Datasets:

timaeus
/

pile-dm_mathematics

Dataset card Data Studio Files Files and versions Community

Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
28 + 28. Does 1/36 = r? False Let h = 19 - 19. Which is smaller: 1.1 or h? h Let v = -14 - -14.27. Is 0 greater than v? False Let s = -29 + 33. Suppose 0g + 4g = 0. Suppose g = si + 2p - 8, 1 = 5i + 2p - 8. Is i <= 2/9? False Suppose 0x = -2a + 2x + 10, 5a - 25 = 3x. Suppose a = 5p, 6h - 26 = h + 4p. Which is smaller: 7 or h? h Let n = -82/77 + 18/11. Which is bigger: n or -1/3? n Let d = 0.54 + -0.6. Let b = d - -0.07. Let f = b - 3.01. Which is greater: -1 or f? -1 Let v(u) = u3 + u2 - 8u - 6. Let b be v(-3). Is 16 >= b? True Suppose -4v - 12 = -3w, 4v = 2w + 3v - 3. Suppose w = -5m + 2m + 6. Is m <= 3? True Suppose n - 1 = 2. Suppose -4h + 3h - n = 0. Which is bigger: h or -1? -1 Let y = 18 - 8. Let o be y1/(8/(-12)). Which is greater: -14 or o? -14 Let v be (-3)/(-10)(2 - 4). Which is greater: 2 or v? 2 Let r be -4 + (-33)/(-30) - -3. Which is greater: 1 or r? 1 Let p = 2 - 2. Let n = 6 + -5. Do n and p have the same value? False Suppose -4r - 8 = -6r. Suppose rp = -j + 16, 2p - 18 = -3j - 0. Suppose -5n - j = -n. Is n smaller than 2/11? True Suppose 6 = 3d + 3z, 0d - 2z + 12 = 4d. Let m(b) = b3 + 8b*2 + 6b - 5. Let c = 0 + -7. Let f be m(c). Is f less than d? True Let f = 3 - -2. Is 5 at most f? True Suppose -5o - 3q = 10, -o - 6 = 3o + 2q. Is o smaller than 2? True Let j(k) = 2k3 + 31k*2 - 17k - 16. Let q be j(-16). Is q less than 4? True Let d = -22 - -37. Let b = d - 12. Let q = -0.2 + 0.3. Which is greater: b or q? b Suppose 0s = 2s - 6. Suppose -12g + 9g + s = 0. Which is bigger: g or 9/4? 9/4 Let j(h) be the third derivative of -h*4/24 - 3h*3/2 + 2h*2. Let r be j(-10). Let m be (r-1)/(3/(-12)). Is 3 != m? True Let j = -124 + 368/3. Are -2 and j non-equal? True Let m = 3 - 3. Suppose mi - 12 = -4i. Let z = i - 2. Is z smaller than -3? False Let t be (-4)/39/(-6). Let v be t/11 - (-32)/(-418). Is v less than or equal to -1? False Suppose -4i = -4s + 12, -2s + i = -3s + 9. Let r be (-3 - (-1 + 1))/1. Let d = 2 - r. Which is bigger: d or s? s Suppose 0 = 2f + 36. Let o be 4/f + 76/18. Suppose -u = ou. Which is greater: u or -4/7? u Let i be 6/(-14)2/(-3). Suppose 0k - 4 = 4k. Which is bigger: i or k? i Let d = -2/39 + -23/312. Let b(u) = -2u - 17. Let s be b(-8). Is s less than d? True Let l = -32 + 30. Which is smaller: l or -0.2? l Let b be (1/(-3))/((-4)/3). Let x(q) = q3 - 5q*2 + 5q - 5. Suppose -4m + 28 = 5s, 4s - 5m - 9 + 3 = 0. Let r be x(s). Are b and r equal? False Suppose v = 2v. Let r(y) = y3. Let z be r(v). Let a be (-1)/2(-1 - 0). Are a and z non-equal? True Let i = -1.25 + 0.05. Let h = 1.1 + i. Is -0.3 at most h? True Let h be (-99)/15 + (-8)/20. Is -6 > h? True Suppose -5f - 9 = -2f. Which is bigger: f or -8/3? -8/3 Let j be (-2 + -6)(-1)/2. Suppose 4y = 5q - 16, 4y - j = -2q + 5y. Which is smaller: 1 or q? q Let d = -3.2 - -3. Suppose 7q - q = 0. Which is smaller: q or d? d Let m = 0 + 0. Let b = m + -2. Let x(n) = -n3 + 3n*2 - 2n - 1. Let d be x(2). Which is greater: d or b? d Let c(w) = -w*2 + w. Let i be c(1). Let l be (0 - 0) + (i - 0). Let r be 2/(-30)(-8)/(-20)5. Are r and l equal? False Let z be -2(-3 - -1)/(-2). Which is greater: 3 or z? 3 Let f = -16.8 + 17. Which is bigger: f or -6/7? f Let i = -3 + 4. Suppose -7b + 2b = 0. Suppose -4 = 2y - b. Which is bigger: y or i? i Let s = -3 + -1. Let q = s + 4.04. Let w = q - 0.04. Which is bigger: 2 or w? 2 Suppose 17 = -4p - 35. Let d = p - -7. Let x be 8/(-3) + (-4)/d. Is x at least -1? False Let w = 1245 + -21171/17. Let o(r) = r*3 - 5r*2 + 3r. Let t be o(1). Which is greater: t or w? w Let q be 3/9 - (-2)/(-6). Let s(a) = a*3 + a - 7. Let v be s(q). Suppose l - b + 14 = 7, -2b + 26 = -4l. Is l at least v? True Suppose 0 = 3c, -4o + 3o + 4c - 2 = 0. Let t be o/4(-2 - -2). Is t at most -7? False Suppose 6o = o + 20. Suppose 7v - 3v - 16 = 0. Is o < v? False Let g = 115 + -93. Which is greater: g or -2/13? g Let r(x) = -x3 + 4x*2 + 2. Let t be r(4). Is t smaller than 2? False Suppose 3j - 4y = 10, -3j + 2j = 4y - 30. Suppose -5r + 3r = -3z - 21, z = r - 10. Are r and j equal? False Let r be (-4)/20 - (-279)/(-30). Which is smaller: r or -9? r Let p(i) = 249i*2 - 3i - 2. Let v be p(-2). Let w be v/(-16) - (-2)/(-4). Let j be (-120)/w + (-1 - 1). Is j >= 1? False Let g(a) = -a*3 + 4a*2 - 3a + 1. Let u be g(2). Suppose 2t - 22 = -2x, 0x + 4t - 51 = -5x. Suppose 0 = 4b - u + x. Is b less than -3/8? True Let j = 49 + -41. Which is smaller: j or 0.3? 0.3 Let u = -0.04 + -0.96. Let x = -0.5 + u. Let q = x + -0.5. Which is bigger: q or 0? 0 Let j = 1 + 0. Let l = 45750/43 + -1064. Which is smaller: l or j? l Let h(i) = -i + 1. Let t be h(-3). Suppose -2b - 2s = 12, tb - s + 13 = -16. Which is smaller: b or -9? -9 Let a(j) = j. Let k(f) = 3f - 6. Let i(w) = 4a(w) - k(w). Let x be i(-4). Let o = -2 + 2. Is x >= o? True Let y = -0.5 + -1.5. Let h = 3 - 0. Let u = 1 - h. Is u greater than or equal to y? True Let k be (2/(-18))/((-1)/3). Let u = -3680 + 11179/3. Let y = u - 46. Is k at least y? True Let h = -55 - -58. Which is smaller: -5 or h? -5 Let t be (0 - 36/(-3))/2. Is 7 less than or equal to t? False Let y be 9/(-12)2-2. Let v be (8/(-6))/(16/(-24)). Is v at most y? True Let c = -4 + 7. Let g = -10 + c. Does g = -7? True Let o = 4 + -3. Let r = -1.6 - 0.4. Let u = r - -1.9. Which is smaller: o or u? u Let n = 58 - 61. Do -3 and n have the same value? True Suppose 4m + 4 = -4o, -2o - 5m - 21 = -o. Suppose oc - 55 = -c. Suppose -z - 2n = -c, -3 = -5z - 5n + 27. Do z and 2/7 have the same value? False Let x be 3 - (0 + 3 + 11). Is -9 bigger than x? True Let l = -23 + 23. Which is greater: -9/7 or l? l Let q(k) = 12k + 21. Let m be q(-5). Which is smaller: m or -38? m Let m = -2 - -7. Suppose -1 - m = o. Let p be (-4)/(-6) - 2/o. Is p >= 2/15? True Let f be 81/(6/15). Suppose 0p = -4p + f. Suppose d + p = 2. Is d equal to -4? False Let u be 1/(-4) + 347/(-8932). Let d = 1/319 + u. Is d at least as big as 0.1? False Let u = 1.5 + -0.4. Let r = -0.1 + u. Does r = 2/15? False Let s(c) = -c2 + c - 1. Let v be s(-3). Let i = v - -38/3. Which is bigger: -2/7 or i? -2/7 Let l = -179 + 174. Is l > -9? True Let d be 2(-8 - 5) + 1/1. Is d at least 2/7? False Let u = 34 + -33.86. Which is greater: -1/2 or u? u Let l = -2 + 3. Let w = -4 + -4. Let d(x) = -x*2 - 7x + 10. Let t be d(w). Which is bigger: t or l? t Let a be 4/(-4) + 1/1. Suppose -r + 4 + 1 = a. Suppose c = -rt - 13, -2t - t + 4c = -6. Is -1 <= t? False Let v = 103 - 92.4. Let w = 10 - v. Let p = w - -0.7. Which is bigger: 0.8 or p? 0.8 Suppose a - 26 = 3a - 2g, -a + 4g = 22. Let n be (-4)/a + (-13)/(-5). Suppose 4b = 2l + 1 - 25, -25 = -5l + 3b. Which is bigger: l or n? n Suppose 2f + 2f = 0, 0 = 2m + 5f + 18. Let y(p) = p*2 + 8p - 10. Let r be y(m). Let a be r/(-6) - 2/(-4). Is 1 bigger than a? True Let w(m) = -m + 8. Let q = 16 - 12. Let k be w(q). Which is bigger: k or 2/5? k Let n be 0 + 26/14 + 14/98. Which is greater: n or 4? 4 Let d = 27.41 - 0.41. Let j = -19 + d. Is 0 equal to j? False Suppose 0 = -g - 3x - x + 10, 0 = 5g - 2x - 28. Suppose h + g = -h. Let s be (1/h)/((-3)/45). Which is greater: 3 or s? s Let a = -0.37 + -0.03. Let i = a - 1.6. Do -2 and i have the same value? True Suppose 0 = 4y + 20, 3y - 70 = -5s + 7y. Suppose 0 = -2d + 8, 5l + 0d + d = 24. Suppose -m = lm - s. Is -1/4 greater than m? False Let t = -0.052 - -0.382. Is t < 0? False Let a(v) be the second derivative of v3/3 - v. Let b be a(3). Let o be -2(b/(-3))/4. Is o < 1? False Let m be (19 - 16) + 4 + -1. Suppose 3h - 17 = 4. Is h > m? True Let z be ((-9)/12)/(15/(-36) + 0). Which is smaller: z or 1? 1 Let t = -4981/50180 + 3/965. Let z = t - 2/13. Suppose -1 + 3 = 2v. Which is smaller: v or z? z Let q = 6 + -6. Let o = -1 - -1. Let n = o - q. Which is smaller: n or -0.5? -0.5 Let s be (1/8)/((-8)/(-12)). Is 1 not equal to s? True Let o be (-10)/40 - (-22)/(-8). Is o != -3? False Let f = -22 - -26. Suppose -2v - 3h + 9 = 0, 0 = fv - 0h - 2*h + 6. Is v less than or equal to -5/8? False Let o be (-8)/(1 - 1/3). Let x be (o/(-33))/	{ "pile_set_name": "DM Mathematics" }
te the remainder when (10/6)/((-35)/(-1260)) is divided by 7 + z + 151. 12 Let l(p) = 4p*2 - 3p + 8. Let c = 21 + -19. What is the remainder when l(c) is divided by 10? 8 Suppose 3y - 416 = 361. Calculate the remainder when y is divided by 29. 27 Let f = -17 + 1. Let b = f + 16. Suppose 14 = -2p - 5z, b = -2p - 0p + 5z + 26. Calculate the remainder when 14 is divided by p. 2 Let q = -214 - -252. What is the remainder when 340 is divided by q? 36 Suppose 3r + 52 = 259. Suppose 54 = -5u + r. Suppose -3c + 8c - 20 = 0. Calculate the remainder when c is divided by u. 1 Suppose 154o = 149o + 1170. Calculate the remainder when o is divided by 63. 45 Let v be (-402)/8 - 14/(-56). What is the remainder when 3/5 - 5270/v is divided by 27? 25 Suppose w = 2n + 4w + 18, n + 9 = 2w. Let x = 25 - n. Calculate the remainder when 100 is divided by x. 32 Suppose -4u + 5 = -16p + 15p, p + 2u - 19 = 0. What is the remainder when 823 is divided by p? 9 Let g(k) = k3 + 40. Suppose 360t = 381t - 441. Calculate the remainder when g(0) is divided by t. 19 Let o be 0 + 9 + (-7)/7. Suppose -ov + 4v = -92. Calculate the remainder when 89 is divided by v. 20 What is the remainder when 4 is divided by 2 - 5(-5)/(-25)0? 0 Suppose -4i = -s + 12, 2s + 14i = 12i + 4. What is the remainder when 45 is divided by s? 1 Let b(h) = 14h*2 - 26h - 90. Calculate the remainder when b(-3) is divided by 13. 10 Let l = -100 + 141. Suppose -l = -4v - x, -3v = 2x - 9 - 23. Calculate the remainder when v is divided by 4. 2 Let l = 10 - -5. Suppose 4o + o = 5w - 65, -3w - 105 = 5o. What is the remainder when l is divided by (-148)/o - 34/153? 7 Let j(n) = -2n*2 + 67n + 2. What is the remainder when j(33) is divided by 26? 9 Let g = 31 + 11. Suppose -177 = -5o - g. What is the remainder when o is divided by 6? 3 Let i(f) be the first derivative of -2f*3/3 - 15f*2/2 + 4f - 10. What is the remainder when 20 is divided by i(-7)? 9 Let m(q) = -q3 + q2 + q - 3. Let u(z) = z*2 - z + 1. Let k(a) = -2m(a) - 2u(a). What is the remainder when 9 is divided by k(2)? 1 Let n(y) = -5y3 + y2 - 1. What is the remainder when 26 is divided by n(-1)? 1 Let t(w) = 204w2 - 28w + 28. Calculate the remainder when t(1) is divided by 23. 20 Suppose 0 = -j + 72 + 26. Suppose -8g = 6g - j. What is the remainder when 53 is divided by g? 4 Suppose -10 = 2i, -5d + 2i + 8 + 32 = 0. Suppose -667 = -11a - 271. Suppose -9t + dt = -a. Calculate the remainder when 22 is divided by t. 10 Let h(s) = -6s - 91. What is the remainder when 18 is divided by h(-16)? 3 Calculate the remainder when (-6465)/(-9) - (-4)/6 is divided by 24. 23 Suppose -4k + 626 = -2n, -5k + 847 = -6n + 75. Calculate the remainder when k is divided by 10. 8 Suppose -7o - 3 = -3f - 4o, -4f + 2o + 10 = 0. Suppose 4d = -x + 1 + 82, -5d = fx - 387. What is the remainder when x is divided by 26? 25 Let q = 2 - 3. Let t(c) = 16c*2 - 4c + 1. Let r(y) = 15y2 - 5y + 2. Let x(j) = -2r(j) + 3t(j). What is the remainder when 35 is divided by x(q)? 16 Suppose h + 5r + 14 = 18, -5h - 2r + 66 = 0. Suppose -n - 2 = -54. Calculate the remainder when n is divided by h. 10 Suppose -4g = 2u - 148, 2u + 4g = -2u + 312. Calculate the remainder when (u/(-6))/((-2)/6) is divided by 17. 7 Let b = 16 + -17. Let f(x) = -13x3 - x2 - 2x - 1. What is the remainder when f(b) is divided by 5? 3 Suppose -4b + 55 = -3x, 4b - 61 = -9x + 10x. What is the remainder when b is divided by 3? 1 Suppose 9b - 135 = -0b. Suppose -2m + 33 = m. Let g = m + -5. Calculate the remainder when b is divided by g. 3 Suppose 3 = -16h + 17h. Suppose -hg = -4d - 69, g + 3d = 2d + 16. What is the remainder when 51 is divided by g? 13 Suppose 2d - 51 - 21 = 0. Let u = -9 + d. What is the remainder when 106 is divided by u? 25 Suppose 180 = -0l + 5l. Let s(n) = 4n - 25. Let b = -26 - -37. Calculate the remainder when l is divided by s(b). 17 Suppose -7n = -6n - 44. Calculate the remainder when n is divided by 3. 2 Let v = 44 - 39. Suppose -4m = -79 - v. What is the remainder when 62 is divided by m? 20 Suppose -5s = b + 42 - 61, -3b = 3. Let i(r) = 3r3 - r2 + r - 3. Calculate the remainder when i(2) is divided by s. 3 Suppose 2g + 0g - 552 = 0. Suppose 32 - 5 = v - 2b, b + 122 = 4v. What is the remainder when g is divided by v? 28 Let z(k) = -k - 4. Let y be z(4). Suppose 0 = -v - 2. What is the remainder when 50 is divided by (-51)/(-4) + v/y? 11 Suppose 0 = 25p - 28p + 66. Suppose h - 1 = 2t, 5h + 4t - 2 = 3h. Suppose -2z + 20 = 3y, -3 = -z + h. Calculate the remainder when p is divided by y. 2 Suppose 5s - 518 = -2o, 0 = -s + o + 98 - 0. Suppose -3x = -34 - 44. Calculate the remainder when s is divided by x. 24 Let h(b) = 10b*2 - 5b + 3. Suppose -2u = -2y - 6, 0 = -2u - 0y + 4y. Let j be 14/u + 2/3. What is the remainder when h(j) is divided by 20? 18 Let g be (9/(-6))/((-1)/2). Suppose -gp + p = k - 13, 5k - 65 = -4p. What is the remainder when k is divided by (-2)/(-4) + (-14)/(-4)? 1 Suppose 3f - 141 = -3h, -4f - 39h + 178 = -40h. Calculate the remainder when 223 is divided by f. 43 Suppose 7x + 130 = 5k + 2x, 0 = 5x + 5. Let z = k - 2. Let j(s) = 14s - 4. Calculate the remainder when j(5) is divided by z. 20 Let v be (-5 + 21)/(-4) - 10-1. Suppose -y - 5i + 166 = y, -3i = v. Calculate the remainder when y is divided by 30. 28 Suppose 5l + q - 24 = 0, 2l + l - 4q = 19. Let j = 3 + l. Let v(r) = 2r + 21. Calculate the remainder when j is divided by v(-9). 2 Let h be (0 + 1 - 2) + -46. Let r be h - -18/(-4). Calculate the remainder when 28/r + 722/14 is divided by 13. 12 Let o be 2/(-1 - 1)(-1 - -1). Suppose 2f - 12f + 1020 = o. What is the remainder when f is divided by 21? 18 Suppose -k + 19 = -34. Calculate the remainder when 313 is divided by k. 48 Let q(y) = 27y*2 + y. Let f be q(1). Suppose 4i - 216 = f. Calculate the remainder when i is divided by 5452/174 - (-4)/6. 29 Suppose -r - 5k + 51 = 0, 189r - 4k - 33 = 188r. Let z(w) = -5w3 - w2 + 3w + 4. Calculate the remainder when z(-3) is divided by r. 39 Suppose -5q + 3m = -15, -q + 3 + 0 = 5m. Suppose -3v - v = -qu - 8, -4v + 2u + 12 = 0. What is the remainder when 14 is divided by v? 4 Suppose 120 = -339o + 345o. What is the remainder when 71 is divided by o? 11 Let c be (-20 - 2)/(-2) - 5. Suppose -cr = -184 - 230. What is the remainder when r is divided by 35? 34 Suppose -379v = -374v - h - 2519, 3v - 4h - 1525 = 0. What is the remainder when v is divided by 18? 17 Suppose -5g = 5d - 95, -g = 4d - 47 + 16. Let m = g - 9. Let q(k) = k + 5. What is the remainder when 43 is divided by q(m)? 10 Let j = -70 - 32. Calculate the remainder when 36 is divided by (j/36 + 3)114. 17 Suppose 4m = s + 2s + 84, 2m - 2s - 42 = 0. What is the remainder when 41 is divided by m? 20 Let r(n) = n*2 - 22n + 128. What is the remainder when r(19) is divided by 18? 17 Calculate the remainder when (-2)/32-424 + 1/(-2) is divided by 8. 2 Suppose 1033 + 717 = 10z. Calculate the remainder when z is divided by 16. 15 Let n(z) = -9z + 1. Let b be n(-5). Suppose 0 = 4t - 3t + 4i - b, -4i = -t + 70. Suppose r + 2r - 90 = 0. Calculate the remainder when t is divided by r. 28 Let o(l) = l*3 + 5l*2 + 2l + 8. Let k = -23 - -60. Calculate the remainder when k is divided by o(-3). 17 Suppose 3r + 6t - 9t = 21, 3r - 41 = -2t. What is the remainder when 40 is divided by r? 7 What is the remainder when 479 is divided by (-22)/((-484)/(-33))(-74)/3? 35 Suppose 5b + 3g - 148 = -g, -108 = -4b + 2g. Calculate the remainder when 162 is divided by b. 22 Let q(s) = s*2 - 25s + 19. Let o(i) = -1. Let z(a) = 5o(a) + q(a). What is the remainder when 38 is divided by z(25)? 10 Suppose -30z = -29z + 6. Suppose 0i + 3x = -2i + 153, i + x - 79 = 0. Let m = i + z. Calculate the remainder when m is divided by 20. 18 Suppose 2w + 4 = -0w. Suppose 0 = -4d + t + 57, 4t = 4d - 24 - 24. Calculate the remainder when (2 + (-25)/w)4 is divided by d. 13 Let k = 1325 - 1058. What is the remainder when k is divided by 67? 66 Let a(g) = 12g2 - 32g - 6. What	{ "pile_set_name": "DM Mathematics" }
greatest common divisor of k and z. 1 Let c = -19 - -22. Suppose -cy = -0y + 57. Let b = 31 + y. Calculate the highest common factor of 12 and b. 12 Suppose 0 = -5y + h + 2794, 1901 + 336 = 4y + h. What is the greatest common factor of y and 13? 13 Let x(u) = -36u + 122. Let m be x(-8). What is the greatest common factor of 10 and m? 10 Let z = 25 - 17. Let o(h) = -h3 + 2h*2 - 3h + 4. Let v be o(5). Let t = v - -134. What is the highest common factor of z and t? 8 Suppose 5y = -2d + 183 + 653, -3y + 2052 = 5d. Calculate the greatest common divisor of 24 and d. 24 Let p = 906 - 886. Calculate the highest common divisor of 380 and p. 20 Suppose -5z = -43 - 32. Let w be 6/z - 358/(-5). Let a = -166 + 174. Calculate the greatest common factor of a and w. 8 Suppose -q - 4 = -3k, 2k + 4 = 4q - 10. Suppose 0 = qb - 73 + 43. What is the greatest common factor of b and 12? 6 Let m(a) = -a3 + 2a*2 + 16a + 88. Let v be m(-6). Calculate the greatest common factor of v and 90. 10 Suppose 0 = -4t + 8, 4q - 2t - 60 = -4t. Let y be 2/18 + (-53741)/(-549). What is the highest common divisor of q and y? 14 Suppose b - 1 = 3. Suppose -2515 = bt - 9t. Let c = 733 - t. What is the greatest common divisor of 23 and c? 23 Suppose 3k = 2k. Suppose -65 + k = -5c. What is the greatest common divisor of c and 104? 13 Let t(r) = -4r + 162. Let g be t(27). Calculate the highest common divisor of 12 and g. 6 Let u be 5/(-2)28/(-2). Let b be (64/36)/8 + (-102)/(-27) + 1. Calculate the greatest common factor of b and u. 5 Let q(i) = -i + 5. Let m be q(3). Let d(o) = -47o + 4. Let a be d(m). Let g be 9/(-3) - a/5. What is the highest common factor of g and 5? 5 Let i = -252 + 273. Calculate the greatest common factor of 567 and i. 21 Suppose 10s - 35 = 5s + l, -45 = -5s - l. What is the highest common factor of s and 2? 2 Let o(m) = -m2 - 38m - 30. Let l be o(-35). What is the highest common divisor of 150 and l? 75 Let z(t) = -t - 14. Let m be z(-14). Let q(l) = l3 - l2 - 2l + 80. Let k be q(m). What is the highest common divisor of k and 10? 10 Suppose z - 21 = -5f + 28, 0 = -3f - 2z + 35. Suppose 13b = 4b + 162. Calculate the highest common divisor of f and b. 9 Suppose 5 = -o - 4o. Let d be (-108)/(-4) - (2 - o). Suppose 4 = 2v - 0v, a + 2 = 5v. Calculate the greatest common divisor of a and d. 8 Let v(t) = 2t - 87. Let r = -33 - -33. Let l be v(r). Let d = l - -185. Calculate the highest common divisor of 14 and d. 14 Let p = 3935 + -3932. Suppose -62 = -5b + 43. What is the highest common divisor of b and p? 3 Suppose 30 = 5w + 3s, -10 = -2w - 2s + 6. Suppose 6r - 270 = wr. What is the highest common divisor of 60 and r? 30 Suppose -11a = 8a - 1672. What is the highest common divisor of 48 and a? 8 Let y = 6 + 18. Suppose 2j - 3i - 19 = 9, -3j - 4i = -8. Let p = -5 + j. Calculate the greatest common factor of p and y. 3 Let z = -421 + 619. Let h = 52 - 16. Suppose h = m + m. Calculate the highest common divisor of m and z. 18 Let y = 161 + -149. Suppose 384 = 3a - 3x, 124 = 5a - 4a - 2x. Calculate the highest common divisor of a and y. 12 Let r be 2(-5)/90 - 884/(-18). Calculate the highest common factor of r and 49. 49 Suppose u = -0u. Let f(j) = j2 + 39. Let i be f(u). Suppose 0z = -4p - 3z + 67, 51 = 2p + 5z. What is the highest common divisor of p and i? 13 Let g = -64 - -76. Calculate the greatest common factor of g and 300. 12 Suppose 0 = -4q - 5a + 25, q - 12 = -a - 6. Suppose 36 = 4g - 2r, g + 38 = qg - 3r. Calculate the highest common divisor of 16 and g. 8 Suppose -245 = -11q + 195. Calculate the greatest common factor of 10 and q. 10 Suppose -47a + 168 = -33a. Calculate the highest common factor of 132 and a. 12 Let n(l) = 3l - 3l - 5l + 4l - 15. Let c be n(-18). Calculate the greatest common factor of 21 and c. 3 Let w(s) = 3s3 + s2 + s - 2. Let a be w(1). Calculate the greatest common factor of 303 and a. 3 Let j = 74 + -70. Suppose jb - a = 68, 0b = 3b - a - 52. Calculate the highest common divisor of b and 48. 16 Let p(f) be the first derivative of 3f*2 - 18f + 2. Let t be p(11). What is the highest common factor of 16 and t? 16 Suppose 2g = 0, 0l = -2l - 2g - 56. Let q = l - -30. Suppose -2f = 5i - 8 - 26, 0 = -qi + 3f + 6. Calculate the greatest common factor of 66 and i. 6 Let w = 1068 - 478. Calculate the highest common factor of 10 and w. 10 Let z = 524 + -227. What is the greatest common divisor of 11 and z? 11 Let y be 56/(-3)6468/(-176). Calculate the greatest common factor of 42 and y. 14 Let l(c) = 3c - 58. Let u be l(28). Suppose h - 59 = -u. What is the greatest common divisor of 11 and h? 11 Suppose 0 = -0i - i + 2. Suppose -c + 1 + i = 0. Suppose 4o = c + 37. Calculate the highest common factor of o and 50. 10 Let p be 2/4 - (46740/24)/(-5). What is the highest common divisor of 52 and p? 26 Suppose -3o = 3, 2n - 5n = -5o - 29. Let s be 16 + 1 + -2 - (3 - 2). Let v = s - n. What is the greatest common factor of 2 and v? 2 Let p be 221(1 + 1). Suppose -3n = -2a + 57, -2n = -2a + p - 28. What is the greatest common divisor of 45 and a? 9 Let r(d) = 6d2 - d + 6. Let w be r(-6). What is the greatest common factor of w and 76? 76 Suppose -40n = -303 - 297. What is the highest common factor of n and 63? 3 Suppose -2m + 0m - 6 = 5i, 6 = -3i - 2m. Suppose -3q - 4s + 217 = i, -3q - 2s = -0s - 221. Calculate the highest common divisor of 30 and q. 15 Suppose -30y = -31y + 133. Calculate the highest common factor of y and 14. 7 Suppose -m - 101 + 173 = 0. Let h be 14/(-119) - 6124/(-34). Calculate the highest common factor of h and m. 36 Let w(p) = -10p + 3. Let g be w(-5). Let b be g - (3/1 + -1). Let m be (3 - 6 - -21) + -1. Calculate the greatest common divisor of m and b. 17 Let b = -49 - -55. Suppose bl = 4l + 50. What is the highest common factor of l and 5? 5 Let f be -5(25/(-75) - 1173/45). Let h be 3(1 + -2 - -5). What is the highest common divisor of f and h? 12 Let x be (9/21 - 1) + 975/175. Calculate the greatest common divisor of x and 10. 5 Let d(a) = 9a - 3. Let w be d(-7). Let x be (-11)/w - (-11)/6. Suppose xv - 20 = -2v, -3j + 2 = -5v. What is the greatest common divisor of 1 and j? 1 Let q = 318 + -52. Let j(a) = -a*2 + 14a - 7. Let b be j(9). What is the greatest common divisor of b and q? 38 Let b be ((-1926)/(-63))/(1/7). Suppose -5n = -p + b, n - 2n - 761 = -4p. What is the highest common factor of p and 21? 21 Let x = 53 - 54. Let s be (2/3)/(1/(-36)). Let k be -1 - x - 0 - s. Calculate the highest common divisor of 12 and k. 12 Suppose -3s + 20 = -2s - 4c, -20 = -4s - 4c. Calculate the greatest common divisor of 216 and s. 8 Let r = -1499 + 1516. What is the greatest common factor of r and 3043? 17 Let v(k) = 3k + 4. Let y be v(-10). Let c = -12 - y. What is the greatest common divisor of 21 and c? 7 Let l(d) = -d3 + 14d*2 + d - 12. Let n be l(12). What is the greatest common factor of 32 and n? 32 Suppose 6d - 22d + 304 = 0. Calculate the highest common factor of 1159 and d. 19 Suppose -3s + 279 = 42. Suppose -5f + 31 = 4g - s, 5f = 4g + 70. Let o be (-3 + 1 + 47)1. What is the greatest common divisor of f and o? 9 Let d(u) be the second derivative of u4/12 + 4u*3/3 - 9u*2/2 - 4u. Let y be d(-9). Suppose y = t + 1 - 5. What is the greatest common divisor of t and 8? 4 Let f(b) = -b*3 + 11b*2 + 12b + 7. Let w be f(12). Let s be (1078/(-44))/(1 - w/6). Calculate the highest common factor of s and 42. 21 Suppose 3t = 4r + 4, -r - 4t + 14 = -t. Let u be (-154)/(-21) - r/(-3). What is the greatest common divisor of u and 1? 1 Let i = -198 - -320. Let c be i/14 - (-1 - (-15)/21). Calculate the highest common factor of 9 and c. 9 Let j = 90 + -63. Calculate the greatest common factor of j and 3. 3 Suppose 0 = 2o + 2o - 2b - 1100, 5o + b = 1375. Suppose m - w = 110, 2m - 4w + 86 = 306. What is the greatest common divisor of o and m? 55 Suppose -4v + 5v = 4b - 217, 2v = -2. Calculate the highest common divisor of b and 30. 6 Suppose 103 = 3g + 2g - n, -2g + 34 = 2*n. Calculate the highest common divisor of g and 60. 20 Let m(b)	{ "pile_set_name": "DM Mathematics" }
)c)c)46) assuming c is positive. c(-1223/63) Simplify ((p1/p(-1))/(p*(2/7)/pp)(-21))/((p/p(2/5))(26/5)/((p2p)/(p(1/8)p))) assuming p is positive. p(1351/200) Simplify ((((c(-3/16)/c)/c(-24))(1/8))28)(-4/3) assuming c is positive. c*(-2555/24) Simplify pp*(1/5)/ppp(-39)/p(((p*(-45)p)/p)/p)/((p/p(-32))/p) assuming p is positive. p(-584/5) Simplify a(a(-1/4)a)/aa(-7)a*(2/9)a*(-2/15)(a*2a(-2))/(a(2/5)aa(1/3)) assuming a is positive. a(-1421/180) Simplify (vv(-2/51)v*(-23)v*(-4/13)vvvv/v24)(1/5) assuming v is positive. v(-28076/3315) Simplify ((g(4/3)g/((g*(3/8)g)/g)(g(-1))8)(-24))(-2/109) assuming g is positive. g(-290/109) Simplify (d8dd(1/5))34/((d(d/(dd/(d/((dd*2d)/d))))/d)/d*(-3)d*(1/8)/(d/(dd*(-2/19)d)d)) assuming d is positive. d(237713/760) Simplify ((((k/(k/k(1/5))k)/k)/k)(-18))(-6)(k(2/5)k*(-5)k)/(k0)19 assuming k is positive. k(-90) Simplify (((g(-6)/(gg8gg))/(g(-8)/((gg5)/g)))16)32 assuming g is positive. g(-2048) Simplify ((((((m(-24)/m)/m)/m)/m)/(((m/m(-3/10))/m)/m))/((mm(-22)mmm)/m(-8/11)))14 assuming m is positive. m(-7721/55) Simplify (t(-1))(-2/63)/((t/t(-1/6)t)/t7)(tt(-1/2))(-19/4)/(t(-1/3)/(tt/(tt/(tt*(2/5)t)))) assuming t is positive. t*(13163/2520) Simplify ((ww*(3/2)ww)(12/13))(1/10)/(((ww(1/5))/(w/w(-3/4)w))/(w/((w(-2)w)/w))(-2/31)) assuming w is positive. w(14281/8060) Simplify (((xx(-4)x)44)38)(1/23) assuming x is positive. x(-3344/23) Simplify (d1)26/(((d/(d*(1/2)/dd))/d)/d*5)(d*1d)(17/3)/(d2/(d/(dd/d(1/6))d)) assuming d is positive. d*41 Simplify ((d(dd(-1/7)dd)/d)(-15))37/(((d/(dd/d(-4)))/(d8d))/(d(-2))(-2/93)) assuming d is positive. d(-1023158/651) Simplify (((j/(j0jjj))/j)*(4/11)j*0jj/j(-1/5))/(j4/jj*(-2/13)(j(j/j(-1/4)j)/j)(-18)) assuming j is positive. j(55431/1430) Simplify (r*25/(r/(rr*(-2/63)))r*(-1/10)r12)(-6/13) assuming r is positive. r*(-23227/1365) Simplify (u/(u/((u(uuuu29)/u)/u)uu))/(u(4/19)u)u(4/27)/u(-3/2) assuming u is positive. u(30203/1026) Simplify ((g/(g(g*(1/5)/g)/gg)(g7g)/g)/(g(-18)/g(30/7)))(-24) assuming g is positive. g(-25272/35) Simplify (p(-1)/p(1/8)pp*(-3/5)p(((p(-4)/p)/p)/p)/p)/((p0)(-13)/(((p/(pppppp*(-8)p))/p)/(p*(-9)p))) assuming p is positive. p*(91/40) Simplify ((nn/((n(((n(-1/2)n)/n)/nn)/n)/n)n)/n*(2/11)n*(-1/6)/(nnnn(-1/6)))/((n(-1/4))*15(n*(-2)nn)/(n6n)) assuming n is positive. n(531/44) Simplify ((z(5/8)zz*(-8)z)/(z(2/5)/z)(-3/17))(-4/19) assuming z is positive. z(3727/3230) Simplify ((xx(1/6)xx)/(x0x))(6/5)/((x0)*(4/25)/((xx/(x/(x*(-1)/x)x))/(x(4/9)/x))) assuming x is positive. x(52/45) Simplify (o*(1/8)o(-10/9))18/((o(-3)/(o(-2/13)o))/(((oo(-1))/o)/(o/(o(2/13)/oo)))) assuming o is positive. o(-63/4) Simplify ((((f/f(8/5))/(f/(f/(f5/f))))0)(-4/13))44 assuming f is positive. 1 Simplify (k/(k/((k(2/7)kk)/k))k3)(-9/4)/((k/(k*(1/2)/k)kk)(-3)((kk/(k/(kk(1/4))))/k)(2/13)) assuming k is positive. k(121/182) Simplify ((j(-8)j)/(jj(2/3)))/(j/j(-1)j/j3)((j/j*1j)(-6/5))15 assuming j is positive. j(-80/3) Simplify (k/(k/k(-6/7))k(1/5)k(k/(k(-1)k)k)/k(4/9))/((k(2/7))(23/4)kk/(kk/k*(2/17)kkk)(k(1/4)/k)/k) assuming k is positive. k(14957/3060) Simplify t(3/5)/(t3t)(tt/(ttt0/t))(8/3)(t0/(t/(ttt5tttt)t))/(t0/t)(-3) assuming t is positive. t(79/15) Simplify (((d/d(-1/2))/d(d/(dd(1/3)/d))/d)/((d(-1/5)/d)/d)(-4/27))/(d(2/9)d/(dd*(-1/3)d)(d/d(-2))(5/11)) assuming d is positive. d(-3203/2970) Simplify ((((w/w9)/w)/www(-2)(w/(ww/(w/(w/w0))))(-16/7))(-1/2))(-44) assuming w is positive. w(-1342/7) Simplify (p(3/11)/(p21p)(pp/p0)/p(-26))(3/8) assuming p is positive. p(207/88) Simplify (((tt(-2)/t)/(t/(tt/(tt/(tt/(t(tt/t*(-3/11)t)/t)))t)))/(tt(-14))(4/25))(4/7) assuming t is positive. t(-1312/1925) Simplify ((l/l*(-3)l)(1/30))(-1/3)l(-1/10)/(l/(l(1/6)l))(l/(ll*(-4/7)l))/l(2/5) assuming l is positive. l(-103/126) Simplify (v*31v(-26/5))/(v(4/17)v)12 assuming v is positive. v(933/85) Simplify (q/q(-3)q/((qqq*(1/5))/q)q)/(q(1/3)/q4)((q/q1)/qq*(-5/4)/qq)(-9) assuming q is positive. q(1723/60) Simplify (t0)(3/28)/(t(1/4))(17/6)((((t(-4/5)t)/t)/t)/((t*(-2)t)/tt))(-8) assuming t is positive. t(683/120) Simplify ((m/(mm/(m/(m*(1/33)m))))/((m/m*31)/m)m(2/23)/(((m9/m)/m)/m))(-2/13) assuming m is positive. m(-36518/9867) Simplify ((z*10z(z(1/4)/z)/z)/(zz*47zz(-2/5)/z))(-34) assuming z is positive. z(13039/10) Simplify (zz*(-17)z)*(2/95)(z(-32))17 assuming z is positive. z(-10342/19) Simplify ((o(2/3))(20/7)/(o(-2/17)/ooo(2/21)))25 assuming o is positive. o(17200/357) Simplify k(-18/13)kk*(-21/5)(k/k*(-44)k)/(k/k(-3/47)) assuming k is positive. k(123274/3055) Simplify (o*1o*(2/3)o)/(((((((oo(-6)o)/o)/o)/o)/o)/o)/(o*(-1/4)/oo))(o1)(-11)/(o6oo(-2/9)) assuming o is positive. o(-229/36) Simplify (f(-1/3)f)(-31/3)/(f(-1/3))*(-3/29)(f/f*(2/9)f(2/7))(3/32) assuming f is positive. f(-398939/58464) Simplify (g18g(-18)g*(1/13)gg(-4/5)g)(-22) assuming g is positive. g(-1826/65) Simplify ((v/(v/(v/v*(-6)v)))/v(-5/4))/((v(2/5)v)/(v/((vv/(v/v*(1/6)))/v)))((vv/(v1v))(-18))(1/58) assuming v is positive. v(521/60) Simplify o(-4)/o(o(-2)/oo)/oo(-5)/oo*(-4)(((o*(-2)/o)/ooo)/o(-1/4))(-2/9) assuming o is positive. o(-317/18) Simplify (((oo*(-1))/(o/(oo((o1/o)/o)/oo)))/(oo(-5)o*(-5)/oo))/(ooo*(-2)o*(5/4)o/o*(-4)o/o(-3/5)) assuming o is positive. o(23/20) Simplify ((qq15q)/q)(-15)/(q/(q(-4)/qqq)q(-29)) assuming q is positive. q(-215) Simplify w2w*8w(3/8)/(w/((w3/w)/www))(w10/w(1/7))(-5) assuming w is positive. w(-2067/56) Simplify ((p/(p/(p/(ppppppp(-1/3)p)p)))/p(-7/5))(-38)(p*(-8)p3)19 assuming p is positive. p*(437/15) Simplify (lll(l*(-27)l)/lll*(-8/5)(ll24)/(l/(l/(ll/(l/(ll/(ll/((l/l(-6/5))/l))))))))(-3/4) assuming l is positive. l(27/20) Simplify (((n(-1)n)/(n/(nn2)))/(n(-2/3)n(3/14)))39 assuming n is positive. n(1339/14) Simplify ((g/((gg0)/g))(-37)(g(-2/17)/g)/g5)/(g(7/2)g(-1/4))41 assuming g is positive. g(-11993/68) Simplify ((x(2/7))*(-1/21)/((x/(xxx(x(xx*(4/5))/x)/x)x)/((x/x(-9/8))/x)))10 assuming x is positive. x*(17119/588) Simplify ((qqqq*(-2/17)qqq)/((qq(2/27))/q)(((((q*(-20/7)qq)/q)/q)/q)/q)(-17))(-47) assuming q is positive. q(-13346308/3213) Simplify (z1z/(z*6z))/((z*(2/9)z)/(zz(1/3)))z*(-4)((zz(-1/4)z)/z)/z(z/z3z)/(z/(z(1/4)/z)) assuming z is positive. z(-107/9) Simplify (((r/(r*(-11)rrrr))/r)(2/119)/(r(-1/2)/r)(-22))(-2/9) assuming r is positive. r(1118/153) Simplify (((yy(1/5)/y)/y1)/(y*(3/7)yy(y*(-9)/y)/yy))(-4) assuming y is positive. y(-948/35) Simplify (((u8/u(-2/7))(-40))17)(2/13) assuming u is positive. u(-78880/91) Simplify ((u/u(-11))(-40)uu*(-2/3)u(-5))(-39) assuming u is positive. u18902 Simplify (y/(y/(y/y0)))(-50)/((y/(y/(y(1/8)y)yy)y)/(y/y*0y))(y(-3)/(y/y0))(2/3) assuming y is positive. y(-1219/24) Simplify (ll/((ll/(l/(l(1/3)/l))l)/ll))(-45)(l1)(1/24)((l/(l/l3l))/((ll0)/l))(4/29) assuming l is positive. l(-20659/696) Simplify (((n/((n/(nnn(5/3)/nn))/n)nn*(3/17)n)(5/11))(2/3))(3/2) assuming n is positive. n(1745/561) Simplify ((u(-1))(-13/4))*19(u(1/2))(19/2)/(u/(uu(-1/2))u(2/11)) assuming u is positive. u(724/11) Simplify ((((cc/c(-27))(-4))(4/7))(-39))25 assuming c is positive. c(452400/7) Simplify p*	{ "pile_set_name": "DM Mathematics" }
-93? -93 Let t = 287 + -283. Suppose 19 - 23 = -tk. Which is greater: k or 1/194? k Let w be (12685470/108)/(-29) - (-10)/(-45). Are -4050 and w nonequal? True Suppose 5n = -q + 23, 5n + 5 = 4q + 13. Let g be 6/(-7)(-1218)/q. Let y be 1 + g/(-410) + (-19)/95. Which is smaller: y or 0? y Suppose -4s = 12, -26x + 4s + 17 = -31x. Which is smaller: -14/11 or x? -14/11 Let w = -1.684 + 1.584. Is w >= 385? False Let g be 83 - (8/3(-9)/4 - 0). Is 81 bigger than g? False Let x = -1109/5 + 18973/85. Suppose -8m + 7 = -m. Do m and x have different values? True Suppose 0 = -l + 4a + 16, l = 119a - 121a - 8. Let x be (2 + -2)/(-4 + 2). Suppose xh = -2h. Is h at least l? True Let c be 11 + (-3 + 3)(-2 + 1). Let k = -85 - -20. Let s be 4/(-26) + (-790)/k. Which is smaller: s or c? c Let f = 636 - 623. Suppose -74 = -fn - 841. Which is greater: n or -58? -58 Let p = 10780 + -10784.657. Let r = p - 0.343. Are 0.27 and r non-equal? True Let y be (-314)/(((-8)/(-80))/((-5)/(-25))). Is y > -631? True Let y(s) = -s*2 - 7s - 5. Let r be y(-5). Suppose -3w = -5l - 2w + 47, -15 = -rw. Let j be (-5)/l(-6)/11. Are j and 0 unequal? True Let j = -1174 - -1664. Suppose 0 = 3r + u + j, -170 = 2r - 5u + 168. Is -164 smaller than r? False Let q be 3652/(-198)(-15)/6. Is q at most as big as 45? False Let u(h) = -4h + 5. Let k be u(-4). Let b = k - 24. Suppose 134i + 187 = -483. Is b >= i? True Let q(t) = t3 + 5t*2 - t. Let s = 81 - 86. Let w be q(s). Suppose -3h + wh = 4, h - 70 = -2v. Is 34 > v? False Let y(m) = -m*3 - 14m*2 - 13m + 3. Let p be y(-13). Suppose -5l - 3z - 275 = -4z, -3l - pz = 147. Let b be (-2)/9l/(-612). Which is smaller: 1 or b? b Let m(j) = -10j. Let p be m(-1). Suppose 10 = 5x - p. Let f be (2 - 1) + 1 + (0 - x). Which is smaller: f or 7? f Let a be 2 - 15/(-7) - (-12)/14. Suppose ax + 89 + 76 = 0. Is -15 less than or equal to x? False Suppose -7s = -s - 354. Let f = -54 + s. Suppose -fv + 38 = 4r, -4r = v - 0v - 14. Does v = 33/5? False Let d = 1.23 + -1.281. Let r = 0.289 - d. Let p = -0.44 + r. Which is smaller: p or -38? -38 Let r be 345/(-10695) - 60/62. Is -6/12317 less than r? False Let f(z) = z*2 + 3z - 7. Let y be f(-3). Let w(n) be the second derivative of n*5/20 + 7n4/12 + n2/2 + n. Let d be w(y). Which is bigger: d or 2? 2 Let y be (-80)/760 - (-99)/(-114)4462. Is -3875 bigger than y? False Let g be 2761/66 - (1/6)/(-1). Let x be (-24)/(-28) + 6/g. Is x at least as big as 9/7? False Let k = -11097 - -11086. Which is smaller: -50 or k? -50 Let l = 255 + -4844/19. Suppose 1338 = -j + 495. Let u = j + 842. Is u at most as big as l? True Let z = 112 + -115. Let h be ((-260)/39 + 4)z/28. Let a = -1.1 + 7.1. Is a != h? True Let s = 1/206559 + -29285477/206559. Let h = 142 + s. Let p = 143 - 136. Which is bigger: p or h? p Let u be 124/(-93)((-297)/(-2))/(-3). Let z be (-192)/u + 6 - -1. Which is bigger: 3 or z? z Suppose 2s + 283 = -0s - 3m, 526 = -4s + 2m. Suppose 0 = -4a + 5o - 516, 2a = 5a - 4o + 386. Is a at least as big as s? True Let o be (-1)/(1/14)40. Let s(x) = -20x2 - 48x - 127. Let l be s(-6). Which is greater: l or o? l Let v = 3.973 + 0.027. Suppose -9 = 3u, -2m + 19 = 3u - 16. Let h be m/(-88) - 1/(-4). Which is bigger: v or h? v Let v be 1 + 12/3 + 28/(-14). Let d be (v + (-4 - -2))2. Is 2 greater than or equal to d? True Let j = 0.063 - 60.063. Let h = -59.67 - j. Let t = -0.43 + h. Which is bigger: t or 17? 17 Let a(g) = g*3 + 11g*2 + 9g - 13. Let p be a(-10). Let q(b) = 3b3 - 3b*2 + 2b + 2. Let s be q(-1). Is p > s? True Let f = -4 + -21. Let u = 0 - 24. Let m = f - u. Which is bigger: m or -5/21? -5/21 Let d = 198 + -125. Suppose d = 5t - 2q, -5t = 2q + 3q - 45. Suppose 0 = 6f - t + 1. Which is smaller: 3 or f? f Let n be (-20)/15 - (-32)/6. Suppose 15 = 3y + 3q, -y + 6y - n = 2q. Let w = 116 + -106. Is w at most y? False Let j = -2201 + 2200. Is -1/2259 > j? True Let o = -62229/2 - -31115. Which is smaller: -413 or o? -413 Let j be (1004 - 999)1/(-865)-1. Which is smaller: j or -0.02? -0.02 Let u be ((-12)/(-2) + -4)/((-1431)/42 - -4). Are u and -1 equal? False Let c = -63747/64 - -996. Let p be 396/20 - (-12)/(-15). Suppose -p = 4i + y + 4y, 0 = y + 3. Are i and c equal? False Suppose -3h = 2o - 20 + 7, 0 = -5o + 2h + 42. Let k be (-6)/o + 5/(-21 - -1). Let t be 6/(-7)(-42)/16. Is k less than or equal to t? True Let b be 35774/(-449050) - (27972/(-900) - -31). Which is smaller: 1 or b? b Let l be (-1054774)/(-175812) - (1 - -5). Which is smaller: l or 1? l Let i = -1568 - -2238. Let y = i - 723. Which is smaller: 1 or y? y Let f = 778103/122 - 6378. Which is bigger: -1 or f? f Suppose 0 = -3v + b + 5, 3b - 3 = 2v + 3. Suppose i - 21 = 5n, 0n = vn. Let m = i + -36. Is m less than -15? False Let d = -898 + 1003. Which is smaller: 1 or d? 1 Suppose 256q = 259q - 252. Let r(v) = 31v + 3. Let x be r(3). Let n = q - x. Which is bigger: n or -11? -11 Let c = 64 + -257/4. Let n = -400.743 + 401. Let h = -0.257 + n. Is h >= c? True Let b = -14010 + 126250/9. Let u = 370 + -351. Does u = b? False Let o = -56033/20457644 + 14/5689. Which is smaller: -1 or o? -1 Let x be 12/(-3)1260/75. Which is bigger: x or -68? x Suppose -2k = -4, -k - 8 = 2y - 5k. Suppose 8 = -168940f + 168942f. Suppose 5c - 11 - f = y. Which is greater: -1 or c? c Suppose 31h = 34h + 315. Let o be (2 - -4)/((h/(-410))/7). Is -1 greater than or equal to o? False Let m(w) = -w2 + 29w - 83. Let i be m(41). Let f = i - -571. Is 5/11 greater than f? True Suppose 3j + 703 = -2h, -5h = 5j + 756 + 424. Let v be (-2)/(-11) - 364/j. Let t = -12/11 + v. Is 28 >= t? True Let j = -6481 - -6439. Is j bigger than 32? False Let a = -1 + -4. Let b = 98580 + -496246/5. Let i = b - -664. Which is greater: i or a? a Let a = 2084 - 2212. Which is greater: a or 2/99? 2/99 Let q = 2750/19 - 27523/190. Let d = 65833/95 - 693. Let z = d - q. Which is greater: z or 0? z Suppose 22o = -43o - 14o - 12719. Is o at least as big as -201? True Let g = 2.378 + 934.622. Is g at least as big as -2/9? True Suppose 169 = -y - 5b + 4b, -3y = 5b + 501. Let r be 2/(-3) + y/(-6). Let a = 37 - r. Which is smaller: a or 5? 5 Let a be (-2)/(-6) - (-3 - 32/12). Suppose 2f + 2 = d + 1, -2f + 2d - a = 0. Suppose -2m + fn - 12 = 0, -5m - n = -4n + 20. Which is bigger: 0.6 or m? 0.6 Let y be (3150/1260)/(6/(-196) + 0). Is y < -83? False Let b be -35(2 + -1)/(-10)(-766)/(-70). Which is smaller: -1/3 or b? -1/3 Let k(j) = -j + 154. Let p = -143 + 129. Let r be k(p). Which is smaller: 0 or r? 0 Let y(h) = -22h2 + 217h - 1782. Let o be y(8). Which is smaller: -1451 or o? o Suppose 7t = -36 + 1. Let j be t1 - (-2955)/75. Let s = 2042/55 - j. Is s >= -0.1? True Let y be (220/(-6))/(34/(-357)). Is y not equal to 385? False Let f = -2240 - -4022. Is f >= 1783? False Suppose 2b - 2b + 3b = 0. Suppose -5v + v = 3d - 4272, b = 3v - 4d - 3229. Let q be 6/(-4) + v/(-14). Do -79 and q have different values? True Suppose 12r - 27r = 79r - 113834. Which is greater: r or -1/16? r Suppose 0 = 2m + w - 15, -5m + 10m - w = 20. Let i be (m/4)/(-2 + 18/8). Suppose -4d = -p + ip - 24, 1 = d - 4p. Which is smaller: d or 9? d Let x = -153/134 + 290663/253394. Which is greater: x or 0? x Suppose -3s = 4p - 7, -4s = 3p - 2s - 6. Let b be (6/(-5))/(13132/(-3280) + p). Which is smaller: 327 or b? 327 Suppose r + 669 = -10r - 134. Does r = -120? False Let s(u) = 44u - 7. Let c(t) = 221t - 34. Let f(v) = -2c(v) + 11s(v). Let k be f(3). Let j be ((-4)/(-6))/((-13)/(k/42)). Which is greater: 0 or j? 0 Suppose 15d - 4246 = 11d + 15d. Which is smaller: d or -384? d Let v be ((-337)/(-17))/((-67)/(-1139)). Do 337 and v have the same value? True Let f be ((-1148)/2296)/((-91)/(-2)). Suppose 2 = 3n - 1. Which is greater: f or n? n Let h be 1279/(-6) - (-4 - 1). Let m = -512/3 - h. Which is bigger: m or 0? m Suppose -151 = -2p - 111. Let a be (p/(-3))/((-6)/(14 - -4)). Which is smaller: a or 25? a Let b be ((-1324)/(-2)(-2)/(-10))/(12/(-20)). Is -221 != b? True Let g be 1 + -14/2. Suppose 3a - 3c + 18 = 0, -3a + c - 6 = 4. Let q be 267/(-855) + (a - 14/(	{ "pile_set_name": "DM Mathematics" }
