Datasets:

timaeus
/

pile-dm_mathematics

Dataset card Data Studio Files Files and versions Community

Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
ween 8:43 PM and 4:16 AM? 453 What is 104 minutes after 7:10 PM? 8:54 PM How many minutes are there between 2:37 PM and 10:10 PM? 453 How many minutes are there between 1:19 AM and 4:56 AM? 217 How many minutes are there between 3:02 AM and 8:24 AM? 322 What is 123 minutes after 12:25 AM? 2:28 AM How many minutes are there between 8:09 PM and 4:43 AM? 514 What is 197 minutes before 3:18 PM? 12:01 PM What is 274 minutes before 11:14 AM? 6:40 AM How many minutes are there between 9:39 PM and 1:52 AM? 253 How many minutes are there between 8:17 PM and 4:28 AM? 491 What is 421 minutes after 3:56 PM? 10:57 PM How many minutes are there between 3:44 AM and 11:49 AM? 485 What is 323 minutes after 11:14 PM? 4:37 AM How many minutes are there between 3:34 PM and 11:27 PM? 473 How many minutes are there between 5:01 AM and 2:50 PM? 589 What is 366 minutes after 10:13 PM? 4:19 AM What is 42 minutes after 1:34 PM? 2:16 PM What is 170 minutes before 3:21 AM? 12:31 AM What is 385 minutes after 1:29 AM? 7:54 AM What is 14 minutes after 9:27 AM? 9:41 AM How many minutes are there between 3:38 PM and 9:15 PM? 337 What is 591 minutes before 8:45 PM? 10:54 AM What is 610 minutes after 6:37 PM? 4:47 AM How many minutes are there between 1:33 AM and 6:38 AM? 305 How many minutes are there between 11:03 AM and 7:49 PM? 526 What is 491 minutes before 8:31 PM? 12:20 PM What is 692 minutes after 11:13 PM? 10:45 AM How many minutes are there between 7:49 AM and 9:57 AM? 128 What is 76 minutes before 7:18 AM? 6:02 AM How many minutes are there between 1:15 PM and 10:01 PM? 526 How many minutes are there between 4:48 AM and 11:34 AM? 406 How many minutes are there between 10:27 PM and 8:08 AM? 581 What is 89 minutes before 3:37 AM? 2:08 AM What is 416 minutes before 3:29 PM? 8:33 AM How many minutes are there between 11:44 AM and 8:06 PM? 502 How many minutes are there between 8:19 AM and 10:59 AM? 160 What is 385 minutes after 5:57 PM? 12:22 AM What is 588 minutes after 5:49 PM? 3:37 AM How many minutes are there between 11:58 AM and 8:32 PM? 514 What is 250 minutes before 1:18 AM? 9:08 PM What is 547 minutes after 8:33 PM? 5:40 AM How many minutes are there between 7:36 PM and 7:09 AM? 693 How many minutes are there between 9:19 AM and 7:24 PM? 605 What is 480 minutes after 4:21 AM? 12:21 PM What is 596 minutes after 7:15 PM? 5:11 AM What is 631 minutes before 5:05 AM? 6:34 PM What is 467 minutes after 2:55 PM? 10:42 PM What is 549 minutes before 11:06 PM? 1:57 PM How many minutes are there between 6:11 AM and 12:25 PM? 374 What is 661 minutes before 6:05 PM? 7:04 AM How many minutes are there between 4:51 PM and 2:34 AM? 583 What is 508 minutes before 1:36 PM? 5:08 AM What is 160 minutes after 8:59 AM? 11:39 AM What is 504 minutes before 3:53 AM? 7:29 PM What is 235 minutes before 11:27 PM? 7:32 PM How many minutes are there between 2:23 PM and 9:51 PM? 448 What is 89 minutes after 1:57 AM? 3:26 AM How many minutes are there between 2:50 PM and 4:45 PM? 115 What is 191 minutes before 4:31 PM? 1:20 PM What is 283 minutes before 10:16 PM? 5:33 PM What is 62 minutes after 4:48 AM? 5:50 AM What is 165 minutes before 12:39 AM? 9:54 PM What is 296 minutes after 6:45 PM? 11:41 PM What is 303 minutes before 11:32 PM? 6:29 PM How many minutes are there between 9:34 PM and 12:21 AM? 167 How many minutes are there between 4:45 PM and 12:21 AM? 456 What is 159 minutes after 9:22 PM? 12:01 AM What is 605 minutes after 11:21 PM? 9:26 AM What is 485 minutes after 8:10 AM? 4:15 PM How many minutes are there between 12:37 PM and 2:52 PM? 135 What is 217 minutes before 12:24 AM? 8:47 PM How many minutes are there between 3:22 AM and 2:49 PM? 687 What is 51 minutes after 11:41 PM? 12:32 AM How many minutes are there between 5:24 PM and 3:55 AM? 631 How many minutes are there between 7:49 PM and 1:16 AM? 327 How many minutes are there between 5:44 AM and 11:43 AM? 359 How many minutes are there between 10:48 AM and 5:33 PM? 405 What is 171 minutes before 2:14 AM? 11:23 PM How many minutes are there between 2:51 PM and 5:43 PM? 172 What is 546 minutes after 11:40 AM? 8:46 PM How many minutes are there between 11:56 AM and 6:07 PM? 371 How many minutes are there between 10:25 PM and 11:01 PM? 36 How many minutes are there between 8:21 AM and 2:33 PM? 372 What is 445 minutes after 1:39 PM? 9:04 PM What is 173 minutes after 1:35 AM? 4:28 AM What is 274 minutes after 8:05 PM? 12:39 AM How many minutes are there between 10:52 AM and 11:30 AM? 38 What is 317 minutes after 11:07 AM? 4:24 PM What is 488 minutes before 7:25 AM? 11:17 PM What is 424 minutes after 9:00 PM? 4:04 AM How many minutes are there between 2:03 AM and 1:07 PM? 664 What is 209 minutes before 9:52 PM? 6:23 PM What is 503 minutes before 12:13 PM? 3:50 AM What is 546 minutes after 8:45 PM? 5:51 AM What is 331 minutes before 8:08 AM? 2:37 AM What is 36 minutes before 12:35 AM? 11:59 PM What is 697 minutes after 12:32 AM? 12:09 PM How many minutes are there between 8:46 PM and 8:56 PM? 10 What is 416 minutes after 2:48 AM? 9:44 AM What is 88 minutes before 11:33 AM? 10:05 AM What is 304 minutes before 4:40 PM? 11:36 AM What is 444 minutes after 5:14 AM? 12:38 PM What is 617 minutes before 10:56 AM? 12:39 AM How many minutes are there between 11:42 PM and 11:26 AM? 704 What is 279 minutes before 6:42 PM? 2:03 PM How many minutes are there between 3:19 AM and 8:36 AM? 317 What is 355 minutes after 2:52 PM? 8:47 PM What is 240 minutes before 5:35 AM? 1:35 AM What is 588 minutes before 5:31 PM? 7:43 AM How many minutes are there between 8:01 PM and 2:57 AM? 416 What is 20 minutes after 10:02 AM? 10:22 AM What is 631 minutes after 3:12 PM? 1:43 AM What is 292 minutes after 9:09 AM? 2:01 PM How many minutes are there between 1:47 PM and 12:47 AM? 660 What is 41 minutes before 11:30 AM? 10:49 AM What is 359 minutes after 5:32 AM? 11:31 AM How many minutes are there between 4:27 AM and 6:08 AM? 101 How many minutes are there between 4:57 AM and 5:16 AM? 19 How many minutes are there between 8:19 PM and 11:25 PM? 186 How many minutes are there between 11:05 AM and 8:14 PM? 549 What is 595 minutes after 6:11 PM? 4:06 AM What is 690 minutes before 5:55 AM? 6:25 PM What is 556 minutes before 6:22 PM? 9:06 AM What is 327 minutes after 12:10 PM? 5:37 PM How many minutes are there between 5:26 AM and 1:28 PM? 482 What is 617 minutes before 12:39 PM? 2:22 AM How many minutes are there between 10:29 PM and 9:08 AM? 639 How many minutes are there between 10:37 AM and 5:22 PM? 405 How many minutes are there between 9:36 AM and 12:28 PM? 172 What is 173 minutes after 9:22 PM? 12:15 AM How many minutes are there between 1:09 PM and 11:19 PM? 610 What is 692 minutes after 5:44 AM? 5:16 PM How many minutes are there between 3:21 AM and 5:42 AM? 141 How many minutes are there between 11:33 PM and 12:21 AM? 48 How many minutes are there between 1:25 AM and 6:25 AM? 300 What is 490 minutes before 1:06 PM? 4:56 AM How many minutes are there between 8:30 AM and 10:46 AM? 136 What is 493 minutes before 9:14 PM? 1:01 PM What is 173 minutes before 8:50 PM? 5:57 PM How many minutes are there between 6:55 PM and 12:27 AM? 332 How many minutes are there between 6:46 PM and 10:56 PM? 250 How many minutes are there between 10:13 AM and 10:46 AM? 33 What is 132 minutes before 11:14 AM? 9:02 AM What is 719 minutes before 3:42 AM? 3:43 PM What is 27 minutes before 8:57 PM? 8:30 PM How many minutes are there between 6:01 AM and 11:56 AM? 355 What is 103 minutes before 1:44 AM? 12:01 AM What is 691 minutes before 10:24 PM? 10:53 AM What is 404 minutes before 3:37 AM? 8:53 PM What is 104 minutes before 12:12 AM? 10:28 PM What is 700 minutes after 6:05 AM? 5:45 PM What is 88 minutes after 12:49 AM? 2:17 AM What is 317 minutes before 4:04 PM? 10:47 AM What is 249 minutes before 10:20 PM? 6:11 PM How many minutes are there between 1:37 AM and 9:59 AM? 502 What is 692 minutes after 3:53 PM? 3:25 AM How many minutes are there between 12:26 AM and 3:06 AM? 160 What is 354 minutes after 4:53 AM? 10:47 AM What is 2 minutes after 6:15 AM? 6:17 AM What is 466 minutes after 5:09 AM? 12:55 PM How many minutes are there between 2:49 PM and 10:01 PM? 432 How many minutes are ther	{ "pile_set_name": "DM Mathematics" }
18 + 6 - 7) 16 What is the value of 4 + -9 - -9 - (-6 - -2)? 8 What is the value of 2 - -6 - (8 + 2 + -2)? 0 What is 3 + (-11 - -2 - (24 + -23))? -7 Calculate 18 - (0 - -42) - -1. -23 Calculate -1 + 10 + 1 + (3 - 7). 6 What is the value of 0 - (-1 + 2) - (-14 - -25)? -12 Calculate (-24 - -20) + 7 + -5. -2 Evaluate (-1 - (5 - 18)) + -6. 6 Calculate (6 - (35 - 21)) + (6 - 0). -2 -15 + 30 + 15 + 5 35 Evaluate -6 + 12 + -3 + -9 + 3 + -7. -10 What is the value of -2 + (-12 + 47 - 15)? 18 Evaluate (-143 - -135) + (26 - 1). 17 Calculate -6 + (-5 - (0 + (-6 - -2) + 3)). -10 What is the value of 11 + -19 + (1 - -5) + -18? -20 Evaluate -22 + 15 + -3 + 2. -8 Evaluate 11 - (-35 - -23 - -2). 21 Evaluate -3 + (-3 - (-31 - -9)). 16 What is 0 + -28 + 1 + (2 - -2)? -23 Calculate 49 - 27 - 43 - -10. -11 Calculate (-50 - (-8 + -2)) + -3 - -15. -28 Evaluate 36 + -14 + -13 + 0 + -4 + -7. -2 What is the value of (7 - (-5 - -10)) + (2 - 0)? 4 Evaluate -13 - (-23 - 17 - -14) - (1 + -9). 21 What is 97 + -93 - (-4 - -5)? 3 (-25 - (-40 + 21 + -10)) + 14 + 1 19 What is 24 + -4 + -2 - 2? 16 Calculate (9 - 9) + (-2 - 2) + 6. 2 Evaluate 1 + (-185 - -189 - (2 - 8 - 1)). 12 What is the value of 2 - -1 - -8 - (64 - (-21 + 45))? -29 What is the value of (-6 - -1) + 1 - -14 - -3? 13 Evaluate 43 - ((61 - 33) + 15). 0 What is (11 + -9 - -4) + -9 + 11? 8 -17 - (13 - 11 - -11 - 12) -18 What is -2 + 12 + -50 + 35? -5 Calculate 0 + -24 + 526 + -519. -17 Calculate 11 - -29 - 45 - (-8 + (-2 - -1)). 4 What is -8 - ((1 - -13 - (12 - 4)) + 1)? -15 Evaluate 4 + 0 + -9 + -1 - -1. -5 Calculate (-11 + -3 + 4 - -7) + 7. 4 Evaluate -20 - (-3 - 1) - (-3 - (5 - 1)). -9 What is the value of 0 + (0 - (-8 - -15)) - (-15 + 1)? 7 What is the value of 10 + 0 + (1 - (-5 + 11 + -12))? 17 Evaluate 0 + -9 - (-197 + 171 + (-5 - -1)). 21 What is the value of 6 - (-81 + 24 - -40)? 23 What is 28 + -17 + (4 - (7 + -2))? 10 Evaluate 2 + 4 + (-1 - 12) + 3. -4 Calculate 21 + (-1 - 15) + (-2 - 0) - 0. 3 -2 - -3 - (12 + (-23 - -7)) - 4 1 149 + -153 - (-3 + (9 - 3) - 11) 4 What is the value of 4 + 0 + 7 + -9 - (25 - 5)? -18 What is the value of 25 + 232 + -240 + 7 + -1? 23 Evaluate 553 - 536 - (-7 - (-1 + -2)). 21 What is -37 + (-25 - (-64 - -33))? -31 Calculate 20 + (1 - -1) + -10 + -5. 7 What is -12 + 2 + (-1 + 9 - (-6 + 11))? -7 Calculate -34 + 19 - (15 - 29). -1 Calculate -23 - (-20 + (-20 - -15)). 2 Calculate (-5 - (-2 + -5)) + -9 + -5. -12 Calculate 1 + -22 - (-94 + 81). -8 Evaluate -19 - (15 - 11) - (-1 + -7). -15 Evaluate (-9 - (0 - 1)) + (-17 - (4 - 17)). -12 What is -27 + 21 + -9 + (-1 - -7)? -9 What is 6 + 0 + (48 - (-41 + 95))? 0 Evaluate (2 + -8 + 0 - 0) + (-158 - -154). -10 What is the value of (1 - -9) + (-43 - (-45 + 19))? -7 35 + 29 + -24 + -19 21 What is the value of 368 + -313 + (-21 - 0)? 34 (7 - 25) + -8 + 44 18 What is the value of 6 - ((-11 - -5 - (8 - 6)) + 7)? 7 Evaluate 2 + -16 - -2 - (504 - 490). -26 What is -13 - (-16 - (-8 + 14))? 9 What is the value of (621 - 641) + (31 - 1)? 10 What is 15 - (-3 + (-19 - -36))? 1 What is (-16 - (-26 + 16)) + 5 - (0 + 8)? -9 -11 - ((-10 + 12 - 4) + -12) 3 What is 8 + (-24 - 14) + 9? -21 Evaluate (-23 - -2) + 23 + (9 - 21). -10 Calculate -3 + 0 + (2 - 3) - (-221 - -198). 19 -14 + 0 - ((-10 - -6) + 1) - -5 -6 Evaluate -3 + 2 - (5 - 6) - (3 - 2). -1 Calculate -1 + -21 + (-1 - (-4 + 2)). -21 What is the value of 13 - ((-18 - -2) + (29 - -31))? -31 Evaluate 1 + -34 + -96 + 105 - -4. -20 What is the value of 3 + 1 + (-135 - -143)? 12 What is the value of -5 - (-10 + -1 + (-5 - 11) + 11)? 11 Calculate (195 - 188) + (-9 - 2) + (6 - 0). 2 What is the value of 3 - 2 - (-6 - -2) - (-232 - -223)? 14 4 - (5 + -8 + 5) - -4 6 Calculate -16 - (-16 + -19) - (0 + 7). 12 Evaluate -6 - (7 + -8) - 5. -10 0 + -17 + -13 + (-8 + 5 - -17) -16 Calculate -10 + 8 + 4 + -5 + 8. 5 What is 26 + -27 + -9 - (-12 + 2)? 0 Calculate 29 + 2 + 124 + -60 + -65. 30 Calculate -16 + -24 + -11 + 35. -16 (-6 - -23 - 13) + (-5 - -1) + 3 3 Calculate (15 - ((9 - 10) + 11) - 11) + -6. -12 (9 - (7 - 2)) + -6 - (5 + -5) -2 Evaluate (23 - 16) + -11 + 22. 18 (5 - -4) + (11 - 9) - -5 16 What is the value of 8 + 0 + (-15 - -1)? -6 Calculate (1 - -1) + 4 + 7 + -7 + 2. 8 Calculate (-1 - (-32 - -16)) + -19 + 1 + -7. -10 (-2 - 0) + -7 + (4 + 1 - 4) -8 Evaluate (0 - (2 - -3)) + -6 + 11 + -1. -1 Evaluate (-2 - 13 - -26) + 0. 11 What is the value of -8 + (0 - -7) - -8? 7 What is the value of -2214 + 2172 + (26 - -1)? -15 What is the value of (-19 - (6 + -3)) + 21? -1 What is the value of (-5 - -7) + -7 + -3 + 5 + 23? 20 Evaluate -28 + -3 + (-13 - -23). -21 What is the value of 2 + (22 + -12 - 11)? 1 What is -18 - -7 - (-1 + 5 - 5)? -10 Evaluate -16 + (-4 - -22) + -16. -14 What is the value of 15 - (8 - 10 - -5)? 12 (-4 + 0 + 3 - 0) + (-16 - -21) 4 Calculate 2 + -11 + 2 - (7 + -53 + 29). 10 Calculate 25 - (-3 - (-39 + 4)). -7 What is 12 + -38 + 9 + 18? 1 (11 - 0) + 1 + 1 + -6790 + 6791 14 What is -13 + 1 + 4 + 0 + -11 + 15? -4 6 - 7 - 2 - ((-8 - 0) + 5) 0 Calculate 6 + (8 - (3 + -1 + 6)) - 6. 0 Evaluate -18 + (-13 - (-37 - -3)). 3 What is -2 + 6 + 2 + -29 + 4? -19 0 + (0 - 0) - -11 11 Calculate (-10 - 0) + (-23 - -5) + 13. -15 -5 - (-48 + 3 - (32 + -21 - 21)) 30 What is 11 + (-3 - (-6 - -26 - 8))? -4 Calculate -3 - (29 - 23 - (2 - -1)) - -10. 4 What is -20 + (-2 - 5 - -18) - (-1 + 5)? -13 7 + -2 - (-2 - (-9 - -8)) - -1 7 Evaluate (-2 - 8) + (-45 - (-18 - 39)). 2 0 + -9 - -27 - 7 - 48 -37 What is 20 - -2 - (38 + -15 + -33 + 2)? 30 Calculate (-15 - 5) + (38 - 24). -6 What is 16 - ((10 - 11) + 10)? 7 Calculate 0 - (4 + 7 - 3). -8 Calculate -71 + 75 + (1 - 3) + -1. 1 What is the value of -41 - 0 - (259 + -293)? -7 73 - 66 - ((-4 - -13) + -3) 1 Calculate (-9 - 7) + (58 - 29) - -1. 14 0 + -6 + -7 - (-5 - (-1 + 1)) -8 -9 + -23 + (22 - -24) 14 What is the value of 38 + (42 - 84) - (-1 + 5 - -1)? -9 What is -18 + 5 + 3 + (15 - 17)? -12 Calculate -16 + (1 - -31 - 2). 14 (2 + -9 - -15) + 1 9 (25 - 19) + (4 - (11 - 5)) 4 What is (1 + -6 - (-11 - -3)) + -4? -1 -13 - (-8 + 14) - -18 -1 What is 34 + -29 + -11 - (-1 + -12 - 1)? 8 (8 + 2 - 0) + 2 + -4 + -3 5 Evaluate (14 - (-1 + 1)) + (-25 - -19). 8 Evaluate 8 + 81 + -76 + -30 + -2. -19 What is -7 + -12 + 18 + (-2 - (3 + -18))? 12 Evaluate (-19 - ((8 - 26) + 11)) + 2 + 5. -5 What is 20 + (30 - 27) - 9? 14 -6 + -30 - ((-20 - -5) + 5) -26 Evaluate 5 + (1 - -5) + -34 + 38 + 0. 15 What is 38 + (-18 - (-41 + 13 - -10))? 38 What is the value of 1 + -3 + (16 - 20) + 1 - -4? -1 Calculate (-3 - -19 - (0 - 8)) + (2 - -3). 29 Calculate 6 - (3 + -4 - (-13 - -7)). 1 What is the value of -3 - (-4 - -1) - 11 - (50 - 23)? -38 Calculate -167 - -185 - (2 - 7). 23 Calculate -17 + (32 + 14 - 0) + -9. 20 Evaluate 12 + 2 + (-4 - 0 - 0 - 1). 9 What is (7 - 1) + -23 + (4 + 17 - 11)? -7 Evaluate 18 - (13 - 2 - (-40 + 44)). 11 -1 + (-18 + 56 - 20) 17 What is the value of (-9 - 4) + 5 + (-2 - -4) + 22? 16 -7 + -6 + 12 + 6 + -8 + -5 -8 Evaluate (-2 - -3) + -2 + (-5 - -5). -1 Evaluate -3 - (5 + -4 - 5 - (-1 - -5)). 5 Calculate -9 - (2 + -6 + (11 - 9) + -27). 20 Evaluate -10 + 7 + (-9 - -7) - (1 - 0). -6 Calculate (-1 - 0) + 14 + 0 + 508 + -500. 21 Evaluate -9 - (13 + 15 + -48). 11 What is the value of -914 + 912 - (1 - (12 - 0))? 9 What is 2 + -10 + (-24 - -20) + -1? -13 What is 13 - (29 - 10 - 6)? 0 16 + 24 + -13 + -28 -1 Calculate 20 - (4 - 1 - 3 - (72 + -78)). 14 Evaluate 16 + ((4 - 5) + -4 - (-12 + 15)). 8 (0 - (-23 - (-5 - -9))) + -12 15 Calculate 4 - 33 - (-29 + -16). 16 What is -11 - (-8 + 4 - 17)? 10 What is the value of (-257 - -255) + (0 - 0 - -6) - 10? -6 Calculate 33 - (103 - 109 - (-8 + -1)). 30 Evaluate (-12 - -24 - 29) + (1 - -4). -12 What is (-4 - 7) + (3 - (0 + 8))? -16 Calculate (-7 + 3 + -3 + 6 - -2) + 9. 10 What is 9 + -17 + 1 + 5 + -10? -12 2 - (5 + -8) - 4 1 Calculate (1 + -3 - -2) + 0 + 19 + -33. -14 What is the value of -7 + (9 - (4 - 5)) - 12? -9 What is (2 - (-76 + 84)) + (1 - 18)? -23 Evaluate 46 - (9 + (12 - -4)). 21 Calculate 6 + 3 + (31 + -31 - (1 + 9)). -1 What is the value of 1 + -8 + (18 - 10) - (-1 - 0)? 2 -146 - -157 - ((-11 - -2) + (-15 - -13)) 22 Evaluate -19 - (0 + -12 + -11). 4 Calculate 47 - (22 + -6) - 15. 16 515 - 503 - (9 + 0 + -1 - 2) 6 -12 + (4 - (-2 + 10) - 8) -	{ "pile_set_name": "DM Mathematics" }
+ (2 - 1) + (-9 - -7). 1 Calculate -4 - (-4 + -5 - -9). -4 -19 + 15 - (-9 + 3 + 1) 1 -2 + (-1 - -5 - -3) 5 What is the value of 1 + (0 - 3) - -3 - 4? -3 What is -3 - (-14 + 13 + 0 + -1)? -1 Evaluate 1 + 2 - (6 - (6 + -1)). 2 What is -10 + -9 + 3 + 10? -6 What is the value of -12 + 14 + 0 + (-1 - 2)? -1 7 + -14 + -3 - (-5 - 3) -2 What is the value of -1 + 0 + -1 + 0 + 4? 2 What is the value of -5 + -3 + 0 - -3? -5 Evaluate (-12 - -6) + 3 + 2 + -7. -8 Calculate -1 + (5 - 4 - -1) - -5. 6 What is the value of 7 + (3 + -7 - -1) + -1? 3 Calculate 0 + -2 - (-10 - -4). 4 Evaluate 14 - (-12 + 9 + 11). 6 What is the value of 4 + (-4 - -8) + -5 + 2? 5 What is the value of -2 + 4 - (25 + -15)? -8 Evaluate 0 - -6 - (-9 + 9). 6 What is (-1 - -3) + (15 - 20)? -3 Evaluate 5 + -1 - (5 + -9 - -5). 3 Calculate 5 + -4 + 2 + -1 + -5. -3 0 + 0 + (-40 - -45) - 10 -5 -24 + 19 + -1 + 7 1 Calculate -4 + 6 + -1 - (-1 - -1). 1 Evaluate 12 - ((0 - -13) + -7). 6 Evaluate -6 - -2 - (24 + -26) - -5. 3 Evaluate (-2 + 6 - 6) + 5. 3 What is (2 - (3 + -2)) + 1 + -6? -4 Evaluate -5 + (13 - (13 - (-5 + 11))). 1 4 + -4 - (-2 - 0) 2 2 + (5 - -3) + -5 5 Evaluate -5 + 6 + 2 + 4. 7 2 - 1 - -11 - (-10 + 16) 6 (0 - 2 - -2) + (9 - 13) -4 What is -8 + 10 + -1 + 3 + -8? -4 What is the value of -10 + 21 + -12 + 7? 6 What is the value of -12 + (1 - -5) + (8 - 6)? -4 -4 + 3 - (5 + 2 - 3) -5 What is 0 + -8 - (-6 + -6) - 5? -1 What is the value of 2 + (1 + -3 - -2) + -2? 0 -8 + (-5 - -9) + 4 0 Calculate 1 - 10 - (70 + -71). -8 What is 2 - 0 - (17 + -18)? 3 What is the value of 0 - (2 + 4) - (3 - 6)? -3 What is -5 - (-2 - 5) - (-2 - -8)? -4 What is 0 - (-4 - -12) - -14? 6 2 - (-3 - (-16 + 4)) -7 What is the value of (-3 - 5) + (-3 - -6)? -5 (-1 - -1) + 3 + -2 + -2 -1 Calculate (-12 - -17) + (-6 - -2). 1 Calculate -83 + 77 - (1 + -6). -1 -4 - -3 - (-6 + 6 - -1) -2 Evaluate (3 + -5 - -6) + -9. -5 Evaluate -5 + 4 + -4 + 4. -1 -1 + (-6 - -4) - 1 - -3 -1 What is 0 - (0 + (3 - -2))? -5 4 - -2 - 4 - (-9 + 13) -2 What is the value of -8 + 14 + -1 - (14 - 3)? -6 Calculate 3 - (7 - (0 - 4 - 0)). -8 6 + (6 - 8) + -11 + 1 -6 Evaluate 0 + -1 + (-3 - -10) - 0. 6 Calculate (7 - (-6 + 9)) + 0 + 5. 9 What is 2 + -2 + (2 - -2)? 4 -7 + 2 + -2 - 0 -7 Evaluate 5 + (-3 - (-4 - -8)) + -6. -8 Evaluate 1 + 3 + -2 + 4 + -8. -2 Calculate (-2 - -3) + 3 - (-1 - 3). 8 Evaluate 5 + 3 + (1 - (-2 + 8)). 3 What is 7 + (-3 + 0 - (1 - 2))? 5 2 + (0 - (-4 - -11) - -2) -3 (6 - 0) + (-11 - (-2 - 6)) 3 What is the value of -1 + -4 - (-4 + -2)? 1 What is the value of -1 + -2 - (-48 + 53)? -8 What is the value of 9 + -10 - (2 + 0 + 0)? -3 What is the value of (-1 - -5 - 5) + 6? 5 What is the value of 1 + -1 + -3 + 6? 3 What is the value of -8 + 3 + 8 + -5? -2 Evaluate 1 - 2 - (-2 + 0 + 0). 1 9 - (2 + 3 + 8) -4 Evaluate -16 - (-4 - (-1 - -4)). -9 What is the value of 0 - 7 - (41 + -48)? 0 Calculate (-4 - (-5 + (2 - -4))) + 1. -4 (5 - (0 + -5)) + -2 8 Calculate -8 - ((0 - 0) + -8 - -5). -5 What is the value of 2 + 6 - (5 + -1)? 4 Evaluate 2 + -5 + -2 + 5. 0 -11 - (4 + -10 - 0) -5 What is the value of 4 - (2 + -2 + -1)? 5 Evaluate 6 + 0 + (35 - 48). -7 Calculate -8 + 2 + (-11 - -11). -6 What is -3 + 2 - (0 - -2 - 0)? -3 Calculate 4 + (-1 + 4 - 3) - 8. -4 Calculate (-11 + 11 - (-3 - -1)) + -10. -8 Evaluate 0 + (1 - -2) - (-2 - -2). 3 6 + 2 + 28 + -40 -4 Calculate 4 - (-2 + 1 + 2). 3 What is the value of 5 - (2 - (-3 + 4)) - 6? -2 What is the value of 25 - 22 - (5 - -1) - 3? -6 Calculate 0 + (-2 + -1 - (16 + -15)). -4 What is the value of (-14 - -13) + (0 - -3)? 2 Evaluate -14 - -20 - (1 + 8). -3 What is -48 + 45 - (-1 - (0 - -4))? 2 Evaluate (-12 - -4) + 16 + -13. -5 Evaluate (3 - 0) + (4 - (-4 + 7)). 4 What is the value of (0 - -7) + -7 - (0 + -4)? 4 (8 - -3) + -13 + 9 7 Evaluate 46 + -35 - (6 + 0). 5 Evaluate (-14 - (-1 - 6)) + 2. -5 Calculate -4 + -3 + 4 + 0. -3 What is 2 + 2 - (2 + 1)? 1 Calculate 2 + (0 - 4) + 3. 1 -1 + -5 - (-3 - (0 - 3)) -6 2 + 5 + -2 + (-2 - -1) 4 What is the value of (-22 - -6) + 11 - -13? 8 Calculate -1 + 2 + (-11 - -33 - 31). -8 What is 9 + 8 + -19 - 2? -4 What is (4 - (-6 - -14)) + 6? 2 5 + -10 - -6 - 0 1 Evaluate -20 + 20 - (1 - -5). -6 2 + -5 - (-9 + (-1 - -5)) 2 (2 - 3) + 15 + -15 -1 Calculate (4 - 2) + (0 - 2). 0 What is (-4 + (2 - -4) - -3) + -2? 3 What is -1 + (-10 - -6) + 8? 3 What is -3 - (0 + (12 - 9))? -6 Evaluate 6 - (-6 + 19 + -9). 2 Evaluate 0 + 0 + -1 + -2 - -1. -2 What is 0 - 0 - (3 + (13 - 13))? -3 What is 4 + 9 + (1 - 12)? 2 What is -4 - ((3 - -7) + -8)? -6 What is the value of 5 - (5 + -9 - -5)? 4 Evaluate 5 - (-3 - (-5 + 2)). 5 What is -4 + 4 + -6 + 5 - 4? -5 Calculate 12 - (7 - (-2 - -2 - -3)). 8 Evaluate -4 - (6 - (3 - -3)). -4 (-1 + (6 - 8) - 5) + 10 2 Calculate 40 + -42 - (3 - 1 - 0). -4 What is the value of (0 - -1 - -7) + (21 - 23)? 6 What is the value of (4 - 3) + (2 - 3 - 5)? -5 What is the value of (10 - 10) + 0 + (-1 - -8)? 7 What is the value of (13 - 7) + 1 + -3? 4 What is 3 + -1 + 6 + -9? -1 Calculate (3 + 0 - 4) + 4 + -1. 2 Calculate 11 + -7 - (0 - -4 - -1). -1 What is the value of (-1 - 3) + 2 + 3 + 1? 2 1 - 0 - (0 - 0) 1 (-3 - 3) + 4 + -1 -3 What is the value of 8 + (-10 + 5 - (3 + -4))? 4 Calculate 6 - (22 - (0 - -1)) - -7. -8 What is -13 + 8 - -9 - 6? -2 5 - (0 + 0 + 3 - 1) 3 Calculate -2 + 8 + -7 + 5. 4 Calculate -4 + 0 - (2 - 1). -5 Evaluate (-3 - (-1 - 1)) + -1. -2 What is the value of 1 - 3 - (-5 + 1)? 2 What is -15 + 15 - (-5 + -3)? 8 Evaluate 0 + (2 - 3) + -2 + -1. -4 What is the value of (6 - 4) + -2 + 6 + -1? 5 What is (-2 - 2) + (-16 - -22)? 2 What is 0 + (2 - (0 - -5)) + 5? 2 Calculate -8 + -7 + 4 + 8. -3 Evaluate 6 - (-5 - (0 + 2 + -19)). -6 What is the value of 3 + (-4 + (1 - -3) - -2)? 5 (0 - -5) + 3 + -5 + -6 -3 -1 - (-3 - (-5 - -2)) - -1 0 What is -4 + 18 + -1 + -8? 5 What is the value of -2 - (0 - (-2 + 2 + 1))? -1 What is the value of 2 + 1 - (-2 - -7 - 4)? 2 Evaluate 1 + (1 - (-3 - (-2 + -4))). -1 What is 0 - (6 - -2) - (1 - 5)? -4 -6 - ((-2 - (0 - 8)) + -11) -1 What is the value of 3 + (-1 + 4 - 2) + -9? -5 What is -113 + 112 + -1 + -1? -3 -7 + (5 - -3 - 9) -8 Calculate 5 + -9 + 3 + 4. 3 4 + (4 - (1 - -1) - 11) -5 -15 - -5 - (-3 + 0) -7 (-15 + 6 - -5) + -1 + 4 -1 Evaluate (11 - (1 - -6)) + -5. -1 Calculate 0 - -4 - (34 + -33). 3 Evaluate -4 + 0 + (-6 - -2). -8 What is -2 + 0 + (-11 - -5) + 7? -1 What is -2 + 1 + 5 - (-5 + 4)? 5 Evaluate -3 - (5 + (-3 + 0 - 3)). -2 What is the value of 1 - 6 - -4 - (-1 + 1)? -1 What is -15 + (12 - 4) - -8? 1 Calculate -2 + 14 - 10 - 5. -3 (-8 - (3 - 6)) + (-4 - -3) -6 Evaluate 1 + (1 - (-3 - -1) - 2). 2 Calculate 3 - (-3 - (4 - 11)). -1 What is the value of -4 + (-4 - -1) + 4 + 5? 2 What is the value of (-7 - (-1 - -5)) + 3? -8 Calculate 1 + -1 + -7 + 5 + 7. 5 What is the value of 11 + -1 + -5 + -5? 0 Calculate -6 + (-7 - -5) + 4. -4 What is -2 + (0 - (-3 + 4))? -3 Evaluate -1 + 3 - (1 - 4). 5 -13 + (-9 - -5) + 8 -9 Calculate (3 - (5 - 2)) + 0. 0 What is 3 + -3 - (8 - 9)? 1 Calculate 4 + (9 - 12) + -2. -1 Evaluate 1 + -1 + 1 - (-4 + 1). 4 Calculate -3 - (-13 - (0 + -5)). 5 Calculate (-26 - -32) + (-7 - 1). -2 What is the value of -2 - (-9 - -6 - -6)? -5 What is the value of (17 + -23 - (-1 - 4)) + 1? 0 What is -3 + 2 + (6 - 3) + 1? 3 Evaluate 3 - (10 + -7 - 2). 2 What is the value of 7 - (6 - -1) - (-4 - 1)? 5 Calculate (1 - 1) + (-4 - -5) + 1. 2 Calculate 6 - (8 - 14) - 4. 8 0 - 2 - (-12 + 8 + 3) -1 Calculate (-34 + 12 - -11) + 8. -3 3 + (2 - ((2 - -3) + 3)) -3 Evaluate -9 - 9 - (0 + -10). -8 -3 - (-3 + 7 - (16 + -16)) -7 Evaluate -2 + 0 + 0 + 2. 0 What is the value of -1 + (7 - 1) + 1? 6 What is 1 - (-9 - -5) - 5? 0 What is the value of 4 + (-6 - (-4 + 4 + -5))? 3 What is -4 + (-3 - (2 - 4))? -5 What is the value of -1 - -7 - (-1 + -3 - -7)? 3 -11 + 14 - (-1 - (-7 + 2)) -1 Evaluate (2 - -6) + (-2 - 1). 5 (-4 + -2 + 2 - -1) + 7 4 What is the value of (22 - 27) + (2 - -6)? 3 (-9 + 3 - -1) + (-1 - -3) -3 Calculate -12 + 10 + (-9 - -8 - 1). -4 1 + 0 + (-33 - -26) -6 (10 - 3) + (0 + -2 - 1) 4 Calculate 13 + -19 - (0 + 2 + -12). 4 Evaluate -5 + (6 - -4) + -7. -2 (2 - 0 - 3) + 2 + 2 3 Evaluate 3 + -3 + 6 + -8. -2 (0 - -2 - (-6 - -7)) + 3 4 Calculate 3 + -1 + 9 + -8. 3 What is 2 - (7 + -3 + 3 + 1)? -6 Evaluate -1 - (-8 + 4) -	{ "pile_set_name": "DM Mathematics" }
z + 183. Let v = n - -46. What is the units digit of v - -1 - (-3)/((-12)/(-400))? 0 Suppose -2 = -2r - 4b, -4r + b = -0b + 23. Suppose 3h - 2h - 39 = 0. What is the tens digit of h - ((4 - 1) + r)? 4 Suppose 0 = -2d + 5y + 53, -5d + 0y = 3y - 148. Let j be d/6 - (-1)/6. Suppose -25 = ji - z - 110, -2i + 5z + 11 = 0. What is the units digit of i? 8 Suppose 3p + 9504 = 3g, -13p = -9p + 16. What is the units digit of g? 4 Suppose -5s = 3j - 119020, j + 2s + 1624 = 41296. What is the ten thousands digit of j? 3 Let k(l) = 16l + 36. Let i(c) = c*3 + 6c*2 + 2c + 6. Let h be i(-2). What is the hundreds digit of k(h)? 3 Suppose -87j = -215j + 112j + 586512. What is the units digit of j? 7 Let b = -380 - -383. Suppose 0 = 4l + 12, bu = -2l + 180 + 459. What is the units digit of u? 5 Let f be 2 - (6 - (-6 + 13)). Suppose 58 = -fj + 1771. What is the hundreds digit of j? 5 Suppose 115 = 2v - 19o + 16o, -282 = -5v + 2o. Suppose -72h + 4992 = -vh. What is the hundreds digit of h? 3 Suppose -34g + 15 + 53 = 0. Suppose 2n + 2792 = 4c, c + 698 = gc - 5n. What is the tens digit of c? 9 Let g = -14250 + 32674. What is the thousands digit of g? 8 Suppose 0 = 534y - 89y - 14180890 - 11265100. What is the units digit of y? 2 Let y(d) = 7d + 52. Let q be y(-11). Suppose -5x + 2f + 225 = 37, 0 = 2x - 3f - 84. Let k = x + q. What is the tens digit of k? 1 Let x = 137 + -181. What is the units digit of (x/(-8))/(2/92)? 3 Suppose -48l = -55l + 9751. What is the tens digit of 3/(21/l)1? 9 Let b = 98 - 111. Let l(k) = k2 - 18. What is the hundreds digit of l(b)? 1 Let l = 197574 + -133157. What is the hundreds digit of l? 4 What is the hundreds digit of (-5)/((-130)/(-4)) + (-68070240)/(-2730)? 9 Suppose 5s = s + 4. Let y be (-17 - -14) + 0/s. What is the tens digit of (75/y)/((-3)/3)? 2 Let f be (-13)/((-273)/18)7. Suppose 0q = fq - 1062. What is the tens digit of (20/(-30))/((-2)/q)? 5 Let f be (-2)/(-8)6(-1056)/(-198). What is the tens digit of 1399 - 8/(f/(-7))? 0 Suppose 80087 + 21697 = 3k - y, y - 101790 = -3k. What is the tens digit of k? 2 Suppose 9o + 2 = 47. Suppose -ok + 567 = -1368. What is the hundreds digit of k? 3 Suppose 2910 = q - 2c - 202, -18 = 3c. What is the hundreds digit of q? 1 Let k(h) = 24h2 - h - 2. Let a(c) = c2 + 17c + 35. Let i be a(-15). Suppose -15 = -5f - i. What is the tens digit of k(f)? 9 Let t be (-54)/(-15)(-20)/(-8). Suppose 0 = 4u + 13 - t. Let b(l) = 66l2 + 3l + 2. What is the tens digit of b(u)? 6 Let s = 102 - 198. Let n = -95 - s. What is the units digit of 77 + n/33? 8 What is the units digit of 1923 + 1 - (-42 + 56)? 0 Let j(y) = -6y + 303. Let g be j(45). Let k = 2196 - 1097. Suppose -26a - k = -ga. What is the tens digit of a? 5 Suppose 48 - 2 = 45g - 44. Suppose -2m = 3m - 920. Suppose -85 = -u + j, j + m = gu + 6j. What is the units digit of u? 7 Let c(r) = 11r*3 + 19r*2 + 11r + 31. What is the hundreds digit of c(9)? 6 Suppose 0 = -4l - 0l + z - 132, 3l + 5z + 76 = 0. Let c = -45 + l. What is the units digit of 1/(-3)(8 + c)? 3 Let u(i) = i3 + 22i*2 - 204i - 78. What is the units digit of u(31)? 1 Suppose 0 = 14d - 36 - 132. Let u(h) = 8h + 102. What is the tens digit of u(d)? 9 Suppose 5z - 605 - 1619 = 4x, 4z + 2x - 1774 = 0. Suppose -k - z - 73 = -2w, -5k + 782 = 3w. What is the units digit of w? 9 Suppose -5d + 2d + 3u + 176322 = 0, -4d + 235102 = -3u. What is the ten thousands digit of d? 5 Suppose 0 = 2i + g + 4, -7i + 12i - 5 = 5g. Let h be 22/(-3 + 25/8). What is the hundreds digit of h + (5 + -3 - i)? 1 Let o(g) = 391g - 400. What is the tens digit of o(2)? 8 Let r(f) = -f2 + 10f - 2. Let t be r(9). Suppose -2u + 1 = t. Let j = u - -67. What is the units digit of j? 4 Let f = 14370 + 58864. What is the units digit of f? 4 Let c(r) = 6r + 99. Let x(f) = -2f - 33. Let l(z) = -6c(z) - 17x(z). What is the units digit of l(-23)? 3 Let y be 1-2(-10)/(-20)5631. What is the hundreds digit of y/(-13) - (-50)/(-325)? 4 Suppose 30458 = 4p + 5k, -51k + 15202 = 2p - 53k. What is the tens digit of p? 0 Let k be (1335/6)/(-46/(-336)). Suppose 105g - 112g = -k. What is the hundreds digit of g? 4 Let n(i) = -97i + 29. Let v(w) = -w3 + 15w*2 - 26w - 3. Let s be v(13). What is the tens digit of n(s)? 2 Let r(q) = -2q2 + 2q + 61. Let u be r(-6). Let l = u + 84. What is the units digit of l? 1 Let u(l) be the first derivative of -186l2 + 15l + 20. What is the hundreds digit of u(-1)? 3 Suppose -5p - 28 = -4i, 24 = 3i + i - 4p. Let n = 147 - i. What is the tens digit of n? 4 Let h be 102/((-7)/14 + 5/2). Let x = h + -49. What is the tens digit of x/(2 + 8) - (-224)/5? 4 Suppose 172 = 3d + 5s, 7s + 292 = 5d + 10s. Let c(l) = -129l*3 + 62l*3 + dl*3 + 2l*2 - 3 - 3l. What is the tens digit of c(-2)? 7 Let x(k) = -55k - 100. Let q be x(-20). Let f = q - 558. What is the units digit of f? 2 Let f = -4162 + 8694. Suppose 2x + f = 13x. What is the hundreds digit of x? 4 Suppose -4p = -24, -4w - 10p + 60230 = -11p. What is the thousands digit of w? 5 Suppose -33d + 23191 + 16948 = 56d. What is the units digit of d? 1 What is the units digit of ((-126)/(-3))/7 + 11272? 8 Let y(n) = -19n - 3. Let c(k) = 19k + 2. Let p be -6 - -7 - (-2 - 1). Let v(l) = pc(l) + 5y(l). What is the tens digit of v(-3)? 5 Suppose -5v = -2g + 25, 3g + 4v + 17 = -3. Let s(j) be the second derivative of -j4/6 + 34j*2 + j + 19. What is the tens digit of s(g)? 6 Suppose 479887 = 77p + 114445. What is the thousands digit of p? 4 Let x(s) = 3633s2 + 47s + 48. What is the hundreds digit of x(-1)? 6 Let w = -780 - -408. Let g = w - 120. What is the tens digit of g/(-2)3/9? 8 What is the hundreds digit of (6/48125178)/(1/4)? 5 Let r(c) = -c. Let v be r(-3). Let b be v/5 + 471/(-5)3. What is the tens digit of b/(-8) - 6/24? 3 Let z(x) = -2x + 30. Let w be z(18). Let r(o) = 12o2 - 13o - 50. What is the tens digit of r(w)? 6 Let k = -662 + 2060. What is the tens digit of k? 9 Suppose -65k + 442546 + 194324 = 0. What is the units digit of k? 8 Suppose -279p + 276p + 2b = -6229, -4p + 8303 = -5b. What is the tens digit of p? 7 Suppose 0r = 2r - 18. Let c(k) = k*2 - 3. Let u(a) = -4a*2 + a + 8. Let x(f) = -7c(f) - 2u(f). What is the tens digit of x(r)? 6 Let v(h) = -h3 + 20h*2 + 223h + 54. What is the units digit of v(-30)? 4 Suppose -3w - 3x + 5 = -5w, 2w + 4x - 16 = 0. Suppose -9 = -3h + 3s, 3h - 36 = -2h - ws. What is the hundreds digit of (h - 7)/((-306)/(-309) - 1)? 1 Let s(m) = 9m3 + 3m*2 - 2m + 5. Suppose -q = -5 + 3. What is the units digit of s(q)? 5 Suppose -5j + 29 = 9. Suppose 1746 = jr - 2k, -25 = 4k - 5. What is the units digit of r? 4 Suppose 2l + 114 = -5v + 843, -3l = -4v - 1036. Suppose -k = 5x - 780, l = 2k + x - 1172. What is the units digit of k? 0 Let n(i) = 5i - 42. Let f be n(31). Suppose -109j + fj = 140. What is the tens digit of j? 3 Let t(y) = -684y*3 + 2y*2 + 4y + 1. Let q be t(-2). Suppose 7p - 1982 = q. What is the tens digit of p? 6 Let t be (7/2)/((-2)/(-8)). What is the tens digit of ((-144)/(-10))/((t/105)/2)? 1 Let r be (-2 - 24/(-9))/((-2)/204). What is the units digit of (-1337)/(-4) - 51/r? 5 Let i(x) = 297x*2 - 21x + 172. What is the thousands digit of i(5)? 7 Suppose 57 = 5w - 3o, 2o + 24 + 11 = 3w. Suppose -3477 - 42 = -wa. What is the hundreds digit of a? 3 Suppose 6y + 10 = y. What is the units digit of y/12 - ((-2973)/18 + -4)? 9 Suppose r = 348 + 1392. Suppose -4a = 3m - 2331, 3a + 4m = -m + r. Let h = -362 + a. What is the hundreds digit of h? 2 Let n be (666/(-36))/((-2)/(-4)). Let p = -16 - n. Suppose -7h - p = -10h. What is the units digit of h? 7 Suppose 84b = -1004080 + 3250660. What is the thousands digit of b? 6 Let w(f) = -3f*2 + 6f*2 - 2f*2 + 11f - 2f2 - 12. Let s be w(9). Suppose 0 = -sr + 3r + 108. What is the tens digit of r? 3 Let y(b) be the first derivative of 730b*3/3 + 2b + 80. What is the hundreds digit of y(1)? 7 Let r(z) = 9z2 - 87 + 85 - 8z*2 - 623z**3. What is the units digit of r(-1)? 2 What is the hundreds digi	{ "pile_set_name": "DM Mathematics" }
uppose -62 = -7t + 204. What is the highest common divisor of t and 152? 38 Let i be 9 + -7 - (-4)/(-2). Let r = i + 6. Calculate the greatest common divisor of r and 18. 6 Let m be (-1)/(142/143 - 1). Let s = -132 + 212. Let k = m - s. Calculate the highest common divisor of 9 and k. 9 Suppose 2f = 5z + 158, 2f - 156 = -z + 14. What is the greatest common divisor of 21 and f? 21 Let u(a) = 20a2 + 16a + 6a2 - 16a. Let y be u(1). What is the greatest common factor of y and 52? 26 Suppose -93 = -4k + 7. Calculate the greatest common factor of k and 25. 25 Suppose 24 = 3h + 5l, h - 24 = -2h + 2l. What is the greatest common factor of h and 16? 8 Let u be ((-6)/2)/((-9)/117). What is the highest common divisor of u and 65? 13 Let b = 288 + -172. What is the greatest common factor of 29 and b? 29 Let x = -2 + 5. Calculate the highest common factor of 6 and x. 3 Suppose 0 = -4v - 3l + 31, 3 = 2l + l. Calculate the greatest common factor of v and 7. 7 Let j(x) = 3x + 4. Let f be ((-6)/5)/((-4)/10). Let w(r) = 3r - 4. Let m be w(f). Let h be j(m). What is the highest common divisor of h and 152? 19 Let r be (-6)/420/(-3). Let w be -79 + ((-2)/(-1) - 4). Let k be w/(-4) + (-2)/8. What is the greatest common divisor of k and r? 10 Suppose -4f = 89 - 329. Let m be -1 + -2 + 1 - -2. Suppose -5z - 3u + 129 = m, 3u - 99 = -4z + 6. Calculate the highest common divisor of z and f. 12 Let o = -34 + 72. What is the highest common factor of o and 57? 19 Let o = -16 - -25. Suppose 0 = 6r - 2r - 884. Suppose 5b - r = -41. What is the greatest common divisor of o and b? 9 Let d be 11(21/(-35) + (-23)/(-5)). What is the highest common divisor of 11 and d? 11 Let y be ((-2 - -4)/1)/2. Let b be (-24)/36 - 46/(-6). What is the greatest common divisor of b and y? 1 Let q(p) = 4p3 - p2 + p2 + 7p*2 + 5p + 5 - 3p3. Let z be q(-5). Calculate the greatest common divisor of 12 and z. 6 Let x(w) = w + 32. Let i be x(0). Calculate the highest common factor of 16 and i. 16 Suppose 0 = -5o - 0o - 5a + 55, -15 = -o - 2a. Let b = -46 - -53. What is the greatest common factor of b and o? 7 Let f be (-60)/(-9)(-1 - (-22)/4). What is the highest common factor of f and 10? 10 Suppose -2v = 3v - 25. Suppose -v = -z, 5u - 6z = -2z + 255. What is the greatest common divisor of 5 and u? 5 Suppose 55 = 3d - 53. Let o = -22 + d. What is the highest common divisor of 7 and o? 7 Suppose -383 + 59 = -3y. Calculate the greatest common factor of y and 12. 12 Suppose 0o = 4o. Suppose t + 4f - 34 = o, 0t + 3t + 5f = 116. What is the greatest common factor of t and 21? 21 Let r(d) = 14d*2 - d. Let o be r(2). Calculate the highest common factor of o and 27. 27 Let r be (-1)/(-1)(3 - -1). Suppose -2y + 73 = 5v - y, 4v = ry + 68. What is the highest common divisor of v and 60? 15 Let f = 43 + -35. What is the highest common factor of 8 and f? 8 Suppose -4v - 64 = -2s, 121 = 2s + 3v + 43. Calculate the highest common divisor of 126 and s. 18 Suppose -5t = 778 - 1988. Suppose n = -n + t. What is the highest common divisor of n and 11? 11 Let n = -87 + 207. Suppose -5u + n = -0u. What is the highest common divisor of u and 60? 12 Suppose -6 = -4m + 7m. Let l be (m - (-1 - 2)) + 17. Calculate the highest common divisor of l and 45. 9 Suppose 5l - 18 = 3l. Suppose -3f - l = -6f. Let s = 19 - f. Calculate the highest common divisor of s and 2. 2 Suppose 3s + 3s - 120 = 0. What is the greatest common divisor of 220 and s? 20 Let z(i) = -2i - 4. Let d be z(-5). Calculate the highest common divisor of 18 and d. 6 Let x be 1/33/1. Let n be 13/x - 18/(-6). Calculate the highest common divisor of n and 4. 4 Let m = -6 - -14. What is the highest common factor of 1 and m? 1 Let v be -2 + (4-1)/(-2). Let o(h) = 1 + h - 2 + 10. Let a be o(v). What is the greatest common divisor of a and 18? 9 Let x = -52 + 64. Calculate the highest common factor of x and 30. 6 Let p be -3 + 0 - 18/(-1). Let f = p - -33. Calculate the greatest common factor of f and 12. 12 Let q be -4(0 - 7/2). Suppose 0 = -3p + 5b - 158, -76 = 2p + 7b - 3b. Let k = p - -74. Calculate the highest common divisor of k and q. 14 Suppose -5l + 6l - 18 = -k, -2k + l + 30 = 0. What is the greatest common divisor of k and 128? 16 Let f be 9(-2 - 28/(-12)). Suppose -3w - 4i = -18 - 31, 3w - 84 = fi. What is the greatest common divisor of 92 and w? 23 Let g = 3 - -18. Let t = -13 + g. What is the highest common divisor of t and 56? 8 Let w(f) = f + 1. Let c be w(7). Let t = -15 + 31. Calculate the greatest common factor of c and t. 8 Suppose -4b = y - 68, 6b + 5y = 3b + 68. What is the greatest common divisor of 208 and b? 16 Let g = 257 - 117. Calculate the highest common divisor of 20 and g. 20 Suppose -34 = -5g - 2b, 5g - b - 8 = 35. Suppose -2t - 22 = -4l, -3l + gt = 5t - 15. Calculate the greatest common divisor of 18 and l. 6 Let g = 10 - 6. Suppose gs - 33 = -13. Suppose sv - 16 = 29. What is the highest common divisor of 99 and v? 9 Let g be 3(-4)/((-16)/12). Suppose -4p + g = -3p. Let v = 8 + -5. What is the highest common divisor of p and v? 3 Let p(y) = 3y*2 - 5y - 4. Let x be p(4). Let u(k) = 9k2 + 2k - 1. Let i be u(1). Let b = i + -2. Calculate the greatest common factor of x and b. 8 Suppose -30 = 2t - 5t. Let q(x) = x*2 + 3. Let k be q(-3). Suppose 2y + k = b - 0b, 0 = -b + 3y + 13. Calculate the highest common factor of t and b. 10 Suppose -o + 6 = 3c, 5o - c + 3 + 15 = 0. Let b = 12 - o. Suppose -3j + 4j - 3v - b = 0, 3v = -4j + 30. Calculate the highest common factor of j and 18. 9 Let b be 1 + 9 + 5/(10/(-8)). What is the greatest common divisor of 4 and b? 2 Let g = -40 - -49. What is the highest common factor of 18 and g? 9 Let l be (4 + (-8)/(-5))/(2/30). Calculate the greatest common divisor of l and 12. 12 Let u(h) = h2 + h + 1. Let z(d) = -d + 3. Let j be z(3). Suppose j = 4q - 8 - 0. Let l be u(q). Calculate the greatest common factor of 63 and l. 7 Let m(x) = x*2 + 6x + 7. Let j be m(-8). Calculate the highest common factor of j and 23. 23 Suppose -d + 722 = d. Suppose 2t = 5t + x - d, -3x + 123 = t. Calculate the greatest common factor of 15 and t. 15 Suppose 0 = -r - u + 4u + 19, 30 = 2r - 4u. Suppose 380 = ro - 2o. What is the highest common factor of 19 and o? 19 Suppose 5b - 30 = -f, -4f + 0b = -3b - 74. What is the highest common factor of 10 and f? 10 Let g = 0 - -5. Suppose -k = g, 7 = -3y - 4k + 59. Calculate the greatest common divisor of y and 8. 8 Let o(w) = w*2 + 14w - 11. Let v be o(-15). Let i be (2 - -14)/v + 10. What is the greatest common factor of i and 21? 7 Let j be (43/24)/((-4)/(-96)). What is the greatest common factor of j and 9? 3 Let c = 23 - 10. What is the greatest common divisor of 117 and c? 13 Let q be (-3)/((1/1)/1) - -18. Calculate the highest common factor of 120 and q. 15 Suppose 5p - 2 + 17 = 0. Let i(b) be the first derivative of -6b2 - 2b - 2. Let k be i(p). Calculate the highest common divisor of 17 and k. 17 Let w = -10 + 2. Let p = w - -30. Suppose -3j + 23 + p = 0. Calculate the highest common divisor of 75 and j. 15 Suppose 0 = -7i + 10i - 18. Suppose -iq + 8q = 132. What is the greatest common divisor of q and 44? 22 Let v(k) = -k3 - 4k2 - k. Let p be v(-7). What is the highest common factor of p and 28? 14 Let r = -74 + 52. Let k = r + 32. Let j be (-6)/((-9)/(-3)) + k. What is the highest common divisor of j and 2? 2 Let v(m) = m + 14 - 1 + 4 + m2. Let x be v(0). Let i = -31 + 48. Calculate the greatest common divisor of x and i. 17 Let i be 2 + 0 + -1 - -4. Suppose -2 = 2y - j - 12, 3y = -2j + 1. Suppose -yh - 2 + i = 0. Calculate the highest common factor of h and 8. 1 Suppose 0 = -4t + 20, -3u + 101 = 4t - 549. What is the greatest common factor of 10 and u? 10 Suppose 0 = -7m + 326 + 794. Calculate the highest common divisor of 32 and m. 32 Let k be 6/(-4)(-140)/3. Suppose -5h + 5n + 25 = 0, 5h + 3n - 13 + 4 = 0. Suppose 7m = hm + 40. What is the greatest common factor of m and k? 10 Let k(l) = 9 + 0 - 26l + 2. Let b be k(-9). Let m = b + -137. What is the highest common factor of m and 1	{ "pile_set_name": "DM Mathematics" }
nded to 5 decimal places? -0.00006 Let q be (2/(-2) - -2)(-21)/7. Let m be q20(-130050)/(-27). Round m to the nearest 10000. -290000 Let k = 2855 + -2800.56. Round k to 0 decimal places. 54 Let y be (-5 - -2) + 0 - 63/(-7). Suppose h = 4u - 4h + 256010, y = 3h. What is u rounded to the nearest ten thousand? -60000 Let n = 5 + 1. Let t = n + -4. Suppose -4o + to = 17200. Round o to the nearest one thousand. -9000 Let k = -1.59 + 0.59. Let u = 9.6 - k. What is u rounded to zero dps? 11 Suppose 16 = 5u - w + 4, 0 = -5u + 5w. Suppose -uf + 30 = -8f. Let n be (46/f)/((-1)/(-150)). What is n rounded to the nearest 100? -1200 Let w = 95 - 92. Let p be 980001 + w/93 + -2. What is p rounded to the nearest 100000? 1000000 Let a = -61.889 - 0.111. Let s = -62.000076 - a. Round s to five dps. -0.00008 Suppose 0 = 4a + 3n - 220000015, 5n = 4a - 5a + 55000025. Round a to the nearest 1000000. 55000000 Let v = 127.9529 - 128. What is v rounded to 2 dps? -0.05 Let g = 4631.5 - 23281. Let t = g - -18649.5439921. Let x = t - 0.044. What is x rounded to 6 decimal places? -0.000008 Let y = 240376073.19 + -240375950.19000093. Let u = -123 + y. Round u to seven dps. -0.0000009 Let o(a) = -5a - 29. Let l be o(5). Let b(k) = -k*2 + 5k + 10. Let p be b(-13). Let r = p - l. Round r to the nearest one hundred. -200 Let y(k) = 5 - k*3 + 0k + 7k2 + k - k. Let i be y(7). Suppose 0 = 6v - 4v - 4t - 104012, -260015 = -iv + 5t. What is v rounded to the nearest 10000? 50000 Suppose 5 = q - 9. Suppose 0 = -x + q - 5. Suppose xk = 4k + 2950000. What is k rounded to the nearest one hundred thousand? 600000 Let f be (-6 - (-8925)/(-6)) + 2/(-4). What is f rounded to the nearest 10? -1490 Let d = -33.4 - 0.6. Let k = d + 33.99999981. What is k rounded to six decimal places? 0 Let d(i) = 69i2 - 5i. Let h be d(-5). Let b be 8003h-1. What is b rounded to the nearest one million? -4000000 Let f = 6072.0005691 + -6072. What is f rounded to 4 decimal places? 0.0006 Let q(j) = -3j - 20. Let m be q(-6). Let w be (7/14)/(m/28). What is w rounded to the nearest ten? -10 Let z = 28 - 28.38. Let r = -5.98 - z. What is r rounded to 0 decimal places? -6 Let t = -587688842680 + 587685537754.89743. Let v = t - -3304906. Let j = 19.1 + v. What is j rounded to four decimal places? -0.0026 Suppose 3a - 2r + 29828 = 0, 9a - 19892 = 11a - 3r. Round a to the nearest 1000. -10000 Let g = -332133.72 - -317331.717. Let r = g + 14813. Let l = r - 11. Round l to two dps. 0 Suppose -6314 = -5m + 1636. Round m to the nearest one hundred. 1600 Let z be 4/(-10) - (-2 - (-76)/10). Let i(q) = q + 1. Let s(v) = -160v + 10. Let n(k) = 2i(k) - s(k). Let y be n(z). Round y to the nearest 100. -1000 Let y be (-2092613 + 2 + -1)50/(-5). Suppose -2m - 4i = -28852256, -i + 20 = 4i. Let q = m - y. What is q rounded to the nearest 1000000? -7000000 Suppose 5s + 96890 = -2y, 65s + 77535 = 61s + 3y. Round s to the nearest ten thousand. -20000 Let m = 0.036 + -8.036. Let j = 3680 - 3688.171. Let c = j - m. What is c rounded to 2 decimal places? -0.17 Suppose -2w - 6 = 3u + 7, 2w - u = -9. Let k be 5/(w/(-2)) + -120002. What is k rounded to the nearest 100000? -100000 Suppose 3j = 6 - 0. Suppose -3b - jv = 290994, -6 = -4v + 2v. What is b rounded to the nearest ten thousand? -100000 Let m = 549 + -548.304. Round m to 1 dp. 0.7 Let r = 2.065998997 + -2.066. Round r to seven dps. -0.000001 Let d = -2779655 - -4187959. Let c(x) = -x2 + 14x - 11. Let h be c(13). Suppose 5008304 = -ho + d. Round o to the nearest 1000000. -2000000 Let l(a) = 749999a + 2. Let s be 2/11 + (-80)/(-44). Let x be l(s). What is x rounded to the nearest 1000000? 2000000 Let a = -846885 + 1621885. What is a rounded to the nearest 10000? 780000 Let a be 3 - (-4)/((-4)/(-2)). Suppose 0 = 2v + 4y - 18, 2v + y + 6 = av. Suppose -4b = -3q - 0q + 5684, 5b = vq - 5680. Round q to the nearest 1000. 2000 Let p = -264.99606 + 265. Round p to four dps. 0.0039 Let c = 148.54 + -17.64. Let j = c - -11.1. Let x = j - 142.0000077. Round x to 6 dps. -0.000008 Let v = -2.29 + 2.4. Let f = 0.07 + v. Let i = 0.17942 - f. What is i rounded to 4 dps? -0.0006 Suppose 2o + 103 = 743. Let j(w) = -11w3 + w. Let z be j(-1). Suppose o = -za + 9a. Round a to the nearest 100. -300 Let y = -1023 + 1476. Let l = y + -452.99999294. What is l rounded to 6 dps? 0.000007 Let h = 34 + -52. Let u = 24 + h. Let w be u/(-4) - (-70)/4. What is w rounded to the nearest 10? 20 Let b be (-94010)/(-6) - 3/9. Let c = b - 8368. What is c rounded to the nearest 1000? 7000 Let b = 42 + -41.29. Let c = 0.11 - b. Let i = -0.6005 - c. Round i to three decimal places. -0.001 Let o = 4384.9990531 + -4385. Round o to 4 dps. -0.0009 Let s = 24 - 25.1. Let q = 0.93 + s. Let l = q + 0.03. Round l to 1 decimal place. -0.1 Let x = 53 + -38. Let r(n) = -38n*3 - 9n*2 + 17n + 20. Let j be r(x). Round j to the nearest one hundred thousand. -100000 Let f = 88837 + -49740. Let r = f - 9122. Suppose v - 4a = a + r, 2a = -2v + 60010. Round v to the nearest one hundred thousand. 0 Let d = 19662 - 9552. Round d to the nearest 1000. 10000 Let d = 27117 + -11837. Round d to the nearest 1000. 15000 Let x = -516499.008066 - -0.008066. Let r = x - -516497.900002. Let v = -1.1 - r. Round v to five dps. 0 Let u = 46.36 - 47. Let h = u + 0.63999635. What is h rounded to 6 dps? -0.000004 Let x = -1368.1041 - -1368. Round x to two decimal places. -0.1 Suppose -6u + 2x - 12 = -2u, -3x = u + 17. Let b = 3 + u. Let h be 28(-260)/(-8)b. What is h rounded to the nearest one hundred? -1800 Let h = 645 - 645.726. Let s = 0.7 + h. What is s rounded to 2 decimal places? -0.03 Let b = 41353 - -32017. Round b to the nearest one thousand. 73000 Let m = 46 - 45.81. Let a = 0.1900092 - m. What is a rounded to six decimal places? 0.000009 Let f = -242 - -241.619. Let h = 3.6 - 4. Let u = f - h. Round u to 2 decimal places. 0.02 Let p be ((-12)/(-15))/((-34)/(-10) + -3). Let f be 287992/(-40) + (p - 11/5). Round f to the nearest one thousand. -7000 Let y = 0.0941 - 0.094105636. What is y rounded to 6 dps? -0.000006 Let n = -36.964 + 204.094. Let i = 1.13 - n. Let j = 166.000143 + i. What is j rounded to 5 decimal places? 0.00014 Suppose 3d + 9 - 6 = 0. Let w be 4698 + (1/1 - d) + 0. Round w to the nearest 1000. 5000 Let p = 56 + -52. Suppose 3c - 2c - pw + 87 = 0, -170 = 2c - 4w. Round c to the nearest 10. -80 Suppose -38a + 41380 = -34a. Let j(m) = -132m*3 + 6m*2 - m. Let l be j(-5). Let r = l + a. Round r to the nearest ten thousand. 30000 Let t(z) = -8306z - 58. Let p be t(-43). Round p to the nearest 10000. 360000 Let z = -2476343 - 11325657. What is z rounded to the nearest one million? -14000000 Let g = -1716.04405 - -1716. Let z = 0.04 + g. Round z to 3 dps. -0.004 Let r = 628098 + -628095.10077. Let j = -2.977 + 0.077. Let q = r + j. Round q to 4 decimal places. -0.0008 Let u(t) = t*3 - 2t*2 + 3t - 3. Let w be u(2). Suppose -3k = 0, -s + ws - 5k = 6. Suppose -sx - 2 = 1, 3i + 3x = 177. Round i to the nearest ten. 60 Let r = 154.403202 - 154.4. Round r to 3 dps. 0.003 Let j = -2023.97434 + 2024. What is j rounded to 3 dps? 0.026 Suppose 4a - 4p = -304, -5a + 0p = -3p + 372. Let f = -117 - a. Round f to the nearest ten. -50 Let p = -1.63 + 3.61. What is p rounded to the nearest integer? 2 Suppose -2c = -3c + 25. Let y(j) = -8j*2 + 2j + 1. Let h be y(-2). Let p = h - c. Round p to the nearest 100. -100 Let w = 872.63 - 868. What is w rounded to 1 dp? 4.6 Let v = 9.47 + -12.5. Let t = v - 0.67. Round t to the nearest integer. -4 Suppose -a + 10144 = 2s, 4s - 4a = s + 15194. What is s rounded to the nearest 100? 5100 Let q = 227 + -206.1. What is q rounded to 0 dps? 21 Let c = -8071 + 7642.7. Round c to the nearest 10. -430 Let l(b) = 7130b*3 + 15b*2 + 6b - 4. Let s be l(11). Suppose 27491907 = 3a + s. Round a to the nearest 1000000. 6000000 Let w = -0.035 - -0.011. Let k = -0.0284 - w. Round k to three decimal places. -0.004 Let f = -81.908 - -82. What is f rounded to 2 decimal places? 0.09 Let r(k) = -k3 - 8k*2 + 19k + 2. Let j be r(27). What is j rounded to the nearest 1000? -25000 Let c = -6.078	{ "pile_set_name": "DM Mathematics" }
the closest to -1 in -1, 88/5, -4812? -1 What is the nearest to -0.03 in 0.3, 1, 2/23, -1? 2/23 What is the closest to 0.02 in -2/7, 2, -0.04689? -0.04689 What is the nearest to 1167 in -1/5, 2, -4? 2 Which is the closest to 1.3? (a) 8 (b) 1/10 (c) -2 b Which is the closest to -0.6? (a) -0.5 (b) 0.11 (c) 917 a What is the closest to -0.2 in -4, 387/4, 0.3, 2, 26? 0.3 Which is the nearest to 0.15? (a) 13/3 (b) -4/7 (c) 4/3 b What is the closest to 1 in 69, 9, -4, -2, -9? -2 What is the closest to -2 in 16, -2/959, -4? -2/959 Which is the closest to 0.5? (a) 24 (b) -297 (c) 0 c Which is the nearest to -1/3? (a) -3/5 (b) -0.19 (c) -4 (d) -1/4 d What is the nearest to -0.1491 in 2, 1/2, 18? 1/2 What is the closest to -2.4 in -13, 236.1, -2? -2 Which is the nearest to 0? (a) 1/4 (b) 4/7 (c) 2/7 (d) -24/7 (e) 1 a What is the closest to 0 in -45, -0.08, -1.3, 4, -13? -0.08 What is the closest to -1/21 in -42.7, -3/7, 3, 5? -3/7 Which is the nearest to -49? (a) 0.1 (b) -4/7 (c) -26 (d) 4 c Which is the closest to -1? (a) -2/11 (b) 3 (c) -5/1778 a Which is the nearest to 1? (a) 3/5 (b) -1 (c) -2367 a Which is the nearest to -1.7? (a) 0.07 (b) -0.46 (c) 0.5 b What is the closest to 2 in 3, -2, 1/4, -14/41? 3 Which is the nearest to 0? (a) 0.2 (b) -0.4 (c) -2 (d) 0 d Which is the closest to -31? (a) 0 (b) -7 (c) -0.05 b Which is the closest to -3? (a) -2/5 (b) -0.8 (c) -1/2 (d) 1 b What is the closest to 1 in -0.4, -3, 10/249? 10/249 What is the closest to -2/7 in 0.2, 149, -0.06, -5? -0.06 What is the closest to 2/5 in 1, -3/2, -0.4, 147? 1 Which is the nearest to 1? (a) -3 (b) 6.3 (c) 1 (d) -0.4 (e) 2 c Which is the nearest to -2.929? (a) 3 (b) -1/6 (c) -0.3 (d) 1 c Which is the nearest to 1352? (a) 10 (b) 0.1 (c) -2 a What is the nearest to -0.14 in -2, -302, -1/5, 0.2, 2? -1/5 Which is the nearest to 0.06? (a) 0 (b) -1 (c) 3/8 (d) -2.6 (e) 30 a Which is the nearest to -198? (a) -1 (b) -0.5 (c) -1.7 c What is the nearest to 1 in 2, -15, 238.4, 0.3? 0.3 Which is the nearest to 172? (a) -0.0585 (b) -0.5 (c) 1 c What is the closest to 305 in 1/5, -0.3, 1? 1 Which is the closest to -0.1? (a) 7 (b) -0.2 (c) -201 b What is the nearest to 0.34 in 40, -3.5, -1? -1 What is the closest to 131 in -138, 0.09, 0.4? 0.4 Which is the closest to 0.1? (a) 2.26 (b) 0 (c) 0.5 (d) -5/4 (e) -10/19 b What is the nearest to -43 in 3, 33, 2, 5? 2 Which is the closest to -0.1? (a) 1.9 (b) 0.5 (c) 23 b Which is the nearest to 0? (a) 0 (b) -13.54 (c) -9 (d) 0.4 a Which is the nearest to -2? (a) -15410 (b) 4/23 (c) 5 b Which is the closest to -2? (a) -5/6 (b) 0.08 (c) 127/4 a What is the nearest to 1/9 in 2, -13.1, -6? 2 What is the nearest to 3 in -5.9, -5/3, -2, 0.6? 0.6 Which is the nearest to 27? (a) -0.3 (b) -53 (c) 0.3 c What is the closest to 1/2 in -0.2, -346, -0.4, -1/3? -0.2 What is the closest to -0.1 in -0.5, -2, -114378? -0.5 Which is the nearest to 25? (a) 592 (b) -5 (c) -4 c Which is the nearest to 0.1? (a) -8 (b) 512 (c) 2 c What is the nearest to 1 in 26/9, 17, -0.5, 101? -0.5 What is the nearest to -0.05 in 2/31, -5, 4/3, -0.3242, 3? 2/31 Which is the nearest to 81? (a) -1/2 (b) -0.3 (c) 0.2609 c Which is the nearest to -1? (a) -8 (b) 2 (c) -236 b Which is the closest to 2/9? (a) -5 (b) -24 (c) 36 (d) 0.2 (e) -5/3 d Which is the nearest to 2? (a) 0 (b) 62 (c) 0.03 (d) 3 d Which is the closest to 2/7? (a) 2/15 (b) -8/37 (c) 2045 a Which is the nearest to -12? (a) 1 (b) -3/7 (c) 0.059 (d) -6 d Which is the nearest to 2? (a) -0.049 (b) 34 (c) -0.1 a Which is the nearest to 0.046? (a) 4 (b) -2/23 (c) 9 (d) 0 d What is the closest to 0 in -0.8, -3, 1975? -0.8 Which is the nearest to -0.1? (a) -2/1437 (b) -0.2 (c) -3 a What is the nearest to 0.8 in -0.09, -128, 0.2? 0.2 Which is the nearest to -3/5? (a) -2 (b) -13 (c) -0.04 (d) -47.4 c What is the closest to 2 in -1299, -0.3, 1/2? 1/2 Which is the nearest to -1? (a) 265 (b) 3 (c) -876 b What is the closest to -4.3 in 1/2, -109, -1/5, -20, -0.5? -0.5 Which is the nearest to -61? (a) 4/3 (b) 6 (c) 2.72 a Which is the nearest to 0.143? (a) -0.3 (b) -4 (c) -5 (d) 2/13 d What is the closest to 95.9 in -0.35, 0, -0.4, -5? 0 What is the nearest to 1 in 1, -5, 282, -23, 1/3? 1 What is the nearest to -1 in -0.2, -4/9, -4, 19.6, -26? -4/9 Which is the closest to 2/21? (a) 0.74 (b) 23 (c) 1 a Which is the nearest to -58? (a) 8/3 (b) -2 (c) -0.1 b What is the nearest to -2 in -1/8, 4, -134, -1/5, -0.28? -0.28 Which is the closest to 2/7? (a) 117 (b) 3/4 (c) 8 (d) 3 (e) 5 b Which is the closest to 28? (a) 3 (b) -3 (c) 80 a What is the closest to -8 in 17, -9.9, 0? -9.9 What is the closest to -11 in -1/7, 809, -6? -6 What is the nearest to -1 in 10, -1/4, 0, 325/19? -1/4 Which is the closest to -3? (a) 20 (b) 59 (c) -1/5 (d) -1/7 (e) -6/11 e What is the closest to 2/3 in 2/3, -113/4, 4, -0.11? 2/3 What is the nearest to 3/16 in 525, 0.2, -4? 0.2 What is the closest to 5 in -0.4, -98, 0.1, -0.01? 0.1 What is the nearest to -0.016 in 5/81, -15, -1? 5/81 Which is the nearest to -6? (a) -0.33 (b) -5 (c) 0.1 (d) 0.05 (e) -0.1 b Which is the nearest to -2/7? (a) -1.08 (b) 10/11 (c) -0.3 c What is the nearest to 2/7 in 11, 2.3, 3, 4/49? 4/49 Which is the nearest to 0.1? (a) -1 (b) 0.17 (c) 2/27 (d) 0.3 c Which is the nearest to 4? (a) -1 (b) -1/9 (c) -8 (d) -3/76 d Which is the nearest to 25? (a) 2 (b) -2 (c) -20 (d) -2/11 a What is the nearest to -2 in -30, -1/27, 0.2? -1/27 What is the closest to 0.1 in -34/3, 2, -1/2, -5/8? -1/2 Which is the nearest to -1? (a) 0.1 (b) 262 (c) 18/7 (d) -0.5 d What is the nearest to -3 in -7, 0.1, 1/60, 0? 0 Which is the closest to 0? (a) -6 (b) -1 (c) 0 (d) 16 c Which is the nearest to 3? (a) 3/70 (b) -2/31 (c) -2/7 a What is the closest to -2 in -23, 11, 0? 0 Which is the closest to -2/3? (a) 0.8 (b) -4/53 (c) 0.3 (d) 0.2 (e) -1 e Which is the closest to -3? (a) -2/13 (b) -1.78 (c) -0.1 b Which is the nearest to -0.3? (a) 5 (b) -814 (c) -1.1 c What is the nearest to -0.2 in 1, 362, -0.003? -0.003 Which is the nearest to 1/84? (a) 2/3 (b) 5 (c) -2/107 c Which is the closest to -23? (a) -4 (b) 5/9 (c) 5 (d) -24 d Which is the nearest to -3? (a) -1 (b) 0.09 (c) -90 (d) -3 d What is the nearest to 1 in -8, 0.018, -2/21, -1, 1/10? 1/10 What is the closest to -7/24 in -0.5, -5, -0.4, 3/5, 1? -0.4 What is the nearest to 1 in -0.3, -1396.8, -5? -0.3 What is the nearest to 1 in 2/561, -19, 0.4? 0.4 What is the closest to 1 in -18/11, 12, -26? -18/11 Which is the closest to 0? (a) 4.67 (b) -0.1346 (c) 0.2 b What is the closest to 2.8 in 5, -3/5, -2? 5 Which is the nearest to 2/5? (a) -20 (b) 16.7 (c) -0.5 c What is the nearest to 0.02 in 2, 1.4, -18.2, -5? 1.4 Which is the nearest to -183? (a) 4 (b) 1 (c) 0.4 (d) 4/7 (e) -4 e What is the closest to -19 in 1/3, -59, 1/6, -0.1? -0.1 What is the closest to 487 in 17, -17, 0? 17 What is the closest to -2/3 in 0.1, 0.48, 96? 0.1 Which is the nearest to 0.0284? (a) -0.4 (b) -0.049 (c) -1 (d) 5 b Which is the closest to 0.09? (a) -0.5 (b) 33 (c) 0.0395 c Which is the nearest to -15? (a) 0.1 (b) -1 (c) -8.8 c Which is the nearest to 0? (a) 3/5 (b) 1/356 (c) -0.7 (d) 11 b What is the nearest to 1 in -3, -0.08, 1.733, -2/3? 1.733 What is the closest to 0.4 in -0.5, 1/740, 0? 1/740 Which is the closest to -1? (a) -2/15 (b) -0.05 (c) 5822 (d) -2/11 d Which is the closest to 0.06? (a) 0.11 (b) -28 (c) 1.1 (d) -2/3 a Which is the nearest to -0.2? (a) -1/2 (b) 0 (c) -102.05 b Which is the closest to -13? (a) 5 (b) -5 (c) -137 (d) -7 d What is the nearest to 7898 in -2/13, -3, 10, 1? 10 Which is the nearest to -8? (a) -5 (b) 3 (c) 1/4 (d) -3/2 a Which is the nearest to 0? (a) -0.2 (b) 36 (c) 1/7 (d) 31 c Which is the closest to 2? (a) 0.5 (b) 0.0948 (c) -4 (d) 0.2 a What is the nearest to -4 in -1/4, 0.1, 4, 3/25? -1/4 Which is the closest to 1/2? (a) -101 (b) 89 (c) 0 c What is the closest to 36/11 in -3/2, -4, 0.05, -56? 0.05 What is the closest to 2/5 in -2.1, -23, 1/3, -2? 1/3 Which is the closest to	{ "pile_set_name": "DM Mathematics" }
of -r*3/3 - 11r*2 - 32r. Let v be c(-23). Suppose -6p + v = -0p. What is the third smallest value in p, 0.2, -1/2, 1? 1 Let q(l) = l*3 + 7l*2 + 29l + 200. Let j be q(-7). Which is the third smallest value? (a) j (b) -2 (c) 2 (d) -1/6 d Let g be (17/(170/(-80)))/(1 - 3). Suppose 0 = -4o, o + go - 40 = 4a. What is the second smallest value in a, -1, 0.4? -1 Let k = 4.37 + -3.494. Let y = 0.076 - k. What is the second biggest value in y, -14, 1? y Let x = -24.31 + -0.89. Let t = 25.6 + x. What is the fourth biggest value in 5, 2, t, 0.3? 0.3 Let w = -667 + 669. Which is the second smallest value? (a) -3 (b) 0.5 (c) w (d) 2/15 d Suppose -n = -25 + 30. Suppose -2p = -0 + 4. Let i = -1.06 + 4.06. Which is the second smallest value? (a) p (b) i (c) n (d) 6 a Suppose 6v = -5h + 55, -30h = -26h + 5v - 45. Which is the biggest value? (a) -3276 (b) h (c) 3 b Let s = -28046 + 28045.9. Which is the smallest value? (a) s (b) -5/274 (c) -0.5 c Let n = 0.6751 - -0.1249. Let t = 0.85 - 1. Let g = t + 0.05. Which is the second smallest value? (a) g (b) 4 (c) n c Let v = -6637 - -6636.6. Which is the third biggest value? (a) 209/2 (b) v (c) 0.5 (d) 3/2 c Let t be 24/273/2. Let r = 42 - 42. Let j = 2.637 + -2.837. Which is the fourth biggest value? (a) t (b) -1 (c) r (d) j b Let l = 0.4 + 0.1. Let r = 31151 - 31151. Which is the third smallest value? (a) r (b) l (c) 0.4 (d) 6/11 b Let u = -2/7 - -25/63. Suppose 11k - 14k = 5i + 3374, -2i - 1354 = -k. Let p = i + 676. Which is the third smallest value? (a) 2 (b) p (c) u a Let f = 302.2 + -302. Let r = 291.7 + -292. What is the biggest value in -0.9, f, r, -1? f Suppose -209i + 208i = 2o - 7, 15 = 3o + i. Let u = -16 + 63/4. What is the third biggest value in -0.07, u, o? u Let v = 406 + -714. Let z = 293 + v. Let c be (0 + -1)/((-3)/(-5)). What is the biggest value in z, 4, c, -0.3? 4 Let p be (-9)/(-1) + (-8376)/(-33). Let j = 263 - p. Let i = -0.5 - -3.5. Which is the second biggest value? (a) i (b) j (c) 0.2 (d) -5 c Let y = -13435.8 + 13438. What is the third biggest value in -1/31, y, -0.5, 3/2? -1/31 Let o = -1.313 + 1.5. Let j = o + 0.213. Which is the second smallest value? (a) -2/29 (b) 1/7 (c) j (d) -2/11 a Let f = 46 + -134/3. Let c be 135/297(((-624)/20)/(-6) + 0). What is the second smallest value in 1/12, 2, f, c? f Let j = 0.7 + 3.3. Let h = 0.216 - 0.206. Let s = 1.8 + -2.1. Which is the fourth smallest value? (a) s (b) j (c) h (d) 5 d Let j = -161.9 - -178.9. Which is the smallest value? (a) -3/8 (b) -2 (c) -1/3 (d) j b Let c = 140.205 + -141. Let d = 0.205 - c. What is the biggest value in 0.4, -4/25, d? d Let s = 162.2 - 138.2. What is the smallest value in 2/5, s, -5? -5 Let i = 115 + -5. Let l = i - 109.7. What is the fourth smallest value in 0, l, -0.3, -2/7? l Let n = -138 - -3847/28. Let w = 6/7 + n. Let t = 55 - 54.6. What is the fourth biggest value in -0.1, w, t, -0.5? -0.5 Let q = 6890 - 6894. Let o = -2 + 2.01. Which is the biggest value? (a) q (b) o (c) 3 c Let k = -308168/55 + 5603. Which is the smallest value? (a) -0.4 (b) -1/9 (c) k a Let v be 3/(-10)(-280)/(-16) + 6. Which is the third biggest value? (a) v (b) 2 (c) 0.4 (d) -0.054 c Let f = 128475 + -128477. Let m = 0 + 0.4. Let l = -2 + -7. Which is the second smallest value? (a) l (b) f (c) m b Let f = -650.3 - -650. Let y = -41.6 + 43.59. Let m = y + 0.01. Which is the third smallest value? (a) f (b) m (c) -0.2 (d) 3 b Let z = 7.51 + -7.91. What is the biggest value in -5/6, 5, -7, z, 0.3? 5 Let f = -18259/6552 - -1/936. Let m = 16/7 + f. Which is the fourth biggest value? (a) 1/17 (b) -2 (c) -1 (d) m b Let f = 0.39 + 0.11. Let t = 19 - 20.24. Let l = 0.24 + t. Which is the third biggest value? (a) f (b) l (c) -1/10 (d) -4 b Let y = -194 + 205.4. Let i = -16.4 + y. What is the second biggest value in 0, 2/5, -6/13, i? 0 Let s = 1.1 + 6. Let q = s + -5.1. Which is the second biggest value? (a) q (b) 2/77 (c) -0.5 (d) -5 b Let l = 0.0148 + 0.6852. Which is the second biggest value? (a) -0.04 (b) l (c) -0.2 a Suppose -3y + 1 = -4r - 5, 0 = -2r - y - 8. Suppose -2l = -158 + 164. Let m be ((-1)/r)/(l/(-378)6). What is the biggest value in 3/7, -2, m? m Let r = -1586.03 - -1586. Which is the second biggest value? (a) 0.5 (b) r (c) 1.4 a Let j = -349.6 - -349.6. Which is the second smallest value? (a) 2/7 (b) -5 (c) 0.3 (d) 14 (e) j e Let w = -129.84 + -1.16. Let d = w - -131.2. Let j = 74/5 - 14. What is the third biggest value in d, j, -5, 1? d Let j = -2 - 19. Let m = -11 - j. Let p be 85/684/(5-4). What is the second smallest value in p, -0.5, m? p Let r = 83.367 + -0.567. Let k = r - 83. Let q = 3.6 - 4. What is the second smallest value in k, -0.3, q? -0.3 Let i = -1058 - -1060. Let l = -7/59 - 121/472. Which is the second smallest value? (a) 58 (b) l (c) i c Let o = 445 - 984. Let x = o - -538.5. Which is the third smallest value? (a) x (b) -0.2 (c) -15/14 b Let r = -0.3303 + 0.5303. Let z = -0.083 + -0.017. What is the fourth smallest value in 0.082, z, -1/4, r? r Let x = -99 + 100.17. Let r = 0.17 - x. Which is the third biggest value? (a) r (b) 0.5 (c) -0.089 a Let s = 63/2 + -32. Suppose -5w = -j + 3, -3j - w + 37 = 12. Let d be (147/84)/(2/j). Which is the smallest value? (a) -0.2 (b) s (c) d b Let v = 5870/7 - 19864/21. Let k = 108 + v. Which is the fourth biggest value? (a) k (b) -8 (c) -2/9 (d) -2 b Let w = 10.6 - 11. Let z = w + 0. Let x = -2.851 - -2.351. Which is the third biggest value? (a) z (b) -0.2 (c) x (d) 0 a Let a = 2.3 + -0.3. Let j = 13.28 + -15.9. Let v = j + 2.82. What is the biggest value in a, -0.2, v? a Let l = -51 - -41. Let d = -29 - -29.17. Let x = d + 0.23. Which is the biggest value? (a) 1/3 (b) l (c) x c Let j(t) = t3 - 14t*2 + 4t - 16. Let i be j(14). Let x be 90/i16/6. Which is the fourth biggest value? (a) x (b) -0.4 (c) 0 (d) -0.3 b Let d be (-2)/20 + (-3)/(-5). Which is the smallest value? (a) d (b) 434 (c) -5 c Let k be (-4 - 170/(-35))/(45/15). What is the third smallest value in -11, -5, 2/3, -2/3, k? -2/3 Let h = 75.97 - 72.97. Which is the fifth smallest value? (a) 8/5 (b) h (c) -2 (d) 0.3 (e) -0.4 b Suppose -2f = 6, 5l + 0l + 22 = f. Let u = 0.044 - 120.744. Let g = -121 - u. Which is the third smallest value? (a) -0.2 (b) l (c) g (d) -1 c Suppose -17j + c = -12j + 17, 20 = 10c. What is the biggest value in 2/7, -258, 0, j? 2/7 Let f = -21986 - -21988. Let b = 0.03 + -44.03. What is the second smallest value in f, -2/9, b? -2/9 Let p be (0/4)/(-5) - (-1)/(-5). What is the fourth smallest value in -2/3, p, -2/9, -3? p Let n be (-3170)/348722/4. Let h = -0.03 + -0.37. What is the third biggest value in n, 17, h? n Let y = -12.72 - -12.52. Let j = 201/7 + -157/14. Which is the second smallest value? (a) y (b) j (c) -5 a Let i = -240 - -240.81. Let u = i + -0.31. Which is the biggest value? (a) -4 (b) 0.09 (c) u (d) 0 c Suppose 43z + 6 = 40z + 3q, 3q - 4 = 5z. Let t = -9 - -8.2. Let y = 0.7 + t. Which is the second smallest value? (a) y (b) 1/6 (c) z b Let t(n) = -n2 - 15n - 36. Let w be -17 + (1 - 3)35/(-14). Let f be t(w). Let y = 2.8 + -3. What is the third biggest value in y, 3, f? y Let s = 7/11 - 45/88. Let q = 334.994 - 338. Let v = q - -0.006. Which is the smallest value? (a) 2/5 (b) s (c) -5/2 (d) v d Let a = -7341 - -7261. What is the second biggest value in -0.2, a, -7/3? -7/3 Suppose -23h + 5h = 12h - 90. Which is the second biggest value? (a) 795/11 (b) 0.1 (c) h c Let i = 29/3 - 91/9. Suppose -4j - 520 = 4a, 4a = 2j + 5a + 264. Let t = j + 136. What is the second biggest value in t, 3, i, -4? t Let k = -23453/296 - -2927/37. Let m = 0.05 + 0.35. What is the third biggest value in k, -1/6, m, 36? k Let g = -43 - -42. Let d = -0.8093 + 0.8493. Which is the biggest value? (a) g (b) d (c) 3/2 c Let q = -650/9 + 72. Let i = -1612/3 - -549. Let d = i + -12. Which is the third biggest value? (a) d (b) -2/7 (c) q a Let o = 80.47 + -451.47. Which is the third biggest value? (a) -0.2 (b) o (c) 0.2 (d) 0 (e) -1/2 a Let f = 326310 + -326311. Suppose -2 = 4o	{ "pile_set_name": "DM Mathematics" }
). What is i(1)? -2 Suppose 20 = 5j - 2p - 6, 0 = 3j - p - 15. Let o(z) = -3z + 0z - z2 - 2z2 + z3 - 1. What is o(j)? 3 Let m(k) = 32k - 10. Let v(h) = -17h + 5. Let q(f) = -4m(f) - 7v(f). Give q(2). -13 Let p(a) = a*2 - 9a + 1. Let s = 4 + -14. Let v = -6 - s. Determine p(v). -19 Let d(z) be the first derivative of 1/4z4 + 5/3z*3 + 23 + 2z + 5/2z2. Calculate d(-4). -2 Let l(r) = r3 - 12r*2 - 13r - 5. Let b = 257 + -244. Calculate l(b). -5 Let k(m) = 6m - 7. Let s(v) = v - 1. Let w(r) = k(r) - 4s(r). Let o = -4 - -7. Give w(o). 3 Let l(z) = 11z2 + 64z + 47. Let x(n) = -2n2 - 11n - 8. Let k(f) = 6l(f) + 34x(f). Give k(8). -38 Let w(b) = -2b + 7. Let p = -32 + 26. Let u(m) = 2m - 8. Let y(a) = pw(a) - 5u(a). Determine y(2). 2 Let p(c) = 1181 + 1180 + 3c + 1175 - 3551. Determine p(3). -6 Suppose -4o = -3o + 4. Let f be o/(-22) - (-186)/66. Let w(a) = fa*2 + 4a - 3a2 + a2 - 5. Calculate w(-6). 7 Let x(r) = -2r*3 - 2r*2 - 2r - 3. Suppose -10z = -8z + 16. Let w(v) = -v - 8. Let k be w(z). Suppose -3h - 2h - 10 = k. What is x(h)? 9 Let l(z) = -8 + 143z - 144z + 8. Suppose -7v = -3v + 24. Determine l(v). 6 Suppose 0c + 8 = -4c. Let s(t) = 6t + 1 - 4 - 1. Let y(a) = -3a + 2. Let n(v) = -6s(v) - 11y(v). Determine n(c). 8 Let g(q) = q*2 - 6q - 1. Let o(d) = 8d - 82. Let r be o(11). Determine g(r). -1 Let u(n) = 0 - 3n - n*3 - 2n + 7n2 - 5. Let i = -273 + 279. Give u(i). 1 Let d(c) = -c2 + 41c + 39. Let z be d(42). Let u(w) = -w3 - w + 4. What is u(z)? 34 Let w(p) = -p2 - 3p + 3. Suppose 3i = 2y - 68, 3i + 2y - y + 56 = 0. Let o = 22 + i. Give w(o). -7 Let p(c) = -c + 2. Let r = 34 - 30. Let n be 60/24r/5. Give p(n). 0 Let l be 2 + -1 + (2 - 1). Let o(c) = 22c - 2 - c2 + 5 - 25c + l. Determine o(-5). -5 Let f(h) be the third derivative of 0 + 0h + 0h*5 + 2h*2 - 1/6h*3 + 1/12h*4 + 1/12h*6. Give f(1). 11 Suppose 0 = 2y - 24 - 8. Suppose y = -3w - w. Let t be w/6 + 2/3. Let g(m) = m3 + m2 - m + 1. Calculate g(t). 1 Let g(p) be the third derivative of p4/8 - 3p*3 + 187p2. Give g(8). 6 Let c(o) be the first derivative of -o4/4 + o*3 + 4o*2 + 4o + 396. Determine c(5). -6 Let z be (6 + 0)/((-9)/(-6)). Suppose 15 = -zw + 3. Let b(p) = 2p*2 + 5p + 4. Calculate b(w). 7 Let k(p) = -5p2 - p. Let y be (-3)/2 + 71/2. Let n = -35 + y. Calculate k(n). -4 Suppose -13 = g - 14. Let c(n) = -3n*2 + 3n*2 + 6n*2 - 2n*2 - g. Determine c(-1). 3 Let p be (60/(-25))/((162/60)/(-9)). Let n(l) = -3l + 7. Give n(p). -17 Let r(z) be the first derivative of z*3/3 - 7z*2/2 + 5z - 1. Let u = 72 - 50. Let a(i) = 2i - 40. Let v be a(u). Calculate r(v). -7 Let s(x) = -x3 - 5x*2 + 5x - 3. Suppose 72p = 65p + 105. Suppose pa + 62 + 28 = 0. What is s(a)? 3 Let s(i) = -2i*2 - i - 1. Let t(v) = -9v*3 + 5v*2 + 5v + 2. Let d(b) = -3s(b) - t(b). Determine d(1). 9 Let p(h) be the third derivative of -h4/6 - h3/6 - 4h*2. Suppose 2x - 3w + 9 = -3x, 4x + 4w + 20 = 0. Let v = -2 - x. What is p(v)? -5 Let b(i) = 6i - 2i*2 - 1 - 6 - 14 + 19 + 3i. Give b(6). -20 Let j(m) = -5m + 26. Let s(c) = c - 5. Let z(d) = 2j(d) + 11s(d). Suppose -81 = -k + 4k. Let o = -21 - k. Determine z(o). 3 Let s(a) be the second derivative of a5/20 + a4/12 + 10a2 - 84a + 2. Give s(0). 20 Let r(s) = 15s2. Let p be r(1). Let a be 32/10 - 3/p. Let w be a/(-9) - 14/(-6). Let y(h) = -h2 + h. Give y(w). -2 Suppose -k + 10 = -0k. Let u(m) = 0m2 + 9 + 3m*2 + 3m - km - 2m*2. Determine u(7). 9 Let u be 100/(-16) + 1/4. Let s(q) = q + 3. Let m be s(u). Let r(a) = -2a*3 - 5a2 - a - 4. Let i(g) = -g3 - 1. Let d(z) = mi(z) + r(z). Give d(5). -6 Let g(f) be the third derivative of 0 + 0f + 5f2 + 1/3f*3 + 1/24f*4. Suppose 20 = 2j - 4t, -j + 13 = -5t - 6. What is g(j)? 6 Let x(v) = v3 + v2 + 5. Let m be x(0). Let w(g) = -g*3 + 3g*2 - 1. Let j(s) = 3s*3 - 8s*2 + 6s + 3. Let d(n) = j(n) + 4w(n). Calculate d(m). 4 Let x(s) = 7s*2 - 9s - 19. Let y(q) = 0q2 + 10q*2 - 28 + 2q - 16q. Let p(g) = -7x(g) + 5y(g). Determine p(6). -13 Let b be ((-128)/(-12))/(-8)2/(-8). Let u(n) be the first derivative of bn3 + 1/4n*4 + 0n + 0n2 + 6. Give u(1). 2 Let x(o) = -o + 8. Suppose -w = -3p - 22, 10p - 11p = 5. What is x(w)? 1 Let a(x) = 2x - 5. Let r be (-1)/((-4)/16) - -592. Let f be 2/(-7) - r/(-28). Suppose v - 5 = -4t + 4, 4v + t - f = 0. Give a(v). 5 Let d(j) = j2 - 16j - 16. Let t be d(17). Let h(q) = q*2 - 3q + 3. What is h(t)? 1 Let o(g) be the first derivative of -g*4/4 - 7g*3/3 - 3g*2 + 2g + 125. Calculate o(-6). 2 Suppose 6 = 18b - 30. Let f(h) be the second derivative of 0 + 7/6h*3 - 5/2h*b - 1/12h*4 + 4h. Determine f(6). 1 Let t(r) = -4r2 - 3r + 15. Let b(n) = -3n2 - 2n + 13. Let y(j) = -6b(j) + 5t(j). What is y(-3)? -12 Suppose -21w + 29 = 197. Let a(c) = c3 + 7c*2 - 7c + 11. Determine a(w). 3 Let v(f) = 2f - 9. Let t be v(6). Suppose 5d - 3 = -2a, -a - td + 7d + 8 = 0. Let s(k) = ak2 - k2 + 3k3 + 2k - 2k3 + 3 + 0k2. Give s(-2). 3 Let a(r) = r3 - 12r2 + 2r - 14. Let p = -26 - -38. What is a(p)? 10 Let f(p) be the third derivative of -p4/24 - p3/2 - p*2 + p. What is f(-4)? 1 Let r = -4 + 6. Suppose k - 5f - 18 = 0, 3f = -5 + r. Let b = k + -11. Let p(d) = -d2 + 3d - 2. Determine p(b). 0 Let i = -1 + 1. Let r(f) = -f + 1. Determine r(i). 1 Suppose 0 = -2t + 4t - 50. Let q(y) = 31 - 50 - y + t. Give q(-6). 12 Let i = 1092 - 1106. Let q(y) = y*3 + 14y*2 - y - 13. Give q(i). 1 Suppose -4q = 4d - 20, 4d - q + 2q = 32. Let s(p) = 7p*3 + 12p*2 + 3p - 23. Let x(g) = 3g3 + 6g*2 + g - 11. Let c(t) = dx(t) - 4s(t). Give c(5). 3 Suppose -90 = 45s + 180. Let i(l) = 7l + 42. Determine i(s). 0 Let r(q) = -2q*3 + 13q2 - q + 3. Let l(w) = w3 - w*2. Let j(m) = 3l(m) + r(m). Calculate j(-10). 13 Suppose 0 = 6a - 22 + 4. Let z be (-14)/56 - (-9)/4. Let v(c) = 0 + 13c - c*3 - 15c + 4 + 3cz - 1. Give v(a). -3 Let t be (20/30)/(3/(-18)). Let i(p) = -p2 - p + 1. What is i(t)? -11 Let r be (4/(-3))/(124/(-837)). Let b(q) = q3 - 10q*2 + 11q - 11. What is b(r)? 7 Suppose -58 - 50 = 12p. Let d(t) = 4t - 6. Let a(v) = -v + 1. Let i(r) = pa(r) - 2d(r). Give i(5). 8 Let h(z) be the first derivative of 3/2z2 + 4 + 5z. What is h(-4)? -7 Let q(j) be the first derivative of 8/3j3 - 8 + 1/12j*4 + 0j + 0j2 - 1/120j*5. Let u(v) be the third derivative of q(v). Calculate u(-3). 5 Let o(c) = 0c - 77c2 + 5 + c3 + 81c*2 + 0c. Give o(-5). -20 Let a(w) be the first derivative of -1/360w6 - 1 + 1/12w*4 + 0w - 1/40w5 + 0w*2 + 2/3w*3. Let z(n) be the third derivative of a(n). Give z(-5). -8 Let k be 28/(-49) - 39/(-7). Let v be 15/3(1 - 0). Let u(w) = 3w - w2 - v + 4w + 0. Give u(k). 5 Suppose -x + 3h = 2h - 12, 8 = -x - 3h. Let k(w) = -xw + 9w - w. Calculate k(4). 4 Let m(x) = 3x - 6. Suppose 3j - j = -18. Determine m(j). -33 Suppose 2n - 3f = 19, -2f + 14 = 11n - 35. Let g(j) = 4j - 21. Give g(n). -1 Let g(q) be the second derivative of q4/8 + q3/3 + 6q2 + 7q. Let f(k) be the first derivative of g(k). Determine f(-4). -10 Let w = 26 + -25. Let v = 8 - 6. Let m(a) = va + a - 2a + 5a2 - a2. Calculate m(w). 5 Let w(r) = 104r - 203r + r2 + 103r - 4. What is w(-6)? 8 Let w(b) = b*2 + 2b + 2. Suppose 5x + 3 - 13 = 5d, 11 = -2d - 5x. Let k be w(d). Let y(m) = -8m - 11m - 4 - 10m + 30m. What is y(k)? 1 Let u be (15(-7)/(-70))/((-6)/16). Let s(o) = -2o*2 - 5o + 2. Calculate s(u). -10 Let r(k) = -5k3 + 2k + 7k3 + 5k*3 - 5k*2 - 7 + 0. Let a(p) = 3p*3 - 2p*2 + p - 3. Let m(v) = 5a(v) - 2r(v). Determine m(1). 1 Suppose -5x + 8x = 6. Let l(v) = -2v*x - 3v*2 + 6v*2 + 7 + 7v. Let b(w) = -6w2. Let p be b(-1). Determine l(p). 1 Let m(h) = 14h. Let o(x) = -x3 + x2 + 17x + 2. Let a be o(0). What is m(a)? 28 Suppose -2u - 14 = -2g, -3g - g + 12 = -2u. Let b(v) = v2 + 7v - 2. What is b(u)? 6 Let q(g) be the second derivative of g3/3 + g2 - 459g. Let a(p) be the first derivative of -p4/4 + p*	{ "pile_set_name": "DM Mathematics" }
Solve n + 330 - 338 = 2b, 2b - 5n = -16 for b. -3 Solve -q - 33 = -3o, -10q = -3o - 15q + 51 for o. 12 Solve -650q + 21 = -653q - 3c, 0 = 4q - 5c - 62 for q. 3 Solve -3h + 9 = 6u, 0 = 73h - 78h + 4u - 13 for h. -1 Solve 2q = 338v - 340v - 12, 2q - 2v = 0 for q. -3 Solve 0 = -6c - 2m, 17m - 18m + 5 = -2c for c. -1 Solve -l - 2y = 257 - 256, -4l = 4y + 4 for l. -1 Solve 42j = 34j - 3g - 46, 7j + 45 = -5g for j. -5 Solve 2r - 4r = 5h + 14, 1739r - 1737r = -h - 6 for r. -2 Solve 4t - 90c + 87c + 2 = 0, 3 = -t + 2c for t. 1 Solve -r + 5x = -36, 43x + 35 = 38x for r. 1 Solve -9i - 114 + 42 = 0, -3i = b + 24 for b. 0 Solve 0q + 5q + t = 8, 5t - 11 = 4q for q. 1 Solve 549f - 23 = -5y + 546f, f + 25 = 31y for y. 1 Solve 4j + 3 = -5w, -5w = -j - 8w - 6 for j. 3 Solve 5j = -2g - 2, -4j + 0g = -3g + 20 for j. -2 Solve -5c + 35 = 0, -3f + 2c = -522 + 536 for f. 0 Solve 17k + 39 = -l, -4l - 86 = -4k - 74 for k. -2 Solve 4j = 3w - 7, 0j - 2j - 519w + 515w + 2 = 0 for j. -1 Solve -2t - 10 = -5h, -20t + 21t + 4h - 21 = 0 for t. 5 Solve 10 = 3w + 469m - 471m, -w = 2m - 6 for w. 4 Solve -2m = q + 13, 3q + 3m + 170 - 149 = 0 for q. -1 Solve 0 = s - 1364a + 1368a + 12, -42s + 2a + 6 = 0 for s. 0 Solve -p = -257l + 262l + 3, 4p - 7 = -l for p. 2 Solve -52 = -f + 4w - 45, 5w - 4 = -3f for f. 3 Solve -j - 5l - 633 + 611 = 0, j + l + 10 = 0 for j. -7 Solve 21h = -3y + 24h - 24, 3y - h + 16 = 0 for y. -4 Solve 0 = 6k + j, 109j = 3k - 8k + 105j for k. 0 Solve 0 = k - 3h + 1011 - 1022, -4h - 18 = -3k for k. 2 Solve -3g - 13 = -2f, -16g + 21g + 3f = 10 for g. -1 Solve -7v - 20 = -o, 4v + 9o - 4o + 6 = -11 for v. -3 Solve -4a - 9s + 96 = 0, -4s + 11 - 55 = -4a for a. 15 Solve -3j - 17 = 2w, -126j - 8w - 41 = -123j for j. -3 Solve 13y + 28 = -3l, -32 = -2y + 6l - 11l for y. -4 Solve -7l - 3k = -106, -9l + 2k + 36 = -7l for l. 16 Solve -3 = 5g + 3o, -2g + 4 = -9o + 5o for g. 0 Solve -154h + 155h + 2r = 0, -3h + 5r = 22 for h. -4 Solve -3x - 46 = -d - 27, 5d + 24 = -2x for x. -7 Solve -3s + 486k = 489k - 6, -s + k = 6 for s. -2 Solve -210s + 5a - 35 = -213s, 4s - 28 = -2a for s. 5 Solve -41s - 3y - 12 = -45s, -2s + 2y + 8 = 0 for s. 0 Solve -3c = v + 7 - 5, v - 2c + 2 = 0 for v. -2 Solve 4c + 4t - 48 = 0, 308 = -2c + 15t + 60 for c. -4 Solve 2o - 93s = -88s + 1, 0 = o - 4s - 2 for o. -2 Solve 0 = -4g + 2n - 678 + 648, 3n = g + 20 for g. -5 Solve 1 = 1673v - 1674v + 2n, 0 = -3v - 5n + 19 for v. 3 Solve 0p - 5p = 12h + 105, 2h + 16 + 6 = 2 for p. 3 Solve 3h = 4v + 6, h - 76v + 80v - 18 = 0 for h. 6 Solve 0 = -2l - 2, -5l = 5f + 1864 - 1879 for f. 4 Solve -5q + 4b - 16 + 17 - 35 = 0, 4b = -12q for q. -2 Solve 5c = -4b - 28, 27b - 24b = -21 for c. 0 Solve -15 = o + 4d, 0 = 5o - d - 344 + 335 for o. 1 Solve 0 = 5y + 66z - 69z, 0 = 3y + z + 14 for y. -3 Solve -150w + 144w = 4j - 4, 2w = 3j + 10 for j. -2 Solve -2 = 5o - 2p, 209o - 200o + 5p + 38 = 0 for o. -2 Solve 4i - 5y = -8, -99y + 204y + 10 = -5i + 103y for i. -2 Solve -1 = -2q + 5i, -443 = -3q - i - 450 for q. -2 Solve -a - 5h = 10, 3a - 4h - 30 = h for a. 5 Solve 3m = -25f + 27f + 10, 4m = 0 for f. -5 Solve -5f - 5s = -118 + 118, 0 = 3s for f. 0 Solve 0 = 2i - 29611j + 29609j - 30, 5i = -2j - 9 for i. 3 Solve -j + 4k + 16 = k, -24j + 4j + 96 = -4k for j. 4 Solve -5s + 11s + x + 33 = 0, -3 = x for s. -5 Solve 0 = 2m - j + 15, 41m - 42m + j = 14 for m. -1 Solve -28i = 5w - 44, -i = 4w + 24 + 5 for w. -8 Solve 0 = -2f - 176u + 179u + 55, 12f + 2u + 50 = 0 for f. -1 Solve 0 = 5p - 5, 0 = 4o - p - 20 + 9 for o. 3 Solve 0 = -32t + 28t + 5q + 33, 0 = -t - q + 15 for t. 12 Solve -2q + 5k = -93, -487k + 46 = 3q - 489k for q. 4 Solve -3c = -4u + 21, c - 56c - 196 + 40 = 3u for c. -3 Solve -273m + 272m + 3u = -12, -2u + 9 = 5m for m. 3 Solve -2o - 151 = -4i - 127, 5i = -3o + 8 for o. -4 Solve 5k - 33 = 6q, q - 153k + 152k = -5 for q. -8 Solve 4n = -5q + 28, 27q - 22q = 9n + 2 for q. 4 Solve 4j + 101 = 4n + 85, -5j - 20 = 5n for n. 0 Solve -6v = -2a - 42, -147a - 31 = -152a - 2v for a. 3 Solve 22i - 24i - h = 12, -h - 4 = 0 for i. -4 Solve 14d = c - 86, -5d + 3c - 30 = -d for d. -6 Solve 4t - 12 = 5l, -886 = 5t - l - 901 for t. 3 Solve -449k + 3b + 31 = -447k, 5k = -2b + 125 for k. 23 Solve -48 = -3u + 3y - 81, 4u + 23 = -3y for u. -8 Solve -2i = -i - 4n + 5, 78n + 2 = 79n for i. 3 Solve 50g - 53g - 5p + 7 = 0, 4g + p - 15 = 0 for g. 4 Solve -4b - 3u = 0, 707b + 4u - 37 = 714b - 0u for b. -3 Solve 215 = -f + 93g + 683, f - 4g - 26 = -f for f. 3 Solve -3o + 10 = 241f - 240f, 11f = -5o + 54 for f. 4 Solve 4n - 34 = -2w, -2w - 7n = -4w - 65 for w. -1 Solve -3t - 686 = -674, -a - 16 = 3a + 3t for a. -1 Solve 1985y - 7 = 1988y - 2d, -5y + 5d - 15 = 0 for y. -1 Solve -h - 4 = -c, 47c - 52c = -h for c. -1 Solve 4113g = 4118g + w + 12, 0 = -5g + 5w for g. -2 Solve i - 2 + 1 = -4j, -1701j - 2 = -2i - 1692j for i. 1 Solve -z + 203 = -2i + 231, -70 = -5i - 4z for i. 14 Solve 285n = 5x + 290n + 10, 2n + 13 = x for x. 3 Solve 0 = 4h + 2x - 756 + 710, -4x + 80 = 5h for h. 4 Solve 0 = 3a + 21, 29x - 2a - 7 = 34x + 2 for x. 1 Solve 4 = -9s - 4q - 27, 3q = 2s + 3 for s. -3 Solve -5 = -x - v, 82v - 83v = 7x + 7 for x. -2 Solve 0 = 4i + 2o - 190 + 154, 3o + 36 = 3i for i. 10 Solve 21 = -5a - 2j, -56a = -57a + 2j - 9 for a. -5 Solve 5x + 6v = 17, 82v - 87v + 15 = 5x for x. 1 Solve 0 = -b + 3b - 2g, 12 = b + 5g for b. 2 Solve -5g - h - 21 = 0, 3h - 12306 = -4g - 12325 for g. -4 Solve 3c - 1 = -2z, -3 = -38399z + 38404z + 2c for z. -1 Solve 0 = 3n + 5x + 1045 - 1016, 4x + 1 = 5n for n. -3 Solve -3z = -2u + 9, -4z = 2u + 50 - 38 for z. -3 Solve 13g + 10 = -5s - 15g + 31g, 4s - 6g + 8 = 0 for s. -2 Solve -5z + 2406o - 2410o = -5, 5o = z + 28 for z. -3 Solve -5q + 45 = 4i + 61, 8q - 4i = 16 for q. 0 Solve -45 = 3a - 6y, 377a - 48 = 373a - 4y for a. 3 Solve 93 = -4w + 2a + 141, 0 = 36w + a + 100 for w. -2 Solve 5d - 17 = 4o, -2d + 39o - 41o = 4 for d. 1 Solve 0 = -2a - 4v, 9a + v = 11a for a. 0 Solve 53 = -5x - 2t + 37, -2x + 2t = 12 for x. -4 Solve -4r = 3o + 11, 222r - 12 = 8o + 224r for o. -1 Solve 22b + 16 = 25b - 4y, 16 = 5b + 4y for b. 4 Solve -4d - 3u = 11, 3d + 455u + 11 = 450u for d. -2 Solve 330u = 5s + 333u + 106, -2s + u = 49 for s. -23 Solve 1848g - 1854g - 2j - 8 = 0, 3g = j - 8 for g. -2 Solve 0 = n - 3q - 25, -4428 + 4465 = -3n - 5q for n. 1 Solve -o - 3y = -59 + 49, 3y + 90 = 24o for o. 4 Solve -28 = 5t + r, -t = 94r - 107r - 34 for t. -5 Solve 5a + 31p = 36p, -3a + 2p + 0p + 1 = 0 for a. 1 Solve 0 = 3c + 4p + 13, 3c = 4p + 18 - 23 for c. -3 Solve -2r = y + 9, -5y + 3169 - 3174 = 0 for r. -4 Solve 0 = 4k + 28 - 20, 36 = -4i - 22k for i. 2 Solve 0 = -3f + 1793 - 1790, t - f = 0 for t. 1 Solve 6 = -4a - 3w, 0 = -55a + 58a + 24w - 39 for a. -3 Solve 4l + 8 = 4z, -26 = 7z + 2l - 4 for z. -2 Solve -4t = -2i - 4, -4i - t - 11 + 30 = 0 for i. 4 Solve -20q + 6f - 23 = 3f + 100, q + 4f + 2 = 0 for q. -6 Solve -2c - 12 = 4m, -136m = -137m + 4c + 6 for m. -2 Solve 15s + 5 = 14s + 2r, -44r = s - 41 for s. -3 Solve 0 = 4d - 5g + 8, 270d - 8 = 274d - 2g for d. -2 Solve 3o = -5u - 66, 1652u = 1650u + 4o - 16 for u. -12 Solve 4v = 2q - 26, 2q + 0v + 4v = -14 for q. 3 Solve 9 = 5d - 2g, 4d + 5g - 17 + 23 = 0 for d. 1 Solve 20o - 18o + 3i - 12 = 0, -2o + 4i - 16 = 0 for o. 0 Solve 2p - 3b + 2 = 0, 359b = 2p + 364b + 2 for p. -1 Solve -36w + 41w = b - 33, 0 = 2b - 4w - 30 for b. 3 Solve 0 = 4w - n - 17, n + 22 = 29w - 24w for w. 5 Solve -1623 = -3p - 9w - 1563, -4p - 5w + 31 = 0 for p. -1 Solve 2r = i - 20, 6296i - 6294i + 5r = 13 for i. 14 Solve -2h = 8, -2h - 37 = -5u - 49 for u. -4 Solve 34p + t + 63 = 0, 3p - 2p + 2t + 0t = -4p for p. -2 Solve 0 = 2w + 3z, -3w + z + 5 - 16 = 0 for w.	{ "pile_set_name": "DM Mathematics" }
1/42 1/4 What is -2(-2)/(-12)0/3? 0 Calculate (-2)/(-1)-1(-24)/24. 2 Calculate 49/14((-32)/28)/(-4). 1 What is 174/1743/((-42)/4)? -2/7 Calculate ((-6)/(-7))/((-540)/(-280)). 4/9 Evaluate 39/11715/(-1). -5 What is 14/(-3)(-19)/((-418)/(-33))? 7 610/(-9)(-33)/55 4 What is the value of (9/15)/(-3(-1)/(-15))? -3 Calculate (3/(-14))/((-9)/4). 2/21 6/(810/(-10)) -3/4 2/244/1 1/3 Calculate 8/(-12)(-18)/(-3). -4 What is the value of 135/(-165)2/6? -3/11 (2/(-2))/(68/17) -1/4 What is the value of 2/(1(-1)/(-2))? 4 Evaluate ((-3)/(15/5))/(-3). 1/3 Evaluate (-1)/(((-4)/6)/((-40)/12)). -5 What is (3/54)/((-1)/(-3))? 1/6 Calculate ((-2)/(-3))/((165/(-15))/66). -4 Evaluate (15/3)/(5/5-1). -5 What is (-1)/(6/(-9))28/(-14)? -3 Evaluate (10/(-6))/((-165)/132). 4/3 Evaluate (1/33)/((-1)/(-3)). 3 Calculate (2/(-5))/(14(-45)/150). 2/21 Evaluate 33/5114/77. 2/17 Evaluate ((-32)/654/36)/(-1). 8 What is (-30)/(-55)(-22)/(-3)? 4 Calculate ((-19)/((-1140)/(-36)))/(13). -1/5 ((12/18)/(-2))/(-5)9 3/5 What is the value of (16830/(-44))/512/40? -3/8 What is the value of (255/459)/((-10)/12)? -2/3 What is 1/10(-1)/(8/(-20))? 1/4 What is ((-15)/45)/(12/(-8))? 2/9 What is the value of (-4)/2(-9)/(-18)-5? 5 -2(12/10)/(56/(-210)) 9 What is (-244)/4272/8? -1/7 What is (168/(-12))/((-4)/2)? 7 What is ((-96)/(24/(-4)))/(-2)? -8 Evaluate 1/(-5)-6(-35)/(-14). 3 What is the value of (-1)/3(-33)/22? 1/2 Evaluate (6/(-4))/((-69)/46). 1 Calculate (-80)/(-30)(-3)/2. -4 Calculate (6/3)/(((-24)/6)/(-8)). 4 Evaluate (-2)/((-2)/((-6)/(-17))-3). -2/17 What is the value of (-66)/(-44)1/(-3)? -1/2 Calculate 108/90-31/(-27). 2/15 Calculate ((-2)/2)/(-2)6. 3 ((-3)/6)/((-1)/8) 4 Calculate (-132)/22(-5)/(-5). -6 Evaluate 102/28-7. -5 Evaluate 3/(-1)7/(-7)1. 3 28/496-2 -2/31 Evaluate ((-2)/(-8))/(543/362). 1/6 What is (20/120)/((-2)/(-6))? 1/2 Calculate (11/((-132)/(-8)))/((-4)/3). -1/2 Evaluate 16/206/(-108)10. -4/9 Evaluate ((-2)/3)/(17/(102/24)). -1/6 Evaluate (-64)/192(-2)/(-3). -2/9 Evaluate (2/(-12))/1372/(-372). 1/6 Calculate (6(-7)/21)/(-1). 2 What is (-40)/(-180)18/1? 4 Evaluate (-40)/366/(-10). 2/3 What is the value of ((-7)/(84/(-8)))/2? 1/3 Evaluate (75/(-630))/(20/(-16)). 2/21 What is (-9)/((-189)/(-56))12/4? -8 What is -42/(6/3)? -4 What is (61/(-8))/(3/(-2))? 1/2 Evaluate 10/8-2(-7)/(-105). -1/6 What is the value of -81/(-24)15/1? 5 What is 3/2(-4)/(-4)-2? -3 Calculate ((-198)/462)/(12/14). -1/2 What is the value of (-6)/208-48/(-6)? -2/13 Calculate (300/(-1100))/((-6)/(-4)). -2/11 What is the value of (0/6)/(6/9-6)? 0 What is -5(-9)/(-90)2/(-9)? 1/9 Calculate (6/90)/((54/(-20))/9). -2/9 ((-7)/((-28)/12))/((-21)/49) -7 (6/(-4))/(60/16) -2/5 Calculate 3/((-12)/4)-31. 3 What is 4(-6)/(-252)6? 4/7 Calculate (-6)/(-9)160/32. 5/4 What is 201/67(-1)/11? -3 (3/6)/(12/(-8))-1 1/3 What is the value of 2/5(-102)/(-2)? 4 Evaluate 3/2(-3)/(36/2). -1/4 Evaluate 3/(-18)(-15)/(-10)-1. 1/4 What is the value of ((-42)/(-7))/(-1)(-1)/2? 3 (-28)/(-8)(-6)/(-7) 3 What is (-8)/(-20)(-40)/(-32)? 1/2 Evaluate (-9)/3(-2)/(-14)-1. 3/7 What is (2/(-5))/(4/((-20)/(-1)))? -2 Evaluate 40/4826/65. 1/3 Calculate (56/(-84))/(2/6). -2 What is the value of (-14)/((-588)/(-6))0/(-2)? 0 What is (0/3)/((-3)/(-3))? 0 Evaluate (-1)/(((-2)/30)/(12/36)). 5 What is the value of 8/2(-7)/(-84)-4? -4/3 What is 6/(-36)418/(-4)? 3 What is 1/2-4(-3)/2? 3 (3/9)/(1/(-6)) -2 What is (14/49)/(12/14)? 1/3 Calculate 50/(-45)(-1)/5. 2/9 Calculate (-18)/(-12)(-1)/(9/5). -5/6 25/((-20)/(-8)) 4 ((-1)/(-3)-1)/(1/9) -3 What is (-52)/(-13)(2/(-2))/(-1)? 4 (-9)/6(-8)/(-24) -1/2 What is the value of ((-15)/(-3))/(-10)0/(-12)? 0 (-5)/(-2)64/(-80) -2 What is -10(-20)/1252/8? 2/5 (4/(88/(-11)))/(2/(-4)) 1 What is -33-2(-3)/(-18)? 3 What is the value of (-20)/(-5)((-2)/5)/(-2)? 4/5 Calculate (-4)/60(-9)/(-6). -1/10 75/150(-3)/(6/(-20)) 5 8/17641 2/11 What is the value of 1(-3)/(-1)682/(-19437)? -2/19 What is ((-4)/6)/(3/9)? -2 What is (-5)/1(-3)/(-5)? -3 What is 118/(-590)1(-5)/(-2)? -1/2 0/(((-8)/4)/42) 0 What is 0/229/87? 0 1/(12/((-288)/(-372))) 2/31 Evaluate (-12)/(-20)10/42. 3 What is (2/1)/((-1573)/(-143))? 2/11 What is (20(-9)/(-24))/(1-6)? -5/4 What is ((-2)/(-5))/((-102)/(-153))? 3/5 What is 5/((-3)/(-2)34/(-51))? -5 40/24((-54)/(-4))/9 5/2 What is (-23/8)/(108/(-24))? 1/6 Calculate (-7)/140-6-2. -3/5 (-3)/66/27 -1/9 Evaluate 1/(((-24)/18)/(-2)). 3/2 What is (787/6296)/(((-18)/32)/(-3))? 2/3 Evaluate (5/15)/(-2(-5)/(-10)). -1/3 What is (9/(-6))/((-6)/161)? 4 Calculate (18/(-21))/((-12)/56). 4 What is ((-2)/(-4))/(64/640)? 5 Evaluate (9-4)/(-2)(-5)/15. -6 Evaluate ((105/(-9))/7)/((-10)/2). 1/3 What is (-9)/(72/40)(-2)/8? 5/4 Calculate 8312/(-12). -4 632/395(-2)/8 -2/5 Calculate 10/((-6)/4104/(-78)). 5 Evaluate (10/(-30))/(((-55)/(-6))/5). -2/11 What is ((0(-6)/(-24))/(-2))/(-3)? 0 What is 5/(-20)(-68)/51? 1/3 Evaluate ((-6)/8-2)/(36/48). 2 Calculate ((-6)/(-8))/(2/(72/162)). 1/6 What is the value of (-2)/((-13)/((-520)/16))? -5 Evaluate (-8(-1)/(-2))/(-2). 2 (-1)/((-3)/((-24)/20)) -2/5 What is ((-16)/(-10))/((-12)/30)? -4 ((18/(-56))/(-9))/(4/16) 1/7 What is (87/28)/(3/(-6))? -4 What is (1/1)/(6/(-24))? -4 (19/57)/(1/(-3)) -1 Calculate ((42/(-7))/18)/((-1)/15). 5 (1/3)/(27/(-54)) -2/3 2/2(-3)/18 -1/6 What is the value of 2/((-1)/141-7)? 4 What is the value of (28/(-126))/(3/27)? -2 145/210241 8 What is 42/(-6)(-13)/78? 7/6 Calculate ((-5)/40)/((-2)/(2-1)). -1/8 Calculate (-4(-5)/(-660))/((-1)/6). 2/11 What is the value of (12/16)/((-2)/(-16))? 6 (-1)/(-4)(-8)/(-4) 1/2 What is the value of (29/(-435))/(8/(-10))? 1/12 (((-8)/110)/2)/(2/(-10)) 2/11 Evaluate -36/36-8. 4 What is (19/(-24))/(6/(-8))? 1/2 Evaluate 32/(-1)1/(-2). 3 (3/(-4))/(5/20) -3 Evaluate (4/(-84))/((-90)/(-315)). -1/6 What is the value of ((-7)/14)/(2/20)? -5 Calculate 2/(68/171/2). 1 Calculate ((1/(-1))/((-2)/10))/(-1). -5 Evaluate (-3(-6)/(-36))/(7/7). -1/2 What is (-651)/316/(-147)? 6/7 What is the value of ((4/1)/(-8)2)/2? -1/2 What is ((-27)/(90/(-10)))/2? 3/2 Calculate ((-45)/(-60))/(20/16). 3/5 Calculate (7/7)/(((-30)/(-25))/6). 5 Calculate 9/3(-1)/(-1). 3 Calculate ((65/(-150))/(-13))/((-3)/(-12)). 2/15 What is the value of 27/36(-36)/405? -1/15 Evaluate 6/(-99)(-9)/(-3). -2/11 Evaluate ((-1)/(-9))/(13/(-195)). -5/3 Calculate ((-70)/50)/((-12)/20). 7/3 What is the value of (-10)/8((-112)/21)/(-4)? -5/3 Calculate (-1)/(-5)22/((-528)/(-300)). 5/2 What is the value of 34/(-51)2/4-3? 1 What is ((-52)/910)/((-3)/(-15))? -2/7 (-19)/(38/(-5))(-8)/110 -2/11 What is the value of (-6)/(84/7)2/2? -1/2 Calculate (-5)/(7/14-2). 5 What is the value of (-25)/(-5)1/1? 5 Evaluate 5(-1)/(15/12). -4 Evaluate (-4)/(-2)16/(-240). -2/15 What is (-306)/459(-27)/(-2)? -9 What is (-16)/40(-2)/(16/(-15))? -3/4 Evaluate 13/39(-6)/(-3)3. 2 Evaluate 12/43/(-45). -1/5 What is (-45)/(-35)70/15? 6 4/(((-2)/(-10))/((-36)/90)) -8 Calculate 2/(18/(-9)-11). 1 1/(3/3)-1-2 2 Evaluate (-1)/(64/48). -2 Evaluate (-3)/6(-2)/(-5). -1/5 Evaluate (-97/(-273))/(27/(-18)). -2/13 Evaluate (-3)/((-162)/(-15))111/37. -5/6 (-5)/((-60)/(-4))15 -5 What is the value of 105/(-15)2/4-2? 7 What is the value of ((-6)/(-8))/(2/8)? 3 ((-4)/(-12))/((-5)/3) -1/5 Evaluate ((3/3)/1)/((-24)/6). -1/4 Calculate 24/(-16)-10. 5 What is the value of ((-168)/2464)/((-3)/8)? 2/11 Calculate ((-116)/203)/(10/7). -2/5 What is the value of ((-1)/11)/((48/6)/16)? -2/11 Calculate 6(-6)/(-27)3. 4 What is the value of (10/6)/(32/(-96))? -5 (6/(-15))/((-72)/(-270)) -3/2 What is the value of (-7)/(-63)9-1? -1 Calculate 2/(-9)(-9)/(-3). -2/3 What is the value of (15/(-10))/(-9(-5)/120)? -4 6/(-42)(-21)/7 3/7 Calculate ((6/3)/(-8)-8)/(-3). -2/3 Evaluate 7/((-30)/(-40)(-28)/(-6)). 2 What is the value of 1/520/22? 2/11 What is (3/15)/(4/(-5))? -1/4 Calculate 3/(-7)17/(510/(-20)). 2/7 What is the value of (((-6)/10)/(-3))/(4/60)? 3 What is the value of (24/(-40))/(102/(-20))? 2/17 What is the value of (15/(-16))/34? -5/4 What is the value of ((-8)/68)/2(-2)/1? 2/17 Evaluate (-855)/228*((-1)/1)/(-5). -3/4 Evaluate ((-9)/((-126)/(-8)))/1. -4/7 Ca	{ "pile_set_name": "DM Mathematics" }
v - v) + 0v - 3v + 4v + (10v - 21 + 21)(4 - 4 - 2))((-6 + 4 + 1)(-3v + 4v - 2v) - 3v + 4v - 3v). 19v*2 Expand (-3 + 3 + 2)(x - 2x + 3x) + (2 - 5 + 2)(-4x + 0x + 3x). 5x Expand (2k - 2k - 6k)(-5k*2 + 0k*2 - 2k*2) - 9k + 9k + 3k*3 + (-2k*2 + 7k*2 - 3k*2)(k + k - 3k). 43k*3 Expand (-37 - 8 + 91)(2 + 1 - 5)((2g - 2g - g)(g - 2g + 3g) - 4g2 + 4g2 - g2 + 0g2 + 3g*2 - 4g*2). 368g*2 Expand (0h*3 + 5h*3 - 3h*3)(2h2 - 1 + 1) + 4h*5 + 2h*5 - 3h*5 - 6h + 6h + 2h*5. 9h*5 Expand (x - x + 2x)(0x + x + 0x) - 41 + 5 - 3x2 - 6. -x2 - 42 Expand (-4a + 3a - 2a)(2 - 22 - 94). 342a Expand s2 + s2 - 3s*2 + (-3s - s + 3s)(3 + s - 3) + 84s2 + 299 - 299 + 0s*2 - 2s2 - s2. 79s2 Expand (c - 5c - 3c)(c - 3c + 5c) + (-2c + 3c + c)(-4c - 3c + 5c). -25c2 Expand 0l - l*5 + 0l + (-24l - 12l + 24l)(l4 - l3 + l*3) - 5l*2 + 5l*2 + 4l*5. -9l*5 Expand (3f - 5f + 3f)(2f*3 - 351f*2 + 0f*3 + 337f*2). 2f*4 - 14f*3 Expand (-52 + 40 + 30)(2g2 - 96 + g - g). 36g*2 - 1728 Expand (-y - 4y + 6y)(-16y + 48y + 61y)(0y + 0y + y). 93y3 Expand (-5q + q*3 + 5q)(-1 + 0 + 0)(-3 + 1 + 4)(q + q - 5q + 1 - q - 1 + (-3 - 2q + 3)(1 - 1 - 1) - 4 - 2q + 4 + 3 - 3 - 4q). 16q4 Expand (-2q - 3q + 2q + q - 3q + 3q + (2q - 4q + q)(2 + 2 - 2))(-1 - 2 + 4)(-8 + 0 - 7). 60q Expand (-11y - 9y + 16y + 3)(-2y + 0y - 14y). 64y*2 - 48y Expand ((-2d + 2 - 2)(0 - 3 + 0) - 2 + 2 - 2d + 0 - 2d + 0)(-2d*2 + 2d2 + d2). 2d3 Expand (1 + 19 + 18)(-2x5 + 5x*5 - 2x*5 + (-2x + 4 - 4)(2 - 2 - 2x*4)). 190x*5 Expand (c + 0c + 0c)(0 + 0 - 2) + (937 - 937 - 62c)(0 + 0 + 1) + 1 + c + 2c - 5c. -66c + 1 Expand (7 + 27 - 8)(6y - 11y + 3y + 3). -52y + 78 Expand (0z - 2z + 0z)(-z - 2z + 4z)(2z*3 - 2z*3 + 3z*3). -6z*5 Expand (-3 + 3 + 1)(3 - 3 + 2a) - 218 - 754a + 218. -752a Expand 4h*4 - 2h4 + h2 - h*4 + (-2 + 0 - 1)(-2 + 4h3 + 2)(-1 + 1 + h). -11h4 + h2 Expand (1221804b*2 + 13b - 1221804b2 - 23b*3)(0b - b - b). 46b*4 - 26b*2 Expand (34 - 3k + 30 - 63)(-k3 - 1 + 1 + 2k*3 + 5 - 5 + (-k + 0k + 2k)(-k + k + k2) - k3 - k*3 + 4k*3). -12k*4 + 4k*3 Expand (0b + 0b - 3b + 5b - 3b - 4b - 1 + 1 - b + 4 + 2b - 4 + (-1 + 2b + 1)(-2 + 0 + 3) - 2b + 0 + 0 + 0 + 0 - 3b)(b - b + 4b*2). -28b*3 Expand (0 + 6 - 1)(3t + t - 2t - 4t + 0t + 2t + (-2t + t + 2t)(1 - 1 - 1) + 2t + 0t + t + t - 9t + 2t). -20t Expand (0 + 0 - 2g*2)(2g + 1 - 1) + 0g + g*3 + 0g - 3g3 + 6g*3 - 5g3 + g3 + 0g3 - 4g*3 - 16g*3 - 27g*2 + 27g*2. -24g3 Expand -h5 + 3h5 + 0h*5 + (4h + 2h - 4h)(6h - 6h - 12h4) - h5 + 4h5 + 0h*5 - 2h*5 + 0h*4 + 0h*4. -21h*5 Expand (-1 + 4 - 1)(-1805c + 30 - 2939c - 22 - 8). -9488c Expand q2 + 0 + 0 + q2 + 0 + 0 + (-6q*2 + 3q2 + q2)(-4 + 1 + 2) + 347q*2 - 391 + 391. 351q*2 Expand (-9f*2 + 154f*2 - 6f*2 + 43f*2)(-5f2 + 6f*3 + 5f*2). 1092f*5 Expand (-l + 3l - 3l)(5l3 + 3l3 - l3) - 11l3 - 6l*4 + 11l*3. -13l*4 Expand (-54 - q + 30 + 31)(4 + 6 - 2). -8q + 56 Expand (-31 - 6 + 227o*2 - 224o*2)(-3 + 3 - o). -3o3 + 37o Expand 6y2 - 2y*2 - 2y*2 + (0 - 3y + 0)(-2y + 2y + 2y) - y + y + y*2 + 946y - 946y - 96y*2. -99y*2 Expand (2m*2 - 2m*2 - 2m*2)(-467 + 258 + 255 + 5m). -10m*3 - 92m*2 Expand -4i*2 - 402 - i + 402 + (2i + i - 5i)(3i - 2i + i) - i*2 - 2i + 2i. -9i*2 - i Expand (44 - 6o - 44)(-o - 3o + 6o)(-4 + 2o + 4)(3o - 2o + 2o). -72o4 Expand (-d4 - d3 + d3)(0 + d + 0) - 5d*5 + 2d5 + d5 + 20d - 10d*5 + 2d + 1 - 24d. -13d*5 - 2d + 1 Expand (80 + 41 + 76)(-3r + 2r + 3r). 394r Expand (-4 + 4 + 2m)(86m*3 + 146m*2 - 146m*2 + (-1 + 2m*3 + 1)(-3 + 6 - 4)). 168m4 Expand (-93x*3 - 41 + 2 + 96x*3)(x - 3x - 2x)(0x - 3x + 2x). 12x5 - 156x*2 Expand (2c*2 - 6c*2 - 3c*2)(3 - 6c + 4c + 5). 14c3 - 56c*2 Expand (-32m*3 + 2m*3 - 2m*3)(-3m + 1 - m - 2)(4 + 0 - 2)(-2m - 3m + 3m). -512m5 - 128m*4 Expand (-2q - 2 + 2)(-4q + 2q + q) - 6q + 5q + 54q*2 - 35q*2. 21q*2 - q Expand (12 + 4 + 7)(3 + 0 - 6)(-x + 0x - x)(2x*4 - 2x*4 + 2x*4). 276x*5 Expand (4 - 3 + 0)(3 - 2f2 - 3)(25 - 26f + 33 - 55). 52f*3 - 6f*2 Expand -33r2 + r4 + r*4 + 15r*2 - 5r4 - r4 + 4r4 - 3r*4 - 3r*4 + 2r4 + (r + r4 - r)(-4 + 1 + 1) + 4r + r*4 - 4r. -5r4 - 18r*2 Expand (-4 - 1 + 1)(-78x - 1 + 84x - 3). -24x + 16 Expand (0 + 0 - 2)(2 + 1 - 5)(-4b - 2b + 2b + 4). -16b + 16 Expand -55x - 24x2 + 55x + (2x + 0x + 0x)(2x + 3x - 7x). -28x*2 Expand (-48 - 37 + 24)(-5j + 3 + 2j*2 + 5j). -122j2 - 183 Expand ((2h + 0h + 0h)(-4 + 0 + 2) + 3h + 3h - 4h)(9h + 17 - 17)(h3 + 2h*3 - 6h*3). 54h*5 Expand (10a + 4158 - 4158)(0 - 2a*4 + 0). -20a5 Expand d3 + 3 - 3 + (0d + 0d + 2d)(5d2 - 2d*2 - 2d2) + d3 - 2d2 + 2d*2 + 2d3 + d3 - 2d3 + (-d + 0d - 3d)(31d - 11d*2 - 31d). 49d3 Expand (4g - 3g + 4g)(73 - 129 + 73 + 79). 480g Expand (-2n + 2n + 2n)(n*2 - 6n*2 + 2n*2 + (-2 + 2 - 2n)(0n + 3n - n) + (-103n - 99n + 195n)(1 - 1 + 2n)). -42n3 Expand v3 - v + 2v5 - v3 + (v2 - v4 - v*2)(0v + 2v + 0v) + 2601v - 52v5 - 2601v. -52v5 - v Expand (4 - 4c - 4)(-20 - 33 + 14). 156c Expand 1129 + 19p5 - 2241 + 1078 + (-p4 + 3p*4 - 3p*4)(2p + 3 - 3). 17p*5 - 34 Expand (0n2 + n2 + n*2)(36 - 13n + 28 - 64). -26n*3 Expand (115c - c*2 - 6 + 2c*3 - 115c)(-6c*2 + 3c*2 - 4c*2)(0 + 2 - 4). 28c5 - 14c*4 - 84c*2 Expand (2i + i + 4i)(0i + 0i + i)(i - 3i + 0i). -14i*3 Expand (-2x + 2x - 2x + (-4 + 4 - 2x)(-2 + 3 - 2) + 3x + 3x - 5x - 4x + 2x + 0x + 0x - 4x - 4x)(3 - 1 + 0). -18x Expand (10s - 7s - 14s)(2 + 1 + 1)(s + s - 4s). 88s*2 Expand (-5w*3 + 6w*2 - 6w*2)(2 - 7 + 0) - 8w3 - 19w*3 + 40w*3. 38w3 Expand (-1 + 0 + 0 - z3)(747 + 314z*2 - 747). -314z*5 - 314z*2 Expand (-20l - 118 + 118 + 1 - 1 - 2l + (2l - 2l - 2l)(1 - 2 - 1) - 4l + l + 2l + 2l - l - 3l + 1 - 1 - 2l)(-2l*4 - 3l*4 + 3l*4). 46l5 Expand -1 - a3 + 1 + 330a2 + 338a*2 + 3a*3 - 678a2 + (a2 + 2a2 - 2a*2)(-a + a + a) - 1 + 1 + a*3 - 3a3 - a3 + 2a3. 2a*3 - 10a*2 Expand 20d - 5d - 2 - 2d + 6 + 7d - 6 + (-5d + 2d + 2d)(5 + 3 - 6). 18d - 2 Expand (2 + 1 - 1 + (3 - 4 + 3)(-1 + 2 + 0) + 4 - 4 - 2 - 4 + 0 + 3 - 1 - 5 + 5 - 13 + 5 - 24)(-2 + 2 - 7j). 224j Expand (23 + 45 - 37)((2m + 1 - 1)(-2m - m + 5m) + 2m*2 - 3m*2 + 4m*2 + 0m + 0m - 2m*2). 155m*2 Expand -25u - 14u - 1 + 4u + 3u - 3u - 2u + (2 - 2 - 2u)(1 + 1 + 0) + 0u - u - u - u + 8u - 2u. -38u - 1 Expand ((-4 - 1 + 3)(-d + 2d - 2d) - 10d - 8d + 4d)(-2d + 0d + 3d). -12d*2 Expand (5j - 5j - 5j*2)(-2j + 0 + 0)(14 + 26 - 8)(-1 + 4 - 2)(-j + 0 + 0). -320j4 Expand (20z*2 - 4z2 + z2)(92z - 92z - 19z*2). -323z*4 Expand (5y + 12y - 14y)(7y - 7y + 7y)(-2 - y + 2). -21y*3 Expand (-528d*2 + 0 + 1 + 522d*2)(2d3 + 2d*3 - 7d*3). 18d*5 - 3d*3 Expand (6 - 3 + 0)(-27r - 16r + 2r)(-4 - 1 + 4)(0r - r - 8r). -1107r*2 Expand (5 - 1 + 2)(-66b5 + 80b*5 + 128b*5). 852b*5 Expand (b - 2 + 2)(-8 + 18 - 37) - 9b - 14 + 15b - 5b. -26b - 14 Expand -156d + 197 - 102 - 95 + (6 - 1 - 4)(2d - 2 + 2). -154d Expand (0q + 6q - 3q)(2q - 4q - 2q) - 1 + 1 + q2 + 16 - 8q*2 + 0 + 11q*2. -8q2 + 16 Expand (i2 - i*2 + 2i*4)(-4i + 5i - 4i)(42 - 4 + 3) + 2i5 - i5 + i5. -244i*5 Expand (19 + 14 - 14)(-1 + 1 - 2)(-6 + 2 + 2)(t*2 + 15t - 15t). 76t*2 Expand (1 + 0 - 5)(-d - d + 0d) + 0d - d - d + (3 - 2 - 3)(0d + 2d + 0d) + d - 3 + 3. 3d Expand (-10f + 13f - f2 + 3f)(-f2 + 7f*2 + 2f*2). -8f*4 + 48f*3 Expand (6g + 5 - 5)*(-53 +	{ "pile_set_name": "DM Mathematics" }
