Datasets:

timaeus
/

pile-dm_mathematics

Dataset card Data Studio Files Files and versions Community

Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
Is 13 a factor of 1-3(z + -6 + -3)? True Suppose 0 = -5g - 5v + 85, 4g = 5v - 16 + 48. Let f be (3/(-2))/(g/(-3588)). Does 3 divide (-1)/(-5) - f/(-30)? False Let x(u) = 3u2 + 2u - 36. Let p(k) = -2k2 - k + 24. Let c(f) = 7p(f) + 5x(f). Does 4 divide c(-8)? True Let g = -61 + 374. Is g a multiple of 5? False Let r be 24 + (0 + 3 - 6). Let x be ((-12)/r)/((-4)/14). Suppose xn + j - 39 = 0, -2j + 0j = -3n + 41. Is n a multiple of 3? False Let c = -79 + 144. Let s = c + -40. Is 8 a factor of s + (1 - -2) + 1? False Let a be 18/(-10) + 2/(-10). Let z = 34 + -66. Let n = a - z. Is 14 a factor of n? False Let a(n) = n2 - n - 3. Let y be a(-4). Suppose 7 = 2k - y. Does 4 divide k? True Does 12 divide 6433/21 + -1 + (-2)/(-3)? False Suppose 0d = -2d + 2s + 12, 6 = -d - 5s. Suppose -p + 15 = 4j, 0 = -dp + 2p + 2j. Suppose -pn + 4n - 24 = 0. Does 8 divide n? True Suppose -2s = 5r - 7, 0s + 2s - 1 = -3r. Does 27 divide r/(9/429 - 0)? False Let n = -48 - -48. Suppose 4o + 4 = 6o. Suppose -ot = -n - 76. Does 10 divide t? False Let z(d) = d*3 + 35d*2 + 51d + 67. Does 23 divide z(-33)? False Suppose 3 = 3u - 9. Let i(v) = -v2 + 5v. Let d be i(u). Suppose x = 19 - d. Is 15 a factor of x? True Suppose 9i = 16i - 525. Is i a multiple of 8? False Let g = -69 - -37. Is g/(-3) + 6/(-9) a multiple of 6? False Let d be 1 - 5 - (9 - 7). Is 14 a factor of (15/d)/(5/(-140))? True Let d = -13 + 17. Let n be (-3)/d + 622/8. Let o = n + -52. Is o a multiple of 6? False Let j(o) = -o3 + o2 - 46. Let m be j(0). Let q be (-1 - m/6)-9. Does 12 divide (-1 - 0)q/5? True Let i(x) be the first derivative of x*5/8 + 8x*3/3 - 8. Let c(r) be the third derivative of i(r). Is c(6) a multiple of 21? False Suppose 5a + 2n - 50 = -n, -2n = 0. Suppose -4d - 1920 = -ad. Does 13 divide d? False Suppose 0u - 5u + 5h + 5 = 0, 5h + 2 = 4u. Suppose 4k - 5 = u. Suppose -5f + 90 = -5a, -60 = -2f - kf + a. Is f a multiple of 3? False Let n = 204 + 11. Does 26 divide n? False Let t be -3 + (-23)/(-3) + 8/(-12). Suppose -tz = -2n + 116, -n = 5z + 8 - 59. Is n a multiple of 16? False Let g = 2511 + -2043. Is 30 a factor of g? False Does 9 divide 2/((38/(-18) - -2)/(-3))? True Let s = 145 - -23. Is s a multiple of 28? True Let i(a) = -4a - 18. Let p be i(-7). Let g be (12/(-8))/((-1)/p). Is g - (5 + 3 + -6) a multiple of 2? False Is 10 a factor of 22/((-8)/(-362))? False Let u = -15 + 19. Suppose 184 = 4v - 4o, -uv = o - 2o - 190. Is 6 a factor of (v/28)/((-4)/(-42))? True Suppose -14t = -4t - 20. Suppose 0l = tl + 3h - 146, -2l + 5h + 146 = 0. Is 14 a factor of l? False Let v be 0/(1 - 0) + 3. Let y be (-6 + -2)/(-2 - -1). Suppose 0 = -g - s + 1 + y, vs = 0. Does 9 divide g? True Let p be 34/10 - 36/45. Does 6 divide ((p - 3) + 33)/1? False Suppose 3s - 13 = 17. Is (-738)/(-8) - s/40 a multiple of 23? True Let h(p) = 27p*2 - 34p + 236. Does 74 divide h(6)? False Let n(c) = 9c2 + 123c + 42. Is 58 a factor of n(-28)? True Let n(s) be the second derivative of s*5/20 + 5s*4/6 - 7s*3/6 - 3s*2/2 - 4s. Does 15 divide n(-10)? False Is 615 + (30/(-9) - 17/(-51)) a multiple of 8? False Suppose -5v = -5s - 105, 3s = 2s. Suppose -v = 6z - 51. Suppose 4j - 6b = -4b + 86, zj - 112 = 4b. Is 20 a factor of j? True Suppose 2q - 4s = 60, 2q - 40 = -3s + 2s. Suppose -qm + 6m = -3808. Is 32 a factor of m? False Suppose -5d = 5q, 5q = -4d - 0 - 2. Suppose 32 = 2c - d. Is c a multiple of 13? False Suppose -m + 24 = 4g, m - 6 + 27 = 5g. Suppose 5x - 221 = -mb + 5b, b = -3x + 139. Is 9 a factor of x? True Let s be ((-21)/(-12) - 1)/((-5)/(-320)). Suppose 4k - 2 - 6 = 0. Does 14 divide 1 - (-1 - s) - k? False Let g = 667 - 386. Is g a multiple of 14? False Suppose -205 - 213 = -11h. Does 9 divide h? False Let a(o) = -7o - 17. Let p be a(-7). Let m = 31 + 76. Suppose 2j = -w + p, -2j = -3w + 3j + m. Is w a multiple of 7? False Suppose 5f = -z + 11607, -4f = -0f - 5z - 9274. Is f a multiple of 18? False Suppose -4m - 11 = -3q, -4q + 4m = 1 - 21. Let u be (-2)/(-3) - 7/(-3). Let r = q - u. Is 4 a factor of r? False Suppose 4d - 24 = 364. Let u = -62 + d. Is u a multiple of 7? True Let f(v) = -v*2 + 7v - 3. Let a be f(6). Let t(s) = s3 + s2 - 4s + 1 - s + s. Is 13 a factor of t(a)? False Suppose 7 = 4v - 109. Let b = 190 - v. Is 15 a factor of b? False Suppose 0 = 7o - o - 18. Suppose 2g + 3g + 5 = 4u, 30 = 5g + ou. Suppose 77 = 5q + 3i, 5q - gi + 0i - 83 = 0. Does 12 divide q? False Let y be (-1 + 0/1)-3. Let n(f) = 3 + 2f - 7fy + f2 + f*2 - 2. Is n(-1) a multiple of 8? True Is 2 a factor of (9/(-18))/((-4)/224)? True Let x = -6 + 11. Is 9 a factor of (-3)/x + (12306/(-30))/(-7)? False Let u = -628 + 1069. Is 21 a factor of u? True Suppose -d = 2o + 3d - 40, -62 = -3o - 4d. Is o even? True Suppose -7h = 2h - 162. Let v = 1 - 1. Is 8 a factor of (v - -1) + 4 + h? False Is 3329/4 + (477/(-36) - -13) a multiple of 26? True Let w be ((-6)/18)/((-1)/6). Let p = w + -6. Let o(i) = -4i + 5. Is o(p) a multiple of 9? False Suppose -5q - 4x + 3x = -4732, 2q - 5x = 1882. Does 43 divide q? True Suppose 10g - 50 = 8g. Is 4 + (3 - 2) + g a multiple of 5? True Let v = 4153 - 1807. Is v a multiple of 22? False Suppose 0 = 5s - s. Suppose -5a + 0a - 20 = s. Let i = 20 - a. Is 19 a factor of i? False Let c(q) be the first derivative of q3/3 - q2/2 + 51q + 3. Let o = -2 + 2. Is 15 a factor of c(o)? False Suppose -15f - 9f + 2376 = 0. Is f a multiple of 11? True Suppose -2d - 56 + 248 = 0. Does 6 divide d? True Let o(t) = -4t - 4. Let m be o(-2). Suppose -mb = b - 210. Is 21 a factor of b? True Suppose 13 - 167 = -7c. Suppose 20v - cv = -28. Is 7 a factor of v? True Let m = 6 + -11. Let u = m + 10. Let l(n) = n2 - n + 9. Is 26 a factor of l(u)? False Let h = 34 + 32. Let a = -23 + h. Let y = -31 + a. Is 4 a factor of y? True Let a(d) = -d + 2d*2 + 2d*2 - 21d*3 - 4d*2. Does 11 divide a(-1)? True Suppose 2j = -j + 1350. Suppose 6s - j = 4s. Is s a multiple of 45? True Let o = -143 - -146. Suppose -5h + 7h - 39 = on, 0 = -3h + 4n + 56. Is h a multiple of 6? True Let l(u) = 11u + 37. Is l(3) a multiple of 2? True Let t = -238 - -623. Does 23 divide t? False Let s(b) = 8b2 - 4b*2 + 3b - 5b2 + 12. Let r = -18 - -18. Does 6 divide s(r)? True Let n(j) = j + 48. Suppose 0 = g + 4c - 41, c + 42 = 2g - c. Is 5 a factor of n(g)? False Let s be (-1 - 2)8/(-6). Suppose 0d + 120 = sd. Is d a multiple of 5? True Suppose 3y = 229 + 29. Let b = -147 + y. Let z = -13 - b. Is 16 a factor of z? True Let i be (24/(-9))/((-4)/12). Suppose -5x = -x - i. Suppose 124 = 4c - 5s, -3c + 30 = -xc - s. Is c a multiple of 6? False Suppose 0 = 2q - 5s - 7 - 9, 4q - 32 = s. Let h = q - 6. Suppose hm - 92 = -2z, -4z - 267 - 8 = -5m. Is 17 a factor of m? True Suppose 23 = 5z - 17. Suppose 392 = -r + zr. Is 28 a factor of r? True Suppose 0 = 5b + 283 + 277. Let q = -32 + 33. Is (-2)/(q - (-116)/b) a multiple of 28? True Suppose -177 = -135a + 132a. Does 59 divide a? True Suppose -3g = 3g - 24. Let b(z) = z - 1. Let u be b(g). Suppose uj - 24 = -3j. Does 2 divide j? True Let d = 131 - -144. Does 39 divide d? False Suppose -3p = a - 28, 4p = 3p - 5a + 28. Suppose -9o + po + 182 = 0. Is 8 a factor of o? False Let t(d) be the first derivative of -d*3/3 + 7d*2 + 11d + 2. Does 17 divide t(10)? True Let d(c) = c*3 + 16c*2 - c - 2. Suppose 1 = 3s + 10. Let o be (3 + -6)/(s/(-16)). Is d(o) a multiple of 4? False Let r(b) = 221 - 10b + 3b - 15b - 238. Does 34 divide r(-4)? False Let t(u) = u2 + 6u + 1. Let o be t(-7). Suppose 0 = -5m - 0m + 135. Let f = o + m. Is 11 a factor of f? False Let u = 15 - 12. Suppose -4y + up = -471, -5y = 2p - 4p - 594. Suppose 0 = -5l, 0 = 4a + 2l + 2l - y. Does 10 divide a? True Let u(k) = 221k*2 + k + 1. Let r be u(1). Let j = 371 - r. Is j a multiple of 24? False Let r be (1 + -4)(-10)/(-6). Is (-4 - 45/r) + 3 a multiple of 8? True Suppose -2w = -5w + 18. Suppose -5d = a - 2, -3d = 5a - wd - 10. Suppose aq - 48 = 24. Does 9 divide q? True Let u(v) = -v*2 +	{ "pile_set_name": "DM Mathematics" }
e of 61ln*3 + 2l + 3n3 + 227n wrt n. 366ln + 18n What is the derivative of -2829h*2y*3 + 1063h*2 wrt y? -8487h*2y*2 Find the third derivative of -478s5 - s2 + 81 wrt s. -28680s2 Find the second derivative of 3o*3 - 5o*2 - 2o - 2. 18o - 10 Find the second derivative of -3x*2 - 2x - 490 wrt x. -6 Find the third derivative of 544f4 + 2f*2 - 612. 13056f What is the third derivative of -27u2y*3 + 14u*2y*2 - 5uy4 + 2uy2 wrt y? -162u*2 - 120uy What is the second derivative of 3068c*2n + 271c + 7n wrt c? 6136n What is the second derivative of 1249dz4 - dz - d + 2z4 - 6z + 144 wrt z? 14988dz*2 + 24z*2 Find the second derivative of -34h*2mp2 - h2mp - 2h - 2mp*2 - mp + m wrt p. -68h2m - 4m Find the third derivative of 141a5 + a3 + 726a2. 8460a*2 + 6 Find the third derivative of -290a*4q - 3a4 - 12a*2q - 37q wrt a. -6960aq - 72a What is the second derivative of -2u2y + 56u2 + 646uy - y wrt u? -4y + 112 Find the first derivative of -5j2n - 273j2 + n + 371 wrt j. -10jn - 546j What is the second derivative of -1013c3y + 2c3 - 4cy - 27y + 6 wrt c? -6078cy + 12c Find the third derivative of -968m*3s*3 - 29097m*2s*3 wrt m. -5808s*3 Differentiate -178k*3 - 3k - 1435. -534k2 - 3 What is the first derivative of -31b - 364? -31 Find the third derivative of 36i6 + 3i*5r + 147i2r - 2ir + 2r wrt i. 4320i*3 + 180i*2r What is the second derivative of -8475p2y*2 + 22p*2y - 8py - 13p - 2y*2 wrt y? -16950p*2 - 4 Find the third derivative of -93m*4 - 15m*3 - 70m*2 + 39m - 2 wrt m. -2232m - 90 What is the derivative of a2cz2 + a2cz - 176a*2z - 3cz*2 + 3cz - 67c wrt a? 2acz2 + 2acz - 352az What is the first derivative of 3j2np - 21jn2 - jp*2 + 3n*2p*2 + 1106n*2 wrt j? 6jnp - 21n2 - p2 What is the third derivative of -is*3 + is + 8i - 223s*4 - 3s*2 wrt s? -6i - 5352s What is the third derivative of -1317a*3 + 54a*2 - 4a? -7902 What is the derivative of 8i2m - 2i2z*2 - 7im2 - 13imz*2 - 2im - 3m*2z wrt z? -4i2z - 26imz - 3m*2 Find the third derivative of 2qrw*4 + 14qrw*3 + 15qrw + qr + 2qw4 + 2w*2 wrt w. 48qrw + 84qr + 48qw What is the third derivative of 3ly*5 + ly*4 - 14ly2 - 11ly + 6y5 + y2 wrt y? 180ly*2 + 24ly + 360y*2 What is the third derivative of -2d*4q3 - d3qy - 32d3wy - 2d*2q*3y + 8d2q2 - d2wy - q*3w + 3q wrt d? -48dq3 - 6qy - 192wy What is the third derivative of 644m*3 + 62m*2 - 1? 3864 Find the second derivative of 2x*4 - 386x*3 - x + 131 wrt x. 24x*2 - 2316x What is the second derivative of 7b5 + 40b*2z - bz + 130b - 4z wrt b? 140b*3 + 80z What is the second derivative of fk3l*2 + 2fk2l*2 + 4fkl + 2fku3 - 3flu*2 + 3k*3lu2 - 2k*3u*3 - 2kl2u*3 wrt l? 2fk3 + 4fk2 - 4ku3 What is the third derivative of 940z*6 - 901z*2 - 2 wrt z? 112800z*3 What is the third derivative of -124dx5 + 2dx3 - 2dx - 3d + 3x2 wrt x? -7440dx2 + 12d Find the third derivative of 2o3ps + 5o*3s*2 - 35o*3s - o*2ps - 2o*2s*2 + 9o*2 - 5ps2 wrt o. 12ps + 30s*2 - 210s Differentiate -234d2f*2s + d*2f + 5df*2 + 35f*2s - 2f2 - fs - 20s wrt d. -468df2s + 2df + 5f2 What is the second derivative of -5002i*5 + i + 416 wrt i? -100040i*3 Find the third derivative of -41x6 - x3 - 407x2 wrt x. -4920x*3 - 6 Find the second derivative of -877v*2y - 392vy + 5y wrt v. -1754y Find the first derivative of 1183l2p + 1561l2 wrt p. 1183l*2 Find the second derivative of 409a*2g + 3ag - 2a + 4g wrt a. 818g What is the second derivative of 9tu5 - tu*3 - 4tu - 5u*4 + 6u wrt u? 180tu*3 - 6tu - 60u*2 What is the second derivative of 20fl3 - 2fl2 + 2fl - 2l*3 + 54l wrt l? 120fl - 4f - 12l What is the second derivative of 3f3i*2n*2 + 2f*3in - 7f*3 - 159f*2i*2n*2 + fin2 - 4i wrt i? 6f3n*2 - 318f*2n*2 Find the third derivative of 7b*3u - 5b3 + 3b*2u - bu - 5u wrt b. 42u - 30 What is the second derivative of -13b5 + b4 - 331b? -260b*3 + 12b*2 Find the third derivative of 6d*5s*3 + 5d*4s*3 + 5d*2s*3 + 12d*2 wrt d. 360d*2s*3 + 120ds3 What is the second derivative of -2081o3 - o2 - 18o - 39? -12486o - 2 Find the third derivative of 3y4 - 93y*3 + 111y*2 + 10. 72y - 558 Find the second derivative of 656x3 - 120x + 3 wrt x. 3936x Find the third derivative of -2695z*4 + 24z*2 - 84z wrt z. -64680z Find the second derivative of 2s*3y*2 - 283s*3y + 3s3 - 3sy2 - 300s wrt s. 12sy*2 - 1698sy + 18s Find the third derivative of -1052y4z*3 - 118y*2z*3 - 7z*3 wrt y. -25248yz3 Find the second derivative of 122q*4 + 4q3 - q2 + 7089q + 2. 1464q*2 + 24q - 2 What is the first derivative of 2am*2 - 13av + 4m*2v + 8mv + 6 wrt m? 4am + 8mv + 8v What is the second derivative of c5 - 103c*4 - 2c wrt c? 20c3 - 1236c*2 What is the second derivative of 399c*3v + 2c3 - c2v*2 + 114cv2 - 3cv wrt c? 2394cv + 12c - 2v2 What is the second derivative of -5829x*2y*3 + 1700xy + y3 wrt x? -11658y*3 Differentiate 123g*2 + 2gn3 + 805n*3 with respect to g. 246g + 2n3 What is the derivative of -26mz2 + 3m + 8z2 wrt m? -26z*2 + 3 What is the first derivative of 129f*3 + 3f*2 - 9620? 387f*2 + 6f Find the first derivative of 3j2n*2 + 137j*2nu + j2n + jn2u - 19jn - 2u wrt u. 137j*2n + jn2 - 2 What is the third derivative of 2i*6 + 28i*5 + 41i*2 - 17i wrt i? 240i3 + 1680i*2 What is the second derivative of 252b*3j*2 - 2b*3j + b*2jn + b2j - 9b2n - 2bj*2n wrt j? 504b3 - 4bn What is the third derivative of -t5 - 64t*3 + 293t*2? -60t*2 - 384 What is the first derivative of 30362a*2 + 16066? 60724a Find the second derivative of -1068t5 + 2t*2 - 6610t. -21360t3 + 4 What is the second derivative of -4a*5 - 3a*4 + 66a*2 + 96a + 15? -80a3 - 36a*2 + 132 What is the derivative of -18an3 - 12an - 2n*3 + 464n wrt a? -18n3 - 12n What is the third derivative of -3ak*3x*3 + 2ak3x*2 + 58ax - 24k*3x*3 - 2k*3x*2 - 2kx3 + x wrt x? -18ak3 - 144k*3 - 12k Differentiate 2i2 - 155i + 46 with respect to i. 4i - 155 Find the first derivative of -11aq2z - 2aqz - 3az - q4z - 207z wrt q. -22aqz - 2az - 4q3z What is the derivative of -322y3 + 242? -966y*2 Find the second derivative of -2277l*3 - 395l - 4. -13662l What is the third derivative of -43d*6 - 4372d*2? -5160d*3 What is the third derivative of 56cm4 - 26cm3 + 10216cm2 - 1 wrt m? 1344cm - 156c Differentiate 2c2y + 194c2 - y - 741 with respect to c. 4cy + 388c Find the first derivative of 552q3r*2v + 2q3 + 3q*2r*3v + 2784r3 wrt v. 552q*3r*2 + 3q*2r*3 What is the first derivative of 9222j*3o + 15882o wrt j? 27666j*2o What is the third derivative of 894m5 + 2m*2 - 6982m? 53640m2 What is the second derivative of -19130jw3 - jw - 1083w + 2 wrt w? -114780jw Find the third derivative of -2947c*3 + 4c*2 - 85c wrt c. -17682 Find the third derivative of -57u5 - 2u*3 - 124u*2 wrt u. -3420u*2 - 12 Differentiate -2b*4n - 825b2n*2 + 18n*2 + 6 with respect to b. -8b*3n - 1650bn*2 Find the second derivative of 635gu2 + g + u + 7 wrt u. 1270g Find the second derivative of 8f2i3 - f2i2 + 5f*2 + 9fi3 - 30fi + i wrt i. 48f*2i - 2f2 + 54fi What is the derivative of 55d*4n*2 - 3d*2n*3 - 2n*3 - 64n wrt d? 220d3n*2 - 6dn3 What is the second derivative of -6b*4cg - 3b*3cg - 153bcg wrt b? -72b2cg - 18bcg What is the third derivative of 9u6 + 33u*3 + 7u**2 - 48	{ "pile_set_name": "DM Mathematics" }
j - 4v + 5 = -3v for j. 4 Suppose 0 = -4s - 3 - 1. Let g = 2 - s. Suppose -2i + 38 + 2 = 0. Solve 2d + gd - i = m, d + 5m - 4 = 0 for d. 4 Suppose -o + 8 = -2k, 3o - 2o = 3k + 12. Suppose o - 4 = -u. Solve 2y = 3y + 5j - 25, uy - 4j = -20 for y. 0 Suppose 5s + 0s - 15 = 0. Suppose -45 = -2k - sk. Suppose -3v - k = -4o, -4v + 9 - 20 = -5o. Solve 5n + oc + 25 = 0, 0 = n + 3c + 5 for n. -5 Let u = 28 - 5. Suppose -5m = -4c, -4c + c - 2m + u = 0. Solve -6g = v - 2g - 7, cv + 3g = -16 for v. -5 Let x(g) = -5g - 1. Let u be x(-1). Suppose 0 = -v + 2y - 8, 2v + uy = v + 16. Solve -5l + 0i - 3i - 5 = v, -4l = 5i + 17 for l. 2 Let t = 3 + -2. Let s(g) = 28g3 - g2 + 2g - 1. Let z be s(t). Suppose 0 = -0k + 2k - z. Solve -k + 2 = -5c - 3p, c - 4p = 7 for c. 3 Let a(m) = m3 - 6m*2 + 3m + 12. Let s be a(5). Solve 0 = -5c - 15, 5r - sc + 0c - 6 = 0 for r. 0 Let b = -15 + 15. Solve 5c - 21 = -3q, b = q + c + 2c - 11 for q. 2 Let l = -1 - 3. Let b be (l/6)/(1/(-6)). Solve -h - 2j = 2j + 5, -5j - 1 = -bh for h. -1 Suppose 5b - 13 = 3d, 5d = 3b + d - 10. Suppose 2 = -2w + 8. Let f(j) = 3j - 7. Let o be f(6). Solve -g + bp - o = 0, 0 = 5g + wp - 8p + 40 for g. -5 Let v(w) = -15w. Let o be v(-1). Solve -4p - h = -2h + o, -2h - 35 = 5p for p. -5 Let z be 6 + -6 - (-16 + -1). Let n = -15 + z. Solve 5h + 0h = m + 24, 4h - nm - 18 = 0 for h. 5 Suppose -2p = -2r - 4, -46 = -3r + 6r + 5p. Let k = 12 + r. Let a = k + -3. Solve 0 = av + 5t - 11, -3v + 2t + 8 = t for v. 3 Let i(b) = -b3 - 4b*2 + 2b - 12. Let a be i(-5). Solve 0 = 4h + an + 31, -h + 0 + 1 = -n for h. -4 Suppose 0 = 4u + 20, -4u - 26 = 2s - 4s. Solve 0l - 1 = -l - sr, 4r + 1 = l for l. 1 Suppose f - 1 + 0 = 0. Let m = -1 + f. Solve 5v - 2i = 20, -i + mi - 9 = -2v for v. 2 Suppose 5r = -90 + 100. Solve 2d + r = j - 3, -3j = 4d + 35 for j. -5 Let a be 0/(5 - 1)-1. Suppose a = k - 3 + 1. Solve ko + 0 = g + 8, 0 = -g for o. 4 Suppose 0 = 2v - 4f - 24, 0 = -v + 2v + f. Solve 0r = 3w - r - 20, -2w + 30 = -vr for w. 5 Suppose -3k - k - 2h + 10 = 0, -5h - 17 = -4k. Suppose m = km. Let i be 6 + (1 - m)-2. Solve iw - 32 = -7v + 2v, 7 = -2v + 5w for v. 4 Suppose 12 = -10h + 13h. Suppose 2f - 14 = -4z, 12 = -0z - 3z. Suppose 2i - f = -1. Solve 0 = -3y + u + 19, hy = 4u + 43 - i for y. 5 Suppose -5 = v - 21. Solve -3q + 20 = 2i, 0 = -q - 0q - 3i + v for q. 4 Let m be (-5)/10 + (-1)/2. Suppose -2d + 5 = 4a - 5a, 3d - 10 = 2a. Let f be (-9)/(-3) + m - d. Solve -3z - 21 = -i - fi, 4z - 12 = -4i for z. -2 Suppose 0 = -2s + s + 2. Solve -s = -5a - 3b - 5, -3b = -5a - 27 for a. -3 Suppose 0 = 3r + 6 - 39. Solve -r = j + 2o - 0o, -4j - o = 16 for j. -3 Let k = -13 - -22. Solve -3a - 11 = -5w, -5a + a = -w + k for w. 1 Let s = -2 - -2. Suppose sl + 2l = -4d - 4, 5l = 3d + 16. Solve -4h - l = o - 6o, -3o = -6 for h. 2 Let r be (-630)/(-40) + (-2)/(-8). Suppose -17p + r = -13p. Solve -2i + 13 = 2a - 7i, -13 = a + pi for a. -1 Let k(f) = -f*3 - 16f*2 + 14. Let g be k(-16). Solve -8 = j - y, -2y - g = 3j - 3y for j. -3 Suppose -1 + 3 = 2s. Suppose 0 = -d - 4d + p + 19, d - s = 3p. Solve 5r - l = dl, -5r = -4l - 1 for r. 1 Let w = 74 - 74. Let m be 10/3(-6)/(-5). Let r be -3-1(-8)/(-6). Solve w = -mn + f + 1, f = n - r for n. -1 Let m(v) = v2 + 3v - 2. Let z be m(-4). Suppose -7b + 22 = -3b - zh, 2h = b - 7. Solve -2n + 2 = -s + b, 9 = 3s + 2n for s. 3 Let s be 12/(-30) - 44/(-10). Solve -j - s = 3q, -3q - 3j = -q + 5 for q. -1 Suppose w = -2s + 27, 6s = 4w + 2s - 48. Solve p + w = -3d, 6d + 5p + 45 = d for d. -4 Suppose -q + 0q = q. Let c be -1 + 2 - (15 - 4). Let w be ((-16)/c)/(4/10). Solve q = 5l + wp - 9, -4p = l - 3p - 2 for l. 1 Let i(o) = -o*3 + 7o*2 + 2o - 6. Let r be i(7). Suppose -r = -5l - 3p, 4l + p = -2p + 4. Solve ln - 17 = -3v, -v + 4v + 3n - 12 = 0 for v. -1 Let a = -187 + 191. Solve -6 = -4o - 5g + 5, -4o = ag - 8 for o. -1 Suppose 3p + 15 = 36. Let n = p + -7. Solve -5b - 3 = -3x, -4x - 2b + nb - 22 = 0 for x. -4 Let z = -9 - -13. Let r(v) be the second derivative of v*3/6 + 3v*2 + 5v. Let q be r(-6). Solve -24 = -zm + 4s, 4m - 27 = -qs + 5s for m. 3 Let n = -2 + 2. Suppose 2k + k + 3a - 12 = 0, n = -3k - 4a + 12. Solve v = -3f + 25 - 10, 2f - 10 = -kv for f. 5 Suppose -5n = 10, 2 = -b - 5n - 8. Solve 0 = -5k + 3k - 2m - 12, -5k - 2m - 18 = b for k. -2 Let d = 83 - 83. Solve d = 5k - b + 30, -k = -3k + b - 15 for k. -5 Let w(q) = q2 - 6q + 9. Let v be w(5). Solve -a + 12 = -3o + 3a, -va = -4o - 12 for o. 0 Suppose 0 = x - 6x. Solve 3c + 45 = -5f - 2c, x = f - c + 1 for f. -5 Let r be (-2)/((-1)/(4/(-2))). Let c be 36/8 + 2/r. Solve 0 = 3x - 4x - 3i - 9, -12 = ci for x. 0 Let p(q) = q*2 + 3q - 3. Let s be p(4). Solve -r + 0a = -5a + 30, s = 5a for r. -5 Let c = 6 + -4. Let v be 6 - (c + (-1 - 0)). Suppose 2h - 57 = -3a + 5h, 4h + 96 = 5a. Solve vm - 5b - a = 25, -2m - 2b = -2 for m. 5 Suppose 4n - 40 = -4o, -1 = 4n + o - 26. Solve -2l + 0l + 3h - n = 0, 2l - h = -7 for l. -4 Let y = 26 + -24. Solve 5d = -10, -5j + 0d - yd + 11 = 0 for j. 3 Let u(h) = 2h + 11. Let p be u(-2). Let c(o) = o*2 + 5o - 3. Let z be c(-6). Solve 0 = zv - s + p, -5v + s - 7 - 4 = 0 for v. -2 Let h(z) = -z*3 - 6z*2 + z + 6. Let x be h(-6). Suppose 12 = -xp - 2p. Let i be -3(p/3)/2. Solve -7 + 0 = 5q - k, 4q + ik = -17 for q. -2 Suppose 0 = 3q - 10q + 28. Solve -qn - 10 = 4z + 14, 0 = 3z + 4n + 23 for z. -1 Suppose 3b - b = 5u, -2u = 4b - 24. Suppose -4f - 5 = -5j, -b + 15 = 4f - 2j. Solve g + q = 1, -2g + f = 3g + q for g. 1 Suppose 14 = -2h + 18. Suppose -2 = -d - 0. Solve 0w - d = 2w + 2u, u = -hw - 3 for w. -2 Let t(h) = h*2 - 2h + 2. Let c be t(4). Solve 2f = -8, -q = -3q + 4f + c for q. -3 Let i be 2/((-28)/12 + 3). Solve -im + 7 = t - 2, -3t = 3m - 3 for t. -3 Suppose 0 = -5y - 5b + 5, 5b + 0b + 22 = 4y. Let x be ((-1)/5 + 231/55)/1. Suppose yk = xk. Solve -u + n + 4n = 12, k = -u + 2n - 3 for u. 3 Let q(x) = 2x - 15. Let m be q(9). Solve -12 = 4t, mt = -4f + 4t + 3 for f. 0 Suppose -4q = -3q + a - 6, 2q - 4a = 0. Solve qp - 16 = v, 2p = 5p - 9 for v. -4 Suppose 2z = -5q + 36, -2q - 6 = -2z + 16. Solve 2c + 4y = 4, -5y - z = -2c - 0y for c. 4 Let v be (2/5)/((-2)/10). Let x(n) = -2n. Let t be x(v). Solve -o = -0o + tp + 5, p = -3o - 15 for o. -5 Suppose 0 - 16 = -8y. Let p = 8 + -4. Solve pa + c + 1 = ya, 0 = -3a + 3c - 6 for a. -1 Suppose -2s - 4z + 40 = 0, 0 = -3s + 2z - 4z + 68. Let c be (4/16)/(3/s). Solve 4k - 9k = -cd - 16, -5k + 20 = 0 for d. 2 Let l be ((1 - 1) + -2)1 + 5. Solve 4f + 3h = 25, 0 = -4f + lh + 2h + 1 for f. 4 Let r be (6/21)/(3/21). Suppose 0 = -3v + rd - 0d + 7, 0 = 4d + 8. Solve 5q + o + 10 = 0, -5o = 3q + 5 + v for q. -2 Suppose 12 = -8f + 4f - 3h, 3f - h = 4. Solve -4s - t - 4 = f, 4t = -s + 3t - 1 for s. -1 Let x be 1 + 1 + 6/(-3). Let c be (x - (-1)/(-1))-4. Solve 0p - c = -q - 2p, -q + 3p = 16 for q. -4 Suppose -36r = -35r - 7. Let m(y) = -y*3 + 9y*2 + 6. Let q be m(9). Let k be q/15 + (-8)/(-5). Solve 2j = -x - 9, kx + 2j = -19 + r for x. -3 Suppose 5b = -4v + 13, 2 = 3v - 3b - 1. Let r be ((-2)/(-1))/(-2) + 5. Let m be 1 + 2 + -1 + 1. Solve -4w = -mi + 16, i = -vw - ri + 18 for w. -1 Let i be -11 - 1-2 - 1. Let c = -6 - i. Suppose -4d + 15 = -d. Solve -3b + db = -4, -10 = co + b for o. -2 Let p(t) = -5t + 3 + 2t3 - t3 + t - 3t*2 + 0t*2. Let w be p(4). Let u be 1w - (8 - 7). Solve -5 = 4y + x + 16, uy - 2x = 2 for y. -4 Let h = -11 + 19. Suppose hd - 4d = 108. Solve -4x - d = -3s, -x + 9 + 8 = 4s for x. -3 Let y(o) = -o*2 + 4o. Let f be y(2). Solve -2n - 7 = fv - n, -5v = 2n + 8 for v. -2 Let h be (-3 + 0 + 4)0. Solve 5j - 3s - 13 = h, 0 = -j - 2s + s + 1 for j. 2 Suppose -3g + 35 = 2g + 5l, 5g - 5l + 15 = 0. Let y be (6/g)/((-3)/(-2)). Solve 5t - 21 = 5p - yp, -2p + 2 = 2t for p. -2 Let f(s) = -s*2 - 6s + 2. Let q	{ "pile_set_name": "DM Mathematics" }
p*2 - 224p - 224. Give -672f(l) - 3j(l). 96l3 Let j(u) = 663u*3 - 6u*2 + 22u + 6. Let n(p) = -132p3 + p2 - 4p - 1. What is 2j(y) + 11n(y)? -126y3 - y2 + 1 Let w(c) be the third derivative of -c3/6 - c2. Let p(s) = 2s + 2. Suppose -24y + 20y + 40 = 0. Let j be (-63)/45 - (-4)/y. What is jp(m) - 2w(m)? -2m Let h(o) = 17o - 2. Let q be 13 - 6 - (5 + -2 - -2). Let v(c) = -8c + 1. Give qh(j) + 5v(j). -6j + 1 Let v(n) = -6 + 314n - 152n - 145n + 6. Let l(c) = -68c. Calculate -4l(x) - 17v(x). -17x Let f(c) = c2 + c - 1. Let g(j) = -j + 10. Let q be g(13). Let s(h) = 2h*3 - 2h*2 - 3h + 3. Calculate qf(d) - s(d). -2d3 - d2 Suppose -6q - 100 = 14q. Let n(r) = -7r3 - 2r. Let o(z) = 15z3 + 5z. Calculate qn(s) - 2o(s). 5s3 Let k(a) be the second derivative of a5/4 + a3/3 - a2 + 31a - 6. Let c(j) = 9j3 + 5j - 4. What is -2c(t) + 5k(t)? 7t3 - 2 Let o(i) = -3i. Let w(k) = -4k - 1. Let z(d) = d. Let r(f) = -w(f) - 5z(f). Suppose 15 = -6s + 3. Calculate sr(n) + o(n). -n - 2 Let q(y) = -2y2 - 2y - 3. Let x(w) = -w*2 + 3w*2 - 5w + 1 + 1 + 7w. Suppose 60 = -11s - 4s. Calculate sx(c) - 3q(c). -2c*2 - 2c + 1 Let o(n) = n*2 - n. Let u(q) = -12q*2 - 8q. Let m(w) = 22w + 617. Let j be m(-28). What is ju(s) - 8o(s)? -20s*2 Let q(x) = 356x + 28. Let u(h) = -119h - 8. Give 3q(r) + 10u(r). -122r + 4 Let w(u) = 40u - 29. Let d(s) = -19s + 14. Determine 9d(y) + 4w(y). -11y + 10 Let p(z) = -z - 1. Let m = 2 + -4. Suppose 4 = 4y - 2b - 18, -5y = b - 24. Let l(s) = -4 + 2 - 1 - 3s. Determine ml(t) + yp(t). t + 1 Let h(i) = -12i*2 - 3i - 3. Let z(x) = x*3 + 31x*2 - 65x + 36. Let j be z(-33). Let u(k) = 13k2 + 4k + 4. Calculate ju(c) + 4h(c). -9c2 Let j(o) = 119o + 1. Let v(g) = -118g. What is -2j(y) - 3v(y)? 116y - 2 Let o = -149 + 155. Let q(l) = -4l2 + 3l + 3. Let w(c) = -c*2 + c + 1. Determine ow(k) - 2q(k). 2k2 Let u be 9 + 435/(-60) + 6/(-8). Let m(t) = -t2 + t + 1. Let j(a) = -4a3 - 6a*2 + 4a + 6. Determine uj(h) - 4m(h). -4h3 - 2h2 + 2 Let d(q) = -q2 - 1. Let j(x) = 176x2 - 176. What is -176d(a) + j(a)? 352a2 Let c(u) = 0 + 3u + 3u - 7u + 1. Let d be (-20)/(-6)21/(-14). Let g(f) = 2f - 3. Give dc(h) - 3g(h). -h + 4 Let m be ((1 + -6)48/(-12))/2. Let l(f) = -2f*3 - 4f + 6. Let v(h) = h*3 + h - 2. Give mv(k) + 3l(k). 4k*3 - 2k - 2 Let q(y) = y2. Let c(j) be the third derivative of j5/20 + j4/8 + j3/2 - 890j2. What is -c(m) + 4q(m)? m*2 - 3m - 3 Let g(y) = -143y - 26. Let p(a) = -16a + 2 + 5 - 11 + 1. Determine 3g(f) - 26p(f). -13f Let m(n) = 9n*3 + 2n*2 + 4n + 7. Let u(p) = -4p3 - p2 - 2p - 3. Calculate -6m(j) - 14u(j). 2j3 + 2j*2 + 4j Let w(x) = -2x2 + x - 2. Let c(y) = 6y*3 + 28y*2 - 4y + 10. Give -c(a) - 5w(a). -6a*3 - 18a2 - a Let t(u) be the first derivative of u3/3 - 2u - 28. Let r(x) = -x2 + 12 - 12. Give -4r(n) - t(n). 3n2 + 2 Suppose 9q + 8 = 4m + 5q, -4m - 2q + 20 = 0. Let k(c) = -5c. Let a(w) = w. Let g(d) = d2 - 20d + 20. Let i be g(19). Give ik(l) + ma(l). -l Let p(n) = -n*2 - n. Let r(f) = -3f*3 + 2f*2 + 6f - 1. Determine -3p(d) - r(d). 3d3 + d2 - 3d + 1 Let a(t) = -t + 4. Let g be (-2)/9 - (-40)/18. Let j(i) = -74. Let b(r) = 21. Let d(o) = -7b(o) - 2j(o). Calculate ga(n) - 7d(n). -2n + 1 Let s(i) = 63i3 + 69i*3 - 133i*3 - 1 - i. Let w(h) = 2h*3 - 2h*2 + 4h + 3. Give 3s(r) + w(r). -r3 - 2r*2 + r Let i(l) = -2l3 - l - 2. Let k(f) be the third derivative of -f6/120 + f5/60 - f4/24 - f*3/2 - 4f*2 - 5f. Give 3i(a) - 2k(a). -4a3 - 2a*2 - a Let b(x) = 28x*2. Let g(a) = -17 + 3a*2 + 19 - 2. Calculate 4b(r) - 35g(r). 7r*2 Let w(r) = 210r + 21. Let p(n) = -631n - 72. Determine 2p(m) + 7w(m). 208m + 3 Let d(g) = -13g2 - 5g - 6. Let p(l) = l*2 + l + 1. Let f(b) = -6b - 47. Let w be f(-8). Calculate wd(n) + 6p(n). -7n2 + n Let o(w) = -w + 1. Let x(d) = 3d*2 - 6d + 6. Let n(i) = 2i2 - 33i + 96. Let q be n(13). Calculate qx(k) - 30o(k). 15k2 Let t(h) = 115h - 2. Let m(b) = 4599b - 81. Calculate -2m(r) + 81t(r). 117r Let r(i) = 4i3 - i2 - i + 1. Let j(a) = -5a*2 - 9a + 5. Determine j(v) - 5r(v). -20v*3 - 4v Let o(s) = -2 + 10s2 + 1 + s - 5. Let h(g) = 7g*2 + g - 4. Let w(r) = -3r*2 - 3r. Let d be w(-2). Let x = d + 13. Give xh(v) - 5o(v). -v*2 + 2v + 2 Let f(c) = c. Let s(o) = -o + 1. Suppose 0 = -4j + 2q + 230, -5j + 5q = -292 + 17. Let u = j - 56. Give uf(z) + 2s(z). 2z + 2 Let o(n) = -393n + 4. Let f(h) = -785h + 7. Determine -4f(g) + 7o(g). 389g Let r(i) = i. Let l = 83 - 81. Let s(c) = -l + 3 - 4c - 16c*2 + 14c*2. Calculate -5r(n) - s(n). 2n2 - n - 1 Let u(l) = -2l*3 + 5l*2 + 5l - 7. Let c(g) = -3g3 + 7g*2 + 7g - 11. Let i(v) = -6v3 - 3v + 4. Let j be i(1). Give jc(q) + 7u(q). q*3 + 6 Let s(m) = -9m*2. Suppose k + 5r + 15 = -10, -5r = 20. Let q(o) = -9o*2. Calculate kq(t) + 6s(t). -9t*2 Let z(k) = 4k*2 - 4k. Let y(q) = -4q2 + 11q - 4q - 2q. Let l be ((-38)/(-10) + -3)-5. Give ly(h) - 5z(h). -4h2 Let v(h) = h3 - 10h2 + 9h + 3. Let o be v(9). Let p(j) = j*o + 75j*2 - 3j*3 - 67j2 + 2. Let w(i) = i2. Determine p(l) - 6w(l). -2l*3 + 2l2 + 2 Let q(t) = -t3 - t - 1. Let f(o) = -19o3 + 4o - 26. Let c(k) = 9k3 - k + 12. Let y(b) = 7c(b) + 3f(b). Give -5q(h) - y(h). -h*3 - 1 Let l(k) = 4k - 11. Suppose t - 9 = -4. Let z(p) = t - p - p + 0p. Calculate -3l(n) - 7z(n). 2n - 2 Let d(k) = -20k - 724. Let q(m) = 23m + 721. Give 7d(t) + 6q(t). -2t - 742 Let f(d) = 2d*2 - 12d - 42. Let v(i) = -2i - 2. Determine f(x) - 5v(x). 2x2 - 2x - 32 Let m(u) = 2u2 + 1. Let q(s) = 159s*2 + 24. Calculate -120m(r) + 5q(r). 555r2 Let l(j) = j2 + 2j - 6. Let z(w) = w - 3. What is 2l(y) - 5z(y)? 2y*2 - y + 3 Let o = 603 - 605. Let f(m) = -m - 31. Let d(u) = 15. What is of(k) - 5d(k)? 2k - 13 Let f be (1 + -3)/(-7 + -6 + 11). Let w(t) = t + 1. Let r(x) = -20x2 + 2x + 2. What is fr(l) - 2w(l)? -20l2 Let k(s) = 3s*3 - 6s*2 + 29s + 8. Let x(f) = -f*3 + 2f*2 - 10f - 3. What is 6k(z) + 17x(z)? z*3 - 2z*2 + 4z - 3 Let j(f) = -f + 7 + 4f + 5f. Let k(q) = 7q + 6. Suppose y + 12 = -2y, 0 = -3u + 2y + 26. Determine uk(w) - 5j(w). 2w + 1 Let h(p) = -21p + 84. Let t(s) = -1. Let n = -183 + 184. Calculate nh(r) + 84t(r). -21r Let y(n) = 3n - 8. Let a(w) = 2w + 8. Let r(q) = -3q - 13. Let k(x) = -5a(x) - 3r(x). Calculate 6k(b) - y(b). -9b + 2 Suppose x = -1 + 6. Let h(s) = 6035s + 40 - 46 - 6033s. Let w(p) = 3p - 7. Calculate xh(f) - 4w(f). -2f - 2 Let c(y) = y - 1. Let z(b) = 2b2 - 10b + 20. Let h(i) = -i + 2. Let k(u) = 7h(u) - z(u). Give -5c(p) + k(p). -2p2 - 2p - 1 Suppose -k + 1 = 3z + 5, 2k = -3z - 11. Let a(l) = 3l*2 + l. Let n(p) = 9p*2 + 3p + 1. Determine ka(o) + 2n(o). -3o2 - o + 2 Let a(h) = -42h*2 - 6h. Let m(x) = -63x2 - 9x. Give -7a(q) + 5m(q). -21q2 - 3q Let h = -3 + 6. Let y(n) = 5n2 - 3n - 3. Suppose -5j + 6 = -l + 2, 3j - l - 4 = 0. Let u(r) = j + 8r + 0 - 14r*2 + 8. What is hu(v) + 8y(v)? -2v*2 Let l(c) = 6c*2 - 4c + 3. Let o(a) = -a*3 - 15a*2 + 9a - 6. What is -5l(k) - 2o(k)? 2k3 + 2k - 3 Let z(v) = -88v2 - 6v - 4. Let j(m) = 176m2 + 10m + 7. Determine -3j(o) - 5z(o). -88o2 - 1 Let h(u) = 3u*3 + 10u*2 - 7u - 26. Let l(o) = 2o3 + 4o*2 - 3o - 13. What is -4h(v) + 10l(v)? 8v3 - 2v - 26 Let g(h) = -329h + 3. Let x(s) = -6s. What is g(c) - 2x(c)? -317c + 3 Let k(o) = -10o2 - 8o + 11. Let l(i) = 2i - 1. Determine k(x) + 4l(x). -10x2 + 7 Let u(i) = -i2 - i - 3. Let o(w) = -92w*2 - 3w - 9. Give -o(y) + 3u(y). 89y2 Let f(y) = y3 + y*2 - y - 1. Let l(v) = -4v*3 + 3v*2 - 3v - 3. Suppose 60m = 64m + 4. Calculate ml(b) + 3f(b). 7b3 Let y(l) = 128l + 13. Let t(h) = -43h - 4. Calculate 7t(s) + 2y(s). -45s - 2 Let o(b) be the first derivative of 3b2 + 2b + 4769. Let u(r) be the second derivative	{ "pile_set_name": "DM Mathematics" }
3? 1 Let s = -20 - -42. What is the highest common divisor of s and 88? 22 Let m = -4 + 4. Let i be m/1 - 1-4. Suppose -iv + 133 = 5. What is the highest common divisor of v and 16? 16 Let h be (-238)/(-10) + (-2)/(-10). What is the highest common factor of h and 36? 12 Suppose -5a - n + 3 = -18, a + n = 5. Calculate the highest common divisor of a and 4. 4 Let m = 20 + -8. Calculate the greatest common factor of 3 and m. 3 Let q = 201 - 129. What is the greatest common divisor of 8 and q? 8 Let c(b) = -b2 - 15b - 6. Let y be c(-12). Calculate the highest common factor of y and 75. 15 Let r(s) = 2s2 - 17. Let g be r(-4). Let p = 155 + -110. What is the highest common factor of p and g? 15 Let j(k) = -2k*3 - 5k*2 - 10k - 4. Let p be j(-2). What is the greatest common factor of p and 132? 12 Suppose 3l - 2p - 4 = 0, 4 = 4l - 2p - 0. Let k(s) = -s + 3. Let x be k(l). Calculate the greatest common factor of x and 1. 1 Let l = -5 + 9. Suppose -k + 55 = lk. Calculate the greatest common factor of 99 and k. 11 Let l be 600/4512/10. Calculate the highest common factor of 80 and l. 16 Suppose 0 = 5h + 4v - 75, 0 = 3h - 4v + v - 18. Let c be (1 + -2)/(3/(-297)). What is the greatest common divisor of c and h? 11 Let x be 12/(-2)50/(-4). Let t(f) = -36f - 201. Let i be t(-6). Calculate the highest common divisor of i and x. 15 Let f = 248 + -163. What is the greatest common divisor of f and 34? 17 Let d(m) = -m*3 + 5m*2 + 2m - 7. Let n be d(5). Let w(g) = 4g. Let p be w(n). What is the greatest common divisor of p and 24? 12 Let u = -31 - -51. Let v(w) = 3w*2 - 2w - 5. Let h be v(5). What is the highest common divisor of h and u? 20 Let j = -26 - -28. What is the highest common divisor of 5 and j? 1 Suppose -4j + 2l + 32 = 8, 2j - 3l - 8 = 0. Let r(i) = 7i + 1. Let n be r(j). What is the highest common divisor of n and 10? 10 Let a be (-1)/(2/(-16)) + -1. Let t be a/(-14)(-1 - 13). Calculate the greatest common divisor of 7 and t. 7 Let v(b) = 2b3 - 9b*2 + b + 12. Let j be v(6). Let l = -35 - -19. Let y = 30 + l. Calculate the greatest common divisor of j and y. 14 Let z(b) = -4b*3 + 9 + 14b + 8b2 - 11b + 3b3. Let r be z(8). Calculate the greatest common factor of r and 11. 11 Let n be 3 - 7/(28/(-156)). Calculate the greatest common divisor of n and 28. 14 Suppose 68 = 2t - b - b, 0 = 3t - 5b - 104. Calculate the highest common factor of t and 11. 11 Suppose v - 9 = 63. Suppose -3y + 0x + 11 = x, 5y = -4x + 30. Suppose 5i - 45 = 2n, -yi = 4n - 10 - 8. Calculate the highest common divisor of i and v. 9 Let u = -2 + 23. What is the greatest common divisor of u and 7? 7 Let p = 36 + 39. Calculate the highest common divisor of p and 50. 25 Suppose 5v - 3 = 57. What is the greatest common divisor of 60 and v? 12 Let n = -72 + 142. Let u be -1(2 + -23)/3. Calculate the greatest common divisor of u and n. 7 Let b(p) = p*3 + 8p*2 - 20p + 13. Let m be b(-9). What is the highest common divisor of m and 14? 14 Suppose -2l - 56 + 6 = -3z, 3z - 3l = 45. Calculate the greatest common factor of z and 10. 10 Let s(g) = g*2 - 5g - 5. Let w be -1 + -1 - (-12 - -15). Let t be s(w). Calculate the highest common factor of t and 15. 15 Suppose 0t + t = 12. Let d = 56 - 26. Calculate the highest common factor of t and d. 6 Let v = 4 - 2. Suppose 5r + 3n = 30, n - 3 - 2 = 0. Suppose 518 = 5c - vq, rc - 4c + 5q = -122. What is the greatest common factor of 17 and c? 17 Let c(l) = -l*3 + 5l*2 + 2l + 1. Let g be c(5). Let s be 9 - 90/10 - (1 + -100). Calculate the greatest common factor of g and s. 11 Let r = -20 - -24. Calculate the greatest common factor of r and 6. 2 Let f(m) = 3m. Let p be f(5). Suppose 0 = h - 2h + p. What is the highest common divisor of h and 5? 5 Let b be 12/(-16) + 111/4 + 2. What is the greatest common divisor of b and 203? 29 Suppose 6m - 8 = 2m. Suppose -j - 2j + 50 = 2g, 0 = mg + j - 46. What is the greatest common divisor of 242 and g? 22 Let l be -722/(-2). Calculate the greatest common divisor of l and 70. 14 Let m be (7/3)/(1/(-18)). Let u = m + 60. Let i be 4/u + (-284)/(-18). Calculate the highest common factor of 40 and i. 8 Let r be 8/6 - 3/9. What is the highest common divisor of r and 9? 1 Let l(f) = 2 + 5 - 3 + 7f + f. Let r be l(4). What is the greatest common divisor of r and 4? 4 Let c(q) = -q*2 - 7q - 4. Let j be c(-5). Let n = 17 - j. Let k = 85 - -3. Calculate the greatest common divisor of n and k. 11 Let n = -74 + 88. Let l(x) = 2x3 - 10x*2 + 8x + 6. Let y be l(6). What is the highest common divisor of y and n? 14 Let m = 75 - 3. What is the greatest common divisor of 48 and m? 24 Let c(p) = -p*2 + 24. Let n be c(0). Let l = 4 + -1. Suppose -o = -ls, o = -o + 3s + 6. What is the highest common factor of o and n? 6 Suppose g + 23 - 5 = 0. Let w be (-245)/(-9) + 4/g. Calculate the greatest common divisor of w and 18. 9 Suppose 3m = 2m + 6. What is the greatest common factor of m and 60? 6 Let h(q) = 3q - 4. Let r be h(5). What is the greatest common factor of 77 and r? 11 Suppose -33 = 4m - m. Let p = m - -18. Calculate the highest common divisor of 35 and p. 7 Let q be (8/(-28))/((-4)/14). Calculate the greatest common divisor of q and 9. 1 Suppose 11o - 3 = 8. Suppose -x + 6w + 4 = 2w, -x + 4 = -w. What is the highest common divisor of o and x? 1 Let q = 59 + 60. Let z(l) = 2l2 + 4l - 31. Let c be z(4). Calculate the highest common factor of c and q. 17 Suppose -336 = -5a - 5j + 154, 4a - 2j - 386 = 0. Suppose 4b - 409 = -a. Let n be b/9(-21)/(-2). What is the highest common factor of n and 13? 13 Let z be ((-48)/(-2))/((-1)/(-1)). Calculate the highest common factor of z and 60. 12 Suppose -3p + 2p + 4 = 0. Suppose -w + 1 + p = 0. Calculate the greatest common divisor of w and 50. 5 Let z be 387/7 - (-4)/(-14). Let c(k) = 3 + 0 + k + 5k2 - k3 - 1. Let a be c(4). Calculate the greatest common divisor of z and a. 11 Suppose 4z - 2t - 1082 = t, -t + 818 = 3z. Calculate the highest common divisor of 16 and z. 16 Suppose 0 = 4y + 7 - 199. Calculate the greatest common factor of y and 16. 16 Suppose 21 = 3a + y + 2y, 0 = -5y + 25. Suppose -3x + 48 = 4d + ax, 5d = -3x + 60. Suppose d = w - 0w. What is the greatest common factor of 4 and w? 4 Let p = 17 + -10. Calculate the highest common divisor of p and 35. 7 Let q = 19 + -7. Calculate the greatest common factor of 60 and q. 12 Let k = -79 - -81. What is the highest common factor of k and 8? 2 Let t = 150 - -254. Suppose 0 = -0k - 4k + h + t, 516 = 5k - 4h. Let x be (-4)/(-6) - k/(-12). Calculate the highest common divisor of x and 81. 9 Let t = 7 + -14. Let h(o) = -10 - o*3 - 10o + 6o2 + o3 + o3. Let m be h(t). What is the greatest common factor of m and 99? 11 Suppose 0 = 4s + 12, -6t + s + 99 = -2t. Let o(q) = 5q3 - 3q*2 - q + 2. Let p be o(1). What is the highest common factor of t and p? 3 Let c be 22 - (2 - (4 - 5)). Let w = 26 - c. Calculate the greatest common factor of w and 7. 7 Let u = 145 + -131. Calculate the highest common factor of 154 and u. 14 Suppose 7i - 12 = 3i. Suppose -im + 4z = -26 - 11, 5m - 85 = -5z. Let c be (-448)/(-6)m/10. What is the highest common divisor of 14 and c? 14 Suppose -2f - f = c - 22, -5c + 50 = -5f. Let i be 2/c - (-200)/52. Calculate the greatest common factor of 6 and i. 2 Suppose -5q + 70 = -0z - z, -3q + 42 = 5z. Calculate the highest common divisor of q and 7. 7 Suppose 81 = 3z - 99. Let i be (-621)/(-15) - (-2)/(-5). Let u = -29 + i. What is the highest common factor of z and u? 12 Let z be 2/1 + -1 - -3. What is the highest common divisor of z and 4? 4 Suppose -2f + 34 = -0f. What is the greatest common factor of f and 187? 17 Let f = 3 + 0. Let v be -2 + f - 0/(-4). Calculate the highest common divisor of 4 and v. 1 Let l be (8 + 0)-11-24. Calculate the greatest common divisor of 24 and l. 24 Let y = 25 - -13. Let u be (0 + 1 - -13) + 2. Let d = 3 + u. What is the highest common divisor of y and d? 19 Suppose -g = 3y - 83 + 17, 93 = 4y + 3g. Calculate the highest common factor of y and 168. 21 Suppose -22 - 34 = -4*j. Calculate the highest co	{ "pile_set_name": "DM Mathematics" }
3) to base 8. -633661 What is -1044404101 (base 5) in base 8? -10734437 5030664 (base 7) to base 16 9174c What is 127811 (base 14) in base 3? 1012021200002 What is 23303032 (base 4) in base 2? 1011110011001110 Convert -10221022011221 (base 3) to base 11. -11aa029 What is -2204513 (base 6) in base 12? -53739 Convert -310168 (base 12) to base 5. -144024311 Convert -90a02 (base 11) to base 5. -13223411 Convert 132403 (base 6) to base 5. 342433 Convert 6b621a (base 15) to base 2. 10011100101011000011010 What is 204276 (base 10) in base 5? 23014101 Convert -c643ca (base 14) to base 10. -6696126 102011201022 (base 3) to base 2 110101101100101110 What is -1d83b7 (base 14) in base 5? -232404213 What is aaa7 (base 16) in base 15? ce27 20011100111 (base 3) to base 10 121270 -302044142 (base 5) to base 10 -1206172 What is 3aa22 (base 14) in base 11? 99776 1112120111220 (base 3) to base 7 6645516 2562d (base 16) to base 13 54916 Convert -2212222120110 (base 3) to base 12. -620356 Convert -331303211 (base 4) to base 11. -163223 Convert 256278 (base 15) to base 3. 10101002002212 What is -14bbc1 (base 14) in base 2? -10110000110000011101 20202221100 (base 3) to base 11 91219 Convert 1010000101100101 (base 2) to base 14. 110b3 -95323 (base 13) to base 7 -2166001 -4974b5 (base 12) to base 2 -100100011101100001001 Convert -d87115 (base 14) to base 15. -998678 Convert 5a532a (base 11) to base 6. 32314255 Convert 24ca7d (base 15) to base 8. 6565426 What is 535380 (base 11) in base 12? 353650 What is 2663b (base 12) in base 15? 1096b -44562050 (base 7) to base 8 -16572572 -21012012010102 (base 3) to base 12 -1343b3b c4c919 (base 15) to base 6 532321553 -133781 (base 11) to base 14 -566d1 Convert 302123101 (base 4) to base 2. 110010011011010001 What is -a4961 (base 13) in base 9? -501026 Convert 61479b (base 16) to base 9. 12886262 Convert 4022400 (base 6) to base 11. 11a659 Convert -40460 (base 10) to base 8. -117014 102552515 (base 6) to base 8 6740437 What is 72baa (base 15) in base 6? 11444024 What is -510597 (base 15) in base 6? -214254211 Convert -12d3dc (base 15) to base 5. -212433012 Convert 195047 (base 11) to base 2. 1001001001000000110 -22145450 (base 6) to base 11 -416476 Convert -c523da (base 15) to base 9. -18565617 What is 410207 (base 8) in base 2? 100001000010000111 -26309c (base 14) to base 11 -818683 Convert -4db163 (base 15) to base 16. -38f64c -1135534 (base 8) to base 13 -ab1c6 What is -465146 (base 12) in base 7? -12410220 What is -36562 (base 14) in base 9? -222121 Convert -1f581 (base 16) to base 13. -4658a What is 603554 (base 7) in base 11? 6a829 What is -262613 (base 8) in base 7? -530566 -494458 (base 13) to base 5 -422024013 12030136 (base 7) to base 13 2b4353 -300555 (base 11) to base 8 -1660752 -43241164 (base 7) to base 12 -129ba47 Convert 1113131202 (base 4) to base 2. 1010111011101100010 Convert 324502130 (base 6) to base 9. 11857000 Convert -1a518cb (base 13) to base 14. -1221792 2732a47 (base 12) to base 10 7780951 What is 22220010101 (base 3) in base 5? 21100201 5700351 (base 8) to base 14 2c14b7 -224153210 (base 6) to base 12 -1468806 3120303310 (base 4) to base 10 888052 Convert -692337 (base 10) to base 13. -1b3189 Convert 121201103213 (base 4) to base 7. 110602304 Convert -112320053 (base 6) to base 3. -10220121121020 Convert -334111003 (base 5) to base 14. -2a495a Convert 35450514 (base 6) to base 3. 2002102211001 -2049033 (base 12) to base 8 -27120347 138487 (base 10) to base 12 68187 What is -101111011101110010101 (base 2) in base 7? -16135355 Convert 145361206 (base 7) to base 4. 211003031230 What is -5587d (base 16) in base 6? -11301525 What is -814e (base 15) in base 16? -6aa3 Convert 10120221012 (base 3) to base 12. 34a88 What is 10011011100001011101 (base 2) in base 3? 1012100211101 What is -6324 (base 14) in base 10? -17084 What is 101120021000112 (base 3) in base 6? 320202152 Convert -113310233212 (base 4) to base 12. -211225a Convert 126b326 (base 12) to base 8. 15655016 What is 8cb35 (base 13) in base 7? 2116362 What is 1001111011010001 (base 2) in base 14? 10b61 What is 1001011001011101000 (base 2) in base 7? 2421540 Convert 10021122020101 (base 3) to base 14. 335b53 What is 27cc0 (base 14) in base 6? 2040144 Convert 1110111011000011 (base 2) to base 13. 21a8a What is 1359925 (base 10) in base 2? 101001100000000110101 What is -1100110001111110110000 (base 2) in base 13? -90401a What is db865d (base 14) in base 8? 34276273 What is 1336623 (base 7) in base 14? 48a4a 1202303 (base 4) to base 6 45135 What is -73352c (base 13) in base 12? -a99ba8 What is -320412453 (base 6) in base 15? -7639d9 Convert -6778c (base 13) to base 3. -100112221121 Convert 12888154 (base 9) to base 16. 614cf5 What is 1011110101101110 (base 2) in base 14? 1395c 1a4fd (base 16) to base 9 173747 What is -236209 (base 11) in base 13? -101475 What is 101102132021 (base 4) in base 13? c28b26 -225101 (base 7) to base 11 -28209 3104100 (base 6) to base 4 210102210 What is 1210101223 (base 4) in base 9? 685367 What is -15e0c3 (base 16) in base 5? -331340140 What is -cd51 (base 16) in base 14? -15225 What is 517e8 (base 16) in base 15? 68d85 5548211 (base 9) to base 5 1231002243 What is -114674 (base 13) in base 9? -684058 Convert -1586c5 (base 16) to base 10. -1410757 Convert 401b1 (base 16) to base 6. 5343345 Convert 1413793 (base 10) to base 2. 101011001001010100001 What is 657685 (base 9) in base 4? 1133320331 What is 735504 (base 8) in base 5? 30311143 Convert -1223333322 (base 4) to base 10. -442362 Convert 3410020 (base 5) to base 7. 336646 10212000121 (base 3) to base 11 51a79 Convert 434945 (base 12) to base 15. 160bd2 Convert 7d90e2 (base 15) to base 13. 1322c81 What is -10120012210000 (base 3) in base 10? -1893780 Convert 12010 (base 10) to base 5. 341020 100010001001001101111110 (base 2) to base 14 128dc86 -10222011110102 (base 3) to base 12 -858818 What is 21313023110 (base 4) in base 3? 11212100100212 35723404 (base 9) to base 2 1000010100000100111010100 Convert 5c1855 (base 13) to base 6. 115114120 Convert 111001010110010111110 (base 2) to base 4. 13022302332 What is -2213429 (base 10) in base 14? -418901 What is -1144 (base 13) in base 10? -2422 Convert -515d01 (base 14) to base 8. -12356775 -101100011101000100011111 (base 2) to base 4 -230131010133 -678ab1 (base 12) to base 11 -a2a36a Convert 12241014223 (base 5) to base 13. 30a7608 Convert 100102202200212 (base 3) to base 14. 947679 What is -bde7 (base 15) in base 11? -28287 Convert -102120122222222 (base 3) to base 5. -3033413332 Convert -2320413213 (base 5) to base 15. -6d9e23 Convert -10012222001020 (base 3) to base 11. -a6a054 Convert -433642 (base 8) to base 15. -2d0c9 -aba431 (base 14) to base 2 -10110001111000111011011 Convert 11122012011 (base 3) to base 16. 16480 Convert 16611315 (base 8) to base 14. 72ac33 -a113a (base 13) to base 6 -10101241 Convert 104213214 (base 6) to base 13. 50c5b1 What is 2838a6 (base 13) in base 14? 1b6b97 Convert 220111012022 (base 3) to base 2. 1110101101011011100 Convert -13b46 (base 16) to base 12. -3a85a What is -121101325 (base 6) in base 7? -25333544 What is -4c4c02 (base 13) in base 15? -264c17 What is 17006300 (base 8) in base 4? 33000303000 -b4842 (base 15) to base 14 -10c781 Convert b02294 (base 12) to base 14. 514ca4 What is 111030112102 (base 4) in base 8? 25142622 Convert 1cc600 (base 13) to base 9. 1350011 11000000101001 (base 2) to base 6 133025 3100302 (base 8) to base 12 33622a 11101221012 (base 3) to base 2 10101001010101110 Convert -556223 (base 7) to base 6. -2034405 Convert -8296 (base 13) to base 7. -103405 10122020022 (base 3) to base 5 4242422 What is -1120331320 (base 4) in base 14? -96b32 Convert -4ae00 (base 16) to base 4. -1022320000 -261313 (base 10) to base 7 -2135563 What is -111130002 (base 4) in base 5? -10302220 -308ac7 (base 15) to base 6 -121243054 102004422 (base 6) to base 5 423231300 Convert 4316542 (base 7) to base 5. 113311001 Convert -10447104 (base 8) to base 2. -1000100100111001000100 -1173133 (base 10) to base 8 -4363215 What is 11000011000011110011 (base 2) in base 11? 4a6300 Convert 103919 (base 13) to base 5. 44120202 10422073 (base 8) to base 7 25006215 -10143224044 (base 5) to base 16 -a0940	{ "pile_set_name": "DM Mathematics" }
z be 1988/6 + (-28)/21. Suppose 4c - z = -2c. What is the tens digit of c? 5 Let v(m) = m*3 + 2m*2 + 6m. Let c be v(-4). Let g = c + 94. What is the tens digit of g? 3 Suppose 1 + 14 = 5p. Suppose 2x = -px, v - 136 = -3x. What is the tens digit of v? 3 Let n = -147 + 502. What is the units digit of n? 5 Let q(d) = -d*3 - 18d*2 + 19d + 4. Let x be q(-19). Suppose 5 = xs - 103. What is the tens digit of s? 2 Let a(m) = -m2 + 7m - 2. Let x be a(6). Suppose xn + 2p - 326 = 0, -n + 3p + 83 = -16. What is the tens digit of n? 8 Suppose -36 - 9 = -3h - 3y, 0 = h + 2y - 15. Let l = h + -11. Suppose -lp = -3o - 48, -6o + 4o = -3p + 35. What is the units digit of p? 9 Suppose -1 = 4j + 3, 0 = 3v + 2j - 412. Suppose -4b - v = -342. What is the tens digit of b? 5 Let j be (-4)/(-3) + 4/(-3). Let s be (-10 + 21)/(1 + j). Suppose 1 = 2u - s. What is the units digit of u? 6 What is the thousands digit of (-13701)/(-10) + 31/(-310)? 1 Suppose -3o + 1 = -2m - 9, 17 = 5m + 3o. What is the units digit of 11 - (m/6 - (-5)/(-30))? 1 Let p = 21 - 17. Suppose -b + 3 = 7, 0 = -pf - b + 524. What is the tens digit of f? 3 Let s = 1 + 6. Suppose -4v - s + 259 = 0. Let z = -26 + v. What is the units digit of z? 7 Let z(u) = -14u + 119. What is the units digit of z(-11)? 3 Let d = 9 + -4. Suppose 0 = dx - 10x + 230. Suppose 5n + w - 73 = -w, w = 3n - x. What is the tens digit of n? 1 Let q(o) = -2o*2 + 4 + 6 - 3 - 3 + 3o. Let d be q(-4). Let j = -24 - d. What is the units digit of j? 6 Let z(q) = 34q - 85. What is the hundreds digit of z(11)? 2 What is the tens digit of 42 - 1 - (-32 + 27)? 4 Suppose 0 = -6y - y - 798. Let x = -63 - y. What is the tens digit of x? 5 Let l(g) be the third derivative of -g*6/120 - 7g*5/60 - 2g4/3 - g3/2 + 27g2. What is the tens digit of l(-8)? 8 Suppose 0 = 5l + 5 - 15. Suppose 0 = -4g + lx + 424, -2x = -4x. What is the tens digit of g? 0 Let i = -898 + 1520. What is the hundreds digit of i? 6 Let g be -2 + (6 - 2 - -91). Suppose -3b + g = -60. What is the units digit of b? 1 What is the tens digit of 188 - (5 - 4)1? 8 Let n be (-6)/8 + 18129/12. Suppose -m = 9m - n. What is the hundreds digit of m? 1 Let x be (36/(-54))/((-4)/30). Suppose -28l = -33l + x. What is the units digit of l? 1 Let p(q) = 254q + 30. What is the units digit of p(5)? 0 Suppose -10149 = -13k + 849. What is the hundreds digit of k? 8 Let n(q) = q2 + 4q + 19. Let y(b) = -b*2 - 4b - 18. Let o(l) = -5n(l) - 6y(l). What is the units digit of o(-11)? 0 Let f(d) = -d*2 + 8d + 2. Let o(s) = 6s3 - s2 + 3s - 2. Let p be o(1). What is the tens digit of f(p)? 1 Let j = 795 + -375. Suppose 4z + j = -3z. What is the tens digit of 2/((1 + -3)/z)? 6 Let r = -20 - -18. Let u(j) = -5j2 - j + 2. Let o be u(r). What is the units digit of o/(-5) - 2/10? 3 Suppose 2n - 3h - 36 = 0, 0n + 5h + 85 = 5n. Suppose -6 = -3z + n. Suppose -46 = zp - 445. What is the units digit of p? 7 Let p = -6 - -6. Let l = 8 + -2. Suppose li - 7i + 24 = p. What is the tens digit of i? 2 Let o = 1928 - 180. What is the units digit of o? 8 What is the units digit of (-93(-2)/12)/(2/4)? 1 Let f(r) = 8r - 6. Let j be -8 + 9 - (-1 - 3). Let l be f(j). Let p = l - 11. What is the tens digit of p? 2 Suppose 0 = 4l - s - 1004, -5l - 3s = -259 - 996. What is the hundreds digit of l? 2 Let g be ((-224)/120)/14 - 43/15. What is the hundreds digit of (g/(-2))/(5/(-1890)-3)? 1 Let a(m) = 12m2 - 7m - 11. What is the tens digit of a(4)? 5 Suppose -t + 5 = -0t. What is the hundreds digit of 18-2t/((-30)/28)? 1 Suppose 15v + 268 = 1858. Let q = v - -151. What is the hundreds digit of q? 2 Let o be (0 + 0)/(-1 - 0). Suppose o = -l + 5 - 0. Suppose 5s + p - 82 = -3p, -2p = -ls + 94. What is the tens digit of s? 1 Let j(x) be the second derivative of x5/20 - x4/4 - 5x3/6 + 3x*2 + 17x. What is the tens digit of j(5)? 3 Let v(f) = -428f + 22. What is the units digit of v(-4)? 4 Let v(g) = 0 + 4g - 18g - 5 - 8. What is the tens digit of v(-4)? 4 Suppose 11y - 2860 = -9y. Suppose 142v - yv = -99. What is the tens digit of v? 9 Suppose 127 = j - v, -5j + 0v - 2v + 621 = 0. Suppose -h + j = 28. What is the tens digit of h? 9 Let a(n) = -n + 8. Let y be (-9)/(-15) + (-51)/(-15). Let z = y + -4. What is the units digit of a(z)? 8 Let s(j) = -j*3 + 3j*2 - 1. Let z be s(2). Suppose zl = 107 + 73. Suppose 2n + 4m - 26 - 4 = 0, l = 4n - m. What is the tens digit of n? 1 Suppose 70 + 56 = 7n. What is the tens digit of (-6)/4((-546)/n - -5)? 3 Suppose 3m + 2805 = 18m. Suppose -5l + 325 = 5d, 3l - 5d - m = -0d. What is the tens digit of l? 6 Suppose 8 = -2t - 0x + 3x, -2x = 4. Suppose -2o + 7o = -5. Let p = o - t. What is the units digit of p? 6 Suppose -154x = -146x - 5168. What is the tens digit of x? 4 Suppose 3y + 7 = 2n - 36, 5n - 45 = -5y. Let m = 1 + -1. Suppose -8h + 9h - n = m. What is the tens digit of h? 1 What is the thousands digit of (68 + -65)(0 - -334)? 1 Let l = -25 + 30. Suppose lw - 36 = -11. What is the units digit of w? 5 Let x(c) = -5c3 - 10c*2 - 11c + 12. What is the hundreds digit of x(-6)? 7 Let n(p) = p3 + p2 - 3p - 1. Let m be n(-2). Let u be -3 + (2 - m) + -4. What is the units digit of u/(-3) - -1 - -7? 0 Let q(c) = 3c*2 - 5c - 6. What is the units digit of q(11)? 2 Let g(b) = -26b + 7. Let t = 17 + -22. Let l be g(t). Suppose -4n + l = 1. What is the units digit of n? 4 What is the thousands digit of (815/32)/(3/3348)? 4 Suppose -2f + 5u + 65 = 0, 4f - 3u = -35 + 172. Suppose -3r - f = -146. What is the tens digit of r? 3 Let m be 9(-2)/(-6) + (2 - -470). Let j = m + -281. What is the units digit of j? 4 Let f be (-6)/90-10(4 - 1). Suppose -5g + 966 = n - fn, 8 = 2n. What is the units digit of g? 4 Let u(d) = -d*3 + 5d*2 + 10d - 4. Let h be (1/4)/(4/80). Let b = h - 0. What is the units digit of u(b)? 6 Let u = 3447 - 1988. What is the hundreds digit of u? 4 Let o = -70 - -204. What is the units digit of o? 4 Suppose -12s = -10s. Suppose s = -5r + 5i - 245, 0r + r + 4i = -59. Let w = r - -100. What is the units digit of w? 9 Let p(c) = -31c + 1. Let l be p(1). Let f be 140/6 - 22/(-33). What is the units digit of (-16 + 0)l/f? 0 Let w(y) = y*3 + 4y*2 - 13y - 6. Let g be w(-6). Suppose 4i + 2i - 1626 = g. What is the tens digit of i? 7 Suppose -5k = -3 - 7. Suppose -kg = -0g + 8. Let b = g - -18. What is the tens digit of b? 1 Let m(x) = x2 - 4x - 8. Suppose 4a - 40 = -5z - 6, -3z = 5a - 23. Let w(u) = -u*3 + 7u*2 - 5u. Let h be w(z). What is the units digit of m(h)? 4 Suppose 0 = -4z - 5s - 10, 0 = -4s - 8. Suppose z = -w - w - 8, -2j + 4w = -536. What is the units digit of j? 0 Suppose 3 = d - 7. Suppose 5u - 45 = d. Suppose -12r = -ur - 30. What is the tens digit of r? 3 Let q(o) = -12 + 3o + 0 + 29. Let b be q(-5). Suppose -4l = 3t - 120, 2l + bl + 2t - 120 = 0. What is the units digit of l? 0 Suppose a - 12a = -66. Suppose -5s = -4f - 824, -2s - af + 348 = -3f. What is the hundreds digit of s? 1 Let g(a) = 2a + 78. Let m be g(0). Let x = -32 + m. Let u = x + -16. What is the tens digit of u? 3 Suppose 14 = 4y + 3k, -6y + 3y = 5k - 5. Let t be y/(-15) + (-85)/(-3). Suppose -242 = -5g + t. What is the units digit of g? 4 Suppose 8w = -14 - 2. Let i(t) = -5t3 - t + 4. What is the tens digit of i(w)? 4 Suppose 3x = 0, 4g - 6 = -4x + 6. Suppose -4l = -gr - 212, 3l - 120 = l + 5r. What is the tens digit of l? 5 Suppose -3g + 0g = -561. Suppose 3h - 98 = g. Let l = h - 66. What is the tens digit of l? 2 Suppose -6c = -13088 - 7654. What is the thousands digit of c? 3 Let y(v) be the second derivative of 2v4/3 - v3/3 - v2 + 11v. What is the units digit of y(-4)? 4 Let m = 170 + -330. What is the units digit of (27/12)/((-15)/m)? 4 Suppose -t - 22 = -82. Let c = -2 + t. What is the units digit of c? 8 Let m be ((-14)/(-4) - 4)34. What is the tens digit of (m/(-2))/(9/54)? 5 Let s(a) = a - 9. Let z be s(12). Suppose -5f = -zf - 12. Let l(v) = v3 - 6v*2 + 2v - 2. What is the tens digit of l(f)? 1 Suppose 16 = 4u + 8. Suppose uh =	{ "pile_set_name": "DM Mathematics" }
3 + kr2 and give k. -5 Express 17477z3 + z4 + 17905z3 - 31141z*3 + (0z - z + 2z)(0z3 - 4z3 + z3) in the form j + pz2 + hz + tz4 + vz*3 and give v. 4241 Express 177 - 20k - 109 + 3k2 - 49 + (-9 + 9 + 4k)(-5k + 2k + 5k) in the form bk2 + vk + l and give v. -20 Express (968c - 4431c - 701c)(-2c + 1 - 1) as hc*2 + zc + t and give t. 0 Rearrange -58v3 - 123v*2 + v + 64v*3 + 272v*2 to the form i + sv*3 + av + rv2 and give r. 149 Rearrange -367 - 46678g*2 - 246 - 30 + 46669g*2 to lg + ng2 + j and give n. -9 Express -883f + 894f + 6 - 11 - 4 in the form lf + r and give l. 11 Rearrange (157t + 148t - 742t)(4 - t - 4) + (-2 + 2 + t)(t + t + t) to a + dt*2 + gt and give d. 440 Express 71n3 + 0 - 2276n + 0 + n*4 + 58n*3 - 130n*3 as mn + un2 + rn*4 + vn*3 + i and give r. 1 Express 607s*2 - 5s*3 - 605s2 - s3 + 56s4 as os*3 + t + cs*2 + ws + ns4 and give c. 2 Express -12c*2 - 1047 + 1029 - 73c*2 - 120c*2 as fc + vc2 + u and give u. -18 Express 1102w - 2 + 5w4 - 3w*4 - 2217w + 17w2 + 1111w in the form x + jw3 + dw + pw4 + hw*2 and give x. -2 Express -458w*3 + 0w*2 - 11 - 2w*2 - 2 + 518w*3 as fw*3 + gw*2 + vw + c and give f. 60 Rearrange 1224p2 - 2815p*2 + 1359p*2 to vp*2 + hp + z and give v. -232 Rearrange (187 + 206 - 5)(0t*2 + 0t*2 - 2t*3)(3t - t + t)(1 + 1 + 0) to ct2 + ot*4 + bt + st3 + l and give o. -4656 Rearrange (-2 - 479o + 1508o - 451o)(-2 + 5 + 1) to the form t + ro and give r. 2312 Express -4w2 - 9w*3 - w - 8w*3 - 9 + 7 - 3w*3 as mw*2 + bw*3 + l + fw and give m. -4 Express (44v2 - 24v*2 + 32v*2)(2v2 - 16v + 10v - 4v) in the form kv4 + tv + w + pv2 + nv3 and give n. -520 Rearrange f3 + 3f - 3f + (2591f - 1596f*3 - 2591f)(0 + 0 + 2) + (3f + 2f - 3f)(f + f2 - f) to x + tf*2 + hf + jf3 and give x. 0 Rearrange 0 - t2 - 2t*3 + 0 + (4t*2 + 0 + 0)(-1654t - 1 + 1693t + 2) to yt + nt*3 + f + mt*2 and give n. 154 Express -5i - 14 + i*4 - 2 + 7449i*3 - 7448i*3 - 9i*2 in the form fi*3 + li*4 + yi + ki2 + b and give k. -9 Express (-1 - 4 + 3)(-77 + 155 - 77)(2 - 3 - 2)(2f + 0 + 0) as af + n and give n. 0 Express 1731i + 20 - 9 - 31i - 11 as l + ki and give k. 1700 Express -93 + n + 4n*4 + 2n*2 + 2n*3 - 63 - 3n*2 + 135 as in*3 + wn*2 + t + on + an4 and give t. -21 Rearrange -366 + 170 + 197 + 22i + 43i4 to qi*2 + c + ui*3 + ai + oi4 and give q. 0 Rearrange -58 - 5 + 13010d - 12984d to the form jd + y and give j. 26 Express (-4 + 4 - 1)(3g*3 - 155g*4 + 29g*3 - 33g*3) + (0g3 + g3 - 3g3)(-g + 0g - 7g) as bg3 + sg*4 + kg + rg2 + y and give b. 1 Express -50 + 148 - 42 - 56 - 8485z*2 as kz + n + fz2 and give n. 0 Express (-65 + 3369f*2 + 65 + 452f*2)(1 - 5 + 0) in the form yf + nf*2 + i and give i. 0 Rearrange -16723 + 8366 + 6070a + 8357 to ba + r and give b. 6070 Express -43d*4 + 37d*4 + 2d*3 + 10d*4 - 10d*2 as zd*2 + fd*4 + rd + t + ld3 and give z. -10 Rearrange 10665x*2 - 13x - 3073x2 + 13x to the form zx2 + h + qx and give z. 7592 Express (0 - 1 + 2)(-22093 - 23z + 22093)(-4 + 3 - 2) in the form vz + i and give v. 69 Rearrange -3v + 1177 + 2v - 542 - 1991 to hv + l and give h. -1 Express -25y*3 + 3y*2 + 51y*3 - 31y*3 + 156y in the form oy3 + ny*2 + cy + q and give o. -5 Express 2830 + 2816 + 2780 - 8488 - 9f in the form hf + c and give c. -62 Rearrange 417a2 + 410a*2 + 84a*3 - 2a*4 + a - 2 + 1 + 410a*2 - 1236a*2 to the form za + l + ma2 + ga*3 + na*4 and give g. 84 Rearrange (-12 + 165 - 13)(2x - 6x + 6x) - 2 + x + 3 - 3x to the form q + wx and give q. 1 Rearrange 388h + 170h - 2351h - 1600h - 517h to the form a + nh and give n. -3910 Express (-3c*4 + 2c*4 - 33c*4)(52 - 191 - 215) as rc2 + p + hc + yc3 + dc*4 and give d. 12036 Rearrange (1722l - 9 + 7 + 1135l)(-2l2 + 4l*2 + 5l*2) to rl*3 + n + ol*2 + sl and give r. 19999 Rearrange -35421 - 35421 + 70842 + 2559s2 to ts*2 + gs + d and give t. 2559 Express -945x2 + 62x*3 - 12569x + 12569x - 60x*3 as fx*2 + y + ox + rx3 and give f. -945 Express (-713j - 16j4 + 713j)(150 - 47 - 652) as aj*3 + i + nj*4 + tj*2 + kj and give n. 8784 Rearrange -2f2 + 0f*2 + 4f*2 + (-5 + 0 + 8)(3 - 45 + 16 + f*2 - 2f) to the form q + yf2 + df and give d. -6 Rearrange -1280m - 196 + 618m + 669m to the form h + qm and give q. 7 Express (331 - 331 - 18l)(14 + 21 + 6)(-2 - 2 + 1)(-4 + 4 - 1) in the form sl + g and give s. -2214 Rearrange 2y + 21y + 15 - 19 + (3y - 5y + 3y)(7 + 9 + 1) - 2y - 3y + 7y to sy + a and give s. 42 Express 32044m - 2m2 + 2m*3 + 4674 - 64085m + 32040m as h + qm + bm2 + rm*3 and give r. 2 Express ((-26 - 243 + 50)(-4 + 4 + 4) - 1 + 5 - 1)(3r*2 - 2r*2 + 1 + 2r*2) as g + ar*2 + qr and give g. -873 Express 2225 - g - 2223 - g*3 - 13g*2 + 180g*4 + 15g*2 as hg*3 + v + cg*4 + yg + pg2 and give c. 180 Express -3010g*4 - 52 + 16g*2 + 3g - 2982g4 + 5993g*4 in the form q + fg*3 + sg + ag2 + kg*4 and give q. -52 Express 53k*2 + 9k*2 - 68k*2 + 2 + 2k + (-2 + 2 + 1)(10k*2 + 6k*2 + 0k*2) as mk + xk2 + w and give m. 2 Express 2v - 6v + 0v + (1 - 1 - 2)(1 + v - 1) + 2v - 3v - v - 18 + 10v + 18 - 21v + 14v + 15v + 5 in the form t + rv and give r. 10 Express 4k3 + 69k*2 - 22k*2 - 2k - 2 + k - 46k2 as sk*2 + i + yk + qk3 and give i. -2 Rearrange 14133n - 3649n - 41886n to r + wn and give w. -31402 Express (-2 + 2 - 2n)(5 + 2 - 5 - 1 + 4 - 2 + 1 + 1 - 3 + (3 + 2 - 6)(1 + 2 - 2) + 7 - 18 - 10)(-1 + 1 - 4)(8 - 3 - 2) as fn + i and give f. -480 Rearrange (-22h*3 - 19h*3 + 26h*3)(-1609h - 710h + 2536 - 2534) to the form x + lh + zh*3 + ih*4 + th*2 and give l. 0 Express -4165t*3 - 4142t*3 + 8t + 8t2 + 11 + 8305t*3 as wt + yt2 + rt*3 + p and give r. -2 Rearrange (0t - 2t - t)(1 - 6 + 0)(0t - 3t - t)(2t - 4t + t) + 3 - 13t3 + 7076t - 7076t to r + vt*3 + yt + qt2 and give v. 47 Express (n - 3n - 4n)(91 + 89 - 200 + (5 - 1 - 3)(0 - 1 + 2)) + n + 3n - 5n as a + pn and give p. 113 Rearrange 1870r - 1870r - 268r3 + (7 + 24 - 12)(1 + 0 - 2)(6r*3 + 7r*3 + 0r*3) to the form n + vr*3 + qr + hr2 and give v. -515 Rearrange 199j*3 - 393j*3 - 46j + 192j3 + 18j*2 + 4 - 13j*2 to s + yj + tj3 + vj*2 and give t. -2 Express w - 3w - 2w + (2 + 4 - 2)(3 + 4 - 3)(-112w + 486 - 486) as c + lw and give l. -1796 Rearrange 477 - 6y*4 + 8y*4 - 22y*2 + y + 24y*2 - 229 to m + sy + iy4 + ty*3 + cy*2 and give s. 1 Express 9 - 38 - 50q - 3 - 7 in the form l + rq and give l. -39 Express 211 - 10t - 6t + 17t + 61 - 8t in the form o + jt and give j. -7 Rearrange 141r3 + 71975r*2 + 307r*3 - 14 - 71976r*2 to the form br + g + wr3 + or2 and give o. -1 Rearrange -892 - y3 + 6y - y3 - 3y2 + 910 + y2 to p + hy2 + ry*3 + qy and give q. 6 Rearrange -2j3 - 2j3 + j3 + (0j + j + 3j)(7j*2 - 2j*2 - 3j*2) - 2024646 - 29j*3 + 6j + 2024646 to gj2 + vj + rj3 + b and give r. -24 Rearrange -7u + 5 + 3677u2 - 2u*3 - 3783u*2 - 9 + 3u to w + gu3 + iu*2 + pu and give g. -2 Express (6137 + 5694 - 12686 + 4h)(0 + 0 - 4)(1 - 6 + 3) in the form qh + t and give t. -6840 Express 5l - 11l - 44 - 52 - 38 + 70 in the form f + ul and give u. -6 Express 4044n*2 - 80941 + 80941 as p + xn + gn2 and give p. 0 Rearrange 509 - 2k + 510 + 2k2 - 1023 + 2k*4 to the form qk*3 + ok*2 + uk + t + ik4 and give i. 2 Rearrange -5 - i - 2 - 46 + 55 - 4 - 1263i*2 to di*2 + si + x and give s. -1 Rearrange -6a - 5a + 2a - 2649 + 7a - 451 to the form ra + s and give r. -2 Express (-2b + b + 3b)(3b - 5b + 4b) - 2 + 8b*2 + 2 + 48b*2 - 4b*2 - 238b*2 in the form cb + qb2 + v and give q. -182 Rearrange (0a2 - a2 + 0a*	{ "pile_set_name": "DM Mathematics" }
(-2/93) assuming t is positive. t(3983/186) Simplify ((o(-5/3)/o(-1/5))43)(-1/2) assuming o is positive. o(473/15) Simplify (cc6/c)/(ccc/(c(-3/13)/c))ccc(c/(c/c(-12)c)c)/cc((cc(-21))/c)/c assuming c is positive. c(-380/13) Simplify ((((yy0)/y)(-8))(-9))3 assuming y is positive. 1 Simplify (((m(3/5)/m)/m3)(-47))18 assuming m is positive. m(14382/5) Simplify jj*15jjj*(-3/11)jj/((j/(j(-1)/j))/j)j(-5/4) assuming j is positive. j(725/44) Simplify p(2/19)/(p5/p)p(3/4)p(2/33) assuming p is positive. p(-7735/2508) Simplify ((n*(5/3)/nn)/(n*(-38)nnnn))/(n(2/5)n/n0) assuming n is positive. n(514/15) Simplify ((f*3ff(-1/5)f)/(f*(-1/4)ffff2/ffff))(-39) assuming f is positive. f(1521/20) Simplify (z(-3)/z)5z(-1/2)/zz(7/4) assuming z is positive. z(-79/4) Simplify b*(-9/4)/bb*(-3/11)b*(-2/3)b/b24 assuming b is positive. b(-3589/132) Simplify (n(-2/45)/n(24/11))/(n*(-2/89)/n(nnn(4/3))/n) assuming n is positive. n(-155828/44055) Simplify (mm(-3/22)m*(1/2))/(mm(-3/2)/m)14 assuming m is positive. m(246/11) Simplify ((j5/j*(-3))/(((j(j*3/j)/j)/j)/jj*6/jj))(-37) assuming j is positive. j(-74) Simplify (z*10zz(-2/11)/zz)/(z/(zz(-5/7)z))(27/5) assuming z is positive. z(4759/385) Simplify (w(-1/6))(-8/5)/(w(3/5))(-7/4) assuming w is positive. w(79/60) Simplify m3/m*(-15)(mm/m(3/7))(-1/12) assuming m is positive. m(1501/84) Simplify (kkk(-2)kk/(((kk*(-1/6))/k)/kk)(k(-2/5))(-2/39))48 assuming k is positive. k(6824/65) Simplify (k(4/5)k)*44(k(-1/4))(-10) assuming k is positive. k*(817/10) Simplify (((ff*(-3/8))/ff*(-1/6))/((ff(-2/9))/f0))(-28/9) assuming f is positive. f(665/162) Simplify (r(6/5))46(((r(r/r*(-9/2)r)/r)/r)/r)/(r*1r) assuming r is positive. r(577/10) Simplify (z11/z*(-7))/((zz(-9/4))/z(2/33)) assuming z is positive. z*(2549/132) Simplify ((u/(u/(uuu/u0)))/(u(-16/7)u))/(uu/u(3/8))(-6) assuming u is positive. u(393/28) Simplify (c/c(-4))(18/7)/(c(-1/8)c/(c(cccc/(c(-2/19)/c))/c)) assuming c is positive. c(18181/1064) Simplify ((h(-1/17))(-5/12))(-1/23) assuming h is positive. h(-5/4692) Simplify (f2)(-1/8)/(f(((ff/(f/f*(-1/4)ff)f)/f)/f)/ff(ff/f(-15))/ff) assuming f is positive. f(-16) Simplify (p(-3)/(p/(p/(p*3p))))/((pp6)/(ppp5/p)) assuming p is positive. p(-8) Simplify c5/(ccc(-6))cc/c(-3/20)cc(-7/4) assuming c is positive. c(52/5) Simplify (((((r/(r/r(-15)))/r)/rrr)/r(-1/13))(-1/8))(-2/5) assuming r is positive. r(-97/130) Simplify (qq1)(-1/27)(q/q(2/19))23 assuming q is positive. q(10519/513) Simplify (i(-3/2))(-1/2)/(i(-11/2)/((i/(ii/((i*14i)/i)i))/i)) assuming i is positive. i(69/4) Simplify ((g/(ggggg(-6)gg))/g)(-33)g*0/((gg3)/g) assuming g is positive. g(-3) Simplify (x*(-9)x*(4/7)x*(-1/2)((x*(-1/5)/x)/x)/xx)(-4/11) assuming x is positive. x(1558/385) Simplify (((j(-15)/j)/j)/j(-12/5))32 assuming j is positive. j(-2336/5) Simplify ((w/(ww(ww(-6)w)/w)w(1/7)w)/(w*1(w/(ww/((w/(w/w(1/10)))/w)))/ww))(-36/11) assuming w is positive. w(-7614/385) Simplify (m*(-5)/(((mm/m*(2/9))/m)/m)(m(2/7)/m)(-21))(-2/21) assuming m is positive. m(-184/189) Simplify (hh(-6))(-34)((h/h*3)/h)/(hh(-1/15)/h) assuming h is positive. h(2506/15) Simplify (g/(g/(g/g(-2/13))))(4/23)/(g/(gg21g)g6) assuming g is positive. g(4844/299) Simplify h(1/12)h/(hh7)h*(2/3)h(-21) assuming h is positive. h(-109/4) Simplify z*(-1)zzz/(z/(z/z*(10/9)))z/(z*1/z)z/(z(-5/6)/z) assuming z is positive. z(85/18) Simplify ((v(-5)/v(-1/10))/(v*7(vv(-3)/vv)/v))(-2/3) assuming v is positive. v(89/15) Simplify (z6)(3/11)/(z/(zz(-5)))25 assuming z is positive. z(-1357/11) Simplify c(-27)/c(-25)c*(-2/13)c/(c/(cc/(c/(ccc/(c(-21)c)))c)) assuming c is positive. c(297/13) Simplify (o/(o/o(-9/5)))(1/2)((oo(-3/25))/o)(-2/127) assuming o is positive. o(-5703/6350) Simplify (t23)(-5/3)(t/t*5t)/tt/((t(t(tttt(-29))/t)/t)/t) assuming t is positive. t(-43/3) Simplify (o/o(1/8))24(o(-2/19)o)(-49) assuming o is positive. o(-434/19) Simplify (i0)(2/5)/(i(2/7))(-33) assuming i is positive. i(66/7) Simplify (n(3/4)/nnn)*(4/19)/(nn*(1/9)n(-3)/n) assuming n is positive. n(557/171) Simplify ((t/(((t*(-14)t)/t)/t)(t(-3)/t)/t)(-23))(-49) assuming t is positive. t12397 Simplify (q(-5/2)q/q*(-1/7))/(qq(q/(q(q*(1/23)q)/q))/qq/q(-31)) assuming q is positive. q(-11049/322) Simplify (r(-2/5))44r/(rr(6/7)r)(r/(r/(r14r)))/rrr assuming r is positive. r(-121/35) Simplify (d/(d(-2/11)/d)dd(-2/29))/(d5)(4/13) assuming d is positive. d(6529/4147) Simplify (((x/x(2/9))(-49))(-3))(-11/6) assuming x is positive. x(-3773/18) Simplify (u2u3u*(2/5)/uu/u(-5))(2/93) assuming u is positive. u*(104/465) Simplify (w/(ww*(2/5)w)w(w/((w/w*(-1/4))/w))/w)/(ww(2/5))(-11/7) assuming w is positive. w(31/20) Simplify (((l16l)/l)/ll)/(l*(-12/7)ll)(llll(-2/11))(-47) assuming l is positive. l(-8989/77) Simplify (i(2/7))(1/7)/(i(1/4))(2/9) assuming i is positive. i(-13/882) Simplify (((k0/k)/k)(-17/6)/((kk(-1/3))/k(-1/6)))(2/17) assuming k is positive. k(29/51) Simplify (s(2/13)/s8)/(s*6s(ss/(ss(-3/2)))/s) assuming s is positive. s(-425/26) Simplify (((i1)(-3/5))(5/8))31 assuming i is positive. i(-93/8) Simplify (b(2/25)(b*(-23)b)/b)(-2/49) assuming b is positive. b(1146/1225) Simplify h*(-5)/hh/(hh(3/2))(h/(hh/(h(((((hh/(h(4/5)h))/h)/h)/h)/h)/h)))(-5) assuming h is positive. h(33/2) Simplify ((vv0)/v(-5/2)(v*(-1/2)v)(-2/31))(-5/14) assuming v is positive. v*(-1075/868) Simplify ((ff/(f((f(-1/2)/f)/f)/f))(4/11)((f/f*(-6/13)f)/f)/((ff/f2f)/ff))(1/55) assuming f is positive. f(60/1573) Simplify ((a(-2)a)/(a2/a))/(a(2/9)(a/a27)/a) assuming a is positive. a(223/9) Simplify ((b27/b)/b)(-3/43)/(b/((b/(((bbb/(b/b(-1/10))bb)/b)/b))/b))47 assuming b is positive. b(-59359/430) Simplify (x/(xx*(-1/10)xxxx)x24/x)(-15) assuming x is positive. x*(-573/2) Simplify ((z/(z/(zzzz*5))z/z*(-5)z)/(z(2/3))(-19/6))14 assuming z is positive. z(2156/9) Simplify (mm/(((mm/(m*(1/2)m)mm)/m)/mm))35/(m(4/7)(m/(m/(m/((m(-1/3)/m)/m))))/m) assuming m is positive. m(613/42) Simplify hh(-14)h(h/h(-12))/hh((h/h1)/h)(-15) assuming h is positive. h16 Simplify (m/(m21/m))/(m(-22)/m)m(-23)/m(-2/55) assuming m is positive. m(-1043/55) Simplify ((r(2/5)/r)/r)25/(r(2/27)/r(-1/8)) assuming r is positive. r(-8683/216) Simplify (w18/(w/w(-10)))/((((w/(ww(-10))ww)/w)/ww)/ww(-8)) assuming w is positive. w5 Simplify l/(l/(ll/(l/(l/(ll/(ll*(1/6))))))l)((llll*(5/2)/ll)/l)/ll(l/((l/(l*(1/26)/l)lll)/l)l)/l(1/16) assuming l is positive. l(1649/624) Simplify ((s8sss(-7/4))(-19))(-6) assuming s is positive. s(1881/2) Simplify (f(2/9)/f)(-14/5)f(fff/f*(-4/7))/ff(-3) assuming f is positive. f(866/315) Simplify i/i*(-4/3)ii(i/i*(-3/10))/i((iii*13iii)/i)/(ii19i) assuming i is positive. i(19/30) Simplify (z/z6)(-37)/(z(-28)z(3/17)z) assuming z is positive. z*(3601/17) Simplify (((ggg(-2/31)g)/g)/(g/(g*(6/7)g)))(16/7) assuming g is positive. g(9696/1519) Simplify (w/(ww(-33))w14)/(w(-18)w)(-46) assuming w is positive. w(-735) Simplify (i2/(i/i(1/15)))/(i2)1 assuming i is positive. i(-14/15) Simplify ((v2)(-31/2)(vv(-2))/(v/(vv*3v)v))36 assuming v is positive. v(-1044) Simplify ((((u/(u/((u/(u/(u(-26/9)/u)))/u)))/u)/u)/u9)/(u(2/19))39 assuming u is positive. u(-3419/171) Simplify uu*(3/17)uuu*(2/15)uu/(u/(u/(u/(uu*(-5/2)u)u)u))u*(1/12) assuming u is	{ "pile_set_name": "DM Mathematics" }
cked without replacement from ccllllll? 3/7 Two letters picked without replacement from {r: 1, z: 2, c: 1}. Give prob of picking 1 z and 1 r. 1/3 Three letters picked without replacement from fcfffcffdfffddcfcf. What is prob of picking 1 d and 2 c? 3/136 Three letters picked without replacement from {h: 4, j: 2, m: 7}. What is prob of picking 3 h? 2/143 Four letters picked without replacement from hofohooohhhhhhohkf. What is prob of picking 2 o and 2 f? 1/204 Four letters picked without replacement from {d: 2, m: 2, b: 1}. Give prob of picking 2 m and 2 d. 1/5 Two letters picked without replacement from aadddqqqdqq. Give prob of picking 1 d and 1 a. 8/55 Three letters picked without replacement from naobiabg. Give prob of picking 1 b, 1 i, and 1 n. 1/28 What is prob of picking 2 a when two letters picked without replacement from {j: 3, a: 4}? 2/7 What is prob of picking 1 h and 1 l when two letters picked without replacement from {g: 4, l: 3, q: 1, t: 1, h: 1, r: 2}? 1/22 What is prob of picking 1 y and 1 c when two letters picked without replacement from kcykkkwcq? 1/18 Calculate prob of picking 1 n and 1 w when two letters picked without replacement from dfwbndbvbwffvw. 3/91 What is prob of picking 3 q when three letters picked without replacement from {q: 4}? 1 Two letters picked without replacement from rssrs. What is prob of picking 1 s and 1 r? 3/5 Two letters picked without replacement from wwrwrr. Give prob of picking 2 w. 1/5 What is prob of picking 1 o and 1 m when two letters picked without replacement from momoomoomoomo? 20/39 Two letters picked without replacement from ieeedideeeiieeie. What is prob of picking 2 e? 3/10 Two letters picked without replacement from rcyyj. Give prob of picking 1 j and 1 r. 1/10 Four letters picked without replacement from {n: 1, y: 1, j: 4, h: 5, q: 1, l: 3}. Give prob of picking 1 q, 2 j, and 1 l. 6/455 Three letters picked without replacement from eedxeddteddddxetieee. What is prob of picking 1 d, 1 t, and 1 x? 7/285 What is prob of picking 2 c when two letters picked without replacement from ckeccekeceec? 5/33 What is prob of picking 1 q, 1 y, and 1 g when three letters picked without replacement from {r: 1, m: 5, y: 1, g: 1, q: 6, i: 6}? 1/190 Four letters picked without replacement from {w: 1, v: 1, u: 2, l: 1, m: 2}. Give prob of picking 1 v, 2 u, and 1 l. 1/35 What is prob of picking 1 n and 2 v when three letters picked without replacement from lvlnljlllvljjlnjlll? 2/969 Calculate prob of picking 1 w and 1 s when two letters picked without replacement from wsssxcwsk. 2/9 Calculate prob of picking 2 u and 1 j when three letters picked without replacement from lflxulxxflujulc. 3/455 Two letters picked without replacement from {x: 1, c: 5, f: 1, g: 4}. What is prob of picking 1 x and 1 c? 1/11 What is prob of picking 2 q and 2 f when four letters picked without replacement from {f: 2, q: 5}? 2/7 Two letters picked without replacement from {d: 2, x: 3, o: 3, k: 9, i: 2, h: 1}. Give prob of picking 1 k and 1 x. 27/190 Two letters picked without replacement from {h: 1, q: 1, w: 2, t: 1, p: 2, v: 2}. What is prob of picking 1 p and 1 q? 1/18 What is prob of picking 3 a and 1 f when four letters picked without replacement from {f: 5, j: 6, l: 4, b: 1, a: 4}? 4/969 Four letters picked without replacement from ciiicciciiciicccci. What is prob of picking 3 i and 1 c? 21/85 Two letters picked without replacement from {y: 5, w: 2}. What is prob of picking 1 w and 1 y? 10/21 Two letters picked without replacement from ffssss. What is prob of picking 2 f? 1/15 What is prob of picking 1 u, 1 b, 1 t, and 1 p when four letters picked without replacement from {t: 3, k: 1, u: 3, o: 1, p: 6, b: 1}? 18/455 Calculate prob of picking 3 e and 1 x when four letters picked without replacement from xdyye. 0 What is prob of picking 2 m and 1 x when three letters picked without replacement from xxmmcmmxcmcwxm? 15/91 Calculate prob of picking 2 m when two letters picked without replacement from jmwmjmmjmn. 2/9 Three letters picked without replacement from lrlrrrlrrrrrlrrlrrrr. Give prob of picking 2 r and 1 l. 35/76 What is prob of picking 2 k when two letters picked without replacement from {n: 1, q: 14, k: 2}? 1/136 Calculate prob of picking 4 y when four letters picked without replacement from yynnyyyynnnyyy. 18/143 Two letters picked without replacement from dbbsssr. What is prob of picking 1 d and 1 s? 1/7 Four letters picked without replacement from xuxwzuxxxvuxvxxwxux. Give prob of picking 2 x, 1 u, and 1 z. 15/323 What is prob of picking 1 m and 1 l when two letters picked without replacement from czcczccmwlcctc? 1/91 Four letters picked without replacement from urrrrgggrgrnr. Give prob of picking 2 g, 1 n, and 1 u. 6/715 Two letters picked without replacement from wwbcupppppupccwkkkc. Give prob of picking 1 k and 1 u. 2/57 What is prob of picking 1 j and 1 k when two letters picked without replacement from kfjkjf? 4/15 Three letters picked without replacement from svsszvzzvzv. Give prob of picking 2 z and 1 v. 8/55 Three letters picked without replacement from hxhhhhhhhhhhhhhxhhhh. What is prob of picking 1 x and 2 h? 51/190 Four letters picked without replacement from wtuwuauutdtww. What is prob of picking 1 t, 2 u, and 1 d? 18/715 Two letters picked without replacement from {h: 2, d: 4, f: 2, c: 2, n: 1, i: 3}. What is prob of picking 1 c and 1 d? 8/91 Calculate prob of picking 2 u, 1 q, and 1 w when four letters picked without replacement from {u: 3, q: 4, w: 4, l: 7}. 4/255 Two letters picked without replacement from {b: 2, g: 1, f: 1}. Give prob of picking 1 g and 1 f. 1/6 Three letters picked without replacement from {d: 7, u: 5, b: 3, v: 1}. What is prob of picking 1 v, 1 d, and 1 b? 3/80 Three letters picked without replacement from efppdpeeeefevpweff. Give prob of picking 1 p, 1 e, and 1 w. 7/204 Calculate prob of picking 2 e when two letters picked without replacement from {e: 4, m: 2}. 2/5 What is prob of picking 3 g and 1 b when four letters picked without replacement from {c: 1, b: 1, g: 3}? 1/5 What is prob of picking 1 i and 1 q when two letters picked without replacement from {i: 1, j: 4, x: 1, q: 2, z: 3}? 2/55 Calculate prob of picking 1 o and 1 h when two letters picked without replacement from hnehlehhonoonohn. 1/6 Two letters picked without replacement from {v: 8, a: 2}. Give prob of picking 2 v. 28/45 Calculate prob of picking 1 a, 2 y, and 1 f when four letters picked without replacement from arrrfrffyrrrryffrafr. 4/1615 Calculate prob of picking 1 w and 1 v when two letters picked without replacement from qcwqwov. 2/21 Two letters picked without replacement from ppppppps. Give prob of picking 2 s. 0 What is prob of picking 1 s, 1 j, and 1 f when three letters picked without replacement from ifjojfsff? 2/21 Calculate prob of picking 4 a when four letters picked without replacement from aeeaeeaaeeeaeaeaaaea. 14/323 Two letters picked without replacement from qqbbbqqblbr. Give prob of picking 2 b. 2/11 What is prob of picking 1 f and 1 g when two letters picked without replacement from {f: 3, p: 2, d: 2, g: 2}? 1/6 Three letters picked without replacement from vvvvvnn. What is prob of picking 1 n and 2 v? 4/7 Four letters picked without replacement from {y: 2, d: 2, x: 5}. What is prob of picking 2 d, 1 y, and 1 x? 5/63 What is prob of picking 1 p and 1 i when two letters picked without replacement from qqippjpiiq? 1/5 What is prob of picking 1 h and 1 m when two letters picked without replacement from hmmmmmmmmhmmmmmmhmh? 20/57 Two letters picked without replacement from {e: 1, f: 4, o: 1, v: 6, j: 6}. Give prob of picking 1 f and 1 v. 8/51 Four letters picked without replacement from {s: 4, q: 4, v: 4, n: 1, p: 1, y: 4}. Give prob of picking 1 p, 1 n, and 2 s. 1/510 What is prob of picking 1 g, 1 s, and 2 m when four letters picked without replacement from mmsgmsiomoo? 2/55 Three letters picked without replacement from {z: 5, x: 7}. What is prob of picking 1 x and 2 z? 7/22 Calculate prob of picking 2 p when two letters picked without replacement from ppzpqwppqwpzpp. 4/13 What is prob of picking 2 u when two letters picked without replacement from uwptuittcwucucu? 2/21 Three letters pic	{ "pile_set_name": "DM Mathematics" }
sqrt(7) + 2)) + (-1 + (sqrt(7) - sqrt(336)/sqrt(3)))2 + 4). -345 - 35sqrt(7) Simplify 3((-1sqrt(684)-1)2 - (-2sqrt(684) + -3)) - (-2 + sqrt(684) + 1 + 2)3. 18sqrt(19) + 2058 Simplify (4-25(1 + sqrt(468) + -1 + sqrt(468) - sqrt(468) - (-4 + 0 + sqrt(468)))-5)*2. 640000 Simplify (1(sqrt(275) + 24sqrt(275) + -5 + sqrt(275) + sqrt(275) + 0 + -5 + (sqrt(275) - (sqrt(275) + -2))1))2. -880sqrt(11) + 33339 Simplify -5 + (4sqrt(108) + sqrt(108))-1 - (sqrt(84)/sqrt(4)-2 + sqrt(21))/(-1sqrt(28)/sqrt(4)). -31sqrt(3) - 5 Simplify (sqrt(200) + -1)2 + 2 + 1 + -3 - (sqrt(54)5)/(sqrt(192)4). -655sqrt(2)/32 + 201 Simplify (sqrt(528) - (sqrt(528) + -1sqrt(528) - sqrt(528))6)/(sqrt(22)/(sqrt(8)/sqrt(4))) + 0 + (2sqrt(384)-2)/sqrt(8). 12sqrt(3) Simplify -5 + ((1 + -2sqrt(112) - (sqrt(112) - (sqrt(112) - 5(sqrt(112) + -2sqrt(112) + sqrt(112)))))*2 - -1(sqrt(448) + (sqrt(448) + 1)-1)). -16sqrt(7) + 443 Simplify ((4-2sqrt(2662)-1)/((sqrt(1100) - (sqrt(1100) - (sqrt(1100) + 2(sqrt(1100) - 2sqrt(1100)))))-1))*22. 7744/25 Simplify -4((sqrt(833) - (-1 + sqrt(833)))-3 + (sqrt(833) - sqrt(833)-14) + sqrt(833) + (-3 + (sqrt(833) + 4sqrt(833) - sqrt(833)))-1)*2. -13328 Simplify (6((sqrt(140)/sqrt(5))/sqrt(2) - sqrt(14)))/(sqrt(14)/(-1sqrt(2)4)) + -3. -3 Simplify -1 + (-54(sqrt(343) + -2 + -2 - (sqrt(343) + sqrt(343) + 1)-5))2. 61600sqrt(7) + 16601599 Simplify 6(1-1sqrt(66) - ((sqrt(66) - (-5-4sqrt(66) + sqrt(66))) + sqrt(66)))/(sqrt(12)/sqrt(2)1 - sqrt(216)2). -108sqrt(11)/11 Simplify 5(-6(5 + -2 + 2 + sqrt(684) + (-4 + -1sqrt(19))-1 + 1))*2. 25200sqrt(19) + 185580 Simplify 6(2 + (6sqrt(68)3 - (1(sqrt(17) + sqrt(272)) + (sqrt(17) - (sqrt(17) - (-1sqrt(204))/sqrt(12)))))2). 104460 Simplify ((-4(sqrt(136) + sqrt(136)-2 + sqrt(136)) + sqrt(136) - sqrt(136))/(sqrt(8)11) + (sqrt(2448) + -1sqrt(2448))*2-3-5)1. 0 Simplify 0 + (-1sqrt(81) - sqrt(9))/(sqrt(12) - -1sqrt(12)) + ((sqrt(336) - (sqrt(336)-2 + sqrt(336)))/sqrt(7))2 + (sqrt(27) + 0)1. 2sqrt(3) + 192 Simplify (-5(3(sqrt(252) + 1) + 6(-2 + sqrt(252)))1-1)*2-2-4. -194400sqrt(7) + 4098600 Simplify (1 + (2sqrt(2))2 - sqrt(2)) + sqrt(2) + sqrt(162)1 - ((sqrt(2) - (sqrt(18))*2)-3 - (sqrt(200) + 0)). -45 + 22sqrt(2) Simplify (sqrt(4320) - -3sqrt(4320) - (sqrt(330)4)/sqrt(11))/((sqrt(80)1)/sqrt(8) + sqrt(10) - (sqrt(10) - sqrt(10)-1)6). -22sqrt(3)/5 Simplify ((((1 + sqrt(171))2 + sqrt(171))4 - (-1 + -1sqrt(171) - (sqrt(171) + -1 + 5)))-5)2. 27300sqrt(19) + 842125 Simplify 2 + ((-1sqrt(726) + sqrt(726))/(sqrt(2) - -43sqrt(2))-2)*2. 2 Simplify (-2 + (sqrt(154)/((sqrt(343) - 1sqrt(343)) + sqrt(343)))/(sqrt(99)/(sqrt(81) - sqrt(9))-2))2. -4 - 2sqrt(2)/7 Simplify ((sqrt(80) - 2(sqrt(80) + sqrt(80)2 - sqrt(80)))/(sqrt(8)/sqrt(2)-2))/((sqrt(1024)1)/sqrt(4)4). 3sqrt(5)/64 Simplify ((sqrt(3087)-2)/(2sqrt(144)) + 4)2 + (sqrt(7) + sqrt(70)/(sqrt(10) + sqrt(60)/sqrt(6)) - sqrt(77)/(sqrt(44)/sqrt(4))) + -4. -27sqrt(7)/2 + 535/16 Simplify (3 + 5 + ((sqrt(80) + (sqrt(80) - (sqrt(80) + -3sqrt(80))))/sqrt(4))2 + (sqrt(20)-2 + 5)*2)-15. -2165 + 200sqrt(5) Simplify (4-5(0 + sqrt(1008))-5)2 + ((-1(sqrt(1008) + sqrt(1008)-2) - (1(1 + sqrt(1008)) - sqrt(1008))) + 2)*2 + 0. 24sqrt(7) + 10081009 Simplify (-2 + -5(sqrt(39)/sqrt(3) + -5))2 - (-4sqrt(234))/(-2sqrt(162)). -692sqrt(13)/3 + 854 Simplify 1(3 + (sqrt(612)1 + 5 - sqrt(612)) + sqrt(612) + -5 + ((-1 + (sqrt(612) - sqrt(612)-2))2 - 6(sqrt(612) + -1)*2)). 42sqrt(17) + 1834 Simplify -1 + (6(2sqrt(99)-3 + sqrt(99))1)/((2sqrt(3888))/(5sqrt(6)/sqrt(2))). -25sqrt(11)/4 - 1 Simplify (sqrt(2736) + 1)3 - (2 + (sqrt(2299) - 2sqrt(2299) - sqrt(2299)) - sqrt(2299)) - -3(2 + -2sqrt(684) + 5)2. -435sqrt(19) + 8356 Simplify (-3 + (sqrt(1872) + -2 + sqrt(1872) - sqrt(1872))5 - (3 + (sqrt(1872)1 + -4)*2)) + 3 + 2. -1899 + 156sqrt(13) Simplify (-6(-3 + sqrt(1539) + 1sqrt(1539) + sqrt(1539)) + -4 - (1 + 6sqrt(1539) + sqrt(1539) + 0 + 5))2. -3600sqrt(19) + 961939 Simplify 6(-4sqrt(1224)-4)/(-1-1sqrt(2)-1)-2. 1152sqrt(17) Simplify -6-6-5(-6(2sqrt(1053))2-1 + (4 + 33sqrt(1053) + sqrt(1053))*2). -23505840 - 129600sqrt(13) Simplify 5(4 + (sqrt(275)2 - sqrt(275))*2) + 3 + (sqrt(99)1)*2 + sqrt(99) + (sqrt(11) - (sqrt(110)/(sqrt(10) + sqrt(160)) + sqrt(11))). 14sqrt(11)/5 + 1497 Simplify 1 + (2sqrt(209)2-53)/((sqrt(704)5)/(sqrt(64)/sqrt(4))). -6sqrt(19) + 1 Simplify 1(-6(sqrt(136)3 - sqrt(136) - sqrt(136)) + sqrt(136) + sqrt(136)-1-3)/(sqrt(648) - (sqrt(648) + sqrt(648)-3) - 1sqrt(8)2). -2sqrt(17)/25 Simplify (-1((1sqrt(1088)5 - (-1 + sqrt(1088) + 1)) + (sqrt(1088)1-1 + sqrt(1088) - sqrt(1088))-3)-3)*2. 479808 Simplify ((32sqrt(187) - sqrt(187)-1-5)/(3sqrt(44)3)1)*2. 17/324 Simplify (-2(sqrt(80) + sqrt(80)-3) + 0 + sqrt(80) + -2 - -5(1 + ((2sqrt(80) - sqrt(80))2 - sqrt(80))))*2. 240sqrt(5) + 8009 Simplify -1(14(0 + (sqrt(684) - ((1 + sqrt(684) + -3 - sqrt(684)) + sqrt(684)))2) + -5) + 5. -6 Simplify (5((sqrt(330)/(sqrt(40)/sqrt(4)))/(-2sqrt(363)) + (sqrt(110)23)/(sqrt(40)/(sqrt(36) + sqrt(4)))))2. 6943225/44 Simplify (-5(0 + 0 + sqrt(605) + -2sqrt(605)-2) - (-3sqrt(605)-2 + 2(-2 + sqrt(605))))2-4. -2635444 + 11616sqrt(5) Simplify -3 + ((5 + 3sqrt(2) - (3sqrt(4))/sqrt(2))3 - (-52sqrt(288) - ((sqrt(2) + sqrt(32))-2 + (sqrt(2) - sqrt(150)/sqrt(3)))))2. 3180sqrt(2) + 22694 Simplify (sqrt(684) + -6(-1 + sqrt(684) + sqrt(684)) + -5 + 2 + 23(-1 + (sqrt(171) - sqrt(19)) + 4))2. -2268sqrt(19) + 55845 Simplify (-4((-1sqrt(1100) - sqrt(1100)) + 5) + -3 + sqrt(1100) + (sqrt(1100) - sqrt(1100)3) + 3)3. -60 + 210sqrt(11) Simplify ((-5(sqrt(364) - ((6sqrt(364) - sqrt(364)) + sqrt(364))))/sqrt(7))/(((sqrt(72)5)/sqrt(9) + sqrt(8))/sqrt(2)). 25sqrt(13)/6 Simplify (-1sqrt(972) + sqrt(27) - 3sqrt(2187))/((sqrt(324) - -1sqrt(324) - sqrt(324))2 + (sqrt(324) - sqrt(324)25)). 16sqrt(3)/21 Simplify -3 + 5 + (((sqrt(99) - 1sqrt(99)) + sqrt(99))/sqrt(9) - (sqrt(11) + 1)-4) + (5 + (5 + sqrt(99) + sqrt(99) + -2 - sqrt(99)))*2 + 1. 170 + 53sqrt(11) Simplify (-5(-3sqrt(8064) + sqrt(8064) - sqrt(8064)) + sqrt(8064))/((-3-1sqrt(88))/sqrt(11)). 64sqrt(7) Simplify (sqrt(704)-1)*2 + 1 + ((3-1sqrt(121))/sqrt(11))2 - (-3sqrt(3168))/(sqrt(72)-5). -6sqrt(11)/5 + 804 Simplify -5 + 6(sqrt(432) + 4 + -1 + (1(-3 + sqrt(432) + sqrt(432)) + sqrt(432))*2). -1224sqrt(3) + 23395 Simplify (-2 + (3 + sqrt(99) + 0 + 4)*2 + ((0 + sqrt(99) + 2)6 + -1)*2)-1. -3831 - 438sqrt(11) Simplify ((1 + -3 + 4(sqrt(396) + (3sqrt(396) + sqrt(396))6))-66 + 5)*2. -3326400sqrt(11) + 5132165929 Simplify -4(sqrt(84)/(sqrt(120)/(3sqrt(10))) + 0 + (2 + sqrt(7))-3)2. -144 Simplify -4(0 + (sqrt(1088) - sqrt(1088)-2) + -5)2 + ((sqrt(1088) + 0)-6 - (2 + -1 + sqrt(1088)))*2. 1072sqrt(17) + 14045 Simplify (((sqrt(833) + (sqrt(833) - 1sqrt(833)))-3 - 6(sqrt(833) + 1))4)*2 - -6(6(sqrt(833) + 0) + 0). 12348sqrt(17) + 1080144 Simplify (((sqrt(125) + 0)4 - 1(sqrt(125) + (sqrt(125) - -1sqrt(125)))) + 3)2 + (-5((sqrt(15) + sqrt(135))-6)/((sqrt(48)/sqrt(2))/sqrt(8)))2. 30sqrt(5) + 72134 Simplify ((sqrt(300)/(sqrt(24)/sqrt(2))2)/(sqrt(30)/(sqrt(66)/(sqrt(11) + 1sqrt(11)))) + -5)-1. -sqrt(5) + 5 Simplify ((sqrt(95) - (-3sqrt(95) - sqrt(95))-3)-1-2)/(-1(sqrt(320) - -2sqrt(320)) + ((sqrt(320) - -2sqrt(320)) + sqrt(320) - sqrt(320))-4). 11sqrt(19)/60 Simplify ((sqrt(392)-1-4 - sqrt(392))/(sqrt(21)/sqrt(3)-3))/((sqrt(128) - (sqrt(128) + -1sqrt(128))) + sqrt(8) + sqrt(72)/sqrt(36)). -2sqrt(7)/11 Simplify 1(((-1 + sqrt(180))4 + 0 + sqrt(180) + 2 - -5(sqrt(180) - (sqrt(180) + -1)*25)) + 0). -4527 + 360sqrt(5) Simplify 4 + 5((sqrt(5) - (sqrt(5) - -5(sqrt(5) + 2)) - ((sqrt(5) - (sqrt(5) + -4)) + 2))2 + -3)-5 + -1. -9447 - 4000sqrt(5) Simplify 4 + -4-3sqrt(200) + (sqrt(128)-4)/(2sqrt(16) + sqrt(16)). 4 + 352sqrt(2)/3 Simplify (-5-2-1-1sqrt(304)-2-46)2. 70041600 Simplify -4(-1(sqrt(500) - (sqrt(500) - (sqrt(500) + -1))2)2 + -5 + (-3 + sqrt(500) - sqrt(500))2 + 5) + 4. -160*sqrt(5) + 1984	{ "pile_set_name": "DM Mathematics" }
ultiple of 3 and (-15)/(-25) + (-17)/i. 12 What is the common denominator of 29/198 and 28539/(-2430) - (-4)/9? 990 Suppose q + 4q - 4w - 200 = 0, q = -2w + 26. Suppose 5i - 84 = -3k, -27 = -k + 3i - 5i. Calculate the lowest common multiple of q and k. 396 Find the common denominator of (-10)/(-130) - 2118/(-351) and -61/10. 90 Suppose -p - 3p - 1756 = 2m, 434 = -p + 2m. Find the common denominator of p/60 + 2/5 and 2805/(-275)(-2)/(-3). 10 Let v = -1/17983 - -1168911/287728. What is the common denominator of v and -81/4? 16 Let v(z) = z3 + 24z*2 + 23z + 1. Let k be v(-23). Find the common denominator of -43/11 and k(184/(-44) + 1). 11 Suppose 4u = -2o + 18, -16 = -3o - o + 2u. Suppose -3p = -p - 5j - 17, oj + 39 = 4p. Calculate the least common multiple of 2 and p. 22 Suppose -28692 = z - 4z. Let r be z/(-22365) + (-3)/(-7). Let b = r + 3313/355. Find the common denominator of b and 38. 3 Suppose -44 = 4y - 76. Calculate the smallest common multiple of 33 and (-792)/(-55) + (y/5 - 1). 165 Calculate the common denominator of (-6)/4 + (-410)/(-148) and 5/(-6) - (-11492)/1248. 296 Let g(i) = -4i*3 + 4i*2 - 3i + 2. Let l be g(2). Let m = -2 - l. What is the lowest common multiple of 24 and m? 72 Let b = -4742/3 - -1602. What is the common denominator of 7/18 and b? 18 Let w(n) be the second derivative of 13n4/12 + n3/6 + n2/2 + 4n. Let v be w(-1). What is the smallest common multiple of v - (-2 - 1)/(-1) and 10? 10 Let j = -319 + 325. What is the smallest common multiple of 208 and j? 624 Suppose 2t + 2m = 24, -2t + 0t = 3m - 29. Calculate the least common multiple of t and 9 + (-2)/(-9) + (-64)/288. 63 Let j(b) = -5b - 23. Let g be j(-4). Calculate the common denominator of g(-9)/(-54)(-53)/(-6) and 17/15. 60 Suppose 5a + 8 + 22 = 0. Let c be a/8 - 185/20. What is the common denominator of 0 + 2 + c/7 and 9/7? 7 Let d(m) = -m - 10. Let q(r) = -r + 3. Let b be q(3). Let t be d(b). What is the least common multiple of 9 and t/4(6 + -10)? 90 Suppose -4w - 3630 = w. Find the common denominator of w/120 + (-1)/(-2) and 51/14. 140 Let q = 35 - 35. Suppose q = -2l + 74 - 26. Calculate the smallest common multiple of l and 4. 24 Let p(k) = k*2 + 25k + 57. Calculate the least common multiple of 296 and p(-35). 3256 Calculate the common denominator of 6(1 - 2) - (-11)/44 and (-394)/8 + 2/(-8). 4 What is the smallest common multiple of ((-12)/18)/((-2)/12) and (2 - (3 + -2)) + 13? 28 Let k = -417 - -529. Calculate the least common multiple of k and 144. 1008 Let r(b) = 94b*2 + 4b - 6. Let j be r(6). Let n = 1362 - j. What is the common denominator of 97/4 and (n/64)/(3/(-4))? 4 Suppose -25b = -21b + 4. Let g(c) = -4c - 4. Let f be g(8). What is the common denominator of -43/14 and (b/(-4))/(f/(-207))? 112 Suppose 4o = 3o + 1. Calculate the smallest common multiple of 18/55/2 and (9 - -2) + -1 + o. 99 Let l = 62011/71757 + -212/603. Find the common denominator of l and 21/85. 595 Suppose -4b + 0k + 244 = 2k, 3b = k + 193. What is the lowest common multiple of b and 91? 819 Suppose -5y + 16y = 330. Suppose 0 = -10i + 13i - y. Calculate the smallest common multiple of i and 4. 20 Suppose 5g + 20 = -2a, 4g + 23 = a - 4a. Let n = g + 7. Suppose -6d + 4d = -16. What is the least common multiple of n and d? 40 Suppose 492 = 13a - 9a - 4v, 0 = -a - 5v + 141. Calculate the smallest common multiple of 14 and a. 126 Let g = -8/149 - 11416/9387. Calculate the common denominator of 53/70 and g. 630 Let n(v) = 3v + 35. Let o be n(-21). Let h = o + 30. Let m = -2 - -14. Calculate the least common multiple of m and h. 12 Suppose -y - 3c - 45 = -20, -3y - c - 59 = 0. Let i = -40 + 37. Let k = i - y. Calculate the smallest common multiple of k and 8. 16 Let r = 799 + -12879/16. Find the common denominator of r and (-214)/(-56) + -1 + 1. 112 Let l = -3758 - -101426/27. Calculate the common denominator of 1 + ((-2576)/105)/8 and l. 135 Let b = -64 + 84. Suppose -3d - d = h - b, d + 2h - 12 = 0. Let m = -7 - -19. Calculate the smallest common multiple of d and m. 12 Let r(v) = v3 - 7v*2. Let q be r(7). Suppose 0a + a - 4j - 34 = q, 0 = -2j - 10. What is the common denominator of ((-3)/a)/(2/52) and -71/6? 42 Let f be 1/(-6) + 4081086428/192. Let j = f - 21263844. Let h = -8192 - j. What is the common denominator of 19/10 and h? 80 What is the smallest common multiple of 36 and 91/5 + -5 + (-240)/(-50)? 36 Suppose 5v = 10 + 500. What is the common denominator of -31/2 and (v/30)/((-12)/50)? 6 Calculate the least common multiple of 26 and (-8 + (-1870)/(-11))(-2)/(-6). 702 Let b = -12/35 - -341/280. Calculate the common denominator of -35/62 and b. 248 Let k be 4849/1920 + (27/(-15))/(-3). Let q = k + 1/128. Calculate the common denominator of -50/3 and q. 15 Let q = 44624986/7085 - 250972752969/39851708. Let u = q + 1/7031. What is the common denominator of (-4)/6765/(-84) and u? 140 Let b = 6627 - 92731/14. Calculate the common denominator of 227/10 - (-12)/90 and b. 42 Calculate the smallest common multiple of ((-20)/(-8)-1)/(25/(-10)) and 13. 13 Let i = -2937 - -20596/7. What is the common denominator of 53/9 and i? 63 Let h(i) = i*3 - 8i*2 - i + 9. Let d be h(8). Let k(a) = 10a*2 + 4a - 4. What is the lowest common multiple of k(d) and 34? 170 Let q(w) = w*2. Let s(d) = 9d*2 + 3. Let f(h) = -18q(h) + 3s(h). Calculate the lowest common multiple of 9 and f(2). 45 Suppose 97 = -5p + 297. Suppose -3u + p = 5f - 21, 0 = -5u + 3f + 45. Find the common denominator of (-16)/(-4) + 86/u and -23/3. 6 Suppose -3g - 16 = g. Let f be ((-1)/(-3))/(g/(-24)). Suppose w = fw - 4. Calculate the smallest common multiple of 5 and w. 20 Suppose d + 0j - 44 = 2j, 140 = 4d + j. Calculate the common denominator of (-4)/(-24)1 + 249/d and 31/20. 60 Let a = 24719/1788 + 5/596. What is the common denominator of (-5)/355(-3)/((-36)/582) and a? 426 Suppose 6 - 94 = -4f. Suppose 5l = 3l - 3y + 3, 2l - 6 = -2y. Calculate the lowest common multiple of l and f. 66 Let m be ((-9)/(-13935))/((-3)/8). Let k = -182997/9290 + m. Let z = 248/15 + k. What is the common denominator of z and 56/5? 30 Let b be 13/(-52)24/134. Let f = -20721481 + 24990096961/1206. Let a = f + b. Find the common denominator of 119/12 and a. 36 Let r = 389669/1012 + -14877/44. Let i = -43676/897 + r. What is the common denominator of i and -35/22? 858 Calculate the common denominator of -47/56 and 315/(-2646)(-111)/10. 56 What is the least common multiple of (1 - -4) + (64 - 63) and 6? 6 Let t be (4 + (-15)/12 - 3)-4. Let z be (-8)/(-10)(-75)/10. Calculate the lowest common multiple of 2/z(-36)/t and 3. 12 Suppose -128 = -2f + 4b, 3b + 0b - 149 = -2f. Calculate the least common multiple of 105 and f. 210 Let j = 628554077347/93893220 - 2/4694661. Let g = 6696 - j. Calculate the common denominator of -85/22 and g. 220 What is the lowest common multiple of (198/27 + -8)/(2/(-30)) and 4? 20 Suppose 42 = 5h + 12. Let s(w) = -w*2 + 8w - 5. Let l be s(7). Suppose 8 - l = 3q. Calculate the lowest common multiple of h and q. 6 Suppose u + 14 - 46 = 0. Suppose 0 = -19j + 11j + 32. Calculate the least common multiple of u and j. 32 Let o be ((-1)/2)/(6/(-18693)). Let h = o - 1550. Find the common denominator of -47/5 and h. 20 Suppose 19u - 154 - 2867 = 0. What is the smallest common multiple of 265 and u? 795 Let m be 0/((-3)/6-4) + -8. Calculate the lowest common multiple of 14 and 2/(8/17) + 2/m. 28 Let d = 9 + -5. Suppose 5i - 29 = -14. Suppose 4r + 0r = 3y - 32, ir + 38 = dy. Calculate the smallest common multiple of 16 and y. 16 Let u = 18692 + -92032/5. Let l = u + -11289/40. What is the common denominator of -79/20 and l? 40 Suppose 23 = -s + 28. Suppose sj - 80 = 4p, 2p = 4p + 5j + 10. Calculate the smallest common multiple of 7 and 3/(1(-5)/p). 63 Let m(z) = z2 + 11z + 15. Let g be m(-10). Suppose -4v + 11 = -5f, -2f - 6 = 5v + g. Calculate the smallest common multiple of 20 and 2/v + (-4)/(-1). 20 What is the common denominator of (-105)/378 - (3 - -2) and 43/72? 72 Suppose 42n - 21 = 38n - 5w, -w = -5n + 48. Suppose -d + 5a = -35 - 15, -a - 124 = -4d. Calculate	{ "pile_set_name": "DM Mathematics" }
greatest common divisor of 1628 and 9581. 11 What is the greatest common divisor of 968 and 2816? 88 Calculate the greatest common factor of 586 and 362734. 586 What is the greatest common factor of 591141 and 1038? 519 Calculate the highest common divisor of 416 and 10244. 52 Calculate the greatest common divisor of 252804 and 30. 6 Calculate the highest common divisor of 25440 and 2145. 15 What is the highest common divisor of 414834 and 189074? 2822 What is the highest common factor of 22650 and 400? 50 Calculate the highest common divisor of 367575 and 450. 75 What is the highest common factor of 71271 and 9? 9 Calculate the highest common factor of 382183 and 1007. 53 Calculate the greatest common factor of 2123815 and 145. 145 What is the highest common factor of 5892046 and 6728? 1682 Calculate the highest common factor of 97344 and 390. 78 Calculate the highest common factor of 3939 and 1859. 13 Calculate the highest common factor of 8381 and 4046. 289 What is the greatest common factor of 174 and 13224? 174 Calculate the highest common divisor of 55283 and 1475. 59 What is the greatest common divisor of 35 and 18809? 7 What is the highest common factor of 912100 and 50? 50 Calculate the highest common factor of 69 and 215466. 3 What is the greatest common factor of 149 and 108025? 149 What is the highest common divisor of 39065 and 130? 65 What is the greatest common divisor of 114 and 261117? 57 What is the greatest common factor of 765 and 9792? 153 Calculate the greatest common divisor of 74294 and 65084. 614 Calculate the greatest common factor of 292 and 43654. 146 What is the highest common factor of 2875 and 2990? 115 What is the highest common factor of 212 and 2809? 53 What is the highest common factor of 3702 and 36? 6 Calculate the highest common factor of 28851 and 18745. 163 What is the highest common divisor of 30 and 1560? 30 What is the highest common factor of 9212 and 4018? 98 Calculate the greatest common divisor of 198 and 7678. 22 What is the greatest common factor of 21696 and 49344? 192 What is the highest common factor of 4085 and 810? 5 What is the highest common factor of 12212 and 4300? 172 What is the highest common factor of 450 and 1837575? 225 Calculate the highest common factor of 37067 and 3303. 367 What is the greatest common factor of 94758 and 102? 102 Calculate the greatest common divisor of 1026 and 1216. 38 What is the greatest common divisor of 1046948 and 252? 28 Calculate the greatest common divisor of 21520 and 1360. 80 What is the greatest common divisor of 7396 and 4128? 172 What is the greatest common divisor of 830 and 16102? 166 Calculate the highest common divisor of 63 and 5877. 9 What is the greatest common factor of 1980 and 29832? 132 Calculate the highest common divisor of 789030 and 66. 66 What is the greatest common factor of 445 and 23407? 89 Calculate the highest common factor of 17969 and 9826. 17 Calculate the greatest common factor of 1051299 and 54. 27 Calculate the highest common divisor of 113220 and 714. 102 What is the greatest common divisor of 758 and 400? 2 Calculate the greatest common divisor of 90 and 3750. 30 What is the highest common factor of 2080 and 1060384? 416 What is the highest common factor of 4608 and 204032? 256 What is the greatest common divisor of 267023 and 257? 257 What is the greatest common divisor of 132 and 34188? 132 Calculate the greatest common factor of 755446 and 102. 34 What is the highest common factor of 174173 and 5874? 89 Calculate the greatest common divisor of 120 and 24612360. 120 What is the greatest common divisor of 318585 and 402? 201 Calculate the highest common divisor of 364 and 266. 14 Calculate the highest common divisor of 980 and 2012. 4 Calculate the greatest common factor of 84502 and 24794. 506 Calculate the highest common factor of 51760 and 16. 16 Calculate the greatest common divisor of 3 and 13382. 1 What is the highest common factor of 5375153 and 343? 343 Calculate the greatest common factor of 136 and 148376. 136 Calculate the highest common factor of 936 and 9248. 8 What is the greatest common factor of 2 and 14842? 2 Calculate the highest common divisor of 74 and 153661. 37 Calculate the highest common divisor of 8 and 90568. 8 Calculate the greatest common factor of 3296 and 205176. 824 What is the greatest common factor of 980 and 1084370? 490 Calculate the greatest common divisor of 2979 and 19529. 331 Calculate the greatest common factor of 133719 and 318. 159 What is the highest common factor of 183744 and 33? 33 What is the greatest common divisor of 246625 and 2125? 125 Calculate the greatest common divisor of 39809 and 44891. 847 What is the highest common divisor of 432 and 3624? 24 Calculate the greatest common factor of 27 and 395. 1 Calculate the highest common divisor of 2080 and 45040. 80 Calculate the greatest common divisor of 12815 and 17708. 233 What is the highest common divisor of 12 and 118644? 12 What is the greatest common factor of 247705 and 535? 535 What is the highest common divisor of 195772 and 204? 68 Calculate the highest common divisor of 23 and 3424171. 23 What is the highest common divisor of 62491 and 16744? 299 Calculate the greatest common factor of 630 and 585270. 630 What is the greatest common factor of 12 and 19928? 4 What is the highest common factor of 456 and 26467? 19 Calculate the greatest common factor of 3 and 25923. 3 What is the highest common factor of 6 and 73582? 2 What is the greatest common divisor of 126 and 103698? 126 Calculate the highest common divisor of 234 and 61470. 18 Calculate the highest common divisor of 34829 and 70859. 1201 Calculate the highest common divisor of 6280 and 27004. 628 What is the highest common divisor of 840 and 198555? 105 What is the highest common factor of 42 and 22820? 14 What is the highest common factor of 563766 and 154? 14 Calculate the highest common factor of 2326936 and 4. 4 Calculate the greatest common factor of 397106 and 4. 2 What is the greatest common factor of 440755 and 420? 35 Calculate the highest common factor of 1157 and 247. 13 Calculate the greatest common factor of 5494 and 61238. 134 What is the highest common factor of 349033 and 123? 41 What is the highest common divisor of 68 and 73729? 17 What is the greatest common factor of 40 and 64860? 20 Calculate the greatest common factor of 1888 and 832. 32 Calculate the greatest common factor of 908 and 6448. 4 What is the highest common divisor of 88646 and 76082? 698 What is the highest common factor of 504 and 33180? 84 What is the highest common divisor of 6681 and 9? 3 What is the greatest common factor of 12 and 20676? 12 Calculate the greatest common factor of 45 and 274565. 5 What is the greatest common factor of 3856 and 120500? 964 Calculate the greatest common factor of 201 and 1186704. 201 Calculate the greatest common factor of 1291948 and 28. 28 What is the highest common factor of 407200 and 1? 1 Calculate the greatest common divisor of 860 and 20399200. 860 Calculate the highest common divisor of 13 and 601393. 13 What is the greatest common factor of 20080 and 605? 5 What is the highest common factor of 23 and 25047? 23 Calculate the highest common divisor of 24 and 17826. 6 Calculate the greatest common divisor of 2033476 and 62. 62 Calculate the highest common factor of 76 and 30761. 19 What is the greatest common factor of 276 and 3084? 12 Calculate the highest common divisor of 21532 and 314521. 769 What is the greatest common factor of 9314 and 14? 2 What is the greatest common factor of 36 and 65934? 18 What is the greatest common factor of 39464 and 24? 8 Calculate the highest common divisor of 24800 and 2950. 50 What is the highest common factor of 25372 and 12? 4 What is the highest common divisor of 4983 and 19479? 453 Calculate the highest common factor of 35 and 1296757. 7 Calculate the highest common divisor of 336 and 93576. 168 What is the greatest common factor of 11328 and 295? 59 Calculate the greatest common factor of 19830 and 10410. 30 Calculate the highest common factor of 6785 and 46020. 295 What is the greatest common factor of 14190 and 11330? 110 What is the highest common divisor of 8142 and 4278? 13	{ "pile_set_name": "DM Mathematics" }
