus 1703731055808? -1703731055812 Add 275397 and -472076. -196679 What is the difference between 1323.5 and -7.4330058? 1330.9330058 Calculate 103 + 11936703204. 11936703307 -27.2 + 665946646563 665946646535.8 -0.111616748109 + -0.0995 -0.211116748109 What is 181676848185 + -5? 181676848180 Total of 70401798017 and -36. 70401797981 What is 414298236948.7 minus 0.5? 414298236948.2 Add together -2.4583 and 2039366939. 2039366936.5417 Calculate -15285497.32 - 803. -15286300.32 Total of 10452712222747 and 0.2. 10452712222747.2 What is 447905003.3459 minus 4? 447904999.3459 What is the difference between -2624 and -197.8848716? 2426.1151284 What is -479784 take away -0.1412798? -479783.8587202 Add together 4282577684535 and 5.4. 4282577684540.4 Sum -1255271396 and -4511.22. -1255275907.22 Subtract -0.1011577564 from -748979. -748978.8988422436 Calculate 25.065823 - -1444874.8. 1444899.865823 Put together 6401802 and 3666. 6405468 Put together -1090200822800 and 17. -1090200822783 Total of 22662 and 192999155. 193021817 Calculate -0.2 - 0.23564375621. -0.43564375621 What is 25458.83599 minus 8707? 16751.83599 Work out 62163243074 + -9.9. 62163243064.1 What is -35942951 take away 6641160? -42584111 What is -57 + 1514.3277324? 1457.3277324 Total of 51.282428 and -1728823. -1728771.717572 What is -7170 less than 2.856116? 7172.856116 Sum 0.0665 and -94260245. -94260244.9335 -37214640752.06 - -4 -37214640748.06 Put together 279.798444 and -0.24. 279.558444 Add together 4316835 and -185546958. -181230123 Total of 0.188 and 362925222.6. 362925222.788 -28.1 - 739429044 -739429072.1 Work out 0.38 + -73212.335183. -73211.955183 Calculate 83485.62645961 + -2. 83483.62645961 Put together -8843 and 690390.33252. 681547.33252 Add toget	{ "pile_set_name": "DM Mathematics" }
9 divide h? False Is (45 - 48) + (11541 - -5) a multiple of 84? False Let u = -7 - -12. Suppose -118 = -3c - j - 18, 0 = 5c + 3j - 172. Suppose -4b - 48 = -us + 32, 3b = -2s + c. Is s a multiple of 8? True Suppose -4x + 13 = 4m + m, -4m + 2x + 26 = 0. Let a(c) = 0c*2 + 7c + 3c2 + 2c2 + c3 - 2c3. Is a(m) a multiple of 6? False Suppose -4o - 747 - 220 = f, 0 = 5o - 2f + 1225. Is (-61668)/o - 2/(-9) a multiple of 66? False Let y = 14726 + -8472. Is y a multiple of 53? True Let t = 2178 + -1038. Let j = -753 + t. Is j a multiple of 7? False Let p = -101 - 8. Let t = 107 + p. Is -2 - ((t - -32) + -330) a multiple of 27? True Suppose 20i - 23i = 6. Is (28/56)/(i/(-44)) even? False Let o(h) = h2 - 9h + 23. Suppose -j - 2r = 2j - 24, 0 = -5j + r + 27. Let u be o(j). Suppose -uc + 30 = -3x, 2x + 10 = c - 3. Does 2 divide c? False Suppose -3a + b = -26, -5b = -2b + 15. Suppose al - 1568 = -4f + 5l, -5f = 4l - 1957. Is 16 a factor of f? False Suppose 146j - 295j + 140j = -49680. Is 24 a factor of j? True Let v = 118 - 120. Let s(f) = 8f*2 + 2f + 5. Is 4 a factor of s(v)? False Let d = 1 - -2. Suppose -z = -4j - 5 - 130, dz = 2j + 425. Is 13 a factor of z? True Let q(r) be the third derivative of r5/30 - r4/6 - 2r*3/3 + 5r*2. Let l be q(-7). Suppose -5k = -4k - l. Is 18 a factor of k? False Let m(w) = -44w - 268. Let n be m(-6). Let h(b) = -122b - 65. Is 47 a factor of h(n)? True Suppose 5c + 5929 = 4s, -5418 = -5s + c + 2009. Is 6 a factor of s? False Let p be (10 + (-108)/12)/(2/8). Suppose 4q + py = 1704, 0 = -3y - 16 + 7. Does 11 divide q? True Suppose 8 = -x + 3k - 1, 5x - k - 11 = 0. Suppose -3z = -2r - 118, xr - 124 = -3z - r. Suppose 0 = -2s + 208 - z. Does 28 divide s? True Let f be ((-172)/(-6) + 0)(-27)/18. Let k = -23 + f. Let v = 45 - k. Does 15 divide v? False Let s(i) = 2i*2 - i + 7. Let f be s(4). Suppose fb - 31b - 100 = 0. Is b a multiple of 4? False Let t(r) = 71r - 1363. Is 20 a factor of t(73)? True Is 32 a factor of 551040/252((-36)/20 + 3)? True Let w = 81 - 149. Let z = 948 + w. Does 55 divide z? True Let o(l) = -l + 40. Let n be o(23). Is 4490/n - 6/51 a multiple of 4? True Let l(d) = 5d*3 + 5d*2 - 20d + 2. Let q(n) = 9n3 + 11n*2 - 39n + 5. Let r(h) = -11l(h) + 6q(h). Is r(4) a multiple of 2? True Let d(k) = 2k3 - 9k*2 + 87k - 60. Is d(12) a multiple of 24? True Let l be 6 - (-1748)/(6 - 2). Let n = -124 + l. Is 11 a factor of n? True Is 16 a factor of (-66)/(-2 - -2 - 25/1200)? True Let j = -1730 + 2660. Is j a multiple of 93? True Let z(m) = -m - 9. Let a be z(-8). Let g = 4 + a. Suppose -378 = -10o + go. Does 9 divide o? True Let b be 1/(-1) + (14 - 6/(-3)). Suppose -4c + 2z - b = 5z, 0 = 2c - 3z + 21. Let a(i) = -3i - 3. Does 15 divide a(c)? True Suppose q + 4x = -2 - 9, -3x = 4q + 57. Let t = 21 + q. Suppose -5r = -2a + 295, 0 = 2r - tr - 20. Is a a multiple of 27? True Let h = 291 + -292. Is h - -6 - -9422/4 a multiple of 18? True Suppose 4 = 2b, 5a - 803 + 283 = 5b. Is a a multiple of 34? False Let z be ((-6)/(-4))/((-2)/24). Let u(k) = -3k - 38. Let y be u(z). Is 31 a factor of y/(-12) + (-644)/(-6)? False Let u = 200 + -192. Suppose -uk = -16k + 1832. Does 13 divide k? False Suppose 44 = -5f + 24. Let h be 1/((-2)/f + (-6)/36). Let q = 32 + h. Is q a multiple of 4? False Let w(j) be the first derivative of j4/4 - 7j*2 + 4j + 36. Does 9 divide w(-3)? False Let x = 49 + -25. Let m = 35 - x. Suppose 0 = 5h - m - 19. Is h even? True Suppose -4189 = -22x + 5777. Is x a multiple of 16? False Suppose -o + 65 = -3c - 585, -4c + 1885 = 3o. Is 5 a factor of o? True Is 245286/27 - 1/(-3) a multiple of 143? False Suppose g + 72 = 2u + 11, -u = -5g - 35. Does 30 divide 126224/345 + 4/u? False Let y = -8875 - -17730. Is y a multiple of 37? False Suppose 0 = -166o + 1853903 - 312759. Is 211 a factor of o? True Suppose -16x + 15x = -20. Let k = -105 + x. Let l = k - -139. Does 8 divide l? False Let g(y) = 7y + 719. Does 46 divide g(55)? True Let p be 2660/8 - 1/2. Let z = p + 857. Does 29 divide z? True Suppose 0 = -4r - 3z + 22, -24 = r + 4z - 36. Suppose 0 = 4g - j - 266, rg - 4j - 103 = 169. Does 6 divide g? True Let f(v) = 183v*2 + v + 2. Let x be f(-1). Suppose 0 = 4h + 8 - x. Is 22 a factor of h? True Suppose -22r + 29902 = -21r - 3l, 0 = -5l + 20. Is 22 a factor of r? False Suppose -238380 = -37v - 21v. Does 22 divide v? False Suppose 0w + 410029 + 476759 = 63w. Is w a multiple of 7? False Suppose z - 2z + 7 = j, -5z + 4j - 10 = 0. Suppose 11r - 10r = 16. Suppose -r = -zh + 176. Does 24 divide h? True Suppose 6l = 8042 + 8008. Let c = l - 1565. Is c a multiple of 12? False Suppose -x - 22 = -2x. Let i(j) = 3j + 26. Let g be i(-8). Suppose 3y = -5k + 164, gk - x = y - 84. Does 39 divide y? False Does 31 divide (-13 + 14)/(74/124628) - 6? False Suppose -12g = -7g - 15. Let s be 105/(-84)g/((-3)/8). Is 2/s - (-903)/35 a multiple of 13? True Does 23 divide ((-92)/(-10) - 10)-6445? False Suppose 3b - 5p - 14 = 2b, 0 = 4b + 4p - 8. Let q be (-6)/b236 - 1/1. Is (q/(-5))/1 + 4-1 a multiple of 6? False Let a = -9947 + 17538. Is a even? False Let y(q) = q*3 - 12q*2 - q + 23. Let f be y(12). Does 6 divide 329 + -14 + f? True Let f(m) = -2m - 2. Let c(q) = -53q - 96. Let o(x) = c(x) - 3f(x). Is o(-6) a multiple of 24? True Let g(n) be the third derivative of -187n*4/8 - 7n*3 + 288n*2. Is g(-2) a multiple of 15? True Suppose b + 3b = -300. Let c = 197 + b. Is 83 a factor of c? False Suppose 2m - 80 = -f, 3f + m = 2m + 254. Suppose -3 = -3v + g, 3v + g - 15 = -2g. Suppose vt - f = -24. Does 15 divide t? True Suppose -612 = -q - 2d - 151, -2q + 886 = -5d. Is q a multiple of 5? False Let q(d) = 3d + 1 + d - 88 + 2d. Is q(28) a multiple of 15? False Suppose -5717 = -7m + 28303. Is m a multiple of 18? True Let l = 10880 - 6344. Does 14 divide l? True Suppose 1883 - 633 = d - 4u, 15 = -3u. Does 30 divide d? True Suppose 14a + 271a - 52a - 1013550 = 0. Is a a multiple of 25? True Suppose -x = -2x + 34. Let h(a) = -a3 - 14a*2 - 28a - 22. Let t be h(-12). Let f = x + t. Is 20 a factor of f? True Suppose 3y = 2y + 4v + 2, -4v = -3y + 6. Let h(t) = 9t + 5. Let o be h(y). Suppose -q = -42 + o. Is q a multiple of 4? False Is 8 a factor of 348/((-202)/(-505) + (-221)/590)? True Suppose 0 = 27a - 16152 - 3990. Suppose 8l = -a + 3290. Is 46 a factor of l? False Let r = -6477 - -11520. Is r a multiple of 33? False Let q(l) = -35l + 60. Let x be q(-13). Suppose 8u - 4u = -5v + 694, 0 = 3u + v - x. Is 22 a factor of u? False Let f(p) be the first derivative of -p4/4 - 10p*3/3 - 11p*2/2 - 22p + 12. Let q be f(-9). Is q(2/(-4) - (-369)/(-12)) a multiple of 25? True Is (-117)/195 - (-68823)/5 a multiple of 12? True Suppose -m + 3 + 3 = 4g, -5m = -g - 9. Suppose 2i - 3i + u = -m, i - 4u = -1. Suppose -6b = -3o - 5b + 289, io + 4b = 269. Does 19 divide o? True Let x = 22521 + -20141. Is 119 a factor of x? True Let q be (1 - 0)/((-1)/(-64)). Suppose -167v = -170v - 156. Let f = q + v. Is f a multiple of 11? False Let m(r) = r3 - 12r*2 + r - 4. Let x = -8 + 20. Let u be m(x). Is 14 a factor of (4 + 126/u)4? False Suppose 5j + 10 = -33m + 37m, 0 = -4j + 2m - 2. Suppose 985 = jg - z, -16g = -18g - 4z + 1010. Does 15 divide g? True Is 34 a factor of ((-2)/(-8) - (-7991)/1220)2335? True Let p(w) = -3w2 + 124w + 165. Let h be p(43). Let s(q) = q*3 - 4q*2 + 7q. Let g be s(6). Let y = h + g. Is y a multiple of 24? False Let c(w) = -w3 - w2 + 2w + 90. Let y be c(0). Suppose -6g + y = -5g. Let x = -58 + g. Is x a multiple of 28? False Suppose 4d - 9703 = -3n, 2n = d - 1653 - 770. Is 21 a factor of d? False Let d = 25040 + -8595. Is 13 a factor of d? True Let p(b) = 6b - 2. Let g be p(9). Let i = g - 55. Is 27 a factor of 2240/22 - i(-4)/(-66)? False Let n be 8 - -218/(-28)1. Suppose 1051 = 3y + y + 3h, -3h - 503 = -ny. Is y a multiple of 37? True Let g = -42 + 46. Suppose -gs - 2r = 910, 594 = 5s - 5r + 1709. Let n = s + 336. Is n a multiple of 27? False Let t(l) be the sec	{ "pile_set_name": "DM Mathematics" }
se Let t = 5 - -89. Does 30 divide t? False Let y(n) = n*2 + 7n + 3. Does 7 divide y(-9)? True Let j = 206 + -118. Suppose y - 2b - 11 = 0, -4y + 2 = 2b - 2. Suppose -31 = yf - j. Is 11 a factor of f? False Let v be (-18)/(-4)(-28)/6. Let t = 43 + v. Is 22 a factor of t? True Let h(k) = -k2 - 9k + 11. Let l be h(-10). Let z = l + -1. Let f(n) = -n + 30. Is 15 a factor of f(z)? True Is 3 a factor of -250(-4)/8? False Let g = -5 - -22. Suppose 2n + g = 4x - n, 3 = -n. Suppose 3j - 3l - 30 = 0, -j - xl + 0 + 1 = 0. Does 7 divide j? True Suppose 124 = 18j - 2. Is j a multiple of 5? False Let j(b) be the third derivative of -11b4/12 - b3/6 - 7b*2. Let q = 0 - 1. Is 21 a factor of j(q)? True Suppose -3b - 121 = -460. Does 6 divide b? False Let o(j) = 5j2 + 3j + 2. Is o(-7) a multiple of 54? False Let h be 33 + (-1 - 0) + 2. Suppose h = 2d - 26. Is 9 a factor of d? False Suppose j - 86 = 4n, 5j = 3j + 5n + 184. Does 6 divide j? True Is 560/9 + (-12)/54 a multiple of 12? False Suppose -6 = 2b + 3z, b + 4z = -12 - 1. Suppose -3w = 3 + b. Let u(y) = -y3 - y2 - y + 2. Is u(w) a multiple of 6? False Let d(l) = -23l - 9. Suppose 3i - 8 = 4s - 1, -3s - i - 15 = 0. Is d(s) a multiple of 17? False Let a(y) be the third derivative of y7/5040 + y6/180 - y5/30 + 2y2. Let m(i) be the third derivative of a(i). Is 2 a factor of m(0)? True Let o(f) = f3 - 7f2 - f + 6. Let x be o(7). Let i be (0 - 0 - 165)/x. Suppose 5g = -5w + i, 5w = 3w + 2. Is 18 a factor of g? False Suppose 0 = -3q + 16 - 4. Suppose -qd + 2d = 0. Suppose 5b - 3 - 227 = d. Is 23 a factor of b? True Suppose 58 = 2r + 2o, 3 = r - 4o - 46. Let a = r - 4. Is 7 a factor of a? False Suppose -8g = -5g - 21. Is g even? False Let x be -6(-2)/(-4) + 1. Let r(p) = 2p2 - p + 1. Does 3 divide r(x)? False Let k = -22 - -34. Is k a multiple of 3? True Let v(h) be the third derivative of -h6/120 - h5/24 + h4/12 + h*2. Let d(k) be the second derivative of v(k). Is d(-6) a multiple of 14? False Suppose 3t - 5h + 21 = 5t, -2t = -5h + 9. Let d be (-2)/(-3) + (-44)/t. Does 10 divide (-4)/d + (-204)/(-21)? True Suppose -3p - 18 = 4s, -4p - s - 24 = -0s. Let d(x) = -7x2 - 7x - x + x2 - 2 - x3. Does 16 divide d(p)? False Let w = -7 - -18. Does 9 divide w? False Is ((-187)/(-4) - -2)/(4/16) a multiple of 15? True Let z be 2 - 3 - (1 + -16). Let m be -4(-1)/2 - -41. Suppose z = -f + m. Is 13 a factor of f? False Let s(f) = 6f - 7. Let c be s(6). Suppose -c = -5i + 71. Is 20 a factor of i? True Let u(z) = -2z - 6. Let p be u(-5). Suppose -21 = -f + 5y, 4f - 2f = py + 48. Does 13 divide f? True Let k = -96 - -140. Does 22 divide k? True Suppose -5w + 10 = -20. Let l(m) = -12m + 6. Let j be l(w). Let u = -44 - j. Is 17 a factor of u? False Let f be (-16)/(-7) - (-6)/(-21). Suppose 0 - 4 = -fb. Let m(v) = 18v - 2. Is m(b) a multiple of 17? True Let v be (-9)/7 - (-6)/21. Let h(r) = -2r3 - r2 + 1. Let u be h(v). Suppose -ux = -7x + 115. Is 12 a factor of x? False Let q = 4 - 1. Does 7 divide (q - -1)/(-4) + 11? False Suppose -v + 9 = 1. Suppose 5o = o + v. Suppose -a + 4a = -od + 41, 4d + 6 = 2a. Does 6 divide a? False Let w = -11 + 76. Is 17 a factor of w? False Let z be ((-12)/(-10))/(1/75). Suppose 0v = -3v + z. Is 15 a factor of v? True Suppose 0 = 3l - 3w + 191 - 719, 0 = -3l - 5w + 488. Does 17 divide l? False Suppose 5a + 11 = 3s, -4s - 7 = 4a + 21. Is 10 + ((-18)/s - 3) a multiple of 13? True Is 388/10 - (-1 - (-16)/20) a multiple of 39? True Let t = 3 - 1. Suppose 0 = -5v - 20, -tv = -h - 2 + 15. Is h a multiple of 2? False Suppose 0 = -4t - 3u + 5u + 458, 0 = -2u - 2. Is 38 a factor of t? True Let b be ((-1)/3)/(5/(-15)). Does 7 divide 2 + (b - (-17 + 3))? False Suppose 0b = -b. Does 10 divide (-30)/(-2) + -3 + b? False Let w be (-30)/(-9) - 1/3. Suppose z + x - 2 = 5, 2z + 14 = 5x. Let h = w + z. Is 5 a factor of h? False Does 8 divide 204 + ((-3)/12)/(3/(-48))? True Let u be (5/2)/((-3)/(-6)). Let g be 4/(u/((-15)/2)). Is (10/g)/((-2)/12) a multiple of 5? True Let i = -43 - -146. Let n = -56 + i. Is n a multiple of 18? False Suppose 2t - 74 = -2f, -t + 11 + 26 = 2f. Let m = -7 + t. Is m a multiple of 22? False Let p be 18/12 + (-3)/(-6). Suppose -p = u - 43. Does 17 divide u? False Let k = -110 - -158. Suppose -s + 29 = 2p, 3s = -5p + 2p + k. Is p a multiple of 4? False Let o = 209 + -93. Is o a multiple of 9? False Suppose 5k - 14 = x - 2x, 0 = k - 4x + 14. Does 15 divide (-1)/(k/180-2)? True Let g(v) = -v*3 - 3v*2 + 6v - 5. Let j be 156/(-36) + 4/(-6). Is 10 a factor of g(j)? False Let g(j) = -7j + 1. Let x(m) = -3m*2 - 18m - 11. Let a(u) = u*2 + 6u + 4. Let l(h) = -8a(h) - 3x(h). Let d be l(-4). Is 18 a factor of g(d)? False Suppose 5o = -5d + 145, o + 0d - 2d = 38. Suppose -3t = -t - o. Is t a multiple of 4? True Suppose 3u - 28 = 8. Suppose 144 = 2h + u. Is 20 a factor of h? False Let i(u) = -15u*2 - 5u - 31. Let h(v) = 7v2 + 3v + 15. Let l(b) = -13h(b) - 6i(b). Let k be l(-7). Suppose kq = -92 + 312. Does 18 divide q? False Suppose 3g = 2g + 3y + 9, -3g + 2y + 62 = 0. Does 8 divide g? True Let w = -6 - -32. Does 3 divide w? False Let t(j) = j*3 - 4j*2 + 2j - 6. Let k be t(4). Suppose kh = -h. Let c = 3 + h. Does 3 divide c? True Let z be (-310)/(-110) + 2/11. Let l(n) = 2n*2 - 3n + 4. Is l(z) a multiple of 13? True Suppose 5z = -4y - 15, -z - 6 = 3y + z. Suppose 3j = -yj. Suppose j = -q + 4 - 0. Is 2 a factor of q? True Suppose -5f + 2f + 3o + 168 = 0, -4f - 3o + 210 = 0. Is 18 a factor of f? True Let g = -5 + 10. Suppose -3o - 3x + 26 = o, -gx = -5o + 50. Is o a multiple of 8? True Suppose -4 = -3x - 8u + 3u, -3x = 2u - 7. Suppose -xn + 22 = -44. Is n a multiple of 10? False Let a(y) = y*3 - 2y + 3. Let c be a(3). Suppose -c = 6r - 8r. Does 12 divide r? True Let m be (35/28)/((-2)/(-8)). Suppose 3w = a + m, -2w = 3a + w - 45. Does 9 divide a? False Suppose 18 = -r - 0r - 4w, -4r = -2w - 18. Suppose 3g + 3l = 21, -rg - 1 - 15 = -4l. Suppose -p = -gt + 75, -2p = t - 2t + 39. Does 24 divide t? False Suppose m + 0m - 3v = 114, 0 = 5v - 10. Does 10 divide m? True Suppose -6c = -5w - c + 150, 3c = 4w - 116. Is 8 a factor of w? False Let p = -1 - -4. Does 2 divide p? False Let p = 35 + 114. Does 16 divide p? False Suppose -921 = -4t + 143. Suppose -2z = -0z - t. Suppose -4u + z = 5k - 2k, 0 = u + 2k - 27. Is 19 a factor of u? False Let w be (0 - 28)(-12)/7. Let f = -27 + w. Does 7 divide f? True Let s be 2/(-4) - (-3)/(-2). Let v be (3/s - -2)56. Let r = v - 17. Does 11 divide r? True Suppose 4t = 4w + 6t - 78, 4t - 90 = -5w. Is 11 a factor of w? True Suppose -3t = -5n - 277 - 459, 3t - 4n - 740 = 0. Is t a multiple of 42? True Let z be (0 + 2)(-12)/(-8). Let d(o) = 7o2 - zo*2 + 6o - 2 + 4o2 + o3 - o. Is 6 a factor of d(-7)? True Suppose -m - 3d + 9 = 0, 6d - d = 4m - 2. Let v(g) = -12g + 3g*3 + 28g - 4g2 + 3 - 15g. Is 15 a factor of v(m)? False Let u = 935 - 621. Is 13 a factor of u/6 - 1/3? True Let x be (3 - 4)(0 + 1). Let a(l) = -34l3 + l2 + l + 1. Let d be a(x). Suppose -3r = m - d, -3m + 8m = -5r + 55. Does 6 divide r? True Let j = -19 - -24. Suppose 4v = -jx + 165 - 60, -4x + 2v = -84. Is x a multiple of 5? False Let a(w) = 4 - 4 + 5w - w. Let t be a(2). Suppose b = 4o - 7o + t, -o + 31 = 2b. Is 5 a factor of b? False Is (-4)/6(-561)/22 a multiple of 7? False Let i(m) be the first derivative of -m3/3 + 9m*2/2 + m - 3. Let x be i(7). Is (3/9)/(1/x) a multiple of 5? True Let v be ((-6)/(-5))/((-2)/10). Is 4 a factor of v1/3-2? True Let t be (-4)/10(1 + -11). Suppose -p - 1 = -t. Suppose 7b - pb - 89 = -5v, 72 = 4v + 3b. Is 19 a factor of v? False Let f(o) be the third derivative of o6/120 + 7o*5/60 - 5o*4/12 + 5o*3/3 + 8o2. Let u(y) = -y3 + y*2 - 8. Let d be u(0). Is f(d) a multiple of 13? True Suppose i - 128 = -3i. Does 14 divide i? False Let o = -2 + 14. Let h = 21 - o. Is 3 a factor of h? True Let a = -62 + 149. Is a a multiple of 24? False Suppose -i = 3i - 20, 0 = 2a + 4*i -	{ "pile_set_name": "DM Mathematics" }