Evaluate 7 + 0 - (64 + -61) - -4. 8 Evaluate -3 + (3 - 0 - 3). -3 What is the value of -11 + 2 + (-75 - -73)? -11 What is -2 + 9 + (12 - 14)? 5 What is the value of (-3 - -4) + (-6 - -11) + -3? 3 (6 - 1) + (0 - 8) -3 What is the value of -1 + -6 - (-11 - -8)? -4 1 + -7 + (-4 - (-2 - 4)) -4 What is -2 - 4 - (-6 + 10 + -6)? -4 Evaluate -3 + (-2 - (6 + (0 - 0))). -11 What is the value of 1 + (-4 - -5) + 3? 5 Evaluate -7 - (1 + -7 + (1 - -1)). -3 Evaluate (10 - 12) + (-3 - -1). -4 16 + 7 + -9 - 12 2 Calculate (2 + 3 - 5) + 2 + 1. 3 Calculate 59 - 64 - (3 - -1). -9 -8 + (10 - 5) - (-2 + 2) -3 (-8 - -11) + -1 + -4 -2 0 + (-1 - -2) + -118 + 122 5 97 + -91 - (-2 - (-1 + -8)) -1 What is the value of -3 + 0 + 0 - 2? -5 Calculate 12 - (-9 - -13) - 4. 4 -6 + 10 - 7 - (-3 + 4) -4 What is the value of -2 - (0 - (-1 + -2)) - -2? -3 What is (1 - (3 - 2)) + -2? -2 What is the value of (-3 - -4) + 1 + -2 + 3? 3 What is -3 + (1 - 1 - -2 - -7)? 6 Evaluate (-40 + 36 - (1 - 2)) + 3. 0 What is the value of -3 - (-1 + -1 - -2)? -3 4 - (-9 - -6) - 2 5 What is 53 - 56 - (-15 - (1 - 4))? 9 What is (8 + -7 - (-2 - -5)) + 2? 0 What is 3 - (10 + (-4 - 7))? 4 What is the value of 4 + 1 + 14 + -14? 5 What is the value of 0 - 1 - -1 - 4? -4 Calculate 0 - (4 + -4 + -3). 3 What is the value of 2 + 6 + (-2 - 1) - -3? 8 Calculate 18 + -3 - 2 - 5. 8 What is 1 + -2 + 0 - (0 + -6)? 5 Calculate 1 + 6 + (-5 - 1). 1 Evaluate -4 - (4 - 7) - (-19 - -22). -4 Calculate 4 - ((-1 - -2) + -1). 4 1 - (-9 + (10 - 5)) 5 What is -138 + 124 - (-8 - -1)? -7 Evaluate 7 + (3 - (8 + 10)). -8 4 + (2 - 0) + -6 + 2 2 Evaluate 9 + -6 + (1 - 2). 2 What is the value of (2 - 3) + 4 + 1? 4 Evaluate 0 - (0 + 0 + -6). 6 What is the value of 1 - 0 - (0 + 0 - -1)? 0 10 - 7 - (0 - (-2 - 0)) 1 What is the value of -8 + (-1 - (-11 + 5 + 3))? -6 What is the value of (-3 + 3 - 2) + -49 + 45? -6 What is 11 + -19 + 6 - (0 - -5)? -7 Calculate -4 - (-2 + -5 - -7). -4 3 - (-3 - -1 - -4) 1 Evaluate -2 - ((5 - 1) + -4). -2 Evaluate 2 + -3 - -3 - -3. 5 Calculate -5 + (-7 - 0) - -8. -4 What is the value of 0 + 7 + -14 - -1? -6 What is -12 + 0 + 1 + 6? -5 Calculate -1 + 2 + -6 + (-70 - -82). 7 What is the value of 1 + -4 - -5 - (0 - 1)? 3 Evaluate -4 + -4 + 10 + (-1 - 0). 1 Evaluate 0 - -2 - (-1 + 3) - 2. -2 What is (-10 - -5) + 2 + (11 - 3)? 5 Evaluate 3 + (1 - -2) + (-1 - 0). 5 Evaluate 4 - (3 - (-2 - 0 - -3)). 2 Calculate -1 + -1 + (-5 - -4) - 0. -3 What is 22 + -19 + 1 + (-7 - -3)? 0 Calculate -11 + (6 - -13) + -10. -2 Calculate (1 - 6) + (10 - 8) + 1. -2 Evaluate 4 + (9 - 6) + (8 - 14). 1 What is -8 + 21 + -9 + 4? 8 What is 1 + 4 + -4 - 6? -5 Calculate (7 - 6) + (1 - (1 + 1)). 0 Evaluate (2 - -4) + (37 - 43) + 0. 0 Calculate 3 - 1 - (-67 + 74). -5 Evaluate 6 + 4 + (7 - 9). 8 Calculate 7 + (4 - 12) - 2. -3 Evaluate 14 + (-6 - -1) + -4 + -1. 4 3 + (-8 - -2) + 7 4 2 + 11 + (-7 - 7) -1 What is -8 - (-4 + 4) - (-2 - 0)? -6 Calculate 2 - ((4 - 7) + (2 - -4)). -1 (-6 + 0 - -4) + 3 1 Calculate (0 - 4) + 3 - (-2 - -1). 0 Calculate 7 - 12 - ((3 - 2) + -9). 3 What is the value of (0 + 0 - -3) + -38 + 33? -2 Evaluate -6 + (2 - (-5 + (-5 - -10))). -4 What is the value of 12 + -6 + (2 - (-2 - -3))? 7 Calculate -2 - 1 - -2 - -2. 1 What is 6 + (-4 - -2) + 1 + -4? 1 4 + -3 - (1 + 0) 0 What is the value of -7 - ((5 - 23) + (1 - -2))? 8 -3 - (6 - 7) - (3 + 2) -7 (1 - (6 - 3 - 0)) + 3 1 What is the value of 15 + -8 - (-3 + 2 + 13)? -5 Calculate -16 + 5 + 6 + 1 + 5. 1 What is the value of -3 + (8 - 5 - 4)? -4 What is -3 + -1 + (0 - -11) - 14? -7 3 + 4 + -9 - (1 + -1) -2 Calculate 6 - (7 - 1 - 1). 1 Evaluate (2 - -4) + (-11 - 0). -5 (6 - 4 - 3) + 3 2 What is the value of ((-5 - -4) + 5 - 3) + 6? 7 Calculate (-7 + (8 - 4) - 2) + 14. 9 Evaluate 9 + -3 + 4 + -7. 3 What is 1 - (-4 - (-2 + 6))? 9 3 + (-6 - -9) + (0 - 3) 3 (-8 - (5 - 22)) + -12 -3 Evaluate (-8 - -5) + (-2 + 4 - -4). 3 Calculate 1 + -3 + (1 - 0) - 5. -6 Calculate (11 - (7 - 6)) + (-4 - 0). 6 What is the value of 3 + -2 + (-2 + 1 - 0)? 0 What is the value of (3 - -1 - -4) + -6 - 6? -4 Calculate -2 - -8 - (10 - (5 - 1)). 0 Evaluate (7 + -13 - (-4 + -1)) + 2. 1 -5 - ((-5 - 2 - -2) + -6) 6 Calculate 34 + -38 - (1 - 1). -4 Calculate 1 + 7 + -24 + (-10 - -22). -4 What is 1 + 0 + 24 + -25? 0 Evaluate 7 + -15 + (4 - -6). 2 Evaluate 3 + (-2 - -8 - 7). 2 Evaluate 4 + (-9 - -5) + (-11 - -2). -9 Evaluate -4 + 0 + 2 + 0 + 4. 2 Calculate (-1 - 3) + (14 - (5 - -3)). 2 What is the value of 1 + 4 - (11 + 2 + -4)? -4 What is 6 + -5 + -8 - -1 - -4? -2 What is 1 - 1 - ((-5 - -2) + 3)? 0 Evaluate 0 + (-2 - 4) - 2. -8 Evaluate 1 + -4 + -1 + (-2 - -4). -2 Calculate 7 - 6 - (-3 + (1 - -6)). -3 Calculate 6 + -9 + -2 + (-3 - -12). 4 Evaluate -225 + 230 + (1 + -1 - 8). -3 What is -2 - 1 - (-1 + (-4 - -12))? -10 Evaluate 0 - (7 - 2) - (-6 - -5). -4 Calculate -7 + -2 - (3 - 10). -2 Calculate 12 + (-14 + 5 - -1). 4 What is the value of 9 + -2 + (-3 - 0)? 4 (5 - (1 - (4 - 4))) + -7 -3 Calculate -1 + 9 + -1 - 2. 5 Evaluate -8 + (2 - -6) + -5. -5 What is the value of (6 - (2 + -3)) + -1? 6 What is 1 - 2 - (-6 - -2)? 3 Calculate 16 + -7 + 6 + -7. 8 What is the value of (7 - (18 + -3)) + 13? 5 -4 + (6 - (-4 - 1)) 7 Calculate 5 + (3 - 1) + (-7 - -4). 4 What is the value of -5 - (3 - 8 - 5)? 5 What is (7 - 1) + -7 + -1? -2 -1 + (-19 + 23 - (-6 + 0)) 9 (-2 - 1) + 0 + (80 - 83) -6 Evaluate 3 - ((5 - 1) + 4) - 2. -7 What is the value of 31 - 37 - (-4 - -1)? -3 What is 0 + 2 + (0 - 2 - -5)? 5 -11 - (-6 - -5 - 5) -5 What is -4 + (6 - (10 - 3))? -5 Evaluate -14 + (-7 - (8 - 0 - 18)). -11 What is the value of -4 + 5 + (3 - 5 - -2)? 1 Evaluate 2 + (-26 - -25 - (0 - 0)). 1 What is -1 - (1 + (-7 - -5) + 0)? 0 Evaluate (0 - 4 - (-10 - -9)) + 1. -2 What is 0 + 3 + (-7 - -2)? -2 (0 + 3 - (-2 - -7)) + 1 -1 Calculate -11 + (6 - 2) + -3 - -4. -6 What is -7 - (2 - 12 - -6) - -3? 0 Calculate (13 - 4 - 3) + (-5 - -3). 4 7 + (5 - 16) + 3 -1 What is -11 - (-11 + 7 + -5 + 4)? -6 Evaluate (10 - (-11 - -5)) + -11. 5 Evaluate 1 + 4 + 0 + -4. 1 Calculate 6 - (-3 + 2 - -4). 3 -1 - (3 + 0 + 0) -4 (28 - 22) + 2 + -5 + 1 4 What is -6 + (16 - 0 - 7)? 3 What is -2 - (1 - (-5 - -2) - 1)? -5 What is the value of 3 - (-1 - (2 - 8)) - -2? 0 What is the value of 1 + (5 - 7 - -4)? 3 Evaluate 6 + (-9 - (-8 - -4)) + 3. 4 (-4 - (3 - 3)) + -2 -6 Calculate 1 - -8 - (25 - 26). 10 -4 - (-1 - 3 - 7) - -1 8 What is 32 + -48 + -1 + 7 + 4? -6 What is 1 - 6 - (-3 + -8 + 9)? -3 What is the value of ((-7 - -1) + 1 - -1) + -3? -7 What is the value of -6 - -3 - (-2 + 4)? -5 Evaluate 2 + 6 - (-10 + 8 + 2). 8 What is the value of -9 + (10 - -14) - 24? -9 What is (5 - (3 - 3)) + -1? 4 What is the value of -5 + (-1 - 0 - -5) + -1? -2 Calculate -2 - (1 - (-6 - -3 - -7)). 1 2 + (2 + -3 - -6) + -3 4 Evaluate 0 + (4 - 1 - 3). 0 What is 7 + -13 + (3 - 1) - -2? -2 Evaluate 4 + -1 + 0 + 2 + 0. 5 Evaluate -1 - -2 - 0 - (8 - 3). -4 What is 1 + -3 + (-18 - -17)? -3 Evaluate ((0 - 5) + -4 - -5) + 1. -3 Evaluate -2 - (5 + -4) - -4. 1 What is (0 - -4) + (11 - 5) + -15? -5 (-2 - 1) + (-10 - 0) + 2 -11 -3 - (8 + (-4 - 2) + 3) -8 Evaluate 3 - (-6 - (3 + -13)). -1 Evaluate -2 + (8 - 11 - (2 - 4)). -3 What is the value of -3 + (19 - 19 - (-5 + 1))? 1 -9 - (2 - (6 - 5 - -4)) -6 3 - (-1 + (12 - 7)) -1 -1 + -1 + 24 + -24 -2 Evaluate (5 + -3 + 2 - 1) + 0. 3 What is the value of 8 + 3 - (-6 + 9 + 1)? 7 Calculate (-15 - (6 + (1 - 11))) + 1. -10 Evaluate -5 + (-4 - (-3 - 9)). 3 2 + -2 - -2 - 7 -5 -39 + 31 - (-13 + 2 - -3) 0 What is -12 + 14 - (4 - 1)? -1 Calculate 4 - (9 - (-1 + 1)). -5 (10 - 0) + -5 - (0 - -1) 4 Calculate -1 - (-3 + -2 + 4). 0 Calculate -14 + 2 + 24 + -18. -6 Evaluate -4 - (-2 - 4) - (-5 - -3). 4 Calculate -3 + (-3 - -8) + -2. 0 Evaluate (2 + 0 - 3) + 1. 0 What is -2 - (0 - -2) - (-39 - -39)? -4 What is -7 + 3 - (-2 - -1)? -3 Evaluate -3 - (-2 + (1 - -3)). -5 Calculate 6 + (3 - 4 - (5 - 1)). 1 Calculate -2 + (3 - ((0 - -4) + 1)). -4 Evaluate 6 + 4 + -6 - 1. 3 Calculate 2 + (15 - 15) - -2. 4 What is 13 + -3 - (-7 + 16)? 1 What is 56 + -64 + (0 - -5)? -3 What is -8 + 8 - (-5 + 0)? 5 4 - (2 + 4 + 4 - 6) 0 Evaluate (1 - -2) + -3 - 0. 0 Calculate -4 + 11 + -2 + -2. 3 What is -2 + (1 - (-10 - -9))? 0 What is 2 + (1 - 3) + 2 - 3? -1 What is the value of (0 - (10 + -5)) + 3? -2 What is	{ "pile_set_name": "DM Mathematics" }
rue Which is greater: -7681671/13 or -590897? -590897 Which is bigger: -0.01 or 1.066363? 1.066363 Which is greater: 64416 or 64578? 64578 Is -538586 at least as big as -538583? False Is -18576362 > -18576362? False Which is smaller: -7 or -30475444? -30475444 Is -4454/45 less than -100? False Which is greater: -68320 or -68336? -68320 Is -2/70381895 greater than 0? False Is 1598939 greater than or equal to 1598935? True Is 253571 greater than or equal to 2? True Which is smaller: 34053337 or 0.1? 0.1 Is -151560749 <= -151560750? False Is 199160 != -32/89? True Is 653010 equal to 653029? False Which is smaller: 0 or -13/15385905? -13/15385905 Is 1057517 at most -3.31? False Which is bigger: -813 or 25613? 25613 Are -15000 and -946 unequal? True Are 3/1934138 and 1 equal? False Is 11 at most -87760? False Is 1 smaller than -2/50965705? False Is 550873 greater than 25890978/47? True Which is smaller: -7688 or -238? -7688 Is -451892 less than -22/3? True Is 90 at least 9/140176? True Are 4/2592317 and 0 non-equal? True Is 128985283 less than or equal to 128985284? True Do 28108630 and 28108627 have the same value? False Which is bigger: -8322 or 2662? 2662 Is 235831894 greater than 235831894? False Do 1227219 and 1227215 have the same value? False Which is greater: 2/45581785 or 1? 1 Is -155290836 less than -155290837? False Are -1338.7 and -0.7776 equal? False Are -4675/3177 and -2 equal? False Which is bigger: 158/64287 or -17? 158/64287 Which is bigger: -2/3 or 4516.796? 4516.796 Which is greater: -185 or 8.569? 8.569 Which is greater: 0 or 2/51790621? 2/51790621 Which is smaller: -1953 or 80824? -1953 Is -10269 at most -1065? True Which is bigger: -12 or -26403/2485? -26403/2485 Is 0 at least 4/2166021329? False Is 0 less than or equal to -46/54457549? False Which is smaller: -0.07281849 or 1? -0.07281849 Are 3228288 and 3228256 unequal? True Is 37/400 at least as big as 12? False Is 9598 <= 11831? True Is 324062 less than or equal to 6805333/21? True Which is smaller: 5/23525151 or -1? -1 Which is smaller: 2620 or -4/367? -4/367 Is 0 bigger than 3/1151125988? False Which is smaller: -76 or -49033/637? -49033/637 Which is smaller: 0 or -1/38714306? -1/38714306 Which is smaller: 0 or 4/30093839? 0 Which is smaller: -8173 or 1099? -8173 Is -11842/6121 greater than -2? True Is 1 equal to -4/96641? False Which is smaller: -932851/34 or -27437? -27437 Is -1 less than or equal to 26/473919? True Is 48094299 smaller than -8? False Is 121322032 smaller than 121322029? False Are -473 and 59849 equal? False Which is greater: 53053975 or 53053978? 53053978 Which is smaller: 2826/192311 or 0? 0 Which is bigger: -1 or -5/134254967? -5/134254967 Which is smaller: 1 or -1716/23479? -1716/23479 Are -2/61705835 and 0 equal? False Is 67545/2827 < 23? False Which is greater: -83083789 or -913921674/11? -913921674/11 Which is smaller: -9008 or -14300? -14300 Which is bigger: -13027323 or -13027322? -13027322 Which is greater: 63 or -9338? 63 Are -23178255 and -23178255 unequal? False Does -2 = -14676/18161? False Which is bigger: -373 or -2429107? -373 Which is smaller: 0 or 6/2664583? 0 Which is smaller: 3/49 or 4093? 3/49 Which is smaller: 325171 or 325458? 325171 Which is bigger: 68358 or 128? 68358 Which is greater: 71726/7877 or 10? 10 Is 142188 at least as big as 142083? True Is -273823210 not equal to 0? True Which is greater: 4391370 or 4391376? 4391376 Which is smaller: -244/7 or 1.3041? -244/7 Is 83854828 equal to 586983801/7? False Which is greater: -332049/5959 or -55? -55 Which is greater: 50882 or -437? 50882 Is 1/81743365 at most as big as -1? False Which is smaller: 1/1601 or -667? -667 Which is bigger: 1 or 2/22142319? 1 Is -159634605 at most -159634605? True Is -198703 equal to 122? False Which is bigger: -13/68096723 or 0? 0 Which is bigger: 161303100 or 161303099? 161303100 Which is smaller: -16/2948433 or 0? -16/2948433 Which is smaller: -1314672 or -6573366/5? -6573366/5 Are 0.3 and 24.156 unequal? True Is -87590 > -88083? True Which is smaller: 0 or 20015/27757? 0 Which is smaller: 0 or -5/3733898? -5/3733898 Which is smaller: -5327 or 131176? -5327 Is 61357/7 > 10? True Which is bigger: 17337/14 or 221? 17337/14 Is 1 >= -2/48685621? True Which is smaller: -1446857 or -1446858? -1446858 Is 304242510 greater than or equal to 2? True Which is smaller: 813/214025 or -1? -1 Which is bigger: 64 or 609065/3? 609065/3 Which is bigger: -3 or -3/76688? -3/76688 Which is bigger: 28457 or 18329? 28457 Is 1469/56487 < -1? False Is -151030/56883 <= -3? False Is 634 >= 46083? False Which is greater: -7.8 or 4345.2? 4345.2 Is -50 at most -6220505? False Is 23189110/47 equal to 493385? False Are -25/7090137 and 1 nonequal? True Is 2/211 bigger than 21921? False Is 2574614 less than 2574609? False Is 17980247 smaller than 17980246? False Is -35 at most -108.086? False Which is smaller: 432876 or -227? -227 Which is smaller: -506428/161 or -3146? -3146 Is -41 not equal to -75973/1809? True Does 602596 = -662? False Is -159078 greater than or equal to -795391/5? True Is 142/770363 > 1? False Which is greater: 1/2486572 or 958? 958 Is 1971642 smaller than 1971587? False Which is smaller: -2 or 1155063? -2 Which is smaller: 25227805 or 25227804? 25227804 Is -4.3262 less than -102/7? False Which is bigger: -26 or -49047/1901? -49047/1901 Is 1071/16297 smaller than -1? False Which is smaller: 1 or 580/46723? 580/46723 Which is smaller: 49/5 or -8/2413? -8/2413 Which is greater: 303482032/11 or 27589276? 27589276 Is 975273054 less than 975273052? False Which is smaller: -18332697/7 or -2618956? -18332697/7 Which is smaller: 1 or 1/187070852? 1/187070852 Which is bigger: 6864 or 6284? 6864 Is 1787874 <= 1787820? False Is -5650660 at most as big as -8? True Which is bigger: 1042341 or 1042342? 1042342 Is 43975319 at most as big as 43975322? True Is -37059 equal to -37041? False Which is bigger: 5168222 or 21/4? 5168222 Is 38 at least as big as 281025/11? False Are -0.1 and -132.115103 unequal? True Which is bigger: 158378811 or 158378808? 158378811 Is 240214 at least 240202? True Is -751 < 1916? True Is 178507 less than or equal to -103? False Is 961409/509 at least 1889? False Is 2 at least 21753/38659? True Is -1 at least 7713/48280? False Is 3495/45247 less than -1? False Which is smaller: 96994 or 95724? 95724 Which is smaller: 62213 or 10/11? 10/11 Is 2204119 <= 2204097? False Which is greater: 327444 or 10150788/31? 10150788/31 Are -375059 and -375040 equal? False Which is greater: -43770052 or -43770053? -43770052 Which is smaller: -19 or -4369677? -4369677 Is 4786/16911 less than 0? False Which is smaller: 13374573/2 or 1? 1 Is 156978 > 1883737/12? False Which is bigger: -1372740 or -1203? -1203 Is 0 at most 189871.835? True Which is bigger: 21 or 2923532? 2923532 Which is smaller: 2/901275727 or -1? -1 Which is bigger: 8173 or 6231? 8173 Which is smaller: 315450 or 315454? 315450 Which is smaller: -45244017 or -45244018? -45244018 Is -1 < 478/12579? True Is 16244 greater than 16537? False Which is smaller: -73 or -452/1181? -73 Is 11099.52 smaller than 5? False Is 13/25618 bigger than -167/6? True Which is smaller: -685579/463 or -1480? -685579/463 Which is smaller: -13837 or -13823? -13837 Which is greater: -147260 or -147557? -147260 Which is greater: 31828275 or 6? 31828275 Which is smaller: 65/68644 or -1? -1 Is -2/3 at most 487059457? True Which is bigger: 0 or 645/106058? 645/106058 Which is greater: -37884970 or -37884962? -37884962 Which is greater: 3734220 or 3734257? 3734257 Is -0.36897 < 2099? True Is -379563 greater than -379722? True Is -236500 >= 550? False Which is smaller: 2/5 or 13318360? 2/5 Which is greater: 426 or 33/314? 426 Is -71505 less than -76512? False Which is smaller: -1/824506824 or 0? -1/824506824 Which is smaller: -0.5 or -0.61573799? -0.61573799 Which is bigger: -2/828333039 or 2? 2 Which is smaller: 209083259 or 209083258? 209083258 Is -13461449 equal to -40384348/3? False Which is bigger: 101485 or 101378? 101485 Which is greater: 1258183 or 1258193? 1258193 Is 76234291 bigger than 76234291? False Which is bigger: -618 or -165889/268? -618 Do -1/121545850 and -1 have different values? True Which is smaller: 22504269	{ "pile_set_name": "DM Mathematics" }
, 2q - bf - x = -2f for q. 5 Suppose 4 = -s + 3s. Suppose -sx + 5h + 17 = 0, -3h = 5x - 20 - 7. Suppose -3u + x = -u. Solve 6 = 3w - 2o + uo, 4w - o - 1 = 0 for w. 1 Let m = 36 + -36. Solve -6j = a - j + 17, 2j + 8 = m for a. 3 Let c(p) = 3p - 1. Let o be c(1). Solve 0 = -5i + 4j + o, -2i - 2j + 3 = -5 for i. 2 Suppose -14 = -2o - 0o. Let s(y) = 4y. Let g be s(4). Solve -5f + 4l + g + 0 = 0, f + 3l = o for f. 4 Let s(a) = 3a. Let f be s(-2). Let j be -6((-30)/(-9))/(-2). Let h = j + f. Solve -6 = 3l, 4r - 6 = -hl + l for r. 3 Suppose 3i = -2i - 2d + 19, 11 = 3i + d. Suppose 4g + i = 11. Suppose -g - 1 = -q. Solve 5y - 15 = 0, 9 = -qr - 2y + 5y for r. 0 Suppose 0 = 3r + 4v - 24, -5r + 6 = -2v - 34. Let l be (-8 + r)2/4. Solve 3i - 5k - 5 = -li, 5i + 3k = -3 for i. 0 Suppose 3z - 8 = 10. Let y be ((-3)/z)/(1/(-14)). Solve -3h = 3w - 5w - 7, y = w + 2h for w. 1 Suppose -4r = 4r. Solve -5g + 2d = 14 + 16, 5g - 5d + 45 = r for g. -4 Let w = 3 + -2. Suppose 0 = s + 6s - 21. Solve -2 - w = -sn, 4d = n - 21 for d. -5 Suppose 0 = -8z + 50 + 30. Solve -5f + 25 = -5j, z = 5j - 3f + 35 for j. -5 Let j(o) = o3 + 2o*2 + o. Let f be j(-1). Let k(t) = 8t - 225. Let r be k(29). Solve 5z - 3s - r = f, 0 = 2z + 3s + 5 + 9 for z. -1 Suppose 9b - 4b = 10. Suppose 2v - 6 = 5g + 4, g = -b. Solve 0 = 3h + 5a + 8, va + 5a = -2h - 12 for h. 4 Let k = 18 - 15. Suppose w + 1 = k. Solve -3c + 3g = g - 1, -wc - 5g = 12 for c. -1 Suppose 5h = -2o - 8, -4h - o = 2o + 12. Suppose 5t + 55 - 155 = h. Solve t = 2c - 2x - x, -5x = -3c + 32 for c. 4 Let c(h) = h*3 + 4h*2 - 2h - 5. Let f be (2/4)/(1/(-2)). Let a = f - 3. Let s be c(a). Solve -2 = -o - 3t, o - so - 2t = 0 for o. -1 Let y = -1 - 1. Let o be -25/y - 2. Let r be 15/o + (-3)/3. Solve g = -rl - 14, 5g = -l - 9 - 4 for l. -3 Let s = 2 - -7. Solve -4r + 5g + 4 = -2, 5r + 2g = -s for r. -1 Suppose 2v = -v + 33. Solve -i + 4i + 4t = -v, 4i + 5t = -13 for i. 3 Suppose 5u = -g + 20, -g = u - 2g + 2. Let f(i) = i2 - 6i + 1. Let z be f(6). Let y = 1 - z. Solve -u = d - 3o - 5, d - 5o - 2 = y for d. 2 Let y(x) = -x*2 + 10x - 4. Let l be y(9). Suppose 2h = -d - l + 27, -3d = 3h - 51. Solve u = -4u + 5q - 5, -5u - 2q - d = 0 for u. -2 Let w(j) = 2j*2 + 6j - 4. Let c be w(-5). Suppose -3v = 4 - c. Solve n + n + 3h = 5, -vn + 4h = 0 for n. 1 Suppose 2s + 6 = 16. Solve -4b = -b - 4j + 13, sj = -5b - 10 for b. -3 Let x = -7 + 14. Let h = 10 - x. Let y be (-3)/(-9) + 14/h. Solve 7 = -5k + 6k - 2v, -4v - 17 = -yk for k. 1 Suppose -2g - 38 = -3l - 9, 0 = -4g - 4. Let f = l + -6. Let n(s) = -s3 - s2. Let c be n(-2). Solve -4k = x - 17, ck - 8 = fk + x for k. 5 Suppose 4j - 3v - 10 = 0, -2j + 2 = -3v - 0. Let c be (0 + 27/6)-2. Let a be ((-3)/c)/(2/12). Solve -jq + 4r = -32, -aq = -3q + 5r + 28 for q. 3 Let g(y) be the first derivative of -y*3/3 + 7y*2 - 10y - 7. Let w be g(13). Solve 0n + 16 = wn + 2h, 0 = 5n - 5h - 10 for n. 4 Let i be (-208)/(-117) - (-4)/18. Solve -w + 18 = -3h, w - i - 1 = 0 for h. -5 Let d be (-5 - 62/(-12)) + (-2)/12. Solve d - 8 = s + r, s + 4r + 20 = 0 for s. -4 Let a(n) = -n + 4. Let b(c) = -c + 13. Let z be b(10). Let f be a(z). Suppose -2p + f = -7. Solve 3r + 4h = -28 + p, r - 11 = 5h for r. -4 Suppose -v = v - 6. Solve 6h - vo = 3h + 15, 5o + 7 = -h for h. 3 Suppose 0k = -3u - 3k + 15, u = 5k - 1. Solve -5s + 4 = -d, -3d + u = -s + 2 for d. 1 Suppose 0 = -4j + 5z + 3, j + 5z - 7 = 0. Solve 2g = y + 4, jy + 0g = -g - 8 for y. -4 Let y be (-1)/6-20. Let x(u) = u3 + 4u*2 + 2u + 3. Let j be x(-3). Solve 0 = -p - t + 3, 2p - t + y = j for p. 3 Let a = -10 + 10. Suppose 2t - 3l - 10 = a, 5t - 2t = -5l + 15. Solve -3u = -tw - 11, 2w + 11 = -5u - 12 for u. -3 Let t be 5/4(8 + 0). Solve -4x - t = -3f, -f + x = 5x + 18 for f. -2 Let a(j) = -3 + j - 2j - 1 + 0j. Let w be a(-7). Solve 4t + wo = 3t - 5, -2t = 3o + 7 for t. -2 Let r = -17 + 17. Solve -3u + r + 3 = -3z, -2z = -u - 2 for u. 4 Suppose -o + 4h = -90, -289 + 84 = -2o + 3h. Suppose 5q - o - 65 = 0. Solve -4n + 5k - 10 = -n, -3n - 4k = -q for n. 5 Suppose -7y + 3y + 16 = 0. Solve t - 5a = -2a + 17, yt = -5a for t. 5 Let a(f) = f - 12. Let c be a(0). Let g = -10 - c. Suppose 3k + 28 = gy - 0y, -3y - 3k = -42. Solve 5j - y = 3v, -2j + 2v - 1 = 3v for j. 1 Suppose -4r - 3 = -19. Suppose -z + 16 = -rp, z - 4z = 3p + 12. Suppose 0 = -2l + 6l - 8. Solve -t + 5o + 1 = -lt, -t + 4o + 8 = z for t. 4 Suppose 4f - 1 = 11. Solve -2v - j - 12 = -f, -3v = -5j - 19 for v. -2 Let u(z) = z2 - 6z + 1. Let f(j) = -2j2 + 12j - 3. Let q(o) = 6f(o) + 11u(o). Let a be q(3). Solve 25 = -3t - 4l, -2t - 5 = al + 9 for t. -3 Suppose t + 2 = 4. Suppose a = 3x - 1, -ta + 2x + 5 = 3. Solve r - 2r = -a, -3v - 5 = 2r for v. -3 Suppose -4j = -32 + 12. Suppose k - 2t - 7 = 0, 5k - 7 = 2t - 4. Let b be (-2 - (k - -1)) + 4. Solve -2m = z, -5z = jm - 3z - b for m. 2 Suppose 1 = i - 4. Suppose -36 = -iv + 79. Solve 4r + 5c + 1 = -v, -3r = c + 7 for r. -1 Suppose -h - 4 = 3h + 4z, -4z = -5h + 4. Suppose h = -2y + 4. Let q be 5/1 + 0 + -2. Solve -4k = -3o - k, -qo = yk - 5 for o. 1 Suppose 0r + 22 = -r - 4k, 4r = -k - 13. Let o be (-2 + 1)-2 - r. Solve -b + c - o = 0, 4c = b - c + 12 for b. -2 Suppose -3h - 2h = 3z + 16, 4h + 5z = -18. Let y = 5 + h. Suppose -3k + 1 = x, 4x + 4k = yk + 15. Solve 4n + 3f = -13, 4n = -xf - 4 - 8 for n. -4 Let w(t) = -t2 + 14t + 5. Let f be ((-4)/(-12))/(1/42). Let b be w(f). Solve -bs = -5z + 15, -z = -s - 4s + 1 for z. 4 Let s = -5 + 15. Suppose 2z - 3q + 14 = 0, 0 = 4z - 6z - 2q - 4. Let c = z + 6. Solve cv - 14 = 4m, 5v + m - 34 = -s for v. 5 Let f be ((-11)/2 - -4)(-16)/6. Solve 5r + v = -2v - 18, fv - 5 = 3r for r. -3 Suppose 3v = 62 + 58. Suppose -l = 3l + v. Let m be (-8)/l(-20)/(-8). Solve w = mn, -4w = 5n - 10n for n. 0 Let h = 34 - 29. Let y(s) = 2s*2 + 3s. Let w be y(-2). Suppose -7d + wd = -30. Solve hc = -2u - 3u, -2c - d = -4u for c. -1 Let d be (-1)/(((-8)/22)/4). Let n = 16 - d. Solve 0 = 3p - nc - 27, -5p - 5c = -2c - 11 for p. 4 Suppose 5t - 11 = 9. Suppose -8 = -2y + t. Solve -2d + 5 = 5s, -y = 2s - 8 for d. 0 Let u = -2 - -3. Let n be 0 + 6/2 - u. Suppose -47 + 19 = -7s. Solve 0 = 4q + 20, t + nq - sq = 5 for t. -5 Let n = 37 + -10. Suppose 0 = -2b + v + n, 3v - 71 = -4b - 2. Suppose -u - 8 = 2g + 1, -2u - 2g - 8 = 0. Solve -z = 3t - b, 5z + 0z + u = 4t for z. 3 Suppose -19w + 21 = -12w. Solve 4s + 3v = -20, 12 = ws + s - 5v for s. -2 Let s be (-4)/(-10) - (16/40 - 5). Solve i = s, -o = 3o - 5i + 29 for o. -1 Suppose 3y + 0y = 3. Let l be y/(13/4 + -3). Solve 3r - 11 - 5 = -ls, 3r + 16 = 4s for r. 0 Let c be (28/(-35))/((-4)/(-50)). Let k = c - -14. Solve 3i + i - 2w + k = 0, i + 4w - 17 = 0 for i. 1 Suppose -3j + 2 = -2j. Suppose js - 3 = 3. Solve -sg - 1 - 3 = -4y, -4g - 16 = 0 for y. -2 Let f = 4 - -1. Solve 10 = 2k + fj - 0, -k + 8 = 4j for k. 0 Let j be -13/12 + 41/4. Solve a = m, 0m = 5m + 5a + j for m. -1 Let s be 6/(-9) - 50/(-3). Solve 36 = 4z + 4b, -5z + b - 1 = -s for z. 4 Suppose 4h - 5 - 7 = 0. Let o = -19 - -35. Solve -4x = 4w - o, -3x - hw + 6w + 18 = 0 for x. 5 Let v = 25 - 23. Suppose vp = -1 + 25. Solve -k = -4w - 3k + 4, 0 = 3k + p for w. 3 Suppose -4v - 1 = -5s, 2s = v + 2v - 1. Let p be v/636. Let c = -7 - -11. Solve -cz + 2a - 4a - 18 = 0, pa = 4z + 23 for z. -5 Let s = 76 + -64. Solve 2i + 3 + s = -5o, 20 = 4i for o. -5 Suppose -27 = -3f + 21. Suppose 3 = k + 1. Let q = -29 + 34. Solve -5m = -s - 28, -qm - ks + f = s for m. 5 Let k be (-2 + 4)/((-3)/(-6)). Suppose -3r + 2 = -k. Suppose -f = -5u + 16, ru - 4 = -0u - 2f. Solve 2z = 8, ux - 5z + 22 = -10 for x. -4 Let z(d) = -d*3 + 7d*2 + 4. Let s be z(7). Solve -o - 5 = 0, -o + 2 = si - 3o for i. -2 Let u(h) = h - 2. Let i be u(11). Suppose 4r - x - 4 = i, 0 = r + x - 7. Solve -l - rl - 14 = 2a, 0 = 2*l + a + 6 for l. -	{ "pile_set_name": "DM Mathematics" }
q + 1595. Let y(r) = 3n(r) + 7v(r). Find the second derivative of y(i) wrt i. -1950i Let s be 68/16 - 37/1. Let b = 40 + s. Find the third derivative of 19f*6 - 33f*6 + 17f*b - 7f*2 wrt f. 360f*3 Let q be (-404)/(-707) - (-17)/7. Let g(c) be the first derivative of -10 - 15/2c*2 + 0c + 11/3cq. What is the second derivative of g(l) wrt l? 22 What is the second derivative of 192m*4 + 2515m + 246m4 - 183m5 - m3 + 345m5 - 156m*5 wrt m? 120m*3 + 5256m*2 - 6m Differentiate -1152r3 - 1333 - 1665r*3 + 25 - 1103 - 369 with respect to r. -8451r*2 Let g(a) be the second derivative of 309a*5/5 - 871a*2/2 - 2a + 94. What is the derivative of g(y) wrt y? 3708y2 Let l(a) be the third derivative of 335a*8/168 - 527a5/30 - a4/12 + 3124a2. Find the third derivative of l(r) wrt r. 40200r*2 Suppose -15 = -0y - 5y. Let g = -672 + 690. What is the second derivative of -gl - yl + l + 22l*4 - 11l wrt l? 264l2 Let m(j) be the second derivative of -33j*7/2 - 11j*4/4 - 7j*2/2 + 10j + 43. Find the third derivative of m(t) wrt t. -41580t2 Let d(o) be the first derivative of o6/3 - 452o*5/5 - 71o*3/3 - 4343. What is the third derivative of d(v) wrt v? 120v*2 - 10848v Let x(a) = a3 + a2 - 15a. Let w(c) = -84c*3 - 2c*2 + 40c + 5189. Let d(r) = w(r) + 2x(r). Differentiate d(g) with respect to g. -246g*2 + 10 Suppose -4d = j - 74 - 76, 2j - 297 = -5d. What is the first derivative of 39l - 413 + 150 - 108 + j wrt l? 39 Let x(c) be the second derivative of 0c*2 + 17/2c*3 - 12c + 1/3c4 - 2 + 0c*5 - 2/15c*6. What is the second derivative of x(l) wrt l? -48l*2 + 8 Let s(p) be the first derivative of 3300p*2 + 868p - 732. What is the derivative of s(j) wrt j? 6600 Let s(b) = 65b - 1. Let u(y) = 1954y + 172. Let k(l) = -5s(l) - u(l). What is the first derivative of k(o) wrt o? -2279 Let c(t) = t3 + 16t*2 - 27t - 166. Let s be c(-17). What is the second derivative of -1529ms + 760m*4 + 6m + 729m4 wrt m? -480m*2 What is the second derivative of -83g*2 - 22 - 1419g + 69g2 + 22 - 520g2 wrt g? -1068 Let r(n) be the first derivative of -n3 - 161 + 48 + 645n5 - 667n*5. What is the third derivative of r(f) wrt f? -2640f Let w(s) be the second derivative of 5 + 12s + s3 - 15/2s*2. Differentiate w(m) with respect to m. 6 Let u(k) be the second derivative of 3847k*5/20 + 11k*4/12 + 2k*3/3 + 2k*2 - 2k + 2313. Find the third derivative of u(s) wrt s. 23082 Let q be 1 + 0 + 1 + 0. Suppose -7 = -2w + 3, -1722 = -2d + qw. What is the third derivative of -866 - 13i*5 + d - 2i*2 wrt i? -780i*2 Suppose -3v + 5n = 14, -15v + 3n - 8 = -13v. Find the first derivative of -77u + v - 18 + 1 - 35 wrt u. -77 Let c be (2/(-8))/((-10)/(129 - 9)). Let q(s) be the third derivative of 0 + 16s*2 + 0s + 0s4 + 7/2s*c - 2/15s*5. Differentiate q(b) wrt b. -16b Let v(h) be the third derivative of -83h5/4 + h4/12 - 295h*3/3 + 5h*2 - 2h - 151. Find the first derivative of v(b) wrt b. -2490b + 2 Let l(t) be the first derivative of -2/3t*3 - 162 + 121/2t*2 + 0t - 19/4t4. What is the second derivative of l(o) wrt o? -114o - 4 Let f(q) = 61q - 26. Let i be f(19). Find the third derivative of 52b*2 + 1133b*3 - 39b*4 - ib*3 - 2b*6 wrt b. -240b*3 - 936b Let m = 835 + -588. Differentiate -1049t2 - m + 555t*2 + 581t*2 wrt t. 174t Suppose 2f + 20 = 6f. Suppose 4x + 10 = 5r, r + 4r - 10 = -x. What is the first derivative of -84 + xj + 85 + fj + 7j wrt j? 12 Let o(t) be the first derivative of 268t3/3 + 824t + 639. What is the first derivative of o(s) wrt s? 536s Suppose 0 = 3r + 4j + 21, 3j + 24 = -4r - j. Let s be (1 - 33/(-9)) + r/(-9). Find the second derivative of -93k*4 + k - 7k*s + 93k*4 wrt k. -140k*3 Let h(l) = 8492l*2 - 2847l + 21. Let k(b) = 4246b2 - 1423b + 9. Let r(t) = 3h(t) - 7k(t). What is the second derivative of r(s) wrt s? -8492 Let z be (3 + (-104)/(-6))/(3/9864). What is the third derivative of -66856 + 305u2 - 165u*3 + z wrt u? -990 Let y = 5625/2 - 2811. Let i(a) be the second derivative of -ya*3 + 0a*4 + 3/5a*5 + 0a*2 + 0 - 19a. What is the second derivative of i(t) wrt t? 72t Let g(m) = -12869m*2 + 3178m - 10. Let y(q) = -6434q2 + 1589q - 6. Let j(w) = -3g(w) + 5y(w). What is the second derivative of j(p) wrt p? 12874 Let y(p) be the third derivative of 5/6p6 - 5/12p*4 + 0p*5 - 74p*2 - p + 0 + 0p*3. What is the second derivative of y(i) wrt i? 600i Let g(c) = 647c2 - 459c + 30. Let q(l) = 648l2 - 460l + 25. Let h(w) = -5g(w) + 6q(w). What is the second derivative of h(a) wrt a? 1306 Differentiate 0t2 - 37t*3 - 105394 - 2t2 + t3 + 106217 wrt t. -108t2 - 4t Let i(x) = -x*2 + 2x + 3. Let l be i(2). Find the second derivative of 11190pl + 4p*5 - 11190p*3 - 14p - 5p2 wrt p. 80p*3 - 10 Let d = -19 - -54. Let a be ((-11)/d + (-16)/56)-5. Find the first derivative of 22 - 21f3 - 2f*3 - 4 - 2f*a wrt f. -75f2 Let x be 1104/136 - (-1 - (-95)/85). What is the third derivative of -33 + g2 + 0g2 + 149g*3 + xg*2 - 33 - 11g*2 wrt g? 894 Suppose 535 = -5k + 85. Let o = -86 - k. Differentiate 10 + 20y + 16 - oy wrt y. 16 Suppose 23 = 9k + 5. Let b(t) be the second derivative of -20t + 296 - 9tk + t4 - 296. What is the first derivative of b(x) wrt x? 24x Let p(j) = -j - 2. Let z be p(-4). Let l = -31 + 41. What is the third derivative of -zg6 + lg2 + g2 - 11g6 wrt g? -1560g*3 Let b(z) be the third derivative of 37/12z*4 - 77z + 0z3 - z2 - 1/60z*5 + 0z*6 - 1/5z*7 + 0. Find the third derivative of b(y) wrt y. -1008y Let d be ((2 - (-27)/(-12)) + 2)40. Let s = -66 + d. What is the third derivative of 151k*4 + 36k*2 - 28k*6 - 151k*s wrt k? -3360k*3 Let q be (-1524)/(-168) + ((-32)/7 - -4). Let y(w) be the second derivative of 0w*3 + qw2 - w4 + 0 + 17w. What is the first derivative of y(c) wrt c? -24c Let y(c) be the second derivative of 929c4/12 + 839c*3/3 + 2333c. What is the second derivative of y(s) wrt s? 1858 Let k(a) = 5a2 + 8a - 9. Let d be k(1). Find the third derivative of 12h4 - 45h*2 - 65h*3 - 18h*4 + 4h*d wrt h. -48h - 390 What is the second derivative of -g*3 - 609g + 3g3 + 94g*4 + 23g*4 + 6g*3 - 6g*3 wrt g? 1404g*2 + 12g Let i(d) be the third derivative of 1937d5/60 - 1082d*3/3 - 2189d*2. Find the first derivative of i(a) wrt a. 3874a Let i(b) be the third derivative of 0b6 + 0 - b + 11/35b*7 + 0b*4 + 0b*3 + 8b*2 - 49/60b*5. Find the third derivative of i(c) wrt c. 1584c Let i(y) be the third derivative of 0 + 13/3y4 + 73/6y*3 - 50y*2 + 0y. What is the derivative of i(v) wrt v? 104 What is the second derivative of 190v3 + 415v + 1143v3 + 393v*3 + 786 - 413v wrt v? 10356v Let u(y) be the first derivative of -33y + 9y + 19y*3 + 29 + 8y. What is the first derivative of u(c) wrt c? 114c Let g(z) = -3249z*3 - 805z*2 - 35z + 1. Let i(b) = 4874b3 + 1207b*2 + 56b - 1. Let p(q) = 8g(q) + 5i(q). Find the third derivative of p(w) wrt w. -9732 Let q(f) be the second derivative of 142f6/5 - 2519f*3/6 + 483f. Find the second derivative of q(d) wrt d. 10224d2 Let v(i) be the second derivative of -12i*2 - 13/3i*3 - 2i - 7. What is the derivative of v(k) wrt k? -26 Find the third derivative of 617j3 - 192j*2 + 92j*3 - 10j*2 wrt j. 4254 Suppose -22g + 35 = -163. What is the second derivative of -122b - 62b*3 + 62b3 + b5 + gb4 + 0b5 - b4 wrt b? 20b3 + 96b*2 Let k(w) be the first derivative of 32w*5/5 - 19w*4/2 - 1528w*3/3 - 6227. Find the third derivative of k(r) wrt r. 768r - 228 Let j be ((-2)/(-4))/((-25)/(-400)). Find the third derivative of 4u - ju*2 - 4u*2 + 13u*6 - 6u*2 + 9u*2 - 2u*4 wrt u. 1560u*3 - 48u Let z(m) be the second derivative of -17m8/1120 + 107m*5/120 + 22m*4/3 + 2m + 11. Let x(q) be the third derivative of z(q). Differentiate x(p) wrt p. -306p2 Let d(o) be the third derivative of -491o5/60 - o4/24 + 16	{ "pile_set_name": "DM Mathematics" }
-302? (a) 2/3 (b) 1/23 (c) 2/13 b What is the nearest to 0 in -2/35, 2/5, 2/13, 4, -0.3? -2/35 What is the nearest to -2/15 in -0.4, -52, 5? -0.4 What is the nearest to -1 in 1/12, 0.5, -0.07, -45? -0.07 Which is the closest to -0.2? (a) 1 (b) -19 (c) 0.163 (d) -96 c What is the closest to 6 in 0.1, -7/6, -7/2? 0.1 Which is the closest to 355? (a) 3 (b) 4 (c) 1/3 (d) -3 b Which is the closest to -2/5? (a) -551 (b) -130 (c) 1 c What is the nearest to 0.4 in -1/8, -25, 3.65, -2/7, -3? -1/8 Which is the nearest to -0.04? (a) -0.6 (b) 2/5 (c) -2 (d) -1669 b What is the closest to -226 in -2, 2/21, -0.1, 6/7? -2 Which is the nearest to -1? (a) 38678 (b) 0 (c) 1/9 b Which is the closest to 6/7? (a) 10 (b) 4.82 (c) 6/7 (d) 5 c What is the closest to -0.2 in 0.2, 1277/4, 0.5, -3? 0.2 Which is the nearest to 2? (a) -6/7 (b) 0.3 (c) 1.2 (d) -3 (e) -1 c Which is the closest to 8/13? (a) 0.12 (b) 0.2 (c) 0 b What is the nearest to -2 in 11, 0.4, -3, -169? -3 Which is the nearest to 0? (a) 5 (b) -1/24243 (c) 15 b What is the nearest to -0.27 in 5, 0.4, 1, 3, 0.6? 0.4 What is the closest to 2/5 in 7/32, -0.4, -2, 1/17, -1? 7/32 What is the nearest to 1/3 in 26, -0.9, -3, 7? -0.9 Which is the closest to -2.53? (a) -2/15 (b) -6 (c) 5 a Which is the closest to -12? (a) 1/2 (b) 5 (c) -2/3 (d) -2.9 (e) -1.2 d What is the nearest to -2 in 2, 2.9, 15? 2 Which is the nearest to 45? (a) -1/6 (b) 1/32 (c) -0.055 b What is the nearest to 0.2 in 7, -5, -1, 2.8? -1 Which is the nearest to -4? (a) -429 (b) -1/6 (c) 3 b What is the closest to -66 in -0.08, 0.2, -0.5? -0.5 What is the closest to -4/3 in 10, 0, 1/8, 2/13, 2/3? 0 What is the nearest to 0.02 in -0.12, 0.3, -2/7, -819? -0.12 What is the closest to -2/3 in -1/6, -2, -0.4, 2458? -0.4 What is the closest to 0.2 in 0.46, 3/5, -4.94? 0.46 What is the closest to -22 in 5/4, -2, -35938? -2 Which is the nearest to 3? (a) 0.5 (b) 48973/5 (c) 1 c Which is the closest to 6170? (a) -5 (b) -0.1 (c) -1/2 b Which is the nearest to -14? (a) 0 (b) 3 (c) 36 (d) -2 d What is the nearest to -0.1 in -1/2, 4/9, 7, -3/10, 4? -3/10 Which is the closest to 1? (a) 1 (b) -2/11 (c) 43 (d) 153 (e) 4 a Which is the closest to -1/6? (a) -140 (b) 2/3 (c) 0.1 c Which is the nearest to 20.1? (a) -0.6 (b) -0.1 (c) 0 (d) -4 c Which is the closest to -0.1? (a) -0.4 (b) 1116/17 (c) 3 a Which is the closest to 1/7? (a) -2/11 (b) -2/19 (c) -1/13 (d) 1 c What is the closest to -2/5 in 3, 500, -19, 5? 3 What is the closest to -4 in 0, 11, 5, -0.114? -0.114 Which is the closest to 2? (a) 14 (b) -265 (c) 1/4 c What is the closest to 0 in 0.4, 5, 0.17, -2/143? -2/143 Which is the closest to -0.08? (a) -3 (b) 94 (c) -3/8 (d) 1 c Which is the nearest to 123? (a) 0.047 (b) 4 (c) 1/5 b Which is the closest to -144? (a) -8 (b) -1.1 (c) -2/7 (d) 2/5 a What is the closest to -0.1 in -1449, 3, 0.6? 0.6 What is the closest to 0 in -1, 2, -2/33, -2/5185? -2/5185 What is the closest to 0.1 in 508, 45, 0.4? 0.4 What is the nearest to -2 in -0.03, -58, -2/19, 0.2? -2/19 What is the closest to 1 in 8, -2/13, 155/3, 2, 3/5? 3/5 Which is the closest to -2? (a) 2 (b) 1 (c) -5/17 (d) 0.03 c What is the closest to -1/4 in -125/7, -2, 0.3? 0.3 What is the closest to 2.4 in 1/7, -1/9, 1397? 1/7 Which is the nearest to 7? (a) -2 (b) -0.3 (c) 5 (d) -0.13 (e) -0.415 c Which is the nearest to 0? (a) 80445 (b) 3/4 (c) -1 b What is the nearest to 3 in 2/413, -0.3, 1/55, 3? 3 Which is the nearest to 1? (a) 0.1 (b) 50956 (c) 5 (d) 0.3 d Which is the closest to -1? (a) -7.5 (b) 26 (c) -4/7 (d) 2/3 (e) -0.3 c What is the nearest to -6 in 0.3, -5, 2, -2/15? -5 Which is the nearest to -8? (a) 0.02 (b) -4 (c) 10 (d) -2/39 b What is the closest to 2/7 in -0.045, 0.3, -18, -2/7? 0.3 Which is the nearest to -0.08? (a) -2 (b) -3/7 (c) -32 (d) -0.03 d What is the closest to 2 in 7, 449, 34/9? 34/9 What is the nearest to -10/17 in 1/3, 4/3, 0.5, 5, 0.1? 0.1 Which is the closest to 1? (a) 0.2 (b) 1/2 (c) -6 (d) 5/9 (e) 4 d What is the closest to 24.8 in -9, -1/2, -25? -1/2 What is the closest to 1/4 in 0.4, 5, -27/32? 0.4 What is the closest to 10 in -4.7454, -1/5, -5? -1/5 What is the nearest to 2/5 in -0.1, 0.13, 4/7, -4/7, -69? 4/7 What is the nearest to 2/29 in 4, -1/8, 4/3, -17, 3/53? 3/53 What is the closest to -8.6 in 4.97, 4, 1.3? 1.3 What is the nearest to -1 in -0.3, -5, -0.02252, -0.4? -0.4 Which is the closest to -0.1? (a) -1/6 (b) 1/3 (c) -34 (d) -4/13 a Which is the closest to -0.1? (a) 2/7 (b) 5 (c) -4 (d) 8/101 d What is the nearest to 0.1 in -5/8, 1/3, 2, -0.4, -0.3? 1/3 Which is the nearest to 2? (a) 91 (b) 0.01 (c) -24 b What is the nearest to 8 in -103/4, -7, 0.5, -2, -2.3? 0.5 What is the nearest to 1 in 0.253, 0.5, 3, -1/233, 5? 0.5 What is the nearest to -107 in -1, 0.3, 45, 2? -1 What is the closest to 0 in -3, 0, -39? 0 What is the nearest to -3 in 3, -2.5, 0.3, 2/3, -11? -2.5 What is the closest to 0 in 3, -3/8, -1/4, -2, -0.027? -0.027 What is the closest to 2/5 in 0, 0.31, -183? 0.31 Which is the closest to 478? (a) -0.4 (b) -1/6 (c) 0.4 (d) 0 c What is the closest to 2.1 in 2/7, -4, 0.5, -0.2, 0.1? 0.5 Which is the nearest to 1/2? (a) 15/2 (b) -0.5 (c) 3 (d) -0.2 d What is the nearest to 2/35 in 0.4, 0.077, -3, 2/17? 0.077 Which is the nearest to -0.1? (a) -3 (b) -3/5 (c) 5 (d) -3.3 (e) 77 b Which is the closest to 2? (a) 2.03 (b) -11 (c) 2 c Which is the closest to -1/4? (a) -30 (b) 1/718 (c) 4 b What is the closest to -12 in -44/39, -0.3, 5? -44/39 Which is the closest to -10? (a) 0.16 (b) 1.8 (c) -2 c What is the nearest to 2.7 in -2/3, 14, -0.04, -1? -0.04 Which is the nearest to 1? (a) -10 (b) 1 (c) -7/36 b What is the closest to -10/43 in 4, -1, -2, 12/7? -1 What is the nearest to 75 in 4, 0, -136? 4 What is the closest to -14 in 2/10879, 0.5, 2/5? 2/10879 What is the closest to -18682 in -7/2, -4, 2? -4 What is the nearest to 15/7 in -0.3, -3, -37? -0.3 Which is the closest to -1? (a) -0.165 (b) 4/3 (c) 20 (d) 14 a What is the closest to 0 in 0.36, 86, -0.2, 2? -0.2 Which is the closest to 0? (a) -0.4 (b) 0 (c) -5 (d) -3637 (e) -3 b What is the nearest to 0 in 5/2, -1/2, 0.01, 1/12, -0.1? 0.01 What is the closest to 0 in -7/3, 8, 0? 0 Which is the nearest to 2? (a) -1 (b) 2/9 (c) 15 (d) -35 b What is the nearest to -0.1 in -0.7, -5, -8, 7/5? -0.7 What is the nearest to 3469 in -2, -0.4, -0.6? -0.4 What is the nearest to 1/4 in 1/5, 130/9, -3, -0.1, 10/7? 1/5 What is the nearest to 0 in -1, -2/1981, 1/6? -2/1981 What is the closest to -0.3 in 112, 4/3, 0.09, -0.03? -0.03 Which is the nearest to -2/5? (a) -3 (b) 4 (c) 3.91 (d) -1 (e) -5/3 d Which is the closest to -1152? (a) 0.2 (b) 644 (c) -2/9 c What is the nearest to -0.1 in -0.1, 5, -0.499, 4, -1/2? -0.1 What is the closest to 1 in 32/3, 3, -1/6, -0.08? -0.08 What is the nearest to -149 in 1, -4, -2/11, 17? -4 Which is the closest to 0? (a) -3 (b) 0.055 (c) -0.79 (d) 0.2 b Which is the nearest to -0.12? (a) -2/9 (b) -2744 (c) 6 a What is the nearest to -1/85 in -1/9, -5, 2/9, 1? -1/9 What is the closest to -5 in 1/3, -3624, 5? 1/3 Which is the nearest to -5/6? (a) -2/3 (b) -5/3 (c) -783 a Which is the nearest to -197? (a) 1/3 (b) -18.3 (c) -2/13 b Which is the nearest to 1? (a) 5 (b) -18/491 (c) 14/5 b Which is the nearest to 2/9? (a) -21/11 (b) -3.7 (c) -3 (d) -2/11 d Which is the closest to -0.1? (a) -9 (b) -5 (c) 4 (d) 3 (e) 739 d What is the nearest to -1 in 116, -4, -0.2, 0.1? -0.2 What is the nearest to 0.2 in 40/21, -1, -2.6? -1 Which is the closest to 4/91? (a) -0.11 (b) 1/5 (c) 0.47 a Which is the nearest to -1? (a) 3/5 (b) 1/14 (c) -10 (d) 71 (e) 2/21 b What is the nearest to 2/9 in -3, -1, 1.78, 1? 1 What is the nearest to 1/2 in -15, -2/17, 12/103? 12/103 Which is the closest to -1? (a) 2803 (b) -1/26 (c) 0 b What is the closest to -2 in 3/10, -24, 204/5? 3/10 What is the nearest to -6 in -1/44, -1.04, 1/2, 0, -0.5? -1.04 Which is the closest to -7/2? (a) 1 (b) -2/7 (c) 0.0097 b What is the closest to 0 in -15, 16, -6, 13? -6 Which is the closest to -3595? (a) -1/2 (b)	{ "pile_set_name": "DM Mathematics" }
Let z = q - -18. Round z to six dps. 0.000001 Let n = -185.9707 + 186. Round n to 3 decimal places. 0.029 Let r = -0.5500067 - -0.55. Round r to 6 dps. -0.000007 Suppose -5m + 8m = 9. Let g(w) = 4w2 + 2 - 3w + 4w + 2w*2 - 4w*m. Let q be g(6). What is q rounded to the nearest 100? -600 Let m = 1228.64 + -1257. Let x = m - -0.56. Let z = x + 24. Round z to the nearest integer. -4 Let d = -4.67 - -3.3. Round d to one dp. -1.4 Suppose 4p - 5u - 6 = 0, -5u = 5p - u + 13. Let t be -1 + -149996 - (2 - p). Round t to the nearest one hundred thousand. -200000 Suppose -7g + 4g - 2639988 = 0. Let o be 1/(-4) + g/16. Round o to the nearest 10000. -60000 Suppose 4a - 2 = 2a. Suppose -a - 3 = -4x. Let u be ((-20000)/12)/(x/(-3)). Round u to the nearest ten thousand. 10000 Let g(y) = -y + 7. Let a be g(7). Let m be 848339/(a + 3/9). Let h = m + -245017. Round h to the nearest one million. 2000000 Suppose -119500000 = -w - 4w. Round w to the nearest 1000000. 24000000 Let t = 0.6 + -57.4. Round t to 0 decimal places. -57 Let o = 196 + -132.6. Let h = -58 + o. Round h to the nearest integer. 5 Let j = 143 + -143.00000073. What is j rounded to 7 decimal places? -0.0000007 Let y = -0.5000057 - -0.5. Let v = -0.36 + 0.36. Let u = y + v. What is u rounded to six dps? -0.000006 Let b be (0 - -1)(4 - -645). Let x(s) = s*2 - 3s - 7. Let y be x(5). Suppose -yh = b + 5351. Round h to the nearest 10000. 0 Let x = -2.73 - -1.7. Round x to 1 dp. -1 Let w = -3 - -7. Let m(q) = -26q*2 + 3 + 2 - wq - 59q2. Let b be m(-5). What is b rounded to the nearest 1000? -2000 Let l be -12(10747 - -4). Let j be l/5 - (-8)/20. What is j rounded to the nearest 1000? -4000 Let b = 89.78 + -91. Let u = b + 1.273. Round u to two decimal places. 0.05 Let b = 160362192.723 - 160508884.122973. Let v = -146692 - b. Let m = 0.6 + v. What is m rounded to five decimal places? -0.00003 Let d be (-3 - 17/(-5))(1164 - -1). What is d rounded to the nearest 100? 500 Suppose 4b - 8 = 4m, -5 = 5m + b + 5. Round m to the nearest 10. 0 Let j(h) = -55h*2 - h + 12. Let z be j(-13). What is z rounded to the nearest 1000? -9000 Let o = 0.14566 - -39.94634. Let v = o - 0.092. Let g = 40.0071 - v. Round g to 3 dps. 0.007 Let x = -94.9432 - -95. Let r = x + -0.05. Round r to 3 decimal places. 0.007 Let t = 98 - 38. Let g = t + -59.9999927. What is g rounded to six decimal places? 0.000007 Let s(i) = -1186666i + 4. Let x be s(-6). Suppose d = 5d + x. What is d rounded to the nearest one hundred thousand? -1800000 Suppose -31548 - 4952 = -5x. Round x to the nearest 1000. 7000 Let g = -0.05 + 0.04999989. Round g to 7 decimal places. -0.0000001 Suppose -a = 3b - 906, -a - 3b = 2b - 898. Suppose a = -m - 982. Round m to the nearest one thousand. -2000 Let y = 3.2 - 3.200061. What is y rounded to 5 dps? -0.00006 Let j = 2.13 + -1.4287. Let s = 11.3 + -12. Let p = s + j. What is p rounded to 3 decimal places? 0.001 Let a = 13040 + -6440. What is a rounded to the nearest one thousand? 7000 Let j = -35 + 7. Let z = 30.821 + 0.079. Let r = j + z. Round r to 0 decimal places. 3 Suppose 4v - 235 = 61. Let b be (v - -1) + 0 + -2. Round b to the nearest ten. 70 Let v = -20 + 19.986. What is v rounded to 3 decimal places? -0.014 Let i = -268 + 182. What is i rounded to the nearest ten? -90 Let r = 1.659 - 25.729. Let c = -24 - r. Round c to one decimal place. 0.1 Let d = -0.25 + -13.75. Let w = d - -13.89. What is w rounded to 1 dp? -0.1 Let p = -319.2308 + 319. Let y = 0.23 + p. What is y rounded to 4 dps? -0.0008 Let n = -26.87 + 27. Let m = 0.12998 - n. What is m rounded to 4 decimal places? 0 Let l(c) = c*2 + 3c - 1 + 6c3 - c2 - 2c*3 - 3c*2. Let q be l(2). Suppose 0 = -4o + q + 27. What is o rounded to the nearest ten? 10 Let o = 39 - 39. Round o to three dps. 0 Let r = -16.63 - -17. Let d = 0.3700059 - r. Round d to 6 dps. 0.000006 Let j = 152849869.69999986 - 152849871. Let d = -1.3 - j. What is d rounded to 7 decimal places? 0.0000001 Let n be ((-15 - 1)3)/(2/5875). What is n rounded to the nearest ten thousand? -140000 Let h = -65.331 - -65. Let r = 0.37 + h. Round r to two decimal places. 0.04 Let l = -381409224.00000007 - -381409226. Let v = -2 + l. Let k = 0 - v. What is k rounded to 7 dps? 0.0000001 Suppose 4907564 = 5s - g, 2s + 941656 = -g + 2904676. Let z be 4/(-10) - 56815116/10. Let m = z + s. What is m rounded to the nearest one million? -5000000 Let t = -8050770 + 8045695.5244. Let a = t - -5096.4755962. Let i = 22 - a. What is i rounded to 6 dps? 0.000004 Let b = 37 + -25. Let f = b + -7. Suppose -3g - 4j + 2j = -1312, 3j - 2188 = -fg. Round g to the nearest 100. 400 Let i = -8.978 - -9. Round i to one dp. 0 Let v = -3827.47 + 3811. Let h = 16.2 - 0.2. Let w = h + v. Round w to 1 dp. -0.5 Let i = 1006526 + 1729436. Suppose -4z = 4l + 3319984, 5z + 1414058 + i = 5l. Round z to the nearest one hundred thousand. -800000 Let c = -567220.41 - -587215.4156. Let x = -19988 + c. Let a = -7 + x. Round a to three dps. 0.006 Suppose 3l - p = -3059999, -4l = 2p + 1461516 + 2618486. What is l rounded to the nearest one hundred thousand? -1000000 Let n = -0.2 + 0.1. Let l = -0.042 + 0.452. Let g = n - l. Round g to 1 dp. -0.5 Let i(t) = 30t - 2. Let f be i(5). Round f to the nearest 10. 150 Let o = 142 + -142.00000071. Round o to seven decimal places. -0.0000007 Let z = 138 + -142.13. Let w = z - -184.13. Let f = w + -178.87. What is f rounded to 1 dp? 1.1 Let k be (-7 - 2)(-2)/6. Suppose -x + kx = 7800. Round x to the nearest 1000. 4000 Let p = 17 + -12. Let q = -12 + p. Let o = q - -7.003. What is o rounded to 3 dps? 0.003 Suppose 4l = 4c - 1640072, -3c - c - 5l + 1640090 = 0. Suppose 4x - c = -5t, -5t + 84234 = -4x - 325746. Round t to the nearest 10000. 80000 Let b = -0.04 - 0.012. Let u = b - -1.672. What is u rounded to 1 dp? 1.6 Let x = 262.9 + -252. Round x to 0 decimal places. 11 Let k = 20.99 + -0.19. Let q = -40.8 - k. Let d = q + 69. Round d to zero decimal places. 7 Suppose 2k + 2216 + 12985 = -z, 22795 = -3k + 5z. Round k to the nearest 1000. -8000 Let z be (1/2)/(1/2). Let d be -3 + z + 0 - -19002. What is d rounded to the nearest 10000? 20000 Let u be (-3 + -43850)(12 + -1). Let f = u - 17617. Round f to the nearest 100000. -500000 Let g = -31.909773 - -47.70971. Let c = -1.38 + 17.18. Let x = c - g. Round x to five dps. 0.00006 Let j = 0.0934 - -0.32404. Let b = -30.64356 - j. Let f = b + 31. Round f to 2 decimal places. -0.06 Suppose 0 = -t + 4 + 1. Let w be 349999/t + 7/35. What is w rounded to the nearest one hundred thousand? 100000 Let b = 0.03 - 0.18. Let z = b + 0.14982. Round z to 4 dps. -0.0002 Let w = 1.99 + 0.01. Let t = w - -2. Let h = 4.0000002 - t. Round h to 7 decimal places. 0.0000002 Let w = 29 + -28.4. Let v = -12377 - -12377.60024. Let t = v - w. What is t rounded to 4 decimal places? 0.0002 Let r = -602.9999573 - -603. What is r rounded to five decimal places? 0.00004 Let y = 285 + -184. Let q = y - 99.79. Round q to one dp. 1.2 Let v be 60/(-25) - 3/5. Let u be (45/(-6))/(v/(-43600)). What is u rounded to the nearest ten thousand? -110000 Let n = -1022.8954 - -1023. What is n rounded to two decimal places? 0.1 Let c = -50 + 51.12. Let d = 1 - c. Let f = d - 0.02. What is f rounded to one decimal place? -0.1 Let k = -9 - -9.033. Let z = k - 0.03201. What is z rounded to 4 dps? 0.001 Let n = 230 - 73. Let h = -156.11 + n. Let t = -0.42 + h. What is t rounded to 1 dp? 0.5 Let a = -7.7 + 7.62. Round a to two decimal places. -0.08 Let g = 0 + -0.02. Let l = 0.06 - g. Let a = -0.067 + l. What is a rounded to 2 dps? 0.01 Let b = 0 - -5. Let q = b + -12. Let d = q + 6.99936. What is d rounded to four decimal places? -0.0006 Let l = 0.04672 - 0.00129. Let y = l - 0.045. Round y to 4 decimal places. 0.0004 Let v = 14.55 - 4.01. Let x = v - 10. What is x rounded to 1 decimal place? 0.5 Let w = -7.1 + -2.7. Let m = -129380.257 - -129370.4570101. Let b = w - m. What is b rounded to six dps? -0.00001 Let r = -189 - -188.783. Round r to two dps. -0.22 Let c = 558 + -494.2. Round c to the nearest ten. 60 Let k(x) = x - 150. Suppose -5b = -4b - 4. Suppose -5n + h = 4h + 3, -4h = -4n + b. Let q be k(n). Ro	{ "pile_set_name": "DM Mathematics" }
-5 = 2v - 1, -2v = u + 6. Let z be -151 - (-2)/(((-2)/1)/u). Let q = z - -271. List the prime factors of q. 2, 61 Suppose -n = 5o - 202954, -4n + 3n + 40598 = o. What are the prime factors of o? 37, 1097 Let g be (-8 - -9) + -5 - (-27 - -1). Suppose -gh - 167 = -2059. List the prime factors of h. 2, 43 Let v(n) = 16n - 32. Let m be v(-1). Let s = 1400 + m. List the prime factors of s. 2, 13 Let h(a) = 7a*2 - 41a - 693. What are the prime factors of h(-30)? 3, 43, 53 Suppose 0 = -3h - 5m - 7, m = -m - 10. Let i = h + -2. Suppose iy + 17 = 101. List the prime factors of y. 3, 7 Suppose u + 19 = 5d - 1, -u - 10 = -3d. Suppose -13y + 12y = -u, -2y = -3c + 782. List the prime factors of c. 2, 3, 11 Suppose 0 = -38a + 40a - 14. Suppose 0 = 3j - a + 1. Suppose -3d - jd + 2q + 457 = 0, -2d - 3q + 198 = 0. List the prime factors of d. 3, 31 Let t(n) = n2 + 18n - 91. Let l be t(7). Let f = 0 + 0. Suppose -2r + l + 22 = f. List the prime factors of r. 53 Let u(z) = 60z*3 + 26z*2 - 116z - 51. List the prime factors of u(5). 73, 103 Suppose -3k + 7914 = -y, 4k - 10536 = -38y + 34y. Let p = k - 1478. List the prime factors of p. 19, 61 Suppose -12s = -7s + 5c + 10, -2s + 2c - 16 = 0. What are the prime factors of (84/(-8))/(s/290)? 3, 7, 29 Let g(j) be the first derivative of j4 - 2/3j*3 + 3j*2 - 10j - 5. List the prime factors of g(3). 2, 7 Suppose 80547 = 11n + 7815. What are the prime factors of n? 2, 3, 19, 29 Let l(g) = -76g - 273. Suppose 0 = 25p - p + 360. List the prime factors of l(p). 3, 17 Let g = 14042 - 7738. What are the prime factors of g? 2, 197 Suppose 0 = 2j + g - 29, 2j - 16 = -3g + 3. Suppose -k - 2542 = 14w - jw, w - 869 = -4k. What are the prime factors of w? 3, 283 List the prime factors of (90 - 87)/(3/1034 + 0). 2, 11, 47 Let r(t) = 443t + 724. What are the prime factors of r(42)? 2, 5, 1933 Let l(v) be the second derivative of -v*5/10 + 11v*4/4 - 4v*3/3 + 12v*2 + 47v. List the prime factors of l(11). 7, 181 Let n be (-8)/255/(-44). Suppose -953 + 167 = -3l. Suppose 0 = -3o + no - l. List the prime factors of o. 131 Let g(i) = i*3 + 92i*2 + 68i - 328. List the prime factors of g(-90). 2, 23, 53 What are the prime factors of (15 - -33)/161019? 3, 1019 Let o = -366 + 512. Suppose n - 2g - o = 0, 4n + g + 236 = 802. What are the prime factors of n? 2, 71 Let c = 491 + -299. Let g = 183 + c. List the prime factors of g. 3, 5 Let w be 105192/34 - ((-140)/34 - -4). Suppose -w = 2v - 16v. What are the prime factors of v? 13, 17 List the prime factors of (-518 + 2)46/(-4). 2, 3, 23, 43 Let z = 3165 - -3066. What are the prime factors of z? 3, 31, 67 Let h = 22 + -10. Suppose a + 27 = j, j - 3a - h = 9. List the prime factors of j. 2, 3, 5 Suppose 5g - 32 = 4f + 9, f - 16 = -4g. Suppose 2v = 2z - 448, z - gz + 3v = -897. List the prime factors of z. 3, 5 Let n = -36 - -39. Let a be (45/(-25))/(n/(-5)). List the prime factors of 3534/18 + 1 + (-1)/a. 197 Suppose 3x - 25 = -2n, 4n = -5x + 7 + 36. Let k(i) = i*3 + 20i*2 - 38i - 55. Let h be k(-20). Suppose xu + 12 = h. List the prime factors of u. 3, 11 Let r = 1502 - 1125. List the prime factors of r. 13, 29 Let w(v) = 1616v + 3. Let d be w(2). Suppose -5u = -4a - d, 5a - 6a + 656 = u. Suppose 11q = 4q + u. What are the prime factors of q? 3, 31 Let h(u) = 3u2 + 31u + 132. List the prime factors of h(-21). 2, 3, 67 Suppose 5z + 3h - 679 = 484, -229 = -z + 3h. Let q = 376 - 366. Suppose 0 = qt - 14t + z. What are the prime factors of t? 2, 29 Suppose 4a - 2z = -70, 0 = 5a - 2z + 41 + 44. What are the prime factors of (-7257)/a - 3/(-15)? 2, 11 Suppose -4y - 2y = 0. Let h(u) = u2 - u + 5. Let j be h(y). Suppose 178 = l + jo + 54, 5o + 74 = l. List the prime factors of l. 3, 11 Suppose -k = 3t - 3506, 4k - 4664 = -6t + 2t. Suppose 0 = -207y + 212y - t. What are the prime factors of y? 2, 3, 13 Suppose 734t = 543t + 11440709. List the prime factors of t. 7, 43, 199 Let i be -1((-6)/3 + 0) + -10. Let u be (-1)/(-2) - 36/i. What are the prime factors of (-1 + u)/(2/33)? 2, 3, 11 Suppose -13h - 52 - 117 = 0. What are the prime factors of (h + -1946)(-7)/21? 653 Suppose -722998 = -26a + 278334 + 50628. What are the prime factors of a? 2, 5, 7, 17 Let s(t) = 86t*2 - 167t*2 - 16 + 82t*2. Let x be s(4). Suppose -2q = -4g + 3q + 509, x = 4g + q - 479. What are the prime factors of g? 11 Let p(l) = 2l*3 + 207l*2 + 106l - 362. List the prime factors of p(-102). 2, 43, 233 Let m = 3216 - -16632. List the prime factors of m. 2, 3, 827 Let y(w) = w*3 - 4w*2 - 4w - 2. Let c be y(5). Let n be 1128/18 + (-2)/c. Let p = -24 + n. List the prime factors of p. 2, 19 Suppose -6l + 8 = -5l. Let z be ((-2)/l)/((-5)/40). Suppose -q + 80 = -z. What are the prime factors of q? 2, 41 Suppose 778 - 770 = 2y. Suppose 0 = yr + 4k - 5008, k + 4 = -0k. What are the prime factors of r? 2, 157 Let b(h) = 589h2 - h - 1. Let i be b(1). Let g = i + -273. List the prime factors of g. 2, 157 Suppose -k + 113 + 30 = 0. Suppose 0 = -3s + b + 82, -5s - 7b + 110 = -2b. Let z = k - s. List the prime factors of z. 3, 13 Let t = 7432 + -4009. Suppose 5i - 1202 = t. Suppose -i = -5f - 0d + 5d, 0 = 3d - 15. What are the prime factors of f? 2, 5, 19 Let n(u) = -2u3 - u2 + 1. Let f(p) = -29p3 + p2 + 6p + 1. Let l(z) = f(z) - 2n(z). What are the prime factors of l(-3)? 683 Let c = -47238 + 91117. What are the prime factors of c? 11, 3989 Suppose -4s - j + 28 = 0, -s - 3j + 7 = -0s. Suppose 4d - y = 410, -d + 4y = -88 - s. What are the prime factors of d? 103 Suppose -9 - 9 = 2t. What are the prime factors of t/(-15) + 2644/10? 5, 53 Let m = -6585 + 9339. What are the prime factors of m? 2, 3, 17 Suppose -9v - 11v = -21729 - 74171. What are the prime factors of v? 5, 7, 137 Suppose m = 4m. Suppose -3w - 6 = m, 5p + 682 = -2w + 2018. What are the prime factors of (-1)/(4 - 1076/p)? 67 Let r = 39845 - 15882. List the prime factors of r. 31, 773 Let p(v) = -1122 + 1084 - 18v - 8v - v*2. Let b be p(-22). Suppose -63 = -y + b. What are the prime factors of y? 113 What are the prime factors of (42 - 46) + (-7)/((-14)/1168)? 2, 5, 29 Suppose 256b - 258b = -4858. What are the prime factors of b? 7, 347 Let s = 3168 + -614. Suppose 3v = 2g + 1580, 5v - 3g - s = 78. What are the prime factors of v? 2, 131 What are the prime factors of (1471/(-4))/(3/(-72)3)? 2, 1471 Let l(p) = -p*3 - 2p*2 - 3p - 3. Let s be l(-1). List the prime factors of (27/18)/(s/(-242)). 3, 11 What are the prime factors of (21419/3)/(2280/(-72) + 32)? 21419 Let u(h) be the third derivative of -h*6/120 + 7h*5/60 + 7h*4/24 + 7h*3/6 + 7h*2. Let d be u(8). List the prime factors of 1((-15)/d - 3). 2, 3 Let z be ((-56)/(-6))/((-17)/25959). Let j be (-4)/(-24) - 2/(48/z). Let o = -298 + j. List the prime factors of o. 2, 37 Let s = 140 - 139. Let p be 10/4(2 + 18/(-15)). What are the prime factors of 3/(s + p) + 107/1? 2, 3 Let y = 53 + -32. Let n = y - -91. Suppose 3w - n = -w. List the prime factors of w. 2, 7 Let c(g) = 5g - 8. Let k be c(3). Suppose -kh = h + 432. List the prime factors of (-6)/(-4)(-576)/h. 2 Let l = -625 + -1269. Let y = -887 - l. What are the prime factors of y? 19, 53 Suppose -260 = 8b - 396. Let w(m) = 3m2 - 7m + 5. Let a be w(6). Suppose -v + b = -a. What are the prime factors of v? 2, 11 Let l = 7642 - -549. List the prime factors of l. 8191 What are the prime factors of -16(-12 + -56 - 11)? 2, 79 What are the prime factors of (21/4 + -4)5492? 5, 1373 Let l be (3-35)/(-5) + 3. Suppose -5z = -9z + l. List the prime factors of -6 - (-12)/z - (-464)/2. 2, 3, 19 Let g(p) = 933p - 871. List the prime factors of g(10). 11, 769 Let x = -30 - -38. Suppose -2d + 8 = x. Suppose 4z + 85 - 401 = d. What are the prime factors of z? 79 Let l(s) = 3s2 - 6s + 14. Let g be l(3). Let t = 43 - g. Let y = t - -63. List the prime factors of y. 83 Let p(d) = 5d + 240. Let k be p(-45). Suppose 21j = -kj + 28872. List the prime factors of j. 2, 401 Suppose 4a + 16 = 2d, a = -2d + 2*a + 4. Let s be -1 - 1480/(d - -2). Let n = -521 - s.	{ "pile_set_name": "DM Mathematics" }
maller: 1 or h? 1 Let x = -3 - -2. Let o be 29/(-6)1/3. Do o and x have different values? False Let s be 2/4-2 + 0. Let r = s + 1. Let q be (6/8)/(90/80). Which is smaller: q or r? r Let i be 4 + 1 + (-2)/(-1). Let f(l) = l3 - 3l*2 - 3l + 1. Let z be f(3). Let b = z + i. Which is smaller: b or 2/11? b Let m be (2/5)/((-9)/(-45)). Is m >= 1/13? True Let g = 31/2 + -16. Let y(l) = -l*3 + 5l*2 + 7l - 2. Let u be y(6). Let q = u - 5. Does g = q? False Let b = 0.11 - 7.11. Which is greater: 1 or b? 1 Let x = -0.19 + 0.19. Let m(w) = w3 - w2 - 3w + 2. Let g be m(2). Is g >= x? True Let b = 67 + -16. Let a be b/207 - (-2)/(-6). Are a and 1 unequal? True Suppose -2n + 2r - 2 = 0, 4n = n + 2r - 2. Does 1/62 = n? False Let s = 104 - 68. Suppose 0 = 4t - t + s. Let g be 0 - 0 - (-18)/t. Are -1 and g non-equal? True Let x = -15 - -7. Let d be (-2)/8 + (-2)/x. Let y be (1 + d)0/(-1). Which is greater: 1 or y? 1 Let m = 8.9 + -0.9. Do m and -2/13 have the same value? False Let y = 133 + -133.091. Is 0 less than or equal to y? False Let a = 3 - 6. Suppose 5 = 5d - 5. Let t be 4(-1)/(-4) - d. Does t = a? False Let g be (-1)/4 + (-24)/32. Is g != -1/15? True Let p = 1091/9 + -121. Which is smaller: p or 0.12? 0.12 Let p be 2 + 2 + -3 + 1. Suppose pl - 5a - 33 = 0, -2l - 4 = 2a - 2. Suppose 2c - 4 = l. Which is greater: 3 or c? c Let g = 8 + 2. Suppose 0 = 5w + 4j + 5, -5w + 3j - 4j + g = 0. Suppose -h = -wh. Is -2/15 <= h? True Let y = -177 + 176. Let d = 10 + -10.7. Is d bigger than y? True Let i be (2 + -4)/(4/(-2)). Let o = i + 1. Suppose 2s = -0s + o. Which is smaller: -2/7 or s? -2/7 Let v = -4 - -3.4. Let m = v - -2.6. Is m at most as big as 0? False Suppose 0v - 2j = 3v + 596, 0 = -v - 2j - 204. Let r be 7/v + (-2)/(-7). Are -2 and r nonequal? True Let p = 17 - 18. Which is smaller: 2/5 or p? p Let s(r) = 2r2 + 5r. Let o be s(-5). Let t be (-8 - -7) + o/23. Is t greater than or equal to 0? True Let u be (48/(-28))/(6/42). Is -1 at most u? False Suppose -u = -5z + 12, 5 = 4z - u - 5. Let x be ((-9)/(-6))/((-3)/(-4)). Are x and z equal? True Let n be (4/(-10) + 8/(-30))3. Suppose 0 = -2o + 2 + 2. Suppose -7 = -5a + 2j - 4, oa - 10 = 3j. Which is bigger: a or n? a Let d = -53/4 - -13. Suppose -2k + 4 = 2k. Do k and d have different values? True Suppose -4n = -7n. Which is smaller: n or -4/11? -4/11 Suppose 0 = 16n - 10n + 72. Is -12 greater than or equal to n? True Let j(i) = -i*3 - 17i*2 + 16i - 43. Let v be j(-18). Which is smaller: -15/2 or v? -15/2 Suppose 3k - 16k = 13. Is 2 <= k? False Let j(s) = s + 6. Let l be j(-6). Suppose 0 = -2k - 2, 5k = -x + k - 4. Let n be (-2)/9 - (0 - x). Is n < l? True Let d(s) = 0 - 3 - s + 4. Let k be d(1). Is k at most as big as 0? True Suppose -2w + 16 = 2w. Which is smaller: w or 14/3? w Let z be 110/6 + (-2)/(-3). Suppose 4n + z = -p, -6p = -2p - 2n - 14. Are p and 2/9 nonequal? True Let l = 67 + -203/3. Suppose 0 = f + 5g + 12, 3f - f - g + 2 = 0. Is l less than or equal to f? False Let f = 18 + -23. Suppose -p = -0p - 12. Let b = -17 + p. Is f >= b? True Let c be -2 + 4 + -5 + 244/82. Which is smaller: c or 1? c Suppose 2l + 5 = -3f, -2l - 2f - 1 = -3l. Let w = -2 + l. Which is greater: w or -4? w Let v be (36/8)/(3/4). Let a be (-2)/(-5)(-10)/v. Which is smaller: 0 or a? a Let f = -27 - -111/4. Suppose 0 = 2x + 5a + 21, -x - 12 = -2x + 5a. Let m be 2/((-1 - 5)/x). Which is smaller: m or f? f Suppose 2w = 4x - 38, 6w - 2w + 58 = 2x. Which is smaller: -1/3 or w? w Let q = -0.11 + 0. Let h = -2.11 - q. Is 5 at most as big as h? False Let r be 2/9 - 92/90. Which is bigger: r or 0? 0 Let a be (2/40)/(4/(-24)). Which is smaller: 0 or a? a Suppose 54t = 61t - 280. Which is bigger: 41 or t? 41 Let x be (0 - 1/(-3))-3. Let w(v) = -v - 12. Let t be w(-12). Is x less than or equal to t? True Suppose l = f + 1, 9f - 5 = 4f. Suppose -5q + 105 = -lq. Suppose q = -5m - 5. Is m < -7? True Let b be -3(-5)/2852. Is b > 5? False Let c = 433/2 - 221. Let w = -15 - -19. Suppose wi = 8i + 20. Is i less than or equal to c? True Let v be (-4)/18 - 204/(-432). Which is greater: v or 3.9? 3.9 Suppose h + h - 18 = 0. Suppose -hk = -6k. Let w be (-4)/32/(-8). Which is greater: w or k? w Let v(p) be the second derivative of p4/12 + 2p*3/3 - 3p*2 + p. Let q be ((-4)/6)/(14/105). Let w be v(q). Which is smaller: w or -2? -2 Let l = -0.81 - -1.81. Which is smaller: l or 0.096? 0.096 Let p = 41/3 + -281/21. Let i = 0.038 + -8.038. Is i greater than p? False Let w be 1 - (-1)/3-3. Let p be 1/5 + (-655)/25. Let r be 4/p + 58/(-130). Which is smaller: w or r? r Let l = -54 + 13. Is 2/5 greater than or equal to l? True Let c(n) = n*2 - 6n + 3. Suppose 0 = 2j - 7j + 5, -5p + j = -19. Let i be c(p). Is -3 <= i? False Let a be ((-5)/(-15))/((-2)/30). Let h be a/(-4) + (-5)/20. Which is bigger: 5/7 or h? h Let a = -4 - -8. Is -1/3 < a? True Suppose 6z = 3z + 24. Let x be ((-1)/10)/(4/z). Which is smaller: x or -2? -2 Let g(p) = p2 + 7p + 6. Let h be g(-5). Let k be (0 - 3 - h)6. Is 6 at least k? True Let o(g) = 2g*2 + g. Let h be o(-2). Suppose i - hi = 0. Suppose 3w + w = i. Do w and 1/2 have the same value? False Let m be 1/(-2)16/14. Suppose -j - 3h = h + 5, -2h - 5 = 3j. Which is bigger: m or j? m Suppose 2d + 5o + 1 = 0, 3d + o - 5 = -0o. Let r be (6/(-4))/(3/(-30)). Let i be 4/6 - 16/r. Are d and i equal? False Suppose 0 = -j + 39 - 17. Let g be 18/j - (-6)/33. Let d = -3 + g. Is d smaller than -2? False Let n = 16 - 20.7. Let a = -5 - n. Let k = 0.2 + a. Does 0.2 = k? False Suppose 7y + 6 + 1 = 0. Is -4 less than or equal to y? True Let u(r) = -r + 8. Suppose 5n - 38 = -8. Let p be u(n). Let w be (-5)/p(6 - 4). Are w and -1/2 unequal? True Let x(o) = -2o - 5. Let c be x(-3). Let t be 3/12 - (-86)/(-408). Which is smaller: t or c? t Let t be -2 + -2 + 4/1. Let x be (-1 + 2 + -2)-1. Let f = t + x. Is -3/10 smaller than f? True Suppose -f + o + 2 = 0, 0 = 3f + 2f + o + 14. Is f >= 0? False Let n = -28 - -28. Is n at most as big as -0.11? False Suppose -4 = -3s - 7. Suppose 5t = 4t + 5p + 36, -t + 6 = 5p. Let l be (-9)/t(-1 + 2). Is l not equal to s? True Let f be 232/(-12) + (1 - 3). Let y = f - -20. Let p = 0 - 0. Is y >= p? False Suppose 4t - 3j = -4, -4t - 7j = -3j - 24. Suppose -2x - 22 = 5q, -5x - 21 = tq + 2q. Which is smaller: q or 1/3? q Suppose -3z = -8 - 82. Let q = 59/2 - z. Is q equal to -1? False Suppose 364 + 186 = -10i. Is i bigger than -55? False Let u(z) = -2z - 7. Let q be 10/41-2. Let s be u(q). Suppose -3g = 4j - 21, sg + 6j = 3j + 18. Is -0.1 bigger than g? False Let x = 1/137 + -1240/959. Is -1/3 <= x? False Let c(s) = -4s + 8s - 3 - 3s. Let f be c(3). Let b = 53/2 - 26. Is f less than b? True Let f = -21.757 + -0.143. Let n = 22 + f. Is n at least as big as 9? False Let l = -0.11 + -2.09. Let y = l - 0.8. Let b = y + 3.3. Is 2 greater than or equal to b? True Let p = -2.2 - -1.2. Which is bigger: 60 or p? 60 Suppose -2 + 7 = -b, 0 = -r - 4b - 48. Let u be 1/2 + r/8. Let w be u/44/(-6). Is -3/5 < w? True Let z = 1.001 + -0.001. Is -0.15 bigger than z? False Let i = 1571/11 - 143. Are -0.2 and i unequal? True Suppose 4l - 7 - 9 = 0. Let q be (-1)/6-32 - 2/6. Does l = q? False Let r be (-1 + -2)(14 + -13) + -3. Is r <= -3? True Let x = 6.4 + -0.4. Is -2/3 greater than x? False Let m = -45.2 + 45. Is -30 greater than m? False Let q = -7873/1270 + -1/1270. Which is smaller: -7 or q? -7 Suppose 0 = 2s - 2 - 4. Let u be (-1)/s0 - 3. Let p = 4 + u. Which is smaller: p or -2? -2 Let p(k) = -k*3 - 6k*2 - 4k - 3. Let w be p(-5). Let i be 2/10 + w/(-10). Is 2/15 greater than i? False Suppose 4c - 3 = -3o, -1 = -0c + 3c - o. Which is smaller: c or 12/11? c Let y be ((450/(-4))/3)/12. Let d = -458977/24 - -19127. Let j = y + d. Is j less than or equal to -1? False Suppose 5r = 6 - 1. Let q be (-2)/6(2 + r). Which is greater: q or -1/10? -1/10 Suppose 0 = 8*p + p + 36. Is -0.3 != p? True Let f be -5 + -7 + 0 + -1. Is -40/3 greater than or equal to f? False Let a = 9.7 - 8. Let u = a - -6.3. Let b = u - 8.1. Which is smaller: 2 or b? b Let a be -1 + -	{ "pile_set_name": "DM Mathematics" }
Suppose 5r + 5o = -20, r + 5 = -0r - 2o. Let k = 20 + -35. Let h = r - k. What is the tens digit of h? 1 What is the hundreds digit of (-42)/(-9)393 + -2? 8 Let v(y) be the second derivative of -9y*3/2 - 19y*2 - 16y. What is the units digit of v(-9)? 5 Suppose t + 0 = -5, 2z + 5t - 4201 = 0. What is the hundreds digit of z? 1 Let b(r) = r*2 - r + 3. Let p = 12 + -9. Let j be p/3 - -7 - 3. What is the units digit of b(j)? 3 Suppose -3q = 28 + 29. Let j = q + 20. What is the units digit of j? 1 Let z = 7 + -4. Suppose 0 = -4w + a + 186, 2w + za + a - 102 = 0. What is the units digit of w + (3 + 1 - 4)? 7 Let b be 1312/(-12)(-12)/(-8). What is the units digit of 1 - -2 - (b + -5 - 2)? 4 Let t be 26/(-7) - (-6)/(-21). Let y(p) = 14p2 + 8p + 12. What is the units digit of y(t)? 4 Let d = 431 - 230. Suppose -8m + d = -1191. What is the tens digit of m? 7 Let h(r) be the first derivative of 3r*2 + 3r + 4. Let f be h(3). What is the tens digit of f((1 - 2) + 3)? 4 Let h(v) = v2 + 2v - 49. What is the tens digit of h(-12)? 7 Let h(k) = -2k2 - 66k - 10. What is the units digit of h(-14)? 2 Suppose 14h = 90 - 454. Let d(w) = w3 + 27w*2 + 22w + 32. What is the hundreds digit of d(h)? 1 Let k be 82 + -2 + (1 - 1). Suppose -2t + t + k = 0. What is the units digit of t? 0 Suppose -2m = -497 - 325. What is the units digit of m? 1 Let m be (-68)/(-18) - 3/(27/(-2)). Suppose 2c + 9k - 186 = 4k, mc + 4k = 348. What is the tens digit of c? 8 Let y = 4 + 38. Suppose -y = -o - 2o. What is the tens digit of o? 1 Let r be (-6)/(-10) + (-2)/(-5). Let k(i) be the second derivative of 11i4/6 + i3/6 + i. What is the tens digit of k(r)? 2 Suppose -1152 - 1089 = -9h. What is the hundreds digit of h? 2 Let y(p) = 2p2 - 31p - 134. What is the tens digit of y(23)? 1 Suppose 21c - 357 - 84 = 0. Let l be 78/(-8) - 2/8. Let a = c + l. What is the tens digit of a? 1 Suppose -2 - 7 = -3n. Suppose m = -nm + 72. What is the tens digit of m? 1 Suppose j + 5s + 3 = 0, -j + s - 5 = -2j. Suppose ju + u = 720. What is the tens digit of u? 9 Let d be 0 - 0 - (-12 + -8). Suppose 0u + 2u = d. What is the tens digit of u? 1 Suppose 0 = -3i + 7i - 4. Suppose 4c = 5k - 17, i + 4 = 3k - 5c. What is the units digit of k? 5 Suppose 2k - 2j = -3k + 717, -4j + 568 = 4k. Suppose 3l + 115 + k = 2r, -l = 0. What is the hundreds digit of r? 1 Suppose -5k - f + 16 = -5f, -3k - f = -13. Let q be (-8)/(-28) - k/14. Suppose 3y + 2x - x - 5 = q, 2y - 3 = -x. What is the units digit of y? 2 Let n(p) = 114p + 126. What is the units digit of n(9)? 2 Let c(h) = -22h3 + h2 - 39h - 96. What is the tens digit of c(-6)? 2 Suppose -10n = -35139 + 2069. What is the hundreds digit of n? 3 Suppose -2c = -6c. Suppose cr + 172 = -3r + t, -r - 3t - 44 = 0. Let j = r + 78. What is the tens digit of j? 2 Let w = 49 + -40. Suppose -18 - w = -r. What is the units digit of r? 7 Let r = 102 + -47. Let m = r + 22. What is the units digit of m? 7 Let t = 52 - 23. Let m be t - (1 - 1) - -1. What is the units digit of 80/m - 2/(-6)? 3 Suppose 6a - 2968 = 1250. What is the tens digit of a? 0 Let y(h) = 2 + 2 - 2 + h2 - 2h. Let p(d) = d*2 + 13d + 27. Let f be p(-11). What is the units digit of y(f)? 7 Let g be (-24)/10110/(-4). Let l(m) = -m*3 + 16m*2 - 12m - 1. What is the tens digit of l(g)? 8 What is the hundreds digit of ((-156)/(-130))/((-1706)/1710 - -1)? 5 Suppose 0 = -13z + 4304 + 2131. What is the tens digit of z? 9 Let p be 5 - 3 - (-444)/2. Suppose -9d + 13d - p = 0. What is the units digit of d? 6 Let h(i) be the third derivative of -i6/120 + 7i*5/30 - 5i*4/8 + 8i*3/3 - 4i*2. Let k be h(13). What is the tens digit of (-2)/4 + (-195)/k? 1 Let a(j) = 2j - 1. Let g be a(2). Let r be 114(g - (-16)/(-6)). Suppose l + 63 = 3b - r, -3b - 2l + 104 = 0. What is the tens digit of b? 3 Let k be (-13 + 5)/(-1 + 0). What is the tens digit of k/(-16) - 83/(-2)? 4 Suppose 0 = -4h - 2p + 486 + 3258, p = 2h - 1872. What is the tens digit of h? 3 Suppose -2m = -4m - 8. Let w(f) = -f3 - 3f*2 - 5f - 6. What is the tens digit of w(m)? 3 Suppose 0o - 3o + 32 = -5x, 4o - 36 = 5x. Suppose of - 603 = 5r, -f + 4r = -5f + 576. What is the hundreds digit of f? 1 Let p(y) = 2y*2 + 7y + 6. Let a be p(-4). Let m be 0/(4(-5)/a). Suppose m = -8f + 36 - 4. What is the units digit of f? 4 Suppose 0 = 823t - 816t - 952. What is the hundreds digit of t? 1 Let t(m) = -2m3 - 4m*2 - m. Suppose 3 = 2x - 3g, g - 3g = -2x. What is the units digit of t(x)? 1 Suppose -w + 2k + 3738 = 1265, -2w + 3k = -4951. What is the thousands digit of w? 2 Suppose -3y = -2r - 4, -3y = 2y + 4r - 36. Suppose 5h = 7h - y. Suppose -hq + 69 = -9. What is the tens digit of q? 3 Suppose y = a + 7, 0 = -y + a - 4a - 1. What is the units digit of 6/((-2)/y - -1)? 0 Let r = 21 - 19. Suppose 2s - 10 = -rc - 3c, -4c + 36 = -4s. Suppose ck = 2j - 4j + 34, -j + 4k - 7 = 0. What is the units digit of j? 9 Let i be (-96)/(-4) + (-6)/3. Suppose -3 + i = g. Suppose 0t = -o - 3t + g, 14 = o + 2t. What is the units digit of o? 4 What is the tens digit of 23 + -22 - (-442)/1? 4 Let i(b) = 1712b + 86. What is the tens digit of i(1)? 9 Let d(a) = -19a + 25. Let q be d(-5). Let x = -65 + q. What is the units digit of x? 5 Let d(l) = -l3 + 34l*2 + 29l + 187. What is the units digit of d(33)? 3 Suppose n - 4n = 0. Suppose -4g = 4r - 3r - 5, -2r - 2g + 4 = n. Let m(l) = 3l. What is the units digit of m(r)? 3 Suppose -4f - 9 = -3f. What is the units digit of (-79)/f - 16/(-72)? 9 Suppose 7v = 2366 + 2310. What is the hundreds digit of v? 6 Suppose 0 = 2b - 4, 4c - 2b - 264 = -0c. Suppose -h + 187 - c = 3g, 5h = 2g + 634. What is the units digit of h? 6 Suppose 3g + 11094 = 3q, -q + 3146 = 3g - 552. What is the thousands digit of q? 3 Suppose 3c - 4c + 36 = 0. Suppose j - 4j + c = 0. What is the units digit of -1 + j - (-1 - -1)? 1 Suppose -22n = -17n - 3235. What is the hundreds digit of n? 6 Let d(s) = -s3 - s2 + 4s + 1. Let n be 2/((-14)/4 + 3). What is the units digit of d(n)? 3 Suppose 4q = 4r - 1932, 17q - 18q - 963 = -2r. What is the hundreds digit of r? 4 Let m(t) = 2t - 10. Let c(w) = -2w + 10. Let y(f) = -5c(f) - 6m(f). Let s be y(6). What is the tens digit of 141/11 - s/11? 1 Let m(l) = -4l + 91. What is the tens digit of m(8)? 5 Suppose c - 76 = 3q, -3c - q = -4q - 216. What is the units digit of 1c/2 - 3? 2 Let v(m) = -m - 7. Let d be (2 + 28/(-8))6. Let x be v(d). Suppose 4c - xf - f = 100, -3c = -4f - 68. What is the tens digit of c? 2 Suppose -1721 = -3n - 2s, -5n + 2964 - 102 = -3s. What is the tens digit of n? 7 Let s(r) = -r2 + 18r + 23. Let j(i) = -i*2 + 6i + 2. Let v be j(6). Suppose vy = -3y + 4o + 96, 4y - 72 = 2o. What is the tens digit of s(y)? 5 Let y(c) = -2c + c + c + 24 - c. What is the units digit of y(16)? 8 Suppose -p - 5l + 3l = -249, 2l = -2p + 496. Suppose 5y = h + 1244, 0h = -y + 2h + p. What is the hundreds digit of y? 2 Suppose g = -3g - 2b + 254, g + b = 65. Suppose 0 = 2a + g - 626. What is the units digit of a/30 - 2/5? 9 Suppose 5398 = 29c - 3592. What is the tens digit of c? 1 Let v(t) = -3t*3 - 6t*2 + 5t. Let b be 2 + (2 + 2 - -1). Let a(f) = -f*3 - 2f*2 + 2f. Let d(h) = ba(h) - 2v(h). What is the units digit of d(-5)? 5 Suppose -2l - 3l = 5x + 60, 2l - 2x + 24 = 0. Let r = 24 - l. Suppose 0 = 2h - c - r, -2h + 5c + 0c = -36. What is the units digit of h? 8 Suppose f - 3l = 744, 0 = -0f + 2f + 3l - 1452. What is the units digit of f? 2 Let t(g) = -g3 - g2 + 4g + 6. Let h be t(-5). Let l(c) = -c*2 - 8c + 3. Let b be l(-8). Suppose 0 = -bn + n + h. What is the units digit of n? 3 Suppose j + 512 = x, 0 = -3x - 2j + 1808 - 277. What is the units digit of x? 1 Suppose 4 = -i - 2. Let p(b) = 2b*2 + 3b - 16. What is the units digit of p(i)? 8 Let u(a) = a*2 + 5a + 7. Let v(h) = -h*2 - 6h - 8. Let b(o) = -5u(o) - 4v(o). Let g be b(3). What is the units digit of (-8 + -3 + 7)*g? 0 Let f be (4/(-5))/(22/1595). Let w = f + 261. What is the units digit of w? 3 Supp	{ "pile_set_name": "DM Mathematics" }
7 = 2t, 0 = qt + 3r - 135. What is t rounded to the nearest ten? 50 Let z = 2620.6396478 + 0.1731522. Let b = z - 2575.812881. Let l = -45 + b. What is l rounded to 5 decimal places? -0.00008 Let w = 32.2 + 5.8. Let v = w - 30.6. Round v to 0 dps. 7 Let i = -1.87 - -1.8. Let h = 0.0721 + i. Round h to 3 decimal places. 0.002 Let v = 3 + -2.9. Let x = 0.0999957 - v. Round x to six dps. -0.000004 Let b = -30.021 - -30. Round b to two decimal places. -0.02 Let m be (0 + 0)2/(-4). Let s be (m - 0) + 3 + 127996. Suppose 2b + 2b - r + s = 0, 127996 = -4b + 4r. What is b rounded to the nearest 10000? -30000 Let t(d) = -131d2 + 11d - 10. Let f be t(10). What is f rounded to the nearest one thousand? -13000 Let r = -502.8981 + 502.82909942. Let i = 0.069 + r. What is i rounded to 7 dps? -0.0000006 Let x = 2838375.99858 + -2838408. Let m = -32 - x. Round m to four decimal places. 0.0014 Let m = -4.051 + 0.391. What is m rounded to 1 decimal place? -3.7 Let o = -0.0489 + -87.3511. Round o to the nearest 10. -90 Let g = -63.946 - -64. Let j = 12.146 + g. What is j rounded to 0 dps? 12 Let y = -8.5 + 8.5101. What is y rounded to three dps? 0.01 Let c be (2 - (-16)/(-10))215. Let s be (-32)/(-40)10/4. Suppose -c = -a + sa. Round a to the nearest 10. -90 Let u = 6 - 9. Let a = -1.08 - u. What is a rounded to one decimal place? 1.9 Let h = 45960.5 + -45962.056696. Let y = -0.143234 + h. Let q = y + 1.7. Round q to 5 decimal places. 0.00007 Suppose 5g = 521792 - 1521792. Round g to the nearest 100000. -200000 Suppose -3a + 16 = a. Suppose 3y + 79991 = -ap, -3p - 3y + 34722 = 94713. What is p rounded to the nearest 10000? -20000 Let q = -6.70068 + 6.7. What is q rounded to four decimal places? -0.0007 Let z = -0.31 - 21.99. Round z to zero decimal places. -22 Let y = 19119328.69999993 + -19119329. Let m = y - -0.3. What is m rounded to seven dps? -0.0000001 Let k = -118 + 117.999939. What is k rounded to five dps? -0.00006 Let l = 6 + -16. Let q be (-16808)/20 + (-4)/l. What is q rounded to the nearest one hundred? -800 Let c = -0.31 + 2.29. Let a = c + 0.02. Let l = a + -3.6. Round l to the nearest integer. -2 Let v be 41(-4)/((-32)/(-516)). What is v rounded to the nearest 10? -260 Let k(q) = 165q*3 + 23q*2 + 4q + 16. Let c = -27 + 11. Let a be k(c). Round a to the nearest one hundred thousand. -700000 Let c = 16.8 - 16. Let m = -0.799981 + c. What is m rounded to five dps? 0.00002 Suppose 3i = -0 + 24. Let o = -3 - i. Let d be 1/1 - o9. Round d to the nearest one hundred. 100 Let n = -22.29 - -27.296. Let i = 4.3 - -0.7. Let l = i - n. What is l rounded to two dps? -0.01 Let m be (0(-3)/(-9))/1. Let a be 2 - (-8 + m + -1). Suppose b = -2h - 122, h = 3b + a - 72. Round h to the nearest 10. -60 Let s = -82.7 + 127. Let m = s - 47. Let r = 2.70000042 + m. What is r rounded to seven decimal places? 0.0000004 Let c = 53.3 - 60. What is c rounded to the nearest integer? -7 Let k = 104.5007 + -104.30069935. Let o = 0.2 - k. What is o rounded to seven decimal places? -0.0000007 Let n = 0.9 + -1.6. Let r = n + 0.76. Round r to one decimal place. 0.1 Let k = -869.00001421 - -869. Round k to 6 dps. -0.000014 Let n = 1327 + -1327.0827. What is n rounded to two dps? -0.08 Let u = 181783.053 + -181891. Let k = u + 108. Let y = k + -0.0468. Round y to 3 decimal places. 0.006 Let g(y) = 43y*2 + 3y + 4. Let m be 2 + 0 + -2 + 3. Let v be g(m). Round v to the nearest one thousand. 0 Suppose 4w + 0w - 584977 = -3n, -w + 389983 = 2n. Let c be 12/(-20) - n/15. What is c rounded to the nearest 10000? -10000 Let f = -0.29 - 2.31. Let j = 2.60026 + f. Round j to four dps. 0.0003 Let c(l) = -l*2 - 4l - 1. Let g be c(-4). Let v be g + 938 + (1 - 3). Suppose -2q - 2k - 914 = 0, -2q + 2k = -3k + v. Round q to the nearest 100. -500 Let j(b) = b2 - 2b + 2. Let r be j(2). Suppose 5l + 5y = rl - 9025, -y + 11995 = -4l. What is l rounded to the nearest 1000? -3000 Let b = -99 - -99.00000041. What is b rounded to seven dps? 0.0000004 Let u be 8/28 + 68/7. Suppose -4t + 7t = -b + u, 5t - 30 = -5b. Let q be 4901(1 - t) - -1. Round q to the nearest 1000. -5000 Let i(h) = -h2 - 8h + 3. Let s be i(-7). Let q(u) = 8u3 + 2u*2 - 10u. Let r be q(s). What is r rounded to the nearest one thousand? 8000 Suppose 5n - 202 = -3c, -n = -4c + 149 + 82. Let r = 130 - c. What is r rounded to the nearest ten? 70 Let y = -15.047 + 0.616. Let p = y + 0.131. Let u = p - -14.29999943. Round u to 7 decimal places. -0.0000006 Let t = -10 - 0. Let s = 10 - t. Let j be -112s/8. Round j to the nearest 100. 0 Suppose -4v + 7399994 = -6v - 2t, -11099985 = 3v + 5t. What is v rounded to the nearest 1000000? -4000000 Let p = -524 - -637.5. Round p to the nearest 10. 110 Let x = 15.35 + -0.35. Let a = x - 14.998. What is a rounded to two decimal places? 0 Suppose -3i - 2n - 35 = 0, -5n = 4i + 16 + 26. What is i rounded to the nearest 10? -10 Let t = 9.0000023 - 9. What is t rounded to six decimal places? 0.000002 Let h(i) = -i*2 + 7i + 11. Let w be h(8). Suppose 2o + 7a - wa = 378, 3a - 193 = -o. Let d = 81 - o. What is d rounded to the nearest ten? -100 Let h(u) = -13 - 106u2 - 3u + 7 + 365u2. Let q be h(-9). Round q to the nearest ten thousand. 20000 Let c = -2.7 - -2.695. Round c to 3 decimal places. -0.005 Let v = -4.993 - -5. What is v rounded to two dps? 0.01 Let m = -248.00107 - -248. What is m rounded to four dps? -0.0011 Let z = 61 + -61.00053. Round z to four decimal places. -0.0005 Suppose -5g + 1424061 = 119061. Round g to the nearest 10000. 260000 Let n = 0.49414211 - 0.05413471. Let r = 0.33 + 0.11. Let l = n - r. Round l to six decimal places. 0.000007 Let g = 715442.69 + -719261. Let b = -3783 - g. Let w = 35 - b. What is w rounded to one dp? -0.3 Let r = 1.300048 + -1.3. Round r to five decimal places. 0.00005 Let c = 0.04 + 0.46. Let v = c + -0.49925. What is v rounded to four decimal places? 0.0008 Let v = -85918411152 + 85918226252.400002. Let g = -184900 - v. Let o = 0.4 + g. What is o rounded to 6 decimal places? -0.000002 Let z = -9.6 - -0.6. Let q = z - -8.9984. Round q to 3 dps. -0.002 Let d = 3035935.4 - -334785.6. Let y = d + -3370739.10073. Let z = y + 18.1. What is z rounded to 4 dps? -0.0007 Let f = 3729541 - 10329541. What is f rounded to the nearest one million? -7000000 Let w = 0.35 - 0.26. Round w to one decimal place. 0.1 Let b = 5444961 - 13634961. Round b to the nearest 100000. -8200000 Let o = 91 + -90.999918. What is o rounded to five decimal places? 0.00008 Let b be 14/(-3) + (-3)/9. Let m(n) = 2001n2 + 6n + 5. Let v be m(b). Round v to the nearest 10000. 50000 Let z = -2 + 1.99. Let o = -1.6 - -1.5872. Let k = z - o. What is k rounded to 3 dps? 0.003 Let n = -988848126.9999953 + 988848044. Let f = -83 - n. What is f rounded to 6 decimal places? -0.000005 Suppose -3d = -6, 18 = 2r + 2d + d. Suppose -rs + 8 = -2s. Round s to 0 dps. 2 Let y(v) = 254v - 6. Let k be y(-16). Round k to the nearest one hundred. -4100 Let j = -0.27 + 0.12. Let w = j + 0.1500031. Round w to 6 decimal places. 0.000003 Let v = 0.6 - 0.36. Let g = v + -0.24000184. Round g to seven dps. -0.0000018 Let b = -0.006 - 0.03. What is b rounded to two dps? -0.04 Let t = 8 + -8. Let z(u) be the third derivative of -u6/120 - u4/24 + 105000u3 - u*2. Let y be z(t). Round y to the nearest 100000. 600000 Let z = -1.1116 - 1234.1984. Let m = -1273 - z. Let y = -38 - m. What is y rounded to one decimal place? -0.3 Let a = 2.459501 + -0.059311. Let b = 2.4 - a. Round b to four dps. -0.0002 Let d = 35348915.00213 - 35349187. Let j = d + 272. Round j to four dps. 0.0021 Let g = 0.52 + -0.562. Let i = -0.025 + g. What is i rounded to 2 dps? -0.07 Let p = -2.6 - -8.5. What is p rounded to 0 decimal places? 6 Let w = 0.04 - 0.1. Let q = w - 0.34. Let i = -3.1 + q. Round i to zero dps. -4 Let q = -680.9571 + 681. Round q to 3 dps. 0.043 Let u = 10.0005 - 10. Round u to four decimal places. 0.0005 Let z = -176 - -178.47. Let s = -0.03 - z. Round s to the nearest integer. -3 Let k = -0.776 + 0.8. Let u = -0.049 - k. What is u rounded to 2 dps? -0.07 Let y = -110176.30085 + 110180. Let w = y - 3.7. What is w rounded to 4 de	{ "pile_set_name": "DM Mathematics" }
. Let c(j) = j + 1. Let y be c(0). Let f(v) = -v*3 - 13v*2 + 47v - 17. Let w be f(-16). Sort w, g, y. w, y, g Let m = -3862 - -3865. Let d(z) be the second derivative of z*4/12 - 5z*2 + 2z. Let a be d(0). Sort m, 1, a in decreasing order. m, 1, a Let h be (-2)/(-1 - 1) + -2. Suppose -55b = -3t - 59b - 10, -4b - 24 = -4t. Sort t, 5, -7, h. -7, h, t, 5 Let q(u) = u2 + 13u + 2. Let n = -6 - 7. Let y be q(n). Suppose yz + z - 3 = o, 3z + o = 3. Put z, -4, -5 in increasing order. -5, -4, z Let d = 33 + -33.4. Suppose -3g - 18 = -6. Let t be 30/84 + 2/g. Sort t, 0.2, d. d, t, 0.2 Let j = -1863 - -1863.3. Sort 0, j, -12, -0.5. -12, -0.5, 0, j Let n be (-3 + -1)/(6 + -5). Suppose 4a - 1 = -y, a + y = -4a. Put a, n, -0.4, 0.4 in ascending order. n, a, -0.4, 0.4 Let m = 18 + -13. Let a(o) = o3 - 4o*2 - 9o + 8. Let l be a(5). Let w be 1/((2/l)/(1/2)). Put w, 6, m in ascending order. w, m, 6 Let z be 4 + (-816)/135 + 0. Let v = z - -22/9. Put v, 0, -2/11 in ascending order. -2/11, 0, v Let r(b) = -3b + 7. Let k be 12/5 - 9/(-15). Let i be r(k). Suppose 2m = -2, 0g - m - 1 = -2g. Sort g, i, -3 in increasing order. -3, i, g Let d = -1120/11 - -102. Let j be 10/(-5) + (-7)/(-4). Put -0.5, -1, j, d in decreasing order. d, j, -0.5, -1 Let l = -3.121 + 0.121. Put -2/7, 3, l, 5 in descending order. 5, 3, -2/7, l Let m = -72 + 74. Suppose -3g + 2c - 1 - 27 = 0, -2c - 44 = 3g. Sort g, -3, -2, m in ascending order. g, -3, -2, m Suppose -2d = -7d. Suppose 3a - 4a = 2y - 6, -3a = -6. Suppose -yb - 9 = -1. Sort -3, b, d in ascending order. b, -3, d Let u = 845/33 + -76/3. Let g = 49 - 50. Let z be 5/(-10) - (g - 57/(-90)). Sort u, z, 4 in ascending order. z, u, 4 Let v(r) = r2 + 9r + 3. Let u be v(-9). Suppose 3j + 2j - 16 = ug, -3j = -g - 8. Put g, -3, -1 in decreasing order. -1, g, -3 Suppose -w + 0 + 3 = -n, -10 = 5n - 4w. Suppose -9c - 37 = 4y - 4c, y = 3c + 12. Sort -4, n, -5, y. -5, -4, y, n Let t = 12 + -12. Let c be (-4 + t)/(-8 + 6). Suppose 2o = 3i + 1, 4o - co = -3i + 19. Put i, -2, 0 in decreasing order. i, 0, -2 Let k = -2/125 - -1133/500. Let q(f) = 2f - 27. Let x be q(13). Put k, x, 1 in decreasing order. k, 1, x Let p be (8/6 + -1)/(420/(-180)). Let w = -1 + 0. Let b be 18/(-10) + (-2)/w. Sort b, p, -1/3 in decreasing order. b, p, -1/3 Let g(s) = s*3 + 10s*2 + 5s + 10. Let o be g(-9). Let f = 44 - o. Sort 0.4, 2, f, -0.1 in ascending order. f, -0.1, 0.4, 2 Suppose -17 = -4a - 2k + 9, 5a - 3k - 49 = 0. Suppose -a = -5d - 3. Sort -3, d, 4. -3, d, 4 Let s be (2 + (-77)/22)2-1. Put 4, -1, s, 0 in decreasing order. 4, s, 0, -1 Let c = 0.5 - 14. Let k = -10 - c. Let f = k - 0.5. Sort 2, f, 2/9 in descending order. f, 2, 2/9 Let j(d) = -d3 - d2 - d - 2. Suppose 2x + 2x = 0. Let l be j(x). Put -4, l, 5, -3 in decreasing order. 5, l, -3, -4 Let p(f) = f2 - 2f + 6. Let l be p(4). Let i be l/63 - 2/3. Let z = 11 + -8. Sort z, 1, i. i, 1, z Let h be 1/(-7)(7 + -4). Sort -0.4, h, 45, -0.3 in descending order. 45, -0.3, -0.4, h Let r(t) = 6 + 4 + 4t*3 - 2t3 - t3 - 13t + 5t*2. Let h be r(-7). Suppose 3z = 6z - hd - 18, -4z = -5d - 25. Sort 4, -4, z. -4, 4, z Let i = 483 + -483.14. Put -5, i, -0.9, 0 in increasing order. -5, -0.9, i, 0 Let m = -155 + 91. Let y = m + 65. Sort -11, y, -5 in decreasing order. y, -5, -11 Let o = 34 - 66. Let n = -24 - o. Put -0.3, 1/5, n in descending order. n, 1/5, -0.3 Let r = -2886 + 2891. Sort 0.4, -9, r in ascending order. -9, 0.4, r Suppose 0 = -2o + 5o + 9. Let b = -21 - o. Let x = b - -21. Sort -5, x, -3 in decreasing order. x, -3, -5 Let m = -1454/3 + 484. Sort m, -0.01, -6 in ascending order. -6, m, -0.01 Suppose 2v + v = -2u - 20, -5v = -u + 29. Suppose b - 4l - 7 = 0, -7l = 4b - 5l + 8. Put -3, b, v, -2 in decreasing order. b, -2, -3, v Let f = 758.1 + -758. Sort 0.4, 1, 2, f in ascending order. f, 0.4, 1, 2 Let j = 419 - 412. Put j, -1, 5 in increasing order. -1, 5, j Let z be 6/36(-1 + -3). Sort 16, 2, z in increasing order. z, 2, 16 Let i be 17/153 - (-110)/(-18). Sort -2, 44, i. i, -2, 44 Let m be (21/(-144))/((-34)/(-136)). Sort 2, 0.1, m. m, 0.1, 2 Let v(f) = -f*3 - 8f*2 - 9f - 12. Let a be v(-7). Let o be 4/(-14) - (-111)/21. Put o, a, -5 in decreasing order. o, a, -5 Let i = -5/187 - -389/561. Sort i, 3/5, -1/6 in decreasing order. i, 3/5, -1/6 Suppose -8m + m - 252 = 0. Let f = m + 36. Suppose 3z + 0o + 19 = 2o, -3o - 19 = 5z. Sort 1, z, f in ascending order. z, f, 1 Let g be 4/170(-3 - 2). Let k(z) = z3 + 17z*2 - 17z + 16. Let h be k(-18). Put g, -0.1, h in increasing order. h, g, -0.1 Suppose 4m + 2 + 70 = 0. Let w = -20 - m. Sort w, 3, -0.2. w, -0.2, 3 Let w = 169 + -1519/9. Let c = 0.042 + -1.042. Put c, 2/19, w in decreasing order. w, 2/19, c Let z = 0.15 - 0.55. Let u be (89 + -1)/(9 - 8). Let y be (u/18)/(-4) + 1. Sort z, 1/5, y in increasing order. z, y, 1/5 Let r be ((-58)/3 - 1) + (-8)/12. Let i(j) = -j3 - 20j*2 + 19j - 40. Let k be i(r). Sort 3, -1, k. -1, k, 3 Let a = 99 - 73. Let w = a + -29. Sort -4, 0, 2, w. -4, w, 0, 2 Let u(i) = -4i3 - 5i*2 + 10i - 4. Let c be u(1). Put 27, 0, c in descending order. 27, 0, c Let c = 2562 + -2559. Let d = 7 - 5. Put c, d, -3, -1 in increasing order. -3, -1, d, c Let n = -58.6099 - 1.3201. Let m = 59 + n. Let f = m + -0.07. Put f, -1/6, -3/7 in decreasing order. -1/6, -3/7, f Let u(z) = 3z - 12. Let f be u(7). Suppose 10 - f = w. Sort w, 5, 3, 4 in descending order. 5, 4, 3, w Suppose 4a + 0a = 64. Suppose -6t - a = 2. Let n = 0 - 4. Sort -1/7, n, t in increasing order. n, t, -1/7 Suppose 4d = -4t - 32, d - 3t - 4 = 2t. Let p = d + 10. Suppose j + 3y = 6y - 7, 5j - 41 = -4y. Put j, p, -1 in increasing order. -1, p, j Suppose 0 = 2j - 4. Let m = j + -12. Let h be (-2 + 1)10/m. Put h, 2, 5 in increasing order. h, 2, 5 Let k = -4 - -4. Suppose s - 3 - 1 = k. Suppose 0 = -3v - 5 - s. Sort v, 3, 1 in ascending order. v, 1, 3 Let r(i) = i3 + 43i*2 - 2i - 88. Let s be r(-43). Put 0, -128, s in ascending order. -128, s, 0 Let q = 0.08 - 0.08. Let d = 2 - 4. Let c(j) = -j*3 + 10j*2 - 17j + 12. Let n be c(8). Sort d, q, n. d, q, n Let r = -2573/8 + 322. Put r, -3, -2, 0.2 in increasing order. -3, -2, 0.2, r Let b = -359/1232 - -1/176. Let n = 13.3 + -14.3. Sort b, 5, n in decreasing order. 5, b, n Suppose 5d - 46 = -3a - 14, 5d - 36 = -4a. Suppose -k + 2k = -o + 1, -2k = -do + 16. Sort -4, -1, k in decreasing order. -1, k, -4 Let z = -0.06 - -0.46. Let x = -321/109 - 197223/763. Let f = 262 + x. Sort f, 5, z in decreasing order. 5, f, z Suppose -20 = 5w - 35. Sort w, -205, -1, 1 in descending order. w, 1, -1, -205 Let a = -8.1 - -6.1. Sort a, -13, 1/4, -5 in increasing order. -13, -5, a, 1/4 Let x be (-17)/(-102) - (-115)/30. Put -1, x, -847 in increasing order. -847, -1, x Let b = 0.005 + -6.005. Let f = 1 - 0.9. Sort f, b, -4. b, -4, f Let o be (-23)/69 + 2/(-3). Put o, -3, -8, 1 in descending order. 1, o, -3, -8 Let v(s) = 3s2 + 7s. Let k(b) = -7b2 - 13b + 1. Let w(l) = -2k(l) - 5v(l). Let n be w(-6). Suppose c - n = -3c. Sort -5, -1, c. -5, -1, c Suppose 4n - 10 = -14. Let g be n/2-12. Sort -2/7, 12, g in descending order. 12, g, -2/7 Let h = -1999.4 - -1999. Let p = -20/141 - -2/235. Sort -1/7, h, -3, p in decreasing order. p, -1/7, h, -3 Let s be (-4 - -2)2/(8/(-14)). Suppose 0 = 2y + s + 1. Put y, 5, 2/7 in increasing order. y, 2/7, 5 Suppose 6p - 5p = -151. Let x = 155 + p. Let w be (-1 - 0) + 0 + 6. Put -5, x, w in decreasing order. w, x, -5 Let o = -17 + 14. Let v = 69107/85 - 813. Let i = -164/255 - v. Sort 2, o, i. o, i, 2 Let j = -16 - -54. Let f = j + -34. Sort 0.2, f, -0.11. -0.11, 0.2, f Let u(c) = 2c2 - 7c + 8. Let g be u(2). Put -4, 3, g in ascending order. -4, g, 3 Suppose 4w - 1 = 3g, 0 = 5g - 2w + 18 - 7. Sort g, 5, -5, 17 in descending order. 17, 5, g, -5 Let b = 23 - 28. Let g = 92 - 90. Let p be (-1)/3 - (-11)/(-3). Sort g, p, b. b, p, g Let p = 0 + 0. Let j = p + 0.4. Let u(d) = d*3 - 2d*2 - 13d + 7. Let r be u(-3). Put r, j, -1 in descending order. r, j, -1 Let m(h) = h*2 - 32h - 1. Let z be m(32). Let u be 2 - 1 - (1 + -3). Put u, 4, z, -2 in ascending o	{ "pile_set_name": "DM Mathematics" }
g(-2)? 6 Suppose 5c - 5756 = 6v - 8v, -2c = -4v + 11536. What is the units digit of v? 3 Let p = 289 - 285. What is the hundreds digit of 0 + (-2)/p + 7008/64? 1 Suppose 105t - 476406 = 48t + 48t. What is the units digit of t? 4 Let q(i) = i*3 + 5i + 78. Let j be q(0). Suppose 30v - 3b = 31v - j, 10 = -5b. What is the tens digit of v? 8 Let l = 24 - -3. Let c = l - 41. Let s = c - -22. What is the units digit of s? 8 Let f(i) = 5412i - 335. What is the ten thousands digit of f(2)? 1 Suppose 2u = -u - 2z + 42483, -14139 = -u + 3z. What is the hundreds digit of u? 1 Suppose 0 = -3o + 4p + 130813, -3o + 234p + 130778 = 235p. What is the thousands digit of o? 3 Suppose 3702 = -69u + 154260. What is the thousands digit of u? 2 Let c = 18022 + -6861. What is the hundreds digit of c? 1 What is the units digit of 426540/255/3? 6 Let j = -40 + 43. Let s(p) = -17p*2 + 135p*j - 5 - 8p - 137p3 + 17p. What is the tens digit of s(-10)? 0 Let v(h) = 12h2 - 56h - 1829. What is the hundreds digit of v(51)? 5 Suppose 66 = 14o - 60. What is the hundreds digit of 5493/o + (-10)/(-6)? 6 Let z(d) = -46d + 5. Let w be z(-9). What is the tens digit of w + -5 + 1 + 4? 1 Let k be (816/170)/(2 - 17/10). What is the hundreds digit of -566(-2)/k4? 2 Let f = 47628 + -22577. What is the thousands digit of f? 5 Suppose 5w - 16 - 4 = 0. Suppose wy + 5n - 371 = 0, -18 - 71 = -y - 2n. What is the units digit of y? 9 Suppose 2r - 827 = -k, -773 = -5r - 3k + 1295. Suppose 4f - 2945 = -r. What is the units digit of f? 3 Let r = 3702 + -1323. What is the hundreds digit of r? 3 Let h = 29244 + 2497. What is the units digit of h? 1 Let f(x) = -60x + 136. Let l be f(2). Let k(a) = a + 12. Let z be k(-5). Suppose -w + l = -z. What is the tens digit of w? 2 Let q = -7523 + 13551. What is the thousands digit of q? 6 Let l(b) = -47b + 90. Let g be l(8). Let a = 26 - g. What is the units digit of a? 2 Let b(m) = -10m2 + 7m + 1. Let i be b(4). What is the tens digit of (1 - i)2 - (38 + -41)? 6 Let m(x) = 97x*2 + 12x - 20. Let r be m(2). Suppose -3t - 4j + 4431 - r = 0, 4t - 5360 = j. What is the thousands digit of t? 1 Suppose 5p - 4b - 118 = 0, -3p + 3b + 74 = -b. Suppose -2l = -p + 18. Suppose lr - 189 - 149 = 0. What is the hundreds digit of r? 1 What is the hundreds digit of 13((-7 - 17/((-51)/4122)) + 7)? 8 Let m(k) = 3k3 + 61k*2 + 42k - 131. What is the thousands digit of m(20)? 9 Suppose 539u + 575u + 817745 = 1155u. What is the tens digit of u? 4 Let l = -217 + 133. Let o = 43 + l. Let d = 178 - o. What is the units digit of d? 9 Let w(u) = -13u + 0u3 - 3u - 1 - 14u2 + u3 - 7. Let t be w(15). What is the units digit of t/(0 - 4/8)? 6 Suppose -5o + 0k = 5k + 15, -4o = 3k + 13. Let j be -1 + (o - (-3 - 2)). Suppose j = 3r - 42 - 39. What is the units digit of r? 7 Suppose 7k - 17402 = 11486 + 23899. What is the tens digit of k? 4 Let n = 7757 + -953. What is the hundreds digit of n? 8 Let t(d) = 2d2 - 59d - 28. Let n be t(30). Suppose 5s + nq - 6q = 1901, -3q = 12. What is the units digit of s? 7 Let a(r) = r*3 - 109r*2 - 143r + 3991. What is the hundreds digit of a(110)? 3 Suppose -1805844 = -77y + 1081348. What is the units digit of y? 6 Suppose 44 - 14 = 5v. Let m(f) = 2f + f3 - 8 - 5f - 2f2 + f2 - vf*2. What is the units digit of m(8)? 2 Let l(h) = 3h*2 + 3h + 3. Let u = 17 + -16. Suppose -4y - u = -2t - 11, y - 20 = -3t. What is the units digit of l(t)? 3 Let q(g) = -7g + 257. Let n be q(0). Suppose -2l + 97 + n = 0. What is the units digit of l? 7 Let t = 21 - 22. What is the units digit of t - 105/(-91) - 2412/(-39)? 2 Let f be 5 + 60/(-8) + (-3)/6. What is the units digit of 7 - -1229 - (-5 - (-3 - f))? 1 Let p = 384 + -380. Suppose -6t + pj + 41 = -t, 5j + 13 = 2t. What is the units digit of t? 9 Let m(n) = 6n - 99. Suppose x - 5y = -5, -x - 5y + 5 = 4x. Let o be m(x). Let q = -47 - o. What is the tens digit of q? 5 Suppose -4j - 35 = -11j. Suppose -2b - 4u + u = -330, b + ju = 172. What is the units digit of b? 2 Suppose 208 = 2c + 6c. Suppose -ch = -32h + 3966. What is the units digit of h? 1 Suppose 7d - 29 = -1. Suppose dj = 19 + 37. What is the tens digit of j/(-21) - (-610)/6? 0 Suppose -2f + x = -10205, -315f + 319f - 20385 = -3x. What is the units digit of f? 0 Suppose -2c + 6c - 4 = 0. Let k be (-3)/(c(-3)/273). What is the hundreds digit of (-6)/k - (-377)/3? 1 Suppose 0 = -2j - 5z + 20, -3j + 2z = -2z - 7. Suppose jp + h = -2, -3 - 7 = p + 5h. Suppose p = -7w + 5 + 177. What is the tens digit of w? 2 Suppose 9u = 2137 - 33088. Let a = 5129 + u. What is the units digit of a? 0 Let f(d) = 15d*3 + 25d*2 + d + 20. Let v(k) = 13k*3 + 26k*2 + 2k + 17. Let h(x) = -6f(x) + 7v(x). What is the units digit of h(-9)? 0 Let g(a) = -23a - 9. Suppose 18k = 23k + 10. Let j be -14 + 8 - (1 + k). What is the hundreds digit of g(j)? 1 What is the tens digit of (330906/2096)/((-2)/(-496))? 5 Suppose -8w - b = -20712, -3w + b + 0b + 7767 = 0. What is the thousands digit of w? 2 Suppose 0 = -5i + 3k - 2563 - 4065, -5k + 1330 = -i. Let o = -930 - i. What is the units digit of o? 5 Let v(n) = 334n*2 - 2n - 3. Let x be v(-1). Let p = x - -315. What is the units digit of p? 8 Let s(t) = -28t - 101. Let l be s(-16). Suppose -l - 583 = -6q. What is the units digit of q? 5 Suppose -126 = 3g - 45g. Suppose -2577 = -gy - 129. What is the units digit of y? 6 Let m(o) = o3 + 10o*2 - 12o + 7. Let a = 2 - 6. Let j be -12 + (-1 + a)/(-5). What is the units digit of m(j)? 8 Let v = 54669 + -25058. What is the tens digit of v? 1 Let u = 24520 - 8104. What is the thousands digit of u? 6 What is the tens digit of ((-162)/(-12))/((-11)/(-6820))? 7 Suppose -9l + 181 = -1385. What is the hundreds digit of (49/7 - 2) + l? 1 Let w = 32473 - 14756. What is the hundreds digit of w? 7 Suppose -5t + 5g + 64030 = 0, 379g + 64045 = 5t + 377g. What is the hundreds digit of t? 8 Let d = 1588 + 3181. What is the tens digit of d? 6 Let x = -513 + -1018. Let n = 2166 + x. What is the hundreds digit of n? 6 Let y be (23 - -10) + (-1 - -2). Let m = 178 + y. What is the hundreds digit of m? 2 Suppose 7j - 38 + 10 = 0. What is the units digit of -18j/(-72)4? 4 Suppose -5s + 4m = -2, -2m + 0m - 4 = -4s. Suppose -1562 = -5w + 4y, -y - 951 = -sw - 328. What is the units digit of w? 0 Suppose -3c = 15w - 666657, -19c + 18c = -5w + 222211. What is the tens digit of w? 4 Suppose -4d + 313 = -4771. Let o = d - 884. What is the units digit of o? 7 Let x be (26/4)/((-40)/(-80)). What is the tens digit of (78/12)/x178? 8 Let v = 31 + -28. Suppose 62 = -5t - 5x - 213, -vt - 2x = 162. What is the units digit of ((-302)/(-7))/(2 - t/(-28))? 2 Let v = -66287 - -131678. What is the ten thousands digit of v? 6 What is the hundreds digit of (84 - 80) + -1 + 2653? 6 What is the hundreds digit of (189644/728)/((-2)/(-500))? 1 Suppose -506 - 268 = -2b + 4r, 3b + 5r - 1216 = 0. Suppose -b = -4w - 3j, -5w + j = -w - 385. Suppose 4h = 5h - w. What is the units digit of h? 7 Let v = 21381 - -6261. What is the units digit of v? 2 Let b = 1324 + 9531. What is the ten thousands digit of b? 1 Let f(h) = -h3 - h2 - h + 6. Let m be f(0). Suppose 0 = mu - 1660 - 1826. What is the hundreds digit of u? 5 Let i(d) = -8d + 2. Let v be i(-4). Suppose -5n + 5z = -225, -5z = -n - 2n + 149. Let x = n - v. What is the units digit of x? 4 Let d be (4/8)/((-4)/(48/(-2))). Suppose 0 = 2m + k - 9, d = -2m - 2k + 13. What is the units digit of 2615/13 + 1m/(-26)? 1 Let u be (-2 - -1)/(4/7812-1). Suppose 0 = 5j - 4j + 4m - 405, 0 = -5j - 2m + u. Suppose j = 4c - 299. What is the units digit of c? 2 Suppose 14c = 10c - 352. Let z = 374 + c. What is the tens digit of z? 8 Let l be ((-3)/3)/((-2)/(-34)). Suppose n + 16 = -5. Let x = l - n. What is the units digit of x? 4 Suppose 329 = i - 2c, 0 = -5i + 2c + 2790 - 1137. What is the hundreds digit of i? 3 Suppose 886 = 5j - a, -3j + 7a = 2a - 536. Let r = j - 80. What is the units digit of r? 7 Suppose -o + 13 = 5c, 0 = -5o - 0c - 3c + 43. Let l(z) = 10	{ "pile_set_name": "DM Mathematics" }
s. 2, 47 Let p = 1259 - 865. List the prime factors of p. 2, 197 Let m = -428 - -763. Suppose 8w = 3w + m. What are the prime factors of w? 67 Suppose -3l + 17 = -2j, 0 = 5l - 5j - 45 + 15. Let k be ((-108)/(-21))/((-2)/(-28)). Suppose b + k = lb. What are the prime factors of b? 2, 3 Let p(z) = 23z + 1192. List the prime factors of p(29). 11, 13 Suppose -14c - 64 = -18c. Suppose 3o = -3k + 15, -2k + c = 5o + 3. Suppose kh - 4x - 264 = 0, 0x = 3h - x - 202. List the prime factors of h. 2, 17 Let n(j) = j*3 + 18j*2 - 18j + 29. Let t(s) = -s*3 - 17s*2 + 18s - 29. Let h(x) = -2n(x) - 3t(x). What are the prime factors of h(-16)? 61 Let i be (-8)/72 + (-6531)/27. Let w = i + 447. What are the prime factors of w? 5, 41 Suppose -z + 21 = 61. Let c = 30 - 31. What are the prime factors of (15/30)/(c/z)? 2, 5 Let s(i) = 6i - 3. Let w be s(2). Suppose 2p - w = -1. Suppose -y = 3y + pu - 108, 0 = -y + 5u + 27. What are the prime factors of y? 3 Suppose 0 = 15n - 5275 + 340. What are the prime factors of n? 7, 47 Suppose 5k - 7 = -22. Let a be 23/(-2) - k/2. Let h(o) = o2 + 8o - 13. List the prime factors of h(a). 7 Let a(x) = x*3 - 14x*2 - 29x + 79. What are the prime factors of a(17)? 3, 151 What are the prime factors of (43/(-2))/((-60)/480)? 2, 43 Suppose 0 = 8j - 1827 - 16981. List the prime factors of j. 2351 Let w(o) be the first derivative of 7/2o*2 - 6 + 8o - 1/3o3. What are the prime factors of w(6)? 2, 7 Let w(o) = 2o - 17. Let t be w(13). Suppose -3i - t = 6. Let x(d) = d + 9. List the prime factors of x(i). 2 Let u = 39 - 37. Suppose uv - 4g - 104 = -v, -g = 5. List the prime factors of v. 2, 7 Let y(x) = -3x*3 - 16x*2 - 5x + 13. List the prime factors of y(-8). 5, 113 Let t be (-11)/(88/928) + (-3)/1. List the prime factors of ((-29)/(-1))/((-17)/t). 7, 29 Suppose -1776 = 13x - 19x. List the prime factors of x. 2, 37 Suppose 2z - 5c = 630, 4c - c = -4z + 1234. Let p be ((-2)/4)/(5/z). Let w = -12 - p. List the prime factors of w. 19 Let k(y) = y + 6. Let z be 77/(-14) - (-2)/4. Let w be k(z). What are the prime factors of (-46)/(-1 + -1)w? 23 Let t = -925 - -1683. What are the prime factors of t? 2, 379 Let g(p) = -3p + 3. Let v be g(3). Let q(h) = -h*2 + h + 3. Let j(z) = -3z*2 + 2z + 7. Let n(d) = -4j(d) + 11q(d). What are the prime factors of n(v)? 23 Suppose -7v - 2 = 5. Let n(f) = -55f*3 - f - 1. What are the prime factors of n(v)? 5, 11 Suppose 0 = n - 5n - 5i - 8, 0 = -2n - 2i - 4. Let v be n/(-14/264). Suppose 5m + 3g = m + v, 2g + 142 = 5m. What are the prime factors of m? 2, 3, 5 Let s be 0/1(-2)/(-4). Suppose -3x + 3q + 105 = s, -4x - 5q + 107 = -33. What are the prime factors of x? 5, 7 Let j(d) = d + 5. Let c be j(-3). Let m(s) = 4s*2 - 4s + 2. Let o be m(c). Suppose -4w + 130 = 4f - o, -3f + 105 = -2w. List the prime factors of f. 5, 7 Let i = -35 + -41. Let r = -16 + 4. What are the prime factors of i-2(-3)/r? 2, 19 Let t = -5281 - -11472. List the prime factors of t. 41, 151 Let i = -759 - -1372. List the prime factors of i. 613 Let y = 2642 + -1642. What are the prime factors of y? 2, 5 Suppose f + 5x - 36 = 0, -f + 5x + 21 = 7x. Let v = f + -11. Suppose 5i - 212 - 13 = v. List the prime factors of i. 3, 5 Let s be (23)/((-6)/(-8)). Let d(y) = 4y*3 + 7y*2 + 5y + 11. Let z(j) = -j*3 - 1. Let m(i) = -d(i) - 5z(i). List the prime factors of m(s). 2, 3 Suppose 16 = 4y, 3y - 112 = 5q - 410. Let o = -41 + q. List the prime factors of o + (1 - 2) - 2. 2, 3 Suppose 4z = 4h - 8, 0z + 5z = 3h - 6. What are the prime factors of (-8)/(-20) - (h + 1383/(-5))? 5, 11 Let f(r) = 142r3 + 4r*2 + 56r - 179. List the prime factors of f(3). 17, 227 Suppose -2n + 12 = 2w, 0n - 5w + 20 = 3n. Suppose -2 = 3k - n. List the prime factors of 1/((k + -2)/(-32)). 2 Let s = 158 + -82. What are the prime factors of (363/132)/(1/s)? 11, 19 Suppose -235 = -5r + 115. Suppose -r = -2s + 4. List the prime factors of s. 37 Let q(v) = 49v. Let h = 28 - 27. List the prime factors of q(h). 7 Let z(j) = -2j*3 + 4j*2 - 2j - 2. Suppose 0 = 3w + 2 - 8. Let k be z(w). What are the prime factors of -16(k/(-4) + -3)? 2, 3 Suppose 5t = -3x + 2778 + 4712, -2t + 4x + 2996 = 0. List the prime factors of t. 2, 7, 107 Let r(c) = c*3 - 60c*2 + 138c + 43. List the prime factors of r(58). 1319 Suppose -2j = j - 15, -4j = -2x + 172. Let h be (x/(-40))/(2/(-5)). Suppose 0 = hp - 11 - 91. What are the prime factors of p? 17 Suppose 3d + 150 = 8d. Suppose 2b - a = 13, 2a = 2b - 6b + d. Let h = b + 8. List the prime factors of h. 3, 5 Suppose -3j + 1416 + 221 = 2z, -2j - z = -1091. What are the prime factors of j? 5, 109 Let i(z) = 51z*2 + 1. Let f be ((-4)/14)/(4/28) - 0. List the prime factors of i(f). 5, 41 Let k(h) = -4h*3 + 5h*2 - h - 2. Let j be k(3). Suppose 3c = 4d - 90, 4c = -2d - 2d - 148. Let b = c - j. List the prime factors of b. 2, 17 Let n(c) = c*3 - 8c*2 - 9c - 2. Let v be n(9). Let z be v/6105/7. What are the prime factors of 551 + (z - -4)? 2, 3 Suppose -3m + 9 - 3 = 0. Suppose x - 15 - 84 = -z, x - mz = 105. List the prime factors of x. 101 Let b(c) = 4c + 13. Let k be b(10). Suppose 48o = ko - 800. What are the prime factors of o? 2, 5 List the prime factors of 58948/10 + 0 + (-5)/(-25). 3, 5, 131 Suppose -3y - 9 = 4r, r - 2y - 15 = 3y. Suppose r = n + 2n - 366. What are the prime factors of n? 2, 61 Let w = 7184 + -4977. List the prime factors of w. 2207 Let y(d) = -d*2 - 12d + 3. Suppose 0 = -3r - 16 - 20. What are the prime factors of y(r)? 3 Let a be ((-4)/(24/(-741)))/((-2)/(-4)). Let t = a - 118. List the prime factors of t. 3, 43 Let f be 211 - 0(-3)/9. Suppose f = 3x - 341. What are the prime factors of x? 2, 23 Let c(b) be the first derivative of -b3/3 + 13b*2/2 - 9b + 5. Let s be c(8). Suppose 5f + 6 = s. List the prime factors of f. 5 Suppose -3p + 5o = 2p - 45, -2p + 33 = -5o. What are the prime factors of 4/11(-3 + p)? 2 Let r(j) = j*2 + 5j - 1. Let g = 10 + -16. Let o be r(g). Suppose -oq = -52 - 43. What are the prime factors of q? 19 Let j be (-6)/14 - (-1539)/63. Let l be 1/2 + (-36)/(-8). Suppose -3p + j = 4a - lp, -p + 24 = 4a. List the prime factors of a. 2, 3 Let s = 92 + -55. Let b = s - -11. What are the prime factors of b? 2, 3 Let r = -14 - -27. Let b(y) = 6y - 139. Let u be b(28). Suppose -i = 5t - u, -t = -2i + 4t + r. List the prime factors of i. 2, 7 List the prime factors of (4086/8)/(221/52 - 4). 3, 227 Suppose -5 = 5u, 2x + u = -x + 1823. What are the prime factors of x? 2, 19 Let p be 9(-1)/6-2 + 106. Suppose y - d - p = 3d, -3y - d = -353. List the prime factors of y. 3, 13 What are the prime factors of (0/(-1) - (11 - 3311)) + 2? 2, 13, 127 Let u(n) = -14n. Let p be u(-1). Suppose 18o = po + 284. What are the prime factors of o? 71 Let w = -459 + 2129. List the prime factors of w. 2, 5, 167 What are the prime factors of ((-2)/3)/((-15)/(5085/2))? 113 Suppose w = -p + 3p + 433, 0 = -w - 5p + 440. What are the prime factors of w? 3, 5, 29 Suppose -3f = -24 - 762. What are the prime factors of f? 2, 131 Suppose 0 = o - 37 + 36, -5r + 5o = -570. List the prime factors of r. 5, 23 Let u(t) = -7t*3 - 8t*2 + 20t - 4. List the prime factors of u(-6). 2, 5, 11 Suppose 0x - 10x + 45220 = 0. List the prime factors of x. 2, 7, 17, 19 Suppose -c = -3q + 1026, 3q - 440 = 5c + 598. List the prime factors of q. 11, 31 Let q(s) = -2s3 - s2 - s + 1. Let a be q(-4). Let k = a - 78. What are the prime factors of k? 3, 13 Suppose -5b - 83 = -4u, 2u + 4b = 13 + 61. Suppose -4n + u = -25. What are the prime factors of n? 13 Suppose 5t - g + 2g - 5438 = 0, 1084 = t + 2g. What are the prime factors of t? 2, 17 Let h = -4 - -9. Suppose 5i + 29 = 3k, hk - 2i = i + 43. Suppose ky - 3y + w - 74 = 0, -4w - 19 = -y. What are the prime factors of y? 3, 5 Let t be (5/((-20)/72))/(-2). Let c(u) = -3u + 4u - 1 + tu*2 + 3u*2 - 3u. What are the prime factors of c(-1)? 13 Suppose 3r = 5m - 26, 2r - 1 + 10 = -5m. Let v be (-25 + 2)*(-14)/r. Let a = v + 69. What are the prime factors of a? 23 Let q	{ "pile_set_name": "DM Mathematics" }