i = f - 2.8. What is the nearest to l in i, 3, 6/7? i Let w = 10154/3 + -3349. Let h = w + -1180/33. Let l = -0.04 - 0.36. What is the nearest to 1 in h, 0.4, l? 0.4 Let o(q) = q*3 - 4q*2 - 3q - 5. Let j be 1(-1)/((-2)/10). Let i be o(j). Let a = 9/16 + -13/80. What is the nearest to a in i, -2, 0.2? 0.2 Let j = -7 + 2. Let y = 0.05 + 1.95. Let n = -1 - -5. Which is the closest to -0.1? (a) n (b) y (c) j b Let z = -0.02 + 0.14. Let j = z - 5.12. Let o = 0.9 + -2.9. What is the nearest to -0.1 in o, j, 0.1? 0.1 Let k be 85/(-50) + -2 + 4. Which is the closest to k? (a) 2/5 (b) 4 (c) 5 a Let p = 10 + -5. Let n = 4.8 - p. What is the closest to -1/2 in n, -5, 1? n Let m = -90 - -452/5. What is the closest to 0 in m, 0.1, 3/4? 0.1 Suppose -2 = 3f - 2f. Let o be f + 2 - (-4)/(-10). Let d = 2.9 - 3.4. What is the closest to o in -2, d, 2/13? d Let w be 164/(-9) + -1 - 2. Let t = w + 21. Suppose 0 = -2n - 2v - 16, 6n - 2n + v = -20. Which is the nearest to 2? (a) t (b) -2/11 (c) n b Let k = -9.8 - -10. Let h = -1.7 - -0.3. Let z = 1 + h. Which is the closest to 0? (a) 2/7 (b) k (c) z b Let j = -6.9 - -7. What is the closest to j in 5, 0.4, -0.3? 0.4 Let d(l) = -l3 - 4l*2 + l + 1. Let t be d(-4). Let s be (t - -1) + (-36)/(-9). Let z = 2 + -2.2. Which is the nearest to z? (a) s (b) 3 (c) 4 a Let z be 1/((-3)/34-2). Let x = 16/3 - z. Let y = -245/348 - 4/87. Which is the nearest to x? (a) -0.5 (b) y (c) 0 a Let t = 2 - 3. Let d = 4.02 + -0.02. Let u = 0 - -0.4. What is the nearest to t in d, -0.5, u? -0.5 Let i = 78 - 78.08. Which is the nearest to 2? (a) -0.2 (b) 3 (c) i b Let w = 3.6 - 4.1. What is the nearest to 1/3 in w, 0.4, 0.17? 0.4 Let v be (-7)/(-1)6/(-7). Let r = v + 7. Let s(y) = -y2 + 4y + 5. Let z be s(5). Which is the closest to z? (a) r (b) -0.5 (c) 2/3 b Let t = -3 - -2. Let l = 0.9 - -3.1. Let r = l + -3.6. What is the nearest to t in -2, r, -0.4? -0.4 Let r = 2.9 + -4. Let k = 2.9 - r. What is the nearest to 1/5 in 0.2, k, -5? 0.2 Let s = -19/36 + 3/4. Let b be (-1 - -1) + 1 - -1. What is the nearest to b in s, 0.4, -0.5? 0.4 Let a = 0.1 + -0.1. Let q = 0.6 - 0. Let x = 0.8 - q. What is the closest to a in -3/8, x, 1/2? x Let y = -158 - -786/5. What is the closest to 1 in -2, -0.3, y? -0.3 Let k be 0/(0 + 4 + -1). Let h be 3/12 + (-6)/88. What is the closest to k in 0.1, -3/7, h? 0.1 Let w be (-9)/122/(-6). Let t = 10/3 - 77/24. What is the closest to w in 3, -1, t? t Let x = 41 - 41.5. Which is the nearest to 0.1? (a) -0.4 (b) x (c) -2/3 a Let l = 207/4 - 52. Suppose 0g + 71 = 2j + g, 3j - 104 = -g. Let v = -166/5 + j. Which is the closest to 0.1? (a) l (b) -3 (c) v c Suppose 0v = 5v + 5. Let p be (10 - 6)1v. Let y = 0 - 0.1. What is the nearest to y in p, 2/7, 5? 2/7 Let o = -19.7 - -16. Which is the nearest to 2? (a) -0.2 (b) o (c) 5 a Let p be (36/30)/(2/(-5)). What is the nearest to 1/4 in 3, p, -0.3? -0.3 Let n = -10 - -6. Let y be -13 + (-52)/(-12). Which is the nearest to -1? (a) n (b) -2/7 (c) y b Let m = 12.8 - 13. What is the closest to m in -2/7, 1, -5? -2/7 Let x = -1 - 1. Let f = 2 + -3. Let k = 11 + -14. Which is the closest to 0? (a) f (b) k (c) x a Let t = -15 - -15. Which is the nearest to -1? (a) 0.1 (b) t (c) 4 b Let j = 0.4 + 0. Let v = 0.5 - j. Let q = 1.1 + -5.1. Which is the nearest to v? (a) -1 (b) q (c) -0.1 c Suppose 5n - p - 12 = 2p, -4n = -5p - 20. Let x = -0.1 + 0.3. Let w = 0.1 - 0.2. What is the closest to 0 in n, x, w? n Let z = 3.9 - 4. Let l = 0 - z. Let o be 10/25 + 4/(-35). Which is the nearest to o? (a) -0.1 (b) l (c) -4 b Let a be 6/3 - 14/10. What is the closest to 0.2 in 0.2, a, 0? 0.2 Let i = -2.7 - 0.3. Let r = 3.1 + i. Let j = -30.6 - -30.6. What is the closest to r in -2, j, -0.3? j Let j = -4 - -3.7. Let l = -2 - 2. Let v = l - -4. Which is the closest to v? (a) j (b) -2 (c) -2/21 c Let p = 0.42 - -4.58. Which is the closest to 0.2? (a) -0.1 (b) p (c) -2/7 a Let q(b) = 4b*3 - b. Let k be q(-1). Let j = -1.3 + 1.2. What is the closest to j in 0.3, 2, k? 0.3 Let c = 0.22 + 4.78. Let n = -0.4 + 1.4. What is the nearest to n in -3/8, c, -0.3? -0.3 Suppose -4r + r + 3 = 0. Which is the nearest to -0.1? (a) 0.3 (b) r (c) -5 a Let l = 0.06 + -5.06. Let y = 1 - 2. Let q = 349 - 7331/21. Which is the nearest to y? (a) 4 (b) q (c) l b Let x be 4 + (-3)/(51/70). What is the nearest to -2/5 in 0.3, x, -2/3? -2/3 Suppose 3w - 3q + 15 = 0, 0 = -2w - 0q - 4q + 20. Let d = -0.015 - 0.085. Which is the closest to -1? (a) 0.2 (b) d (c) w b Suppose 2v + q = 3, -4v = -4q - 0q - 36. Suppose vh + 12 = b, h - 10 = 2b - 5b. What is the closest to -2 in h, -3, -1/6? h Let y = -142/3 - -48. Suppose -2k + 10 = 5u - k, 26 = u + 5k. Let o = 3.9 - 4. Which is the nearest to u? (a) o (b) y (c) 1 c Let m = 0.5 + -0.3. Let n = -0.6 - -0.6. Let i = m + n. Which is the nearest to 2/3? (a) i (b) 2/9 (c) -2/9 b Let i = 34 - 24. Suppose -4s - 10 - i = 0, -73 = -4r + 5s. Let l be -39/r - -2. What is the closest to l in -1, -4, 5? -1 Let g = 2.3 - 2.4. Which is the nearest to 0? (a) 5 (b) -1/6 (c) g c Let i = -6.3 - -1.3. Which is the nearest to 2? (a) -3 (b) -2 (c) i b Let r = -6/91 - 480/1001. What is the nearest to -2 in r, -4, 1? r Let z = -3.4 + -0.6. Which is the nearest to -0.1? (a) z (b) 1/5 (c) -22 b Let z = -0.34 - -0.34. Which is the closest to 4? (a) -5 (b) z (c) -1 b Let o = -10.9 - -10.7. Which is the closest to -3? (a) -3 (b) -0.4 (c) o a Let p = -0.01 + 0.21. What is the closest to p in 1/3, -0.14, 0? 1/3 Let g = 0.238 + -0.178. What is the nearest to 0.2 in g, -0.1, -3? g Let g = -2.5 + 3. Let d = 0.149 - 0.649. Which is the nearest to 0.1? (a) g (b) -1/11 (c) d b Let p be (-361)/(-133) - (-2)/7. Which is the closest to 58? (a) 0.2 (b) 4 (c) p b Let u = -1.7 - 0.3. Let d be (8/(-20))/(3/5 + -2). Which is the closest to 1? (a) d (b) u (c) -0.5 a Let u(y) = -y3 + 9y*2 - 8y - 4. Let l be u(8). What is the nearest to -2/7 in l, -0.06, -1? -0.06 Let d(n) = -n + 8. Let j be d(6). Suppose js - 4 = -0s. Suppose -v + 4 = -r, -sr - 5v = r + 4. Which is the nearest to 1? (a) 4 (b) r (c) 2/9 c Let m(l) = -l + 8. Let y be m(3). Let o = -0.3 + 0.1. Which is the closest to o? (a) y (b) -0.4 (c) -4 b Let r = -0.1 + -0.1. Let c = -10.6 - 2.4. Let y = 9 + c. What is the closest to -2/5 in r, y, -3? r Let g = 5 + -10. Let w = -1/67 + -58/603. Which is the nearest to 1? (a) -0.3 (b) g (c) w c Let d(c) = -c - 6. Let x be d(-4). Let l be 6/x + 3 + 0. Let s = 0.6 + -0.3. What is the closest to l in s, 6/7, -0.2? -0.2 Let c = 5 - 5.5. Let d = 0.3 + c. What is the closest to d in -4, -2, 4? -2 Let m be 2/3 - 14/12. Let q = 91/474 - 2/79. Let y = q + m. What is the nearest to 1/4 in 3, y, 1? y Let l = 113 - 793/7. Let f = 73 - 73.31. Let j = f - -0.11. Which is the nearest to 2/7? (a) -0.4 (b) l (c) j c Let u be (3 - 2) + 5/(-7). Let l = 23 + -23.9. Let g = -2.9 - l. Which is the nearest to u? (a) g (b) 4 (c) -0.4 c Let f = -124 - -128. Which is the nearest to 0? (a) -0.2 (b) f (c) -6/11 a Let x = 399 - 398. Suppose -6 = 3n - n. Which is the nearest to 1? (a) 0.3 (b) x (c) n b Let c = 0.14 - 0.34. Let t be 0 + (2 - (-7)/(-5)). Let n = 9 + -6. What is the closest to c in -1/3, t, n? -1/3 Let y = 18 + -18. Which is the nearest to -0.1? (a) y (b) -3 (c) 2 a Let p = 16 + -27. Let o = p + 16. What is the closest to 1 in -2/7, 0.2, o? 0.2 Let o = -3.2 + 3. Let g = -663/4 - -165. What is the closest to -2 in g, o, -0.5? g Let s = 1.5 + 1.5. Which is the closest to 2/5? (a) -0.4 (b) s (c) 3/2 a Suppose -3x - 4 = -x - 5v, 3x + 6 = 3v. Which is the closest to -0.1? (a) 3 (b) x (c) 1/18 c Suppose 3g = -2g + 20. What is the closest to 2/7 in 3/2, -1/3, g? -1/3 Let u = -5 + 0. What is the nearest to 0.1 in -1, u, -0.4? -0.4 Let o = 0.21 - -0.03. Let q = o + 0.06. Let k = -0.03 + 0.43. Which is the closest to -0.1? (a) k (b) q (c) -4 b Let d = 3 - 3.2. Let x = -12.6 - -14. Let o = x - 0.9. Which is the closest to d? (a) o (b) 2 (c) 0 c Let w be 8/183*3/6. Which is the nearest to w? (a) -0.3 (b) 0 (c) -3/5 b Let t = -0.931 + -0.069. Let k be (-1	{ "pile_set_name": "DM Mathematics" }
1. -sqrt(5) Simplify sqrt(14)/(-1sqrt(2)) + (2 + sqrt(343))2. 27sqrt(7) + 347 Simplify -4(sqrt(833)-1 - sqrt(833))*2. -13328 Simplify sqrt(228)/(sqrt(12) - (sqrt(72)-2)/sqrt(6)). sqrt(19)/3 Simplify (-1 + 3 + (sqrt(78) - 1sqrt(78))/sqrt(6))2. 4 Simplify sqrt(432) + 0 - sqrt(192)4. -20sqrt(3) Simplify ((-1sqrt(45)/sqrt(3))/(sqrt(25)/((sqrt(5) - sqrt(45)) + sqrt(5))))2. 3 Simplify (sqrt(136)/sqrt(8) + sqrt(17) + 3)24. 48sqrt(17) + 308 Simplify sqrt(704) + -2(sqrt(704) + 0) - ((2sqrt(66) + sqrt(66))/sqrt(6) + ((2sqrt(1100))2 - sqrt(1100))). -4400 - sqrt(11) Simplify (sqrt(272)41 - (sqrt(136)/sqrt(4)-3)/sqrt(2))*2. 6137 Simplify (sqrt(72)/(sqrt(6)/sqrt(2)) + sqrt(24))/sqrt(8). 2sqrt(3) Simplify (sqrt(208)-3 + 5)-2. -10 + 24sqrt(13) Simplify sqrt(1900) + -4sqrt(1900) + 5. -30sqrt(19) + 5 Simplify 4 + ((sqrt(12) - (sqrt(48)/sqrt(64) + sqrt(12)))/(-2sqrt(864)))*2. 18433/4608 Simplify (sqrt(228)2-6)/((sqrt(72) + 3sqrt(72))/sqrt(6)). -3sqrt(19) Simplify 5sqrt(2) + -2 - sqrt(10)/sqrt(180). -2 + 29sqrt(2)/6 Simplify (sqrt(1216) - sqrt(19))2 + 2 - (1 + sqrt(19) + -5). -sqrt(19) + 937 Simplify ((sqrt(304) + 0)2)*2. 1216 Simplify sqrt(847)1 + 2 - ((2sqrt(252))2 + 5). -1011 + 11sqrt(7) Simplify (-5((-1sqrt(132)-1 - sqrt(132) - sqrt(132)) + sqrt(132))/(sqrt(960)/sqrt(5)))2. 0 Simplify -1(sqrt(3) + 0) + (sqrt(6)/sqrt(2))*25. -sqrt(3) + 15 Simplify 0 + (sqrt(567) - ((-1sqrt(567))2 + -5)). -562 + 9sqrt(7) Simplify sqrt(32)/sqrt(4) - (sqrt(128) + 1)*2. -129 - 14sqrt(2) Simplify ((sqrt(130) + sqrt(130)1)5)/((-1sqrt(100) - sqrt(100))/sqrt(10)). -5sqrt(13) Simplify 1(-5 + sqrt(98) + 2). -3 + 7sqrt(2) Simplify -5 + sqrt(637) + 0 + sqrt(637) + sqrt(637). -5 + 21sqrt(13) Simplify (sqrt(2268) - (1 + sqrt(2268))) + (sqrt(2268) + -1sqrt(2268) + sqrt(2268))*2. 2267 Simplify (1sqrt(325) - sqrt(325))6 - (0 + sqrt(325) + sqrt(325))2. -20sqrt(13) Simplify (-4 + sqrt(1053)2 - sqrt(1053))*2 + (sqrt(1053) - (sqrt(1053) + 0)) + 0. -72sqrt(13) + 1069 Simplify 5 + (sqrt(18) - (sqrt(18) + 0)). 5 Simplify (sqrt(425) - (sqrt(425) + sqrt(425) + -2 + 5))*2. 30sqrt(17) + 434 Simplify 5sqrt(931)2. 70sqrt(19) Simplify (5 + sqrt(13) + 1)-5. -30 - 5sqrt(13) Simplify (-1 + -4 + 0 + sqrt(243) + -4)2. -162sqrt(3) + 324 Simplify ((sqrt(7) - (0 + sqrt(7))) + -5)*22. 50 Simplify (sqrt(26)/(-1sqrt(8)) + 4)-1. -4 + sqrt(13)/2 Simplify (4 + 3sqrt(208))2. 96sqrt(13) + 1888 Simplify (sqrt(448) + 1 + sqrt(448))5. 5 + 80sqrt(7) Simplify -5 + (6(-1sqrt(2) - sqrt(2)))*2-1. -293 Simplify ((sqrt(66)-2)/sqrt(6))2 - sqrt(11) - sqrt(275)-2. 9sqrt(11) + 44 Simplify (-2sqrt(14)-3)/(sqrt(21)/(sqrt(3) - sqrt(12) - sqrt(3))). -12sqrt(2) Simplify (-4 + (sqrt(832) - (sqrt(832) - (2 + sqrt(832) + sqrt(832)))) + sqrt(832))*2 - (1 + sqrt(832)-1). -88sqrt(13) + 7491 Simplify sqrt(405) + 5. 5 + 9sqrt(5) Simplify ((1 + (sqrt(19)-2 + sqrt(19) - sqrt(19)) - (sqrt(152)/sqrt(32))2) + -5)3. -105/4 - 6sqrt(19) Simplify (sqrt(1100)-5)*2. 27500 Simplify -5(-4-4sqrt(132))/sqrt(12). -80sqrt(11) Simplify (-3 + 3 + sqrt(19)1)2. 19 Simplify (sqrt(180) + 1 + sqrt(180) + -2)2. -24sqrt(5) + 721 Simplify (-5(-1sqrt(133) - sqrt(133)) - sqrt(133))/(sqrt(343) - ((sqrt(343) - (sqrt(343)2 + sqrt(343))) + sqrt(343))). 9sqrt(19)/14 Simplify (-1(3 + sqrt(567)) + sqrt(567))*2. 9 Simplify ((sqrt(204) + 2sqrt(204))-5)/(-2sqrt(1452)). 15sqrt(17)/22 Simplify (3 + -2sqrt(833))*2. -84sqrt(17) + 3341 Simplify sqrt(70)/(sqrt(100)/(-1sqrt(10))). -sqrt(7) Simplify -5((sqrt(11) + ((sqrt(11) - 1sqrt(11)) + sqrt(11) - sqrt(11))2)2 - ((sqrt(11) + -1)*2 + sqrt(11))2). -20sqrt(11) + 120 Simplify 4 + (sqrt(2) + sqrt(20)/(sqrt(40)/sqrt(4)))2. 12 Simplify 3(-4 + -1sqrt(75) + sqrt(75) + -3)2. 147 Simplify sqrt(77)/((1sqrt(99))/sqrt(9)). sqrt(7) Simplify -1(-1 + sqrt(500))2. -20sqrt(5) + 2 Simplify sqrt(136)/(sqrt(24)/(sqrt(18)/sqrt(6))). sqrt(17) Simplify -1 + -2 + (-1 + sqrt(19))2 + 2. -2sqrt(19) + 19 Simplify ((sqrt(80) + -1)2)2. -32sqrt(5) + 324 Simplify (-5(4 + sqrt(200) + sqrt(200)-2))*2. -2000sqrt(2) + 5400 Simplify (-5(sqrt(114) + sqrt(114) + -1sqrt(114) + sqrt(114) - sqrt(114)))/(sqrt(6)-2-2). -5sqrt(19)/4 Simplify sqrt(91)/(-4(sqrt(7) + sqrt(7)2)). -sqrt(13)/12 Simplify (sqrt(3388)1 + sqrt(3388) + sqrt(3388))/(2sqrt(324)). 11sqrt(7)/6 Simplify -4 + (2sqrt(245))2. 976 Simplify (6(sqrt(1216)1 + 2))2. 1152sqrt(19) + 43920 Simplify ((-3 + sqrt(243))-3)2 + sqrt(243). -477sqrt(3) + 2268 Simplify (sqrt(405) + 1)*2 + sqrt(405). 27sqrt(5) + 406 Simplify 5 + 6(sqrt(252) + -5). -25 + 36sqrt(7) Simplify (1(1sqrt(70) + sqrt(70)))/(sqrt(1000) - -1sqrt(1000)). sqrt(7)/10 Simplify (sqrt(95)/(sqrt(405)2))*2. 19/324 Simplify (4 + (-1sqrt(187))/sqrt(11))*2. -8sqrt(17) + 33 Simplify -11(sqrt(504) - (sqrt(504) - (sqrt(504) - (sqrt(504) - -2sqrt(504))) - sqrt(504)))/sqrt(2). 6sqrt(7) Simplify sqrt(567) + ((sqrt(567)-1 + sqrt(567))-3 + sqrt(567))2 - (-1 + -2 + sqrt(567))2. -9 + 63sqrt(7) Simplify (1 + sqrt(80) + 2sqrt(80))*2. 24sqrt(5) + 721 Simplify (sqrt(19) + -1sqrt(1539) + 1 + sqrt(171))2-5. -2380 + 50sqrt(19) Simplify sqrt(864)/sqrt(8) + (sqrt(75) + sqrt(3))-5. -24sqrt(3) Simplify (sqrt(12)-2-2)/sqrt(4). 4sqrt(3) Simplify -3 + sqrt(80) - (sqrt(320) + -3). -4sqrt(5) Simplify 2(-3 + 1 + sqrt(48) - sqrt(48)). -4 Simplify (sqrt(99) - (sqrt(99) + 2 + 2) - (-2(-2 + sqrt(99)) - sqrt(99)))2. -144sqrt(11) + 955 Simplify -5 + -4(0 + sqrt(2) + -3)2. -49 + 24sqrt(2) Simplify 3(2 + sqrt(63) + -5 + sqrt(63) + -4). -21 + 18sqrt(7) Simplify 5 + (sqrt(55)/(sqrt(245)-2))2. 991/196 Simplify (2 + -5sqrt(75) - sqrt(75) - sqrt(75))*2. -140sqrt(3) + 3679 Simplify ((-62sqrt(102) + sqrt(102))/((sqrt(90)/sqrt(5))/sqrt(3)))*2. 2057 Simplify (3 + (sqrt(272) - (-2 + 1 + sqrt(272))))-5. -20 Simplify (sqrt(1573) - sqrt(1573)1-2)*2. 14157 Simplify (sqrt(77) - sqrt(77)-3-5)/(sqrt(55)/(sqrt(5) - (1sqrt(5) - sqrt(5)))). -14sqrt(7) Simplify 3(sqrt(12)/sqrt(4))*2-1 + -1. -10 Simplify -4 + (sqrt(21)/(sqrt(7) + sqrt(700) + 1sqrt(700)))2. -587/147 Simplify (sqrt(720) - (sqrt(720) + 0 - sqrt(720))) + 0 + -5. -5 + 12sqrt(5) Simplify (-1sqrt(288))2 - ((sqrt(20)-3)/sqrt(10))*2. 270 Simplify -52sqrt(3)1. -10sqrt(3) Simplify 1(1sqrt(19) + sqrt(19)) + (4 + 1sqrt(19))*2 + sqrt(19). 35 + 11sqrt(19) Simplify (2sqrt(252) + 3)2-6 + 1. -6101 - 432sqrt(7) Simplify (sqrt(720)1 + -4 + 6sqrt(720)1)*2. -672sqrt(5) + 35296 Simplify -5(sqrt(30)/(sqrt(486)-2))*2. -25/324 Simplify (sqrt(272) + 1sqrt(272)-3)2 + 3 + -4. 1087 Simplify (-4(4 + -2sqrt(300)))2. -2560sqrt(3) + 19456 Simplify (-1 + sqrt(1900) + -3 + -32sqrt(1900))*2. 400sqrt(19) + 47516 Simplify sqrt(153)/(-1sqrt(9)) - ((sqrt(187)3)/sqrt(11) - sqrt(17)). -3sqrt(17) Simplify ((2 + 2sqrt(19) + -4)-5)2. -200sqrt(19) + 2000 Simplify -4 + sqrt(432)/sqrt(9). -4 + 4sqrt(3) Simplify 2 + (1 + sqrt(68) + 0)2. 4sqrt(17) + 71 Simplify -2(1 + sqrt(11) + sqrt(11)) - ((sqrt(330)/sqrt(6))/sqrt(5))2. -4sqrt(11) - 13 Simplify (sqrt(1331) + sqrt(1331)-3)4. -88sqrt(11) Simplify sqrt(320)-3 + 5. -24sqrt(5) + 5 Simplify ((sqrt(136) - -1sqrt(136))1 - sqrt(136))/(sqrt(24)/sqrt(3)-2). -sqrt(17)/2 Simplify (0 + sqrt(272) - sqrt(17) - ((sqrt(17) - sqrt(425)) + 4))*2. -56sqrt(17) + 849 Simplify ((sqrt(3) - -5(sqrt(3) - sqrt(48))) + 2)2. -56sqrt(3) + 592 Simplify 5 + (sqrt(304) + sqrt(304) + sqrt(304) + sqrt(304)2 + sqrt(304) + -3)2. -144sqrt(19) + 10958 Simplify 1(-1sqrt(20) - sqrt(20) - -5sqrt(45))2. 605 Simplify ((sqrt(468)/(sqrt(36)/sqrt(3)))/sqrt(3))2. 13 Simplify 4(4 + 4sqrt(405)). 16 + 144sqrt(5) Simplify (sqrt(17) + sqrt(17) + sqrt(17)-1 + -4 + sqrt(17) + 5 + sqrt(17) + -1)2. 153 Simplify (sqrt(2448) - (sqrt(2448) + -1))-6-3 + -4. 14 Simplify ((1 + sqrt(288))2 + sqrt(288))5 + (1sqrt(288) + 1 - sqrt(288))2. 180sqrt(2) + 1446 Simplify (1 + -4sqrt(7)5)*2. -40sqrt(7) + 2801 Simplify (1 + sqrt(7))64. 24 + 24sqrt(7) Simplify sqrt(132)/sqrt(3)4. 8sqrt(11) Simplify (sqrt(112) + sqrt(7))4 + ((-1sqrt(28))2 - sqrt(28)). 28 + 18sqrt(	{ "pile_set_name": "DM Mathematics" }
hat is prob of sequence nnnm when four letters picked without replacement from {n: 3, h: 1, m: 4}? 1/70 Two letters picked without replacement from sxhhsshsggsxxhszsg. What is prob of sequence xx? 1/51 Calculate prob of sequence ssf when three letters picked without replacement from jsqqggsjqjgsfshh. 1/280 Two letters picked without replacement from xvkkxvikixxx. What is prob of sequence xk? 5/44 Four letters picked without replacement from bkbmtttkjbbjvkb. Give prob of sequence bmtb. 1/546 Four letters picked without replacement from uhhrhurrr. Give prob of sequence rrru. 1/63 What is prob of sequence pa when two letters picked without replacement from {p: 2, a: 1, h: 2}? 1/10 Calculate prob of sequence jjjr when four letters picked without replacement from jjjjjjjjjjjrjjjrjjj. 5/57 Three letters picked without replacement from llloaflbbl. Give prob of sequence lfa. 1/144 Calculate prob of sequence ii when two letters picked without replacement from ifiikikikikkfakkkfk. 5/57 Three letters picked without replacement from {e: 3, g: 4, l: 1, p: 1, o: 2, s: 1}. Give prob of sequence ogo. 1/165 Calculate prob of sequence tq when two letters picked without replacement from {d: 1, m: 1, t: 1, e: 1, q: 1}. 1/20 Calculate prob of sequence kqk when three letters picked without replacement from kyykekkeqekey. 5/429 What is prob of sequence oggo when four letters picked without replacement from gogggoogoo? 5/63 Three letters picked without replacement from {z: 1, c: 1, n: 5, w: 1, j: 3, q: 3}. What is prob of sequence qjn? 15/728 Two letters picked without replacement from {a: 1, d: 5, i: 10, v: 1}. What is prob of sequence dv? 5/272 Calculate prob of sequence bttt when four letters picked without replacement from ktktkkvkbtbvbkrkkkb. 1/3876 Calculate prob of sequence lav when three letters picked without replacement from cvcbclllallb. 1/264 Two letters picked without replacement from {r: 3, e: 3, o: 4, k: 1, p: 2, l: 3}. What is prob of sequence lo? 1/20 Four letters picked without replacement from zkvkykjkzzj. Give prob of sequence zkvk. 1/220 Three letters picked without replacement from {i: 3, r: 2, e: 4, h: 2}. Give prob of sequence rre. 4/495 Three letters picked without replacement from {z: 3, s: 1, c: 1, i: 1, u: 5}. What is prob of sequence zcs? 1/330 What is prob of sequence ppup when four letters picked without replacement from {u: 6, p: 6}? 2/33 Two letters picked without replacement from vxmtxv. Give prob of sequence vt. 1/15 What is prob of sequence cy when two letters picked without replacement from wpyhpcjy? 1/28 Three letters picked without replacement from {o: 3, m: 9, c: 2, q: 2}. What is prob of sequence cmo? 9/560 Three letters picked without replacement from oooo. Give prob of sequence ooo. 1 Two letters picked without replacement from qbobooqqzbq. What is prob of sequence qb? 6/55 What is prob of sequence ucmm when four letters picked without replacement from {v: 3, c: 2, u: 5, m: 3}? 1/286 What is prob of sequence ig when two letters picked without replacement from aiaagagyaaarggarrya? 2/171 Four letters picked without replacement from uaua. Give prob of sequence aauu. 1/6 Calculate prob of sequence svy when three letters picked without replacement from {v: 1, y: 3, s: 5}. 5/168 Calculate prob of sequence si when two letters picked without replacement from risxx. 1/20 Three letters picked without replacement from vjojoouo. What is prob of sequence ojj? 1/42 Four letters picked without replacement from rrmrrmmrmmmmm. What is prob of sequence rrmm? 28/429 Four letters picked without replacement from snuunnnsuu. Give prob of sequence nuun. 1/35 Three letters picked without replacement from bybiteo. What is prob of sequence tby? 1/105 Three letters picked without replacement from {v: 1, c: 1, n: 2, t: 1}. What is prob of sequence cvt? 1/60 What is prob of sequence kk when two letters picked without replacement from {f: 1, d: 1, k: 5, w: 2, m: 1}? 2/9 Two letters picked without replacement from qkceo. Give prob of sequence qo. 1/20 Two letters picked without replacement from kgkkkgggkkgzgnkggg. What is prob of sequence kk? 7/51 Calculate prob of sequence uwj when three letters picked without replacement from {w: 1, u: 2, j: 1}. 1/12 What is prob of sequence qoq when three letters picked without replacement from oqqeqqqqq? 1/12 What is prob of sequence uuh when three letters picked without replacement from {h: 1, m: 5, u: 4, z: 5}? 2/455 Calculate prob of sequence vv when two letters picked without replacement from nnnrvnvrr. 1/36 What is prob of sequence zfr when three letters picked without replacement from fnwwrnwwznz? 1/495 Two letters picked without replacement from mimmmoiooooooommmom. Give prob of sequence mi. 8/171 Calculate prob of sequence ttz when three letters picked without replacement from tzttztttttzttt. 55/364 Three letters picked without replacement from hnhnhhhnnhhhn. What is prob of sequence hhh? 28/143 Three letters picked without replacement from bubqqmudmdxbbxdqxduq. What is prob of sequence xbx? 1/285 Calculate prob of sequence vvrv when four letters picked without replacement from {r: 6, c: 4, d: 3, s: 4, v: 3}. 1/3230 Four letters picked without replacement from {y: 4, a: 4, c: 6}. What is prob of sequence ayay? 6/1001 Two letters picked without replacement from {q: 2, w: 8, f: 1, s: 2}. Give prob of sequence qs. 1/39 Calculate prob of sequence kikk when four letters picked without replacement from {k: 11, i: 5}. 165/1456 What is prob of sequence efe when three letters picked without replacement from xefffffexexfex? 3/91 Calculate prob of sequence fmy when three letters picked without replacement from {m: 1, k: 5, f: 4, q: 1, y: 3, r: 1}. 2/455 Calculate prob of sequence cgc when three letters picked without replacement from qqqongcgggqqoagqcaac. 1/228 Four letters picked without replacement from {q: 1, y: 17, f: 1}. Give prob of sequence yyqy. 5/114 Two letters picked without replacement from bxwbwbxbbxw. Give prob of sequence xx. 3/55 What is prob of sequence ww when two letters picked without replacement from ojjpwpjpojjjw? 1/78 What is prob of sequence gi when two letters picked without replacement from kiidddgdgsiggd? 6/91 Three letters picked without replacement from {q: 1, p: 2, z: 1, y: 1}. Give prob of sequence zyq. 1/60 Calculate prob of sequence gy when two letters picked without replacement from {o: 2, m: 1, y: 1, h: 4, g: 1, j: 3}. 1/132 Three letters picked without replacement from {i: 1, e: 1, b: 1, u: 2}. Give prob of sequence eub. 1/30 Four letters picked without replacement from rdrrdqrrzrrd. What is prob of sequence qrzd? 7/3960 What is prob of sequence nryy when four letters picked without replacement from {y: 4, r: 1, n: 2, c: 2}? 1/126 Calculate prob of sequence nrrt when four letters picked without replacement from rrznrzxtzjjrzn. 1/1001 What is prob of sequence kmjx when four letters picked without replacement from {m: 1, k: 1, y: 2, x: 1, j: 2, q: 1}? 1/840 Four letters picked without replacement from {z: 5, k: 3, h: 7, l: 4}. What is prob of sequence hkhz? 35/5168 Calculate prob of sequence yyy when three letters picked without replacement from {y: 9, a: 11}. 7/95 Calculate prob of sequence ff when two letters picked without replacement from rvmfrvrvrrirvvdvvrfr. 1/190 Three letters picked without replacement from {y: 1, w: 5, r: 2, d: 3, h: 3, u: 1}. What is prob of sequence wrw? 4/273 Three letters picked without replacement from ffzvlzzvzlljzffzl. What is prob of sequence zvv? 1/340 Three letters picked without replacement from {a: 3, v: 3, b: 2}. Give prob of sequence abv. 3/56 Three letters picked without replacement from {p: 1, w: 1, q: 2}. Give prob of sequence pqq. 1/12 Three letters picked without replacement from {r: 3, f: 1, n: 3, u: 1, y: 3}. Give prob of sequence fny. 1/110 Two letters picked without replacement from vuuuv. Give prob of sequence uv. 3/10 Calculate prob of sequence jycj when four letters picked without replacement from jjjqyqjccc. 1/140 Two letters picked without replacement from {t: 9, i: 3}. Give prob of sequence ii. 1/22 Calculate prob of sequence iiip when four letters picked without replacement from {q: 1, i: 4, b: 1, p: 1, t: 4}. 1/330 Calculate p	{ "pile_set_name": "DM Mathematics" }
- 16. Let m(k) = 8o(k) + 7w(k). Solve m(t) = 0 for t. -9, 0, 3/2 Factor -129554216/5 - 768108/5w - 1/5w*3 - 1518/5w2. -(w + 506)3/5 Suppose 3i + 14 = 19l - 17l, 10 = 4l + 3i. Let p(a) be the first derivative of 23 - 4a*2 - la - 4/3a3. Determine z so that p(z) = 0. -1 Let v(s) be the first derivative of -s6/720 - s5/120 + s4/6 - 25s*3/3 - 2s*2 - 75. Let c(m) be the third derivative of v(m). Factor c(p). -(p - 2)(p + 4)/2 Let d = -575 + 574. Let q be ((-141)/(-470))/(d/(-10)). Suppose 5/3m + 0 + 5/6m*q + 5/2m*2 = 0. What is m? -2, -1, 0 Let q be (0/((-25)/(-300)(1 - -11)))/(-6). Solve 3/5t - 3/5t*2 + q = 0. 0, 1 Let h be (-4)/((-16)/1) + (-175190)/(-360). Let k = 488 - h. Factor -14/9c - kc3 - 2c*2 - 2/9c*4 - 4/9. -2(c + 1)*3(c + 2)/9 Let l(j) = -51j5 + 150j*4 - 270j*3 + 192j*2 - 75j - 18. Let z(o) = -o5 - o4 - o*3 - o - 2. Let u(g) = l(g) - 12z(g). Factor u(v). -3(v - 1)4(13v - 2) Let b = 1/1576 - -785/4728. Let g(o) be the second derivative of 0 - 12o - 1/20o5 + 0o*4 + bo*3 + 0o*2. Factor g(v). -v(v - 1)(v + 1) Let b(f) be the second derivative of -28 + 1/48f*4 - 23/12f*3 - 2f + 529/8f2. Suppose b(g) = 0. Calculate g. 23 Let m = 113541 - 113539. Let 0s + 2sm + 0 - 1/3s3 = 0. What is s? 0, 6 Let b(u) = -u5 - 5u4 - u3 + 31u*2 - 18u + 12. Let g(l) = -l4 - l3 - l - 6. Let w(a) = -2b(a) - 4g(a). Factor w(x). 2x(x - 1)*2(x + 4)(x + 5) Let x(p) = 9p2 + 1. Let w(m) = m3 - m*2 + m + 1. Let s(r) = w(r) + x(r). Let b be s(0). Factor 2/5n*4 + 0 - 2/5n*b + 2/5n*3 + 0n - 2/5n5. -2n*2(n - 1)*2(n + 1)/5 Let r = 126 + -124. Factor -r + 3w - 84w2 - w3 + 84w2. -(w - 1)2(w + 2) Factor 19s2 - 10s + 68 - s*4 + 69 + 75 - 212 - 8s*3. -s(s - 1)*2(s + 10) Let k(n) = -n*3 + 8n*2 - 4n + 2. Let f be k(2). Suppose 4a = -a - x + 12, -f = -4a + 2x. Solve -3g3 + g3 - 2g3 + 2g*a - 2g2 = 0. -1, 0 Let p(q) be the second derivative of q4/36 + q*3/9 - 323q*2/6 - 3107q. Factor p(t). (t - 17)(t + 19)/3 Let w = -2053265/6726 - -19380/59. Let l = 444/19 - w. Factor -1/3n + 0 - ln2. -n(n + 2)/6 Let s(r) be the first derivative of r6/90 - r5/30 - 10r4/3 + 86r*3/3 - 134. Let i(b) be the third derivative of s(b). Factor i(n). 4(n - 5)(n + 4) Let n(p) = 9p*3 + 7242p*2 - 6. Let j(o) = -11o*3 - 7241o*2 + 8. Let w(b) = 3j(b) + 4n(b). Solve w(a) = 0 for a. -2415, 0 Suppose -2 + 14 = -x. Let j be ((-224)/x)/(-8)(-12)/21. Factor 2/3y5 + 0y*4 + 2y + 4/3y2 - 8/3y*3 - j. 2(y - 1)*3(y + 1)(y + 2)/3 Suppose -7p = -22p + 75. Suppose 0 = -6v + 4v + 10, 5q + p = 4v. Factor 0 - 2/3x*q - 2/3x*2 - 2/9x - 2/9x4. -2x(x + 1)3/9 Factor -7r*3 - 42r - 61/2r2 - 18 - 1/2r4. -(r + 1)2(r + 6)2/2 Let r(x) be the first derivative of 1/4x*3 + 1/32x*4 - 1/80x*5 + 0x + x*2 - 36. Let u(t) be the second derivative of r(t). Let u(c) = 0. What is c? -1, 2 Suppose 2 = -38j + 39j. Let f = 27 + -12. Find b such that -fb + 18bj - 4 - 5 + 6 = 0. -1/6, 1 Suppose -23q + 17q + 150 = 0. Suppose -9r - q = -133. Find s, given that 16/3 - 8s - rs*2 - 10/3s*3 = 0. -2, 2/5 Let r = -81 - -62. Let d be r/(-2)4 - 2. Factor 549v3 + dv + 67v2 - 7v*2 + 4v*4 - 521v*3. 4v(v + 1)(v + 3)*2 Let n(b) be the first derivative of 1/27b*6 + 65/9b*2 - 1/9b*4 + 101 - 92/27b*3 - 50/9b + 14/45b5. Factor n(o). 2(o - 1)*3(o + 5)*2/9 Solve -73p*2 - 456p + 71p2 + 782p + 996 = 0. -3, 166 Let n(d) be the first derivative of -2d5/11 - 169d*4/22 - 8d*3 - 2934. Factor n(q). -2q*2(q + 33)(5q + 4)/11 Let b(y) be the first derivative of 0y + 4/35y*5 - 1/21y*6 + 179 + 3/14y*4 - 4/7y*2 - 8/21y*3. What is f in b(f) = 0? -1, 0, 2 Let n be ((-885)/60 - -15)/(-2) - 58/(-432). Let x(g) be the second derivative of 3g + 0 - 1/2g2 + 1/9g*3 - ng*4. Determine q so that x(q) = 0. 3 Let h be 15/35 - (-5)/(70/22). Suppose 5b*3 - 139b*2 + 73b*h + 76b*2 - 40b = 0. Calculate b. -4, 0, 2 Let o(y) be the second derivative of -y6/40 - y5/30 + y*4/24 + 20y*2 + 45y. Let a(r) be the first derivative of o(r). Factor a(x). -x(x + 1)(3x - 1) Suppose 13l = 6 + 59. Suppose 198 = -lq + 14q. Suppose -h*2 - 22 + q + h = 0. Calculate h. 0, 1 Let b = -10103 - -363713/36. Let p(j) be the second derivative of 0j*2 + 1/126j*7 + bj*4 - 1/9j*3 - 1/90j*6 - 1/20j*5 - 16j + 0. Factor p(r). r(r - 1)3(r + 2)/3 Let p(y) be the second derivative of y8/4200 - y6/900 - y3/6 + y2 + 2y + 19. Let q(s) be the second derivative of p(s). Factor q(f). 2f*2(f - 1)(f + 1)/5 Let b(i) be the third derivative of i7/1470 - i6/56 + 43i*5/420 + 11i*4/8 - 70i*3/3 + 2472i*2. Suppose b(u) = 0. Calculate u. -4, 5, 7 Let v(k) be the first derivative of -11k*3/8 - 183k*2/8 - 33k/8 + 432. Solve v(r) = 0 for r. -11, -1/11 Let v(a) be the first derivative of a5/10 - a3/3 + 85a - 48. Let b(g) be the first derivative of v(g). Factor b(x). 2x(x - 1)(x + 1) Determine s so that -3/4s5 - 7/4s*4 - 27 + 79/4s*3 - 81s + 27/4s2 = 0. -6, -2, -1/3, 3 Let b be (-330)/(-1540) + (-679)/(-1470)3. Factor 8/5 + bk - 6/5k*2. -2(k - 2)(3k + 2)/5 Let a(i) be the first derivative of -1/3i6 + 0i + 0i2 - 6/5i*5 - 2/3i*3 - 3/2i*4 - 32. Factor a(v). -2v*2(v + 1)*3 Factor 3655/6v*2 - 13/2v*4 + 4624v - 1/6v5 - 29478 - 97/2v3. -(v - 6)2(v + 17)3/6 Let b(x) be the second derivative of -1/2x*3 + 1/60x*4 + 222x + 0 + 7/5x2. Factor b(l). (l - 14)(l - 1)/5 Let g(j) be the first derivative of j6/6 + j5/2 - 5j4/4 - 112j + 231. Let t(k) be the first derivative of g(k). Factor t(x). 5x2(x - 1)(x + 3) Factor -9/5t*3 + 18/5 + 51/5t - 12/5t2. -3(t - 2)(t + 3)(3t + 1)/5 Suppose 0 = r - 3. Suppose -39 = -2a - rm, 5a - 6m = -2m + 40. Find c, given that -2c4 + 4c*5 + 7c*2 - 34c*5 - ac*2 + 37c*4 = 0. -1/3, 0, 1/2, 1 Factor -8/5n*3 + 48/5n*2 + 4 - 4/5n*4 - 56/5n. -4(n - 1)3(n + 5)/5 Let a(q) be the third derivative of -7q5/12 - 5905q*4/4 - 5060q3/3 + q2 + 5q + 266. Factor a(u). -5(u + 1012)(7u + 2) Determine y, given that -112y3 - 239y*3 - 1915y*4 + 5y*2 - 1500y*5 - 74y*3 - 15y*2 = 0. -1, -1/4, -2/75, 0 Let a be (0/(-6))/((-3 + 0)/3). Let u(s) be the second derivative of 1/40s*6 - 1/16s*5 + 3s + 0 + as3 + 0s*2 + 1/24s*4. Solve u(w) = 0 for w. 0, 2/3, 1 Let q = -3260081 - -1339894667/411. Let s = q + -2/137. Factor 23/3u + 10/3 - u*3 + su*2. -(u - 5)(u + 1)(3u + 2)/3 Let k be 4 + 55/(-50) - (-85)/850. Factor -1/9j4 + 0j - 16j2 - 8/3jk + 0. -j2(j + 12)2/9 Let j(c) be the third derivative of c5/75 - 433c*4/15 + 374978c*3/15 - 1488c*2. Determine s, given that j(s) = 0. 433 Let u(m) = 4m*2 + 23m - 11. Suppose -6p = -0p - 132. Let y(b) = -232b2 + 215b*2 + 43 - 52b - 41b. Let h(j) = pu(j) + 6y(j). Factor h(k). -2(k + 4)(7k - 2) Let c(w) = -7w4 - 55w*3 + 106w*2 + 172w + 6. Let t(v) = -12v4 - 110v*3 + 211v*2 + 342v + 11. Let p(s) = 11c(s) - 6t(s). Solve p(o) = 0. -1, 0, 4, 8 Let s(z) be the first derivative of -z*6/150 + 3z*5/50 + 4z*4/15 - 73z - 81. Let q(i) be the first derivative of s(i). Factor q(u). -u*2(u - 8)(u + 2)/5 Let u be (-9)/(-5) + (-2)/(-10). Let a = u - -2. Determine z, given that -46z*a - 6z*2 + 12z*5 + 7z*4 + 38z*3 - 5z*3 = 0. 0, 1/4, 1, 2 Suppose -3t - 5b = -41, 17b + 74 = 4t + 14b. Suppose 5i + 17 - t = 0. Suppose 8/5 - 2c*2 + 2/5c*4 + 0c*3 + ic = 0. What is c? -2, -1, 1, 2 Let q(c) = -13c2 - 2c + 12. Let b(d) = 37d2 + 6d - 34. Let w(v) = 6b(v) + 17q(v). Let n(f) = -258f - 5808. Let x(r) = -n(r) + 3w(r). Factor x(t). 3(t + 44)2 Suppose -109a = -118a + 135. Suppose 5i + j = 15, aj = -i + 9j + 3. Suppose -1/2m4 + 0m - m*i + 0m*2 + 0 = 0. What is m? -2, 0 Suppose -1 = 3d - 10. Suppose 12n + 24 = 16n. Solve 4b - 12b*5 - nb*4 + 6b*3 + 20b*2 - 14b4 - b3 + db5 = 0 for b. -2, -1, -2/9, 0, 1 Let a(w) = -8w*5 - 36w*4 - 220w*3 - 396w*2 - 204w + 11. L	{ "pile_set_name": "DM Mathematics" }
is the remainder when 18(o + 50/6) is divided by 33? 30 Let d(g) = 2g*2 + g. Let p be (-1 + -4)/(-10)4. Suppose -5w = -7w + p. Calculate the remainder when d(-1) is divided by w. 0 Suppose 779 = 2x + 6k - 11k, 1552 = 4x - 4k. What is the remainder when x is divided by 16? 3 Suppose -34i + 1653 - 89 = 0. What is the remainder when i is divided by 16? 14 Let i(r) = r + 1. Let j be i(4). Let u(y) = jy - 2y + 1 - 2y + 0y. What is the remainder when 20 is divided by u(6)? 6 Let p = -5517 + 5553. Calculate the remainder when p is divided by ((-1)/(-2))/((-2)/(-52)). 10 Let t = 67 - -29. Let o(b) = 2b2 + 78b + 96. Calculate the remainder when t is divided by o(-38). 16 Suppose 5z - 10z = -40. Calculate the remainder when 61 is divided by z. 5 Let w be -31((-14)/18 - 2/9). Let l = w - 7. Calculate the remainder when 67 is divided by l. 19 Let b(y) = 19y - 31. Calculate the remainder when -26(-3 - (-2 - 0)) is divided by b(2). 5 Let k(x) = -41x - 273. Calculate the remainder when 545 is divided by k(-7). 13 Let h = 33 + -30. Suppose v - 4v = -o + 9, hv + 45 = 5o. Calculate the remainder when 80 is divided by o. 8 Let s = -27 + 31. Suppose 10 = si - 26. Suppose -5f = -if + 72. Calculate the remainder when f is divided by 7. 4 Let h(z) = -z*3 + 17z*2 + 2z - 25. Let a be h(17). Let o = 23 - a. What is the remainder when 22 is divided by o? 8 Suppose 5s = -5t + 75, -2s + 4t + 59 = 17. Let f = 5 + s. Calculate the remainder when 43 is divided by f. 21 Let o(m) = m*3 + 2m2 - 5. Let d be o(-4). Let z = -6 - d. Calculate the remainder when z is divided by 12. 7 Let m(s) = -s3 - 2s2 + 4s + 2. Let x be m(4). Let q = 119 + x. Suppose 0 = t - 1, 3t - 34 + 119 = 4h. Calculate the remainder when q is divided by h. 19 Let r be (3/6)/((-2)/(-16)). Suppose 5f - l = -2l + 85, rf + 4l - 68 = 0. What is the remainder when 64 is divided by f? 13 Let u be (1 + 0)/(-3 - 6/(-3)). Let h(z) = 68z2 + z + 2. Calculate the remainder when 272 is divided by h(u). 65 Suppose 6b + 272 = 10b. Suppose -4t = -5o + 253, -5o + b = t - 175. Let p = o - 20. Calculate the remainder when p is divided by 15. 14 Let z = -766 - -1290. What is the remainder when z is divided by 31? 28 Suppose -3a + 16 = 133. Let y = a + 83. Calculate the remainder when y is divided by 12. 8 Suppose 236i = 233i + 2901. What is the remainder when i is divided by 19? 17 Let x = 4 + 25. Suppose -2s + 1 + 9 = 0. Suppose -si = -16 - x. What is the remainder when 23 is divided by i? 5 Suppose a - 6 = 2q, -3q - 5 = -2a + 4. Let g(f) = 31f2 + 7f - 1. Calculate the remainder when q(344/(-6))/4 is divided by g(-1). 20 Suppose 4p + 924 = 2o, 2278 = 5o - 8p + 6p. What is the remainder when o is divided by 13? 12 Let a(b) = -b + 2. Let h be a(6). Let j(d) = d*3 + 6d*2 + 5d + 1. Suppose -3 = -4r + 17. Calculate the remainder when j(h) is divided by r. 3 Let f = 211 + -34. Calculate the remainder when f/9 + (-10)/(-30) is divided by 9. 2 Let a(t) = t3 + 9t*2 + 5t - 35. What is the remainder when 109 is divided by a(-7)? 25 Suppose -5n + 17 = 5j - 18, 2j - 16 = -4n. Let k be 4/(16/j - 2). Calculate the remainder when 29 is divided by -7 + k + -1 + 10. 5 Suppose 72 = 6o - 936. What is the remainder when o is divided by 22? 14 Suppose -10q + 112 = -14q. Let g = q - -46. Calculate the remainder when g is divided by 12. 6 Suppose -4p + 145 = 3b - 174, b - 79 = -p. Suppose w + 58 = 5u, 24 = -5w + 2u - 174. Let q = p + w. Calculate the remainder when q is divided by 15. 14 Suppose 11h = 5h + 84. Calculate the remainder when 137 is divided by h. 11 Let u(h) = 49h2 + 5h + 3. Calculate the remainder when 280 is divided by u(-1). 45 Let r be (-135)/(-20) - 6/8. Suppose -3a = -ra + 93. Suppose -23 = -2v + 11. Calculate the remainder when a is divided by v. 14 What is the remainder when 180/(-40)(1 + 26/(-6)) is divided by 9? 6 Let s(k) = -31k - k2 - 3 + 2 - 29 + 12k. Calculate the remainder when s(-11) is divided by 21. 16 Let s = 310 - 306. Let q(v) = 16v2 - 2v - 1. What is the remainder when q(-1) is divided by s? 1 Let n(h) be the second derivative of 19h3/6 - 11h*2/2 + 44h. What is the remainder when n(4) is divided by 33? 32 Suppose 17x + 15x = 22560. What is the remainder when x is divided by 59? 56 Suppose -169f = -173f + 240. What is the remainder when 166 is divided by f? 46 Suppose -3s + u + 96 = 0, -u + 120 = 4s - 5u. Let v(y) = -11y + 30. What is the remainder when v(-12) is divided by s? 30 Let x(m) be the second derivative of m5/20 - m4/4 + m*3/6 + 2m*2 + 22m. Suppose -1 = -u + 1. What is the remainder when x(3) is divided by u? 1 Suppose -499b - 791 = -506b. Suppose 2f - 87 = -f. What is the remainder when b is divided by f? 26 Calculate the remainder when 4(7 - 0 - -31) is divided by 12. 8 Let i(j) = -j*3 + 6j*2 + 18j - 4. Calculate the remainder when i(7) is divided by 63. 10 Suppose 2m + 0m - 4 = 0. Suppose 3h = -a + 5, -5a - h + 7 = -ma. What is the remainder when 32 is divided by (-330)/(-20)a/3? 10 Let g = -308 - -319. Calculate the remainder when g is divided by 8. 3 Let l = 20 + -19. Let u(f) = -f*2 - 7f + 7. Let p be u(-8). Calculate the remainder when l is divided by 8/12 + p/(-3). 0 Let i(h) = h*3 + 3h*2 - 36h - 15. Let w = -11 + 32. What is the remainder when i(-7) is divided by w? 20 Let q(y) = y*2 + 9y + 18. Let r be (-1 - -1)/3 - -9. Suppose -3 = -3j + r. Calculate the remainder when q(-8) is divided by j. 2 Let i(b) = -127b + 19. What is the remainder when i(-1) is divided by 25? 21 Let n = 100 + -89. What is the remainder when 2/3 + (-220)/(-3) is divided by n? 8 Let m(s) = 3s + 4. Let i(r) = r3 + 11r*2 - 11r + 27. Let g be i(-12). Let v = g - -48. What is the remainder when v is divided by m(4)? 15 Suppose -10y = -4y - 126. Let u = 20 - 15. Calculate the remainder when y is divided by u. 1 What is the remainder when 53 is divided by (1 + (-5)/(-2))(-6 + 8)? 4 What is the remainder when 52 is divided by ((-17)/34)/((-3)/168)? 24 Let f = -692 - -1223. Suppose -f = 18g - 1683. Let x(v) = v*2 + 3v - 6. Calculate the remainder when g is divided by x(-7). 20 What is the remainder when (10/(-20))/1-190 is divided by 33? 29 Suppose 0 = 11o - 69 - 8. Let q(p) = p*2 - 6p + 18. Calculate the remainder when 47 is divided by q(o). 22 Let k(r) = r*2 - r - 1. Let s(q) = -5q*2 + 10q - 20. Let a(m) = 6k(m) + s(m). Let x = 7 - -2. What is the remainder when x is divided by a(-8)? 3 Suppose -5v + 309 = -3n, -2v + 0n - 3n = -111. Calculate the remainder when 175 is divided by v. 55 Suppose 2l + 16a = 21a + 157, 2l - 4a - 160 = 0. What is the remainder when 599 is divided by l? 83 Let w(u) = -u3 + 12u*2 - 6u + 11. Let x be w(12). Let l = -44 - x. Calculate the remainder when 66 is divided by l. 15 Let f = -133 - -349. Suppose -d + f = 8d. What is the remainder when 116 is divided by d? 20 Suppose 2t + 9 = 5t. What is the remainder when 2/t-3 + 119 is divided by 17? 15 Let w(z) = 128z2 + 6z - 5. Let u be w(3). Suppose 0 = -12a + 17a - u. Calculate the remainder when a is divided by 39. 38 Let r = -99 - -93. Suppose z = 9 + 1. What is the remainder when ((-63)/(-35))/(r/(-130)) is divided by z? 9 What is the remainder when 301 is divided by (-8)/(9 - 132/12)? 1 Suppose -7d + 99 = -34. What is the remainder when 28 is divided by d? 9 Let q = 41 + -24. What is the remainder when q is divided by (-15)/(-2) + -610/40? 5 Suppose -2q + 5q - 114 = 0. Let y = 34 - q. What is the remainder when 7 is divided by y/((-24)/(-9))-2? 1 Let k(b) = 2b*3 + 19b*2 + 7b - 47. Let p(r) = r*3 + 10r*2 + 3r - 24. Let j(t) = 3k(t) - 7p(t). What is the remainder when 160 is divided by j(-13)? 25 What is the remainder when (-2)/(-4 - (-80)/(-75) - -5) is divided by -2(-1)/(-1) + 19? 13 Suppose -4j - j - g + 3659 = 0, g = j - 727. Calculate the remainder when j is divided by 15. 11 Let x = -399 + 623. What is the remainder when x is divided by 15? 14 Suppose 2k - 6k = 0. Suppose k = -0h + 2h - 238. What is the remainder when h is divided by 40? 39 Suppose 3g + 20 = -2g, -2r + 4g + 20 = 0. Suppose -15p = -10p + 55. Wha	{ "pile_set_name": "DM Mathematics" }
. What is the units digit of x? 0 Suppose 5p + 48960 = -7f + 10f, 3f + 3p = 49008. What is the hundreds digit of f? 3 Suppose 0 = -171u + 3143856 - 1211325 + 4622070. What is the thousands digit of u? 8 Suppose 2j + 7093 = -5f + 27302, -2j + 7f = -20149. What is the hundreds digit of j? 0 Suppose 22o - 17683 = -50o + 1103357. What is the units digit of o? 0 Suppose t + 2y = 1860, 4t + 2y = 6424 + 998. What is the thousands digit of t? 1 Let t(f) = -2f*2 + 20f + 30. Let k be t(13). What is the units digit of 12027/24 - (-6)/k? 1 Let l be (-1)/4 + (-6)/(-24). Let p = -37 - -40. Suppose l = -ps - s + 88. What is the units digit of s? 2 Suppose 0 = 16c - 3c - 29328. Let v = -1592 + c. What is the hundreds digit of v? 6 Let x(j) = -j - 9. Let m be x(-13). Suppose 0 = -2f - 5z + 32, mz + 8 = 2f + 3z. What is the units digit of (-390)/(-12) + 3/f? 3 Suppose 4y - 2 = 2o - 0, -5y = -o - 7. Let h = -1614 - -1617. Suppose -4f + yc = -c - 803, -hf = -4c - 611. What is the tens digit of f? 9 Suppose 7v = -0v + 54621. What is the units digit of v? 3 Suppose 0 = -28u + 50u - 583440. What is the tens digit of u? 2 Let o = 50048 + -11108. What is the thousands digit of o? 8 Suppose -28r + 450876 - 3686416 = -149r. What is the units digit of r? 0 Suppose -3q = -q + 2. Let f = -4953 - -5104. Let r = q + f. What is the tens digit of r? 5 Suppose -9x + 2x = 28. What is the hundreds digit of (-2)/x(29 - -1541)? 7 Suppose -5x - 68735 = -3m + 23369, m - 30720 = 4x. What is the units digit of m? 8 Let v = -6350 - -9470. Let y = v - 1813. What is the tens digit of y? 0 Suppose 135n = 1081155 + 777207 + 339438. What is the thousands digit of n? 6 Let h = -62 - -602. Suppose m - 5m + 5 = -5s, 1 = -m - s. Suppose -32w + 36w - h = m. What is the hundreds digit of w? 1 Let w be (-784)/(-44) + 2/11. Suppose -5b + 2 = -w. Suppose -5a = -ba - 56. What is the tens digit of a? 5 Let z = 549 - 43. Suppose -119 - z = 5x. What is the tens digit of 2/4 + x/(-10)? 1 Suppose -7o - 23 + 72 = 0. Suppose -o = 2d - 4n - n, 3d = 4n. What is the units digit of 0/d - -3 - -3? 6 Suppose 370 = -y - 68. Let d = y - -805. What is the tens digit of d? 6 Let l be 4/(-26) + 280/130. Suppose 1 - 3 = -u, -lu = 5x - 14. Suppose b - xt - 8 = -4t, 3t - 21 = -2b. What is the tens digit of b? 1 Suppose 2x - 56 = 28. Let k = x + -37. Suppose 43 = 2j - kc, -6j - 3c + 151 = -2j. What is the tens digit of j? 3 Let n = 1816 + -1035. Let s = n - 466. Suppose -s = 5l - 12l. What is the units digit of l? 5 Let p(a) be the second derivative of 5a4/12 - a3 + a2/2 + 106a. What is the hundreds digit of p(7)? 2 Let p = 36 - 23. Suppose pk + 4k - 21743 = 0. What is the thousands digit of k? 1 What is the thousands digit of (-20)/25 - ((-962814)/30 + -2)? 2 Let m be 2/1 + 263/3. Let z(t) = -67t*3 + 3t*2 - 4t + 2. Let j be z(1). Let p = m - j. What is the units digit of p? 0 Let a = -13423 - -23848. What is the thousands digit of a? 0 Let m = -98 - -389. Let r = -270 + m. What is the tens digit of r? 2 Let u(x) = -919x - 3445. What is the tens digit of u(-64)? 7 Suppose 0 = -x - 6x. Suppose -j + 2 + 3 = x. Suppose -y + 379 = 3o, 5o - 424 - 211 = -jy. What is the tens digit of o? 2 Let a(t) = 2t*2 - 5t + 4. Let p be a(2). Suppose ph - 7319 = -11h. What is the tens digit of h? 6 Suppose -509y = -511y + 398. Suppose -2m - 4v + 336 = 0, -m - 25 + y = -v. What is the tens digit of m? 7 Let r be (-1)/(-7) + (-8)/7. Let l(a) = -2a3 + 8a*2 - 2a - 5. Let s(y) = -y*3 + y. Let z(q) = rl(q) + s(q). What is the tens digit of z(9)? 1 What is the tens digit of (-94)/((-2)/(-7) - (-3744)/(-12222))? 5 Let j(c) = 187c + 604. What is the hundreds digit of j(42)? 4 Let i = -104 - -52. Suppose 86 = -6u + 704. Let v = i + u. What is the tens digit of v? 5 Let x be (0/(-3) - 0) + 206. Let r(n) = 141n3 - 3n*2 + n + 3. Let j be r(-1). Let i = x + j. What is the tens digit of i? 6 Let m(j) = j + 1. Let w(s) = -2s*3 - 10s*2 + 5s + 2. Let n(q) = 6m(q) - w(q). Let d be n(-5). What is the tens digit of 124 + -1 + (-5 - d)? 1 Let a(i) = 4i - 29. Suppose 33 = 5l - 7. Let w be a(l). Suppose 0 = 5f - 2b - 20 - 362, -wb + 301 = 4f. What is the units digit of f? 6 Let m(u) = -2u*3 + 5u*2 + 6u + 6. Let q be m(-4). Suppose 29h = 30h - 3z + 60, 0 = -z + 4. Let s = q + h. What is the units digit of s? 2 Let z be (501/(-9))/((-2)/66). Let u = z - -16. What is the thousands digit of u? 1 What is the units digit of (0/7)/(-1) - 5816/(-2)? 8 Let i(u) = 33u - 44. Let d(a) = a*3 - 12a*2 + 2a - 18. Let y be d(12). What is the hundreds digit of i(y)? 1 Let r be -604 - 18/1525/10. Let f = 1039 + r. What is the units digit of f? 2 Suppose -120 = -3s - b + 109, -4s = -b - 303. Let h = s - 49. Let n = h - -145. What is the units digit of n? 2 What is the ten thousands digit of -1((-34)/(-85) - (-5 + (-241922)/(-5)))? 4 Let z(o) = -4o3 - 2o*2 - 3o + 18. Let s(p) = 2p - 15. Let h be s(5). What is the units digit of z(h)? 3 Suppose -435u + 452u = 421634. What is the hundreds digit of u? 8 Let a(w) = 13w*2 + 50w - 23. Suppose 0 = 845t - 852t + 63. What is the tens digit of a(t)? 8 Suppose 3303v = 3314v - 448793 + 181086. What is the tens digit of v? 3 Suppose 0 = -5o + 23 - 18. Suppose -h + o = -1. Suppose -hw + 5u - 5 = 0, -4w = -2w - 4u. What is the tens digit of w? 1 Let k = -474 + 478. Suppose -6x + x - 1425 = -5u, -x - 1131 = -ku. What is the hundreds digit of u? 2 Suppose -14w + 24w - 20w + 90780 = 0. What is the units digit of w? 8 What is the hundreds digit of (12856/(-25)(-1005)/(-134))/(2/(-5))? 6 Let k = 2843 - 1918. Suppose 12m + k = 5161. What is the units digit of m? 3 Let f(c) be the third derivative of 2c5/15 - 7c*4/12 - 7c*3/6 + 264c*2. What is the hundreds digit of f(11)? 8 What is the thousands digit of 3/((-783)/(-8786844)) + 4 + (-118)/29? 3 Let h(a) = 421a*2 + 11a - 3. Let t be h(-2). Let p = t - -286. What is the hundreds digit of p? 9 Let n = 56 + -56. Suppose -3z + 4o + 896 = n, -3o + 1 = -2o. Suppose 3i + i = z. What is the units digit of i? 5 Let j(z) = 5z - 38. Let d be j(9). What is the hundreds digit of ((-196)/d)/7 - -475? 4 Let c = 37 + -25. Suppose co - 5110 - 410 = 0. Suppose -5t + 5 = 0, -4l = 2t - 102 - o. What is the hundreds digit of l? 1 Let t = -41 + 38. Let u be 33 + 2/(2/t). What is the units digit of u(-12)/15-4 + -1? 5 Let q(k) = -167k - 190. Let x be q(0). Let z(u) = -5u*2 + 5u + 4. Let i be z(4). Let h = i - x. What is the tens digit of h? 3 Suppose -344 = 24q - 20q. Let g = q + 88. Suppose -gk + 699 = k. What is the tens digit of k? 3 Let m be (6040/(-453))/(2/(-12)-4). Suppose 73 = j + 27. Let p = j + m. What is the units digit of p? 6 Let m = 4088 + 25305. What is the hundreds digit of m? 3 Let f be -21404/2617/(-4). Suppose -3x + f = -4188. What is the tens digit of x? 4 Let y(j) = -2j*2 - 22 + 8j*2 + 39j - 41j - 4j*2. Let w be 4/(4/(-3)) + -3. What is the units digit of y(w)? 2 What is the thousands digit of ((-4913)/34)/((-427)/(-214) - 2)? 0 Let r(i) = 20788i*3 - 2i*2 - 27i + 29. What is the thousands digit of r(1)? 0 What is the units digit of (40/(-30))/(8/(-43788))? 8 What is the units digit of -13 - (8 - 10 - 7176)? 5 Let i = 27 - 24. Let j(s) = 6s + 36 - 40 - is. What is the units digit of j(3)? 5 Let m(r) be the third derivative of -r*4/12 + 37r*3/3 + 5r*2 + 7r. What is the units digit of m(-2)? 8 Suppose -372r + 163114 + 1910414 = 0. What is the hundreds digit of r? 5 Suppose -79d + 268d = 2985255. What is the hundreds digit of d? 7 Suppose 10i - 15i + 4145 = 0. Suppose -13k = -i - 952. What is the tens digit of k? 3 Suppose -4h = 2u + 78, -6h + 3u - 114 = -h. Let c(r) = -8r2 + 16 - 29 + 2r - 32r + 7r*2 - 17. What is the tens digit of c(h)? 5 Let v(i) = -5i + 125. Let t be v(26). Let o(y) = -162y - 6. What is the tens digit of o(t)? 0 Let i(t) = 60t*2 - 3t + 4. Suppose 5u + 42 = 2j, -126 = -5j + 2u - 0u. Let h = 27 - j. What is the tens digit of i(h)? 6 Suppose 143 = 10p + 43. Suppose 4k = -2i + p, -2i + 2k = i - 31. Suppose 12g - ig - 387 = 0. What	{ "pile_set_name": "DM Mathematics" }
66) + 299 + -187. 49 31 + 0 + (196 - (-166 - -357)) 36 Evaluate 61 + 7 + (-97 - -83). 54 Evaluate (-4 - -7) + -169 + 150 - 4. -20 (28 - 20) + (53 - 47 - (16 + 0)) + -4 -6 What is the value of 0 + (25 + -28 - -3 - 22) + (-5 - 0)? -27 Calculate (56 - (23 - -23)) + -16. -6 What is the value of -30 - ((157 - 153) + (-5 - -2 - 1))? -30 What is (-604 - -445) + (118 - 18)? -59 Calculate -7 - (-7 - (-27 + 18) - -41). -50 -10 + -3 - ((-3 + -12 + -3 - -18) + -19) 6 What is 184 - (39 + -6 - (5 + -3))? 153 (-120 - -1) + -1 + (38 - 1 - (2339 - 2297)) -125 What is -22 - -2 - (392 - 387)? -25 Evaluate 36 + (19 + -3 - (12 - -29)). 11 Calculate 75 + -137 + 15 + -14. -61 1 - (-71 + 51) - (-20 - -3) 38 What is the value of 1 - -11 - 12 - 26? -26 (91 - (-5 + 25 + -33)) + -20 84 Calculate (67 - (103 - 10)) + 56. 30 Calculate -30 + 24 + -1 + 79 + (-4 - 7). 61 -133 + 123 + 3 + (-2 - -96) 87 Calculate -61 - -15 - (0 + 0 + -12). -34 What is the value of -51 + (5 - (2 + -3) - 9) - (-4 - 0)? -50 What is (3 - (-18 + 64 + (0 - 11))) + 14 + -5? -23 Calculate 42 + -73 + -21 - -45. -7 Calculate (-3780 - -3734) + 1 + 68. 23 What is the value of 38 - (295 + -283 - (-3 + 17 + 2))? 42 What is -44 - (12 - (39 - (10 + -10)))? -17 79 - (156 + -80) - 85 -82 What is 36 + -6 - -4 - (25 - (3 - -21))? 33 What is -464 + 449 + (78 - 1)? 62 (29 - (-175 + 115)) + -109 -20 What is 1345 + -1456 + 189 + 13? 91 What is (-23 - -18) + 10 + 6? 11 Evaluate 84 + -68 - (-14 + (3 - 14)). 41 (3 - (1 - -3)) + (1 - 25) + 13 + 10 -2 Calculate 140 + -77 + 12 - -6. 81 What is the value of -9 + -8 + 28 + -1 + 67 + -10 - -8? 75 Evaluate (-5 - -43) + -85 + 18. -29 Calculate -53 + (11 - (-46 + 23)). -19 What is 0 - -126 - -2 - (-50082 + 50110)? 100 -34 - (166 - 94) - -116 10 What is the value of (0 - -10) + (36 - 37) - (25 - -57)? -73 Evaluate 71 - (3 - (-16 - (-2 + -10 + 10) - -4)). 58 What is the value of (-307 - -339) + (-93 - -25)? -36 -451 + 412 + 51 + 2 14 Evaluate -2 - -3 - (-5 + (-11 - (1 - 4)) + 15). -1 -17 - (75 - (10 + (-6 - 5) - 0)) -93 -10 + 24 + 34 + -41 7 Calculate (-1035 - -898) + 7 + 44. -86 1040 + -1047 + (-11 - -127) 109 What is the value of -97 - (-8 - 31) - -57? -1 Calculate (0 - 12) + 15 + 2 + 3 + -5 + -3. 0 What is the value of 6 + (-15 + 13 - -2)? 6 What is the value of -2 + (-4 - -7) + (28 - -2) + -92 + -14? -75 Calculate (184 - 187) + -34 + 0. -37 Evaluate -14 + (0 - -1) + 3 + (-45 + -44 - 0). -99 What is the value of 35 - (-22 + (6 - (-19 + -132)))? -100 Evaluate 11 - -3 - (0 - 0 - (-183 - -157)). -12 (3 - -12 - (84 + -75)) + (-30 - 2) -26 What is -73 + (-2 + 0 + 12 - (6 - (-7 + 12)))? -64 Evaluate -152 + -2 - (-1095 + 977). -36 32 + 19 + (-28 - (-38 - 34)) 95 What is 5 + (-1 - 10) + -19 + (-32 - -8) + 9? -40 Calculate 6 + -2 + 6 + -11 - -2 - -38 - 5. 34 What is 31 - -10 - (17 + -40 + 42)? 22 (73 - 61) + -25 + 3 + (24 - -35) 49 Evaluate (-70 - 8) + 76 + (-10 - (-1 + 2)). -13 What is the value of (-1 - -15) + (1236 - 1225 - (13 - 0))? 12 Calculate 144 + -33 - (207 - 145). 49 Evaluate -4 + -1 - -1 - (-50 + (28 - -37)). -19 (34 - (15 + 15) - 28) + 5 -19 What is the value of 21 + 4 + -2 + -16 + (15 - -15) + -13? 24 Calculate 0 - (2 - (-5 - -11) - (-9 + 21 - 10)). 6 Evaluate 137 - (92 + 11) - (-1 - -21). 14 Evaluate (-112 - (72 - 143)) + (1 - 6) + 1. -45 Calculate -3 + 10 - (103 - (2 - -64)). -30 5 + (-16 - 2) + -4 + -26 -43 What is -2 + (8 + -5 - ((-3 + 68 - 4) + -6))? -54 What is 3933 - 4008 - (2 - 0 - 0)? -77 What is the value of 48 + (13 - (6 - -1) - 3)? 51 Evaluate -9 + (1 - (6 - 57)) + 13 + 4. 60 Evaluate -2 - (-9 + -1 - (-1 + -15)) - (-1 - 92). 85 (17 - 17) + (9 + -8 - 13) + 22 10 -68 + (-115 - -53) + 87 -43 What is the value of -79 + 80 + (0 + -3 - -3) + 62? 63 What is -239 + (126 - 36) - -44? -105 Evaluate 55 - (29 + 0 + 46). -20 -112 + 125 - ((2 - -3) + 21) -13 18 + -22 + 29 + 112 + -52 85 Evaluate 19 + (-5 - (16 - (-7 - -14))) - -35. 40 (4667 - 4662) + (-5 - 2) -2 Evaluate 90 - (20 + -17 - -14) - (14 + -1). 60 What is -13 + (86 - (61 - 33)) + -35? 10 56 + 6 + -24 + 17 + 6 + -16 45 -22 + 72 + -36 - -4 18 178 - 102 - 17 - (-1 + 1 + -1) 60 Evaluate -31 + (86 + -32 - -22). 45 Evaluate (0 + (-20 - -3) - -4) + -1 - -46 - 6. 26 What is (35 + -50 - (8 - (-8 + 17))) + 1 + -2? -15 What is the value of (-2 + 1 - (30 + -32) - 3) + 79? 77 -66 + (-5062 - -5076 - (16 + (2 - 4 - -1))) -67 Calculate (28 - -15) + (-73 - 90). -120 Evaluate (-66 - -1) + (42 - (76 - 18)) + (3 - -9). -69 What is the value of 22 - (61 + (-3 - 31))? -5 Calculate (31 - 20) + 8 + -41 + (9 - 2 - 1). -16 What is 5 - (7 + -18 - -28)? -12 What is (11 - -3) + -1 + -14 + 3 - 16? -14 What is -3410 + 3446 - (63 + -1)? -26 Calculate (25 - -4) + -15 + (-55 - -53). 12 What is the value of -2601 + 2637 + -43 + 0 + -58 + (-1 - -3)? -63 Evaluate (-1778 - -1779) + 4 + -2 + 20. 23 Calculate -19 + 27 + -8 + 0 + -30. -30 What is the value of (85 - (-81 - -56)) + -75? 35 Calculate -12 + 8 - ((5 - 85) + (-4 - -8)). 72 -116 - ((23 - (-21 - -6 - -20)) + -14) -120 What is 9 - (1 - (-12 + -17 + 2)) - 16? -35 Evaluate -11 + 1 - (46 + -35 + (5 + -1 - -56)). -81 Evaluate -3 + 9 + -3 - (1 + 11 - -31). -40 What is the value of (-10 - -20) + (22 - 35) - (-1 + 47)? -49 Evaluate -560 - -566 - (13 + 0 + -4). -3 What is 9 + ((-1 - -21) + -12 - 16) + -8 - -17? 10 Evaluate -2783 + 2812 + (2 - 4). 27 -73 + (-15 - ((37 - 45) + 7)) -87 What is 5 - (-10 + (-1 + -8 + 10 + -5 - -5))? 14 Evaluate (-14 - -6 - -15) + -13 + -4 - -4 - 51. -57 Calculate -37 + (1 - 1) - (-11 + (-6 - -4) + 14). -38 What is 23 - (-1 + (-12 - (48 + 1)))? 85 (-37 - -21) + -57 + 12 -61 What is the value of 0 + 15 - (31 - 30 - -9) - 21? -16 Evaluate 9 + (5 - 1) + (-8 - 0) + 7. 12 What is 0 - (-3 - 4 - -1) - (-74 + 49 + -55)? 86 Evaluate 57 + 0 + 3 - (10 - (6 + -11 - -9)). 54 What is the value of (39 + -44 - (42 + -6 + 2) - 3) + 12? -34 Evaluate (-31 + 55 - -21) + -35. 10 What is the value of (32 - 56) + -3 - -42? 15 What is the value of -59 - (-4 + (-10 - -16) - 24)? -37 What is the value of -8 + -5 + -9 + 11 + (0 - 1 - 8)? -20 What is the value of 53 - -11 - 48 - 63? -47 What is the value of 0 + 2 + -523 + 568 + 6 + -7 + 1? 47 Evaluate (1 - -11) + 107 + -45 + 13 + 1. 88 Calculate 3 + (1 - 0) - (3 + 2 + (35 - 30)). -6 -57 + 76 + 13 + (0 - -2) + -3 + 5 36 Evaluate (-12 - 1) + 1 + 1 + (296 - (67 - -171)). 47 What is the value of (75 - 0) + -183 + 60? -48 What is -2 - -43 - (169 - (-185 - -364))? 51 Calculate 18 + (-2 - -8 - (33 - (13 - -18))). 22 Evaluate (-15 + 9 + -22 - 27) + -22. -77 Evaluate (13 - (14 - (10 - -1))) + (3 - -78) + -8. 83 Calculate 114 - (-21 - (3 + -9 + 4)) - 3. 130 Calculate 0 + (-30 - -7) + -7 + 1 + (-5 - -7). -27 -9 - (1 - -37 - (124 + -109)) -32 -4 - (44 + -1 + (2 - 51 - -25) + 16) -39 Evaluate 37 - (((-8 - (11 - 9)) + -1 - -29) + -10). 29 What is the value of (52 - 18) + -26 - (9 + -6 + 15 + -1)? -9 Calculate (7 - -28) + (14 + 0 - 32) + 14. 31 What is the value of (-1 - 10) + -25 + 27 + -13? -22 (14 - -20 - 59) + (81 - -2) 58 Calculate (76 - 2) + (110 - 245). -61 Evaluate -80 + (17 + (13 - -11) - 15). -54 What is the value of -18 - (-60 + (-10 - -6) + 23)? 23 -106 - -76 - (24 + 2 + -6) -50 (-45 + 22 + 24 - (-12 + 9)) + 70 74 -88 - ((-4 - -8 - (7 - 0)) + -471 + 481) -95 What is (17 - 2) + 1 + 2 + 12322 + -12332? 8 What is (20 - (-1 + -16 + 29)) + -3 + -52? -47 Evaluate (-9 - -1) + (-1 - -22 - (-144 - -271)) + -10. -124 Evaluate -23 + (-17 - -48) - (0 + 1 + -2). 9 -30 + (86 - 61) + (0 - (0 + -2)) + 19 16 What is the value of -75 - -109 - -122 - 95? 61 Evaluate 2 - ((24 - 10) + -58). 46 What is the value of (-7 - (28 + -3)) + 17? -15 (-1 - -2 - -36) + (5 - (5 + 4)) 33 -114 + 8 + -19 - -171 46 What is (-21 + 22 - 3) + -19 + 19? -2 Evaluate (-14 - -1) + 3 - (-25 + 16 - 13). 12 What is the value of (-161 - -50) + -15 + (8 + 8 - 23)? -133 Evaluate (0 + 15 - 7) + (28 - -1) + (4 - 0). 41 What is the value of (84 - 57) + (4 + -2 - (-13 - -13))? 29 What is -99 - (35 - -34 - 82)? -86 Evaluate -43 - (-77 - -52) - -13. -5 Evaluate -5 - (-14 + 41 + 6 - 17). -21 81 - (36 + -11 + -12 + -6) 74 What is -156 - -135 - (0 + -48 - -3)? 24 602 + -601 - ((-2 - 16) + -4) - -75 98 What is the value of -41 + (-1 - -10 - (2 - (-14 + 5 - -9)))? -34 What is -24 - (-7 + 11 + -17 + 27)? -38 What i	{ "pile_set_name": "DM Mathematics" }
- -8195.999991931. What is l rounded to seven decimal places? -0.0000081 Let k = -27 + -12. Let c = 6 + k. Round c to the nearest ten. -30 Let w = -0.19 - -0.3154. Round w to two decimal places. 0.13 Let h = 1334.18 - 1345. Let i = -0.18 + h. Let d = i - -10.9999998. What is d rounded to 6 decimal places? 0 Let v be 117/(-6)((-49)/3 + 1). Let l = v - -86. Round l to the nearest 10. 390 Let d = 17 - 16.92. Let s = 0.07999935 - d. Round s to seven dps. -0.0000007 Let o = 0.16 - 0.02. Let b = 0 + o. Let w = -0.140017 + b. What is w rounded to six dps? -0.000017 Let f = -392 - -594. What is f rounded to the nearest 100? 200 Let n(w) = w2 + 3w - 8. Let r be n(4). Suppose 2l = -3l + r. Suppose -3v = -lz + 3z - 182, -4z - 128 = -2v. Round v to the nearest 10. 60 Let a = -0.068485 + -448826.931515. Let x = -448826.7900068 - a. Let n = x + -0.21. What is n rounded to 6 dps? -0.000007 Suppose 4p = -y - y + 10, -5y = 4p - 7. Let k(x) = -3001x3 + 3x*2 - 2x + 6. Let g be k(p). Round g to the nearest ten thousand. -80000 Let s = -21.746 - 0.254. Let f = -250550.17 - -250572.169971. Let g = s + f. What is g rounded to five decimal places? -0.00003 Let n(o) = o*3 - 14o*2 + 3o - 5. Let f be n(6). Let k = 9527 + 3198. Let y = f - k. Round y to the nearest 10000. -10000 Let m = -1629.276 + 1635. What is m rounded to the nearest integer? 6 Suppose 2q - q - 3 = 0. Let n be (-6)/3 - -8 - q. Suppose nc - c - 4600000 = 0. Round c to the nearest 1000000. 2000000 Let o = 634215 - 443815. What is o rounded to the nearest ten thousand? 190000 Let u be (1-67)/(3/(-35157)). Suppose u = -2j - 2614823. Let b be j/5 - 18/45. What is b rounded to the nearest 100000? -300000 Let m = -5043244 - -5043273.900469. Let q = -29.9 + m. What is q rounded to five decimal places? 0.00047 Suppose i = -i + 6. Let g(q) = q3 - q2 - 6q. Let h be g(i). What is h rounded to 7 decimal places? 0 Let w = 29112.13101 + -29584.129. Let n = 472 + w. What is n rounded to four decimal places? 0.002 Let h be (0 - 256)11750000/94. Round h to the nearest 1000000. -32000000 Let j(n) = -57n3 - n2 - n + 2. Let s(y) = y + 9. Let w be s(-7). Let g be j(w). Round g to the nearest 100. -500 Let j(m) = -104143m*2 - m. Let d be j(1). Let t = d + -85856. What is t rounded to the nearest 100000? -200000 Let m = -0.04632 + 56.95832. Let p = -57 + m. Round p to two dps. -0.09 Let k = -2751 + 2647.56. What is k rounded to the nearest 10? -100 Let q = 6 + -6.9. Let p = q + 0.1. Let m = 1.25 + p. Round m to one dp. 0.5 Let p be (-13 + 921)/(1/(-475)). What is p rounded to the nearest 10000? -430000 Let z = 57 - 33. Let i = -34395957 - -34395932.9999945. Let g = z + i. Round g to six dps. -0.000006 Let m(c) = 2c - 13. Let r = -17 + 22. Let p be m(r). Round p to the nearest 10. 0 Let r = -39916 + 79607. Let t = r - 39695.0002. Let x = t - -4. Round x to four dps. -0.0002 Let b = -185267076 - -185317258.0212. Let i = 50212 - b. Let x = -30 + i. Round x to three dps. -0.021 Let r = -398926 - -188170. Let a = 62244 - r. What is a rounded to the nearest ten thousand? 270000 Let g = -0.15511 + -0.13215. Let v = 0.282 + g. What is v rounded to three dps? -0.005 Let n = 759 + -383. Suppose -u - n = 384. Round u to the nearest 100. -800 Let d = 66.31 - 67. Let l = 0.83008 + -0.1407. Let i = l + d. Round i to 4 dps. -0.0006 Suppose 3c = -m + 3m + 556, -c = -5m - 168. What is c rounded to the nearest one hundred? 200 Let n(p) = 40480005p*2 + 4p - 1. Let k be n(-1). Round k to the nearest 1000000. 40000000 Let t = 6.155 + -0.275. What is t rounded to 0 dps? 6 Let y = -1721.99997932 + 1722. What is y rounded to six dps? 0.000021 Let r = -572 + 572.481. Round r to 1 decimal place. 0.5 Let q = 24 - 24.4. Let n = -0.39999988 - q. What is n rounded to seven decimal places? 0.0000001 Let y = 1972.9997721 - 1973. What is y rounded to 5 decimal places? -0.00023 Suppose 64056 = -z - 185944. Round z to the nearest one million. 0 Let v = -1300785 - -5160785. Round v to the nearest 1000000. 4000000 Let o be 10000/(0 - 2 - 32695/(-16350)). Round o to the nearest one million. -33000000 Let h = 63 + -36. Let v = 10 - h. Let n = v + 16.999964. Round n to 5 decimal places. -0.00004 Suppose o = -o - 56. Let i be 6187 + (-7)/(o/(-8)). What is i rounded to the nearest 100? 1100 Suppose 0 = 7q - 1200437 + 4788980. Let i = q - 1887351. What is i rounded to the nearest one hundred thousand? -2400000 Let g = -10.49 + 12.528. Let q = g - 2. Let u = q - 0.0485. Round u to 3 decimal places. -0.011 Let d = 0.43 - 0.4. Let x = -5.97 - d. Let c = x - -5.5. Round c to zero dps. -1 Let p = 242440 + -93961. Let n = 1468479 - p. Suppose -2t = t - n. Round t to the nearest 100000. 400000 Let x = 3928464 - 5623522. Let p = x + 1206058. Round p to the nearest one hundred thousand. -500000 Let a(y) = -y2 - 7y - 2. Let h be a(-7). Let b be 13(h - 1/(-1)). Round b to the nearest integer. -13 Let x = 25.28 - -0.2. Let h = -25 + x. Let c = h + -0.47999981. What is c rounded to 7 decimal places? 0.0000002 Let a = 495.99439 - 496. Round a to 4 decimal places. -0.0056 Let x = -563 + 512.4. What is x rounded to the nearest ten? -50 Let s = 4761056207547926.9999726 - 4761056888887338. Let w = 681339490 + s. Let p = w - 79. What is p rounded to 6 decimal places? -0.000027 Let t = 0.51 + -0.44. Let u = 19.49945 + -19.57. Let c = u + t. What is c rounded to four decimal places? -0.0006 Suppose -6809 = -2d + z, 3z - 6797 = -2d - 0z. Let j be 2/((-3)/(-4) - 1/12). Let h be j - (3 - 3) - d. Round h to the nearest 1000. -3000 Let d = -0.1562 + 0.067. Round d to three dps. -0.089 Suppose 5i = -2p - 4299990, -2i + 4p - 380749 = 1339271. What is i rounded to the nearest 1000000? -1000000 Let p = -5637 + 5637.00004163. What is p rounded to 6 dps? 0.000042 Let n = -3 - -11. Suppose q + q - n = 0. Suppose 4o - 5j = -19, -o + 2j - j = q. Round o to 1 dp. -1 Let c = 226 + -375. Let a = 151.1508 + -3.4608. Let w = a + c. What is w rounded to 1 decimal place? -1.3 Let b = 7556847 - 7556777.999815. Let w = -69 + b. Round w to 5 dps. 0.00019 Let c = -3.26 - -0.56. Let s = c + -1. What is s rounded to 0 dps? -4 Let b = -1384.04 - -1349. Let z = b + 0.04. Let u = -17.3 - z. What is u rounded to zero dps? 18 Let s = 37420.659933 - 37495.659933115. Let f = -75 - s. What is f rounded to seven dps? 0.0000001 Let r = 123.9999674 + -124. What is r rounded to five decimal places? -0.00003 Let u(v) = -v*2 + v - 66. Let w be u(0). Let h = -576 + 428. Let f = w - h. What is f rounded to the nearest ten? 80 Let k = -20250.4 + 20250.3822537. Let w = -2.6178503 - k. Let b = w + 2.6. What is b rounded to five dps? -0.0001 Let g = -0.23 - -0.268. Let i = g + -0.03794. What is i rounded to five dps? 0.00006 Let c be (-394)/((12/9)/(-2)). Let g = c + -3391. What is g rounded to the nearest 1000? -3000 Let h = 4 - 6. Let b = h - -2.11. Let i = -0.03 + b. Round i to 1 dp. 0.1 Let a = 13 + 14. Let z = a - 27.0000008. Round z to seven dps. -0.0000008 Let o = 2049.4503 - 2049. What is o rounded to 2 dps? 0.45 Let r(d) = d + 1. Let m(x) = -6x + 11 - 7x - 8x + 0x. Let t(w) = -m(w) + 6r(w). Let s be t(5). What is s rounded to the nearest one hundred? 100 Let t = 2413702 - 943702. What is t rounded to the nearest 100000? 1500000 Suppose 3m - 14 = y, 2m + y = -4y - 19. Suppose 3g - a - ma - 389 = 0, 4g - 5a - 520 = 0. What is g rounded to the nearest ten? 140 Let y = 1679367 + -1065367. Suppose -y = -20x + 22x. Round x to the nearest ten thousand. -310000 Let x = -23 + 27. Let n be 23199996/10 - x/(-10). What is n rounded to the nearest 100000? 2300000 Let h = -1.4 - 6.6. Let w = 229361.900035 + -229353.9. Let j = w + h. Round j to five decimal places. 0.00004 Let n(z) = -127z - 5. Let p be n(-5). Suppose p = 2g - g. Round g to the nearest 100. 600 Let m = 4168.9998187 - 4169. What is m rounded to 5 decimal places? -0.00018 Let t = 321.061 - 321. What is t rounded to two decimal places? 0.06 Let s = 34.907 - 0.107. Let n = 80 - 52. Let m = s - n. What is m rounded to 0 decimal places? 7 Suppose 4r - 8540008 = 2z, r = -3z + 7z + 17080002. Round z to the nearest one hundred thousand. -4300000 Suppose -6 = 4b - 34. Suppose -a = b*a - 697	{ "pile_set_name": "DM Mathematics" }
- 13. Suppose cq = -5d + 1406, 8 = -4q + 20. Is 35 a factor of d? True Let t(v) = 8v - 1. Suppose -7h + 2h = -5. Let r be t(h). Suppose rq - 2q = 415. Is q a multiple of 17? False Let g be (-6)/(-2) - 0 - (-11 - -10). Does 4 divide ((-48)/(-28))/(g/28)? True Let b(q) = -q + 3. Let a be b(-4). Let x = a - -11. Suppose 0w - x = -3w. Does 2 divide w? True Let t(s) = -s*3 + 6s*2 - s + 9. Let p be t(6). Suppose 3f + 64 = 4f - m, -pf + 182 = -5m. Does 23 divide f? True Let z(b) = -b3 + 9b*2 - 8b + 3. Let p be z(8). Let r be p + 3/((-3)/2). Let f(k) = 7k3 + 2k*2 - 2k + 1. Is f(r) a multiple of 8? True Let n be 6/7(1 - (-11)/3). Suppose 2k - n - 16 = 0. Is k a multiple of 5? True Suppose -c - 3w + 9 = 3c, c = -3w. Suppose -ca = -66 + 18. Does 29 divide a/(-48) + (-349)/(-3)? True Is (234/5)/((-36)/(-120)) a multiple of 12? True Suppose 0 = 5a - 3g - 4613, -a = -3a + 4g + 1834. Does 25 divide a? True Let f be (-3 - -2 - -2)5. Suppose 2b - 5b = -3y - 237, -fy - 2b = 430. Let j = y - -129. Does 10 divide j? False Let u(c) = -2c3 + c2 + 2c + 2. Let i be u(-2). Let w = -6 + i. Let r = w - 9. Is r a multiple of 2? False Let b(r) = r3 - r2 + 4r - 4. Let x be b(3). Let v be (-2)/((-79)/x + 3). Suppose 3z = 2p + v, -p = z + 4z - 65. Does 4 divide z? False Let j(l) = 43l + 1. Suppose t - 15 = -2t + m, 11 = 5t + 3m. Suppose -12 = -2f + to + o, 0 = -2f - 2o - 2. Is j(f) a multiple of 22? True Let w = -37 + 19. Let f = w + 42. Is 8 a factor of f? True Suppose -2r + 2 = 0, -11l + 6905 = -7l + 5r. Is l a multiple of 69? True Suppose -h + 318 = -162. Is 8 a factor of h? True Let s = -87 - -90. Suppose 4j + 79 = 2m - 77, 0 = 3m - sj - 231. Is 16 a factor of m? False Let n = -2 + 7. Suppose 0 = 2r - n - 3. Suppose ra = -0a + 304. Does 19 divide a? True Let v(q) = -q2 + 2q + 332. Let k be v(0). Suppose -4z - k = -8z. Does 11 divide z? False Suppose -20i = -1 + 1. Suppose i = 5m - 193 - 107. Is m a multiple of 15? True Let r(b) = -b*3 - 5b*2 - 6b - 4. Let q be r(-4). Suppose -4a + 196 = -ql, -a + 40 + 19 = -3l. Does 9 divide a? False Suppose -3m + 384 = 276. Does 6 divide m? True Suppose 13v - 1541 = -54v. Is v a multiple of 18? False Suppose 35 = 3p + 2p. Suppose -pv + 5 = u - 3v, 4v = 3u - 47. Suppose 0 = -3n - 7 + u. Is 2 a factor of n? True Let d(s) = s + 9. Let l be d(-5). Let b be 153/(-4) - (-1)/l. Does 8 divide 14402/361 - 4/b? True Let f(n) = n3 + 5n*2 + n - 7. Let c be (-16)/10(-10)/(-4). Is f(c) a multiple of 2? False Suppose -2w + 159 = 2w - 5v, -4w + 156 = -4v. Let l = w - -10. Is l a multiple of 23? True Suppose 5z - 4r + 0r = 281, 16 = -4r. Suppose -49c + zc = 80. Is 3 a factor of c? False Suppose -s = 3z - 1604, 0 = -7s + 5s + 3z + 3181. Is s a multiple of 55? True Let y(i) = 6i3 - i2 + 5i + 3. Let g(x) = -7x*3 + 13x + x*2 - 3 - 23x + 4x. Let h(v) = -4g(v) - 5y(v). Is h(-3) a multiple of 17? False Suppose -3u + 4t + 8327 = 0, 0 = -4u + t + 9851 + 1243. Is 47 a factor of u? True Let k = 18 + -63. Let o = 37 + k. Is o/(-24) + 250/6 a multiple of 7? True Suppose -12d + 61 = 4h - 9d, -3h + 77 = -4d. Is h a multiple of 2? False Suppose -1616 + 176 = -2q. Does 8 divide q? True Let v = -2 - -307. Does 22 divide v? False Suppose 572 = 20p - 6908. Is 11 a factor of p? True Let l(m) = 127m*2 + 100m - 307. Does 27 divide l(3)? False Let b = 697 + -410. Is 4 a factor of b? False Let h = 96 + -96. Suppose h = -v - 3c + 6c + 205, 2v - 417 = -c. Is v a multiple of 13? True Suppose 4m + 2g + 14 = 0, -7 = m + 3g - 6g. Let j = 15 + m. Is 20/2(j - 9) a multiple of 10? True Suppose 5v - 378 = -g, 4v = 9v + 5g - 390. Let j be 1v2/3. Is 13 a factor of (j/(-35))/((-3)/105)? False Is (-24)/(-30) - 24577/(-35) a multiple of 37? True Suppose 5d + 0d + 3p - 1 = 0, -5 = -5d - 5p. Let l = 3 - d. Suppose 2t - lv - 24 = t, -4t = -5v - 74. Is 3 a factor of t? False Suppose -d - 8 = u - 5u, 0 = d + u - 2. Suppose d = 5s - 5i - 165, 5s - 2i + i - 165 = 0. Does 11 divide s? True Let q = -10 + 22. Suppose 5 + 1 = 3t. Does 6 divide q/t(2 - 0)? True Suppose -4y + 91 = -81. Let j = -15 + y. Does 14 divide j? True Let y = -16 - 14. Suppose 47 = f - j, 0 = 5f - 7f + 5j + 82. Let n = y + f. Is n a multiple of 5? False Suppose 3713 = 3w + 5t, 0 = -12w + 9w + 5t + 3763. Does 89 divide w? True Let y be 198/90 - (-1)/(-5). Suppose -19 = -2b - 5s, 2s + 2s - 16 = -yb. Suppose m + 4g - 16 = -bm, 2m + 5g - 13 = 0. Is m even? True Suppose -3c + 285 = -567. Suppose -w = -2u - 70, 4w - 4u = -0w + c. Is w a multiple of 36? True Let y(o) = -o3 - o2 + o + 1. Let r(q) = 2q*3 + 3q*2 - 3q - 40. Let n(g) = -r(g) - 3y(g). Let s = 4 - 4. Is n(s) a multiple of 13? False Let t(w) = w + 15. Let r be t(-8). Let j be ((-6)/(-8))/(r/(-364)). Let g = 92 + j. Is 26 a factor of g? False Let g(z) = 5z*2 - 5z - 1. Let f be g(-4). Suppose f + 85 = b. Suppose -4i + 42 + 28 = 2n, 4n - 3i - b = 0. Is 14 a factor of n? False Let c(q) = q*2 + 20q + 36. Let d be c(-18). Suppose -2w - 10 = d, -s - 2w - 394 = -5s. Is 12 a factor of s? True Let g(u) = -u3 + 16u*2 - 8u + 32. Is 10 a factor of g(10)? False Let g = -139 + 292. Does 3 divide (-1)/72 - g/(-21)? False Suppose -3m + x + 2x = -132, 3x = -m + 36. Suppose -2p = 2z + 52, -z + 41 = -p + 3z. Let y = p + m. Does 3 divide y? False Let f = 1293 - 1127. Is 4 a factor of f? False Suppose 9h = 1697 + 3550. Does 53 divide h? True Let s = 389 + 306. Is s a multiple of 15? False Is 43 a factor of 46/2071629/2? False Let h = 36 + -18. Let n = h + -18. Suppose -5y + 169 - 10 = -l, n = -3y + 3l + 105. Does 8 divide y? False Let d = 581 - 35. Is d a multiple of 14? True Let a(i) = -7i2 + 4i + 5. Let g(q) = 6q2 - 3q - 4. Let y(r) = -5a(r) - 6g(r). Let k be y(-9). Does 4 divide k/405-1? True Let v = 26 + -11. Let l be (-3)/v - (-32)/10. Is ((-24)/(-7))/(l/21) a multiple of 8? True Suppose 0 = 3s - c - 10, s = 5s - 2c - 16. Suppose 3d + 345 = sk, 3k = 2d + 217 + 288. Is 7 a factor of k? False Let v = 20 - -2. Let l = v - 12. Does 22 divide (44/l)/(8/40)? True Let j(b) be the first derivative of 2 - 7b*2 - 1/3b*3 - 6b. Is j(-6) a multiple of 14? True Suppose -2a = -0z + 3z - 12, -8 = -a - 2z. Suppose -h - 3 = -ah. Let p = 16 + h. Is p a multiple of 10? False Is -12 + 9 + 0 - (-1 + -1553) a multiple of 19? False Suppose 114v - 107v - 2709 = 0. Is v a multiple of 5? False Suppose 16a = 19a - 198. Suppose -71m + 350 = -am. Is 14 a factor of m? True Let r = 158 + -23. Suppose -10q + 5q = -r. Does 9 divide q? True Let r be 0 + 9 - (-8 - -5). Let d(a) = -5a + 2a - a + 3a + r. Is d(-4) a multiple of 8? True Suppose 1495 = -61h + 66h. Is 13 a factor of h? True Suppose 4h - 5033 + 2369 = 0. Is h a multiple of 19? False Suppose -5l + 2 = -3l, -3u + 2l = -922. Is u a multiple of 14? True Suppose 6v - 3v - 162 = 0. Suppose 0 = s - 1 - v. Is 9 a factor of s? False Is 13 a factor of 207 - (-6 + 4)2? False Let o(q) = q*3 + 2q*2 - 5q - 6. Let b be o(-3). Suppose -2n + bn = -56. Is n a multiple of 6? False Let a(s) = s*3 - 12s*2 + 20s + 12. Let q be a(10). Let j(k) = k*3 - 12k*2 + 7k - 1. Does 16 divide j(q)? False Suppose 1296 = 12n - 6n. Suppose -176 = -4g - 5c, -4g - c + n = -6c. Is g a multiple of 7? True Let m(i) be the second derivative of i*4/12 - 13i*3/6 - 5i*2 - 12i. Is 5 a factor of m(15)? True Let t(l) = -l*2 + l + 1. Let y(k) = -67k*2 - 2k - 5. Let n(p) = -4t(p) - y(p). Is 35 a factor of n(1)? True Let c(y) = 4y*2 - 8y. Let i be (-20)/114/(-35). Does 15 divide c(i)? False Let i(g) = -181g - 270. Is 8 a factor of i(-6)? True Is 49 a factor of 48/(-6)1 - -839? False Let m(b) = 18b - 6. Let j(i) = -i*2 + 4. Let w be j(-3). Let a(r) = -6r + 2. Let f(q) = wm(q) - 16a(q). Is 7 a factor of f(5)? True Let d(q) = 11q2 + 17q + 18. Let c(h) = -h*3 + 22h*2 + 35h + 37. Let y(v) = 2c(v) - 5d(v). Is y(-6) a multiple of 10? True Let c(v) = 14v2 + 10v - 16. Does 40 divide c(8)? True Let l(o) = -o*3 + 8o*2 + 11o - 1. Suppose -44 = 5a - 7a. Suppose -v + 5z + 8 = 4z, -4*z	{ "pile_set_name": "DM Mathematics" }
16, what is -63d + -5? -642 In base 3, what is -210 + 2101110? 2100200 In base 4, what is 21012 + -11? 21001 In base 12, what is -1219 - 10? -1229 In base 9, what is 13 - -15? 28 In base 3, what is -101000112 + 0? -101000112 In base 5, what is -1 - -1002? 1001 In base 15, what is 9 - 3ba? -3b1 In base 4, what is 312 - 2211? -1233 In base 3, what is 2 - 10220? -10211 In base 7, what is 255 - 5? 250 In base 8, what is 3 - -674? 677 In base 8, what is 5 + 4? 11 In base 11, what is 4 - -690? 694 In base 2, what is 0 + 100110001100? 100110001100 In base 15, what is -2 - 14? -16 In base 6, what is -2 - 42? -44 In base 4, what is -32110 + 1? -32103 In base 16, what is -1197 + 0? -1197 In base 4, what is 223 + -10? 213 In base 9, what is 4 - -3814? 3818 In base 13, what is -a - 2? -c In base 9, what is 2 + -11184? -11182 In base 7, what is 13121 + 1? 13122 In base 5, what is -111 - 40? -201 In base 13, what is 321 + -4? 31a In base 16, what is 4 + 50? 54 In base 5, what is 20424 - 0? 20424 In base 5, what is 30 + 4? 34 In base 10, what is 2 + 177? 179 In base 11, what is -1 - -493? 492 In base 4, what is 3 + 202? 211 In base 13, what is 4 + 32? 36 In base 9, what is -250 + 7? -242 In base 8, what is -246 + 2? -244 In base 9, what is 2 - 61? -58 In base 2, what is -1001 - 10011? -11100 In base 16, what is -133 - -8? -12b In base 8, what is -1 + -1423? -1424 In base 3, what is 10 - -1000? 1010 In base 9, what is 27 + 554? 582 In base 15, what is cd + 14? e2 In base 4, what is 10 - 330322? -330312 In base 2, what is -111100 - -10010? -101010 In base 5, what is -141 + 11? -130 In base 10, what is -1 - 285? -286 In base 14, what is 265c + -5? 2657 In base 11, what is -548 + -1? -549 In base 7, what is 4 + 2355? 2362 In base 6, what is 33202 + -3? 33155 In base 5, what is 1 + 1044? 1100 In base 13, what is 2 - -414? 416 In base 5, what is -221 + -1411? -2132 In base 10, what is -366 - 2? -368 In base 3, what is -1000220 - 120? -1001110 In base 13, what is 25 + 8? 30 In base 3, what is -120200 - -11? -120112 In base 3, what is 2 - -100112? 100121 In base 7, what is 40 + 2062? 2132 In base 13, what is -33b - 4? -342 In base 2, what is 0 + 11101001? 11101001 In base 16, what is 5 + fa6? fab In base 6, what is 222 - -335? 1001 In base 8, what is -3114 + -1? -3115 In base 13, what is 113 + -29? b7 In base 12, what is 3 + 1a9? 1b0 In base 3, what is -20 - 121? -211 In base 2, what is 101 + 1101101? 1110010 In base 6, what is -3 + 1315? 1312 In base 7, what is 5 + 31? 36 In base 16, what is -38b + 5? -386 In base 12, what is -2 - -89? 87 In base 9, what is 3 - 185? -182 In base 7, what is 265 + -2? 263 In base 6, what is -1153 + -21? -1214 In base 4, what is 1 - -3? 10 In base 13, what is 4 - 14b? -147 In base 3, what is -1102210 - 11? -1102221 In base 6, what is 134 - 0? 134 In base 16, what is 64 - -28? 8c In base 10, what is 4 - -46? 50 In base 8, what is -4 - -4363? 4357 In base 8, what is -2 + 16? 14 In base 12, what is -8 + 10? 4 In base 13, what is -3 + -2b? -31 In base 10, what is -1 + 2190? 2189 In base 9, what is 3666 - -5? 3672 In base 16, what is 30 + -5? 2b In base 13, what is -b9 + 40? -79 In base 5, what is -114 - -20? -44 In base 5, what is 3411 + 4? 3420 In base 2, what is 1111111 + -111? 1111000 In base 5, what is 10 - 2221? -2211 In base 16, what is 0 - ae? -ae In base 5, what is 31201 + -4? 31142 In base 16, what is 5b + -2? 59 In base 3, what is 2212122 + 10? 2212202 In base 8, what is -1 - 276? -277 In base 8, what is -214 - -4? -210 In base 14, what is 5 + -27d? -278 In base 5, what is 1 - -1123? 1124 In base 7, what is 15 - -1652? 2000 In base 10, what is -29 - -3? -26 In base 12, what is 5 - -405? 40a In base 8, what is 4 - -43? 47 In base 7, what is 40 - 224? -154 In base 12, what is -3a + 20a? 190 In base 10, what is 225 + -4? 221 In base 6, what is 5 + -1041? -1032 In base 11, what is -26 - -a9? 83 In base 8, what is -175 + 3? -172 In base 6, what is -114 + 3? -111 In base 15, what is 5 + -d? -8 In base 8, what is -530 + -40? -570 In base 8, what is 5 - 1163? -1156 In base 4, what is 32 + 3022? 3120 In base 8, what is -144 + 14? -130 In base 4, what is 3 - 202320? -202311 In base 13, what is 1 + 18? 19 In base 11, what is -23 - 4? -27 In base 16, what is 30 + -2? 2e In base 5, what is -2141 - 12? -2203 In base 4, what is -2 - -230? 222 In base 8, what is 5 - 525? -520 In base 13, what is 6571 - 3? 656b In base 14, what is 8d0 - 0? 8d0 In base 3, what is -21 - -121? 100 In base 7, what is -24066 + 4? -24062 In base 15, what is -1d2 + -c? -1de In base 2, what is -101000001001 - 100? -101000001101 In base 11, what is 1 - -39a? 3a0 In base 6, what is -42544 + 5? -42535 In base 5, what is 10 - -202? 212 In base 9, what is 48 - 4? 44 In base 6, what is 55401 - 4? 55353 In base 4, what is -33023 - -10? -33013 In base 16, what is -4 + b68? b64 In base 13, what is -7 - -4? -3 In base 11, what is 63 - -5? 68 In base 14, what is -6 + 907? 901 In base 5, what is -10 + 14? 4 In base 14, what is -68ab + 4? -68a7 In base 2, what is 1001 + -100011010? -100010001 In base 13, what is -28 - -95? 6a In base 3, what is -212102 - 0? -212102 In base 4, what is -12221 + 22? -12133 In base 6, what is 43 - -5? 52 In base 5, what is 3 - 2401? -2343 In base 2, what is 10 + 100100? 100110 In base 13, what is 44 - -3? 47 In base 15, what is -e8 - 1? -e9 In base 14, what is 114 + 0? 114 In base 6, what is 11051 + 1? 11052 In base 15, what is 3 - 1e5? -1e2 In base 9, what is -3144 + 5? -3138 In base 10, what is -52 - 3? -55 In base 8, what is 32 - 25? 5 In base 15, what is -17b + -4? -180 In base 14, what is d - -1a? 29 In base 12, what is -6 + -30? -36 In base 7, what is -3 + -146? -152 In base 14, what is 5 + 1cb? 1d2 In base 12, what is -296 - -4? -292 In base 2, what is 1011011 + -1001? 1010010 In base 11, what is 5 + 9? 13 In base 3, what is 1021 - -200? 1221 In base 10, what is -926 - 13? -939 In base 4, what is 220 + -202? 12 In base 16, what is -8 + 2b? 23 In base 3, what is 10 - 21022? -21012 In base 15, what is 74a - 6? 744 In base 11, what is 3a - -258? 297 In base 15, what is -15 - -61? 4b In base 12, what is 41 - -5? 46 In base 9, what is -2705 - 1? -2706 In base 12, what is 6 - 7a? -74 In base 14, what is -2 - -10? c In base 8, what is 152 + 4? 156 In base 10, what is -245 - 2? -247 In base 10, what is -13757 - 1? -13758 In base 16, what is 5 + -180? -17b In base 2, what is 10100010 + -101? 10011101 In base 14, what is -46 - 301? -347 In base 5, what is 1 + 3? 4 In base 4, what is 11 + -1202? -1131 In base 15, what is -b + 46? 3a In base 7, what is -2225 - 6? -2234 In base 10, what is 25 - -7? 32 In base 8, what is 3 + 12? 15 In base 16, what is -1 + -54? -55 In base 11, what is -133 + -48? -180 In base 6, what is -1315 + 3? -1312 In base 5, what is 41 - -4? 100 In base 6, what is -10010 + 5? -10001 In base 6, what is -4 + 4? 0 In base 13, what is 5 + 1b0? 1b5 In base 15, what is -3ad - 4? -3b2 In base 8, what is -26 - 11? -37 In base 11, what is -5 - 182? -187 In base 16, what is 0 - -3e? 3e In base 6, what is 3201 + -5? 3152 In base 10, what is 362 - -15? 377 In base 6, what is -1244 + 20? -1224 In base 15, what is -a - 5? -10 In base 11, what is -2 - -1040? 1039 In base 11, what is -2 - 57? -59 In base 7, what is -24 + -22? -46 In base 16, what is -2 + 3? 1 In base 10, what is 3 - 60? -57 In base 7, what is 0 - -104? 104 In base 16, what is b6 - 3f? 77 In base 8, what is 127 - 0? 127 In base 11, what is 48 - -7? 54 In base 16, what is 1264 + 4? 1268 In base 2, what is 1111 - -10010? 100001 In base 15, what is 4 - -18? 1c In base 6, what is 3 - 1225? -1222 In base 9, what is 6 + 52? 58 In base 6, what is 113 - -3? 120 In base 4, what is -3 + -123? -132 In base 6, what is 11025 - 3? 11022 In base 8, what is 3 - -5534? 5537 In base 2, what is -10001 - 0? -10001 In base 3, what is 12 - -120? 202 In base 13, what is -b21 + 7? -b17 In base 2, what is -101010110110001 + 1? -101010110110000 In base 11, what is 3 + 148? 150 In base 7, what is -1 + 313? 312 In base 7, what is 344 - -11? 355 In base 5, what is -13212 - -2? -13210 In base 11, what is 7 - 5? 2 In base 5, what is 13241 + -22? 13214 In base 16, what is -4a3 + -a? -4ad In base 10, what is -2 + 1	{ "pile_set_name": "DM Mathematics" }
-2 Express 12168l3 - 24281l*3 + 12165l*3 + 20l*2 as jl*3 + xl*2 + m + ol and give x. 20 Rearrange -1676b2 - 4048b*2 - 3252b*2 - 154b*2 + 2334b*2 to r + kb + wb2 and give w. -6796 Rearrange -4f - 28 - 21 - 22 + f + 1 - 1 - f - 3f + 3f + (4 - 2 + 0)(1 - 1 - 2f) + 0f + 3f - 2f + 17f - 4f + 0f to the form qf + s and give s. -71 Rearrange -7p*2 - 44p*2 - 16p + 5p2 - 3 - 12p*2 - 3p*2 to up + k + wp2 and give w. -61 Express (l + 2l - 2l)(1445 + 5520 - 1136) + (-5 + 3 + 4)(2l - 5l + 4l) as jl + y and give j. 5831 Express (-107 - 182 - 76)(-7 + 0 + 4)(1 + 2g - 1)(-3 + 6 - 4) as qg + x and give q. -2190 Express (5730808b2 - 5730808b*2 + 25072b*3)(2b + 2 - 2) in the form tb*3 + cb*4 + ub + y + pb2 and give c. 50144 Express (3 - 3 + 2)(j + 2 - 2 + (j - 1 + 1)(0 + 3 - 2) - 588j + 1051j + 1109j) in the form c + oj and give o. 3148 Express -11s*2 + 2s*2 + 0s*2 + (-2 + 2 + 2s)(-3s + 3s - s) - 16s*2 + 33s*2 - 28s*2 as ls + v + as2 and give a. -22 Express (0 - 6 + 3)(-18495s4 - 28982s*4 + 21695s*4 + 2s) - 2s4 + 4s*4 - 3s*4 in the form zs + os2 + c + as*4 + ms*3 and give z. -6 Express (3b*2 + 2b - 2b)(-68b + 126b - 73b) + 1 - b3 - 1 + 2b*2 as db*2 + gb*3 + zb + m and give d. 2 Express y*3 - 281y + 102y - 6y*4 + 94y + 1 + 87y in the form v + hy*2 + ty + wy4 + ay*3 and give t. 2 Express -1 - 1223739o*4 + 1229o + 2o2 + 1223741o*4 + 329o in the form bo3 + fo*2 + uo*4 + h + lo and give h. -1 Express -6410y + 10728y + 10143y + 5872y as d + fy and give f. 20333 Rearrange -27 + 32879h - 8113h + 27 to j + vh and give v. 24766 Rearrange -3n3 + 3n3 - n3 + (-31n2 - 39n + 39n)(1 + n - 1) + 174 + 3n2 - 174 - 15n*3 to yn*2 + g + cn*3 + kn and give y. 3 Express (-3 - 5 + 2)(-3k - k + 5k)(-106k2 + 1475k - 1475k) as xk*2 + mk + dk3 + p and give d. 636 Rearrange 1017773w*2 - 2 + 4w*3 + 2w*3 + 326w*4 - 3w*3 - 1017771w*2 - w to qw + zw4 + ow*3 + kw*2 + g and give z. 326 Rearrange 5460p*2 - 188p + 4 - 9833p2 + 188p to the form qp + k + sp*2 and give s. -4373 Express (2 - 1 - 2)(-14a + 14a + 5a2)(-3498 - 3493 + 6996)(a + 4a - 4a) in the form pa*3 + ua + ba2 + j and give p. -25 Rearrange 95r + 5r2 - 8r*2 - 2r*3 - 493r - 3220r4 + 3 + 3221r*4 to the form mr*4 + i + fr*2 + or + zr3 and give o. -398 Express (-15620 + 31193 - 15673 + 39p)(0 - 4 + 3) - p - 3 + 3 + (-5 + 3 + 0)(-p + p - p) + (3 + 0 - 4)(-2p + p + 4p) as w + fp and give w. 100 Express -63r + 7 - 9r*2 - 13 + 19 - 10r*2 - 15 as jr + pr2 + g and give p. -19 Rearrange 20l*2 + 1 - 5l*4 - 4l*3 + 22l*2 + 2l*2 + 7l*4 + 0l*4 to bl*3 + ql*4 + v + zl*2 + gl and give v. 1 Express 0q + q + 0q + 10 - 2q - 10 + (7q - 5q + 2q)(-4 + 2 + 4) - 5q - 2q + 5q - 54q - 236 + 236 as j + sq and give s. -49 Rearrange 3640l - 8421l - 8278l - 525l - 8814l to the form il + a and give i. -22398 Express (-22 - 36 - 29)(-1116h*4 + 358h*4 + 542h*4) - 2h*4 + 3h*4 + 2h*4 in the form vh*2 + zh + nh4 + jh*3 + o and give n. 18795 Express (71 - 231 - 162 + 66)(2c + 0c + c + c + 3c + 0c - 2 + 2 + c + (3 - 1 - 1)(2 - 2 + 2c) - 3c - c + 3c) as l + rc and give r. -2304 Express 41 - 46 + 38 + 5b - 14b in the form d + fb and give f. -9 Rearrange -b - 3b + 5b + (-406 + 63 + 151)(-46 + 49 + 33)(3b - 2b + 0b) to l + rb and give r. -6911 Rearrange 19626 + 21x - 24x + 6740 - 24x + 28x - 2x + 4x + 0x + (1 - 1 - 2)(x + 4x - 3x) to v + zx and give z. -1 Express (0 + 3 - 1)(-428225w4 + 834148w*4 - 420360w*4) in the form dw + hw4 + jw*2 + aw*3 + r and give h. -28874 Express (-4p - 9p + 0p)(-156 - 39 + 60) + 3p + 2p - 2p as m + xp and give x. 1758 Express 82q*2 + 2q - 30q2 - 51 + 50 - 3q*3 as rq*3 + yq*2 + u + kq and give u. -1 Express -316i - 9i3 - i2 + 2i2 - 315i + 648i + 2 as bi*2 + zi + yi3 + u and give b. 1 Rearrange 5c - 2137c2 + 4215c*2 - 2165c*2 to l + oc + zc2 and give o. 5 Express (2 - 2 + 2t)(4t - 3t - 2t) + 1 - t2 - 1 + (1 - 1 + t2)(0 + 0 + 2) - 57347t - 360t2 + 57347t as c + rt + ot*2 and give o. -361 Rearrange -31 + 2v*3 - 2v + 7 + 20 + 4 - 2556v4 to the form l + qv + av4 + sv*3 + mv*2 and give a. -2556 Express (-3t + 0 + 0 + (6 - 3 - 1)(-252 - 20t + 252))(5 + 5 + 4) as pt + k and give p. -602 Rearrange -31a + a + 8a - 17 - 8 + 7 to the form ca + t and give c. -22 Express (16 + 2z - 16)(8 + 1 - 5 + (-3 + 0 + 4)(-2 + 0 + 1))(0 + 1 - 3) in the form h + uz and give u. -12 Express (-52 + 807543a2 - 807543a*2 - 174a*3 - a)(-4a + 5a - 3a) as sa*2 + z + va*3 + ia + ta4 and give s. 2 Rearrange (1 + 2 - 4)(12u + 34u - 19u)(5u - 6u + 8u) to the form qu*2 + lu + o and give q. -189 Express i*2 + 5524i - 250i - 4 - 5 + 9 in the form ui*2 + m + oi and give o. 5274 Express 2n + 605 + n + 760 - n - 397 in the form f + kn and give k. 2 Express -277s + 541s + 63 - 951s - 47 in the form ms + l and give m. -687 Express (35 - 3 - 13)(-13d - 2d + 6d) + 7d - 17 + 17 in the form ad + z and give a. -164 Express -130p - 774p - 1416p as cp + s and give c. -2320 Express -63i + 1 + 262i*2 - 65i + 5i3 + 194i - 66i as q + ui*3 + li*2 + mi and give u. 5 Rearrange -140n4 - 2n - 140n2 + 139n*2 - 7n*4 + 3 to the form fn*2 + sn*3 + wn + p + vn4 and give v. -147 Express (4 - 2 + 0)(151b2 + 820b*2 + 2770b*2) in the form xb*2 + rb + a and give x. 7482 Rearrange (3 - 3 - 2a2)(3a + a - 3a)(-102a - 1005 + 502 + 504) to the form sa2 + za*4 + ka*3 + ga + h and give z. 204 Rearrange (-5 - q + 5)(-158 + 1 - 97)(3q - 2q - 6q)(-3 + 2 + 3) to lq2 + fq + z and give l. -2540 Rearrange -305i2 + 241i*2 + 3 - 284i + 325i to b + mi + ui2 and give m. 41 Rearrange w2 - 15238w3 + w4 - 31 - 2w + 15236w*3 + 0w*4 to dw*2 + jw + rw3 + m + lw*4 and give l. 1 Express -6280i + i*3 - 4i*2 + 3i*3 + 8 + 3140i + 3141i in the form mi*3 + gi + j + di2 and give j. 8 Rearrange (-2u + 4u - u)(99303u2 - 99303u*2 - 589u*3) - 86u*2 - 46u*4 + 86u*2 to the form k + lu*4 + mu*3 + ju*2 + gu and give l. -635 Express 4j3 - j2 - 133 - 6j3 - j4 - 137 - 131 + 409 as k + sj2 + mj + wj3 + nj*4 and give k. 8 Express 11b*4 + 1015b*2 + 15 + 4b - 14b3 - 1018b*2 + 14b*3 - 8b*4 as ab*3 + mb*2 + vb*4 + p + ib and give v. 3 Express -1 + 1728t2 + 4980t + 4943t - 9922t as yt2 + j + ot and give j. -1 Express 17091t - 3026t + 1638t + 6491t in the form v + it and give i. 22194 Rearrange 2b - b + 5b - 1 - 2b + 1 + (-1 + 1 - b)(-3 - 1 - 1) + 3 - 3 - 2b + b + 8b - 4b to the form ub + i and give u. 12 Express 188j*2 - 16j*3 + 1167 - 1256 - 187j*2 as hj + xj3 + cj*2 + l and give x. -16 Express -728t - 723t - 737t + 2187t - 1975t*3 in the form ht*2 + wt + g + ut3 and give w. -1 Express 1059 - 540 + 10210h - 519 in the form fh + d and give f. 10210 Express -14212p*4 + 28410p*4 + 143p*3 - 2p*2 - 14199p*4 in the form op*3 + rp + wp4 + s + cp*2 and give c. -2 Express 19p*4 + 8 - 15p*4 + 48 + 3p - 11 - 2p3 in the form fp + w + zp4 + cp*3 + rp*2 and give f. 3 Express -10591s - 6780s + 5897s - 11615s - 8690s in the form ms + u and give m. -31779 Express 52u - 15864 + 15975 - 110u + 4u*3 + 54u as p + zu + ku*2 + su*3 and give s. 4 Express (3j - 4j - j)(-10417 - 2742 - 9239 + 10351 - 12749) as aj + w and give a. 49592 Express 3f - 3f + 3f + 2f + 3 - 3 + (0f + f - 3f)(-3 + 1 + 0) + 2f + 0f + 0f + (-880 + 343 - 8)(0 + 0 - 3f) as bf + d and give b. 1646 Express -10t + 9t + 2t + 295t*3 - 884t*2 + 886t*2 in the form z + kt*3 + ot + ct2 and give z. 0 Express (-2637g + 5262g - 3871 - 3285 - 2624g)(-g + 2g*2 + g) in the form t + fg*2 + dg + cg3 and give f. -14312 Rearrange (-12360q - 16839q - 13602q + 13817	{ "pile_set_name": "DM Mathematics" }
Suppose s = j - z. Solve 2q + j = -2q for q. -4 Let z(d) = -36d3 + d - 8 + 4d*2 + 18d*3 - 5d + 19d3. Let h be z(-4). Solve 3i + h = -4 for i. -4 Let p be (-6 - -7)-3 + (-2 - -17). Suppose b - 27 = -p. Solve 5 = 4h - b for h. 5 Let t = -6 + 1. Let u(d) = -7d - 35. Let s be u(t). Solve s = -o + 7o for o. 0 Suppose 136g - 62 + 2 = 131g. Solve gi + 215 = 323 for i. 9 Suppose 0 = -3c + 15, -w - 3w + c + 11 = 0. Let y(r) = 19r - 54. Let g be y(w). Solve -18d = -gd + 8 for d. 2 Suppose -4w + 3v + 628 = 0, 6v - 442 = -3w + v. Solve -21u = u - w for u. 7 Let y(t) = -5t*3 - 3t*2 + 2t - 19. Let c(m) = 2m3 + 2m*2 + 9. Let s(u) = 9c(u) + 4y(u). Let p be s(4). Solve 11z + 12 = pz for z. -2 Let b(r) = 5r*2 - 96r + 197. Let n be b(17). Solve 43i = -ni - 424 for i. -8 Let h(t) = -8t - 8 + 2t*3 - 7t*2 + 0t*3 - 7t*3 + 2t*3 + 2t*3. Let l be h(-6). Solve -10d - 30 = -ld for d. -5 Let j = -749 + 759. Suppose 3x = 4b + 18 - j, -5x - 4b - 8 = 0. Solve x = -0c - 2c for c. 0 Let q be 20/25(-862)/(-8) - 2/10. Solve -79 = -7f - q for f. -1 Let w be (12/15)/(52/50). Suppose -40 = 2c - 5x - 57, wx - 26 = -5c. Solve cf + 30 - 42 = 0 for f. 2 Suppose 0 = 297n - 294n - 6. Suppose -nv - 2g = -4, 5g = 13v - 16v. Solve -5c - v = -15 for c. 2 Let h(q) = 74q - 1554. Let m be h(21). Solve -s + 18 - 14 = m for s. 4 Suppose -5 = -g - 142. Let q = g + 139. Solve -q = 2c - c for c. -2 Suppose 0 = 7a - 5a. Suppose x + 2x = 3p - 33, a = p + 3x - 7. Let w(y) = -y*2 + 8y - 9. Let t be w(2). Solve p = q - tq for q. -5 Suppose 0 = -3o + 4p + 44, -5o + 4p + p + 85 = 0. Solve -oq + 46q = 24q for q. 0 Let t = 5406 + -5371. Solve 0 = -ty + 231 - 21 for y. 6 Let f be (-10829)/(-182) - (-6)/4. Solve fc - 63c = 8 for c. -4 Let p(o) = -4o3 + o2 + o. Suppose 2g = 2 - 4. Let d be p(g). Let b(l) = -l3 + 15l*2 + 2l - 14. Let c be b(15). Solve 0m + dm = c for m. 4 Let i(q) = 59q + 17q*2 - 19q*2 + 7q*2 - 12. Let z be i(-12). Solve z = 5k - 12 - 8 for k. 4 Let b(j) = -10j3 + 20j*2 + 9j - 10. Let y be b(-1). Solve -yi + 78 = -24i for i. -6 Let z(u) = -4u - 12. Let g be (-36)/14(-84)/(-18). Let k = -20 - g. Let i be z(k). Solve w + 3w + i = 0 for w. -5 Suppose -o + 35 = 11n - 7n, 0 = n + 3o - 6. Let w = -3 + n. Suppose 5r - w = -1. Solve -l = -4 + r for l. 3 Suppose -4p - 27 = -11. Let c be (-568)/(-16) + 2/p. Suppose c = -4u + 55. Solve h = -0h - u for h. -5 Suppose r + 169 = 2h, 5h + 27r - 436 = 25r. Solve -5d - h = -116 for d. 6 Let x = 26 - 18. Suppose 0 = 6o + 8 - x. Suppose 3 + 11 = 4i - z, o = -2z - 4. Solve 4r - 5 = ir for r. 5 Let g = -40776 - -41236. Solve 50x + 42x + g = 0 for x. -5 Let c(t) = -5t - 4t*2 + 3t*2 + 1 + 8t2 + t3. Let u be c(-6). Let k = 71 - u. Solve -z = 3 - k for z. 1 Let i(r) = -16r3 + 3r*2 + 8r + 6. Let f be i(-1). Suppose 4z + 5k + 25 = 0, -3z - 13k + fk + 20 = 0. Solve z = 19d - 13d - 30 for d. 5 Suppose 2f - 20 = 3r - 0r, 0 = 3r + 4f - 4. Suppose 0 = -3g - 3b + 93, 16 = 5g - 2b - 132. Let i be (r/(-10))/(1/g). Solve i = 4m - 0m for m. 3 Let q(u) = 48u2 + 2u + 1. Let k be q(-1). Let d = 56 - k. Solve d = 2s - 1 for s. 5 Let i(y) be the third derivative of -y4/8 - 17y*3/6 - 3y*2. Let p be i(-5). Let z be (p/3)/(5/(-30)). Solve n = -zn for n. 0 Suppose 13 = 5i - 2. Suppose 253g + 54 = 254g. Suppose 55s - 6 = gs - 5r, -2s + 3r = -12. Solve -ic - s = -0c for c. -2 Suppose -5i + 2t = -198, 1693i - 102 = 1690i + 4t. Solve 20r - 27r + i = 0 for r. 6 Suppose -8d = 29d - 851. Suppose 0 = -3y + 5m + d, -52 = -2y - 3m - m. Solve 25 = -11r + yr for r. 5 Let x(i) = i3 + 16i*2 - 17i + 6. Suppose 25 - 110 = 5m. Let r be x(m). Solve 2f + r - 10 = 0 for f. 2 Let w(o) = o*2 + 23o + 117. Let p be w(-16). Solve -pj - 221 = -241 for j. 4 Let g = -4599 - -4642. Solve 0 = -20v - 3 + g for v. 2 Suppose 0 = 5f - 5p, -2f + 21 + 33 = 4p. Let b be ((-6)/(-7))/((-2)/(-14)). Solve bn - 27 = -f for n. 3 Suppose 19m - 8m = 29m - 432. Solve 7p = -m + 66 for p. 6 Let n be ((-30)/6 - -1)-1. Suppose -3j + 12 = -ns, 0s + 3j = 5s + 12. Suppose s = h - 3p + 7p + 2, -3h = 2p - 14. Solve -4c = -6c - h for c. -3 Let a be 1426/31 - (8 + -1). Solve aj + 10 = 10 for j. 0 Let p be (-175)/112-10 + (-18)/(-48). Solve 61 = pv + 29 for v. 2 Suppose -51q + 1072 + 509 = 0. Solve q = -8o + 47 for o. 2 Suppose 5x + 4y + 194 + 250 = 0, 16 = 4y. Let r = 126 + x. Let k = -33 + r. Solve 0 = -c - 0 - k for c. -1 Let u be 3/((-6)/(-146)) + -4(-7)/28. Solve -14k + u = -51k for k. -2 Suppose -9h + 4h - 29 = -4s, 0 = 5h - 2s + 37. Let m(b) = b3 + 9b*2 - 13. Let c be m(h). Let d be c/(-6) + (-12)/72. Solve 4 = -dt + 6t for t. 1 Let u(n) = 3n*2 + 153n + 1050. Let o be u(-8). Solve -423 = -op - 405 for p. 1 Suppose -12500o + 12489o + 143 = 0. Let n be (-1 + 4)2 + 0. Solve -5 = -nb + o for b. 3 Let r(d) = -89d - 797. Let b be r(-9). Solve -5y + 6 = -b for y. 2 Suppose 176i - 84 = -3n + 175i, -4i = -12. Solve 0 = -42u + nu + 45 for u. 3 Let k be 18/4 + -4 + 2/(-4). Suppose -5x - x + 18 = k. Suppose -xc + 41 = -7. Solve 5d - 9d + c = 0 for d. 4 Let n(y) = y2 + 15y - 182. Let a be n(8). Suppose f - 23 = 5h, 2h = af - 0h - 14. Solve fb + 4 = 2b for b. -4 Suppose -21b - 5b = 52b - 5148. Solve 2p = b - 64 for p. 1 Let b(w) = -16w - 10. Let f(r) = 11r + 7. Let i(m) = -5b(m) - 8f(m). Let c be i(-2). Let a be 13/2 - (-15)/c. Solve -5y - a = -y for y. -2 Let l = -745 - -739. Let r be (-1 - 7) + (l - -46). Solve -44 + r = -6c for c. 2 Let l(w) = 216w + 7002. Let o be l(-32). Solve -56 = -76h + oh for h. -4 Let v = 26558 + -26558. Solve 0 = -6s - vs + 6 for s. 1 Suppose -5i = -2i. Suppose i = 7b - 3b. Suppose 3p - 19 - 5 = b. Solve 3w = -p + 20 for w. 4 Let d(b) = -b2 - 13b + 54. Let h be d(0). Solve -h = -27m + 81 for m. 5 Let g be (4/6)/(1/(-3)). Let s be (3 + (g - 1))1. Suppose 5h + 0 - 20 = s. Solve 3v - hv + 3 = 0 for v. 3 Let l(a) = -2a*3 + 15a*2 + 32a + 28. Let w(v) = v*3 + 2. Let b(j) = -l(j) - w(j). Let z be b(17). Solve 0 = 5h - 6 - z for h. 2 Let c be 28/(-49) - (-1548)/14. Let y = c - 97. Solve 2x - 17 = -y for x. 2 Suppose 20 = 2s - 4g, -5g = -4s + 54 - 23. Suppose -8 + 68 = 10a. Let x be (s + 56)/5 - a/2. Solve 4w = 7w - x for w. 3 Let y(g) be the first derivative of g3 + g2/2 + 61. Let z be y(-2). Solve 6i + z = 8i for i. 5 Suppose 13i = 10i. Suppose 0 = -5f - 4l, 5f + if = -l + 15. Suppose -fc = 2u - 34, 2u + 3c - 57 = -3u. Solve -3g = -u - 0 for g. 3 Let n be 80 - (18 - (18 - 7)). Solve 84q = nq - 22 for q. -2 Suppose -1 = 12b - 13b + 2w, -5b + 2w = -13. Let a(z) = z3 - 3z*2 - 5z + 16. Let r be a(b). Solve 4 = 3j + r for j. 1 Let d be ((-14)/(9 + 5))/(121/(-60) + 2). Solve -49k = d - 403 for k. 7 Suppose -3q + 6q = b - 209, 217 = -3q + 5b. Let w = q + 75. Solve w = 3o - 9o for o. -1 Suppose 122q = 30q - 14q - 161q. Solve -15t - 1974 + 2004 = q for t. 2 Let u(o) = 3o + 37. Let y be u(-20). Let x = y - -43. Solve 0 = -6s - 10 - x for s. -5 Let l = 1562 - 1522. Solve -l = 15n - 25n for n. 4 Suppose 0 = 6y - 4y + 2, 0 = 5c + 2y + 947. Let k = -185 - c. Solve 0 = -kq - 13 + 1 for q. -3 Suppose -h - 97 = -4m + 163, 0 = m - 2h - 58. Let l be (-1 - -3)/(44/m). Suppose -3v - lv = 0. Solve 4x - 2x - 2 = v for x. 1 Let f(k) = -3k2 - 17k + 30. Suppose 6c - 3c + 6 = 0. Let b(w) = -w*2 - 8w + 15. Let r(a) = cf(a) + 5b(a). Let n be r(6). Solve -n = -d - 4d for d. 3 Suppose 326l = 348l - 1188. Solve 57f - lf + 9 = 0 for f. -3 Let h be (8/12)/(2/3). Suppose 2t = -15t - 17. Let l = t + h. Solve lk - 3k - 6 = 0 for k. -2 Let r(b) = -2b*2 - 90b - 586. Let k be r(-8). Solve -2j + kj = 4 for j. 1 Suppose 4p + 32 = 4l, -4p + 19 = 5l - 2p. Let g = -11083 - -11107. Solve 0 = -ls + 4 - g for s. -4 Let x = 21199 + -21188. Solve -x = 2d - 1 for d. -5 Let m = 4925 + -4873. Solve -60 = -40r + mr for r. -5 Let o(u) = u3 - 6u*2 - 6u - 73. Let x be (-112)/12(-102)/119. Let v be o(x). Solve 7t + 14 = -v for t. -3 Let n b	{ "pile_set_name": "DM Mathematics" }