k + 6k)(-k*2 + 4k2 - k2). -22k3 + 2k Expand (-9 + 6 + 0)(-71 - 11o - 60 + 135). 33o - 12 Expand (-6 + 1 - 3)(2g3 - g3 - 2g*3 + (1 + 0 - 2)(3g - 6g - 3g)(-25 - 43g2 + 25)). 2072g*3 Expand (-7 - 1 + 7)(-72b3 + 11052b - 11052b) + 0b3 + b3 - 2b3 + (-2b - b + 2b)(-b*2 - 2b2 + b2). 73b3 Expand (1 - 2 - 1)(3 + 4 - 4)(-239g*4 - 272g*4 - 1089g*4). 9600g*4 Expand (-j + 2j + j)(-13 + 21 + 25) + 3j + j - 2j + 4j - 12j - 18j. 42j Expand (-3g + g - g)(g - g - 2g*3) + (0g + g*4 + 0g)(-24 + 52 + 40) + g + g4 - g + (-3g*2 + 2g*2 + 0g*2)(4 + g*2 - 4). 74g*4 Expand (0 + 5 - 4)((-s + s + s)(-3 - 2s*3 + 3) + 6978451 - 6978451 + 1573s*4). 1571s*4 Expand -11007p*5 + 1820p*5 + 920p*5 - 1433p + 2857p - 1424p + (4p - 2p - 3p)(6p4 - 2p*4 - 2p*4). -8269p*5 Expand (4h - 4h - 3h + (3 - 3 - h)(3 + 2 - 3) - h + 3h - 4h + 162h + 81h - 46h + 4h - 3h - 3h)(-1 + 4 - h + 0) + 4h + 2h*2 - 4h. -186h2 + 564h Expand (4580 - 4580 - 60n2)(19n2 + 138 - 138) + (-n + n - 2n*3)(2n + 3 - 7 + 2). -1144n*4 + 4n*3 Expand -r - 2 + 2 + (4r - 6r + r)(1 - 1 + 2) + (0 - 3 + 5)(-r + 0r + 3r) + 0r - 3r + 2r + 3r - 5 + 5 + (2 - 2 - 2r)(0 + 1 - 3) - 2r + 3r + r. 9r Expand (-2v2 - 2v*2 + 5v*2)(2v2 - 2v2 + v2) + (-609v + 42v - 9327v2 + 9325v*2)(4v2 + 0v*2 - 2v*2). -3v*4 - 1134v*3 Expand (3j + 4j - 2j)(21 - 2j + 15 - 30). -10j2 + 30j Expand (18 - 18 + 32l)((-1 + 2 + 0)(0 + 0 - l) + 96l - 34l - 17l). 1408l2 Expand (2d*2 + 2d - 2d - 5d2 + d2 + 2d2 + (d - 3 + 3)(-1 - 2d + 1) + 230d*2 + 1741d - 1741d - d2 + 3d*2 + 0d*2)(3d + 4d - 3d). 920d*3 Expand (308 + 165 + 492 + 752)(-t - 7t + t). -12019t Expand (5731 + 4536 - 716)(-3h*5 + 2h*5 + 2h*5). 9551h*5 Expand (-3c + 4 + c*2 - 3 - 3)(-78725 + 149384 - 75149). -4490c2 + 13470c + 8980 Expand (-2w + 2 - 2)(-4 + w + 4) + 0w + 0w - w*2 - 2w*2 - 21w*2 + 179w - 9 - 177w. -26w*2 + 2w - 9 Expand -4t4 + 383t - 383t + 11t*2 - 39t*4 - 11t*2 + (-5t*2 + 6t*2 - 3t*2)(0t + 2t*2 + 0t) - 2t4 + 4 - 4. -49t*4 Expand (-33t + 26t + 17t)(-3t + 0t + 2t) + (2t2 + 5t*2 - 10t*2)(3 + 2 - 4). -13t2 Expand (-28 + 64j + 13 + 13)(0 - 4 - 3 + 9)(0j2 + 0j2 - j3). -128j4 + 4j*3 Expand -966h + 22h2 + 966h + (-2 + 0 - 3)(h - 2h*2 - h). 32h*2 Expand (-4v + 2v + 0v)(3052 - 635v - 3050 - 18v + v - 3v + 3v + (1 + 1 + 0)(-v - 2 + 2)). 1308v2 - 4v Expand (1 + 2 - 4)(-189u*2 - 34u*2 - 21u*2 + (3u + 3u - 4u)(2u + 0u - 3u) - 7 - 2u2 + 7). 248u*2 Expand (0j + 3j - j)(1057j2 + 3488 - 3488). 2114j*3 Expand (-3y + 0y + y)(174y + 198y - 101y) - 7y + 4y + 5y + 3y2. -539y*2 + 2y Expand -103v4 - 186 + 186 + (13 + 10 + 4)(-3 - 3 + 7)(-2v*4 - 2v*4 + 2v*4). -157v*4 Expand (-692 - 2037 - 2054)(-2r3 + 2r - 2r). 9566r*3 Expand 3r*5 + 0r*5 - 4r5 - r5 - r*5 + 3r*5 + (2r5 + r5 - 5r5)(-1 + 1 - 2) + (-3r5 + 0r*5 - 2r*5)(-21 + 152 + 40). -851r5 Expand -6c*2 + 6c*2 + 10c*5 + (-2c4 - c4 + 4c4)(131c + 1213 - 4046 - 133c). 8c5 - 2833c*4 Expand (-14 - 5u*2 + 14)((2 - 4 - 1)(2u + 2u - 2u) - u + 5u + 5u + u + 2u + 4u)(1 - 2 - 1)(1 + 2 - 2) - u3 + u3 + 3u3. 103u*3 Expand -8x*3 + 9x*3 - 2x*3 + (-1108 + 1167 - 2801)(-3x + 3x + x*3). -2743x*3 Expand (41926 + 368y - 41926)((2 - 7 + 2)(2y4 - 2y + 2y) + 0y*3 + 2y*4 + 0y3 + (-y4 + y*4 - 2y*4)(0 + 1 + 2)). -3680y5 Expand (0i + 2i + 0i)(-10i + 4i - 40i)(82 + 0 + 296). -34776i*2 Expand (-128f + 69f + 418f)(f + 0f + f)(-6 + 1 + 0). -3590f*2 Expand -4w - 2w3 + 4w + (-8 - 12 - 34w + 18)(0w2 + 3w*2 - 2w*2). -36w*3 - 2w*2 Expand (1 - 2 - 2x - 2)(206x*2 + 210x*2 - 3 - 264x*2). -304x*3 - 456x*2 + 6x + 9 Expand (-4484z - 2752z + 686z)(3 - 1 + 0). -13100z Expand -2038k + 872k - 1455k + (4 - 1 - 2)(k + k - k). -2620k Expand ((-3 + 3 - 1)(2m*2 - 5m*2 + 2m*2) + (3m - 7m - 2m)(-258m + 95m + 98m))(2m*2 + 4m*2 - 3m*2). 1173m*4 Expand (0a + 5a - 3a)(-6a4 + 107 - a4 - 103). -14a5 + 8a Expand 9r5 - r4 - 8r*5 - 2r*4 + (0 + 0 + 2r*2)(-2 + 2r3 + 50r - 50r + 20r*2). 5r*5 + 37r*4 - 4r*2 Expand -2675f*4 + 1627f*4 + 1808f*4 + (0f*3 + 2f*3 + 3f*3)(f + 0f + 0f). 765f4 Expand (-2 + 2 + 2w*2)(4w + 2w - 5w) - 18227w*3 + 9708w*3 + 9426w*3 + 5w*3 - 2w + 2w. 914w*3 Expand (2b + 2b - 2b)(-7923b - 2879137852 + 2879137846 - 3620b). -23086b*2 - 12b Expand 91v4 - 917v*4 + 1545v*4 + (2v - 2v + v2)(-4v2 + 3v*2 + 3v2) - v4 - 3v4 + 6v*4. 723v*4 Expand (11 - 11 + 19b + 2916b)(9b4 + 5b*4 - 5b*4). 26415b*5 Expand (-2y - 1 + 1)(-y3 + y3 + 2y*3) + 568y - 568y + 31y*4 - 5y*4 + 3y*4 + 3y*2 + 4y4 + y4 + 6y4 + 5y*4. 41y*4 + 3y*2 Expand (31 - 12 + 29)(2y4 + 24y*4 + 36y*4). 2976y*4 Expand (-472n + 301n - 125n)(-2n*3 - 3n3 - n3). 1776n4 Expand (4d + 4d - 5d)(10 + 10d - 10) - 75d2 - 120d*2 + 42d*2. -123d*2 Expand (-2j + 5j - 5j)(4j + 7j - j) + 70j - 968j2 - 39j - 33j. -988j*2 - 2j Expand (-4g + 3g + 4g)(-g*2 + 1 - 1) - 5g*3 + 4g*3 + 2g*3 + (-2g - 3g + 3g)(-7 - 9 + 8)(11g2 + 16g*2 + 35g*2). 990g*3 Expand (2 + 9n - 3n - n)(-3 + 1 + 1)(-35 + 147 + 147). -1295n - 518 Expand 778b - 778b - 320b3 + (-1 + 2b*2 + 1)(4 - 4 + 2b). -316b*3 Expand (-6z - 4z + 3z + 0z + 0z - 2z + (0 + 2 - 4)(2 - 2z - 2) - 2z - 7z + 2z)(-5z*3 + 3z*3 + 4z*3). -24z*4 Expand (4k + 11k + 8k)(-2k3 + k3 + 3k3) + (k2 - 1 + 1)(-3k2 + 2k2 - k2) - k*4 - 5k*4 + 4k*4. 42k*4 Expand (-2c - 7c + 2c)(12 + 9 - 23 - 2c*2 - 25c). 14c3 + 175c*2 + 14c Expand (-4069k + 16k*2 + 4069k)(-4k*2 - 8 + 8k*2 - 6k*2). -32k*4 - 128k*2 Expand (m + 3 - 3)(-3 + 60452m - 69552m + 4 - 1 - 69499m). -78599m*2 Expand (-10d + 40d2 + 10d)(-12d - 3d - d). -640d*3 Expand (-11890 - 9015 + 18498)(0n - 2n - 2n). 9628n Expand (p - 2 + 2)(5 - 2 - 2 + 3 - 2 - 2 + 5 - 2 - 5 + 3 + 1 - 3 + (4 - 5 - 1)(-3 - 2 + 4) + 0 - 3 + 2 + 1 - 4 + 1 + 3 - 5 + 0 - 22 + 9 - 30)(4 - 4 + p). -47p*2 Expand -4404q*2 - 27262q + 27262q + (-1 - 1 + 1)(2q2 - 2q + 2q). -4406q*2 Expand (-31n*3 - 8n*3 - 21n*3)(5n + 2n - 4n) + (3 - 2 + 6)(-4n3 + 4n3 + n4). -173n4 Expand 8 + 37t + 111t - 8 - 5t - 2t + 5t + (t - 2 + 2)(-1 + 8 + 5). 158t Expand (-6t - 6t + 6t)(44t - 121t - 5t). 492t*2 Expand -h + 4h - 2h + (3 + 7h - 3)(-3 + 1 - 2) + (5h - h - 2h)(0 - 1 + 3). -23h Expand (-5z*2 + 15z*2 - 2z*2)(-z + z + 3z) - z2 + z2 - 4z*3 - 7z*3 + 12z*3 + 17z*3. 42z*3 Expand (m - 1 + 687m*2 + 2 - 698m*2 + 11m*4)(6 + 0 + 0). 66m4 - 66m*2 + 6m + 6 Expand (-2j2 + j2 - 2j*2)(-2j3 + 0j + 0j) + (-2j - 4j + 5j)(623j*4 + 68286j*2 - 68286j*2). -617j*5 Expand (3 + 0 - 1)(-2q - 2q*2 + 2q) + (q + q - 3q)(215 - 400 + 283)(77 + 6q - 77). -592q2 Expand -12q*3 + 32 + 828q*2 - 405q*2 - 423q*2 - 33q + (-4q + 4q - 2q2)(-4 + 2q + 4). -16q*3 - 33q + 32 Expand -5l2 + 4l*2 + 4l*2 - 11719 + 11719 - 802l*2 + (2 - 4 + 1)(3l - l2 - 3l). -798l2 Expand (7 - 3 - 39k - 2)(43k + 45k - 87k + 1). -39k2 - 37k + 2 Expand 3 - 3 - c*2 - 4c*2 - 3c*2 + 363 - 350 + 2c + (-2 + 0 - 3)(0c2 + c2 - 3c2) - 2c*2 + 3c2 + c2. 4c2 + 2c + 13 Expand -603c - 780c - 8504 + 8503 + (-c + 3c + 2c)(0 - 2 + 0) - 6c + 2c + 2c. -1393c - 1 Expand (-45u + 21u + 3 + 23u)(u - u - 6u). 6u2 - 18u Expand (-55469f3 + 257f - 15f4 + 55469f*3)(3f - f - 3f). 15f5 - 257f*2 Expand (-117 - 17 - 45)(0 + 0 - 2)(-3 - 1 + 1)(-5d + 5d - d). 1074d Expand 26j*4 - 88 + 88 + 0j*4 - 2j*4 + 3j4 + (j2 - 2j2 - j2)(2j - 2j - 2j2) + 4	{ "pile_set_name": "DM Mathematics" }
- o + (2 - 3 + 2)(4o + 0o - 3o) + 653o - 61o + 375o). -1938o*3 Expand (4u - 5u + 0u)(u + u - u + (-u - 4 + 4)(-3 + 0 + 1) + 3 - 3 + u)(-8 + 43 + 14). -196u2 Expand (d5 - 4d5 + d5)(0 + 2 - 1) + (-d*4 - 2d*3 + 2d*3)(127d + 322d + 103d). -554d*5 Expand (-4 + 2p + 4)(22 + 19 + 3)(-p + 2 - 2). -88p2 Expand (0l + l + 0l)(-18 + 24 + 31). 37l Expand (3 - 3 - 3x*2)(-x + 3x - 3x) - 53x + 16x*3 + 53x + (-2 - 2 + 3)(2x*3 - 4x3 - x3). 22x3 Expand (-7 + 6b*2 + 7)(-3 + 2 - 6)(b2 - 2b*2 + 5b*2). -168b*4 Expand (-3b + 3b + b3)(0b2 + 2b*2 - 4b*2) - 16b*5 + 91b*5 + 36b*5. 109b*5 Expand -5l*2 + 4l*2 + 4l*2 + (9l - 73l + 3l)(5 - 5 + 2l) + 2l2 - l2 - 3l*2. -121l*2 Expand (3 + 2 + 1)(-1 - 1 + 0)(-5o - 4o + 3o)(0 - 3 + 4) - 2o + 4o - 3o. 71o Expand (4 - 62 - 6)(-3k4 + 7k4 + k4). -320k4 Expand (-1 - 1 + 0)(z - 6z3 + 1106z*2 + 5z - 1105z2). 12z*3 - 2z*2 - 12z Expand 2j4 + 2j4 - j4 + 1729j4 - 950j*2 + 950j*2 + (0j2 - j2 + 0j2)(6j2 - 2j*2 - 2j*2). 1730j*4 Expand (3g - 4g + 2g)(2g*3 + 0g*2 + 0g2) - g4 + 50 - 137 + 72. g*4 - 15 Expand (-3i + 3i - 2i*3)(53 - 6 + 4)(-i - 3i + 2i). 204i*4 Expand 2d*2 - 2d2 - d2 + (3d + 0d - 2d)(-2d + 5d - d) + 24d2 - 3 + 101d*2 + 2584d - 2584d. 126d*2 - 3 Expand -3j*3 + 4j3 + j3 + (5j - 2j + 0j)(3 - 2j2 - 3) + 37j*2 + 6j*3 - 36j*2 + 8j*3. 10j3 + j2 Expand (0 - 1 + 0)(-y - 23y + 9y) + (-6 + 3 + 4)(-1 - 2y + 1) + 3 - 3 - 2y + 3 + 2y - 3. 13y Expand (11t - 15t - 24t)(-3t4 + 3t*4 - 2t*4) - 32t*5 - 159 + 159. 24t*5 Expand 2m*4 - 6 + 1 + 4 + (-5m + m + 0m)(0m3 + 5m*3 - 3m*3) - 4m + 4m - 5m*4. -11m*4 - 1 Expand (-c + 0c + 2c)(1 - 1 + 1 + (2 - 1 - 2)(-3 + 0 + 2) - 7 - 22 + 0 + 2 + 1 - 4 + (4 + 1 - 3)(-1 + 0 - 1) + 3 - 4 + 0) - 2 - 3c + 2. -36c Expand -5b + 2 - b + b + (-5 - 1 + 4)(0b - b - b) + (0 + 1 + 1)(b - 2b - 7b). -17b + 2 Expand (10x*4 + 4x*4 + 18x*4)(0x + 3 + 0x - 5x). -160x*5 + 96x*4 Expand 4a3 - a3 - a*3 + (-61a*3 + 94a*3 - a - a)(-3 + 2 - 2). -97a3 + 6a Expand 3r5 + 1 - 2r*5 - 2r*5 + (-101r + 101r - 21r*5)(1 + 1 + 0). -43r5 + 1 Expand (-26j + j - 24j)(-5 - j + 5 + (-j + j + j)(4 + 2 - 2)). -147j*2 Expand (-19t*2 - 24t*2 + 17t*2)(8 + 17 + 15) - t*2 - 4t*2 + 4t*2. -1041t*2 Expand (6l - 2l + l + (-1 + 0 + 2)(-l + 2l - 2l) + 4l + 16l - 8l)(2l + 3 - 3). 32l*2 Expand (-8 - 225u + 81u + 7)(-1 - 1 + 0). 288u + 2 Expand (2 + 3 - 4)(-7k - 4k*4 + 46k - 40k - 6k*2). -4k*4 - 6k*2 - k Expand (-60r*2 - 18270 + 18270)(1 + 3 - 2)(-1 - 2 - 1)(r - 3r + 3r). 480r3 Expand -3z*3 + 5z*3 - 5z*3 + (0z*3 + 0z3 + z3)(-3 + 3 + 2) + 2z3 + z3 - 2z3 + (0z + z - 3z)(2z2 + 2z*2 - 2z*2). -4z*3 Expand (-2o + 2o + 3o)(-37o*2 + 109o - 109o) + 2o3 - o2 + o*2. -109o3 Expand (-g4 - 3g4 + 2g*4)(-76g - 5g - 502g). 1166g*5 Expand (5 - 2r*2 - 5)(26r + 36r + 58r + (-3 + 5 + 0)(0r + r - 3r)). -232r3 Expand -a4 + 1 - 2 + 0a*4 + (-3a*2 + 5a*2 - 4a*2)(5a2 - 4a2 + a2). -5a4 - 1 Expand (2 - 2 + 1)(137 - 97d2 - 137). -97d*2 Expand (4a + 1 - 1)(-14a - 11a + 0a)(3 + 4 - 6). -100a*2 Expand (-5 - 4 + 2)(-5 + 2 - 2)(3t*5 + 2t - 2t). 105t*5 Expand ((-5w + 2w + 2w)(-2w + 3w + w) + (-40 + 40 + 8w*2)(4 + 9 - 1))(5 - 3 - 4). -188w*2 Expand (1 + 4 + 1 + (0 + 3 - 1)(3 + 0 - 1))(-7g + g - 3g). -90g Expand ((-1 + 1 + 2)(-5 + 6 + 6) + 4 + 0 + 10)(3u2 - 5u2 + u2). -28u2 Expand (3n + 0n - n)(n - 3 + 3) + 6151n2 + 3 - 6178n*2 + 3. -25n*2 + 6 Expand 11a*4 + 31a*4 - 76a*4 + (4 + 2a*3 - 4)(2a - 4a + 0a) + ((5 + 0 - 4)(3a - a - a) - 2a + 6a - 3a)(3a - 3a - a3). -40a*4 Expand (-4 + 3 - 1)(-373 + 88 + 44)(4 - b - 4 + 1). -482b + 482 Expand 659u + 957u - 967u + (0u + u + u)(1 + 2 - 5) + 4u - 3u + 0u. 646u Expand 2r - r*2 - 2r + (0r2 - 3r2 + r2)(-22 + 0 + 3) + 0 + 0 + 2r*2. 39r*2 Expand (0i*3 + 2i*3 + 1 + 7)(3i - 5i - i)(-3i + i + 0i). 12i*5 + 48i*2 Expand (0i + i + i)(0i + 3i + 2i)(11i - 11i - 84i). -840i3 Expand ((-4o*3 + 2o3 - o3)(o + 7o - 4o) + o4 - 2o*4 - 4o*4)(-o + 3o + 0o). -34o5 Expand (0 + 0 - 2g*3 + (-2g*2 - g + g)(2g + 3g - 2g) - g3 + 2g - 2g)((2g + 3g - 3g)(-2 + 1 + 0) - 1 - 5g + 1 + 5g - 4g - 2g). 72g4 Expand (-3 - 5d + 3d - 1)(0 - 3d + 0 + (-1 + 1 + 2)(-5d + 2d + 5d) - 2d + 0d + 4d + (1 - 1 + 14d)(4 - 2 + 0)). -62d2 - 124d Expand 3q - 2q + 0q + (-q - q + 3q)(5 - 1 - 2) - 2q - 2 + 2 - 3q - 3q + 7q + (2 + 4 - 1)(0q - 3q + 2q)(6 - 6 + 7). -33q Expand (6n*2 - 2n*2 - 3n*2)(3n - 3n + n) + n3 + n2 - n*2 - 27 - 15n*3 - 2n*2 + 27. -13n*3 - 2n*2 Expand (3b*4 + 2b*4 - 6b*4)(-7 + 7 + 3b) + (-5b*3 + 9b*3 - 2b*3)(-3b2 + 7b*2 - 2b*2) + 0b*5 + 2b*5 + 2b*5. 5b*5 Expand 2i*2 - 2i2 + i2 + (4i - 5i - i)(-3i + 4i - 2i) + (1 - i - 1)(-28i + 8i + 8i). 15i2 Expand (-5g + 2g + 5g)(8 - 22 - 33)(2 + 0 - 3). 94g Expand (-3 - 3 + 4)(1 - 3 + 1)(11 - 11 - 3z*2). -6z*2 Expand (-2 - 3 + 1)(-2h2 + 0h + 0h) + (-2h*2 - 2h*2 + 2h*2)(-1 + 1 - 2). 12h2 Expand (-3 + f + 3)((3f + 4f - 5f)(5f + 5f - 4f) + 0f*2 + 2f2 - f2). 13f3 Expand (58u - 180u - 100u - u)(u3 - 4u*3 + 4u*3). -223u*4 Expand (x + 2x + 0x + (23x + 90 - 90)(-2 + 1 + 2))(16x3 - 3x*2 - 14x*3 - 2x*4 + 0x*2). -52x*5 + 52x*4 - 78x*3 Expand (-8 + 3 + 3)(-b + 3 - 3) + 0b + 0b - b - 126b + 62 - 62 + (6b - 2b - 3b)(-1 + 5 - 2) + 2b + 3 - 3. -121b Expand (-2r - 2r4 + 2r)(-2 - 1 + 1)(976 - 603 - 597). -896r4 Expand (2z*3 + 4z*3 + 0z*3)(1 + 3 + 1)(2 - 3 + 2)(0z - z + 2z). 30z4 Expand -3t*3 + 3t*3 + 2t*3 + (t + 3t - 2t)(-t*2 + 2t2 + t2) - 3t3 + 2 - 2 - 123t*3 - 203t + 203t. -120t*3 Expand 0o*2 + 0o2 + o2 + (5o - 8o - 5o)(1 - o - 1) + (-1 + 2 + 0)(-5o2 + o2 + o*2) + (-2o + 2o - o)(-o - 3o + 3o). 7o2 Expand (-3q*2 + 0q2 + q2 + (4q - 2q + 2q)(4q - q - q))(-2q3 + 2q*3 - 3q*3) + (-2 - 2 + 5)(0 - 2q5 + 0) + 3q5 + q4 - q*4. -17q*5 Expand (0s*4 - 5s*4 + 3s*4)(3s + 0s - 2s + (2s - s + 2s)(2 - 4 + 3)) + (-8 - 1 - 2)(0s5 + s5 + 0s5). -19s5 Expand (i3 + 3i3 - 5i*3)(-i - 2i + 4i) + 11i4 + 3i*4 - 75i*4. -62i4 Expand -m2 - m*2 + 3m*2 + (0m + 0m + 3m)(m + m - 4m) - m + 0 + 2 - m*2 - 1. -6m*2 - m + 1 Expand ((-2 + 2 + 3o)(0 - 1 + 0) + 14o - 16o + 16o)(-3o - 1 + 1). -33o2 Expand -f4 - 3f*4 + 5f*4 + (-4 + 1 + 0)(-f*4 - 2f*4 + 2f*4) + (233f - 233f + 21f*4)(6 + 5 - 6). 109f4 Expand (-10 + 10 - 2y)(-9y - 11y + y). 38y*2 Expand (-9f + 16f + 2 - 8f)(f + 9 - 9). -f2 + 2f Expand (-5 + 0 + 3 + (1 + 0 - 2)(-4 + 3 + 3))(5i - 3i - 4i)(-i2 + i2 + 2i3). 16i*4 Expand 43y*4 + 11y - 11y + (4y*2 + 3y*2 + 0y*2 + (-2 + 2y*2 + 2)(2 - 5 + 2))(-2 - 3y*2 + 2). 28y*4 Expand (-2p - 3p - 2p)(34p*2 + 17p - 17p). -238p*3 Expand -4944r*5 + 1363r*4 - 2r - 1363r4 + 2r + (3r3 - 2r*4 - 3r*3)(-2 + 2 + 2r). -4948r*5 Expand (2h*5 - 2h5 + h5)(-1704 - 569 - 1275 - 1741). -5289h*5 Expand (-598o - 207o + 213o)(0 + 0 + 2). -1184o Expand ((-1 + 1 - 2)(3 - 5 + 3) + 4 - 3 - 3)(0i + 3i + 0i - 3i - i + i + (-1 + 1 - 1)(-i + i + i) + i + i + 0i)(-7 - 1 - 2). 40i Expand -41s3 - 2s + 21s3 - 84s*3 + (-2s - 2 + 2)(-2s + 2s - 3s*2). -98s*3 - 2s Expand (3 + 2 - 3)(-3l*5 - 3l*5 + 31l*5) + 3l*5 + 0l*5 - 2l*5. 51l*5 Expand 0i*3 - 2i*3 + 2i*5 - 4i*5 - 37i*5 + 29i*5 - 54i*5 + (2i - 1 + 1)(4i4 + i4 - 4i4). -62i*5 - 2i*3 Expand 2i - 2i - 6i + (2 - 2 - i)(-2 - 10 - 4). 10i Expand (4w + 4 - 7 - 3w)(2w*3 + 8w - 8w). 2w**4 -	{ "pile_set_name": "DM Mathematics" }
ulate s(-1). 48 Let j(a) = -106a + 572. Determine j(5). 42 Let y(c) = -10c - 316. Give y(-45). 134 Let b(u) = -45u + 277. Give b(6). 7 Let n(g) = 61g - 152. Give n(-7). -579 Let b(p) = p*2 - 2942p + 113207. Give b(39). -10 Let s(q) = 2q3 - 19q*2 + 96q - 2444. Calculate s(13). -13 Let c(q) = -2q2 - 35q - 43. Determine c(-16). 5 Let r(q) = q*3 + 8q*2 + 99q + 511. Determine r(-6). -11 Let x(u) = 116u2 - 5567u - 58. Determine x(48). -10 Let r(n) = -64n - 3474. Calculate r(-54). -18 Let v(k) = 3k*3 + 2k*2 - 7k + 10. What is v(-3)? -32 Let c(u) = 5294u + 47639. Give c(-9). -7 Let z(n) = n2 + 29n + 6. Calculate z(-26). -72 Let x(y) = 59y - 411. What is x(7)? 2 Let r(q) = -4q - 826. Calculate r(-58). -594 Let c(o) = -o*2 - 1079o + 2. Determine c(0). 2 Let a(q) = -88q - 3528. Calculate a(-40). -8 Let m(u) = 46u + 155. What is m(-4)? -29 Let j(v) = -v*3 - 82v*2 - 103v - 1776. Determine j(-81). 6 Let j(a) = 41a + 360. Give j(-10). -50 Let u(l) = 2l*3 + 65l*2 - 35l - 15. Calculate u(-33). 51 Let q(r) = 11r2 - 13r - 324. Calculate q(6). -6 Let z(d) = d*2 - 829d + 827. Determine z(1). -1 Let v(b) = -7b2 + 1888b - 1349. Determine v(269). -4 Let k(p) = -3p - 95. Determine k(-20). -35 Let w(r) = -707r + 22. Calculate w(-1). 729 Let f(b) = 173b + 28383. Calculate f(-164). 11 Let n(s) = -s2 - 8s + 749. Calculate n(23). 36 Let q(n) = -n*3 - 41n*2 - 90n - 2026. Calculate q(-40). -26 Let p(s) = -18s + 451. Calculate p(24). 19 Let d(s) = -160s - 974. Give d(-6). -14 Let a(p) = -5p3 + 85p*2 + 192p - 41. Calculate a(19). -3 Let m(z) = -31z3 - 86z*2 + 22z + 3. What is m(-3)? 0 Let j(r) = -r*3 + 9r*2 + 10r + 269. Calculate j(11). 137 Let i(q) = -5599q - 106382. Give i(-19). -1 Let x(d) = -d3 - 37d*2 - 75d - 47. Calculate x(-35). 128 Let y(i) = -i*3 - 4i*2 + i + 36. Give y(-4). 32 Let f(a) = 19a - 2811. Determine f(148). 1 Let w(a) = 235a - 3065. Calculate w(13). -10 Let j(t) = t3 - 29t*2 + 49t + 71. What is j(27)? -64 Let o(u) = 8u2 + 2u - 13. Calculate o(2). 23 Let z(b) = 2b2 - 14b - 158. Determine z(16). 130 Let c(w) = -9798w - 19592. Give c(-2). 4 Let r(x) = 3x*2 + 93x - 48. Give r(-31). -48 Let y(c) = -c*3 + 11c*2 - 12c - 57. Determine y(9). -3 Let a(p) = p*3 + 5p*2 + 11p + 23. Calculate a(-3). 8 Let f(r) = -r*3 + 5r*2 - 7r + 7. Determine f(3). 4 Let o(j) = j*3 - 3j*2 - 4j + 13. Calculate o(2). 1 Let g(t) = t*2 - 18t - 1004. Determine g(42). 4 Let q(t) = -10t3 - 756t*2 + 305t + 72. Give q(-76). -4 Let w(s) = 30s + 2183. Determine w(-76). -97 Let m(z) = -91z - 609. Calculate m(-7). 28 Let w(p) = 5p2 - 270p + 184. Give w(53). -81 Let q(c) = -2200c - 2179. Give q(-1). 21 Let o(k) = k2 - 20k + 57. What is o(13)? -34 Let p(w) = -94w2 + 1495w + 136. What is p(16)? -8 Let u(n) = 546n - 5986. Give u(11). 20 Let k(x) = -x2 + 40x + 61. What is k(45)? -164 Let p(w) = 23w + 48. Give p(-4). -44 Let a(c) = 183c - 2090. What is a(13)? 289 Let z(p) = -2p2 + 27p. Calculate z(15). -45 Let l(f) = 32f2 - 5502f - 349. Determine l(172). -5 Let x(n) = n*2 + 592n - 9045. Calculate x(15). 60 Let o(d) = -245d - 30. What is o(1)? -275 Let p(t) = -102t3 - t + 6. Determine p(-2). 824 Let j(d) = -d3 + 30d2 - 88d + 185. Determine j(27). -4 Let l(x) = -7x - 30. What is l(12)? -114 Let m(g) = 3g*3 + 14g*2 - 3g - 9. Give m(-5). -19 Let g(i) = -3i2 - 57i - 57. Calculate g(-18). -3 Let c(u) = 2u3 + 17u*2 + 10u - 16. What is c(-8)? -32 Let c(k) = -53k - 23. Calculate c(-6). 295 Let g(t) = t2 - 21t + 64. Give g(4). -4 Let k(y) = y*2 + 55y - 508. Determine k(-63). -4 Let q(z) = -4398z - 21994. Give q(-5). -4 Let g(h) = -10h - 1. Give g(6). -61 Let c(u) = -u*3 + 16u*2 + 57u - 161. Give c(2). 9 Let s(r) = 79r - 368. Determine s(0). -368 Let c(t) = 105t*2 - 403t - 75. What is c(4)? -7 Let n(g) = 26g2 - 2448g + 370. Calculate n(94). -6 Let z(t) = 9030t - 36107. Calculate z(4). 13 Let t(y) = 64y + 2164. Calculate t(-31). 180 Let n(h) = 1278h + 8923. Give n(-7). -23 Let x(i) = 80i + 2454. Calculate x(-29). 134 Let v(d) = -d*3 + 7d*2 + 25d + 10. Give v(10). -40 Let y(x) = 2x3 - 49x*2 - 25x + 15. Give y(25). 15 Let x(f) = -f*2 - 130f - 272. Determine x(-128). -16 Let g(s) = -s*3 - 16s*2 + 351s - 42. Give g(12). 138 Let r(g) = -1055g2 + 9490g + 31. Calculate r(9). -14 Let d(l) = -l*2 + 35l - 132. Give d(4). -8 Let o(w) = 58w2 - 164w + 9. Calculate o(3). 39 Let l(s) = 469s - 5637. Calculate l(12). -9 Let y(f) = -f3 - 33f*2 + 28f - 175. What is y(-34)? 29 Let o(m) = -2m2 + 334m - 1936. Give o(6). -4 Let g(i) = -26i2 + 13i + 15. Determine g(4). -349 Let i(j) = 4j2 + 9j - 15. Determine i(-3). -6 Let y(u) = 977u - 8588. Determine y(9). 205 Let t(z) = -z3 - 10z*2 + 39z - 4. Calculate t(-13). -4 Let v(g) = 3g3 - 32g*2 - 2g + 15. Give v(5). -420 Let a(j) = 5j3 - 30j*2 + 10j - 51. Calculate a(6). 9 Let r(l) = -l*3 - 31l*2 + 217l - 236. Determine r(-37). -51 Let g(b) = -2b2 + 202b + 33816. Calculate g(190). -4 Let d(x) = -277x + 32411. Calculate d(117). 2 Let b(q) = q3 - q2 - 8q + 31. What is b(4)? 47 Let j(i) = 150i + 13244. What is j(-88)? 44 Let i(n) = -n2 - 34n + 12. Determine i(-25). 237 Let a(o) = 20o2 - 19o - 67. What is a(-3)? 170 Let h(w) = -35w - 20. Determine h(-2). 50 Let m(p) = -p3 - 66p*2 - 65p + 32. Determine m(-65). 32 Let f(w) = w*2 - 244w + 730. Determine f(3). 7 Let a(m) = m*2 + 39m - 824. Determine a(15). -14 Let v(k) = -2k3 + 3k*2 - 2k - 7. Give v(3). -40 Let w(s) = 126s + 1902. Calculate w(-15). 12 Let v(r) = r3 + 58r*2 + 64r + 240. Determine v(-57). -159 Let o(l) = 5l2 - 10l - 159. What is o(-8)? 241 Let w(a) = -a*3 - 29a*2 - 23a + 146. Give w(-28). 6 Let x(h) = h*3 - 3h*2 - 303h + 1740. What is x(6)? 30 Let v(h) = h*3 - 57h*2 + 150h + 650. Calculate v(54). 2 Let j(z) = 2z2 + 9z - 167. Determine j(7). -6 Let c(u) = -23u3 - 8u*2 - 4u + 3. Determine c(0). 3 Let l(y) = y*2 + 39y - 270. Calculate l(10). 220 Let d(b) = 2b3 + 11b*2 - 6b + 7. Determine d(-6). 7 Let w(o) = -14o2 + 14o + 54. Determine w(6). -366 Let m(t) = 1153t + 106087. What is m(-92)? 11 Let v(d) = -2d*3 - 27d*2 - 32d + 113. Give v(-11). -140 Let v(z) = 5z2 + 56z - 288. What is v(-15)? -3 Let o(v) = 7v3 - 3v*2 + 15v - 33. Calculate o(2). 41 Let z(w) = w*2 + 5537w - 381136. Determine z(68). 4 Let g(d) = 4d2 + 20d - 205. Determine g(-10). -5 Let g(f) = -3f3 + f2 - 5f + 10. What is g(-3)? 115 Let w(j) = -2j2 - 38j - 128. Determine w(-9). 52 Let s(x) = -158x + 5. Give s(0). 5 Let y(j) = -18j*2 - 9j - 3. What is y(-3)? -138 Let i(q) = q*3 - 18q*2 + 46q + 47. Give i(13). -200 Let t(v) = -4v2 - 2v + 12. What is t(-3)? -18 Let g(y) = -9y3 + 6y*2 + 2y + 3. What is g(3)? -180 Let a(b) = b*3 - 8b*2 + 75b - 486. What is a(7)? -10 Let p(b) = -40b2 + 996b + 72. Determine p(25). -28 Let k(b) = 211b - 408. What is k(2)? 14 Let q(j) = j3 + 10j*2 - 15j + 27. Determine q(4). 191 Let s(p) = p*2 + 66p + 19. Calculate s(-67). 86 Let w(j) = -19j + 18. Give w(40). -742 Let a(x) = -x3 - 2x*2 + 81x + 17. Give a(0). 17 Let p(a) = 250a - 21994. Give p(88). 6 Let l(d) = -4d - 62. What is l(-14)? -6 Let z(p) = p*2 + 28p + 226. What is z(-14)? 30 Let j(i) = 13i2 - 416i - 24. Give j(32). -24 Let q(w) = -341w + 2679. Calculate q(8). -49 Let d(n) = 243n - 2320. Determine d(10). 110 Let l(j) = -8j2 + 85j + 49. Determine l(11). 16 Let a(g) = 2g2 - 95g + 1118. Calculate a(22). -4 Let i(d) = 506d + 4989. What is i(-10)? -71 Let j(i) = 138i + 3481. Give j(-25). 31 Let i(q) = -236q - 4966. Give i(-21). -10 Let d(j) = -10j + 216. Determine d(2). 196 Let w(b) = -2b3 + 24b*2 + 12b - 28. Give w(12). 116 Let y(d) = -d*3 + 678d*2 - 2033d + 9. Calculate y(3). -15 Let y(j) = -38j + 37. Give y(1). -1 Let n(a) = -2a*3 - 36a*2 + 68a + 14. Calculate n(-20). 254 Let t(g) = -4g3 + 5g*2 - 8g + 14. Determine t(2). -14 Let y(w) = -12w + 232. Determine y(35). -188 Let q(t) = -t3 - 6t*2 - 2t + 14. Give q(-5). -1 Let	{ "pile_set_name": "DM Mathematics" }