is (2/(-22))/(12/12)? -1/11 What is the value of (7/(70/15))/((-462)/56)? -2/11 What is the value of ((-136)/85)/(34/(-680))? 32 What is ((-201)/402)/((-10)/32(-34)/(-765))? 36 What is (2/7)/(-1)119(-28)/(-476)? -2 What is the value of 3/(((-27)/(-2))/(-9))? -2 Evaluate (26/(-468))/((6/3)/((-48)/(-3))). -4/9 What is (-54026)/(-908)(-4)/(-7)? 34 What is ((-7072)/(-4862))/((-2)/11)? -8 What is the value of ((-402)/(-2345))/((-2)/(-10)3)? 2/7 Calculate (-122)/(5845/5220). -8 (-6(-5)/(-420))/(-2)8/(-3) -2/21 (-8)/((-192)/24)-23 -23 What is ((-224)/(-336))/((-2)/(-81))? 27 What is the value of 2/(-5)2(-175)/63? 20/9 ((2/(-30))/1)/((-90)/225) 1/6 What is (66/440)/((-7)/28)? -3/5 What is (80/(-140))/((-9)/(-91))(-333)/(-74)? -26 6/430/40512 4/3 What is the value of -2((-240)/(-25))/(-16)5/(-18)? -1/3 Evaluate 6/(11(-45)/(-1155)). 14 What is the value of (-12)/(-10)11(-680)/(-1122)? 8 Calculate 182/39-1(-60)/8. 35 What is ((-3)/((-33)/(-10)))/((-750)/3300)? 4 Evaluate ((-48)/40)/((24/(-20))/6). 6 Calculate (7/14(-6)/(-9))/(8/(-60)). -5/2 What is the value of (71/(-213))/((-3)/(-180))? -20 What is ((-57)/418(-4)/(-2))/((-15)/(-5))? -1/11 What is the value of ((-44)/8)/(24/48)? -11 Calculate 6308/3323/19. 3 What is the value of (-36)/20(-9)/567-30? -6/7 What is the value of ((-60)/(-36))/(30/54)(-26)/(-6)? 13 What is the value of (((-138)/42)/(-23))/(1/4)? 4/7 What is ((-14)/105)/((-6)/3(-5)/(-6))? 2/25 What is the value of 5004/708934/(-6)? -4 (342/(-3040))/(72/(-120)) 3/16 What is 7((-1848)/(-637))/(-22)? -12/13 ((-10)/(-36))/(((-30)/16)/((-162)/108)) 2/9 What is (64/(-16))/(34/68)1? -3 Calculate (64/96)/(5/15). 2 Evaluate (6307/(-159))/(-119)(-3)/(-5). 1/5 What is the value of (6/(-99))/((-31)/1023)? 2 Calculate ((-77)/(-147)-3)/((-21)/(-147)). -11 ((-4)/(-434))/(((-8)/(-56))/(39/13)) 6/31 What is the value of (2/6)/(40/(-360))? -3 ((-19)/(171/27))/(6/(-2)) 1 Evaluate (5/(-4)6/30)/((-39)/(-104)). -2/3 80/(-5)(1/1)/(10/10) -16 What is ((-9)/18-12)/((-368)/16)? -1/23 What is the value of ((3/2)/1)/((-120)/64-26)? 2/65 Calculate (-4)/(-8)(-28)/(-98)-711. -11 Evaluate (516/(-200))/((-36)/(-420)). -14/3 Calculate 29/(3190/44)(-40)/2. -8 Evaluate 451/49242/33. 7/6 Calculate (-66)/8(-1636)/(-1227). -11 Calculate (((-63)/30)/7)/((-258)/(-1505)). -7/4 What is (-36)/(-32)((-736)/168)/(-23)? 3/14 What is the value of 449/(-140)66/77? -6/5 Calculate 7(-165)/6302/11. -1/3 Calculate (-270)/(-12)35/315. 5/2 What is 10/(-16)-1114/770? 1/8 Calculate -1(-5)/(-20)20-1. 5 (40/(-112))/(3/(-42)-40) -1/8 What is ((-64)/108)/(112/(-84))? 4/9 What is ((-10)/3-2)/((-12)/1267)? -10 What is 20/22(-403)/9321/(-91)? 10/11 Evaluate 5((-60)/15)/((-60)/(-78)). -26 Calculate 2010/(-938)42/(-20). 9/2 Evaluate 6/(-8)(-4)/(-72)12. -1/2 What is -7(-2)/(22/(-11))? -7 Calculate 299/(-13)-73/(-21). -23 What is ((-6)/18)/((-203)/174)? 2/7 -7(-16)/(-112)0 0 (24/(-14))/(28/(17248/(-66))) 16 What is ((77/(-42))/1)/(84/(-126))? 11/4 3/39((-236)/295)/(2/(-5)) 2/13 What is the value of (((-6)/24)/(1/(-52)))/((-8)/(-8))? 13 What is the value of 226/339-2(-9)/42? 2/7 ((36/(-300))/((-5)/50))/(3/20) 8 Calculate (-94851)/(-105390)1/62. 3/10 Calculate (44/(-264))/((12/(-9))/2)16. 4 What is (((-1354)/(-79209))/((-1)/3))/(1/(-3))? 2/13 What is ((-62286)/(-11864))/((-2)/((-8)/1))? 21 Evaluate ((-6)/45)/((-2)/(-3)). -1/5 Evaluate ((-6)/(-27))/(346/(-14013)). -9 Evaluate -22((-411)/(-548))/(12/(-2)). 11/4 What is (-38/360)/((-4)/5)? 1/12 What is (1357/(-1534))/(2/13)? -23/4 Evaluate 506/15181/((-49)/(-6)). 2/49 What is 125/350112/(-240)? -1/6 Evaluate ((-4)/36)/(87/261). -1/3 What is the value of 9/(-945)-35-18? -6 (-2)/((-11/2)/(248/1240)) 4/5 What is 38/((-2280)/(-36))((-2)/(-1))/(-6)? -1/5 What is (590/354)/(3/((-252)/(-20)))? 7 What is the value of (-54)/8(-1248)/(-936)? -9 Calculate (1/(-18))/((780/(-168))/(-65)). -7/9 Calculate (-3)/(-320)165/(-22). -3/8 What is ((2/36)/((-610)/732))/((-1)/2)? 2/15 Evaluate ((-7)/88218)/(2/8). -4/7 Calculate (-4672)/(-5840)(-1)/4. -1/5 Calculate 6/(-5)100(-45)/675. 8 Calculate (2/(-3))/(15249/21114). -12/13 Evaluate (84/10)/(9/(-30)148/111). -21 What is the value of (-27)/48615(-63)/45? 7/6 Calculate 7/((-28)/33)6(-18)/81. 11 What is the value of (-2)/((-4)/241(-20)/5)? -3 Calculate 16/1((-636)/24)/(-53). 8 (16/3)/((-36)/(-81)) 12 (-32)/80((-60)/33)/(-2) -4/11 What is the value of (2340/(-15015))/(4/(-14))? 6/11 What is -3(-3)/(-45)((-1500)/(-8))/25? -3/2 (34/(-2040)-30)/(3/(-162)) -27 Calculate ((8/16)/((-6)/(-4)))/(23/(-207)). -3 Evaluate 799/3036208/(-1). -2/95 (36/16)/(25/(16500/45)) 33 What is (-6)/((-20)/(-1190)-17)? 21 What is the value of (60/(-84))/((-4495)/406)? 2/31 What is (-2)/(4/19)28/14? -19 (18/(15/(-90)-30))/(3/20) 24 What is 12/(-33)1(-29)/((-58)/4)? -8/11 What is the value of 2214/(-224)-8? 11 Calculate (-32)/483-457/(-24). -19 Evaluate (0(-24)/768)/((-15)/(-3)). 0 What is the value of 117/(507/(-13))25/3? -25 What is the value of 3296/(-412)(-6)/(-3)? -16 Calculate 3-7(-16)/504(-2)/(-8). 1/6 195/(-60)(-38)/(-247)66 -33 Evaluate ((-954)/(-10335))/(3/10). 4/13 What is the value of (7/(-28))/(5/(-2)28/8400)? 30 What is (18/150)/(9-3159/(-4770))? 2/15 Evaluate (-1715)/(-3430)3/((-102)/8). -2/17 What is (1138/(-3414))/((-2)/210)? 35 Evaluate ((-2)/(-5))/(-149/(-126)). 2/5 Evaluate 32/(-48)(-3)/(-18). -1/9 Calculate ((-2889)/(-6420))/(12/5). 3/16 What is the value of ((-5)/20)/(((-72)/(-32))/3)? -1/3 Evaluate -12-3(-2)/(-30)(-30)/(-12). 6 Calculate (3(27/(-9))/36)/((-5)/4). 1/5 Calculate ((-5)/2)/(10/80-70). 2/7 Calculate 6/(17/(272/6)). 16 Calculate (133/57)/((-15)/90). -14 112/(-8)(-11)/(-66)(-4)/2 14/3 What is (-24)/((-27)/((-81)/(-6)))? 12 Calculate (-80)/(-2)(-4)/(-36)(-1038)/(-1730). 8/3 Evaluate (85/510)/((-8)/(-576)). 12 (-12)/(-944)736/(-276) -2/59 What is the value of (210/(-48))/(341/(-2728))? 35 Evaluate (8/6)/2702/(-117). -4 What is the value of (1/7-2)/((16992/(-112))/18)? 2/59 Evaluate 25/(-10)(-784)/(-2940). -2/3 Calculate 3/((-78)/72-18). 2/13 What is (-12)/((2/(-16))/((-13)/208))? -6 ((1160/(-87))/20)/((-1)/3-26) -1/13 What is the value of 2(386/(-579))/(8/6)? -1 Calculate (3/15)/((-47)/1410). -6 Calculate 36/110(-10180)/1527. -24/11 1(-135)/60-1 9/4 2(-15)/105(378/(-4))/9 3 (16/(-1344)7)/((-2)/16) 2/3 What is the value of 41/(-410)(4/(-8))/((-6)/16)? -2/15 Calculate 70/(-28)-4-1. -10 What is (-3(-5)/(-60))/(13/676)? -13 What is ((-2)/(-7))/((-8)/(280/55))? -2/11 ((-17)/1)/((-875)/2625)2/6 17 What is the value of (96/28)/(-6)10/40? -1/7 (77/(-165))/((-86)/(-258)) -7/5 -34/12(-90)/495 2/11 ((-60)/39)/(454/2951) -10 Evaluate 22/(-4)(-378)/(-2079)17. -17 What is (-198)/612(-12)/(-33)? -2/17 Evaluate (-2)/(-60)(-4060)/(-406). 1/3 10/2(1056/110)/(-16) -3 What is ((-13)/((-1235)/114))/((-399)/35)? -2/19 What is ((-21)/49)/(45/(-35))? 1/3 Calculate 2/1(-44)/(-8)1. 11 302/(-28)(-9)/(-15) -9/7 What is (-9)/642/(-315)-35? -7 Evaluate ((-105)/2548014)/(((-2)/(-2))/(-4)). 3/13 Evaluate 6(-112/(-30))/(12/(-10)). -2 What is ((-1182)/(-16745))/(4/17)? 3/10 2/(-2)18/16016 -9/5 (5/(-2))/(35850/(-33460)) 7/3 What is ((-1)/5)/((-29)/(-145))? -1 Evaluate (-440)/(-132)(-9)/(-25). 6/5 What is the value of 5/(-310)78/39? -1/31 Evaluate ((-3)/(-2)86/(-43))/((-126)/(-30)). -5/7 Calculate 201(-30)/75. -8 What is 5856/10986/(-2)? -16 What is ((-8)/(-30)(-108)/72)/(10/10)? -2/5 69/(-3)((-12)/(-12))/((-6)/(-6)) -23 Evaluate ((-2)/(-11))/((-978)/1467). -3/11 What is the value of (3(-5)/120)/((-8)/816-17)? -3/4 What is ((-2014)/(-424))/((12/4)/(-12))? -19 What is (-7(-40)/210)/(4/(-18)3)? -2 Evaluate 0/(-7(-5)/3544/22). 0 Evaluate (8/168-12)/(396/(-42)). 2/33 (-300)/(-42)(-9)/((-135)/42) 20 Evaluate ((-21)/18)/(((-192)/16)/(-24))-3. 7 27/13500308/6 2/25 What is ((-16)/((-880)/(-297)))/((-3)/10)? 18 Calculate ((80/20)/(-23))/(2/(-30)). 10 What is (-1586)/(-7564)(-28)/91? -2/31 Evaluate (22/(-429))/(48/1040-10). 1/9 Evaluate ((108/(-10))/3)/(1206/3015). -9 What is 1123/(-39305)-7(-2)/(-8)? 1/20 What is the value of (60/30)/(2/6)? 6 Calculate -1214(-114)/1368. 4 (-8	{ "pile_set_name": "DM Mathematics" }
- 5. Let l(h) = 6h - 2. Let u(x) = -4b(x) + 9l(x). Suppose -i - 3 = 1. Let d be u(i). Round d to the nearest 10. -40 Let y = 20.9833 - 21. Round y to three dps. -0.017 Let j = -284.99999726 - -285. Round j to 7 dps. 0.0000027 Let k = -2.2000025 + 2.2. What is k rounded to 6 decimal places? -0.000003 Let c = -0.84 + 1. Let f = 0.17 + 0.61. Let d = f - c. What is d rounded to one decimal place? 0.6 Let t(w) = 322500w3 - w2 - 3w - 2. Let g be t(-2). Let s be g/(-18)(1 + -31). Round s to the nearest one million. -4000000 Let n be 150/(-2 - (-196003)/98000). What is n rounded to the nearest one million? 5000000 Suppose -735 = 7z + 1449. Let d be z(3 - (-4964)/12). Round d to the nearest 100000. -100000 Let v = 0.05 + -0.16. Let k = -1 - -1.05. Let u = k - v. What is u rounded to one decimal place? 0.2 Let g = -1.03 - -0.908. What is g rounded to two dps? -0.12 Let f = -0.7 - -1.6. Let i = 0.895 - f. Round i to three decimal places. -0.005 Let y = 83 + -334. Let p = 237.3 + y. Let o = 13.6999943 + p. What is o rounded to six dps? -0.000006 Let r(o) = -9o + 11. Let j be r(-4). What is j rounded to the nearest 10? 50 Let h = -311.7 + 290. Let y = h - -23. What is y rounded to zero dps? 1 Let f(c) = c - c - 10 + 3c*2 + 1 + 10c - 999c3. Let l be f(6). Let i be l64/(-1 + -1). Round i to the nearest one million. 7000000 Let s = 196 + -274. Let w = s + 78.00000164. Round w to seven dps. 0.0000016 Let v be 1 + 1 - 9/3. Let h be v/(3/603062)3. Let n = h + 1083062. What is n rounded to the nearest 100000? 500000 Suppose 1 = -p + 5, -j + 3p - 236 = 0. Round j to the nearest ten. -220 Let k = 11861 + 10010. Let i = k + -22003.882. Let f = -133 - i. What is f rounded to two dps? -0.12 Suppose 2n - 50 = 2. Let l be (-1403996)/(-26) - (-4)/n. What is l rounded to the nearest ten thousand? 50000 Let s = -5632 + 2394. Let j = -3239.1964 - s. Let w = 1.2 + j. What is w rounded to three decimal places? 0.004 Let j(p) = p3 - 9p*2 - 5p + 2. Let k be (-2)/((-4)/(-5) - 1). Let i be j(k). Let n = i + -10. What is n rounded to the nearest ten? 40 Let i = -0.202 + -8.79. Let a = -9 - i. Round a to 2 dps. -0.01 Let p = -12979.202 - -29.202. Let j = 12950.0099935 + p. Let h = -0.01 + j. Round h to six dps. -0.000007 Let c(s) = -s*3 - s + 190000. Let z be c(0). Round z to the nearest 100000. 200000 Let b = 0.068 - -27.932. Let s = b + -27.918. Let x = 0.0761 - s. What is x rounded to three dps? -0.006 Let i = 959099.220612 - -92090.778728. Let s = 1051200 - i. Let k = s + -10. Round k to four decimal places. 0.0007 Let x = 18 + -18.33. Let d = 0.32999948 + x. Round d to seven decimal places. -0.0000005 Let m be (296 + 8/2)-8000. What is m rounded to the nearest 100000? -2400000 Let g = -331.43 - -329. What is g rounded to the nearest integer? -2 Let u(l) = -l + 10. Let d be u(0). Let k be 4/d + 804/(-10). What is k rounded to the nearest one hundred? -100 Let y = 10.81349 - -85.19081. Let q = -96 + y. Round q to 3 dps. 0.004 Let b = -0.2 + 0.4. Let c = b - 0.21. Let x = -0.0100031 - c. What is x rounded to 6 decimal places? -0.000003 Let i = -239 - -56. Let t = i + 182.999791. What is t rounded to 5 dps? -0.00021 Let n = 4.620819 - 5.92087. Let l = -1.3 - n. Round l to 5 dps. 0.00005 Let b = 0.18 + -0.17999987. What is b rounded to seven dps? 0.0000001 Let y(s) = 11s3 - 4s*2 + 5s. Let v be y(2). What is v rounded to the nearest 10? 80 Let h = 18 - 16. Suppose hy = -0y - 680. Round y to the nearest 100. -300 Let n = -29.58 - -30. Let y = -0.4 + n. Let l = -0.0176 + y. Round l to three decimal places. 0.002 Let w = -46787 - -48702.92. Let f = 1961 - w. Let m = -46 + f. What is m rounded to one dp? -0.9 Let t = 0.06 + -0.12. Let b = t - 6.34. Let d = b + 6.39999969. What is d rounded to 7 dps? -0.0000003 Suppose 2h - 246600 - 218484 = -4s, h - 5s = 232535. Suppose h - 802540 = v. Round v to the nearest 100000. -600000 Let n = 0 - 3. Let a = -34458416.0000003 + 34458419. Let x = n + a. Round x to seven dps. -0.0000003 Let j = -17.699 - 27.377. Let r = 0.63 - -44.37. Let w = j + r. What is w rounded to two decimal places? -0.08 Let t = -147 - -155.7. What is t rounded to 0 decimal places? 9 Let x = -2176.182784 + 2220.1829. Let m = x + -44. Round m to five decimal places. 0.00012 Let z be 500/15(-4051 + 1). What is z rounded to the nearest ten thousand? -140000 Let l = 1 - -4. Suppose 0b + b + 1910008 = 2d, -d + 9550004 = -lb. Round b to the nearest one hundred thousand. -1900000 Suppose -2d + 57356470 = 3d. Let c = 109242 + d. Let u = -6580536 + c. What is u rounded to the nearest one million? 5000000 Suppose 0 = 4u + 16, -2n + 2u + 16 + 0 = 0. Suppose -337 + 1185 = -nt. What is t rounded to the nearest 10? -210 Let o = 21128.998 - 21109.99799856. Let i = o - 19. What is i rounded to 7 decimal places? 0.0000014 Let d = 0.5 + -4.5. Let q = d - -10. Let c = q - 6.0002. What is c rounded to 3 decimal places? 0 Let o(r) = 750r*2 - 2r + 5. Let h be o(4). Suppose 4v - 9 = v. Let u be (h + v)/(1/200). What is u rounded to the nearest one million? 2000000 Let a = -81 - -81.0033. What is a rounded to 3 dps? 0.003 Let g = -0.304 + 0.29938. What is g rounded to four decimal places? -0.0046 Suppose 30 + 6 = 4j. Let z be (5 - j)-7931. Suppose -5r = -s + 1195, -r = 5s - z - 2933. What is s rounded to the nearest 100? 1200 Let f = -56.938 + 57. Round f to two decimal places. 0.06 Let b = 0.3 + 1.7. Let o = b - 2.04. Let t = 0.44 + o. What is t rounded to one dp? 0.4 Let p = -241.00000254 + 241. Round p to 7 decimal places. -0.0000025 Suppose 2o - 21291665 = o + i, 5i + 21291661 = o. Let b = o - 13491666. Suppose 5m - b = 4m. What is m rounded to the nearest one million? 8000000 Let u = -3.58 - 0.22. Round u to 0 dps. -4 Suppose -5972852 - 227148 = -2r. Round r to the nearest one million. 3000000 Let h = -3 - -3. Let x be (1 - 1) + h/(-2). Suppose x = -4l - 27719 - 88281. What is l rounded to the nearest ten thousand? -30000 Let a(s) = -13890s3 + 8s*2 - 9s + 6. Let d = -1 + 4. Suppose 6b = db + p + 21, 9 = -3p. Let x be a(b). Round x to the nearest 1000000. -3000000 Suppose -i - 2 = -2i + 3z, 5z - 10 = -5i. Suppose s + 5v - 38990 = 0, 0 = is - v - 82770 + 4768. What is s rounded to the nearest ten thousand? 40000 Suppose -3u = u - 312000. Round u to the nearest 10000. 80000 Let f = -5052 + 7519. Let c = f - 7267. Round c to the nearest 1000. -5000 Let x = 11080 - 3182. Let o = x - 4798. Round o to the nearest 1000. 3000 Let c = -48 - -24. Let y = 0.8154921 + 23.1845519. Let r = c + y. What is r rounded to five decimal places? 0.00004 Let p(h) = 926h - 4. Let i = 0 + 4. Let z be p(i). Round z to the nearest 1000. 4000 Let a = -36 + 138. Let f = a + -107.3. What is f rounded to 0 decimal places? -5 Let q(n) be the first derivative of -n2 - 17n - 1. Let i(x) = x + 8. Let c(u) = -7i(u) - 3q(u). Let k be c(0). Round k to the nearest ten. -10 Let f = 141 + -140.01. Round f to one dp. 1 Let q = 9.211467 - 0.110607. Let h = 9.1 - q. What is h rounded to four decimal places? -0.0009 Let z be 12/4640004/(-6). Let t be z + 4/(6/3). Round t to the nearest 100000. -300000 Let p be 10/(-4)(-8)/10. Let v be (p - 1)-2 + 336002. Suppose -2m - v = -6m. What is m rounded to the nearest ten thousand? 80000 Let m = 3887.27516 - 7879.175185. Let n = -3992 - m. Let l = -0.1 - n. Round l to five decimal places. -0.00003 Suppose 2a - 5a = -16227468. Suppose -273582 + a = -z. Let v = 9535574 + z. What is v rounded to the nearest one million? 4000000 Let p = -0.8 - 3.2. Let s = 4.0024 + p. What is s rounded to 3 decimal places? 0.002 Let s = -0.38 + 1.25. Let w = 0.870059 - s. Round w to five dps. 0.00006 Let l = -0.6 + 0.706. Let g = l - 0.11. What is g rounded to 3 dps? -0.004 Let o(l) = -1800l. Let w be o(3). Round w to the nearest 1000. -5000 Let k = 3.75 - 3. Let n = k - 0.2. Round n to one dp. 0.6 Let t = 20.4 - 21.47. Round t to one decimal place. -1.1 Let b(x) = 47778x2 + 2x + 4. Let z be b(-3). Round z to the nearest one hundred thousand. 400000 Let m = -6 - -4.61. What is m rounded to 1 decimal place? -1.4 Let l = -21 + 16. Let w(z) = 518z + 1 - 6 - 199z. Let m be w(l). Round m to the nearest one thousand. -	{ "pile_set_name": "DM Mathematics" }
/n)nn)(-1/39) assuming n is positive. n(-3181/39) Simplify ((t(-2/3))9(tt(-1/7))/t(1/11))/(t*(2/9)t*(-2)t*(1/3)tt(1/4)) assuming t is positive. t(-13969/2772) Simplify ((m/(m/m(-27)))/(m(19/5)/m)(mm(-15))(11/7))27 assuming m is positive. m(-6993/5) Simplify b/b(-41)bb(-9/11)(bb6/b)/bb(-12) assuming b is positive. b(387/11) Simplify (i/(((ii0)/ii)/i))*43(i6/i)/(i/(i/i(-3/2))i)i*(-6)i*(2/13)i*6i(3/11) assuming i is positive. i(13993/286) Simplify ((i1)(11/3)/((i*(-5)i)/(iii*(-7)ii)))/((ii/(i*(2/7)iiii)i)*(-4/43)i/(i/(ii(-7)))i1) assuming i is positive. i(8621/903) Simplify ((q*(2/5)q)34)(-2/37)((((q5/q)/q)/q)/(qq(1/5)))/(((q(-3/4)/q)/q)/(q*(2/7)q)) assuming q is positive. q(11721/5180) Simplify (a(-6)/a(-4/3))19/(a/((a*6/a)/a)a(-3))(2/41) assuming a is positive. a*(-10870/123) Simplify ((ww*(1/18)ww)(-6)/((w23w)/w15))37 assuming w is positive. w*(-3034/3) Simplify (((((c/(cccc*29/cc))/cc)/c)/(cc(-2/27)))/((c/c(2/3)c)/(cc(c(-18)c)/c)))(-42) assuming c is positive. c(18998/9) Simplify ((qq(-3/7))/qqq/(q(2/9)/q)(qq(5/4)q)/(q/(qqq*(1/6))))/((q/(q/((q/(q/(qq(2/3))))/q)))(37/2))(-26) assuming q is positive. q(82513/252) Simplify ((s*0s)/(ss(14/9)/s)ss(-1/5)s/(sss/s(3/7)))26 assuming s is positive. s(-10868/315) Simplify (j13)*(-1/21)((jj/((j/(jj*15))/jj))/j)/(j/(jj(3/8)jjj)) assuming j is positive. j(3151/168) Simplify ((c(-2))(-23))(-10)/(cc(2/7)ccccc*6c*1c(-3/2)/c) assuming c is positive. c(-6577/14) Simplify ((q(1/4)/(q37/q))/(q/(q/q*(-3/5))q/(q*(-6)q)))(16/3) assuming q is positive. q(-3292/15) Simplify rr8r*(-4/7)(r*0r)*(-26/9)(rrr(-1/3)/r)(1/5)r(-8)r8 assuming r is positive. r(1787/315) Simplify ((m/m(4/15))(-9/8)m/m(15/7)m(2/109))(-31) assuming m is positive. m(1844469/30520) Simplify ((r/r7)/rrr*(7/5)r)(5/7)/(r(-4)/((rrr(-9))/r))(-49) assuming r is positive. r*(1354/7) Simplify ((t/(tt(1/2)))(3/16))(-1/16)/(t(1/3)t(-1))16 assuming t is positive. t(16393/1536) Simplify ((kkk32)(-36)k*(-1/4)k(-1/17))(-6/29) assuming k is positive. k(249759/986) Simplify (((m/(m(-3/2)m)mm)/m(mm(-18))/m)/(m10/m(2/15)))36 assuming m is positive. m(-4566/5) Simplify ((xx4)/x(2/5))*(-46)((x*(3/2)x)(2/27))2 assuming x is positive. x*(-28516/135) Simplify ((kk/((k(k(-5)k)/k)/kk))/(kkk(2/7)))(34/7)((k(-1/3))(-47))17 assuming k is positive. k(41803/147) Simplify ((w1)(1/31))*(-5/14)(((w/(w1/w))/w)/w)(16/9)/(w*4w/(w*(-1/4)w)) assuming w is positive. w*(-47179/7812) Simplify ((bbb(1/4))13)(-34)/((bb*(-4/5)bb(-2/3)b)/((b*(1/4)b)/(b/(b*(2/13)b)b))) assuming b is positive. b(-776591/780) Simplify (n(n/(n/(n(n/n(2/7))/n)))/nn(-1))(4/11)/((n*0n)46/(n(1/4)/(n*(1/4)n))) assuming n is positive. n(-3627/77) Simplify (h(-1)h)(-1/4)/(h/(h(h/((h/((hhh*(-2/3)hhh)/h))/hh))/h))(1/7)((h*2h)(-3/7))40 assuming h is positive. h(-1073/21) Simplify ((i/i(-2))(1/14))26/(i*5ii4ii(-6)/(iii/i(-8))) assuming i is positive. i(81/7) Simplify (q34/q(2/5)(q*13q)/qq(2/51)/q)(2/35) assuming q is positive. q(23276/8925) Simplify ((a11aa(-20/7))/(a4)(-8/7))40 assuming a is positive. a(3840/7) Simplify (b/(b6b)b/b(-5))(14/11)/((b0b)36/(b(1/2)/(bb/(b/((bb1)/b))))) assuming b is positive. b(-75/2) Simplify (nn1(n*4n)/nn(1/3)/n(-6))/(((nnn0n)/n)(-27))(1/22) assuming n is positive. n(488/33) Simplify (d(3/7)d9)(9/7)/((dddd*5(dd/d(-2/11))/dd)/(d*(-7)d/(ddd/(d*(-5/3)d)))) assuming d is positive. d(-12493/1617) Simplify ((y(-1/3)yy)/(y*(-2)y)y(-3/4)/y6)/((y(-3/4)y)/(y*(6/5)y)y8/y1) assuming y is positive. y(-137/15) Simplify (((s/(ssss*(-7)/s)s/(s/s*(-2)))/(s(s/(s/s*0))/ss)(-24))(-2/3))28 assuming s is positive. s(-1568/3) Simplify ((x/(xx13))(1/10)x/x*(-2)xx(-2/59))20 assuming x is positive. x(3146/59) Simplify ((oo/((o*(4/7)oo)/o)o)/oo)(-36)(oo16o)32 assuming o is positive. o(3672/7) Simplify (((vv5v/v(1/6))/(v(-2/13)v/(v(1/3)/v)v))50)17 assuming v is positive. v(143225/39) Simplify ((s35s)/(ss/s*34)(s/(s/(s/(s/s*(-7/5)))))/(s/(ss/(s*(2/11)s)s)))41 assuming s is positive. s(152028/55) Simplify (g(-1)g(-1))(-5/19)(g3g/((gg1)/ggg)gg)/(g/(gg/g*3g)g(-2)) assuming g is positive. g(86/19) Simplify k/(kk/k*(-4/7))k*1(k/k0)(-31)(k1)(1/94)(k(-1/2))(-47) assuming k is positive. k*(-2652/329) Simplify (((vv*(-4)vv)/(v/(v/(v(-3/2)/v))))/((v/v(-1/4))/vvvv(-5)))/((((v/(v(-10/7)v))/v)/vv)/vv(-2/9))(-41) assuming v is positive. v(-7129/252) Simplify ((ff(-21/2)/f)/f)(-3/16)f8f/(fff/(ff(6/37)))f assuming f is positive. f(12217/1184) Simplify ((j8/jj(jjj(-2/13))/j)/(j/j(-19)j(-2/21)))(4/5) assuming j is positive. j(-12076/1365) Simplify (((rr*2)/(rr/(rr/((r6/r)/r))r))/(r1)(-2/17))/((r*(-1/9)/((rrr2)/rr))/(r*(-2)/rr(3/5))) assuming r is positive. r(-131/765) Simplify (z*4zz/(zz(-3/2)))(-12)((z/z(-1))(17/4))(-44) assuming z is positive. z(-452) Simplify ((o1)(4/5)(oo/o(5/6))/o(2/5))/(((oo/o*(-6/11))/(oo(-2/7)))/(o(-1/3)/o)2) assuming o is positive. o(-2257/770) Simplify ((u/u(-1))(-4/37)((uu*(-2))/u)/uu/(u*(1/5)/u))/((uu*(-4/7))/uu/u(-1/13))(-5/3) assuming u is positive. u(-28976/50505) Simplify (((c(-1/14)/c)/c)/c22)/(c(-7))(-1) assuming c is positive. c(-435/14) Simplify ((zz(1/6)zz/(zz/(z/z*(1/6)z)))/(((z/z(-1))/z)/z)(30/11))/(z1/(z(-5)/z)(z(2/3)z)(1/74)) assuming z is positive. z(-893/222) Simplify ((f(-1/4))(-2/7))*42(f0)(2/15)/(f*(2/7)f*(-2)ff) assuming f is positive. f(19/7) Simplify ((n/(n(2/3)n))(-37)/(n(-2/7))(-2/43))/(n(-6)/nnnnn(-2/3))(-20) assuming n is positive. n(-62018/903) Simplify (b(-2/3))*(-2/45)bbb*(-1/4)(b/b*2)/bb(-1/2)/b(-5)(b/b(-1/3))(-27) assuming b is positive. b(-17129/540) Simplify (((w/(w/w(3/7))w)/w(-3/4))/(w(-2/5)ww)11)(-27/2) assuming w is positive. w*(58293/280) Simplify ((n/(((nn(-7))/n)/n))37/(nn(-5/7)n)(-1/48))(6/17) assuming n is positive. n*(111897/952) Simplify (((qq*(-13/5))/qq(-5/3))/(q(-1)qq(-2/3)))17 assuming q is positive. q(-306/5) Simplify ((b(3/17)b(-6/13))/(bb*18bbb*(-2/3)b))(-25) assuming b is positive. b(358325/663) Simplify ((c14)(-13)c((c/((cc(1/6))/c))/c)/ccc(9/7))37 assuming c is positive. c(-279535/42) Simplify ((c/(c/((c(-5/3)/c)/c)))/c(-45)(c*23c)40)(1/8) assuming c is positive. c*(751/6) Simplify (((aa*(2/7)aa)3a*(-7)(a*(-2/5)a)/a)(-16))(-5/4) assuming a is positive. a*(344/7) Simplify (y/(yy*(-14))yyy*(1/9)y)*(3/5)(y(2/9))(-10/9)y(-6)/(yy(-1/5)) assuming y is positive. y(1304/405) Simplify ((w0)39/(w(-2/7)/(w14/w)))(-1/61) assuming w is positive. w(-93/427) Simplify (((y*9y*7)/(y(y/y(-2/5))/y)(-2/107))(-8/9))(-23) assuming y is positive. y(525872/1605) Simplify (u(-4/5)u(-3/10))(-1/4)/((u(3/5)/((u(-2/3)u)/uu))/(u(1/2))36) assuming u is positive. u(2161/120) Simplify ((x6/x)/(x(-3/5)x)x(-18)/x8)(-1) assuming x is positive. x(107/5) Simplify (f(-5/2)f/(f/f*(-2/11))(f*(-1)/f)/ff(-1))/(((f(-1/4)f)/(f5/f))/((f/(f/(f/f3)))/f(1/4))) assuming f is positive. f(-125/22) Simplify b/(b(1/2)b)b/((bb*4)/b)(b/(b*(-1/4)/b)b)*9(b/(b*(-3/2)b)((b/(b(2/17)/b))/b)/b)(-9/2) assuming b is positive. b(332/17) Simplify ((f(-22))(-30)((((ff(-15))/f)/f)/ff)(-3))31 assuming f is positive. f21948 Simplify ((g/g(-6/7))/(g*(2/17)g))*(-6)((g(-1))(-32/5))(-6/17) assuming g is positive. g(-3984	{ "pile_set_name": "DM Mathematics" }
of 595/(-56) - -8 - (-390)/156? -1/8 Evaluate (-2)/(-1)(2 + 9/(3 + -6)). -2 Calculate ((-108)/(-15))/((-120)/(-500)). 30 What is 28/8((-6)/20)/((-336)/40)? 1/8 Calculate -13 + 26(-2)/(-4) + 2/(-19). -2/19 0/(9/36-16) 0 What is -15 + 18 - ((-2)/(-3) + (-128)/(-54))? -1/27 Calculate ((-17 - -21)/(-4))/(2/(-30)). 15 What is 1/(81/18 - 1)? 2/7 (-34972)/(-123651) + 31/33 + -1 2/9 Calculate ((-136)/80 + 2)((-17)/6 + 2). -1/4 What is the value of (10/(-20)3)/(3/(3-6))? 9 Evaluate 8 + (-6)/(-1350)18-99. 2/25 What is (-2 - 21/(-10))/(208/2080)? 1 What is -12 + (-36 - -50) - -18? 20 What is (-4)/(24/3)(-426)/(-639)? -1/3 ((-21)/((3 - 2)-1))/(522/(-522)) -21 Evaluate 5225/1904/22. 5 What is the value of ((15225/63)/29 + -8)(-1 + -56)? -19 (((-5520)/(-161))/(-10))/((-4)/(-14)) -12 What is 7/(-4)2/(-14) - (-14)/(-24)? -1/3 Evaluate 1263/27 - (-170)/(-12). -1/6 What is (4/6)/(-9 + (-7)/(-42)50)? -1 What is the value of (0 - (-9 - -2)) + 2 - 22? -13 What is the value of (-8)/(-24) + 3 + 120/(-54)? 10/9 Calculate 1/(-5 + (-396)/(-81)). -9 317 + -329 + 18/2 -3 ((-47 - -23)/(-720))/(1/(-9)) -3/10 Evaluate -32/(-33) + ((-658241)/24090)/127. -1/30 Calculate (-44496)/10197(-11)/(-2). -24 (3 - (-57)/(-21))/(67/1764) 12 What is the value of 82/1148210 + (0 - -8)? 23 What is the value of 2(6 - 3/((-11)/(44/(-3))))? 4 What is the value of 88/10 + 292/(-365)? 8 What is (364/21)/13 + 32/(-72)? 8/9 What is the value of 184/7 - 27 - (-79)/(-7)? -12 Evaluate ((-3)/2)/(-3)(19 - (-518)/(-28)). 1/4 What is ((-14)/1)/(-664 - -655)? 14/9 Calculate 5 + (-371)/77 + 212/44. 5 Evaluate -5-6(-16)/(-40). 12 Calculate 20 + 14 + -54 + 2. -18 What is ((43/6)/((-104)/72) + 5)/(-1)? -1/26 Calculate ((-19)/(5320/(-160)))/((-4)/(-14)). 2 Evaluate ((-2)/7)/((-117)/(-273)) + 99/135. 1/15 What is the value of (-10 + (42/36 - -9))(-9)/(-4)? 3/8 -9 - 27/(162/(-30)) -4 Evaluate 14/(-4)(-2620)/(-917). -10 What is (2 - 17) + (-2747)/(-164)? 7/4 Evaluate (3/6)/((-54)/1404). -13 What is (-23)/3 - 468/130(-10)/6? -5/3 What is the value of 2/(40 - (-2600)/(-78))? 3/10 What is ((-260)/25)/(280/700)? -26 What is ((-11203)/(-1318))/(1/2)? 17 What is (-21)/(-35)(-11 - -6)-111? 33 Calculate ((-20)/(-14))/(4 + -16 + 11). -10/7 What is -4 + 7/5 + (-7896)/940? -11 Calculate 12 - 12/(-7)(45/(-10) - -1). 6 Evaluate (-5046)/406 - 4/7. -13 What is 362/(-26) - (-47)/(1504/448)? 1/13 Calculate (-10)/105(-3 + (-75)/(-10)) - 0. -3/7 Calculate 26 - 6 - 15/((-150)/(-80)). 12 (-3486)/(-1078) + (-405)/189 12/11 What is the value of (-7 + 5)/4-2(1 + 2)? 3 -15 + (-42)/77 + 5218/330 4/15 Calculate 1/(80/48)(9/2 + -2). 3/2 Evaluate ((-12)/20)/((-116)/(-140) + (-50)/125). -7/5 What is the value of 478 + -483 - (-10 - -1)? 4 What is ((-154)/(-1617))/(11/77)? 2/3 Evaluate (-61)/(-1952) - (-492)/640. 4/5 What is the value of (-176)/(-12 + 28) - (1 + 10)? -22 Calculate (-2)/(3 - -2 - (-48)/(-12)). -2 (28/(-12) - -3)/((-78)/(-468)) 4 What is 100/28 + (12 - 17 - (1 + -1))? -10/7 What is 3358/292 - (-10)/(-1)? 3/2 What is the value of 4(-5 + 4)/(9 + -8)? -4 Calculate 9/((-90)/11) - (-12)/(-30). -3/2 32/(-528) - (-1825)/165 11 Evaluate (12/8)/(-21 - (-4266)/144). 4/23 Calculate 2/((-90)/(-333)) - (-7)/(-5). 6 Evaluate 100/(-44) + -12 + 4050/330. -2 Evaluate 2268/3528(-4)/(-6). 3/7 Calculate 26((-2270)/250 - -9) + 2. -2/25 (0 - 8/(-72)) + (-2576)/(-144) 18 Evaluate ((-82)/(-42) - 2) + (-4 - 2850/(-315)). 5 What is the value of 78/286 - (5 + 102/132)? -11/2 (-8)/(-14)(-41)/164 -1/7 (8 + (-697)/85)/(72/35 + -2) -7/2 What is the value of 7/2((-195)/126)/65? -1/12 What is -2 + (-17)/(-6) - (182/168 - 3)? 11/4 Evaluate (912/(-247))/(-24) - (-134)/(-26). -5 What is the value of (-3)/(-2) + 1638/364? 6 Calculate 47(9 - 280/30) + (-63)/27. -18 What is the value of (-2 - 0)/10(-2)/(-12)15? -1/2 What is the value of (-18)/32(-8)/(-252)21? -3/8 What is 24/(-7800)-9451 - 29? 2/25 What is the value of (-18)/2 - (-187 - -187)? -9 What is (2/4)/(619/1238)? 1 What is (-5)/6-10(-10)/(-50)? 5/3 What is the value of 290/348(-3)/15334? -17 Evaluate ((0 - -1)/((-44)/22))/(125/150). -3/5 What is the value of (21420/936)/(-85)8/14? -2/13 What is the value of ((4/(-1))/(-2))/(21 - 12520/600)? 15 What is (-166443)/12725 + 4/50? -13 What is (340/(-204))/((-35)/12)? 4/7 Calculate 36/(-3) - (-1)/((-220)/(-2673)). 3/20 Evaluate -2 - ((-2)/(-8) + (-1674)/248). 9/2 Calculate (-16)/14 - 59535/(-1715). 11 What is the value of ((-14)/3 + 6)/(19/114)? 8 What is 22 + (-49)/(-14)(-16)/14? 18 What is 1337/7641/((-5)/(-30))? 21/2 Evaluate (4/6)/(1140/180). 2/19 Calculate 13/((-260)/(-840)-7). -6 Calculate 5/80684. 17 What is the value of 20/(-6)(-4992)/(-2080)? -8 Calculate (-20)/(-14)8462/4224. 5/4 Evaluate (-40392)/(-20493)(-3)/2 + 3. 1/23 Calculate 46((-10)/(-85))/(60/255) - 12. 11 Calculate -1 + -3 + -1 - (-317 - -303). 9 Evaluate ((2/4)/((-60)/(-120)))/(-5). -1/5 Calculate 1675/(-25)-1. 27 ((-2420)/(-100) - 20)-1 -21/5 Calculate (5181/(-12089))/((4 - 2)/(-56)). 12 What is 171/1368 + (-195)/(-40)? 5 4/(-58) - (-252)/33933 2/13 Calculate ((-819)/(-104))/((-3)/(-4))8/14. 6 Evaluate 3996/405 + (6 - 15 - 1). -2/15 -62 + 61 - -2 - (1 - 9)/(-1) -7 What is the value of (-280)/15 - (-23 + 3)? 4/3 (-1032)/(-387) - 105/9 -9 Evaluate -1 - (-1011/(-132) + 3/18). -2 Calculate ((-23)/((-2116)/69))/(2/8). 3 Evaluate 15/(-35)(-157 + 115). 18 What is the value of 78(-2)/16 - -9? -3/4 What is (-62)/651 - (3 - (-2256)/126)? -21 What is 28 + -40 - 22/33-21? 2 Evaluate (-33 - 11)/((-4)/(-1)). -11 44/2 - 2376/132 4 (-1 + 8/(-2))265/795 -5/3 What is ((-322)/(-252) + (-4)/(-18))/((-3)/12)? -6 Calculate (312/33 + -10)/(1/(-22)). 12 Calculate (-54)/(-22) - (-654)/1199. 3 What is the value of (7 + 1236/(-168))/((-135)/216)? 4/7 Evaluate 56/((-48)/(-6)) - (2 - (6 + -10)). 1 What is the value of 910/(-35) + (-42)/(-7)? -20 What is the value of (13/136540)/(30/35)? 4/9 Evaluate (((-504)/144)/(((-21)/6)/(-7)))/4. -7/4 Evaluate (4/(-26) + (-6237)/(-6318))(-5)/50. -1/12 Evaluate 12 - (-105 + 106). 1 What is the value of ((-2)/2)/(153/2448)? -16 (66/(-8))/((-261)/36 + 8) -11 Calculate 28/132 + 198/(-1089). 1/33 What is the value of (-493)/(-986)(2 - (-6)/21)? 8/7 What is (18/(-4))/3 + 7 + 2240/(-384)? -1/3 Calculate 392/98(0/(-1) + (-2)/14). -4/7 Evaluate (96/(-624) - 0) + 29/104. 1/8 What is the value of (-1800)/1700(-2)/(7 + 17)? 3/34 What is the value of ((-29)/(-203))/((-4)/40)? -10/7 -5 + (-2)/(-64)-80 -5 What is the value of ((-3)/2)/((-1363)/174 + 8)? -9 (-19 + 18)-11 - (-37)/(-2) -15/2 Evaluate ((-2)/(-8))/(33/(-44)(-2)/(-12)). -2 Calculate 32/1413251/(-1262). -24 What is 45/(-35) + 7820/6188? -2/91 -29/12(1456/(-8))/(-13) -21 Calculate (-5)/(-25) - (-504)/(-120). -4 (-6)/(18/21) - (-741)/117 -2/3 What is ((-34)/10)/(((-3569)/430)/(-83))? -34 What is -32 - ((-275)/(-22))/((-108)/72)? 7/3 (5/(-2) + 1)/(158/(-316)) + -28 -25 (-8)/(8/(-3)) - (13 + -11 - -22) -21 (2/(-8))/(8(-69)/736)-114 -38 Evaluate (1 - 110/114)/((-422)/633). -1/19 Evaluate 11/66 - (-459)/(-324). -5/4 What is the value of (-1)/((-1)/8) + (-57 - -50)? 1 What is the value of (-464)/174(5 + -2)? -8 What is (-30 + 20370/680)8? -6/17 (-41755/(-360))/((-6)/(-8)) 26 ((-87)/27 - -1)198/(-264) 5/3 (9/2)/(-32 - (-1449)/46) -9 Calculate -3 - -1 - (41 + -36). -7 Calculate ((-75)/(-6) + -5)(-16)/(-216)9. 5 ((-98)/147)/((-2)/18) 6 What is -1 + 308/385(-7)/2? -19/5 609/(-105)24/18(-15)/(-4) -29 What is 1218/2639 + 8/(-26)? 2/13 What is the value of ((-3)/2)/((-102)/(-204)) - 3? -6 What is ((-4)/((-72)/(-135)))/(3/(-2)) - -3? 8 Calculate (1 - 3) + (-4)/(-10) + 340/200. 1/10 Evaluate (2/4 + -1)(1 - (-21)/21). -1 137 + -140 + 945/130 8/13 Calculate ((-2)/(-1))/(226/(-130)). -5 What is -10 - 7/(154/(-374))? 7 What is 3/(11 + (9 - 21)) + -15? -18 (-735)/(-23) + 16/368010 32 What is 1416/(-15340)3/(9/(-10))? 4/13 What is (20 + -21)-14 - (-106)/(-8)? 3/4 What is the value of (26398/(-4824) - (-5)/4) + 6/27? -4 ((-72)/(-630))/(28/70) 2/7 Calculate 7 - 4 - (-450)/50. 12 What is the value of 1/(2/(-2) - 47/(235/(-6)))? 5 What is 8618/2790 + ((-2)/(-1))/(-10) + -3? -1/9 What is -5 - 2 - 3*(7 - 6)? -10 What is 1/(-7) - ((-275)/(-1820))/((-1)/4)? 6/	{ "pile_set_name": "DM Mathematics" }
the nearest one hundred thousand? 9000000 Round -29340460.45 to the nearest 10000. -29340000 Round 0.00759808136 to 4 dps. 0.0076 Round 0.00003396348308 to five decimal places. 0.00003 What is -4.1082337 rounded to 3 decimal places? -4.108 What is 18361.3801 rounded to the nearest 10? 18360 What is -74827515 rounded to the nearest 100000? -74800000 What is -0.0001891225078 rounded to six decimal places? -0.000189 What is 9435164.52 rounded to the nearest one million? 9000000 Round 12.298781 to two decimal places. 12.3 Round -0.015680008 to 6 dps. -0.01568 What is -2427042.212 rounded to the nearest one thousand? -2427000 What is 0.00036242625 rounded to 6 dps? 0.000362 Round -816942.96 to the nearest ten thousand. -820000 What is -0.193323596 rounded to five decimal places? -0.19332 What is -0.00090684692 rounded to five decimal places? -0.00091 Round -68914272 to the nearest one hundred thousand. -68900000 What is 0.0055301268 rounded to 4 dps? 0.0055 What is -727.52409 rounded to one dp? -727.5 What is -15393.310774 rounded to the nearest one hundred? -15400 What is 8246.48242 rounded to the nearest integer? 8246 What is -48200590.91 rounded to the nearest one hundred thousand? -48200000 What is -112206614.02 rounded to the nearest 1000000? -112000000 What is -0.000020675565 rounded to six dps? -0.000021 Round 0.00192475521 to 5 dps. 0.00192 What is -18284254200 rounded to the nearest 1000000? -18284000000 Round -0.004963627557 to three decimal places. -0.005 What is 0.009676261377 rounded to six decimal places? 0.009676 What is -91422316 rounded to the nearest 100000? -91400000 What is 0.00060803952 rounded to 5 dps? 0.00061 What is 0.001759335041 rounded to four decimal places? 0.0018 What is -0.0004009115522 rounded to 5 decimal places? -0.0004 Round 232096950400 to the nearest 1000000. 232097000000 Round -8.83329659 to 0 decimal places. -9 Round -0.00992511904 to six decimal places. -0.009925 What is 0.0065402563 rounded to 6 dps? 0.00654 Round -3629951.9 to the nearest 10000. -3630000 What is -13283.3505 rounded to the nearest ten? -13280 What is 306.83343 rounded to the nearest integer? 307 Round 22464.2487 to 0 dps. 22464 Round 49926.8982 to the nearest one thousand. 50000 Round 0.00052453678 to 7 dps. 0.0005245 Round -2333.922137 to the nearest one hundred. -2300 Round 11.72606606 to the nearest integer. 12 Round -0.00188787857 to 6 decimal places. -0.001888 What is -343662.346 rounded to the nearest 1000? -344000 Round -56869.3372 to the nearest one thousand. -57000 Round 88.38998 to the nearest 10. 90 What is -853640.004 rounded to the nearest one hundred? -853600 Round -30576.23444 to the nearest ten. -30580 Round -24793478 to the nearest 10000. -24790000 What is 0.00000510622888 rounded to seven decimal places? 0.0000051 Round 0.01572085541 to five decimal places. 0.01572 Round 0.0468942873 to 3 decimal places. 0.047 What is 0.000015136252 rounded to seven dps? 0.0000151 Round -0.0000013311709 to seven decimal places. -0.0000013 Round 0.00000346661156 to six decimal places. 0.000003 Round -53545497870 to the nearest one million. -53545000000 What is -2689.576281 rounded to the nearest integer? -2690 What is 288.7077145 rounded to the nearest integer? 289 Round 21637003 to the nearest ten thousand. 21640000 What is -586646152 rounded to the nearest 1000000? -587000000 What is 2.436914274 rounded to two dps? 2.44 Round -0.0016344880432 to five decimal places. -0.00163 What is -68286.861 rounded to the nearest one thousand? -68000 What is -1227.107828 rounded to one decimal place? -1227.1 What is -0.0294092736 rounded to six dps? -0.029409 Round -1985990.92 to the nearest one hundred. -1986000 What is -51701511.1 rounded to the nearest one million? -52000000 What is -34720421 rounded to the nearest one million? -35000000 Round 8510.1389 to the nearest 1000. 9000 Round 187534.0002 to the nearest 1000. 188000 What is -0.02726006035 rounded to 4 decimal places? -0.0273 Round 569017.1036 to the nearest 1000. 569000 Round 2711411.62 to the nearest 100. 2711400 What is -1305257.589 rounded to the nearest 10000? -1310000 What is -0.000706786 rounded to 4 decimal places? -0.0007 Round 390.4941064 to 2 dps. 390.49 Round 4007548.15 to the nearest one hundred. 4007500 Round -0.00003476887098 to seven decimal places. -0.0000348 Round -0.002339600681 to six dps. -0.00234 Round -0.00024469958 to six decimal places. -0.000245 What is 0.0000106625974 rounded to 7 dps? 0.0000107 Round 30025.7534 to the nearest 10. 30030 What is 182925.9103 rounded to the nearest 100? 182900 What is 0.000089936669 rounded to five dps? 0.00009 What is -3.72860715 rounded to three decimal places? -3.729 What is 65089.83408 rounded to the nearest ten? 65090 What is -0.020711262 rounded to three dps? -0.021 Round -5.65423787 to three decimal places. -5.654 What is 2684082.21 rounded to the nearest 100000? 2700000 Round 0.00000145279048 to 7 decimal places. 0.0000015 What is -2833673.3 rounded to the nearest one hundred thousand? -2800000 Round 0.0000010734023 to six decimal places. 0.000001 What is 8393564.64 rounded to the nearest ten thousand? 8390000 What is 2.17808629 rounded to four decimal places? 2.1781 What is 11.2155493 rounded to 0 decimal places? 11 What is -29.129727 rounded to 2 dps? -29.13 What is -0.0000636403408 rounded to 5 dps? -0.00006 What is -349506979 rounded to the nearest 100000? -349500000 Round 2494.8914 to the nearest 10. 2490 What is 0.00000114002038 rounded to six decimal places? 0.000001 What is 0.000001143617793 rounded to seven dps? 0.0000011 What is 0.4080287009 rounded to 2 dps? 0.41 What is 0.00230372641 rounded to five decimal places? 0.0023 Round -712.8512433 to 0 dps. -713 Round 173593.3804 to the nearest 100. 173600 What is -0.00893912496 rounded to 6 dps? -0.008939 Round 9.42567287 to four decimal places. 9.4257 What is -0.003948282379 rounded to five decimal places? -0.00395 Round -3622.29156 to the nearest 10. -3620 What is -22617.2525 rounded to the nearest ten? -22620 What is -0.0077071069 rounded to five decimal places? -0.00771 Round 0.5700149963 to 4 decimal places. 0.57 What is -3215139900 rounded to the nearest 1000000? -3215000000 What is -34.05704505 rounded to two dps? -34.06 Round -149.942766 to one decimal place. -149.9 What is 0.2403380697 rounded to 3 decimal places? 0.24 What is 16.4016337 rounded to the nearest integer? 16 Round 0.000113382828 to 6 decimal places. 0.000113 Round 0.02795972158 to three decimal places. 0.028 What is -2002.1190426 rounded to the nearest 10? -2000 Round 0.002446803632 to six decimal places. 0.002447 Round 14781375.91 to the nearest one thousand. 14781000 What is 3174.80971 rounded to the nearest ten? 3170 What is -7478213.99 rounded to the nearest one hundred? -7478200 What is -2692778.84 rounded to the nearest ten thousand? -2690000 What is 413.990123 rounded to two decimal places? 413.99 What is 7414.694615 rounded to 1 dp? 7414.7 What is -0.03163003997 rounded to 2 decimal places? -0.03 What is -0.00017640958 rounded to 4 decimal places? -0.0002 What is 11129.731 rounded to the nearest 10000? 10000 What is 0.391037889 rounded to three dps? 0.391 What is -474049.072 rounded to the nearest ten thousand? -470000 Round -80560789100 to the nearest 1000000. -80561000000 What is -2248988.43 rounded to the nearest 1000? -2249000 What is 0.000123535845 rounded to seven dps? 0.0001235 What is 0.2211035405 rounded to 1 decimal place? 0.2 What is 84029.428 rounded to the nearest 10? 84030 Round 35225295 to the nearest ten thousand. 35230000 What is 28383313890 rounded to the nearest 1000000? 28383000000 Round 0.000004329210691 to 6 decimal places. 0.000004 What is -48.6038213 rounded to the nearest ten? -50 What is 347.157238 rounded to two dps? 347.16 What is 0.000000573412716 rounded to 7 decimal places? 0.0000006 What is -2210555.962 rounded to the nearest 1000? -2211000 What is -0.00000000912813 rounded to seven decimal places? 0 What is 0.2780530478 rounded to five dps? 0.27805 Round 0.157279089 to 2 dps. 0.16 What is 1.23137174 rounded to 1 decimal place? 1.2 What is 39.531223 rounded to 0 dps? 40 What is 0.124793985 rounded to 4 decimal places? 0.1248 Round 6544.11226 to one decim	{ "pile_set_name": "DM Mathematics" }
he nearest to k? (a) -1/5 (b) 1/4 (c) -0.5 b Let t = -3 - -2.5. Let x = 150 - 149.942. Let p = -0.458 + x. What is the closest to 2 in -1/9, t, p? -1/9 Let h be 27/(-540)16 + 13/10. Let d be 12 - 12/9. Which is the closest to d? (a) h (b) 1 (c) -1 a Let a = -0.888 - -37.988. Let k = a + -36.7. What is the closest to -6 in -5, k, -3? -5 Suppose -91 = 4y - 35. Let l = -235 - -237. What is the closest to y in 5, l, 0.2? 0.2 Let b be 2/(-4)(-8)/18. Let p = 16.6663 - 16.7063. What is the closest to 0 in p, 9, b, 1/7? p Let u be (30/8 - 2)(0 + (-24)/(-84)). What is the nearest to -3/4 in 5, -0.01, u? -0.01 Let n be -82214/(-714) - 16. Which is the nearest to n? (a) -3 (b) 1/4 (c) 3 (d) 1/11 d Let z be (1/(-8))/(6/8). Suppose 14w = 18w - 80. Suppose -4i = -0i + w. Which is the nearest to 2? (a) 0.1 (b) z (c) i a Let k be ((-585)/(-975))/(0 + -6). Which is the nearest to -9/4? (a) 4 (b) k (c) 0.4 b Let w = -0.15 - 0.25. Suppose -16y = -23y - 7. Which is the closest to 9? (a) w (b) y (c) 3 c Let t = 10928 + -21865/2. Let l = 0.2 + -0.1. What is the nearest to t in -0.2, l, -5? -5 Let y = 305 - 280. Suppose -39h + 42 = -yh. Which is the nearest to -0.1? (a) 0.1 (b) 14 (c) h a Let k = 2190 - 2189. Which is the nearest to -0.4? (a) -2 (b) -4 (c) k (d) 1.3 c Suppose 0 = -2c - 0 - 2. Let l = 60.21 + -60.41. Let h be (30/8)/(3/2). What is the closest to l in c, h, -3? c Let z = 627.5 + -627.5. Let n = 82/7 + -12. Which is the nearest to 0.2? (a) z (b) 0.2 (c) -0.2 (d) n b Let g = -0.8037 - 4.1963. Which is the closest to -3? (a) 9/7 (b) g (c) -1/2 b Let j = 7574 + -7572. What is the closest to -101 in 0, 0.4, 0.1, j? 0 Suppose 13 = 5a + 3r, -4r = -4a + 17 - 45. What is the nearest to -1 in -1.2, 14, a? a Let w = -696.0727 + 0.0727. Let j = w + 696.1. Let i = 2 - 3. Which is the nearest to i? (a) -3 (b) j (c) -2/11 c Let l = 6838 + -6804.93. Let t = 0.07 - l. Let c = 35 + t. What is the nearest to c in -0.4, 2, 5? 2 Let r = -4627 - -4627.3. Which is the nearest to 0? (a) -3/2 (b) r (c) -2.3 (d) -1 b Let p = 0.24 + -5.24. Let c = -264 + 263.926. What is the closest to 0 in c, 3, p? c Let p = -0.23 - -0.43. Let u = 1654.4 - 1654. Let i = 0.2 + -0.2. Which is the closest to 0? (a) u (b) i (c) p b Let t = -80 - -401/5. Suppose 4z = -3q + q, 0 = -4z + 3q. Let c be (-3)/(-9)z/(-4). What is the nearest to t in c, 1, -0.2? c Let g be (7/(-7))/(3/(-22 - 2)). Let j be 1/(g/(-48) + (-10)/12). Let r be (52/6)/((-80)/(-24)) - 3. Which is the nearest to -2? (a) j (b) -0.5 (c) r a Let f = -180 - 151. Let p = f + 329. Which is the nearest to p? (a) 12 (b) -0.2 (c) -2/5 c Let s = -2.7 + 3. Let z = 6.0974 + -11.0974. What is the nearest to 6 in s, -0.2, z, 4? 4 Suppose 3r - 7 = 2p, 251p - 256p - 29 = 4r. Which is the closest to -4/3? (a) -0.1 (b) -6 (c) 0.05 (d) p a Let s be ((-2)/(-80))/(2/5). Let f = -5140 - -5144. What is the closest to 1/2 in s, f, -2? s Let f be (-153)/374 - (-4)/(-32)-4. What is the closest to 365 in f, 0.4, 1/7, -1/4? 0.4 Let y(x) = -2x + 16. Let q be y(11). Let p be q/10 + (2/5)/(-1). Which is the nearest to 0.1? (a) 1 (b) p (c) 6 a Let x = -160.69 + 180.69. Which is the nearest to x? (a) -6/7 (b) 4 (c) -3/2 (d) -1 b Suppose 5o = 14 - 14. Suppose o = -4h - 0h - z + 16, 2z = -5h + 20. Let c = 5 + -3. What is the closest to -0.2 in c, h, -0.5? -0.5 Let n be -5 - -2 - (-105)/(-63)-3. Let d(h) = h2 - h - 2. Let t be d(2). Which is the nearest to 31? (a) 5 (b) t (c) n a Let l be ((-175)/(-1575))/((3/(-3814))/(-3)). Let y = 424 - l. Which is the nearest to -2/3? (a) 2 (b) y (c) -4 (d) -1 d Let x = 123.057 + -123. Let i = -0.043 - x. Let s = 233/4 + -58. Which is the nearest to 0.1? (a) i (b) 0.03 (c) s b Suppose -5f + 8 - 4 = s, 0 = 5s + 2f - 20. Suppose 2o = -4q + s, -o + 3q - q = 6. What is the nearest to -79 in -4, o, -2/3? -4 Let t = 14502 + -14502. Which is the closest to 81? (a) 0.4 (b) t (c) 6 c Let s = -19958 + 179623/9. Which is the nearest to 0.12? (a) s (b) 0 (c) 3 a Let w = 0.281 - 0.081. Suppose 516i = 523i - 28. Which is the nearest to 0? (a) -3 (b) i (c) w c Let n = -48.44 - -48.54. What is the closest to 52 in 7, 2, -1/5, n? 7 Let n = -0.15 - 1.85. Let m = -2.51 - -3.01. Which is the nearest to -1? (a) m (b) 2/5 (c) n c Let x = -6927 + 41563/6. Which is the nearest to 1? (a) -25 (b) x (c) 1/4 c Suppose -123s + 3684 = 96s + 837. What is the nearest to s in -2, -1/7, -0.4, -5? -1/7 Let k = -0.447 + 0.027. Let g = k + 0.52. Which is the nearest to g? (a) -0.5 (b) 2/15 (c) 0.2 b Let f = 3 - 47. Let u = 36.9 + f. Let k = u - -5.1. What is the closest to -1/2 in k, -1/4, 2/3? -1/4 Let l = -194 + 198. Suppose -r = -2r + l. What is the closest to 2/7 in r, 0.2, 3? 0.2 Let x = -2503 + 1766. Let s = -742 - x. What is the closest to 9/5 in -0.1, 5/4, 2, s? 2 Let o = -1.62 + 4.62. What is the closest to -1.12 in o, 0, -1? -1 Let v be -2 - (10/(-28) + 6/42). Let r = v - -453/238. Let i = -7 + 4. Which is the nearest to 0.1? (a) r (b) i (c) -0.3 a Let z = -253 + 254. What is the nearest to z in 5, 0.3, -130, 3? 0.3 Let p = 3 - 3.1. Let z = 2 + -14. Let w = 11.5 + z. Which is the nearest to p? (a) -4/3 (b) -2/3 (c) w c Let u be 23/33 - 986/(-22). Suppose uv = 38v + 7. Which is the nearest to -1? (a) 3 (b) v (c) 4 b Let y be (2 - 3/2) + -2. Let v = -104 - -101. Let z = 3567.6 + -3568. Which is the closest to y? (a) 1 (b) v (c) z c Let d = -5949/10 - -595. Let q = 55 - 55.5. What is the nearest to -2 in q, 4, d? q Let d = -10045 + 10050. Which is the nearest to 13? (a) 0.34 (b) d (c) -0.3 b Let a be 4 + (-126)/33 + 0. Let i be (19/76)/(3/41). Suppose x - 5u - 12 = -3x, -u = 3x - 9. What is the closest to i in 0.5, x, a? a Let o = -1392.854 - -1440.9. Let f = 0.046 - o. Let p = -48 - f. Which is the closest to -0.1? (a) 0.2 (b) p (c) -4 b Let o = 48 - 12. Let r = 30 - o. Let y = r - -5.5. Which is the closest to -1? (a) -2/7 (b) y (c) 2/7 b Let h = 204.973 - -1.927. Let s = 198 - h. Let k = -7.9 - s. Which is the closest to 2? (a) -0.2 (b) k (c) -1/4 b Let r = 241.59 - 252.899. Let o = 0.091 - r. Let u = -12.4 + o. Which is the nearest to 0? (a) 4 (b) 1/5 (c) u b Let j = -0.218 + 0.018. Let l = -153 - -1227/8. Let d = -274 + 274.1. Which is the nearest to d? (a) j (b) 5 (c) l c Let o = 8419.4 + -8419. What is the closest to -2 in -73, o, 0.5? o Let c = -68.978 - -69. Let i = 0.042 - c. Let x = -0.22 + i. What is the closest to x in -0.1, 1/6, -4/3? -0.1 Let h = 6 + -10. Suppose -15 = -k - 5. Let r be k/(-60)(-1 - (-7)/3). Which is the nearest to r? (a) h (b) -1/6 (c) -2 b Let v = 1 - 0.9. Let a = -7.185 - -8.185. Let c = 32 + -37. What is the nearest to -7/8 in v, c, a? v Let i = -0.07 + -1.93. Let h be 5/((-275)/65) + 1. Let g = 0.1 - 0. What is the nearest to h in g, i, 3/7? g Let h = -101.8 - -99.8. Let l = 11/9 - 32/9. Which is the closest to h? (a) 2 (b) -1 (c) l c Let v = 549 + -1183. Let i = 633.5 + v. Which is the closest to 0.1? (a) 12 (b) 1 (c) i c Let q = -33 + 37.1. Let k = -4 + q. Let r be -18 + 20 - -14((-14)/4)/7. What is the closest to k in r, 0, -0.4? 0 Suppose 4 = -2u, 0 = 2y - 4u - 2 - 0. Let l be (2 + 1y)/1. Let i = 137191 + -137187. Which is the nearest to l? (a) -3/4 (b) -1/4 (c) i a Let z be (8/54)/((-208)/(-5616)). Let k be 2 + (4 - 2)-1. What is the nearest to k in z, 6, 0.4? 0.4 Let n = 18315.1 + -18314. Which is the closest to -55? (a) -0.1 (b) -0.3 (c) 0.4 (d) n b Let k = 2186 - 2185.6. What is the closest to 5/2 in k, 0.2, 3, 60? 3 Suppose 4o = -3j - 185, 0 = 2j + 2j + 3o + 249. Let t = j - -503/8. Let d = -3 - -3.2. What is the closest to d in -2, t, 8? t Let m be (-34)/(-60) + 2/(-5). Let w = -811 + 554. Let f = w - -257.3. What is the closest to 1/8 in m, 1/3, f? m Suppose 2w - 42 = -420. Let m be (-1)/4(-56)/w. What is the nearest to -1 in m, 17, -1? -1 Let g be (1 + -4)(-6)/9. Suppose -4x = -gs - 6, -2x - 15 = 3x + 5*s. Let j = -1.63 - 0.37. What is the closest to -3/4 in x, -1, j? -1 Let s = -272.98076 + -0.01924. What is the nearest to 1 in s, -0.4, 1? 1 Let g = 0.8454 - -0.1546. Which is the closest to g? (a) 2	{ "pile_set_name": "DM Mathematics" }
at is the tens digit of x? 2 Suppose 16 - 10 = p. What is the tens digit of 897/p - ((-27)/6 + 4)? 5 Let f(x) = 22x2 + 12x + 77. What is the tens digit of f(-4)? 8 Suppose -4c - 10 = -3w - 3c, -2c = 4w. Suppose 1 + 3 = wl. What is the units digit of l + -4 - (1 - 11)? 8 Suppose -g = -3l - 25, l + 3l = 5g - 37. Let t = -8 - l. Suppose -4q - 4x + 76 = t, -3q - 5x + 10 = -55. What is the tens digit of q? 1 Let k be -4 - -1 - (-10 + 3). Suppose 176 - 24 = kr. Suppose o + 7 = r. What is the units digit of o? 1 Let f(k) = k*2 + 7k + 12. Let u be f(-5). Suppose 0 = -8c + uc + 780. What is the tens digit of c? 3 Suppose -2r = 3r. Suppose -5z + 4k = 0, r = 2z - k - 0k. Suppose -4c + 42 + 206 = z. What is the units digit of c? 2 What is the hundreds digit of (-6 - -9) + 255 - 1-4? 2 Let g(q) = 205q + 406. What is the hundreds digit of g(7)? 8 Suppose -3v = q - 8, 0v + 8 = -5q + v. What is the units digit of (-15)/(-1) - q - -3? 9 Let w be (-35)/(-5) + -4 - -17. Suppose wi = 18i + 50. What is the tens digit of i? 2 Let z(k) be the third derivative of 0 + 1/60k5 - 2k*2 + 1/120k*6 + 13/3k*3 + 0k*4 + 0k. What is the units digit of z(0)? 6 Let y be -4 + ((-32 - 0)/(-4) - 1). Suppose yu + 2a - 747 = 0, -3u - a = -135 - 612. What is the hundreds digit of u? 2 What is the thousands digit of (-22 - 0)/(-4(-18)/(-7236))? 2 Let a be (-1)/4 - (-2050)/8. Suppose -a - 40 = -4x. What is the tens digit of x? 7 Let i(b) = -7b*3 + 4b*2 + 8b - 1. What is the tens digit of i(-5)? 3 What is the hundreds digit of (-5 - -24 - 5)/((-1)/(-28))? 3 Let c(p) = -5p - 9. Let j be c(7). What is the units digit of 2/4(5 - 5) - j? 4 Let w(p) = 2p2 - 14p - 104. What is the units digit of w(-11)? 2 Let a = 5841 - 2616. What is the hundreds digit of a? 2 Let r(t) = 2t2 - 8t + 3. Let u be r(4). Suppose 0 = -3z + 3b + 165, 2z + ub = z + 47. What is the tens digit of z? 5 Suppose 367f = 363f + 3164. What is the units digit of f? 1 Let l = 4217 + -1029. What is the tens digit of l? 8 What is the units digit of (((-98035)/(-10))/7)/((-2)/(-4))? 1 Let t = 15 + -27. Let x = 9 + t. What is the tens digit of 40((-6)/4)/x? 2 Let g be (-4)/6-3 - -13. Suppose -5h - g = -10h. Suppose y = -2m + 5m + 33, -hy - m + 49 = 0. What is the units digit of y? 8 Let i be 2/((5 - 1)/4). Suppose ir - 4o = 172, -4r - 2o = -9r + 398. Suppose 3j = -5l - 16 + 121, 4l = 3j - r. What is the units digit of j? 0 Suppose -10 = -5n - 5i, 3n + 11 - 3 = 4i. Suppose n = -p + 3p. Suppose p = v + 2v - 81. What is the units digit of v? 7 Let t = -2685 + 3911. What is the tens digit of t? 2 What is the units digit of (6/(-48)-26)/(1/12)? 9 What is the tens digit of ((-13)/(-78))/((-7)/(-32298))? 6 Suppose x + r + 2 = 0, 2x = 4r + 4 - 2. What is the tens digit of (x - -15)/(((-16)/(-22))/4)? 7 Suppose 2f - f - 27 = 0. Suppose f = 2n + 89. Let w = n - -51. What is the units digit of w? 0 Suppose 5b - 4u = 6460 + 1317, 3u = 5b - 7774. What is the thousands digit of b? 1 Let p = 1454 + -1451. Let v be ((-6)/(-2))/(1/2). What is the tens digit of 368/4p/v? 4 Suppose 0 = -3o - 1 + 4. Let b(c) = 89c - 1. Let h be b(o). Suppose -5l + 50 = -3k - 46, -5l = k - h. What is the tens digit of l? 1 Suppose 969 = 18m - 15m. What is the units digit of m? 3 Let u = -1592 - -2724. What is the hundreds digit of u? 1 Suppose -17m + 3504 = -9m. Let w = -286 + m. What is the hundreds digit of w? 1 Let k = -4 - -3. Let j(z) = z2 - 14z. Let l be j(8). What is the units digit of ((-7)/(-14))/(k/l)? 4 Let q be (-3 - -42)(-12)/9. Let x = -22 - q. Suppose 2 + x = 4u. What is the units digit of u? 8 Suppose 0 = 33u - 13u - 20400. What is the tens digit of u? 2 Let d be (-1)/(-5) + (-5034)/(-30). Suppose 4j - d = -2h - 2h, -4h = 5j - 208. Suppose 3b + 0b = m - j, 0 = -5m - b + 184. What is the units digit of m? 7 Suppose 10 = 3r - 89. What is the hundreds digit of 104 + (r/(-22) - 6/4)? 1 Let r(j) = -j3 - 14j*2 - 11j + 18. Let g be r(-13). Let w = -11 + g. Let p = w + 34. What is the units digit of p? 5 Suppose 2 = 2l - 0. Suppose 0 = -3n - 4y - 7, -n + y = -8 + l. Suppose 0f - 24 = -nf. What is the units digit of f? 8 Let q = 109 - -1159. What is the units digit of q? 8 Suppose 3v - 40 = -p, 40 = -2p + 4p - 4v. Suppose -4y = -3d - 21, -2d - p = -2y - 3y. Suppose -40 = -ys + s. What is the units digit of s? 8 Let b(r) = -r2 + 3r + 5. Let m be b(12). Let j = -46 - m. What is the tens digit of j? 5 Let s(b) = -3b3 - 7b*2 - 29b + 2. What is the hundreds digit of s(-13)? 7 Suppose -3i - 9 = k, 4i + 12 = i. Suppose 453 = 4u - ka, 5u + 5a = 43 + 532. What is the hundreds digit of u? 1 Suppose 2k - a + 4 = 0, -32 = -0k + 5k + 3a. Let n(h) = -3h - 2h2 + h2 - 2h. What is the units digit of n(k)? 4 Let x = -721 + 1665. What is the hundreds digit of x? 9 Let d = -306 - -588. What is the units digit of d? 2 Suppose 5q - 24 = -14. Suppose -532 = -2k - qk. What is the tens digit of k? 3 Suppose 349 = 9c - 398. Suppose 125 = cp - 78p. What is the tens digit of p? 2 Suppose 5a - 7 = w + 21, 36 = -5w - a. Let d(c) = -29c - 74. What is the units digit of d(w)? 8 Suppose 0 = -4q + 5d + 30, -4d + 3d + 13 = 3q. Suppose -l + 30 = -2u, ql = 4u + u + 130. What is the tens digit of l? 2 Let i be (-1854)/(-14) + 15/(-35). Suppose 2 + 8 = -5k, -5k = -2x + i. What is the tens digit of x? 6 Suppose 134o - 115o - 51870 = 0. What is the tens digit of o? 3 Let z be 2 + (-2 - 2 - -2)/(-1). Suppose -zn = -6n + 26. What is the units digit of n? 3 Let r be 399/9 - 8/6. Let g = 69 - r. What is the units digit of g? 6 Suppose 5h - 127 + 467 = 0. Suppose 0n = -2n - 92. Let l = n - h. What is the units digit of l? 2 Suppose -3l + 207 + 191 = -d, -4d = -3l + 404. Suppose 4m = 112 + l. What is the tens digit of m? 6 Suppose -25 = -3h + 2h. Suppose -3 - h = -7t. What is the units digit of t? 4 Let b be (-12)/15(-2 - -237). Let o = b - -284. Suppose 0n - 2z - o = -3n, 4z = -3n + 114. What is the tens digit of n? 3 Let j(w) = 21w*3 - 4w*2 + 8w + 1. Suppose 2m = -4d - 2, 5m = -d + m - 18. What is the units digit of j(d)? 9 Let w(j) be the second derivative of 12j*3 - 2j*2 - j. Let m be w(2). Suppose -4k = 5v - 83, v + 0v + m = 5k. What is the units digit of k? 7 What is the tens digit of (-1)/4 - -1 - (-1455)/12? 2 Let s = -1865 + 3332. What is the thousands digit of s? 1 Suppose 3r - 3 = 3. Suppose 10 + 6 = -rn. Let y = n + 10. What is the units digit of y? 2 Let b(a) = -6a - 34. Let y be b(-12). Let s = y - -229. What is the hundreds digit of s? 2 Let a(p) = p*2 + p - 1. Let i be a(-3). Suppose -m = m, 10 = ib + 5m. Suppose 3y - 12 = -r, -by - 3y + 69 = 4r. What is the units digit of r? 1 What is the tens digit of 2/(-2 - -1)(-7158)/12? 9 Let s(o) = o*3 - 7o*2 + 3. Let a be s(7). Let f = 2 - a. Let p = f + 18. What is the units digit of p? 7 Let u = 59 - 55. Suppose -174 = -2l - uj, 3l - 5j = -0l + 261. What is the tens digit of l? 8 Let g = -1358 + 1418. What is the units digit of g? 0 Let u = 767 - -1047. What is the thousands digit of u? 1 Let b = 1 - -7. Suppose -i = -b - 30. What is the tens digit of i? 3 Suppose 590 = o - 11o. What is the units digit of 28 - 0/1 - o/(-59)? 7 Suppose 5n = 3m - 220, 0n = -2m + n + 142. Let i(l) = l3 - 26l*2 - 26l - 22. Let t be i(27). Suppose 0b + m = tb. What is the tens digit of b? 1 Suppose 4h - 2y - 70 = 0, -2h + 38 = -0h - 2y. Suppose 0 = 2o - h + 4. Let l(q) = -q*3 + 6q*2 + 4q + 1. What is the units digit of l(o)? 5 Suppose 0 = -3j + 2j + 2. Suppose 0 = -z - g + 3g + j, g - 26 = -4z. Suppose s - 3h + h = 26, 0 = 3h + z. What is the units digit of s? 2 Suppose 0d = 3d. Suppose -2k + 4c + 94 = d, 2c + 194 = 4k - 0c. What is the tens digit of k? 4 Let t(o) be the first derivative of o4/4 - o3 - o2/2 - 3o + 1. Let b be t(4). What is the units digit of 48/18b/12? 2 Let w(i) = 19i*2 + 9i + 24. What is the hundreds digit of w(-4)? 2 Let z = 124 - 182. Let f = z + 160. What is the tens digit of f? 0 Suppose -39053 = -36k - 13k. What is the units digit of k? 7 Suppose -5	{ "pile_set_name": "DM Mathematics" }
76)/(-1120)) + 9/21. 920 Let v be (-5)/(-5) + 10/2. Suppose 0 = 3s - vs - 6. Find the common denominator of 36/11 and 1 + 189/(-6) + s. 22 Calculate the common denominator of 4/((-3760)/(-2622)) + -37 + 34 and 91/282. 1410 Let s = 28 + -26. Suppose -4z = -b + 24, 7b - 2b - 156 = sz. What is the least common multiple of 6 and b? 96 Let d = 63 + -40. Suppose 34 = -3q - d. Let g = -185/99 - -23/11. What is the common denominator of g and q? 9 Let d = -1437 - -1582. Calculate the lowest common multiple of d and 55. 1595 Let k = -22201 + 665947/30. Suppose x - 6 = -352. Let a = 3401/10 + x. Find the common denominator of a and k. 30 Let u(n) = -10n*3 - 4n*2 + 9n + 27. Calculate the lowest common multiple of u(-2) and 7. 511 Suppose 0 = -7h + 2h + 5, 46 = 4z + 2h. Suppose 90 = 12r - 6. Suppose -r = -6v + 22. Calculate the least common multiple of v and z. 55 Let t = 9/79 + 5677/790. Let z be -85(-3 - -4). What is the common denominator of 198/z + (-1)/4 and t? 10 Suppose -5y - 17 = -2g - 2y, -4g = -3y - 37. Calculate the smallest common multiple of 18 and g. 90 Let n = 386 - 347. What is the least common multiple of 6 and n? 78 Let k = -14 + 11. Let r(a) = -a2 - 4a - 3. Let x be r(k). Suppose h - 5h + 40 = x. What is the lowest common multiple of h and 7? 70 Let m(p) = 4p*2 + 2p + 4. Let y be m(-5). Suppose 0 = -21d + 19d + y. Let r = -29 + d. What is the smallest common multiple of 14 and r? 126 Let l = -22 + 16. Find the common denominator of -112 + -2(-9)/l and (-1)/3 + (-310)/(-66). 11 Let r(i) = -i*2 + 22i - 17. Suppose -2f - 18 = 4z, 0z = 5f + 3z + 45. Let k = f + 17. What is the lowest common multiple of r(21) and k? 8 Let b = -2 - -4. Suppose -4v + 6 - 22 = -4m, bm + 3v - 33 = 0. Find the common denominator of 101/10 and m/6 + 19/2. 10 Let d be -31/(-3 + 3 + -1). Suppose -dl + 55 - 22 = 0. What is the smallest common multiple of l and 62? 682 Let r = 42/85 + -13394/27795. Let z = 3193/2616 - r. What is the common denominator of z and 49/10? 120 Let a = -460 + 944. Let u = a + -6789/14. Calculate the common denominator of u and 43/8. 56 Let d be (-178)/(-9) + 6/27. Suppose d + 25 = 5w. Calculate the least common multiple of ((-3)/w)/(3/(-9)) and 2. 2 Let d(s) be the second derivative of s*4/6 + 5s*3/3 + 5s*2 - 18s. What is the lowest common multiple of d(-8) and 4? 116 Let r(b) = -b*3 - 9b*2 - 7b + 11. Let i be r(-8). Suppose 0 = -iy + y. Calculate the common denominator of 365/(-120)2 + y and 65/38. 228 Suppose 0 = -255o + 267o - 1740. Calculate the smallest common multiple of o and 29. 145 What is the lowest common multiple of 1526/10 + (-254)/(-635) and 170? 1530 Calculate the common denominator of 19/2 and (-42)/(-98)(-90)/(-48). 56 What is the common denominator of (6 - 1143/180)(-10)/(-6) and 2/(-12)218/(-6)? 36 Suppose 362k = 366k - 44. What is the lowest common multiple of 59 and k? 649 Let n = 2742 - 2722. What is the smallest common multiple of n and 94? 940 Let s = 140 - -20. Suppose 5c - 3c = -s. What is the lowest common multiple of 8 and ((-40)/25)/(4/c)? 32 Suppose 2w - 1 = -5, -3w - 16 = -a. Let t(j) = 3j*2 - 65j + 62. Calculate the smallest common multiple of a and t(21). 20 Suppose -5p + 4f = 7, -2p = -7p + f + 2. Let s(y) = 20y2 + 3y - 2. Calculate the smallest common multiple of 21 and s(p). 21 Suppose 58 = 19k + 20. Suppose 0 = -3b - 21 - 6. Let p = -4 - b. Calculate the least common multiple of p and k. 10 Let f be (3-1)/(5 - 6). Suppose 0 = -3x + fz - 0 - 3, -4z = x - 19. Calculate the lowest common multiple of 1 + 0(0 - 1) and x. 3 Suppose 5o - 18 = 42. Suppose b = 5s + 23, -2b - 5s + 126 = 50. What is the lowest common multiple of o and b? 132 Calculate the common denominator of -53/8 and 18/327(-62)/(-16). 872 Let a be 46314626/(-137774) - 6/39. Let j = -84/757 + a. Let g = j + 340. Find the common denominator of g and 4. 7 Let c = 1144 + -1142. Suppose -3r + p = -r + 10, 3r = 2p - 15. Calculate the least common multiple of c and ((-8)/r)/((-1)/(-5)). 8 Let o = -2968025/54 - -54966. What is the common denominator of o and -44? 54 Let o = 1935/8 - 106321/440. What is the common denominator of o and 24/11? 55 Suppose -j + 3 = -0, 5c = 3j + 1961. What is the lowest common multiple of 20 and c? 3940 Let t = 13 + -15. Let l be 4 - (-2)/(t + 1). Suppose 3q + lq - 30 = 0. Calculate the smallest common multiple of q and 3. 6 Suppose 35n + 276 = 58n. Calculate the smallest common multiple of n and 2/(-3) + (-2212)/(-42). 156 Suppose 6l = -1 + 13. Suppose lq + 11 = 7. What is the common denominator of q and -40/13? 13 What is the common denominator of ((-3)/60)/(10440/5150 + -2) and -1/56? 56 Let f be ((-1)/(-3)1)/((-2483534)/(-372)). Let v = f + 2683731/1762508. Calculate the common denominator of v and 77/16. 176 Let o = -201109/18 + 11176. Calculate the common denominator of 17/180 and o. 180 Let y = -8629/11 + 786. Let b = -104 + 272. Find the common denominator of y and b/(-55) + 4/(-10). 11 Suppose 3g - 18 - 12 = 0. Let b be ((-4)/(-3))/(6/9). Calculate the least common multiple of 56/(-12)(-9)/b and g. 210 Suppose 4j - 216 = -2j. Suppose -5i = -i - j. Calculate the smallest common multiple of i and 24. 72 Let z = 1/3398 - -29724/28883. Let v = 12499/1190 + -2/595. What is the common denominator of v and z? 34 What is the common denominator of -67/36 and 254/50(-110)/(-1496)? 3060 Let c = 93 - 261. Find the common denominator of 17/6 and ((-12)/14)/3 + 701/c. 24 Let c = -649/21 - -76253/2478. Find the common denominator of c and -10/7. 2478 Suppose -8f + 336 = -2f. What is the least common multiple of 232 and f? 1624 Let j be 4 - 211316/(-1320) - 2/(-10). Let r = j + -333/2. Calculate the common denominator of -62/15 and r. 165 Suppose 250 = g - 2z, -2g + 3z + 460 = 7z. Find the common denominator of (-1164)/g(-2)/(-3) and 14/3. 30 Let n be 15/(-10)(-4)/3. Let p = 3 - n. Find the common denominator of p + (1281/(-48))/(-7) and -29/20. 80 Let n be ((-123)/(-18))/(2/(-582)). Let b = 1951 + n. Find the common denominator of b and 51/11. 22 Let v = -53 + 32. Let g be ((-3129)/(-270))/1 - -2. Let n = g + -97/10. Find the common denominator of v and n. 9 Let i = 229/16 - 121/16. Let h = -3048983/6462 - 2/3231. Let s = h + 465. Find the common denominator of s and i. 12 Suppose 5s + 0s - 3o = -6, -5s + o = 2. Suppose sb + 4b - 68 = 0. Let c = b - 10. Calculate the smallest common multiple of c and 8. 56 Let b = 2949 - 67776/23. Calculate the common denominator of 35/3 and b. 69 Let w(t) = 686t3 + t2 - 2. Let o be w(-2). Let i be 2898951/110(-50)/240. Let f = i - o. Find the common denominator of f and 71/20. 80 Let v = 5 - 8. Let r = 7 + v. Find the common denominator of 51/10 and 4/(-24)(-94)/r. 60 Calculate the lowest common multiple of 28/36 + -1 + (-38)/(-9) and 28. 28 Let q(i) = -i2 + 95i - 2167. Let w = -61/27 - -100/27. What is the common denominator of w and q(58)? 9 Suppose 128l - 984 = 120l. What is the smallest common multiple of l and 21? 861 Let v(x) = x*3 + 9x*2 - 13x - 20. Calculate the smallest common multiple of v(-10) and 96. 480 Let g = -489/8 + 323/8. Calculate the common denominator of g and 63/4. 4 Suppose -5d = -8d - 165. Calculate the lowest common multiple of (-5)/20 + (-82)/(-8) and (-8)/44 + (-230)/d. 20 Let c = -4 + 9. Suppose c = g, 1 = -z - 2g + 8. What is the smallest common multiple of 2 + 36/((-6)/z) and 18? 180 Let b(m) = 151m3 + m2 - 3m + 4. Let x be b(-3). What is the common denominator of 87/16 and (-6)/(-21) + x/(-630)? 144 Let q = 444/47 - -58849/94. Let u = q - 650. Find the common denominator of 82/33 and u. 66 Let m = -12 + 47. Calculate the smallest common multiple of 70 and m. 70 Let t be ((-4)/(-6))/(16/72). Let g be t/((45/115)/3). Suppose g + 2 = 5w + 2h, -5w - h = -20. Calculate the smallest common multiple of 4 and w. 12 Let p be 232/6 + 21/63. Suppose -p = -2b - 15. What is the smallest common multiple of 22 and b? 132 Let n = -16086 - -563068/35. What is the common denominator of n and -59/20? 140 Suppose -6q + 24 = -2q - 4l, 0 = 4*q + l - 24. Let w be (4/q)/((-2)/(-9)). Find the common denominator of (4/16)/(w/189)	{ "pile_set_name": "DM Mathematics" }
j + 6)*2/4 Let s(f) be the second derivative of -1/49f*7 - 24/7f*5 + 0f*3 + 0f*2 + 32/7f*4 + 17/35f*6 - 73f - 2. Factor s(a). -6a2(a - 8)*2(a - 1)/7 Suppose -2/15u2 + 94/15u - 344/15 = 0. What is u? 4, 43 Let j = 1566888/55 - 28488. Let w = -38/55 + j. Solve 98/11 + wi2 - 28/11i = 0 for i. 7 Find u such that -85u4 - 805u + 353 - 950u2 - 5u*5 - 995 + 397 - 470u*3 = 0. -7, -1 Let d(y) = -11y*2 - 89y + 5. Let t(x) = -62x2 - 490x + 28. Let u(b) = -28d(b) + 5t(b). Factor u(l). -2l(l - 21) Let a(g) be the second derivative of 3g5/20 + 13g*4/2 + 102g*3 + 756g*2 + 556g. Factor a(f). 3(f + 6)2(f + 14) Let t(n) = -15n + 4. Let o be t(-3). Determine u so that -5u*5 - ou*3 + 21u*4 + 35u*3 - 13u*5 + 13u*4 - 2u*2 = 0. -1/9, 0, 1 Let m(j) be the second derivative of -2j*7/63 + 32j*6/135 - 28j*5/45 + 16j*4/27 + j + 99. Factor m(s). -4s*2(s - 2)*2(3s - 4)/9 Let t(g) be the second derivative of -g7/42 + 2g*6/15 + 7g*5/5 + 8g*4/3 + 705g. Factor t(a). -a*2(a - 8)(a + 2)2 Let b be (12771/3311)/((-10)/358 - -3). Factor 3/5s4 - 99/5s*2 - bs*3 - 36/5 - 21s. 3(s - 12)(s + 1)*3/5 Let f = 6079/6 - 1013. Let j(k) be the second derivative of -fk*4 - 1/18k*5 - 2/9k*2 + 9k - 7/27k3 + 0 - 1/135k*6. Solve j(r) = 0. -2, -1 Suppose -4c*3 + 0c*3 + 26c*2 + 82c + 3c3 - 306c - 85c2 - 220 = 0. Calculate c. -55, -2 Determine v so that -48/5v*2 + 16/5v*3 + 0 + 0v + 4/5v5 + 28/5v4 = 0. -6, -2, 0, 1 Let y(l) be the second derivative of -l7/1890 + 13l6/540 - 2l*5/15 - 3l*4/2 + 15l - 1. Let w(p) be the third derivative of y(p). Solve w(t) = 0 for t. 1, 12 Let 8d3 + 12d*3 + 76d - 175d - 21d*3 + 40d*2 + 60d = 0. What is d? 0, 1, 39 Let n(j) be the first derivative of -j*3/12 + 7j*2/2 - 40j + 3006. Factor n(s). -(s - 20)(s - 8)/4 Let x(s) be the third derivative of 0s - 11/120s5 + 0 - 1/24s*4 - 1/105s*7 + 126s*2 + 0s*3 - 13/240s*6. Factor x(j). -j(j + 1)(j + 2)(4j + 1)/2 Let g(y) be the second derivative of y7/14 - 4y*6/25 - 27y*5/100 + 2y*4/5 + 2y*3/5 + 131y + 4. Solve g(r) = 0. -1, -2/5, 0, 1, 2 Let h(r) = 15r2 - 273r + 1357. Let k(y) = 7y2 - 130y + 678. Let z(i) = -6h(i) + 13k(i). Solve z(a) = 0. 24, 28 Factor -1377746 + 110246 + 1855h - 2827h - 2928h - 3h*2. -3(h + 650)2 Let x(a) = -a3 - 64a2 + 143a - 162. Let c(d) = -13d2 + 2d - 1. Let m(o) = -7c(o) + x(o). Find i such that m(i) = 0. -5, 1, 31 Let n(q) = 21q*2 + 28q - 6q3 + q - 11q + 2q + 8. Let i(a) = -4a*3 + 20a*2 + 20a + 8. Let o(t) = -5i(t) + 4n(t). Find s such that o(s) = 0. -2, -1 Let m(z) be the third derivative of z8/8960 - z7/840 - z*6/192 - 37z*4/8 - 124z*2. Let p(b) be the second derivative of m(b). Factor p(q). 3q(q - 5)(q + 1)/4 Let n be ((-24)/(-10))/((-10)/(-3775)). Solve -n + h*2 + 5h - 2h2 + 902 = 0 for h. 1, 4 Let y(u) = u2 + 15u - 83. Let j be y(-20). Factor -jl2 + 11l*2 + 68 + 38l + 2l2 + 6l*2. 2(l + 2)(l + 17) Let k = -490 + 522. Suppose -k = 35r - 102. Factor -20/7l - 2/7l*r + 0. -2l(l + 10)/7 Find s, given that 21/4s*2 - 3/4s*3 - 21/4s*4 + 3/4s*5 + 0s + 0 = 0. -1, 0, 1, 7 Let p(q) be the second derivative of -2q6/45 - q5/15 + q4/3 + 2q*3/9 - 4q*2/3 + q + 244. Suppose p(r) = 0. What is r? -2, -1, 1 Let a = 220/793 + 2512/2379. Factor -1/3r*2 - 2/3r*3 + a + 8/3r. -(r - 2)(r + 2)(2r + 1)/3 Let s = 43569 + -43567. Let l(b) be the third derivative of 0 - 1/15b*5 + 20/3b*3 - 24b*s + 0b + 3/2b4. Factor l(k). -4(k - 10)(k + 1) Let v(w) = -3w*3 + 26w*2 + 8. Let a(k) = 5k*2 + 4k - 6. Let x(u) = -u*2 - u + 1. Let z(n) = -a(n) - 4x(n). Let b(y) = v(y) - 4z(y). Factor b(j). -3j*2(j - 10) Let n(f) be the first derivative of f*6/24 - 13f*5/12 + 5f*4/2 + 36f*2 + 50. Let d(g) be the second derivative of n(g). Determine r, given that d(r) = 0. 0, 1, 12 Let u(x) be the second derivative of 0 + 1/30x*5 + 1/180x*6 - 4/9x*3 + 0x*4 + 7x - x*2. Let c(b) be the first derivative of u(b). Factor c(v). 2(v - 1)(v + 2)2/3 Let h = 299/594 + -1/297. Determine t, given that ht + 1/4t2 + 1/4 = 0. -1 Let w(i) be the second derivative of 5i + 16/9i3 - 4/3i*2 + 0 - 29/72i*4 + 7/240i5. Factor w(q). (q - 4)2(7q - 2)/12 Suppose -258s + 4 = -257s. Factor 774z4 + 0z*2 - 6z - 773z4 + sz3 + z2. z(z - 1)(z + 2)(z + 3) Let a(q) = 47q*2 + 327q - 677. Let d(j) = 17j2 + 109j - 226. Let m(y) = 12a(y) - 33d(y). Determine o, given that m(o) = 0. -111, 2 Let o = -148548 + 148552. Factor 2/3q + 2q*5 + 0 + 8q*3 - 20/3q*o - 4q*2. 2q(q - 1)3(3q - 1)/3 Let v = -13352 - -13373. Let f(c) be the first derivative of -1/16c*4 + 3/8c*2 + 0c - v - 1/6c3. Find i such that f(i) = 0. -3, 0, 1 Suppose -28 = -4r + 4k, 2r + 3k = 2k - 1. Factor 6l4 + 9l*4 + 324 - 169l + 184lr - 11l*4 - 407l + 74l3 - 10l*3. 4(l - 1)*2(l + 9)*2 Let -30/7 - 3/7v*4 - 9/7v + 9/7v3 + 33/7v*2 = 0. Calculate v. -2, -1, 1, 5 Let j(f) = 5f*3 + 68f*2 + 243f. Let u(a) = a*3 + a. Let w(n) = -j(n) + 3u(n). Solve w(z) = 0 for z. -30, -4, 0 Let c(l) be the third derivative of -l*6/24 + 79l*5/4 + 405l*4 + 9800l*3/3 - 1969l*2. Let c(v) = 0. Calculate v. -4, 245 Let y = -32483 - -194899/6. Let a(m) be the second derivative of 4m + 0 + 1/48m4 - ym*3 + 0m2. Suppose a(l) = 0. What is l? 0, 4 Let h(m) be the second derivative of -m7/147 - m6/21 + m5/5 - m*4/21 - 13m3/21 + m2 - m + 1582. Let h(j) = 0. Calculate j. -7, -1, 1 Let x(d) be the first derivative of 356445d4/4 + 1780d*3 + 10d*2 - 8309. Find o such that x(o) = 0. -2/267, 0 Suppose -252 + 9i*5 - 78i*3 - 211i*4 - 312i*2 + 573i + 454i4 - 183i4 = 0. What is i? -7, -3, 1, 4/3 Let k(h) be the first derivative of h5/12 - 5h4/18 - 35h*3/18 - 10h*2/3 + 23h + 68. Let i(o) be the first derivative of k(o). Factor i(y). 5(y - 4)(y + 1)*2/3 Suppose 0 = -14v + 84791 - 84763. Factor -48/11t + 2/11t*v + 0. 2t(t - 24)/11 Let z = 16 - 21. Let t(b) = 2b*2 + 25b - 2. Let c(o) = -3o2 - 37o + 5. Let w(u) = zc(u) - 7t(u). Factor w(j). (j - 1)(j + 11) Determine g, given that 0 + 46/5g*2 + 2/5g*3 + 44/5g = 0. -22, -1, 0 Let c(w) = 26w2 - 23478w + 23622. Let y(p) = -6p2 + 5872p - 5906. Let q(i) = 4c(i) + 17y(i). Solve q(j) = 0 for j. -2957, 1 Suppose -27n - 27n = -n. Let y(r) be the third derivative of 37r2 - 1/180r*5 + 0r*3 + nr + 0 - 1/48r4. Factor y(h). -h(2h + 3)/6 Let x(i) be the second derivative of i4/20 - 7i*3/2 + 2i - 1004. What is d in x(d) = 0? 0, 35 Let j(c) = 2c3 - 13c*2 + 10c + 40. Let t(n) = n*3 - 4n*2. Let v(k) = -j(k) - 3t(k). Let v(m) = 0. Calculate m. -1, 2, 4 Let j(i) = 3i2 + 13i - 2. Let p(m) = -m*2 - 4m + 1. Let x be ((-2)/(-6))/((-2)/(-12)). Let v = -12 - x. Let r(z) = vp(z) - 4j(z). Factor r(k). 2(k - 1)(k + 3) Let 0 - 14s - 3/2s*3 - 22s*2 = 0. What is s? -14, -2/3, 0 Solve -388/3 + 64l + 1/3l2 = 0 for l. -194, 2 Let g(w) be the first derivative of 3w*4/4 + 3w*3 - 216w*2 - 2496w + 866. Determine t so that g(t) = 0. -8, 13 Find b such that 22b5 + 864b - 23b5 + 2382b*3 + 477b*4 + 10b*5 - 3744b*2 + 3b*5 + 9b*5 = 0. -12, 0, 2/7, 1 Let -225y*3 + 503y*2 - 3453 - 68y*2 - 215y + 3453 + 5y4 = 0. What is y? 0, 1, 43 Let f(n) be the second derivative of 0n*2 + 7n + 1/2n3 - 5/6n*4 + 8 + 9/20n*5 - 1/15n*6. Factor f(c). -c(c - 3)(c - 1)(2c - 1) Let a(f) be the third derivative of 5f8/1344 - f6/32 + f*5/24 - 979f2. Let a(c) = 0. Calculate c. -2, 0, 1 Let f(x) be the third derivative of x5/240 - 377x4/48 + 142129x*3/24 + 6x2 + 3. Factor f(h). (h - 377)2/4 Let n = -76 + 212. Solve -5q5 + 87q*3 + 69q*3 + 15q*4 + 2q - nq3 - 2q - 80q2 + 80 = 0. -2, -1, 2 Let l(v) = 2v*2 - 2v + 13. Let w be l(0). Let -13q2 - wq*2 - 26q - 20 + 36q2 - 14q*2 + 2q*3 = 0. Calculate q. -2, -1, 5 Factor 66x + 0 + 65x3 - 107x*3 - 180 + 40x*3 + 4x*2. -2(x - 5)(x - 3)(x + 6) Let f	{ "pile_set_name": "DM Mathematics" }
n 6:34 AM and 1:18 PM? 404 What is 462 minutes after 4:01 PM? 11:43 PM What is 664 minutes before 2:09 AM? 3:05 PM How many minutes are there between 12:56 PM and 5:02 PM? 246 How many minutes are there between 11:16 AM and 2:33 PM? 197 How many minutes are there between 5:42 PM and 1:01 AM? 439 How many minutes are there between 2:39 PM and 4:36 PM? 117 How many minutes are there between 6:58 AM and 2:41 PM? 463 What is 456 minutes before 11:03 PM? 3:27 PM How many minutes are there between 2:01 AM and 5:38 AM? 217 How many minutes are there between 5:23 PM and 7:51 PM? 148 How many minutes are there between 2:47 AM and 2:51 AM? 4 How many minutes are there between 10:06 PM and 10:48 PM? 42 How many minutes are there between 1:07 AM and 6:03 AM? 296 What is 353 minutes before 11:08 PM? 5:15 PM How many minutes are there between 2:05 PM and 11:14 PM? 549 How many minutes are there between 4:19 PM and 8:33 PM? 254 How many minutes are there between 9:21 PM and 7:03 AM? 582 How many minutes are there between 7:49 AM and 4:12 PM? 503 How many minutes are there between 8:52 PM and 11:53 PM? 181 How many minutes are there between 10:44 AM and 12:39 PM? 115 How many minutes are there between 12:34 PM and 4:54 PM? 260 What is 90 minutes before 8:20 AM? 6:50 AM How many minutes are there between 9:54 AM and 4:01 PM? 367 What is 665 minutes before 3:19 AM? 4:14 PM What is 313 minutes before 4:26 PM? 11:13 AM How many minutes are there between 1:07 AM and 10:48 AM? 581 How many minutes are there between 6:53 AM and 8:37 AM? 104 How many minutes are there between 3:18 PM and 9:32 PM? 374 How many minutes are there between 3:21 PM and 8:30 PM? 309 How many minutes are there between 8:47 AM and 3:18 PM? 391 How many minutes are there between 6:25 PM and 5:58 AM? 693 What is 387 minutes before 2:36 AM? 8:09 PM How many minutes are there between 4:20 AM and 5:10 AM? 50 What is 25 minutes before 7:52 AM? 7:27 AM How many minutes are there between 12:45 AM and 10:32 AM? 587 What is 693 minutes before 10:08 PM? 10:35 AM How many minutes are there between 11:32 PM and 12:21 AM? 49 How many minutes are there between 4:03 PM and 4:51 PM? 48 What is 295 minutes after 11:30 AM? 4:25 PM How many minutes are there between 7:47 AM and 2:41 PM? 414 How many minutes are there between 6:07 PM and 3:13 AM? 546 How many minutes are there between 10:24 PM and 10:30 PM? 6 How many minutes are there between 11:32 AM and 6:14 PM? 402 How many minutes are there between 1:48 AM and 8:32 AM? 404 How many minutes are there between 8:10 AM and 5:27 PM? 557 How many minutes are there between 4:04 PM and 10:10 PM? 366 What is 398 minutes before 2:52 PM? 8:14 AM How many minutes are there between 7:34 PM and 6:08 AM? 634 How many minutes are there between 4:41 PM and 12:17 AM? 456 What is 576 minutes after 8:54 AM? 6:30 PM How many minutes are there between 7:22 AM and 1:47 PM? 385 How many minutes are there between 12:35 AM and 12:17 PM? 702 How many minutes are there between 10:04 AM and 5:52 PM? 468 How many minutes are there between 4:06 AM and 1:34 PM? 568 What is 376 minutes after 5:40 PM? 11:56 PM What is 490 minutes before 5:06 AM? 8:56 PM What is 490 minutes after 4:54 PM? 1:04 AM How many minutes are there between 2:54 PM and 4:22 PM? 88 What is 88 minutes before 12:13 AM? 10:45 PM How many minutes are there between 5:16 PM and 2:32 AM? 556 How many minutes are there between 10:58 AM and 10:53 PM? 715 What is 252 minutes after 2:48 AM? 7:00 AM How many minutes are there between 4:44 AM and 4:14 PM? 690 How many minutes are there between 9:31 AM and 8:14 PM? 643 What is 252 minutes after 8:10 AM? 12:22 PM What is 508 minutes after 11:10 PM? 7:38 AM How many minutes are there between 10:55 PM and 1:41 AM? 166 How many minutes are there between 7:05 AM and 7:49 AM? 44 How many minutes are there between 9:21 PM and 8:31 AM? 670 How many minutes are there between 2:24 PM and 7:51 PM? 327 What is 618 minutes after 8:32 PM? 6:50 AM What is 501 minutes after 4:52 AM? 1:13 PM What is 391 minutes after 2:43 AM? 9:14 AM How many minutes are there between 4:27 AM and 2:37 PM? 610 How many minutes are there between 12:04 AM and 8:04 AM? 480 What is 472 minutes after 10:56 AM? 6:48 PM How many minutes are there between 3:52 AM and 1:59 PM? 607 What is 289 minutes after 1:15 PM? 6:04 PM What is 142 minutes before 4:31 AM? 2:09 AM How many minutes are there between 6:57 AM and 1:10 PM? 373 What is 371 minutes before 9:12 PM? 3:01 PM How many minutes are there between 11:32 AM and 1:35 PM? 123 How many minutes are there between 3:30 AM and 6:34 AM? 184 What is 121 minutes after 3:36 AM? 5:37 AM How many minutes are there between 1:44 PM and 12:41 AM? 657 What is 253 minutes after 12:28 PM? 4:41 PM How many minutes are there between 4:23 AM and 6:10 AM? 107 What is 42 minutes before 2:42 AM? 2:00 AM What is 610 minutes before 1:07 PM? 2:57 AM How many minutes are there between 3:07 AM and 1:18 PM? 611 What is 443 minutes before 9:22 PM? 1:59 PM What is 303 minutes after 11:25 PM? 4:28 AM What is 586 minutes before 3:13 PM? 5:27 AM What is 704 minutes after 4:09 AM? 3:53 PM What is 184 minutes after 10:32 PM? 1:36 AM How many minutes are there between 6:23 PM and 9:08 PM? 165 What is 203 minutes before 1:57 AM? 10:34 PM What is 388 minutes after 9:21 PM? 3:49 AM What is 137 minutes before 9:27 PM? 7:10 PM What is 617 minutes before 11:20 PM? 1:03 PM How many minutes are there between 12:44 PM and 1:47 PM? 63 What is 300 minutes after 2:26 PM? 7:26 PM What is 662 minutes after 9:14 PM? 8:16 AM What is 144 minutes before 1:43 PM? 11:19 AM What is 360 minutes before 7:19 PM? 1:19 PM What is 584 minutes after 1:15 AM? 10:59 AM How many minutes are there between 9:29 PM and 7:59 AM? 630 What is 467 minutes before 2:38 PM? 6:51 AM How many minutes are there between 5:41 PM and 8:52 PM? 191 How many minutes are there between 8:42 AM and 5:07 PM? 505 How many minutes are there between 6:34 PM and 5:46 AM? 672 What is 706 minutes after 5:59 PM? 5:45 AM How many minutes are there between 4:54 AM and 6:32 AM? 98 How many minutes are there between 7:27 AM and 5:34 PM? 607 What is 709 minutes before 8:55 PM? 9:06 AM What is 578 minutes after 1:32 AM? 11:10 AM What is 77 minutes after 7:58 PM? 9:15 PM What is 40 minutes before 8:07 AM? 7:27 AM How many minutes are there between 9:43 AM and 4:42 PM? 419 What is 404 minutes before 2:52 PM? 8:08 AM What is 643 minutes before 5:04 AM? 6:21 PM How many minutes are there between 7:05 PM and 4:12 AM? 547 How many minutes are there between 3:18 AM and 5:35 AM? 137 How many minutes are there between 8:21 PM and 5:01 AM? 520 How many minutes are there between 11:34 AM and 6:34 PM? 420 What is 103 minutes after 11:22 AM? 1:05 PM What is 194 minutes before 7:45 AM? 4:31 AM What is 634 minutes after 10:45 PM? 9:19 AM How many minutes are there between 9:54 AM and 2:59 PM? 305 What is 699 minutes after 6:17 PM? 5:56 AM What is 687 minutes before 7:03 PM? 7:36 AM What is 689 minutes after 1:05 AM? 12:34 PM What is 693 minutes after 3:55 PM? 3:28 AM What is 439 minutes before 7:57 AM? 12:38 AM What is 325 minutes before 1:59 PM? 8:34 AM How many minutes are there between 7:27 PM and 9:56 PM? 149 How many minutes are there between 5:02 PM and 1:15 AM? 493 How many minutes are there between 4:37 PM and 7:23 PM? 166 What is 702 minutes before 12:29 AM? 12:47 PM What is 473 minutes after 12:42 AM? 8:35 AM What is 54 minutes before 6:27 AM? 5:33 AM What is 480 minutes after 3:05 AM? 11:05 AM How many minutes are there between 3:54 PM and 2:17 AM? 623 How many minutes are there between 4:08 AM and 11:32 AM? 444 What is 132 minutes after 1:52 AM? 4:04 AM What is 572 minutes before 9:04 AM? 11:32 PM How many minutes are there between 5:27 AM and 8:23 AM? 176 How many minutes are there between 3:38 PM and 8:15 PM? 277 What is 573 minutes before 8:31 AM? 10:58 PM How many minutes are there between 4:42 PM and 11:30 PM? 408 How many minutes are there between 4:31 PM and 12:04 AM? 453 What is 468 minutes before 6:20 AM? 10:32 PM What is 154 minutes before 9:15 AM? 6:41 AM How many minutes are there between 3:53 AM and 9:52 AM? 359 How many minutes are there between 11:37 PM and 9:	{ "pile_set_name": "DM Mathematics" }
.1. What is j rounded to 6 decimal places? 0.000007 Let z = -303 - -302.9999907. Round z to 5 decimal places. -0.00001 Let q = 8 + -8. Suppose -2t + qb - b = 0, 3t = 4b. Suppose -11x + 10x + 5500000 = t. Round x to the nearest 1000000. 6000000 Let n = 287 + 265. Let l(h) = -h*2 + 8h - 7. Let x be l(6). Suppose -c + 3f = n, 0c + xc - 4f + 2716 = 0. What is c rounded to the nearest one hundred? -500 Suppose v - 7038000 = 10v. What is v rounded to the nearest one hundred thousand? -800000 Let g(y) = -9000000y. Let a = -12 - -16. Let k be a((-26)/(-8) + -3). Let w be g(k). What is w rounded to the nearest 1000000? -9000000 Let k = -5.7 - -27.1. Let t = 7 - k. Round t to the nearest integer. -14 Let w = 1 + -11. Let z = -9.999882 - w. Round z to 5 decimal places. 0.00012 Suppose -g - 3v + v - 143 = 0, 164 = -g + 5v. What is g rounded to the nearest 100? -100 Let f(t) = 4t. Let g be f(4). Suppose -19i + gi = -6. Suppose m + 5c = 6425, im + 0c = -c + 12805. What is m rounded to the nearest one thousand? 6000 Let r be (-2480000)/(-93)150/1. What is r rounded to the nearest 1000000? 4000000 Let r = 2487057.097731 - 296.117731. Let o = -2486639.9800204 + r. Let b = o + -121. Round b to six decimal places. -0.00002 Let u = 2454 - 2958.8. What is u rounded to the nearest 100? -500 Let r = 11456678.18827537668 - -112.81171162332. Let n = -11456797 + r. Let t = n + 6. What is t rounded to five dps? -0.00001 Suppose 0 = 3o - 5z + 20, -2z + 5 = -2o - 3. Suppose -w + 2h = o, -2h = 2w - 0w - 12. Suppose 496 = -0a + wa. Round a to the nearest 10. 120 Let m = -170.1 + 9.1. Let o = m - -160.9999774. What is o rounded to six dps? -0.000023 Let p(o) = -o*3 - 16o*2 - 14o + 23. Let r(s) = -s*3 - 13s - 3 - 16s2 - 7 + 34. Let d(g) = -3p(g) + 2r(g). Let k be d(-15). Round k to the nearest 10. -40 Let l = -1.9112 + 0.9679. Let i = 12 + -11.05. Let z = l + i. Round z to 3 decimal places. 0.007 Let t = 91.1 + -62.2. What is t rounded to the nearest 10? 30 Suppose x + 4i = -11, 2x = 7x - i - 29. Suppose -2u - 33499996 = xv, -4v + u - 26800002 = -0u. Round v to the nearest one million. -7000000 Let k = -87 + 86.98. Let v = k + 0.019996. What is v rounded to 6 dps? -0.000004 Let p = -85.99999735 + 86. Round p to seven dps. 0.0000027 Suppose -5 = 5t, -1153 - 789 = -r - 3t. Suppose 4p + 615 = -r. Let m be p/(-8)40-5. What is m rounded to the nearest 10000? -20000 Let z = -72342.5662 + 72266.5661947. Let c = z + 76. Round c to 6 dps. -0.000005 Let x = -1180.58486 + 1180.4. Let s = -0.187 - x. Round s to 4 dps. -0.0021 Let h = -1182385 - -2027385. What is h rounded to the nearest 100000? 800000 Let z = -1051701 - -200998. Let k = z + 550703. What is k rounded to the nearest one million? 0 Suppose 0k + 5k = -15. Let o be -583 + (-4)/(1 + k). Let m = o + 931. Round m to the nearest one hundred. 400 Let c = -35387 + 35365.951. Let r = c + 0.049. Let p = 20.99895 + r. Round p to 4 decimal places. -0.0011 Let j = 241.99926 + -242. Round j to 4 dps. -0.0007 Let s = -3.893 - 623.307. What is s rounded to the nearest 100? -600 Suppose 145016 = -6m + 558338. Suppose -g + 36415 = 3o, -3g - o = -40318 - m. Round g to the nearest one thousand. 36000 Let d(n) be the third derivative of -n4/24 - n3/2 + 3n2. Let q be d(3). Let t be 3 + -4506 + q/(-2). What is t rounded to the nearest 1000? -5000 Suppose -3v - 134550 = 6v. Round v to the nearest 1000. -15000 Let w = 159 + -227.78. Let f = 68 + w. What is f rounded to 1 decimal place? -0.8 Let v be 2464787/(-104) - (-3)/(-24). What is v rounded to the nearest ten thousand? -20000 Let h = -74.6288 + 2280526.6288. Let l = h + -2280453.3000008. Let r = 1.3 + l. What is r rounded to 6 dps? -0.000001 Let a = -1473.0000619 + 1473. What is a rounded to 4 dps? -0.0001 Suppose 0 = 5w - 2w - 8243886. Let o = -1427962 + w. What is o rounded to the nearest one hundred thousand? 1300000 Let d = 0.007 + 13.393. Let c = d - -1.5. What is c rounded to 0 decimal places? 15 Let p = -4.103 - -32.985. Let j = p + -0.582. Let m = 28.29999873 - j. What is m rounded to seven decimal places? -0.0000013 Let w = 4.371444 - 4.37. What is w rounded to four dps? 0.0014 Let v = -85.69818 - -104.698065. Let r = -18.66 - 0.34. Let x = r + v. Round x to five dps. -0.00012 Let s be 16844(-35)/(-14)2. Round s to the nearest ten thousand. 80000 Let a = -38 + 42. Let k = -4.000028 + a. Round k to 5 dps. -0.00003 Let d(k) = -7859985k + 54. Let o(t) = -1571997t + 11. Let b(n) = -4d(n) + 21o(n). Let i be b(-5). Round i to the nearest one million. 8000000 Let y = -40.76 + 35.6. Round y to one dp. -5.2 Let i(z) = z2 + 13z - 14. Suppose -4p - 15 = 41. Let k be i(p). Suppose k = -2g - 24 - 296. What is g rounded to the nearest 10? -160 Let g(a) = -5a2 - 13a. Let d be 3((-2 - -3) + -4). Let q be 82d/24. Let b be g(q). What is b rounded to the nearest 10? -100 Let t = -33 + -54. Let l = t - -87.0098. What is l rounded to three decimal places? 0.01 Let j(r) = r2 + 11r - 9. Let b be j(-12). Let k(l) = -25l3 + 4l - 9l2 - b + 3 + 6l*2. Let w be k(3). Round w to the nearest one hundred. -700 Let p = 28.9537255 - 32.25372536. Let v = 3.3 + p. What is v rounded to 7 dps? 0.0000001 Let x(v) be the first derivative of -519v*2 - 58v + 33. Let p be x(9). Round p to the nearest one thousand. -9000 Let y = 3825 - 3825.05622. Let a = y + -263.64378. Let x = a + 279. What is x rounded to 0 dps? 15 Let u = -0.2775 + -0.0265. What is u rounded to two dps? -0.3 Suppose -2i + 2051761 - 758173 = 3u, -5i = -2u - 3233932. Suppose 3c + i = -0c. Let a = 2684404 - c. What is a rounded to the nearest 1000000? 3000000 Let r = 134 + 79. Let s = 212.515 - r. What is s rounded to 2 dps? -0.49 Let h = -0.05946 - -7.18146. Let a = h - 42.952. Let q = -36 - a. What is q rounded to 1 decimal place? -0.2 Let c(j) be the second derivative of -j*3/6 - 6j*2 + 6j. Let d be c(-15). Let t be 3 - (6/d + 501). What is t rounded to the nearest 100? -500 Let i = 25033 - -20883. Let n = i + -21416. Round n to the nearest 1000. 25000 Let b = -52.83 + 52. Let i = b + 8.63. What is i rounded to the nearest integer? 8 Let h = 107 + -162. Let p = h - -54. Round p to the nearest 10. 0 Let y = 109.63 + -0.63. Let b = -109.059 + y. Round b to 2 decimal places. -0.06 Let r = 129 + -118.16. Round r to one dp. 10.8 Let r = 153.0065 + 0.2475. Let o = -155.74 + 2.74. Let b = r + o. Round b to 2 dps. 0.25 Let p = 89.19269 + -89.2. What is p rounded to three decimal places? -0.007 Suppose -5a = -3a + 100. Let j = a - -373. Suppose 0i + 5i - j = 2w, 2w = -2i + 132. What is i rounded to the nearest ten? 70 Let o = -0.203 - 0.042. Let t = o + 0.245109. Round t to five decimal places. 0.00011 Let s = 10 + -8. Let g(m) = 14m3 - m2 - 2m - 1. Let q be g(s). What is q rounded to the nearest ten? 100 Let g(t) = -t + 4. Let a be g(7). Let p be 143(a + (-3 - -7)). Let d = p - 207. Round d to the nearest 10. -60 Let o = 10585991.60981 - 10586066. Let j = o - -74.36. Let t = 0.03 + j. Round t to four dps. -0.0002 Let w = -22.981 + -0.019. Let r = 27.1 + w. Round r to the nearest integer. 4 Let i = 16.1 - 13. Let r = -16.9 - i. Let l = r + 20.00000016. Round l to 7 decimal places. 0.0000002 Let f = 162 - 147.9. Let m = -93.1 + f. Let k = m + 79.00067. Round k to four decimal places. 0.0007 Let j = -587.4729989 - -587.443. Let r = -0.03 - j. What is r rounded to 6 decimal places? -0.000001 Let m = -34 + 23. Let j = 33 + m. Let b = j + -21.999924. What is b rounded to 5 dps? 0.00008 Let h = -38 - -16. Let w = h - -23.16. Let q = 11.24 + w. Round q to the nearest integer. 12 Let q(u) = 27646u2 - u + 12. Let s be q(-5). Suppose 0 = -7t + s + 1828833. Round t to the nearest 100000. 400000 Let m = 0.9 - 63.9. Let v = m + 62.9991. Round v to 4 decimal places. -0.0009 Suppose -5g + 4m = -32, 12 = 4g - m - 7. Suppose -3 = -gs + 5. Let o be (-9)/s*(-36)/(-1). Round o to the nearest ten. -160 Let s = -45.6 + 269.6. Let d = s - 224.000127. What is d rounded to five dps? -0.00013 Let p = -7.591 + 7.37. Round p to two dps. -0.22 Let v = -10178.0004209 - -10178. What is v rounded to four decimal places? -0.0004 Let g = 4915 + -4914.996679.	{ "pile_set_name": "DM Mathematics" }
m*3 + 4m*2 + 5m. Let f be q(5). Suppose 0w + 5w - 310 = f. Is w a multiple of 21? False Let h(i) be the third derivative of i6/120 + i5/12 - i4/4 + i3/6 - 2i2. Let u be h(-6). Is 22 a factor of 2 - (1/u - 21)? True Suppose 2372 + 2848 = 15t. Is 21 a factor of t? False Let c = -3 - 31. Let v = 11 - c. Does 15 divide v? True Let g = -226 + 359. Suppose 3d + 2m = -3m + g, 0 = 2d - 5m - 47. Is 18 a factor of d? True Let x(n) = -25n - 13. Let q(u) = -13u - 6. Let f(m) = 11q(m) - 6x(m). Does 21 divide f(10)? False Let a = 107 - -108. Suppose -3m + 8m - a = 0. Does 12 divide m? False Suppose -3g = 2t - 5t - 132, 4t = g - 32. Suppose 2u - 6u + g = 0. Does 12 divide u? True Let f be 7/28 - (-1 + (-83)/4). Suppose -2 = r + 3. Let u = f + r. Is u a multiple of 17? True Suppose -4c = 5v - 45 - 37, -5v = -3c + 79. Does 10 divide c? False Let v = 20 - 14. Does 24 divide (-715)/(-30) + 1/v? True Suppose -3g + 21 = f, 9 = -3f - 5g + 60. Does 12 divide f? True Suppose -5j + 195 = -2j. Is 13 a factor of j? True Suppose 3x - 4x = 0. Let p(h) = h*3 - h + 5. Let r be p(x). Suppose 12 = 4q, -8 = -rt - q + 95. Does 10 divide t? True Suppose 1 = w + 2z, -5w - 23 = z - 1. Let y(j) = -7j*2 + j + 2. Let a be y(-2). Let i = w - a. Is i a multiple of 16? False Suppose 0v + 3 = v. Does 2 divide v? False Is (-13 + -5)16/(-6) a multiple of 24? True Suppose 4a + t + 3 - 13 = 0, 2a = -5t + 14. Let z = 2 + a. Is 4 a factor of z? True Let i = 457 + -317. Does 19 divide i/4 - (1 - 4)? True Suppose 0 = -6m + 522 + 84. Is 14 a factor of m? False Does 45 divide 100 - ((-54)/6 - -6)? False Let r(c) = -48c*3 + 2c*2 + 3c + 2. Is 7 a factor of r(-1)? True Let d(x) = -17x3 + 2x + 1. Let v be 4/(-6) + 22/6. Let c(k) = -k*3 + 4k*2 - 3k - 1. Let m be c(v). Is 7 a factor of d(m)? False Let t(d) = 21d3 + d - 3. Let v(y) = y3 - y + 1. Let h(f) = -f3 + f2 - 1. Let l be h(0). Let o(b) = lt(b) - 2v(b). Is o(-1) a multiple of 10? False Let d = -7 + 15. Suppose -6v = -4v - d. Suppose -99 = -vf + 33. Is f a multiple of 11? True Let i = 4 - 9. Does 14 divide ((-21)/4)/(i/40)? True Let u(x) = 0x3 - x3 + 8x + 5 + 6x2 + 1. Let s(q) = -q3 + 5q*2 - 2q - 1. Let o be s(4). Does 13 divide u(o)? True Let j = -635 + 905. Suppose -5n - 4s = -230, 0 = 5n + 5s + 45 - j. Is n a multiple of 14? False Let z be (-3)/9 - (-20)/6. Suppose -2g + 3g = n - 29, 5g = -zn + 63. Is 17 a factor of n? False Is (12(-20)/(-6))/1 a multiple of 16? False Suppose 0 = 2w - 4w - 116. Let i = w + 140. Let z = i + -56. Is z a multiple of 13? True Suppose -557 = -3z - 5t, 0 = z - 0t - t - 183. Is z a multiple of 22? False Suppose 16q + 18 = 17q. Is 4 a factor of q? False Let r = 7 - 5. Let y(c) = c*3 - 2c2 + 2. Let g be y(r). Does 4 divide g/8 - 23/(-4)? False Let h(r) = -r3 + 11r - 2. Is 10 a factor of h(-5)? False Suppose 3a + 4t = 4a + 1, 3a + 5t = -20. Let j = 5 + a. Suppose j = -4u - 3 + 103. Is 9 a factor of u? False Let x(a) = -a2 + a + 2. Let h be x(-7). Let v = -26 - h. Is v a multiple of 13? False Let y = 18 + -13. Suppose u - 31 + 9 = -5o, yu + 30 = 3o. Does 5 divide 11 - (0 - (u - -2))? True Is -1 + 9 + -1 + -1 a multiple of 3? True Suppose -2s - 12 = -2, 4s = -5u + 1015. Is 23 a factor of u? True Let m be (-1)/(-2) - 798/(-12). Suppose 23 = 3l - m. Is l a multiple of 10? True Let t(a) = 32a2 + a + 2. Does 14 divide t(-1)? False Suppose -67 + 277 = -3c. Let w = -16 - c. Does 23 divide w? False Let h(g) = g*3 + 8g*2 + 5g - 7. Let m(a) = -3a3 - 17a*2 - 11a + 14. Let z(p) = 5h(p) + 2m(p). Is 8 a factor of z(5)? False Let l be (2/5)/(1/10). Suppose -li + 9i - 74 = -4p, 4i = 3p - 71. Suppose -2k + 0f + p = -5f, 0 = -5k + 5f + 45. Is k a multiple of 4? True Let s(k) = -42k + 25. Does 12 divide s(-3)? False Suppose 0 = r - 3, 5v + 3r - 7 = 22. Suppose 4n - x + 6x + v = 0, 3n + 3 = -x. Let m = 6 + n. Is 5 a factor of m? True Let l(j) = -20j - 6. Let u(z) = -z2 - 9z - 12. Let x be u(-8). Let r be l(x). Let c = -49 + r. Does 16 divide c? False Suppose 3s - 61 = -1. Is s a multiple of 5? True Let u(z) = 3z*3 - 4z*2 + 9z + 3. Is 5 a factor of u(3)? True Let p be -132/2 + 3. Let t = 23 - p. Is t a multiple of 11? True Let c(t) = -t3 + 2t*2 + 3t - 2. Let d be c(2). Let i = -6 + d. Let v(l) = 3l2 - 4l - 3. Does 9 divide v(i)? False Suppose -4h + 52 = -0h + 4t, -5t + 52 = 4h. Suppose 5n + 117 = 3w, 0 = -w - 2n + 15 + h. Does 17 divide w? True Suppose 0 = -3v - 2v + 25. Let o = -11 + v. Let k = o - -12. Does 6 divide k? True Let b = -5 + 14. Is (-1)/(b/(-6) + 1) a multiple of 2? True Let p = 12 + -5. Is 7 a factor of p? True Let q be (-3 + -5)3/6. Is (q/(-5))/(2/10) a multiple of 2? True Suppose m - 7 + 2 = 0. Let x(y) = 4y + 17. Is 13 a factor of x(m)? False Suppose 93 + 215 = -4z. Let u be (1 - 1) + (118 - 1). Let c = u + z. Is 19 a factor of c? False Let t be 285/(-4)-2. Suppose 4y - 19 = t. Suppose -4c + s + y = 3s, -c - 4s - 4 = 0. Is 8 a factor of c? True Suppose -4y = -0y + 112. Let q = 59 + y. Does 11 divide q? False Let y = -23 - -44. Let v = 40 - y. Is v a multiple of 5? False Does 11 divide (9 + -1)/((8/(-22))/(-2))? True Suppose 0 = -6i + 4i + 6. Let s(p) = 2p*3 - 3p*2 - 2p - 1. Is 11 a factor of s(i)? False Let o = 0 - 4. Is (4/1)/(-2 - o) even? True Let o(z) = z*2 + 8z + 4. Is o(-10) a multiple of 6? True Suppose 3j - 4 + 34 = 0. Let w(y) = -y2 - 11y + 14. Does 12 divide w(j)? True Suppose -p + 4p = -9. Is 5 a factor of -1 - (-10 - (p + 1))? False Suppose -19 = -4s + 1, 0 = -3k - 3s + 207. Suppose -3u + 7u - k = 0. Is u a multiple of 8? True Suppose -89 = -3x + 5a, 8x + 3a - 103 = 3x. Is 23 a factor of x? True Let i = -1 - -3. Suppose -7a + 135 = -ia. Let x = a + -17. Does 5 divide x? True Suppose -q = 1 - 3. Suppose -7c - 10 = 5k - qc, 0 = -4k + 5c - 26. Let v(u) = -u*2 - 7u - 6. Is v(k) a multiple of 6? True Suppose -5 - 4 = -3q. Let l be q/1147/9. Suppose 4h - 20 = -4m, 4h + h - m - l = 0. Is h a multiple of 4? False Let t be (-4(-51)/6)/1. Suppose -274 = -5d - t. Suppose 0x + d = 4x. Is x a multiple of 12? True Let o(j) = 49j - 14. Is 9 a factor of o(6)? False Suppose -11 = 4l + 5. Let k = 4 + l. Suppose kw + 24 = 2w. Does 6 divide w? True Let l = -45 + 93. Is 5 a factor of l? False Suppose 2c - 7c + 5 = 0. Let p be (c - 3 - -25) + 1. Suppose 4j = j + p. Does 8 divide j? True Is 2656/20 - 4 - 1/(-5) a multiple of 11? False Let n = 5 + -3. Let p = -1 + n. Is (-3p)/(3/(-38)) a multiple of 13? False Let f(h) be the first derivative of 17h4/2 - h3/3 + h*2 - h - 1. Suppose 0 = 5q - 5. Does 17 divide f(q)? True Let c = 14 + -10. Let y(u) = 49u3 - 1. Let w be y(1). Suppose 5r - w = cr. Is r a multiple of 16? True Suppose 4397 - 616 = 19a. Does 33 divide a? False Let k(y) = -y*3 - 9y*2 + 9y - 8. Let d be k(-10). Let v(f) = 14f2 + f + 2. Let l be v(d). Let p = l + -43. Is 10 a factor of p? False Suppose -2r + s = -2s - 21, -r - s + 8 = 0. Suppose -rf + 124 = -7f. Does 31 divide f? True Suppose -6z = 44 - 614. Does 21 divide z? False Let k be (6/(-4) - -3)2. Suppose ko = 2o + 8. Is 6 a factor of o? False Suppose 0 = 5h - 30 - 60. Is h a multiple of 18? True Let p = -39 - -81. Let r = -18 + p. Suppose -s = -2s + r. Is 12 a factor of s? True Let o(h) = -5h3 + h2 - 1. Let m be o(-1). Let w be (-1)/(-3) - 8/(-3). Suppose q - i + 5i = m, 4q = wi + 58. Is q a multiple of 7? False Let p(a) = -5a*3. Is 2 a factor of p(-1)? False Suppose u - 64 = -s, u = -u - 3s + 127. Is u a multiple of 7? False Suppose 3n = 36 + 39. Suppose 0 = u - 2u + n. Suppose 0 = -5s + u, 0c - 3c = -s - 31. Is c a multiple of 6? True Let o be (-9)/(-2)(-174)/(-9). Let r = -60 + o. Is 24 a factor of r? False Let l(f) = -19f - 2. Let i = -6 - -4. Does 12 divide l(i)? True Let w(j) = 11j2 + j3 - 6 - 3j + 11j + 0j3. Suppose 2c = -2c - 40. Is 7 a factor of w(c)? True Let o = 5 + 3. Let d(w) = w2 - 4w - 9. Does 10 divide d(o)? False Let c = -70 + 135. Is 13 a factor of c? True Suppose -4 = -2g - 6. Let m be 107(1 - 1 - g). Suppose 0 = 5*j + 32 - m. Is	{ "pile_set_name": "DM Mathematics" }