(-1368)? 27 10/(-45)(-1 - 7)/(-16) -1/9 (-7526)/(-1590) - 4/(-15) 5 What is the value of ((-10)/9)/(4725/(-102060))? 24 What is the value of (-48)/(-15) - 66/330? 3 Calculate (-2)/5(-29 + 0 + 19). 4 (20/(-14))/((-360)/630) 5/2 What is the value of ((-20)/(-50) + 42/20)(-32 + 30)? -5 What is the value of ((-3)/(-20))/((-264)/(-40) + -7)? -3/8 124/8 + (-6)/(-12) 16 Evaluate (-12)/(-8) - 4/7 - 1. -1/14 What is the value of ((-52)/(-286) + 9/11)/(7/7)? 1 Calculate 1 + -9 + 11 + (3/(-1) - -2). 2 What is the value of (-329)/23516/(-56)? 2/5 What is ((-1)/(-6))/((-8)/40)4? -10/3 Calculate (-12)/(-34) + 902/1394. 1 5/35 + (-171)/1491 2/71 What is the value of 1200/(-54) - -13 - -9? -2/9 What is the value of ((4/10)/((-6)/(-20)))/((-224)/2352)? -14 Evaluate 1792/30576 + 4/(-26). -2/21 861/492 - 22/8 -1 What is (((-279)/105)/3 + 136/476)-5? 3 712/28 + (6 - (-7 + -12)) 28 What is the value of ((-8844)/33902)/(21/(-46))? 4/7 (-3 - (3 + -2) - -2)/((-216)/(-1836)) -17 Evaluate (-30)/4 + -4 + (-35)/(-14). -9 What is the value of 21/(4 - 7) + (-288)/(-40)? 1/5 What is 9/12(3975/315 - 13)? -2/7 222/(-21) + 354/413 + 10 2/7 Calculate (-1 + -2)/((-20)/(-7 - -3)). -3/5 What is -8 + 2/(-4)12 + 0 + -11? -25 Evaluate (1/(6/(-8)))/(88/(-576)). 12 (-5568)/(-4176)1/(-4) -1/3 117/(-9) - 65/(-13) -8 (-28)/(-126)-3 + -1 + (-278)/(-174) -2/29 Evaluate (1/(-9) + 260/72)5/10. 7/4 What is the value of (-96)/(-324)18(-4 - 25/(-10))? -8 Evaluate (-100)/(-60)(7/5 + -1)-6. -4 Evaluate ((1 - 2) + 3)/(-91 - -90). -2 20/4 + (-226)/50 + (-14)/35 2/25 (1 + 3/(-4) + 2)/((-13)/52) -9 ((-2)/132)/((-43)/(-172)) -2/33 (-20 + 10)/((-28)/12 + 3) -15 Evaluate ((-22)/(-385) - (-1915)/175)/1. 11 (-20)/3(-582)/485 8 (-188)/(-95) + (-92)/(-4370) 2 Evaluate (-72)/180 - (-15)/100 - 3/(-6). 1/4 What is the value of 3102/(-1683) - 9/(-51)? -5/3 Evaluate ((-13464)/39)/(-44) + 5/((-15)/24). -2/13 (-72922)/6137 + -2 + 32/17 -12 4 + 75 - 94 - 281/(-19) -4/19 Evaluate 8/(-192) - 42/(-144). 1/4 ((-3302)/(-381))/((-4)/(-6)) 13 What is the value of 3/(-4)((-110)/(-6))/(-5)-4? -11 What is 6 + 2 + (22 - 26)? 4 Evaluate (-570)/(-627) - 3582/(-198). 19 1178/380 - (-5)/(-50) 3 What is (3/(-46))/((1/4)/((-75)/225))? 2/23 Calculate (4/12)/(9/(-243)). -9 What is the value of 5((-5 - -9) + -5)? -5 (1/9)/((-1)/(-3)(-107)/535) -5/3 Evaluate 18240/3000 - (3 - -3). 2/25 What is (-988)/(-152) - 2/4? 6 Evaluate (-1 - 0) + (-1452)/1815. -9/5 What is -4(3 - 7038/2392)? -3/13 Calculate -4 + 316/(-120)(-49 - 16). 22 Evaluate 3(572/(-66) + (-12)/(2/(-1))). -8 0 + (-148)/377 + (-1620)/(-3510) 2/29 What is the value of 198/(-231) - (-33)/21? 5/7 Evaluate (-2 + 3)/(9 + 36/((-36)/6)). 1/3 What is the value of 2/(-25) + (-20 - (13 + 1509879/(-45675)))? -2/87 What is (20/(-42))/(15/18) - (-43)/14? 5/2 Calculate -2(2 + -1)-6440/(-480). -11 Calculate 693/5082 - 687/198. -10/3 Calculate (6/5)/((-46)/(-115)3/(-18)). -18 Calculate ((-148)/(-28) - 3)/((1804/(-154))/(-41)). 8 Evaluate 99/11 + (-812)/91. 1/13 What is the value of 14/(-4) - (351/(-1014) - (-2)/(-13))? -3 Evaluate (-1 - (0 + 1)) + (-2312)/(-289). 6 What is ((-2)/(-10))/(-1 + 2)? 1/5 What is -6 - (-63)/14 - (-24)/18? -1/6 Evaluate ((-280)/(-336))/((-20)/15). -5/8 What is the value of 52/(-32) - (-7)/56? -3/2 Calculate 65/(-65)(3 - 43)/2. 20 What is ((-16)/(-48)24/(-16))/(1/44)? -22 What is the value of 4558/13416 - (-10)/130? 5/12 (1280 - 1287) + ((-40)/6)/(-2) -11/3 (-12)/10150/120 -3/2 Calculate (-23)/23 - (-13 + 1). 11 What is ((-490)/(-9555))/((-6)/9)? -1/13 Evaluate 2/5(-575)/(-920). 1/4 What is ((-4)/40-5)/(-2)? -1/4 Evaluate (-7)/(14/15)4/27. -10/9 Evaluate ((-154)/(-910))/(8/25) - (-2)/(-13). 3/8 What is the value of ((-3)/(-18))/(46/(-621) - (-80)/(-135))? -1/4 (-1 - 8/(-2))/(33 + -17 - 31) -1/5 What is 8 + (156/12 - 13)? 8 What is the value of -13 + (-282)/(-110)5? -2/11 What is the value of 1/(-3)(-36)/(-10)? -6/5 Calculate (-730)/(-50) - (-19 + 31 - 2). 23/5 What is the value of -6 + 496/80 - 6/(-20)? 1/2 What is (-8 - 610/(-70)) + 259/49? 6 (16/2 - (-3157)/(-154))6/(-5) 15 Evaluate 7 + (135/(-270))/((-1)/(-38)). -12 What is the value of (-3660)/366 - (-776)/78? -2/39 What is the value of (-70)/(-6) - (-8073)/(-1053)? 4 What is the value of (-29 - -25)/(((-48)/9)/(-8))-2? 12 (-22)/4(-16 - 8 - -26) -11 What is the value of -8(23 + (-990)/44)? -4 -6 + (20 - (-2432)/(-171)) -2/9 What is (-23)/(207/(-12)) - (-88)/(-84)? 2/7 Evaluate 30/25 + (7 - 882/110). 2/11 What is the value of (15(-7)/(-560))/((-1)/(-36)) - 5? 7/4 Calculate ((-25)/60)/(1/(-1) - (-2)/(-3)). 1/4 Calculate 5/(-130)12 - (-2142)/(-91). -24 What is (1108/1385)/((-188)/10)? -2/47 Evaluate ((-1500)/(-4125))/(1(-4)/(-3)). 3/11 What is (-32 + 29)/(12/(-2))? 1/2 What is the value of 11/(-33)-1 - (-44)/(-6)? -7 Evaluate 386/(-22) - (-1128)/2068. -17 What is (-308)/8624(-16)/18? 2/63 What is -10(-12)/360 + (-26)/(-3)? 9 (2 + (-540)/75)35/14 -13 Evaluate 8(-27)/(-576) + 5/8. 1 What is 2595/692(-24)/(-195)? 6/13 Calculate (-7320)/920 - 35/805. -8 Calculate (-11 + 13)((-3)/(-12) + 10/56). 6/7 Calculate (-2365)/198 + 3/(-54). -12 What is (-105)/(-75) - (-434)/(-35)? -11 Evaluate (-45)/10 + ((-80)/(-2))/8. 1/2 What is (9 - 3960/500)(14/(-3) + 3)? -9/5 What is the value of (0 - -6) + -3 - (-41 + 58)? -14 What is the value of ((-556)/(-120) - -3) + 105/(-30) + -4? 2/15 What is (13 + 568/(-44) - (-4)/(-22))1? -1/11 (-183)/15 + 765/(-425) -14 What is the value of ((-58)/(-3))/(48/18) - (-30)/40? 8 Calculate 3 + (29/(-90) - (-5044)/(-1755)). -2/27 Calculate (-21 - -52) + (-15112)/488. 2/61 Calculate (-10 - (-429)/(-66)) + 18. 3/2 What is the value of (2768/128 + -14)2 - 11? 17/4 Calculate (-912)/1368(-90)/4. 15 What is the value of ((-1536)/(-13440))/((-2)/5)? -2/7 Calculate (-1687)/105 + (-11 - -1) + 26. -1/15 18/15270/(-36) -9 What is (-19)/2 + (-1)/2 - 30272/(-2992)? 2/17 Calculate -2(12/21)/(13 - 9). -2/7 Calculate 5 + (-180)/(-450) + 248/(-20) + -2. -9 (-18536)/(-23170) + -1 + 208/(-10) + 1 -20 What is the value of 21 + 1311/(-63) - -4(-6)/(-252)? 2/7 Evaluate 3 - -1 - (552 + -552). 4 What is (-1845)/792 - (-6)/(-11) - -3? 1/8 What is the value of (-30)/(-36) + 1161/(-810)? -3/5 What is the value of 7/((-9765)/4247) + 3? -2/45 (-5 - 26/(-5))/(13 - 12) 1/5 ((-1)/6)/(((-16)/(-72))/(80/45)) -4/3 Calculate 31/(-12) + 2 + (-102)/24. -5/2 What is the value of (1500/180)/((-5)/6)? -10 Evaluate 4/18 - -410/(-180). 0 What is the value of (-93)/(-9) - (-4420)/(-300)? -22/5 What is (1052/3419)/((-2)/(-6))? 12/13 What is (((-230)/40)/(-23))/(13/(-104))? -2 Calculate (11 + (-105)/63)(-12)/(-14). 8 What is 14 - -6 - (468/13)/9? 16 What is -7((507/21 - 13) + -13)? 13 Evaluate (0 + 44)91/364. 11 Evaluate (133/(-14) + 10)2. 1 Calculate -5(-11 + 11451/(-1045)-1). 4/19 Calculate ((-37613)/1044 - -36)(1 + 7). -2/9 What is (-21 - 6)/81 - ((-10)/(-6) - 2)? 0 9 + 0 + 3945/(-435) -2/29 Evaluate ((0 - -2)3/(-21))/((-10)/42). 6/5 Evaluate ((-3375)/(-648))/((-15)/(-12))6. 25 What is (-30)/234(4/8 - (-45)/(-50))? 2/39 What is the value of (-2 - -3)/1 - (-1109 + 1133)? -23 (-8 + 10 + -14)(-4)/3 16 Evaluate (-10 - 0)(-1)/390/(-60). -5 What is 2/7813 - (-4)/(-3)-2? 3 Evaluate 7/(-2)(15 + (-3489)/231). 4/11 Evaluate 12/(308/132 + (-3)/9). 6 What is the value of (33 - 18)-51/(-15)? 5 What is the value of (-1)/7 - 238/49 - (-22)/6? -4/3 Evaluate -29 - 42/88/(-28)2. -26 What is (289835/1092)/245 + (-10)/12 + 0? 1/4 Evaluate ((-2)/28)/((-80)/(-160)) - (-156)/14. 11 What is the value of (-29 - 3000/(-108))-27? 33 What is the value of (-3)/(-22) - 1/2 - 39867/(-72336)? 3/16 What is the value of (-5)/(-15)1 + (-6)/14? -2/21 Evaluate 8/(-12)34/7. -8/7 Evaluate (-15774)/1012 - ((-936)/184 + 7 + -2). -31/2 What is the value of (1 - 1)/(((-248)/(-31))/(-2 - -6))? 0 What is 1/(-10) + (-52)/(-120) + 160/(-525)? 1/35 Evaluate -5 + 55/((-33550)/(-14040)) + -18. 1/61 What is (-32708)/5180 + 13/5? -26/7 What is (1/(-11))/((-117)/((-25740)/(-200)))? 1/10 (-92)/(-14) + (1/(-2))/(9/126) -3/7 Evaluate 5(-3)/(6(-65)/208). 8 What is the value of (15202/(-1210) - -13)((-4)/(-1) + -9)? -24/11 Calculate 28 - 306/((-216)/(-24)). -6 Evaluate 3162/510(0 + 0 + -5). -31 (-158)/(-6) + -	{ "pile_set_name": "DM Mathematics" }
z3 + 565z*2 + 3z + 121131. 33z2 + 1130z + 3 Differentiate 2n3q*3 + 2n*3 - 36932n - 1574705q3 wrt q. 6n*3q*2 - 4724115q*2 What is the derivative of -10i4 + i3 - 3i2 - 607i + 883931 wrt i? -40i3 + 3i*2 - 6i - 607 Differentiate -h*2p*2y - 2h2p - 129352h2y - hp2 + 82h + 58p2 wrt y. -h2p*2 - 129352h*2 Differentiate 2z*4 - 78439z*3 + 55654 wrt z. 8z*3 - 235317z*2 Find the third derivative of 2rz4 + 1293rz3 - 64rz2 + z4 + z3 - 32z*2 - 4 wrt z. 48rz + 7758r + 24z + 6 What is the derivative of 11h*2v*2 + 3h*2 + 783hv2 - 4h - 98 wrt v? 22h2v + 1566hv Find the second derivative of 99258u2 + 143992u wrt u. 198516 Differentiate 1234871a2k*2 + 267548k*2 - 1 wrt a. 2469742ak2 Differentiate -2015260n*3 - 1303500. -6045780n*2 What is the second derivative of 3f*3hx - 1760f*3xy2 + fhy3 - fh + 188fxy + 2hxy - 4y3 wrt y? -3520f*3x + 6fhy - 24y Find the third derivative of my5 - 2my3 + my*2 - 2m - 2y4 - 422y3 + y2 + 6136 wrt y. 60my*2 - 12m - 48y - 2532 Differentiate -70457w*2 + 84747 with respect to w. -140914w Find the first derivative of 164r4 - 24r*3 + r - 47279. 656r*3 - 72r*2 + 1 Differentiate 2dv2 + 3dv + 2d + 142v2 + 2502 wrt v. 4dv + 3d + 284v What is the second derivative of v2y*2 - 316v*2y + 29v2 - 44vy2 + 279vy + v wrt v? 2y*2 - 632y + 58 Find the second derivative of -233331z2 + 32z - 31016 wrt z. -466662 Find the third derivative of 20375q2t*3 - 4q*2t - 2qt*2 - 99qt + 10t*4 + 9t*2 - 1 wrt t. 122250q*2 + 240t What is the first derivative of 1995t2u - 4t2 + 11999u - 1 wrt t? 3990tu - 8t Find the second derivative of 983x*3 - 39x*2 - 36286x. 5898x - 78 Find the second derivative of -2224698t*2v*5 + 1263t*2v - 3t2 - tv + 48 wrt v. -44493960t2v*3 Find the second derivative of 4095c*3r + c3 - c2nr + 148cnr - 2nr + n + 2r wrt c. 24570cr + 6c - 2nr Find the third derivative of 317fr4 + 4fr3 + 20700fr2 - 12f + 38r6 wrt r. 7608fr + 24f + 4560r3 What is the second derivative of 5a*2g - 1657a2o*2 + 28a*2oy + 2agy + 259ao*2 - 15ay + 3oy wrt a? 10g - 3314o2 + 56oy What is the first derivative of -179303n*3 + 53816 wrt n? -537909n*2 Differentiate -3107o*3p - o*3 + 35o*2p + 79o2 - 58o + p + 9 wrt p. -3107o3 + 35o2 + 1 Find the third derivative of g4 + 67961g3 + 365445g*2. 24g + 407766 What is the second derivative of -350746u5 - 372919u wrt u? -7014920u3 What is the third derivative of 102480k*3u*2 + 41k*2u2 - k2u + ku*2 - 68 wrt k? 614880u*2 What is the first derivative of -2t*4 - 11486t*2 - 47870? -8t*3 - 22972t What is the first derivative of -3c2 + 11859c + 238195 wrt c? -6c + 11859 Differentiate 2158396n*2 + 573717. 4316792n Find the third derivative of -2u2x*3 - 6u*2x*2 + 25628ux3 - 10ux - u - 2x*2 - 4x wrt x. -12u2 + 153768u What is the third derivative of 33a4d*2 + 5a*3d - 15a3 - 2a*2d*2 - 17a*2 - 2ad2 + 2d*2 wrt a? 792ad2 + 30d - 90 Find the third derivative of -3g6 + 4361g*4 + 128551g*2. -360g*3 + 104664g Find the second derivative of 49546t2z - 11264tz - 2z wrt t. 99092z Differentiate 2cip - 3ci - 12cp2 - 3cp - 5c - 4ip*2 + 1274i - 56p2 + 3p wrt i. 2cp - 3c - 4p*2 + 1274 Find the third derivative of -245o*4 - 670o*3 + 258797o*2. -5880o - 4020 Differentiate -1882p2u*2 + 161p*2 + 5u*2 + 2065 with respect to p. -3764pu2 + 322p Find the second derivative of 1097a4z - a*3 + 2az - 63a + 2z + 3 wrt a. 13164a*2z - 6a Find the second derivative of 4j*3u*2 + 10j*3u - 19554j3 - 5j*2u*2 - ju*2 - 2ju + 2030u*2 wrt u. 8j*3 - 10j*2 - 2j + 4060 Find the third derivative of -3344v6 + 2v*5 + 10v*3 + 10v*2 + 11840. -401280v*3 + 120v*2 + 60 Find the second derivative of -243r*3 - 661r*2 - 906r + 29 wrt r. -1458r - 1322 What is the first derivative of 60300dr2 - 3dr + 14824r*2 + 3 wrt d? 60300r*2 - 3r What is the derivative of 122219bu*2 - 2b - 2u2 + 37916 wrt b? 122219u*2 - 2 Find the third derivative of 177550r*3 + 182564r*2. 1065300 What is the second derivative of -96970r*3 - 132618r wrt r? -581820r Differentiate -10990y + 13020 wrt y. -10990 What is the third derivative of 181102h3 - 12h*2 - 165h - 8? 1086612 What is the first derivative of -2dl*3 + 102875dl - 4l*3 + 16109l*2 + 2l wrt d? -2l3 + 102875l Differentiate 2b4 - 6115b*3 - 110999. 8b*3 - 18345b*2 Find the third derivative of -2f*3w*3 - 12576f*3w + 4fw*2 + 6221w*3 wrt w. -12f*3 + 37326 What is the third derivative of 2218485c6 + c2 + 1436c + 131? 266218200c*3 What is the second derivative of -695901p*2 - 13p - 10715 wrt p? -1391802 What is the second derivative of -168318a2 + 168825a wrt a? -336636 What is the third derivative of 20r6 - 14266r*4 - 2r*2 - 135r - 256 wrt r? 2400r3 - 342384r What is the third derivative of 2007bfw4 - 6bfw*2 + 30bfw - 5bf - 10bw*4 - 2fw4 - 2fw wrt w? 48168bfw - 240bw - 48fw What is the third derivative of 2n2q*3 + 607n*2q - 3nq3 + q3 + 3q2 wrt q? 12n*2 - 18n + 6 What is the derivative of -28qv*3 - 116qv2 - q + v3 - 62864 wrt v? -84qv2 - 232qv + 3v*2 What is the third derivative of 749630n*4 + 299n*2 - 25n - 2? 17991120n Differentiate 15lo4 + 980lo3 + 80133l with respect to o. 60lo*3 + 2940lo2 Differentiate 1172jy3 - 3jy2 - jy - 5579y3 - 2 wrt j. 1172y*3 - 3y*2 - y Find the first derivative of 240388p*2r + 18p2 + 536p wrt r. 240388p2 Find the second derivative of -1470487y*2 + 54y + 2029 wrt y. -2940974 What is the second derivative of -3c3d*2 + 1785c*3d - 81754c2d*2 + 3d*2 + 3d + 16 wrt d? -6c3 - 163508c*2 + 6 Find the second derivative of -15546u*2 + 7296u wrt u. -31092 What is the second derivative of 63558h2 - 12188h? 127116 Find the first derivative of 55x4 + 264x*2 - 5762391 wrt x. 220x*3 + 528x What is the derivative of -b*4w - 61089b4 + 5w - 5123 wrt b? -4b3w - 244356b3 What is the second derivative of -465742o*4 + 55551o? -5588904o2 Find the first derivative of 285500u*4 + 1570266 wrt u. 1142000u*3 Find the second derivative of 7953a*3 - 24a*2k + 200677ak + 6a wrt a. 47718a - 48k Find the third derivative of -58h*4 + 2315h*3x - h*2x + 10h2 - 3h wrt h. -1392h + 13890x Differentiate 128c2vx + c2 - 1533cv + 2cx + v + 10816x - 1 with respect to c. 256cvx + 2c - 1533v + 2x What is the second derivative of 3b3i*2 + 9b*2i*2 + 850b*2 - 33461bi2 wrt b? 18bi2 + 18i*2 + 1700 Find the third derivative of 3716r*5 - 2r4 - r3 + 1133r2 + 3r - 3. 222960r2 - 48r - 6 Find the third derivative of 93806k3 - 2k*2 + 15k - 106 wrt k. 562836 Differentiate -101493d4s - ds + 76s - 54 wrt d. -405972d3s - s Differentiate 2v3 + 361v*2 - 2v - 26677 wrt v. 6v2 + 722v - 2 What is the second derivative of f*3w*3 + 3139f*3w - f*2w - 13512w2 wrt w? 6f*3w - 27024 What is the second derivative of -732285cm*2 - 224849cm wrt m? -1464570c What is the second derivative of -2l2m*3 - 21795l*2 - 19256lm3 + 2m wrt m? -12l2m - 115536lm What is the second derivative of -172g5 + 6g3 - g2 - 33054g wrt g? -3440g*3 + 36g - 2 Differentiate 285dg + 137d + 93g - 122 wrt g. 285d + 93 Find the first derivative of 7671b*2 - b - 17149 wrt b. 15342b - 1 What is the second derivative of b*2j*3q + 683b2 + 34530bj3 - j + 91q wrt j? 6b2jq + 207180bj What is the derivative of -1285856p*3 + 2511496? -3857568p*2 What is the third derivative of 8o*6 + 19o*5 - 35o*3v - 2o2v + 5o2 - v + 3746 wrt o? 960o*3 + 1140o*2 - 210v What is the derivative of -13687mz*3 + 58m - p*2z**4 + 24	{ "pile_set_name": "DM Mathematics" }
11 and 33655759. 33656670 27 - 4.03960146168 22.96039853832 What is -1341304330.9 take away -3.341? -1341304327.559 What is -28013488 + 2053? -28011435 0.06+35982.16872 35982.22872 What is -1003561683 minus 25474? -1003587157 What is 96 minus -10475030174? 10475030270 What is -170132959287 less than -0.45? 170132959286.55 What is 38 plus -152613372.3? -152613334.3 Work out -128.6 - 6397024. -6397152.6 Subtract -129114884 from 5. 129114889 173.109176+-953664 -953490.890824 Work out 391565366.8 + 74. 391565440.8 -0.1 - -4527.0684516 4526.9684516 Calculate 610838 + 210540349. 211151187 What is 229516.1712446 less than 4.4? -229511.7712446 -0.065494+-3048224 -3048224.065494 Subtract 10 from 1872132845706. 1872132845696 Add -671 and 7990612201. 7990611530 Put together -204084860 and 1384069. -202700791 Add together -153045715.874 and 0.11. -153045715.764 What is -27465957731294 - -0.2? -27465957731293.8 What is -131 less than 361690137471? 361690137602 Work out 702 + 484243859. 484244561 What is -89687 plus -201799347? -201889034 What is 121772516132 - -0.3? 121772516132.3 What is -4610 plus 3428599372? 3428594762 Sum 2.7895 and 48880026. 48880028.7895 Calculate 5896782885 - -2.101. 5896782887.101 Calculate -369541296 + -1803. -369543099 What is -0.5 less than 526.70414480942? 527.20414480942 What is -2410555 - 76324.32? -2486879.32 119+820186.79414 820305.79414 Work out -0.2 - -29106168867195.2. 29106168867195 What is the distance between 690443603125 and 0.0257? 690443603124.9743 What is -0.05 less than 72778.596827? 72778.646827 Work out 20442 + -0.1340616002. 20441.8659383998 What is 32782782 minus 695472? 32087310 Subtract 61007233435 from 0.225. -61007233434.775 What is 72307639775674 + -2? 72307639775672 Work out -335868996987 + -1. -335868996988 What is 20.56 - 2878556770? -2878556749.44 What is -61.4 less than -60084023436? -60084023374.6 Subtract 6921962 from 1566.66. -6920395.34 Calculate -144982151 + -1.43. -144982152.43 What is 26354048729 plus 0.0974? 26354048729.0974 1293.624+579280.94 580574.564 What is 5054.955 minus 230302? -225247.045 What is -2.578124944 + -0.4269? -3.005024944 Subtract -10758 from -3142969. -3132211 What is the difference between -40790109 and 0.05192? 40790109.05192 What is the difference between -0.06 and -21.860418405719? 21.800418405719 What is the difference between 0.7 and 124.7476044335? 124.0476044335 What is 0.175 minus 11266850.466? -11266850.291 What is -5357181886 - -414? -5357181472 338746324+-494234 338252090 What is the distance between -0.28147342 and 18766? 18766.28147342 What is 2636530648.8 less than -4.501? -2636530653.301 Add together 3 and 14630.36067. 14633.36067 -80927965.137+-137.5 -80928102.637 What is -59866838173 - -0.3? -59866838172.7 What is the difference between -36370 and -852.076162? 35517.923838 Total of 145104095647 and 2228. 145104097875 Put together 252936758 and -272720. 252664038 What is the distance between -81 and -6.30334039? 74.69665961 Subtract 16427433214 from 0.084. -16427433213.916 -0.4 - 2508658.262885 -2508658.662885 1.8 - 1168.398854593 -1166.598854593 What is -1.462483 less than -7486956? -7486954.537517 Put together 0.5 and -0.531670648675. -0.031670648675 What is the difference between 1318525994013 and 8.1? 1318525994004.9 25.3513 - 9.8840472 15.4672528 Sum 112586.2 and 2458028.2. 2570614.4 What is -40.87 less than 20941.0816? 20981.9516 What is the difference between -0.3427523631 and 33562? 33562.3427523631 Total of -0.054 and 0.2409890577. 0.1869890577 Put together 0.1219709 and -0.721136. -0.5991651 Add -214793123 and -226586. -215019709 What is the distance between 660725151.87 and -79.6? 660725231.47 What is 4 + -8843077193606? -8843077193602 What is -260.433 - 1495539? -1495799.433 Sum -17307930646371 and -7. -17307930646378 Add together 101670.134395 and -253. 101417.134395 Put together -16955940.8 and -574850. -17530790.8 -260147 + 5823693.9 5563546.9 2478185376.551 - -5 2478185381.551 Subtract -39.98752883 from 111. 150.98752883 What is 0.03 minus -21066790710881? 21066790710881.03 Subtract 0.0469 from -345.526563. -345.573463 Work out -285588805109 + -0.11. -285588805109.11 What is -17.9 - 14487.67828? -14505.57828 Total of -412427.88 and -0.016244. -412427.896244 What is 18621 plus -3593897? -3575276 What is the difference between -28.052 and 73.7647259? 101.8167259 What is the difference between 38 and -223040783791? 223040783829 What is 1097.668119154 less than -2? -1099.668119154 2916643943377+-1.1 2916643943375.9 Put together 22249865801.2 and -0.5. 22249865800.7 Sum 3838597934 and 735. 3838598669 0.5 - -64473998758329 64473998758329.5 Work out 6749318 - -5022405. 11771723 Total of 13.745 and 208774940. 208774953.745 Work out -25114506691996 - -0.5. -25114506691995.5 Subtract 82718927720 from -846. -82718928566 What is 50.52 + 3820.4187? 3870.9387 Subtract -589331198.257 from -4. 589331194.257 Calculate 3.3135 - 1114368747. -1114368743.6865 Add together -140709 and 231.663721. -140477.336279 Total of -54533.460338 and -17892. -72425.460338 Total of 0.1408056599955 and 441. 441.1408056599955 What is 1796773 + -65395.1? 1731377.9 Put together -128.4341562 and -28491. -28619.4341562 -87 + -393861414183 -393861414270 What is -1306749079958 minus -0.4? -1306749079957.6 55260992.165+-1.75 55260990.415 Add together 2003.52 and -1695425. -1693421.48 Subtract 63611.04 from 23730. -39881.04 What is -20.6 - -607436473567? 607436473546.4 What is -33772559958 less than 0.2? 33772559958.2 Sum 949816102611508 and -4. 949816102611504 Add 0.5 and -148696566595. -148696566594.5 What is -12.24983 take away 137.38373? -149.63356 What is -162.33 take away -1.9024754? -160.4275246 What is 149753122 - 3.099? 149753118.901 What is 1199131483 + -0.35771? 1199131482.64229 What is 1113 minus -330549706? 330550819 0.176416 - 1406363 -1406362.823584 -36999 + -2.376522219 -37001.376522219 Calculate -32104185138 - 34. -32104185172 What is -29434359 minus 161955? -29596314 Work out -1619568.183 + -0.022. -1619568.205 1288285731.4+-30 1288285701.4 Calculate -6.001611617586 - 10. -16.001611617586 Sum 18649033412 and -192. 18649033220 Work out -99232561877 + -7. -99232561884 What is -2.218 take away 2469707591? -2469707593.218 Work out 5.454 - -0.19424276. 5.64824276 Sum -2799654600 and 9. -2799654591 Work out -24402486014 - -26. -24402485988 Subtract -708.657192707 from -167. 541.657192707 What is -660.34 less than -22763.8993? -22103.5593 Calculate 0.67564 - -771226. 771226.67564 What is 0.3 - 48.644517086? -48.344517086 Calculate 0.55 + 10015097397289. 10015097397289.55 39564.4 + 374333 413897.4 -0.1+9051821793.046 9051821792.946 What is 0.032851 take away 62350.902? -62350.869149 What is -1719 plus -6593425465? -6593427184 What is the difference between -7776 and 6459637073? 6459644849 What is -153805734532 minus -0.42? -153805734531.58 What is -1521.40307 less than -3268092? -3266570.59693 578343 + -242.152 578100.848 Work out 0.0427 + 20802985. 20802985.0427 Work out 0.1 + -3740408339655.62. -3740408339655.52 What is -4 - -49624814974554? 49624814974550 -16743653897064 - 4 -16743653897068 Sum -5.6 and -16449914091. -16449914096.6 Calculate -304.585520633 - -1. -303.585520633 Add -769225 and 795.031. -768429.969 Add 3754958 and -0.05910451. 3754957.94089549 Put together -3202 and -214629087. -214632289 What is the distance between 142.0981 and -49.49? 191.5881 What is -35674.8278 minus 15.2? -35690.0278 Add together -32530899482 and -81. -32530899563 What is 0.24 minus 5199264090253? -5199264090252.76 Work out 0.005 - 45618676.32. -45618676.315 What is the distance between -571552.121427 and 0.5? 571552.621427 -2.467 - 15.79602707 -18.26302707 What is -70279527 plus 717983? -69561544 Add together -0.01122 and -3639.9781709. -3639.9893909 Work out 48942022590369 - -0.4. 48942022590369.4 Work out -283.96680838 + -0.425. -284.39180838 What is -7094842381985 minus -1? -7094842381984 -210 + -259610152641 -259610152851 Work out 959452351992 + -28. 959452351964 Subtract 2.53297 from 0.120403. -2.412567 152783869218.8 - -0.1 152783869218.9 Sum 35.730276 and 1514. 1549.730276 Add together -1614795848 and -394. -1614796242 Total of 9 and 5570727414. 5570727423 Put together -8	{ "pile_set_name": "DM Mathematics" }
pect to r. 864n3r*3 - 4n*3r Find the third derivative of 30h4v*2 - 5h*3v + 10h2v + 2h2 + 5hv2 wrt h. 720hv2 - 30v Find the second derivative of 29j4 + 42j3 + j2 - 87j - 20 wrt j. 348j*2 + 252j + 2 What is the second derivative of 129u4 + 3u*3 - 70u? 1548u2 + 18u Differentiate -2n4 - 354n + 31 wrt n. -8n3 - 354 What is the second derivative of 385c*2q*4 - 6c*2q*2 - 2c*2q - 2cq*2 + 8cq + 5c wrt q? 4620c2q*2 - 12c*2 - 4c What is the third derivative of 2o2q3 - o2q2 + 221oq3 + 63q*2 wrt q? 12o*2 + 1326o Find the third derivative of -11a3how - a*3hw + 4a*3o*2 + 36a*2o + 11ao*2 + 3aow - 2aw + 2ho*2w - h wrt a. -66how - 6hw + 24o*2 What is the second derivative of -2163b*4 - 1350b - 1? -25956b2 What is the third derivative of 1256g6 + g3 + g*2 + 9325g? 150720g3 + 6 Find the third derivative of -2z*6 + 13z*3 - 52z*2. -240z3 + 78 Find the third derivative of p4qt - p*3qt + 641p*3 - 4p*2qt - 21pqt - 2t wrt p. 24pqt - 6qt + 3846 What is the first derivative of -315g3 - 142 wrt g? -945g*2 Differentiate -11g*4s*2 + 552g*4 + 5s*2 + 2s + 451 wrt g. -44g3s*2 + 2208g*3 What is the third derivative of 967s*3 - 935s*2? 5802 What is the second derivative of 4936c*5 - 4650c? 98720c3 Find the third derivative of v5 - 6v*4 + 77v*3 + 123v*2 - 5v - 9. 60v2 - 144v + 462 What is the second derivative of -6a3d*3 + 4a*3d - 4a3 + 140ad3 - 2ad2 wrt a? -36ad3 + 24ad - 24a Find the third derivative of 3526j4 - j3 + 3342j*2. 84624j - 6 What is the second derivative of 837u4 + 28u + 54? 10044u2 Find the third derivative of -3j*2q*3 - 4j*2q*2 + 7j*2q + 166jq*3 + jq*2 + 2 wrt q. -18j*2 + 996j Find the first derivative of 12630v - 10485 wrt v. 12630 Find the second derivative of 1165k*3 + 366k wrt k. 6990k What is the second derivative of -2c*2k3 + c2k2 + 227c*2k - k*3 wrt k? -12c*2k + 2c2 - 6k What is the second derivative of -3308m2n*3x*2 - 7mn3x*2 - 2mn3 + 17mnx*2 wrt m? -6616n*3x*2 Find the third derivative of -2b*5 + 4b*3 - 678b*2 wrt b. -120b*2 + 24 Find the third derivative of -2d*2u*4 + 4d*2u*2 - 7du2 - 13u*5 + 6u*3 + 2 wrt u. -48d*2u - 780u2 + 36 What is the first derivative of 12gs3 - 2gs2u + 2g + s3u + 250su wrt u? -2gs2 + s3 + 250s What is the second derivative of -p2s*3u*2 - 412p*2s*2u*3 + 133p*2u*3 + 2psu*3 wrt s? -6p*2su2 - 824p*2u*3 What is the second derivative of 2q*3 + 153q*2 - 4323q wrt q? 12q + 306 Find the third derivative of -86r*4 - 33r*2 - 1. -2064r What is the third derivative of 5j4 - 57j*3 - 38j*2 - 3? 120j - 342 Find the first derivative of -1016oz - 1264z wrt o. -1016z Find the second derivative of 11h3s3 + h3s + 9s*5 + 29s wrt s. 66h3s + 180s3 What is the second derivative of -69c*2 - 346c wrt c? -138 Find the second derivative of -f*2ps + 1627f*2s + 15fps + 2fs - 3ps - 4 wrt f. -2ps + 3254s What is the third derivative of -361d3g*2 + 223d*2g2 - d2g wrt d? -2166g*2 Find the third derivative of -988n*3 + 534n*2 wrt n. -5928 Differentiate 8h*2t - 33h2 - 5ht - h wrt t. 8h*2 - 5h What is the second derivative of 17j4 - 6j*3 + j + 34 wrt j? 204j*2 - 36j What is the second derivative of 5091b3v*2 + 19608b*3v wrt v? 10182b3 Find the second derivative of 9x*5 - 96x*4 + 644x wrt x. 180x3 - 1152x*2 What is the second derivative of 41bt4 + bt*2 + 13b - 17t5 + 6t wrt t? 492bt*2 + 2b - 340t3 What is the third derivative of -f2h*5 + 16f*2h*4 - 222f*2h2 + h3 wrt h? -60f2h*2 + 384f*2h + 6 Find the third derivative of d*3w*3 - 13d*3 + 13d*2w*2 - 510dw3 - dw*2 wrt w. 6d*3 - 3060d Find the second derivative of 5c3n*2 - 10c*2n*2 + 2cn2 - cn - 2c wrt c. 30cn2 - 20n*2 What is the derivative of 177hl4q - 4hl*4 + 727hq wrt l? 708hl3q - 16hl*3 Differentiate -5j*2w2 - j2w - 12jw2 - 2w*2 wrt j. -10jw2 - 2jw - 12w*2 What is the second derivative of 96h*2p - 3h2 + h + 233p - 2 wrt h? 192p - 6 What is the third derivative of -o3r*3 - 9o3 + o2r - 58or4 + r4 + r2 wrt r? -6o*3 - 1392or + 24r Find the second derivative of -4415o5 - 2o + 794 wrt o. -88300o3 Find the second derivative of -725v*4 + 6v*3 - 3028v. -8700v2 + 36v Find the third derivative of -78l4 + 27l*2 - 10l wrt l. -1872l What is the second derivative of 167m*2y*2 - 2m*2y + m*2 - 2my5 - 38y wrt y? 334m2 - 40my3 What is the first derivative of 1532k*2 - 129 wrt k? 3064k What is the second derivative of -1203p3t*4 + 2p*3t - 106p2t - 3pt*5 + 3pt - 3p wrt t? -14436p3t*2 - 60pt3 What is the third derivative of 1463l*5 - 991l*2 wrt l? 87780l*2 What is the second derivative of -617dgj*2 + 6dgj - gj2 - 3g + 8j wrt j? -1234dg - 2g What is the second derivative of -7a2wx2 + 49a*2w + aw + 2ax - 8wx2 + x2 - 4 wrt x? -14a*2w - 16w + 2 What is the third derivative of 15ht5 - 31ht3 + 2216ht2 wrt t? 900ht2 - 186h What is the first derivative of -2nw*3 + 13nw2 + 13n - 5w - 10 wrt w? -6nw2 + 26nw - 5 What is the second derivative of -22127u*2 + 12u - 137 wrt u? -44254 What is the second derivative of -654t2v*2 - 2tv2 - 2t - 29v2 wrt t? -1308v*2 Find the third derivative of 1626d*2f*3g*3 + 8d*2f*3g + 3d2g*3 + 7d*2g*2 - 2dfg*2 wrt g. 9756d*2f*3 + 18d*2 Find the second derivative of -4489b*4 + 7595b. -53868b2 What is the third derivative of 16l*6q*2 + 4l*5q*2 - 27l*2 + 3q*2 wrt l? 1920l*3q*2 + 240l*2q*2 What is the first derivative of 2002l*3 + 1011 wrt l? 6006l*2 What is the third derivative of -1879n*6z3 - n2z + 728z*3 wrt n? -225480n*3z*3 Differentiate 269m*2t + 435m2 with respect to t. 269m*2 What is the third derivative of 203j*6 - 11j4 - j2 - 7j - 274? 24360j*3 - 264j What is the second derivative of -2015l3 + 156l - 1? -12090l Find the second derivative of 8b*5 + 2b*2 + 438b - 4 wrt b. 160b3 + 4 What is the second derivative of 4gk + 2gq2 - 2gq - 38kq2 + 3kq + q2 + 2q wrt q? 4g - 76k + 2 Find the second derivative of -16456n5 - 1330n - 1. -329120n3 Differentiate 13b*2j*2t - 12b2j2 - b2n3 - b2t + bj2n*2 - 2bn3t wrt t. 13b2j2 - b2 - 2bn*3 Differentiate 63box*2 + 2bo - 2bx + b - 2ox2 - 55o - x*2 - 1 with respect to x. 126box - 2b - 4ox - 2x What is the derivative of -55u2 + 4u + 508? -110u + 4 Find the second derivative of -31l*5y - l*2y*2 - 2l*2 + l - 203y*2 wrt l. -620l*3y - 2y2 - 4 Find the second derivative of 50x*5 - 12x*3 - 1500x. 1000x3 - 72x Find the first derivative of 7320t2 + 6277 wrt t. 14640t Find the third derivative of 260u5 + 2u*3 + 585u*2. 15600u*2 + 12 Find the first derivative of -25901oq + 17738q wrt o. -25901q What is the second derivative of 7n*2s*2 + 3n*2s - n*2 - 3ns - 604s*3 + 13 wrt s? 14n*2 - 3624s What is the first derivative of -2275g2v*2 - 1716v*2 wrt g? -4550gv2 What is the second derivative of 6ao2 + 261ao - 2ar2 - o3r*2 - 30o3 - r2 wrt o? 12a - 6or2 - 180o Find the third derivative of -32q5 + 2q*4 - 84q*2. -1920q*2 + 48q Find the third derivative of -dw4 - 9dw3 - 2d + w*4 + 8w*3 + 1328w*2 wrt w. -24dw - 54d + 24w + 48 What is the derivative of 1432g*2 - 1002 wrt g? 2864g What is the derivative of -12j3s*2 - 2j*3s + 157j3 + 3j*2s wrt s? -24j3s - 2j3 + 3j*2 What is the derivative of -8i*3 - 139i*2 - 2i + 15038 wrt i? -24i2 - 278i - 2 Find the first derivative of 1190l4p - 4l3p*2 + 351p**2 - p wrt l.	{ "pile_set_name": "DM Mathematics" }
d(m) be the first derivative of -m*2 + 4406. Determine d(q(j)). -32j + 2 Let k(h) = -1480h. Let s(g) be the third derivative of g5/60 + 3021g*2. What is k(s(u))? -1480u*2 Let f(l) = -5l. Let q(u) = 680u2 + 193u - 10. Give q(f(t)). 17000t2 - 965t - 10 Let v(c) = c*2. Suppose 3a - 15 = f, -2a + 2f - 5 = -19. Let g(n) = n3 + n2 - 2n - 4. Let x be g(2). Let d(b) = 3b + ab - b + xb. Determine d(v(p)). 10p2 Let x(c) = -2c. Let o(p) = 2p. Let z(y) = -4o(y) - 5x(y). Let a(l) = 7372l*2 - 3681l*2 - 3674l*2. Determine z(a(v)). 34v*2 Let p(o) = -12o - 11o - 2 - 7o. Let i(q) = -913491 + 913491 + q. Give i(p(v)). -30v - 2 Let g(p) be the first derivative of 13p*3/3 + 1. Let i(r) be the first derivative of 1/2r*2 + 0r - 3. Determine i(g(c)). 13c2 Let x(w) = -w + 7713. Let i(h) = 36h - 4. Calculate i(x(f)). -36f + 277664 Let r = 10 + 1. Let c(m) be the first derivative of -16 - 13 + 50 - rm2. Let s(t) = t2. Give s(c(u)). 484u2 Let k(s) = 7s. Let t = -227 + 413. Let o(n) = tn2 - 97n*2 - 92n*2. Give k(o(f)). -21f*2 Let a(j) = -10j*2 + 28j*2 + 26 - 9 - 17. Let n(f) = 5f + 3. What is n(a(s))? 90s2 + 3 Let w(p) = 450p*2. Let f(a) = 7a. Let g(r) = -13r. Let q(s) = -2s - 34. Let z be q(-14). Let c(t) = zg(t) - 11f(t). Give c(w(l)). 450l2 Let o(w) = 14w*2. Let v be (-170)/(-15) - (-3)/(-9). Suppose 0m + 11 = vm. Let z(s) = s. Let l(d) = 5d. Let i(j) = ml(j) - 4z(j). Determine o(i(f)). 14f2 Let r(d) = -354d + 136d + 82d + 130d. Let n(j) = 25j*2 + 5. Determine r(n(z)). -150z*2 - 30 Let s(j) = -49j*2. Let m(u) = -21335 + 21344 + 6u - 5u. Give m(s(v)). -49v*2 + 9 Let r(m) = -4217m. Let z(j) = 2j2 + 3j + 244. Give z(r(g)). 35566178g2 - 12651g + 244 Let z(w) = 13w. Let d(s) be the second derivative of -77s*4/12 + 16s + 16. What is z(d(m))? -1001m2 Let y(z) = -1623z*2 - 414z. Let h(p) = -24p2. Determine y(h(f)). -934848f*4 + 9936f*2 Suppose -o + 60 = 58. Let j(w) = ow + 0w + w - 2w. Let k(a) = -45a + 9. Let f(r) = -11r + 2. Let n(b) = 9f(b) - 2k(b). Calculate j(n(p)). -9p Let u(n) be the second derivative of -4n*3/3 - 7n + 3. Let o(v) = 2v + 4. Let d be o(-2). Let h(m) = dm + 3m - m - 6m. Determine u(h(a)). 32a Let h(v) be the first derivative of v2 + 1. Let j(m) be the second derivative of 89m*4/4 - 1038m. What is j(h(o))? 1068o2 Let s(d) = 17d. Let f(l) = -6l2 + 286l - 27. Let i(k) = -5k2 + 260k - 26. Let m(h) = 10f(h) - 11i(h). Calculate s(m(n)). -85n2 + 272 Let t(y) = y2. Let h(z) = -7099412z*2 - 18z. What is h(t(j))? -7099412j4 - 18j*2 Let k(d) = -2d*2. Suppose -6433u = -6440u. Let h(q) be the second derivative of -17q + uq2 + 0 + 0q*3 - 1/3q*4. Calculate k(h(b)). -32b*4 Let i(m) = 4m. Let p(r) = r + 56. Let y be p(25). Suppose -a - 4a - 4v + 78 = 0, 5a - y = -3v. Let t(h) = -11h + 20h - 12h - ah. Give i(t(n)). -84n Let o(z) be the second derivative of -z4/4 + 2z. Suppose 0 = 5v - 5q - 25, -2v + 5q + 22 = 3. Let c(u) = -141uv + 0u + 139u2 + 0u. Give c(o(w)). -18w4 Let y(f) = -17018490f*2. Let o(h) = -6h*2. Calculate y(o(l)). -612665640l4 Let u(a) = a2 + 50. Let m(f) = -20481f2 - 1 + 20475f*2 + 1. Determine u(m(d)). 36d*4 + 50 Let r(t) = -3t*2. Let y(z) = 49983845z. Determine r(y(k)). -7495154282952075k2 Let m(c) = -53c + 60. Let n(o) = -264o + 288. Let q(l) = 24m(l) - 5n(l). Let w(b) = -35b*2. Determine w(q(g)). -80640g*2 Let f(r) = 9r - 8r + r. Let l(o) = -2 - 15 + 16 + 95o*2. Give f(l(p)). 190p2 - 2 Let m(y) = 2956 - y2 + 2955 - 8873 + 2962. Let q(z) = 12z + 34. Give m(q(o)). -144o*2 - 816o - 1156 Let b(d) = -17d2. Let k(u) = 5u*2 + 18u*2 + 10u*2 + 35u - 35u. Calculate k(b(p)). 9537p*4 Let x(v) = -447v - 24. Let w be x(12). Let n be (4/5)/(7 + w/770). Let t(g) = 308 + g - n. Let b(z) = 6z2. Determine b(t(s)). 6s*2 Let i = -21 + 21. Suppose i = -3m + 3g, 4m - 8 = -m + g. Let s(q) = 47q2 - 8q*2 - mq*2 - 18q2. Let r(v) = -v2. What is r(s(z))? -361z4 Let m(g) = -g + 69. Let i(l) = -154l*2 + 3l + 9. Let t(k) = -145k2 + 2k + 6. Let v(x) = 2i(x) - 3t(x). Give v(m(y)). 127y2 - 17526y + 604647 Let w(n) = -4n2. Let q(r) = -r + 2. Let x be q(0). Suppose 0 = -282c + 104 + 1024. Let t(d) = cdx - 11d*2 - 5d*2. What is t(w(i))? -192i*4 Let j(w) = -91w - 5. Let o(q) = -q*2 + 9q - 12. Let i(v) = 4v2 - 39v + 52. Let r(h) = -6i(h) - 26o(h). Determine r(j(f)). 16562f2 + 1820f + 50 Let x = -639 + 637. Let y(u) = 3. Let q(a) = -36a + 3. Let v(p) = xy(p) + 2q(p). Let c(t) = -2t. What is v(c(w))? 144w Let t(d) = 47d*2. Let x(k) = -2267k*2 + k + 3. Calculate x(t(r)). -5007803r*4 + 47r2 + 3 Let y(j) be the first derivative of j2/2 + 4938. Let d(o) = 3091o. What is d(y(v))? 3091v Let j(x) = -2x - 6582. Let s(p) = 3049p. Calculate s(j(o)). -6098o - 20068518 Let r(v) = -27v. Let o = -404 - -409. Let k(h) = oh2 + 7h*2 + 9h*2 - 22h*2. Calculate k(r(w)). -729w*2 Let n(z) = -6z. Let c(f) = 41f. Let m(a) = -312a - 16. Let v(g) = 8c(g) + m(g). Determine v(n(i)). -96i - 16 Let n be (-24)/(-2) - (457 + -449). Let z(a) be the third derivative of 0a + 0a*3 + 0 - 2/15a*5 + 0a*n - 7a*2. Let r(k) = k. Give r(z(p)). -8p2 Let c(o) = -o2. Let w(y) be the third derivative of y*5/60 - 43y*3/3 + 358y2. Determine c(w(q)). -q4 + 172q2 - 7396 Let f(z) be the second derivative of z3/3 - 3z. Let d be (195/39)/(1/((-1)/1)). Let t(m) = 76m. Let x(j) = -39j. Let g(y) = dx(y) - 3t(y). Give f(g(r)). -66r Let o(s) = 2s. Let m(p) = -28p2 + 22p - 4969. What is o(m(g))? -56g2 + 44g - 9938 Let b(k) = -14k2. Let a(n) = 14n + 5. Let j be a(3). Let t(f) = -32f - 19f + jf. Give t(b(i)). 56i*2 Let h(w) = 31w*2 - 43w. Let j(v) = 14v2 - 18v. Let l(t) = 2h(t) - 5j(t). Let i(d) = -2d + 4. Determine l(i(y)). -32y*2 + 120y - 112 Let j(i) = i*2 + 0i*2 - 4i*2 - 3i*2. Suppose 269 = -4p - 3g + 1472, 0 = -3p - 2g + 901. Let n(b) = -580b + 289b + pb. Calculate n(j(t)). -36t2 Let s(n) = -28338n. Let x(c) = 1614c + 1633c - 3249c. What is x(s(l))? 56676l Let n(z) = -3z. Let f(q) = -3q. Let k(m) = 7f(m) - 6n(m). Let a(x) be the third derivative of x*4/24 - 19x*2 - 9x. What is a(k(p))? -3p Let m(y) = -y + 13. Let l(j) = -2994j*2 + 5 - 3 + 2983j*2 - 2. Give m(l(h)). 11h*2 + 13 Let k(b) = -339b*2. Let i(z) = 10753z. Give i(k(u)). -3645267u2 Let v(r) = -728r*2. Let w(l) = -124 + 154 + 2l*2 - 30. What is v(w(g))? -2912g*4 Let i(z) = 2z. Let d be (1005/(-134))/(2/(-4)). Let k = -22 - -41. Let g(x) = -dx2 - 10x - 9x + kx. Calculate i(g(a)). -30a2 Let n be (0 - 403/(-9)) + 4/18. Suppose -b = -12 - n. Let m(t) = 113t - 33t - bt. Let l(a) = -3a. Give l(m(h)). -69h Let l(r) be the second derivative of 2r4 - 1401r. Let s(g) = -49g - 44g + 92g. Determine s(l(j)). -24j*2 Let g(s) = -208s*2 - 320s - 64. Let q(y) = -16y2 - 25y - 5. Let f(w) = 5g(w) - 64q(w). Let n(k) = -179k2. Give f(n(m)). -512656m*4 Let j(l) = 24874374l. Let p(i) = 14i2. Give j(p(r)). 348241236r*2 Let j = -33 + 68. Let n = j + -13. Let k(h) = -11h - 13h + nh. Let c(u) = 15u2. Calculate k(c(v)). -30v*2 Let w(s) = -2s*2. Let t(y) = 6y - 85397 - 409y + 85397. Determine t(w(g)). 806g*2 Let y(l) = -338l. Let d(b) be the second derivative of b*4/6 + 14b + 32. What is d(y(f))? 228488f2 Suppose 10 = -5f + b - 5, -5f + 2b - 10 = 0. Let x(c) = 5c + 12. Let i(s) = -4s - 9. Let l(t) = fi(t) - 3x(t). Let h(o) = -9o - 2. Determine h(l(r)). -9r - 2 Let u(n) be the first derivative of 104n3/3 - 2559. Let d(q) = 5q. Calculate u(d(v)). 2600v2 Let i(t) = -t + 1. Let a(f) = -136f - 141f - 1 + 415f - 140f. Let g(k) = 3a(k) + 3i(k). Let x(c) = 20c*2. Determine x(g(m)). 1620m*2 Let x(i) = -3i. Let z = 303/34 + -24/17. Let c(h) be the first derivative of -11 + 0h - zh*2. Calculate c(x(t)). 45t Let d(v) = v*2 + v - 2. Let z(s) = 14s - 18s + 8 - s2 - s2. Let h(x) = 4d(x) + z(x). Let m(y) = y - 71. Determine m(h(g)). 2g	{ "pile_set_name": "DM Mathematics" }
84/45 Calculate 266240 divided by -8. -33280 Divide -3 by 58788. -1/19596 Calculate 405 divided by 548. 405/548 Calculate -605360 divided by 920. -658 Divide 1 by 43596. 1/43596 What is 24024 divided by 546? 44 Calculate -134622 divided by 7. -134622/7 -215568 divided by 998 -216 Calculate -47760 divided by -597. 80 -191056 divided by -8 23882 Calculate 884997 divided by 3. 294999 What is -42004 divided by -15? 42004/15 Divide -574914 by -191638. 3 Divide -1584 by 36. -44 Divide 10625 by -25. -425 4038 divided by 90 673/15 211835 divided by 13 16295 Calculate -56704 divided by -886. 64 What is -4939 divided by -1? 4939 Calculate 19 divided by 1586. 19/1586 Calculate 7348 divided by -334. -22 -3780192 divided by 1352 -2796 What is 7556 divided by -38? -3778/19 51732 divided by 2 25866 What is 119667 divided by -119667? -1 Divide 73287 by -153. -479 Calculate -82728 divided by 383. -216 Divide 12760 by 2552. 5 6182 divided by 6182 1 Calculate -298038 divided by -99346. 3 76560 divided by 528 145 Calculate 1506 divided by 15. 502/5 What is -398687 divided by 9? -398687/9 Calculate 71076 divided by 5923. 12 -478456 divided by -22 21748 Calculate 2 divided by -11151. -2/11151 10 divided by -107762 -5/53881 Divide 3 by 9748. 3/9748 What is -756420 divided by -10? 75642 2788060 divided by 58 48070 -562604 divided by 1132 -497 Divide -46 by 346. -23/173 18319 divided by -2617 -7 Calculate 72 divided by -660. -6/55 What is -245754 divided by -2997? 82 What is 154308 divided by 2? 77154 Calculate 22 divided by 6567. 2/597 What is -68359 divided by -7? 68359/7 What is 5 divided by 70683? 5/70683 What is 3434 divided by -39? -3434/39 Divide 3938176 by 6. 1969088/3 What is 25 divided by 2348? 25/2348 What is 3685 divided by 1? 3685 Calculate 42642 divided by 2369. 18 -20835 divided by -2315 9 Calculate -4 divided by -3442. 2/1721 Divide 158350 by -158350. -1 What is -4344 divided by -724? 6 Calculate 30827 divided by -23. -30827/23 What is 3 divided by 168423? 1/56141 4 divided by 63266 2/31633 Divide -3 by 8856. -1/2952 Divide -4 by -23938. 2/11969 Divide 4581 by -3. -1527 Divide -35917 by -5131. 7 Divide -762765 by 5. -152553 Calculate 5 divided by -98329. -5/98329 Calculate 53618 divided by -19. -2822 -709 divided by -386 709/386 Divide 56336 by -16. -3521 Divide 2843 by 15. 2843/15 What is 74960 divided by 74960? 1 371778 divided by 61963 6 Calculate 3 divided by 5446. 3/5446 Calculate -276605 divided by 2. -276605/2 Divide -22 by 4709. -22/4709 -89488 divided by -752 119 136356 divided by 33 4132 Divide 5 by -13444. -5/13444 112 divided by -55 -112/55 What is 23356 divided by 2? 11678 Divide 3 by 914862. 1/304954 Calculate 5175900 divided by 31950. 162 0 divided by -1825 0 Divide -101242 by -454. 223 What is 2710 divided by -220? -271/22 Divide 7 by 118025. 7/118025 What is 12 divided by -37976? -3/9494 Calculate -19073 divided by 2. -19073/2 -247095 divided by 82365 -3 -37728 divided by 12576 -3 84193 divided by -8 -84193/8 1 divided by 6351 1/6351 -21358 divided by -3 21358/3 Divide -3 by 107491. -3/107491 35695 divided by -7 -35695/7 32 divided by 66603 32/66603 4294 divided by -98 -2147/49 What is -218 divided by -1359? 218/1359 Calculate -878 divided by -150. 439/75 What is -241059 divided by -6181? 39 Divide 28678 by -5. -28678/5 What is 625833 divided by 16047? 39 Divide 663828 by -3531. -188 181320 divided by 4533 40 Divide 291917 by 291917. 1 Calculate -27104 divided by 6776. -4 What is 2337 divided by -4? -2337/4 Calculate -56512 divided by 64. -883 Calculate 92640 divided by 6. 15440 -362 divided by -11 362/11 Divide 0 by 11338. 0 Divide -488 by 153. -488/153 Calculate 95 divided by 472. 95/472 What is -132086 divided by -626? 211 -80446 divided by -146 551 Divide 57789 by -3. -19263 Divide -248604 by 2. -124302 Divide 586824 by -48902. -12 What is -12 divided by 128067? -4/42689 Calculate 13 divided by 273195. 1/21015 What is -627030 divided by -125406? 5 Divide -324856 by 2. -162428 Calculate -2 divided by 169774. -1/84887 7 divided by 3269 1/467 Calculate -78165 divided by -15633. 5 Calculate -2508 divided by -28. 627/7 Divide 474275 by -311. -1525 What is -10 divided by -108? 5/54 What is 1574244 divided by 224892? 7 3117 divided by 66 1039/22 Divide 208658 by -12274. -17 -16836 divided by -8418 2 Calculate -496752 divided by 3144. -158 10013 divided by 26 10013/26 32157 divided by 2 32157/2 Divide 21114 by 207. 102 What is 68922 divided by 126? 547 Divide 4032 by 1. 4032 Divide 235692 by -3. -78564 391 divided by 1234 391/1234 Calculate 2838 divided by 2. 1419 Calculate 28 divided by 22986. 14/11493 Calculate -9519 divided by 5. -9519/5 Divide 122932 by 2. 61466 5 divided by -216736 -5/216736 What is 3733940 divided by 5? 746788 Calculate -50316 divided by 32. -12579/8 Calculate 14006 divided by 64. 7003/32 What is 31390 divided by -6278? -5 Calculate -298089 divided by 6. -99363/2 What is 324876 divided by 54146? 6 Divide 33431 by -101. -331 0 divided by 13657 0 Divide 266220 by -17748. -15 Calculate -4343081 divided by -6. 4343081/6 Calculate 404320 divided by -133. -3040 -484909 divided by 1 -484909 What is 1554172 divided by -4? -388543 Divide 4 by 550757. 4/550757 -4384 divided by -3 4384/3 Divide -10092 by -18. 1682/3 Calculate 87080 divided by -1. -87080 -478214 divided by -22 21737 What is -1476090 divided by 45? -32802 What is 2419708 divided by 1? 2419708 17438 divided by -8 -8719/4 What is 43475 divided by 235? 185 What is 114943 divided by -3? -114943/3 Divide -11243 by 38. -11243/38 Calculate 301749 divided by 14369. 21 -10 divided by 316 -5/158 Calculate 6 divided by 1830. 1/305 What is 5 divided by 28748? 5/28748 What is 292400 divided by 136? 2150 What is 4430720 divided by 5? 886144 18 divided by 23517 2/2613 -1722 divided by 2 -861 Calculate -3 divided by -57966. 1/19322 What is -115472 divided by 1031? -112 177804 divided by -2694 -66 70782 divided by -282 -251 Divide -428571 by 481. -891 Calculate -65 divided by -19. 65/19 Calculate 1227663 divided by -27. -45469 What is -1189884 divided by -4? 297471 Calculate 209668 divided by 52417. 4 What is 21 divided by 1859? 21/1859 Divide -1 by -331323. 1/331323 -3 divided by 24181 -3/24181 What is -9504 divided by 864? -11 Calculate -1227717 divided by -1977. 621 Calculate -4492 divided by 898. -2246/449 Divide -645 by 645. -1 Calculate -434 divided by 46. -217/23 Divide -46238 by 122. -379 Divide 289570 by -5. -57914 What is -467480 divided by 1? -467480 What is 163250 divided by 10? 16325 Calculate -1031564 divided by -2. 515782 Divide -1116 by -12. 93 Divide -36984 by -6164. 6 What is 5 divided by 491626? 5/491626 What is -51564 divided by 6? -8594 What is 19568612 divided by -4? -4892153 478260 divided by -2 -239130 Calculate 356 divided by 6009. 356/6009 Divide -20 by 2952. -5/738 Calculate 54 divided by 4025. 54/4025 Divide 1051367 by 1051367. 1 What is 6 divided by 224127? 2/74709 What is 12813 divided by -4271? -3 Divide 10037208 by 6. 1672868 Calculate 689122 divided by -14. -49223 741528 divided by -82392 -9 Divide 244294 by -6. -122147/3 9474 divided by 6 1579 Calculate 26685 divided by -5337. -5 Calculate -725195 divided by 5. -145039 6298 divided by -13 -6298/13 Calculate -292996 divided by 4. -73249 -170 divided by 42 -85/21 Calculate -2132095 divided by -3. 2132095/3 -33 divided by -661 33/661 What is 6952 divided by -316? -22 -295386 divided by -6 49231 What is 894888 divided by 111861? 8 Divide 3 by 561231. 1/187077 -89 divided by 2823 -89/2823 7 divided by -3381 -1/483 What is -582 divided by 435? -194/145 -118 divided by 1194 -59/597 Divide 5329 by 91. 5329/91 Divide 60157 by 5. 60157/5 Divide -114960 by -1916. 60 Calculate 2 divided by -49988. -1/24994 -279965 divided by -95 2947 Calculate -81840 divided by -120. 682 668720 divided by -133744 -5 Divide 365430 by -121810. -3 -93 divided by -6130 93/6130 What is -439550 divided by -7450? 59 What is -805080 divided by 13418? -60 What is -1626599 divided by 5? -1626599/5 Calculate -244456 divided by 2. -122228 What is 161802 divided by 8989? 18 Calculate -131100 divided by 92. -1425 -1046412 divided by 5 -1046412/5 Calculate -76141 divided by -5857. 13 -42840 divided by -18 2380 What is -225248 divided	{ "pile_set_name": "DM Mathematics" }
t -3990v3 + 99741v*2/5 - 15951v - 36/5 = 0. -3/6650, 1, 4 What is x in -5x5 + 1655x*4 - 127715x*3 - 129375x*2 = 0? -1, 0, 125, 207 Suppose -2n*3 + 3894n*2 - 1928070n + 31661650 = 0. Calculate n. 17, 965 Suppose 4j2 - 66120j = 0. What is j? 0, 16530 Determine m, given that m4/4 + m3 - 13m2 - 28m + 96 = 0. -8, -4, 2, 6 Determine m, given that m*3 + 7976m*2 + 15912117m + 31792338 = 0. -3987, -2 Factor -36h3 + 3448h*2 - 2652h - 760. -4(h - 95)(h - 1)(9h + 2) Factor n*4/2 + 539n*3/2 + 13057n*2/2 + 106965n/2 + 145719. (n + 7)(n + 9)2(n + 514)/2 Suppose 3q4/7 + 342q*3/7 - 3789q*2/7 - 8592q/7 - 4464/7 = 0. What is q? -124, -1, 12 Factor -a*4/3 - 74a*3 + 1319a*2/3 + 504680a - 46512400/3. -(a - 44)*2(a + 155)*2/3 Determine n, given that 3n*2/4 - 147n/2 - 5865/4 = 0. -17, 115 Factor l*3/3 - 232l*2 - 14341l/3 + 5012. (l - 716)(l - 1)(l + 21)/3 Factor 2x3 + 380x*2 - 1562x - 1940. 2(x - 5)(x + 1)(x + 194) Determine v so that -9v*5/4 - 471v*4/4 + 441v*3/2 + 984v*2 + 648v = 0. -54, -4/3, -1, 0, 4 Find q, given that 2q5 - 620q*4 + 63008q*3 - 1987020q*2 - 11311650q - 9261000 = 0. -4, -1, 105 Find w such that -w*2/3 + 59w - 3542/3 = 0. 23, 154 Solve j*5/5 - 29296j*4/5 + 214710309j*3/5 - 428834898j2 = 0 for j. 0, 10, 14643 Factor -o2/5 + 1853o/5 - 3702/5. -(o - 1851)(o - 2)/5 Let -5b2 + 84300b - 355324500 = 0. What is b? 8430 Factor -3838w2/5 - 3842w/5 - 4/5. -2(w + 1)(1919w + 2)/5 Let 2y*2/3 - 1774y/3 - 1780 = 0. Calculate y. -3, 890 Factor -y*2/11 - 45319y/11 - 45318/11. -(y + 1)(y + 45318)/11 Factor -4r*3/7 - 25940r*2/7 + 14832r. -4r(r - 4)(r + 6489)/7 Factor -o3/4 + 91o*2/2 - 539o/4 + 179/2. -(o - 179)(o - 2)(o - 1)/4 Determine r, given that -2r5/5 - 20006r*4 - 250180030r*3 - 750420058r*2 - 750380048r - 1250600072/5 = 0. -25006, -1 Determine u, given that -2u5/15 - 4u*4/5 + 8u*3/3 + 12u*2 - 38u/15 - 56/5 = 0. -7, -3, -1, 1, 4 Let 5k5 + 12425k*4 = 0. What is k? -2485, 0 Solve -2k*2/13 - 200724k/13 - 5036265522/13 = 0. -50181 Factor -w*3/11 - 14w*2/11 - 53w/11 - 40/11. -(w + 1)(w + 5)(w + 8)/11 Suppose -5z2 + 61010z + 122040 = 0. What is z? -2, 12204 Factor -2p2 + 11558p. -2p(p - 5779) Suppose -2d5/3 + 15028d*4/15 - 5561044d*3/15 - 12799360d*2/3 - 69881698d/15 - 2292196/3 = 0. Calculate d. -10, -1, -1/5, 757 Solve -2y4/5 - 1579y*3/5 - 286149y*2/5 + 2055904y + 1042220 = 0. -410, -1/2, 31 Solve -i*2/2 + 4269i/2 + 17108 = 0. -8, 4277 Solve 5c4/6 - 745c*3/6 + 25465c*2/6 + 199045c/6 - 326095 = 0. -11, 6, 77 Factor -j*2/5 - 314j/5 + 30576/5. -(j - 78)(j + 392)/5 Solve 5r*5 + 52615r*4 - 30r*3 - 315650r*2 + 420905r - 157845 = 0 for r. -10523, -3, 1 Find q, given that -3q4/5 + 2853q*3/5 + 111561q*2 + 24372963q/5 - 50999922/5 = 0. -87, 2, 1123 Factor 2q3 + 7076q*2 - 8q - 28304. 2(q - 2)(q + 2)(q + 3538) Let u5 + 16u*4 - 39u*3 - 46u*2 + 140u - 72 = 0. What is u? -18, -2, 1, 2 Factor a*5/3 + 164a*4/3 + 6388a*3/3 - 9184a*2 + 9408a. a(a - 2)2(a + 84)*2/3 Solve -2b*5/11 - 126b*4/11 - 1612b*3/11 + 6552b*2/11 + 6480b/11 - 24192/11 = 0. -42, -24, -2, 2, 3 Determine i so that -2i2 + 254948i - 509888 = 0. 2, 127472 Find b such that -2b4/5 - 48b*3/5 + 134b*2/5 + 708b/5 - 1872/5 = 0. -26, -4, 3 Let -1878845k2 + 91950k - 1125 = 0. What is k? 15/613 Factor 3q4 - 486q*3 - 984q*2. 3q*2(q - 164)(q + 2) Factor -x3/3 - 128x*2 - 10349x/3 - 6390. -(x + 2)(x + 27)(x + 355)/3 What is m in -147m4/4 - 78981m*3/2 - 247959m*2/4 - 25755m - 3219 = 0? -1073, -1, -2/7 Factor 2o3/9 - 176o*2/9 + 3146o/9 - 5324/3. 2(o - 66)(o - 11)*2/9 Find c, given that 4c*3 + 52c*2 + 88c = 0. -11, -2, 0 Find o, given that o*3/4 - 127o*2/4 + 1195o/4 - 2925/4 = 0. 5, 117 Let -2q3/3 + 110q*2 - 11878q/3 - 4070 = 0. What is q? -1, 55, 111 Factor y*2/2 - 52334y - 314013/2. (y - 104671)(y + 3)/2 Factor -5r*3 + 6155r*2 + 247110r + 685800. -5(r - 1270)(r + 3)(r + 36) Factor 3v*4/5 + 16v*3/5 - 283v*2/5 - 296v/5. v(v - 8)(v + 1)(3v + 37)/5 Determine k, given that k*4/4 + 234k*3 + 65985k*2/2 + 1674164k + 115677429/4 = 0. -777, -53 Factor 2i3 - 128924i*2 + 257842i - 128920. 2(i - 64460)(i - 1)*2 What is m in -34m*4 - 23770m*3 - 50226m*2 - 29278m - 2788 = 0? -697, -1, -2/17 Solve -u*3/4 + 19u*2 - 201u/4 - 657/2 = 0. -3, 6, 73 Determine p, given that 2p3/3 - 41100p*2 + 369874p/3 + 164392 = 0. -1, 4, 61647 Factor 2n2 + 92n - 19344. 2(n - 78)(n + 124) Factor -3n3 + 194058n*2 - 388107n + 194052. -3(n - 64684)(n - 1)*2 Find c such that 3c*4 + 2256c*3 + 4503c*2 + 2250c = 0. -750, -1, 0 Determine l so that -3l2 + 3687l - 43812 = 0. 12, 1217 Factor -4t2 - 21600t - 21596. -4(t + 1)(t + 5399) Solve -5u4 + 175u*3 + 105u*2 - 3775u + 3500 = 0. -5, 1, 4, 35 Factor 3z3 - 292785z*2 + 292782z. 3z(z - 97594)(z - 1) Determine a so that 3a*2 - 280584a + 6560615088 = 0. 46764 Factor -3d2 - 1353072d - 152566986432. -3(d + 225512)2 Determine v so that -3v*2/7 - 705v/7 + 6588/7 = 0. -244, 9 Factor 3o3 - 732o*2 + 4311o - 6426. 3(o - 238)(o - 3)*2 Suppose -4a*3 - 88a*2 + 1488a - 4896 = 0. What is a? -34, 6 Factor 2j2 + 8618j - 25872. 2(j - 3)(j + 4312) Let 25j4 - 445j*3 + 1835j*2 + 385j = 0. Calculate j. -1/5, 0, 7, 11 Factor 29160555843l2 - 591546l + 3. 3(98591l - 1)*2 Determine d, given that 10d*3 + 50765d*2 - 177820d - 101600 = 0. -5080, -1/2, 4 Factor z*4 - 1738z*3 - 5412z*2 + 329882z - 1450253. (z - 1741)(z - 7)2(z + 17) Solve m*3/6 + 22m*2/3 + 262m/3 + 440/3 = 0. -22, -20, -2 Factor 15a3 + 318940a*2 + 1695485035a + 1130181610. 5(a + 10631)2(3a + 2) Solve -3z*2 + 336z - 6336 = 0 for z. 24, 88 Let -9b5/2 - 789b*4/2 - 19867b*3/2 - 114211b*2/2 - 121484b - 87846 = 0. What is b? -121/3, -3, -2 Factor 5l2 + 35405l - 248080. 5(l - 7)(l + 7088) Factor -3l2 + 153l + 4260. -3(l - 71)(l + 20) Solve -z*3/8 - 8133z*2/8 - 4065z/4 + 2033 = 0. -8132, -2, 1 Factor -3p3 - 420p*2 - 381p + 5004. -3(p - 3)(p + 4)(p + 139) Solve 4u*2/5 + 7244u/5 - 7248/5 = 0 for u. -1812, 1 Let -3t2/4 + 62259t/4 - 466605/2 = 0. Calculate t. 15, 20738 Factor -z*4 + 72z*3 - 1296z*2 + 6912z. -z(z - 48)(z - 12)*2 Solve -4a*4 - 680a*3 - 26388a*2 + 249920a + 2818816 = 0 for a. -88, -7, 13 Determine d so that -d*5/2 + 69d*4/2 + 635d*3/2 - 1473d*2/2 + 385d = 0. -10, 0, 1, 77 Factor 4o2 - 738912o + 34124433984. 4(o - 92364)2 Solve -3s*5 - 153s*4 - 111s*3 + 16065s*2 + 31866s + 15840 = 0 for s. -48, -11, -1, 10 Let 3x2/7 - 746958x/7 + 46495521147/7 = 0. Calculate x. 124493 Let 4l5 - 5924l*4 + 35420l*3 - 29500l*2 = 0. Calculate l. 0, 1, 5, 1475 Let -76t*3 - 4648t*2 + 8756t - 4032 = 0. What is t? -63, 16/19, 1 Factor -2j2/13 - 548j/13 + 5094/13. -2(j - 9)(j + 283)/13 Find u such that -u*2/5 - 780287u/5 - 780286/5 = 0. -780286, -1 Factor -62j4/5 - 272j*3/5 - 344j*2/5 - 96j/5. -2j(j + 2)*2(31j + 12)/5 Suppose -q2/2 - 5141q/2 + 2571 = 0. Calculate q. -5142, 1 What is c in -2c3/9 + 76c*2/9 + 158c/9 + 80/9 = 0? -1, 40 Factor -c*2/3 + 1224c - 21924. -(c - 3654)(c - 18)/3 Determine t so that -2t*3/5 + 66234t*2/5 + 529968t/5 + 212000 = 0. -4, 33125 Solve 9k5/8 + 165k*4/4 + 189k*3/4 - 639k*2 + 1245k/8 + 1575/4 = 0. -35, -5, -2/3, 1, 3 Solve -20z4 - 4336z*3 + 14068z*2 - 2640z = 0 for z. -220, 0, 1/5, 3 Suppose -2j2/17 + 92824j/17 - 1077036872/17 = 0. What is j? 23206 Factor 15a3/2 + 395a*2 - 5575a/2 + 885. 5(a - 6)(a + 59)(3a - 1)/2 Suppose -3369044x2 - 3369048x - 4 = 0. What is x? -1, -1/842261 Suppose 2s3 + 946s*2 - 22890s - 38708298 = 0. What is s? -327, 181 Determine o so that -3o3/4 - 1323o*2/4 + 28386o - 559911 = 0. -517, 38 Find h, given that -4h2 + 163160h + 2448300 = 0. -15, 40805 Factor c*4/6 + 63c*3/2 + 5620c*2/3 + 28704c - 366336. (c - 8)(c + 53)(c + 72)2/6 Factor u4 - 28	{ "pile_set_name": "DM Mathematics" }
-j = 5d + g - 11, 5d + 23 = -3g for d. -4 Let k = -4420 - -4422. Solve 26i = -3a + 29i - 15, -ki = 0 for a. -5 Suppose -2p + p + 1 = -3u, 0 = u - p + 5. Let t = 12 + -8. Let v = t - 0. Solve -3c - k = c - 4, -uc = -vk - 2 for c. 1 Let d(z) = -z. Let f(h) = -2h + 35. Let i(b) = 15d(b) - 5f(b). Let k be i(-38). Solve r + 3u + k = 0, 3u + 0 = -2r - 15 for r. 0 Let x(d) = 19d + 820. Let z be x(-43). Solve v - 2v = h - z, 4v - 5h + 6 = 0 for v. 1 Let m be 47/9 + 12(-12)/648. Solve u - 3y - 3y = 22, 0 = -2u + my + 23 for u. 4 Suppose -2m - 2m + 16 = 2a, -6 = 5m - 4a. Suppose 0 = 2j - 225 + 99. Let c = j + -59. Solve 4p - 5g + 0 = c, m = 2p + 4g for p. 1 Let k(y) = -y2 - 18y + 76. Let v be k(-21). Suppose 3o + vo = 0. Suppose -40w + 43w - 6 = o. Solve -c - 2z - w = -4, 2c - 6 = -2z for c. 4 Let t = 97 - 103. Let k be (1/(t/(-9)))/(1/(-4)). Let a(w) = -7w - 37. Let b be a(k). Solve 16 = 4h, -27 - b = -4f - 5h for f. 3 Let m be (-4 + 5)(10 + -3 + -12 + 6). Solve b + b - m = 5l, 0 = 4l - 5b + 11 for l. 1 Let j be ((-16)/(-10))/(7/(-35)). Suppose 0 = -6c + 19 + 41. Let r = j + c. Solve 0 = t - 2v + 4, -rv = -5t - 0v + 4 for t. 2 Suppose 2k - 1389 = -5i, -2k + 318 = 3i - 1073. Suppose -23z - k = -64z. Solve 5q + 4c = z, q + 3c = 5q - 26 for q. 5 Let v(g) = g*3 - 19g*2 + 33g + 21. Let s be v(17). Solve -4j - 5d + 5 = -5j, sj - 26 = -3d for j. 5 Suppose 0 = -1571t + 1623t. Solve -3u + 4i + 3 = 1, t = 4u + 5i - 13 for u. 2 Suppose -13 = -i + o, -5i + 4i - 2 = 4o. Suppose -iz + 116 = 19z. Solve 7m + z = 2m - 2a, 4m - 4 = -4a for m. -2 Suppose 3h - 4t = -3067, 3071 = -3h - 41t + 43t. Let v = h - -1029. Solve -12 = -2g - 5s, -2g + 0g = -vs + 6 for g. 1 Let g(b) = b3 + 15b*2 - 35b - 12. Let j be g(-17). Suppose 4s - 3z = 27, 0 = 2s - js - z + 4. Solve 0 = o - 5q + 17, -q + 7 = -5o + so for o. -2 Suppose 0 = v + 3w - 5w + 4, -w + 4 = 0. Suppose 70 = -vq + 18q. Solve -2o + n = qn - 8, -5o = 4n - 20 for o. 4 Let c(m) = 6m - 62. Let r be c(10). Let q = r - -4. Solve 4x - 11 = -qi + x, -3i - 2x + 4 = 0 for i. -2 Suppose v - 3r = 26, 4v - r - 48 - 1 = 0. Suppose -5 = -vy + 39. Suppose -2z + z + 2 = 0. Solve zm + 4 = 0, ya = 2a - 3m for a. 3 Suppose -3i - 8y - 18 = 0, 5y + 5 = -20i + 15i. Solve -2 = -2g - o - 4, -4o - 14 = ig for g. 1 Let t(i) = i*3 + 6i*2 + 4. Let d be t(-6). Suppose 6r - 48 = 2r. Suppose 2x - 2f - r = 0, 26 - d = 4x - 3f. Solve xv - 3 = z, 0z = 3z + v + 9 for z. -3 Let x = -361 + 373. Solve 0 = -3i + x, 2i = -2b - 17 + 35 for b. 5 Let q = -25 + 217. Let v be 4/(-12) + 0 + q/9. Solve 0 = -3y + y - 2o + 6, 5y = o + v for y. 4 Suppose -4y - l = 1, 79 = -y + 4l + 83. Solve -4d + yd + 3g + 1 = 0, 2d - 2g + 2 = 0 for d. 4 Let l(v) = -v2 - 19v*3 + 11v*3 + 23 + 11 - 17v + 9v3. Let w be l(4). Solve g + 4b = -16, -3b = -5g - b - w for g. -4 Suppose t = 5q + 57, -2t + 7t - 265 = 5q. Suppose -23w + 27w - t = 0. Suppose -wj + 9j = 0. Solve 4m + 5 = -3h, -m - 4m + 5 = j for h. -3 Let s = -96 - -98. Suppose 0t - 6 = -st. Let c = 47 + -18. Solve -c = -4l + ty, 0l + y = -4l + 17 for l. 5 Let z be 11 + (-130)/13 - 353/1. Let j = 362 + z. Solve q = 2k - 8, -2k + j = q - 3q for q. -2 Suppose 14l = 22l + 16. Let u be -2 + (-5)/l + 129/6. Suppose 0 = 18t - ut + 40. Solve -3p + 23 = 4w, -3p + t = -3w + 1 for w. 2 Let o(c) = 378c - 9448. Let n be o(25). Solve -5g + y = 8, -ny = g - 46 + 52 for g. -2 Let g = 36 - 60. Let b = 2 + g. Let v = -22 - b. Solve 2u - 6 = -4x, v = x + 3u + 1 for x. 2 Let k(q) = -q*3 + 13q*2 - 105q + 940. Let i be k(11). Solve -5w = 3n + 40, -3w = 3n + i + 3 for w. -5 Let j(u) = 92u - 518. Let q be j(6). Solve -2x - 1 = -b, q = -5b + 9 for x. -3 Suppose 0 = -10k + 4931 - 4901. Solve 5g = -s + 24, ks = 13 - 1 for g. 4 Let h(d) = d*2 + 2d - 18. Let b be h(4). Let z(i) = 4i - 21. Let y be z(b). Let q be 0/((-1 - -1) + -2 + y). Solve 3g = 3u + 12, 2g = -2u - qg for u. -2 Let b = 128 - 131. Let p be 545/(-45)b + 4/(-3). Suppose 8 = 2o - 0. Solve -33 = od - q - 4q, -5q + p = -5d for d. -2 Let k(r) = -10r - 5 - r2 + 0 - 7. Let s be k(-6). Solve -4q + 10 = -2h, 4q - 1 - s = -h for h. 1 Suppose -h = 2, 5b = 2h + 2h + 28. Let n be (b/(-4))/(-1) + 2. Suppose -4c = -o + 3o, 2c + no = -8. Solve 0 = -4j + cf + 6, 3f = -j + 6j - 10 for j. -1 Let m = -117 + 123. Let c(i) be the first derivative of -3i*2/2 + 21i + 4. Let k be c(m). Solve -5 = l - 4x, k = 5l + 4x + 28 for l. -5 Suppose 0m = 5m - 10, -2h = -4m. Let n(u) = -2u*3 - 9u*2 - 2u - 3. Let t be n(-5). Solve l + 5y + 33 = -l, hy = -3l - t for l. -4 Suppose 3d + 20 - 65 = 0. Suppose -173 = -11s + 3. Let o be 52/s - d/(-20). Solve 3g = 3, 4a - og - g + 9 = 0 for a. -1 Let m be (6/(-4))/((-3)/(-8)). Let c be m/(-10) - 189/(-15). Let l be (6/(-7))/((-42)/196). Solve 5w = -20, -d - 3w = ld - c for d. 5 Let p = 310 - 403. Let u = p - -95. Solve u = -2x, 2y - 4x - 13 = 5y for y. -3 Suppose 56l - 4g = 59l - 127, -2l - 5g + 94 = 0. Solve -4p - l = -5f, 8 = 2f - 2 for p. -3 Let q = -58 + 110. Let k be (-9)/(-2)q/78. Solve -4g - 8 = kf, 3g = g + 4f - 26 for g. -5 Let r = 230 + 80. Let m be (1 + (-33)/55)/(4/r). Solve -3c + y - 17 = -0c, -5c - m = -3y for c. -5 Suppose 3b = -2g + 42, -3g - 51 = -4b - b. Suppose -7l + bl - 30 = 0. Suppose l = -10s + 206. Solve -5c - s = 3a, 4a + c + 8 = -c for a. 0 Let j(u) = 25u + 1329. Let t be j(-53). Solve p + 8 = -4w - 2p, -tw - 4p = 8 for w. -2 Suppose 5v = 5k - 45, -820 = 4k + v - 811. Solve 127h + 2 = 125h, -r - h - 6 = k for r. -5 Let x be (-4 + (-22)/(-4))6. Let j(w) = w2 + 32w + 254. Let y be j(-18). Solve x = -5c - a - y, 2c = 3a - 18 for c. -3 Let a(m) = m3 + 5m*2 + 5m + 4. Let w be a(0). Solve -2g = wr - 6, -5r + 4 - 1 = -2g for r. 1 Let m(n) = 21n - 10. Let p be m(1). Suppose 0 = 4t + 8, 0 = q - t + p - 21. Solve 0 = -x - 4c + 12, -4x - 2c = -qx - 6 for x. 0 Let g(c) = c*2 - 5c - 1324. Let q be g(39). Solve -qp + 18 = -2k, 4p = -3k + 14 - 13 for k. -5 Let j(y) = -y*3 - 13y*2 - 35y + 27. Let m be j(-5). Solve 0 = -2h - 4u - 18, 13h - 17h + mu - 16 = 0 for h. -5 Let b be (-138787)/(-7733) - (-1)/19. Suppose -10 = -j - 0s + 2s, j = -s - 2. Solve -5p + b = 4o - 11, 0 = jp - o - 9 for p. 5 Suppose 0 = 17g - 8g - 1935. Let b = 219 - g. Solve bc = 3d - 7, -c = -5d + c - 7 for d. -3 Let b(o) = o3 + 6o*2 + 29o + 84. Let u be b(-4). Solve u = h - 5, h + 4 = 3k - 6 for k. 5 Let m be (-1)/3 + 5124/(-18). Let x = -280 - m. Solve 3b = xu + 4 - 20, -4b + 4u = 16 for b. -2 Let w be (668/20 - 5)5/2. Suppose 10q - w = -11. Solve 3 + 1 = -3f - c, 2f - c + q = 0 for f. -2 Let b be 13 + (-596 - -593 - (2/(-2) - 8)). Solve -t = -2g - 14 + b, 11 = -t + 4g for t. 1 Let v = 193 - 248. Let d be (-10)/v + (-786)/(-33). Solve k - 2k + d = 5w, 20 = 5w for k. 4 Let m(v) = -191v - 2098. Let o be m(-11). Solve 3p - 2w = -3, -2p + ow = 3p + 5 for p. -1 Let i be (5/(-4))/((5 + -8)/12). Solve 0 = 6h - h + 20, -3s + i = h for s. 3 Let s(f) = -f*2 - 31f - 104. Let c be s(-27). Suppose o = -3j + 7, o + 0o = -cj + 6. Solve -3t + 2z - 2 = -o, -t + 4 = -z for t. 0 Let l(h) = -29h*3 - 9h*2 + 53h*3 - 25h*3 - 17h + 7. Let i be l(-6). Solve -9 = -5u + g, u - 6u - g = -i for u. 1 Let y be (-52030)/(-198) + ((-2)/(-9))/1. Suppose 2w + y = 143. Let x = w - -74. Solve 6o - 5c + x = 2o, -c = -2o - 4 for o. -1 Let c(y) = -540y - 535. Let b be c(-1). Solve -4 = -k, -8s + bs + 4k - 19 = 0 for s. -1 Let s = 34 - 37. Let b be (60/(-16) - s)-4. Suppose -i - 5q = -bi + 10, 5i - q = 25. Solve 5u = -5t - 15, -3u + u = t + i for t. -1 Let t(i) = -20i3 - i2 + 6i - 8. Let a be t(2). Let u = a - -164. Solve 2j - u = 6j - 4r, 2j - 22 = -4r for j. 3 Suppose -21m + 19m + 4 = -w, 2 = m - 4w. Solve -a + 1 = -2t - 0a, t = -ma + 12 for t. 2 Let t(v) = v + 13. Let z be t(-9). Let q be (-3255)/(-45) - (4/(-6) + 1). Let g = q - 69. Solve 2a = o, -ga + 2 = -zo + 12 for a. 2 Let r be (35 - (-111	{ "pile_set_name": "DM Mathematics" }
a*2 + 3a + 4. Is w(-4) a multiple of 3? False Let c(v) = -v. Let b(m) = -4m + 30. Let r(u) = b(u) - 3c(u). Is r(0) a multiple of 10? True Let h(q) = -2q3 + 9q*2 - 45 + 51 - 11q + 3q3. Is 4 a factor of h(-10)? True Let f(c) be the first derivative of -3/2c*2 - 4c + 1/3c3 - 4. Is f(7) a multiple of 12? True Let h = 1 + 6. Suppose 23 = 5l - h. Is l a multiple of 2? True Let j = 18 + -20. Let y = 0 - -5. Let d = y - j. Is 4 a factor of d? False Let a = -100 - -145. Does 9 divide a? True Suppose 0 = 2c - 6c + 64. Let g = -4 + c. Is 12 a factor of g? True Suppose 3b - 2j - 14 - 14 = 0, 24 = 4b + 4j. Let r(i) = -i*2 + 12i - 20. Does 12 divide r(b)? True Let k(s) = -10s - 13. Is 5 a factor of k(-5)? False Let p = 47 - 27. Suppose -2v = 5r - 7v - p, -5v = -3r + 14. Let j = 7 - r. Is 2 a factor of j? True Let a(l) = -10l + 4. Let j be a(7). Let v = j - -109. Does 17 divide v? False Let n = -265 + 535. Suppose n = 8p - 3p. Is 20 a factor of p? False Suppose -2x = x - 624. Is 13 a factor of x? True Let t be ((-18)/(-5))/((-3)/(-1000)). Suppose -2a - t = 3a - 5q, -3q + 958 = -4a. Is 5 a factor of a/(-22) + 8/44? False Let r(f) = f2 - 6f + 6. Let p(u) = -4u + 1. Let b be p(-1). Let h be r(b). Suppose 0 = -3a + h + 8. Is a a multiple of 3? True Suppose d - 10 = -4d. Suppose o + 72 = 2u - 2o, 5u + do = 218. Does 15 divide u? False Let x = 29 - 20. Suppose -10 = -2i, n + 5i = x + 24. Does 8 divide n? True Let c(x) = 3x + 5. Let q be c(6). Let j = q - 3. Is 20 a factor of j? True Let q = 2 - 0. Suppose -qh + y - 7 + 4 = 0, -y = -5h. Suppose -4v = -7 - h. Is v a multiple of 2? True Let v = -43 - -150. Suppose 5w - 30 = -q, -2w - v = -3q - 0w. Suppose -q - 29 = -4a. Does 16 divide a? True Let a(v) = 2v2 + 9v - 18. Let m(g) = g*2 + 4g - 9. Let w(c) = -4a(c) + 9m(c). Let x be (2 + -1 - -6) + 0. Is w(x) a multiple of 14? False Let g(y) = 3y - 23. Does 6 divide g(11)? False Suppose 0 = 5g - 2p - 56, 2g = -3g + p + 58. Is 8 a factor of g + (-9)/31? False Suppose -q = 5z - 241, -3z + 5q + 145 = 6. Is z a multiple of 16? True Is 2 a factor of 6/14 - 875/(-245)? True Let p(b) = 3b2 + b - 9. Let y(o) = -o2 + o. Let f(u) = -p(u) - 4y(u). Is f(6) a multiple of 11? False Let h be ((-1)/(-3))/(4/12). Let p = h - -9. Let c(l) = -l3 + 10l*2 + l + 8. Is 9 a factor of c(p)? True Suppose 0w - 3w - 45 = -3o, -5w - 35 = 3o. Is 10 a factor of (-9)/((-9)/w)-2? True Let j(y) = 4y*2 + 2y - 2. Does 14 divide j(-3)? True Let q = -14 - -8. Let y(w) be the first derivative of -w*2 - 6w - 3. Is 3 a factor of y(q)? True Suppose -i + 2i = 2s - 82, 0 = -3s - 4i + 123. Does 5 divide s? False Is 12/54 + ((-5178)/(-27) - -3) a multiple of 9? False Let y(j) = -4j + 7. Let z(f) = -4f + 7. Let q(u) = -5y(u) + 4z(u). Is q(10) a multiple of 11? True Let m = 21 + 30. Does 17 divide m? True Suppose 2z - 130 = -3z. Is 7 a factor of z? False Suppose 2y - 39 - 25 = 0. Is y a multiple of 16? True Let f(l) be the third derivative of 1/6l*3 - 1/12l4 + l2 + 3/20l5 + 0 + 0l. Does 4 divide f(1)? True Let a(l) = -l - 1. Let x be a(-6). Suppose 3h - 8 = xg + 17, h - 12 = -2g. Does 6 divide h? False Is 36/16(-1 + (-163)/(-3)) a multiple of 12? True Let g be (-642)/36 - 2/12. Let b = -10 - g. Is b a multiple of 3? False Is (44 + -1)/(14 + -13) a multiple of 5? False Let y(z) = -6z2 + z + 3z2 - z3 + 10 - 5z2. Let j be y(-8). Suppose -23 - 15 = -jb. Is 19 a factor of b? True Let g = -10 + 14. Is 18/g(2 - 0) a multiple of 5? False Let v(h) = -h3 - 7h*2 - 4h - 2. Let i be ((-14)/6)/((-2)/(-6)). Does 9 divide v(i)? False Let n = 11 + -6. Suppose -v + 57 = nl, -5l + v = -4v - 45. Is 11 a factor of l? True Let d(m) = -m3 + 6m*2 + 7m + 1. Let c be d(7). Suppose r - 6 - c = 0. Is 3 a factor of r? False Let i be 1/((-1)/3) + 9. Let v(w) = w*3 - 5w*2 + w - 1. Is v(i) a multiple of 12? False Suppose -3z + 8j = 4j - 817, -2j = -5z + 1357. Let g = z - 183. Suppose n - 66 = -3c - 3n, -4n - g = -4c. Is c a multiple of 11? True Is (-82)/(-4)6 + 17/17 a multiple of 31? True Suppose 65 = 5x - 5f, 2f = 5x - 5 - 48. Suppose -3q = -6 - x. Is q a multiple of 5? True Does 22 divide (-880)/6(-1 - 5/25)? True Suppose -3x - 2x - 15 = 0. Let t(j) = 20j*2 - j. Let m be t(x). Suppose -4w + 177 = -5g + 28, m = 5w - 3g. Is 12 a factor of w? True Suppose -1 + 6 = x. Suppose 0a = xa - s - 189, -110 = -3a + 4s. Is a a multiple of 11? False Let q be -11215/(-10). Suppose 3f = -3r + q, -2f = f - 9. Let j(p) = 3p. Does 7 divide j(r)? False Let t be (0 - -65)(1 - 2). Let s = -5 - -8. Does 8 divide (1 - t)/s - -1? False Suppose -3c + 50 = 2c. Is c-2(-3)/12 a multiple of 5? True Let y = -50 + 121. Is 18 a factor of y? False Let w(z) = -z*2 + 9z - 9. Let s be w(6). Is 43/s - (-4)/18 a multiple of 2? False Let q = 5 + -1. Suppose -r + n - 1 = 1, 5n + 17 = -qr. Is (0 + r)(-32)/12 a multiple of 8? True Let c = 82 + -53. Suppose c = 2i + 1. Does 7 divide i? True Suppose 4n - 8 = 0, 2u = -2n - 3n + 4. Let t(v) = -2v. Let z be t(u). Is 6 a factor of z + 1 + 1 + -2? True Suppose 3h = -2y + 194, -2h + 96 = y - 0h. Does 5 divide y? True Suppose 0i - i = -62. Suppose 2m = n + i, -4m + 126 = -n - 2n. Does 17 divide m? False Let j(m) = -m2 - 3m + 2. Let o be j(-3). Suppose -20 = -4s, 4s = -z - 0 + 17. Is 22 a factor of o/(-2 - z)22? True Let g(b) = -b2 + 6b + 5. Let s = 9 - 3. Is g(s) a multiple of 3? False Let q(y) = -y - 1 - 3y + 4y*3 + 5y + 3. Does 7 divide q(2)? False Let p = -23 + 30. Does 7 divide p? True Let s be 6/27 - 922/18. Let v = 86 + s. Suppose -4a - 3 = -v. Is 4 a factor of a? True Let m(c) = c - 7. Let s be m(3). Let b(n) = -19n - 9. Is b(s) a multiple of 15? False Let k(h) = -h*2 + 2. Let o be k(2). Does 11 divide (-20)/o + 1/1? True Let q(i) = -3i*3 + 2i*2 + 5i + 1. Let t(d) = -16d3 + 9d*2 + 26d + 5. Let c(b) = 11q(b) - 2t(b). Let r be (-60)/27 - (-2)/9. Does 17 divide c(r)? False Let f(c) be the second derivative of -2c3 - 2c. Let r = -1 + -1. Is 10 a factor of f(r)? False Let l be -3 + (3 - (-4)/(-2)). Let n be 12/54 + l/9. Suppose h - 5 - 1 = n. Is h a multiple of 6? True Let n(z) = -z*3 + 3z + 70. Is 5 a factor of n(0)? True Suppose -6y + y + 25 = 0. Is y a multiple of 5? True Suppose -v + 3b = 14, -34 = 4v - 3b + 4. Does 13 divide -4(68/v - -2)? True Let x be (3/(-3))/(2/10). Let w(h) = -7h - 3h2 - 2h*2 + 6 + 4h2. Is 16 a factor of w(x)? True Let t be (-6)/3 + -1 - -14. Let l(z) = -z2 + 13z + 10. Is 18 a factor of l(t)? False Let c = 9 + -9. Does 19 divide (-5 - -2 - c)-19? True Suppose 0k - 4k = m - 44, 0 = 2m + k - 53. Is 8 a factor of m? True Suppose 0 = 5f - 2o - 460, -f + 104 = -0f + 2o. Does 30 divide f? False Let l = 9 - -44. Does 3 divide l? False Suppose 3r + 45 = 3v, 5r = -0v - 4v + 33. Let x = -4 + v. Is 8 a factor of x? True Suppose 2m + 2m = 44. Let o = m - -22. Does 12 divide o? False Is -80(2 - 3)1 a multiple of 6? False Let v be (-1 - 0)/(1/25). Let i = 57 + v. Does 11 divide i? False Suppose -280 = -4b + 5h, -7h = 2b - 3h - 140. Does 7 divide b? True Let g(i) = 6i - 4. Let n be g(6). Does 10 divide (-2)/(-2) - (-1 - n)? False Does 2 divide (-32)/(-18) - (-16)/72? True Let j = 12 - 8. Suppose 174 = ji - c + 18, 0 = -3c - 12. Suppose 0 = q + q - i. Is 19 a factor of q? True Let n = -70 + 112. Is 14 a factor of n? True Suppose 0 = 4q - 8. Suppose 2o - 120 = -qo. Does 10 divide o? True Let o = 78 + 11. Does 25 divide o? False Let t(a) = -a3 - 5a*2 - 5a + 1. Let b be t(-4). Suppose -5u = -0u - c - 226, -bu - 5c + 250 = 0. Is 23 a factor of u? True Suppose -490 = -2q - 3q. Suppose -z = z - q. Does 19 divide z? False Let t(r) be the third derivative of -r*4/24 + 2r*3/3 + 4r*2. Let n be t(-6). Suppose 0 = ng - 7g - 42. Is 14 a factor of g? True Suppose -4n = 5m - 32, -m + 4m = -2n + 18. Let c(p) = p2 - 2p - 1. Let v be c(n). Does 15 divide v/(-4) - (-62)/4? True Suppose 2f + 3f = -2c + 115, -5f - 3c + 120 = 0. Does 7 divide f? True Suppose 3p = -2p - 20, 0 = 4k - 4p + 4. Let b(z) = 3z*2 + 6z - 5. Let y be b(	{ "pile_set_name": "DM Mathematics" }
324r2 - 690r + 8 = 0. Calculate r. -1, 4/337, 1/3 Let 5w5 - 40w*4 + 75w*3 + 40w*2 - 80w = 0. What is w? -1, 0, 1, 4 Factor 5y3 + 45y*2 - 125y - 165. 5(y - 3)(y + 1)(y + 11) What is n in 2n*5/3 - 86n*4/9 - 22n*3/3 + 86n*2/9 + 20n/3 = 0? -1, -2/3, 0, 1, 15 Let 3s2 + 3156s + 830028 = 0. What is s? -526 Factor w*2/2 - 34w + 67/2. (w - 67)(w - 1)/2 Solve 250g*4 - 50g*3 - 630g*2 - 486g - 108 = 0 for g. -3/5, 2 Factor 3m5 + 6m*4 - 12m*3 - 24m*2. 3m*2(m - 2)(m + 2)2 Suppose 4u*4 - 552u*3 + 24816u*2 - 335768u - 1245876 = 0. Calculate u. -3, 47 Solve t*5/5 - 18t*4/5 + 97t*3/5 - 144t*2/5 + 64t/5 = 0. 0, 1, 8 Factor 8t2 + 1724t - 4360. 4(t + 218)(2t - 5) Factor -3m*5/2 + 15m*4/2 - 12m*3 + 6m*2. -3m*2(m - 2)*2(m - 1)/2 Factor -2y2/9 - 80y/9 - 26/3. -2(y + 1)(y + 39)/9 Factor -4n3 + 8n*2 + 76n - 80. -4(n - 5)(n - 1)(n + 4) Find v such that -v5/4 - v4/4 + 27v*3/4 - 27v*2/4 - 27v/2 = 0. -6, -1, 0, 3 Determine c so that 5c4 = 0. 0 Find d such that 2d*5/3 - 8d*4/3 - 14d*3/3 + 20d*2/3 = 0. -2, 0, 1, 5 Factor 2a*2/9 + 1160a/9 + 168200/9. 2(a + 290)2/9 What is i in -3i*5 + 45i*4 + 162i*3 - 3846i*2 + 5841i + 9801 = 0? -9, -1, 3, 11 Determine x, given that -3x3 - 852x*2 - 849x = 0. -283, -1, 0 Find y, given that 13y5 - 236y*4 + 1453y*3 - 3494y*2 + 3052y - 392 = 0. 2/13, 2, 7 Determine x so that x5/6 - x4/6 - x3/6 + x2/6 = 0. -1, 0, 1 Determine k, given that 22k4 - 128k*3 + 42k*2 + 232k + 40 = 0. -1, -2/11, 2, 5 Factor 4b2/5 + 1432b/5 + 128164/5. 4(b + 179)2/5 Factor -2c*3 + 436c*2 - 24192c + 46656. -2(c - 108)2(c - 2) Determine h, given that 2h2/11 + 392h/11 + 3720/11 = 0. -186, -10 Let -5f5/3 - 20f*4 - 45f*3 + 180f*2 + 540f = 0. Calculate f. -6, -3, 0, 3 Solve -3l4/5 - 34l*3/5 - 3l*2/5 + 84l/5 - 44/5 = 0. -11, -2, 2/3, 1 Find a such that -9a5 + 12a*4 - 3a*3 = 0. 0, 1/3, 1 Let -3b*4/5 + 9b*3 - 87b*2/5 - 621b/5 - 486/5 = 0. Calculate b. -2, -1, 9 Find s, given that 5s4/3 - 25s*3/3 + 40s*2/3 - 20s/3 = 0. 0, 1, 2 Find d such that -3d5 - 21d*4 + 63d*3 + 81d*2 = 0. -9, -1, 0, 3 Suppose 18f*3 - 22f*2 - 32f + 8 = 0. What is f? -1, 2/9, 2 Factor 2b3/7 - 8b*2/7 - 22b/7 - 12/7. 2(b - 6)(b + 1)2/7 What is d in d4 - 2d3 = 0? 0, 2 Suppose -3z*3/7 + 6z*2 - 153z/7 + 162/7 = 0. What is z? 2, 3, 9 Solve -7c2/6 + 41c/3 + 4 = 0 for c. -2/7, 12 Solve 2t2/15 - 6t/5 + 8/3 = 0. 4, 5 Suppose k*4 - 3k*3 - 2k*2 + 12k - 8 = 0. What is k? -2, 1, 2 Factor -m4/5 + m3 + 33m2/5 + 27m/5. -m(m - 9)(m + 1)(m + 3)/5 Find f, given that -22f*3 - 14f*2 + 8f = 0. -1, 0, 4/11 Factor -a*3/6 + 15a*2/2 - 7a - 44/3. -(a - 44)(a - 2)(a + 1)/6 Determine u, given that 2u3/7 - 18u*2/7 + 40u/7 - 24/7 = 0. 1, 2, 6 Factor -l*3/6 - 85l2/3. -l2(l + 170)/6 What is l in -45l*2 - 70l = 0? -14/9, 0 Solve -14r3 + 130r*2 - 36r = 0. 0, 2/7, 9 What is i in 22i3/9 - 2668i*2/3 - 1054i - 1460/9 = 0? -1, -2/11, 365 Factor c*2/9 - 3190c/9 + 2544025/9. (c - 1595)*2/9 Solve -4v*5 - 1288v*4 - 104964v*3 - 206080v*2 - 102400v = 0. -160, -1, 0 Determine s, given that -s*4 - 35s*3 - 396s*2 - 1296s + 1728 = 0. -12, 1 Find q such that -q*3 + 14q*2 - 43q + 30 = 0. 1, 3, 10 Factor -w*2/7 - 8w/7 - 1. -(w + 1)(w + 7)/7 Factor -4f*2 + 9436f + 9440. -4(f - 2360)(f + 1) Let 4j4/9 + 88j*3/9 - 832j*2/9 - 280j/9 + 2900/3 = 0. Calculate j. -29, -3, 5 Factor 12i2 - 11772i + 2887083. 3(2i - 981)*2 Solve -2n*2/7 + 8n/7 = 0 for n. 0, 4 Factor -175f2/3 + 305f/3 + 30. -5(f - 2)(35f + 9)/3 Find b such that b4/11 + 25b*3/11 - 112b*2/11 + 116b/11 = 0. -29, 0, 2 Factor -o*5 + 8o*4 + 11o*3 - 18o2. -o2(o - 9)(o - 1)(o + 2) Factor h4/2 + 49h*3/2 - 53h*2 - 98h + 204. (h - 2)*2(h + 2)(h + 51)/2 Factor v3/5 + 24v*2/5 - 45v - 248/5. (v - 8)(v + 1)(v + 31)/5 Factor -5p5 + 74p*4 + 15p3. -p3(p - 15)(5p + 1) Find m, given that 242m*3/7 - 198m*2/7 - 6m - 2/7 = 0. -1/11, 1 Factor 3q3 + 35q*2/4 - q - 3/4. (q + 3)(3q - 1)(4q + 1)/4 What is d in -3d*5/4 - 15d*4/2 - 93d*3/4 - 33d*2/2 + 24d + 24 = 0? -4, -2, -1, 1 Let 234g4/7 + 4012g*3/7 + 4318g*2/7 + 68g - 64/7 = 0. Calculate g. -16, -1, -2/9, 1/13 What is s in 28s4 + 92s*3 - 480s*2 - 144s = 0? -6, -2/7, 0, 3 Let -f*4/2 - 29f*3/2 + 17f*2 + 58f - 60 = 0. What is f? -30, -2, 1, 2 Suppose -5h5 + 70h*4 - 360h*3 + 880h*2 - 1040h + 480 = 0. What is h? 2, 6 Determine f so that -5f2 - 390f - 385 = 0. -77, -1 Let -2f5/7 - 8f*4/7 - 10f*3/7 - 4f2/7 = 0. Calculate f. -2, -1, 0 Determine u, given that u5 - 9u4 - 3u*3 + 25u*2 + 18u = 0. -1, 0, 2, 9 Determine u, given that -18u4 - 60u*3 + 107u*2/2 + 45u/2 + 2 = 0. -4, -1/6, 1 Solve 4b3 = 0 for b. 0 Determine f so that -f4 + 12f*3 - 23f*2 - 36f = 0. -1, 0, 4, 9 Factor -2f4 + 304f*3 - 11552f*2. -2f*2(f - 76)2 Factor v3 - 7v2 + 36. (v - 6)(v - 3)(v + 2) Factor -a4/4 + 127a*3/2 - 16381a*2/4 + 8001a - 3969. -(a - 126)*2(a - 1)2/4 Determine b so that -b2/3 - 86b/3 + 176/3 = 0. -88, 2 What is m in -4m*5 - 20m*4 + 8m*3 + 112m*2 + 32m - 128 = 0? -4, -2, 1, 2 Suppose -2n5/15 + 62n*4/15 - 374n*3/15 - 578n*2/5 = 0. What is n? -3, 0, 17 Factor -4b*2 + 12b + 352. -4(b - 11)(b + 8) Factor 5l3 - 4775l*2 + 9535l - 4765. 5(l - 953)(l - 1)*2 Find o such that -4o*3/3 - 68o*2 + 216o = 0. -54, 0, 3 Factor f*5 - 5f*4 + 7f*3 - 3f2. f2(f - 3)(f - 1)*2 Factor 4q*5 - 16q*4 - 28q*3 + 40q*2. 4q*2(q - 5)(q - 1)(q + 2) Factor -2l3 - 76l*2 - 278l - 204. -2(l + 1)(l + 3)(l + 34) Suppose 3w*3 - 66w*2 - 141w - 72 = 0. What is w? -1, 24 Factor 5a2 + 14775a - 14780. 5(a - 1)(a + 2956) Factor -3l4 - 24l*3 - 60l*2 - 48l. -3l(l + 2)*2(l + 4) Determine l, given that -3l4/2 + 12l*3 - 51l*2/2 + 15l = 0. 0, 1, 2, 5 Find j such that -j*2 - 2991j = 0. -2991, 0 What is y in -3y4 - 6y*3 + 21y*2 + 24y - 36 = 0? -3, -2, 1, 2 Let -2m2/7 + 472m/7 + 1920/7 = 0. Calculate m. -4, 240 Determine v, given that 2v5 - 28v*4 - 222v*3 - 352v*2 - 160v = 0. -4, -1, 0, 20 Factor 5i2 - 115i + 300. 5(i - 20)(i - 3) Let 2t3/3 + 6t*2 + 40t/3 + 8 = 0. Calculate t. -6, -2, -1 Factor -2l2/3 - 244l/3 - 7442/3. -2(l + 61)2/3 What is m in 12m*5 + 16m*4 - 104m*3 - 144m*2 - 36m = 0? -3, -1, -1/3, 0, 3 Factor -2s2/3 - 170s/3 - 3572/3. -2(s + 38)(s + 47)/3 Find o, given that -5o3 + 5o*2 + 25o + 15 = 0. -1, 3 Factor -65025u3/4 - 11985u*2 - 3141u/4 - 27/2. -3(3u + 2)(85u + 3)2/4 Solve w3/5 - 607w2/5 - 1217w/5 - 609/5 = 0. -1, 609 Find k, given that -k*3/8 + 347k*2/8 - 3827k + 11094 = 0. 3, 172 Determine k, given that 54k4 + 108k*3 + 72k*2 + 16k = 0. -2/3, 0 Factor -169t3/6 + 3289t*2/6 - 2920t + 2400. -(t - 1)(13t - 120)*2/6 Factor 3b*4 + 51b*3 - 111b*2 + 57b. 3b(b - 1)*2(b + 19) Factor -25q5 + 40q*4 - 16q3. -q3(5q - 4)*2 Factor -4f*2 - 156f + 504. -4(f - 3)(f + 42) Find s such that 5s5/3 + 137s*4/3 - 32s*3 - 340s*2/3 - 112s/3 = 0. -28, -1, -2/5, 0, 2 Suppose -2j4 - 296j*3 - 13356j*2 - 112360j + 3275294 = 0. What is j? -53, 11 Factor -3j3 - 39j*2 - 117j - 81. -3(j + 1)(j + 3)(j + 9) Factor -4s*3/7 - 368s*2 + 5164s/7 - 2584/7. -4(s - 1)2(s + 646)/7 Factor 2l4/7 - 24l*3/7 + 10l*2 - 48l/7. 2l(l - 8)(l - 3)(l - 1)/7 What is l in 3l4/5 - 6l*3/5 - 21l*2/5 + 12l - 36/5 = 0? -3, 1, 2 What is o in 25o5 - 10o*4 - 75o*3 - 20o*2 + 20o = 0? -1, 0, 2/5, 2 Factor 5u4 + 5u*3 - 25u*2 + 15u. 5u(u - 1)*2(u + 3) Find k such that -k*3/6 - 27k*2/2 - 39k = 0. -78, -3, 0 Solve -2g5 + 46g*4 + 192g*3 - 936g*2 = 0 for g. -6, 0, 3, 26 Factor -2h*4 + 38h*3 + 580h*2 + 2304h + 2880. -2(h - 30)(h + 3)(h + 4)2 Determine r so that -5r*3/2 + 89r*2/2 - 387r/2 - 81/2 = 0. -1/5, 9 Suppose 3k2 + 3288k + 90	{ "pile_set_name": "DM Mathematics" }
l(w(c))? -729c2 - 15552 Let f(p) = 12p*2 + 7p. Let c(m) = 7m2 + 4m. Let a(g) = -7c(g) + 4f(g). Let u(o) = 7o2 - 2. Determine u(a(h)). 7h*4 - 2 Let y(r) = -13r. Let a(i) be the third derivative of 0 + 0i3 + 0i + 1/24i4 + 7i*2. Determine y(a(q)). -13q Let j(c) = -12c. Let r(y) = -632y*2 - 5y. Calculate r(j(u)). -91008u2 + 60u Let r(v) be the second derivative of -v4/3 + v. Let t(n) be the second derivative of -n4/6 + 41n - 2. Give t(r(h)). -32h*4 Let l(u) be the second derivative of 5u*3/3 + 7u. Let o(a) = a*2 - 8a + 10. Let n be o(7). Let q(d) = 5d - 3d - nd. Determine q(l(t)). -10t Let d(i) = -2i - 238. Let a(w) = 2154w. Calculate a(d(x)). -4308x - 512652 Let g(o) = 2o*2. Let i(m) = -18m*2 - 44m2 - m2. Give g(i(s)). 7938s4 Let o(p) = 57p + 1. Let f(x) = -581x2 - 583x*2 + 1166x*2. Determine f(o(u)). 6498u*2 + 228u + 2 Suppose 0 = -2d - 3z + 75, -134 - 37 = -4d + z. Let n(a) = -a + 22 - d + 20. Let m(i) be the third derivative of -2i5/15 + i2. Calculate n(m(y)). 8y2 Let h(m) = -1127m + 4. Let y(z) = z. Calculate h(y(q)). -1127q + 4 Let x(m) = 2m. Let q(u) = -86275u. What is q(x(y))? -172550y Let t(m) = -2m2. Let b(a) = 201707a. What is t(b(c))? -81371427698c2 Let m(g) = 113g*2 + 2g. Let i(p) = 6546p. What is i(m(o))? 739698o*2 + 13092o Let l(b) = -380b2. Let o(j) = j - 5. Give o(l(z)). -380z2 - 5 Let z(b) = -b2 + 6b. Let w(n) = -n. Let o(y) = -6w(y) - z(y). Let j(q) = 14q + 2. Determine o(j(m)). 196m*2 + 56m + 4 Let a(l) = 391l - 766l + 385l. Let v(w) be the first derivative of w3/3 + 1. Calculate v(a(d)). 100d*2 Let i(l) = -2l. Let g(o) = -o*2 + 875832. Give g(i(t)). -4t*2 + 875832 Let l = 19 + -7. Let u(h) = -75h + lh2 + 75h. Let p(q) = -2q. Determine p(u(r)). -24r2 Let s(x) be the first derivative of -x3/3 - 239. Let n(a) = -9a - 2. What is n(s(r))? 9r*2 - 2 Let p(y) = 19y*2. Suppose -6j = -9j + 243. Let q = -45 + j. Let x(o) = -36o - o*2 + qo. What is p(x(n))? 19n4 Let x(g) = -5g. Let j(q) be the second derivative of 5q4/12 + 12q. Let p(r) = r*2. Let z(k) = -j(k) + 3p(k). Calculate z(x(f)). -50f2 Let k(o) = 264o*2. Let h(s) = -1212 + 2s + 1212. Determine k(h(y)). 1056y2 Let c(x) be the third derivative of 25x*2 + 0 + 1/12x*4 + 0x + 0x3. Let h(s) = 26s*2. What is h(c(d))? 104d*2 Let p(y) = -4y*2 + 5y + 10. Let o(r) = r*2 - r - 2. Let g(d) = -10o(d) - 2p(d). Let i(h) = 778h*2. Give g(i(f)). -1210568f*4 Let b(u) = 12u + u*2 - 12u - 2u2. Let s(k) be the third derivative of k5/8 - 3k*3/2 + 9k*2. Let l(g) be the first derivative of s(g). Give l(b(z)). -15z*2 Let j(s) = 5s + 3. Let g(p) = -12p2 - 3. Determine j(g(q)). -60q2 - 12 Let s(x) be the third derivative of -x5/30 + x*2. Let y = 2017 + -1412. Let b(j) = y + 4j*2 - 605. Calculate s(b(k)). -32k*4 Let y(l) = 2l2 + 30. Let n(b) = -b2 - 15. Let o(s) = 5n(s) + 2y(s). Let a(j) be the first derivative of o(j). Let d(z) = -16z2. What is a(d(u))? 32u2 Let a(r) be the third derivative of -r8/5040 + r5/30 - r2. Let u(d) be the third derivative of a(d). Let h(g) = 0g + 0g - 2g. Calculate u(h(b)). -16b*2 Let m(f) be the first derivative of 12 + 0f + 0f2 + 2/3f*3. Let k(l) = 3l. Calculate m(k(r)). 18r2 Let q(r) = -47r + 149. Let z(h) = 17h2 + 1. What is z(q(d))? 37553d*2 - 238102d + 377418 Let d(l) = -2l. Let b(k) be the first derivative of 0k*2 - 6 + 0k - 32/3k3. Give d(b(m)). 64m*2 Let i(v) = -9v*2 - 734v. Let b(t) = 16t. Determine b(i(g)). -144g*2 - 11744g Let o(c) = -2c. Let f(l) = -8l*2 - 7l + 34. Let p(k) = 7k2 + 6k - 31. Let d(u) = 6f(u) + 7p(u). Calculate o(d(h)). -2h2 + 26 Let v(y) = 386y - 5. Let c(z) = 10z. Give c(v(p)). 3860p - 50 Let s(m) = 0 + 0 - 14m + 13m. Let d(f) = -42f + 5. Let p(a) = 525a - 63. Let k(y) = 63d(y) + 5p(y). Determine k(s(t)). 21t Let c(m) = -m. Suppose 0 = 2u - 6u - 20. Let q(z) = 2z*2 - 5z. Let x(a) = uc(a) + q(a). Let p(r) be the first derivative of 2r*2 - 91. What is x(p(w))? 32w*2 Let r(m) = 8m*2 - 4m + 2. Let t(b) = -27b2 + 14b - 7. Let k(u) = 7r(u) + 2t(u). Let z(w) = 19w - 4. Determine z(k(j)). 38j2 - 4 Let p(s) be the third derivative of -s4/12 + 374s2. Let z(c) = -107c*2 + c. Give p(z(w)). 214w*2 - 2w Let d(p) = 21p. Let j(l) = -13l*2 - 7l. Let z(f) be the first derivative of 4f3/3 + f2 + 8. Let g(r) = 2j(r) + 7z(r). Give g(d(m)). 882m*2 Let j(c) = -10c*2. Let z(m) = 27163m*2 - 3. Calculate z(j(w)). 2716300w*4 - 3 Let w(t) be the first derivative of 10t*2 + 23t*2 + 57 + 17t2. Let h(d) = -d2. Calculate h(w(g)). -10000g2 Let x(p) be the first derivative of p6/360 - 13p*3/3 - 15. Let d(b) be the third derivative of x(b). Let c(g) = -12g. Determine c(d(w)). -12w2 Suppose -5j - 39 = -49. Let w(f) = 28f2 - 10f*2 - 6f*2 - 11fj. Let o(s) be the third derivative of s5/30 + s*2. Calculate o(w(u)). 2u*4 Let g(u) = 3u*2. Let f(c) = 40872c. Determine g(f(o)). 5011561152o2 Let z(t) = -7t*2. Let o(x) = 473 + 9x*2 - 242 - 231. Give o(z(g)). 441g*4 Let p(l) = 2l*2. Let w(u) be the second derivative of 16u*3 - 16u3 - u4 - 13u. Calculate w(p(k)). -48k*4 Let h be 1 - (5 - 2) - -6. Suppose 4b - 104 = -4v - 0, h = -b + 5v. Let m(o) = 21o - bo - 3o2. Let q(i) = 2i*2. Determine q(m(a)). 18a*4 Let c(l) = -2829l. Let j(f) = -4f2. What is j(c(o))? -32012964o2 Let y(z) = -z2. Let j(s) = -21s2 + 7s - 7s + 32 - 26. Let h(g) = 1. Suppose 2o = -2o + 24. Let d(u) = oh(u) - j(u). What is d(y(m))? 21m4 Let d(t) = 7t*2. Let s(c) be the third derivative of 7c6/720 + c4/2 - 15c2. Let o(m) be the second derivative of s(m). Determine d(o(x)). 343x*2 Let i(q) = 2q + 2q + 0q. Let u(a) be the second derivative of a7/1260 + a4/3 + 6a. Let m(g) be the third derivative of u(g). Give m(i(h)). 32h*2 Let x(z) = 45z - 18. Let w(f) = 2f2 + 166. Determine x(w(d)). 90d*2 + 7452 Let b(j) = 6646j - 5. Let a(y) = 2y2. Determine b(a(k)). 13292k*2 - 5 Let l(n) = -83n. Let j(d) = 422d. Let z(h) = -2j(h) - 11l(h). Let g(c) = -6c*2. What is g(z(p))? -28566p*2 Let g = 47 + -32. Let p be (50/g)/((-2)/(-3)). Let j(l) = pl + 2l - 5l. Let t(v) = v*2. Give t(j(z)). 4z*2 Let l(z) = 2z + 1 - 1. Let f(k) be the second derivative of 0k2 + 1/3k*4 + 0k*3 + 13k + 0. Give l(f(v)). 8v2 Suppose 2b + 3 = -9. Let m be (b/(-1 + -2))/1. Let v(s) = 3s - ms - 3s. Let h(r) = -r. Give v(h(p)). 2p Let v(j) = -10j2. Let g = 44 - 26. Let d(q) = 15q*2 - 36q*2 + gq*2. What is v(d(o))? -90o*4 Let b(s) be the third derivative of -3s*5/10 - 8s*2. Let y = 14 - 11. Let f(w) = -yw + 4w + 0w. What is f(b(r))? -18r2 Let r(b) = -b. Let o(m) = 2808m + 6. Give r(o(q)). -2808q - 6 Let t(z) be the second derivative of z7/2520 - 17z*4/12 + 14z. Let p(x) be the third derivative of t(x). Let b(w) = -12w. Give b(p(j)). -12j*2 Let p(b) = 3b - 10. Let g(j) = -30j + 96. Let k(x) = -5g(x) - 48p(x). Let l(s) = 3s. Give l(k(f)). 18f Suppose -5f + 31 = -9. Let o(i) = i + f - 2 - 6. Let v(a) = 2a. Calculate o(v(t)). 2t Let v(c) = 33c2. Suppose 10 = -2s + 92. Let b(q) = 45q2 + sq*2 - 88q*2. Calculate b(v(a)). -2178a*4 Let j(t) = -258t + 528t - 266t. Let x(m) = 4m2 - 2m. Give j(x(u)). 16u2 - 8u Let g(d) = -11d2 - 7d + 7. Let p(z) = -5z2 - 3z + 3. Let u(s) = 3g(s) - 7p(s). Let o(l) = -10l - 3l + l. Give o(u(f)). -24f2 Let r(p) = 1 - 1 + 3p. Let v = 91 + -66. Let m(w) = 53w - 23w - vw. Calculate r(m(b)). 15b Let x(m) = -m*2. Let l(g) = -45g*2 + 31g*2 + 2g + 19g2. Give x(l(u)). -25u*4 - 20u*3 - 4u*2 Let p(b) = b. Let k(v) be the third derivative of -47v5/30 + v3/6 + 72v2. What is p(k(t))? -94t*2 + 1 Let l(d) = -2d*2. Let m(y) = 20y. Let b(u) = -517u. Let j(q) = -3b(q) - 77m(q). Give l(j(h)). -242h*2 Let w(q) = 20q*2 + 17q*2 + 11q*2 - 60q*2 + 13q2. Let b(x) = -x2 + 49x. Calculate b(w(a)). -a4 + 49a*2 Let y(f) = 17f. Let h(p) = 66p*2 + 2. Gi	{ "pile_set_name": "DM Mathematics" }
r 5:26 AM? 1:38 PM What is 715 minutes after 8:08 AM? 8:03 PM What is 707 minutes before 11:07 AM? 11:20 PM How many minutes are there between 1:17 PM and 8:02 PM? 405 How many minutes are there between 5:13 PM and 9:09 PM? 236 What is 697 minutes before 7:13 AM? 7:36 PM What is 264 minutes after 10:29 PM? 2:53 AM How many minutes are there between 10:58 PM and 7:06 AM? 488 What is 391 minutes before 5:51 PM? 11:20 AM What is 298 minutes after 2:08 PM? 7:06 PM What is 463 minutes after 8:26 AM? 4:09 PM How many minutes are there between 1:27 AM and 7:12 AM? 345 How many minutes are there between 6:18 PM and 1:22 AM? 424 How many minutes are there between 4:26 PM and 12:36 AM? 490 What is 400 minutes after 8:58 PM? 3:38 AM How many minutes are there between 2:16 AM and 8:56 AM? 400 What is 153 minutes after 4:27 PM? 7:00 PM What is 126 minutes after 5:45 AM? 7:51 AM What is 636 minutes before 8:21 AM? 9:45 PM What is 703 minutes before 4:16 PM? 4:33 AM How many minutes are there between 1:30 PM and 10:15 PM? 525 What is 419 minutes after 5:29 AM? 12:28 PM How many minutes are there between 10:07 PM and 4:55 AM? 408 How many minutes are there between 7:25 PM and 11:25 PM? 240 How many minutes are there between 4:45 AM and 9:11 AM? 266 What is 439 minutes before 11:11 AM? 3:52 AM How many minutes are there between 3:59 PM and 3:45 AM? 706 How many minutes are there between 11:13 PM and 3:11 AM? 238 What is 564 minutes before 1:00 PM? 3:36 AM What is 171 minutes after 8:23 AM? 11:14 AM How many minutes are there between 3:50 AM and 11:00 AM? 430 What is 300 minutes before 11:33 PM? 6:33 PM How many minutes are there between 6:12 AM and 2:39 PM? 507 What is 317 minutes before 2:49 PM? 9:32 AM How many minutes are there between 2:31 AM and 2:41 AM? 10 What is 430 minutes after 5:27 PM? 12:37 AM What is 676 minutes before 12:20 AM? 1:04 PM How many minutes are there between 1:32 AM and 6:41 AM? 309 How many minutes are there between 11:19 PM and 5:44 AM? 385 How many minutes are there between 10:01 AM and 4:55 PM? 414 How many minutes are there between 8:05 AM and 3:17 PM? 432 How many minutes are there between 6:06 AM and 10:32 AM? 266 How many minutes are there between 3:03 PM and 3:22 PM? 19 How many minutes are there between 12:31 AM and 2:32 AM? 121 What is 665 minutes before 11:28 PM? 12:23 PM How many minutes are there between 1:05 AM and 6:07 AM? 302 How many minutes are there between 4:33 AM and 4:21 PM? 708 How many minutes are there between 3:26 PM and 4:55 PM? 89 How many minutes are there between 2:44 AM and 12:12 PM? 568 How many minutes are there between 12:39 AM and 12:07 PM? 688 How many minutes are there between 3:34 PM and 3:23 AM? 709 What is 463 minutes after 12:28 PM? 8:11 PM How many minutes are there between 9:32 AM and 11:44 AM? 132 What is 504 minutes after 2:32 PM? 10:56 PM How many minutes are there between 11:00 AM and 1:01 PM? 121 What is 44 minutes after 5:12 AM? 5:56 AM What is 552 minutes after 3:35 AM? 12:47 PM How many minutes are there between 1:54 PM and 1:37 AM? 703 What is 539 minutes before 11:41 AM? 2:42 AM What is 89 minutes after 7:47 PM? 9:16 PM How many minutes are there between 7:59 PM and 8:13 PM? 14 How many minutes are there between 3:12 PM and 8:40 PM? 328 What is 184 minutes after 7:20 PM? 10:24 PM What is 496 minutes before 10:58 AM? 2:42 AM What is 204 minutes before 9:24 PM? 6:00 PM What is 293 minutes before 5:57 PM? 1:04 PM What is 289 minutes after 3:00 AM? 7:49 AM How many minutes are there between 6:15 AM and 1:14 PM? 419 What is 296 minutes after 1:15 AM? 6:11 AM How many minutes are there between 2:00 AM and 5:04 AM? 184 What is 252 minutes after 4:46 PM? 8:58 PM What is 238 minutes after 11:06 AM? 3:04 PM What is 158 minutes after 7:12 PM? 9:50 PM How many minutes are there between 11:29 AM and 2:04 PM? 155 How many minutes are there between 8:09 AM and 1:26 PM? 317 What is 323 minutes after 6:45 AM? 12:08 PM What is 209 minutes before 11:17 PM? 7:48 PM What is 185 minutes after 8:15 AM? 11:20 AM What is 355 minutes before 2:53 AM? 8:58 PM How many minutes are there between 11:01 PM and 10:11 AM? 670 What is 175 minutes after 12:23 PM? 3:18 PM What is 159 minutes before 2:24 PM? 11:45 AM What is 709 minutes after 2:22 PM? 2:11 AM How many minutes are there between 1:16 PM and 9:17 PM? 481 What is 127 minutes after 12:37 AM? 2:44 AM What is 130 minutes after 3:34 PM? 5:44 PM How many minutes are there between 8:08 AM and 11:30 AM? 202 How many minutes are there between 8:08 AM and 11:19 AM? 191 How many minutes are there between 10:40 AM and 9:43 PM? 663 What is 502 minutes before 7:12 PM? 10:50 AM How many minutes are there between 2:02 AM and 1:23 PM? 681 How many minutes are there between 5:48 AM and 6:21 AM? 33 How many minutes are there between 12:01 PM and 4:52 PM? 291 How many minutes are there between 1:24 PM and 3:59 PM? 155 How many minutes are there between 1:52 PM and 8:05 PM? 373 What is 462 minutes before 3:43 PM? 8:01 AM How many minutes are there between 8:39 AM and 11:13 AM? 154 What is 9 minutes before 10:36 PM? 10:27 PM How many minutes are there between 11:50 PM and 2:19 AM? 149 What is 691 minutes after 10:01 PM? 9:32 AM How many minutes are there between 1:04 AM and 6:41 AM? 337 What is 320 minutes after 8:30 PM? 1:50 AM What is 664 minutes after 5:20 PM? 4:24 AM What is 538 minutes before 12:26 AM? 3:28 PM How many minutes are there between 8:31 PM and 6:41 AM? 610 What is 6 minutes before 5:16 PM? 5:10 PM How many minutes are there between 10:46 PM and 5:17 AM? 391 How many minutes are there between 9:55 PM and 9:35 AM? 700 What is 128 minutes after 11:47 PM? 1:55 AM What is 592 minutes after 8:50 AM? 6:42 PM What is 587 minutes before 1:14 PM? 3:27 AM How many minutes are there between 5:27 PM and 7:11 PM? 104 What is 547 minutes before 8:12 PM? 11:05 AM What is 612 minutes after 2:42 AM? 12:54 PM What is 493 minutes after 5:02 AM? 1:15 PM How many minutes are there between 12:34 AM and 9:20 AM? 526 What is 153 minutes after 12:52 AM? 3:25 AM How many minutes are there between 1:26 AM and 7:37 AM? 371 What is 345 minutes before 12:44 PM? 6:59 AM What is 595 minutes before 5:11 PM? 7:16 AM What is 657 minutes before 4:16 AM? 5:19 PM How many minutes are there between 5:45 AM and 5:56 AM? 11 How many minutes are there between 10:52 PM and 10:37 AM? 705 What is 514 minutes before 9:47 AM? 1:13 AM What is 643 minutes before 9:57 PM? 11:14 AM What is 337 minutes before 11:31 PM? 5:54 PM How many minutes are there between 5:18 PM and 2:10 AM? 532 What is 77 minutes after 7:01 AM? 8:18 AM What is 707 minutes after 1:20 AM? 1:07 PM What is 587 minutes after 2:23 AM? 12:10 PM What is 719 minutes after 5:22 AM? 5:21 PM How many minutes are there between 4:56 PM and 4:29 AM? 693 What is 573 minutes after 2:10 AM? 11:43 AM What is 102 minutes before 7:03 AM? 5:21 AM What is 303 minutes before 9:04 AM? 4:01 AM How many minutes are there between 12:48 AM and 1:00 AM? 12 What is 305 minutes before 5:10 AM? 12:05 AM What is 617 minutes after 6:28 AM? 4:45 PM What is 557 minutes after 1:07 AM? 10:24 AM What is 345 minutes after 12:06 AM? 5:51 AM How many minutes are there between 7:28 AM and 6:59 PM? 691 What is 353 minutes after 4:01 PM? 9:54 PM How many minutes are there between 2:28 PM and 11:31 PM? 543 What is 676 minutes before 10:26 AM? 11:10 PM How many minutes are there between 11:44 PM and 1:12 AM? 88 How many minutes are there between 10:11 AM and 4:11 PM? 360 How many minutes are there between 11:01 PM and 4:14 AM? 313 How many minutes are there between 7:51 PM and 7:53 PM? 2 How many minutes are there between 2:04 AM and 3:26 AM? 82 What is 710 minutes before 3:06 PM? 3:16 AM How many minutes are there between 9:09 PM and 9:23 PM? 14 How many minutes are there between 6:51 AM and 2:14 PM? 443 What is 323 minutes after 7:15 PM? 12:38 AM How many minutes are there between 4:33 AM and 1:31 PM? 538 What is 251 minutes before 12:16 PM? 8:05 AM How many minutes are there between 8:17 AM and 6:02 PM? 585 What is 607 minutes after 3:27 AM? 1:34 PM How many minutes are there between 3:02 PM and 5:31 PM? 149 What is 111 minutes after 6:25 AM? 8:16 AM What is 639 minutes befor	{ "pile_set_name": "DM Mathematics" }
-1? (a) s (b) l (c) 1 b Let y = -90.81 - -90. Let j = 0.81 + y. Which is the nearest to -0.09? (a) j (b) -4 (c) -2/7 a Let v = -4815 - -4816. Let s = 0.24 + 0.16. Which is the closest to -2/3? (a) 3/7 (b) v (c) s c Let u = -4.9823 - 0.0177. Suppose 6n - 2n = 4w - 36, -n - 5w + 21 = 0. Let h be (-4)/(-132 - 4)n. Which is the closest to -3/5? (a) h (b) u (c) 3 a Let w = -0.99 + -0.01. Let t be 14 + (-2 - (-34)/10)/(119/(-595)). Which is the nearest to w? (a) -0.3 (b) 1/8 (c) t (d) 5 a Let u = -0.6 - -3.6. Let a = 4.9212 - 4.9712. What is the closest to a in -2, 0.5, u? 0.5 Let t = -109469/6 - -18193. Let w = 52 + t. Which is the closest to -1? (a) -7 (b) w (c) -5 b Let r = 0.08 - 3.08. Let a be (-76)/105 + 182/3185. What is the closest to r in -1, a, -4? -4 Let g be 1 + 5 - ((-6534)/189 - -41). Which is the closest to -4? (a) g (b) 2/5 (c) 0.3 (d) -0.06 a Let r = 5611 + -5611.2. What is the closest to 13 in -44, -1, r? r Let v be 18431/1736 - (0 + 4/14). Let q(h) = -h - 1. Let u be q(-2). Which is the nearest to -6? (a) v (b) u (c) -2 c Let z = -3.73 + 3.73. Which is the nearest to -1? (a) -0.4 (b) z (c) 1 (d) -4/3 d Let n = -1780 - -1780.1. What is the closest to n in -5, -11, -2/5, 2/11? 2/11 Let s(k) = -k*2 + 6k + 4. Let y be s(7). Let q = 12926 - 12926.1. Which is the closest to -0.1? (a) q (b) 0.04 (c) y a Suppose -4607 + 4543 = -8a. What is the nearest to 1/2 in 0.4, a, 7? 0.4 Let c(b) = -46b - 1653. Let o be c(-36). What is the closest to 2 in -1/6, o, -0.5, 6? o Suppose 925m + 20 = 930m. Suppose -g - 4l - 10 = 0, -8g - 18 = -11g + ml. What is the nearest to 4 in 2/5, -4, g, 8? g Let h = -0.5305 - -0.53. Let k = -0.1005 - h. Let i = -2 - -2. Which is the nearest to i? (a) -3/2 (b) k (c) -0.2 b Let f = 0.113 - -77.887. Let q = f + -81. Let w(u) = -u*3 - 2u*2 - u. Let l be w(-2). What is the nearest to l in -3/8, -0.3, q? -0.3 Suppose -1497 = 4n - 1481. Let i = -1.38 + 1.3. What is the nearest to 1 in i, -1, n? i Let k be (17 + 11619/(-684))/((-1)/4). What is the nearest to 0.1 in k, -1/3, 22? k Let f = -0.04 - -0.34. Let m(j) = -j*3 + 6j*2 - 30. Let y be m(4). Suppose -yp + 3 - 3 = 0. Which is the nearest to -1/2? (a) p (b) f (c) 1/7 a Let h = -0.1 + -5.9. Let d = -68710.85 - -68711. Which is the closest to h? (a) -0.5 (b) d (c) 1/8 a Let m = -556.1 - -556.1. What is the nearest to m in -0.003, 4, -2? -0.003 Let s = -184 + 193.9. Let d = 9.9 - s. Let m = -4 - -4.4. Which is the closest to 0.1? (a) 4 (b) m (c) d c Let f = 6 + -3. Let y be 4 - (1 + 0)(-3840)/(-896). Which is the nearest to -1/4? (a) f (b) y (c) 1 b Let s = -1.1 - -1.2. Let t = 8816 + -8816. Which is the nearest to t? (a) 1/3 (b) s (c) 2/11 b Let v be (0/8 + 3)1/246. Which is the nearest to 3.1? (a) v (b) 19 (c) 4 c Let w = -0.631 - 0.069. Let z = 0.4379 - 0.2379. Which is the closest to z? (a) w (b) 3 (c) 4 a Let n be (2/(-3))/(25 - 23). Which is the closest to 2? (a) -33.2 (b) -0.5 (c) n c Let c = 3 + -3.5. Let p = 254 - 77. Let m = p + -174. What is the closest to -2 in -0.2, m, c? c Let q = 26160/7 - 3737. Which is the nearest to 405? (a) q (b) 0.2 (c) 1/3 (d) 3/7 d Let h = 0.063 + -0.163. Suppose 0t - u + 3 = 4t, -5t + 6 = 2u. Which is the closest to -3? (a) 1 (b) h (c) t (d) -1 d Let t = -45408 + 227043/5. Suppose 0 = -5r + 5 + 10. What is the nearest to -1 in r, t, -11? t Let y = 29.5 + 9. Let n = 0.5 - y. Let g = -37.6 - n. What is the nearest to 0.4 in 1, 2, g? g Suppose 0 = 2h + 2h + 440. Let u be 20/h + (-700)/22. Let r be 8/u - (-15)/(-36). Which is the nearest to r? (a) -3 (b) -5 (c) 0 c Let y = 2738.7 + -2742.7. Which is the closest to -4? (a) 3 (b) y (c) 40 b Let q = -10131.1 + 10131. What is the nearest to 73 in q, -0.4, -1/3? q Let v = -0.51854 - -0.11854. Which is the closest to v? (a) 5 (b) -3/8 (c) 17 (d) 4 b Let b = -575.235 + 1.235. Let s = 597 + b. What is the closest to 1 in s, -0.1, -2, 0.3? 0.3 Suppose -35t + 9 = 36t - 62t. Let v be (-15)/24/(-40). Which is the nearest to t? (a) -2/5 (b) -0.2 (c) v c Let b = -764 - -767. Let t be (-7 - -3) + (5 - (b - 3)). What is the closest to t in 0.4, 40, 1? 1 Let i = -1555/6 - -4505/18. Let q = i + 554/63. Let v = 27 - 80/3. Which is the nearest to v? (a) 4/3 (b) -1/4 (c) q c Let m be 6/((-6 - -9)(-11)/(-22)). Which is the closest to 0.3? (a) 0.06 (b) m (c) 0.6 (d) -5 a Let r = 18227 + -18218. What is the closest to -2/9 in 4, 4/7, -2, r? 4/7 Let t = -13 - -10. Let p = -4119 - -4119.4. Which is the closest to t? (a) -1 (b) p (c) 0.3 a Let r be (6/5)/(-1) + (666/90 - 6). Which is the closest to 61? (a) 0 (b) r (c) -0.2 (d) 0.5 d Let u = -202.89 - -202.49. Let l = -13 - -12.99. Which is the nearest to 2/33? (a) l (b) u (c) -3 a Let q = 44634 + -44639. What is the nearest to 7 in -0.125, -1, q? -0.125 Let h = -161.45 - -3.45. Let l = h - -162. What is the nearest to l in 5, 2, -0.1? 5 Let h be 5 + 3/(-1) + 0/(-4). Let q be (-2 - 2648/(-10)) + (-7 - -4). Let o = -259 + q. What is the nearest to -0.2 in o, 7, h? o Let i = -82.5 - -294.8. Let o = 212 - i. Which is the nearest to 2? (a) o (b) 2/27 (c) 1 c Let u = -6/25 + 23/200. Let k = -47.2 + 44. Let o = k + 3.2. What is the nearest to -2 in -6, u, o? u Let o = -39575 + 39550. Which is the nearest to -4/15? (a) -0.1 (b) -3 (c) o a Let w = -21 + 23. Suppose 4g - wg = 6. Let a = -592/6279 - -2/273. What is the closest to a in g, 5, -2? -2 Let n = -9 - -11. Let f be (-15)/(-4) + ((-35)/(-20))/7. Suppose -f - 2 = 3h. Which is the closest to 0.1? (a) 6 (b) n (c) h b Let l be (((-1276)/29)/88)/((-1)/1). Which is the closest to l? (a) -0.24 (b) -2/9 (c) -2 b Let y = -39 + 37. Suppose 4 = -2q - q + 5d, -5q = 5d + 20. Let h be 4/187/(14/q). Which is the closest to h? (a) -4 (b) 4/5 (c) y b Let x = -176/3 - -60. Let a = -84.113 + 84. Let l = a - -0.413. What is the closest to 0.2 in l, x, 3? l Let u = -54 - -45. Let g = u + 7. Let x = -4.3 - -4. What is the nearest to -2 in 2/7, g, x? g Let x = 101/185 + 2/37. Let n = -4.3 + -46.7. Let k = n - -50.9. What is the nearest to k in -0.3, x, 4? -0.3 Let r = -414.7 - -415. Let s be (-9)/(27/(-6)) + 14/(-6). What is the nearest to s in 1/4, 2/7, r? 1/4 Let s be (-12)/5(1 - -23)/24. What is the nearest to -1 in 1/2, s, -0.2, -0.1? -0.2 Let j = -1/720 - 431/720. Let l = -0.043 + 0.143. What is the closest to l in 0.5, j, -5, -8? 0.5 Let d = 7.406 - 7.376. What is the nearest to 1 in 5, -6, d? d Let n = -2296.5 - -2296. Which is the closest to -0.2? (a) 2/29 (b) n (c) -2/5 (d) 4 c Let a be (3 + -12 - -9)/6. What is the closest to a in 2, -0.06, -0.5? -0.06 Suppose -2h + w + 158 = 158, 4h + 5w = 0. Which is the nearest to -2? (a) 2/5 (b) -4/143 (c) h (d) 4 b Let m = 290.42 - 290.92. What is the nearest to -1/6 in m, 0.2, 1/3, 0.4? m Suppose 0 = -5s - g + 127, 0s + 2s - 3g = 61. Let m = -11633/46468 - -4/11617. What is the closest to -1 in 2, m, s? m Let x(o) = -4o*2 - 35o + 11. Let z be x(-9). Let l be (-8)/(-8) - (z + -4). What is the closest to 0.14 in 0.1, l, -0.4? 0.1 Let y = -682 - -699. Which is the closest to y? (a) -4 (b) -9 (c) -1 c Let q be (1/2)/(39/(-6) + 6)1. Which is the closest to q? (a) -0.77 (b) -1/4 (c) -2/5 a Let d be 19669/(-255) - (-4)/30. Let x be ((-22)/d)/(12/14). Let b = 328/187 + -18/11. What is the closest to -0.2 in b, -0.4, x? -0.4 Let u be (-64)/(-560)(-6 + (-76)/(-8)). Which is the nearest to -0.1? (a) -0.06 (b) u (c) 2 (d) -3 a Let x = -8285 - -8284.988. Which is the nearest to -1? (a) 0 (b) x (c) 2 b Let y be 5/33 + 3/(-9). Suppose 3p + 4a + 5 = 0, 0 = p - 6a + 11a - 2. What is the nearest to -2 in 2/9, 3, y, p? p Let m = 0.1 + 0. Let z = 28.4 - -152.5. Let o = z - 181. Which is the closest to o? (a) -1 (b) 0.05 (c) m b Let q = 6047.3 + -6047. Which is the nearest to -1/4? (a) 1/5 (b) 0.22 (c) q (d) -1/5 d Let m = 22004 + -22000. What is the closest to -258 in 2/5, m, -2/13? -2/13 Let n = -27/124 + -1/31. Let w = 139.1 + -138.9. Which is the closest to -2/31? (a) w (b) n (c) 4 b Let m = 262.7 - 262.7. Which is the closest to m? (a) -0.1 (b) -1/4 (c) -14/5 a Let n = -11437/4 - -2859. Which is	{ "pile_set_name": "DM Mathematics" }