0 Solve 1537w - 1589w - c - 250 = 0, 5w = 3c - 55 for w. -5 Solve 6h + 518433w + 13 = 518434w, w = 2h + 1 - 0 for h. -3 Solve 4f + 7r = -43, -32 + 57 = -7f + r + 16 for f. -2 Solve -52j + z + 21 = -29j - 21j, 15 = -3z for j. 8 Solve 8 = -24925n + 24929n - o, 0 = -4o - 16 for n. 1 Solve -20i + w - 360 = 0, 3i + 4w - 2022 = -2076 for i. -18 Solve 0 = -y + 3144z - 3145z - 11, 4y + 19z = -14 for y. -13 Solve 8l - 12l - 189 = -5f + 112, 0 = 3f - 893l + 892l - 175 for f. 57 Solve 0r - 7r - 26 + 68 = -11r - 10b, -2r = -2b - 14 for r. 2 Solve 11w - 7w - 33t - 327 = 156, -t = -3w + 6 for w. -3 Solve -5k - 12 - 38 = -5t, k = 655t - 645t - 100 for t. 10 Solve 5z = 5r + 18 + 17, 2 - 17 = -r + 6z - 37 for r. -4 Solve 24p + 4114 - 4210 = 0, -3l + 2p + 7 = 0 for l. 5 Solve 0 = 5v + 4i - 27, 87 - 70 = -0v + 7v + 3i for v. -1 Solve -20c - 4c = -72, -3w - 2560 + 2584 = 2w - 2w + 3c for w. 5 Solve 4s - 4s = 2r + 1400 - 1402, -4r + 22 = 3s - 0r for s. 6 Solve 257 = -2x + 5i + 297, 3i = 0 for x. 20 Solve -4k = -12i - 68, 4890i + 1 = 2k + 4873i for k. 26 Solve 4t - 129h + 62h + 63h + 76 = 0, 4h = -3t + 76 for t. 0 Solve 2l - 3d + 208 = 48l - 53l, 0l - 3l + 2d - 87 = 0 for l. -31 Solve -1715n - 36 = -1714n - 3o, 0n - 7n - 11o + 10o = -34 for n. 3 Solve -7q + 4q - 2 = q - 3q + 3, -2g - 5q - 41 = 0 for g. -8 Solve -2n - 5l - 97098 = -97144, 0 = n - 3l + 32 for n. -2 Solve 7f + 24s - 10 = 22s, -17f + 8f + s - 5 = -5f for f. 0 Solve -5g - 11o - 25 = 0, -g + 31 = -148o + 143o for g. 6 Solve -271705r = -2o - 271710r - 50, -2o + 3r = -46 for o. 5 Solve -3b - 8 = 7u - 6 - 20, -u + 2b - 12 = 0 for u. 0 Solve 27 = a - 4v, -2v + 3091 - 3096 = -9a for a. -1 Solve 0 = 795o - 799o + 124, 5p - 79o = -2459 for p. -2 Solve -70l + 165 = 8a - 69l, 54 = 3a - 2l + 5l for a. 21 Solve m - 15v + 17v + 13 = 0, -7m = -12m - 5v - 51 + 11 for m. -3 Solve 5o - 4h - 63 = -266, 4h = 225o + 6690 + 2093 for o. -39 Solve 0 = 766c - 760c + n - 40 - 1, -5c + 695 = 11n for c. -4 Solve 0 = -4b + 3k + 139 + 150, b + 3b + 3k - 319 = 0 for b. 76 Solve -78z - 3r + 66 - 192 = 0, 0 = 5z + 3z - 3z - r + 20 for z. -2 Solve -82h - 15h - 164 = -683y + 686y, -3y = h - 28 for h. -2 Solve 2c + 344 - 416 = 10r, 0 = 2c - 2r - 0r - 16 for c. 1 Solve 34j + 1254 = -2w, -179 = 5j - 179w + 182w for j. -37 Solve -4m - 200 = 20t, -4m - 100t + 106t = -86 for m. 5 Solve 2x - 9d = 3, 199x - 200x + 17d - 2d + 1 = 11d for x. -3 Solve 88 = -3c - 7x, 47x - 29 = c + 45x - 4 for c. -27 Solve -758r + 763r = -8h - 321, 12 = 5r - h for r. -5 Solve -380u + 372u + 141 = -5g, -3u + 50 = g for g. -1 Solve -2k - 54 = -2h, 5k + 2h = 14749 - 14849 for k. -22 Solve 0b - b - 14 = -0w - 4w, -68w + 3b + 54 = -52w for w. 3 Solve 3v + 28510a - 28511a = -37, -v - 5a = -233 for v. 3 Solve -3r - 15 = -6t - 5 + 5, 10 = 2t for r. 5 Solve -2c = 2z + 74, 287767c + z + 4z - 167 = 287773c for c. -32 Solve 34 = -5y + f, 30f + 176 = 9y - 8f + 201 for y. -7 Solve 0 = 7x - 5n + 6n + 3 - 15, 225x - 3n + 36 = 287x for x. 0 Solve -45 = -2u + 2463q - 2468q, u = 2q - 27 for u. -5 Solve -5u - 5w - 74 = 7u + 57, -334w + 110 = -10u - 338w for u. -13 Solve 0 = -8p + 5j - 81, -2j + 103 - 156 = 9p for p. -7 Solve 9b + 196 = 10b + 3b + 5y, 5b = -5y + 200 for b. 4 Solve -3q - 107 = 2d, 47q + 195 = 42q + 2d + 3d for q. -37 Solve -13d - 61z - 44z = -110z - 127, 4d - 61 = 3z for d. 4 Solve 74c = 82c + 2r + 172, 23c + 5r = 20c - 73 for c. -21 Solve 3b + 3k = 6, -58084 + 58080 = -4b - 5k for b. 6 Solve k - 2 = 2s, -8k = -0k - 9k - 6s - 22 for k. -4 Solve 0 = 3c - 4p - 49, -c - 2p = -9861 + 9888 for c. -1 Solve 5n + 5d - 90 = 0, 21n = -5d + 208 - 86 for n. 2 Solve 24k + 440 = -4m, -5k - 3m - 4 - 99 = -7 for k. -18 Solve 4v - v + 561 = 96k, 3k + v + 18 - 12 = 29 for k. 6 Solve -3f + 40p - 36 = 42p - 23, 0 = -5f + 8p + 1 - 0 for f. -3 Solve 9b + 23 = -2g, 2g = -34b + 32b + 12 for b. -5 Solve 3n = y + 12, -70n - 64n = -145n - 5y + 44 for n. 4 Solve -1055u - 5l = -1053u + 42, 0 = 6u + 5l + 166 for u. -31 Solve 2l - 217 = 51f, -3l - 3112f + 3110f - 67 = 0 for l. -19 Solve -7885 + 7905 = 2m - m + 3a, -5m + 0a + 2a = 2 for m. 2 Solve 40417 = 5i + 2s + 40379, 25s = -i + 229 for i. 4 Solve 4420419c = 4420414c - m + 23, 0 = -3c - 5m + 27 for c. 4 Solve 2z - 52 = m - 85, -59z + 3m - 1106 = 0 for z. -19 Solve 39l + 3i + 7 = 61l - 21l, -i + 19 = -3l for l. -8 Solve 2v - 70 = -y, -63y + 137y + 175 = 5v + 69y for v. 35 Solve 0 = -2r - 5m + 24, -72r + m = -73r + 15 for r. 17 Solve -2668s + 2666s = -5i + 227, s - i = -112 for s. -111 Solve 4g - u - 29 + 139 = 61, -6g + 0g = -9u + 291 for g. -5 Solve 14q = 5h + 8q + 76, -3h + 5q - 52 = q for h. 4 Solve -6s + 630 - 526 = -5u, 0 = 4s + 6u + 80 for s. 4 Solve -29h = -5k - 82, 2h + 6993 = 6999 for k. 1 Solve -2x + 68 = -299i + 348i - 6, -2 = 5i + x for i. 2 Solve 5m - 2h - 730 = -631, -4m = -2h - 96 for m. 3 Solve 5m = 37r + 94, r + 10m - 197 + 159 = 0 for r. -2 Solve 84 = 4t - 6y, t - 4t + 297 = 19y - 43y for t. 3 Solve -8t - 2i = -10, -1115i + 436 = -t - 559i - 596i for t. 4 Solve -136071g + 136067g = 41k - 185, 5g = -k - 20 for k. 5 Solve -5n + 57 = 4h, 163h = 86h + 73h + 4n + 84 for h. 18 Solve -90o + 3z - 887 = 4z - 870, 0 = -5o + z + 17 for o. 0 Solve -2448 + 2442 = -x, 64 = -4v + 10x for v. -1 Solve -5y + 101 = -13d, 2d + 38 - 22 = y for d. -7 Solve -9728h + 9729h + 30 = -4a - 17, 2 = 5a - h for a. -5 Solve -8o + 10o + 54z + 5 = -3o + 53z, 10 = -2z for o. 0 Solve -5383v - 4q = -5381v + 2, q = 0 for v. -1 Solve 0 = -4f + 173z - 82z - 87z - 24, 9 = -2f + 5z for f. -7 Solve -g + 5p - 72 = 4p - 51, -161g + p - 821 = 0 for g. -5 Solve 5u - 30 = 4d, 843d + 30 = 5u + 832d for u. 6 Solve 0 = -4x - 5k + 1 + 1, 158k - 154k - 518 = -526 for x. 3 Solve 0 = -5u + 10, -2j - 3046 = 4u - 6083 + 3041 for j. -6 Solve 8m + 21 = -9b + 13m - 69, 4b - 10m = -180 for b. 0 Solve -2h = 2h - 4t + 27 + 257, -10t - 23 = -4h - 301 for h. -72 Solve -3k - 45 = 0, -7a + 2a - 4k + 6 = 3k - 5k - 7k - 59 for a. -2 Solve -10523c + 10527c = 3t - 80, 0 = 247t + 4c - 6920 for t. 28 Solve -i - 1379 = -3x - 1374, 2 = -5x - 10i + 15i - 3 for x. 3 Solve 20w + 257d = 96d + 157d + 84, 3d = w - 17 for w. 5 Solve 4g - 6 = -5r, 0 = 94r + 81g - 83g + 196 for r. -2 Solve 6g - 13f + 9f + 0 - 1 = g - 9f - 11, -7f = 35 for g. 3 Solve -5m - 4d + 48 - 127 = 0, 395m = 416m - 2d + 407 for m. -19 Solve 124 = 2w - 19j, -100237j + 15 = -3w - 100242j for w. 5 Solve 7v = 420d - 409d + 58, 5d + v + 18 = 0 for d. -4 Solve 2h + 2x + 2x + 20 = 0, -982x + 978x - 32 = 8h for h. -2 Solve 0 = 4n + 11 + 13, 81n - 95n + 35 - 111 - 22 = -2o for o. 7 Solve 5c - 70 = -5v, -339 = -v - 4v + c - 323 for v. 5 Solve 0 = 155771f - 155759f + 3g + 42, 4f - 5g + 2 = 0 for f. -3 Solve 25n + 691 = -3w, 5n + 4w + 134 = 6 for n. -28 Solve j = 3q + 35, -4q - 46 = -832j + 830j for q. -12 Solve -d - 5 = -y, y - 94d + 262 = 4y + 359 + 373 for y. 0 Solve -5m - 21723 = -557t, -81 + 198 = 5m + 3t for m. 0 Solve -5a = d - 4, -205a + 292a = -d + 168 for a. 2 Solve -869a = -868a + 4d + 23, 3a + 8d = -65 for a. -19 Solve m - 5k - 1 = 0, 851m + 851m = 1700m + 2k - 14 for m. -9 Solve -6s + 12 = -3f + 5f, -6s + 205480f - 205475f + 54 = 0 for s. 4 Solve 0 = 4j + 4g - 8, 2j + g = -3948 + 3952 for j. 2 Solve -9491 = -2l + 4s - 9513, -l = -6s + 19 for l. -7 Solve -4b = -3k - 494, 5b + 486 = 2b - 65k + 722 for b. 122 Solve 5p = -u - 16, -3p - 4540u + 4535u - 14 - 22 = 0 for p. -2 Solve f - 289c = -290c - 1, 3f = f - 6c + 3c - 3 for f. 0 Solve -8x + 3x = -5d, 4d + 19x - 7x = 11x - 13 - 12 for d. -5 Solve 0 = -k + 4r - 27, -95r - 66 + 534 = k for k. -7 Solve -3s - 284 = 146444f - 146436f, 164 = 3s + s - 4f for s. 4 Solve w + 12n + 10n = 17n + 3, 30w + 8n + 200 = 3n for w. -7 S	{ "pile_set_name": "DM Mathematics" }
12 and 16330 equal? False Do 1172621 and 1172623 have the same value? False Which is smaller: -1 or -265672? -265672 Which is smaller: 49/867025 or -1? -1 Which is greater: -68562 or -67900? -67900 Do 65705801 and 65705801 have different values? False Is 101367726 greater than or equal to 101367724? True Is -0.015314 != 392? True Is -295670 smaller than -5322085/18? False Which is greater: 7058098 or -1/10? 7058098 Is -723084 < -723108? False Which is smaller: 7310667/23 or 317855? 317855 Which is bigger: 40245 or 40235? 40245 Which is greater: 1914.77751 or 0.01? 1914.77751 Is -61/2 at most as big as 5053253? True Which is bigger: -1 or 3/8999392? 3/8999392 Which is smaller: -1 or 15/111891931? -1 Which is greater: -2952 or -41.42? -41.42 Which is smaller: 31 or 21086/711? 21086/711 Which is smaller: 24344 or 24139? 24139 Which is greater: 0.1985633 or 0.015? 0.1985633 Are 83 and 137750 nonequal? True Is 2/175617369 bigger than 0? True Is -5190/2261 equal to 1? False Is 11/19036 <= 0.07? True Is -4 less than -6465/2002? True Which is greater: -972431 or -972429? -972429 Which is smaller: -7 or 1168238? -7 Which is smaller: -8917 or 5092? -8917 Which is bigger: -1 or -4/64294787? -4/64294787 Is 7845 smaller than -6680? False Is 1 not equal to 894/2054455? True Which is smaller: -436135/22 or -19825? -19825 Is -12664 bigger than 3705? False Which is greater: 18865/2764 or 8? 8 Is 11315843 greater than or equal to 181053495/16? False Which is smaller: -2618/4413 or 3/2? -2618/4413 Is -112067886 less than -112067886? False Which is bigger: 1 or 390/69067? 1 Which is smaller: -0.248 or 689674? -0.248 Which is bigger: -22040347 or -22040349? -22040347 Which is greater: -4021729 or -52282472/13? -52282472/13 Do -5586 and 0.5678 have different values? True Is -51306 smaller than -2206179/43? False Is 118331380 equal to 118331382? False Do -13855233 and -13855233 have the same value? True Is -5981937 less than or equal to -41873558/7? True Is -12/872453 <= 1? True Is 3342595 smaller than 0.3? False Is 2737948 greater than or equal to -0.5? True Which is greater: -2458 or 21493? 21493 Is -4/23100017 > -1? True Is -8055335 < -8055334? True Is -19 >= 572574? False Is 62353548 <= 62353547? False Is 9019917 <= 9019934? True Which is smaller: -3128075 or -3128079? -3128079 Is -2466162 less than -44390939/18? False Is 723260/113 less than 6402? True Is 981375/76 greater than or equal to 12912? True Is 13295 bigger than 199406/15? True Do 53712255 and 53712254 have the same value? False Is -72783 less than -577? True Which is smaller: -1137997 or -145? -1137997 Which is smaller: -570013/1835 or -311? -311 Do 1828 and 418436/229 have the same value? False Which is smaller: -197346 or -2.432? -197346 Are 0 and -16/1368353 equal? False Which is bigger: 2151719 or 2151725? 2151725 Do -1 and 17/1017315 have different values? True Is 9 smaller than -78/2701? False Which is greater: 1 or 1557/97952? 1 Which is smaller: -2/89187371 or 0? -2/89187371 Is 222919 greater than or equal to 1158? True Which is smaller: 519 or 179397/346? 179397/346 Is -6021 > 116710? False Which is bigger: 56900482 or 56900485? 56900485 Which is smaller: 7852697 or 102085068/13? 7852697 Are 20333308 and 20333309 unequal? True Which is smaller: -4310920 or 5? -4310920 Are 14.469272 and -4 unequal? True Which is smaller: 1/4 or 6627256? 1/4 Which is greater: 899 or -14126? 899 Which is greater: 9551771 or 57310625/6? 9551771 Which is bigger: 2512/215141 or 0? 2512/215141 Do -51.335 and 756 have the same value? False Which is smaller: -73947746 or -0.1? -73947746 Which is bigger: -3.83 or -61273? -3.83 Is -45.2 less than 213751? True Is 21866 <= 2654? False Which is greater: -2860962/557 or -5136? -5136 Is -10551103 less than -10551109? False Which is smaller: -95347/83 or -1148? -95347/83 Do -124/13503899 and -1 have different values? True Which is smaller: 823/111310 or -1? -1 Is 15537830 greater than or equal to 15537861? False Are 530 and 11186 equal? False Is 43/4 <= 328772? True Which is greater: 1555277 or 1555314? 1555314 Which is greater: 1 or 89/20021? 1 Is 3890958 <= 3890979? True Is 1/5 bigger than 11571663/7? False Which is smaller: 0 or -74283017? -74283017 Is -35864 less than or equal to -36590? False Which is bigger: 1 or -4/10144297? 1 Is -309944464 equal to -309944465? False Which is bigger: 3911/561 or -1/4? 3911/561 Which is greater: 1 or 26/19531591? 1 Do -2/2247 and 69793 have different values? True Is -21334/49 greater than -435? False Is 143627 less than 143631? True Which is smaller: -53411/199 or -269? -269 Which is bigger: -15/40954127 or 0? 0 Are 69/5 and 5.5578 unequal? True Is -153/1269641 > -1? True Is -46/726485 < -1? False Which is smaller: -142838 or -962? -142838 Which is smaller: -1 or 1742/1204591? -1 Is -35/59049198 greater than or equal to 1? False Which is bigger: 1080 or 8880? 8880 Is -22538603 greater than or equal to -22538600? False Is 31059344 >= 31059345? False Is -655948 at most as big as -656356? False Is 23224307 at most as big as 23224307? True Are -2/36754069 and -1 non-equal? True Which is smaller: 6/59715703 or 1? 6/59715703 Is 198 at least -1163068? True Which is greater: -914531 or -2/3? -2/3 Which is smaller: -9316 or 37019? -9316 Is 24/10235905 at most as big as 0? False Is -6/3372167 > 0? False Which is greater: 38 or -24.75? 38 Is 0 > 2987/3703? False Is -455315 not equal to -455319? True Which is bigger: 1233 or -1708? 1233 Is -2023 < 0.4287? True Does -2/4166407607 = 0? False Is 177529443 not equal to 177529444? True Is -2329258 less than or equal to -2329183? True Is -48/169 equal to -3852? False Which is greater: 768899 or 769736? 769736 Is 7422 bigger than 9540? False Is 123892437 smaller than 123892436? False Which is greater: -69678017 or -69678018? -69678017 Is 9/55902079 greater than 1? False Which is smaller: -26039 or -4612? -26039 Which is greater: 9196409 or 3? 9196409 Are -2947511 and -120847956/41 equal? False Is 9920.62 less than 8? False Which is smaller: -69051388 or -69051385? -69051388 Which is bigger: -116/1174777 or 0? 0 Do 13087156/3 and 4362384 have different values? True Which is bigger: -10 or -61340/6117? -10 Which is greater: -53453/641 or -82? -82 Is -1328561 at most as big as 7? True Which is greater: 971677 or 2915027/3? 971677 Is 2628453 less than 2628451? False Is 1 less than -202/203703? False Is -2276829 less than -2276952? False Which is bigger: 791673 or 791667? 791673 Is 2203 > 238? True Which is smaller: -0.4 or -14267001? -14267001 Which is bigger: 0 or 1/4005709395? 1/4005709395 Is -6521 less than -21728? False Is 685/1912 at most 125? True Which is greater: 1.474 or -18283? 1.474 Which is smaller: 78933 or -450.2? -450.2 Do -7926 and -4752 have different values? True Does 100 = 668132? False Which is greater: 1 or 3/265132? 1 Is -8297 at most as big as 4430? True Is 23834125 bigger than 23834125? False Which is smaller: -125534 or -2? -125534 Which is smaller: 2463906 or -9? -9 Which is smaller: -2/7625 or 1/2819? -2/7625 Is -1 <= 391/63813? True Which is bigger: 0 or -2/146445667? 0 Which is greater: -1271591 or -1271593? -1271591 Are 14836001 and 103852011/7 non-equal? True Which is bigger: -74597441 or -74597445? -74597441 Which is smaller: 88715342 or 88715340? 88715340 Which is smaller: -10.6494 or -1/176? -10.6494 Which is greater: 109656 or 3070371/28? 3070371/28 Are -292/3248387 and -1 unequal? True Is -1817529 at least -1817392? False Are -57843420 and -347060519/6 non-equal? True Which is smaller: 6266032 or 6266034? 6266032 Is -8644 at least -3209? False Is 40275 >= 28349? True Which is smaller: -0.8 or -100539040? -100539040 Which is smaller: -447/95 or -783? -783 Is 16463919 >= 16463920? False Is -18334280 smaller than -18334289? False Which is smaller: 178562 or 179155? 178562 Which is greater: -266851558 or 1/5? 1/5 Is -301179/38 greater than or equal to -7926? True Which is bigger: 61855526 or 61855529? 61855529 Which is greater: 2 or 756419.29? 756419.29 Which is greater: 689897 or 689105? 689897 Is 275220 at most as big as 275418? True Which is smaller: -1 or -9/56847169? -1 Is -3 < 24592062? True Are 15985778 and 15985777 nonequal? True Which is greater: 141218237 or 141	{ "pile_set_name": "DM Mathematics" }
45v - 6213. Calculate b(-14). 17 Let z(l) = -l2 + 25l + 153. Calculate z(-5). 3 Let v(b) = 10b3 - 6b*2 + b + 3. Determine v(-1). -14 Let q(j) = 2j*3 + 11j*2 + 12j + 11. Determine q(-4). 11 Let a(i) = i*3 + 73i*2 - 236i - 6. What is a(3)? -30 Let j(t) = -t*3 - 8t*2 + 17t + 98. What is j(-5)? -62 Let h(j) = -j*2 - 52j + 332. Calculate h(6). -16 Let w(j) = 67j2 + 117j - 260. Determine w(-3). -8 Let s(k) = 3k2 + 81k + 85. Calculate s(-27). 85 Let j(o) = -o*2 + 126o + 1809. Give j(-13). 2 Let o(y) = 36y + 59. What is o(-4)? -85 Let z(v) = 108v - 199. Give z(2). 17 Let i(m) = -m*2 + 34m - 175. Calculate i(28). -7 Let x(z) = -5z2 - 161z - 162. Determine x(-1). -6 Let q(j) = j*3 - 117j*2 + 234j - 408. Calculate q(115). 52 Let o(x) = x*3 - 20x*2 - 95x - 45. Determine o(24). -21 Let c(x) = -38x2 - 66x + 2. Give c(-5). -618 Let o(q) = -q*2 - 23q + 130. Calculate o(4). 22 Let j(a) = a*2 + 274a + 3144. Determine j(-12). 0 Let d(r) = r*3 - 33r*2 - 77r + 411. Give d(35). 166 Let v(l) = -l*3 + 19l*2 - 43l + 51. What is v(16)? 131 Let x(b) = -3b2 - 159b - 170. What is x(-52)? -14 Let v(x) = -47x + 868. What is v(18)? 22 Let o(h) = -h2 - 30h + 452. Calculate o(9). 101 Let k(w) = 5w - 166. Calculate k(0). -166 Let y(z) = -3z*2 - 48z - 12. Give y(-15). 33 Let f(k) = k*2 - 60k + 753. Determine f(16). 49 Let r(y) = -25y + 26. Calculate r(9). -199 Let z(u) = 10u*3 + 2u*2 - 20u - 30. Give z(-2). -62 Let t(j) = 10754j - 516186. Calculate t(48). 6 Let p(q) = 7q*2 + 15q + 71. Calculate p(-6). 233 Let h(w) = -172w2 - 3w - 1. What is h(-1)? -170 Let k(t) = -4t3 + 74t*2 - 37t - 40. Give k(18). -58 Let m(v) = v*3 - 16v*2 + 12v - 22. What is m(12)? -454 Let g(a) = 375a - 656. Give g(2). 94 Let x(q) = q3 + 2q*2 - 10q + 24. Give x(-3). 45 Let j(w) = -w*2 - 103w - 1012. Calculate j(-11). 0 Let m(u) = -17u2 + 3666u + 1274. Calculate m(216). -22 Let a(s) = -s*2 + 12s - 39. Determine a(12). -39 Let t(k) = k*2 + 170k - 1623. What is t(9)? -12 Let i(n) = -102n + 1533. What is i(15)? 3 Let c(i) = -15i - 126. Calculate c(8). -246 Let m(x) = -8870x + 26605. What is m(3)? -5 Let q(v) = 33v - 1898. What is q(57)? -17 Let q(p) = -p*3 - 25p*2 - 149p + 3. What is q(-10)? -7 Let c(a) = 1306a + 9148. Give c(-7). 6 Let s(d) = -d3 + 10d*2 - 31d - 9. Determine s(5). -39 Let y(t) = -2t2 - 31t + 204. What is y(5)? -1 Let a(z) = -5z3 - 3z*2 + 11z + 10. Give a(-5). 505 Let h(s) = -69s3 - 64s*2 - 66s - 1. What is h(-1)? 70 Let s(k) = -9k + 258. Determine s(33). -39 Let k(d) = 3d*2 + 15d + 2. Give k(-4). -10 Let i(f) = -2689f - 107554. Give i(-40). 6 Let g(z) = 3z*2 + 29z + 138. Calculate g(-7). 82 Let l(r) = -454r + 7712. What is l(17)? -6 Let v(b) = -2b*2 + 15b. Determine v(-6). -162 Let x(i) = -i*2 - 79i - 1064. Give x(-61). 34 Let m(d) = d*3 - 13d*2 - 54d - 45. Determine m(-2). 3 Let s(g) = 2g2 - 218g - 6050. What is s(-23)? 22 Let x(s) = s*3 - 32s*2 + 34s - 71. Calculate x(31). 22 Let b(l) = -108l + 384. Calculate b(4). -48 Let g(m) = -2m*2 + 507m - 3010. Calculate g(6). -40 Let x(w) = -373w + 23871. Calculate x(64). -1 Let w(g) = g2 - 7g - 21. Determine w(-12). 207 Let a(l) = l*3 - 8l*2 + 11l - 33. What is a(6)? -39 Let k(s) = -49s + 10038. Determine k(205). -7 Let l(r) = -9r*3 + 1390r*2 - 612r - 619. What is l(154)? -3 Let u(t) = 2t2 - 42t + 306. Calculate u(13). 98 Let r(n) = n*3 - 6n*2 - 2n + 22. Calculate r(2). 2 Let b(j) = -312j + 8439. Determine b(27). 15 Let s(j) = j2 + 26j - 182. What is s(-31)? -27 Let g(z) = 56z2 - 304z + 607. Determine g(2). 223 Let v(b) = 3b2 + 49b - 30. What is v(-17)? 4 Let j(x) = 20x - 1178. Determine j(59). 2 Let t(c) = 15c*2 - 79c - 36. Give t(5). -56 Let i(v) = v*3 + 6v*2 + 16v + 51. Calculate i(-5). -4 Let b(v) = -2v2 + 31v - 32. Give b(6). 82 Let b(z) = -z*3 + 38z*2 - 5z - 1268. Give b(37). -84 Let h(w) = -w*2 + 4w + 70. Give h(-8). -26 Let l(b) = 17b2 - 118b - 750. Calculate l(-6). 570 Let d(p) = p*2 - 15p - 214. Determine d(-10). 36 Let f(k) = 88k + 373. Determine f(-4). 21 Let j(m) = -m2 - 616m - 2457. Calculate j(-4). -9 Let t(p) = 225p2 - 8p - 8. What is t(-1)? 225 Let t(g) = 2707g - 2669. What is t(1)? 38 Let g(y) = y2 - 75y + 17. Give g(75). 17 Let l(b) = 6b - 115. Calculate l(-10). -175 Let u(d) = 4418d - 44153. Give u(10). 27 Let n(v) = 513v + 10776. What is n(-21)? 3 Let h(v) = -v3 + 205v*2 + 411v + 625. Determine h(207). 4 Let u(m) = -m - 56. What is u(14)? -70 Let n(s) = 383s - 402. Give n(1). -19 Let m(t) = -40t + 578. Give m(15). -22 Let z(s) = 25s + 1252. What is z(-76)? -648 Let i(r) = 13r*3 - 18r*2 + 14r - 15. What is i(1)? -6 Let c(k) = -k*3 - 7k*2 - 7k + 34. Determine c(-4). 14 Let g(w) = 20w2 - 227w + 90. Calculate g(11). 13 Let a(w) = -w*3 - 33w*2 - 41w + 650. What is a(-31)? -1 Let y(h) = -964h - 955. Determine y(-1). 9 Let w(z) = -196z - 1324. Give w(-5). -344 Let d(x) = -x*3 + 9x*2 + 13x + 262. Give d(12). -14 Let c(l) = -2l2 - 110l - 1001. Calculate c(-10). -101 Let n(q) = -31q - 628. Calculate n(-20). -8 Let z(v) = v2 + 86v + 1247. What is z(-68)? 23 Let s(z) = -6z2 - 208z - 1373. Determine s(-9). 13 Let c(p) = -2p3 - 8p*2 - 8p - 62. Determine c(-4). -30 Let v(l) = -4l - 54. What is v(7)? -82 Let h(q) = 81q + 558. Give h(-7). -9 Let y(x) = -28x - 1122. What is y(-34)? -170 Let j(m) = -6m - 217. Determine j(-40). 23 Let w(i) = 2i2 - 13i - 45. Calculate w(10). 25 Let m(h) = 2h3 + 12h*2 + 26h + 44. Determine m(-4). 4 Let s(d) = 1645d - 37822. Calculate s(23). 13 Let y(t) = 3t*2 - 325t + 8730. What is y(49)? 8 Let f(u) = u*2 - 562u - 7469. Determine f(-13). 6 Let p(n) = n*2 + 125n - 254. Calculate p(2). 0 Let z(u) = u*2 - 2424u + 50466. Calculate z(21). 3 Let h(w) = -5w2 - 424w + 2566. Give h(6). -158 Let v(j) = -j*3 + 3j*2 + 76j - 22. Give v(10). 38 Let d(f) = -13f2 + 93f - 128. Give d(5). 12 Let z(s) = 11s - 66. Give z(12). 66 Let n(l) = -352l + 719. Give n(2). 15 Let f(j) = -95j - 691. Give f(6). -1261 Let c(i) = 89i*2 - 37i - 75. Give c(-2). 355 Let r(c) = c*3 + 70c*2 - 202c + 1231. What is r(-73)? -10 Let i(h) = -24h - 709. What is i(-29)? -13 Let q(x) = x2 - 68x - 202. Determine q(-3). 11 Let g(y) = 3y2 + 97y + 123. What is g(-34)? 293 Let y(b) = b*2 + 12b - 70. What is y(-20)? 90 Let k(x) = -x*2 - 2x + 11. What is k(0)? 11 Let q(i) = -96i + 7407. Determine q(77). 15 Let y(g) = g3 - g2 - 31. Determine y(0). -31 Let v(d) = 204d + 2664. Determine v(-13). 12 Let y(w) = 19w - 838. Determine y(44). -2 Let k(q) = 3q*3 + 62q*2 + 34q - 108. Give k(-20). 12 Let x(u) = u*3 - 32u - 14. Determine x(6). 10 Let m(r) = 53r - 740. Calculate m(14). 2 Let c(j) = -4j - 33. Calculate c(-39). 123 Let x(z) = 3z3 + 5z*2 - 18z + 14. Calculate x(5). 424 Let b(a) = a*3 - 4a*2 - 24a - 1. Calculate b(7). -22 Let x(j) = -j*2 + 21j + 145. Give x(-8). -87 Let k(t) = -t*3 + 58t*2 + 753t + 8. Calculate k(69). -406 Let c(i) = -18i2 + 146i + 8. Give c(7). 148 Let y(s) = 562s - 2288. What is y(4)? -40 Let g(b) = 44b - 540. What is g(13)? 32 Let b(h) = h*2 - 2299h - 53408. Give b(-23). -2 Let s(q) = 4220q + 16886. What is s(-4)? 6 Let i(k) = k2 + 142k + 142. Give i(-141). 1 Let n(p) = p*3 - 10p*2 + p + 57. What is n(9)? -15 Let m(n) = -91n - 403. Give m(-3). -130 Let l(v) = -v*2 - 39v - 294. Calculate l(-28). 14 Let h(i) = -i*2 + 29i - 10. Calculate h(29). -10 Let b(n) = 2024n - 2056. Determine b(1). -32 Let l(q) = -6q*3 + 8q*2 - 31q - 5. Give l(5). -710 Let y(c) = -105c - 99. Give y(1). -204 Let b(j) = j2 - 10j - 1357. Give b(42). -13 Let a(m) = -48m2 - 3m + 1. What is a(1)? -50 Let i(c) = 9c - 573. What is i(65)? 12 Let a(m) = 58m + 228. Give a(-4). -4 Let j(l) = 15l2 - 1886l + 1375. Give j(125). 0 Let w(b) = -488b + 1391. Calculate w(3). -73 Let w(g) = 2g*3 - 82g*2 + 91g - 431. Give w(40). 9 Let k(u) = u*3 + 6u*2 + 13u. What is k(-5)? -40 Let h(l) = -3l3 - l2 - 5l - 1. What is h(-5)? 374 Let l(v) = 26*v + 109. Give l(-13	{ "pile_set_name": "DM Mathematics" }
er. 2, 1, z Let p(o) = -o*2 + 5o + 3. Let j be p(5). Suppose -2z - 3v - j = 0, z + v - 9 = 2z. Sort z, 5, -4 in decreasing order. 5, -4, z Suppose 0 = -2x - 1 - 9. Suppose 0 = 8i - 202 - 134. Suppose -iy - 7 = -35y. Sort x, y, 4. x, y, 4 Let z = 79 - 73. Put -1, z, 4 in ascending order. -1, 4, z Let f = 7.79 - 7.5. Let c = 0.19 - f. Sort c, 1/3, 0. c, 0, 1/3 Let f = -0.086 - -0.926. Let q = f + -2.84. Put -2/9, 1, q in decreasing order. 1, -2/9, q Let h = 10 + 7. Let c = 15.92 - h. Let i = c - -0.08. Sort i, 17, 0.1 in decreasing order. 17, 0.1, i Let z = 0.5 + -5.5. Let u = -2038 - -2035. Put z, 2, u in descending order. 2, u, z Let g = 8.6 + 0. Let w = 13.6 - g. Sort 3, -1, w in descending order. w, 3, -1 Let w(l) = 3l*2 - 54l + 56. Let o be w(17). Let x(v) = v*3 + 4v*2 - 4v + 4. Let j be x(-5). Sort -4, 2, o, j in increasing order. -4, j, 2, o Let q = -2189 - -2185. Let d be -11 + (3 - (-1)/(-1)). Put q, d, 0, 4 in increasing order. d, q, 0, 4 Let u = -67 + 71. Suppose 5z - 20 = 0, -5m + 40 = uz + z. Put m, -4, 1 in decreasing order. m, 1, -4 Let v = -8 - -5. Let d be 2/(-4)(5 + 3). Let f = -191 + 191. Sort d, f, v in decreasing order. f, v, d Suppose -2l + 1 = 15. Let h = -9 + 10. Let r be -3(-7)/42(3 - h). Sort l, r, 4 in increasing order. l, r, 4 Let x(o) = o3 + 3o*2 - 6o - 5. Let l be x(-4). Let r(u) = -u*2 + 14u - 13. Let t be r(13). Sort l, 1, t in descending order. l, 1, t Suppose 11 = 5x - 29. Suppose 4z - 5 = 5j, 0z = -3j - z - 3. Put 0, j, x in decreasing order. x, 0, j Let a(d) = -2d + 9. Let u be a(4). Suppose -5z - 1 + 11 = -3q, -2 = -z + 2q. Sort z, -3, u in ascending order. -3, u, z Let t be (1 - 14/4)2. Let n be -5 - 71/(-1). Sort -2, n, t in descending order. n, -2, t Let n(u) = 0 - u - 2 + 4 + 4. Let t be n(6). Suppose 3k - 2s = 9, 0 = 7k - 4k + s. Sort -2, k, t in descending order. k, t, -2 Let i = -121 - -125. Suppose -18s - i - 14 = 0. Put 0.1, 1/5, 0.3, s in descending order. 0.3, 1/5, 0.1, s Suppose h - 3 - 1 = -3d, -3h - 14 = -4d. Let u(m) = 2m*3 - 31m*2 + 88m - 50. Let o be u(12). Sort o, 4, d. o, d, 4 Suppose 4c = 27 - 7. Suppose 3f + 5g = 4f + 27, -cf = 5g - 15. Let y = 30 + -121/4. Sort -0.3, f, y. f, -0.3, y Let r be -126(-3)/18-8. Let n be 74/(-14) - 48/r. Let p(c) = -c - 1. Let t be p(-5). Sort n, 2, t in descending order. t, 2, n Let p = 76.951 - 77. Let y = p + 0.449. Sort 1, -1, 5, y in descending order. 5, 1, y, -1 Suppose -69 = 4p + 3k, -2p - 59 = 2p + 5k. Let y be 12/p + (1 - 0) - 1. Sort -4, 5, 9, y in decreasing order. 9, 5, y, -4 Let c = -4 + 8. Suppose -cu = 7 + 5. Let w = 6 + u. Put 0, w, -1 in ascending order. -1, 0, w Let g = -497 - -468. Sort g, -3/4, 0.2 in descending order. 0.2, -3/4, g Suppose -5q = 13 - 3. Suppose -6s = -9s + 6. Put 9, q, s, 0 in descending order. 9, s, 0, q Let o = -34 - -24. Let h be -1 + 4 - (o + 2). Let a = 10 - h. Put a, -0.2, 0.3 in descending order. 0.3, -0.2, a Let m = 36 - 28. Suppose -2w - m = c, c = w + 2c + 4. Let r be ((-6)/9)/((-1)/9). Sort r, -2, w. w, -2, r Let h = -515 + 283. Let r = 1620/7 + h. Sort -1/5, r, 0.3, -1 in decreasing order. 0.3, -1/5, r, -1 Let u(f) = 9f - 459. Let i be u(46). Sort i, 5, 2, 1 in descending order. 5, 2, 1, i Let q(j) = 8j + 121. Let g be q(-15). Sort 0.2, g, -255 in descending order. g, 0.2, -255 Let a = -4/115 + 10/23. Let b = 30 - 30.4. Put -0.1, a, 0.1, b in ascending order. b, -0.1, 0.1, a Let d = 0.03 + -105.53. Let r = 107 + d. Put r, -1, -3 in descending order. r, -1, -3 Let o = -4.2 - -8.2. Put -2/9, 2/25, o in descending order. o, 2/25, -2/9 Let j(v) = 3v - 47. Let t(d) = 2d - 31. Let i(s) = 5j(s) - 8t(s). Let a be i(15). Sort 0, a, 6 in descending order. 6, 0, a Let x = 444 + -442. Sort 1, x, -5, -3. -5, -3, 1, x Let s(j) = -22j - 132. Let h be s(-6). Sort -4, 2, h, -1. -4, -1, h, 2 Let n = -4 + -8. Put 2, 5, n, -3 in decreasing order. 5, 2, -3, n Let o be -7 + 7 + 111. Suppose 2k - 8 = -2. Suppose km - 2 + o = 0. Put 1, 3, m in descending order. 3, 1, m Suppose -15s + 18s = -4i + 18, 5i + s = 39. Let j be (25)/((-2)/(-1)). Put i, 3, j in ascending order. 3, j, i Let h(g) be the third derivative of g*4/24 - 21g*3/2 + 37g*2. Let v be h(25). Sort 0.3, -0.5, v. v, -0.5, 0.3 Let s(o) = -3o + 0 - 17 - 13. Let g be s(-11). Suppose -n + 3h - 12 = -h, -2n - h = 6. Sort g, -5, n. -5, n, g Let d be -1 + (-141)/(-15) + 10/(-25). Suppose -25 = -4f - u, -du + 3u = f - 30. Put 4, f, -4, -1 in increasing order. -4, -1, 4, f Suppose 60d - 58d + a = -3, -3 = -a. Sort d, -22, 4, 3 in decreasing order. 4, 3, d, -22 Let b(v) be the first derivative of v2 - 12v + 2. Let f be b(8). Let d = 151 - 151. Put f, -1, d in ascending order. -1, d, f Let j = 55 + -28. Let b = j - 24. Suppose -5k - 32 = 4o, k - o = -k - 5. Sort 0, k, b in increasing order. k, 0, b Let k = -1605 - -6423/4. Let a = -65 + 324/5. Sort k, -0.01, a in descending order. k, -0.01, a Suppose -8q = -10q + 2. Suppose -m = 2y - q, -4y - 4m + 2 = -6. Sort 2, y, 5 in ascending order. y, 2, 5 Suppose -3 = o - 4o. Suppose -d = r - 0r - o, -5r = -20. Sort d, 6, -4. -4, d, 6 Let o = 98 - 99. Sort 4, o, 5, 2 in descending order. 5, 4, 2, o Let v = 19138/11 + -1740. Let m = -1.2 + 0.2. Let t = m - 3. Sort v, -0.5, t in increasing order. t, -0.5, v Let s be -1 + -3 + (8 - (-18)/(-3)). Let n be (-14)/6 + (4 + s)1. Sort 22, n, 0.4 in increasing order. n, 0.4, 22 Let p be ((-16)/80)/((-1)/(-25)). Put -2, -1/2, p, -2/15 in descending order. -2/15, -1/2, -2, p Let f = 111 + -119.5. Let s = 9.5 + f. Let w = -0.6 - -0.9. Sort w, s, -0.2 in descending order. s, w, -0.2 Let w be (-3 - -1) + (-3)/(-3). Suppose -4r - 2f - 2f - 8 = 0, -4r - 2f = 10. Sort 0, r, w. r, w, 0 Suppose -1 = -2p + 3. Let x be (73/231)/(2/22). Let t(m) = -m*3 + 7m*2 - m + 2. Let a be t(7). Put a, p, x in descending order. p, x, a Let l = -2.77 - -0.37. Sort -0.4, 5, l in increasing order. l, -0.4, 5 Suppose -1416n + 76 = -1397n. Sort 3, 71, -2, n in increasing order. -2, 3, n, 71 Let r = 37 + -36.8. Let c be (1/(-8))/(16/(-32)). Sort r, 0.3, c in decreasing order. 0.3, c, r Let g = 0.52 - 0.483. Let q = -5.037 + g. Sort q, -1, -2, -0.2 in decreasing order. -0.2, -1, -2, q Let k = 2.01 + -0.01. Let l = 0.0546 + -0.1546. Put 0.2, l, k in increasing order. l, 0.2, k Suppose -3j - j + 16 = 0. Let q be (-3 - (-75)/10)(-3 + 1). Let x be (-2)/((-4)/(-6))6/q. Sort j, x, -3 in decreasing order. j, x, -3 Let t be ((40/(-3))/5 - -2) + 0. Let a = 0.23 - -0.07. Let h = -0.8 + a. Put -3, t, h in increasing order. -3, t, h Let u = 320 - 324. Let p be (-1)/3 - (-24)/(-9). Let s = 9 + -7. Put p, u, s in decreasing order. s, p, u Let j = 494 + -494.2. Sort 10, 5/2, -5/4, j. -5/4, j, 5/2, 10 Suppose -4a = -2a + 450. Let y be a/(-6)20/6. Let s = -503/4 + y. Sort 2/3, s, 1 in ascending order. s, 2/3, 1 Let o(z) = -18z - 87. Let n be o(-5). Sort -6, 2, -2, n in descending order. n, 2, -2, -6 Let x = 0.516 - 0.016. Sort 0.1, 4, x, -0.2 in decreasing order. 4, x, 0.1, -0.2 Suppose 4k + w = -6 - 7, 2 = 4k - 2w. Let l(g) = -2g*3 - 7. Let p be l(-3). Let r = 42 - p. Sort k, r, -1 in increasing order. r, k, -1 Let l = -15/38 + -2/19. Let h = 5.036 - 0.036. Sort -3, -0.4, h, l in descending order. h, -0.4, l, -3 Let a be 3/24288/36. Put a, -2, -12, -4 in descending order. a, -2, -4, -12 Let p = 6 - 11. Let r = -4900 + 4900.02. Sort r, -0.5, p in descending order. r, -0.5, p Let d be ((-16)/(-36))/236/48. Let l = -68/7 - -10. Let k = -105/8 + 13. Put d, k, l in decreasing order. l, d, k Let i = -0.21 + 0.11. Let l be 49/42 - (-6)/(-4). Sort 0.4, l, i, -3. -3, l, i, 0.4 Let s = -140 + 63. Let o = s + 63. Put -5, 0, o in increasing order. o, -5, 0 Suppose 2w - 70 = 34. Let f = -54 + w. Sort -5, f, 12. -5, f, 12 Let n(o) = 2o2 - o - 1. Let p be n(-1). Suppose 0 = 5l - 2x - 145, -3l - 3x = -4x - 86. Let y = 27 - l. Put y, -1, p in ascending order. -1, y, p Let k be (11 + -2)(-88)/396. Sort k, 2, -46 in ascending order. -46, k, 2 Let z(i) = 3i + 55. Let d be z(-18). Sort 3, -5, d, -11 in decreasing order. 3, d, -5, -11 Let z = -1977/5 + 396. Sort 5, -2, z, 0.2 in descending order. 5, z, 0.2, -2 Let w = -26	{ "pile_set_name": "DM Mathematics" }