d + p for d. 62 Solve 5k + 18j + 14 - 7 = 22j, 0 = -5k + 31j + 47 for k. -3 Solve -1660 = -2z + 6a - 1658, -44 = -5z + 5a - 9 for z. 10 Solve 3w - w - 10 = 0, -29o - 5w = -13o - 9o - 67 for o. 6 Solve 80283h - 160564h - 2g = -80275h + 112, 3h - 3g + 60 = 0 for h. -19 Solve 0 = 2y + 2p + 30, -8y + 2p - 149 + 9 = 0 for y. -17 Solve 5g + 1409p - 1392p + 19 = -26, 3g - 2p = 34 for g. 8 Solve 2k + 13 = -g, 11k - 16g - 1 + 77 = -6k - 13g for k. -5 Solve -185267x + 5c = -185263x - 49, -17c - 155 = -2x for x. 1 Solve 0 = -80j + 5b - 920, 0b = 28076j - 28073j + b + 25 for j. -11 Solve 4a - a - a - 24x - 84 = -a, -5x = -4a - 7x - 24 for a. -4 Solve -91 = -5u + 3m, -4u - 2 - 2 + 63 = -u - 2m for u. 5 Solve 38 = -5r + v, 2r + 38 = 7r + 2v + 7 for r. -3 Solve 95 = -5d - 5i, -38i = 15d - 12d - 19 + 181 for d. -16 Solve 4c - 75j + 146 = 3c + 4c - 206j, -15 = -0c - 2c + 5j for c. 5 Solve -3p = g - 8 - 21 - 8, -35g + 129 = -2p + p for g. 4 Solve -10j - 5n - 17 = -4n - 1, 18j - 26j - 32 = -4n for j. -2 Solve -22485p + 2u = -22489p - 30, -3p - 4u - 40 = 0 for p. -4 Solve 8v + w + 55 + 33 - 51 + 79 = 0, -130 = v + 29w for v. -14 Solve -7o - 160 = -181, -2o = -2q - 12 for q. -3 Solve -2s + 891u - 18 = -895u + 1780u, 0 = s + 3u + 3 for s. -6 Solve 4740c = 4744c + 3t - 107, -270c + 5t + 7015 = 0 for c. 26 Solve -p = -0p - 5, -5p - 53 = -2x - 3p + 44 - 51 for x. 28 Solve -790w + 793w + 21 = 3q, -9 = -3q - 3w for q. 5 Solve g - 778 + 162 = 9l, -130g + 128 = -2l - 132g for l. -68 Solve -4c - 30 = -16u + 3u + 12u, -4c + 9c = -17u - 3 + 2 for c. -7 Solve -11330 = 2r + 3s - 11257, 0 = -2r + 4s + 102 for r. 1 Solve 20142c - 20147c + 111 = -3l, -5l = 4c + 222 for c. -3 Solve -p + 22 = p + 40j - 39j, 29p - j = 1556 - 1299 for p. 9 Solve -5p - 988m + 992m = -31, -15p - m - 10 = -17p for p. 3 Solve 68 = -4h + 4v, 9 = -89h + 92h - 15v for h. -22 Solve -3a - 13527 = 6q - 13518, 3a + 5q = 4a - 11 for a. 1 Solve 274h = 2d + 278h, -11h + 6h = 25d - 45 for d. 2 Solve 2w = 3r + 8, -67148r = -67149r - 3w + 1 for r. -2 Solve -4s - 3m = 4m - 12m + 41, -4s - 10m = -17m + 43 for s. -9 Solve 4k - 3m - 5789 - 5802 + 11578 = 0, -k + 5m + 16 = 0 for k. 1 Solve 5n + 7 = 48r - 36 + 302, 72 = -r + 3n for r. -3 Solve 6b = 2214m - 2230m - 6b + 236, -2b = -10 for m. 11 Solve -2d - 5g = -16, 3740g = -4d + 3741g + 10 for d. 3 Solve -12 = -f + 2r, 60f - 59f = -5r + 12 for f. 12 Solve -2k - 14 = 4w - 44, 0w + 5k = -w - 1062 + 1092 for w. 5 Solve 694 - 689 = -5r, -k - 43 = 3r for k. -40 Solve 12x - 14x + r = 8, 0 = -2x + 9r - 8 - 32 for x. -2 Solve 39l = 2p + 242, -p - 640 + 642 = l for l. 6 Solve 3l = -0a + 4a - 116, 2a - 4a + 6a = 35l + 1140 for a. 5 Solve 0 = -9n - u + 57, -4n - 676u - 28 = -342u - 338u for n. 5 Solve -15 = 8f - 3f + i - 3, f + 11i = -186 for f. 1 Solve 126 = -c + 4u + 137, -12c - 4 = -10c + 5u for c. 3 Solve 21g - 5 = -15g + 37g - 3v, -2g - 10 = 134v for g. -5 Solve -2i + 122a = 119a + 8, -9i + 3a + 3 = -3 for i. 2 Solve -4b - 8 = -5a + 10, -5a + 38b = -418b - 922 for a. 2 Solve 0 = 44f - 4x + 240, 15x + 14 = 39x - 22x - 18 for f. -4 Solve -5w = -3x - 0x + 214, -18w + 2x + 434 = 650 for w. -5 Solve 34l - 714 = 0, 0f - 6f + 38 = 6f - 3f - 8f + 2l for f. -4 Solve -c = 45d - 18d + 89, 4d = 5c - 111 for c. 19 Solve 5y + 17k + 28 = 9k, 3k = 2y + 5 for y. -4 Solve 5y = -5h + 180, 178 = 110504h - 110501h + 5y for h. 1 Solve 2k + 1 = 4u - 3, -2u + u - 56 + 30 = 3u - 17k for u. 2 Solve -2t = 6w + 22 + 230, -5t - 5 = 2w + 79 for w. -42 Solve 2k = -5b - 41, 16807b - 16888b + 4k - 373 = 0 for b. -5 Solve -d = -6z - 19, -3z + 1886475 - 1886523 = 3d for z. -5 Solve 0 = -3d + 3z + 66, -14d + 66 + 95 = -9d - 8z for d. 5 Solve -2m = 2y - 2371 + 2389, -31m - 4y - 9 = 0 for m. 1 Solve 6j = -30i + 78, 4i + 6939 = -j + 6950 for j. 3 Solve -4d - 14 = 5j - 74, 3j + 346 = -3d + 382 for d. 0 Solve -3844r - 35 = -v - 3846r, -7v + r + 130 = -37v for v. -5 Solve 3y + 2y = -753g + 750g - 97, y + 166g = -3989 for y. -5 Solve 14x + 2f = -12, -18134 = 3x - 2f - 18129 for x. -1 Solve 1028a - 1026a - 4i - 26 = 0, 37 = 5a + 4i for a. 9 Solve -l - 27 = 3o, -461858o + 461855o - 2l - 39 = 0 for o. -5 Solve 30a + 27a + 2n - 129 = 54a, -820 - 1651 = -4a - 43n for a. 5 Solve -3s = -2n + 17, 30s - 17s = 17s + 12 for n. 4 Solve -3973434j = 11k - 3973439j - 98, 0 = -k + 4j + 16 for k. 8 Solve -10c - 3h + 166 = 0, 4c - 286 = 14h - 11h - 228 for c. 16 Solve 0 = -3r + 2m - 46, -583r - 5m + 109 = -590r for r. -12 Solve -3a + s + 888 = 2s + 905, 0 = -5a + 3s - 4s - 13 for a. 2 Solve -35 = -5u + 1402d - 1401d, -u - 64 = 14d for u. 6 Solve -4y - 214p + 45 = -209p, -10 + 28 = -4y + 2p for y. 0 Solve 0 = -5c - 11d + 19, 2c + 25096d - 25101d + 30 = 0 for c. -5 Solve -10w + 13w - 336v - 56 = -323v, 5w + 2v + 25 = 0 for w. -3 Solve -333 = -7i - 5v, -978878v - 57 = -i - 978874v for i. 49 Solve g + 2g - 82 = 10t - 83, t + 4g = -21 - 9 for t. -2 Solve -16m - 2u + 416 = 94m + 95m, -3m - 4u = -18 for m. 2 Solve 68s = 5h + 73, -165s - 2h + 2 = -161s for s. 1 Solve -5d + 57 = 9v - 12v + 1 - 11, -3d = -33 for v. -4 Solve 4v + 48 = 5t + 15 - 10 + 13, -2t + 11v = -59 for t. 2 Solve x + 18 = 120o - 116o, 64o - 312 = 4x for x. 2 Solve 4 = -4w + 66d - 61d + 37, 3w - 12d - 33 = 0 for w. 7 Solve 63b = -3j + 59b + 63, 5j - 105 = 5b + 2b for j. 21 Solve q + 695a - 696a - 11 = 0, -a + 1 = -5q for q. -3 Solve -5s = l + 97, 1928s - 373 = -91l + 1933s for l. 3 Solve d - 9 = -3u, -5d - 3991u + 3972u = -61 for d. -3 Solve 5d - 6z + 77 = -2z - 38, 23z = 5d + 115 for d. -23 Solve -5d = 15c + 345, -c - 18 = 336d - 334d for c. -24 Solve 5m = i - 61, -7502m + 7497m = -4i + 274 for i. 71 Solve 100b + 100b - 2 = 197b + 5o, 18 - 43 = -5o for b. 9 Solve 5m = 4g - 69, 4m + 1933 = 4g + 1877 for m. -13 Solve 110932 = 2q + 55b + 111199, q + b + 1 = 0 for q. 4 Solve 4n - 4x = 44 + 24, -2x - 331 = 5n - 304 for n. 1 Solve -3i - h + 13 = 0, -h + 80 = 34i + 4i - 0h - 38 for i. 3 Solve -2o = -4a + o + 23, -2o = 25a - 313 + 439 for a. -4 Solve 91 = 2k + 5z, 49k = 55k - 4z - 330 for k. 53 Solve -516n + 511n - 47t + 107 = 0, 0 = n + 5t - 17 for n. 12 Solve 25i + w - 49 = 0, -217i - 5w + 1 = -214i for i. 2 Solve 7 - 17 = q - 2v, 0 = -3q - 7v + 8312 - 8251 for q. 4 Solve u - 1498 + 1517 = 3n, -43 = 7u - 3n for u. -4 Solve -3j - 261d + 515d - 7 = 250d, 0 = -4j - 6d + 36 for j. 3 Solve -14 = -2c - 4l + 22, -3l - 190 = -6c - 37 for c. 24 Solve -3429p + 3424p - 5g + 125 = 0, 0 = -3p + 11g + 145 for p. 30 Solve 0 = -5d - 13a + 38, 10 + 0 = -4a - 6 for d. 18 Solve -j + 3g + 10635 = 10644, 3g + 45 = -5j for j. -9 Solve p + 6g - 13 = 2, 4760p + 10g - 12g = 4761p - 3 for p. -3 Solve 7p + 5r = 238, -248r - 1 = -246r - 99 for p. -1 Solve 0 = 2i + 2y - 33 + 71, -40i + 44i = -2y - 68 for i. -15 Solve -6 = 2n + 28h - 31h - 41, 103 = 4n + 5h for n. 22 Solve 2z + 41 = 5r, -2r + 0r = 11z - 12291 + 12369 for r. 5 Solve 261 = 2f + b + 260, -f - 3f = 2f + 2b - 4 for f. 1 Solve -3h - 3z - 21 = 0, 165 + 166 = -4h + 2z + 363 for h. 3 Solve -349 = -9g - 28g + 30g + 5y, -3g - 4g - 2y + 370 = 0 for g. 52 Solve 402n + 2g = 397n - 40, -4n + 4g = 60 for n. -10 Solve 5z + u = -295, -u + 1292 - 2882 = 3z - 1411 for z. -58 Solve 3l - 519g + 3 = 518g - 1032g, 5g + 1 = -l for l. -1 Solve 3m - l = -5, 6m - 4l = -m - 93 + 161 - 78 for m. -2 Solve 3t + 69 + 36 = 16z, -171z - 24 = -177z - 4t for z. 6 Solve -3p + 14 = -5y, 1933p - 237 = -37y + 1929p for y. 5 Solve -12 = 3s, -2s - 2 + 3 = -5z - 5s - 6 for z. 1 Solve -2l + 2f = 8106 - 8102, -l + 2l - 5f = 14 for l. -6 Solve 17w - 5i = -79, -9i + 10i - 2 = 5w + 17 for w. -2 Solve -4o + 553l - 556l = -16, -2l = 53o - 363 for o. 7 Solve 80z - 5g - 340 = 0, z - 271349 + 271329 = 4g for z. 4 Solve -x = -8	{ "pile_set_name": "DM Mathematics" }
t s = -0.8 + v. Which is the smallest value? (a) s (b) p (c) 1/5 a Suppose -3m = 130 + 41. Let b = -24 + 66. Let g be -3 + (-2)/(b/m). What is the second smallest value in g, -0.4, 0? g Let n = 48 - 20. Let z = n - 28. What is the biggest value in 3, -1/2, z? 3 Let m be 0 + -1 + 30/26. Let p = 4 - 2. Let k be 3/(-63)p + 0. What is the biggest value in 1/6, m, k? 1/6 Let v be 0 + (-75)/(-231) - (-2)/(-11). What is the third smallest value in 1, 3, 2/3, v? 1 Let q = -6 + 2. Let k(t) = -t - 10. Let s be k(-8). What is the second smallest value in -3/8, q, s? s Let r be (20/28)/((-1)/22). Let g = r - -16. Let o = 4 - 1. What is the biggest value in g, o, -3/8? o Let h = 0.16 - 0.2. What is the second biggest value in 5, h, -2/7? h Let s be ((-4)/(-10))/((-3)/30). Let a = -3/64 - -41/192. What is the biggest value in -0.5, a, s? a Let z be ((-6)/(-4) + -1)-3. Let m = 0.31 - 0.01. What is the second biggest value in -0.3, m, z? -0.3 Let p = 8 + -11. Let h = 0.2 + -0.18. Let v = h + -2.02. Which is the second smallest value? (a) p (b) v (c) 3 b Let p = -44.7 - -45. Which is the smallest value? (a) p (b) -3 (c) 1/4 b Let r = 13 + -18. Let y = 144.3 - 152. Let u = 8 + y. What is the second smallest value in 5, u, r? u Let h = 4.5 + -5. Let m(d) = d - 2. Let u be m(3). Which is the biggest value? (a) h (b) u (c) 5 c Let u = 34 + -31. Which is the third smallest value? (a) -5 (b) 0.1 (c) u c Let l = 185/4 + -46. Which is the third biggest value? (a) l (b) 3 (c) 0 c Suppose 2l + 7 = 5k - 8, 5l = 4k - 12. Let m be 2/3(-2 + 1). Which is the second smallest value? (a) 1 (b) m (c) k a Let j(k) = -k*3 - 8k*2 - 7k - 3. Let p be j(-7). Let x be p(-4)/(-12)4. What is the biggest value in 1, 0.04, x? 1 Let i be 183/(-6)12/567. Let p = 2/27 + i. Let u = -3.01 - -0.01. What is the smallest value in p, -0.1, u? u Let p = 1.67 + -4.67. Which is the third smallest value? (a) p (b) -21 (c) 2 c Let k = -2.91 + -0.09. Let f = 8 + k. Which is the second smallest value? (a) -1 (b) 2 (c) f b Let r = -8 + 3. Which is the third smallest value? (a) -0.05 (b) r (c) 3/5 c Let m = -1/67 - -72/335. Let j = 6 + -10. Let v be (j/(-14))/(4/8). Which is the biggest value? (a) v (b) m (c) 1/6 a Let t = -3 + 4. Suppose -2b - 5k = 26, 0 = b - 2k - t - 4. Let f be 2/b - (-16)/6. What is the third biggest value in 4, -0.5, f? -0.5 Let b = 1 + -1.3. Let n = -2.35 - -2.45. What is the second smallest value in n, -1/4, b? -1/4 Let t = 33674 + -235148/7. Let z = -81 + t. Let o(p) = p*2 + 5p + 3. Let x be o(-4). Which is the third smallest value? (a) z (b) 0.2 (c) x a Let c = -5 + 3. Let b = -0.058 + -0.012. What is the third smallest value in -2/17, b, c? b Let q be -37 + 30 - (-3 - -1). Which is the second biggest value? (a) -1 (b) q (c) -0.3 (d) 1/6 c Let w = 3.97 + -4. Let t = w - 3.97. Let x = -2.96 + -0.04. What is the smallest value in x, t, 1/3? t Let u = 15 - 11. Let k = -132 + 130. Which is the biggest value? (a) 3 (b) k (c) u c Suppose p - p = -6p. Let u = -9 + 7. What is the biggest value in -0.3, u, p? p Suppose -2i - 3i = -2i. Let g = -0.3 + 0.8. Let s = g - 0. What is the second smallest value in s, 5, i? s Let l = -0.06 + -0.04. What is the third smallest value in -2/9, l, 1/2? 1/2 Let l = 0.2 + -0.13. Let o = -0.53 - -0.2. Let u = o - l. What is the smallest value in 6, u, -4? -4 Let t(i) = i*3 + 9i*2 + 8i + 4. Let k be t(-8). Which is the third smallest value? (a) k (b) 5/3 (c) -1/4 (d) -1 b Let p = -83 - -78. What is the third biggest value in 3, p, -0.3? p Let o = 5 - 8. Let z(q) = -q*3 - 4q*2 + 4q + 8. Let h be z(-6). Let w be (8/h)/(4/14). What is the biggest value in o, -2, w? w Let s = -339/5 - -68. Let k = 3390/11 - 308. Which is the biggest value? (a) s (b) k (c) 4 c Let d be 63/4 + -3. What is the third smallest value in 1, d, 2? 2 Suppose -5h = -10h + 5. Let l = 661/63 - 75/7. What is the second smallest value in h, 2, l? h Suppose -150 = 3g - 3l, -g - 5l + 14 = 46. Let y = g - -140/3. Let i = 2.99 - -0.01. Which is the third smallest value? (a) i (b) 0.3 (c) y a Let f = 9 + -15. Let v = -0.4 - 1.6. Let m = v - f. What is the second biggest value in -2/7, m, 3? 3 Let s = 0 - 0.4. Let n = -0.13 + 0.29. Let w = 0.24 + n. Which is the third smallest value? (a) 1/4 (b) w (c) s b Let l = 80.6 + -81. What is the smallest value in 0.3, l, 1? l Let w be 128/117 - 4/6. Which is the biggest value? (a) 4 (b) w (c) -3 (d) 0.4 a Let t = 9 + -9.2. Let i = 63 - 62.71. Let y = i + 0.01. Which is the second smallest value? (a) y (b) t (c) 0 c Let q(k) = k2 - 15k - 4. Let d be q(15). Let s = 0.4 - 0. Which is the smallest value? (a) 0 (b) s (c) d c Let j = -9 - -14. Let s be 2 - ((-1)/(-2) + 0). Let o = 8 - 4. Which is the second biggest value? (a) j (b) o (c) s b Let i = -15 + 21. Let m be (-8)/i(-21)/(-14). Which is the third biggest value? (a) 1/4 (b) m (c) 0.5 b Let j(x) = -x + 2. Let p = -4 + 4. Let n be j(p). Let k be (5 - n)(-2)/4. What is the second smallest value in k, 1/9, -1? -1 Let u = 0.8 + -0.6. Let p = -5843723/13 - -449756. Let w = -239 + p. What is the third biggest value in u, w, -3? -3 Let l = 5 + -8. Suppose 3x + 4h + 5 = 0, -15 = 3h - 0. Suppose 4f - 3v - 10 = 0, -4f = -f - v - x. What is the biggest value in f, l, -1/7? f Let h = -0.51 + 0.11. Which is the second biggest value? (a) 1 (b) h (c) 2 a Let l = 0.03 - -3.97. Let u = -1 - l. Let s = 4 + -4.1. Which is the smallest value? (a) u (b) s (c) -3/5 a Let a = 0.9 - 4.9. Let g = a - -5. What is the smallest value in g, -2, -3? -3 Suppose -o + 4g = -13, -2g = -o + 4o + 3. Let q(s) = -3s + 4s - 2s - o. Let y be q(4). Which is the smallest value? (a) -1/5 (b) y (c) 0.1 b Let k = 22.954 - -0.046. Let u = k + -23.06. Which is the second smallest value? (a) 2 (b) u (c) 0.3 c Let c = -9 + 10.2. Let q = -0.8 + c. What is the smallest value in 2, 2/9, q? 2/9 Let r be 19/762-2. What is the second smallest value in 1, r, 6/7? 6/7 Suppose -3f = -3h + 15, 3h = -2h + f + 13. Let z = 3 + -4. What is the third biggest value in h, 4/5, z? z Let v be ((-43)/(-3) + 4)/(-28). Let q = v - 2/21. What is the third smallest value in q, -0.01, -2? -0.01 Let u = 0.033 - 3.033. What is the third biggest value in u, 3, 3/8, 2? 3/8 Let n be ((-2)/10)/((-64)/(-160)). What is the biggest value in 0.3, 1/6, n, -1? 0.3 Let m = 115 + -114.5. Suppose t - 7 = -2. What is the second smallest value in t, 0.3, m? m Let w be 20/(-6)(-3)/2. Let s = 1 + -0.66. Let p = 0.06 + s. What is the biggest value in p, -2/21, w? w Let b = 32/7 - 29/7. What is the second biggest value in b, -7, 0? 0 Suppose 6 = -5f + 3f + 4m, 3m = -4f - 1. Let w be -1 - 3/((-9)/4). What is the second smallest value in f, -2/5, w? -2/5 Suppose -2y = 2o - 30, 4y - 28 + 8 = 0. Let n be (9/o)/(24/(-10)). Let i = 3 - 3.3. What is the second smallest value in i, 5, n? i Let j = 747/4940 - -1/380. Suppose -2z + 2 + 8 = 0. Suppose -n + 4o - 10 = -3, -zo = -15. Which is the biggest value? (a) n (b) -1 (c) j a Let z(q) = -30q + 3. Let w be z(1). Let m = 186/7 + w. Which is the second biggest value? (a) -5 (b) m (c) -4 c Suppose 5y + 40 = -3w, -4y - 32 = -0w + 3w. Let l = -6 - y. Which is the third smallest value? (a) 3 (b) l (c) 1 a Let i = 0 - -3. Let t = -2 + 2.1. Which is the second biggest value? (a) t (b) i (c) 4 b Let u be (4 + -2)/(1/(-2)). Let x be 3u/(-30)-1. What is the biggest value in 3, -1, x? 3 Let z = 0.02 + 3.98. What is the second biggest value in -0.4, 3, 5, z? z Let o = 1 - 1.6. Let d = 0.47 + 1.53. Which is the biggest value? (a) d (b) o (c) -1/6 a Let d = -256/77 + 46/11. Let u = -0.033 - -3.033. Which is the biggest value? (a) u (b) d (c) -0.3 a Let q = -95.01 + 95. What is the second biggest value in 1/2, 4, q, -1/2? 1/2 Let o = -8 - -2.8. Let z = o - -0.2. Suppose 11 = 3n - 2j + 4j, 0 = -2n - 3j + 4. Which is the biggest value? (a) n (b) z (c) -4/7 a Let q = -11 - -10. Let t(x) = x3 + 2x**2 - 1. Let s be t(q). What is the second biggest value in -0.2, s, 0.5? s Let f be 6/90 + 1 + -1. Let j = f + -17/30. What is the second biggest value in 4, j, -5? j Let l = 0.01 - -0.39	{ "pile_set_name": "DM Mathematics" }
+ 3. Let d(v) = -v*3 + 5v*2 - 2v - 2. Let j be d(2). Let q be n(j). Which is greater: s or q? s Suppose -2 = -4q - 2r - 4, 3r = 4q - 13. Suppose 0o + 5c - 10 = 5o, -2o - 4c = -2. Is o at most q? True Let m = -194 + 192. Is -24 at least m? False Let z = -3/20 + -7/20. Which is smaller: -1 or z? -1 Suppose 0 = 4j + 8. Let d be j/(-1 + (-7)/(-5)). Let l be -57/(-14)4/(-2). Is d > l? False Let b = 3 + -14. Let o be (0 + -1)-3 + b. Let g(r) = r2 + 9r + 9. Let k be g(o). Which is smaller: 2/11 or k? 2/11 Let n = -0.59 + 0.33. Let a = 0.06 + n. Are a and -2/13 non-equal? True Let g be -3 + 5 - -15 - 1. Let v = g - 15. Which is greater: 2/7 or v? v Let a = 0.3 - 0.3. Suppose -18 = -5x + 372. Let s be 2/(-13) + (-1)/x. Which is smaller: s or a? s Let x be 147/14 + (-2)/4. Suppose s = -q - 2, 5q - 5s - x = -0. Are -3/5 and q equal? False Let x be (10/(-15))/((-2)/6). Suppose -2y + 5z - 11 = 0, -4y + 2z = -x - 0. Suppose -3d + 4f = -19, -2f + 5f + 10 = -yd. Which is smaller: 2 or d? d Let j = -13/14 - -10/7. Let q = -56 - 16. Let f be q/(-42) + 4/14. Which is smaller: j or f? j Suppose -4w - 24 = -4n, -2w + 0 = 3n - 3. Let y = n - 1. Suppose -6 = 3p - 5p. Is y at least p? False Let h(k) = -k*2 - 7k - 5. Let s be h(-4). Suppose 23 - 2 = so. Suppose 0 = 6l - l - 20. Is l <= o? False Let g be ((-3)/2)/((-11)/(-154)). Is g equal to -21? True Let x = -4 + 4. Suppose u - 3u = x. Suppose 3j = 5c - 6, 5c + 0c + 5j + 10 = u. Which is greater: c or -2? c Let j(y) = -y*3 + 6y*2 - 3y - 5. Let o be j(5). Suppose 5i = op + 20, -2i = -4p + i - 13. Which is bigger: -2/31 or p? -2/31 Let a = -30 + 54. Let q = a - 22. Which is smaller: 3 or q? q Suppose -h - 4 = -3. Is h not equal to -1? False Suppose 5o - 20 = -t, 5t - 2o - 3o = -20. Suppose t = -2j + 6j + 4. Are -2 and j unequal? True Let z(o) = -o*2 - 2o + 4. Let p be z(-4). Let u = -3 - -3. Which is smaller: p or u? p Suppose 28 = 2k - 4z, -55 = -5k + 2z + 23. Is k > 16? False Let r(s) = 5s2 - 8s - 2. Let d(n) = -6n2 + 8n + 2. Let q(v) = -6d(v) - 7r(v). Let f be q(-8). Are f and 4 unequal? True Let n = -1565594/2925 - -6956/13. Let w = n - 4/75. Which is bigger: -2 or w? w Let w be ((-2)/20)/(68/(-85)). Does 1 = w? False Let i = 6.1 + -1.1. Let z = -1 + i. Let c = 53 + -54. Which is greater: z or c? z Let x(j) = -j*3 - 9j*2 + 6. Let i be x(-9). Suppose 22 = -4k + i. Are -4 and k nonequal? False Let j = 5 + -32. Are -27 and j equal? True Suppose 10 = -5m + 5w, -2m = w + 4w - 10. Which is bigger: 4 or m? 4 Let x = -26 + 32. Which is bigger: 4 or x? x Let v = 5.19 + -5.2. Suppose 0d - 3 = -3d. Which is greater: d or v? d Let v be (-4)/(-22) - 20/(-11). Suppose vu = 1 + 1. Suppose m + 4i = 14, -5i + 15 + 0 = 0. Which is bigger: m or u? m Let r be 2/(1/(-2) + 1). Suppose 3i - 2 = r. Is 2 less than or equal to i? True Suppose -4q = p - 16, 2q - 8 = p + 4p. Let x be ((-1)/(-2)-2)/1. Let w = p + x. Is -1 greater than or equal to w? True Let h = 61 + -63. Let c(l) = 2l2 + 2l - 2 - l*2 + 2l. Let q be c(-4). Is q > h? False Let q be (-16)/(-6)(1 + -4). Which is greater: q or -7? -7 Let u(q) = q2 - 8q + 20. Let i be u(8). Is i at most as big as 20? True Let j(b) = 5b - 36. Let v be j(7). Which is greater: v or 1/83? 1/83 Let a(b) = -b3 + 2b - 2. Let l be a(2). Which is bigger: l or -5? -5 Suppose -l - 20 = -5r, 3l + 5r - 10 = 6l. Let o = 8 - l. Suppose c + 16 = n - oc, -13 = -3n + 5c. Which is bigger: -5 or n? n Let t = -2.8 - -2.67. Let k = t - -0.03. Let d be 2/2032/8. Is k at least as big as d? False Suppose 0 = -9a + 4a. Suppose 5b + ab = 0. Do -1/5 and b have the same value? False Suppose -5p + 320 = -0p. Suppose -3v + 3w = -4v + 27, -p = -2v + 4w. Let k be ((-2)/v)/(2/(-6)). Is 1 at least as big as k? True Let j = 95485/6 - 15990. Let b(i) = -i3 + 11i*2 + 6i + 10. Let a be b(11). Let k = j + a. Which is bigger: 0.1 or k? k Suppose 0 = 5n - 89 + 69. Let o be (6/(-4))/((-2)/4). Which is smaller: o or n? o Let o(u) = u3 + 6u*2. Let g be o(-6). Suppose 0 = -gp + 4p. Let d(q) = q - 4. Let c be d(5). Is c less than p? False Let x = 7 - 5. Let q be x/(-4)-4 - 3. Let g be ((-20)/8)/(q/2). Which is bigger: 4 or g? g Let j = 34 - 32.7. Let d = 13 + -14. Let k = j + d. Which is smaller: 1 or k? k Let z be 54/(1 - -2) - 0. Suppose 5y - z = 4x, 5y - 3y = x + 6. Is x < -1/2? True Let v be 1105/25 + -4. Which is smaller: v or -0.02? -0.02 Let b = 0.38 - 0.19. Let l = -0.022 + 0.032. Let i = l + b. Which is smaller: i or 2/7? i Let b = 52 + -311/6. Let d(j) = -j2 + j + 1. Let a be d(0). Which is smaller: b or a? b Suppose 3f - 2f - 1 = 0. Let o be (f/3)/(1/3). Let j = -1 - -2. Is j smaller than o? False Suppose -j - 31 = -5p - 1, -3j + 5 = 4p. Let r be j/(-10) - 3/(-6). Is 2/67 less than or equal to r? True Let h = 99 + -125. Which is smaller: h or -28? -28 Suppose c + 2 = 2c. Let d be (c/(-6))/(8/6). Suppose 4l - 3n + 49 = 0, -3n + 5n - 6 = 0. Is d >= l? True Let m be (-3 + 1)/(14)2. Is 9/11 <= m? False Suppose 2b + 8 = -2b. Suppose -11 = -r + 2n, 4n - 3n = -4r + 8. Let z be ((-3)/r + 1)/(-2). Is b > z? False Suppose -5d + 4d = -3. Let x = d + -2. Does 2 = x? False Suppose 4y + 6 = 2k + 2, -5k = 5y + 35. Which is greater: y or 1/5? 1/5 Let h = -14 + 13. Let l be 4/10 + 8/(-70). Are h and l non-equal? True Let x = 1.9 + -2. Which is greater: x or -5? x Let n = -3 + 3.7. Let c = -0.81 + n. Let m = c - -0.01. Is -1 at least as big as m? False Let t be (-15)/(-1)(3 + -2). Suppose t + 5 = 4a. Are a and 4 nonequal? True Let p = 2 + -5. Let j(i) = -i2 - 5i - 2. Let b be j(-5). Let m = b - p. Is -3 greater than or equal to m? False Let h be (-1)/((-1 - -2)/28). Which is bigger: h or -27? -27 Let c(f) = 3f + 29. Let z be c(-13). Is -12 at least as big as z? False Let c(h) = -h - 8. Let b be c(-8). Let o = b - 1. Which is bigger: o or -3/4? -3/4 Suppose 0 = -5f - 56 - 144. Are -39 and f unequal? True Suppose 0 = -2p - 0p + 14. Do 9 and p have different values? True Let u(p) = 8p3 - p. Let g be u(1). Let k = 6 - g. Is 0 greater than k? True Let o be 155/(-90) - (0 - 4/18). Is o < 2? True Suppose 4t + 0t - 40 = 0. Let a(u) = -u3 + 13u*2 + 17u - 31. Let x be a(14). Which is bigger: t or x? x Suppose -4o + 11 = -1. Suppose 3x - 8x - 25 = 0, 2x = -2t - 8. Let n be 16/12 + (t - o). Is 0 equal to n? False Let p be 13/21 + 2/(-7). Which is bigger: 2/17 or p? p Suppose 0 = 8q - 2 - 6. Let y(m) be the third derivative of -7m6/120 - m5/60 + m4/24 - m3/6 - m2. Let i be y(q). Is i >= -7? False Suppose 3v = 5v - 4, -5m = 4v - 18. Suppose 3j - 2 = ms, -5j - 4s = -2s + 2. Is -2/9 >= j? False Let s be (-1 - -2) + 88/8. Suppose 0 = 2i - 6i - s. Which is greater: 2 or i? 2 Suppose -2q - q + 5 = -5x, -5x - 5q - 5 = 0. Suppose -6 = 5w - 26. Suppose 0l + 4 = -wl. Is x >= l? True Let h = -1172/17 - -69. Are h and 0 non-equal? True Suppose 2a + 4 = 3a. Let l = a + 1. Let p = l + -6. Which is smaller: 1/10 or p? p Let o = -12 - -17. Suppose 100 + 35 = -ob. Let a be ((12/b)/2)/1. Which is smaller: a or 0? a Let q(u) = -u*2 - 2u + 2. Let l be q(-2). Let f be l/3 - (-5)/15. Let p be -3 + f - (1 - 6). Is p at least as big as 4? False Suppose -5s - 124 - 16 = 0. Which is smaller: s or -27? s Suppose 4 = 5s - 61. Are s and 53/4 equal? False Suppose -2n - 4 = 2. Let i = n - -7. Suppose -5u - 15 = 3v, 3v + 3u + i + 5 = 0. Which is smaller: v or -2/3? -2/3 Let z = -6 - -5. Suppose -4m + 9m = 15. Suppose t = -mt. Which is smaller: z or t? z Suppose 3l - l + 3l = 0. Which is greater: 2 or l? 2 Let f(i) = i + 7. Let z be f(-6). Is -2/45 greater than or equal to z? False Let v = 0.05 + 1.95. Let u = -0.04 - -0.14. Which is greater: v or u? v Let m be (84/(-15))/(4/(-10)). Let j be (-10)/(-35) - 88/m. Is j less than or equal to -6? True Let w be 2/9 - (-10)/(-45). Suppose 0 = 4h - l + 5 + 12, h + 4l = 17. Let g = -3 - h. Is g less than w? False Suppose -z - 123720 = -4*z. Let s be 6/(-2) + z/9528. Let j = -2/397 - s. Which is bigger: -2 or j? j Let w = 1.5 + -1.32. Let m = -1.82 - w. Are m and -0.4 unequal? True Let k = -18 + 6. Are k and	{ "pile_set_name": "DM Mathematics" }
? x*2 + 1043467x + 650 What is the t'th term of -7222, -17210, -29960, -45472? -1381t2 - 5845t + 4 What is the y'th term of 18191, 36485, 54779, 73073, 91367? 18294y - 103 What is the v'th term of 9277095, 9277093, 9277091, 9277089? -2v + 9277097 What is the o'th term of 30969, 30257, 29545, 28833, 28121? -712o + 31681 What is the x'th term of 16936, 3960, -9018, -21998, -34980, -47964, -60950? -x2 - 12973x + 29910 What is the v'th term of -9151768, -9151765, -9151762, -9151759? 3v - 9151771 What is the g'th term of 36524, 36606, 36822, 37238, 37920, 38934? 11g3 + g2 + 2g + 36510 What is the l'th term of -1077, -1534, -1461, -858, 275, 1938, 4131? 265l*2 - 1252l - 90 What is the k'th term of 2057, 3189, 4299, 5387, 6453, 7497, 8519? -11k2 + 1165k + 903 What is the r'th term of 2531883, 2531870, 2531851, 2531826, 2531795, 2531758? -3r2 - 4r + 2531890 What is the t'th term of 8942, 18633, 28306, 37955, 47574? -t*3 - 3t*2 + 9707t - 761 What is the z'th term of -158845, -634952, -1428451, -2539336, -3967601, -5713240, -7776247? z*3 - 158702z*2 - 8z - 136 What is the f'th term of 2384, 1203, -760, -3505, -7032, -11341, -16432? -391f2 - 8f + 2783 What is the a'th term of -2443355, -4886724, -7330093, -9773462? -2443369a + 14 What is the c'th term of -70792, -66698, -62604, -58510? 4094c - 74886 What is the t'th term of -55169, -48006, -40843, -33680? 7163t - 62332 What is the y'th term of 960011, 3840147, 8640405, 15360785, 24001287, 34561911? 960061y*2 - 47y - 3 What is the d'th term of 82548, 162121, 241698, 321279, 400864, 480453? 2d2 + 79567d + 2979 What is the t'th term of 102556, 410254, 923086, 1641052, 2564152? 102567t2 - 3t - 8 What is the l'th term of 110587, 221114, 331583, 441988, 552323, 662582, 772759? -l*3 - 23l*2 + 110603l + 8 What is the k'th term of 7427455, 7427460, 7427465, 7427470, 7427475? 5k + 7427450 What is the m'th term of -5930, -22389, -49838, -88277, -137706, -198125? -5495m*2 + 26m - 461 What is the x'th term of 4706451, 9412900, 14119349? 4706449x + 2 What is the f'th term of 292, 17, -476, -1193, -2140, -3323, -4748? -f3 - 103f*2 + 41f + 355 What is the r'th term of 5185353, 10370705, 15556057? 5185352r + 1 What is the y'th term of -17791699, -35583395, -53375091, -71166787? -17791696y - 3 What is the t'th term of -1515250, -1515365, -1515476, -1515583, -1515686, -1515785, -1515880? 2t2 - 121t - 1515131 What is the s'th term of -9048, -17852, -26656, -35460? -8804s - 244 What is the f'th term of 34574, 34534, 34492, 34448? -f2 - 37f + 34612 What is the t'th term of -533995, -534014, -534037, -534058, -534071, -534070, -534049, -534002? t*3 - 8t*2 - 2t - 533986 What is the w'th term of -52256, -208921, -470030, -835583, -1305580? -52222w2 + w - 35 What is the a'th term of 843, 3872, 9115, 16572, 26243, 38128, 52227? 1107a*2 - 292a + 28 What is the c'th term of 138595, 277196, 415809, 554434? 6c2 + 138583c + 6 What is the c'th term of -59710, -59041, -58372? 669c - 60379 What is the f'th term of 5165, 29196, 72093, 133856, 214485, 313980, 432341? 9433f*2 - 4268f What is the r'th term of 14365, 14293, 14213, 14119, 14005? -r*3 + 2r*2 - 71r + 14435 What is the y'th term of -459635, -3677010, -12409863, -29415932, -57452955, -99278670, -157650815? -459623y3 - y2 - 11y What is the f'th term of 204066, 204341, 204604, 204849, 205070? -f*3 + 282f + 203785 What is the a'th term of -11235310, -44941234, -101117774, -179764930? -11235308a2 - 2 What is the o'th term of -164852, -165000, -165150, -165302? -o2 - 145o - 164706 What is the b'th term of -744193, -2976778, -6697753, -11907118, -18604873, -26791018? -744195b2 + 2 What is the m'th term of -4141, -17002, -38581, -68878, -107893, -155626, -212077? -4359m*2 + 216m + 2 What is the s'th term of -15457, -30924, -46357, -61762, -77145? -s*3 + 23s*2 - 15529s + 50 What is the p'th term of -2640, -2513, -2386? 127p - 2767 What is the k'th term of 36074576, 36074583, 36074596, 36074615? 3k*2 - 2k + 36074575 What is the p'th term of 2281, 13, -2221, -4403, -6515, -8539? 3p3 - p2 - 2286p + 4565 What is the r'th term of 334842, 669681, 1004506, 1339311, 1674090, 2008837, 2343546? -r3 - r2 + 334849r - 5 What is the i'th term of -39908781, -39908782, -39908783, -39908784, -39908785, -39908786? -i - 39908780 What is the u'th term of -348, -1203, -2634, -4653, -7272, -10503? -2u*3 - 276u*2 - 13u - 57 What is the o'th term of -181245, -181243, -181237, -181221, -181189, -181135? o*3 - 4o*2 + 7o - 181249 What is the f'th term of -1016317, -1016285, -1016251, -1016215, -1016177, -1016137, -1016095? f*2 + 29f - 1016347 What is the c'th term of -16404, -36520, -56636, -76752, -96868? -20116c + 3712 What is the k'th term of 1833397, 7333607, 16500627, 29334457, 45835097? 1833405k*2 - 5k - 3 What is the t'th term of -55080, -440677, -1487304, -3525477, -6885712, -11898525, -18894432, -28203949? -55086t3 + t2 + 2t + 3 What is the r'th term of -7791, -15604, -23349, -31026, -38635? 34r2 - 7915r + 90 What is the q'th term of 2379607, 2379502, 2379397, 2379292, 2379187? -105q + 2379712 What is the y'th term of 1933, 5340, 10961, 18790, 28821? -y3 + 1113y*2 + 75y + 746 What is the j'th term of 3867, 16369, 37523, 67329? 4326j2 - 476j + 17 What is the i'th term of 357134, 714283, 1071448, 1428629? 8i2 + 357125i + 1 What is the z'th term of 42707142, 85414271, 128121400, 170828529, 213535658? 42707129z + 13 What is the s'th term of 78581923, 157163843, 235745763, 314327683? 78581920s + 3 What is the k'th term of -6335337, -6335344, -6335351, -6335358, -6335365, -6335372? -7k - 6335330 What is the b'th term of 6680158, 13360321, 20040484, 26720647, 33400810, 40080973? 6680163b - 5 What is the n'th term of -6777926, -13555889, -20333852, -27111815, -33889778, -40667741? -6777963n + 37 What is the a'th term of -56739, -123103, -189467, -255831? -66364a + 9625 What is the z'th term of -4896814, -9793627, -14690440, -19587253, -24484066? -4896813z - 1 What is the o'th term of 27762864, 55525730, 83288594, 111051456, 138814316? -o2 + 27762869o - 4 What is the c'th term of -32171408, -32171421, -32171436, -32171453? -c*2 - 10c - 32171397 What is the w'th term of -2862, -2642, -2264, -1716, -986? 2w3 + 67w*2 + 5w - 2936 What is the j'th term of 435784, 435671, 435558, 435445, 435332? -113j + 435897 What is the x'th term of -902747, -902688, -902625, -902558? 2x*2 + 53x - 902802 What is the k'th term of 28852, 57655, 86458, 115261? 28803k + 49 What is the t'th term of 38386, 76745, 115094, 153439, 191786, 230141? t3 - 11t*2 + 38385t + 11 What is the v'th term of 408, 517, 806, 1365, 2284, 3653, 5562, 8101? 15v3 + 4v + 389 What is the s'th term of 78174853, 78174851, 78174849? -2s + 78174855 What is the g'th term of -164833, -164774, -164715? 59g - 164892 What is the m'th term of 1381537, 1381517, 1381485, 1381441? -6m2 - 2m + 1381545 What is the p'th term of 3624592, 3624592, 3624590, 3624586, 3624580, 3624572? -p*2 + 3p + 3624590 What is the n'th term of -130177839, -130177837, -130177835? 2n - 130177841 What is the b'th term of 11810, 7911, 4014, 119, -3774? b2 - 3902b + 15711 What is the f'th term of -22480, -89961, -202438, -359911, -562380? -22498f2 + 13f + 5 What is the g'th term of -279, -3011, -7563, -13935, -22127, -32139, -43971? -910g2 - 2g + 633 What is the f'th term of -254011, -1016029, -2286067, -4064125, -6350203? -254010f2 + 12f - 13 What is the c'th term of 1490, 2815, 4116, 5393, 6646, 7875? -12c2 + 1361c + 141 What is the d'th term of 8680739, 8680734, 8680727, 8680718, 8680707, 8680694, 8680679? -d*2 - 2d + 8680742 What is the k'th term of -95983, -105301, -114619, -123937? -9318k - 86665 What is the b'th term of -2315704, -4631417, -6947134, -9262855? -2b*2 - 2315707b + 5 What is the i'th term of -23642, -47233, -70774, -94265? 25i2 - 23666i - 1 What is the j'th term of -16335, -16104, -15873, -15642, -15411? 231j - 16566 What is the a'th term of -6938892, -6938893, -6938872, -6938817, -6938716, -6938557? 2a3 - a2 - 12*a - 6938881 Wh	{ "pile_set_name": "DM Mathematics" }
late the remainder when r is divided by 65. 62 Suppose 0 = 6m + 4446 + 1824. Let a = -907 - m. Calculate the remainder when a is divided by 29. 22 Calculate the remainder when -9 + 108/(-42)(-3486)/18 is divided by 55. 49 Suppose 3y + 5 = 14. Suppose -17 = -r - 2i, -yi - i + 8 = 0. Let t = 23 - r. What is the remainder when 28 is divided by t? 8 Suppose 12t - 2298 = 5934. Suppose -6j + 124 = -t. What is the remainder when j is divided by 39? 18 What is the remainder when 104 is divided by -3(78 - 80)/((-6)/(-5))? 4 Let f(r) = -r*3 + 3 - 392r + 4 + 2r2 - 9r*2 + 398r. Suppose 3z - 2o + 7o + 19 = 0, 0 = 3o - 3. Calculate the remainder when 89 is divided by f(z). 20 Let x = 9451 - 9431. What is the remainder when 34 is divided by x? 14 Let y = 230 - 217. Let a(u) = 3u - 1 - 25 - 8. What is the remainder when 23 is divided by a(y)? 3 Let l(z) = 2z*3 + 3z*2 - 3z - 5. Let w be l(-1). Let c = 60 - w. Calculate the remainder when c is divided by 31. 30 Let o(x) = -x*2 - 16x - 31. Let d be o(-15). Let n = -79 + d. Let t = -60 - n. What is the remainder when 103 is divided by t? 33 Let h = -61 + 85. Suppose 0 = 4a - 0 - h. Let p(f) = -13945f + 27912. What is the remainder when p(2) is divided by a? 4 Let i = 68 - -242. Calculate the remainder when 936 is divided by i. 6 Let l(g) = -g3 + g2 - 2g - 5. Let h be l(-5). Let y = 259 - h. Let t = 108 - 87. What is the remainder when y is divided by t? 20 What is the remainder when 20(-15)/(-3000) - 3199/(-10) is divided by 79? 4 Let s(m) = m*3 + 7m*2 - 12m - 21. Let g be s(-8). Suppose gf - 281 = -6. Let h = -529 - -752. What is the remainder when h is divided by f? 23 Let x(g) = 5g*2 - 2g. Let o be x(2). Suppose -10z - 2b = -5z - 250, -129 = -2z + 5b. What is the remainder when z is divided by (0 - -1)-1 + o? 7 Let l be ((-65)/(-5) + -6)1/1. Suppose -20 = -9s + l. Suppose sr - 32 = 253. Calculate the remainder when r is divided by 7. 4 Let j(m) = m3 - 17m*2 + 44m - 22. Let y = -154 + 168. Calculate the remainder when 74 is divided by j(y). 2 Suppose 0 = -2y + 5o + 69, 153 = 202y - 199y - 2o. What is the remainder when 3536 is divided by y? 2 Let w(n) = n3 + 31n*2 - 33n - 9. Suppose 0 = -16b + 21b + 160. What is the remainder when 64 is divided by w(b)? 18 Let t(i) = -i*3 + 9i*2 + 38i - 14. Let w = -14 + 49. Calculate the remainder when w is divided by t(12). 5 Let v(b) = -183b - 10. Let s be v(8). Let a = s - -853. What is the remainder when 26 is divided by ((-2)/(-3))/((-46)/a)? 8 Let f(b) be the first derivative of -2b*3/3 - 55b*2 + 3b - 314. What is the remainder when f(-55) is divided by 2? 1 Let w be -1 - (2/17 - (-7160)/(-170)). Let b = w - 23. Calculate the remainder when 58 is divided by b. 4 Let h(o) = -o*3 + 22o*2 - 59o - 29. Calculate the remainder when 1036 is divided by h(18). 11 Let o(l) = -l*3 - 18l*2 - 19l. What is the remainder when (-17 - 49)/((1 - 3) + 1) is divided by o(-17)? 32 Suppose 0 = -4w + c + 5866, 85c = 82c - 6. What is the remainder when w is divided by 113? 110 Let c = 26 + -50. Let d be c/(5 - 1) - -4. Calculate the remainder when 34 is divided by d/(-3) + (112/12 - 0). 4 What is the remainder when 171 is divided by (12(-1)/5)/(1038/(-6920))? 11 Let c(n) be the second derivative of -16n + 1/20n*5 + 0 + 1/6n*3 + 29/2n*2 - 1/6n*4. What is the remainder when 142 is divided by c(0)? 26 Suppose 0 = 2n + 8n - 543 - 357. What is the remainder when 2879 is divided by n? 89 Calculate the remainder when 282 is divided by ((15/(-9))/((-8)/6))/((-166)/(-3320)). 7 Let h(v) = -249v - 6076. What is the remainder when 2524 is divided by h(-25)? 140 Suppose 4z - 80 = -5r - z, -4r + 4z + 24 = 0. Let v(a) = -2736a + 16 + 17 + 2739a. What is the remainder when v(6) is divided by r? 7 Let p = 85 - 76. Let g(f) = -2f + 4. Let b be g(0). Suppose bw - 5w = -44. Calculate the remainder when w is divided by p. 8 Suppose -548q - 1410 = -558q. What is the remainder when 981 is divided by q? 135 Let r = 4 - -1. Suppose 7 = 6m - r. What is the remainder when (-10 - m)/(18/(-27)) is divided by 5? 3 Let j(l) = 16l2 - 80l + 102. Calculate the remainder when 10918 is divided by j(3). 4 Suppose 14a - 604 = -86. Calculate the remainder when a is divided by 26 - (7 + 7 + -9). 16 Suppose 104 + 358 = 29l + 56. Let k(u) = -u*2 + 6u + 17. Calculate the remainder when l is divided by k(7). 4 Suppose -131 = 117f - 11012. Let x(t) = 7 + 3t - 4t - 3. Calculate the remainder when f is divided by x(-2). 3 Let j(r) be the first derivative of -r2/2 + 42r - 75. Let x(s) = s*3 + 6s*2 - 6s - 4. Calculate the remainder when x(-6) is divided by j(25). 15 Let x(c) = 8c2 + 26c - 246. Calculate the remainder when x(8) is divided by 16. 10 Suppose 3y + 2y - 2v = 101, -y + v = -19. Suppose yb + b - 4686 = 0. Calculate the remainder when b is divided by 73. 67 Let n(z) = 231z + 7. Let x = -315 + 317. What is the remainder when n(x) is divided by 59? 56 Suppose -w = -2a + 62, 3a + 2a - 5w = 140. What is the remainder when a is divided by 16? 2 Let k be (-13 + (-1 - -4))/(-2). Suppose 4b - ks - 337 = -14, 4s - 20 = 0. What is the remainder when (-2 + 2 + b)(4 - 3) is divided by 18? 15 Suppose -16m + 2m + 3584 = 0. What is the remainder when 520 is divided by m? 8 Let q be (2/(-6))/(8 - 4330/540). Suppose 53b + q = 55b. Calculate the remainder when 21 is divided by b. 3 Let s be ((0 + 8/(-20))235)/1. Let m = -74 - s. What is the remainder when m is divided by (-6)/3-1 - -6? 4 Let z be 2/8 + 44/16. Let a be (z - 4) + -3 + 16. Suppose -15i + 108 = -ai. Calculate the remainder when 69 is divided by i. 33 Suppose 563x - 59192 - 6116 = 0. Let g(h) = -h*3 + 7h*2 - 3h - 6. What is the remainder when x is divided by g(6)? 8 Let u(v) = -13v - 11. Suppose -65 = -2c + t, 0t = -3c + 2t + 99. Let n = c - 34. Calculate the remainder when u(n) is divided by 10. 8 Let t = -89 - -98. Let d be 3/(1 - 4)-1. What is the remainder when (d - -18) + (7 - 9) is divided by t? 8 Calculate the remainder when 195 is divided by (-1)/3-105 - 10. 20 Let k(f) = -32f - 16. Let z(r) = -16r - 11. Let h(v) = 6k(v) - 11z(v). What is the remainder when h(-7) is divided by 70? 67 Suppose -3a - 5g = -109 - 39, -5a + 234 = 2g. Calculate the remainder when 75 is divided by a. 29 Let i be (-3)/2(-471 + -49). Let p = i - 760. Calculate the remainder when p is divided by 19. 1 Suppose 227 = -29v + 84v - 4778. Calculate the remainder when v is divided by 68. 23 Suppose -26 = -2b + 5m, -5m - 35 = -4b - 3. Suppose 5n = 5s + n - 790, bs - 474 = n. What is the remainder when s is divided by 8? 6 Let u be 6/427 - -158. Let v = 197 - u. Calculate the remainder when 72 is divided by v. 34 Let n = -22522 + 22987. What is the remainder when n is divided by 14? 3 Suppose -9b + 4b + 26 = 4r, -5r + 22 = b. Suppose -s = i - 6i + 100, 4s + 80 = ri. Suppose 0q - i = -10q. What is the remainder when 6 is divided by q? 0 Let d(m) = -9m*2 + 88m - 135. Calculate the remainder when d(7) is divided by 29. 11 Let o = -2483 + 2958. Calculate the remainder when o is divided by 26. 7 Suppose j - 3 = 7. Let x(m) = -2m3 - 6m*2 - 5m + 3. Let c be x(-2). Suppose cn = 119 - 34. What is the remainder when n is divided by j? 7 Let w(h) = 2h*2 + 64h - 20. Let a be 68(-5 + 9 + -3)/(-2). Calculate the remainder when w(a) is divided by 18. 8 Suppose 4y + 15n = 80 + 219, n = -y + 72. What is the remainder when 247 is divided by y? 34 Let n(f) = -6f + 10. Suppose 15x + 18 = 12x. What is the remainder when n(x) is divided by -6 - 2/((-4)/46)? 12 Let l(b) = 16b2. Let a be l(2). Let q = a + -37. Suppose -74v + 196 = -252 - 70. Calculate the remainder when q is divided by v. 6 Calculate the remainder when 1539 is divided by ((-80)/48)/((-1)/21). 34 Suppose -4r - 5 + 16 = -c, 0 = -5r + 4c + 11. Calculate the remainder when (336/252)/(8/126) - 10 is divided by r. 2 Let m(u) = -57u + 275. Calculate the remainder when m(-8) is divided by 15. 11 Suppose 2d + 50 = 4n, n - 30 = 7d - 11. Calculate the remainder when 3609 is divided by n. 9 Let h(l) = 3l - 3. Let f be 7 - (1 + 2 + -2). Let b = 364 + -362	{ "pile_set_name": "DM Mathematics" }
hat is n(-2)? 51 Let n(f) = -3f3 - 19f - 46. What is n(-2)? 16 Let p(a) = 2a2 + 850a + 3404. Determine p(-4). 36 Let d(r) = -28r3 - 2r2 + r - 2. Determine d(-2). 212 Let g(x) = x3 + 14x2 - 19x + 30. Calculate g(-15). 90 Let f(s) = -s*3 - 29s*2 - 26s + 94. Give f(-28). 38 Let b(n) = -3n3 - 10n*2 + 3n + 36. Calculate b(-3). 18 Let g(w) = 14w2 + 90w - 282. What is g(3)? 114 Let h(b) = 27b + 306. What is h(-8)? 90 Let v(p) = p2 - 7p - 175. Give v(-12). 53 Let p(k) = -339k + 4735. What is p(14)? -11 Let s(g) = 56g*3 - 10g*2 + 12g - 5. Give s(1). 53 Let v(y) = y*3 - 15y*2 + 13y + 1. Calculate v(13). -168 Let i(c) = -117c - 204. Calculate i(-2). 30 Let y(d) = 3900d - 27265. Calculate y(7). 35 Let l(a) = 2741a + 131568. What is l(-48)? 0 Let w(h) = 7h - 23. Calculate w(6). 19 Let q(b) = b*2 + 19b - 210. What is q(-27)? 6 Let b(q) = 2q3 - 13q*2 + 17q - 10. Calculate b(5). 0 Let l(u) = -u*2 - 23u + 97. Give l(-26). 19 Let i(j) = -2100j + 109189. What is i(52)? -11 Let l(d) = -3d*3 + 168d*2 - 474d - 38. Give l(53). 121 Let l(j) = 19j2 - 1730j + 54. Calculate l(91). -37 Let j(b) = -b*2 - 4917b - 9823. What is j(-2)? 7 Let v(i) = 289i - 1192. Calculate v(4). -36 Let r(p) = -546p - 1199. Determine r(-2). -107 Let t(d) = -15d2 + 8d + 37. Determine t(-1). 14 Let n(x) = -4x2 - 25x + 24. Give n(-5). 49 Let r(c) = -c*3 - 65c*2 + 71c + 298. What is r(-66)? -32 Let b(z) = -28910z + 173466. Determine b(6). 6 Let q(i) = 47i*2 + 333i + 14. Determine q(-7). -14 Let x(r) = -r*3 - 23r*2 + 15r - 25. What is x(-24)? 191 Let d(g) = 187g + 6903. Give d(-37). -16 Let h(t) = 10t*2 + 83t - 5. Calculate h(-8). -29 Let j(a) = a*2 - 17a - 377. Calculate j(30). 13 Let z(u) = 29u3 + 14u*2 - 28u + 11. Give z(2). 243 Let d(n) = 2n - 15. Determine d(3). -9 Let h(l) = l3 - 31l*2 - 31l + 6. Give h(32). 38 Let a(y) = -2y2 + 112y + 436. Calculate a(60). -44 Let s(a) = -a*2 + 79a - 1150. What is s(19)? -10 Let o(h) = 37h + 1117. Give o(-26). 155 Let p(v) = -2v*3 - 19v*2 + 111v + 249. Calculate p(-13). -11 Let l(p) = -p*3 - 16p*2 + 39p + 597. What is l(-16)? -27 Let j(w) = -w*2 - 73w - 654. What is j(-9)? -78 Let h(u) = u*3 - 10u*2 - 10u + 19. Give h(9). -152 Let q(r) = 2r2 + 81r + 847. What is q(-14)? 105 Let o(z) = 215z + 16334. Give o(-76). -6 Let d(w) = w3 - 73w*2 + 248w - 7524. Give d(71). 2 Let j(f) = -245f + 28669. Calculate j(117). 4 Let i(w) = w2 + 160w - 1705. Give i(10). -5 Let a(c) = c*2 - 41c + 282. Calculate a(32). -6 Let u(s) = -s*3 - 38s*2 + 23s - 447. Give u(-39). 177 Let h(m) = 6m2 + 30m - 1976. What is h(16)? 40 Let g(w) = w*2 + w - 236. Give g(14). -26 Let q(b) = 12b - 482. Give q(45). 58 Let o(a) = -3a + 207. Give o(4). 195 Let a(s) = 229s - 254. What is a(1)? -25 Let s(t) = -17t - 800. What is s(-46)? -18 Let z(g) = -123g + 98. Determine z(0). 98 Let p(x) = 232x - 1238. Give p(5). -78 Let b(g) = -g3 + 11g*2 - 11g - 17. Calculate b(10). -27 Let a(f) = -f*2 + 267f + 37172. Calculate a(-101). 4 Let y(b) = 3b3 + 109b*2 + 641b + 28. Determine y(-29). -59 Let c(a) = a*3 - 18a*2 + 40a + 40. Calculate c(15). -35 Let l(y) = -y*3 + 39y*2 + 5y + 52. Calculate l(39). 247 Let o(t) = 13t3 - 50t*2 - 25t + 19. Determine o(5). 269 Let v(o) = 5458o - 60034. Calculate v(11). 4 Let a(x) = -7x*3 + 183x*2 + 70x - 2493. Give a(26). 3 Let k(m) = -70m + 519. Determine k(8). -41 Let s(f) = 10f + 348. Give s(-37). -22 Let g(y) = y*3 + 11y*2 + 9y - 14. Give g(-5). 91 Let s(j) = -6j3 + 40j*2 - 27j - 2. Determine s(3). 115 Let x(f) = 2f2 - 58f + 250. Give x(22). -58 Let q(h) = h*2 - 47h - 1862. Give q(73). 36 Let f(j) = 331j + 2317. Give f(-7). 0 Let g(a) = 3a*2 + 20a + 28. Give g(-9). 91 Let j(i) = 12i - 138. Determine j(0). -138 Let u(c) = 62c - 649. What is u(9)? -91 Let l(u) = -u*3 + 148u*2 + 275u + 3735. Determine l(150). -15 Let v(n) = -n*3 - 262n*2 - 3698n + 98. Give v(-15). -7 Let k(d) = -3d2 - 16d - 8. Give k(4). -120 Let l(w) = -w*3 + 66w*2 - 176w - 819. Determine l(63). 0 Let d(r) = 18r2 - 40r - 155. Calculate d(-4). 293 Let z(l) = -l*2 + l - 14. Determine z(6). -44 Let j(w) = 2w*3 + 3w*2 + 14w + 42. What is j(-3)? -27 Let p(o) = -5779o + 52007. Determine p(9). -4 Let q(p) = 42p*2 - 1053p + 33. Calculate q(25). -42 Let l(r) = r3 + r2 - 4r + 5. Calculate l(-3). -1 Let h(t) = -16025t - 128207. Give h(-8). -7 Let h(q) = 2q2 + 257q + 4259. Calculate h(-110). 189 Let h(t) = 397t2 + 1986t + 10. Calculate h(-5). 5 Let q(j) = -2j3 + 6j*2 + 6j - 61. What is q(3)? -43 Let g(q) = 177q + 1588. Determine g(-9). -5 Let y(f) = -2f*2 - 350f - 133. Give y(-175). -133 Let f(d) = 27d + 45. Determine f(-8). -171 Let g(c) = -c3 - 151c*2 - 1135c + 1288. Give g(-143). 1 Let a(r) = -r*3 - 25r*2 - 51r - 567. Determine a(-24). 81 Let c(l) = 2l2 - 10l - 412. Calculate c(18). 56 Let q(c) = -c*2 + 45c - 50. Give q(44). -6 Let s(i) = i*3 + 5i*2 - 1977i - 11853. What is s(-6)? -27 Let b(j) = -j*3 + 8j*2 - 44j + 94. Calculate b(3). 7 Let g(b) = 13b - 870. Give g(66). -12 Let j(v) = v2 - 37v - 25. Determine j(-2). 53 Let o(c) = -30c + 1291. What is o(42)? 31 Let c(b) = -15b*2 + 1037b - 2158. Give c(67). -14 Let l(f) = -3448f + 106887. What is l(31)? -1 Let x(o) = -o2 - 8o - 234. Calculate x(0). -234 Let g(k) = -2532k + 48103. What is g(19)? -5 Let r(y) = 600y + 6002. What is r(-10)? 2 Let d(r) = -r*3 - 27r*2 + 220r + 1912. Calculate d(-32). -8 Let m(s) = s*3 + 11s*2 + 22s - 325. Calculate m(4). 3 Let o(x) = -10x2 + 200x - 529. Give o(3). -19 Let k(v) = 260v - 2120. Determine k(8). -40 Let p(j) = -50j + 284. Determine p(7). -66 Let f(h) = -h*2 + 12h - 62. Calculate f(6). -26 Let b(w) = w*2 + 1145w - 32840. Give b(28). 4 Let w(f) = -f*3 - 18f*2 + 241f + 60. Give w(-27). 114 Let i(t) = 8t2 + 602t - 454. Give i(-76). 2 Let m(d) = -98d - 3722. Determine m(-38). 2 Let d(f) = -896f + 903. Determine d(1). 7 Let o(f) = 4f2 - 678f - 2780. Give o(-4). -4 Let v(w) = 12w2 - 28w - 4. Give v(-1). 36 Let q(t) = 102t2 + 332t - 659. Calculate q(2). 413 Let x(d) = 7d2 - 541d - 13. What is x(0)? -13 Let k(u) = 6u - 98. What is k(9)? -44 Let z(c) = 143c - 132. Give z(1). 11 Let n(f) = -2f2 - 225f + 2853. Determine n(-124). 1 Let y(r) = 151r - 1516. Calculate y(10). -6 Let x(r) = 3r*2 + 3r - 249. Determine x(-9). -33 Let b(g) = 21g - 2575. What is b(123)? 8 Let y(s) = s3 + 24s*2 + 115s - 11. Calculate y(-9). 169 Let t(z) = z*2 - 35z + 145. Give t(27). -71 Let k(i) = 392i2 + 139i - 139. What is k(1)? 392 Let r(j) = 37j2 - 188j + 11. Give r(5). -4 Let a(f) = -59f + 2935. What is a(43)? 398 Let f(i) = i3 - 38i*2 + 193i - 937. Give f(33). -13 Let g(v) = -2v3 + 283v*2 + 130v + 1708. Calculate g(142). 4 Let s(a) = -14a2 + 97a + 178. What is s(-2)? -72 Let a(j) = -32j2 - 33j - 40. Give a(-2). -102 Let h(s) = 101s - 531. Determine h(5). -26 Let m(q) = 3q*2 - 437q + 15315. Give m(87). 3 Let o(y) = y*3 - 24y*2 + 54y - 60. What is o(21)? -249 Let a(c) = -c*3 - 16c*2 + 65c + 35. Calculate a(-19). -117 Let w(a) = -15a - 100. Calculate w(-6). -10 Let u(z) = -9z - 732. Determine u(-81). -3 Let d(j) = 3j3 - 13j*2 + 82j - 308. Calculate d(4). 4 Let t(q) = -29q2 - 19q + 85. Calculate t(2). -69 Let w(l) = -4l2 + 229l + 1435. Give w(63). -14 Let g(l) = -26l + 263. Calculate g(10). 3 Let j(l) = -l2 - 24l - 122. What is j(-8)? 6 Let t(c) = -18c2 + 36c - 233. Give t(5). -503 Let q(d) = -329d + 73350. Determine q(223). -17 Let c(b) = 2b*3 - 392b - 6. Determine c(14). -6 Let g(j) = -j*3 + 91j*2 + 288j - 569. Give g(94). -5 Let p(m) = -115m - 3011. Give p(-26). -21 Let a(l) = 2l*3 - 21l*2 + 11l + 21. Calculate a(10). 31 Let n(c) = -c*3 + 11c*2 + 11c - 38. Give n(12). -50 Let o(d) = d*2 - 336d - 1329. What is o(-4)? 31 Let v(k) = -k*3 + 5k*2 + 26k - 131. Give v(5). -1 Let m(h) = -h*3 + 26h*2 - 31h + 395. Calculate m(26). -411 Let t(m) = 5m2 + 205m - 12. Determine t(-39). -402 Let u(l) = -l*3 - 7l	{ "pile_set_name": "DM Mathematics" }
List the prime factors of i(6). 19 Let g be 3 - (1 - -9 - -2). List the prime factors of 20 + g/62. 17 Let c(v) = v2 + 2v. List the prime factors of c(-4). 2 Let b = -103 + 149. What are the prime factors of b? 2, 23 Let p(d) = d*3 + 5d*2 + 5d + 4. What are the prime factors of p(-3)? 7 Suppose 0 = -0p - 3p - 12. Let m = -1 - p. Suppose -2v + 7 + m = 0. List the prime factors of v. 5 Suppose 3x - 6x + 132 = 0. Let a be (-2)/11 - (-96)/x. List the prime factors of (-78)/(-21) + a/7. 2 Let a(j) = -2j*2 - 10j - 9. Let i(r) = -r*2 - 5r - 5. Let m(v) = -4a(v) + 7i(v). What are the prime factors of m(-7)? 3, 5 Let n = -93 - -160. What are the prime factors of n? 67 Let k = -21 + 14. What are the prime factors of 112/(-24)(k - -1)? 2, 7 Let a(y) = y + 9. Let m be a(-7). Suppose -5s + 24 = mr, -6r + r = s - 60. List the prime factors of r. 2, 3 Let w be (-11 + (-2 - -1))1-1. Let t = 0 + 3. Suppose -tm + 2g = -38, -3m - g + 14 + w = 0. What are the prime factors of m? 2, 5 Let a = -5 + 10. Let l = -15 - -16. Suppose -2w - 41 = -as, -2s + w - l = 6w. List the prime factors of s. 7 What are the prime factors of (-3)/(-2)11/((-33)/(-274))? 137 Suppose 3n + n + 38 = -5g, -2g = 3n + 11. List the prime factors of 12/(-10)g/3. 2 Let s(m) = 5m*3 - 13m*2 + 10m + 2. Let v(k) = -4k3 + 12k*2 - 9k - 3. Let q(u) = 3s(u) + 4v(u). What are the prime factors of q(8)? 2, 5 Suppose -37 = -4q + 3s, 0 = -2q - 0s + 5s + 29. List the prime factors of q. 7 What are the prime factors of 885/10 + 3/(-2)? 3, 29 Let g be 4/8 + 1/(-2). Let n be (1 + g)/(3/36). Suppose v - 12 = -2b, -n = -4b + b. List the prime factors of v. 2 Let y = 13 - 4. Let j be ((-12)/y)/((-6)/9). List the prime factors of (j + 1)(1 - 0). 3 Let t(p) = 3p2 + p + 8. What are the prime factors of t(-4)? 2, 13 Suppose 3l - 158 = -2o - 0o, 4l - 3o - 205 = 0. What are the prime factors of l? 2, 13 Suppose 0 = 5u - 24 - 126. What are the prime factors of u? 2, 3, 5 Suppose 4m - 9 = 87. What are the prime factors of m? 2, 3 Let u(n) = 5n3 + 9n*2 - 7n + 6. Let h(z) = -z3 - z2 - 1. Let y(m) = 4h(m) + u(m). List the prime factors of y(-6). 2 Let a(u) = -6u + 6. Suppose j + 4j = -25. Let l be a(j). Suppose -6m + 2m + l = 0. List the prime factors of m. 3 Let o = -415 - -664. What are the prime factors of o? 3, 83 Let m = -6 + 15. What are the prime factors of m? 3 Let s(c) = -3c*3 - 7 + 5c*2 + 0c*3 + 7c + 2c3. Let x be s(6). List the prime factors of x/3 + (-75)/(-9). 2 Suppose -157h = -159h + 118. What are the prime factors of h? 59 Let t be ((-15)/10)/(3/(-2)). List the prime factors of t(19 - 3/3). 2, 3 Let q be (-108)/162-2. Suppose -4w - q = -87. Let s = w + -8. List the prime factors of s. 7 Let s = -4 + 20. Suppose 2n = -3v + 30, -7v + 3v - s = -2n. What are the prime factors of n? 2, 3 Let u(h) be the second derivative of 5/6h3 - 5/12h4 + h2 + 2h - 1/20h5 + 0. What are the prime factors of u(-6)? 2 Let o(r) = -r3 - 7r2 - 16r - 6. What are the prime factors of o(-7)? 2, 53 Suppose -3u + 4j + 5 = -19, -3j = u + 5. Let r be (0 + 1)/(u/36). Let h = 13 - r. List the prime factors of h. 2 Let x be (8/(-10))/(2/(-15)). Let b = x + -6. Suppose -y + 2 + 7 = b. List the prime factors of y. 3 Let q = -3 - -12. Let p(y) = 4y*2 + 5y + 37. Let n(i) = i*2 + i + 9. Let o(a) = qn(a) - 2p(a). What are the prime factors of o(0)? 7 Let t(y) be the third derivative of -y6/120 - y5/5 - y4/24 + 17y*3/6 + 3y*2. List the prime factors of t(-12). 29 Let t be (-1)/2(-8 + 4). Suppose -s - b + 28 = 0, ts + b + 3b = 48. Suppose 5u = 3u + s. What are the prime factors of u? 2 Let c(f) = -f*2 - 3f + 4. Let p be c(-4). List the prime factors of p + 3 - 33-1. 2, 3 Suppose -4s + 2 - 6 = 0. Let f = s + 13. What are the prime factors of f? 2, 3 Suppose 4a + 180 = 2f - 84, 0 = -3f - a + 431. List the prime factors of f. 2, 71 Let m(i) = -13i*2 + 5i + 12i2 + 0i. Let w be m(4). Suppose 3t + 5s = 18 - 2, ws = t - 28. List the prime factors of t. 2, 3 Let v be (-2)/(-12) - 174/(-36). Suppose 2z - 2u - 52 = -z, -6 = -z - vu. What are the prime factors of z? 2 Let q be 0/(1/((-2)/(-4))). Suppose -k = -qk - 12. Suppose 0v = 4v - k. List the prime factors of v. 3 Suppose 2v = -4k + 30, -3v + 6v - 2k - 5 = 0. Suppose -vn = -o - n - 5, -2o + 2n = -2. Suppose o = -y + 9. List the prime factors of y. 2, 3 Let u(o) = -o. Let c be u(3). Let y = c + 6. What are the prime factors of y? 3 Let w(z) be the second derivative of -z4/12 + 3z*3/2 + 6z*2 - 5z. Suppose 4f = 3k + 31, k = 3f - 4k - 15. List the prime factors of w(f). 2 List the prime factors of ((-282)/9)/(1/6-1). 2, 47 Suppose 0t - 268 = -4t. What are the prime factors of t? 67 Let g(a) = -2a*3 + 2a*2 - a - 2. Let i be g(-1). Suppose -126 = -3q + in, -2q + 4q + n - 69 = 0. What are the prime factors of q? 37 Let r(g) = -g3 + g2 + g - 5. What are the prime factors of r(-5)? 2, 5, 7 Let p(z) = 2z*2 + 3z. Let j be p(-2). Suppose jx = -x + 21. What are the prime factors of x? 7 Suppose z - 4 = -0z. Suppose -y + 16 = -zt, -5t = -y + 6y - 30. Suppose 0 = -5q + c + 23, 0 = 3q + 4c - 15 - y. List the prime factors of q. 5 Suppose -2x = -108 + 30. What are the prime factors of x? 3, 13 Suppose -2h + 2y = -74, h - 4 = 5y + 53. List the prime factors of h. 2 Suppose -3y = 2i - 83, 2i - 133 = -5y - 0i. List the prime factors of y. 5 What are the prime factors of (-188)/(-6) + (-3)/9? 31 Suppose -7b + 9b - 190 = 0. What are the prime factors of b? 5, 19 Suppose 3u - 25 - 11 = -3q, -27 = -u + 4q. List the prime factors of u. 3, 5 Let y be 10 + (-2)/2 + 3. Let k = y + -5. Suppose 1 = 2j - k. What are the prime factors of j? 2 Let g be (9 + -3)62/3. Suppose -4m + g - 44 = 0. What are the prime factors of m? 2, 5 Suppose -a - 2 = -b + 5, b - 2 = 0. What are the prime factors of (-6)/(-4)(a + 7)? 3 Suppose 5a + 3b - 401 = 0, 245 - 642 = -5a - b. What are the prime factors of a? 79 Let o = 10 - 6. What are the prime factors of 45/3o/10? 2, 3 Let w(x) = x*2 - 6x - 9. Let a be w(7). What are the prime factors of ((-9)/(-18))/(a/(-76))? 19 Let x = 4 - 1. Suppose 4h = -xi + 2, 3h - 20 = -5. List the prime factors of (-56)/i + (-3)/9. 3 Let k = 18 - 11. What are the prime factors of k? 7 Suppose 14o + 609 = 1785. What are the prime factors of o? 2, 3, 7 Let h = -2 - -2. Let z(m) = m*2 + 8m + 9. Let l be z(-7). Suppose j = -hj + l. What are the prime factors of j? 2 Let a(d) = -3 - 1 - d + 8d - 7d2 + d3. Let g be a(6). Suppose 0i = -gi + 32. List the prime factors of i. 2 Let w(j) = -4j - 2. Suppose -3h + 5l = -2, -h - 2h - 6 = -3l. Let g = -9 - h. List the prime factors of w(g). 2, 5 Let x be (-21)/6(-2 - -4). Let h(f) = -f3 - 7f*2 + 6. List the prime factors of h(x). 2, 3 Suppose 5k = -4l + 35, -4k + 3l = -0 + 3. Let x = 10 - k. Suppose -16 = -3r - x. What are the prime factors of r? 3 Suppose -319 = -519b + 518b. What are the prime factors of b? 11, 29 Let r(i) = 12i2 + i - 1. What are the prime factors of r(1)? 2, 3 Let i(l) be the first derivative of l4/24 + 2l2 - 1. Let b(t) be the second derivative of i(t). What are the prime factors of b(5)? 5 Let k(o) be the third derivative of -o4/24 + o*3/6 - 3o*2. Let x be k(4). What are the prime factors of (-2 - x)/(3/51)? 17 Let i(z) = 21 - 3z - 3z + 5z. Let p(w) = -2w + 52. Let j(s) = 12i(s) - 5p(s). List the prime factors of j(-8). 2 Let j = 42 + -32. What are the prime factors of j? 2, 5 Let i(p) = -11p. Let s be i(-1). Suppose u = 3h + 2u - s, u = 3h - 7. List the prime factors of h. 3 Let f = 28 + -22. What are the prime factors of f? 2, 3 Let y(a) = a + 8. Let p be y(-3). Suppose 0 = 4r - 5v - 43, -pr + 0r = v - 32. List the prime factors of r. 7 Let c(m) = -m + 5. Let f be c(5). Let r = f - 5. Let i = r + 8. List the prime factors of i. 3 Suppose 3w - 2v = 92, -2w + v + 74 = 11. Suppose d - 3d = 4s - 40, -4s + d = -w. List the prime factors of s. 3 Suppose 4b = 25 - 97. Suppose -3u + q - 28 = 0, 3u - 3*q = u - 7. Let a = u - b. What are the prime factors of a? 7 Let v(t	{ "pile_set_name": "DM Mathematics" }
. 2l - 1 Let q(l) = l - 8. Let z(c) = c - 4. Let a(v) = -3q(v) + 7z(v). Let p(i) = 17i - 17. What is 9a(g) - 2p(g)? 2g - 2 Let n(r) = -2r*2 - 4726r*3 - 6 - 3 - 8r + 4729r3. Let w(i) = 2i3 - i2 - 5i - 6. Give -5n(a) + 8w(a). a3 + 2a*2 - 3 Let x(w) = 2w*2 + 4w + 13. Let k(f) = -3f3 + 1. Let h be k(-1). Let s(i) = -i2 - 2i - 6. Suppose -4 - 23 = -3c. Determine cs(p) + hx(p). -p2 - 2p - 2 Let u(i) = -2i + 3. Let a(q) = -q - 1. Suppose 2j + j - 5g + 2 = 0, 0 = 4j - 5g + 1. Calculate ju(h) + 2a(h). -4h + 1 Let s(y) = -19y3 - 2y*2 - 2. Let f(o) = 20o*3 + 3o*2 + 2. What is 2f(c) + 3s(c)? -17c*3 - 2 Suppose -29 + 2 = 3y. Let v(x) = -3x + 2x + 5x + 6x*2 - 8x*2 + 4. Let d(q) = 5q*2 + 0q*2 - 3 - 9q - 6. Calculate yv(h) - 4d(h). -2h2 Let z(k) = -9k - 5. Let s(m) = -18m - 9. Calculate -4s(b) + 7z(b). 9b + 1 Let p(f) = 8f - 8. Let l(z) = -5z + 4z + 2 - z. Determine -9l(c) - 2p(c). 2c - 2 Let x(b) = -b. Let c(q) = -16q. Calculate c(y) + 3x(y). -19y Let b(q) = 18q*2 + 0 - 17q2 + 0. Let d(y) = y3 - y*2 + y. What is -2b(z) - d(z)? -z3 - z2 - z Let m(g) = -g*2 + 4g + 1. Let h(r) = -5r2 + 17r + 4. Give -2h(y) + 9m(y). y*2 + 2y + 1 Let l(f) = -8f3 + 122f - 11. Let z(u) = -3u3 + 41u - 4. Determine -4l(t) + 11z(t). -t*3 - 37t Let z(p) = 4p - 5. Let k be z(4). Let s(l) = l2 - 2l - 1. Let y be s(-1). Let q(o) = koy + 3 + 2 + 6. Let b(i) = -6i*2 - 6. Give -7b(c) - 4q(c). -2c*2 - 2 Let o(x) = -593x + 9x3 + 4x*2 + 598x - 4x2. Let i(z) = 10z*3 + 6z. Give 5i(j) - 6o(j). -4j3 Let i(j) = 8j*2 + j. Let w be i(-1). Let h(p) = 4p*3 + 6p*2 - 6p + 6. Let k(g) = 5g3 + 7g*2 - 7g + 7. Determine wh(d) - 6k(d). -2d3 Let i(r) = -6r + 1 + 8r + 3r + 5r3 + 0. Let n(k) = 14k*3 + 14k + 2. What is -8i(l) + 3n(l)? 2l3 + 2l - 2 Suppose 2 = 3p - 1. Let f be p((-3)/1)/(-3). Let m(r) = 1. Let w(l) = 3l + 5. Calculate fw(u) - 5m(u). 3u Let p(x) = 6x2 + 11x + 11. Let a(o) = -o*2 - 2o - 2. Let f(d) = 11 - 6d2 + 8d - d*3 - 2 + 0d*3. Let u be f(-7). Give up(q) + 11a(q). q2 Let n(t) = 7t*2 - t. Suppose p = m - p + 12, 5p - 60 = 4m. Let f = m - -25. Let i(v) = 0v + v*2 + 0v. What is fi(g) - n(g)? -2g*2 + g Suppose 4v = 3a - 3, a + v = 2a. Let o = -6 - 2. Let r(m) = -2m3 + 2m*2. Let x(n) = 5n*3 - 5n*2. Give ax(h) + or(h). h3 - h2 Let h(l) = 7l + 8. Let b(t) = 1. Give 6b(o) - h(o). -7o - 2 Let y(q) = 3q2 + q - 2. Let x(m) = -m2 + m - 1. Let v(t) = -2t*2. Let z(c) = -3v(c) + 2x(c). Calculate 3y(p) - 2z(p). p2 - p - 2 Let o(f) be the third derivative of -f4/12 - f3/3 - 2f2. Let b(a) = -a2 + a + 1. What is -2b(u) - o(u)? 2u*2 Let p(t) = 2t*3 - 2t*2 + 3t. Let n(i) = -5i3 + 5i*2 + 8i. Let d(l) = -l3 + l2 + 2l. Let r(j) = -9d(j) + 2n(j). Determine -2p(u) - 3r(u). -u3 + u2 Let p(b) = b + 3. Let d(k) = 31k + 14 - 53k + 26k. Suppose -x - 4x - 55 = 0. Let u = x + 25. Determine up(j) - 3d(j). 2j Let t(c) = -2c3 - 2c + 2. Suppose 11 + 1 = 3f. Suppose 0 = -2i + z + 2, -2i + 3z + f = 2i. Let u(w) = w2 + w. Calculate it(x) + 2u(x). -2x*3 + 2x2 + 2 Let h(y) = y2 - y - 1. Suppose -7a = -4a - 9. Suppose a = -4l + l. Let f(m) = 2m*3 + 2m*2 - 3m - 4. Calculate lf(b) + 2h(b). -2b3 + b + 2 Let v(j) = -j. Let x(d) be the third derivative of d4/4 + 2d*2. What is -27v(l) - 4x(l)? 3l Let v be (-1430)/198 + (-4)/(-18). Let j(x) = -8x3 - 5x*2 + 6x. Let k(r) = -9r3 - 6r*2 + 7r. What is vj(i) + 6k(i)? 2i3 - i2 Let i(c) = -50c - 8. Let l(d) = -33d - 5. What is -5i(p) + 8l(p)? -14p Let l(w) be the first derivative of -2w3/3 + 7w*2/2 + 7w + 7. Let q(m) = -m*2 + 3m + 3. Calculate 6l(a) - 14q(a). 2a2 Let q(g) = g3 - 2g*2 - 3. Suppose 3 = 2m - 1. Let f(w) = w + w*m + 1 - w + 1. Calculate 3f(b) + 2q(b). 2b3 - b2 Let i(b) = 4b + 17. Let n(j) = 2j + 9. Give 4i(v) - 9n(v). -2v - 13 Let j(l) = l + 1. Let y = -8 + 4. Let n(f) be the third derivative of -5f4/24 - f3 - 3f2. Suppose o - 2o = 1. Determine on(d) + yj(d). d + 2 Let o = -21 - -14. Let x(k) = k*2 - 2k. Let u(m) = m - 1. Let n(l) = 6u(l) + 3x(l). Let y(j) = 4j2 - 7. Determine on(q) + 6y(q). 3q*2 Let v(d) = 15d - 1. Let j(p) = -14p + 2. Calculate -2j(b) - 3v(b). -17b - 1 Let r(u) = u3 + u2 + u - 2. Let x(c) = -c3 - c2 - c + 1. Let m(g) = 2r(g) + 3x(g). Let j(h) = 4h3 + 2h*2 + 2. What is j(z) + 2m(z)? 2z3 - 2z Let o(x) = 3x + 3. Let b(q) = 3q + 4. Give 4b(w) - 5o(w). -3w + 1 Let y(j) = -j3 + 3j*2 + j. Let s be y(3). Let a = -2 - s. Let w(i) = 9i3 - i2 - 4i - 5. Let r(p) = -4p*3 + 2p + 2. Calculate ar(l) - 2w(l). 2l3 + 2l*2 - 2l Let o(s) be the second derivative of -s*4/4 + 7s. Let c(i) = i*2 + i. Calculate -2c(m) - o(m). m*2 - 2m Let b(t) be the third derivative of t*4/24 + 2t*3 - 14t*2. Let l(y) = 2. Give 2b(w) - 11l(w). 2w + 2 Let a be 6/(-18) - 1/(-3). Let p(w) = -2w3 + 0 + aw*2 + 3w3 + 1 + w2. Let z(y) = 2y3 + 6y*2 + 4. Calculate 4p(c) - z(c). 2c3 - 2c*2 Let z(i) = -55i. Let u(p) = -28p. Calculate -7u(d) + 3z(d). 31d Let s(a) = -2a3 + 4a*2 + 7a + 4. Let x(o) = 3o3 - 3o*2 - 6o - 3. Calculate -3s(b) - 4x(b). -6b3 + 3b Let s(g) = -g*3 + 3g2 + g. Let z(t) be the third derivative of t6/120 - t5/12 - t4/12 + t*2. Let n(l) = -l - 9. Let q be n(-6). Give qz(m) - 5s(m). 2m3 + m Let i(w) = -w2 + 1. Let d(p) = -2p2 - 3p + 3. Calculate -d(z) + i(z). z*2 + 3z - 2 Let k(c) = -13c2 - 11c - 43. Let r(x) = -7x2 - 6x - 21. What is 6k(p) - 11r(p)? -p*2 - 27 Let a(o) = o - 4. Let s = -9 - -11. Suppose -4q - 5 = 3n, -sq + 2n = -0q + 6. Let c(t) = 3t - 9. Determine qc(b) + 5a(b). -b - 2 Let q(f) = f + 8. Let a = 71 - 77. Let l(h) = h + 7. Give al(s) + 5q(s). -s - 2 Let t(q) = -6q*3 - 6q*2 - 5q - 1. Let i(a) = -7a3 - 7a*2 - 6a - 1. Determine -4i(p) + 5t(p). -2p3 - 2p*2 - p - 1 Let y(g) = -3 + 0g + 4 - g + 0g. Let j(b) = -3b + 7 + 2b + 0. Let h(x) = -1. Let r(f) = 6h(f) + j(f). What is 3r(n) - 2y(n)? -n + 1 Let y(b) = -62b2 - 5. Let t(a) = 31a*2 + 3. Give 5t(u) + 3y(u). -31u*2 Let p(j) = 3j*2 + 5j - 1. Let i(c) = 3c2 + 4c. What is 3i(r) - 2p(r)? 3r2 + 2r + 2 Let p(b) = -4b - 3. Suppose -n = -q - 5n - 10, -3q - n = 19. Let y = q + 14. Let w(j) = j - 10j - 2j - y. What is -8p(v) + 3w(v)? -v Let p(t) = 16t3 + t2 - 5. Let r(b) = -8b3 + 2. Determine 2p(a) + 5r(a). -8a*3 + 2a2 Let y(i) = -i3 + 2i2 + 3i - 1. Let v be y(3). Let r(l) = l*2 + 2l + 2. Let a(b) be the first derivative of -b - 5. What is vr(d) - 2a(d)? -d*2 - 2d Let s(f) = 7f + 7. Let o(x) = -8x - 7. Calculate 3o(v) + 4s(v). 4v + 7 Let y(g) = -g + g3 + 0g - 4 + 4. Let l(b) = -2b3 + 3b - 1. Determine -l(j) - 4y(j). -2j3 + j + 1 Let b(w) = -w3 - 5w + 3. Let v(q) be the second derivative of q5/10 + 2q3/3 - q2 - 4q. Give -2b(s) - 3v(s). -4s*3 - 2s Let v(t) = -t - 1. Let l(k) = 5k - 2. What is -l(f) - 6v(f)? f + 8 Let c(r) = -r + 1. Let p(t) = -t - 1. Let o(a) = -8a - 9. Let d(h) = -6o(h) + 51p(h). Give 10c(g) - 4d(g). 2g - 2 Let h(i) = -71i3 + 6i*2 - 6i. Let u(l) = 71l3 - 7l*2 + 7l. Calculate -7h(n) - 6u(n). 71n3 Let k(a) = 2a*3 - 2a*2 - a - 1. Let h be k(2). Let i(v) = v - 1. Let s(n) = -3n + 3. Let o be (-8)/(80/15) - 5/(-2). Determine hi(l) + os(l). 2l - 2 Let u(c) = -3c*2 - 2c. Let b(g) = g*2 + g. Calculate 4b(m) + u(m). m*2 + 2m Let o(j) = 5 + 3 - 4 - j*2. Suppose 2k = 3f - 21, -3f = k - 2 - 10. Let r(q) = -3q2 + 5q*2 + 0q*2 - 7. Determine kr(h) - 5o(h). -h2 + 1 Let f(k) = k2 + 2. Let b(v) be the second derivative of v7/2520 + v6/720 - v4/2 + 3v. Let o(g) be the third derivative of b(g). Give f(h) - 2o(h). -h2 - 2h + 2 Let z(v) = -v - 1. Let k(d) = d + 1. Give -2k(p) - 5z(p). 3p + 3 Let c(m) = 3m - m*2 - 5 + 3m*2 - 2m*2 - 3m2. Let r(w) be the third derivative of w5/30 - w*4/12 + 2w*3/3 - 6w**	{ "pile_set_name": "DM Mathematics" }
q + cb + ob*2 and give o. 2 Express 139o + 494o - 193o in the form vo + q and give v. 440 Express (3 + 2r - 3)(-9 + 11 + 4 - 7 - 2 + 0 + 0 + 2 + 0 + (4 - 7 + 1)(1 + 1 - 1)) as vr + s and give v. -6 Rearrange (6 + 0 - 5)((-l*2 + 1 - 1)(5 - 3 - 3) - 1496l2 - 1383l*2 + 2659l*2) to il*2 + al + b and give a. 0 Express 3r3 - 3r*3 + 3r*3 + (-14r + 14r + 11r*2)(-8r - 5 + 2 + 2r) as t + vr3 + ir + pr2 and give p. -33 Express 54r + 35 - 22 - 13 as lr + u and give l. 54 Express 834a - 260a + 450a + 50a - 172a as u + za and give z. 902 Express -24797i + 24797i - i2 + i3 + 0i*2 in the form p + xi*2 + wi + ki3 and give w. 0 Rearrange f + f - 3f + (-2 - 2 + 5)(4f - f - 4f) + (1 - 1 + 2f)(-106 - 120 - 86) to the form h + nf and give n. -626 Rearrange (-224a + 0a*3 + 26a + 2a3 - 1)(0 + 0 - 1) + a*3 + 2 - 2 to u + za*2 + la*3 + ra and give u. 1 Express (686b - 271b - 7b)(2 - 2b - 3b + 6b) in the form db + z + ob2 and give o. 408 Express -12l + 6l3 + 2l*2 + 398 - 375 + 12l in the form t + wl2 + al*3 + zl and give t. 23 Rearrange -275j + 1 + 79j - 1 - 111j to the form qj + s and give q. -307 Express -47v + v - 18v - v in the form lv + i and give l. -65 Rearrange -127j - 378 + 378 - 336j to the form p + cj and give c. -463 Express 12x2 - x3 + 0x*2 - 11x*2 - 4x - 8x2 in the form z + yx*3 + px + rx2 and give y. -1 Express (-37 + 39 - 100 - 81)(3t - 3t - 5t4) in the form ft + d + kt2 + xt*4 + it3 and give d. 0 Express 35 - 35 + a2 + 62a3 + 0a*2 - 52a*3 as ja*3 + sa*2 + i + ha and give j. 10 Rearrange -2f4 + f - f + (-3f + 2f + 0f)(-23f + 27f + 9f)(-5f*2 + 6f - 6f) to af*3 + nf + b + df2 + pf*4 and give p. 63 Express 16x*2 + 8x2 + x3 + 3x3 - x4 - 33x*2 - x as nx*2 + bx + qx4 + wx*3 + l and give l. 0 Rearrange 50 - 84 - 54 + o to ro + i and give i. -88 Rearrange (-718 - 194w + 718)((3w - w + w)(3 - 2w - 3) + 0 + 0 + w2) to the form n + uw*3 + cw*2 + vw and give u. 970 Rearrange 7o3 + 5o - 12o2 + 2o*3 + 9o*3 - 6o + 2o3 to the form y + zo*3 + fo + to2 and give t. -12 Rearrange -4 + 10 + 4g*2 - 7g*2 - 95 to the form rg*2 + vg + s and give r. -3 Express 6k - 2k - 2k + 2k - 5k + 2k + (3 - 5 + 3)(-k + 2k + k) - 4 + k + 4 + 3598k - 3 + 22 - 19 - 9566k in the form f + vk and give v. -5964 Express -71 - 39z - 80 + 152 in the form sz + p and give p. 1 Express -q4 - 2q + 102q2 + q3 - 204q*2 + 104q*2 in the form jq*2 + oq + nq3 + uq*4 + l and give o. -2 Express (-6w + 0w + w)(1 + 3 - 6) + 1 - w - 1 + (-1 + 0 + 2)(0w + 0w - w) as hw + m and give h. 8 Express 4a - 97 - 6a2 + 185 - a2 + 13a4 - 5a - 89 + 2a3 in the form sa*3 + ca*4 + ga + ya2 + f and give s. 2 Rearrange -6v + 5v + 2v*2 + 2 + 5v + (16v + 55v - v)(-2 + 3v + 2) to rv + uv2 + d and give u. 212 Rearrange -z3 + 46z4 - 43z*4 - 6z - 3z3 to the form iz*2 + fz*4 + mz*3 + uz + j and give f. 3 Rearrange 83r - 3r*3 + 90r + 12 + 4r4 - 172r to the form qr3 + xr*2 + or*4 + v + gr and give q. -3 Express ((-2f + 3f + 0f)(1 - 5 + 0) - 3f - 3f + 5f)(4f3 - 6f*3 - 10f*3) in the form yf*2 + t + cf*3 + zf + jf4 and give j. 60 Express (7 + 2w - 7)(3w + 11 - 11)(4 + 2 - 3)(-2w - 2 + 2) as qw*3 + p + gw + yw2 and give g. 0 Rearrange -15c - 1 - 20c + 11c*3 - 16c + 54c to kc*3 + u + mc + jc2 and give m. 3 Express (-6o - 4o + 2o)(-3o + 4o + 0o) - 2o2 + 6o + 3o2 - 4o in the form p + wo + ko*2 and give p. 0 Express -8g3 - g2 + 3g2 + 3g - 6g3 + 0g*2 as z + xg + tg3 + vg*2 and give t. -14 Rearrange -1797f - 3f2 + 1795f - 10f4 + 21f*4 + (2f*2 - 1 + 1)(-2f2 + f2 + 2f*2) to g + nf*3 + pf*2 + yf*4 + cf and give y. 13 Rearrange (1 + 1 + 0)(-1858512 + 1858512 + 3177s) to the form ds + p and give d. 6354 Rearrange (-h + 1 - 1)(2h2 - 2h*2 + 2h*3)(-89 - 109 + 37) to the form o + jh4 + ch*3 + gh*2 + mh and give j. 322 Express 22k2 - 279 + 139 + 144 in the form ok*2 + j + mk and give j. 4 Express 2r2 + 4r*2 + 0r*2 + (2r + 0r + 3r)(3r + 0r - 4r) + (0r - r - r)(-3r - r + 0r) as wr + g + lr*2 and give l. 9 Rearrange -28v*4 + 27v*4 - 739v*3 + 740v*3 + 3v*2 - 2 to zv + c + uv2 + nv*4 + rv*3 and give r. 1 Rearrange (5d*3 - 2804 + 2804)(-4 + 0 + 3) to p + fd2 + ld + od3 and give o. -5 Rearrange (2 + 519r + 7 - 7 + 43r)(-2r + 0r + 3r) to qr + lr2 + g and give l. 562 Express (3 - 1 - 3)(-666m + 12050 - 12050)(-2 - 1 + 1) as i + xm and give i. 0 Rearrange (1 - 1 + y)(4 - 2 - 3 + (0 + 2 + 5)(12 - 130 + 52)) - 4y + y + 2y to xy + v and give x. -464 Express 10o3 - 1004o*4 + 1 + o + 1005o*4 - 2 + (-o + 4o - o)(-3o*3 + 7o*3 - 2o*3) in the form so + k + io4 + no*2 + ro*3 and give k. -1 Express (3h*2 + 0h*2 - 2h*2)(-3h2 - 4h*2 + 5h*2) - 8 + 5599h*2 + 203h*4 - 5599h*2 as xh*3 + uh*2 + wh*4 + p + lh and give w. 201 Express (-175 + 24b + 175)(0 + 1 + 7 + 4) in the form zb + h and give z. 288 Rearrange (-47 + 34 - 8v + 23v - v2)(6 - 2 - 5) to s + dv2 + xv and give d. 1 Express ((-5 + 1 + 2)(-11 - 10 + 8) - 2 + 3 - 2)(3d2 - 3d*2 - 7d*3)(-d + 0d + 4d) as o + zd3 + vd*2 + fd*4 + hd and give f. -525 Express (3776233r - 3776233r + 152r2)(-1 - 1 + 1 - r*2) in the form kr + ar2 + zr*3 + tr*4 + v and give a. -152 Express (62h - 62h - 19h*2)(h*2 + 5h*2 + 6h*2)(-1 - 3 + 3) in the form wh2 + u + zh*4 + rh + th3 and give z. 228 Rearrange -54w*2 - 49w*2 - 54w*2 - 41w*2 to sw + b + gw2 and give g. -198 Express (5 - 6 - 7)(50d + 8d + 2d)(6 - 1 - 3) in the form y + md and give m. -960 Rearrange -2 - 2b - 497b3 + 492b3 - 2 + 6 - b2 to the form xb3 + i + jb + lb2 and give l. -1 Express 7z*3 - 4z*3 + 26 - 2z4 + z + z3 - 33 in the form t + nz + jz*4 + fz*3 + uz*2 and give t. -7 Rearrange (-2 + 2 - 4a)(27a*3 + 8a*3 - 8a*3) to q + la*2 + ba + ya4 + na*3 and give l. 0 Express -13i*2 - 16 + 12i*2 - 26i + 10 + 8 + 5i4 in the form ki*2 + bi*3 + xi + yi4 + p and give y. 5 Rearrange (-3 + 2 - 2)((2 + 0 + 1)(62u - 62u + 16u2) + 9 + u2 - 9) to bu2 + x + ou and give b. -147 Rearrange (-458b2 - 33b + 923b2 - 460b*2)(b - 2 + 2) - 5b3 + 2b3 + b3 + 3 - 3 - 2b3 to x + qb*2 + ob + yb3 and give q. -33 Rearrange (235k*4 + 202k*4 + 70k*4)(-2 + 4 + 1) to sk2 + n + ok*4 + qk + bk3 and give o. 1521 Rearrange -5r*3 - 3r*2 - r - 5r*2 + 9r*2 + 3r - 2 to the form tr + sr*3 + ir*2 + g and give s. -5 Express (0n + 0n + n3)(5n - 4n - 2n) - 709n*2 + 709n*2 + 128n*4 in the form fn*4 + a + pn + on2 + gn*3 and give f. 127 Express (392y + 182y - 44y)(2 - 1 - 2) + 0y + 0y - 2y as sy + u and give s. -532 Rearrange 2 - 42z*3 + 2z*4 + 2z*2 - 43z*3 + 125z*3 - 36z*3 to the form g + nz*3 + yz + hz4 + az*2 and give a. 2 Express -10n*3 + 4n*3 + 2n*2 + 168n + 4n3 - 164n in the form in + r + gn*2 + yn*3 and give g. 2 Rearrange (0s + 3s - 2s)(0s3 + s3 + 37701s - 37213s) to ps3 + ws*4 + ns + rs2 + k and give w. 1 Rearrange -29w - 25w + 28 + 11 + 50w to the form h + vw and give v. -4 Rearrange -894 + 9h + h*2 + 1784 - 904 - 3h*2 + 4h*2 + 0h*2 + (-2h + 3h - 3h)(h + 2h - 5h) to the form b + lh + zh2 and give b. -14 Rearrange -6 + 8f - 7 + 3f + 2f - 5f to w + cf and give c. 8 Express -9r2 + 87 - 87 + (5r - 6 + 6)(4 - 2r - 4) in the form kr2 + y + vr and give k. -19 Express -b - 41b - 3b - 37b as g + ub and give u. -82 Express 10g + 5 - 3 - 6g - 8g2 - 16g as mg2 + sg + i and give i. 2 Express 282b + 20b*3 - 3 - 569b + 286b - 2b*2 as sb*3 + fb + t + vb2 and give f. -1 Express -3l + 133l4 + 67 - 134l4 - 69 + l3 + 2l2 in the form kl*2 + rl*4 + al*3 + o + gl and g	{ "pile_set_name": "DM Mathematics" }
rob of picking 3 k? 1/165 Calculate prob of picking 1 v and 2 q when three letters picked without replacement from {g: 1, v: 3, q: 3, j: 4, s: 1, h: 5}. 9/680 Four letters picked without replacement from {b: 1, a: 3, i: 2, h: 3, z: 3, f: 4}. What is prob of picking 1 i, 1 f, 1 b, and 1 z? 6/455 Calculate prob of picking 1 j and 1 t when two letters picked without replacement from {t: 9, l: 4, x: 2, j: 3}. 3/17 Three letters picked without replacement from xivowvdiwooi. Give prob of picking 1 d, 1 i, and 1 x. 3/220 Two letters picked without replacement from hwwrfwrxw. Give prob of picking 1 x and 1 w. 1/9 Calculate prob of picking 2 p when two letters picked without replacement from {d: 3, p: 4, s: 4, n: 4}. 2/35 What is prob of picking 2 c when two letters picked without replacement from cdcccdddcccccducddcd? 11/38 Two letters picked without replacement from uxuuuuxxsxuuusux. Give prob of picking 2 s. 1/120 Two letters picked without replacement from {n: 2, l: 4, x: 3, w: 2, z: 6, s: 1}. What is prob of picking 1 z and 1 l? 8/51 Three letters picked without replacement from {h: 4, l: 7}. Give prob of picking 3 h. 4/165 Three letters picked without replacement from {q: 1, v: 2, f: 2, s: 1, l: 1, a: 2}. What is prob of picking 1 l and 2 a? 1/84 Calculate prob of picking 1 j and 2 d when three letters picked without replacement from djdffdjdddfdfjdd. 27/140 What is prob of picking 1 n and 2 p when three letters picked without replacement from {p: 5, y: 4, n: 3}? 3/22 Calculate prob of picking 1 u, 1 q, and 2 m when four letters picked without replacement from nqqunqmuqnqmm. 6/143 What is prob of picking 1 r and 1 e when two letters picked without replacement from byeyr? 1/10 Three letters picked without replacement from {b: 1, o: 2, d: 1}. Give prob of picking 1 d and 2 o. 1/4 What is prob of picking 2 q and 2 l when four letters picked without replacement from {q: 3, l: 7, a: 2}? 7/55 Two letters picked without replacement from jzjjzj. Give prob of picking 2 z. 1/15 What is prob of picking 1 s and 1 u when two letters picked without replacement from {c: 4, s: 3, d: 2, u: 9}? 3/17 What is prob of picking 2 a, 1 s, and 1 t when four letters picked without replacement from amtmagtssassammgmgtk? 24/1615 Calculate prob of picking 1 r, 1 h, and 1 j when three letters picked without replacement from htqrraj. 2/35 Three letters picked without replacement from xtmyimm. What is prob of picking 1 t, 1 y, and 1 x? 1/35 What is prob of picking 1 y, 1 j, 1 n, and 1 k when four letters picked without replacement from jykyyyxkxyjnjjnxykxk? 64/1615 Two letters picked without replacement from {e: 1, k: 2, a: 1, o: 1, g: 1, p: 1}. What is prob of picking 1 o and 1 a? 1/21 Calculate prob of picking 2 k when two letters picked without replacement from kkjjkjjjjj. 1/15 What is prob of picking 1 l and 3 r when four letters picked without replacement from lrllllllllrllr? 1/91 What is prob of picking 2 d and 2 n when four letters picked without replacement from ddsnsn? 1/15 Two letters picked without replacement from {s: 1, l: 2, e: 1, p: 2}. What is prob of picking 1 p and 1 l? 4/15 Calculate prob of picking 1 g, 1 w, 1 h, and 1 z when four letters picked without replacement from {g: 1, w: 3, z: 2, h: 7, a: 4}. 3/170 What is prob of picking 1 w and 3 j when four letters picked without replacement from {j: 7, w: 3}? 1/2 Two letters picked without replacement from lxxxqxxmxlmymyxxbxmb. Give prob of picking 1 b and 1 x. 9/95 Calculate prob of picking 2 h when two letters picked without replacement from {p: 5, g: 2, q: 2, l: 7, h: 4}. 3/95 Two letters picked without replacement from {a: 2, u: 1, v: 1, o: 1, y: 1, w: 1}. What is prob of picking 1 u and 1 y? 1/21 What is prob of picking 3 y and 1 k when four letters picked without replacement from {k: 3, y: 5, d: 4}? 2/33 What is prob of picking 3 z when three letters picked without replacement from zazzzfoofzxfoaa? 2/91 Calculate prob of picking 2 d and 1 g when three letters picked without replacement from {b: 1, t: 1, d: 2, o: 2, a: 1, g: 2}. 1/42 What is prob of picking 1 f and 1 y when two letters picked without replacement from {u: 2, y: 2, f: 9, e: 2, q: 5}? 9/95 What is prob of picking 3 w and 1 y when four letters picked without replacement from vyyyvvevwwvyqlw? 4/1365 What is prob of picking 1 g, 1 b, 1 f, and 1 m when four letters picked without replacement from {m: 8, g: 4, b: 3, a: 1, f: 1}? 24/595 Calculate prob of picking 1 b and 2 h when three letters picked without replacement from {p: 7, h: 2, b: 1}. 1/120 Two letters picked without replacement from {n: 7, r: 2}. Give prob of picking 2 n. 7/12 Two letters picked without replacement from {t: 1, q: 1, p: 1}. Give prob of picking 2 p. 0 Two letters picked without replacement from {d: 10, a: 10}. What is prob of picking 1 d and 1 a? 10/19 Four letters picked without replacement from hhxxiihixxh. Give prob of picking 1 x, 1 i, and 2 h. 12/55 Calculate prob of picking 2 d when two letters picked without replacement from {d: 13, x: 3}. 13/20 Calculate prob of picking 4 n when four letters picked without replacement from {b: 2, j: 3, v: 5, n: 10}. 14/323 Three letters picked without replacement from {k: 4, l: 6}. Give prob of picking 3 k. 1/30 Four letters picked without replacement from {y: 4, n: 1, s: 3}. What is prob of picking 1 n, 1 y, and 2 s? 6/35 Two letters picked without replacement from {y: 1, k: 4, n: 4, r: 3, l: 1, j: 1}. Give prob of picking 1 n and 1 l. 4/91 What is prob of picking 2 a when two letters picked without replacement from {d: 1, i: 1, a: 3, h: 5, p: 1, q: 1}? 1/22 Two letters picked without replacement from ididididiiizi. Give prob of picking 2 i. 14/39 What is prob of picking 2 l when two letters picked without replacement from lllllll? 1 Two letters picked without replacement from lzzozeg. Give prob of picking 1 o and 1 z. 1/7 What is prob of picking 2 r when two letters picked without replacement from rhrrrrryr? 7/12 Three letters picked without replacement from {v: 4, d: 3, i: 2, j: 2, b: 1}. Give prob of picking 2 i and 1 v. 1/55 Calculate prob of picking 1 g and 1 f when two letters picked without replacement from {q: 1, d: 2, f: 2, g: 4, v: 1}. 8/45 Two letters picked without replacement from hvmcvhhhvvcvvcvvicv. What is prob of picking 1 v and 1 h? 4/19 Two letters picked without replacement from {p: 1, i: 1, k: 1, x: 2}. Give prob of picking 2 x. 1/10 Four letters picked without replacement from qccqqc. What is prob of picking 3 q and 1 c? 1/5 What is prob of picking 2 k when two letters picked without replacement from mzzmmzkmm? 0 Three letters picked without replacement from {e: 3, f: 1}. What is prob of picking 3 e? 1/4 Two letters picked without replacement from jhhhhhhh. Give prob of picking 2 h. 3/4 Two letters picked without replacement from vvvv. Give prob of picking 2 v. 1 What is prob of picking 1 x and 1 i when two letters picked without replacement from {c: 1, x: 9, i: 4}? 36/91 What is prob of picking 1 j, 1 k, 1 b, and 1 a when four letters picked without replacement from wwwbejaeakbkjaw? 8/455 Calculate prob of picking 1 y, 2 u, and 1 r when four letters picked without replacement from ruhhhhhyuhhrwwrruhw. 1/323 Four letters picked without replacement from mnmnbmmbmum. Give prob of picking 1 u and 3 m. 2/33 Four letters picked without replacement from {p: 4, v: 3, c: 1, q: 1, w: 3, z: 3}. What is prob of picking 1 w, 2 p, and 1 c? 6/455 Three letters picked without replacement from lnlnjnjhffnnnj. Give prob of picking 1 l, 1 f, and 1 j. 3/91 Three letters picked without replacement from {g: 3, w: 1}. Give prob of picking 3 g. 1/4 Calculate prob of picking 2 x when two letters picked without replacement from vvvxvvvvxxvvxxvvvvv. 10/171 What is prob of picking 1 n and 1 g when two letters picked without replacement from {n: 6, g: 12}? 8/17 Calculate prob of picking 3 q when three letters picked without replacement from {u: 5, w: 1, q: 3}. 1/84 Calculate prob of picking 3 k when three letters picked without replacement from {k: 3, w: 5, d: 1}. 1/84 What is prob of picking 3 h and 1 u when four letters picked without replacement from {p: 6, h: 7, d: 1, u: 3}? 3/68 Calculate prob of picking 2 n when two letters pi	{ "pile_set_name": "DM Mathematics" }
6? 36 Calculate the least common multiple of 2 and 1. 2 Calculate the common denominator of -75/466 and 7/12. 2796 What is the common denominator of 37/11890 and 67/45? 107010 Calculate the least common multiple of 220 and 33. 660 Find the common denominator of 79/540 and -89/15. 540 Calculate the common denominator of 67/22 and 89/4634. 50974 What is the lowest common multiple of 502 and 12? 3012 Calculate the lowest common multiple of 183 and 1197. 73017 Calculate the smallest common multiple of 444 and 3. 444 Find the common denominator of -67/63 and 29/35. 315 What is the least common multiple of 180 and 120? 360 Find the common denominator of 25/118 and 127/18. 1062 Find the common denominator of -19/91 and 22/91. 91 What is the lowest common multiple of 1843 and 19? 1843 What is the smallest common multiple of 3 and 2276? 6828 Calculate the common denominator of 95/84 and 29/24. 168 Calculate the lowest common multiple of 274 and 44. 6028 What is the least common multiple of 26 and 7604? 98852 Calculate the common denominator of -99/4 and 97/234. 468 Calculate the lowest common multiple of 71 and 29. 2059 What is the common denominator of 59/30 and 169/1020? 1020 What is the common denominator of 119/270 and 79/18? 270 Calculate the lowest common multiple of 165 and 1065. 11715 What is the lowest common multiple of 50 and 100? 100 Calculate the common denominator of 43/35 and -61/25. 175 Calculate the common denominator of -23/14 and -69/490. 490 Calculate the least common multiple of 6396 and 780. 31980 Calculate the smallest common multiple of 351 and 29. 10179 Calculate the least common multiple of 10 and 90326. 451630 Calculate the smallest common multiple of 3 and 67. 201 Calculate the smallest common multiple of 138 and 184. 552 Find the common denominator of -61/75 and 89/135. 675 What is the lowest common multiple of 28 and 3836? 3836 Find the common denominator of -1/32 and 49/64. 64 What is the least common multiple of 8150 and 20? 16300 Find the common denominator of -83/8 and -94/1875. 15000 Calculate the smallest common multiple of 2 and 11524. 11524 Calculate the common denominator of -70/9 and 43/12. 36 What is the least common multiple of 14456 and 9035? 72280 Calculate the lowest common multiple of 329 and 49. 2303 Find the common denominator of -179/60 and 113/96. 480 Find the common denominator of -119/8140 and 51/40. 16280 What is the smallest common multiple of 81 and 939? 25353 What is the smallest common multiple of 144 and 96? 288 Find the common denominator of 58/175 and -31/40. 1400 Calculate the common denominator of -65/66 and -109/220. 660 Find the common denominator of -103/204 and -197/1020. 1020 What is the common denominator of 19/1980 and 53/6072? 91080 What is the common denominator of -49/104 and 117/10? 520 Calculate the common denominator of 59/6 and -143/144. 144 What is the common denominator of 2/1389 and -11/6945? 6945 What is the least common multiple of 44 and 66? 132 Calculate the least common multiple of 546 and 858. 6006 What is the smallest common multiple of 7 and 3607? 25249 Calculate the common denominator of 47/4 and -71/1510. 3020 What is the least common multiple of 1030 and 927? 9270 Calculate the common denominator of -1/321 and -37/12. 1284 What is the smallest common multiple of 36 and 72? 72 What is the smallest common multiple of 216 and 5? 1080 Calculate the lowest common multiple of 12 and 405. 1620 Calculate the smallest common multiple of 660 and 880. 2640 Calculate the common denominator of 1/294 and -44/81. 7938 Calculate the least common multiple of 6 and 10. 30 Calculate the least common multiple of 1368 and 228. 1368 Find the common denominator of 25/288 and -115/156. 3744 Calculate the lowest common multiple of 50 and 600. 600 Find the common denominator of -39/2720 and -167/90. 24480 What is the lowest common multiple of 414 and 138? 414 What is the smallest common multiple of 50 and 2? 50 What is the common denominator of 167/8274 and -137/13790? 41370 Calculate the least common multiple of 146 and 16. 1168 Calculate the lowest common multiple of 33 and 5766. 63426 What is the common denominator of -85/232 and -103/400? 11600 Calculate the least common multiple of 3532 and 16. 14128 Calculate the least common multiple of 158 and 8. 632 Calculate the smallest common multiple of 78 and 24. 312 Calculate the common denominator of 79/100 and -119/550. 1100 What is the lowest common multiple of 10 and 13? 130 Calculate the least common multiple of 114 and 168. 3192 Calculate the common denominator of -97/1022 and 101/84. 6132 Calculate the least common multiple of 84 and 72. 504 Calculate the common denominator of 74/153 and -155/102. 306 Calculate the common denominator of 26/27 and 31/87. 783 Find the common denominator of -125/24978 and 2/15. 124890 Calculate the common denominator of -47/6021 and 40/8697. 78273 What is the lowest common multiple of 6 and 6? 6 Calculate the lowest common multiple of 8022 and 4. 16044 What is the common denominator of 49/311 and 57/4? 1244 What is the common denominator of 131/336 and -93/224? 672 Calculate the common denominator of 105/34 and -93/68. 68 What is the lowest common multiple of 1410 and 30? 1410 Find the common denominator of -35/9 and -1/69. 207 Calculate the least common multiple of 255 and 84. 7140 Find the common denominator of -63/292 and 39/4672. 4672 What is the common denominator of -47/16 and 41/454? 3632 What is the lowest common multiple of 851 and 2? 1702 Find the common denominator of -1/9 and -107/100. 900 What is the smallest common multiple of 44 and 128? 1408 Find the common denominator of 33/76 and -39/4. 76 What is the smallest common multiple of 2222 and 1111? 2222 Calculate the common denominator of 67/204 and -41/748. 2244 Calculate the common denominator of 151/462 and -95/693. 1386 Calculate the common denominator of 113/2970 and -7/330. 2970 What is the smallest common multiple of 45 and 1755? 1755 Calculate the common denominator of -53/16 and 111/28. 112 Calculate the least common multiple of 231 and 264. 1848 Calculate the lowest common multiple of 276 and 782. 4692 Calculate the least common multiple of 98 and 8. 392 Calculate the common denominator of 54/869 and -25/474. 5214 What is the smallest common multiple of 8 and 4? 8 Find the common denominator of 10/7 and -131/402. 2814 Find the common denominator of 51/100 and -41/300. 300 What is the common denominator of 26/7 and 42/1879? 13153 Calculate the lowest common multiple of 111 and 42. 1554 Calculate the lowest common multiple of 370 and 40. 1480 Calculate the common denominator of 133/72 and -35/36. 72 Calculate the common denominator of 17/33 and -119/1458. 16038 Calculate the common denominator of -27/10 and 137/762. 3810 What is the common denominator of 77/24 and -57/8? 24 Calculate the least common multiple of 231 and 49. 1617 What is the lowest common multiple of 19 and 8? 152 What is the common denominator of -41/1368 and -55/6? 1368 Calculate the common denominator of 139/12 and 59/734. 4404 What is the common denominator of 63/44 and -51/8? 88 Calculate the common denominator of 61/15 and 5/246. 1230 Calculate the common denominator of -47/36 and -47/36. 36 What is the smallest common multiple of 378 and 8? 1512 Calculate the least common multiple of 12 and 60. 60 Find the common denominator of -53/38 and -57/10. 190 Calculate the smallest common multiple of 70 and 98. 490 What is the common denominator of 40/177 and -37/9? 531 What is the common denominator of -1/132 and -151/2442? 4884 Calculate the smallest common multiple of 330 and 5280. 5280 What is the lowest common multiple of 370 and 1? 370 Find the common denominator of -43/250 and 49/275. 2750 What is the common denominator of 131/1218 and -91/82? 49938 What is the lowest common multiple of 15 and 2? 30 Find the common denominator of 5/324 and 101/360. 3240 What is the smallest common multiple of 115 and 23? 115 What is the lowest common multiple of 341 and 341? 341 Calculate the lowest common multiple of 91 and 42. 546 What is the lowest common multiple of 198 and 44? 396 What is the smallest common multiple of 20 and 24? 120 What is the least common multiple o	{ "pile_set_name": "DM Mathematics" }
a*2 - a Let p = -66 - -72. Let u(l) = -pl*2 - 7l*2 + 2l2. Let m(c) be the first derivative of c2 - 3. Give m(u(n)). -22n2 Let g(t) = 10t. Let h(r) = 76r2 + 4r - 24. Let d(y) = 3y2 - y + 6. Let j(n) = 4d(n) + h(n). What is g(j(x))? 880x2 Let o(n) = n2 - 8n. Let h(z) = 258528z. Calculate o(h(l)). 66836726784l*2 - 2068224l Let i(c) = 10c. Let m(j) = -2736j + 22. Give m(i(v)). -27360v + 22 Let k(g) = 8g*2. Let d(a) = -11a - 38142a2 + 4a + 38127a2. Give d(k(y)). -960y*4 - 56y*2 Let u(o) = -3o*2. Let g be 1/(2/(-2)) - -8. Suppose 0 = 2v - 4p + 20, -3v + p + 27 = 32. Let c(t) = 3t + vt - gt. Determine u(c(d)). -48d*2 Let c(s) be the second derivative of 2s5/15 - s4/24 + 17s3/3 + s2 + 2s - 2. Let o(g) be the second derivative of c(g). Let z(f) = 2f. Give z(o(d)). 32d - 2 Let s(o) = -3o + 5. Let z(d) = 39d - 39. Let n(l) = 96l - 94. Let q(g) = -5n(g) + 12z(g). Determine s(q(x)). 36x - 1 Let b(r) = 7695710r2. Let y(g) = 17g*2. Calculate b(y(v)). 2224060190v*4 Let g(o) = 403o. Let h(n) = 127n. Let s(d) = -6g(d) + 19h(d). Let f(m) = -5m*2 - 6. Calculate f(s(b)). -125b*2 - 6 Let d(m) = 285m. Let t(o) = o*2 - 4o - 168863. Give t(d(y)). 81225y2 - 1140y - 168863 Let v(c) = 3c - 2. Let p(h) = h3 - 23h*2 - 2h - 48. Let q be p(24). Let d(y) = -474y - qy + 955y. Calculate d(v(r)). 3r - 2 Let a(k) = 2487299k. Let q(v) = -v. Give q(a(m)). -2487299m Let c(s) be the first derivative of -148s3 - 2s - 3360. Let a(q) = 2q. Determine a(c(w)). -888w*2 - 4 Let f(d) = -32784 + 32784 - 140d. Let m(g) = -5g2. Calculate m(f(q)). -98000q*2 Let x(a) = -811a - 2. Let c(g) = 355995g + 879. Let w(d) = -2c(d) - 879x(d). Let s(z) = 3z*2. Determine w(s(f)). 2637f*2 Let w(r) = r. Suppose 8z = 5z - 72. Let n = 46 + z. Let c(g) = 2g - 2g + 14g*2 - ng*2. Determine w(c(j)). -8j*2 Let z(t) = 520t. Let b(l) = 217l. Let n(c) = -12b(c) + 5z(c). Let r(x) be the second derivative of -2x*3 - x. Calculate r(n(i)). 48i Let r(m) = -m*2 - 6m + 6. Let q(k) = -20k + 69k - 22k + 1 - 28k. Let j(w) = 6q(w) - r(w). Let x(i) = 36i*2. Calculate j(x(d)). 1296d*4 Let v(a) = 16a. Let k(c) = 41c2 + 20084c. Give v(k(q)). 656q2 + 321344q Let b(r) = 2r. Let w(z) = -60279z - 91. Determine b(w(h)). -120558h - 182 Let h(j) = 305j. Let l(x) = -x*2 + 28x - 187. Let u be l(16). Let f(k) = uk - 7k + 5k + k - 3k. What is f(h(a))? 305a Let u(s) = 11s - 1. Let x(v) = -2v. Let g(r) = 2u(r) + 6x(r). Let m(q) be the first derivative of q3/3 - 3. What is g(m(t))? 10t*2 - 2 Let q(a) = -28a + 9a + 10a - a*2 + 9a. Let k(p) = -229p2 - 13. Give q(k(l)). -52441l*4 - 5954l*2 - 169 Let l(x) be the first derivative of 189x*2 - 1979. Let a(b) = 25b*2. Calculate l(a(r)). 9450r*2 Let w(f) = -137815f. Let v(a) = 91a. Determine w(v(h)). -12541165h Let x(t) = -14t2. Let i(g) = 2g*3 - 7g2 + g + 8. Let z be i(3). Let r(c) = -cz + 9478 - 9478. Calculate x(r(l)). -14l4 Let f(v) = 47v*2. Let a(n) = 9n - 430. Give f(a(z)). 3807z2 - 363780z + 8690300 Let f(j) = 4j + 5j - 5j + 3j. Let h(b) = b*2 + 2b*2 - 2b*2 - 4b*2 + 0b*2. Determine f(h(a)). -21a*2 Let r(l) = 1628l + 68l + 1418l + 1396l. Let y(c) = c. Determine y(r(k)). 4510k Let y(r) = -9r - 44r - 170r. Let c(l) be the second derivative of l4/12 - 2l + 591. Determine c(y(g)). 49729g2 Let z(i) = -9i + 6. Let d(j) = -j - 1. Let s(o) = 18d(o) + 3z(o). Let r be ((-12)/(-8))/(12/16). Let h(x) = -2x2 + 0x*r + 2x*2 + 2x*2. Give h(s(m)). 4050m2 Let k(f) = f2 + 6f - 318. Let g(s) = -s2 - 5s + 265. Let b(n) = 6g(n) + 5k(n). Let w(t) = 71t2 + 4t + 2. Calculate w(b(y)). 71y4 - 4y*2 + 2 Let n(s) = -11s + 21s + 12s - 20s. Let w(y) = 5y + 341. Calculate w(n(j)). 10j + 341 Let l(j) = 5j. Let u(n) be the first derivative of -11 + 0n2 + 4/3n*3 + 0n. Determine u(l(v)). 100v2 Let r = 422 + -420. Let p(l) = 187l*2 - 373l*r + 187l*2. Let k(v) = 49v*2. Give k(p(o)). 49o*4 Let g(n) be the second derivative of 3337n*3/6 - 1809n. Let c(p) = p. Calculate c(g(k)). 3337k Let j(z) = -z2. Let s(n) be the first derivative of -7n4/4 + n2/2 - 31n - 19. Let x(u) be the first derivative of s(u). What is x(j(i))? -21i*4 + 1 Let b(c) = -911c + 3. Let t(s) = -7s2 + 12. Let g(a) = 32a*2 - 56. Let z(p) = 3g(p) + 14t(p). Calculate b(z(w)). 1822w*2 + 3 Let w(f) = 19f*2 + 18f - 24. Let u(h) = -23h2 - 16h + 21. Let n(p) = 8u(p) + 7w(p). Let t(g) = -44g. Calculate n(t(d)). -98736d*2 + 88d Suppose 25y = -125 + 175. Suppose -4i + 3j + 32 = 0, -i + 3j = 2i - 21. Let a(g) = -g + g + 13g*2 - ig*y. Let z(q) = 11q*2. Give z(a(w)). 44w*4 Let j(f) = 13f + 1081. Let b(d) = d - 111. What is b(j(h))? 13h + 970 Let m = 59 + -55. Let a(h) = 13h + 8. Let r(f) = 50f + 30. Let q(c) = mr(c) - 15a(c). Let o(y) = 14y. Give o(q(p)). 70p Let q(d) = d3 - d2 - 2d - 1. Let y(m) = -m*2 - 8. Let z(k) = -q(k) + y(k). Let h(l) be the second derivative of z(l). Let v(b) = 17b. Determine h(v(f)). -102f Let n(f) = 7f. Let k(v) = -16v + 18649. Calculate n(k(r)). -112r + 130543 Let t(g) be the third derivative of -164g4/3 + 1864g*2 + 2g. Let z(c) = 6c2. What is z(t(w))? 10328064w*2 Let c(w) be the first derivative of 5w*3/3 + 275. Let s(n) be the first derivative of -19n*3/3 + 53. Calculate s(c(d)). -475d4 Let a(b) be the first derivative of -b2 - 100. Let r(x) = -2666x + 1. What is r(a(y))? 5332y + 1 Let h(u) = u*2 + 28u + 196. Let v be h(-16). Let j(r) = -45r2 - 4925r - 22r2 + 4925r + vr2. Let t(n) = -n. What is j(t(s))? -63s*2 Let f(m) = 8m*2. Let d(c) = 15494 - 30995 - 1081c + 15501. Give d(f(i)). -8648i2 Let l = 27 - 20. Let j(c) = 2c + lc + 15c. Let r(a) be the first derivative of a*2/2 + 154. Give j(r(z)). 24z Let z(r) = -49146r + 431. Let b(n) = -4n. Determine b(z(u)). 196584u - 1724 Let c(w) = -3w*2 - 5w*2 - 11w*2 - 3w*2 + 11w*2. Let g(d) = -9d*2 - 8d. Give g(c(h)). -1089h4 + 88h2 Let q(v) = -v2. Let k(s) be the first derivative of -5222s2 - 5942. Give k(q(w)). 10444w*2 Let f(s) = -3s*2. Suppose -5u - 9 = 1, 3p = -3u + 51. Let n(k) = 6k + 6k + pk + k. Determine n(f(b)). -96b*2 Let v(k) = 3k. Let u(s) = 65955314s2. Give u(v(n)). 593597826n*2 Let d(t) be the first derivative of 9t*2/2 + 1. Let h(g) be the third derivative of 11g*2 + 0g*4 + 1/30g*5 + 0g + 0 + 0g3. Determine h(d(m)). 162m*2 Let c(l) = -22l + 4l - 20l - 8l. Let b(k) = -6545k + 3301k + 3243k. What is c(b(m))? 46m Let d(m) = 3 - 7 + 5m + 6 - 2. Let i(f) be the second derivative of f*4 - 5f. Calculate i(d(k)). 300k2 Let b = -640 + 642. Let k(u) = 9u*2 + 2u*2 + 2u*2 - 3u*b - 14u*2. Let o(r) = 16r*2. Determine k(o(i)). -1024i*4 Let t(k) be the third derivative of 0k + 1/12k4 + 0 + 0k*3 - 2k*2. Let p(m) = -11m + 1. Calculate p(t(y)). -22y + 1 Suppose -z + 6 = 4. Let c(n) = n2 - 7n*2 + 2n*z. Let x(s) = -77s*2 - 79s*2 + 224s*2 - 83s*2. What is x(c(j))? -240j*4 Let h(i) = 2i. Let g(t) = -45t2 - 25t + 18. Let s(m) = 33m2 + 23m - 16. Let v(a) = -3g(a) - 4s(a). Give h(v(w)). 6w2 - 34w + 20 Let h(t) = -t*2. Let z(c) = 5782584c. Give h(z(j)). -33438277717056j2 Let i(n) = 14n*2 + 12n. Let b(y) = 3y2 + 3y. Let s(o) = -4b(o) + i(o). Let p(a) = -9a + 334. Determine p(s(v)). -18v2 + 334 Let p(j) = 7j - 168439. Let n(w) = -2w. What is p(n(r))? -14r - 168439 Let o(n) = -3n2 + 2099 - 1052 - 1047 + 5n2. Let q(v) = v2 - 739. Give q(o(b)). 4b4 - 739 Let g(l) = -l. Let q(o) be the third derivative of -899o4/6 + o2 + 334. What is g(q(t))? 3596t Let r(m) be the third derivative of -m5/24 + 55m*3/3 - 72m*2. Let y(c) be the first derivative of r(c). Let x(z) = -28z*2. Calculate x(y(f)). -700f*2 Let t(h) be the third derivative of 11h*5/60 + 47h*2 - 6h. Let r(g) = 3g + 4. Let d(f) = -f + 1. Let m(w) = 4d(w) - r(w). What is t(m(z))? 539z2 Let x = 5250 + -5248. Suppose -5p + 2q + 1355 = 90, -2p + 507 = -q. Let s(o) = 106o*	{ "pile_set_name": "DM Mathematics" }
.095431ng? 0.009095431 How many micrograms are there in 9/10 of a milligram? 900 How many seconds are there in 5/24 of a hour? 750 Convert 59.10003l to millilitres. 59100.03 Convert 3.903531 micrograms to nanograms. 3903.531 What is 4/3 of a century in months? 1600 How many micrograms are there in 52/5 of a milligram? 10400 How many millimeters are there in thirty-two fifths of a meter? 6400 How many years are there in 3/50 of a century? 6 What is 660831.8t in milligrams? 660831800000000 How many years are there in 3/25 of a century? 12 How many weeks are there in 125296926.3 nanoseconds? 0.00000020717084375 Convert 39504.56 years to centuries. 395.0456 How many micrograms are there in 3/25 of a milligram? 120 Convert 73.28898 millennia to months. 879467.76 How many nanoseconds are there in five quarters of a microsecond? 1250 Convert 66.51579mm to centimeters. 6.651579 How many kilograms are there in 29469.47mg? 0.02946947 How many micrometers are there in 5/4 of a centimeter? 12500 Convert 194823.2 millennia to centuries. 1948232 How many millilitres are there in 38943.3 litres? 38943300 How many litres are there in 38.7807 millilitres? 0.0387807 What is twenty-five quarters of a litre in millilitres? 6250 What is 2991.686ml in litres? 2.991686 Convert 70.23318 millimeters to micrometers. 70233.18 How many kilograms are there in fourty-three quarters of a tonne? 10750 Convert 20.4144 centuries to years. 2041.44 How many minutes are there in 1834405.5us? 0.030573425 How many hours are there in 0.7820094 weeks? 131.3775792 What is 2089.6722 minutes in days? 1.45116125 How many millilitres are there in 11/2 of a litre? 5500 What is 75/8 of a week in minutes? 94500 What is 59.11936mg in grams? 0.05911936 What is eighteen fifths of a tonne in kilograms? 3600 How many months are there in 7/3 of a millennium? 28000 What is 40.93873ml in litres? 0.04093873 What is seventeen halves of a litre in millilitres? 8500 How many millimeters are there in 22664.71m? 22664710 Convert 881.0141 centimeters to micrometers. 8810141 Convert 881605.7 millilitres to litres. 881.6057 What is eleven tenths of a minute in seconds? 66 What is 0.8107872t in grams? 810787.2 How many nanometers are there in 9170.675 millimeters? 9170675000 What is twenty-six fifths of a century in months? 6240 How many months are there in 27859.19 years? 334310.28 Convert 933.6467um to millimeters. 0.9336467 How many months are there in thirty-seven halves of a decade? 2220 How many minutes are there in 58/3 of a hour? 1160 How many meters are there in five eighths of a kilometer? 625 What is 11/10 of a millennium in months? 13200 Convert 4313.141mg to kilograms. 0.004313141 How many grams are there in 2.984753 tonnes? 2984753 What is 63.0698 meters in centimeters? 6306.98 How many micrograms are there in 79.46172 kilograms? 79461720000 Convert 4765.284 nanoseconds to days. 0.00000000005515375 How many nanograms are there in twenty-one halves of a microgram? 10500 How many years are there in 3/10 of a decade? 3 What is 2/27 of a day in seconds? 6400 How many months are there in 8/15 of a millennium? 6400 What is twenty-one halves of a litre in millilitres? 10500 How many nanoseconds are there in 137631.4us? 137631400 How many nanometers are there in 28217.5mm? 28217500000 What is 58634.9mm in micrometers? 58634900 How many millilitres are there in thirty-seven fifths of a litre? 7400 How many litres are there in 9.105438ml? 0.009105438 How many hours are there in eight thirds of a week? 448 How many grams are there in 8145.921 micrograms? 0.008145921 How many seconds are there in seven sixths of a hour? 4200 How many days are there in 16.5015387ms? 0.00000019099003125 How many months are there in fifty-eight thirds of a decade? 2320 How many millilitres are there in 1/10 of a litre? 100 How many nanoseconds are there in 0.0496894 days? 4293164160000 Convert 94192.52ml to litres. 94.19252 How many milligrams are there in 12/25 of a gram? 480 How many litres are there in 0.6544338 millilitres? 0.0006544338 How many hours are there in eleven quarters of a day? 66 What is 0.0612313ms in microseconds? 61.2313 Convert 0.35709ml to litres. 0.00035709 What is 1/4 of a milligram in micrograms? 250 What is fifty-seven fifths of a day in minutes? 16416 How many centuries are there in 2913.624 millennia? 29136.24 How many meters are there in 3/10 of a kilometer? 300 What is nine tenths of a century in months? 1080 What is 54/5 of a litre in millilitres? 10800 How many weeks are there in 10580.04801 microseconds? 0.000000017493465625 What is 11950.92nm in millimeters? 0.01195092 What is 4/3 of a year in months? 16 How many millimeters are there in 13/8 of a meter? 1625 Convert 1765.15cm to micrometers. 17651500 What is 94863.34s in milliseconds? 94863340 How many millilitres are there in eleven quarters of a litre? 2750 How many grams are there in eighty-seven quarters of a kilogram? 21750 What is 320222.6 kilograms in nanograms? 320222600000000000 Convert 2.193429 days to weeks. 0.313347 How many minutes are there in three tenths of a day? 432 How many microseconds are there in 47.5727 hours? 171261720000 What is 27/2 of a meter in centimeters? 1350 Convert 71.9082 hours to milliseconds. 258869520 How many nanograms are there in thirteen fifths of a microgram? 2600 How many millilitres are there in 7/8 of a litre? 875 What is 7/3 of a hour in seconds? 8400 How many millilitres are there in 37/5 of a litre? 7400 How many nanoseconds are there in 3/50 of a microsecond? 60 Convert 7655.72g to tonnes. 0.00765572 What is 6788.241 millilitres in litres? 6.788241 What is two fifteenths of a millennium in months? 1600 Convert 76699.68 milligrams to kilograms. 0.07669968 How many millilitres are there in 5/8 of a litre? 625 Convert 928.5502kg to milligrams. 928550200 What is 4732.956 nanometers in millimeters? 0.004732956 What is 35.09193 tonnes in kilograms? 35091.93 Convert 50.34394 years to decades. 5.034394 Convert 72.53378 years to centuries. 0.7253378 How many litres are there in 3.882783 millilitres? 0.003882783 What is thirty-two fifths of a kilogram in grams? 6400 Convert 0.5463352 years to decades. 0.05463352 Convert 0.6334212 centimeters to meters. 0.006334212 Convert 16625.09 nanometers to kilometers. 0.00000001662509 What is five quarters of a litre in millilitres? 1250 What is 8/25 of a micrometer in nanometers? 320 How many millilitres are there in three fifths of a litre? 600 How many meters are there in 84.24254 centimeters? 0.8424254 How many millilitres are there in 123.3868 litres? 123386.8 How many millilitres are there in seven quarters of a litre? 1750 What is 916.277 grams in milligrams? 916277 What is thirty-three fifths of a gram in milligrams? 6600 How many microseconds are there in 11/8 of a millisecond? 1375 What is 19/7 of a week in minutes? 27360 How many years are there in 80253.48 decades? 802534.8 What is 276.2372 litres in millilitres? 276237.2 How many micrometers are there in 13/4 of a millimeter? 3250 How many millilitres are there in three tenths of a litre? 300 How many micrograms are there in fourty-two fifths of a milligram? 8400 Convert 25.441059 hours to weeks. 0.151434875 What is sixty-seven fifths of a second in milliseconds? 13400 Convert 985573.5ml to litres. 985.5735 How many milligrams are there in 13/5 of a gram? 2600 How many litres are there in 54.78659ml? 0.05478659 What is thirteen eighths of a century in months? 1950 How many millilitres are there in twenty-seven fifths of a litre? 5400 What is 1/10 of a decade in months? 12 Convert 1.207663km to millimeters. 1207663 How many kilograms are there in three fifths of a tonne? 600 What is 407.0107ng in kilograms? 0.0000000004070107 Convert 519162.777 minutes to weeks. 51.50424375 What is 849.593 litres in millilitres? 849593 How many nanoseconds are there in three fifths of a microsecond? 600 How many microseconds are there in 5523.45 days? 477226080000000 How many meters are there in 8360.591um? 0.008360591 How many micrometers are there in 0.2827647 millimeters? 282.7647 How many litres are there in 68.86396 millilitres? 0.06886396 How many minutes are there in 69/2 of a hour? 2070 How many millilitres	{ "pile_set_name": "DM Mathematics" }