- 2t - 4 + 4 + (-3t - 3t + 4t)(2 - 5 + 1) - 2t + 3t - 2t in the form w + yt and give y. -447 Express -86h*3 + 78h*3 - 47 + 57 as gh + ah3 + w + xh*2 and give w. 10 Express 1029k2 - k3 - 2k - 67 - 1029k*2 - 2k*4 in the form r + gk*2 + mk*4 + xk + pk3 and give x. -2 Rearrange -2s + 5s - 2s + 2s + 0 + 0 + (0s - 2s + s)(0 + 1 - 3) - 995 + 991 + 2s + 8s to the form cs + m and give c. 15 Express -429w*3 + 186w*3 - 2w + 4 + 259w3 + w2 in the form uw + nw3 + kw*2 + b and give n. 16 Rearrange 12z*2 + 5z*2 - 3 + 12z*2 to oz*2 + a + kz and give o. 29 Rearrange -5y + 149y*2 + 4y + 503y2 to the form vy*2 + uy + a and give v. 652 Rearrange 8 + 4m2 - 2m + 8m3 + 5m*3 - 2 - 15m*3 to the form hm*2 + w + lm*3 + rm and give r. -2 Express -3n4 + 9 - 3n*3 + 10n4 + n - 8 + n3 in the form sn3 + ln*4 + fn*2 + t + an and give t. 1 Rearrange -5 + 103y + 3 + 401y + 300y to ly + p and give p. -2 Rearrange 2n - 89n*2 + 3n*3 + 88n*2 - 7 - 5 to the form cn + r + an3 + sn*2 and give c. 2 Express (2 - 1 + 1)(0 + 3 + 2)(11b + 4b + 0b) in the form xb + v and give x. 150 Express -24v*2 + 439 - 439 in the form wv*2 + xv + t and give t. 0 Rearrange g*3 - 11g - 4g + 5g - 12 - 5g to the form bg*2 + xg + hg3 + l and give h. 1 Rearrange 0q + 4q - 6q + 2q + 0 + 0 + (3q - 4q + 3q)(0 + 3 - 1) - 5q + 5q - q + 26q - 1 + 0 - 33q to pq + y and give y. -1 Express -57i2 - 2 - 41i*2 + 2i*4 - 35i*2 - 2i*3 + i + 99i*2 as ai*3 + si*2 + ci + oi4 + f and give o. 2 Express -4w + w - 4w + (2 + 7w + 3 - 2w)(-3 + 3 + 1)(3 - 7 + 3) in the form mw + z and give m. -12 Express -7 + 3 + 7 + 0d + d + 14 as md + w and give w. 17 Express (3v + 3v - 4v + (-1 + 7 - 4)(-3v + 4v - 3v) + 2 - v + 5v - 7v)(-68 + 108 - 85) in the form h + xv and give h. -90 Express -307n*2 + 307n*2 + 4n*3 - 3n*4 - 2n*3 - 10n in the form c + hn3 + xn*4 + gn*2 + kn and give h. 2 Express (2 - 3m - 2)((m - 3 + 3)(1 - 2 - 1) - 82m + 143m - 87m) as n + am + gm*2 and give g. 84 Rearrange 4 + 4p*3 + 5 - 2p*3 + 2p*4 + 6 + p to np + vp2 + cp*3 + m + fp*4 and give f. 2 Express -116h - 34h - 169h + 33h - 7h in the form u + gh and give g. -293 Rearrange (7 - 2 - 1)(-68 + 161 + 13k - 91) to p + ok and give o. 52 Express 711l3 + 2l - l - 883l3 in the form f + wl*2 + ml*3 + kl and give m. -172 Rearrange -8 + 3 + 55b + 6 + 0 - 3b to l + sb and give s. 52 Rearrange (8f + 56f + 272f*2 - 262f*2)(-f + 3 - 3) + 4f3 - 3f*3 - 3f*3 to pf + kf3 + c + wf*2 and give w. -64 Express (-191t*3 + 33310 - 33310)(-3t - 4t + 5t) + 2t*4 + 2t - 4t4 + 0t*4 in the form a + zt*2 + vt + kt3 + yt*4 and give k. 0 Rearrange -19 - 5x + 6 + 14 to the form n + ix and give i. -5 Express (-1480u - 2 + 1829u + 2)(4 - 3 + 0) + 0 + 0 - 2u in the form l + ou and give o. 347 Rearrange 20u3 - 39u*3 + 3u - 2u2 + 31u + 21u3 to the form w + yu*3 + hu*2 + fu and give y. 2 Rearrange -24 + 12x2 + 6x*3 + 24 + 5x*3 to qx*2 + b + nx + px3 and give p. 11 Rearrange 249 - 6r*3 + 4r*3 - 2228r*2 + 2230r*2 to dr*2 + mr*3 + yr + n and give n. 249 Rearrange ((4 + 0 + 1)(3g - 2g + 0g) - 3 - 3g + 3 + (-2 + 0 + 1)(-2g + 3g - 2g))(-1 + 1 + g) to r + og + kg*2 and give o. 0 Express 6j*3 - 5j*3 + 4j*3 + (2j + 2j - 3j)(26j*2 + 3 + 86j - 136j2 + 113j*2) in the form ij*2 + lj + o + fj3 and give l. 3 Rearrange 19h + 3h2 - 14h - 55h3 - 3h*2 to mh*3 + jh*2 + uh + z and give u. 5 Rearrange (2l2 - l2 - 2l*2)(-2 + 4 - 3 + (0 - 3 + 1)(5 + 6 - 7)) to the form r + nl*2 + pl and give n. 9 Rearrange -59050 + 9q + 18q + 59050 to the form p + xq and give x. 27 Express 595 - 146 - 149 - 149 - 140 + 7m in the form tm + g and give g. 11 Express -88p*3 + 86p*3 + 59p*2 + 6p*2 + 22p*2 in the form fp + np3 + bp*2 + a and give b. 87 Rearrange (1 + 1 + 2)(16 - 16 - 17l)(4l - l - 5l)(3 + 0 - 4) to the form gl + sl2 + q and give q. 0 Express 40 - 27l*2 - 69 + 42 + 8l + 28l2 + 3l*3 in the form c + ol*3 + dl + ml2 and give c. 13 Rearrange (2f + 2f - 3f)(-44f + 58f + 100f) to the form jf2 + v + nf and give j. 114 Rearrange ((-1 + 2v + 1)(-1 - 2v + 1) - 3v + v*2 + 3v - 5v - v2 + 5v)(-v - 5v + 46v) to the form gv*3 + m + qv*2 + fv and give g. -160 Express (-6v + 3v + 17v)(-2v - 3 + 3)(5 + 1 - 1) as y + tv2 + gv and give t. -140 Rearrange 4z - 9 - z2 + 3z*3 + 7 + 33z + 0z2 to sz + hz3 + az*2 + m and give m. -2 Rearrange (-4 - 26r + 3 + 29r)(-10r + 4r - 5r) to the form ar*2 + xr + l and give x. 11 Rearrange -7r - 3r*4 + 4r + 4r + (9r*3 - 12r*3 + 2r*3 - 45)(-2r - 2r + 0r) to tr*3 + jr + yr4 + mr*2 + n and give j. 181 Express (2m - 4m - 6m)(3 - 1 - 1)(-14 + 14 + m) in the form pm2 + hm + o and give p. -8 Express 1423o - 394o + 1057o + 278o + 2o in the form ro + m and give r. 2366 Express -1403t3 + 61t*2 + 2810t*3 - 2t - 1408t3 as yt*3 + kt*2 + xt + l and give k. 61 Express 4g3 - 10g*2 + 164g*4 - 4g*3 + 1 + 11g*2 as r + mg + ig4 + lg*2 + sg*3 and give r. 1 Rearrange j + 1297 - 644 - 687 - 3j*2 - 4j to bj + h + kj*2 and give b. -3 Rearrange -18g + 0 + 2g2 + 5 - 3g*3 + 15g - 7 to the form wg + xg*3 + ng*2 + p and give n. 2 Express -15t*3 + 15t*3 - 3t2 + t4 + (-t*3 - t + t)(-4t + 10t + 8t) as ct*2 + v + yt*3 + xt + nt4 and give n. -13 Rearrange -870 - 870 - 9b*2 - 372b*2 + 1742 to the form t + sb + xb2 and give x. -381 Rearrange (-5c + 5c + 6 + c2)(-21c2 - 34c*2 + 13c*2) to the form hc*2 + ac + oc3 + gc*4 + l and give g. -42 Express 20p*3 - 32p*3 - 13p*3 + (-4p + p + p)(13p*2 - 6p*2 + 6p*2) as ap*3 + t + gp + ip2 and give t. 0 Rearrange -425x*2 + 867x*2 - 204x*2 to yx*2 + j + fx and give y. 238 Rearrange (-4 + 4 - 2c)(-846 - 429 + 239) to the form u + lc and give l. 2072 Rearrange (-2o*2 + o - o)(-5152 + 38o + 5152)(-4 - o + 4) to the form d + io4 + zo + no2 + ro*3 and give i. 76 Rearrange (0b + b - 2b)((-4 - 1 + 6)(-2b - 3b + 4b) - b + 5b - b) + (48 - 9b - 48)(-3 - 2b + 3) to the form lb2 + k + jb and give l. 16 Rearrange (-4y2 + 2y*2 + 0y*2)(1 - 2 + 3) - 2656y2 + 567y*2 + 1072y*2 to my + b + fy2 and give f. -1021 Express (2w - 2w + 2w)(82w - 62567 + 62567) as ow2 + jw + d and give o. 164 Rearrange (-13 + 16u + 13)(-14 + 21 - 3) to i + vu and give v. 64 Express -19 - 39 + 64 + 12l*2 as tl + dl2 + w and give t. 0 Rearrange 111w*3 + 4 + 2 - 5 to ow*2 + qw*3 + nw + s and give q. 111 Express -7h2 + 403h + 7 - 3h3 - 9h*2 - 199h - 204h in the form rh + qh2 + fh3 + a and give f. -3 Express -m3 - 2m3 + m3 + (-6 + 1 + 1)(0m3 + 6m*3 - 4m*3) + 4m*2 - 4m*2 - 11m*3 + m as dm*3 + xm*2 + c + nm and give n. 1 Express -11y + 478y - 9y in the form k + fy and give f. 458 Express -c*4 - 2c*3 - 2 - 81c + 3c2 + 83c + 1 as qc3 + mc*4 + zc + pc2 + n and give n. -1 Rearrange -v3 - 22v*4 + 25v*4 - 4 + 0v*4 to the form g + pv + uv3 + hv*4 + nv*2 and give u. -1 Rearrange 13k*3 + 9k - 9k - k to tk*2 + r + xk*3 + qk and give x. 13 Rearrange 8g2 + 4g*2 + 5g - 15g2 + (-3g + g + 0g)(4g + 2g - 5g) - 3g*2 + 2g2 - g2 to dg2 + tg + y and give t. 5 Rearrange 4m2 - 2m2 - m2 + (m - 6m + 4m)(-4m + 0m + 2m) + 4m2 + 29m + 7776 - 7777 - m*2 to sm + xm2 + l and give l. -1 Express 4q*3 - 2q3 - q3 + (-1607 - 263q2 + 1607)((4 + q - 4)(0 + 2 - 1) + q + 0q + 2q) in the form hq*3 + bq + x + lq2 and give h. -1051 Rearrange -68o - 5o2 + 38o + 30o + 44o*3 to the form co + so2 + b + go*3 and give s. -5 Express 8 + 2 + 1 - 2 + h in the form zh + i and give i. 9 Express ((-3 + 4 + 0)(7h + 2h + h) + 5h - 4h + h)(-3 + 1 - 3)(1 - 2 + 0) in the form qh + p	{ "pile_set_name": "DM Mathematics" }
173 What is the next term in 2358777, 4717580, 7076419, 9435312, 11794277, 14153332, 16512495? 18871784 What is the next term in -105692, -422734, -951136, -1690898, -2642020, -3804502, -5178344? -6763546 What is the next term in -1980609, -3961084, -5941559, -7922034, -9902509? -11882984 What is next in 27959, 56034, 84109, 112184? 140259 What comes next: -37079, -147868, -332377, -590600, -922531, -1328164, -1807493, -2360512? -2987215 What is next in -42838, -68388, -93940, -119494, -145050, -170608? -196168 What is the next term in -27423, -219687, -741545, -1757793, -3433227? -5932643 What is next in -33365276, -33365274, -33365272, -33365270, -33365268, -33365266? -33365264 What is next in 304016, 608053, 912110, 1216187? 1520284 What is the next term in 1267, 2532, 3825, 5152, 6519, 7932, 9397? 10920 What comes next: -1109, -2292, -3567, -4964, -6513, -8244, -10187, -12372? -14829 What is next in 16478, 16145, 15804, 15449, 15074? 14673 What is the next term in -14043, -13783, -13523, -13263? -13003 What comes next: 5731, 5487, 4833, 3565, 1479, -1629, -5963, -11727? -19125 What comes next: 2906, 5777, 8648? 11519 What comes next: 6640, 26746, 60324, 107380, 167920? 241950 What comes next: 116762574, 116762575, 116762576, 116762577, 116762578? 116762579 What is next in -43757, -87474, -131209, -174962, -218733, -262522? -306329 What is the next term in -540, -1075, -1676, -2373, -3196, -4175? -5340 What comes next: -11923629, -11923625, -11923621, -11923617? -11923613 What comes next: -91329, -365068, -821301, -1460028, -2281249, -3284964? -4471173 What is next in -2986386, -5972764, -8959142? -11945520 What comes next: -97, -397, -635, -781, -805, -677, -367, 155? 919 What is the next term in -1270473, -1270472, -1270471? -1270470 What comes next: 1816065, 3632121, 5448169, 7264203, 9080217, 10896205, 12712161, 14528079? 16343953 What comes next: -474, -3077, -7770, -14553, -23426, -34389, -47442? -62585 What is next in 240, 1448, 4182, 9018, 16532, 27300? 41898 What is next in -6791086, -6791093, -6791106, -6791125, -6791150? -6791181 What comes next: -14785, -17711, -20637, -23563, -26489, -29415? -32341 What is the next term in -12460, -54551, -126276, -227635? -358628 What is next in -12858421, -25716848, -38575277, -51433708? -64292141 What is the next term in 355820623, 711641246, 1067461869, 1423282492, 1779103115, 2134923738? 2490744361 What is next in 1201062, 2402220, 3603382, 4804548, 6005718? 7206892 What is next in -678, 4882, 14154, 27144, 43858, 64302? 88482 What is the next term in 123223, 122985, 122591, 122041, 121335, 120473, 119455? 118281 What comes next: 182005, 363446, 544887? 726328 What is next in 347, 1893, 4383, 7823, 12219? 17577 What is the next term in -1244, -6195, -14682, -26693, -42216, -61239, -83750? -109737 What comes next: -1564, -2408, -2524, -1900, -524, 1616? 4532 What comes next: 59568, 59483, 59350, 59169, 58940, 58663? 58338 What comes next: 318452570, 636905141, 955357712? 1273810283 What is the next term in -259, -616, -1131, -1738, -2371? -2964 What is next in -845942, -3383730, -7613380, -13534892, -21148266, -30453502? -41450600 What is the next term in 1246606513, 1246606512, 1246606511? 1246606510 What comes next: 2704069, 2704087, 2704105, 2704123, 2704141, 2704159? 2704177 What is next in -39980927, -79961851, -119942775? -159923699 What is the next term in 65528, 80375, 105110, 139727, 184220, 238583, 302810? 376895 What is the next term in -563, -549, -483, -341, -99, 267, 781? 1467 What is next in 5239, 4519, 3813, 3121, 2443? 1779 What comes next: -22952, -46013, -69088, -92183, -115304, -138457, -161648, -184883? -208168 What comes next: -142003, -284113, -426233, -568369, -710527? -852713 What is the next term in -9315857, -9315861, -9315865, -9315869? -9315873 What comes next: -50919529, -101839060, -152758591, -203678122? -254597653 What is next in 14078929, 14078920, 14078911? 14078902 What is the next term in -6916, -7488, -8046, -8578, -9072, -9516, -9898? -10206 What is the next term in -66323862, -132647722, -198971582? -265295442 What is the next term in 588, -1499, -3586, -5673, -7760? -9847 What is the next term in -3608694, -3608592, -3608438, -3608244, -3608022? -3607784 What is the next term in 721, -115, -1515, -3479, -6007? -9099 What is the next term in 951349, 951523, 951711, 951919, 952153, 952419? 952723 What is next in 208102, 832423, 1872960, 3329713, 5202682? 7491867 What is next in 1573835, 1573829, 1573817, 1573799, 1573775, 1573745, 1573709? 1573667 What comes next: -905, -1822, -2785, -3794, -4849, -5950, -7097? -8290 What comes next: -620, -3954, -12392, -28484, -54780? -93830 What is next in -15430523, -30861044, -46291565? -61722086 What is the next term in 57634001, 115268000, 172901999, 230535998, 288169997? 345803996 What is the next term in -123554, -494337, -1112312, -1977479, -3089838, -4449389, -6056132? -7910067 What is the next term in 30168, 120743, 271710, 483075, 754844, 1087023? 1479618 What is the next term in -342576, -685171, -1027766, -1370361, -1712956, -2055551? -2398146 What comes next: -313081, -626159, -939237, -1252315? -1565393 What is the next term in -9839, -9961, -10165, -10451, -10819? -11269 What comes next: -416, 2476, 7302, 14068, 22780? 33444 What comes next: 3758909, 3758911, 3758915, 3758921, 3758929, 3758939, 3758951? 3758965 What comes next: -377, -3735, -10085, -19427, -31761, -47087? -65405 What is the next term in -12601895, -25203784, -37805673, -50407562, -63009451, -75611340? -88213229 What comes next: -829019, -829027, -829035, -829043, -829051? -829059 What is the next term in 27255371, 27255375, 27255379? 27255383 What comes next: -37453, -37536, -37619? -37702 What is the next term in 173410, 173347, 173252, 173131, 172990, 172835? 172672 What is next in 4306, 6815, 9286, 11719, 14114, 16471, 18790? 21071 What is the next term in 1466, 6542, 14992, 26810, 41990? 60526 What is next in -471, -2040, -4633, -8238, -12843? -18436 What is the next term in -4616015, -9232025, -13848035? -18464045 What is next in -258809, -258815, -258821, -258827? -258833 What is next in -11695, -23931, -36167, -48403? -60639 What is next in -592703, -1185471, -1778241, -2371013? -2963787 What comes next: -3356, -5710, -9648, -15176, -22300, -31026? -41360 What comes next: 4997954, 4997955, 4997956? 4997957 What is next in -34609725, -34609729, -34609733? -34609737 What comes next: -228, -1844, -6752, -16764, -33692? -59348 What comes next: 119088, 237973, 356656, 475137, 593416, 711493? 829368 What is next in -11691806, -23383615, -35075426, -46767239, -58459054, -70150871? -81842690 What is the next term in 7158130, 14316268, 21474416, 28632580, 35790766, 42948980, 50107228? 57265516 What is the next term in -7178, -25574, -56238, -99170? -154370 What comes next: 10000, 39035, 87426, 155173? 242276 What is the next term in -472, -1013, -1442, -1693, -1700? -1397 What is next in -312144, -624298, -936452, -1248606? -1560760 What is next in -79764345, -79764347, -79764349? -79764351 What is the next term in -3781009, -3780911, -3780803, -3780679, -3780533, -3780359? -3780151 What is next in -4967, -5510, -6081, -6680, -7307? -7962 What comes next: -1424, 1502, 4428? 7354 What is next in 2919, 5853, 8761, 11643, 14499, 17329? 20133 What comes next: -420033, -1678975, -3777213, -6714747? -10491577 What comes next: -6884, -12172, -17460? -22748 What is the next term in -816234, -1632916, -2449608, -3266316, -4083046? -4899804 What is next in -32721, -65389, -97991, -130497, -162877, -195101, -227139? -258961 What comes next: 905998, 3623937, 8153834, 14495689, 22649502, 32615273? 44393002 What is next in -11245991, -22491957, -33737923, -44983889, -56229855? -67475821 What comes next: -12456, -51311, -116342, -207555, -324956, -468551? -638346 What is next in -2269754, -2270464, -2271186, -2271926, -2272690, -2273484, -2274314, -2275186? -2276106 What is the next term in -5359, -10733, -16117, -21517, -26939? -32389 What is the next term in -34601138, -34601134, -34601130? -34601126 What is next in 12814344, 12814423, 12814502? 12814581 What comes next: 4026, 11753, 23164, 38259, 57038, 79501? 105648 What is next in 4261, 4139	{ "pile_set_name": "DM Mathematics" }
h + 164. What is the least common multiple of s and 3? 114 Let r be (154/5)/2 - (-10)/(-25). What is the least common multiple of 35 and -3r/(-9) - -5? 70 Let c(l) = 2l3 + 8l*2 + 12. Let a be c(-6). Let w = -85 - a. Calculate the common denominator of w and 25/2. 2 Let q = -4141 - -4227. What is the smallest common multiple of -322/(-3) - 0 and q? 946 Suppose 4y - 52 = 4i, 3i - 5y = i - 41. Let o = i + 23. What is the lowest common multiple of 1 and o? 15 Let n(v) = v. Let k(r) = -12r + 3. Let l(o) = k(o) + 9n(o). Let w be l(2). Find the common denominator of w/(-36)(-472)/(-4) and -87/8. 24 Let l = -5/6 - -877/48. Let k = l + -123/8. What is the common denominator of k and 137/54? 432 Suppose -m - 2t = -14, -5m + 2t + 0t = -46. Let n = 15 + -9. Calculate the lowest common multiple of n and m. 30 Let d(l) = -2l + 6. Let u be d(5). Suppose -2i - 2i = -4. What is the lowest common multiple of (-2 - u)/1 + 8 and i? 10 Suppose 3j - 2m - 48 = -11, j - 29 = 4m. What is the smallest common multiple of j and 8/6(-27)/(-6)? 18 Suppose -2i + 3i = 35. Let a be 10/(-25) - 267/(-5). Let t = a - i. What is the smallest common multiple of t and 4? 36 Find the common denominator of 44/27 and (-308)/33(-4)/88. 297 Suppose -5s + 94 = -y, 55 = 3s - 5y + 3y. Let q = s + -12. Suppose 3k - 5k + 8 = 0. Calculate the lowest common multiple of k and q. 28 Let b = -4042 + 16251/4. Suppose -2h = 2h - 12. What is the common denominator of 1/h + 56/9 and b? 36 Let r be (8 + -10)527/2. Let a = 8429/16 + r. Calculate the common denominator of (-4)/18 + (-436)/72 and a. 144 Suppose 37s - 1125 = 355. Calculate the least common multiple of s and 22. 440 Suppose -3d - 2d = 4i - 11, -i = -d - 5. Calculate the least common multiple of i and 6(-66)/(-54)3/2. 44 Let l(r) = -2r3 - 20r*2 + 43r - 36. Calculate the smallest common multiple of 28 and l(-12). 168 What is the least common multiple of ((-1465)/3)/((-490)/(-84) - 6) and 16? 23440 Let i = 426624 - 3748745092/8787. Let p = 1080841/87870 + i. Find the common denominator of p and 67/3. 30 Calculate the least common multiple of 147 - 7/(-14)6 and 12. 300 Let i = -112897/18 + 6279. Find the common denominator of i and ((-2)/8)/((-33)/2486). 18 Let p(k) = -k + 19. Let s be p(-5). What is the common denominator of 27/8 and (-14)/21149/s? 72 Let a = 95 + -255. What is the common denominator of 3/(-2) + (-54)/(-14) and (4/a)/(2/(-348))? 140 Suppose s = -4s + 25. Let o = s - 2. Suppose y - 85 = -5h, oh + 3y + 2y = 73. What is the lowest common multiple of 18 and h? 144 Suppose 3j = 5f + 4, 0 = -4j + f - 4 + 15. Suppose 23 = -jg - 94. Let x = g - -59. Calculate the smallest common multiple of x and 18. 180 Let d be (0 + 39)(4 - 3). Suppose -2b - 16 = 64. Calculate the lowest common multiple of 14 and d/15 - (-24)/b. 14 Let k = 12 - 4. Suppose 0 = 6o - 837 + 105. Let f = o - 115. What is the lowest common multiple of k and f? 56 Suppose 0 = 3g + 2w - 1, -g - 6w = -2w - 7. Let i = -1373/66 - -121/6. Find the common denominator of i and g. 11 Let g(f) = -2f3 + 25f*2 + 13f + 10. What is the least common multiple of g(13) and 116? 580 Let p(l) = -l*3 + 7l*2 - 9l + 9. Let x be p(6). What is the common denominator of -73/6 and x/3 - 15/(-6)? 6 Suppose -15y = y + 64. Find the common denominator of -52/3 and (-3)/y(-1572)/(-54). 6 Calculate the least common multiple of 87 and (-8)/(-6) + -2 + (-6262)/(-186). 957 What is the common denominator of 97/(-348) + (51/68 - 1) and 34/27? 783 Let h = -64 + 66. Suppose -4t = -h - 2. Calculate the smallest common multiple of 18 and t. 18 Suppose j + 0 - 4 = 3k, 2j - 24 = -2k. Let u = -8 - -13. Suppose un = 8n - 24. What is the least common multiple of j and n? 40 Let d be (-7 - -3) + 35 + 3. Find the common denominator of -37/18 and (-3)/(132/d) + -3. 198 Let f = 17 + 1. Let z = 61/173 - -11999/2768. Calculate the common denominator of (f/4 - 3) + -4 + -1 and z. 16 Let p = 10239 + -12737317/1244. Let b = 534921929305/115986876516 - 85/31079013. Let o = b + p. Find the common denominator of 17/2 and o. 18 Let z = 34 - 21. Let n = 4 - z. Let d = 27 + n. Calculate the lowest common multiple of 22 and d. 198 Let t(u) be the third derivative of 0u + 1/2u*3 + 4u*2 + 0 - 1/12u*4. Calculate the smallest common multiple of 9 and t(-3). 9 Calculate the lowest common multiple of -3(-9)/((-18)/(-164)) and 30. 1230 Let y be (-4)/26 + (-134)/(-26). Suppose b + z - 1 = 0, 0 = yb - b + 5z. Suppose -bp + 2 + 8 = 0. Calculate the least common multiple of p and 8. 8 Suppose 13 = 7w + 48. What is the least common multiple of 4 + ((-8)/5)/(2/w) and 3? 24 Let h be 1/6 + 406601/78. Let m = -78146/15 + h. What is the common denominator of -79/24 and m? 120 Let w(n) = n*3 + 4n*2 - 11n + 11. Let j be w(-6). Suppose -jh + 22 = 2c, -3c - 5h + 46 = 18. What is the least common multiple of c and 8? 24 What is the common denominator of -19/88 and ((3 + -2)/(-12))/((-10)/(-153))? 440 Calculate the lowest common multiple of (2 + -3 + 547)/2 and 147. 1911 Suppose s = -3s - 20. Calculate the common denominator of 107/6 and -4 - s - 122/(-8). 12 Suppose 0 = 6x - 4x - 42. Let c = 11617 + -11608. What is the least common multiple of c and x? 63 Find the common denominator of 74/135 and 830/(-225)18/24. 270 Suppose -3t - 1 = 4r + 6, 0 = -4r + t + 13. Let k = r - -2. Suppose -444 - 870 = -72c + 270. Calculate the smallest common multiple of k and c. 44 Let g(o) = o*3 - 5o*2 + 6o - 63. What is the lowest common multiple of g(6) and 117? 117 Let s(a) = -a*3 - 11a*2 - 10a + 20. Let u be s(-10). Let i = u - 19. What is the smallest common multiple of 6(i - (-15)/9) and 10? 80 Suppose 14 = m - 2q, 4q + 0q = -5m + 14. What is the lowest common multiple of m and 17? 102 Let y be (7 - 401)/(-2 - 0). Calculate the common denominator of y/20 - (1/(-4) + 0) and 47/9. 90 Suppose -5m + 275 = -b, -b + 2b = 0. Let r = m + 23. Let p = r - 34. Calculate the common denominator of p and 1/9. 9 Let x(r) = -3r*3 + 5r*2 + 42r + 52. Suppose b = 32 + 4. Calculate the lowest common multiple of x(-2) and b. 36 Let p = 1173 - 6967/6. Calculate the common denominator of p and (582/(-8))/(15/10). 6 Let g = 43/28 - 25/112. Find the common denominator of g and (66/(-4))/3 - (-4)/16. 16 Let i = -40 - -5. Let p = i - -39. Calculate the smallest common multiple of p and 11. 44 Let m(s) = s. Let h = 18 - 13. Suppose 5l - 3 - 13 = d, 0 = hl - 5d. Calculate the smallest common multiple of m(l) and 7. 28 Let z = 328829/104955 + 2/6997. Find the common denominator of -22/15 and z. 15 Suppose 5l - 46 = -3j - 1, 4j = 3l + 31. Let i = 33 - 17. Suppose 0t = -2t + i. Calculate the smallest common multiple of j and t. 40 Let r(p) = -p3 - 8p*2 - 6p + 22. Let x be r(-7). Suppose 0 = f - 6 - x. Calculate the least common multiple of 4 and f. 84 Let c(d) = d*3 - 3d + 2. Let r be c(2). What is the common denominator of (-308)/48(-3 - (-14)/r) and -40/27? 216 Let s be (1 + (-16461)/12)14/5. Let z = s - -3833. What is the common denominator of -79/18 and z? 90 Let p = 697426813/22 + -31708510. Let r be -7297 - (1/4)/(1/(-4)). Let h = r - p. Calculate the common denominator of h and 97/2. 22 Let k(n) = 2n - 11. Let v be k(5). Let c be (-77)/21(v + -2). Suppose 44 = 4b - 4g, -g - 3g - c = -b. Calculate the smallest common multiple of b and 9. 99 Let h(a) = -a2 - a. Let g(r) = -10r*2 - 10r - 8. Let f(y) = 2g(y) - 22h(y). What is the smallest common multiple of 36 and f(-6)? 396 Suppose -23p = -28p + 8365. Suppose 3v + 335 = -4m + p, -3v - m = -1347. Calculate the common denominator of -1/14 and ((-2)/(-10))/((-468)/v). 182 Let s be (193-1)/(26 + 2). Let i be 6/1429/3. Let k = s + i. Calculate the common denominator of -87/8 and k. 8 Let h = -28 - -98. Find the common denominator of 34/5 and 5/h-2 + -1. 35 What is the common denominator of -12(-8)/(-24) + (-398)/(-120) and -49/15? 60 Let p be (2/416/(-8))/1. Calculate the common denominator of 1 + (1 - (-17)/22) + p and 59/4. 44 Suppose -3r - 18 = 42. Let p = 20 + r. Suppose -5o - 21 = i, 0 = 4i + 3o - p*o - 1. Calculate the smallest common multiple of i and 2. 4 Suppos	{ "pile_set_name": "DM Mathematics" }
c be z(13). Solve -2n - 10 = -i, -5i - cn = -0n + 10 for i. 0 Let h = 63 + -63. Let g(u) = -u*3 + 7u*2 - 8u + 9. Let t be g(6). Let z be 0/((-6 - t)/3). Solve -m + hm - 2 = -p, m + 2p - 13 = z for m. 3 Let g(b) = b*3 - 7b*2 - 5b + 1. Let o be g(5). Let p(x) = 41x - 16. Let s be p(3). Let w = o + s. Solve -3n = 2n - 4a + w, -4 = -2a for n. -5 Let x = 1 + 3. Suppose xq - q - 4b = 34, 5q = -5b + 45. Suppose -7k + 2a = -2k - q, -32 = -3k - 4a. Solve 3o + 8 = ko - 2g, 5o - 14 = -3g for o. 4 Suppose -4n + 372 = -3h + 6h, -3n + 308 = -5h. Let z = n + -92. Solve -2i = 3p + 2i + z, 0 = -2p + 2i - 12 for p. -4 Let m = 300 + -297. Solve p - 10 = 4u + m, -p - 8 = 3u for p. 1 Let s be (-2 - -4) + -1 + 2. Let o(c) = 3c + sc3 - 4c*3 + c + 2 + c. Let x be o(-3). Solve -2i + 2n = -n - x, 0 = -i + 2n + 8 for i. 4 Let d be 2((-40)/(-20))/(8/14). Solve f = -b - 9, -5b - 36 + d = f for f. -4 Let q be (49 + -25)/(6/4). Solve -4 = -f, -2p + 4p + 4f = q for p. 0 Let f(x) = 21x - 2. Let p be f(2). Suppose 3l - p = -s - l, -2l = s - 34. Let i be (5/4)/(7/s). Solve 27 = iz - v + 1, 5z = -v + 24 for z. 5 Let b(w) = 3w + 14. Let s be b(-8). Let h be -1 + 3 - 0 - s. Let o be (-40)/(-15)6/4. Solve -2n + 13 = 5y, 5y - 1 = on - h for y. 1 Suppose 2v - 55 + 39 = 0. Solve -3j + v = -4g + j, j = 3g for g. 1 Suppose 2k + 2k + 5 = -v, 0 = 4v - k - 14. Suppose -3g + 3 = v. Solve g = -3h + 3b, h - 3 = -4h + 4b for h. 3 Let d be (2/3)/((-2)/(-72)). Suppose 17i - 144 = -31i. Solve -6s - d = -is + 5m, 4s - m + 9 = 0 for s. -3 Let n(g) = 27g - 133. Let h be n(5). Solve 5t - 2s + 15 = hs, -4s - 9 = 3t for t. -3 Suppose -4p - 13 = -1. Let t = p + 14. Suppose 6u - 4c = u - t, 3u - 5c + 17 = 0. Solve -m = -u, 3m - 1 + 10 = -3s for s. -4 Let s = 78 - 90. Let d be 42/s22/(-7). Solve -2o - 18 = dy, 3o + 11 = -o + y for o. -4 Suppose -675 + 645 = -10c. Solve -ci + 6 = j, 2i = 3j - 2j + 4 for i. 2 Suppose -128 = -11t + 59. Solve -3y + p + 5 = 0, -5p - 8 = -2y + t for y. 0 Let g = 14 + -14. Suppose 10j - 7j = g. Suppose -2p = -j - 6. Solve 2 + 3 = -pi - 4h, -i - 8 = -5h for i. -3 Suppose -62 - 36 = 7x. Let z be (-10)/25(x + 4). Solve 2r + z = 3r - 2y, 0 = -r - 2y + 4 for r. 4 Suppose -2j = -2a + 8, 4a + 3j = 44 - 0. Let y = -5 + a. Suppose 3x + 0x - 10 = z, -16 = 2x + 5z. Solve 0 = xp - 5h - 6 + 3, -yh = 3p + 6 for p. -1 Let p be (-8)/(-5) + 306/90 + -3. Solve 7 = -5i - 0x + 4x, -4x = -pi + 2 for i. -3 Let i = -30 + 32. Solve -2o = il + 4, -4o + 4l - 20 = -52 for o. 3 Suppose 0 = -3v + 15, l + l - 38 = -2v. Suppose -6f = f - 98. Let u = f - l. Solve 0 = -4j + 5t + 24, 2j + 3t - 6t - 14 = u for j. 1 Let o = 7 - -3. Let w be ((-18)/10)/((-3)/o). Suppose 4d = 14 - w. Solve 0 = -4m + 3l + 23, 0 = -dm - 3m - 4l - 10 for m. 2 Let m = 4 - -6. Let y be (56/(-84))/((-2)/(-3)) + 5. Solve 0 = -u - 2u + j - m, -4u - yj = 24 for u. -4 Suppose n - 5 = -3. Let j = -13 + 21. Suppose 6w = 2w + j. Solve -wk + 4z = 26, z = 5k + nz + 21 for k. -5 Suppose -2h + 13 - 5 = 0, -2g = -3h - 28. Solve -5i - 3o = -g, -i - o + 4 = -0o for i. 4 Let p(u) = -u2 + 18u + 5. Let t be p(18). Solve -2c - 13 = c - f, 3f = -tc - 17 for c. -4 Let g = -12 - -13. Suppose g = y + 4. Let m = 13 + y. Solve 4f + 2j + 3 = 13, 3f - 2j = -m for f. 0 Let l be (2 - 1)/(7 - 8). Let w = 1 + l. Suppose -m + wm = -4. Solve mf + 8 = 4a, 6a - 8 = 2a + f for a. 2 Suppose -30 = -3o - 5m, -52m - 37 = -5o - 56m. Solve 4w + 31 = 8w - 3q, ow - 5 = -3q for w. 4 Suppose 0 = -16q + 17q + v - 4, 0 = 5q - 3v - 28. Solve 5 = a + 4r - 2r, 7 = qa + r for a. 1 Suppose 160u - 162u = -6. Solve -uf - 4l + 1 = -0f, -3f + l = 4 for f. -1 Let n(b) = -6b - 258. Let u be n(-48). Solve 5x - 2m = -6m - 45, m + u = -5x for x. -5 Let y be (6(-18)/(-27))/2. Solve -4m - 5c - 7 = -yc, 5m + c = -17 for m. -4 Suppose -3w + 29 = 4n, -2w - n = 3w - 20. Solve wu + 2z = 7, -6z = -9z - 3 for u. 3 Let t = 14 - 10. Suppose 0 = 4b - 3w + 10, 3b + 35 = -2w + 53. Solve 0 = bz + 4a - 10, -4a + 18 = tz - 2 for z. 5 Let s = 20 + -19. Let m be 0/(s/24). Let u be 7 - (-2 + 5 + m). Solve -p + 3p - 4 = un, -3n = -3 for p. 4 Let i(u) = u2 - 15u - 95. Let o be i(-5). Solve -3s - 2q = -6, -3s - o = 4q - 17 for s. 0 Suppose -19v = -v. Solve 5u - 4g = 20, u - 4g - 7 + 3 = v for u. 4 Suppose -20 = -4h - 3i, 0h + 3i - 10 = h. Solve 0 = -l - 4j + 8, 0j + j = -5l + h for l. 0 Let z(h) = -h2 - 11h - 5. Let r be z(-11). Let g be r((-22)/10 - -1). Let a be (-18)/(-2 - 0/1). Solve 0 = 3x - l + a, gl - 15 = 5x + 2l for x. -3 Suppose 2c - 3c + 7 = o, -o + c + 1 = 0. Solve 2g - 2h = 12, 9h - oh + 5 = 0 for g. 5 Suppose 2v + 76 = -4u - 2v, 0 = 5u + v + 111. Let g = 47 + u. Solve 2p + 4y + g = 0, -2y - 9 = -2p - 3 for p. -2 Let i be ((-376)/141)/((-1)/3). Solve 0 = 2c + k, -k + i = 3k for c. -1 Suppose 3k - 3b - 17 = 1, k + b = 2. Solve 16 = 4z - kx, -2x = -z + 3x + 20 for z. 0 Let v(n) = 11n + 2. Let r be v(0). Solve -x = -3x + d - 3, -4d - 12 = -rx for x. -4 Let i = -325 - -327. Solve 2j = -is, -5j + 5s - s + 27 = 0 for j. 3 Let r = -13 + 19. Solve v - 3 = -x - x, x = -3v - r for v. -3 Let g be 1(0 + 7) - (-23 - -22). Solve 3 = d, -5y - 4d + g = -24 for y. 4 Let t(s) = 2s + 25. Let h be t(6). Let o = 61 - h. Let f be 4/(-2) - o/(-4). Solve 6l - 4l - 2d + f = 0, 5d - 24 = -2l for l. 2 Suppose -4z + 3h + 6 = 0, -4z + 0 = -2h - 4. Suppose z = -2u - 0u. Suppose u = -4p + p + 12. Solve 5j + 0q + 2q + 16 = 0, 2j + pq = 0 for j. -4 Let p = -118 + 120. Solve -3c + 6 = 4u - 5, -c - 3 = -pu for u. 2 Suppose 5r - 3w - 18 = 0, -2r - 2r - w + 11 = 0. Solve f + 3u - 1 = 0, -5f + 4u + 8 = r for f. 1 Suppose -4a = 41b - 44b + 18, -4b = -4a - 20. Solve -6y + 7y + 3 = bg, -35 = -3y - 5g for y. 5 Suppose 0p - 120 = -4p. Let h(c) = 9c + 8c - c2 - 19c. Let f be h(0). Solve -3y - 5k + p = f, 3y + 0k - 24 = -3k for y. 5 Let j be 053/15. Suppose -o = -j - 2. Solve a + 3w + o = -1, 4w = -3a + 1 for a. 3 Let c be ((-24)/32)/(1/(-4)). Let y(q) = -q*c + 9 - 2q*3 + 3q*3 + 7q - 5q2 - q3. Let j be y(-6). Solve i + s = -1, ji + 4s + 4 - 3 = 0 for i. -3 Suppose -3r - p - 110 + 167 = 0, -3r = -4p - 57. Solve 2l + 3l + s = -r, 0 = -3l + 5s + 11 for l. -3 Suppose 2q = -4v + 14, 4q = -6v + 26 - 8. Solve y - 2l + 17 = -5l, 4y - vl = 17 for y. -2 Suppose 3b = 18 + 42. Let f be (-24)/b(0 - 5). Let t be (f/(-4))/(-3)10. Solve tm - 7 = 4y, y - m + 11 = 5y for y. 2 Let j(f) = f + 21. Let m be j(-10). Let a be 35/11 + (-1)/(m/2). Solve 5s = -5, 2c - 4s = -ac + 24 for c. 4 Let r = 168 - 166. Solve -5z + rm = -0m - 20, -m - 5 = 0 for z. 2 Suppose -29 = z - 29. Solve z = -4d + 3q - 7, -d + 4q = 2d + 7 for d. -1 Suppose 5q = 4h + 8, 6 = q + 3h - 6h. Suppose 5b = -z, 4z + 2b + 2b = q. Solve 3u - r + 8 = z, -8u + 3u - r - 24 = 0 for u. -4 Let t be ((-72)/16)/(4/(16/(-6))). Solve 5k - 4 = -3x, k - tk + x = -6 for k. 2 Suppose -a - 146 = -5h - 121, -a = -3h + 15. Solve x + 4 = -t - 1, ht + 25 = -x for x. 0 Let w be -2 + 7/((-7)/(-6)). Solve -5r + s - 25 = -4s, s - w = 0 for r. -1 Suppose 68p - 175 - 437 = 0. Solve -2d - 6 = 0, -ph - 5d = -8h + 12 for h. 3 Let k be -1 - (8-1 - -3). Suppose -2t + k = -0t. Let l = -218 - -221. Solve to + lh = -0 + 6, 5h - 29 = 3o for o. -3 Let z(w) = 2w - 5w + 21w. Let q be z(1). Suppose 5t = 2t + 2s + q, 2t + s = 5. Solve -4g = k + 1, 9k + 2g + 5 = tk for k. -1 Let x(l) = l3 + 19l*2 - 20l + 6. Let n be x(-20). Let i be 10(n/(-10) + (-1 - -2)). Solve w = 5f - if + 6, 3f = -3w + 6 for w. 4 Let f(w) = -w2. Let c = 7 - 7. Let h be f(c). Suppose h = -0u + u - 1. Solve -1 = 3v + o + 4, o - u = 0 for v. -2 Let l be 1(-3 - 0)/(-5 + 4). Solve 4z = -2v - 8, 4v - 3z = -2 - l for v. -2 Let k = -128 + 128. Solve ku + u - 13 = 5y, -4u - 5 = -y for y. -3 Let j = -971 + 977. Solve jf - 2f - 2t = -14, 5f - 5t = -15 for f. -4 Let k be 3/(21/196) - (-3 + 6). Solve 6 + 16 = -4o - g, 5	{ "pile_set_name": "DM Mathematics" }
-1) - -1. 4 Let r be (5 + -2)/(-1) + 3. Suppose 2m - 4m + 108 = r. What is the remainder when m is divided by 19? 16 Let k = 14 + -5. Calculate the remainder when 46 is divided by ((-36)/10)/(k/(-30)). 10 Suppose 0 = 4c + 2v - 1042, -c - 5v = -v - 271. What is the remainder when c is divided by 10? 9 Suppose -17w + 22w - 105 = 0. Calculate the remainder when 82 is divided by w. 19 Let c(n) = -3n - 4. What is the remainder when 33 is divided by c(-7)? 16 Let i(o) = o + 26. Calculate the remainder when 36 is divided by i(-16). 6 Suppose 5m - 27 = -4n, m = -0m + 5n - 12. Suppose -mx = -0x - 18. Calculate the remainder when 46 is divided by (-2)/(-2) - (-138)/x. 22 Let b = 4 - 3. What is the remainder when (-10 + 1)/(-6(-3)/(-6)) is divided by b? 0 Let y = -2 + 8. Let q be 374/y + 2/(-6). Suppose q = 5x - 8. Calculate the remainder when 41 is divided by x. 13 Calculate the remainder when 15 is divided by -143/(-2). 3 Let b(y) = -8y - 106. Calculate the remainder when b(-20) is divided by 28. 26 Let n = 11 - -4. Let l(i) = -7i + 1. Calculate the remainder when n is divided by l(-1). 7 Let c(z) = -z*3 - 8z*2 - 7z + 7. Calculate the remainder when 23 is divided by c(-7). 2 What is the remainder when 267 is divided by (-1)/(16/(-20))(28 - 4)? 27 Suppose 5h + 0a - 21 = 2a, -10 = -5a. Suppose -3m + 70 = hf, -5f + 131 = 5m + 31. Calculate the remainder when m is divided by 2/8 + (-62)/(-8). 7 Let x = 100 + -68. Calculate the remainder when x is divided by 9. 5 Let l(z) = -6 + 4z + 3 + 4 - 5. What is the remainder when l(7) is divided by 4/(-14) + 93/7? 11 Let l = -20 + 20. Suppose -n - 2n + 27 = l. What is the remainder when n is divided by 4? 1 Suppose -l = -2w + 3l + 64, -5w + 2l + 120 = 0. Let o(f) = -6f - 12. What is the remainder when o(-9) is divided by w? 20 Let l(b) = b*2 - 8b + 7. Let i be l(7). Suppose -4t - 4p + 6 + 2 = 0, i = -3t + 5p + 22. Calculate the remainder when t is divided by (-1 - -2)/(3/6). 0 Let m(w) = -w + 1. Let u be m(1). Suppose u = y + 5c - 6, c + 1 = y - 5. Calculate the remainder when 9 is divided by y. 3 Suppose 0 = -2d + d - 5. Let w(b) = -4b - 5. Calculate the remainder when 43 is divided by w(d). 13 Let x be (5 + 0)(-1 - 0). Let a(k) be the second derivative of -k5/20 - k4/2 - k*3 + 3k*2/2 - 7k. What is the remainder when 14 is divided by a(x)? 6 Let g(v) = 2v3 - 6v*2 + 3v + 10. What is the remainder when g(3) is divided by 13? 6 Suppose -2 = -3f + 4w, -4w - 35 = f - 9. Let v = 8 + f. Suppose 5q - 86 = -d, -53 + 21 = -2q + vd. What is the remainder when 32 is divided by q? 15 Let s = -4 + 11. Let f(v) = v + 3v2 - 7v*3 - 4v*2 - 3v*2 + 6v*3. What is the remainder when f(-5) is divided by s? 6 Suppose 4y = -299 - 13. Calculate the remainder when (-2 + y/9)-3 is divided by 11. 10 Let h = 110 + -103. Let z = 37 - 10. What is the remainder when z is divided by h? 6 Let n = 17 - 42. Let w = n - -53. Calculate the remainder when 81 is divided by w. 25 Suppose -35 = -3k - 3h + 1, -3k + 4h + 43 = 0. Let i = 0 + k. Calculate the remainder when 51 is divided by i. 12 Let k be (-64)/11 + (-4)/22. Let c = -7 - -9. Calculate the remainder when 8 is divided by c/(k/15)-1. 3 Suppose f + 1 - 5 = 0. Calculate the remainder when 10 is divided by f. 2 Calculate the remainder when (-1 + 2)/((-2)/(-22)) is divided by 3. 2 Let p be -3 + 2 + -2 - -2. Calculate the remainder when 13 is divided by (p + -1)/((-2)/7). 6 Suppose l = -2v - 0v - 4, -4l - 4 = 2v. Suppose l = -x + 21 - 2. Calculate the remainder when 75 is divided by x. 18 Suppose 0 = p - 8p + 273. Calculate the remainder when 76 is divided by p. 37 Let z = 28 - -15. Let t = 114 + -38. Calculate the remainder when z is divided by t/5 + 5/(-25). 13 Suppose 6u = u + 20. Suppose -l = -s + 8, 8s + ul = 4s + 48. What is the remainder when 28 is divided by s? 8 Let f(d) = 3d - 13. Let m(g) = -g + 4. Let p(q) = 3f(q) + 8m(q). Calculate the remainder when p(10) is divided by 3. 0 Suppose -5u = -5t - 20, 25 = -5u - 5t + 5. Suppose -3 = 5d - 6d, u = -m - d + 13. What is the remainder when m is divided by 6? 4 Suppose 0 = -x - 4q - 64, 0 = -0x + 3x + 3q + 201. Let z = -48 - x. What is the remainder when 59 is divided by z? 19 What is the remainder when (11/(-22))/(2/(-112)) is divided by 10? 8 Suppose -36 = -3v - 2m - 8, -v + 18 = 5m. Calculate the remainder when v is divided by 5. 3 Suppose 3g - 72 = -0g. Suppose -4k = 2y - g - 10, -k + 1 = -y. What is the remainder when 47 is divided by (15/9 - -1)k? 15 Let n = 91 - -48. What is the remainder when n is divided by 47? 45 Let c = 9 + -4. Suppose -5f - 4g = -110, cg = 2f - 6f + 88. What is the remainder when 64 is divided by f? 20 Suppose 15k - 759 = 4k. What is the remainder when k is divided by 12? 9 Let h = 28 - 27. What is the remainder when 3 is divided by h? 0 What is the remainder when 1135/45 + (-8)/36 is divided by 18? 7 Suppose 0 = -2u - 5 - 43. Let t = u + 44. What is the remainder when t is divided by 11? 9 Let y be (-3)/3 + 6 + -1. Suppose -yd + 86 = 2. Suppose 19 = 2a + j, -4a + 36 = j + 1. What is the remainder when d is divided by a? 5 Suppose -7 = -4v + 113. What is the remainder when v is divided by 11? 8 Let o(m) = -56m - 3. Let p be o(-3). What is the remainder when p/22(-24)/(-5) is divided by 19? 17 Suppose -2 + 13 = -z. Let i = 27 + z. What is the remainder when 29 is divided by i? 13 Let o be (2 - -11) + (-4)/(-2). Let r = -10 + o. Calculate the remainder when (-186)/(-14) - (-2)/(-7) is divided by r. 3 Let y(s) = 5s + 4. Let b = 2 + -2. Suppose -4l + 4 = -2n, bl - 4l + 28 = 4n. Calculate the remainder when y(l) is divided by 10. 9 Let q(i) = -3i + 5. Calculate the remainder when 56 is divided by q(-5). 16 Let f = -19 + 17. What is the remainder when 41 is divided by 11/(f/8-2)? 19 Let y = 110 - 84. What is the remainder when y is divided by 14? 12 Let r(b) = b - 1. Let i be r(4). Suppose 0 = -2x + x - 5m - 12, 19 = ix + 4m. Let w(z) = -z*2 - 7z - 3. What is the remainder when x is divided by w(-5)? 6 Let a(p) be the first derivative of 11p2/2 - 3p + 1. What is the remainder when a(4) is divided by 21? 20 Let b = 40 + -28. Suppose 4r - 34 = 54. Calculate the remainder when r is divided by b. 10 Suppose 5d - d = -5o + 103, -d = 2o - 22. What is the remainder when 92 is divided by d? 28 Suppose 0 = -5w + 4y + 34, 5y + 36 = 4w + 4y. Let o = 34 - 12. Suppose -3p + o = -2r, 4p - 8 = r + 13. Calculate the remainder when w is divided by p. 2 Suppose 3a = -5l + 130, -l - 79 = -4l - 2a. Calculate the remainder when l is divided by 13. 10 Let n = 66 + -46. What is the remainder when 39 is divided by n? 19 Let h(f) = f*3 - 9f*2 - 10f - 3. Let m be h(10). Let y = 9 + m. What is the remainder when 9 is divided by y? 3 Suppose -3y - 2 = -2z - 5, z + y - 6 = 0. Let h = z - 2. Suppose -2n = -7n + 5u + 25, -4n - 12 = 4u. Calculate the remainder when h is divided by n. 0 Let h be ((-6)/4)/((-4)/8). Let d(i) = -1 + 3 - 7i*h - 2i + 8i3. Calculate the remainder when 11 is divided by d(2). 5 Suppose -30 = 2m - 4m + 2s, -5s + 5 = -m. Calculate the remainder when 36 is divided by m. 16 Let h(o) = -o2 + 6o + 1. Let s be h(5). Let b be s + (1 - (1 - -1)). Suppose 0 = bx - 52 - 58. Calculate the remainder when x is divided by 8. 6 Suppose 4a = 2i + 61 - 15, 2a - 3i = 21. Calculate the remainder when 34 is divided by a. 10 Let t be 0 + 5/(10/(-6)). Let v = t + 12. Suppose 24 = -2h + 58. What is the remainder when h is divided by v? 8 Let l be (-16)/(-8) - 103/1. Suppose 4w - 39 = w. Calculate the remainder when 2/(-8) + l/(-4) is divided by w. 12 Let d(p) = p3 + 10p*2 + 7p - 11. Calculate the remainder when d(-9) is divided by 4. 3 Let a = 73 + 45. What is the remainder when a is divided by 30? 28 Let i(t) be the first derivative of t*4/4 + 10t*3/3 + 5t + 1. What is the remainder when 9 is divided by i(-10)? 4 Let h = 2 - 0. Suppose 35 = 2n - 5i - 0i, n = hi + 15. Let p(t) = 10t*2 - 1. Calculate the remainder when p(-1) is divided by n. 4 Let u = 4 - -28. What is the remainder when u is divided by 9? 5 What is the remainder when (6/(-4))/(	{ "pile_set_name": "DM Mathematics" }
949/21 + -521. Calculate the common denominator of u and -2 + (31/3 - -2). 21 Suppose 0 = -4b + 20 + 12. Let a be (-2)/1(-88)/b. What is the common denominator of 4/a + (-2401)/924 and 35/8? 24 Let p(b) = -4b + 53. Calculate the common denominator of 22/43 and p(13). 43 Suppose -3x = -8 + 5. Suppose -3 = 2q - 4q + b, 5b = 3q - x. Suppose qg = -0g + 20. Calculate the smallest common multiple of g and 4. 20 Let t be (1/(117/54879))/(1/3). Let b = t - 1406. Calculate the common denominator of b and -26/3. 39 Let d(l) = l*2 - 3l. Suppose 2m + 2 = 12. Suppose -mv - 3s = -14, 3v - 5s = 2v + 14. Calculate the lowest common multiple of 4 and d(v). 4 Let k = -32 + 44. Suppose 0 = -5y + ky - 112. What is the lowest common multiple of y and 22? 176 What is the common denominator of -15/16 and ((-2)/8)/(37/(-82))? 592 What is the lowest common multiple of (-1897)/(-42) + 3/(-18) + 0 and 90? 90 Let c(k) be the third derivative of -5k4/24 - 7k*3/3 - 2k*2. Calculate the common denominator of c(-5) and -43/10. 10 Let c = -560 - -8963/16. What is the common denominator of c and 2810/2508 + (-16)/88? 912 Let x = -56795/12 + 4723. Let z be 52/(-3) + (-4)/6. Calculate the common denominator of x and 82/z + 1/(-2). 36 Let p(j) = 2j*3 - 45j*2 + 24j - 32. Calculate the lowest common multiple of 440 and p(22). 1320 Let i = -12/41 + -390/1189. Let x = i - 1194/319. Find the common denominator of x and 154/(-20) - (5 - 6). 110 Let l = -5 + 10. Let x be 0 + 5 - (2 - l). Calculate the common denominator of ((-12)/x)/(60/86) and 85/18. 180 Let j = -739 + 2985/4. Find the common denominator of j and -101/196. 196 Let m be (-8 + 14099)/(2/(-6)). Let z = 1860109/44 + m. Calculate the common denominator of z and 67/12. 132 Let l(m) = -67m2 - 3. Let z be l(1). Let b(f) = -5f + 2. What is the lowest common multiple of b(-2) and -1(-56)/10 - 28/z? 12 Suppose -2n + 54 = -3k, 3n - 106 = -n + 5k. What is the least common multiple of n and 96? 96 Let x = -1034 + 620. Calculate the common denominator of (3/(-42))/(1/(-46)) and 2/6 + x/189. 7 Calculate the common denominator of 29/201 and 94(-3)/168 + (-30)/40. 1407 Suppose -5l = -2w + 5, -2w + 6w - 35 = 5l. Let b = 15 - w. Suppose 24 = -bn + 4n. What is the smallest common multiple of 6 and n? 6 Suppose -31r + 1617 = 191. Calculate the least common multiple of 1 and r. 46 Let x be (3 + 12/(-3))-701. Let z = -7019/10 + x. What is the common denominator of 3/22 and z? 110 Let b(i) = -i + 12. Let o be b(6). Suppose -om + 36 = -0m. Suppose 3k - 3w = -2w + 34, w = -k + m. What is the smallest common multiple of 8 and k? 40 Let p = -11781 + 3074837/261. Let d = p - 18523/522. What is the common denominator of -57/28 and d? 28 Suppose y + 0m - 5m = -33, 4y - 4m = -84. Find the common denominator of 48/7 and -1(-4)/(128/y). 112 Let z = 3413 + -27257/8. Let y(a) = -a - 955. Let r be y(0). Let p = -2891/3 - r. Calculate the common denominator of z and p. 24 Let n = 505 - 410. What is the lowest common multiple of n and 76? 380 Suppose -26 = -4p + l, 4l - 9l = p + 4. Calculate the least common multiple of p and 4. 12 Let u = 13/238 - -18/119. Let p = 26 + -16. Find the common denominator of 423/91/p and u. 170 Find the common denominator of (0 - 1) + (-83)/(-14) and (-6)/(-4) + 9 + -5 + 9. 14 Let z(l) = -l3 + l2 + l + 6. Let f(h) = -h2 + 18h + 11. Let d be f(18). Suppose 88 = db - 7b. Calculate the lowest common multiple of z(0) and b. 66 Let p = -84 + 24. Calculate the common denominator of (-25(-34)/(-935))/((-2)/3) and 2/4 - (-78)/p. 55 Let b be 2 - 4 - 72771/27. Let o = 2694 + b. What is the common denominator of 19/6 and o? 18 Let l = -1876 + 2085. Calculate the least common multiple of 209 and l. 209 Suppose -36 - 99 = -5l. Calculate the common denominator of 134/220 - (-1 - -2)/5 and 2/(-2) + l/(-24). 88 Let h = -23/58 - -1006/87. Find the common denominator of h and 65/51. 102 Let m be ((-1332)/(-3) + 3)/(-1). Let y = 6631/15 + m. What is the common denominator of y and 28/3? 15 Let i = 78 + -260/3. Let q = -45 - -67/2. What is the common denominator of i and q? 6 Suppose 3r = -0r - 5n + 80, 3r - 96 = 3n. Suppose -3g - r = -8g. Let v(t) = -t3 + 7t*2 - 2t - 6. Calculate the least common multiple of v(g) and 18. 18 Suppose -4v = -3j + 1, 2j = -2v + 5j - 5. Suppose 4y - 24 = -vb, 2b - 4b + 3y = 11. Calculate the common denominator of 119/6 and 377/208 + b/4. 48 Suppose -t + v = -10, -5t + 2v + 68 = 6v. Suppose -4194 = -13c - 3934. What is the least common multiple of c and t? 60 What is the common denominator of -55/4 and (-3425)/1002/66? 132 Let x = -186 + 234. Calculate the least common multiple of x and 60. 240 Find the common denominator of 3(-1 - -2) - (-428)/(-220) and -107/40. 440 Let q(z) = 6z3 + z2 - 5z + 10. What is the least common multiple of 260 and q(2)? 260 Let c = -70 - -98. Suppose u = -1 + 33. Let j = u - c. Calculate the lowest common multiple of 7 and j. 28 What is the common denominator of -1/24 and (2/((-16)/(-6)))/((-81)/189)? 24 What is the common denominator of ((-22)/55)/(36/485) and 82/33? 198 Let y = 21/334 - -13693/2672. Find the common denominator of 43/316 and y. 1264 Let r(z) = -z*3 - 13z*2 + 13z - 12. Let h be r(-14). Suppose hb + 4b - 12 = 0. What is the least common multiple of b and (15/6 - 2)2? 2 Let q(k) = -k + 8. Let h be q(-6). Suppose 3m - 5u - h = 0, 0m + u = m - 4. Calculate the lowest common multiple of m and 6. 6 Let x = 23007367/168 + -136949. What is the common denominator of x and 55/93? 5208 Let n(z) = -z*2 + 6z + 3. Let t be n(4). Suppose 2k = -43 - t. Calculate the common denominator of (3/k)/((-6)/(-258)) and -8. 9 Suppose 175 - 60 = 5v. Calculate the smallest common multiple of v and 23. 23 Suppose 4f = 3g + 26, 5f + 4g = -0g + 17. Suppose -f = -5w, -5y + 57 = -5w + 2w. Let l = y - 8. Calculate the lowest common multiple of l and 6. 12 Calculate the smallest common multiple of 94 and (15 + -2)/((-1)/(-2)). 1222 Let p(u) = -20u + 15. Let t be p(-6). Let f = -99 + t. Calculate the least common multiple of f and 8. 72 Suppose 0 = 4x + 20, 4x = -5h - 37 + 1042. Calculate the least common multiple of h and 5. 205 Let y = -328782049 - -518245653. Let t = y - 264301716151/1395. Let r = t - -39/155. Calculate the common denominator of -55/6 and r. 18 Let p(v) = -46v - 4. Let b be p(-9). Let g = b - 246. Calculate the lowest common multiple of 10 and 2/(-4 + g/40). 20 Suppose -5l = -3q + 8, -l = q + 1 + 7. What is the common denominator of (l/6)/(30/(-432)) and (-10)/(-4)(-98)/(-10)? 10 Let q = -83653843/11543904 - -7292/11637. Let b = -5/992 + q. Let n = -16135 - -322793/20. Find the common denominator of n and b. 40 Let z = 132 + -18. Suppose -5y = -2o - 216, -3y - 6o + z = -2o. What is the lowest common multiple of 2 and y? 42 Let r = -2/6649 + 352433/119682. Calculate the common denominator of 13/30 and r. 90 Suppose -2s + q + 3q - 26 = 0, -4s + 3q = 27. Let k(l) = 2l + 22. Calculate the smallest common multiple of (-3)/((-3)/7) - s and k(-7). 40 Let k(a) = -a2 + 11a - 5. Let t be k(11). Let x(q) = q + 7. Let o be x(t). Suppose -d + 8 = -o. What is the least common multiple of 2 and d? 10 Let a = 3577 - 35691/10. Suppose o + 14 = w, 0w + 5o + 50 = 3w. Find the common denominator of a and (-605)/5(-1)/w. 10 Let q(k) = 2027155k2 - 3k - 7. Let m be q(-3). Let o = m - 15252310241/836. Let w = o + -2/209. What is the common denominator of 13/11 and w? 44 Suppose -118u + 112u + 636 = 0. Calculate the least common multiple of u and 5. 530 Suppose 2k - 223 = -3c, -360 = -5c + 3k + 37. What is the smallest common multiple of c and 22? 154 Suppose -2449 = -6*q - 217. Calculate the common denominator of 59/5 and ((-117)/(-6))/((q/28)/1). 310 Let c = 3643/63 + -395/7. Calculate the common denominator of c and 27/49. 441 Calculate the common denominator of 2/(-8) + 1 + 1195/(-600) and 13/44. 1320 Let p = 2339/84 + -251/12. Calculate the common denominator of 125/42 and p. 42 Let i = -3778/55 + 6109/90. Find the common denominator of 55/8 and i. 792 Let d = -48571/16506 + -5/2751. What is the common denominator of 27/8 and d? 72 Let l =	{ "pile_set_name": "DM Mathematics" }
-7k - 188. Let r be q(-28). Let f be (4/r)/(g/4). Solve -f = -2h + 3h for h. -2 Suppose -3c + 19 - 14 = -5k, 10 = 2k. Solve 16l + 24 = cl for l. -4 Let m(b) = -b*2 - 18b + 2. Let x be m(-18). Suppose 0 = 8g + xg - 80. Solve -5w = -w + g for w. -2 Let g(j) = j2 - 5j - 4. Let o be g(7). Suppose -73 = -18l - 1. Solve -lt = t - o for t. 2 Let y(b) = b + 3. Let t be y(-13). Let k be (-2)/(45/t + 4). Solve -3u = -8 - k for u. 4 Suppose -2u = 5h - 56, 0 = 4h - 3h + 2u - 16. Solve -3r = -16 + h for r. 2 Suppose 0 = -4r - 21r + 50. Let c(b) = -b - 5. Let v be c(-6). Suppose -5w + q = -10, 0 = -q - 6 + v. Solve -w = rl - 3 for l. 1 Let o = -26 - -35. Let v(s) be the first derivative of -s3/3 + 4s*2 - 9s + 2. Let m be v(6). Solve 0q + mq = -o for q. -3 Let z be 712/49 + 2/7. Solve -zr + 4 = -0r for r. 2 Suppose v - 15 = -2a - 3a, -4a = 5v - 138. Solve 0 = t + 5t + v for t. -5 Let p be 0 - 23/(207/(-54)). Solve 7k = p + 8 for k. 2 Let t be (-2)/(-7) + (-26)/(-7). Let l be 25 - ((-2)/(-4)-4 - 0). Let v be 9/l(29 - 2). Solve tq - q = -v for q. -3 Suppose 23 = 2d + 2s + 11, 8d - 42 = -2s. Solve 0 = -y + 2y - d for y. 5 Let h(i) = -2i + 11. Let w be h(3). Suppose -wd + 23 = 4c, 2d - 5c + 4 = -0d. Solve b - 8 = -db for b. 2 Suppose 436 = 24j - 20. Solve 26 = 9y - j for y. 5 Let k(w) = -1 + w + 2 + 0w + 8. Let r be k(-9). Suppose 7a = -c + 3a + 2, -5c - 2a + 10 = 0. Solve -ci + ri + 4 = 0 for i. 2 Let p = -813 - -832. Solve -pz = -8z - 22 for z. 2 Suppose 3g + 3v - 39 = 0, 5v = -g + 4 + 1. Suppose g + 15 = 5s. Suppose -i + 4i = s. Solve -ik = -7 + 1 for k. 3 Suppose -z - 2z + 21 = 0. Let n = 0 - 0. Let y = -56 + 60. Solve n = yf - z - 5 for f. 3 Let d = 21 - 19. Suppose da - 4b = 0, -a + b - 1 = -2. Suppose -5z + 25 = 5m, -m + az - 16 = -4m. Solve m + 2 = 2f for f. 4 Let s = -11 - -13. Suppose 3b + 0i + 4i = 22, si + 2 = 5b. Solve 1 = -x + b for x. 1 Let w = -16 + 25. Let t be (30/8)/(w/48). Solve 4x = -x - t for x. -4 Suppose -9y + 62 - 17 = 0. Solve 2k - 6 = yk for k. -2 Suppose -8 = -0w - 4w. Suppose wk + 6 = 3k + 3q, 5k - 3q - 12 = 0. Suppose -kl = a + 9, -2a - 3l - 2 = 4. Solve -8 = am + 7 for m. -5 Suppose 3h = 6h. Suppose 5c - 3c + 10 = 5i, -c + 5 = h. Solve 0 = s - 2s + i for s. 4 Let n(s) = s*3 - 11s*2 + 33s - 11. Let t be n(6). Solve -tj = 3j - 40 for j. 4 Let h be (-6)/(-3) - (-42)/7. Solve 4t + 0 - h = 0 for t. 2 Let f(v) = -v3 - 8v*2 - 8v - 4. Suppose 5a + 3 + 32 = 0. Let p be f(a). Let n be ((-14)/(-21))/(p/18). Solve no - 3o = -1 for o. -1 Let r(m) = -m3 + m2 + 12m + 47. Let g be r(-3). Solve -41o = -go for o. 0 Let x(i) be the first derivative of -12 + 1/2i2 + 9i. Let f be x(-5). Solve 0 = 4v + f + 12 for v. -4 Let y(p) = -p2 + 9p - 7. Let g be y(7). Solve 0 = -gn + 6n for n. 0 Suppose -i + 6i + 15 = 0. Let h be -3(2 + (-6 - i)). Suppose -o = -hj - 4o + 18, -j + 9 = 2o. Solve m + 16 = -jm for m. -4 Let t be 48/(-22) + 24/132. Let n be 0 + (4 + t - -3). Solve -q - 4q = n for q. -1 Let l = 669 - 664. Solve -lz + 18 - 18 = 0 for z. 0 Let q = -47 + 32. Let m = -9 - q. Solve -2c + 0 = m for c. -3 Let w(u) = -68u + 165. Let x be w(2). Let b(h) = 2h - 7. Let o be b(6). Solve -x = oc - 9 for c. -4 Let x = -412 - -426. Solve -a = -x + 11 for a. 3 Suppose 0 = 3c + l - 5l, 0 = 2l - 6. Suppose -j + 3j - c = 0. Solve -2s + 16 = js for s. 4 Suppose 0 = -6y + 3y + 12. Suppose -8p + 22p - 56 = 0. Solve pa - y = 16 for a. 5 Let q be 4/(-14) + 624/(-21). Suppose 156 = 4u - 44. Let y = u + q. Solve 4n + y = 8 for n. -3 Suppose 492 = 54h - 13h. Let z(s) = s2 + 3s. Let w be z(-5). Suppose -ht = -wt - 18. Solve -t = -4n + n for n. 3 Let q = -43 + 46. Suppose qu - 29 = -5y, 2y - 23 = -3u - 2u. Solve -4 = ya - 24 for a. 5 Let h = 1 - -100. Let v = -96 + h. Solve vd = 15 + 5 for d. 4 Suppose 4l - 5 - 1 = -5g, 0 = -l + 4g + 12. Suppose 39 = lo + 9o. Solve x = ox for x. 0 Let z = -6 + 31. Let l = z - 23. Solve -3b = -lb - 2 for b. 2 Let f = -338 + 343. Solve -31 + 6 = fb for b. -5 Let j = 345 + -325. Solve -6n - 4n - j = 0 for n. -2 Suppose 2y + y - 1 = c, 3c = -3y + 9. Let a(g) = 2g3 - 5g*2 - 16g + 19. Let r be a(4). Solve t + r - c = 0 for t. -1 Suppose 346a - 374a = -112. Let l be (-99)/(-6) + (-1)/2. Solve -4z - a = l for z. -5 Suppose 7x - 2x = 0. Suppose 0i - i = -5b + 15, i - 3b + 9 = x. Suppose -m + 40 = 4m - 5s, 5m + s - 64 = 0. Solve i = c + 2c - m for c. 4 Suppose 0 = 2n + 2w + 6, -2w - 20 = -5n - 0w. Suppose nl - 2 - 8 = 0. Solve 1 + l = -2u for u. -3 Let o be -3 + 3 - 4 - (-5 + 1). Let b be 4/1 + ((-10)/5 - o). Solve bh - 6h = -12 for h. 3 Let r = -35 + 31. Let v be 4 - (4 + -14 - r). Solve 8x - 3x = -v for x. -2 Suppose 0a = -7a + 28. Suppose 0w + w - 6 = -2l, 4w = -l + 3. Solve c = lc + a for c. -2 Let m(b) = b3 - 8b*2 + 6b + 9. Let w be m(7). Let i be (-24)/(-6) + 32/w. Suppose -2x + i = 2a, -a + 40 = 5x + 2a. Solve 0 = 4y - 9y + x for y. 1 Let p(k) = 62 - 118 - k*2 - 2k + 64. Let u be p(-4). Solve -a + 1 + 4 = u for a. 5 Let y(g) = g*3 + 15g*2 + 16g + 29. Let b be y(-14). Suppose -12 - b = 3u + 5i, -4i = -2u + 28. Solve -uf = -20 + 4 for f. 4 Let f be 38/8 - (-15)/(-20). Suppose w + 0w + 3 = -t, -3w - 7 = ft. Solve -2g + 0g = t for g. -1 Let o = 149 + -142. Solve oh = -17 - 18 for h. -5 Let t(z) = 10z + 336. Let h be t(-33). Solve hs = 4s + 4 for s. 2 Suppose -7k + 36 = -13. Let w be k/(-56)6 - (-54)/8. Solve -wg + 2g = 0 for g. 0 Let r = 18 + -13. Suppose -rm - 2 = -32. Let p = -4 + m. Solve 10 = -pl + 7l for l. 2 Suppose 154x - 153x - 11 = 5f, f = -1. Solve 6m - 36 = -x for m. 5 Let a = 14 - 10. Let w = a + 3. Solve -2c - w = -1 for c. -3 Suppose 10 = 5v + 5. Solve -l - 4 = v for l. -5 Suppose -501i + 496i = -5. Solve -i = 2w - 1 for w. 0 Let n = 1106 - 1062. Solve n - 45 = -p for p. 1 Suppose -b = -2o + 19, 0 = 4o + b - 66 + 13. Solve -2t + 5t = o for t. 4 Let f(i) = -i*3 - 17i*2 + i + 17. Let j be f(-17). Solve -2z + jz = -8 for z. 4 Let v(a) = -a + 2. Let h(s) = s2 - 4s + 2. Let q be h(4). Let j be v(q). Let o be 2/21 + (-600)/(-315). Solve jb - b = o for b. -2 Let j(r) = -r3 + 4r*2 + 2r - 3. Let f be j(2). Solve 0 = g + 5 - f for g. 4 Let o = 853 + -853. Solve o = 34r - 29r - 25 for r. 5 Let j(a) = -a*3 - 5a*2 - 5a - 1. Let i be j(-4). Solve -it = t + 4 for t. -1 Let b(u) = -5u*2 - 3u + 3. Let r be b(2). Let c = 25 + r. Suppose -3a - a - 2p = -20, -a + 8 = cp. Solve 2m = a + 2 for m. 3 Let m = 207 + -74. Suppose 4o = -o - 25, -4y + o = -m. Suppose -2r + 18 + y = 0. Solve -4k = k + r for k. -5 Let n = 1 + 0. Let q = 27 + 1. Suppose qi - 15 = 23i. Solve i - n = b for b. 2 Let k(g) = -g*3 - 3g*2 + 3g - 4. Let v be k(-4). Solve v = 9n + 2n + 44 for n. -4 Suppose -5k - 8w + 3w - 185 = 0, 0 = -3k - w - 101. Let c = k + 36. Solve 0 = -3b - c - 11 for b. -5 Let g(p) = -p2 - 7p - 6. Let a be g(-5). Let y be (0(-1)/3)/(-90 - -89). Solve 0 = v - yv - a for v. 4 Let j = -59 + 61. Suppose -4o = -h - jh - 3, 0 = -2o + h + 3. Solve -ot = 1 + 2 for t. -1 Let f be (-14)/5(-60)/24. Solve 6c + 5 = fc for c. 5 Let x = -8 + 17. Suppose 4m - 27 = -3c, -2m - c + 2c = -1. Suppose -11 = -my + 4. Solve yl = 11 + x for l. 4 Suppose 0 = -2t + 6t + 3n + 325, -2t = n + 165. Let x = -80 - t. Solve 7 + 8 = xc for c. 3 Suppose n = -m - 3, -4m + 2 = -5n + 32. Solve p - n = 2 for p. 4 Let p = 12 - 8. Suppose -50 = -5k - 5b, pk - 34 = -k - b. Solve -k = -2z - z for z. 2 Suppose -r + 3r - 4 = 0. Suppose -n = -rn. Let y be (2 + n + -2)/(-1). Solve b - 1 = -yb for b. 1 Suppose -21 - 8 = -5m - 4s, -13 = -2m - 3s. Let w = -4 - -8. Let b be w/(4/(8/2)). Solve 9d + m = bd for d. -1 Suppose -3r + 5c - 3c = 8, -3r = -4c + 10. Let k be (-6 - r)(3 + -4). Let s be 1/2 + 2/k. Solve 0 = -p + s - 5 for p. -4 Suppose 84y + 150 = 90y. Solve -3s - 2s = -y for s. 5 Let o = -1555 - -1564. Suppose 0 = -g + 3t + 1, 0 = g - 5t + t. Solve -gk + k = o for k. -3 Suppose -15j + 74 - 14 = 0. Suppose -2w - 18 = -jg, g - 4w - 24 +	{ "pile_set_name": "DM Mathematics" }
w2 - 1323885 + 1323885. -6w*2 Collect the terms in -1565b*2 + 3383b*2 + 3969b*2 + 745b*2. 6532b*2 Collect the terms in 16272h + 16201h - 32473h + 6h3 - 4h*3. 2h*3 Collect the terms in 11o - 25o3 + 23o*3 + 19o*3. 17o*3 + 11o Collect the terms in -4 + 184u - 186u + 1. -2u - 3 Collect the terms in -1782x + 1782x + 8x*2. 8x*2 Collect the terms in 1 - 2s*3 - 6082s + 6125s - 1. -2s*3 + 43s Collect the terms in -2r - 382r*2 - 472r*2 + 771r*2. -83r*2 - 2r Collect the terms in -95z + 95z + 88z - 67z. 21z Collect the terms in 310u*2 - 23892974 + 23892974 + 100u*2. 410u*2 Collect the terms in 12z - 23511 - 23319 + 46830. 12z Collect the terms in 23u*2 + 28u*2 + 22u*3 + 33u*2 - 84u*2. 22u*3 Collect the terms in 765495055 - 765495055 - 4b. -4b Collect the terms in -69 - 60 + 129 + 2h - 11h + 6h. -3h Collect the terms in 1028x*2 + 2043x*2 + 1207x*2 + 3283x*2. 7561x*2 Collect the terms in 9 - 108v - 7 - 3 - 24v. -132v - 1 Collect the terms in 8474 + 0q + 8477 + 7q - 16951 - 5q. 2q Collect the terms in 12531 + 49t - 12532 + 18t. 67t - 1 Collect the terms in -30768 + 4z - z + 61536 - 30768. 3z Collect the terms in 4 - 4j*2 - 3 - j - 3j*2. -7j*2 - j + 1 Collect the terms in -11n - 39n + 3n - 1 + 21n - 10n. -36n - 1 Collect the terms in 985 - 985 - 101b + 56b + 50b. 5b Collect the terms in -8420f + 16834f - 8424f. -10f Collect the terms in 18x + 39737808 - 39737808. 18x Collect the terms in -75335c + 37674c + 37668c. 7c Collect the terms in -11 + 10 - 2c*2 - 76 + 6c*2. 4c*2 - 77 Collect the terms in 317s*3 + 2s - 77 - 628s3 - 2s + 315s3. 4s*3 - 77 Collect the terms in -8728q + 17496q - 8724q. 44q Collect the terms in -6041i*2 + 3020i*2 - 5i*3 + 3020i*2. -5i3 - i2 Collect the terms in -10 - 990t3 - 991t*3 + 2973t*3 - 994t*3. -2t*3 - 10 Collect the terms in 0 - 858s + 926s + 3. 68s + 3 Collect the terms in -n*2 + 468 + 16 - 5n*2 - 484. -6n*2 Collect the terms in 0 + 0 + 2p*3 + 160p*2 - 27p*2 - 74p*2. 2p*3 + 59p*2 Collect the terms in -9508 - 388a*2 - 9510 + 19018. -388a*2 Collect the terms in 858b*3 - 297b*3 - 322b*3 - 317b*3. -78b*3 Collect the terms in 35q - 67q - 469q*2 + 32q. -469q2 Collect the terms in -48a - 60a - 3 + 15a. -93a - 3 Collect the terms in 828i*2 - 1632i*2 + 3i*3 + 804i*2. 3i*3 Collect the terms in 32s*2 - 3s*2 + 9s*2 - 3s*2 - 649s + 648s. 35s*2 - s Collect the terms in -1583430s - 22s3 + 1583430s. -22s3 Collect the terms in 487 + 379n*2 - 225 - 262. 379n*2 Collect the terms in 206a*2 + 220a*2 + a + 194a*2 - a. 620a*2 Collect the terms in -6l + 8l + 29l. 31l Collect the terms in 92q + 2q2 - 36q - 2q2 + 3q3 - q3. 2q3 + 56q Collect the terms in 18 + 14v - 19 + 3v + 11v. 28v - 1 Collect the terms in 2833q - 598q - 602q - 600q - 1032q. q Collect the terms in -4u - 14u3 + 3u*3 + 5u*3 - 7u + 8u3. 2u*3 - 11u Collect the terms in 950k2 - 2696k*2 + 791k*2 + 956k2. k2 Collect the terms in 20418 - 6809 - 6806 + 4z - 6803. 4z Collect the terms in 2m2 + 1625m - 477m + 2076m. 2m2 + 3224m Collect the terms in 4972a - 9953a + 4955a - 4a*2. -4a*2 - 26a Collect the terms in -167 + 2b + 31 + 34 + 102. 2b Collect the terms in 580290m3 + 580303m*3 - 1160595m*3. -2m3 Collect the terms in -f2 + 6 + 3190 + 999 + 286. -f*2 + 4481 Collect the terms in 241 + 206 + 4b - 447. 4b Collect the terms in 4559o*3 + 2o*2 + 11o*2 - 13o*2 - 4582o*3. -23o*3 Collect the terms in -49 - 445c - 10 + 430c. -15c - 59 Collect the terms in -1182w - 1188w + 2373w + 2w2 - w2. w*2 + 3w Collect the terms in 2270t3 + 2262t*3 + 2269t*3 + 2271t*3 - 9075t*3. -3t*3 Collect the terms in 143b*3 - b + 11b*3 - 15b*3 + 3b*2. 139b*3 + 3b*2 - b Collect the terms in 3p + 7p - 147p*3 - 10p. -147p3 Collect the terms in -1 + 3f + 1 - 635f2 - 23f*2. -658f*2 + 3f Collect the terms in -2p + 5p - p + 3875p2 - 2p - 3879p2. -4p*2 Collect the terms in 3 + 0 - 246i*3 + 6i - 6i. -246i*3 + 3 Collect the terms in -8393p*3 - 3062p*3 + 11452p*3. -3p*3 Collect the terms in 186i*3 + 151i*3 + 188i*3 - 463i*3. 62i*3 Collect the terms in -4o*2 - 12155118 + 2o*3 + 12155118 + 4o*2. 2o*3 Collect the terms in -90i*3 + 32i*3 + 31i*3 + 2 + 22i*3. -5i*3 + 2 Collect the terms in 370g*3 - 369g*3 - 48g*2 + 120g2. g3 + 72g2 Collect the terms in 38l - 73l + 1035l*2 + 35l. 1035l2 Collect the terms in -366082t - 4t3 + 11t*3 + 366082t. 7t3 Collect the terms in 12m*2 - 22m*2 + 598m + 12m2. 2m*2 + 598m Collect the terms in 8554w2 + 12 - 12. 8554w*2 Collect the terms in -11k - 20k + 12k - 12k + 48k - 12k. 5k Collect the terms in 654p2 - 1304p*2 + 635p*2. -15p*2 Collect the terms in -1033 - 48n*3 - 1035 + 2064. -48n*3 - 4 Collect the terms in -10141j*2 + 4j - 4j. -10141j*2 Collect the terms in 6f*3 + 88f*2 - 166f*2 + 80f*2. 6f*3 + 2f*2 Collect the terms in -18r*2 + 715r + 712r - 1427r. -18r2 Collect the terms in 6j*2 - 53j*2 + 9j*2 + 39j2. j2 Collect the terms in 20710567j2 - 20710567j*2 + 2j*3. 2j*3 Collect the terms in 767n + 1191n + 1009n - 836n + 1082n. 3213n Collect the terms in 178h*2 - 358h*2 + 182h*2. 2h*2 Collect the terms in -2598q*3 + 2460q*3 + 4982q*3. 4844q*3 Collect the terms in 57608 - 19197 - 19208 - 19203 - 2z*3. -2z*3 Collect the terms in a + 2484a*2 - 4a - a - 3134a2. -650a*2 - 4a Collect the terms in -5 + 93h3 - 122h*3 + 59h*3. 30h*3 - 5 Collect the terms in -7342m - 1293m - 678m. -9313m Collect the terms in 3t + 11t + 2655 - 6t - 3t. 5t + 2655 Collect the terms in -43f + 12367 + 12364 + 12361 - 37092. -43f Collect the terms in -6 - 34k - 21 + 31k + 8. -3k - 19 Collect the terms in -390 + 390 - 1915a. -1915a Collect the terms in 3c*3 - 60c + 28c - 5c*3 - 140 + 32c. -2c3 - 140 Collect the terms in 4451m*2 - 2136m*2 - 2094m*2. 221m*2 Collect the terms in -14f*2 + 75f*2 - 32f*2 - 11f*2 - 10f*2. 8f*2 Collect the terms in -819x + 1694x - 829x. 46x Collect the terms in 236k*3 - 26k*3 + 207k*3 - 30k*3 + 270k*3. 657k*3 Collect the terms in -1199j - 1 + 1066j3 + 1 + 1199j. 1066j3 Collect the terms in -8d*2 + 97d + 6d2 - 12d. -2d2 + 85d Collect the terms in -353486p2 + 176764p*2 + 176720p*2. -2p*2 Collect the terms in 17w + 3419 - 3419. 17w Collect the terms in 229 - 34j - 120 - 109. -34j Collect the terms in -53 + 156 - 59 - 13t - 44. -13t Collect the terms in 13 + 68 - 81 + 24a. 24a Collect the terms in 6 - 34u - 33u - 32u + 134u - 34u. u + 6 Collect the terms in 23445v - 11709v - 11716v. 20v Collect the terms in 269b2 - 1315b*2 - 993b + 993b. -1046b*2 Collect the terms in -72y + 12645 - 12645. -72y Collect the terms in v - 2v - 41v2 - 2v - 6v2. -47v*2 - 3v Collect the terms in -33 - 2072c - 31 + 66. -2072c + 2 Collect the terms in 7 - 10 + 3 + 54i2. 54i*2 Collect the terms in 4219m*3 + 3388m*3 + 51m*3 + 4249m*3. 11907m*3 Collect the terms in -596a*2 + 6072a*2 + 1272a*2. 6748a*2 Collect the terms in 6q + 22780 - 22780 + 4q. 10q Collect the terms in 1623i - 811i - 805i. 7i Collect the terms in -6h2 - 59181 + 59181 + 9h*2. 3h*2 Collect the terms in 7f*3 - 17f*3 - 16f*3. -26f*3 Collect the terms in 605c + 544c + 848c - 190c - 273c. 1534c Collect the terms in -11d*2 + 12d*2 - 5d*2 + 25d*2 + 16d*2. 37d*2 Collect the terms in 3253 - 3253 + 56u - 44u. 12u Collect the terms in -14182f2 + 42545f*2 - 14183f*2 - 14190f*2. -10f*2 Collect the terms in -22z + 4z + 3z + 24z + 13z. 22z Collect the terms in -21x + 378948 - 378948 - 24x. -45x Collect the terms in 218 + 235 + 3j + 773. 3j + 1226 Collect the terms in 864246 - 432062 - 3q2 - 432184. -3q*2 Collect the terms in 109366h - 28642*h +	{ "pile_set_name": "DM Mathematics" }
0338980 a multiple of 55? True Is 1786125320 a multiple of 14? True Is 15917600 a multiple of 100? True Does 9 divide 24763341? False Is 516 a factor of 23566010? False Is 1118300802 a multiple of 851? True Does 3551 divide 105326211? True Does 909 divide 143492500? False Is 27506003 a multiple of 62? False Is 80 a factor of 2650656980? False Is 18 a factor of 743220? True Is 265732250 a multiple of 2? True Is 5810440356 a multiple of 18774? True Does 3051 divide 430965954? True Is 9930372 a multiple of 218? False Does 319 divide 31940832? True Is 2 a factor of 4255926? True Does 22 divide 299538976? True Does 107 divide 419448560? True Is 914144103 a multiple of 9422? False Does 890 divide 14683220? True Is 1697046056 a multiple of 1784? True Is 4077 a factor of 3729762863? False Is 666992089 a multiple of 117? False Is 57 a factor of 164411067? False Is 934003020 a multiple of 271? False Is 4 a factor of 4313888? True Is 735 a factor of 1695941482? False Is 1165 a factor of 39921264? False Is 151306119 a multiple of 314? False Does 33 divide 27182024? False Is 5 a factor of 53952240? True Is 116546465 a multiple of 35? True Is 33107105 a multiple of 578? False Does 44 divide 2050704? False Is 36 a factor of 3338403? False Is 1301 a factor of 1298591504? False Does 72 divide 244474977? False Does 6674 divide 1546012078? True Is 78124243 a multiple of 227? False Is 29328768 a multiple of 3637? True Is 4088824 a multiple of 7? False Is 22 a factor of 4310033816? True Does 39 divide 658102770? True Is 9 a factor of 29828286? True Is 49986980 a multiple of 655? True Does 4104 divide 271385208? True Is 11572541 a multiple of 35? False Is 311 a factor of 67325591? True Does 726 divide 668221290? True Is 437127398 a multiple of 12? False Is 49 a factor of 31238376? False Is 2556787 a multiple of 11? False Is 4073396 a multiple of 26? False Is 3342 a factor of 46396986? True Is 120 a factor of 4051912? False Is 5000402400 a multiple of 161? True Does 142 divide 686801336? False Is 227 a factor of 48112877? True Does 3955 divide 5867543548? False Does 564 divide 27259812? True Is 153061910 a multiple of 4? False Is 7948 a factor of 449999864? True Is 84927447 a multiple of 6? False Does 264 divide 11989291? False Is 470779980 a multiple of 4633? False Does 38 divide 23203079? False Does 8 divide 22829855? False Is 9 a factor of 1886410? False Is 9 a factor of 351038129? False Is 435730610 a multiple of 2807? True Is 159 a factor of 65287467? True Is 32 a factor of 29314859? False Is 192142 a multiple of 67? False Is 13 a factor of 32958237? True Is 2958 a factor of 623345256? True Is 6142 a factor of 1663130760? True Is 1365 a factor of 1524790995? True Is 3372922205 a multiple of 155? False Does 15 divide 2310633165? True Is 6565779 a multiple of 157? False Is 10407328 a multiple of 23? False Is 2734 a factor of 2921655369? False Is 17085185 a multiple of 2015? True Is 10 a factor of 520952971? False Is 1505434141 a multiple of 6878? False Does 611 divide 3907076? False Does 1882 divide 63551376? True Is 233973729 a multiple of 455? False Is 308217400 a multiple of 7400? True Does 26 divide 27921738? True Is 203 a factor of 2204640862? False Is 6525639 a multiple of 11? False Is 2787807 a multiple of 3? True Is 178097019 a multiple of 452? False Is 178 a factor of 451175420? False Is 61079579 a multiple of 31? True Is 1129474240 a multiple of 243? False Is 229 a factor of 97315840? True Is 7777946686 a multiple of 11? False Does 1489 divide 116554323? False Is 63629202 a multiple of 6? True Is 35 a factor of 712789871? False Is 1243620 a multiple of 105? True Is 1452310458 a multiple of 448? False Does 26 divide 1259431964? False Does 8 divide 1491379? False Does 642 divide 72982916? False Does 3225 divide 502572273? False Is 25670260 a multiple of 374? False Is 26104672 a multiple of 176? True Is 22994320 a multiple of 23? False Is 572 a factor of 1204466716? False Is 32 a factor of 98481301? False Does 48 divide 145025448? False Is 497485101 a multiple of 1609? True Is 87 a factor of 19378819? False Is 119 a factor of 19008584? True Does 12 divide 5965694? False Is 46077537 a multiple of 521? False Does 475 divide 23761476? False Does 26 divide 644866716? True Is 11244146 a multiple of 2790? False Does 2264 divide 178831096? True Is 26 a factor of 2372973009? False Is 66636413 a multiple of 188? False Does 5 divide 1263207885? True Does 6314 divide 1470454832? True Does 2550 divide 2119483500? True Is 3370176 a multiple of 48? True Does 102 divide 50761353? False Is 18446816 a multiple of 4? True Is 15 a factor of 434600036? False Does 32 divide 946807169? False Is 297 a factor of 113563515? False Is 435052201 a multiple of 27? False Is 1065 a factor of 132393253? False Is 3222634 a multiple of 853? True Does 5186 divide 16946238? False Does 2213 divide 226190730? True Is 10086093 a multiple of 7? False Is 4 a factor of 1373337395? False Does 285 divide 123941085? True Does 309 divide 4428897? True Does 27 divide 159831225? True Is 676457829 a multiple of 332? False Does 20 divide 9617760? True Is 28490848 a multiple of 1448? True Does 2384 divide 2855237755? False Does 6 divide 19142862? True Does 194 divide 22725548? True Is 115426411 a multiple of 56? False Does 372 divide 368224065? False Is 37 a factor of 2966808750? False Is 2680 a factor of 695646722? False Is 114 a factor of 1313997858? True Does 866 divide 265707852? True Is 46 a factor of 63808302? True Is 25740000 a multiple of 551? False Is 65668434 a multiple of 2054? True Is 4154 a factor of 73087114? False Does 1159 divide 2342020738? False Is 26 a factor of 44492637? False Does 1754 divide 10670250? False Is 64 a factor of 348711232? True Is 886705228 a multiple of 25? False Does 169 divide 663929175? True Does 1211 divide 52123377? False Is 2157 a factor of 65411025? True Is 3375735 a multiple of 27? False Is 13903280 a multiple of 12? False Does 353 divide 326957041? False Is 73931840 a multiple of 40? True Is 11519 a factor of 550200669? False Is 145 a factor of 203872175? True Is 886 a factor of 571435446? True Does 3 divide 81658371? True Is 20 a factor of 283000025? False Does 41 divide 1226649644? True Is 212318095 a multiple of 1010? False Does 141 divide 18174039? False Is 47965344 a multiple of 56? True Is 13 a factor of 167722416? False Is 48 a factor of 336537233? False Is 529333624 a multiple of 17? True Is 14 a factor of 116472978? False Is 11452207 a multiple of 381? False Is 275733890 a multiple of 295? False Is 3551 a multiple of 3? False Is 648 a factor of 2084078808? True Is 4617 a factor of 2175862824? True Is 2505360 a multiple of 880? True Does 38 divide 17210390? True Is 212 a factor of 4525934? False Does 37 divide 956018136? True Does 1129 divide 32300442? False Is 586175906 a multiple of 648? False Is 90 a factor of 2769769800? True Is 31 a factor of 6509628? True Is 4817252 a multiple of 242? True Does 720 divide 14179680? True Does 844 divide 164123396? True Is 1031768727 a multiple of 3201? True Does 1255 divide 494770769? False Is 18473987 a multiple of 246? False Does 302 divide 111482394? True Is 506562192 a multiple of 1292? True Is 988697208 a multiple of 439? False Does 7 divide 172439302? True Does 68 divide 65027856? True Is 542608432 a multiple of 656? True Does 2759 divide 1057836395? False Does 382 divide 15082556? False Does 34 divide 69326068? True Does 1763 divide 1916381? True Does 33 divide 7248207031? False Is 177411371 a multiple of 24? False Is 3284 a factor of 36317596? False Does 4418 divide 18228668? True Is 81 a factor of 23329296? True Does 645 divide 220266174? False Is 27021309 a multiple of 18? False Is 729 a factor of 341204076? True Is 163174287 a multiple of 303? True Is 690 a factor of 1180511340? True Does 6 divide 431292870? True Is 5737017 a multiple of 129? True Does 33 divide 26666739? True Is 1364684334 a multiple of 1869? False Does 13 divide 693910057? False Is 169265414 a multiple of 45? False Is 31802712 a multiple of 218? True Is 78 a factor of 61603698? True Does 15 divide 52022880? True Does 109 divide 199285136? True Is 374139878 a multiple of 1637? False Is 208258245 a multiple of 13? True Is 57 a factor	{ "pile_set_name": "DM Mathematics" }
836. Let t = a + -50.2. Round t to one dp. 1 Let y = 26877876.149247 + -26877893. Let h = y - -16.85. Round h to 3 dps. -0.001 Let f = -46.7915 - -46.6. Let a = 0.0195 - f. Round a to 2 decimal places. 0.21 Let m = -1998.253 - 0.747. Let u = 953 + m. Let g = u - -1045.999999481. What is g rounded to seven dps? -0.0000005 Let w = 9360 + 10004. What is w rounded to the nearest 1000? 19000 Let z = 275753 + -276100.647. Let j = z + 347. Let p = j - -0.65. Round p to 2 decimal places. 0 Let y = 11.893 - -0.207. Let o = -11.7343014 + -0.3657078. Let z = o + y. What is z rounded to six dps? -0.000009 Let y = 31 + -533. Let m = 501.9752 + y. Round m to 2 decimal places. -0.02 Let w = -969 - -538. Let v = w + 431.000722. What is v rounded to 4 decimal places? 0.0007 Let s = -28175 + 100739. Round s to the nearest 10000. 70000 Let y = 7042 - 8726.8. What is y rounded to the nearest 100? -1700 Let l = -14972 + 14972.00046595. What is l rounded to six decimal places? 0.000466 Let a(o) = o - 1. Let d be a(7). Suppose -3y + 0y + d = 0. Let p(t) = 3650000t2 - t + 2. Let x be p(y). Round x to the nearest 1000000. 15000000 Let f = -0.16845 + 0.168380686. What is f rounded to 6 dps? -0.000069 Let w = 87 - 72. Suppose 12v - w = 7v. Suppose -2f = -3a - 1600009, -a = vf + 4a - 2399985. Round f to the nearest 1000000. 1000000 Let z = 58.3591 - 59.02793309. Let k = z - -0.06883152. Let h = k - -0.6. What is h rounded to seven dps? -0.0000016 Let s = 69195725 - 48544760. Let h = -20650963.5600077 + s. Let l = -1.44 + h. Round l to 6 dps. -0.000008 Let c = 8.18 - -5.46. Let b = c + -15. Let s = -21.76 - b. Round s to the nearest integer. -20 Let d = 617 - 1023. Let n = 405.606 + d. Round n to two dps. -0.39 Suppose -6s + 2s + 2 = -5d, -d - 7 = -3s. Let u = 3 - -712. Suppose 0 = -4c + 3f + u, df = -2c - 2f + 352. Round c to the nearest 10. 180 Let q(f) = -82f3 + 3f*2 + f - 1. Suppose -65r = -56r + 9. Let z be q(r). What is z rounded to the nearest ten? 80 Let x = -122 - -122.632. Let j = -0.218 + x. Round j to 1 dp. 0.4 Let l = 109737.123337 + -109737. Round l to 2 dps. 0.12 Let i(b) = 9877b*3 + 37b*2 + 19b + 83. Let l be i(-33). What is l rounded to the nearest 1000000? -355000000 Let s be -365/(-330) - (-493776812)/(-22). What is s rounded to the nearest one million? -22000000 Suppose -2089 = -4q - 5s + 146, -3s = 5q - 2797. Let v be 3153/(-9) + 2/6. Let o = v + q. What is o rounded to the nearest 100? 200 Suppose -152k + 153k + 2u = -1605986, 0 = k - 4u + 1606028. Round k to the nearest 100000. -1600000 Let c = -38.155305 + 38.23. Round c to 3 dps. 0.075 Let k(s) = 2s*2 + 20s + 16. Let j = 49 - 44. Let c(g) = g*2 + 13g + 11. Let x(l) = jk(l) - 8c(l). Let i be x(4). Round i to the nearest integer. 8 Let n = -139710 - 626726. Let a = n - -766590.0302. Let z = a - 154. Round z to 2 decimal places. 0.03 Let i = 4305.3978 - 4304. What is i rounded to one decimal place? 1.4 Suppose -672w + 675w = 2j - 119988018, -179982006 = -3j + w. What is j rounded to the nearest one hundred thousand? 60000000 Let g = 3754.8139 + -0.8139. Let b = g - 3754.7662. Round b to 1 decimal place. -0.8 Let m = 6.04 + -6.543. Let k = 0.502975 + m. Round k to 5 dps. -0.00003 Let w = -538 - 591. Let i = 1128.999381 + w. What is i rounded to 5 decimal places? -0.00062 Let x = 0.08824 + -49.62724. What is x rounded to the nearest ten? -50 Let u = -536.0282 + 536.1. Round u to one dp. 0.1 Let r = -12891148 + 12891176.900074. Let y = r + -28.9. What is y rounded to five decimal places? 0.00007 Let z = 4934.68952039 + -4932.66151. Let g = z - 2.028. Round g to six dps. 0.00001 Let g = 0.223146211 - 22.223136761. Let q = 22 + g. Round q to 6 dps. 0.000009 Let v(d) = 4720d3 - 14d*2 + 37d + 56. Let u be v(34). Suppose -2y - 4p = -3y + 37099992, 5y - u = -5p. Round y to the nearest one million. 37000000 Let c = -6599067077.9998138 + 6599068519. Let j = 1441 - c. What is j rounded to 5 dps? -0.00019 Let u = 89 + -128. Let r = -15 - u. Let t = 24.00183 - r. What is t rounded to four decimal places? 0.0018 Let t(a) = 90a*2 - 3a - 27. Let w be t(-3). Let n be w/(-18)2544. What is n rounded to the nearest one thousand? -48000 Suppose 0b - 15 = 3b. Let n be (-18)/b - (-4)/10. Let k(i) = 8i + 4. Let g be k(n). Round g to the nearest ten. 40 Let f = -45 + 45. Let q be (f - -335)/(1/3 - 0). Let s be 3/(9/18510)(q - 5). Round s to the nearest one million. 6000000 Let p = 629019 + -629484.0438. Let x = -465 - p. Round x to three dps. 0.044 Suppose -74s = -75s + 55716. Suppose -s = 7y + 73084. Round y to the nearest 10000. -20000 Let u = 23490382779.00001597 - 23490382897. Let j = -118 - u. What is j rounded to five decimal places? -0.00002 Suppose 2f - 12379243 = -2p + 6520761, -f + 18900002 = 2p. Suppose 19n = 24n + p. Round n to the nearest 100000. -1900000 Let n = -46672018740.00000039 - -46672018552. Let c = n + 188. What is c rounded to seven decimal places? -0.0000004 Suppose 2p + 37518 = -2w, -w = -342 + 343. What is p rounded to the nearest 1000? -19000 Let m = 2920 - 2920.3254. Round m to two dps. -0.33 Let g = -30313785141.80049943 - -30313782190. Let s = g + 2949.8005. Let n = 2 + s. Round n to 7 dps. 0.0000006 Let l = 32.89088 - 32.68. Round l to 2 dps. 0.21 Let g = 26848.99947859 + -26849. Round g to four dps. -0.0005 Let v(k) = 2k2 + 29k + 3. Let f be v(-14). Let g be (-523212)/(-44) + 2/f. Let x = g + -8231. Round x to the nearest one hundred. 3700 Let j(l) = l*3 - 8l*2 + 5l + 16. Let d be j(7). Suppose -u + 6 = du, 5q = -3u - 30264. Let b = q - -246054. Round b to the nearest one hundred thousand. 200000 Let g = 21079.999977877 - 21080. Round g to six decimal places. -0.000022 Suppose -14f = 151f + 64262550000. What is f rounded to the nearest one million? -389000000 Let z(f) be the third derivative of -f5/20 - 47f*4/24 - 4f3 + f2 + 20f. Let i be z(-16). What is i rounded to the nearest ten? -40 Let i = -5.1554269 - -5.2007. Let b = 0.0453 - i. Round b to six decimal places. 0.000027 Suppose -4p + 108 - 48 = 0. Suppose 1233 = 18f - pf - 3c, -c - 1233 = -3f. What is f rounded to the nearest 10? 410 Let f = 22450.5 - 24620. Round f to the nearest 1000. -2000 Let n = 181 + -180.921. Let g = n - 0.819. Let i = g + 0.740224. Round i to 5 decimal places. 0.00022 Let v = 11.609 + -11.611243. Round v to three decimal places. -0.002 Let z(r) = -5292r2 - 23r - 105. Let i be z(-5). Round i to the nearest 1000. -132000 Suppose 2m - 4 = 0, -2c + 2 = -3m + 8m. Let j be (-1205 + -25)c/6. Round j to the nearest 100. 800 Let r = 647.9539 + -648. Let c = r + 6.2361. Round c to the nearest integer. 6 Let y = 39.1884488 - 39.195. What is y rounded to three dps? -0.007 Suppose -4k + k + 6 = 0. Suppose -3i - 60 = -2j + ki, 0 = 5j - 5i - 120. Suppose 26u = 21u - j. What is u rounded to the nearest 10? 0 Let j = 4.01543 - 3.981. Round j to 4 dps. 0.0344 Suppose h = 5p + 66358884 + 1238091114, -521780004 = 2p + 2h. Round p to the nearest one million. -261000000 Let x = 643 + -643.0731. Let l = x + 0.015. Round l to three dps. -0.058 Let o = -959.414 - -947.8. Round o to one decimal place. -11.6 Let v = 4425384889 + -4425385399.0000038. Let r = -510 - v. What is r rounded to 5 dps? 0 Let x = 180192980 - 180193268.0000075. Let o = -288 - x. What is o rounded to six decimal places? 0.000008 Let q = 100.81 - 105.389. Let k = 5.134 - q. Let o = 0.087 + k. What is o rounded to the nearest integer? 10 Let x = -1361104080.40000595 - -1361103497.4. Let m = 583 + x. Round m to 6 dps. -0.000006 Let t = 49467 + -49467.00100077. Round t to 5 decimal places. -0.001 Let b = 4783919 + -2999919. What is b rounded to the nearest one hundred thousand? 1800000 Let o = 140 - 138.54. Let s = 334.54 + o. Let a = 336.00000261 - s. Round a to seven decimal places. 0.0000026 Suppose 2l - 5 = -j - 1, l = -2j - 1. Suppose 4r = 12, 4u + 0u + 485 = lr. What is u rounded to the nearest ten? -120 Let h = 0.324 + -0.4. Let u = h - 58.924. Let p = u - -59.218. What is p rounded to two decimal places? 0.22 Let m = 18 + 51. Let d = 68.886 - m. What is d rounded to 2 decimal places? -0.11 Let m = -171242 + 171241.9928203. W	{ "pile_set_name": "DM Mathematics" }
- 23t - 57. Let d(g) = -53g*2 - 34g - 85. Give 5d(n) - 7x(n). n*2 - 9n - 26 Let h(x) = 2x3 + x2 + 3. Let y(q) = 2 - 3q*2 - 9 + 16 + 6 - 6q*3 - 25. Let n = 5 - 7. Determine ny(r) - 7h(r). -2r3 - r2 - 1 Let i(k) = -36k2 + 2k - 32 + 32 + 82k2 + 5k*3 - 48k*2. Let d(s) = 21s*3 - 9s*2 + 9s + 1. What is -2d(u) + 9i(u)? 3u3 - 2 Let x(u) = -u2 + 7u. Let v be (0(-1)/(-5))/(-3). Suppose -2i + z - 11 = v, -i - 19 = -5z + 9. Let c(r) = 3r*2 - 20r. Give ic(a) - 8x(a). -a*2 + 4a Let k be -6 + 13/(52/20). Let o(j) = 6j2 - 2j + 2. Let g be o(1). Let t(p) = 2p3 - 3p2 + 6. Let c(x) = -x2 + 1. Give gc(d) + kt(d). -2d3 - 3d*2 Let c(x) = -5x*2 - 3. Let s(h) = -h + 2 - 2. Let r(p) = c(p) - 3s(p). Let l(z) = 5z - 13 - 10z*2 + 10 - 2. Calculate 3l(w) - 5r(w). -5w*2 Let n(r) = 3r + 4208 - 37r2 - 4208. Let t(v) = -3663v*2 + 296v. What is 296n(a) - 3t(a)? 37a2 Let b(x) = 10x*3 - 11x*2 - 10x + 67. Let a(l) = 5l3 - 6l*2 - 6l + 33. Calculate 7a(y) - 4b(y). -5y3 + 2y*2 - 2y - 37 Let y(u) = -9u2 - 2u - 1. Let p(l) = 45l2 + 6l + 13. Determine p(a) + 2y(a). 27a*2 + 2a + 11 Let a(v) = v*3 - v. Suppose -4b = u - 10, -104 + 42 = -4u - 5b. Let w(l) = ul - 1501 - 15l*3 + 1501. What is -18a(i) - w(i)? -3i3 Let t(g) = 3g*2 + 1. Let l be 4 + 11 + -10 + -3. Suppose 3i = 8i + 70. Let f = i - -3. Let c(v) = 16v*2 - v + 4. Give ft(y) + lc(y). -y2 - 2y - 3 Let n(k) = -92k2 - 2k + 24. Let z(f) = -368f2 - 9f + 92. Calculate -23n(u) + 6z(u). -92u2 - 8u Let l = -16062 + 16059. Let s(c) = 17c. Let x(z) = 18z. What is lx(k) + 4s(k)? 14k Suppose 510 = 369r - 80 - 148. Let b(a) = -3a - 6. Let q(c) = c. Give rq(f) + b(f). -f - 6 Let q(a) = -237a - 1555. Let i(x) = 86x + 518. Give 11i(r) + 4q(r). -2r - 522 Let f = 64 - 32. Suppose 2q + f - 38 = 0. Let v(j) = -9j3 + 7j*2 - 7. Let a(r) = -4r*3 + 3r*2 - 3. Give qv(x) - 7a(x). x3 Let l(g) = -375g - 175. Let k(t) = -75t - 32. What is 22k(i) - 4l(i)? -150i - 4 Let o(k) = k. Let a = -6779 + 6771. Let p(h) = -24h. What is ao(z) - p(z)? 16z Let o(z) = -343z*2 + 21z + 18. Let x(w) = -342w2 + 17w + 15. Determine -5o(m) + 6x(m). -337m2 - 3m Let n(x) = -4x3 - 7x*2 - 205x + 6. Let y(q) = -3q3 - 6q*2 - 208q + 5. Determine 6n(m) - 7y(m). -3m3 + 226m + 1 Let u(k) = -2k + 3. Let b(f) = -4f. Let d(y) = -21y - 1. Let h(m) = 11b(m) - 2d(m). Suppose 16150 - 16186 = 12s. Calculate sh(j) + 2u(j). 2j Let s(z) = 4z*3 - 3z*2 + 9z. Let q(n) = -1787944 + 2n3 + 1787944 - n2 + 4n. What is -13q(u) + 6s(u)? -2u3 - 5u*2 + 2u Let i(q) = -13q2 - 3q - 3. Let o(x) = 20x2 + 5x + 4. Let l be 622/1866 + 60/910/(-8). Determine li(w) - 5o(w). 4w*2 - w + 4 Suppose 2c - 5 + 7 = 0. Let l(s) = s3 + 1. Let u(z) be the third derivative of z6/30 + z4/12 - z3/6 - 21z2 - 1. Calculate cl(q) + u(q). 3q3 + 2q - 2 Let s(v) = -5v3 - 2v*2 + 8v - 2. Let x(a) = 2a3 + a2 - 4a + 1. Let r be 32/2 + 495 + -514. Calculate rs(h) - 7x(h). h3 - h2 + 4h - 1 Let h(q) = -57q*3 + 5q*2 + 18q - 2. Let d(g) = 38g3 - 3g*2 - 12g + 1. Determine 8d(n) + 5h(n). 19n3 + n2 - 6n - 2 Let z(r) = -4r2 + 2r + 5. Let k(l) = l*2 - l - 2. Determine -11k(c) - 6z(c). 13c*2 - c - 8 Let f(m) = 4m*2 - 29m + 48. Let t be f(4). Let v(z) = 5z + 6. Let i(s) = s2 + s + 1. What is ti(b) + v(b)? -4b2 + b + 2 Let s(f) = f - 1. Let t(b) be the first derivative of -4b*2 + 17b + 333. Calculate 6s(i) + t(i). -2i + 11 Let b(o) = -4o - 2 - 11o*2 + 4o*2 - 2o. Let r(p) = -4p + 0p - 6p2 - p - 2. Let k be -34 - (8 + 185(-24)/120). What is kb(c) + 6r(c)? -c*2 - 2 Let x(c) = 23c*3 + 15c*2 - 16c - 8. Let t(q) = 22q3 + 16q*2 - 12q - 6. Determine -4t(o) + 3x(o). -19o3 - 19o*2 Let x(k) = -2936k*2 + 2569k - 2569. Let j(g) = g*2 - g + 1. Calculate 5138j(n) + 2x(n). -734n*2 Let c = -2362 + 2370. Let t(b) = -3b - 10. Let a(z) = -2z - 7. Give ca(g) - 5t(g). -g - 6 Let s(a) = a2 - 35. Let x be (-791)/(-2)212/371. Let m = x + -221. Let u(v) = -5. What is ms(l) - 35u(l)? 5l2 Let n(c) = 17c*2 - 45c. Let k(s) = 3s2 + 8s - 15. Let o(i) = -5i2 - 9i + 21. Let j(w) = 7k(w) + 5o(w). What is 9j(a) + 2n(a)? -2a2 + 9a Let n(r) = -3r3 - 2r - 1. Let c(x) = -4x3 - x2 - 3x - 1. Let l be ((-276)/115 - (-8)/20) + -1. Give ln(v) + 2c(v). v*3 - 2v*2 + 1 Let s(a) = 3a*2 - 2a + 6. Let n(m) = -3m2 + 2m - 5. Let c = -246 - -248. Suppose -t + cd - 1 = d, 2d = -5t + 23. Give ts(y) + 4n(y). -3y*2 + 2y - 2 Let k(m) = m*2 - 61m + 775. Let l be k(18). Let p(i) = -2 + 3i2 - 7i + 2i2 + 0i2. Let g(s) = -s2 + s + 1. Determine lp(r) + 4g(r). r*2 - 3r + 2 Let g be (12/3 + -2)/1. Let y(w) = -w3 + w2 + w. Let c be 12/(-4) + 7 + -1. Let r(o) = 2oc - 5o*3 - 2o - 8o2 + 2o*3 + 6o*2. Give gy(t) + r(t). -3t3 Let t(v) = 2v*3 - 3v*3 - 137v*2 - 1 + 0 + 138v*2 - v. Let q(p) = 3p*3 - 4p*2 - p + 2. Give q(u) + 2t(u). u*3 - 2u*2 - 3u Let v(s) = -24s3 - 36s*2 - 3s. Let c(n) = -6n3 - 9n*2 - n. Determine -15c(z) + 4v(z). -6z*3 - 9z*2 + 3z Let z(i) = -10i - 13i*2 + 15i + 28i2 - 16i*2 - 6i - 1. Let o(u) = -6u2 - 3u + 2. What is o(d) - 2z(d)? -4d2 - d + 4 Let z(i) = i3 - 1. Let p be 15/(-18)-3 + (-21)/(-14). Let a be p(-22 + (20 - 4)/4). Let m = 74 + a. Let f(y) = -y*3 + y + 1. What is mf(l) + 3z(l)? l3 + 2l - 1 Let t = -3183 - -3177. Let n(d) = -7d3 - 13d*2 + 13d + 17. Let r(s) = 3s3 + 6s*2 - 6s - 8. What is tn(h) - 13r(h)? 3h3 + 2 Let g = 163765 - 163760. Let i(s) = -4s - 3. Let t(d) = 3d + 2. Suppose 0 = -0v + 3v - 18. What is gi(f) + vt(f)? -2f - 3 Let g(a) = -4a. Let u(w) = w. Let t(q) = q2 + 3q - 42. Let k be t(-5). Let p = -34 - k. Calculate pg(i) - 11u(i). -3i Let c(v) = v3 - 9v*2 + 34v + 5. Let r be (38/171 - (-3 + 74/9))-1. Let j(g) = -4g*2 + 17g + 2. Give rj(l) - 2c(l). -2l3 - 2l*2 + 17l Let j(m) = 0m + 5m - 4m. Let h(p) = -2949p + 18. Let w(g) = -776g + 5. Let i(l) = -5h(l) + 19w(l). What is -i(x) + 3j(x)? 2x - 5 Let b(i) = -2i + 8. Let t(y) = y - 7. Let n(g) = g*2 - 394g - 4461. Let o be n(-11). Calculate ot(h) - 5b(h). 4h + 2 Let h = 2320 + -2322. Let o(v) = 6v - 1. Let t(y) be the first derivative of -y*2/2 - 1. Calculate ht(p) - o(p). -4p + 1 Let b(f) = 1860f + 744. Let c(j) = -2j + 3. Give b(n) - 248c(n). 2356n Suppose -f - 1 + 18 = 4k, 2k = -4f - 2. Let z(r) = 13r2 - 6r + 7. Let g = 170 + -177. Let w(s) = 9s2 - 4s + 5. What is gw(p) + kz(p)? 2p2 - 2p Let p(q) = -q + 1. Suppose -l + 0v + 47 = -v, 4l = -4v + 204. Let k(r) = -1711 - lr - 7r + 1759. What is k(f) - 48p(f)? -8f Let f(z) = 40z - 5. Let a(h) = 23h - 3. Let c(s) = -7a(s) + 4f(s). Let m(q) = -2q + 39. Calculate 4c(o) - m(o). -2o - 35 Let y(i) be the second derivative of -i5/10 + i4/3 - i*3/3 - 56i + 1. Suppose 0 = -6k + 16 - 28. Let t(u) = u3 - u2 + u. Determine ky(w) - 6t(w). -2w*3 - 2w*2 - 2w Let j(o) = o - 6. Let s(x) = 3. Let w(u) = 37u + 271. Let i(l) = -7l - 54. Let n(q) = -11i(q) - 2w(q). Let z be n(-18). What is zj(c) - 5s(c)? -2c - 3 Let b(l) = 32 + 3304l*2 - 33 - 3305l*2. Let j be -3 - 2(0 + 1). Let m(r) = -4r2 + 3r - 3. Determine jb(t) + m(t). t2 + 3t + 2 Let m(i) be the first derivative of 4i2 - 5i + 626. Let t(g) = -17g + 9. What is 5m(l) + 3t(l)? -11l + 2 Let c(l) be the third derivative of l4/12 - l3/2 - 7l2. Let k(d) = -3 + 20d - 18d + 3 - 3. Give -4c(f) + 3k(f). -2f + 3 Let z(o) = 3o - 5. Let n(s) be the first derivative of 2s*2 - 4s - 1069. Give 4n(l) - 3z(l). 7l - 1 Let h(c) = -c3 + 5c. Suppose 5a = -10l - 5, -8l + 12l - 8 = 0. Let z(y) be the first derivative of 3y2 + 1 - 2 - 2y*2. What is az(w) + 2h(w)? -2w*3 Let u(a) = a + 3. Suppose 2k = z - 6, 0 = -0z - 2z - k + 2. Let h(b) = 41. Let o(v) = -17. Let c(l) = 5h(l) + 12o(l). What is zu(j) - 5c(j)? 2j + 1 Let g(o) = -o*2 - 17. Let l be g(0). Let	{ "pile_set_name": "DM Mathematics" }
25 What is eighteen fifths of a century in years? 360 Convert 708201.7 millennia to decades. 70820170 What is 11/8 of a gram in milligrams? 1375 How many millimeters are there in 3290.243um? 3.290243 How many centimeters are there in 3/10 of a kilometer? 30000 What is 0.3251298 hours in days? 0.013547075 How many months are there in one sixth of a year? 2 How many microseconds are there in 3/5 of a millisecond? 600 How many millilitres are there in 92822.79 litres? 92822790 What is six fifths of a century in decades? 12 How many litres are there in 0.967834 millilitres? 0.000967834 How many decades are there in 1.9648935 months? 0.0163741125 How many millimeters are there in three eighths of a meter? 375 How many millilitres are there in 3/50 of a litre? 60 What is 0.0289513 years in decades? 0.00289513 What is 6.128207ug in tonnes? 0.000000000006128207 What is 9872.141l in millilitres? 9872141 What is 1/6 of a century in months? 200 Convert 6871.281 years to months. 82455.372 Convert 10.29474ml to litres. 0.01029474 What is 1/5 of a decade in months? 24 Convert 0.7242427ml to litres. 0.0007242427 What is 27/5 of a kilometer in meters? 5400 Convert 924772.7ml to litres. 924.7727 How many micrograms are there in 1.153084 kilograms? 1153084000 How many seconds are there in twenty-eight thirds of a minute? 560 How many millilitres are there in six fifths of a litre? 1200 How many microseconds are there in 1/5 of a millisecond? 200 What is 73/5 of a litre in millilitres? 14600 What is 4/7 of a week in hours? 96 How many minutes are there in seven eighteenths of a week? 3920 What is 21/5 of a hour in seconds? 15120 What is five quarters of a litre in millilitres? 1250 What is 32/5 of a litre in millilitres? 6400 What is one fifth of a millennium in centuries? 2 What is 64090.91 nanoseconds in milliseconds? 0.06409091 Convert 86777.23kg to nanograms. 86777230000000000 What is 9.149064nm in kilometers? 0.000000000009149064 Convert 648.0307 litres to millilitres. 648030.7 How many seconds are there in one sixth of a minute? 10 Convert 149836.9 centuries to decades. 1498369 Convert 0.9629317 centimeters to micrometers. 9629.317 What is seven halves of a century in months? 4200 How many months are there in 247.0135 centuries? 296416.2 What is five quarters of a micrometer in nanometers? 1250 How many millimeters are there in 65.69375km? 65693750 Convert 22.5595t to kilograms. 22559.5 Convert 8.780461 days to nanoseconds. 758631830400000 What is 1.94775ml in litres? 0.00194775 What is 0.251822km in centimeters? 25182.2 How many millilitres are there in 3.667499l? 3667.499 How many decades are there in 2264.4 millennia? 226440 What is thirty-two fifths of a microgram in nanograms? 6400 What is one tenth of a litre in millilitres? 100 What is 222274.86 months in years? 18522.905 Convert 46834338.6 minutes to weeks. 4646.26375 How many kilometers are there in 5.251806mm? 0.000005251806 How many millimeters are there in 27/4 of a meter? 6750 What is eighty-eight fifths of a litre in millilitres? 17600 Convert 73656.48 seconds to nanoseconds. 73656480000000 What is 27/4 of a gram in milligrams? 6750 How many millimeters are there in 33/5 of a centimeter? 66 Convert 8273.322m to nanometers. 8273322000000 What is 7813.338 millilitres in litres? 7.813338 Convert 9.33511ng to tonnes. 0.00000000000000933511 How many meters are there in 25/4 of a kilometer? 6250 What is 599.682 days in seconds? 51812524.8 What is 350.648 centuries in years? 35064.8 What is 158540.1 minutes in microseconds? 9512406000000 How many seconds are there in thirty-one fifths of a minute? 372 What is 21/2 of a microgram in nanograms? 10500 What is one fifth of a litre in millilitres? 200 How many nanograms are there in 19/4 of a microgram? 4750 Convert 270.606 litres to millilitres. 270606 Convert 2.738871 microseconds to seconds. 0.000002738871 What is 99.595mm in centimeters? 9.9595 Convert 8.859578ml to litres. 0.008859578 How many millilitres are there in fifty-nine fifths of a litre? 11800 What is 1/6 of a minute in milliseconds? 10000 What is 592653.5 meters in nanometers? 592653500000000 How many millilitres are there in 90733.69 litres? 90733690 How many milliseconds are there in 87892.22 days? 7593887808000 How many kilograms are there in 5/4 of a tonne? 1250 What is 7.80944 tonnes in kilograms? 7809.44 Convert 1.6355313 months to decades. 0.0136294275 How many kilograms are there in 2/125 of a tonne? 16 How many millilitres are there in twenty-nine fifths of a litre? 5800 How many kilograms are there in 15/4 of a tonne? 3750 Convert 9.654956 kilograms to grams. 9654.956 What is 10/3 of a millennium in months? 40000 What is 248.653m in kilometers? 0.248653 What is fifty-one quarters of a litre in millilitres? 12750 Convert 5.548374g to tonnes. 0.000005548374 Convert 45066.3m to nanometers. 45066300000000 What is 9/10 of a centimeter in micrometers? 9000 What is 8027.896 weeks in days? 56195.272 How many years are there in 6/5 of a decade? 12 How many micrograms are there in 7.428139 nanograms? 0.007428139 How many seconds are there in one sixteenth of a day? 5400 How many nanometers are there in 74/5 of a micrometer? 14800 How many millennia are there in 575030.3 years? 575.0303 How many micrometers are there in eleven halves of a centimeter? 55000 How many months are there in 7/3 of a century? 2800 How many nanometers are there in one tenth of a micrometer? 100 How many hours are there in five sixths of a day? 20 How many decades are there in 7132.336 centuries? 71323.36 How many meters are there in 5.00471mm? 0.00500471 Convert 89544.2ng to micrograms. 89.5442 What is nine tenths of a gram in milligrams? 900 What is five quarters of a litre in millilitres? 1250 What is 711206.6 decades in millennia? 7112.066 How many millilitres are there in twenty-seven fifths of a litre? 5400 What is 1.767632 millilitres in litres? 0.001767632 How many micrograms are there in fourty-five eighths of a milligram? 5625 How many milligrams are there in 86.18414kg? 86184140 How many hours are there in 3801925.8us? 0.0010560905 What is 2698.009us in nanoseconds? 2698009 What is three fifths of a kilometer in centimeters? 60000 What is eleven quarters of a tonne in kilograms? 2750 How many litres are there in 7852.069 millilitres? 7.852069 How many minutes are there in 24283.911ns? 0.00000040473185 What is 3/8 of a litre in millilitres? 375 What is 13/8 of a centimeter in micrometers? 16250 What is 0.2282748 nanograms in kilograms? 0.0000000000002282748 What is thirty-two fifths of a kilogram in grams? 6400 How many millilitres are there in three tenths of a litre? 300 How many seconds are there in five eighths of a day? 54000 What is 6/5 of a microsecond in nanoseconds? 1200 What is one fifth of a minute in milliseconds? 12000 What is seventy-one quarters of a millennium in decades? 1775 How many micrograms are there in 883477.7 kilograms? 883477700000000 What is 1/4 of a microgram in nanograms? 250 How many millilitres are there in five quarters of a litre? 1250 How many years are there in 0.8142041 millennia? 814.2041 How many centimeters are there in one quarter of a meter? 25 How many milligrams are there in 1/16 of a kilogram? 62500 How many seconds are there in 29/5 of a hour? 20880 What is three tenths of a meter in millimeters? 300 What is seventeen halves of a millennium in years? 8500 How many centuries are there in thirty-one fifths of a millennium? 62 How many grams are there in 17/4 of a kilogram? 4250 How many millilitres are there in seven halves of a litre? 3500 How many months are there in 9/10 of a millennium? 10800 How many milligrams are there in 0.2448152 kilograms? 244815.2 What is 27/2 of a litre in millilitres? 13500 Convert 2721.412 decades to centuries. 272.1412 Convert 47.84157 millilitres to litres. 0.04784157 How many milliseconds are there in one sixteenth of a minute? 3750 How many months are there in 60598.01 centuries? 72717612 What is 3/50 of a tonne in kilograms? 60 Convert 3894.628 grams to nanograms. 3894628000000 What is 13/5 of a micrometer in nanometers? 2600 How many minutes are there in 14/9 of a week? 15680 What is 50045.2l in millilitres? 50045200 What	{ "pile_set_name": "DM Mathematics" }