r be j(w). Is 78 - (-3)/6r a multiple of 30? False Let u = -1 + 5. Let y be (-1)/(-2)(-8 + u). Let g = 38 + y. Does 14 divide g? False Suppose -17t + 144 = -6486. Is t a multiple of 13? True Is ((-1)/(-4)18)/(31/682) a multiple of 9? True Is 15 a factor of (86 - -20) + 1/(-1)? True Let u = 73 + -63. Suppose up - 12p = -14. Is 7 a factor of p? True Let o = 635 + -431. Is o a multiple of 59? False Let q = 83 - -4. Suppose -4h + 3z = -q - 181, 2h = -5z + 108. Does 22 divide h? False Suppose 0 = -5i + 5s + 200, 4i - 83 = -5s + 41. Is 25 a factor of (150/8)/(9/i)? True Let b = 1997 + -1392. Suppose -o - 3f = -0o - 132, -5o - 4f = -b. Does 39 divide o? True Let h(g) = g*3 + 11g*2 + 8g - 10. Let l be h(-10). Let w = l + -4. Is w a multiple of 3? True Let o(h) be the second derivative of h*3/6 - 15h*2/2 + 5h. Let f be o(18). Suppose 3t = -2v + 27, 0 = fv + 3t - 53 + 8. Does 11 divide v? False Let k = 460 + -379. Is k a multiple of 27? True Let v = -105 + 257. Suppose 812 = 4y + v. Does 14 divide y? False Let x = 636 - 428. Is x a multiple of 23? False Let j(r) = 14r - 45. Let p be j(4). Suppose -111 = -4l - p. Is l a multiple of 2? False Let c(s) = s2 + 8s + 11. Let j be c(-12). Suppose -175 = -6m + j. Is m a multiple of 14? False Let c(u) = 3u. Let g be c(1). Suppose 0 = -10o + 23 + 197. Suppose gw - 85 + o = 0. Is w a multiple of 7? True Suppose r = -3q + 103, 0r = -r - 2q + 99. Is 13 a factor of r? True Let d = -2274 - 528. Is 26 a factor of 1/3 - d/18? True Suppose 5r = -t + 21, 3t - 4r = -0t + 6. Suppose -2 = 4z - 6, -5o = z - t. Suppose o = -m + 10. Is m a multiple of 6? False Let a(m) = 15m*2 + 12m - 17. Does 32 divide a(-9)? False Suppose 10a - 72 + 22 = 0. Suppose -363 = -at - 2w, 5t + w - 320 - 44 = 0. Is t a multiple of 48? False Let m = 20 + -15. Suppose -h + 216 = mf, -f + 6h + 40 = 3h. Is f a multiple of 12? False Suppose 4m - 486 = -2c, 4m - 566 + 100 = 2c. Let b = m - 77. Is 42 a factor of b? True Let f(s) = -s3 - 4s*2 + 5s + 2. Let q be f(-5). Suppose 0 = qm + 3m - 15. Suppose 0 = mj - 4j - 2t + 19, 2t + 31 = j. Does 16 divide j? False Let x = 93 - -277. Does 37 divide x? True Let f be -55 - (4/8)/(2/4). Let l = f + 127. Does 12 divide l? False Let t(m) be the second derivative of m5/20 - m4/4 + m*3/6 + 2m. Let q be t(3). Is 4/(q + -7) + 43 a multiple of 14? True Let g(l) = -141 + 142 + l2 + l2 + 12l. Is g(-7) a multiple of 3? True Let k(a) = a3 - 5a*2 - 11a - 4. Let u be k(7). Let d be -2(-1)/(-2)-1. Let s = d + u. Is 9 a factor of s? True Let w(f) = -739f - 23. Is w(-1) a multiple of 10? False Let j(c) = 0 + 2c*2 + 16c - 15 - 5c2 + 4c*2. Let y be j(-9). Is (-5 - -3)/(3/y) a multiple of 13? True Let k(u) = 2u - 6. Let w be (-18)/1540/(-12). Let s be k(w). Suppose -2x = -sl - 60, 0 = -x - 3l + 23 - 5. Is 22 a factor of x? False Is -58 - -52 - 1406/(-1) a multiple of 25? True Let y(s) = s*3 + 15s*2 - 44s - 40. Is y(-14) a multiple of 4? True Let t be (8/20)/(1/5). Suppose -4l + y + 62 = 0, tl = -0l + 5y + 22. Is l even? True Let d = 1 + 107. Let a = d + -99. Does 2 divide a? False Let a(x) = -2x2 + 36x + 20. Is a(9) a multiple of 4? False Let r(y) = 0 - 9y + 19y2 - y3 - 23y2 + 2. Is r(-5) a multiple of 12? True Let w be -43/(-15)5. Suppose -5u = -wu - 4. Is 12 a factor of u/12 + 142/6? True Let x(y) = -5y - 5. Let b be x(-5). Let r = -38 + b. Let g = 18 - r. Does 12 divide g? True Let l = -7 - -7. Suppose -4m + 34 = 4a - 34, l = -m + 3a + 29. Is 20 a factor of (m/1)/((-2)/(-4))? True Let f(j) = -2j - 3. Let q be f(-4). Let h = q + 0. Suppose 46 = hr - 89. Is r a multiple of 9? True Suppose -o + 4o = 33. Let x(a) = -a*3 + 11a*2 - a + 15. Let z be x(o). Suppose 9m - zl - 259 = 4m, -4l + 236 = 4m. Is 10 a factor of m? False Let u(l) = 19 + 5l - 4 - 8l. Let w be u(5). Suppose -5m + 195 = -wm. Is m a multiple of 10? False Suppose 4m - 3p = -5p + 32, 3p = -12. Does 10 divide m? True Let n = -26 + 29. Suppose 2g - y - ny = 234, 4g - 477 = -y. Is 30 a factor of g? False Let y = 148 + -79. Let r = y + -61. Is 8 a factor of r? True Suppose -178c = -181c + 1131. Is 9 a factor of c? False Suppose 2i + 2 = 0, -5j = -5i + 109 - 319. Let o = -38 + j. Is 3 a factor of o? True Let g(y) = -y*2 - 5y + 6. Let f be g(-5). Let w(b) = 2b3 - 12b*2 + 4. Let s be w(f). Suppose 0 = si - 152 + 36. Does 10 divide i? False Let s(p) = p*3 + 2p*2 + 2. Let d be s(-2). Let u be ((-42)/(-5))/(9/60). Suppose 0g = -dg + u. Is 6 a factor of g? False Suppose -4x = -2s - 22, 24 = -2s + x + 5. Let j = s - -9. Suppose 2t - 52 - 2 = j. Does 6 divide t? False Is ((-3374)/(-8))/(46/184) a multiple of 5? False Suppose -973 = -5d + 4g + 1256, -4d + 4g + 1784 = 0. Let p = -214 + d. Suppose -4w = w - u - p, 5w - 227 = 2u. Is 7 a factor of w? False Suppose 2w - 1415 = 3z, 0 = -4w - 2z - 210 + 3032. Does 15 divide w? False Let p = -3 + 24. Suppose -l + 15 = -p. Does 9 divide l? True Let o = 122 + -45. Let k be (o + 1)1/2. Suppose 0 = 2r - 69 - k. Is 14 a factor of r? False Let q be -2 + 3/((-3)/(-5)). Let a(j) = qj + 1 - 2j - 1. Is 4 a factor of a(7)? False Let h = -451 - -660. Is 28 a factor of h? False Let l be 0/(0 + -1 + 0). Suppose l = 4d - u + 363, u - 273 = 3d - 0u. Let r = -57 - d. Is 11 a factor of r? True Let z be 281 + -2 + -2(-4)/(-8). Suppose 4c + 2m = z, c + 3 = -m + 71. Is c a multiple of 12? False Let w(v) = 314 + 13v - v2 + 10v - 316. Does 3 divide w(22)? False Suppose -61w + 233857 = -73644. Is 71 a factor of w? True Let f be (-168 - (-2 - -4))/(-2). Let z = f - 61. Does 4 divide z? True Let z(u) = -u2 + 6u - 1. Let s be z(5). Suppose -4r + s = -12. Suppose 0d + 2d = -2w + 90, 3d - 139 = -rw. Is d a multiple of 6? False Let u = 7 + -2. Suppose ub - 17 = 4b. Let d = 18 + b. Is 15 a factor of d? False Let u be 4/10 + (-132)/(-20). Suppose -2n - 43 = -p, n - up = -2p - 44. Let c = n + 51. Is 16 a factor of c? True Suppose -14 = 4m - 6m. Let v(k) = 34k + 0 + 3 - m + 3. Is 12 a factor of v(1)? False Suppose 7n - 624 = 4n. Let s = n - 132. Let z = -44 + s. Is 16 a factor of z? True Let m = -76 + 81. Suppose 8q - 3q + 5l = 85, mq = 5l + 125. Is q a multiple of 8? False Suppose -7 - 25 = 8d. Is 8 a factor of (d - (-312)/3) + -4? True Let n(m) = m*2 - 3m - 1. Suppose 0c - 28 = 4c. Let a = -10 - c. Is 11 a factor of n(a)? False Let r(a) = a*3 - 34a*2 + 35a - 55. Does 3 divide r(33)? False Let h = -3 - -40. Suppose -5w - h = -4g, -4g = -g + 2w + 1. Suppose gn = q - 4q + 246, -4q - n = -313. Does 24 divide q? False Let g = -4 + 8. Suppose -s = 4y - 14, 34 = 6s - 3s + gy. Let x = 29 - s. Is 10 a factor of x? False Suppose 34b - 30b - 12 = 0. Suppose 27 = bi - 18. Is i even? False Let n(y) = 44y2 - 7. Does 23 divide n(-3)? False Let n be (-2)/(-2) + 4/2. Let w be (15/(-3))/1 + n. Is 3 a factor of ((-1)/3)/(w/36)? True Suppose 32 = -6i + i + 2m, 44 = -3i - 5m. Let n = -1 - i. Suppose -2j = -j - n. Is j a multiple of 3? False Suppose -5m - 5n + 740 = -n, -3n + 303 = 2m. Is 24 a factor of m? True Let r = 58 - 55. Is (7 - 8)/((-1 + r)/(-414)) a multiple of 12? False Suppose -11x + 12x = 1210. Does 55 divide x? True Let g = 8 - -4. Let o be 10/3g/10. Suppose ob - y + 2y = 17, 4y = -2b + 12. Is b a multiple of 4? True Let n = -108 - -15. Let g = 7 - n. Is 20 a factor of g? True Suppose -7d = d + 80. Is 6/d - 0 - 1176/(-10) a multiple of 26? False Let o(a) = -a*3 - 2a*2 + 42a + 55. Is o(-13) a multiple of 38? True Suppose 0 = -28l + 23l - 5. Is 13 a factor of l/3 + (-944)/(-24)? True Let p(z) = -5z - 3. Let v be p(-2). Let g be 2/4 + v/2. Suppose u + u - 2r - g = 0, 0 = u - 2r. Is 4 a factor of u? True Suppose 0 = s + 4s - 2160. Let w = -221 + s. Suppose 3 = b, 4l + 4b = -b + w. Is 9 a factor of l? False Suppose 53g - 3120 = 45g. Does 13 divide g? True Suppose -2n = 2g + 20, -2g + 5n = -3g - 22. Let h = 43 + g. Is h a multiple of 6? True Let f = -12 - 4. Does 10 divide 3 + f/4 + 31? True Suppose -19c = 38 - 0. Let d(k) = -8k3 - 11k*2 - 11k - 1. Let q(t) = 4t3 + 6t*2 + 6t. Let b(i) = 3*	{ "pile_set_name": "DM Mathematics" }
kc(i) - 5b(i). i Let y(k) = k - 1. Let f(a) = a*3 - 3a*2 + 9a - 20. Let x be f(3). Suppose xc = -c + 8. Let l(p) = 5p - 2. Determine cl(s) - 4y(s). s + 2 Let s(z) = -42z2 - 146z + 8. Let a(h) = 54h2 + 144h - 10. What is -4a(r) - 5s(r)? -6r2 + 154r Let w be (112/(-40))/(4/(-30)). Suppose -wd - 2 - 19 = 0. Let q(z) = z + 1. Let s(l) = -2l*2 - 4l - 4. What is ds(r) - 4q(r)? 2r2 Let a(t) = -6t - 1086. Let m(p) = 10p + 2167. What is 7a(i) + 4m(i)? -2i + 1066 Let w(i) = -i - 6. Let o(h) = 1238286 + h - 619138 - 619139. Determine 5o(b) + 7w(b). -2b + 3 Let g(j) = 497j + 17. Let y(b) = 1491b + 46. Give -8g(a) + 3y(a). 497a + 2 Let d(x) = 4 + 16x - 2x - 5 - 2. Let a(j) = -5j + 1. Let i = -26 + 18. Let b = 2167 - 2170. Calculate bd(v) + ia(v). -2v + 1 Let t(g) be the third derivative of 58g2 - 1/6g*5 + 0g*3 + 0g + 5/24g4 + 0. Let b(q) = -3q*2 + 2q. Give -8b(u) + 3t(u). -6u2 - u Let l(i) = 48i*2 - 33i + 33. Let n(d) = 3d2 - 2d + 2. Let b(h) = 17h2 + 2h - 32. Let c be b(-6). Let a = c + -601. What is an(o) + 2l(o)? -3o2 Let t(v) = -297v*2 + 168v + 46. Let p(y) = -89y2 + 51y + 14. Let n(z) = -23p(z) + 7t(z). Let g(i) = -672i2 + 64i. Give -3g(m) + 64n(m). -32m2 Let r(z) be the third derivative of -z5/30 - z4/6 - 3z*3/2 + 799z2. Let q(y) = -y2 - 3y - 8. Give 4q(v) - 3r(v). 2v*2 - 5 Let f(t) = -16833t - 724. Let i(a) = -23a - 1. Determine -5f(l) + 3620i(l). 905l Let x(t) = 2t + 3. Let c = 14 - 15. Let k(m) = -2m*2 + 37m - 127. Let j be k(14). Let z(i) = -i - 1. What is cx(n) + jz(n)? -n - 2 Let r(o) = 5o + 4o - 16o + 6o. Let g(j) be the second derivative of 10j3/3 + 3242j. Calculate -g(h) - 10r(h). -10h Let d(u) = -34u3 - 5172094 + 8u + 5172105 + u*3 - 11u*2. Let y(g) = -11g*3 - 4g*2 + 3g + 4. What is 4d(a) - 11y(a)? -11a3 - a Let p(h) = -3h*2 + 6h + 5. Let d(y) be the first derivative of y3/3 - y2/2 - y + 1099. Calculate -6d(g) - p(g). -3g*2 + 1 Let b(j) = 593j*3 - 4j*2 + 2j + 1. Let z(o) = -1780o3 + 13o*2 - 6o - 4. Give -13b(f) - 4z(f). -589f3 - 2f + 3 Let r(v) be the third derivative of -70v5 - 112v*3/3 + 2v*2 - 1436v. Let o(a) = 56a2 + 3. Give -224o(p) - 3r(p). 56p*2 Let c(j) = -7j*2 - 20j - 23. Let a(m) = -m*2 + 5m + 2. Give -4a(t) - c(t). 11t*2 + 15 Let i(l) = -4l + 5. Suppose -70a + 72a - 5n - 42 = 0, 4n + 36 = 2a. Let k(m) = 4m - 5. What is ak(f) + 7i(f)? -4f + 5 Let v(b) = -2b*3 + 6. Let o(r) = -9r3 - r2 + 3r + 26. What is o(j) - 6v(j)? 3j3 - j2 + 3j - 10 Let u(h) = 4h - 3 + 3 + 0. Let t(y) = -3y - 12191131 + 12191131. Determine -6t(f) - 5u(f). -2f Let k(j) = 7j*3 - 12j*2 - 130j. Let z(q) = -8q3 + 14q*2 + 131q. Calculate 7k(g) + 6z(g). g*3 - 124g Let g(j) = j*2 + 1. Let a(u) = 17u*2 + 9. Let d(p) = 3p*2 - 214p + 1194. Let x be d(6). Give xg(c) - 2a(c). -16c2 Let z(v) = 26509v - 16. Let j(f) = -8845f + 6. Calculate -11j(g) - 4z(g). -8741g - 2 Let q(w) = 619w2 - 3w + 92. Let p(i) = 617i2 - 3i + 79. Determine -7p(z) + 6q(z). -605z2 + 3z - 1 Suppose 22r = -645 + 755. Let p(o) = 45o. Let d(h) = -23h. Calculate rd(i) + 2p(i). -25i Let p(q) = 5q2 + 16q + 10195. Let s(o) = -2o2 - 6o - 3392. Determine -3p(l) - 8s(l). l*2 - 3449 Let d(t) = -19t*3 + 6t*2 - 3t + 109. Let u(f) = -18f3 + 4f*2 - 2f + 112. Give -2d(w) + 3u(w). -16w3 + 118 Let h(b) = b3 + 7b*2 - 2b + 25. Let l be h(-6). Let x(g) = -42 - g*2 - 30 - 2g + l. Let z(d) = d*2 + 3d - 2. Determine -8x(t) - 5z(t). 3t2 + t + 2 Let d(i) = i. Let z(g) = -38g. Let p be 10/55 + (13/(-3))/(176/48). Give pz(l) + 6d(l). 44l Let a(k) = -6k2 - 19. Let d(h) = -h2. What is a(f) + 5d(f)? -11f*2 - 19 Let a = -125 - -89. Let i be (a/(-63))/(2/21). Let z(v) = 10v + 6. Let j(g) = g + 5. Let h be j(-4). Let k(m) = -m - 1. Determine hz(t) + ik(t). 4t Let i(o) = -o2 - 7o + 2. Let p(m) = m*2 + 14m - 61. What is 2i(k) + p(k)? -k2 - 57 Let t(x) = -11x3 + x2 + 5x + 5. Let l(k) = -27k*3 + 3k*2 + 12k + 12. Let c = -7553 + 7558. What is cl(f) - 12t(f)? -3f3 + 3f*2 Let m(c) = -c - 1. Let k(v) be the second derivative of 0 + 1/6v*3 - 127v + 0v2. Calculate -6k(q) - 5m(q). -q + 5 Let d(x) = -731x*2 - 24x - 16. Let v(q) = -243q2 - 8q - 6. Give -3d(p) + 8v(p). 249p2 + 8p Let c(t) = 510t2 + 2t + 39. Let v(q) = -170q2 - q - 15. Determine 3c(p) + 8v(p). 170p*2 - 2p - 3 Let w(z) = -z. Let a(s) be the first derivative of -6s2 - 2s - 1141. Calculate -a(l) - w(l). 13l + 2 Let v(w) = -8w*2 - 2w + 22. Let p(q) = -3q2 - 3. Determine 2p(u) - v(u). 2u2 + 2u - 28 Let c(m) = -7m - 119. Let q(k) = -2k - 35. Determine -3c(f) + 8q(f). 5f + 77 Let l(s) = 1170s + 19. Let a(g) = 587g + 10. Calculate -15a(r) + 8l(r). 555r + 2 Suppose -7h - h + 88 = 0. Let p(z) = z2 + 7z + 8. Let k = -8 - -6. Let o be 672/108 - k/(-9). Let i(y) = -2y2 - 13y - 15. What is hp(s) + oi(s)? -s*2 - s - 2 Let a(c) = -6c*2 - 13c + 8. Let d(t) = -2t2 + 2t - 1. Determine -a(z) - 7d(z). 20z2 - z - 1 Let p(d) = -d2 - 7 + 5706d - 5706d + 1 + 7. Let r(o) = 3o2 + 2o + 4. What is -4p(a) + r(a)? 7a*2 + 2a Let a(g) = -7g3 + 6g*2 - 43g + 3. Let j(v) = -19v3 + 19v*2 - 130v + 8. What is 8a(d) - 3j(d)? d*3 - 9d*2 + 46d Let n(k) = -k*3 - 5k. Let p(u) = -3u3 + 2u*2 - 10u + 247. Determine 2n(r) - p(r). r3 - 2r*2 - 247 Let x(f) = -1228f*2 - 3f + 3. Let k(l) = -71225l2 - 175l + 175. What is -3k(s) + 175x(s)? -1225s2 Let d(w) = 5w + 12. Let y(s) = 7s + 11. Let l(z) = 6d(z) - 4y(z). Let j(h) = -h - 14. Give 7j(n) + 4l(n). n + 14 Let z(c) = 19c - 312. Let u(h) = -25h + 316. Calculate 2u(b) + 3z(b). 7b - 304 Let n(k) = 6k3 - k. Let a(p) = -2p + 92p3 - 192p*3 + 107p*3. Suppose 2y + 3 + 5 = 0. Determine ya(b) + 5n(b). 2b3 + 3b Let t(i) be the third derivative of i4/24 + i3/6 + 213i2. Let c(x) = 2 - 8 + 1 + 4. Determine -3c(v) - t(v). -v + 2 Let h(f) = 14f + 1. Let m(r) = 520r + 4. Give 5h(z) - m(z). -450z + 1 Suppose -1053 - 48 = -3d. Let r = 359 - d. Let c(t) = -3t*3 + 6t*2 + 3t - 3. Let k(u) = 9u3 - 17u*2 - 8u + 8. Calculate rc(l) - 3k(l). -3l3 + 3l*2 Let t(o) = -5o + 5o2 - 4o*2 - 2o2. Let n(d) = -d2 - 4d + 1. Suppose 81l - 80l = 3k + 24, 3l = -3k + 12. Determine kn(z) + 4t(z). z*2 - 5 Let h(j) = 85j - 3176. Let g(y) = 62y - 2381. Determine 11g(b) - 8h(b). 2b - 783 Let m(p) = -p. Let c(z) be the second derivative of z4/12 - z3/2 + 1088z. Calculate c(s) - 4m(s). s*2 + s Let p(d) = 6d - 4. Let t(s) = 4304s - 17215. Let c be t(4). Let g(n) = n - 1. Suppose 3u + u = -12. Calculate cp(i) + ug(i). 3i - 1 Let j be (-29)/(-9) - 22/99. Let r(b) = jb*2 - 874 - 2b*2 + 875. Let s(v) = 6v*3 + 3v*2 + 3. Let m = -1 - -2. What is ms(g) - 3r(g)? 6g*3 Suppose -4y + 13q = 8q + 48, 40 = -4y + 3q. Let l(f) = 4f2 + 13f - 7. Let x(m) = -3m2 - 9m + 5. Give yx(w) - 5l(w). w*2 - 2w Let z(n) = 7n2 + 2n + 5. Let x(t) be the first derivative of t + 10. Let h(m) = -m*3 - 118m*2 - 342m + 349. Let g be h(-115). Determine gx(u) - z(u). -7u*2 - 2u - 1 Let y(m) = -7. Let o(l) = -6. Let c(b) = 5o(b) - 4y(b). Let d(v) = v + 2. Suppose 172 + 187 = 2j + 363. Calculate jc(w) - 3d(w). -3w - 2 Let n(t) = 7t + 48. Let u(b) = -26 - 22 + 3299943b - 3299951b. What is -7n(l) - 6u(l)? -l - 48 Let y(g) = 4g*2 - g - 1. Let a(x) = x. Let u = -6151 + 6152. Determine uy(m) - a(m). 4m2 - 2m - 1 Let d(q) = -17q3 - 18q*2 + 84q + 22. Let r(l) = 4l3 + 4l*2 - 21l - 5. Calculate 3d(i) + 13r(i). i*3 - 2i*2 - 21i + 1 Let w(q) = -q*2 - 1. Let f(x) = 8x*3 + 3x*2 + 3. Let h(k) = 21k*3 + 6k*2 + 6. Let d(v) = -7f(v) + 3h(v). Calculate -d(n) + 5w(n). -7n3 - 2n*2 - 2 Let a(v) = 100v*3 + 16v*2 + 630v - 16. Let g(t) = 35t3 + 6t*2 + 210t - 6. What is -3a(m) + 8g(m)? -20m3 - 210m Let h(u) = 54u2 - 154u + 662. Let s(o) = -6o2 + 17o - 71. Let j(k) = -3h(k) - 28s(k)	{ "pile_set_name": "DM Mathematics" }
9, f, v Let k = -77 + 46. Let m(d) = -2d2 + 43d + 90. Let n be m(24). Let h = n - k. Sort h, -15, 0 in descending order. h, 0, -15 Let o = -359 + 291. Let v = 148 - 76. Let h = o + v. Put -3/16, h, -0.3 in increasing order. -0.3, -3/16, h Suppose 24g + 65 = 11g. Sort g, 284, 0, 1 in descending order. 284, 1, 0, g Let z = -30 + 38. Suppose 4y = -0 + z, -4m = -4y - 4. Let c be 0/m2/4-1. Sort -4, 13, c in descending order. 13, c, -4 Let l = -7/2 - -55/14. Suppose -34 = -25w + 91. Put l, -2, -4, w in increasing order. -4, -2, l, w Let i(l) = l*2 + 4l - 4. Let t be i(-5). Suppose -72x - 126x = 16x + 608 + 34. Sort t, x, 3. x, t, 3 Let k(t) = 25t + 73. Let h be k(-12). Let l = 230 + h. Sort l, -1.3, 0.1. -1.3, 0.1, l Let f = 232 - 232. Let z be (-35 - -29) + (f - 0) - -1. Let l = 4.7 - 5. Put l, -0.09, z in decreasing order. -0.09, l, z Let a be 1/(-3)-3 + 0. Let c = 44/135 - 25/27. Let d = -4.87 - 0.13. Put c, -1, d, a in decreasing order. a, c, -1, d Let n be 2((5 - 7) + 4 + -3). Sort -4, -30, n, -8, -1 in descending order. -1, n, -4, -8, -30 Let a be -17(-1)/6 + (-272)/204. Let m = 1084 + -5438/5. Put a, m, 0.1, -5 in descending order. a, 0.1, m, -5 Let o(b) = 4b*3 + 2b*2 - 3b - 4. Suppose -5r = -m, r - 4m = 12 + 7. Let u be o(r). Sort u, -44, 1 in decreasing order. 1, u, -44 Let i = -4.92 + 4.8664. Let o = -39.0536 - i. Sort -1, o, -1/6. o, -1, -1/6 Let k = 1727 - 1918. Sort -2/3, k, 1/3. k, -2/3, 1/3 Let f = 0.1 - 0.1. Let y be 522/(-13) - (-1 + -39). Put -3, y, -2, f in descending order. f, y, -2, -3 Let h be ((-1)/(-3))/(((-6)/28)/((-4068)/(-1582))). Let a = 0 + -3. Put 9, a, h in decreasing order. 9, a, h Let q(k) = 92k2 - 91k2 + k3 + 4k - 4 - 3k*3. Let w be q(-2). Suppose 6j + 5 = j. Put 4, w, j in increasing order. j, 4, w Suppose -4v + 5y = -55 - 386, 0 = -3y - 15. Let f = -6422 + 6424. Sort 0, f, v in decreasing order. v, f, 0 Let q = 21239 - 21236. Sort 1.19, q, -0.5, -0.07 in decreasing order. q, 1.19, -0.07, -0.5 Let z = 345216 + -2416510/7. Let i = 7 + 0. Let x = -10 + i. Put x, 0.3, z, 4 in increasing order. x, z, 0.3, 4 Let a = 90.921 + -88.71. Put -4/7, 1, a in increasing order. -4/7, 1, a Let v be (12/(-15)145/(-348))/1. Sort -1, v, -4, 2/11, 0.5. -4, -1, 2/11, v, 0.5 Let d = 56 - 80. Let i = -1.1043 - -1.5043. Sort d, 1, i, 2. d, i, 1, 2 Suppose 0 = -4z - 6 + 22. Let j = 5433 + -5431. Put z, j, -7, -0.5 in decreasing order. z, j, -0.5, -7 Let c = -3406 - -3385. Put 3, 5, c, 22 in increasing order. c, 3, 5, 22 Let u(l) = -37l*3 - 223l*2 - 3l + 21. Let p be u(-6). Sort -3, p, -258 in descending order. p, -3, -258 Let c be (-33)/15 + 2 + 0/1. Let b = 1519 - 1523. Sort c, b, -1/4 in decreasing order. c, -1/4, b Suppose o - 9o = -16. Suppose -5n = 25, 0 = -2x + on + 2n + 48. Sort 1, x, -9. -9, 1, x Let i(t) = t3 + 11t*2 - 3t - 14. Let x be i(-11). Suppose xj - 17j = 10. Let a be ((-3)/9)/((-1)/3-1). Put a, j, 0 in decreasing order. j, 0, a Let v be 8 - (6/(-9) + 11/3). Suppose vq + 6 = -3k - 3, 0 = -2q + k - 8. Sort q, -9, 0, 2 in decreasing order. 2, 0, q, -9 Suppose 22k - 229 = 13. Suppose kf - f = 70. Put -5, 2, f, 4 in ascending order. -5, 2, 4, f Let r be (-8)/36 - (-305)/(-45). Let k(n) = -n*3 - 7n*2 - 2n - 7. Let c be k(r). Put c, -2, -4 in increasing order. -4, -2, c Suppose -2b - 3o = -17, 3b - 2b = -2o + 10. Let x(a) = -a. Let h be x(-3). Suppose hn - 9 + 24 = 0, 5w = 5n - 15. Put -5, w, b in increasing order. w, -5, b Suppose -5i - 81 + 94 = -3u, 0 = 4u - 3i + 10. Let x(t) = -t - 3. Let f be x(-4). Sort u, -5, f, 22 in descending order. 22, f, u, -5 Suppose 0 = -0a - 3a - 129. Let v = -320 - -359. Let s = a + v. Put s, 3, -1, 4 in ascending order. s, -1, 3, 4 Let v(y) = -y + 3. Let i be v(0). Let s(k) = 7 + 61k + 55k - 111k. Let g be s(i). Put 2, 0, g in descending order. g, 2, 0 Let a(c) = c3 + 8c*2 - 78c - 609. Let y be a(-9). Put y, -8, -1, -5 in descending order. y, -1, -5, -8 Let v be (40 - 10 - 14) + -13. Put 5, 1, -8, v in decreasing order. 5, v, 1, -8 Let g be 524/(-5796) + (-8)/(-84). Let w = g + -626/1035. Sort w, 4, 10. w, 4, 10 Let s be 1/((-2)/24-3). Suppose -1 - 9 = -4n + p, -sp + 5 = -n. Suppose -5z + 20i - 15 = 16i, 0 = -3z + 3i - 9. Sort z, n, -5 in decreasing order. n, z, -5 Let w be (2 + -827)/(-3) + -6. Let f = -199 + w. Sort 0, f, -2 in descending order. f, 0, -2 Suppose -4u - 15 = -f, -1010u + 1011u = -4f + 26. Sort -3, -23, 12, f. -23, -3, f, 12 Suppose 0 = -8j + 4r - 12, 2r = -7j + 4j + 20. Sort -6, j, 0, 0.2, -2. -6, -2, 0, 0.2, j Let m be 8/18 - ((-55)/99 + 5). Suppose 4q = 16, -2r + q - 10 = -q. Sort m, r, 0 in descending order. 0, r, m Let d(f) = -17f*2 - f + 3. Let h be d(3). Let l = -111 - h. Let u = -47 + l. Put -3, u, -2 in ascending order. u, -3, -2 Suppose -48 = -b - 5q - 13, -3q - 117 = -4b. Suppose -7g - b = -g. Sort -3, g, -9 in decreasing order. -3, g, -9 Let c be 3 - 6 - -6 - (-4)/1. Suppose 0d - 14 = -cd. Suppose -6 = 2u - d. Put -1, 3, -5, u in ascending order. -5, u, -1, 3 Let p = -224 - -219. Suppose 0 = -119j + 127j - 40. Sort 4, -0.3, j, p in ascending order. p, -0.3, 4, j Let p(j) = -4j3 - 27j*2 + 13j + 47. Let r be p(-7). Put r, 0, 1, 21 in decreasing order. 21, r, 1, 0 Let x = -1109 - -1118. Put -2/5, x, -3.1 in decreasing order. x, -2/5, -3.1 Let f(h) = h*2 - 12h + 23. Let g be f(10). Let b be (-6)/(-5) - (g + -1). Let a = -267.1 + 267. Sort 5, a, b in decreasing order. 5, a, b Let j = 30 + -43. Let z = 130 + -117. Let s = z + -13.4. Sort 2, s, j in ascending order. j, s, 2 Suppose 0 = 37m - 35m - 10. Sort 9, 24, 1, m in decreasing order. 24, 9, m, 1 Suppose 0b - 4b = 3m - 14, 4b = -5m + 18. Let q = -18.8 + 19. Sort q, b, -1/3 in descending order. b, q, -1/3 Let t = -2782 + 2782. Sort -1, -5, 3, 1, t. -5, -1, t, 1, 3 Let g(v) = 2v*3 + 10v*2 - 4v - 23. Let c be g(-5). Let s be 14 - (5 + (c - 0)). Sort 0.2, s, -4/5, -5 in ascending order. -5, -4/5, 0.2, s Let w be ((-12)/45)/((24/(-10))/(-2)). Sort w, 0.1, 1.1, -2/15. w, -2/15, 0.1, 1.1 Let r = 7 + -7.08. Let m = 0 + 9. Let f = m - 13. Sort f, r, 3/5. f, r, 3/5 Suppose 149r + 423 = 125. Let s(k) = -5k + 11. Let a be s(2). Sort a, r, 5. r, a, 5 Let r = 569 - 568.7. Sort -8, 2/7, -3, r in ascending order. -8, -3, 2/7, r Let g = -13 - -10.5. Let v = 8.6 + -11.4. Let p = g - v. Sort 4/3, 0.4, p in ascending order. p, 0.4, 4/3 Suppose 0 = 5v + v + 12. Let m be (v + 5)/(-3) - -3. Suppose -28 = 6f + m. Put -3, 4, -10, f in decreasing order. 4, -3, f, -10 Suppose -37h - 408 = 24h + 41h. Sort -1, h, 101 in descending order. 101, -1, h Let o = -6015 + 6024. Let d = -77452/47 - -1648. Let z = 66/329 + d. Sort -1, o, z. -1, z, o Let i = 0.7 + -0.4. Let v = i - 0.8. Let s = 1.0276 - 1.4276. Sort s, 0.4, v in descending order. 0.4, s, v Let h(d) = d*3 + 14d*2 - 6d - 250. Let r be h(-13). Put r, -4, -13 in descending order. r, -4, -13 Let w = -4781 + 4783. Put -4, w, -3, -0.3, 0 in increasing order. -4, -3, -0.3, 0, w Let w = -771 - -737. Let d be 2 - 112/(-2). Let g be d/(-6)(-51)/w. Put -1, 3, g in decreasing order. 3, -1, g Let s = -43 - -45. Suppose 10w - 7w - 34 = -5d, -3w = -sd + 1. Put d, -2, 1, 24 in increasing order. -2, 1, d, 24 Let r = 8.5 - 7. Let k = -116.3 + 114.6. Let p = k + r. Put 1/7, p, -0.1 in ascending order. p, -0.1, 1/7 Let y = 8 + -7. Let r = 2 - y. Suppose 5i = -48 + 73, s + 2i - 13 = 0. Put 9, s, r in decreasing order. 9, s, r Let m = -13552 - -13554. Let b = 5.4 + -5. Sort m, b, 3, 5. b, m, 3, 5 Let v = 15 + -15. Let l = 1.16 - 1.26. Let t = -13.6 + 13.8. Sort l, t, v in decreasing order. t, v, l Let h be 0 - (0 - (-6)/3). Let u(k) = -8k*2 - 9k + 25. Let b be u(5). Let o = -220 - b. Sort 3, o, h, -5 in increasing order. -5, h, o, 3 Let x be (-90)/(-150)(3/1 + 287). Put -1, x, 1/3, -0.1 in descending order. x, 1/3, -0.1, -1 Let k = 299 + -312. Let p be (-27)/(-5) - (k + 2 + 16). Sort 0.1, p, -2/45, 0.5 in decreasing order. 0.5, p, 0.1, -2/45 Suppose 5t - 35 = p, -76p - 4t + 28 = -75p. Sort -9, 2, -5, p. -9, -5, p, 2 Let c(a) = -a2 - 11a - 11. Let f be -10 + (-7)/(-21)3/1. Let d be c(f). Suppose 4u - 2w - 2 = 0, 4u - 4*w = -d - 1. Put	{ "pile_set_name": "DM Mathematics" }
= 12 - 8. Let j = 1 + a. Let s(u) = -u + 11. Give s(j). 6 Let p(i) = -i*2 - 5i - 2. Let d be p(-4). Let z(o) = -o*d + 3o + 1 + o + 2. What is z(4)? 3 Let k(d) be the second derivative of 3/2d2 + 0 + 7d - 1/6d3. Suppose -3f + 46 - 8 = -4b, -3f + 8 = 2b. What is k(f)? -3 Let k(r) = r2 + r + 4. Let y = 16 + -16. Calculate k(y). 4 Let y(z) = -z3 - 11z*2 - 9z + 11. Let c be y(-10). Let h(s) be the second derivative of -5s4/12 - s2/2 + 34s. Give h(c). -6 Let i(q) = q*3 - 3q*2 - 5q + 3. Suppose 2j + 2j = 16. What is i(j)? -1 Let i(d) = d*3 - 8d2 + 1. Let w(r) = -r3 + 7r2 - r - 2. Let f(g) = 2i(g) + 3w(g). Give f(4). 0 Let y(m) = m + 3. Suppose 4 = 4o + 24. Let p be y(o). Let a(d) = 3d. What is a(p)? -6 Let g(d) = -5d*2 - 3d - 3. Let j(o) = 27o2 + 16o + 15. Let l(z) = -11g(z) - 2j(z). What is l(0)? 3 Let o(f) = -f*2 + 7f - 2. Let s(n) = -n*2 - 12n - 20. Let i be s(-9). What is o(i)? -2 Let f(a) = a + 11. Let x be 4/(-18) + (-146)/(-9). Suppose -5d + 9d - x = 0. Suppose dc = 4q + 3c + 21, 3 = -q - 2c. Give f(q). 6 Let x = 4 - 9. Let t = x + 11. Let s(i) = -2i + 8. Give s(t). -4 Suppose -3w + 4 = -2x - 4, -9 = -2w + 5x. Suppose u = 4a - wu - 5, 0 = u + 3. Let o(h) = -5h*2 - 2h - 1. Determine o(a). -4 Let x(c) = c - 2. Suppose 7k - 35 = -0. Calculate x(k). 3 Suppose 0u - 5u = -j - 8, u + 4j = 10. Let n = -1 + u. Let f(r) = 4r2 - 2r + 1. Give f(n). 3 Let l(k) = k*3 - 3k2 - 4. Let z(x) = x3 + 6x2 - 7x + 5. Let m be z(-7). Suppose -mr + 0r + 20 = 0. Calculate l(r). 12 Suppose 2x = 6, 9t - 36 = 4t + 3x. Suppose 5u = tu + 4. Let b(n) = -n*2. Determine b(u). -1 Let i(k) = 2k*2 - k - 2. Suppose 3y = 2a - 12, -30 = -5a + 6y - y. Suppose 2f + 14 - 6 = 5w, -f - w = 4. Let r = f + a. Give i(r). 4 Let h(r) = 2r*2 + 2. Suppose -5s = -8 - 2. Determine h(s). 10 Let z(f) = f*2 + 3f + 3. Let b be z(-3). Let m(s) = -8 + 5s - 2s2 - sb + s + 9. What is m(-4)? 9 Let a(f) be the second derivative of -f6/720 - f5/60 - f*4/4 - 3f. Let y(r) be the third derivative of a(r). Calculate y(-5). 3 Suppose 5w = 6 + 14. Let n(d) = -3d*2 - 3d + 9. Let y(h) = 2h2 + 4h - 8. Let u(v) = -3n(v) - 4y(v). Give u(w). -7 Let j = -1 - -2. Let a(p) = p*2. Let q be a(j). Let w(i) = 5 - 6 + 1 + 7i + 1. Calculate w(q). 8 Let i(t) = t*2 + 3t + 5. Let z(h) = -2h2 - 6h - 10. Let o(b) = 5i(b) + 2z(b). Let c(q) = -q*2 - 3q - 6. Let y(d) = 4c(d) + 5o(d). Give y(-2). -1 Suppose 2i - 4n + 8 + 6 = 0, -13 = 3i - 2n. Let l(p) = p*2 + 4p - 1. Give l(i). -4 Let n(g) = g - 3. Let y = -15 + 3. Let x = -7 - y. Calculate n(x). 2 Let l = -4 - -6. Let y be l-3(-2)/4. Let i(o) be the third derivative of o6/120 - o5/30 - o*4/24 - 2o*3/3 + 3o*2. Calculate i(y). 2 Suppose 0 = -10o - 45 + 115. Let c(m) = -m*3 + 8m*2 - 5m - 10. Give c(o). 4 Let x(p) = p3. Let q(h) = h3 + 3h2 + h - 3. Suppose 2l + 15 = -3l. Let u be q(l). Let t be u/21 + 4/14. Determine x(t). 0 Let j(p) be the third derivative of 1/120p*6 - 1/10p*5 + 0p4 + p3 + 0 - 4p2 + 0p. Calculate j(6). 6 Let j(i) = -6i + 10. Suppose 4a - a - 3h + 6 = 0, h = 1. Let g(o) = o - 1. Let x(w) = aj(w) - 3g(w). Give x(5). 8 Let l(m) = m3 + 2m*2 - 2m - 3. Let c be l(-2). Suppose -c = 2y + 3. Let s(k) = -k2. What is s(y)? -4 Let t(w) = -5w*2 - 2w - 1. Let j(v) = -6v2 - 2v - 1. Let c(q) = 4j(q) - 5t(q). Calculate c(-6). 25 Let b(r) = r*3 - 4r*2 + r - 2. Let j be ((-8)/24)/((-2)/12). Suppose 0h = -jh + 6. Determine b(h). -8 Let o = 2 - 2. Let p(t) = 5t + 1. Let v(n) = 5 - 4n - 5 - 5 + 3. Let s(m) = 5p(m) + 6v(m). Determine s(o). -7 Let m(t) = 2t + 3 + 6t + t - 5t. What is m(4)? 19 Suppose -1 = -4q + 3q. Let a = q + 0. Let w(n) be the third derivative of -5n4/24 + n2. Calculate w(a). -5 Let z(w) = w. Let s be 60/14 + 14/(-49). Suppose 4b = si - 8, -10 = i + 4i + 5b. Suppose 4 + i = -r. Determine z(r). -4 Suppose -2p - 4l + 11 = 33, -5l - 17 = -p. Let a = -4 - p. Let i(o) = 0 - 5o + 2 - 3. Calculate i(a). 4 Let v(o) be the third derivative of -o8/20160 - o7/1008 + 7o6/720 - o5/60 + 9o2. Let r(t) be the third derivative of v(t). Give r(-6). 1 Let c(k) = k2 - 7k + 6. Let t be 2/(-6) + (-176)/(-6). Suppose -5o + a + t = 0, -o + 3a = -6 - 11. What is c(o)? -4 Suppose 3q + 24 = -0q - 3i, -3i = 5q + 30. Let x(y) = y2 + 3y - 2. Give x(q). -2 Suppose -3p = 2p - 30. Suppose 3d = d - p. Let q = -1 + d. Let s(v) = -v + 4. Give s(q). 8 Suppose 2v - 30 = -4t, -5t + 2v = -6 - 9. Let a be -1(0 + (-1 - 1)). Let u(n) = 0n - 5n + 0na - 3 + n2. Determine u(t). -3 Let u(x) = 2x*3 - 7x*2 - 5x + 2. Let b(k) = 2k3 - 6k*2 - 5k + 2. Let o(h) = 4b(h) - 3u(h). What is o(3)? 14 Let k(q) be the first derivative of -2q + 1 + 5/2q*2 - 2/3q*3. Let z be (-3)/(-9) + 16/6. Give k(z). -5 Suppose 0 = -3a + 4a - 6. Let n(t) = t2 - 6t - 8. Determine n(a). -8 Let m(y) = -y3 + y2 - y + 1. Let p(l) = -4l3 + 8l*2 - 3l - 1. Let z(r) = -3m(r) + p(r). What is z(4)? 12 Let o(h) = h3 + 3h*2 + 2 + 2 - 1 + h. Calculate o(-3). 0 Let l(c) = -3c - 6. Let y(j) = -j*2 + 5j - 4. Let i be (-102)/(-27) - 2/(-9). Let a be y(i). Suppose a + 4 = -w. Give l(w). 6 Let s(y) be the third derivative of y5/20 - y4/24 - 9y2. Give s(1). 2 Let w(o) = -2o*2 + 4o - 4. Let f(y) = -y + 6. Let t be f(3). Let m be (-48)/(-14) - t/7. Give w(m). -10 Let i(m) = m - 3. Let x be i(5). Let l(y) = 3y - 9 - y + 8 - 3y*3 - xy*2. Determine l(1). -4 Let c(r) be the third derivative of -2r*2 + 1/60r*5 - 1/120r*6 + 0r + 0r3 + 0r4 + 0. Determine c(0). 0 Let d(g) = g2 + 5g + 8. Let j(b) = 3b*2 + 16b + 25. Let r(u) = -11d(u) + 4j(u). Calculate r(-8). 4 Let k(b) be the second derivative of b5/20 - b4/2 - 5b3/6 - 7b*2/2 + 23b. Determine k(7). 7 Let k(d) = d*3 - 2d*2 - d - 2. Suppose r + 11 = 3h - h, -5h = 5r + 10. Determine k(h). 4 Let p(v) be the first derivative of -v*3/3 + 3v*2/2 + 3v + 10. What is p(5)? -7 Let g(b) = 2b + 2. Let w(k) = k3 - 8k*2 + 5k + 16. Let t be w(7). What is g(t)? 6 Let n(y) = -y*2 + 3y - 1. Let b be n(2). Let i(j) be the second derivative of j5/5 - j4/12 + 5j. Give i(b). 3 Suppose 3h - 2 = 13. Suppose 2a = -6 + 10. Let n(i) = -2i + 4 + i*a - 1 - 2 - 6. Determine n(h). 10 Suppose -3b = 4q + 71, 4b - 8 = -2q - 36. Let a be ((-6)/(-5))/(q/(-50)). Let d(c) = c2 + 2c - 3. Give d(a). 12 Let q(j) = j*2 - 11j + 11. Let h be q(10). Let c(a) = 16a3 - a2 - a + 1. What is c(h)? 15 Let l(r) be the first derivative of -r4/4 + 8r*3/3 - 7r*2/2 + 10r + 7. Give l(7). 10 Let q(v) = v - 7. Let o = -6 - -11. Determine q(o). -2 Let l(i) = 4i. Let s be (1 - (-2 + 0)) + -4. Calculate l(s). -4 Let d(z) = 4 - 7z - z*3 - 8z*2 + 2z*3 + 3z*2. Calculate d(6). -2 Suppose 3o + 27 = 9. Let k(v) = 2v + 6. Determine k(o). -6 Let l(c) = -c3 - 3c*2 + 6c + 4. Suppose 3r = 9, 0 = -o - 4o - 2r - 14. Let k be l(o). Let v(t) = t2 + 5t + 4. Give v(k). 0 Suppose -5x - 2t + 21 = 0, 2x + 4t - 15 = t. Let c(f) = f*3 - 2f2 - f - 3. Calculate c(x). 3 Let u(d) = -d2 + 7d + 10. Let z = 73 + -66. Calculate u(z). 10 Let a(v) = v2 + 3v. Suppose -18k - 20 = -13k. What is a(k)? 4 Let p(r) = 2r2 - 8r - 2. Let i be p(5). Let y(j) = -j*2 + 9j - 7. Calculate y(i). 1 Let m(q) = 1 + 3q3 - 4q*3 - 4q*3 + 0. Determine m(-1). 6 Suppose -5d + 25 = -3n, -2d = -5n - 35 + 6. Suppose -3t = -10 - 2. Let l(x) = -x + d + 2x + t. Determine l(0). 6 Let i = -38 - -35. Let b(f) = 7f*3 + 5f*2 + 9f - 10. Let j(o) = -6o3 - 5o*2 - 8o + 9. Let v(w) = 5b(w) + 6j(w). Determine v(i). -5 Let r(n) = 2 + n - 6 - 1 + 3. Determine r(-6). -8 Let c = 0 - 3. Let r(k) = k*2 + 6k - 1. Let o(z) = -z*2 - 6z + 2. Suppose -4w + 13 + 3 = 0. Let x(b) = wo(b) + 5r(b). Calculate x(c). -6 Let g(p) = -p2 - p - 2. Let f be 2(25/(-5) + 4). What is g(f)? -4 Let x(f) be the third derivative of -f6/120 + f5/10 + f4/3 - f3 - 6f2. Determine x(7). 1 Suppose 3p = -2p + 35. Let m be (-2)/10 - (-22)/10. Let b(h) = -p - 2hm + h3 - 5h - 3h + 6h*2. Det	{ "pile_set_name": "DM Mathematics" }
53 = 10h - 9083. What are the prime factors of h? 19, 37 Let y = -294 - -206. List the prime factors of ((-56)/(-32))/((-2)/y). 7, 11 Let i = -27 - -40. Suppose 4w + 108 = 4u, -35 - i = -2u + 4w. Let h = u + 3. What are the prime factors of h? 3, 11 Let w be (3 - -5)(-10)/(-8). Suppose 5q + 80 = w. Let n = 18 + q. What are the prime factors of n? 2 List the prime factors of 4/161898. 3, 7 Let k(i) = -2i - 8. Let l be k(-4). Suppose 0 = 5r + n - 19, r + ln = -n + 7. Suppose 4d + w - 3w = 90, -rd + 87 = 5w. List the prime factors of d. 2, 3 Let d(r) = 30r2 + r - 2. Let n(o) = o2 + 4o - 11. Let g be (1 - -8)/(18/(-12)). Let f be n(g). What are the prime factors of d(f)? 29 Let j(w) = -w*2 + 4. Let y be j(0). Suppose -yu + 40 = -0u. List the prime factors of u. 2, 5 Let y(w) = -w3 + 6w*2 - 7w + 5. Let m be y(4). Suppose 5n - m = 11. Suppose -nh + 10h - 192 = 0. List the prime factors of h. 2 Suppose -p + 303 = -5k - 32, -345 = -p - 5k. List the prime factors of p. 2, 5, 17 Let t = -30 - -35. Let m(o) = 2o3 - o2 - 2o + 4. What are the prime factors of m(t)? 3, 73 Let t = -47 + 43. Let x(l) = 5l*2 - 7l - 6. What are the prime factors of x(t)? 2, 3, 17 Let s(t) = t*3 + 13t*2 + t + 10. Let a be s(-13). Let o(l) = 6l*2 - l. List the prime factors of o(a). 3, 19 Let d(q) = 4q*2 + 4q + q*3 - 1 - 4q*3 + 2. Let x be d(-3). Suppose 4u + 10 = x. List the prime factors of u. 2, 3 Let m be 0 + 1 - 60/6. What are the prime factors of 48/m(1 - 4)? 2 Let a(p) = -p3 + 5p*2 - 3p - 1. Let o be a(3). Suppose 0 = -of + 12f - 8. What are the prime factors of f? 2 Let q(c) = -c*2 + 9c - 5. Let m be q(6). Suppose -9s + 132 = -ms. Let u = s + 56. List the prime factors of u. 23 Suppose u + q = -0u - 11, 11 = -u + 3q. Let o = 2 - u. List the prime factors of o. 13 What are the prime factors of 3/7 - (4720/(-28) + 8)? 7, 23 Suppose 0 = -g - 3j - 3, -3 + 0 = 4g + 3j. Suppose g = -6v + 172 + 482. List the prime factors of v. 109 Suppose 3w + 0w - 336 = 0. Suppose 0 = -0c - 2c - 8, 2i - 162 = 5c. Let p = w - i. What are the prime factors of p? 41 Suppose -k - 3592 = -4j, j - 909 = -0j + 3k. What are the prime factors of j? 3, 13, 23 Suppose -5n = -5k - 230, 4 = 3k - 5n + 152. Let i = k - -66. Suppose -2h + h + 2m + 28 = 0, 0 = h - 5m - i. List the prime factors of h. 2, 3, 5 Let b(k) = k*2 + k + 1. Let a(g) = 7g*2 + 8g + 12. Let x(i) = a(i) - 6b(i). List the prime factors of x(-8). 2, 3 Suppose 0 = -0r + 2r - 8. Suppose 3w - d = 12 + 4, -w + d = -r. What are the prime factors of w? 2, 3 Let v(o) = 2o2 - 2o - 1. Let f = 8 - -1. Suppose 0 = 4u - fu - 10. List the prime factors of v(u). 11 Let v = -3 + 630. List the prime factors of v. 3, 11, 19 Let y(q) = -8q - 6q + 4q. Let a be y(-2). Suppose -5k + 2i + a = 0, -3i = -2k - 4 + 1. List the prime factors of k. 2, 3 Suppose 4i = -4m + 52, -2m + 2i + 64 = m. Let z = 30 + m. What are the prime factors of z? 2, 3 Suppose -1499 = -5m + 2q, 2m - 1514 = -3m - 3q. List the prime factors of m. 7, 43 Let c(z) = -z*2 + z + 25. Let n be c(0). Suppose 3t = -3t + 12. Suppose j = tj - n. List the prime factors of j. 5 Let i = 48 - 44. What are the prime factors of 5904/60 - i/10? 2, 7 Let x(u) = 1013u2 - 94u - 191. List the prime factors of x(-2). 4049 Let s = 44 + -42. Let c(m) be the first derivative of 10m3/3 - 2m - 2. What are the prime factors of c(s)? 2, 19 Let z = 25 - 21. Suppose -zh + 117 = 5h. Let v = 36 + h. What are the prime factors of v? 7 Suppose 6 + 1026 = 4c. What are the prime factors of c? 2, 3, 43 Let u = -108 + 253. What are the prime factors of u? 5, 29 Let u(s) = 14s*3 - 2s*2 + 2s - 1. Let p be u(1). Suppose pv + 635 = 18v. What are the prime factors of v? 127 Let x be (-5)/((-5)/2)-1. List the prime factors of 116/x33/(-22). 3, 29 Let g = 639 - -1438. What are the prime factors of g? 31, 67 Let h(p) = 2p3 + 31p*2 - 3p + 42. List the prime factors of h(-15). 2, 3, 13 Let t(m) = m*2 + 7m + 7. Suppose -x + 7 = -v - 0, -2v + 40 = 4x. List the prime factors of t(x). 151 Let l(z) = -z*3 + 7z*2 + 11z - 20. Let s be l(8). Suppose sp = 3p + 34. List the prime factors of p. 2, 17 Let s = 330 - -175. What are the prime factors of s? 5, 101 Suppose 4o - 164 = -0o. Let l = 81 - o. What are the prime factors of l? 2, 5 Let a(i) = 28i2 - i + 4. Let h be a(3). Suppose 4v = h + 31. What are the prime factors of v? 71 Let g = -222 + 594. List the prime factors of g. 2, 3, 31 Let z be (-22)/(-55) + 4/(-10). Suppose -5n = -5q - 59 - 46, z = 5n + 3q - 113. List the prime factors of n. 2, 11 Let t(w) = 29w2 - 4w - 5. Let f(l) = 3l + 16. Let q be f(-6). What are the prime factors of t(q)? 7, 17 Suppose -27g = -39g + 7224. List the prime factors of g. 2, 7, 43 Let r(f) = f2 - 5f - 2. Let n be r(7). Let c = -29 + 30. Let b = n + c. What are the prime factors of b? 13 Suppose -25 = -5t, -2d - t = d - 557. What are the prime factors of d? 2, 23 Let z(b) = -b*3 - 6b*2 + 6b - 3. Let j be z(-7). Suppose 5d - 34 - 31 = -f, 20 = -jf. List the prime factors of d. 2, 7 Suppose 3y = 3g + 8811, -13g - 3 = -10g. List the prime factors of y. 2, 367 Let i = -24 + 35. Let b = i + -17. List the prime factors of 63 + b(-2)/(-3). 59 Suppose -3g = -2u + 3u - 741, 5u = -2g + 3692. List the prime factors of u. 2, 3, 41 Suppose -982 = -45j + 43j. List the prime factors of j. 491 Let b be (1 - 7)(-20)/30. Suppose -2k + 289 = 5w, 2k + 2w = bw + 324. List the prime factors of k. 157 Suppose 4b - 894 - 498 = 0. Suppose 5g + 0w - b = -3w, 2w = -8. Let x = -25 + g. What are the prime factors of x? 47 Let i(q) = -q3 + 7q*2 + 3q - 6. Let k be i(7). Suppose -5 = -5p - k. Let a = 15 - p. List the prime factors of a. 17 Let u(t) = t3 + 13t*2 + 15t + 38. List the prime factors of u(-12). 2 Let b be ((-4)/10)/(5/(-25)). What are the prime factors of (-570)/(-40) + b/(-8)? 2, 7 Let k = 436 + -258. Let s = k + -18. What are the prime factors of s? 2, 5 Suppose t + 2i - 7i = -25, 5t + i + 47 = 0. Let d = t + 13. Suppose 17 = s - dz, 4s = s - z + 31. List the prime factors of s. 11 Let g be 10 - (-8)/(-2) - 1. Let v(p) = p3 - p2 - 5p - 7. List the prime factors of v(g). 2, 17 Suppose 4i - 16 - 12 = 0. Let v = 1 + i. Suppose g - v = -2. List the prime factors of g. 2, 3 Let k(j) = 4j*2 - 2j + 14. Let n be k(-6). Suppose 2y - 5q = -y + n, q = 2. What are the prime factors of y? 2, 3, 5 Let r be 5/(5/(-61))-5. Let o = -139 + r. List the prime factors of o. 2, 83 Let x be (30/50)/((-1)/(-25)). Let t(p) = xp*2 + 16p*2 + 1 - 5p - 28p2. What are the prime factors of t(4)? 29 Let w(b) = -b3 + b2 - 8b + 1. Let j be w(2). Let p = 57 + j. What are the prime factors of p? 2, 19 Let g = 1069 - 749. Suppose -3p + 299 = -k, -4p - g = -k + 2k. List the prime factors of (2/4)/((-11)/k). 2, 7 List the prime factors of (-9461)/(-9) + (33/(-27) - -1). 1051 Suppose -3y = w - 10, -w - 6 = -0w - 5y. Suppose 7v + 52 = 3k + 3v, 0 = wk - 2v - 86. List the prime factors of k. 2, 3 Suppose -185b + 178b = -2863. What are the prime factors of b? 409 Suppose r + 1119 = 5r + q, -1410 = -5r - 5q. List the prime factors of r. 3, 31 Suppose -4v - 545 = -9v. List the prime factors of v. 109 Let r(w) = -8w - 5. Let z be r(7). Let y = z + 19. Let b = -27 - y. List the prime factors of b. 3, 5 Suppose 735 = 21w - 20w. List the prime factors of w. 3, 5, 7 What are the prime factors of (836/(-3) + -3)-3? 5, 13 Let p(u) = -137u - 25. Let d be p(4). What are the prime factors of d/(-6) + (-3)/2 + 1? 5, 19 Suppose -d - 5z = -304, z = 3d - 0z - 864. Suppose 4v - d + 45 = 0. List the prime factors of v. 61 Let s = 132 - 66. Suppose -s = -4b + 2. List the prime factors of b. 17 Let z(q) = -q*3 + 5q*2 - 3q - 4. Let c be z(4). Suppose c = 4d + 2d - 546. Let x = d - 32. What are the prime factors of x? 59 Let w(t) = 13t2 + 5t + 66. List the prime factors of w(-8). 2, 3, 11, 13 Let x be (16/(-20))/((-4)/(-10)). What are the prime factors of x + (-245)/(-5) + 0? 47 Suppose -472 = -6*g - 184. Let l = g + -31. List the prime factors of l. 17 Let r(	{ "pile_set_name": "DM Mathematics" }