ppose 3d = 11 + 4. Suppose -z + k + 1 = 0, -1 = -0z - 3z + dk. Suppose 2h + zh - 24 = 0. Is h a prime number? False Let t(b) = -b*2 + 11b + 1. Is t(9) a composite number? False Suppose 633 = 5b + w, -2w = 2b - 6w - 262. Let t = b - 12. Is t a prime number? False Suppose j - 2 = -1. Let y(d) = 210d3 + 2d*2 - d. Is y(j) a prime number? True Suppose -i = -2s + 426, 4i - 186 = -2s + 220. Is s prime? True Let l(r) = r*2 - 8r - 5. Let t(o) = o*2 - 7o - 5. Let y(f) = -2l(f) + 3t(f). Suppose -m = m + 2j + 18, -m - 5 = -j. Is y(m) a prime number? True Let v = 5 + -1. Let d = 8 - v. Let h(b) = b3 + b2 - 2b + 5. Is h(d) a composite number? True Suppose 3m + 36 = -3j, -5j + 2m - 106 = -39. Is (-1185)/j - 6/39 prime? False Suppose 15l - 16l + 445 = 0. Is l a composite number? True Suppose 0 = 3s - 2m - 435, -5s + 4m + 451 = -276. Is s a prime number? False Let y be 2/(2 - 4) - 93. Let k be (-3)/((-9)/210) + -3. Let b = k - y. Is b a composite number? True Is (33/99)/(((-2)/12462)/(-1)) composite? True Suppose -7m + 7932 = -10639. Is m a composite number? True Let b(v) = -v3 + 3v*2 + v - 4. Is b(-5) prime? True Let x(t) = t - 2. Let k be x(5). Suppose -h + 0 + 1 = s, s = kh - 19. Suppose -hy + 3 + 27 = 0. Is y composite? True Let x(f) = -f3 - 20f*2 - 5f + 49. Is x(-20) a composite number? False Let p(f) = 0 - 1 + 26f + 0 + 0. Is p(3) a composite number? True Let k = 217 - -25. Suppose -s - 20 + 94 = 3f, k = 3s + 5f. Is s composite? False Is (-6 - -1)/((-1)/179) + 0 prime? False Let y be (-6)/4(-172)/3. Let o(j) = -j3 - 6j*2 + 10j + 5. Let r be o(-8). Let w = y - r. Is w a composite number? True Suppose 2l - 3 = 1. Suppose d + n = 1, 3d + 19 = ld - 5n. Suppose b = db - 55. Is b prime? True Suppose 52 + 230 = 2p. Is p a composite number? True Suppose 2f - k + 2k = 1953, -2f + 4k + 1958 = 0. Is f a prime number? True Let t be -1072/(-2 - 0). Let k be (-1)/(-1 - (-8)/10). Suppose 3c = -ks + s + 62, 5c + 3s = t. Is c a composite number? True Suppose 4s - 558 = -c + 476, -2s - 3c + 512 = 0. Is s a prime number? False Suppose 0 = -10x + 1037 + 293. Is x a composite number? True Let m = 14 + -5. Let d(b) = 13b + 4. Is d(m) a composite number? True Let u be ((-2)/(-1))/((-2)/208). Let y = u + 297. Is y prime? True Let c(h) = h*3 - 5h*2 + h - 2. Let j be c(5). Let b be (1 - j) + 1 + 4. Suppose z - 458 = -5i - 63, -237 = -3i - bz. Is i prime? True Let s(g) = -g*3 + 7g*2 + 10g - 7. Let m be s(9). Suppose x + 75 + 352 = -3j, 4x = 5j + 740. Let y = m - j. Is y composite? True Suppose -3t + t = -180. Let q = -39 + t. Is q composite? True Suppose 3p + 16 = -2. Is (-6)/(-4)(-172)/p prime? True Let s(j) = 17j2 + 2j - 2. Is s(4) a prime number? False Let u(v) = v*3 - 12v*2 + 13v - 9. Let y(a) = -10a + 1. Let q be y(-1). Is u(q) prime? True Is 97702/5515/6 prime? True Let l = -4 + 11. Is (-2)/7 + 408/l prime? False Suppose -5g - 5c + 20 = 0, 20 = -0g + 3g - c. Suppose 6 = 4l - g. Suppose -4n + 224 = -0n + 3p, 0 = -2n - lp + 118. Is n a composite number? False Suppose 0p + 413 = p. Is p a composite number? True Let i(f) = -4f*3 - 4f*2 - 5f - 4. Suppose 2v - 3 = 1. Suppose j + vl = 1, 0 = 2j - 5l + 2l + 12. Is i(j) prime? True Let a be 24/(-18)9/(-2). Is 2056/10 + a/(-10) prime? False Let h(y) = -3y3 + 3y*2 + 7y. Is h(-5) prime? False Suppose f + p - 1 + 2 = 0, 0 = -f + 2p - 4. Let y be (6/(-4))/((-1)/f). Is 2 - -1(2 - y) composite? False Let z be (15/(-9))/((-2)/6). Suppose 0 = -zd - 0d + 4u + 101, 0 = 5d + 3u - 108. Is 14/d + 43/3 a prime number? False Let t = -55 - -18. Let m(d) = d - 7. Let k be m(-8). Let r = k - t. Is r prime? False Suppose 0 = r - 5r + 2i + 790, -4r + 793 = -3i. Let y = -121 + r. Suppose -2q = 3c - 35 - 32, -2q + y = -5c. Is q a composite number? True Let z = 0 - -2. Suppose 0 = -5i - 4y + 708, 4i + 2y - 282 = zi. Let p = -87 + i. Is p prime? False Suppose -436 = -4z + 2z. Suppose 4o - z - 442 = 0. Suppose 2x = 23 + o. Is x a composite number? True Is ((-135)/6 + -4)-6 a prime number? False Suppose 12 = -5z + 32. Let t(n) = -2n - zn - 3 - 9n. Is t(-6) composite? True Let o = 61 + 202. Is o a composite number? False Suppose -2w = 3w + 315. Let t = w - -102. Is t composite? True Let i(s) = s3 - 6s*2 - 7s + 11. Suppose 4d - 5p - 32 = -0d, 8 = d - 3p. Is i(d) composite? False Suppose -y + 5y - 1028 = 0. Is y prime? True Suppose -5p = -x - 20, 2p - 4x = 6 + 2. Let d be (p/10)/((-4)/20). Is (1 - 0) + d + 15 a prime number? False Let s(v) = -v*2 + 9v + 1. Let g be s(9). Is (-127)/(-1 + g + -1) a prime number? True Let x be (-66)/8 - 3/(-12). Is (-4)/x-2 - -72 a composite number? False Let v(y) = 3y*2 - 5y + 2. Let w be v(5). Let p = 80 + -43. Let n = w - p. Is n composite? True Let w(s) = s + 5. Let h be w(0). Let v = h - 3. Is v/8 + (-182)/(-8) prime? True Let t be -1 + ((-1)/1)/(-1). Suppose -4 = u - 7. Suppose 5h = h - 4b + 136, t = h + ub - 40. Is h composite? False Let n(u) = u2 + 4u - 3. Let o be n(-5). Let t(p) = 4p2 - 7p + 7. Let q(d) = -3d2 + 8d - 7. Let g(s) = ot(s) + 3q(s). Is g(7) prime? False Suppose 4x = 2x + 8. Suppose 0 = xp - 12 + 4. Suppose s - 17 = ph, -2s - 32 = -6s - 4h. Is s a prime number? True Let b(v) = -28v*2 - 2v. Let u be b(2). Let i = u + 265. Is i composite? False Let i(q) = 3q + 1. Let o(s) be the third derivative of s6/120 - s5/10 + s4/3 - 7s*3/6 + 2s*2. Let n be o(5). Is i(n) prime? False Suppose 64 = -n + 453. Is n a composite number? False Let o(c) = 237c - 4. Is o(1) composite? False Let o = -8 - -11. Suppose 0 = oh - 2h - 50. Let w = 85 - h. Is w prime? False Let s = 745 + -510. Is s prime? False Let x(n) = -n*2 - n + 34. Let s be (3/(-2) - -1)0. Let l be x(s). Let v = -23 + l. Is v a composite number? False Suppose h - 3 = -2. Is 0/h + 314/2 a composite number? False Suppose 6g + 66 = 8g. Is g a prime number? False Let w(z) be the third derivative of z5/3 - z4/4 + z*3/3 + 2z*2. Let x(t) = 10t*2 - 3t + 1. Let r(c) = -2w(c) + 5x(c). Is r(2) a composite number? True Let c(l) = -49l2 - l + 1. Let p be c(1). Is (-16233)/p + (-4)/14 prime? True Is 0 - -1 - (-4 - 180) a composite number? True Let b be -870 + 6(-2)/(-6). Let m = b + 1545. Is m a composite number? False Let g(v) = v*2 + 7v + 5. Let c be g(-6). Is (0 + c)/((-3)/39) composite? False Suppose -23 + 3 = -5g. Suppose 5p = k + 25, -3p + 2k + 15 = gk. Suppose 5u + 3m - 32 = 4u, 0 = pu - 3m - 124. Is u a prime number? False Is (14/(-21))/(6/(-1467)) a composite number? False Let a be (-3)/6 + 5/2. Suppose -av = 4t - 12, -4v + t = 2t - 38. Suppose 3l - 63 = -3w, 0 = -6l + l + v. Is w a composite number? False Let v(i) = 6i3 + i2 - i. Let w be v(1). Is w/9 + (-379)/(-3) composite? False Let h = 180 - -398. Suppose -m + h = 2a - a, -2321 = -4m - a. Is m prime? False Let v(j) = -4 - 7j - 21j - j. Is v(-3) composite? False Let j = 7 - -48. Is j prime? False Suppose -4o + 356 = -296. Is o a composite number? False Let t(n) = -n3 + 15n*2 + 22n + 10. Is t(16) a composite number? True Is (-337905)/(-54) - 1/2 composite? False Let v = 0 - -3. Suppose -p + 2p - 17 = 0. Suppose -vm + p = -13. Is m a composite number? True Suppose -u - 19 = -4v, -5v = 4u - 10 + 2. Suppose 5l + vg = -0g + 737, -3l + 449 = -g. Is l prime? True Let c(j) be the first derivative of -6j - 1 - 1/4j4 - j3 + 5/2j*2. Is c(-5) a composite number? False Let y = 615 + -164. Is y prime? False Suppose 0 = -s - 3s + 3368. Let v = -469 + s. Is v composite? False Suppose -4b = 7v - 2v - 4982, 0 = 3v - b - 2996. Is v a composite number? True Let t(n) = -33n + 2. Let l be t(-2). Suppose 272 = 4h + 4v - l, 4v = 8. Is h a composite number? False Let s be 302(2 + 6/(-4)). Suppose 3k + s = -5i, -i + 4i + 99 = -2k. Is (51/6)/((-3)/k) prime? False Suppose 3d + i - 1439 = 0, -4i + 3i + 960 = 2d. Is d prime? True Is (-3)/5 - (-92508)/30 a composite number? False Let o be 2(-2)/((-4)/3). Suppose -os + 289 + 266 = 0. Is s a composite number? True Let j(y) = y3 - 9y**2 + 13. Let t = -6 - -16. Is j(t) prime? True Le	{ "pile_set_name": "DM Mathematics" }
+ 5d4/12 + 13d*3/2 + 5d*2 + 6. Let s be k(-4). Is -13 greater than s? True Let m = -68/333 + -2/111. Let g be 8 + 138/(-18) + (-8)/6. Is m equal to g? False Let i be (-1116162)/249275 + 1/((-1)/(-4)). Let n = i + -2/845. Is 0 <= n? False Suppose 3 = -g - 2g. Let r = -33798 + 1047743/31. Which is smaller: r or g? g Suppose 11d + 1457 = 4416. Let u = -219 + d. Is u greater than or equal to 50? True Suppose -2z - 5 = -5n + 3z, 3n - 2z = 1. Let j be (14440/2432)/(1n/4). Which is bigger: j or -24? j Let r = -3/172 + -3769/860. Suppose -5s + 20 = -6h + 3h, -2h = -2s + 8. Suppose -j - 2 - 11 = 3z, h = 5z + 4j + 24. Is r > z? False Let o be (-3 - (4 - (3 - -5))) + 51. Let c be ((-78)/o)/((-3)/(-4)). Which is greater: -6 or c? c Let p be (-3)/(-15) + (-2409)/2805. Which is greater: 0 or p? 0 Suppose 0 = 2s - s - 2. Suppose 110 = -32t + 54t. Suppose tx - sa = -3a - 11, -4a = -16. Is -9 greater than x? False Let g be (-2098)/355 - (2 + 21/((-147)/56)). Is 1 greater than or equal to g? True Let o be 13((-40)/(-6) - (-1895)/(-1137)). Suppose 2g - 3k = 114 + 21, -2k + 246 = 4g. Which is smaller: o or g? g Let l be (-9)/(435861/6)(7 - (-1 - -2)). Which is smaller: l or 0? l Let h(v) = -v*2 - 10v - 1. Let i be h(-7). Let f(t) = 23 - 5t2 - t3 + i - 2t - 36. Let c be f(-4). Is -2/35 != c? True Let z = -468 - -466.8184. Let j = -0.0116 - z. Are j and -3 unequal? True Let m be 1636/18(-9 + 1 + 1). Let b = -637 - m. Suppose 4p + 18 - 10 = 0. Is b >= p? True Let c be (6/(-10))/((374/(-1615))/22). Which is smaller: c or -21? -21 Let c(u) = u*2 + 182u + 2352. Let p be c(-14). Which is smaller: -3/335 or p? -3/335 Let k = 1586/7 - 26948/119. Suppose 0c + 2c + 2 = 0. Let a = c - -2. Is k greater than a? False Let t = 6931 + -6829. Is t equal to -18? False Let g be 14562/2082 + (-53 - -46). Is 2/15 at least as big as g? True Let c = 91060.7222 + -91072. Let b = c - 0.2322. Let p = b - -11.6. Is 1 smaller than p? False Let i = 69 - 67. Suppose -j = ij - 15. Let u be 17/5 + (-2)/j. Which is smaller: u or 13/6? 13/6 Let z(q) = -17q - 9. Let a = 2 + -7. Let k be z(a). Let w be 2-2 - k/(-22). Are w and -2 unequal? True Let p = -918130/43 + 21353. Which is smaller: 1 or p? 1 Let b(w) be the second derivative of -17w*3/6 + 46w*2 + 76w. Let h be b(0). Which is smaller: 93 or h? h Let d = 22103 - 20710514/937. Is 1 < d? False Let o = -2397 - -2276.9. Which is bigger: o or -2? -2 Let l be ((-2)/18)/((-13)/254046). Suppose -5n - 1202 = s + 976, -10970 = 5s + 5n. Let c = s + l. Is c less than -26? True Suppose 5o + 0o - 181 = v, 4o - 2v = 146. Let t(r) be the first derivative of r4/4 - 4r*3/3 - 3r*2 + 16. Let j be t(6). Is o equal to j? True Suppose 5g + 2s - 373 = 0, -223 + 0 = -3g - 2s. Let f be ((-125)/g)/(10/(-12)). Suppose 3 = l + k, -5l = -2k - f + 8. Is l <= -8.7? False Let y(n) = 25243n*2 - 4n - 6. Let p be y(-2). Let v be (-2)/(-5) - (4 - p/27600). Let q = v + -3/200. Which is smaller: 0 or q? 0 Let k = 11647 - 11655. Let c be 16/(-1) + (3 - 1). Let g be 1/21 + (-4)/c. Are g and k nonequal? True Suppose 4z - 4x = -49 + 41, 3z + x = -18. Is 14 > z? True Suppose 3n - 13 = 4p, -2n - 22 = -1051p + 1056p. Are n and 30/1459 equal? False Let u be 170/(-24) + ((-63)/12)/(12/(-16)). Which is smaller: u or -12/7? -12/7 Let h = 98080 - 17556042/179. Which is greater: 3 or h? 3 Let i(z) = -4z2 - 164z + 295. Let o be i(-58). Is -3648 not equal to o? True Let v be 5(-5 - -3) - -2296. Is 2290 greater than or equal to v? True Let b = -7576 + 5395. Is b greater than -2181? False Let z be 30/(-4)812/(-21). Let i be -2 + 5/15(z - -1). Let v = 473/5 - i. Are v and 0.03 non-equal? True Let j be -51 - ((-4 - -10) + -8). Let o be -7 - -10 - j/(-1). Is o greater than or equal to 5/21? False Suppose 2x - 582 = 2z, 3x = -0x - z + 873. Suppose 730u + 5 = 2n + 729u, 0 = 3n + u. Is x not equal to n? True Let v(s) = 3s2 - 13s - 81. Let q be v(23). Let f = q + -162943/135. Let x be -3 + 4 - 21. Is f at least as big as x? True Let v be -6 - (-372)/18(-33)/(-114). Let i = -4 - -3. Is i smaller than v? True Let k = -0.12964 + -0.37036. Is 4/285 equal to k? False Let w = -244 + -85. Let c = w + 329.26. Is 5/4 less than or equal to c? False Let t(k) = -2k2 - 38k + 38. Let b be t(-20). Let j be (-51)/(-459) - b/(-153). Is j at least -1? True Suppose 11g = 15g - 32. Let j(h) = 2h3 - 21h*2 + 14h - 19. Let n be j(g). Which is bigger: -226 or n? -226 Let c be -4 - -1 - 1/(129/(-389)). Suppose -136 = 9x + 224. Let f = 39 + x. Which is bigger: c or f? c Let i be (-1 + 33/27)/((-15)/(9 + -1764)). Suppose 173 - 65 = 4s. Is s at most i? False Let x(h) = -5h + 9. Let v = 98 + -96. Let d be x(v). Which is bigger: -5/8 or d? -5/8 Let v = 38.452 - -0.148. Let o = 37.6 - v. Is o > 5? False Let y be 34/119 + (3/14 - 0). Is 2.7 at least as big as y? True Let k = 563959 - 1179326. Let v = k - -135996558/221. Let r = -36/17 + v. Which is smaller: r or 1? r Let l be (4/(-10))/((-12)/420). Let p be l/(-35) - 28/(-120). Let j = -555/3113 - 1/283. Is p at least as big as j? True Let g = 1 - 0. Let s = -1047/53075 - -4/275. Which is greater: g or s? g Let b = 124 + -212. Let o = b + 52. Let w = -14 + 13. Which is bigger: w or o? w Let k = -1101 + 1179. Let r(u) = u2 + 7u - 1. Let o be r(-13). Which is greater: o or k? k Let g(p) = 4p3 - 10p*2 + 2p - 12. Let n be g(16). Suppose -5v + 27708 = -v - 5s, -5s - n = -2v. Let x = v - 62468/9. Which is greater: -10 or x? x Let n = 27 + 5. Suppose -3a = -2a + n. Let f = a - -37. Is -1 at least f? False Let q(u) = 2u2 + 39u - 29. Let b be q(-20). Let h be 48/1430/b. Is h < -11? True Let l(u) = 119u*3 - 6u2 - u + 17. Let x be l(2). Is x < 952? True Let q(v) = -v3 - 2v2 - v + 2. Let s be (-3)/9 - 2/(-6). Let c be q(s). Is -3 at most c? True Let s = -22026 + 22326. Which is smaller: 295 or s? 295 Let d(x) = 176x - 2612. Let b be d(26). Are 1964 and b non-equal? False Let s = -3110 - -3109. Is s greater than 12/611? False Suppose 4i = 2r + 10, -2r + 29 = 2i + 9. Suppose -j + rj - 5b - 9 = 0, -j - 4 = 5b. Let v = -1915/103626 - 2/51813. Which is smaller: v or j? v Suppose 0 = 5f + 3l, 2l - 25 = 7l. Suppose 2w + w + 25 = 2y, 2y + w = 5. Suppose -fj + 26 = -yj. Is -23/2 greater than j? True Suppose 4u + 5 = -2x - 483, u + x = -121. Which is smaller: u or -126? -126 Let d be (2/7172)/(1/4). Let s = -551 + 550. Is s < d? True Let i = 12610 + -11212. Which is bigger: 1399 or i? 1399 Let n be 34 - 42 - 54/(-7). Is n bigger than -3/13? False Let s(t) = 4t2 + 26t - 9. Let w be s(2). Which is smaller: 62 or w? w Let t = -226.22 - -226. Let w = -0.239 - t. Which is smaller: -0.1 or w? -0.1 Let m = -267 - -266.9515. Let n = m + -67.9515. Do n and -0.1 have the same value? False Let o be -2 - (-103 + -4 + 4). Let v = -136 + o. Does -35 = v? True Let v = 75 + -70. Suppose -z - 4j + 13 = v, -8 = -z - j. Suppose -2m - 1 = -s + z, -6 = -m + 4s. Is m at most as big as -10? False Let i(q) be the first derivative of 4 + 3/2q*2 + 9/2q4 - q - q3. Let m be i(1). Is m smaller than 17? False Suppose 5s + 19370 = -5x, 2x = -2s + 4x - 7748. Let m be (-5)/((-525)/30) - s/14. Which is smaller: 276 or m? 276 Suppose 0p = 5p + l - 18, 3l = 2p + 3. Let w be (-8)/((-1)/4 - p/12). Do w and 12 have different values? True Let r = -1.0798 + 0.8298. Do 1/67 and r have the same value? False Let j(h) = -54h - 926. Let k be j(-17). Is k < -35? False Let y = -4/2363 - -17545/593113. Let k = 13641/471127 - y. Is k != -1? True Suppose 0 = -10x + 41 + 119. Suppose -840 = -xa + 888. Is 108 equal to a? True Let h = -0.1267 - 0.1533. Are h and -29 equal? False Suppose 2c = 2s + 28, -4s - 78 = s - c. Suppose -3k - 77 = 5y, 78 = -5y + 172k - 174k. Is y < s? False Suppose 18t - 10t + 25t = -33. Is -3/1354 at most t? False Let g be ((-26)/(-10))/((-3)/(-15)). Suppose gv - 171 = 24. Which is greater: v or 1? v Let p = 3.58797 + -0.08797. Which is smaller: p or 51? p Let s be (-440)/792 - ((-1)/3 + 0). Let u = -2 + 2.8. Is u at most as big as s? False Suppose -2s - o - 9 = 0, -2o = 3s + 2o + 16. Let p be ((-14)/(-21) - 16/15)/s. Le	{ "pile_set_name": "DM Mathematics" }
b*2. Suppose p = 2q - 11, -3p = -0q + 5q - 22. Let s(h) = 0 - qh + 4h + 0. Give k(s(r)). 5r*2 Let x(t) = -5t + 7. Let u(v) = 2v - 3. Let r(q) = -14u(q) - 6x(q). Let z(p) be the first derivative of -p2 + 1. Calculate r(z(n)). -4n Let i(n) = -6n2. Let m(h) = 1500h*2. Calculate i(m(s)). -13500000s4 Let w(h) = h2. Let t(r) = -6r - 11. Let q(i) be the third derivative of i4/12 + 2i3/3 + i2. Let m(y) = -11q(y) - 4t(y). Calculate m(w(j)). 2j2 Let u(k) = k. Let q(c) = -c + 3. Let l(d) = -1. Let x(w) = 3l(w) + q(w). Give u(x(a)). -a Let v(h) = 3h2 + 2h - 2. Let y be v(-6). Let x(b) = yb - 94b + 2b2. Let g(j) = 8j*2. Calculate g(x(k)). 32k4 Let m(s) = -s2 - 24. Let v(i) = 3i. What is m(v(n))? -9n*2 - 24 Let x(r) = 15r*2. Let w(p) be the first derivative of -2p*3/3 - 9. Determine x(w(d)). 60d*4 Let t(p) be the first derivative of 0p + 0p2 + 2/3p*3 - 2. Let u(q) = -q - 1 + 5 - 4. Calculate u(t(d)). -2d*2 Let y(a) = -26a*2. Let u(t) = 5t*2 + 6t - 6. Let p(w) = -11w2 - 13w + 13. Let l(j) = 6p(j) + 13u(j). Give l(y(v)). -676v4 Let o(u) = 2u. Let l(a) = -23a + 2. Determine o(l(y)). -46y + 4 Let r(k) = -5k2. Let d(o) be the first derivative of -o5/60 - o2/2 + 4. Let n(c) be the second derivative of d(c). Give n(r(m)). -25m*4 Let v(o) = 13o*2 + 11o. Let u(w) = -7w2 - 6w. Let s(n) = -11u(n) - 6v(n). Let z(d) = -d2. Determine z(s(y)). -y4 Let o(v) = -3v2. Let q(z) = -z2 + 2. Let l(u) = 4u*2 - 7. Let g(f) = 4l(f) + 14q(f). What is g(o(c))? 18c*4 Let p(k) = 4k*2. Let x(o) = 9o - 3. Let c(h) = 9h - 4. Let l(q) = -3c(q) + 4x(q). What is p(l(w))? 324w2 Let a = 8 - 3. Let h(p) = -p2 + 5p - 5. Let k(f) = f2 - 7f + 7. Let v(z) = ak(z) + 7h(z). Let x(n) = 3n2. Give v(x(o)). -18o4 Let w(k) = k2. Let r(c) = -9c + 2c + 12c + 6c. What is r(w(q))? 11q2 Let i(r) = 3r. Let u(p) = 1227p2. Determine i(u(d)). 3681d*2 Let h(d) = -4d. Let z(y) = 250y2. Give h(z(u)). -1000u*2 Let f(w) = 155 - 312 + 2w*2 + 157. Let m(h) be the first derivative of 0h - 2/3h3 + 0h*2 + 2. Give f(m(g)). 8g*4 Let d(s) = 8s. Let r(c) = 179c2. Determine r(d(t)). 11456t*2 Let o(i) = 5i*2 - 29i. Let q(w) = w*2. Determine o(q(x)). 5x*4 - 29x*2 Let i(p) = 3p*2. Let v(k) = 4k. Let z(c) = -c. Let f(y) = -v(y) - 5z(y). What is i(f(l))? 3l*2 Let z(h) = 36h + 2. Let m(x) = 24x2 - 2x. Calculate m(z(d)). 31104d2 + 3384d + 92 Let z(t) = -6t2. Let k(l) = -8l - 7. Let q(m) = -7m - 6. Let s(j) = 6k(j) - 7q(j). Calculate s(z(g)). -6g*2 Let v(h) = -52h. Let u(w) = -37w2. Give u(v(l)). -100048l*2 Let g(o) = o. Let c(q) = -2q - 2999. Calculate g(c(l)). -2l - 2999 Let z(k) = 3k. Let q(y) = 17y2 - 58y - 1. Give q(z(d)). 153d2 - 174d - 1 Let m(k) = -2k2. Let l(n) = -6n + 6n + 2n*2. What is l(m(y))? 8y*4 Let b(r) = -11r*2. Let a(l) = -3l. Determine a(b(i)). 33i2 Let z(n) = -4n. Let v(f) = -66f - 27. Give z(v(a)). 264a + 108 Let x(s) = -2s. Let v(m) be the third derivative of -8m4/3 + m2 + 12. Determine v(x(u)). 128u Let i(c) be the third derivative of c5/20 + c2. Let y(f) be the third derivative of -f5/60 + 12f*2 - 3f. What is y(i(o))? -9o4 Let q(r) = -r. Let k(v) = 4v - 6. Let c(j) = k(j) + 2q(j). Let w(m) = -1. Let g(a) = -c(a) + 6w(a). Let d(o) = -2o. Give d(g(f)). 4f Let u(g) = g + 2. Let o(l) = 5l + 11. Let z(h) = 2o(h) - 11u(h). Let c = 6 + -4. Let q(v) = 2v*2 + 0v*c + 5v*2. Determine q(z(d)). 7d*2 Let s(o) = -4o*2 - 10o. Let q(x) = -2x2 - 6x. Let k(u) = -5q(u) + 3s(u). Let g(w) = -18w2. Determine k(g(d)). -648d4 Let s(z) = -z2. Let m(c) = -340c. Calculate m(s(n)). 340n*2 Let w(u) = -4u*2. Let h(o) be the first derivative of -23o*2/2 - 25. Determine w(h(p)). -2116p*2 Let k(z) = 2z. Let g(d) = -2d - 7. Let t(x) = -1. Let c(j) = 2g(j) - 14t(j). Determine k(c(o)). -8o Let u(y) = y*3 + 12y*2 - 12y + 15. Let w be u(-13). Let k(r) = -r*2 + 1 + wr*2 - 1. Let j(t) = -2t. What is j(k(s))? -2s2 Let r(l) = -2l + 9. Let u(t) = 8t2. Determine r(u(a)). -16a*2 + 9 Let y = 19 + -12. Let r = -12 - -14. Let p(h) = 2h*r + 7 - y. Let u(k) = -k. Give u(p(j)). -2j*2 Let s(h) = 15h. Let i(n) = -4n. Let m(t) = -22i(t) - 6s(t). Let y(u) = u - 1. Let o(l) = 5l - 3. Let p(c) = o(c) - 3y(c). Determine p(m(a)). -4a Let b(d) = -3d - 5. Let n(w) = 2w + 4. Suppose 0 = -3j + 9 + 3. Let s(v) = jb(v) + 5n(v). Let h(g) = -5g*2 + 2g*2 - 2g*2. What is s(h(m))? 10m*2 Suppose -10 = -3o + o. Let c(m) = 5m - 5 + o. Let d(n) = n. Calculate d(c(b)). 5b Suppose -4i + 6i - 8 = 0. Suppose 0 = 3o - 0o - 4m + 14, 2m = 3o + 4. Let p(k) = i + ok - 4. Let j(w) = 3w2. Give p(j(l)). 6l*2 Let p(g) = -g. Let l(o) = 22o*2 + 7o*2 - 2o + 0o2. Calculate p(l(w)). -29w*2 + 2w Let t(m) be the third derivative of -m6/360 - m4/8 + 2m2. Let p(d) be the second derivative of t(d). Let s(x) = 4x*2. Calculate p(s(l)). -8l*2 Let x(y) = 0 - 6y*2 + 10y*2 - 4. Let j(w) = -w. What is x(j(t))? 4t*2 - 4 Let p(q) = 6q2 + q2 - 3q2 - 2q*2. Let k(b) = b. Determine p(k(j)). 2j2 Let o(p) = p. Let q(m) = m2 - m + 1. Let g(w) = -8w2 + 6w - 6. Let j(z) = g(z) + 6q(z). Give j(o(u)). -2u*2 Let k(f) = 32f. Let v(x) = -6x2. Determine v(k(j)). -6144j*2 Let j(z) = z. Let l(q) = 8q*2 - 13q*2 + 4q*2 + 2q2. Determine j(l(f)). f2 Let w(y) be the third derivative of -5y4/6 + 61y*2. Let s(t) = 3t*2. Determine s(w(c)). 1200c*2 Let a(u) = 2u. Let m(w) = w*2 - 5w - 32. Let o be m(9). Let k(i) be the second derivative of 0i2 + i - 1/6i*o + 0i*3 + 0. Calculate k(a(z)). -8z2 Let j(y) be the second derivative of y4/4 - 16y. Let u(p) = 7p. Determine j(u(d)). 147d2 Let u(f) = 5f. Let v(o) = -11823o. Give u(v(a)). -59115a Let c(g) = 40g. Let s(w) = -2w - 64. What is c(s(x))? -80x - 2560 Let f(h) = -8h*2. Let j(d) = 12d + 1. Determine j(f(i)). -96i2 + 1 Let j(a) be the third derivative of 8a*5/15 + 14a*2. Let y(z) = 2z*2. What is y(j(n))? 2048n*4 Let g(i) = 7i2 - 37. Let p(f) = -f2. Calculate p(g(t)). -49t4 + 518t2 - 1369 Let n(u) = -u. Let f(d) = -d2 + 9d - 5. Let l be f(7). Let w(c) = 3 + 0 + lc - 3. Calculate w(n(a)). -9a Let i(k) be the second derivative of 8k + 0 + 0k2 - 2/3k3. Let u(p) = p2. Give i(u(w)). -4w2 Let m(t) = -t. Suppose 5o + n - 17 = -4, 4o = 5n + 22. Suppose 3w - 3d = -o, d = w + 5d - 14. Let g(y) = 4y*2 - 5y*2 + 0yw. Give m(g(x)). x2 Let i(p) = 2p2. Let y(u) = u2 - u + 4. Let a be y(0). Let r be -4(-1 + 2/a). Let n(g) = -g - r + 2g + 2. Calculate n(i(l)). 2l2 Let z(m) = -m2. Let f(t) = 6t - 3t + 8t. What is z(f(j))? -121j2 Let p(o) be the first derivative of -o2 + 5. Let j(c) = -c*2. Calculate j(p(y)). -4y2 Let z(g) = -g2. Let k(s) = -s + 1169. What is z(k(t))? -t*2 + 2338t - 1366561 Let c(a) = -2a + 5. Let q(h) = -2h + 6. Let w(o) = -6c(o) + 5q(o). Let u(i) be the third derivative of i*5/12 - 2i*2. What is w(u(r))? 10r*2 Let n(y) = 8y + 4y - 9y. Let b(a) = 4a2. Determine b(n(r)). 36r2 Let l(d) = -d2 + 0d2 - 3d2. Let c(p) be the third derivative of -p5/30 + 7p2. What is l(c(n))? -16n*4 Let k = -8 - -3. Let t = -2 - k. Let m(j) = tj + 3j - 4j. Let q(y) = -y. Calculate q(m(l)). -2l Let t(z) = z2. Let a(r) be the third derivative of -r5/15 - r4/12 + 11r*2. What is a(t(j))? -4j*4 - 2j*2 Let t(j) = 4j*2 - 117j. Let s(i) = 8i2. What is t(s(d))? 256d*4 - 936d*2 Let i(s) = -4s*2. Let j = 64 - 46. Suppose 0 = -c - 0c - 3p + j, 0 = 4c - p - 7. Let l(g) = c + 3 + g - 6. Give i(l(z)). -4z2 Let z(p) = -5818p. Let g(d) = 2d. Calculate g(z(v)). -11636v Let t(l) = -4l. Let y(f) = -f2 - 2 + 1 + f + 2f*2. Let n(v) = 2v*2 + 3v - 3. Let z(r) = n(r) - 3y(r). What is z(t(o))? -16o*2 Let p(z) = 2z*2. Let o be (3-1)/(9/(-6)). Let n(f) = 3fo + 95f - 95f. Calculate n(p(m)). 12m4 Let z(p) be the first derivative of -p3 - 12. Let k(l) = l. Give k(z(a)). -3a2 Let i(c) = -4c. Let a(z) = z**2	{ "pile_set_name": "DM Mathematics" }
Calculate 660.17240884765 - -1. 661.17240884765 Subtract 15209086794.3 from -0.1. -15209086794.4 What is 4 less than 153.97611124736? 149.97611124736 What is -44.2701274 take away -2184519? 2184474.7298726 Add together 124643684.38764 and -0.08. 124643684.30764 Sum 5 and 599215480663. 599215480668 Total of -4276015012187 and -31. -4276015012218 Add 124724158 and -580.5. 124723577.5 What is 355336030066 + 0.15? 355336030066.15 What is the difference between 195040972 and 1022? 195039950 What is 0.2 minus -21130546939239? 21130546939239.2 What is the difference between -3851660 and -0.0084807? 3851659.9915193 Calculate 37380774 - -8387. 37389161 Calculate -86256 + 173923.798. 87667.798 Add together 233379 and -138915.507. 94463.493 -20972 - -819397173 819376201 What is the difference between 0.29 and -5740911558? 5740911558.29 Sum -0.0793093 and 0.0515904847. -0.0277188153 Work out -137.74 + 9290229269. 9290229131.26 Put together 0.202509 and -1719956. -1719955.797491 Calculate -30.48504816433349 - 1. -31.48504816433349 What is -293898619 minus -4606? -293894013 Total of -1570 and 1511903.55. 1510333.55 Subtract -1388313796 from 11997. 1388325793 Calculate -30945883.74 - 0.99. -30945884.73 Add together 0.047 and -1916636622. -1916636621.953 Subtract 39749753686 from -0.08. -39749753686.08 What is the distance between 0.2239713 and -877151? 877151.2239713 -22.29 + 1362313143 1362313120.71 Work out 0.899 - -23328.046345. 23328.945345 Add together 228510326240766 and -3. 228510326240763 Work out -6813.2 - 717635954. -717642767.2 Calculate 387701876562 + -1. 387701876561 What is 0.02661 take away 72976620? -72976619.97339 What is 10 less than 34627826.83? 34627816.83 Total of -1079717811 and -3017. -1079720828 What is 3527658044527 - 0.2? 3527658044526.8 Calculate 0.3 - -163837606627. 163837606627.3 Add together 18 and -65658.31596. -65640.31596 Work out -324.37 - 0.921414487. -325.291414487 Calculate -1.62705874 - -34851. 34849.37294126 What is 3354 take away -2053.556449? 5407.556449 Add together -6970073.0429 and 3. -6970070.0429 Work out 348764577 - -6351. 348770928 What is the difference between -0.1 and -5262213927129? 5262213927128.9 -6066.4717 - 3654 -9720.4717 What is the distance between 7385 and -19722111? 19729496 147313 - 250999451 -250852138 What is -7103833090 plus 358? -7103832732 What is 463714431736 + 939? 463714432675 Work out 3 + -9.523798065679. -6.523798065679 What is the difference between -4061 and -16357104870? 16357100809 Total of 9084366090 and -8257. 9084357833 What is the distance between 375200.56768698 and -0.6? 375201.16768698 Add together -59.026 and -639907401. -639907460.026 -17858 - -1303150 1285292 What is 2.5618585 minus 331056? -331053.4381415 Work out 338 - -120502.98875. 120840.98875 What is -147640194 minus 18.4? -147640212.4 Calculate -178441801.7 - -2015. -178439786.7 -6.15673+8370577 8370570.84327 Calculate -358390.12 + 5.953. -358384.167 What is -66565 less than 2359798566? 2359865131 What is 405267 take away 2522280? -2117013 Add -18246282 and 4811. -18241471 What is the difference between 26.01 and -125358.822399? 125384.832399 6407578499+-2.7 6407578496.3 -1216.2215374776+-2 -1218.2215374776 Calculate -4.674 - 1245244550. -1245244554.674 What is 0 minus -958.5208549164? 958.5208549164 What is 536144811.5 plus 52? 536144863.5 What is -53954 - 292.0062? -54246.0062 What is the difference between 59 and -67809116.435? 67809175.435 What is 328.930877314 minus -32? 360.930877314 What is -29397874 + 3509546? -25888328 What is 287.646 minus -60080.32? 60367.966 Calculate 870 - -7224859007. 7224859877 1256 + 316.25486 1572.25486 What is 1433626037 less than -0.189? -1433626037.189 Add together -6107.6457 and 70.5526. -6037.0931 What is 1895.099891 take away 158322? -156426.900109 What is -0.15 take away 9888975852? -9888975852.15 What is 1271 minus 5049.09824? -3778.09824 829613009909 + -0.1 829613009908.9 What is the difference between -154215814327 and 9? 154215814336 What is 6.089 take away 0.801911? 5.287089 What is -248.8982993746 take away -0.03? -248.8682993746 What is 53353 minus 79428908.8? -79375555.8 -1 + 22.9579657526 21.9579657526 Calculate 244440897.9049 + 0.7. 244440898.6049 Calculate 0.00203 - 192699341. -192699340.99797 -12.993 + -4164535520 -4164535532.993 -202385+147363 -55022 What is 11833320183 less than 1135? -11833319048 Calculate 118385 - 1477.854. 116907.146 Calculate -9267227 - 18.46269. -9267245.46269 What is -9 less than -5583513886072? -5583513886063 -19411662815273 + -1 -19411662815274 Put together 1178412 and 0.00441. 1178412.00441 Subtract 6195 from 42550978283. 42550972088 Total of -0.24 and -81373634607. -81373634607.24 What is -278820607.926 less than -14? 278820593.926 0.073831248 + -273.542 -273.468168752 Work out 3 - 0.10926796421. 2.89073203579 -1.52 + 1060545.192225 1060543.672225 Work out -37073549733804 - 8. -37073549733812 What is 72.689739 minus 2900? -2827.310261 What is 0.2 + 10.0208731559974? 10.2208731559974 -4780031346+21053 -4780010293 What is 15527788 less than -6793377? -22321165 -0.01072 + -34861.655 -34861.66572 Work out 18235 - 7.28561. 18227.71439 Work out -1.01347491 + 206.5. 205.48652509 Work out 3146105004 - -8819. 3146113823 What is 519 plus -3427965780? -3427965261 What is 743261 take away -0.0709261? 743261.0709261 317 - 331.598982 -14.598982 Put together -59.09 and -108667.00839. -108726.09839 Work out -483775967.6 - 105.72. -483776073.32 Sum 2244.3249008 and -1. 2243.3249008 Subtract -2392996 from 91746.17. 2484742.17 What is 0.09789 less than 2769580.1? 2769580.00211 -41647 + 0.4484784 -41646.5515216 Work out 14803511 - 155.07. 14803355.93 What is -1.356548357457 take away -0.04? -1.316548357457 What is 2.6 take away 82258152625? -82258152622.4 Work out -0.083 + 2092202377.6. 2092202377.517 Calculate -0.3 - 1.4808964399028. -1.7808964399028 Add -1338.84003763 and 0.2. -1338.64003763 Subtract 27 from 104138439542. 104138439515 Work out 60 - -28548.15684866. 28608.15684866 What is the difference between 88.50319191 and 0.767? 87.73619191 Calculate -594494672913407 + 1. -594494672913406 What is -95857266 take away -4.798? -95857261.202 Calculate -0.15688195803 - 0.4. -0.55688195803 -3+-34934631074158 -34934631074161 Add -2.51332924 and 0.69. -1.82332924 Subtract 3858 from -83751837. -83755695 Put together -0.06 and -0.07050346922. -0.13050346922 What is 2859 take away 22217353982? -22217351123 What is 255282 less than 1247282? 992000 Add 0.7 and 1131834745.908. 1131834746.608 291640798 + 46322.7 291687120.7 Put together 3 and -2731999237549. -2731999237546 Calculate 17 + 775816.9184574. 775833.9184574 What is 19434282872 - 35085? 19434247787 105727.928049946+-0.2 105727.728049946 274069 - 13553.4799 260515.5201 What is the difference between -0.4 and 739454018942? 739454018942.4 Total of 0.11 and -0.03614000152352. 0.07385999847648 What is -1509678163.90638 minus -9? -1509678154.90638 What is 13.97 minus 61225.1083? -61211.1383 -0.23 + -10300852 -10300852.23 What is -13664239019177 take away 0.4? -13664239019177.4 Work out 0.4732 + 656282981. 656282981.4732 Work out -874.33538 - 17.1. -891.43538 Calculate -1.3 + -7851918560. -7851918561.3 What is -585.98108723994 - 0.5? -586.48108723994 -31091.663 - 23814.531 -54906.194 Subtract 251250 from -0.090065992. -251250.090065992 Sum -9279036586326 and -4.9. -9279036586330.9 Subtract 4.10953 from -2171143. -2171147.10953 What is 16851996 + 12684? 16864680 What is -0.68792813373 plus -521.2? -521.88792813373 Work out -5246935963 + -4.1. -5246935967.1 Sum 15536418822 and -15.4. 15536418806.6 What is 627910 less than 881552.31? 253642.31 What is the difference between 0.0508866381 and 0.359? 0.3081133619 What is 0.9 minus -8601233680? 8601233680.9 What is -1721035.7 less than 4424? 1725459.7 -24.3323465 - 162341 -162365.3323465 Work out -0.53 - -6650195946703. 6650195946702.47 What is 4177392.584054 less than 3? -4177389.584054 What is 230.27427493 less than 26? -204.27427493 Work out 2.591 - 25011798. -25011795.409 What is the difference between 0.0440865471801 and -24? 24.0440865471801 Subtract -446483830 from 7.305. 446483837.305 10+-4124228081 -4124228071 What is -75 + 11.0515074? -63.9484926 0.07+-	{ "pile_set_name": "DM Mathematics" }
ce jaaj. 1/14 Two letters picked without replacement from {h: 14, b: 1, c: 1}. What is prob of sequence bc? 1/240 Two letters picked without replacement from ilikkikklkikikk. Give prob of sequence ii. 2/21 Calculate prob of sequence mpoo when four letters picked without replacement from {p: 2, j: 1, m: 2, i: 1, o: 2}. 1/210 Two letters picked without replacement from gcgnccgcgnnngnngg. Give prob of sequence gc. 7/68 What is prob of sequence onob when four letters picked without replacement from otuuoonbnnuonn? 5/2002 Four letters picked without replacement from {i: 2, z: 2, b: 1, r: 3, h: 1, g: 3}. What is prob of sequence hzib? 1/2970 What is prob of sequence vpvj when four letters picked without replacement from {j: 2, d: 2, p: 3, v: 6}? 3/286 Two letters picked without replacement from kskesksmzkklsesk. What is prob of sequence ee? 1/120 Four letters picked without replacement from {u: 7, d: 2, c: 9}. Give prob of sequence uccc. 49/1020 Four letters picked without replacement from epessoezsszo. What is prob of sequence espo? 1/495 Three letters picked without replacement from {f: 5, b: 4, h: 2}. Give prob of sequence hbf. 4/99 Three letters picked without replacement from {f: 2, g: 1, n: 8, k: 6, i: 1, w: 2}. What is prob of sequence ing? 1/855 What is prob of sequence ddd when three letters picked without replacement from gddddddgddddgddd? 143/280 Four letters picked without replacement from {i: 1, t: 3, j: 3, n: 2, v: 1}. What is prob of sequence nnti? 1/840 Two letters picked without replacement from vvvevvvv. What is prob of sequence ve? 1/8 Two letters picked without replacement from {e: 4, v: 2, d: 5, f: 2, b: 1}. What is prob of sequence fe? 4/91 What is prob of sequence uu when two letters picked without replacement from zuzu? 1/6 Calculate prob of sequence eppe when four letters picked without replacement from epeppppepe. 1/14 Three letters picked without replacement from {g: 8, n: 2, b: 7, j: 2}. What is prob of sequence gnj? 16/2907 Three letters picked without replacement from zzuz. Give prob of sequence zuz. 1/4 Calculate prob of sequence qxq when three letters picked without replacement from {e: 5, s: 1, q: 3, x: 1, g: 1}. 1/165 Calculate prob of sequence cqq when three letters picked without replacement from {q: 7, p: 1, c: 3, l: 2, z: 2, v: 5}. 7/380 Four letters picked without replacement from jnjnnnbnvbnbb. Give prob of sequence bnjb. 6/715 Calculate prob of sequence eeaa when four letters picked without replacement from {a: 13, e: 5}. 13/306 Four letters picked without replacement from rvrvrvvvvvrvvjrj. Give prob of sequence jjvv. 3/910 Calculate prob of sequence dd when two letters picked without replacement from {d: 2, j: 2, c: 2}. 1/15 Calculate prob of sequence sh when two letters picked without replacement from {s: 8, h: 5}. 10/39 Four letters picked without replacement from iiiiiiiisiiiiii. Give prob of sequence sssi. 0 Two letters picked without replacement from dyydyyyyyyyyyd. What is prob of sequence yy? 55/91 Two letters picked without replacement from upqup. What is prob of sequence pq? 1/10 What is prob of sequence kak when three letters picked without replacement from kkkkkaaakaaaka? 7/52 Two letters picked without replacement from fncn. Give prob of sequence nc. 1/6 Three letters picked without replacement from {t: 2, f: 1, n: 1, v: 1, x: 1, h: 2}. What is prob of sequence htf? 1/84 What is prob of sequence pzqj when four letters picked without replacement from zlfjfplpflffpq? 1/8008 Calculate prob of sequence ws when two letters picked without replacement from {c: 1, s: 1, w: 1, l: 3, y: 6, z: 6}. 1/306 Calculate prob of sequence boo when three letters picked without replacement from {a: 2, b: 4, o: 2}. 1/42 What is prob of sequence jjj when three letters picked without replacement from {j: 4, m: 10}? 1/91 Four letters picked without replacement from qbbebeeqessbsq. Give prob of sequence eqeb. 6/1001 Calculate prob of sequence sgy when three letters picked without replacement from gyspssypg. 1/42 What is prob of sequence gf when two letters picked without replacement from {p: 13, f: 5, g: 2}? 1/38 Two letters picked without replacement from ysyhsyssshhss. Give prob of sequence hh. 1/26 Calculate prob of sequence mr when two letters picked without replacement from ysmhsqr. 1/42 What is prob of sequence gm when two letters picked without replacement from tgtgmio? 1/21 Two letters picked without replacement from {s: 12, t: 1}. What is prob of sequence st? 1/13 Four letters picked without replacement from rjtkktrtrkjtttt. What is prob of sequence kjrj? 1/1820 Calculate prob of sequence zxz when three letters picked without replacement from {x: 2, z: 2}. 1/6 Calculate prob of sequence wmy when three letters picked without replacement from lmwymxw. 2/105 What is prob of sequence vvv when three letters picked without replacement from ssvvsvvvvs? 1/6 What is prob of sequence fxm when three letters picked without replacement from dhmxhhhfhdfddhxdfdm? 2/969 Two letters picked without replacement from {u: 1, f: 10, q: 2, r: 3, i: 3}. Give prob of sequence iq. 1/57 Four letters picked without replacement from {k: 1, n: 1, g: 5, q: 1, x: 2}. Give prob of sequence gnkq. 1/1008 Four letters picked without replacement from hhxxkdtxxxxt. What is prob of sequence hthh? 0 Three letters picked without replacement from {l: 17, c: 2}. What is prob of sequence ccl? 1/171 Two letters picked without replacement from vvvvvvvvvxvvxvvvvvvv. Give prob of sequence xv. 9/95 Calculate prob of sequence ni when two letters picked without replacement from {i: 2, l: 1, w: 2, n: 4, p: 1}. 4/45 Two letters picked without replacement from {j: 1, h: 2, w: 1, b: 3}. What is prob of sequence jb? 1/14 Two letters picked without replacement from {n: 1, w: 13, k: 2, a: 1}. What is prob of sequence ak? 1/136 Four letters picked without replacement from sxbksrkrkbkkkssxbbrr. Give prob of sequence srrk. 4/1615 Four letters picked without replacement from yiyiyyyyiyyy. Give prob of sequence yyii. 2/55 What is prob of sequence km when two letters picked without replacement from {m: 1, v: 1, g: 1, k: 1, q: 1}? 1/20 Calculate prob of sequence cr when two letters picked without replacement from lylslrrcyyrryyy. 2/105 What is prob of sequence cz when two letters picked without replacement from {c: 1, b: 2, z: 1}? 1/12 Three letters picked without replacement from {k: 5, y: 1, c: 3, r: 1}. What is prob of sequence rcy? 1/240 Three letters picked without replacement from {g: 11, j: 3}. What is prob of sequence ggj? 55/364 Three letters picked without replacement from lddlnlltntut. What is prob of sequence nun? 1/660 Calculate prob of sequence mmm when three letters picked without replacement from mcmcwmkkccmck. 2/143 Two letters picked without replacement from {z: 1, h: 2, j: 1, o: 1}. Give prob of sequence hh. 1/10 What is prob of sequence lnln when four letters picked without replacement from llnxnlixil? 1/210 Three letters picked without replacement from bcvbq. Give prob of sequence bcc. 0 Calculate prob of sequence ovv when three letters picked without replacement from {o: 1, v: 4, n: 4, l: 1}. 1/60 Calculate prob of sequence ph when two letters picked without replacement from yhhppkhhppkypyp. 4/35 Three letters picked without replacement from {c: 7, t: 2, m: 2, o: 4, f: 2, b: 2}. Give prob of sequence bbt. 2/2907 What is prob of sequence uuu when three letters picked without replacement from uoooooouuouoouoouoo? 20/969 What is prob of sequence mmw when three letters picked without replacement from wtwmwwmwwmwwmmm? 8/91 Two letters picked without replacement from {r: 15, k: 3}. What is prob of sequence rk? 5/34 Calculate prob of sequence hu when two letters picked without replacement from {k: 1, w: 1, u: 2, g: 1, h: 1, d: 1}. 1/21 Two letters picked without replacement from {h: 1, t: 5, e: 2, y: 1, f: 1}. What is prob of sequence ey? 1/45 What is prob of sequence nnnb when four letters picked without replacement from nnnnbbbbbbb? 7/330 Calculate prob of sequence cci when three letters picked without replacement from {z: 1, i: 3, w: 3, c: 5, t: 1, y: 4}. 1/68 Three letters picked without replacement from {n: 1, l: 4, j: 7, t: 2, a: 1, m: 4}. What is prob	{ "pile_set_name": "DM Mathematics" }
t is w rounded to the nearest 100? -300 Let d = 7.798 - 7.7. Let n = d - 0.07. Round n to 2 dps. 0.03 Let q = 90 + -49. Let m = q + -41.058. Let d = m + 0.05823. Round d to 4 decimal places. 0.0002 Let m = -1.77 + 17.17. Round m to the nearest integer. 15 Let k be (-24)/(-16)74/(-3). Round k to the nearest 10. -40 Let a = 0.9561 - 3.6845. Let m = -0.729 - a. Let v = 2 - m. What is v rounded to four decimal places? 0.0006 Let h = 0.6 - 15.6. Let l = -14.9993 - h. Round l to four decimal places. 0.0007 Let q = 2309 - 197808. Let w = -124501 + q. What is w rounded to the nearest 100000? -300000 Let n be 1/(-2) + (-588)/8. What is n rounded to the nearest 10? -70 Suppose 5c - 8 = 3c. Suppose f - 3n - 20 = 0, 0f + 3n = -3f. Suppose 0 = 5x + p - 0p - 265, -cp + 265 = fx. What is x rounded to the nearest 10? 50 Suppose 3j = j + 8. Suppose -8y + 52000 = -jy. Round y to the nearest ten thousand. 10000 Let q(d) = 82144d + 8. Let l be q(-7). Let c be (l/3)/((-3)/(-72)). Round c to the nearest 1000000. -5000000 Let b = 154.999 + 0.001. Let f = b - 108. Let o = f + -46.99981. Round o to four dps. 0.0002 Let t be (-7661)/(1 + (-18)/17). Let c = -230237 + t. Let p be c/(-5)(0 + 550). What is p rounded to the nearest one million? 11000000 Suppose -4v = -8v + 12. Suppose 334020 = vr - 715980. Round r to the nearest one hundred thousand. 400000 Let m be (-114)/(-22) - (-10)/(-55). Let h be m/1 + (-2)/1. Suppose -2q = hn + 2q + 301, 5n + 4q = -491. Round n to the nearest 10. -100 Let k = -0.1803 + 0.188. Round k to 3 dps. 0.008 Let z = 1113886 + -1113882.280924. Let s = z + -3.359. Let i = s + -0.36. Round i to 5 dps. 0.00008 Suppose 26i + 9600 = 23i. Round i to the nearest 1000. -3000 Let a(k) = -k*2 - 6k + 2. Let i be a(-6). Let r be i - -1778(-1 - -2). Suppose -3p + r = -5p. What is p rounded to the nearest 100? -900 Suppose -5c + 32 = -1538. Suppose z - 366 - c = 0. What is z rounded to the nearest one hundred? 700 Let u = -0.689 - 0.121. Round u to one decimal place. -0.8 Let z = 20.942 + -9.408. Let c = z - 0.134. Let f = c + -5.3. What is f rounded to the nearest integer? 6 Let x = -4.5 - -6. Let k = 4.7 - x. Let i = k - 4. What is i rounded to 1 decimal place? -0.8 Let f = 10419782 - 4019782. Round f to the nearest one million. 6000000 Let t be ((-6700)/6)/((-9)/216). What is t rounded to the nearest one thousand? 27000 Let q = 14.5 - -44.5. Let p = 59.0054 - q. Round p to 3 decimal places. 0.005 Let q be 1 - (0/1 - 1). Suppose 6a - a + 649980 = 0. Let b be a/q + (-4)/2. What is b rounded to the nearest 10000? -70000 Let s = 0.06 + -0.06000013. What is s rounded to seven dps? -0.0000001 Suppose -4w + 444524 = -2w. Let j = w + -544262. Round j to the nearest ten thousand. -320000 Let q(t) = 6444t - 4. Let w be q(-9). Round w to the nearest ten thousand. -60000 Let f = 675382 - 382382. Round f to the nearest 10000. 290000 Let j = 392 - 346.8. Round j to the nearest integer. 45 Let h(z) be the second derivative of 27499z3/3 - z2 + 2z. Let c be h(-1). Round c to the nearest ten thousand. -60000 Let q = 17003.8659 + -17081.87. Let j = q + 78. What is j rounded to 3 dps? -0.004 Let r = 0 + 17. Suppose -r = q + n, 113 = -4q + 2n + 3n. Let j be (-4)/q + 128699994/33. What is j rounded to the nearest one million? 4000000 Let p = 3.6 + -3.455. Let o = 0.063 - p. What is o rounded to two dps? -0.08 Let o = -181 - -179.99875. Let d = o + 1. Round d to 4 dps. -0.0013 Let v be ((-20523)/9)/(1/(-2946)). Let i be (9528551 - 3)/4 - -1. Let q = v + i. What is q rounded to the nearest one million? 9000000 Let c = -2.705 - -2.8. Let n = c - 5.195. What is n rounded to zero decimal places? -5 Let y = -0.11 - 0.01. Let v = 1.18 + y. Round v to 1 dp. 1.1 Let l be (4/(-6))/(2/180882). Let v be l/(-9) + (-4)/(-6). What is v rounded to the nearest 1000? 7000 Let d = 0.194 - 0.194219. What is d rounded to five decimal places? -0.00022 Let t = -201 - -200.9901. Round t to three dps. -0.01 Let q = 44.0000072 - 44. What is q rounded to 6 decimal places? 0.000007 Let w be (-1)/3 - 28/(-12). Suppose 3l + 142 = -w. Let s = -84 - l. Round s to the nearest ten. -40 Let a = -0.054 + 0.714. Let f = -0.6 + a. Let b = -0.035 + f. What is b rounded to 2 dps? 0.03 Let n = -21 - -13. Let p = n - -8. Suppose pb - b = -480. What is b rounded to the nearest 100? 500 Let i = 29 + -9. Suppose 7f = 2f + i. Let k(g) = 150g. Let q be k(f). Round q to the nearest one thousand. 1000 Let b be (-275)/((-5)/10 - 0). What is b rounded to the nearest one hundred? 600 Suppose -149 = -3c + 4y, c + 0c - 47 = 2y. Suppose 20s - 15s + 145 = 0. Let w = c - s. What is w rounded to the nearest ten? 80 Let l = 10508 - -492. Suppose -6t = -4t - l. Round t to the nearest 1000. 6000 Suppose -p = -5p + 8. Let h(n) = -100 - 2n2 - n2 + 2np. Let k be h(0). Round k to the nearest one hundred. -100 Let t = -33 + 27.5. What is t rounded to the nearest integer? -6 Suppose -13599980 = -u - 0u. Suppose 5r = -2k + u, -6k + 3r = -k - 34000012. Round k to the nearest one million. 7000000 Let q be 3 + 2 + -6 + 209997. Suppose -5o + r = q, 23 - 7 = -4r. What is o rounded to the nearest 10000? -40000 Let m = -111 - -46. Let t = -64.9999926 - m. Round t to six decimal places. 0.000007 Let b = -0.34954 + 0.35. Round b to 5 decimal places. 0.00046 Let q be (0 + (-126)/4)1-6. Round q to the nearest ten. 190 Suppose 9 = 4a - 3. Suppose 227467 - 719492 = 3i + 5f, 5i - af = -819985. Round i to the nearest ten thousand. -160000 Let m = -0.256 - -0.084. Round m to 2 dps. -0.17 Let f = -167138 - -167145.4933. Let h = -4.5 - -12. Let p = f - h. What is p rounded to 3 decimal places? -0.007 Let v = 19.21 - 19. What is v rounded to one dp? 0.2 Let w = 466906 - -173073. Let c = w - 639975.00003. Let u = -4 + c. Round u to 5 decimal places. -0.00003 Let h be 41/(-2 - 21/(-9)). Let u be (3 - h)/((-5)/(-18750)). What is u rounded to the nearest 100000? -500000 Let i = -934.2874989 + 936.2875. Let m = -5 + 7. Let l = i - m. What is l rounded to six decimal places? 0.000001 Let y = 25.942 - 26. Let p = -157.942 + y. Let m = p - -158.0000069. Round m to six dps. 0.000007 Let s = -30.06 - 1.44. Let o = s + 25. Let d = o - -6.499933. Round d to 5 dps. -0.00007 Let i be (-3)/12 + 17/4. Suppose ig - 2c + 10 = 0, -2g = -5c - 4 + 13. Let w be ((-13600)/3)/(g/150). Round w to the nearest 100000. 300000 Let q = 8 - 5. Let j(b) = 3b + 15718b2 - b + 7614b*2 + 2b. Let p be j(q). Round p to the nearest one hundred thousand. 200000 Let a = -95.9 + 88.17. What is a rounded to 0 decimal places? -8 Suppose i = -i. Suppose i = 3n + 5f + 53985, -4n = 5f + 45086 + 26899. What is n rounded to the nearest 10000? -20000 Let j(z) be the third derivative of -163z6/4 + z5/30 + 5z4/24 - z3/2 - 6z2. Let h be j(3). Round h to the nearest 10000. -130000 Let q = -31 + 26.3. Let y = 4.6999979 + q. What is y rounded to 6 dps? -0.000002 Let u = -2 + 4. Suppose ui + 0i = 1082. Let r = i - 161. Round r to the nearest 100. 400 Let r = -25 - 4. Let j = r + 28.963. What is j rounded to two decimal places? -0.04 Let s = 16120 - 39120. Let w be 107/(7/s). Round w to the nearest one hundred thousand. -200000 Let f = 0.034 - 0.03458. Round f to 4 decimal places. -0.0006 Let f = 9.8 - 7. Let d = -2.3 + f. What is d rounded to 0 dps? 1 Let m(p) = -p - 1. Let h be m(-2). Let g be (-2996 - 2)h + -2. What is g rounded to the nearest ten thousand? 0 Let c = 191862.559958 - 191863. Let m = -0.44 - c. Round m to five dps. 0.00004 Let k = 5 + 0. Suppose -kr + 7 + 3 = 0. Suppose -ri + 188 = -4i. What is i rounded to the nearest 10? -90 Suppose 2u - 4u + 2b + 286002 = 0, -4u + b + 572001 = 0. What is u rounded to the nearest ten thousand? 140000 Suppose -p - 2w = 21, -p + 2p - 3w = -41. Round p to the nearest ten. -30 Let w = -17 + 20. Let y be 80000/w(-300)/8. Round y to the nearest 1000000. -1000000 Let u be (-50)/(((-4)/22)/1). Suppose 3x + 0l = -5l + u, 5l = -4x + 375. What is x rounded to the nearest one hundred? 100 Let o = -10 + 10.5. What is o rounded to 0 dps? 1 Let q(b) = 52b*3 + 8b*2 - 6. Let j be q(11). Suppose -2f - j = -4s + 221834, 4s - 291996 = -f. What is	{ "pile_set_name": "DM Mathematics" }
Is h a composite number? False Suppose d - 168 = -5d. Let o = d + 258. Suppose -4x + o - 74 = 0. Is x composite? False Suppose 6c = 19 - 1. Suppose -2u - 5y + 30 = 0, -2u + 2y + 46 = cy. Is u composite? True Suppose -g = 3h - 22307, 7h = 12h - 15. Is g a prime number? False Suppose 28n = 16n + 23316. Is n a composite number? True Is -37704/(-8) + -3 prime? False Let q = -15 + 40. Is (1 + -5 + q)/1 composite? True Suppose -6851 = -2k + 32211. Is k a prime number? True Is (17 - 22) + 1367 a prime number? False Let f(z) = -z*2 + 18z + 4. Let a be f(18). Suppose 0 = at - 2t - 298. Is t a composite number? False Suppose 3a - 9 - 3 = 0. Suppose 0 = -2c + ak + 387 + 35, 2c - 387 = -3k. Is c a composite number? True Let a = 10847 - 7134. Is a a composite number? True Let b = -3028 + -6778. Is 26/104 - b/(-16)-2 a composite number? True Suppose 5b - 17 = 2o, 0 = 2b + 3o - 2 - 1. Is b - (-8214)/13 - 6/(-39) a prime number? False Suppose 0b - 2m = -2b + 26, b - 3m - 19 = 0. Let q = 8 - b. Let d(t) = 67t2 + 4t + 3. Is d(q) composite? False Let b be 260 - 1 - (4 - 4)/(-5). Let q(k) = k3 + k2 - k + 298. Let i be q(0). Suppose -p + b = -i. Is p prime? True Suppose 5z - 8 = -a + 15, 2z + 48 = 4a. Suppose -2933 = -5i + s, 0 = 4i - 11s + as - 2352. Is i a composite number? False Let u(p) = 561p*2 + 6p - 10. Let f be u(2). Suppose 8x - 6x - f = 0. Is x a composite number? False Let r(y) = -6 + 8 + 461y - 5 - 9. Is r(3) a prime number? False Let k(y) = 5y*2 - 7y - 41. Let a be k(-7). Suppose 463 = 4u + 115. Let b = a - u. Is b composite? True Suppose -3n + 6m + 24 = m, -n + 15 = -4m. Suppose 5u - 25 = 25. Suppose 0 = -nq + 2 + u, 5o - 647 = -3q. Is o prime? True Let u be 10/(-45) + 245/9. Suppose 29a = ua + 622. Is a a prime number? True Suppose 2k + 14 = -4w, 5k + w - 35 = 5w. Suppose -q + 3y - 3 = 0, 4y - 4 = -kq - 0. Is q/(2 + 2) - -373 a prime number? True Let z be (-22)/4 + 5/(-10). Is 810 + -2 - (z - -5) a prime number? True Suppose 0 = 5h - u - 1 - 8, 4u + 6 = 5h. Suppose hp = -36 + 314. Suppose 0 = 4c - z + 3z - 516, -3z + p = c. Is c composite? False Let i be (2061/2 - 1)/(1/2). Let v = i + -560. Is v composite? False Suppose 2p - 561 = -3h + 630, h + 3p = 397. Let c = h - 186. Is c a composite number? False Let d(i) = -416i3 + i2 - 1. Let c be d(-1). Let h(f) = 255f2 - f + 1. Let t be h(2). Suppose -5p + c = -t. Is p prime? False Suppose -2l = l + 12, 4l = 5k - 941. Let n = 132 + k. Is n composite? False Suppose -2v + 4c = 2v - 40, 4c = -4v. Suppose -2438 = -vf + 3147. Suppose 6u - 653 = f. Is u a composite number? True Let m be 142/12 - (-3)/18. Let h be (2 - 2)/(m/6). Is (2 + h)(-3609)/(-18) a prime number? True Let t = 81 + 24. Is ((-2961)/t)/((-2)/10) a prime number? False Suppose -4u = 2l + 746, -2u - 3l - 365 - 10 = 0. Let q = -47 - -29. Is (-2)/6 + u/q a composite number? True Let f = 92 + -76. Let r(x) = 8x*2 + 18x + 38. Is r(f) prime? False Let q(t) = -1 + 15t3 - 6t*3 - t + 5t*2 - 8t*3. Let h be q(-5). Suppose -o = -hy + 564, -118 - 23 = -y - 3o. Is y a prime number? False Suppose 360 = -9q + 4q. Let c = q - -406. Is c prime? False Suppose -12732 - 6676 = -8l. Suppose -l = 5q - 7q + 2h, 2h - 8 = 0. Is q a composite number? False Suppose -14v + 11v = -y + 17678, -4v = 2y - 35326. Is y a prime number? True Let a(l) = l*3 + 6l*2 + 3l - 12. Let s be a(9). Let z(u) = -4u3 - 2u*2 + u. Let r be z(5). Let n = s + r. Is n a prime number? False Suppose -2p + 39 = p. Let x = p - 16. Is (246/x1)/(-1) composite? True Let u(l) = 10l*2 + l - 5. Let t be u(3). Suppose z - t = 834. Is z prime? False Let s(q) = -5q + 4. Let o be s(-6). Let l be (165/10)/(-11)-2. Suppose -t - l = -o. Is t composite? False Let a = -38 + 31. Let r(w) = w3 + 8w*2 - 2w - 4. Let d be r(a). Let y = d + 68. Is y prime? True Let i be 1 + (-1)/1 + 1130. Suppose -3h - 137 = -i. Is h a composite number? False Let w = 3687 + 320. Is w composite? False Suppose x = 5, -5a - 5x + 494 + 401 = 0. Suppose -2q + a - 8 = 0. Is q composite? False Let l(n) = n*3 + 14n*2 + 22n - 16. Let p be l(-12). Suppose -pu = -59 - 989. Is u composite? False Is (-5 - 15528/20)/(1/(-5)) a prime number? True Let y(o) = -o2 + 2o + 15. Let r be y(-3). Suppose rm + 2m = 1262. Is m a composite number? False Let v(w) be the first derivative of 0w + 77/3w*3 + 0w*2 - 2. Is v(1) a composite number? True Suppose -3s - f = -87, 4s + s = -3f + 141. Suppose -2b = -3y + 17, 4y = -y + 5b + s. Suppose -yj - 21 = -l + 38, 0 = -l - 5j + 79. Is l composite? True Let t be 2/(-1)(-8019)/18. Let j = 814 + 1044. Let n = j - t. Is n a composite number? False Let a(l) be the third derivative of -37l4 + l3/6 + 27l2. Is a(-1) prime? False Let k = 792 - -8845. Is k composite? True Let d = -7 - -12. Suppose 2o = -3o + 10. Suppose 0 = 5n + dl - 1665, 5n - 5l = -ol + 1649. Is n prime? True Let w = -45323 - -92224. Is w a prime number? True Let o(s) = -3s2 - 5s + 14. Let y be o(-7). Let m = y - -255. Is m a prime number? True Let w(d) = -d + 6. Let i be w(2). Suppose 0g - 44 = -g + 3x, -ig = x - 241. Is g prime? True Let c(l) be the first derivative of -37l*2/2 + 6l - 16. Is c(-9) composite? True Let o be -515/25-1. Suppose 4z = 4p + 8272, op = 3z + z - 8267. Is z prime? True Let d(x) = -2x3 - 8x*2 + x + 29. Is d(-14) a prime number? False Suppose -2s + 4s - 4844 = 0. Let j = -1080 + s. Suppose -2n - 2d = -j, 2n - 3d - 2025 = -n. Is n a prime number? True Suppose 0 = -5h + 2n + 84543, -5h + 59446 + 25101 = 2n. Is h a prime number? False Let y = 8885 + -5874. Is y a prime number? True Let k = -172 - -176. Is (((-18)/k)/(-9))/(2/3572) prime? False Let l(i) = -34i + 4. Let u be l(-1). Suppose 5t + 13 = u, 0 = 4a - 3t - 989. Is a a composite number? False Let r(g) = 222g*2 + 2g - 1. Let a be r(1). Is (a - 4) + (4 - 0) composite? False Is (1 - 0)11146 - (5 - 8) composite? False Let u(d) = 81d*2 + 40d - 332. Is u(21) a composite number? False Suppose 0 = -5v + 17r - 14r + 197080, -5r = 3v - 118282. Is v a composite number? False Let y(u) = 24u*2 - 3 + 6 - 3 - 3. Is y(4) prime? False Let w = 32561 + -16260. Is w a prime number? True Let f(z) = -2z*3 + 2z*2 - 4z + 15. Let i be f(-9). Is 1/(-4 + 6687/i) a composite number? False Suppose 5k - 98 = -2x, 0 = -3x + k + 2k + 168. Let l(s) = 57s + 5 + 8s*2 - xs + 6s2. Is l(-2) prime? False Suppose 5o = -4m + 33, -2m - 2o + 37 = 3m. Suppose -5v + mv = 218. Is v prime? True Let b = -4424 + 8917. Is b prime? True Suppose -13l = -9l - 36. Suppose -lo + 5o + 1228 = 0. Is o prime? True Is (-1)/4 + 3915540/144 prime? True Let a(t) = 948t2 - 13t + 93. Is a(4) a prime number? False Let a be (-185)/(-20) - 2/8. Suppose -a = 3q - 0q. Is 428 - 1/(-3)q a composite number? True Suppose 2d - 15 = p, 31 = 4d - 2p - p. Let u = d + -2. Suppose 2x - 211 = -us, 0 - 1 = -s. Is x prime? True Is (5/10-46)/((-11)/4939) composite? True Let r = -8 + 13. Suppose -5j - 2b = -3b - 17, 2b = -rj + 11. Is 187 - (2 - 2)/j a prime number? False Suppose -2s + 3s - 32 = 0. Is s + -3 + (1 - -5) composite? True Suppose 0 = 55s - 52s. Suppose -3q - u + 2609 = s, -q - 5u = -5q + 3466. Is q a prime number? False Let x(n) = 182n*2 + 5n - 4. Is x(5) a composite number? True Suppose -3i + 11086 = -17147. Suppose -i = -17r + 14r. Is r composite? False Is 240/48 - (-7560 + 2)/1 prime? False Is -990971(-7)/147 + (-8)/84 a prime number? True Suppose -12056 = -3x - 3773. Is x a composite number? True Is (-2)/(-21) + 986323/273 a prime number? True Let f = -28263 + 60177. Is (-1)/(4 - f/7978) prime? True Is 6/(-12) + (-4 - (-160822)/4) a composite number? True Let z(q) = 19q*3 + 24q*2 + 2q - 16. Is z(7) prime? True Suppose 3f - f - 2 = 0. Suppose s - 5i + 19 = 0, 2s - s + 4i + f = 0. Is (53/2)/(s/(-18)) a composite number? False Let w be 529/3 + 8/12. Suppose 0 = -3t - 7q + 2q + w, -4t = -2q - 236. Is t a prime number? True Let q(u) = 18u*2 - 2u - 3. Let o be q(-4). Suppose 2z - 139 = -r, -z = -0r + 2*r - o. Is r a prime number? True Le	{ "pile_set_name": "DM Mathematics" }
How many millennia are there in 5717.976 years? 5.717976 How many nanograms are there in 11/2 of a microgram? 5500 What is 56.65901 centimeters in nanometers? 566590100 What is 760.7001mg in kilograms? 0.0007607001 How many centuries are there in 6.287754 decades? 0.6287754 What is 113181.1 decades in millennia? 1131.811 What is 42.2952 nanometers in kilometers? 0.0000000000422952 What is 3.6269 micrometers in nanometers? 3626.9 Convert 36165.07m to nanometers. 36165070000000 How many microseconds are there in eighteen fifths of a millisecond? 3600 How many millimeters are there in 71/5 of a meter? 14200 Convert 0.9245359ml to litres. 0.0009245359 What is 1706.02g in micrograms? 1706020000 How many millilitres are there in one fifth of a litre? 200 Convert 50.19745 seconds to nanoseconds. 50197450000 What is 1/15 of a hour in seconds? 240 What is 4439.424km in centimeters? 443942400 What is thirty-seven fifths of a millennium in months? 88800 How many micrograms are there in 3/40 of a gram? 75000 How many months are there in four thirds of a century? 1600 How many milligrams are there in one tenth of a kilogram? 100000 How many months are there in 3/40 of a decade? 9 What is 1/5 of a minute in milliseconds? 12000 Convert 5.153956 kilograms to micrograms. 5153956000 How many micrograms are there in 3666.736 tonnes? 3666736000000000 What is twenty-one fifths of a century in months? 5040 Convert 67.61013 minutes to milliseconds. 4056607.8 What is 3/32 of a meter in micrometers? 93750 How many millilitres are there in fifty-one halves of a litre? 25500 How many millilitres are there in three fifths of a litre? 600 What is 13/5 of a litre in millilitres? 2600 How many hours are there in 5/6 of a week? 140 How many months are there in twenty-nine thirds of a year? 116 How many nanometers are there in 320564.6km? 320564600000000000 Convert 760019.3 nanometers to kilometers. 0.0000007600193 What is 54/5 of a litre in millilitres? 10800 What is fifty-four fifths of a litre in millilitres? 10800 How many years are there in 825.6827 millennia? 825682.7 What is 7685.618mm in centimeters? 768.5618 How many litres are there in 2309.225 millilitres? 2.309225 What is 6/25 of a minute in milliseconds? 14400 What is 6/25 of a kilogram in grams? 240 What is 468272.9 years in decades? 46827.29 Convert 0.9131276mg to tonnes. 0.0000000009131276 How many seconds are there in 4/15 of a hour? 960 What is 91/2 of a decade in years? 455 Convert 1.085736 tonnes to milligrams. 1085736000 How many microseconds are there in 1/10 of a millisecond? 100 What is twenty-nine fifths of a litre in millilitres? 5800 How many weeks are there in 3240.69417 nanoseconds? 0.000000000005358290625 What is fifty-seven halves of a gram in milligrams? 28500 Convert 77464.7l to millilitres. 77464700 Convert 0.7403859 centuries to months. 888.46308 How many millimeters are there in 1/5 of a centimeter? 2 How many millilitres are there in 1/4 of a litre? 250 What is seven thirds of a millennium in months? 28000 How many millilitres are there in 7/8 of a litre? 875 What is 939.8821 years in millennia? 0.9398821 What is eight fifteenths of a hour in seconds? 1920 How many months are there in 7.737074 decades? 928.44888 Convert 6.830981 litres to millilitres. 6830.981 Convert 706673.1 microseconds to milliseconds. 706.6731 What is 888519.6ml in litres? 888.5196 How many micrometers are there in 634.9198km? 634919800000 What is 25/2 of a milligram in micrograms? 12500 How many years are there in 8/25 of a millennium? 320 What is 482678.8 decades in millennia? 4826.788 How many seconds are there in 4/15 of a minute? 16 How many millimeters are there in eighty-nine halves of a centimeter? 445 What is 1546.229 centuries in decades? 15462.29 Convert 214.946 micrograms to grams. 0.000214946 How many litres are there in 8295.04 millilitres? 8.29504 Convert 5.640231 months to years. 0.47001925 How many grams are there in 3/40 of a kilogram? 75 What is 6.549132ng in milligrams? 0.000006549132 Convert 0.512584l to millilitres. 512.584 Convert 206573.22 days to weeks. 29510.46 What is 11/8 of a week in hours? 231 How many meters are there in twenty-one eighths of a kilometer? 2625 What is sixty-one quarters of a millennium in decades? 1525 What is 1/5 of a millennium in years? 200 What is 1/4 of a litre in millilitres? 250 How many micrograms are there in 6/5 of a milligram? 1200 How many millilitres are there in one fifth of a litre? 200 How many milligrams are there in seventeen halves of a gram? 8500 Convert 73.65345ug to tonnes. 0.00000000007365345 How many micrograms are there in one sixteenth of a gram? 62500 What is 3/50 of a litre in millilitres? 60 How many milligrams are there in 7.702711 kilograms? 7702711 How many nanograms are there in thirty-one fifths of a microgram? 6200 What is 7071.43 seconds in nanoseconds? 7071430000000 Convert 0.6471095 years to months. 7.765314 What is 11/4 of a kilogram in grams? 2750 What is fifteen quarters of a meter in centimeters? 375 Convert 0.9048796 kilometers to centimeters. 90487.96 What is twenty-seven quarters of a litre in millilitres? 6750 What is 54/5 of a litre in millilitres? 10800 How many grams are there in 475.5709 micrograms? 0.0004755709 How many millilitres are there in 11/4 of a litre? 2750 How many micrometers are there in 17/2 of a centimeter? 85000 Convert 13065.144 milliseconds to minutes. 0.2177524 Convert 14070.90069s to weeks. 0.023265378125 Convert 584085.7 millilitres to litres. 584.0857 How many millimeters are there in seventeen halves of a meter? 8500 What is 3/5 of a centimeter in micrometers? 6000 What is 13/5 of a litre in millilitres? 2600 Convert 59.27825 millilitres to litres. 0.05927825 How many tonnes are there in 0.5805546 nanograms? 0.0000000000000005805546 Convert 0.5565078 seconds to milliseconds. 556.5078 How many minutes are there in 31/2 of a hour? 930 How many seconds are there in 3/16 of a hour? 675 How many micrograms are there in fifteen quarters of a milligram? 3750 What is 13/5 of a millennium in decades? 260 How many millilitres are there in 9/10 of a litre? 900 How many kilograms are there in 0.7329544 nanograms? 0.0000000000007329544 How many milligrams are there in eleven halves of a gram? 5500 Convert 537429.3 nanometers to kilometers. 0.0000005374293 How many months are there in one quarter of a century? 300 What is 524.8064ml in litres? 0.5248064 What is 869.448 centuries in months? 1043337.6 How many millilitres are there in 1.836458l? 1836.458 How many micrograms are there in 99319.11kg? 99319110000000 How many years are there in twenty-one quarters of a century? 525 What is 1.1383947s in minutes? 0.018973245 Convert 6524920.71ns to weeks. 0.000000010788559375 Convert 201923.2l to millilitres. 201923200 How many millilitres are there in three eighths of a litre? 375 What is 893.155ml in litres? 0.893155 What is 5363.537 centuries in decades? 53635.37 Convert 13.58008l to millilitres. 13580.08 How many grams are there in fourty-eight fifths of a kilogram? 9600 What is 19/4 of a hour in minutes? 285 How many litres are there in 46.09843ml? 0.04609843 What is 31/2 of a litre in millilitres? 15500 What is 773.7198ns in minutes? 0.00000001289533 What is nine tenths of a hour in seconds? 3240 How many months are there in 5/4 of a millennium? 15000 How many kilometers are there in 59109.4 micrometers? 0.0000591094 Convert 641511.9ms to hours. 0.17819775 What is 1/6 of a minute in seconds? 10 How many kilograms are there in 41/2 of a tonne? 20500 How many nanometers are there in one sixteenth of a millimeter? 62500 What is 142896.84 milliseconds in minutes? 2.381614 How many centimeters are there in eighty-nine halves of a meter? 4450 How many millilitres are there in thirty-two fifths of a litre? 6400 What is 51/4 of a microgram in nanograms? 12750 What is twenty-six fifths of a microsecond in nanoseconds? 5200 How many decades are there in 1/5 of a century? 2 What is 3/10 of a centimeter in micrometers? 3000 Convert 572.5046um to nanometers. 572504.6 What is 2287.794 millilitres in litres? 2.287794 Convert 3.003798 centuries to millennia. 0.3003798 What is 768.665 years in millennia? 0.768665 How many mi	{ "pile_set_name": "DM Mathematics" }
4) + 3 - b*5 - 3 - 3b*4 - 2b*5 + 3b4 + (b3 - b3 + b3)(-b2 + 0b2 - b2) + 0b + 0b - b*5. -3b*5 Expand 6w*5 + 0w*4 + 0w4 + w5 + 0w + 0w + (w2 - w2 + w*3)(-2w2 + 3w*2 + 0w*2) - 3w5 - w5 + 6w5. 10w*5 Expand (-1 + 3 - 1)(0j4 + 0j*4 - 2j*4 + (-2j + 0j + j)(2 - 2 - j*3) - 4j4 - j2 + j*2). -5j*4 Expand (0c*3 + 0c*3 + 2c*3)(0c + 2c - 10c)(-3 + 3 + 2). -32c4 Expand (-4j + 2j + 3j + (2 - 3 + 2)(-j - j + j) + 6j - 3j - j)((1 - 1 + 1)(6 - 4 + 0) - 3 + 1 + 5). 10j Expand (7q2 + 4q - q - q)(-q2 + 0 + 0) - q4 + q4 - 2q*4. -9q*4 - 2q3 Expand (-g4 + 4g - 4g)(51 - 1 - 5). -45g*4 Expand 6 + 162c - 79c - 81c - 2c - 3 + 3 + (-c - 2 + 2)(-4 - 1 + 4). c + 6 Expand (7c - 3c - 2c)(-4 - 3 + 5)(6c + 5 - 5). -24c2 Expand ((-l + l + l)(-3 + 0 + 5) + 0l + 3l - l + 9 - 9 + 5l)(4l2 + 5l - 5l). 36l*3 Expand (-6 + 3 - 1)(-2n4 + 2n4 - n4) + (-2n - 1 + 1)(-2n3 - 3n*3 + 4n3) + n4 + 0n3 + 0n*3. 7n*4 Expand ((-1 - 4 + 3)(5 - 3 - 3) + (1 - 2 + 0)(-4 + 3 + 2))(9 - 4 + 3u + 2u). 5u + 5 Expand ((3 + m - 3)(-5 + 1 + 3) + 4m - 4m + 2m)(-875 - 50m2 + 875). -50m*3 Expand (-2w2 - w2 + 0w2)(0w + 0w - w) + 2w2 + 2w - 4w2 + w3 + 0w. 4w3 - 2w*2 + 2w Expand 16x + 34x + 2x + 0 - 2x + 0 + (-1 + 5 - 5)(0 + 2x + 0) - 3 + x + 3. 49x Expand 3c + 3c - 7c + 4c - 3c + 0c + (2 + 2c - 2)(1 + 2 - 1) - 2c + c + 0c + (-4 - 2c + 4)(5 - 1 + 0). -5c Expand -3 - 2g5 + 3 + 3g*5 - 5g*5 + 5g*5 - 2g5 - g2 + g*2 + (0g5 + g5 + 0g5)(-1 + 5 - 1). 2g5 Expand ((2n - 3 + 3)(-3 - 2 + 7) - 2 + 2 + n)(4n2 + 3n*2 - 2n*2). 25n*3 Expand -2 + 2i + 2 + 5 + (4 - 5 + 0)(2i - 4i + 0i). 4i + 5 Expand (4g - 4g - 5g)(-24g - 404 + 404). 120g2 Expand (40 - 40 + 7u*2)(-2 - 2 + 6)(u - 3u + 3u). 14u*3 Expand (-4p + 0p + 2p)(1 - 6p - 1). 12p2 Expand (2q*4 + 0 + 0)(67 - 67 + 34q). 68q*5 Expand 3q*2 - 6q*2 + 2q*2 + (3 - 2 - 2)(3q + 0q + 2q)(-3q + 0q + 2q). 4q2 Expand (n2 - n*2 - 2n*2)(-6n2 - 5n + 5n) + n4 - 4n*4 + 4n*4 + (-n - n - 2n)(2n*3 + 3n*2 - 3n*2). 5n*4 Expand (-i + 3i - i)(-i2 - 2i*2 + 0i2) + i3 + i3 - i3. -2i3 Expand (2z*4 - 2z*4 - 4z*4)(-5z + 2z - z)(-5 + 0 + 4). -16z*5 Expand 1 + 3l*2 - 1 + (-2 - 1 + 1)(-2l2 - 4l + 4l). 7l*2 Expand (-50h + 38h + 41h)(-h + 4h - h) + h2 - h2 - h*2. 57h*2 Expand (5q*3 - 4q*3 - 3q*3)(q + 2q - 2q) - 17q4 - 4 + 4. -19q*4 Expand (0n + n - 3n)(0n + n + n) - 3n*2 + 3n*2 + 15n - 2n2. -6n*2 + 15n Expand (-3 + 1 + 1)(-4t*2 + 4t*2 - 2t2) + t2 + 0t2 + 2t*2 + (-2t + 0 + 0)(1 + 2t - 1). t*2 Expand (2f*2 + 3f*2 - 3f*2)(2f + 3f - f) - 2f3 - 5 + 5 - 2f*3 + 0 + 0. 4f*3 Expand (8 + 0 + 1)(-z + 2z2 + 0z*2 + 2z)(0z + 0z + 2z*2)(2 + 1 - 2). 36z4 + 18z*3 Expand 6o*2 - 8o*3 - 6o*2 + (0o - o*2 + 0o)(-4o + 4o - o) - 3o*3 - 4 + 4. -10o*3 Expand (-2p - 2 + 4p + 3)(31p3 + 10p*3 - 13p*3). 56p*4 + 28p*3 Expand -4 + 4 - f + ((-1 - 1 + 0)(1 - 1 - 2f) - 2f + f - f)(2 - 1 - 2). -3f Expand (-2 - k*2 + 2)(31k + 1 - 31k - 6k2). 6k4 - k2 Expand -62u + 5u*2 + 62u + (-u - 3u + 2u)(-u - u + 3u) + (-2u + 0u + 0u)(u - 4u + 0u). 9u2 Expand (-3h*3 - 15h + 15h)(4 - 1 - 2) - 2h2 + 2h*3 + 2h2. -h3 Expand (2c2 - c2 - 3c*2)(16c - 14c - 7c + (-c - 2c + 4c)(4 - 3 + 1)). 6c3 Expand (0 + 0 + 2 + (5 - 2 - 2)(-3 - 1 + 5))(3q - 4q - 2q)(-364q + 16q2 + 364q). -144q3 Expand (-2x3 + x3 + 4x3)(0x - 5x + 3x) - 4x*4 + 2x*4 + 4x*4 - 6x4 + x4 + 3x4. -6x*4 Expand (1 - 1 - 3)(0g - 4g + 2g)(2g3 + 0g3 - g3). 6g4 Expand (r - 13r*2 + 32r*2 - 18r*2)(0r2 + 2r2 - r3 + 2r3). r5 + 3r*4 + 2r*3 Expand 4g5 + g5 - 6g5 + (6g - g - g)(0g4 - g4 + 0g4). -5g*5 Expand (6 - 6 + n)((1 - 1 - 2)(-7 + 7 - 3n3) + n3 + 2n3 - n3). 8n*4 Expand (3 - 3 + 3y)(1 + 2 - 15). -36y Expand 11l2 + 0l*2 + 0l*2 - 4l*2 + 4l2 - l2 + (0 + 2 + 0)(5l2 - l2 - 2l2) - l2 - 4l + 4l + l2 - 5l*2 + 3l*2. 12l*2 Expand (17y - 3y + 0y)(2y - 5 + 5). 28y2 Expand (3w - 7w + 3 - 4)(2w + 5w - w). -24w2 - 6w Expand (-6u3 + u3 + 3u*3)(5 - 5 - 2u) + 2u*4 + 0u*3 + 0u*3 - 2u*4 + 3 - 3 - 5u4 + u4 - 13u4. -13u4 Expand (c2 - c*2 - 2c*4)(3c + 3c - 5c) - 9c*3 + 9c*3 - 8c*5 + 3c*5 + 3c*5 - 4c*5. -8c*5 Expand 5v2 - v2 - 2v2 - 2v + v*2 + 2v - 2v2 - v2 + v2 + (-2v*2 + 4v*2 - 4v*2)(2 - 2 - 3). 7v2 Expand (0 + 2 + 4)(3z + z - 6z)(3z - 3z + 2z). -24z2 Expand (6g - 4g + 0g)(-1 - 1 + 0) - 1 + 1 - g + 1 - 2 - 2g - 3g. -10g - 1 Expand (-2s + 3s + 2s)(-1 + 2 + 0)(s + 1 - 1). 3s*2 Expand (-i + i + 3i + (-3i + 3i - i)(3 - 4 - 1) + i - i + 2i)(i + i - 5i). -21i2 Expand (0z*3 + 3z3 - z3)(-6 - 5 + 5) + 3z*3 - 2 + 2. -9z*3 Expand (-5 + 2 + 1)(0n2 + 2n*2 - 3n*2)(-2n + 3n + 5n). 12n*3 Expand (j - j + 3j)(1 - 5j - j - 3j). -27j*2 + 3j Expand (-3 + 4 - 2)(-4b*5 + 4b*5 - 2b*5) - 6b*5 + 20b - 20b + 0b*5 + 0b5 - b5 + (b*4 + 0b*4 + 0b*4)(2b + 2 - 2). -3b*5 Expand (234h + 21h3 - 234h)(0 + 0 + 2)(-1 + 1 + 2). 84h3 Expand (-u2 + 5u*2 - 3u*2)(-2 + 10 + 1). 9u2 Expand 2j*2 - 4j + 4j + (-2j + 4j - j)(4j - 6j + j) - 4j2 + 4j*2 + 2j*2 + 0 + 0 + 2j2 + 0 + 0 - j2 - 198j2 - 203j*2 + 464j*2. 67j2 Expand -f3 + 0 + 0 + (3f - 4f - f)(0f*2 - 2f2 + f2) + 2f3 + 0 + 0 + 110f - 110f - 14f*3. -11f*3 Expand (-10 - 10 - 9n + 17)(2n*3 - 2n*2 + 2n*2). -18n*4 - 6n*3 Expand (2a3 - a2 + a*2)(-2a - a + 6a) + 7a - 7a - 3a4. 3a*4 Expand -2g*5 - 2g*5 + 3g5 + g5 + 0g5 + 0g5 + (g5 + g - g)(0 + 4 - 3) - 183g*2 + 183g*2 - 21g*5. -20g*5 Expand 2d*3 + 0 + 0 + (-22 + 22 - 7d*2)(-2d + 2d + 2d) + 0d*2 + 3d*3 + 0d*2. -9d*3 Expand (-14 + 4 + 3)(-2d + 0d + d). 7d Expand (-3z*3 - 3z3 + z3)(2z - 5z + 6z). -15z4 Expand 3t - 3t + 2t + (-t - 2t + 4t)(-1 - 2 + 1) - 4t + 2t + 0t + (-1 - 2t + 1)(7 + 3 - 2). -18t Expand (0b + 0b - 2b*2)(-2 + 1 + 0)(-14b - 6b3 + 14b). -12b5 Expand (2u - 2u + 2u)(2 - 1 + 4) - 18 + 32 + 4u - 12. 14u + 2 Expand 7k5 - k5 - 4k5 + (-1 + 0 - 2)(-5k5 + 0k*5 + 3k*5). 8k*5 Expand (-2 + 0 + 0)(5s2 - 5 - 2s*2 - 4s*2). 2s*2 + 10 Expand (0k + 3k - k)(10k4 + 10k - 3k - 5k). 20k5 + 4k2 Expand 1 + u4 - 1 + (-u3 + u3 + 2u3)(-u - 4u + 2u) + (u2 + u3 - u*2)(2u + 1 - 1) + u + u4 - u. -2u*4 Expand (3f - 6f + 2f)(-1 + 1 + 3f)(-1 - 1 + 3). -3f*2 Expand (-f + f + f)(2 + 3 - 2) - 2 + 2 + 3f. 6f Expand ((-3 + 2w + 3)(0 + 4 - 2) - w - 4w + 3w + (2w + 3w - 6w)(-2 + 5 + 14))(5w*2 + 0w*2 - 3w*2). -30w3 Expand p5 - 4 + 4 + (4p - 4p - p*3)(0p2 + p2 - 4p*2). 4p5 Expand (w2 - 5w2 - 2w*2)(-w + 0w + 3w). -12w3 Expand ((-2 - 2 + 3)(-2 + 2 - 2l) + 5l - 4l + l)(-46 + 46 + 2l). 8l*2 Expand -5b*3 + 5b3 + b3 + (-3b - 3b + 4b)(0 - 2b2 + 0). 5b*3 Expand (-3q*3 + 4q*3 + 0q*3)(26q2 + 16q - 16q) - 13q*2 + 13q2 + q5. 27q5 Expand (-1 + 3 - 3)(-13t + 13t - 6t2 + 0t*2 + 4t*2 - 3t*2 + (-t + 0t - t)(0 - 2t + 0)). t*2 Expand (15u - 15u + 10u*2)(5 + u - 8u + 8u). 10u3 + 50u*2 Expand -755m - 17m2 + 755m + (-2 + 3 - 3)(-2 + 4 + 0)(-2m2 + m - m). -9m*2 Expand -8f*2 + 8f*2 - 5f*5 + 5f*5 - 2f5 - f5 - f*5 - 2f5 + f5 + (3f2 - 2f2 + f2)(f - f + 2f3). -f5 Expand (m - 4 + 4)(m - 3m - 2m)(32 - 11m2 - 32). 44m*4 Expand -3h*2 - 13h*5 + 15h*5 + 2h*2 + (2h - 2h + h2)(-h*3 - 4h*3 + 3h*3) - 3h5 + h5 + 3h5. h5 - h2 Expand (0g + 4g - 5g)((-2 - 3 + 2)(-2 + 1 + 3) +	{ "pile_set_name": "DM Mathematics" }
the ten thousands digit of 47050? 4 What is the tens digit of 30350? 5 What is the tens digit of 41475? 7 What is the ten thousands digit of 157447? 5 What is the thousands digit of 4228? 4 What is the thousands digit of 1781? 1 What is the ten thousands digit of 42325? 4 What is the tens digit of 6209? 0 What is the hundreds digit of 251? 2 What is the thousands digit of 13937? 3 What is the tens digit of 684? 8 What is the thousands digit of 5527? 5 What is the hundreds digit of 6768? 7 What is the units digit of 100293? 3 What is the units digit of 4209? 9 What is the ten thousands digit of 10765? 1 What is the hundreds digit of 2062? 0 What is the ten thousands digit of 24592? 2 What is the hundreds digit of 12257? 2 What is the thousands digit of 7017? 7 What is the hundreds digit of 4478? 4 What is the tens digit of 797? 9 What is the hundreds digit of 21599? 5 What is the units digit of 11432? 2 What is the hundreds digit of 98620? 6 What is the hundreds digit of 2003? 0 What is the hundreds digit of 2038? 0 What is the hundreds digit of 20450? 4 What is the hundreds digit of 27511? 5 What is the tens digit of 13885? 8 What is the thousands digit of 1251? 1 What is the tens digit of 60980? 8 What is the hundreds digit of 45213? 2 What is the units digit of 3784? 4 What is the tens digit of 1950? 5 What is the hundreds digit of 14790? 7 What is the tens digit of 9122? 2 What is the units digit of 3044? 4 What is the tens digit of 52? 5 What is the thousands digit of 4324? 4 What is the tens digit of 10518? 1 What is the units digit of 3643? 3 What is the hundreds digit of 8285? 2 What is the units digit of 194? 4 What is the tens digit of 3265? 6 What is the tens digit of 17? 1 What is the tens digit of 31548? 4 What is the hundreds digit of 1730? 7 What is the tens digit of 22170? 7 What is the hundreds digit of 4416? 4 What is the hundreds digit of 2808? 8 What is the hundreds digit of 8426? 4 What is the ten thousands digit of 20089? 2 What is the hundreds digit of 14010? 0 What is the tens digit of 49309? 0 What is the units digit of 23139? 9 What is the tens digit of 3993? 9 What is the tens digit of 1235? 3 What is the ten thousands digit of 41736? 4 What is the units digit of 229? 9 What is the units digit of 203? 3 What is the units digit of 5106? 6 What is the thousands digit of 4323? 4 What is the tens digit of 8499? 9 What is the units digit of 40709? 9 What is the hundreds digit of 4073? 0 What is the thousands digit of 3935? 3 What is the units digit of 239? 9 What is the hundreds digit of 1098? 0 What is the thousands digit of 4287? 4 What is the units digit of 692? 2 What is the tens digit of 10653? 5 What is the tens digit of 3244? 4 What is the hundreds digit of 16640? 6 What is the units digit of 2221? 1 What is the units digit of 4533? 3 What is the tens digit of 11745? 4 What is the thousands digit of 19055? 9 What is the thousands digit of 18618? 8 What is the units digit of 694? 4 What is the tens digit of 2529? 2 What is the tens digit of 828? 2 What is the thousands digit of 1121? 1 What is the units digit of 109? 9 What is the units digit of 37592? 2 What is the tens digit of 5105? 0 What is the units digit of 4128? 8 What is the hundreds digit of 15533? 5 What is the units digit of 11? 1 What is the ten thousands digit of 124570? 2 What is the tens digit of 15620? 2 What is the thousands digit of 12274? 2 What is the tens digit of 38554? 5 What is the thousands digit of 3566? 3 What is the units digit of 6527? 7 What is the hundreds digit of 539? 5 What is the units digit of 2471? 1 What is the hundreds digit of 4438? 4 What is the units digit of 171? 1 What is the tens digit of 5781? 8 What is the thousands digit of 1426? 1 What is the thousands digit of 8702? 8 What is the hundreds digit of 5495? 4 What is the tens digit of 3278? 7 What is the tens digit of 1570? 7 What is the hundreds digit of 25635? 6 What is the thousands digit of 28970? 8 What is the units digit of 693? 3 What is the hundreds digit of 744? 7 What is the tens digit of 2024? 2 What is the ten thousands digit of 12947? 1 What is the units digit of 34234? 4 What is the hundreds digit of 2905? 9 What is the tens digit of 4815? 1 What is the units digit of 20047? 7 What is the hundreds digit of 1099? 0 What is the units digit of 30882? 2 What is the tens digit of 5833? 3 What is the hundreds digit of 34588? 5 What is the tens digit of 534? 3 What is the thousands digit of 1156? 1 What is the thousands digit of 7539? 7 What is the units digit of 295? 5 What is the tens digit of 3261? 6 What is the tens digit of 10450? 5 What is the tens digit of 4925? 2 What is the units digit of 16136? 6 What is the tens digit of 7963? 6 What is the hundreds digit of 2051? 0 What is the tens digit of 401? 0 What is the units digit of 531? 1 What is the hundreds digit of 1180? 1 What is the tens digit of 494? 9 What is the thousands digit of 18404? 8 What is the units digit of 1222? 2 What is the hundreds digit of 978? 9 What is the thousands digit of 8993? 8 What is the tens digit of 3914? 1 What is the hundreds digit of 3385? 3 What is the hundreds digit of 1309? 3 What is the tens digit of 147379? 7 What is the thousands digit of 3550? 3 What is the thousands digit of 4801? 4 What is the units digit of 11233? 3 What is the ten thousands digit of 30469? 3 What is the units digit of 1730? 0 What is the hundreds digit of 1097? 0 What is the tens digit of 34530? 3 What is the hundreds digit of 22721? 7 What is the tens digit of 2798? 9 What is the hundreds digit of 1557? 5 What is the tens digit of 22595? 9 What is the tens digit of 444? 4 What is the thousands digit of 1463? 1 What is the units digit of 9016? 6 What is the hundreds digit of 10664? 6 What is the units digit of 1484? 4 What is the units digit of 71211? 1 What is the hundreds digit of 5076? 0 What is the thousands digit of 5338? 5 What is the tens digit of 723? 2 What is the tens digit of 945? 4 What is the thousands digit of 143645? 3 What is the tens digit of 1155? 5 What is the units digit of 3323? 3 What is the tens digit of 586? 8 What is the units digit of 3200? 0 What is the tens digit of 7304? 0 What is the tens digit of 89704? 0 What is the units digit of 1482? 2 What is the hundreds digit of 2305? 3 What is the tens digit of 1003? 0 What is the tens digit of 33669? 6 What is the units digit of 13791? 1 What is the hundreds digit of 1993? 9 What is the units digit of 6961? 1 What is the thousands digit of 3839? 3 What is the units digit of 730? 0 What is the ten thousands digit of 23746? 2 What is the tens digit of 801? 0 What is the tens digit of 1784? 8 What is the hundreds digit of 4281? 2 What is the hundreds digit of 1219? 2 What is the units digit of 1283? 3 What is the thousands digit of 3936? 3 What is the tens digit of 113? 1 What is the units digit of 3105? 5 What is the hundreds digit of 15511? 5 What is the units digit of 987? 7 What is the hundreds digit of 486? 4 What is the ten thousands digit of 14780? 1 What is the units digit of 1801? 1 What is the thousands digit of 2311? 2 What is the tens digit of 620? 2 What is the hundreds digit of 3405? 4 What is the tens digit of 155? 5 What is the hundreds digit of 2999? 9 What is the units digit of 3287? 7 What is the tens digit of 603? 0 What is the hundreds digit of 22608? 6 What is the hundreds digit of 70319? 3 What is the tens digit of 187? 8 What is the units digit of 5848? 8 What is the tens digit of 44004? 0 What is the units digit of 605? 5 What is the tens digit of 797? 9 What is the ten thousands digit of 10848? 1 What is the ten thousands digit of 51709? 5 What is the ten thousands digit of 12156? 1 What is the hundreds digit of 148235? 2 What is the ten thousands digit of 25332? 2 What is the tens digit of 883? 8 What is the hundreds digit of 903? 9 What is the thousands digit of 42657? 2 What is the hundreds digit of 76120? 1 What is the tens digit of 2587? 8 What is the units digit of 46810? 0 What is the thousands digit of 2699? 2 What is the tens digit of 82249? 4 What is the hundreds digit of 708? 7 What is the hundreds digit of 14567? 5 What is the hundreds digit of 4522? 5 What is the thousands digit of 2	{ "pile_set_name": "DM Mathematics" }
k*2 - 3j*3k - 2j2k*2 + 2jk2 - 5jk - 246j - 107473k2 + 2k - 2 wrt k? 4j3 - 4j*2 + 4j - 214946 Find the third derivative of 599275k3x - k*3 - 12k*2x + 161k2 + 2kx + k wrt k. 3595650x - 6 What is the third derivative of 2100k6 - 84k*5 + 10k*2 - 3145k + 4? 252000k3 - 5040k*2 Find the third derivative of 345bt3x*3 + bt*3x*2 + 729btx*2 + 31bx2 + 30t*3x*3 wrt x. 2070bt3 + 180t*3 What is the third derivative of -49202b*3 - 6b*2 - 135b? -295212 Find the third derivative of -31928g3 + 15g*2 - 93g + 3. -191568 What is the third derivative of -8051i5 + 35365i*2 - 2 wrt i? -483060i*2 Differentiate -2013j*3w*3 - 31j*3w + 32439w3 with respect to j. -6039j*2w*3 - 93j*2w Find the second derivative of -305376m3 + 1006572m wrt m. -1832256m What is the first derivative of j4 - j3 - 86j*2 - 170j + 1487495 wrt j? 4j3 - 3j*2 - 172j - 170 What is the second derivative of 29d4k + 2696d4 + 33dk + d - 2k + 431 wrt d? 348d2k + 32352d2 Differentiate 2b*4d - 549b4 + 8bd + 9958d wrt b. 8b3d - 2196b3 + 8d Find the third derivative of -38132s5 - 2s*2 - s - 8288. -2287920s2 What is the second derivative of k3w4 + 106k*3w - 148k2w - kw3 + 42627kw2 wrt w? 12k*3w*2 - 6kw + 85254k Differentiate 60907br + 71355b with respect to r. 60907b What is the third derivative of -2444398o3 - 2566604o*2 wrt o? -14666388 What is the second derivative of 699166m*2y + 22611m + 73y wrt m? 1398332y What is the second derivative of -1420607d*2 + 5d + 72819? -2841214 What is the third derivative of 507x5 + 2x*4 + 4x*3 - 2409538x*2? 30420x*2 + 48x + 24 What is the derivative of -60613t + 48317 wrt t? -60613 What is the second derivative of 5gi4o*2 + gio3 + 3gi - 19310i*2o*3 + 17799o*3 wrt i? 60gi2o*2 - 38620o*3 Find the second derivative of -2t*3x*2 - 4t*3x + 22996t2x - 3038tx*2 + 78t wrt t. -12tx*2 - 24tx + 45992x Find the second derivative of 39926u2 - 97427u. 79852 Find the third derivative of -135404j5 - 12j*3 + 2j*2 + 5235988 wrt j. -8124240j*2 - 72 What is the third derivative of 65m*3z*4 + 399m*3 - 18m*2z4 + m2z2 + mz - 8z2 wrt z? 1560m*3z - 432m2z What is the second derivative of 2127f4t*2 - 17f*4 + 587ft + 3f + t*2 - 2 wrt f? 25524f*2t*2 - 204f*2 What is the third derivative of 123636x*3 - 554328x*2 wrt x? 741816 What is the first derivative of -6w*2z4 - w2 + 70301wz*2 + 209996w + 3 wrt z? -24w2z*3 + 140602wz What is the second derivative of 1976801z*2 + z - 665810? 3953602 Find the third derivative of -17783r*3 + 50r*2 + 2r - 90 wrt r. -106698 What is the second derivative of -35452j2 + 12343j? -70904 Find the third derivative of -h*4i + 13989h3i + 22h2i - hi + 332h wrt h. -24hi + 83934i Find the second derivative of 28501a*5 + 9845a wrt a. 570020a3 What is the third derivative of 68dj3k*2 + 9dj3 + 28dj2k + dj2 - 2djk*2 - 3djk + 10dj - 809j3k - j3 + j2k wrt j? 408dk2 + 54d - 4854k - 6 Find the third derivative of 331989y*5 + 100y*2 + 5y - 4 wrt y. 19919340y2 Differentiate -130555u*4 - 167465 wrt u. -522220u3 Find the third derivative of -a5o2 - 42451a*5o - 5a2o*2 - 62a*2 + 190ao - o2 + 1 wrt a. -60a*2o*2 - 2547060a*2o What is the third derivative of 17063l4 - 127l*2 - 32l? 409512l What is the second derivative of -50823t*3 - 2859652t + 2? -304938t Differentiate 32811v + 79294 with respect to v. 32811 Find the third derivative of 5p5 - 4323p*4 - 252p*2 + 22p wrt p. 300p2 - 103752p What is the first derivative of u*4 + 12289u*2 - 57730 wrt u? 4u*3 + 24578u What is the first derivative of 2p3 + 17332p*2 + 87080? 6p*2 + 34664p What is the third derivative of 85p5 + 37p4 + p3 + p*2 - 289? 5100p*2 + 888p + 6 What is the derivative of 3541a2fm + 775370a*2m - 43afm wrt f? 3541a*2m - 43am Find the second derivative of -58339b4 + b + 79218 wrt b. -700068b*2 Find the second derivative of 7i*3m + 93i3 - i2m*2 + im - i - 2m2 - 5475m wrt i. 42im + 558i - 2m*2 Differentiate 1967772c*4 + 927857 wrt c. 7871088c*3 Find the third derivative of 197s*5 + 6s*4 + 295s*2 + 4s + 3. 11820s2 + 144s What is the third derivative of -34979s2u*3 + 2s*2u - 17s2 + 11su2 - 8u wrt u? -209874s2 What is the second derivative of 112601z4 + z2 + 697z + 111 wrt z? 1351212z*2 + 2 What is the second derivative of -2i*3 - 93109i*2 - 8932i - 4? -12i - 186218 What is the third derivative of -18fq3 + 17958fq2 - 5062q*3 + 2q*2 wrt q? -108f - 30372 Find the third derivative of -286d3y + 33d3 + 45d*2y + 9dy wrt d. -1716y + 198 Find the first derivative of 3743466x*2 - 2927553 wrt x. 7486932x Differentiate 23j2u*2 - 25j*2u + 2j2 + 7j + 86810u2 + 2 with respect to j. 46ju2 - 50ju + 4j + 7 What is the second derivative of -7z3 + 809z*2 - 15447z? -42z + 1618 Find the second derivative of -2o*2r*2z - 4o2r*2 + 2o*2z - 21o2 + 8or2z + 4o - 4rz + 1 wrt o. -4r*2z - 8r2 + 4z - 42 What is the first derivative of -9a2 + 21042a - 205676? -18a + 21042 Find the second derivative of 2269009f*2 + 988762f wrt f. 4538018 What is the second derivative of -144l4 + 25l*3 + 8l + 4272 wrt l? -1728l2 + 150l Find the first derivative of 1304034h2 - 782000 wrt h. 2608068h Find the second derivative of 8j5 - 3295j*4 - 262037j - 1 wrt j. 160j3 - 39540j*2 Find the second derivative of -516978a*4 - 54099a wrt a. -6203736a2 What is the second derivative of -a5 - 72505a*4 + 270a - 28 wrt a? -20a3 - 870060a*2 Find the second derivative of 706428z*2 + 297726z + 1 wrt z. 1412856 What is the third derivative of 21457z4 + 23204z*2 wrt z? 514968z Differentiate 237501s + 2486730 wrt s. 237501 What is the third derivative of 16330o5 - o4 - 20113o2 wrt o? 979800o*2 - 24o Differentiate -7cf*2 + 9cf - 100087c + 4f2 - 3f + 4 wrt f. -14cf + 9c + 8f - 3 Find the first derivative of -6667a2p*2 + 2a*2p + 2a2 + 2p*2 - 167p - 92 wrt a. -13334ap*2 + 4ap + 4a Find the first derivative of 43724h - 52626 wrt h. 43724 Find the third derivative of 217028o*4 - 202363o*2 wrt o. 5208672o What is the derivative of 24225pu*2 - 27u*2 - u - 45 wrt p? 24225u*2 Find the third derivative of -4095i4 + i3 + 8i2 - 159i wrt i. -98280i + 6 Find the third derivative of -519077s*3 - 8557s*2 - 15 wrt s. -3114462 What is the second derivative of -10442q*3x*3 - 15q3 - q2x3 - 6qx - 5x*3 - 1810 wrt q? -62652qx3 - 90q - 2x3 What is the third derivative of 16k*4 + 436k*3 - 2487k*2? 384k + 2616 Find the second derivative of -3344548n2z*2 - 2nz + 55323z*2 wrt n. -6689096z*2 Find the second derivative of -199706k*2 + 3k - 72817. -399412 What is the second derivative of 847k3z*3 - 2k*3z - 4126k3 + 124k*2z*4 + 47k*2z + kz wrt z? 5082k*3z + 1488k2z*2 Find the third derivative of -294hrs*3 - 35hs3 - 2hs + 11rs2 + 148rs wrt s. -1764hr - 210h What is the first derivative of -869a2 + 459a + 1233437? -1738a + 459 Find the second derivative of -22029k*3 + 2k - 129100. -132174k Differentiate -23318hw3 + 12h - 297 wrt w. -69954hw*2 What is the second derivative of -86601st5 - 125s + 25t + 1 wrt t? -1732020st3 Find the third derivative of 1629k*2y*4 + 4k*2y*3 - 21898k*2 - 3ky3 - k + y2 wrt y. 39096k*2y + 24k2 - 18k What is the third derivative of -110414d3 + 165148d*2 wrt d? -662484 Find the second derivative of -130800q*5 + 43551q. -2616000q3 Find the third derivative of 297350j*5 + 2j*4 - 2126319j*2 wrt j. 17841000j*2 + 48j What is the second derivative of 927a5 - 1222a*2v*3 + 7av2 - 2av - 47a + 9v3 wrt a? 18540a*3 - 2444v**3 What is	{ "pile_set_name": "DM Mathematics" }
20. 8160 Find the common denominator of -23/63 and 10/153. 1071 Calculate the smallest common multiple of 342 and 45. 1710 Calculate the common denominator of -63/1688 and -14/5. 8440 Find the common denominator of -13/360 and 131/720. 720 What is the smallest common multiple of 422 and 1899? 3798 Calculate the common denominator of -7/16 and 37/156. 624 What is the smallest common multiple of 530 and 477? 4770 Find the common denominator of -51/16 and 28/9. 144 What is the common denominator of -1/16 and -35/10048? 10048 Find the common denominator of -29/9196 and 79/16. 36784 What is the lowest common multiple of 980 and 32? 7840 Calculate the common denominator of -53/1210 and -29/1100. 12100 Calculate the common denominator of 18/187 and -40/143. 2431 What is the common denominator of -53/30 and -13/30? 30 Calculate the lowest common multiple of 1247 and 87. 3741 What is the lowest common multiple of 16 and 408? 816 What is the smallest common multiple of 54 and 318? 2862 Calculate the smallest common multiple of 1 and 20120. 20120 What is the common denominator of 19/132 and 79/1254? 2508 Calculate the common denominator of 28/7655 and -65/3. 22965 What is the smallest common multiple of 20 and 60? 60 Calculate the least common multiple of 312 and 56. 2184 Find the common denominator of -5/77 and 7/26. 2002 What is the common denominator of -5/1188 and -161/792? 2376 Calculate the common denominator of -173/1134 and -73/3780. 11340 Calculate the smallest common multiple of 18 and 53058. 159174 What is the common denominator of 83/18 and 23/669? 4014 What is the least common multiple of 394 and 394? 394 What is the least common multiple of 3 and 1113? 1113 Calculate the smallest common multiple of 2425 and 20. 9700 What is the common denominator of 48/91 and -51/14? 182 What is the lowest common multiple of 198 and 252? 2772 Calculate the common denominator of -7/38 and 15/209. 418 Calculate the least common multiple of 8 and 168. 168 What is the least common multiple of 1414 and 1616? 11312 What is the common denominator of -31/20 and -21/1180? 1180 What is the lowest common multiple of 664 and 28? 4648 Calculate the common denominator of 12/7085 and 94/1635. 21255 What is the smallest common multiple of 885 and 354? 1770 Calculate the least common multiple of 30 and 66. 330 What is the lowest common multiple of 320 and 8? 320 What is the common denominator of -143/2436 and 59/12? 2436 What is the lowest common multiple of 50 and 14? 350 Calculate the least common multiple of 570 and 399. 3990 Find the common denominator of 37/9 and -7/33. 99 Calculate the common denominator of 55/296 and -3/481. 3848 Find the common denominator of -149/36 and 127/24. 72 What is the smallest common multiple of 11 and 1898? 20878 Calculate the common denominator of -56/9 and 117/238. 2142 Calculate the smallest common multiple of 189 and 168. 1512 What is the smallest common multiple of 55 and 10? 110 Calculate the lowest common multiple of 15521 and 102. 93126 What is the common denominator of 29/19 and 5/2? 38 Calculate the common denominator of -7/10 and 89/24. 120 Find the common denominator of 127/30 and 23/57. 570 Find the common denominator of -79/90 and -67/24. 360 Calculate the lowest common multiple of 6 and 36. 36 Calculate the least common multiple of 32 and 590. 9440 What is the common denominator of 69/64 and 17/440? 3520 What is the common denominator of -61/16 and -97/40? 80 What is the common denominator of 125/234 and -77/52? 468 What is the least common multiple of 3 and 24? 24 What is the least common multiple of 136 and 204? 408 Calculate the common denominator of 25/72 and -29/8. 72 Find the common denominator of 151/114 and 97/684. 684 Calculate the common denominator of -46/189 and 143/918. 6426 What is the least common multiple of 768 and 12? 768 Calculate the smallest common multiple of 133 and 15. 1995 Calculate the smallest common multiple of 5487 and 12. 21948 Find the common denominator of -59/2768 and -44/9. 24912 What is the common denominator of 95/102 and 86/15? 510 What is the smallest common multiple of 354 and 27? 3186 Calculate the least common multiple of 18 and 4080. 12240 Find the common denominator of 19/12 and 57/892. 2676 What is the lowest common multiple of 60 and 8? 120 Find the common denominator of -7/141 and -68/123. 5781 Find the common denominator of -53/744 and -1/1240. 3720 Calculate the smallest common multiple of 39 and 273. 273 What is the least common multiple of 273 and 49? 1911 What is the common denominator of -127/2064 and 77/10? 10320 What is the common denominator of 94/15 and 34/3? 15 What is the lowest common multiple of 36 and 888? 2664 Calculate the common denominator of 67/8 and 43. 8 Find the common denominator of -67/332 and -5/332. 332 Calculate the least common multiple of 4 and 194. 388 Calculate the least common multiple of 116 and 3228. 93612 Calculate the lowest common multiple of 33 and 561. 561 What is the smallest common multiple of 9 and 87? 261 Calculate the lowest common multiple of 81 and 81. 81 What is the least common multiple of 6 and 100? 300 Calculate the lowest common multiple of 196 and 14. 196 What is the common denominator of 47/90 and -5/4122? 20610 Calculate the lowest common multiple of 319 and 58. 638 What is the common denominator of 53/4 and 19/28? 28 Calculate the smallest common multiple of 63 and 21. 63 Find the common denominator of -119/1272 and -47/66. 13992 What is the lowest common multiple of 8472 and 8? 8472 Find the common denominator of 5/33 and -21/88. 264 Find the common denominator of 5/7 and -53/7. 7 What is the lowest common multiple of 2 and 914? 914 What is the least common multiple of 1057 and 1359? 9513 What is the common denominator of -23/4775 and -27/764? 19100 What is the common denominator of -64/153 and 77/48? 2448 What is the common denominator of 4/3141 and 67/698? 6282 Find the common denominator of -31/1232 and -65/12. 3696 Find the common denominator of 70/51 and 9/136. 408 Calculate the smallest common multiple of 9438 and 66. 9438 Find the common denominator of -7/1872 and -107/624. 1872 Calculate the least common multiple of 12 and 36. 36 Find the common denominator of -95/534 and 9/25. 13350 Calculate the common denominator of 9/580 and 43/870. 1740 What is the lowest common multiple of 21 and 75? 525 Find the common denominator of 23/2456 and 39/4912. 4912 Find the common denominator of 19/132 and 7/132. 132 Calculate the common denominator of 53/10 and -73/2148. 10740 What is the smallest common multiple of 49 and 70? 490 What is the common denominator of 91/368 and 43/460? 1840 Calculate the least common multiple of 153 and 18. 306 Find the common denominator of 92/315 and 69/385. 3465 Calculate the least common multiple of 1526 and 1526. 1526 What is the least common multiple of 1000 and 50? 1000 Calculate the common denominator of -5/6 and 2/1635. 3270 What is the common denominator of -55/428 and -127/12? 1284 Calculate the lowest common multiple of 204 and 216. 3672 Calculate the common denominator of 83/10 and 6. 10 Find the common denominator of 21/8 and 34/2253. 18024 Calculate the least common multiple of 238 and 8. 952 Calculate the common denominator of -95/57638 and -105/22. 634018 Calculate the smallest common multiple of 63 and 126. 126 Find the common denominator of 49/129 and -38/473. 1419 What is the common denominator of -93/10 and 79/10? 10 Calculate the smallest common multiple of 18 and 154. 1386 What is the common denominator of 5/66 and 71/198? 198 Calculate the common denominator of 83/1512 and -31/54. 1512 Calculate the least common multiple of 594 and 9. 594 Calculate the smallest common multiple of 2418 and 15. 12090 Calculate the least common multiple of 184 and 184. 184 Find the common denominator of -11/36 and 113/12. 36 Calculate the lowest common multiple of 123 and 12710. 38130 What is the least common multiple of 369 and 123? 369 What is the common denominator of -33/4 and 14/513? 2052 Find the common denominator of -31/21 and 83/2154. 15078 What is the least common multiple of 15880 and 110? 174680 What is the smallest common multiple of 1314 and 63? 9198 Find the common denominator	{ "pile_set_name": "DM Mathematics" }