tiple of 11? True Is 15 a factor of 2610? True Is 4927 a multiple of 103? False Does 2 divide 1541? False Is 21 a factor of 1445? False Is 96 a factor of 1728? True Is 7344 a multiple of 27? True Does 2 divide 271? False Does 21 divide 2331? True Is 4921 a multiple of 19? True Does 62 divide 1288? False Is 5 a factor of 3400? True Is 399 a multiple of 3? True Is 110 a factor of 12775? False Is 178 a multiple of 57? False Is 22299 a multiple of 128? False Is 1059 a multiple of 4? False Is 86 a factor of 9546? True Does 9 divide 207? True Is 1219 a multiple of 23? True Is 3 a factor of 2233? False Is 1440 a multiple of 96? True Is 5304 a multiple of 34? True Is 16 a factor of 9877? False Is 9 a factor of 100? False Does 312 divide 96720? True Is 26 a factor of 33358? True Does 44 divide 1144? True Does 8 divide 40208? True Does 122 divide 50221? False Does 13 divide 1050? False Is 2925 a multiple of 93? False Is 54 a factor of 42336? True Does 21 divide 5670? True Is 45 a factor of 11864? False Is 59 a factor of 10887? False Is 2120 a multiple of 20? True Is 8 a factor of 2111? False Does 70 divide 1120? True Is 21 a factor of 63? True Is 3 a factor of 2544? True Is 2299 a multiple of 11? True Does 2 divide 497? False Is 1031 a multiple of 52? False Is 57 a factor of 26260? False Is 6 a factor of 1584? True Is 12 a factor of 485? False Is 15447 a multiple of 126? False Does 36 divide 2268? True Is 7530 a multiple of 19? False Is 6996 a multiple of 106? True Does 5 divide 12815? True Is 3683 a multiple of 4? False Is 26 a factor of 6240? True Is 1362 a multiple of 65? False Is 22 a factor of 8822? True Is 33 a factor of 660? True Is 8 a factor of 88? True Is 2153 a multiple of 10? False Does 79 divide 19338? False Is 2 a factor of 9? False Does 43 divide 1375? False Is 6 a factor of 3342? True Does 15 divide 31753? False Is 11856 a multiple of 11? False Is 28 a factor of 19377? False Does 5 divide 211? False Is 5898 a multiple of 7? False Is 59 a multiple of 8? False Is 10 a factor of 975? False Is 6 a factor of 2265? False Does 8 divide 10176? True Is 93 a factor of 15754? False Is 10006 a multiple of 21? False Is 15 a factor of 5025? True Does 18 divide 267? False Does 27 divide 13347? False Is 13 a factor of 562? False Is 22 a factor of 1606? True Is 75 a factor of 4200? True Does 27 divide 375? False Is 15 a factor of 520? False Does 240 divide 96913? False Is 65 a factor of 1616? False Is 10098 a multiple of 66? True Is 12 a factor of 11551? False Does 17 divide 4547? False Does 8 divide 6130? False Does 38 divide 18398? False Is 23 a factor of 12538? False Does 47 divide 6956? True Does 265 divide 104678? False Is 11684 a multiple of 92? True Is 709 a multiple of 13? False Is 1750 a multiple of 35? True Is 1867 a multiple of 26? False Does 14 divide 2856? True Is 784 a multiple of 20? False Is 5000 a multiple of 100? True Does 16 divide 1832? False Is 5691 a multiple of 27? False Does 5 divide 329? False Is 2544 a multiple of 12? True Is 24 a factor of 4207? False Does 9 divide 2727? True Does 293 divide 49090? False Does 33 divide 18637? False Does 38 divide 4645? False Is 49 a factor of 19404? True Is 28 a factor of 560? True Does 25 divide 17325? True Is 20 a factor of 14950? False Is 22 a factor of 37774? True Does 20 divide 180? True Does 132 divide 17939? False Does 21 divide 3694? False Does 17 divide 3264? True Is 36 a factor of 2572? False Is 32928 a multiple of 8? True Is 5 a factor of 4598? False Is 766 a multiple of 16? False Is 11 a factor of 833? False Is 31 a factor of 186? True Does 2 divide 754? True Does 18 divide 9072? True Does 5 divide 389? False Is 15 a factor of 1858? False Does 13 divide 702? True Does 38 divide 1581? False Does 21 divide 126? True Does 2 divide 1879? False Does 8 divide 9046? False Does 26 divide 60? False Does 14 divide 22438? False Is 27 a factor of 1492? False Is 13 a factor of 251? False Is 3962 a multiple of 10? False Does 6 divide 37091? False Does 16 divide 2279? False Is 24058 a multiple of 46? True Is 203 a multiple of 3? False Does 45 divide 40860? True Is 21 a factor of 651? True Does 107 divide 963? True Is 21 a factor of 767? False Does 12 divide 216? True Is 12588 a multiple of 59? False Does 8 divide 3808? True Is 3 a factor of 993? True Is 15 a factor of 10481? False Is 211 a factor of 8128? False Is 20 a factor of 1000? True Does 154 divide 4891? False Does 122 divide 3050? True Is 1040 a multiple of 20? True Is 26 a factor of 779? False Does 25 divide 33127? False Is 23444 a multiple of 3? False Is 669 a multiple of 61? False Does 17 divide 8042? False Does 19 divide 11384? False Is 6200 a multiple of 25? True Is 9 a factor of 25354? False Is 10 a factor of 632? False Does 3 divide 106? False Is 213 a multiple of 3? True Is 58 a factor of 8049? False Is 27 a factor of 10789? False Is 3005 a multiple of 19? False Is 1356 a multiple of 72? False Is 121 a factor of 2057? True Does 26 divide 1083? False Is 17 a factor of 17544? True Is 641 a multiple of 15? False Is 25 a factor of 1600? True Does 77 divide 898? False Does 86 divide 11524? True Does 31 divide 1541? False Is 20 a factor of 8264? False Is 153 a multiple of 9? True Does 178 divide 41343? False Is 969 a multiple of 17? True Is 2622 a multiple of 5? False Is 15655 a multiple of 37? False Is 5778 a multiple of 107? True Is 12412 a multiple of 33? False Does 37 divide 2035? True Is 37 a factor of 42772? True Is 1389 a multiple of 41? False Is 33 a factor of 297? True Is 1370 a multiple of 13? False Is 199 a multiple of 17? False Is 448 a multiple of 10? False Is 2091 a multiple of 17? True Is 2 a factor of 899? False Does 15 divide 8104? False Is 312 a multiple of 3? True Is 169 a factor of 2425? False Is 14756 a multiple of 34? True Does 26 divide 988? True Does 6 divide 24? True Is 53 a factor of 9485? False Is 21 a factor of 2771? False Is 15 a factor of 3825? True Does 6 divide 2380? False Does 63 divide 14863? False Is 5280 a multiple of 40? True Is 9479 a multiple of 172? False Is 34 a factor of 12104? True Is 49 a factor of 2597? True Is 3767 a multiple of 3? False Is 79 a factor of 3746? False Is 427 a multiple of 33? False Does 28 divide 9807? False Does 11 divide 1518? True Does 12 divide 50058? False Is 841 a multiple of 29? True Is 3785 a multiple of 17? False Does 33 divide 1108? False Is 15 a factor of 2940? True Does 34 divide 46896? False Is 15 a factor of 4875? True Does 13 divide 1315? False Does 22 divide 3278? True Does 6 divide 1492? False Is 13882 a multiple of 27? False Is 110280 a multiple of 24? True Is 3353 a multiple of 6? False Does 5 divide 230? True Is 5 a factor of 1180? True Does 8 divide 568? True Is 593 a multiple of 21? False Is 32 a factor of 270? False Does 46 divide 1231? False Does 48 divide 11853? False Does 132 divide 6642? False Does 260 divide 88920? True Is 49 a factor of 735? True Is 2 a factor of 442? True Is 52215 a multiple of 15? True Is 15 a multiple of 3? True Is 100496 a multiple of 44? True Does 36 divide 27246? False Is 43 a factor of 3271? False Is 742 a multiple of 19? False Is 17 a factor of 493? True Is 4687 a multiple of 46? False Does 49 divide 196? True Is 23 a factor of 439? False Is 26 a factor of 338? True Is 49 a factor of 229? False Is 7 a factor of 602? True Does 7 divide 497? True Is 99 a factor of 24392? False Is 6118 a multiple of 46? True Is 28 a factor of 16626? False Is 1400 a multiple of 55? False Is 143 a multiple of 2? False Does 118 divide 48144? True Is 393 a factor of 72703? False Does 2 divide 86? True Is 6 a factor of 723? False Is 1232 a multiple of 7? True Is 32 a factor of 17184? True Is 33 a factor of 792? True Is 246 a multiple of 15? False Is 17 a factor of 11966? False Does 13 divide 1794? True Does 17 divide 3123? False Does 22 divide 2112? True Is 2 a factor of 9606? True Is 16 a factor of 32? True Is 504 a multiple of 24? True Is 3156 a multiple of 12? True Is 11 a factor of 2167? True Is 31 a factor of 1220? False Does 53 divide 265? True Does 73 divide 2190? True Is 16 a factor of 239? False Does 87 divide 56426? False Is 63 a factor of 7246? False Does 5 divide 365? True Does 7 divide 5733? True Is 21041 a multiple of 56? False D	{ "pile_set_name": "DM Mathematics" }
est value? (a) 2/15 (b) -18 (c) 0.1 b Which is the fifth biggest value? (a) 4 (b) -0.044 (c) 0 (d) 3/7 (e) -2 e Which is the second biggest value? (a) 2 (b) -45 (c) 0.1 c Which is the smallest value? (a) -5 (b) 12 (c) 1/22 a Which is the fourth biggest value? (a) 1 (b) -1/15 (c) -0.4 (d) -14 (e) -2/3 e What is the second biggest value in -2, -0.01, -1/2? -1/2 What is the second biggest value in -5, 0, -0.4? -0.4 What is the biggest value in -1/3, -11, 0.39? 0.39 Which is the third smallest value? (a) -0.023 (b) 4/5 (c) 3 c Which is the third biggest value? (a) -1/2 (b) -1/5 (c) 1.3 a Which is the biggest value? (a) 68 (b) -1 (c) 1.7 a What is the fourth smallest value in -4, 0.24, -5, 1/3? 1/3 Which is the second smallest value? (a) 5 (b) -1237 (c) 0.5 c What is the biggest value in -0.01, 0, 0.3, 4? 4 Which is the second smallest value? (a) 360 (b) 0.2 (c) 0.9 c What is the third biggest value in 0.3, 3/274, 5? 3/274 Which is the third smallest value? (a) 2/15 (b) -4 (c) 2/369 (d) -0.1 (e) 2/3 c Which is the fourth smallest value? (a) -1/4 (b) 0.05 (c) -7 (d) 1/4 (e) 0.1 e What is the fourth smallest value in -10, 2, -0.2, -2, 0.5? 0.5 Which is the biggest value? (a) 0.5 (b) 11 (c) 3/5 (d) -45 b What is the fifth smallest value in -12/29, 3/5, -1, -2.7, -3? 3/5 What is the fifth smallest value in 0.5, 0, 10, 0.2, 5? 10 Which is the smallest value? (a) 0.01 (b) 3 (c) 0.4 (d) 4 a Which is the smallest value? (a) -0.08 (b) 12 (c) -1/6 (d) -3 (e) 1 d Which is the third biggest value? (a) -474 (b) 2/7 (c) -1 (d) -2 d Which is the second smallest value? (a) 4/5 (b) 2 (c) -56 (d) -0.1 d What is the fourth biggest value in 289, -1, 3/8, -3, -2/9? -1 Which is the third biggest value? (a) -1/4 (b) -5 (c) -2/13 b What is the fourth biggest value in 0.2, -1, -0.01, 5? -1 Which is the smallest value? (a) -1/6 (b) -0.3 (c) -1/4 (d) 1/6 b What is the fourth biggest value in -1, -4, -16, -2/3? -16 What is the second smallest value in 4, -0.1, -4, -5.4, 7/5? -4 What is the biggest value in -5.8, 1/2, 2/21? 1/2 Which is the second biggest value? (a) -25 (b) 2/3 (c) 2 b Which is the second biggest value? (a) 0.4 (b) 1 (c) -0.84 a Which is the second biggest value? (a) 3 (b) -2/112555 (c) -1 b Which is the smallest value? (a) -1 (b) 0.5 (c) -5 (d) -2 (e) -12/19 c What is the third biggest value in -2, -1.2, -0.3, 0? -1.2 Which is the second smallest value? (a) 9 (b) 4 (c) -1/14 (d) 2 d What is the second biggest value in -0.04, -16, 0.1, 3/4? 0.1 Which is the fourth biggest value? (a) -0.1 (b) -8 (c) -1 (d) 2/23 (e) 3/2 c Which is the second smallest value? (a) 2/13 (b) -16 (c) 2/9 (d) 2 a Which is the third smallest value? (a) -7 (b) -0.1 (c) -81 b What is the biggest value in -2/13, -0.1, 3/8, 3/7, 1.2? 1.2 What is the second biggest value in -1, -14, -5, 3? -1 Which is the fourth biggest value? (a) 2/3 (b) 45/7 (c) 1 (d) 3 a What is the fourth smallest value in 203, -2/9, 0.06, -1/3? 203 Which is the second smallest value? (a) -4 (b) 324 (c) -3 c Which is the third smallest value? (a) 11 (b) -4.2 (c) -1 a Which is the second smallest value? (a) -0.9 (b) 0.07 (c) 2 (d) 5 b What is the fourth biggest value in 14, -1, -0.4, 3? -1 Which is the second biggest value? (a) -2/163 (b) 1/3 (c) -3 a Which is the second biggest value? (a) 2 (b) -42 (c) -5 (d) 0.5 d What is the second biggest value in -4/7, 5, 7? 5 Which is the second smallest value? (a) 0.2 (b) -0.12 (c) 1/4 (d) -0.4 b What is the smallest value in 116, 3, 0.1? 0.1 Which is the smallest value? (a) 0.4 (b) 0.35 (c) -1 (d) -5 (e) 3 d Which is the third smallest value? (a) -4 (b) 0.4 (c) 0.019 b Which is the smallest value? (a) 4/7 (b) 53 (c) 0.09 c What is the second biggest value in -2, 1.2, 0.1? 0.1 Which is the biggest value? (a) 0.03 (b) -6.4 (c) -2/5 a What is the biggest value in 0.5, 15, 1/7? 15 Which is the biggest value? (a) -1 (b) -38 (c) 0.14 c What is the second smallest value in -2/199, 16, -5? -2/199 What is the biggest value in -0.2, -14/5, 0.4, -1/3? 0.4 What is the smallest value in 1/5, -3, 4, -10/7? -3 What is the biggest value in -3, -0.3, 21? 21 Which is the second smallest value? (a) -2 (b) -3 (c) -1.55 a Which is the smallest value? (a) -0.06 (b) -5 (c) 1 (d) 1/2 b What is the third smallest value in -4, -24, -3.5? -3.5 What is the fourth biggest value in 0.3, 3, 23, -0.2, 4? 0.3 Which is the third biggest value? (a) -0.2 (b) -0.01 (c) 17 (d) -1/2 a Which is the biggest value? (a) 31 (b) -2/9 (c) -0.5 a What is the third biggest value in 17, -2, 1/8, 0, -5? 0 What is the second biggest value in -0.2, 5, -8, 4? 4 What is the third smallest value in -27, 1/2, -2, 0? 0 What is the third biggest value in -36/5, -0.3, -5? -36/5 What is the fourth biggest value in 0, 3, -10, -0.2, 2/5? -0.2 What is the third biggest value in 3, 1/14, 1/4? 1/14 What is the fourth biggest value in 2, -10, -6/7, -3, -1? -3 What is the fifth biggest value in 0.4, 11/5, 1, -2, 12/13? -2 What is the smallest value in -7, -106, 2? -106 Which is the biggest value? (a) -6 (b) 2/5 (c) 0 b What is the second biggest value in 5, -7, 13/3, -5? 13/3 What is the second biggest value in 3, -1, 4, -0.14? 3 Which is the fourth smallest value? (a) -15 (b) -2/15 (c) -4/7 (d) -0.3 (e) -1 d Which is the smallest value? (a) -2/7 (b) 3 (c) -2 (d) 1/4 c What is the smallest value in -56, -1/22, 4? -56 Which is the second biggest value? (a) 1.5 (b) -0.1 (c) -3 (d) 2/13 d Which is the third smallest value? (a) 1/30 (b) 1/5 (c) 0.07 b Which is the second smallest value? (a) 3/7 (b) -4 (c) -1/2 (d) 0.5 c Which is the second biggest value? (a) -134 (b) 4 (c) 3 c What is the third biggest value in -83, -1/3, 3, -0.4? -0.4 Which is the smallest value? (a) -5/2 (b) 2/15 (c) -0.07 a Which is the fifth smallest value? (a) 0.06 (b) 3 (c) -0.3 (d) -2/3 (e) -3/2 b What is the third biggest value in -32, -2/11, 4/7? -32 Which is the fifth biggest value? (a) 1/3 (b) -0.1 (c) 5/3 (d) 0 (e) 81 b What is the third smallest value in -1, 15/7, 1? 15/7 Which is the second smallest value? (a) -84 (b) 3 (c) -2/5 (d) 1/6 c Which is the third biggest value? (a) -3 (b) 4 (c) 5 (d) -0.29 d What is the biggest value in -52, 1/16, 1/7? 1/7 What is the third smallest value in -4/7, 3/20, -0.5? 3/20 Which is the smallest value? (a) 0 (b) -1/5 (c) -5 (d) -1/6 (e) -4 c Which is the third smallest value? (a) 1.3 (b) 1/6 (c) -1 (d) 1 d Which is the second smallest value? (a) 125 (b) -4/3 (c) 4 (d) -2 b Which is the second biggest value? (a) -2/9 (b) -1/454 (c) -0.5 a Which is the third smallest value? (a) 2 (b) -4 (c) -24 a Which is the second smallest value? (a) 5 (b) 176 (c) -2 (d) -1/5 d What is the second smallest value in 0.3, -21, 2? 0.3 Which is the third biggest value? (a) 1 (b) -3 (c) 0.11 (d) -1/4 (e) -4 d Which is the smallest value? (a) -29 (b) 0.13 (c) 2 a What is the third smallest value in -14, 0, -1, -3? -1 Which is the third biggest value? (a) 12 (b) 4/7 (c) 9/4 b Which is the fifth biggest value? (a) -5 (b) -0.1 (c) -15 (d) -2/5 (e) -26 e Which is the second biggest value? (a) 2 (b) -4 (c) -25 (d) -18 b What is the biggest value in -0.2, 0.0567, 0.5? 0.5 Which is the second biggest value? (a) 0.2 (b) -9 (c) -5 c Which is the second biggest value? (a) 1 (b) 0.2 (c) 16 (d) -4 a Which is the smallest value? (a) -25 (b) 2/5 (c) 1/6 a Which is the fourth smallest value? (a) 3 (b) -0.1 (c) 88 (d) -4 c Which is the fourth biggest value? (a) 0 (b) -132 (c) 1 (d) -3/2 b Which is the fourth biggest value? (a) 0.4 (b) 0.02 (c) -0.1 (d) -0.5 d What is the fourth biggest value in 2, -9, 27, -5? -9 Which is the third smallest value? (a) 14 (b) -9 (c) 0.2 a Which is the smallest value? (a) 144 (b) -3 (c) 1/2 b Which is the second biggest value? (a) 0.04 (b) -5 (c) -262 b What is the second biggest value in 0, -8, -2, 3? 0 Which is the second biggest value? (a) -44.1 (b) -5 (c) 1 b What is the second biggest value in -1/3, -4, -53? -4 What is the fourth biggest value in -19, 10/7,	{ "pile_set_name": "DM Mathematics" }