. -174q2 Collect the terms in -6 + 464m + 3 + 3. 464m Collect the terms in 9x + 32x2 - 346x*2 + 13x - 32x2. -346x*2 + 22x Collect the terms in 76 - 32 - 5w2 - 32. -5w*2 + 12 Collect the terms in 9s - 12 - 5s + 14s + 0 + 8. 18s - 4 Collect the terms in -30 - 567h*3 + 14 + 16. -567h*3 Collect the terms in 50 - 44 + 8p - 7p + 2p - 14. 3p - 8 Collect the terms in 3a*3 - 3594a + 3594a - 3a*3 - 3a*3. -3a*3 Collect the terms in -407 + 1698k + 216 + 191. 1698k Collect the terms in 1992r - 1947r + 4r*3 - 6r*3. -2r*3 + 45r Collect the terms in -60 - 72 - 711 - b - 2b. -3b - 843 Collect the terms in -311i + 66i + 58i + 60i + 65i + 61i. -i Collect the terms in 1052m - 527m - 516m. 9m Collect the terms in 10 - 5x3 - 22 - x3 + 2x*3. -4x*3 - 12 Collect the terms in -441 - 470 + 1874 - 2b - 441 - 463. -2b + 59 Collect the terms in -173z*3 + 49z*3 + 40z*3 + 39z*3 + 46z3. z3 Collect the terms in -q*3 - 11q*3 - 24q3 + q3. -35q3 Collect the terms in 788y + 791y - 1591y. -12y Collect the terms in -278 - 296 - 284 + 858 - 15o*2. -15o*2 Collect the terms in 2 + 8893k*2 + 8962k*2 - 17957k*2. -102k*2 + 2 Collect the terms in -54c*2 - 61c*2 - 77c*2 - 63c*2 + 253c*2. -2c*2 Collect the terms in 300r*3 - 202r - 279r3 + 202r. 21r3 Collect the terms in 2k + 147 + 198 + k - 25. 3k + 320 Collect the terms in 418 + 3g - 3g - g - 849. -g - 431 Collect the terms in 18h - 29h - 207h. -218h Collect the terms in -735z*3 + 3 - 2 - 89z*3 + 0. -824z*3 + 1 Collect the terms in -109g + 9 + 4 + 4 - 16. -109g + 1 Collect the terms in 888j - 2159j + 1116j. -155j Collect the terms in -128 + p - 139 - 142 + 399. p - 10 Collect the terms in -7 - 27 - 62z - z2 + 2. -z2 - 62z - 32 Collect the terms in -7f*3 - 442f*2 + 3f*3 + 2046f*2. -4f*3 + 1604f*2 Collect the terms in -2548201 - s + 2548201. -s Collect the terms in 253j - 500j + 10 + 247j - 17 - 2j2. -2j*2 - 7 Collect the terms in -5w - 53w2 - 4 + 24 + 5w + 52w2. -w2 + 20 Collect the terms in -751s - 830s - 2s*3 - 748s + 2329s. -2s*3 Collect the terms in 210738k*2 - 160632k*2 + 494503k*2. 544609k*2 Collect the terms in 0i*3 - 5i*3 + 270i + 4i3. -i3 + 270i Collect the terms in 19f + 443 - 2f - 186 - 257 - 2f3. -2f*3 + 17f Collect the terms in 3y - 3y + 429y3 - 209y*3 - 228y*3. -8y*3 Collect the terms in -32b*2 + 335 - 2b*3 - 669 + 334 + 74b. -2b3 - 32b*2 + 74b Collect the terms in -o*3 - 3359o*2 + 9504o2 - 78 + 78. -o3 + 6145o2 Collect the terms in 807d + 1414d - 464d + 568d. 2325d Collect the terms in -8 - 18r3 - 29r*3 + 4r*3. -43r*3 - 8 Collect the terms in 959996j - 959996j + 4j*3. 4j*3 Collect the terms in 11 + 8 + q + 18 - 20. q + 17 Collect the terms in -703a + 378a - 11a*3 + 325a. -11a3 Collect the terms in i - 3i - 4i - 14i + 24i. 4i Collect the terms in 398p3 - 389p*2 + 389p*2 - 401p*3. -3p*3 Collect the terms in 67l + 69l - 269l + 54l + 66l + 60l. 47l Collect the terms in 78 - 24 + 8u2 - 20 - 34. 8u*2 Collect the terms in -24r*2 + 24r*2 - 3504r*3 - 4896r*3. -8400r*3 Collect the terms in 1854c*2 - 604c*2 - 624c*2 - 630c*2. -4c*2 Collect the terms in -381o - 66o - 1 + 0 - 39o. -486o - 1 Collect the terms in -16 + 5 + 11 + 586049v*2. 586049v*2 Collect the terms in 19w*3 + 15083 - 15083 - 15w*3. 4w*3 Collect the terms in 82l + 84l - 259l + 13759 - 13759 + 87l. -6l Collect the terms in -11621s - 7716s - 1105s. -20442s Collect the terms in -57y - 49y - 51y - 66y + 231y. 8y Collect the terms in -25c - 30334c*3 - 41c + 30332c3. -2c*3 - 66c Collect the terms in -4t2 - 104 - 107 + 214. -4t*2 + 3 Collect the terms in 3410q + 1 - 1 - 832q + 1550q. 4128q Collect the terms in 5448n + 5449n - 21805n + 5448n + 5455n. -5n Collect the terms in 177600w*2 - 177605w*2 + 3w - 3w. -5w*2 Collect the terms in 2d - 1051 + 2130 - 1079. 2d Collect the terms in -16o - 11o + 19o + 18 - 21. -8o - 3 Collect the terms in -140v - 249v + 42v. -347v Collect the terms in -k - 281k*2 + 162k*2 + 2k - k + 117k2. -2k*2 Collect the terms in -1174k*2 - 1081k*2 + 2261k*2. 6k*2 Collect the terms in 193s*2 + 194s*2 + 199s*2 + 187s*2 - 745s*2. 28s*2 Collect the terms in -3249s - 9536s - 8648s - 2286s. -23719s Collect the terms in 37 + 61q3 + 6q*3 - 37 - 18q*3. 49q*3 Collect the terms in -19d*2 + 152d*2 - 32d*2 - 45d*2 - 19d*2. 37d*2 Collect the terms in -6698q*2 - 2q + 2q + 6701q*2. 3q*2 Collect the terms in 23860b*3 - 47655b*3 + 23825b*3. 30b*3 Collect the terms in 163c*2 + 162c*2 - 326c2 + 2 - 2. -c2 Collect the terms in -155 + 85 - 7i - 125. -7i - 195 Collect the terms in -d - 241 - 2d + 30. -3d - 211 Collect the terms in -385b3 + 3 + 870b*3 - 3. 485b*3 Collect the terms in 8m + 84m - 22m + 67m. 137m Collect the terms in -12821n3 - 23748n*3 - 9604n*3 - 52868n*3. -99041n*3 Collect the terms in -367d - 341d + 1411d - 348d - 347d. 8d Collect the terms in -9b*3 + 4b*3 - 28468263 + 28468263 - 3b*3. -8b*3 Collect the terms in 362330a - 181152a - 181145a. 33a Collect the terms in -4157s + 4157s - 3s*2. -3s*2 Collect the terms in 10m - 334 + 242 - 292. 10m - 384 Collect the terms in -11851i*3 - 288i*2 + 288i*2. -11851i*3 Collect the terms in -44o*3 + 41o*3 - 2159o - 1 + 1. -3o3 - 2159o Collect the terms in -32807h + 10936h + 10936h + 10932h. -3h Collect the terms in 4o*2 + 1741o + 472 - 472 - 1804o. 4o*2 - 63o Collect the terms in 16l3 - 795 + 436 + 359. 16l*3 Collect the terms in -305 + 305 - 57s. -57s Collect the terms in -20t + 51t - 35t + 178t. 174t Collect the terms in c*3 - 12849968c*2 + 12849968c2. c3 Collect the terms in -131a - 821a - 1120a. -2072a Collect the terms in -19b + 53b*2 + 174b*2 - 38b*2 + 14b. 189b2 - 5b Collect the terms in -150v + 93v - 52v - 556v. -665v Collect the terms in 0n2 - n2 - 2n2 + 11n*2 - 4n*2 - 50. 4n*2 - 50 Collect the terms in 2f*2 - 971f*3 + 111 - 111. -971f*3 + 2f*2 Collect the terms in -9821a*2 + 6 - 10 + 4. -9821a*2 Collect the terms in -9b + 9 + 25b + 17b - 2b. 31b + 9 Collect the terms in 1547n3 - 786n*3 - 762n3 + 6 - 6. -n3 Collect the terms in -2f3 + 39472f - 39472f - f3. -3f*3 Collect the terms in 31812j - 637j + 20572j. 51747j Collect the terms in 558l*2 - 38500 + 38500 + 873l*2. 1431l*2 Collect the terms in 11973r*2 - 3992r*2 - 19r*3 - 3991r*2 - 3990r*2. -19r*3 Collect the terms in 22 + 70f + 3 - 12 - 14. 70f - 1 Collect the terms in -31m*3 - 239m*3 + 148m*3 + 134m*3. 12m*3 Collect the terms in -541 + 101 + 499 + v. v + 59 Collect the terms in 1711 - 2v*2 + 2747 - 4458. -2v*2 Collect the terms in -7v*3 - 10010652v*2 + 10010652v*2. -7v*3 Collect the terms in 666l*3 - 7 + 1277l*2 - 1277l*2. 666l*3 - 7 Collect the terms in 492o*3 + 416o*3 - 1163o*3. -255o*3 Collect the terms in -51j - 109j - j - 24j. -185j Collect the terms in 4q - 9q + 374 - 374 + 19q - 3q. 11q Collect the terms in -6 + 2 - 3i3 - 58567i + 4 + 58592i + 4i3. i3 + 25i Collect the terms in 9w*2 - 53w*2 + 50w*2 - 11 + 11. 6w*2 Collect the terms in -16 + 13 - 4t + 4t + 87t*2. 87t*2 - 3 Collect the terms in 22i - 67i + 46i. i Collect the terms in 1003p + 997p - 3016p + 1003p. -13p Collect the terms in -5774h*3 + 23104h*3 - 5775h*3 - 5779h*3 - 5775h3. h3 Collect the terms in -7r + 1591 - 1591 - r - 14r. -22r Collect the terms in -3 + 2d + 14d2 + 7d*2 + 7d - 29d2. -8d*2 + 9d - 3 Collect the terms in -165l - 168l - 171l - 170l + 838l - 165l. -l Collect the terms in -133 - 20w - 131 - 132 + 398. -20w + 2 Collect the terms in 42155h3 - 42243h*3 - 4h2 - h2 + 3h2. -88h*3 - 2h*2 Collect the terms in 3b*3 + 127b*3 - 1 + 2 + 0b*3. 130b**3 + 1 Collect the terms in 2 - 1	{ "pile_set_name": "DM Mathematics" }
197, 211? x*3 - 5x*2 - 2x + 221 What is the k'th term of -40, -36, -18, 20, 84, 180, 314? k3 + k2 - 6k - 36 What is the d'th term of 36, 38, 40, 42? 2d + 34 What is the h'th term of 10, 9, 8, 7, 6? -h + 11 What is the g'th term of 24, 51, 80, 111, 144? g*2 + 24g - 1 What is the p'th term of -3112, -6223, -9334, -12445, -15556, -18667? -3111p - 1 What is the z'th term of -66, -152, -238, -324? -86z + 20 What is the x'th term of 7, 1, -1, 7, 31, 77, 151? x*3 - 4x*2 - x + 11 What is the p'th term of 607, 2445, 5511, 9805, 15327, 22077? 614p*2 - 4p - 3 What is the k'th term of -56, -384, -1266, -2978, -5796, -9996? -46k3 - k2 - 3k - 6 What is the v'th term of -759, -757, -755, -753, -751, -749? 2v - 761 What is the r'th term of 50, 52, 54, 56? 2r + 48 What is the y'th term of 236, 432, 628, 824, 1020? 196y + 40 What is the w'th term of -69, -70, -71, -72, -73? -w - 68 What is the i'th term of 12, 10, 10, 12, 16? i2 - 5i + 16 What is the y'th term of -107, -218, -331, -446, -563, -682, -803? -y*2 - 108y + 2 What is the z'th term of -84, -93, -104, -117, -132, -149, -168? -z*2 - 6z - 77 What is the r'th term of -483, -966, -1449, -1932, -2415, -2898? -483r What is the h'th term of -26, -34, -42, -50, -58? -8h - 18 What is the m'th term of 721, 727, 731, 727, 709, 671? -m*3 + 5m*2 - 2m + 719 What is the p'th term of 17954, 17965, 17992, 18041, 18118, 18229, 18380, 18577? p*3 + 2p*2 - 2p + 17953 What is the y'th term of 71, 118, 163, 206, 247? -y*2 + 50y + 22 What is the q'th term of -110, -222, -336, -452? -q*2 - 109q What is the r'th term of -355, -729, -1089, -1429, -1743, -2025? r3 + r2 - 384r + 27 What is the g'th term of -4920, -4921, -4922? -g - 4919 What is the s'th term of 82, 150, 218, 286? 68s + 14 What is the y'th term of 1280, 1275, 1270, 1265? -5y + 1285 What is the f'th term of 52, 216, 492, 874, 1356, 1932? -f3 + 62f*2 - 15f + 6 What is the t'th term of 77, 65, 63, 77, 113, 177, 275? t3 - t2 - 16t + 93 What is the t'th term of 151, 304, 457? 153t - 2 What is the j'th term of 10, 3, -4? -7j + 17 What is the x'th term of 720, 727, 734, 741, 748, 755? 7x + 713 What is the k'th term of 17, 28, 39, 56, 85, 132, 203, 304? k*3 - 6k*2 + 22k What is the s'th term of -32, -97, -192, -317, -472, -657? -15s2 - 20s + 3 What is the v'th term of -1762, -1754, -1750, -1756, -1778, -1822, -1894? -v*3 + 4v*2 + 3v - 1768 What is the i'th term of 3, 29, 69, 123, 191, 273? 7i2 + 5i - 9 What is the b'th term of 1742, 1739, 1734, 1727, 1718, 1707? -b*2 + 1743 What is the p'th term of 313, 606, 899, 1192? 293p + 20 What is the j'th term of -3905, -7809, -11711, -15611, -19509? j*2 - 3907j + 1 What is the d'th term of 8414, 16826, 25236, 33644, 42050, 50454, 58856? -d*2 + 8415d What is the c'th term of -37, -74, -113, -154? -c*2 - 34c - 2 What is the p'th term of 0, 6, 12, 18, 24, 30? 6p - 6 What is the x'th term of -11, -34, -65, -98, -127, -146, -149? x3 - 10x2 - 2 What is the b'th term of -7, -21, -47, -91, -159, -257, -391? -b3 - 7b + 1 What is the r'th term of 27, 46, 51, 36, -5, -78, -189, -344? -r3 - r2 + 29r What is the v'th term of -119, -94, -69, -44? 25v - 144 What is the n'th term of -515, -524, -535, -548, -563? -n2 - 6n - 508 What is the p'th term of -185, -734, -1649, -2930, -4577? -183p2 - 2 What is the y'th term of 6, 6, 4, 0, -6? -y2 + 3y + 4 What is the v'th term of 175, 348, 521? 173v + 2 What is the i'th term of -5557, -11116, -16675, -22234? -5559i + 2 What is the q'th term of -40, -39, -38? q - 41 What is the h'th term of 209, 211, 215, 221, 229, 239? h*2 - h + 209 What is the d'th term of 44, 64, 88, 116, 148, 184? 2d*2 + 14d + 28 What is the y'th term of 131, 125, 121, 119, 119, 121? y*2 - 9y + 139 What is the s'th term of -79, -70, -61, -52, -43? 9s - 88 What is the j'th term of 82, 86, 54, -32, -190, -438, -794? -3j*3 + 25j + 60 What is the f'th term of 5, 0, -1, 8, 33? f*3 - 4f*2 + 8 What is the k'th term of 42, 89, 182, 333, 554, 857, 1254, 1757? 2k*3 + 11k2 + 29 What is the v'th term of 819, 820, 821? v + 818 What is the y'th term of -430, -857, -1298, -1759, -2246, -2765, -3322, -3923? -y3 - y*2 - 417y - 11 What is the h'th term of -5061, -10120, -15179, -20238? -5059h - 2 What is the g'th term of -118, -152, -232, -376, -602, -928, -1372? -3g*3 - 5g*2 + 2g - 112 What is the f'th term of 610, 1224, 1838, 2452, 3066? 614f - 4 What is the d'th term of 42, 35, 28? -7d + 49 What is the r'th term of -615, -616, -617, -618, -619? -r - 614 What is the t'th term of 24, 107, 326, 747, 1436, 2459, 3882, 5771? 11t3 + 2t2 + 11 What is the i'th term of 36, 11, -26, -81, -160, -269? -i3 - 18i + 55 What is the g'th term of 24, 34, 54, 90, 148, 234, 354, 514? g3 - g2 + 6g + 18 What is the k'th term of -1307, -2625, -3957, -5309, -6687, -8097, -9545? -k3 - k2 - 1308k + 3 What is the v'th term of -54, -58, -62, -66? -4v - 50 What is the j'th term of 528, 1047, 1566, 2085, 2604? 519j + 9 What is the o'th term of -12, -33, -70, -123? -8o*2 + 3o - 7 What is the q'th term of 38, 63, 88, 113? 25q + 13 What is the m'th term of 2832, 5659, 8486, 11313, 14140? 2827m + 5 What is the z'th term of 103, 209, 497, 1057, 1979? 15z3 + z2 - 2z + 89 What is the q'th term of 34, 67, 100, 133, 166, 199? 33q + 1 What is the d'th term of -13, -24, -23, -4, 39, 112, 221? d3 - 18d + 4 What is the l'th term of -64, -602, -2076, -4954, -9704, -16794? -78l3 + 8l + 6 What is the p'th term of 247, 246, 247, 250, 255, 262, 271? p*2 - 4p + 250 What is the f'th term of -245, -224, -175, -86, 55? 2f3 + 2f2 + f - 250 What is the o'th term of 2110, 4221, 6330, 8437, 10542, 12645? -o2 + 2114o - 3 What is the a'th term of -159, -319, -479, -639, -799, -959? -160a + 1 What is the l'th term of 20, 58, 128, 248, 436, 710, 1088? 3l3 - 2l*2 + 23l - 4 What is the c'th term of -253, -278, -321, -382? -9c2 + 2c - 246 What is the f'th term of 4, 41, 132, 301, 572, 969, 1516, 2237? 4f3 + 3f*2 - 3 What is the a'th term of -1891, -3782, -5673? -1891a What is the u'th term of 30, 65, 106, 153, 206, 265? 3u2 + 26u + 1 What is the i'th term of 42, 199, 460, 825, 1294, 1867? 52i2 + i - 11 What is the c'th term of -5, -23, -55, -107, -185, -295? -c3 - c2 - 8c + 5 What is the q'th term of -580, -579, -578? q - 581 What is the t'th term of 39, 38, 29, 6, -37? -t*3 + 2t*2 + 38 What is the p'th term of -20, -75, -166, -293, -456? -18p2 - p - 1 What is the v'th term of 735, 1466, 2201, 2946, 3707? v3 - 4v2 + 736v + 2 What is the i'th term of -7, -8, -9, -10, -11, -12? -i - 6 What is the i'th term of 548, 1102, 1654, 2204, 2752? -i*2 + 557i - 8 What is the z'th term of -20, -47, -74, -101, -128, -155? -27z + 7 What is the t'th term of -3528, -3527, -3526, -3525, -3524, -3523? t - 3529 What is the g'th term of 11, 18, 25, 32? 7g + 4 What is the x'th term of 248, 268, 288, 308, 328, 348? 20x + 228 What is the o'th term of 353, 351, 347, 341, 333? -o2 + o + 353 What is the o'th term of 205, 810, 1819, 3232, 5049, 7270, 9895? 202o*2 - o + 4 What is the c'th term of 7968, 7971, 7974, 7977? 3c + 7965 What is the t'th term of 13, 109, 371, 883, 1729, 2993, 4759? 14t3 - t2 + t - 1 What is the g'th term of 44, 129, 214? 85g - 41 What is the n'th term of -400, -392, -372, -334, -272? n3 + n - 402 What is the w'th term of 116, 226, 334, 440? -w2 + 113w + 4 What is the u'th term of 17, -4, -45, -112, -211? -u3 - 4u*2 - 2u + 24 What is the l'th term of -241, -242, -243? -l - 240 What is the s'th term of -70, -120, -168, -214, -258, -300, -340? s*2 - 53s - 18 What is the l'th term of 11, 22, 33, 44, 55? 11l What is the n'th term of 69, 173, 289, 423, 581, 769, 993, 1259? n3 + 97n - 29 What is the k'th term of -1, -10, -37, -88, -169, -286, -445, -652? -k*3 - 3k*2 + 7k - 4 What is the v'th term of -286, -319, -412, -595, -898, -1351? -5v3 + 2v - 283 What is the t'th term of 48, 54, 70, 102, 156? t3 - t2 + 2t + 46 What is the c'th term of -1579, -1573, -1567, -1561, -1555, -1549? 6c - 1585 What is the n'th term of -140, -138, -136, -	{ "pile_set_name": "DM Mathematics" }
-5 Let q = 1 + 1. Let d(f) = 4 + qf + 0 + 3 - 5. Determine d(-5). -8 Let z(w) = 3w*2. Let p be z(1). Let y be (p + -2)/(3 - 2). Let f(t) = -6t3 + t2. What is f(y)? -5 Let h(m) be the first derivative of -m*4/4 - 2m*3 - 5m*2/2 + m - 2. Let d = -111 - -107. Determine h(d). -11 Let b be (-28)/(-24) - 2/12. Let u be (-13 + b)18/(-24). Suppose 4s = 11 + u. Let z(g) = g3 - 4g*2 - 6g + 2. What is z(s)? -3 Suppose -15o - 72 = -6o. Let l(z) = -z*3 - 7z*2 + 7z + 2. What is l(o)? 10 Suppose s + 3s - 24 = 0. Suppose -s = 2h - h. Let d(n) = -n*2 - 5n + 8. Calculate d(h). 2 Let o(h) = 6h2 + 0h - h*2 - 1 - 4h*2 + 5h. What is o(-5)? -1 Let t = -90 + 56. Let c(p) = -2p2 + 4p. Let j(x) = 108x + 5x*2 - 131x + 7x2. Let v(r) = tc(r) - 6j(r). Calculate v(2). -12 Let x(l) = 3l - 1. Let d(w) = 7w - 3. Let c(p) = -4d(p) + 9x(p). Let m(k) = -k + 2. Let t(q) = -4c(q) + 5m(q). What is t(4)? -6 Let t(p) = 4p3 + p2 - p*2 - 3p3. Determine t(2). 8 Let a(p) = -p3 + 4p3 - p - 1 - 6p*3. Calculate a(-1). 3 Let q(a) = -a. Let s(w) = -6w + 1. Let j be (-2)/(-5)(-15)/6. Let m(p) = jq(p) - s(p). What is m(1)? 6 Let a(l) = -2l - 6. Suppose -b - 8 = -1. Calculate a(b). 8 Let x be (-1 + 6)(-8)/10. Let d = 9 + -7. Let k(g) = 4g2 + dg + 0g2 - g + g3 + 1. Give k(x). -3 Let z(h) = -4h - 1. Let k(v) = 21v + 4. Let n be ((-66)/(-24))/(2/(-8)). Let c(q) = nz(q) - 2k(q). What is c(-3)? -3 Let w(q) be the second derivative of q4/12 + 7q*3/6 - 3q*2/2 + 7q. Give w(-6). -9 Suppose -2c + 19 = 11. Let z(n) be the second derivative of 1/12n*c + n + 0 + 2n2 + n3. Give z(-3). -5 Let j(q) = -q*2 - 6q - 3. Let x(c) = c*2 + 6c + 2. Let z(d) = 4j(d) + 3x(d). Let n be 32/(-6)5. Calculate z(n). -1 Let y(h) = h. Let p(s) = s - 13. Let f be p(10). Determine y(f). -3 Suppose 2s + 6v - 2v = 0, 4s - 3 = -5v. Suppose 3q = -1 + 10. Let k(h) = -2 - 2h - 2h*2 - 2h*3 + 4h + h*3 + 2h*q. Calculate k(s). 2 Let h(y) = -2y + 1. Let d be (-2)/6(7 - 1). Let v be h(d). Let r(i) = -i + 4. Determine r(v). -1 Let d = -11 + 12. Suppose -7 = 3k - d. Let t(b) = b*2 + b + 2. Determine t(k). 4 Let c(t) be the second derivative of 3t8/2240 + t6/720 + t5/120 + t4/6 - t. Let f(a) be the third derivative of c(a). Calculate f(-1). -9 Let g(z) = 4z3 + 3z*2 + z + 2. Let o be (3/93)/(4/(-8)). What is g(o)? -20 Let n(r) = -11r2 - 2r + 1. Let m = 11 + -17. Let j be 22/33m/(-4). What is n(j)? -12 Let j(l) be the second derivative of l5/60 + l4/8 + l3/3 - 2l. Let t(p) be the second derivative of j(p). What is t(-4)? -5 Let q(r) = -r*3 + r + 7. Let v be ((-3)/2 + 27/18)1. Give q(v). 7 Suppose -88f - 33 = -91f. Let r(k) = k*2 - 12k + 9. What is r(f)? -2 Let t(i) = i*3 + 5i*2 + 2i - 3. Suppose 2m - 8 = 4b + m, -3b + 1 = m. Let x = b + -3. Give t(x). 5 Let r = 2 + 1. Suppose -f + 3a - 4 = 2, 0 = -2f - 3a - r. Let d(m) = 3m + 4. Give d(f). -5 Let r(x) = -x3 + 3x*2 + 5x + 2. Let j(c) = 3c - 14. Let t be j(6). Calculate r(t). 6 Let q(a) = -a + 3. Let r be q(-5). Let b(t) = t3 - 7t*2 - 9t + 9. Let g be b(r). Let m(j) = 0 + 3 - g - j. What is m(4)? -2 Let h be ((-12)/(-15))/((-4)/10). Let b = h + -2. Let x = b + 4. Let n(i) = -i3 - i + 5. What is n(x)? 5 Let f(d) = -d2 + 9d + 9. Let p(x) = x3 + x2 + x - 5. Let g be p(2). Calculate f(g). 9 Let u(f) be the first derivative of -f4/4 - 4f*3/3 - 2f*2 + 20. Calculate u(-3). 3 Let u(y) = 7y + 17. Let i be -5(-3)/(-3)-1. Let a(c) = -4c - 8. Suppose 31 = 2d - 5q, d - 4q - 23 = -0d. Let v(n) = du(n) + ia(n). Give v(-5). 6 Let j(f) = -f3 - 4f*2 + 5f - 5. Let v be 4/(-8)-72. Suppose 3t + 9 = y, -t = 4y - v - 3. Suppose -2 = m + y. Determine j(m). -5 Let u(i) = i - 1. Suppose 2c + 225 = 49. Let k be (c/(-8))/(2 - 1). Let d(s) = -3s + 2. Let q(y) = ku(y) + 4d(y). Determine q(-3). 0 Suppose 3t + 4w = 2w - 17, 6 = -t - w. Let f(b) = -b. What is f(t)? 5 Let d = 21 - 9. Suppose -3p = -h - d, 3h - 3p + 20 - 2 = 0. Let g(q) = 2q - 2. Give g(h). -8 Let f(m) = -m + 11. Suppose 0 = x - 0b - b - 17, -31 = -3x - 2b. Suppose 0 = -h + 4i + 3 - 0, -i = -2h + x. Let o be f(h). Let n(w) = w - 3. What is n(o)? 1 Let k(v) = v + 5. Let t(z) = -z*3 - 7z*2 - 7z - 6. Let u(i) = i3 - i2 - 6. Let s be u(0). Let a be t(s). Calculate k(a). 5 Let s = 13 + -11. Let h(k) = 2k3 - k2 - k - 2. Calculate h(s). 8 Let x(u) = 2u + u*2 - 2u - 4u - u. Determine x(6). 6 Let b(x) be the first derivative of 5/3x*3 - x + 7 - 2x*2 - 1/4x4. Determine b(3). 5 Let f(x) = x2 + 6x + 4. Let b(h) = 2h - 16. Let g be b(6). What is f(g)? -4 Let i(n) = n2 - 6. Let b = 15 + -15. Give i(b). -6 Let d(k) = -k3 + 2k2 + 1. Let l be d(2). Suppose -10 = 5g + 5f, 2g - 20 = -0g + 4f. Let j(a) = g + 32a - 3 - 16a - 12a. Give j(l). 3 Suppose -1 + 5 = 2r. Let o(p) = -2p - 1. Calculate o(r). -5 Let w be 21/148/6. Let t(l) = 3l2 - 4l + 3. Give t(w). 7 Let p(a) be the third derivative of a6/120 + a5/10 + a4/4 + a3 + a*2. Let r = -10 - -19. Let v = 4 - r. Give p(v). 1 Suppose 4l - 8 = 32. Suppose 2o = -g + l, 3g = -o - 3o + 18. Let s(j) = -j2 + 8j - 4. Determine s(o). 8 Let g(m) = m*2 - 7m - 10. Suppose -13 - 43 = -7t. Give g(t). -2 Let g(a) be the first derivative of a4/4 + 8a*3/3 + 3a*2 - 5a + 4. Let w(v) = -v*3 - 9v*2 - 7v + 6. Let z(h) = -5g(h) - 4w(h). Calculate z(-2). -3 Let a(q) = -6q - 6 + 4 + 6 - q2 + 3. Calculate a(-6). 7 Let c be (-28)/(-16) + (-2)/(-8). Let r(g) = 1 - 3g*c + 2 - g - 3g + 5g2. Let n = 3 - 1. Calculate r(n). 3 Let p(j) = j3 - 6j*2 - 7j + 3. Let y be p(7). Let a(z) = -2z. Calculate a(y). -6 Suppose -6 = 8s + 66. Let x(j) = -j*2 - 9j - 2. Determine x(s). -2 Let o(y) = 3y + 2. Suppose -2 = -7j + 6j. Calculate o(j). 8 Let u be 32/(-18) + 4/(-18). Let j(x) be the second derivative of x5/20 - x4/12 - x3/2 - x2/2 - 6x. Calculate j(u). -7 Let y(i) = i + 2. Let c be y(3). Let x = -2 - -5. Let b(f) = -10 - f + 2f + 3f - xf. Determine b(c). -5 Let b be (-45)/(-5) - (-4)/(-4). Let o(n) = 2n*3 - 4n2 + 4 - n3 + 6n - bn. Calculate o(4). -4 Let k be (-2 - -2) + -2 - -1. Let d(a) = -a*3 - a + 1. Let c(t) = 3t*3 + 3t - 3 + 5t2 + 5 + 0. Let w(n) = kc(n) - 4d(n). Give w(5). -1 Let q(v) = 2v*3 - 3v*3 + 2v*2 + 3 + 0 + 3v - 1. Suppose 4n + 32 = 5a, -n + 7 = 5a - 10. Suppose -az = i - 7, 0i - 4i + 11 = -z. Calculate q(i). 2 Let d(q) = -2 + 3q + 2 + 1. Let m be d(-1). Let r(n) = -2n. Calculate r(m). 4 Let w(r) = r*3 - 2r*2 - 7r - 5. Let m(t) = -22t + 3 + 5t*3 - 5t*2 - 19 - 2t*3. Let x(c) = 2m(c) - 7w(c). Determine x(5). 3 Let g(c) = c2 + 7c - 3. Let w = -2 - -4. Let q be 6/(-5)10/w. Calculate g(q). -9 Let l(o) = o2 - 6o - 7. Let u be 9/2 + (-4)/(-8). Determine l(u). -12 Let p(j) be the first derivative of -4 - 1/4j4 + 5/3j*3 - 3j - 2j2. Determine p(4). -3 Let d(c) = 5. Let y(v) = -v - 18. Let u(l) = 7d(l) + 2y(l). Let t be 2/3 + 7/3. What is u(t)? -7 Suppose -l = -2, 2a - 14 = l - 6l. Let i(m) = 0 + 2 - am + 5m - 2m. Let x = -3 - -7. Determine i(x). 6 Let n(y) = y. Suppose 0 = f - 3x - 15, -3f - 13 = -2f + 4x. Let v(m) = m + 4m3 - 4m + 1 - fm3. Let j be v(2). What is n(j)? 3 Let z(x) = 2x3 - x3 + 0x3. Let v(d) = 16d3 - d2 + d + 0d2 - 24d*3 + 3d*2. Let r(o) = -v(o) - 2z(o). Determine r(-1). -7 Let v(c) = c*2 - 12c + 14. Let j(u) = u*2 + 10u + 19. Let m be j(-9). Give v(m). -6 Let m be (-3)/4 + 138/24. Suppose 4w - 2v = -6v + 28, 0 = mw + 2v - 20. Let u(j) = -5 - j2 + 8j - wj - 1 + 0. Calculate u(4). 2 Suppose u - 8 = -0u. Suppose -x = x + u. Let t(q) = q*2 + 3q + 2. What is t(x)? 6 Suppose 3t = 2t + 4. Let w(y) = -7y3 + 10y*2 + 2y - 11. Let i(j) = 15j3 - 21j*2 - 4j + 23. Let k(h) = 6i(h) + 13w(h). Calculate k(t). 3 Let x(h) = -5h3 + 6h*2 + 3h - 8. Let l(q) = 11q3 - 12q*2 - 7q + 16. Let a(o) = 6l(o) + 13x(o). What is a(-6)? 10 Let a = -4 - -3. Let x be (-2 - 1)a1. Let o(m) = m*3 - 3m*2 - m. What is o(x)? -3 Let l = 0 - -3. Suppose -4y - p + 2p = 5, -ly = p + 2. Let t(r) = -5r*2. C	{ "pile_set_name": "DM Mathematics" }
t common divisor of 750 and 508325. 25 What is the highest common factor of 14082 and 744? 6 Calculate the highest common factor of 120 and 616020. 60 What is the highest common divisor of 326112 and 1806? 258 What is the highest common factor of 190 and 6475? 5 Calculate the greatest common divisor of 153 and 108477. 153 What is the greatest common factor of 51259 and 299? 13 What is the highest common factor of 947 and 1? 1 Calculate the greatest common divisor of 1624520 and 2720. 680 Calculate the greatest common factor of 529424 and 29. 29 What is the greatest common divisor of 24675 and 30315? 705 Calculate the greatest common factor of 141 and 1518758. 47 What is the highest common factor of 28345 and 15? 5 What is the greatest common factor of 139211 and 292? 73 What is the highest common factor of 36 and 310056? 12 Calculate the highest common divisor of 65 and 680. 5 What is the highest common factor of 220 and 35332? 44 Calculate the greatest common factor of 677430 and 1890. 270 Calculate the greatest common divisor of 216 and 260. 4 Calculate the greatest common factor of 270 and 1152765. 135 Calculate the highest common divisor of 6074 and 34. 2 What is the greatest common factor of 232389 and 567? 81 Calculate the greatest common divisor of 549 and 3429. 9 Calculate the greatest common divisor of 8997328 and 16. 16 Calculate the greatest common divisor of 7291 and 138. 23 Calculate the highest common divisor of 6948 and 1548. 36 Calculate the highest common divisor of 31882 and 38. 38 What is the greatest common factor of 705 and 321809? 47 Calculate the greatest common divisor of 437613 and 298. 149 What is the greatest common factor of 831 and 40996? 277 What is the highest common divisor of 732 and 101931? 183 Calculate the greatest common divisor of 24034 and 43676. 122 Calculate the greatest common divisor of 26950 and 7315. 385 Calculate the highest common factor of 3336 and 80. 8 Calculate the highest common divisor of 213790 and 10. 10 Calculate the highest common factor of 24558 and 144. 6 What is the highest common divisor of 112 and 399224? 56 What is the greatest common factor of 1025 and 3239? 41 Calculate the greatest common divisor of 165 and 36795. 165 What is the highest common divisor of 47736 and 357? 51 What is the greatest common factor of 2074 and 611708? 122 What is the greatest common divisor of 534 and 243148? 178 What is the greatest common divisor of 608 and 619628? 76 What is the highest common factor of 550522 and 490? 14 Calculate the greatest common factor of 604233 and 161. 161 What is the greatest common factor of 2151 and 45? 9 Calculate the greatest common divisor of 12625 and 275. 25 Calculate the highest common factor of 13393 and 2655. 59 What is the highest common factor of 222 and 2368? 74 Calculate the greatest common factor of 1760927 and 7. 7 What is the highest common factor of 128 and 16056? 8 Calculate the highest common factor of 2240 and 872. 8 What is the highest common divisor of 924 and 20053? 11 What is the greatest common divisor of 1722 and 154224? 42 Calculate the highest common divisor of 4964 and 2993. 73 Calculate the highest common factor of 75775 and 350. 175 What is the greatest common divisor of 91492 and 1028? 1028 What is the greatest common divisor of 35574 and 84? 42 What is the highest common factor of 72616 and 3130? 626 What is the highest common factor of 774809 and 119? 119 Calculate the highest common factor of 52215 and 22125. 885 Calculate the highest common divisor of 25 and 682115. 5 What is the highest common factor of 15 and 932115? 15 What is the greatest common divisor of 12 and 348336? 12 What is the highest common factor of 669 and 201? 3 What is the highest common factor of 3115 and 22339? 89 What is the greatest common divisor of 2155620 and 888? 444 Calculate the greatest common factor of 95 and 4525. 5 What is the highest common divisor of 30 and 2904? 6 Calculate the greatest common divisor of 418 and 372647. 209 Calculate the greatest common factor of 142 and 332422. 142 Calculate the highest common divisor of 756 and 15204. 84 What is the greatest common factor of 44 and 93456? 44 What is the highest common factor of 45 and 11955? 15 What is the highest common factor of 55557 and 9? 9 What is the highest common divisor of 1005252 and 456? 228 What is the highest common factor of 144293 and 1565? 313 Calculate the greatest common divisor of 454018 and 274. 274 What is the highest common factor of 6080 and 350? 10 What is the greatest common divisor of 20175 and 75? 75 Calculate the highest common factor of 1 and 8338. 1 What is the greatest common divisor of 624 and 341136? 48 What is the highest common factor of 252 and 7212? 12 Calculate the highest common factor of 408007 and 47. 47 Calculate the highest common factor of 184 and 364274. 46 What is the greatest common divisor of 1107 and 147987? 27 Calculate the greatest common divisor of 96915 and 65. 65 Calculate the greatest common factor of 2507 and 436. 109 Calculate the highest common factor of 20 and 130. 10 What is the highest common factor of 44197 and 5038? 229 Calculate the greatest common factor of 158 and 418226. 158 What is the highest common factor of 9000 and 4625? 125 Calculate the greatest common divisor of 6096 and 104. 8 Calculate the highest common factor of 5044 and 3068. 52 Calculate the greatest common divisor of 29036 and 833. 119 What is the greatest common divisor of 489 and 112633? 163 Calculate the highest common factor of 204945 and 975. 195 Calculate the greatest common divisor of 3 and 67251. 3 What is the highest common factor of 10591 and 490? 7 What is the highest common factor of 9559 and 10043? 121 What is the highest common divisor of 3132 and 8? 4 What is the highest common divisor of 230437 and 466? 233 Calculate the greatest common factor of 276 and 4731. 3 What is the greatest common factor of 64 and 732736? 64 What is the highest common divisor of 7050 and 3450? 150 Calculate the greatest common factor of 850 and 57188. 34 Calculate the highest common divisor of 58 and 62. 2 Calculate the highest common factor of 140 and 43673. 7 Calculate the greatest common divisor of 8119 and 1219. 23 Calculate the highest common divisor of 39649 and 93. 31 Calculate the highest common factor of 108 and 16875. 27 Calculate the highest common divisor of 270 and 32598. 18 What is the greatest common factor of 434 and 546406? 434 Calculate the greatest common factor of 5533 and 23138. 503 What is the greatest common divisor of 281855 and 70? 35 Calculate the highest common divisor of 93495 and 1380. 345 What is the highest common factor of 54 and 15202? 2 Calculate the highest common factor of 683378 and 898. 898 What is the greatest common factor of 38204 and 4? 4 What is the highest common divisor of 54 and 2883492? 54 Calculate the greatest common divisor of 60 and 5268. 12 Calculate the highest common divisor of 14 and 37646. 14 What is the highest common divisor of 47913 and 18? 3 Calculate the highest common divisor of 52 and 1542502. 26 Calculate the greatest common factor of 38491 and 17037. 631 What is the highest common divisor of 20898 and 43086? 258 Calculate the highest common divisor of 338 and 28366. 26 Calculate the highest common factor of 17 and 1855499. 17 What is the highest common divisor of 28 and 140077? 7 What is the highest common divisor of 46872 and 3759? 21 What is the greatest common divisor of 2925 and 9594? 117 Calculate the highest common divisor of 3838 and 38. 38 Calculate the greatest common divisor of 760 and 228. 76 Calculate the greatest common factor of 216011 and 19. 19 What is the highest common divisor of 130077 and 873? 873 Calculate the highest common divisor of 269980 and 60. 20 What is the greatest common factor of 68 and 953938? 34 Calculate the highest common divisor of 182 and 34463. 13 What is the highest common factor of 7175 and 12275? 25 Calculate the greatest common divisor of 49756 and 28. 28 Calculate the highest common factor of 180 and 10692. 36 Calculate the greatest common divisor of 30 and 3186. 6 What is the highest common divisor of 175823 and 32796? 911 Calculate the greatest common divisor of 651	{ "pile_set_name": "DM Mathematics" }
1, 2, 0, -4 in increasing order. -4, -1, 0, 1, 2 Sort -0.89, 4, 1/4, 7 in decreasing order. 7, 4, 1/4, -0.89 Put -15, 3, -1, 2 in decreasing order. 3, 2, -1, -15 Put -7, 3/2, 0, -4 in increasing order. -7, -4, 0, 3/2 Sort 1/4, -7.9, 5, 1, 20 in decreasing order. 20, 5, 1, 1/4, -7.9 Sort -4, -340, -3, 1 in ascending order. -340, -4, -3, 1 Sort -3, 4, -2, -5, -8. -8, -5, -3, -2, 4 Sort -4, -13, -22. -22, -13, -4 Put 6, -3, -2, -4, 0.4 in increasing order. -4, -3, -2, 0.4, 6 Put -0.5, 3/7, -100, -5, 14 in ascending order. -100, -5, -0.5, 3/7, 14 Put 3, -5, 177 in descending order. 177, 3, -5 Put 9, -4, 11, -5, -3 in increasing order. -5, -4, -3, 9, 11 Put 5, -5, -8, 2, 29 in ascending order. -8, -5, 2, 5, 29 Sort 1, -7, -1, -5/4, -3. -7, -3, -5/4, -1, 1 Put 78, 3, -4, -5 in increasing order. -5, -4, 3, 78 Sort -4, 39, 0.3, 4/5, -0.2 in descending order. 39, 4/5, 0.3, -0.2, -4 Sort 0, -1, 5, -7. -7, -1, 0, 5 Sort -0.2, -2, 4, 3.79 in decreasing order. 4, 3.79, -0.2, -2 Put -3, 15, 49 in ascending order. -3, 15, 49 Sort 1, -3, 102 in descending order. 102, 1, -3 Sort 0.4, 10/17, 0.5 in descending order. 10/17, 0.5, 0.4 Sort -2, 89, -4, -2/21 in descending order. 89, -2/21, -2, -4 Put 26, 2, -7, -1, 1 in descending order. 26, 2, 1, -1, -7 Sort -1, 0, 50, 5 in increasing order. -1, 0, 5, 50 Sort 0.5, -2/11, -0.2, 4/5. -0.2, -2/11, 0.5, 4/5 Sort 0, 6/5, -1/2, -1/9, 0.13 in increasing order. -1/2, -1/9, 0, 0.13, 6/5 Put -0.48, -4, 1 in decreasing order. 1, -0.48, -4 Sort 12, 9, -3. -3, 9, 12 Put 5, 90, 0.1 in decreasing order. 90, 5, 0.1 Sort 6, 0, -5. -5, 0, 6 Put 1, 0.4, -3.86 in increasing order. -3.86, 0.4, 1 Sort 2, 5, -33, -3, -5. -33, -5, -3, 2, 5 Sort 119, -9, -7 in increasing order. -9, -7, 119 Put -4, 1, 139 in descending order. 139, 1, -4 Sort -0.3, -1, -6.6 in increasing order. -6.6, -1, -0.3 Put -7, 4, 2, -23 in decreasing order. 4, 2, -7, -23 Sort -39, -2, -17, 5 in decreasing order. 5, -2, -17, -39 Put 0.07, -1, -17 in descending order. 0.07, -1, -17 Sort 0, 1/7, 3, -649 in increasing order. -649, 0, 1/7, 3 Put -9, 1, 4, -2 in increasing order. -9, -2, 1, 4 Put 0, -4, 23 in ascending order. -4, 0, 23 Sort 270, 4, 0, -4. -4, 0, 4, 270 Sort -1/3, -1/5, -434, -4. -434, -4, -1/3, -1/5 Put -138, -0.5, -4 in increasing order. -138, -4, -0.5 Put -3, 2, -0.01, -4, -1.43 in descending order. 2, -0.01, -1.43, -3, -4 Sort -3, -1/5, -0.1, -1/2 in increasing order. -3, -1/2, -1/5, -0.1 Sort 46, 2, 146 in descending order. 146, 46, 2 Sort -4, 1/7, -0.09, 0.5. -4, -0.09, 1/7, 0.5 Sort -2/7, 1, 152, -0.3 in increasing order. -0.3, -2/7, 1, 152 Put 3, 1, 6 in decreasing order. 6, 3, 1 Sort 301, 2, -8. -8, 2, 301 Sort 0.5, 1333, -2 in decreasing order. 1333, 0.5, -2 Put 3, 1, -3, -1 in descending order. 3, 1, -1, -3 Put 785, 0.3, 3/7 in ascending order. 0.3, 3/7, 785 Sort -46, 5/3, -0.5, 4/3 in ascending order. -46, -0.5, 4/3, 5/3 Sort 4, -2, 0 in decreasing order. 4, 0, -2 Sort 6, -104, 2, 0 in ascending order. -104, 0, 2, 6 Put 3/5, 24, -0.2 in decreasing order. 24, 3/5, -0.2 Sort 0.08, -104, -0.3 in increasing order. -104, -0.3, 0.08 Sort -2/11, 0.4, -2, 16, -2/15. -2, -2/11, -2/15, 0.4, 16 Sort -0.4, 0.06, 2/99. -0.4, 2/99, 0.06 Sort 0.2, -1/4, -13, -0.5, 0.1 in descending order. 0.2, 0.1, -1/4, -0.5, -13 Sort -2, -35, 1, 5 in decreasing order. 5, 1, -2, -35 Sort 0.0187, 4/3, -2/5, -2. -2, -2/5, 0.0187, 4/3 Put 3, 2, -119, 0, -11 in decreasing order. 3, 2, 0, -11, -119 Put 4, -7, -1, -2 in decreasing order. 4, -1, -2, -7 Sort -3/8, -14, 3/5, -0.5, -3 in descending order. 3/5, -3/8, -0.5, -3, -14 Put 0, -4, 3/10 in increasing order. -4, 0, 3/10 Put -4, 1, 2 in increasing order. -4, 1, 2 Put 1, 0, -5, 3, 19 in decreasing order. 19, 3, 1, 0, -5 Put -163, 1/4, -1, -4 in increasing order. -163, -4, -1, 1/4 Put -5, 1, 7, -3 in descending order. 7, 1, -3, -5 Sort -1, 4, -2. -2, -1, 4 Sort 0, -1, -5, -9, -13 in descending order. 0, -1, -5, -9, -13 Put -2, 275, 3 in decreasing order. 275, 3, -2 Put -2/19, -0.4, -2/3 in decreasing order. -2/19, -0.4, -2/3 Put -6, 6, 25 in increasing order. -6, 6, 25 Put 12, 0.3, -94 in descending order. 12, 0.3, -94 Sort 1, -51, 5 in increasing order. -51, 1, 5 Put -1, -0.16, 0.3, -0.04 in decreasing order. 0.3, -0.04, -0.16, -1 Put 0.1, 1/5, 0, -1/14, -1 in increasing order. -1, -1/14, 0, 0.1, 1/5 Sort 4, 0, -0.2, 1/2. -0.2, 0, 1/2, 4 Sort -4/15, 4, 0.3, 0, 0.03. -4/15, 0, 0.03, 0.3, 4 Put -2/5, 3/5, -3/41, -2 in descending order. 3/5, -3/41, -2/5, -2 Put 0, -6, -3, 5 in descending order. 5, 0, -3, -6 Sort -3, -54, -66 in decreasing order. -3, -54, -66 Put -2.3, 3, -0.3 in decreasing order. 3, -0.3, -2.3 Sort 3, -4, -5, 1, 5 in descending order. 5, 3, 1, -4, -5 Put -1, 5, -18 in increasing order. -18, -1, 5 Sort 4, 5, 20 in decreasing order. 20, 5, 4 Put 0.1, 1/15, 2, 19 in descending order. 19, 2, 0.1, 1/15 Put -0.6, 1, -69, 4 in ascending order. -69, -0.6, 1, 4 Put -33, -9, -5 in descending order. -5, -9, -33 Sort -1, -40, 5, -5. -40, -5, -1, 5 Sort -1, 1, -4/181. -1, -4/181, 1 Sort -1, 0.5, 1, 0.1, 3 in descending order. 3, 1, 0.5, 0.1, -1 Put -0.04, 0.007, -1 in increasing order. -1, -0.04, 0.007 Sort 9/31, -1, 1/4 in ascending order. -1, 1/4, 9/31 Sort -2, -186, -4, 2 in increasing order. -186, -4, -2, 2 Sort 7, -36, 2 in ascending order. -36, 2, 7 Sort 4, -3, -4, -23, 2 in descending order. 4, 2, -3, -4, -23 Put -149, -1, -0.1 in ascending order. -149, -1, -0.1 Put -84, 68, 4 in increasing order. -84, 4, 68 Sort 55, 4, 0.2, 3. 0.2, 3, 4, 55 Sort -3, 86, -5, -7, 4 in decreasing order. 86, 4, -3, -5, -7 Put 1, 12, 5, -2, -3 in increasing order. -3, -2, 1, 5, 12 Sort 5408, 5, 2 in descending order. 5408, 5, 2 Put 2, 0.4, -1/6 in decreasing order. 2, 0.4, -1/6 Put 34, 6, -5 in decreasing order. 34, 6, -5 Put 14, -6, 1 in ascending order. -6, 1, 14 Sort 3, 4, -170, -4, -1 in increasing order. -170, -4, -1, 3, 4 Put 4, -1, -2491 in decreasing order. 4, -1, -2491 Put -0.5, 1, 7.3, 0.4 in increasing order. -0.5, 0.4, 1, 7.3 Sort -4, -3, 21, 0, -1. -4, -3, -1, 0, 21 Sort -4, 11, 0, -2, 4. -4, -2, 0, 4, 11 Sort 47, -1, 1, -5 in ascending order. -5, -1, 1, 47 Put 0, 2, -13 in ascending order. -13, 0, 2 Sort 0.08, -0.09, 0.3 in decreasing order. 0.3, 0.08, -0.09 Put -4, 47, 4 in decreasing order. 47, 4, -4 Sort 4, -1/6, -3, -34 in increasing order. -34, -3, -1/6, 4 Sort -15, -14, -5, 2 in descending order. 2, -5, -14, -15 Put 2/27, 0.1, -4 in descending order. 0.1, 2/27, -4 Sort -5, -8, -19 in increasing order. -19, -8, -5 Put -7, -3, 1/3, 3 in descending order. 3, 1/3, -3, -7 Sort 3, -2, 0.4, 0.341, 2/7. -2, 2/7, 0.341, 0.4, 3 Sort -0.15, -4/7, -1, 0.2, 4 in descending order. 4, 0.2, -0.15, -4/7, -1 Sort -1, -5, 77. -5, -1, 77 Sort 13, 4, -4, 1 in increasing order. -4, 1, 4, 13 Put -2/9, 1/7, 2/25, -0.2 in decreasing order. 1/7, 2/25, -0.2, -2/9 Put 4, 32, 16 in ascending order. 4, 16, 32 Sort -0.08, 4, 0, -1/4 in ascending order. -1/4, -0.08, 0, 4 Sort 2/5, -2, -4, -5, -2/21 in descending order. 2/5, -2/21, -2, -4, -5 Sort -4, 3, -1, 794, -0.4 in ascending order. -4, -1, -0.4, 3, 794 Sort -2/11, -1/14, 0.5. -2/11, -1/14, 0.5 Sort 21, -3, 3, 23 in decreasing order. 23, 21, 3, -3 Sort -5, -26, 0, -1, -2 in descending order. 0, -1, -2, -5, -26 Sort 0, -5, -17, 2, -2 in descending order. 2, 0, -2, -5, -17 Put 2, -5, 13, 3 in decreasing order. 13, 3, 2, -5 Sort -42, -3, 3 in increasing order. -42, -3, 3 Sort -2/63, 1, 2, 82, -3 in ascending order. -3, -2/63, 1, 2, 82 Sort 6, -9, -4/5, -1. -9, -1, -4/5, 6 Put 1, -16, -4, 3 in descending order. 3, 1, -4, -16 Sort 4, -3, -4, -13 in descending order. 4, -3, -4, -13 Sort 0, 8, 4/11 in increasing order. 0, 4/11, 8 Put 0.3, 3/7, 0.129 in increasing order. 0.129, 0.3, 3/7 Sort -26, -1, 2, 6, -2. -26, -2, -1, 2, 6 Sort -5/62, 2, -1, 5, 0.4 in increasing order. -1, -5/62, 0.4, 2, 5 Sort -3, 0.16, -0.4 in increasing order. -3, -0.4, 0.16 Put 1/11, 5, -3, 2/5, -0.1 in descending order. 5, 2/5, 1/11, -0.1, -3 Put 2/9, -42/5, -5 in descending order. 2/9, -5, -42/5 Sort -210/29, -3/2, 0.5. -210/29, -3/2, 0.5 Put 0.07, 0, 0.043 in decreasing order. 0.07, 0.043, 0 Sort -4, 1, -7 in increasing order. -7, -4, 1 Sort -5, -1, -31, 4, 1 in descending order. 4, 1, -1, -5, -31 Put 4, -1, 2, 11 in descend	{ "pile_set_name": "DM Mathematics" }
/(-36))/(-7)(-3 - 964 - -1) a multiple of 14? True Let s(y) = -212y - 2023. Is 19 a factor of s(-22)? True Let v = -274 - -277. Suppose 5i + vf - 1741 = 0, -f + 883 + 164 = 3i. Is 25 a factor of i? True Suppose 25 = 4r - 3c, r + c + 2 - 3 = 0. Suppose 0 = -rx, -5x = -2k - 4x + 326. Suppose -3b + n + 755 = 0, 2b - 362 = 5n + k. Does 50 divide b? True Suppose w = -17 + 18. Let d(q) = 248q - 1. Is 19 a factor of d(w)? True Let x be 147/((-2)/(-4) - (-3)/12). Suppose 3y - 68 = x. Does 4 divide y? True Let r(t) be the second derivative of t*4/6 - 37t*3/6 - 9t*2/2 + 4t. Let g be r(19). Does 28 divide (17 + 1 + -4)g? True Suppose 5y - 72 = -w, -3w + 2y - 4y = -190. Let f = 237 - w. Is 9 a factor of f? False Suppose -52 = -4q + 5w, q - 3w = -4w + 22. Suppose 14c - qc + 2008 = 0. Does 29 divide c? False Suppose 2m - 5g = -3g + 12, 4g = -5m + 3. Let a be (-37)/(-7) - (-2)/(-7). Is 100 - a/15m a multiple of 11? True Suppose -22 = 13u - 11u. Let f be u/((-11)/4) - (-1 + 1). Suppose fx - 463 = -111. Is x a multiple of 22? True Let s = -95 - -96. Does 11 divide ((-24)/120)/(s/(-5)) - -391? False Suppose -o + 21h = 24h - 345, 0 = -4o + h + 1328. Suppose -o - 39 = -4d. Does 31 divide d? True Let z be (-2)/6(18 + -3)1. Let c be (-1)/z + (-1)/5. Suppose 26l - 24l - 114 = c. Is l a multiple of 19? True Let k(j) be the third derivative of -7j6/720 - j5/24 - j4/2 + 13j*2. Let n(f) be the second derivative of k(f). Does 11 divide n(-6)? False Let r(w) be the first derivative of 5w3/3 - w2/2 + 2w - 54. Does 6 divide r(4)? True Suppose -4w + 2a - 26 = 0, 5 = -2w + 2a - 13. Let y be ((-198)/(-15))/(w/(-10)). Let c = 56 - y. Does 3 divide c? False Let q(u) = 19u + 13. Let b = 38 - 33. Let c be q(b). Suppose -3m - 39 + c = 0. Is 21 a factor of m? False Let b = -36 - -11. Let p be (-10)/b + 148/5. Suppose -2k + 88 = -p. Is 10 a factor of k? False Let g(v) = -v*3 + 7v - 6. Let a be g(2). Let i(p) = -2p3 - 14p + 2 - 16p + 29p + ap3 + 7p*2. Is i(3) a multiple of 8? True Let b = -150 - -152. Suppose 189 + 477 = bc + 5w, -c + 323 = 5w. Does 49 divide c? True Suppose -3i = x + i - 2, 0 = -i. Suppose 0 = 2h, xf = -5h + 7h + 160. Is 10 a factor of f? True Let n = 5 - -10. Let j(g) = 7g + 229. Let f be j(-32). Suppose -m - 5 = -p - 35, n = -fp. Does 6 divide m? False Let o = -950 - -1388. Let b = o + -222. Is b a multiple of 18? True Suppose 5j = 5u + 48355, -14542 = -2j - u + 4800. Is j a multiple of 19? True Let h(f) = 14f3 + 3f*2 + 4. Let t be h(4). Suppose -11p - 343 = -t. Is p a multiple of 5? True Suppose 4v + 50 = -5i + 353, 0 = 4v - 3i - 343. Is v/1 - (-24)/(-12) a multiple of 8? True Suppose -5q - 9 + 99 = 0. Suppose -1638 = qf - 24f. Is 21 a factor of f? True Let a(q) = q2 - 3q. Let x(k) = -k*2 + 6k - 4. Let u be x(4). Let b be a(u). Does 10 divide (1 + 0)/(b/236)? False Suppose 11f - 21f + 34293 = -43377. Does 9 divide f? True Suppose 0 = 121j - 5450178 + 1314640. Is j a multiple of 31? False Suppose -481i + 543i - 608220 = 0. Is 54 a factor of i? False Let z = 17172 - 7062. Is 6 a factor of z? True Let g = -191 - -197. Suppose -2u - 3p = 3u - 256, 0 = 3p - g. Does 5 divide u? True Let f be -1(1 + 4) + 3. Is 84 a factor of ((-21)/3 - (1 + f))-238? True Suppose 4a + 3c = a + 105, 3a = 3c + 99. Is -2 + a + (-12)/4 a multiple of 15? False Let w = 1007 - -140. Suppose -5d = 4a - w, 129 + 163 = a + 3d. Does 8 divide a? False Suppose -3n + 12v + 8976 = 15v, -3n + 8996 = -v. Suppose 8783 + n = 62j. Is j a multiple of 19? True Suppose -j - 2j + 9 = 0. Suppose -jm - 5 = -2. Is 9 a factor of (-160)/64m/((-10)/(-88))? False Suppose 6t + 50 = 16t. Suppose -5s - t = 0, 0 = -9u + 4u - 3s - 853. Does 6 divide (-4)/(-2) - u/5? True Let t(g) = g*3 - 17g*2 + 36g - 9. Let c(m) = 3m - 12. Let k be c(9). Let p be t(k). Suppose -7 - p = -4x. Is 6 a factor of x? False Let w(s) = -240s3 - 3s*2 - 39s - 77. Does 31 divide w(-2)? False Suppose 2l - 2u - 90 = 0, 0 = l + u - 60 + 13. Let o = 46 - l. Suppose o = 7s - 8s + 100. Is 32 a factor of s? False Suppose -4t - 6282 = -2i + 2782, 2t - 18098 = -4i. Is 125 a factor of i? False Suppose 3p = -2h + 19, -2 - 9 = -p + 4h. Let l be ((-14)/4 + 2)2p. Is 11 a factor of (-959)/l - 4/6? False Let u = -29 - -32. Suppose uo = 2k + 25, k = 2o - 21 + 5. Let t = o + 21. Does 7 divide t? True Let z(l) = 6l2 + 473l + 396. Does 4 divide z(-84)? True Suppose -8s + w - 613 = -10s, -2w + 314 = s. Let a = s - -128. Does 24 divide a? True Let b(i) be the first derivative of -i4 - 2i*2 - 1. Suppose a + g - 2 = 0, g + 4 = 7a - 10a. Is b(a) a multiple of 24? True Suppose -692q - 83q = -6238750. Is 46 a factor of q? True Let a(p) = -2p*2 - 5p + 6. Let t(l) = 2l3 - 29l*2 - 14l - 14. Let n be t(15). Let x be a(n). Is 9 a factor of 56 - x/(-3)6? True Suppose 4y + 4 = 0, -2y - 99 = 5r - 3y. Let g = 11 + r. Let q(s) = -s + 3. Is q(g) a multiple of 7? False Let p = -3605 + 3991. Is 2 a factor of p? True Is 77011((-60)/10)/(-6) - 1 a multiple of 110? True Does 91 divide (63/(-27)-3 - 23)(-2 + -861)? False Let h(b) = -b2 + 6b + 4. Let q be h(7). Does 20 divide (-9 + 8)/(q/7951)? False Let p(t) = 4t - 16. Let r be p(5). Suppose 5q - 216 = rv, -2q + 45 = -q + v. Let n = q - 24. Is n a multiple of 8? False Suppose 5q = 5j + 1065, -2j - 210 = -26q + 25q. Let l(m) = 2m2 - 2m - 3. Let a be l(3). Suppose q = -g + ag. Is g a multiple of 5? False Let f(d) = -7d + 4d - 9 - 44d - 36d. Does 18 divide f(-3)? False Let m be (-4)/(-1) - (-3)/62. Suppose -867 = -2a + 3l, ma = 2a + 5l + 1300. Does 24 divide a? False Suppose 4516 = -3o + 4p, -4o - 4p - 6053 = -3p. Suppose 6y = 4y - 2. Is y/(-2)o/(-9) a multiple of 14? True Suppose 0 = -7404c + 7422c - 410400. Does 38 divide c? True Let r(f) = 135f + 2. Let q(l) = 136l + 2. Let g(t) = -4q(t) + 3r(t). Is 17 a factor of g(-1)? False Let c(s) be the second derivative of s4/6 + s3 + 32s*2 + 92s. Is c(12) a multiple of 18? False Suppose 5g - 22 = -2v - 8, 3 = -3g - 5v. Suppose u + 1636 = gd, -4d - 5u + 2070 = d. Is 5 a factor of d? True Let m = -7392 + 9512. Is m a multiple of 20? True Suppose -3l - 5j - 919 = 0, 7l - j + 889 = 4l. Let m = 606 + l. Is m a multiple of 11? True Let d(r) = r3 - 30r*2 + 10r - 42. Let s(b) = 18b2 - 5b + 5. Let c be s(1). Suppose c - 288 = -9y. Is d(y) a multiple of 43? True Suppose a + 3y - 3522 = 0, -6a + 8a - 7052 = -4y. Is a a multiple of 16? False Let c = 12 - 19. Let z be c((-30)/(-21) + 2). Is (-16)/z(-234)/(-4) a multiple of 26? False Does 83 divide (-386 + 137)/((-1)/(-3)(-2)/16)? True Let c(k) = 29k + 206. Let m be c(-7). Suppose 3y = 2t + 478, -t - 2t - 483 = -my. Does 8 divide y? False Let a(o) = -17o - 87. Let i be a(-5). Is -12(-3)/(i + (-114)/(-48)) a multiple of 3? True Let v = 597 + -607. Does 8 divide (-2464)/1401v? True Suppose 4l + 5 - 24 = -o, 4o - 16 = -l. Let h(x) = 22x - 64. Is h(l) a multiple of 13? False Let v(q) = q*2 + 4q - 2. Let k be -7 - (-42)/1210/(-7). Does 14 divide v(k)? False Suppose -12d + 330981 + 81915 = 0. Does 88 divide d? True Let q = 45557 + -1044. Is 193 a factor of q? False Suppose -y = -4c + 26, -2y - 6 = y. Let j be (543/(-9))/(c/(-18)). Suppose -2a + 15 + j = -4l, -123 = -a - 3l. Is a a multiple of 27? True Suppose -8j - 7j + 331785 = 0. Suppose 0 = 40n + j - 62439. Is n a multiple of 18? True Let u = 90 + -26. Suppose -4r + 92 = -j, -j + 60 = 5r - u. Suppose -r = -3f + 5s, 7s + 14 = 2f + 3s. Is 13 a factor of f? True Let h(w) = w2 - w + 14. Let i be (-2 - (-2 + 2))(-3 - -2). Suppose -3u + 10 = f - 19, 0 = iu + 5f - 41. Is 20 a factor of h(u)? False Let q(f) = 5082f - 6. Does 141 divide q(1)? True Suppose -2w + 14400 = 2s + 2w, 3w = 2s - 14407. Does 13 divide s? True Let c be ((5 - 4) + 5)1. Is 19 a factor of c20/(-18)-114? True Let v(b) be the first derivative of 4b3/3 + 4b + 14. Let q be v(3). Let t = -13 + q. Does 8 divide t? False Let u(h) = -41h3 - 8h*2 + 15h + 14. Is 44 a factor of u(-6)? True Let v(b) = -b*3 - 9b*2 - 2b + 6. Su	{ "pile_set_name": "DM Mathematics" }
323 Two letters picked without replacement from aaaaa. Give prob of picking 2 a. 1 What is prob of picking 1 b and 2 u when three letters picked without replacement from bbbbubbbubbbbbu? 36/455 What is prob of picking 2 v and 1 q when three letters picked without replacement from {v: 2, q: 6}? 3/28 Four letters picked without replacement from {f: 1, h: 2, o: 1, u: 3, b: 4}. What is prob of picking 2 h, 1 u, and 1 o? 1/110 Calculate prob of picking 2 y, 1 j, and 1 k when four letters picked without replacement from yykjjyjk. 9/35 Calculate prob of picking 2 r and 1 f when three letters picked without replacement from {r: 2, f: 6, d: 4}. 3/110 Calculate prob of picking 1 l, 1 q, and 1 b when three letters picked without replacement from {b: 1, u: 2, q: 9, j: 1, l: 7}. 21/380 What is prob of picking 1 c and 2 n when three letters picked without replacement from cfn? 0 What is prob of picking 3 a when three letters picked without replacement from {h: 4, a: 6, v: 3}? 10/143 What is prob of picking 1 s and 1 c when two letters picked without replacement from dsskcga? 2/21 Calculate prob of picking 2 l and 2 g when four letters picked without replacement from gglgrrrlligllrllgggg. 196/1615 Four letters picked without replacement from {d: 1, p: 2, g: 1, h: 2, s: 1}. Give prob of picking 1 g, 1 h, and 2 p. 2/35 Calculate prob of picking 1 o and 1 u when two letters picked without replacement from uoqotnt. 2/21 Calculate prob of picking 1 o and 2 v when three letters picked without replacement from {o: 5, v: 11}. 55/112 Two letters picked without replacement from {j: 1, m: 1, d: 4, k: 7, x: 2}. Give prob of picking 1 j and 1 m. 1/105 Two letters picked without replacement from kxwkklkkkxlklkkk. Give prob of picking 1 l and 1 x. 1/20 Three letters picked without replacement from {i: 9, o: 3, a: 4}. Give prob of picking 2 i and 1 o. 27/140 Two letters picked without replacement from {y: 3, d: 7}. What is prob of picking 1 y and 1 d? 7/15 Calculate prob of picking 1 n and 2 e when three letters picked without replacement from enneeneenuunneennen. 84/323 Two letters picked without replacement from {e: 4, j: 4, a: 2, y: 5}. Give prob of picking 1 e and 1 j. 16/105 Two letters picked without replacement from {o: 3, t: 9}. What is prob of picking 2 t? 6/11 Two letters picked without replacement from {p: 1, s: 1, m: 3, j: 2}. Give prob of picking 2 p. 0 Calculate prob of picking 2 a and 1 f when three letters picked without replacement from {o: 6, f: 3, s: 4, a: 2}. 3/455 Four letters picked without replacement from cygyzna. Give prob of picking 1 a, 1 c, 1 g, and 1 n. 1/35 Three letters picked without replacement from yydeppdpdypeypde. Give prob of picking 2 d and 1 p. 3/56 Two letters picked without replacement from {m: 2, n: 3, i: 4}. Give prob of picking 1 i and 1 m. 2/9 Three letters picked without replacement from emmmmmmemmmmmmeeemm. Give prob of picking 3 e. 10/969 Calculate prob of picking 2 g and 1 b when three letters picked without replacement from {b: 2, g: 9}. 24/55 Two letters picked without replacement from ooojjxxbboqjooxb. Give prob of picking 1 x and 1 b. 3/40 Calculate prob of picking 1 u and 2 p when three letters picked without replacement from {r: 1, m: 1, p: 4, t: 1, u: 1}. 3/28 Two letters picked without replacement from jkljjjjkjjkjjjkkkjl. Give prob of picking 1 k and 1 j. 22/57 Two letters picked without replacement from {l: 3, z: 1, a: 3, o: 3, g: 1, s: 2}. Give prob of picking 1 z and 1 g. 1/78 Four letters picked without replacement from yxykkydyxdrkyk. What is prob of picking 3 k and 1 d? 8/1001 Calculate prob of picking 1 i, 1 p, 1 n, and 1 y when four letters picked without replacement from {i: 5, n: 6, y: 1, p: 7}. 35/646 Two letters picked without replacement from {f: 7, h: 7, j: 1, m: 1}. What is prob of picking 1 m and 1 h? 7/120 Calculate prob of picking 1 c, 1 d, and 1 m when three letters picked without replacement from jcncnnjdjnccnjmj. 1/140 Three letters picked without replacement from iiiiiiiiiisiisissiii. What is prob of picking 1 i and 2 s? 8/95 Calculate prob of picking 3 r when three letters picked without replacement from rxrrmrmmmrr. 4/33 What is prob of picking 2 k when two letters picked without replacement from {k: 17, b: 3}? 68/95 Three letters picked without replacement from {o: 2, a: 11, y: 1, h: 1}. Give prob of picking 2 a and 1 y. 11/91 Calculate prob of picking 2 z and 1 m when three letters picked without replacement from zfhfzmmfmzmhfzf. 24/455 Four letters picked without replacement from xexeexexpe. What is prob of picking 2 e, 1 p, and 1 x? 4/21 Four letters picked without replacement from whuuuuwhuauapukawh. What is prob of picking 1 a, 1 w, 1 p, and 1 h? 3/340 Three letters picked without replacement from ffafallflalfl. What is prob of picking 2 a and 1 f? 15/286 Calculate prob of picking 1 w and 2 k when three letters picked without replacement from {s: 1, w: 1, m: 3, k: 7}. 21/220 What is prob of picking 1 n and 2 z when three letters picked without replacement from xzvznzzx? 3/28 Calculate prob of picking 2 m when two letters picked without replacement from pmxxxxfxxxxxxxfxmz. 1/153 Four letters picked without replacement from {f: 4, a: 2, t: 1, q: 1, w: 5, l: 2}. What is prob of picking 2 w and 2 f? 4/91 Three letters picked without replacement from yyyeeyueyyeyeeyeeee. What is prob of picking 1 e, 1 y, and 1 u? 80/969 Calculate prob of picking 1 v, 1 f, and 1 c when three letters picked without replacement from {o: 2, c: 4, f: 11, v: 2}. 88/969 What is prob of picking 1 i and 1 r when two letters picked without replacement from {r: 1, z: 1, i: 3}? 3/10 Two letters picked without replacement from {m: 1, n: 7, k: 3, p: 2, v: 7}. What is prob of picking 1 p and 1 m? 1/95 Two letters picked without replacement from {c: 3, g: 13, e: 3}. What is prob of picking 1 g and 1 e? 13/57 Calculate prob of picking 2 k and 1 c when three letters picked without replacement from {k: 3, z: 4, c: 2}. 1/14 What is prob of picking 1 u and 1 y when two letters picked without replacement from {y: 1, n: 5, t: 3, a: 6, u: 2}? 1/68 Calculate prob of picking 2 s, 1 e, and 1 v when four letters picked without replacement from {e: 4, s: 3, k: 1, p: 7, v: 4}. 4/323 Four letters picked without replacement from ioijxojxxxxxj. What is prob of picking 3 j and 1 i? 2/715 Two letters picked without replacement from vvmgxgke. Give prob of picking 2 v. 1/28 What is prob of picking 1 t and 2 r when three letters picked without replacement from {p: 4, t: 1, u: 3, r: 2}? 1/120 Two letters picked without replacement from afalfaf. Give prob of picking 2 f. 1/7 What is prob of picking 2 m when two letters picked without replacement from ffxxmfmff? 1/36 Three letters picked without replacement from wbwssisssbsssbssb. Give prob of picking 1 i and 2 s. 9/136 Two letters picked without replacement from jngjjjjsggggjj. Give prob of picking 2 j. 3/13 What is prob of picking 3 v when three letters picked without replacement from {s: 2, f: 1, v: 9, p: 8}? 7/95 Three letters picked without replacement from {w: 1, h: 2, v: 2, e: 2, k: 1}. What is prob of picking 2 h and 1 e? 1/28 Four letters picked without replacement from nnnnnxnnnnnnnxnnnnnn. Give prob of picking 2 n and 2 x. 3/95 Four letters picked without replacement from qjjjqjjjj. Give prob of picking 4 j. 5/18 Calculate prob of picking 2 r when two letters picked without replacement from {k: 9, r: 9}. 4/17 Three letters picked without replacement from nnnnhwwnnwwnh. What is prob of picking 2 n and 1 w? 42/143 What is prob of picking 1 s and 1 d when two letters picked without replacement from dsddddsdddd? 18/55 Two letters picked without replacement from {x: 7, t: 6}. What is prob of picking 2 t? 5/26 Four letters picked without replacement from {f: 4}. Give prob of picking 4 f. 1 Two letters picked without replacement from {p: 3, x: 1, h: 5, y: 5, a: 1}. What is prob of picking 1 y and 1 x? 1/21 What is prob of picking 3 x when three letters picked without replacement from {m: 4, x: 5, c: 3}? 1/22 What is prob of picking 1 b and 2 h when three letters picked without replacement from {b: 4, h: 2}? 1/5 Calculate prob of picking 1 r and 1 u when two letters picked without replacemen	{ "pile_set_name": "DM Mathematics" }
e. l(-11/6) Simplify (s/(s(-2/35)/s)s)/(s(((s*(-2/17)/s)/s)/s)/s)(ss(-1/3))(-6) assuming s is positive. s(1294/595) Simplify (a(-6)/(a7/a))/((a(-5)a)/a(a/a(-3))/a) assuming a is positive. a(-10) Simplify (s(-3/5)ss4)/((s/s(-4))/s2) assuming s is positive. s(7/5) Simplify (x28x)/((x*(-25)/x)/x)xx(-31)(x/x(-14/11))/x assuming x is positive. x(300/11) Simplify ((j/(j/(j*(-1/2)/j))(j/j(-3/10))/j)(-24))(-6) assuming j is positive. j(-864/5) Simplify k*(6/7)k*(-15/2)(k(-2/23))(10/19) assuming k is positive. k*(-40921/6118) Simplify ((jj*0j)(-2/53)/(j(-2/31)/(j*(-2/27)jjj)))(-3/10) assuming j is positive. j(-129311/147870) Simplify ((uuu(-22/5))/u(-5))/(u/(u*(-1/9)/uu)((uu(uu/u*(-8/9)u)/u)/u)/u) assuming u is positive. u(-7/5) Simplify (i/(i/(i/i9ii))i)/i(6/17)(i/(i(2/5)/i))(-16/5) assuming i is positive. i(-4451/425) Simplify (u23u)/(u(-9/5)u)(uu/u(-1/3))(-11) assuming u is positive. u(-13/15) Simplify ((c/(c/((c(-12/7)c)/c))c)39)(1/24) assuming c is positive. c*(-65/56) Simplify (xxxx/(((x/(xx(-2)x))/x)/x)(xx*(6/17)x)/x)/(xx(-2/9)x)(1/8) assuming x is positive. x(938/153) Simplify (x*(16/7)x18)(-33) assuming x is positive. x*(-4686/7) Simplify (rr*(-2/7)rrr*7/rrr(rr(r*(2/7)/r)/rr)16)(-44) assuming r is positive. r(-9636/7) Simplify ((m/(m/(m(-1/13)m)))/mm/(((m(m(-3)m)/mm)/m)/m)(mm/(mmm(-1/4))m)/((m(-7)/m)/m))(-27) assuming m is positive. m(-19899/52) Simplify (((z/z2)/zz/z3)/((zz/((z*(1/3)z)/z)zz)/z(-5)))(7/9) assuming z is positive. z(-266/27) Simplify (((y(-3)y)/y(2/5))(2/121))(1/16) assuming y is positive. y(-3/1210) Simplify (l/(l(2/17)/l))26/(l/(l/(l/(l8/l))))(-8) assuming l is positive. l(16/17) Simplify (x(2/7))(-11)(x/x*(-1/4)x)17 assuming x is positive. x(983/28) Simplify (g/((gg(-6))/g)g(3/4))/(g(-16)/g18) assuming g is positive. g(167/4) Simplify (jjj*6/jjjj/j*3j*(1/5)jj2)(-2/59) assuming j is positive. j(-102/295) Simplify (((((gg*0g)/g)/gg)/g)(1/21)g*(2/13)/gg/g(-2/9))(-5/2) assuming g is positive. g*(-110/117) Simplify (dd/d*(-8)d)/(d/(ddd/(d((d(-1/7)d)/d)/dd)d))(d12d)/d(d/((d(-2/9)/d)/d))/d assuming d is positive. d(1724/63) Simplify (f1/(fff(-2)f))/(f*(-18)f/(f*(1/3)f)) assuming f is positive. f(55/3) Simplify (c/c(-4/7)c4c*3c(-5))(-12/11) assuming c is positive. c(-300/77) Simplify o/o18o/(ooo(oo/(oo*(7/9)))/oo)o(15/7)oo(-3/10)o assuming o is positive. o(-9689/630) Simplify (f(-14))(-22)/(f(2/21)f/(f/(f/f(-14/3))f)) assuming f is positive. f*(6368/21) Simplify (b((b/(b*(-1/14)b))/b)/b)*38/((bb31)/b(-2/5)) assuming b is positive. b(-2369/35) Simplify (q/q(-3/7)q)/((q(6/7)/q)/q)(q(-3/11))(-50) assuming q is positive. q*(1325/77) Simplify ((vv(-12))/v7)/(v*(-5)v(-10)) assuming v is positive. v(-3) Simplify jjj*(19/5)j*25((jj/(j/(jj*(10/3)j)j)j)/j)/(jj(1/6)) assuming j is positive. j(1049/30) Simplify ((m(-29/3))(-1/5))(-2/25) assuming m is positive. m(-58/375) Simplify (((rrr(3/7)r)/(r/(((r/r*(2/13)rr)/rr)/r)))(-2))10 assuming r is positive. r*(-7780/91) Simplify (aaaaa(26/7))/(a33a)(a/(a/(a/(a/a19)))a)(-17) assuming a is positive. a(-2564/7) Simplify ((p/(pp(-18)))/p)(2/37)p(-39)/(p(-23)pp) assuming p is positive. p(-632/37) Simplify (u(-8)/u)*(-23)/((uu(-13)/u)/((u/u5)/u)) assuming u is positive. u*215 Simplify (z(z*(-1)/z)/zz)*(1/29)(z/z*(-2)z)(-29) assuming z is positive. z(-3365/29) Simplify (((y*(-2)/yy)(9/10))36)(15/8) assuming y is positive. y(-243/2) Simplify (p17/p)(1/61)/(p/(ppp(p(-17)p)/pppp)pp(4/7)) assuming p is positive. p(-5683/427) Simplify ((v(-2))(-4)(v/((v/(vv(-3/4)/v))/v))(-1/3))(25/3) assuming v is positive. v(2375/36) Simplify ((l(1/6)/l)/l)(-9/8)l*(5/6)(ll18ll)/l assuming l is positive. l(1099/48) Simplify ((uu*(-2)u)(2/25))(-1/71) assuming u is positive. 1 Simplify (((((j*3j)/j)/j)/j)/((j*(6/7)j)/j)j/(jjj(-4))j*7j)(-24/5) assuming j is positive. j(-1872/35) Simplify ((z*(-1/3)zz)/z)/z(-1)(zz(-4/3))(10/13) assuming z is positive. z(55/39) Simplify (oo/(oo4o))(-12)/(o(-7)oo(-7/6)) assuming o is positive. o(331/6) Simplify (sss*9ss4s)/(s/(((ss1)/s)/s))(40/7) assuming s is positive. s(79/7) Simplify (((ii*5ii)/(i(5/6)/i))/((i/(i/i(-3))i)/(i(-2/9)/i)))(-6/17) assuming i is positive. i*(-161/51) Simplify ((gg*(-11)/ggg)/g21)/(g(2/41)g(-2/5)) assuming g is positive. g(-6078/205) Simplify (o(-16))36o(1/45)o(4/7) assuming o is positive. o(-181253/315) Simplify (r*(2/13)rr9)/(r/r(-1/3)r(2/39)) assuming r is positive. r(114/13) Simplify (y/(y/(y(y(3/2)/y)/y))yyy/(y/(yy(-2/7)))yyy)/((y/(yy(-1/4)))/((y/(y(8/7)y))/y)) assuming y is positive. y(107/28) Simplify ((l(-1/5))*(-16/5)l/l*(-7)ll/l(4/5))(-15) assuming l is positive. l(-738/5) Simplify (nn(-7))(-20/7)/(n/(n/n(3/2)))(1/19) assuming n is positive. n(4539/266) Simplify ((c21/(cc(c20/c)/c))49)(-6/23) assuming c is positive. c(-294/23) Simplify ((c(2/5)/c)/c(-7))/(((cc(6/5)c)/c)/(c/(c/(c/c*(-1/3)))c)) assuming c is positive. c(98/15) Simplify ((g/g(-20/7))/(gg(-17/2)))/(g(6/5)g3) assuming g is positive. g(501/70) Simplify (((((g*(3/10)g)/g)/g)/g(-26))5)(-42) assuming g is positive. g(-5313) Simplify ((o(1/4))(-20/3)(o(-1)/ooo)/o2)(2/61) assuming o is positive. o(-22/183) Simplify (((d(-7)/d)/d)/ddd/((dd/((d*2d)/d)d)/ddd))/(dd/(d/(dd(-10))dd)dd(-1/8)d) assuming d is positive. d(-15/8) Simplify (h/h(-10)h(-12))/((hh/(hh(-15)))/(h3hh)) assuming h is positive. h(-12) Simplify (v/(v(1/3)/v))(45/7)(v*(-4/7)v)/(vv/((v/v2)/v)) assuming v is positive. v(50/7) Simplify (w1)(-4/19)/((w(w/w*(-2/61)w)/ww)/(w/(w(-14)w))) assuming w is positive. w*(12467/1159) Simplify zz*11zz(2/13)((zz(-14))/z)/(zz/(z*(-6)zz)) assuming z is positive. z(-89/13) Simplify (g/((gggg/(g/g14))/g))/g7(gg(-3))43 assuming g is positive. g*(-108) Simplify (ww/(w/(w/(w*(1/3)ww))))(-5)/(w(-3/4)wwww5) assuming w is positive. w(-67/12) Simplify (o/(ooo(o/(o/((o*(3/7)o)/o)))/o)o)/(o(-3/2)o)((oo/o*1o)/o)7 assuming o is positive. o(99/14) Simplify (((i(2/19))(1/7))(-21))(-33) assuming i is positive. i(198/19) Simplify ((a3/aaa3/a)(-49))(-7/13) assuming a is positive. a(1715/13) Simplify ((ii/i4ii)/i)(5/8)/((i(-1/7)ii)/i(-2/37)) assuming i is positive. i(-5255/2072) Simplify (xx/(xx(-2/19)))/(xx/(x/x*(-1/3)))x*(-10)xx/(x(-1/2)x) assuming x is positive. x*(-919/114) Simplify ((tt/t2)17(tt(2/11))/t(-4/7))(-28) assuming t is positive. t(-540/11) Simplify w/(w*(-7/4)/w)wwwww*25w(w(-12))(9/2) assuming w is positive. w(-81/4) Simplify ((j10)(2/13))(1/9) assuming j is positive. j(20/117) Simplify ((aa*9)/aa/(a/(a/(a*7a))))/((aa(2/3)a)/(aa(3/8))) assuming a is positive. a(17/24) Simplify (g(3/7))39g*(1/10)g/(g*4g) assuming g is positive. g(897/70) Simplify (((d/d(-2))2)18)(-4/5) assuming d is positive. d(-432/5) Simplify ((ww7)/ww/w*(1/7)w(-2/7)/(w/w(-4)))(2/3) assuming w is positive. w(12/7) Simplify k*7/(k/(k/(kk*(-1/9)k)))k8/(k/(k11k)k) assuming k is positive. k(208/9) Simplify (((h(3/13)h)/h)/(hh/(h/(hh*(-1/6)h))))/(hh18/hh(9/5)) assuming h is positive. h(-8737/390) Simplify ((uu(22/7))/(uu/(u/(((u*(-25)/u)/u)/u))u))/(u*(1/16)(u/((u*(1/13)uu)/u)u)/u) assuming u is positive. u(43909/1456) Simplify (((u/u(5/6))/u)/u6)/(u(-5/2)/(uu(-4/11))) assuming u is positive. u(-122/33) Simplify (((g(-1/4))0)35)*(-32) assuming g is positive. 1 Simplify (	{ "pile_set_name": "DM Mathematics" }
t one hundred thousand. -900000 Let d = -156 + 296. Let t = d - -105. Let x = t + -246.01. Round x to 1 decimal place. -1 Let r = 134 - -94. Let j = -227.99818 + r. What is j rounded to four dps? 0.0018 Let s = -72 - -117. Let q = -6 - s. What is q rounded to the nearest ten? -50 Let g(r) = r - 2. Let k be g(4). Suppose kt + 10 = 0, 4t = h + t - 6600015. Round h to the nearest one million. 7000000 Let f = 44878484 + -27178484. What is f rounded to the nearest 1000000? 18000000 Let k = -7779906 + 12274487. Let h = k - 4494584.0999896. Let b = h + 3.1. What is b rounded to 6 dps? 0.00001 Let o = -22.34 + 0.34. Let v = o - -21.953. What is v rounded to 2 dps? -0.05 Let m(b) = b*2 + 5b + 1. Let q be m(-7). Let s = 10 - q. Let k(f) = -16801f3 - 6f*2 - 5f. Let h be k(s). What is h rounded to the nearest 1000000? 2000000 Let q = -27684137 + 27684116.0000068. Let f = q + 21. What is f rounded to six dps? 0.000007 Let y = -0.5 - 4.5. Let f = -67072 + 67066.9931. Let c = y - f. What is c rounded to three dps? 0.007 Let c = 426.1 - 336.0926. Let d = c - 90. Round d to 3 dps. 0.007 Let s = -330.0199 - -330. What is s rounded to three decimal places? -0.02 Let o = -68 + 38. What is o rounded to the nearest 100? 0 Let w(i) = i - 10. Let b be w(13). Suppose 4398 + 3017 = -2f + bp, -5p + 11125 = -3f. Round f to the nearest 1000. -4000 Let t = 3.399981 - 3.4. What is t rounded to five dps? -0.00002 Let l = -3614.339999 - -3614.3. Let m = -0.36 - -0.32. Let o = l - m. What is o rounded to five decimal places? 0 Suppose -8f + 12f = 0. Suppose -y = -p + 2p + 29005, 5p + 25 = f. What is y rounded to the nearest ten thousand? -30000 Let b = -9955.31 - -9874. Let s = b + -0.69. Let m = 81.99911 + s. Round m to four dps. -0.0009 Let q = -23 + -3. Let y = 26.073 + q. Round y to two decimal places. 0.07 Let s(p) = -4p - 8. Let j(k) = -5k - 9. Let b(l) = 2j(l) - 3s(l). Let u be b(7). Round u to the nearest 100. 0 Let n(c) be the first derivative of -2100c3 - c2/2 - c - 19. Suppose -3 = 2l - 1. Let d be n(l). Round d to the nearest one thousand. -6000 Let f = 1 + 1. Let l be (-17)/(-2) - f/(-4). Let z be l((-21)/9 + 1). Round z to the nearest 10. -10 Suppose 2l - 50396 = -3q, 5q - 67204 = q + 2l. Suppose c - 3c - q = 0. Round c to the nearest 1000. -8000 Suppose -4h - 3r - 9434 = 2957, 0 = 4h - 2r + 12406. What is h rounded to the nearest one thousand? -3000 Suppose -7500020 = -3h - 4g, -4h + 12500020 = h + 4g. Let r be (3 + -2)/(2/h). Round r to the nearest 100000. 1300000 Let z = -185.92 - 4.08. Let c = -198.1 - z. Round c to the nearest integer. -8 Let p = -804.6 + 143.6. Let a = p + 461. Let m = a - -200.00000093. What is m rounded to seven decimal places? 0.0000009 Let a = 70127634 - 70127599.999979. Let u = -34 + a. What is u rounded to five dps? 0.00002 Let u = 0.5 + -31.5. Let y = 31.0000017 + u. Round y to 6 dps. 0.000002 Let r = -25.86 + 31.7. What is r rounded to 0 decimal places? 6 Let q = 1.2587 + -1.24. What is q rounded to 3 dps? 0.019 Let y = 3 - -9. Suppose -y = 3m, 4i + 3m = m - 372008. Round i to the nearest ten thousand. -90000 Let t = -0.031 + -0.279. Let x = 7646737 - 7646736.6900039. Let c = t + x. What is c rounded to six decimal places? -0.000004 Let v = 6103 - -1472. Suppose k + 3z - 3815 = -k, 4k - 5z = v. Round k to the nearest 1000. 2000 Let g be ((-2)/(-5))/(1/10). Suppose -5k - g = 2u, -7k + 2k - 5u = 10. Suppose y + 39000 = -ky. What is y rounded to the nearest 10000? -40000 Let o be 2240008/4 - (1 - -1). Round o to the nearest 100000. 600000 Let g be 7/((-98)/(-12))7. Suppose g = w - 2. Let f(b) = -131251b*2 + 7b + 8. Let d be f(w). Round d to the nearest 1000000. -8000000 Let u = -18.9999915 + 19. Round u to six decimal places. 0.000009 Let b = -88.0232 + 88. Round b to three dps. -0.023 Let m = 69.366 + -1.666. Round m to the nearest 10. 70 Let a = -13 - -12.93. Let c = -0.06999997 - a. Round c to 7 decimal places. 0 Let w = -28.003 + 0.003. Let d = w + 42. Let s = d - 13.62. What is s rounded to one decimal place? 0.4 Let u(p) = -133361p3 - 3p*2 + 12p + 10. Let b be u(-5). What is b rounded to the nearest 1000000? 17000000 Let a = 7427 + -7395.77. Let i = a + -31. Round i to one dp. 0.2 Let y = 4.472038 + 0.528022. Let c = 5.6 + -0.6. Let w = y - c. What is w rounded to 5 decimal places? 0.00006 Let f be -5 - -2 - -3 - -7. Let v = -4 + f. Suppose 3y = 4l - 7200, vl - 5966 = 2y - 1166. What is y rounded to the nearest one thousand? -2000 Suppose 2 = -b + r, 2r = 6r - 12. Let p be b/5 + (-2142)/35. Round p to the nearest ten. -60 Let h = -40 - 32. What is h rounded to the nearest ten? -70 Let v = -0.099 - -0.152. Round v to two dps. 0.05 Let p = 294 - 294.000000258. What is p rounded to 7 dps? -0.0000003 Suppose -2s = 2s - 2m - 17846, 4m = -5s + 22288. Round s to the nearest one thousand. 4000 Let f(y) = 108000y*2 - y + 5. Let l be f(5). What is l rounded to the nearest 1000000? 3000000 Let a = -14.2 - -14.19538. What is a rounded to 3 decimal places? -0.005 Let y = 5 - 8. Let o = 0 - y. Suppose -93 = -ot + 165. Round t to the nearest ten. 90 Suppose -8 = -o - 0. Let t = o - 3. Let r be (-4)/(-10) + (-4352)/t. What is r rounded to the nearest 100? -900 Let o = 10.5 + -32. What is o rounded to the nearest 10? -20 Let o(c) = 2944c + 8. Let b be o(-2). What is b rounded to the nearest one thousand? -6000 Let j = 10168 + -10166.9463. Let q = j - 10.9614. Let o = q + 9.9. What is o rounded to 3 dps? -0.008 Let j = 0.0106527 + -0.0107. What is j rounded to 5 decimal places? -0.00005 Let q = -7642 - -18642. Round q to the nearest one thousand. 11000 Let v = -13718044.88890652 - -14939981.8289065. Let i = -1221937 + v. Let l = i + 0.06. Round l to seven decimal places. 0 Let q = 17358158465.0890957 + -17371284443.0691. Let p = 13125979 + q. Let o = p + -1.02. Round o to 6 dps. -0.000004 Suppose 0 = 3t - 4y + 2440 + 1460, 2t - 3y + 2600 = 0. What is t rounded to the nearest one thousand? -1000 Let d = 0.24 - 0. Let p = -205.628 + 206. Let l = p - d. What is l rounded to two dps? 0.13 Let d = -33.4115 - -202.5245. Let l = d - 169. Round l to 2 dps. 0.11 Let u = -4.899393 - -4.9. Round u to four decimal places. 0.0006 Let i be 1215083 - (1 - 3 - -1). Let u = i - -854916. Suppose 5w = 2w + u. What is w rounded to the nearest 100000? 700000 Let v(b) be the second derivative of -31b4/6 - b3/3 + b*2 + 5b. Let d be v(-3). What is d rounded to the nearest 100? -600 Suppose -4d + 6z - 5z + 32 = 0, 0 = -2d + 3z + 16. Let q(i) = -95000i. Let y be q(d). Round y to the nearest one hundred thousand. -800000 Let m = 0.158 + -0.1578988. Round m to five decimal places. 0.0001 Suppose -3r = -z + 2z + 3389995, 3r = 3z - 3390015. What is r rounded to the nearest one hundred thousand? -1100000 Let h = -92.234 - -10.014. Let x = h - -51.8. Let v = -31 - x. Round v to one decimal place. -0.6 Let r = 50.4 + -50. Round r to 1 dp. 0.4 Let t = 311205 + 199698. Let l = 1560903 - t. Round l to the nearest 100000. 1100000 Let x(t) = -1933334t + 4. Let g be x(6). Round g to the nearest 1000000. -12000000 Suppose 0 = 2s + 2s. Suppose 4t + 4y + 4 = 0, -2t - y = 1 - 2. Suppose s = -2b - 2a + 133996, b - 200992 = -tb - 4a. Round b to the nearest 10000. 70000 Let f = 143 - 223. Let n = f - 93. Let k = 181.1 + n. What is k rounded to zero decimal places? 8 Let o = 592 - 152. Round o to the nearest 100. 400 Let q = 0.47701 - -54.39999. Let r = 55 - q. What is r rounded to 2 decimal places? 0.12 Let l = 128005 + -4868005. Round l to the nearest one hundred thousand. -4700000 Suppose -4n - 3v + 2 = 0, -n + 3 = -2v - 3. Suppose -nr + 1839998 = -4j, 5j - 421560 + 2721555 = 5r. What is j rounded to the nearest 100000? -500000 Let c = 5.5 + -7. Let q = -8.5 - c. Let b = -7.00000005 - q. Round b to seven dps. -0.0000001 Suppose -4g = -11 + 3. Suppose -35 = gk + 15. Let v = k + 55. What is v rounded to the nearest 10? 30 Let t be (-271 - -2)/(7/(-287)). Suppose t + 29971 = d. What is d rounded to the nearest ten thousand? 40000 Suppose 6u + 41 - 155 = 0. What is u rounded to the nearest ten? 20 Let h = 11 + -8. Suppose -3c - 1525 = -5f, -c - 2f = -hc - 1010. Roun	{ "pile_set_name": "DM Mathematics" }
((b(4/7)/b(-4))(2/15))(-40))(1/12) assuming b is positive. b(-128/63) Simplify ((r*6rr/(r/(r3rr)))/(r/((r(-1/6)/r)/rr)rr/r(-3)))/(r(1/6)/r(2/5))41 assuming r is positive. r*(72/5) Simplify (j/(((j/((jj*(-7))/j))/j)/j)jj/(j(-7)j))/(j(-1))(8/15)(jj(jj*(-5))/jj*(-2/9))/(j/(jjj(1/3)j))23 assuming j is positive. j(2429/45) Simplify ((t*(-18)/t)/((t/(ttt(-2/19)/t))/t)t*6/t(tt/((t(-4/7)/t)/t))/t)44 assuming t is positive. t(-55792/133) Simplify ((((l(-1))(-7/3))(-20))(-4/15))(-44) assuming l is positive. l(-4928/9) Simplify ((w(2/5))(-35)/(w(2/5)w*(-2)))/(((ww/(w*(-9)/w))/((ww/(ww6www))/ww))/(w(-1/3))(-1/14)) assuming w is positive. w(-6799/210) Simplify (m(-1/32)m*(7/3)m*(-1/21)/mm((mm*(8/9))/mm)/m)(3/2) assuming m is positive. m(6337/1344) Simplify (o*(4/5)oo(1/8)o)(-4/15)/(o(-7/3)/o9)(1/7) assuming o is positive. o(881/1050) Simplify (((s/((s(-4/21)s)/s)s(-5)/s)(6/19))(-15/7))(-1/16) assuming s is positive. s(-1515/7448) Simplify (j2/j(-2/3))/(j(1/12)jjj(-5)j)j(2/7)jjj*(2/3)jj/j3j(-4) assuming j is positive. j(71/28) Simplify ((t0)(1/3))*(-41)/((tt*(-1/13))/(ttt(2/7)))(-41) assuming t is positive. t(-5084/91) Simplify ((v6/v)(2/35)/((vv9)/v21))(16/5) assuming v is positive. v(1264/35) Simplify ((l(-2)/l)(-10))29/(((l(-3/8)ll)/(lll(ll1)/l))/(l(-2/7)l(-3/10))) assuming l is positive. l(244101/280) Simplify ((ll/((l*3l)/ll))1/(((l/(l4l)l)/ll)/ll(2/17)/l))(-9/2) assuming l is positive. l(-441/34) Simplify (((j/j(1/10))/((j/(jj(2/3)))/j))/(j/j(-3)j(-2)))/((j(-1)/j)/j(2/13))(-4/13) assuming j is positive. j(-487/5070) Simplify ((((q/(q/((q/q1)/q)))45)(15/7))24)(20/3) assuming q is positive. q(-108000/7) Simplify ((a4/a(1/2))/((a6/a)/a4))/((a/(aa*(-3))aaaaa*0/aa)/(a(1/3))(18/7)) assuming a is positive. a*(-51/14) Simplify (tt/(t/(tt/(t(2/7)/t)tt))ttt)(32/5)/((t(-1/5)t)/(tt*0t))(t(2/13)/(t(-2/5)/t))(23/2) assuming t is positive. t(13621/182) Simplify ((q1)(8/9))0/(((q/(q9/q)qq)/q)/(q(-1/2)/q))38 assuming q is positive. q171 Simplify (((d/d(1/4))/d)/d(2/9))(-37)((d/(dd/(d/d(2/7)d)))/d(-1/3))/(d(-4)/d(-4/5)) assuming d is positive. d(27367/1260) Simplify (((y(-1/26)/y)/y25)/((yy/(yy/y*(-2)y))/(y*1y)))36 assuming y is positive. y(-9846/13) Simplify ((y/y*0)/yy*(1/28)y*46y*46/yy)(-1/19) assuming y is positive. y(-2577/532) Simplify (((j*(-1/13)/jj)/(j8/j))/(j(-2/5))(-49))(-32) assuming j is positive. j*(55488/65) Simplify (jjjj*28jj)25j(-18)/j(-30/11) assuming j is positive. j(8907/11) Simplify ((o(2/7)o)13o*(-1/5)/(oo((o(-3/5)/o)/o)/ooo))/(((o(-2)/o)/o)/ooo(-3/5)o)11 assuming o is positive. o(390/7) Simplify (yy(yy(-24))/yyy(-41))/((y/(y(-2/3)y))/(y*43/yy)) assuming y is positive. y(-59/3) Simplify ((i(-7)/i(2/17))/(i/i(-19)iii(-30)i))(-21/4) assuming i is positive. i(21/34) Simplify ((n(-2/5)/n)(1/5)n/(n6/n)n/n*(1/3))/(((n/(nn*(2/5)n))/n)(-20)/((n(2/3)/n)/n)38) assuming n is positive. n(-2557/25) Simplify ((((sss/s*(1/5)s)/s)/ss)(5/3)s(11/4)/(s/s15))25 assuming s is positive. s(6425/12) Simplify (qq(5/4)qq4/q)/(q(4/3)qqq*(2/17))((qqq/(qq(-1/2)q)qq)(11/6))2 assuming q is positive. q*(1063/68) Simplify ((x(xx(-35))/x)36/(x(2/15)/xx(-37)))10 assuming x is positive. x(-35584/3) Simplify (d/d(-30)d10/d(d*(-21)/d)/((dd/d(-7/3))/d))(-5/3) assuming d is positive. d(-220/9) Simplify ((z/z(5/3)z)/zz/((z/(z/z(2/9)))/z))(-48)(z/z(-1/3))(1/51)(((z*(-6)z)/z)/z)/(zz(-3/8)z) assuming z is positive. z*(-75805/1224) Simplify (((iiiii(-1)i)/i)*43/(((ii*(-5/3)i)/i)/(i/(i/(ii(-1/5))))))/((i/i(-1/4))(-27))(-40) assuming i is positive. i(-18293/15) Simplify ((c/(((c/c(-1))/c)/c))18)(3/14)(c/(c/c(1/2)))(3/26)c/((cc*(-7)c)/c)c/c(2/3) assuming c is positive. c(12283/1092) Simplify k(2/5)/k2(k/k(-1))(-20)((k/k(-8/7))/(kkk/(kkkk*(2/7)k)))(-4/5) assuming k is positive. k(-1552/35) Simplify (g/g*(-40)((gg(-1)/g)/g)/g)/(((g(-7/3)g)/g)/gg/g(-1/14)g) assuming g is positive. g*(1649/42) Simplify ((yy(-2/9)/y)/y(-3))*(-3)(y/(y*(2/7)y))(1/3)/((y(-3)/y)/(y/(yy(1/5)))) assuming y is positive. y(-162/35) Simplify ((m(1/6))(8/11))(-1/17)/(m/m(-1/3)m/(m/m*4mm)m((mmm(2/3)m)/m)(-34)) assuming m is positive. m(16143/187) Simplify (z(-1/5))(1/26)/((z/z*6)/(zz*(2/7)))((zz(1/4)/z)/(z(4/5)z))/(z*5/((z/((zz/(z/z(-3/8)))/z))/z)) assuming z is positive. z(75/728) Simplify ((bb(-10))/bb*(1/36)b(-2/23)/(b/b(-8)))(-7) assuming b is positive. b(110467/828) Simplify ((a(-1)/a)(-32)/(a*2a)(-40))/(a(-4)/((aaa/(a*(-8)aa))/a)a*(-2/23)aa(-8/5)/a) assuming a is positive. a(22734/115) Simplify (((f(-3)/((fffffff(fff*1)/ff)/f))/(ff/f(-2/11)f*3/ff))(32/9))(10/17) assuming f is positive. f*(-6720/187) Simplify (hhh(2/7)/hhh(-4))/((h(h/h*(-2/11))/hh)/(h*(-4)h))(h/h0)(-8/3)h*(2/3)h2 assuming h is positive. h(-531/77) Simplify (w/w*(-2/9)w(-1))/((w1/w)/ww(-2/17)/ww)(w(-1/3)/w)(-10)/(w(-3)/(((w(1/2)w)/w)/w)) assuming w is positive. w(5255/306) Simplify ((t/((t(-2)t)/t)tt/(t/(tt(-5/2))))/(t1)20)/(t(-1)t(-1/6))(-34) assuming t is positive. t(-343/6) Simplify (l/(llll/(ll/(l(17/5)l))))/(l/(l*(-4/11)/l))(l/(l/(l/(lll*(-17))l)l))/l20 assuming l is positive. l(-647/55) Simplify (((oo*(4/3)o)/o)/(o/(oo/(oo(1/8)))))(-32)/(o*(2/23)o/o*(-2/5)oo/o(-1)o(-1)) assuming o is positive. o(-25583/345) Simplify (gg/((gg(ggg/g(-1/4)gg)/ggg)/g))/g(-2/3)(gg1)(-2)((g0)(-2/25))(-34) assuming g is positive. g(-103/12) Simplify ((g/((g*(-3/7)g)/g))(-2/19))35g(-7/4)(g*(-7)/g)/gg(-1)/g(2/7) assuming g is positive. g(-9203/532) Simplify ((x(-2/5))(-2/3))(-1)(x(-1)xx(-6)/x)/(x(-1/2)/x)(10/13) assuming x is positive. x(-1192/195) Simplify (((p31/p)/p)(-2/69)/(p/p43p*(2/19)p))(-6/7) assuming p is positive. p(-105022/3059) Simplify (f(1/10)/f(-6))/((f/(f*(1/5)f))/(f/((f(ffff*(-1/7))/fff)/f)))(f(1/3))8/((ff(-2/3))/ff(-2/17)) assuming f is positive. f(24611/3570) Simplify (((u*(2/9)u)/((uuu/u*(5/6)uu)/uu)(u/u1)/(u/u0))18)(-17) assuming u is positive. u1207 Simplify (aa*3a*(-2/15)a(aaaa*(-1/3)a)(-1/3))/(((a/a(2/21))/a)/aa5(a/(a/(aa(2/7)a)a)a)14) assuming a is positive. a(-10162/315) Simplify (c/(c*0/cc)c(-4)c)(-19)/(c(-2/13)c(-1)/cc)(-39) assuming c is positive. c(-7) Simplify (((n(n(-8/5)/nn)/nn)/nnn(-1/2))(-26))(-2/19) assuming n is positive. n(-286/95) Simplify ((a/(a(a(a/a(1/4))/a)/aaa))/(a/a(3/11)))(-1/42)/(a(-2/23)a/a7)(20/9) assuming a is positive. a(1732321/127512) Simplify ((j(-2/7))*(5/9)j/(j/(j/(j/(jj5))))j11)47 assuming j is positive. j(49867/63) Simplify ((f/(f/(f/(f1/f))))(-8/13))(-10/9)/((f(3/7))(2/3))(-7) assuming f is positive. f(314/117) Simplify ((l*(-5)llll15l)/((l/(l(ll*18/l)/l))/(l/(lll(3/7)l))))4 assuming l is positive. l(800/7) Simplify ((h*(-1)h)20/(h(-4)/hhh/(h*3h)))/((h(2/7))(30/7))34 assuming h is positive. h(-1697/49) Simplify ((b(-3/7)/b(-6))/(((b/((b/(b/(b/(b/b*(-1))b)))/b)b)/bb)/(b*3/b)))/((bb(2/7))29)2 assuming b is positive. b(-70) Simplify (hh(-1/3)h)*(-11)(h/(hhhh5/h)h)/(h/(h*7h))(h/h(2/5))(-4)/((h(-7)h)/hh/h(-5/6)) assuming h is positive. h(-407/30) Simplify (l/((l/(ll*1))/l)l6)18/((l/(l*(-1/4)/ll))/l*4ll(l*(-4)/l)/lll/(l(-1/3)/l)l) assuming l is positive. l(1973/12) Simplify (((m(-3/5)/m*(-1/6))/(mm1)(-1/	{ "pile_set_name": "DM Mathematics" }
t n be o(-4). Suppose 0 = -4v - 5k - 12, v - 4v + nk = -14. Solve 2t + v = -5q - t, lq - t + 5 = 0 for q. -1 Suppose 0 = -6o + 4o - 4j + 14, -2j + 22 = 4o. Solve a + 3f - 3 = -2a, -4a + 9 = of for a. -4 Let z be (-32)/(-8) + (-1 - 1). Suppose 0 = n - zn. Solve 3a = -5c + 15, n = -3a + 5c - 4 - 11 for a. 0 Let u be (8/32)/((-1)/(-20)). Solve -3f - 23 = -uv - 5, 5v - 5f - 20 = 0 for v. 3 Let w(x) = -3x. Let j be w(-1). Solve 0 = jp - 0c - c + 7, 3p + 2c + 4 = 0 for p. -2 Suppose 5y = 5x - 16 + 6, 2x - 3 = 3y. Solve xg = 3b + 9, -b = 4g - 3g + 7 for g. -2 Let b(m) = -m*2 + 5m + 38. Let h be b(9). Solve -g + 1 = 5j, -j + 0g + 9 = -hg for j. 1 Let f(c) = c2 - 10c - 11. Suppose 8k - 12k + 44 = 0. Let h be f(k). Solve d + 2t + 3 = 0, ht - 3 = -d + 4t for d. -1 Suppose a - 10 = -5. Suppose -1 = 2q - 11, 0 = -g - q + a. Suppose h = -gh + 3. Solve 0 = 5t, -4t + h + 3 = 3i for i. 2 Let x be (-54)/36(-8)/6. Solve -2b + xw - 4 = 0, 0b + 2w = -b - 11 for b. -5 Suppose 0v - g + 15 = 3v, 0 = 3v - 2g - 6. Suppose -2 = vl - 22. Let n(p) = -p*2 - p + 3. Let a be n(0). Solve aq = 4q - u + 5, 3q - lu = -21 for q. -2 Let g = -23 + 26. Solve 7 = -4a + j, -2 - 6 = -a - gj for a. -1 Let a(t) = t + 8. Let l be a(-7). Let r be (-2 + l - 1) + 5. Solve 0 = 4z - 5k + 10, -z - 6 = -5z - rk for z. 0 Suppose -41 = -5r + 64. Let l be (-1)/5 + r/5. Suppose m = -0m + l. Solve -p - 4p - 16 = -3c, 0 = mc + p - 6 for c. 2 Let g be (-7)/((-6)/94/8). Solve -12 = -3j + 3q, -3j = -2j + 4q + g for j. -1 Let p(d) = d*3 - 4d*2 - 3d - 5. Let i be p(5). Suppose 0 = -4g - 3 - 1. Let q be 6 - (-1 - (-2 + g)). Solve b = w, 0 = w + ib - qb - 6 for w. 3 Suppose 11b - 6 = 9b. Solve -3m + bv = -15 + 3, -2m + 11 = v for m. 5 Let j(u) = -u*2 - 5u - 2. Let g be j(-2). Solve -s = -3m - 3s + 23, 16 = gs for m. 5 Let f = -5 - -11. Solve 2m = l - 2 - f, 0 = -2l + 3m + 13 for l. 2 Let p = -4 + 9. Solve pb = -g + 2g - 24, 5b + 4g + 4 = 0 for b. -4 Let s = 3 + -9. Let k be 13/2 - (-3)/s. Let z be (-16)/(-6) - (-2)/k. Solve 5b = -zc, 0b + 17 = -4b + c for b. -3 Suppose -3l + 3y - 4y + 9 = 0, 5y = -3l + 9. Solve -c = -2q - 6, -lq + q = 10 for c. -4 Suppose w + 1 = -2y - 0, 4y - 7 = -5w. Solve -2g - wg = 4q + 14, -5 = 5q for g. -2 Suppose 28 = 31n - 17n. Solve 0 = -4t - 2l + 18, nl = -3t + t + 8 for t. 5 Let f = -1 + 4. Suppose 0 = fq - 5q + 10. Solve 0 = g - qt + 15, -2t = -4g + t + 8 for g. 5 Suppose 14 = -5p + 24. Solve -4y + s - 12 = -0, -py + 12 = 4s for y. -2 Let a(t) = -9 - 3 - t2 + 7t + 3t. Suppose 2q = q + 8. Let f be a(q). Solve 5r + w = 22, 7 = fr - 5w - 28 for r. 5 Suppose -2f + 0f + 15 = -z, 4z - 12 = 0. Solve -3y - 2i + f = -0i, 5y + 2i - 15 = 0 for y. 3 Let k(t) = -t3 - 6t*2 - 3t + 6. Let d be k(-5). Let a = 1 - d. Solve 4w - 2w + 8 = 0, aw = 5u + 5 for u. -5 Let r(v) = -v*2 + 4v + 9. Let n be r(5). Solve 2q = n, 0q = -5d + q + 13 for d. 3 Let k be (-1)/(-2)-6 + -1. Let r = k + 24. Solve 4z - 3z = -3p + r, z = 2p - 5 for z. 5 Let j = -12 + 12. Let w be 2 + 3/12j. Solve -2f + 0f = 2v, -3v - 15 = -wf for f. 3 Let x(w) = 7w + 4 + 0 - 8w + 3. Let s be x(4). Solve j + 20 = i - 4j, sj + 4 = -i for i. 5 Let y(o) = -o + 12. Let h be y(6). Solve -hx - 3z - 11 = -x, 5 = -5x - 5z for x. -4 Let j be (-2 - -2) + (2/2 - -3). Solve 0 = 5t - jm - 30, -3t = -0t + 3m + 9 for t. 2 Suppose 2l = -2k, -7k + 3k - l + 6 = 0. Let b be 5 + (-2 - -2 - 1). Solve -k = -s + 2p, bs + s = -p - 12 for s. -2 Let q(w) = w2 + 4w. Let h be q(-4). Solve -2d - t + 2 = 0, 5d - d + 5t + 8 = h for d. 3 Let m(i) = i2 - 9i + 11. Let f be m(8). Solve -3v = fo - 21, o = -4v + 5v - 3 for o. 2 Let t(v) = v3 + v2 - 2v. Suppose 5m - 3m + z = -3, -1 = -2m - 5z. Let o be t(m). Solve o = 5i - 15, 2f - i = 2i - 13 for f. -2 Let l(m) = -2 - 4 + 3m - 4 + 9m2 + m3. Suppose -2b + 22 = -2g, 5b + 2 = 3g + 41. Let k be l(g). Solve -k = -2z - 4v, 40 = -2z + 7z + 3v for z. 5 Let q be (6 + -11)3/(-5). Let d = q + 18. Solve 5b + 16 = 3f, -3b - d = -f + 3f for f. -3 Suppose 3o - 19 = -4. Solve 5a = -og, 0a - 3g = 5a - 8 for a. 4 Let a(x) = x*2 - 3x. Let i be a(-4). Suppose 0 = -5m - 3 + i. Solve 5y - 45 = -5n, -my = -0y - n - 15 for y. 4 Let s = 7 + -2. Suppose sx - 16 = 4. Solve -w - i = 4i - 15, xi = -3w + 1 for w. -5 Let f = 1 + 1. Suppose -y = fy. Solve y = 2g - a - 4a, -3a - 1 = -g for g. -5 Let w(c) = c3 + 8c*2 - 10c + 20. Let f be w(-9). Let g(t) = t - 1. Let i be g(1). Solve 6l = -4u + 2l + 28, i = 2u + 5l - f for u. 2 Let h be (-1)/3(-7 + -8). Suppose 4t - 10 = hg + 12, 5g - 10 = 0. Solve 4s - t = -0o - 2o, 2o - 4s + 8 = 0 for o. 0 Suppose 3j - x + 0x - 3 = 0, x = 0. Solve -5n + 26 + j = -3l, -n + 3l = -15 for n. 3 Let q = 5 + 2. Let h = -7 - -10. Solve 6 = -3v, p + hv = 2v - q for p. -5 Let h(o) = o*2 + 5o - 4. Let u be h(-6). Let r be ((-6)/(-15))/(u/10). Solve 3b + r = 6b - z, 4b + 12 = 5z for b. 2 Let z(q) = q*2 - 5q - 6. Let v be z(7). Solve -v = -3h + n - 3, -2h + 22 = 4n for h. 3 Suppose -3d - 6 = -3m, -2d + 4m - 29 = -5d. Let l = 6 - 5. Let q be (-1)/(-1) - (-2 - 1). Solve 0 = qh + dx + x - 4, 3h = -2x - l for h. -3 Let i be (-1 + (-8)/(-3))-3. Let y be i/(-10)41. Suppose 15 = -v + 6v. Solve 0 = -3x + vt - 9, -2x + t - 9 = -yt for x. 0 Let w(y) be the third derivative of y4/24 + y3/2 - 9y2. Let q be w(-1). Solve 8 = -k + 4x, 4k - qx + 13 = -5 for k. -4 Let c = 8 - 11. Let x be c - -1 - (13 + -17). Solve -3i + g + 4g = -11, -5g = xi + 26 for i. -3 Let b = -31 + 43. Let o be (-120)/(-45)b/2. Solve -q + 1 = 2l - 6, o = l + 3q for l. 1 Let d be (1-5)/(-4 + 3). Solve -5g - df - 20 = 0, 18 - 2 = -g - 5f for g. -1 Let x be -11(6/(-3))/2. Suppose -4o - 4j = -4, 3o = o + 2j - 6. Let n be (-1)/((o/2)/1). Solve 3 = -2v - 5, 0 = 3q + nv + x for q. -1 Let m(j) = -j2 - 11j - 3. Let z be 31 - (-26)/(-2). Let i be m(z). Solve -5y + 14 = -2f, 4y = if - 2f + 18 for y. 2 Let b(h) = h*3 + 11h*2 - 14h - 17. Let w be b(-12). Solve 15 = 5s, 4s = m - 0m + w for m. 5 Let y = 5 - 1. Suppose -yn = -3n - 2. Solve -v = 4w + 3v - 12, nw = -3v + 8 for w. 1 Suppose -2l + 4l + 4 = 3g, 4l = 2g. Suppose gp - 4p + 10 = 0. Solve 0 = -b + pk + 1, k = -2b - 12 + 3 for b. -4 Let s(j) = -j*2 + 8j + 3. Let i be s(4). Suppose 3n - 4d = 16, -2d - 4 = 2d. Solve -nz - 30 = -2q, -z - i = -3q + 1 for z. -5 Suppose 4t - 63 = t. Solve -4v + 18 = -n, -4v = v - 2n - t for v. 5 Let z(d) = 2d*2 + 5d - 8. Let j be z(3). Solve -r = -4g - j, 4r + 0 - 5 = -3g for g. -5 Let i be (5 - 2)(-21)/(-9). Solve 0 = -4g - s - 7, -2 = 3g + is - 3s for g. -2 Suppose 0 = -5m + 3m + 8. Solve -z + 3 = 3w + 2z, -w - 11 = mz for w. 5 Suppose 32 = 4o + 12, 2f - 2o - 6 = 0. Let k be (41/4)/(2/8). Solve -2m - 3m + k = 4c, 3c = 4m - f for c. 4 Suppose -12b + 7b + 50 = 0. Let z be (6/15)/(1/b). Solve 0 = zy + 2g - 10, -y = -4g + g - 13 for y. 4 Let k = -4 + 8. Suppose -kq = -9q + 35. Let g = 206 + -206. Solve gz = 3l - 2z - q, l - 4z + 11 = 0 for l. 5 Let d(l) = -l*2 + 4l - 3. Let a be d(2). Suppose -s + 9 + a = 0. Solve -2p - 12 = -4w, 3p - 3w - 4 = -s for p. 2 Suppose -14k = -404 - 72. Solve -3x - 2x - k = 3m, 5 = -x for m. -3 Let q(p) = 2p + 8. Let v be q(-6). Let g(d) = -d2 - 3d + 4. Let c be g(v). Let l = -16 + 17. Solve -f - 14 = 5x + l, c = 3x + 5f - 13 for x. -4 Suppose -3a + 85 = -4f, 0 = 5a + f - 51 - 83. Solve -3l = 2g - 7g - 30, -a = 4g - 3l for g. -3 Suppose 3d + 5n = 24, 0n = 2d + 5n - 21. Suppose -2s = ds - 20. Solve 2y - 4 = 2u, 5u + 2 + s = 4y for y. 4 Suppose -2c + 18 = 4u, -4c - 4u - 1 = -25. Suppose c + 8 = d. Suppose -d = -b - 0. Solve 5t - 27 = -3z, -4z + b = t - 8 for t. 3 Suppose 2j + 5 - 11 = 0. Solve -2c - 14 = -2s, -s + 10 = -4c - j for s. 5 Suppose -2v + 15 - 3 = 0. Suppose 4d = -14 - v, 0 = 3o + 3d - 3. Solve z = -3, -2a + 2z = -oa + 14 for a. 5 Let i = -5 - -7. Suppose -5z - in = -9, -2n + n = -2z. Solve	{ "pile_set_name": "DM Mathematics" }
3 Collect the terms in -1379b + 845b + 538b. 4b Collect the terms in -11787r3 - 11769r*3 - 11762r*3 + 35320r*3. 2r*3 Collect the terms in -8 - 27188t + 54372t - 27185t. -t - 8 Collect the terms in -6326i2 + 96i - 96i. -6326i*2 Collect the terms in -8433n*2 + 9 - 10 + 7n*3 + 9n*3. 16n*3 - 8433n*2 - 1 Collect the terms in -177h*3 + 75h*3 + 85h*3. -17h*3 Collect the terms in 31d2 + d2 - 9d + 7d - 16. 32d2 - 2d - 16 Collect the terms in 0 + 0 - 20301n + 20421n. 120n Collect the terms in 149u + 189u + 7 - 7. 338u Collect the terms in 39015 - 78026 + 5t + 39011. 5t Collect the terms in -91 + 16h + 0h*2 - 9h - 4h2. -4h*2 + 7h - 91 Collect the terms in 62t3 + 23520661 - 23520661. 62t*3 Collect the terms in -45x + 29x + 23x - 6x + 26x*2. 26x*2 + x Collect the terms in 746f - 2250f + 737f + 764f - 5. -3f - 5 Collect the terms in 6g2 - 5g2 - g2 - 17406g3. -17406g*3 Collect the terms in -22g*3 - 21g*3 + 34g*3 + 345g*2 + 2. -9g*3 + 345g*2 + 2 Collect the terms in 492z*2 - 301z*2 - 248z*2. -57z*2 Collect the terms in 43 - 127x - 127x + 384x - 127x. 3x + 43 Collect the terms in -307015a + 153512a + 153507a. 4a Collect the terms in 216752 + 297d2 - 216752. 297d*2 Collect the terms in 1 + 1 + 3 + 982m*2. 982m*2 + 5 Collect the terms in 3 + 4t*2 + 6t*2 - 6t*2 - 6t + 11t2. 15t*2 - 6t + 3 Collect the terms in -3772 + 38q3 + 1893 + 1879. 38q*3 Collect the terms in -361 + 0p*2 - 2p*2 + 710 - 349. -2p*2 Collect the terms in 49o*2 + 138o*2 - 102o - 164o + 266o. 187o2 Collect the terms in 3 - 5242f - 3 + 6728f. 1486f Collect the terms in 93094p2 - 1 - 9169p*2 + 1. 83925p*2 Collect the terms in 43572z - 43572z - 4z*3. -4z*3 Collect the terms in -844n*2 + 82 - 82 + 844n*2 - 17n*3. -17n*3 Collect the terms in -34f*2 + 686f*3 + 697f*3 + 22f*2 - 1386f*3. -3f*3 - 12f*2 Collect the terms in 42r*2 + 16r*2 - 102r*2 + 18r*2 + 21r*2. -5r*2 Collect the terms in 29551w + 0 - 14773w + 0 - 14776w. 2w Collect the terms in 4485w*2 + 4498w*2 - 8956w*2. 27w*2 Collect the terms in 7 - 12 + 7 - 2 - 816a*2. -816a*2 Collect the terms in 1875 - 53w*2 - 2w*2 - 3753 + 1880. -55w*2 + 2 Collect the terms in -18r*2 + 17r*2 - 506r - 38r. -r2 - 544r Collect the terms in 4o + 238 - 131 + 221 - 2o. 2o + 328 Collect the terms in 22 + 90 - 3 + 148t. 148t + 109 Collect the terms in -2173r - 20r3 - 2598r + 5r3 + 17r*3. 2r*3 - 4771r Collect the terms in 144 - 36 - 16f - 37 - 36 - 37. -16f - 2 Collect the terms in -1750 - 1752 + 4c2 + 3502. 4c*2 Collect the terms in -55j + 37j2 + 665j*2 + 53j. 702j2 - 2j Collect the terms in -2254h + 2254h - 941h2 + 904h*2. -37h*2 Collect the terms in 810z*3 + 2z - 452z3 - 397z*3. -39z*3 + 2z Collect the terms in 77t - 36t - 43t - 29t*2 + 0t*2. -29t*2 - 2t Collect the terms in 52l + 57 - 30l - 20l. 2l + 57 Collect the terms in 3695o2 - 7387o*2 - 3o*3 - 6o*3 + 3692o*2 - 34o. -9o3 - 34o Collect the terms in -724x2 - 11x*3 - 10x*3 + 724x*2 + 22x3. x3 Collect the terms in 6216d2 + 4677d*2 + 2d - 2d. 10893d*2 Collect the terms in -31f*2 + 2f - 2f + 23f*2 - 4f*2. -12f*2 Collect the terms in -52 + 97 - 45 + 358q + 407q. 765q Collect the terms in p + 4p3 + 3p + 15p3. 19p*3 + 4p Collect the terms in 300w - 49641979 + 49641979. 300w Collect the terms in -75j2 + 2j - 37 - 1049j2 + 37. -1124j*2 + 2j Collect the terms in 5351 - 5351 - 18w2. -18w*2 Collect the terms in -18q + 12q - 5q - 5q + 7. -16q + 7 Collect the terms in -2w2 + 3465 + 3436 - 6835. -2w*2 + 66 Collect the terms in -1954b*3 + 6b + 0b - 2b + 1962b3. 8b*3 + 4b Collect the terms in -131r3 - 1665r*3 - 1672r*3 + 1046r*3. -2422r3 Collect the terms in -v2 + 35v3 + v2 - 3v + 83v3. 118v*3 - 3v Collect the terms in 166 + 4t - 6t - 165 + 3t + t. 2t + 1 Collect the terms in -50189j2 + 50188j2 + 25 + 3 - 3. -j2 + 25 Collect the terms in 108606g2 - 36196g*2 - 36196g*2 - 36211g*2. 3g*2 Collect the terms in 2g*2 + 9076g - 9085g - 9g*2. -7g*2 - 9g Collect the terms in -2687050v - 2v*2 + 2687050v. -2v2 Collect the terms in -2238a - 2208a + 4443a. -3a Collect the terms in -22455952y + 3 + 22455954y - 3. 2y Collect the terms in -4 - 7892l3 + 14 + 7890l*3 - 10. -2l*3 Collect the terms in 252w*2 - 84w + 1 + 84w. 252w*2 + 1 Collect the terms in 196 + 190 + 51j*2 + 199 - 585. 51j*2 Collect the terms in 89600v + 3 - 3. 89600v Collect the terms in -26767a*2 - 28006a*2 + 16490a*2. -38283a*2 Collect the terms in 26 + 10 + 444x*2 + 0x - 3x - 36. 444x*2 - 3x Collect the terms in 122688468 + 200f + 5f*2 - 122688468 - 200f. 5f2 Collect the terms in -4 - 54417p + 4 - 5p2 + 54417p. -5p2 Collect the terms in 423j*3 + 80j*3 + 6 - 462j*3. 41j*3 + 6 Collect the terms in 61f - 539f + 1165f + 1314f. 2001f Collect the terms in -688s - 1065 + 1383s - 698s + 1057. -3s - 8 Collect the terms in -852i3 + 407i*3 + 392i*3 + 6 + 3 - 12. -53i*3 - 3 Collect the terms in -2 - 32f - 19f - 152f. -203f - 2 Collect the terms in -3 - 2 + 4 + 69d*3 + 1. 69d*3 Collect the terms in -50n*2 + 128n*2 - 43n*2 - 46n*2. -11n*2 Collect the terms in 2819x*3 - 4x + 2887x3 - 5613x*3 + 4x. 93x3 Collect the terms in -65 - 57 + 29 - 4c*2 + 49 + 44. -4c*2 Collect the terms in -149690 - 6u + 149690. -6u Collect the terms in -172109 + 49z*2 + 172109. 49z*2 Collect the terms in 18l*2 + 12l*2 - 81l*2 - 51l*2 - 34l*2. -136l2 Collect the terms in i2 - 176674499 + 176674499. i*2 Collect the terms in -125h*3 - 18h*3 + 76h*3 + 60h*3. -7h*3 Collect the terms in -56x - 22x + 171x*2 - 167x*2. 4x*2 - 78x Collect the terms in -15o3 - 865 - 29o*2 + 18o*3 + 29o*2 + 848. 3o*3 - 17 Collect the terms in -4 - 24r + 0r + 7r + 4r + 9r. -4r - 4 Collect the terms in 25n + 22n - 46 + 46 + 22n - 62n. 7n Collect the terms in -k*2 - 301583k3 + k2 + 603169k3 - 301580k*3. 6k*3 Collect the terms in 6f + 10 + 16 - 5f - 8f*2. -8f*2 + f + 26 Collect the terms in -13t - 13t + 5t + 9t + 8t. -4t Collect the terms in 23p - 209 - 35p + 13p. p - 209 Collect the terms in -12 + 6 - 42r3 + 51r*3 + 6. 9r*3 Collect the terms in -4964u*2 + 9432u*2 - 4729u*2. -261u*2 Collect the terms in 233v*2 - 851v + 851v. 233v*2 Collect the terms in 2 - 2 - 16g + g - 10g. -25g Collect the terms in -1088b3 - 540b*3 - 220b*3. -1848b*3 Collect the terms in 572a - 295a + 468a. 745a Collect the terms in 3g*2 - 2g*2 + 11g*2. 12g*2 Collect the terms in 4r2 + 405 + 99 - r2. 3r2 + 504 Collect the terms in 61l*2 - 5l*3 + 98l*2 - 2l*3 - 79l*2 - 81l*2. -7l3 - l2 Collect the terms in -938575s2 + 5s*3 + 938575s*2 - 7s*3 - 15. -2s*3 - 15 Collect the terms in -3 - 5m*2 - 2 + 1013m + 1004m - 2017m. -5m2 - 5 Collect the terms in 15401r*3 - 30786r*3 + 15387r*3. 2r*3 Collect the terms in 2 + 280755v - 2. 280755v Collect the terms in -7m*2 + 56m - 4m2 + 14m*2. 3m*2 + 56m Collect the terms in 31w2 - 95w*2 + 28w*2 + 33w*2 + 25w*2. 22w*2 Collect the terms in -14m - 4158 + 4158 - 17m - 17m - 12m. -60m Collect the terms in 10g - 7073g*3 - 10g. -7073g3 Collect the terms in -153185j*2 - 1 + 153192j*2 + 1. 7j*2 Collect the terms in -208 + 208 - 10y*2. -10y*2 Collect the terms in -103229o*3 + 51614o*3 + 51631o*3. 16o*3 Collect the terms in -186o + 159o3 + 186o - 518o3. -359o*3 Collect the terms in 70f - 3 - 42f - 38f + 8f. -2f - 3 Collect the terms in -21p + 2p + 4p - 6p + 10p. -11p Collect the terms in 26k2 + 7650k*3 + 3k*2 - 7632k*3. 18k*3 + 29k*2 Collect the terms in -50h*3 + 5 + 177h*3 - 5. 127h*3 Collect the terms in 10i - 8i - 2i + 111i3 - 105i*3. 6i*3 Collect the terms in 406v**2 - 67	{ "pile_set_name": "DM Mathematics" }
e dps. -0.00023 Let w be 2 + -3 + -1997 - 2. Round w to the nearest ten thousand. 0 Let c = -207.3 - 6.7. Let m = 213.794 + c. What is m rounded to two dps? -0.21 Let n = 6 - 2. Suppose 5b + 20 = -p, 0 = np + 2b - b - 15. Suppose -4q + 28000008 = -ph, 16800008 = -3h + 3q + q. Round h to the nearest one million. -6000000 Let s = -475454562.6000111 - -475454774.6. Let w = s + -212. Round w to six decimal places. -0.000011 Let g = 5.91 - 1.21. What is g rounded to zero decimal places? 5 Let k = 15 + -15.0003. What is k rounded to two decimal places? 0 Let q(v) be the second derivative of -v5/20 - v4/4 + 5v3/3 - v2 + 2v. Let z be q(-7). What is z rounded to the nearest ten? 120 Suppose 24 = 4f - 2d, 5f + d - 17 = -3d. Suppose -fh = 5133775 - 1483775. What is h rounded to the nearest 100000? -700000 Let w = -0.28 - -0.3396. Let f = w - 0.06. What is f rounded to four decimal places? -0.0004 Let x = -1.45 + 0.05. Let a = -21.2 - -14.3. Let r = a - x. Round r to 0 dps. -6 Let w = 8 - 6. Suppose y + 4o = 708, -2889 = -4y + wo + o. Suppose -l - y = 2l. What is l rounded to the nearest 100? -200 Let k = -0.044 - 0.636. What is k rounded to 0 decimal places? -1 Let i(g) = -g*3 + 3g*2 + 5g - 5. Let m be i(4). Let z be (3/6)/(m/(-2)). Let s be -15(z - (-4569)/(-9)). What is s rounded to the nearest 1000? 8000 Let j = 77 - 45. Let l = j + -6. Let q = l - 26.000021. Round q to 5 decimal places. -0.00002 Suppose -3l + 355 - 109 = 0. Suppose -564 = -z + 5z. Let b = l + z. Round b to the nearest ten. -60 Let i = 1081 - 1851. What is i rounded to the nearest one hundred? -800 Let b = 3.441 + 0.059. What is b rounded to 0 decimal places? 4 Let b = -1.1 + -17.9. Let u = -16.9 - b. What is u rounded to the nearest integer? 2 Let t = 31.4 + -31.399583. What is t rounded to 5 dps? 0.00042 Let r = 2.76 - -5.604. Let w = -0.064 + r. Round w to zero dps. 8 Let y(c) = 910c3 - c2 - c - 1. Let q be y(-1). Let p = -501 - q. What is p rounded to the nearest one hundred? 400 Let q = 32 + -59. Let t be 6/q + (-311638)/(-18). Suppose 2i - 3287 - t = 0. What is i rounded to the nearest 1000? 10000 Let i = 437384 - 47384. Round i to the nearest 100000. 400000 Let f = -0.6 + 0.6000019. Round f to 6 dps. 0.000002 Let p(k) = 14265k*3 + 9k*2 + 11k - 13. Let l be p(9). Round l to the nearest one million. 10000000 Let g = -153.71301407 + 30.71301338. Let v = 261 - 138. Let r = g + v. What is r rounded to 7 decimal places? -0.0000007 Let d = 38.9999928 - 39. Round d to six decimal places. -0.000007 Let z = -20913.876 - -20986. Let a = z - 72. What is a rounded to two decimal places? 0.12 Suppose 2b - 4x - 12 = 0, -b + 0b + 5x + 12 = 0. Let v be (-71980)/90 + b/(-9). Round v to the nearest 1000. -1000 Let v = 61 - 59.52. Round v to 1 decimal place. 1.5 Let c = -42 + 14. Let t = 28.0000022 + c. Round t to six dps. 0.000002 Let d = 118757 - 118749.30924. Let g = -10.6908 + d. Let p = 3 + g. What is p rounded to four dps? 0 Let r = 282 - 63. Suppose -4c = 185 + r. Let l = -58 - c. What is l rounded to the nearest ten? 40 Let l = -1103 - -543. Let d be 225/(-1 - 554/l). Round d to the nearest 10000. -20000 Let s = -0.68 - -0.679951. Round s to five decimal places. -0.00005 Let r = 11.00000061 + -11. What is r rounded to 7 decimal places? 0.0000006 Let l = 34 + -6. Let y = l - 27.99917. What is y rounded to four decimal places? 0.0008 Let n(b) = -68000b. Suppose 2j - r + 7 = j, 5j = 4r - 30. Let y = j + -3. Let c be n(y). Round c to the nearest one hundred thousand. 300000 Let s be 32/(-24)6/(-4). Suppose -sk + 4k = 1560000. Round k to the nearest 100000. 800000 Let r = 0.71 + -9.31. Let u = 458 + -448.83. Let x = r + u. Round x to 1 dp. 0.6 Let s = 8183 + 211957. Let z = s - 70128. Suppose n + z = -2n + 3h, -5h + 100020 = -2n. Round n to the nearest 10000. -50000 Let j = 10.9 + -1.9. Let x = j + -9.000065. What is x rounded to five dps? -0.00007 Let c = -51.71832749 + -1.28169951. Let k = 11.2 + -64.2. Let l = c - k. Round l to 5 dps. -0.00003 Let d = -8368 - -8360.998. Let b = -7 - d. Round b to three dps. 0.002 Let b = 4148.088 - 4130. Let o = b - 18. Round o to two dps. 0.09 Let k = 25 - 17. Let p(t) = 4t + 8 + 0t + 103125t2 - 5t. Let q be p(k). What is q rounded to the nearest one million? 7000000 Let f = -26 - -26.0000044. What is f rounded to 6 decimal places? 0.000004 Let q = -0.04859367 + 0.0486. What is q rounded to 6 dps? 0.000006 Suppose 2 = -3m + 3a - a, 5a = -4m - 18. Let z be (-6)/(-3) - (m + -9799996). Round z to the nearest one million. 10000000 Suppose -3i - 331 = 3l - 5i, 2l + 3i + 225 = 0. Let n = l + -109. Round n to the nearest 100. -200 Suppose 4t + 34152561 - 552561 = 0. Round t to the nearest one million. -8000000 Let w = 0.043 - -0.497. Let g = w + -0.607. Round g to 2 dps. -0.07 Suppose -4j - 125400000 = -10j. What is j rounded to the nearest 1000000? 21000000 Let b = 2.69935 - 2.7. What is b rounded to 4 dps? -0.0007 Let c be 18/42/3. Suppose -69985 = -5n + 2g + 3g, cg - 28009 = -2n. What is n rounded to the nearest ten thousand? 10000 Let t = 3241739 + 2158261. What is t rounded to the nearest 1000000? 5000000 Let i = -4.3 + 6.2. Let r = 0.1 + i. Let x = 1.99955 - r. Round x to 4 decimal places. -0.0005 Let q = -1.80004 - -1.8. What is q rounded to 5 dps? -0.00004 Suppose 16q - 69200000 = 12q. What is q rounded to the nearest one million? 17000000 Let c be (2/4)/(3/8034). Round c to the nearest one hundred. 1300 Let b = 2.4 + -3. Let s = 0.64646 - 0.0471. Let x = b + s. What is x rounded to 4 dps? -0.0006 Let j(d) = d*2 + 3d. Let w be j(-3). Let i be 0(1 + w)1. Round i to the nearest ten. 0 Let i = 0.18500565 + -0.185. Round i to six decimal places. 0.000006 Let g(f) = 225f2 - 3f + 1. Let r be (9/(-12))/(2/(-8)). Let b be g(r). Suppose b + 183 = z. Round z to the nearest one thousand. 2000 Suppose 8q + 1540000 = 15q. What is q rounded to the nearest 100000? 200000 Suppose 0t - 4 = 2t. Let u = 1 - t. Let z be 28012503/u. What is z rounded to the nearest 100000? 400000 Let t = 5979144.00062 - 5979082. Let c = 15.2 + 46.8. Let u = t - c. Round u to 4 decimal places. 0.0006 Suppose 0 = -n + 3. Let b be (-750)/((-244)/80 + n). What is b rounded to the nearest 10000? 20000 Let u = 2152 + -1185. Suppose 2v - 47 + u = 0. Round v to the nearest 100. -500 Let l = -0.5 + 0.3. Let a = l - -1.55. Let p = a - 2. What is p rounded to 1 decimal place? -0.7 Let d(m) = 220m*3 + 2m*2 + 11m + 4. Suppose -2c = s + 24, -3c - 28 - 8 = 5s. Let b be d(c). What is b rounded to the nearest 100000? -400000 Let m = 1305 - 1305.0001182. Round m to 5 dps. -0.00012 Let w be 1/((-3 + 0)/(-150)). Suppose -5g - 10 - w = 0. Let d = 15 - g. Round d to the nearest ten. 30 Let c = 2.2 + -2.2115. Round c to 3 dps. -0.012 Let f = -162.385 + 0.385. Let u = f - -161.862. Let p = u - -0.12. What is p rounded to 2 decimal places? -0.02 Suppose 17 = 4h + 5. Let g be 56700002/h - (-3)/9. Suppose -2a - 5 = -7a, 3z = a - g. Round z to the nearest one million. -6000000 Let u be (-47)/4 + 2/(-8). Let y be (179097/(-2))/(u/32). Let p = 761204 + y. Round p to the nearest one million. 1000000 Let v be 2/2 + (-4)/(-4). Suppose r - 5z = 3r + 1, 2z + v = 0. Suppose 0o = ro. Round o to 4 decimal places. 0 Let r = 35 - 18. Let n = r + -12. Let s = -4.999989 + n. What is s rounded to five dps? 0.00001 Let x = -10182 + 24784. Let m = -2 + 5. Suppose z - x = 2w, mw - 4z + 21906 = -z. What is w rounded to the nearest 1000? -7000 Let x = 1740780 + -1076145. Let c = 996960 - x. Suppose -147675 - c = 3j. Round j to the nearest one hundred thousand. -200000 Let v = 9 - 1. Suppose 2s = -0s - v, 3q - 16 = 4s. What is q rounded to the nearest 1000? 0 Let i be (-2)/(-3) - (-14)/(-3). Let p = i + 4. Round p to one dp. 0 Let f(y) = 45185y3 + y2 - y - 1. Let b(j) = j*3 - 5j*2 + j - 2. Let a be b(5). Let h be f(a). What is h rounded to the nearest 100000? 1200000 Let v = 162 - -69. Suppose 3i - 3 = -v. Round i to the nearest 10. -80 Let z = 4.4 + 30.6. Let c = z - 34.22. What is c rounded to 1 decimal place? 0.8 Let k be 5(2 - 21/15). Suppose -2w - k = 3u + 2, -1 = -2u + 3*w. Let d be (-26)/(2 -	{ "pile_set_name": "DM Mathematics" }