What is next in 20814, 83312, 187486, 333336, 520862? 750064 What is next in -270, -378, -148, 588, 1998, 4250, 7512, 11952? 17738 What is the next term in 2385, 4866, 7535, 10488, 13821, 17630, 22011? 27060 What is the next term in 7423, 14855, 22285, 29713, 37139? 44563 What comes next: -1910, -3869, -5828, -7787, -9746? -11705 What comes next: 164, -831, -2488, -4807, -7788, -11431? -15736 What comes next: 36587, 73194, 109801, 146408, 183015, 219622? 256229 What is the next term in 475, 503, 549, 613? 695 What is the next term in -888, -3475, -7786, -13821? -21580 What comes next: -794, -822, -886, -1004, -1194, -1474? -1862 What is next in 12966, 12964, 12962, 12960, 12958, 12956? 12954 What is the next term in -6420, -25345, -56780, -100731, -157204, -226205, -307740? -401815 What is next in -169, -930, -2201, -3982, -6273, -9074, -12385? -16206 What is the next term in -46880, -46867, -46864, -46877, -46912? -46975 What comes next: 21933, 43864, 65795? 87726 What comes next: -19, -91, -291, -685, -1339? -2319 What is next in 33635, 33651, 33677, 33713? 33759 What comes next: -1041, -4191, -9439, -16785, -26229, -37771, -51411? -67149 What is the next term in 11809, 47281, 106399, 189163, 295573? 425629 What is next in 2545, 4880, 7215, 9550? 11885 What is the next term in 29269, 29260, 29249, 29236, 29221, 29204? 29185 What is next in -293773, -293739, -293673, -293569, -293421, -293223, -292969? -292653 What comes next: -234051, -468116, -702207, -936336, -1170515, -1404756? -1639071 What is the next term in 171, 430, 853, 1434, 2167, 3046? 4065 What comes next: -66, 17, 236, 657, 1346? 2369 What comes next: -3759, -14997, -33731, -59961? -93687 What is the next term in -510, -514, -530, -564, -622, -710? -834 What comes next: 1078, 2085, 3092, 4099, 5106, 6113? 7120 What is next in -202, -1215, -3978, -9367, -18258? -31527 What comes next: 3824, 3813, 3802, 3791? 3780 What is next in -905, -902, -899, -896, -893, -890? -887 What is the next term in -41575, -83147, -124719, -166291? -207863 What comes next: -20094, -80338, -180734, -321282, -501982, -722834? -983838 What is the next term in -906, -3613, -8122, -14439, -22570, -32521, -44298, -57907? -73354 What is next in -406, -221, 100, 563, 1174? 1939 What is the next term in -67, -163, -255, -343? -427 What comes next: 18, 35, 40, 27, -10, -77, -180? -325 What is next in 336, 459, 586, 717, 852, 991? 1134 What is next in 2088, 4166, 6248, 8334? 10424 What comes next: 52, 61, 58, 37, -8, -83? -194 What comes next: -22, -312, -792, -1462, -2322, -3372? -4612 What is the next term in 179, 253, 325, 395, 463, 529, 593? 655 What is next in -10624, -21255, -31886, -42517, -53148, -63779? -74410 What comes next: -5685, -11410, -17175, -22980, -28825, -34710, -40635? -46600 What comes next: 709, 1447, 2185, 2923, 3661, 4399? 5137 What is next in -76317, -152629, -228941? -305253 What comes next: -444, 22, 504, 1008, 1540? 2106 What is next in -52792, -52785, -52774, -52759, -52740? -52717 What comes next: -9003, -18025, -27061, -36117, -45199, -54313? -63465 What comes next: 498221, 498223, 498225? 498227 What is next in 256, 267, 274, 277, 276, 271? 262 What is next in -85035, -85042, -85053, -85068, -85087, -85110, -85137? -85168 What comes next: 1255, 2467, 3605, 4633, 5515, 6215, 6697, 6925? 6863 What is next in 13937, 27907, 41877, 55847, 69817? 83787 What is next in -14734, -14736, -14738, -14740, -14742? -14744 What is next in -3038, -12105, -27198, -48317? -75462 What is next in -642902, -642900, -642898, -642896, -642894? -642892 What is the next term in -180, -532, -1126, -1968, -3064? -4420 What is next in 251, 227, 171, 65, -109, -369, -733? -1219 What is the next term in -75, -600, -1475, -2700, -4275? -6200 What is next in -423168, -423166, -423164, -423162, -423160? -423158 What comes next: 16249, 32506, 48767, 65032, 81301? 97574 What is the next term in 444223, 444216, 444205, 444190, 444171, 444148, 444121? 444090 What is next in -1838, -1671, -1394, -1007, -510, 97? 814 What comes next: -375, -1376, -2999, -5238, -8087, -11540, -15591, -20234? -25463 What is the next term in -102015, -204031, -306047? -408063 What is the next term in 22914, 22912, 22910, 22908, 22906? 22904 What is next in -960, -1972, -3036, -4152, -5320? -6540 What comes next: -228, 148, 1130, 2718, 4912, 7712? 11118 What comes next: -76435, -152871, -229307, -305743, -382179, -458615? -535051 What comes next: 191697, 383395, 575093, 766791? 958489 What is the next term in -2390, -3553, -4716, -5879? -7042 What is the next term in -25599, -51401, -77203, -103005, -128807, -154609? -180411 What is the next term in -12337, -24672, -37053, -49504, -62049? -74712 What is next in 41413, 82815, 124217, 165619, 207021, 248423? 289825 What is the next term in -82357, -82361, -82355, -82333, -82289, -82217, -82111? -81965 What comes next: 212, 861, 1936, 3419, 5292, 7537, 10136? 13071 What comes next: -23825, -47646, -71467, -95288? -119109 What is the next term in 440, 1360, 2894, 5042, 7804, 11180, 15170? 19774 What is next in -245, -1265, -2267, -3245, -4193, -5105, -5975? -6797 What comes next: -130, -230, -300, -334, -326, -270, -160? 10 What comes next: -3104, -3168, -3228, -3284, -3336? -3384 What is next in 1157, 1449, 1739, 2027, 2313, 2597? 2879 What comes next: -122, -170, -218, -266? -314 What is next in -10520, -42048, -94594, -168158, -262740, -378340, -514958? -672594 What comes next: 751, 3131, 7099, 12655, 19799? 28531 What comes next: -97, -216, -343, -478, -621, -772, -931? -1098 What is the next term in -392, -741, -1090? -1439 What is the next term in -2853, -2972, -3091, -3210, -3329, -3448? -3567 What comes next: 1461, 1163, 865, 567, 269? -29 What is next in -6753, -6765, -6765, -6747, -6705? -6633 What is the next term in 432, 513, 598, 687? 780 What is next in 7707, 15419, 23131, 30843, 38555? 46267 What comes next: 115918, 115929, 115940? 115951 What comes next: -451, -499, -547? -595 What is the next term in 744, 3056, 6908, 12300, 19232, 27704, 37716? 49268 What is next in -442948, -442953, -442958, -442963? -442968 What comes next: 3624, 3507, 3312, 3039? 2688 What is the next term in 46, 367, 1232, 2911, 5674, 9791, 15532? 23167 What comes next: 549, 1942, 4263, 7512, 11689, 16794, 22827? 29788 What comes next: -1869, -7490, -16857, -29976, -46853? -67494 What is next in 73125, 146255, 219387, 292521, 365657? 438795 What is next in -62, -89, -76, -23? 70 What comes next: -154602, -154598, -154594, -154590, -154586, -154582? -154578 What comes next: -353, -1299, -2873, -5075, -7905, -11363? -15449 What comes next: 231, 501, 807, 1149, 1527? 1941 What comes next: -6, -10, -40, -108, -226, -406, -660, -1000? -1438 What is next in -405, -346, -287, -228, -169? -110 What is the next term in -17, -121, -317, -617, -1033, -1577, -2261, -3097? -4097 What comes next: 11771, 94177, 317847, 753413, 1471507, 2542761, 4037807, 6027277? 8581803 What is the next term in 165, 209, 233, 231, 197, 125, 9? -157 What is the next term in 3429, 3456, 3501, 3564, 3645, 3744, 3861? 3996 What is the next term in -4035, -8035, -12011, -15963, -19891, -23795, -27675? -31531 What is the next term in 28559, 28560, 28561, 28562? 28563 What comes next: 30, -135, -422, -837, -1386, -2075, -2910, -3897? -5042 What is the next term in 6163, 24835, 55955, 99523, 155539, 224003? 304915 What comes next: 125, 49, -105, -343, -671, -1095, -1621? -2255 What comes next: 6023, 6016, 6007, 5996, 5983, 5968? 5951 What comes next: 60382, 60403, 60438, 60493, 60574, 60687, 60838, 61033? 61278 What is the next term in 17780, 17748, 17696, 17624, 17532, 17420, 17288? 17136 What is the next term in 4914, 9797, 14664, 19515, 24350, 29169, 33972? 38759 What comes next: -83121, -166266, -249385, -332466, -415497? -498466 What is next in 2249, 2999, 3759, 4535, 5333, 6159, 7019, 7919? 8865 What is next in 42, 50, 58, 66, 74? 82 What comes next: -204, -789, -2120, -4569, -8508? -14309 What is the next term in -4231, -4233, -4235, -4237, -4239, -4241? -4243 What comes next: -13229, -26466, -39725, -53012, -66333, -79694, -93101, -106560? -120077 What comes next: 166, 340, 528, 736, 970? 1236 What comes next: 5677, 11350, 17023,	{ "pile_set_name": "DM Mathematics" }
w - 2. Let f(a) = -5a*2 - 2a + 1. Let n = -1 - -3. Let u be 2 + (n - 2) - -1. Let o(v) = -4v2 - v + 1. Determine uo(m) + wf(m). -2m*2 + m + 1 Let n be 2/(-4)(-2 - -4). Let h(i) = -i*2 - i - 1. Let t(w) = 3w*2 - w + 0w + 4 + 6w + 0. What is nt(z) - 4h(z)? z2 - z Let b(y) = y2 - y - 1. Let r(s) = s2 - 2s - 1. Let x = -8 - -5. Let j be -1 + -1 + (-4 - (-5 + -2)). What is jr(v) + xb(v)? -2v2 + v + 2 Let t = 30 - 35. Let r(a) = 2a*3 + a - 6. Let x(y) = 2y*3 + y - 7. What is tx(p) + 6r(p)? 2p*3 + p - 1 Let t(i) = -2i*3 + 5i*2 + 5i - 6. Let m(z) = -z*3 + 3z*2 + 3z - 3. Calculate 10m(b) - 6t(b). 2b3 + 6 Let n(t) = 2t*3 + t - 7. Let k(v) = -3v*3 - 2v + 13. What is -3k(d) - 5n(d)? -d*3 + d - 4 Let m(z) = -9z + 6. Let k(p) = -p. Let d(a) = -2k(a) + m(a). Let o(c) = -15c + 13. Calculate -13d(w) + 6o(w). w Let v(l) = -4l + 2. Let a(s) = -5 - 5s + 2s + 14s + 0. Suppose -4r = 2h + r - 6, 3r = 0. Determine ha(u) + 8v(u). u + 1 Let o(s) = -7s - 1. Let k(u) = -6u - 2. Let q(y) = -6k(y) + 5o(y). Let t(a) = 1. Determine q(m) - 6t(m). m + 1 Let a(h) = h + 1. Let x(q) = -3q - 3. Let y(p) = -2a(p) - x(p). Let l(s) be the first derivative of s - 5. What is -2l(n) + y(n)? n - 1 Let m(z) be the second derivative of z5/5 - z3/2 - 3z*2/2 + 29z. Let g(p) = -11p3 + 8p + 8. Calculate 3g(b) + 8m(b). -b*3 Let q(z) = -16z. Let r(y) = -8y + 3. Let s(c) = 9c - 4. Let m(o) = 4r(o) + 3s(o). Determine -14m(v) + 4q(v). 6v Let a(j) = -j2 + j + 1. Let d(y) = -2. Let t be (-5)/(-2)(-72)/(-20). Suppose 6b + 4 = b - 3i, -4i = 3b + t. Calculate bd(n) + 2a(n). -2n2 + 2n Let b(z) = 6z3 + 20z + 8. Let x(c) = 2c - 63 + 60 - 9c - c3 - c3. Let s = 32 + -18. Give sx(a) + 5b(a). 2a3 + 2a - 2 Let c(s) = s*3 - 6s*2 + s - 2. Let p(n) = 2n*3 - 7n*2 + 2n - 2. Determine 5c(k) - 4p(k). -3k3 - 2k*2 - 3k - 2 Let r(w) = 4w2 + 15w. Let c(f) = 7f2 + 29f. Determine -6c(s) + 11r(s). 2s2 - 9s Let o(r) = -6r + 9. Let n(h) = -3 - 2 - 2h + h + 4h. Calculate -5n(v) - 3o(v). 3v - 2 Let c(n) = 2n + 2. Let g(p) = -p - 1. Let r(s) = 1. Suppose -x = -1 + 2. Let h(t) = xr(t) - 2g(t). What is -2c(k) + 3h(k)? 2k - 1 Let y(c) = -6c + 6. Let i(o) = o - 1. What is 3i(x) + y(x)? -3x + 3 Let d(m) = -5 + 2 + 3m + 1. Let q(h) = -1 - 3 + 1 + 4h. Let r = 10 - 7. Determine rd(l) - 2q(l). l Let n(u) = -u2 + 2u + 2. Let j(g) = 17g2 - 9g - 9. Let t = -18 + 27. Let b(i) = -8i2 + 5i + 5. Let w(f) = tb(f) + 4j(f). Give 18n(x) - 4w(x). -2x2 Suppose 0 = -3r - 15, -5z + 5r = -10 - 5. Let k(g) = g*3 + 1. Let x(p) = -20p*3 - 22. Determine zx(h) - 44k(h). -4h3 Let w(q) = q3 - 5q - 5. Suppose 3y + 9 = -3n, 0y - y - 3 = -5n. Let i be n/9(-1 + 2). Let z(b) = ib - 1 + 0 - b + 0b. Calculate w(j) - 5z(j). j3 Let y(v) = -v3 + v2 - v + 1. Let b(n) = 2n*3 - 4n*2 + 4n - 4. What is -3b(k) - 12y(k)? 6k3 Suppose -4s = 9 - 37. Let b(m) = 2m2 - sm - 3 - 1 + 7. Let l(a) = -a*2 + 3a - 1. Let k(p) = -2p2 - 5p + 2. Let c be k(-4). Determine cl(h) - 4b(h). 2h2 - 2h - 2 Let m(p) = -7p - 3. Let a(d) = -7d - 4. Calculate -2a(f) + 3m(f). -7f - 1 Let t(p) = 2p - 8. Let x(j) = -2j + 8. Calculate -2t(b) - 3x(b). 2b - 8 Let s(t) = t - 1. Let r(p) = -3 + 8p + 0p - 2p. Suppose -u = 6 - 2. What is us(m) + r(m)? 2m + 1 Let t(w) = 7w + 4. Let m(h) = -h. Let r = 126 + -120. Calculate rm(v) + t(v). v + 4 Let c(n) = n - 9. Let j(d) = -d - 11 - 1 + 24 - 8. Calculate 3c(v) + 7j(v). -4v + 1 Let c(s) = -16s - 29. Let p(y) = 3y + 6. Give 4c(u) + 22p(u). 2u + 16 Let z(p) = -7p*3 - 6p*2 + 14p - 11. Let l(i) = 2i3 + 2i*2 - 5i + 4. Determine -11l(h) - 4z(h). 6h3 + 2h*2 - h Let a(o) = -8o*2 - 5o + 2. Let d(m) = -m*2 - m. Calculate a(n) - 5d(n). -3n2 + 2 Let s(k) = -2k - 13. Let r(l) = -7l - 12. Let c(j) = -3j - 6. Let x(g) = 5c(g) - 2r(g). Calculate -6s(u) + 13x(u). -u Let x(g) = 6g + 3. Let z(i) be the second derivative of 1/2i*2 + 1/6i*3 + 3i + 0. Let p = -11 - -7. What is pz(y) + x(y)? 2y - 1 Let j(r) = -r + 1. Let s(g) = -10. Determine 10j(w) + s(w). -10w Let o(c) = c*2 - 5c. Let m(s) = 3s2 - 14s + 1. What is -3m(w) + 8o(w)? -w*2 + 2w - 3 Let u(i) be the third derivative of 0 + 0i + 1/60i*5 + 0i*3 + 0i*4 - 1/120i*6 + 5i*2. Let z(j) = -7j*3 + 5j*2 + 1. Calculate -6u(a) + z(a). -a3 - a2 + 1 Let z(q) = 1 - 5 + q2 + q2. Let c(p) = -3p2 + 7. What is -4c(g) - 7z(g)? -2g*2 Suppose -4w - 12 = 20. Let v = w + -6. Let l(h) = 5h + 2. Let r(o) = 2o + 1. Determine vr(s) + 6l(s). 2s - 2 Suppose -2o + 17 = 3k, 5o = -2k - 0k + 15. Let l(g) = -5g3 + 2g*2 - 2g. Let x(q) = -11q3 + 5q*2 - 5q - 1. Determine kl(u) - 2x(u). -3u3 + 2 Let v(g) = -15g*3 - 2g*2 + 2g + 2. Let p(r) = -481r3 - 65r*2 + 65r + 65. What is -2p(q) + 65v(q)? -13q3 Let j(u) = -11u3 + u2 - 2u - 7. Let a(v) = -v3 - 1. Give 6a(i) - j(i). 5i3 - i2 + 2i + 1 Let c(f) = -5f + 4 - 16 + 9. Let d(x) = 9x + 6. What is -5c(i) - 3d(i)? -2i - 3 Let s(v) = 196v*3 + 16v*2 - 16v - 16. Let m(z) = -39z3 - 3z*2 + 3z + 3. Give 16m(q) + 3s(q). -36q3 Let z(j) = 2j - 5. Let d(v) = -v*2 + 13v + 35. Let u be d(15). Let q(y) = 3y - 6. Give uq(n) - 6z(n). 3n Let s(j) be the third derivative of 5/24j4 + 0 + 0j*5 + 1/120j*6 - 5/6j*3 + 0j - 2j2. Let a(c) = c - 1. What is 5a(f) - s(f)? -f*3 Let p(q) = -5q*3 - 3q + 2. Let w(d) = 6d3 + 4d - 3. Suppose 18 = -0b + 6b. Give bp(j) + 2w(j). -3j3 - j Let u(z) be the second derivative of -1/6z*3 + 1/3z*4 - z - 1/2z*2 + 0. Let t(p) = -5p*2 + p + 2. Calculate 3t(c) + 4u(c). c2 - c + 2 Let j(k) = 7k*3 - 5k*2 + 5k + 5. Let o(t) = -7t3 + 4t*2 - 4t - 4. Determine -4j(q) - 5o(q). 7q3 Let o(d) = -6d2. Let k(l) be the second derivative of -l5/20 + 3l2/2 - l. Let g(u) be the first derivative of k(u). Determine -5g(y) + 2o(y). 3y2 Let h(b) = -b2 + 2b + 7. Let f(m) = 2m*2 + 17m + 22. Let q(y) = y*2 + 11y + 15. Let l(d) = 5f(d) - 8q(d). Determine 7h(j) + 5l(j). 3j2 - j - 1 Let c(i) = -4i - 27. Let l(s) = -s. Determine -c(u) + 6l(u). -2u + 27 Let g(r) = -7r3 - 7r*2 + 5. Let x(w) = 0 - 3 - 3 + 4w*2 + 3 + 4w*3. Determine 3g(z) + 5x(z). -z3 - z2 Suppose 5l + 15 = -q + 3q, 0 = 4l + 12. Suppose -4x + x - 33 = 5y, q = -3x - 3. Let z(n) = -9n + 15. Let b(d) = 5d - 8. What is yz(m) - 11b(m)? -m - 2 Let n(m) = 14m - 6. Let q(a) be the first derivative of -9a2/2 + 4a - 15. Let l be 1 + 0 + (1 - -3). Determine ln(o) + 8q(o). -2o + 2 Let n(g) = -2g*2 + 9g. Let z(j) = 7j2 - 36j. Let m(c) = 9n(c) + 2z(c). Let h be 2/(-6) + 38/6. Let y(o) = 2o2 - 4o. Determine hm(w) + 13y(w). 2w2 + 2w Let m(g) = -3g - 4. Let c(l) = 4l + 5. Suppose 0 = o + 2r - 5, 0 = -0r + 5r - 5. Calculate om(t) + 2c(t). -t - 2 Let y(z) = -5 + z - 2z - z. Let h(a) = -2a + 4. Let m(p) = 5p - 11. Let s(v) = 8h(v) + 3m(v). Calculate -4s(i) + y(i). 2i - 1 Let t(j) = 33j2 + 3j + 5. Let m(u) = 100u2 + 8u + 14. Determine 3m(y) - 8t(y). 36y2 + 2 Let t = 1 - -32. Let g(u) = -5u + 151. Let v be g(29). Let i(r) = -3r3 + 2r*2. Let l(x) = 16x*3 - 11x*2. Give ti(b) + vl(b). -3b*3 Let t(h) = -45h*3 - 15h*2 + 15h. Let b(f) = -f3 - f2 + f. Determine 30b(x) - 2t(x). 60x3 Let f(n) = -7n*2 + 6 + 6n + 5n - 5n + 3n2. Let q(r) = 4r*2 - 5r - 5. Give -5f(k) - 6q(k). -4k2 Let h(g) = -g3 + 3g - 3. Let d(t) = -t*3 + 1 - 2 - 4 + 5t. Let w = -26 - -31. Determine wh(z) - 3d(z). -2z3 Let f be -2((-4)/(-2) + -4). Let h(x) = -8x2 + x + fx*2 - 6 - 9x. Let n(t) = 5t2 + 9t + 7. Calculate -7h(m) - 6n(m). -2m2 + 2m Let f(b) = b*2 - 4b + 2. Let z(k) be the first derivative of k*3/3 - 3k*2/2 + k + 22. Give 3f(w) - 4z(w). -w2 + 2 Let s(n) = -8n*2 - 2n + 4. Suppose -4u + 63 = -185. Suppose -3f = -4g + u, 4g - f + 5f - 76 = 0. Let z(y) = 23y*2 + 6y - 11. Give gs(m) + 6z(m). 2m2 + 2m + 2 Let n(m) = 8m2 + 2m + 7. Let q(x) =	{ "pile_set_name": "DM Mathematics" }
3). Factor 0 + tc - 2/5c*2. -2c(c - 1)/5 Let d be (0/2)/(-3) - 0. Let q(k) be the second derivative of -1/6k*4 + dk*3 + 0 + 0k*2 - 1/10k*5 + 3k. Factor q(h). -2h2(h + 1) Let v be (-4)/(-30)((-33)/12 - -3). Let u(f) be the second derivative of vf*6 + 0f*2 + 0 + 0f*3 - 3/40f*5 - f - 1/12f4. Factor u(d). d2(d - 2)(2d + 1)/2 Let n(j) be the second derivative of j + 1/15j*3 - 1/50j*5 + 0j*2 + 0j*4 + 0. Factor n(v). -2v(v - 1)(v + 1)/5 Find k such that -5/3k2 - 2/3k + 0 - k*3 + 1/3k*5 + 1/3k4 = 0. -1, 0, 2 Let c(y) = y3 - 3y2 - 3y - 8 + y + 0y3 + y. Let k be c(4). Factor 2/7s*k - 2/7s + 0 - 6/7s3 + 6/7s*2. 2s(s - 1)3/7 Let y = 59/282 - 2/47. Let i(t) be the first derivative of 2/9t*3 + 0t - 2 - yt4 + 0t*2. Factor i(d). -2d*2(d - 1)/3 Let u(g) be the second derivative of g10/30240 + g9/7560 - g7/1260 - g6/720 - g*4/6 - 3g. Let p(y) be the third derivative of u(y). Factor p(h). h(h - 1)(h + 1)3 Let f(g) = -g3 + 5g2 + 4g. Let a(t) = -t*3 + 4t*2 + 3t. Let i(s) = -4a(s) + 3f(s). Factor i(p). p*2(p - 1) Suppose 5a - 61 = 2v, 3a - 2v = -a + 50. Suppose 0 = 3p - a + 2. Factor 2 + p + c4 - 4 - 2c2. (c - 1)2(c + 1)2 Let j = -12 - -22. Let u be (-37)/j(-2 + -2). Let -18/5o4 - uo*2 - 8/5 + 8o + 12o3 = 0. What is o? 2/3, 1 Let z(a) = 6a*3 + 3a*2 + 5a - 55. Let w(r) = r3 - r2 - 1. Let o(f) = 20w(f) - 4z(f). Factor o(p). -4(p - 2)(p + 5)2 Let j(v) be the second derivative of -v6/720 + v5/60 - v4/16 + v*3/2 - 3v. Let r(p) be the second derivative of j(p). Find h such that r(h) = 0. 1, 3 Let h = 206/39 + -60/13. Solve hr + 2/3r*2 + 0 = 0. -1, 0 Suppose 5q - r = 3q + 3, -q = 3r + 9. Let p be (-10)/12(-1)/(20/8). Factor ps*2 + 0s - 1/3s3 + q. -s2(s - 1)/3 Let d(o) = -o*2 - o + 2. Let t be d(-2). Suppose 2y - 10 = t, -5y + 13 = -3s + 3. Determine v so that 0vs + 2v*3 - 5v*5 - v + 2v*5 + 2v*5 = 0. -1, 0, 1 Let u be (-192)/52 + 2 + -2 + 4. Solve -14/13x*2 - ux + 0 = 0. -2/7, 0 Factor 2b4 + 9b5 + b3 - 9b5 + 0b3 + b5. b*3(b + 1)2 Let d(m) be the first derivative of -m3/18 + m*2/4 + 2m/3 - 13. Suppose d(j) = 0. What is j? -1, 4 Let f = 13601/3 + -707141/156. Let a = f + -6/13. Factor -i - ai2 - 1. -(i + 2)2/4 Let r(h) be the second derivative of -h7/840 - h6/120 - h5/40 - h4/24 + h3/3 + 2h. Let c(b) be the second derivative of r(b). Factor c(x). -(x + 1)*3 Let i(n) be the second derivative of 2n*7/147 - 2n*6/15 + 11n*5/35 - 5n*4/21 - 26n. Solve i(y) = 0 for y. 0, 1, 5 Let i be 2/2010/4. Suppose 2f + 2v = -f + 6, -8 = -4f - 3v. Suppose -ib*3 + 0 + 0b - 1/4bf = 0. Calculate b. -1, 0 Factor -15q - 20q2 + 12 - 16 + 9. -5(q + 1)(4q - 1) Let r be -1 + (-4)/(-10) + (-18)/(-10). Factor ry4 + 0 + 2/5y*3 - 4/5y*2 + 0y. 2y2(y + 1)(3y - 2)/5 Let x(r) be the third derivative of -r7/8820 + r5/105 + r4/6 + r2. Let s(t) be the second derivative of x(t). Factor s(b). -2(b - 2)(b + 2)/7 Let v(y) = 3y2 - 4y - 5. Let p(m) = -3m2 + 9 + 6m - 2 - m*2. Let b(r) = -5p(r) - 7v(r). Find o such that b(o) = 0. -2, 0 Suppose 4q + u - 9 = 0, -3q - 3u = -q - 7. Let o = 1 + q. Factor l*3 + ol*3 - 2l*3 + 2l*2. 2l*2(l + 1) Let f(c) be the first derivative of -27c4/16 - 15c*3/4 - 21c*2/8 - 3c/4 + 7. Factor f(x). -3(x + 1)(3x + 1)2/4 Let j = 2 + -7. Let a(y) = -y3 - 4y*2 + 5y. Let i(b) = b*3 + 2b*2 - 3b. Let g(q) = ji(q) - 3a(q). Factor g(c). -2c2(c - 1) Let x(t) be the second derivative of t7/2520 - t5/120 + t*4/12 - 3t. Let c(s) be the third derivative of x(s). Factor c(l). (l - 1)(l + 1) Let u(q) = -4q*3 - 4q*2 + 3q. Let a(t) = -2t2 - 7t - 4. Let j be a(-4). Let x(g) = -11g3 - 11g*2 + 8g. Let w(v) = ju(v) + 3x(v). Factor w(f). -f*2(f + 1) Factor 2/7z2 - 12/7z + 18/7. 2(z - 3)2/7 Let p(d) be the second derivative of -3d*5/100 - 3d*4/10 - 6d*3/5 - 12d*2/5 - 24d. Factor p(a). -3(a + 2)3/5 Let z = -6 + 6. Let d = -50 + 251/5. Factor 1/5m + dm2 + z. m(m + 1)/5 Let m(w) be the second derivative of -w5/70 - w4/42 + 5w3/21 - 3w*2/7 + 9w. Factor m(k). -2(k - 1)2(k + 3)/7 Let r = -2 + 6. Solve -y - y*4 + 2y*3 + 2yr - y2 - y*3 + 0y = 0 for y. -1, 0, 1 Find u such that 5u4 + 0u*4 - 10u*3 - 8u*2 + 13u*2 = 0. 0, 1 Let g = 1 - -1. Factor -3n*3 - 3n - 3n4 + 4n*4 + 0n*3 + 4n - n*g + 2n*5. n(n - 1)(n + 1)2(2n - 1) Let k = 51 - 49. Let f = 6 - 4. Factor -k - 1/2b*2 - fb. -(b + 2)*2/2 Let j(v) be the second derivative of -8/27v*3 + 3v - 1/3v5 - 2/3v*4 + 0v*2 + 5/27v*6 + 0. Suppose j(m) = 0. What is m? -2/5, 0, 2 Factor -19k + 108 + 47k + 3k*2 - 64k. 3(k - 6)2 Let s(c) be the first derivative of -5c*3/3 + 55c*2 - 605c + 11. Let s(f) = 0. What is f? 11 Let o be 4/22 - (-156)/110. Let w(f) be the first derivative of 5/6f6 + 10/3f3 - f4 + 1 - of5 - 1/2f*2 - 2f. Factor w(k). (k - 1)*3(k + 1)(5k + 2) Let o = -1639/5 - -328. Factor -ox - 3/5x*2 + 0. -x(3x + 1)/5 Let f(r) be the third derivative of 0r + 0 + r*2 - 1/90r*5 + 2/9r*3 + 1/36r4. Find m, given that f(m) = 0. -1, 2 Let b(y) = y2 - 11y + 15. Let u be b(10). Suppose 5 = -s - o + 4, -o = 3s - u. Let 8/7 - 2/7a4 - 8/7a + 8/7as - 6/7a*2 = 0. Calculate a. -1, 1, 2 Let c(z) = 2z*2 - 11z - 3z2 + 4z*2. Let r(i) = i. Let u(m) = -c(m) - 5r(m). Factor u(b). -3b(b - 2) Let h(y) be the first derivative of -1/2y4 + 1 + 0y*2 - 4/3y*3 + 0y. Factor h(o). -2o2(o + 2) Suppose -2p + 0 = -8. Suppose 4k - 6k - 12 = -ps, 5s - 5k = 20. Factor -2/5 - 2/5g4 + 4/5g*s - 4/5g*3 + 2/5g*5 + 2/5g. 2(g - 1)3(g + 1)2/5 Let i(c) be the third derivative of c6/60 + c5/10 - c4/3 - 46c2. Determine o, given that i(o) = 0. -4, 0, 1 Suppose 0 = -2k - 3k + 15. Find y such that yk + 3y - 2 - 5y3 + y + 2y*4 = 0. -1, 1 Let r(i) be the third derivative of 0 + 1/80i*5 + 0i*3 - 1/32i*4 + 0i + 8i2. Factor r(m). 3m(m - 1)/4 Suppose -3f = -2 - 7. Let l = 0 + f. Factor 3v3 - 4v*2 + 3v*3 + v + 0v*l - 4v4 + v5. v(v - 1)4 Let n(d) be the second derivative of 3d5/40 - d4/8 + d - 1. Determine g so that n(g) = 0. 0, 1 Factor -4/11f3 + 2/11f - 2/11f4 - 2/11 + 4/11f*2 + 2/11f*5. 2(f - 1)*3(f + 1)2/11 Let h(x) = x2 + x - 1. Let a(y) = -2y3 + 12y*2 + 24y + 4. Let g(t) = -a(t) + 6h(t). Factor g(w). 2(w - 5)(w + 1)2 Let k(q) be the first derivative of -2/3q*4 + 5 + 0q*2 + 0q - 4/15q5 - 4/9q*3. Let k(y) = 0. What is y? -1, 0 Suppose -r - 31 = 5z, z - 7 = -0r + 2r. Let g be r/9(-3 - 0). Let 7o - 3o - 3o - o*g + 2 = 0. What is o? -1, 2 Let j = 2/1179 - -1570/1179. Factor 4/3k + 1/3k3 + jk*2 + 0. k(k + 2)*2/3 Let l be (27/(-36))/((-6)/16). Let y be 4/(-10) + l/5. Find v, given that 7v - v + y - 4 - 2v2 = 0. 1, 2 Let -1 + 5t*2 - 5t*2 - 2t - 2t2 + t2 = 0. Calculate t. -1 Let r(h) = -3h*4 - 30h*3 - 45h*2 + 2h. Let p(v) = -8v4 - 90v*3 - 135v*2 + 7v. Let s(a) = -2p(a) + 7r(a). Solve s(g) = 0. -3, 0 Let v(f) be the first derivative of 9/2f2 - 3f*4 - 2 + 0f*3 - 3f. Factor v(q). -3(q + 1)(2q - 1)2 Let y(o) = -o3 + o. Let d = 2 + -1. Let a = d + 0. Let h(k) = -3k*3 + 6k*2 - 10k + 8. Let c(q) = ah(q) - 2y(q). Factor c(u). -(u - 2)*3 Let t be ((-39)/9 - -4)/(3/(-36)). Factor 0 - 1/4n + 1/4n3 + 1/4n*t - 1/4n*2. n(n - 1)(n + 1)2/4 Let f be (-4)/10 + 6/15. Suppose 4k - 2l + 0l - 14 = f, l + 1 = -k. Suppose 2/7i3 + 0 + 8/7i*k + 8/7i = 0. What is i? -2, 0 Let p(y) be the second derivative of 147y5/40 - 77y*4/8 + 8y*3 - 3y*2 + 6y. Factor p(f). 3(f - 1)(7f - 2)2/2 Let v = 7 - 5. Suppose 2g*3 - 5g + vg2 + 3g - 4 + 2 = 0. Calculate g. -1, 1 Let l = -33 - -33. Let y(n) be the third derivative of -2n2 + 0n*3 + ln - 1/42n4 + 1/420n*6 + 0 - 1/210n*5. Solve y(s) = 0. -1, 0, 2 Solve 0l + 0l2 - 1/2l*3 + 0 + 1/4l*4 = 0 for l. 0, 2 Let v be (-5 - -4)/((-3)/18). Suppose h = vh. Factor 1/3*c	{ "pile_set_name": "DM Mathematics" }
divided by 118? 115 What is the remainder when 135884 is divided by 15086? 110 What is the remainder when 1405 is divided by 282? 277 What is the remainder when 25661 is divided by 420? 41 Calculate the remainder when 431913 is divided by 17275. 38 What is the remainder when 406 is divided by 95? 26 What is the remainder when 3296 is divided by 208? 176 What is the remainder when 197549 is divided by 43? 7 What is the remainder when 4461 is divided by 907? 833 What is the remainder when 17065 is divided by 3108? 1525 What is the remainder when 272709 is divided by 132? 129 Calculate the remainder when 160258 is divided by 3270. 28 Calculate the remainder when 71366 is divided by 366. 362 What is the remainder when 73683 is divided by 6140? 3 Calculate the remainder when 74592 is divided by 37276. 40 Calculate the remainder when 5984 is divided by 431. 381 Calculate the remainder when 23776 is divided by 79. 76 What is the remainder when 78224 is divided by 175? 174 Calculate the remainder when 140759 is divided by 1224. 1223 What is the remainder when 23311 is divided by 78? 67 Calculate the remainder when 22560 is divided by 1149. 729 Calculate the remainder when 12429 is divided by 3933. 630 What is the remainder when 3907 is divided by 87? 79 What is the remainder when 1732 is divided by 194? 180 What is the remainder when 1140 is divided by 89? 72 Calculate the remainder when 850 is divided by 213. 211 What is the remainder when 79879 is divided by 17? 13 Calculate the remainder when 70977 is divided by 93. 18 What is the remainder when 951168 is divided by 39? 36 What is the remainder when 1158 is divided by 105? 3 What is the remainder when 10936 is divided by 2151? 181 What is the remainder when 455526 is divided by 664? 22 What is the remainder when 3459 is divided by 3459? 0 Calculate the remainder when 17553 is divided by 163. 112 What is the remainder when 55333 is divided by 119? 117 What is the remainder when 651 is divided by 319? 13 What is the remainder when 4237 is divided by 191? 35 Calculate the remainder when 40536 is divided by 1621. 11 What is the remainder when 43645 is divided by 5423? 261 What is the remainder when 26248 is divided by 5234? 78 What is the remainder when 21499 is divided by 1630? 309 Calculate the remainder when 14198 is divided by 67. 61 What is the remainder when 58751 is divided by 200? 151 Calculate the remainder when 14223 is divided by 837. 831 What is the remainder when 18714 is divided by 2397? 1935 What is the remainder when 8357 is divided by 17? 10 What is the remainder when 22628 is divided by 111? 95 What is the remainder when 14136 is divided by 104? 96 What is the remainder when 490628 is divided by 215? 213 Calculate the remainder when 1339 is divided by 229. 194 What is the remainder when 58179 is divided by 594? 561 Calculate the remainder when 694447 is divided by 151. 149 What is the remainder when 137703 is divided by 94? 87 Calculate the remainder when 677 is divided by 353. 324 Calculate the remainder when 53631 is divided by 8935. 21 Calculate the remainder when 14088 is divided by 4663. 99 What is the remainder when 6860 is divided by 26? 22 Calculate the remainder when 33982 is divided by 15. 7 Calculate the remainder when 1808 is divided by 107. 96 Calculate the remainder when 14684 is divided by 4892. 8 What is the remainder when 2786 is divided by 542? 76 What is the remainder when 13296 is divided by 5? 1 What is the remainder when 28866 is divided by 128? 66 What is the remainder when 1863 is divided by 1840? 23 Calculate the remainder when 5103 is divided by 269. 261 Calculate the remainder when 19879 is divided by 3843. 664 What is the remainder when 18898 is divided by 225? 223 Calculate the remainder when 8989 is divided by 58. 57 Calculate the remainder when 96092 is divided by 16010. 32 Calculate the remainder when 180645 is divided by 13. 10 Calculate the remainder when 16911 is divided by 404. 347 Calculate the remainder when 9489 is divided by 207. 174 Calculate the remainder when 183427 is divided by 80. 67 What is the remainder when 2212 is divided by 159? 145 What is the remainder when 80171 is divided by 943? 16 Calculate the remainder when 27557 is divided by 82. 5 Calculate the remainder when 146055 is divided by 49. 35 What is the remainder when 912672 is divided by 1138? 1134 Calculate the remainder when 43418 is divided by 542. 58 Calculate the remainder when 99923 is divided by 13. 5 What is the remainder when 3724 is divided by 32? 12 What is the remainder when 18970 is divided by 1387? 939 What is the remainder when 7873 is divided by 15? 13 Calculate the remainder when 27007 is divided by 9. 7 What is the remainder when 180585 is divided by 52? 41 Calculate the remainder when 10416 is divided by 549. 534 What is the remainder when 189399 is divided by 10520? 39 What is the remainder when 22585 is divided by 27? 13 What is the remainder when 6013 is divided by 380? 313 Calculate the remainder when 2802 is divided by 620. 322 Calculate the remainder when 111609 is divided by 131. 128 What is the remainder when 12090 is divided by 46? 38 What is the remainder when 5395 is divided by 384? 19 What is the remainder when 2020 is divided by 738? 544 What is the remainder when 3067 is divided by 53? 46 What is the remainder when 45170 is divided by 189? 188 Calculate the remainder when 7759 is divided by 1808. 527 Calculate the remainder when 269638 is divided by 126. 124 What is the remainder when 705447 is divided by 22? 17 What is the remainder when 13748 is divided by 9? 5 Calculate the remainder when 5806 is divided by 41. 25 What is the remainder when 934 is divided by 776? 158 What is the remainder when 402949 is divided by 76? 73 Calculate the remainder when 26056 is divided by 12958. 140 Calculate the remainder when 744940 is divided by 8277. 10 What is the remainder when 24952 is divided by 960? 952 Calculate the remainder when 32120 is divided by 365. 0 Calculate the remainder when 9528 is divided by 27. 24 Calculate the remainder when 99455 is divided by 19. 9 What is the remainder when 4763 is divided by 85? 3 Calculate the remainder when 567 is divided by 114. 111 Calculate the remainder when 1986 is divided by 558. 312 Calculate the remainder when 6597 is divided by 140. 17 Calculate the remainder when 55766 is divided by 55559. 207 What is the remainder when 21611 is divided by 34? 21 Calculate the remainder when 22298 is divided by 1061. 17 What is the remainder when 2060 is divided by 344? 340 What is the remainder when 46375 is divided by 527? 526 What is the remainder when 1932 is divided by 311? 66 Calculate the remainder when 196967 is divided by 196957. 10 Calculate the remainder when 12149 is divided by 58. 27 What is the remainder when 15090 is divided by 2506? 54 Calculate the remainder when 91215 is divided by 48. 15 Calculate the remainder when 5368 is divided by 2638. 92 What is the remainder when 1846 is divided by 6? 4 Calculate the remainder when 30566 is divided by 30494. 72 What is the remainder when 5850335 is divided by 13? 10 What is the remainder when 14878 is divided by 855? 343 Calculate the remainder when 21335 is divided by 194. 189 Calculate the remainder when 18800 is divided by 177. 38 Calculate the remainder when 1936673 is divided by 25. 23 What is the remainder when 83408 is divided by 67? 60 What is the remainder when 794 is divided by 3? 2 Calculate the remainder when 7124 is divided by 546. 26 What is the remainder when 373674 is divided by 170? 14 What is the remainder when 218507 is divided by 122? 5 Calculate the remainder when 687277 is divided by 343632. 13 What is the remainder when 1529993 is divided by 125? 118 What is the remainder when 180451 is divided by 1611? 19 What is the remainder when 77760 is divided by 2592? 0 Calculate the remainder when 1536 is divided by 641. 254 Calculate the remainder when 5295 is divided by 38. 13 Calculate the remainder when 11567 is divided by 47. 5 Calculate the remainder when 40671 is divided by 20327. 17 What is the remainder when 55797 is divided by 120? 117 Calculate the remainder when 23340 is divided by 864. 12 What is the remainder when 155969 is divide	{ "pile_set_name": "DM Mathematics" }
e p(8). 12 Let m(o) = o - 2. Let r be m(4). Let x(p) = -1 + p*2 - r + 0p + 2p + p. Determine x(-3). -3 Let o(z) be the second derivative of -1/12z*4 + 0z*3 + 0 - 3z*2 + z. Let c = -6 + 6. Calculate o(c). -6 Let g(r) = -r - 8. Suppose 5x - 5p + 10 = 0, -5x - p = -3p + 22. Determine g(x). -2 Let a(g) = 36 - g3 - 72 - g2 + g2 + 2g + 30 + 4g2. Suppose 3k - r = 5k - 11, 32 = 5k + 4r. What is a(k)? 2 Let d(g) = 3g + 6. Let m(u) = -2u - 6. Let z(p) = -3d(p) - 4m(p). Let x = 38 - 13. Suppose 7r = 2r + x. Calculate z(r). 1 Let a = -3 + 2. Let s be 0/a - (0 + 0). Let w(k) = -k + 8. Give w(s). 8 Let k(s) = s3 + s + 1. Let n(b) = -8 - 7 + 13 - 6b - 7b3 + 5b*2. Let y(i) = -6k(i) - n(i). Determine y(5). -4 Let f be 0/(4/21). Let u(k) = -10k*3 + 4k*2 - 4k + 1. Let l(j) = 7j3 - 3j*2 + 3j - 1. Let g(n) = 7l(n) + 5u(n). Give g(f). -2 Let q = 0 - -1. Let n(v) = -v*2 - v + 4. Let j(m) = -m + 3. Let p(u) = 5j(u) - 4n(u). Let x(w) be the first derivative of p(w). Give x(q). 7 Let u(j) be the second derivative of j5/10 + j4/4 + j3/3 + 3j*2/2 + 22j. Suppose z = 2w - 4z - 1, -5w + 4z - 6 = 0. Calculate u(w). -5 Let g(y) = 21 - y*2 + 16 + 8y - 43. Give g(5). 9 Let m(o) = -o - 5o3 + o3 + 3o*3 + 6o*2 - 5. What is m(6)? -11 Suppose -25 - 5 = 6w. Let b(i) = -i - 7. Determine b(w). -2 Let d = 2 - 2. Let u(p) = p*2 + 6p + 8. Let k be u(-4). Let v(x) = x - 4 - 2 - 2x + k. Calculate v(d). -6 Let x be 1 - (2/2 - 2). Suppose -2r = xr + 4. Let t(w) be the second derivative of w5/5 + w3/6 + w2/2 + 454w. Determine t(r). -4 Let x(n) = -2n3 + n2 - 1. Let m be x(-1). Suppose -5i - b + 3 = 0, 2i + b = -0i. Let r(q) = -q + 4q - q + i. What is r(m)? 5 Let f = 13/6 - -4/3. Let u(k) be the second derivative of -1/12k*4 - 2k + k*3 + fk*2 + 0. Determine u(5). 12 Let v(n) = 2n + 1. Let j(r) = 4r + 1. Let w be j(1). Suppose -4g + 16 = -wp, p = -4g - 8 + 24. What is v(g)? 9 Let u(d) be the third derivative of 0d + 1/360d*6 - 1/40d*5 - 1/3d*3 + 1/24d*4 + 0 + 3d*2. Let p(x) be the first derivative of u(x). Give p(5). 11 Let g(h) = 6 + 3h - 4h - h + 0h. Calculate g(4). -2 Suppose -5k + 16 = 4x - 4, -8 = 4x - 2k. Let o(f) = f3 + f2 + 5. Calculate o(x). 5 Let d(j) = 2j3 + 12j*2 - 5j. Let z(f) = -f*3 - 6f*2 + 2f. Let q(y) = -6d(y) - 13z(y). Determine q(-4). 16 Let n(b) = -2b2 + 10b + 1. Let t(i) = -5 + 3i2 - 3 + 7 - 11i. Let y(l) = 4n(l) + 3t(l). Give y(-5). -9 Suppose -5g = 2p - 13, 2 - 1 = -4p - g. Let v(i) = 3i - 1. Let l(y) be the first derivative of -2y2 + y - 2. Let m(c) = 6l(c) + 7v(c). Give m(p). 2 Let d(y) = y3 + 5y2 + 2. Suppose p = -7 + 2. Let q be d(p). Let h(x) = x2 - x - 3 + 4x + 0x. What is h(q)? 7 Let t(p) = -2p - 8. Let f(o) = -3o - 16. Let s(d) = 3f(d) - 5t(d). Calculate s(8). 0 Let g = 39 - -41. Let q be (-6)/4g/24. Let p(l) = -l2 - 7l - 5. Calculate p(q). 5 Let v(q) be the first derivative of -q4/4 + q2/2 - q - 12. What is v(0)? -1 Let l = -15 - -18. Suppose v - lv = 2. Let z(q) be the third derivative of q6/120 - q5/60 + q3/6 + 2q*2. Calculate z(v). -1 Let o(x) = 3x. Let n(i) = -i. Let d(l) = 5n(l) + 2o(l). Let w = -7 - -1. Give d(w). -6 Let m(l) = 2l2 - 2l - 1. Suppose -4u = -u - 12. Let s = u - 1. Suppose -5n + 5 = 3p + 2p, -5n - s = p. Determine m(p). 3 Let a be (-2)/(-2) + -41. Let m(p) = 6p2 - 597 + 593 - p2 + p3 + 2p. Give m(a). 8 Let r be (-1)/1 + 2 + -5. Let w(a) = a - 4. Let i(g) = 3g - 9. Suppose -5z - 4 = -19, 3u = 4z + 15. Let j(k) = ri(k) + uw(k). Give j(2). -6 Let u be (-24)/7 + (-6)/(-14) + -2. Let y(g) = -g*2 - 4g + 5. What is y(u)? 0 Let j = -30 + 29. Let k(b) = -4b2 + 3b - 2. Let q(m) = -19m2 + 16m - 11. Let f(h) = 11k(h) - 2q(h). What is f(j)? -7 Let c(o) be the third derivative of o6/120 - o5/10 + o4/12 - o3 + 3o2. What is c(6)? 6 Let x = -89 + 94. Let m(y) = y3 - 4y*2 - 7y - 2. Determine m(x). -12 Let w(f) = -f - 1. Let a(l) = -8l - 5. Let v(u) = -4u - 2. Let s(m) = 2a(m) - 5v(m). Let h be -2((-9)/6)/(-3). Let k(g) = hs(g) + w(g). Determine k(1). -6 Let l = 0 + 7. Let d = -4 + l. Let c(w) = 4w2 + w2 - 3w*2 - 1 - dw - 3w2. Calculate c(-2). 1 Let m = -3 - -6. Let o(n) be the second derivative of n3/3 + 3n*2/2 + 26n. Give o(m). 9 Let g(f) = 4f + 2. Suppose -5i - 3i = -32. What is g(i)? 18 Let q be -3 + 3 + -1 - -7. Let s(t) = t. Calculate s(q). 6 Let h(u) be the third derivative of u4/24 - 7u*3/3 + 3u*2. What is h(6)? -8 Suppose 5f - 3 = 2u - u, 4u + 12 = 0. Let r = f - 2. Let h(d) be the third derivative of d5/60 + d4/24 - d*3/3 + 3d2. Give h(r). 0 Let r(w) be the third derivative of w7/5040 + w6/720 + w5/30 + w*2. Let j(f) be the third derivative of r(f). Calculate j(0). 1 Let s(a) = 0a - 4 - 3a - 2. Suppose -15 = -2k - k. Let y(r) = -r*2 + 5r - 4. Let d be y(k). Determine s(d). 6 Let m(t) = t - 5. Let g = 6 + -1. Calculate m(g). 0 Suppose -2b = -6b + 8, 2t - 5b - 56 = 0. Suppose r - t = -6. Suppose -r = 5o - 2. Let y(p) = -p2 - 7p - 2. Determine y(o). 8 Let q(r) = r*3 + 6r*2 + 6r + 2. Suppose -p - 4h - 9 - 11 = 0, 3p = -2h - 20. Give q(p). 10 Let k = -2 - -4. Suppose 4l - 3a = 2 + k, 2a = -4l + 24. Suppose 2t + 10 - 1 = 5r, -lr - 5t = -27. Let n(v) = -v2 + 4v. Give n(r). 3 Let c be (-1)/2 + 21/6. Let w(v) be the first derivative of v*2/2 - v + 41. Calculate w(c). 2 Let p(w) = w + 2. Let l be p(-4). Let i(q) = 3q*3 - 8q*2 + 4q*2 - 3q + 2q3 - 7q*3. Determine i(l). 6 Let u(n) be the second derivative of -2n*3/3 - 3n*2 + 3n. Determine u(-4). 10 Let m(j) = -j*2 + j - 1. Let a(c) = -10c*2 - 4c + 1. Let o(k) = a(k) + 2m(k). Suppose 2t = 5u + 4t + 1, -4t + 3 = 5u. Determine o(u). -11 Let r be 8/2 + 4 + -3. Let g(c) = c*3 - 6c*2 + 4c + 6. Give g(r). 1 Let t(z) = 5z - 5. Let c be t(9). Let a(s) = 2s + 38 - c - s. Let k be (0 - 0) + 4 - -2. Determine a(k). 4 Let t(n) = -5n2 - 2n + 6. Let j(y) = 4y2 + 2y - 5. Let o(v) = 4j(v) + 3t(v). What is o(-2)? -2 Let c(y) = -y*2 + 5y + 3. Let o = -12 + 19. Let r(i) = i*3 - 8i*2 + 7i + 5. Let w be r(o). Calculate c(w). 3 Let t(z) = -z - 7. Let p = -7 + 4. Let s(v) = -v - 7. Let y(c) = ps(c) + 2t(c). What is y(-6)? 1 Let f(s) be the third derivative of -s*2 - 1/6s*3 - 1/30s*5 - 1/120s*6 + 1/12s*4 + 0s + 0. Determine f(-3). 2 Let h(b) = -b + 2. Let i(x) = 9 - 3x + 4 + 2x - 3. Let l be i(7). What is h(l)? -1 Suppose 0h + 12 = -h + 4p, 9 = 5h + 3p. Let v(s) = -s3 - s2 + s - 3. What is v(h)? -3 Let s = -5 + 5. Let j(t) = -t2 + t - 8. Calculate j(s). -8 Let v(k) = k2 + 3k + 15. Let g(p) = 6p*2 + 16p + 75. Let m(u) = -2g(u) + 11v(u). What is m(0)? 15 Let d(z) = 3z2 + 4 - 2 - z + z3 + 0z*2. Suppose x = -2x. Let y = -3 + x. Calculate d(y). 5 Let x(l) be the second derivative of l*3 + l. Let p = 15 + -14. Give x(p). 6 Let n = -6 - -7. Let z = n - 2. Let d(f) = 4f + 3. Let w(b) = -1. Let u(o) = zd(o) - 2w(o). What is u(1)? -5 Let j(c) be the second derivative of -c5/10 + c2/2 + c. Calculate j(-1). 3 Let b(s) = 0s + s - s - s - 12. Give b(-9). -3 Let w = -49 - -85. Suppose -3s = -2s - 18. Let f be 4/s + (-188)/w. Let i(t) = t + 11. Give i(f). 6 Let i(s) = 9s - 3. Let r(a) = 10a - 3. Let q(k) = -7i(k) + 6r(k). Determine q(3). -6 Let i(u) be the second derivative of -2u*4/3 + 4u. Let k(b) = b*2 + 6b - 1. Let j be k(-6). Give i(j). -8 Let a = 9 + -8. Let y(z) = 12z3 + 2z2 - 1. Determine y(a). 13 Let p(k) be the third derivative of -k6/120 + k5/30 + k3/3 - 3k2. Give p(2). 2 Let i = 7 - 10. Let f(v) = -v + 4. Let l(h) = h - 3. Let p(y) = il(y) - 4f(y). Determine p(9). 2 Suppose 5 = 2t - 5. Suppose -5u - 4v + t = 0, -u - 2u + 3v + 30 = 0. Let d(y) = 0y - 6y - y*3 - 3y + 6y2 + 2y + 7. Give d(u). -3 Let o(a) = 8a3 - 3a*2 - a + 3. Let c(b) = -9b*3 + 2b*2 + b - 2. Let d(g) = -3c(g) - 2o(g). What is d(1)? 10 Suppose 4f = -20, -2l - 11 + 2 = 3f. Let u be (-6)/(l-1)2. Suppose -q = 3q + u. Let m(n) = n2 + n + 1. Give m(q). 1 Let j(y) = -y2 - 2y + 4. Let r = -86 - -82	{ "pile_set_name": "DM Mathematics" }
Let v be j(-4). Suppose -vr = -r - 50. Suppose -2o + 139 = -rc, -5o + 154 = -c - 228. What is the units digit of o? 7 Let c(p) = 4p + p - 20 + 2p - 8p - 10p + 250p2. What is the thousands digit of c(-2)? 1 What is the hundreds digit of (-6760)/(-3)(-13)/6596/(-4)? 8 Let o(s) = -2s + 22. Let u(k) = 5k - 68. Let g(v) = -8o(v) - 3u(v). What is the units digit of g(-5)? 3 Let s(x) be the first derivative of x4/4 - x3/3 + 6x*2 - 5x + 33. Let g be s(4). Let r = g + 74. What is the tens digit of r? 6 Let k = 50849 - 29709. What is the ten thousands digit of k? 2 Let w be -14 - (-11 - 4). Let x(m) = 14m - 22. Let y be x(w). What is the units digit of -4 + (-1y)/(-4)? 9 Suppose 47z = 5z - 33z + 934125. What is the thousands digit of z? 2 Let r(f) = 210f + 1305. What is the hundreds digit of r(27)? 9 What is the tens digit of ((-11420)/(-7))/(((-396)/(-63) - -4) + -10)? 1 Suppose -629923 - 125626 = -168v + 1292539. What is the tens digit of v? 9 Let t = 10 + 0. Suppose 1 = 3l - 2k, 0 = 6l - tl + k + 3. What is the units digit of (l - 0)/((-180)/(-44) - 4)? 1 Let i = 158 + -214. What is the tens digit of (85 - i)(-8)/(-6)? 8 Let q(g) = 39g*3 + 5g*2 - 57g - 122. What is the thousands digit of q(10)? 8 Let c be 4382/4 + (-9)/18. Suppose 0 = -t - 4t + c. What is the hundreds digit of t? 2 What is the ten thousands digit of ((-8)/((-320)/9870))/((-12)/(-496))? 1 What is the tens digit of ((34/(-6) + 7)3 - 2445)-7? 8 Suppose -13o - 275 = -8o. Let b = -47 - o. What is the tens digit of -236(1/(-6))/(b/12)? 5 Suppose 0 = 5n - 953 - 1552. Let k = n - 949. Let o = -267 - k. What is the units digit of o? 1 Let f = 94 + -90. Suppose k + fk = -k. Suppose 0 = -kb - 3b - 3, -a + 3b + 127 = 0. What is the hundreds digit of a? 1 Let v(c) = 85c*2 + 3c + 20. Let t(w) = 57w2 + 2w + 13. Let n(b) = 8t(b) - 5v(b). Let h = 2465 + -2467. What is the hundreds digit of n(h)? 1 Let r = -8998 - -15444. What is the thousands digit of r? 6 Let u(y) = -y2 + y - 3. Let p be u(3). Let c(f) be the third derivative of -f5/60 - 5f4/8 - f3/2 - 16f*2. What is the tens digit of c(p)? 5 Suppose -15y + 18y + 5u = 10760, 4y - 14336 = -4u. What is the hundreds digit of y? 5 Suppose 3g - 44 = -4w, -2w - 13 - 7 = -2g. Suppose a - gm - 286 = -9m, 3m + 870 = 3a. What is the tens digit of a? 9 Let t be (-2288)/(-13) - ((-6)/(-1))/(-2). Let p = -350 + t. What is the hundreds digit of 5/(-8 - -3) - p? 1 Let w(v) = 2976v - 5306. What is the units digit of w(7)? 6 Suppose 0 = 3o + 23 - 41. Suppose -u = 2l - 273, 10l - ol = u - 303. Let i = u - 152. What is the hundreds digit of i? 1 Suppose 75023 = -159f + 492706 + 234694. What is the thousands digit of f? 4 Suppose 5d = 7 + 38. Let t be ((-2)/4)/(d/270). Let v = t + 69. What is the units digit of v? 4 What is the ten thousands digit of ((-48)/(-12))/((-20)/(-149020))? 2 Let d be 4/(-10) + (-132)/(-30). Suppose 0 = -4u - 1398 + 1410. What is the units digit of u/(-6) - -2 - (-390)/d? 9 Suppose -l - 2s + 2481 = -2329, 2l - 4s = 9636. What is the thousands digit of l? 4 Let r be 5 + ((-1)/3)/((-1)/(-6)). Let c(d) = dr + 3d - 4d3 - 6 + 4d*3. What is the units digit of c(2)? 8 Let g = -878 + 882. Suppose 4q = gp + 5504, -26 = -3p - 20. What is the hundreds digit of q? 3 Let z(k) be the second derivative of -3k3/2 + 9k*2/2 - 33k. Suppose 3 = -5y - 37. What is the units digit of z(y)? 1 Suppose -2x - 23l = -21l - 12, 5x - 14 = 3l. Suppose xb + 409 - 1117 = 4n, -3n - 9 = 0. What is the tens digit of b? 7 Suppose 2h = 3864 + 4806. What is the units digit of h? 5 Suppose -9z + 58852 = 20584. What is the hundreds digit of z? 2 Let c = 12904 - -4875. Suppose 2389 - c = -27v. What is the tens digit of v? 7 Suppose 0 = 137f + 157687 - 248430 - 328614. What is the units digit of f? 1 What is the units digit of 65321 - (138 - 132)? 6 Suppose 4j + 26z = 28z + 1330, -j + 328 = -5z. Suppose -4t - j = -1653. What is the units digit of t? 0 Let n(q) = -176q - 106. Let l be n(-5). Suppose 1802 + l = 4v. What is the tens digit of v? 4 Let y(a) = -4 + 10a*2 + 2 + 2 + 17 + 21a + 1. What is the tens digit of y(11)? 5 Suppose -4v = -4l - 4, -v + 6 = -2l - 3v. What is the hundreds digit of 517 + (5 - 8) + l? 5 What is the thousands digit of ((-150)/(-300))/(1/79696)? 9 Suppose -n = -5c + 65190, 222n = -4c + 223n + 52153. What is the ten thousands digit of c? 1 Let h(n) = 305n2 - 25n + 3. What is the tens digit of h(4)? 8 Let n be 175/(-35/(-135)). Suppose 0 = -5w - 2w + n. Suppose 8g - 5g - w = 0. What is the units digit of g? 5 Let t(w) = 1200w - 411. What is the units digit of t(8)? 9 Let d = -16 - -18. Suppose -p + 14 = 2x - 0x, 0 = -dx + 2p + 2. Suppose 2l - 4l - xj = -205, 5l - 435 = 3j. What is the units digit of l? 0 Let z = -963 - -5295. What is the units digit of z? 2 Let x(n) = 4n*2 - 7n - 10. Let q be x(3). Suppose -qf + 822 = 5c - 243, -5f + 1061 = c. What is the hundreds digit of f? 2 Suppose 5f = -p + 3p - 1727, p - 3f - 863 = 0. Let t = -468 + p. What is the units digit of t? 8 Suppose 0 = a + 1 - 5. Suppose -7s = -as - 147. Suppose 44x - sx + 545 = 0. What is the hundreds digit of x? 1 Let v(i) = 27i + 643 + 2i*2 - 337 - 335. What is the hundreds digit of v(16)? 9 What is the tens digit of (-1 + 1 + -4)/(1194/(-10097061))? 2 Let s(x) = 224x*2 - 32x - 325. What is the tens digit of s(-10)? 9 What is the thousands digit of ((-340)/(-51))/((-1)/(-330))? 2 Suppose 2c = -2d + 450, -4d + 2c + 521 = -349. Let i = d + -163. What is the units digit of i? 7 Let f = 5 + -22. Let h be 4 - (-6)/((-12)/(-19))6. Let a = f + h. What is the units digit of a? 4 Suppose -227b = -235b + 224. What is the tens digit of 42/b(-416)/(-12)? 5 Suppose -23 = -23u + 23. Suppose 3z = ua + 275, -323 = -4z - 4a + 57. What is the units digit of z? 3 Suppose 2p = h - 417, 2h + 0p = p + 846. Suppose -2l + 5w = -h, 5w - 4w = 3. What is the units digit of l? 0 Let b be (-2 - (-5817)/(-6))/((-7)/14). Let c = b - 571. What is the hundreds digit of c? 3 Let w(b) = -2b3 + 10b*2 - 10b - 47. Let a be w(11). Let u = a + 2545. What is the units digit of u? 6 Let n(u) = 22536 - 22538 + 4u + 147u*3 - 3u*2 + 198u*3. What is the tens digit of n(1)? 4 Suppose -12c + 8c = -46c + 268926. What is the thousands digit of c? 6 Suppose 362 = v + 1293. Let d = v - -1749. What is the tens digit of d? 1 Suppose -f + 24o = 27o - 23951, 0 = 2f - 2o - 47830. What is the tens digit of f? 2 Suppose 0 = -2c + 2h + 20, 5h = 5c + 3h - 35. Suppose cp + 245 = 1155. Suppose -4y = p - 534. What is the tens digit of y? 8 Let h(b) = -15b*2 + 5b + 66. Let t(l) = l*2 + 2l - 1. Let r(o) = -h(o) - t(o). What is the thousands digit of r(10)? 1 Suppose 10 = 15x - 13x, 0 = -j + 3x + 335. Let i = -246 + j. What is the hundreds digit of i? 1 Let s(a) = 2a*2 - a + 13. Let w = 127 + -118. What is the units digit of s(w)? 6 Suppose 67z - 406350 = 22z. What is the hundreds digit of z? 0 Suppose 58j - 6 = 57j. Let m be (69/j - 1)4/(-6). What is the tens digit of 2 + ((-166)/(-8) - m/28)? 2 Suppose 2z - 4z = -14. Suppose 0 = -o + 3u - u + z, -5o + 5u + 35 = 0. Let n(v) = 14v - 8. What is the units digit of n(o)? 0 Let c(n) = -26n + 28. Let q be c(1). Suppose 2r - 4u - 2210 = 0, -6r - 4u + 4432 = -qr. What is the tens digit of r? 0 Suppose -3f + 5n - 9n - 852 = 0, -5n = -3f - 879. Let h = -73 - f. What is the tens digit of h? 1 Suppose 115o - 126o = -122122. What is the thousands digit of o? 1 Let t = -3756 - -6307. What is the hundreds digit of t? 5 Let p(a) = -15a + 34. Let f be p(-16). Let n = 163 - f. Let z = 95 - n. What is the tens digit of z? 0 Suppose 10u + 0u - 136875 = 5u. What is the tens digit of u? 7 Suppose -66c - 55c + 137c = 880320. What is the ten thousands digit of c? 5 Suppose -3b - 1781 = -5x, -2x + 3b + 338 + 369 = 0. Let y = x + -232. Let q = y - 26. What is the hundreds digit of q? 1 Suppose -19s = -10s - 18. What is the thousands digit of -10634/(-85)(37 - s)? 1 Let k = 8973 - 982. What is the tens digit of k? 9 Let z(o) = 615o*2 + o - 1. Let h = 1	{ "pile_set_name": "DM Mathematics" }
t i(p) = -p*2 - p + 1. Let u be i(0). Let v be x(u). Suppose -vg + 9 = -g. Solve 3 = gt - 0t for t. 1 Let j(o) = o*3 - 5o*2 - 3o + 7. Let n be j(6). Let k = 29 - n. Solve kv + 0 = 4 for v. 1 Suppose 2n - 32 = 6n. Let u = n + 13. Suppose 0 = ux - 10, -3c = c - 5x - 30. Solve 0 = -0r - 2r + c for r. 5 Let j(n) = -3n + 7. Let i(h) = 4 - 3h + 4 + 0. Let b(q) = -6i(q) + 5j(q). Let x be b(6). Solve xw - 8 = 17 for w. 5 Suppose 2y - 97 + 8 = -5o, -2o + 24 = -5y. Solve 0 = z + 13 - o for z. 4 Let h = -575 + 584. Solve -7 + h = -t for t. -2 Suppose 4 = -4d - 0, 0 = 2s - 4d + 92. Let a be (-10)/55 + s/(-22). Suppose -2x = -6x. Solve ap - 3p = x for p. 0 Let z = -23 + 23. Let d = -3 + 4. Suppose 9 = 8o - 7o. Solve -2k - d + o = z for k. 4 Suppose 2s - 3 + 1 = 3b, -b + 3 = 3s. Solve b = 3v + 1 - 4 for v. 1 Let a be (-16)/(4 + -6) + -4. Suppose am - 12 = 4. Solve -7 = -n - m for n. 3 Suppose -6q = -3q + 57. Let w = q - -25. Let f be (1 + -4)w/(-9). Solve -y - f = y for y. -1 Let d(l) = -32l - 223. Let h be d(-7). Solve 8 = 7a + h for a. 1 Let j be -1 + -2 - (1 - 4). Let q(k) = -2k*2 - 38k - 16. Let l be q(-18). Suppose 0b - 4b + l = j. Solve -19 = bv + 1 for v. -4 Suppose 5k + l + 27 = -18, -4l + 50 = -3k. Let q(i) = i*2 + 11i + 13. Let c be q(k). Solve -12 - 3 = cz for z. -5 Let t be (31)/(9/6) + -2. Solve n + t = 3 for n. 3 Let v = 339 - 336. Solve 5o + v = 8o for o. 1 Let z(l) = -l*3 + 30l*2 + 30l + 76. Let q be z(31). Solve -q = -c + 10c for c. -5 Let d(q) = -10q - 2 - q*2 - 13 + 1. Let j be d(-8). Solve z = jz - 3 for z. 3 Let k(s) = -5s - 98. Let j be k(-20). Solve u - 3 = j for u. 5 Suppose -4x + 17 = -31. Suppose 60w - 58w - x = 0. Solve -7m = -wm - 1 for m. 1 Suppose -16v = -36v + 100. Solve l + 4 - v = 0 for l. 1 Let k(d) = -d. Let h = 4 + -7. Let o be k(h). Suppose 88s - 33s = 275. Solve -op = -4 - s for p. 3 Let q be 56/6 + 18/(-54). Solve 0x = -qx - 9 for x. -1 Suppose 3u - 15 = 0, 4u - 19 = -2w + 7. Suppose -3s + 5b = -30, wb - 8 = -4s - b. Solve -8c + s = -3c for c. 1 Let x be (-6 - -2)(-405)/36. Solve 14p + x = 3 for p. -3 Suppose 6j = 36 - 12. Let a(f) = -f3 + f2 + f + 8. Let u be a(0). Solve -j - u = -3y for y. 4 Let h(c) = -c*3 - 8c*2 + c + 11. Suppose 3r - w = 2w - 9, 4r + 52 = -4w. Let y be h(r). Solve 4 = yn - 8 for n. 4 Suppose 3m = 1 + 5. Let t = 205 + -202. Solve h - t = -mh for h. 1 Let r be 26/363. Solve 0 = -4m - 11 - r for m. -3 Let l(i) = -i3 - 12i*2 - 9i + 28. Let o be l(-11). Solve 5t - 19 = o for t. 5 Suppose 4d + 4o - 20 = 0, 2o = 9d - 5d - 20. Solve -d = -5j + 5 for j. 2 Suppose -3c = 5n - 3n - 4, 2n - 3c = 28. Solve -9i + 2 = -ni for i. 2 Suppose -5g + 56 = -49. Let o be (-6)/g - (-46)/14. Suppose -ou + 16 = -2p + 2u, -p - 2u = -10. Solve 3c + p = -4 for c. -2 Let t be (-1)/(-3) + -1 + 88/(-12). Let l = t - -12. Solve lq + 1 + 3 = 0 for q. -1 Let o = 81 + 69. Solve 4y - 166 = -o for y. 4 Suppose 3w - 2s - 10 = -3s, -w + 5 = 2s. Suppose -2h + 60 = wh. Solve -5y + y = -h for y. 3 Suppose -p + 5 = 2. Suppose 0 = pq + 6q - 72. Solve 7d = 3d - q for d. -2 Suppose 4f + 4 = -0f, -4l - 106 = -2f. Let q be (18/l)/((-2)/42). Solve 0 = -4x - q + 2 for x. -3 Let w(s) = s + 18. Suppose 3n = 0, 2l = l + 5n - 16. Let a be w(l). Solve -ak = -k for k. 0 Suppose 3z + 435 = 3m, -4m + 5z - 22 + 605 = 0. Suppose -5g - 17 + m = 0. Solve 0b - 5b = g for b. -5 Suppose 3j = -j + 4. Let o be 13 + (j - (3 - 2)). Let p = 13 - o. Solve p = -4n + 2 + 6 for n. 2 Suppose -2f - 23 = -5p, -10p + f = -6p - 16. Solve 2y - 1 - p = 0 for y. 2 Let y(i) = i*2 - i + 4. Let n be y(5). Solve -16b + n = -24b for b. -3 Suppose 0d = -d. Suppose d = -4r + 4y + 20, -r - 3r + 3y + 19 = 0. Suppose 4p = 3l + r, 3p - 2l - 8 = -p. Solve q = -0q - p for q. -4 Let v = -59 + 59. Suppose 7y - 4y - 2u - 17 = v, 11 = y - 2u. Solve yr - r = 0 for r. 0 Let x = -158 - -161. Suppose r - 2r = -4q - 22, -5r = -5q - 35. Solve -rn + xn = 0 for n. 0 Suppose 8j - 5j = 4n + 126, -5n + 15 = 0. Solve -jq = -50q for q. 0 Suppose -4i = 5m - 80, 4m + i = -0m + 75. Let z be 1/5 + (-152)/10. Let g = m + z. Solve -2p - g = 3p for p. -1 Suppose -8 + 0 = -4o. Suppose 6 = 3z + 3h, -h + 12 - o = 5z. Let g(m) = m*2 - 1. Let y be g(2). Solve -20 = yw + zw for w. -4 Let k(o) = -o3 + 5o*2 - 7o + 10. Let m be k(4). Let x = m + 6. Solve -7 = xs + 1 for s. -2 Let m be -6116/(-6). Solve 13h - 9h - m = 0 for h. 4 Let o = 126 - 122. Solve 0 = -of + 3f - 4 for f. -4 Let h be (05/(-25))/(-3). Solve -12 + h = 4r for r. -3 Suppose 0 = -1354q + 1350q + 20. Solve -qx - 3 = 7 for x. -2 Suppose -348 + 328 = -w. Solve 19 - w = f for f. -1 Let t = -6 - -40. Suppose t = 3i - 4k, 3i - 3k - 34 = -4. Suppose -n + in = 0. Solve b - 2 + 4 = n for b. -2 Let j(a) = -a - 17. Let q be j(-8). Let g be 6/18 - (-3)/q. Let x be 3 + (0 - 2 - g). Solve -4 = 3b - x for b. -1 Suppose 5t - 325 - 38 = 3a, 3t + 5a - 245 = 0. Let p = -73 + t. Solve -12 + 4 = -pk for k. 4 Let j = -2 + 14. Solve -j = -13l + 9l for l. 3 Let x = 32 + -30. Suppose -3v - 4 = -k + xk, -v = k + 4. Let s = -2 - -2. Solve vq - q - 3 = s for q. -3 Suppose -5c + 67 = -8. Let a = 18 - c. Solve ao = o + 2 for o. 1 Let a be (-110)/(-7) - (-18)/63. Let l = -10 + a. Solve -4w = -lw for w. 0 Let n(p) = 2p2 - 3 - 2p + 2 + 0. Let i = 98 + -96. Let u be n(i). Solve -5 = uz + 4 for z. -3 Let g(u) = -u3 - 2u + 3 + 1 + 4u2 - 2. Let p be g(3). Let k be (-6)/10 - (-33)/p. Solve 0 = 3b - k - 9 for b. 5 Let n(k) = -3k - 54. Let m be n(-18). Solve -p + m = -1 for p. 1 Let t = 43 - 53. Let r(u) = -3u*3 + 3u*2 - u + 2. Let f be r(2). Let b = t - f. Solve 0 = -0h - h + b for h. 2 Let c(p) = p*2 + 5p - 39. Let m be c(-13). Let t = 74 - m. Solve 2n - t = -n for n. 3 Suppose -24o + 19o = 5. Let i be (0 - (16 + -1))o. Solve g = 4g + i for g. -5 Let i(s) = s3 + 5s*2 + 2s - 5. Let f be i(-4). Suppose fy = -h + 10, y + 3h - 14 = -0. Solve -ya - 11 + 3 = 0 for a. -4 Let n(h) = -5h - 95. Suppose 0 = -5s + 1 - 96. Let w be n(s). Solve 3z + w = 12 for z. 4 Let g(i) = 2i - 3. Let d be g(4). Let o = 9 - d. Let m = o + -2. Solve v = -m + 1 for v. -1 Let a(u) = -27u + 132. Let n be a(4). Solve -nv = -23v for v. 0 Let m = 41 - 95. Let w = 26 - 60. Let u = w - m. Solve p + u = -3p for p. -5 Let k(j) = -j3 - 6j*2 - 2j + 10. Let s be k(-7). Let v = s + -67. Solve -2 - v = -2w for w. 4 Suppose -h - 20 = 4d - 2h, -3d - 32 = -5h. Let s be ((-2)/2)/(d/20). Suppose 35 = sc + 3v + 2v, 0 = 2v - 8. Solve 0 = -ca + a for a. 0 Let f = -2 + 1. Let v be 0 - (f - (0 - -1)). Suppose vk + 2 = 6. Solve -5q = -kq - 15 for q. 5 Let g be 8/(-10) + 24/(-20). Let o(l) = 14l. Let p be o(g). Let c = p + 31. Solve c + 12 = -3j for j. -5 Let l(r) = r2 - 12r + 23. Let f be l(10). Suppose -x - 3a - a = 2, -5a - 11 = -fx. Solve -k = -3 + x for k. 1 Suppose -16 = -4i, 3i + 6 - 39 = -3c. Suppose 4k - 16 = -2r, -cr + 11 = -6r + 3k. Solve -rt + 3 = -t for t. 3 Suppose -60n + 53n + 77 = 0. Solve -n = 4z - 3 for z. -2 Let n(v) = v3 - 10v*2 + 8v + 15. Let y be n(9). Suppose -10p + 8 = -yp. Solve 0q + p = q for q. 2 Let r be 2/833(15 + -11). Let f = -30 + r. Solve -fs = -s for s. 0 Let x(z) = 3z + 9. Let k be x(-3). Let y = k - -3. Let l be 11 + y - (0 + 2). Solve 0 = -3a - l + 3 for a. -3 Let r(n) = 6n2 - 17n*3 - 5n + 18n3 - 18 - 8. Let y be r(-6). Solve yx + 12 = -0x for x. -3 Suppose 40 - 20 = 4j, -2j = n - 15. Solve 4m = n + 15 for m. 5 Suppose w + 0r - 3r = 3, 2w - 6 = -3r. Suppose -5o + 0o - 5 = -4m, 2m - 5o = 5. Solve m = -wq + 2 - 5 for q. -1 Let u be (-282)/(-54) + (-76)/18 + 4. Suppose 0 = 5d - 3d - 8. Suppose -d = l - u. Solve -13 + l = 3i for i. -4 Let n(o) = o2 + 3o - 9. Let l be n(-6). Let g be -2 - (-2 - -3 - l). Suppose -gu + 55 = -u. Solve -u = -3f + 4 for f. 5 Suppose -5o = -3k - 29 - 6, -14 = -2o + 5k. Suppose 5d = 2j - 15, -od - 20 = -3j - 2d. Solve 3 - 23 = -jn for n. 4 Let b be ((-390)/(-15) + -16)*3/5. Solve -7 = -q - b for q. 1 Suppose 3	{ "pile_set_name": "DM Mathematics" }
asing order. 18, 3, b, -4 Let q(c) = c*2 - 8c - 19. Let t(b) = 1. Let r(i) = -q(i) - t(i). Let h be r(10). Sort -1, h, 2. h, -1, 2 Suppose 0 = -4j - s + 156, 4s = -2j + 84 - 20. Let g = j + -41. Let b = -3 + 4. Put 4, b, g in decreasing order. 4, b, g Let l(t) = t3 + 18t*2 + 43t - 3. Let g be l(-3). Suppose -2r = 4 - 0, 4a - 36 = 2r. Sort g, 4, a. g, 4, a Let k(u) = -6u + 41. Let g be k(-7). Let w = g - 87. Let l = -6 + 4. Sort 3, l, w in decreasing order. 3, l, w Suppose -7q = -6 - 29. Let b(v) = -v2 - 7v. Let k be b(-7). Sort q, 1, k, 4 in descending order. q, 4, 1, k Let m be (-3)/9-3 + 5. Let j = -10 + m. Let z = j + 4. Put 3, z, -4 in descending order. 3, z, -4 Let c be 32/12 + (-3)/(-9). Suppose x - 8 = -m, -cm + 16 = m. Suppose 0 = 4q + 4o + 20, -3o = xq - 0q + 15. Put q, 4, 5 in decreasing order. 5, 4, q Suppose 45 = -4x - x - 5u, -4x = -5u + 72. Let c be (x + 2)/((-3)/(-6)). Let z = c + 21. Sort z, -3, -2 in descending order. z, -2, -3 Let t(x) = -3x*2 - 50x + 13. Let s be t(-17). Suppose q = -5y + 2q - 5, -q - 5 = 0. Sort 3, s, y. s, y, 3 Let k = 623 - 625. Put -2.5, k, -0.5 in increasing order. -2.5, k, -0.5 Let m = -20.03 + 19.5. Sort 0.4, -4, m, -3 in descending order. 0.4, m, -3, -4 Suppose 2 = -2f - 2. Suppose 0 = -q - 4 - 1 - 0. Put f, 3, 5, q in descending order. 5, 3, f, q Suppose -6h - 5 = 7. Suppose 9j + 919 = 883. Put 1, 8, j, h in descending order. 8, 1, h, j Suppose 5 = -9w - 31. Sort w, -10, -7. -10, -7, w Let x = -4.9 + 4.9. Put 0.5, x, 4, 1 in increasing order. x, 0.5, 1, 4 Let v = 992 - 996. Suppose 0 = -6z + 3z + 9. Suppose -zl = 5c + 2l, -l = -c - 4. Sort v, 1, c in descending order. 1, c, v Suppose -6f + 18 = 6. Put -36, 1, 0, f in ascending order. -36, 0, 1, f Let v = -52.896 - 0.804. Let w = 54 + v. Suppose -d = 2d. Put d, w, 1 in decreasing order. 1, w, d Suppose -4o + 5u - 25 = 0, -2o = 2u - 6 - 4. Sort -1, 574, o in increasing order. -1, o, 574 Let v be 4/7 - (78/14 - -8). Put -3, v, -4 in descending order. -3, -4, v Suppose -41 = -2q - 5i, q + 8 - 31 = -3i. Let g be 35/(30/q). Suppose 0 = -2l + 4v - 24, -l - 8v - 8 = -9v. Sort g, 2, l in increasing order. l, 2, g Let h = 0.063 + -0.163. Put -7/9, h, 2/11 in increasing order. -7/9, h, 2/11 Let p(h) = h. Let r be p(-1). Let m be (-39)/(-65) + (-72)/(-5). Suppose -mi - 5c = -11i - 10, 4i - 12 = -4c. Put i, -4, r in decreasing order. i, r, -4 Suppose y - 1 = 3q, -q + 206 = -2y + 208. Sort 4, y, -17. -17, y, 4 Let z(s) = -s*3 - 5s*2 - s - 10. Let r be z(-5). Sort -33, -2, r, -3 in decreasing order. -2, -3, r, -33 Let k be (-6)/10 - (-19)/15. Let s = -0.692 + -4.308. Put s, k, -9 in ascending order. -9, s, k Let c be (-16)/(-24) - (26/(-6) - 1). Let g be (-12)/126c(-2)/2. Let s = 0.02 - -0.38. Put g, -0.3, s in decreasing order. g, s, -0.3 Let k = -16 - -21. Let h(x) = x + 18. Let q be h(-19). Sort q, k, -9 in descending order. k, q, -9 Let f(x) = -x2 + 27x + 140. Let l be f(-10). Put 0, -1, 1, l in increasing order. l, -1, 0, 1 Suppose -2u + 0u + 2 = 3y, y = 3u - 3. Suppose -q - 12 = -6q + 4r, y = -4q + r + 14. Put 3, q, -5, -1 in ascending order. -5, -1, 3, q Let z be (39/(-6) + -1)8/(-3). Suppose 5h + z = -0. Suppose 0 = 2l - u + 10, 5 = l + 5u - 3u. Put l, h, -7 in descending order. l, h, -7 Let m = -0.34 + 0.331. Let k = m + 26.009. Sort k, -2, 5. -2, 5, k Let c = 810.167 - 810. Sort -2, c, -1 in increasing order. -2, -1, c Let x be (-2)/6(-2 - -14)-1. Put x, -48, -5 in increasing order. -48, -5, x Let n = -4.8 + 87.8. Let k = n - 83.3. Sort -3, k, -2/7 in decreasing order. -2/7, k, -3 Let m = -1462 - -1473.97. Let n = m + 0.03. Let h = -14 + n. Sort 1/2, 5, h in decreasing order. 5, 1/2, h Let b = 119 - 96. Sort 0.1, b, 5. 0.1, 5, b Let v = 443 + -897/2. Sort 5, v, -2/13. v, -2/13, 5 Let c be -1 + 4 + -1 - (1 - -1). Suppose -2x + 6x = -24. Put c, x, -1 in ascending order. x, -1, c Let j = -76255/9 + 8614. Let q = -141 + j. Sort 3/2, q, -2 in increasing order. -2, q, 3/2 Suppose 2x = 26 - 8. Suppose 2j = xj - 14. Let u be (-63)/(-12) + 3/(-12). Sort u, j, 3. j, 3, u Let p(o) = -2o*2 + 2o + 4. Let c be p(3). Let l = -2078/285 - -136/19. Let u = 7048/85 + -414/5. Sort c, u, l in ascending order. c, l, u Let p be ((-6)/42)/((-13)/182). Let y be 1/2 - 10/(-4). Let i = 12 - 7. Sort i, p, y in increasing order. p, y, i Let x = 0 - 0. Let q = 0.5 - 5.5. Let o = 461/2 + -232. Sort x, o, q in decreasing order. x, o, q Let i = -0.574 + 0.174. Sort i, -2, 2, -5. -5, -2, i, 2 Let z(i) = -i*3 + 10i*2 - 2i - 66. Let g be z(9). Put 0, -18, 1, g in decreasing order. 1, 0, g, -18 Let y be 4/48(-9)/(-6). Put y, 1, -4/5, 4 in decreasing order. 4, 1, y, -4/5 Let i be ((-560)/(-21) - -2)/(2/3). Let g(l) = l3 - 6l*2 - 7l + 2. Let f be g(6). Let w = i + f. Sort w, -4, 12 in increasing order. -4, w, 12 Let o = -6.8 + 7.3. Let t = -81.98 + 0.98. Sort t, -5/3, o. t, -5/3, o Let t be -5((-320)/(-120) + 10/(-6)). Sort t, -1, -7, -4 in descending order. -1, -4, t, -7 Let o be -6 + 40/153. Suppose 2u - b = 4u + 10, 4b + 24 = -4u. Sort o, u, -2. u, -2, o Let p = -1 - -3. Let y be 1(-4 - ((0 - -2) + -6)). Put 4, p, y, -22 in decreasing order. 4, p, y, -22 Let v = 307 - 314. Sort v, -0.2, 10, -5 in descending order. 10, -0.2, -5, v Suppose 3y + 5 - 29 = 0. Suppose -y = -8p + 24. Sort 3, -3, -4, p in ascending order. -4, -3, 3, p Let a = -2 - -4. Let y = -4433 + 4437. Put 0, y, a in descending order. y, a, 0 Let x be -1(-1)/(5/4). Let p = -823/285 - -5/57. Put p, x, 0.1 in decreasing order. x, 0.1, p Suppose -5q + 4n - 470 = 0, 5n - n = -q - 118. Let u be 6/4 + q/(-28). Suppose -2w = uw + 28. Put 2/3, w, -0.9 in ascending order. w, -0.9, 2/3 Suppose 29 = -264a + 293a. Suppose 5y + 4 = -1. Let z = -7 - -3. Put a, z, y in decreasing order. a, y, z Let s(k) be the first derivative of k*3/3 + 3k*2 - 21k + 13. Let c be s(-8). Sort 4, -3, c. c, -3, 4 Let u = 6.7 - 7. Let k = 67.006 - 67. Let a = -0.006 + k. Sort -0.5, u, a in increasing order. -0.5, u, a Let o = 8 + -6. Suppose -5h + 1 = 6. Put -18, h, o in increasing order. -18, h, o Let y = -1037 + 739. Let p be y/8 + 12/(-16). Let a be p/(-33) + (-8)/6. Put 5, 4/3, a in ascending order. a, 4/3, 5 Suppose -3t = -4y + 2y + 13, 5y + 2t = 4. Suppose -3 = -2k + 4b - b, -4k + 2b = 6. Sort y, k, 3 in descending order. 3, y, k Let g = 45.47 + 4.53. Put -0.1, g, 5 in descending order. g, 5, -0.1 Let r be -1 - 4(5 - (-24)/(-6)). Let j = 14 - 12. Put r, 19, 3, j in descending order. 19, 3, j, r Let c(k) = -k. Let d be c(3). Sort 37, d, -2. d, -2, 37 Suppose -3k - 24 = -3g, -3g + 2k - 28 = -55. Sort 4, 1, g, -7 in ascending order. -7, 1, 4, g Suppose 193 = 7z + 151. Put z, 11, 0 in increasing order. 0, z, 11 Let d = 49 - 87. Let l = d - -41. Put 1, l, -1 in decreasing order. l, 1, -1 Let d = -4 - -6. Let u(k) = -3k - 32. Let g be u(-11). Suppose -4j + g = 13. Sort 1, d, j in decreasing order. d, 1, j Let d be 2/(-14) + 12750/119. Let t = d - 108. Sort t, 28, 5 in ascending order. t, 5, 28 Let y = -365/7 + 52. Sort 3, -0.9, y. -0.9, y, 3 Let h(i) = -i + 4. Let z be h(-8). Let c = -9 + z. Suppose 6 - 9 = -ca. Put 3, -2/9, a in descending order. 3, a, -2/9 Let a be 2/(4 - 2) + 19. Let j = -15 + a. Let v(k) = -k3 + 3k*2 + 3k + 4. Let m be v(4). Sort m, j, -0.5 in decreasing order. j, m, -0.5 Let v(z) = -z*2 - 5z - 2. Let f be v(-6). Let x be 17/(-5) - 16/(-4). Let y = 4.3 + -4. Put f, y, x in descending order. x, y, f Suppose 2v = -4x - 22, -2v - 29 = 2v + 5x. Let y be v - -124/44. Let l = -1 + 0.6. Sort y, 2, l in decreasing order. 2, y, l Let q = -0.97 - 0.03. Let w = -0.409 - 0.021. Let h = w + -0.07. Put q, 3/5, h in ascending order. q, h, 3/5 Let w = 272.8 + -273. Put w, -5/4, 6, -2/5 in descending order. 6, w, -2/5, -5/4 Suppose 0 = -f - 4, 3y + f = -0 + 2. Put -47, y, 4 in decreasing order. 4, y, -47 Let o be 26/(-21) + 4/6. Let t = 109 - 61. Let h = t - 47.7. Sort h, o, 2/7. o, 2/7, h Let a = 1 + -1. Suppose 117v = 143 - 611. Sort v, 2, a. v, a, 2 Let k = 51 - 8. Let m = k - 43.5. Sort -4, m, 1/5, -0.1 in descending order. 1/5, -0.1, m, -4 Let f = 0.083 + -2.083. Let g = -57/2 - -29. Put f,	{ "pile_set_name": "DM Mathematics" }
-1? -10/157 What is the closest to 6 in -68, -5, 16, -0.5? -0.5 What is the nearest to -2 in 1/6, 1, 2/11, 346/51? 1/6 What is the closest to -1 in 0, -1.7, 2865? -1.7 Which is the closest to -1/8? (a) -2 (b) 40/7 (c) -0.3 c What is the nearest to 11 in -1/5, 11, 0.4, -12/13? 11 Which is the nearest to 0.0185? (a) -29 (b) 2/5 (c) 0.3 (d) 2/13 d Which is the closest to 0.07? (a) -0.5 (b) 4961 (c) -2 a Which is the closest to 2? (a) 3.1 (b) -4 (c) 4 (d) 2/9 (e) 1/5 a What is the closest to 4/9 in -17, 3, -6.09? 3 What is the closest to -1 in 0, 3, 3/2, 51/26? 0 Which is the nearest to -60? (a) 5 (b) -11 (c) 0.01 (d) 2/9 b Which is the closest to 2/13? (a) -3 (b) -0.07 (c) -15 (d) -4/5 (e) -0.3 b What is the nearest to -3 in -2, 4/5, 2/3, 2291? -2 Which is the nearest to 0.0329? (a) 2/5 (b) -0.5 (c) 6 a What is the nearest to -2 in 4.8, -1, -0.13? -1 What is the closest to 10 in -0.4, 2/7, 5, -0.03, 12? 12 Which is the closest to 0.1? (a) 3/25 (b) -2/45 (c) -3.3 a Which is the closest to 20? (a) 0.057 (b) -1 (c) 0.5 (d) -1/37 c What is the closest to -1/3 in 884, 8, -4? -4 Which is the nearest to 1/3? (a) -3 (b) -4 (c) -1886 (d) 4 a What is the nearest to 1 in 0.1, -660/23, 35/3? 0.1 What is the closest to 2 in -0.251, -5/7, -20, -4? -0.251 Which is the closest to -0.2? (a) 0 (b) -388 (c) 0.4 a Which is the closest to -2/21? (a) 11 (b) -8 (c) -1/2 (d) -4 (e) 1 c Which is the nearest to -0.4? (a) 8 (b) -3 (c) -39 (d) -1/71 d What is the nearest to -192 in -2/9, -1.7, -11? -11 Which is the closest to -4.455? (a) 0 (b) 2/67 (c) -4/7 (d) 2/13 c Which is the closest to 1.7? (a) 3/7 (b) -2 (c) -5/2 (d) -4/7 a What is the nearest to 1/2 in -19, 0.02, 4? 0.02 What is the nearest to 1/2 in -4/5, -10, 21588? -4/5 What is the nearest to -1/2 in 0, 268, 4, 1/2? 0 What is the nearest to 1 in 11, 239, -0.4? -0.4 What is the nearest to -2 in -3/8, -1/2, 938, -4? -1/2 Which is the nearest to 0.1063? (a) -0.2 (b) 3/5 (c) -2 (d) 0.18 d What is the closest to 100059 in 4, -0.4, -3? 4 Which is the closest to -0.092? (a) 14 (b) 5 (c) -66 b Which is the nearest to 1? (a) -2/11 (b) 0.4 (c) 1/126 (d) 2/601 b What is the nearest to 0.3 in -2.92, -0.1, -5, -1? -0.1 What is the closest to -1 in 4/5, 39473, 0.07, 0? 0 Which is the closest to 0.089126? (a) -2 (b) -3/5 (c) -5 b What is the nearest to 0.1 in -5, -0.158, 4.4, 0.3? 0.3 What is the nearest to -0.1 in 0.09, -1/4, -1, 3/5, -2/13? -2/13 Which is the closest to 1/4? (a) -5 (b) -11 (c) 3/2 (d) 32649 c What is the closest to -0.2 in 8, -1, 0.056, -1/2? 0.056 What is the closest to -5 in 2, -2/9, -0.1, -15/8? -15/8 What is the nearest to -0.2 in 288/281, 0, 0.1? 0 Which is the closest to 0? (a) 3 (b) 2 (c) 3/164 (d) -13 (e) 0.4 c What is the nearest to 1 in 1.01, -1/4, -0.1, -2/57? 1.01 What is the nearest to -73 in -6/37, 6, 5? -6/37 Which is the closest to -31? (a) 3 (b) 0.3 (c) -6 c What is the nearest to -6722 in 1/2, 5, -0.4? -0.4 What is the closest to 0.86 in -2/121, -0.1, -3, -2? -2/121 Which is the nearest to -143? (a) -0.4 (b) -2 (c) -9/8 b Which is the closest to 1? (a) -0.1 (b) 3 (c) 0 (d) 123/10 c What is the nearest to 1 in 7/3, -1/2, -4/15? -4/15 What is the nearest to 4/9 in -5, -12, 4, 28? 4 Which is the nearest to -41? (a) -0.4 (b) 10187 (c) 0.3 a What is the nearest to -2/7 in 1/3, -508, 4/7, -6, -0.2? -0.2 What is the nearest to 1 in 11, -2, 694? -2 What is the closest to -0.1 in -153/107, 4, -0.2? -0.2 What is the closest to -107/4 in 0.4, -5, -0.2, -108? -5 Which is the nearest to -2/3? (a) -3 (b) -23 (c) 12.29 a Which is the nearest to 800? (a) -0.3 (b) 4 (c) 332 c Which is the nearest to 4.9? (a) -2 (b) -0.5 (c) 5/6 c What is the closest to -1920 in -5, -2, 1, -0.7, 3? -5 Which is the closest to -1/5? (a) -0.3 (b) -2/7 (c) 1/2 (d) 1/10 b What is the nearest to 0.05 in 4, 2, 5/13, 1? 5/13 Which is the closest to 0? (a) -1 (b) -0.2 (c) -2/45 (d) 14 (e) -7 c Which is the closest to -0.2? (a) 1534 (b) -8 (c) -1 c What is the closest to 1/42 in 2/29, -5, 1/6? 2/29 What is the closest to 2.4 in -5, -1/18, -4, 2/9, -5/6? 2/9 Which is the nearest to 191? (a) 16 (b) 6 (c) 3 a What is the closest to -0.2 in 79, 49, -3/4? -3/4 What is the nearest to 0.167 in -0.22, -0.1, 0, -0.4? 0 What is the closest to 0.2 in -46/9, 92, -2, 2/15? 2/15 What is the closest to -0.04 in 0.1, 6, -10.2, -0.5? 0.1 What is the nearest to -2/5 in 0.96, -4/13, -2/23, -3? -4/13 What is the closest to 4 in 20, -0.09, -1/2? -0.09 Which is the closest to 253/5? (a) 8 (b) -1 (c) 1 (d) 2/9 a Which is the nearest to 1/3? (a) -493 (b) -5 (c) -3 (d) -2/7 d Which is the closest to 1? (a) 0.1 (b) 0.05 (c) 0.3 (d) 2.5 (e) 2/13 c What is the closest to -2 in 0.2, -30/37, -1/4, 0.5, -3? -3 What is the nearest to -0.4 in 5, -0.5, 2, 0.5, 56/3? -0.5 What is the nearest to -2/3 in 11/10, -0.27, 0.1, -1/3? -1/3 What is the nearest to -0.05 in -2/1337, 0, 0.14? -2/1337 What is the closest to 1/2 in -2/325, 5, -815? -2/325 Which is the nearest to -1/2? (a) 0.185 (b) 0.26 (c) -1/9 c Which is the closest to 2453? (a) 0 (b) 1/7 (c) 2/3 c What is the closest to 0 in 4, 0, -1/6, 1059/8? 0 What is the nearest to 5 in -0.5, 555, -28/15? -0.5 Which is the nearest to -2? (a) 3 (b) -2 (c) 0.1 (d) -6.5 (e) -1.1 b Which is the nearest to -3? (a) -187 (b) 5 (c) 104 (d) -0.1 d Which is the closest to 2/119? (a) 4 (b) -4 (c) 1/19 (d) -0.02 (e) -5 c What is the nearest to -1/2 in -73/6, -0.2, -1/2? -1/2 Which is the nearest to -8.9? (a) 0 (b) -4/3 (c) 6/23 b What is the nearest to -12 in 2/27, -8, -3, -5? -8 Which is the closest to 9? (a) -2/19 (b) 11 (c) 5 (d) -1 b What is the nearest to -0.5 in 184, -1, 0.2, -4, 5? -1 Which is the closest to -0.01? (a) -1/6 (b) -6.94 (c) -0.4 (d) 0 d Which is the closest to 1.3? (a) -0.1 (b) -4 (c) -5 (d) -2/1867 d Which is the closest to -1/5? (a) 7/6 (b) -1.7 (c) 1/3 (d) 2 c Which is the nearest to -1? (a) 2/3 (b) 7/720 (c) 1/4 b Which is the nearest to 1/4? (a) -0.1 (b) -5 (c) 48 (d) 105 (e) -3 a What is the nearest to -0.024 in 3, 0.31, -5? 0.31 What is the closest to 1/3 in 5, 0.2, -2/139, 0.3? 0.3 Which is the nearest to -307? (a) 3/10 (b) 28 (c) 4 a What is the closest to -20 in 384, 0, 0.2? 0 What is the nearest to 2 in -0.1, -0.4, -50/153, -8? -0.1 Which is the nearest to 9/2? (a) -0.03 (b) 46/3 (c) 2/9 c What is the nearest to -4 in 4, -2/117, -3, 1? -3 What is the closest to 3/55 in -2, 2/3, 6.1? 2/3 Which is the nearest to 66/5? (a) -1/9 (b) 55 (c) 1/3 (d) -2/5 c Which is the nearest to 10? (a) -1.2 (b) -1 (c) -2/3 (d) -0.5 (e) -4/3 d What is the closest to -2 in 0.19, -42, 3, 5? 0.19 Which is the nearest to 0.1? (a) 0.2 (b) 2/9 (c) 0.08 (d) 1.4 (e) 1 c Which is the closest to -25? (a) -459 (b) 5 (c) -5/3 c Which is the closest to -1? (a) 14 (b) 0.4 (c) -79 (d) 4 (e) 2 b Which is the closest to 0.573? (a) -4 (b) -5 (c) 0.1 (d) -76 c Which is the nearest to -2/3? (a) -880 (b) 1/7 (c) 1/11 (d) 4 c Which is the nearest to 2/115? (a) -2 (b) -44 (c) -1/6 (d) -0.5 c Which is the nearest to 2/5? (a) 4 (b) 0.3 (c) 4052 b Which is the closest to 8? (a) -3 (b) 2 (c) 2/3563 b Which is the nearest to 604/3? (a) -1/8 (b) 0 (c) -3 (d) 0.5 d Which is the closest to -13.52? (a) 1/4 (b) -3 (c) 4 b Which is the closest to -0.1? (a) 2/785 (b) 0.1 (c) 0.7 a Which is the nearest to 5? (a) -5 (b) -19 (c) 10 (d) 6 (e) -2 d What is the closest to 0.2 in -5, 0.3, 0, -3, 1/7? 1/7 What is the closest to 1/4 in -7.2, -3/2, -2/7? -2/7 What is the closest to 12 in -2/9, 5, -2/3, 14? 14 Which is the closest to 2/15? (a) -2 (b) 6 (c) 7/4 (d) 0 d Which is the nearest to 1/2? (a) 47.4 (b) 0 (c) 22 (d) -0.1 b What is the nearest to -36 in 0.1, 2/3, -0.27, 0.3, 3? -0.27 What is the closest to 1 in 5, 3/14, -0.12, 32? 3/14 What is the closest to -4 in -1/2, 0.2, -0.3, -3/836, -4? -4 What is the nearest to -0.0045 in -2, 2, 85? -2 What is the nearest to 2/11 in -3, 2/3, -1, 1586, -4? 2/3 Which is the closest to -5.5? (a) 171 (b) 0.05 (c) -0.2 (d) -4 d Which is the nearest to -2? (a) -0.3 (b) -0.08 (c) 2	{ "pile_set_name": "DM Mathematics" }
f sequence iixi when four letters picked without replacement from {i: 3, x: 5}. 1/56 Two letters picked without replacement from ppttpeteeeeee. Give prob of sequence et. 7/52 Two letters picked without replacement from vvfvvvfvfvf. Give prob of sequence vv. 21/55 Two letters picked without replacement from rkprrrrnr. What is prob of sequence nr? 1/12 Calculate prob of sequence ggw when three letters picked without replacement from {s: 5, w: 4, g: 3}. 1/55 What is prob of sequence oz when two letters picked without replacement from {z: 1, o: 17}? 1/18 What is prob of sequence xbx when three letters picked without replacement from bxxmbbxbxbmxx? 25/286 Three letters picked without replacement from {f: 1, n: 1, i: 3, u: 1, l: 1}. What is prob of sequence iln? 1/70 Calculate prob of sequence iiiz when four letters picked without replacement from zziiizizii. 2/21 What is prob of sequence xxx when three letters picked without replacement from ttttttttttxttttttttt? 0 Four letters picked without replacement from {v: 7, y: 4}. What is prob of sequence vyvy? 7/110 Calculate prob of sequence qg when two letters picked without replacement from {g: 3, c: 3, q: 2}. 3/28 Two letters picked without replacement from {i: 2, p: 6, r: 1, s: 2}. What is prob of sequence ii? 1/55 What is prob of sequence vm when two letters picked without replacement from xbxdbmxvmxvdx? 1/39 What is prob of sequence gyy when three letters picked without replacement from {g: 3, d: 1, c: 3, y: 5}? 1/22 Four letters picked without replacement from fjhjjlfffjf. Give prob of sequence llhj. 0 Four letters picked without replacement from afafddfddffd. Give prob of sequence adda. 1/297 Two letters picked without replacement from xzzzffxvzffpvzpxvfff. What is prob of sequence vf? 21/380 Four letters picked without replacement from {t: 5, r: 4, g: 5, e: 1}. Give prob of sequence rger. 1/546 Two letters picked without replacement from mnhqq. What is prob of sequence qn? 1/10 Three letters picked without replacement from jccqcqjcjj. Give prob of sequence jqj. 1/30 Calculate prob of sequence ccck when four letters picked without replacement from {c: 17, k: 2}. 5/57 Calculate prob of sequence hhi when three letters picked without replacement from hhhhhhiyhhh. 4/55 What is prob of sequence dyyy when four letters picked without replacement from dxyssyxyaxsasysady? 1/612 Four letters picked without replacement from xanaxxxaxzmzmx. Give prob of sequence znzm. 1/6006 Three letters picked without replacement from ccccccccccccchcccccc. Give prob of sequence hcc. 1/20 What is prob of sequence mom when three letters picked without replacement from fmhfoooohomooohfooh? 10/2907 Calculate prob of sequence ff when two letters picked without replacement from ooxffowwwxwfooo. 1/35 What is prob of sequence uees when four letters picked without replacement from veeevsuveevvvee? 1/780 Three letters picked without replacement from {a: 1, b: 2, q: 1, p: 3, v: 4, m: 4}. What is prob of sequence qvp? 2/455 Calculate prob of sequence cb when two letters picked without replacement from uccubuubcuuucuuuuuc. 5/171 Four letters picked without replacement from {z: 7, i: 9}. What is prob of sequence ziii? 21/260 Three letters picked without replacement from {x: 8, h: 3, v: 5}. What is prob of sequence vhh? 1/112 Calculate prob of sequence dm when two letters picked without replacement from {d: 4, l: 4, m: 3}. 6/55 Calculate prob of sequence dz when two letters picked without replacement from {d: 17, z: 3}. 51/380 Two letters picked without replacement from ypyypypypyyaya. What is prob of sequence yp? 16/91 Calculate prob of sequence ok when two letters picked without replacement from {q: 1, d: 1, o: 3, k: 2}. 1/7 Four letters picked without replacement from dvvdttdttdttvt. What is prob of sequence vttt? 15/572 Three letters picked without replacement from sskskkskkksskkskskss. Give prob of sequence skk. 5/38 Two letters picked without replacement from {v: 1, h: 1, q: 1, z: 7, k: 3}. What is prob of sequence zk? 7/52 Calculate prob of sequence lrl when three letters picked without replacement from {l: 2, d: 1, k: 1, r: 1}. 1/30 Three letters picked without replacement from {t: 2, m: 4, v: 2, g: 1, o: 1, d: 5}. Give prob of sequence ovv. 1/1365 Calculate prob of sequence xx when two letters picked without replacement from cxcccxxcxc. 2/15 Two letters picked without replacement from {e: 8, s: 3}. What is prob of sequence ee? 28/55 Calculate prob of sequence tk when two letters picked without replacement from {r: 3, j: 1, k: 1, l: 3, t: 1, m: 5}. 1/182 Three letters picked without replacement from {s: 10, d: 4, o: 2}. What is prob of sequence dod? 1/140 Two letters picked without replacement from ivvgivvivtuvu. What is prob of sequence uv? 1/13 Calculate prob of sequence lgv when three letters picked without replacement from {g: 1, l: 3, f: 6, v: 1, j: 4, m: 1}. 1/1120 Calculate prob of sequence cccp when four letters picked without replacement from ppppccpcpppcppppcpp. 35/3876 Two letters picked without replacement from tyqtqtqqttqytqt. What is prob of sequence qt? 1/5 Two letters picked without replacement from {s: 5, o: 4, k: 5, h: 3, t: 2}. What is prob of sequence ko? 10/171 What is prob of sequence bz when two letters picked without replacement from ttbtytzybzbfbtty? 1/30 Calculate prob of sequence ancn when four letters picked without replacement from {w: 1, a: 2, n: 2, c: 1}. 1/90 What is prob of sequence lx when two letters picked without replacement from {k: 2, x: 2, l: 3, o: 3, a: 1, q: 1}? 1/22 Two letters picked without replacement from {l: 1, n: 2, o: 2}. What is prob of sequence on? 1/5 What is prob of sequence pjp when three letters picked without replacement from ypsdzpj? 1/105 Calculate prob of sequence dg when two letters picked without replacement from {d: 3, g: 7}. 7/30 What is prob of sequence peez when four letters picked without replacement from petwpkeeeezzwwpwee? 7/2040 Three letters picked without replacement from rbhnuhhrtrrrhht. Give prob of sequence tbu. 1/1365 Three letters picked without replacement from {i: 1, w: 2, b: 1, s: 1}. Give prob of sequence wbs. 1/30 Four letters picked without replacement from ppxxxxrr. Give prob of sequence xprr. 1/105 Three letters picked without replacement from hoooohoooohooooo. Give prob of sequence hoo. 39/280 What is prob of sequence zz when two letters picked without replacement from czczzz? 2/5 Calculate prob of sequence ajq when three letters picked without replacement from lqjla. 1/60 What is prob of sequence shw when three letters picked without replacement from {b: 3, y: 3, s: 8, h: 3, w: 1}? 1/204 Three letters picked without replacement from pppppppwwppppppwppwp. What is prob of sequence wpw? 8/285 What is prob of sequence mss when three letters picked without replacement from {b: 1, d: 6, s: 2, m: 3}? 1/220 What is prob of sequence kppk when four letters picked without replacement from {p: 3, k: 9}? 2/55 Calculate prob of sequence jw when two letters picked without replacement from gcwyjjcljgjcj. 5/156 Two letters picked without replacement from kkdqk. What is prob of sequence qd? 1/20 What is prob of sequence ppee when four letters picked without replacement from {p: 1, e: 11}? 0 What is prob of sequence rkt when three letters picked without replacement from rrihurrrhrttkruir? 1/255 Two letters picked without replacement from tnhhtnhthnhvhthtnn. What is prob of sequence tn? 25/306 Four letters picked without replacement from {a: 10, b: 6, j: 2}. Give prob of sequence abjb. 5/612 What is prob of sequence ioii when four letters picked without replacement from {z: 2, i: 5, o: 6}? 3/143 Four letters picked without replacement from tsuyssmtmykss. Give prob of sequence ytuy. 1/4290 Four letters picked without replacement from {z: 7, r: 8, l: 2, a: 1}. Give prob of sequence rarr. 7/1530 Three letters picked without replacement from {t: 5, g: 6, o: 2}. What is prob of sequence ggg? 10/143 Three letters picked without replacement from wgctmig. What is prob of sequence tgg? 1/105 Calculate prob of sequence rnr when three letters picked without replacement from {r: 5, n: 15}. 5/114 What is prob of sequence zx when two letters picked without replacement from	{ "pile_set_name": "DM Mathematics" }
culate h(v(k)). -112k2 Let y(p) = -p2. Let a(m) = 100m. What is a(y(x))? -100x2 Let d(y) = -5y. Let a(v) = 13v2 - 4v + 8. Let l(m) = 26m2 - 7m + 14. Let h(r) = -7a(r) + 4l(r). Give d(h(n)). -65n2 Let a(m) be the second derivative of -17m*3/6 - m. Let i(c) = -3c*2. Let z(p) = 4p*2. Let f(o) = 5i(o) + 4z(o). Calculate f(a(y)). 289y2 Let l(c) = -c2. Let q(d) = d*2 + 9d + 10. Let v be q(-8). Let p(k) = -4kv + 0k2 + k2. What is l(p(h))? -9h4 Let f(a) = -2 - 3a - 3 + 1 + 4a. Let x be f(6). Let w(s) = -xs*2 + 2s + 0s - 2s. Let v(z) = -3z2. What is w(v(h))? -18h*4 Let l(x) = -2x. Let q(r) = r + 8. Let z(s) = s*3 + 4s*2 - 5s - 6. Let t be z(-5). Let m be q(t). Let b(i) = -4im + 2 - 2. Calculate l(b(a)). 8a*2 Let t(j) = -88j*2 + 2. Let g(c) = 3c*2. Calculate g(t(d)). 23232d*4 - 1056d*2 + 12 Let z(v) = 2v. Suppose 0s - 5s + 4l + 18 = 0, s + l = 0. Suppose 0 = -6k + sk. Let t(o) = k - 4o*2 + 0 + 2o*2. What is z(t(g))? -4g*2 Let f(j) = 12j*2 + 0j + 0j. Let p(h) = -9h - 7h - 2h + 19h. What is f(p(m))? 12m2 Let i(o) = o2. Let s(p) = p - 25. Determine s(i(u)). u2 - 25 Let m(v) = v2. Suppose -k = -0k - 3. Let p(s) = -11 + k + 8 + 2s. Give p(m(y)). 2y2 Let a(h) = 19h. Let s(t) = 66t. Let j(g) = -18a(g) + 5s(g). Let m(y) = -3y*2. Calculate j(m(i)). 36i*2 Let c(x) = 2x*2. Let d(f) = -5f + 2. Let v be 2(0 - 3)/3. Let i(l) = -20l + 9. Let o(k) = vi(k) + 9d(k). What is c(o(p))? 50p2 Let w(p) = 42p. Let l(h) = -h*2 + 4h. Determine w(l(z)). -42z2 + 168z Let u(t) = -2t2. Let b(m) = 4m*2 + 3. Let q(i) = 9i*2 + 5. Let o(p) = 5b(p) - 3q(p). Determine o(u(g)). -28g4 Let h(d) = d2 + 4d. Let n(s) = 3s*2 + 15s. Let g(i) = 15h(i) - 4n(i). Let z(o) = -7o2. Determine z(g(p)). -63p*4 Let w(p) = 2p. Let u(q) = 91q2. What is u(w(h))? 364h*2 Let r(u) = -596u*2. Let v(p) = 3p*2. Give v(r(a)). 1065648a*4 Let q(f) = -151f. Let y(g) = 7g2. What is y(q(j))? 159607j*2 Let h(j) = -1 + 2 + 2j*2 + 3j2. Let y(w) = -w2. Calculate y(h(k)). -25k4 - 10k*2 - 1 Let u(s) = 9s*2 + 7s - 7. Let q(w) = -w*2 - w + 1. Let c(o) = -14q(o) - 2u(o). Let n(d) = 3d. Calculate n(c(l)). -12l2 Let d(p) = p. Let m(b) = 18b*2 - 17b + 4. What is m(d(c))? 18c2 - 17c + 4 Let f(v) = -2v. Let z(j) = -20j. Let c(u) = u. Let r(q) = -28c(q) - 2z(q). Determine r(f(b)). -24b Let f(j) = 2j*2 + 0j*2 - 4j*2. Let l(d) = 17 + 4d*2 - 17. Determine f(l(g)). -32g4 Let l(i) = i2. Let o(g) be the first derivative of 13g3/3 + 1. Give o(l(u)). 13u*4 Let w(t) = -2t*2. Let s(z) = -19z. Calculate s(w(x)). 38x2 Let a(j) = -4j. Let q(t) = 6t2 - 7t + 7. Let h(x) = -3x2 + 3x - 3. Let o(p) = 7h(p) + 3q(p). What is a(o(f))? 12f2 Let n(y) be the first derivative of 2y3/3 + 12. Let x(g) be the first derivative of g3 - 2. Calculate n(x(m)). 18m4 Suppose 5p - 7p + 24 = 0. Let x(j) = j - pj + 9j. Let k(o) = 91o*2 + 77o. Let u(r) = 7r2 + 6r. Let q(t) = 6k(t) - 77u(t). What is q(x(d))? 28d2 Let k(v) = -142v*2. Let j(c) = 42c*2. What is j(k(h))? 846888h*4 Let k(v) = -2v. Let a(r) = r*2 + 1302r. Calculate k(a(i)). -2i2 - 2604i Let w(v) = -3v2. Let s(m) = -2m*2 - 12m + 2. Let d be s(-6). Let g(i) be the second derivative of 0i3 + 0 + 0i*2 - di - 1/6i4. Give g(w(h)). -18h*4 Let t(d) = 2 + 2d - 2. Let w = -4 - -5. Let m(f) = -f - 1 + w. What is m(t(z))? -2z Let h(m) = -13m. Let t(j) = -61j - 2. What is h(t(p))? 793p + 26 Let n(g) = 2g2 + 3g*2 - 3g2 - g2. Let k(m) = -m. What is n(k(i))? i*2 Let x(n) = 4n. Let r(q) = -493q2. Give x(r(l)). -1972l*2 Let w(h) = 2h. Let y be (-1 - 2)(-12)/18. Let p(s) = -s2 + 6s*2 + 7s*y. What is w(p(n))? 24n*2 Let z(a) = 6a*2. Suppose 7f = 2f + 20. Suppose fc + 0 = 12. Let x(y) = -4y - 3y + 3y + cy. Give z(x(q)). 6q2 Let w(s) = -69s. Let m(t) = -7t2. What is w(m(r))? 483r2 Let y(j) = -j2. Let l(t) be the third derivative of -t7/630 - t4/12 + t*2. Let u(s) be the second derivative of l(s). Determine y(u(d)). -16d*4 Let f(k) = 23k*2 - 39k*2 + 18k2. Let m(g) be the first derivative of -g3 - 1. Determine m(f(w)). -12w4 Let p(j) be the second derivative of -5j*4/12 + 17j - 1. Let g(x) = -8x2. What is g(p(v))? -200v4 Let k(z) = z2 + 2z2 - 6z2. Let r(t) be the second derivative of t4/4 - 2t + 7. Calculate k(r(n)). -27n*4 Let g(p) = -p. Let c(o) = 397o*2. Give g(c(i)). -397i*2 Let z = -2 - -3. Let k(v) = v - 1. Let m(w) = 4w - 6. Let q(f) = zm(f) - 6k(f). Let y(x) = -x. What is q(y(h))? 2h Let l(y) = -y2. Let b(n) = n3 + 4n*2 - n - 1. Let r be b(-4). Let i(j) = 0j*2 + rj2 - j2. Give i(l(k)). 2k4 Let s(n) be the second derivative of n3/3 - n. Let i = 7 + -5. Let j(w) = 11 - wi - 11. Give s(j(m)). -2m*2 Let h(u) = -6u*2 - 11u. Let w(a) = a*2 + 2a. Let c = 5 + -9. Let k(f) = ch(f) - 22w(f). Let d(z) = -2z. Give k(d(r)). 8r*2 Let i(r) = -151r*2. Let o(h) = 5h. What is o(i(b))? -755b2 Let n(l) be the third derivative of l5/12 + 3l*2. Let q(v) = -2v. What is n(q(j))? 20j2 Let z(s) = 5s. Let p(t) = 4t + 7. Let o(b) = 2b + 3. Let j(x) = -7o(x) + 3p(x). Calculate z(j(a)). -10a Let d(u) = -u + 8. Let q(r) = 197r - r*2 - 197r. Give q(d(i)). -i*2 + 16i - 64 Suppose -4j + 3j + 2o = -8, -4j - 4o = 16. Let i = 4 - j. Let h(d) = -3d + 3d + id. Let l(r) = -2r. Calculate h(l(m)). -8m Let g(s) be the first derivative of 2s2 + 4. Let w(p) = 0 + 0 - p2. Determine w(g(h)). -16h*2 Let h(n) = 2n2. Let l(r) = -r - 16. Let k be l(-11). Let s be 66/30 + 1/k. Let x(d) = ds + d2 - d2 - 4d2. Determine h(x(z)). 18z*4 Let o(u) = 8u - 5. Let h(i) = 47i. Give h(o(t)). 376t - 235 Let o(p) = 34p. Let h(s) = -6s*2. Calculate o(h(m)). -204m2 Let z(t) = -t2. Let f(p) = 3p2. Give f(z(j)). 3j*4 Let g(x) = 299x + 2. Let m(z) = -4z2. Determine m(g(b)). -357604b*2 - 4784b - 16 Let j(i) = 10i2. Let s(u) = -5u*2. What is s(j(x))? -500x*4 Suppose 0 = 14q - 3q - 33. Let d(v) be the second derivative of 5/6v*3 + 0v*2 - qv + 0. Let a(g) = 2g2. Give a(d(l)). 50l*2 Let p(s) = -9s*2. Let n(j) = -2j*2 - 5j*2 + 9j*2. What is n(p(c))? 162c*4 Let b(r) = r. Let v(j) = 696j*2. What is v(b(s))? 696s2 Let w(v) be the first derivative of -v2/2 - 8. Let i(m) = -65m. Determine i(w(d)). 65d Let g(f) be the second derivative of f*6/180 + 5f*4/12 + 4f. Let z(c) be the third derivative of g(c). Let b(o) = -3o2. What is b(z(h))? -48h*2 Let l(v) = -v. Let k(y) = 3643y. Calculate l(k(d)). -3643d Let p(d) = 15d*2. Let x(a) = 21a2. Let k(y) = y2. Let u(f) = -18k(f) + x(f). Calculate p(u(m)). 135m4 Let x(j) be the first derivative of -j3/3 - 2. Let u(g) = 18g2. Give x(u(b)). -324b*4 Let c = 4 + 1. Let m(w) = 9w + 5. Let f(d) = -22d - 12. Let i(x) = cf(x) + 12m(x). Let y(p) = -3p. Give y(i(t)). 6t Let w(h) = 25h. Let v(m) = -4m. What is v(w(b))? -100b Let f be (-1 - -1)/(1-2). Let d(j) = -6j*2 + fj*2 + 2j*2. Let n(p) = -p. What is d(n(c))? -4c*2 Let v(z) = -3z*2. Let q(d) = d - 3290 + 3290. Calculate q(v(a)). -3a2 Let g(q) be the first derivative of q5/120 + q*3/3 - 1. Let l(n) be the third derivative of g(n). Let b(x) = 2x*2. Calculate l(b(a)). 2a*2 Suppose 0z - 2z = 0. Suppose z = b - 5b. Let o(x) = 0 - x + b. Let a(c) = 2c. Determine o(a(w)). -2w Let n(y) be the third derivative of y4/6 - y2. Suppose -23 = -5w - 3, 0 = 2t + 4w - 20. Let h(c) = -c - tc + c. Calculate n(h(j)). -8j Let z(r) be the second derivative of -r3/6 + 3r. Let a(i) = -3i. Calculate a(z(f)). 3f Let p(z) = -z*2. Let b(u) = 357u*2 + 1. Determine p(b(v)). -127449v*4 - 714v2 - 1 Let z(i) be the second derivative of -i3/6 - 5i. Let j(f) = 7f. Give z(j(n)). -7n Let p(j) = -2j*2. Let s(y) = -2y*2 + 3. Calculate p(s(a)). -8a*4 + 24a*2 - 18 Let n(y) = -238y. Let v(z) = -13z2. Calculate v(n(p)). -736372p*2 Let i(h) = 0h + 130h2 + 0h - 104h2. Let n(u) = 2u*2. Determine i(n(s)). 104s*	{ "pile_set_name": "DM Mathematics" }
prime factors of 7658? 2, 7, 547 List the prime factors of 40050. 2, 3, 5, 89 What are the prime factors of 1324? 2, 331 List the prime factors of 14840. 2, 5, 7, 53 List the prime factors of 9365. 5, 1873 What are the prime factors of 782? 2, 17, 23 List the prime factors of 633. 3, 211 List the prime factors of 1029. 3, 7 List the prime factors of 19025. 5, 761 List the prime factors of 3487. 11, 317 What are the prime factors of 133? 7, 19 List the prime factors of 8863. 8863 What are the prime factors of 34476? 2, 3, 13, 17 What are the prime factors of 834? 2, 3, 139 List the prime factors of 12121. 17, 23, 31 What are the prime factors of 1110? 2, 3, 5, 37 What are the prime factors of 1075? 5, 43 List the prime factors of 7369. 7369 List the prime factors of 6439. 47, 137 What are the prime factors of 63946? 2, 31973 What are the prime factors of 6338? 2, 3169 List the prime factors of 24016. 2, 19, 79 What are the prime factors of 11791? 13, 907 List the prime factors of 57546. 2, 3, 23, 139 List the prime factors of 26970. 2, 3, 5, 29, 31 What are the prime factors of 6416? 2, 401 What are the prime factors of 10951? 47, 233 What are the prime factors of 23277? 3, 7759 List the prime factors of 1381. 1381 What are the prime factors of 13729? 13729 List the prime factors of 14526. 2, 3, 269 What are the prime factors of 2834? 2, 13, 109 What are the prime factors of 30072? 2, 3, 7, 179 What are the prime factors of 5257? 7, 751 List the prime factors of 64573. 31, 2083 List the prime factors of 2313. 3, 257 List the prime factors of 1253. 7, 179 What are the prime factors of 84630? 2, 3, 5, 7, 13, 31 What are the prime factors of 864? 2, 3 What are the prime factors of 1478? 2, 739 What are the prime factors of 2769? 3, 13, 71 What are the prime factors of 197? 197 What are the prime factors of 90883? 13, 6991 List the prime factors of 2386. 2, 1193 List the prime factors of 7669. 7669 What are the prime factors of 1500? 2, 3, 5 What are the prime factors of 4027? 4027 What are the prime factors of 7087? 19, 373 What are the prime factors of 137963? 7, 19709 What are the prime factors of 427? 7, 61 List the prime factors of 4595. 5, 919 What are the prime factors of 1731? 3, 577 What are the prime factors of 2614? 2, 1307 What are the prime factors of 2213? 2213 What are the prime factors of 32366? 2, 16183 List the prime factors of 13478. 2, 23, 293 List the prime factors of 10805. 5, 2161 List the prime factors of 520. 2, 5, 13 What are the prime factors of 44823? 3, 67, 223 List the prime factors of 6109. 41, 149 List the prime factors of 816. 2, 3, 17 What are the prime factors of 273? 3, 7, 13 What are the prime factors of 4765? 5, 953 What are the prime factors of 10702? 2, 5351 What are the prime factors of 5828? 2, 31, 47 What are the prime factors of 12730? 2, 5, 19, 67 What are the prime factors of 426? 2, 3, 71 List the prime factors of 6591. 3, 13 What are the prime factors of 282? 2, 3, 47 List the prime factors of 23666. 2, 11833 List the prime factors of 33319. 11, 13, 233 List the prime factors of 1049. 1049 List the prime factors of 352. 2, 11 What are the prime factors of 13695? 3, 5, 11, 83 What are the prime factors of 18112? 2, 283 What are the prime factors of 423? 3, 47 List the prime factors of 1567. 1567 List the prime factors of 2172. 2, 3, 181 List the prime factors of 1109. 1109 List the prime factors of 11679. 3, 17, 229 What are the prime factors of 33184? 2, 17, 61 List the prime factors of 20876. 2, 17, 307 List the prime factors of 22899. 3, 17, 449 What are the prime factors of 831? 3, 277 List the prime factors of 492. 2, 3, 41 What are the prime factors of 97110? 2, 3, 5, 13, 83 What are the prime factors of 117? 3, 13 List the prime factors of 15408. 2, 3, 107 What are the prime factors of 2870? 2, 5, 7, 41 List the prime factors of 90926. 2, 11, 4133 What are the prime factors of 2520? 2, 3, 5, 7 What are the prime factors of 188229? 3, 62743 What are the prime factors of 753? 3, 251 What are the prime factors of 326? 2, 163 What are the prime factors of 1083? 3, 19 List the prime factors of 115319. 115319 List the prime factors of 3227. 7, 461 List the prime factors of 35939. 83, 433 What are the prime factors of 758? 2, 379 What are the prime factors of 159? 3, 53 What are the prime factors of 8196? 2, 3, 683 List the prime factors of 41006. 2, 7, 29, 101 What are the prime factors of 87158? 2, 43579 List the prime factors of 9413. 9413 List the prime factors of 20863. 31, 673 What are the prime factors of 2209? 47 What are the prime factors of 194? 2, 97 List the prime factors of 22697. 22697 List the prime factors of 3858. 2, 3, 643 List the prime factors of 2590. 2, 5, 7, 37 What are the prime factors of 11898? 2, 3, 661 What are the prime factors of 8153? 31, 263 What are the prime factors of 2350? 2, 5, 47 List the prime factors of 4282. 2, 2141 List the prime factors of 1508. 2, 13, 29 List the prime factors of 1639. 11, 149 List the prime factors of 63695. 5, 12739 List the prime factors of 2301. 3, 13, 59 List the prime factors of 3937. 31, 127 What are the prime factors of 10676? 2, 17, 157 What are the prime factors of 1117? 1117 What are the prime factors of 630? 2, 3, 5, 7 List the prime factors of 14062. 2, 79, 89 List the prime factors of 16982. 2, 7, 1213 What are the prime factors of 2898? 2, 3, 7, 23 What are the prime factors of 15373? 15373 What are the prime factors of 4580? 2, 5, 229 What are the prime factors of 6301? 6301 List the prime factors of 17557. 97, 181 What are the prime factors of 8042? 2, 4021 List the prime factors of 343. 7 What are the prime factors of 21225? 3, 5, 283 List the prime factors of 3697. 3697 List the prime factors of 1533. 3, 7, 73 What are the prime factors of 32046? 2, 3, 7, 109 What are the prime factors of 31342? 2, 15671 List the prime factors of 9595. 5, 19, 101 List the prime factors of 5224. 2, 653 List the prime factors of 90885. 3, 5, 73, 83 List the prime factors of 1509. 3, 503 What are the prime factors of 3419? 13, 263 What are the prime factors of 18611? 37, 503 What are the prime factors of 2476? 2, 619 List the prime factors of 538. 2, 269 List the prime factors of 10053. 3, 1117 List the prime factors of 5481. 3, 7, 29 List the prime factors of 7034. 2, 3517 What are the prime factors of 1517? 37, 41 What are the prime factors of 39294? 2, 3, 37, 59 List the prime factors of 114801. 3, 17, 2251 What are the prime factors of 9948? 2, 3, 829 What are the prime factors of 6731? 53, 127 What are the prime factors of 1036? 2, 7, 37 What are the prime factors of 103814? 2, 51907 What are the prime factors of 24225? 3, 5, 17, 19 What are the prime factors of 13191? 3, 4397 What are the prime factors of 13945? 5, 2789 What are the prime factors of 4527? 3, 503 List the prime factors of 524. 2, 131 List the prime factors of 6496. 2, 7, 29 List the prime factors of 1658. 2, 829 What are the prime factors of 2999? 2999 What are the prime factors of 2329? 17, 137 List the prime factors of 5463. 3, 607 List the prime factors of 7143. 3, 2381 What are the prime factors of 1923? 3, 641 List the prime factors of 43339. 19, 2281 What are the prime factors of 18218? 2, 9109 List the prime factors of 2471. 7, 353 List the prime factors of 30725. 5, 1229 What are the prime factors of 1261? 13, 97 List the prime factors of 14898. 2, 3, 13, 191 What are the prime factors of 18933? 3, 6311 What are the prime factors of 13664? 2, 7, 61 What are the prime factors of 1609? 1609 What are the prime factors of 574? 2, 7, 41 List the prime factors of 99948. 2, 3, 8329 List the prime factors of 595. 5, 7, 17 List the prime factors of 4483. 4483 List the prime factors of 247. 13, 19 What are the prime factors of 2961? 3, 7, 47 What are the prime factors of 2869? 19, 151 What are the prime factors of 582? 2, 3, 97 What are the prime factors of 11038? 2, 5519 What are the prime factors of 2131? 2131 List the prime factors of 27450. 2, 3, 5, 61 What are the prime factors of 35200? 2, 5, 11 List the prime factors of 649. 11, 59 List the prime factors of 16900. 2, 5, 13 List the prime factors of 64138. 2, 32069 List the prime factors of 87666. 2, 3, 19, 769	{ "pile_set_name": "DM Mathematics" }
3z2 - 3z - 3. Suppose -2a = 283 - 267. Let t(k) = -2k*3 + 8k*2 + 8k + 8. Calculate ay(g) - 3t(g). -2g3 Let d(n) be the first derivative of n3/3 - n2/2 - 166. Let k(p) = p - 2. Let i(f) = 4f - 9. Let q(w) = 2i(w) - 9k(w). What is 2d(r) - 3q(r)? 2r2 + r Let l(b) = -2b*3 - 6b*2 + 28b - 2. Let p(t) = 2t3 + 7t*2 - 27t + 3. What is -5l(z) - 4p(z)? 2z3 + 2z*2 - 32z - 2 Let d(j) = -44j3 - 26j*2 - 16j + 24. Let i(o) = -9o3 - 5o*2 - 3o + 5. Determine -3d(x) + 16i(x). -12x3 - 2x2 + 8 Let z(f) = f2 + 1. Let q(x) = 9x2 + 7. Suppose 0 = 431j - 427j + 24. Determine jz(d) + q(d). 3d2 + 1 Let n(s) = -5s + 15. Let o(g) = 4g - 14. Let l = -610 - -613. Calculate ln(x) + 4o(x). x - 11 Let d(l) = -l - 4. Let q(h) = 14h - 42. What is -10d(t) - q(t)? -4t + 82 Let v(p) = p - 1. Let n(j) = 9j + 17. Let f(t) = -9t - 12. Let a(z) = -4f(z) - 3n(z). Give -2a(l) + 6v(l). -12l Let c(h) = -3h. Let f(o) = 82o + 81o + 77o - 239o. Calculate 3c(a) + 5f(a). -4a Let c(m) = 174m*3 - 6m2 + 4. Let w(h) = -h2 + 1. Calculate c(d) - 5w(d). 174d3 - d2 - 1 Let a(d) = d*2 + 10. Let z(v) = v + 1. Let u be z(0). Suppose 1 = j - u. Suppose 3k - 7k = 88. Let n(w) = 1. Determine ja(h) + kn(h). 2h*2 - 2 Let d(m) = 27m*3 - 14m*2 + 7m - 6. Let o(p) = 18p3 - 10p*2 + 5p - 4. Calculate -5d(r) + 7o(r). -9r3 + 2 Let x(w) = 75w*3 - 5w*2 - 10w - 5. Let o(y) = 112y3 - 8y*2 - 16y - 8. Determine -5o(f) + 8x(f). 40f3 Let z(y) = 5y*2 + 3y + 6. Let l(d) = 10d2 + 7d + 14. Give 4l(m) - 9z(m). -5m2 + m + 2 Let f(q) = 6q*3 + 2q*2 - 5q. Suppose 2u - 124 = 2s, 3u - 2s + 248 = 7u. Let o = u + -59. Let k(r) = 2r3 + r2 - 2r. Give of(i) - 8k(i). 2i*3 - 2i*2 + i Let b(c) = -5c + 3. Let t(k) = -11k + 5. Suppose 116 = 70y + 1026. What is yb(f) + 6t(f)? -f - 9 Let w(t) = 16t + 16. Let j(z) = -5z - 5. Let r(c) = 14j(c) + 4w(c). Let h = -56 + 51. Let p(g) = -2g + 4g + 1 - g. Determine hp(f) - r(f). f + 1 Let i(q) = -q - 1. Let o(k) = -14k*2 + 3. Let w(j) = -48j*2 - 2j + 9. Let n(r) = 7o(r) - 2w(r). Let v be (2/5 + 0)-5. Determine vi(m) - n(m). 2m2 - 2m - 1 Let m(b) = 6b + 95. Let x(z) = 5z + 96. What is -2m(o) + 3x(o)? 3o + 98 Let d(v) = 6v + 5. Let y(g) = -5g - 4. Let w(r) = -4d(r) - 5y(r). Let p(h) = 6h + 2. Suppose -6 = 5s - 1. Let f = 20 + -15. What is fw(t) + sp(t)? -t - 2 Let r(q) = -4q*2 - q + 11. Let u be (-6)/(-27) - (-344)/72. Let g(k) = -6k*2 - k + 16. Give ug(b) - 7r(b). -2b*2 + 2b + 3 Let r(a) = -a + 4. Let t(v) = -13v + 16. Let o be t(1). Let f(b) = -3. What is of(g) + 2r(g)? -2g - 1 Let p(g) = 8g3 - 15g*2 + 21g + 19. Let s(q) = -4q3 + 7q*2 - 9q - 10. Determine -3p(d) - 7s(d). 4d3 - 4d*2 + 13 Let s(b) = 10b + 17. Let x(f) = -12f - 19. Let i(k) = -5s(k) - 4x(k). Let v(y) = -3y - 14. Determine 8i(r) - 5v(r). -r - 2 Let w(r) = -r*2 - 4. Let i(o) = -2o - 2. Let l(b) = b*2 - 2b + 1. Let p(a) = -i(a) + l(a). What is -6p(s) - 5w(s)? -s*2 + 2 Let f(i) = 2i2. Let b(u) = -u2 - 3u2 + 0u*2 + 4u*2 + 4u*2. What is 2b(h) - 5f(h)? -2h*2 Suppose -2j = -j - 2. Let y(z) = z - 1. Let w(p) = -2p - 1. Let n(v) = -v2 - 12v - 2. Let g(t) = n(t) - 5w(t). Calculate jg(r) + 4y(r). -2r*2 + 2 Let w(u) = -4u*3 - 9u*2 - 2u + 1. Let z(b) = -11b3 - 26b*2 - 6b + 3. What is 17w(i) - 6z(i)? -2i3 + 3i*2 + 2i - 1 Let x(n) = -n. Let f(g) = 24g. Suppose -7z - 35 = -28. Give zf(h) - 4x(h). -20h Let d be ((-6)/8)/(1/(-4)). Let v(p) = 4p*2 - 3p + 1. Let m(a) = -2a + 7a - 2a - 5a*2 + 1948 + a - 1949. What is dm(q) + 4v(q)? q2 + 1 Let c(i) = 1. Let y(h) = 3h - 1. What is 2c(o) - y(o)? -3o + 3 Let s(i) = -42 + 18 + 13 + i*2 + 11 - 3i. Let q(h) = -h3 - h2 + 2h. Determine 3q(g) + 2s(g). -3g3 - g2 Let d(k) = k*2 - 1. Let b(m) be the first derivative of 16 - 1/2m2 - m. Determine -b(t) + d(t). t2 + t Let c(m) = -2m3 + 10m*2 - 11m - 6. Let l(v) = -v*2 + 2v + 1. What is c(r) + 6l(r)? -2r*3 + 4r*2 + r Let d(n) = 29n + 11. Let k(m) = 28m + 10. Give -6d(r) + 7k(r). 22r + 4 Let w(c) = -169c - 1. Let k(y) = -1. Calculate -2k(z) + w(z). -169z + 1 Let g(m) = -2m*2 - 3. Let k(r) = 3r*2 - 2r + 7. Let l(i) = -15i2 + 11i - 36. Let x(v) = -11k(v) - 2l(v). What is -7g(w) + 4x(w)? 2w2 + 1 Let g(k) = 43k - 262. Let d be g(6). Let b(z) = -4z2 + z - 6. Let p(i) = i3 - 3i*2 + i - 5. What is dp(y) + 3b(y)? -4y*3 - y + 2 Let i(v) = -195v*2 - 20v + 20. Let h be 20(8 + (-35)/5 - 0). Let m(l) = 28l*2 + 3l - 3. What is hm(c) + 3i(c)? -25c2 Suppose -2f + 5f - v - 11 = 0, v + 19 = 5f. Let z(h) = -h + 4. Let b be (-5)/(-4) - (-1)/(-4). Let i(d) = 2 - d + 2 + b. What is fi(q) - 5z(q)? q Let r(y) = 19y. Let c(o) = 6o - 3o + 3o + 5o - 2o. Determine 7c(s) - 4r(s). -13s Let s(n) = 4n - 3 - 6n - 3n + 3n. Let z(q) = 28q - 614. Let o be z(22). Let f(j) = -j + 1. Give of(k) + s(k). -4k - 1 Let b(o) = -7o2 - 8o + 10. Let h(i) = -i + 2. Determine b(c) - 6h(c). -7c*2 - 2c - 2 Let y(z) = -3z2 + 18z + 18. Let a(p) be the second derivative of 2p + 1/2p*2 - 33 + 1/6p*3. Give -18a(l) + y(l). -3l2 Suppose 0 = -5x + 5y + 60, -4x - 8y + 9y + 48 = 0. Let l(g) = 3 + g - 3. Let s(t) = 8t. Calculate xl(n) - s(n). 4n Let q(k) = -k3 - 9k*2 - 9. Suppose -86u + 83u + 54 = 0. Let g(t) = -2t*2 - 2. Determine ug(a) - 4q(a). 4a3 Let j(g) = -g3 + 2g - 2. Suppose 2t = 4t - 20. Let z be ((-8)/t)/(10/(-75)). Suppose b - z = 4b. Let f(w) = -3w3 + 9w - 9. Give bf(u) + 9j(u). -3u3 Let v be (-234 - (-3 - -1))(-9)/4. Let y(w) = -522w + vw - 2 - 3w2. Let a(o) = 14 + 19o*2 + 0 - 1. Give -6a(x) - 39y(x). 3x2 Let k(i) = i2 - i - 3. Let h(t) = 2t2 - 2t - 4. Let w(v) = -2h(v) + 3k(v). Let u(x) = -8x2 + 6x + 5. What is u(p) - 6w(p)? -2p*2 + 11 Let p(s) = -1160s + 27. Let n(r) = -287r + 7. Calculate 15n(l) - 4p(l). 335l - 3 Let u(r) = 9r3 + 14r*2 - 9. Let k(o) = -17o*3 - 27o*2 + 17. What is 6k(z) + 11u(z)? -3z*3 - 8z*2 + 3 Let z(o) = 2o*2 - 2o + 10. Let y(w) = 3w2 - 2w + 11. Determine 4y(d) - 5z(d). 2d2 + 2d - 6 Let r(f) = 73f2 + 6f + 1. Let v(u) = -147u2 - 14u - 3. Calculate -7r(z) - 3v(z). -70z2 + 2 Let l(v) = 783v*2 - 21v. Let f(w) = -197w2 + 5w. Determine -21f(c) - 5l(c). 222c2 Let a(j) = -j2 - 2j + 2. Let t(c) be the second derivative of 3c4/4 + 7c*3/2 - 21c*2/2 + 72c. What is -42a(g) - 4t(g)? 6g2 Let z(r) = -2r + 3 + 2 - 5 + 1 - 3. Let h(p) = p + 3. Let k(c) = -c - 4. Let q(n) = -4h(n) - 3k(n). Give 5q(s) - z(s). -3s + 2 Let l(w) = w + 5w2 + 6w + 0w2. Suppose -5y - 2b = -29, 2y - 4b - 1 = 25. Let v(s) = -3s*2 - 5s. What is yv(r) + 5l(r)? 4r2 Let r = -560 - -571. Let a(h) = -5h - 6. Let v(t) = 14t + 18. What is ra(w) + 4v(w)? w + 6 Let c(g) = -4g*2 + 4g - 6. Let j(w) = 2w - 13. Let v be j(6). Let b(d) = -d2 + d - 1. Let t = 1 + -10. Let k = t + 15. Determine kb(s) + vc(s). -2s*2 + 2s Let w(c) = -5c3 - 95c. Let q(j) = -5j3 - 94j. Calculate 2q(l) - 3w(l). 5l3 + 97l Let q(i) = 5i - 3. Let n(j) = j. Suppose 0 = -4o - 12, -5k - 2o = -0k + 11. What is kq(g) + 4n(g)? -g + 3 Let u(x) = x. Let p(b) = -5b + 18. Let d be p(3). Let z(w) = -5w - 2 - dw + 2w. Calculate -5u(l) - z(l). l + 2 Let d(x) = x*2 + 4x. Suppose -2j - 3 = w, j - 2w + 1 + 8 = 0. Let h(y) be the first derivative of 2y3/3 + 3y*2/2 + 4. Calculate jd(o) + 4h(o). 5o*2 Let s = 17 - 13. Let g be 13 - (5/5 - 0). Let r(d) = 2d3 - 7 - 3 + d + 14 - sdg. Let q(j) = j3 - 3j2 + 3. Determine 4q(c) - 3r(c). -2c*3 - 3c Let b(h) = -9h3 - 5h2 - 5. Let q(j) = -j3 - j*2 - 1. Suppose 5i - 45 = -5c, 3i = 5i - 2. Suppose -3 = 11f + c. Calculate fb(z) + 5q(z). 4z3 Let y(q) = -q2 - q. Let j(u) = -10u*2 - 9u - 2. Let d(z) = j(z) - 5y(z). Let x(l) = -2 + 195l + 0 - 6l2 - 200l. Calculate 4d(k) - 3x(k). -2k2 - k - 2 Let r(c) = c - 9. Let o(a) = 2a - 14. Let v = 460 + -468. Determine v*r	{ "pile_set_name": "DM Mathematics" }