t a = -23 - w. Let l = 12.16 + -0.16. Sort -5, a, l in ascending order. -5, a, l Let u = 31.3 + -72. Let v = 41 + u. Put 2/9, v, 0.4, -0.3 in ascending order. -0.3, 2/9, v, 0.4 Suppose 0 = -0m + 4m, 2v = m - 216. Let r = -105 - v. Sort 2, 5, r in increasing order. 2, r, 5 Let s = -1811 - -2300. Sort s, 3, -0.2 in decreasing order. s, 3, -0.2 Let b = -0.291 + 1.291. Put -2, b, -3, -3/58 in ascending order. -3, -2, -3/58, b Let a = 0.248 - -0.052. Put a, -5, -170 in ascending order. -170, -5, a Suppose -56 + 2 = -3o. Suppose -oi = -22i - 4. Put 0, 1, i, 4 in increasing order. i, 0, 1, 4 Suppose 0 = -b - p - 3 - 1, 2p = -10. Let m = 46.05 + -41.05. Let r = 0.1 - 0.1. Sort r, b, m in descending order. m, b, r Suppose 8k - 24 - 8 = 0. Suppose -kf = 1 + 3. Put -2, -3, f in ascending order. -3, -2, f Suppose 5q = f - 4f - 12, 5q - f = 4. Suppose -2t = -4z + 2, z + 35 = -3t - z. Sort q, -2, t in decreasing order. q, -2, t Let u = -97 - -99. Let s be u/((-220)/106) + 1. Sort s, -4, 1/8 in descending order. 1/8, s, -4 Suppose -2c = -c. Suppose 9o - 4o = c. Suppose -3k + 5l = o, 3k + 11 + 1 = l. Sort k, 2, 5 in descending order. 5, 2, k Let y = -2357/55 + 217/5. Sort -5, -4, y in ascending order. -5, -4, y Suppose 4q + 21 = -3g + 4g, 0 = 4q + 4g - 4. Suppose -7y = -34 - 99. Put 4, q, y in decreasing order. y, 4, q Let v = 3211.5 - 3216.5. Let d = 87 - 172. Sort v, d, 0.4 in decreasing order. 0.4, v, d Let n be ((-18)/4)/((-1)/2). Let j(i) = 2i - 22. Let c be j(n). Sort -1, c, 1, -3. c, -3, -1, 1 Let q = -375.4 - -375. Put -5/2, 1, q, -22 in decreasing order. 1, q, -5/2, -22 Let f = -82 - -77. Let t = 4 + -3.8. Put t, f, 0.7 in increasing order. f, t, 0.7 Let d(h) = -h*3 - 4h*2 + 4h + 2. Let v be d(-4). Let y = v + 18. Suppose -u - 4f = -1, -3u + y = u + 3f. Put u, -1, 3 in ascending order. -1, u, 3 Suppose 5o + z - 64 = 0, 24z - 22z = -2. Sort -3, 1, 3/4, o in descending order. o, 1, 3/4, -3 Let h = -51 - -47. Put 2, -0.2, h, -2/13 in decreasing order. 2, -2/13, -0.2, h Suppose -5z - 19 = -0k - 3k, -5z = -2k + 16. Suppose -3a = 3a + 12. Let f = a + -3. Put k, 4, f in ascending order. f, k, 4 Suppose r + r - 10 = 0. Suppose -2f - a = -8, -3a + 5 = f - 2a. Suppose 71h - 13 = -13. Put h, r, f in decreasing order. r, f, h Let i be (-10)/(-20) + (-9)/(-2). Suppose -im - 8 = 2u, 0u = 2u + 4m + 6. Let b(p) = p*3 - 8p*2 - 1. Let y be b(8). Sort y, -3, u in ascending order. -3, y, u Let f = -377 + 5657/15. Let i = 26.6 - 27. Let h = 136/75 - 12/25. Put h, i, f in descending order. h, f, i Let f = 428/9 + -425/9. Sort -5, f, 108, -2/3 in decreasing order. 108, f, -2/3, -5 Let p(n) = 6n3 - n2 + n + 2. Let d be p(2). Suppose 2u + 10u - d = 0. Sort 13, 0, u, -4 in ascending order. -4, 0, u, 13 Suppose 8x - 20 = 4x. Let i = 48 - 40. Put i, x, -3 in descending order. i, x, -3 Let n = 18 - 84. Let l = n + 61. Suppose -7d + 2d = -25. Sort -1, d, l in decreasing order. d, -1, l Suppose 0 = 24y - 37 + 13. Put y, 3, 0, -4 in decreasing order. 3, y, 0, -4 Let z be 74350/13110 + -5 - 2/3. Put -2, -5, z in descending order. z, -2, -5 Let p = 46 + -30. Let w = -21 + p. Put w, 5, 2/3 in ascending order. w, 2/3, 5 Let y = 0.3258 + -0.0558. Put 0, 0.6, y in descending order. 0.6, y, 0 Let f = 0.11 - -4.89. Sort 2/13, 2, 1/2, f. 2/13, 1/2, 2, f Let d = 0.2 - 0.7. Suppose -5q + y - 180 = 0, 2q + 4y = 32 - 104. Let g = q + 107/3. Put -0.4, g, d in descending order. g, -0.4, d Let v = 1106.6 + -1107. Let n = 8 + -11.5. Let w = -0.5 - n. Put w, -4, v in increasing order. -4, v, w Let l = -737.6 + 738. Put -17, 5, l in increasing order. -17, l, 5 Let y(c) = c*2 - 6c + 6. Let j be y(4). Let i be j/(4 - (-2 + 5)). Let h be (-12)/(-7) - i/(-1). Sort -2, h, 5 in increasing order. -2, h, 5 Let o be 5/(-10)0 - -4. Suppose 0 = -b - 2 + 3, -3q + 2 = -ob. Sort 1, 2/9, q. 2/9, 1, q Let p = -12 + 7. Let l be ((-18)/(-135))/((-2)/(-10)). Sort p, 5, 0.5, l in increasing order. p, 0.5, l, 5 Let k = 4 + -37. Let p = 23 + k. Let s be (-60)/p(-1 + 0). Put 1, s, -1 in ascending order. s, -1, 1 Let v = 520 + -509. Put -5, v, 0.03, -3 in increasing order. -5, -3, 0.03, v Suppose 9z - 25 = 6z + 2w, 5z = 5w + 50. Put -125, 0, z, 4 in decreasing order. z, 4, 0, -125 Suppose -2c - 2 = -3r - 3c, -5c + 10 = 0. Let w be r/(-4)(0 - -1). Let l = -1 + 2. Put l, w, 5 in descending order. 5, l, w Let k = -19 + 23. Suppose 0 = -3z - 4s + 8, z + 3s = -2z + 6. Put z, k, -1 in increasing order. -1, z, k Let c = -0.3 + 0.2. Let m = 3.72 + 1.28. Put c, m, -1/2 in increasing order. -1/2, c, m Let v = -1/227 - -688/1589. Let d = -5.641 - -5.341. Let i = 13 - 18. Put d, i, v in descending order. v, d, i Let n = 67 - 67.132. Let f = n + -0.868. Let h = 0.9 - 0. Sort h, 3, f. f, h, 3 Let g = 35 - 31.4. Let i = 6.6 - g. Let c(a) = a + 1. Let v be c(-1). Sort 0.5, i, v. v, 0.5, i Let i = -13 + 9. Let j = 4 + i. Let q(t) = -t*3 + 9t*2 + 6t + 44. Let k be q(10). Sort j, k, -3 in increasing order. -3, j, k Let t = -11 + 11.7. Let w(h) = -4h - 8. Let l be w(-3). Suppose 0 = -v + 4r + 3 + 1, -4r = lv - 16. Sort -0.5, t, v. -0.5, t, v Suppose -5b - 199 = 4j, -3j = -8j - 5. Let p = b + 42. Let w be (-2)/(-21) + 1. Sort p, 1, w in increasing order. 1, w, p Let m = 2133 + -2131. Sort -11, m, -16 in descending order. m, -11, -16 Let s = -0.18 + -2.22. Let x = -1.4 - s. Let h = 1 - x. Sort 1/8, -2, h in descending order. 1/8, h, -2 Let r = -268 - -264. Sort r, -6, -13. -13, -6, r Let b = 0.1102 - 3.1102. Put 16/9, b, -2 in decreasing order. 16/9, -2, b Suppose 3j = c + 7 + 10, -2j + 18 = -4c. Put -4, c, 6, 2 in ascending order. -4, c, 2, 6 Let l be (-1 + 4)(41 + -42). Sort l, -4, 2, 1. -4, l, 1, 2 Suppose -4s + 5s + 2 = 0. Let o be (-2)/(-4) + (-9)/s. Sort 1, 4, o in increasing order. 1, 4, o Let u = -7 - -12. Suppose 0 = -3i, -2y - 4i = -0y + 10. Let a = 233 + -237. Put u, a, y in descending order. u, a, y Suppose -1 = 35b - 36b. Sort -0.2, b, 9/7 in descending order. 9/7, b, -0.2 Let z = -7.48 + -0.52. Let f = z - -8. Put 6, 2/3, f in ascending order. f, 2/3, 6 Suppose -5o + 0u - u + 11 = 0, -o + 5u - 3 = 0. Sort o, 1, -20 in descending order. o, 1, -20 Suppose 0y + 6 = -3y, -3z + 3y = 6. Let d(t) = t*2 + 7t - 4. Let c be d(-8). Suppose -cp - 17 = -4s - 1, -4s = -12. Sort p, -5, z in increasing order. -5, z, p Let y = 6 - 17. Let t = 11 + -2. Let n = y + t. Put -2/3, -4, n in increasing order. -4, n, -2/3 Let j be 0/2 + 2/8. Let z = -144 - -91. Let k = 51 + z. Sort 1, k, j in increasing order. k, j, 1 Let m be (-4)/75(-84)/(-120). Sort m, -18, 1 in decreasing order. 1, m, -18 Let l = 63 - 89. Let f = -28 - l. Put 1, 0.3, f in ascending order. f, 0.3, 1 Let p(o) = o2 - 6o + 3. Let q be p(2). Suppose 2k = 3v + 6k - 7, -3k = -3. Let d = -120 - -123. Sort v, d, q in decreasing order. d, v, q Let m = -7 - -12. Let c = 85 + -77. Suppose 12 = -cn + 2n. Sort m, n, -0.2. n, -0.2, m Let h = -138 - -142. Sort -2, h, 11 in ascending order. -2, h, 11 Let w(b) = b*3 - 16b*2 + 22b + 7. Let a be w(2). Put a, 140, 5 in ascending order. a, 5, 140 Let n = -154 + 153. Sort n, -13, -2 in decreasing order. n, -2, -13 Suppose -8u - 44 + 44 = 0. Let p be u + 0 - (-252)/98 - 3. Sort -1/3, p, 2/3, 2/11 in ascending order. p, -1/3, 2/11, 2/3 Suppose 12 = 4w - 0w. Let l = -6 + 6. Suppose 0 = -lo + wo - 2i - 11, 2o - 3i = 4. Put o, 1, -4 in decreasing order. o, 1, -4 Let h(y) = -y*2 + 17y + 9. Let q be h(17). Sort -5, q, 0, 3 in ascending order. -5, 0, 3, q Let z = -0.2378 + -0.1622. Sort 1, 0.18, z in ascending order. z, 0.18, 1 Suppose -15 = 4l - 7l. Let r(a) = -a*3 + 3a*2 - 2a - 2. Let w be r(2). Let u(o) = 3o + 2. Let g be u(-2). Sort w, g, l in ascending order. g, w, l Suppose -h - 480 = -41h. Sort -3, 5, 2, h. -3, 2, 5, h Suppose 25 = -5l - z, -2l + 3 = l - 3z. Let j be -42 + 41 + (0/2 - -1). Sort l, j, -5 in increasing order. -5, l, j Suppose -w - 2g = -6w + 374, -w + 66 = 4g. Let j = 68 - w. Sort -2, j, 5, 3. j, -2, 3, 5 Let o(g) be the third derivative of 0g + 0 - 1/12g*4 + 1/6g*3 - 8g**2. Let t be o(2). Sort 2/15, t, 0.3. t, 2/15, 0.3 Let p be 8052/3432 + 2/13. Sort -2, p, 1/3, 3/5	{ "pile_set_name": "DM Mathematics" }
l*4 - 32l*4 in the form bl + jl2 + cl*3 + n + wl*4 and give w. 58 Express 4 - 52w - 58w - 7w + 11 - 6 in the form fw + j and give f. -117 Express 16088g*3 + 1 + 0 + 76g*2 + 250g*2 + 1 - 16090g*3 + 2g in the form jg3 + w + og + ug2 and give o. 2 Rearrange 10 + w3 - 2w*2 - 34w - 12w + 6 - 18w + 30w to aw*2 + i + zw + xw3 and give a. -2 Rearrange 132 - 296 + 105 + 5h + 4h - 6 + 6 + 2h + 4 - 4 + (2 + 2 - 3)(0h - 3h + h) + 3h - 3h - h to p + th and give p. -59 Rearrange (-167p - 3163p - 2145p)(-2 + 6 - 5)(0p + 0p + 3p) to the form x + wp + dp*2 and give d. 16425 Rearrange (-272 + 272 + 33p)(224p - 39308 + 39308)(5 - 2 - 4) to lp*2 + q + mp and give l. -7392 Express 2 + 20x2 - 103x*4 + 287x*4 - 87x*4 - 98x*4 in the form qx*4 + bx + t + ax3 + lx*2 and give l. 20 Rearrange -55 + 159 - 51 + 55b - 52 to the form o + vb and give v. 55 Express 285a*2 + 1210a*2 - 2213 + 776a*2 + 2213 in the form v + na*2 + da and give v. 0 Rearrange 1025h + 4h*4 - 504h + 26h2 - 519h - 2 to uh3 + fh + l + ih2 + xh*4 and give l. -2 Rearrange -2p*3 - 101p*2 - 7 + 6 - 2p*4 + 19795p - 19797p to the form ap*3 + m + dp*2 + vp*4 + bp and give d. -101 Rearrange -31m + 146m - 12m + 8m*2 - 49m to tm2 + i + rm and give i. 0 Rearrange 42x4 - 193x*3 + 192x*3 - 4x*2 + 2 - 2x*2 - 137x*4 to the form fx*3 + sx*2 + n + lx + jx4 and give s. -6 Rearrange (15b*3 - 22b*3 - 3 - 2)(-2 - 2 + 6)(5 + 1 - 4) to the form jb*3 + ub + s + cb2 and give j. -28 Express 240a*4 + 243a*4 - 297a + 2 + a*3 - 730a*4 + 248a*4 - 1469a as oa2 + t + ka*3 + la*4 + xa and give t. 2 Express -126o - 2067o - 2340o + 74o as co + u and give c. -4459 Express 0n + 0n - n2 + (5n - n + 10n)(11 - 6 + 2)(-1 + 1 - 4n) as in2 + qn + w and give i. -393 Rearrange -4z2 - z3 - 3z*2 + 0z*2 + 876 - 1142 to the form oz + a + kz3 + bz*2 and give a. -266 Express (1 - 4 + 1 + (-1 + 0 - 1)(1 - 7 + 1))(1763s*3 + 2745s*3 - 2713s*3) as t + cs + js2 + os*3 and give j. 0 Express -192l*2 - 453l*2 + 219l*2 + 10l - 286l2 as yl*2 + gl + x and give y. -712 Express 253n + 159n - 25n in the form gn + k and give k. 0 Rearrange (-17k2 - 8k*2 - 7k*2)(-7k + 2k + 11k) - 3 - k3 + 3 - 3k*2 + 3k*2 - 2 - 2k*3 to bk*2 + u + tk + rk3 and give r. -195 Rearrange 138153t - 2t4 - 138154t + 5 - 44t2 - 7 - t3 to the form pt*3 + it*2 + bt + l + yt4 and give i. -44 Express (1257k*4 + 4498k*3 + 1522k*4 - 4498k*3)(1 - 4 + 13) as uk + ak*4 + lk*3 + jk*2 + o and give l. 0 Rearrange (2f + f - 6f)(-6132 + 3323 + 4538 + 1018 + 1812) to the form cf + x and give c. -13677 Rearrange (8r - 1 + 1)(2r - 3r - r)(11r2 + 73r*2 + 20r*2) to the form ur*2 + s + or + gr4 + vr*3 and give g. -1664 Rearrange -206 + 9z + 304 - 4z + 550 + 281 to x + fz and give f. 5 Express 270y - 4910 + 141 - 271y as fy + h and give f. -1 Rearrange 25r*4 - 10r*4 + 299r + 1 - 294r to c + hr*2 + ir*4 + vr*3 + ur and give u. 5 Rearrange (-2072 + 4230 + 3128 + 1358 + 1962)(-3 + t2 + 3) to kt*2 + gt + v and give k. 8606 Express i*3 - 11i + 919 + 24i + 17i - 919 - 11i2 in the form ni*3 + b + di*2 + vi and give n. 1 Rearrange 196k - 3k*2 + 3k*2 + 2 - 3k*3 - 254k + 176k to the form ck + zk2 + j + mk*3 and give m. -3 Express -19z*2 + 34z*2 - 16z*2 + 485z*3 - 586z - 487z3 as nz + f + qz2 + yz*3 and give n. -586 Rearrange (-4y + 0y + 3y)(6y - 3y - 4y) - 9 + 9 + 16y2 + (9 + 0 + 3)(7y2 + 9y*2 + 5y*2) to uy*2 + o + xy and give u. 269 Express (x + 4x - 4x)((5 + 13 + 3)(1 + 2x - 1) + 8x + 0x - x) - 5x*2 - 2x*2 + 5x*2 as w + yx*2 + dx and give d. 0 Express -1 + 706h2 + 444h2 - h3 + 366h2 + 297h*2 + 510h*2 in the form yh*2 + ah + w + gh3 and give w. -1 Express 489b*3 + 289b*3 - 722b*3 - 54b + 0 + 0 as db3 + x + tb*2 + jb and give d. 56 Rearrange (-11 + 2s + 11)(0 + 0 - 24s) + 0s*2 + 8s*2 - 3s*2 to the form q + bs*2 + vs and give b. -43 Rearrange (-3 + r + 3)(-2r + 4 - 4)(-7390 + 1506r + 7390) to the form xr + br*2 + h + wr*3 and give w. -3012 Express -954k + 1915k - 962k + 2683 as dk + i and give i. 2683 Rearrange -68s - 137s - 1070s - 1611s to fs + d and give f. -2886 Express -600503i + 255i*2 + 600503i - 6 + 1 as qi2 + ui + x and give x. -5 Express 272z2 + 228z*2 - 583z*2 + 8z in the form kz + qz*2 + o and give k. 8 Rearrange 9k - 2 + 69k3 - 7 + 6 + 8k*2 - 67k*3 + 0 to the form ok*3 + l + mk*2 + sk and give s. 9 Express -501a3 + 386 + 200a*3 - 2a*2 - 387 - 532a*3 - 360a*3 + 2a in the form ga3 + b + ca + ka2 and give c. 2 Express 40u*2 + 1 + 16u*4 + 5u - 38u3 - 19u*4 - 47u*2 + 34u*3 in the form a + yu*2 + xu*4 + gu + zu3 and give z. -4 Rearrange (957 + 410 - 21)(-2 + 2 - 3t) to jt + a and give a. 0 Express (-25 + 0m3 + 2m3 + 23 - m2)(-m + 1 - 1 + (2 - m - 2)(161 - 81 + 113)) in the form g + lm3 + qm*4 + um + zm2 and give l. 194 Rearrange 65 - 6 + 51 + 2b*4 + (-1 - 3 + 5)(-99b4 - 24b*3 + 24b*3) to the form ob + jb2 + rb*3 + wb4 + i and give i. 110 Rearrange (q3 + 0q3 - 3q*3)(-30 + 178 + 272) - 3q3 + 2q*3 + 0q*3 to nq*2 + cq + uq3 + x and give u. -841 Express (-8 + 8 + 48z)(1 + 0 + 1)(-3 + 42 + 61) in the form j + cz and give c. 9600 Rearrange (2 - 1 + 0)(4g + 2g - 4g) + (10 + 31 + 14)(-4g + 5 - 5) + 0 - g + 0 to the form j + pg and give j. 0 Rearrange -165k3 + 1 + 362k*3 - 184k*3 + 7k*4 + 2k*2 to the form lk + ok4 + wk*3 + sk*2 + g and give g. 1 Rearrange 97o + 816 - 64o + 57 - 38o to so + n and give s. -5 Express (0 - 3 + 1)(42 - 42 - 20y)(-8y - 10y + 22 + 16y) as c + iy + ly2 and give l. -80 Rearrange -938p*2 - 349p*2 + 222p*2 + (2 - 2p - 2)(p - 2p + 3p) + 0p + 0p - p2 to the form y + ap*2 + bp and give a. -1070 Express -71 - 78 + 151 - 18l - 58 as b + vl and give b. -56 Express 148743b2 - 148743b*2 - 3b*4 - 101b + (-2b + b + 3b)(-3b*3 + 2b*3 - 3b*3) in the form v + hb*2 + cb + ob3 + tb*4 and give c. -101 Express (41 - 32 + 60)(4y + 3y*2 - 4y)(-17 + 3 - 2) as zy + h + xy2 and give x. -3312 Rearrange (233h*2 - 233h*2 - 213h*3)(-211 + 211 - 173h) to the form s + bh*3 + gh*4 + xh + qh2 and give g. 36849 Rearrange x3 - 15112x*2 - 2x*3 - 1987x*2 to q + hx*3 + fx*2 + jx and give h. -1 Rearrange (-27 - 31 + 42 - 2 + 4 - 1 + (-2 + 2 - 1)(1 - 1 - 2))(-2 + 2 + 1)(4a2 - a2 + a*2) to the form ha + ka2 + y and give k. -52 Rearrange 4845x - 1120x - 1206x + 1970x + 3817x to the form tx + k and give t. 8306 Express -20r*4 - 147548 + 2r + 147551 - 24r3 + 19r*4 in the form or*4 + lr + tr3 + w + pr*2 and give l. 2 Rearrange -3216q + 6479q - 3263q - 50q2 + q3 to vq*3 + m + cq + pq2 and give v. 1 Rearrange (-2 + 3 - 5)(-2 - 14 - 10 + (-1 + 2 - 2)(-1 - 3 + 5))(7n - 45 + 45) to c + vn and give v. 756 Rearrange (-3y + 0y + y)(-104y - y*2 + 15y - 94y + 38y) to uy3 + my + p + ry2 and give r. 290 Express (-462h*3 + 1129 - 1109 + 66h*3)(-2h + 4h - h) in the form mh2 + fh + j + wh3 + vh*4 and give v. -396 Express (2q*2 + 0q*2 + 0q*2)(7 - 5q - 7 + (5q + q - q)(5 - 4 - 4))(-13q + 2q + q) in the form xq + cq*2 + i + vq*3 + sq*4 and give s. 400 Express -20u - 62u + 1 + 157u + 151u as su + w and give s. 226 Rearrange ((0u - 2u - 4u)(7 - 3 + 2) + (-4 + 2 + 4)(1 - 1 - 2u) - 9u + 7 - 7)(45 + u - 45) to fu + du*2 + q and give d. -49 Express 53 + 17c*2 - 5c*3 + 8c2 - 44 + c2 as wc + pc*2 + j + mc*3 and give p. 26 Rearrange -1 - 21 - 23 - 72y*2 + 54 to the form my + p + dy2 and give d. -72 Rearrange 3j - 6j - 11j + 116 - j*2 - 5j - 11j to xj*2 + s + rj and give r. -30 Express 54y - 1011y - 3y2 + 478y in the form cy + ay**2 + d and give a. -3 Rearr	{ "pile_set_name": "DM Mathematics" }
(x) = 21x. Let l(j) be the second derivative of 1/2j*3 + 0j*2 - 149j + 0. Determine m(l(y)). 63y Let t(m) = -15m - 1. Let x(u) = -133u - 9. Let q(p) = 9t(p) - x(p). Let l(k) = -113k2 - 4k. Calculate l(q(c)). -452c2 + 8c Let d(a) = -92a. Let v(o) be the third derivative of -o7/2520 + o4/8 - 2o*2 + 15o. Let p(u) be the second derivative of v(u). What is d(p(b))? 92b2 Let g(r) = 1278r*2. Let c(t) = -23t*2 - 720t. Let n(y) = -58y2 - 1728y. Let k(u) = 12c(u) - 5n(u). Determine k(g(x)). 22865976x4 Let i(y) = -3y. Suppose 4d = -743 + 759. Let a(p) = -dp*2 - 3p*2 + 858p - 855p. What is i(a(n))? 21n*2 - 9n Let x(b) be the third derivative of b*5/60 - 4704b*2 + 2. Let n(f) = -680f - 2. Give n(x(t)). -680t2 - 2 Suppose 2w + 46 = 4l + 122, 5l = -4w + 126. Let z(a) = wa + 74a - 41a. Let b(h) = -2h2. Determine z(b(k)). -134k2 Let x(r) = -r2 + 4r - 1. Let d(y) = -217y*2 + 992y - 248. Let z(m) = -3d(m) + 744x(m). Let n(g) = -28g. Give n(z(u)). 2604u*2 Suppose -436 = -8j - 180. Let q(l) = -jl + 64l - 191l. Let i(n) = -n. Give i(q(p)). 159p Let o(y) = 150163y. Let a(d) = -13d + 18. Calculate a(o(s)). -1952119s + 18 Let a(m) = -4m. Let r(q) = 875906q. Give r(a(f)). -3503624f Let w(p) = 26p2 - 1764p + 1764p. Let n(j) = -9j*2. Let u(y) = 17n(y) + 6w(y). Let d(m) = 25m. Give u(d(b)). 1875b2 Let a(z) = -321z + 52. Let x(s) = 34343s - 5551. Let n(f) = 427a(f) + 4x(f). Let p(m) = -m2. Determine n(p(w)). -305w*2 Let d(l) = -68l - 4. Let p(x) = 1240 - 7x - 531 - 709. Calculate d(p(r)). 476r - 4 Let p(a) = -49a2. Let y(l) be the second derivative of 3 - 34l - 1/2l3 + 0l*2. What is p(y(g))? -441g*2 Let t(d) be the second derivative of 23/3d*3 - 12d + 0 + 0d2. Let b(f) = 92f. Let x(i) = -4b(i) + 9t(i). Let z(v) = v. Give x(z(c)). 46c Let j(m) = 7068m + 190. Let g(a) = 43a + 1. Let c(d) = -570g(d) + 3j(d). Let k(n) = -2n. What is c(k(p))? 6612p Let g(x) = -569x*2 + x. Let k(z) = 1 + 571z*2 - 1 - 570z*2. What is k(g(i))? 323761i*4 - 1138i3 + i2 Let x(l) = 5l2. Let a(j) be the second derivative of -36j*3 + 3272j. Calculate x(a(v)). 233280v2 Let f(u) = -3u - 24. Let s be 6/3 + -1 - -1. Let y(c) = 67c + 60c - 127c + sc*2. Give y(f(l)). 18l*2 + 288l + 1152 Let s(r) = -74364755r2. Let o(k) = 6k. Give o(s(f)). -446188530f2 Let x(z) = -3z*2. Let g(h) = 1914h*2 - 3344h. Calculate g(x(t)). 17226t4 + 10032t*2 Suppose -123v + 125v = 4. Let l(s) be the first derivative of -12 + 3sv - s2 + 30 - s*2. Let g(b) = -34b. Calculate g(l(t)). -68t Let l(m) be the second derivative of m3/6 - 6494m. Let w(d) = -50d2 + 40d. Determine w(l(i)). -50i2 + 40i Let a(b) = -3b. Let m(y) be the third derivative of y8/6720 + y7/280 - y5/4 - y4/12 + 86y*2. Let p(t) be the third derivative of m(t). Give a(p(f)). -9f*2 - 54f Let j(g) = -379122g. Let o(t) = t2. What is o(j(f))? 143733490884f*2 Let u(v) = 4928v - 1. Let t(y) = 2y - 12401. What is t(u(k))? 9856k - 12403 Let j = 15 + -4. Let m(h) = -3h2 + 7h*2 + 9h*2 + jh*2. Let z(a) = 3a + a + 2a2 - 4a. Give z(m(c)). 1152c4 Let r(d) = 78d - 19. Let x be r(10). Let f(k) = xk - 1408k + 718k. Let q(y) = y. Give f(q(c)). 71c Let b(p) = 7p2 + 3p + 1. Let a(k) = -12k2 - 18k - 6. Let f(j) = -a(j) - 6b(j). Let d(t) = -3t - 5. What is d(f(y))? 90y2 - 5 Let i(a) = -2a. Let d(j) = -6j. Suppose -4n = -38 + 6. Let u(h) = ni(h) - 3d(h). Let v(m) = 20 + 25 - 18m - 45 + 4m. Calculate v(u(r)). -28r Let b(w) = 28w*2. Let u(z) = 618738z. Determine u(b(c)). 17324664c2 Let s(u) = u2. Let p(k) be the first derivative of 0k + 0k2 + 2 + 14/3k*3. Determine p(s(w)). 14w*4 Let a(j) = -126j*2 - 11. Let k(y) = -25y*2 - 2. Let x(l) = 2a(l) - 11k(l). Let t(g) = 7g*2. Determine x(t(n)). 1127n*4 Let m(o) = -261o*2 + 12o - 6. Let v(j) = -3652j2 + 166j - 83. Let q(x) = -83m(x) + 6v(x). Let l(r) = r. What is q(l(z))? -249z2 Let i(c) = -3c. Let t(b) = -b*2 + 3b + 14. Let r be t(5). Let o(x) be the third derivative of 0x + 1/12x*r - 14x*2 + 0 + 0x*3. Calculate i(o(s)). -6s Let o(v) = -22v + 112. Let m be o(5). Let q(r) = 4r + 7. Let z(a) = 3a + 8. Let f(t) = mq(t) - 3z(t). Let s(h) = -h2. Give s(f(l)). -l2 - 20l - 100 Let c(a) = 40a + 1. Let d(y) be the first derivative of -y4/6 - 68y + 103. Let i(q) be the first derivative of d(q). Calculate i(c(z)). -3200z2 - 160z - 2 Let b(x) = x. Suppose -5u = -10, -4u - 12 = -n - 0. Let g = n + -17. Let a(y) = gy - y + 0y. Determine a(b(m)). 2m Let a(y) = 10y. Let d(r) = 28r - 24. Let m(v) = -56v + 44. Let l(w) = -5d(w) - 3m(w). Let s(h) = 2h - 1. Let x(f) = l(f) - 12s(f). Give a(x(p)). 40p Let d(i) = 2i*2 + 12i. Let l(a) be the first derivative of -46 - 2/3a3 + 0a + 0a2. What is l(d(t))? -8t*4 - 96t*3 - 288t*2 Let p(x) = -552x. Let h(d) = -11d2 + 1566d. What is h(p(n))? -3351744n2 - 864432n Let a(p) = -3p2. Let s(v) = 929v - 913v - 32v*2 + 67v*2 - 28v*2. Calculate s(a(n)). 63n*4 - 48n2 Let w(b) = -b2 + 9b - 9. Let f be w(6). Suppose 3 - f = -3t. Let s(n) = -145 - 7n2 + 145 - 3n*t. Let a(j) = -2j*2. Calculate s(a(m)). -40m*4 Let i(k) = -27k2. Let g(p) be the first derivative of p4/12 - 44p - 24. Let v(f) be the first derivative of g(f). Calculate i(v(d)). -27d*4 Let b(t) = 13t*2. Suppose -5y = -3a - 0y + 20, -3a - 3y - 12 = 0. Suppose 2k + i = 0, ai + 14 = 5k - i. Let q(p) = kp - 3p + 2p. Determine q(b(g)). 13g2 Let m(k) = 1 - 1 + k2. Let o(h) = -6222h*2 - 5834h*2 + 12071h*2. Give m(o(l)). 225l*4 Let m(w) = -15w*2 + 54w. Let r(k) = -k*2 + 4k. Let i(f) = 2m(f) - 27r(f). Let o(u) = 2u. What is i(o(t))? -12t*2 Let v(j) = -104959796j. Let y(w) = -w*2. Determine y(v(d)). -11016558776361616d*2 Let y(i) = 53611i. Let j(a) = -37a. Determine y(j(k)). -1983607k Let m(q) = -11454q2 + 612. Let u(w) = -10w*2. Determine m(u(h)). -1145400h*4 + 612 Let o(c) = 83c*2. Let z(x) = x - 14. Let s be z(22). Let d(g) = 13 - s - 5 - 2g. Calculate o(d(t)). 332t2 Let q(z) = 3. Let m(s) = -s + 15. Let v(y) = -2m(y) + 10q(y). Let u(x) = -4 + 29x*2 - 5 + 9. Determine v(u(t)). 58t*2 Let j(h) = 1020481h*2 - 2h. Let n(v) = -v - 14. Calculate n(j(f)). -1020481f2 + 2f - 14 Let h(o) = -o - 22. Let z(f) = f + 23. Let b(k) = 6h(k) + 5z(k). Let m be -8(287/(-28) + 10). Let q(p) = 2040p*m - 1020p*2 - 1019p2. Give q(b(a)). a2 + 34a + 289 Let s(k) = -9k*2 + 25k. Let l(i) = 2i - 6. Let v(o) = -6. Let z(m) = l(m) - v(m). Give z(s(a)). -18a*2 + 50a Let v be (-5 - 61/(-5))/(2/40). Let k(n) = -59n2 - 69n*2 + vn*2. Let u(p) = -5p. Determine k(u(i)). 400i2 Let s(u) = -34u. Let d(k) = 25697k2. Give d(s(p)). 29705732p*2 Let v(q) = -42614934q*2. Let u(f) = 2f*2. Calculate v(u(d)). -170459736d*4 Let r(j) = 4j*2 + 6j. Let q(s) = -978s + 1. What is q(r(l))? -3912l*2 - 5868l + 1 Let u(t) = 4t2. Let l(n) = 41n - 60. Let h(j) = j + 20. Let i(s) = -3h(s) - l(s). Calculate i(u(x)). -176x2 Let p(q) = q2 - 2q + 14. Let k be p(-3). Let o be (-2)/(-4) + 114/12. Let m(w) = -56 + 27 + k - ow. Let r(u) = 3u. Calculate r(m(a)). -30a Let q be (-2 + -6)(-12)/32. Let m(a) = -9a*2 + 3a*2 - qa*2 + 8a*2. Let i(k) = 9k. Calculate i(m(o)). -9o2 Let h(s) = 851s*2 + 1380s + 138. Let x(d) = -6d2 - 10d - 1. Let p(n) = h(n) + 138x(n). Let w(k) = 10k*2. What is p(w(v))? 2300v*4 Let y(l) = -2l*2. Let g(d) be the third derivative of 0 + 81d*2 + 0d + 41/24d4 + 0d*3. Calculate y(g(o)). -3362o*2 Let r(i) = -93i*2. Let o(x) = -3x*2 + x - 103. What is o(r(u))? -25947u*4 - 93u*2 - 103 Suppose 4f = -m + 12, 5f = -0m - m + 14. Let d(g) = -mg + 2g - g - 3g. Let s(n) = 5n2. Let i(c) = c2. Let r(q) = -9i(q) + 2s(q). Calculate d(r(v)). -6v2 Let i(q) = -2q - 336. Let b(o) = 6o + 952. Let g(f) = -6b(f) - 17i(f). Let x(j) = -14j. What is x(g(d))? 28d Let u(g) = 895085g + 47. Let n(h) = -h. What is n(u(f))? -895085*f - 47 Let n(q) be the second	{ "pile_set_name": "DM Mathematics" }