te ((-7)/73)/36. -6 What is 7/((-6)/6611)? -7 21-7(-93)/434 3 Calculate ((-16)/24)/(((-58)/60)/(-29)). -20 What is the value of (-7)/(-285)-51/42-9? 1/38 Calculate (-1)/(128/40)(-4)/(-20). -1/16 What is the value of (-55)/(990/324)5/10? -9 What is the value of (-3)/((4/(-8))/(2/455))? 4/3 Evaluate -35(-5)/(3675/(-30)). -10/7 What is the value of 17/(-21)9? -3 What is (39/26)/(16/(-640)4)? -15 What is the value of (43/(-36)-16)/((-56)/(-12))? 8/7 What is (2(-1)/26)/((-654)/1962)? 3/13 -11296/870 -1/5 What is the value of (-1008)/24020/(-6)? 14 Calculate (8/((-736)/598))/((1/(-1))/2). 13 Evaluate (2/(-8))/(((-376)/(-736))/47). -23 Evaluate (7752/(-133))/(-17)1/((-6)/(-28)). 16 Evaluate 10/(-1)8/13617. -10 What is the value of ((-250)/4)/(-25)4/351? 2/7 Evaluate (9/6)/(48/(-88)(-11)/20). 5 Calculate 1222/59427. 12 (-1)/(-10)(-2775)/(-222) 5/4 Evaluate 1827/(-2030)(-2)/(24/(-5)). -3/8 Calculate (-3)/((-15)/(-5))11. -11 What is the value of 4/((-128)/4)(-304)/1912? 24 Evaluate 1/(((-9)/78)/(147/98)). -13 Evaluate 2/32822. 11 Evaluate (2/(-20))/((-96)/176011). 1/6 (-1)/220(-3)/6 0 Evaluate 6/630/(-35)(-70)/45. 4/3 Calculate 3/22344/129. 4/11 (-31)/(((-4)/6)/((-12)/9)) -6 (-14424/756)/(12/(-14)) 16/3 What is the value of 6((-4)/(16/(-6)))/((-222)/(-74))? 3 Evaluate ((-18)/93/(-2))/(120/(-440)). -11 Calculate 320/(-10)14/28-1. 16 Calculate -41(-768)/(-6912). -4/9 3/2((-3120)/(-45))/(-13) -8 What is (-18(-7)/(-924))/(18/12)? -1/11 ((-2)/2)/(1/(-5)68/(-340)) -25 ((-1)/(-5))/((-36)/101) -1/18 Evaluate ((-62)/((-11718)/(-81)))/((-30)/(-7)). -1/10 What is (872/33354)/(2/6-2)? -2/51 What is (-217)/(930/(-30))-3? -21 Calculate (4224/(-6864))/((-10)/13). 4/5 What is the value of (11/3)/((1680/216)/(-70))? -3 What is 182/4(-23)/(-69)? 3 (74/(-111))/(((-2)/14)/((-216)/(-42))) 24 What is the value of (3/30)/((-294)/630)? -3/14 What is the value of 4674/3116(8/10)/(18/(-465))? -31 What is -2616(-32)/1024? 13 Calculate 34(18/63)/(2/(-7)). -34 Calculate -515/(-50)42/18. 7/2 Evaluate ((-5)/(-2))/(497/6958). 35 What is the value of (10/42)/(2745/17934)? 14/9 (-2)/(140/(-14))4/((-60)/(-175)) 7/3 Evaluate ((-81)/(-135))/(4/(-20)). -3 What is the value of (46/(-23))/((-14)/35)? 5 What is the value of ((4554/44)/(-69))/(3(-3)/(-12))? -2 Calculate (((-44)/(-330))/(6/(-30)))/((-1)/(-2)). -4/3 What is (-444/(-40)1)/(30/75)? 11 What is (15/(-4))/((-7)/(-4))? -15/7 Calculate ((-1)/(-2))/((-6(-435)/(-60))/6). -2/29 Evaluate (-6)/(-55)192/(-128)20/(-18). 2/11 ((-1)/3-2)/((-18)/189-28) 1/4 -2(-12)/(-4)19/38 -3 What is the value of (3/(-48))/(555/17760)? -2 ((22/(-10))/(-11))/(9/(-15)) -1/3 What is the value of (-1)/(-2)(22230/(-1729))/((-9)/(-42))? -30 What is ((-12)/(-128))/((-4464)/(-7936))? 1/6 What is (3(-19)/(1881/44))/(2/1)? -2/3 What is 96/(-32)(-20)/(-70)21/(-207)? 2/23 What is the value of ((609/28)/29)/((-3)/6)? -3/2 (3310/(-15))/((-8)/(-4)) -11 Evaluate (7/4)/(77/88). 2 What is the value of 243/((-120)/(-5))? 3 Calculate ((612/(-18))/17)/((-4)/26). 13 Calculate ((-9157)/18314)/(7/6(-1)/(-42)). -18 Calculate ((-20)/(-220)253)/(-1). -23 41(-11)/572 -1/13 What is the value of 23/92-82? -4 What is the value of ((-156)/(-9))/2633? 22 What is (-3)/((-19)/((-76)/9))? -4/3 What is (27/2)/(2025/45)? 3/10 Evaluate -3((-280)/(-36))/(-5)(-6)/(-2). 14 Calculate (-15)/(38(-22)/(-3344)). -20 ((-104)/39)/((7/(-9))/(5/(-15))) -8/7 (-7)/(-21)6/(-24)-4-33 -11 ((-119)/(26180/264))/(-133) 2/55 (-76)/2394(-2)/(4/6) 2/21 Evaluate 9/6-118/(-66). 2 Evaluate (4/39(-63)/42)/(2/1). -1/13 What is the value of (8/(-6))/(6710/(-1830))? 4/11 What is 810/8775(-5)/1? -6/13 (0/((2/(-5))/(48/240)))/(-1) 0 What is 1/((42/(-84))/((-2)/11))? 4/11 Calculate (5/2)/((-12)/((-8640)/(-300))). -6 Evaluate ((-126)/3612-43)/((-2)/(-24)). 18 What is ((-210)/315)/(-132/6)? 2/13 Evaluate (44132/2541)/((-88)/(-28)). 8/11 What is (-13)/(7/(280/48))? -5/2 What is the value of (3410/(-1364))/(10/(-132))? 33 What is the value of (15/20005)/(126/(-105))? -1/32 Evaluate (-10)/6117/260(-44)/165. 1/5 (-12)/(-14)(-23)/(-276)-4 -2/7 ((-372)/16)/(84/392035) -31 ((-3568)/(-8697))/((-72)/(-78)) 4/9 What is the value of (6/(-15))/(7/(3185/(-26)))? 7 What is the value of (17/((-323)/6))/(-3)? 2/19 Evaluate ((-13)/(-65)30)/((-2)/3). -9 2/5(-1)/(16/8)90 -18 What is the value of 0/(-49)2/(-4)1/2? 0 1/211533/73 1 What is the value of (55/5)/(594/1242)? 23 What is (18/660)/(96/128)? 2/55 Calculate (3/(3/5))/((-23)/1155). -5 Evaluate ((-3)/8)/((-101)/4040). 15 What is the value of 49/28132/(-165)? -7/5 What is ((15/(-4))/5)/((-7155)/5300)? 5/9 22/5(-13)/((-130)/75) 6 Calculate 2/(-5)(-201)/(-134). -3/5 Calculate -21(5/12510)/((-48)/20). 7/2 What is the value of (-44)/154(-21)/24? 1/4 (45(-24)/(-1800))/(6/250) 25 Calculate (-26)/((-2080)/(-15))2/(-3). 1/8 What is the value of (87/(-87))/(4/(-19))4? 19 What is the value of ((8/(-6))/((-150)/(-450)))/(-4)? 1 8/(-80)610/1 -6 Calculate (24/(-108))/((5/3)/(-1)). 2/15 What is ((-425)/357)/(-25)4/4? 1/21 Calculate (60/(-12))/(-20)4/3-1. -1/3 (100/(-140))/(25/(-70)) 2 (4/(-24)-9)/((-2225)/(-300)-9) -2/89 What is the value of ((1020/(-560))/51)/(2/(-16)-5)? -2/35 What is (-110/20)/(1/44)? -22 Evaluate 9/((-171)/19)5. -5 What is 2098/(-420)12/14? -4 Evaluate (0/1)/((-4)/12-6). 0 What is the value of ((-12)/(-7))/(29/(2436/120))? 6/5 (-98)/147(2/(-4))/(1/30) 10 Evaluate (-33)/1119/(-38)-16. -9 18/(-135)-3(-160)/(-96) 2/3 Calculate 6/(-10)(-4300)/1290. 2 What is the value of 4/12195/30-12? -26 What is ((4-60)/8)/2? -15 What is the value of ((-3)/4)/(1(96/40)/(-4))? 5/4 Calculate ((203/(-435))/((-5)/50))/2. 7/3 Evaluate (8/(-54))/((-14)/21). 2/9 Evaluate -52(-18)/(-72)1. -13 What is 12/(-8)(-616)/(-2772)? -1/3 What is (1155/84)/((-5)/4)? -11 (-80)/(-16)8/820 2/41 What is the value of (1856/(-6032))/(((-2)/(-3))/(-1))? 6/13 Evaluate ((-2)/(-1))/(483/161). 2/3 What is (-5)/(-4)-255/(2475/(-216))? 12 What is the value of (-4)/((-4)/(-10)-10)11? 11 What is the value of (-8)/(-3)(-351)/(-5616)? 1/6 Evaluate (-4)/6(-714)/(-3094). -2/13 (16/((-320)/(-175)))/(25/(-40)) -14 What is the value of (32/(-6))/2(-11)/((-1408)/864)? -18 (34(-12)/(-2380))/(((-3)/(-5))/(-1)) -2/7 What is ((10/(-60))/((-1)/(-4)))/((-4)/24)? 4 -25(-37)/925132/(-2) -13 Calculate (-54)/(-16)((-48)/9)/(-2). 9 Calculate ((-909)/(-7575))/(5/(50/(-4))). -3/10 What is the value of (8/9692)/((-4)/120-10)? 23 What is the value of (-25578)/(-9947)28/(-6)? -12 ((-60)/294)/1028/(-8) 1/14 (42/(56/(-4)))/1 -3 Evaluate ((-22)/(-66))/((-2)/66). -11 Calculate (12/135)/(((-264)/(-30))/(-22)). -2/9 ((-12)/(-224))/(-3(-18)/(-432)) -3/7 What is the value of (54/9)/((4/6)/(92/(-138)))? -6 Evaluate ((-2)/(-108))/(-5337/(-7844)). 2/27 -161438/(-532) 16 (-1)/((-10)/8)(-443)/(-8860) 1/25 What is the value of (17/((-714)/28))/(1/6)? -4 ((-2712)/(-791))/((-88)/(-28)) 12/11 Calculate (-18)/(-135)-10((-3)/(-16))/(-3). 1/12 What is the value of ((-2336)/(-64))/(-73)158/(-4)? 29/4 Calculate 5/(-10)-8((-99)/(-22))/(-1). -18 What is the value of (20/16)/(((-6125)/1176)/(-125))? 30 ((-24)/21)/(380/(-266)) 4/5 What is ((-9)/(-5))/(70/((-80500)/(-138)))? 15 Evaluate 626/(-2067)(-1)/(-2). -2/53 Evaluate 0/((-24)/((-132)/22)). 0 What is (((-161)/(-21))/(-23))/(31/9)? -1 What is 45/(-12)3(-36)/(-81)? -5 What is 2((-462)/(-105))/(8/(-10))? -11 54/1283/(-18) -6 What is the value of (-7)/2-44(-32)/115808? -2/47 Evaluate (8/(72/3))/(2/(-27)). -9/2 What is 5(-96)/(-9)33/110? 16 (1300/(-100))/(2/4) -26 Evaluate (-368)/(-368)1/((-1)/2). -2 Evaluate (55/176)/((-35)/(-14)). 1/8 Evaluate ((-10348)/597)/((1/(-5))/(27/(-90))). -26 What is (-506)/(-23)(-4)/8? -11 Calculate -920/(-18)339/226. 15 What is the value of (2805/(-5))/(-11)(-11)/(-33)? 17 What is the value of ((-4)/841)/(3/(9/1))? -1/7 (44/(-110))/((-96)/(-20))2-5 5/6 What is (1/((2/(-2))/(-1)))/(133/(-266))? -2 Calculate (-624)/858(-22)/4. 4 Calculate 233/(-88)4. -3 What is the value of 27/((-10098)/(-22))-2? -2/17 Evaluate (-72)/(22/(-11))(6/3)/(-6). -12 Evaluate (21/(-15))/((4/(-60))/(3/(-9))). -7 Evaluate ((-46)/23	{ "pile_set_name": "DM Mathematics" }
he form qv2 + jv*3 + x + av and give j. -5662 Express n - 83 + 156 - 84 in the form fn + w and give w. -11 Rearrange (-q - 2q + q + 2)(9q - 8q - 32q) + 10 - 10 - 2q2 to h + cq + yq2 and give y. 60 Rearrange ((-3p - 3p + 4p)(6 - 6 + 1) - 5p + 4p + 0p)(9p + 0p - 3p)(3p - 3p - p) to vp*2 + sp + tp3 + q and give t. 18 Express (-m2 - 2m*2 + 5m*2)(3 - 3 - 2m)(1270m + 4575m - 551m) as o + xm*3 + im*4 + pm + nm2 and give i. -21176 Rearrange (3 + 1 + 57)(8m + 8m + 0m) to the form d + pm and give p. 976 Rearrange (-15p + 66p - 16p)(66 - 6p2 - 66) to xp*3 + fp*2 + u + op and give x. -210 Rearrange (3 - 3 - 7)(h + 0h + h)((3 - 2 + 1)(1 + 1 - 3) + (-25 - 22 + 4)(0 + 0 - 1)) to the form mh + r and give m. -574 Rearrange f*3 - 3f*3 + f - 22f*4 + 24f*4 + 18 to qf + if2 + zf*3 + a + of*4 and give a. 18 Rearrange 6607 + 295d - 6607 to the form m + id and give i. 295 Express (-2z + 7z + 0z)(-3z*2 - 4z*2 + 2z*2) + (3z + 2z - 3z)(5z*2 - 3z*2 - 3z*2) in the form r + hz + az3 + xz*2 and give a. -27 Express -6y + 1 - 7 - 8y - 2y + 12y in the form ty + c and give c. -6 Express 3c3 + 276 + 98 - 597 - 2c*3 as j + ac*3 + rc*2 + tc and give j. -223 Rearrange -256o + 7o - 203o - 398o - 5o + 3o + 4o + (1 - 5 + 2)(-o + 0o + 2o) - 2o + o + 0o - 4o + 4o - o to the form po + c and give p. -852 Rearrange ((2 + a - 2)(9 - 4 + 6) - a - 2a + 0a)(5a - 2a - 2a) to the form w + la + va*2 and give v. 8 Express (3 - 3u - 3 - 3u + 0u + 4u + (2 - 1 + 1)(-3u + u + 0u) - 2u + 0u + u)(-27 - 15 - 10) - 3u + 2u - u as vu + t and give v. 362 Rearrange -4o2 + 1010 - 4o*2 - 999 to the form ho*2 + c + vo and give c. 11 Express (-3 - 1 + 3)(13 - 4 + 6)(0x + 0x + 3x)(-x - x - x) in the form dx + hx2 + p and give h. 135 Express -f3 + 32 + 3f4 + 6f*4 + 0f + 2f - 28 as gf*3 + tf + i + qf2 + hf*4 and give i. 4 Rearrange (-13 + 7x*2 + 13)(-2 - 3 + 2) + (3x + 4x - 6x)(-3x - x + 5x) to w + bx2 + mx and give b. -20 Rearrange 5 - 3 - 146k2 - 2 to y + qk + uk2 and give y. 0 Express 13v*2 + 490v - 490v - 2 in the form ov + i + hv2 and give i. -2 Rearrange 150i - 308i + 158i + 208i2 to ji + xi2 + r and give x. 208 Express -2a + 139a3 - 8a - 137a3 in the form ha + ga3 + p + ka2 and give h. -10 Express (c3 + 10c - 10c)(0 + 7 + 14)(-5 + 1 + 2) in the form yc2 + uc*3 + pc + h and give u. -42 Rearrange 42839 + 2v + v3 + 3v*2 + 0v*3 - 42839 to the form p + av*2 + xv + jv3 and give j. 1 Express 4t - 2t - t - 6t - 5t + t + (t + 2 - 2)(5 - 2 - 1) + 17t + 20t - 34t - t - 4 + 4 in the form u + pt and give p. -5 Express (-168d + 12d*2 + 168d)(-13 - 1 + 0)(-1 - d + 1) as pd2 + t + xd*3 + rd and give x. 168 Express -x*3 - 2x + 11x2 + 19x2 + x4 + x*2 in the form cx*3 + ox*2 + gx + tx4 + h and give h. 0 Rearrange (3q + 2 - 2)(1 - 3 + 1)(388 - 18 - 201) to the form k + iq and give i. -507 Express (-2r - 4r + 7r)(-8r - 14r - 186r) in the form x + jr + ar*2 and give a. -208 Rearrange -2k + 0k + k3 + 86k*2 - 68k*2 to the form rk*2 + sk + hk3 + i and give s. -2 Rearrange 205t - 41 + 16 + 23 to the form u + ft and give u. -2 Rearrange (-3 + 5 + 0)(3v - 3v + 2v)(-565641 + 565641 - 1065v2) to the form dv*3 + w + sv*2 + hv and give d. -4260 Rearrange (-t*2 + 2t*2 + 0t*2)(7t - 78t + 21t) + 2t*3 - 2t*3 - 5t*3 to it*2 + lt + g + xt3 and give x. -55 Express (5f - 5f + f)(-2f - f + f) + (3f + f - 2f)(31f + 105f + 2f) as y + cf*2 + kf and give c. 274 Express (-2q2 - q3 + 2q*2)(-1 + 0 + 7)(4 - 4 + 14) in the form vq*2 + dq*3 + c + nq and give v. 0 Express (-1 + 2i + 1)(-836 + 847 + 3i + 3i) in the form ni + bi*2 + o and give n. 22 Rearrange 0w3 - w3 - 2w3 + (404 - 40w*2 - 404)(3w + 0w - 4w) to the form hw + zw2 + mw*3 + i and give m. 37 Express 1192 + 644n*2 - 1192 as wn + ln2 + z and give z. 0 Express 0f*3 + 8f + 13f2 - 10f*2 + 9f*3 as c + tf + sf2 + jf*3 and give s. 3 Rearrange (-2l + l - l)(-2 - 3 + 3) + 5l - 4l + l + (3 + 1 - 6)(-1 + 1 + l) + 70l + 8l + 22l to rl + f and give r. 104 Express ((-3 - 1 + 2)(8 - 3 - 1) - 17 - 38 + 20)(4 + 2i4 - 4) in the form gi*3 + v + ki*2 + xi + wi4 and give x. 0 Express (-57d + 96 - 96)(-5 + 3 + 3d*2 + 0) as p + zd*2 + bd + md3 and give b. 114 Rearrange 11w*2 + 0 - 6w2 - 4 + w2 to b + fw + jw2 and give j. 6 Rearrange y2 + 4y2 - 2y*3 - 7y*2 - 6y + 5y3 + 13 - 4y*3 to qy*3 + z + uy*2 + sy and give s. -6 Express 3c2 - 4c*2 + 4c*2 + (0 - 3 - 3)(-3c2 + 5c*2 - 3c*2) + 98c*2 - 166c + 166c as vc + ic2 + h and give i. 107 Rearrange l3 + 8 + 1 - 22l + 41l + 2l*2 - 18l + 9l4 + 0 to the form jl*2 + yl*3 + rl*4 + i + kl and give r. 9 Rearrange (12v + 0v*2 + 2v*2 - 7v)(39v + 38v + 73v) to the form rv2 + gv + k + pv3 and give p. 300 Rearrange (-11 + 9 - 22)(3753 - 70h - 3753) to p + dh and give d. 1680 Rearrange 19s3 - 40s*3 + 54s*4 + 19s*3 - 120s*2 + 118s*2 to js*4 + fs + ls3 + ks*2 + a and give l. -2 Rearrange (c - 2c + 0c)(-9 + 37 + 53)(1 - 1 + 2c*2)(2 - 1 + 5) to n + kc2 + uc + ic3 and give i. -972 Express (11p + 10p + 0p)(-4p*3 + 8p3 + p3) in the form hp + x + zp*2 + jp*4 + sp*3 and give j. 105 Express (-4s*4 + 6s*4 + 6s*4)(0 + 1 + 0 + 4 - 6 - 5 + (2 - 1 - 2)(0 + 1 + 1)) in the form qs*4 + ys + fs3 + w + ps*2 and give q. -64 Express (0h - 2h + 3h)((3 - 1 - 3)(2h + h - h) + 378h - 377h + 6 + 0) in the form k + gh + lh2 and give l. -1 Rearrange (-1 - 3 + 7 + (3 + 0 - 2)(-1 - 3 + 2) - 3 + 2 + 3 - 4 + 2 + 4)(-3 + 2 + 2)(3 + 8 - 4)(-5v + 27 - 27) to kv + i and give k. -175 Rearrange -3g*3 + 4g*3 - 4g*3 + (-g + 2g + 0g)(2g2 + 3 - 3) - 5g*3 - 2g*3 + 2g*3 to tg + p + sg2 + cg*3 and give c. -6 Rearrange (-9116i + 5148i + 9261i)(-i + 5i - 3i) - 5i*2 + 0i*2 + 3i2 - 4 - i2 + 4 to yi2 + u + fi and give y. 5290 Rearrange 120k + 4k - 267k to zk + g and give z. -143 Rearrange (-2m3 - m + m)(10686 + 10686 - 20650) to the form pm2 + km + sm3 + j and give s. -1444 Express -139s + 331s - 2269s - 561s as w + ps and give p. -2638 Rearrange n*3 - 172n + 3 - 3n4 + n4 + 170n to h + sn + ln*3 + zn*4 + qn*2 and give h. 3 Rearrange (-13k - 19k + 44k - 21k)(12k2 - 61k + 61k + k3) to the form v + rk*3 + mk*4 + zk*2 + nk and give r. -108 Express 3c + 2c - 3c + (-1 - 2 + 4)(c - 6c + 3c) + 1 - 2c - 1 + (1 - 1 - 2)(17c + c + 12c) as oc + a and give o. -62 Rearrange (-2f - 4f + 3f)(-3 + 3f + 8 - 3)((-2 + 6 - 3)(4 + 2 - 4) + 5 - 5 + 3) to yf2 + pf + o and give y. -45 Rearrange -4q4 - q - 4q - 1 - 68q2 + 5q + 3q4 to the form jq + aq3 + fq*4 + xq*2 + d and give x. -68 Express (0 + 0 + 4)(-3x + 2x + 0x)(1 - 2 + 0)(13 - 23 + 11) in the form ax + h and give a. 4 Express -9r - 50r - 22r - 6r as g + cr and give c. -87 Express 8s - 8s - 6s*3 + (-s - s + 0s)(-s2 + 0s*2 + 0s*2) + (-2s*3 - 3s*3 + 3s*3)(-2 + 3 - 7) as ns2 + is + ds3 + m and give d. 8 Express 12p*2 - 5p2 - p2 - 27p - 4p*2 in the form up*2 + b + wp and give u. 2 Express s - 7 + 13 + 2s2 - 4 - s4 as hs + d + ms3 + bs*4 + js*2 and give j. 2 Rearrange (505 - 14x*4 - 505)(1 + 0 + 1) - 15x2 + 15x*2 + 2x*4 to sx*4 + qx*3 + rx + bx2 + i and give s. -26 Express -2q + 3q + 497 - 228 - 51q*2 + 53q*2 as kq + m + aq2 and give m. 269 Rearrange -l3 - l2 - 103l*4 - 5l - 99l4 - 100l*4 + 299l*4 - 6 to the form wl*2 + jl*4 + pl*3 + k + vl and give k. -6 Express (45u - 29u - 25u)(-1 + 3 - 4)(-3u*2 + 3u2 - u2) - 4u2 + 4u*2 + 3u*3 in the form ou + zu3 + bu*2 + k and give z. -15 Express -1424x + 1992x - 2 + 2 as ix + u and give i. 568 Express (2r - 2r - r)*(1236 + 2099 -	{ "pile_set_name": "DM Mathematics" }
w + 13 = -l. Let a = c - 26. List the prime factors of a. 11 Let w(r) = 9r*2 - 2r + 2. Let h be w(1). Let t = h + 0. List the prime factors of t. 3 Let x(h) = -h - 4. Let c be x(-7). Suppose -2q - cq = -110. Suppose 2d + 2o - q = -2d, -d - 2o = -1. What are the prime factors of d? 7 Let a = 36 + -21. Let z be (6/a)/(1/5). Suppose -x - z = -3x + 5d, -4x - d + 48 = 0. List the prime factors of x. 11 Let n(v) = -v2 - 6v + 2. Let s be n(-6). Let g = 63 + s. Suppose -9x + 4x + g = 0. What are the prime factors of x? 13 Let q = -11 + 39. Suppose 0 = -i + 4i - 3b - 96, -i = -5b - q. What are the prime factors of i? 3, 11 Let j(i) = i2 + 8i + 8. Let g be j(-6). Let h be 7/((-7)/6) + -2. Let a = g - h. What are the prime factors of a? 2 What are the prime factors of (-762)/(-21) + 4/(-14)? 2, 3 Let z(g) = g - 2. Let b(r) be the third derivative of -r*4/6 + 3r3/2 + r2. Let a(y) = -2b(y) - 9z(y). What are the prime factors of a(-3)? 3 Let c(s) = -s*2 + 7s - 1. Let n be c(7). Let o = 6 + n. What are the prime factors of o? 5 Suppose 2 = 4t - 3t. What are the prime factors of t? 2 Suppose -3i + 344 = i. What are the prime factors of i? 2, 43 Let x be 1 + 0 - (5 - 4). What are the prime factors of 2 - (-2 - x/1)? 2 Let f(o) be the first derivative of -o4/4 + 4o3/3 + o2 - 3o + 1. Let g = -4 - -6. List the prime factors of f(g). 3 Let t be (-12)/(-18) - 10/(-3). Let q be 2/t(-1 - -5). Suppose 3v - 24 = 2v + qp, -4 = p. What are the prime factors of v? 2 Suppose 438 = 7w + 4. List the prime factors of w. 2, 31 What are the prime factors of (1908/(-24))/(-1 + (-1)/(-2))? 3, 53 Suppose 0 = 8j - 1706 + 698. What are the prime factors of j? 2, 3, 7 Let n(m) = -5m*2 + m + 2. Let p be n(-3). Let o = -22 - p. What are the prime factors of o? 2, 3 Let j(i) = 4i + 8. Let p be j(-6). Let q = 39 + p. What are the prime factors of q? 23 List the prime factors of 1/((-20)/(-6) - 3). 3 Suppose 5x + 5 = 4f - 3, 0 = 2x + 3f - 6. Let s be (4 + -5)/(3/(-6)). Suppose x = n + sn - 12. List the prime factors of n. 2 Let c(l) = l2 + l - 1. Let n be c(-2). What are the prime factors of ((-8)/(-24))/(n/12)? 2 Let u = 8 + -8. Suppose -7 = -uh - h. List the prime factors of h. 7 Let n be 1536/18 - 2/6. Suppose 2i + 2a - 34 = 0, i - a = -4i + n. What are the prime factors of i? 17 Suppose 5z - 58 = 3z. Suppose 0 = -5g + 31 + z. What are the prime factors of g? 2, 3 Suppose -3o = -9 - 0. Suppose -or + 3f - 3 = 0, 1 = -2r - f + 5. List the prime factors of -3(3 - 8/r). 3, 5 Let v(j) = -j2 + j. Let c be v(0). Suppose c = -3x + 3 - 0. Let z = x + 5. List the prime factors of z. 2, 3 Let o(c) = -7c + 5. Let m be o(-5). Suppose -8x + 3x = -m. List the prime factors of x. 2 Let r(q) = 2q*2 + 13q + 9. List the prime factors of r(-8). 3, 11 Suppose 0 = -6k + 18k - 372. What are the prime factors of k? 31 What are the prime factors of (-2)/(112/(-7889)) - (-1)/8? 3, 47 Let v = -43 - -27. What are the prime factors of ((-3)/(-6))/((-4)/v)? 2 Let k(n) = n*2 - 2n - 13. Let j be k(6). Let y = 26 - j. What are the prime factors of y? 3, 5 Suppose 0 = -2f - 4 - 0. What are the prime factors of (-207)/(-27) - f/(-3)? 7 Let a = 0 + 23. Let g = 0 + a. What are the prime factors of g? 23 Let z(y) = -y2 - 7y - 1. Let o be z(-6). Let s(n) = 2n2 - 4n + 1. Let v(f) = 2f2 - 3f. Let b(x) = 5s(x) - 4v(x). List the prime factors of b(o). 3, 5 Suppose -l - 15 = 2l, 0 = -m + 2l + 4. List the prime factors of (-2)/m - (-87)/9. 2, 5 Suppose 3x = 5 + 4. List the prime factors of x. 3 Suppose y - 4y + 357 = 0. What are the prime factors of y? 7, 17 Let z(j) = j*3 - 12j*2 + 9j + 34. List the prime factors of z(11). 2, 3 List the prime factors of (-9)/12 + (-107)/(-4). 2, 13 What are the prime factors of -147(-4 + (-21)/(-6))? 7 What are the prime factors of -4 + 412 + 4 + -1? 3, 137 Suppose 4y = 4 + 12. Suppose 4d = l + 2l - 12, 12 = l - yd. Suppose -6c - 5r = -c - 5, l = -4c - 3r + 6. List the prime factors of c. 3 Let s(n) = -n*2 + n + 1. Let o be s(0). Suppose -2w - 5 - o = 0. Let d = 5 + w. List the prime factors of d. 2 Suppose 0 = -4a - 6 - 2. Let u be a + 0 + 1 + -3. What are the prime factors of (u/(-10) + 2)5? 2, 3 Let n = 7 - 25. Let l = -7 - n. List the prime factors of l. 11 Let t(v) = 2v2 - 4v - 5. Suppose 0 = 3s + 2s. Suppose 5m + s - 20 = 0. List the prime factors of t(m). 11 Suppose a - 8 = 5a. Let f be (3 + 3)/2 - -5. What are the prime factors of ((-6)/4)/(a/f)? 2, 3 Let r = 213 - 103. List the prime factors of r. 2, 5, 11 Let j = -2 + 20. List the prime factors of j. 2, 3 Let j(o) = -o*2 + 5o - 3. Let c be j(5). Let r = c + 4. What are the prime factors of 3/6r6? 3 Suppose -z + 28 + 361 = 5j, j + 5z = 73. What are the prime factors of j? 2, 3, 13 Suppose -7 = 5v - 27. Suppose 5b - 30 = -2u, -vu - 25 = u. What are the prime factors of b? 2 Let m(y) = 3y - 11. Let z be m(5). Suppose -zo = 2o - 96. What are the prime factors of o? 2 Suppose 4c - 6c + 300 = 0. List the prime factors of c. 2, 3, 5 Suppose 2i + 0q + 3q - 34 = 0, 0 = i + q - 16. What are the prime factors of i? 2, 7 Let v(g) = -g*2 + 5g - 5 - 6g - 8g + 1. Let y be v(-8). Suppose -y = r + 2q - 28, 0 = r + 4q - 32. List the prime factors of r. 2 Let s = -27 - -27. Suppose -4x + x + 153 = s. List the prime factors of x. 3, 17 Let i = 73 - 7. List the prime factors of i. 2, 3, 11 Suppose r = 16 + 13. List the prime factors of r. 29 Let q be -3 - 2 - -3 - 11. What are the prime factors of 3/(-3)(-2 + q)? 3, 5 Suppose 8 = 4x - 2x + h, -5x - 10 = -5h. Suppose -5v + 31 = 2w - 0v, -xv = -2w - 4. Suppose wa - 32 = -a. What are the prime factors of a? 2 Let n(q) = 6q - 5. Let v(t) = -t - 1. Let b(z) = -n(z) + 6v(z). What are the prime factors of b(-2)? 23 Suppose -4x + 2 = -2f - 2x, -4f + 5x = -1. Let t = f + 8. List the prime factors of t. 2 Suppose 0 = -2v + 6v + 4j - 280, 0 = -4v + 5j + 289. Suppose v - 3 = 4u. List the prime factors of u. 17 Let d = 84 - 32. Let i = d + -35. List the prime factors of i. 17 Suppose -z + 3 = 0, 0k = 3k - 5z - 1137. List the prime factors of k. 2, 3 Suppose -l = -91 + 19. What are the prime factors of l? 2, 3 Let s be (-12 - -6)1/2. List the prime factors of -95(17/(-5) - s). 2, 19 Suppose 7d + 4a = 4d + 326, -3d + 329 = a. List the prime factors of d. 2, 5, 11 Let g be (7/3)/(1/(-9)). Let o = -13 - g. Suppose -5m + m + o = 0. What are the prime factors of m? 2 Let z(l) = -l3 + 6l*2 - l - 4. Suppose 6q - 15 = 3q. List the prime factors of z(q). 2 Let i = 3 + 0. Let b be 48(-1 - -2) - i. Suppose 0u = -3u + b. List the prime factors of u. 3, 5 Suppose 0 = 6h - 56 - 64. What are the prime factors of h? 2, 5 Let x = -24 + 39. Suppose -x = 5p, 2y = 5y - 5p - 159. What are the prime factors of y/96/4? 2 Suppose -2n - 5k - 5 = -0k, 3n + 3k = 6. Suppose -nz = -27 - 128. List the prime factors of z. 31 Let a = -311 + 550. List the prime factors of a. 239 Let h(j) = -j*3 - 7j*2 - 3j - 9. List the prime factors of h(-10). 3, 107 Let b = -7 - -7. Suppose bw = -w + 14. List the prime factors of w. 2, 7 Let k be -93/1212. Let a(x) = -21x + 3. Let h be a(2). Let l = k - h. What are the prime factors of l? 2, 3 Let z = 11 + 19. List the prime factors of 522/z - 3/(-5). 2, 3 Let o(r) = -70r2 + 14r + 14. Let s(d) = 23d2 - 5d - 5. Let t(h) = -6o(h) - 17s(h). What are the prime factors of t(-1)? 29 What are the prime factors of 1(28 - 2)(2 + 7)? 2, 3, 13 Suppose 4a = -4h + 184, -5a + 10a - h - 224 = 0. List the prime factors of a. 3, 5 Suppose y + 5l - 235 - 158 = 0, 0 = -2l + 8. What are the prime factors of y? 373 Suppose -3d + 21 + 225 = 0. List the prime factors of d. 2, 41 Let f = -11 - -7. Let g(u) = -u. Let s be g(f). Suppose -16 = -sp + 24. List the prime factors of p. 2, 5 Let z be (9/6 - -1)-6. Let t be 25 + (2 - 1 - 1). Let h = t + z. List the prime factors of h. 2, 5 Let x = -16 - -16. Suppose x = -h + 2 + 14. List the prime factors of h. 2 Let r(m) = -m3 - 11m*2 + 11m - 3. Suppose 3n + 33 = -4k + 3k, 0 = 5n + k + 57. List the prime factors of r(n). 3 Suppose 0*c + c + 2 = 0, -l	{ "pile_set_name": "DM Mathematics" }
erivative of 0z - 1 + 1/12z*4 + 0z*3 - 1/6z*2. Solve f(n) = 0 for n. -1, 0, 1 Let l(i) be the second derivative of 1/7i*2 + 0 + 2/21i*3 - 13i + 1/42i4. Factor l(s). 2(s + 1)*2/7 Suppose 3h - 4h - 2s = 0, h + 5s = -6. Factor -1/4y + 0 + 1/4y3 + 1/4y*h - 1/4y*2. y(y - 1)(y + 1)2/4 Let f be ((-64)/12 - 0 - -6)3. Find y, given that -1/7yf + 5/7y + 0 = 0. 0, 5 Let l(c) be the second derivative of 0 + 0c2 + 1/12c*4 - 20c + 1/126c7 - 1/9c*3 + 1/60c*5 - 1/30c*6. Suppose l(a) = 0. Calculate a. -1, 0, 1, 2 Find t such that -16 - 16t*3 + 4 - 20t*3 + 3t*5 + 21t*2 - 9t*4 + 33t*3 = 0. -1, 1, 2 Factor 2/9z*4 + 8/3z*3 + 8/3z - 14 + 76/9z2. 2(z - 1)(z + 3)2(z + 7)/9 Let i be 6/(-9) + 116/12. Suppose 10t - 4t = it. What is u in 0u + 1/7u2 + t = 0? 0 Let o(l) be the third derivative of -5l*8/336 - 5l*7/14 - 37l*6/12 - 11l*5 - 15l*4 - 87l*2. Suppose o(m) = 0. Calculate m. -6, -2, -1, 0 What is i in 4/7i + 0 - 19/7i2 = 0? 0, 4/19 Let l(d) be the first derivative of -5/4d4 - 24 - d5 + 0d + 10d*2 + 20/3d*3. Factor l(h). -5h(h - 2)(h + 1)(h + 2) Let w = 30 - 14. Factor 4 - 2v*2 - 10 - wv + 7v - v2. -3(v + 1)(v + 2) Suppose -k = 2k - 3. Let g be ((-2)/(-5))/(k/10). What is y in -1 - gy - 5y + 3y3 - 1 - 4 = 0? -1, 2 Let y(z) = -z3 - 45z*2 - 16z + 5. Let v(d) = d*3 + 67d*2 + 24d - 8. Let b(i) = 5v(i) + 8y(i). Factor b(g). -g(g + 8)(3g + 1) Let l(x) be the second derivative of -x8/8400 - x7/1050 + 4x*4/3 - 18x. Let w(i) be the third derivative of l(i). Determine p so that w(p) = 0. -3, 0 Solve 22/7c - 20/7 - 2/7c2 = 0 for c. 1, 10 Let u(f) be the third derivative of -f6/60 - 16f5/45 - 17f*4/9 - 32f*3/9 - 209f*2. Factor u(h). -2(h + 2)(h + 8)(3h + 2)/3 Let q = -2176/7 - -313. Factor -12/7 + qa - 3/7a2. -3(a - 4)(a - 1)/7 Let n(z) = -z3 - 22z*2 - z - 18. Let y be n(-22). Let v be (-3)/18(-8)/(-24)-3. Solve -vh*y + 0h + 1/3h3 + 0 - 1/6h*2 = 0. 0, 1 Suppose -3c - 90 = -6c. Factor 5r - 15r - 25r - 5r3 - cr*2 - 5r. -5r(r + 2)(r + 4) Let t(u) be the first derivative of -u3 + 99u*2/2 + 102u - 32. Factor t(n). -3(n - 34)(n + 1) Let z(f) = -2f3 + 2f*2 - 3f - 2. Let a(r) = -r3 + r2 - 1. Let j = -12 + 13. Let w(l) = jz(l) - 5a(l). Factor w(b). 3(b - 1)2(b + 1) Let d(o) be the second derivative of 49o6/180 + 7o*5/12 - 199o*4/72 + 23o3/9 - o2 - 27o - 3. Find p, given that d(p) = 0. -3, 2/7, 1 Let n = 6 - 3. Suppose nm - 2m = 2. Let a + 5a + 3am + 0a = 0. Calculate a. -2, 0 Factor -2/7l3 + 18l + 60/7l2 + 64/7. -2(l - 32)(l + 1)2/7 Suppose 10c = -0c - 1360. Let b be 1/(-7) + (-1)/(70/c). Suppose 12/5k + 36/5k2 + 0 + 33/5k*3 + bk4 = 0. Calculate k. -2, -1, -2/3, 0 Let w(j) be the second derivative of -j4/6 + 11j3/3 - 18j*2 + 3j + 8. Find q, given that w(q) = 0. 2, 9 Suppose -2y + 6 + 10 = 5f, -y + 8 = -3f. Let l(w) be the second derivative of -4/3w*3 + yw*2 + 1/12w*4 + w + 0. What is j in l(j) = 0? 4 Factor 2 - 36 - 2t*2 - 36t*3 - 9 + 46t*2 + 208t - 5. -4(t - 3)(t + 2)(9t - 2) Let u(n) be the second derivative of 0n2 + 3n + 1/8n3 - 1/120n*6 + 1/48n*4 - 3/80n*5 + 0. Factor u(v). -v(v - 1)(v + 1)(v + 3)/4 Let i(n) be the first derivative of -n*6/2 + 7n*5/12 - 5n*4/24 + 17n*2/2 - 6. Let q(a) be the second derivative of i(a). Find f such that q(f) = 0. 0, 1/4, 1/3 Let r = -10 - -3. Let u = -3 - r. Factor -7f*2 - 3f - 2 + 2 + uf2. -3f(f + 1) Let u be (-96)/(-2464) - (3/21)/(-1). Factor -ul*3 - 4/11l*2 + 0 + 6/11l. -2l(l - 1)(l + 3)/11 Let j(q) be the second derivative of 0 + 1/4q*4 + 11q + 24q2 - 4q3. Find p, given that j(p) = 0. 4 Let u(o) be the first derivative of o5/15 + 13o4/12 - o3/3 - 37o*2/6 + 26o/3 + 427. Suppose u(t) = 0. What is t? -13, -2, 1 Let a be 6/4(-2)/(-3). Let b(i) = -i2 - i + 1. Let h(k) = -5. Let g(f) = ah(f) + 5b(f). Suppose g(s) = 0. What is s? -1, 0 Let h(x) = -11x*2 - 38x + 42. Let t(o) = -5o2 - 17o + 22. Let l(w) = 4h(w) - 9t(w). Factor l(r). (r - 5)(r + 6) Let u(w) be the first derivative of w7/28 - w6/20 - 3w*5/20 - 6w - 18. Let f(a) be the first derivative of u(a). Factor f(b). 3b3(b - 2)(b + 1)/2 Let i(l) = 6l*3 + 31l*2 - 25l + 32. Let a(v) = v*3 + 6v*2 - 5v + 6. Let j(o) = 22a(o) - 4i(o). Solve j(g) = 0. 1, 2 Let x be (-136)/153-3 + (-2)/3. Factor 0 + 12/13l + 2/13lx + 2/13l*4 - 8/13l*3. 2l(l - 3)(l - 2)(l + 1)/13 Factor 99/5z*2 - 3/5z*3 - 204/5 + 108/5z. -3(z - 34)(z - 1)(z + 2)/5 Suppose -5w = 4i - 4w + 48, -12 = i - w. Let y be ((-36)/7)/(i/42). Solve -12c + 4c*2 + yc + 26c + 64 = 0 for c. -4 Let o be (48/(-192))/(7/126(-1 + 0)). Let k = 71/14 + -4/7. Factor op2 - 3/2p*3 + 3/2 - kp. -3(p - 1)3/2 Let o(y) be the first derivative of 5/14y*4 - 5/7y*2 + 6/7y*3 - 10 - 4/7y - 2/5y5. Suppose o(r) = 0. What is r? -1, -2/7, 1 Suppose 5d - 9 + 36 = u, -13 = -4u + d. Suppose -3a = 4h - 15, -2a = -3h + 3a + 33. Let -w*2 - 3w*u + 0w + 3w2 - 9 + hw = 0. What is w? 3 Let f(i) be the first derivative of 7i4 + 100i*3 + 96i*2 - 80i - 626. Determine r, given that f(r) = 0. -10, -1, 2/7 Let n(h) be the first derivative of -h*4/6 + 10h*3/9 + 2h*2 - 83. Find f such that n(f) = 0. -1, 0, 6 Suppose -4f - 4v + 8 = 0, 2f - 6 = -f + v. Suppose 70a - 60a = 0. Suppose 0 + ap - 14/9p*3 + 4/9pf = 0. Calculate p. 0, 2/7 Let k(b) = b3 + b*2 + 2. Let a(s) = 4s*3 - 18s*2 + 58s - 36. Let t(c) = -a(c) + 2k(c). Determine o, given that t(o) = 0. 1, 4, 5 Let d(m) be the first derivative of -m6/6 - 2m5/5 + m4/4 + 2m3/3 + 59. Determine q, given that d(q) = 0. -2, -1, 0, 1 Suppose 8l - 51 - 37 = 0. What is f in 4f3 - 8 + 3 - 16f*2 - 4f*2 - l + 32f = 0? 1, 2 Let p be -10 - -12 - (-15 + -1). Factor -pd2 + 3d + 3d5 - 3d*3 + 18d*2 - 3d*3. 3d(d - 1)2(d + 1)2 Let l(t) = -t3 + 11t2 - 13t + 23. Let h be l(10). Let b be (-4)/8 - 0 - h/2. Factor 1/4n2 - 1/4n*b - 1/4 + 1/4n. -(n - 1)*2(n + 1)/4 Let o(v) be the first derivative of v6/54 - v4/12 - 2v3/27 + 42. Suppose o(d) = 0. What is d? -1, 0, 2 Let g be (-4)/(-18)13566/35. Let z = g - 86. Factor -zc4 + 0c*2 - 4/15c*3 + 0c + 0. -2c3(c + 2)/15 Factor 51r + 47r*2 + 14 + 19r*2 - 10 - 15r*3 - 34. -3(r - 5)(r + 1)(5r - 2) Let p be (90/24)/(2/8). Factor 3d*4 - 12d*3 - 10d + d + pd2 + 3d. 3d(d - 2)(d - 1)2 Let q(d) = 2d*3 + 7d + 6. Let p be q(-1). Let m be 3 + -4 - (-3 + p). Factor -3/5f2 + 0f + 0 - 3/5fm + 3/5f*3 + 3/5f*4. -3f*2(f - 1)*2(f + 1)/5 Let n(f) be the third derivative of 0 + 0f + 2/3f*3 + 2/3f*4 + 1/15f*5 + 6f2. Let y(x) = x2 + x + 1. Let r(p) = n(p) - 8y(p). Solve r(v) = 0. 1 Let t(y) be the first derivative of y5/150 - y4/30 + y3/15 + 11y*2/2 + 2. Let b(u) be the second derivative of t(u). Let b(m) = 0. Calculate m. 1 Let -16/11f - 2/11f3 + 2f*2 - 40/11 = 0. What is f? -1, 2, 10 Let j = 30 - 32. Let l be (-324)/(-315) - j/5. Factor 4/7 - lv*2 + 6/7v. -2(v - 1)(5v + 2)/7 Let n = -1862 + 1864. Factor 0s + 0sn - 6/5s*3 + 3/5s*4 + 0. 3s*3(s - 2)/5 Let i(f) be the second derivative of 2f7/63 - 4f*6/15 - 8f*5/15 + 2f*4/3 + 14f*3/9 + 55f. What is q in i(q) = 0? -1, 0, 1, 7 Factor -9c - 21/2 + 3/2c*2. 3(c - 7)(c + 1)/2 Suppose 0 = -761i + 765i - 12. Let s(j) be the first derivative of -9 + 1/6j*i + 0j + 0j2 + 1/16j*4. Let s(a) = 0. Calculate a. -2, 0 Solve 0 + 5/2s*4 + 15/2s*2 + 0s + 10s3 = 0 for s. -3, -1, 0 Let i(g) be the third derivative of -g7/630 + g6/135 + g5/30 + 5g*3/2 - 30g*2. Let q(f) be the first derivative of i(f). Factor q(j). -4j(j - 3)(j + 1)/3 Let s(r) be the second derivative of -r*5/40 + 19r*4/24 - 16r*3/3 + 15r*2 + 382r. Factor s(j). -(j - 15)(j - 2)2/2 Let p be -2 - ((-30)/360)/((-1)/(-26)). Let m(j) be the second derivative of 1/15j*6 + 6j - pj4 + 0 - 2/3j*3 + 1/5j*5 + 0j*2. Factor m(s). 2s(s - 1)(s + 1)*(s + 2) Suppose -45 =	{ "pile_set_name": "DM Mathematics" }