+ 3. Let l(i) = 14i - 11. Give 11h(t) - 4l(t). -t Let d(h) = -2h*2 + 3h - 3. Let i(l) = 7l2 - 11l + 11. Suppose 4v - 2t + 7t = -88, -4v - 88 = -3t. Let r = -497 - -491. What is ri(n) + vd(n)? 2n2 Let n(l) = -l2 - 2l - 10. Let a be n(-4). Let h = a + 15. Let d(z) = -z3 + 3z*2 - 3z + 2. Let o(m) = m3 - m2 + m. Give ho(v) - d(v). -2v*3 - 2 Let b(n) = -n + 9. Let m be b(3). Let v(d) = 5d*2 - 11d + 11. Let p(t) = -t*2 + 3t - 3. Give mv(x) + 22p(x). 8x2 Let x(m) = 3. Let a(u) = 192u + 5. Give a(g) - x(g). 192g + 2 Let b(o) = -5o*3 + 52o - 5 + 4 + 7o2 + 7 - 44o. Let n(v) = -11v3 + 15v*2 + 17v + 13. Let x = 1 - 7. Determine xn(l) + 13b(l). l3 + l2 + 2l Let r(s) = 2s + 84. Let l(b) = -b - 42. Determine 5l(h) + 3r(h). h + 42 Let z(w) = -w + 1. Let y(a) = -19a + 11. Let l(x) = -5x + 3. Let u(g) = -22l(g) + 6y(g). Suppose 4q = 5q - 2. Give qz(j) - u(j). 2j + 2 Suppose 2o + 2w = -o, 1 = 5o + 3w. Suppose -7 = -og - 3. Let h(p) = 6 - 7 + 8p*3 + 7pg + 1. Let m(y) = y3 + y*2. Give -3h(a) + 21m(a). -3a*3 Let a(u) = -2u - 2. Let v = 1593 - 1587. Let h(p) = -4p - 4. Calculate vh(q) - 13a(q). 2q + 2 Let c(b) = 116545b. Let n(z) = 607z. What is 2c(p) - 385n(p)? -605p Let z(n) = 3n3 + n2 + n + 12. Let p(t) = 13t3 + 5t*2 + 5t + 46. What is -2p(f) + 9z(f)? f3 - f2 - f + 16 Let b(d) be the first derivative of -4d3/3 - 2d*2 - 3d + 628. Let f(c) = 9c2 + 7c + 5. Determine -10b(t) - 6f(t). -14t2 - 2t Let c(u) = 12495u2. Let l(z) = 88z*2. Calculate 3c(y) - 425l(y). 85y*2 Let o(h) = -7h - 63. Let j(q) = -13q - 127. Give -4j(g) + 7o(g). 3g + 67 Let f(u) = -2u3 - 4u*2 + 3u*3 + 3u - 3u3 + 4 - 7u + 0u3. Let w(l) = -15l*3 - 33l*2 - 33l + 33. Determine 33f(o) - 4w(o). -6o3 Let c(i) = -14705 - i + 14706 + 0i. Let x(l) = 4l - 2l + l - 4 - 4. Let s = -13 + 8. Determine sc(k) - x(k). 2k + 3 Let b(u) = 25u2. Let m(s) = 28s*2. Determine -3b(g) + 2m(g). -19g*2 Let l(i) = -15i*3 - 47i*2 + 7i - 9. Let k(d) = -8d3 - 24d*2 + 4d - 5. Determine 7k(q) - 4l(q). 4q3 + 20q*2 + 1 Let s(p) = 2p + 11. Let x(h) = h + 6. Suppose -2q - 3 = -5o, 3q - 4 = 2o - 14. Let l be o - 5(-12)/(-20). Calculate ls(z) + 7x(z). -z - 2 Let g(a) = 909a + 10. Let s(p) = 2729p + 35. Determine -7g(z) + 2s(z). -905z Suppose -5t + 13 = 2o, 3o - 6o - 5t + 27 = 0. Let c(v) = -2 + 3v - 2 + 1. Let a(l) = 10l - 10. Determine oc(g) - 4a(g). 2g - 2 Let z(l) = l - 7. Let f(y) = 7y + 153. What is -f(c) + 4z(c)? -3c - 181 Let a(r) = r2 + r + 2. Let g(c) = -2c*2 - 4c + 2. Determine -3a(p) - g(p). -p2 + p - 8 Let y(h) = 1148h*3 - 42h*2 - 14h + 14. Let p(u) = 383u3 - 15u*2 - 5u + 5. Calculate 14p(d) - 5y(d). -378d3 Let j(z) = -58 + z + 56 - 4z. Suppose 92 = 4n + 2m, -3n + 4m - 2m = -83. Suppose n + 0 = -5p. Let h(o) = 2o + 2. Determine ph(y) - 4j(y). 2y - 2 Let q(g) = -3g3 + 4g*2 - 5g + 76. Let n(y) = 5y3 - 6y*2 + 6y - 76. Determine 2n(z) + 3q(z). z*3 - 3z + 76 Let j(p) = -9p3 + 3p*2 - 3p - 3. Let m(q) = 4 - 4q3 + 2q - 9 - 2q2 + 7 + 14q*3. Calculate -2j(f) - 3m(f). -12f*3 Let t be 2(-27)/6 + 4 + 1. Let n(k) = -k*2 + 3k - 10. Let j(r) = 2r2 - 4r + 11. Give tn(f) - 3j(f). -2f2 + 7 Let r(d) = 52d + 8. Let q(n) = -53n - 10. Determine -3q(w) - 4r(w). -49w - 2 Let v(p) = -4p3 - 2p*2 - 2p + 5. Let h(q) = -3q3 - q + 4. What is 3h(z) - 2v(z)? -z3 + 4z*2 + z + 2 Let u(o) = 24o*3 + 9o*2 + 7o + 12. Let m(f) = 73f3 + 26f*2 + 20f + 34. What is -6m(q) + 17u(q)? -30q3 - 3q*2 - q Let s(z) = z + 1. Let b(j) = -16j - 4. Calculate -b(t) - 3s(t). 13t + 1 Let p(l) = l. Let d(o) = 4o. Let i be 4/69/(-3)3. Let g(j) = id(j) + 33p(j). Let c(f) = -f. Give -6c(m) - g(m). -3m Let m(i) = 2i*2 - 2i + 6. Let t(p) = -p*2 + p - 3. Give 4m(u) + 9t(u). -u2 + u - 3 Let k(g) = -g3 + g - 1. Let q(z) = 11z*3 - 6z + 6. Suppose 0 = 42l - 46l + 24. Give lk(i) + q(i). 5i*3 Let d(r) = -3r + 3. Let a(n) = 5n - 7. Suppose 10 = -12m + 17m. Let c(u) = ma(u) + 5d(u). Let k(t) = -11t + 3. What is -7c(y) + 3k(y)? 2y + 2 Let h(i) = 12i*2 + 32i + 12. Let s(d) = d*2 + 3d + 1. Let x(y) = h(y) - 10s(y). Let c(v) = -9v*2 - 11v - 11. What is -6c(k) - 33x(k)? -12k2 Let r(h) = 233h*2 - 10h + 3. Let m(x) = -116x2 + 4x - 1. Calculate 5m(l) + 2r(l). -114l2 + 1 Let o(h) = 5h + 1. Let x(m) = 42m + 13. Let w(q) = -21q - 7. Let v(t) = 5w(t) + 3x(t). Give -9o(r) + 2v(r). -3r - 1 Let f(t) = 7t*3 + 56t*2 - 13t + 22. Let d(s) = -2s3 - 14s*2 + 3s - 5. Calculate -9d(j) - 2f(j). 4j3 + 14j*2 - j + 1 Let q(o) = 2o + 3. Let g be (-18)/(-8) - 2/8. Let k(y) = 27 + 2y + 4y - 2y - 20. Suppose 1 + 4 = -w. What is gk(r) + wq(r)? -2r - 1 Let t(b) = -7b3 + 11b*2 - 2b - 11. Let h(y) = -4y3 + 6y*2 - y - 6. What is -5h(f) + 3t(f)? -f3 + 3f*2 - f - 3 Let k(q) = q - 32. Let t(f) = f - 59. What is -11k(r) + 6t(r)? -5r - 2 Let a(t) = 28t3 + 5t*2 + 5t. Let l(s) be the second derivative of -77s5/10 - 7s*4/3 - 14s*3/3 - 293s. Determine 28a(v) + 5l(v). 14v3 Let a(s) = 81s + 570. Let u be a(-7). Let b(z) = 2z - 1. Let c(j) = 2j - 1. Calculate uc(x) - 4b(x). -2x + 1 Let h(u) = -4u + 1. Let x(n) be the third derivative of n6/30 - n4/12 + n*3/6 - 4n*2. Let z be x(1). Let q(v) = -v + 1. What is zq(b) - h(b)? b + 2 Let j be (-3 + (-40)/(-12))12 + -4. Suppose 0 = 3q + 15, j = 4p + 7q - 2q + 9. Let m(u) = -5u*2 - 3. Let z(g) = -2g*2 - 1. Determine pm(y) - 11z(y). 2y*2 - 1 Let z(j) = 7j*2 + 27j. Let i(l) = -3l2. Calculate -4i(p) - 2z(p). -2p*2 - 54p Let d(k) be the third derivative of -11k4/24 - 4k*3/3 - 390k*2. Let t(c) = -4c - 3. Determine -6d(v) + 17t(v). -2v - 3 Let u(w) = 3w - 15. Let b(i) = -2i + 1. Give 2b(v) + u(v). -v - 13 Let i(n) = n3 + n2 + n + 1. Let z = 1857 + -1851. Let y(s) = 6s2 + 6s + 3. Determine zi(f) - y(f). 6f*3 + 3 Let f be 3(-1 - 0) + (2 - -7). Let z(j) = 4j3 - 6j. Let a(w) = -4w3 + 5w. Let b be 78/18 + 2/3. Calculate bz(r) + fa(r). -4r3 Let r(q) = -22. Let s(v) = v + 1. Let j(t) = -4t*2 - 168t - 1. Let d be j(-42). What is dr(f) - 22s(f)? -22f Let u(y) = 70y - 85. Suppose -3j - 58 = -4b + 144, j = -5b + 262. Let t = b - 58. Let z(v) = 5v - 6. Determine tu(o) + 85z(o). 5o Let d(j) = -16j*2 - 5j - 1. Let z(w) = w*2 + w + 1. Give -d(r) - 5z(r). 11r2 - 4 Let z(c) = -c. Let d(v) = -v + 5. Let r(u) = -u - 1. Let x(y) = d(y) + 3r(y). Let j = 133 + -63. Let i = j + -73. What is iz(f) + x(f)? -f + 2 Let o(d) = d - 482. Let r(c) = 3c - 1689. What is 18o(j) - 5r(j)? 3j - 231 Let k(y) = -2y*3 - y - 1. Let g(j) = -78j*3 + 2j*2 - 2j - 2. What is g(n) - 2k(n)? -74n*3 + 2n*2 Let a(q) = 10q*2 + q. Let x be a(-1). Let j be 3/x-3 + 4. Let n(d) = -d + 1. Let z(v) = v - 2. Give jn(w) + z(w). -2w + 1 Let w(k) = 3k2 + 5k. Let u(i) = 20i2 + 32i. Suppose 4y - 9y = 25. Determine yu(l) + 32w(l). -4l2 Let b(f) = f - 1. Let v(a) = 3a - 3. Suppose -5l + 45 = -10l. What is lb(q) + 2v(q)? -3q + 3 Let r(g) = -6g*2 - 7g - 6. Let z(i) = -i - 1. What is r(p) - 5z(p)? -6p*2 - 2p - 1 Let b(o) = -4o2 - 7o - 7. Let j(y) = 3y2 + 6y + 6. Let k = 66 + -63. Suppose n = -0f - 2f - k, 4f + 41 = 3n. Calculate nj(g) + 6b(g). -3g2 Let k(n) = 11n*2 - n + 2. Let a(h) = -21h*2 + 3h - 2. Determine 2a(u) + 5k(u). 13u2 + u + 6 Let y(c) = 8c*3 + 3c*2 - 2c + 3. Let o be (3/9)/1(-189)/63. Let t(u) = -u3 - u2 - 1. Give oy(j) - 3t(j). -5j*3 + 2j Let x(k) = -7k. Let c(q) = 3q - 2. Let n(y) = -77y + 56. Let i(u) = -84c(u) - 3n(u). What is -2i(p) + 7x(p)? -7p Let m(q) = -7q + 5. Let g(t) = 2t*2 - 6t + 4. Let h(l) = 3g(l) - 2m(l). Let s(w) = 5w2 - 3w + 1. Give 3h(x) - 4s(x). -2x2 + 2 Let b(z) = -12z*2 - 5z - 5. Let f(y) be the second derivative of y4/12 + y3/6 + y*2/2 + 55y - 2. Give -b(o) - 5f(o). 7o*2 Let m(v) = 15v*3 - 3v*2 + 14v - 16. Let b(t) = -8t3 + 2t**	{ "pile_set_name": "DM Mathematics" }
Which is the nearest to -6? (a) -17/6 (b) 0.3 (c) -1/2 (d) 3 a What is the nearest to -24.3 in -2, 21, 0.02? -2 Which is the closest to 0.05? (a) 5 (b) -8/7 (c) -1 (d) -2/3 (e) -7 d Which is the nearest to 1093? (a) -0.5 (b) -3 (c) 33/7 c What is the closest to -3/5 in -1/7, 0.1, -2, 0.26, 5/3? -1/7 Which is the closest to -3? (a) -70 (b) 11 (c) 3/8 (d) 0 d Which is the closest to 2/153? (a) 1/5 (b) 3174 (c) -1 a Which is the closest to -1/2? (a) 0.4 (b) 0.1 (c) 7212 (d) 1/8 b Which is the closest to 2/7? (a) 3 (b) -0.4 (c) 6 (d) 4 (e) 5 b Which is the closest to -2/3? (a) -4 (b) 5 (c) 2 (d) 2/47 d Which is the nearest to -119.74? (a) 0.3 (b) -1 (c) 0 b Which is the closest to -24/47? (a) -0.03 (b) -0.5 (c) 0 (d) -2/5 (e) -1/11 b Which is the nearest to -2/3? (a) -1.2 (b) 38 (c) -3/11 c What is the nearest to -2/15 in 5, 1/4, 13, 6? 1/4 Which is the nearest to -0.12? (a) -3 (b) 0 (c) -7 (d) 16 b What is the closest to 0 in 15, 2/3, 3, 0.2, 1829? 0.2 Which is the closest to -0.2? (a) -119 (b) 3/2 (c) -2 (d) -0.4 d What is the nearest to -1 in 2/15, -2, 5140, -66, 1? -2 Which is the closest to 2341? (a) -0.5 (b) -0.3 (c) 5 c What is the closest to -1/2 in 5, -85, 1/6, 5/6? 1/6 What is the nearest to -0.1 in 0.2, -84, -54, -3/5? 0.2 Which is the nearest to -5? (a) 4 (b) -8 (c) 17/4 (d) 5 b What is the nearest to 41169 in 1, -2/3, -0.4? 1 Which is the nearest to -2? (a) 20/9 (b) -0.4 (c) 21/2 (d) 7 (e) -1/6 b Which is the closest to -2? (a) -10 (b) 2 (c) -0.1 (d) -0.7 (e) -11 d What is the nearest to -7 in -2/5, -2, 13, -1.36, -2/3? -2 What is the closest to 1354 in 1, 0.3, -2/23? 1 What is the nearest to -2 in 0, 4/5, 7, 87? 0 Which is the nearest to -0.115? (a) 2/11 (b) 0.1 (c) -1048 b Which is the nearest to -2/13? (a) -0.4 (b) -3/8 (c) -2 (d) -1/2 (e) -1/3 e Which is the closest to -0.5? (a) 1 (b) 44 (c) -6 (d) 0.003 d Which is the closest to -2/3? (a) 1/20 (b) -516 (c) -2/117 c Which is the nearest to 163? (a) -3 (b) -9 (c) -4 a What is the nearest to -0.1 in -3, 5, 2/49, -23? 2/49 Which is the closest to 2/7? (a) -1/6 (b) -1/2 (c) -0.253 (d) 2 a Which is the closest to -0.11? (a) -4 (b) 0.2 (c) 0.3 (d) 2/7 (e) 17 b What is the closest to -3 in 4/9, 0.061, 1? 0.061 What is the closest to -39 in 10/21, -1, 2? -1 Which is the closest to 3/10? (a) -0.3 (b) 3/119 (c) -4/29 b Which is the closest to 767? (a) -1 (b) -18 (c) -1/5 c Which is the closest to 2/3? (a) -5 (b) 0.03 (c) 0.1 (d) 18 c Which is the nearest to -4/55? (a) -3 (b) -4 (c) 851 a Which is the closest to 28? (a) 1072 (b) 5 (c) 0.4 b Which is the nearest to -7? (a) 1/5 (b) 2/3 (c) -0.5 (d) -1 (e) 101 d What is the closest to 1 in 13380, -4, 0? 0 Which is the nearest to -2/9? (a) 2 (b) 82 (c) 97 a What is the closest to 5 in 60/13, -5, 0.02? 60/13 Which is the nearest to -265? (a) -0.24 (b) -1/6 (c) 0.05 a Which is the nearest to 4? (a) 2.43 (b) 0.1 (c) -1 (d) 20 a What is the nearest to 0 in -1/17, 57, 0, 4/9, -4? 0 What is the closest to -0.1 in 317/5, -1, -10.98? -1 Which is the nearest to -0.5? (a) 0.1 (b) -661 (c) 2 (d) 0.2 a What is the nearest to 1/38 in 5, 0.2, -1, -6? 0.2 Which is the closest to 0? (a) 1/11 (b) 71874 (c) 5 a Which is the closest to 82? (a) 4 (b) -2/3 (c) 173 a Which is the nearest to 1/4? (a) 0.4 (b) 1/6 (c) -144 (d) -2 (e) 3 b What is the closest to -2 in 0, -0.3, -8, 0.1, -20? -0.3 Which is the closest to -1? (a) 1 (b) 0.31 (c) -20 (d) 1/8 d What is the nearest to -1/4 in 51/5, -5, 3, -0.25, 2? -0.25 Which is the nearest to 0? (a) -0.3 (b) -282 (c) 3/2 (d) -2031 a Which is the nearest to 1? (a) -3/8 (b) 56/5 (c) -0.1 (d) 3 (e) 3/5 e What is the nearest to 1 in 2/3, 186, -0.06, 4, 3/4? 3/4 What is the nearest to -3 in 27, -0.1, 2/11, -0.4, -7/3? -7/3 Which is the closest to 1? (a) -0.4 (b) -5 (c) -0.38 (d) -4 c Which is the nearest to 0.1? (a) 20 (b) -2/13 (c) -1/4 (d) 0 d Which is the closest to -117? (a) 136/15 (b) 3 (c) 1 (d) -0.1 d What is the nearest to 2/5 in 4, 11/7, 2/19, -2/7, -2/3? 2/19 Which is the nearest to 2/5? (a) 6/11 (b) -0.08 (c) -3 a Which is the closest to 206? (a) -3 (b) 7 (c) -4 b What is the nearest to -0.9 in -1553, -2, 0, -0.1? -0.1 What is the closest to 2 in -4, -0.3, 0, 1806? 0 What is the closest to -131 in 0.1, -2/69, -1/2, -2/7? -1/2 What is the nearest to 85 in -1, -8/3, 0.3, 3? 3 What is the closest to -5/19 in 3, 7.7, -4, -79, 2/3? 2/3 What is the closest to 62 in -3/7, 1/5, -0.005? 1/5 What is the nearest to 1/5 in -5, 1/11, -1/5, -10? 1/11 What is the closest to 248 in 1, -3, -0.2, -11? 1 What is the nearest to 0.2 in -157, 0.2, 5, -0.4, 1/7? 0.2 Which is the closest to 2/7? (a) -1243 (b) -15 (c) -0.9 c Which is the nearest to 19/8? (a) -3 (b) -5 (c) -37 a Which is the nearest to 13? (a) 2 (b) 0.4 (c) -112 a Which is the closest to -2? (a) 911 (b) -3 (c) 3 (d) -1/12 b What is the nearest to -2 in -724, -2, 119, -2/7, 2? -2 Which is the nearest to 1? (a) 1/6 (b) -0.5 (c) 2/29 (d) 13 a What is the nearest to 2 in 366, -1, -509? -1 What is the nearest to 1/2 in 16, 2/7, 1/12, -5, -2/43? 2/7 What is the nearest to 0.1 in 2/9, 2, 0.055, 5, -4/3? 0.055 Which is the nearest to 1/3? (a) 2/11 (b) 22/5 (c) 1989 a Which is the nearest to 1? (a) 2/9 (b) -0.4 (c) 384/25 (d) 2/3 d Which is the closest to -1? (a) -2 (b) 27.25 (c) -5 (d) -1/2 d What is the nearest to -1/6 in 5, -0.2, 11, 3, -3/4? -0.2 What is the nearest to 2/7 in 1, 21, 0.1, 2? 0.1 Which is the closest to -1? (a) -84811 (b) 2 (c) -0.4 c Which is the closest to -0.05? (a) -1/16 (b) -23 (c) 0.9 (d) -2 (e) 3/4 a What is the closest to -24 in -1.9, -116, -1? -1.9 What is the closest to 0.1 in -7, 1, 7.5, 2, 65? 1 What is the nearest to -1/27 in -0.45, -2, 1? -0.45 Which is the nearest to 0.1? (a) 0 (b) -0.066 (c) 0.066 (d) -2 c What is the nearest to 308 in -1/5, 0.19, 2, -3/7? 2 What is the nearest to 0.1 in 0.0813, -59, -0.5? 0.0813 Which is the nearest to -17? (a) 2/5 (b) 1 (c) -0.3 (d) -2/15 (e) -5.5 e Which is the closest to 4? (a) 3/4 (b) -0.02 (c) -88 a What is the closest to -2/5 in -3/4, -1, -2/13, -0.00262, 10? -2/13 Which is the closest to -1? (a) 1 (b) -3/35 (c) 5 (d) 407 b What is the closest to -1.2 in -0.03, -16/203, -0.3? -0.3 Which is the closest to 2/5? (a) -2/3 (b) -0.3 (c) 2.4 (d) 21 (e) -0.04 e Which is the nearest to -3? (a) 413 (b) 64 (c) -0.3 c What is the closest to -0.2 in -17, 4/3, -237, -2, -0.2? -0.2 Which is the closest to 0? (a) -2/5 (b) -0.5 (c) 159 (d) 3/2 a Which is the nearest to 3? (a) 3/5 (b) -2/19 (c) -0.16 (d) 430 a Which is the closest to -14/15? (a) -0.5 (b) -3 (c) 0.2 (d) -1 (e) 4 d Which is the closest to 12961? (a) -0.4 (b) 4 (c) -0.02 b Which is the closest to -62/3? (a) 2 (b) 0.07 (c) 1 (d) 3 b What is the closest to -4 in -0.3, 4, 0.1608? -0.3 Which is the closest to -4? (a) -0.013 (b) 3 (c) 1/5 a What is the nearest to 2 in -0.24, 1/64, 0.5? 0.5 What is the nearest to -174 in 28, -1/5, -3/7, 23? -3/7 What is the closest to -12 in -4, -0.1, -162.4? -4 Which is the closest to 1? (a) -3/49 (b) 2 (c) -810 (d) 1 d What is the closest to -2/7 in -4, -5, 274, -2? -2 What is the nearest to 0.0454 in 0.2, -3/7, -1? 0.2 Which is the nearest to -13449? (a) 0.4 (b) 2 (c) 3 (d) -9 d Which is the closest to -1/2? (a) 25 (b) -11 (c) 4/25 c Which is the closest to 0.1? (a) -0.2 (b) 1/4 (c) -273 (d) 2/3 b Which is the nearest to 1? (a) 2 (b) 11399 (c) -0.1 a What is the closest to 11830 in 9, -3, 3/5? 9 Which is the nearest to -11.34? (a) 2 (b) -0.5 (c) 3/8 (d) 5/3 (e) -3/5 e What is the closest to 1 in -0.4, -620, 0.2, 0.4, -5? 0.4 What is the closest to -2 in -8, -0.1, -4/5, 5? -4/5 What is the nearest to -0.1 in -2824, 1/2, 0.23? 0.23 What is the nearest to -8 in 0, 40, 7? 0 What is the closest to -0.2 in 4, -3/8, -1, -168? -3/8 Which is the nearest to -1? (a) 4/7 (b) -0.2 (c) -0.5 (d) -5 (e) -4/3 e Which is the closest to -0.1? (a) 0 (b) 238 (c) 1/7 (d) -0.0402 d What is the nearest to 0 in 6/5, 2/3, -5, -0.3, 23/6? -0.3 What is the nearest to 1 in 6, -5	{ "pile_set_name": "DM Mathematics" }
the r'th term of 11361, 11374, 11397, 11436, 11497? r3 - r2 + 9r + 11352 What is the k'th term of 43, 29, 1, -47, -121? -k3 - k2 - 4k + 49 What is the d'th term of -21, -25, -41, -75, -133, -221, -345, -511? -d*3 + 3d - 23 What is the p'th term of 12, 209, 744, 1785, 3500, 6057, 9624? 28p3 + p2 - 2p - 15 What is the h'th term of 300, 312, 340, 390, 468, 580, 732? h*3 + 2h2 - h + 298 What is the t'th term of 44, 41, 40, 41? t2 - 6t + 49 What is the a'th term of 3, 26, 81, 186, 359, 618, 981, 1466? 3a*3 - 2a*2 + 8a - 6 What is the x'th term of 623, 681, 749, 833, 939, 1073, 1241, 1449? x3 - x2 + 54x + 569 What is the b'th term of 6, 78, 260, 606, 1170? 9b3 + b2 + 6b - 10 What is the q'th term of -107, -125, -157, -209, -287, -397, -545? -q3 - q2 - 8q - 97 What is the b'th term of 66, 130, 194, 258, 322, 386? 64b + 2 What is the z'th term of -4826, -4830, -4844, -4874, -4926, -5006, -5120, -5274? -z3 + z2 - 4826 What is the z'th term of -194, -179, -174, -185, -218, -279, -374? -z3 + z2 + 19z - 213 What is the f'th term of -789, -796, -807, -822? -2f2 - f - 786 What is the f'th term of 129, 145, 163, 183? f2 + 13f + 115 What is the m'th term of 31, 102, 229, 418, 675, 1006? m*3 + 22m*2 - 2m + 10 What is the h'th term of 745, 1495, 2245? 750h - 5 What is the a'th term of 67, 343, 1095, 2563, 4987? 40a*3 - 2a*2 + 2a + 27 What is the u'th term of -151, -139, -99, -19, 113, 309, 581, 941? 2u3 + 2u*2 - 8u - 147 What is the d'th term of 455, 921, 1399, 1895, 2415? d*3 + 459d - 5 What is the u'th term of -8, -3, 4, 13, 24, 37, 52? u*2 + 2u - 11 What is the g'th term of -2131, -2101, -2041, -1945, -1807, -1621? g*3 + 9g*2 - 4g - 2137 What is the o'th term of 876, 877, 878, 879? o + 875 What is the o'th term of -187, -377, -567, -757, -947, -1137? -190o + 3 What is the r'th term of -33, -70, -107, -144? -37r + 4 What is the x'th term of -82, -60, -16, 56, 162, 308, 500, 744? x*3 + 5x2 - 88 What is the z'th term of -13807, -13805, -13801, -13795, -13787, -13777, -13765? z2 - z - 13807 What is the b'th term of -254, -496, -740, -986, -1234, -1484, -1736? -b*2 - 239b - 14 What is the j'th term of 25, -4, -19, -14, 17, 80, 181? j3 + j2 - 39j + 62 What is the u'th term of 200, 411, 636, 881, 1152? u3 + u2 + 201u - 3 What is the m'th term of 2725, 2723, 2721, 2719, 2717, 2715? -2m + 2727 What is the n'th term of -180, -160, -140, -120, -100, -80? 20n - 200 What is the k'th term of 984, 1974, 2964, 3954, 4944? 990k - 6 What is the s'th term of -14, -21, -30, -41, -54? -s2 - 4s - 9 What is the l'th term of -109, -238, -365, -490, -613, -734, -853? l*2 - 132l + 22 What is the h'th term of 3, 2, 1, 0? -h + 4 What is the o'th term of 116, 267, 478, 755, 1104, 1531? o*3 + 24o*2 + 72o + 19 What is the f'th term of 24, 26, 28, 30, 32, 34? 2f + 22 What is the p'th term of 5, 20, 59, 134, 257, 440, 695, 1034? 2p3 + p + 2 What is the j'th term of -99, -177, -257, -339, -423? -j2 - 75j - 23 What is the u'th term of 13, 39, 87, 163, 273, 423, 619? u3 + 5u*2 + 4u + 3 What is the s'th term of 538, 1076, 1612, 2146, 2678, 3208? -s*2 + 541s - 2 What is the l'th term of -31, -90, -235, -508, -951, -1606, -2515, -3720? -7l3 - l2 - 7l - 16 What is the c'th term of 39, 59, 85, 117? 3c2 + 11c + 25 What is the d'th term of -107, -208, -309? -101d - 6 What is the m'th term of 413, 401, 385, 365, 341, 313, 281? -2m*2 - 6m + 421 What is the f'th term of -21, 1, 69, 183? 23f2 - 47f + 3 What is the m'th term of -22, -111, -260, -469, -738? -30m2 + m + 7 What is the h'th term of 263, 264, 275, 302, 351, 428, 539? h3 - h2 - 3h + 266 What is the v'th term of 34, 24, 12, -2, -18? -v*2 - 7v + 42 What is the w'th term of -18, -35, -50, -63, -74, -83, -90? w*2 - 20w + 1 What is the c'th term of 289, 583, 877? 294c - 5 What is the t'th term of 124, 494, 1106, 1954, 3032, 4334, 5854, 7586? -t3 + 127t*2 - 4t + 2 What is the c'th term of 20, 27, 38, 53? 2c2 + c + 17 What is the a'th term of -60, -113, -152, -171, -164, -125, -48? a3 + a2 - 63a + 1 What is the d'th term of 52, 109, 166, 223, 280? 57d - 5 What is the i'th term of 2895, 2898, 2903, 2910, 2919? i2 + 2894 What is the c'th term of 1494, 1498, 1504, 1512? c2 + c + 1492 What is the l'th term of 15, 58, 129, 228, 355? 14l*2 + l What is the s'th term of -58, -53, -44, -31, -14? 2s*2 - s - 59 What is the o'th term of 32, 40, 48, 56? 8o + 24 What is the t'th term of 32, 23, 4, -31, -88? -t3 + t2 - 5t + 37 What is the u'th term of 6, 25, 56, 99, 154, 221, 300? 6u2 + u - 1 What is the t'th term of -9582, -9582, -9568, -9534, -9474? t3 + t*2 - 10t - 9574 What is the d'th term of -8573, -8577, -8583, -8591, -8601? -d*2 - d - 8571 What is the w'th term of 6272, 6278, 6288, 6302, 6320, 6342, 6368? 2w*2 + 6270 What is the v'th term of 325, 1307, 2945, 5239, 8189? 328v*2 - 2v - 1 What is the z'th term of -2853, -2845, -2825, -2787, -2725? z*3 + z - 2855 What is the b'th term of 23, 124, 395, 920, 1783? 14b3 + b2 + 8 What is the a'th term of -152, -143, -132, -119, -104, -87? a*2 + 6a - 159 What is the o'th term of 370, 372, 374? 2o + 368 What is the m'th term of -1225, -2450, -3673, -4894, -6113, -7330? m2 - 1228m + 2 What is the m'th term of 4, -10, -42, -98, -184, -306, -470? -m*3 - 3m*2 + 2m + 6 What is the l'th term of 15, 1, -21, -51, -89, -135, -189? -4l2 - 2l + 21 What is the w'th term of -883, -1752, -2623, -3496? -w*2 - 866w - 16 What is the i'th term of -71, -91, -111, -131, -151, -171? -20i - 51 What is the i'th term of -107, -112, -117, -122, -127? -5i - 102 What is the y'th term of -58, -57, -52, -43? 2y2 - 5y - 55 What is the l'th term of 200, 399, 612, 845, 1104, 1395, 1724? l3 + l2 + 189l + 9 What is the z'th term of 11, 29, 75, 161, 299, 501, 779? 2z*3 + 2z*2 - 2z + 9 What is the l'th term of -262, -264, -276, -304, -354, -432, -544, -696? -l3 + l2 + 2l - 264 What is the g'th term of -2485, -2474, -2449, -2404, -2333, -2230, -2089, -1904? g3 + g2 + g - 2488 What is the w'th term of -105, -426, -955, -1686, -2613, -3730? w3 - 110w*2 + 2w + 2 What is the b'th term of 101, 190, 279, 368, 457? 89b + 12 What is the i'th term of -58, -130, -170, -172, -130, -38, 110? i3 + 10i*2 - 109i + 40 What is the h'th term of -16210, -16211, -16212, -16213? -h - 16209 What is the c'th term of -544, -543, -542, -541, -540? c - 545 What is the b'th term of 101, 210, 323, 440? 2b2 + 103b - 4 What is the l'th term of 40, 43, 48, 55, 64, 75, 88? l*2 + 39 What is the c'th term of -106, -108, -110, -112, -114, -116? -2c - 104 What is the m'th term of -19, 1, 37, 95, 181, 301, 461? m*3 + 2m*2 + 7m - 29 What is the v'th term of -20, -21, -22, -23, -24? -v - 19 What is the l'th term of 215, 429, 645, 863, 1083, 1305, 1529? l*2 + 211l + 3 What is the x'th term of 1318, 1317, 1316, 1315, 1314, 1313? -x + 1319 What is the p'th term of -43, -35, -21, -1, 25, 57? 3p2 - p - 45 What is the l'th term of -269, -312, -385, -488, -621? -15l*2 + 2l - 256 What is the i'th term of 313, 315, 317, 319, 321, 323? 2i + 311 What is the y'th term of 3, -21, -43, -63, -81, -97, -111? y2 - 27y + 29 What is the t'th term of -230, -468, -708, -950, -1194, -1440, -1688? -t*2 - 235t + 6 What is the y'th term of -306, -632, -948, -1248, -1526, -1776? y3 - y2 - 330y + 24 What is the y'th term of -907, -1822, -2739, -3658, -4579? -y2 - 912y + 6 What is the x'th term of 2880, 2875, 2870, 2865, 2860, 2855? -5x + 2885 What is the j'th term of -7, -38, -117, -268, -515? -4j*3 - 3j What is the d'th term of -172, -188, -204, -220, -236? -16d - 156 What is the o'th term of -67, -65, -63, -61, -59? 2o - 69 What is the o'th term of 2103, 4205, 6307, 8409? 2102o + 1 What is the s'th term of 21, 52, 89, 126, 157, 176? -s3 + 9s*2 + 11s + 2 What is the o'th term of 57, 72, 85, 96, 105, 112? -o*2 + 18o + 40 What is the u'th term of -60, -55, -50, -45, -40, -35? 5u - 65 What is the r'th term of 0, -3, -8, -15, -24, -35? -r*2 + 1 What is the x'th term of -224, -225, -226, -227, -228, -229? -x - 223	{ "pile_set_name": "DM Mathematics" }
nded to 3 decimal places? -0.006 Let w = -1028 + 1028.2658. What is w rounded to 2 dps? 0.27 Suppose 79152 = -8m - 47248. What is m rounded to the nearest 1000? -16000 Let r = 50.58 - 50. Let a = -0.28 + r. Let u = a - 0.2999953. Round u to six decimal places. 0.000005 Suppose -3 = 14q - 13q. Let i be q + (0 - 21199997/1). What is i rounded to the nearest 1000000? -21000000 Let l = -256.4 + 239. What is l rounded to the nearest integer? -17 Let z = 24 + 172. Let d = 197.93 - z. What is d rounded to one decimal place? 1.9 Let c be ((-374)/51)/(1/(-198)). Let t be 2 + -2 + -1 + 4. Suppose -3o + 5768 = o - 2b, -o + c = -tb. Round o to the nearest 100. 1400 Let r(l) be the first derivative of -10l3/3 + 3l*2/2 - 5l - 7. Let o be r(5). What is o rounded to the nearest one hundred? -200 Let x(s) = 15s3 - 3s*2 + 2s + 4. Let p be x(3). Suppose -5h + p = 25688. Round h to the nearest 1000. -5000 Let j = 1.958 - 1.956691. Round j to 5 decimal places. 0.00131 Let o(s) = -2s - 10. Let d be o(-6). Suppose 0y = dy + 22973986. Let c = y + -3613007. What is c rounded to the nearest 1000000? -15000000 Let k(i) be the first derivative of 5i4/4 + i3/3 - 6i*2 - 5i + 4. Let z be k(9). Let t = z + -7613. What is t rounded to the nearest 1000? -4000 Let z(p) be the first derivative of -p*2/2 - 3p - 4. Let j be z(-3). Suppose -3m = -2f + 143, -f + 3m = -jf - 79. Round f to the nearest ten. 60 Let s = -1946830341.39874803 + -36.60125197. Let d = s - -1946830313.99999865. Let o = d + 64. What is o rounded to 7 decimal places? -0.0000014 Suppose 49r = 996649 + 2098191. What is r rounded to the nearest 10000? 60000 Let m(p) = 39p*3 - 14p*2 + 12p + 14. Let v be m(5). What is v rounded to the nearest one thousand? 5000 Let c = 224204 - 120085. Let g = c - 104108.70051. Let f = g - 10.3. What is f rounded to four dps? -0.0005 Let f = 723797 + -723796.9360043. Let c = f - 0.064. What is c rounded to six dps? -0.000004 Suppose -12q - 61112 = 145288. Round q to the nearest 10000. -20000 Let u be (245/(-2))/(1/1418). Let d(o) = 11072o + 15. Let h be d(-10). Let z = u - h. Round z to the nearest ten thousand. -60000 Let p be 27596/(-6)174/116. Round p to the nearest one thousand. -7000 Suppose 6k + 3y = 5k - 9, 9 = 3k - 3y. Suppose k = -5c + 2c + 228000. Round c to the nearest ten thousand. 80000 Suppose 0x - 418 = -2x. What is x rounded to the nearest 10? 210 Let i = -0.27 - -0.2666. Round i to 3 dps. -0.003 Let i = -163350804164970 + 163350782714797.4000022. Let z = i - -21450175. Let k = 2.4 - z. What is k rounded to seven dps? -0.0000022 Let o = 55.973 + 0.027. Let r = o + -56.000012. Round r to six decimal places. -0.000012 Let y = 10 + -4. Suppose 3z - yz + 13140 = 0. Suppose 0 = -2p + 4p - z. Round p to the nearest one hundred. 2200 Let s be ((-168500)/(-1))/(-4 - 14/(-4)). Round s to the nearest one hundred thousand. -300000 Let g = 0.07069 + 0.05305. Round g to three dps. 0.124 Let g = 4.786 - 4.8. Let n = 62619 - 62618.98599913. Let r = g + n. What is r rounded to 7 decimal places? 0.0000009 Let d = -250.31 - -253. Let s = d + -1.4. Let i = 2.9 - s. What is i rounded to 1 decimal place? 1.6 Let z = -0.084 + 1.2. Let p = -0.95 + 2.18. Let y = p - z. Round y to two dps. 0.11 Suppose 35c + 532252 = -336798. Round c to the nearest one thousand. -25000 Let p = -48.932 + -0.068. Let t = -1591152412.99999895 - -1591152364. Let a = t - p. Round a to 7 decimal places. 0.0000011 Let u = 7990.922 - 7984. Round u to 1 dp. 6.9 Suppose 0 = 2p - 4p + 6762. Suppose -4s + 4b + 4964 = 0, 26s - 23s + 5b - 3723 = 0. Let d = s - p. What is d rounded to the nearest one hundred? -2100 Let f = -0.121 - -7.221. Let x = 2.08 + 9.92. Let a = f - x. What is a rounded to 0 decimal places? -5 Let p(f) = f*2 - f - 3. Let t be p(3). Let n = 131 + -92. Let j be 13/n - (-77399999)/t. Round j to the nearest 1000000. 26000000 Let v = 1913.159 + -1913. Round v to 3 dps. 0.159 Let j = -0.03 - -29.03. Let a = -9 + j. Let y = a + -19.9973. Round y to three dps. 0.003 Let u = 152.4 + -10.8. Let x = u - -1.4. Let m = x + -142.999929. What is m rounded to 5 decimal places? 0.00007 Let r = -25 + 76. Let o = 95 + r. Let y = o + -131.4. Round y to 0 dps. 15 Suppose 3d + 4o = -o - 3, 0 = 5d - o - 23. Suppose 12 = -4t + d. Let w be 1 - 6 - t - -1060003. What is w rounded to the nearest one hundred thousand? 1100000 Let d = 13188 - -296712. Round d to the nearest 10000. 310000 Let j = -51.6 - -61. Let h = -12 + j. Let a = h + -1.2. Round a to the nearest integer. -4 Let n = -0.273 - -2.413. Round n to the nearest integer. 2 Let y(s) = -980001s - 5. Let a(b) = -980001b - 5. Let f(o) = -5a(o) + 4y(o). Let w be f(-5). Round w to the nearest one million. -5000000 Let n = -13.24 - -13. Let t = -0.23988 - n. Round t to 5 dps. 0.00012 Let v = -594.45 - -633. Let q = 37 - v. What is q rounded to 1 dp? -1.6 Let i = 232 + -231.936. Let n = 6.08 + -6. Let q = i - n. Round q to three decimal places. -0.016 Let z = -3 + 7. Suppose z + 36 = 5u. Let f be ((-362)/u)/((-2)/8). What is f rounded to the nearest ten? 180 Let y = 426.64167 + -0.04167. What is y rounded to the nearest ten? 430 Suppose -d + 4v - 2v + 7 = 0, 0 = d - 3v - 9. Suppose 5z - 151 = r, -2z = -dz + r + 27. Suppose 44 = 3s - z. Round s to the nearest 10. 30 Let u = 269543 + -14871. Let k = u + -254518.901. Let t = k - 153. Round t to 2 decimal places. 0.1 Let u = 42.5 - 42.5000892. What is u rounded to five dps? -0.00009 Let u = -279.75 - -279.7519289. Round u to 5 decimal places. 0.00193 Let u = -23435532 + 23435412.00159. Let j = u + 120. What is j rounded to four dps? 0.0016 Let r(f) = 15f*2 + 2f. Let n be r(-2). Let b be 14/n - (-1359999)/4. What is b rounded to the nearest one hundred thousand? 300000 Let q(i) = 2i + 4700. Let h(u) = 2u*2 + 5u + 2. Let j be h(-2). Let z be q(j). Round z to the nearest one thousand. 5000 Let g = -132.4 - -140. Let v = -6.97 + g. Round v to 1 decimal place. 0.6 Let i = 2319.1 + -2560. Let y = i - -218.72. Let d = -22 - y. Round d to two dps. 0.18 Let l = 353.00357 + -353. What is l rounded to three decimal places? 0.004 Let k = 678.10949097 - 560.1094934. Let o = 118 - k. What is o rounded to seven dps? 0.0000024 Let y = -170.5 - -312.3. Round y to the nearest 10. 140 Let l = -749 + 741.66. Let w = -6.3 - l. Let q = -0.73 + w. Round q to 1 dp. 0.3 Let w = -1091707 + -78293. What is w rounded to the nearest 100000? -1200000 Let g = -293 - -748. Let o = g + -454.9999747. Round o to six decimal places. 0.000025 Let s = 20.4610636647 + -0.3895623747. Let l = s + -119.07149639. Let q = -99 - l. What is q rounded to six dps? -0.000005 Let v = -0.0338 - -0.5451. Round v to 2 decimal places. 0.51 Let w = -0.15 + 14.15. Let f = -3113 + 3098.916. Let h = w + f. Round h to 2 dps. -0.08 Let b = 324.165 - 316.8. What is b rounded to zero dps? 7 Let r = 43.35 + -0.35. Let i = 20 - r. Let q = i + 22.99928. Round q to 4 decimal places. -0.0007 Let y = 162.9999967 - 163. What is y rounded to 6 dps? -0.000003 Let a be (85005 - 15/(-4 + 7))628. Round a to the nearest 1000000. 53000000 Let i(v) = -3v - 49. Let p be i(-18). Suppose 0 = pb + 187683 + 722317. Round b to the nearest 10000. -180000 Let h be 38(-4)/24. Let g(n) = 783331n + 6. Let z(a) = 3133325a + 25. Let y(c) = hz(c) + 15g(c). Let f be y(-6). Round f to the nearest 1000000. 5000000 Suppose 3c + 118500 = -2c - 3y, 0 = 4c + 5y + 94800. What is c rounded to the nearest 1000? -24000 Let f = 41 + -16. Let t = 24.999985 - f. Round t to 5 dps. -0.00002 Let k = 18.6 - 18.59454. Round k to 4 decimal places. 0.0055 Let b = 150.5 + -26.5. Let w = b + -123.9999776. What is w rounded to six dps? 0.000022 Let g = 0.26 - 0.285. Round g to 2 dps. -0.03 Let u = 2 + -1.64. Let q = -0.3583 + u. What is q rounded to three decimal places? 0.002 Let x be (18 - 927344)(-30)/(-1). Suppose -9254165 = k + 33865615. Let q = k - x. Round q to the nearest 1000000. -15000000 Let x(f) = 467998f3 - f2 + 3f - 2. Let w be x(1). Suppose -4n + j - w = 0, 2j + j + 6 = 0. Round n to the nearest ten thousand. -120000 Let r be (-1 - 0)1 + 1. Suppose r = c - 4 + 14. Let s be (-795003)/15 - 2/c. What is s rounded	{ "pile_set_name": "DM Mathematics" }
-2/9 Determine n so that -645n5/7 + 29721n*4 - 2687583n*3/7 - 4227267n*2/7 - 1386612n/7 - 55620/7 = 0. -1, -2/5, -2/43, 15, 309 Factor 4c2/9 - 519289312c/9 + 16853836847339584/9. 4(c - 64911164)2/9 Determine p, given that -82p*2/3 - 57328p/9 + 115640/9 = 0. -28910/123, 2 What is r in -2r2/5 - 86500196r/5 - 935285488504802/5 = 0? -21625049 What is i in -4i2 - 996023848i + 996023852 = 0? -249005963, 1 What is b in 2b2/15 - 209274692b/5 + 16423461266885574/5 = 0? 156956019 Factor 4355a2 - 26113a/2 - 51/2. (a - 3)(8710a + 17)/2 Solve -5l2 - 157625l + 120040680 = 0. -32269, 744 Factor z*3 - 530481z*2 + 6365664z - 19096884. (z - 530469)(z - 6)2 Factor 3c*2/2 - 167976675c/2 + 83988336. 3(c - 55992224)(c - 1)/2 Determine l, given that 15l2 + 184240l + 3495145 = 0. -36791/3, -19 Solve 504739523645h2 + 2541784h + 16/5 = 0 for h. -4/1588615 Solve -p*5/3 - 16498p*4/3 - 214340p*3/3 - 576926p*2/3 + 269255p = 0. -16485, -7, 0, 1 Factor -d*3 + 49d*2 + 128242d - 3992800. -(d - 368)(d - 31)(d + 350) Find j, given that 2j3/9 - 4246j*2/9 - 155138j/9 - 669290/9 = 0. -31, -5, 2159 Find a such that 2a4/3 - 554552a*3 + 115324079360a*2 - 1383862333952a/3 = 0. 0, 4, 415912 Determine x so that x*4/2 - 681x*3 - 708729x*2/2 - 352319x + 707364 = 0. -401, -2, 1, 1764 Factor 5r3 - 1550r*2 - 661880r + 13817600. 5(r - 544)(r - 20)(r + 254) What is a in 3a*2 + 47605743a/2 - 23802873/2 = 0? -7934291, 1/2 Suppose 3m2/7 - 2325168m/7 + 11625765/7 = 0. What is m? 5, 775051 Factor 5g2 - 53429870g. 5g(g - 10685974) Solve n*2 - 131789n - 1317990 = 0 for n. -10, 131799 Factor z*2/6 + 614947z/6 - 512460. (z - 5)(z + 614952)/6 Factor 5d*2/2 + 5975d + 596445/2. 5(d + 51)(d + 2339)/2 Factor 2p2/3 + 2076886p/3 - 16615216/3. 2(p - 8)(p + 1038451)/3 Solve 3a5 - 4689a*4 + 1648062a*3 + 143834430a*2 + 2896997103a + 2754815427 = 0. -37, -1, 819 Let n*5 - 1530n*4 + 215232n*3 - 7959328n2 = 0. Calculate n. 0, 76, 1378 Determine v, given that v3/4 - 119337v2/4 - 566941v = 0. -19, 0, 119356 What is f in 5f2 + 223825f + 223820 = 0? -44764, -1 Let 5m5 - 2420m*4 + 26205m*3 - 90130m*2 + 123100m - 56760 = 0. Calculate m. 1, 2, 6, 473 Determine h, given that -3h2 - 44628h + 21305871 = 0. -15339, 463 Let i*5 - 12934i*4 + 42310766i*3 - 3160743440i*2 + 62735911401i - 113167128258 = 0. What is i? 2, 37, 6429 Factor -45c2 - 24365995c + 10829340. -5(c + 541467)(9c - 4) Let -18191447a*4/2 - 18375229033a*3/3 - 419178342a*2 - 9562788a - 72720 = 0. What is a? -2020/3, -6/263 Find o such that -34o4 + 7220o*3 - 124022o*2 + 577780o - 460944 = 0. 1, 108/17, 11, 194 Factor -5f2 + 645545790f - 20836468349336205. -5(f - 64554579)2 Factor 4n*3 + 2462604n*2 + 379160330076n + 41299222960276. 4(n + 109)(n + 307771)*2 Factor 2f*2/15 - 90226f/3. 2f(f - 225565)/15 Factor -3c2/7 + 5598540c/7 - 2611970844300/7. -3(c - 933090)2/7 Solve m4/3 + 89774m*3 + 8059909648m*2 + 723812067859328m/3 + 4340261519956992 = 0 for m. -89768, -18 What is d in -3d5/4 + 672d*4 + 114261d*3/4 + 463815d*2/2 = 0? -30, -11, 0, 937 Solve 3z*2/7 + 52946874z/7 + 233614288864323/7 = 0 for z. -8824479 Determine k so that 7k5/10 + 551k*4/10 + 1269k*3/2 + 5317k*2/10 - 9760k + 2730 = 0. -65, -10, -7, 2/7, 3 Let -4i3 + 29992i*2 + 1235556i + 6332760 = 0. What is i? -35, -6, 7539 Factor 2w2 + 38405816w + 153623232. 2(w + 4)(w + 19202904) Factor 3h3/4 + 18695629h*2/4 + 7281803772852h + 2427267404961. (h + 3115938)*2(3h + 1)/4 Factor -4r*2/5 - 4151908r/5 + 16607696/5. -4(r - 4)(r + 1037981)/5 Suppose 2g4/5 + 11938762g*3/5 + 21489750g*2 + 322346142g/5 + 322346088/5 = 0. What is g? -5969372, -3 Suppose -25140196q4/9 - 17559028q*3/9 + 7358065q*2/3 + 17559028q/9 + 3066001/9 = 0. Calculate q. -1, -1751/5014, 1 Factor -35c2 + 136697900c - 39056540. -5(c - 3905654)(7c - 2) Solve -2x*2/9 + 686672x/9 + 8927074/9 = 0 for x. -13, 343349 Solve -4r3 - 541080r*2 - 7574276r + 8115360 = 0. -135256, -15, 1 Determine u so that -u*4/3 + 146309u*3/3 - 1784810861u*2 + 208575242335u/3 + 919981254700/3 = 0. -4, 43, 73135 Factor 2d3 + 4492d*2 + 347022d + 1000692. 2(d + 3)(d + 77)(d + 2166) Factor 5v*2/6 - 108998065v/3 + 2376115634748845/6. 5(v - 21799613)2/6 Let 3d*5 + 312069d*4 + 8115430512d*3 - 8307997836d*2 - 5001072387360d - 46129891351488 = 0. What is d? -52012, -14, 29 What is l in 2l3/5 + 1516l*2/5 + 8240l + 46720 = 0? -730, -20, -8 Factor -b*3 - 49960b*2 - 616286293b + 193290312834. -(b - 306)(b + 25133)2 Factor -2f*2/9 + 244f + 1449536/9. -2(f - 1562)(f + 464)/9 Suppose -30181z3/4 + 4119707z*2 - 2249360841z/4 + 74529/2 = 0. Calculate z. 2/30181, 273 Factor 1156u3 - 7003320u*2 + 1180499328u - 50461761024. 4(u - 5886)(17u - 1464)2 Let -5l*5 + 29210l*4 + 14620215l*3 + 1772576800l*2 + 3486906500l = 0. What is l? -235, -2, 0, 6314 Suppose -2u4/9 - 22364u*3/3 + 4504558u*2/9 + 4661096u/3 + 9411640/9 = 0. Calculate u. -33613, -2, -1, 70 Let 74x2/7 + 1297776x/7 + 280576 = 0. Calculate x. -17536, -56/37 Suppose 520u3 + 2917194u*2 + 4091339340u - 47208150 = 0. Calculate u. -2805, 3/260 Suppose 50y5 + 970y*4 - 8628y*3 - 212644y*2 - 737918y + 958170 = 0. Calculate y. -19, -41/5, 1, 15 Let -2b3/5 - 6284b*2/5 - 472862b/5 - 522276 = 0. What is b? -3065, -71, -6 Suppose -6o3/11 - 1675416o*2/11 - 10052334o/11 - 15078420/11 = 0. What is o? -279230, -3 Factor 2l4/3 + 1116134l*3/3 + 1116130l*2 + 3348386l/3 + 1116128/3. 2(l + 1)3(l + 558064)/3 Suppose 3a3 - 663543a*2 - 31857123a + 32520663 = 0. What is a? -49, 1, 221229 Suppose -2r5/3 + 440r*4/3 + 1356r*3 + 4104r*2 + 4122r = 0. What is r? -3, 0, 229 Determine z, given that -2z2 + 35702z - 1175988 = 0. 33, 17818 Suppose -2z3/9 - 12178z*2/9 + 526204z/3 - 174048 = 0. What is z? -6216, 1, 126 Suppose 3k2 + 1504214586k + 188555126727929283 = 0. What is k? -250702431 Factor 4c2 + 3040880296c + 577934560912565476. 4(c + 380110037)2 Solve -2u*3 + 5660276u*2 - 124525346u + 684888072 = 0. 11, 2830116 Determine u, given that -5u3 + 2204575u*2 + 216084365u + 5294361065 = 0. -49, 441013 Solve 611177284k5 + 6724927884k*4 + 21756960k*3 + 17600k2 = 0 for k. -11, -20/12361, 0 Factor -z2/3 + 2394032z/3 - 11172084. -(z - 2394018)(z - 14)/3 Factor 5j3 - 30860j*2 + 20720320j + 167740160. 5(j - 5404)(j - 776)(j + 8) Suppose 3s*4/5 - 939s*3/5 - 171s*2/5 + 53691s/5 - 52584/5 = 0. What is s? -8, 1, 7, 313 Factor 599427j3/4 - 7698681j*2/2 + 20420400j + 57437016. 3(j + 2)(447j - 6188)2/4 Solve -10g*4 + 35g*3/2 + 435g*2 + 1015g/2 + 100 = 0 for g. -5, -1, -1/4, 8 Factor 235l4 - 73460l*3 + 7740450l*2 - 283684660l + 923354315. 5(l - 103)3(47l - 169) Solve -3t*2/2 - 5271t/2 - 18375 = 0 for t. -1750, -7 Factor 4h3/3 + 17480h*2 + 366884h/3. 4h(h + 7)(h + 13103)/3 What is w in 10w*2 - 179596w/3 - 4774322/3 = 0? -397/15, 6013 Solve -4h4 - 28020h*3 + 1097908h*2 - 6735180h - 7861104 = 0 for h. -7044, -1, 9, 31 Find g, given that 1397712g5 - 32848104g*4 + 184629333g*3 + 98291475g*2 + 12447432g - 16848 = 0. -1/4, 39/29119, 12 Determine c so that -14c5/5 - 753c*4/5 - 1021c*3 - 2310c*2 - 9776c/5 - 2592/5 = 0. -324/7, -4, -2, -1, -1/2 Suppose 5w5/2 + 47510w*4 - 855585w*3/2 = 0. What is w? -19013, 0, 9 Factor 3l*3/2 + 6296529l*2 + 13215526559835l/2 + 105722600573400. 3(l + 16)(l + 2098835)2/2 Factor l2/3 + 71030944l/3 + 1261348751382784/3. (l + 35515472)2/3 Factor 2k*2 + 3900996k. 2k(k + 1950498) Factor 4o3/9 - 661724o*2/9 + 27368408320o/9 - 27366423184/3. 4(o - 82714)2(o - 3)/9 Factor -i*4/6 + 178105i*3 + 6411942i*2 + 57707964i. -i(i - 1068666)(i + 18)*2/6 Suppose -3c*4 + 4719c*3 + 6139806c*2 - 24615756c + 24634584 = 0. Calculate c. -849, 2, 2418 Solve -p*3/6 + 113p*2 - 106571p/6 - 17875 = 0 for p. -1, 250, 429 Determine s, given that 4s3 + 11680s**	{ "pile_set_name": "DM Mathematics" }
is the o'th term of 56, 64, 72? 8o + 48 What is the w'th term of 61, 67, 69, 67, 61, 51? -2w*2 + 12w + 51 What is the h'th term of -11, -55, -129, -233, -367, -531? -15h2 + h + 3 What is the y'th term of -197, -213, -241, -281, -333, -397? -6y*2 + 2y - 193 What is the j'th term of -47, -98, -149? -51j + 4 What is the w'th term of 12, 24, 36, 48, 60, 72? 12w What is the u'th term of 167, 289, 411, 533? 122u + 45 What is the n'th term of -1376, -1375, -1374, -1373, -1372? n - 1377 What is the i'th term of -69, -148, -241, -354, -493? -i3 - i2 - 69i + 2 What is the d'th term of 424, 847, 1270, 1693, 2116? 423d + 1 What is the i'th term of -352, -359, -370, -385? -2i2 - i - 349 What is the u'th term of 15, 33, 65, 117, 195, 305, 453? u3 + u*2 + 8u + 5 What is the b'th term of -7, 20, 35, 32, 5? -b*3 + 34b - 40 What is the g'th term of 20, 39, 58, 77? 19g + 1 What is the b'th term of -415, -408, -397, -382? 2b*2 + b - 418 What is the i'th term of 9, -37, -83, -129, -175? -46i + 55 What is the i'th term of 9480, 9490, 9512, 9552, 9616, 9710, 9840, 10012? i*3 + 3i + 9476 What is the h'th term of -773, -1547, -2319, -3089, -3857? h*2 - 777h + 3 What is the z'th term of -33, 14, 61, 108, 155? 47z - 80 What is the s'th term of 46140, 46142, 46146, 46152? s2 - s + 46140 What is the u'th term of 342, 332, 316, 294, 266, 232, 192? -3u2 - u + 346 What is the y'th term of -15, -30, -47, -60, -63, -50, -15, 48? y3 - 7y2 - y - 8 What is the v'th term of 578, 617, 682, 773, 890, 1033? 13v*2 + 565 What is the g'th term of -12, -26, -66, -144, -272, -462, -726, -1076? -2g3 - g2 + 3g - 12 What is the z'th term of 636, 625, 608, 585, 556, 521? -3z*2 - 2z + 641 What is the z'th term of 340, 357, 384, 421, 468? 5z2 + 2z + 333 What is the a'th term of -95, -84, -57, -8, 69, 180? a*3 + 2a*2 - 2a - 96 What is the o'th term of 39778, 39780, 39782, 39784, 39786? 2o + 39776 What is the g'th term of -1694, -1695, -1696? -g - 1693 What is the c'th term of 233, 241, 261, 299, 361, 453, 581? c3 + c + 231 What is the l'th term of -23, -77, -165, -287, -443? -17l*2 - 3l - 3 What is the a'th term of -1306, -5205, -11704, -20803, -32502, -46801? -1300a2 + a - 7 What is the u'th term of -28, -23, -44, -103, -212? -2u3 - u2 + 22u - 47 What is the s'th term of 419, 418, 415, 410, 403? -s2 + 2s + 418 What is the l'th term of -54, -59, -82, -129, -206, -319? -l*3 - 3l*2 + 11l - 61 What is the b'th term of -66, -134, -202, -270, -338? -68b + 2 What is the f'th term of 631, 627, 621, 613, 603? -f2 - f + 633 What is the q'th term of -764, -1531, -2298? -767q + 3 What is the o'th term of -10, -14, -18, -22, -26, -30? -4o - 6 What is the s'th term of -49, -108, -171, -238, -309, -384, -463? -2s*2 - 53s + 6 What is the x'th term of -1564, -1562, -1558, -1552? x*2 - x - 1564 What is the y'th term of -82, -188, -294, -400, -506, -612? -106y + 24 What is the t'th term of 5, 53, 101? 48t - 43 What is the j'th term of -9, -16, -33, -66, -121? -j3 + j2 - 3j - 6 What is the i'th term of -5, -8, -11, -14, -17, -20? -3i - 2 What is the d'th term of 13, 27, 41, 55? 14d - 1 What is the y'th term of -316, -334, -380, -466, -604, -806? -2y3 - 2y*2 + 2y - 314 What is the r'th term of 14, 38, 80, 146, 242, 374? r*3 + 3r*2 + 8r + 2 What is the q'th term of 399, 411, 423, 435, 447, 459? 12q + 387 What is the v'th term of -523, -524, -525, -526, -527? -v - 522 What is the g'th term of -830, -825, -818, -809, -798, -785, -770? g2 + 2g - 833 What is the l'th term of -6, -8, 4, 36, 94, 184, 312, 484? l3 + l2 - 12l + 4 What is the b'th term of -420, -2869, -9516, -22461, -43804, -75645, -120084, -179221? -350b3 + b2 - 2b - 69 What is the q'th term of 11, 78, 195, 368, 603, 906, 1283, 1740? q3 + 19q*2 + 3q - 12 What is the d'th term of -27, -56, -105, -174, -263, -372, -501? -10d2 + d - 18 What is the v'th term of -95, -89, -83? 6v - 101 What is the x'th term of -16737, -16741, -16747, -16755? -x*2 - x - 16735 What is the k'th term of 17, 41, 65, 89, 113, 137? 24k - 7 What is the l'th term of -3, -34, -121, -294, -583? -5l3 + 2l*2 - 2l + 2 What is the j'th term of 33, 23, -3, -51, -127, -237? -j*3 - 2j*2 + 3j + 33 What is the f'th term of 14, 82, 200, 362, 562, 794, 1052, 1330? -f*3 + 31f*2 - 18f + 2 What is the v'th term of -4552, -4550, -4538, -4510, -4460, -4382? v3 - v2 - 2v - 4550 What is the c'th term of 914, 1771, 2630, 3491, 4354? c2 + 854c + 59 What is the d'th term of 2, 15, 42, 83? 7d2 - 8d + 3 What is the c'th term of 554, 546, 532, 512? -3c2 + c + 556 What is the q'th term of -4344, -4343, -4342, -4341, -4340? q - 4345 What is the b'th term of 1, 4, 9, 16, 25? b2 What is the o'th term of -52, -55, -58? -3o - 49 What is the p'th term of 89, 186, 295, 422, 573, 754? p*3 + 90p - 2 What is the b'th term of 4, -3, -10, -17, -24, -31? -7b + 11 What is the s'th term of 25, 62, 115, 190, 293, 430, 607? s3 + 2s*2 + 24s - 2 What is the o'th term of 10253, 20507, 30761, 41015, 51269, 61523? 10254o - 1 What is the b'th term of 410, 422, 444, 482, 542, 630, 752? b3 - b2 + 8b + 402 What is the w'th term of -67, -11, 93, 251, 469, 753, 1109? w*3 + 18w*2 - 5w - 81 What is the r'th term of 89, 104, 129, 164, 209, 264, 329? 5r2 + 84 What is the o'th term of -90, -176, -272, -384, -518, -680, -876, -1112? -o3 + o2 - 82o - 8 What is the o'th term of 61, 62, 63, 64? o + 60 What is the v'th term of 33, 126, 267, 444, 645, 858? -2v3 + 36v2 - v What is the c'th term of -232, -457, -680, -901, -1120, -1337? c2 - 228c - 5 What is the t'th term of -13, -73, -181, -343, -565? -t3 - 18t*2 + t + 5 What is the t'th term of 130, 120, 88, 22, -90, -260, -500? -2t3 + t2 + t + 130 What is the m'th term of 199, 387, 575, 763? 188m + 11 What is the l'th term of 923, 1844, 2765, 3686, 4607? 921l + 2 What is the t'th term of -10, 18, 34, 32, 6, -50, -142, -276? -t*3 + 35t - 44 What is the m'th term of 836, 826, 814, 800, 784, 766, 746? -m*2 - 7m + 844 What is the w'th term of -150, -298, -446, -594, -742, -890? -148w - 2 What is the r'th term of -6, 0, 2, -6, -30, -76? -r3 + 4r*2 + r - 10 What is the l'th term of 9, -49, -145, -279? -19l*2 - l + 29 What is the w'th term of -1058, -1060, -1062, -1064? -2w - 1056 What is the i'th term of 73, 81, 79, 61, 21, -47, -149, -291? -i3 + i2 + 12i + 61 What is the r'th term of -400, -835, -1272, -1711, -2152, -2595? -r2 - 432r + 33 What is the j'th term of 140, 285, 442, 617, 816, 1045, 1310, 1617? j*3 + 138j + 1 What is the c'th term of -34, -24, -14, -4, 6? 10c - 44 What is the c'th term of -6, -18, -44, -90, -162, -266, -408, -594? -c3 - c2 - 2c - 2 What is the i'th term of 55, 103, 151, 199, 247, 295? 48i + 7 What is the a'th term of 3, -20, -55, -96, -137, -172? a3 - 12a*2 + 6a + 8 What is the b'th term of 1807, 1800, 1787, 1768, 1743? -3b2 + 2b + 1808 What is the q'th term of 232, 431, 630, 829, 1028, 1227? 199q + 33 What is the t'th term of -137, -563, -1279, -2285? -145t*2 + 9t - 1 What is the s'th term of -34, -64, -114, -184, -274? -10s2 - 24 What is the h'th term of 27, 24, 21, 18, 15? -3h + 30 What is the s'th term of -551, -554, -557, -560? -3s - 548 What is the t'th term of -958, -1914, -2870? -956t - 2 What is the g'th term of 31332, 31331, 31330, 31329? -g + 31333 What is the s'th term of -98, -125, -152, -179, -206? -27s - 71 What is the l'th term of -83, -162, -241, -320, -399, -478? -79l - 4 What is the n'th term of 26, 27, 28, 29, 30? n + 25 What is the d'th term of -242, -490, -740, -992, -1246, -1502? -d*2 - 245d + 4 What is the d'th term of -14, -30, -46, -62, -78? -16d + 2 What is the x'th term of -65, -72, -83, -98, -117? -2x2 - x - 62 What is the w'th term of -364, -732, -1102, -1474, -1848, -2224? -w2 - 365w + 2 What is the q'th term of -44, -22, 34, 142, 320? 3q3 - q2 + 4q - 50 What is the o'th term of 50, 225, 522, 941, 1482, 2145? 61o*2 - 8o - 3 What is the y'th term of 32, 119, 268, 485, 776? y*3 + 25y*2 + 5y + 1 What is the y'th term of -47, -193, -437, -779, -1219, -1757? -49*	{ "pile_set_name": "DM Mathematics" }
-n = -m - 3. Is l(m) prime? True Let x be (-8)/4 + (-2 - -1041). Let b(z) = z*3 + 9z*2 - 6z - 8. Let i be b(-8). Let n = x + i. Is n composite? True Let x be (-6)/(-30) - 11/5. Is -2110x/123 a composite number? True Let p(t) = -2 - t + t*3 - 15t*2 + 4t + 5t. Is p(16) composite? True Let r(t) = -225t - 44. Let a be r(-7). Let s = 3048 - a. Is s composite? True Suppose -3 = 4y - 19. Suppose -yx - 490 = -6x. Let a = x - 126. Is a a composite number? True Let k = 36 + -14. Suppose 2z - 3s - 40 = -0s, -3z + k = 5s. Is (-3)/7 - (-8168)/z a composite number? True Suppose 0x + 15 = -5x + 4n, 4x + 3n - 19 = 0. Let j(v) = 5v3 - v2. Let r be j(x). Suppose rq + 80 = 264. Is q prime? False Suppose 3v - 23574 = 3195. Is v a composite number? False Let i(o) = -33o - 32. Let n(v) = -17v - 17. Let x(q) = 6i(q) - 11n(q). Let r = 16 + -28. Is x(r) prime? True Let r = -94 + -131. Let w be -3 + -8 + -5 + 2. Let m = w - r. Is m a composite number? False Suppose -5i - 4l + 84090 = -3i, -3i + 3l + 126099 = 0. Is i a prime number? False Let o(y) = -2590y + 19. Is o(-3) a prime number? True Suppose 138d = 136d - 252. Suppose 4u + 696 = -7r + 3r, 5r + 3u + 876 = 0. Let q = d - r. Is q composite? True Suppose -4d + 2q = -28, 4q - 7q - 7 = -d. Suppose -4s + 12 = 0, -w + ds - 3s = -661. Is w prime? True Let y(m) = m*2 + 6m + 2. Let z be y(-3). Let k(r) be the third derivative of -3r4 - 5r*3/6 + 8r2 + 4. Is k(z) a composite number? False Let y(j) be the second derivative of j4/12 - 5j3/2 + 7j*2/2 - 17j. Suppose 0 = -4c + c - 39. Is y(c) prime? False Let u be 10/(-3) - 14. Let x be (-2500)/(-40) + 2/4. Is 1829/9 + u/x a prime number? False Is 46/(-368) + 159369/8 a prime number? False Let v(s) = -s*3 - 5s*2 + 5s - 3. Let x be v(-6). Suppose -6k + 11331 = xk. Is k a composite number? False Suppose -150v + 156v = 53778. Is v composite? False Let j = 7 - -26. Let w(u) = -27u + 24. Let y be w(-6). Suppose -3c - 2c + y = -p, -c = 4p - j. Is c composite? False Let w(q) = 2q + 2. Let c be w(-1). Suppose c = 7f - 0f - 4746. Let x = f + -175. Is x composite? False Let o = -98 + 100. Suppose -2458 = -ox - 2x - 3s, x = 4s + 605. Is x composite? False Let x(t) = -2123t - 354. Is x(-17) prime? False Let k be 2/6 + 33/9. Let l = -70 + 144. Suppose 1738 = km - l. Is m composite? True Suppose -5s + 1 = 3x - 32, -3x + 2s = -12. Let u(t) = 172t - 65. Is u(x) a composite number? False Suppose -y + 23 = -w, 0y + 2y + 2w = 30. Let z = y - 16. Suppose -zu + 243 + 744 = 0. Is u a prime number? False Let k = -309 - -1207. Is k composite? True Let p(a) = -14a3 + 2a*2 + 3a + 25. Is p(-8) a prime number? True Let q = -135 - -138. Let y = 0 - -3. Suppose g = -4g + yl + 421, g + ql = 77. Is g a prime number? True Suppose -w - 129752 = 3w. Is ((-1)/(-2))/(0 + (-7)/w) a composite number? True Suppose -3o = -0j - 2j + 8, 2j - 2o - 12 = 0. Suppose 2c + 40 = jc. Suppose -cf = 2r - 445, -f + r - 177 = -3f. Is f prime? False Let f(k) = -384k + 143. Is f(-5) prime? True Let j(d) = 5d*3 + 2d*2 - 3d + 1. Is j(12) composite? False Let n = -122 - -122. Suppose 2x + 2w - 4312 = n, -w = 3x - 0w - 6474. Is x a composite number? True Let n = -7618 - -11210. Suppose -x - 5s - 1785 = -2x, -s + n = 2x. Is x a composite number? True Let s be 4/1(0 + -263 + -4). Let u = -445 - s. Is u a prime number? False Suppose 3 + 25 = 7n. Suppose 2a = -g + 3718, na - 7424 = -3g - 2g. Is a a composite number? False Let g be 7/(-42) + 53/(-6). Let h(m) = -m2 - 9m - 2. Let d be h(g). Is 744/36(-3)/d a composite number? False Let l = -3724 - -6875. Is l a composite number? True Let q(b) = -5b*3 - 14b*2 - 21b - 13. Is q(-20) a prime number? True Suppose -s - 641919 = -4m, -5s = 2m + 92603 - 413590. Is m composite? False Suppose 2n = -3j + 7j + 6308, 2j = 3n - 9470. Is n prime? False Suppose -280 = -3s + 11s. Is (-4602)/(-14) + (-2)/s5 composite? True Suppose -5d - 15 = 30. Is 132/(-8)186/d a composite number? True Suppose 7p - 9p = -10, x - 1629 = 2p. Is x composite? True Suppose 4l + 6l - 27330 = 0. Let o = -760 + l. Is o a composite number? False Let a be -3 + 24 + 2 + -2. Suppose -4x + a = n - 0x, 3n + 3x - 27 = 0. Suppose 0b + 64 = 2b + 2k, 4b - nk = 137. Is b a prime number? False Suppose -18c = 29c - 127793. Is c prime? True Suppose -3j - 1365 + 3810 = 0. Let g be (-5 - 2)26/(-7). Suppose -21l - j = -gl. Is l prime? True Let w(q) = 1 - q + 5q + 4 + 7q + 2q*2. Is w(-12) composite? True Suppose -6j = -0j + 6. Is (-820 + 1j)20/(-20) composite? False Suppose 0 = 5b + 7 + 13. Let h(p) = p*3 + 4p*2 - 3. Let l be h(b). Is (1477/(-21))/(1/l) a composite number? False Let t be ((-3)/4)/(-1) + (-141)/188. Is 2477 + 6/3 - t/1 a prime number? False Let f = -39322 + 91109. Is f composite? False Let k(g) = -g - 8. Let p(v) = -7v*2 - 2v + 1. Let q be p(1). Let i be k(q). Suppose 0 = -4u - u - 2h + 625, 2u + 4h - 234 = i. Is u a prime number? True Let r(i) = 16i + 7. Let v = 1 + 3. Let j be (-189)/(-28) - (-1)/v. Is r(j) a prime number? False Suppose -5z + 15 = -b, 5z - 48 = -4b + 17. Suppose -9n - 563 = -bn. Is n composite? False Let n(v) = -250v - 19. Is n(-6) a composite number? False Let u = 39093 - 24394. Is u prime? True Is (-30417)/(-5)(-370)/(-111) prime? False Is 42272/14 + 216/(-504) composite? False Is ((-35474)/3)/(396/(-27) + 14) composite? False Let t(x) = x3 + x2 - 5x + 4. Let v be t(9). Is (v/5)/((-16)/(-5) + -3) composite? False Let r(t) = -2t*3 - 77t*2 - 51t + 57. Is r(-38) a prime number? False Let p = 122 - 116. Is ((-63)/p + 7)/((-2)/4) composite? False Suppose 56a - 53a = 12. Is 299 - (-3 + 12/a) a prime number? False Suppose 6 = -0f + 2f, 2b - f - 3 = 0. Suppose -2x = bx. Let w(r) = r3 + 2r + 443. Is w(x) a composite number? False Suppose -5x - 4l = -17957, -4l - 17971 = -5x - l. Is x a prime number? True Is -3(1231012/(-18) + -1) a prime number? True Suppose 13w = 4w + 144. Suppose 4i + w = 0, -1339 = -5t + 2t - 2i. Is t composite? False Suppose 2r + 0r - 80 = 0. Suppose 6n = 4n + r. Let d = 35 - n. Is d a prime number? False Let u(k) be the first derivative of -2k3/3 + 8k2 + k + 2. Let p(f) = -f2 + 15f. Let a(m) = 6p(m) - 5u(m). Is a(8) a composite number? False Let s(x) = 48x - 14. Suppose 21n - 3n - 216 = 0. Is s(n) a composite number? True Let h = -1733 + 5910. Is h a prime number? True Let k(f) = -f*3 + 5f*2 - 6f - 1. Let l be k(3). Let p be (-20)/(-12) + l/(-3). Suppose 2v + 4y = 188, 3v + 3y = -py + 282. Is v a composite number? True Let f(n) = 3n*2 + 2n + 2. Let s be f(-1). Suppose r - 12 = -sr. Suppose -85 - 296 = -rh. Is h prime? True Let h(r) = 101r2 + 3r + 69. Is h(11) a prime number? True Let v be -7 + 8 + (0 - -2) + 0. Suppose 3l - 317 = -2i, -3i + 161 = vl - 160. Is l a prime number? True Let n(f) be the third derivative of 17f7/840 + f6/144 + f5/40 + f4/12 + f2. Let m(i) be the second derivative of n(i). Is m(4) prime? True Let g be (-63)/38/24. Let n(u) be the second derivative of -13u3/6 + 3u*2 - u. Is n(g) a composite number? False Let t = 137 + -60. Suppose 3u - t - 130 = 0. Suppose -2k + 179 - u = 0. Is k a prime number? False Let u(b) = 7b*2 - 5b + 3. Let r be u(1). Let q be 2103/4. Is 2 - r/(q/(-99)) a prime number? False Let f(q) = 6764q - 799. Is f(9) a composite number? False Suppose -2l - 16 = -6l. Suppose -lh + 4 = -2h. Suppose -hu + 4u = 148. Is u a prime number? False Let d = 755 - 124. Is d composite? False Suppose 5m - 5684 = -4z - 1691, 2997 = 3z + 3m. Suppose -2c - z = -4b, 4c + 749 = -0b + 3b. Is b composite? False Let k(j) = j*3 - 7j*2 + 17j - 13. Let h(z) = z + 28. Let l be h(-14). Is k(l) prime? True Let y(v) = v*3 + 10v*2 - 2v - 12. Let x be y(-10). Let n = x + 401. Is n a composite number? False Let m be 3428/6 - 5/15. Suppose -5w - 4x - 1860 = 0, 5w - 4w = x - 363. Let p = w + m. Is p prime? False Suppose -4q - 12 = m, -3q = -6q - 2m - 4. Let w be q/18 + (-220)/(-99). Is w - 3/3 - -252 composite? True Let m(z) be the third derivative of -155z*4	{ "pile_set_name": "DM Mathematics" }
(17)3 + 0. -6sqrt(17) + 5 Simplify (sqrt(275)2 + -3 + -4)2. -140sqrt(11) + 1149 Simplify 1 + sqrt(80) + -1. 4sqrt(5) Simplify ((sqrt(36)/sqrt(4))/sqrt(3))2 + (3sqrt(6)/sqrt(2))*2. 30 Simplify ((sqrt(54)/sqrt(3))/sqrt(3))/(sqrt(48)-2). -sqrt(2)/8 Simplify 5(1 + (1sqrt(3) + -5 - sqrt(3)))-4. 80 Simplify 3 + sqrt(21)/sqrt(3) - (5sqrt(14)/sqrt(2))*2. -172 + sqrt(7) Simplify (-6sqrt(66)2)/sqrt(6). -12sqrt(11) Simplify sqrt(143)/(sqrt(88)/(sqrt(8)3)). 3sqrt(13) Simplify 1 + 3(3 + -1 + sqrt(3)). 3sqrt(3) + 7 Simplify (-1(1 + sqrt(11)))2 + 0 - (-1 + sqrt(22)/sqrt(2) + -3). sqrt(11) + 16 Simplify sqrt(60)/((sqrt(48) + -2sqrt(48) + sqrt(48) + sqrt(48))/sqrt(4)). sqrt(5) Simplify (-4 + 2 + sqrt(5) - (1 + (sqrt(5) - (2sqrt(5) - sqrt(5)))))2. -6sqrt(5) + 14 Simplify sqrt(14)/(sqrt(7)-1) + (sqrt(2) - (sqrt(2) + (sqrt(2) - (sqrt(50) + -1 - sqrt(2)))))2 - (1 + sqrt(98) + -4). -14sqrt(2) + 22 Simplify (((2sqrt(3) - sqrt(3)) + -2 + sqrt(3))-2)*2. -32sqrt(3) + 64 Simplify (-5 + sqrt(1100) + 1)*2 - (0 + (sqrt(1100) - (2sqrt(1100))*2)). -90sqrt(11) + 5516 Simplify 5(1 + sqrt(2))-1-3. 15 + 15sqrt(2) Simplify -1 + 1 + sqrt(704) - -5(sqrt(704) + 1)2. 88sqrt(11) + 3525 Simplify ((sqrt(1216)1 - sqrt(1216) - sqrt(1216)) + -2 + -1-3sqrt(1216))2. -64sqrt(19) + 4868 Simplify ((sqrt(78) + 2(sqrt(78) - (-4sqrt(78) - sqrt(78) - sqrt(78) - sqrt(78))))/sqrt(6))*2. 3757 Simplify sqrt(56)/(sqrt(128) + sqrt(8)) - sqrt(252)2. -59sqrt(7)/5 Simplify (sqrt(60)/sqrt(3) + -5)2. -20sqrt(5) + 45 Simplify (-4(sqrt(136) - 2sqrt(136)) - sqrt(136))/(-2sqrt(1152))-2. sqrt(17)/4 Simplify sqrt(1872)/sqrt(4) - (4sqrt(468))2. -7488 + 6sqrt(13) Simplify ((-2 + sqrt(468))2)2 + 5. -96sqrt(13) + 1893 Simplify 5 + sqrt(34)/sqrt(2) + -1. 4 + sqrt(17) Simplify ((sqrt(170) + 5(sqrt(170) + (sqrt(170) + sqrt(170)-2 + sqrt(170) - sqrt(170))))/((sqrt(100) - (sqrt(100)3 - sqrt(100)) - sqrt(100))/sqrt(10)))2. 17/4 Simplify (sqrt(33) + (sqrt(33) - sqrt(297)))/sqrt(3)4. -4sqrt(11) Simplify -6((sqrt(500) + 2)-5)2 + -2. -75602 - 6000sqrt(5) Simplify -1 + (-1 + sqrt(68))*2 - (-3 + sqrt(68) + -4). -6sqrt(17) + 75 Simplify ((sqrt(432) - sqrt(432)-2) + -1 + sqrt(432))2. -96sqrt(3) + 6913 Simplify (0 + (sqrt(13) + -2 - sqrt(13)) - sqrt(143)/(sqrt(11) + sqrt(22)/sqrt(2)))*2. 2sqrt(13) + 29/4 Simplify -1 + -1 + sqrt(117). -2 + 3sqrt(13) Simplify -5(sqrt(28)/sqrt(4)5)2. -875 Simplify (3 + (sqrt(13) + 0)2 - sqrt(13))-1 - ((-1 + sqrt(832))6 + sqrt(832)). -55sqrt(13) - 10 Simplify 2(sqrt(3) - (sqrt(9)/sqrt(3))2) + 2. -4 + 2sqrt(3) Simplify 4-6(1 + sqrt(11)). -24sqrt(11) - 24 Simplify -5sqrt(32)1 + 2sqrt(96)/sqrt(3). -12sqrt(2) Simplify (sqrt(5) + sqrt(15)/sqrt(3) + -3)2 - (0 + -1 + sqrt(5) + sqrt(5)). -14sqrt(5) + 30 Simplify -5sqrt(25)/sqrt(45). -5sqrt(5)/3 Simplify (sqrt(200)1)/sqrt(10). 2sqrt(5) Simplify sqrt(11) - sqrt(1782)/sqrt(2) - sqrt(77)/sqrt(7)6. -14sqrt(11) Simplify ((3sqrt(320))/sqrt(4))2 + 4. 724 Simplify ((sqrt(288)-4)/sqrt(9))*2. 512 Simplify ((sqrt(6048) - (-1sqrt(6048) - sqrt(6048)) - sqrt(42))/(sqrt(432)/sqrt(8)) + -3)*2. -70sqrt(7) + 8656/9 Simplify (sqrt(12) + -2)2 + (-1 + sqrt(3) + 5)2. 35 Simplify (sqrt(256) - (sqrt(256) - sqrt(256)2 - sqrt(256)))/(sqrt(32)/sqrt(4)-4). -3sqrt(2) Simplify (sqrt(180) + (sqrt(180) - (4 + (sqrt(180) - sqrt(180)-2))) + -4(sqrt(180) + sqrt(180) + -2 + sqrt(180)))2. -624sqrt(5) + 30436 Simplify 2 + sqrt(19) + 0 - 6(-1 + sqrt(19)). -5sqrt(19) + 8 Simplify 0 + sqrt(567) + -4. -4 + 9sqrt(7) Simplify 1(sqrt(3) + -3 + sqrt(3) + 5). 2 + 2sqrt(3) Simplify ((-6(3 + sqrt(2)) - sqrt(2)) + sqrt(2) + (sqrt(20)4 - sqrt(20))/sqrt(10) + sqrt(2))2. 72sqrt(2) + 332 Simplify (-622sqrt(2))2 - sqrt(10)/(-2sqrt(125)). sqrt(2)/10 + 1152 Simplify (sqrt(832)-1 - sqrt(832)) + sqrt(832) + 3 + -3. -8sqrt(13) Simplify (sqrt(52) - sqrt(156)/sqrt(3))*2-2 + -2. -2 Simplify ((sqrt(1664) + sqrt(1664) + sqrt(1664) + -2sqrt(1664))/(sqrt(16)/(sqrt(8) - -2sqrt(8))))*2. 7488 Simplify (sqrt(2736)-5-5 - sqrt(2736)) + sqrt(2736). 300sqrt(19) Simplify -1 + -3 + (sqrt(13)2)2 + (sqrt(1300)2)*2. 5248 Simplify -3 + (sqrt(208)-1 - sqrt(13)). -5sqrt(13) - 3 Simplify (sqrt(1584) + (sqrt(1584) - (-1 + sqrt(1584))) - (-4 + sqrt(11) + 0)) + 2 + sqrt(99) + 4. 11 + 14sqrt(11) Simplify ((sqrt(170) - (sqrt(170)5 + sqrt(170) + sqrt(170)))3 + sqrt(170))/sqrt(10). -17sqrt(17) Simplify (sqrt(875)3)/(sqrt(70)/(sqrt(10)-2) + sqrt(7) - sqrt(7)). -30sqrt(5) Simplify -2sqrt(17)-314 + 1. 1 + 24sqrt(17) Simplify (22sqrt(132) + sqrt(132) + sqrt(132))/(sqrt(48)/sqrt(4)1). 6sqrt(11) Simplify (sqrt(88)/(sqrt(12)/sqrt(3)))/(1sqrt(539) + sqrt(539)). sqrt(2)/14 Simplify ((-4(sqrt(77) - sqrt(77)-1))/((-1sqrt(70))/sqrt(10)))2. 704 Simplify (sqrt(80) + (sqrt(80) + sqrt(80) + -1 - sqrt(80)))2 + 2 + (sqrt(80) - (0 + sqrt(80) + sqrt(80) + -5)). -20sqrt(5) + 328 Simplify sqrt(33)/(sqrt(132)/sqrt(300)) + 0. 5sqrt(3) Simplify ((sqrt(9) - sqrt(27)/sqrt(3)-6)/(sqrt(33)/sqrt(99)))*2. 1323 Simplify (2sqrt(240) - sqrt(60))/((sqrt(108) + sqrt(108) + 1sqrt(108))/sqrt(9) + sqrt(12))-1. -3sqrt(5)/4 Simplify ((sqrt(143)/(-1sqrt(11) - sqrt(11)))*2 - -3sqrt(39)/sqrt(3))5. 65/4 + 15sqrt(13) Simplify 3(sqrt(3) - (sqrt(3) + -3sqrt(3)1)2). -36 + 3sqrt(3) Simplify (-1(sqrt(9)2 + sqrt(9) + sqrt(9)))/(sqrt(6)/(sqrt(2)-2)). 8sqrt(3) Simplify (sqrt(72) + 0 + sqrt(72))-6. -72sqrt(2) Simplify (((sqrt(308) + sqrt(308)1 - sqrt(308)) + sqrt(308))/sqrt(11))/(sqrt(28)/(sqrt(14)/sqrt(2)) + sqrt(4)). sqrt(7) Simplify -465(sqrt(17) + 1). -120sqrt(17) - 120 Simplify 3 + sqrt(2) + 1 - sqrt(50)2. -9sqrt(2) + 4 Simplify 4 + (1sqrt(1331) + sqrt(11))*2 + -1. 1587 Simplify -5(sqrt(135)/sqrt(3))*2. -225 Simplify -5sqrt(95)/sqrt(20). -5sqrt(19)/2 Simplify sqrt(208)2-4 + -3. -32sqrt(13) - 3 Simplify 11sqrt(72)2. 12sqrt(2) Simplify -6(2sqrt(605))*2. -14520 Simplify ((-5(sqrt(209) - -3sqrt(209)))/sqrt(11))2. 7600 Simplify (6-1sqrt(2448) + 3(sqrt(68)/sqrt(4) + -1))*2. 414sqrt(17) + 80946 Simplify -2(sqrt(30)-2)/sqrt(10) + -2 + 4. 2 + 4sqrt(3) Simplify -4 + -2sqrt(7) + 1. -2sqrt(7) - 3 Simplify ((2 + sqrt(11))2 - ((sqrt(121)1)/sqrt(11))2) + -2. -9 + 2sqrt(11) Simplify sqrt(121)/(-4sqrt(396))1. -sqrt(11)/24 Simplify (-2sqrt(15))/sqrt(5) + (1sqrt(48))*2. -2sqrt(3) + 48 Simplify (1 + 1(-2sqrt(68))/sqrt(4))*23. -12sqrt(17) + 207 Simplify -4 + ((sqrt(17)33)2 + sqrt(17))-5. -6889 - 5sqrt(17) Simplify 4 + sqrt(200) + (sqrt(200) - (-1(sqrt(200) - 1sqrt(200)) - sqrt(200)))2. 10sqrt(2) + 804 Simplify (sqrt(112)-2 + -5)2. -16sqrt(7) - 10 Simplify (sqrt(700) - (2sqrt(700) - sqrt(700)))*2 + 1. 1 Simplify (sqrt(36)/((sqrt(972) - sqrt(972)1) + sqrt(972)))*2-6. -2/9 Simplify ((sqrt(500) + 1)-5 + -5-1sqrt(500))2. 25 Simplify (-5(sqrt(102) + sqrt(102)-2) - sqrt(102))/(-1sqrt(6)2). -2sqrt(17) Simplify 1 + (sqrt(3) + sqrt(24)/sqrt(2) - 4sqrt(15)/sqrt(5)). -sqrt(3) + 1 Simplify -3 + (sqrt(396) + sqrt(396)1 + sqrt(396))2. -3 + 36sqrt(11) Simplify (2sqrt(175) - sqrt(175)) + 5. 5 + 5sqrt(7) Simplify ((sqrt(2) + (sqrt(6)/sqrt(3) - sqrt(2)) + 4 + sqrt(2))-3)2. 144sqrt(2) + 216 Simplify (1sqrt(896))/((-1sqrt(88))/sqrt(11)). -4sqrt(7) Simplify (sqrt(78)/(sqrt(6) + sqrt(6)-3) + 5)*2-1. -113/4 + 5sqrt(13) Simplify -2(1 + sqrt(10)/sqrt(2))*2. -12 - 4sqrt(5) Simplify 3 + (sqrt(5) - (1 + sqrt(5)))*2 + (sqrt(720) + (sqrt(720) - (sqrt(720)1 - sqrt(720))) + sqrt(720))*2. 6484 Simplify (((sqrt(2299) - sqrt(2299)-5) + -2 - sqrt(2299))5)2. -5500sqrt(19) + 1436975 Simplify (sqrt(1100)-2 + 3 + sqrt(1100) - (-3 + (sqrt(1100) - (sqrt(1100) + sqrt(1100) + sqrt(1100)1 - sqrt(1100)))))*2. 36 Simplify (((sqrt(13) + 1)4)*2 - (sqrt(13) + (sqrt(1872) + 1sqrt(1872) - sqrt(1872)))) + sqrt(208) + -3 + (sqrt(13) + sqrt(325) + sqrt(325) + 1)*2. 45sqrt(13) + 1795 Simplify -4 + sqrt(12)/(-3sqrt(36)). -4 - sqrt(3)/9 Simplify sqrt(275)-2-56 + 2. 2 + 300sqrt(11) Simplify ((4 + sqrt(242) + sqrt(242) + -1 - (0 + sqrt(242) + sqrt(242) + -2))2)*2. 100 Simplify -5 + sqrt(1300)-3. -30sqrt(13) - 5 Simplify (3-6*	{ "pile_set_name": "DM Mathematics" }
econd derivative of l(p) wrt p? 36p Differentiate 54 + 26k - 22k - 97k - 26 + 63 wrt k. -93 Let g(u) be the second derivative of -11u5/20 - 5u*4/12 + 2u*3/3 + 7u*2 + 154u. What is the second derivative of g(c) wrt c? -66c - 10 Suppose -i - 3i = -48. What is the third derivative of -6h2 + h2 + 11h*6 + 0h*2 + i + 2h*2 wrt h? 1320h*3 Let z = -13 + 1. Let r = -7 - z. What is the third derivative of -rq4 + q4 + 8q2 - 8q*2 + 2q*2 wrt q? -96q Let o be (-2)/9 + 76/18. What is the second derivative of 13po - 10p + 3p - 3p wrt p? 156p2 Let f be (648/66 - 10) + (-202)/(-22). Let m(w) be the first derivative of -7/4w*4 + 0w*2 + 8 - fw + 0w3. Differentiate m(v) wrt v. -21v*2 Suppose 5p - 3p + 28 = 0. Let s = p + 18. What is the derivative of 258v*3 - 258v*3 + 3v*s - 1 wrt v? 12v*3 Let i = 8 + -8. Suppose 2w = -4z, -5w = -iz - z. What is the first derivative of 4 + 0 - 5f*3 + wf*3 wrt f? -15f*2 Suppose 6 = -2j + 3i - 8, 0 = -5j - 5i - 10. Let h(g) = g3 + 4g*2 - 3g. Let d be h(j). What is the second derivative of -p*2 + dp - 3p - p wrt p? -2 Let c(d) = d3 + 3d*2 - 4d + 5. Let j be c(-4). Differentiate -1 - t*4 + 1 + j - 2 with respect to t. -4t*3 Let s(c) be the second derivative of -8c*7/105 + 2c*3/3 + 7c*2 - 9c. Let w(a) be the first derivative of s(a). Find the first derivative of w(q) wrt q. -64q3 Let a(t) be the first derivative of -8 + 0t*3 + 0t*2 - 11t + 5/2t4. Differentiate a(j) wrt j. 30j2 Let t(u) = u2 - 17u - 16. Let a(i) = 2i*2 - 9i. Let p be a(6). Let q be t(p). Find the third derivative of 0w5 - qw5 + w5 + 8w2 wrt w. -60w2 Let u(q) = q3 + 14q2 - 2q - 25. Let m be u(-14). What is the third derivative of -mz5 + 3z*5 - 2z*5 + 4z*2 - 2z*2 wrt z? -120z*2 What is the second derivative of 22u*4 - 36u*2 - 82u + 34u4 - 55u*4 wrt u? 12u*2 - 72 Suppose 18x + 23x = 0. Let s(t) be the second derivative of xt*3 + 1/4t*4 - 5t - 1/10t5 + 0t*2 + 0. Find the third derivative of s(m) wrt m. -12 Suppose 3f + 2f - 9710 = 0. What is the third derivative of -1942t*3 + ft*3 + 10t*2 + 24t*5 wrt t? 1440t*2 Let x(v) be the first derivative of -19v*6 - 2v*5/5 - 820v*3/3 - 695. What is the third derivative of x(n) wrt n? -6840n*2 - 48n Let o(b) = -b*3 + 5b*2 + 2b - 8. Let k be o(5). What is the derivative of 3r2 - 2r*3 - 3r*k + 15 wrt r? -6r2 Let y(u) be the first derivative of u4/4 + 194u3/3 + 257u - 336. What is the derivative of y(p) wrt p? 3p2 + 388p Let j(q) be the third derivative of 5/2q3 + 13q*2 + 0 + 0q - 1/6q4. Differentiate j(f) with respect to f. -4 Let v(n) be the first derivative of 3n*3/2 + 9n*2/2 - 5n - 8. Let y(m) be the first derivative of v(m). What is the derivative of y(t) wrt t? 9 Let l(z) be the third derivative of 47z9/56 - 149z*5/20 + 3z*2 - 3z. Find the third derivative of l(q) wrt q. 50760q3 Let x(a) be the third derivative of -21a*5/10 - 65a*4/24 + 30a*2 + 2a. Find the second derivative of x(i) wrt i. -252 Let u(g) = -g*2 - 1. Let h(p) = -10p*2 - 4p - 7. Let s(m) = h(m) - u(m). Find the second derivative of s(y) wrt y. -18 Let o(c) be the third derivative of 0c4 + 23c*2 + 0 + 23/6c*3 + 13/30c*5 + 0c. Differentiate o(n) with respect to n. 52n Let y be (-21)/49 - (-22)/(-14). Let p = 1 - y. What is the third derivative of 0q*2 + pq*2 - 6q*2 + 7q*2 + 4q*6 wrt q? 480q*3 Let r be 3 + 5/(5/3). Differentiate -6p - 6p + r - 3 with respect to p. -12 Let h(q) be the first derivative of -237q5/5 + q4/2 - 17q3/3 + 470. Find the third derivative of h(z) wrt z. -5688z + 12 Let h(m) be the first derivative of -68m7/7 - m4 + 24m*3 - 197. Find the third derivative of h(l) wrt l. -8160l3 - 24 Let i(t) = t3 + 19t2 + 16t - 34. Let o be i(-18). Find the third derivative of 9jo + 138j - 32j3 - 138j - 4j2 wrt j. -192 Let d(o) be the first derivative of -o7/7 + 2o*6/3 - 9o*3 - 74. What is the third derivative of d(r) wrt r? -120r*3 + 240r*2 Let o(z) be the second derivative of -5z*4/8 - 13z*3/6 + 12z*2 - 2z. Let f(a) be the first derivative of o(a). Find the first derivative of f(t) wrt t. -15 Let f(s) be the second derivative of -s*3/6 + 11s*2/2 - 11s. Let c be f(7). What is the third derivative of cg4 - 22g*2 - 13g*4 + 11g*2 wrt g? -216g Let g(k) = 9k - 4. Let c(b) = 1. Let o = 23 + -22. Let d(l) = og(l) - 3c(l). Differentiate d(i) with respect to i. 9 Suppose 0 = -0y + y - 4. What is the third derivative of -12gy - 4g*2 - 17g*2 + 14g*2 wrt g? -288g Let r(b) be the second derivative of b*3/6 + 13b*2 - 2b. Let y be r(0). Differentiate -3u3 + 26u - yu - 3 wrt u. -9u*2 Let s(c) = 6c*3 - 1. Let b be s(1). Suppose -bz + 25 = 0, -2t = 2z + 9 - 27. Differentiate 5 - t + 1 + 3 + 5v3 wrt v. 15v*2 Let v(n) = -n + 2. Let q(o) = -259o - 221. Let d(a) = -q(a) + 2v(a). What is the first derivative of d(g) wrt g? 257 Find the second derivative of 478q + 193q2 + 11q*2 - 62q*2 + 90q*2 wrt q. 464 Let p(x) be the second derivative of -11x*5/10 + 37x*4/12 + 52x. Let n(m) = -m*3. Let i(w) = 4n(w) + p(w). What is the third derivative of i(c) wrt c? -156 Suppose -j = 2t - 45, 0t + 4j = t. What is the second derivative of -tr*3 - 30r + 15r5 + 20r*3 - 4r wrt r? 300r3 Let c(g) = -4g*3 - 8g*2 - 13g + 8. Let f(b) = 14 - 13 + 0b - b2 - b - b3. Let k(u) = 3c(u) - 24f(u). Find the second derivative of k(q) wrt q. 72q Let b(i) = -76i2 - 2i + 652. Let a(m) = 232m2 + 7m - 1956. Let w(d) = 2a(d) + 7b(d). Differentiate w(h) with respect to h. -136h Let x(y) be the second derivative of y5/10 + 55y*4/4 - 11y3/6 + y2 - 61y. What is the second derivative of x(i) wrt i? 12i + 330 Let s be (17 + -19)(-1 + 0). Find the third derivative of -8w*2 + 33w*4 + 5w2 - ws - 8w2 wrt w. 792w Let g(b) = b*3 + 150b + 0 - 148b - 2b*2 - 1. Let x be g(2). Differentiate xv*2 + 0v*2 - 4 + 2 - 5 with respect to v. 6v Let r = 23 - 38. Let s = r + 24. Find the first derivative of s + 12 - n - 12 wrt n. -1 Let q(a) be the third derivative of -23a6/60 - 22a*4/3 - 59a*2. Find the second derivative of q(s) wrt s. -276s Let o(y) = -7y2 + 5y - 22. Let v(h) = 3h2 - 2h + 11. Let i be (1-3)/((-45)/30). Let t(u) = io(u) + 5v(u). What is the first derivative of t(l) wrt l? 2l Let j(z) = -236z3 + 13z*2 - 13z + 34. Let q(w) = -118w3 + 6w*2 - 6w + 17. Let t(x) = -6j(x) + 13q(x). Find the first derivative of t(v) wrt v. -354v2 Let z(n) = 17n*2 + 82n + 243. Let d(a) = -5a2 - 28a - 81. Let r(q) = -7d(q) - 2z(q). Find the first derivative of r(p) wrt p. 2p + 32 Let r = -138 + 140. Find the third derivative of -40f*5 - 28f*r + 38f*6 + 74f*5 - 34f*5 wrt f. 4560f*3 Let d be (-288)/(-20) - 2/5. Let s = -10 + d. Find the third derivative of 5v*2 + 21v*s - 10v*4 - 15v*4 wrt v. -96v Let o(k) be the second derivative of -73k6/5 - 35k*4 - 286k. Find the third derivative of o(x) wrt x. -10512x Let q = 19 + -20. Let p be (2/(-4))/(q/8). Find the first derivative of -4 - 2 + 34y*p - 26y*4 wrt y. 32y*3 Let f = 11 + -6. Suppose 3l = -19 + 31. Differentiate -fa2 - la*2 + 4a*2 + 1 with respect to a. -10a Let x(j) = 33j3 - 17j*2 + 3. Let b(v) = 230v*3 - 118v*2 + 22. Let k(m) = -6b(m) + 44x(m). What is the third derivative of k(r) wrt r? 432 Find the third derivative of -105p*4 + 4p*5 - 118p*4 + 223p*4 - 2p + 54p3 + 3p*2 wrt p. 240p*2 + 324 Let a(n) be the third derivative of -25n*7/21 - 163n*3/6 - 16n*2 - 7n. Differentiate a(q) with respect to q. -1000q3 Let j = 1253 - 7511/6. Let n(u) be the third derivative of 0u + 11/24u4 + 0 + ju*3 + 4u*2. Differentiate n(r) with respect to r. 11 Let i = 451 - 449. Let k(v) be the second derivative of -5/6v*3 + 0 - 2/15v*6 + 0v*4 + 0v*i - 6v + 0v5. What is the second derivative of k(h) wrt h? -48h*2 Let t(c) = 27c*3 - 25c - 17. Suppose 5k - 26 - 4 = 0. Let x(p) = 9p*3 - 8p - 6. Let a(f) = k*t	{ "pile_set_name": "DM Mathematics" }
+ 7/12j4 + 7/30j*5 + 0 + 0j + 0j3. What is the second derivative of p(r) wrt r? 28 Let k(g) = 604g + 683. Let i(u) = u - 15. Let r(d) = -i(d) + k(d). What is the derivative of r(a) wrt a? 603 Suppose 9o - 883 = 4o + 4r, 5o - r - 877 = 0. Suppose h + o = 8h. What is the second derivative of -hf - 25f + 42f + 3f4 wrt f? 36f*2 What is the third derivative of 2k + 209337k2 - 209296k*2 - 2k - 418k3 wrt k? -2508 Find the second derivative of 299n*5 + 4 + 1205n - n*4 - 2406n + 1212n wrt n. 5980n*3 - 12n*2 Suppose 0 = 2q + 5o - 43, -12q + 119 = -7q + o. Find the third derivative of qr*6 - 18 - 22r*2 + 18 - 10r*2 wrt r. 2880r*3 Let q = 277 + -407. Let d = 731 + q. Find the third derivative of 12l*5 - dl*3 + 601l*3 - 9l*2 wrt l. 720l2 Let t(x) be the second derivative of x6/20 + 7x3/2 + 9x*2/2 + 4x. Let v(q) be the first derivative of t(q). Differentiate v(z) wrt z. 18z2 Find the second derivative of -238g - 156g2 - 25g + 518g2 - 125g*2 - 28g wrt g. 474 Suppose -p + 11 + 11 = 0. Suppose 4x - p = 2z - 4z, 4z - 20 = -2x. What is the derivative of 19 + r3 - 20 + 4r*z wrt r? 15r2 Let r(n) be the second derivative of n3/6 - 2n2 + n. Let o be r(7). Find the first derivative of 4 - 4x4 + x3 - x*o wrt x. -16x*3 Let l be 3/(-4) - 38/(-8). What is the first derivative of -6c*4 - 1 - 13 - 8c*4 + 9c*l wrt c? -20c*3 Let j(c) = 720c*3 + 2c*2 - 3c - 6. Let d(a) = -2161a3 - 7a*2 + 9a + 17. Let l(b) = -2d(b) - 7j(b). Find the second derivative of l(v) wrt v. -4308v Let v be 2 + 1 - (1 + 1). Suppose v = 2d - 5. Find the third derivative of 2gd + 5g*3 - 5g*3 - 4g*2 wrt g. 12 Let f(w) = -26w*2 - w. Let z be f(1). Let y = z - -29. Find the second derivative of 8u*2 - 12u*y + 11u*2 + 0u + 5u wrt u. 14 Suppose 3h - 7 = -1. Find the third derivative of 5 + 0 - l*h - 5 - 11l*3 wrt l. -66 Let j(p) = -189p*4 - 5p*3 - 21. Let s(l) = -756l*4 - 21l*3 - 84. Let z(y) = 21j(y) - 5s(y). Differentiate z(i) wrt i. -756i*3 Let g(s) be the third derivative of -17/120s*6 - 3/10s*5 + 0 + 0s*3 - 2s*2 + 0s*4 + 0s. Find the third derivative of g(o) wrt o. -102 Suppose 3a = 7a + 40. Let k(v) = -2v - 18. Let l be k(a). Differentiate o3 + 8o3 - l - o3 wrt o. 24o2 Find the first derivative of -2v*3 + 2v*3 - 11805v*2 + 169 - 217v*4 + 11805v*2 wrt v. -868v*3 Find the second derivative of -4w*3 - 2w + 156w2 + 10w*3 - 20 - 156w2 - w4 wrt w. -12w2 + 36w Let q(b) be the second derivative of 2b7/21 - b4/2 - 111b*3 + 345b. What is the second derivative of q(p) wrt p? 80p3 - 12 Let k(z) = 2z - 6. Let q be k(4). Let y = 783 - 767. Find the third derivative of -yi - 9i*5 + 7i*q + 2i*5 + 16i wrt i. -420i2 Let l(x) = 4x*2. Let v(t) = -8t*3 - 41t*2 - 97t - 3. Let z(o) = 2l(o) + v(o). Find the second derivative of z(g) wrt g. -48g - 66 Differentiate -231r3 + 445 + 222 - 12 + 30 - 331r*3 wrt r. -1686r*2 Let f(x) = -45x*3 + 2x*2 - 38x - 5. Let r(w) = 67w3 - 3w*2 + 57w + 8. Let o(h) = 8f(h) + 5r(h). What is the second derivative of o(k) wrt k? -150k + 2 Let k(z) be the first derivative of 33z7/7 + z6/2 - 59z3/3 + 133. What is the third derivative of k(t) wrt t? 3960t*3 + 180t*2 Let u(l) = -4l*3 - 12l*2 + 3l + 332. Let h(w) = -2w3 - 2w*2 + 1. Let p(v) = 6h(v) - u(v). What is the derivative of p(o) wrt o? -24o2 - 3 Suppose -23 = -6m - 5. Differentiate 3c3 - 61 + 5c*m + 18 with respect to c. 24c*2 Let x(z) be the third derivative of 0z + 5/24z4 + 0 + 35/6z*3 - 3z*2. What is the derivative of x(c) wrt c? 5 Let i(x) be the second derivative of -23x*7/21 - 11x*4/12 + 80x. What is the third derivative of i(b) wrt b? -2760b2 Let g be (-1309)/(-121) + 4/22. Find the second derivative of gr*3 - 26r + 23r3 - 4r*3 wrt r. 180r Differentiate 307 + 3176r + 436 - 2689r with respect to r. 487 Let r(q) be the first derivative of -35q6/6 - 3q*4/4 - 457q*3/3 + 209. Find the third derivative of r(z) wrt z. -2100z*2 - 18 Let u(k) be the second derivative of -2k7/3 - k6/30 + k*4/6 - 150k*2 - 35k - 5. What is the third derivative of u(j) wrt j? -1680j2 - 24j What is the second derivative of d*3 - 464d4 - d3 + 59d + 436d*4 wrt d? -336d*2 Let u(o) = 15o*4 + 3o*3 - 10o + 67. Let d(p) = 12p4 + 2p*3 - 10p + 68. Let x(i) = -3d(i) + 2u(i). Differentiate x(f) wrt f. -24f3 + 10 Let p = 1 + 4. Find the first derivative of -po + 2o - 2 - 2 - 2o wrt o. -5 Suppose h - 12 = -3h. What is the third derivative of 23 - 13j*2 + 3j*3 - 23 - 25j*h wrt j? -132 What is the third derivative of 152s*6 - 535s*2 + 1041s*2 + 38s*6 wrt s? 22800s*3 What is the third derivative of -78s*6 - 20s*2 + 82s*2 + 0s*4 + 0s*4 wrt s? -9360s3 Let q(w) be the second derivative of w4/12 - 5w3/3 + 72w*2 + 18w - 1. What is the first derivative of q(a) wrt a? 2a - 10 What is the derivative of 17 - 13l - 12 - 40l - 38 wrt l? -53 Let l be (-1020)/(-8) - 2/4. What is the first derivative of 60 - l + 4x*2 + 75 wrt x? 8x Let t(i) be the second derivative of 0i2 + 0 - 5i - 3/10i6 + 0i*5 + 0i*4 - 3/2i*3. Find the second derivative of t(b) wrt b. -108b2 Let u(f) be the second derivative of f5/4 + 19f3/6 - 211f*2/2 + 5f - 11. Find the first derivative of u(t) wrt t. 15t2 + 19 Let c(f) be the second derivative of 0f*3 + 0f*4 + 0f*5 - 10f*2 - 3/5f*6 - 18f + 0. Find the first derivative of c(q) wrt q. -72q3 Differentiate -3p - 25p + 189 - 15p - 334 with respect to p. -43 Let d(q) be the third derivative of -q*9/252 - 89q*8/336 + 29q5/60 + q4/6 + 238q2. What is the third derivative of d(k) wrt k? -240k*3 - 5340k*2 Let d(a) = -280a3 + a2 + 77a + 2. Let i(o) = -o2 + o + 1. Let u(x) = d(x) - 2i(x). Find the third derivative of u(k) wrt k. -1680 Let w(r) be the second derivative of 4r2 + 0 + 0r*4 + 7/15r*6 + 0r*3 - 14r + 0r5. Differentiate w(o) wrt o. 56o*3 Suppose t - 2 = u + 26, 0 = 5t + 2u - 154. Let p be 6/(-4) - t/(-4). What is the first derivative of -5g - 2 + 10g - pg wrt g? -1 What is the second derivative of 92z - 49z - 33z3 - 52z - 23z3 wrt z? -336z What is the derivative of 17 - 27009j4 + 18 + 27173j*4 wrt j? 656j*3 Let w(m) = 64m3 + m2 + 11m + 14. Let y(d) = 64d3 + d2 + 9d + 15. Let t(r) = 6w(r) - 5y(r). What is the second derivative of t(i) wrt i? 384i + 2 Let o(v) be the third derivative of v8/168 + v5/30 - 7v4/12 - v3/6 - 22v*2. What is the second derivative of o(n) wrt n? 40n*3 + 4 What is the second derivative of -29d*2 + 167 - 2d*2 - 176 + 2d - 97d2 wrt d? -256 Suppose b = 3o - 9, -4o + 6 = -2o + 3b. Find the second derivative of 35t*3 + 53t*3 + 21t - 61to wrt t. 162t Let n(u) be the third derivative of 27u4/4 + 43u*3/3 - 101u*2. Differentiate n(j) with respect to j. 162 Let o(i) = -62i*3 + 5i*2 - 7i - 11. Let u(q) = 31q3 - 3q*2 + 4q + 6. Let p(b) = -6o(b) - 11u(b). What is the third derivative of p(d) wrt d? 186 Let t(l) = -2l - 2. Let v be t(-3). Differentiate -10 - 3 + 19 + 14i*v wrt i. 56i3 Let u(k) be the second derivative of k4/6 - k*3/6 - 53k*2/2 + 45k - 2. Find the first derivative of u(x) wrt x. 4x - 1 Let t = 26 - 15. Differentiate t - 19i*3 - 31 + 10 wrt i. -57i*2 What is the third derivative of -26c*2 + 52c*2 + 3c*4 - 31c*2 - 114c*4 - 1 wrt c? -2664c What is the derivative of -697x + 423 - 71x*2 - 57x*2 - 182x*2 + 697x wrt x? -620x Let q(p) be the third derivative of p6/8 - 17p5/60 - p4/24 + 23p2 - 1. Find the third derivative of q(h) wrt h. 90 Let i be -2 - (-80)/6 - (-6)/9. What is the third derivative of -4u*5 - iu*2 + 5u*5 + 16u*5 wrt u? 1020u*2 Let a(i) = -743i*2 - 1007. Let b(z) = -1487z*2 - 2011. Let y(t) = 11a(t) - 6b(t). Differentiate y(h) wrt h. 1498h Let g(a) = -158a5 + 2a*4 + 260a + 8. Let w(y) = 105y5 - y4 - 173y - 5. Let p(v) = 5g(v) + 8w(v). What is the second derivative of p(r) wr	{ "pile_set_name": "DM Mathematics" }
rounded to the nearest ten? -240 Let b = -115.787 - 0.213. Let i = -116.0000234 - b. What is i rounded to six dps? -0.000023 Let l(z) = 42z + 613. Let g be l(-28). What is g rounded to the nearest 100? -600 Let u = 0.30700838 - 0.307. Round u to 6 dps. 0.000008 Let q = -97 - -102.8. Let u = -5.800000088 + q. Round u to 7 decimal places. -0.0000001 Let j = -0.11 + 0.1262. What is j rounded to 1 decimal place? 0 Let t = -813 - -819.82. What is t rounded to the nearest integer? 7 Let y = 4959.999996647 + -4960. What is y rounded to seven dps? -0.0000034 Let z = 53758230804960 - 53758233019634.51999976. Let m = z - -2214691.52. Let b = m - 17. What is b rounded to seven dps? 0.0000002 Let k = -1258 + 1258.0843. Round k to three decimal places. 0.084 Let l be (-24)/(-9)(-6)/(-4). Suppose 0 = lt - 0t + 135600. Round t to the nearest one thousand. -34000 Let n = 38 + -1.1. Let i = 36.574 - n. Let d = 0.3127 + i. What is d rounded to 3 decimal places? -0.013 Let h be (-4)/10 + (-88)/(-20). Let w be 6/(3 + 6/(-4)). Suppose ha + o + 2o = -15199985, 7600020 = -2a + wo. Round a to the nearest 1000000. -4000000 Let f = -24.199999365 - -24.2. What is f rounded to 7 dps? 0.0000006 Let y(z) = -641z2 - 6z - 5. Let c = 0 + -2. Let q = -7 - c. Let n be y(q). What is n rounded to the nearest 10000? -20000 Let l = -1201 + 426. Let v = l + 546. Let p = 228.899 + v. What is p rounded to two decimal places? -0.1 Let l = -216.9 + 216.8998533. What is l rounded to 4 decimal places? -0.0001 Let x = 384.8261 - 385. Round x to 2 decimal places. -0.17 Suppose 16a + 1080 = a. Let t be (-59759984)/a + 4/18. Round t to the nearest one hundred thousand. 800000 Let w = -455369758.133 + 455624774. Let l = w + -255068.8669785. Let y = -53 - l. What is y rounded to 6 dps? -0.000022 Let u(q) be the third derivative of -877q*4/24 + 8q3/3 - q2. Suppose -23 = -9s + 49. Let r be u(s). Round r to the nearest one thousand. -7000 Let v = -7375 - -7351.966. Let j = v - -0.034. Let n = -23.000008 - j. Round n to 5 decimal places. -0.00001 Let h(d) = d2 + 10d + 16. Let i(w) = -3w2 + 2w. Let y be i(2). Let o be h(y). Suppose -4k = -ok - 2560. What is k rounded to the nearest one hundred? 600 Let q = 0.18 + -1.18. Let b = q + 6.2. Round b to the nearest integer. 5 Let i(t) = 3t2 - t - 1. Let g(r) = -3r*2 + 1. Let m(f) = -3g(f) - 2i(f). Let d be m(9). Round d to the nearest 100. 300 Let p = -65893583 - -143693583. Round p to the nearest one million. 78000000 Let x be (2 + 64/(-12))/((-8)/12). Suppose 0d - 289984 = xn - 4d, -2n + 4d - 115984 = 0. Round n to the nearest 10000. -60000 Suppose 8c + 52896 = -2259104. What is c rounded to the nearest 10000? -290000 Suppose -2a + 7355 = -7a. Let f = a + 2828. Suppose 4l - f = 203. What is l rounded to the nearest 100? 400 Let z = 0 + -1. Let l be 2 - (-2 - -9)z. Let d be (-1 - -205)3/l. What is d rounded to the nearest 10? 70 Suppose -2v = p + 149290, 19p + 597215 = 15p + 3v. Round p to the nearest ten thousand. -150000 Suppose -l - 42 = -7l. Let x(k) = 22450k*3 - 8k*2 + 4k + 14. Let y be x(l). Round y to the nearest 1000000. 8000000 Let m be 70(10/(-55) + 81/22). Let u = m - -88. Round u to the nearest 10. 330 Let s = -0.158 + 150.158. Let y = -2425811 - -2425660.9879. Let t = y + s. What is t rounded to three dps? -0.012 Let f = -22.48 - -22. Let p = f - -0.98. Round p to 1 decimal place. 0.5 Let g = -60605.3 + 60605.27635106. Let o = -0.1263509 + g. Let q = o + 0.15. What is q rounded to 7 dps? 0.0000002 Let g = -0.0376 + -173.9624. Let o = 11830595695 + -11830595868.99999827. Let z = o - g. Round z to 7 dps. 0.0000017 Let d = -415 - -260. Let b = d - -155.00226. Round b to four dps. 0.0023 Let m(v) = 1 + 12v*2 - 4v + 5 - v*3 + 2. Let q = 259 + -253. Let b be m(q). Round b to the nearest 1000. 0 Let t = 783881034 - 783880908.0000053. Let o = 126 - t. What is o rounded to 6 decimal places? 0.000005 Suppose 0 = 8y - 7y - 15. Let m be (-6)/y - 201/(-15). What is m rounded to the nearest integer? 13 Let x = -17.9 + 22.86. Let m = x - 5. Round m to 2 dps. -0.04 Let c = 123.8 - 123.813865. What is c rounded to four decimal places? -0.0139 Let y be (9/5)/((-8)/(-120)). Let c be 6/(-27) - (-8241)/y. Round c to the nearest 10. 310 Let q = -1778.00000192 + 1778. Round q to six dps. -0.000002 Let i = 0.034 + 150.966. Let l = -151.0091 + i. Round l to 3 dps. -0.009 Let z = 3276.0001471 - 3276. Round z to 5 decimal places. 0.00015 Let w = -1.45 - -1.59. Let j = -0.4 - -0.3. Let x = w - j. Round x to one dp. 0.2 Let b = 1.485 - -0.215. What is b rounded to the nearest integer? 2 Let f = 2612870274.00000074 + -2612870410. Let i = f - -136. What is i rounded to 7 decimal places? 0.0000007 Let m = 0.31 + -5.56. Let f = m + -0.25. What is f rounded to the nearest integer? -6 Let i = -30552439 + 21492439. What is i rounded to the nearest one million? -9000000 Let p = 4350 + -4350.00004738. What is p rounded to 5 decimal places? -0.00005 Let c(g) = -4g - 30. Let m be c(-12). Let f(s) = -73s + 14. Let n be f(m). What is n rounded to the nearest one hundred? -1300 Let q = -32 + 32.2. Let p = q - 0.199925. What is p rounded to 5 dps? 0.00008 Let r be (-2)/2 - (-9 - -4). Let m be r + -2 - (1491264 - -1). Let i = m - -9291263. What is i rounded to the nearest one million? 8000000 Let v = 155 + -154.999815. Round v to five dps. 0.00019 Let f(k) = -189k + 26. Let u(l) = -2l - 24. Let m be u(-14). Let z be f(m). Round z to the nearest 100. -700 Let d be (-5039)/2-3 + (-57)/(-38). Suppose 4i + 8i - d = 0. Round i to the nearest 1000. 1000 Let s = 161 + 101. Let d = 261.8076260981 + 0.1923506019. Let o = d - s. What is o rounded to 6 dps? -0.000023 Let u = -1559.653 - -1579.5. Let n = u - 20. Round n to 2 dps. -0.15 Suppose 0 = -7y + 2y - 10. Let n be 16399996/(-4) - ((-3)/(-1) + y). What is n rounded to the nearest 1000000? -4000000 Let z = -14 + 16. Suppose 2s + zs - 102733716 = 0. Suppose -2p + 3083429 = s. Round p to the nearest one million. -11000000 Let m = 185.663 + -195.6657. Let v = 10 + m. What is v rounded to three decimal places? -0.003 Let p = -57 + 57.2. Let l = -0.2000007 + p. Round l to 7 decimal places. -0.0000007 Let j be 93166/(-26) + 48/156. What is j rounded to the nearest 100? -3600 Let v(o) = 26o - 106. Let h be v(-23). What is h rounded to the nearest 10? -700 Suppose 5k = -3a + 29, -5a + 7 = -4a + k. Suppose 4p = -4z - 3488, -4z + ap + 878 = -5z. Let g = z - -319. Round g to the nearest one hundred. -600 Let i(b) be the third derivative of 83b5/15 + b4/12 - b*3/3 - 24b*2. Let p be i(-3). What is p rounded to the nearest one hundred? 3000 Let t = 100.1892 + 14.2638. Let j = -113.9 + t. Round j to one dp. 0.6 Let c(k) = 8441480k + 360. Let t be c(-7). What is t rounded to the nearest one million? -59000000 Let a(m) = -m*3 - 6m*2 - 10m - 10. Let c be a(-4). Let u be (-11 - -3)(-1)/c + -13299996. Round u to the nearest one million. -13000000 Let q = 4.74 - -0.26. Let f = -3.7 + q. Let w = f - 1.30000004. What is w rounded to 7 decimal places? 0 Let w = -819 + 724.3. Let j = w - -92. What is j rounded to the nearest integer? -3 Suppose 37u - 31*u = 83400000. What is u rounded to the nearest one million? 14000000 Let n = 322 + -322.0000467. Round n to 5 decimal places. -0.00005 Let k = 2.1 - -4.3. Let j = k + -6.40000124. What is j rounded to 7 decimal places? -0.0000012 Let l = -0.0285 - -0.0285112. What is l rounded to 5 decimal places? 0.00001 Let z = 126.99998 + -127. Round z to five decimal places. -0.00002 Let p = -0.14 - 0.036. Let g = -0.07 - p. What is g rounded to one dp? 0.1 Let f be (-1)/7 - 675210/21. Let p = 52353 + f. Round p to the nearest one thousand. 20000 Let d = -1268 - -1268.00003199. What is d rounded to 6 dps? 0.000032 Let j = 2166973104.999509 - 2166972131. Let f = j + -974. Round f to 4 decimal places. -0.0005 Let b = 0.635 - -12.325. Let s = b + -7.18. Let v = -0.28 + s. Round v to 0 decimal places. 6 Let b = 27.416 - 0.016. Let o = b + 3.4. What is o rounded to the nearest integer? 31 Let p = -19221 + 7119. Round p to the nearest one hundred. -12100 Let y = 16030 - 16004.034. Let a = y + -26. Let f = a + 0.0339977. What is f	{ "pile_set_name": "DM Mathematics" }
(w + 123) Factor -4u2 + 187040u - 2186497600. -4(u - 23380)2 Factor -2w*2 - 3986656w - 1986678257792. -2(w + 996664)2 Suppose 10m*4/9 + 7592m*3/9 - 4564m*2/3 + 4568m/9 + 1522/9 = 0. Calculate m. -761, -1/5, 1 Solve 5b4 + 345b*3 + 7920b*2 + 60500b = 0 for b. -25, -22, 0 Solve -200u5/3 - 2426u*4/3 - 9706u*3/3 - 13150u*2/3 - 426u + 120 = 0 for u. -5, -4, -3, -1/4, 3/25 Suppose 2u2 - 278u - 852 = 0. Calculate u. -3, 142 Solve -2d3/11 - 38028d*2/11 - 16429824d + 361608256/11 = 0 for d. -9508, 2 Factor -q*2/11 - 242q - 161051. -(q + 1331)*2/11 Factor -5d*4 - 67650d*3 - 305101500d*2 - 458669255000d. -5d(d + 4510)3 Suppose -q2/6 - 463q - 2777/6 = 0. What is q? -2777, -1 Let -4i*2/5 + 131992i - 5444340020 = 0. Calculate i. 82495 Factor -5c4 - 420c*3 + 1745c*2 - 1320c. -5c(c - 3)(c - 1)(c + 88) Determine z, given that -1615z2 - 6410z + 200 = 0. -4, 10/323 Determine t so that -4t5 + 16600t*4/3 - 16903060t*3/9 - 221757440t*2/9 - 142196560t/9 - 7795264/3 = 0. -12, -1/3, 698 Find s, given that s*5/4 - 966s*4 - 3s*3/4 + 5795s*2/2 + 1932s = 0. -1, 0, 2, 3864 Let -c*2/7 + 5791c/7 + 11586/7 = 0. What is c? -2, 5793 Factor 5p2 - 64780p - 64785. 5(p - 12957)(p + 1) Let 33y5 + 394y*4/3 - 8y*3/3 - 528y*2 - 1552y/3 + 32/3 = 0. What is y? -2, 2/99, 2 Solve -c*2 + 97298c - 2366725201 = 0. 48649 Determine k so that 2k3/17 + 7866k*2/17 + 15724k/17 = 0. -3931, -2, 0 Find r, given that -2r3/3 + 116r*2 - 3010r/3 + 2200 = 0. 4, 5, 165 Factor 5d3 - 545d*2 - 3100d + 28500. 5(d - 114)(d - 5)(d + 10) What is t in t5/3 - 37t*4/3 + 149t*3 - 2047t*2/3 + 2896t/3 - 420 = 0? 1, 7, 10, 18 Factor 4z5 - 596z*4 - 1208z*3 - 8z*2 + 1204z + 604. 4(z - 151)(z - 1)(z + 1)3 Find c, given that -3c*5 + 3096c*4 - 905343c*3 + 52783866c*2 + 109213920c = 0. -2, 0, 80, 477 What is s in s*5/2 - 173s*4/10 - 497s*3/2 - 6431s*2/10 + 2932s/5 + 322 = 0? -7, -5, -2/5, 1, 46 Determine a, given that 4a3/7 - 5384a*2/7 = 0. 0, 1346 Let -175x*5 + 81360x*4 + 170260x*3 + 91070x*2 - 2325x - 4670 = 0. Calculate x. -1, -2/7, 1/5, 467 Determine m so that -m*3/3 - 44m*2/3 + 575m = 0. -69, 0, 25 Factor -b*3/3 + 980b*2/3 - 13537b/3 + 4186. -(b - 966)(b - 13)(b - 1)/3 Factor -3c3 - 3330c*2 + 16707c - 20070. -3(c - 3)(c - 2)(c + 1115) Solve s3/4 - 443s*2/2 - 1342s + 3568 = 0 for s. -8, 2, 892 Factor 5y3 + 47790y*2. 5y*2(y + 9558) Find o, given that 2o2/19 + 1472o/19 - 16434/19 = 0. -747, 11 Find k, given that 2k5/7 + 118k*4/7 + 1556k*3/7 + 1440k*2/7 = 0. -40, -18, -1, 0 Determine h, given that 36h*4 - 1365h*3 - 555h*2 + 16170h + 22344 = 0. -7/3, -7/4, 4, 38 Determine j so that -8j4 - 145j*3/2 - 137j*2/2 + 476j + 30 = 0. -6, -5, -1/16, 2 Factor -2g2 - 4288g + 21490. -2(g - 5)(g + 2149) Suppose 2a3/9 - 388a*2/9 + 254a/3 + 128 = 0. What is a? -1, 3, 192 Let f*4/7 + 15f*3/7 - 50f*2/7 - 240f/7 + 544/7 = 0. What is f? -17, -4, 2, 4 Suppose -2s4 - 8080s*3 + 24252s*2 - 24256s + 8086 = 0. Calculate s. -4043, 1 Let -u*2/4 + 747u/2 - 87413/4 = 0. Calculate u. 61, 1433 Find x such that x*4/5 + 44x*3/5 + 161x*2/5 + 34x/5 - 48 = 0. -40, -3, -2, 1 Let 13t5 + 583t*4 + 989t*3 - 1843t*2 + 258t = 0. What is t? -43, -3, 0, 2/13, 1 Let n*2/6 - 1949n/2 - 5849/3 = 0. Calculate n. -2, 5849 Find k, given that 2k2 + 26752k + 89458688 = 0. -6688 Suppose -20p2 - 6055748p + 3633456 = 0. What is p? -302788, 3/5 Find c, given that -c*4/4 + 31c*3/2 + 63c*2/4 - 9261c - 9261 = 0. -21, -1, 42 Solve d*3 - 55d*2 - 3477d + 191691 = 0. -59, 57 Determine z, given that z*3 + 1043z*2 + 40520z + 401200 = 0. -1003, -20 Solve 1017l3/8 + 223995l*2 + 789366309l/8 + 2328483/4 = 0. -881, -2/339 What is b in -3b2 - 61047b - 61044 = 0? -20348, -1 Factor 2z3 - 10750z*2 + 42976z - 42968. 2(z - 5371)(z - 2)2 Let -i2/2 - 391i + 7200 = 0. What is i? -800, 18 What is h in 2h*5/3 - 52h*4 + 3932h*3/3 - 10768h*2 + 21266h/3 + 19220 = 0? -1, 2, 15, 31 Suppose -v*5 - 40v*4 - 212v*3 + 1360v*2 - 1536v = 0. Calculate v. -32, -12, 0, 2 Find t, given that -5t5/3 + 100t*4 - 3280t*3/3 + 10450t*2/3 + 2375t - 58750/3 = 0. -2, 5, 47 Factor i*2 + 144i + 695. (i + 5)(i + 139) Let -2u*3/3 + 392u*2/3 - 23944u/3 + 430336/3 = 0. What is u? 32, 82 Let -2m2 + 32560m + 162850 = 0. Calculate m. -5, 16285 Determine q, given that 2q5/3 - 660q*4 + 275392q*3/3 - 10383044q*2/3 - 91798q + 10385024/3 = 0. -1, 1, 79, 832 Let 4h4 + 4832h*3 + 1454408h*2 - 2942720h - 4392300 = 0. What is h? -605, -1, 3 Factor -5w3 + 311915w*2 - 4864392400w - 4864704320. -5(w - 31192)2(w + 1) Determine q, given that -4q2 - 592408q - 21934202404 = 0. -74051 Determine a, given that -5a3 + 4554a*2 - 66360a + 50176 = 0. 4/5, 14, 896 Suppose 33z5 - 2721z*4/5 + 3561z*3/5 + 429z*2 - 630z = 0. Calculate z. -10/11, 0, 1, 7/5, 15 Factor 2w2 + 422w - 304980. 2(w - 299)(w + 510) Factor -3h4 + 1248h*3 - 133455h*2 + 756450h. -3h(h - 205)*2(h - 6) Let 2i5 + 112i*4 + 742i*3 - 1312i*2 - 3000i + 3456 = 0. Calculate i. -48, -9, -2, 1, 2 Let 3j2/7 + 4980j/7 = 0. Calculate j. -1660, 0 Determine t so that -22t4/9 + 322t*3 - 13816t*2/3 + 151808t/9 + 14848/3 = 0. -3/11, 8, 116 Factor 2f5/3 + 39026f*4/3 + 190554134f*3/3 + 570960114f*2 + 1712178144f + 1711827072. 2(f + 3)3(f + 9752)*2/3 Find c such that 24c*5/13 + 34000c*4/13 + 12052990c*3/13 + 8017390c*2/13 - 1005360c/13 - 1002528/13 = 0. -708, -1/2, 1/3 Factor 2u3 - 3151u*2 - 26937u + 14256. (u - 1584)(u + 9)(2u - 1) Find j, given that 4j*3 - 204j*2 - 1096j - 1344 = 0. -3, -2, 56 Determine x so that -4x3 - 2888x*2 + 4x + 2888 = 0. -722, -1, 1 Factor -2v3/13 + 224v*2 - 1157850v/13 + 139802436/13. -2(v - 898)(v - 279)*2/13 What is o in 4o*4 + 584o*3 + 6916o2 = 0? -133, -13, 0 Solve -r5 + 2652r4 + 2656r*3 - 7954r*2 - 13263r - 5306 = 0 for r. -1, 2, 2653 Factor -2a3/7 - 186450a*2/7 + 372906a/7 - 186454/7. -2(a - 1)2(a + 93227)/7 Factor -2m3 - 1894m*2 + 122740m - 237888. -2(m - 59)(m - 2)(m + 1008) What is l in l2/4 + 27l/4 + 45 = 0? -15, -12 Find v, given that -v*3/2 - 87v*2 - 7235v/2 - 3531 = 0. -107, -66, -1 Factor 2q2/13 - 509774q/13. 2q(q - 254887)/13 Let -548c2 - 54268c - 1584 = 0. Calculate c. -99, -4/137 Factor 17405f3 - 384680f*2 + 38985f - 990. 5(f - 22)(59f - 3)2 Factor 2n*3 - 4500n*2 + 2535744n - 5053504. 2(n - 1124)2(n - 2) Factor 2c3/11 - 16108c*2/11 + 32210c/11 - 1464. 2(c - 8052)(c - 1)*2/11 Factor -5v*2/4 + 24245v/4. -5v(v - 4849)/4 Factor 2c3/3 + 21700c*2/3 + 19627648c + 39226368. 2(c + 2)(c + 5424)*2/3 Let -8i*5/3 - 10538i*4/3 + 9674i*3 - 23758i*2/3 + 2642i/3 + 880 = 0. What is i? -1320, -1/4, 1 Factor 3h3/7 - 2763h*2/7 - 3180h - 33444/7. 3(h - 929)(h + 2)(h + 6)/7 Find t such that -t2/4 - 12067t/4 + 3017 = 0. -12068, 1 Solve -t*4/2 + 537t*3 - 6390t*2 + 19116t = 0. 0, 6, 1062 Factor n*2 + 61107n - 61108. (n - 1)(n + 61108) Factor -3u*2 - 1229121u + 1229124. -3(u - 1)(u + 409708) Solve -5b5 - 310b*4 + 1375b*3 + 3660b*2 + 1980b = 0. -66, -1, 0, 6 Determine s, given that -2s2 - 144s + 608 = 0. -76, 4 Factor j*3/2 - 87j*2 - 4387j/2 + 7350. (j - 196)(j - 3)(j + 25)/2 Determine j, given that -4j5/3 - 3484j*4/3 - 767276j*3/3 - 3749780j*2/3 = 0. -433, -5, 0 Determine r, given that -2r*2/7 + 678r/7 - 12160/7 = 0. 19, 320 Suppose 4o2 - 4754524o + 4754520 = 0. What is o? 1, 1188630 Solve -s*5/2 - 85s*4/4 - 37s*3/4 + 52s*2 - 21s = 0 for s. -42, -2, 0, 1/2, 1 Solve -3s5/2 - 93s*4/2 - 555s*3/2 + 1605s*2/2 + 279s - 756 = 0. -21, -12, -1, 1, 2 Factor 4a3 - 348228a*2 - 348232a. 4a(a - 87058)(a + 1) Let -4d*2 - 72104d + 1299168 = 0. What is d? -18044, 18 Factor 2k4/9 + 8k*3/9 - 952k*2/9 - 3136k/3. 2k(k - 24)(k + 14)2/9 Suppose -1015q*3/6 + 923q*2 - 76q/3 = 0. Calculate q. 0,	{ "pile_set_name": "DM Mathematics" }