g, -5g + 30 = a. Let t = q - a. Solve 0 = c + c - 6, -4c + 6 = -tl for l. 2 Suppose -83h - 3547 = -393. Let b = -6 - -44. Let r = b + h. Solve -2s - 5p + 24 = -11, r = 5s - 4p - 5 for s. 5 Let d = -12579 - -12584. Solve -4o - 54 + 19 = 3l, -5o - d = -4l for o. -5 Let h(u) = -5u*2 + 44u - 14. Let d be h(16). Let b = d + 593. Solve 2m + 10 = -5g + g, -4g + 5m = b for g. -2 Let h = -17 - -19. Let b(w) = -w*3 - 15w*2 + 108w + 1476. Let c be b(-16). Solve -co = v + o, 0 = -v + ho for v. 0 Let i(b) = -b*2 - 15b + 5618. Let p be i(-82). Solve -o = -4u - 13, 128u + 16 = pu + 4o for u. -3 Let m(y) = -y3 - y2 - y + 32. Let d be m(0). Let x be (-1 - 8/4) + -26. Let n = d + x. Solve 0 = -3p, nt - p = t - 10 for t. -5 Suppose 0 = -11r + 177 - 1. Suppose 4z + 0z - r = 2n, 4n - 33 = -5z. Solve 5i = -ny + 24, 3i + 2i - 28 = -4y for i. 4 Let u be -21(25/15 + -2) + 2. Solve -uq - 3p = -13q - 31, 2q + 3p - 7 = 0 for q. -4 Suppose -12 = -3i - 0. Suppose 0 = 4s - 2n - 0 - i, -n = 5s - 12. Suppose -3y + 2y + s = 0. Solve yg = -5c + c - 2, -3c + g = -11 for c. 2 Let s(l) = l + 3 - 7 + 6l + 23l*3 + 2 - 3l. Let b be s(1). Solve -2k + 8 = 3r + b, k = -3r - 13 for r. -3 Suppose -4p + 7 = -c, 28p = 30p + 2c - 26. Solve a = 9t - pt + 15, 3t + 2a + 9 = 0 for t. -3 Let k(l) = 123l + 3089. Let z be k(-25). Solve 10 = -4q - 4m - 18, 3q - 4m = z for q. -2 Suppose 0 = 37g + 75 - 371. Solve 0 = -4m - 2w - 10, 2w + 2 + g = 3m for m. 0 Let t(i) = -i2 + 97. Let p be t(0). Let z = 1451 - 1350. Let u = z - p. Solve -4d - 6 = -2m, 0 = m + 3 - u for d. -1 Suppose -4u - 2u = -18. Let x(s) = 20 + 13 + us - 2s2 + 18s*3 - 35. Let l be x(1). Solve c - 3c = n + 13, 0 = -5n + 2c - l for n. -5 Let y be ((6 + -30)/3)/(4/(-66)). Let j = -130 + y. Suppose -5o + 1 = v, -5v + 0 = -5. Solve 0 = b - 5a + 3 + j, -5b + 3a + 19 = o for b. 5 Let m(s) = -14s - 990. Let y be m(-71). Solve r + 17 = 2g, -3g - 14 + 12 = yr for g. 6 Suppose 186i = 180i + 30. Let x = 93 + -93. Solve -5 = -ib + 2f + 16, -2b + 2f + 6 = x for b. 5 Suppose 485r - 477r - 16 = 0. Solve 3y - 10 = -rb, 0b = 4y + 5b - 11 for y. 4 Let t be 4/10 + (-216)/(-10). Let w be (4/6)/(t/957). Suppose 5m - w = 111. Solve -p + 2p = -5h - 24, 5h + 2p + m = 0 for h. -4 Let p(j) = 6j*2 + 29j + 24. Let n be p(-4). Solve -w - nd = 17, 4w - 67 = 7d - 20 for w. 3 Let n(m) = m2 - 2m + 1. Let x be n(3). Let k = 88 - 183. Let i = 98 + k. Solve 0 = -id + 2a + 5, 3d = xd - a for d. 5 Let f(q) be the first derivative of 9q2/2 + 228q + 24. Let w be f(-25). Let k = -17 - -35. Solve -3l - 7 = 2s, -wl - 2s = -5s - k for l. 1 Suppose -40x - 90 = -46x. Let p(d) = d3 - 16d*2 + 11d + 74. Let g be p(x). Solve -4b - 8 = 4k, -g = 2k + 2b + 2b for k. 3 Let z = 79 - 76. Suppose 3a - 12 = zr, 2a + 3r = a. Solve 8l - 3l + 4b = -17, 0 = -l - 4b + a for l. -5 Let q = 3113 - 3111. Solve 3a + 3r = -24, -2r - q = 6 for a. -4 Suppose -147q + 292 = -7 - 583. Let n(m) = m3 - 8m*2 + 9m - 3. Let d be n(7). Let s = -8 + d. Solve -h + x = 0, -4h + sx - 5 = -q for h. 1 Let v = -987 - -1005. Let k(h) = -h*3 + 17h*2 + 17h + 22. Let o be k(v). Suppose -3f - 3 = -12. Solve 0 = 5t - 0t + fc - 32, -3t - oc = -28 for t. 4 Let n be (-91)/7 - (-28 - -15). Solve n = 5p + 25, 9u - p = 4u - 5 for u. -2 Let a = -7706 + 7717. Solve 3l - 15 = -2r, -l + 5 = -6r + ar for r. 0 Suppose -2o = -2v - 7o - 25, 5o + 15 = -4v. Solve 2s - 7s + 30 = -vg, -15 = -5s for g. -3 Suppose -71n - 8 = -73n. Suppose nf + 7w = 3w + 32, -9 = -3w. Solve -5s = -4i - 1, -5i + 0s = -fs + 5 for i. -4 Let f be (3/2 - 2)0. Let d be (-3)/(-1 + f/7). Solve dn + 3v = 2v - 1, v = 3n + 11 for n. -2 Let b(s) = 3s + 10. Let n be b(-4). Let p be (-1 - n)/(3/135). Let i be p/5 + (-3 - 1). Solve -2c - 3y = 2y - 27, ic - 25 = -4y for c. 1 Let f(w) be the second derivative of -w*4/6 + 25w*3/6 + 23w*2/2 - 22w. Let d be f(13). Solve -2c = -t - 2, -3t - d = 2c - t for c. -1 Let o(l) = l3 - l2 + 2. Let t be o(3). Suppose 4b + 4d = t, 12 = -14d + 11d. Solve 3s + b = 2s + a, -5s - 5 = 3a for s. -4 Let h(c) = 1434 - 1434 + 4c. Let p be h(-2). Let m be (((-4)/8)/(-1))/(-1)p. Solve 2t + 2y = -0 + m, 4t = 5y + 17 for t. 3 Let y(i) = 2i*3 - 7i*2 - 17i + 12. Let j be 324/60 - (-4)/(-10). Let k be y(j). Solve m + 5f = 2f - k, 8 = -4m - 5f for m. -2 Suppose -28 + 52 = 4c. Let n be 6 - (c - (-1 - -4)). Solve -3i = -4q - 1, -3q = ni - q + 5 for i. -1 Let c = -16666 + 16666. Solve c = 2d + 3b - 2 - 1, 5d + 4 = 4b for d. 0 Let m be -5 + 0 - (-23 + 10 - -5). Solve g - 14 = -md, -22 = 2g - 9d + 5d for g. -1 Suppose 0 = n + 5c - 115, 0 = -10n + 14n + c - 422. Suppose 7s + o - 70 = 4s, -4s = -o - n. Solve -3y - 4i = s - 5, 10 = -5y - 2i for y. 0 Suppose 3u + 2 + 16 = -3i, -5u - i - 14 = 0. Let b be -45u/20. Solve -6s - 26 = -4r - 8s, bs - 21 = -3r for r. 5 Suppose 0 = 4m + i + 1283, -5m - i = 1684 - 80. Let q = -311 - m. Solve -4g - 2l - q = 0, 5g = 2g + l + 5 for g. 0 Let p(x) = x3 + 9x*2 + 19x + 10. Let s be p(-6). Let q(v) = v*2 + 6v - 12. Let k be q(-8). Solve -3w + 2j = 6j - 1, -20 = -sw + kj for w. 3 Suppose -21x - 38 = -23x + 2b, 54 = 3x - 2b. Suppose -xa = -5a - 55. Solve 0 = 4h - af - 12, -2f = f + 12 for h. -2 Let n(o) = -o2 - 30o - 121. Let w be n(-29). Let x = w - -97. Solve 0k = -2m + 3k - 21, xk - 37 = 4m for m. -3 Suppose 5i + 85i - 2i - 1584 = 0. Solve -3v - i = -3c, -2v = -5c + 209 - 188 for v. -3 Let v be (-12)/212/72-3. Solve -2h - 13 = -vr, -4h + 25 = 5r - 9h for r. 3 Let a = -40993 - -40995. Solve c - 5d - 19 + 34 = 0, -3c = -ad + 19 for c. -5 Let b be 1 - ((-9)/2)/92. Suppose 0 = -bw - 10 + 18. Solve -r = -5s + 12, -3s - w = -8s - 3r for s. 2 Suppose 39y = 86y - 44y. Solve -r + 12 = 4k, y = k + 36r - 40r - 3 for k. 3 Let l be (-1 - 133)/(2/(-8)). Let z = l - 532. Solve 0 = 5a + 2w + w - 17, 3w = za - 19 for a. 4 Let q = 1593 - 1596. Let z(r) be the first derivative of -r*2 - 4r - 1. Let a be z(q). Solve -5i = 10, ak + i = -3k + 3 for k. 1 Suppose 2s + 2 = i - 3, -5s - 2i = -10. Let w(h) = -6 - 2 + 1 + s - 5h. Let k be w(-3). Solve 0 = 6y - 2y - 2u + 8, 2y - 3u = -k for y. -1 Let n(f) = 2f - 10. Let c = -19 - -26. Let t be n(c). Suppose -5m + tb + 32 = 0, -3m = b + 5 - 31. Solve g = -2k - m, 0k + 14 = -3g - k for g. -4 Let z(x) = x2 + 6x + 2. Let o be z(-6). Let c(f) = -67f + 10799. Let u be c(161). Solve 4d = u, -2d - 10 = -oy - 4d for y. 2 Suppose -4g = 3u - 21, -35 = -5u - 137g + 132g. Solve 2m - 2y = um + 9, 5y + 5 = 5m for m. -1 Let m(a) = -a3 - 7a*2 - 6a. Let h be m(-9). Suppose -7j = -13j + h. Let u = j - 21. Solve -3c = -5g, -3c - u = -0c for g. -3 Suppose w = 2l + 19, 0w + 95 = 5w + 2l. Let j(n) = -3n2 + 10n + 10. Let b be j(4). Solve g - 2p = 4g - w, 2p - 14 = -bg for g. 5 Let a(t) = t*3 + 37t*2 + 31t - 177. Suppose m - 2g = -16 - 26, -177 = 5m + g. Let i be a(m). Solve -5 = -iz - 2y + 2, z = -y + 3 for z. 1 Let f be (508/(-12) - (-1)/3)27/(-54). Solve -3 + 2 = 3r - v, -f = -2r + 5v for r. -2 Suppose 21y - y = 5320. Let s = 268 - y. Solve -t + 0m - 5 = -sm, -m = 4t + 2 for t. -1 Let m be (6/5 - 9/(14 - -31))1. Solve o - 2h = 2, 0 = 2h + 3 - m for o. 0 Let z(y) = -119y + 1314. Let d be z(11). Solve 0 = dj + 4x - 9, -10x + 12x = 2j for j. 1 Let p be (0 + -1)139(3 + -4). Let v = -134 + p. Suppose 3i + z - 2 = 0, -10 = -4i + 3i + 2z. Solve -2x + 12 = 4u + i, 4u - vx = 3 for u. 2 Suppose -9i + 924 = -21i. Let c = i + 77. Solve -2m = -m - 3l + 18, c = 3m - 4l + 29 for m. -3 Suppose -4l - 83 = 3x + 962, 4l = -x - 351. Let h = x - -350. Solve k + 3a + 4 = 0, -hk + 4a = 2k + 20 for k. -4 Let t(c) = c*2 + 3c - 16. Let d be t(-6). Let l be 0 + d - 1215/(-10). Solve -7y = -5y + 4f - l, -y + f = 5 for y. 0 Suppose 2g = -3b - 21 - 8, 4b + g = -37. Let r(i) = i + 12. Let z be r(b). Solve n + 2 = -p, -p - 5n = -z*p - 11 for p. -3 Let p be (-2 - -3 - 44)/((-22)/(-66))	{ "pile_set_name": "DM Mathematics" }
0q. Solve qw + 3 = -2w - m, 2w + 6 = -4m for w. -1 Let x = 17 - 10. Let z(q) = q3 + 5q*2 + 6q + 5. Let s be z(-4). Let i be 0 - s/((-9)/(-6)). Solve 5y = 2j - x, -y + ij + 11 = -2y for y. -3 Let t = -112 - -133. Suppose -o = -3o + 6. Solve t = 3g - on, -2g - 4 = 3n + n for g. 4 Let q be (-8)/12(1 + -7). Suppose 0 = -5v + qv. Solve 5a - w - 4w + 15 = v, 5a + w = -15 for a. -3 Let g be (-3 - -3) + 2 + 0. Suppose 3m + x = -2, 5x + 10 = -gm + 4m. Solve 5r + v = m, -v + 2v = 4r - 9 for r. 1 Suppose 0 = -4s - 5l + 3l - 6, 4l = s - 12. Let x be 2 + s + (2 - 1). Solve -5u + xr - 18 = -2u, -5r = -2u - 21 for u. -3 Let t be 7((-36)/14 + 3). Solve -r = 4z + 20, -tr - 3z - 15 = -0z for r. 0 Suppose 5t - 16 = t. Suppose tu + 4 = 3u. Let k(m) = -2m - 4. Let i be k(u). Solve s - b - 7 = 0, -is + b + 24 = 8 for s. 3 Let q(v) = -2v - 3. Let p = -15 - -6. Let o be (-1 - -4)/(p/12). Let g be q(o). Solve w = -5, -gw - 18 = 4h + 15 for h. -2 Suppose 0 = 3z - 0v + 4v, 0 = -z - 2v - 2. Suppose 12 = -0f + 4f. Suppose 0h + h - f = 0. Solve zk - 3m - 2m - 5 = 0, -hk + 4m = -4 for k. 0 Let q(s) = -s*3 - 6s*2 + 6s - 5. Let r be q(-7). Let p = r + -2. Solve p = n + l - 0 - 1, -2l = n for n. 2 Suppose -21 = -6p - 9. Solve pw = -3i - 15, -3i - 3w + 0w - 15 = 0 for i. -5 Suppose 0 = 5y - y + 4a - 48, 4a + 12 = y. Let s = 12 - y. Solve sz = 3f - 5z, -3f + 4z - 3 = 0 for f. -5 Suppose -n - 4n + 10 = 0. Suppose ny - 4y = -6. Solve -o + 1 + y = -3m, 2o = 5m + 8 for m. 0 Suppose 3 = -4m + 3z, -2m + z + 26 = 5z. Suppose 0y = 5y - mf - 17, 1 = f. Solve 2n - 5r = 8, yr + 10 = 2n - 4n for n. -1 Let k(l) = l - 2 - 2l2 - l3 + 6 - 5. Let m be k(-3). Solve 5s - 3w + w - 21 = 0, 3s - 5w - m = 0 for s. 5 Let y = 17 - 11. Let z(b) = -6b + 15b - 6 + 0 - 6b2 + 5b*2. Let m be z(y). Solve -3v = -0f - 5f - 18, -4f - m = 0 for v. 1 Let p(r) = 2r3 - r2 + 1. Let s be p(1). Suppose -4a + sa = -2. Solve -g = -3, -2h - g - 6 = a for h. -5 Let c(i) = -i + 10. Let o(u) = -3u + 1. Let j be o(-2). Let p be c(j). Suppose 4z - 6 = -2. Solve 5 = -4x + z, -q = -px for q. -3 Suppose -3g = k - 20, 2k + 10 = -k + 5g. Let m be (-8)/(-14)7/2. Suppose mq - 28 = -2b - 0q, -40 = -3b - 5q. Solve -x = 5a - b, x - 2 - k = -a for x. 5 Let k(v) = -v2 - 4v + 3. Let m be k(-3). Let a(n) = -5n - 69. Let l be a(-15). Solve -ld + d - 24 = p, -2d = 4p + m for p. 1 Let k be ((-52)/(-20) + (-6)/10)/1. Solve 0 = kc + j + 3j + 4, j + 1 = -2c for c. 0 Suppose -2p + 0p = 0. Suppose n - 1 - 1 = 0. Solve nh = s + 2s, p = 2s + h - 7 for s. 2 Suppose -4 = -4d - 12. Let g = 32 + d. Suppose 5o - g = -5. Solve op = 5q + 10, -4p + 4q + 7 = -p for p. 1 Suppose -3q + t + 2 = -9, 0 = -3q - 4t + 16. Solve 2a + 28 = 3i + i, -qi + 24 = -a for i. 5 Let h = -261 - -264. Let r(t) = t2 - t - 4. Let u be r(4). Let q(m) = -m3 + 5m2 + 3m - 3. Let f be q(5). Solve -2j - z + f = -2z, hj - u = -z for j. 4 Let a = -4 - -6. Solve -4b + aq + 10 = -8, 0 = 5b + 2q for b. 2 Suppose -4f - 4 + 16 = 0. Let u be -1 + 1 + (10 - 2). Let t(h) = -h*2 + 5h - 3. Let n be t(3). Solve -24 = 3q + fp, -5q + 0 = -np + u for q. -4 Let f(t) = 3t2 + 10t + 8t2 - t3 + 8t*3 - 6t*3. Let o be f(-10). Suppose o = -3x + 7 + 2. Solve -5h = a - 25, -xh = 3a - a - 15 for a. 0 Suppose -7 = 3u + 4b, 3b - 13 = -3u + 4b. Solve -uq - v = -3v - 9, -q + 2v + 3 = 0 for q. 3 Let m be 2-3(-2)/3. Let i = -4 + m. Suppose i = 2k - j - 13, -4j - 2 = 3k + 6. Solve z = -z - kn + 18, -3n = -2z - 10 for z. 1 Suppose -3f + 32 = -i - 163, -2i - 130 = -2f. Let s = -40 + f. Solve -5p = -4u + 20, -u + s = 4u for p. 0 Suppose 5y = 2 + 33. Solve -y = 2o - h, -h + 5 = 2 for o. -2 Suppose 2b = 3i - 56, -2b + 5b = -4i + 52. Solve -4r - i = -3d, -r - 4d = -0r + 4 for r. -4 Let k be (-8)/(-28) - (-26)/7. Suppose 4p + 21 = 5w, 3p - 4 = -kw + 19. Solve -j = -3i + p - 10, 0 = j - 3 for i. -2 Let o = -16 - -20. Solve 0 = -3k - ou + 4, 2k + 2u - 28 = 7k for k. -4 Suppose -3 = -5p + 4o + 15, 4o = -4p. Solve 4v + 10 = r, 0v + 2v = -r - p for v. -2 Let t be 2 - ((-1)/(-1) - 4). Suppose 3b - 10 = b + 5z, z = -tb + 25. Solve 7 = -2w + 3l, -bw + 2l = -w - 6 for w. 4 Let i = -3 - -7. Let y(t) = -2t - 1. Let w be y(i). Let u be 12 + (1 - w). Solve 0 = 3b - b - 4f + u, 2f = -3b - 10 for b. -4 Let p = 10 - 5. Let u = p + -2. Let m(a) = a + 6. Let b be m(-6). Solve -uq - 6 = -bx + 3x, -2x - 4 = -3q for x. -2 Let u be (-1)/(1 - 1 - 1). Let o be 2 - ((-1 - u) + 4). Suppose -4r + 2r + 40 = 0. Solve o = 5f - 3n - 9 - 6, 0 = -2f + 4n + r for f. 0 Let s = 76 + -72. Solve -2w + 0 = -3r - 11, sr + 2w + 10 = 0 for r. -3 Suppose 1 = 4p - 7. Let d be (-4)/(-1) + -1p. Let y be (-1)/(-2)(3 + 3). Solve u - yl = 0, 4u + dl + l + 15 = 0 for u. -3 Suppose -3o = 3l - 0 - 45, 3l + 2o = 44. Suppose -l = -4f + 2. Suppose 0 = -fn + 4s + 36, 3n + 4s = -2 - 6. Solve 3x = nk - 2, -k - x = 3 - 0 for k. -1 Let z = 5 - 3. Suppose 5u - 23 = 7. Solve -5n + 5f = 40, -zn + 4f - 28 + u = 0 for n. -5 Let g(n) = 2n*3 - 13n*2 + 7n - 3. Let d be g(6). Suppose -b = y - 4, -6 = -2b - 2. Solve yx = -5p + d + 26, 3p - x = 13 for p. 5 Suppose 6h = h - 15. Let k = h - -7. Solve 0 = kb - 6 - 10, 0 = 5u + 5b + 5 for u. -5 Suppose -1 = 4d - 9. Suppose 5v = -2u + 30, -2v - 9 = -du - 35. Let q = -2 + 7. Solve qf + 37 = -4r, -5f + 4r - v = -f for f. -5 Suppose 0 = -2a + 5n + 70, n + 4n + 205 = 5a. Solve 5o + 5f = -a, -4o - 2f - 28 = -0f for o. -5 Let f(s) = -s*3 - 8s*2 - 8s - 5. Let z be f(-7). Solve 3k = -3o - 24, 0 = -zk - 6 - 4 for o. -3 Let i = -12 - -16. Suppose 0 = 4t + id - d - 10, 4t = 3d + 22. Solve 2s + 31 = -tw + 5s, -s + 13 = -2w for w. -4 Suppose 0 = 16v - 13v - 15. Solve -vg + 2p - 9 = 0, 2p - 5 = -0g + g for g. -1 Let t(q) = -2q - 2. Let b be t(-2). Suppose -5a + 22 = -z, -4a = 3z - z + b. Let f = -3 - z. Solve fn + 2y = -18, 0 = -4n - y + 6 - 19 for n. -2 Let s(w) = w*2 - 7w + 2. Let f be s(7). Suppose fu = 3u + 2p + 3, -4u + 2p = 2. Let g be (-4 - u)/((-3)/2). Solve h + 4 = a, 3a + ga = -5h - 10 for h. -3 Suppose w = n - 19, n - 65 = -2n + 5w. Suppose 2s + s - n = 0. Let u = 6 - 1. Solve -m + 10o - so = 14, -u = 4m - 3o for m. 1 Suppose 5p + 0 + 15 = 0. Let b = 7 - 10. Let s = b - p. Solve s = v - n + 9 - 4, 4n = 16 for v. -1 Suppose 23 = 5f + 4i - 8i, -2f + 14 = -4i. Solve 13 = -5o - 0o + fw, -2 = 2o + 2w for o. -2 Let o = 21 - 21. Solve -2m + 4 = o, -3r - 1 = -2m + 12 for r. -3 Let h = -14 + 16. Solve 3v - h = -3s + 4, 0 = 5v for s. 2 Let i = -3 - -6. Suppose 7s - 3s = -4m, -20 = -is + m. Solve -4t = -t - b + 5, -2t - sb = 9 for t. -2 Let v = 3 - -10. Let g = v - -12. Suppose 3x + 2x = g. Solve xs = 2h + 22, -3s + 19 = -2h + 5 for h. -1 Suppose -60 = -2r - 2r. Let u = r - 12. Solve -2o - uo - 15 = 4l, 2l - 15 = 5o for o. -3 Let k be 2 - 0/2 - -2. Suppose 2b = 7u - 2u - 6, kb + 2 = 5u. Let w be 3/((-2)/(-4) - -1). Solve 7l - bh + 1 = wl, 4l - h - 1 = 0 for l. 1 Let o = -131 - -156. Solve 0 = 5p - 2z + 15 + 15, 5z - o = 0 for p. -4 Let k = 9 + -5. Suppose -42 + 6 = -2y. Let f be y/1(-2)/(-4). Solve -s = ko - 17, -3s + 6 = -f for o. 3 Suppose c - b + 2 = 4b, 2c - b = 5. Suppose -14 = -2f + p, -3f + 3p = 2f - 37. Solve 2 = 3k - 4k - q, cq = fk + 34 for k. -5 Suppose -j = -1 + 4. Let n = 2 - j. Solve 0 = 3w - nh - 17, 3h = 5w - 3 - 4 for w. -1 Let n = 1 + -1. Suppose n = -t - 2t - 15, 0 = 3j - 3t - 30. Suppose 42 + 13 = jr. Solve -3d + 2 = -5q, -4d = -2q - 1 - r for d. 4 Let y be 0/((-5)/(15/6)) - -2. Solve 2x + yp + 12 = 0, 4x = -2p - 2 - 16 for x. -3 Let n = 427 - 423. Suppose -2w + 35 = 5x, 2w + 2x = 19 + 1. Solve r = nr - 3f + 9, -wr - 3f = 31 for r. -5 Let k = -12 - -14. Solve 0n = -n - k, -5m = 3n - 14 for m. 4 Suppose o - 20 = -3o, n + 5o - 54 = 0. Suppose -n = 5l - 134. Solve 4a + 17 = -0a + r, -5a - l = -r for a. -4 Let q = 10 - 8. Let d = 2 - q. Solve d = -5i - 2w + 25, w + w =	{ "pile_set_name": "DM Mathematics" }
q + 4 for q. -1 Solve -4p + 4d - 8 = 0, 4p + 106d + 8 = 105d for p. -2 Solve 3h + 13 = -f + 9, 5f = -2h - 46 for f. -10 Solve 5d + 20 = d, 3b - 10 = 5d for b. -5 Solve -5m + 3 + 19 = l, 4m + 3l - 22 = 0 for m. 4 Solve 2s = 4g + 16, 2g + 17 - 1 = -3s for s. -2 Solve -2f - 8z = -7z + 13, 11 = -f - 2z for f. -5 Solve 4i + 3h = 8 - 27, 5i - 10 = 3h for i. -1 Solve -6q + 4q + 20 = 3f, -5f - 3q + 32 = 0 for f. 4 Solve 0 = -k + 4, -8p - 5k = -10p - 12 for p. 4 Solve s + 5p - 10 = 0, -5s - 638p + 20 = -643p for s. 5 Solve 6r + 4d = 4r - 18, 0 = 2d + 8 for r. -1 Solve 2k - 17s - 2 = -15s, k = 3s - 3 for k. 3 Solve -28 = -3c - 4p, -2 + 10 = 4c - 2p for c. 4 Solve -14 = -n + 3n - 4s, 0 = 5n - 3s for n. 3 Solve 34u - 4 = 32u, 5u = f + 12 for f. -2 Solve 5m + 5q - 20 = 0, -2q = -2m + q - 17 for m. -1 Solve -3d = 4t - 4, -3d = -0d - 2t + 2 for d. 0 Solve -4x - 10 = -2q, -5 = 3q + 2q - 4x for q. -5 Solve y + 5z + 1 = 4, 0 = y - 3z + 5 for y. -2 Solve 24q + 3r = 26q - 3, 5r = 5 for q. 3 Solve -4j = o - 9, j = -4j - o + 11 for j. 2 Solve -2 = -k, 0 = 5p - 7p + 3k - 16 for p. -5 Solve 2b + 5w = -11, 32 - 47 = 5w for b. 2 Solve -25 = -5s, 0 = 3c + 5s - 6 - 19 for c. 0 Solve 16 = 2s - 2k, 21s - 18s + 4k = -4 for s. 4 Solve 5r = -5, 0 = 15f - 12f - 4r - 16 for f. 4 Solve -t + 17 = -4h, 0t - t = 4h + 23 for h. -5 Solve -3f + 3 = -5z, -4f - 5z + 174 - 205 = 0 for f. -4 Solve 0 = -3q - o + 10, -5o + 6o + 18 = 4q for q. 4 Solve -4w = -5g + 14, 0w - w - 3 = -g for g. 2 Solve 0 = -3h - 2u + 2, 2h - u = 3h - 2 for h. -2 Solve 0 = 5a + 3t - 2, -t - 4 = 3a - 6 for a. 1 Solve -75x - t = -80x - 21, -5t + 5 = -5x for x. -5 Solve -v = l, 4l + 5v = 3l + 12 for l. -3 Solve 0 = -2n - 39t + 34t - 13, -6t = 6 for n. -4 Solve -2g = -2o - 3o, 14 = -2g - 2o for g. -5 Solve 6 = 2j + 3n - 12, 2j + 4n = 22 for j. 3 Solve -2h - 2w = 4, -3w = h + 3 - 1 for h. -2 Solve 2i + 11 = -3c + 15, 10 = 5c for i. -1 Solve 0 = -2t + 4i + 12, -i = -10t + 14t + 3 for t. 0 Solve 15 + 11 = -3n + 5m, -4n = -5m + 28 for n. -2 Solve 2n + 7 = 3o, -35 = 3n - 38 for o. 3 Solve -c + n - 7 = 0, 0 = 7c - 3c + 5n + 19 for c. -6 Solve 5t + m - 14 = 0, -20t - 4m + 10 = -23t for t. 2 Solve 4k + 3 = 3q + k, -3k = 4q + 31 for q. -4 Solve 3d - 8d - o + 10 = 0, 0 = -2d + 5o + 4 for d. 2 Solve 2j - 5 = -a, 6j - 2j + a = 11 for j. 3 Solve -b - 2b = -o + 17, -31 = -3o + 5b for o. 2 Solve 5j = 3n + 16, 0 = j - n - 45 + 41 for j. 2 Solve 2h = r - 3h + 20, r + 3h = 20 for r. 5 Solve -4p - 18 = 2q - 40, 0 = -5q + 5 for p. 5 Solve -16w + 2a = -12w + 6, 5w - 5a = -10 for w. -1 Solve -5n + 19 = 2s, -n - 2s = 3s - 13 for n. 3 Solve -3y - 4g = -9 + 25, -5y - 12 = 3g for y. 0 Solve 6 + 4 = k + 3s, 8s - 20 = 4k for k. 1 Solve p - x - 4x = -15, -7p - 4x = 27 for p. -5 Solve -w = -5a + 24, -5w + 5a = -0a + 20 for w. 1 Solve 0 = 3z - 8 - 4, 5o = -5z + 45 for o. 5 Solve 16 = 3y - c - 0, -5c = y for y. 5 Solve -2t = -2s - 4, t + 17 = -6s + 5 for s. -2 Solve -34 = -3u - 5a, -2u - 4a + 16 = -2a for u. 3 Solve 3j = 4p - 0j, 4p - j = 0 for p. 0 Solve -f = -0f, -3 = -d + f for d. 3 Solve t - 2 = 3n - 6n, 0 = 2n - 4t - 20 for n. 2 Solve -5o + i = -31 + 15, 3o - 2i = 4 for o. 4 Solve -5f - 1 - 4 = t, 9 = t - 2f for t. 5 Solve -152h + 156h - 4 = 0, 5q + 17 = 2h for q. -3 Solve h = -3h - 3f - 3, -27 = 5h - 4f for h. -3 Solve n + 7 = 5m, 7 = -m + 2n + n for m. 2 Solve -3c = 3q + 3, -29q - 19 = -5c - 28q for c. 3 Solve 2f + 3x = 6x + 