62176970 What is one sixth of a minute in seconds? 10 What is 421.8828 kilometers in micrometers? 421882800000 What is 13/8 of a tonne in kilograms? 1625 Convert 695.2637kg to milligrams. 695263700 How many millilitres are there in 29/5 of a litre? 5800 What is 0.6162761 millennia in centuries? 6.162761 How many millilitres are there in thirteen quarters of a litre? 3250 How many millilitres are there in seven halves of a litre? 3500 Convert 99988.89 decades to millennia. 999.8889 How many months are there in 48/5 of a decade? 1152 How many weeks are there in 5655905.5 days? 807986.5 What is 21/5 of a micrometer in nanometers? 4200 What is 377.9315 millennia in years? 377931.5 Convert 20.081031 months to years. 1.67341925 Convert 1.857513l to millilitres. 1857.513 What is 752066.7us in seconds? 0.7520667 What is 61378.3 weeks in hours? 10311554.4 How many micrometers are there in seventeen halves of a centimeter? 85000 Convert 504.9701 millimeters to centimeters. 50.49701 How many milliseconds are there in 0.770162 days? 66541996.8 How many years are there in 211901.3 centuries? 21190130 What is thirty-four fifths of a litre in millilitres? 6800 What is 13/5 of a meter in millimeters? 2600 Convert 2862.275 litres to millilitres. 2862275 What is 3/50 of a millennium in months? 720 How many micrometers are there in 0.3710565mm? 371.0565 What is 6/5 of a centimeter in micrometers? 12000 Convert 113.4477 minutes to microseconds. 6806862000 What is three tenths of a kilometer in centimeters? 30000 What is 1/9 of a hour in seconds? 400 How many days are there in 186.024843 milliseconds? 0.0000021530653125 How many seconds are there in one fifteenth of a week? 40320 What is 1220.14 years in decades? 122.014 What is 5.697257kg in grams? 5697.257 Convert 325.8 millennia to centuries. 3258 How many minutes are there in 1.938069us? 0.00000003230115 What is fifteen quarters of a litre in millilitres? 3750 What is four thirds of a century in months? 1600 What is 26/5 of a litre in millilitres? 5200 How many months are there in three tenths of a decade? 36 How many millilitres are there in 2.112647 litres? 2112.647 What is one quarter of a litre in millilitres? 250 Convert 690.005mm to micrometers. 690005 What is 9.874429 millilitres in litres? 0.009874429 How many months are there in 3/10 of a century? 360 What is 961.6512cm in micrometers? 9616512 How many millilitres are there in 6/25 of a litre? 240 Convert 998554.1 seconds to milliseconds. 998554100 What is 406922.22us in hours? 0.00011303395 How many millilitres are there in 3/50 of a litre? 60 What is 17/2 of a millennium in decades? 850 What is 13/5 of a litre in millilitres? 2600 Convert 5396.257 tonnes to micrograms. 5396257000000000 What is twelve sevenths of a week in hours? 288 What is 668502.3us in seconds? 0.6685023 What is 7/8 of a litre in millilitres? 875 What is 67.69033 years in decades? 6.769033 How many millimeters are there in 606756.3 centimeters? 6067563 How many years are there in 51/2 of a century? 2550 What is 14231.532 months in centuries? 11.85961 How many nanograms are there in thirty-two fifths of a microgram? 6400 How many centuries are there in 64/5 of a millennium? 128 How many nanoseconds are there in 9617.05s? 9617050000000 How many milliseconds are there in 3.833us? 0.003833 What is 594.3181 kilometers in centimeters? 59431810 How many years are there in 2009.6337 months? 167.469475 Convert 53225.72 hours to microseconds. 191612592000000 What is 88562.51 millennia in centuries? 885625.1 How many micrograms are there in 56.81297 grams? 56812970 How many milliseconds are there in five eighths of a second? 625 How many minutes are there in 5/8 of a week? 6300 How many seconds are there in 1/6 of a hour? 600 How many centimeters are there in 3/8 of a kilometer? 37500 How many years are there in 3/50 of a millennium? 60 Convert 338904.8mm to kilometers. 0.3389048 What is 3/50 of a kilogram in milligrams? 60000 Convert 1522.579mg to nanograms. 1522579000 How many micrometers are there in 1/100 of a centimeter? 100 Convert 0.4745238 micrometers to kilometers. 0.0000000004745238 How many minutes are there in eleven halves of a hour? 330 Convert 71174.07 months to years. 5931.1725 How many micrometers are there in three tenths of a centimeter? 3000 What is 445853.3 millennia in years? 445853300 Convert 638988.5um to centimeters. 63.89885 How many hours are there in three sevenths of a week? 72 What is 6/25 of a meter in millimeters? 240 What is 254.83008 months in years? 21.23584 What is 64/3 of a week in hours? 3584 How many milligrams are there in 656.2034kg? 656203400 What is 13/4 of a milligram in micrograms? 3250 What is 5.773681 weeks in milliseconds? 3491922268.8 How many millilitres are there in 3.142422 litres? 3142.422 What is three fifths of a gram in milligrams? 600 How many hours are there in 5/6 of a week? 140 How many milligrams are there in 8929.328g? 8929328 What is 11/4 of a millisecond in microseconds? 2750 Convert 46.58828 weeks to microseconds. 28176591744000 What is 330.3053l in millilitres? 330305.3 How many months are there in three sixteenths of a century? 225 How many millennia are there in 0.9432254 decades? 0.009432254 How many millilitres are there in 6/25 of a litre? 240 How many litres are there in 0.8775708 millilitres? 0.0008775708 What is 13/5 of a milligram in micrograms? 2600 What is 44/5 of a microsecond in nanoseconds? 8800 How many months are there in 886933.7 millennia? 10643204400 Convert 24.75385l to millilitres. 24753.85 How many microseconds are there in 4539.52 days? 392214528000000 What is 5411.316ng in micrograms? 5.411316 How many minutes are there in 2.3506041us? 0.000000039176735 How many decades are there in 26/5 of a millennium? 520 What is seven halves of a centimeter in micrometers? 35000 How many years are there in 0.1604708 centuries? 16.04708 How many meters are there in 72958.07 nanometers? 0.00007295807 What is 52529.96 grams in kilograms? 52.52996 How many kilograms are there in one quarter of a tonne? 250 How many decades are there in 27/4 of a millennium? 675 How many kilograms are there in seventeen halves of a tonne? 8500 How many microseconds are there in 16.5424 weeks? 10004843520000 Convert 0.710469 nanoseconds to microseconds. 0.000710469 What is seventeen halves of a meter in millimeters? 8500 Convert 0.6200803l to millilitres. 620.0803 How many grams are there in 4096.212ng? 0.000004096212 What is 5235.183ng in milligrams? 0.005235183 Convert 560.2048nm to meters. 0.0000005602048 How many micrometers are there in 519.6468 meters? 519646800 How many millilitres are there in three tenths of a litre? 300 What is one tenth of a decade in months? 12 What is 4.738812 decades in years? 47.38812 What is 0.1653122 seconds in microseconds? 165312.2 How many nanoseconds are there in twenty-one eighths of a microsecond? 2625 What is 11/2 of a litre in millilitres? 5500 What is 7.706512 weeks in hours? 1294.694016 What is twenty-seven fifths of a milligram in micrograms? 5400 How many nanoseconds are there in 27/4 of a microsecond? 6750 How many days are there in 565524.99 minutes? 392.7256875 How many litres are there in 42.11914 millilitres? 0.04211914 How many minutes are there in 1/80 of a day? 18 What is 9.924105 centuries in decades? 99.24105 Convert 0.0216261ms to nanoseconds. 21626.1 How many nanoseconds are there in 3/8 of a microsecond? 375 How many nanoseconds are there in 144837.2 seconds? 144837200000000 What is one tenth of a decade in years? 1 How many millilitres are there in 0.2436549 litres? 243.6549 How many microseconds are there in 863758.4 nanoseconds? 863.7584 How many minutes are there in 45/4 of a hour? 675 How many milligrams are there in 31/2 of a gram? 15500 How many seconds are there in fourty-nine fifths of a hour? 35280 What is 7/4 of a microgram in nanograms? 1750 How many hours are there in 809.73603ms? 0.000224926675 What is twenty-nine halves of a litre in millilitres? 14500 How many grams are there in eighty-eight fifths of a kilogram? 17600 What is 1.745272 millilitres in litres? 0.001745272 What is seventy-five sevenths of a week in days? 75 How many seconds are there in 2/27 of a	{ "pile_set_name": "DM Mathematics" }
2 AM? 331 How many minutes are there between 8:50 AM and 8:06 PM? 676 What is 689 minutes after 10:56 PM? 10:25 AM What is 158 minutes after 5:57 AM? 8:35 AM How many minutes are there between 9:07 PM and 11:24 PM? 137 How many minutes are there between 11:18 AM and 2:23 PM? 185 How many minutes are there between 3:01 AM and 10:38 AM? 457 How many minutes are there between 7:47 AM and 9:50 AM? 123 How many minutes are there between 4:32 AM and 3:15 PM? 643 What is 71 minutes after 1:00 AM? 2:11 AM What is 474 minutes after 4:21 PM? 12:15 AM What is 462 minutes after 1:36 PM? 9:18 PM What is 385 minutes after 3:37 PM? 10:02 PM How many minutes are there between 2:58 AM and 5:10 AM? 132 How many minutes are there between 2:58 PM and 3:10 PM? 12 What is 419 minutes after 5:52 PM? 12:51 AM How many minutes are there between 3:45 AM and 6:25 AM? 160 How many minutes are there between 3:47 AM and 3:32 PM? 705 How many minutes are there between 7:04 AM and 6:22 PM? 678 What is 337 minutes after 2:31 AM? 8:08 AM What is 419 minutes after 10:53 AM? 5:52 PM What is 385 minutes before 6:25 PM? 12:00 PM What is 115 minutes before 6:33 PM? 4:38 PM What is 321 minutes after 11:15 PM? 4:36 AM What is 715 minutes before 7:22 PM? 7:27 AM How many minutes are there between 10:19 PM and 11:48 PM? 89 What is 176 minutes before 11:49 PM? 8:53 PM How many minutes are there between 11:23 AM and 11:18 PM? 715 What is 372 minutes after 7:24 PM? 1:36 AM What is 90 minutes before 3:41 PM? 2:11 PM How many minutes are there between 12:17 AM and 4:54 AM? 277 How many minutes are there between 5:49 PM and 2:05 AM? 496 How many minutes are there between 10:24 PM and 5:14 AM? 410 How many minutes are there between 5:19 AM and 9:16 AM? 237 How many minutes are there between 10:19 PM and 7:51 AM? 572 How many minutes are there between 9:57 PM and 10:41 PM? 44 How many minutes are there between 2:32 PM and 8:25 PM? 353 What is 624 minutes before 8:31 AM? 10:07 PM What is 295 minutes after 7:22 AM? 12:17 PM What is 492 minutes after 4:56 PM? 1:08 AM What is 462 minutes after 9:55 AM? 5:37 PM What is 88 minutes before 12:43 PM? 11:15 AM What is 586 minutes before 4:56 PM? 7:10 AM How many minutes are there between 6:51 AM and 12:08 PM? 317 What is 154 minutes before 5:18 AM? 2:44 AM How many minutes are there between 6:46 PM and 9:32 PM? 166 How many minutes are there between 5:33 AM and 5:18 PM? 705 How many minutes are there between 1:52 AM and 11:04 AM? 552 What is 27 minutes before 9:25 PM? 8:58 PM What is 607 minutes after 10:54 PM? 9:01 AM How many minutes are there between 6:00 AM and 11:02 AM? 302 What is 260 minutes after 3:22 AM? 7:42 AM What is 240 minutes before 4:13 AM? 12:13 AM What is 97 minutes before 4:28 PM? 2:51 PM How many minutes are there between 9:37 PM and 9:49 PM? 12 What is 50 minutes after 8:29 PM? 9:19 PM How many minutes are there between 5:49 AM and 6:38 AM? 49 How many minutes are there between 4:39 AM and 8:53 AM? 254 How many minutes are there between 10:51 AM and 4:23 PM? 332 What is 704 minutes after 5:51 PM? 5:35 AM How many minutes are there between 6:41 AM and 2:00 PM? 439 How many minutes are there between 1:25 PM and 5:51 PM? 266 How many minutes are there between 12:07 PM and 3:13 PM? 186 How many minutes are there between 11:49 AM and 9:27 PM? 578 What is 559 minutes after 10:59 AM? 8:18 PM What is 463 minutes before 1:48 AM? 6:05 PM What is 141 minutes after 2:37 PM? 4:58 PM What is 414 minutes before 12:15 PM? 5:21 AM What is 625 minutes before 2:35 PM? 4:10 AM How many minutes are there between 8:32 AM and 2:44 PM? 372 What is 492 minutes after 6:15 PM? 2:27 AM How many minutes are there between 4:06 AM and 4:16 AM? 10 What is 400 minutes before 7:01 PM? 12:21 PM How many minutes are there between 1:17 AM and 11:00 AM? 583 What is 703 minutes before 12:48 PM? 1:05 AM How many minutes are there between 9:09 AM and 1:24 PM? 255 How many minutes are there between 1:58 AM and 9:24 AM? 446 What is 539 minutes after 7:54 AM? 4:53 PM What is 145 minutes before 7:33 PM? 5:08 PM What is 714 minutes after 5:00 PM? 4:54 AM How many minutes are there between 5:35 PM and 9:35 PM? 240 How many minutes are there between 5:04 PM and 4:59 AM? 715 What is 374 minutes before 12:01 PM? 5:47 AM How many minutes are there between 8:53 PM and 4:02 AM? 429 What is 662 minutes before 2:40 PM? 3:38 AM How many minutes are there between 9:19 PM and 8:37 AM? 678 How many minutes are there between 1:13 AM and 3:25 AM? 132 What is 386 minutes before 11:18 PM? 4:52 PM How many minutes are there between 12:21 PM and 11:41 PM? 680 What is 490 minutes after 3:15 PM? 11:25 PM How many minutes are there between 9:32 AM and 8:47 PM? 675 How many minutes are there between 10:01 PM and 7:20 AM? 559 How many minutes are there between 1:49 AM and 2:49 AM? 60 What is 331 minutes after 4:34 AM? 10:05 AM What is 557 minutes before 2:12 AM? 4:55 PM How many minutes are there between 5:13 AM and 7:37 AM? 144 How many minutes are there between 8:27 AM and 3:25 PM? 418 What is 277 minutes before 5:44 PM? 1:07 PM How many minutes are there between 1:09 AM and 9:14 AM? 485 What is 126 minutes before 8:37 PM? 6:31 PM What is 719 minutes before 12:41 PM? 12:42 AM What is 439 minutes before 6:26 AM? 11:07 PM How many minutes are there between 2:28 PM and 4:35 PM? 127 What is 586 minutes before 12:22 AM? 2:36 PM How many minutes are there between 12:11 PM and 1:02 PM? 51 What is 704 minutes before 11:07 PM? 11:23 AM What is 44 minutes before 5:40 PM? 4:56 PM How many minutes are there between 8:04 PM and 12:10 AM? 246 What is 141 minutes before 11:49 PM? 9:28 PM What is 238 minutes after 2:55 PM? 6:53 PM What is 719 minutes after 2:40 PM? 2:39 AM How many minutes are there between 4:20 PM and 6:42 PM? 142 What is 353 minutes after 12:01 AM? 5:54 AM What is 135 minutes before 7:50 AM? 5:35 AM How many minutes are there between 10:15 AM and 8:12 PM? 597 What is 639 minutes before 1:35 PM? 2:56 AM What is 663 minutes before 12:10 PM? 1:07 AM How many minutes are there between 6:36 PM and 10:13 PM? 217 How many minutes are there between 1:54 PM and 12:01 AM? 607 What is 355 minutes before 5:51 PM? 11:56 AM What is 97 minutes before 12:27 AM? 10:50 PM What is 142 minutes before 7:57 PM? 5:35 PM What is 524 minutes before 4:45 AM? 8:01 PM What is 289 minutes before 8:15 AM? 3:26 AM How many minutes are there between 10:32 AM and 5:03 PM? 391 What is 223 minutes before 2:04 PM? 10:21 AM How many minutes are there between 9:20 PM and 8:35 AM? 675 What is 386 minutes before 3:35 PM? 9:09 AM How many minutes are there between 9:45 PM and 8:37 AM? 652 How many minutes are there between 2:01 PM and 12:17 AM? 616 How many minutes are there between 3:15 AM and 10:57 AM? 462 What is 535 minutes before 5:56 PM? 9:01 AM What is 360 minutes before 12:46 PM? 6:46 AM How many minutes are there between 1:12 AM and 12:44 PM? 692 How many minutes are there between 4:05 PM and 6:12 PM? 127 What is 137 minutes after 11:23 PM? 1:40 AM What is 300 minutes before 6:57 AM? 1:57 AM What is 423 minutes after 11:50 PM? 6:53 AM How many minutes are there between 10:07 PM and 6:30 AM? 503 What is 423 minutes after 11:27 PM? 6:30 AM What is 472 minutes after 3:16 AM? 11:08 AM What is 250 minutes after 5:27 PM? 9:37 PM How many minutes are there between 5:19 PM and 9:56 PM? 277 How many minutes are there between 8:55 AM and 12:12 PM? 197 How many minutes are there between 6:33 PM and 6:52 PM? 19 How many minutes are there between 2:21 AM and 9:47 AM? 446 What is 592 minutes after 8:05 AM? 5:57 PM What is 578 minutes after 5:29 PM? 3:07 AM How many minutes are there between 12:28 PM and 3:15 PM? 167 How many minutes are there between 9:09 PM and 5:21 AM? 492 What is 52 minutes after 5:01 PM? 5:53 PM How many minutes are there between 10:13 AM and 6:13 PM? 480 How many minutes are there between 11:26 AM and 11:28 AM? 2 What is 710 minutes before 7:48 AM? 7:58 PM How many minutes are there between 12:20 PM and 3:35 PM? 195 What is 524 minutes before 6:05 AM? 9:21 PM What is 388 minutes after 11:07 PM? 5:35 AM What is 96 minutes after 4:13 PM? 5:49 PM What is 693 minutes after 11:33 PM? 11:06 AM How many minutes are there	{ "pile_set_name": "DM Mathematics" }
the nearest integer? 3 What is the seventh root of 868 to the nearest integer? 3 What is 628 to the power of 1/3, to the nearest integer? 9 What is the cube root of 404 to the nearest integer? 7 What is 1294 to the power of 1/5, to the nearest integer? 4 What is 1425 to the power of 1/2, to the nearest integer? 38 What is 6363 to the power of 1/10, to the nearest integer? 2 What is the third root of 17540 to the nearest integer? 26 What is 15455 to the power of 1/2, to the nearest integer? 124 What is the eighth root of 94196 to the nearest integer? 4 What is the square root of 267 to the nearest integer? 16 What is the tenth root of 850 to the nearest integer? 2 What is the third root of 5572 to the nearest integer? 18 What is 625 to the power of 1/3, to the nearest integer? 9 What is the square root of 1418 to the nearest integer? 38 What is 91 to the power of 1/3, to the nearest integer? 4 What is 957 to the power of 1/7, to the nearest integer? 3 What is 2684 to the power of 1/8, to the nearest integer? 3 What is 116058 to the power of 1/9, to the nearest integer? 4 What is the sixth root of 26823 to the nearest integer? 5 What is the square root of 23917 to the nearest integer? 155 What is 5078 to the power of 1/2, to the nearest integer? 71 What is 2045 to the power of 1/2, to the nearest integer? 45 What is the fifth root of 12934 to the nearest integer? 7 What is 97391 to the power of 1/3, to the nearest integer? 46 What is the square root of 2925 to the nearest integer? 54 What is the fifth root of 2536 to the nearest integer? 5 What is the ninth root of 63824 to the nearest integer? 3 What is 140958 to the power of 1/2, to the nearest integer? 375 What is the cube root of 51221 to the nearest integer? 37 What is the square root of 258 to the nearest integer? 16 What is the fifth root of 18297 to the nearest integer? 7 What is the third root of 44716 to the nearest integer? 35 What is the third root of 1247 to the nearest integer? 11 What is 1857 to the power of 1/9, to the nearest integer? 2 What is the cube root of 31341 to the nearest integer? 32 What is 62295 to the power of 1/2, to the nearest integer? 250 What is the third root of 7508 to the nearest integer? 20 What is the fifth root of 85285 to the nearest integer? 10 What is 43097 to the power of 1/2, to the nearest integer? 208 What is the cube root of 6088 to the nearest integer? 18 What is 1479 to the power of 1/5, to the nearest integer? 4 What is 129098 to the power of 1/4, to the nearest integer? 19 What is the square root of 47547 to the nearest integer? 218 What is the square root of 59983 to the nearest integer? 245 What is 147 to the power of 1/3, to the nearest integer? 5 What is the cube root of 5264 to the nearest integer? 17 What is 3776 to the power of 1/9, to the nearest integer? 2 What is 4989 to the power of 1/8, to the nearest integer? 3 What is the square root of 2996 to the nearest integer? 55 What is 4054 to the power of 1/9, to the nearest integer? 3 What is 11856 to the power of 1/2, to the nearest integer? 109 What is the square root of 7825 to the nearest integer? 88 What is 508 to the power of 1/2, to the nearest integer? 23 What is 2944 to the power of 1/9, to the nearest integer? 2 What is 1323 to the power of 1/6, to the nearest integer? 3 What is the square root of 3674 to the nearest integer? 61 What is the cube root of 10256 to the nearest integer? 22 What is the square root of 120922 to the nearest integer? 348 What is the ninth root of 6280 to the nearest integer? 3 What is the cube root of 1457 to the nearest integer? 11 What is the fourth root of 1092 to the nearest integer? 6 What is the cube root of 27398 to the nearest integer? 30 What is the cube root of 3381 to the nearest integer? 15 What is 69939 to the power of 1/3, to the nearest integer? 41 What is the ninth root of 2543 to the nearest integer? 2 What is 7031 to the power of 1/3, to the nearest integer? 19 What is the cube root of 1499 to the nearest integer? 11 What is the ninth root of 115343 to the nearest integer? 4 What is 2173 to the power of 1/7, to the nearest integer? 3 What is the sixth root of 5726 to the nearest integer? 4 What is the square root of 2453 to the nearest integer? 50 What is 9541 to the power of 1/9, to the nearest integer? 3 What is the square root of 657 to the nearest integer? 26 What is 10828 to the power of 1/3, to the nearest integer? 22 What is 702 to the power of 1/9, to the nearest integer? 2 What is 1952 to the power of 1/2, to the nearest integer? 44 What is 1317 to the power of 1/6, to the nearest integer? 3 What is the fifth root of 3016 to the nearest integer? 5 What is 7696 to the power of 1/2, to the nearest integer? 88 What is 54934 to the power of 1/6, to the nearest integer? 6 What is 5728 to the power of 1/2, to the nearest integer? 76 What is the third root of 2195 to the nearest integer? 13 What is the square root of 686 to the nearest integer? 26 What is 314 to the power of 1/7, to the nearest integer? 2 What is 4757 to the power of 1/3, to the nearest integer? 17 What is the seventh root of 101078 to the nearest integer? 5 What is the square root of 79647 to the nearest integer? 282 What is the ninth root of 1010 to the nearest integer? 2 What is the square root of 6448 to the nearest integer? 80 What is 854 to the power of 1/3, to the nearest integer? 9 What is 1137 to the power of 1/2, to the nearest integer? 34 What is the square root of 68310 to the nearest integer? 261 What is 13932 to the power of 1/4, to the nearest integer? 11 What is the square root of 64425 to the nearest integer? 254 What is the cube root of 42375 to the nearest integer? 35 What is 4686 to the power of 1/2, to the nearest integer? 68 What is the third root of 3161 to the nearest integer? 15 What is 1137 to the power of 1/4, to the nearest integer? 6 What is 2897 to the power of 1/5, to the nearest integer? 5 What is the eighth root of 76451 to the nearest integer? 4 What is 1689 to the power of 1/7, to the nearest integer? 3 What is the fourth root of 7572 to the nearest integer? 9 What is the cube root of 7270 to the nearest integer? 19 What is the cube root of 1012 to the nearest integer? 10 What is the cube root of 1102 to the nearest integer? 10 What is 2874 to the power of 1/9, to the nearest integer? 2 What is the third root of 32156 to the nearest integer? 32 What is the cube root of 3196 to the nearest integer? 15 What is the ninth root of 11041 to the nearest integer? 3 What is 17771 to the power of 1/2, to the nearest integer? 133 What is the cube root of 24638 to the nearest integer? 29 What is the cube root of 2377 to the nearest integer? 13 What is the square root of 4494 to the nearest integer? 67 What is the cube root of 514 to the nearest integer? 8 What is 81210 to the power of 1/3, to the nearest integer? 43 What is 47800 to the power of 1/2, to the nearest integer? 219 What is 6477 to the power of 1/5, to the nearest integer? 6 What is 2077 to the power of 1/2, to the nearest integer? 46 What is the tenth root of 4242 to the nearest integer? 2 What is the cube root of 1237 to the nearest integer? 11 What is 3195 to the power of 1/8, to the nearest integer? 3 What is the cube root of 81696 to the nearest integer? 43 What is the cube root of 14843 to the nearest integer? 25 What is the square root of 2795 to the nearest integer? 53 What is the eighth root of 26560 to the nearest integer? 4 What is 4856 to the power of 1/9, to the nearest integer? 3 What is the square root of 4635 to the nearest integer? 68 What is the cube root of 819 to the nearest integer? 9 What is the fourth root of 430 to the nearest integer? 5 What is the seventh root of 69305 to the nearest integer? 5 What is the cube root of 3424 to the nearest integer? 15 What is 933 to the power of 1/6, to the nearest integer? 3 What is the square root of 2126 to the nearest integer? 46 What is the square root of 693 to the nearest integer? 26 What is the cube root of 156939 to the nearest integer? 54 What is the eighth root of 1826 to the nearest integer? 3 What is 14133 to the power of 1/9, to the nearest integer? 3 What is the square root of 4759 to the nearest integer	{ "pile_set_name": "DM Mathematics" }
- g. What is the third biggest value in 2, 0.3, x? x Let m = -0.615 + -636.385. Let v = -636.9 - m. Which is the second smallest value? (a) 5 (b) -0.103 (c) 4 (d) v d Suppose 0 = 4i - 2v + 1 - 13, 5i = 4v + 24. Let s be (-46)/10 - (-10 - -6). Which is the biggest value? (a) s (b) i (c) 2/9 c Let u = 33536 + -33352. Which is the second smallest value? (a) u (b) 3 (c) 2/5 b Let j be -8 + (72/10)/(1218/1365). Which is the second biggest value? (a) -3.7 (b) -4 (c) 0.2 (d) j d Let w = -53 - -62. Let r = w - 6. Let l = 106.4 + -106. Which is the second smallest value? (a) -0.4 (b) l (c) r (d) 0.24 d Suppose 0 = -2l + 4, -l = -3c - 142 - 265. Let p be 4/(-6)(-4)/((-72)/c). Let u = -2.04 + 0.04. What is the fourth smallest value in u, 2, -1/2, p? p Let y = 2469/10712 - -3/10712. Let g = -0.06 - 0.24. What is the smallest value in g, 5, y? g Let l = -1.97 - 0.03. Let v = 17866 - 17861. What is the third biggest value in 2/7, v, -3/7, l? -3/7 Let b be (840/600)/(14/10 - 1). What is the fourth biggest value in -3, -4, 5, b? -4 Let j = -75 - -18. Let n = 60 + j. Let t be (-6)/33 - (204/88 + -4). Which is the second smallest value? (a) 11 (b) -2/13 (c) t (d) n c Let k = 13694 - 13694. Which is the second biggest value? (a) -0.4 (b) -0.5 (c) 3/7 (d) -8 (e) k e Let s = -167 + 37. Let g = -126 - s. Which is the smallest value? (a) 115 (b) 0.4 (c) g b Let v be -9(236/(-59) + (-26)/(-6)). Which is the third smallest value? (a) 0.121 (b) v (c) -19 a Let i = 112713 - 112712.6. Let p be 3/(7/(-2) - -2). Let r be (-54)/55 + 4/22. What is the fourth biggest value in r, 0, p, i? p Let k be 18/(-315)(-10)/8. Let f be 12/(-90)6290. Let g = f + 1620/7. Which is the second biggest value? (a) -2/3 (b) -3 (c) k (d) g d Let v = -2.05 + 0.05. Let s = 109.08 + -100. Let h = s + -0.08. What is the second biggest value in v, h, -0.3? -0.3 Let g = 0.2 + -0.6. Suppose 217 = o - 5s, -o = o + s - 456. Let t = o + -907/4. Which is the fourth biggest value? (a) -1 (b) t (c) g (d) 0 a Suppose 6w = 5w - 5n - 9, 4w + n - 21 = 0. Let d be 8/(8/w(-12)/8). Which is the second biggest value? (a) d (b) 2/55 (c) 0.2 b Let t = -0.921 + 0.871. Let m = 1.36 - -32.84. Let j = m - 34. Which is the third smallest value? (a) -5 (b) t (c) 5 (d) j d Let x = 0.3 - 0.8. Let o = 3 - -2. Let k = 249684 + -3245890/13. Which is the third biggest value? (a) k (b) x (c) o b Let x = 10798 - 10801. Which is the fourth smallest value? (a) x (b) 1/7 (c) -644 (d) 3 d Let w(u) = -u3 + 2u*2 + 17u - 127. Let f be w(0). Which is the smallest value? (a) -1 (b) f (c) 0.4 b Let p = 1/27 - -79/54. Let m be 2650/(-1272) + (-8)/(-6). Which is the third biggest value? (a) 5 (b) m (c) p (d) 15 c Let h = 393/2101 + -1/191. Let o(t) = t*3 + 18t*2 + 48t + 48. Let w be o(-15). What is the fourth smallest value in w, h, -1/3, -5? w Let n = -1.343 + 1.38. Let p = n - 0.087. Which is the third smallest value? (a) -1 (b) -0.5 (c) 1/2 (d) p d Let t be 1/45678 - (-2 - -14). What is the biggest value in -1/7, -5, -4, -0.3, t? t Let o = 1523 - 1524. Let h = -17.04 - -17. Let i = 2.04 + h. Which is the third smallest value? (a) o (b) -3 (c) i c Let u = 46 + -50. Let n be (-1)/(-3) + (75/(-9) - -8). Let y = 5/17 - 99/221. Which is the smallest value? (a) y (b) u (c) 2/9 (d) n b Let w = 361 + -356. Let l = 1391/6426 - 1/459. Which is the second smallest value? (a) l (b) -2 (c) 2 (d) w a Let h be 2/9 + 14 + 32798/(-2277). Which is the smallest value? (a) 6/11 (b) -0.5 (c) h b Let x = -0.486 - -0.206. Let k = x - -0.18. Which is the biggest value? (a) 12 (b) k (c) -0.2 (d) 0.08 a Let u = 27 + -14. Let x(t) = 61t3 + t2 - 2t. Let k be x(1). Let b be 7 - 234/k2. What is the third biggest value in b, u, -1, 4? b Let c = -915 + 858. Let i = 4 - 23. Let k be c/i + (-13)/3. What is the fourth smallest value in k, -0.06, -0.2, 3/5? 3/5 Let o = 148.2 + -149.2. What is the smallest value in -5/6, -2/3, 15, o, 0.4? o Let s = 2569 + -38533/15. What is the second biggest value in 4, -26, s, 0? s Let h be (-2)/(-19)(0/5 + 1). Let g = 91.9 - 92. What is the smallest value in g, 0.07, -1/2, h? -1/2 Let v = -0.075 - 0.125. Let w = 3.6 - 4. What is the third biggest value in w, -7, v? -7 Let l = -12284/7 + 1751. What is the fourth biggest value in 0.4, 2, 0.5, 3, l? 0.4 Let y be (2/12)/((-3)/6)-27. Suppose 7 = yk - 2. Which is the fourth smallest value? (a) 0.4 (b) 2/15 (c) 314 (d) k c Let s = -1357 + 23071/17. Let v = -299/7 + 43. Let i = 1.2 - 0.2. Which is the smallest value? (a) 1/4 (b) v (c) i (d) s d Let b = -12.9 + 13.128. Let t = 5.672 + b. What is the second smallest value in -3, 3, t? 3 Let c = 14.209 + -4.223. Let x = -0.014 - c. What is the second biggest value in 1/3, 3/4, x? 1/3 Let w = -131.877 + 132. Let i = w + -0.103. Which is the fourth smallest value? (a) i (b) -1/3 (c) 3 (d) -0.3 c Let l be (2/51)/((-1)/3). Let k = 5609.6 + -5603.6. Which is the third smallest value? (a) l (b) k (c) 5 b Let u = -0.8 - 1.2. Let k = 134 + -58. Let m = k - 76.3. Which is the second smallest value? (a) m (b) 0 (c) u (d) 1/2 a Suppose 4j + 6 = -2, -4y + 2j = -4. Which is the fourth smallest value? (a) y (b) -2/7 (c) -268 (d) 2 d Let s be -24 - (0 - 1)-1. Let c = 202 - 204. What is the fourth smallest value in s, 0.4, c, -5? 0.4 Let i be ((-4 + 1)/(24/(-16)))/28. Let t be (-5)/18 + 4/(-18). What is the second biggest value in i, -0.4, t, 3? i Let o = -6.21 + 6. Let r = o + 5.21. Let u = 5.4 - r. What is the biggest value in u, 8, 1/4? 8 Let l = -2.109 - -0.059. Let z = l + 0.05. Let m = 2007/11 - 10024/55. What is the second smallest value in m, z, -5? z Suppose -5o + 5h = 7h - 4, 5o = 3h + 44. Which is the third smallest value? (a) -5 (b) o (c) 1 (d) 1079 b Let o = 333 + -327. Which is the second biggest value? (a) -34 (b) -5 (c) o b Let n = 9339 - 9341. Which is the biggest value? (a) n (b) 14 (c) 15/4 b Let o = 5.775 - 5.475. What is the smallest value in -3, 0.1, 2/17, -3/5, o? -3 Let d = 7.8 + -8. Let j = 28982 - 28979. Let h = -0.42 + 0.5. What is the third biggest value in d, j, -1, h? d Let x = -3 - -2. Let m be 14/(-8) + (-47088)/(-6976). Which is the third smallest value? (a) 0.3 (b) -1/23 (c) m (d) x a Let h = 3.301 - 3.521. What is the smallest value in -0.2, 0.56, h? h Let g = 3 - 1.1. Let f = -3.4 - g. Let h = f - -4.9. Which is the fourth biggest value? (a) 5 (b) -2 (c) 0.2 (d) h b Let v = -2.103 + 2.503. What is the biggest value in v, 2, 0.2, -3, 0? 2 Let k be 5/((-5)/2)(-11)/(-110)-25. Which is the second smallest value? (a) -4 (b) k (c) 0.1 (d) 1 c Let n = 48 - 526/11. Let u = 140923 - 140924. What is the second smallest value in n, 36, u? n Let c = 5 - 6. Let z = -2019.6 - -2021.7. What is the third smallest value in 1, z, c? z Let j = -20465 + 20707.9. Which is the smallest value? (a) 1/6 (b) -0.5 (c) -3 (d) 1/9 (e) j c Let x = -8677/11 - -789. What is the biggest value in -1/4, 4, 3, x, 5? 5 Let t = -1.0811 + 0.9811. Which is the second biggest value? (a) 4 (b) t (c) 3/2 (d) 3/7 (e) 0.1 c Let s(d) = d*3 - 36d*2 + 241d + 17. Let w be s(9). Which is the biggest value? (a) 39/10 (b) -4 (c) w a Let a = -354 - -4600/13. Let b = -2 - 1. Let z be 3/18(-4)/b. What is the second biggest value in -1/4, z, a, -2/9? a Let r = 383 - 381.62. Let f = r + 1.62. What is the biggest value in 1/6, f, -8? f Let h = 2976.5 - 2976.7. Let t = 1.4 + 0.1. Let o = t - 0.5. Which is the second biggest value? (a) o (b) h (c) 5 a Let n = 84.1 + -80. Let z = -0.0457 + 3.7457. Let t = z - n. What is the second smallest value in t, 2, -2? t Let s = 0.4 - 1.4. Let n be ((-70)/80)/7 - (2 - 26/16). What is the third smallest value in 0.07, s, -2/3, n? n Let h = -17146 + 137167/8. Which is the biggest value? (a) 93.6 (b) h (c) -2/9 a Let k be 3/15(4 - 161/42)-6. Which is the fourth smallest value? (a) 3 (b) k (c) -1.54 (d) -3 (e) -3/5 b Suppose -3w + 9 = -4k - 0w, 5k + 3w = 9. Let n = 211 - 226. Let c be (k/(-2) - n/5)*-1. What is the smallest value in -2/9, c, 3/8? c Let t = 0.082 + -3.082. Let y = 0.137 + -1.727. Let r = -0.59 - y. Which is the third smallest	{ "pile_set_name": "DM Mathematics" }
) Simplify (q*4q)/(q/(qq/(qq*3)q))q/(q(2/21)q)(q/q7)/q assuming q is positive. q(-86/21) Simplify (o(-1/17))14(o/(o/(o/o(-4/5))))6 assuming o is positive. o(848/85) Simplify ((k(-2/21)k)(-27))(10/7) assuming k is positive. k(-1710/49) Simplify (q(8/3)/(q/q(4/3)))/((q/q(-1/7)qq)/qqq(4/7)q) assuming q is positive. q*(-12/7) Simplify (((n/(n/(n(n/n1)/n)))/n)/n)(-3)n(-16)n/n*(-1/3)n assuming n is positive. n(-23/3) Simplify r(-2/51)rrr37r((rr/r*26rrr)/r)(12/17) assuming r is positive. r(1246/51) Simplify v*(2/13)/vv*(-1/3)v(v/(v4/v))/v(-25) assuming v is positive. v(890/39) Simplify ((a(4/3)a)/(a*(-11)/a))/(a/(a/((a/(a/(aa(-2/3)/a)))/a)))25 assuming a is positive. a*56 Simplify ((a/((a/(a((aa(-8)a)/aa)/a))/a)a)/a)*35/(aa(a(1/3)/a)/aa(-2)) assuming a is positive. a(-520/3) Simplify (((ff(1/11)f)/f2)/(f(1/4)/(f(fffff(2/5)/ff)/f)))(3/5) assuming f is positive. f(2799/1100) Simplify (g*(-4/13)g)*45g*(-1/17)/gg*(-4/5)g assuming g is positive. g*(33476/1105) Simplify ((m/(m/(m/(mm*(1/4)m))))/m*(-1/4))/((m/((m/(mm/(mm/(mm*(-11/2))mm)))/m))/m(-7)) assuming m is positive. m(-5/2) Simplify ((ww/(w*(2/7)/w)w)/w)*(-4/5)w*(8/9)w10 assuming w is positive. w(2746/315) Simplify (z*(-7)z*(-2/19)/z(z/z(-1/3))(11/5))(39/5) assuming z is positive. z(-19162/475) Simplify sss*(-7/5)sss(ss/(s*(-16)s)s)/s((s*(-5)/s)/ss)(-22/5) assuming s is positive. s47 Simplify (p(-1/4))0/(p*7p11) assuming p is positive. p(-18) Simplify (((r(-8)/r)/r10)/(((rr(-1/11))/r)/((rr((((r(-13)/r)/r)/r)/r)/r)/r)))42 assuming r is positive. r(-16590/11) Simplify (d/(d0d))*(-26)d*(-8)d/(d/(d*(1/20)d)d) assuming d is positive. d(-159/20) Simplify (t(-3/4)/t(2/3)t*(-13/5)t7)(5/8) assuming t is positive. t(179/96) Simplify (((t(-5)t)/((t(-4/3)/t)/tt))/(t*3t/(t(tt(-1/4))/t)))46 assuming t is positive. t*(-1357/6) Simplify (g/((g/(ggg(-1/3)))/g))(6/35)(g(gg/g*(-1/10)g)/g)/((g/g(4/13))/g) assuming g is positive. g(3517/910) Simplify (uu10)(-3/44)u(-13/2)/(u/(u/u(-10))) assuming u is positive. u(11/4) Simplify (l11l)(-2)(l(-5))(-4) assuming l is positive. l*(-4) Simplify (((ww/(w/w*(-1))ww)(-26))(-5))(-13/6) assuming w is positive. w(-1690/3) Simplify (((u0)21)(-21))(1/22) assuming u is positive. 1 Simplify ((x((x/(x/(xx0))x)/x)/x(x(-27)x)/x)(-28/9))(1/6) assuming x is positive. x(364/27) Simplify (t(-3/8)tt/t*7t*7/tt/t(-2))(-22) assuming t is positive. t(-319/4) Simplify (f/f(2/9))(2/33)/(f(-10)/(ff(8/3))) assuming f is positive. f(4073/297) Simplify t(3/7)/(tt*(-1/19))t/t*(-2)tt0 assuming t is positive. t(463/133) Simplify ((q/q(-8/5))/(q(-7/3)/q))(-36) assuming q is positive. q(-1068/5) Simplify ((((l(1/8)/l)/l)/ll)/l*(2/19)(ll(-1/6))/lll/((l/l(-2/17))/l))35 assuming l is positive. l(-71785/7752) Simplify (c/(c/c(2/19)))/c11c*(-15)ccccc25 assuming c is positive. c(59/19) Simplify (ii/(ii(5/4)/i))(-46)/(i*(2/27)ii)(2/31) assuming i is positive. i(-57977/1674) Simplify ((oo/(o((o/(o/(o/o(1/7))))/o)/ooooo)o)/oo(o(oo*(-2/21))/o)/o(o/o(-5))/(o/o(-2/11)))16 assuming o is positive. o(14288/231) Simplify k*(-2/59)k*17k/k*1kk(kk(-25)k)/k assuming k is positive. k(-297/59) Simplify (v(2/5)vv(20/7)/v)/((v/v(-26))/(v(12/11)/v)) assuming v is positive. v(-9106/385) Simplify r*23rr/r(-2/5)(r/(r/(rr(1/8))))/r(1/4) assuming r is positive. r(1051/40) Simplify ((r3r)/r)/(rr(-3/5))(r/(r(r(r/r*(-1/3)r)/r)/r))39 assuming r is positive. r(-247/5) Simplify (q/q(1/4))(12/5)q(4/9)/(qqqq(-10)) assuming q is positive. q(416/45) Simplify ((y*(-7)y)/(((y*9/yy)/y)/y))/((y*(-8/7)/y)/(yy10)) assuming y is positive. y(1/7) Simplify (t(-6))(-1/61)(t(-5))(-1) assuming t is positive. t(311/61) Simplify (fff7/ff)*(-20)/((fff(-11))/ff(-15)) assuming f is positive. f(-155) Simplify ((kk/k(2/3))/(kkkk*2)k*(-3)kk/(k((k/k*1)/k)/kk))(-24) assuming k is positive. k112 Simplify (f(-6/11)/((((f(-5)f)/f)/f)/f))(5/14) assuming f is positive. f(355/154) Simplify ((((f(5/6)/f)/f)/f(-2/15))(4/25))(6/11) assuming f is positive. f(-124/1375) Simplify (kk(4/13))11k23/(k(1/2)/k) assuming k is positive. k(985/26) Simplify (n(nn(-10))/n)/n32(n*(-2/73)/n)/nn/n(6/5) assuming n is positive. n(-15778/365) Simplify ((y/(yy/((y/y2)/y)))/(y(2/29)y))/((y/(y/(y*11/yy)))/y(-5)) assuming y is positive. y(-582/29) Simplify (((a*0a)(9/7))46)(-5/7) assuming a is positive. a(-2070/49) Simplify ((yy(-12))/(y/(y(-1/7)/yyy)))(2/47) assuming y is positive. y(-156/329) Simplify ((tt*(-6/11)tt6)/(t1)(-11/6))(2/47) assuming t is positive. t(613/1551) Simplify (dd*30)/(d/(d/(d/(((dd*16)/d)/d))))((dd(-14/5)/dd)/d)/(d*27/dd) assuming d is positive. d(76/5) Simplify (((v/v(1/11))/v)/v*(-6)v/(v/(vv(-2/29)))vv(6/7)v)(-5/9) assuming v is positive. v(-12030/2233) Simplify (v(2/5))(-2/65)(vv(-2/3))/v7 assuming v is positive. v(-6512/975) Simplify ((b(-1/2))*(1/93)b*6/((bbbb*(2/3)bb)/b))(-41) assuming b is positive. b(-10127/186) Simplify (x(-3)x)(-1/15)/((x(5/6)x)/(xx(-4))) assuming x is positive. x(-47/10) Simplify (h/((h*(-4)h)/h))/h*(1/19)h*(-3/16)hhh(hh17)/h assuming h is positive. h(7527/304) Simplify (((j/j*0j)/(jj/(jj*(-1/2)/jj)))(-3/25))(-14) assuming j is positive. j(21/25) Simplify (p18p6)/(p(1/5)/p(4/13)) assuming p is positive. p(1567/65) Simplify ((d(-1)/((d/((d/(dd*(-3)))/d))/d))/(d/(d/(d/(d/(d/(dd*(-3/11)d)d))))d(-1/3)))(-1) assuming d is positive. d(-35/33) Simplify (b5/bbb6)/(b(-6/11)/(b*11b)) assuming b is positive. b(259/11) Simplify ((h(-3/2)/h)/h)*(4/5)h*(1/7)h7/h assuming h is positive. h(117/35) Simplify (v/(v*(-8)/v)v0)/(v(1/9)/(vv/v(-1/5)v)) assuming v is positive. v*(589/45) Simplify (((qq(-4/9))/(q/q(-1)))45)(-1/38) assuming q is positive. q*(65/38) Simplify (kk*(-4/13)k(17/5))(-1) assuming k is positive. k(-266/65) Simplify (d/d9)(-27)/(d(-3/4)d)50 assuming d is positive. d(407/2) Simplify (x24xx(-28)xx)/((x(-2/51)/x)/((x(-2/39)x)/x)) assuming x is positive. x(-8/663) Simplify u(-2/67)uu/(u/(uu/(uu/(uu/u21)u)))u30uu/u(-3/8) assuming u is positive. u(7153/536) Simplify z(4/17)(z/z*(-5/11))/z((zzz*(-6)/zz)/z)(-26) assuming z is positive. z(24439/187) Simplify (u/(uu/(u/(u(u/u*(-7))/u))))/(uu*(-5/8))(u(-1/16))(30/7) assuming u is positive. u(-121/14) Simplify (s(-22/3)/sss*(-17))/(ss*(-4/11)s/s(-5/8)) assuming s is positive. s(-7021/264) Simplify z16/z(-3)(z(-5)/z)(-1/23) assuming z is positive. z(443/23) Simplify (c(-2/5)/c(-3)c*(-2/3)/(c/(c/(c/(c/(c/(ccc3/c)))))))(-17/5) assuming c is positive. c(-1258/75) Simplify fff(ff/((ff*(-12))/f))/ffff(ff*(-5))/fff(f/f(2/3))(-1/17) assuming f is positive. f*(815/51) Simplify (((z/(z/(zz*(-3/7)))zz)/z(z*(1/2)zz)/z)/(z(-4)/z(1/6)))50 assuming z is positive. z(7600/21) Simplify (w(-4/5))(4/31)/(w8www/(ww(2/17)/w)) assuming w is positive. w(-28947/2635) Simplify (((aaa7)(-20))(-2/141))(-7/9) assuming a is positive. a(-280/141) Simplify ((p(-4/9)p(2/21)/p)/(p1/p)(-22))21 assuming p is positive. p(-85/3) Simplify (q3q/(q3/q))/(q11q0/q) assuming q is positive. q(-8) Simplify (xx(2/3)x/x*(-1)((x/x1)/x)(-15))(-5) assuming x is positive. x(-280/3) Simplify (((b/(b/(b/(b/(b*2b)))))/bb)(5/3)/(b(-1/2)b/b(-1/5)))(-50) assuming b is positive. b(-215) Simplify (((r(-1/3))42)(2/23))(-38) assuming r is positive. r(1064/23) Simplify (d(-4/25)/(d(1/2)/d))**(-1/51) assuming d is posi	{ "pile_set_name": "DM Mathematics" }
f(c) = -2c. Give h(f(w)). -8w Let j(l) = 13l - 4l + 7l + 5l. Let q(n) = -2n2. Calculate q(j(k)). -882k*2 Let o(n) = 19n - 8n - 13n. Let w(m) = 4m2 - 4m2 + m2. Give w(o(a)). 4a2 Let h(s) be the second derivative of -4s*3/3 - 8s. Let f(u) = -4u + 4u - 2u. Determine f(h(b)). 16b Let v(o) = 4o + 4 - 3o - 4. Let c(y) = 2 - 2y - 2. Determine v(c(f)). -2f Let z(o) = -12o2. Let s(t) = -28t - 10. Determine z(s(l)). -9408l2 - 6720l - 1200 Let s(x) = 2x + 6. Let u(k) = -2k. Give s(u(i)). -4i + 6 Let h(r) = -2r*2. Let k = 4 + 1. Suppose 20 - 50 = kg. Let i(l) = 3l - 2. Let v(f) = -16f + 11. Let z(t) = gv(t) - 33i(t). What is h(z(u))? -18u2 Suppose 3n - 5 = -4p + 3, 6 = 3p. Let r = 0 - n. Let m(l) = rl - l - l. Let j(w) = 5w*2. Give m(j(o)). -10o*2 Suppose k + 0k = 0. Suppose k = -4h + 2h. Let f(u) = 5u - 3u + hu. Let q(j) = -2j. Give f(q(y)). -4y Let q(f) = 11f*2. Let v(j) = -122j. Give q(v(d)). 163724d2 Let x(u) = 46u2. Let f(w) be the second derivative of w4/6 + 20w. Determine f(x(v)). 4232v*4 Let b(q) = -2q*2. Let k(s) = s - 6. Let v be k(8). Let w be v - (-3 + 1) - 2. Let u(d) = -4d*2 + 4d2 - dw. Calculate u(b(a)). -4a4 Let h(z) = 4z*2 - 7z - 7. Let i(a) = a*2 - 2a - 2. Let j(k) = -4h(k) + 14i(k). Let m(x) = 0x - 3x - x. What is m(j(v))? 8v2 Let s(c) = c. Let g(k) be the first derivative of 9k*2 - 5k*2 + 6 + 4k*2 + 0k*2. What is s(g(j))? 16j Let b(v) = 4v2 - 7v. Let c(f) = f*2 - 2f. Let z(m) = 4b(m) - 14c(m). Let x(i) = -24i. Let n(w) = 5w. Let j(k) = -14n(k) - 3x(k). Calculate z(j(r)). 8r2 Let w(f) = -22914f*2. Let x(h) = -h. What is x(w(r))? 22914r*2 Let x(w) be the third derivative of 0w + 3w2 + 1/12w*4 + 0 + 0w3. Let d(v) be the first derivative of v2 + 6. Calculate d(x(u)). 4u Let s(v) = 29v*2. Let n(b) = -b + 3. Let t(x) = 4x - 11. Let l(i) = -22n(i) - 6t(i). Give l(s(j)). -58j2 Let i(n) = -15141n. Let j(f) = -2f2. What is j(i(l))? -458499762l*2 Let g(d) be the third derivative of -3d*2 + 0d + 0d3 + 0 + 1/12d*4. Let c(w) = -w. What is c(g(i))? -2i Let f(p) = -3p + 4. Let h(k) = 8k - 11. Let a(o) = 11f(o) + 4h(o). Let y(q) = -2q. Let r(l) = -2l. Let g(j) = 3r(j) - 4y(j). Determine a(g(i)). -2i Let v(l) = -46l*2. Let a(t) = 16t. Give a(v(y)). -736y2 Let m(r) be the first derivative of -2r*3/3 + 2. Let w(o) = -2o*2 + 0o*2 + 5o*2. Give m(w(t)). -18t*4 Let s(t) = -11t. Let g(i) = 25i2. What is g(s(a))? 3025a*2 Let x(c) = -11c. Let j(i) = 13i + 29. Calculate x(j(p)). -143p - 319 Let d(m) = 3m + 0m - m. Let k(w) = 6w2. Give k(d(z)). 24z*2 Let y(n) = 2n*2. Let l(f) = 22f - 47f + 29f. Determine l(y(p)). 8p2 Let n(i) = 2i. Let u(p) = -514p2. Calculate u(n(a)). -2056a*2 Let v be ((-12)/(-15))/((-4)/(-10)). Suppose 3 = 3t - vt. Let u(o) = -t - o + 3. Let j(a) = -2a. Determine j(u(z)). 2z Suppose 3y - 2y + 3r = 7, y = -2r + 11. Suppose -5b = 4 - y. Let v(g) = 0g + 5g - bg - g. Let o(t) = 6t*2. Calculate o(v(u)). 6u*2 Let n(m) = -3m. Let d(q) = -5q. Let w(a) = 5d(a) - 8n(a). Suppose 2l = 5l + 3y - 33, y = 5l - 37. Let u(g) = -g + lg - g. Calculate w(u(p)). -6p Let j(s) = 2s. Let l = 9 + -4. Let i(m) = 3m2 - 5. Let u(q) = -q2 + 2. Let v(t) = lu(t) + 2i(t). Calculate j(v(h)). 2h*2 Let o(a) = 336a*2. Let c(w) = 14w*2. What is c(o(f))? 1580544f*4 Let t(l) = -l. Let z(y) be the first derivative of 3/2y*2 - 2 + 0y. What is z(t(c))? -3c Let r = -5 - -8. Let t(d) = rd - d + d. Let o(j) = -j. Give t(o(q)). -3q Let x(r) = r3 - 11r*2 + 10r + 4. Let o be x(10). Suppose -os + 3s = -2. Let b(m) = 0m2 - 3m*2 + sm2. Let z(i) = -i. Give z(b(a)). a2 Let z(o) = -2o. Let c(i) be the third derivative of -i4/24 + 4i*2. Calculate z(c(n)). 2n Suppose -r - 2n = -11, r + r - 17 = -3n. Let z = 1 + r. Let f(v) = -4 + 0 + zv2 + 4. Let h(m) = 2m. What is h(f(a))? 4a2 Let w(r) = 2r*2. Let h(v) = 5v - 6v + 0v. Give h(w(g)). -2g2 Let i(z) = 4z. Let p(d) = -651d2. Calculate i(p(v)). -2604v*2 Let x(h) = 9h. Let l(m) = 55m. Let w(p) = 8p. Let q(c) = 3l(c) - 22w(c). Determine x(q(f)). -99f Let k(s) = -14s*2. Let h(y) = 1. Let i(d) = -d - 2. Let r(z) = 2h(z) + i(z). Calculate r(k(f)). 14f2 Let q(a) = 2a. Let s(w) = -2867w2. Give q(s(o)). -5734o*2 Let s(i) = 2i. Let m(w) = -10w - 100. Calculate m(s(u)). -20u - 100 Let c(p) = -4p. Let i(n) = 3n*2 + 466 - 466. Determine c(i(g)). -12g*2 Let m(n) = 2n2. Let f(k) be the second derivative of -k3/3 + 4k. What is m(f(v))? 8v*2 Let w(z) = 5z*2. Let h(r) = -3r - 2. Let j(k) = k - 1. Let u(a) = -h(a) + 2j(a). Calculate u(w(g)). 25g*2 Let d(a) = -4a. Let t(g) = -2 + 2 - 4g2 + 0. Calculate d(t(m)). 16m2 Let h(n) be the first derivative of n2 + 1. Let k(z) = 2z2 - 4z*2 + 4z*2 - 4z*2. Calculate h(k(m)). -4m*2 Let u(h) = 5h*2. Let x(r) = -3r - 3r + 2r + 0r. What is u(x(m))? 80m*2 Let r(d) = 2d*2. Let y(s) be the first derivative of -3/2s*2 + 0s + 3. Determine r(y(h)). 18h2 Let l(k) be the second derivative of -5k*4/12 - 4k. Let f(a) be the third derivative of a*4/24 - 7a*2. What is l(f(n))? -5n*2 Let m(o) = -o. Let t(i) be the first derivative of -4 + 0i - 1/2i2. Determine t(m(h)). h Let q(j) = -3j. Let z = 7 + -5. Suppose 0u + 2u = 0. Let c(g) = zg + ug - g. Give c(q(k)). -3k Let x(y) = -2y*2. Let o(f) = -46f. What is o(x(k))? 92k2 Let q(z) = -3z. Let h(o) = -446o. Give q(h(v)). 1338v Let y(t) = -638t2. Let w(v) = -v2. Give w(y(f)). -407044f4 Let q(z) = 1301 + z2 - 1301. Let a(v) = 38v2. Calculate q(a(j)). 1444j*4 Let u(y) = -3y2. Let a(i) be the third derivative of i4/24 - 6i2. Give a(u(j)). -3j*2 Let g(p) be the second derivative of p - 1/4p*4 + 0 + 0p*3 + 0p2. Let w(k) be the third derivative of k4/12 + 2k2. Give w(g(r)). -6r*2 Let f(k) = -2k. Let n(p) = 4p2 + 10p + 2. Calculate n(f(v)). 16v2 - 20v + 2 Let n(p) = -p*2. Let l be ((-3)/7 - (-208)/273)2. Let q(t) be the first derivative of 0t2 - 1 + 0t - lt3. What is n(q(u))? -4u*4 Let y(j) = -2j. Let d(q) be the third derivative of -q*2 + 0 + 1/60q*5 + 0q*4 + 0q*3 + 0q. Give y(d(b)). -2b2 Suppose 0 = 4r - 11 + 3. Let k(s) = s - 2s - rs. Let z(t) = 0 + 6t2 - 4t*2 + 0. Calculate k(z(x)). -6x2 Let d(g) be the first derivative of g2/2 + 6. Let p(m) be the second derivative of m*3/6 - m. Give p(d(l)). l Let o(c) = -18c + 17c - 5c. Let t(h) = -3h. Calculate o(t(k)). 18k Let d(n) be the first derivative of -5 - n*2 + 1 + 0. Let o(a) = 2a. What is o(d(b))? -4b Let b(i) = -3i - 3i + 0i. Let x(s) be the first derivative of s6/360 + s3/3 + 4. Let z(n) be the third derivative of x(n). What is z(b(m))? 36m2 Let j = 5 - 0. Let q(p) = -2p*2 - jp*2 + 5p*2 + 3p2. Let f(x) be the third derivative of -x5/30 - x*2. Determine f(q(t)). -2t*4 Let w(r) = 7r*2. Let p(n) = 49 - 49 + n. What is w(p(z))? 7z*2 Let i(y) = -9 + 2 - 2y + 7. Let n(x) be the second derivative of x*3/3 + 2x. What is i(n(t))? -4t Let i(o) = -98o. Let g(h) be the third derivative of -h*4/24 - 19h*2 - h. Give g(i(p)). 98p Let d(k) = 1723k. Let r(u) = u. Determine r(d(i)). 1723i Let c(y) = -y*2. Let q(v) be the second derivative of -2v*3/3 - 6v. What is c(q(l))? -16l2 Let c(s) = -9s*2. Let v(k) = -24k + 24k + k2. Determine v(c(g)). 81g*4 Let a(i) = 231i*2. Let p(y) = 3y. What is p(a(g))? 693g2 Let n(m) = 7m*2 - 11m - 22. Let v(x) = 4x2 - 6x - 12. Let s(i) = -6n(i) + 11v(i). Let f(b) be the third derivative of -7b4/8 - 2b*2. Give f(s(q)). -42q*2 Let h(s) = -24s. Let w(f) be the third derivative of f*5/30 + 10f*2. What is h(w(u))? -48u*2 Let u(b) = 2b. Let y(n) = 2n - 6. Let t be y(4). Let h(c) = 8c*t + 2c - 2c + 0c. What is u(h(a))? 16a2 Suppose 0t - 16 = -2t. Let l(q) = -5q - tq + 11q. Let r(n) = n - n + 3n2. Determine r(l(d)). 12d*2 Let r(g) be the first derivative of 4g*3/3 - 1. Let j(l) = -2l*2 - 8l + 5l + 3l. Give j(r(h)). -32h*4 Let z(k)	{ "pile_set_name": "DM Mathematics" }
) -0.5 (c) -30 b Which is the nearest to -1/2? (a) -3 (b) -0.5 (c) -2 (d) -7/8 b What is the closest to -0.06 in 2, -5, 5, -0.4? -0.4 What is the nearest to 6 in 1, 1.3, -6.6, -3? 1.3 What is the nearest to -9 in 2/7, -1, 11/5? -1 Which is the nearest to -10? (a) 5 (b) -9 (c) -2/11 b Which is the nearest to 2? (a) -194 (b) -4 (c) 1/8 c What is the closest to -0.1 in 1/21, -1/4, -61, -4? 1/21 What is the closest to -1 in 1/7, 5, 0, -9.77? 0 What is the closest to 1 in -4, 3, 5.6? 3 Which is the nearest to -1/4? (a) 1 (b) -5 (c) 4 a What is the nearest to 2/4807 in 4, 4/3, 4/7? 4/7 Which is the nearest to -0.1? (a) 55 (b) -4 (c) 3 c What is the closest to 0 in 7, 0, 2/11, 0.1? 0 Which is the nearest to 1? (a) -0.1 (b) -1/5 (c) -1/6 (d) -2/5 a What is the nearest to -359 in -2/15, 5, -0.2? -0.2 Which is the closest to 1? (a) 3 (b) -0.57 (c) -3/5 b What is the closest to 3 in -2, 1/2, 0.4, 0? 1/2 What is the nearest to -2/5 in 1/24, 3, 120, 0.5? 1/24 What is the nearest to 3 in 0.2, -4.45, -2/9, -1/8? 0.2 What is the nearest to -2 in -2, 3, 0.1, -3/7? -2 What is the nearest to 155 in 0, 3, -1, -0.4? 3 What is the nearest to 8 in 4, -0.1, 2/9? 4 Which is the closest to 0? (a) 3/5 (b) 1.725 (c) -2 a Which is the closest to -0.2? (a) -1/4 (b) 0.4 (c) 15 (d) 5 a Which is the closest to -0.1? (a) 0.5 (b) 1/4 (c) 7 b What is the closest to 1/4 in 4, 0.05, -4? 0.05 What is the closest to 4 in -0.2, 0.03, 1/7? 1/7 Which is the closest to 0? (a) 0.3 (b) -4/7 (c) 1 a What is the closest to 10 in 0.3, -1/4, -3/250, 2/7? 0.3 What is the nearest to -3.35 in 2, -0.5, 1? -0.5 What is the closest to -1 in -0.4, -1.2, 5, 2? -1.2 Which is the closest to 9? (a) 4 (b) -1/9 (c) 6 (d) 2/19 c What is the closest to -4 in 3, -3, -4? -4 Which is the nearest to 21? (a) -3/5 (b) 6 (c) 0.1 (d) 0 b What is the nearest to 0 in 0.5, -6/7, 5, 0.07? 0.07 What is the closest to 57 in 4, -1/6, 0? 4 Which is the nearest to 3? (a) 2/3 (b) -2 (c) 4 c Which is the nearest to -0.2449? (a) 0.1 (b) -0.4 (c) 5/2 b What is the closest to -1/4 in 2/7, -1.6, -17? 2/7 What is the closest to 0 in 18, 6/95, -5? 6/95 Which is the nearest to -0.1? (a) -125 (b) -1/3 (c) -4 b Which is the closest to 2/5? (a) -0.3 (b) -0.6 (c) -2 (d) 1/2 d Which is the nearest to 0? (a) -1/4 (b) 1 (c) -2 (d) 38 a What is the closest to 1 in 119, -12, -1? -1 What is the nearest to 0 in 0.1, 0.3, -2/15, -14? 0.1 Which is the nearest to -1? (a) -0.3 (b) -1/3 (c) -2/19 (d) -5 b What is the closest to 0.2 in 2, 0.08, -53? 0.08 Which is the nearest to 2/17? (a) 3 (b) 27 (c) -8 a Which is the nearest to 0.1? (a) 3 (b) -2/99 (c) 2/5 b What is the closest to -0.3 in -2, 3, 0.13? 0.13 Which is the nearest to -29/12? (a) -1/11 (b) 5 (c) 0.3 a What is the nearest to 0 in -0.6, 2, 1? -0.6 What is the closest to 1 in 8, 0, 0.593? 0.593 What is the closest to 0.18 in -2/9, 0.04, -0.2, -2? 0.04 What is the nearest to 1 in 0.2, -3, -5, 0.1? 0.2 What is the nearest to 0 in 1/7, -4, 0, -1? 0 What is the nearest to 1/2 in 3/5, -1/4, 0.5, -4? 0.5 Which is the nearest to -0.1? (a) -1 (b) -4/7 (c) -0.2 (d) 0.5 c Which is the closest to -2/5? (a) -2 (b) -5 (c) -0.2 (d) 0.41 c Which is the closest to -0.1? (a) 0.3 (b) 8 (c) -3 (d) 4 a What is the closest to 11 in -2/3, -0.5, -3, 3/4? 3/4 What is the nearest to 1/3 in -4/5, 0, 1.57? 0 Which is the closest to -1/4? (a) 1 (b) 6/11 (c) -9 b What is the closest to -95 in 5, 2, 2/3? 2/3 Which is the closest to 2? (a) -0.3 (b) 2 (c) -18/7 b Which is the nearest to 1? (a) -10 (b) 0.6 (c) -0.2 (d) -0.3 b What is the nearest to 2 in -0.3, -1/4, 0.019? 0.019 What is the nearest to -2/5 in 3, -4, 0.5, -16? 0.5 Which is the closest to 0.2? (a) 5 (b) 0.4 (c) 139 b Which is the nearest to 2? (a) 4 (b) -1 (c) 19 (d) 3/7 d Which is the nearest to -0.2? (a) -0.2 (b) -0.1 (c) 1 (d) -22/5 a What is the closest to -3 in -67, 6, -1? -1 Which is the closest to -2? (a) -0.1 (b) 0.4 (c) 4/3 (d) -1/4 d What is the closest to -1/379 in 0.4, -2, -3? 0.4 What is the closest to 1 in -0.5, -68, 0? 0 Which is the nearest to -2/635? (a) 3/2 (b) 5 (c) 0.2 c Which is the closest to 8? (a) 0.4 (b) -4 (c) 0.34 a Which is the nearest to 0.1? (a) -4 (b) -0.5 (c) -0.2 (d) -0.4 c What is the closest to 3 in -1/3, -1, 2, -1/2? 2 What is the closest to 372 in 0.2, 1, 4, 5? 5 Which is the nearest to -45.7? (a) -2 (b) -1/2 (c) -3 c What is the nearest to 1 in 123, 3, -3, -3/2? 3 Which is the closest to 0? (a) 20 (b) -2/9 (c) 3 (d) 7 b What is the closest to 0.11 in -3/4, 2, 1/3, 0? 0 Which is the closest to 0.03? (a) 1/4 (b) 0.1 (c) -1 b What is the closest to -2/7 in 5, -2/3, -4, 3? -2/3 What is the nearest to 0 in 0.165, -1/3, -3? 0.165 What is the closest to -8 in -5, 3, 4/9, 0.3? -5 Which is the nearest to 1? (a) -0.3 (b) -2/9 (c) -49 b Which is the closest to 1/4? (a) 0.4 (b) 50 (c) -1 a Which is the closest to -0.8? (a) 1 (b) 94 (c) -2/5 c What is the nearest to -19 in -2/11, 5, 2? -2/11 What is the nearest to -0.1 in -4, 1/9, 5, 0? 0 Which is the closest to -0.02? (a) -1/5 (b) -3 (c) 1/4 (d) 2/19 d Which is the closest to 7? (a) 3/4 (b) -12/5 (c) 0.4 a What is the closest to -1 in -6/5, 3, 0, -2/19? -6/5 What is the nearest to -1/3 in 0, -13, 5/2? 0 Which is the nearest to -0.094? (a) 3 (b) 5 (c) 0.4 (d) 0.1 d What is the nearest to -0.5 in -1, 0.4, 0.02? -1 Which is the nearest to 8? (a) -2/3 (b) 2 (c) 0 (d) 4 d What is the closest to 198 in -1/8, 1, -2/7? 1 What is the nearest to 0.07 in -7/2, -1/20, 0.2, 0.4? -1/20 Which is the closest to 2/5? (a) -6 (b) -4 (c) 9 (d) -1/5 d What is the nearest to -0.1 in -3, -101, -3/7, -2? -3/7 Which is the nearest to -7? (a) 0.054 (b) -3/5 (c) -0.5 b Which is the nearest to 1? (a) 5 (b) 5/2 (c) 0.9 c What is the closest to 1 in 5, -1/5, -2/5? -1/5 Which is the nearest to -2/7? (a) 1/5 (b) -0.2 (c) -0.3 (d) 2 c Which is the closest to -4/7? (a) -2/11 (b) -0.36 (c) 4 b What is the nearest to -513 in 3, -0.4, -4? -4 Which is the closest to -1? (a) 11 (b) 2 (c) 65 b Which is the closest to -1? (a) -7/6 (b) -2 (c) 4 a Which is the closest to -7? (a) 0.1 (b) 2/11 (c) 0.01 c Which is the closest to 0? (a) 5/2 (b) -3/10 (c) 2/9 (d) 2/5 c Which is the nearest to 2? (a) 3/8 (b) 30 (c) 0 a Which is the nearest to -1/3? (a) 0.2 (b) 2/19 (c) -1/2 c Which is the closest to 0.1? (a) -4/5 (b) -37 (c) 8 (d) 3/5 d What is the closest to -0.06 in 7/2, -1.3, 1? 1 What is the closest to 0 in -0.2, -2/3, 10, 4/9? -0.2 What is the nearest to -0.2 in 2/89, -11, 5? 2/89 Which is the closest to -3? (a) 4 (b) -4 (c) -0.06 (d) 2 b What is the nearest to 2/7 in 1.7, 4, 0.4? 0.4 What is the nearest to -1/4 in -2/7, -7/8, -1, 2/11? -2/7 What is the closest to 0.2 in -1, 3, -0.5, 0.12? 0.12 What is the nearest to 1 in -0.5, 1/6, 0.2, -25? 0.2 What is the nearest to 1/4 in -2/9, 1/6, -200/7? 1/6 What is the closest to -2 in 0.05, -7, -5? 0.05 What is the closest to -2 in 0.5, -0.3, -1/4, -10? -0.3 What is the nearest to -0.04 in -134, 0.5, 0.3, -0.2? -0.2 What is the closest to -5 in -2, -1, -4/5, -5? -5 What is the closest to -1 in 2.7, 3/8, 3, -1/2? -1/2 Which is the closest to 2/11? (a) -0.5 (b) -4 (c) -29 (d) 1/3 d Which is the closest to -2.2? (a) -2 (b) -0.5 (c) 1/10 a Which is the closest to 14? (a) -1 (b) 0.2 (c) -0.6 (d) -1/3 b Which is the nearest to -2/7? (a) 1 (b) -0.5 (c) -0.0496 b Which is the closest to 2/25? (a) -17 (b) -0.2 (c) 0 c Which is the closest to 3? (a) -121 (b) -3/5 (c) 5 c What is the nearest to -6 in -12, 4, -4, -5? -5 Which is the closest to -5/4? (a) -4/3 (b) -1.9 (c) -0.5 a What is the closest to 1 in -4/7, -1, -15? -4/7 What is the closest to -1 in -2/13, 1, -2, 4? -2/13 Which is the nearest to 1? (a) 1 (b) 0.15 (c) 10 a Which is the nearest to 1/2? (a) 6 (b) 0 (c) 98 b Which is the closest to -1/3? (a) -1 (b) 1.1 (c) 0.2 c Which is the closest to 1/7? (a) -0.041 (b) 5 (c) 1 (d) -1 a What is the closest to -2 in 4, 0.3, -0.4, -16? -0.4 What is the nearest to -2/5 in 2/13, 5, 0.25? 2/13 Which is the nearest to -1? (a) -5 (b) 0 (c) -51 (d) -3 b Which i	{ "pile_set_name": "DM Mathematics" }
is k rounded to the nearest one thousand? 12000 Let h = 73 - 45. Let w = -32 + h. Let v = -22.2 + w. What is v rounded to 0 decimal places? -26 Let m = -0.2664 - -205.1664. Let y = m + -208. Round y to one decimal place. -3.1 Let r = 12597 - 2590. Let f = r + -10006.9995261. What is f rounded to four dps? 0.0005 Let p = 84 - 23. Let l = p - 34. Let d = -27.0000001 + l. What is d rounded to 7 decimal places? -0.0000001 Let p = -1018 - -1187.4. Let j = 137 - p. Let s = j - -32.39517. Round s to three dps. -0.005 Let g = -164164 + 164163.770019. Let y = -44 + 44.23. Let l = y + g. What is l rounded to five decimal places? 0.00002 Suppose 7h - 4h = 879. Let r = h - 91. Let b = -138 + r. What is b rounded to the nearest ten? 60 Let y = 147156 + -147791.09. Let h = y - -647. Round h to the nearest integer. 12 Let s = 218.216846029 - -11.583149623. Let q = s - 229.8. What is q rounded to six decimal places? -0.000004 Let s = 341555 - -756267. Let z = 1097823.61000415 - s. Let d = -1.61 + z. Round d to seven decimal places. 0.0000042 Let p = 10870.010666 - 10870. Round p to 3 dps. 0.011 Let m = -6251 + 25646. Suppose -m + 67245 = 2b. Suppose -3u + b = -138375. Round u to the nearest 1000. 54000 Let p = 194.35 + -2.35. Let x = p - 191.999423. Round x to five decimal places. 0.00058 Let z = -0.0626 - -0.1272. Let o = z + -107.2646. Round o to the nearest 10. -110 Let o = 80479 - 80478.952021. What is o rounded to three decimal places? 0.048 Let p = 51567202602.54864223 + -55276061062.0486441. Let z = p - -3708858789.5. Let v = z - 330. Round v to six decimal places. -0.000002 Let k = -168865 + 106115. Round k to the nearest 10000. -60000 Let y(s) = -9s3 - 30s*2 - 14s + 120. Let z be y(-52). Round z to the nearest one hundred thousand. 1200000 Suppose -7 = -5q - w, -q - w = -4 + 5. Suppose -2d - 3 = k, -7d = -4k - qd + 27. Let j be (k - 7) + (-946 - 0). Round j to the nearest one hundred. -1000 Let r(k) = 3214k + 10. Let y be r(3). Suppose -h - 10648 = y. Round h to the nearest 10000. -20000 Let a(l) = 288926l3 - 8l*2 + 24l - 2. Let v be a(3). Round v to the nearest 1000000. 8000000 Let o = -1443 - 2852. Let v = o + 4294.6147. Let p = v - -0.412. What is p rounded to three decimal places? 0.027 Let n = -0.002 - 4.398. Let g = -42.3 - -38. Let k = n - g. What is k rounded to the nearest integer? 0 Let w = 8097 + -4262. Let t = w - 6845. Round t to the nearest one hundred. -3000 Suppose -3t + 2j + 79 = 0, 4j + 129 = t + 4t. Let u be (2 + 9/(-3))0. Suppose tg - 25g + 12000000 = u. Round g to the nearest one million. -3000000 Suppose -3x - 582 = -5r + 103, 2x + r + 474 = 0. Let q(z) = -6z + 49. Let g be q(-3). Let m = x + g. Round m to the nearest 10. -170 Let o = -16476 - -16663.38. Round o to zero dps. 187 Let w = 49.65370435 + -49.655. What is w rounded to five decimal places? -0.0013 Let u = -21.972 - -18.4. Let o = u + 4.1. Round o to 1 dp. 0.5 Let s = 803 - 802.9639. Let v = 113.9361 - s. What is v rounded to the nearest 10? 110 Let q = 57 - 56.59. Let r = -6.39 - q. Let v = r + 6.800245. What is v rounded to five decimal places? 0.00025 Let o = 20.7207708017 - 105.3207704287. Let n = 686 + -770.6. Let m = n - o. Round m to 7 decimal places. -0.0000004 Let p = 2824 - 2503.2. Let j = -146.4 + p. What is j rounded to the nearest ten? 170 Let u be 1/((-2)/(-16)) + -4. Let g = 3333 - 1839. Suppose -ul - g = 1226. Round l to the nearest 100. -700 Let r = 16168.9999909632 - 16169. Round r to six decimal places. -0.000009 Let g = -8511.99993804 - -8512. Round g to 6 decimal places. 0.000062 Let d = 124.687 - 123.9. Let z = d + -0.77773. What is z rounded to three dps? 0.009 Let h = -596.9 - 220. Round h to the nearest ten. -820 Let p = -151303641933.463 - -203229841.463. Let m = p - -151100410955.999999499. Let l = m - -1136. Round l to 7 dps. -0.0000005 Let g be (-2)/(1 + (-476)/474). Suppose 475s - gs = 667. What is s rounded to the nearest one hundred? 700 Let u = -121 - -130.1. Let p = 63897.95 + -63907.049963. Let q = u + p. Round q to 5 dps. 0.00004 Suppose 31f - 11f - 40 = 0. Suppose 5p - 29250008 = 4v, -fp = p + 2v - 17549996. What is p rounded to the nearest one million? 6000000 Let k = -9.26 - -426.26. Let i = -417.309 + k. What is i rounded to 2 decimal places? -0.31 Let y = -24.26 + 23.4255. What is y rounded to 1 decimal place? -0.8 Let l = -2541.000001766 - -2541. What is l rounded to six decimal places? -0.000002 Let j(c) = -809c + 4066. Let v be j(46). Round v to the nearest 1000. -33000 Let w = -9161.999674 - -9162. Round w to 2 decimal places. 0 Let t = 16.588 - -7.688. Round t to one dp. 24.3 Let h = -1431276 + 1431044.0522. Let w = 0.0522 - h. Let m = 231.99999513 - w. Round m to 6 decimal places. -0.000005 Let p = 1739.7 + -1565. Let g = -19.3 - p. Let k = g - -193.9999332. What is k rounded to five decimal places? -0.00007 Let p = -14561 + 14570.183. Round p to zero decimal places. 9 Let x = -12919.82 - -13032. Round x to the nearest ten. 110 Let l(u) = -2334u*3 + 2u*2 - 5u + 3. Suppose -19 + 37 = -6w. Let t be l(w). Let m = -189054 + t. What is m rounded to the nearest ten thousand? -130000 Let f = 37 - 36.63. Let l = f - -1.51. Let c = -1.8244 + l. Round c to 2 dps. 0.06 Let y(w) = w3 + 7w*2 + 6w - 17. Let i be y(-5). Suppose m + iz + z + 4440012 = 0, -4m - 5z - 17760015 = 0. Round m to the nearest one hundred thousand. -4400000 Let g = 31443108.9100101 - 31442932.91. Let u = -176 + g. Round u to 6 decimal places. 0.00001 Let f = 20 - 1769.8. What is f rounded to the nearest ten? -1750 Let j(u) be the second derivative of 3288895u*3/6 + 165u*2/2 - u - 27. Let t be j(-27). Round t to the nearest 1000000. -89000000 Let y = -0.185644 - 410.409356. Let d = y + 411. What is d rounded to two dps? 0.41 Let s = -15794 + 16695.9. Round s to the nearest one thousand. 1000 Let k = 0.134 + -6.234. Let c = 17.5 - k. Round c to the nearest 10. 20 Let c = -185076.499 - -184992. What is c rounded to zero decimal places? -84 Let m = -2.9825 - -2.932065. What is m rounded to three dps? -0.05 Let x = -93041.24602 - -93043. Round x to one dp. 1.8 Suppose 5p = 4t - 965612, 5p + 965588 = -7t + 3t. What is p rounded to the nearest one thousand? -193000 Let c be 2(-3)/662/(-2). Suppose 0 = 5d - 29 - c. Let z be 1/4 - (5175/d)/(-15). Round z to the nearest 10. 30 Let v = -16973.969 - -16976. What is v rounded to one dp? 2 Let a = 3124.7137 + -3125. What is a rounded to 2 decimal places? -0.29 Let b(v) = -2v*2 + 26v - 61. Let p(a) = 5a2 - 51a + 125. Let s(g) = 7b(g) + 3p(g). Let r be s(-20). Round r to the nearest one hundred. -200 Let l = 0.114364 - -9067.785636. What is l rounded to the nearest one hundred? 9100 Suppose 8820000000 = -30v - 3v - 23v. Round v to the nearest one million. -158000000 Let v(n) = 1388237n - 23. Let q be v(-3). Let r = 3495266 - q. What is r rounded to the nearest one million? 8000000 Let q(n) = n*3 + 9n*2 + 23n + 73. Let s be q(-7). Let i be 10/(-6)108(s + 0). What is i rounded to the nearest 100? -1800 Let l = -30 - 36. Let r = -39 - l. Let i = r + -27.00078. Round i to 4 dps. -0.0008 Suppose 21x + 26296 - 292576 = 0. What is x rounded to the nearest 10000? 10000 Let j = 4328 - 1322. Let z = 3005.8269 - j. Round z to two dps. -0.17 Suppose 12m - 76340 = -8m. Let w = m + -6707. What is w rounded to the nearest 100? -2900 Let f = -2696.2254 - -1.0254. What is f rounded to the nearest 1000? -3000 Suppose 5z + 5h = -20945005, -22z = -24z - h - 8378001. Round z to the nearest one million. -4000000 Let g = 218 - 98. Let j = g + -68. Let k = j + -51.999979. Round k to five dps. 0.00002 Let u(q) = 2q + 83q2 - 8 - 3q - q - 4q2 + 3q. Let g be u(-28). Round g to the nearest 10000. 60000 Let y = 44.29 + -45. Let g = -9.29 + y. Let m = g + 9.924. What is m rounded to two decimal places? -0.08 Let c = 60 - 59.63. Let p = c - 0.3700059. Round p to 5 decimal places. -0.00001 Let r = -107.1 - 55.5. Let p = r - -118. What is p rounded to the nearest 10? -40 Let o(k) = -411*k - 3. Let s be o(-4). Let a = s + -3640. Let g = a + 1179. What is g rounded to the nearest 100? -800 Let d = 7349.42 - 7337. What is d rounded to zero decimal places? 12	{ "pile_set_name": "DM Mathematics" }
third derivative of c*6/120 - 17c*5/60 - 13c*4/8 + 13c*3/3 + 1832c*2 - 2c + 1. Give w(19). 7 Suppose 0 = -3l - 5d - 284 + 249, -5l + 2d = -14. Let t(w) be the third derivative of 35w2 - 1/24w*4 + 1/30w*5 + 0 + lw - 1/6w3. Calculate t(2). 5 Let x(n) be the second derivative of n5/20 + n4 + 9n*2/2 + 15n + 1. Let j be ((-144)/40)/((-3)/20-2). What is x(j)? 9 Let y(w) = w2 + 9w + 43. Let n(p) = -p*2 - 9p - 35. Let u(x) = 5n(x) + 4y(x). Let i be 4/(-12) - (-2 - (-17)/3). Give u(i). 17 Suppose -4f + 63 = -5v, -15v + 7 = -20v - 4f. Let x(t) = -2t*3 - 13t*2 + 7t + 1. Calculate x(v). 1 Let c(s) = -s*3 - 9s*2 - 2s - 13. Let j be (-6)/4(-6 + 3 - -1). Suppose -jw + 3k = -0k + 12, 0 = -4w + 2k - 26. Calculate c(w). 5 Let d(t) = -t*2 - 3t + 8. Let m be ((-26)/65)/((-2)/(-10)). Let v be (-5 + (-126)/(-30))5. Let f = v + m. Determine d(f). -10 Suppose 19g - 4a + 4 = 23g, -3g + a = -15. Let f(r) = -3r*2 - 5r + 5. Calculate f(g). -63 Let v(w) = 530w2 - 5w + 522w2 + 528w*2 - 5w + 15 - 1581w2. What is v(-16)? -81 Suppose -5q - 4t + 13 + 11 = 0, -3t = -2q + 5. Let k(n) = 6n*2 - 25n + 10. Calculate k(q). 6 Let j(w) be the second derivative of w5/5 - w4/4 - w*3/2 + 2w*2 + 3436w. Give j(-2). -34 Suppose -514 = -3q + 161. Suppose -215y + qy - 40 = 0. Let a(p) = 4p - 3. Give a(y). 13 Let h(m) = -m*3 + 4. Suppose 19d - 15d - 12 = 0. Suppose -dr = 48 - 63. Suppose rf + 15 = -5j, -3f + 0f - 6 = 2j. Give h(f). 4 Let v = -423 + 429. Let q(u) = u3 - 3 + 4u*2 + 4u - 3u + v - 2. What is q(-4)? -3 Let y(f) be the third derivative of f6/120 - 7f*5/30 - 17f*4/12 + 17f*3/3 + 79f*2 + 12. Give y(16). 2 Suppose 0 = -25x + 31x + k - 62, 71 = 5x - 4k. Let a(p) = -5p + 45. What is a(x)? -10 Suppose -3g + 2g + 7g = 0. Suppose g = -2s + 4s + 2. Let z(k) = -17k3 + k2 + 2k + 1. What is z(s)? 17 Let u(n) = -2n - 8. Suppose 48 + 44 = 4f. Suppose fl - 36 = 29l. Determine u(l). 4 Let k be (((-480)/25)/8)/(27/(-90)). Let c(m) = m3 - 8m*2 + 2m - 28. Determine c(k). -12 Let o(k) = 2k2 + 28k - 9. Let u be o(-14). Let r be 2/(-2) + ((-24)/8 - u). Let v(s) = s - 11. What is v(r)? -6 Let k = -10327 + 10335. Let a(t) = -t + 43. Give a(k). 35 Let c = 44 + -30. Let g be c/(-70) + 28/(-10). Let b(t) = 12t + 4 - 2t - 5t + t2. Give b(g). -2 Let s = 59 + -49. Let y(p) = p - 9. What is y(s)? 1 Let u be 1 - 3 - (-1 - 1). Let a(l) = 231 - 3l*3 - 5l*2 - 2l*2 - 2l - 280. Let x(j) = -j*3 - 3j*2 - j - 24. Let p(t) = 2a(t) - 5x(t). Give p(u). 22 Let v(x) = x2 + 16x + 54. Suppose 0 = -241p + 273p + 128. What is v(p)? 6 Let q(f) = -2f3 - f2 - f. Let o be q(-1). Suppose -3v = oc + 14, 0 = -c - 3v + 7v - 7. Let i(s) = -2s*2 - 15s - 8. What is i(c)? -1 Let l(q) = -q*3 + 2q*2 + 61q + 15. Let b(t) = t*2 + 3t + 11. Let n be b(-2). Let r be l(n). Let g(m) = m*3 + 2m*2 - 4m - 3. Determine g(r). 0 Let b(w) = 22w2 + 14 - 17w + 130w + 4817w*3 - 4816w*3. Calculate b(-8). 6 Suppose -2j = -11j + 94 - 166. Let v(i) = 6i + 34. What is v(j)? -14 Suppose 0 = -5r - 9o + 5o + 41, -4r - 5o + 31 = 0. Let p(l) = -199l*3 - rl*2 + 7l*2 - 3l - 2 + 200l3. Determine p(3). -2 Suppose 9v - 11v - 4u = 0, 2u = 4v - 10. Let m(q) = -q*v + 952 - 3q - 1901 + 951. Let p be (-2)/(-8) - 63/12. Give m(p). -8 Suppose 3i - 31 = -176a + 181a, 5i + a - 5 = 0. Let v(r) = -4r + 16. What is v(i)? 8 Let r(z) = 10z*2 + z + 1. Let a be ((-7)/((-7)/3))/(6/4). Let c be (-1)/(-3 + a + 2). What is r(c)? 10 Let s(i) = -5i*3 - 12i2 - i + 4. Let y(j) = j3 + j*2 - j - 1. Let f(k) = -s(k) - 6y(k). Suppose 2o = -13o + 105. Calculate f(o). 2 Suppose -19h - 68 = -23h. Suppose -4x - y + 16 = 0, -3y - h = -3x + 10. Let z(b) = 7b*2 + xb + 0b2 - 7b - b3 - 1 - b2. What is z(5)? 14 Let d(g) = g*2 + 18g + 46. Let a(i) = 2i2 + 58i + 393. Let m be a(-12). What is d(m)? 1 Suppose -3k = -3r, -1 = k + 3r + 3. Let g be (56 + -1)/(-5) - k. Let v be (((-32)/g)/4)/(16/40). Let u(i) = 3i*2 - 3i + 3. What is u(v)? 9 Let u(r) = -r*3 - 2r*2 - 3r. Let b be ((-2 - -1) + 0)((7 - 3) + -2). Give u(b). 6 Let q(b) be the first derivative of 56 - 9/2b*2 - 1/4b*4 - 14b + 11/3b3. Give q(10). -4 Let h(i) = -119i. Let m(g) be the second derivative of 7g3/6 - g. Let y(j) = -2h(j) - 35m(j). Let s = -124176 + 124175. What is y(s)? 7 Suppose -1594 = -90u + 22 + 4. Let g(q) = -q*3 + 18q*2 - 3q + 25. Give g(u). -29 Let p = 1448 + -1454. Let i(j) = j*3 + 5j*2 - 9j - 15. Let t be i(p). Let k(l) = 3l + l3 - 4 - 2l*3 + l. What is k(t)? -19 Let l(q) = -3q*2 - 2q - 3. Let x(w) = 3w2 + w + 3. Let j(s) = -3l(s) - 2x(s). Suppose -a - 2v = 3a + 16, 4a = v - 4. Give j(a). 7 Let c(d) be the second derivative of d*4/6 - 7d*3/6 - 53d*2/2 - 86d. Let v(z) be the first derivative of c(z). Calculate v(5). 13 Let h(v) = v*3 - 21v*2 - 2v + 16. Let o = 4706 + -4685. What is h(o)? -26 Let x(f) be the third derivative of -f4/4 + f3/6 + f*2. Suppose 99m - 31m = -136. Determine x(m). 13 Let h(w) = -3w*2 + 8. Let i(m) = -7m*2 + m + 18. Let s be (-1)/1-5 - (7 + -4). Let c(z) = si(z) - 5h(z). Suppose 0b = -2b - 8. Calculate c(b). 4 Let t(r) be the third derivative of 17r4/12 + 211r*3/6 + 71r*2 + 2. Calculate t(-6). 7 Let g be 2230/36 - 11/33. Suppose 3a - 21 = -j, -2j + 11 = 4a - 21. Suppose 0 = -jv - 30 - g. Let w(d) = d*3 + 9d*2 + 7d - 2. What is w(v)? 6 Let j be -2 + 300/32 + (-228)/608. Let q(p) = 5p - 44. Give q(j). -9 Let p(h) = h2 - h - 2. Let w be p(3). Suppose -5n - 30 = -wt, 15n = 11n + 2t - 18. Let i(j) = -2j3 - 2j*2. What is i(n)? 8 Let p be 2 - (-46 + 2)(3 + 54/(-24)). Let r(t) = t*3 - 36t*2 + 36t - 78. What is r(p)? -43 Let w(n) = -6n3 + n. Let k be (14/(-6))/(4/204). Let a = 120 + k. Give w(a). -5 Let m(c) = c - 28. Let n(k) = -6k*2 - 10k + 81. Let v(h) = -3m(h) - n(h). Give v(-2). 13 Let l = -44 + 47. Let c(b) be the second derivative of b4/6 - 5b3/6 - b2 + 11b - 3. Give c(l). 1 Let s(p) = 7p*2 - 61p - 24. Let h = -16675 - -16684. What is s(h)? -6 Let f = 34 - 21. Suppose -fm + 112 = 151. Let g(q) = 2q - 3. Determine g(m). -9 Let t(l) = 0 + l*2 + l + 5 - 2 + 5. Let x = -182 - 361. Let k = x + 543. What is t(k)? 8 Suppose 14426 + 9899 = -5a. Let c be 48/(-22) - -2 - a/77. Let i = -62 + c. Let b(g) = 9g3 + g2. Give b(i). 10 Suppose 4n - 7 = 3u - 8, u = -4n + 11. Let g(o) = -no2 + 286o - 1 - 283o - 4o2. Determine g(1). -4 Let j(s) be the second derivative of s4/12 - s*3 - 1207s. Let q(a) = -a + 3. Let o be q(3). Let v(r) = r*2 + r + 6. Let i be v(o). Give j(i). 0 Let w = 18 + -16. Suppose -17l + w = -16l. Suppose -l + 8 = 3h. Let x(v) = v*2 - 2v + 1. Calculate x(h). 1 Let c(x) be the third derivative of -46x2 - 1/12x*4 + 0x + 7/6x3 + 0. Calculate c(4). -1 Let r(y) be the third derivative of -5y*4/24 - 5y*3/6 + 57y*2 - 40y. Calculate r(-7). 30 Suppose 11j + 9j - 3j + 68 = 0. Let s(f) = 35f + 140. Give s(j). 0 Let z(d) be the second derivative of 0d2 + 1/24d*4 + 1/40d*5 + 29/6d*3 + 0 + 26d. Let o(s) be the second derivative of z(s). What is o(-2)? -5 Suppose -403z = -406z - 2l - 1, -20 = -3z - 5l. Let s(o) be the first derivative of o3/3 + 3o*2/2 - 2o + 3. Calculate s(z). 8 Let c(t) be the third derivative of -t*4/12 - 53t*3/6 + 3327t*2. What is c(-23)? -7 Let k be (8 + 49/(-14) + -6)(1 + -3). Let q(i) = 2i2 + i + 1. Determine q(k). 22 Let c(r) = 2r - 19. Suppose 5a - h = 39, 3a + 4h - 514 + 486 = 0. Calculate c(a). -3 Let u be -1 - -3 - (30/6 + -8). Suppose 0 = -ud - 15, -k + 0d - 3d = 11. Let w(x) = -x*3 - 3x2 + 1. Calculate w(k). -3 Let j(n) = n2 - 11n + 2. Suppose 0c - 19c = 95. Let s(f) = f3 + 3f*2 - 8f + 21. Let r be s(c). Give j(r). 2 Let c = -35754 - -35754. Let n(m) = -m3 + m2 - m - 41. Calculate n(c). -41 Let t = -14751 + 14744. Let x(k) = -13k2 - 93k - 6. Determine x(t). 8 Let f(r) = -14r + 4 + 12r + 2r - 19 + 4r. Calculate f(11). 29 Let b(i) = -i*3 - 41i*2 - 131i - 646. Let s be b(-38). Let l(m) = -21*m - 5	{ "pile_set_name": "DM Mathematics" }
585 = 3n. Let a be 63/13 + (-18)/n. Suppose -q = -aw - 0q + 225, w - q = 45. What is the remainder when w is divided by 16? 13 Let j = 64 + -35. Suppose -i = -0i - j. Let p = -4371 + 4513. What is the remainder when p is divided by i? 26 Suppose 4i - 1246 = -2v, 0 = -5v - 249 + 244. What is the remainder when i is divided by 45? 42 Let w(h) = h2 - 79h + 184. Calculate the remainder when 306 is divided by w(0). 122 Suppose -l + 82 = 3t, t - 278 = 11l - 14l. Let v(n) = -n2 - 7n - 2. Let a be v(-7). Let r = a - -18. Calculate the remainder when l is divided by r. 14 Suppose -o + 285 = 291, 0 = -4h - 5o - 14. What is the remainder when 44 is divided by h? 0 Let k(a) = -a*3 + 14a*2 + 69a - 175. What is the remainder when 385 is divided by k(-7)? 14 Suppose 2u + 3o = 104, 2u + 5o - 83 = 21. Let s = 1125 - 1112. What is the remainder when u is divided by s? 0 Suppose 48c = 29925 + 193371. Calculate the remainder when c is divided by 99. 98 Calculate the remainder when 67838/107 + (-2)/(-9) + (-7)/(-9) is divided by 58. 55 Let i = -5535 + 5560. Calculate the remainder when 3324 is divided by i. 24 Let k = -26344 - -26594. What is the remainder when 1502 is divided by k? 2 Let g(f) = 6f + 102. Let j be g(-14). What is the remainder when 97 is divided by (-4 + j/4)86? 11 Suppose 0 = -20v + 1847 - 587. Calculate the remainder when 97 is divided by (3 + (-40)/15)v. 13 Let w = -1848 + 2081. What is the remainder when w is divided by 8? 1 Let i be ((-7730)/(-55) + 24/(-44))9. Suppose -7g - 21g = -i. Calculate the remainder when 177 is divided by g. 42 Let q = 26 + -26. Suppose 3r - 4 = 2m - 3m, 4r - 4m = q. Let l(z) = z3 + 5z*2 + 3z - 2. Calculate the remainder when l(-4) is divided by r. 0 Let x = -647 + 777. Suppose -o - 235 = -4p, -p + 302 = 4p - 4o. Let l = p + -39. Calculate the remainder when x is divided by l. 16 Suppose 5w = 5x - 475, -645 = -3x + 5w - 358. What is the remainder when 298 is divided by x? 16 Let g = -48 + 85. What is the remainder when 1044/6 + (2 - -8) is divided by g? 36 Suppose 3l - 24 = -v - 0l, 5v = -4l + 65. Suppose -d = -8 - v. Let s = -1280 + 1328. Calculate the remainder when s is divided by d. 14 Let i = -257 - -151. Let h = -802 + 945. Let k = i + h. Calculate the remainder when k is divided by 10. 7 Let f = -43 + 53. Let n(u) = -2u3 - u2 + 3u + 2. Let r be n(-2). Let k = r + 11. Calculate the remainder when k is divided by f. 9 Suppose 48o - 1134 = 86o - 56o. Calculate the remainder when 3331 is divided by o. 55 Suppose -89v + 3186 = -1887. Calculate the remainder when 1021 is divided by v. 52 Let j = -3882 - -4252. What is the remainder when j is divided by 130? 110 Let m(o) = -o3 - 7o*2 - 8o + 4. Let y be (-27)/4 + 183/244. What is the remainder when 41 is divided by m(y)? 9 Suppose 0 = t + l + 271, t + 4l + 325 = 66. Let k = t - -299. Calculate the remainder when k is divided by 13. 11 Calculate the remainder when 2(210/112 + (-3)/(-24)) is divided by 4. 0 Let m(d) = d*3 - 6d*2 + 8d - 27. Let v(b) = -3b. Let s be v(-2). Suppose -4g + 9 = -35. Calculate the remainder when m(s) is divided by g. 10 Calculate the remainder when -1110/(-165) + 9402/18 is divided by 139. 106 Let h be (-140)/(-6)513/95. Let l = -50 + h. What is the remainder when l is divided by 25? 1 Suppose 29r - 110r + 1782 = 0. What is the remainder when (-956)/(-9) + (-4)/18 is divided by r? 18 Let x = 2973 + -2841. Calculate the remainder when x is divided by 36. 24 Suppose -36x - 199x - 1545 = -15645. Calculate the remainder when x is divided by ((-2)/3)/(18/(-729)). 6 Suppose -17 = -4a + 4o + 7, -4a + o + 15 = 0. Suppose ar = 48 - 33. Calculate the remainder when r is divided by 3. 2 Let s(w) = -w*2 - 25w - 14. Let h be s(-22). Suppose 0 = -4i + h - 28. Suppose -133 = io - 7o. Calculate the remainder when o is divided by 34. 31 Calculate the remainder when 2/(6/21) + 4 is divided by (-68)/374 + 7 + -7 - (-158)/22. 4 Let x(w) be the first derivative of -33 - 1/4w*4 + 8/3w*3 + 0w + 11w2. Calculate the remainder when 32 is divided by x(10). 12 Suppose -80w = -75w - 50. Suppose -wk = -16k + 66. Calculate the remainder when 26 is divided by k. 4 Let l = 5 + -1. Calculate the remainder when (121/11 - -48) + -9 is divided by ((-1)/(-3))/(l/132). 6 Suppose 0 = -7t + 92 - 1254. Let f = -84 - t. What is the remainder when f is divided by 42? 40 Suppose -26q + 15q = 297. Suppose 235 = 4h + 3c, c + c = h - 67. Calculate the remainder when h is divided by ((-2)/6)/((-9)/q) + 32. 30 Suppose 0 = -19z - 112 + 74. What is the remainder when 21 is divided by (-10)/z + (6 - 5)? 3 Suppose 11q + 629 = -636. Calculate the remainder when (q/2)/((-17)/34) is divided by 24. 19 What is the remainder when (-24)/112 + (-49017)/(-14) is divided by 17? 16 Let u = 297 + -268. Suppose -416 = 3r - ur. Calculate the remainder when 62 is divided by r. 14 Suppose 27 = z + 24. Suppose zm - 410 = -2m. What is the remainder when m is divided by 22? 16 Let w be 1/((-30)/70(-2)/6). What is the remainder when 98 is divided by 7(-6 + w + 4)? 28 Let f(h) = h*3 - 2h*2 - 11h - 8. Let c be f(8). Suppose 9g - 18g = -c. What is the remainder when g is divided by (-3)/(-9)-5-3? 2 Suppose 5j - 2w + 154 = 0, -34 = j + 3w - 5w. Let c(u) = 6u + 16. What is the remainder when c(11) is divided by (3766/105 - -6) + (-4)/j? 40 Suppose b + 10 = 50. Suppose 26r = 11698 - 11126. What is the remainder when b is divided by r? 18 What is the remainder when 1128 is divided by (-5)/(20/(-12))70/42? 3 Let z = -5088 - -5135. Calculate the remainder when 3090 is divided by z. 35 Suppose i - 3b + 17 = 66, 4i = -3b + 226. Suppose -n + 3d - 2d = -15, -2d = 2. What is the remainder when i is divided by n? 13 Suppose -y - 4094 = 22y. Suppose -428 = -4c + 8c. Let q = c - y. Calculate the remainder when q is divided by 25. 21 Let f = 11018 - 10957. What is the remainder when 3537 is divided by f? 60 Let j(s) = -5s3 - 82s*2 - 27s + 123. What is the remainder when 2750 is divided by j(-16)? 41 Let h = -664 - -668. Suppose 4q + 61 = hl + 5, 0 = l - 3q - 20. What is the remainder when 64 is divided by l? 9 Let a = 97 + -23. Let o be (-32)/(-3) + 2/6. Calculate the remainder when a is divided by 17 + o + -3 + 1. 22 Let u = -16287 - -26061. Calculate the remainder when u is divided by 188. 186 Let g(r) = -r3 - r2 + r - 2. Let n be g(-2). Suppose -4j - j = n. Suppose z - 18 - 85 = j. What is the remainder when z is divided by 52? 51 Suppose -70a + 363a - 14868 = -61a. Calculate the remainder when a is divided by (-4 + 10/4)-6. 6 Suppose 6y - 5y + 2 = 0. Let c be 53 - ((1 - -2) + y). Suppose 0 = -cn + 48n + 192. Calculate the remainder when n is divided by 10. 8 Let l = 25448 + -25313. Suppose 3c + 4n = 54, c - 2n - 20 = -4n. What is the remainder when l is divided by c? 9 Suppose -152 = -6j + 670. What is the remainder when j is divided by 36? 29 Let b(l) = l3 - 9l*2 + 10l + 15. Let c(g) be the first derivative of g*2 - 32g + 24. Let d be c(20). Calculate the remainder when 122 is divided by b(d). 29 Let y(w) = w*3 + 7w*2 + 13w + 36. Calculate the remainder when 2939 is divided by y(-5). 20 Let o = 18 - -7. Suppose -56 = -3v + o. Suppose 20 = -4w, 0 = 22d - 19d + w - 25. What is the remainder when v is divided by d? 7 Suppose 4m = 3i + 364, -5i = -5m + 80 + 525. Let l = 156 + i. Suppose -218 = -2s + l. Calculate the remainder when s is divided by 32. 31 What is the remainder when 634 is divided by 78/338 - 6972/(-39)? 97 Let b(d) = -14d + 441. Let r be b(13). Suppose 0 = 2f + 155 - r. What is the remainder when 254 is divided by f? 46 Calculate the remainder when (776 + 1)/(18 + 7 - 22) is divided by 194. 65 Let g(j) = -j3 - 86j*2 - 38j - 44. Let x(n) = -43n2 - 19n - 22. Let o(k) = -2g(k) + 5x(k). Calculate the remainder when 483 is divided by o(22). 43 Let c be (-2 + 2 - -1)25. Let h(x) be the first derivative of 2x*2 - 61x - 3. What is the remainder when h(c) is divided by 7? 4 Suppose -30*u + 8211 = -2349. Calculate the remainder when u is divided by 192. 160 Let z = -3637 + 3701. What is the remainder when z is divided b	{ "pile_set_name": "DM Mathematics" }
prime factors of v? 2, 13 Let j be 1/3(-108)/(-9). What are the prime factors of (-1)/j(0 - 0) + 170? 2, 5, 17 Suppose 52 = b + 2b + 2z, 0 = b + 5z. Suppose 0 = 3s - 11 + b. List the prime factors of 4 + 2s - -5. 3 List the prime factors of 8 + (2 - 7) - (2 + -279). 2, 5, 7 Let l(z) = -15z - 10. Let p be l(-4). Suppose -c + 76 + p = 5d, 458 = 3c - d. What are the prime factors of c? 151 Suppose 25 - 313 = -4q. Suppose -q + 30 = -2x. Let l = x - -2. List the prime factors of l. 23 Let i(d) = -9d3 - 8d*2 + 17d - 28. Let y(l) = -5l3 - 4l*2 + 9l - 14. Let k(c) = 4i(c) - 7y(c). List the prime factors of k(-6). 2, 7 List the prime factors of 14/(-2)34/(-238) - -1668. 1669 Let b(z) = 199z3 + z2 - 2z + 5. List the prime factors of b(2). 1597 Suppose 8c - 4676 = 4c. What are the prime factors of c? 7, 167 Suppose 3h - 100 = -2h. Let b = h + 36. List the prime factors of b. 2, 7 Suppose -k - 3k - 448 = -3j, -2j - 5k + 314 = 0. What are the prime factors of j? 2, 19 Let w(f) = -25f3 + f3 - 51f3 + 3 - 4 + f2. List the prime factors of w(-1). 3, 5 Suppose 0 = -9u + 25u - 3376. What are the prime factors of u + ((-2)/4 - (-6)/(-4))? 11, 19 Let k = 234 - 114. What are the prime factors of k? 2, 3, 5 Let f(k) = 6k*2 - 161k + 17. List the prime factors of f(42). 11, 349 Let k(i) = -9i - 13. Suppose -3b = -t + 8, -2b - 3b + 27 = 2t. Let m be k(t). List the prime factors of ((-128)/m)/(2/14). 2 Let h(p) = -p - 10. Let q be h(-10). Suppose 4m + 2c - 651 = -3c, -5m + 2c + 789 = q. List the prime factors of m. 3, 53 Let f = 241 - -1360. What are the prime factors of f? 1601 Let o(b) = -5b + 32. Let c be o(6). Suppose 2h = -ch + 3a + 332, a - 332 = -4h. List the prime factors of h. 83 Let r be -3 + (1 + 5)/2. Suppose r = -o - 3y - 10, 3o - 3y + 3 + 3 = 0. List the prime factors of (o - -2)/((-1)/10). 2, 5 Let c(u) = 2u2 + 13u + 11. List the prime factors of c(-14). 13, 17 Let t = 5730 - 3432. List the prime factors of t. 2, 3, 383 Let i = -27 - -31. Suppose 3t - 5y + y = 4, it = -y - 1. Suppose td - 10 = -3q + 2d, -8 = -2d. List the prime factors of q. 2, 3 Let o = 118 + -114. Suppose -2a - 286 = -3y, 0 = y - oa - 48 - 54. What are the prime factors of y? 2, 47 Let a(g) = -g. Let h(m) = 38m2. Let j(t) = -a(t) + h(t). Let k be j(-2). Suppose 5b - k = -0b. List the prime factors of b. 2, 3, 5 Let s = -4332 + 6098. List the prime factors of s. 2, 883 Suppose 5n = 32 - 12. Suppose 5q - n = -24, 105 = o - 4q. What are the prime factors of o? 89 Let c(f) be the third derivative of f*4/8 + 4f*3 - 9f*2. What are the prime factors of c(10)? 2, 3 Let q be (-1 + 0)(20 - 33). Suppose 6s - qs = -707. List the prime factors of s. 101 Let j = -215 + -315. Let i = j + 355. Let q = -110 - i. What are the prime factors of q? 5, 13 Let l be (6/15)/((1/(-1))/(-780)). Let a = l - 220. List the prime factors of a. 2, 23 Suppose -h = 2h + 114. Let i = -18 + 12. Let p = i - h. What are the prime factors of p? 2 Let p = -3162 + 6728. What are the prime factors of p? 2, 1783 Let j be 747/15 - 5/(-25). Let k = j + -45. What are the prime factors of k? 5 Suppose -1 = -b, 4u - 487 = 4b + 281. List the prime factors of u. 193 Suppose l - 18l + 6766 = 0. List the prime factors of l. 2, 199 Let o(p) = -p*2 + 6p - 6. Let s be o(5). Let z be (0 - -3)/(s/(-6)). What are the prime factors of (z/(-8))/((-18)/240)? 2, 3, 5 Suppose 3w = -c + 94, -3w + 9 = 3. What are the prime factors of (1 + -1 + c)15/6? 2, 5, 11 Let p(t) = 2 - 5t + 0t + 2t - 5. Let q(d) = -d*2 - 7d + 1. Let y be q(-8). List the prime factors of p(y). 2, 3 Let m = -11 + 15. Suppose -1 = -mq + 3. Let g(j) = 7j*2 + j. List the prime factors of g(q). 2 Let a(d) = 14d*2 + 2d + 3. Let f be a(6). Suppose -5p + f + 336 = 0. List the prime factors of p. 3, 19 Let a = -73 - -75. Suppose 158 = -0z + az - 5t, -88 = -z - 2t. List the prime factors of z. 2, 3, 7 Let a(g) = g3 - 9g*2 + 6g + 11. Let n be a(8). List the prime factors of -2(-752)/20 + 1/n. 3, 5 Let t(j) = -5j*3 - 6j*2 - 8j + 6. What are the prime factors of t(-4)? 2, 131 Suppose 0 = 2f + 4i + i - 124, -5f + 352 = 2i. Let y be ((-1)/(-1))/(3/f). Suppose z - 5w = 7, 5w = -z + 3z - y. List the prime factors of z. 17 Suppose -4649 = -31x - 743. List the prime factors of x. 2, 3, 7 Suppose 4q - 8q + 18 = 2o, q - 2 = 0. Suppose -om + 2h - 3h = -399, -4m + h = -321. List the prime factors of m. 2, 5 Suppose -6n - 4 + 16 = 0. Suppose -nl + 6l = 1244. What are the prime factors of l? 311 Suppose 5z = 4z + 2. Suppose -zc - 5c = -21. List the prime factors of c. 3 Suppose -3c = 2c - 20. Suppose 3 = 5t + ch + 38, 0 = -3t - 4h - 13. List the prime factors of t/(-55) - 189/(-5). 2, 19 Suppose 0x + 15 = 5x. Suppose -a + 5k = 2k - 22, -5a + 182 = xk. List the prime factors of a. 2, 17 Let f(b) be the first derivative of -b*4/4 - 5b3/3 + b2 + 7b + 2. Let x be f(-5). What are the prime factors of (x - 57/(-6))2? 13 Let j(l) = l*2 - 12l + 15. Let m be j(2). Let x(g) = 4g - 4. Let y(c) = 3c - 5. Let u(s) = -3x(s) + 2y(s). What are the prime factors of u(m)? 2 Let o = -357 + 519. List the prime factors of o. 2, 3 Let g be (-14)/(((-20)/38)/(-5)). Let q = 194 + g. What are the prime factors of q? 61 Suppose -5253 + 1881 = -12t. What are the prime factors of t? 281 Let b(o) = 34o*2 - 5o - 2. List the prime factors of b(2). 2, 31 Let t be (-6)/(-2)(-80)/6. Let k = -24 - t. What are the prime factors of k? 2 Suppose 2j + q + 51 = 0, -j - 2q - 56 = j. Let i = -20 - j. Suppose 0 = if + 6, -3r + 108 = 2r - 4f. What are the prime factors of r? 2, 5 Let c(t) = -6t*2 - t - 1. Let z be c(-1). Let i be (4/3)/(4/z). List the prime factors of ((-69)/6 + 2)i. 19 Let x be (2 + 3/(-6))2. Let l = x + 5. List the prime factors of (-2)/l + 750/24. 31 Let v = 1820 - 771. What are the prime factors of v? 1049 List the prime factors of ((-8406)/(-10))/((-69)/(-230)). 2, 3, 467 Let w(l) = -459l + 3. List the prime factors of w(-1). 2, 3, 7, 11 Let v(m) = 57m - 11. What are the prime factors of v(14)? 787 Let y = -11 - -17. Suppose 4c = yc - v - 226, 0 = -3c + 2v + 341. List the prime factors of c. 3, 37 Let f be (35 - 3) + (-8)/2. Suppose -f - 1 = 3w - 5o, 49 = -3w + o. List the prime factors of 1662/36 + 3/w. 2, 23 Let y = -965 - -1960. What are the prime factors of y? 5, 199 Suppose 244 = 4k + 88. Suppose 2v = -0v + 280. Suppose -3r = 2z + k - 120, -5z + v = -5r. What are the prime factors of z? 3, 11 Let i(f) = -f3 + 13f*2 + 12f + 30. Let r be i(14). Suppose 0 = rz - z + 24. Let s = 45 + z. List the prime factors of s. 3, 7 Let l(z) = z - 4. Let t be l(7). Let g be 21/t + -2 - 1. Suppose gd - 20 = 24. List the prime factors of d. 11 Let i = 142 + -97. Suppose 133 - i = 2b. What are the prime factors of b? 2, 11 Let o be 4/14 - 6/21. Let c = o + 13. Suppose c = -5j + 53. What are the prime factors of j? 2 Let g(t) = -t*3 - 10t*2 - 8t + 6. Let c be g(-10). Suppose 3k = k + c. Suppose -4o + 93 = -k. List the prime factors of o. 2, 17 Suppose -5g = -h - 27, -4h - 5g - 26 - 7 = 0. Let z = -15 - h. Let o(m) = m2 + 2m + 2. What are the prime factors of o(z)? 5 Suppose 5l = -2a - 17, -3a + 0l = -l - 17. List the prime factors of (-19)/(((-20)/210)/(a/6)). 7, 19 Let w = 555 + -260. List the prime factors of w. 5, 59 Suppose -8c = -3c + 10. Let k be 1/(c/(-12))-1. What are the prime factors of (-233)/k + (-8)/(-48)? 3, 13 Let c(q) = -5q*2 - 30q - 21. Let v(n) = -4n2 - 29n - 22. Let h(f) = -3c(f) + 4v(f). List the prime factors of h(-20). 5, 19 Suppose -26x = -5093 - 5359. List the prime factors of x. 2, 3, 67 Let w(c) = -5c*2 - 89c + 22. List the prime factors of w(-17). 2, 3, 5 Let z(b) = b*3 - 26b*2 + 19b - 23. What are the prime factors of z(26)? 3, 157 Let f(n) = -n*3 - 4n*2 - 2n - 6. Let g be f(-4). List the prime factors of 2 + g + -8 - -57. 53 Let p(x) = x*3 - 2x*2 - 14x. Let j be p(6). What are the prime factors of (4 - 3)(j - (0 + 0))? 2, 3, 5 Suppose -u - 2 = 1, -5b + 2596 = -2*u. List the prime factors of b. 2, 7, 37 What are the prime factors of 28/98	{ "pile_set_name": "DM Mathematics" }
der. 1/7, q, 2 Let k = -21/2 + 12. Let w(r) = -r*3 + 10r*2 + 7r - 2. Let p be w(10). Let v be 3(1 + p/(-72)). Sort v, k, -2 in descending order. k, v, -2 Let t = 2.9 + -0.4. Let q = 0.5 - t. Let y be 1/((-3)/(-5))-3. Sort y, 0.3, q in descending order. 0.3, q, y Suppose -4x + 0x + 24 = 0. Let a = x + -9. Let c = -8 - -6. Put a, c, 4 in ascending order. a, c, 4 Suppose 5a = i + 12 - 4, -3i = -3a + 12. Put -19, -4, i in descending order. i, -4, -19 Let g = 43 - 38. Sort -3, -3/2, 0.2, g in ascending order. -3, -3/2, 0.2, g Suppose -4o + 5x = 41, 5o - 38 = -3x - 117. Let u = -10 - o. Let y(l) = -2l - 1. Let q be y(1). Sort q, u, -5 in decreasing order. u, q, -5 Let t be ((-2)/(-6))/((-2)/(-12)). Let b be 3/4(t + -6). Let a = 2 - 2. Put b, 1, a in decreasing order. 1, a, b Let i be 9/(-11) + 1 + 0. Suppose 0c - c - b = 9, 5c + 4b = -41. Let d be 2/(-5)(6 + c). Sort 1, d, i in decreasing order. 1, i, d Let l = -185 + 176.3. Let v = l - -9. Sort -1/9, v, 2/9 in descending order. v, 2/9, -1/9 Let d(a) = -a - 5. Let u be d(-3). Suppose -x - 18 = -4x. Suppose 0 = 2o + 5l + 10 + 3, -3o = -l - x. Put -5, o, u in decreasing order. o, u, -5 Let q = 9 + 7. Sort -0.1, -1/11, 1, q in ascending order. -0.1, -1/11, 1, q Let h = 0.29 + 0.01. Let c = -1977805/13 + 151992. Let p = c + 147. Put p, h, 0 in ascending order. 0, p, h Suppose -4 + 28 = 8i. Let j = 0.1 + -0.6. Sort -5/4, j, i in increasing order. -5/4, j, i Let t(b) = b*2 + 8b - 6. Let n be t(-9). Put -4, -3, n in descending order. n, -3, -4 Let w be ((-24)/(-60))/(38/30 - 1). Let t = -1.6 + 2. Sort t, -2/13, w in descending order. w, t, -2/13 Suppose 3a + 4q - 10 = -2, -5q + 10 = 0. Sort a, 1, 4 in descending order. 4, 1, a Let b = 0.02 - -7.98. Let k = b + -14. Let c = k + 3. Put c, 3, 2 in descending order. 3, 2, c Let b be 1 - 0 - (-29 + 16). Sort -2/9, b, 0.1 in ascending order. -2/9, 0.1, b Suppose 0x - 4 = x. Let d = 0 + 0. Put x, -5, d in descending order. d, x, -5 Let h = -4 + 4.3. Let n = 1312/9 - 146. Sort h, n, -2 in increasing order. -2, n, h Let c = -3.13 + 0.13. Sort c, -5, 4 in decreasing order. 4, c, -5 Let r = 2 - 0. Suppose 4 = -16g - 44. Put r, g, -1/5 in increasing order. g, -1/5, r Let h(b) = b3 - 9b*2 - 3b + 27. Let w be h(9). Sort w, -4, -23. -23, -4, w Suppose -5f = 5m + 40, 5m = -0f + 5f + 10. Sort 0.3, f, 17 in descending order. 17, 0.3, f Suppose -11p + 13 = -12p - 4d, 4p = 3d - 14. Let n(a) = -a3 - a2 + 2a - 1. Let i be n(1). Sort p, -3, i in ascending order. p, -3, i Let k = -179 + 375/2. Let l = 285/34 - k. Sort l, 0.2, 4 in increasing order. l, 0.2, 4 Let o be (11/66 - 0)(-6)/(-4). Sort 3/5, o, 7/2 in descending order. 7/2, 3/5, o Suppose 18 = 2p + 20. Sort p, -14, -3, -2 in decreasing order. p, -2, -3, -14 Let b be 29/6(1 - 4). Let l = b + 15. Put -2/3, -0.2, l in descending order. l, -0.2, -2/3 Let b = -28 - -18. Sort -0.3, 1/8, b. b, -0.3, 1/8 Suppose 138 = 5s - 4w + 2w, -5s + w + 134 = 0. Suppose 5o - s = -11. Suppose -oy + 2y = 0. Put 2, y, -4 in decreasing order. 2, y, -4 Let g = 0 + -4. Suppose -5 = t - 3. Let y be 2(-4)/16 - (-2)/3. Put y, g, t in increasing order. g, t, y Let p = -2.3 - -0.5. Let s = p + 1.8. Put -0.2, s, 0.13 in ascending order. -0.2, s, 0.13 Suppose -3f = f - 48. Suppose x - 4 = -2p, 6x - 3x - f = -p. Sort -3, 4, p in increasing order. -3, p, 4 Let a(n) = -5n + 8. Let y be a(5). Let c = 18 + y. Put c, -1, -3 in descending order. c, -1, -3 Suppose -2f = -4f + 6. Suppose -4g - 4 = 5t - ft, -5g = -5t + 35. Let x(i) = -i*3 - 7i*2 - 6i. Let m be x(-6). Put -3, t, m in decreasing order. t, m, -3 Suppose -3q = 16 - 22. Sort 0, q, -2 in descending order. q, 0, -2 Let c be -144 - 6 - 3/1. Let i be (3/c)/((-4)/24). Put 0.3, i, -4 in decreasing order. 0.3, i, -4 Suppose 3 = -v - 3. Sort -2, 7, v. v, -2, 7 Let y = -0.8 + 0.4. Let j = 1 - 0.7. Put 0, y, j in decreasing order. j, 0, y Let f(v) = v - 2. Let q be f(0). Sort 12, 5, q in decreasing order. 12, 5, q Let k be 6/(-15) + 6/15. Suppose k = -2u + 7u + 5. Sort u, -3, -5. -5, -3, u Suppose -3 = 5o + i, 0 = -8o + 3o - 3i + 1. Suppose -5 = -3a + q + 8, 0 = 4a - 3q - 9. Suppose a = s - 3s. Put s, 3, o in descending order. 3, o, s Suppose 6p = p + 20. Suppose 3i = -pt + 4, 4t + 16 = -5i + 3t. Sort -2, i, -10 in descending order. -2, i, -10 Let b be (-30)/44 - 5(-8)/80. Put 1/6, b, 0.3 in descending order. 0.3, 1/6, b Let b(m) = -m*3 - 5m*2 + 6m. Let v be b(-6). Suppose -2d + 5 = -5d + 4h, 5d + 5h - 15 = 0. Let z = -3 - 1. Sort v, z, d in increasing order. z, v, d Let q = -4.005 + 0.005. Suppose 2l - 8 = 6l. Let h be -1(l - (-5)/3). Sort h, q, 3 in decreasing order. 3, h, q Let h = -17.2 - -17. Let u = 4/11 - -10/33. Put -2/3, h, u in decreasing order. u, h, -2/3 Let i be (-6)/(-4) - (-2)/4. Suppose -2 = -id + x + 1, 2 = 3d - 4x. Put 1, d, -5 in increasing order. -5, 1, d Let t be ((-4)/(-6))/((-1)/3). Suppose 8p - 8 = 4p. Sort -0.4, t, p in decreasing order. p, -0.4, t Let k = -0.3 + 0.1. Let w = k - -0.3. Let p = -134 - -1472/11. Sort p, w, -1 in descending order. w, p, -1 Let k(i) = -i2 - 5i + 1. Let l be k(-6). Suppose 0r = -2u + 4r - 10, -4r + 8 = 0. Put u, 2, l in ascending order. l, u, 2 Suppose -6a + 10 = -a. Suppose -ar = -6r - 8. Let i = -16.1 - -15.1. Put i, 0.1, r in descending order. 0.1, i, r Let k be (-63/6)/((-3)/(-3)). Put 61, 5, k in descending order. 61, 5, k Let u = 0.15 + -2.15. Let b = u - -1.7. Put 0.3, 0.1, b in increasing order. b, 0.1, 0.3 Let a(s) = s*2 + 8s + 8. Let m(f) = f*2 - 3f + 3. Let p be m(2). Let o be p + -4(3 + -1). Let q be a(o). Put q, -4, -2 in ascending order. -4, -2, q Let p = 2 + -6. Let j(i) = -i3 + i2 - 2. Let t be j(-2). Suppose t = -2c - 0. Put c, -3, p in descending order. -3, p, c Let a be -1 + (2 + -26 - -1). Put a, 4, -5 in decreasing order. 4, -5, a Let q(c) = -c. Let v = 5 - 1. Let x be q(v). Let j = -0.08 + -0.22. Put j, 0, x in descending order. 0, j, x Let f = -0.11 - 4.89. Suppose -2w = 2w + 4. Let n = 0.1 - 0.2. Sort w, n, f in decreasing order. n, w, f Let o(f) = -2f - 15. Let r be o(-10). Put 4, 0, r in descending order. r, 4, 0 Let j = 22 + -20. Sort -7, -1, j in descending order. j, -1, -7 Let t be 15/(-10) + 3/(-2). Sort 5, t, -5 in decreasing order. 5, t, -5 Let t = 14.9 + -15.1. Sort 2, -1, t, 5 in increasing order. -1, t, 2, 5 Suppose -24 = -5j + 1. Suppose -4w + 2 + 2 = 0. Put j, -3, w in decreasing order. j, w, -3 Let i = 15.6 + -16. Put 2/9, 1, i in increasing order. i, 2/9, 1 Let b = 16 + -16.1. Sort b, 2/21, -1/2. -1/2, b, 2/21 Let t = 9 + -1. Suppose r = -s - t, 6r - s = 3r - 12. Put -3, r, 4 in increasing order. r, -3, 4 Suppose n + m = 3, -2n - 6m + 9 = -3m. Let y(x) = -x*3 + 6x*2 - 5x + 5. Let z be y(5). Suppose -z = q - n. Put 1, q, 4 in ascending order. q, 1, 4 Let l(s) = 3s + 17. Let t be l(-4). Let a = -98/3 + 33. Put t, a, -2 in descending order. t, a, -2 Suppose 5v + 5b = 35, -2v + b + 8 = -0. Let z = 40 + -23. Suppose -3y - z = -5i - 6, -5y = i + 9. Sort -4, v, i in decreasing order. v, i, -4 Let w = -0.1 + -0.9. Let c = -4 + w. Let l = c - -9. Put -2/13, -5, l in descending order. l, -2/13, -5 Suppose 2 = 4i - 5w - 0, 0 = 5w + 10. Suppose 0 = -3t + 2l - 1 - 13, 2l + 34 = -3t. Let a = 8 + t. Sort 4, i, a in descending order. 4, a, i Let q = -1 + -2. Suppose 2 + 4 = 3g. Let o = 109 + -982/9. Sort o, g, q in ascending order. q, o, g Let v = 0.1 - -0.1. Let w = -208 + 211. Sort w, -2, v. -2, v, w Let g(i) = -i2 - 3i + 2. Let s be g(-3). Let t(c) = -7c2 + 3c*s + 4c - c3 - c2 - 9 + 1. Let h be t(-6). Put 3, -4, h in increasing order. -4, 3, h Let y = -146 - -142. Sort -2/5, 2, y in increasing order. y, -2/5, 2 Suppose -3i = i. Suppose -3k + 7k + 16 = i. Sort k, -3, -2/11 in increasing order. k, -3, -2/11 Let r be ((-6)/15)/(104/(-3004)). Let x = r + -57/5. Let m be ((-3)/4)/(0 - -3). Sort x, m, -5 in ascending order. -5, m, x Suppose 3x + 4 = 2a, -3x - 5 = -3a + 2x. Suppose 0 = -i + 3i. Sort 4, i, a in descending order. a, 4, i Let d = 0.29 - -4.71. Let a = 0.02 - 2.02. Put 2/7, d, a in increasing order. a, 2/7, d Let a be 1/(-24/24). Let s = -	{ "pile_set_name": "DM Mathematics" }