on divisor of 7980 and 1463. 133 Calculate the highest common factor of 91872 and 12. 12 What is the greatest common factor of 16 and 8? 8 Calculate the highest common factor of 671 and 61. 61 Calculate the highest common divisor of 70 and 1855. 35 What is the highest common divisor of 5253 and 187? 17 Calculate the greatest common divisor of 234 and 3198. 78 Calculate the greatest common divisor of 403 and 2573. 31 Calculate the greatest common divisor of 255 and 204. 51 What is the highest common divisor of 689 and 169? 13 What is the greatest common divisor of 880 and 22? 22 What is the greatest common factor of 172087 and 37? 37 What is the highest common factor of 60 and 105? 15 Calculate the highest common divisor of 142 and 4402. 142 Calculate the highest common divisor of 1288 and 56. 56 Calculate the highest common divisor of 11 and 143. 11 Calculate the highest common factor of 51 and 1819. 17 What is the highest common factor of 36 and 18? 18 What is the highest common factor of 171 and 703? 19 What is the highest common divisor of 6 and 174? 6 What is the greatest common factor of 201 and 36? 3 What is the greatest common divisor of 1536 and 2784? 96 Calculate the highest common factor of 55 and 43780. 55 What is the highest common divisor of 1161 and 243? 27 Calculate the highest common factor of 18 and 126. 18 What is the greatest common divisor of 145 and 1247? 29 What is the greatest common divisor of 605 and 165? 55 Calculate the greatest common divisor of 135 and 90. 45 Calculate the highest common factor of 46 and 874. 46 Calculate the highest common factor of 42 and 266. 14 What is the highest common factor of 4 and 272? 4 Calculate the highest common divisor of 45 and 735. 15 What is the highest common factor of 8 and 308? 4 Calculate the greatest common divisor of 76 and 4. 4 Calculate the highest common divisor of 192 and 3720. 24 What is the highest common divisor of 12 and 300? 12 Calculate the greatest common divisor of 320 and 1216. 64 What is the highest common divisor of 32 and 88? 8 What is the highest common factor of 78 and 104? 26 Calculate the greatest common divisor of 2784 and 174. 174 Calculate the highest common factor of 300 and 30. 30 Calculate the greatest common factor of 12 and 942. 6 What is the highest common factor of 240 and 1488? 48 What is the greatest common divisor of 22 and 143? 11 What is the highest common divisor of 377 and 26? 13 What is the highest common divisor of 414 and 72? 18 Calculate the highest common divisor of 1696 and 2862. 106 What is the greatest common factor of 570 and 390? 30 Calculate the highest common divisor of 144 and 1422. 18 Calculate the greatest common factor of 504 and 56. 56 Calculate the highest common factor of 1572 and 12. 12 Calculate the greatest common divisor of 56 and 476. 28 What is the highest common divisor of 27 and 945? 27 Calculate the greatest common factor of 2725 and 125. 25 Calculate the greatest common factor of 888 and 24. 24 What is the highest common divisor of 1328 and 32? 16 Calculate the highest common factor of 72 and 41292. 36 Calculate the highest common divisor of 96 and 33. 3 Calculate the greatest common divisor of 154 and 182. 14 What is the greatest common factor of 177 and 118? 59 Calculate the greatest common divisor of 17068 and 68. 68 Calculate the highest common divisor of 108 and 1782. 54 What is the greatest common factor of 92 and 46? 46 Calculate the highest common factor of 16 and 6248. 8 What is the highest common divisor of 52 and 8? 4 What is the highest common divisor of 665 and 4480? 35 What is the highest common divisor of 32 and 1824? 32 Calculate the greatest common factor of 40 and 410. 10 Calculate the highest common factor of 465 and 5. 5 Calculate the greatest common divisor of 306 and 558. 18 Calculate the greatest common factor of 39 and 26. 13 What is the highest common divisor of 255 and 30? 15 Calculate the greatest common divisor of 754 and 78. 26 Calculate the highest common divisor of 36 and 189. 9 What is the greatest common divisor of 105 and 1365? 105 What is the greatest common divisor of 5934 and 430? 86 Calculate the highest common factor of 3755 and 5. 5 What is the greatest common factor of 56 and 28? 28 What is the greatest common divisor of 10 and 2? 2 Calculate the highest common factor of 8 and 152. 8 Calculate the highest common divisor of 234 and 18. 18 Calculate the greatest common divisor of 1008 and 784. 112 Calculate the highest common factor of 26 and 793. 13 Calculate the highest common divisor of 247 and 169. 13 What is the highest common factor of 42 and 15? 3 Calculate the greatest common divisor of 568 and 3834. 142 What is the greatest common divisor of 111 and 8103? 111 What is the greatest common factor of 553 and 1501? 79 What is the greatest common divisor of 60 and 200? 20 What is the highest common factor of 783 and 2784? 87 Calculate the highest common divisor of 4439 and 193. 193 Calculate the highest common divisor of 216 and 3996. 108 Calculate the highest common factor of 2709 and 42. 21 Calculate the greatest common factor of 72 and 2088. 72 What is the greatest common divisor of 345 and 598? 23 Calculate the greatest common divisor of 20 and 35. 5 What is the greatest common factor of 38 and 1102? 38 What is the highest common factor of 121 and 22? 11 What is the greatest common factor of 34 and 34? 34 What is the highest common divisor of 1036 and 28? 28 Calculate the greatest common factor of 2140 and 20. 20 Calculate the highest common divisor of 915 and 75. 15 Calculate the highest common factor of 333 and 12099. 111 What is the highest common divisor of 892 and 20? 4 What is the highest common factor of 24 and 15? 3 What is the highest common divisor of 60 and 264? 12 Calculate the highest common divisor of 904 and 33674. 226 Calculate the highest common divisor of 6077 and 206. 103 What is the highest common factor of 50 and 80? 10 What is the highest common divisor of 516 and 24? 12 What is the highest common divisor of 52 and 1300? 52 What is the greatest common factor of 22 and 1980? 22 What is the highest common divisor of 57 and 12? 3 Calculate the highest common factor of 54 and 30. 6 What is the highest common divisor of 18 and 1746? 18 Calculate the highest common divisor of 561 and 102. 51 What is the greatest common divisor of 28 and 24262? 14 Calculate the greatest common factor of 682 and 2. 2 What is the greatest common factor of 1242 and 27? 27 What is the highest common divisor of 219 and 2? 1 What is the greatest common divisor of 3792 and 144? 48 What is the highest common divisor of 602 and 559? 43 What is the greatest common divisor of 48 and 21192? 24 What is the greatest common divisor of 126 and 6336? 18 Calculate the greatest common divisor of 364 and 56. 28 What is the highest common divisor of 339 and 3503? 113 What is the greatest common divisor of 279 and 288? 9 Calculate the greatest common divisor of 322 and 21. 7 Calculate the greatest common divisor of 385 and 462. 77 Calculate the greatest common divisor of 17 and 1. 1 What is the highest common factor of 34 and 5134? 34 Calculate the greatest common factor of 8718 and 2. 2 What is the highest common divisor of 6797 and 7? 7 Calculate the highest common factor of 32 and 8. 8 What is the greatest common divisor of 52 and 52? 52 Calculate the greatest common factor of 18 and 1098. 18 What is the greatest common factor of 923 and 247? 13 Calculate the greatest common factor of 165 and 275. 55 What is the highest common divisor of 80 and 360? 40 What is the greatest common divisor of 154 and 112? 14 Calculate the highest common divisor of 2075 and 50. 25 What is the highest common factor of 125 and 8500? 125 What is the highest common divisor of 222 and 12? 6 Calculate the greatest common factor of 154 and 44. 22 What is the highest common divisor of 27 and 2727? 27 What is the greatest common factor of 22 and 5610? 22 Calculate the greatest common divisor of 28 and 518. 14 Calculate the highest common factor of 450 and 702. 18 What is the greatest common divisor of 425 and 500? 25 Calculate the highest common divisor of 356 and 10. 2 What is the greatest common factor of 6	{ "pile_set_name": "DM Mathematics" }
2. Let u(f) = 10f - 15. Let x(o) = -3o + 5. Let y(i) = 2u(i) + 7x(i). Let w(q) = -5h(q) - 2y(q). Let j(p) = 3p2. Give w(j(s)). -9s*2 Let r(v) = -150v*2. Let o(d) = -14d*2 - 6d - 12. Let n(x) = 30x2 + 13x + 26. Let j(p) = 6n(p) + 13o(p). Determine j(r(a)). -45000a4 Let d(n) = -5n*2. Let a(y) be the first derivative of -3y*5/20 + 6y*2 + 11. Let h(c) be the second derivative of a(c). What is h(d(f))? -225f4 Let a(c) be the second derivative of -c6/90 + 11c3/6 - 6c. Let k(t) be the second derivative of a(t). Let p(b) = -1 - b + 1. Determine p(k(x)). 4x2 Let v(j) = 237j - 34. Let z(k) = -11k2. What is v(z(p))? -2607p*2 - 34 Let j(q) = -22576q*2. Let p(k) = -10k. Determine j(p(r)). -2257600r2 Let z(l) = -l. Let v(m) = -2m*2 + 21m - 210. Calculate z(v(b)). 2b2 - 21b + 210 Let n(q) = 70q. Let s(t) = 47 + 3t - 98 + 51. Determine s(n(i)). 210i Suppose -5s - 7 + 17 = 5n, -5n + 16 = 3s. Let g(p) = -n - 4p + 12 - 7. Let r(w) = 5w. Give r(g(v)). -20v Let h be (2/(-4))/((-6)/60). Suppose j - 3 + h = 0. Let b(t) = 3t2 - 2. Let c(i) = -16i*2 + 11. Let m(q) = jc(q) - 11b(q). Let f(z) = 2z. Give f(m(d)). -2d2 Let w(c) = -1730c. Let a(f) = -10f. What is a(w(n))? 17300n Let k(w) = w*2. Let p(u) be the second derivative of 14u - 13/6u3 + 0u*2 + 0. Give k(p(l)). 169l*2 Let r(l) = -2l*2. Let c be 2 + 0 + 0 + 145/(-75). Let u(q) be the third derivative of 0q*3 + 0q + 0q4 + 0 - 9q*2 + cq*5. Give r(u(m)). -32m*4 Let d(m) = -13m + 7. Let b be -9 + 9 - (-11)/(-1). Let v = 15 + b. Let t(q) = 4q - 2. Let n(o) = vd(o) + 14t(o). Let l(u) = -3u. Determine l(n(h)). -12h Let h(y) = y2. Let s(i) = -3136i*2 + 1585i*2 + 1007i*2 + 1147i*2. Determine s(h(c)). 603c*4 Let y(n) = -23n*2 - 11n - 11n + 29n - 7n. Let l(f) = -7f. Determine l(y(u)). 161u2 Let c(n) = -2n - 1106. Let l(y) = 727y. What is l(c(g))? -1454g - 804062 Let i(o) = 4o. Let k(q) be the first derivative of -7q*5/30 + 3q*2/2 + 2. Let r(w) be the second derivative of k(w). Give i(r(a)). -56a*2 Let p(l) = -11l2. Let o(t) be the second derivative of -t4/24 + t*2/2 - 2t. Let b(u) be the first derivative of o(u). What is b(p(f))? 11f2 Let f(n) = -15n. Let r(t) = 4578t. Determine r(f(s)). -68670s Let d(n) be the second derivative of 9n + 0 + 0n*2 + 1/2n3. Let f(l) = -l2. What is f(d(b))? -9b2 Let k(g) = -16g + 12g + 0g + 9g. Let a(q) = q + 3q - 6q. What is k(a(m))? -10m Let o(f) = 54f2 + 11f - 11. Let t(w) = 30w2 - 2w + 4w - 58w*2 - 2 + 39w*2. Let g(b) = 2o(b) - 11t(b). Let k(y) = 2y. Give g(k(r)). -52r2 Let v(r) be the third derivative of 0r + 52r2 + 0r*3 + 0 - 1/60r*5 + 0r*4. Let o(k) = 7k*2 - 3. What is v(o(u))? -49u*4 + 42u*2 - 9 Let t(f) = -6f - 5. Let b(v) be the first derivative of -7v3/3 + 251. Give b(t(c)). -252c*2 - 420c - 175 Let k(p) = 8p. Let h(u) = 38u + u*2 + 6 - 46u + 8. Let y be h(6). Let q(d) = -2d2 + 3d*y + 2d*2 - 4d*2. Give k(q(j)). -8j*2 Let k(b) = -6b. Let x(y) be the third derivative of y7/2520 - y4/6 + 15y2. Let g(w) be the second derivative of x(w). What is k(g(q))? -6q*2 Let z(s) = -27s + 10s + 8s + 12s. Suppose -p + 18 = 2p. Let v(l) = 6 - p - 4l2. What is z(v(x))? -12x*2 Let b(w) = 2 + 0 - 106w*2 + 401w*2 + 94w*2. Let v(i) = -i. Give b(v(a)). 389a2 + 2 Let p(h) be the third derivative of h4/12 + 57h2. Let l(b) = 136b. Give l(p(a)). 272a Let x(u) = -16562u*2. Let w(b) = -10b*2. What is w(x(p))? -2742998440p*4 Let y(d) = -2d*2. Suppose 2b + 12 = 6b. Suppose -bw = -7 + 1. Let k(i) = 4i2 - i2 - wi*2. Give k(y(j)). 4j4 Let b(p) = p2. Let h(q) = 1572q. What is b(h(z))? 2471184z*2 Let y(j) be the second derivative of 49j*4/4 + 32j - 4. Let n(c) = -c*2. What is n(y(q))? -21609q*4 Let y(s) = -75s*2. Let z(l) = 1761l. Calculate z(y(r)). -132075r2 Let a(d) = 2d + 3d + 0d - d. Let m(s) = 2s. Let c(p) = -6a(p) + 11m(p). Let t(k) be the second derivative of k4/12 - 5k. Calculate t(c(u)). 4u2 Let q(i) = -789i + 8. Let p(f) = 37f. Calculate q(p(v)). -29193v + 8 Let u(t) = 8t2 - 14t + 62. Let r(p) = -5p2 + 10p - 41. Let x(i) = -7r(i) - 5u(i). Let v(j) = -2j. What is v(x(o))? 10o*2 + 46 Let u(m) = 6m. Let c(x) = x*3 + 9x*2 + 8x + 2. Let v be c(-8). Let a(l) = -2lv - 104l + 104l. Determine a(u(p)). -72p*2 Let g(h) = 91h*2 - 28. Let m(j) = 10j*2 - 3. Let k = -57 + 85. Let w(y) = km(y) - 3g(y). Let i(a) be the first derivative of -a2 + 8. Determine w(i(l)). 28l*2 Let z(a) = 34a. Let d(v) = -2v2. Let x(y) = -y2. Let w(j) = 2d(j) - 20x(j). Calculate w(z(p)). 18496p*2 Suppose 3 + 125 = 8w. Suppose 6 + 12 = 4q - 2g, -2q = 4g + w. Let k(v) = 3v + qv - 2v. Let r(c) = 2c. Give k(r(j)). 6j Let w(j) = 24j. Let l be 14/4 + (-6)/4. Let q(d) = 3d2 + d2 - 6d*2 + 3d*l. What is w(q(g))? 24g*2 Let k(a) = a. Let g(v) = -11v. Let t(m) = 4g(m) + 36k(m). Let u(o) be the second derivative of -2o + 1/6o*3 + 0o*2 + 0. What is u(t(i))? -8i Let w(v) = -2v2. Let f(c) = 13c + 2. Let u(i) be the first derivative of 11i2/2 + i + 18. Let q(r) = -2f(r) + 3u(r). What is q(w(g))? -14g*2 - 1 Let c(v) = 15v. Let t(n) be the third derivative of -n*5/10 - 3n*2 + 12n. Give t(c(u)). -1350u2 Let z(l) be the third derivative of -l4/24 - l3/3 + 2l*2. Let u be z(-4). Let r(c) = -10c + u - 3 + 1. Let p(s) = s. What is r(p(b))? -10b Let p(i) = 3i. Let j(x) = 2 - 6 + 4 + 23x. Give p(j(u)). 69u Let j(g) be the third derivative of -51g4/2 - 574g*2. Let v(r) = -2r*2. Give j(v(b)). 1224b*2 Let n be (-18 - (-324)/18)(-1)/4. Let h(f) be the second derivative of -9f + nf*2 - 2/3f*3 + 0. Let x(j) = 2j*2. What is h(x(y))? -8y*2 Let k(w) be the second derivative of 7w*3/2 + 2w. Suppose 3m = -2m + 325. Let c(z) = -mz + 31z + 32z. Determine k(c(g)). -42g Let l(c) be the second derivative of 12c - 1/2c*4 + 0c*3 + 0c*2 + 0. Let n(h) = 5h - 3h - h. Determine l(n(d)). -6d*2 Let y(n) = 3n*2 - 4n*2 + 4n - 4n. Let h(j) = 39j. Give y(h(z)). -1521z2 Let o(s) = -6s*2. Let r(a) be the second derivative of -13a*4/12 - 6a - 8. Give r(o(d)). -468d4 Let f(s) = s3 + 16s*2 - 12s + 23. Let j be f(-16). Let c(p) = j - 19p - 215. Let l(t) = -2t. Give l(c(n)). 38n Let n(z) be the second derivative of -z3/3 + z. Let r(a) = 10a*2 - 6a. Let i(p) = 17p2 - 10p. Let b(k) = -3i(k) + 5r(k). Give n(b(g)). 2g2 Let f(q) = -113q*2 + q. Let h(p) = -9p*2 + 5p - 5. Let k(t) = -16t2 + 9t - 9. Let u(g) = 9h(g) - 5k(g). What is f(u(s))? -113s4 - s2 Let j = 8 + -5. Let w(t) = -1 - j + 4 - 2t*2. Let v(f) = -13f*2 + 112 - 112. Determine w(v(i)). -338i*4 Let b(f) be the third derivative of -17f*5/60 - 2f*3 + 26f2. Let h(m) be the first derivative of b(m). Let v(j) = j2. Determine v(h(l)). 1156l2 Let i(s) = -3s*2 - 4s - 4. Let y(a) = 6a2 + 9a + 9. Let c(r) = -9i(r) - 4y(r). Let l(b) = -26b. Calculate c(l(j)). 2028j*2 Let r = 148/39 - 32/13. Let y(c) be the first derivative of 0c + 2 + rc3 + 0c2. Let h(m) = -m2. What is h(y(b))? -16b4 Let m(t) = -2t. Let v(p) = -30978p - 12. Calculate m(v(x)). 61956x + 24 Let o(x) = 4x. Let q(n) = 7727n - 1. Calculate o(q(k)). 30908k - 4 Let q(s) = 2s*2. Let t(j) = -19j + 127j + 79j + 247j. Calculate q(t(g)). 376712g*2 Let p(r) = -454r*2 + 1. Let m(d) = -98d*2. Give p(m(z)). -4360216z4 + 1 Let q(l) be the first derivative of -l4/6 - 7l2 - 30. Let z(m) be the second derivative of q(m). Let g(b) = 11b. Calculate g(z(v)). -44v Let b(z) = 2z. Let n(a) = -9a + 257. What is n(b(p))? -18p + 257 Let y(b) = 3b2. Let n(l) = -572l + 5. Let r(v) = 122123v - 1067. Let t(q) = 1067n(q) + 5r(q). What is t(y(x))? 873x*2 Let v(p) = 18p. Let t(r) = 6r - 30. Let q(m) = -m + 6. Let f(x) = -5q(x) - t(x). Give f(v(b)). -18b Let s(n) = n - 123. Let c(h) = -1978h*2. Determine s(c(d)). -1978d*2 - 123 Let h(s) = 3s. Let m(c) be the second derivative of 4c3/3 - 84c. What is h(m(b))? 24*b Let q = -44 +	{ "pile_set_name": "DM Mathematics" }
108)/(-864)) -12 Calculate 2/(20/(-15))(-4)/(-6) - 2. -3 Evaluate ((-104)/(-12))/(1/6(-108 - -104)). -13 Evaluate (-14)/4(436/(-238) - (-8)/68). 6 What is 0(-15 - 46/(-3))? 0 Calculate (18/10)/(91/455). 9 Evaluate (-5)/(-3)(-3)/(-1). 5 What is (45/12 - 4)/1 - 3741/172? -22 Calculate ((-20)/(-80))/((12/32)/((-30)/4)). -5 (-1272)/(-168) + (-4)/7 7 What is the value of 39/273 + ((-46)/28 - (-14)/21)? -5/6 What is (-329)/(-282)16/(-14)6? -8 Calculate (230/(-460))/(1/3). -3/2 What is ((-370)/(-222))/(-2 - (-13)/4)? 4/3 What is the value of (-375)/(5 - 0)(651/(-63) - -10)? 25 Calculate -11 - (-13 + 8/1). -6 Evaluate (1/608)/(4/(-20)). -2/3 What is ((-390)/780)/((1/(-3))/((-102)/9))? -17 What is the value of (-11457)/(-3762) - (-60)/(-110)? 5/2 Evaluate (12/9)/(558/(-54) + 9). -1 Evaluate (-174)/18 + 20/33011. -9 What is the value of ((-105)/7 - -12)/((-21)/(-133))? -19 What is (((-490)/72)/(-49))/(1/6)? 5/6 What is (-3905)/21312/90? -22/9 Calculate (-36)/(-45) - 2296/(-205). 12 Evaluate -6930/2415(-1)/2. 3/7 What is the value of (-12)/(-138) + (-1782)/1449? -8/7 4 + (-40)/(-5460)-553 -2/39 2536/(-2219) - 1990/133 - -16 -2/19 What is ((-25)/((-2475)/22))/((-4)/6)? -1/3 292/30 + 141 + -151 -4/15 ((-51)/((-4284)/56))/((-2)/51) -17 644/42 + 77/21 + -4 15 (0 - (-9)/6)(-360)/(-405) 4/3 18/378 - (-2 - (-463)/21) -20 What is ((2 + -1)(-1 + 5))/(-64 + 63)? -4 What is (-32)/(-2704)(-299)/115? -2/65 Evaluate ((-3)/12)/(150/3000). -5 What is the value of (-4)/(-10) - 2/15(-2077)/(-134)? -5/3 What is 3 + 69/(-12) - (29 + 28 + -58)? -7/4 What is the value of 544/476 - 141/(-7)? 7 Evaluate 2 + 8 - (1629/(-90) - -28). 1/10 What is the value of 1 + (816/(-45))/16? -2/15 Evaluate (39/(-26))/((-38)/(-95)). -15/4 Evaluate 142/14 - (-17)/(-119). 10 Calculate (-1 - 18/(-14))/(33 + (-7939)/238). -4/5 Calculate 43/8 + 135/(-27). 3/8 What is (-152)/(-6) + 26 + -49? 7/3 What is the value of (-6744)/564 + 84/(-2)4/(-14)? 2/47 Evaluate 10/(-18 + 8) - (-27)/15. 4/5 (0 - 1/4)/((-5)/603) 1 Calculate 4 + 3 - (32/(-2) + (0 - 0)). 23 What is ((-136)/(-578))/((-3)/(-153))? 12 Calculate (230/30 - 7)/((-5 - -1)/48). -8 What is 3182/387 - (-15 + 23)? 2/9 Evaluate 10/85 + (48/(-72))/(17/(-201)). 8 (-831 - -848) + (-253)/15 2/15 What is (-1 - -4) + -1 + (-54 - -73)? 21 What is (-996)/144 - -7 - 951/(-12)? 8 What is the value of (0 + -1)(-210 + 229)? -19 What is (-72)/(-119) - (-123)/(-697)? 3/7 15705/(-349)2/63 -10/7 What is 5/(-150)-10 - ((-272)/(-42))/(-8)? 8/7 What is the value of 7 - ((-72)/(-90) - (3 + 609/(-45)))? -13/3 ((-96)/(-168)77/4)/(-1 - -2) 11 What is the value of (((-5)/(-10))/(1 - 0))/(34/374)? 11/2 Evaluate (-1296)/180 + 8 + 0. 4/5 Calculate (-4)/(-39)((155/10 - 5) + 3). 18/13 What is (-372)/12 - (-21 - -4)? -14 What is the value of (-1)/(14/162) - (-6 - 450/(-70))? -12 (-88)/528 + (-2)/12 -1/3 What is the value of (10/4)/(((-377)/(-130))/(-29))? -25 Evaluate (-18)/12((-4)/5)/(90/75). 1 Evaluate (-4)/(-12)(168 + -93). 25 What is the value of ((-180)/(-3825))/(32/206/8)? 2/51 Calculate 16 + (-4 - 2200/180). -2/9 What is (-9)/33 + (-21)/165? -2/5 Calculate (21/(-9))/((-16485)/(-693) - 24). 11 Calculate (135/(-6))/(6 + (-493)/68). 18 53 + -68 - 714/(-48) -1/8 What is the value of (-27)/(4 + -7)((-2408)/(-1596))/43? 6/19 ((-125)/10 - -2)40/(-210) 2 What is (-3652)/(-528) - 7 - 1/12? -1/6 What is (1 - 154/168)1 - (-2)/(-8)? -1/6 What is (-1 - (-14 + 1))(13 - (-3686)/(-285))? 4/5 Evaluate 60/(-9)(-21)/28 - (-99)/9. 16 Evaluate 13/((-130)/(-60))1. 6 Evaluate (6/(-8))/((-24)/608) + (-133)/19. 12 Calculate ((-6)/(-6) - 0)/(5/2255). 9 Calculate 53/(-735) + 828/(-60858). -3/35 Evaluate -6(3/65 + 50/(-10)). 15 What is (-2)/21 + 430/(-1806)? -1/3 1 + 28 - (-12070)/(-426) 2/3 What is the value of 265/(-10) - ((-411)/(-685))/((-12)/(-50))? -29 ((-3)/9)/(6765/1230) -2/33 Evaluate (3/21 - (-1450)/(-203))1/1. -7 What is (2/2 - -2)(-187 + 186)? -3 What is (-1159)/38 + 559/(-86)? -37 Evaluate ((-26)/(-4))/(-1)(4 - (-17 + 19)). -13 Evaluate (328/(-12) - (-4)/(-6)) + (-8913)/(-2971). -25 What is -7 - (6 - (-2718)/(-135)) - (-14)/(-2)? 2/15 Calculate 4 + (-44)/24 + -3 + 33/(-198). -1 What is 9 + -2 - (-55)/(-44)12 - 26? -34 -67 + 62 - (25 + -24 + 0 + -11) 5 Evaluate 12980/(-2420) - (-28)/77. -5 Evaluate 90/(-54)(10 - -2). -20 What is the value of -14 - (1 + (6/7)/((-4)/28))? -9 Evaluate 1 + 26/(-91) + -1 + 92/28. 3 Evaluate (19 + -20)((0 - 3) + 3). 0 Evaluate -19 - -2 - 1225/(-75). -2/3 What is the value of ((-72)/60)/(36/(-171)) - (-1 - -7)? -3/10 Calculate 40/(-660) + 3182/231 - (-4)/14. 14 What is the value of 238/(-22) + 11 + -4 + 88/22? 2/11 -137 + 128 - (-7 + 0) -2 What is 36/27(-3 + (-84)/(-22))? 12/11 What is 8/(10 + 234/(-27)) - -51? 11 What is (4118/87 + -48)/((-4)/(-138))? -23 What is the value of -54/(-5) + (-3 + 0 - 1)? 0 What is the value of 417/278 + 17/(-2)? -7 Calculate (6/4)/((-186)/(-48) + -2). 4/5 (-1)/((-10)/(-21 + 11)) - (-6 + 0) 5 Evaluate -11 + (-195)/(-78)(-42)/15-4. 17 What is the value of 2651/(-588) + -9 + 11? -3/14 Calculate (52/(-1521))/(8/(-36)). 2/13 What is the value of 40/(-14) - ((-46)/253 - 93/33)? 1/7 What is the value of 3 + -7 - (-11)/(154/60)? 2/7 What is the value of (6 - 8)/((-5)/49) + (-7)/(-5)? 21 Evaluate 67/11 - (31 + 11 + -36). 1/11 What is the value of (-4)/(-14) + 2230/770 + -3? 2/11 12/15 - 7/6 - (-15)/90 -1/5 Calculate (46/47 - 1)(119 + -117). -2/47 (-44)/(-264) - (-786)/36 22 (21 - (0 + 16))8/(-10) -4 What is the value of (-1)/(((-3570)/(-2380))/((1-1)/26))? 1/39 Evaluate -3 + 168/363/(-2). -10 What is the value of (34/6)/((-91)/273)? -17 What is the value of (-5 - 48) + 1 + 33? -19 What is 18/(-54) + 28/(-96)? -5/8 What is the value of (-9)/4(69/(-9) - (-210)/42)? 6 Evaluate (-2)/((-21)/((-84)/(-20))). 2/5 What is the value of 3050/(-3660) + (-89)/(-6)? 14 (-2)/(-27) - (-187)/27 7 Calculate (-7)/420-8 + (-970)/(-600). 7/4 Calculate ((-117)/18 + 6 + -1)280/(-150). 14/5 What is the value of ((-126)/(-441) - (-19)/7)-6? -18 What is the value of (((-30)/(-4))/(6 + -1 + -11))/(-5)? 1/4 24(7 + 132/(-18)) -8 3(-652)/(-660) + (-32)/88 13/5 (-2 + 1/2)/(25/(1750/21)) -5 What is -74 - 12428/(-208) - 6/8? -15 Calculate 259/(-49) + (3/63)/(3/18). -5 What is the value of -121 + 3((-96)/9 + 10)? -14 What is 119750/5748 + 1/6? 21 Evaluate ((-14)/(-176))/((-672)/(-384)). 1/22 What is the value of -16 + ((-246)/205)/(3/(-20))? -8 Calculate (-2)/10(-108)/(-9) - (1 - 4). 3/5 Evaluate (-11860)/593 - (-8 - -1). -13 Calculate 25/(-4)576/(-540)(-3)/2. -10 What is the value of (846/(-4230))/(38/(-20))? 2/19 What is the value of (6/14 + (-451)/154)/(238/136)? -10/7 Calculate (12/126)/((36/(-56))/(-3)). 4/9 ((-24)/30)/((162/(-1080))/((-2)/16)) -2/3 What is 11/(-3)2106/(-66924)? 3/26 What is the value of (-14)/(-10) + -1 + -30264/17050? -2/31 Evaluate (-2)/(-44) - (-36855)/2310. 16 What is (-29/60)/(213/1065)? -3/2 Evaluate 0/(13 + -22) + 19. 19 What is -11 - 88/(-8) - (-1)/(-2)46? -23 What is (2 - 4) + ((-30)/(-8))/((-80)/(-48))? 1/4 Evaluate (3 - (-393)/(-165)) + ((-18)/(-15) - 2). -2/11 What is (-22)/(-1((-2)/(-11) - (-1224)/(-561)))? -11 124/(-12) - 108/(144/(-12)) -4/3 Calculate (45/(-14))/(4122/(-3206)). 5/2 Calculate (-39)/1(-331)/993. 13 Evaluate (-16)/(-6) + (-4774)/1860. 1/10 What is the value of (-754)/364 + (0/1 - -2)? -1/14 Evaluate ((1680/36)/(-14))/(4/(-6)) - 35. -30 Evaluate 44/52 + 190/1235. 6/13 What is the value of (-608475)/23485 - (2/44)/((-2)/(-4))? -26 What is 11130/(-10395) + 40/45 + 0? -2/11 What is the value of 13/((-78)/(-126)) - (-544)/(-32)? 4 Calculate (139/2)/(-139) - 38/(-4). 9 28/(-182)(-2002)/440 7/10 Evaluate (141 - 127) + 177/(-12). -3/4 What is 20/6 + -70 + 3366/51? -2/3 Calculate (-66)/(-440)68(-15)/(-9). 17 What is (14/2 + -8)(19/(-5) + 4)? -1/5 Evaluate (-2 - (5 - 6))/((-4 + 6)/12). -6 -16 + (14 - (19 + -13)) -8 What is ((-231)/(-55))/2125/(-40)? -1/8 What is (-11)/(-330)30? 0 Evaluate (202/(-4) + -1 + 8)-9. 27 Evaluate (5 + -9)45/630. -2/7 What is the value of (24/(-348)-29)/(-5)? -2/5 Evaluate -16 - (3/(6/4) - (110 + -110)). -18 Evaluate (462/(-132) - (-2 + (-18)/20))-10. 6 What is -2(161/(-14) + 13)? -3 Evaluate (-2275)/(-70)*(-26)/65. -1	{ "pile_set_name": "DM Mathematics" }
o3 + 18o*2 + 6o What is the first derivative of -37010p2 + 1034751? -74020p What is the derivative of 105130uy - 129910u wrt y? 105130u What is the second derivative of -23726v3w*2 + 5v*3w - v*2w - 174w wrt w? -47452v*3 What is the second derivative of -4hj2 + hj + 12h + 4207j*4 + 446j - 3 wrt j? -8h + 50484j*2 What is the second derivative of 117896q*2 - 58970q + 4 wrt q? 235792 What is the second derivative of 8911i4 + 85547i wrt i? 106932i2 What is the second derivative of -193638j*4 - 9j*3 + 688816j wrt j? -2323656j2 - 54j What is the second derivative of -13j2l - 1962j2 - 3jl - 1172j - 3l wrt j? -26l - 3924 Find the second derivative of -1385679h3l*3 + 2h*2l*3 + 58hl3 - 1678hl - 2l*3 + 2l wrt h. -8314074hl*3 + 4l*3 Find the first derivative of 21iv3w - 1004iv*3x*2 + 30v*3x*2 - 5v*3x - v*2x*2 + 2wx2 wrt i. 21v*3w - 1004v3x*2 Find the second derivative of 5976616u*4 - 72938u + 4. 71719392u2 Find the first derivative of 8628f*2h - 1819413f2 - 20fh wrt h. 8628f*2 - 20f What is the second derivative of -52122d2o*2 + 2do2 - 9983d wrt d? -104244o2 What is the second derivative of -4299k4 - k3 + 8k2 + k - 5171 wrt k? -51588k*2 - 6k + 16 What is the first derivative of 3h3u - 3h3 + 2509h*2uy - h2y - huy - 2u - 395y - 1 wrt u? 3h3 + 2509h*2y - hy - 2 Find the second derivative of 5910m5 + m4 + 2m + 79701 wrt m. 118200m*3 + 12m*2 Find the third derivative of -136328n*4 + 719697n*2 wrt n. -3271872n Differentiate 910j4 - 1621j*2 + 1300632 with respect to j. 3640j*3 - 3242j Differentiate 22313do + 7o + 15 with respect to d. 22313o Find the third derivative of -2251930x3 - 351904x*2. -13511580 Find the second derivative of -742815g*2 + 784835g wrt g. -1485630 What is the derivative of -44458u - 22551 wrt u? -44458 What is the third derivative of 35015z6 + z2 - 58z - 67 wrt z? 4201800z*3 What is the second derivative of -28h*3i*3 + 145h*3i*2 + 1001840h*3 - 2h*2i - 25i3 wrt i? -168h*3i + 290h3 - 150i What is the first derivative of -pt + 8997p + 7t + 1443 wrt p? -t + 8997 What is the third derivative of -198918w3 + w2 + 238333w wrt w? -1193508 What is the second derivative of -35888i*2 - 2i + 31 wrt i? -71776 What is the second derivative of -485a3 - 469a*2 - 2a + 95237? -2910a - 938 Differentiate -125761v*3 - 40648 with respect to v. -377283v*2 What is the third derivative of -5350708f*3 - 8f*2 + 30753f + 1? -32104248 Find the third derivative of -5f3l*2 - 8392f*3l - 16f3 - 62f*2l*2 + 948f*2 - 23l*2 wrt f. -30l*2 - 50352l - 96 What is the derivative of -42858k - 91820 wrt k? -42858 Find the second derivative of -40329l*2w*2x*2 + 10l*2w*2 + 249l*2wx2 + 10l*2wx + 2l*2x*2 - lx*2 - 8lx - 2wx2 wrt w. -80658l*2x*2 + 20l*2 What is the third derivative of 362n*2r*3 + 29n*2r*2 + 2nr3 - r3 - 215r*2 wrt r? 2172n*2 + 12n - 6 Find the third derivative of -170970u3 - 16u*2 - 3u + 82. -1025820 Find the third derivative of 271fl*2t*3 + 4fl2t*2 - 38fl2t + 2flt2 - 121ft3 - 35l*2t*2 wrt t. 1626fl2 - 726f Find the second derivative of -1905707o4 - 209280o + 2 wrt o. -22868484o2 What is the derivative of -184dq + 673853d + 6779q3 wrt q? -184d + 20337q2 What is the third derivative of -d3f*3 + 7d*3f*2 + 151d*3f + 7d2f2 + f3 + 4f2 + 2f wrt d? -6f3 + 42f*2 + 906f What is the second derivative of -186543q2 - 53631q wrt q? -373086 Differentiate -2213710l2 - 5373994 wrt l. -4427420l Differentiate -2033q4 - q3 + q2 - q + 402634 wrt q. -8132q*3 - 3q*2 + 2q - 1 What is the third derivative of -128324pv*3 - 6pv2 - 8p - 2v2 - 96 wrt v? -769944p Differentiate 383r2 + r - 11828 with respect to r. 766r + 1 Find the third derivative of 20v5w*3 - 7237v*5 - 3v*2w*3 + 579v2 + w3 wrt v. 1200v2w*3 - 434220v*2 What is the first derivative of -20s*3 - 3s*2 - 7056s - 516893 wrt s? -60s2 - 6s - 7056 Find the second derivative of -3285809l2u*2 + 11lu2 - 89lu + 113u + 2 wrt l. -6571618u2 Find the third derivative of 73i*3q2 - i3q + 3409i*3 - 9i*2q*2 + 4i*2q - 584q2 + 2 wrt i. 438q*2 - 6q + 20454 What is the third derivative of a*3m - 78186a3 - 10191a*2m + 5a2 + am wrt a? 6m - 469116 What is the derivative of -3373976t + 2032221? -3373976 Find the third derivative of 2o6 + 2o*4 + 209o*3 - 1386o*2 - o - 2. 240o*3 + 48o + 1254 What is the second derivative of 1328600q5 - 15q - 19656 wrt q? 26572000q3 What is the first derivative of 357j*3 + 132j*2 - j - 1001452 wrt j? 1071j*2 + 264j - 1 Find the second derivative of 19437z4 + 39267z wrt z. 233244z2 What is the third derivative of 2g*4w - 16167g4 + 7973g*2 + gw wrt g? 48gw - 388008g Find the first derivative of -3jz + 76536j - 30778z3 wrt z. -3j - 92334z2 What is the second derivative of 33920d*2o*4 - 3d*2o + 245d2 - 4do5 + 83do + 4d - o wrt o? 407040d2o*2 - 80do3 What is the third derivative of 87696g4 - g2 + 317g + 14? 2104704g What is the second derivative of 38588ox*2 + 6ox - 13211o wrt x? 77176o What is the third derivative of -7u*5 + 2329u*4 + 48u*3 + 2u*2 + 4u + 244098 wrt u? -420u2 + 55896u + 288 What is the second derivative of -39822p4 - 2p + 16857? -477864p2 What is the second derivative of 3g*2t*2 - 24074g*2t - 22g2 - 1931602gt2 - gt wrt g? 6t2 - 48148t - 44 What is the first derivative of -88g2l - g*2 - 139l + 7815 wrt l? -88g2 - 139 What is the second derivative of 16r*3t - 2r2tw - 5r*2t + r*2w + 280rtw - 2tw + 2w wrt r? 96rt - 4tw - 10t + 2w What is the third derivative of -d*2q*3 + 641505d*2q - 10701dq*3 + 19q*3 - 2q*2 wrt q? -6d*2 - 64206d + 114 Find the third derivative of -99l5 - 1572l*3 - 241018l*2. -5940l*2 - 9432 What is the third derivative of -16f*6 + 149f*4 + 3f*3 + 208395f*2 wrt f? -1920f*3 + 3576f + 18 What is the first derivative of 3b4 + 19b*3u + b - 58u + 5 wrt b? 12b*3 + 57b*2u + 1 Find the third derivative of -25j4 + 4544j*3 - 25j*2 - 4j + 3396. -600j + 27264 Differentiate -849ck + c + 20k + 485 with respect to c. -849k + 1 What is the first derivative of -4895y*2 + 33y + 718380? -9790y + 33 Find the third derivative of -h5 - 10h*4 - 431h*3 + 3h*2 - 3311h - 1. -60h2 - 240h - 2586 What is the derivative of -1135500j - 167686? -1135500 Differentiate 2504177n*3q + 2n3 + 422470n*2 wrt q. 2504177n*3 Find the second derivative of 209750s*4 + 2s*2 + 112731s - 2 wrt s. 2517000s2 + 4 What is the second derivative of -563223f*3n*2 + 347648f*3n wrt n? -1126446f3 Find the third derivative of -166876n*6 - 333n*2 - 18n + 3. -20025120n3 What is the derivative of 6491ny2 + ny + 339845n + 37y*3 + 2y wrt y? 12982ny + n + 111y2 + 2 What is the first derivative of -4911f*3 - 9f + 34135? -14733f2 - 9 What is the second derivative of 82l*5 - 9l*3 - 38l*2 - 22207l? 1640l3 - 54l - 76 Find the first derivative of 2450668y + 1244410 wrt y. 2450668 Find the second derivative of 5l*4 + 6l*2 - 10541l. 60l2 + 12 What is the second derivative of -5a*5 - 26a*4 + 1269a*2 - 4a + 111524 wrt a? -100a3 - 312a*2 + 2538 Find the second derivative of 8x5 + x4 - 122x2 + 27x + 468. 160x3 + 12x*2 - 244 What is the derivative of 2fij + 226fi + 25fj - 3f + 528850ij wrt f? 2ij + 226i + 25j - 3 Differentiate 617613k - 1902095. 617613 Differentiate 828t4 - 2t*3 + 7t*2 + 164323 wrt t. 3312t*3 - 6t*2 + 14t What is the derivative of 923ly*3 - 191l + 3y3 + 73061y wrt l? 923y3 - 191 Find the third derivative of -37725w*4 - 8116w*2 wrt w. -905400w Find the second derivative of -210g5 - 20g*2 - g - 10601. -4200g**3 - 40	{ "pile_set_name": "DM Mathematics" }
t(h) = -5h2 - 4h - 2. Suppose 16 = -3a + 4y, -4a - 4 = 2y - 3y. Suppose 6d + 18 + a = 0. Determine ds(f) + 5t(f). 2f2 + f - 1 Let r(b) = -28b + 10. Let t(z) = 97z + 95z - 201z + 3. Give 3r(g) - 10t(g). 6g Let g(y) = 14y2 - 14y - 20. Suppose -3u + 170 = -13u. Let i(s) = 5s2 - 5s - 7. Determine ui(z) + 6g(z). -z2 + z - 1 Let d(p) = -p3 - p*2 + p. Let f(a) = 2a*3 + 2a*2 - a - 1. Let l be 1/(-4)(-32 + 28). Determine ld(x) + f(x). x3 + x2 - 1 Suppose i + 12 = 59. Let d(a) = 46a + 3 - ia - 3. Let f(z) = -2z + 1. Determine -3d(k) + f(k). k + 1 Let r(x) = 11x*2 + 5x + 5. Let l be (11/(-88)6)/(1/(-24)). Let g(o) = -39o*2 - 18o - 18. Calculate lr(h) + 5g(h). 3h2 Let p(i) = 3223i*2 + 77i + 77. Let z(v) = -124v2 - 3v - 3. Give 3p(m) + 77z(m). 121m2 Let g(d) = -170d*2 + d + 3. Let q(j) = -848j*2 + 6j + 16. Give 16g(n) - 3q(n). -176n2 - 2n Suppose -5d = -14d + 27. Let a(w) = -w - 1. Let c(p) be the first derivative of 2p3/3 + p2 + 2p + 65. What is da(j) + c(j)? 2j*2 - j - 1 Let t(f) = 4f - 2f2 - 3f - 10 - f2. Let h(j) = -j2 - 3. Suppose 5l - 16 = 49. Suppose 0 = o + 5a - l, o + 2a = -0o + 1. Calculate oh(d) + 2t(d). d*2 + 2d + 1 Let h(k) = k*2 - k - 6. Let j be (-3)/4 + (-3 - (-31)/4). Let z = 2 + 0. Suppose -zc + j = -6. Let i(x) = x*2 - 2x - 11. What is ch(u) - 3i(u)? 2u2 + u + 3 Let s(y) be the first derivative of y4/6 - y3/3 + 10y*2 - 9. Let d(r) be the second derivative of s(r). Let v(j) = 3j - 1. Give -4d(p) + 6v(p). 2p + 2 Let r(k) = 201k + 4. Let p(l) = -403l - 10. Calculate -3p(n) - 7r(n). -198n + 2 Let i(t) = -257442t3 - 1605t*2 + 3210. Let f(d) = -321d*3 - 2d*2 + 4. Determine -1605f(s) + 2i(s). 321s*3 Let o(r) = 15r*3 - 5r*2 - 5. Let d(w) = -8w*3 + 2w*2 + 2. Suppose 0 = -6c + 4c - 6, 4n + 11 = 3c. Give nd(a) - 2o(a). 10a*3 Let q(p) = -4p - 17. Let s(k) = -k - 4. Suppose -2c = -4z + 38 - 14, 3z - 3c = 24. What is zq(m) - 18s(m)? 2m + 4 Let u(r) = -6r*2 + 3r - 4. Let z(g) = 12g2 - 4g + 7. Give -7u(s) - 4z(s). -6s2 - 5s Let y(t) = -1337t3 + 5t*2 + 5t - 5. Let h(r) = 23397r3 - 88r*2 - 88r + 88. Give -5h(k) - 88y(k). 671k3 Let c(l) = 2. Let z(j) = 5j + 10. Let g(i) = 6c(i) - z(i). Let p = 7 + 4. Let r(f) = -9f + 3. Give pg(x) - 6r(x). -x + 4 Suppose 0 + 10 = -5c. Let j(f) = -f + 1. Let s(a) = 4a - 3. Let p be (10/15)/(4/(-42)). Calculate cs(l) + pj(l). -l - 1 Let u(z) = 7z + 8. Let p(k) = -k - 1. Let s(a) = 6p(a) + u(a). Let h(t) = 29t - 5t - 17t - 6t. Calculate h(x) + s(x). 2x + 2 Let o(m) = 5m*2 + 10m + 15. Let n(a) = -6a2 - 11a - 17. What is -7n(f) - 8o(f)? 2f2 - 3f - 1 Let k(n) = 3n + 3 + 7 - 4. Let o(u) be the second derivative of -7/2u*2 + 0 - 8u - 2/3u3. Determine -7k(r) - 6o(r). 3r Let u(b) = -3b + 8. Let l(y) = -4y + 7. Give 3l(v) - 2u(v). -6v + 5 Let u(f) = f + 1. Let c(d) = d2 - 5d - 11. What is -c(w) - 4u(w)? -w2 + w + 7 Let x(r) = -48r + 8. Let a(f) = f - 3. Calculate -5a(j) - x(j). 43j + 7 Let u(c) = 7c3 - c2 + 6c. Let k(m) = m*3 + 12m*2 - 2m - 149. Let x be k(-11). Let p(v) = -15v3 + 2v*2 - 13v. Give xp(l) - 13u(l). -l3 + l2 Let p(q) = -865q3 + 4q*2 - 4. Let u(j) = 866j*3 - 5j*2 + 5. Calculate -5p(i) - 4u(i). 861i*3 Let i be (9/4)/((-3)/(-8)). Let z(x) = 2x*2 - 2x + 7. Let c(y) = 3y2 - 10 + 5y - 4y2 + 6 - 3y*2 - 11. Give ic(s) + 13z(s). 2s*2 + 4s + 1 Let w(y) = -2y3 - 1. Let r(f) = 6f*3 - 2f + 14. Give r(b) + 12w(b). -18b*3 - 2b + 2 Let q(y) = y*2 - 3. Let v be -2 + 3 + -6 - 1. Let j = 9 + v. Let b(r) = -2r*2 + 5. Let s = 11 + -6. Give jb(w) + sq(w). -w2 Let w(l) = 9l*3 + 563l*2 + 4. Let u(r) = -2r3 + r2 - 1. What is -5u(t) - w(t)? t3 - 568t*2 + 1 Let j(c) = 2c*2 - 2c - 27. Let v(o) = -2o3 + 7o*2 - 7o - 82. Give -7j(k) + 2v(k). -4k3 + 25 Let v(c) = -c3 - 4c*2 + 5. Let u be 4 - (13 + (6 - (0 + 4))). Let f(a) = -2a3 + a2 + 14 - a*3 - 12a*2. What is uv(h) + 4f(h)? -h3 + 1 Let i be -1 + -9 + (0 - -3). Let s(a) = a3 - 5a*2 + 4a2 - a2. Let b(t) = -4t3 + 7t*2. Give is(n) - 2b(n). n3 Let c(s) = -s2 - s + 3. Let h(r) = -2r*2 - 2r + 8. Let x(q) = -3q. Suppose -2g - 2 = -0. Let p be x(g). Suppose pj - 7 = 2. What is jh(u) - 8c(u)? 2u*2 + 2u Let y(v) = -3v3 - 6v*2 - 50v - 18. Let a(l) = l*2 + l + 3. Determine 6a(z) + y(z). -3z3 - 44z Let y = -327 + 334. Let w be 9/(-3)8/(-6). Let l(q) = 4q*2 - 7q + 7. Let v(b) = -2b2 + 4b - 4. What is wl(r) + yv(r)? 2r2 Let i(g) = g2 + g - 1. Let n(r) = 679r*2 + 582r - 582. Determine -582i(w) + n(w). 97w*2 Let a(b) = -5b*2 + 2b. Let j(r) = -r*3 + 3r*2 + 2r + 5. Let o be j(4). Let w(d) be the first derivative of d*3/3 - 467. Calculate ow(p) - a(p). 2p2 - 2p Let o(g) = -17g2 + 2g. Let x(u) = -52u2 + 5u. Determine 11o(s) - 4x(s). 21s2 + 2s Let r(u) = 6u + 2. Let x = -1063 + 1059. Let h(n) = -12n - 4. Determine xh(w) - 9r(w). -6w - 2 Let f be 21/(-2)500/(-375). Let g(y) = -21y2 - 14y - 14. Let s(r) = 4r2 + 3r + 3. What is fs(t) + 3g(t)? -7t2 Let k(n) = -4n*3 + 7n - 4. Let r(d) = 0d - 2d + 6 + d. Let i be r(5). Let g(v) = -13v2 - v + v3 + 13v*2 + i. What is 5g(b) + k(b)? b*3 + 2b + 1 Let o(y) = 3y3 + 3. Let t(s) = 2s*3 + s + 2. Give 3o(i) - 4t(i). i3 - 4i + 1 Let c(n) = 2n3 + 3n - 1. Suppose 3a = 6x + 4a + 28, 0 = -3x + 5a + 8. Let j(d) = -3d*3 - 4d. Give xc(r) - 3j(r). r*3 + 4 Let w(a) = 151a*3 + 18a*2 - 13a - 15. Let y(h) = 76h3 + 8h*2 - 6h - 7. Calculate -4w(f) + 9y(f). 80f3 - 2f - 3 Let u(n) = 2n3 - 37n*2 + 4n. Let j(h) = 8h3 - 149h*2 + 17h. What is 2j(w) - 9u(w)? -2w3 + 35w*2 - 2w Let o(n) = -n*2 + 6n - 2. Let w be o(3). Let d be w/((-21)/12) - 2. Let l(k) = k3 - k2 - 6k + 2. Let g(c) = c. What is dg(q) - l(q)? -q3 + q2 - 2 Let f(w) = w - 2. Let z(u) = 7u - 1. What is f(t) - z(t)? -6t - 1 Let l(r) = -3r2 - 5r - 15. Let u(o) = 7o2 + 12o + 32. Give -5l(s) - 2u(s). s*2 + s + 11 Let s(p) = 26p*3 - 6p + 32. Let n(u) = -6u3 + u - 8. Determine 9n(d) + 2s(d). -2d*3 - 3d - 8 Let m = -26 - -27. Let z(c) = -c. Let k(p) = p + 6. What is mk(o) + 2z(o)? -o + 6 Let r(t) = -2t2 + t - 3. Let d(x) = 9x*2 - 6x + 40. Determine -d(u) - 6r(u). 3u*2 - 22 Suppose 0 = -3p, -w - 4p - 91 = -92. Let t(g) = -3g3 + g2 - g - 2. Let v be 5/(-7) + (-2)/7. Let x(k) = -k*2 - k. Give vt(n) + wx(n). 3n*3 - 2n*2 + 2 Let r(k) = 2k*2 + 4k. Let d(w) = w*2 + w. Suppose -3c + 3b - 27 = 0, -2 = 2b - 10. What is cr(p) + 20d(p)? 10p2 Let d(o) = -o3 + o - 1. Let r(n) = 2n*3 - 5n + 5. Suppose -5i = 4u - 34 + 33, 2u + 2 = 0. What is ir(m) + 5d(m)? -3m3 Let a(i) = i3 - i*2 + 1. Let b(v) = -48v*3 + 2v*2 + 2v - 6. Determine 4a(w) + b(w). -44w*3 - 2w*2 + 2w - 2 Suppose n + 4 = -2b, 3b + 2 + 6 = -n. Let o(f) = -7f + 4. Let d(g) = -3g + 2. Give no(c) - 9d(c). -c - 2 Let n(o) = 5o3 - 8o*2 - 4. Let k(s) = 2s*3 - s. What is -2k(q) + n(q)? q*3 - 8q*2 + 2q - 4 Let r(g) = -35g - 64. Let m(s) = -12s - 23. Give 11m(q) - 4r(q). 8q + 3 Let n(h) = -2h*3 + 93h + 9. Let i(x) = 7x3 - 279x - 24. Give -3i(l) - 8n(l). -5l3 + 93l Let r(t) = t - 1. Let j be ((-10)/(-35))/((-5)/35). Let x(v) = v*3 - 2v + 2. What is jx(h) - 4r(h)? -2h3 Let f(m) = -28m - 48. Let d(a) = -9a - 17. Determine 8d(o) - 3f(o). 12o + 8 Let z(n) be the third derivative of 1/6n3 + n2 + 0n + 1/6n4 + 7. Let w(p) = -3p - 1. Suppose -6t + 5t = 3. Give tw(a) - 2z(a). a + 1 Let q(n) = -9n2 - 412. Let g(w) = 2w*2 + 103. Determine -26g(t) - 6q(t). 2t*2 - 206 Let q(f) = -12f*2 - 11f - 4. Let r(j) = -14j2 - 11j - 5. Give 6q(h) - 5r(h). -2h2 - 11h + 1 Let y(h) = 8h2 - 1. Let v(u) = -3u*2 - 2u. Calculate -6v(z) - 2y(z). 2z2 + 12z + 2 Let y(u) = -39u3 - 2u*2 - 6u + 9. Let g(o) = 117o3 + 6o*2 + 17o - 25. Give -6g(c) - 17y(c). -39c3 - 2c*2 - 3 Suppose -t - 3f - 12	{ "pile_set_name": "DM Mathematics" }
prob of sequence zmv? 3/286 What is prob of sequence jngl when four letters picked without replacement from {j: 2, n: 1, a: 1, g: 2, l: 1}? 1/210 Three letters picked without replacement from {z: 9, m: 5}. Give prob of sequence mzm. 15/182 What is prob of sequence mfoo when four letters picked without replacement from {m: 1, f: 7, l: 1, o: 6}? 1/156 Four letters picked without replacement from cklicnclkllll. What is prob of sequence lkin? 1/1430 What is prob of sequence yzyy when four letters picked without replacement from {z: 8, y: 5, k: 4, p: 2}? 5/969 Two letters picked without replacement from fffvgfvvfffvvffvf. Give prob of sequence gv. 3/136 Calculate prob of sequence bhn when three letters picked without replacement from {b: 1, n: 1, h: 1, x: 1, w: 1}. 1/60 Three letters picked without replacement from ccoooco. What is prob of sequence cco? 4/35 Calculate prob of sequence kek when three letters picked without replacement from {e: 4, k: 3}. 4/35 What is prob of sequence nam when three letters picked without replacement from cczcncnpccpmzaznccac? 1/1140 Calculate prob of sequence ll when two letters picked without replacement from llelee. 1/5 What is prob of sequence miih when four letters picked without replacement from aiihmqr? 1/420 What is prob of sequence rrcr when four letters picked without replacement from {r: 3, c: 7}? 1/120 What is prob of sequence aa when two letters picked without replacement from {r: 2, a: 2}? 1/6 Two letters picked without replacement from {c: 1, v: 1, s: 1, r: 1, t: 1, d: 2}. What is prob of sequence ts? 1/42 Four letters picked without replacement from {b: 4, y: 9, w: 3}. What is prob of sequence wbbw? 3/1820 Calculate prob of sequence agp when three letters picked without replacement from {n: 1, m: 3, p: 1, a: 1, g: 1}. 1/210 What is prob of sequence nn when two letters picked without replacement from {n: 3, b: 11}? 3/91 Calculate prob of sequence pc when two letters picked without replacement from cpupcpupcppuu. 3/26 Calculate prob of sequence cebc when four letters picked without replacement from {b: 1, c: 2, u: 1, e: 1}. 1/60 What is prob of sequence bn when two letters picked without replacement from mmmmvmbmnvbvmv? 1/91 Two letters picked without replacement from {c: 5, i: 2, y: 4, j: 1, t: 4}. Give prob of sequence jc. 1/48 What is prob of sequence ip when two letters picked without replacement from bibopboobobo? 1/132 Calculate prob of sequence veo when three letters picked without replacement from evooveoe. 3/56 What is prob of sequence wp when two letters picked without replacement from wbpwvsrp? 1/14 Calculate prob of sequence ttp when three letters picked without replacement from itpti. 1/30 Four letters picked without replacement from {r: 4, a: 3, x: 5, i: 1}. Give prob of sequence xxai. 1/286 Calculate prob of sequence nlqn when four letters picked without replacement from nhllqntq. 1/210 Two letters picked without replacement from {k: 7, x: 3, m: 1, r: 2, q: 4}. What is prob of sequence rr? 1/136 What is prob of sequence oqkx when four letters picked without replacement from moxqmkxk? 1/420 What is prob of sequence ee when two letters picked without replacement from exxxxxxexxxxxexeee? 5/51 Calculate prob of sequence es when two letters picked without replacement from vcvvssvev. 1/36 Two letters picked without replacement from efzfezze. Give prob of sequence zz. 3/28 What is prob of sequence yw when two letters picked without replacement from wwjjyjwojyyyyyyjo? 21/272 Two letters picked without replacement from {s: 15, m: 4}. Give prob of sequence mm. 2/57 Calculate prob of sequence tkbt when four letters picked without replacement from tvwkkvkkvkkbbtvbk. 1/1360 Calculate prob of sequence ccb when three letters picked without replacement from cbcbcbc. 6/35 What is prob of sequence nlt when three letters picked without replacement from {w: 1, t: 1, n: 5, l: 1, f: 6}? 5/2184 Calculate prob of sequence gaaa when four letters picked without replacement from {g: 2, a: 4, l: 7}. 2/715 Four letters picked without replacement from apaim. What is prob of sequence pima? 1/60 Four letters picked without replacement from gggyxssgggggxggg. What is prob of sequence gygg? 33/1456 Three letters picked without replacement from wkn. What is prob of sequence nwk? 1/6 What is prob of sequence iiii when four letters picked without replacement from {i: 9}? 1 What is prob of sequence aa when two letters picked without replacement from yapal? 1/10 What is prob of sequence yq when two letters picked without replacement from qsy? 1/6 Calculate prob of sequence uee when three letters picked without replacement from {e: 18, u: 1}. 1/19 What is prob of sequence fqf when three letters picked without replacement from {q: 1, v: 2, s: 1, f: 2}? 1/60 What is prob of sequence fzx when three letters picked without replacement from {f: 4, z: 2, v: 1, x: 7, h: 3}? 7/510 Four letters picked without replacement from bbbbybbvbbbbvy. Give prob of sequence yyvb. 5/3003 Calculate prob of sequence zj when two letters picked without replacement from {j: 1, z: 4, a: 2, m: 7}. 2/91 What is prob of sequence rviv when four letters picked without replacement from rrjjarrvirivarj? 1/1365 Calculate prob of sequence onno when four letters picked without replacement from {z: 4, b: 1, n: 2, o: 8, a: 1}. 1/390 Two letters picked without replacement from {j: 2, r: 3, t: 4, m: 2}. Give prob of sequence jt. 4/55 Calculate prob of sequence ss when two letters picked without replacement from {q: 2, s: 5, f: 2}. 5/18 Two letters picked without replacement from uuuzzuiqizzczzziz. What is prob of sequence ui? 3/68 What is prob of sequence lxu when three letters picked without replacement from {u: 2, l: 3, c: 1, x: 1}? 1/35 Two letters picked without replacement from {x: 3, y: 3}. Give prob of sequence yy. 1/5 Four letters picked without replacement from {k: 2, s: 2}. What is prob of sequence kssk? 1/6 What is prob of sequence ogg when three letters picked without replacement from ovvovogvovgoo? 1/143 Calculate prob of sequence ss when two letters picked without replacement from {e: 11, s: 2}. 1/78 Four letters picked without replacement from {d: 4}. What is prob of sequence dddd? 1 Two letters picked without replacement from wowwwooowfoowfwooo. Give prob of sequence ww. 7/51 What is prob of sequence qqoa when four letters picked without replacement from graqraqqkkraggrqaako? 1/1938 Calculate prob of sequence jjzz when four letters picked without replacement from {j: 10, z: 2}. 1/66 What is prob of sequence lly when three letters picked without replacement from {y: 5, h: 9, l: 2}? 1/336 Four letters picked without replacement from lllzz. What is prob of sequence llzl? 1/10 Four letters picked without replacement from {m: 9, s: 3}. What is prob of sequence msmm? 7/55 Calculate prob of sequence eeb when three letters picked without replacement from {b: 2, e: 4, t: 7}. 2/143 Two letters picked without replacement from {a: 7, e: 7}. What is prob of sequence ae? 7/26 Four letters picked without replacement from sfbgbaagglbbssl. What is prob of sequence baga? 1/1365 What is prob of sequence cac when three letters picked without replacement from {k: 2, c: 6, a: 5}? 25/286 Calculate prob of sequence oyo when three letters picked without replacement from hdyodohyoyoohyyddyo. 10/323 Three letters picked without replacement from {m: 1, b: 11}. What is prob of sequence mbb? 1/12 Calculate prob of sequence jm when two letters picked without replacement from jjmvjjmjkmjjekjw. 1/10 Three letters picked without replacement from tttqtttttttttttqtt. What is prob of sequence ttt? 35/51 Calculate prob of sequence eox when three letters picked without replacement from ixlieyoieyxyixi. 1/455 Four letters picked without replacement from {j: 4, w: 2, g: 1, y: 2, c: 7}. What is prob of sequence jccc? 1/52 Four letters picked without replacement from fbvbbvvvbbfffb. What is prob of sequence vbbv? 15/1001 Three letters picked without replacement from {q: 3, g: 1, o: 3}. Give prob of sequence qqq. 1/35 Four letters picked without replacement from {j: 5, w: 9}. What is prob of sequence jwww? 15/143 Calculate prob of sequence qw when two letters picked without replacement from {	{ "pile_set_name": "DM Mathematics" }
6y2 + 9y - 16. Give o(7). -2 Let x(b) = b*2 - 7b + 1. Determine x(8). 9 Let k(g) = -g*2 + 8g - 6. Give k(3). 9 Let a(b) = -3b3 + 5b2 - 3. What is a(-1)? 5 Let j(s) = -s2 - 5s + 1. Give j(5). -49 Let u(k) = -2k + 9. Give u(-10). 29 Let g(t) = -2t2 + 67t - 157. Determine g(31). -2 Let k(w) = -w*2 - 10w - 60. What is k(-6)? -36 Let r(a) = a - 13. Calculate r(16). 3 Let x(s) = -s*2 - 6s + 27. Give x(-7). 20 Let b(h) = 2h + 35. What is b(-22)? -9 Let q(b) = b3 + 12b*2 + 30b - 16. Determine q(-8). 0 Let a(c) = 2c2 + 23c + 9. Calculate a(-10). -21 Let l(h) = 3h - 102. What is l(17)? -51 Let s(j) = -4j - 56. What is s(-13)? -4 Let a(s) = 16s3 + s2 + s + 1. What is a(-1)? -15 Let s(k) = 15k - 4. Calculate s(-2). -34 Let n(v) = 4v - 37. Give n(8). -5 Let c(q) = -q + 27. What is c(21)? 6 Let y(z) = z2 + 19z - 1. Determine y(-19). -1 Let r(s) = s*2 + 8s + 3. Determine r(-8). 3 Let o(y) = y*2 + 10y. Calculate o(-8). -16 Let n(g) = -g*2 - 22g + 56. Calculate n(-24). 8 Let m(x) = -x + 12. What is m(8)? 4 Let l(x) = -x2 + x - 9. Calculate l(0). -9 Let m(c) = c3 + 9c2 + 4c - 3. What is m(-8)? 29 Let g(s) = -4s2 + 30s + 4. What is g(6)? 40 Let o(m) = -m*2 + 9m - 2. Calculate o(3). 16 Let l(t) = -3t + 16. Give l(-27). 97 Let t(g) = -g3 - 12g*2 - 23g - 36. What is t(-10)? -6 Let a(v) = -v - 4. Determine a(2). -6 Let g(x) = 65x - 23. Calculate g(-2). -153 Let x(r) = r3 + 2r + 1. Calculate x(-2). -11 Let o(f) = -10f2 + f. Give o(-1). -11 Let t(q) = -3q - 2. What is t(-10)? 28 Let p(i) = 2i - 18. Give p(11). 4 Let x(s) = -s2 - 9s + 25. Calculate x(-9). 25 Let v(d) = d*3 + 7d*2 + 7d - 1. What is v(-5)? 14 Let c(u) = 30u + 304. Give c(-10). 4 Let q(a) = a3 - 5a*2 - 7a - 1. What is q(7)? 48 Let s(i) = -46i2 - i - 1. What is s(-1)? -46 Let u(q) = q3 - 2q*2 + 4q - 4. Determine u(2). 4 Let o(h) = -4h - 4. Determine o(2). -12 Let d(s) = -s2 + 8s + 1. Give d(9). -8 Let x(z) = -5z - 32. Calculate x(11). -87 Let c(h) = -h2 - 4h - 13. Calculate c(-3). -10 Let r(i) = i*2 + 7i + 5. Determine r(-5). -5 Let r(a) = -a*2 + 21a + 23. Give r(24). -49 Let o(a) = a + 7. What is o(7)? 14 Let g(t) = 56t + 5. Determine g(3). 173 Let g(y) = 2y*3 - 9y*2 + 10y + 7. Give g(6). 175 Let i(z) = -z*3 + 4z*2 + z - 2. Calculate i(4). 2 Let f(r) = 81r + 161. Give f(-2). -1 Let c(d) = -8d2 - d - 5. Determine c(4). -137 Let s(k) = 2k*2 - 27k - 11. Calculate s(12). -47 Let l(w) = 10w - 56. Give l(7). 14 Let w(v) = -v3 + 2v*2 + 5. Give w(3). -4 Let s(t) = 25t3 - t2 + 2t - 1. Give s(1). 25 Let y(n) = -n3 - 11n*2 - 11n. Calculate y(-10). 10 Let k(s) = 44s. What is k(-1)? -44 Let t(d) = 4d - 11. Determine t(5). 9 Let k(x) = 14x - 21. Give k(-9). -147 Let l(i) = -2i*3 + 5i - 2. Calculate l(3). -41 Let m(h) = h + 27. Calculate m(-9). 18 Let a(b) = -3b + 9. Calculate a(6). -9 Let n(o) = o3 - 8o2 + 14. Determine n(7). -35 Let q(l) = -l3 - 31l2 + 31l - 25. Determine q(-32). 7 Let q(r) = r*2 - 41r - 49. Give q(42). -7 Let w(h) = -3h3 - 6h*2 - 6h + 2. Calculate w(-2). 14 Let r(t) = -t + 40. Give r(20). 20 Let c(h) = -22h - 20. Calculate c(0). -20 Let w(o) = 12o*3 - o. Calculate w(1). 11 Let v(c) = 12c - 346. Calculate v(29). 2 Let t(f) = 3f + 43. Determine t(-18). -11 Let d(h) = -2h2 - h + 2. What is d(1)? -1 Let i(o) = o2 + 10o + 18. Give i(-8). 2 Let b(a) = a2 + 3a + 1. What is b(-4)? 5 Let w(d) = d*3 - 6d*2 - 4. What is w(4)? -36 Let w(a) = 21a - 257. Calculate w(12). -5 Let q(p) = -p*3 + 6p*2 + 3p - 4. Determine q(6). 14 Let h(k) = -k*2 + 36k + 22. What is h(37)? -15 Let t(y) = y*3 + 7y*2 - 15y - 2. What is t(-9)? -29 Let x(u) = 8u - 1. Determine x(1). 7 Let t(x) = x2 - 3x - 27. What is t(-8)? 61 Let x(q) = -q*2 - 2q + 1. Give x(-5). -14 Let p(a) = -4a - 14. Determine p(-5). 6 Let h(t) = -2t - 27. Give h(0). -27 Let f(a) = 7a + 2. Determine f(1). 9 Let v(t) = -7t*3 + 2t*2 - 2t + 1. Determine v(1). -6 Let n(x) = -4x - 4. Calculate n(-2). 4 Let f(q) = -3q2 - q. Determine f(-1). -2 Let i(t) = -t2 - 8t - 10. Calculate i(-6). 2 Let l(p) = -p3 - 14p*2 + 11p - 56. Calculate l(-15). 4 Let h(m) = 3m + 12. What is h(-5)? -3 Let l(c) = 8c*3 - 2c2 - c + 1. Calculate l(1). 6 Let n(k) = -k3 - k2 + 32. What is n(0)? 32 Let p(q) = -q3 - 10q2 + 11q + 7. What is p(-11)? 7 Let y(i) = i + 23. What is y(-25)? -2 Let o(r) = -r*2 + 9r + 34. What is o(14)? -36 Let i(q) = 7q2 - 3q - 4. Give i(3). 50 Let c(k) = 15k - 30. Determine c(9). 105 Let n(i) = 10i*2 + 6i + 10. Calculate n(-2). 38 Let d(s) = -s*3 - 9s*2 - 10s + 17. Give d(-7). -11 Let u(m) = m*3 - 9m*2 + 10m - 5. Give u(8). 11 Let x(h) = -3h2 - 6h + 10. Determine x(-4). -14 Let w(p) = 2p - 27. Give w(8). -11 Let t(k) = k2 + 15k + 45. What is t(-11)? 1 Let y(t) = t + 11. What is y(-7)? 4 Let z(m) = 3m + 3. Give z(2). 9 Let h(o) = 17o - 8. Calculate h(-2). -42 Let k(h) = -h*2 - 13h - 15. Calculate k(-14). -29 Let r(b) = -b*3 - 6b*2 - 10b - 16. Determine r(-5). 9 Let s(y) = y*3 - 5y*2 + 2y + 4. Calculate s(6). 52 Let g(n) = 7n2 - 2n + 3. Give g(-4). 123 Let f(k) = k*2 + 31k - 1020. Calculate f(-51). 0 Let z(g) = -20g - 5. Calculate z(5). -105 Let l(h) = h2 - 18h - 23. Give l(19). -4 Let z(m) = 5m + 32. Calculate z(-6). 2 Let i(j) = -j - 6. Calculate i(-12). 6 Let r(u) = -u2 - 3u + 1. Calculate r(-2). 3 Let u(z) = -z*3 + 9z*2 - 2z + 15. What is u(8)? 63 Let f(n) = -n*2 - 8n - 10. Give f(-5). 5 Let w(y) = -5y2 + 2y - 2. Calculate w(1). -5 Let s(x) = 12x + 89. Give s(-7). 5 Let o(z) = z2 - 11z + 14. Calculate o(4). -14 Let l(r) = -r*3 + 7r*2 + 10r + 5. What is l(8)? 21 Let n(z) = z*3 + 5z*2 - 7z + 15. Give n(-7). -34 Let c(k) = -k + 13. Calculate c(5). 8 Let c(j) = -j*2 - 4j + 55. What is c(5)? 10 Let q(j) = j*3 + 2j2 - j - 3. Determine q(-3). -9 Let j(t) = -t3 + 5t2 - 18. What is j(4)? -2 Let f(r) = -22r + 4. Determine f(3). -62 Let a(u) = 3u3 - 27u*2 - 4u + 21. Determine a(9). -15 Let f(m) = 3m2 - 1. Calculate f(1). 2 Let m(d) = -2d*2 + 18d - 24. Give m(7). 4 Let i(l) = -6l + 4. Determine i(-6). 40 Let j(b) = -2b*2 - 39b + 11. Give j(-20). -9 Let v(d) = -2d - 5. Give v(-12). 19 Let g(u) = u3 + 11u*2 + 4u + 28. What is g(-11)? -16 Let t(b) = b*3 + 21b*2 - 21b + 33. Give t(-22). 11 Let r(g) = g*3 + 5g*2 - 14g - 1. Determine r(-7). -1 Let k(u) = -6u + 17. What is k(2)? 5 Let t(p) = -p + 38. Determine t(32). 6 Let k(s) = 2s - 3. What is k(7)? 11 Let s(o) = o*2 + 2o + 2. What is s(-7)? 37 Let a(h) = 4h2 - 66h - 24. Calculate a(17). 10 Let q(a) = a*2 + 6a + 9. What is q(-4)? 1 Let t(q) = -q*3 + 5q*2 - 2q - 3. What is t(6)? -51 Let y(f) = -f*3 - 11f*2 - 14f - 47. Determine y(-10). -7 Let a(f) = -21f + 185. Give a(9). -4 Let k(r) = 2r - 1. Give k(-1). -3 Let u(d) = 2d2 - 4. What is u(-3)? 14 Let r(b) = 2b + 6. Give r(0). 6 Let z(a) = -a*3 - 11a*2 - 22a + 15. What is z(-8)? -1 Let f(m) = -m*2 + 36m - 295. Determine f(22). 13 Let b(a) = -a*3 - 24a*2 + 53a + 44. What is b(-26)? 18 Let c(r) = 15r - 2. Determine c(2). 28 Let f(s) = -s2 - 8s - 3. Calculate f(-6). 9 Let g(n) = 4n - 25. Determine g(7). 3 Let d(x) = -15x + 37. Determine d(6). -53 Let z(u) = u*3 + 8u*2 + 5u - 18. Calculate z(-7). -4 Let m(l) = l*3 - 3l*2 - 57l - 4. Calculate m(-6). 14 Let f(q) = -12q + 3. Give f(5). -57 Let z(p) = -157p + 784. Calculate z(5). -1 Let s(h) = -h*3 - 38h*2 - 74h - 83. Determine s(-36). -11 Let t(i) = i*3 + 2i*2 - 11i + 15. What is t(-5)? -5 Let t(k) = k*3 + 7k*2 + 7k + 6. Determine t(-4). 26 Let q(k) = k2 + k + 5. What is q(-5)? 25 Let l(h) = h2 - 5h - 6. Calculate l(-2). 8 Let o(y) = -4y + 4. Give o(2). -4 Let a(g) = -g*3 + 12g*2 - 10g - 11. Determine a(11). 0 Let x(k) = -14k - 41. Calculate x(-3). 1 Let i(d) = d2 + 12d + 3. What is i(-4)? -29 Let m(h) = -h*3 + 11h*2 + 5h - 31. Calculate m(11). 24 Let u(o) = -o*3 - 7o*2 + 2o + 10. Give u(-7). -4 Let s(l) = l*3 + 5l*2 - 11l - 15. Calculate s(-6). 15 Let t(i) = -145*i - 2615. Determine t(-18). -5 Let h(o) = -o	{ "pile_set_name": "DM Mathematics" }
(3b - 2)/5 Let o(h) = h3 - h2 - 9h + 13. Let a be o(3). Let r = 12/47 + 340/141. Suppose 0 + 7/2j*2 + 3/2j + 2/3ja + rj*3 = 0. Calculate j. -3/2, -1, 0 Let 15h + 2h - 3h*3 - 449h*2 + 443h*2 + 7h = 0. What is h? -4, 0, 2 Suppose -z - z = -2p - 8, 0 = -p. Let -4v*3 - 18v*2 - 20 + 6v*z + 12 + 23v + v = 0. What is v? -2, 2/3, 1 Let u = 35633/4 + -8908. What is n in 3/8n2 - 1/8n*4 + 5/8n - 1/8n3 + u = 0? -1, 2 Let x(t) be the third derivative of -t5/180 - 19t*4/72 + 2t*2 + 91t. Find o, given that x(o) = 0. -19, 0 Let m(g) = -6g5 + 6g*4 - 6g*3 - 3g. Let z(n) = -11n5 + 13n*4 - 13n3 + n2 - 5n. Let h(f) = -5m(f) + 3z(f). Factor h(l). -3l*2(l - 1)3 Let h(z) = z3 - 6z2 - 7z + 13. Let u be h(7). Suppose x = ux. Determine j, given that -6/5j*4 + 27/5j*5 + xj + 6/5j2 + 0 - 27/5j3 = 0. -1, 0, 2/9, 1 Let f(c) = -c3 + c - 1. Let h(t) = 6t3 - t3 + 5t*2 + 9t - 9t3 - 15 - t3. Let a(k) = 6f(k) - h(k). Find w, given that a(w) = 0. -3, 1 Let w(a) = a*2 + 1. Let u(m) be the second derivative of 3m5/20 - m3/2 + 3m2 - 17m. Let l(z) = -u(z) + 3w(z). Factor l(p). -3(p - 1)*2(p + 1) Let g = -6416 + 6418. Find j such that 3/8j3 + 0j + 3/2 - 9/8jg = 0. -1, 2 Let p(g) = -4g*2 - 6g + 44 + 3g2 - 51. Let c be p(-3). Determine t, given that -11t*2 - 3t - 17t3 + 2t4 + t4 + 20t3 + 6 + ct2 = 0. -2, -1, 1 Let o(i) be the third derivative of -i7/525 + 11i5/50 + 5i*4/3 + 28i*3/5 - 55i2 - 7. What is r in o(r) = 0? -3, -2, 7 Let y(u) be the third derivative of u7/70 + 3u6/20 + 7u*5/20 - 3u*4/4 - 4u*3 + 10u*2 + 3u. Let y(r) = 0. What is r? -4, -2, -1, 1 Let s be (4 + -7)(-25)/3. Suppose -y - s + 27 = 0. Determine u so that 259 - 5u*2 + 3u*3 + yu*3 - 254 - 5u = 0. -1, 1 Let x(f) be the second derivative of f*5/15 + 7f*4/9 + 16f*3/9 - 32f*2/3 + 23f. Let x(h) = 0. What is h? -4, 1 Suppose 934 = -n + 937. Factor 50vn - 2/5 - 30v*2 + 6v. 2(5v - 1)3/5 Let h(s) = s3 + 77s2 + 2183s + 19687. Let j(t) = -t*3 - 78t*2 - 2184t - 19686. Let w(y) = -3h(y) - 4j(y). Determine m so that w(m) = 0. -27 Let w be -2 + (-2 - -1) + 13. Let n = 12 - w. What is y in 0 - 1/4y - y4 - 3/2y3 - yn - 1/4y5 = 0? -1, 0 Let c = -1/3595 + 43147/25165. Factor -4/7h*2 + 16/7 + ch. -4(h - 4)(h + 1)/7 Let y(s) = -s*3 + 27s*2 - 47s + 25. Let i(q) = q*2 + 1. Let b(u) = -2i(u) + y(u). Find a such that b(a) = 0. 1, 23 Let l be ((-3)/36)/((-300)/224 + 2). Let x = 1022/111 - l. What is c in -4/3c - 12c*3 + 0 - xc*4 - 8/3c*5 - 20/3c*2 = 0? -1, -1/2, 0 Let m = 1322 - 11897/9. Let h(v) be the first derivative of -mv*3 - 1 + 1/6v*2 + 2/3v. Factor h(q). -(q - 2)(q + 1)/3 Suppose 3x = 6 + 3. Let d be (-9)/211 - (-192)/56. Find j such that -j2 - 3 - xj - dj - 6 = 0. -3 Let n(z) be the second derivative of -z7/560 + z6/60 + z5/16 - 5z3/6 + z2/2 - 53z. Let a(j) be the second derivative of n(j). Factor a(m). -3m(m - 5)(m + 1)/2 Let a(i) = 7i2 + 2i + 1. Let b be a(-1). Suppose 3r - br*3 + 7r - 6r + 3r*5 - r = 0. What is r? -1, 0, 1 Let s(u) be the third derivative of -5/3u*3 + 0 + 5/24u*4 + 0u - 16u2 + 1/12u5. Determine y, given that s(y) = 0. -2, 1 Let x(d) = d5 - 61d4 - 6d*3 - 6d*2 - 12. Let s(g) = 10g*5 - 670g*4 - 65g*3 - 65g*2 - 130. Let z(v) = 6s(v) - 65x(v). What is r in z(r) = 0? -11, 0 Let f be (-13)/(-3) - 12/36. Suppose f = 9m - 14. Determine o so that 0 + 2/7o4 + 2/7o*m + 0o + 4/7o3 = 0. -1, 0 Let a(f) be the first derivative of -f5/15 + 7f*4/3 - 98f*3/3 + 17f*2/2 - 13. Let p(d) be the second derivative of a(d). Factor p(l). -4(l - 7)2 Let b(j) be the third derivative of j5/60 - 7j4/24 + j3 - 13j2. Solve b(z) = 0. 1, 6 Let d(x) be the second derivative of x5/150 - x*3/15 + 7x*2/2 - 12x. Let f(s) be the first derivative of d(s). Find t such that f(t) = 0. -1, 1 Let y(m) be the second derivative of 2/7m7 - m3 - 17m - 2m4 + 3/2m*2 - 3/10m*5 + 0 + 7/10m*6. Factor y(c). 3(c - 1)(c + 1)3(4c - 1) Suppose -276h*2 - 6h*5 - 176/3h*4 + 688/3h*3 - 52/3 + 386/3h = 0. What is h? -13, 2/9, 1 Suppose 4c - 35 = -5b - 9, -14 = -3b - 2c. What is z in -2/9z - 2/9z*3 + 0 + 4/9z*b = 0? 0, 1 Let h = -11 + 19. Let v be -4 - (2 - h) - -11. Factor 8/9w - 2/9w*4 - 4/3w*2 - 2/9 + 8/9w*v. -2(w - 1)*4/9 Let y = 19 - 33. Let x be (-35)/1010/y. Let -3/2c + 9/2 - 1/2c*3 - xc2 = 0. Calculate c. -3, 1 Let x(w) be the second derivative of -w5/20 + w*4/4 + 5w*3/3 - 8w + 2. Factor x(n). -n(n - 5)(n + 2) Factor 4/7q2 - 2/7q*3 + 0 - 2/7q. -2q(q - 1)*2/7 Find u such that -9/5u + 0 + 3/5u2 - 3/5u*4 + 9/5u*3 = 0. -1, 0, 1, 3 Factor 14/9g*3 + 0 + 56/9g - 106/9g2. 2g(g - 7)(7g - 4)/9 Let k(g) be the second derivative of -g4/18 + 158g*3/9 - 6241g*2/3 - 54g + 1. Factor k(u). -2(u - 79)2/3 Let w be 0((-2)/10)/(90/(-150)). Factor w + 2p3 + 0p + 1/2p4 + 2p2. p2(p + 2)2/2 Factor -112/3l + 1568 + 2/9l2. 2(l - 84)*2/9 Let -4u*3 + 72 + 104u*2 - 34u*4 - 1505u + 1341u + 26u*4 = 0. Calculate u. -9/2, 1, 2 Suppose -2a + l + 7 = 0, 5 + 4 = 3a - 2l. Let k be 0 + a - 42/18. What is x in -k - 4x + 8/3x*2 + 4x*3 = 0? -1, -2/3, 1 Let v = 17767 - 17765. Solve 0 - 9/2n*4 + 9/2n*v + 15/4n - 3n3 - 3/4n*5 = 0. -5, -1, 0, 1 Let x = 943 + -938. Let f(v) be the second derivative of 0v*2 - 2v - 9/20v4 + 0 + 1/5v*3 + 21/100v*x. Factor f(h). 3h(h - 1)(7h - 2)/5 Let f(j) be the third derivative of j8/112 + j7/35 - j6/5 + 2j2 + 91. Find s such that f(s) = 0. -4, 0, 2 Let b(f) be the first derivative of -f6/2 + 12f4 + 38f*3 + 99f*2/2 + 30f - 32. Factor b(v). -3(v - 5)(v + 1)*3(v + 2) Let k(g) be the second derivative of -g7/840 + g5/40 - g*4/12 + 5g*3/2 + 3g. Let m(n) be the second derivative of k(n). Factor m(w). -(w - 1)*2(w + 2) Let x(d) be the first derivative of -8 + 8/17d2 + 32/17d + 2/51d3. Factor x(g). 2(g + 4)*2/17 Let y = 84 + -71. Suppose -17r = -yr - 12. Factor 2/5q*4 + 0q + 0 - 2/5qr + 0q*2. 2q*3(q - 1)/5 Let b(f) = -17f3 + 150f*2 - 411f + 270. Let o(q) = -48q3 + 450q*2 - 1234q + 810. Let l(z) = 11b(z) - 4o(z). Factor l(w). 5(w - 27)(w - 2)(w - 1) Let t(u) be the third derivative of -u8/60480 - u7/7560 - u6/2160 - 7u*5/60 - 4u2. Let w(j) be the third derivative of t(j). Factor w(d). -(d + 1)2/3 Solve 4b4 + 4b*4 - 7b*4 = 0 for b. 0 Let b(t) be the third derivative of 14t*2 - 1/5t*3 - 1/15t*4 + 0 - 1/150t*5 + 0t. Find s, given that b(s) = 0. -3, -1 Let f = -4 + 11. Factor 4i + 23i*2 + fi*3 + 5i*3 - 3i*2 + 4i. 4i(i + 1)(3i + 2) Suppose 1 - 2 = -r. Let i(j) = -21j2 + 11j*2 + 4 + 5j*2 + 9j*2 + 12j. Let c(l) = l. Let z(v) = ri(v) - 4c(v). Factor z(b). 4(b + 1)2 Let h be (2 - -48/(-12))-3. Let 28r*2 - 4r*3 - 19r*2 - 17r*h + 6r + 6r3 = 0. What is r? 0, 1, 3 Let v(k) be the first derivative of 5k - k*2 + 1/3k*3 - 4. Let o(j) = 2j*2 - 3j + 6. Let x(t) = -4o(t) + 5v(t). Factor x(a). -(a - 1)(3a + 1) Let g(w) be the second derivative of w*6/270 + 2w*5/15 + 11w4/18 + w3/2 + 3w2/2 - 41w. Let y(o) be the second derivative of g(o). Solve y(u) = 0. -11, -1 Suppose -g + 5x = 0, 69g = 66g + 2x. Factor g - 2/5z2 + 0z. -2z2/5 Let 2 - 7r*5 + 9r*3 + 12r*2 - 2 - 20r*4 + 8r*4 + 2r*3 - 4r = 0. What is r? -2, -1, 0, 2/7, 1 Factor -18/11x3 - 30/11x*2 + 0 + 0x. -6x2(3x + 5)/11 Let a = 61 + -46. Let k be 6/a35/21. Find m, given that -m*2 - 1/3m + k = 0. -1, 2/3 Let b(z) be the second derivative of 1/21z4 + 6z - 4/7z2 + 0 + 2/21z*3. Factor b(f). 4(f - 1)(f + 2)/7 Let n be (-48)/287/(-38). What is k in -2/19 - nk2 - 2/19k*3 - 6/19k = 0? -1 Suppose 27/2k + 3/2k*2 + 30 = 0. Calculate k. -5, -4 Let x(t) = -2t*4 + 17t*3 - 13t*2 - 17t + 22. Let d(f) = f*4 - 8f*3 + 6f*2 + 8f - 11. Let i(a) = -7d(a) - 4x(a). Determine s, given that i(s) = 0. -1, 1, 11 Let j(o) be the third derivative of	{ "pile_set_name": "DM Mathematics" }
is o rounded to the nearest one thousand? -58000 Let y = 614.93 - 623. Let q = 2.25 + y. Round q to zero dps. -6 Let m = -10.2 + 34.4. Let o = -4.2 + m. Let r = -20.0000106 + o. Round r to six dps. -0.000011 Let a = 6067092712.20102 + -6066988877. Let n = 103832 - a. Let p = 3.2 + n. Round p to 4 decimal places. -0.001 Suppose 9892188 = -3d + 38l - 41l, 5d - 3l + 16487012 = 0. What is d rounded to the nearest one hundred thousand? -3300000 Let l(z) = 2097z - 839. Let x be l(-14). What is x rounded to the nearest one thousand? -30000 Suppose -16v + 30 = -v. Suppose f + 2u + 0 - 1 = 0, -3f + vu + 11 = 0. Let w be -30(1006/3 - (-3 + f)). What is w rounded to the nearest 1000? -10000 Let k = -87285.572 - -87437. Let m = 16.8 - -134.2. Let w = k - m. Round w to one decimal place. 0.4 Suppose 0 = 4k - 44 + 8. Suppose 44877 = -km - 172923. What is m rounded to the nearest one thousand? -24000 Let r = -17654 + 20041.6. Round r to the nearest one hundred. 2400 Let n = 242.2 + -242.1974628. What is n rounded to 5 dps? 0.00254 Let h(x) = 4269345x - 11. Let j be h(2). Let f = 5891301 + j. Let o be f/(-130) + 4/(-26). Round o to the nearest 10000. -110000 Let b = -7336.47163253 - -7829.5777412. Let c = b + -516.2061077. Let z = -23.1 - c. What is z rounded to six dps? -0.000001 Let n = 530 - 519.88. Let s = n - 0.02. Let d = -10.099998967 + s. Round d to seven dps. 0.000001 Let h = 7242.044 - 7221. Round h to 1 dp. 21 Let q = 12904 + -12903.99983643. What is q rounded to five dps? 0.00016 Let i = -55015 - -55292.41. Round i to the nearest ten. 280 Let j be ((-2976)/(-620))/(22103/22105 - 1). Round j to the nearest one thousand. -53000 Let h(m) = 30074m3 + 2m*2 - 2m + 1. Let a be h(1). Let l = 23580 + -6605. Let t = l - a. What is t rounded to the nearest 1000? -13000 Let o be (-3 - -4)(16 - 1). Let w(v) = 3v - 47. Let r be w(o). Let q be 1 + r + -88986 + -13. What is q rounded to the nearest ten thousand? -90000 Let o = 0.03957 - 103.66957. Round o to the nearest ten. -100 Let h = -7113.233 + 7137. Round h to 1 decimal place. 23.8 Let p = -2833.82 - -2740. Round p to the nearest 10. -90 Let r = 331 - 186. Let j be r/(-58) + (-432010)/(-4). Round j to the nearest ten thousand. 110000 Let m(i) = i3 + i2 + 6i - 8056. Let t be m(0). What is t rounded to the nearest one hundred? -8100 Let t = 192 - 146. Suppose 44g + 2r = tg + 688, g = 2r - 340. Round g to the nearest one hundred. -300 Let k = 2.939 + -2.94911. What is k rounded to four decimal places? -0.0101 Let m(z) = -177601200z + 8175. Let c(a) = 1585725a - 73. Let g(o) = -225c(o) - 2m(o). Let j be g(7). Round j to the nearest 1000000. -11000000 Let r = 12817 - 12817.024273. What is r rounded to four dps? -0.0243 Let m = -90 + -1. Let b = 83.99 + m. Let h = 6.1 + b. Round h to 1 dp. -0.9 Let n = -53.8 - 24.2. Let g = 306 - 223.1. Let s = g + n. Round s to the nearest integer. 5 Suppose -7c + 2343485 = -2c. Suppose -3r = 4m - 2794785, 5m + 7r = 6r + 3493484. Let a = m - c. Round a to the nearest 100000. 200000 Let k = -0.03695 - 0.0931. Round k to 3 decimal places. -0.13 Let c = -962 + 962.2732. Let x = c + -0.2733193. Round x to five dps. -0.00012 Let j = -17135873 + 17137180.0889. Let b = 1307 - j. What is b rounded to two decimal places? -0.09 Suppose -13h - 1151555 = 107625. Round h to the nearest 1000. -97000 Let p(k) = -k - 18. Suppose -g + 119 = -8g. Let i be p(g). Let d be 0 + -135 - (i + 0). Round d to the nearest 10. -130 Let i = 769.0707 + -769. Let f = -7.4193 - i. Round f to the nearest integer. -7 Let p = -2337 + 2501.45. Let b = p + -167. What is b rounded to 1 dp? -2.6 Let h = 0.2286242 - -46.5701358. Let f = -1.20034 - h. Let d = -48 - f. What is d rounded to three decimal places? -0.001 Let d = -21.100001786 - -21.1. What is d rounded to 7 decimal places? -0.0000018 Let b = -15711065 + 15711091.999972. Let k = 37 + -10. Let i = b - k. Round i to six dps. -0.000028 Let q = 40823 - 27303. Suppose -a = q + 5180. Round a to the nearest 1000. -19000 Let g = 0.613 - 0.4. Let j = g - 0.146. Let z = j - 0.0670264. Round z to 6 decimal places. -0.000026 Let r = 5.92 + -5.414. Let b = -0.026 + r. Let z = -0.4800084 + b. Round z to 6 decimal places. -0.000008 Let c be (-72)/27(-106139700)/72. Round c to the nearest one hundred thousand. 3900000 Let f = -173.5 + -772.5. Let b = f + 954.91. What is b rounded to the nearest integer? 9 Let g = -0.091 - -170.091. Let o = 169.232 - g. What is o rounded to 1 decimal place? -0.8 Let q(n) = 92040006n*3 + 5n*2 + 9n + 10. Let d be q(-1). Round d to the nearest one million. -92000000 Let l = -18.6 + 22.84. Let h = 1.42 - l. Round h to one decimal place. -2.8 Let b = -163 - -98. Let g = 56 + b. Let c = g - -9.0003. What is c rounded to three decimal places? 0 Let f = 14.279 - 14.278987015. What is f rounded to six dps? 0.000013 Let u = -47.3 - -49.072. Round u to one decimal place. 1.8 Suppose -145055 + 2066888 = -17x + 68x. Round x to the nearest one hundred. 37700 Let i = 85340160.1 + -85340167.93000509. Let u = -7.83 - i. Round u to seven decimal places. 0.0000051 Suppose 7736 = -72j + 80j. Let l be (8 - (-3)/(-3)) + -2. Suppose lf = c - 963, -4f + 9f + c = -j. Round f to the nearest 10. -190 Let b(j) = -10157j - 3. Let f be b(6). Suppose -7i = -31i + 214680. Let s = f + i. Round s to the nearest ten thousand. -50000 Let n = -40363.3 - -47024. Round n to the nearest one hundred. 6700 Let c = -17512 - -17511.88839. What is c rounded to three decimal places? -0.112 Let u(w) = w*3 - 4w*2 + 2w - 6. Let y be u(4). Let r be 6/(-4)y2096/(-12). Suppose 10l - r = 6l. Round l to the nearest ten. 130 Let f = -309.264 - 0.736. Let h = f + 315.7. What is h rounded to the nearest 10? 10 Let p = -210.861 - -211. Let c = -0.13937 + p. What is c rounded to four dps? -0.0004 Let m = -188803 + 188781.52696. Let v = m - -21.5. Round v to three dps. 0.027 Let a = -1600.173 + 1601. Let c = -0.9273 + a. Round c to three dps. -0.1 Suppose -2j + 30 = 8j. Suppose 0o + 35000 = 2o + 2z, jo = 4z + 52500. Round o to the nearest one thousand. 18000 Let q = 30.675 - 59.25. Round q to 1 dp. -28.6 Let l = 5 - -25. Let z = -26 + l. Let g = 4.16 - z. What is g rounded to 1 decimal place? 0.2 Let g(p) = -4p*2 + 10p - 18. Let o be g(-10). Let c = o - -313. Let u be (-8050)/(3 - c/(-70)). Round u to the nearest ten thousand. -60000 Let s = -27727 + 27727.012309. What is s rounded to 4 dps? 0.0123 Suppose -4a = -5a - 991. Let r = a - -1544. Round r to the nearest 100. 600 Let u = 2.827 + -1398.027. What is u rounded to the nearest one hundred? -1400 Let p = -2475 - -2474.68355. What is p rounded to three decimal places? -0.316 Let c(u) = 11u + 57. Let f be (10 + 9/(-1))/(1/4). Let m be c(f). What is m rounded to the nearest 100? 100 Let y = -52.29 + -0.71. Let b = -52.76 - y. Let o = -0.2504 + b. Round o to 3 dps. -0.01 Suppose 0 = -33b + 59b + 106678. What is b rounded to the nearest one hundred? -4100 Let h = -220962.76594901 + 221089.76595. Let l = h - 127. Round l to 7 dps. 0.000001 Let l = 4317 - 4317.0001532. Round l to five decimal places. -0.00015 Let z(f) = 2f2 + 6f + 1. Let p be z(-5). Let h(a) = -11337a2 - 13a - 12a - 24 + 8a - 2. Let r be h(p). What is r rounded to the nearest one million? -5000000 Let c = -9931 + 10052.58. Round c to 0 decimal places. 122 Let k be (-4 + 5)/((-1)/291629). Let f = 507629 + k. Round f to the nearest 10000. 220000 Let i = 6069 - 6068.74395. What is i rounded to 1 decimal place? 0.3 Let x = -6443211 + 11109513. Suppose -x + 15502 = -14y. What is y rounded to the nearest ten thousand? 330000 Let l(h) = h3 + 17h*2 + 29h - 18. Let o be l(-15). Let d be (o - 8821)/4 + -4. What is d rounded to the nearest one hundred? -2200 Let x = -7121 - -7121.008982. Round x to 4 dps. 0.009 Let g(d) = -1623d. Let n(f) = -11867375f. Let b(s) = 29250g(s) - 4n(s). Let y = -816 + 818. Let k be b(y). Round k to the nearest one thousand. -7000 Let c = -2472.5617 + -1.2383. Round c to the nearest 100. -2500 Let q = 12212.78 + -12491. Let t = q - -276. What is t rounded to one dp? -2.2 Let x be (2 - 188)/(4008/1328 - 3). Round x to the nearest 1000. -10000 Let d = -0.05843 - -5	{ "pile_set_name": "DM Mathematics" }
- 11. Let i(y) = y*2 + 6y - 7. Let k be i(f). Sort k, -3, -1 in decreasing order. k, -1, -3 Let r = 0.76 + -0.96. Sort r, -4/5, 1 in decreasing order. 1, r, -4/5 Suppose 224b + 66 = 221b. Sort b, -5, -2/3 in ascending order. b, -5, -2/3 Suppose g = -5c + 20, -3g - c = -6 + 2. Let u = -22 - -21. Sort -0.5, g, u in descending order. g, -0.5, u Let b = 19 - 22. Put b, -1, 1, -10 in decreasing order. 1, -1, b, -10 Let g be (-1)/12 + 12/(-48). Sort 5, -2/15, g. g, -2/15, 5 Suppose -g = z - 3, -4g = -z - 2z - 5. Sort 2, z, -10. -10, z, 2 Let z = -0.1 + 0.1. Let x = 8 - 6. Let f = x + z. Sort f, -1/9, -2. -2, -1/9, f Let a(u) = -5u2 - u. Let w(l) = -l2 - 5l - 1. Let y be w(-5). Let v be a(y). Suppose 2 = -b - 0b. Put -5, v, b in increasing order. -5, v, b Suppose 5n = 39 - 29. Let v be 3 + -12-1. Sort -3, v, n. -3, n, v Let v = 134/165 - 7/33. Sort v, 0, 1/8. 0, 1/8, v Let h = -3/80 - 13/80. Let i = 7 + -12. Sort i, h, -2. i, -2, h Let u = -34 - -49. Let a = -12 + u. Put -3, -2, a in decreasing order. a, -2, -3 Let b be (8-1)/(6 - 8). Sort b, 2, -4 in increasing order. -4, 2, b Let z be ((-15)/(-6))/534. Let h = z + -12. Put 2, h, -1 in decreasing order. h, 2, -1 Let y = -0.029 + -16.971. Sort 4, -2, y in decreasing order. 4, -2, y Let x = 2 - -4. Let b = x + -5.6. Let h = -12 + 11. Sort 2, b, h in ascending order. h, b, 2 Let n = 1 + 0. Suppose -2 + 3 = l. Let p be (0 + 0)/(1/l). Sort p, 4, n in decreasing order. 4, n, p Let w be (2/(-4))/(1 + -2). Put 4/5, 2/13, w in descending order. 4/5, w, 2/13 Let o(b) = b. Let z be o(-1). Let i = 65 + -453/7. Let p be (1/(-7))/((-4)/4). Sort z, p, i in increasing order. z, p, i Suppose 2h = 37 - 5. Suppose s = 5s - h. Put -4, -3/4, s in descending order. s, -3/4, -4 Let x(u) = u*3 - 6u*2 - 8u + 9. Let g be x(7). Let j(h) = 0h + 2h - 3h. Let y be j(g). Put -5, 5, y in increasing order. -5, y, 5 Let c = -7.5 + -0.5. Let p = -5 - c. Sort 2, p, -4 in decreasing order. p, 2, -4 Suppose 35 = 2v - 3k, 5v - 5k = 65 + 15. Suppose -w + v = 12. Put -1, -3, w in descending order. w, -1, -3 Let j(s) = s2 + 2s - 8. Let f be j(-4). Put -7, 2, -1, f in increasing order. -7, -1, f, 2 Let z be 1 - 1 - (-10)/2. Let u = -2 - -1. Let t be 0(u/(-3) - 0). Put t, z, 0.4 in decreasing order. z, 0.4, t Suppose 3h + 1 + 2 = -3z, -4z - 20 = 0. Put h, -5, 23 in descending order. 23, h, -5 Let c be (-1)/(1(-1)/(-5)). Let g be (10 + -8)(-1)/(-2). Sort c, 0, g in decreasing order. g, 0, c Suppose -t + 8 = -y - 0t, 3t - 12 = -y. Let m = y - -1. Sort 2, m, 5. m, 2, 5 Let d be (-80)/1803/2. Put -3/2, d, -5 in increasing order. -5, -3/2, d Let n be (2/6)/(3/189). Let x = n + -16. Sort x, -3/7, 0. -3/7, 0, x Let f be (-51)/(-15) + (-5 - -2). Let b be (-2)/5 + 32/30. Sort f, -2, b in decreasing order. b, f, -2 Let j = 5 + -2. Suppose jf + m = -10 + 1, 0 = -2m. Put f, 1, 7 in decreasing order. 7, 1, f Let c = -9 - -11. Suppose 0 = -5q + 3 + c, 4u + 3q + 9 = 0. Suppose -3n + 3 = y - 3, -5y = -2n + 4. Sort 4, u, n in increasing order. u, n, 4 Let c = 106/3 - 35. Let f = -6.3 + 6. Put 0.1, f, c in decreasing order. c, 0.1, f Suppose 8 = b - 0b. Let s be b/92 - 2. Sort 4, s, -1/8 in decreasing order. 4, -1/8, s Let c be -3 - (-1 - (-33)/(-15)). Sort c, 4, 0, -1/5 in descending order. 4, c, 0, -1/5 Let v = -39/2 - -583/30. Put -3, v, 4 in decreasing order. 4, v, -3 Let p = -40 - -39. Put 1, 3, 2, p in ascending order. p, 1, 2, 3 Suppose 4m - 73 = -8i + 3i, -2i + 2 = 0. Suppose 0 = -f - 2l - 9, -5l + m = -5f - l. Put 3, -2, f in decreasing order. 3, -2, f Let k(h) = -h - 6. Let b be k(-5). Let c be (b/(-3))/(1/(-3)). Put 2, -3, c in decreasing order. 2, c, -3 Suppose -m - c = 4, c + c + 26 = -5m. Sort 0.2, m, 4. m, 0.2, 4 Suppose -i + 5u - 10 = 12, i - 2u = -7. Suppose 5 - 2 = 4f - 3h, -5f = -ih - 6. Sort 0, 1, f in descending order. f, 1, 0 Let f = -78 - -79. Sort 10, 3, f in decreasing order. 10, 3, f Let t = 0.2 + -4.7. Let l = t + 4. Sort 3, l, -5 in ascending order. -5, l, 3 Let f = -0.4 + 3.4. Let a = -0.04 + -1.96. Let c = a - -2.1. Sort c, 1, f in decreasing order. f, 1, c Suppose 5 = 3r - 4. Let k = r - 5. Let p = -2 - k. Sort p, -2, -4 in increasing order. -4, -2, p Let f = 0.66 + 1.34. Sort -2/19, f, 1 in increasing order. -2/19, 1, f Suppose -3n - u = -4n, -3n = -4u + 2. Let o(l) = l*3 - 8l*2 + 5l + 10. Let a be o(7). Put a, n, 1 in ascending order. a, 1, n Let c = 5 + -5. Let x = c - -4. Let n = 7 - 4. Sort n, x, -1 in increasing order. -1, n, x Suppose -u + 6u = 0. Let j = 19 + -11. Suppose h + 4 = -9t + 4t, -t + j = -2h. Put u, h, 3 in increasing order. h, u, 3 Suppose -5p - 22 = -7. Sort 0.4, 1, 4, p. p, 0.4, 1, 4 Let f = -3.06 - -0.06. Sort f, 4, -21 in descending order. 4, f, -21 Let j = -2881/66 - 15/22. Let a = j - -44. Sort a, 0.3, 4 in decreasing order. 4, 0.3, a Let k = 0.38 - -0.12. Sort -1/3, k, -4. -4, -1/3, k Let n be ((-3 - 5) + 8)/((-1)/1). Sort -1, -2, -4, n. -4, -2, -1, n Let p(v) = v3 + 3v*2 - v + 1. Let g be p(-3). Let m be (-2)/5 + (-21)/35. Let c be m(-1 - -2)1. Put c, 3, g in increasing order. c, 3, g Let i = -3 - -18. Suppose -12 = 3u, -s + 2u + 2u = -i. Suppose -6q + 5d = -3q + 8, -5q + 4 = -4d. Sort s, q, 5 in descending order. 5, q, s Let u be -2((-45)/10 - -3). Put -13, u, 0 in decreasing order. u, 0, -13 Let h = -0.2 + 0.1. Let i = -95 - -95.2. Sort i, 0.03, h. h, 0.03, i Let d(o) = 0 + 0 - 2 - o. Let b be d(2). Sort b, -2, -3 in ascending order. b, -3, -2 Let c = -78 + 57. Sort 3, -3, c in descending order. 3, -3, c Let n be -2(-1)/2 + -6. Let g be 102(-4)/16. Let c(f) = -2f - 12. Let q be c(g). Put q, -4, n in descending order. q, -4, n Suppose 5m = 4m + 5. Suppose -15 = -4k + mj + 20, -2j = 6. Suppose ki - 4s - 31 + 8 = 0, -8 = -4i - 2s. Sort 5, 2, i in ascending order. 2, i, 5 Suppose 0 = -3q - q + 44. Put q, 0, -4, -5 in ascending order. -5, -4, 0, q Let x = -1.6 + 1. Let v = -2.4 + x. Sort v, 6, 2. v, 2, 6 Let m = -3 + 65. Suppose 3y + 28 = -m. Let h be 8/y + 6/9. Sort 5, 1, h in ascending order. h, 1, 5 Suppose 5z = -d + 56, -6z + z + d = -64. Let k be (z/8 + -1)4. Sort k, -0.1, -5 in descending order. k, -0.1, -5 Let q be ((-1)/(-2))/(-3 - (-4 + 2)). Put q, -2, 15 in decreasing order. 15, q, -2 Let v = 3 - 3.2. Let m = 3.8 - v. Let n = 0.06 + 0.34. Sort n, -1/6, m in decreasing order. m, n, -1/6 Let m be ((-9)/(-4))/320. Suppose 0 = -3j - m, -10 = -5r - j - j. Let n = -10 - -11. Put r, n, 5 in decreasing order. 5, r, n Let o = -0.2 + 2.2. Let d = -1611/8 + 201. Let w = -109 - -765/7. Sort o, w, d in increasing order. d, w, o Let i = -5 - -4.5. Sort 0.5, -7, i in ascending order. -7, i, 0.5 Suppose 0 = 3c + 19 + 11. Let h = c + 5. Sort 4, 0.3, h in descending order. 4, 0.3, h Let l = 86.87 - 87. Sort -4, 1/2, -2/9, l in decreasing order. 1/2, l, -2/9, -4 Suppose -3m = -2u - 2, -4m - 2 = -2u - 3m. Suppose p + 0p = -u. Sort p, 1, 5 in increasing order. p, 1, 5 Let k = 158.98 - 157. Let d = 0.02 + k. Let s be -6(2 + (-34)/16). Sort 0, d, s in descending order. d, s, 0 Let s be (-17 - -13)(-3)/(-4). Put s, 2, -5 in descending order. 2, s, -5 Let z = 124 - 124. Suppose 3x = -4o + 3, 3x + o + 0o - 12 = 0. Suppose a = 4l + 1, -xa + 2l - 3l = 16. Sort 3, z, a in decreasing order. 3, z, a Suppose 0 - 4 = -4a. Put -4, a, -6 in descending order. a, -4, -6 Suppose 6u - 3u = 12. Let h(i) = i - 7. Let x be h(u). Sort -1, x, 5 in descending order. 5, -1, x Let h be (-14 + 16)/((-3)/(-2)). Put 4, -0.3, h in increasing order. -0.3, h, 4 Let h be 12/(-56)14/(-4). Let y(v) = v*2 - 5v - 15. Let u be y(8). Put u, 0.4, h in decreasing order. u, h, 0.4 Suppose -2u = 3u - 20. Let v be (u/8)/((-1)/(-92)). Let q be v/10 - (-6)/15. Sort 3, 1, q in descending order. q, 3, 1 Suppose 0 = -3z + 203 - 11. Let y = z + -321/5. Sort y, 2/7, 0.1 in descending order. 2/7, 0.1, y Let b = 2 + -1.7. Let u = 149/228 + 1/76. Sort u, b, 1. b, u, 1 Let l = 102 + -101. Sort 0.1, -2, l in decreasing order. l, 0.1, -2 Suppose 2h + 3v - 14 = 0, 3h - 4v - 8 = -2v. Suppose -3*p = p - h. Let t = -7 - -11. Put p, -2, t in ascending order. -2, p, t Let r = -0.01 - -0.41. Let c = 64 - 59. Let g = -0.2 - -0	{ "pile_set_name": "DM Mathematics" }
) - 11/22. Let d = 5.5 + -5. What is the nearest to m in d, 2, -5? d Let c = 4 + 1. Let w = 2 - 1. What is the closest to 0.06 in 0.4, w, c? 0.4 Let w = -0.088 + -0.912. Let l = -0.2 - -1.2. Let t = l - 0. Which is the closest to w? (a) -1/3 (b) t (c) -0.5 c Suppose -4p = 3d - 2 + 13, -5p - 12 = 2d. Let k = -0.3 + 0.5. Let q = 0.03 - 0.33. Which is the closest to 3? (a) q (b) k (c) d b Let f = -0.18 + 0.11. Let s = -0.03 + f. Let c = -55/6 - -29/3. What is the closest to 0.1 in c, 5, s? s Suppose -3p - 9 = -45. Let m = 10 - p. What is the closest to -2 in 5, 3, m? m Let o = 0.04 - -0.26. Let t = -0.4 + o. Let h = -682 - -680. What is the nearest to -1 in h, -1/8, t? -1/8 Suppose -4b = -2s + 98, 3b - 5s + 65 - 2 = 0. Let l be (1/b)/(45/154). Let z = l + -1/45. What is the nearest to 0 in 3, z, -4? z Let q = 14 - 4. Let z = q - 9.9. Which is the nearest to z? (a) 0 (b) 2 (c) -4 a Let f = -2.5 - -3. Suppose 17k = 15k - 2. Which is the nearest to 0.2? (a) f (b) k (c) -0.4 a Let b = -0.3 + 0.1. Let x = -5 + 10. Suppose 0 = -2d + 3d + x. What is the closest to 0.1 in d, b, 5? b Let y be 13/(-4) + (-2)/(-8). Which is the closest to -2? (a) y (b) -0.2 (c) 0.6 a Let a = -7.4 - -4.4. Let f be (-2)/3 + 26/(-6). What is the closest to 0.04 in a, 0.2, f? 0.2 Let s = -4.1 + 4. Let r(o) = -o3 + 7o*2 - 4o - 7. Let y be r(6). Let a = -2/83 - 73/415. What is the nearest to s in -3, y, a? a Let t be 24/(-24)3. Which is the nearest to t? (a) 2 (b) 2/3 (c) 5 b Let l = 37 + -37.5. What is the nearest to 0.1 in l, 2, -3? l Let u = -10 - -8. Let v = -16.6 + 17. What is the closest to u in -0.1, v, -0.4? -0.4 Let n = 2 + -5. Let l = 1.9 - 2. Suppose -5i = -2j - 0j + 4, 4j - 8 = 4i. Which is the closest to 2/5? (a) l (b) n (c) j a Let o = -52 + 52.3. Which is the nearest to 2? (a) o (b) 2 (c) 0.4 b Let y = 0.1 - -0.2. Which is the closest to -1? (a) 0 (b) 2 (c) y a Suppose -17 = 3g - 2y, 0g + 2g - 2y = -8. Which is the nearest to 4? (a) 2/15 (b) 0.5 (c) g b Suppose 4z + 52 = -4m, z = -3m - z - 37. Let t = m + 10. What is the closest to 1 in t, 0, -3? 0 Suppose -15 = -5w + 15. Let j be -3 - 2/((-4)/w). What is the closest to -0.4 in -1, -5, j? j Suppose -16 + 1 = 5q. Let u = 3.9 + 0.1. What is the nearest to 0 in q, u, 0.5? 0.5 Let w = 2 - 6. Let o = -1/115 + -109/690. What is the nearest to -2 in w, o, -2/5? -2/5 Let p = 133.6 + -134. Let b = 1 - 6. What is the nearest to 3 in b, p, -0.3? -0.3 Let s(o) = o2 - 12o + 14. Let h be s(11). Which is the nearest to 0.1? (a) -4 (b) 2 (c) h b Let r be (3/5)/((-3)/2). Let q = -0.15 - 0.15. What is the closest to r in -4, 4, q? q Let h be ((-1)/3)/(5 - 4). Which is the closest to h? (a) 0.4 (b) 1 (c) 0 c Let c = 0.43 + 0.57. What is the nearest to c in -1, 0.1, 0.5? 0.5 Let j be 26/(-8) - (-5 - -2). Which is the closest to 1/4? (a) 2/9 (b) j (c) 4 a Let l(t) = 6t2 + 2t - t - 13 + 4t2 - t3 + 0t*3. Let o be l(10). What is the closest to -0.1 in 0.4, 5, o? 0.4 Let k = 0.3 + -0.4. Let o = 46 + -55.5. Let w = o - -10. What is the closest to k in -0.4, -0.5, w? -0.4 Let n = -105 + 209/2. What is the closest to n in 2, 1/3, -2/7? -2/7 Let f be (-12)/(-18) + (-878)/(-24). Let n = f + -38. What is the nearest to 1 in 5, n, 1? 1 Let i = -4.82 - 0.18. What is the closest to -2 in i, 4/5, 0.5? 0.5 Let p(x) = -3x*2 + 2x + 2. Let b be p(-1). What is the nearest to b in 1, 4, 0.6? 0.6 Let k = 5 - 5. Which is the closest to k? (a) 0 (b) 3 (c) -2 a Let a = 2.961 - 0.061. Let l = 0.1 + a. Let k = -69 + 205/3. What is the closest to 0 in l, -0.3, k? -0.3 Let w be 2-1 + 140/49. Which is the closest to -2/9? (a) -1 (b) 2/3 (c) w a Let t(c) = -c3 + 2c*2 - c + 1. Let z be t(2). Let n = 10 - 9.9. Let b = 3.8 + -4. What is the closest to n in 2, z, b? b Let j be 4/(-18) + (-124)/(-72). Let r be (0 + 6)(-22)/33. Which is the nearest to j? (a) 0.4 (b) r (c) -0.1 a Let g = -66/7 + 9. Let r = 72 + -218/3. What is the nearest to r in 1, 0, g? g Suppose 3v + 6 = -3d, 0v + 2v + 10 = 0. Let k = 0.25 - 0.35. What is the nearest to k in -2/13, 2/3, d? -2/13 Suppose 0 = -4i + 2i + 6. Suppose id = -4z, z + d = -2d + 9. Let t = 0.7 + 0.3. Which is the closest to t? (a) 3/7 (b) z (c) -0.4 a Let o = -84 - -86. What is the nearest to -2 in o, 3, 2/7? 2/7 Let b = 4 - 3. Let i = -8 - -10. What is the nearest to b in 2/7, i, 3? 2/7 Let z(o) = -o2 + 4o + 2. Let w be z(3). Suppose 5l - 7 = -4x, 0 = l + wx - 14. Let t = -3.2 - -0.2. Which is the nearest to 0.1? (a) l (b) t (c) 0 c Let p be 2/3 - 28/21. Let n be (-9)/(-15) - 2/10. Which is the closest to -1? (a) -3 (b) p (c) n b Suppose 11 - 1 = h - 5r, 2h + r = -2. Let l be 0 - (h - -1)1. Let f = 2.6 + -3. Which is the closest to l? (a) 2 (b) -2 (c) f c Let v = 2.01 + -0.01. Suppose 5m = 6m - 5. Let s = 0.4 + 0.1. What is the nearest to v in s, -0.3, m? s Let i = -335/226 - 2/113. Let j = 12 + -10. What is the closest to j in i, -3/4, 3? 3 Let p = 0.06 - -3.94. Let d = 5 - 4.8. What is the nearest to 1/2 in 3/2, d, p? d Let v = 5 + -1. Which is the closest to 1? (a) -4 (b) -2/9 (c) v b Let g = 129.6 + -130. Let l = 0.8 + -1. Which is the closest to 2? (a) l (b) g (c) -5 a Let v be (-4 + 18/4)(-4)/18. Which is the closest to -2/5? (a) -3/8 (b) -6 (c) v a Let a = 0 + 1.1. Let r = a - 0.9. Let n = -0.06 - 1.94. What is the nearest to 2/3 in -0.1, r, n? r Let i = 144 + -142. Let m be -10(-2 + 56/30). What is the closest to i in m, 2/9, -2? m Let y = -448/1989 + 2/663. Suppose 2w = 3i + 17, -7i + 30 = 5w - 2i. What is the closest to -1 in w, y, -1/4? -1/4 Let z = 22/217 - 12/31. Let x = -1345 + 9392/7. Let c = 55/21 + x. What is the nearest to c in 1, -0.1, z? z Let y(j) = j - 1. Let t(s) = -s + 5. Let i(q) = -t(q) - 4y(q). Let v be i(-1). Let z = 0.52 - 0.32. Which is the nearest to 0? (a) v (b) -5 (c) z c Let t = -5 + 7. Suppose -2z - 4 = tz. Which is the closest to -2/7? (a) -1/5 (b) 0 (c) z a Let z = 0.1 - 0.1. Let w be 8-2(-15)/(-36). Let q = w + 7. What is the nearest to q in 1, -3, z? z Let n be (6/30)/((-3)/(-15)-8). What is the nearest to 5 in n, -3, -4? n Suppose 7 = -4x + 63. Let h be 2/x(-3 + 1). What is the closest to -1 in h, -2, -1? -1 Suppose -2j = -5m - 4j - 18, 0 = -3j - 12. What is the nearest to 0.1 in -0.5, -1, m? -0.5 Let s = -128/3 + 43. Which is the nearest to 2? (a) 7 (b) s (c) 4 b Suppose -i - 3z = -4z - 10, 0 = 3i + 3z - 12. Let f be 7/i - 7/5. Let g(h) = -h + 5. Let v be g(0). What is the closest to f in 1/2, v, -0.5? -0.5 Let z = 0.09 + 0.01. Suppose 0 = c + 5h - 15, -5c + 3c = 3h - 9. What is the nearest to -0.1 in z, -0.1, c? -0.1 Let q = 1384/11 + -126. Let m be 1 - 1 - 6/9. Which is the closest to m? (a) q (b) 0 (c) 3 a Let l = 1.3 + -0.3. Let z = -1.9 - -1.6. Which is the closest to 3? (a) l (b) -1 (c) z a Let i be (-3 - -2)46/(-115). Let y be (-200)/(-132) + 2/(-11). Let h(k) = -k3 - k2 - k - 1. Let t be h(-2). What is the closest to i in y, t, 3? y Let o = 0.28 + 0.02. Let v = 0.2 + -0.1. Let x = v - o. Which is the nearest to 1? (a) -2 (b) x (c) -5 b Let f be (5/(-3))/(4/12). What is the nearest to 2 in -0.1, f, 0.5? 0.5 Let m = 2.2 + -2. Let t = 4.856 - -0.144. What is the nearest to m in t, 3/4, -3? 3/4 Let k = -6.5 + 7. Which is the closest to 2? (a) 3/4 (b) k (c) -0.5 a Let v = 31 + -29. Which is the nearest to -1? (a) 0.5 (b) v (c) 4 a Let l = -22.1 - -19. Let w = -1.1 - l. Which is the nearest to w? (a) -2/19 (b) 0.3 (c) -0.2 b Let z = -61 + 63. Let m = 2 - 6. Which is the closest to 0.2? (a) m (b) 0.1 (c) z b Let l = -1/489 + 995/8313. Let o(m) = -m*3 + 27m*2 - 48m - 48. Let n be o(25). Which is the nearest to n? (a) -0.4 (b) 1 (c) l b Let h = -27/5 - -76/15. Let z be -12(-3)/(-6). Suppose 0 = -2n - 8. What is the closest to z in n, h, -0.5? -0.5 Let j be 1/(-6)(-16)/12. Let l = -1.3 - -0.3. Let w = 1.1 + l. What is the closest to w in -5, j, -1? j Suppose 0y + v = 3y, -2y = 4v + 14. Let g be -1 + y - 88/(-48). What is the nearest to -3/4 in -1, g, 5? -1 Let r = 9 + -8.9. Let f = -4.1 + r. What is the nearest to 1 in f, 2/5, 1/6? 2/5 Let h = -45 + 136/3. Let o =	{ "pile_set_name": "DM Mathematics" }
8. Let c be f(-4). Solve ct = 55 - 59 for t. -1 Let l be 14 + (204/17 - 21). Suppose 0j + 2j - 32 = 0. Solve -c + j = -lc for c. -4 Let s(f) = 4f3 - 10f*2 - 2f - 7. Let t(c) = -5c3 + 10c*2 + 3c + 10. Let o(b) = 4s(b) + 3t(b). Let u be o(0). Solve -18 = -11h + uh for h. 2 Let d(f) = -f*3 + 16f*2 - 11f - 24. Let v be d(14). Let t = -187 + v. Solve t = w + 30 for w. -3 Let l be (-12)/(-5) + (-3)/(-5). Let i be l/(-30)-5(3 + -3). Suppose -o - 2 + 3 = i. Solve 5 = -w + o for w. -4 Suppose 18t + 765 = 13t. Let b = -153 - t. Solve -3n = -b - 6 for n. 2 Suppose -3w + 5s = -17, 5s = 2w + 9s - 26. Solve 3h = -wh - 60 for h. -5 Suppose 32h = -529 + 1105. Solve 99c - 90c - h = 0 for c. 2 Let j(l) = -5l*3 + 110l*2 - 14l + 311. Let r be j(22). Solve -rd = -22d - 133 for d. -7 Suppose -n - 19n = -420. Suppose 69 + 225 = ni. Solve -2q = -iq - 24 for q. -2 Let n = 28 + -28. Let r(c) = -c + 2. Let v be r(2). Suppose 3g - 27 + 9 = v. Solve n = -j + gj - 25 for j. 5 Let d(p) = 44 + 11p - 101 - 47. Let t be d(10). Solve 0 = -tl + 2l + 16 for l. 4 Let u(i) = -i2 - 36i + 41. Let w = 176 - 213. Let a be u(w). Solve -ah + 4 = -4 for h. 2 Let r be 6/8 + 292/16. Suppose -r = -3p + 17. Let n(h) = h*2 - 155h - 960. Let t be n(-6). Solve tk = 2k + p for k. 3 Let r(t) = t*3 - 11t*2 + 27t + 10. Let h be r(7). Suppose hn = 7n - 2d - 140, 3n + 3d = 105. Solve -nj = -29j - 30 for j. 5 Let h(o) = -o3 - 15o*2 + 19o + 48. Let n be -5 + 6 + 1 + -1 + -17. Let m be h(n). Suppose m = z - 1. Solve v - 5 = -z for v. 4 Suppose -53 = -34k + 763. Solve -kq - 16 = 32 for q. -2 Suppose 3c = 2s + 211 + 109, -322 = -3c + 4s. Solve 28j - c - 62 = 0 for j. 6 Let s(r) = r3 + 96r*2 + 138r + 4138. Let g be s(-95). Solve 0 = -gd - 162 + 56 for d. -2 Suppose 213v = 45v. Solve v = 872r - 866r + 30 for r. -5 Let r be 8 + (-918)/117 - (-392)/(-13). Let d be (-96)/r + 6/(-5). Solve -dy = -9y for y. 0 Let t be (-8)/7(-7)/2. Suppose -28 = -2d - 3c, 16c = -td + 12c + 48. Solve -1 - d = 3x for x. -3 Let r be (-50)/7530/(-4). Suppose 4s + 0 + 14 = -2v, v - rs = 0. Let p be (5/v - -2)/((-2)/(-8)). Solve 1 = 5n - pn for n. 1 Let k(c) = c*3 - 13c*2 + 18c - 47. Let f be k(12). Let l(j) = -14j + 362. Let w be l(f). Let a be 2/7 - 38/(-14). Solve -ax - w = x for x. -3 Let n(r) = r*2 + 13 - 611r - 3r2 + 632r. Let o be n(11). Solve -6m - 4 = o for m. -1 Let g = -142 - -147. Let q be (g + 92/(-28))/(3/14). Suppose -3a = -qy + 5y + 12, 2a + 6 = y. Solve 0 = -6s + ys + 4 for s. 1 Let h = -4268 - -4300. Solve -21a + ha - 77 = 0 for a. 7 Let n = 0 + 10. Let m be 4/(-3)(n + -13). Let g = -275 - -282. Solve -gz = -mz + 9 for z. -3 Let m be 12/21 - (-8)/(-28) - (-7458)/14. Solve 533 - m = -y for y. 0 Suppose 446v = 463v. Solve vn + n = -n for n. 0 Suppose p = -4f + 17, 2f - 3p + 7 + 2 = 0. Suppose 0 = -g - 3y + 2y, -12 = -g + 5y. Let o be (g + -3)-3 + 0 - -1. Solve -ov = -v - f for v. 1 Let x = 12 + -7. Let s(w) = w3 + 38w*2 + 353w - 73. Let o be s(-21). Solve x - o = 2i for i. -3 Let y be -2 - ((-117)/3 - 3). Solve -y + 25 = -3h for h. 5 Suppose 275x - 171 = 218x. Solve xk - 25 = 28k for k. -1 Let v be 4/(-18) + (-232)/(-72). Suppose vq + 6p + 17 = 2p, -3p - 16 = -q. Let y be 1 - q - (-20 - -10) - 0. Solve -2f - y = -0f for f. -5 Let s = 7 - 3. Suppose sj = -4q - 4 + 12, 0 = -5j + 2q - 4. Suppose jl = 2l - 16. Solve lr = 4r - 12 for r. -3 Let t be ((-124)/(-12) - 10)0. Let m(u) be the third derivative of -u6/120 + u5/60 - u4/24 + 13u3/6 - u2. Let j be m(t). Solve -3 = -4d + j for d. 4 Let a be (-12)/(-15) - 42/(-10). Suppose 28 = -an + 38. Suppose 0v + 2i = -5v, 4i = 0. Solve -ny + 2 = -vy for y. 1 Suppose 5u + 2c + 197 = -c, 2u + 4c + 76 = 0. Let g be (-12)/(-32) + (-665)/u. Solve -gh + 15h = -6 for h. 3 Let z be 115/35 - -2 - 8/28. Suppose z = 3o - 2v, 3o + 9v = 6v + 15. Solve -6 = ot + 6 for t. -4 Let h be 7/(((-16)/4)/(-8)). Suppose -3s + 4s = -z - 2, 5s - z - h = 0. Solve -28r = -29r + s for r. 2 Suppose 1 = x, 3w = 4w - 5x - 10. Suppose -wb + 10 = -65. Solve 1 - b = s for s. -4 Let v(x) = 0 - 8x - 5 + x - 3 - x*2. Suppose -70 = -4f + 18f. Let i be v(f). Solve -ip = -3p for p. 0 Let s(m) = 13m - 127. Let b(l) = 9l - 71. Let p be b(9). Let r be s(p). Solve -rj - 14 = -8 for j. -2 Let z = -312 + 527. Let k = -210 + z. Solve k = 10p - 25 for p. 3 Let p(w) be the first derivative of w4/4 + 2w*3 + 3w*2/2 - 4w - 1. Let r = -8267 - -8262. Let b be p(r). Solve b = 4a - 10 for a. 4 Suppose 3527 - 3303 = 14a. Solve 8d + 8 = -a for d. -3 Let h(i) be the first derivative of -i3/3 + 3i*2 + 11i + 1. Let v = -205 - -212. Let p be h(v). Solve 6t - 8 = pt for t. 4 Let g = -101 + 177. Suppose -8z + 12z + 5y = 74, -5z + 2y + g = 0. Let a be (-3)/(-2)(-2)/(-1). Solve b - z = -ab for b. 4 Let g be (-476)/(-35) - ((-7)/5 - -1). Suppose -15 = 9u - gu. Let v = 0 + 2. Solve uy - 11 = -v for y. 3 Let r(x) = 2x2 + 667x - 16019. Let z be r(-356). Let l = 41 + -24. Solve l = 6j - z for j. 3 Suppose -22o + 10 = -17o. Suppose 0 = -oh - 42 - 24. Let c = -31 - h. Solve -c - 6 = -2w for w. 4 Suppose 0 = -20y + 18y. Suppose -5b = w - 25, -5w + 45 = -yb + 5b. Let t be (-2)/(b/(-14)) + -2. Solve -3 = j - t for j. 2 Suppose 6 = -x - 4h - 1, -5x = -3h + 12. Let t(w) be the second derivative of w4/12 - w3/2 - 8w2 + 81w. Let r be t(x). Solve -j - rj = 0 for j. 0 Let v(u) = -u3 + 13u*2 - 9u + 24. Let x be v(13). Let h = x + 100. Solve 0 = -hd + 13d for d. 0 Let u be 3(-78)/18-1. Suppose -2a + 2o + 8 = 0, 20 = ua - 11a + 4o. Solve 4v = 2v + a for v. 3 Let a be 166 - ((-24)/(-3) - 4). Let u = 171 - a. Solve ux = 7x - 6 for x. -3 Let j(h) = 125h + 104. Let r be j(5). Let c = 731 - r. Solve 0 = -2z - 10 + c for z. -4 Let j = -4012 - -4156. Solve j = -24g - 0 for g. -6 Suppose 15 = 4t + g, 43 = 3t - 4g + 8. Let n be (-8)/(-168)-7 + 2284/(-6). Let a = n - -383. Solve -tw - 17 + a = 0 for w. -3 Suppose 13 = 5f + 3. Let k = -20 - -14. Let h = f - k. Solve -b + h = 3 for b. 5 Let s(t) = -5t + 1. Suppose 6 - 18 = 3d. Let j be s(d). Suppose -5x + x + 3g = -j, -2g = 2x. Solve -k - 1 = -x for k. 2 Let c be (0/(21))/(3/(44 - 41)). Solve 59y - 62y + 3 = c for y. 1 Suppose 339 = 13m - 16m. Let l = m - -116. Let y be ((-2)/l - 8/6) + 18. Solve j + 3j - y = 0 for j. 4 Let g(m) = -m*2 - m + 2. Let f(u) = 8u*2 + 14u - 22. Let l(h) = f(h) + 12g(h). Let a be l(0). Solve o + a = 5 for o. 3 Suppose 3t = -j - 894, 15t + 1181 = 11t - 5j. Let u = t + 302. Solve -15 + u = -6q for q. 2 Suppose -3j + 92 = -4k, -2j - 60 = 4k + 52. Let n = k + 12. Let i = n + 17. Solve -5z + 2 = -iz for z. 1 Let c be 0 + (-6)/3 - -6. Let k be 33/(-7) + 2 - c/14. Let m = 3 + k. Solve 0 = -4b - mb + 12 for b. 3 Suppose -13p + 2p = -99. Let w(h) = -h*3 - 11 + 8h + 12h + 8 + 28 + 20h*2. Let d be w(21). Solve 0 = da - pa for a. 0 Suppose 5p - 5i - 315 = 0, 4p + 4i - 5i = 249. Suppose 0 = -t + 4h + p, 19t + 256 = 24t - 2h. Solve t = 12l - 2l for l. 5 Suppose -g = -2k - 2000, 0 = -3g + 12g - 3k - 18000. Solve 8o - 1968 = -g for o. -4 Let q be -11 + 18 + -13 + 26. Solve 32z - 28z = q for z. 5 Suppose -172x + 130x = 0. Solve x = 8a - 181 + 173 for a. 1 Let n = 6562 - 6562. Solve -47y - 167 - 21 = n for y. -4 Suppose -3q = 2a - 68, 0 = 42a - 45a - 3q + 108. Solve 3 = 37f - af for f. -1 Let v be (-3)/(-3) - 3/(-1). Suppose vu - 9 - 3 = 0. Let m be (-2 - -2)/(-1 - 1). Solve ub + 0b = m for b. 0 Suppose -2c - 3l - 31 - 31 = 0, 3l - 197 = 5c. Let u = -29 - c. Suppose -2x = 2h - u, 2x + 3h = 3x + 12. Solve -4s + 0 + 12 = x for s. 3 Let l(q) = -5q*3 - 54q*2 + 72q + 52. Let u(b) = -2b3 - 18b*2 + 25b + 17. Let g(r) = -4l(r) + 11u(r). Let j be g(8). Solve -w + 6 = -jw for w. -3 Let u(b) = 8b - 47. Let t be u(8). Solve 23d = 6d - t for d. -1 Suppose 0 = -4k - 5k + 27. Suppose -10 = -0p - 2p, -3x - kp + 21 = 0. Solve x = h - 0 for h. 2 Let k = 234 + -203. Suppose -ku = -29u - 8. Solve -1 = -u*b - 17 for b. -4 Let l(r) = -	{ "pile_set_name": "DM Mathematics" }
denominator of -37/267 and -67/12. 1068 What is the smallest common multiple of 75 and 8295? 41475 Calculate the lowest common multiple of 1064 and 56. 1064 Calculate the common denominator of 94/405 and 11/90. 810 Find the common denominator of -89/48 and -89/88. 528 Find the common denominator of -55/1197 and 121/168. 9576 Find the common denominator of 115/12 and 9/10234. 61404 Calculate the common denominator of -79/2 and 43/3892. 3892 Calculate the smallest common multiple of 24 and 96. 96 Calculate the smallest common multiple of 12 and 7668. 7668 What is the common denominator of -51/8 and 25/114? 456 Calculate the common denominator of -85/24 and -149/210. 840 Calculate the common denominator of -109/132 and -5/66. 132 Find the common denominator of -13/120 and 109/120. 120 Find the common denominator of 53/946 and 95/258. 2838 What is the common denominator of -26/21 and -101/78? 546 Calculate the common denominator of 101/70 and -31/50. 350 What is the lowest common multiple of 230 and 989? 9890 Find the common denominator of 21/1444 and -35/304. 5776 What is the lowest common multiple of 133 and 56? 1064 What is the smallest common multiple of 6 and 42? 42 Calculate the smallest common multiple of 35 and 35. 35 Calculate the smallest common multiple of 36 and 60. 180 What is the least common multiple of 15 and 336? 1680 Calculate the common denominator of 119/3168 and -41/768. 25344 Calculate the smallest common multiple of 7 and 34. 238 Find the common denominator of -34/63 and -29/259. 2331 What is the least common multiple of 594 and 462? 4158 What is the common denominator of -55/48 and -47/12? 48 Calculate the least common multiple of 8 and 22. 88 What is the common denominator of -78/665 and 46/35? 665 Calculate the least common multiple of 1750 and 1050. 5250 What is the common denominator of 9/187 and 38/3? 561 Calculate the common denominator of -17/520 and 97/20. 520 Calculate the common denominator of 71/39 and -61/26. 78 What is the common denominator of 95/256 and -67/192? 768 Calculate the smallest common multiple of 88 and 44. 88 What is the common denominator of -55/3374 and -75/14? 3374 What is the common denominator of -5/158 and 55/3? 474 What is the smallest common multiple of 572 and 260? 2860 What is the common denominator of 65/3 and -167/882? 882 What is the least common multiple of 10 and 540? 540 Find the common denominator of -7/6 and -133/60. 60 Calculate the lowest common multiple of 4674 and 328. 18696 What is the smallest common multiple of 54 and 648? 648 What is the common denominator of -7/15 and 113/138? 690 Calculate the common denominator of 95/12 and 73/93. 372 What is the lowest common multiple of 150 and 942? 23550 What is the common denominator of 69/2 and -21/16720? 16720 Calculate the common denominator of -5/18 and -87/86. 774 Find the common denominator of 82/99 and 157/594. 594 What is the lowest common multiple of 40 and 1004? 10040 Calculate the least common multiple of 306 and 10. 1530 Find the common denominator of -79/63 and -29/9. 63 Calculate the least common multiple of 218 and 80. 8720 Calculate the common denominator of -41/7 and -48/23. 161 What is the least common multiple of 111 and 28? 3108 Calculate the least common multiple of 15 and 4968. 24840 Calculate the common denominator of 32/99 and -58/99. 99 What is the common denominator of -49/53 and 79/106? 106 Calculate the common denominator of -47/132 and -35/1408. 4224 What is the smallest common multiple of 1536 and 36? 4608 Calculate the least common multiple of 160 and 1720. 6880 Calculate the common denominator of -2/3 and -27/10. 30 Find the common denominator of 157/30 and 115/18. 90 Calculate the common denominator of -47/261 and -50/99. 2871 Calculate the common denominator of -167/480 and -139/960. 960 Find the common denominator of 58/111 and 91/148. 444 Calculate the common denominator of 89/736 and 65/92. 736 What is the common denominator of 111/80 and -107/30? 240 Calculate the common denominator of 47/378 and 3/5. 1890 Calculate the smallest common multiple of 566 and 10. 2830 What is the lowest common multiple of 10416 and 16? 10416 Calculate the lowest common multiple of 18 and 360. 360 Find the common denominator of 61/2 and 83/1202. 1202 Calculate the least common multiple of 67 and 4. 268 Calculate the common denominator of -101/136 and -13/51. 408 What is the least common multiple of 84 and 32? 672 What is the common denominator of -28/69 and -34/21? 483 Calculate the lowest common multiple of 66 and 522. 5742 Find the common denominator of 161/1140 and 13/20. 1140 Calculate the smallest common multiple of 109 and 8. 872 Calculate the common denominator of 1/91 and 41/70. 910 Find the common denominator of -109/14 and 11/348. 2436 Calculate the least common multiple of 180 and 828. 4140 What is the common denominator of 55/2 and -73/1720? 1720 Calculate the lowest common multiple of 70 and 30. 210 Calculate the lowest common multiple of 60 and 12. 60 Calculate the least common multiple of 1634 and 215. 8170 Calculate the least common multiple of 39 and 17. 663 Calculate the lowest common multiple of 44 and 12. 132 Calculate the common denominator of 69/16 and -115/468. 1872 What is the common denominator of 11/250 and 91/100? 500 What is the smallest common multiple of 6 and 543? 1086 What is the common denominator of -38/87 and -26/6351? 6351 Calculate the least common multiple of 3276 and 3. 3276 Find the common denominator of 26/49 and -13/35. 245 What is the least common multiple of 891 and 81? 891 Calculate the least common multiple of 6 and 1. 6 Calculate the smallest common multiple of 7119 and 2373. 7119 What is the lowest common multiple of 2512 and 2198? 17584 What is the common denominator of 111/2350 and 8/17625? 35250 Find the common denominator of -36/71 and 37/639. 639 Find the common denominator of 1/354 and -25/4. 708 What is the common denominator of 13/214 and 89/642? 642 What is the smallest common multiple of 240 and 216? 2160 Find the common denominator of 45/2 and 34. 2 What is the common denominator of 4/27 and 7/288? 864 What is the common denominator of 79/626 and 28/3443? 6886 What is the smallest common multiple of 23 and 49? 1127 Calculate the common denominator of -99/14 and -47/514. 3598 What is the least common multiple of 34 and 1? 34 What is the common denominator of -15/8 and 81/80? 80 Find the common denominator of -85/886 and 75/4. 1772 What is the common denominator of -121/30 and 87/430? 1290 Calculate the smallest common multiple of 94 and 16. 752 Find the common denominator of -55/7 and 56/57. 399 Find the common denominator of 85/984 and 53/66. 10824 Calculate the lowest common multiple of 171 and 2. 342 Calculate the lowest common multiple of 22 and 121. 242 Calculate the least common multiple of 42 and 21. 42 Calculate the smallest common multiple of 24 and 676. 4056 Find the common denominator of -1/684 and 151/12. 684 What is the lowest common multiple of 21 and 1458? 10206 What is the least common multiple of 32 and 44? 352 Calculate the smallest common multiple of 16 and 776. 1552 What is the least common multiple of 3717 and 1239? 3717 What is the smallest common multiple of 1068 and 81? 28836 What is the common denominator of -49/139 and 61/3475? 3475 Calculate the common denominator of 67/24 and -85/6. 24 What is the least common multiple of 30 and 3? 30 What is the smallest common multiple of 24 and 132? 264 Calculate the common denominator of 71/292 and -81/4. 292 Calculate the least common multiple of 98 and 126. 882 Calculate the common denominator of -67/8 and -57/56. 56 Calculate the smallest common multiple of 6 and 262. 786 Calculate the smallest common multiple of 484 and 2420. 2420 Find the common denominator of 19/216 and -29/18. 216 What is the smallest common multiple of 228 and 76? 228 Calculate the smallest common multiple of 48 and 6. 48 What is the least common multiple of 440 and 550? 2200 Calculate the common denominator of -25/81 and -43/15. 405 Find the common denominator of -17/1387 and -83/8. 11096 What is the common denominator of -62/123 and -65/4? 492 Calculate the smallest common multiple of 181 and 15. 2715 Calculate t	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.