6, -15 = -5f + 2x for f. 3 Solve -4p + 44 = -5s, 2s + 22 = 5p - 16 for s. -4 Solve 2o + o - 4 = 4x, 0 = 2o + 8 for x. -4 Solve -12p - 4x = -7p - 45, 5p - x - 20 = 0 for p. 5 Solve 14 = -5c + 3t, 212c - 4t + 13 = 211c for c. -1 Solve d = 2d - 4t - 9, 2t - 3 = 3d for d. -3 Solve -14j = 3w - 12j + 5, -4j = -8 for w. -3 Solve 3h = -f + 4, -h + 0h - 4 = 3f for h. 2 Solve 2c + 3x = 1 - 6, -5x + 5 = 0 for c. -4 Solve -5i + x - 11 = -0x, 5i = -3x - 27 for i. -3 Solve -5d + 24 = 4b, -2b - 3b + 21 = 4d for d. 4 Solve 5q - 4q - 4n - 10 = 0, -4q - 3n = 17 for q. -2 Solve -4j - h = -6h + 29, -2h + 8 = 2j for j. -1 Solve 5g - 4t - 2 = -4, t = 4g + 6 for g. -2 Solve -5 = 5m, -2f + 0 = -2m + 2 for f. -2 Solve -4l - x - 13 = 2x, 0 = 6l - 5x + 29 for l. -4 Solve -z - 2t = -6 - 2, -t = -z + 2 for z. 4 Solve 2h - 7 = 3n, 26h + 5n = 22h - 41 for h. -4 Solve -3f = 2q + 5f - 48, -2f = 5q - 30 for q. 4 Solve -4j = -v - 10 + 29, 5v - 31 = 4j for j. -4 Solve 4d + 2a + 0a = -10, -3d - 3a = 15 for d. 0 Solve -17n + 12 = -14n, 0 = 3f - 3n + 18 for f. -2 Solve -87p + 25 = 4g - 82p, -g + 4p - 20 = 0 for g. 0 Solve 5i + 27 = 2h, -5h - 4i + 21 = -i for h. 6 Solve 0 = -4s - 2v + 20, 2s + 5v - 12 = 3v for s. 4 Solve 3a + 5u = 18 + 14, -16 = -4u for a. 4 Solve 4k = -6n + 54, -4k + 7n = 3n + 36 for k. 0 Solve 6c - 3c - 5n + 16 = 0, -4c - 3n = -27 for c. 3 Solve 4q + 17 = -3w, 0 = 5q - 10q - 4w - 22 for q. -2 Solve 8 = -5i + 4g, 2i + 4g = 1 - 21 for i. -4 Solve 6 = -q - d, q + 2d + 2d + 18 = 0 for q. -2 Solve 2w - 4f = 2, 0w - 5f = 4w + 22 for w. -3 Solve 19 = -4p + 3s, 4p + 2s + 1 = -13 for p. -4 Solve 0 = -s - 2h + 4, 5s + 2 = -2h - 2 for s. -2 Solve 3j = 5r - 6 - 9, 2j - 3r = -10 for j. -5 Solve -2y + 8 = -z, -12z + 7z - 4y = 12 for z. -4 Solve 2v - 7v = 2l - 12, 5l + 4 = -4v for l. -4 Solve -3r = -2f + 16, -3r - f - 5 = 5 for r. -4 Solve 2p - 7 = 5f, 0 = -f - 3p - 12 - 3 for f. -3 Solve 3k + 0k = n - 6, -4k - 19 = -5n for n. 3 Solve -2q + 21 = y + 20, 0 = 4y - 4q - 28 for y. 5 Solve -2p - 5g = 3, -4p = -5g + 24 - 3 for p. -4 Solve 0 = 3v + 5u - 12, -10u = -11u for v. 4 Solve -5t - 2l = -15, t - 2t + 3 = -5l for t. 3 Solve -4r - 19 = -4s - 31, -s + 2 = 0 for r. 5 Solve -4h + 4 = 0, 4h - 4 = 2x + 10 for x. -5 Solve -5d - 14y + 10y + 13 = 0, 3y = -3d + 6 for d. 5 Solve 5o + 14 = b, 21b = -2o + 18b - 9 for o. -3 Solve 0q + q + v - 3 = 0, -3q - 4v = -10 for q. 2 Solve -6n - 5r - 65 = 0, -n + 4n + 29 = r for n. -10 Solve 5k + 7 = -4j + 10k, 2k - 4 = j for j. 2 Solve 0 = -3r - 4a + 4, -r - 2r = 3a for r. -4 Solve -11s = -12s - 4g + 17, 0 = s - 4g + 7 for s. 5 Solve 5u + 5a = -5 - 10, 4u = -3a - 10 for u. -1 Solve 4z = -2f + 12, 4z = -4f + 25 - 9 for z. 2 Solve 4p + 2l - 12 = 0, 2p - 7l - 14 = -12l for p. 2 Solve -3z - 12 = 4y, -39y + 40y + z = -3 for y. -3 Solve -2 = -3h + 4h + 4t, 0 = -h + t + 3 for h. 2 Solve -u + 7 = -2k, 2u - 5 = -k - 16 for u. -3 Solve 4t + 10 = -3f, 2f - f - 3 = 5t for t. -1 Solve 1 = -0w + w + 2y, 4w - y = -14 for w. -3 Solve 76c = z + 81c - 10, 0 = -5z + 3c + 22 for z. 5 Solve -2w = -5q + 21, 4q - 12 = -w - q for w. -3 Solve 0 = 2b - 29i + 31i, 4i = -2b - 2 for b. 1 Solve 4j - 3k = 5, 2k + 35 = 4j + 5k for j. 5 Solve 5m - 2g = 4, -66m + 3g = -64m + 5 for m. 2 Solve -5k + 3 = -12, -3 = -4v + 3k for v. 3 Solve -5d + c = -4d - 7, -4d - 3c - 7 = 0 for d. 2 Solve -22p = 3m - 24p + 20, m + 2p = 4 for m. -4 Solve -c - 19a + 24a - 30 = 0, 0 = -3c + 2a - 25 for c. -5 Solve 2h - 8 = -3w, -5h + 10w - 5w + 20 = 0 for h. 4 Solve -5b - 9 = -3x, 3b + 3 = 4x + 2 for b. -3 Solve 3y - 5j + 4 - 5 = 0, 8 = -4j for y. -3 Solve 0 = 5h - 5r + 20, 4r = 15 - 7 for h. -2 Solve -a = k + 4, -2a - 14 = -8 for k. -1 Solve -3f = -h + 11, -15f = -5h - 16f + 7 for h. 2 Solve -2p = 5s - 7, -2p + 97s - 101s = -4 for p. -4 Solve -q - 12 = -4q, -5n + 4q = 41 for n. -5 Solve -2i - 4y - 12 = 0, 3i + 13 = -4y + 3 for i. 2 Solve 0 = 4v + 8c - 10c + 6, 2c - 5 = 3v for v. -1 Solve 5a = -0b + 2b - 12, -2 = 4b + 3a for b. 1 Solve -4w = s + 3, 3s - 62w + 65w + 18 = 0 for s. -7 Solve 0 = -5s - 3h + 12, -4s - 43h = -47h - 16 for s. 3 Solve -h - 3w + 10 = 0, -11h = -14h + 2w - 25 for h. -5 Solve 4c = -2t + 16, 5c = 3t - 23 + 21 for c. 2 Solve 0 = -5b + 3b + o - 7, 5b + 25 = -5o for b. -4 Solve f - 3h + 6 = 0	{ "pile_set_name": "DM Mathematics" }
5q2 - 6q*2 wrt q? -10 What is the second derivative of 16k + k - 29k5 + 15k*5 wrt k? -280k*3 Let f(u) be the third derivative of -19u*4/24 - 10u*3/3 + 13u*2. What is the first derivative of f(x) wrt x? -19 What is the derivative of -31q*4 + 17q*4 - 11 + 15q*4 wrt q? 4q*3 Let a(j) be the second derivative of 1/6j*3 + 0j*4 + 0 + 0j*5 + 0j*6 - 5/42j*7 + 0j*2 - 2j. Find the second derivative of a(z) wrt z. -100z3 Let z be 4/10 - (-4)/(-10). Let r = z - -1. What is the derivative of 1 + r + 2h*4 + 0h*4 wrt h? 8h*3 Let i(z) = -62z*6 + 16z*2 - 11. Let f(m) = 21m*6 - 5m*2 + 4. Let w(j) = 11f(j) + 4i(j). Find the third derivative of w(u) wrt u. -2040u*3 Suppose -h + 4h - 12 = 0. Let q be (6/9)/(4/6). Find the first derivative of -q - 1 - 2b4 + 4b*h wrt b. 8b*3 Let z(a) = -19a - 16. Let w(p) = -18p - 17. Let b(n) = -5w(n) + 4z(n). What is the first derivative of b(r) wrt r? 14 Let q(g) = g3 - 9g*2 + 8g - 5. Let j be q(8). Let y be (j + 2)/(3/(-2)). Find the first derivative of 2 - 2 + ya - 2 wrt a. 2 Let k(n) = n - 4. Let i = -6 - -12. Let s be k(i). Find the second derivative of sx + 0x4 + 2x*4 - 4x wrt x. 24x2 Let v(l) be the second derivative of -2l*7/3 + 17l*4/12 + 12l. Find the third derivative of v(y) wrt y. -1680y2 What is the second derivative of -19q*3 - 14q + 36 - 36 wrt q? -114q Let f(s) be the third derivative of -s7/280 + s4/3 - s3/3 - 3s*2. Let v(q) be the first derivative of f(q). What is the first derivative of v(l) wrt l? -9l2 Let w(c) = c4 + c*3 - 1. Suppose 3r = -16 + 1. Let n(p) = p*4 + 5p*3 + 4p - 5. Let l(y) = rw(y) + n(y). Find the second derivative of l(f) wrt f. -48f2 Let a(h) = h3 - 7h2 + 8h - 7. Let i be a(6). What is the third derivative of -id2 - 29 + d3 + 29 + 2d*2 wrt d? 6 Let w(g) = -9g3 + g2 - 5g - 5. Let u(c) = -5c*3 - 3c - 3. Let x(t) = 5u(t) - 3w(t). What is the third derivative of x(v) wrt v? 12 Suppose -3y + 3l = -24, 5l = 5y - y - 35. Find the second derivative of 6g5 + gy + 5g + g wrt g. 140g3 Let y(h) be the second derivative of 0h*4 + 0h*5 + 0 + 1/15h*6 + 0h*3 - 3/2h*2 + 2h. Differentiate y(z) with respect to z. 8z3 Find the second derivative of -2w + 8w2 + w - 2w + 0w wrt w. 16 Let g(x) be the third derivative of x6/120 - 5x*4/24 - 5x*3/6 + 8x*2. Let s(m) be the first derivative of g(m). What is the derivative of s(v) wrt v? 6v Let s(a) be the second derivative of -3/2a2 + 0a*4 + 1/15a*6 + 0a*3 + 0 + 0a*5 + 3a. Find the first derivative of s(v) wrt v. 8v3 Let y(d) = 7d*3 + 2d. Let t(w) be the second derivative of 2w5/5 + w3/3 - 2w. Let b(m) = -6t(m) + 7y(m). What is the second derivative of b(g) wrt g? 6g Let q = -11 - -13. Differentiate 4x*4 + 2x*4 - qx*4 + 3 - 2x*4 with respect to x. 8x*3 Let s be 0 - 1 - (-5 + 2). Differentiate -2p*2 + 2 - 3 - 4p*2 + 0p*s with respect to p. -12p Suppose 0 = -l + s + 1, 2l - 2s + 6 = 4l. What is the second derivative of -a + 2a - a - 3a + la*2 wrt a? 4 Let f(m) = -6m + 3. Let h(t) = -31t + 15. Let k(i) = 11f(i) - 2h(i). Let r(j) = 1. Let g(v) = -k(v) + 2r(v). What is the derivative of g(p) wrt p? 4 Find the second derivative of -8i + 18i*3 + 2 + 21i - 2 wrt i. 108i Let c(w) be the first derivative of 9w*5/5 + 2w*3 + 4. What is the third derivative of c(j) wrt j? 216j Suppose -2j + 11 = r, -2j + 0 + 8 = 0. Find the third derivative of -2f2 + 2f*r + 0f*3 - 3f*3 + 4f3 wrt f. 18 Let v(d) = d3 - d*2 + d - 1. Let m be v(2). What is the third derivative of 4w2 - w2 - mw + 4w*5 + 5w wrt w? 240w2 What is the first derivative of 11 + 3 + 4t*2 + 1 wrt t? 8t Let b be (-3 - -2)0/5. Differentiate b - 5 + 13w*2 - 6w*2 wrt w. 14w Let j(l) = -49l2 - 4l - 20. Let t(r) = -r*2 - r - 1. Let g(d) = j(d) - 4t(d). Differentiate g(v) wrt v. -90v Let v = 7 + -2. Let y(p) = p6 - p2 + p + 1. Let f(o) = 2o*6 - 4o*2 + 5o + 5. Let x(z) = vy(z) - f(z). Find the third derivative of x(a) wrt a. 360a*3 Let q(a) be the first derivative of 2a*5/5 - 9a - 9. Find the first derivative of q(g) wrt g. 8g3 Let i(d) be the second derivative of 0d*2 - 1/4d*4 + 0 - 1/6d*3 + 3d. What is the second derivative of i(t) wrt t? -6 Let g(t) be the third derivative of -4t7/105 - t4/8 + 7t*2. Find the second derivative of g(f) wrt f. -96f*2 Let r be (-3 + -2)3/(-3). What is the second derivative of -y*5 - 2y - 12y + ry wrt y? -20y3 Suppose 2j - 2o - 12 = 0, 3 - 1 = -5j - 3o. Find the second derivative of 0c + 3c + cj - 2c wrt c. 2 Let f(y) = 3y2 + y. Let j be f(1). Let z(m) be the first derivative of -2m*2 + 7m*3 - 7m3 + 2 - mj. Find the second derivative of z(w) wrt w. -24w Find the third derivative of 21r*5 - 26r*2 - 31r*2 + 8r*5 - 19r*2 wrt r. 1740r*2 Differentiate -18 + 11 + 6 - 24 - 11i*2 wrt i. -22i Let y(k) be the first derivative of -k6/120 - k4/12 - k*3 + 1. Let f(p) be the third derivative of y(p). Find the first derivative of f(m) wrt m. -6m Let z(i) = i + 2i - 22 + 20. Let a(w) = -4w + 1. Let s(k) = -4a(k) - 6z(k). Differentiate s(v) with respect to v. -2 Let s(h) be the third derivative of 0h3 + 1/24h*4 + 0 - 2h*2 + 0h - 1/60h6 + 0h*5. What is the second derivative of s(i) wrt i? -12i Let q(a) be the first derivative of 3a5/20 - a4/4 + 2a - 6. Let n(m) be the first derivative of q(m). Find the third derivative of n(t) wrt t. 18 Suppose -14 = 3x - 56. Suppose -5r + x - 4 = 0. Find the second derivative of -3w + 3w*r + w - 2w*2 wrt w. 2 Let s(y) be the first derivative of 0y - 2/3y3 - 1/2y*4 - 2 + 0y*2. Find the third derivative of s(o) wrt o. -12 Let q(d) be the first derivative of -2d*6/3 + 5d*3/3 + 2. What is the third derivative of q(i) wrt i? -240i*2 Let n(q) be the first derivative of -1/4q*4 + 0q*2 + 4 + 4/3q*3 + 0q. What is the third derivative of n(f) wrt f? -6 Let l = 0 + 2. Suppose -3y - 4 = -m - y, 2m + 1 = -5y. What is the second derivative of x - x2 + x - mx*l - x wrt x? -6 Let i(s) = 2s*4 + 2s3 - s2 + 2s + 2. Let j(z) = z4 - z3 - z - 1. Let t(b) = -i(b) - 2j(b). What is the third derivative of t(v) wrt v? -96v Let z(s) = -s2 + 7s - 7. Let b be z(5). Differentiate 4ob - 3o*3 + 5o*3 - 2o*3 - 5 wrt o. 12o*2 What is the third derivative of -5j*2 - 5j*2 + 4j*2 - 3j*2 + 3j*5 wrt j? 180j*2 Let h(x) be the third derivative of 7x*6/120 - 5x*3/6 - 6x*2. Differentiate h(z) wrt z. 21z2 Let h be (6/5)/((-1)/5). Let s(o) = o2 + 6o + 2. Let u be s(h). What is the second derivative of 3n - 4 + 3 + 1 - un3 wrt n? -12n Let l(f) = 2f4 + 4f*3 + 4f*2 + 25. Let s(b) = 3b*4 + 3b*3 + 3b*2 + 26. Let m(h) = -3l(h) + 4s(h). What is the first derivative of m(i) wrt i? 24i*3 Find the second derivative of 6j - 32j + 165j*4 - 178j*4 wrt j. -156j*2 Let w(u) be the third derivative of 7u*4/24 + 5u*3/3 + 2u2. Differentiate w(v) wrt v. 7 Let y(x) be the third derivative of -x4/6 + x*3/6 + 4x*2. Find the first derivative of y(t) wrt t. -4 Let h(k) be the first derivative of -9k*4/2 + 20k + 10. What is the first derivative of h(z) wrt z? -54z2 Let j(y) be the third derivative of y5/30 + 7y*4/12 - 24y*2. Find the second derivative of j(v) wrt v. 4 Let r(i) be the third derivative of 1/20i*5 + 0i*3 + 0i*6 + 1/112i8 + i2 + 0 + 0i7 + 0i + 0i4. Find the third derivative of r(k) wrt k. 180k*2 Let f(r) be the second derivative of 0r*3 + 1/2r4 + 0 + r2 + 8r. What is the first derivative of f(v) wrt v? 12v Let i(d) be the first derivative of -d6/90 + d5/40 - 4d3/3 + 1. Let f(k) be the third derivative of i(k). What is the second derivative of f(u) wrt u? -8 Differentiate 6 - 6d + 0d + 0d wrt d. -6 Let l(r) = 23r5 - 7r2 - r - 1. Let t(y) = y5 - y - 1. Let g(s) = -l(s) + t(s). What is the third derivative of g(p) wrt p? -1320p2 Let x(s) be the third derivative of -s6/180 + s4/12 + 2s3/3 - s2. Let y(r) be the first derivative of x(r). What is the d	{ "pile_set_name": "DM Mathematics" }
i - 131. Solve -cr + 5 - 1 = -3w, 0 = -4w - 4r - 16 for w. -3 Let p be (-12)/(-90)-301/(-2). Let h(v) = v*2 - 2v + 1. Let o be h(3). Suppose 2b + 8 = ob. Solve 5r - g = -12, 5g - p = bg for r. -2 Let g be (-14)/21((-333)/(-2))/(-3). Suppose 4r - 81 = -g. Solve -y - r + 2 = -2h, -h + 5y + 9 = 0 for h. 4 Suppose 5l - 3t + 5 = 13, -2l - 3t + 20 = 0. Suppose p = 5o - 6, lp - 13 = -4o + 11. Let v = 10 + -6. Solve -15 = u + 2u - vk, -u + ok - 5 = 0 for u. -5 Let t = 72 - 69. Suppose k + 5k = tk. Let s be (k(-5)/(-25))/(-2). Solve s = -2n + 5w - 16, n - 5w = -3 - 15 for n. 2 Suppose -5 = -3o + 1. Suppose -ov + 5k = -14, 6 - 2 = -3v - 5k. Solve vd - 19 = -5i, 0 = -4d + 5i + 8 - 45 for d. -3 Suppose 0 = 290l - 334l + 176. Solve 11z = -b + 16z + 23, 0 = lb - z + 3 for b. -2 Let g be 3(-5 - -15 - 9). Solve -b - o + 14 = -4b, b + go = -8 for b. -5 Let v = -7762 + 7765. Solve -vz = 13b - 11b + 1, 3b - 18 = 2z for z. -3 Let p be (-13)/(-39) + (-16)/(-6). Suppose 2 - 10 = -8n. Let v be 3(1 + n) - 1. Solve -c + 2z = -p, 2c + v = 3c - 4z for c. 1 Let u(x) = x2 + 10x - 93. Suppose -5d - 5c - 54 = -d, 22 = -2d - 5c. Let g be u(d). Solve -l + gs = 14, -2s = 4l - 0l + 14 for l. -5 Let r(h) = -h - 8. Let p be r(-10). Suppose 3x = 5l - 1, 0 = px - l + 13 - 17. Solve g - 2m = 10, 5m = -2g + xg - 22 for g. 2 Let x(u) = -115u*3 - 3u*2 - 9u + 11. Let i be x(1). Let m = i - -118. Solve 12 = 5c - 4d, d = 5c + md + 3 for c. 0 Suppose -80v + 78v = 0. Suppose 5d = 4d. Suppose d = 3t - 0t - 9. Solve -2q - 5n - 21 = v, 2q + t = -2n - 3 for q. 2 Let l(x) = -48x2 - 3x - 2. Let m be l(-1). Let i = m + 47. Suppose i = 5j, 0 = -5h + j + 13 + 7. Solve -b + 11 = 3b - 3u, hb + 3u = -19 for b. -1 Suppose -5o + 5k + 55 = 0, 3o + 2k = -27 + 45. Solve 5c + 10d - 20 = -0c, -4d + o = 3c for c. 0 Let w be 21 + (-19)/38 + (-9)/(-2). Let h = -11 - -12. Suppose 24m = wm - h. Solve 3o + r = 11, o + 3r = m - 0 for o. 4 Suppose -3f + 1179 = -7h + 3h, 3h - 2f = -884. Let t = h - -294. Solve -3u = 9, -3u = 4w - tu - 3 for w. 3 Let c be -2(-1)/(-10) - (-8)/40. Suppose c = -4n + 62 + 34. Suppose 29d = nd. Solve 6f - 3x - 8 = 2f, d = -4f + 5x + 16 for f. -1 Suppose 0 = 46d - 41d - 15. Suppose 0 = -4g - dn + 14, 3g = 4g - 5n - 15. Solve -u - 14 = -gz, u + 0u = -4 for z. 2 Suppose 4d = 12, 3h = -2h + d + 27. Let x(b) = b2 - 13b + 46. Let l be x(5). Solve -4v = -y - h, 2y - 3v = ly + 5 for y. -2 Suppose -280 + 282 = g. Suppose -3s = 4m, -gm + 12s = 14s. Let n be ((-9)/(-6))/((-3)/(-32)). Solve -i - f = 5, -5i - 2f = -mf + n for i. -2 Let t(k) = k + 9. Let n(h) = -h - 1. Let a be n(7). Let m be t(a). Let d be 18 - 10 - m(0 + -1). Solve 2w = -2o - 2o - 18, -3o = -3w + d for w. -1 Let k(z) = 185z + 19. Let u be k(2). Let n = -385 + u. Solve 25 = -p + ng, -g - 22 + 2 = 5p for p. -5 Let k(r) = 149 - 57 + 7r - 48 - 17r - 48. Let a(m) = m3 - m - 1. Let h be a(0). Let y be k(h). Solve d - 6t = -3t + y, 4d = 5t + 3 for d. -3 Suppose -5f + 29 + 1 = -0f. Solve 2b + 4a = 14, 2a + f = b + 3a for b. 5 Let b(m) = -38m + 38. Let n be b(8). Let k = n + 269. Solve 3z = -kg + 12 + 6, 0 = -3z + 5g - 6 for z. 3 Let o be 172/(-36) + (-3)/((-27)/(-2)). Let y be 6 - (-41 + 10 + o). Solve yd = 2q + 1 - 30, -2d = 2q + 6 for q. 2 Let n be (-88)/(-6) - 2/(-6). Let v = -1356 + 912. Let j = -443 - v. Solve l = -3w - l - j, -3l = n for w. 3 Suppose -5b = -5a, 4a + b - 17 - 3 = 0. Let m be (-9 - (26 - 23))(-4)/6. Solve 3r - 13 = -ac - 1, 0 = -2r - 5c + m for r. 4 Suppose -19w = 21w - 1600. Solve 23 = 2z - 3u, -3z + 4u + w = 2z for z. 4 Let i be (7 + -8)20(6/8)/(-3). Solve -9s = 5p - 5s + 28, 0 = -4p - is - 26 for p. -4 Let r(d) = d2 + 86d + 624. Let z be r(-8). Solve -5h + 5 = 2t - z, -2t + 5h = 25 for t. -5 Let o(d) = -3d + 1. Let h be o(-1). Let j = -381 + 388. Suppose 2n - j = -v, -2n + 4v = -7n + 10. Solve 2z = -2w - n, -hw = 5z - w + 7 for z. 1 Suppose 17h - 26 - 11 - 31 = 0. Solve 0 = 4n, 10w - 6w = 4n + h for w. 1 Let g = -15 - -9. Let d(m) = -4m + 4. Let l(t) = -3t + 3. Let j(b) = gl(b) + 5d(b). Let q be j(-2). Solve -q = 2i - 3n, -3i + 4n - n - 6 = 0 for i. 0 Suppose -2o + 21 = 463. Let w = o + 222. Solve -3z = l - 11, -3z + 11 + w = 0 for l. -1 Let d = 4 + -2. Let g be (0/82)/(6 - -4). Solve g = 4q - 2c + d, -5q = 2c - 1 + 8 for q. -1 Suppose 0 = -n - 4t - 22, 4n = -5t + t - 40. Let p be -3 + (-1)/((-3)/(15 + n)). Solve -b = -h + 1, -12 = 3b - p for h. -3 Let s be 1/(5/(-30)-6). Let v be (116/145)/(s/5). Solve -3q = 2q - vj + 5, 4j = 2q + 14 for q. 3 Let v(h) = 65h + 1565. Let p be v(-24). Solve -3s - 17 = 4j, -2s + p = 5j - 7s for j. -2 Suppose -18975 + 19055 = 10l. Solve 10g + 5s = 7g + 14, -s = -3g + l for g. 3 Let i be (22 - 36) + 12 + 2. Let u = 3 - 3. Let q = u + i. Solve x + 3n + 4 = 10, q = -2x - 4n + 10 for x. 3 Suppose -2r + 49 + 143 = 0. Suppose 4o - 16o = -r. Solve 5m + 2s = 11 + 18, 4s = o for m. 5 Let u(b) = 4b*2 + 39b. Let z be u(-10). Solve -zn + 5q - 31 = -14n, -4n + 5q = -1 for n. 4 Suppose 19d = 36d. Suppose d = 3y - 0 - 27. Let k = -26 - -41. Solve -y = s + 2q, k = 2s - 5s - 3q for s. -1 Let j(z) = -4z2 + 23z + 8. Let w be j(6). Solve -5l + wl - 19 = 2y, y + l = -8 for y. -5 Suppose 0 = -w - 3t + 66 - 1, 5t = -3w + 215. Suppose 0 = -y + 6y + w. Let u = -12 - y. Solve -2s + u = 4k, s = k - 1 - 0 for k. 1 Let p(z) = -z3 + 10z*2 - 27z + 165. Let n be p(9). Solve 3x + 18 = 6v - nv, 4v + x = -1 for v. 1 Suppose 11606 = 7w + 11578. Solve -12z + 8z + o - 25 = 0, -wz - o = 15 for z. -5 Let c = -42 + 83. Let x = c - 38. Suppose 0 = f - 5q - 5, 5q - 45 = -3f - f. Solve -2i - 25 = xg, 2i - 5g = -g + f for i. -5 Suppose 22j - 3j + 9880 = 0. Let v = j + 527. Solve 5l = 3p + 3 - v, -5p = -5l - 10 for l. 1 Suppose -11t - 3t + 980 = 0. Let w = -56 + t. Solve -4c + 5 = f, -2f + 2c - w = -2c for f. -3 Suppose -4f = -6f - 14. Let y(c) = -c2 - 9c - 12. Let r be y(f). Let o be (-6)/9(-15)/r. Solve -6q + 2q = -20, 0 = 5x - 4q - o for x. 5 Let w = 44 - 44. Suppose 6a + 33 - 807 = w. Let n = a - 111. Solve -5z = -3d + 20, -3z - 2d = n - 6 for z. -4 Suppose -2p - 2c = -18, -18 = -2p + 2c - 16. Solve 17t + 6 = 3s + 14t, -5t = ps + 20 for s. -1 Let m be (27/(-36))/(48/(-256)). Solve -6z + 4z + m = 0, -3z = 5b - 6 for b. 0 Suppose k + 21 = 24. Suppose 3b - 6b = o - 9, 2b - 17 = ko. Let g be 20/8 + (-1)/2. Solve -gp = -5v - 12, 3p - 7p + 3v = b for p. -4 Suppose -477j + 484j = 7. Let b be (2/5)/((-1)/(-5)). Suppose 0 = 3p - 0p - 5x - 100, -5p - bx + 115 = 0. Solve -2f + 4 = 3a - j, -a + p = -4f for a. 5 Let t be 6 + 12 + 2 - 7/1. Solve tj - 17j - 4 = 0, j = -3v - 16 for v. -5 Suppose 0 = -3q - 2 + 14. Suppose -147n = -124n - 3634. Suppose -170u = -nu - 36. Solve 0f + v = -3f + 6, 0 = uf + qv - 6 for f. 2 Let b(t) = -t + 38. Let p be b(10). Suppose -70x - p = -71x. Solve 2j = -5m - x, -m + 2m + 3j = -16 for m. -4 Suppose 495 = 67y + 227. Solve -4m = yj + 12, -5j = -3m - 2j - 21 for m. -5 Let v = 5803 + -5798. Solve 4u = 6s - vs, -5u = 5s for s. 0 Let f be 123/196832/1. Solve 0 = -5b - fq + 28, -4 = -3b + 2q - 0 for b. 4 Let r(q) = -3q3 + 13q*2 + 65. Let w be r(0). Solve -5 = 64s - ws - 3k, -2s - 5k = -6 for s. -7 Suppose -60t + 86t - 540 = -82t. Solve a = -2c + 13, 19 = 3a - tc + 24 for a. 5 Let c = 58 - 78. Let p be 2 + (-36)/c + (-2)/(-10). Suppose q - 9 = -5m, pm + 1 = 3q - 7. Solve 4y + 3s - 10 = 0, 3y + 4s = 5s + m for y. 1 Suppose -14 = -b - 13. Suppose -r + 2y - b = 0, 2r = -2y - 2y + 14. Solve -rs + 6s = 5f - 7, 0 = 4f - 2s - 4 for f. -1 Let x be (-729 - 8) + 5 - 7. Let y = x + 741. Solve -yi - 1 = -3z, 3i = -3z - 2z - 30 for z. -3 Suppose -20v = 100 - 140. Solve -5w + 30 = -4m, vw + 3m = -w - 9 for w. 2 Let n be 6/(-5)(-4 + 10/15). Suppose 16 = na, y - 3a = 2a - 4. Solve 0 = -5d + 2h - y, -2h + 2 - 14 = 2d for d. -4 Suppose -3h + 3 = 4v - 0h, -3*v	{ "pile_set_name": "DM Mathematics" }