o + 5 + 27. What are the prime factors of o? 11 Let m(z) = -z2 + 6z + 1. Let f be m(6). Suppose -5 - 7 = 4p. List the prime factors of f/(p/(-48))1. 2 Suppose -2p = 2q - 86, 4p = 3p + 5q + 19. What are the prime factors of p? 3, 13 Let n(c) = c3 + 6c*2 - 8c - 6. List the prime factors of n(-6). 2, 3, 7 Let j = -6 - -10. Let x = 20 - j. List the prime factors of x. 2 Suppose -5t + 83 - 8 = 0. What are the prime factors of t? 3, 5 Let n be -1 + 1 - (0 - 0). Suppose -4h + 27 - 7 = n. List the prime factors of h. 5 Let l(c) = c*2 + 3 - 1 + 0 - 2c + 0c2. What are the prime factors of l(2)? 2 Suppose -11 - 21 = 4q. Let h be 3821/4. Let y = q + h. List the prime factors of y. 11 Let l be (12/15)/((-1)/(-5)). List the prime factors of l/10 - (-159)/15. 11 Let z = 2 + 3. Suppose 0 = a + zc + 19, 2a + 5c = -0a - 18. What are the prime factors of a/(-2) - (-147)/14? 2, 5 Let u(z) = 0z2 + 5z*2 - 4 - 6z*2 + 3z. Let k be u(-5). Let c = 62 + k. List the prime factors of c. 2, 3 Suppose 2g + r = -6, g + 9 = 2r + 1. Suppose 5u - 15 = 0, u = 4v - v + 12. List the prime factors of (0 + 1)gv. 2, 3 Let i(t) = 2t2 + 9t + 1. List the prime factors of i(-6). 19 Let n(o) = -5o3 - 3o*2. What are the prime factors of n(-2)? 2, 7 Let u(f) = -8 + 2 - 9f - 2 + 0f2 - f2. List the prime factors of u(-7). 2, 3 Let u(s) = -s + 13. Let v be u(-9). Suppose -5y - v = -6y. List the prime factors of y. 2, 11 Suppose 5z + 2 = -3. Let x = z + 3. Suppose 0 = -3g - 6, -xs + 3s - 11 = g. List the prime factors of s. 3 Suppose 0 = -2k - 5 - 9. Let i = k + 3. List the prime factors of (i/(-3))/(2/30). 2, 5 Suppose 3j = 4u - 225, j - 119 = -2u - 4j. Suppose 4x = 3k - 0x - u, -2k = -x - 43. What are the prime factors of k? 23 Suppose 3z + 2n = 159, 0z - 2z + 5n + 106 = 0. List the prime factors of z. 53 Let f be 6/1(-15)/(-2). Suppose -t = -c - 5t - 15, 4c - 5t = f. What are the prime factors of c? 5 Let g(i) = 4i - 15. List the prime factors of g(16). 7 Let m = 16 - 7. Let y = m + 0. List the prime factors of y. 3 Suppose -323 = -2z - g, -g + 2g + 3 = 0. List the prime factors of z. 163 Let k = 55 + 30. What are the prime factors of k? 5, 17 Suppose 312 = -8r + 11r. List the prime factors of r. 2, 13 Let m = 57 + -31. Suppose -7x + m = -5x. What are the prime factors of x? 13 Let m(n) = -n3 + n2 + 17. Let a(s) = -s*2 - 5s + 1. Let q be a(-4). Suppose 3y + 10 + q = 5f, 0 = -5y + 4f - 12. What are the prime factors of m(y)? 17 Let t(d) = -d*3 - 11d*2 - 13d - 2. Suppose -3l + 9 - 39 = 0. Let c be t(l). Suppose -5o + c = -o. List the prime factors of o. 7 Let i(o) = -3o3 + 3o*2 + 2o + 3. Let g(w) = -w3 - w2 + w. Let j(b) = -4g(b) + i(b). List the prime factors of j(-7). 17 What are the prime factors of 21((-50)/(-15) - -3)? 7, 19 Let u = 16 - 1. Suppose 5o + u = 0, -3w - w - 4o = -36. What are the prime factors of (-3)/w - (-77)/4? 19 Let f(v) = 2v. Let o be f(2). Suppose -op - 23 + 67 = 0. List the prime factors of p. 11 List the prime factors of 6(3 - (-55)/10). 3, 17 Let p = 488 + -206. What are the prime factors of p? 2, 3, 47 Let c be (-2)/5 + 561/15. Let i be 16 + ((-4)/(-2))/2. Let q = c - i. List the prime factors of q. 2, 5 Suppose 0 = -3r + 4p + 53, -19 - 81 = -4r - 2p. Let x = r + 8. List the prime factors of x. 31 Let o(z) = -z*3 + 4z*2 + 2z - 6. Let r be o(4). Suppose 0m = 2m - r, 4t = -m + 57. What are the prime factors of t? 2, 7 Suppose -2d + d + 3 = 0. Suppose -do - 2j + 8 = -2o, 5o + 3j - 19 = 0. What are the prime factors of o? 2 Suppose -h - 69 = -4h. What are the prime factors of h? 23 Let r(t) = -4t + 7. What are the prime factors of r(-6)? 31 Suppose 3p - x - 135 = 0, -6p = -p - 3x - 221. What are the prime factors of p? 2, 23 Suppose -4a + 3a - 56 = -2y, -2y = -4a - 68. What are the prime factors of y? 2, 13 Suppose 12 - 4 = 4w, -4w - 832 = -3x. What are the prime factors of x? 2, 5, 7 Let a(u) be the second derivative of -u4/12 + u3 + 3u2 + 2u. Let m be a(6). Let d = m + 2. List the prime factors of d. 2 What are the prime factors of (135/18)/(6/32)? 2, 5 Let n = 11 + -11. Suppose -4u + 4 + 12 = n. Suppose 3v - 41 = uo, -v - 5o - 11 = -50. What are the prime factors of v? 19 Let r be 1/5 - (-164)/(-20). What are the prime factors of ((-14)/r)/(2/16)? 2, 7 Suppose v + 2t = -2t + 6, 4v - 2t - 24 = 0. Let x be (-115)/(-25) - v/10. What are the prime factors of ((-12)/9)/(x/(-6))? 2 Suppose -t - n + 281 = 0, 4n + 293 = 3t - 557. What are the prime factors of t? 2, 3, 47 Let q = 1 - -1. Suppose -97 = -3z + qp, 5p = -2z + 3p + 58. List the prime factors of z. 31 Suppose 0 = -s + 6s + o - 1046, 3s - 2o = 625. Suppose 54 - s = -5w. List the prime factors of w. 31 List the prime factors of ((-4)/(48/(-114)))/(1/10). 5, 19 Let x be (-10)/(-2 - 6/(-4)). Let v = 9 + x. List the prime factors of v. 29 Let r(f) = f2 + 5f - 6. Let y be r(-6). Let h be y + 147 + -2. Suppose -5s = -4g - h, 5g = 2s - 0s - 52. List the prime factors of s. 2 Suppose -3g + 222 = 2j + j, -4j + g + 271 = 0. List the prime factors of j. 3, 23 Let z = 404 - 195. What are the prime factors of z? 11, 19 Let v = 4 - 9. List the prime factors of v/10 + (-10)/(-4). 2 Let t be ((-27)/6)/(3/(-4)). Suppose 0i + 258 = ti. What are the prime factors of i? 43 Let o be (1 - (-3 - -1)) + -3. What are the prime factors of (o + 3)/317? 17 Let u be 36/(-2) - 10/(-5). What are the prime factors of (-2)/((u/4)/28)? 2, 7 Let n(f) = f*2 + 10f + 9. Suppose -5k = -12 - 3, 56 = -5d + 2k. What are the prime factors of n(d)? 3 List the prime factors of 573/6 + (-6)/(-4). 97 Let n(g) = 2g*2 - g. Let w be n(-4). Suppose 5u - w - 39 = 0. List the prime factors of u. 3, 5 List the prime factors of (11/2)/(17/34). 11 Let g(m) = m2 - m. Let z(a) = a2 - 7a - 3. Let y(f) = -2g(f) + z(f). Let w(o) = -o + 3. Let q be w(6). List the prime factors of y(q). 3 Let p(c) = c3 + c2 + c + 38. Let l be p(0). Suppose 0 = o - 4r - l, r + 158 = -0o + 3o. What are the prime factors of o? 2, 3 Let j = -8 + 12. Suppose 2v + n - 13 = -0v, 2 = v - jn. List the prime factors of v. 2, 3 Let m(g) = g. Suppose 0 = 2z - z - 7. Let p be m(z). Suppose 0 = 5i - 4k - 56, -4i + 4k - p = -51. List the prime factors of i. 2, 3 Suppose a = -0a + 5, -5z + 40 = 3a. Suppose -172 = -zd + 38. Suppose -4x = -d + 10. What are the prime factors of x? 2 Let i(w) = -21w - 7. What are the prime factors of i(-4)? 7, 11 Suppose 5x + 20 = 0, 49 = 3d - 5x - 13. List the prime factors of d. 2, 7 Suppose 6 = 3i + 78. Let p = i + 40. What are the prime factors of p? 2 Suppose -3n = -4g - 8n + 104, 17 = g - n. List the prime factors of g. 3, 7 Let w(x) = -x*3 - 6x*2 - 10x - 11. Let h(a) = -a3 + a2 + a - 1. Let y(i) = 2h(i) - w(i). List the prime factors of y(9). 2, 3 Suppose 0 = -h + 2h - 3. Suppose -hr + 24 = r. List the prime factors of r. 2, 3 Suppose -2s = -3j + 4j - 50, 5j - 58 = -2s. What are the prime factors of s? 2, 3 Suppose -35b + 38b - 282 = 0. What are the prime factors of b? 2, 47 Suppose 0 = 3h - 404 - 145. List the prime factors of h. 3, 61 Let g(n) = -n2 + 4n + 4. Let b be g(4). Suppose -22 = -bs + 2s. Let k = 15 - s. What are the prime factors of k? 2 Suppose -12 - 9 = -3c - 3b, c = -3b + 15. Let r(w) = 2w*2 - 5w + 3. Let s be r(c). Let k = s - 3. What are the prime factors of k? 3 Let q be (-11)/2(7 - 5). Let i(y) = -y3 - 10y*2 + 8y - 14. List the prime factors of i(q). 19 Let a(d) = -d2 - d + 1. Let t(r) = -r2 - 9r - 4. Let h(p) = -2a(p) + t(p). Let g be h(-4). Suppose -u + g = 3w, -2 = -u + 3. List the prime factors of w. 11 Let k = 6 - -53. List the prime factors of k. 59 What are the prime factors of (-1)/31 - 271/(-3)? 2, 3, 5 Suppose -f = -3k + 29, -4f - 2k - 39 = 7. Let v be f/(-6) + (-2)/(-3). Suppose b = -d + 24 - v, -4b = 5d - 100. List the prime factors of d. 2 Let x(z) = 6z + 2. Suppose -6k - 4p = -2k, -2 = k + 2p. List the prime factors of x(k). 2, 7 Suppose 2c = -c + 6. Suppose -4a - 80 = -4p, -48 = -2p - 0a - ca. List the prime factors of p. 2, 11 List the prime	{ "pile_set_name": "DM Mathematics" }
ent values? True Let b = 7773 + -9004. Which is smaller: 3 or b? b Let b = -55 + 57. Suppose -2w - w = -br - 21, -2w + 14 = 5r. Is 2 at most w? True Suppose 15 = -5t, 4v - 31 = -v + 2t. Suppose 2r = -10i + vi + 23, 3r - 12 = 0. Let n be i/52(-12 - -4). Is n smaller than 3? True Suppose -3j + 3 = 6. Let y be 1/(0 - (j - 0))-3. Which is bigger: y or -38/11? y Let s(c) = 5c + 20. Let u be s(-4). Suppose u = 4n + d + 183, 2d - 3d + 52 = -n. Is n less than -44? True Let b(t) = t - 15. Let v be b(15). Suppose -m = -2p + 5p + 70, v = -p - 3m - 26. Is 1 >= p? True Let t = 13763 + -12122. Which is greater: 3 or t? t Let b be ((-1)/38)/(26/(-176 - -20)). Which is smaller: -1/2 or b? -1/2 Suppose -24w + 70 = -19w. Suppose -4 = -wo + 10. Which is greater: -1/163 or o? o Let m = -246245/3 + 82083. Let t = 1 + 5. Let s be (1 + -1)/(t/(-3)). Which is smaller: m or s? s Let u be 123/(26 + 19). Which is smaller: u or 2? u Suppose -2x - x = -2h - 18, -3x = 3h + 12. Let d be 16/(-6)(-9)/h + 9. Suppose -j = q - 29, -4q - 36 = -dj - 197. Are q and 35 nonequal? True Let z(n) = 9n + 11. Let g be z(-2). Let d(k) = 4k*2 + 28k. Let f be d(g). Which is greater: 4/55 or f? 4/55 Let b(u) = -25u2 - 280u - 167. Let k be b(13). Do -8033 and k have the same value? False Let g = -10809/7 + 1547. Let x = g - 47/14. Is x smaller than -85? False Suppose 0 = -s + 2w + 58, -5s + 2s - w + 188 = 0. Suppose 0 = -3p - 3j + 12, p - j = -4j + 4. Suppose 5o - s = po. Is 61 smaller than o? True Let x be -12 + 15 + (-6)/2. Let m(u) = -6u + 27. Let k be m(x). Is k >= 26? True Let y be -7 + ((-18717)/12 - 1). Let w = y - -351179/224. Which is smaller: 0 or w? 0 Let m(j) = -j2 + 4j - 31. Suppose i - 9i = -24. Let b be (-7)/(-2)(i + -5)-1. Let r be m(b). Which is smaller: -53 or r? -53 Suppose 2w - a - 18 = 1, 0 = -4w + 4a + 48. Let k be 6 - -8(-4)/(-8). Let c = -4 + k. Which is bigger: c or w? w Let u = -31196 - -35483. Which is bigger: -0.1 or u? u Let j = 3876 + -3861. Let b be 3/(-6) + (-394)/(-28). Is j greater than or equal to b? True Let b = -0.041 + -39.959. Let w = 38.1 + b. Let t = w + 2.1. Is -0.21 not equal to t? True Suppose -123 - 184 = -q - u, -589 = -2q + 3u. Is 302 <= q? True Let t(r) = 35. Let z(v) = v + 141. Let x(o) = -9t(o) + 2z(o). Let f be x(17). Do f and -4/31 have the same value? False Let h be (4 + (184/(-20) - -4))/(48/(-64)). Which is greater: h or 1.5? h Suppose -153i = 204910 + 20918. Do -1476 and i have the same value? True Let z be 42/(-3) - 1580/(-110). Is z bigger than -1.4? True Let b = 8202 - 8201. Which is bigger: -3/1706 or b? b Suppose 5l - 2x = 102, 15x - 18x + 72 = 5l. Which is greater: l or 239? 239 Let m = 2688/5 - 35224/65. Is -2/7 != m? True Let q = 2690 + -5878. Is q greater than or equal to 1/4? False Suppose -102g = -94g. Suppose 9k - 137 + 47 = g. Let x be 731/6 + -2. Which is smaller: x or k? k Let x(b) be the third derivative of 5b*4/24 + 45b3/2 - b2 - 88b. Let s be x(-23). Which is bigger: 16 or s? s Let t be (40/(-2680))/(5 + -1). Which is greater: 0 or t? 0 Let x = -46 - -46. Suppose 4 = -xr + r. Is r >= 14? False Suppose -5j + 3u + 10 = 0, 3u + 17 = -25j + 23j. Which is greater: 2/24307 or j? 2/24307 Suppose 224 = -0s - 8s. Let l be s/98 - 59/14. Let n(p) = 2p + 6. Let z be n(-5). Is l != z? True Suppose -2b + 2o = -16, -7o = -5b - 3o + 36. Let r be (4/48388)/(2/6). Suppose bt = -6g + g + r, -3t + 2g = -67. Is 23 less than or equal to t? True Let m = -0.253 - -326.253. Let i = -457 + m. Is i < -1/4? True Let f = -1451404633/9673 + 150047. Which is smaller: 0 or f? f Let d be 5 + (5 - (2 - 5)). Suppose dq = -50 - 314. Does -28 = q? True Let x be (-42)/(15/5505). Let l be 5060/x8/(-10). Is 14 at least as big as l? True Suppose 2p + 26 = 90. Let j = 11647/360 + -83/72. Are p and j equal? False Let w = -132 + 135. Let v be ((-4)/w)/((-5)/120). Which is bigger: 30 or v? v Suppose -11j + 27j = 12j - 4. Let n(w) = -145w + 3. Let m be n(6). Let o = m - -40747/47. Is o bigger than j? True Let n be 152/24 - 6 - 142/(-6). Let c = 48 - n. Let j be c/(-30) - 2/10. Is -2/171 at least j? True Let s = 2.1266 - 633.3466. Let h = s + 631. Which is bigger: h or 1/7? 1/7 Let g be ((1215/(-6))/5)/((-272)/544). Does g = 2204/27? False Let p(h) = h*3 - 13h*2 + 6h - 9. Let i be p(13). Suppose 9v + 24 = i. Let t(f) = -f2 + 11f + 61. Let l be t(15). Which is greater: v or l? v Let l(k) = -15k2 - 331k - 667. Let t be l(-2). Is -127/2 greater than t? True Let i = 6.6907 - 6.66. Let j = -0.1417 + i. Which is greater: -0.2 or j? j Let y = -11 - -8. Let b be y/2(-88)/(-18). Let f be 1(-52 + (-1980)/(-45)). Which is greater: f or b? b Let j(t) = -t*2 - 4t - 2. Let o(u) = -u + 5. Let w be o(8). Let h be j(w). Let k be (-4)/(-14) + 6/(-231)11. Does k = h? False Let j = -344 + 348. Let s be (j/(-8))/((-44)/1443). Suppose 0 = 2w - 0w. Is w not equal to s? True Let c = 0.1 - 0.1. Let j be (1/2091)/((-1373)/229 - -6). Let d = j + 1/123. Which is bigger: d or c? d Let b be (6/(-12))/(2/8). Let u be (-11)/b24/(-16). Is -9 at most u? True Let g = -1868.22 - -1864.34. Let d(y) = -y. Let p be d(0). Is p at most g? False Suppose 0 = -j + 3b + 11, -2j + 3b + 28 = 3. Let l be j/56 - (262/120 - 1). Which is bigger: l or -1? l Let u = -244 - -133. Let n = 55 + u. Let p be (-35)/n(-3)/(-5). Are p and -1 equal? False Let n(i) = -4i*3 - 15i*2 + 125i - 1005. Let t be n(11). Is t less than -6768? True Let p(d) = -d*3 + 16d*2 - 9d - 3. Let o be p(12). Suppose o + 2155 = 2s. Let b be s/70 + (-1)/((-7)/2). Which is bigger: b or 17? b Let r = -91 + 119. Suppose -r + 43 = -15z. Is z at most 2/195? True Let q = 2.37 + -7.87. Let l = q + 6.3. Which is smaller: l or 0.15? 0.15 Let o(q) = q*3 - 165q*2 + 11q - 1357. Let k be o(165). Is k less than or equal to 456? False Let d be (-55)/15 + 2/(-6). Let k be (-15)/d + -2 + -3. Suppose -39 + 15 = 24c. Which is greater: c or k? c Let a be 2/(-4 + 10/3). Let j be ((-12)/32)/(a/11). Suppose i + i + 1 = -5h, -3i + 10 = -4h. Is i bigger than j? True Let c = -2686 + 67149/25. Is c bigger than -175? True Let s = 6920 + -6906. Which is greater: s or -1/4? s Suppose 175z = 358z - 174z - 18. Which is smaller: z or -3271/5? -3271/5 Let g = 0.295 - -0.705. Suppose 0 = 2f, k - 98 = 5f + 72. Let w be (8 - 8) + (k/12)/(-5). Which is smaller: w or g? w Let j be 1 - 0 - (-30)/2. Let g be (15 - (3 - 9))/1. Let k = -6 + g. Which is greater: k or j? j Let x(g) = -18g - 17. Let y be x(-1). Let k = y - -21. Is 11 less than or equal to k? True Let o be -10 - (9 + (-308)/19 - 3). Which is greater: o or 4? 4 Let f = -14 + 14. Let u = -6/1237 - -15126/58139. Which is smaller: u or f? f Let h = -24 + 17. Let y(u) = -u + 1. Let l(t) = 4t - 11. Let p(d) = l(d) + 5y(d). Let k be p(h). Which is smaller: -1/5 or k? -1/5 Let a = 26581182458654/14202781657299 - -2/2321095221. Let t = 3856/3 + -111662/87. Let x = a - t. Is 0 equal to x? False Let w = -2109 - -1182. Is w at most as big as -927? True Let b = 177385/12 + -14782. Which is bigger: -4/25 or b? b Let t = 0.003 + 20.997. Let n = -21.06 + t. Suppose -26 = -7v + 2. Is n at most as big as v? True Let g = -339651 - -339650.7. Let p = -38.969 - -39. Is p less than or equal to g? False Let c = -32371756/72443 + 12/10349. Which is greater: -446 or c? -446 Let l be 12/(-10)(-393540)/126. Is 3748 not equal to l? False Let k = 11.598 + 0.002. Let q = k - 11.715. Let i = q + -1.885. Do -0.1 and i have the same value? False Suppose 11m - 47m + 18m - 6444 = 0. Is -3232/9 greater than m? False Let o = 2993 + 23. Is o equal to 0.1? False Suppose -12c + 58c = -250746. Is c != -5451? False Let i(u) be the second derivative of u5/20 + u4/3 + u. Let d be i(-4). Suppose 24 = -3r + 82a - 86a, r = 5a + 30. Is r bigger than d? False Suppose -5t - 48 = -21t. Let u be (-409)/t + 48/(-72). Which is greater: 1 or u? 1 Let s be (-4)/(-109)(-3)/(-6). Suppose -n - 28 = -2d, 12 = -5n - 8. Suppose 20 = -5w, 0 = -6x + 2x + 4w + d. Which is bigger: s or x? s Let d = 345304 - 345321. Suppose -q = 3q - 36. Which is greater: q or d? q Suppose w - 7 = -5m, -2m + 8 = -2w - 2. Sup	{ "pile_set_name": "DM Mathematics" }
461512625, 1461512624? -x + 1461512629 What is the m'th term of -94713, -189392, -284039, -378660, -473261, -567848, -662427, -757004? -m*3 + 22m*2 - 94738m + 4 What is the u'th term of 228028, 227970, 227912, 227854, 227796? -58u + 228086 What is the m'th term of 1167609, 2335210, 3502811, 4670412, 5838013? 1167601m + 8 What is the v'th term of -273619, -273681, -273743, -273805, -273867, -273929? -62v - 273557 What is the s'th term of -57355, -56314, -54579, -52150, -49027? 347s*2 - 57702 What is the j'th term of -24649, -24718, -24819, -24952? -16j*2 - 21j - 24612 What is the s'th term of 72785, 143025, 213265? 70240s + 2545 What is the h'th term of 2613216, 5226340, 7839462, 10452582? -h2 + 2613127h + 90 What is the q'th term of -13493, -12879, -12265, -11651, -11037? 614q - 14107 What is the p'th term of 93248, 186529, 279808, 373085? -p2 + 93284p - 35 What is the s'th term of 2490019, 2489962, 2489905, 2489848? -57s + 2490076 What is the z'th term of 1107476, 1107506, 1107536? 30z + 1107446 What is the z'th term of -2928, -10824, -23968, -42348, -65952, -94768, -128784, -167988? 2z3 - 2636z*2 - 2z - 292 What is the a'th term of -2085, -1664, -1243, -822? 421a - 2506 What is the a'th term of -347013, -348753, -350493, -352233, -353973? -1740a - 345273 What is the o'th term of -14640, -28286, -41914, -55518, -69092? o*3 + 3o*2 - 13662o - 982 What is the y'th term of 34398, 68698, 102998, 137298? 34300y + 98 What is the t'th term of -19672526, -19672525, -19672522, -19672517, -19672510, -19672501, -19672490? t2 - 2t - 19672525 What is the s'th term of 6034, 11969, 17934, 23941, 30002, 36129, 42334? 2s3 + 3s*2 + 5912s + 117 What is the k'th term of 26736, 26770, 26816, 26868, 26920, 26966, 27000, 27016? -k*3 + 12k*2 + 5k + 26720 What is the q'th term of 27, 97, 327, 819, 1675, 2997? 17q3 - 22q*2 + 17q + 15 What is the u'th term of -119906, -120080, -120376, -120800, -121358, -122056, -122900? -u*3 - 55u*2 - 2u - 119848 What is the k'th term of -14628043, -14628016, -14627985, -14627950? 2k2 + 21k - 14628066 What is the v'th term of 27118, 108476, 244072, 433906? 27119v2 + v - 2 What is the g'th term of -47, 522, 1519, 2944, 4797? 214g*2 - 73g - 188 What is the f'th term of 3987, -5245, -14477, -23709, -32941? -9232f + 13219 What is the c'th term of -45967, -45979, -46011, -46069, -46159, -46287? -c3 - 4c*2 + 7c - 45969 What is the g'th term of -25811, -106418, -240761, -428840, -670655? -26868g2 - 3g + 1060 What is the j'th term of -94547, -93932, -93317? 615j - 95162 What is the b'th term of 762014, 1524025, 2286036, 3048047, 3810058? 762011b + 3 What is the u'th term of -57584, -57814, -58044, -58274, -58504? -230u - 57354 What is the o'th term of -607970519, -607970517, -607970515? 2o - 607970521 What is the q'th term of 1001, 1350, 1747, 2216, 2781, 3466, 4295, 5292? 4q3 + 321q + 676 What is the u'th term of 1974655, 3949313, 5923971, 7898629, 9873287, 11847945? 1974658u - 3 What is the v'th term of 40053, 40267, 40481, 40689, 40885? -v3 + 6v*2 + 203v + 39845 What is the k'th term of -459250, -459256, -459262, -459268? -6k - 459244 What is the l'th term of 871745, 871752, 871757, 871760, 871761, 871760? -l2 + 10l + 871736 What is the k'th term of -2930, -3056, -3202, -3368, -3554, -3760, -3986? -10k2 - 96k - 2824 What is the l'th term of 309, 547, 1281, 2757, 5221, 8919, 14097, 21001? 41l3 + 2l*2 - 55l + 321 What is the w'th term of -3902493, -3902551, -3902609, -3902667, -3902725? -58w - 3902435 What is the o'th term of -1458922083, -1458922081, -1458922079? 2o - 1458922085 What is the b'th term of 30701310, 30701434, 30701640, 30701928? 41b2 + b + 30701268 What is the k'th term of -12869515, -25739047, -38608579, -51478111, -64347643? -12869532k + 17 What is the d'th term of 296280, 592573, 888868, 1185165, 1481464? d*2 + 296290d - 11 What is the r'th term of -542, -1342, -1760, -1604, -682, 1198, 4228? 32r3 - r2 - 1021r + 448 What is the h'th term of -94099, -94096, -94077, -94030, -93943, -93804, -93601? 2h3 - 4h*2 + h - 94098 What is the q'th term of -23907, -46585, -69263, -91941, -114619? -22678q - 1229 What is the i'th term of -274, -88, 132, 404, 746, 1176, 1712? 3i3 - i2 + 168i - 444 What is the j'th term of 40740, 89358, 137976? 48618j - 7878 What is the i'th term of 1313, 2552, 3787, 5018, 6245, 7468? -2i*2 + 1245i + 70 What is the v'th term of -174, -1427, -4788, -11295, -21986, -37899? -173v3 - 16v*2 + 6v + 9 What is the y'th term of -231704, -463368, -694988, -926564, -1158096, -1389584? 22y2 - 231730y + 4 What is the o'th term of 16386, 65569, 147544, 262311, 409870, 590221, 803364? 16396o2 - 5o - 5 What is the w'th term of 137985, 140697, 143419, 146157, 148917, 151705, 154527, 157389? w3 - w2 + 2708w + 135277 What is the k'th term of 669, -374, -3155, -7674, -13931, -21926? -869k*2 + 1564k - 26 What is the j'th term of -2083, -8864, -20383, -36640, -57635, -83368? -2369j2 + 326j - 40 What is the b'th term of -27738, -55597, -83502, -111459, -139474? -b*3 - 17b*2 - 27801b + 81 What is the y'th term of -5138, -9893, -14648? -4755y - 383 What is the t'th term of 474878, 1899682, 4274362, 7598924, 11873374, 17097718? t3 + 474932t*2 + t - 56 What is the c'th term of 36193, 78140, 120087, 162034, 203981, 245928? 41947c - 5754 What is the w'th term of -156786, -313659, -470520, -627363, -784182, -940971, -1097724, -1254435? w*3 - 156880w + 93 What is the z'th term of -3473334, -3473470, -3473606? -136z - 3473198 What is the v'th term of -164523, -328929, -493335? -164406v - 117 What is the p'th term of 8892, 8613, 8148, 7497? -93p2 + 8985 What is the n'th term of 131392, 262779, 394154, 525511, 656844, 788147, 919414? -n3 + 131394n - 1 What is the f'th term of 2207, 2134, 2015, 1850, 1639, 1382, 1079? -23f2 - 4f + 2234 What is the j'th term of -4155, -3887, -3599, -3291, -2963, -2615? 10j2 + 238j - 4403 What is the y'th term of 7056, 12631, 18206, 23781, 29356? 5575y + 1481 What is the c'th term of 340157, 340153, 340149, 340145? -4c + 340161 What is the k'th term of -130814, -130811, -130820, -130841? -6k2 + 21k - 130829 What is the t'th term of 327, 378, 411, 414, 375, 282, 123? -2t3 + 3t*2 + 56t + 270 What is the c'th term of -118862, -237741, -356636, -475547, -594474, -713417? -8c2 - 118855c + 1 What is the q'th term of -432686801, -865373603, -1298060407, -1730747213, -2163434021, -2596120831, -3028807643? -q*2 - 432686799q - 1 What is the z'th term of -22, -127, -270, -409, -502, -507, -382, -85? 7z3 - 61z*2 + 29z + 3 What is the m'th term of -1462896, -1462901, -1462906, -1462911, -1462916? -5m - 1462891 What is the t'th term of 655214933, 655214931, 655214929? -2t + 655214935 What is the o'th term of -4544, -5337, -7516, -11783, -18840, -29389, -44132? -117o3 + 9o*2 - o - 4435 What is the u'th term of 783862, 1569494, 2355126, 3140758? 785632u - 1770 What is the u'th term of -156, 32, 324, 714, 1196? -u*3 + 58u*2 + 21u - 234 What is the j'th term of -174, -869, -2710, -6255, -12062? -93j3 - 15j*2 + j - 67 What is the a'th term of 55504056, 111008113, 166512170? 55504057a - 1 What is the o'th term of 1606199, 6424659, 14455427, 25698503, 40153887? 1606154o2 - 2o + 47 What is the h'th term of 6688, 13756, 20834, 27928, 35044, 42188, 49366? h3 - h2 + 7064h - 376 What is the a'th term of 343075128, 343075125, 343075122? -3a + 343075131 What is the w'th term of -134100, -538473, -1212428, -2155965, -3369084, -4851785? -134791w2 + 691 What is the r'th term of 13255, 26460, 39643, 52792, 65895? -2r3 + r2 + 13216r + 40 What is the l'th term of 130434, 521712, 1173842, 2086824, 3260658, 4695344, 6390882? 130426l*2 + 8 What is the z'th term of -15203801, -15203808, -15203815, -15203822? -7z - 15203794 What is the q'th term of -104, -467, -892, -1385, -1952, -2599? -q*3 - 25q*2 - 281q + 203 What is the w'th term of 7341, 6917, 6493, 6069, 5645? -424w + 7765 What is the o'th term of -705342, -705354, -705374, -705402, -705438, -705482, -705534? -4o**2 - 705338 What is t	{ "pile_set_name": "DM Mathematics" }
pose -sq = -4q - 16. What are the prime factors of q? 2 Let m(a) = a*3 + 13a*2 - 16a + 8. Let r be (-2 - 14) + (-10)/(-5). List the prime factors of m(r). 2, 3 Let f(b) be the first derivative of b*4/2 + 2b3/3 - b2/2 - 3. Let m = -3 + 4. What are the prime factors of f(m)? 3 Let k = -57 - -119. Let b = 106 - k. List the prime factors of b. 2, 11 Suppose w = -5j + 26, -4w - 4 = -j - 3. Let d be -10-2w/2. List the prime factors of -2 - ((-6)/(-3) - d). 2, 3 Let r be 1/2(-5 - -5). Suppose r = -f + 3f - 66. What are the prime factors of f? 3, 11 Let n(m) = -2m3 - 19m*2 + 4m - 17. Let z(u) = -u*3 - 10u*2 + 2u - 9. Let g(w) = -4n(w) + 7z(w). What are the prime factors of g(-5)? 2, 5 Let g be 2(2 - 0/1). Suppose gi - 2i = 54. List the prime factors of i. 3 Suppose 0 = -2t - 10, 4t + 156 = -5a + 16. Let g = a + 39. List the prime factors of g. 3, 5 Let p be (-3)/5 + 28/(-20). Let k = p - -26. What are the prime factors of k? 2, 3 Let d(m) = -m*3 + 4m*2 - 4m + 3. Let h be d(2). Suppose hb + 30 = 6b. What are the prime factors of 5/25 + 18/b? 2 Suppose 0 - 3 = -3r. Let c be 1 + 3 + 0/r. Suppose -2k - 5 = -3k, ck - 9 = o. List the prime factors of o. 11 Suppose -163 = 19f - 2329. List the prime factors of f. 2, 3, 19 Let a = -2 - -2. Suppose at - 10 = -2t. List the prime factors of t. 5 Let x be (-16)/(-2) - (0 - 0). Suppose -5i + x + 17 = 0. Suppose 2y = ib - 48, 2y = b + y - 12. List the prime factors of b. 2 Suppose -3i = -0i - 132. List the prime factors of i. 2, 11 List the prime factors of (25/4 - 1)4. 3, 7 Let z be (95)/(3 + -2). List the prime factors of ((-3)/5)/((-9)/z). 3 List the prime factors of (-24)/(-5)(-10)/(-3). 2 Let o(d) = -3d3 + 7d*2 - 6d + 6. Let m(p) = 7p3 - 14p*2 + 12p - 13. Let a(z) = 2m(z) + 5o(z). What are the prime factors of a(6)? 2 Let d = -5 - -11. Suppose 0w + d = 2w. List the prime factors of 4/(-6) - (-11)/w. 3 Let t = 22 + 13. List the prime factors of t. 5, 7 Let w be -5(24/10)/(-2). What are the prime factors of (2 + 1)/(w/20)? 2, 5 Let s(u) = u3 + 5u*2 + 4u + 5. Let c be s(-4). Let n = c - 3. Suppose ny + 5q = 5y - 34, 0 = -q - 2. List the prime factors of y. 2 Let q be (26/6)/((-4)/(-60)). Let n(u) = 3u*3 - u. Let h be n(1). Suppose -7k + hk + q = 0. List the prime factors of k. 13 Let g = 0 + 1. Let o = -36 - -35. What are the prime factors of 13 + 3/o + g? 11 Let u(p) = -p2 + 7p + 11. Let b = 29 - 21. List the prime factors of u(b). 3 Let w(a) = a*3 + 4a*2 + 2a + 4. Let y be w(-4). Let k be 6/(-9) - 52/(-6). Let d = k + y. List the prime factors of d. 2 Suppose -2n - n + 12 = 0. Suppose 0 = 3k - 5d - 26, 5d - 26 = -5k + n. List the prime factors of k. 7 Suppose 9g = 7g + 688. List the prime factors of g. 2, 43 Suppose 0 = -0j + 5j - 65. What are the prime factors of j? 13 Let v = -6 + 9. Suppose vj = -0j + 42. What are the prime factors of j? 2, 7 Let g(q) = -q2 + q + 34. What are the prime factors of g(0)? 2, 17 Let j be 2/12 - 17/(-6). Let g(y) = -y3 + 4y*2 + y. What are the prime factors of g(j)? 2, 3 Suppose -27 = -3z + 5u, -4z + 4u = -7z. Let d = 1 - z. What are the prime factors of (d - 1)/((-6)/15)? 2, 5 Let l(i) = -i*2 - 4i + 5. Let r be l(-5). Suppose -3z + 5w - 46 = -6z, 5z - 3w - 54 = r. What are the prime factors of z? 2, 3 Let v be 3/(6/8) - -1. Suppose 5j + 47 = 182. Suppose 0q + 5s + j = 4q, 5q - vs = 35. What are the prime factors of q? 2 Let g = -31 - -47. Let i(z) = -z2 + 5z - 1. Let a be i(4). Suppose aw - 67 = -g. What are the prime factors of w? 17 Let s(d) = d + 7. Let h be (2 + -3)-1-5. List the prime factors of s(h). 2 Let r(y) = -40y - 1. List the prime factors of r(-2). 79 Suppose 3n - 7n + 20 = 0. Suppose 0 = -q + 23 + 7. Suppose 2w - nw = 2h - 5, 4h = -2w + q. What are the prime factors of h? 2, 5 Suppose -3 = 4b - 5d, -3d = -0b - 3b. Suppose -3v + 26 = 3u - 2v, 0 = -5u - bv + 38. List the prime factors of u. 2, 5 Let v = 19 + 21. List the prime factors of v. 2, 5 Suppose 2l - 12 - 16 = -3f, 0 = -3l - 3f + 45. Suppose 8 = -5x - l, 0 = r + 2x - 22. Suppose -4k + r = -0k. What are the prime factors of k? 2 Suppose -w = s, s - 3w = 2s + 8. Suppose -f + 7k - 2k + 29 = 0, sk = -5f + 87. What are the prime factors of f? 19 Let g(m) = -6m*2 - 2m + 2. Let n be g(-3). Let w = 27 - n. Suppose 0 = -5x - 23 + w. List the prime factors of x. 2, 5 Let q(x) = x2 + x + 55. Let k be q(0). Suppose -k = 3y - 22. Let c = 18 + y. List the prime factors of c. 7 Suppose -4c = -4x - c + 489, 5x - 612 = 3c. Suppose -x = 5w - 313. What are the prime factors of w? 2, 19 Suppose 0 = -5v + 5r + 65, 4v + 2r - r - 42 = 0. Suppose vs - 50 = 6s. What are the prime factors of s? 2, 5 What are the prime factors of ((-60)/48)/(2/(-16))? 2, 5 Let r be (-1)/5 - (-72)/(-40). What are the prime factors of r/((-30)/33)5? 11 Let t be (-4)/(-22) - (-18)/22. Suppose 1 + t = z. Suppose zd - 22 = -7p + 2p, 5d - 55 = -3p. List the prime factors of d. 11 Suppose -5z + 22 = -2v, 3z - 3v = -5v + 26. Let m(y) = y*3 - 5y*2 - 4y + 2. List the prime factors of m(z). 2, 7 Let w(q) = -3q + 3. Let j(z) = -6z*2 - 1. Let r be j(-1). List the prime factors of w(r). 2, 3 Let x = 75 - 67. List the prime factors of x. 2 Suppose 60 = -2c + 392. List the prime factors of c. 2, 83 Let k(v) = -v - 1. Let d be k(4). What are the prime factors of 7/5 - 3/d? 2 Suppose j = -j + 82. List the prime factors of j. 41 Let z(u) = u*2 + 2. Let l be z(-2). Suppose -j - 290 = -lj. Suppose 2f + 3a = 26, -4f + j = -a + 4a. List the prime factors of f. 2 Let u be (-3 - -4)2 - -10. What are the prime factors of ((-6)/u)/((-2)/116)? 29 Let v(o) = -o2 - 14o - 5. Let p be v(-10). Suppose -i + 10 = 3q - q, 0 = i - 3q - p. What are the prime factors of i? 2, 5 Suppose 0 = b - 4r - 17, 5b = b - 3r - 8. What are the prime factors of (14 - 3)b/1? 11 Let x(k) = -k*2 - 6k + 3. Let z be x(-6). Suppose zi = -2i + 40. Suppose 2n - n = i. List the prime factors of n. 2 Let v be ((-2)/(-6))/(3/9). Let t = v + 2. Suppose 0 = 2d + 10, ty + 5d = -2y + 15. List the prime factors of y. 2 Let i(h) = h2 + 2h + 3. Suppose 2n - b = 4b + 11, 2b + 10 = -2n. Let d be i(n). What are the prime factors of (-6)/(-18) - (-47)/d? 2 Let a(r) = -2r - 10. Let k be a(-7). Suppose -ku = -u - 9. Let v(x) = 2x2 - 2x - 2. What are the prime factors of v(u)? 2, 5 Suppose -m + 70 = 4j + 2m, 0 = 4j - 5m - 54. Let p(i) = -4i + 2. Let w be p(2). Let t = w + j. List the prime factors of t. 2, 5 Let j(t) = -20t - 6. List the prime factors of j(-5). 2, 47 Suppose r = 43 + 114. What are the prime factors of r? 157 Let b = 197 + 89. List the prime factors of b. 2, 11, 13 Suppose 5s = 2s + 198. What are the prime factors of s? 2, 3, 11 Let w(z) = -2z3 + 8z*2 + 7z + 3. Let y(v) = 3v3 - 16v*2 - 13v - 6. Let j(s) = -5w(s) - 3y(s). What are the prime factors of j(-3)? 2, 3 Let u(o) = o*3 + 2o*2 - 2. Let a be u(-3). Let y = 72 - 50. Let k = y + a. What are the prime factors of k? 11 Suppose -309 = -4d + 123. List the prime factors of d. 2, 3 Suppose -3m - 14 = 2z, 2z + 0z = 5m + 18. Let x be z - (-2)/42. Suppose 2d + xd = 38. What are the prime factors of d? 19 Suppose 0 = -14k + 15k - 5. Suppose -ki + 45 = -65. List the prime factors of i. 2, 11 Let x(k) = k3 - 2k*2 + 1. Let i be x(-1). Let v = i + 2. Suppose vm = m - 8. What are the prime factors of m? 2 Suppose n - 25 - 81 = -4q, 0 = -3q + 4n + 89. List the prime factors of q/(-3)(2 + -3). 3 Let f = 18 - -1. List the prime factors of f. 19 Suppose 22 = 4k + 5x, -2x = -5k - 8 + 19. Suppose 7l + r - 48 = 2l, -kr + 4 = l. List the prime factors of l. 2, 5 Suppose -4o + 7 = -13. What are the prime factors of o? 5 Suppose 0 = -4j - 40 + 148. What are the prime factors of j? 3 Suppose 3b - 8 = 4. Suppose -11 = -bp + 33. What are the prime factors of p? 11 Suppose -10 = 5h, x + 10 = -2x - 2h. What are the prime factors of (x/6)/(1/(-87))? 29 Suppose -3h - 2h + 5x + 5 = 0, 5x + 5 = -2h. Suppose 0 = r - hr - 48. Suppose 2d + 2d - 57 = -3b, -5d + 4*b + r = 0. What are th	{ "pile_set_name": "DM Mathematics" }
4/39 - w. Factor p(s). 2s*2(s + 1)*2(s + 2)/13 Let a(m) = m*2 - 10m + 12. Let k be a(9). Suppose 4w2 - 6wk + w5 - 3w5 + 4w5 = 0. What is w? -2, 0, 1 Let p(y) be the third derivative of 0 - y2 - 1/48y4 + 0y + 0y3 - 1/240y*5. Factor p(u). -u(u + 2)/4 Let h = -3228/7 + 11575/28. Let d = 48 + h. Solve df2 + 0f - f*3 + 0 = 0 for f. 0, 1/4 Let y = 11 + -5. Factor -1 + 4 - ya*2 - 24a*2 + 3 - 3a. -3(2a + 1)(5a - 2) Let r(i) be the first derivative of -i7/42 - i6/30 + i5/20 + i4/12 + 5i + 8. Let w(p) be the first derivative of r(p). Let w(b) = 0. Calculate b. -1, 0, 1 Let y(s) = -3s*2 + 10s - 35. Let m(q) = -q*2 + q + 1. Let c(u) = -6u*2 + 8u - 7. Let x(g) = c(g) - 5m(g). Let i(z) = -8x(z) + 3y(z). Solve i(j) = 0. 3 Factor 0 + 0o - 2/15o2. -2o2/15 Let s(m) be the third derivative of -m7/315 + m6/60 + m5/90 - m*4/12 - 11m*2. Factor s(o). -2o(o - 3)(o - 1)(o + 1)/3 Suppose -2 = -0j - 2j. Let f(y) = 25y*2 - 23y + 4. Let g(w) = w. Let r(i) = jf(i) + 3g(i). Factor r(n). (5n - 2)2 Let i = -102 - -514/5. Factor 2/5b + 0 + ib2 + 2/5b*3. 2b(b + 1)2/5 Let d(a) be the second derivative of -2a*7/21 + 8a*6/15 - 6a*5/5 + 4a*4/3 - 2a*3/3 - 3a. Suppose d(m) = 0. What is m? 0, 1 Determine y, given that 2/5y - 1/5y2 - 1/5 = 0. 1 Let u(g) be the third derivative of -g9/504 - g8/420 + g7/420 - g*3/2 - 2g*2. Let b(o) be the first derivative of u(o). Factor b(z). -2z*3(z + 1)(3z - 1) Let q = 32 - 32. Let z(y) be the third derivative of qy4 + 0y + 1/180y5 + 0y3 + y2 + 0 + 1/360y6. Factor z(p). p2(p + 1)/3 Let c be 2 - 0 - (1 + -2). Suppose 4/3a + 0 + 2/3a*4 + 0a*c - 2a*2 = 0. Calculate a. -2, 0, 1 Let b(t) be the first derivative of -8t*6/9 + 92t*5/15 - 10t*4 - 4t*3 + 6. Solve b(y) = 0 for y. -1/4, 0, 3 Factor -51/5s - 7/5s2 - 14/5. -(s + 7)(7s + 2)/5 Let l(r) = -4r*2 - 22r - 18. Let p(d) = -d*2 - 7d - 6. Let t(i) = 3l(i) - 10p(i). Suppose t(s) = 0. Calculate s. -1, 3 Let n = -24239/80 + 303. Let u(p) be the second derivative of -1/16p4 + 0 + 1/12p*3 + np*5 - 3p + 0p2. Let u(f) = 0. Calculate f. 0, 1, 2 Let w = -89/28 - -24/7. Let i = -41 + 165/4. Factor -iz + 1/4z3 - wz*4 + 3/4z*2 - 1/2. -(z - 2)(z - 1)(z + 1)2/4 Let w(x) be the third derivative of -x8/30240 + x7/2520 - x6/540 + x5/15 - 3x*2. Let j(y) be the third derivative of w(y). Factor j(c). -2(c - 2)(c - 1)/3 Let a(h) = h3 - 5h*2 + 3h. Let p = -2 - -5. Let x(w) = 0w3 - 2w*3 + 2w + 9w2 - 7w. Let c(o) = px(o) + 5a(o). Factor c(m). -m*2(m - 2) Let a(j) be the first derivative of 3j5/5 + 3j*4/4 - 3j*3 - 15j*2/2 - 6j - 3. Find i such that a(i) = 0. -1, 2 Let y be 2 + -2 - (6 + -9). Let t(p) be the third derivative of 0 - 2p2 + 0p*y + 1/420p*7 - 1/48p*4 + 1/240p*6 + 0p - 1/120p5. Factor t(z). z(z - 1)(z + 1)2/2 Let v = -1064 + 1064. Find i such that 1/3i + v - 1/3i2 = 0. 0, 1 Let l(g) be the third derivative of -g5/140 + g4/28 - g3/14 + 4g*2. Let l(k) = 0. Calculate k. 1 Suppose 238q - 18 = 232q. Let 8/5z*4 + 0z + 0 - 2/5zq + 0z*2 = 0. Calculate z. 0, 1/4 Suppose 8/9t + 8/9 + 2/9t2 = 0. Calculate t. -2 Let o be 5(24/10 - 2). Let w be (-247)/190 - (-6)/82. Factor 0 + 2/5c - wco. -c(c - 2)/5 Let d(x) be the second derivative of 5x7/42 + 7x*6/6 + 9x*5/2 + 55x*4/6 + 65x*3/6 + 15x*2/2 - 38x. Factor d(h). 5(h + 1)4(h + 3) Let h = -215/7 + 1030/21. Let m = h - 599/33. What is r in 0r + 0 - mr*3 - 2/11r2 = 0? -1, 0 Let s(t) be the third derivative of t5/60 + t*4/8 - 2t*3/3 - 37t*2. Factor s(o). (o - 1)(o + 4) Let h = 367/260 - 11/52. Let -1/5x5 + 0 + 4/5x*4 - hx*3 - 1/5x + 4/5x2 = 0. Calculate x. 0, 1 Factor 2/5h*3 + 0 - 2/5h + 0h2. 2h(h - 1)(h + 1)/5 Let a(x) be the third derivative of x6/480 - x5/80 + x4/32 - x3/24 - 14x2. Suppose a(t) = 0. What is t? 1 Let o(g) be the third derivative of -g8/84 - 8g*7/105 - 2g*6/15 - 48g*2. Let o(h) = 0. Calculate h. -2, 0 Determine r, given that -3/2r*2 + 0 - 3/4r*3 - 3/4r = 0. -1, 0 Let k(g) be the third derivative of 5g8/336 - g7/21 - g6/24 + g5/6 + 16g2. Let k(w) = 0. What is w? -1, 0, 1, 2 Let d(o) be the first derivative of o5/50 + o4/40 - o3/30 - o*2/20 + 15. Factor d(y). y(y - 1)(y + 1)2/10 Let q(x) be the third derivative of x8/84 - 2x7/35 + x6/15 + 2x5/15 - x4/2 + 2x*3/3 - 3x*2. Factor q(k). 4(k - 1)*4(k + 1) Let d(q) be the first derivative of 5/4q2 + 3/2q - 10 - 1/8q4 + 1/6q*3. Find g such that d(g) = 0. -1, 3 Let j = -7 - -11. Suppose -z - 1 - 4 = 4b, -2z = jb + 10. Let -2/3m + 2/3m*2 + b = 0. What is m? 0, 1 Let y(q) = 66q*3 - 12q. Let k(v) = v*2 - v. Let f be k(-1). Let u(x) = 5x*3 - x. Let g(r) = fy(r) - 27u(r). Factor g(d). -3d(d - 1)(d + 1) Suppose s - 6 + 4 = 0. Suppose -17u2 - 8u*s - 8u + 29u2 = 0. Calculate u. 0, 2 Let t = 196/9 - 64/3. Determine m so that 4/9m - 2/9m2 + 0 - tm*3 + 2/9m*4 = 0. -1, 0, 1, 2 Let u be (-5)/(10/6) - -5. Let -2g + g + 0g2 - 2g*2 + 0g*u = 0. Calculate g. -1/2, 0 Let f(q) be the first derivative of 16q*5/5 + 11q*4 + 12q*3 + 2q*2 - 4q + 9. Factor f(z). 4(z + 1)3(4z - 1) Let u(w) = -5w*5 - 10w*4 - 18w*3 - 12w*2 - 9w + 2. Let z(b) = b5 + b4 + b3 - b2 - 1. Let n(y) = -u(y) - 4z(y). Factor n(l). (l + 1)4(l + 2) Let k be 1/4 - 15/(-4). Let r = k + -2. Factor v*3 - 1/2v*4 - 1/2v*r + 0v + 0. -v*2(v - 1)*2/2 Let v be 2-12/(-2). Factor -4a*3 - 4a*4 - 1 + 3a*4 - 4a - va - 6a*2 + 2a. -(a + 1)4 Let m(y) = y2 + 8y + 15. Let f be m(-5). Factor -2/7z*2 + 0 - 2/7z*3 + fz. -2z2(z + 1)/7 Let v(x) be the second derivative of x*4/6 + 2x*3/3 + 6x. Factor v(m). 2m(m + 2) Let j(o) be the second derivative of o*4/6 - 2o*3/3 + 9o. Factor j(n). 2n(n - 2) Factor 2/13k2 - 2/13 + 2/13k - 2/13k3. -2(k - 1)*2(k + 1)/13 Let u(h) = 2h2 - 7h - 1. Let a be u(5). Suppose 0 = 4n + l - a, 2n + l = -2l + 12. Find y such that -9/2 - 1/2y*2 - ny = 0. -3 Let c(x) be the first derivative of -7x4/16 + 5x3/12 + x2/4 - 3. Factor c(n). -n(n - 1)(7n + 2)/4 Factor 0v - 8/9v3 + 8/9v*2 + 0 + 2/9v*4. 2v*2(v - 2)*2/9 Let u(x) = -14x - 68. Let n be u(-5). Let -4/3h2 - 1/3h*5 + 0 - nh*3 - 1/3h - 4/3h4 = 0. Calculate h. -1, 0 Let t = -2/511 - -521/2555. Let o = -71 + 359/5. Factor o + i2 - ti*3 - 8/5i. -(i - 2)*2(i - 1)/5 Let q(r) be the second derivative of -r4/78 - r3/39 + 2r2/13 + r. Suppose q(x) = 0. Calculate x. -2, 1 Let h(i) be the first derivative of -2i*3 + 9i*2/2 + 6i - 2. Factor h(v). -3(v - 2)(2v + 1) Let d = 2/5 - 1/5. Let i be (2/(-10))/(1 + -2). Factor -d - il*2 + 2/5l. -(l - 1)*2/5 Let h = 135/28 - 25/7. Let m(r) be the first derivative of 1 + hr*4 + 9/2r*2 + 2r + 4r3. Factor m(t). (t + 1)2(5t + 2) Let h(r) = -r4 - r3 + r2 + r. Let o(x) = 9x*4 - 6x*3 - 8x*2 - 5x. Let j(b) = 10h(b) + 2o(b). Factor j(m). 2m2(m - 3)(4m + 1) Let w be (-5 - -2)(-2)/6. Factor 0 + 1 + w - 2z*2. -2(z - 1)(z + 1) Let l(b) = 4b + 23. Let n be l(-5). Suppose 11 = ng - 1. Factor 0 - 3/2j*2 + 3/2j*3 - 1/2j*g + 1/2j. -j(j - 1)3/2 Let h(y) be the third derivative of -2y5/15 - y4/4 + y*3/3 - 11y*2. Determine g, given that h(g) = 0. -1, 1/4 Let h = 86/27 - 568/297. What is c in -8/11c*2 + hc*4 + 8/11c*5 + 28/11c - 6/11 - 36/11c3 = 0? -3, -1, 1/4, 1 Let v(q) be the first derivative of -60q*5 - 65/2q*4 + 125/3q*6 + 16q + 1 + 284/3q3 - 60q*2. Let v(b) = 0. Calculate b. -1, 2/5, 1 Let g(u) be the third derivative of 0 + 1/14u*4 + 1/210u*5 - 2u*2 + 0u + 3/7u3. Let g(m) = 0. Calculate m. -3 Factor -12/7o*3 + 1/7o*5 + 6/7 + 11/7o - 4/7o4 - 2/7o*2. (o - 6)(o - 1)(o + 1)3/7 Let l(a) be the third derivative of a7/840 - a5/30 + 2a*3/3 + 35a2. Factor l(i). (i - 2)2(i + 2)2/4 Let u be 10(34/10 + -3). Factor -9h3 + hu + 5h*3 - 2h*2 - 3h*4. -2h*2(h + 1)*2 Let b(d) = -2d**3 - d. Let	{ "pile_set_name": "DM Mathematics" }
Let g(o) = -o*3 + 9o*2 + 21o + 2. What is g(11)? -9 Let p(j) = -2j3 + 6j*2 - 5j + 13. Give p(4). -39 Let p(n) = -2n2 - 3n. Determine p(7). -119 Let u(n) = 11n - 59. Calculate u(6). 7 Let g(k) = -3k - 30. Calculate g(-8). -6 Let q(s) = 8s - 185. Give q(24). 7 Let t(o) = o3 + 3o*2 - 11. Calculate t(-5). -61 Let z(f) = 11f*2 + 5f - 1. Determine z(-2). 33 Let t(q) = q*3 + 7q*2 + 4q + 5. Calculate t(-5). 35 Let b(x) = x*3 + 7x*2 + x + 8. Calculate b(-7). 1 Let z(d) = 2d*2 - 20d + 3. Calculate z(11). 25 Let u(x) = x*2 - 8x + 2. Determine u(7). -5 Let d(n) = -n - 7. Determine d(-7). 0 Let h(a) = a*2 + 3a + 1. Calculate h(4). 29 Let h(v) = -v*2 + 9v - 1. Calculate h(16). -113 Let t(p) = -3p3 - 4p*2 + 2p + 2. Calculate t(-2). 6 Let f(w) = -5w2 + 59w + 18. Determine f(12). 6 Let x(q) = 20q2 - q + 1. Determine x(1). 20 Let c(u) = -u2 - 11u - 2. Calculate c(-12). -14 Let h(v) = -v*2 + 8v - 40. Determine h(5). -25 Let z(d) = -2d - 61. Give z(-13). -35 Let z(t) = -t3 + 2t*2 + 2t. Calculate z(2). 4 Let d(x) = x*3 - 8x*2 - 3x + 9. What is d(8)? -15 Let y(a) = -a*2 + 18a - 21. Give y(15). 24 Let d(f) = 10f2 - f - 1. What is d(-1)? 10 Let p(r) = r3 + 5r*2 - 7r - 11. Give p(-6). -5 Let h(f) = f*3 - 2f*2 - 3f + 8. Calculate h(6). 134 Let w(h) = -42h. Calculate w(-1). 42 Let r(k) = -k - 34. What is r(0)? -34 Let y(i) = 2i*3 - 11i*2 - 4i. Give y(5). -45 Let g(k) = 5k - 14. Determine g(-10). -64 Let r(h) = -h2 + 10h + 1. Give r(10). 1 Let b(r) = r*2 - r - 1. Give b(-12). 155 Let w(i) = -12i*2 - i - 3. What is w(2)? -53 Let q(k) = -5k + 82. Give q(12). 22 Let x(u) = -33u + 58. Determine x(2). -8 Let j(u) = -u3 + 3u*2 + 5. What is j(5)? -45 Let d(x) = 2x*3 + 26x*2 - 29x + 2. What is d(-14)? 16 Let q(f) = -174f - 698. Give q(-4). -2 Let q(i) = 3i*2 + 41i - 15. Calculate q(-9). -141 Let f(j) = j*3 - 5j*2 - 10j + 3. Determine f(6). -21 Let w(k) = 4k + 18. What is w(-6)? -6 Let t(b) = 11b*2 + b. Give t(2). 46 Let b(x) = x + 22. Give b(-17). 5 Let k(f) = -3f + 13. Calculate k(0). 13 Let x(y) = 4y - 24. Give x(9). 12 Let t(j) = 2j*2 - 26j + 120. Determine t(6). 36 Let w(u) = -u*3 - 4u2 + u. What is w(-3)? -12 Let p(d) = -d2 + 26d - 63. What is p(26)? -63 Let n(c) = 11c*2 + 4c + 3. Determine n(-1). 10 Let r(l) = -l*2 - 14l - 14. What is r(-13)? -1 Let k(i) = i*3 - 15i*2 - i - 21. What is k(15)? -36 Let j(k) = -5k - 10. What is j(-9)? 35 Let h(z) = 2z2 - z - 5. Calculate h(-3). 16 Let h(t) = -2t3 + t2 + 6t - 6. What is h(1)? -1 Let m(s) = 24s + 41. Determine m(-4). -55 Let y(t) = -t*3 - 4t*2 - 3t - 5. Give y(-3). -5 Let h(k) = k - 14. Calculate h(9). -5 Let k(u) = 3u - 9. Calculate k(8). 15 Let b(d) = -10d - 64. Calculate b(-6). -4 Let g(u) = 7u + 58. Give g(-11). -19 Let x(d) = 2d - 28. What is x(15)? 2 Let b(n) = 2n3 + 14n*2 + 3n - 61. Determine b(-6). -7 Let z(b) = -b + 14. Calculate z(12). 2 Let r(k) = k*3 + 3k*2 + 3k + 3. Give r(-3). -6 Let w(a) = a*3 + 5a*2 - 3a - 11. Calculate w(-5). 4 Let i(q) = -q*3 - 8q*2 - 8q - 2. What is i(-7)? 5 Let m(h) = h + 84. Calculate m(14). 98 Let n(k) = 2k3 + 2k2 - k - 4. Calculate n(3). 65 Let f(r) = -r2 - 32r + 128. Determine f(-36). -16 Let w(r) = -377r - 1511. What is w(-4)? -3 Let h(x) = x*2 - 11x + 17. What is h(9)? -1 Let i(b) = -31b + 27. Calculate i(4). -97 Let a(k) = -k2 - 4k - 52. Calculate a(-8). -84 Let q(h) = -11h - 7. Determine q(-6). 59 Let c(n) = -2n*3 - 8n*2 - 5n - 3. What is c(-5)? 72 Let x(a) = a*3 - 10a2 + 3. Calculate x(10). 3 Let x(f) = -f2 + 7f - 13. Calculate x(6). -7 Let k(f) = -f3 - 2f*2 - f - 5. Give k(-4). 31 Let c(l) = 3l + 4. Calculate c(-10). -26 Let t(g) = g*3 + 2g + 2. What is t(-2)? -10 Let h(t) = 2t2 - 129t - 478. Give h(68). -2 Let n(j) = j*2 + 23j + 141. Calculate n(-9). 15 Let l(t) = -t - 16. Calculate l(-8). -8 Let v(g) = g + 10. Calculate v(-4). 6 Let p(l) = 4l2 - 162l - 81. What is p(41)? 1 Let i(n) = 45n3 + n2 + 2n - 2. Determine i(1). 46 Let q(n) = 2n + 33. Give q(-10). 13 Let w(c) = -c3 - 7c + 5. Calculate w(-4). 97 Let j(w) = -w*2 - 6w + 14. Give j(-7). 7 Let y(g) = -g*2 + 15g - 17. Give y(13). 9 Let l(i) = -2i - 1. Give l(-1). 1 Let n(c) = c3 + 15c*2 - 17c - 7. Give n(-16). 9 Let r(j) = j*2 - 8j - 2. Determine r(7). -9 Let p(r) = -r*3 + 14r*2 - 14r + 19. Determine p(13). 6 Let h(g) = -10g - 5. Give h(1). -15 Let x(y) = y3 - 2y*2 - 7y - 1. What is x(4)? 3 Let y(g) = 11g - 26. Give y(19). 183 Let m(f) = f3 - 9f*2 + 5f + 55. Calculate m(9). 100 Let q(h) = 3h - 6. Give q(6). 12 Let r(m) = -m2 + 32m + 14. What is r(26)? 170 Let q(b) = -b*3 - 17b*2 - 23b - 111. Calculate q(-16). 1 Let t(g) = g*2 - 2g + 5. Give t(3). 8 Let k(y) = 30y - 255. Determine k(8). -15 Let j(k) = k3 - 8k*2 - 3k - 16. Determine j(9). 38 Let h(w) = 7w - 50. Determine h(6). -8 Let q(g) = -g3 + 11g*2 + 9g + 12. What is q(12)? -24 Let z(x) = -3x3 + 6x*2 - 10x + 3. Calculate z(4). -133 Let d(s) = s*2 - 32s + 51. What is d(30)? -9 Let a(f) = -2f3 + 8f*2 + 14f - 17. What is a(5)? 3 Let r(d) = 4d + 54. Give r(-11). 10 Let y(w) = -w3 - 8w*2 - 2w - 12. Determine y(-8). 4 Let h(b) = -9b - 38. Give h(-4). -2 Let s(p) = 2p*3 + 2p*2 - 2p - 3. Calculate s(-2). -7 Let k(n) = -2n - 4. Calculate k(-4). 4 Let m(i) = -3i*2 + 3i + 5. Give m(0). 5 Let r(i) = -35i3 - 2i - 1. What is r(-1)? 36 Let y(j) = -16j - 14. Give y(-1). 2 Let s(k) = -k2 + 14k + 15. Determine s(15). 0 Let m(x) = 2x - 2. Determine m(1). 0 Let q(w) = 18w3 - w2 - 3w + 11. Calculate q(2). 145 Let f(g) = 2g*3 + 27g*2 + 15g + 29. Calculate f(-13). 3 Let o(n) = n*3 - 14n*2 + 11n + 15. Give o(13). -11 Let v(z) = -z*2 - z - 1. Calculate v(0). -1 Let o(b) = 14b*2 + 4b - 4. Determine o(1). 14 Let o(r) = 20r2 + 2r + 2. What is o(-1)? 20 Let n(j) = 2j2 - 6. Give n(5). 44 Let x(g) = g3 + 25g*2 + 46g - 9. Give x(-23). -9 Let w(k) = k*3 - 23k*2 + 60k + 7. Calculate w(20). 7 Let l(w) = w*3 - 8w*2 + 12w + 5. What is l(4)? -11 Let b(q) = q - 2. Calculate b(-2). -4 Let j(l) = -l*2 + 13l - 8. Give j(9). 28 Let x(c) = -c*2 - 5c + 6. Calculate x(-6). 0 Let p(r) = -r*2 + 4r + 6. Calculate p(4). 6 Let p(y) = 2y2 + 2y - 1. Determine p(-2). 3 Let f(s) = 3s3 - 3s2 - s - 5. Give f(2). 5 Let p(s) = s2 - 17s + 23. Give p(16). 7 Let x(n) = n2 + n + 4. Calculate x(-2). 6 Let p(n) = -n2 - 8n + 58. What is p(-13)? -7 Let z(l) = -l*3 - 7l*2 - 6l - 4. Calculate z(-4). -28 Let z(u) = u3 + u2 - 5u - 3. Give z(-5). -78 Let p(l) = -l - 5. Calculate p(-11). 6 Let a(z) = 7z*2 + 152z + 106. Calculate a(-21). 1 Let h(q) = -8q - 16. Determine h(0). -16 Let s(x) = -x3 - 5x*2 + 10x + 3. Determine s(-7). 31 Let m(v) = -v*2 - 12v + 14. Calculate m(-13). 1 Let d(i) = i + 57. Calculate d(0). 57 Let t(a) = a*2 + 4a - 30. What is t(-7)? -9 Let m(f) = 2f3 - 29f*2 + 15f + 17. Calculate m(14). 31 Let u(f) = -25f2 + 2f - 4. Determine u(1). -27 Let s(i) = i + 2. What is s(3)? 5 Let g(z) = 2z - 10. Calculate g(4). -2 Let n(d) = -d3 + 6d*2 + 2d + 19. Determine n(8). -93 Let r(y) = -3y - 30. Calculate r(-9). -3 Let r(w) = -w3 + 9w*2 + 9w + 12. Give r(10). 2 Let z(x) = -x - 14. Calculate z(-16). 2 Let b(a) = a*3 - 3a*2 - 2a + 5. Give b(4). 13 Let g(l) = -2l3 + 13l*2 - 8l + 1. Calculate g(6). -11 Let i(u) = -5u2 - 19u - 5. What is i(-3)? 7 Let c(h) = -2h3 - h2 - 6h - 4. Determine c(-1). 3 Let k(x) = -4x - 81. Give k(-14). -25 Let f(t) = -24t*2 - 2t + 1. Give f(1). -25 Let i(h) = 47h + 278. What is i(-6)? -4 Let x(g) = -g2 - 6g - 4. Calculate x(-4). 4 Let x(m) = -m*3 + 6m2 - 6. What is x(6)? -6 Let v(g) = -g3 + 9g2 - 7g - 10. Calculate v(8). -2 Let v(t) = t - 14. Calculate v(18). 4 Let y(b) = b - 9. What is y(4)? -5 Let y(d) = -d*3 - 6d*2 + 7d + 7. Give y(-7). 7 Let p(w) = -7w + 12. Calculate p(-9). 75 Let t(j) = -8j - 20. What is t(-3)? 4 Let t(u) = u + 1. Give t(3). 4 Let s(c) = c - 19. Give s(6). -13 Let w(o) = 3o + 9. Calculate w(-2). 3 Let v(o) = -o3 - 8o*2 - 10o	{ "pile_set_name": "DM Mathematics" }
51b2 + 14566b - 2658 wrt b? 653526b - 1102 Find the third derivative of 180034w*3z*4 - 2w*3z*2 + 384w*2z*2 - 462wz2 - 40z*4 wrt z. 4320816w*3z - 960z What is the third derivative of 8424889z*3 - 8384513z2 wrt z? 50549334 Differentiate -k4q - 1540062kq2 + 19831023q*2 wrt k. -4k*3q - 1540062q2 Differentiate 831179a*3m - a*3 - 36am + 216106a + 12 with respect to m. 831179a3 - 36a Find the third derivative of 16463f4 + 457f*3 + 18f*2 - 12f - 418 wrt f. 395112f + 2742 What is the third derivative of -7127871r*4 - 15r*3 - 63769r*2 + 809? -171068904r - 90 What is the third derivative of -9754a3s*2 - 6719a*3 + 2a*2 + 5as2 + 2296as - 6a wrt a? -58524s2 - 40314 Differentiate -27404687n*4 - 24336199 wrt n. -109618748n*3 Find the third derivative of 17851h*4m - 10h4 + 2h*3 + 345h*2m + 9634m wrt h. 428424hm - 240h + 12 Find the first derivative of 147786h3k - h*3 - 94hk + 32586918k - 2 wrt h. 443358h2k - 3h2 - 94k Find the third derivative of 16c3u - 278002c3 + 51c*2u - 2cu + 9609c wrt c. 96u - 1668012 What is the derivative of -3b3d*2 - 3486493b*3 - 36d*2 + 86058d wrt b? -9b2d*2 - 10459479b*2 Differentiate -105752d*2v + 159d2 + 33637383v with respect to d. -211504dv + 318d Differentiate -63j*2m - 1595j2 + 2jm3 + 5j + m*3 + 139m*2 - m + 7178 with respect to j. -126jm - 3190j + 2m3 + 5 What is the third derivative of -3d*3v*3 - 6d*3v*2 + 1227154d3 - d2v - 42dv3 + 7057dv wrt d? -18v*3 - 36v*2 + 7362924 What is the second derivative of 5845460f*5 - 26f*2q*2 + 2489206fq2 + 16q*2 wrt f? 116909200f*3 - 52q*2 What is the first derivative of 29778v*3 - 39v + 18264512 wrt v? 89334v2 - 39 Differentiate -219679w*2 - 5w + 4615945 with respect to w. -439358w - 5 What is the second derivative of -569176040s*2t*2v + 64s2t - 1977sv + 5s + 2v wrt t? -1138352080s2v What is the second derivative of -11062740m2 - 7814525m wrt m? -22125480 What is the third derivative of -9588745m3 + 222m*2 - 23906m? -57532470 What is the third derivative of 99400926o3y2 + o2y - 10o*2 + 1638oy2 + 19y*2 wrt o? 596405556y*2 What is the second derivative of 828726920t*2 + 151594529t? 1657453840 What is the second derivative of 446329204j2 - 503984627j wrt j? 892658408 Find the second derivative of 961718j3s3 + j3s - 50j*3 - 148j*2s*3 - 6100js - 2j + 2s wrt s. 5770308j*3s - 888j2s What is the derivative of -81943411l - 261904432 wrt l? -81943411 Find the first derivative of 538m*2 - 3162m + 44598594 wrt m. 1076m - 3162 Differentiate 247kp + 51860232k - 37056p + 2 wrt p. 247k - 37056 Find the third derivative of -13245193dm*4 - 17dm2 - 18dm + 8m*5 - 13641m*2 - 1 wrt m. -317884632dm + 480m*2 What is the second derivative of -960g*3h*2t - 13744g3ht - 2801gh2t - 123gh*2 - ght + 2gt + 2g wrt g? -5760gh*2t - 82464ght Find the second derivative of 234811741y*2 - 154y + 261566. 469623482 Differentiate -207369718i + 177935058. -207369718 What is the third derivative of 29710984o*4 - 48137o*2 + 29o? 713063616o Find the third derivative of j2o4 - j2o2 - 71j*2 + 171662670jo6 + 5jo2 + 50jo + 10j wrt o. 24j2o + 20599520400jo*3 Find the second derivative of 381972012f*2 + 406490958f wrt f. 763944024 Differentiate -b*3m*3 + 1133076b*3m*2 - 31b*3 - 1523b*2 - 21b wrt m. -3b3m*2 + 2266152b*3m Differentiate -31368c3 + 3c*2 + 3c - 17913934 with respect to c. -94104c2 + 6c + 3 Find the third derivative of -103829p3y + 2p3 + 3p*2y - 259423p2 wrt p. -622974y + 12 What is the second derivative of 1407p5 - 2263p4 - p2 - 4735092p wrt p? 28140p*3 - 27156p*2 - 2 Find the third derivative of -9902aq3 - 247aq2 + 2aq + 152q*3 + 653q*2 wrt q. -59412a + 912 Differentiate -1623197k2t*2 - 24214352k*2 wrt t. -3246394k*2t What is the first derivative of -v*3 + 2v*2 - 22646365v - 44996063? -3v2 + 4v - 22646365 What is the first derivative of 394j4 + 437j*2 + 2j - 9765563? 1576j3 + 874j + 2 Find the second derivative of 805101444k3q*2 + 2k*3 + 2k*2 + 58kq + 170q + 2699 wrt q. 1610202888k3 Differentiate 1440321310n - 946086583 wrt n. 1440321310 What is the third derivative of -7bg + 2bi*3 - 2bi2 - 218b + 241624525gi*3 - 82gi2 - 3g + 1 wrt i? 12b + 1449747150g What is the second derivative of 66o3x*3 + 10o*3 - 57455o*2x*3 + 2o*2 + 41048ox wrt x? 396o*3x - 344730o2x What is the derivative of 1354m4 - 3m*3 - 548m*2 - 23959091? 5416m*3 - 9m*2 - 1096m What is the third derivative of -30b3km + 37769b*3m*2x2 - b2kmx + 1801bkm*2x*2 - 5km2x*2 + 2m*2x - 84x2 wrt b? -180km + 226614m*2x*2 What is the second derivative of -2pu2 + 252pu - 37920270u*3 + 26364u + 10 wrt u? -4p - 227521620u What is the third derivative of -n*2u*4 - 3n*2u*2 - 2n*2 + 509633nu4 - 5nu2 + 5u*3 + 191396u*2 + 2 wrt u? -24n*2u + 12231192nu + 30 What is the derivative of -548385707m - 435615376 wrt m? -548385707 Differentiate 1350kv3 - 65091816k + 3v4 - 470v - 1 with respect to v. 4050kv*2 + 12v*3 - 470 What is the first derivative of 26c*3g - 27c3 - 13c*2 + 1018c - 4594395g2 - 79 wrt g? 26c*3 - 9188790g Find the second derivative of 51402kw*2 + 2kw + 3920696k + 48w3 wrt w. 102804k + 288w What is the derivative of -59813356gt3 - 32t*3 + 27t*2 + 14027 wrt g? -59813356t*3 What is the derivative of 5g*2 - 27085g + 10440823? 10g - 27085 Find the second derivative of -169613067l*2 - 3l + 29560247. -339226134 What is the first derivative of -3116383y + 15176399? -3116383 Find the third derivative of 5526b*5 + 2b*4 + 695b*3 + 23b*2 - 8458b - 16. 331560b2 + 48b + 4170 Find the third derivative of -2v6 + 3v*4 - 31392418v*3 + 12v*2 - 25v + 83583 wrt v. -240v3 + 72v - 188354508 What is the derivative of -137679448a - 114017305? -137679448 What is the first derivative of 1452540bh - b - 6h + 18066891 wrt h? 1452540b - 6 What is the second derivative of -18447d*2w*3 - 4d*2w + 930d2 - 5dw2 + 2dw - 115w*3 + 7w + 9 wrt w? -110682d2w - 10d - 690w What is the second derivative of -21329473u2 - 337781917u? -42658946 Find the third derivative of -1646d2p3 - d2p2 + 30285d*2p - 26894dp*4 - 2dp2 - 63p*2 wrt p. -9876d*2 - 645456dp Find the third derivative of -43b*5 + 313372b*4 - 2b*2 + 16558096 wrt b. -2580b*2 + 7520928b Find the third derivative of c*5 + 2595c*4 - 7478c*3 + 305c*2 - 196204. 60c*2 + 62280c - 44868 What is the third derivative of 1318443s5 + 47s*3 - 435459s*2 - 677? 79106580s*2 + 282 What is the second derivative of 652721426o*4 - 299834o - 1056? 7832657112o2 Find the second derivative of 282520346z*2 - 16073015z + 1. 565040692 Find the third derivative of -91820704f5 + 75537351f*2. -5509242240f*2 What is the second derivative of -67202247i*4 - 17615217i - 2 wrt i? -806426964i2 Find the second derivative of -47138905v*4 + 1677343v - 23. -565666860v2 Find the third derivative of -241650790j*4 - 2j*2 - 28513866j wrt j. -5799618960j Find the second derivative of 478a*3s*3 - 58a*3s + 9a2s + 134a2 - 1365s*3 - 4 wrt s. 2868a*3s - 8190s Differentiate -974k*2u + 2k2 - 3046ku - 5u + 2897901 with respect to k. -1948ku + 4k - 3046u Find the third derivative of -78976633x4 - 105719039x*2 wrt x. -1895439192x Find the second derivative of y*5 + 536540796y*2 - 550943562y wrt y. 20y3 + 1073081592 What is the third derivative of 12300131s*4 + 7s*3 + 650990513s*2? 295203144s + 42 Find the first derivative of -q*3v + 2q3 - 3qv - 4428474q - 39575v wrt v. -q3 - 3q - 39575 What is the third derivative of 135984o6u - 23o3u - 21o2u + 113ou + 3u wrt o? 16318080o*3u -	{ "pile_set_name": "DM Mathematics" }
t f = -3.5 - -3. Let d = 76.8 + -71. Let c = 6 - d. What is the third biggest value in c, -2, f? -2 Let f(g) = g*3 + 6g*2 - g. Let i be f(-4). Let k be i/(-27) - (-5)/3. Which is the smallest value? (a) -4 (b) k (c) -2 a Let k = 2.6 + -3.2. Let w = 1.6 + k. What is the third biggest value in w, 0.6, 0.5? 0.5 Suppose 3s - y = 2s + 9, 0 = -3s - 3y + 45. Suppose -3p + 0p = -s. Let h be ((-2)/(-14))/((-2)/p). Which is the smallest value? (a) 0.2 (b) 1/3 (c) h c Let o be 24(-1)/2. Let i = 13 - 18. Let j = -149/2 - -73. What is the smallest value in o, i, j? i Let y be (-2)/(-6) + (-99)/(-27). Let n = 0.2 - 1.2. What is the smallest value in n, y, 2? n Let d = -52.2 + 52. What is the third smallest value in -1/8, 2/7, d, 0? 0 Let k = 13 + -15. What is the third biggest value in -5, k, 1.3? -5 Let v = -0.4 - 1.6. Let r = 3.8 + -0.8. Suppose -94 + 88 = -3z. Which is the third biggest value? (a) v (b) z (c) r a Let l be 8/2(-21)/12. Let t = 5 + l. Let u = -0.1 + 0. What is the second biggest value in u, t, -0.2? -0.2 Let v = -43 - -40. What is the fourth biggest value in -4/9, -2/13, -3/5, v? v Let m = -1 - -7. Let p = m + -3. Let x = 8 + -8.3. What is the biggest value in 1/9, x, p? p Suppose -3c = 4q - 2q + 13, 14 = -3q + c. Let u = 21 - 21. What is the second biggest value in -2, q, u? -2 Let s = -1.12 + 1. Let n = s + 0.52. Which is the second smallest value? (a) n (b) -1 (c) -3 b Let h = 12 - 5. Let n = 5 - h. Let q = 8 - 3. Which is the third biggest value? (a) n (b) 3 (c) q a Let f = -83 - -746/9. What is the third smallest value in 0.5, -0.5, 2, f? 0.5 Suppose 2a - a + 2o + 1 = 0, 0 = -2a + 2o + 10. Suppose ab = 7b. Let y = 0.3 + -0.2. What is the second biggest value in b, 3, y? y Let j = 32.3 - 32. Which is the biggest value? (a) -1 (b) 0.2 (c) j c Let a be (-2)/(-7) - 91/147. What is the third smallest value in -0.2, -3, a? -0.2 Let b = -0.465 - 0.035. What is the second biggest value in -5, 2, b, -3? b Let z = -1.1 - -0.6. Let h = -4 - -3.5. Let w = h - 1.5. Which is the third smallest value? (a) w (b) z (c) -0.2 c Let s = -2 + 1. Let a = -3 + s. Let v be 0 - (12/(-4) - -1). What is the third biggest value in 0, v, a? a Let x(q) = -q3 + 4q*2 - q - 4. Let c be x(3). Let d be (-3 + 6 - 3) + c. What is the biggest value in 4/5, d, 1? d Suppose -24 = 4h - 2h. Let z be (-4 - h1)/2. Which is the smallest value? (a) z (b) -2/13 (c) -6 c Let u = -53/2 + 27. What is the smallest value in u, -1, 1? -1 Let z = 0.15 + -0.65. Which is the second smallest value? (a) z (b) -1 (c) -3/4 c Let l(x) = x + 2. Let v be -2 + (-9)/((-6)/(-2)). Let r be l(v). Which is the third biggest value? (a) r (b) 0.4 (c) -3/4 a Let y = -0.05 + 0.02. Let n = -1 + -3. Let h be (-5)/(-15)2/3. Which is the second biggest value? (a) n (b) h (c) y c Let p be ((-4)/(-12))/(5/(-6)). Let z = 61/20 + -9/4. What is the smallest value in p, z, -2? -2 Let q = 47 + -28. Let z = q + -21. Which is the biggest value? (a) -3/4 (b) z (c) -0.5 c Let d = -483/5 + 97. Let p be -1 + 3 - 138/78. What is the smallest value in 3, p, d? p Let i = -14.2 - -14. Let b = 0.3 - 0.1. Let g = b - 4.2. What is the second smallest value in i, g, 0.5? i Suppose -150 = -5c + 5j, -41 - 54 = -4c - j. Suppose -5r + c = -4a, r + 2a = -r - 8. What is the third smallest value in -0.1, r, 2/21? r Let w = 2.9 - -1.1. Let u(m) = m + 8. Let p be u(-4). Let c be 1/p + (-66)/(-24). What is the second smallest value in -1/2, c, w? c Let d be (-13)/((-3)/2). Let q = -0.38 + 0.08. Let h = -0.3 - q. What is the biggest value in h, -0.1, d? d Let y = 13.6 + -0.6. Let u = y + -10. Which is the third smallest value? (a) -3/2 (b) 4 (c) u b Let v = 2.2 + -2. Let t(h) = -8h + 9. Let x be t(1). Which is the third smallest value? (a) 2/17 (b) v (c) x c Let t = -19/6 + 3. Which is the second biggest value? (a) -0.1 (b) t (c) 0 a Let m = 518 + -539.7. Let h = -30 - m. Let p = 8 + h. What is the third smallest value in -1, p, -3/4? p Let t = 3.6 + -4. Let r = 0.2 - 0.2. Let s = 0.1 - r. What is the second smallest value in s, t, -4? t Let o = 0.09 + 0.21. Which is the second smallest value? (a) 0.2 (b) -4 (c) o (d) -1/5 d Let m = 7 - 13. Let d = 9 + m. Which is the third smallest value? (a) 2 (b) -0.4 (c) d c Suppose 3l + l = 8. Let x = 6.04 - 6. Let s = x + -1.04. What is the second smallest value in s, 5, l? l Let i = -14 - -8. Let z be -3(9/i + 1). Which is the second biggest value? (a) z (b) -6 (c) -2/9 c Let n = 18 + -18.1. Let z = -10 - -15. Which is the third smallest value? (a) z (b) 4 (c) n a Let y be (-350)/231 + (-12)/(-66). Let t = 6 - 8. What is the third biggest value in -0.1, t, y? t Let n = -0.046 - 3.954. What is the second biggest value in -1, 3, -0.06, n? -0.06 Let t = 36 - 34. Which is the second biggest value? (a) 5 (b) 8 (c) t a Let g be (-2)/(-4) + -1 + (-4)/16. What is the third biggest value in -2, g, 5? -2 Suppose 0 = -2y + 2. Suppose -2n - 4v + y = -5, 2v = -4n - 12. Which is the biggest value? (a) -0.5 (b) n (c) -3 a Let r = 100 - 103. Let x be (2/4)/(6/(-3)). Which is the third biggest value? (a) x (b) r (c) 0.1 b Let i = 58 - 62. Which is the second biggest value? (a) -0.06 (b) 4 (c) i a Let y = -1 + 0. Let z = -92 - -92.3. Which is the second biggest value? (a) z (b) y (c) -1/4 c Let a = -6/13 + 212/65. Let m be (-82)/(-30) + (-1)/3. Let i = a - m. What is the second biggest value in -5, -1/6, i? -1/6 Let j = 1 - 0.8. Let g = -1.2 + j. Let r be 15/45 + 33/9. Which is the smallest value? (a) 0.4 (b) r (c) g c Let a be ((-12)/9)/(3/(-9)). Suppose 5b = v - 24, -3v + ab + 22 = -b. Let k = 3.93 - -0.07. What is the biggest value in k, v, -0.5? k Let h = 0.066 - 0.366. Which is the biggest value? (a) h (b) 5 (c) -1/6 b Let f be (-5)/12 + (132/(-16))/(-11). Let o = -0.7 + 0.8. Let n = -1 + -5. Which is the biggest value? (a) f (b) n (c) o a Let t(c) = -c - 6. Let d be t(-6). Suppose d = -3j + 8 + 4. Let m = -0.1 - -0.1. What is the second biggest value in m, -2/11, j? m Let a = -3 - -2. Let s = -28 - -33. What is the second biggest value in a, s, 0? 0 Let w = -0.3 - 9.5. Let u = w + 10. Which is the third smallest value? (a) 0.1 (b) u (c) -2/9 b Let g(v) = 4v3 - v2. Let j be g(-1). Which is the third smallest value? (a) j (b) 0.5 (c) -2 b Let o = 5.19 - 0.19. Which is the second smallest value? (a) o (b) -0.5 (c) 0.4 c Let v = -17 - -21. Let w be (5 - 1)2/(-12). What is the smallest value in v, -7, w? -7 Let f = 56.7 + -53.67. Let l = -0.03 + f. Let i = 2.5 - l. Which is the third smallest value? (a) i (b) -3 (c) 1/8 c Let h = 0.5 - 0.53. Let o = h - 2.97. What is the third biggest value in 0, -0.3, o? o Let k = -0.29 - 2.31. Let v = 0.6 + k. Which is the biggest value? (a) -5 (b) v (c) 5 c Let m = 10.537 + -0.037. Let u = -0.5 + m. Let p = u + -12. What is the biggest value in 0.5, p, 3? 3 Let s = 93 - 93. What is the second smallest value in -0.1, 2/5, s, 3/7? s Let q(z) be the first derivative of 2 + 1/2z2 + 0z. Let d be q(-4). What is the smallest value in -0.5, -1, d? d Let f = 0.07 + 0.03. Let m = -1/105 + 1/7. What is the third smallest value in 2/5, f, m? 2/5 Let k = 38 + -40. Let s be (-7)/9 + (-1)/(-1). Which is the third smallest value? (a) -1 (b) k (c) s c Let a = -0.43 + -3.37. Let c = a - -3. Let y = -0.6 - c. What is the third biggest value in y, -5/2, 1/4? -5/2 Suppose 10 = -0p + 5p. Which is the biggest value? (a) 2/5 (b) p (c) 1/2 b Suppose -5g + 5m + 4 = -26, -4g - 2m = -6. Which is the third smallest value? (a) 2/11 (b) g (c) 1/4 b Let u(m) = -m*3 + 5m*2 - m + 6. Let q be u(5). Suppose -5p = 20 - 5. Which is the biggest value? (a) q (b) 1/10 (c) p a Let g = -11/6 - -13/6. Which is the second smallest value? (a) -1 (b) -0.3 (c) g b Let z = 0.7 - 1.1. Let d = 0 + 6. Let l be -2 + (d/(-4))/(-1). Which is the third smallest value? (a) 0.5 (b) l (c) z a Suppose -k = -4m, k - 5 + 4 = 3m. Let u be (9/18*10)/(-2 - -1). What is the biggest value in k, -3, u? k Let x = -0.005 - -0.305. Let f = 1043/2286 - 3/254. Which is the second biggest value? (a) -3/4 (b) f (c) x c Let g(i) = -i + 6. Let d be g(0). What is the	{ "pile_set_name": "DM Mathematics" }
t - v = -7. Suppose 2 = -3n - j, -tn + 5j - 26 = n. Sort 4, n, 3. n, 3, 4 Let s = 3 - 3. Let y be (-26)/(-10) + (-2)/(-5). Sort 5/3, y, s in decreasing order. y, 5/3, s Suppose 4w - 2w - 5p = 15, 3w - 20 = 5p. Sort w, -3, 1, -2 in descending order. w, 1, -2, -3 Let u = -15 - -22. Put 1/6, -0.5, u in ascending order. -0.5, 1/6, u Let r be (-2)/7 - (-52)/(-14). Let i(b) = 5b3 + b - 1. Let g be i(1). Suppose 14 = 5u + 3s, -2u - gs = -u + 6. Sort r, -3, u in decreasing order. u, -3, r Let z = -22 + 21.7. Sort -5, z, 4/5, 1/3. -5, z, 1/3, 4/5 Let s = 89/588 - -3/196. Put s, -0.2, -5 in ascending order. -5, -0.2, s Let x = -2.6 - 2.4. Sort 0, 1/6, x. x, 0, 1/6 Let j = 109 + -109. Sort j, 2, 4 in increasing order. j, 2, 4 Let c be -2 - -4 - -1 - -2. Put c, 3, -11 in decreasing order. c, 3, -11 Suppose 3t = 4g + 2 + 21, 4t - 16 = -2g. Sort 3, 0, g, 2 in descending order. 3, 2, 0, g Let x(o) = -o3 - 5o*2 - 4o - 2. Let h be x(-3). Sort 5, h, -5 in decreasing order. 5, -5, h Let k = -62 - -58. Sort 3, 4, k, 1. k, 1, 3, 4 Let a = 563/740 + -2/185. Put a, -0.1, -1 in ascending order. -1, -0.1, a Let b(t) = 2t2 - 17t - 12. Let n be b(9). Sort n, -4, 2 in ascending order. -4, n, 2 Let k = 0.8 + 0.2. Let f = -98 + 101.9. Let y = -4 + f. Put y, -2, k in descending order. k, y, -2 Suppose -u = 4u + 695. Let l = -212 - u. Let g = l - -437/6. Put 2/5, 0.1, g in descending order. 2/5, 0.1, g Let d be (0 + -1)/((-8)/32). Suppose 0h + h + 5j - 9 = 0, -2h + 4 = -dj. Let u(t) = -t3 + t2 - 4. Let g be u(0). Sort g, 3, h. g, 3, h Let s = -0.07 - -0.17. Sort -5, 1/4, s in descending order. 1/4, s, -5 Let a = -11 - -14. Let n = 0.3 - 0.5. Put n, a, 2 in descending order. a, 2, n Let k = -13 - -13. Put 1, k, -0.2, 0.5 in ascending order. -0.2, k, 0.5, 1 Let d = 29 + -30. Let l(i) = 10i - 4. Let f(k) = -9k + 3. Let a(v) = 5f(v) + 4l(v). Let n be a(d). Put 3, 0, n in descending order. n, 3, 0 Let u = 0.49 + 0.01. Put 1, -3, u, -18 in descending order. 1, u, -3, -18 Suppose 0g - 14 = 2d + g, 2d - 4g + 4 = 0. Sort -5, d, -2, 5 in ascending order. d, -5, -2, 5 Let n = -379/700 + -3/100. Let r = -1/27 + 7/27. Let s be 3/((-2)/(-8) + -1). Put n, s, r in descending order. r, n, s Suppose 8 = -b + 3b. Let o(t) = t*3 + 3t*2 - 3t + 3. Let w be o(-3). Suppose -2g + 0v + 2v = w, -16 = 2g - 3v. Put g, -3, b in increasing order. -3, g, b Let r(o) = -o2 - 8o - 5. Let m be r(-7). Suppose mf = -2p + 4, -f - 2p - 3p = 2. Sort 4, -5, f in ascending order. -5, f, 4 Suppose -n + 2u - 5 = 0, 25 = -6n + n + 4u. Sort -2, -0.5, n. n, -2, -0.5 Let y be 2/3 - (-16)/(-33). Let d = y + 29/22. Put -5/2, -5, d in decreasing order. d, -5/2, -5 Let k be (-9)/(-15) + -1 + (-162)/45. Put -5, -6, k in ascending order. -6, -5, k Suppose -b - 1 = 0, 1 = -6n + 2n - 5b. Let j(u) = 3u2 + u + 2. Let l be j(-1). Sort l, -3, n. -3, n, l Let r(n) = -12n - 20. Let w be r(-4). Put 5, w, -2 in descending order. w, 5, -2 Let s = 0.1 + -0.06. Let m = 1 - -1. Sort -5, m, s in ascending order. -5, s, m Let j be 4/24-1(-3)/(-2). Put 1, 0.2, 0, j in ascending order. j, 0, 0.2, 1 Suppose 0v = -5v - 45. Let b = v - -8. Sort 0.1, b, 1 in descending order. 1, 0.1, b Let d be (-10)/(-6) + -1 - 0. Let w = 577 - 581. Sort 1/5, d, w in descending order. d, 1/5, w Let d(c) = -11c + 3 + 10c + 8. Let r be d(8). Put 6, r, -3 in ascending order. -3, r, 6 Let c be ((-24)/40)/((-3)/2). Let q = 0.6 + -0.7. Let h = -0.3 - q. Put -0.1, h, c in ascending order. h, -0.1, c Let s be 22/35 - 13/65. Let d be (-3)/21/9. Put 5, d, s in decreasing order. 5, s, d Let n(f) = f + 14. Let w be n(-10). Sort 3, -3, w, 1 in descending order. w, 3, 1, -3 Let f be 0 + (0 - (2 - 4)). Sort f, 0, 0.5 in decreasing order. f, 0.5, 0 Let s = -3 + -3. Let i = 6.4 + s. Suppose 2k + 5 = 3. Sort 0.3, i, k. k, 0.3, i Let v = 18 - 12. Let y = v - 6. Sort 0.1, y, -2/11 in increasing order. -2/11, y, 0.1 Suppose 0o - 3o + 9 = 0. Let c = 17 + -13. Suppose -s + c = -2s. Sort s, o, -2 in descending order. o, -2, s Let o = -1.41 - 0.59. Sort o, -3/2, -4 in descending order. -3/2, o, -4 Let x = 0.8 - 0.3. Let k(w) be the third derivative of w6/120 + w5/10 + w4/4 + w3/6 + 9w*2. Let b be k(-5). Sort b, -0.5, x in ascending order. b, -0.5, x Suppose 0 = -0h - 5h. Let y = h - -12. Let u be (9/y)/((-18)/(-4)). Put 5, 4, u in increasing order. u, 4, 5 Let q be 4/10 + (-21)/15. Let p be (q + -30)(0 + -1). Let v = -216/7 + p. Put -0.2, v, 2/21 in ascending order. -0.2, 2/21, v Let g = 0.15 - -0.35. Put g, -5, 0.2 in descending order. g, 0.2, -5 Let o = -1.9 + 1.5. Sort 3/4, -2, o. -2, o, 3/4 Let f = 535/5643 - 2/513. Put -3, -5, f in ascending order. -5, -3, f Let p be -7 - ((-12)/4 + 6). Put p, 5, -3 in increasing order. p, -3, 5 Let s(l) = l*2 + 9l + 9. Let v be s(-9). Let w be 2 + v/((-6)/2). Let z be -1 + 1 - -1 - 0. Sort z, w, -4. -4, w, z Let q(s) = s. Let o be q(1). Suppose 5 = -3y + w, 4y = -5w + 3w - 20. Put o, 4, y in increasing order. y, o, 4 Let y(o) = o3 - o2 - 4o - 1. Let z be y(3). Let g = -16 - -9. Let p be ((-14)/g)/((-1)/(-2)). Sort p, 1, z in descending order. z, p, 1 Let v = -5.9 - -6.4. Put -2/5, v, 2 in decreasing order. 2, v, -2/5 Let j = -950/63 - -104/7. Let y = 7.2 + -6. Let m = 1 - y. Put 1, m, j in descending order. 1, m, j Let j be (3 + -1)/(5/10). Suppose 5k - 11 = -3r - r, 3r = 12. Let l be (k - 3/(-5))/1. Put 0.2, j, l in descending order. j, 0.2, l Let w(z) = 3z2 - 1. Let h be w(1). Sort 6, -1, h in descending order. 6, h, -1 Suppose 2q - 12 = -q. Sort q, -2, -4. -4, -2, q Let u = 38.7 + -38. Let f = 3.07 + -0.07. Put f, 3/8, u in increasing order. 3/8, u, f Suppose u - 12 = 5u. Let l = 1 + -1. Sort u, l, -5 in descending order. l, u, -5 Let i = 2 + 6. Let d be 42/i - 10/40. Sort 3, -5, d in decreasing order. d, 3, -5 Suppose -50s = -54s + 4. Let c be (-2)/40 + 0. Sort s, 8, c in descending order. 8, s, c Let z = -9 + 9.4. Put -0.1, z, -2 in decreasing order. z, -0.1, -2 Suppose -4r - 21 = -9. Sort 4, r, -4 in ascending order. -4, r, 4 Let r(g) = 2g*2 + 9g - 11. Let n(s) = -3s2 - 18s + 22. Let j(u) = 3n(u) + 5r(u). Let a be j(8). Sort -4, a, 5 in decreasing order. 5, a, -4 Suppose -7b + 3b + 16 = 0. Let l(d) = -d*2 + 2d + 5. Let u be l(b). Put 3/7, 3, u in ascending order. u, 3/7, 3 Let y = -4 - -5. Sort -0.4, y, 2/17. -0.4, 2/17, y Let d = -0.1 - 0. Let u = -4.1 - -0.1. Sort d, 4, u. u, d, 4 Let v be (-1)/(-6) + (-94)/(-12). Let d = v + -6. Let s(t) = -t*3 - 11t*2 + 11t - 13. Let n be s(-12). Sort d, 1, n. n, 1, d Suppose -2w + 5m = 29, 4w + 18 = 4m - 2m. Sort -4, -3, w, 1 in ascending order. -4, -3, w, 1 Let v = -88 + 93. Sort 2/41, v, -1. -1, 2/41, v Suppose 0 = 2t + t. Let f be (-2 - -4)6/9. Sort 3, f, t in descending order. 3, f, t Let m be (-36)/90 + 38/70. Let h = -8 + 5. Sort h, m, 1/3 in decreasing order. 1/3, m, h Suppose 3t + 24 = 5t. Suppose 5n - t = n. Let p be 8/(-8) - 0/2. Put -2, n, p in decreasing order. n, p, -2 Let t = 70 + -75.6. Let f = t - -5. Let w = f - -2.6. Put w, -3, 0.4 in descending order. w, 0.4, -3 Let z = -233 + 2095/9. Let l = -1.97 + 2. Sort l, z, -0.3 in increasing order. -0.3, z, l Let a be (5/2)/(7/(-42)). Let p = a + 12. Suppose -m - 3u + 15 = 0, 2m + 0m + 5u = 26. Sort m, -0.2, p in decreasing order. m, -0.2, p Suppose 7o = 8o - 5. Sort 4, o, -1. -1, 4, o Suppose y + 12 = 4y. Sort y, 5, -5. -5, y, 5 Suppose 7 = f - 3v + 2v, -23 = -5f - v. Put -1, -3, f in increasing order. -3, -1, f Let p = -8 + 5. Let d be (-6)/(-28)(-2)/p. Let w = 5.4 + -5. Put d, w, 0 in descending order. w, d, 0 Let f be 1 + (-2)/(-6)0. Suppose -f = u - 0, -o + 2 = u. Put -4, o, 2 in descending order. o, 2, -4 Let t = -28 - -28. Put 9, t, 2 in ascending order. t, 2, 9 Let s(n) = -n*2 + 3n + 1. Let y be s(4). Let i(c) = -c*2 - 5c - 3. Let x be i(-3). Let d be (-4 - -2) + -3 + 5. Sort y, d, x in increasing order. y, d, x Let x = -13 + 13.17. Let k = x - 1.17. Sort 1/5, 5/3, k in descending order. 5/3, 1/5, k Suppose 4h - 3p - 9 = 0, -5p + 0p + 11 = 2h. Let q = h - 2. Let k = 8 - 11. Sort k, -1, q in descending order. q, -1, k Let l(h) = h*2 + h - 1. Let a be l(-1). Suppose -q -	{ "pile_set_name": "DM Mathematics" }
(4 - 5)(3 + -1). -2 Evaluate (15/(-85))/((18/(-4))/3). 2/17 Evaluate (-2 + 5)(-1 + 20/15). 1 ((-130)/1365)/(2/3) -1/7 Evaluate (3/(-4))/(795/424). -2/5 What is the value of (-785)/(-471) - 7/(-3)? 4 What is 2/80 + 8/(-6)? -4/3 Evaluate (-6)/(-12)-2 + -3. -4 What is (5/(-15))/(19 + -20)? 1/3 Calculate 40/16(-4)/(-85). 2/17 What is ((-29)/(-58))/((-1)/16)? -8 (-440)/(-90) + -5 - 6/27 -1/3 4/3 - (-2)/(-6) 1 What is ((-7)/2 + 1)-2? 5 0 + ((-42)/28)/(30/(-4)) 1/5 What is (2 + 0)/(-1 + (-3 - 0))? -1/2 8(-6)/(-174 + 6) 2/7 What is (4 + 1)/(16 + -5 - 12)? -5 Calculate 3/4 + 3/(-36)-15. 2 What is the value of (110/77)/10-1? -1/7 What is the value of (6 - -4)/(-2)8/(-10)? 4 What is (-6)/(-15) + (-32)/(-20)? 2 What is the value of 7/(-6)-3 + (-4 - -2)? 3/2 Evaluate 1600/(-840) - 4/42. -2 (1/(-1))/((-20)/(-60)) -3 Evaluate 6/28(-420)/(-540). 1/6 (30/9)/(12 - 16) -5/6 What is the value of ((-99)/44)/(-3)16/42? 2/7 What is the value of (-3 + 8)(1 + (-21)/30)? 3/2 30/(-165) + (-34)/132-2 1/3 Evaluate 4 + -501/12. -1/6 What is (-1 - -4 - 3)/(2 + -4)? 0 Calculate (-103 - -100)(-5)/(-3). -5 What is 4/30(13 - 12)15? 2 Calculate (-12)/106/(-27)-15. -4 Calculate (-58)/(-16) + (-36)/(-96). 4 Calculate (-10 + 5 - -6)/((-12)/42). -7/2 Calculate (-10)/1512/10. -4/5 What is (-60)/(-140) + 25/(-42)? -1/6 What is the value of (-43)/(-9) + (-30)/(-135)? 5 What is 30/40 - 81/12? -6 What is the value of 1 - (-86)/(-18) - (-2)/(-9)? -4 What is the value of (-6)/8 - (-5 - -5)? -3/4 4/(-6) + 16/24 - 0 0 What is the value of ((-1326)/119 - -16) + (-10)/2? -1/7 (-48)/90(-30)/72 2/9 15/(-9) - -8(-12)/288 -2 Calculate (-104)/286(-22)/28. 2/7 24/(-14) - (-16)/8 2/7 Calculate 52/60 + 1/(-5). 2/3 Calculate 6/14 + 266/(-49). -5 Calculate (-16)/(-20)3/(-18). -2/15 (-11 - 234/(-27))/(-1) 7/3 What is the value of 7 + (-17)/(1496/648)? -4/11 Calculate -1 + 3 - (2 + 25/5). -5 Evaluate -42(-3)/(-84)-14. 4 What is the value of 1 + (-15)/(-18) + -1? 5/6 7/6 - 325/195 -1/2 (5 + 35/(-6))(-1 - 1) 5/3 What is the value of ((-8)/30)/(-18 + (-2288)/(-130))? 2/3 Calculate ((-40)/60)/((-14)/(-105)). -5 Calculate ((-4)/(-10))/((-434)/70 + 7). 1/2 Evaluate ((-2)/(-14))/(4 - 50/10). -1/7 Evaluate (-7)/(-3) - 40/30. 1 7/7 + ((-4)/(-2) - -4) 7 What is (-30)/(-48) + -3 - -2? -3/8 Calculate (6/(-4))/((-17)/((-2618)/(-33))). 7 Evaluate 110/(-45)(-42)/231. 4/9 Evaluate (-9)/(-3) + 51/(-18). 1/6 Evaluate -27/(5 - 54). 2/7 Evaluate -5 - -9((-35)/(-65))/1. -2/13 What is ((-9)/96)/((-175)/20 + 8)? 1/8 Calculate 16/5 + -6 + (-18)/(-6). 1/5 What is -4 + -4 + 8 + 3? 3 What is 1 + -2 - 3 - (0 + 0)? -4 Calculate 37/37 + 22/4. 2 Evaluate (-4)/9 + 34/(-153). -2/3 What is the value of (6/(-48))/(0 + (-3)/(-12))? -1/2 Evaluate ((5/(-5))/1)/((-4)/16). 4 What is ((-8)/12)/(8/36-3)? 1 Evaluate 24/10(-9 + 51/6). -6/5 What is the value of (-3)/(-2) - (-555)/(-330)? -2/11 What is (-1 + 5/6)/((-365)/(-219))? -1/10 Calculate ((-2)/(30/(-9)))/(3/15). 3 What is (-1)/(-7) + 9/35? 2/5 Evaluate (0 + 42/15)/(312/(-390)). -7/2 Calculate 395/55 + -4 + (-294)/(-77). 7 30/70 + (-225)/(-63) 4 What is (6/6)/(1 - 2)? -1 What is (20/(-6))/(4/6)? -5 What is the value of 6/(-20)(-4)/36-3? -1/10 What is the value of 1/(-2)10/15? -1/3 What is (1 - 3)(34/(-28) - -1)? 3/7 Evaluate (-3)/(((-14)/(-21))/((-3)/(-9))). -3/2 What is the value of (6/99)/(1 - (-30)/(-18))? -1/11 Evaluate (-1(-2)/(-18))/(26/(-156)). 2/3 Calculate (100 - 107)(-2)/(-7). -2 Calculate 1 + (0 - -2) - 620/248. 1/2 Calculate (-3 + 4)8/(-32). -1/4 Evaluate (-3 + 2)1 + 15/9. 2/3 What is (5/(-15))/((-1)/(-9))? -3 Evaluate (1 + 24/(-18))-3. 1 What is the value of (-18)/(-63) - ((-800)/756)/(-5)? 2/27 ((-2)/(-1) + 45/(-25))/1 1/5 Evaluate (-2 + 4)26/(-234). -2/9 What is the value of 20/15(2 + 1)? 4 What is the value of ((-7)/(-4) + -2)/(15/36)? -3/5 -5 - -5(-7 - -9) 5 (-46 - -44)/(1/(-3)-2) -3 What is the value of 2 + (10/(-4) - -2)? 3/2 What is the value of (72/54)/((-12)/(-9))? 1 Evaluate (4/(-14))/(36/28). -2/9 What is the value of 3/7 - (-4)/56? 1/2 What is the value of (((-90)/(-20))/(-1))/(18/(-4))? 1 ((-280)/(-147) - 11) + 9 -2/21 Calculate (1224/84 - 10) + -5. -3/7 What is (-12)/28 - (108/28 + -4)? -2/7 Evaluate 3/(-2) - (-91)/56. 1/8 Evaluate 0 - (-5)/(-180) - (-6)/(-27). -1/4 3/2(-9 - 1527/(-171)) -2/19 What is ((-2)/5)/(624/60 + -9)? -2/7 Calculate (165/66)/(3/(-6)). -5 Calculate (-4 - 19/(-5))/(4/(-10)). 1/2 What is (-96)/(-198) - 4/6? -2/11 What is the value of 40/12(-6)/(-5) - -1? 5 Calculate ((-10)/35)/(520/105 - 5). 6 What is the value of (53/(-159))/(1(-2)/(-6))? -1 Calculate -2 + (-42)/(-9) + -3. -1/3 Calculate 1(2/(-8)2)/(-1). 1/2 Evaluate ((-2)/((-6)/(-9)))/(21/(-7)). 1 What is the value of 63/(-135) + (-4)/(-30)? -1/3 (0/(2 - (-2 - 0)))/1 0 What is (-24)/162/(-1)? 3 What is the value of ((-44)/(-12) - 3) + 0? 2/3 Calculate (36/(-9))/(23 - 21). -1 (-48)/140 + (-5 - 180/(-35)) -1/5 Calculate -1 + 8 + -4 + 1. 4 Calculate (-12)/(-3) + (-1)/(-5)0. 4 (2 - (0 - -3))(34 - 28) -6 What is the value of -7 - (-4)/(5 - 3)? -5 What is (1/(-6))/(70/105)? -1/4 (-6)/4 - -18(-1)/(-20) -3/5 What is ((-6)/(-7))/(550/(-140) - -5)? 4/5 What is -6 + (-17)/(-8) + 2/(-16)? -4 What is the value of (-164)/52 + 3 - (-1 - -1)? -2/13 Evaluate ((-8)/10)/((-1)/52). 2 What is (1/(-4))/((-6)/(144/(-33)))? -2/11 What is (-2)/40/38? 0 Calculate -1(-6 - -6 - 0) + -4. -4 44/6631/(-2) -1 What is 5/(-1) - (48/(-4) + 9)? -2 What is the value of (-23)/(-72) - ((-48)/(-27))/4? -1/8 What is (-1)/((-40)/((-30)/6))? -1/8 (6 - (-2366)/(-299)) + 2 2/23 Calculate 7 + (2 + -2 - 4). 3 Calculate 0/(3 - (9 + -5)). 0 Calculate (-1)/(-20) - (-25)/(-100). -1/5 Calculate (-68)/20 - (-4)/10. -3 What is 27/(-6) - -5 - 4/3? -5/6 Calculate 1(-1 - -6) - 0. 5 Evaluate 1/(-3) + (-1)/35. -2 What is (-52)/(-6) - ((-63)/27 + 1)? 10 48/(-5) - 154/385 -10 What is the value of ((-20)/15 - -2)-3? -2 Calculate ((-16)/1286)/((-30)/(-32)). -4/5 What is the value of -6 + 3 + 5 + -4? -2 Evaluate -11/(-6) - (-76)/(-168). -2/7 Calculate 18/(-52) - (-138)/52. 5/2 Evaluate -3 + (-1 - (-1 - -2)). -5 5/(-4) + (-375)/100 -5 What is 2/(-3) - 78/(-12)? 4 What is the value of 1/(((-5)/4)/5)? -4 (2/(-8))/((-2)/(96/3)) 4 Evaluate 81/16-2. -1 What is (36/39)/((-74)/(-481))? 6 Calculate (-76)/28 + -2 + 4/(-14). -5 What is (-10)/50(6 + 2/(-2))? -1 What is the value of (2 - 18) + (0 - -9)? -7 What is the value of 90/(-78) + 3 + 37/(-13)? -1 What is the value of 16/6 - 2 - 8/18? 2/9 Evaluate ((-3)/(-6))/(7/(-14)). -1 Evaluate (-713)/186 + 4 + 0. 1/6 What is the value of (-10)/((-20)/6) - (1 - 2)? 4 What is the value of (-1 - 1)(-3)/(-18)? -1/3 What is the value of (224/336)/((-5)/3)? -2/5 39/36 + 3/(-9) 3/4 Calculate (-6)/(-16) - ((-675)/(-280))/3. -3/7 Calculate 18/(-15)12/18. -4/5 -8 - (-296)/722 2/9 13 + ((-8)/14)/((-1)/(-7)) 9 What is 24/(-4) - (-8 + -1)? 3 What is ((-6)/(-8))/(90/96)? 4/5 What is the value of 3/168/9? 1/6 -4 - (-1 + (3 - 1/1)) -5 Calculate (2 - 21/9)6. -2 -5 + 11 + -1 + -3 2 Evaluate (-2)/22 + (-351)/(-715). 2/5 What is the value of (12/18)/((-8)/(-36))? 3 What is ((-276)/11)/(-6) + (-10)/55? 4 Evaluate (-7 - -8)(-1)/3. -1/3 Calculate (-46)/(-322)4/(-2). -2/7 (-3 + 1)/((-107)/214) 4 Evaluate 21996/(-2223) + (-20)/(-2). 2/19 What is the value of 12/(-15)20/5 + 3? -1/5 Evaluate (-1 - 0)0/(-22). 0 ((-5)/(-25)2)/(2/(-20)) -4 Calculate 74/518 - (-1)/91. 2/13 Evaluate (-899)/3255 + (-1)/(-7). -2/15 Evaluate ((-38)/(-38))/((-1)/(-7)). 7 What is -3 + 38/4 - (-5)/(-10)? 6 Calculate -51 + 39 + (2 - -6). -4 What is (-20)/(-150) - 9/(-45)? 1/3 -133/9 - -41 -1/3 What is 1/2 - 3/(-6)? 1 What is (-9 + -1 + 6)(-5)/(-10)? -2 17 + -16 - (-5)/(-7) 2/7 What is 0 - (4/(-22) + (-588)/154)? 4 What is (7 - 4) + ((-6)/15 - 3)? -2/5 Calculate (0 - -9)(-76)/(-2394). 2/7 What is -5 + 91/14 - (-6)/(-4)? 0 Calculate (8/(-14) - 0)/(-2). 2/7 Calculate -4 - (0 + -7 + -2). 5 Calculate (-2)/9 + (-28)/(-18). 4/3 Evaluate (-1 + 0)/(3/(-15)). 5 Evaluate (-18)/(-42) - (-88)/(-140). -1/5 Calculate -4(-2)/(-2)(-12)/48. 1 Calculate (-22)/77 + 46/(-84). -5/6 (-5)/(5/(-2))(-1)/3 -2/3 -3 + 11 - (-5 - -8) 5 Calculate 1/42*(-4)/10. -1/5 What is the value of (3 - (-10)/(-4)) + (-14)/4? -	{ "pile_set_name": "DM Mathematics" }
0y)(-1 + 1 + 2y)(78 + 326 + 100). 1008y2 Expand (2v - 3v + 0v)((4 - 4v - 4)(-5v2 - v3 + 5v2) - 3v*3 - 2v*4 + 3v*3 + 0v*3 - 3v*4 + 0v3). v5 Expand (-3a + 0a + 2a)(4a3 + 0a*3 + 0a*3) + 0a*4 - 3a*4 + 4a*4 - 3a*4 + 0a*4 - 2a4 + a2. -8a4 + a2 Expand (-3l - 4l2 + 3l)(3 - 3 - l2) + l4 + l4 + 0l*4 + 24 - 24 - 12l*4. -6l*4 Expand (q + 2 + 380q*2 + 294q*2 + 256q*2)(2q + 0q + 0q). 1860q*3 + 2q*2 + 4q Expand (-7x + 1 - 1 - 7x - 33x)(7x - 5x + 5x). -329x*2 Expand (-3l + 3l + 2l*2)(8l3 - 1576 + 1576). 16l*5 Expand (-3 + r + 4 + 2)(118r - 118r + 109r2). 109r*3 + 327r*2 Expand (8v - 19v - 16v)(13v + 13 - 13). -351v2 Expand -10b*2 - 5b*2 + 6b*2 + (-3b + b + b)(-b + 3b - 4b) - 4 + 4 + 2b*2 + (3b + 5b - 6b)(2b + 2b - 3b) + 0b + 0b + 2b2. -b2 Expand (0q*3 + 0q*3 - 2q*3 + 5q*3 + 17q - 17q + (-2 + 2 + q2)(2q - 3q + 3q) + q - q - q3)(0 - 1 + 0). -4q3 Expand (p - 4p + 2p)(-4p2 - p2 + p2) + 8p*3 + 5p*3 - 2p*3. 15p*3 Expand (-10n*2 + 40n - 40n)(1 - 5 + 2)(2n - n*3 - 2n) + (7 + 6 - 5)(3n*3 - 2n*5 - 3n*3). -36n*5 Expand (-4u*2 + 4u2 + u2)(-4 + 1 + 1) + (-2u - 2u + 5u)(u + 2u + 3u)(4 - 1 - 21). -110u2 Expand (-4 + 4 - o)(25 - 45 - 46) + ((-2 + 2 + 2o)(-4 + 2 + 0) - 2o + o + 2o + 2o + o - o + 3o + 1 - 1 + 1 - o - 1)(-4 + 4 - 2). 64o Expand (193 - 185t - 193)(-4t - 2t*2 + 4t). 370t3 Expand (826o - 2o2 - 1655o + 831o - 47)(0 - 1 + 0). 2o2 - 2o + 47 Expand (d2 + d2 + 3d2)(-2d3 - 2d*3 + 2d3) + d5 - 2795d3 + 2795d*3. -9d*5 Expand 2l4 - l3 + l*3 + (l - 3l + 0l)(l2 + l3 - l*2) + 2l*4 + 3l*4 - 7l*4 - 28l*4 - 53l*4 + 20l*4. -63l*4 Expand (2 - 2 + 2)(-3h - 3 + 3 + (h - 2 + 2)(0 - 4 + 2) + 4h + 0h - 2h). -6h Expand (-266 + 67 + 142)(4 - z - 4). 57z Expand (-1 - 1 - 1)((-c + 3c + 0c)(2 - 3 + 2) - 5c + c + 0c) + c + 7c - c - 8c - 14 + 14. 5c Expand (4t + 0t - 2t)(-12t - 22t - 81t)(-3 - t + 3). 230t*3 Expand -5c*3 + 3c*3 + 0c*3 + (-6c*2 + 3c*2 + 2c*2)(-c + 3c + 0c) - 5c3 + c - c. -9c3 Expand p2 - 4p2 + 5p*2 + (p - 3p + p)(-p + 0p + 3p) - p2 + 0p2 - p2 + 2p2 - 2p2 + p2 + (-p - 4p + 2p)(11p + 15p - 6p). -61p2 Expand l - l + l2 + (0l + l + 0l)(2l + 2l - 2l) + 2l2 - l2 + 0l2 + 0l*2 + 2l*2 + 0l*2 - 7l*2 + 0l*2 - 70l*2. -71l*2 Expand (-1 - 1 + 4 + 2v)(-2v*4 + 3v - 3v) + (1 - 2 + 10)(5 + 1 - 9)(v - v + 3v*5). -85v*5 - 4v*4 Expand -2768x*5 - 14x + 3128x5 + 16x + (4 - 3 - 3)(x5 + 0x + 0x). 358x*5 + 2x Expand 4n2 + 4n*2 - 3n*2 + 0n2 - n2 + 0n2 + (-n - 3n + 2n)(n - 2n + 0n) - 4n2 + 3n*2 + 3n*2 + 10n*2 - 4n*2 + 32n*2. 46n*2 Expand (4 - 1 - 1)(-5t5 + 4t5 - t5) + (t2 - t2 - t*2)(22t3 + 529t*2 - 529t*2). -26t*5 Expand (-3 + 4 + 3d - 2d + 2d*2)(4d - 12d - 2d - 1). -20d*3 - 12d*2 - 11d - 1 Expand k4 - k4 + 2k5 + (-4k + 5k - 3k)(2k*4 + 0k*4 + 0k*4) + 16k*4 + 153k*3 - 153k*3 + 4k*5. 2k*5 + 16k*4 Expand -18a*4 - 5a*5 + 18a4 + (-1 + a2 + 1)(-2a*3 - 3 + 3) + 42a*3 + 5a*5 - 42a*3. -2a*5 Expand (4r2 - r2 - r*2)(r - r + r*3) - 11r*5 + 2r*4 + 36r - 36r. -9r*5 + 2r*4 Expand (-1 - 3 + 2)((0 - 4 + 2)(6 - 4 - 1) + 2 - 1 - 2)(29 - 40 + 17)(-8s + 11 - 11). -288s Expand h3 - h3 + 2h5 + (h3 - 2h4 - h3)(1 - 1 + 2h) + 22h*5 + 16h*4 - 8h*4 - 6h*4 + (h - 2h - h)(15h - 15h - 7h*4). 34h*5 + 2h*4 Expand 573s - 1157s + 1525s*5 + 582s + (-4s4 - s4 + 4s*4)(0s - 2s + s). 1526s5 - 2s Expand -12w + 3w*3 + 12w + (-2w3 - w3 + 2w*3)(4 - 14 + 19)(0 + 2 - 3). 12w*3 Expand (0h + h*4 + 0h)((2 + 1 - 1)(0 - 1 + 0) + 142 + 118 + 64 - 31). 291h4 Expand (1 + 0 - 2)(-6l + 90l - 43l + 74l). -115l Expand 4l - 3l - 2l + (-2 + 2 + 1)(-3 + 3 - 2l) + 95l - 16l - 2l. 74l Expand (-6b3 - 3b*3 + 5b*3)(18b2 - b2 + 0b*2). -68b*5 Expand (0i3 - i3 + 0i3)(3 + 1 - 2 + ((-3 - 5 + 4)(-1 + 4 + 0) - 3 + 1 + 0)(-3 + 0 + 5)). 26i3 Expand -v2 + 2v*2 + 0v*2 + (-v + 4 - 4)(2v - v - 2v) + 0v2 + 0v*2 - 3v*2 + (6 + 0 + 3)(-81 - 15v2 + 81). -136v*2 Expand (8 + 5 - 6)(v*3 + 2v*3 - 2v3 + (v3 + 3v3 - 2v*3)(-2 + 0 + 3) - 133 + 133 + 4v3). 49v3 Expand (-n3 + 0n3 - n3)(-21n2 - 704n + 704n) - 3n*5 - 4n*5 + 0n*5. 35n*5 Expand (-51z + 4 - 45z + 91z)(-3z + z + 3z) + 5 - 5 - 2z*2. -7z*2 + 4z Expand (0 + 0 - 1)(-6 + 5 - 2)(-15 + 15 + 33n)(-1 + 1 + n). 99n2 Expand ((-7 + 3 + 2)(2 + 1 - 2) + 6 + 2 + 7)(-8 - 2 - 6)(s*5 + 2s*4 - 2s*4). -208s*5 Expand -2v - 1 + 1 + (-2v + 0v + 3v)(3 - 2 + 0) - 6 + v + 6 - 3v + 9v + 3v + v + 0v + 0v - 5v - v + 3v. 7v Expand (37t + 35 - 75 + 34)(2 - 1 + 1)(t4 - 2t*4 + 3t*4). 148t*5 - 24t*4 Expand (434m + 145m + 261m)(-1 - 3 + 2)(1 - 1 - 2m2). 3360m*3 Expand (1 - 2 - 3m + 9m)(0m + 2m - 3m) - 9m*2 + 3m*2 - 5m*2. -17m*2 + m Expand (12o + 11 - 11)(-39o - 18 + 18 - 2). -468o2 - 24o Expand (3d2 + 4d + 4d - 9d)(-2d*2 - 8d*2 - 9d*2). -57d*4 + 19d*3 Expand 2 + 4c + 8c - 11c + 0c - c + 2c + (-6c + 3c + c)(-6 + 4 + 1). 4c + 2 Expand -20s2 + 4s*2 - 3s*2 + 0s*2 + 0s2 - s2 + (2 - 5 + 1)(-2s + 2s - 2s2) - s2 - 3s2 - 7s*2. -27s*2 Expand (-2 + 5 + 1)(3x4 - 4x*2 + 4x*2) + (2x*2 - 2x*2 + 2x*2)(-x*2 + 1 - 1) + 5x3 - x4 - 5x3. 9x*4 Expand 4s*4 - 7s4 + s4 + (-2s + 3s + 4s)(3s3 + 0s*3 + 2s*3). 23s*4 Expand (0 - 1 + 0)(6m + 0m + 0m + 4m - 2m - m + (-2m + 2m - 2m)(2 + 0 - 1) - 2m - 3 + 3 + 3m - 5m + 3m - 4m + 4m - 3m). -m Expand (0 - 5 + 3)(-43824 + 43824 + 1145u). -2290u Expand (17l + 330 - 330)(-2l*2 + 0l2 + l2) + l*3 - 3l*3 - 3l*3. -22l*3 Expand (-7g - 7 + 7)(2 - 3 + 0)(4g - 2g + 2g). 28g*2 Expand (2s + 2 + 0 - 4)(6 + 2 + 0 + (4 + 0 + 2)(1 - 3 + 3)). 28s - 28 Expand -84b - b - 15b + 6b - 5b - 2b - b + b - b + (-4 + 6 - 1)(-b - 2b + 2b) + 0b - 3b + 7b. -99b Expand -c5 - c3 + c3 + (2c - 4c + 0c)(-3c*4 + 4c*4 - 2c*4 + (2c*4 - 4c + 4c)(2 - 3 - 2)). 13c5 Expand (4 - 3 + 1)(3 + 0 - 6 + (0 - 5 + 3)(2 - 3 + 0) + 0 - 3 + 2 - 5 + 4 - 6)(w*3 - 4w*3 + 2w*3). 18w3 Expand -w2 + w2 + w4 + (-12w + 10w + 10 - 5)(-18w*3 - 29w*3 - 6w*3). 107w*4 - 265w3 Expand b5 - b + b + (11 - 7 + 8)(-3b*4 + 3b*4 - 3b*5) - 2b*5 + 4b*5 + 0b*5 + (3b - 3b - 2b*5)(1 - 3 + 0). -29b5 Expand 4m*4 - 4m*4 - 10m*5 + (2m*2 + 2m*2 - 2m*2)(2m3 - 5m3 + m3). -14m5 Expand (-4 + 0 + 2)(37s3 + 26s*3 + 6s*3). -138s*3 Expand 3988t*3 - 3988t*3 - 4t*5 - 4t + t5 - t5 + t*5 + (2 - t - 2)(-3t4 + 3t*4 - 2t*4) + 4t5 - t5 + 0t5. 2t*5 - 4t Expand (3 - 1 - 4)(0h - h*3 + 0h) - 3h3 - 2h3 + h3 + (0h3 + 2h*3 - 5h*3)(14 - 4 - 6). -14h3 Expand (-1 - 1 + 0)(21v + 0v + 4v)(0v - 2v + 0v). 100v*2 Expand (1 - 1 - 2)(z + 26z + 43z)(-4 + 1 + 5). -280z Expand (2x - x + x)(62 - 62 - 39x)(5x - 3x - 3x). 78x*3 Expand (-g + 14g + 2g)(-g4 + g4 + 2g4). 30g*5 Expand (1 + 2d - 1)((5 - 1 - 3)(-2d + 2d + d) - 4d + 4d + 2d + 65d - 118 + 118). 136d2 Expand (-199 + v2 - 83v + 199)(-2 + v + 2). v3 - 83v*2 Expand (-2630 + 9i + 2630)(-i2 - 4i*2 + 3i*2)(28 - 10 - 9). -162i3 Expand 3q - 5q + q + (-q - 10q + 3q)(2 - 3 + 2) - 55q - 73q + 30q. -107q Expand -56g - 64g - 41g + g + (0g - g + 0g)(0 - 2 + 4). -162g Expand (7a - 2a - a)(-122a - 28a + 20a). -520a*2 Expand (-2s + 4s - 4s)(-3 - 2 + 15)(2 + 1 - 2)(-4 + 3 - 1). 40s Expand (2 + 3 - 4)(2755 - 4s - 2755). -4s Expand (-h + 4h - 2h)(-3h2 - h2 + 5h*2) + 22h*3 - 7h*3 + 46h*3 + 5h*3 + 0h*3 - 2h*3 + (2h*3 + 1 - 1)(2 -	{ "pile_set_name": "DM Mathematics" }
x(9). Let q(b) = 2b - 3. Does 5 divide q(w)? True Suppose 0 = 5q + 5l + 250, 3q - l + 10 = -132. Suppose -61 = 4y + 35. Let b = y - q. Is 12 a factor of b? True Suppose -4v + 445 = 5g, 215 = -0v + 2v + g. Is 13 a factor of v? False Let u(z) be the first derivative of z4/4 + 7z*3/3 + 3z*2 - 6z + 2. Is u(-5) a multiple of 13? False Let d be (-7)/(-2) - (-2)/4. Suppose 4j - 10 = -i, -dj + 2 = 3i - 28. Is 10 a factor of i? True Suppose 215 = 5b + 4a, -4b = -a - 118 - 75. Let d = b + -32. Does 10 divide d? False Let j be 1/(-3) - 44/(-6). Suppose -h + jz + 13 = 3z, -4z = -4h + 40. Does 6 divide h? False Suppose -5a - 2g - g + 9 = 0, -5g = 10. Let u be 2/4(1 + -3). Let r = a - u. Is 4 a factor of r? True Suppose 0 = 5d - 4l - 2, -4d + 0d = 2l - 12. Is (-246)/(-8) + d/8 a multiple of 8? False Let j(u) = -22u. Let g(h) = 32901h. Let y(b) = -1316b. Let a(r) = 4g(r) + 99y(r). Let c(q) = -2a(q) - 121j(q). Is c(1) a multiple of 11? True Let b = 37 + -15. Let c = -14 + b. Does 4 divide c? True Suppose 0 = -x - 4 - 4. Let g = x + 22. Does 7 divide g? True Suppose -n - 12 = -t + 3, 3t - 2n - 50 = 0. Is 3 + -5 + t + -1 a multiple of 4? False Let i(g) be the first derivative of g*2 - 2g + 1/4g4 + 4 + 2g*3. Is 10 a factor of i(-4)? False Suppose 0 = 5l - 0i - 2i - 94, -2i + 86 = 5l. Does 17 divide 338/l - 4/(-18)? False Let s be (-1 + -17)/(1 + -3). Let t = s - 9. Suppose -5z + tz = -70. Is 13 a factor of z? False Let h = 45 - -45. Is h a multiple of 15? True Let a be 22 + 2 + (0 - 0). Suppose d + 5 = 0, -206 + a = -3x + 4d. Does 26 divide x? False Let d(q) be the first derivative of q*3/3 + 2q - 1. Does 9 divide d(4)? True Suppose 94 = 2j - j - 5p, 5j + 3p - 358 = 0. Is 9 a factor of j? False Suppose 0 = -3p - 0p + 93. Suppose 5 + p = 3o. Does 6 divide o? True Suppose 3w = 5f - 746, 5f + 0w - 4w - 743 = 0. Is f a multiple of 23? False Let w = -151 - -250. Let f be -1(1 - w/3). Does 8 divide (-15)/(-10)f/6? True Suppose 3t + 10 = 94. Let p = 52 - t. Does 12 divide p? True Let l(j) = -j2 + 9j + 10. Let s(n) = n*2 - 5n + 2. Let u be (-1 - 5)(-4 + 3). Let b be s(u). Does 9 divide l(b)? True Suppose -2v - 302 = -2q - 3v, 4q - 4v = 628. Does 17 divide q? True Suppose -4f + 194 = -62. Let s = 136 - 40. Let n = s - f. Is 16 a factor of n? True Let v = 42 + -28. Does 21 divide (v/21)/((-2)/(-69))? False Let c(y) = -y2 + 11y - 10. Suppose -6j = -7j + 8. Does 14 divide c(j)? True Let w(p) = 3p3 - 4p*2 - 3p. Let y be w(-2). Let h be 3(-1 - 15/(-9)). Is 6 a factor of h/6 + y/(-6)? True Suppose 2g + 2g + 144 = 0. Let x = 66 + g. Does 10 divide x? True Let j(k) = 7k*2 + 5k + 3. Let s be j(-3). Suppose -5z - s = 3r, 4z + 52 = -5r - 46. Let f = r + 36. Is 7 a factor of f? True Is 6((-176)/(-6) - 4) a multiple of 38? True Let h(y) = -y3 - 7y*2 - y + 5. Let x be h(-7). Let n(c) = 2c*2 - 3c + 3. Let i be n(2). Suppose -f + if = x. Is 2 a factor of f? False Let k(h) = -h3 + 14h*2 + 3h - 25. Is 43 a factor of k(10)? False Let n(z) = -z*3 - 14z*2 - 15z + 10. Is 9 a factor of n(-13)? True Let u = -2 + 44. Does 14 divide u? True Let c(r) = r*2 + 5r - 7. Let f be c(-6). Is 13 a factor of (-16)/f - (-3)/(-1)? True Suppose 0 = -2m + 5 + 1. Does 2 divide m? False Let x be (-2 + (81 - -1))/1. Suppose -n = 3n - x. Does 6 divide n? False Suppose h + 2h - 63 = 0. Let g = 26 - h. Does 3 divide g? False Let h(o) = o2 + 7o + 2. Let s be h(-7). Suppose -2t + t = 2, -10 = 3c + 5t. Suppose -sv + c + 14 = u, -33 = -3u + 3v. Does 12 divide u? True Let o = 201 - 95. Is 17 a factor of o? False Let s = -56 - -23. Let k = -22 - s. Is k a multiple of 6? False Suppose 3b - 4 + 1 = 0, -3b - 447 = -5l. Does 31 divide l? False Let c(j) = -4j - 1. Let m(r) = 5r. Let h(f) = 3c(f) + 2m(f). Let g be h(-4). Suppose -4p + 27 = -g. Does 3 divide p? False Let b(h) = 7h - 59. Let s(c) = -20c + 176. Let m(t) = 7t2 - 2t + 1. Let a be m(1). Let r(i) = as(i) + 17b(i). Is 20 a factor of r(0)? False Suppose r = 3r + 4. Is 23 a factor of -2 - (-3 + -20 + r)? True Let w = 113 + -8. Does 15 divide w? True Let l(b) = -15b + 1. Let f be -3 - 0 - -3 - 1. Does 12 divide l(f)? False Let w(c) = c*2 + 6. Let b be w(0). Let p(z) = 8z - 6. Does 21 divide p(b)? True Let j(v) = v*3 + 7v*2 - 7v + 8. Let r be j(-8). Suppose ri + 144 = 3i. Is i a multiple of 29? False Let d(f) = -f - 9. Let k be d(-9). Suppose 5 = -kh + h. Suppose 3 + h = 2m, -76 = -2x - m. Does 12 divide x? True Let u = -114 - -196. Is u a multiple of 9? False Suppose 21 = 3i - 3h + 3, -i + 18 = 5h. Suppose -i - 2 = -2p. Is 3 a factor of p? False Suppose 4r + 2h - 50 = -14, -2h = r - 15. Let s(y) = y - 3. Let z be s(r). Let f = 20 - z. Is 5 a factor of f? False Let t(x) be the second derivative of x*3/2 + 2x*2 - x. Is t(4) a multiple of 8? True Let q(r) = -r + 4. Let n be q(-6). Let z = n + -17. Is 21 a factor of (0 - (-1 - -4))z? True Suppose -t = 3t + 2o - 16, -18 = -t - 4o. Suppose m = -3f - tm + 96, 0 = 4f - 3m - 163. Does 10 divide f? False Let f = 560 + -392. Is 28 a factor of f? True Let i = 88 - 55. Is i a multiple of 3? True Suppose 5c - 378 = -c. Is c a multiple of 25? False Let w(z) = 3z - 3. Does 6 divide w(3)? True Let f = 292 + -172. Is f a multiple of 24? True Let i = 7 + -8. Let p be (-1 + i - -2)/2. Suppose -w = -2f + 40, 5f + pw - 93 = -w. Is f a multiple of 8? False Let y(a) = a*2 - 3a - 4. Let d be y(3). Let w be ((-2)/d)/((-2)/(-56)). Let r = w - -10. Is 12 a factor of r? True Let r(x) = -2x3 - 9x*2 - 4x - 12. Is r(-6) a multiple of 20? True Suppose 0 = 6p - 7p + 195. Is 29 a factor of p? False Suppose 26f = 27f - 45. Is f a multiple of 8? False Let h = -254 + 401. Does 49 divide h? True Suppose 0 = -2y - 8, -3y - 321 = -5i + y. Does 15 divide i? False Let n = -64 - -7. Is 2/(-2) + n/(-3) a multiple of 9? True Let c(f) = -3f*3 + 3f*2 + 2f - 2. Let h be c(3). Let s = -32 - h. Is 9 a factor of s? True Suppose 0j + 5j = -3x + 134, 4x - 3j - 227 = 0. Let c = x + -13. Is 18 a factor of c? False Let f = 15 + 15. Is 7 a factor of f? False Let n(q) = 8q*2 + q - 1. Let m = -8 + 5. Let t be n(m). Suppose s + 3s = t. Is s a multiple of 17? True Let w = 11 - 11. Suppose wd + 4d - 148 = 0. Is 12 a factor of d? False Let r = 125 - 77. Does 6 divide r? True Let c = -298 + 422. Is c a multiple of 20? False Let t(l) = 2l2 - 9l + 1. Let a be t(6). Let y = a - 5. Does 7 divide y? True Let j(u) = -u*2 - 10u. Let v be 60/(-9) - 2/(-3). Does 13 divide j(v)? False Suppose 18k - 14k - 352 = 0. Suppose -l = 2t - 4l - k, -2t = 4l - 88. Does 23 divide t? False Let u be (-15)/(-2)(-8)/(-12). Let x(v) = v3 - 3v*2 + 2v + 3. Let j be x(3). Suppose u = s - j. Does 10 divide s? False Let h = -128 - -216. Is h a multiple of 22? True Let b be (3/(-2))/(6/(-80)). Suppose n + 2v = 5n - 24, 0 = 5n - 5v - b. Does 3 divide n? False Let y = -84 + 269. Is y a multiple of 37? True Let l(m) = 46m2 - 8m - 3. Is l(3) a multiple of 43? True Let r be (-2 - -2 - -6)1. Suppose -2c + rc + 2j - 92 = 0, 0 = 5c - 2j - 106. Does 22 divide c? True Let n(z) = z*2 + 4z - 7. Let q be n(-6). Let a = 403 - 235. Suppose 3h + 0r = r + 92, qh = -2r + a. Is h a multiple of 16? True Is 2(-1 + -1)(-50)/5 a multiple of 20? True Let r = -8 + 11. Suppose 2f - 4 = rf. Is ((-8)/(-2))/(f/(-8)) a multiple of 4? True Suppose q + 3q = 24. Let p(c) = 2c*2 - 6c + 5. Let a be p(q). Is 13 a factor of -1(-2 + 3) + a? False Suppose 4i = -10 + 130. Does 30 divide i? True Let a(d) = 3d3 - 2d - 1. Let z be a(-1). Let c be (-2 - z - 1)-2. Suppose -2u = -2o + 58, -co - u = 4u - 51. Is o a multiple of 14? True Let y = 124 - 13. Is y a multiple of 37? True Let g(j) = 3j*2 - j - 2. Is g(-2) a multiple of 3? True Let y = 687 + -482. Is y a multiple of 34? False Let i(r) = -7r*3 + 9r*2 + 2r + 8. Let g(j) = -8j3 + 10j*2 + 2j + 9. Let v(c) = -6g(c) + 7i(c). Suppose 0d + 12 = 4d. Does 4 divide v(d)? True Suppose -3a = -8a + 520. Is 17 a factor of a/6 - (-2)/(-6)? True Let x(j) = j*3 - 7j*2 + 8j + 2. Let l(p) = p*3 - 2p*2 + 3p. Let z be l(	{ "pile_set_name": "DM Mathematics" }