et z(x) = -4x. Let t(j) = 131j*2 - 2427j. Let o(h) = -30h2 + 560h. Let f(y) = 35o(y) + 8t(y). What is f(z(v))? -32v2 - 736v Let p(g) = 191g. Let s(y) = 48y. Let o(i) = 1169i. Let c(l) = 2o(l) - 49s(l). Determine p(c(v)). -2674v Let l(u) = 1843u - 2. Let g(p) = 45p + 13. Calculate g(l(r)). 82935r - 77 Let l(z) = 8z. Let n(x) = -4x2 + 50x + 4x2 + 36 - 50x - x*2. Determine l(n(w)). -8w*2 + 288 Suppose -5w + 81121 = 3d, 5w + 10 = 10w. Let t(o) = -d + 27037 - 14o. Let n(i) = -3i. What is n(t(x))? 42x Let q(d) = -4d + 3. Let s(w) = -7w + 5. Let k(m) = -8m2 - 40m - 3. Let f be k(-5). Let j(o) = fs(o) + 5q(o). Let n(y) = y - 23. Calculate n(j(l)). l - 23 Let d(n) be the second derivative of -7n4/6 - 3n*3/2 + 3n*2/2 + 498n. Let f(h) = -h*2. Give d(f(q)). -14q*4 + 9q*2 + 3 Let r(b) be the third derivative of 7b*2 + 1/2b*4 + 0 + 1/2b*3 - b. Let n(t) = 2t*2. Calculate n(r(f)). 288f*2 + 144f + 18 Let t(o) = 7o - 3. Let i(f) = 10f - 4. Let d(n) = -3i(n) + 4t(n). Suppose -h + 15 = -3k, 11 = -4k - 9. Let z(u) = h - 25u + 21u + 1. Determine z(d(j)). 8j + 1 Suppose -102 = 2p - h, -4p + 5h = -0p + 204. Let d = -49 - p. Let a(i) = -3i*2 + 8i*d - 9i*2. Let c(v) = v. What is a(c(o))? -4o*2 Let f(g) be the first derivative of 3g*2/2 + 2g + 188. Let o(n) = -8n. What is f(o(a))? -24a + 2 Let b(f) = 2f2. Let t = -173 - -175. Let p(v) = 105v*2 + 139v*2 - 183v*t. What is b(p(u))? 7442u*4 Let n(t) = -3t - 1483958. Let u(z) = 4z2. Give n(u(i)). -12i*2 - 1483958 Suppose 2p + 113 = 105. Let g(x) = 23x - 10. Let a(w) = 22w - 8. Let z(j) = pa(j) + 3g(j). Let v(u) = 2u. Determine z(v(n)). -38n + 2 Let y(o) be the third derivative of 41o5/30 - 27957o*2. Let r(m) = 4m. Let z(g) = -6g. Let i(x) = 8r(x) + 5z(x). Give i(y(n)). 164n*2 Let v(q) = -q. Let o(w) = -3w*2 - 1496178. Give o(v(t)). -3t*2 - 1496178 Let b(c) = -2c*2 - 1322 + 647 + 675. Let k(l) = -1306l. Determine k(b(g)). 2612g2 Let n(y) = 17y - 21. Let k(q) = -28q + 35. Let s(a) = 3k(a) + 5n(a). Let d(o) = o2 - 803o. What is d(s(f))? f*2 - 803f Let g(m) = 2m. Let t(n) = -13n - 58966. Give g(t(h)). -26h - 117932 Let o(j) be the third derivative of 0j*3 + 0 + 0j + 0j4 + 11j*2 - 1/60j*5. Let l(s) be the third derivative of -13s*4/12 - 5s*2. Give o(l(r)). -676r*2 Let p(k) be the first derivative of 0k + 9/2k2 - 155. Let w(j) = 2j*2 + 8j. Determine w(p(m)). 162m2 + 72m Let c(a) be the first derivative of -10a3/3 + 1. Let w(m) = -292m - 102. Let l(z) = 255z + 90. Let y(o) = -17l(o) - 15w(o). What is c(y(r))? -20250r*2 Let t(a) = -555576a*2 - 81a. Let l(o) = o. Give l(t(f)). -555576f2 - 81f Let a(k) = -k - 3. Let c(p) = -1. Let q(n) = -a(n) + 3c(n). Let f be (14/6)/7 - 70/(-6). Let m(z) = fz - 12z + 3z. What is q(m(h))? 3h Let x(v) = 11173384v*2. Let h(k) = -15k*2. Give h(x(w)). -1872667650171840w*4 Let o(l) = -135l*2 + 2489l - 899l2 - 2489l. Let s(i) = -10i. Calculate o(s(d)). -103400d*2 Let j = 1065 + -599. Let s(g) = 3g - 3g - 450g*2 + jg*2. Let a(w) = 103 - 196 + 93 + 3w. What is s(a(i))? 144i2 Let j(o) = -4o*2 - 11o. Suppose -3z - z + 2p = 54, -5p = -15. Let v(c) = 14c + 5. Let u(x) = -34x - 12. Let i(q) = zv(q) - 5u(q). Determine i(j(l)). -8l*2 - 22l Let j(c) = -1814c. Let z(b) be the first derivative of 4b*3/3 + 7795. Calculate z(j(n)). 13162384n*2 Let q(d) be the first derivative of 241 + 1/3d*3 + 0d + 0d2. Let k(l) = -l + 7l - l. Determine q(k(u)). 25u2 Let x(j) be the third derivative of -j5/30 + 13j*3/6 - 2j*2 + 42. Let i(y) = 3y*2. What is x(i(o))? -18o4 + 13 Let h(j) = j2. Let t(s) = -50848269s. What is t(h(c))? -50848269c*2 Let h(g) = g. Let j(c) = 822392c. Give j(h(i)). 822392i Let t = -422 - -444. Let a(u) = tu*2 + 54u*2 + 15u*2 - 5u*2 + 2 - 4u*2. Let o(c) = -2c*2. Calculate o(a(y)). -13448y*4 - 656y*2 - 8 Let c(f) = -22f - 9. Let m(y) = -159346y. Give m(c(n)). 3505612n + 1434114 Let z(p) = -540321p2 - 6945p + 2315. Let g(s) = -467s2 - 6s + 2. Let t(w) = 2315g(w) - 2z(w). Let m(i) = 8i. What is m(t(n))? -3704n*2 Let v(b) = 25b*2 - 74b + 72. Let t(j) = -2j2 + 4j - 6. Let l(c) = -12t(c) - v(c). Let m(a) be the second derivative of -a4/3 - a. Determine l(m(s)). -16s*4 - 104s*2 Let o(w) = 136w*2. Let a(b) = 480313b. What is o(a(v))? 31375278603784v2 Let t(i) = -25i + 12. Let o(d) = -9d2 - d + 8. What is t(o(a))? 225a*2 + 25a - 188 Let h(j) = -11j2 - 5j. Let r(u) = 9u - 6u + 3u - 4u + 14u. Determine h(r(b)). -2816b*2 - 80b Let k(t) = -70839t. Let g(x) = -5x - 2267. Give k(g(d)). 354195d + 160592013 Let q(s) = -16149s. Let y(n) = -4n - 106. What is q(y(o))? 64596o + 1711794 Let w(d) = -23805d. Let t(q) = 3q*2 - 5q. Let x(i) = -19i2 + 30i. Let m(v) = -6t(v) - x(v). Give m(w(o)). 566678025o*2 Let r(g) = 5 - 10g - 5 - 10g + 21g. Let n(j) be the second derivative of 5j5/12 + 2j*2 + 5j. Let k(w) be the first derivative of n(w). What is k(r(o))? 25o2 Let z(c) = -c2 + 10c. Let p(s) = -8s2 - 19 - 8 - 9s*2 + 27. Determine z(p(m)). -289m*4 - 170m2 Let b(t) be the second derivative of -t4/4 - 5t2 - 33t. Let n(g) = g*2 + 2. Let d(s) = 2b(s) + 10n(s). Let p(j) = 30j*2. Calculate p(d(w)). 480w*4 Let l(o) = 443o*2 - 4o. Let p(d) = 49d + 1. What is p(l(m))? 21707m*2 - 196m + 1 Let c(k) = 11k2. Let j(z) = -72. Let v(w) = -w2 + 1. Let t(o) = j(o) - 2v(o). What is c(t(a))? 44a4 - 3256a*2 + 60236 Let g(f) = 39f - 2. Let b(o) = -9202o + 473. Let h(y) = 2b(y) + 473g(y). Let x(i) = 5074i. Let k(v) = 473h(v) - 4x(v). Let d(z) = z*2. What is d(k(u))? 1849u*2 Let u(y) = 5393y*2 + 4. Let f(g) = g - 77. What is f(u(a))? 5393a*2 - 73 Let f(o) = -13o. Let d(s) = -31347s2 + 15. Calculate f(d(b)). 407511b*2 - 195 Let q(x) = 11x*2 - 958x. Let r(m) = -12m. Determine r(q(t)). -132t*2 + 11496t Let l(z) = 84z. Suppose 0 = 2h - 9h. Let d(f) = h + 0f + f + 0. Determine d(l(v)). 84v Let d(l) = 3l - 3l - 8l2. Let a(m) be the second derivative of -m6/120 - 31m3/6 - 86m. Let g(t) be the second derivative of a(t). Determine d(g(q)). -72q4 Let j(p) = 5p. Let s(i) = 8320018i2. Calculate s(j(m)). 208000450m2 Let p(w) be the first derivative of w3/2 + 197w + 125. Let s(z) be the first derivative of p(z). Let j(d) = -58d - 1. Give s(j(x)). -174x - 3 Let h(y) = -y - 22. Let m(k) = 3k + 77. Let t(s) = 7h(s) + 2m(s). Let l(r) be the third derivative of -r*4/12 - 10r*3/3 - 12r*2. What is t(l(b))? 2b + 20 Let x(d) = -2d. Let u(o) = -150859137o. Calculate x(u(p)). 301718274p Let i(d) be the first derivative of -11d*2 + 3d - 1027. Let a(s) = -4s2. Give i(a(w)). 88w*2 + 3 Let b(g) = -18049g. Let d(s) = -2701s. Give b(d(h)). 48750349h Let b(y) = 2y2 - 42y + 52. Let f be b(21). Let p(g) = -f + 2g + 52. Let o(x) = 2x - 17. Calculate p(o(q)). 4q - 34 Let x(i) = -65i. Let f(o) = 4357o - 46. Calculate x(f(m)). -283205m + 2990 Let g(u) = -u*2 - 2u + 13133. Let r(l) = -1438l. Determine r(g(i)). 1438i*2 + 2876i - 18885254 Let l(c) = 5c. Let r be l(1). Let m(u) = -2u + u + ru. Let t(z) be the third derivative of -13z*4/24 + 2z*2 - 489z. Determine t(m(y)). -52y Let w(c) = -1080c*2. Let z(u) = 4u + 365. Calculate z(w(t)). -4320t2 + 365 Let f(k) = 9k + 12. Let a be f(2). Let u(j) = -30 + a + 2j. Let c(p) = 8p*2. Give u(c(r)). 16r*2 Suppose 6n - 528 = -2n. Let t(d) = -2d. Let z(w) = -78w. Let h(u) = nt(u) - 2z(u). Let s(j) = -j. Calculate s(h(i)). -24i Let w(z) = 5z. Let p(q) be the third derivative of 2767q*4/24 - 11q*2 - 154q. Determine w(p(g)). 13835g Let d(z) = 161z. Let p(n) = -5n2 - 2n + 18. Let l(j) = 31j2 + 13j - 117. Let x(c) = -2l(c) - 13p(c). Calculate x(d(b)). 77763b2 Let b be (-5720)/(-2805) + (-4)/102. Let j(g) be the first derivative of 0g + 16 - 7/2gb. Let k(u) = 2u*2. What is k(j(r))? 98r*2 Let f(r) = -3r*2. Let p = 324 - 322. Let i(h) be the third derivative of 0h*4 + 7h*p + 0 + 0h*3 - 1/5h**5 +	{ "pile_set_name": "DM Mathematics" }
Let d be (-1)/23/(12/(-16)). Is (-60)/h(4 - d) a multiple of 12? True Let x = 481 + -459. Suppose -h + 25t + 939 = xt, -3t = 3h - 2805. Does 18 divide h? True Let p = 11194 + 277. Is 84 a factor of p? False Suppose -4 = -2t + 38. Let o(h) = t - h3 + 0 + 19h - 19h2 + 2h*3. Is 13 a factor of o(18)? True Let v(r) = 3r*2 + 9r + 66. Let n be v(-27). Suppose -4g - g = -n. Does 67 divide g? True Suppose -2r + 11188 = -2w, 6w + 5824 - 22606 = -3r. Does 19 divide r? False Suppose 6n - 480 = 10n. Let f = -18 - n. Is 17 a factor of f? True Let l = -40799 - -45641. Is 16 a factor of l? False Let l(a) be the second derivative of a4/4 + 7a*3/6 - 6a*2 - 3a. Let o be l(-13). Suppose 1476 = 5y - o. Does 47 divide y? True Let z(d) = d2 - 10d - 11. Let x be 1/((-2)/(-30)) - -2. Let p be z(x). Let a = 276 - p. Is a a multiple of 42? True Let d(m) be the third derivative of m6/120 + m5/5 + 3m4/8 - 2m*3/3 - 37m*2. Is 9 a factor of d(-5)? True Let k = -337 + 445. Suppose k = 6r - 2r. Is r even? False Let f be (-1 + 4/2)(-2 + -10). Let t be (-2 - -1 - 19)f/(-30). Does 12 divide t/4 - (-52 + 2)? True Suppose 5i = 2i + 30966 + 14193. Does 42 divide i? False Let w(r) = -r3 + 6r*2. Let x be w(6). Suppose -4o = 2n - 64, 0 = -5n - o - x + 160. Is n a multiple of 2? True Let v be (-378)/(-90) + 1/(-5). Let l = v + -19. Let j(w) = -w*2 - 16w + 19. Is 11 a factor of j(l)? False Suppose s - 2004 = 5w + 2859, 4s = -5w + 19627. Does 3 divide s? False Suppose 0 = -o - 4d + 14, -5o - 2d + 0d + 70 = 0. Suppose -k + o = 12. Suppose kl = 3h + l - 620, -h + 228 = 5l. Does 13 divide h? True Suppose 4q - 17966 = -3454. Does 10 divide q? False Let k(s) = 48s + 169. Let u be k(-12). Let x = u + 887. Is x a multiple of 8? True Let o(r) = 33r - 22. Suppose -8t + 62 = 22. Is o(t) a multiple of 13? True Let t(q) = -27q + 4680. Is t(0) a multiple of 12? True Suppose 0 = 5h + 2o - 21240, -3o - 4265 = -9h + 8h. Suppose -27c = -2c - h. Is 17 a factor of c? True Let b(m) = 13m - 37. Let g be b(4). Suppose 0 = gt + 2 - 17. Does 28 divide (125/t - -1) + -43 + 44? False Suppose -8038n + 8041n = 69750. Is 155 a factor of n? True Suppose 5u = 2 - 17. Let n be u - ((-1822)/18 + 6/27). Suppose 62 = 5k - n. Does 3 divide k? False Suppose -516h = -190h - 8594012. Does 98 divide h? True Let q be 110/(-4)-2. Let k = -2557 + 2802. Suppose 0 = -qz - 0z + k. Is z a multiple of 12? False Let j(v) = v*3 - 3v*2 + 2v - 2. Let g be j(3). Suppose 0 = -24x + 20x + g. Let o(p) = 5p3 - p2 + 1. Is o(x) a multiple of 3? False Suppose z = -2z + 450. Let o(n) = -2n3 - 12n*2 + 7n - 47. Let m be o(-7). Suppose 4g = 5g + 5c - z, 5g + mc - 704 = 0. Is g a multiple of 14? True Let n(w) = -20w - 6. Let c = 145 + -148. Is 3 a factor of n(c)? True Let c = 5394 + -4299. Is c a multiple of 44? False Let d(f) = -134f - 1114. Does 30 divide d(-19)? False Suppose 5v = -5a - 1035, 4v - 47 = a + 170. Let n = -243 + 153. Let k = n - a. Is k a multiple of 12? False Let q(l) be the second derivative of 19l3/6 - 7l*2 + l. Suppose 4p - 34 = -z, -4p = -2p + z - 18. Is 22 a factor of q(p)? False Let b(o) = -127o + 65. Let n be b(-11). Suppose -28a + 134 = -n. Does 2 divide a? False Suppose 24 = n + 2n + 3m, -4m + 29 = 3n. Let o be (-4)/2n/(-3). Suppose -oj + 5j + 56 = 5i, 59 = 5i - 2j. Is i a multiple of 13? True Suppose -5773 = 15l - 14458. Suppose -7a + l = 3t - 10a, -5t + 3a + 975 = 0. Does 9 divide t? True Suppose -5g + 4k = 59 - 92, -2k = -5g + 29. Let h = 2192 - 1224. Suppose -3m = gt - 6t - h, -5m - 3t = -1604. Is m a multiple of 46? True Let z be (0 - 22)/(34 - 36). Suppose 2100 = -l + zl. Is l a multiple of 42? True Suppose f + 13 = 5p, 0 = -f - 2f - 9. Suppose l - j + 5j = 13, 3j = pl + 7. Suppose 2n - a = 103, -l = 2a + 5. Is 9 a factor of n? False Let h = -16 + 20. Let v(u) = -2 - u - 3u*3 - 3u + 4u3 + 4u*2 + hu*2. Is 19 a factor of v(-4)? False Suppose -154205 - 7411 = -42l. Is 26 a factor of l? True Suppose 22y - 1312724 = 400460. Does 26 divide y? False Suppose 55o - 54o = 12. Does 6 divide -6 + 472/o9? True Let w = 210 + -220. Let i(y) be the second derivative of -4y3/3 - y2 - 6y. Is 39 a factor of i(w)? True Let l(o) = 16o2 - 7o + 36. Let k(j) = 13j2 - 6j + 36. Let g(f) = 5k(f) - 4l(f). Does 11 divide g(10)? False Suppose 0 = -5m - 5w + 162890, -2m + 5w + 65156 = 6w. Does 10 divide m? False Let w(z) = -212z + 580. Is w(-13) a multiple of 8? True Suppose -y + 4b + 510 + 282 = 0, -2y - b = -1557. Is y a multiple of 52? True Suppose -1512 = -14d + 644. Suppose 2h = 4h + d. Let z = h + 89. Is z a multiple of 9? False Suppose 0 = 2m + 4u - 30, -2m + 7m = -2u + 35. Does 5 divide 248/m - -36/45? True Let k = 142 - 143. Let p(b) = 182b*2 + 15b + 16. Does 3 divide p(k)? True Suppose -11a = -14a - 50346. Does 13 divide (a/(-54) - -4) + (-4)/(-18)? False Suppose -4z = 12 - 52. Let s(d) = d2 + 11d - 9. Let f be s(-13). Is 25 a factor of (f - 10/(-2))z? False Suppose -c + 34 = 86. Let u = c - -49. Let s(m) = m3 + 5m*2 - 5m + 4. Is s(u) a multiple of 7? False Let s = -8171 + 12455. Does 34 divide s? True Suppose 0 = 3v - 0d + 5d + 11, 3d = -12. Let u(i) = 23i3 - 8i*2 - 3i. Does 12 divide u(v)? True Let q(s) = -11s. Let g(z) = -10z - 1. Let r(t) = 7g(t) - 6q(t). Let a be r(-7). Suppose 2w - 23 - a = 0. Is 4 a factor of w? False Suppose d = 13d - 252. Suppose -g + 86 = d. Does 5 divide g? True Suppose 3f - 9 = -0f. Let p(c) = -c*3 + 2c*2 + 5c - 2. Let x be p(3). Suppose 0 = fh + r - 558, -2h + xr = -r - 355. Does 17 divide h? False Let t = -1374 - -1958. Is t a multiple of 4? True Let y be (-33)/(-9) - (-2)/(4 - -2). Suppose 0 = 4p + 5i - 1235, 8i = 5p + yi - 1595. Is 35 a factor of p? True Let u be 956/3(-5 + 156/24). Let c = u + 945. Is c a multiple of 12? False Let k = -11741 + 21696. Is k a multiple of 71? False Is (218/10)/((-850)/(-3895125)) a multiple of 39? True Is 2 a factor of ((-1)/(7/2))/(19 - (-98172)/(-5166))? True Suppose -2s + s - 9 = 4j, s = -1. Is 29 a factor of -3 + 49/7 - (j - 632)? True Suppose 4s + 0s - 2300 = -y, -2s + y + 1156 = 0. Suppose -12a - 84 = -24a. Does 8 divide (s/(-10))/(-3)(a - 2)? True Suppose -246y + 1886802 = -250446. Is 7 a factor of y? False Suppose 0 = 2r - r - 4. Let i be (r - 1)240/9. Suppose z = 5m + i, 5m + 413 = 5z - 67. Does 25 divide z? True Suppose 8w + 20w - 461916 = 0. Is w a multiple of 117? True Let m = 16 + -26. Let s be (-216/(-20))/((-1)/m). Suppose s - 64 = -v. Is 24 a factor of v? True Suppose n - 7c + 56847 = 6n, -4c = 3n - 34108. Is 56 a factor of n? True Suppose 18 = 4w - 6. Let l(k) = w - 4 - 2k + 0k*2 + 6k*2. Is l(3) a multiple of 10? True Suppose 0v + 4p - 49427 = -5v, 3v - 2p = 29687. Does 5 divide v? False Let m = 166 - 62. Let v = -2 + m. Let j = v - -48. Does 13 divide j? False Let j = 126 - 75. Does 17 divide (-72)/32-8j/9? True Let i = -26 - -28. Let o be 81 - ((-20)/(-4) - i). Let s = o + -30. Is s a multiple of 6? True Let a(c) = 147c2 + 87c - 693. Is 81 a factor of a(19)? True Let z(c) = 2c. Let a be z(-2). Let m be -3 + (-634)/(-2) - a. Let k = -182 + m. Does 34 divide k? True Let z be (17 - -1) + (-9 - -7). Suppose 0 = zx - 15x + 4. Is x/18 - 1390/(-18) a multiple of 28? False Suppose -o + 654 = r - 119, 3086 = 4o - 2r. Does 8 divide 0 + -3 - (8 - o)? False Suppose -5h = -m - 10, -3m + 4m = -5h + 10. Suppose 3n - hj = 352, n + 5j - 47 = 93. Is 4 a factor of n? True Is 34 a factor of (-1)/((-1)/8-2)(-85629)/73? True Let n(d) = d*3 - 5d*2 - 3d + 5. Let u be n(6). Suppose -25z = -4p - uz + 620, -z + 314 = 2p. Is 13 a factor of p? True Let x = -965 + 965. Suppose -5n - 219 = -2j, 3n - 5n - 84 = -2j. Is 4 a factor of 36/(-45)(x + n)? True Let g(a) = a*3 - 34a*2 - 55a - 304. Does 28 divide g(36)? True Suppose -7i + i = -1560. Suppose -371 = -3j - i. Is j a multiple of 16? False Suppose -50g + 167g - 738153 = 0. Does 4 divide g? False Let g(j) = -j*3 + 9j*2 + 8j + 22. Let i be g(10). Suppose 0 = -k + 2 + 2, 384 = i*n + k. Does 38 divide n	{ "pile_set_name": "DM Mathematics" }
Let b(w) be the first derivative of 2/3w - 1 + 1/9w*3 + 1/2w*2. Factor b(g). (g + 1)(g + 2)/3 Let y(w) be the third derivative of 0 + 2w2 + 0w - 1/150w5 + 1/60w*4 + 0w*3. Determine r, given that y(r) = 0. 0, 1 Let r(g) be the first derivative of -1/6g*4 - 4 + 2/3g*3 + 2g - g*2. Let v(i) be the first derivative of r(i). Let v(x) = 0. Calculate x. 1 Let 0h2 - h2 + 4h + 5 - 8 = 0. Calculate h. 1, 3 Factor 1/2x - 3/4 + 1/4x2. (x - 1)(x + 3)/4 Suppose 3u - u = 4. Let q(x) be the first derivative of 0x*3 - 3 + 1/10x*5 + 0x - x*u + 3/8x4. Determine t so that q(t) = 0. -2, 0, 1 Let a(x) = -x5 - x4 - x3 + 3. Let r(o) = 3o5 + 3o4 + o3 - 7. Let s(z) = 7a(z) + 3r(z). Solve s(j) = 0. -2, 0, 1 Suppose 1/8p5 + 3/8p*4 + 3/8p*3 + 0p + 1/8p2 + 0 = 0. Calculate p. -1, 0 Let w = -17 + 17. Factor w + 4s - 4s - 2s + s2 + 1. (s - 1)2 Let z be 1052-2(-1)/(-612). Let n = 66/17 + z. Determine g, given that 0 + ng - 2/9g2 = 0. 0, 2 Let m(l) be the third derivative of l7/4200 - l6/600 + l5/300 - l*3/2 + 3l*2. Let w(k) be the first derivative of m(k). Suppose w(v) = 0. What is v? 0, 1, 2 Determine l so that 0 + 2/11l*2 + 4/11l = 0. -2, 0 Suppose -3z + 12 = -3w, -2w = -w + 2. Solve -2d*3 - 2/3d + 0 + 2/3d4 + zd*2 = 0 for d. 0, 1 Let k = -7 - -10. Factor -96o*3 + 95o*k + 4o*2 - 3o2. -o2(o - 1) Find n, given that 0n + 1/4n3 + 0 - 1/4n*4 + 0n*2 = 0. 0, 1 Let j(v) be the third derivative of 1/60v*6 + 1/30v*5 + 0v + 0 + 0v4 - 2v*2 + 0v*3 - 1/168v*8 - 1/105v*7. Find n such that j(n) = 0. -1, 0, 1 Let o = -476 - -478. Determine p so that -25/2p*3 - 12p + 2 + 45/2po = 0. 2/5, 1 Suppose 2v + 0v = v. Let t(b) be the third derivative of 4/3b*3 + 0b - 3b2 + v + b4 + 1/6b*5. Factor t(h). 2(h + 2)(5h + 2) Let h = 3 + 4. Let -3g3 + 0g*4 - 5g*4 - hg*4 - 9g*5 = 0. Calculate g. -1, -1/3, 0 Let h(b) = 4b*3 + 11b*2 - 6b - 2. Let n(q) = 27q3 + 78q*2 - 42q - 15. Let z(o) = 15h(o) - 2n(o). Factor z(w). 3w(w + 2)(2w - 1) Let o = -17 - -21. Suppose -5v + 2p + 14 = op, 0 = -v - 4p + 10. Determine k so that -2/3k - 2/9k*v - 4/9 = 0. -2, -1 Let m(k) = 5k*4 + 4k*3 + 10k*2 + 8k + 5. Let a(j) = 4j4 + 4j*3 + 9j*2 + 7j + 4. Let p(q) = -4a(q) + 3m(q). Factor p(w). -(w + 1)*4 Suppose -3j - j + 8 = 0. Factor jw2 + 2w*3 + 0w*2 - w - 2 - w. 2(w - 1)(w + 1)2 Let u(o) = 2o*2 + 4o + 4. Let c(x) = -3x2 - 7x - 8. Let w(j) = -3c(j) - 5u(j). Let f be w(0). Factor 3l5 + 0l*5 + 0l4 + lf - 2l3. l3(l + 1)(3l - 2) Let x be 8/(-40)10/(-12). Factor 0 + xq*3 + 0q*2 + 0q. q3/6 Let g(c) = c2 - 16c + 30. Let r be g(14). Let v(z) be the first derivative of 1/7z*r + 0z + 1/14z4 + 2 + 4/21z*3. Find o such that v(o) = 0. -1, 0 Suppose -k = 1, -u + 5k + 5 = -5. Let m(o) be the first derivative of 2/5o4 + 0o + 2 + 6/25ou + 0o*2 + 2/15o*3. Factor m(x). 2x*2(x + 1)(3x + 1)/5 Suppose 2c = 6, -3n + 0n + 4c - 12 = 0. Let u(w) be the first derivative of nw + 1 - 1/3w*3 + 1/4w*4 + 0w2. Factor u(b). b2(b - 1) Let g(b) = 7b*3 - 24b*2 + 96b - 133. Let f(y) = 6y3 - 24y*2 + 96y - 132. Let c(k) = 5f(k) - 4g(k). Solve c(z) = 0. 4 Let o(t) be the second derivative of 0t2 + 1/130t*5 - 2/39t*3 - 3t + 0 - 1/78t4. Factor o(p). 2p(p - 2)(p + 1)/13 Suppose -3u = -4o + 48, 0 = -3o - 2u + 31 + 5. Suppose -o = -5q + 8. Factor -1/2x*5 + 0 - 1/4x*2 + 0x + 0x3 + 3/4xq. -x2(x - 1)2(2x + 1)/4 Find h such that 2/9 + 2/9h*4 - 4/9h*2 + 0h*3 + 0h = 0. -1, 1 Factor 6c2 - 513c + 447c + 363 - 3c*2. 3(c - 11)2 Let r(z) be the third derivative of -z6/2 - 11z5/12 - 5z*4/12 + 19z*2. Factor r(w). -5w(3w + 2)(4w + 1) Let g(d) be the third derivative of 0d3 + 0 + 0d + 7d2 - 7/300d*6 + 1/75d*5 + 0d*4. Let g(u) = 0. What is u? 0, 2/7 Find o, given that -4o*3 + 4o*4 + 31o*2 + 24o*2 - 63o*2 = 0. -1, 0, 2 Let a be (3 + 55/(-15))-12. Let s be (a/(-16))/(1 - 2). Factor -7/4l - 3/4l*3 + s + 2l2. -(l - 1)2(3l - 2)/4 Let r(h) be the second derivative of h4/72 - h3/12 + h*2/6 + 3h. Let r(w) = 0. What is w? 1, 2 Let j(n) be the second derivative of -n5/10 - n4/3 - n*3/3 - 8n. Factor j(i). -2i(i + 1)*2 Let m(r) be the second derivative of 3r5/20 - r4/4 - r. Determine d so that m(d) = 0. 0, 1 Let g(c) be the third derivative of 0c3 + 2/15c*5 + 1/60c*6 + 0c + 0c4 + 0 - 9c*2. Factor g(b). 2b*2(b + 4) Let h(s) be the second derivative of -s7/63 - s6/9 - 3s5/10 - 7s*4/18 - 2s*3/9 - 7s. Suppose h(n) = 0. What is n? -2, -1, 0 Suppose 2q = 6q - 28. Suppose -1 + q = 2g. Factor 8c*4 - 10c*g - 1 + 2c + 5 - 9c2 - 3c*2 + 2c*3 + 6c*5. 2(c - 1)(c + 1)3(3c - 2) Let g = 10 - 7. Factor 4u*2 + 2u - gu2 + 0u*2 - 3u. u(u - 1) Let d(w) be the third derivative of -1/210w5 + w2 - 1/420w6 + 0 + 0w + 1/84w4 + 0w*3 + 1/735w*7. Factor d(k). 2k(k - 1)2(k + 1)/7 Suppose 68 = 3p + p. Suppose 0 = 2f + f + 5w - 28, 3f - 4w = -p. Find l such that 10l*2 - f - 4 + 16l - 3 = 0. -2, 2/5 Let w(n) = -n*3 - 2n*2 + 3n. Let u be w(-3). Let l be 1 + 1 + u + -2. Let ld + 1 - 5 - 6d*3 + 2d + 8d2 = 0. Calculate d. -2/3, 1 Let n(j) be the third derivative of j5/330 - j4/132 - 7j*2. Suppose n(b) = 0. Calculate b. 0, 1 Let -15 - 408u*2 - 1 - 16u + 404u2 = 0. What is u? -2 Factor -4/5h*2 + 0 - 3/5h - 1/5h3. -h(h + 1)(h + 3)/5 Determine z, given that 0 + 0z*2 + 0z*3 - 1/9z*5 + 0z - 2/9z4 = 0. -2, 0 Let z = 9983/11 - 907. Let 2/11j - zj2 + 0 - 2/11j*4 + 6/11j3 = 0. Calculate j. 0, 1 Let q(o) be the third derivative of o6/300 + 3o5/50 + 9o*4/20 + 9o*3/5 - 9o*2. Factor q(w). 2(w + 3)3/5 Let n(f) = -f3 + f*2. Let c(y) = 2y*3 - 3y*2. Suppose l + l = -6. Let q(o) = ln(o) - c(o). Factor q(r). r*3 Suppose -1 - 15 = -8q. Let z(p) be the second derivative of p + 1/27p3 + 1/27p*4 + 0p*q + 0 + 1/90p*5. Factor z(h). 2h(h + 1)2/9 Suppose 5h + 4f = -3 + 1, -22 = -5h + 4f. Factor 1 + 6i - 3 + 4i4 + 0 - 2i*h - 6i*3 + 0i*3. 2(i - 1)*2(i + 1)(2i - 1) Let y = -2/59 - -65/177. Let a(l) be the first derivative of 0l2 + 1/4l*4 + 1 + 0l - yl3. Factor a(m). m2(m - 1) Let o(d) = 6d2 - 14d + 8. Let n(i) = 63 + i - i*2 - 63. Let j(a) = 2n(a) + o(a). Factor j(g). 4(g - 2)(g - 1) Let x(f) be the first derivative of 0f2 - 2/15f*3 - 3 + 0f - 1/10f4. Factor x(p). -2p*2(p + 1)/5 Let o(t) = t*3 + 12t*2 + 11t - 2. Let k be o(-11). Let v be k/26/(-3). Factor -2/9h*3 + 2/9h + 0 + 0hv. -2h(h - 1)(h + 1)/9 Find z, given that 8z - 4/3z*2 - 12 = 0. 3 Let t(d) be the second derivative of 1/3d*4 + 5d + 0 + 4/3d3 - 8d*2 - 1/10d*5. Factor t(i). -2(i - 2)*2(i + 2) Let v be (-3)/((-4)/(16/6)). Let 29w3 - 9w - 4 + 9wv + 4w*3 + 18w4 + 1 = 0. What is w? -1, -1/3, 1/2 Let w(s) be the third derivative of -s6/60 + s*4/4 - 2s*3/3 + 4s2. Determine i, given that w(i) = 0. -2, 1 Let x(f) be the second derivative of -f4/60 + f*3/5 - 9f*2/10 + 9f. Solve x(n) = 0 for n. 3 Let v be (-27)/2(-1 + -1). Let x be (-70)/(-63) - (-6)/v. Factor x + 2/3f*2 - 2f. 2(f - 2)(f - 1)/3 Let m(n) = -4n4 - 12n*3 + 8n*2 + 16n - 20. Let h(q) = q*2 + q - 1. Let v(c) = 20h(c) - m(c). Determine b, given that v(b) = 0. -1, 0 Let c be 551/174 - 1/6. Find o, given that -2/7o4 + 0o - 2/7oc + 0o*2 + 0 = 0. -1, 0 Let c be (-2)/1(0 + 6/(-4)). Determine x so that 2/9xc + 0x*2 + 4/9x*5 + 0x - 2/3x4 + 0 = 0. 0, 1/2, 1 Let l = -5861/1485 - -110/27. Let x = l + 3/11. Suppose 2/5 + xj*2 - 4/5j = 0. What is j? 1 Let f(u) be the second derivative of -u6/150 + u4/10 - 4u3/15 + 3u*2/10 - 15u. Suppose f(w) = 0. Calculate w. -3, 1 Determine b so that 10b3 + 4b*2 + 13 + 8b*4 - 13 + 2b5 = 0. -2, -1, 0 Let q(t) be the second derivative of t5/10 + t4/6 - t3/3 - t*2 - 13t. Let q(n) = 0. What is n? -1, 1 Let m(i) = -3i2 - 8i - 11. Let f(l) = 7l2 + 16l + 23	{ "pile_set_name": "DM Mathematics" }
to the nearest integer? -8 Let s = 6444 + -6375.6. Let i = -1.21 + -76.79. Let b = i + s. Round b to the nearest integer. -10 Let b(l) be the second derivative of -l*4 - 2l*3 + 17l*2/2 - 26l - 1. Let y be b(-11). What is y rounded to the nearest one hundred? -1300 Let s be 36/33 + 173413094/1727. What is s rounded to the nearest 10000? 100000 Let l = -606.5018342 - -606.5. Round l to four dps. -0.0018 Let r(t) = -10661t2 + 38367t*2 + 108579t*2 - 6t - 15. Let j be r(-2). Let x = j - 862137. What is x rounded to the nearest 10000? -320000 Let a(u) = -10600010u + 10. Suppose -4b - 7 = -31. Let w = 7 - b. Let i be a(w). What is i rounded to the nearest 1000000? -11000000 Let k = -88175 + 87977.423. Let j = k + 197. What is j rounded to 1 dp? -0.6 Let v be (-18)/(-117) - 973/(-13). Let o be 32510/v144. What is o rounded to the nearest 1000? 6000 Let c = 9535.73134 + -9491.7313321. Let u = c + -44. Round u to 6 decimal places. 0.000008 Let q = 35376 + -35376.00018277. What is q rounded to six decimal places? -0.000183 Let f = -212 - -213. Let l be (-4 - -5 - 89) + f. Round l to the nearest one thousand. 0 Let l = -4.395996372 - -4.396. Round l to 7 decimal places. 0.0000036 Let w be 1 + (-4)/10 - 601509/15. Round w to the nearest ten thousand. -40000 Let j = -2.019 + 2.13. Let m = 105 + -104.964. Let i = m - j. Round i to 2 dps. -0.08 Suppose -3x + 3n - 6 = 0, 2n - 13 = -3x + 6. Let m be -1727 + x/((-9)/12). Let p be (-108)/(-15)(m/6 + 1). What is p rounded to the nearest 100? -2100 Suppose 33j - 54j - 848127000 = 0. What is j rounded to the nearest one million? -40000000 Let t be (-4 - (-6)/((-24)/(-10)))-2. Let n be 488526 + (-4)/2. Suppose -127004 = -2g - 2v, tv = -2g - v + n. Round g to the nearest 1000. 64000 Suppose 0 = 5w - 2v + 219 - 2099, 3w = 5v + 1147. Suppose -h - 4q - w = 0, 0 = 8h - 11h + 2q - 1094. What is h rounded to the nearest ten? -370 Let k = 28579.272 + -28699. Let y = k - -119. Let p = 0.052 - y. What is p rounded to 1 dp? 0.8 Let n = -3772 - -3772.9585. What is n rounded to one decimal place? 1 Let r = 6.405 - 7.2512. What is r rounded to 1 decimal place? -0.8 Let w = 31154664101 - 31154663893.99999867. Let m = 3.6 - 210.6. Let g = w + m. Round g to seven decimal places. 0.0000013 Let g = 2023 + -2023.1626. Let p = -0.16967 - g. What is p rounded to three decimal places? -0.007 Let y = 12.275 - 139.345. Round y to the nearest 10. -130 Suppose -2881 = -4r - 5p, -p + 1067 + 378 = 2r. Let t be r - -4 - -31. Let s = t + -489. Round s to the nearest 10. 240 Suppose 0 = -2n + 12, 414n - 409n = 5a - 5859970. Round a to the nearest one million. 1000000 Let q be 13/5 + (-2)/(-5). Let b be (-8)/24 + 19/q. Let l = b - -14. What is l rounded to the nearest 10? 20 Let a = -0.0425 + 164.7425. Let o = 22868 + -23039.57. Let q = o + a. What is q rounded to the nearest integer? -7 Let r(i) = 684i*2 + 436i + 102. Let w be r(-18). Round w to the nearest one hundred thousand. 200000 Suppose 242z = 232z - 50. Let i be (-91499)/1 + -3 + 7 + z. Round i to the nearest 10000. -90000 Let b = 8.9864 + -9.14. What is b rounded to 2 dps? -0.15 Let r = 295078.069 - 295224. Let o = r - -146. Let x = o - 0.062. What is x rounded to 3 dps? 0.007 Let q(j) = -2j + 24. Let b be q(8). Let x be 41932/16 + (-6)/b. Round x to the nearest one hundred. 2600 Let p = 6.0725 - 8.961. What is p rounded to the nearest integer? -3 Suppose -141085 = -5m - 3f, 2m - 56420 = -35f + 31f. Round m to the nearest ten thousand. 30000 Let x = -17.925 - 8.14. Round x to 0 dps. -26 Let x = -3679.999989437 - -3680. What is x rounded to six dps? 0.000011 Let o = 0.32 - 0.58. Let n = 0.149 + o. Let p = 0.19 + n. What is p rounded to 2 decimal places? 0.08 Let z = 106.29315 + -9.27535. Let q = 97 - z. What is q rounded to 2 dps? -0.02 Let g = -39 + -94. Let l = g - -132.79. Let c = l + 0.20999452. Round c to 6 decimal places. -0.000005 Let p(c) = -9c2 - c - 1. Let r be p(3). Suppose 0t - 2t = -690. Let f = r + t. Round f to the nearest one hundred. 300 Let y(t) = -t2 - 12t + 29. Let u be y(-8). Suppose ul - 56l + 139475 = 5d, 2l - 3d + 55785 = 0. Round l to the nearest one thousand. -28000 Let m be (-30)/315 + (-2274)/(-63). Suppose 15120000 = mt - 18t. What is t rounded to the nearest 100000? 800000 Let n = 11057.96614 + -11058. Round n to 2 dps. -0.03 Let m = -11.402 + -213.008. Let q = m - -216. What is q rounded to one decimal place? -8.4 Let n(h) = 3973h*3 + 12h*2 - 22h. Let v be n(2). What is v rounded to the nearest 1000? 32000 Let b(i) = 221i2 + i + 6. Let u be b(-3). Suppose -3k + u = k. Suppose -k = -5w - 3x + 2x, -x = 2. What is w rounded to the nearest ten? 100 Let h = -14170535517.162171309 + 191484588.162142209. Let n = 13979050333 + h. Let q = n + 596. Round q to 6 dps. -0.000029 Let z be 16/104 - ((4741014 + 4)/2)/(-13). What is z rounded to the nearest ten thousand? 180000 Let x = -5.858 - -5.8575064. Round x to six dps. -0.000494 Suppose 33h - 1758640 = -7108600. What is h rounded to the nearest 10000? -160000 Let q = 273.062 + -273. Let n = q + 0.0004. What is n rounded to two decimal places? 0.06 Let o = 2325.416 - 2342. Round o to one decimal place. -16.6 Let q = -62.3373 - -4.3239. Let i = -0.091 + -57.909. Let s = q - i. Round s to 3 dps. -0.013 Let q = -2638990.400007 - -2638983. Let m = 2695.4 + -2688. Let k = m + q. What is k rounded to 6 decimal places? -0.000007 Suppose 2j - 305541 = 5f, 3j = -10 + 19. Let m = f + 6707. What is m rounded to the nearest 10000? -50000 Let m = -49875739 - -2063739. Round m to the nearest 1000000. -48000000 Let m = 0.16419 - 8.01719. Let g = m - 0.047. Let h = -7.852 - g. What is h rounded to two dps? 0.05 Let d be (-34 - -4)/(-5) - 8. Let r be 12/8 + 192603/d. What is r rounded to the nearest 10000? -100000 Let g = 734695 - -126723. Let v = 861418.2000042 - g. Let u = -0.2 + v. Round u to 6 dps. 0.000004 Let d = 2663841.800434 - 2663789.7. Let u = d - 52.1. Round u to four decimal places. 0.0004 Let s = -676477.00282 - -676400. Let j = -77 - s. Round j to 4 decimal places. 0.0028 Let k = 3.6180024 + 8.382. Let t = -0.6 + -11.4. Let d = t + k. Round d to 6 decimal places. 0.000002 Let a = 4958 - 7038. Let g = -2079.3007 - a. Round g to one dp. 0.7 Let a = 0.028 + 26.972. Let m = a - 27.00362. Round m to 3 dps. -0.004 Let y = 5.952 + -0.822. Let w = 2.43 - y. What is w rounded to the nearest integer? -3 Let a = -746 + 688.72. Round a to the nearest 10. -60 Let n = -0.026 + -29.974. Let w = -31.36799 - -1.36796. Let l = w - n. Round l to 6 dps. -0.00003 Let c = -0.14536 - -8.21456. Let m = c - -0.0108. What is m rounded to 0 decimal places? 8 Let y = 0.0372 + -1.0372. Let q = 0.57 + y. What is q rounded to the nearest integer? 0 Let c = 47834 + -47833.879409. Round c to 2 dps. 0.12 Let f = -33703056 + 24001056. What is f rounded to the nearest one hundred thousand? -9700000 Let j = 2437.7 - 2109. Let t = 178.3 - j. Let r = 122 + t. Round r to the nearest 10. -30 Let h = -0.0165 + -0.3115. Let q = 2.949 + h. What is q rounded to 1 decimal place? 2.6 Let z = 3.609 + -3.6529. Round z to three dps. -0.044 Let h = 5.9042 + -6.53. Let p = -0.63 - h. What is p rounded to 4 dps? -0.0042 Let i = -74 - -65. Let x be ((-49335)/i - -5)(3 - 18). What is x rounded to the nearest 10000? -80000 Let u = -92 + 92.0185. Let v = 0.027 - u. What is v rounded to 3 dps? 0.009 Let i = 414 - 115. Let b = i - 544. Let q = -245.00201 - b. What is q rounded to four decimal places? -0.002 Let r be 3/((-1625)/117 - -14). Let y = 81 + -22. Let f = y - r. Round f to the nearest 100. 0 Suppose 5i = 3m - 340, 2i - 3m + 202 = 75. Let s = 71 + i. Suppose s = -12q + 11q + 490000. Round q to the nearest one hundred thousand. 500000 Suppose 4h + 7h + 112519 = 0. Let c = h - 961. Round c to the nearest 1000. -11000 Let k(i) = -40216i3 + 75i*2 - 2i + 8. Let a be k(-4). What is a rounded to the nearest ten thousand? 2580000 Let r(x) = -x*3 - 4x*2 - 2x - 30. Let h be r(-5). Suppose -3l + 27342 = 2l - 4d, 0 = -hd + 10. What is l rounded to the nearest 100? 5500 Suppose -3l + 119908 = -j, -14847 = 4l - j - 174723. Let h = l - 20878. Round h to the nearest one t	{ "pile_set_name": "DM Mathematics" }
es after 11:04 PM? 4:32 AM How many minutes are there between 1:44 PM and 6:39 PM? 295 What is 337 minutes after 11:18 PM? 4:55 AM What is 607 minutes before 9:54 PM? 11:47 AM How many minutes are there between 8:15 PM and 2:40 AM? 385 How many minutes are there between 11:47 AM and 6:31 PM? 404 What is 144 minutes after 7:41 AM? 10:05 AM What is 564 minutes after 4:59 PM? 2:23 AM How many minutes are there between 7:38 AM and 7:00 PM? 682 How many minutes are there between 6:17 AM and 11:44 AM? 327 What is 82 minutes before 9:44 PM? 8:22 PM How many minutes are there between 9:17 PM and 6:24 AM? 547 What is 681 minutes before 11:17 PM? 11:56 AM What is 394 minutes before 1:27 AM? 6:53 PM How many minutes are there between 10:44 AM and 8:30 PM? 586 How many minutes are there between 12:04 AM and 5:24 AM? 320 How many minutes are there between 5:08 PM and 8:31 PM? 203 What is 689 minutes before 3:39 AM? 4:10 PM How many minutes are there between 11:21 AM and 3:21 PM? 240 How many minutes are there between 4:13 AM and 12:40 PM? 507 What is 703 minutes after 7:50 PM? 7:33 AM How many minutes are there between 1:32 PM and 6:53 PM? 321 What is 547 minutes after 5:21 PM? 2:28 AM How many minutes are there between 11:19 AM and 11:01 PM? 702 What is 597 minutes after 8:58 AM? 6:55 PM What is 101 minutes after 5:08 AM? 6:49 AM What is 672 minutes before 7:44 AM? 8:32 PM How many minutes are there between 9:53 PM and 2:17 AM? 264 How many minutes are there between 10:14 PM and 4:13 AM? 359 What is 453 minutes before 2:34 PM? 7:01 AM How many minutes are there between 6:17 PM and 3:24 AM? 547 How many minutes are there between 4:34 AM and 7:02 AM? 148 What is 505 minutes after 6:47 PM? 3:12 AM What is 597 minutes after 12:25 AM? 10:22 AM What is 345 minutes after 4:49 AM? 10:34 AM How many minutes are there between 9:52 AM and 7:57 PM? 605 What is 246 minutes before 12:09 AM? 8:03 PM How many minutes are there between 2:04 AM and 4:05 AM? 121 What is 167 minutes before 11:41 AM? 8:54 AM What is 376 minutes before 8:30 AM? 2:14 AM What is 468 minutes before 3:31 PM? 7:43 AM What is 27 minutes after 8:33 PM? 9:00 PM How many minutes are there between 2:11 PM and 11:43 PM? 572 What is 175 minutes after 2:55 PM? 5:50 PM How many minutes are there between 3:25 AM and 12:42 PM? 557 How many minutes are there between 1:50 AM and 11:22 AM? 572 What is 292 minutes before 10:28 AM? 5:36 AM How many minutes are there between 5:10 AM and 6:32 AM? 82 What is 702 minutes before 9:28 AM? 9:46 PM What is 159 minutes after 2:22 PM? 5:01 PM What is 558 minutes after 5:32 AM? 2:50 PM What is 402 minutes after 7:53 PM? 2:35 AM What is 92 minutes before 6:53 AM? 5:21 AM What is 204 minutes before 3:03 PM? 11:39 AM What is 211 minutes before 10:15 AM? 6:44 AM What is 274 minutes before 11:42 PM? 7:08 PM What is 185 minutes after 1:51 AM? 4:56 AM How many minutes are there between 12:12 AM and 4:22 AM? 250 What is 204 minutes after 7:00 PM? 10:24 PM What is 625 minutes after 12:42 PM? 11:07 PM How many minutes are there between 8:31 AM and 10:12 AM? 101 How many minutes are there between 10:13 AM and 11:44 AM? 91 How many minutes are there between 1:48 PM and 4:21 PM? 153 What is 244 minutes after 1:35 AM? 5:39 AM What is 609 minutes after 6:07 PM? 4:16 AM What is 708 minutes after 9:43 PM? 9:31 AM What is 557 minutes before 10:29 PM? 1:12 PM How many minutes are there between 3:39 AM and 10:27 AM? 408 How many minutes are there between 5:43 AM and 5:04 PM? 681 How many minutes are there between 10:55 AM and 11:09 AM? 14 How many minutes are there between 11:07 PM and 6:10 AM? 423 How many minutes are there between 1:02 PM and 2:19 PM? 77 What is 572 minutes after 10:55 PM? 8:27 AM How many minutes are there between 8:07 PM and 9:50 PM? 103 What is 251 minutes before 12:57 PM? 8:46 AM What is 514 minutes after 7:20 AM? 3:54 PM How many minutes are there between 8:41 AM and 1:01 PM? 260 How many minutes are there between 7:54 PM and 9:54 PM? 120 What is 344 minutes before 4:06 AM? 10:22 PM What is 101 minutes before 9:10 AM? 7:29 AM What is 376 minutes before 9:26 AM? 3:10 AM What is 202 minutes before 12:28 PM? 9:06 AM How many minutes are there between 12:40 AM and 5:10 AM? 270 What is 707 minutes before 2:38 AM? 2:51 PM How many minutes are there between 2:30 AM and 1:27 PM? 657 What is 33 minutes after 10:39 AM? 11:12 AM How many minutes are there between 1:53 AM and 4:27 AM? 154 How many minutes are there between 4:48 AM and 12:22 PM? 454 What is 148 minutes after 10:11 AM? 12:39 PM How many minutes are there between 10:12 PM and 10:01 AM? 709 How many minutes are there between 7:38 PM and 2:26 AM? 408 What is 6 minutes before 4:49 AM? 4:43 AM What is 292 minutes before 9:45 AM? 4:53 AM How many minutes are there between 5:31 AM and 8:46 AM? 195 How many minutes are there between 5:59 AM and 10:54 AM? 295 What is 709 minutes before 2:39 PM? 2:50 AM How many minutes are there between 10:17 AM and 6:05 PM? 468 How many minutes are there between 4:45 AM and 11:44 AM? 419 How many minutes are there between 9:29 AM and 7:07 PM? 578 How many minutes are there between 2:54 AM and 8:47 AM? 353 How many minutes are there between 5:05 AM and 12:47 PM? 462 How many minutes are there between 11:08 AM and 6:51 PM? 463 How many minutes are there between 9:10 PM and 6:26 AM? 556 What is 249 minutes after 5:08 AM? 9:17 AM What is 240 minutes after 4:27 AM? 8:27 AM How many minutes are there between 12:30 PM and 1:14 PM? 44 How many minutes are there between 6:42 AM and 11:35 AM? 293 What is 496 minutes before 1:57 AM? 5:41 PM How many minutes are there between 2:13 AM and 10:40 AM? 507 How many minutes are there between 9:48 PM and 11:48 PM? 120 How many minutes are there between 7:04 PM and 8:32 PM? 88 What is 128 minutes after 2:52 AM? 5:00 AM What is 295 minutes after 5:50 AM? 10:45 AM What is 547 minutes after 12:25 PM? 9:32 PM What is 165 minutes before 3:03 AM? 12:18 AM What is 470 minutes before 1:48 PM? 5:58 AM What is 374 minutes before 8:32 AM? 2:18 AM How many minutes are there between 6:00 AM and 9:15 AM? 195 What is 127 minutes after 12:03 AM? 2:10 AM What is 584 minutes after 6:47 AM? 4:31 PM What is 44 minutes after 3:03 AM? 3:47 AM How many minutes are there between 8:42 PM and 7:21 AM? 639 How many minutes are there between 1:06 AM and 12:51 PM? 705 How many minutes are there between 1:43 PM and 3:43 PM? 120 What is 570 minutes after 5:02 AM? 2:32 PM What is 96 minutes after 10:54 PM? 12:30 AM What is 211 minutes after 11:59 PM? 3:30 AM How many minutes are there between 7:29 AM and 9:06 AM? 97 What is 457 minutes before 11:29 PM? 3:52 PM What is 708 minutes after 7:42 AM? 7:30 PM What is 559 minutes after 6:03 PM? 3:22 AM What is 10 minutes before 8:35 AM? 8:25 AM How many minutes are there between 10:25 PM and 2:31 AM? 246 How many minutes are there between 8:20 PM and 8:40 PM? 20 What is 313 minutes after 12:26 PM? 5:39 PM How many minutes are there between 1:04 PM and 7:43 PM? 399 How many minutes are there between 11:35 AM and 12:08 PM? 33 What is 372 minutes before 8:31 PM? 2:19 PM What is 582 minutes after 4:32 PM? 2:14 AM What is 243 minutes after 4:46 PM? 8:49 PM How many minutes are there between 12:28 PM and 8:05 PM? 457 How many minutes are there between 9:39 PM and 6:42 AM? 543 What is 160 minutes after 5:59 PM? 8:39 PM How many minutes are there between 5:50 AM and 11:45 AM? 355 What is 663 minutes before 5:51 PM? 6:48 AM What is 145 minutes after 9:55 AM? 12:20 PM How many minutes are there between 10:51 PM and 5:59 AM? 428 What is 418 minutes after 10:07 PM? 5:05 AM How many minutes are there between 2:05 AM and 1:08 PM? 663 What is 410 minutes after 6:32 PM? 1:22 AM How many minutes are there between 9:14 PM and 9:28 PM? 14 What is 156 minutes before 9:05 AM? 6:29 AM What is 54 minutes after 2:20 AM? 3:14 AM What is 481 minutes after 12:08 AM? 8:09 AM What is 664 minutes before 7:52 PM? 8:48 AM How many minutes are there between 4:18 AM and 12:41 PM? 503 What is 688 minutes after 9:04 PM? 8:32 AM How many minutes are there between 12:01 AM and 11:30 AM? 689 How many minutes are there between 6:42 AM and 2:29 PM? 467 What is 420 minutes before 2:10 AM	{ "pile_set_name": "DM Mathematics" }