-3 Express (-24 - 17 + 22)(4 + 3w - 4 + (3 - 3 + w)(5 - 4 + 1)) as f + nw and give n. -95 Express 6l + 17l + 13l + 23l - 11l + 5 in the form nl + j and give j. 5 Rearrange -3k2 + 47 + 4k*2 + 11k*3 + 47 - 96 to ak*3 + n + fk*2 + rk and give f. 1 Rearrange 3m2 + m2 - 2m*2 + (0m + 0m - 3m)(-316 - 439m - 319 + 636) to am2 + r + wm and give w. -3 Rearrange (0m + m - 2m)(-1 - 2 + 2 - 4 + 4 - 3 + 0 + 0 - 1 + (3 - 1 - 3)(-6 + 3 + 1) + 0 - 6 + 0) to lm + u and give l. 9 Rearrange -1705 + 1705 - 15t3 + t2 to the form d + pt3 + wt*2 + ot and give w. 1 Express -17b - 12b + 121 + 30b + (5 - 1 - 3)(-b - 3b + 5b) as d + ib and give i. 2 Rearrange 29 + 2d + 0d3 - 255d*2 - 264d*2 - d + 520d*2 - 3d*3 to ad + xd3 + vd2 + k and give k. 29 Express 4 + 15 + h2 + 1 + 0 - h as p + nh + xh*2 and give x. 1 Rearrange -69472y*3 - 9 + 69471y3 + y2 - y*2 - 4y to g + xy + cy*2 + my*3 and give g. -9 Rearrange 3x*3 - 2x*4 - 5x*3 + 132x - 130x + 6x*2 - 31x*2 to the form wx*2 + zx + hx3 + ix*4 + c and give h. -2 Express (-3 + 3 + 2)(-5 - 2 + 6)(339g + 1019g - 363g) in the form sg + x and give s. -1990 Express 26t*3 - 15t*3 + 85t*2 - 5t*3 - 2t*4 - 8t*3 + 3t in the form it2 + jt*4 + at + ht3 + o and give j. -2 Rearrange -32x - 517x - 266x + 9x to ix + s and give s. 0 Express (-3n + n - 2n)(-20125 - 365n + 20125) as an + o + bn*2 and give b. 1460 Rearrange -3 + 6 - 17u - 3 + u - 3 + 3 + (0 + 2u + 0)(1 + 0 + 0) - 3u + u + u to the form b + du and give b. 0 Express -6o + 1393 - 1399 - o3 - o2 + 2o in the form do3 + p + mo + vo2 and give m. -4 Express 2r*3 + 19r - 28r + 7r - 45r2 as gr*3 + ar*2 + xr + h and give g. 2 Express 0k + 154k*2 - 4 + 2k + 4k3 - 4k - 152k2 in the form bk*3 + l + nk*2 + jk and give j. -2 Rearrange 144 - 31n2 + 30n*2 + 95 to t + hn*2 + gn and give h. -1 Rearrange -b*3 - 69b*2 + 119b - 5b2 - 121b to x + yb + fb*3 + wb*2 and give w. -74 Rearrange -2 - 32l*3 + 15l*3 - 10l*4 + 3 + 16l*3 to h + tl*3 + ul*4 + kl*2 + jl and give t. -1 Express (3 + 3 - 7)(4t*2 + 0t*2 - 2t*2) - 17t*2 + 21t*2 - 10t*2 - 5t*2 - 137t + 6t2 - 2t*2 as ot*2 + n + rt and give o. -9 Express -3i4 - 335121 - 2i*2 - i + 5i*4 + 335201 in the form ki + pi2 + ai*4 + u + ci*3 and give a. 2 Express -61u + 8 - 24 - 367u + 16 in the form ku + c and give k. -428 Express -d*2 + 308 + 303 - 613 + 2d - 4d4 - 8d*2 in the form yd + td4 + cd*2 + g + fd*3 and give y. 2 Rearrange (5v - 34v - 8v)(-20 + 3v*3 + 20) + (4v*2 - 5v*2 + 3v*2)(4v - v2 - 4v) to the form yv3 + pv*2 + qv + rv4 + s and give r. -113 Express -4 + 7y - 4y + 0y*3 - 4 - 2y*3 + 6 as fy*2 + h + dy*3 + ny and give d. -2 Express 17g2 + 3 - 2 - 4 + 4 + 17 as kg*2 + og + x and give x. 18 Rearrange -46d2 + 50d*2 + 0 - 10 + 171d - 172d + 1 to ud + t + vd2 and give v. 4 Express 1986 + 11t - 1985 - t*4 - 4t*2 - 9t as gt2 + lt*4 + st + pt3 + d and give g. -4 Rearrange 128k + 6 - 13 + 8 to p + hk and give p. 1 Express 307g*2 - 181g*2 + 5g*2 as lg*2 + cg + f and give l. 131 Express -y*2 - 62 - 167 - 98 + 66 in the form py*2 + ly + x and give l. 0 Express 3029w + w2 - 6062w + 3030w in the form pw + uw2 + x and give p. -3 Rearrange -202x - 249x2 + 202x to rx + t + yx*2 and give t. 0 Rearrange -91 - 16 - 36c + 37c to the form xc + t and give x. 1 Express -10 - 103c + 4 + 7 as hc + n and give n. 1 Express (5r - 3r - 3r)(-2 - 1 + 5)(117 - 399 - 544 - 620) in the form q + ir and give i. 2892 Express (66 - 109 + 85 + 64)(13c + 10c + 0c)(-1 + 0 - 1) as gc + x and give g. -4876 Rearrange 17f3 - f2 + 22f*3 + 2f - 58f3 + 2f*4 to df*2 + bf*3 + mf*4 + t + sf and give s. 2 Rearrange 2y2 - 626y + 165y - 448y + 126y to wy*2 + by + n and give b. -783 Express 17k + 42k + 35k - 16k as qk + l and give l. 0 Rearrange 14s + 12s + s + 4 + 11s - 13s to cs + o and give c. 25 Express (0j + 0j + j)(-8889j*2 + 223j*3 + 8889j*2 + (4j*3 + 0j*3 - 3j*3)(2 - 1 + 0)) in the form mj4 + fj*2 + l + ij + wj3 and give m. 224 Rearrange -110h + 117h2 + 215h - 105h + 1 to ph + rh2 + u and give p. 0 Express 232j*2 + 134j*2 - 53j*2 as yj + v + kj2 and give k. 313 Rearrange 14 + 49c - 13 - 17c + 90c to uc + h and give u. 122 Express (s - 2s - 7s + 16s)(151 + 232 - 67) in the form ys + t and give y. 2528 Rearrange 1 + 6m3 - 2m*3 + 13m*2 - 34m*2 + 3m*3 - 26m*2 to the form o + bm*2 + xm + tm3 and give o. 1 Express 136 + 138 + 45 - 2q - 78 + 159 in the form v + sq and give v. 400 Express -1 + 10 - 8s + 43s2 + 11s - s in the form t + xs + bs*2 and give x. 2 Express (-33 + 19 + 76)(2l + 3l - 2l) + 3l + 2l - 3l as y + rl and give y. 0 Express 626i - 1 + 124i + 1 + 72i as j + ki and give k. 822 Rearrange 49c*2 - 114c*2 + 105c*2 to k + xc + rc2 and give r. 40 Rearrange (7w - 5w - 7w - 8w)(-607 + 88w2 + 607) to the form pw*3 + kw*2 + iw + f and give p. -1144 Rearrange (-2 + 4 + 0)(3g*2 + 3g*2 - 5g*2) + (-4g + 0g + 3g)(3 + 0 + 2)(-80g + 95g + 58g) to the form o + sg + ng2 and give n. -363 Express -8r*3 - 9r*3 + 10r2 + r4 + 9r3 in the form fr*4 + q + zr + mr3 + cr*2 and give m. -8 Express 6v - 2v2 + 0v + 4062v3 - 4v - 3506v3 in the form tv*3 + sv + f + xv2 and give t. 556 Rearrange (-3 + 4 + 5)(48v + 5v*3 - 48v) to cv2 + l + dv + mv3 and give m. 30 Express -175y*2 - 176y*2 + 216y + 524y2 - 170y*2 in the form r + vy*2 + py and give p. 216 Rearrange 431n - 25n - 37n to the form fn + x and give f. 369 Rearrange 2l2 - 24l + 85l + 134l to the form cl2 + a + kl and give c. 2 Rearrange -18773p4 + 12p*2 + 6p*2 + 18776p*4 - p - 5p*3 + 5p*3 to j + sp + bp2 + cp*4 + xp*3 and give c. 3 Express -313t + 262t - 227t in the form ht + o and give h. -278 Express (78 - 16 + 36)(-q - 1 + 1) - 5q + 2q + 5q + 2q - q - 3q + (-3q + 11q + q)(-4 + 2 + 3) in the form yq + w and give y. -89 Rearrange (-7m - 400 + 400)(-44 + 16 - 30m + 25) to s + ym + wm*2 and give y. 21 Rearrange -34k + 14k - 5k*2 - 11k*2 + 17k - 57k2 to ok*2 + s + jk and give s. 0 Express -2110w - 1544w + 2682w in the form iw + o and give i. -972 Rearrange -64r - 332r - 19r to the form p + ir and give i. -415 Express 64462 - 3v2 - 5v - 64472 + 0v2 in the form zv*2 + i + xv and give x. -5 Express (-r - 4r + 3r)(508 - 608 + 424) - r + 2r + 0r in the form t + xr and give x. -647 Rearrange (3 - 3 + 1)(-2i + 11 - 11) - 22i + 12i + 11i - 59 to n + vi and give v. -1 Express 45b - 5 + 31b - 31b in the form yb + x and give x. -5 Express -810m + 379m + 338m + 1 in the form z + fm and give z. 1 Rearrange (-1 + 2 + 2)(-45 + 87 - 18)(2d - 5d + 4d) to the form i + qd and give q. 72 Express ((4b + 11 - 11)(-2 + 6 + 0) + (-3 + b + 3)(2 - 1 - 2) + b + 4b - 3b)((1 - 2 + 2)(-3 - 3 + 5) + 10 + 14 - 8) as kb + c and give k. 255 Rearrange -68b - 13 + 146b*2 + 12 + 68b to tb2 + wb + u and give w. 0 Rearrange (-71y - 29y - 25y + 16y)(588 - 588 - 30y*2) to qy*2 + dy*3 + g + sy and give d. 3270 Rearrange i*4 + 60i + 3i2 - i3 - 29i - 34i to bi*2 + ki*3 + gi*4 + y + ui and give u. -3 Express -p - 115 + 20p2 + 5 - 23p*2 + 9 as lp + t + jp2 and give l. -1 Rearrange 4a - a - a + (1 + a - 1)(2 + 0 - 3) + 4a - 3a + 0a - 8 + 176a + 0 - 175a to l + va and give l. -8 Express -201 + 406 - 794h - 207 as rh + s and give r. -794 Express 36 - 72 + 36 - 108v*2 + 2v in the form lv2 + cv + u and give l. -108 Express -440r + 4 - 598r - 4 in the form ar + s and give a. -1038 Express 2521 - 5048 + 2527 + 36i as f + ri and give f. 0 Rearrange -30d*2 + 29d*2 - 13 + 4d3 + 13 - d4 to l + td3 + ad*2 + id + yd4 and give a. -1 Rearrange (3 + 4 + 9)(2s - s + s) - 7s - 3 + 3*s -	{ "pile_set_name": "DM Mathematics" }
+ 3 - 3 + l*4 - 2l*3 - 10l*4 - 19320l*2 + 1 - 2 + 19316l*2. -13l*4 - 2l*3 - 4l*2 - 1 Expand (-184m - 182 + 182)(0m + m - 2m). 184m*2 Expand -10j*4 + 6j*4 - 8j*4 + (-3 + 4 + 1)(-1 - 2j4 + 1). -16j*4 Expand 15b*2 - 15b*2 - 12b*3 + 2b*3 - 4b*3 + 6b*3 + (0 - 2b + 0)(-2b2 - b2 + 2b2) - b3 + 2b*3 - 3b*3. -8b*3 Expand (1 + 0 + 0)((-3229 - 323h + 3229)(2 + 0 - 4) + 2h + 2h - 3h). 647h Expand (3 - 3 + 3)(2f2 - f2 + f*2) + 0f2 + f2 + 0f2 + (-2 - 2f + 2)(f + 3f - 5f) - 3f*2 - 3f*2 + 3f*2 + 30f*2 - 16f*2 + 13f*2. 33f*2 Expand 0n*3 + 13n3 - n3 + (-37n - 6n - 43n)(n*2 - 3n + 3n). -74n*3 Expand 0n - 3n + 6n + 2n - n + 8n + (4n - 2n + n)(0 + 3 - 1) - 2n + 5n - 4n. 17n Expand (-4v2 + v2 + v*2)(-2v + 1 - 1) + 0v*2 - 2v*3 + 0v2 + v2 + 4v3 - v2 - 6835v + 6835v + 1 - 31v*3. -25v*3 + 1 Expand (-2b + 3b + 0b)(4 - 4 - b3) - 32b*4 + 56b*4 - 40b*4. -17b*4 Expand (-5m + 37m - 12m)(2m*2 - 3m + 0m2 - 4m*2). -40m*3 - 60m*2 Expand -151v*2 + 7 - 2v*2 + 8 - 15 + (0v*2 + 3v2 - v2)(4 - 3 - 2). -155v*2 Expand -4m*2 - m + m + (0m + 0m + 2m)(0m - 3m + 4m) + (1 + 0 + 0)(18m - 18m - 128m*2) + 3m*2 - 6m*2 + 2m*2. -131m*2 Expand 0f*3 + 2f3 - f3 + (f*2 - 4f*2 + 5f*2)(-3f + 3f + f) - 4f3 + 2f*3 + 0f*3 + (5f - 3f + 0f)(-3f + 4994f2 - 5122f*2 + 3f). -255f3 Expand (h + 0h - 2h)(1 - 2 + 2)(-5 + 4 + 9h + 4). -9h2 - 3h Expand (5o - 5o + 10o2)(14o + 10o - 6o) + 3o*3 + 0o*3 - 4o*3. 179o*3 Expand (-1 - 2l + 1)(2 + 5 - 2)(2l - 5l + l)(1 - 1 - 6l)(-l + l - l). 120l*4 Expand (6t*4 + 0t*4 - 3t*4)(t + 3 - 3) + 4t5 - 3t5 + t5 + (0t2 - 2t*3 + 0t*2)(2t2 - 2t2 - t2). 7t5 Expand 7v*3 - 7v*3 - 667v*5 + 896v*5 + (-2v4 - v2 + v*2)(4v - 2v + 0v) + 2v5 - v5 + 0v5. 226v*5 Expand 45 - 45 + 8c5 + (-c3 - 4c3 - 2c*3)(-4c2 + 0c*2 + 2c*2). 22c*5 Expand (-u - u + 3u)(1 - 2u - 1)(9u*2 - 28u*2 - 23u*2). 84u4 Expand (-m2 + m*2 + 3m*4)(-157 - m - 83 + 4m + 85). 9m*5 - 465m*4 Expand 4h2 - h2 + 3h2 + (h - 4h + h)(-h + 2h - 2h) - 2h*2 - 4h*2 + 3h2 + h2 + 2h2 - h2 - 3 + 3 - 2h*2 + 3h2 - h2 + 3h2. 10h*2 Expand 240m - 240m - 7m*5 + (4m*2 + 0m*2 + 2m*2 + (1 + 0 + 0)(-2m + 2m + m*2))(-2m + 2m - 4m3). -35m*5 Expand -3h + 4h + 3h + (4 - 4 - 2)(0h - h - 7h). 20h Expand (-64 + 254 + 352 - 1)(2i*5 + 0 + 0). 1082i*5 Expand (-p + p + 4p)(2 - 3 - 1) + (5p + p - 3p)(2 - 3 + 0) + 185 - 94 - 3p + 4p. -10p + 91 Expand (-2b*2 - 3b + 3b)(0 + 0 - b) - 1247b3 + 195706 - 195706. -1245b*3 Expand 5k - 5k - 4k*3 - k + k - 2k3 + k3 + 0k3 + 0k*3 + (2k2 + k2 - 4k2)(-k + 2k - 3k) + 4 - 4 + 2k3 + 2k*3 + 3k*3 + 7k*3. 11k*3 Expand (11t + 4t5 - 11t - 2t4 - t5 + 2t*4 + (3t - 3t - 2t*2)(t*3 - 4t + 4t) - 4t*5 + 4t*5 + 7t*5)(-1 - 1 - 3). -40t5 Expand (-2x*2 + 8x*2 - 2x*2)(-4x + 2x - 3x + (4x - 3x + 0x)(-1 + 1 + 1) + 0x - 2x + 4x) + x*3 + 2x3 - x3. -6x3 Expand (-3s + 5s - 3s)(3 - 7 + 3)(-3 + 1 + 0 + (-3 - 2 - 4)(-2 + 1 + 2)). -11s Expand (2 - 2 - 2)(-140 + 140 - 43f + 188f). -290f Expand (4 - 4 + 3o2)(-o + 7o + 3o) + (4 - 2o - 9 - o2 + o)(-o + 0 + 0). 28o3 + o2 + 5o Expand 2n5 - 3n*5 + 3n*5 + (0n3 - n3 + 0n3)(-n*2 - 3n + 3n) + (2n*2 - 2n2 + n2)(2n + n - 59n)(6n2 + n2 - 4n*2). -165n*5 Expand (0 - 1 + 0)(-48s - 25s - 74s - s + 3 - 3 - s + 2s - 2s + (0s + 0s + 2s)(1 - 3 + 1) + 0s - 2s + 0s). 153s Expand (-37 - 6b + 74 - 35)(0 + 4 + 6). -60b + 20 Expand (n - 4n + 4n)(6n*3 + 6n*3 - 13n*3) + 0n*4 + 6n*4 - 8n*4. -3n*4 Expand (3w2 + w2 - w*2)(7w2 - 3w*2 - 11w*2) + (0w + 3w - 2w)(-2w3 - w3 + w*3). -23w4 Expand (t4 + t4 - t4)(18 - 4 + 4) + (4t - t - 2t)(-2t3 + 0 + 0) - 4t*4 - 2t*4 + 4t4 - t3 + t3 + t4. 15t4 Expand (6z*4 - 3 + 3)(z + 3z - 6z) + 20z5 - 43z*3 + 43z*3. 8z*5 Expand 42h*2 - 6h2 - h2 + (-2h - 4 + 4)(-5h + 3h + 3h). 33h*2 Expand 9k*3 - 18k + 18k - 7k3 + 4 - 4 + (-k + k - k2)(-2k + 4k - k) + 0k3 - k3 + 2k3. 2k*3 Expand (-2o - o + 2o)(-810 - 1693 + 335 + 461 - 1378). 3085o Expand (0 + 3 + 2)(-4g5 + 6g*5 - 3g*5) + 7g*5 + 17g*3 - 17g*3. 2g*5 Expand (5l - 10 + 10)(3l3 + l2 - l2) + (l3 + 4 - 4)(2 - 2 + l) + 5l*4 + 7l*4 - 5l*4. 23l*4 Expand -76u + 14 + 12 + 13 - 61 + (2 + 2u - 2)(-1 + 0 + 3). -72u - 22 Expand 5t - 5t - 2t*2 + (0t + 0t - 2t*2)(24 + 44 + 31). -200t2 Expand (1 + 1 - 2i - 3)((-1 + 3 + 0)(4 - 4 - 2) + 3 - 5 + 3 - 49 + 23 - 39). 136i + 68 Expand (-4u + 3u4 + 4u)(-2u + 3u + 0u) + (-3u4 - 15u*4 + 9u*4)(-3u - 3 + 3) + u5 + 5u*5 - 4u*5. 32u*5 Expand (-32v - 52v + 108v)(6 - 4 - 3) + (-2 - 2 + 2)(2v - 2v - 2v). -20v Expand (-25 + 6 - 72)(4f*4 - 4f*4 - 3f*4). 273f*4 Expand (-2g*3 + 0g*3 + 0g*3)(-3 - 26g2 + 21g - 21g). 52g*5 + 6g*3 Expand (-2m*3 + 1 - 1)(3m + 4m - 5m) - 52m*3 + 11m4 - m4 + 54m3. 6m*4 + 2m*3 Expand (-4 + 3 + 4)(-3 - 46a - 62a + 126a). 54a - 9 Expand ((-2 + 0 + 0)(-1 + 1 + 1) - 1 - 1 + 1 + 0 + 1 - 2)(1 + 0 + 1)(3a - a - 7a)(-4 + 3 + 2). 40a Expand (2a - 5a + 4a)(-3a*4 - 7a*3 + 7a3) + a3 - a5 - a3 + 31a4 - 7a*5 - 31a*4. -11a*5 Expand (2 - 2 - v + (1 + 0 + 1)(2v + 3 - 3) + 4v - 2v - 4v + 2v - 3 + 3 + 4823 - 4823 - 94v)(6v - 2v + 0v). -364v2 Expand (j3 + 0j3 + j3)(-41j*2 + 205j*2 + 30j*2). 388j*5 Expand (-22h + 71h - 31h)(0h - 4h + 3h) + (h + 2h + 1 - 4h)(-4h - h + 6h). -19h*2 + h Expand (-2j - 5 + 5)(217j + 179j - 146j + 2)(-j - 2 + 2) + 2j*3 - j + j. 502j*3 + 4j*2 Expand -5i*3 + 4i*3 + 3i*3 + 3i*3 - 5i*3 + 3i*3 - 25 + 25 - 8i*3 + (-i + i - i)(-i + i - i*2). -4i*3 Expand (21h*2 - 24h + 24h)(-h - 4h - h). -126h*3 Expand (-5 - 9 + 5)(j + 3j - 2j) + (-4 + 2 - 2)(-4j + 5j + 2j). -30j Expand (-1 + 1 - 17)(-6o - 5o + 0o) + 2o + 3o - 2o. 190o Expand -1825 + 1825 + 89p + (0 + 2 - 1)(p - p - 2p). 87p Expand (2 - 2 - y)(3y2 - y2 + 0y*2) + 0y*3 - 4y*3 - 3y*3 + 6y*3 + 4y*3 - 2y3. -y3 Expand (-f3 + f3 - f*3)(-7 + 17 + 14 + f). -f*4 - 24f*3 Expand 2r*3 - 2r*3 + 4r*4 + ((-5r + 3r + 3r)(-3r + 3r + r2) + 1 + r3 - r - 1)(6r - 7 + 7). 16r*4 - 6r*2 Expand (-787 + 642 + 407)(-3k + 0k + 6k). 786k Expand (2x - 1 + 1)(1 + 3 - 2)(-12 - 5 + 4). -52x Expand (3w2 - 5w2 + w2)(2 - 2 + 6) - 189 + 189 + 292w*2. 286w*2 Expand (7a*3 + 94a - 94a)((1 - 1 + 1)(-2 + 3 - 2) - 4 - 1 + 3 + (0 + 0 - 2)(-1 - 4 + 3) - 4 + 2 + 0 - 1 + 6 - 2 - 2 - 1 + 4). 21a3 Expand (x - 7 + 7)((-2x + 0 + 0)(x + x - x) + 7 - 5x2 - 7). -7x*3 Expand (-2r + 2r + 2r)(3 - 3 - 2r*3) + 2r*4 - 5r*2 + 5r*2 + (-21r*3 + 8r*3 - 29r*3)(-2r + 4r - 4r). 82r*4 Expand (4k + 6k + k)((4 - 3 + 0)(-6 + 3 + 1) + 3 - 4 + 0 + 3 + 0 - 2 + 0 - 1 + 2 - 1 - 3 + 2 + 2 - 2 - 2 + 3 - 2 + 0). -44k Expand -149w + 58w*4 + 149w + (-2w2 + 2w*2 + 2w*3)(-2w + w + 0w) + w*4 + 2 - 2 - 4w*4 + 7w*4 + 5w*4. 65w*4 Expand (13 - 14 - 17 - 25)(-34t - 37t + 45t) + (-2 - 3 + 3)(3 - 2t - 3). 1122t Expand (-6 + 6 + 3d3 + (d2 + d2 - 3d*2)(-2d - 2d + 2d))(14 + 18 - 3d - 27). -15d*4 + 25d*3 Expand (-6i - 30 + 30)(1 - 4 + 2 - i)(-3 + 2 + 3). 12i2 + 12i Expand n*5 + 0 + 0 + (0n*2 + 4n*2 - 5n*2)(-2769 - 42n3 + 2769). 43n*5 Expand (96 + 29z*3 - 96)(3z + 8 + 0z - 6)(1 - 1 + z + 0 + z + 0 + z - 3z + z + (-1 + 2 - 3)(-3z - 4z + 5z) - z + 2 - 2 + 2z + 3 - 3 - 1 + 1 + 3z). 783z5 + 522z*4 Expand (-101l*3 + 101l*3 + 35l*4)(-2 + 2l + 2)(1 + 0 - 2) + (-2l4 - l4 + 2l*4)(-3l - l + l). -67l**5 Expand (2	{ "pile_set_name": "DM Mathematics" }
icrogram in nanograms? 200 What is 21/2 of a meter in millimeters? 10500 How many hours are there in 957.3563 weeks? 160835.8584 What is three tenths of a milligram in micrograms? 300 What is thirty-seven halves of a millisecond in microseconds? 18500 What is fifteen quarters of a meter in centimeters? 375 How many micrometers are there in 3/5 of a millimeter? 600 What is 9/10 of a decade in years? 9 What is 1/4 of a tonne in kilograms? 250 What is three tenths of a decade in years? 3 How many nanoseconds are there in 635551.6 weeks? 384381607680000000000 How many millilitres are there in seventeen halves of a litre? 8500 What is three tenths of a litre in millilitres? 300 How many months are there in fifty-nine thirds of a century? 23600 Convert 149049.3m to millimeters. 149049300 How many millilitres are there in 74/5 of a litre? 14800 How many millimeters are there in 2.665616nm? 0.000002665616 What is 1755.221cm in kilometers? 0.01755221 What is 805174.5 centimeters in micrometers? 8051745000 What is 0.1563966 kilograms in nanograms? 156396600000 What is one quarter of a milligram in micrograms? 250 What is 912789.1 years in centuries? 9127.891 What is 7/4 of a kilogram in grams? 1750 Convert 85134.07um to nanometers. 85134070 How many grams are there in 3/40 of a tonne? 75000 How many millimeters are there in 3/8 of a meter? 375 What is 45/2 of a century in decades? 225 How many kilograms are there in 6046.253mg? 0.006046253 Convert 70776.19 milligrams to grams. 70.77619 Convert 38.00142 milligrams to nanograms. 38001420 How many years are there in 0.2058289 centuries? 20.58289 What is 25/4 of a millimeter in micrometers? 6250 How many nanograms are there in 0.3324835 tonnes? 332483500000000 What is two fifteenths of a day in minutes? 192 How many years are there in 1/5 of a century? 20 Convert 1.886458 nanograms to grams. 0.000000001886458 Convert 1389370.86s to days. 16.08068125 How many kilograms are there in 12/25 of a tonne? 480 How many litres are there in 0.1749777 millilitres? 0.0001749777 How many nanograms are there in six fifths of a microgram? 1200 How many months are there in 1/15 of a decade? 8 What is 4555.131 meters in millimeters? 4555131 Convert 23788.8873us to days. 0.00000027533434375 How many micrograms are there in 0.9920876ng? 0.0009920876 How many milliseconds are there in 8.887242 weeks? 5375003961.6 How many milliseconds are there in 54.1752us? 0.0541752 Convert 6.70989 milligrams to grams. 0.00670989 What is 1100.599ng in micrograms? 1.100599 How many meters are there in 246264.7 kilometers? 246264700 What is 89716.8mm in centimeters? 8971.68 How many nanometers are there in fifty-nine fifths of a micrometer? 11800 Convert 703.6148 kilograms to nanograms. 703614800000000 What is 2746914.9 months in millennia? 228.909575 What is 209.180178 milliseconds in days? 0.000002421066875 Convert 199.5421 days to minutes. 287340.624 What is twenty-nine thirds of a week in minutes? 97440 How many micrometers are there in three eighths of a millimeter? 375 What is thirteen quarters of a litre in millilitres? 3250 Convert 2463.925 weeks to milliseconds. 1490181840000 How many weeks are there in 5273.744 days? 753.392 How many microseconds are there in 4594.278 milliseconds? 4594278 What is 1/10 of a litre in millilitres? 100 What is fifty-two fifths of a century in decades? 104 What is seventy-one quarters of a litre in millilitres? 17750 How many years are there in 1102354.8 months? 91862.9 How many minutes are there in three tenths of a hour? 18 What is 8/25 of a litre in millilitres? 320 How many millilitres are there in 21/4 of a litre? 5250 How many millimeters are there in 21/4 of a meter? 5250 How many centimeters are there in 1/20 of a meter? 5 Convert 49.313ml to litres. 0.049313 How many millimeters are there in thirty-seven halves of a centimeter? 185 How many hours are there in 1145813.1 minutes? 19096.885 What is 11/8 of a week in minutes? 13860 How many millimeters are there in 447.6944 kilometers? 447694400 How many seconds are there in 1/20 of a minute? 3 What is 2242.005 litres in millilitres? 2242005 Convert 156.2222 kilometers to millimeters. 156222200 What is 0.1587212nm in centimeters? 0.00000001587212 Convert 85079.65s to milliseconds. 85079650 What is 88/3 of a day in minutes? 42240 What is 700080.6 litres in millilitres? 700080600 What is 892380.3um in meters? 0.8923803 How many grams are there in seven quarters of a kilogram? 1750 How many months are there in 376.5433 decades? 45185.196 What is 61.57306 litres in millilitres? 61573.06 How many millilitres are there in 5/8 of a litre? 625 How many minutes are there in five quarters of a day? 1800 How many grams are there in 0.5866507 nanograms? 0.0000000005866507 What is 25/2 of a tonne in kilograms? 12500 How many decades are there in 1/10 of a millennium? 10 How many minutes are there in twenty-five quarters of a day? 9000 How many micrometers are there in 6/25 of a centimeter? 2400 Convert 4.63985 millilitres to litres. 