= 2x - 4x, 5k - 7 = 4x for k. 3 Solve 3g = -4d + 23, -g + 3d - 49 = -48 for g. 5 Solve -4 = -4r + 3g, 2295 = 4r - 5g + 2299 for r. 4 Solve 0 = 5l - p - 23, l - 4641p - 1 = -4639p for l. 5 Solve -2s - 25 = -3x, s - 59 = x - 69 for x. 5 Solve -4b - 3j = 23, -4b + 29 = -6b - 5j for b. -2 Solve -d + k + 9 = 0, 10k = 4d - d - 62 for d. 4 Solve 0 = -5m + 3n - 30, 0 = -5m + 1480n - 1481n - 10 for m. -3 Solve 4704 - 4690 = 4p + r, -p = 4r + 4 for p. 4 Solve 0 = -65x + 68x - 2o - 6, x + 11 = 5o for x. 4 Solve 0 = -2z + 15y - 54, 3z + 5y - 31 = -2 for z. 3 Solve -5l - 18 = -2z, 147z = 147z - 3l - 12 for z. -1 Solve 8q - 6q + 21 + 16 = 3o, -1 = 17q + 3o for q. -2 Solve 3y + 81 = 5n + 98, 0 = -5y - 2n - 13 for y. -1 Solve j = -l - 12, -62l - 2j - 59 = -55l for l. -7 Solve 4v - 5m = -11, 114m = 5v + 116m - 11 for v. 1 Solve h + 7 = -2a, 12h = -2a + 10h - 8 for a. -3 Solve 850j + 2s = 848j + 4, 5s = 3j + 26 for j. -2 Solve -75 = 5p - 2f, -2p - 3f + 7236 = 7266 for p. -15 Solve -5f + 8o - 423 = -458, 10 = -2o for f. -1 Solve 5r + 24 = -2s + 13, 2s + 8 = -4r for r. -3 Solve 430i + r = 432i + 20, 3i - 4r + 60 = 0 for i. -4 Solve 4g - 4730b = -4725b - 32, 4g = -5b + 8 for g. -3 Solve t = 1, 37 = -5c - t + 41 - 38 for c. -7 Solve -5a = 5k - 8k + 14, -10 = -5k + 5a for k. -2 Solve 14w - 33w + 112 = -5j, -4j - 3w = 35 for j. -11 Solve -2r + 35221 = -3z + 35225, 2z - 20 = -3r for r. 4 Solve -2n = -y + 607 - 615, 5n = 2y + 20 for n. 4 Solve g - 670 = 5y - 681, -y + 2g - 5 = 0 for y. 3 Solve -6b + 37 - 7 = 4d, 0 = 2d - 6 for b. 3 Solve -5v = -o - 68 + 72, -2v = 3o - 12 for v. 0 Solve -3q - h + 12 = 9, -3q - 6h + 3 = 0 for q. 1 Solve 4j = -a + 11, -5j = -64a + 62a + 22 for a. 11 Solve -2d + 16 = 143o - 148o, 5d - 40 = -5o for o. 0 Solve -2m + 1005j = 1008j + 3, 4m = 40j + 132 for m. 3 Solve 4s - 64 = 216g - 220g, 0 = -2s + 3g - 38 for s. 2 Solve -5o + 592 - 605 = 3x, -18 = 3x for o. 1 Solve 7y - 33 = -w, -y = -62w + 60w + 6 for y. 4 Solve -2120 + 2104 = 7f + 5c, 5f = c + 16 for f. 2 Solve -4p - 9r + 28 = -13r, -2p - 1 = 3r for p. 4 Solve -2f + 4n = -10, 5f - 7n + 117 = 136 for f. 1 Solve 1681 = -x + 3s + 1678, 3s = 2x + 3 for x. 0 Solve -4t = 2h - 8, -t - 3 + 5 = 4h for h. 0 Solve -49 = 3a - 5l, 2a - 2830l - 34 = -2835l for a. -3 Solve 540o = 538o + 2, 5o - 25 = 2g for g. -10 Solve 0 = -5y + 3m, -3y = y - 5m - 0m for y. 0 Solve 600b - 596b + w - 1 = 0, 0 = 21b - w + 26 for b. -1 Solve 0 = -5h - 4j - 33, -4j + 2 = 38h - 40h for h. -5 Solve 3b - 2b = 3j - 5, 4j + 5b - 32 = 0 for j. 3 Solve 2a + 201 - 173 = -f, 2a + 12 = 3f for f. -4 Solve 0 = -z - 2, -7839j + 20 = -7835j + 4z for j. 7 Solve -5d + 5404 - 5394 = 4b, 30 = -5d + 4b for d. -2 Solve -k + 29u + 20 = k + 33u, 4u = -4 for k. 12 Solve 3g + 12 = 0, 147g - 145g + 16 = 4i for i. 2 Solve 109m = 2o + 108m - 10, 5o - 5m - 30 = 0 for o. 4 Solve 119s - 117s + 30 = 14a, 0 = -a - 3s - 23 for a. 1 Solve -m = -4k - 7, 106m + 20 = 105m - 5k for m. -5 Solve -i + 5i = 3a, -i = -0a + 3a for i. 0 Solve -p + 160d + 8 = 159d, p = 3d + 28 for p. -2 Solve -133 + 160 = 4n + 3r, 4r - 52 = 0 for n. -3 Solve -5i - 64 = 17u + 155, 45 = -3u - 3i for u. -12 Solve 51b + 4 = 53b, 4c - b - 10 = 0 for c. 3 Solve 0 = -4y + 4, 0 = 40z - 35z + 3y + 2 for z. -1 Solve -g + 426 = 5h + 399, 6g = h + 69 for g. 12 Solve -35l = 2z - 22l + 31, -3z = 4l for z. 4 Solve -5s + 5o + 287 = 202, 4o - 40 = -2s for s. 18 Solve 0 = 5z - 28x - 92, -4z - 4 = -6x + 3x for z. -4 Solve -20j + 15 = 2m - 17j, 4m - 5j + 3 = 0 for m. 3 Solve -1644x + 1642x = 3h - 7, -6 = 2h - 4x for h. 1 Solve 5v - 132419q - 40 = -132424q, 2v = -q + 8 for v. 0 Solve -5s + 3 = -n, -1545s = -1548s - 6n + 15 for s. 1 Solve 0 = -3g + 9, 1930s - 1925s + g = -17 for s. -4 Solve 3j + 2k + 13 = 0, -62k + 63k + 66 = -10j for j. -7 Solve 20l = -4c + 28, 515 = -2l + 2c + 513 for l. 1 Solve 0 = -z, 2 = -u + 2u + 4z + 4 for u. -2 Solve -j - 3q + 33 - 12 = 0, 0 = 5q - 15 for j. 12 Solve 3u + 5g - 10 = 0, -u - 30 = 56g - 61g for u. -5 Solve 5f - 49 = -k + 12, 2k = 5f - 58 for k. 1 Solve 2m + 47 = 3q, 129m - 124m - 3q + 59 = 0 for m. -4 Solve 12w + 9g - 13g = -88, 0 = 2w - 4g + 18 for w. -7 Solve -62n = -4b - 57n + 4, -b = 4n + 20 for b. -4 Solve -29k - m - 8 = -31k, 0 = -3m + 6 for k. 5 Solve -76w + 72w = b - 17, -11 = -4w + 5b for w. 4 Solve 0 = -i + 2n - 22, 5i + 3n = 731 - 711 for i. -2 Solve -3h = -9, z + 11h - 13h + 15 = 0 for z. -9 Solve -z = 2p + 2, -5p - 5 = 192z - 190z for z. 0 Solve 22335r = 22338r + 2 - 5, -5k = -5r + 5 for k. 0 Solve -2c - 8 = -l - 2, -4l = c - 60 for l. 14 Solve 2l - 2 = 2b, 6b - 3l + 23 = 13b for b. 2 Solve -338q = 5m - 343q + 15, 2m - 4q = -12 for m. 0 Solve -261d - 16 = x - 257d, 9x - 2d = -106 for x. -12 Solve -3463i + 3461i = 2a + 16, a - 5i - 34 = 0 for a. -1 Solve k + 1110i + 17 = 1108i, -5i - 32 = k for k. -7 Solve -5g = 10, n + 1560 - 1555 = -4g for n. 3 Solve 2817f - 13 = -5y + 2820f, 4y - 4f = y + 21 for y. -1 Solve 12p - 5z - 51 = 14p, -z + 34 = -3p for p. -13 Solve 5b + 3j = -3, 4b + 2j - 141 + 145 = 0 for b. -3 Solve -1108n + 1109n + 4p = 22, 0 = 5p - 25 for n. 2 Solve -s + 15 = -k, -k + 1544s - 1549s = -87 for k. 2 Solve -399g + 401g + 5k = -3, g - 2k + 6 = 0 for g. -4 Solve -23 - 19 = 25y - 2k, 0 = 286k - 290k - 16 for y. -2 Solve 11689l - 11672l - 4m + 94 = 0, 0 = 2l + 2m + 16 for l. -6 Solve 3m = -4k - 53, 0 = -2m - 5k + 8 - 55 for m. -11 Solve -2j = 5m - 23, 42j - 4m + 4 = 40j for j. 4 Solve 3p - 15 = 0, -7214p + 35 = -2d - 7209p for d. -5 Solve y + 4l = -14, 0 = -5y + 4l + 3980 - 4050 for y. -14 Solve t + 0 = 6l + 7, 4l = -4t + 28 for l. 0 Solve -4p + 17 = -312f + 314f - 3, -3f - p + 30 = 0 for f. 10 Solve 29a + 2q - 52 = 34a, -2q + 2 = 0 for a. -10 Solve -4m + 53 = -5y, -63m - 5y - 67 + 148 = 0 for m. 2 Solve 4f = -3c - 31, 203f + 11 = 192f for c. -9 Solve 0 = -3f + 2c - c + 36, -135 = 77c - 72c for f. 3 Solve 0 = b - 5o - 28, -1918b - 2o - 4 = -1916b for b. 3 Solve -4l = -5h, 2l - 6l = 18h - 21h for l. 0 Solve -10p - 50 = 7f - 5p, 2p - 4 = 2f for f. -5 Solve -3y = -2t + 11, -3t + 19 = -81y + 76y for y. -5 Solve -3h + 1 = 4q, -5q - 3h = -45 + 40 for q. 4 Solve -4z - 48 = 4a, 12z + 10 = 5a + 7z for a. -5 Solve -54k = -49k - 2p + 27, 3p = 2k - p + 14 for k. -5 Solve 40 = 5t - 4z, -119 = 5t - 6t + 23z for t. 4 Solve -3r - 2f + 245 = 266, r - f = -7 for r. -7 Solve 0 = g - 591r + 594r - 2, -4g - 4r = -16 for g. 5 Solve 84 = 7x, 730b = 731b + 3x - 41 for b. 5 Solve 0 = 3i + 4h - 78, 9930i - 9930i - 3h + 54 = 0 for i. 2 Solve 0 = 5n + 2m + 12, -67n + 63n = 5m + 13 for n. -2 Solve -5j + 20 = 0, 2468 = 4k + 4j + 2436 for k. 4 Solve 6 = 3b - 3n, -34n + 33n + 3 = 3b - 15 for b. 5 Solve 21 = -13522a + 13519a - 3n, 3a - 3n = 9 for a. -2 Solve v + 5z = 33, -v - 1269z = -1066z - 1221 for v. 3 Solve 27k + 4y = -70, -16k + 17k + 22 = -5y for k. -2 Solve m - 3h = 0, 13m - 15m + 2h = 8 for m. -6 Solve -a = b + 20, -72a + 76a + 80 = b for a. -20 Solve -2w + 4 = 2y, 0y = 3w - 3y for w. 1 Solve o + 5b = 7, -42o + b - 5 = -41o for o. -3 Solve 744 = o + 3f + 761, 3o - 9 = 3f for o. -2 Solve k + 5 = 13z - 11z, 10 = 2k for z. 5 Solve 5y - k + 35 = 0, -76y + 4k - 5 = -83y for y. -5 Solve 15 = 3r + 6o - 27, -4r + 4o - 4 = 0 for r. 4 Solve 41s - 3a + 36 = 46s, -5s + 3a + 54 = 0 for s. 9 Solve 3n = -2z - 28, 5n + 5z + 5769 = 5709 for n. -4 Solve -6 = -3r - 5m, -6m + 10 = -668837r + 668842r for r. 2 Solve 3i + 29217 - 29211 = -3r, -2i = -4r - 26 for r. -5 Solve 3y + b + 15 = 0, -3y = -201b + 203b + 15 for y. -5 Solve 165i - 167i = -2p - 32, 5p + 6i = -58 for p. -14 Solve -2536 = -v - 5i - 2522, 3v - 2 = -5i for v. -6 Solve -4i - 2z = 16, -81z = -4i - 77z - 16 for i. -4 Solve -5p + 5 = 3t, 3p + 3t + 3469 - 3466 = 0 f	{ "pile_set_name": "DM Mathematics" }
-1367? 3/2 What is the fifth smallest value in 3/7, 2, -4, -2/27365, -3/34, 1/2, 1? 1/2 What is the second smallest value in 1/2, 544.93, 3, -5? 1/2 Which is the fifth smallest value? (a) -3 (b) 1.112 (c) 4 (d) -1657 (e) -0.4 c What is the third smallest value in -5, -1/7, -4, -0.4945? -0.4945 Which is the third biggest value? (a) 5 (b) 0.1 (c) 77 (d) -393 (e) -0.05 b What is the fourth biggest value in -8343, -3.6, -5/7, 2, 5? -3.6 Which is the second smallest value? (a) -0.03 (b) -1 (c) 9349 (d) -0.7 d What is the biggest value in 1, 0.1, -0.6789658? 1 What is the second smallest value in 26, 1.3, -61, -1, 0.5, 0.06, 9? -1 Which is the fourth smallest value? (a) -4 (b) 213 (c) -1/151 (d) -3 (e) 0.8 e Which is the third smallest value? (a) 36143304 (b) -2 (c) -0.2 a Which is the smallest value? (a) 1.432 (b) 7/44 (c) -1/5 c What is the second smallest value in -0.171, 0.5, 3/5, -15/7, -5, 80.6? -15/7 Which is the fourth biggest value? (a) 0.75 (b) 0.8 (c) 1/33 (d) 4/7 c Which is the third biggest value? (a) -2 (b) 349/2 (c) 5 (d) -0.4 (e) -2/3 (f) 3.84 (g) -4 f What is the fifth smallest value in -0.1, -4, -0.5, -1.568, 5, -20/13, 0? -0.1 Which is the second smallest value? (a) -1 (b) 140/11 (c) -193/267 c Which is the third biggest value? (a) 18.8 (b) 1013 (c) 12 (d) 0.2 c Which is the fifth smallest value? (a) 6 (b) 0.3 (c) -3 (d) 93 (e) -1/6 (f) -8 (g) 0.4 g What is the second biggest value in -342, -3, 0.8, -1/2, 2/2711? 2/2711 What is the seventh biggest value in -1/7, 5, -16/35, -3, -4, 9/142, -5? -5 What is the second smallest value in 2, 1/311, 4, 18, -6, 134? 1/311 Which is the smallest value? (a) -0.5 (b) -0.3 (c) -27 (d) -2 (e) 0.2 (f) 0.639 c What is the fourth smallest value in -1/5, -370467, 1, -2, 2? 1 What is the fourth smallest value in -12, 178246/9, -1, 2? 178246/9 What is the third biggest value in -0.3, -2/21, 23897, 1/2, 13? 1/2 Which is the second biggest value? (a) 147 (b) 0 (c) 98.8 (d) -2/39 c What is the sixth biggest value in -1, -5, -4/5, 1, 55532, 0.2? -5 Which is the smallest value? (a) 3/7 (b) -3 (c) 2/9 (d) 393/53 (e) -1/6 b Which is the third smallest value? (a) -2 (b) -5686672 (c) -0.3 c What is the fifth smallest value in 10, -0.5, -0.9, 0.81, -150, -2, -1? -0.5 Which is the second biggest value? (a) 2631 (b) -464 (c) -11 (d) 4 d What is the sixth biggest value in -10, 635, -4, 1.19, 2/5, 1? -10 Which is the second smallest value? (a) -5 (b) 1/4 (c) 7 (d) 3 (e) 0.74 (f) 58 (g) -0.11 g Which is the sixth smallest value? (a) 557 (b) 5/2 (c) 3 (d) 2 (e) -20 (f) 1 a Which is the third smallest value? (a) -8 (b) 0.08 (c) 713 (d) 0.44 d Which is the sixth biggest value? (a) -0.5 (b) 1 (c) -10 (d) -0.1 (e) -22/9 (f) 2/5 (g) -3 g What is the second biggest value in -8.586, 3.3, 2/2249? 2/2249 What is the fourth biggest value in -0.03, -2/9, -15/49, 441? -15/49 Which is the fifth biggest value? (a) -0.6 (b) -0.4 (c) -5 (d) -24/29 (e) -2/7 (f) 0 (g) 4/11 a Which is the biggest value? (a) 7/13 (b) -1/4 (c) 182 (d) 2/87 c What is the fourth biggest value in -4, 0.012, -107, -2513? -2513 Which is the third smallest value? (a) -0.04 (b) 27333 (c) 1/18 b What is the biggest value in 7, -12/31, -3, -113, 1/5? 7 What is the third biggest value in 3, -247, 0.2, 2070? 0.2 Which is the second biggest value? (a) -2 (b) 5/4 (c) 221 (d) -446 b What is the smallest value in -22/7, 0.056608, 8? -22/7 What is the third smallest value in -3492, -2, -1, -0.4, 0, 4, -0.3? -1 Which is the second biggest value? (a) 5 (b) -158 (c) 43.56 a What is the second biggest value in 3/4, -547/8, 0.03, 76/59? 3/4 Which is the second biggest value? (a) 32 (b) 0.271 (c) 0.5 (d) 0.11 (e) 8.8 e What is the smallest value in 120701, 0, 16, 5? 0 Which is the second smallest value? (a) 2056 (b) -202 (c) -0.177 (d) 5 c What is the fifth smallest value in -1, -1863/2, 164, -20, 0.5? 164 What is the fourth smallest value in -1/3, 27, 0, -2/12415, 1, 7/8? 7/8 What is the biggest value in 11, -7/15, -0.01725? 11 What is the fifth smallest value in 0.4, 0, -0.4, 15, 0.06, 2, 15/47? 0.4 Which is the second smallest value? (a) -4 (b) 1.4 (c) -0.11 (d) 3 (e) 0.16 c What is the third biggest value in 0.15, 0.3, -1.1, -4/7, -0.1, 0.1159, 2/19? 0.1159 Which is the biggest value? (a) -0.082 (b) -3 (c) -4894 (d) 201 d What is the biggest value in 2/5, -335883, -2, 2? 2 Which is the smallest value? (a) 2 (b) -7462 (c) -334 (d) -17 b What is the fifth smallest value in -1, 0.4, -503, 11, -78, 1? 1 What is the sixth smallest value in -42, 4/7, 687, 1/3, 0, -2/3? 687 What is the third smallest value in -55.44, -46, 6, -1/14? -1/14 Which is the biggest value? (a) -0.3 (b) 144101 (c) -2/3 (d) -1/2 b Which is the second biggest value? (a) -3366 (b) 11 (c) 0.1563 c What is the biggest value in -15, 1/6, -10, -0.39, -2.6? 1/6 Which is the smallest value? (a) -4 (b) 19 (c) 325489 a Which is the fourth smallest value? (a) -23/4 (b) 5 (c) -1/7 (d) 3 (e) 0.4 (f) -408 (g) 19 e What is the third smallest value in 31, 3/7, -4, 0.4, 3, 0.23, 2729? 0.4 Which is the smallest value? (a) -0.1 (b) -34 (c) -3/4 (d) -140 (e) 0.2 (f) -2/13 (g) 1/12 d What is the second biggest value in -22, 1/91, 5511? 1/91 What is the biggest value in 331029.1, -13, 5? 331029.1 Which is the third smallest value? (a) 3 (b) -7945.14 (c) 2/7 a Which is the fifth smallest value? (a) -5 (b) 0.5 (c) -2/11 (d) -89 (e) -0.0508 b Which is the fourth biggest value? (a) 919846 (b) 1 (c) 2 (d) 0 (e) -0.02 d What is the biggest value in -3, -8/35, -2/9, 9? 9 What is the fifth biggest value in -1/5, 5.4, -16, 107, -3, -0.1, 2/7? -1/5 What is the second smallest value in -7, 5, -0.15, -92, -8? -8 Which is the fifth smallest value? (a) 0.2 (b) 1 (c) -0.1 (d) -9965 (e) -2/5 (f) 47 b Which is the third smallest value? (a) -581845 (b) 2/9 (c) -2/19 (d) -5 (e) -3 e Which is the biggest value? (a) 0 (b) 29 (c) 46 (d) 6 (e) 1 (f) -3.7 (g) -1 c Which is the third smallest value? (a) -2 (b) -33 (c) -4/7 (d) 5/30209 c What is the third biggest value in 3, -1.07, -96621, 0.1, 5? 0.1 Which is the second biggest value? (a) -148.61 (b) 2/3 (c) 1 (d) -4 b What is the fifth smallest value in 1, -1/4, 13/7, -13/16, -5, 0.1, -3? 0.1 Which is the fifth smallest value? (a) -4 (b) -3322 (c) -9 (d) 2/19 (e) 0.6 (f) 1 (g) 12 e What is the third smallest value in -5/4, 2, 1/3, 0, -2, -3.3006? -5/4 Which is the fourth biggest value? (a) -2687 (b) -5 (c) 1/7 (d) 236 (e) -2 b Which is the second biggest value? (a) 11/5 (b) -130.6 (c) 0.24 c Which is the fifth biggest value? (a) 4/3 (b) -2255 (c) -0.3 (d) 2 (e) -1 (f) -3 (g) 3/11 e Which is the smallest value? (a) 0.14863 (b) -3 (c) 5 (d) -73 (e) 3/4 d What is the third biggest value in -2/15, 58, -0.117, 3, -2, 3/22? 3/22 What is the fifth biggest value in -2.5, 2/3, 107, 5, -5? -5 Which is the second biggest value? (a) -3 (b) 356685 (c) 2/15 c What is the second biggest value in 2/93, 164, 0.5, -65? 0.5 Which is the fifth biggest value? (a) 23.68 (b) -1 (c) -0.06 (d) 1 (e) 10/7 b What is the second smallest value in 1/3, -0.3, -3214197? -0.3 Which is the fifth smallest value? (a) 0.04 (b) 0.5 (c) 4 (d) 2/5 (e) -26 (f) -0.05 (g) 3/2 b What is the second smallest value in -0.26, 31.09, -1679? -0.26 What is the fourth biggest value in -0.2, 0.5, -5, -4/165? -5 Which is the second biggest value? (a) -14848 (b) -2/7 (c) 65 b Which is the third smallest value? (a) -0.06 (b) -4 (c) 1662 (d) -146 (e) 0.3 (f) -0.5 f What is the fourth biggest value in -1/4, 4/341, -5, 0, -4? -4 Which is the second biggest value? (a) 2/3 (b) -22 (c) -5350 (d) 4 (e) -2/31 a What is the smallest value in -0.5, 0.1, -2/18719, 403, -3, 3? -3 Which is the second smallest value? (a) -3/5 (b) -7.8 (c) 7 (d) 9 (e) -4 e Which is the second biggest value? (a) -2/13 (b) 0.6 (c) 785 (d) -1/9 (e) 1 e Which is the smallest value? (a) 1/3 (b) -5/2 (c) -18 (d) -0.052 (e) 21 (f) -19 f What is the second smallest value in 0.3, 1/22, -1275.59? 1/22 What is the smallest v	{ "pile_set_name": "DM Mathematics" }
4t2 + 6. Let i(c) = -3c*2 - 5. Let n(v) = -6i(v) - 5x(v). What is u(n(o))? -12o*4 Let i(r) = 4 - 2r*2 - 4. Let j(s) be the second derivative of 4s + 0s2 - 5/6s*3 + 0. What is i(j(b))? -50b*2 Let d(c) be the third derivative of -5c*2 + 0c + 0 + 7/12c4 + 0c3. Let k(x) = -x2. What is k(d(n))? -196n2 Let g(x) be the third derivative of 0x*3 - 1/20x5 - x2 + 0x4 + 0x + 0. Let v(i) = -188i + 94i + 95i. What is v(g(y))? -3y*2 Let a(v) = -20v*2. Let d(s) = -1 + 0 + 1 - 3s. Determine a(d(h)). -180h2 Suppose -l = -5r + 13 + 9, 0 = r + 2l. Let s(x) = 4 - r + x. Let t(m) be the third derivative of -m4/8 - 4m*2. Determine s(t(v)). -3v Let c(l) = -4496 - 5l + 4496. Let n(v) = -2v2 + v2 - v*2. Give n(c(s)). -50s*2 Let y = -6 - -3. Let s = y - -3. Let m(n) = n - 2n + sn. Let x(h) = -h2. Give x(m(z)). -z2 Let t(j) = -2j*2. Let r(s) = 4s*2 - 2s - 2. Let a(n) = -13n2 + 7n + 7. Let i(u) = -6a(u) - 21r(u). Give i(t(c)). -24c4 Let p(h) = h2. Suppose 0y + 3y - 15 = 0. Let t = y - 2. Let f(x) = 2x*2 + tx - 2x - x. Give f(p(b)). 2b4 Let z(w) = w2 - 2w - 3. Let p(v) = v + 1. Let u(s) = -2p(s) - z(s). Let m(y) = 2y2 - 4. Let r(l) = m(l) + 4u(l). Let t(q) = -2q2. Determine t(r(o)). -8o4 Let v(l) = -l2. Let f(d) = d. Let a(j) be the third derivative of -j*4/12 + 2j*2. Let w(n) = -5a(n) - 12f(n). Give v(w(i)). -4i2 Let w(d) = -d + 1. Let o(t) = -1. Let m(z) = o(z) + w(z). Let r(v) be the second derivative of v3/3 + 3v. Determine r(m(x)). -2x Let s(x) = -7x2 - 5. Let v(o) = -o2 - 1. Let h(l) = s(l) - 5v(l). Let g(d) = d*2. Let m(f) = -4g(f) - h(f). Let y(i) = -2i. What is y(m(t))? 4t2 Let w(r) = -r2. Let q be ((-1)/(4/8))/(-1). Let s(j) be the first derivative of -3/2j2 + 0j - q. What is s(w(a))? 3a2 Suppose -4h - 5i = 0, -3i + 0i = -h. Let r(y) = -2y + y + h + 0. Let p(o) = -o. Give p(r(w)). w Let w(g) = 2g. Let b(j) = j2 - 36j. Let h(a) = 4a. Let y(m) = 4b(m) + 36h(m). Calculate y(w(n)). 16n2 Let z(b) = b2. Let r(k) = 990k. Determine z(r(o)). 980100o*2 Let h(x) = 48114x - 48114x - x2. Let k(b) = 3b*2 - 2b*2 + 0b2. Calculate k(h(r)). r4 Let m(q) = 7q2 + 6q. Let f(k) = 13k2 + 11k. Suppose 4z + 44 + 0 = 0. Let d(s) = zm(s) + 6f(s). Let l(r) = r2. Calculate d(l(i)). i4 Let d(m) = -16m. Let i(u) = -78u. Give d(i(q)). 1248q Let w(g) = 14g + 12g - 26g + g2. Let z(t) be the third derivative of -t4/12 - t2. Determine w(z(p)). 4p*2 Let d(p) = 4p + 5. Let m(c) = 2c + 2. Let a(y) = -2d(y) + 5m(y). Let l(x) = 4x*2. Give a(l(s)). 8s*2 Let n(l) = -2l. Let z(x) be the first derivative of 2x3 - 9. What is z(n(r))? 24r*2 Let k(q) = -3q. Let o(c) = -6c2 + 24c - 2. What is k(o(l))? 18l2 - 72l + 6 Let c(s) = -s*2. Let j(d) be the first derivative of -3d4/4 + d2/2 + d - 1. Let p be j(-1). Let q(h) = -h - 3 + p. What is q(c(g))? g*2 Let t(b) = -416b*2 - 64b. Let j(m) = -32m2 - 5m. Let o(i) = -64j(i) + 5t(i). Let x(u) = -2u. Determine x(o(h)). 64h*2 Let h(m) = -2m*2. Let j(y) = 3. Suppose -2c = 1 + 3. Let a(o) = -o - 2. Let t(u) = cj(u) - 3a(u). Give t(h(k)). -6k2 Let h(x) = x. Let n = 4 + -4. Let b(m) be the third derivative of nm*3 + 0 - 1/30m*5 + 0m + 0m4 - 2m*2. Give h(b(o)). -2o*2 Let j(h) = -13h + 17 - 34 + 17. Let i(l) = -l. Calculate j(i(u)). 13u Let l(q) be the second derivative of -q3/3 + 2q. Let m(w) = 3w - 30 + 30. Calculate l(m(o)). -6o Let c(z) = 1509z2. Let y(m) = 2m*2. Determine c(y(g)). 6036g*4 Let g(j) = -3j + 2. Let z(y) = 2y - 1. Let v(p) = 2g(p) + 4z(p). Let k(i) = -18i. What is v(k(m))? -36m Let r(v) = -v2. Let y(d) = 6. Let w(s) = -s + 5. Let h(x) = 6w(x) - 5y(x). Determine h(r(f)). 6f*2 Let j(l) = 9l + 6. Let h(u) = -18u - 11. Let q(g) = 6h(g) + 11j(g). Let k(m) = m2. Determine q(k(p)). -9p*2 Let r(b) = 17b. Let k(g) = -42g2. What is k(r(z))? -12138z*2 Let a(l) = 2l. Let f(c) = -7c2 + 5c - 5. Let n(w) = -10w2 + 7w - 7. Let s(p) = -7f(p) + 5n(p). Calculate a(s(d)). -2d2 Let g(y) = 2y*2. Let h(l) be the third derivative of 17l*5/60 + 11l*2. Calculate h(g(k)). 68k4 Let y(i) = -i2. Let f(w) = w*2 + 1. Let g(l) = -16l*2 - 32. Let a(n) = 32f(n) + g(n). Calculate y(a(q)). -256q4 Let v(k) = -998k. Let j(l) = l. Determine v(j(d)). -998d Let d(c) = -90c*2 - 2c. Let m(u) = 6u2. Calculate d(m(v)). -3240v*4 - 12v*2 Let s(j) = 2j. Let d(u) be the first derivative of -u6/72 + u3/3 + 2. Let y(c) be the third derivative of d(c). Determine s(y(f)). -10f2 Let b(p) = 5p*2 - 12p*2 + 2p*2 + 7p*2. Let h(w) = -2w*2. What is b(h(l))? 8l*4 Let z(b) be the first derivative of 0b*2 - 2 - 2/3b*3 + 0b. Let s(v) = 5v. Calculate s(z(q)). -10q*2 Let u(c) = 101 + 2c - c - 101. Let m = 0 + 3. Let a(o) = 2o - mo + 3o. What is a(u(x))? 2x Let a(k) = 430k - 215k - 214k. Let s(v) = 22v*2 + 3. Determine a(s(d)). 22d*2 + 3 Let v(c) = -2c*2 - 207 + 207. Suppose 0 = -2q - 0q + 4. Let x(g) = -4g*2 + 0g*2 + 2g*q. Give x(v(s)). -8s*4 Let j(c) = -4c. Let n be (-88)/(-3) + 6/9. Suppose 3b - n = 2b. Let m(u) = b - 30 - u. Calculate j(m(o)). 4o Let p(x) = x. Let s be (-18)/(-24)14. Suppose -13 = -5w - s. Let l(d) = -3d - d + wd. Determine l(p(u)). -2u Let j(i) = -1165i. Let t(c) = c*2. Give t(j(v)). 1357225v2 Let v(w) be the second derivative of w3/6 - w. Suppose -34 = 4l - 142. Let z(x) = -27 - 2x + l. Give v(z(c)). -2c Let z(y) = 144y*2. Let h(f) = -8f. Calculate z(h(n)). 9216n2 Let p(l) be the second derivative of 9l - 5/6l3 + 0 + 0l*2. Let i(k) = -3k*2. Determine i(p(f)). -75f2 Let s(r) = r. Let i(j) be the third derivative of j4/24 + 9j2. Calculate s(i(d)). d Let o(t) = -t. Let h(d) = 5d + 5. Let y(a) = 2a + 3. Let c(u) = 3h(u) - 5y(u). Give c(o(i)). -5i Let f(x) = -63x2 - 5x - 3. Let l(r) = 125r2 + 11r + 7. Let k(c) = -7f(c) - 3l(c). Let z(i) = i*2. Determine k(z(q)). 66q*4 + 2q*2 Let n(o) = -23o*2. Let f(u) = 260u*2. What is f(n(r))? 137540r4 Let b(r) = r2. Let j(f) = 50f + 34. Give b(j(q)). 2500q*2 + 3400q + 1156 Let z(m) = -m2. Let g(s) be the third derivative of -s5/12 + 12s2. Calculate z(g(b)). -25b*4 Let d(q) = -8q*2 - 6q + 6. Let l(n) = n*2 + n - 1. Let m(y) = d(y) + 6l(y). Let a(u) = 1255 - 1255 - u. Determine m(a(p)). -2p2 Let r(o) be the first derivative of o2/2 - 3. Let g(v) be the third derivative of -v5/30 + v2. What is g(r(d))? -2d*2 Let i(l) be the second derivative of 0 + 0l*2 + 0l*3 + 2/3l*4 + 6l. Let b(k) = -2k. Determine i(b(a)). 32a2 Let u(o) be the second derivative of o3/6 + 26o. Let g(j) = 12j*2. Determine u(g(i)). 12i2 Let j(x) = x2 - 2x2 - x2 + 0x*2. Let s(b) = 23b*2. Give j(s(q)). -1058q*4 Let a(x) = -2x*2. Let h(s) = -13s*2 - 9. Suppose 0 = 5t - 35 - 20. Let p = t - 15. Let l(c) = -3c2 - 2. Let q(k) = ph(k) + 18l(k). What is a(q(i))? -8i*4 Let a(u) be the second derivative of -3u - 1/2u3 + 0 + 0u*2. Let s(i) = i. What is a(s(q))? -3q Let h(i) = 14i + 6i - 24i. Let q(x) = -16x*2. Give q(h(b)). -256b*2 Let l(h) = 2h*2. Let k(a) = 34a. Determine l(k(m)). 2312m2 Let t(h) = h. Let j(k) = -3k - 296 + 296. Give j(t(o)). -3o Let h(f) be the first derivative of 1 + 2/3f*3 + 0f + 0f2. Let c(j) = 6j. Determine h(c(p)). 72p2 Let n(l) = -5l. Let g(t) = -2t - 620. What is n(g(d))? 10d + 3100 Let r(j) = -5731j. Let v(q) = -9q*2. Calculate r(v(u)). 51579u*2 Let p(f) = -2f*2. Let a be 0 - (-4)/((-2)/(-1)). Suppose -i = -0 - a. Let y(b) = 0b - 2b + ib + 2b. Calculate p(y(v)). -8v*2 Let b(j) = -4j*2 - 6. Let n(g) = -5g + 3. Let f(a) = 14a - 8. Let i(r) = -3f(r) - 8n(r). Calculate i(b(w)). 8w*2 + 12 Let v(u) = 14u*2 - 3u + 8. Let i(j) = 13j2 - 3j + 6. Let b(k) = 4i(k) - 3v(k). Let m(a) = -2a. Give m(b(l)). -20l*2 + 6l Let z(b) = -3b + b + 4b - 4b. Let p(h) = -2h*2. Calculate z(p(k)). 4k*2 Let w(k) = -7k. Suppose -4l + 0 = -8. Let n(v) = -4v*2 + 2v*2 + 4v**l. Calculate n(w(p)).	{ "pile_set_name": "DM Mathematics" }
b + b)(443b + 202b + 124b) + (-b2 - b2 + 0b2)(3 + 2 - 3) in the form mb2 + jb + p and give m. 765 Rearrange (-p + 0p - p)(3 - 1 + 0) - 6p + 0p + 4p + 79p - 47p - 42p - p + 0p - p + (p + p - 4p)(4 + 1 - 3) - p + 0p - p to l + sp and give s. -24 Rearrange -2 + 358p*2 - 1 - 1 + 16p*2 + 2 to the form kp + l + xp2 and give l. -2 Rearrange (y2 - y2 - 2y*2)(5y2 - 7y2 - y2) + 130y4 - 53y*4 + 61y*4 to the form p + gy + jy2 + ay*4 + ty*3 and give a. 144 Rearrange -6y - y*4 - 72 + 13y - 5y - y3 - y3 - y2 - 3y to oy + ny*3 + dy*4 + h + ty*2 and give h. -72 Express -8s + 148s2 + 5s + 116s2 - s3 - 111 + 111 in the form ts*3 + is + k + ns2 and give i. -3 Rearrange k3 + 7k - 33k2 + 33k*2 + 2k*4 to the form tk*4 + lk*2 + ck*3 + j + sk and give s. 7 Express (-2g3 - g2 + g2)(1883 + 1881 + 10g - 3766) as cg*4 + fg + sg2 + ig*3 + t and give c. -20 Express 3c3 - c3 - 166 - 4c2 - 134 + 260 in the form b + lc*3 + vc*2 + ic and give b. -40 Rearrange (-3 + 5 - 4)((v - 3v + 3v)(-7v + v + 3v) + 3 - v*2 - 3 + 5v*2 - 2v + 2v + v2 - 2 + 2) to the form m + dv*2 + xv and give d. -4 Rearrange r*2 + 1 - 3 + 4 + 0r + r*2 + 0r + (5r - 3r - 3r)(4r - 3r - 2r) + (-26 + 14 - 7)(2r2 + 3r*2 - 4r*2) to lr + m + ar2 and give m. 2 Express (1 + 0 + 1)(3a - 4a - 7a)(13 - 41 + 23) in the form o + ha and give o. 0 Rearrange -m3 - m3 - 315 + 240 to ym + wm2 + s + jm*3 and give s. -75 Rearrange -7i*3 + 2i*4 - 2 + 2i*3 + 2i - 13i4 + 7i*3 to the form bi*3 + di*4 + ai*2 + gi + y and give y. -2 Rearrange (-2 - 1 + 4)(2 + 4 - 4 + (-4 + 3 + 2)(1 + 2 - 1))(-17p - 6p + 0p) to c + dp and give d. -92 Rearrange 22w - w*3 - 44w + w*4 + 0 + 0 + 0w*4 to v + qw + lw3 + tw*2 + hw*4 and give h. 1 Express -86o*3 + 29o*3 - 3 + 32o*3 + 29o*3 - 2 in the form uo*2 + co + xo3 + d and give d. -5 Express (-2575 + 1352 - 1811)(3q - 2q - 3q) in the form g + mq and give m. 6068 Express 7v3 - 2v*2 + 4v*3 + 10v*3 - 8v*3 in the form g + lv + av2 + fv*3 and give f. 13 Express -19y*2 + 7y2 - y3 + 2y3 - 36y + 12y2 as xy*3 + r + gy + qy2 and give g. -36 Express -12 + 13 - 612c + 1383c in the form lc + p and give l. 771 Rearrange 8v2 - 9v*2 + 5v*2 + 8v*2 - 8v*2 + 7v*2 + (2v - 1 + 1)(-2v + 5v - 2v) to the form n + hv2 + dv and give d. 0 Express 0v + v3 + 106v*2 + 3v - 7v3 - 111v*2 in the form lv + s + mv3 + uv*2 and give m. -6 Express 276 - 2u - 2u2 - 5u*4 - 139 + 0u3 - u3 - 140 in the form ku + gu*4 + ru*3 + w + mu*2 and give m. -2 Express -25j - 316j3 + j - j2 + 219j + 318j3 as lj*3 + cj*2 + hj + v and give l. 2 Express 1575u + 10u*2 - 1577u - 54u2 - 1 in the form q + ju + vu2 and give j. -2 Rearrange -3600p + 7714p - 2856p to yp + d and give y. 1258 Rearrange -2 + 1003w + 2w2 - 2029w + 4w4 + 964w to the form xw3 + mw*2 + yw*4 + fw + o and give o. -2 Rearrange 4b3 - b4 + 2b3 + b3 - 4b2 to cb + x + ib3 + ab*4 + zb*2 and give i. 7 Express (-5 + 3 + 0)(-1 - 9427u + 9427u + 7u2)(-10 + 5u + 10) - 2 - u3 + 2 as mu*2 + ou + s + tu3 and give o. 10 Rearrange ((-1 + 3 - 3)(-2 + 2 - 3z) + 0z - z + 0z)(778 - 374 - 372) to s + pz and give s. 0 Rearrange 58a*2 - 17a - 51a4 + 53a4 + a3 - 57a2 to r + na + sa4 + ha*2 + ia*3 and give r. 0 Express (-u + u + 2u*2)(9u - 9u + 3u2) + u3 - 88 + 46u*4 + 88 in the form pu*4 + lu*3 + vu*2 + xu + a and give p. 52 Express 168 + 56q3 + 0q*2 - 72q*3 - 113q3 - 171 + q2 in the form rq + wq*2 + z + kq*3 and give z. -3 Rearrange 0z + 2z - 4z + (-2z + 0z + 0z)(3 - 1 - 4) + (-4z + 5z - 6z)(23 + 19 + 14) to tz + x and give t. -278 Rearrange (-3 - 4 + 1)(2w + 6w - 3w) - 4w + 7w + w to the form yw + i and give y. -26 Express ((5 + 3 - 6)(-2 + 3 - 3) - 2 + 1 + 0)(-37f - 2f*3 + 77f - 32f) as if*3 + d + kf*2 + rf and give r. -40 Rearrange 13y - 44 + 8y*2 + 41 + 2y + 3y to the form o + hy*2 + gy and give h. 8 Rearrange 3 + 0 - 844k3 - 1 + k4 + 131k*2 - 132k*2 to the form jk + l + zk2 + ck*4 + qk*3 and give l. 2 Rearrange -10g*2 + 1 - 22g*2 - 3g + 14167g4 - 14166g*4 to the form x + fg + rg3 + lg*2 + mg*4 and give l. -32 Rearrange -2z*3 + 2z*2 - 10z - z*3 + z - 3z*2 + z to the form vz*3 + cz + l + jz2 and give j. -1 Express -o3 - 2 - 2o + 16o + 1 - 21o as lo + x + yo*3 + ho2 and give x. -1 Rearrange q3 + q*4 - 615q*2 + 582q2 + q4 to the form bq + xq*2 + fq*3 + k + iq4 and give f. 1 Express s4 - 53s3 - 40s*2 + 116s*3 - 61s*3 + 5s*4 - 5s*4 in the form ds*2 + a + ts + ks3 + bs*4 and give k. 2 Rearrange 27m - 26m + 64m*2 - 27m*2 to f + im + km2 and give k. 37 Rearrange 152w + 41w + 112w to d + qw and give q. 305 Rearrange -5s - s*2 + 6s*4 + 2s - 1 - 3s3 - 11s*4 to the form ps*4 + r + ys*2 + fs + ms3 and give m. -3 Express -b4 - b4 + 0b*4 + (5b + 4b3 - 5b)(80b - 48b + 142b) in the form xb4 + w + ob*3 + hb + gb2 and give x. 694 Express -5h*4 - 3h + h + 6084h2 - 6089h*2 as nh + mh4 + ih*2 + qh*3 + z and give z. 0 Express 96 + 3w*2 - 87 + 149 in the form sw + dw2 + p and give p. 158 Express -c - 2c + 1083c2 - 3c + 0c - 1079c*2 in the form w + uc + bc2 and give b. 4 Express (-1 - 4o + 6o + 0)(6o - 2o - 2o)(7o + 1 + 7 - 5) as xo + fo3 + lo*2 + h and give h. 0 Express -6p*2 - 6p*2 + 19p*2 + 2p*3 - 2p*2 - 7p - 9p2 as op + hp2 + fp*3 + j and give h. -4 Rearrange 17i*2 - 7323 - i + 2i*3 + 0i3 + i3 - i*3 + 7321 to wi*2 + si*3 + pi + j and give p. -1 Rearrange -l + 2l - 3l + (l + 3 - 3)(-2 - 2 + 3) - l - 2l + 2l - 3l + 2l + 0l - 105384 + 105384 - 743l to the form cl + h and give c. -748 Express -10u4 - 2 + 5u - 5u - u3 - 2u - 1 as xu2 + v + mu*4 + nu + tu3 and give m. -10 Rearrange (2g*4 - 3g*4 + 3g*4)(40 + 30 + 35)(-2 - 3 + 3) to the form ug*2 + lg + cg4 + s + vg*3 and give c. -420 Rearrange 58a + 7 - 4 - 2 + 7 - 4 to the form l + za and give z. 58 Express (4 - 3 + 1)(x - 2x + 4x)(1 - 1 + 5) as gx + c and give g. 30 Express (-w + 0w - w)(11w3 + 4608w*2 - 4608w*2) in the form nw*2 + aw + sw4 + vw*3 + k and give a. 0 Rearrange (-33 + 2 - 46)(4y - 2y + 0y + (0 + 2 + 0)(2y - 2 + 2) + 1 - 1 + 2y + y + y + 0y) to g + dy and give d. -770 Rearrange (6 - 6 - 2p)(-p + p + p + (6 + 1 + 0)(5p + p - 5p) + (-2p - 1 + 4p - 4p)(-2 - 1 + 2)) to o + wp*2 + vp and give v. -2 Express -11 + 93r + 269r + 19 - 8 in the form nr + f and give n. 362 Rearrange 4j + 2j2 + 1483 - 1483 to the form n + kj + oj2 and give k. 4 Express (8k - 9k + 48k)(1 + 5k - 1)(-2k + 3k - 2k) as nk2 + rk + i + sk3 and give s. -235 Express -31z*2 + 1 - 45z*2 + 16z2 + z4 as fz4 + qz*2 + bz*3 + kz + i and give i. 1 Rearrange 71x + 55x + 3x3 + 14x - x*3 to bx*3 + cx + j + yx2 and give b. 2 Rearrange ((5 + 2 - 4)(-3 + 4 - 17)(3 + 0 - 1) + 4 - 2 - 1)(f*4 - 5f*3 + 5f*3) to rf*4 + af*3 + v + pf*2 + tf and give r. -95 Express (-6p2 + 13p2 - p2)((3 + 2p - 3)(-1 + 0 - 1) - 5p + 3p + p) in the form ip + lp3 + u + gp*2 and give l. -30 Rearrange (-3a + 7 - 7)(0a + 0a - 2a) + 6a2 + 105a*2 - 4a - 57a2 to za*2 + va + b and give v. -4 Express (-32 + 3 - 47)(0 + 4 - 1)(r*2 - 2r + 2r) as vr + h + qr2 and give q. -228 Express 3c*2 + 2c*2 + 5 - 2 + 9c*2 in the form jc + g + sc2 and give g. 3 Rearrange (33d - 45d + 28d)(-2 - 2 + 2 + (0 + 1 - 4)(0 - 1 + 2) + 1 + 1 + 0) to the form g + cd and give c. -48 Express v3 - 2 + 6v*2 - 10v*2 + 2v*4 + 10v*2 as hv + pv3 + fv*2 + nv*4 + y and give p. 1 Rearrange (3q*2 + 2q*2 + 0q*2)(38q - 38q - 32q2)(-1 - 4 - 1) to lq2 + c + bq*4 + tq*3 + x	{ "pile_set_name": "DM Mathematics" }
7k - 81. Let l be r(3). What is the highest common divisor of 5391 and l? 9 Let c(a) = -a2 - 76a + 1364. Let q be c(-68). What is the highest common factor of 36 and q? 36 Suppose 3y = 2v - 85, -y - 2y + 3v - 84 = 0. Let w = -47 - y. Let r = w + 39. What is the highest common factor of 7 and r? 7 Let p(b) = b*2 + 188b - 6251. Let j be p(30). Calculate the highest common divisor of j and 2227. 17 Let s = 1065 + -1043. What is the greatest common factor of s and 1342? 22 Suppose 7a - 591 = 95. Suppose 112d - ad = 224. What is the highest common divisor of 28 and d? 4 Suppose -2y - 6t = -146, -13t + 385 = 5y - 18t. Calculate the highest common divisor of 11476 and y. 76 Suppose 27o - 1077 - 2001 = 0. Let b = -49 + o. Calculate the highest common factor of 585 and b. 65 Let u be (-8136)/(-270) - (-9)/((-540)/8). Let t = 12 - 23. Let y = u + t. Calculate the highest common factor of y and 95. 19 Suppose 13b + 32934 = 33220. Calculate the greatest common divisor of b and 2189. 11 Let d(c) = -184c + 1022. Let k be d(4). Calculate the greatest common factor of k and 242. 22 Let b(c) = -2c*3 + 16c*2 + 116c + 20. Let r be b(-5). What is the greatest common factor of 810 and r? 90 Suppose -5j + 2l + 35 = -9, -4l + 12 = 0. Suppose -31a + 33a + j = 0. Let n be 828/180 + (-1 - 7/a). Calculate the greatest common factor of n and 35. 5 Let k = -3 + 68. Suppose -43 = -12j + 53. Let x be (689/(-212))/(14/j - 2). Calculate the highest common divisor of x and k. 13 Let y(b) = 4b2 + 134b - 198. Let i(n) = -n*2 - 45n + 68. Let d(f) = -7i(f) - 2y(f). Let s be d(45). Calculate the highest common divisor of 95 and s. 5 Let w = -7 - -35. Let k be 48/w21/6. Suppose -12r = -6r - 72. What is the greatest common factor of r and k? 6 Let l = -503 + 553. What is the greatest common divisor of l and 4950? 50 Suppose 0 = 14218r - 14281r + 13293. Calculate the greatest common divisor of 41567 and r. 211 Let n be ((-1)/4 - (-12)/48)/1. Suppose 8s + s - 522 = n. Suppose -4z + t = -s, -2z + 4t + 6 = -30. What is the highest common divisor of 14 and z? 14 Let q(j) = -2j*2 + 3j. Let v be q(2). Let u = -3050 - -3051. Let l be (-52)/vu/2. What is the highest common factor of 117 and l? 13 Suppose -8q + 28 = -4q. Let g be ((-2)/4)/(103/(-3502)). Suppose -22 = go - 39. Calculate the greatest common divisor of o and q. 1 Let b(a) = -219a + 4167. Let n be b(19). What is the greatest common divisor of 7494 and n? 6 Let y be 7299/2(194 - 192). Calculate the greatest common divisor of 18 and y. 9 Let j be 849(1670/(-210) + 8) + 9/(-21). Suppose -3m + 0m - 3i + 318 = 0, 5i = -m + 90. What is the highest common factor of m and j? 10 Suppose -26u + 172062 = 60u + 15198. What is the greatest common divisor of 4 and u? 4 Suppose 43v + 12 = 37v. Let w(p) = -18p - 26. Let u be w(v). Calculate the greatest common factor of 790 and u. 10 Let u = 666 + 76. Let s = u + -735. Calculate the greatest common factor of s and 91. 7 Let a be 0(33/27 + (-4)/18). Suppose -24t + 22t + 6 = a. Suppose tm + 5y + 20 = 69, y = -2m + 28. What is the highest common divisor of m and 143? 13 Suppose 2680 + 28642 + 2662 = 4r. Calculate the highest common factor of 144 and r. 144 Let w be 12 + -5 - (2 + -2). Suppose 0 = 2j - wj + 15. Suppose 4p = -jp + 49. Calculate the greatest common divisor of 7 and p. 7 Suppose 0 = 182f - 174f - 10120. Calculate the highest common factor of 11 and f. 11 Suppose 0 = 4x + 8, -4b - 6x + 5x + 170 = 0. Suppose -bw = -37w - 120. What is the highest common factor of w and 30? 10 Suppose -5b = -5u + 150, 2b = 5u - b - 142. Let c be 0/(-4 + 0) + u. Let s = 40 + -1. What is the highest common factor of c and s? 13 Let b be (-32048)/(-20) + 30/(-75)1. What is the greatest common divisor of b and 234? 18 Suppose 0 = 4m + m - 5s - 3705, -3m + 2223 = s. What is the greatest common factor of 114 and m? 57 Let d be (-54)/270 - 4278/(-15). Calculate the greatest common factor of d and 60. 15 Suppose 6 = m - 2. Suppose -10p + mp = 0. Suppose r + 5r - 666 = p. Calculate the greatest common factor of r and 37. 37 Let i = -271 - -379. Let r(j) = 69j + 141. Let u be r(-3). Let a be -2 + u/(-30) + (-295)/(-25). What is the highest common divisor of a and i? 12 Let a(m) = -m3 + m2 + 2m + 150. Let z be a(0). Suppose -185 = -3y - 4n, -3y - 37n + z = -40n. Calculate the greatest common divisor of 220 and y. 55 Let p(f) = -38f - 701. Let q be p(-25). Calculate the highest common divisor of q and 1. 1 Suppose -3d + 802 = 175. Let f be (-15 + (-731)/(-51))(3 + 117/(-6)). What is the highest common divisor of d and f? 11 Suppose 0 = -3g - 2g + 2m + 152, -4g + 132 = m. Calculate the highest common divisor of g and 144. 16 Let w = -490 - -556. Let z = -10 - -16. Suppose 0t = zt - w. What is the highest common divisor of 55 and t? 11 Suppose 10p - 500 = 5p. Let k = p + -89. What is the greatest common factor of 253 and k? 11 Let w = 56 + -54. Suppose 0 = 2l - 4y + 2, wl + 3y = y + 16. Suppose lb = 9b - 68. What is the greatest common divisor of b and 153? 17 Suppose 120 - 516 = -11u. Suppose 5h - 3h - u = -l, 57 = 3h + 3l. What is the highest common factor of h and 629? 17 Let q be 34/30 + 2072/20. Let l be (q/(-10))/(-5 - (-48)/10). Let w be ((-13)/4)/(-2(-3)/(-24)). What is the highest common divisor of l and w? 13 Let d = -22 - -25. Let s be 12/(-3d/(-9)). Suppose -28 = 10n - sn. Calculate the highest common divisor of 21 and n. 7 Suppose 5a - 2a + 21 = 0. Let i be 0/a(-1)/(-1). Suppose 20v - 22v + 44 = i. Calculate the greatest common divisor of v and 22. 22 Let o = -1320075 + 1320211. Suppose -q - 3q - 5s + 59 = 0, 3s - 45 = -3q. Calculate the greatest common divisor of o and q. 8 Suppose -12 + 4 = 4n. Let l be -2(n - (-3)/6). Let k(y) = -y2 + 47y - 481. Let i be k(31). What is the highest common factor of i and l? 3 Suppose -221c + 27 = -220c + 4a, 0 = -4c - 3a + 173. What is the highest common factor of c and 10951? 47 Let p = 333 - 325. Let f be (-110)/88 + 586/p. Calculate the greatest common divisor of 120 and f. 24 Let q = 50936 - 28631. What is the highest common factor of 15 and q? 15 Let h be (-5775)/(-15) + 0/1. Calculate the greatest common factor of h and 105. 35 Suppose -3w + 88 = 5w. Let o be (1 + 0)w + (3 - 5). Suppose 2c = -y + 25, c - y = 2y + o. What is the highest common factor of 4 and c? 4 Let j be (-5)/2-7(7 + (-12)/4). Calculate the greatest common divisor of j and 42. 14 Suppose 13p - 69781 = 34258. What is the highest common factor of p and 53? 53 Let m = -1007 - -4859. What is the greatest common factor of 749 and m? 107 Let f(m) = 4m*3 + 3m*2 - m + 2. Let l be f(4). Let x = 476542 - 476540. Calculate the greatest common factor of l and x. 2 Let w be (-4 + -4 + 26 + -13)72/15. Let s(k) = 4k2 + 4k + 4. Let p be s(-5). What is the highest common divisor of p and w? 12 Let h be (3 - (-5 - -8)) + -22. Let i be ((-5)/5)/(1/h). What is the highest common divisor of 2 and i? 2 Suppose 2m = -g + 2g - 788, -g + 784 = -m. Suppose -4q = -2792 + g. Let b = q + -260. What is the highest common divisor of 27 and b? 27 Let u be ((-1062)/8)/((-127)/1016). What is the highest common factor of 3068 and u? 118 Suppose 1001m + 4n = 1004m - 5852, 9856 = 5m + 8n. Calculate the greatest common factor of m and 105. 35 Suppose -56s - 9s = -195. Let x = -9 - -5. Let f be 290 - (s + x - -3). What is the highest common factor of 36 and f? 36 Suppose 0 = -2y - 2g + 20296, -13y + 15y - 4g - 20320 = 0. Calculate the greatest common divisor of 16 and y. 8 Suppose 0d = 27d - 6345. Suppose -282 = -7r + r. What is the greatest common divisor of d and r? 47 Suppose 49w + 459 = 64w - 321. What is the highest common factor of w and 2743? 13 Let t = -177 - -369. Suppose 0o = -2o + 132. Let v = t - o. Calculate the greatest common factor of v and 42. 42 Suppose 0 = -3s - 4p + 50, 16 - 64 = -3s - 3p. Let d(o) = -o*3 + 13o*2 + 23o - 38. Let b be d(s). Calculate the greatest common factor of b and 16. 8 Let u = 116 - 4. Let b = 109 + -108. Suppose 0 = -4*c - b + 65. What is the highest common divisor of c and u? 16 Let p = 1244	{ "pile_set_name": "DM Mathematics" }
6p + 497. What is the hundreds digit of p? 1 Suppose f + 13 = 13. Suppose 5m - 1041 - 124 = f. Suppose -6d + 469 = -m. What is the units digit of d? 7 What is the hundreds digit of ((-40)/(-24) + -2)(-3 + -73674)? 5 Suppose 3o = 5l - 78384, 4939 = l + 2o - 10730. What is the units digit of l? 5 Let a = 422 + 27. Let l = -141 + a. What is the tens digit of l? 0 Let g = 70489 - 42530. What is the hundreds digit of g? 9 Suppose -18g = -0g + 144. Let y be 1(2 + g + 2)/(-2). What is the units digit of 0 + 0 + (-3)/3 + y? 1 Let w = -232 - -234. Suppose 44 + 702 = 3x - 4c, -492 = -wx + 4c. What is the tens digit of x? 5 What is the units digit of -2273((-95)/19 + -9)? 2 Let g(t) be the third derivative of t5/15 + t4/6 - 2t3 - t2. Let u be (-3)/(9/6)(-40)/(-16). What is the tens digit of g(u)? 6 Let k = -38 + 41. Suppose ka - 2684 - 718 = 0. What is the hundreds digit of (-1 - 4) + a/7? 1 Let k = -1 - -5. Suppose 5i + 17 = 4a - k, -2a + 4 = 4i. Suppose -2w = -5f + 143, af - 70 - 30 = -2w. What is the tens digit of f? 2 Let b = -18516 + 29839. What is the units digit of b? 3 Let b be (-80)/(-3)(-183)/(-2). Suppose -2g = 5z - b, 2z - 960 = -4g - 0g. What is the tens digit of z? 9 What is the hundreds digit of 808(1(-3)/(-1) - (-175)/(-140))? 4 Suppose 0 = -54p + 51p + 13671. What is the units digit of (p/(-14))/(4/(48/(-9)))? 4 Suppose 24u - 32 = 16u. Suppose -b + 359 = us, 5s - 6b = -5b + 442. What is the units digit of s? 9 Let n be (4 - (3 + -5)) + -8 + 4. Suppose 2769 = 5z - 2x, x = nx + 2. What is the hundreds digit of z? 5 Let c(f) = 3f*2 + 18f + 217. What is the units digit of c(47)? 0 Suppose -7z = -2z - 1880. Suppose 322 - 387 = -13a. Suppose -z = i - ai. What is the units digit of i? 4 Let i(p) = -11 + 40p3 - 42p*3 + 9p - 21p2 - 13. What is the hundreds digit of i(-12)? 3 Let h(x) = 3x*2 + 7x + 16. Let p be 1178/(-95) + (-1)/(-5)2. What is the tens digit of h(p)? 6 Let o(q) = -916q - 1. Let p be o(1). Let b = -317 - p. What is the tens digit of b? 0 Let y(f) be the second derivative of f*5/20 + 7f4/12 + f3/2 - f*2 + 11f. Let a be y(-8). What is the tens digit of 280/6 - 30/a? 4 Let g = 5801 - -5183. Suppose 40a + g = 27944. What is the tens digit of a? 2 Let f(v) = 23v*2 + 81v - 9v2 + 92v - 185v - 31. What is the tens digit of f(-4)? 4 Let l(o) = 7o + 62. Suppose 20 = u + 5f, -2u + 3u = -4f + 19. What is the tens digit of l(u)? 6 Suppose 5m = -4b + 194625, 78705 = 2m + 3b + 848. What is the thousands digit of m? 8 Let l be (-44)/(-77) + 12/(-21). Suppose l = -t + 54 + 201. What is the tens digit of t? 5 Suppose 16 = 4k, -l - 1552k + 1556k + 26739 = 0. What is the tens digit of l? 5 Let r(a) = -15a*3 + 58a*2 + 100a - 68. What is the tens digit of r(-16)? 2 Let p(z) = 57z2 + 137z + 729. What is the ten thousands digit of p(24)? 3 Let i = -530 + 683. Suppose n + 88 - i = 0. What is the tens digit of n? 6 Let i be (-9)/6220/(-30). What is the tens digit of 6 + -4 - -38i? 2 Suppose -5c + 147346 = 4r, 6r - 2c - 168025 - 52937 = 0. What is the tens digit of r? 2 Suppose 20 = -5c - 55. Let z(q) = 13 + 2 - 77q + 5 + 15 + 76q. What is the tens digit of z(c)? 5 Let m = 58162 - 23925. What is the ten thousands digit of m? 3 Let q be (1 + 1)-1 + -3. What is the hundreds digit of (-4 - q)/((-2)/(-468))? 2 What is the tens digit of 6/11 - (737135/(-11) - 504/2772)? 1 Let l be (-6)/152460(-5)/5. Let u = l + -458. What is the hundreds digit of u? 5 Let a = 1291 - 511. Let m = -47 + a. What is the hundreds digit of m? 7 Let r(n) be the first derivative of -n4/4 + n3 + 4n2 - 10n + 5. Let g be r(4). Suppose -546 = gk - 13k. What is the units digit of k? 8 Suppose 221s - 228s = 16814. What is the units digit of s/(-18) + (-2)/92? 3 Let b(v) = -5v*3 + 32v*2 - 16v + 20. Let k(p) = 22p3 - 129p*2 + 65p - 80. Let r(m) = -9b(m) - 2k(m). What is the hundreds digit of r(31)? 3 Let c(f) = f*2 - 2f - 15. Let s be c(-4). Let v be (3 - 3(-8)/3)s. Let a = v - -62. What is the hundreds digit of a? 1 Let f = 43 - 54. Let s = f - -16. Suppose -80 = 4o - so. What is the tens digit of o? 8 Suppose 5n - 1081 + 186 = 0. Suppose -p - n + 12 = 0. Let v = p + 374. What is the units digit of v? 7 Let m = 1086 + -744. Suppose 4h - b = -6b + m, 3b = 2h - 182. Suppose -2u - 152 + 52 = -3v, 3v = 5u + h. What is the units digit of v? 6 Suppose -q + 10v = 3q - 47424, 5q - 59301 = 2v. What is the ten thousands digit of q? 1 Let r(y) be the third derivative of y6/120 + y5/6 - y4/12 + 10y*3/3 + 30y*2. Let x be r(-9). Suppose -4k = x - 1035. What is the units digit of k? 9 Suppose -320 = 6n - 22n. Let f(j) = -j*2 + 18j + 66. Let k be f(n). What is the tens digit of ((-6 - -48) + -2)/(4/k)? 6 Suppose -b + 81 = -33. Suppose -38k + b = -36k. What is the tens digit of k? 5 What is the thousands digit of (-1 - -11396) + 3 - (0/9)/(-7)? 1 Let f be 482/14 + 132/231. Let q(p) = 37p3 - p - 1. Let g be q(-1). Let w = f - g. What is the units digit of w? 2 Let t = 183 - 182. What is the units digit of (0 + -2)t(-2637)/18? 3 Let t = 13141 + 2671. What is the thousands digit of t? 5 Let i(q) = 12q*2 - 6q - 243. What is the tens digit of i(27)? 4 Suppose d + 8p - 7p + 555 = 0, 3d + 1663 = -4p. Let s = -118 - d. What is the hundreds digit of s? 4 What is the tens digit of 10/(-12)(-3633 - -39)? 9 Let w(h) = -8h*3 + 3h*2 - 3h + 2. Let p be w(-6). Let k = -13727 + 13726. What is the tens digit of k/(-3) + p/12? 5 Let m = 94280 + -61180. What is the ten thousands digit of m? 3 Let h(n) = 104n2 - 40n - 2. What is the thousands digit of h(-5)? 2 Suppose -45u + 127409 = -87466. What is the hundreds digit of u? 7 What is the hundreds digit of -9 + (-13)/(((-76)/4384)/19)? 2 Let k = 396 - 158. Suppose 3b + k = 2977. What is the hundreds digit of b? 9 Suppose 0i + 1560 = 6i. Let a = -176 + i. Suppose 8k - a = 7k. What is the tens digit of k? 8 Suppose 0 = -q + i + 7345, 41q - 3i - 14687 = 39q. What is the units digit of q? 8 Let u = 1038 - 676. Suppose 2k - n - u = n, -4n = 20. What is the tens digit of k? 7 Let d(t) = 367t + 151. Let j(m) = 551m + 227. Let s(v) = 8d(v) - 5j(v). What is the hundreds digit of s(3)? 6 Let j(n) = -20n*2 + 36n - 104. Let p be j(3). What is the units digit of 32/p - ((-10234)/22 - 2)? 7 Suppose -3n + 3430 = 2n. Suppose n = -4d + 5d. Suppose 5s - 3r - 745 + 61 = 0, 5s - d = 2r. What is the tens digit of s? 3 Let v = -126 - -735. Let d = v - 415. What is the tens digit of d? 9 Suppose 3t + 2j - 3414 = 0, -t = -4t - 3j + 3411. Suppose 4a = -4l + t, -3l - l + 1135 = -a. What is the hundreds digit of l? 2 Let b be (-6)/39 - 17031/(-91). Suppose -4t + 7t + 5r - 629 = 0, 4r = t - b. What is the hundreds digit of t? 2 Let l be 7 - (-1 + 0)/(8/24). What is the units digit of 50 + ((-25)/15)/(l/(-12))? 2 Suppose 4a - 5z = 28389, -4z + 26463 = 4a - 1953. What is the tens digit of a? 0 Suppose 53q - 45987 - 46657 = 0. What is the thousands digit of q? 1 Let o(b) = 16b + 734. What is the thousands digit of o(72)? 1 Let x = 407 + 245. Suppose x = -4z + 2036. What is the hundreds digit of z? 3 What is the ten thousands digit of (((-5)/35)/(6/21))/((-5)/222370)? 2 Let r(s) = -23s - 17. Let w be (3/(-1) - 0) + 9 + -10. What is the tens digit of r(w)? 7 Suppose 8g - 3g = 725. Let z = g + -92. Suppose 2l - 2s - 46 = 3s, 5l + 3s = z. What is the tens digit of l? 1 Let r(y) = -y*3 + 17y*2 - 17y - 15. Let h be r(16). Let c = 32 + h. What is the units digit of c + 21 - (-14 + 10)? 6 Suppose -7w + 12w - 10 = 0. Suppose 0 = t - w, 2g - g = -t + 81. Suppose z - 4 - g = 0. What is the units digit of z? 3 Suppose 13949 = -21a + 34a. Let h = a + -218. What is the units digit of h? 5 Suppose 4r - 73 = 15. Suppose rx + 80 = 27x. Suppose -14n - 58 = -xn. What is the units digit of n? 9 Let w(s) = 3s3 + 21s*2 + 2s + 10. Let k be w(-7). Let h = 95 + k. What is the units digit of (-10 + 0)h/(-14)? 5 Let m(s) = -1702s + 6070. What is the ten thousands digit of m(-13)? 2 Suppose -13376 = -35*y + 253230 + 79369. What is the thousands digit of y? 9	{ "pile_set_name": "DM Mathematics" }
that o(k) = 0. -1, 0, 1 Let u = 117 + -115. Suppose -2/7m3 + 0 + 4/7m - 2/7mu = 0. Calculate m. -2, 0, 1 Let y(h) be the first derivative of h8/168 - h7/105 - 3h*2/2 + 3. Let w(b) be the second derivative of y(b). Find l, given that w(l) = 0. 0, 1 Suppose -3f + 12 = 3z, -1 - 7 = -4z. Let -1/3cf + 2/3 + 1/3c = 0. What is c? -1, 2 Let s(c) be the second derivative of c7/1260 + c6/360 + c4/4 - c. Let x(q) be the third derivative of s(q). Let x(w) = 0. What is w? -1, 0 Let x(o) be the first derivative of -o7/189 + o6/27 - o5/10 + 7o4/54 - 2o*3/27 - 2o - 2. Let a(s) be the first derivative of x(s). Factor a(h). -2h(h - 2)(h - 1)3/9 Let i be -2 - -7 - (1 + 0). Factor 0l3 + l2 + 4l5 - 4l*i - 3l*4 + 6l*3 - 4l3. l2(l - 1)2(4l + 1) Let s(t) be the third derivative of -t6/180 - t5/270 + t4/36 + t3/27 + 20t*2. Let s(a) = 0. Calculate a. -1, -1/3, 1 Let i be (-6)/12(0 + -2). Let u be (3/(-6))/(i/(-6)). Suppose -4b + ub*2 - 2b*2 - 2 - 3b*2 = 0. What is b? -1 Suppose 8 = -6c + 20. Let s be 1 - (0 - (-3)/4). Factor -smc + 1/2m - 1/4. -(m - 1)*2/4 Let g(w) be the second derivative of 2/21w*7 + 4/5w5 - w2 + 1/3w4 - 2/3w*3 + 0 - 3w + 7/15w6. Solve g(n) = 0. -1, 1/2 Suppose 0l + 24 = 3l. Let r = -5 + l. Let -p4 + 0p3 + p3 + p*2 - 4p + rp = 0. Calculate p. -1, 0, 1 Let z(d) be the third derivative of 0d + 0 + 1/24d3 - 1/480d*6 - 1/240d*5 + 1/96d*4 + 4d*2. Suppose z(x) = 0. Calculate x. -1, 1 Let u(o) be the first derivative of 3o*5/5 - 3o*4/4 - 5. Let u(b) = 0. Calculate b. 0, 1 Let h = -7 - -5. Let g be h/((0 - -1) + -7). Find x such that 1/3x*2 - gx*3 - 1/3x*4 + 1/3x + 0 = 0. -1, 0, 1 Let o = 8259/14 - 1179/2. Let oy + 0 - 5/7y*2 = 0. Calculate y. 0, 3/5 Let p(f) = -13f*2 + 2f - 7. Let s(q) = 7q2 - q + 4. Suppose -w + 4w - 18 = 0. Let k(b) = wp(b) + 11s(b). Factor k(i). -(i - 2)(i + 1) Let b(t) be the first derivative of -t5/30 + t4/9 - t3/9 + 2t + 3. Let x(k) be the first derivative of b(k). Factor x(m). -2m(m - 1)*2/3 Let o(f) = 30f*3 + 82f*2 + 24f. Let y(u) = -15u2 - 10u*3 - 14u*2 - 8u - u*2 + 3u*2. Let g(b) = 3o(b) + 10y(b). Let g(i) = 0. Calculate i. -2, -2/5, 0 Let v(j) be the first derivative of 14/39j*3 + 4/13j - 3 + 9/13j2. Factor v(p). 2(p + 1)(7p + 2)/13 Let u(g) be the first derivative of g*6/14 + 24g*5/35 + 75g*4/28 + 38g*3/7 + 6g*2 + 24g/7 + 7. Factor u(p). 3(p + 1)2(p + 2)*3/7 Let c(k) = -2k - 4. Let w be c(-2). Let q(x) be the second derivative of 3x - 1/4x*4 + 2/3x*3 + w + 2x2. What is b in q(b) = 0? -2/3, 2 Let z(n) = n2 - n - 54. Let v be z(8). Factor 0 + 4/11c + 2/11c*3 - 6/11c*v. 2c(c - 2)(c - 1)/11 Let p(l) be the third derivative of -l8/1008 - l7/210 - l6/180 + l5/90 + l4/24 + l3/18 - 11l2. Factor p(q). -(q - 1)(q + 1)*4/3 Let d(h) be the first derivative of -2h*6 + 8h5/5 + h4 - 40. Find p, given that d(p) = 0. -1/3, 0, 1 Let o be 1 + 3 + (2 - 1). Let n = 46 - 42. Factor -2l - lo + 2l3 - l2 + l3 + l4 - 2l4 + 2l*n. -l(l - 2)(l - 1)(l + 1)2 Let w(k) = -k3 - k*2 + 3k + 2. Let b be w(-2). Solve -2u5 + bu*5 + 4u*3 + 0u - 3u + u = 0. -1, 0, 1 Let n(x) be the second derivative of 9x8/1960 - x6/70 - 2x5/105 - x4/84 - x3/6 - 3x. Let m(o) be the second derivative of n(o). Solve m(f) = 0. -1/3, 1 Let b(v) be the first derivative of v*6/10 + 3v5/10 - v3 - 3v2/2 + v + 3. Let o(r) be the first derivative of b(r). Solve o(f) = 0. -1, 1 Let k(r) = -34r*3 + 83r*2 + 47r. Let b(z) = -11z3 + 28z*2 + 16z. Let y(l) = -11b(l) + 4k(l). Factor y(s). -3s(s - 2)(5s + 2) Let d be (-1)/(-5) - (-87)/15. Suppose ds - 147s*4 - 18s - 96s2 - 248s*3 + 17s*3 = 0. Calculate s. -1, -2/7, 0 Let p(n) be the first derivative of 3/14n*4 + 0n + 0n2 - 3 - 4/21n*3. Factor p(z). 2z*2(3z - 2)/7 Let c(m) be the first derivative of -m9/6804 - m8/2520 + m6/1620 + m3/3 - 3. Let q(j) be the third derivative of c(j). Factor q(p). -2p*2(p + 1)*2(2p - 1)/9 Let u(h) be the third derivative of 0h*4 + 0h + h*2 + 0h*3 + 0 + 5/112h*8 + 1/120h*5 + 19/480h*6 + 59/840h*7. Find z such that u(z) = 0. -2/5, -1/3, -1/4, 0 Factor 0l*2 + 0 - 6/5l*3 - 3/5l*5 - 9/5l*4 + 0l. -3l3(l + 1)(l + 2)/5 Suppose -10 + 4 = 2d + 3x, -4d - 3x = 6. Let s(j) be the first derivative of dj*2 + 0j + 1/3j3 - 1 - 3/4j4. Factor s(r). -r2(3r - 1) Suppose 0 - 16/3h3 - 4h + 26/3h2 + 2/3h*4 = 0. What is h? 0, 1, 6 Let f(g) = 2g + 28. Let a be f(-13). Factor 8/5i + ai*3 + 2/5i*4 + 0 + 16/5i*2. 2i(i + 1)(i + 2)*2/5 Let g(v) = 10v5 - v4 - 10v3 - 10v*2 - 11v. Let u(y) = 2y5 - 2y*3 - 2y*2 - 2y. Let l(t) = -2g(t) + 11u(t). Factor l(c). 2c2(c - 1)(c + 1)2 Let c(p) be the third derivative of 0 - 2p*2 + 0p + 1/1155p7 + 1/165p*5 + 0p*3 + 1/132p*6 + 0p*4 - 1/924p*8. What is g in c(g) = 0? -1, -1/2, 0, 2 Let d(k) be the first derivative of -3k*5/5 - 3k4/4 + k3 + 3k2/2 + 8. Let d(c) = 0. What is c? -1, 0, 1 Let k = 56 - 24. Let v = 172/5 - k. Suppose -4/5u*2 - 9/5 - vu = 0. What is u? -3/2 Let j be 2/5(-5)/8-2. Factor -3/4z + 1/4 + jz*2. (z - 1)(2z - 1)/4 Let j(q) be the second derivative of q6/60 + q5/50 - q4/30 + 2q*2 + 2q. Let f(u) be the first derivative of j(u). Factor f(t). 2t(t + 1)(5t - 2)/5 Let 0y + 0 + 0y*2 + 1/3y*4 - 2/3y*3 = 0. Calculate y. 0, 2 Let a(u) be the third derivative of 1/15u*4 + 4u*2 + 0u - 4/15u3 + 0 - 1/150u*5. Factor a(q). -2(q - 2)2/5 Let l(c) be the first derivative of -c6/300 + c*4/60 - 9c*2/2 + 10. Let s(n) be the second derivative of l(n). Factor s(j). -2j(j - 1)(j + 1)/5 Suppose -3b + 3 = -9. Factor -26v - 3v2 + 22v*4 + 70v*3 + 27v*4 + b + 6v. (v + 1)*2(7v - 2)2 Suppose -2f - 5k + 24 = 0, 4k - 9 = -2f + 11. Suppose -3a - 1 = 4z, -fz - 2z - 2a + 2 = 0. Let -2/7rz - 2/7r*3 + 2/7r + 2/7 = 0. Calculate r. -1, 1 Let -2r2 - 4r - 5r + r - 26r2 = 0. What is r? -2/7, 0 Let s(n) be the second derivative of n6/7 + 11n5/70 - 4n*4/21 - 4n*3/21 - 15n + 3. Suppose s(f) = 0. Calculate f. -1, -2/5, 0, 2/3 Let p be (-4)/((-12)/15) + -2. Factor -3/2sp + 3/2s - s*2 + 1. -(s - 1)(s + 1)(3s + 2)/2 Suppose 4v + 12 = 4f, 0f + 3f + 3v + 9 = 0. Let t be 0 - f - (0 + -5). Factor 0i*4 - 4/7i*3 + 0i*2 + 0 + 2/7i + 2/7it. 2i(i - 1)2(i + 1)*2/7 Find s such that -12/7s*2 + 8/7s + 0 + 4/7s3 = 0. 0, 1, 2 Let d(k) be the second derivative of k4/48 - k3/8 + 3k. Factor d(z). z(z - 3)/4 Let w be (-252)/(-594) + 1/(-11). Suppose 0 - 1/3k + wk2 = 0. Calculate k. 0, 1 Let n be 52/66/4. Suppose -8i - 9 = -11i. Let d + 4d3 - 11d - 6di + n + 8d*2 - 9 = 0. What is d? 1, 2 Let l(y) be the third derivative of 0y + 3/2y4 + 2/3y*3 + 27/20y*5 + 0 - 3y*2. Factor l(x). (9x + 2)*2 Let z(f) be the third derivative of 0f*3 + 1/5f*6 + 0f + 2/3f4 - 4/105f7 - f2 + 0 - 8/15f5 + 1/336f8. Solve z(u) = 0. 0, 2 Let l(h) = h2 - 2. Let n be l(-2). Let z(p) be the second derivative of 1/12p4 + 1/2p*n + 0 + 1/3p*3 - 2p. What is j in z(j) = 0? -1 Suppose -m + 13 = o, 4m = 2 + 2. Let l be (-7)/(-12) - 3/o. Find v such that lv + v3 + 0 - v2 - 1/3v4 = 0. 0, 1 Let w(t) be the second derivative of -t5/8 - t4/24 + 5t3/12 + t2/4 + 37t. Factor w(z). -(z - 1)(z + 1)(5z + 1)/2 Factor -2/5b - 2/5b*3 - 4/5b*2 + 0. -2b(b + 1)2/5 Solve -4/3p*4 - 14p*2 - 10/3 + 34/3p + 22/3p3 = 0. 1, 5/2 Let j(n) be the third derivative of n6/84 - 2n*5/35 - 11n*4/84 + 2n*3/7 + 2n*2 + n. Suppose j(d) = 0. Calculate d. -1, 2/5, 3 Determine t so that 6t*3 - 2t*5 + 663t*2 - 663t*2 + 4t4 = 0. -1, 0, 3 Let g(v) be the third derivative of -v8/2352 - v7/735 + v5/210 + v*4/168 + 2v2. Determine a, given that g(a) = 0. -1, 0, 1 Let c(q) be the second derivative of -q6/90 - q*5/10 - 30q. Solve c(x) = 0 for x. -6, 0 Let y be (-18)/124/(-3). Suppose 8d - 7d - y = 0. Solve -1/4	{ "pile_set_name": "DM Mathematics" }
3 - 2? 254411211 In base 10, what is -246768193 - 5? -246768198 In base 5, what is 310 - 101040032? -101034222 In base 10, what is -94488 - -36? -94452 In base 6, what is 3515250 + 1532? 3521222 In base 2, what is -1 - -110110101010101000111? 110110101010101000110 In base 13, what is -328593 + 132? -328461 In base 2, what is 10101011001001100011111100 - -1? 10101011001001100011111101 In base 6, what is -332 - 320505? -321241 In base 12, what is 35b65 + -31b? 35846 In base 6, what is -30 - 40542152? -40542222 In base 3, what is -2102 + 120212102120? 120212100011 In base 9, what is 24 + 846833? 846857 In base 2, what is -1101 - 111000110100110000100100? -111000110100110000110001 In base 9, what is 12 + 208770343? 208770355 In base 4, what is -20030110 + -121010? -20211120 In base 16, what is db178 + -c? db16c In base 7, what is 66 - 1333262? -1333163 In base 15, what is -5 + -34292eb? -3429301 In base 16, what is -5c241 - -4f? -5c1f2 In base 3, what is 221210 - -112102121? 120101101 In base 12, what is 2112 + -48661? -4654b In base 13, what is 232 + -5989? -5757 In base 15, what is 1ee8d + 39? 1eec7 In base 13, what is -a72c - 3886? -112b5 In base 6, what is -113310115035 + -1? -113310115040 In base 11, what is 104 - 62809? -62705 In base 10, what is 173 + 769200? 769373 In base 10, what is -340 - 17401? -17741 In base 14, what is 2a9da442 + 0? 2a9da442 In base 12, what is -28b061 - -42? -28b01b In base 16, what is 0 - -24bce7b? 24bce7b In base 3, what is -2122111022201120 - 11? -2122111022201201 In base 13, what is -191205 - 73? -191278 In base 15, what is -882 - -3c7? -4aa In base 5, what is 21 - -340411244? 340411320 In base 5, what is 4433433 + 344? 4434332 In base 16, what is 270648d - 1? 270648c In base 3, what is -12220002101 - 2212? -12220012020 In base 6, what is -11143444 - -104? -11143340 In base 8, what is 7130710 + -44? 7130644 In base 9, what is -18544221 + 5? -18544215 In base 16, what is 1b1d + 3991? 54ae In base 9, what is 6657 + -7226? -458 In base 13, what is 30b7 - -401c? 7106 In base 5, what is 212144 - -442410? 1210104 In base 16, what is 3 - 129735? -129732 In base 4, what is -22012 + -101212231? -101300303 In base 5, what is -132222 - -4034? -123133 In base 3, what is 1110212120211 + 11111? 1110212202022 In base 13, what is 161351bc + -2? 161351ba In base 8, what is 34 - 126727151? -126727115 In base 9, what is -618 - 766721? -767440 In base 16, what is 50e89e7 + 6? 50e89ed In base 7, what is 54 - 1221343? -1221256 In base 13, what is -2b01 - 445a? -725b In base 7, what is 2146613053 + -4? 2146613046 In base 7, what is -4 + -11132240? -11132244 In base 15, what is -3 + 1e886ae8? 1e886ae5 In base 5, what is 24322022142 - 4? 24322022133 In base 5, what is -133320242112 + 0? -133320242112 In base 6, what is -101223 - 14550? -120213 In base 8, what is 731370534 - 4? 731370530 In base 16, what is -4f7bc2 + 0? -4f7bc2 In base 6, what is -3 + -134511? -134514 In base 16, what is -6d64e55 + -1? -6d64e56 In base 14, what is 2161cc7 - 3? 2161cc4 In base 4, what is 13003000200 - -121? 13003000321 In base 16, what is -315d + 703d? 3ee0 In base 14, what is 11221b3 - -27? 11221da In base 2, what is 100 - 101011001100111001000? -101011001100111000100 In base 3, what is 1 - 2222002002010111? -2222002002010110 In base 6, what is 23243432 + 5? 23243441 In base 13, what is 16 - 38186b? -381855 In base 7, what is 12453544 - 0? 12453544 In base 10, what is -2 - 22980319? -22980321 In base 2, what is 1000000011111111111111011110 - -1? 1000000011111111111111011111 In base 3, what is 111210 - -221122? 1110102 In base 8, what is -2552 + 1160753? 1156201 In base 2, what is -1111110101 + 1100100110100000? 1100010110101011 In base 13, what is 2b92 - 341? 2851 In base 9, what is -260837122 + -5? -260837127 In base 4, what is -1 + -202110103310? -202110103311 In base 4, what is 302031 - -3221? 311312 In base 11, what is 98 - -5428? 5515 In base 2, what is 11111000110100011100000001 + -1011? 11111000110100011011110110 In base 8, what is -63666242 - -3? -63666237 In base 2, what is 10011010011111010 - 11111000? 10011010000000010 In base 14, what is 69ca + -2c0? 670a In base 14, what is 1730 + -379c? -206c In base 10, what is -2339535 - 499? -2340034 In base 3, what is -1 + 212011000011? 212011000010 In base 4, what is 2012 + -23030201? -23022123 In base 2, what is -1000001011110011011011 + -111? -1000001011110011100010 In base 5, what is -122 - 133041242? -133041414 In base 2, what is -10110010001000111111011 - -11? -10110010001000111111000 In base 15, what is 10 + -1684aa? -16849a In base 15, what is -2594494 - 13? -25944a7 In base 4, what is -3002010200 + -123102? -3002133302 In base 9, what is 3514 + 5132? 8646 In base 2, what is 101001101 - 1001001010101101011? -1001001010000011110 In base 12, what is -3 + 78a1a3? 78a1a0 In base 11, what is -67 + 29a0? 2934 In base 15, what is 69 + -142bc? -14253 In base 12, what is 3 + 4448b8a? 4448b91 In base 3, what is 1011 + -21200110? -21122022 In base 4, what is 1110232 - -3300? 1120132 In base 16, what is 4a3f + a? 4a49 In base 11, what is -2903138 - -4? -2903134 In base 8, what is -7 + 2237615? 2237606 In base 4, what is 20133210321 + 3033? 20133220020 In base 5, what is -10043434013 + -10? -10043434023 In base 4, what is -22101313210300 + 1? -22101313210233 In base 16, what is a182 + 1ff? a381 In base 13, what is -1c27c42 + -6? -1c27c48 In base 8, what is 53551200 - 0? 53551200 In base 11, what is -496 + 1242a? 11a44 In base 8, what is -152516420 - -2? -152516416 In base 8, what is -51 - 4032352? -4032423 In base 2, what is -1101011 - -10111000001101001? 10110111111111110 In base 8, what is -21576472 + 4? -21576466 In base 7, what is -4521120 + 602? -4520215 In base 16, what is 3d98360 - -5? 3d98365 In base 3, what is -1212022210 - -111020? -1211211120 In base 3, what is -21101122 + -1021121? -22200020 In base 15, what is 17 - 2c80e50? -2c80e38 In base 6, what is 5 + -40443234? -40443225 In base 14, what is 4 - 4d74a25? -4d74a21 In base 7, what is -112233 - 20513? -133046 In base 14, what is 77d + 8263? 8a02 In base 14, what is -bdd + 1531? 732 In base 11, what is 65311 + -123? 65199 In base 14, what is 5 - 2438a2? -24389b In base 11, what is 652522 - 7? 652516 In base 7, what is 11106 + 1205456? 1216565 In base 2, what is -10100011101110111 - 100101111000? -10101000011101111 In base 14, what is -8 + 4d58978? 4d58970 In base 6, what is 11013022 + -5340? 11003242 In base 12, what is 3 - 61323? -61320 In base 13, what is -1c53b9 - 121? -1c550a In base 13, what is 605 - -16c422? 16ca27 In base 11, what is -295358 - 766? -296013 In base 13, what is 100a70 - -a? 100a7a In base 6, what is -25332454 - -30? -25332424 In base 16, what is 1f - 25c8a? -25c6b In base 10, what is 22 + 734350? 734372 In base 11, what is -1a73 + 5095? 3122 In base 10, what is 45 + 3845332? 3845377 In base 15, what is e2ad8b - -5? e2ad91 In base 12, what is 80 + -6580? -6500 In base 16, what is -2568 + 35bb? 1053 In base 4, what is -1030011230210 + -32? -1030011230302 In base 11, what is a + -157a9805? -157a97a6 In base 14, what is -101da30 - -5? -101da29 In base 13, what is 23a75378 - 0? 23a75378 In base 12, what is 4158 + -4630? -494 In base 3, what is 2212112 + -1202222200? -1200010011 In base 15, what is -5 + -11d58dd? -11d58e3 In base 14, what is 7b4c0 + -45? 7b479 In base 14, what is -4557 + -d91? -5508 In base 11, what is 0 - -1529a076? 1529a076 In base 13, what is 3784844 + a? 3784851 In base 14, what is -7a8 - -751? -57 In base 9, what is -180 - 5828? -6118 In base 6, what is -2 - 330312133? -330312135 In base 4, what is -1023232 - 22221130? -23311022 In base 15, what is -44 + -b9484? -b94c8 In base 4, what is 113331331 - -3031? 120001022 In base 2, what is -1001010000 + 11111111001010? 11110101111010 In base 13, what is 3459 + -852? 2907 In base 12, what is 1 + 3117599a? 3117599b In base 12, what is 143a952 - -92? 143aa24 In base 13, what is 6 + -c43931? -c43928 In base 6, what is -2311321143 - 4? -2311321151 In base 4, what is 302 - 203133022020? -203133021112 In base 11, what is 355 - 11916? -11571 In base 12, what is -589 - -6503? 5b36 In base 8, what is 614440 + 2670? 617330 In base 16, what is 1b + -3bada1? -3bad86 In b	{ "pile_set_name": "DM Mathematics" }
53647 (c) -5 a What is the fifth biggest value in 3/4, 1/2, 33, 1/3, 2/3, 1450? 1/2 What is the third biggest value in -231.3, 5, -42/37? -231.3 Which is the fourth biggest value? (a) -0.4 (b) -20.671 (c) -1/3 (d) -0.5 (e) -2 (f) 4 d What is the seventh smallest value in 1/2, -57, -3, 0.9, -300, 0.4, 4/7? 0.9 What is the third smallest value in 9, 7, 829, 337? 337 What is the second smallest value in -1/9, -227, -6, 2, 4, -7/5, 0.1? -6 What is the smallest value in -3, 115689, -6? -6 What is the biggest value in 3/4, -3, 0.8, 1/9, -0.3, -3.17? 0.8 Which is the sixth biggest value? (a) 2/7 (b) -1/2 (c) 8/5 (d) 14 (e) 22 (f) 0 b Which is the second smallest value? (a) 1/4 (b) 2 (c) -1.4 (d) 5 (e) 1/2 (f) 0.0151 f Which is the third smallest value? (a) 1 (b) 34 (c) -5/290058 b Which is the second smallest value? (a) -163 (b) -5 (c) 34 (d) 2 b Which is the smallest value? (a) -5 (b) 14 (c) 3 (d) -0.21 (e) -4 (f) 1526 a What is the smallest value in 83, -83/2, 111/464? -83/2 What is the second smallest value in -0.5, 0.05, 3420227? 0.05 What is the third biggest value in 17, -3/5, 2/985, 320/13, 0.2? 0.2 What is the second biggest value in -40, 87, 0, -108, 2? 2 Which is the third biggest value? (a) 5 (b) 1/5 (c) 92 (d) -102 b Which is the second biggest value? (a) -10158 (b) -198/17 (c) -0.4 b What is the third biggest value in -760/3, -17, -3, 2/7, -5, 2/3? -3 Which is the second biggest value? (a) -0.05 (b) 1/3 (c) -1/3 (d) 183/2 (e) 27 e What is the third smallest value in -0.3, 2/5, -404/1903, 10? 2/5 Which is the seventh smallest value? (a) 34 (b) -4 (c) 0.4 (d) 3/4 (e) 0.5 (f) 0.59 (g) -0.1 a Which is the biggest value? (a) -65709 (b) 2/9 (c) 0.4 (d) -0.0139 c What is the second biggest value in -4/5, -0.3, -1.6899, -4? -4/5 Which is the smallest value? (a) 0.32 (b) 20651 (c) 5/4 (d) 1/3 a What is the fifth smallest value in -0.2, -3, -5/6, 2/5, 5, 0.07456? 2/5 Which is the fourth smallest value? (a) -2/9 (b) -0.808 (c) 1622 (d) 4 (e) 2/15 (f) -1 e What is the third smallest value in 297520, 0, -3/17? 297520 Which is the smallest value? (a) 6/19 (b) -268 (c) 13433 b Which is the third smallest value? (a) -26/5 (b) 191 (c) 18 (d) 3 c Which is the third smallest value? (a) 30402 (b) 1 (c) -0.1 (d) 0.2 (e) -0.11 d Which is the second biggest value? (a) 1372 (b) -2 (c) -3732 (d) 4/7 d Which is the third biggest value? (a) -234 (b) -7 (c) -2361/13 a Which is the fourth biggest value? (a) -183 (b) 12 (c) 1932 (d) -1 a What is the smallest value in 2, -2268, -1169, -1, -0.4? -2268 Which is the third smallest value? (a) -38/31347 (b) 2 (c) -3/8 b What is the fifth smallest value in 3, -4, 17, 1.9, 1, -2, -15? 1.9 Which is the second smallest value? (a) -0.05231 (b) 15 (c) -1/206 (d) 1/6 c Which is the third biggest value? (a) -1/4 (b) 0.06863428 (c) 3/2 (d) -0.3 a Which is the fifth smallest value? (a) -4 (b) -3 (c) 0.863 (d) 12 (e) -0.1 (f) 18 d What is the fifth biggest value in -20, -5, -2, -2.4, 0.084, 1/5, 1/3? -2.4 What is the fifth smallest value in -3/7, 1.15, 126, 0.2, 0.5, -0.3? 1.15 Which is the fifth biggest value? (a) 2/5 (b) -2 (c) -0.4 (d) -35 (e) -1/55 d What is the third biggest value in 1, -4/19, 31097, 4? 1 What is the third biggest value in 744473, -2, 0.047? -2 Which is the second smallest value? (a) 7.51 (b) 1 (c) 3.1 (d) -741 b Which is the biggest value? (a) -0.3 (b) 183469.5 (c) 4 b What is the third biggest value in -3, -0.1, -138670? -138670 What is the biggest value in 0.01, 0.1, 538, 44.7, -0.2, 2/3, -5/4? 538 Which is the smallest value? (a) 1/2 (b) -982 (c) 1/13 (d) -5 (e) -4 b What is the smallest value in 2/13, 1, 0.1, 0.4, 1/2, 159? 0.1 What is the smallest value in -557, -0.5, 461/18? -557 Which is the third smallest value? (a) 2 (b) -0.1 (c) 2/3 (d) 0.1 (e) -0.4 (f) -375 (g) 18 b Which is the biggest value? (a) -2/3547 (b) 4/371 (c) 1/8 (d) -0.4 c Which is the third smallest value? (a) -4 (b) -2/5 (c) 0 (d) 119962 (e) 3 c What is the second smallest value in -0.09, -26/319, 5, 269? -26/319 Which is the smallest value? (a) 35297 (b) -5/2 (c) 4 b What is the fourth smallest value in -0.1, -15, 3, 3/4, 5.93? 3 What is the third smallest value in 6/11, 3, -53, 1/7, -1.21, 0.03, -2? -1.21 Which is the second smallest value? (a) -1 (b) 112/117 (c) 0.1 (d) -20 (e) 16 a What is the sixth biggest value in 1/9, 1413, -86, -0.1, -0.9, 3, 0? -0.9 Which is the second smallest value? (a) 8 (b) 2/19 (c) -10 (d) -2 (e) 252 (f) 0 (g) 3/10 d What is the second biggest value in 4/5, -1/27, -1, 0.03489, 1/3? 1/3 What is the sixth smallest value in -1.9, 1/3, -1, 2, -20, -4, -670? 1/3 What is the second smallest value in -1/5, -1, 0.2, 5, -59, -3, -1/45? -3 What is the fifth biggest value in -2, 4/7, -0.3, -24515, 0.3, 31? -2 What is the smallest value in 59, -3, 3/5, -1.8, -723.7? -723.7 What is the second biggest value in -1.18, 5, -1, -140, 4/21? 4/21 Which is the fourth smallest value? (a) 1 (b) -1/7 (c) -2/21 (d) 1/4 (e) 68 (f) -0.404 d Which is the third smallest value? (a) 0.014 (b) 0 (c) 10/27 (d) -12 a Which is the biggest value? (a) -7.87 (b) 12501 (c) -2/11 b What is the biggest value in -9, -3/7, -2/9, -3/11, -0.5, -8, 2/9? 2/9 Which is the second biggest value? (a) -5 (b) 1 (c) -0.4154 (d) -0.4 (e) -75/8 (f) 24 b What is the second smallest value in 0, 27975, 38/33? 38/33 What is the smallest value in 2821, -2/3, -23.8, 0.11? -23.8 What is the third smallest value in 4671, 2, -1/3, -2.8? 2 Which is the biggest value? (a) 12307.462 (b) 3 (c) -18 a Which is the third biggest value? (a) 0.2 (b) 112 (c) -24.2478 c What is the second smallest value in 2/169, -2/9, 0.8094, 2/63? 2/169 What is the fifth smallest value in -249, -42, -0.5, -0.4, 0, -0.2? -0.2 Which is the fifth biggest value? (a) 3 (b) 12 (c) 194 (d) -3 (e) 0.27 d What is the seventh biggest value in 2, -688, -1, 27, -0.4, -5, 34? -688 Which is the smallest value? (a) -3 (b) 63870 (c) -12 c What is the second smallest value in -2/9, 6, 1124, -3, 25? -2/9 What is the second biggest value in -10, -0.3, -4/615, -149? -0.3 Which is the smallest value? (a) -3 (b) -2 (c) 9296771/4 a What is the second smallest value in -10, 0.3, -0.06220499? -0.06220499 What is the third biggest value in 942.1, 1, 36? 1 What is the third smallest value in 0.2, 1.1, 24.6, 9/17? 1.1 Which is the sixth smallest value? (a) 170 (b) 846/7 (c) -0.4 (d) -4 (e) -0.05 (f) 2 a Which is the fourth biggest value? (a) 1/9 (b) 29616 (c) -4/3 (d) 1/8 c Which is the smallest value? (a) -2/9 (b) 5 (c) 8413 (d) 431 a What is the third biggest value in -10.7, -0.08, -0.1, -4, -592? -4 Which is the biggest value? (a) 26 (b) -4717 (c) 2 (d) -0.5 (e) -26 a What is the smallest value in -312, 2/5, 0, -3351? -3351 Which is the biggest value? (a) 3 (b) 4 (c) -0.045428 (d) -0.1 (e) -1 b Which is the second biggest value? (a) -8 (b) -2/7 (c) 0.01 (d) 158/3 (e) -3/5 c Which is the biggest value? (a) -10 (b) 56562 (c) 4 b What is the fourth biggest value in 5, 0, 242496, 0.3, -1/3, 2/27? 2/27 Which is the second biggest value? (a) -19958 (b) -1/7 (c) -0.4 (d) -1 (e) 111 b What is the fourth smallest value in -6352, -7.1, -3, -4? -3 What is the third biggest value in 0.19, 1/7, 80, -1/97? 1/7 What is the third biggest value in 7.3, 3.417, 2/25? 2/25 Which is the third biggest value? (a) 1 (b) -1.87 (c) 37 (d) 2/15 (e) 0 (f) -19 (g) -2 d Which is the third biggest value? (a) -21 (b) 11 (c) 4 (d) -26/29 (e) -7 d What is the fifth biggest value in -5/3, 2/569, 2, -0.3, -0.01? -5/3 Which is the fourth biggest value? (a) -3 (b) -40208605 (c) -4 (d) 3 (e) 1 c Which is the fourth smallest value? (a) -0.2 (b) -0.5 (c) 6/5 (d) 405 (e) 0.058 c What is the fourth smallest value in -88, -1/74, -3, 109? 109 Which is the fourth biggest value? (a) 285 (b) -50 (c) -4 (d) -3 (e) -7 e What is the second biggest value in 1/17708, -4, -61/4, 2/11, -2/5? 1/17708 What is the fifth smallest value in 416, 10/7, -2, -3, -1/3, 7/2, 2/11? 10/7 What is the smallest value in -146, 50, -1, -4,	{ "pile_set_name": "DM Mathematics" }
-l + 7 = z + 1, 14 = 3z + 2l. Suppose 6h - 1 - 23 = 0. Suppose 4g - 2n + z = 5g, h = 4n. Give w(g). 4 Let y(s) be the first derivative of s4/4 - 3s3 - s2/2 + 12s - 40. Calculate y(9). 3 Suppose 6q - 20 = q. Let v(a) = -qa3 + 4a*3 - 6a3 - a2 - a*2 + 1. Determine v(-1). 5 Let y(t) = 2t + 2. Suppose -6m - 43 = -7. Calculate y(m). -10 Let v = 2 + 3. Let x(w) = 3w + 9 - 2 - v. Calculate x(3). 11 Let v = -4 + 1. Let c be 1(-3 + (-9)/v). Let b(n) = -n2. Determine b(c). 0 Let i be (-31)/(-4) - (-1)/4. Let x(d) = d3 - 7d*2 - 8d - 9. Calculate x(i). -9 Let q(i) be the first derivative of i7/840 + i6/180 - i5/60 + i4/8 + 2i3/3 + 7. Let m(y) be the third derivative of q(y). What is m(-3)? 0 Suppose -3v = 2n + 34, 2n + 0n + 26 = -2v. Let r(p) = p + 6. Give r(v). -2 Let i(a) be the second derivative of -a5/20 + a4/3 + a*3 - 3a. Suppose -16 = 3s + 5. Let q = -2 - s. Determine i(q). 5 Let l(g) = -g2 - 5g + 10. Let z(b) = -2b2 - 9b + 19. Let r(u) = -5l(u) + 3z(u). Let k be (-16)/(-6) + (-2)/3. Suppose 3x = kx - 5. Give r(x). -8 Let o(u) be the second derivative of 2u3/3 - 20u. What is o(-2)? -8 Let q be (21/(-7))/(3/(-4)). Let s(u) = u*3 - 5u*2 + 3u - 4. What is s(q)? -8 Let m = 36 + -31. Let z(f) be the second derivative of f5/20 - f4/2 + 7f3/6 - 7f*2/2 - 2f. Determine z(m). 3 Let u(h) = -15h - 4h - 6h2 + 5h*2 + 4 + 5h. Let s be u(-14). Let j(r) be the first derivative of -r*3/3 + 5r*2/2 + r - 1. Give j(s). 5 Let n(h) be the second derivative of -5h*3/6 + 2h. Let b(t) = -t*3 + 10t*2 + 12t - 12. Let u be b(11). Let p be u4/123. What is n(p)? 5 Let f(y) = -5y + 3. Let h(b) = 4b + 6 - 2b - 11b. Let r(q) = -5f(q) + 3h(q). What is r(3)? -3 Let c = 10 - 3. Let a(z) = z*2 - 8z - 9. Give a(c). -16 Let t(f) = -3f - 18. Let c be t(-5). Let k(i) = i2. Determine k(c). 9 Let x(s) = -s2 - 3 - 59s + 54s + 6. Give x(-4). 7 Let m(y) = y3 + 6y*2 + 6y - 6. Suppose a = -2a - r - 17, 3a + 4r + 23 = 0. Give m(a). -11 Let y(z) = 0z*2 - 3z + 6z2 + 1 - 3z - 5z2. What is y(5)? -4 Let r(x) = x3 - 9x*2 + x - 12. Let n be r(9). Let v(l) = -2l - 2. Determine v(n). 4 Let g(c) = c*3 + 3c*2 - 4c + 1. Let f(i) = i*3 - 2i*2 + i + 4. Let s be f(3). Let q = 2 + -2. Suppose s = -qp - 4p. What is g(p)? 1 Let j(a) = 8a + 4a - a. Give j(2). 22 Let q = 295 - 7079/24. Let x(w) be the third derivative of -3w*2 + 0w - 1/60w5 - qw*4 - 1/2w*3 + 0. What is x(0)? -3 Let v(c) = 2c*3 + 4c*2 - 2c - 2. Suppose 2s + 8 = -2l, 1 = -2s - 1. Determine v(l). -14 Let m(i) = -2i. Let g = -10 - -7. Calculate m(g). 6 Let y = -13 - -16. Let a(o) = 43o - 45o - 2o3 - 2o*2 - 1 - 2o*y. Give a(-1). 3 Suppose 0c = -c. Let l(o) = -o*3 - 9 - 4o + 4o. What is l(c)? -9 Let m(s) = 3s + 1. Suppose -4a + 5t = -11, -2t = 4a + 3t + 19. Let u be -2(0 + 2 + a). Determine m(u). -5 Let a(u) = u + 1. Let q(b) = -4b + 0b - 5 - 11. Let h(v) = -5a(v) - q(v). Determine h(5). 6 Let i(c) = c3 + 6c*2 + c - 4. Suppose n = -2 - 3. What is i(n)? 16 Suppose -11 = -r + 3g, 3r + 0r + 3g = 9. Let y(n) = n3 - 5n*2 - 3n + 1. Determine y(r). -14 Let u(o) = -o*3 + 4o*2 - o + 1. Suppose -g + 2g = 10. Let n = 5 - g. Let p(i) = i*3 + 5i2 - i - 3. Let x be p(n). What is u(x)? 7 Let f(c) = c3 - 7c2 - 4c + 1. Let h(i) = -i*3 + 8i*2 + 4i - 2. Let q(l) = 4f(l) + 3h(l). Determine q(5). 3 Let f(x) = -x*3 + 4x*2 + 5x - 5. Suppose 0 = -34d + 30d + 16. Calculate f(d). 15 Let l(s) = 9s2 - s. Let k(j) = -4 - 1 + j - 1. Let d(g) = g - 7. Let o(c) = 2d(c) - 3k(c). Let x be o(3). Calculate l(x). 8 Suppose -6u = -3u - 3. Let d be -1 - u - -23. Let a(r) = r*2 - 5r + 1. Give a(d). -3 Let o be 4 - (0 + (-2 - 0)). Let b(v) = v*3 - 6v*2 + 3. Determine b(o). 3 Let j(z) = -2 - 14z + z*2 + 0z*2 + 32z - 19z. Suppose 5v - 5 = -3h, 0 = v - 0h - 3h + 17. Calculate j(v). 4 Let f(n) = 2n - 6. Suppose 0 = 4g + g. Suppose d + 1 = g, 6u - 18 = u + 3d. Suppose -ul + 6l + 28 = 4a, 20 = 2a - 3l. What is f(a)? 2 Let g(j) = j*2 - 20 - 15j*3 - j + 0j + 21 + 2j. Calculate g(-1). 16 Let g(n) = 5n + 3 + 6n2 + 0n*2 - 2n + 0n. Give g(-2). 21 Let r(k) = 7k + 9. Let j(c) = c + 1. Let l(m) = -5j(m) + r(m). Let s(g) = g3 + 8g*2 + 5g - 10. Let v be s(-7). Determine l(v). 12 Let f be ((-9)/6)/(9/(-24)). Let o(w) be the third derivative of -1/60w5 + 0w*3 + 1/12w*f - 2w*2 + 0 + 0w. Determine o(1). 1 Let n(r) = -r - 2. Suppose 21 = -3t - 2o, -3t - 5o - 15 = -o. Let w = t + 11. Calculate n(w). -4 Let v(x) = x - 4. Let s(f) = 2f - 9. Let c(n) = 3n - 13. Let o(j) = -5c(j) + 7s(j). Let y be o(-2). Let t be v(y). Let g(q) = q - 6. Give g(t). -6 Suppose 7 - 4 = 3q. Let d(x) = -x. Give d(q). -1 Let c(i) = -4i - 2. Let z(r) = r*2 + r + 1. Let f(b) = -c(b) + z(b). Calculate f(-5). 3 Suppose q = -0q + 1. Let c(l) = 2 - 3l - 1 - 6l + 0. What is c(q)? -8 Let h(s) = -s*3 - s + 1. Suppose 4u - 26 = 5y, -3y + 24 = -7y + 4u. Let j = y - -2. Calculate h(j). 1 Let z(n) = n + 10. Let u(r) = r*3 + 2r*2 + 3r + 10. Let k be u(-3). What is z(k)? 2 Let c(w) = w*3 - 6w*2 + 5w - 4. Suppose -15 + 0 = -3g - 4m, 0 = 2g - m - 10. Give c(g). -4 Let w(f) = f2 - f + 4. Let b = 5 - 7. Let r be -3 - b - (4 + -3). Let j be (r - -2)(-2)/4. Determine w(j). 4 Let j(n) = n*3 - 2n*2 - 4n + 3. Let p be j(3). Let s be p(30/(-9) + 3). Let r(c) = -c3 + c2 - 7. Calculate r(s). -7 Let o(c) = -11c*3 - 3c*2 + 6c + 5. Let u(w) = 4w3 + w2 - 2w - 2. Let h(a) = -3o(a) - 8u(a). Let k = -1 + -1. What is h(k)? 1 Let s(c) = c*3 - 6c*2 + 5c + 4. Suppose 21j = 17j + 16. Calculate s(j). -8 Let q(o) be the third derivative of o4/12 - o3/6 + 11o2. What is q(-3)? -7 Let u(s) be the second derivative of s + 5/6s*3 + 3/2s*2 + 0 - 1/12s4. Let z be 21/4 + (-2)/8. Determine u(z). 3 Let t(j) = -j - 3. Let z = -6 + -2. Let o be (0/(-2))/(z/(-8)). Give t(o). -3 Let z(w) = 6 + w + w3 - 1 + 7 - 4. Let a(t) = t*2 + t - 2. Let c be a(-3). Suppose -f + cf = 0. Determine z(f). 8 Let s(n) be the second derivative of -n*3/6 - 5n*2/2 + 2n. Let m = 235 - 235. What is s(m)? -5 Let b = -21 - -25. Let l(m) = -m*2 + 4m + 3. Calculate l(b). 3 Let r(b) = -b*3 - 4b2 - b. Let u(x) be the second derivative of x3/3 - 3x. Let h be u(-1). What is r(h)? -6 Let q(j) be the second derivative of j4/12 - 5j*3/6 + 5j*2/2 + j. Let h(y) be the first derivative of q(y). Give h(5). 5 Let v(k) = 4k*2 - 1. Let c be v(1). Let y(q) = -c + 2q*2 + 5q - 3q2 + 5. Let h be -22(-14)/28 + 2. Give y(h). 6 Let k be (-3)/(-2)(0 - -4). Suppose -4q = -5d - 6q + 2, d = q + k. Let r(b) = -3 - 5b - 1 + b*3 - 2b*d + 4b*2. Determine r(-3). 2 Let l(c) = -2c*2 - 8c + 6. Let o = 9 - 15. What is l(o)? -18 Let h(z) be the first derivative of -z*2/2 + z - 5. What is h(5)? -4 Let t(y) = 3y - 7. Let q(g) = 0 + g*3 - 2g*2 + 0g*3 - g - 1. Let i be q(3). What is t(i)? 8 Let l(c) = -c - 1. Suppose -3k + 16 = -4h - 8, 4k - 22 = 2h. Give l(h). 2 Suppose -1 - 4 = -s. Suppose 0 = -2q - 4r + r - 15, 0 = 3q - sr - 25. Let d(z) = 2z - z*3 + 4z + 3 + qz3 - 4z*2. What is d(-5)? -2 Let t(b) = -b + 8. Suppose 4 = 5i - 4f, 2i = -0i + 2f. Suppose -3m - j + 19 = 0, -5m = j - ij - 27. Determine t(m). 2 Let f(t) be the first derivative of -t3/3 + 7t*2/2 + 8t - 3. Calculate f(6). 14 Let u(k) = -k + 3. Suppose 0 = -4o + 26 - 10. Let z(l) = -l + 2. Let i(x) = ou(x) - 3z(x). Let g be 0/(-7) + (1 - 1). What is i(g)? 6 Let l(h) = -25h + 22h + 0 - 3 - 2h2 - h3. Let i(p) = -p*2 - p - 2. Let n be i(0). Determine l(n). 3 Let g(i) = 2i*2 + i. Let p be (-12)/(-20)3 + (-2)/(-10). Give g(p). 10 Let o = -3 - -2. Let u(l) be the second derivative of 2l3/3 - 5l. What is u(o)? -4 Suppose 2p - 4p - 5n + 29 = 0, -2n = -5p. Suppose a - 6 = -0a. Let z(i) = -4i - a + pi + 1. Give z(-4). 3 Suppose 3l + 33 = 3p - 0l, 2l = -10. Suppose -2f - 8 = -3q + pq, 5f - 14 = q. Let t(c) = -4c + 3c - f - c. Give t(-3). 4 Let c(z) = z*3 + 6z*2 - 4z - 2. Let g be c(-5). Suppose 5*t - g = -13. Let d(b) = b	{ "pile_set_name": "DM Mathematics" }
ify (1(sqrt(1216) - (-2 + sqrt(1216) + -3 - sqrt(1216))))2. 80sqrt(19) + 1241 Simplify (sqrt(35) - sqrt(875))/sqrt(5) - (1 + 2sqrt(7)). -6sqrt(7) - 1 Simplify (6sqrt(304))2 + -2sqrt(1539). -18sqrt(19) + 10944 Simplify (1 + 3sqrt(720)-1)2 + 0. -72sqrt(5) + 6481 Simplify 3(-2 + 2(sqrt(637) + sqrt(637) + 0)*2). 15282 Simplify 1 + -3 + (-1sqrt(180))*2. 178 Simplify -2 + sqrt(136)/(1sqrt(8)) + 1. -1 + sqrt(17) Simplify ((sqrt(85) + (sqrt(85)-2 - sqrt(85)) + sqrt(85))5 - sqrt(85))/(sqrt(20)1 - sqrt(20) - sqrt(20)). 3sqrt(17) Simplify -2 + sqrt(171) + 1 + 2. 1 + 3sqrt(19) Simplify sqrt(132)/(-44sqrt(12)). -sqrt(11)/16 Simplify 5sqrt(363)1. 55sqrt(3) Simplify ((sqrt(3168)-2)/(-3sqrt(11)2))2. 32 Simplify -4 + sqrt(21)/(-1sqrt(567) - sqrt(567) - sqrt(567)). -4 - sqrt(3)/27 Simplify (3-2sqrt(14)/(sqrt(32) - sqrt(8)))*2. 63 Simplify (sqrt(405)1)*2-5. -2025 Simplify (sqrt(2016) + (sqrt(2016)1 - sqrt(2016)) + sqrt(2016))/sqrt(2). 24sqrt(7) Simplify ((0 + sqrt(98) + sqrt(98))-2 + sqrt(98))2 - ((sqrt(128)-3)*2 + sqrt(32) + sqrt(32)). -270 - 8sqrt(2) Simplify (sqrt(275) - (sqrt(275) + -2 + 3 + sqrt(275) + sqrt(275)) - sqrt(275))*2. 30sqrt(11) + 2476 Simplify (sqrt(4) + sqrt(48)/(sqrt(12) + sqrt(432)) + sqrt(4))/sqrt(2). 15sqrt(2)/7 Simplify -5 + (41sqrt(1100))2. 17595 Simplify 1 + sqrt(17) + 3 - ((sqrt(17) + 1)3)*2. -158 - 17sqrt(17) Simplify ((-1sqrt(196) - sqrt(196)) + sqrt(196))/sqrt(7) - (sqrt(112)1)*2. -112 - 2sqrt(7) Simplify 4sqrt(1872)-5. -240sqrt(13) Simplify (sqrt(11) - (sqrt(99) + -4)) + -1. -2sqrt(11) + 3 Simplify ((sqrt(153) + -41sqrt(153) + sqrt(153))/(sqrt(144)/sqrt(4) - sqrt(9)) + 1)*2. -4sqrt(17) + 69 Simplify (sqrt(891) - (sqrt(891) + sqrt(891) + sqrt(891) + 2)*2)2. -16046 - 198sqrt(11) Simplify (-4(-5 + sqrt(50)))*2. -800sqrt(2) + 1200 Simplify sqrt(114)/(sqrt(6) + -5sqrt(54) + sqrt(6)). -sqrt(19)/13 Simplify (((sqrt(228)2)/sqrt(12) - (sqrt(1900)-1 + sqrt(1900)))5)*2. 1900 Simplify (sqrt(2304)1)/(sqrt(64)/sqrt(72)). 36sqrt(2) Simplify -6(-2(sqrt(11) - (2sqrt(11) + sqrt(11))*2) - sqrt(11)). -1188 + 18sqrt(11) Simplify (sqrt(525)1)/(sqrt(147) + sqrt(147) + sqrt(147)1 - sqrt(147) - sqrt(3)). 5sqrt(7)/13 Simplify 2 + ((sqrt(2299) + sqrt(2299) + (1sqrt(2299)6 - sqrt(2299)) - sqrt(2299)) + sqrt(2299))2. 112653 Simplify 5 + sqrt(320) - sqrt(1280). -8sqrt(5) + 5 Simplify (1sqrt(931)-4 + 2 + sqrt(931) + -1sqrt(931))2. -112sqrt(19) + 14900 Simplify sqrt(5) - sqrt(10)/(sqrt(14)/sqrt(7)) - (3 + sqrt(5))-5. 5sqrt(5) + 15 Simplify sqrt(17) + -2 + 0 - (sqrt(17)2 + 3). -5 - sqrt(17) Simplify ((2sqrt(3))*2 - sqrt(3)) + -2 + -2 + 3. -sqrt(3) + 11 Simplify sqrt(44)-1 + -2sqrt(44) - (sqrt(704) + -1)6. -54sqrt(11) + 6 Simplify ((-5(0 + sqrt(5)) + sqrt(5))4)2. 1280 Simplify ((sqrt(22) - -2sqrt(352))/((2sqrt(12))/sqrt(6)))2. 891/4 Simplify 1 + sqrt(448) + 0. 1 + 8sqrt(7) Simplify sqrt(34)/(sqrt(2) - 6sqrt(6)/sqrt(3)) + 1. -sqrt(17)/5 + 1 Simplify sqrt(363) + -5 + sqrt(27)/(-2sqrt(9)). -5 + 21sqrt(3)/2 Simplify (-2 + sqrt(539)11)2. -28sqrt(11) + 543 Simplify (sqrt(190)/(sqrt(10)1) + sqrt(1216)2)-4. -68sqrt(19) Simplify (sqrt(1300)-2 + sqrt(1300))1 + -3. -10sqrt(13) - 3 Simplify (sqrt(2) - (sqrt(2) - (sqrt(2) + 4 + sqrt(4)/sqrt(2) + sqrt(2))) - sqrt(2)) + sqrt(2) - (sqrt(242) + sqrt(242) + (sqrt(242) + 1)2). -239 - 41sqrt(2) Simplify 2-6(0 + sqrt(5))*2. -60 Simplify -3((sqrt(275)1)2 - -2sqrt(11)-6) + 1. -824 + 36sqrt(11) Simplify ((sqrt(190) + (sqrt(190) - (3sqrt(190) + sqrt(190))))-2)/(sqrt(10) - (sqrt(80) + 3sqrt(80))/sqrt(8)). -4sqrt(19)/3 Simplify sqrt(10)/sqrt(2)-3 + -3. -3sqrt(5) - 3 Simplify -5sqrt(32) + 0. -20sqrt(2) Simplify 2 + sqrt(171) + 3 + sqrt(171). 5 + 6sqrt(19) Simplify 2(-1(1 + sqrt(847)))2. 44sqrt(7) + 1696 Simplify (-1sqrt(18))2 - (sqrt(288)3)*2. -2574 Simplify -2(-1sqrt(192))2. -384 Simplify sqrt(55)/(sqrt(5) + sqrt(50)/sqrt(10)) + sqrt(88)/sqrt(8)-3. -5sqrt(11)/2 Simplify 1(0 + sqrt(425))*25. 2125 Simplify -3 + (-2 + sqrt(567))*2 + (sqrt(7) - 2(sqrt(7)2 + sqrt(7) + sqrt(7) + sqrt(7) - sqrt(7))). -43sqrt(7) + 568 Simplify 3(sqrt(17) - (sqrt(1377) + -2sqrt(1377) - sqrt(17))*2)2. -10200 + 6sqrt(17) Simplify ((sqrt(200) - 1sqrt(200))-3)/sqrt(10)-4. 0 Simplify sqrt(304)235. 120sqrt(19) Simplify (sqrt(48)-1-1)*2. 48 Simplify ((sqrt(78) - 2-2sqrt(78)) + sqrt(78) + sqrt(78) + sqrt(78))/sqrt(6). 8sqrt(13) Simplify (-1 + sqrt(684) - sqrt(684))*2 - (sqrt(931) - sqrt(931)2). 1 + 7sqrt(19) Simplify (5sqrt(85)2)/(sqrt(720) + (sqrt(720)-2 - sqrt(720))). -5sqrt(17)/12 Simplify 4 + sqrt(245) + -2. 2 + 7sqrt(5) Simplify (-1-4sqrt(84))/(sqrt(48)2). sqrt(7) Simplify ((1 + sqrt(468))3)*2 + 3. 108sqrt(13) + 4224 Simplify -2((1sqrt(143) + sqrt(143))1)/((sqrt(132)2)/sqrt(12)). -2sqrt(13) Simplify (1 + 63sqrt(1216))2. 288sqrt(19) + 393985 Simplify ((sqrt(99) - sqrt(99)1)-1 - sqrt(99))/sqrt(9). -sqrt(11) Simplify -5sqrt(35)/sqrt(7) - (sqrt(5) + sqrt(30)/sqrt(6) + 0). -7sqrt(5) Simplify (-2sqrt(132)-5)/((sqrt(192)/sqrt(4))/sqrt(4)) + -4. -4 + 10sqrt(11) Simplify (sqrt(132)/(1sqrt(972)) - 4-5(sqrt(11) - (-1 + sqrt(11))))*2. 40sqrt(11)/9 + 32411/81 Simplify -1 + ((sqrt(288)2 + sqrt(288))2 - sqrt(2)24) + -1. -8sqrt(2) + 2590 Simplify ((sqrt(108) + (sqrt(108) - (1sqrt(108) - sqrt(108))) + sqrt(108))5)2. 24300 Simplify (sqrt(27) + 0)2 - sqrt(6)/sqrt(50). -sqrt(3)/5 + 27 Simplify (-4sqrt(539)-2 + sqrt(539)-2-5)*2. 174636 Simplify -4(5sqrt(475)-3)2. -427500 Simplify (sqrt(15)/sqrt(3))2 + -2 + 2. 5 Simplify 2 + (sqrt(3) - sqrt(300)1). -9sqrt(3) + 2 Simplify ((sqrt(20) - 1sqrt(20))-4)/(2sqrt(30)/sqrt(3)). 0 Simplify (-3 + sqrt(13))26 + sqrt(39)/(sqrt(3) + sqrt(3) + sqrt(75) + sqrt(3)). -287sqrt(13)/8 + 132 Simplify (sqrt(832)2)*2-5. -16640 Simplify sqrt(931)-2 - (sqrt(19) + sqrt(57)/sqrt(3) + -4). -16sqrt(19) + 4 Simplify -2(2sqrt(119))/sqrt(7). -4sqrt(17) Simplify ((2sqrt(143)6)/(sqrt(44)-3))*2. 52 Simplify -5(3 + sqrt(10)/(sqrt(5) + sqrt(45))). -15 - 5sqrt(2)/4 Simplify sqrt(28)-2 + sqrt(140)/sqrt(5). -2sqrt(7) Simplify (sqrt(121) - (sqrt(121) + sqrt(121)1)5 - sqrt(121))/(sqrt(396)1)4. -20sqrt(11)/3 Simplify (1sqrt(1900) + 5)-1. -10sqrt(19) - 5 Simplify (sqrt(2736) + (-1 + sqrt(2736))-2 + sqrt(2736) - sqrt(2736) - (1 + sqrt(2736)1))2. -48sqrt(19) + 10945 Simplify 2-2sqrt(192)1 + 2. -32sqrt(3) + 2 Simplify (4 + sqrt(2816)1)2. 128sqrt(11) + 2832 Simplify -4 + 5sqrt(52)/sqrt(4) + (1 + sqrt(52)/sqrt(4))2 + sqrt(13) + 2. 12 + 8sqrt(13) Simplify (2sqrt(153)1)/sqrt(9). 2sqrt(17) Simplify 5 + (2sqrt(60))/sqrt(12) + sqrt(5). 5 + 3sqrt(5) Simplify (-5 + (-5 + (sqrt(605) - (-1 + sqrt(605))))2 + sqrt(605))4. 44 + 44sqrt(5) Simplify 4(sqrt(3) + -1) + sqrt(108) + 0. -4 + 10sqrt(3) Simplify ((4 + sqrt(76))2 + sqrt(19))6. 102sqrt(19) + 552 Simplify (2sqrt(1029))/((sqrt(24) + sqrt(48)/sqrt(2))/sqrt(8)). 7sqrt(7) Simplify ((-1sqrt(132)-5 - sqrt(132) - sqrt(132))/(-2sqrt(12)4))2. 99/64 Simplify (sqrt(36)/(sqrt(12) + sqrt(12)-21) + -1)2. 2sqrt(3) + 4 Simplify sqrt(242) + 5 - (sqrt(6)/sqrt(3) + -4)*2. -13 + 19sqrt(2) Simplify -6(0 + sqrt(1584))-6. 432sqrt(11) Simplify (sqrt(12)/(sqrt(196) - sqrt(196)-1))*2. 3/196 Simplify sqrt(209)/((sqrt(132)-3)/sqrt(12) + sqrt(11) - sqrt(11)). -sqrt(19)/3 Simplify 4(-1(sqrt(931) + sqrt(931) + 0 + sqrt(931) + sqrt(931)))*2 + -5. 59579 Simplify (sqrt(180)/sqrt(36))/(sqrt(10) + sqrt(20)/sqrt(8)). sqrt(2)/3 Simplify (-2sqrt(833) + sqrt(833) + sqrt(833) - sqrt(833))*2 + 5. 838 Simplify ((sqrt(2) + (sqrt(120)/sqrt(5) - sqrt(24))/sqrt(12))-5)*2. 50 Simplify sqrt(143)/(sqrt(11) + 1(sqrt(55)/sqrt(5) + sqrt(11))). sqrt(13)/3 Simplify -4 + ((sqrt(63) + 4sqrt(9072) + sqrt(9072) - sqrt(63))/sqrt(9))2. 25196 Simplify sqrt(153)/(sqrt(27)/sqrt(3)) + 1 + sqrt(425). 1 + 6sqrt(17) Simplify ((sqrt(8) + (sqrt(32) + sqrt(8) - sqrt(8)))/sqrt(4) - -2sqrt(2)-2)*2. 2 Simplify (-2sqrt(5) + -5)*23. 60sqrt(5) + 135 Simplify -2 + (5 + sqrt(45)/(sqrt(18)/sqrt(2)))2. 10sqrt(5) + 28 Simplify ((-5sqrt(110)2 + sqrt(110))/(sqrt(	{ "pile_set_name": "DM Mathematics" }
(-2/7)))/w)/w))(2/13)/(w/(ww/(w/(www/w(2/3)ww))w))(6/23) assuming w is positive. w(4292/2093) Simplify ttt/t*(-38)t/(t/(t*(-1/10)t)tt) assuming t is positive. t(399/10) Simplify (i(2/33)/(i/(i/i(-1/3))))/(i(-1/2))(-13) assuming i is positive. i(-403/66) Simplify (l/(ll(-5)ll))(-44) assuming l is positive. l(-132) Simplify ttt/(((tt*(-3/5)t)/tt)/t)t32 assuming t is positive. t(173/5) Simplify ((ss(-2))(2/5))(4/33) assuming s is positive. s(-8/165) Simplify ((p(-3)p)/p(2/17))(30/11) assuming p is positive. p(-1080/187) Simplify n(-3/5)n7(n(-1/2))10 assuming n is positive. n(7/5) Simplify (a(-1))*(2/195)(a/(a/a*1a))/a(a(-2/13)a)/a assuming a is positive. a*(-227/195) Simplify (j/(jj/j*(-1/5)jjj))(-5) assuming j is positive. j21 Simplify (uu(1/4))16(u*(-6)/uu)/u(-2/13) assuming u is positive. u(184/13) Simplify (ss14)/(s/(s/((s34s)/s))s) assuming s is positive. s(-20) Simplify (d0)(-11/6)(d(1/2))(2/93) assuming d is positive. d(1/93) Simplify (z/((((z6/z)/z)/z)/z))/(z/(z*5z))z4/(z2/zz) assuming z is positive. z6 Simplify (d(1/10)/d)(2/49) assuming d is positive. d(-9/245) Simplify ((u/u*(9/5)u)/u)/u(-17) assuming u is positive. u(81/5) Simplify (n*(1/4)n*(-1/3))/((n/(nnn(-2/7)n))/((n(n(1/3)n)/n)/n)) assuming n is positive. n(55/28) Simplify o8o(-1/3)(o(-2/7))(-13) assuming o is positive. o*(239/21) Simplify ((x(xx12)/x)/x(-2/17))(-42) assuming x is positive. x(-9366/17) Simplify (rrr(-2/5))(-30)(r*(3/7)rrr)/r(-3/8) assuming r is positive. r(-2475/56) Simplify w/w*(2/7)ww(4/13)(ww(3/5)w)/(w/(w/(w/w7))) assuming w is positive. w(4833/455) Simplify a/(aa(-6/11))a/(aa(-13)/a)a assuming a is positive. a*(171/11) Simplify (zz(-8/7)/z)/(z(-2/59)/zz) assuming z is positive. z(-458/413) Simplify (t(1/2))(17/5)/((tt(-1/5))/(t(2/3)t)) assuming t is positive. t(77/30) Simplify (q(-4/9)/(q/(q/q4)q))25 assuming q is positive. q(-1225/9) Simplify s(s/(s(-3/5)s))/ss(-1/21) assuming s is positive. s(58/105) Simplify ((n/(n(14/3)nn))/n)/(n/(n/(n/((n/((n/((n(n/(n*(-18/5)nn))/nn)/nn))/n))/nn)))) assuming n is positive. n(-46/15) Simplify g(-3/2)g/(g/g(1/4))g*2gg/(gg*(-6)g) assuming g is positive. g(27/4) Simplify (w(-3/4)ww*(2/17)w)/(w*(6/11)/ww(-6)) assuming w is positive. w(5851/748) Simplify (q(-13/6))(-46) assuming q is positive. q*(299/3) Simplify ((v(v/v*(-8))/vv)(-12))(3/13) assuming v is positive. v(-360/13) Simplify ((((u(-3/5)/u)/u)/u)/u)/(uu(-9))u*(-2/11)u*(2/19)/uu assuming u is positive. u(3473/1045) Simplify ((n4)(-16/5))(-2/29) assuming n is positive. n*(128/145) Simplify ((nn((n/((nn*(-3))/nnnn))/n)/nn)38)8 assuming n is positive. n608 Simplify (m(2/19)/mm)(1/10) assuming m is positive. m(1/95) Simplify ((v/((v*11/v)/v))/(vvv(8/3)))(-50) assuming v is positive. v(1900/3) Simplify rr*(-2/5)r*(-20)r assuming r is positive. r(-92/5) Simplify ((m/m(-30)m)/m)/m(-35) assuming m is positive. m66 Simplify (vv*(-1)vv(vv(-1/11))/v)(-45) assuming v is positive. v(-945/11) Simplify (q(-1/3)/(qq*(-4)))/(qq*(3/5)qqq(-6)) assuming q is positive. q(76/15) Simplify r*8(r/(r*(-21)/r)r)/r assuming r is positive. r31 Simplify y3/yyy*(1/11)y4/(y/y(3/10)) assuming y is positive. y(703/110) Simplify (l3l)(2/149) assuming l is positive. l(8/149) Simplify (i(-3/2)i/((i/i*(9/2))/ii))/(((i/(i/((ii/i(-3))/i)))/i)/i(-1/6)) assuming i is positive. i(-1/6) Simplify ((iii(-6))/ii)/ii(i*13/ii)/i assuming i is positive. i8 Simplify (b1)*(-49)(b(1/4))(-1/14) assuming b is positive. b(-2745/56) Simplify ((d16/d)/d)/(d/(d/(d*(-1/4)d))) assuming d is positive. d*(53/4) Simplify ((o(oo/o(-11))/o)/(oo*0o))/((ooo9/o)/o4) assuming o is positive. o5 Simplify k/(k/(k(4/19)/k))kkk(-13/5) assuming k is positive. k(-132/95) Simplify r(-25)/(rr(-17)) assuming r is positive. r(-9) Simplify ((jj13)/j)/(jjjjj(15/4)/jjj) assuming j is positive. j(17/4) Simplify (q/(q18q)q)(-1/4) assuming q is positive. q(17/4) Simplify (gg2)/(g(3/10)g) assuming g is positive. g(17/10) Simplify ((zz(zz*(-3)zz)/zzz)/zzzzz(5/6)/zz)(1/7) assuming z is positive. z(5/6) Simplify ((v/(vv(1/5)))/((v(-2)v)/v))/(v(-1))(-8) assuming v is positive. v*(-31/5) Simplify (((bbb/(b/(b(b*(-6)/b)/b))bb)/b)/(bb(1/10)))25 assuming b is positive. b(-255/2) Simplify l(2/29)l/(ll(2/65)) assuming l is positive. l(72/1885) Simplify ((ddd*(-6)dd)/(d(-2)/dd))/(d(2/5))(-37) assuming d is positive. d*(74/5) Simplify ((q(q/q*(-4/9))/qq)/q)(-1/8) assuming q is positive. q(-13/72) Simplify (c(-2/7)/c(-1/2))/(c*(-2)cc(1/4)) assuming c is positive. c(27/28) Simplify v16v/v(-10/13) assuming v is positive. v(231/13) Simplify (zzz/z*(6/11)zz(zz(-4/9))/z)(-47) assuming z is positive. z(-18659/99) Simplify (p(-2))(-6)(p*(7/5)p)/(p*(-1)p) assuming p is positive. p(72/5) Simplify i(-5)i((iiiii*9)/i)/i(i/i6)/i(3/4) assuming i is positive. i(5/4) Simplify m/((m/(m(-1/3)/m))/m)m6 assuming m is positive. m(17/3) Simplify (k10/k)/(k13k) assuming k is positive. k(-5) Simplify (i(3/7)/ii(3/4))/(i(-1/5)i6) assuming i is positive. i(-787/140) Simplify (w(-1/5)/w)(1/13) assuming w is positive. w(-6/65) Simplify (a(1/4))*(-36)/((aa/(aa/((a/(aa*(-4/3)aa))/a)))/aa/(a/(aaa(-2)))) assuming a is positive. a(-19/3) Simplify (mm(2/47)m)(-3/10) assuming m is positive. m(-144/235) Simplify (y(2/7))(1/5)/((yy(-7)yy)/(yy(-4/7))) assuming y is positive. y(157/35) Simplify (g*(-21)/gg)/g8 assuming g is positive. g(-29) Simplify ((n/(n*4n))(20/7))(-20) assuming n is positive. n(1600/7) Simplify n/n(-27)n19 assuming n is positive. n47 Simplify (bb*19b)/(bbb*14/bb) assuming b is positive. b5 Simplify i(-20)/(i*(-19)i) assuming i is positive. i(-2) Simplify i12i(11/2) assuming i is positive. i(35/2) Simplify (u(-10)u)/uuu/(u/u(-4)) assuming u is positive. u(-13) Simplify (j(2/7))24/((j/(j*(2/7)j))/j)22 assuming j is positive. j(246/7) Simplify (dd(-2)/d)(-2/11) assuming d is positive. d(4/11) Simplify a(-13)a(1/31) assuming a is positive. a(-402/31) Simplify ((s/(ss(-1/2)))/(sss(-2/31)ss))/(s(-1/5)s(ss(-2/21)/s)/s) assuming s is positive. s(-20443/6510) Simplify ((y(yy*10yy)/yy)/(y*(1/17)y))/((yy(2/3))/y)(-13/5) assuming y is positive. y(3742/255) Simplify (n/(n/(n2n)))*(-4/7)/(((nn(-5))/n)/n9) assuming n is positive. n*(86/7) Simplify (zz(-3/2))/z(4/17) assuming z is positive. z(-25/34) Simplify ((c0)2)32 assuming c is positive. 1 Simplify ((l/(l*(2/7)/ll))/l(-5))/(l(2/3))(-9/2) assuming l is positive. l(61/7) Simplify (v/((vv2)/v)v(-5))/(v/(v(2/11)/v)v0/vv) assuming v is positive. v*(-86/11) Simplify ((c/((cc/(c/c1))/c))/c)(-2/19)/(c/(c/(c/c*(1/3)))c)(-20) assuming c is positive. c(1906/57) Simplify d(-3/2)/(d(-2/79)/d) assuming d is positive. d(-75/158) Simplify x/(x(-12/7)/xx)x(-8) assuming x is positive. x(-37/7) Simplify ((bb/(b/(b2/b))bb)/((b/((b/(bb/(b*(-2)b)))/b))/b))/((bb/b7)/(b/b6)) assuming b is positive. b Simplify (b/(b/(b(-7)/b))b((b0/bb)/b)/b)/((bb(-2)b)/(b/b(-2/7))) assuming b is positive. b(-54/7) Simplify (r*1r/r(2/17))(1/2) assuming r is positive. r(16/17) Simplify y(-7/2)/y(-1/65) assuming y is positive. y(-453/130) Simplify ((o(-37)/o)/o)41 assuming o is positive. o(-1599) Simplify (((y(-6/7)/y)/y)/(y/(y/y*9y)y))35 assuming y is positive. y(-415) Simplify ((nn*1n)(-32))47 assuming n is positive. n(-4512) Simplify ((p/(p12/p)p)/p(-9))10 assuming p is positive. 1 Simplify (x(-1)/(((x(-3)x	{ "pile_set_name": "DM Mathematics" }
Does 14 divide x(10)? False Suppose 123 = 5q + 3k, -5q + 69 = -2q + 3k. Suppose p - q + 7 = 0. Is p a multiple of 5? True Is 3 a factor of 9 - 5/(15/(-9))? True Suppose -53 = -2a + 3m, -45 + 11 = -a + 4m. Is 11 a factor of a? True Let h = -9 - -14. Suppose -2d + 4 + 74 = 4l, hd = 15. Is l a multiple of 5? False Is 10 a factor of -5(152/5)/(-4)? False Let j = -41 - -9. Let i = -9 - j. Does 12 divide i? False Let p = 24 + 10. Does 17 divide p? True Suppose 4j - 304 = -5s, -4j + 2j + 150 = 3s. Is 32 a factor of j? False Suppose -o - 47 = 3m, 3o + 0o = 4m + 41. Let n = 20 + m. Is 14/4 + 3/n a multiple of 2? True Let s(p) = p3 - 5p*2 + 4p - 1. Let l be s(4). Let n be (-1 + l)/(1/2). Is 2 a factor of 2 + (-1 - n1)? False Suppose -3w + 16 = -2. Let k(f) = -2f2 - 20f - 20. Let m be k(-8). Suppose -w = -3r + m. Is 6 a factor of r? True Let i(q) = -q2 + q + 12. Let j be i(6). Let o = -3 - j. Is 15 a factor of o? True Is 2/(-4) - 495/(-18) a multiple of 3? True Let g(s) = s2 + 4s - 6. Is 26 a factor of g(8)? False Is 11 a factor of ((-83)/4)/(10/(-80))? False Suppose 0 = 3h - 9, 11m - 7m + 3h = 269. Is m a multiple of 39? False Let f be (-38)/8 - 2/8. Let w be ((-2)/f)/((-1)/(-25)). Suppose d = 5, 0 = -3j - 3d - w + 109. Is j a multiple of 19? False Let m be 145/45 + 4/(-18). Suppose 100 = mg - 65. Does 8 divide g? False Suppose 4j - 191 - 132 = -5f, -j + 97 = -2f. Is 19 a factor of j? False Is 8 a factor of 497/9 + (-8)/36? False Let m(n) = n + 4. Let l be m(-4). Suppose 4d + 3u - 410 = l, d = -0d - u + 102. Is 27 a factor of d? False Let o be (-70)/(-3)6/(-5). Let v = o + 48. Does 10 divide v? True Suppose -4b = b - 40. Suppose 4h - 107 = 3g - bg, 5h = -3g + 137. Suppose -2z + 2 = -h. Does 7 divide z? False Suppose 3w = -2k, -w + 2k + 10 = w. Suppose 94 = wf - 12. Does 8 divide f? False Suppose -33 = l - 5l + 3q, -3q = 5l - 48. Suppose 28 = ln - 5n. Is n a multiple of 5? False Let v(s) = s2 - 7. Let m be (-1 + 3)(1 + 5). Suppose j + 6 = -3g, -5j + m = 2g - 10. Is 11 a factor of v(j)? False Suppose -3v + 5h + 4 = -2v, -h + 5 = 0. Let j be -2 + v + (-6)/3. Suppose -o + 2b - 178 = -5o, 5b + j = 0. Is o a multiple of 18? False Let o = 122 - 195. Let w = -33 - o. Is 22 a factor of w? False Let d(s) = s + 7. Is d(8) a multiple of 5? True Let j(o) = -o3 - 7o*2 + 9o + 12. Let c be j(-8). Suppose 4r + c = 16. Suppose rs + 16 = 4s. Is 16 a factor of s? True Let z be (-7)/(21/(-6))-31. Is 14 a factor of -1 - z(-1)/(-2)? False Let p be 5 - 4/(-6)-3. Let n(x) = x*2 - x - 2. Let i be n(p). Suppose 0 + 8 = ic. Is c even? True Let r = -578 - -822. Does 48 divide r? False Is -1 + 99 + (7 + -9 - -3) a multiple of 33? True Let d(r) = r*3 + 3r*2 + 3r. Let s be d(-2). Let m(i) = -7i - 1. Is 9 a factor of m(s)? False Suppose 0 = -2p - 5b - 14 - 1, b = 3p - 3. Suppose -l + 3 = -p. Suppose -2a = -a - l. Is 3 a factor of a? True Let r(y) = -5 - 2y + 3 - 6. Suppose 2g = -3 - 17. Does 6 divide r(g)? True Let o(v) be the first derivative of -3v*2/2 - v - 3. Let q be 3/6-2 + 0. Does 2 divide o(q)? True Is ((-483)/(-14))/(3/4) a multiple of 23? True Let v(z) = -2z2 - 4z + 3. Let y(t) = -4t2 - 7t + 5. Let k(h) = 11v(h) - 6y(h). Let o be k(-4). Let r = o - 21. Is 11 a factor of r? True Let h = -2 - -3. Let i(v) = 2 - 1 + 6v2 - 2v*2 - v. Does 4 divide i(h)? True Suppose -2a = n - 7, 5a - 4n - 1 + 3 = 0. Suppose 0t = -o + at - 36, -3o - 3t = 153. Let x = -28 - o. Is x a multiple of 9? True Suppose 0 = -p - 3k + 137 + 48, 5p = -5k + 915. Is p a multiple of 13? True Does 20 divide -122((-7)/10 + 14/70)? False Let g be 533/9. Suppose 0 = -2n + gr + 51, -4r = -3n - 0n + 87. Is n a multiple of 12? False Let c = 24 + -4. Let z be (-93)/(-9) + (-2)/6. Suppose 0 = b + n - 0n - z, 0 = -4n + c. Is b a multiple of 5? True Suppose 2p - 4 = 0, z - 615 = -4z + 5p. Is z a multiple of 25? True Let p = -6 + 8. Let a be (-24)/2015/(-6). Is a/((-9)/(-24)) + p a multiple of 5? True Let n(x) = x + 6. Suppose -2d + 3d = 0. Let q be n(d). Let h = q + -4. Is 2 a factor of h? True Let x be (-2)/(-2 - 7/(-3)). Let s(l) = -7 - 5l + 4 - 3. Is s(x) a multiple of 12? True Suppose -5t + 10 = 2v, 3v = -3t - v + 20. Suppose 12 = -u - t. Let r = u - -23. Is 7 a factor of r? False Let t = -44 - -102. Is 29 a factor of t? True Let u be (-26)/22 + 4/22. Does 15 divide -6((-5)/(-1))/u? True Let a be 12/(-4)(-8)/3. Let y = a - 3. Suppose -3i - 96 = -yi. Is 16 a factor of i? True Suppose 5j - 106 = 94. Suppose 0 = 4q - j + 16. Is q a multiple of 6? True Let y(z) = z*2 + 12z + 11. Is 7 a factor of y(-14)? False Is 5 a factor of 137/5 + (-2)/5? False Let l(u) = -u - 1. Let c be l(-2). Let g be (6/15)/(c/10). Suppose -gp + 144 = 5y - 47, 4y - 156 = -4p. Does 13 divide y? False Suppose 3f - 5 = -5s, 5f + 4s = 21 + 9. Is f a multiple of 3? False Suppose -k = -5 + 2. Suppose 0 = -kj + 2j + 54. Is 15 a factor of j? False Let g(i) = -i2 - 1. Let x(v) = v3 - 16v2. Let n(r) = -5g(r) + x(r). Let o be n(11). Suppose ol - 137 = -42. Is l a multiple of 11? False Let k(i) = -i3 + 7i*2 + 7i + 5. Does 7 divide k(7)? False Let a(z) be the third derivative of -z*6/120 + 3z*5/20 - 7z*4/24 + 7z*3/6 - 4z*2. Is 15 a factor of a(8)? True Suppose 14w - 74 = 178. Does 18 divide w? True Let a(h) = -h*2 + 6h - 4. Let b be a(5). Is 104/(-2)b/(-2) a multiple of 11? False Suppose -p + 1 = -7. Does 2 divide p? True Suppose 129 = -3u + 1314. Suppose -4k + u = k. Suppose -5h = w - 196, 5h + 5w = 259 - k. Does 15 divide h? False Let g = 1 + 2. Suppose -4m = -4, -q - 2q = -gm - 21. Does 3 divide q? False Suppose h + 6 = w - 5, -4h + 84 = 4w. Suppose -42 = -7c - 0c. Let v = w - c. Is 10 a factor of v? True Let z be 0 - (3 - (2 + 1)). Suppose zi = -i + 6. Does 6 divide i? True Suppose 2k = -2h + 16, 2h = h + 3k - 12. Is h/(-5) + (-1515)/(-25) a multiple of 20? True Is ((-24)/10)/(54/(-405)) a multiple of 3? True Suppose 2i + 3i = 135. Is 9 a factor of i? True Suppose 3j = j - 12. Is (j/(-8))/((-2)/(-112)) a multiple of 17? False Let f(w) = -2w + 0w + 7 + 5w - w. Is f(7) a multiple of 21? True Suppose -4f + 135 = 31. Does 13 divide f? True Let u = 10 - 7. Suppose -c = uc - 120. Is 16 a factor of c? False Suppose 2d - 211 = 3w, 0 = 5d + 6w - 2w - 470. Is 14 a factor of d? True Suppose 0 = 3w - 3n - 24, -1 = -2w - n - 2n. Suppose 0 = -2m + wm - 6. Suppose -mq + 48 = h, q - 2h - 102 = -4q. Is q a multiple of 8? False Let j = 9 - 6. Does 9 divide (1/j)/((-2)/(-66))? False Let u be (34 - 3) + 2 + -5. Let z = u + -19. Suppose z = 5r - 4s - 53, -4r + 3s = -50. Is r a multiple of 6? False Does 9 divide -1 - 3/((45/84)/(-5))? True Let a = -29 - -11. Let p = a - -33. Is 13 a factor of p? False Let d(m) be the third derivative of m*6/120 + 7m*5/60 - 13m*4/24 - 5m*3/3 - 9m*2. Does 6 divide d(-8)? True Let u(g) = -2g*2 + 47g. Is 29 a factor of u(17)? False Let x(z) be the first derivative of -z*4/24 + 2z3 + z2/2 - 3. Let p(j) be the second derivative of x(j). Is p(8) a multiple of 4? True Suppose 96 = 2s - s. Is s a multiple of 32? True Let y = 11 - 8. Suppose -15 = yx - 87. Is x a multiple of 24? True Let i = -80 + 50. Let n = 1 - 15. Let a = n - i. Is 16 a factor of a? True Suppose 2g - 10 = 30. Suppose a + 3o - 8o = -g, -5a + 45 = 4o. Is 4 a factor of a? False Suppose 7w = 8w - 113. Does 15 divide w? False Suppose -2f + 14 = -5d + f, 0 = -d + f - 2. Let g(b) = -b3 - 7b*2 - 5b + 1. Let n be g(d). Let q = n + 45. Does 7 divide q? False Let b(f) = f*2 + f. Let p(g) = -8g*2 + 5g + 12. Let t(s) = b(s) - p(s). Let c(l) = -4l2 + 2l + 6. Let y(n) = -7c(n) - 3t(n). Is 18 a factor of y(6)? True Let d(s) = s + 7. Let q be d(-4). Suppose 0 = 2i + 4l - 2, -18 = i - ql - 44. Is i a multiple of 5? False Suppose -2s + 8s = 1230. Does 26 divide s? False Suppose 42 = 3t - 2t. Suppose -3a + 3 + t = 0. Let l = a - 10. Does 4 divide l? False Let z(p) = -1 + 6 - 12p - 2 - 6. Is 12 a factor of z(-3)? False Let c(r) = 2r*2 + r - 3. Suppose 11 = -5b + 1. Let s = 5 + b. Is c(s) a multiple of 12? Fals	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.