f2 + tf and give s. 139 Rearrange ((-2y - 8y + 2y)(3 + 5 - 5) - 8y + 6y - 7y)(-2 + 2y + 2) to v + xy + oy2 and give o. -66 Express -1 + 1 - 2t*2 + (-6t + 4t + t)(-3t + 2t + 2t) - 1 + 1 + t2 + 295t*2 - 102t*2 + 159t*2 as k + ct*2 + ut and give c. 350 Rearrange -1 + 2 + m*2 - 3 + (10640 - 7081 - 5733)(-3m + 3m - m*2) - 2m2 + m2 + 3m2 to the form fm + om2 + g and give o. 2177 Rearrange -4j - 105 - 3j + 69 + 0j to the form uj + z and give z. -36 Rearrange 24k*2 + k - 9k*2 - 17k*2 - 2k - k*3 - 17k*4 to the form q + wk*2 + pk*4 + hk*3 + fk and give w. -2 Express (3 + 2o - 3)(-4 + 4 + 2)((-o - o + 3o)(3 + 1 - 3) - o + o + 2o + 1 - 1 - 2o + 3o + 2 - 1 - 2) in the form jo + ao*2 + b and give a. 16 Rearrange (-4 + 39d - 66d + 42d)(-3 + 5 - 3 + (1 + 1 + 1)(6 - 4 - 4) + 3 - 5 + 0) to sd + c and give s. -135 Rearrange -37j*4 + 39j*4 + 0j - 7 - 1 - 2j3 - 2j to the form nj + vj*3 + bj*4 + x + uj*2 and give v. -2 Express 713050v*2 - 713050v*2 + 3 + 574v*3 - 2v*4 in the form tv*4 + z + kv*3 + rv + cv2 and give k. 574 Express (6y*3 + 0y*3 - 3y*3)(y + 7y + 4 - 6y) as ly2 + iy*4 + x + fy + vy3 and give x. 0 Rearrange -80l - 90l + 258l - 88l - 2998l*2 to the form p + sl*2 + ol and give s. -2998 Rearrange (7 + 8 + 13)(5 + 0 - 3)(z + 0z - 2z)(-2z + 2z + z)(1 - 2z - 1) to jz*2 + l + wz + dz3 and give d. 112 Rearrange -6n3 + n2 + n*3 - n + 7n*4 + 0n - n*2 + 4 to hn + on3 + rn*4 + t + jn*2 and give t. 4 Express 4l + 3l + 9l + 18 + 5l - 20l as ql + c and give c. 18 Rearrange -181d*3 - 2d + d*2 - 2d*2 + 265d*3 to cd*3 + fd + qd2 + g and give q. -1 Express 2y*2 - 2y*2 + 3y*2 + 462 + 0y*2 + 70 in the form c + gy + ay2 and give c. 532 Express (-5z - 7z - 5z)(6 - 4 - 4)(-4 - 7 + 3) as j + vz and give v. -272 Rearrange (c - 2c*2 - c)(-4c - 10c + 10c) - 8c3 + c3 + 0c3 to wc*2 + q + rc + pc3 and give p. 1 Express (2h + 0h - 5h)(h2 - h2 - h2) - 177h*3 + 31h*3 - 97h*3 in the form s + ch*3 + nh*2 + lh and give c. -240 Express -x + x*2 + x + 25x*2 - 13x2 - x2 + (0 + 0 - x)(-22 + 22 + 5x) in the form sx + f + cx*2 and give c. 7 Express -7k*4 - 2 + 4k*2 - 5k*2 - 4k*3 + 23k*4 + 3k*3 as bk + vk3 + d + uk*4 + ak*2 and give a. -1 Express -3m*2 + 12m*4 + 15m*4 - 37m*4 + 2m*2 + 145m*3 + m + 9m*4 in the form bm*3 + qm + l + vm4 + im*2 and give q. 1 Rearrange (-1 + 3 + 2)(5 + 5k3 - 5) - 2 + 2 - 9k*3 - 2k*2 to the form v + uk*2 + tk + zk3 and give v. 0 Rearrange (-837 + 31p - 802 + 1631)(2 + 2 - 2)(2p2 - 3p*2 - 2p + 2p2) to jp*3 + mp*2 + xp + w and give m. -140 Rearrange -y*4 + y + 7y*2 + 2 - 29y*4 + 29y*4 to the form zy*4 + i + my*2 + oy + dy3 and give m. 7 Rearrange -6l*4 - 4l*2 + 37l*4 - 30l*4 - 3l - 2l3 to il*3 + cl*2 + ml*4 + n + sl and give s. -3 Express -49s - 3s*4 + 82 + 17s + 30s + s3 + 4s*4 as cs*3 + vs + ps4 + j + ws*2 and give w. 0 Rearrange 343 + 344 - 681 + 6a to the form l + ga and give l. 6 Express (11 - 3 - 1)(-4l - 2 + 2) - 7l + 4l + 6l + (-4 + 3 + 2)(l + 0l - 2l) as u + ml and give m. -26 Rearrange 12y + 4y*2 + 0y + 46y2 + 0y*2 to the form ky + ly2 + c and give k. 12 Rearrange -14 + 71 - 5j - 3j + 77 - 53 to tj + d and give d. 81 Rearrange 12 + 5732d - 5729d + 1 to the form z + vd and give v. 3 Rearrange -14 + 12 + 3w3 + w4 + 6w3 to mw*2 + c + jw + nw4 + hw*3 and give n. 1 Express 0k - k + 2k + (-3 + 2 + 3)(33 - 15 + 19k - 20) in the form dk + a and give a. -4 Express -1480 - 1161h + 1480 in the form r + gh and give g. -1161 Rearrange 3q - 99q - 67q - q2 + (2q - 3q + 2q)(-q - q + 0q) to the form rq2 + a + sq and give r. -3 Express (2c2 - 2c + 2c)((0 + 2 + 0)(-2 + 0 + 3) - 11 + 8 - 12)(0c + 2c - 3c) in the form dc*2 + xc*3 + vc + y and give d. 0 Rearrange 5h2 - 19h*3 - 5h*2 + 5h*2 + 0h*2 + 22h*3 + 8 to ph*2 + s + gh + ch3 and give s. 8 Rearrange -7 - 4f*2 + 3 - 4f*2 + 0f*2 to d + gf*2 + vf and give d. -4 Express 10 + b*2 - 14b - 10 + 0 + 1 in the form a + rb + kb*2 and give k. 1 Rearrange (-14 + 46 + 3)(-11s - 10s + 6s) to the form hs + v and give h. -525 Express 2 - 2 - 2o + (2 - 22o - 2)(14 - 4 + 2) as po + x and give p. -266 Rearrange (4w - 5w - 4w)(2w - w + w) + (-w - 3w + 2w)(95 - 33w + 36w - 5w) to the form g + nw + jw2 and give n. -190 Rearrange 16 + 202f + 3 + 135f - 17 to x + nf and give x. 2 Express -897b - 463b - 889b + 179b as m + nb and give n. -2070 Rearrange 163b*2 + b - 13 - 11 + 26 - 2b to the form m + nb2 + zb and give m. 2 Rearrange (57 - 83 - 33)(i3 - i3 - 2i*3) to the form vi + xi3 + z + qi*2 and give x. 118 Express -426o + 992o2 - 1 + 426o in the form go2 + yo + q and give q. -1 Express -58v + 90v*2 + 13 + 55v - 12 in the form qv2 + h + lv and give l. -3 Rearrange 74u - 39u + u*2 - 40u + 2u4 - 3 to the form lu + f + bu4 + mu*2 + gu*3 and give m. 1 Express (4q + q + 7q + (-2 - 4 + 5)(0q - 4q + 3q) + 5 + 2q - 5)(22 + 48 + 35) in the form j + bq and give j. 0 Express 181u - 2u*2 + 150u - 126u as nu*2 + m + bu and give n. -2 Rearrange 4q3 - 20 - 29 + 9q + 49 to tq2 + lq + f + vq3 and give l. 9 Rearrange -2t*3 + 80t + 1 + 2 - 236t + 112t to ot2 + v + lt*3 + at and give a. -44 Rearrange 2q2 + 0q*2 - 3q2 + (q2 + q*2 - 3q*2)(1 + 1 - 4) + (-21q - 16q + 42q)(0q - 2q + 4q) to fq*2 + jq + t and give f. 11 Rearrange -725d - 48d*2 + 2 + 725d to x + pd2 + ad and give a. 0 Express 38c + 4c*2 + 200c*3 - 6c*2 - 36c as i + ac + xc*3 + sc*2 and give x. 200 Express (-4h*2 - 7h*2 + 0h*2)(-103 + 23 - 62) in the form mh + l + gh*2 and give g. 1562 Express -134 - a - 485 - 260 + 22 in the form ia + r and give i. -1 Rearrange (0 - 3 - 2)(-5m3 + m3 + m*3) - 28m*3 + 12m*2 + 76m*3 - 12m*2 to the form gm*3 + tm*2 + p + jm and give g. 63 Rearrange -9271b4 - 2b + 8925b4 + 2 - 4 - b3 to ab + db3 + i + ub*4 + wb*2 and give a. -2 Rearrange (z - 1 + 1)(2z + 1 - 1) + 1 - 1 + 2z*2 + (3z + 7 - 7)(1 - 1 - 10z) to jz2 + oz + t and give j. -26 Rearrange 3 - 16r2 + 12r*3 + 45r + 7r2 + 7r*2 - 47r + r*4 to vr + mr4 + yr*2 + x + cr*3 and give x. 3 Express ((3 - 4 + 0)(1 - 4 + 0) + 0 + 1 + 3)(4z*4 + 10z*4 + 0z*4) as kz + i + sz4 + xz*2 + rz*3 and give s. 98 Express -203b + 1 + 28b - 79b - 75b + 53b as nb + d and give d. 1 Express (-9b*3 - 5b*3 - 3b*3)(0 + 0 - 2)(2 + 1 - 2) + 11b*3 + 4b + b*3 - 7b*3 in the form sb + ub3 + y + gb2 and give s. 4 Rearrange (l2 + 5l2 - 4l*2)(5l - 3l - 3l) + 609l*3 - 240l*3 - 249l*3 to p + tl + xl3 + ql*2 and give x. 118 Rearrange -16 + 177 + 4m*2 + 54 to hm + nm2 + g and give g. 215 Express (-4 + 4k - 8k + 7k)(-3k*2 - 3k*2 + 2 + 9k*2) in the form n + yk*3 + uk + vk2 and give v. -12 Express -248b + 412b + 413b + 178b in the form r + tb and give t. 755 Rearrange 4l - 7 - 10 + 28 - 6 - 4 to the form il + x and give i. 4 Express 4w2 + 5w*2 + 4w*2 + (-5w - w - 3w)(2 - 2 - 2w) in the form aw + o + mw2 and give m. 31 Express 230b + 80b - 15 + 15 in the form g + xb and give x. 310 Rearrange -212k + 70k + 70k + 71k + 2 - 20k2 to the form wk*2 + pk + f and give p. -1 Express -f*3 - 522f - 531f + 189f*2 + 1053f as if3 + tf + pf2 + g and give p. 189 Rearrange (-80b + 71b + 108b)(2 - b - 2) + (-20b + 33b + 8b)(b + 3b - 6b) to the form rb*2 + c + gb and give r. -141 Rearrange m*3 + 2 + 4m + 2m + 2m + 12m2 - 14m*2 + 4m to zm + s + qm*3 + am2 and give q. 1 Rearrange a3 - a*3 + 16141a - 15790a - 2a*3 - 2 to z + pa + ma3 + xa*2 and give p. 351 Rearrange -a + 1 - 9 + 17 to sa + g and give s. -1 Express (-3h + 2h - 3h + (0h + h - 2h)(2 + 0 - 5) - h + h - h	{ "pile_set_name": "DM Mathematics" }
a) q (b) p (c) u a Let w = 8 + -5. Let l = -0.09 - -0.19. Which is the closest to l? (a) -3/2 (b) w (c) -0.2 c Let l = 142 + -146.08. Let z = l + 0.08. Let a = -3 - -3. What is the nearest to a in z, 5, 2/15? 2/15 Let d = -45 + 49. Which is the closest to -0.1? (a) 0 (b) 5 (c) d a Let v be 1(-2)/(-10 - -2). Let z = -6 - -3. Let j = -4 - z. Which is the nearest to j? (a) v (b) -1/4 (c) -0.5 c Let x = -5.2 + 5. Let d = x - -0.7. Which is the closest to 0.2? (a) d (b) 4 (c) 2/13 c Let j = 18 - 18.1. Let s be -3(-1 - (-25)/21). What is the nearest to -2 in j, s, -5? s Let j(m) = 2m. Let g = -2 + 4. Let w be j(g). Let s = -9 + w. What is the nearest to 0.1 in 0.2, s, 4? 0.2 Let i = 41 - 40.5. Which is the nearest to i? (a) 0.2 (b) -3 (c) 5 a Let p = 167 + -168. Which is the closest to p? (a) 2 (b) -1/3 (c) -0.4 c Suppose 0 = 5g - 0 + 20. Which is the closest to 2/7? (a) 1 (b) g (c) -1 a Let r = 12/23 + -151/69. What is the nearest to 4 in -1/4, r, 3/7? 3/7 Suppose 5 = 8u + 21. Which is the nearest to -5? (a) 2/9 (b) u (c) 0 b Let f = 0.6 - 0.9. Let i be (-2)/6(-6)/8. What is the closest to i in f, -0.5, 1/8? 1/8 Let d = -0.9 + -0.1. Let m = 5 - 8. Which is the nearest to d? (a) m (b) 0.3 (c) 0.5 b Let q = -3/217 + -4/31. What is the nearest to -0.2 in 2/5, 4/7, q? q Let v = 1 - -4. Let w = 2.2 - 1.2. Which is the closest to 0.2? (a) v (b) w (c) 3 b Suppose -3z - z - 40 = 0. Let c be z/81/(-5). Let p(f) = -f*2 + 6f - 3. Let q be p(5). What is the closest to c in -5, q, -1/3? -1/3 Let d be ((-12)/(-8) + 0)4/18. What is the closest to d in 4, -0.4, 5? -0.4 Let k be (-408)/(-20) - (-4)/(-10). Suppose v - k = 5v. Let q be (1/18)/(v/(-20)). What is the closest to q in 1/2, 0.4, -0.5? 0.4 Suppose 5q - 2o - 54 = 0, -4 = 5o + 6. Suppose -2k = -0k + q. What is the closest to 0 in k, 3/4, -0.4? -0.4 Let i = 8.79 + 0.21. Let z = 28 - 29. What is the nearest to z in i, -2, 3? -2 Suppose -3k + 1 + 5 = 0. Suppose -7b = -2b - 10. Let a be 2/3 - b/3. What is the closest to a in -3/7, 0.5, k? -3/7 Suppose 3 = -3j - 12, 2j + 25 = -5x. Let a = -9 - -16. Let y = 6.7 - a. What is the closest to -1 in y, x, -5? y Suppose 4o - 3 = 13. Let f = 0.36 - -0.04. Let k = f - 0.2. Which is the closest to k? (a) o (b) 1/5 (c) -5/4 b Let j = 23 + -22.7. Which is the closest to 1/4? (a) j (b) -4 (c) 0.5 a Let z = -0.04 - 0.36. Let b = 0 - 3. Let t = 85/44 - 24/11. What is the nearest to t in z, -2/9, b? -2/9 Let i be -1 + 1 + (-16)/(-72). Which is the closest to -1/2? (a) 5 (b) i (c) -3 b Let i be ((-27)/180)/((-9)/(-8)). Let l = -3.1 + 3. Which is the nearest to l? (a) 3/7 (b) 0.3 (c) i c Let v be 219/(-8)4. Let h be v/(-5) - (-27)/(-9). Which is the closest to 0? (a) h (b) 2 (c) 5 a Let z(s) = s - 4. Let v be z(5). What is the closest to 3/5 in v, 0.4, -4? 0.4 Suppose 0 = -5l + 7l - 26. Let p = l + -13. Which is the nearest to 0? (a) p (b) 2 (c) -0.3 a Let v = -139 - -141. Which is the closest to v? (a) -3 (b) 1 (c) -2 b Let s = 0.111 - 0.311. Which is the closest to -0.1? (a) 2/17 (b) s (c) -0.1 c Suppose -2g + 184 = -92. Let o = -692/5 + g. Let r = -1.5 - -2. What is the nearest to o in r, 0.1, -1/8? -1/8 Let w = 7/6 + -1. Let m = -0.5 + 3.5. Let v = m - 2.6. Which is the nearest to -3? (a) w (b) -3 (c) v b Suppose 3r + 33 = 5n, -5n - 2r = 3r - 25. Let p(j) = j*2 - 5j - 7. Let c be p(n). What is the nearest to c in -2, 0.2, 0.3? -2 Let x = -6 - -6.4. Let w(l) = l - 3. Let s be w(5). What is the nearest to s in x, 0.1, -2/9? x Let j = -5.5 - -6. Let s(x) = 6 + 1 + x - 2 + 1. Let g be s(-5). What is the closest to 1/3 in g, -1/2, j? j Suppose -2q = 3q. Suppose 2y + 4 = -2s, -5y - 3s = -qs + 6. What is the nearest to 2/5 in 3, -2, y? y Let j(w) = -w - 3. Let b be j(-2). What is the closest to b in 1, 5, 3? 1 Let j = 128/3 + -42. Which is the closest to 2/5? (a) -0.4 (b) j (c) 3 b Let t = -1.1 - -2. Let f = t - -4.1. Which is the nearest to -1/4? (a) -1 (b) f (c) -5 a Let j = 1.47 - -0.43. Let v = j + 0.1. What is the closest to -1 in 4/7, 5, v? 4/7 Let q = -53 - -57. Let v = 2 - 1.8. What is the nearest to -1/4 in q, v, -2/11? -2/11 Let u = -49 + 195/4. Let v = -3.8 + -0.2. Let t be 8/(-3) - (-6)/(-18). Which is the nearest to u? (a) t (b) -0.2 (c) v b Let m = -3.6 + 4. Let g = 0 - 1. Which is the closest to g? (a) -5 (b) m (c) 4 b Let y be 4 - (32/5 + -2). Which is the closest to -1? (a) 4 (b) y (c) -2 b Let k = 70.1 - 70. Let d = -1 + 2. Let x = d - -1. What is the nearest to k in -2, x, -0.2? -0.2 Let c be 6/(-4)(-12)/(-9). What is the closest to 0 in c, -0.3, -5? -0.3 Let x = -1.6 + 1.8. What is the nearest to x in 0.5, 0.1, 1/8? 1/8 Let q be 5/88 + 3/24. Which is the nearest to 0? (a) q (b) 3 (c) 0.2 a Let h = -6.7 - -7. Let j = -7.1 - -7.1. What is the closest to j in h, 0, -2/9? 0 Let x = 0.3 - 0.8. What is the closest to -1/2 in 1/4, x, -2? x Let n = 0.8 - -0.2. Suppose 0s + 4s + o + 31 = 0, 3o = 3. Let u be (s/130)/((-4)/(-10)). What is the closest to n in 3/4, 3, u? 3/4 Suppose -2m - 2w + 4w + 4 = 0, -3m + 13 = 4w. What is the nearest to 6/7 in -1, 2/5, m? 2/5 Let o = 1 - 0. What is the nearest to -2 in -4, -3, o? -3 Let g(j) = j + 5. Let i be g(-6). Let z = 3 - 1. Let l be (-1)/4 - 77/(-84). What is the closest to l in -0.4, z, i? -0.4 Let s = 0.5 + -0.8. Suppose 0 = -4i - 2k - 3 + 9, 2i - 23 = -5k. Which is the nearest to i? (a) s (b) 1/3 (c) -4 a Let t = 337/1476 - 1/164. Let f = 0.65 + -0.35. Which is the nearest to 1? (a) t (b) f (c) 0 b Let s = 1 + -2. Let d be 4/(-7) + 64/(-84). What is the closest to 1 in -1/8, d, s? -1/8 Let p be (-230)/(-140) + (-1 - 0). Let u = -6/7 - p. Which is the nearest to -0.2? (a) u (b) -5 (c) -4 a Let x = 0.165 - -0.035. Which is the closest to 7? (a) x (b) -1/3 (c) 0 a Let p = 44 + -45. Let q be ((-1)/4)/((-2)/(-4)). Suppose 2v = -n - 11, 3 + 15 = -3n - v. Which is the nearest to p? (a) q (b) 0.4 (c) n a Let u(r) = r*2 + 5r - 6. Let i be u(-5). Which is the nearest to i? (a) -1/2 (b) 3 (c) -4 c Suppose 0 = 2x - 0x + 26. Let d = x - -15. Which is the nearest to -1? (a) -1 (b) d (c) 5 a Let p = 7/15 - -1/5. What is the closest to 1 in p, -2/3, 0.3? p Let k be (-2)/6 + (4 - (-18)/(-4)). Which is the nearest to 1.5? (a) -0.5 (b) -5 (c) k a Let k be 8/69/6. Suppose -4b + kb = 0. What is the nearest to b in 0.3, -2, -0.2? -0.2 Let y be (-4)/2 + (-18)/(-8). What is the closest to y in 1/3, 1/2, -5? 1/3 Let z = 2 - 4. Suppose 5d = -4a - 30, 2a - 5a - 25 = 5d. What is the closest to 2/3 in 1, z, a? 1 Let s = -11.6 + -0.4. Let t = s - -12.5. Which is the closest to 1/4? (a) t (b) 3 (c) -2/7 a Let s(o) = o*3 - 7o*2 + 2o + 2. Let y be s(7). Let w be 24/y - 1/2. What is the nearest to w in 3, 1/3, -5? 1/3 Let z = 5 + -1. Suppose 9n - 5n - z = 0. What is the nearest to n in -1, 5, -0.4? -0.4 Let n = -0.04 + -0.26. Let p = 0 + n. Which is the closest to 0.1? (a) -2/7 (b) p (c) -0.2 c Let y be 25/(-10)8/110. Let v = -52 + 52.3. Let d = -0.8 - -0.5. What is the closest to 1 in d, v, y? v Suppose -3t + 5q + 11 = 0, -5t + 4t + 2q + 4 = 0. Suppose 2h = -2k + 12, -k - 1 = t. Let g be h/(-24) - (-2)/4. What is the nearest to 1 in 0.4, 0.2, g? 0.4 Let o = -0.058 + -0.442. Let n = -0.2 - -0.3. Which is the nearest to -1? (a) o (b) 2 (c) n a Let r(n) = n - 1. Let d be r(4). Let t(w) = w*2 + 8w - 4. Let q be t(-9). Let g be (1/(-10))/((-4)/q). Which is the closest to 1? (a) d (b) g (c) -0.2 b Suppose -6v - 26 = -4x - 3v, -4x + 40 = 4v. Which is the nearest to 0? (a) -1/4 (b) x (c) 0.5 a Let x(v) = v + 4. Let n = 3 - 3. Let o be x(n). Which is the nearest to -0.1? (a) o (b) -0.4 (c) -1/7 c Let f be (-5)/(-2) - (-1)/(-2). Let w = 13 - 10. Let n = -153 - -1075/7. Which is the closest to -1? (a) n (b) w (c) f a Let j be (2 - 5/3)6. Let u = 0.1 + -0.6. Which is the closest to j? (a) 2 (b) -1/3 (c) u a Let c = 1.5 - 2.5. Let w = c - -1.1. What is the closest to 4/3 in 2, w, -1/4? 2 Let t = 348 - 351. Let p be (1 - 1) + 2/3. Which is the closest to 2? (a) t (b) p (c) -5 b Let n = -2.42 - -0.42. Let f = 0.7 + -0.3. What is the nearest to 1 in n, f,	{ "pile_set_name": "DM Mathematics" }
e j(6). Suppose -4a = -36 - k. Solve 8 = 5r - a for r. 4 Let t be (5 - 4) + 3 + 6/(-2). Solve -f - t + 5 = 0 for f. 4 Suppose 33w + 20 = 38w. Solve -wu + 15 = -5 for u. 5 Let j(m) = -3m*2 - 4m + 0m + 2m*2 + 0m*2. Let q be j(-3). Solve -qt = -4t + 1 for t. 1 Let i be 2/7 - 26/(-7). Let k(n) = n2 - 3n - 1. Let f be k(i). Suppose -5c + fc = 5l + 6, -5l - 18 = -4c. Solve -3h + ch - 1 = 0 for h. -1 Suppose 4k - 56 = 3v, k = -2v + 5v + 5. Let b(a) = -a - 5. Let i be b(0). Let p = k + i. Solve -n - p = -4n for n. 4 Let r = -7 + 13. Suppose 3a + 6 = 2p - 4, 0 = -2p - a - r. Let q be ((-2 + 2)/p)/(-1). Solve qv + 3 = v for v. 3 Let m be (-4 + 3)/((-2)/12). Let c be 9(8/m + 0). Solve -x + 5x = c for x. 3 Suppose -2o = -0v - 3v + 66, 2o + 18 = v. Solve 5c + v + 1 = 0 for c. -5 Let z(w) = -w - 4. Let o be z(-5). Suppose 5x + l + o = -3, -4x = 2l + 2. Let f(v) = -3v. Let c be f(x). Solve -d + 0 = -c for d. 3 Let r(b) = 6b - 9. Let k be r(4). Solve -4h + 3 - k = 0 for h. -3 Let s = 11 - 5. Let n(o) = 12 + o + 4o + 0o - so + o3 + o2. Let f be n(0). Solve -f = -3t - 0t for t. 4 Let b = 10 - 8. Solve 5l - 3 = bl for l. 1 Let s(g) = -1. Let r(v) = 2v - 2. Let i(t) = r(t) + 3s(t). Let b be i(5). Suppose -4z - p = -77, -51 = -3z + 2p - 5p. Solve -z = o - bo for o. 5 Let w be (-7 + 1)/((6 + 2)/(-8)). Solve 0 = -3g + g + w for g. 3 Let k be 7 + (-4)/1 - -17. Solve k = -5x + x for x. -5 Let n be (6/12)/(2/12). Suppose 2r = ny + 2y - 10, -4r + 2y + 12 = 0. Suppose 0h = h. Solve h = -b + 2 - r for b. -3 Suppose h + 2 - 7 = 0. Suppose 6f = 4p + f - 7, 5f - 57 = -4p. Solve hs - s = p for s. 2 Let j be 3 + -1 + 2/(-12). Solve 2 = -3z - j for z. -1 Let t(v) = -v*2 - 8v + 12. Let r be t(-9). Suppose 3c - 8 = -c. Suppose n - r = c. Solve 1 + n = 3a for a. 2 Let h(z) = z*2 + 10z + 20. Let c be h(-8). Solve 0 = -ct - 9 - 7 for t. -4 Let g = -87 - -90. Solve 4l - gl = -2 for l. -2 Let z(y) = -y2 + 6y - 2. Let o be z(5). Let g be -4(-1 - o/(-6)). Suppose 4c - 18 = gk, 0c + 31 = 3c - 5k. Solve -t = t - c for t. 1 Suppose -5g + 18 = -3d + 2d, -2g - 5d - 9 = 0. Let j be (g-1 + 2)-3. Solve -jo - 4 = o for o. -1 Suppose 3y - y - 10 = 0. Suppose -yh - 76 = -3n - 0n, -h = -5n + 90. Suppose 2b + 2l - 7 = 7, 0 = -2b - 5l + n. Solve 0 = -4q - b - 10 for q. -4 Let h(q) = -q*3 + 4q*2 + 5q - 4. Let r be (0 - -1)/(7/35). Let t be h(r). Let v be 3/6 - (-2)/t. Solve 5a + va + 5 = 0 for a. -1 Let k(b) = -b*3 - 8b*2 + 9b. Let v be k(-9). Let p = 2 - v. Solve -4h = -2h + p for h. -1 Suppose d + d + 16 = j, -d + j - 10 = 0. Let c(b) = -b*3 - 6b*2 + 2. Let h be c(d). Let z = h - -4. Solve zp - 4p = 0 for p. 0 Suppose 7 = r + 2. Suppose 4m + 1 = r. Solve -d + m = -3 for d. 4 Let d(t) = -t - 4. Let l be d(-4). Suppose l = -2q + 3q. Solve -2z = -qz for z. 0 Let p(n) = n*3 - 8n*2 + 8n + 1. Let q be p(7). Suppose -i = z - q, 4 = 4i + 3z - 6z. Suppose -it = -2t. Solve t = 4h - 9 - 11 for h. 5 Suppose 0 = -2t - p, -2p = t + 3p. Solve t = x - 2x for x. 0 Let z(d) = 5d. Let y be z(2). Suppose 0 = 3l + 6. Let h be 1(-1)/l4. Solve hu - 2 = -y for u. -4 Suppose 0 = 4c - 0 - 8. Suppose q = cx - 3 - 5, -x = 4q - 4. Let w = 29 + -29. Solve w = 3r - qr for r. 0 Let r be ((-8)/20)/((-2)/(-30)). Let x = 8 + r. Solve x = -0p - 2p for p. -1 Let b = 156 - 152. Solve 0 = bc - 2c + 10 for c. -5 Let h(l) = -l*3 + 8l*2 + 2. Let k be h(8). Let a = k + 2. Suppose ab = w - 8 - 7, w = -4b - 9. Solve -wr - r = -16 for r. 4 Suppose -3q = q. Let y be (5/3 - 2)-6. Solve -yj + 4 + 0 = q for j. 2 Let j be (-4)/(-14) - (-52)/14. Let b = j - 2. Suppose -3q + 5i + 6 = 0, bi - 6i = -3q + 6. Solve -9 = qd + 1 for d. -5 Let f = 5 - 7. Let r be f - -1(1 + 9). Suppose -2z + 1 = -9. Solve zg = 3g + r for g. 4 Let r be 4 + 1 + (-3 - -2). Suppose 2h - h + 20 = rk, -4k - 3h = -36. Let c be (-1)/3 - 32/(-6). Solve -cx = k + 9 for x. -3 Suppose -2c - 7 - 1 = -2f, -20 = -3f - c. Solve -3n - f = -n for n. -3 Suppose 0 = -5t + 34 - 9, 20 = -5r - 2t. Let d be 3/r(2 + -2). Suppose do = -3o + 9. Solve -5 = oy + 7 for y. -4 Suppose 0 = -5a + 3t + 26, -3t + t = 4a - 12. Suppose -4v - 12 = -4l, -5l - 4v - v + 25 = 0. Solve lr - 2r = a for r. 2 Let p(c) = c2 - 7c + 4. Let n be p(7). Suppose y - 5r = -r - 6, -y + 18 = 4r. Suppose -6 = -2b + 4z, -5b + y = -5z - 4. Solve ns + b = 9 for s. 2 Let c be (-60)/(-9) + (-1)/(-3). Let g = c + -5. Solve 0 = 3u - gu for u. 0 Let j(r) = -r3 + 3r*2 - 1. Let t be j(2). Solve -q = t + 1 for q. -4 Suppose -3d = -x + 4x - 3, 5d + 5 = 5x. Let f(t) = t3 + 9t*2 + 5t - 2 + 4t + 13. Let l be f(-8). Solve dh + h = -l for h. -3 Let u(o) = o3 + o2 - 3o + 4. Let p be u(2). Solve x + p = 3x for x. 5 Let z(s) = -2 - 1 - 3 - s*2 - 6s. Let o be z(-4). Solve 0 = 3m - om + 2 for m. -2 Suppose 4u = -3r + 6 + 2, 4r - 19 = 3u. Let m be (-2)/((u + -2)/6). Solve -m = -x - 0 for x. 4 Let s be (5/3)/(2/6). Suppose 0 = o - 2o. Suppose -4m = l + 16, -3l + 5l + 3m + 12 = o. Solve sn + 5 - 25 = l for n. 4 Let a be -1 + (2 - -6)1. Let h(q) = -q + 11. Let b be h(a). Suppose g = -2u + 3, -3u + b + 3 = 2g. Solve -go = -3 + 8 for o. -1 Suppose 3n - n + 54 = 3l, 5l = -n + 77. Solve -7 = 3g - l for g. 3 Let n(h) = h + 1. Let a(r) = r3 + 5r*2 + 8r + 8. Let x(j) = a(j) - 4n(j). Let p be x(-4). Solve 0s = -s - p for s. -4 Suppose 2a + 0a - 10 = 0. Suppose -20 = -2f + v, 3f - av - 3 = 20. Let q = f + -8. Solve 0 = qw - w - 2 for w. 1 Let t = 32 - 23. Let m = t - 4. Solve 17 = -mp - 3 for p. -4 Suppose -4o = -2o - 4. Solve -2c = 2 + o for c. -2 Let r(f) be the third derivative of -f6/30 + f5/60 + f4/24 + f3/6 - 5f2. Let d be r(-1). Solve -di - 9 - 6 = 0 for i. -3 Let l be (-8 + 16)/(2 - 0). Solve 0j + l = -2j for j. -2 Let z(g) = g - 1. Let o be z(5). Suppose -3p - h = -49, -op + 5h + 27 = -2p. Solve 4 = 3c + p for c. -4 Let f(o) = 3o + 3. Let j be f(-1). Solve g + 3 = -j for g. -3 Let i = 13 + 8. Let l be 102/3 + -11. Let a = l - i. Solve -2k = k - a for k. 4 Let z = -21 - -21. Let s(r) = -r - 1. Let x be s(-6). Solve -xm + 15 = -z for m. 3 Suppose 0w = 4w + 20. Let x = w - -7. Let b(f) = -2f - 9. Let n be b(-6). Solve x = -2q + nq for q. 2 Let s be 13 - (-3 - (-3)/3). Let u be (-9)/s - (-26)/10. Solve 2n - 4 = -u for n. 1 Let g(t) = 4t*2 + t - 1. Let i be g(1). Let x be (-3 - -3)(-2)/i. Solve -2 = 2p - x for p. -1 Suppose 1 = -28q + 29q. Solve -a = -2a + q for a. 1 Let o = 12 - 8. Suppose 3m - 68 = o. Suppose -2a - 2c = -16, -3a + 7c - 2c = 8. Solve -8 + m = ak for k. 4 Let z = 3 - -1. Solve 2o = -0o + z for o. 2 Suppose 0 = 3c - v - 38, 2c + 2c = -4v + 72. Solve -11 - c = -5r for r. 5 Let g be 2/(2 + (-4)/3). Suppose 5d = 12 + g. Suppose -3q + 14 = -5q + 5k, q + 4k - 19 = 0. Solve 6 + q = dr for r. 3 Let r(z) = -2z. Let j be r(-1). Solve 0 = -2y + j - 0 for y. 1 Let v be 25((-2)/(-8))/(11/44). Solve 4t - v = -t for t. 5 Suppose -9 = 5o - 29. Solve on = -0n + 12 for n. 3 Let t(s) = 8s3 - s2 + 1. Let g be t(-1). Let h = g + 11. Solve o = -ho + 4 for o. 1 Let t(b) = -b3 - 7b*2. Suppose 5l + 50 = -5k, -2k = -4k - 6. Let w be t(l). Solve w = -3y - y for y. 0 Let h be (1 + (-16)/4 - -4) + 7. Solve 0 = -hs + 5s - 12 for s. -4 Suppose 3t = -22 + 25. Solve t = 4j + 17 for j. -4 Suppose -5 - 10 = 3f, 2f - 115 = -5y. Let z = -17 + y. Solve 4a = z - 0 for a. 2 Suppose 4q + 3y + 2 + 5 = 0, -2q - 2y = 6. Solve -3u = qu + 10 for u. -2 Suppose 0 = -5f - 0 + 15. Let r = -7 + f. Let n(p) = -p2 - 4p. Let c be n(r). Solve cz + 20 = 4z for z. 5 Let z(b) = -4b - 20. Let x be z(-6). Solve 1 = -5c - x for c. -1 Let k = 1 - -2. Solve 0 = 2j + kj + 25 for j. -5 Let l(k) = -k*3 - 3k*2 + 6k + 10. Let a be l(-4). Solve ah = 3h + 3 for h. -3 Let x = -10 + 10. Solve 2z - 1 - 1 = x for z. 1 Suppose -4f - 10 = 5h + f, -2f - 2 = 3h. Solve -hb = -3b for b. 0 Suppose 4y + 0y = 24. Solve l = -2l + y for l. 2 Let h = 20 + -15. Suppose 0 = -hg + 7g. Solve u + 4 - 3 = g for u. -1 Suppose 4j = 6n	{ "pile_set_name": "DM Mathematics" }
18 Find q, given that q*3/5 - 141q*2/5 + 1320q - 20500 = 0. 41, 50 Determine u so that 256u4 + 4672u*3 + 10756u*2 - 96360u + 108900 = 0. -11, 15/8 Factor -h*4 - 20h*3 - 83h*2 - 124h - 60. -(h + 1)(h + 2)2(h + 15) Factor -3r5 + 12r*4 - 3r*3 - 30r*2 + 12r + 24. -3(r - 2)3(r + 1)*2 Factor 5x*3/6 - 55x*2/3 + 400x/3 - 320. 5(x - 8)2(x - 6)/6 Solve -2k3 + 308k*2 + 2k - 308 = 0 for k. -1, 1, 154 Find m, given that -m*4/5 + 15m*2 - 50m = 0. -10, 0, 5 Find u, given that u*4 - 6u*3 + 32u = 0. -2, 0, 4 Factor 2a2/23 - 76a/23 - 78/23. 2(a - 39)(a + 1)/23 Find k such that -4k4/3 - 16k*3/3 + 40k*2/3 + 112k/3 + 20 = 0. -5, -1, 3 Solve -7k3 + 506k*2 - 144k = 0. 0, 2/7, 72 Factor o*3 - 16o*2 - 36o. o(o - 18)(o + 2) Factor -t*2/2 + 47t - 2209/2. -(t - 47)*2/2 Factor -4i*2 + 2120i - 280900. -4(i - 265)2 Find u such that -u2/2 - 132u - 783/2 = 0. -261, -3 Factor c*3 - 28c*2 - 29c. c(c - 29)(c + 1) Solve 5c2 + 80c + 320 = 0. -8 Let 5a3 - 135a*2 + 480a - 460 = 0. What is a? 2, 23 Factor -5l2 - 60l - 135. -5(l + 3)(l + 9) Factor q*4/4 - 5q*3/2 - 3q*2/4 + 7q + 5. (q - 10)(q - 2)(q + 1)*2/4 Let -2t*4/3 + 106t*3 - 6230t*2 + 482650t/3 - 1543500 = 0. Calculate t. 35, 54 Let -2p4/5 + 12p*3 - 448p*2/5 + 192p = 0. What is p? 0, 4, 6, 20 Factor 4y2 - 192y + 860. 4(y - 43)(y - 5) Let 3p2/7 - 1740p/7 + 3468/7 = 0. Calculate p. 2, 578 Let -2o2/7 - 8o/7 + 6490/7 = 0. Calculate o. -59, 55 Suppose -27w2 + 60w - 12 = 0. What is w? 2/9, 2 Suppose -4k5 - 28k*4 - 44k*3 + 76k*2 + 240k + 144 = 0. What is k? -3, -2, -1, 2 Factor j*3 + 24j*2 - 108j + 112. (j - 2)*2(j + 28) Factor -2r2/5 + 8164r/5 - 8331362/5. -2(r - 2041)2/5 Suppose 8m*3 + 30m*2 + 28m = 0. What is m? -2, -7/4, 0 What is n in -2n2/3 + 10n + 32/3 = 0? -1, 16 Factor -2k3/15 + 58k*2/5 + 536k/15 + 24. -2(k - 90)(k + 1)(k + 2)/15 Let f4/5 + 6f*3 - 35f*2 = 0. What is f? -35, 0, 5 Solve 5x*2 - 2530x + 320045 = 0. 253 Suppose -10r4/13 - 314r*3/13 - 1778r*2/13 + 3482r/13 - 1380/13 = 0. What is r? -23, -10, 3/5, 1 Suppose 9h4 + 506h*3 + 1084h*2 + 216h = 0. Calculate h. -54, -2, -2/9, 0 Factor 5a4/4 - 5a*3/4 - 10a*2 + 15a. 5a(a - 2)*2(a + 3)/4 Solve -4s3 - 1688s*2 - 181412s - 698896 = 0 for s. -209, -4 Let 80w5 + 440w*4 - 275w*3 - 215w*2 - 30w = 0. Calculate w. -6, -1/4, 0, 1 Find y such that y*4 - 9y3 = 0. 0, 9 Factor i3 + 24i2 + 84i - 784. (i - 4)(i + 14)2 Determine l, given that -2l*4 - 374l*3/9 - 206l*2/3 - 62l/3 + 76/9 = 0. -19, -1, 2/9 Solve 4l3/5 + 383l*2/5 + 1824l - 2304/5 = 0 for l. -48, 1/4 Factor w*2/4 - 22w - 89/4. (w - 89)(w + 1)/4 Suppose -4n*4 + 31n*3 + 203n*2 + 24n - 144 = 0. What is n? -4, -1, 3/4, 12 Factor -b*4/3 + 44b*3/3 - 43b2/3. -b2(b - 43)(b - 1)/3 Factor -4m2 - 260m + 1400. -4(m - 5)(m + 70) Factor 3i3 - 15i*2 + 21i - 9. 3(i - 3)(i - 1)*2 Determine b so that 2b*5 - 42b*4 + 146b*3 - 174b*2 + 68b = 0. 0, 1, 2, 17 Determine x so that 10x3/9 + 442x*2/9 + 4928x/9 + 968/9 = 0. -22, -1/5 Factor a*3/9 - 392a*2/3 + 38416a. a(a - 588)2/9 Determine r so that -2r*3 + 18r = 0. -3, 0, 3 Factor -5z3 + 355z*2 - 3895z - 92455. -5(z - 41)2(z + 11) Factor -2p2/21 + 4p/21 + 16/21. -2(p - 4)(p + 2)/21 Factor d*4 - 3d*3/2 - 3d*2/2 + d. d(d - 2)(d + 1)(2d - 1)/2 Factor 2g*2/11 + 24g/11 + 70/11. 2(g + 5)(g + 7)/11 Solve p*3/4 - 26p*2 + 499p/4 - 99 = 0. 1, 4, 99 Factor -3l3 + 195l*2 - 3069l - 3267. -3(l - 33)2(l + 1) Determine p so that -4p3/7 - 512p*2/7 - 2480p - 61504/7 = 0. -62, -4 Factor -2n2/7 - 3212n/7 - 1289618/7. -2(n + 803)2/7 Solve t4 - 5t*3 + 5t*2 + 5t - 6 = 0 for t. -1, 1, 2, 3 Factor i*5/8 - 7i*4/8 + 5i*3/8 + 7i*2/8 - 3i/4. i(i - 6)(i - 1)*2(i + 1)/8 Factor -r*3 - 84r*2 - 1764r. -r(r + 42)2 Determine m so that -2m*4 - 48m*3 - 288m*2 + 512m + 6144 = 0. -12, -8, 4 Factor o*3/2 + 21o*2 - o/2 - 21. (o - 1)(o + 1)(o + 42)/2 Let j5 - 70j*4 + 1548j*3 - 11016j*2 = 0. Calculate j. 0, 18, 34 Let -2n*5/5 + 38n*4/5 + 268n*3 - 2740n*2 - 59250n - 56250 = 0. Calculate n. -15, -1, 25 Find i, given that -2i5/7 + 12i*4/7 + 256i*3/7 + 960i*2/7 + 1024i/7 = 0. -4, -2, 0, 16 Find b, given that 4b2 - 11928b = 0. 0, 2982 Factor k*4/2 + 17k*3 + 205k*2/2 + 222k + 162. (k + 2)*2(k + 3)(k + 27)/2 Solve 14z*4 + 802z*3/9 + 1414z*2/9 + 146z/3 + 4 = 0 for z. -3, -2/9, -1/7 Suppose 4v3/21 + 10v*2/21 - 22v/21 + 8/21 = 0. Calculate v. -4, 1/2, 1 Factor 2t2 - 12t - 270. 2(t - 15)(t + 9) Factor 2w3/9 + 16w*2/9 + 40w/9 + 32/9. 2(w + 2)2(w + 4)/9 Suppose 10u2/3 + 4u + 6/5 = 0. Calculate u. -3/5 Factor 4u2 - 4. 4(u - 1)(u + 1) What is i in 3i*2/2 - 195i/2 - 99 = 0? -1, 66 Factor 2s2/15 + 66s/5 + 196/15. 2(s + 1)(s + 98)/15 Factor 50a3/3 - 830a*2/3 - 338a/3 - 34/3. 2(a - 17)(5a + 1)2/3 Find f such that -2f*5/7 + 20f*4/7 - 8f*3 + 12f*2/7 + 90f/7 = 0. -1, 0, 3, 5 Let -2a2 - 20a - 18 = 0. Calculate a. -9, -1 Factor -2q3/11 - 4262q*2/11 + 8530q/11 - 4266/11. -2(q - 1)2(q + 2133)/11 Determine m so that -3m2 + 480m - 19200 = 0. 80 Factor 2v3/15 + 4v*2/5 - 8v/15 - 16/5. 2(v - 2)(v + 2)(v + 6)/15 Factor 51l*2/5 + 114l/5 + 24/5. 3(l + 2)(17l + 4)/5 Factor i5 - 5i*4 + 6i*3 + 2i*2 - 7i + 3. (i - 3)(i - 1)3(i + 1) Factor j*2 - 8j + 12. (j - 6)(j - 2) Find j, given that 5j*5 + 970j*4 - 10j*3 - 1940j*2 + 5j + 970 = 0. -194, -1, 1 What is f in -24f4 + 12f*3 + 378f*2 + 729f + 405 = 0? -3/2, 5 Suppose -9m4/2 - 6m*3 + 39m*2/2 - 9m = 0. Calculate m. -3, 0, 2/3, 1 Factor -z*2 + 3z + 18. -(z - 6)(z + 3) Solve 2d*2/3 - 24d + 136/3 = 0. 2, 34 Determine r so that 4r2 + 556r + 552 = 0. -138, -1 Factor t*5 - 5t*4 - 17t*3 + 49t*2 + 160t + 100. (t - 5)*2(t + 1)(t + 2)2 Factor -3j*3 + 165j*2 - 321j + 159. -3(j - 53)(j - 1)*2 Factor -2s*3 + 188s*2 - 1042s - 1232. -2(s - 88)(s - 7)(s + 1) Factor y3 - 132y*2 + 261y - 130. (y - 130)(y - 1)2 Factor 2p*3/9 + 146p*2/9 + 304p + 288. 2(p + 1)(p + 36)*2/9 What is t in 10t*3 - 775t*2 - 1990t - 800 = 0? -2, -1/2, 80 Factor -d*2/7 + 20d/7. -d(d - 20)/7 Factor -3o*4 + 6o*3 + 3o*2 - 6o. -3o(o - 2)(o - 1)(o + 1) Find o, given that 5o3/2 - 1483o*2/2 + 443o + 296 = 0. -2/5, 1, 296 Find t such that -t*3 - 25t*2 - 24t = 0. -24, -1, 0 Suppose 4f2/7 + 12f + 216/7 = 0. Calculate f. -18, -3 Factor -3z3 + 78z*2 + 255z + 174. -3(z - 29)(z + 1)(z + 2) Solve -3m*4/2 - 51m*3/2 + 57m*2 = 0 for m. -19, 0, 2 Find i, given that -3i*5 - 111i*4 - 1347i*3 - 6009i*2 - 10170i - 5400 = 0. -15, -4, -2, -1 Suppose 4a3 - 36a*2 + 80a - 48 = 0. What is a? 1, 2, 6 Factor q*4 + 11q*3 - 29q*2 - 39q. q(q - 3)(q + 1)(q + 13) Factor -y3/3 - 21y*2 + y/3 + 21. -(y - 1)(y + 1)(y + 63)/3 Let 14k*5/3 - 148k*4/15 - 62k*3/15 + 164k*2/15 - 8k/15 - 16/15 = 0. Calculate k. -1, -2/7, 2/5, 1, 2 Factor 5j5 - 45j*4 + 120j*3 - 80j*2. 5j*2(j - 4)*2(j - 1) Let -10y5 - 64y*4 - 54y*3 + 88y*2 + 40y = 0. What is y? -5, -2, -2/5, 0, 1 Determine x, given that 5x5/2 + 20x*4 + 50x*3 + 25x*2 - 105x/2 - 45 = 0. -3, -2, -1, 1 Solve 2n4/21 - 226n*3/21 + 2420n*2/7 - 6656n/3 - 54080/21 = 0. -1, 10, 52 Factor 2u3/5 - 18u*2/5 + 28u/5 + 48/5. 2(u - 6)(u - 4)(u + 1)/5 Factor 5k*5 - 20k*4 - 40k*3 + 50k*2 + 115k + 50. 5(k - 5)(k - 2)(k + 1)3 Find l such that 2l*3/5 + 6l*2/5 - 8l/5 = 0. -4, 0, 1 Factor 2g3/5 - 908g*2/5 - 1822g/5 - 912/5. 2(g - 456)(g + 1)*2/5 Solve -4z*4/3 + 58z*3/3 - 8z*2 - 58z/3 + 28/3 = 0. -1, 1/2, 1, 14 Solve 3j5 + 12j*4 + 9j*3 - 12j*2 - 12j = 0 for j. -2, -1, 0, 1 What is g in -27g4/8 - 2073g*3/8 - 2793g*2/4 - 663g/2 + 111 = 0? -74, -2, -1, 2/9 Suppose 5o4 + 35o*3 + 75o*2 + 45o = 0. What is o? -3, -1, 0 Factor -5n3/2 - 43n*2/4 - 33n/4. -n	{ "pile_set_name": "DM Mathematics" }