0.00463985 How many seconds are there in 1/9 of a day? 9600 How many centuries are there in 24106.428 months? 20.08869 What is 20.711478 months in centuries? 0.017259565 Convert 55.71269ug to tonnes. 0.00000000005571269 What is 25/4 of a day in hours? 150 How many days are there in 154994.553ms? 0.0017939184375 Convert 446.4414ng to tonnes. 0.0000000000004464414 What is 25/4 of a litre in millilitres? 6250 What is 648368.5m in millimeters? 648368500 How many years are there in 1/5 of a millennium? 200 How many months are there in 8/3 of a century? 3200 Convert 7999.137 nanometers to centimeters. 0.0007999137 How many kilograms are there in 810.9744 milligrams? 0.0008109744 Convert 1828.48941 seconds to days. 0.021163071875 What is three tenths of a micrometer in nanometers? 300 What is 22.8177999 milliseconds in weeks? 0.00000003772784375 How many millilitres are there in 21/4 of a litre? 5250 Convert 0.625275 meters to centimeters. 62.5275 What is 601397.9 grams in nanograms? 601397900000000 How many microseconds are there in 5127.874ns? 5.127874 What is 17/4 of a litre in millilitres? 4250 What is 1/10 of a gram in micrograms? 100000 Convert 0.2537636l to millilitres. 253.7636 How many grams are there in 3/32 of a tonne? 93750 How many centuries are there in 3158.81 millennia? 31588.1 How many days are there in 25390762.2ms? 0.2938745625 What is thirteen eighths of a milligram in micrograms? 1625 What is 3/40 of a meter in micrometers? 75000 How many kilograms are there in six fifths of a tonne? 1200 What is 41.203 milligrams in nanograms? 41203000 What is 0.4833207 micrometers in kilometers? 0.0000000004833207 What is 86933.14 centuries in months? 104319768 What is 29/2 of a millennium in years? 14500 What is 461.2228mm in meters? 0.4612228 Convert 4707142.2 nanoseconds to days. 0.0000000544808125 What is five eighths of a litre in millilitres? 625 What is seven quarters of a week in hours? 294 How many millimeters are there in 1/64 of a kilometer? 15625 What is 260.96886 months in years? 21.747405 How many meters are there in 513955.9mm? 513.9559 What is 5/8 of a litre in millilitres? 625 Convert 6.295628 litres to millilitres. 6295.628 What is four thirds of a hour in seconds? 4800 Convert 502247.2 centuries to millennia. 50224.72 What is 4/15 of a millennium in months? 3200 How many milligrams are there in 47619.28 kilograms? 47619280000 What is 55/2 of a litre in millilitres? 27500 What is 34.73999 hours in seconds? 125063.964 Convert 0.7803613 litres to millilitres. 780.3613 How many decades are there in 5.899022 millennia? 589.9022 How many micrometers are there in 2.517757km? 2517757000 Convert 86.57693 centuries to decades. 865.7693 How many nanograms are there in 338.863kg? 338863000000000 What is 98.13873 millilitres in litres? 0.09813873 How many kilometers are there in 1861.921m? 1.861921 What is 26/5 of a week in minutes? 52416 How many nanograms are there in 47/4 of a microgram? 11750 What is 16/15 of a century in months? 1280 Convert 395236.9cm to nanometers. 3952369000000 Convert 85893.15 meters to millimeters. 85893150 Convert 74683.57 litres to millilitres. 74683570 Convert 4.9170457 days to weeks. 0.7024351	{ "pile_set_name": "DM Mathematics" }
y = 5 - 1. Suppose -2l + yq + 140 = 2l, -4l - 2q + 140 = 0. Calculate the remainder when l is divided by 12. 11 Suppose 5w - 85 = -3f + 91, 0 = -5w - 5f + 180. What is the remainder when w is divided by 19? 15 Let l(q) = 7q - 4q + q2 - 9 - 3q. What is the remainder when l(-8) is divided by 19? 17 Let n(l) = l - 10. Let w be n(11). Calculate the remainder when (-294)/(-4) + w/2 is divided by 19. 17 Let o = 34 + -22. Let g be 6/21 + o/7. Suppose 72 = 4b - 4a, -3b - b + 42 = ga. Calculate the remainder when b is divided by 8. 5 Suppose 4j - 3a - 482 = 0, -7j + 5a = -2j - 605. Calculate the remainder when j is divided by 30. 29 Suppose 4w = -d + 57, -88 - 2 = -5w - 5d. Suppose -6o = -2o - 20. What is the remainder when w is divided by o? 3 Let c be 126/4 - 6/(-4). Let z be 20(-1 + c/15). Let j = z - 11. What is the remainder when 38 is divided by j? 12 Suppose -d + 63 = 2n, d - 15 = -4d. Calculate the remainder when 78 is divided by n. 18 Let i(y) = 3y2 - y3 - 1 + 2y3 + y2 - 3y*2 + y. What is the remainder when 24 is divided by i(2)? 11 Suppose -3j + 6j = 0. Suppose jp + 2p = 6. Calculate the remainder when (-13)/((-3)/(p + 6)) is divided by 20. 19 Suppose 2 = 6n - 76. What is the remainder when 62 is divided by n? 10 Let y be 1/(-4) - (-26)/8. Calculate the remainder when 7 is divided by (y - 2)-1-4. 3 Let u be 6/(-15) - 114/15. Let y(v) = v*3 + 7v*2 - 10v - 5. Calculate the remainder when y(u) is divided by 2/8 + (-46)/(-8). 5 Let n = -2 + 5. Let i be (n + 6)/(6/20). Suppose -f + i = f. Calculate the remainder when 43 is divided by f. 13 Suppose -3u - 37 = -4i, -5i = -0i - 3u - 44. Suppose -3f = 4x - 78 - i, f = -4x + 95. Let q(v) = v + 3. What is the remainder when x is divided by q(4)? 4 Let i(c) = c*3 + 3c*2 - 2c - 3. Suppose 15 = 3w + 3l, -2l + 6 - 2 = -w. Suppose k + wk = 21. What is the remainder when k is divided by i(-3)? 1 Suppose 76h - 71h - 60 = 0. Let v = 13 + -6. What is the remainder when h is divided by v? 5 Let j be ((-2)/(-6))/(9/81). Calculate the remainder when 23 is divided by 01/j - -12. 11 Suppose 5 = -4i - 3f, 0i - 3f + 7 = -2i. What is the remainder when 19/(-95) + 156/5 is divided by -221i/4? 9 Suppose 0 = -5y - 10, -2y = 3m - 75 - 29. What is the remainder when m is divided by (26/4)/(10/20)? 10 Suppose 4u = -2a + 26, -3u - 2a = -15 - 4. What is the remainder when u is divided by ((-1)/3)/((-3)/36)? 3 Suppose 2y - 2l = 8, 2y + 3l + 7 = -0. Let v be (-2 + 1 + 1)/(-2). Calculate the remainder when 2 is divided by 2/(y + v + 1). 0 Let w(z) = 8z + 10. Calculate the remainder when 162 is divided by w(4). 36 Let c = -32 - -60. Calculate the remainder when 81 is divided by c. 25 Let w be (-1)/(-2)(0 + 0). Let o = 3 - w. Suppose 5q - 6q + 7 = 0. What is the remainder when q is divided by o? 1 Suppose 0 = 2x + 3y - 13, y = 3x - 7x + 11. What is the remainder when (-22)/3(-3)/x is divided by 4? 3 Let j(z) = -8z - 5. Let u = -12 - -4. Calculate the remainder when j(u) is divided by 15. 14 Let y(z) = 3z + 9. Calculate the remainder when 117 is divided by y(5). 21 Let h = -53 - -74. What is the remainder when 83 is divided by h? 20 Suppose 0 = u - 5u + 100. Let y(x) = 2x*2 - 4. Calculate the remainder when u is divided by y(3). 11 Let k(v) = -2v - 12. What is the remainder when k(-12) is divided by 7? 5 Let w be (-2)/((-44)/12 - -3). Suppose ws = 14 + 31. What is the remainder when 59 is divided by s? 14 Let y(h) = 14 + 11h - 12h - h2 - h3 + 11. Let f be y(0). Suppose -5m + f = -15. What is the remainder when 21 is divided by m? 5 Suppose u + 25 = 2s, -5u + 70 = 4s + s. Calculate the remainder when 20 is divided by s. 7 Let k(b) = 2b*2 - 7b + 9. Let v(c) = -3c2 - 28c + 12. What is the remainder when k(6) is divided by v(-9)? 18 Suppose 0m + 2m + 69 = 5f, -5f + 60 = -5m. Calculate the remainder when f is divided by 4. 3 Suppose 3 = -4u + 131. Suppose 0 = 2r + 2r - u. What is the remainder when 22 is divided by r? 6 Suppose 0 = -12u + 9u - 147. What is the remainder when 82 is divided by (1 - -5)u/(-14)? 19 Let p = 5 - 1. Calculate the remainder when 4 is divided by p. 0 Let u = 32 - 30. Suppose ut + 52 = 68. Let j(l) = l*3 + 7l*2 + 3l - 5. Calculate the remainder when j(-5) is divided by t. 6 Let r be -5 - (0 + -4) - -3. Suppose -2o - ro - 211 = -5h, 0 = -5o - 20. Let q(z) = 9z + 2. What is the remainder when h is divided by q(2)? 19 Suppose 3o = 5y - 0 - 29, 4y - 4o = 28. Suppose -36 = yp - 0p. Let i(r) = -r2 - 9r + 13. Calculate the remainder when i(p) is divided by 7. 6 Suppose 5b = b + 28. Let t = b - 5. Suppose -a + 2 = -ta, 88 = 4h + 4a. Calculate the remainder when h is divided by 13. 11 Let i(j) = -j*3 - 4j*2 + 3j + 2. Let y be i(-5). What is the remainder when 40 is divided by (-8)/3(-63)/y? 12 Suppose 0 = 2s - 4, -2y = 2s + 19 - 59. Calculate the remainder when 68 is divided by y. 14 Let x(m) = m + 7. Let n be x(-7). Let a = n + 5. Suppose -43 + 8 = -al. What is the remainder when l is divided by 4? 3 Let c = 32 - -13. Let q = -19 + c. Suppose -3f = -0f - 27. Calculate the remainder when q is divided by f. 8 Suppose z - 17 = -0. Suppose 0 = -2i + 7 + 5. Let x = z - i. Calculate the remainder when 41 is divided by x. 8 Let a = 153 - 90. What is the remainder when a is divided by 23? 17 Suppose 0 = c + 5i, 4i - 3i - 8 = -c. Let h = -61 - -98. What is the remainder when h is divided by c? 7 Calculate the remainder when -4 - (-245 + 2) is divided by 19. 8 Let r(z) = 4z2 - 5z - 5. Let b be r(-3). Suppose b = 3l - l. What is the remainder when l is divided by 8? 7 Let l(n) = 1 + 3 - 3 + 3n*2 + n. What is the remainder when l(4) is divided by 14? 11 Let u = -48 + 91. Let t(q) = -q + 3. Let m be t(0). What is the remainder when u is divided by 13 + 4 + (m - 5)? 13 Let i(m) = 2m*2 - 5m + 3. Let w be i(3). Suppose 3h + 2j + 5 = 0, -3h + 15 = -3j - 0. Calculate the remainder when h is divided by 7/(-42) - (-7)/w. 0 Let r = -4 + 71. Calculate the remainder when r is divided by 17. 16 Suppose 5b - 4 = 3b + 2i, -i + 10 = -5b. Let m = b - -15. Calculate the remainder when 23 is divided by m. 11 Suppose 5v + 0 = 35. Let x(b) = b2. Suppose -4m = 3o + 2, -3m + 5 = -2o + 15. Calculate the remainder when v is divided by x(m). 3 Suppose -3m + 6m = 21. Calculate the remainder when m is divided by 2. 1 Let k = 132 - 120. Calculate the remainder when 22 is divided by k. 10 Suppose 0 = x - 2x. Suppose x = -y + 7 + 22. What is the remainder when y is divided by 8? 5 Let y be 26/8 + 2/(-8). Suppose 0 = f - yf + 26. Calculate the remainder when 195/5 + (-6)/3 is divided by f. 11 Let f = -6 + 12. Calculate the remainder when (2/2)/((-9)/(-153)) is divided by f. 5 Let b(o) = -41o + 1. Let g be b(1). What is the remainder when 3/2g/(-6) is divided by -66 - -78 - (7 - 1)? 4 Suppose -2p + 76 = -0p. Let n(d) = -9d3 + d2 - d - 1. What is the remainder when p is divided by n(-1)? 8 What is the remainder when 73 is divided by (-76)/69/(-6)? 16 What is the remainder when 95 is divided by ((-4)/(-10))/(1/50)? 15 Suppose -3w - 4c - 3 = 0, -c + 6 = 3w - 0w. Let v(h) = 2h*3 - 4h*2 - h + 2. What is the remainder when v(w) is divided by 6? 5 What is the remainder when 37 is divided by -3(-4)/((-12)/(-19))? 18 Suppose 2l - 17 = -2y - l, -y = 4l - 6. Suppose -5u + 2 = 3b, -b + 12 = b - 2u. Suppose 166 = bz + 50. Calculate the remainder when z is divided by y. 9 Let k = -37 - -51. What is the remainder when k is divided by 5? 4 Let w(a) = 52a*3 + 2a + 2. Let f be w(-2). What is the remainder when (-3)/(-15) - f/10 is divided by 11? 9 Suppose 0 = -3u - 9, z = -5u - 3 - 12. Suppose -3a + 117 = -za. What is the remainder when a is divided by 14? 11 Let w(g) = -g*2 - 4g + 1. Let h(f) = -f - 4. Let b be h(0). Let i be ((-2)/4)/(b/(-24)). Calculate the remainder when w(i) is divided by 3. 1 Suppose p + p = 2, 4m + 5p = 93. Calculate the remainder when 86 is divided by m. 20 Let i(a) = a*3 - 4a*2 + 3a - 1. Let b be i(3). Let q = 1 + b. Suppose -5u + 4u + 11 = q. What is the remainder when u is divided by 6? 5 Let j be 2/5 - (-336	{ "pile_set_name": "DM Mathematics" }
ultiple of 80 and 2000. 2000 Calculate the smallest common multiple of 5 and 120. 120 Calculate the common denominator of 65/18 and 91/24. 72 What is the lowest common multiple of 20 and 7250? 14500 Calculate the least common multiple of 9 and 473. 4257 Calculate the least common multiple of 6 and 4170. 4170 Calculate the smallest common multiple of 9 and 16. 144 Find the common denominator of -49/5196 and -3/10. 25980 Calculate the lowest common multiple of 40 and 110. 440 Calculate the smallest common multiple of 4 and 4. 4 Calculate the common denominator of 29/312 and 149/6. 312 Calculate the lowest common multiple of 4 and 460. 460 Calculate the common denominator of 41/40 and 101/12. 120 Calculate the common denominator of 53/1100 and 43/300. 3300 What is the lowest common multiple of 2 and 86? 86 What is the smallest common multiple of 164 and 1927? 7708 Find the common denominator of 39/5 and 18/5. 5 Calculate the lowest common multiple of 9851 and 2. 19702 What is the smallest common multiple of 225 and 3050? 27450 Calculate the common denominator of -77/54 and -37/1114. 30078 Calculate the least common multiple of 16 and 60. 240 What is the common denominator of 42/65 and 48/11? 715 Calculate the smallest common multiple of 9 and 1866. 5598 Calculate the lowest common multiple of 5721 and 1. 5721 Calculate the smallest common multiple of 2184 and 6. 2184 Calculate the lowest common multiple of 180 and 72. 360 What is the smallest common multiple of 4 and 12? 12 Find the common denominator of -145/24 and -35/114. 456 What is the least common multiple of 6 and 282? 282 What is the least common multiple of 5121 and 3? 5121 What is the common denominator of -41/1059 and 113/12? 4236 Find the common denominator of -2/1265 and 73/6578. 32890 What is the common denominator of 17/294 and -5/42? 294 Calculate the common denominator of 59/14 and -95/1508. 10556 What is the least common multiple of 957 and 6? 1914 What is the least common multiple of 450 and 1800? 1800 Calculate the smallest common multiple of 15 and 1563. 7815 What is the common denominator of 4/15 and 43/807? 4035 Calculate the common denominator of -17/27 and -43/9216. 27648 Calculate the common denominator of -97/16 and -31/128. 128 What is the smallest common multiple of 871 and 26? 1742 What is the least common multiple of 108 and 564? 5076 Calculate the common denominator of 79/15648 and -33. 15648 What is the lowest common multiple of 9120 and 912? 9120 Find the common denominator of 169/126 and -77/531. 7434 Calculate the lowest common multiple of 215 and 602. 3010 Find the common denominator of -76/21 and -77/4. 84 Calculate the common denominator of -39/1765 and -86/5295. 5295 Calculate the smallest common multiple of 6369 and 4632. 50952 Find the common denominator of 43/16 and -113/37392. 37392 What is the smallest common multiple of 1 and 3464? 3464 What is the lowest common multiple of 64 and 176? 704 Find the common denominator of -23/11442 and -11/6. 11442 What is the lowest common multiple of 11 and 661? 7271 Calculate the common denominator of -7/100 and 101/580. 2900 Calculate the smallest common multiple of 2378 and 20. 23780 What is the least common multiple of 412 and 4? 412 Calculate the smallest common multiple of 8 and 1854. 7416 Calculate the lowest common multiple of 11 and 3652. 3652 Calculate the common denominator of -24/7 and -46/933. 6531 Calculate the smallest common multiple of 3204 and 1869. 22428 What is the smallest common multiple of 11847 and 18? 71082 Calculate the smallest common multiple of 4200 and 312. 54600 What is the lowest common multiple of 9 and 17? 153 Calculate the lowest common multiple of 600 and 1200. 1200 Calculate the common denominator of -37/770 and 64/45. 6930 Calculate the lowest common multiple of 15 and 1180. 3540 Calculate the common denominator of -49/4479 and 59/30. 44790 Calculate the smallest common multiple of 1221 and 220. 24420 What is the least common multiple of 36 and 2732? 24588 What is the common denominator of 47/40 and -25/1268? 12680 Calculate the common denominator of 18/769 and -25/6. 4614 Calculate the common denominator of 107/200 and 23/190. 3800 Calculate the smallest common multiple of 28 and 8. 56 What is the common denominator of -5/12 and 103/552? 552 Calculate the least common multiple of 1352 and 7. 9464 Calculate the common denominator of 17/30 and 87/50. 150 Calculate the common denominator of -51/8995 and 42/55. 98945 Calculate the smallest common multiple of 120 and 36. 360 What is the smallest common multiple of 4 and 34? 68 Calculate the common denominator of 95/378 and 65/6. 378 Find the common denominator of -69/260 and 121/130. 260 What is the smallest common multiple of 90 and 2250? 2250 What is the least common multiple of 70 and 35? 70 Calculate the lowest common multiple of 10 and 235. 470 Calculate the least common multiple of 608 and 1672. 6688 What is the common denominator of 73/5934 and -53/8? 23736 Calculate the common denominator of 27/1100 and 13/33. 3300 Calculate the common denominator of 11/70 and 39/20. 140 Calculate the common denominator of -125/36 and 73/396. 396 Calculate the smallest common multiple of 33 and 6. 66 What is the smallest common multiple of 216 and 288? 864 What is the lowest common multiple of 480 and 30? 480 Calculate the common denominator of -133/6 and 99/190. 570 Find the common denominator of -91/228 and 53/184. 10488 Calculate the common denominator of 77/36 and 1/12. 36 Calculate the lowest common multiple of 10995 and 12. 43980 What is the least common multiple of 429 and 36? 5148 What is the smallest common multiple of 2288 and 11440? 11440 Calculate the common denominator of 64/8285 and -7/5. 8285 What is the lowest common multiple of 1133 and 1133? 1133 What is the least common multiple of 106 and 113? 11978 Calculate the smallest common multiple of 45 and 120. 360 Calculate the lowest common multiple of 66 and 36. 396 Calculate the lowest common multiple of 280 and 84. 840 What is the common denominator of 103/76 and 46/1653? 6612 What is the least common multiple of 752 and 658? 5264 What is the least common multiple of 1650 and 16? 13200 Calculate the common denominator of 65/2 and 109/34152. 34152 Find the common denominator of 157/210 and -133/18. 630 Calculate the common denominator of -30/7 and 3/155. 1085 What is the smallest common multiple of 60 and 28? 420 Find the common denominator of 127/2960 and -125/36. 26640 Calculate the common denominator of 103/6 and -131/96. 96 Find the common denominator of 93/2 and 25/4. 4 What is the smallest common multiple of 320 and 880? 3520 Find the common denominator of 67/4 and -97/28. 28 Calculate the least common multiple of 40 and 4. 40 Calculate the smallest common multiple of 2 and 100. 100 Calculate the common denominator of 117/20 and 123/80. 80 What is the lowest common multiple of 27 and 5793? 52137 Calculate the least common multiple of 2 and 8. 8 What is the common denominator of 25/1992 and -33/5312? 15936 Find the common denominator of 51/70 and -29/40. 280 Calculate the common denominator of -69/110 and 95/506. 2530 What is the least common multiple of 27 and 72? 216 Calculate the common denominator of 69/14 and -137/1368. 9576 What is the common denominator of -63/32 and 101/64? 64 What is the smallest common multiple of 1215 and 35? 8505 What is the least common multiple of 87 and 15? 435 What is the common denominator of 139/36 and -59/4300? 38700 What is the least common multiple of 158 and 28? 2212 Calculate the least common multiple of 88 and 184. 2024 What is the common denominator of -9 and -14/17? 17 What is the common denominator of -137/2130 and 61/84? 29820 Calculate the common denominator of -53/84 and 89/14. 84 Find the common denominator of -113/216 and 25/132. 2376 Calculate the common denominator of -91/592 and -5/28. 4144 What is the common denominator of 83/28 and 9/28? 28 What is the smallest common multiple of 6 and 5? 30 Calculate the common denominator of 71/364 and 47/3120. 21840 What is the common denominator of -47/16 and -113/2628? 10512 Calculate the lowest common multiple of 384 and 177. 22656 What is the smallest common multiple of 4446	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.