+ ds + 2o*2s wrt o? -6ds - 1686d + 4s What is the first derivative of -clw - 58cl + 2cw + 4c + 91lw - 8690w - 10 wrt l? -cw - 58c + 91w Differentiate 5010d*2y + 35d2 + 128dy2 - d + 3252 with respect to y. 5010d*2 + 256dy Find the second derivative of 62376o*3 - 96109o wrt o. 374256o Differentiate -9h*2y*4 + 5h*2y + 160519h2 + 133hy wrt y. -36h*2y*3 + 5h*2 + 133h What is the first derivative of 1169520c4 - 632746? 4678080c*3 What is the third derivative of -2168874u*6 - 448u*2 - 18u + 48? -260264880u3 Find the third derivative of 683d*4 + 95d*3 - 38d*2 + 1448d + 1. 16392d + 570 Find the third derivative of -574a5 - a4 - 19a3 + 266131a*2. -34440a*2 - 24a - 114 What is the derivative of -48879v4 - 31431? -195516v*3 What is the derivative of -4x*3 + 11462x - 286813? -12x2 + 11462 What is the third derivative of -595165x*5 - 265138x*2 wrt x? -35709900x2 What is the third derivative of g4o + 8088g*3o + 11148g2o + 2g2 wrt g? 24go + 48528o Find the third derivative of -10577r4 + 52r*3 + 1154275r*2 wrt r. -253848r + 312 What is the second derivative of 7736cg*3 + 7cg2 + c - 2g*3 - 23019g - 2 wrt g? 46416cg + 14c - 12g What is the derivative of 29924w + 163562? 29924 What is the second derivative of 16k4 + k3v - 16436k*2 - 5kv + 41106k wrt k? 192k2 + 6kv - 32872 What is the derivative of 161bc + 83558b - 62c - 2 wrt c? 161b - 62 Differentiate 304311t - 330597 wrt t. 304311 Find the first derivative of 40j*3r + 1017194j3 + 230j*2r*2 + 14jr - 1 wrt r. 40j*3 + 460j*2r + 14j What is the second derivative of 138174f*2 - 1483975f wrt f? 276348 Find the third derivative of c*4 - 78338c*3 + 905187c*2. 24c - 470028 What is the second derivative of 438z4 - 4z*3 - 2z*2 - 85z - 137? 5256z2 - 24z - 4 What is the third derivative of 812371m3 - 12m*2 + 13045m wrt m? 4874226 Find the second derivative of 1298d4i + 42d3 + 3d*2i + 2di + 22813d wrt d. 15576d*2i + 252d + 6i What is the derivative of -219j2 - 28j - 96548? -438j - 28 Find the second derivative of -834761o*4 + 130o + 2047. -10017132o2 Find the second derivative of -2b*5 + 2b*4 + 195141b*3 - 603b + 350 wrt b. -40b3 + 24b*2 + 1170846b Differentiate 78862w3 - 13650. 236586w*2 Find the third derivative of 231l*3z + 609l3 - 158l*2z + 6l2 + 2lz - 393z wrt l. 1386z + 3654 What is the derivative of -68133w*3 + 58832? -204399w*2 What is the first derivative of 358706f*2 + 1361390? 717412f Find the first derivative of 3a3 - 15a*2 - 23a - 86187 wrt a. 9a2 - 30a - 23 What is the third derivative of -4369q4 - 101q3 - q2 + 806564? -104856q - 606 Differentiate -18h*2o + 9h2 + 4ho + 54h + 237o + 1 wrt o. -18h*2 + 4h + 237 What is the derivative of -3203u3 - u + 5525? -9609u*2 - 1 Differentiate -1092304v*3 - 1129175 with respect to v. -3276912v2 Find the second derivative of -b2h3y + 127054b2y + bh3 + bhy + 3970048b wrt b. -2h3y + 254108y Find the first derivative of 122092a*4 - a - 504632 wrt a. 488368a*3 - 1 Find the third derivative of 3h*3u*3 + 16h*3u - 124h3 + 17h*2u*3 + 1601u*3 wrt h. 18u*3 + 96u - 744 Find the third derivative of -263a3i*3y*2 + 166a*3y3 + a2i3y - 2a2i*2y + 33ai*3y*2 + 4aiy*3 - 13i*2y*3 wrt a. -1578i*3y*2 + 996y*3 What is the third derivative of -289959p*2r*4 + 16p*2r*2 + 6045pr2 wrt r? -6959016p*2r What is the first derivative of s*2 + 59085s + 10712 wrt s? 2s + 59085 What is the third derivative of -604519f*3n2 + f2n2 + 15f*2 - 836fn2 wrt f? -3627114n*2 What is the first derivative of 5583y*4 + 2y - 72272 wrt y? 22332y3 + 2 Find the second derivative of 61654mv2 - 18975mv wrt v. 123308m Find the second derivative of 378c4r - 2c2r - 362c2 - 3cr + 64c + 89r + 21 wrt c. 4536c*2r - 4r - 724 What is the second derivative of -4s*4 + 31530s*2 - 246127s? -48s2 + 63060 What is the second derivative of 393416n*4 + 151647n? 4720992n2 What is the third derivative of -2r*4z - 68884r4 - 7r3 + r2z + r - 244z - 211 wrt r? -48rz - 1653216r - 42 What is the third derivative of -3fg3 - fg*2 - 270fg + 73g6 + g4 - 9g3 + g2 - 3 wrt g? -18f + 8760g3 + 24g - 54 Differentiate -34715g2 - g - 39024 wrt g. -69430g - 1 What is the derivative of -25329x + 45655? -25329 What is the first derivative of -foy + 20454fy + 209o3 + o2y - 2oy wrt o? -fy + 627o2 + 2oy - 2y What is the third derivative of 677380j3k*3z2 + j3kz*2 + 10j*3z*2 - 2j*2k*2z + 4j2k + 566j + 2k*2z*2 wrt k? 4064280j*3z*2 Find the second derivative of 1721033s*2 - 1566075s. 3442066 Find the second derivative of 4501h4r - 3h2r*3 + 4hr3 + 2hr2 + 140hr + 2r*3 wrt h. 54012h*2r - 6r3 Differentiate 13rv3 - 40rv2 + 46379r + 3v2 with respect to v. 39rv2 - 80rv + 6v What is the first derivative of 2151l2 + 2l - 66016 wrt l? 4302l + 2 Differentiate 2k*4n - 570636kn - 1929n - 11 wrt k. 8k*3n - 570636n What is the second derivative of 56o*2p*2 - 24o*2p - 4o2 + 980op2 + 23op + p2 wrt o? 112p*2 - 48p - 8 Find the second derivative of 12ot*3y*3 - 8755oty*3 + 51oty*2 + 130t*3 - 21t*2y*3 + 2ty3 wrt t. 72oty*3 + 780t - 42y3 What is the third derivative of -34694d*6 - 14917d*2 - d wrt d? -4163280d*3 What is the derivative of 24428j*3l*2 - 3j*3 + 6003l*2 - 15l - 1 wrt j? 73284j2l*2 - 9j*2 What is the first derivative of 33517q*4 - 2q*3 - 11q + 277304? 134068q3 - 6q*2 - 11 What is the third derivative of 275958l*3 - 18l*2 - 303l - 1 wrt l? 1655748 Find the third derivative of 9s6 - 3316s*4 - 23816s*2 wrt s. 1080s*3 - 79584s Find the second derivative of 141862m4 + 3514908m wrt m. 1702344m2 What is the third derivative of 70053p*4 - 3p*2 - p - 732 wrt p? 1681272p Find the second derivative of 24c2t*2x + 101c2t2 - c2tx - 5c2t + 14c2x + 40ct*2x - 2tx - 7t wrt t. 48c*2x + 202c2 + 80cx Find the second derivative of 11928c*3 + 6c*2 - 10141c. 71568c + 12 Find the second derivative of -3g*3n*2 + 3g*3 - 1063g*2n*2 - gn - 2935n2 wrt g. -18gn2 + 18g - 2126n2 Find the first derivative of 16031y - 18589 wrt y. 16031 Differentiate gq4 + 7gq2 + 1456g + 6q2 + 29q - 2 with respect to q. 4gq*3 + 14gq + 12q + 29 Find the third derivative of -2h3o*4 + 7h*3o - 115ho*2 - 7o*4 - 43o*3 - 69 wrt o. -48h*3o - 168o - 258 Find the first derivative of -20395q - 15104 wrt q. -20395 Find the second derivative of -1044u5 + 118u*2 + 322426u + 1 wrt u. -20880u3 + 236 Find the third derivative of 16010i*3m*2z*2 - 2i*3m*2 - 2i*2m*2z + 2iz*2 - 53m*2z - 9m wrt i. 96060m*2z*2 - 12m*2 Find the third derivative of 15770s*5y - s*5 + 5s*2 - 61sy wrt s. 946200s*2y - 60s2 Differentiate 339420x*3 + 208248 with respect to x. 1018260x*2 Find the second derivative of -33619a*4 - 48161a. -403428a2 Differentiate -240g*4 - 1455g - 5365486 with respect to g. -960g3 - 1455 Differentiate -1980s*4 - 14s*2 - 532403 with respect to s. -7920s*3 - 28s What is the derivative of -2803fm*3z + 11f + 11m*3z - 6m3 - 2m wrt f? -2803m3z + 11 Find the second derivative of 13z4 + 1908z*3 - 2z*2 + 490133z wrt z. 156z2 + 11448z - 4 What is the second derivative of -28185w5 + 22996w wrt w? -563700w3 Find the second derivative of a2k*2y - 356a2k*2 - 2282a*2ky2 - 7k*2y*2 - k - 4y*2 wrt k. 2a*2y - 712a2 - 14y*2 What is the second derivative of -1254qv2 - 93q - 562v wrt v? -2508q What is the third derivative of -2i5 + 2277i*4 - 6i*3 - 86i*2 - 187i wrt i? -120i2 + 54648i - 36 What is the third derivative of 2z5 - 41868z4 + z3 + 29z*2	{ "pile_set_name": "DM Mathematics" }
y(u). u - 11 Let a(k) = 10k - 5. Let x(o) be the first derivative of -9o2/2 + 4o + 69. Determine 3a(s) + 4x(s). -6s + 1 Let i(k) = k + 3k + 14 - k - 9 - 11k. Let o(g) = -20g + 12. Let c = -10 - -15. Suppose -w = -0w + c. What is wo(v) + 12i(v)? 4v Let l = -93 + -23. Let s = l - -124. Let f(d) = -5d - 21. Let o(r) = 3r + 14. What is so(h) + 5f(h)? -h + 7 Let d(m) be the second derivative of 0m2 + 0 + 295m + 1/20m5 + 1/6m*3 + 0m*4. Let s(k) = 6k*3 + 5k. Let l = 8 + -12. Determine ls(n) + 20d(n). -4n3 Let z(k) = -5k*3 - 4k*2 + 2k - 2. Let w(c) = -5c2 + 31750c*3 - 15874c*3 - 3 + 2c - 15881c3. What is -4w(j) + 5z(j)? -5j*3 + 2j + 2 Let j(k) = -33k + 52. Let w(p) = -48p + 103. Determine 5j(t) - 3w(t). -21t - 49 Let j(q) = 13q*2 + 924q + 1. Let n(u) = 10u2 + 926u + 1. Determine 3j(x) - 4n(x). -x*2 - 932x - 1 Let j(c) = -32c2 - 134c - 25. Let g(o) = -9o2 - 45o - 6. Give 7g(y) - 2j(y). y*2 - 47y + 8 Suppose 2q + 2t = -2q - 6, t = -3q - 2. Let k(v) = -v. Let p(j) = -6j. Let y(b) = qp(b) - 5k(b). Let z(d) = -d + 1. Give 5y(f) - 6z(f). f - 6 Let y(w) = 10w*3 + 7w*2 - 7w - 1519. Let i(x) = -13x3 - 9x*2 + 9x + 2026. What is 7i(b) + 9y(b)? -b*3 + 511 Let h(d) = 2812d3 + d2 + 15d. Let j(x) = 4218x*3 + 2x*2 + 24x. Calculate -8h(n) + 5j(n). -1406n3 + 2n*2 Let g(u) = 2u + u*2 + 3u*2 - 4u2 + u2. Let y be 40/(22 - 12) - (2 - 0). Let n(k) be the first derivative of k*3 + 7k*2/2 - 10. Give yn(r) - 7g(r). -r2 Let m(u) = -4u + 0 + 2u - 1 + u. Let n(a) = -8a - 8. Suppose -5q - 88 = -2s, s + 13 - 56 = 2q. Let l = s - 49. What is lm(x) + n(x)? 2x + 2 Let l(b) = 7b*3 - 7b*2 + 7b + 1. Let d(k) = -4k3 + 4k*2 - 7k - 2. Calculate 3d(q) + 2l(q). 2q3 - 2q*2 - 7q - 4 Let i(o) = -287o + 175. Let b(c) = -32c + 19. What is -35b(u) + 4i(u)? -28u + 35 Let g(k) = k3 + 3k*2 - 7k - 8. Let x be g(-4). Let a(z) = -11z3 + 2z*2 + 2z + 1. Let h(p) = -32p3 + 7p*2 + 7p + 4. What is xh(j) - 14a(j)? 26j3 + 2 Let n(s) = -3s*3 - 5s*2 - 4s - 2. Suppose -15 = 4k - 39. Let q(j) = kj*2 + 3j + 2j + 3j*3 + 4j*3 + 2 - 3j*3. Give -5n(h) - 4q(h). -h3 + h2 + 2 Let l(p) = 352p*2 + 2p - 81. Let d(k) = 27. Calculate 3d(s) + l(s). 352s*2 + 2s Let f(j) be the first derivative of 4j3 + 3j*2/2 - 3j - 330. Let m(x) = 24x2 + 5x - 5. Determine -10f(h) + 6m(h). 24h2 Let u(k) = -2k*3 + 5k*2 + 3k - 5. Let g(t) = t*3 - 4t*2 - 2t + 4. Let z be ((-1)/2)/(7/(-56)). Let h = 191 - 186. Determine hg(n) + zu(n). -3n3 + 2n Let w(k) = -20k2 - 76k + 3. Let n(r) = 22r2 + 79r - 4. Give -2n(m) - 3w(m). 16m2 + 70m - 1 Let z(p) = 11p + 8p + p*2 - 20p - 5 + 5p. Let h be z(-4). Let m(w) = w - 1. Let j(v) = 2v - 1. What is hj(i) + 7m(i)? -3i - 2 Let t(p) = -2p*2 + 10p + 7. Let a = -3023 + 3022. Let j(c) = -c - 1. Give at(h) - 6j(h). 2h2 - 4h - 1 Let v(z) = 1 + z3 + z - z2 - 5 + 3. Let n(x) = 6x3 - 9x*2 + 9x - 9. Let t = 880 - 847. Let q(j) = -3j + 108. Let r be q(t). Determine rv(y) - n(y). 3y3 Let w(f) be the third derivative of 0 + 0f - 16f2 + 0f*3 - 1/24f*4. Let h(l) = 3. Calculate h(x) - w(x). x + 3 Let z(x) = -77x*2 - 21x - 21. Let s(k) = 13k2 + 17k + 71. Let y(g) = 40g2 + 49g + 202. Let l(t) = -17s(t) + 6y(t). Give 21l(n) + 5z(n). 14n2 Let m(v) = 2v*2 - 9v. Let y(r) = 2r2 - 8r. Let p(q) = -54q - 114. Let h be p(-2). What is hm(a) + 7y(a)? 2a*2 - 2a Let m(o) = -3o2 - o - 9. Let z(p) be the first derivative of p3/3 + 2p - 1821. Suppose -1 - 3 = 2u. What is um(y) - 9z(y)? -3y*2 + 2y Let h(t) = t*2 - 2t. Let i(a) = -a*2 - 13a - 3. Calculate 5h(n) + i(n). 4n*2 - 23n - 3 Let t(r) be the second derivative of -r*5/10 - 13r*3/3 - 2r*2 + 2374r. Let a(l) = l*3 + l + 1. What is -4a(b) - t(b)? -2b3 + 22b Suppose o = 5k - 989 + 1000, 0 = 3o + 5k + 27. Let m(f) = f2 + f + 5. Let h(z) = -2z*2 - 2z - 11. Calculate oh(a) - 9m(a). -a*2 - a - 1 Let n(b) = -16b*3 + 19b*2 + 3b - 3. Let r(m) = 32m3 - 35m*2 - 5m + 5. What is 10n(q) + 6r(q)? 32q3 - 20q*2 Let i(q) = -4q + 4. Let p(f) = -735f + 15. Give -4i(n) + p(n). -719n - 1 Suppose 0 = -z + 6 - 2. Let p(k) = -5k*3 - 4k2 + k + 3. Let b(o) = -o3 - o*2 + 1. Let x = -279413 - -279412. What is xp(a) + zb(a)? a3 - a + 1 Let f(h) = -4h*3 - 2h*2 - 9. Let t(w) = -9w*3 - 4w*2 - 18. Suppose -50 = 3j + 4u, 2j - 3j = 3u + 30. Calculate jt(k) + 13f(k). 2k3 - 2k*2 - 9 Let d(y) = 9y*2 - 4y + 6. Let r(p) = -3494p + 8p*2 + 2 + 1750p + 1741p + 3. Determine 3d(c) - 4r(c). -5c*2 - 2 Let z(f) = 2f*3 - f - 3. Let k(m) = -10m*3 + 8m*2 - 10m + 13. Give -k(h) - 4z(h). 2h*3 - 8h*2 + 14h - 1 Let h(w) = 4w + 3. Let l(q) = 15q + 12. Let m(y) = -5y - 4. Let k(d) = 4l(d) + 11m(d). Let v(t) = 4h(t) - 3k(t). Let n(b) = -42b. Give -n(z) - 35v(z). 7z Let s(d) = 535d2 + 238d*2 + d - 772d*2 + 0 + 1. Let i(t) = 160t*2 + 144t + 144. Calculate 4i(l) - 576s(l). 64l2 Let h(x) = 82x - 15. Let q(s) = -5s + 7. What is h(v) + 2q(v)? 72v - 1 Let v(s) = -21s - 19. Let n(k) = 25k + 17. Let d(h) = 4n(h) + 5v(h). Let m(q) = 2q + 14. Determine -3d(p) - 7m(p). p - 17 Suppose -47l = -41l - 1908. Let g = 305 - l. Let s(x) = -5x + 5. Let d(a) = -11a + 10. What is gs(t) + 6d(t)? -t - 5 Let z(n) = 4n + n + 0 - 1 + 3. Let i be -1 - 2-3 - (1 - 1). Let j(p) = 0p - ip - 1 - 2 - p. Calculate -2j(d) - 3z(d). -3d Let n(f) be the first derivative of -f3/3 - f2/2 - f - 2. Let u = 318 - 302. Let c(y) = 14y + 13 + 5 + 8y + uy*2 - 4y. Calculate 2c(g) + 36n(g). -4g2 Let l be ((-60)/210)/(1/21). Let v(w) = -6w*3 - 3w2 - 2. Let z(j) = -j3 - j*2 - 1. Determine lz(a) + 2v(a). -6a*3 + 2 Let m(h) = -3h - 4. Let b be (21 - 23)3122/4. Let x = 180 + b. Let u(a) = 7a + 7. What is xu(z) - 5m(z)? -6z - 1 Let d(w) = -7. Let h(k) = 41k + 105. Let f(y) = -22y - 56. Let j(o) = 13f(o) + 7h(o). Determine -3d(x) - 2j(x). -2x + 7 Let a(k) = 3k - 5. Let g(h) = 124457h - 219630. Determine -43926a(b) + g(b). -7321b Let q(g) = 2609g + 3. Let a(t) = 10437t + 13. What is 6a(h) - 26q(h)? -5212h Let n(u) = -16u - 24. Let x(z) = z - 1. Let k(y) = y3 + 5y*2 - 9y - 28. Let c be k(-4). What is cx(h) - n(h)? 40h Let d(r) = -137r - 24. Let x(j) = 6j - 3. Give -d(l) + 2x(l). 149l + 18 Let f(g) = 6201g - 7. Let v(m) = -12393m + 13. Determine -11f(q) - 6v(q). 6147q - 1 Let z(r) = -10r3 - r2 + 11r - 1. Let o(d) = -11d*3 + 12d - 2. What is 5o(a) - 6z(a)? 5a3 + 6a*2 - 6a - 4 Let k(a) = 30030a2 + 44a. Let r(b) = -6672b2 - 10b. Calculate 5k(o) + 22r(o). 3366o2 Let z(i) = -3i*2 - 2i - 1. Let k(j) be the third derivative of 0 - 1/6j3 + 0j - 206j2 - 1/24j*4. Give -2k(p) + z(p). -3p2 + 1 Let v(a) = 17a*2 - 655a. Let d(s) = 4s2 - 162s. Calculate 9d(m) - 2v(m). 2m2 - 148m Let p(w) = 2w - 2. Suppose 5x + 4 = x, -3j - 293 = -x. Let m = -83 - j. Let s(a) = 4 - 2a - m + 14. Give -6p(d) - 5s(d). -2d - 3 Let b(p) = -4p*2 + 5p + 5. Let v(t) = 2t2 + 5 + 345t - 5t2 + 337t - 678t. What is -4b(z) + 5v(z)? z2 + 5 Let p(d) = -29d*3 + 6d*2 + 6d + 6. Let n(y) = 145y3 - 29y*2 - 29y - 29. Suppose 117j + 803 - 65 = 36. Calculate jn(h) - 29p(h). -29h*3 Let b(w) be the second derivative of -7w*4/12 + 48w - 287. Suppose -j - l = 0, 3j - 3l - 15 = j. Let z(m) = -22m2. Give jz(q) - 10b(q). 4q2 Let d(i) = -i2. Suppose -49 + 58 = 3l - 2m, -4l = 5m + 11. Let u(q) = -3q2 - 5q - 1. What is lu(p) + 2d(p)? -5p2 - 5p - 1 Let n(q) = 2q2 + 4q - 1072. Let h(c) = -5c2 - 14c + 3217. Determine 2h(t) + 7n(t). 4t2 - 1070 Let w(f) = -10f - 66. Let u be w(-7). Let n(h) = h*2 + 4h - 2. Let t be n(2). Let y(z) = -t - 2 + 13. Let l(r) = 3r + 6. What is uy(v) - l(v)? -3v - 2 Let k(n) = -4104n - 6. Let g(d) = 2076d + 3. Calculate -9g(y) - 4k(y). -2268y - 3 Let w(u) = 3u - 11. Let f be w(5). Let s(c) = -20c + 6. Suppose 43m = -118m - 102*m +	{ "pile_set_name": "DM Mathematics" }
2 + 28h - 10 What is the u'th term of 96, 92, 88? -4u + 100 What is the s'th term of 45, 89, 135, 183, 233, 285, 339? s*2 + 41s + 3 What is the k'th term of -25, -15, 3, 29, 63? 4k2 - 2k - 27 What is the p'th term of -673, -682, -695, -712? -2p2 - 3p - 668 What is the t'th term of -3, -123, -445, -1071, -2103? -17t3 + t2 - 4t + 17 What is the k'th term of -11, -31, -79, -167, -307, -511? -2k3 - 2k*2 - 7 What is the r'th term of -1236, -1274, -1338, -1428, -1544, -1686, -1854? -13r*2 + r - 1224 What is the f'th term of 15, 34, 65, 108, 163, 230, 309? 6f*2 + f + 8 What is the u'th term of 4632, 4630, 4628? -2u + 4634 What is the s'th term of 757, 759, 761? 2s + 755 What is the l'th term of 76, 59, 38, 13, -16? -2l*2 - 11l + 89 What is the k'th term of 85, 79, 71, 61, 49, 35? -k*2 - 3k + 89 What is the a'th term of 34, 33, 44, 73, 126? a*3 - 8a + 41 What is the s'th term of 102, 97, 80, 45, -14? -s*3 + 2s + 101 What is the u'th term of -1275, -2550, -3821, -5088, -6351, -7610? 2u2 - 1281u + 4 What is the b'th term of -231, -477, -707, -915, -1095, -1241, -1347, -1407? b*3 + 2b*2 - 259b + 25 What is the k'th term of 1429, 1423, 1413, 1399, 1381? -2k2 + 1431 What is the r'th term of -58, -115, -172, -229, -286? -57r - 1 What is the k'th term of 47, 49, 51, 53, 55? 2k + 45 What is the u'th term of 11, 18, 27, 38, 51? u2 + 4u + 6 What is the f'th term of 18026, 18028, 18030, 18032, 18034? 2f + 18024 What is the w'th term of -176, -356, -536? -180w + 4 What is the b'th term of 0, 38, 114, 234, 404, 630? b*3 + 13b*2 - 8b - 6 What is the o'th term of -58, -29, 18, 83, 166, 267? 9o2 + 2o - 69 What is the q'th term of -11756, -11755, -11754, -11753, -11752, -11751? q - 11757 What is the i'th term of -3, -6, -7, -6, -3? i*2 - 6i + 2 What is the q'th term of 40695, 40694, 40693, 40692? -q + 40696 What is the x'th term of 23, 176, 591, 1400, 2735, 4728? 22x3 - x2 + 2x What is the z'th term of -34, -69, -102, -133? z*2 - 38z + 3 What is the y'th term of -142, -287, -434, -583, -734? -y*2 - 142y + 1 What is the n'th term of 72, 135, 200, 267, 336, 407? n*2 + 60n + 11 What is the x'th term of -102, -408, -920, -1638, -2562? -103x2 + 3x - 2 What is the f'th term of 4592, 4583, 4570, 4553, 4532? -2f2 - 3f + 4597 What is the l'th term of 0, 6, 10, 12, 12, 10? -l*2 + 9l - 8 What is the b'th term of 25, 35, 35, 19, -19, -85, -185? -b3 + b2 + 14b + 11 What is the x'th term of 315, 623, 925, 1221, 1511, 1795, 2073? -3x*2 + 317x + 1 What is the q'th term of -2904, -2907, -2912, -2919, -2928? -q*2 - 2903 What is the a'th term of 55, 231, 523, 931, 1455, 2095? 58a*2 + 2a - 5 What is the z'th term of -3527, -7054, -10581, -14108, -17635? -3527z What is the m'th term of -15, -26, -37? -11m - 4 What is the r'th term of 95, 97, 99? 2r + 93 What is the c'th term of -20, -91, -270, -611, -1168, -1995? -9c*3 - 8c - 3 What is the w'th term of -274, -272, -270? 2w - 276 What is the y'th term of -44, -43, -44, -47, -52, -59, -68? -y2 + 4y - 47 What is the t'th term of -51, -96, -141, -186, -231? -45t - 6 What is the w'th term of -18, -22, -26, -30? -4w - 14 What is the v'th term of -103, -373, -823, -1453? -90v2 - 13 What is the j'th term of -431, -859, -1281, -1697, -2107? 3j*2 - 437j + 3 What is the x'th term of -374, -747, -1120, -1493, -1866? -373x - 1 What is the a'th term of -7, -9, -11? -2a - 5 What is the s'th term of -58, -202, -442, -778, -1210, -1738? -48s2 - 10 What is the p'th term of 366, 360, 344, 312, 258? -p3 + p2 - 2p + 368 What is the j'th term of -171, -143, -115, -87, -59, -31? 28j - 199 What is the q'th term of -102, -120, -140, -162? -q2 - 15q - 86 What is the y'th term of 21, 66, 139, 240, 369, 526? 14y2 + 3y + 4 What is the n'th term of 52, 72, 78, 64, 24, -48, -158? -n3 - n2 + 30n + 24 What is the w'th term of -14, -25, -38, -53, -70, -89, -110? -w2 - 8w - 5 What is the i'th term of 62, 67, 76, 89, 106? 2i2 - i + 61 What is the v'th term of -11, -27, -53, -89, -135, -191? -5v2 - v - 5 What is the c'th term of 13, 31, 67, 127, 217, 343, 511, 727? c3 + 3c2 + 2c + 7 What is the x'th term of -48, -38, -26, -12, 4? x*2 + 7x - 56 What is the o'th term of 773, 778, 793, 824, 877, 958, 1073, 1228? o3 - o2 + o + 772 What is the q'th term of 331, 332, 333? q + 330 What is the m'th term of 358, 371, 374, 361, 326? -m3 + m2 + 17m + 341 What is the n'th term of 13, 36, 85, 172, 309, 508, 781? 2n3 + n2 + 6n + 4 What is the i'th term of 216, 857, 1926, 3423, 5348, 7701? 214i2 - i + 3 What is the v'th term of -379, -752, -1113, -1456, -1775, -2064, -2317, -2528? v3 - 380v What is the i'th term of -120, -124, -140, -174, -232, -320, -444, -610? -i3 + 3i - 122 What is the i'th term of -239, -258, -279, -302? -i*2 - 16i - 222 What is the s'th term of 4, 13, 22? 9s - 5 What is the z'th term of 141, 285, 429, 573? 144z - 3 What is the d'th term of -20, -9, 16, 61, 132, 235? d3 + d2 + d - 23 What is the f'th term of 52, 51, 46, 37, 24, 7? -2f2 + 5f + 49 What is the a'th term of 7, 22, 37, 52? 15a - 8 What is the y'th term of 52, 96, 140, 184, 228? 44y + 8 What is the b'th term of 407, 412, 419, 428? b*2 + 2b + 404 What is the r'th term of 67, 124, 181, 238, 295? 57r + 10 What is the t'th term of -90, -356, -800, -1422, -2222, -3200, -4356? -89t*2 + t - 2 What is the m'th term of 46, 40, 30, 16, -2, -24, -50? -2m2 + 48 What is the z'th term of -219, -973, -2239, -4023, -6331, -9169, -12543, -16459? -z3 - 250z2 + 3z + 29 What is the l'th term of 17, 16, 7, -4, -11, -8, 11? l*3 - 10l*2 + 22l + 4 What is the o'th term of 17, 52, 83, 110, 133, 152? -2o2 + 41o - 22 What is the c'th term of -44, -47, -52, -59, -68? -c2 - 43 What is the g'th term of 33, 27, 11, -21, -75, -157? -g3 + g*2 - 2g + 35 What is the t'th term of -9, -43, -99, -177, -277? -11t2 - t + 3 What is the r'th term of 81, 159, 239, 321, 405? r2 + 75r + 5 What is the r'th term of 1976, 1980, 1994, 2024, 2076? r3 - r2 + 1976 What is the p'th term of 34, 23, -4, -53, -130? -p*3 - 2p*2 + 2p + 35 What is the k'th term of -98, -229, -446, -791, -1306? -7k3 - k2 - 79k - 11 What is the a'th term of 4, 8, 12, 16, 20? 4a What is the x'th term of -1, 5, 11, 17? 6x - 7 What is the y'th term of -233, -453, -661, -851, -1017? y*3 - 227y - 7 What is the s'th term of 49, 48, 49, 46, 33, 4? -s*3 + 7s*2 - 15s + 58 What is the c'th term of 656, 659, 662, 665, 668, 671? 3c + 653 What is the o'th term of 41, 23, -19, -97, -223? -2o*3 - 4o + 47 What is the l'th term of 39, 13, -31, -93, -173? -9l2 + l + 47 What is the c'th term of 120, 198, 274, 348, 420, 490? -c2 + 81c + 40 What is the d'th term of 1149, 2295, 3427, 4539, 5625, 6679, 7695? -d3 - d2 + 1156d - 5 What is the a'th term of -305, -293, -267, -221, -149? a3 + a2 + 2a - 309 What is the c'th term of 770, 1541, 2312, 3083, 3854? 771c - 1 What is the w'th term of -7, -11, -9, -1, 13, 33? 3w*2 - 13w + 3 What is the t'th term of -139, -143, -147, -151? -4t - 135 What is the r'th term of 6, -13, -46, -93? -7r*2 + 2r + 11 What is the u'th term of -432, -860, -1288, -1716, -2144, -2572? -428u - 4 What is the b'th term of -86, -277, -596, -1043? -64b2 + b - 23 What is the a'th term of 2753, 2754, 2755, 2756? a + 2752 What is the a'th term of -58, -102, -148, -196, -246, -298, -352? -a2 - 41a - 16 What is the i'th term of 135, 168, 227, 324, 471? 2i3 + i2 + 16i + 116 What is the m'th term of 2233, 2239, 2249, 2263? 2m*2 + 2231 What is the h'th term of 157, 162, 171, 184, 201, 222, 247? 2h*2 - h + 156 What is the r'th term of -119, -146, -173, -200? -27r - 92 What is the q'th term of -44, -168, -372, -656, -1020, -1464, -1988? -40q2 - 4q What is the f'th term of -2691, -2693, -2697, -2703, -2711, -2721, -2733? -f2 + f - 2691 What is the i'th term of -58, -113, -172, -241, -326, -433, -568? -i3 + 4i2 - 60i - 1 What is the i'th term of 338, 687, 1052, 1439, 1854, 2303? i*3 + 2i*2 + 336i - 1 What is the l'th term of 267, 403, 767, 1473, 2635, 4367, 6783? 19l3 + 3l + 245 What i	{ "pile_set_name": "DM Mathematics" }
(-6)(-21)/1. Suppose 0 = 5b + 3s + o, 0s = 2b - s + 5. Let p = 1083048.4 - 1083049. What is the third smallest value in 5, p, b? 5 Suppose 0 = 54o - 55o - 2l + 8, -o + 3l - 12 = 0. What is the fourth biggest value in -3, 10, o, -223? -223 Let a = 520 - 1069. Let k = -549 - a. What is the biggest value in k, 7.2, 0.5? 7.2 Let x = -10 + 0. Let q = x + 7. Let m = -244042 - -244031. Which is the third biggest value? (a) q (b) 2 (c) m c Let z = -412.233 + 412. Let n = -0.143 - z. Let r = -2 - -2.5. Which is the third smallest value? (a) n (b) 5 (c) r b Let r = 8828 - 44139/5. Which is the third smallest value? (a) 2/9 (b) -7 (c) r a Let l be ((-5)/(-4))/(22/88). Suppose 9z = 5z + 2x + 12, -lx + 3 = z. Which is the third smallest value? (a) 32 (b) 2/5 (c) -0.5 (d) z d Let g = 24 + -25. Let s = -61 - 3. Let r = s + 67. Which is the smallest value? (a) r (b) g (c) 2 b Suppose r - 9 = -k, 2r = -3r - 4k + 46. Let x = -39921.6 + 39922.1. Let g = -0.04 + 0.34. Which is the biggest value? (a) r (b) g (c) x a Let z = -73/156 - -5/13. Let y = -1374 - -2743/2. Let n = -107 - -109. Which is the smallest value? (a) z (b) n (c) y (d) -1/7 c Let i = -1/518169 - -571022303/33680985. Let x = 84/5 - i. What is the third smallest value in x, -3/4, 0.08, 0? 0 Suppose -54w + 52w = -8. Suppose wq = -u, 8 = -5q + 3. What is the smallest value in u, 32, -5? -5 Let s be (-2 - 0)/(24/348). Let t = -115/4 - s. Let m be 11/(-15) - 2/(-6). Which is the second smallest value? (a) -0.5 (b) m (c) t (d) 5 b Let f = -2931 + 2927. Which is the smallest value? (a) -683 (b) 0 (c) f a Let j = 2370787/4020 - 2359/4. Let c = -3126/335 + j. Let f = 0.2 - 0.1. What is the fourth smallest value in f, 2, -0.4, c? 2 Let x = -0.0527 + -17.5473. Let a = 16.7 + x. What is the second smallest value in a, 2/13, 0.3? 2/13 Let l = 26 + -29. Suppose 46 = 5j + 1. Let v = j - 64/7. Which is the second smallest value? (a) -1/10 (b) v (c) l (d) 0 b Let z be (220/(-8))/(-5) + -4. Let r = 0.2 + 0. Suppose -78g + 196 = 27g - 7g. What is the fourth smallest value in z, r, g, -0.2? g Let z be ((-10)/(-4))/((-5)/14 + (-45)/315). What is the second smallest value in z, -0.2, -3, 4, 0.2? -3 Let n be ((-1512)/16)/(-27) - 5. Suppose 3y + 2y = -2o - 12, 2o - 24 = 4y. What is the fourth biggest value in n, o, -1, 0.3? n Let r = -0.3 - 0. Let v(i) = -2801i - 19611. Let q be v(-7). Let f = 72 - 357/5. Which is the second smallest value? (a) f (b) 5 (c) r (d) q c Let g = 13399 - 147392/11. What is the third smallest value in 6.6, -2/5, -0.3, g, -0.1? g Let g = 1027 + -1027.013. What is the third smallest value in -2/9, 5/3, g? 5/3 Let h = -5644 + 16939/3. What is the second biggest value in -2, -21, h, -4? -2 Let a(v) = -v*2 + 6v. Let c be a(6). Let l be 459/42 - (7 - 138/21). Let f = 71/6 - l. What is the smallest value in -1/2, c, f, 2? -1/2 Let f = 53/180 + -2/45. Suppose 417 = -3o - 4k, -2o - 2k + 7k = 278. Let x = 143 + o. What is the third smallest value in x, f, -2? x Let n = -9351 + 9349. Let y = 0.091 - 7.891. Let f = y + 8. Which is the third biggest value? (a) 2/5 (b) n (c) f b Let u = -2833/3 - -14159/15. Let f = -0.1 - -0.1. Which is the second biggest value? (a) -9 (b) u (c) f b Let l = 919 + -568. Let h = 334 - l. What is the third biggest value in h, 2/25, 5? h Let w = -3042.08 - -3042. What is the third smallest value in -0.04, -1/4, w, 5, 3/8? -0.04 Let i = 91 - 79. Let j = -10.96 + i. Let k = -1.24 + j. What is the biggest value in -4, k, 2? 2 Let j = -0.029 - -0.161. Let k = -1872 - -1871.932. Let q = k - j. Which is the third biggest value? (a) -8 (b) 3 (c) q (d) -2/5 d Let f = -510 - -19888/39. What is the second smallest value in -1/5, 5, f? f Let f = 18 - 12.3. Let t = 0.3 + f. Let y = 17/10 - 73/40. What is the second biggest value in y, t, -2/9? y Let s = -18 - -21. Suppose 5 + 4 = -sh. Let a = -469 + 468.8. What is the smallest value in h, -8, 4, a? -8 Let u = -24592/110691 + -2/36897. What is the fifth smallest value in 3, -1, 2, u, 3/5? 3 Let h = -35 + 45. Let k be (-6)/(-27) - -1 - (-9 + h). Which is the second smallest value? (a) -0.4 (b) k (c) 5 b Suppose -3f = -5m + 5 + 4, 4f + 2m = 14. Let n be f + -4 - (-7 + (-246)/(-42)). Which is the biggest value? (a) 22/5 (b) -5 (c) n (d) 4 a Let q(o) = 4o2 + 31o - 4. Let f be q(-8). Let v be 1/f-1 + 196/(-1008). Which is the second smallest value? (a) -5 (b) v (c) 18 b Suppose 4x - 16m + 22m = -14, -3x = -4m + 19. What is the third smallest value in x, -58, -1.2? -1.2 Let v = 0.2665 + -4.0665. What is the third biggest value in 0.1, v, -10/11? v Let g = 8305 - 8306. Let x = -1 + 0.5. Suppose -2j - 10 = 5l, -3l = -3j - 14 + 41. What is the third biggest value in j, g, -3/4, x? -3/4 Let k = 3890 - 3895. Let q = -24.02 - -24. What is the second biggest value in q, k, 0.1? q Let w = 172.2864 - 175.27. Let x = w + -0.0164. Let j = 1/70 + -57/70. What is the second smallest value in -4/3, j, 6/11, x? -4/3 Let q = 2/19837 + -60259/7419038. Which is the biggest value? (a) q (b) -2 (c) 3 c Let d = -45.48 + 51.3. Let w = d + -4.82. Which is the biggest value? (a) w (b) 48 (c) -0.3 b Let t = 3340.023 - 3340. Which is the second smallest value? (a) -0.3 (b) t (c) 135 b Suppose -3q - 18 = 0, 5q - 2 = 5y - 57. Which is the fourth smallest value? (a) 1 (b) -5 (c) 50 (d) y c Let d = 9475 + -9478. Let c be (-5)/(-15) - (-30)/(-63). Let y = -6.4 + 6. What is the third biggest value in y, d, c? d Let d be 1/2 - 1/(-4). Let o = -149 - -464. Let t = o - 314.9. Which is the third smallest value? (a) t (b) d (c) -5 b Let k = -0.631 + 52.231. Let j = 52 - k. Which is the second smallest value? (a) j (b) 2/9 (c) -5 (d) 76 b Let c be -11 + (-783)/(-36) - 10 - 207/12. What is the second smallest value in c, 2, 4? 2 Let c = 4101 - 4100.8. What is the third biggest value in -14, c, 4, 5/6? c Let n = -24869/4 - -6274. Let y = n + -2545/44. Which is the smallest value? (a) 0.4 (b) y (c) 4 b Let o = 15.26 + -0.26. Let s = 298.38 + -300. Let y = s - -4.62. Which is the third smallest value? (a) o (b) -3/2 (c) y a Let l be (-10 + 7)/(18/(-4)). Let u = -0.4305 + 0.3305. Let k = -127 - -1144/9. Which is the second biggest value? (a) k (b) l (c) u a Let x = 218 - 1964/9. Let c be ((0 - -6)/(-2))/(94 + -99). What is the third biggest value in c, x, 0.5? x Let k = 25.438 + -21.438. Which is the third smallest value? (a) 19 (b) 0.08 (c) k (d) 1/6 c Let o = 126.31 - 0.31. Let z = o - 125.5. Which is the smallest value? (a) -2/7 (b) 0.1 (c) z (d) -0.1 a Let x = -0.07089 - -1.47089. What is the second biggest value in -35, 1/2, x? 1/2 Let o = 1249.4 - 1249. Which is the third biggest value? (a) -4 (b) o (c) 1/21 a Let h = -0.75 + 0.15. Let m(v) = 4v. Let y be m(1). Let z be 9538/722 + 1 + -1. What is the smallest value in -3, y, h, z? -3 Let i be (-5 + (-2 - -9))2/12. Let u = -87379/936026 - 2/36001. Let h = u - 5/26. Which is the smallest value? (a) 0.08 (b) i (c) h (d) 0.5 c Let t = 43.1 - 39.1. Let d = -3.4 + -11.6. Let m = 14 + d. What is the fourth biggest value in -6, m, 2/9, t? -6 Let c = 102 + -91. Let y = c + 77. Let x = -83 + y. What is the smallest value in -1/4, x, -3/4? -3/4 Let x = 0.4 + -2. Let f = x - -1. Let v be (4/10)/(768/(-3200)). What is the biggest value in 0.4, f, v? 0.4 Let j be (-143)/44 + (-3)/(1/(-1)). Let z = 24.55 - 21.55. Which is the second biggest value? (a) z (b) 4/9 (c) j (d) -4 b Let u(s) = -s*2 - 6s - 30. Let a be u(-4). Let k = a + 27. What is the second smallest value in 2/9, k, 0.3, -4? 2/9 Let w = -39.904 + 40. Let a = w + -12.096. What is the third biggest value in a, 6, -3/7? a Let q = 14/3195 - 4275008/22365. What is the smallest value in 3, -3/5, q, 0.1? q Suppose 460y = 52 + 47 - 2399. Which is the third smallest value? (a) -1/7 (b) -4/7 (c) y (d) -1/3 (e) -1/173 d Let s = -11 + 15. Let j = -975 - -974. What is the third smallest value in s, j, -0.4, -0.03? -0.03 Let p be 3 + (-32)/10 - 437/(-1235). Which is the fourth biggest value? (a) -1/3 (b) -2 (c) 4 (d) p b Let d = -2006.5 - -2007. Let c be 33/88(-14)/3. What is the biggest value in 3, c, d? 3 Let g = 0.0	{ "pile_set_name": "DM Mathematics" }
-1? -10 Calculate -49 + (101 - 45) + 20. 27 (-45 - (0 + 2)) + 12 + 1 -34 What is -388 + 457 + (-19 - -2)? 52 Evaluate -10 + -33 - (-2 + -2 + 7 - -10). -56 -23 + (-90 + 77 - (4 + -71)) 31 What is 12 - (-4 - (9 - (-8 + (21 - -3))))? 9 Calculate 65 - 1 - ((18 + -39 - -62) + -45). 68 Calculate (879 - 952) + (7 - 2 - 25). -93 Evaluate -159 + 142 - 171 - -141. -47 What is -51 + (58 - (30 + -3))? -20 -110 + 2 - (-1186 - -1101) -23 Evaluate 94 + (6 - 149) - -51. 2 What is -39 - ((7 - -20) + 1 - 130)? 63 Evaluate (-22 - -126) + -120 + 62. 46 -100 - (-251 + 140) - 118 -107 What is the value of 14 + (-41 - (-5 + -10)) + -19? -31 What is -110 + -126 - -246 - ((0 - -40) + 0)? -30 What is 80 + 0 + 3938 + -4025? -7 Calculate (-16 + 8 - (3 + 3 + -11) - -3) + 4. 4 Evaluate -15 - (27 - (2 + -2 + -32)). -74 What is the value of 21 + 48 + -37 + -4 - (-2 - 1)? 31 Calculate 11 + -27 + 3 + -19 + (-32 - (-9 + 6)). -61 What is -3 - ((10 + -25 - (-19 - -7)) + -5 + 0)? 5 (4 - 7) + (-8 - (-11 + -11 + 7 + 2)) 2 What is (58 - (5 - 0 - ((-5 - 4) + 11))) + -1? 54 What is -7 + (-18 - -48 - 47)? -24 Evaluate (-9 - -7) + 0 - ((-66 - 11) + 111). -36 Evaluate -120 + 36 - (-219 + 135). 0 What is 44 - (106 - (31 - 24))? -55 What is the value of (63 - -22 - -6) + -54? 37 Evaluate (247 - 249) + (-34 - (3 + 0)) - 0. -39 What is the value of 15 + (-11 - ((11 - 0) + -28 + 13))? 8 What is 279 + -298 + (1 + 37 - 2) + -44? -27 (-1497 - -1482) + (-2 - -37) 20 Evaluate -3 + 14 - (-183 + 22 - -85). 87 Evaluate 0 - 5 - (48 + -41 + -25). 13 Calculate 104 + 1 - (825 + -739). 19 -55 + (-29 - -88) + (45 - -2) 51 What is (56 - 0 - ((27 - 71) + 41)) + 15? 74 What is -68 - (-6 - 9 - (-3 + 2 + -3 + -2))? -59 Calculate (-41 - (7 + -21)) + 31 - (2 + -51 + -2). 55 -145 + 119 + (48 - -9 - -6) 37 Calculate 0 + 1 + 61 + 67 + -36 + -8 + -28. 57 What is -7 + (71 - 37 - 41) + -94? -108 -70 - (-65 - -63) - -62 -6 What is -6 + (-17 - -87 - 5) + 11 + 9? 79 What is the value of 121 + (1142 - 1112) + (1 - 63)? 89 Calculate -5 + -35 - (86 - 96). -30 Calculate (9 - (0 + 1)) + -33 + 112 + -85 - -63. 65 What is -4 + -21 + (-6 - (5 - 5)) + -2 + -7? -40 20 + -23 + 55 + -29 23 What is the value of (23 - 45 - (17 + -13)) + -7? -33 Calculate (-17 - -10) + (12 - -2) + -117 + 172. 62 What is 115 + -169 + (-37 - -82)? -9 What is 1 - (-2 + (1 - -2)) - (45 + (3 - 2))? -46 Evaluate -11 - -12 - (-18 + -16 - -108). -73 Calculate -12 + 40 + -15 - (5 + -29). 37 Evaluate 36 - -21 - -8 - 5. 60 Evaluate -1 + 10 + (-32 - (-13 - (-12 + -20))). -42 What is 135 - -14 - (45 + -15)? 119 78 + (-44 - 59) + -56 -81 What is the value of 4 - (-2 - 8) - (5 + -28 + 75)? -38 Evaluate -7 - (774 - 772 - (-1 + -16)). -26 What is the value of (2 - 11) + 38 + (-6 - (-6 + 14))? 15 Evaluate (-3 - 26) + 82 + -30. 23 11 + 7 - 10 - -23 - 34 -3 What is (19 - 36) + (45 - 29) + -70? -71 What is the value of 7 + -3 + 6 + -7 - (25 + -37)? 15 What is -3 + 0 + (9 - 17) - (-10 - (-99 + 30))? -70 What is the value of 7 - (7 + -1 - (-10 - (-22 + 28 + -18)))? 3 What is -34 + (23 - (-10 + 20)) - (-6 - (-7 - -4))? -18 (2 + -1 - (20 + -8)) + (41 + 3 - 11) 22 Evaluate 0 - ((-2 - 0) + 879 + -870) - -9. 2 What is the value of -36 + -40 + (109 - 47)? -14 What is the value of 449 - 416 - (47 + 1)? -15 What is the value of 34 - (3 + -11 + 18 + (-4 - 9))? 37 Calculate 35 + (-101 + 115 - 111). -62 -360 + 314 - (-94 - -1) 47 Calculate (12 - 0) + 142 + -144 - 22. -12 Evaluate (-3 + 1 - 7) + (-13 - (-19 - -16) - -5). -14 What is the value of 15 + (64 - (-9 + 20))? 68 Calculate -15 - (153 + -234 - -169). -103 What is the value of (31 + -29 - -55) + -47? 10 Evaluate 10 - -77 - ((24 - 19 - -9) + (2 - 10)). 81 66 + -144 + 36 + -50 -92 What is -2 + (-13 - -16 - 61) + 2 + -12 + 11? -59 (0 - -2 - 52) + -19 -69 Calculate 4 + (0 - 2) - -65 - (12523 - 12512). 56 What is the value of 27 + -8 - (53 + 8 + -20)? -22 What is the value of 0 + -13 - (-17 + 44 + -27)? -13 What is 18 - ((-3 - 14) + 94 - 3 - 23)? -33 Calculate -27 - 2 - (138 + -118 + -92). 43 What is 22 + -36 - ((-6 - 3) + -15)? 10 (51 + -60 - -32) + -78 -55 What is the value of -22 - (16 - (-23 + 46) - -11)? -26 Calculate (-11 - (-17 + (10 - -1))) + 44. 39 Evaluate 82 + 1 + -5 + -5 + (-20 - (-20 - 9)). 82 What is the value of (-2 + (-38 - -58) - (15 - 1)) + -48? -44 Evaluate -30 - -28 - (35 + 8 + -6 + 0 + 5). -44 What is -7 + 5 + (1 - 1) - ((-5 - 11) + -26)? 40 What is (59 + -33 - (52 + 19)) + -7? -52 Evaluate -17 - ((-22 - 1) + (123 - 148)). 31 Calculate 68 + -199 - -57 - -38. -36 What is -4 - ((-71 - -53) + -6)? 20 Evaluate 1 - (17 - -3) - ((2 - -3 - 12) + -1). -11 Evaluate -2 + 28 + (181 - 218) + (-9 - 0). -20 Evaluate (128 + 97 - 29) + -88. 108 What is 73 - ((13 - -1) + (25 - 20) + 0)? 54 What is -12 + 7 + 18 - (8 - (4 - 9))? 0 What is (-17 + 0 - (-30 + 37)) + 25? 1 Evaluate -27 + (64 - -27 - 12) - 14. 38 What is 12 - ((43 - 36) + (15 - 20))? 10 What is -15 + (-19 - (-36 - 18))? 20 Evaluate 7 + (-19 - 1) + (-410 - -570) - -1. 148 Evaluate (56 - -24) + -42 - 12. 26 Calculate 3 + 10 + 0 + -18 + (7 - -12) + -91. -77 What is the value of 16 - -6 - (-69 + 89)? 2 Calculate -11 + -1026 + 980 + (-2 - 70). -129 Evaluate (-2 + -44 - (12 + -28)) + 1 + 5. -24 Evaluate (5 - -11) + -22 - -14 - -39. 47 Evaluate (2 - -3) + -22 + -55 + -21 + 1 + -12. -104 What is (-7 + (4 - 8) - -3) + (-437 - -417)? -28 8 + (-111 + 39 - 4) + 4 + -3 + 0 -67 What is the value of (28 - (13 - -25)) + (18 - 10 - -100)? 98 Calculate -13 + (-51 - 4) + 3. -65 15 + (-31 - -11) + 4 + -20 - -117 96 -35 + 37 + 28 - (-3 - 0) 33 Calculate (-7 + -5 - (-6 + -6)) + -2. -2 What is 14 - ((29 - -33) + -18)? -30 Calculate -29 - (1 + (22 - (31 + -4))). -25 -30 - 1 - (15 + -10) - (3 + -1) -38 What is (1431 - 1325) + (-53 - -1)? 54 What is the value of (-3 - 14) + 5 - (-5 - (-17 + 10))? -14 What is the value of -3 - ((3 - (17 + -7 - 47)) + 7)? -50 What is the value of -83 - 1 - (329 + -351)? -62 Evaluate -46 + (-68 + 2 - -52). -60 What is (-15 + 28 - (-4 + -4) - 9) + -59? -47 71 + (36 + (-21 - -37) - 27) 96 (-3 - (-4 - 18)) + (42 - 62 - -23) 22 What is the value of (8 - (2 - 0) - 59) + 36 + -29 + -16? -62 Evaluate (11 - (150 + 13)) + (-266 - -295). -123 (3 - (-50 + 12 + 37)) + (2 - (-32 + 2)) 36 Evaluate (-21 - (-26 - 30)) + -14. 21 Evaluate -112 + (-135 - -291) + (22 - (2 + 0)). 64 9 + (0 - -31) - (30 - 32 - (3 + 1)) 46 What is (629 - 702) + (-17 - -155)? 65 -49 + -25 + 107 + -21 12 What is the value of (450 - 449) + (-3 - 0 - -6) + -39 - 10? -45 Calculate -22 + -9 - (-3 - -14 - (36 - 25)). -31 What is the value of ((4 + -13 - -6) + 11 + -19 - -84) + 15? 88 -6 + (85 - ((-2 - 15 - (62 + -59)) + 11)) 88 What is (1 - -9) + -102 + 130? 38 Evaluate -30 + -54 + 101 - 42. -25 What is the value of -1 + -1 + -51 - (-155 - (22 + -166))? -42 What is the value of (-17 - (7 - (-1 - -33))) + 2 - 43? -33 What is the value of -20 - (-54 + 16 + -12) - 93? -63 Calculate (-7 - (18 + -24 - 20)) + 7 + 2. 28 Calculate -13 + 1 + (-40 + 17 - -1). -34 Evaluate 4 + (-4 - (-4 - 1 - -1)) + (-493 - -573). 84 -81 + (4 - (-132 + 155 - (2 + -2))) -100 Calculate (-1 - 11) + 120 - (-2 + (1 + -3 - -13)). 99 What is the value of (7 - 1 - (24 - 24) - 1) + -48 + 8? -35 What is -94 + 0 + (17 - 9) + -6 + 13? -79 -10 + (-24 - -13) + (-4 - -14) + -13 -24 What is -11 + -1 + (-3184 - -3287)? 91 What is the value of -123 + 35 - -98 - (8 + 1)? 1 What is the value of -7 + (-10 - (-15 + 14 - 33))? 17 ((-13 - -3) + 1 - 4 - (-160 - -153)) + -64 -70 (-563 - -597) + (-1 - 65) -32 107 + (-2 - 88) + -44 -27 What is -12476 - -12539 - (98 + 1)? -36 What is the value of -45 + 46 + -3 - -25? 23 Evaluate (13 - 70) + 0 - (14 + -28). -43 What is the value of -4 + 58 - (-93 + -12 - -75)? 84 Calculate -12 + (-9 - -14) - (27 - 41). 7 Calculate 20 + -41 + 13 - -50. 42 Calculate -28 + 4 + 5 + 7 + 9 + 1. -2 What is 47 - (8 - (5 - 5 - (-16 - -14 - 14)))? 55 What is -99 + (-28 - (-42 + -34))? -51 Calculate (-15 - -29) + -2 - -20. 32 Evaluate 26 + (31 - 30) + 59 + -38. 48 (7 - 5 - -43) + (5 - 0 - (-13 + 21)) 42 Evaluate 46 - (8 + (7 - ((2 - 8) + 16)) + -1). 42 Calculate -78 + (30 - (-7 - 4)) + 8. -29 Calculate 1 + (-14 - -3) + 6 + (155 - 199). -48 Evaluate 15 + (-9 + 14 + 1 - -6) + -14. 13 What is the value of (-8 - (-2 + -4 + 42)) + -14 + (24 - 15)?	{ "pile_set_name": "DM Mathematics" }
nder when 39833 is divided by 74. 21 Calculate the remainder when 3527 is divided by 501. 20 What is the remainder when 57597 is divided by 447? 381 What is the remainder when 16197 is divided by 424? 85 What is the remainder when 8996 is divided by 896? 36 Calculate the remainder when 23283 is divided by 1455. 3 What is the remainder when 12289 is divided by 1024? 1 What is the remainder when 7629 is divided by 24? 21 Calculate the remainder when 3858 is divided by 156. 114 What is the remainder when 4110 is divided by 59? 39 What is the remainder when 158208 is divided by 1155? 1128 Calculate the remainder when 3709 is divided by 465. 454 What is the remainder when 393401 is divided by 2751? 8 What is the remainder when 6455 is divided by 127? 105 What is the remainder when 11965 is divided by 31? 30 Calculate the remainder when 14910 is divided by 746. 736 What is the remainder when 44542 is divided by 225? 217 Calculate the remainder when 63776 is divided by 68. 60 Calculate the remainder when 110201 is divided by 36674. 179 What is the remainder when 21293 is divided by 79? 42 Calculate the remainder when 2303 is divided by 2194. 109 Calculate the remainder when 364812 is divided by 605. 602 What is the remainder when 126 is divided by 37? 15 What is the remainder when 6764 is divided by 6748? 16 Calculate the remainder when 86389 is divided by 4319. 9 What is the remainder when 6081 is divided by 135? 6 Calculate the remainder when 185731 is divided by 307. 303 What is the remainder when 3704 is divided by 139? 90 Calculate the remainder when 2531 is divided by 419. 17 Calculate the remainder when 17990 is divided by 334. 288 Calculate the remainder when 119213 is divided by 111. 110 What is the remainder when 19794 is divided by 6597? 3 Calculate the remainder when 13243 is divided by 11. 10 Calculate the remainder when 151798 is divided by 18974. 6 What is the remainder when 85830 is divided by 17153? 65 Calculate the remainder when 5750 is divided by 59. 27 Calculate the remainder when 132415 is divided by 5757. 4 What is the remainder when 60968 is divided by 7? 5 Calculate the remainder when 10860 is divided by 99. 69 Calculate the remainder when 22228 is divided by 1389. 4 What is the remainder when 257151 is divided by 2? 1 Calculate the remainder when 37718 is divided by 484. 450 What is the remainder when 527148 is divided by 6936? 12 What is the remainder when 5094 is divided by 282? 18 Calculate the remainder when 13384 is divided by 1673. 0 What is the remainder when 14154 is divided by 1954? 476 Calculate the remainder when 49993 is divided by 55. 53 Calculate the remainder when 1587 is divided by 343. 215 Calculate the remainder when 3679 is divided by 3542. 137 Calculate the remainder when 4756 is divided by 35. 31 What is the remainder when 3480 is divided by 176? 136 What is the remainder when 11741 is divided by 2840? 381 Calculate the remainder when 395802 is divided by 39579. 12 Calculate the remainder when 181218 is divided by 820. 818 Calculate the remainder when 9092 is divided by 3009. 65 Calculate the remainder when 19756 is divided by 19. 15 What is the remainder when 12005 is divided by 5989? 27 What is the remainder when 3228 is divided by 8? 4 Calculate the remainder when 805342 is divided by 24. 22 What is the remainder when 2652 is divided by 58? 42 Calculate the remainder when 5520 is divided by 1344. 144 What is the remainder when 94532 is divided by 145? 137 Calculate the remainder when 11540 is divided by 78. 74 Calculate the remainder when 143114 is divided by 20443. 13 What is the remainder when 11646 is divided by 329? 131 What is the remainder when 1315236 is divided by 111? 108 Calculate the remainder when 149404 is divided by 184. 180 What is the remainder when 10970 is divided by 7? 1 What is the remainder when 120459 is divided by 65? 14 Calculate the remainder when 462312 is divided by 63. 18 What is the remainder when 8144 is divided by 510? 494 What is the remainder when 1219518 is divided by 7? 6 What is the remainder when 25185 is divided by 1143? 39 What is the remainder when 24003 is divided by 73? 59 What is the remainder when 54399 is divided by 13? 7 What is the remainder when 10511 is divided by 100? 11 Calculate the remainder when 471 is divided by 361. 110 What is the remainder when 3250 is divided by 558? 460 Calculate the remainder when 289811 is divided by 345. 11 What is the remainder when 18307 is divided by 394? 183 Calculate the remainder when 756 is divided by 77. 63 Calculate the remainder when 188813 is divided by 11106. 11 Calculate the remainder when 45827 is divided by 45773. 54 Calculate the remainder when 10620 is divided by 80. 60 What is the remainder when 49433 is divided by 25? 8 What is the remainder when 198479 is divided by 45? 29 Calculate the remainder when 29160 is divided by 39. 27 What is the remainder when 2179 is divided by 311? 2 Calculate the remainder when 13338 is divided by 2595. 363 Calculate the remainder when 9183 is divided by 4540. 103 Calculate the remainder when 6329 is divided by 701. 20 What is the remainder when 382 is divided by 320? 62 Calculate the remainder when 12830 is divided by 279. 275 Calculate the remainder when 942 is divided by 853. 89 What is the remainder when 33048 is divided by 234? 54 Calculate the remainder when 6141 is divided by 98. 65 What is the remainder when 1254015 is divided by 32? 31 Calculate the remainder when 29296 is divided by 7324. 0 Calculate the remainder when 3210 is divided by 1495. 220 Calculate the remainder when 23136 is divided by 540. 456 Calculate the remainder when 607 is divided by 426. 181 Calculate the remainder when 389 is divided by 199. 190 What is the remainder when 74230 is divided by 15? 10 What is the remainder when 1179314 is divided by 365? 364 What is the remainder when 3772 is divided by 475? 447 Calculate the remainder when 1233 is divided by 85. 43 Calculate the remainder when 80461 is divided by 188. 185 What is the remainder when 3550040 is divided by 11? 10 What is the remainder when 709379 is divided by 66? 11 What is the remainder when 145453 is divided by 24242? 1 What is the remainder when 1538835 is divided by 1303? 1295 What is the remainder when 440543 is divided by 334? 331 Calculate the remainder when 411 is divided by 3. 0 What is the remainder when 1729 is divided by 287? 7 Calculate the remainder when 181179 is divided by 235. 229 Calculate the remainder when 138720 is divided by 1261. 10 What is the remainder when 24620 is divided by 2734? 14 What is the remainder when 1231914 is divided by 185? 184 Calculate the remainder when 49472 is divided by 239. 238 Calculate the remainder when 956 is divided by 492. 464 What is the remainder when 2179685 is divided by 977? 975 What is the remainder when 1459 is divided by 227? 97 Calculate the remainder when 5243169 is divided by 121. 118 What is the remainder when 546 is divided by 545? 1 What is the remainder when 1008 is divided by 982? 26 What is the remainder when 195084 is divided by 6? 0 Calculate the remainder when 61967 is divided by 127. 118 What is the remainder when 663983 is divided by 226? 221 Calculate the remainder when 50323 is divided by 275. 273 What is the remainder when 1979 is divided by 275? 54 What is the remainder when 23849 is divided by 442? 423 What is the remainder when 10951 is divided by 20? 11 What is the remainder when 64947 is divided by 150? 147 Calculate the remainder when 30213 is divided by 204. 21 Calculate the remainder when 5325 is divided by 24. 21 What is the remainder when 201739 is divided by 131? 130 What is the remainder when 7465 is divided by 165? 40 What is the remainder when 14484 is divided by 12? 0 What is the remainder when 161497 is divided by 32? 25 What is the remainder when 484071 is divided by 6631? 8 What is the remainder when 17808 is divided by 8867? 74 Calculate the remainder when 822 is divided by 778. 44 What is the remainder when 18478 is divided by 330? 328 Calculate the remainder when 50944 is divided by 16959. 67 Calculate the remainder when 75802 is divided by 489. 7 What is the remainder when 2916 is divided by 405? 81 Calculate the remainder when	{ "pile_set_name": "DM Mathematics" }
584h/19 - 1882944 = 0. -235368, 76 Suppose l5/4 - 5003l*4/4 + 3750l*3 = 0. Calculate l. 0, 3, 5000 Find k such that 3k*5/4 + 142887k*4/4 + 285705k*3/4 - 2714799k*2/4 - 714405k = 0. -47627, -5, -1, 0, 4 Find x such that x*5 - 18857x*4 + 169660x*3 - 527780x*2 + 678544x - 301568 = 0. 1, 2, 4, 18848 Factor 2z2/3 + 1649684z/3 - 18147250. 2(z - 33)(z + 824875)/3 Determine y, given that -y*5/3 + 274y*4/3 + 593y*3/3 - 3758y*2 - 3864y = 0. -7, -1, 0, 6, 276 Suppose -o*4 + 661o*3 - 68097o*2 + 1954139o - 1886702 = 0. Calculate o. 1, 59, 542 Factor 3g3 - 2466g*2 - 335235g - 660582. 3(g - 941)(g + 2)(g + 117) Solve -i3/5 + 25851i*2/5 + 1035321i/5 + 8259229/5 = 0. -29, -11, 25891 What is z in 5z3/2 + 1945z*2/2 - 26750z - 362250 = 0? -414, -10, 35 Factor 3a2 - 170439a - 2557260. 3(a - 56828)(a + 15) Find s such that 3s4 - 7868s*3/3 + 71885s*2/3 - 77866s/3 + 13840/3 = 0. 2/9, 1, 8, 865 Factor s*2/2 - 41288186s + 82576371/2. (s - 82576371)(s - 1)/2 Let -3g*5/5 - 42g*4/5 + 9579g*3/5 + 77802g*2/5 - 9576g/5 - 15552 = 0. What is g? -60, -8, -1, 1, 54 Factor -2c3 + 132c*2 + 674c - 96900. -2(c - 57)(c - 34)(c + 25) What is m in -3m*3 + 27084m*2 + 1224477m + 3429594 = 0? -42, -3, 9073 Factor 2m2/5 + 18546m/5 + 222264/5. 2(m + 12)(m + 9261)/5 Solve 4o5 + 21016o*4 + 731260o*3 + 3131400o*2 = 0 for o. -5219, -30, -5, 0 Factor 3l*4 - 25884l*3 + 1288575l*2 - 16083750l. 3l(l - 8578)(l - 25)2 Suppose 31l*5/4 - 27431l*4/4 + 78579l*3/4 - 71461l*2/4 + 8377l/2 + 882 = 0. Calculate l. -4/31, 1, 882 Factor -2b3 + 26924b*2/3 + 11459968b/9 + 44475392. -2(b - 4626)(3b + 208)2/9 Factor -6h*4/11 + 462821544h*3/11 - 11900210088363552h*2/11 + 101993955685570288332672h/11. -6h(h - 25712308)3/11 What is k in k5 - 1024k4 + 137206k*3 - 4709088k*2 + 8478153k + 13325472 = 0? -1, 3, 53, 96, 873 Find l, given that -l*3 - 4159497l*2 - 16637972l = 0. -4159493, -4, 0 Let -4i3/5 + 50847804i*2/5 - 101695596i/5 + 50847796/5 = 0. What is i? 1, 12711949 Factor -4u2 + 20924u - 7444992. -4(u - 4847)(u - 384) Factor 5w3 + 990w*2 + 42145w + 276360. 5(w + 8)(w + 49)(w + 141) What is n in 8n*5 - 84n*4 - 18756n*3 - 135284n*2 - 240804n - 88920 = 0? -39, -5, -2, -1/2, 57 Solve 2v4 - 258v*3 - 17962v*2 + 548322v - 530104 = 0 for v. -67, 1, 23, 172 Factor -z*4 - 9757z*3 + 126970z*2 - 390764z + 351720. -(z - 9)(z - 2)2(z + 9770) Let -2y2/3 + 3526y/3 - 64828 = 0. What is y? 57, 1706 Find k, given that -2k5/11 + 448k*4/11 - 25874k*3/11 + 350292k*2/11 - 324864k/11 = 0. 0, 1, 18, 64, 141 Solve 3f4 - 7731f*3 + 737106f*2 - 2824920f = 0 for f. 0, 4, 95, 2478 Factor -t*3 - 1860t*2 - 78551t - 763140. -(t + 15)(t + 28)(t + 1817) Suppose 1208q3 - 39858q*2 - 456822q - 2268 = 0. Calculate q. -9, -3/604, 42 Suppose -2o5/7 + 21982o*4/7 + 706078o*3/7 - 6681278o*2/7 + 14771620o/7 - 8818400/7 = 0. Calculate o. -40, 1, 2, 5, 11023 What is r in 3r3/2 + 20157297r*2/2 - 80629260r + 161258568 = 0? -6719107, 4 Determine y so that 4y2/7 + 9011428y/7 + 9011424/7 = 0. -2252856, -1 Suppose -3d4 + 552609d*3 - 25442255634d*2 - 534510092736d - 967246742016 = 0. Calculate d. -19, -2, 92112 Factor -4d2 + 1092252d - 1092248. -4(d - 273062)(d - 1) Let -3o3 + 273609o*2 + 2189016o + 4378128 = 0. What is o? -4, 91211 Find j such that -j*5/3 - 26657j*4/3 - 177715463j*3/3 - 885965707j*2/3 + 4321852784j + 4557945084 = 0. -13326, -11, -1, 7 Factor 11h3/4 + 45h*2 - 111071h/4. h(h + 109)(11h - 1019)/4 Find t such that -5t*3 - 16880t*2 - 14076420t + 288320400 = 0. -1698, 20 Factor -3p2 + 594180p + 10101927. -3(p - 198077)(p + 17) Factor c*2/8 - 11471c/8 + 7950477/4. (c - 9858)(c - 1613)/8 Factor 3v*2/5 - 55646958v/5 + 258048661221147/5. 3(v - 9274493)2/5 Suppose 2q*4 - 297780q*3 + 127973376q*2 - 255053420q + 127377822 = 0. What is q? 1, 429, 148459 Factor 2g3 + 559670g*2 + 39156891616g + 430658090368. 2(g + 11)(g + 139912)*2 Solve -2s*5/5 - 19742s*4 + 789814s*3/5 + 296126s*2/5 - 2566844s/5 + 1579616/5 = 0 for s. -49363, -2, 1, 8 Determine v so that -5v2 - 1001570v - 28040040 = 0. -200286, -28 Factor -4b3 + 12464b*2 + 839788b + 827320. -4(b - 3182)(b + 1)(b + 65) Find o such that -o2/8 + 519597o/2 - 269981042409/2 = 0. 1039194 Factor -3i4/2 + 2652177i*3/2. -3i*3(i - 884059)/2 Suppose -1086f3 + 23949f*2 - 132660f + 6897 = 0. Calculate f. 19/362, 11 Solve 2o4/3 - 43708o*3/3 + 255236378o*2/3 - 59871655480o + 11258276616600 = 0 for o. 390, 10537 Factor 2o2 + 197432o + 12233096. 2(o + 62)(o + 98654) Suppose -y*3 + 61684y*2 - 493399y - 555084 = 0. Calculate y. -1, 9, 61676 Let -5j2/6 + 1063775j/3 - 26235220 = 0. What is j? 74, 425436 Solve -3d2 - 31734471d = 0. -10578157, 0 Determine a, given that -2a2/7 + 43244a/7 - 5844192/7 = 0. 136, 21486 Find q, given that q*4/4 + 2865q*3/2 + 748182q*2 + 2984135q/2 + 2981271/4 = 0. -5149, -579, -1 Solve 4w5 - 26544w*4 + 47133220w*3 - 10054763352w*2 - 104095909520w - 263202208800 = 0. -5, 258, 3194 Solve u*3 - 37241u*2 + 446759u - 409519 = 0. 1, 11, 37229 Let 20c2 - 1698815c - 6795580 = 0. What is c? -4, 339779/4 Let -4h4 - 796h*3 - 13164h*2 - 23956h - 11584 = 0. What is h? -181, -16, -1 Suppose 2z4 + 284709z*3 - 996498z*2 + 1138861z - 427074 = 0. Calculate z. -142358, 1, 3/2 Let y*5/4 + 905y*4/4 + 39081y*3/4 - 371993y*2/4 - 19541y/2 + 92772 = 0. What is y? -859, -54, -1, 1, 8 Determine c so that 4c4 + 692c*3 + 13916c*2 + 96268c + 217440 = 0. -151, -9, -8, -5 Determine a so that a*2/9 + 24640a/9 - 128921 = 0. -24687, 47 Factor -2v2/3 - 6010v/3 + 10539496. -2(v - 2748)(v + 5753)/3 Determine b so that 4b4 - 1516b*3 - 207972b*2 - 2326868b - 6627040 = 0. -97, -7, -5, 488 Factor q*2/3 + 69458q - 14591080/3. (q - 70)(q + 208444)/3 Solve 12q*4 + 283641q*3 - 6883983q*2 + 32367924q - 7666164 = 0. -23661, 1/4, 6, 18 Factor 4j2 - 103784j - 4157760. 4(j - 25986)(j + 40) Solve 7v5/2 + 200v*4 - 62473v*3/2 + 739771v*2 - 1293558v + 584820 = 0. -135, 6/7, 1, 38 Suppose -2f5/9 - 70f*4/9 + 117908f*3/9 - 9751556f*2/9 - 39302f/3 + 1083514 = 0. What is f? -293, -1, 1, 129 Factor 122v2/7 + 17380v/21 + 58322/7. 2(v + 33)(183v + 2651)/21 Solve -4u*3 + 10844672u*2 + 21689360u = 0. -2, 0, 2711170 Factor -3t3 + 11343t*2 + 125214t - 295776. -3(t - 3792)(t - 2)(t + 13) Suppose 5l*5/2 - 250l*4 + 13665l*3/2 - 41375l*2 - 291460l = 0. Calculate l. -4, 0, 19, 26, 59 Determine u, given that 5u2 + 359435u + 17600310 = 0. -71838, -49 Find s such that -2s3/9 + 35168s*2/9 + 8s/9 - 140672/9 = 0. -2, 2, 17584 Factor d*3/4 - 13d*2/2 - 611d/4 + 510. (d - 40)(d - 3)(d + 17)/4 Determine m so that -m*2/2 - 16691m/2 - 1101107 = 0. -16558, -133 Determine u so that 4u4 + 1136u*3 + 43596u*2 - 717776u - 32602960 = 0. -235, -46, -29, 26 Let d*3/3 + 992d*2/3 + 100969d/3 + 33326 = 0. What is d? -877, -114, -1 Factor q*3 - 1488q*2 + 78869q - 77382. (q - 1433)(q - 54)(q - 1) Solve -2b3/9 - 534b*2 + 428642b/9 + 443042/3 = 0 for b. -2489, -3, 89 Determine r so that r*3/5 + 4054498r*2/5 + 32435911r/5 - 7298082 = 0. -4054490, -9, 1 Suppose -18z3/19 + 9629626z*2/19 - 2139916z/19 = 0. Calculate z. 0, 2/9, 534979 Suppose -4r2 + 82456r - 3620320 = 0. What is r? 44, 20570 Solve 2z3/9 + 5150z*2 + 15448z = 0 for z. -23172, -3, 0 Factor -s*2/3 + 7050s - 16257048. -(s - 18516)(s - 2634)/3 Find k, given that 5k*3 + 58205k*2 - 16383130k + 16324920 = 0. -11916, 1, 274 Determine r, given that r*2/4 - 9501r/2 + 13443830 = 0. 3460, 15542 Let -d*4 - 9106d*3 - 443691d*2 + 923814d = 0. Calculate d. -9057, -51, 0, 2 Determine i so that i*5/5 + 1808i*4/5 + 5396i*3/5 - 34382i*2/5 - 31425i - 32490 = 0. -1805, -3, -2, 5 Suppose -b*2/2 - 102785b/2 + 771000 = 0. Calculate b. -102800, 15 Suppose 6806d5/13 - 13614d*4/13 - 102086d*3/13 + 30d**2/13 = 0. What is d? -3, 0,	{ "pile_set_name": "DM Mathematics" }
the w'th term of -77, -84, -95, -110, -129, -152? -2w2 - w - 74 What is the i'th term of -16, -47, -78? -31i + 15 What is the s'th term of -39, -72, -105, -138, -171, -204? -33s - 6 What is the z'th term of 42, 33, 26, 27, 42, 77, 138? z3 - 5z2 - z + 47 What is the a'th term of -22, -26, -40, -70, -122, -202, -316? -a3 + a*2 - 22 What is the h'th term of 18, 39, 74, 123? 7h2 + 11 What is the w'th term of -10657, -10654, -10649, -10642, -10633, -10622? w2 - 10658 What is the x'th term of -699, -702, -705, -708? -3x - 696 What is the q'th term of -60, -68, -42, 24, 136, 300, 522? q3 + 11q*2 - 48q - 24 What is the m'th term of -171, -381, -591? -210m + 39 What is the y'th term of -28, -54, -82, -112, -144? -y2 - 23y - 4 What is the r'th term of -415, -837, -1265, -1699? -3r2 - 413r + 1 What is the j'th term of 228, 912, 2052, 3648? 228j2 What is the y'th term of 609, 607, 605, 603? -2y + 611 What is the r'th term of 97, 194, 291, 388? 97r What is the h'th term of -40, -36, -32, -28, -24? 4h - 44 What is the j'th term of -373, -371, -369, -367? 2j - 375 What is the l'th term of 40, 80, 120, 154, 176, 180, 160? -l3 + 6l*2 + 29l + 6 What is the k'th term of 1117, 1122, 1127, 1132, 1137? 5k + 1112 What is the w'th term of 178, 165, 118, 19, -150, -407, -770? -3w3 + w2 + 5w + 175 What is the i'th term of 135, 140, 149, 162, 179, 200? 2i*2 - i + 134 What is the l'th term of 1477, 1478, 1479? l + 1476 What is the m'th term of -45, -169, -375, -663, -1033? -41m*2 - m - 3 What is the y'th term of 689, 2759, 6209, 11039, 17249, 24839? 690y*2 - 1 What is the d'th term of -251, -504, -757, -1010, -1263? -253d + 2 What is the d'th term of 367, 737, 1107? 370d - 3 What is the h'th term of 13, 5, -7, -23, -43, -67? -2h*2 - 2h + 17 What is the u'th term of 2, 54, 200, 488, 966, 1682, 2684? 8u3 - u2 - u - 4 What is the r'th term of 148, 159, 170? 11r + 137 What is the c'th term of 789, 804, 835, 888, 969, 1084, 1239? c*3 + 2c*2 + 2c + 784 What is the z'th term of 2391, 2390, 2389, 2388, 2387, 2386? -z + 2392 What is the b'th term of 209, 166, 41, -208, -623, -1246? -7b3 + b2 + 3b + 212 What is the m'th term of 22, 8, -24, -80, -166, -288? -m*3 - 3m*2 + 2m + 24 What is the z'th term of 83, 333, 751, 1337, 2091? 84z2 - 2z + 1 What is the d'th term of 37, -51, -191, -377, -603, -863? d*3 - 32d2 + d + 67 What is the p'th term of -9, -15, -23, -33, -45, -59, -75? -p2 - 3p - 5 What is the l'th term of 264, 302, 340, 378, 416, 454? 38l + 226 What is the s'th term of -44, -105, -164, -221, -276, -329, -380? s*2 - 64s + 19 What is the l'th term of 15, -9, -33, -57? -24l + 39 What is the k'th term of 145, 302, 461, 622, 785, 950? k2 + 154k - 10 What is the d'th term of -478, -481, -496, -529, -586, -673? -d*3 + 4d - 481 What is the u'th term of -491, -982, -1473, -1964? -491u What is the r'th term of 1249, 1248, 1247, 1246, 1245? -r + 1250 What is the d'th term of 45, 62, 89, 126, 173, 230? 5d*2 + 2d + 38 What is the y'th term of -9, -38, -87, -156, -245? -10y2 + y What is the x'th term of 6375, 6379, 6385, 6393, 6403? x2 + x + 6373 What is the h'th term of 614, 612, 610, 608, 606? -2h + 616 What is the y'th term of -8, -31, -42, -35, -4? y*3 - 30y + 21 What is the c'th term of 1573, 1569, 1563, 1555, 1545, 1533? -c*2 - c + 1575 What is the m'th term of -326, -327, -328, -329? -m - 325 What is the g'th term of -482, -512, -542, -572? -30g - 452 What is the a'th term of -27, -28, -25, -12, 17, 68, 147? a*3 - 4a*2 + 4a - 28 What is the x'th term of 6, -3, -8, -9, -6? 2x2 - 15x + 19 What is the s'th term of 80, 151, 232, 329, 448, 595, 776, 997? s3 - s2 + 67s + 13 What is the y'th term of 4774, 9550, 14326, 19102, 23878? 4776y - 2 What is the r'th term of -4778, -4777, -4776, -4775, -4774, -4773? r - 4779 What is the i'th term of 11507, 23018, 34529, 46040, 57551? 11511i - 4 What is the w'th term of 2, -8, -32, -76, -146, -248, -388? -w3 - w2 + 4 What is the r'th term of -269, -546, -823? -277r + 8 What is the u'th term of -66, -78, -98, -126, -162, -206? -4u2 - 62 What is the m'th term of -13, -32, -63, -106, -161? -6m*2 - m - 6 What is the h'th term of -41, -47, -57, -71? -2h2 - 39 What is the m'th term of -470, -443, -408, -371, -338, -315, -308, -323? -m3 + 10m2 + 4m - 483 What is the q'th term of 1229, 1228, 1227, 1226? -q + 1230 What is the d'th term of -24336, -24335, -24334, -24333, -24332, -24331? d - 24337 What is the x'th term of 2237, 2238, 2237, 2234? -x*2 + 4x + 2234 What is the x'th term of 59, 152, 307, 524, 803, 1144, 1547? 31x2 + 28 What is the i'th term of 184, 202, 218, 232? -i2 + 21i + 164 What is the g'th term of 16, 39, 78, 139, 228, 351? g*3 + 2g*2 + 10g + 3 What is the v'th term of 1241, 1240, 1239? -v + 1242 What is the f'th term of 7, 32, 83, 172, 311? 2f3 + f2 + 8f - 4 What is the v'th term of -80, -340, -768, -1358, -2104, -3000? v*3 - 90v*2 + 3v + 6 What is the a'th term of 33, 242, 813, 1926, 3761, 6498, 10317, 15398? 30a3 + a2 - 4a + 6 What is the v'th term of -2389, -4776, -7163? -2387v - 2 What is the x'th term of -18, -40, -74, -120, -178? -6x*2 - 4x - 8 What is the t'th term of 6, 8, 12, 18, 26, 36? t*2 - t + 6 What is the n'th term of -5, 10, 79, 238, 523, 970, 1615, 2494? 6n*3 - 9n*2 - 2 What is the j'th term of -8, -15, -22, -29, -36? -7j - 1 What is the y'th term of -22, -71, -120, -169, -218? -49y + 27 What is the r'th term of 49, 41, 27, 7? -3r*2 + r + 51 What is the n'th term of -48693, -48691, -48689, -48687? 2n - 48695 What is the u'th term of 48, 48, 44, 36, 24? -2u2 + 6u + 44 What is the n'th term of -542, -553, -586, -653, -766? -2n3 + n2 - 541 What is the k'th term of 87, 79, 61, 27, -29, -113, -231? -k3 + k2 - 4k + 91 What is the z'th term of -58, -65, -72, -79, -86, -93? -7z - 51 What is the g'th term of -161, -324, -487, -650, -813? -163g + 2 What is the f'th term of -9, 57, 241, 603, 1203? 10f3 - f2 - f - 17 What is the s'th term of -31, -196, -647, -1528, -2983, -5156? -24s3 + s2 - 8 What is the g'th term of -18944, -18947, -18950, -18953? -3g - 18941 What is the z'th term of -45, -38, -31, -24, -17? 7z - 52 What is the h'th term of -104, -108, -112, -116? -4h - 100 What is the m'th term of 688, 733, 792, 871, 976, 1113, 1288, 1507? m3 + m2 + 35m + 651 What is the b'th term of 7485, 7487, 7489? 2b + 7483 What is the x'th term of 5, 22, 51, 92? 6x*2 - x What is the m'th term of 103, 119, 135, 151? 16m + 87 What is the g'th term of -834, -1664, -2492, -3318, -4142? g*2 - 833g - 2 What is the k'th term of 1361, 2723, 4083, 5441? -k*2 + 1365k - 3 What is the a'th term of -153, -142, -119, -78, -13, 82? a*3 + 4a - 158 What is the o'th term of 52, 103, 152, 199, 244, 287, 328? -o*2 + 54o - 1 What is the c'th term of 73, 140, 195, 232, 245, 228, 175, 80? -c*3 + 74c What is the o'th term of -4, 9, 46, 119, 240, 421, 674, 1011? 2o3 - o - 5 What is the o'th term of 504, 1010, 1516? 506o - 2 What is the o'th term of -16, -57, -118, -193, -276? o*3 - 16o*2 - 1 What is the d'th term of -12, -34, -56, -78, -100, -122? -22d + 10 What is the t'th term of -247, -281, -375, -559, -863, -1317, -1951, -2795? -5t3 + t - 243 What is the y'th term of -22, -36, -64, -112, -186, -292, -436, -624? -y3 - y2 - 4y - 16 What is the f'th term of -29, -21, -9, 7, 27, 51, 79? 2f2 + 2f - 33 What is the g'th term of 5669, 5676, 5687, 5702, 5721, 5744, 5771? 2g2 + g + 5666 What is the c'th term of 8, 3, -20, -73, -168, -317, -532? -2c*3 + 3c2 + 7 What is the x'th term of 5481, 10959, 16435, 21909? -x2 + 5481x + 1 What is the h'th term of -8, -28, -62, -116, -196, -308, -458, -652? -h3 - h2 - 10h + 4 What is the r'th term of 11, 41, 91, 161, 251, 361? 10r2 + 1 What is the n'th term of -19, -319, -1171, -2851, -5635, -9799, -15619? -46n*3 + 22n + 5 What is the f'th term of -82, -149, -216, -283, -350? -67f - 15 What is the c'th term of 259, 279, 299, 319, 339, 359? 20c + 239 What is the h'th term of -15, -30, -41, -48? 2h2 - 21h + 4 What is the b'th term of 1, 18, 43, 76,	{ "pile_set_name": "DM Mathematics" }
12 = -4r for p. 0 Solve -3p - 2z + 3z + 46 = 0, -41 = -3p + 2z for p. 17 Solve 29y - 33 = 3t + 45y, -10 = t + 5y for t. 5 Solve -6s + 56 = 5b + 32, -16 = -3b - 4s for b. 0 Solve -2g = 4w - 38, -39 = -3g - 1106w + 1102w for g. 1 Solve 2o = -4s + 12, -60o - 15 = -55o + s for o. -4 Solve 0 = -4g + 2y + 28, g + 0y - 2y = 19 for g. 3 Solve -20 = 4o - 2l, 3o + 15 = -67l + 68l for o. -5 Solve 0 = -k - 3a - 12, 2k + 628 = a + 632 for k. 0 Solve -3q + 26 = 5b, 2b - 598q = -602q + 44 for b. -2 Solve -909y - 11 = -2a - 914y, -2y = -6 for a. -2 Solve 3s + 94 - 85 = z, -5z - 7 = -2s for z. -3 Solve 0 = 4y + 4j - 4, -2j + 36 - 13 = -5y for y. -3 Solve 2t = -5z - 35, -99t + 105t + 4z + 94 = 0 for t. -15 Solve 5a = -4p - 4, -37p = 8a - 10a + 37 for a. 0 Solve 2a = 4c + 5538 - 5564, 3a = -c - 4 for c. 5 Solve 3n - 4t + 2 = -14, -2n - 13 = -t - 4t for n. -4 Solve 0 = -3g, -3g = 20909y - 20904y + 20 for y. -4 Solve -2c - 4s + 722 = 698, -2s = 2c - 18 for c. 6 Solve 13 = -4i + y, 40y - 20 = 36y for i. -2 Solve -5g = 5w - 10, -3w = -1640g + 1630g + 7 for g. 1 Solve b + 171 = -5a + 201, -4a - b + 25 = 0 for a. 5 Solve 0 = 23q, -5z + 28q = -28q + 55q + 130 for z. -26 Solve -3t - 3r + 9 = 0, 58t + 3r + 7 = 51t for t. -4 Solve 2w = -16 + 8, -20 = 4i + 2w for i. -3 Solve -7f = 100l - 98l - 10, -2f + 5l = -14 for f. 2 Solve -7 = 4a + w, -41a = -38a - 4w + 48 for a. -4 Solve -6t + 4w - 7 = -1, -2t = 3w - 11 for t. 1 Solve -55r = 3f - 54r + 15, -23r = 2f + 77 for f. -4 Solve 9 = -6a + f, 5a - 3f = 1536 - 1576 for a. 1 Solve 4f = w, -3f - 13 = -10w + 6w for f. 1 Solve 3f = -82o + 83o - 26, -3f - 31 = 4o for o. -1 Solve -3m = 4f + 28, -161 = -2m - 3f - 179 for m. -12 Solve -b - 5c - 7 = 0, 27156b - 27148b + 4c = -56 for b. -7 Solve -32969k + 16 = -32973k, 4k + 64 = -3i for i. -16 Solve f - 4 = j, -6j + 22 = -4f + 40 for j. -1 Solve 58 = -2x + 563p - 558p, 126 = -6x + 3p for x. -19 Solve -2p - 24 = -29l, 239l = 238l + 5p + 60 for l. 0 Solve 6q + 18 = 0, 4116x + 5q + 40 = 4111x for x. -5 Solve 0 = -2k - 5x + 52, -6k + 36 = -4k + x for k. 16 Solve i - 45 = 5q, -5i = -3q + 75 - 212 for i. 25 Solve 2u - 5b + 356 = 337, -3u - 3b = -3 for u. -2 Solve 212t - 210t + 11v = -28, 5t = -5v + 20 for t. 8 Solve 6500t = -4n + 6499t - 77, n - t + 18 = 0 for n. -19 Solve 2d = 5x - 13, -3x - 18d = -15d + 9 for x. 1 Solve -2v - 4w = 4, -4w - 242 = -3v - 258 for v. -4 Solve h + 15t - 18t = -6, 4h - 4t = 0 for h. 3 Solve 50 = 2d + 10b, 0 = 1988d - 1989d + 4b - 20 for d. 0 Solve 3j = -3h - 39, -5h + 178j + 7 = 174j for h. -5 Solve o - 2 = 0, -5s + 193 = -3o + 209 for s. -2 Solve 0 = -10i + 3s - 33, 0 = 5i + 5s - 0s + 10 for i. -3 Solve 4b = 19l - 24l - 41, 2l = -2b - 18 for l. -5 Solve -5b + 6 = 4y + 2b, 5y - b + 12 = 0 for y. -2 Solve 4j - 5n + 5 = 0, -j = -44n + 46n - 15 for j. 5 Solve 4 = u - d, -76d + 74d - 4 = 2u for u. 1 Solve -13v = 4m - 7, -4m - v + 26 - 7 = 0 for m. 5 Solve 2q + 2 = 263w - 261w, -3q + 21 = 5w for q. 2 Solve 4p + 8 = 4b - 0b, -3b - 3p + 24 = 0 for b. 5 Solve -f - 21 = -5v, -2f - 9 = -931v + 932v for f. -6 Solve 0 = 2a + 5u + 4, -167u = -3a - 162u + 19 for a. 3 Solve 2s + 4 = -2x, -42s + 38s - 20 = 0 for x. 3 Solve -5r + 266p = 270p + 50, 0 = 25r + p + 155 for r. -6 Solve 5j + 5u + 29 - 9 = 0, 5j + 2u - 170 = -193 for j. -5 Solve 0 = 4j - 8, r + 10j - 3j + 12 = 4j for r. -18 Solve -5w + 12 = h, 7h - 10h + 68w + 4 = 67w for h. 2 Solve 63 = 4n - 5a, n - a - 3 = 5n for n. 2 Solve -118 = 2n - 22h - 224, 4n - 2h - 2 = 0 for n. -2 Solve 2w - 5v - 23 = 0, 5 = 5w + 1105v - 1107v for w. -1 Solve -754w = -731w + 3x - 67, 0 = -2x + 14 for w. 2 Solve g - 47 = 3v - 52, 5g = 2v + 1 for g. 1 Solve 18087f = 5i + 18090f - 15, 4i = f + 12 for i. 3 Solve -2s - 24r = -s - 25r, -3r = 5s - 4r + 12 for s. -3 Solve 1 = r + 2r - 2o, 69r = 74r - 19o - 33 for r. -1 Solve -39 = 32n + 5a, -9a + 5 = 5n - 6a for n. -2 Solve 7l = -1210q + 1205q - 15, q + 4l = -16 for q. 4 Solve 4v + 620o = 618o + 12, -3v = o - 7 for v. 1 Solve 3z - 99 = 851l - 824l, -3z - 2l - 25 = 2l for z. -3 Solve -5t = -3s - 23, 2s + 452t - 454t = -10 for s. -1 Solve -5n - 5p + 20 = 0, -2n = 5p - 14 + 12 for n. 6 Solve -2m = -2b - 26, 4m = -93b + 96b + 50 for m. 11 Solve -3m - 18 = k, 3m - k + 0 + 18 = 0 for m. -6 Solve 5x - 463g + 461g - 8 = 0, 6g + 24 = -2x for x. 0 Solve 4q = -5n - 15, -36n + 38n + 3q = 1 for n. -7 Solve -4h = 2i + 22, -332i + 2h - 14 = -328i for i. -5 Solve y - 261j - 25 = -257j, 35 = 5y - 2j for y. 5 Solve 4m + 12 = -4w, 12m - 11m - 21 = 7w for m. 0 Solve -3q + 16 + 1 = g, 0 = -7q + 28 for g. 5 Solve -4o - 5u + 43 = 0, -o - 3u - 302 = -318 for o. 7 Solve 3a + 27 = 5t, 7t - 10t + 57 = -12a for a. -4 Solve 5a + 28 = 4t + 58, 0 = a + 5t + 23 for a. 2 Solve 18 = y + 5j, -3948j + 3951j = -5y + 24 for y. 3 Solve -4m + 9 = -3u, -5524u + 13 = 3m - 5520u for m. 3 Solve 5a - 63 + 43 = 0, -4r - 36 = 3a for r. -12 Solve 19 = o + 13u - 9u, -19 = -5o - u for o. 3 Solve -5a + 2a - 254 = 4h - 245, 3a - 9 = 2h for h. -3 Solve -4m - 12 = 4o, 313o - 317o = m + 9 for m. -1 Solve 2u = 8h + 40, -4u - 290 = -2h - 300 for h. -5 Solve 20 = 2d + 4t, -100t + 15 = 6d - 97t for d. 0 Solve -4j - 12 = g, -4g = 3j + 427 - 405 for j. -2 Solve -4k - 5w + 32 = 0, 1449k + 2w = 1452k - 24 for k. 8 Solve 3l = s + 1, 4s - 37l = -41l - 4 for s. -1 Solve -2v + 19 = -3p, -90v + 95v = p + 15 for v. 2 Solve -4x - 37k = -5x + 116, -x - 3k = 4 for x. 5 Solve 25 = 2t + 3h, -311h + 64 = 6t - 313h for t. 11 Solve -8h = -9q + 4q + 12, 5q - h + 16 = 0 for q. -4 Solve -2i + 18 = 3w, 3i + 17w = 19w - 12 for i. 0 Solve 2n = 2u - 10, 0 = -2u + n - 2n + 10 for u. 5 Solve -17 = 2k - 3o, -1503k + 21 = -1499k + 5o for k. -1 Solve 9h = 9, -316h - 14 = -3x - 318h for x. 4 Solve 139q + 23 = -2u + 134q, -12q = -3u + 24 for u. -4 Solve -4s + 41 = 3i, -5i - 235 = 6s - 300 for s. 5 Solve 0 = 5s - 24p - 46 + 51, -2s - 2 = 4p for s. -1 Solve -j - 3g - 2 = 0, 0 = 5j + 12g - 4g + 10 for j. -2 Solve 0 = -5t - 2d - 8, -t + 4d + 42 - 26 = 0 for t. 0 Solve -5v - 5 = 62z - 63z, 0 = 2v - 5z + 25 for v. 0 Solve 11s = 9s + 5j + 24, 18s - 28 = -2j for s. 2 Solve -2s = -5m + 20, 2m + 17 = -s + 8m for s. -5 Solve -226b + 2y = -228b - 36, 4b = 3y - 58 for b. -16 Solve 0 = -2q - 5i + 2, -6812i = 11q - 6813i - 11 for q. 1 Solve 5o = -3k + 29, 138o = -5k + 134o + 57 for k. 13 Solve -a = -2h - 7, 0 = 12h - 4h + 5a + 37 for h. -4 Solve 26 = -6p + 4t, -p = 4t - 18 - 1 for p. -1 Solve p - 587 = 6k - 564, -4k - 19 = 3p for p. -1 Solve 3l - 477 = -4h - 536, -5h - 73 = 3l for l. -1 Solve 2r - 5j + 8 = -9, 0 = r + 2j - 14 for r. 4 Solve 3p + 4l = -35, 0 = 3p - 357l + 356l + 10 for p. -5 Solve 8a + 26 = 2i, -104 = 2i + a - 103 for i. 1 Solve k - 14w = -171, -k + 3w + 482 = 521 for k. -3 Solve -5w = 3x - 12, 3w - 179x - 8 = -180x for w. 3 Solve -5b + 0b + 35 = -5l, -b - 4l = -7 for b. 7 Solve 5v = 4j - 77, 19 - 17 = 5j + v for j. 3 Solve -2u = -4a + 30, 0 = -122a + 124a + 3u + 5 for a. 5 Solve 0 = 4o + 4u + 28, -382u = -3o - 386u - 27 for o. -1 Solve 3m = -27x + 30x - 5 - 4, -6x = 6 for m. -4 Solve 336v - 334v - 2 = -3h, -5h - 4v + 6 = 0 for h. -2 Solve g - 141 = 5o, 5g - 61 = -146839o + 146841o for g. 1 Solve x + 37 - 46 = 0, -42 = -2p - 4x for p. 3 Solve 3u = -2r + 4, 8r + 44 = -634u + 637u for u. 4 Solve -3h + 34170 - 34167 = -z, -34 = 5z + 4h for z. -6 Solve u + 5s + 15 = 0, -19224s - 9 = -5u - 19221s for u. 0 Solve -j + 8 = 5q + 28, q = -5j - 28 for q. -3 Solve -o + 2m = 16, o - 40 = 3469m - 3474m for o. 0 Solve 4w + 35 = -320k + 323k, -20 = w - 2k for w. -2 Solve -274w - 2f = -279w + 8, -4w + 5f = -3 for w. 2 Solve -5c + 4l = -18 - 3, -8c + 218l + 42 = 220l for c. 5 Solve 3x - 1 = c, -3c + 8*c - x = 9 for c. 2	{ "pile_set_name": "DM Mathematics" }
/1872). 7/2 What is the value of (18/(-40))/((2961/(-13160))/((-3)/5))? -6/5 Calculate (-140)/(-360)48 - 19. -1/3 Evaluate (-1)/(38/(-209) + 146/(-44)). 2/7 What is (-422)/38 - (-19 - (-6462)/342)? -11 Evaluate 1/61 - (-450648)/16104. 28 Evaluate -11(18 + (-23 - -7)). -22 What is (-57 - -1)87/((-28536)/205)? 35 Calculate 2/(-8) - ((-28)/(-70))/(112/(-110)). 1/7 What is the value of (1/(-6))/((16125/(-90))/43)? 1/25 Evaluate (-11)/1 + 35084/2864. 5/4 Evaluate (-19686)/579 - (-57)/3. -15 What is the value of (-1688)/6333/(-22)? 4/11 Evaluate (-660)/28 + 50/14 + (-188)/47. -24 12/((-12)/4 + 4) 12 Evaluate (2 - (-36)/(-15))(-425)/34. 5 What is the value of ((-20)/8 - (-64)/28)-6? 9/7 What is 4 - 96/9 - (-8)/(-6)? -8 (96/(-240))/(8/160) -8 Evaluate (-25)/4((-80)/(-50))/(-1). 10 What is (-54 - -39)/(-7 - 4 - -8)? 5 What is the value of (11/3308)/((-2)/5)? -2/3 (-1)/(20/4 - -1 - (4 + 1)) -1 Calculate 2/63252/(-29810). -2/55 What is ((-312)/72)/(((-12)/(-9))/4)? -13 Evaluate ((-535)/(-105) + -7)(133/14 + -8). -20/7 What is -4 + 2150/(-645)(19/(-5) - 1)? 12 ((18/(-21))/2)/(108/72) -2/7 Calculate (-2 - (2 - -1))(-89)/(-267). -5/3 Calculate -11 - (4 - -29 - 19). -25 Evaluate 1 + ((-1)/10)/((-141)/36 + 4). -1/5 What is 3045/(-725)10/(-36)? 7/6 Calculate (-16 - 1) + 1300/76. 2/19 -5 + (-3 - (4 - (-5)/(-5))) - -5 -6 What is 455/(-117) + 0 + 12 - (2 - -5)? 10/9 -2(-33)/44(-88)/(-12) 11 What is (-20)/((-5280)/(-808)) + (4 + -1 - 0)? -2/33 What is the value of (-1560)/(-111) + (-32)/1243221? 14 Calculate (-26)/340 + (-903)/(-5117). 1/10 Calculate 380/20 - 6 - 262/20. -1/10 What is (-4)/104386 + (460/(-299))/10? -15 30/25 - (316/130 - -1) - -2 -3/13 Calculate (-216)/(-680) + (-28)/238. 1/5 Calculate 236/24 + -10 - 184/(-528). 2/11 What is 32/(-208) + 23/(-13)-8? 14 (-192)/(-56) - ((-28)/(-20))/(4/10) -1/14 (-32)/(-3 + 7) - 20/4 -13 ((-4380)/584)/(5/(-3)) 9/2 Evaluate (-298)/(-15) + 1554/11655. 20 Evaluate 20/(-45)(-129 - -126). 4/3 What is ((-48)/2825/(-200))/((-9)/4)? -2/21 What is the value of ((-90)/(-36))/(2 + (-17)/6)? -3 ((-1192)/(-4172))/(30/(-14) - -2) -2 What is the value of (6 + (-4 - 5))-29/(-198)? -3/11 What is the value of (35/(-133))/((-45)/(-18))? -2/19 What is (1 + -6)/110((-18 - -7) + 13)? -1/11 ((-51)/24 + 1)/((-93)/(-62)) -3/4 Calculate (2/4)/(1121/76). 2/59 (-10 + -29)16/48 -13 Calculate (6/340 - 104/884)/(4/(-8)). 1/5 (-2448)/408 - (-32)/6 -2/3 Calculate (2/15)/(-9 - 3893/(-425)). 5/6 (-6)/5(-1795)/9693 2/9 (-7 - -1)(-7)/63(-6 - -21) 10 Evaluate 2286/135 + (-24)/(-60) - (-2)/3. 18 What is -39 + 37 + (-21)/(-9)? 1/3 (-16)/(-488) + 6396/(-1586) -4 What is the value of (-3)/5(123/(-820))/(9/(-8))? -2/25 Evaluate (13804/924 - (-6)/99) + -4 - -5. 16 ((-440)/112 + (56 - 52))6/1 3/7 (-19)/(-3135)22 - 8/10 -2/3 Evaluate (57623/1131 - 51) + 40/1794. -2/69 What is (-2 - (-28)/6)(-51)/(-68) + 0? 2 Calculate (38 + 1)/((-22)/(-14)) + (-7120)/(-39160). 25 What is the value of (((-164)/205)/(-2 + 3))/10? -2/25 What is -45((-2483)/117 - -21)? 10 What is (-28)/(-8)(-12 + (7 - (1 - 4)))? -7 (-5 + 2)(-380)/(-114) -10 What is 8 - 4347/490? 9/5 Evaluate 974/(-26785) + (-288)/1155. -2/7 What is 252/9244/(-4)? -3/11 Calculate (-20 - -9 - (-75)/7) + 100/7. 14 Evaluate (-87)/(-9) + -2(-4)/6. 11 What is 15/(-75) - (-2)/(140/74)? 6/7 What is ((-4)/(-22))/(-1 - 0) - 4800/12320? -4/7 2/7 + (-366)/305(-25)/(-7) -4 What is 12 - (130/(-16) + 25(-4)/(-800))? 20 Calculate -5 + 306/60 - 188/680. -3/17 What is the value of (-1680)/(-216) + -18 - -10? -2/9 1(890/32 - 28) -3/16 Calculate ((-405)/54)/(3 - (-3 + (-33)/(-6))). -15 206/112 - ((-1)/(-5))/((-136)/(-85)) 12/7 What is ((-209)/66 - (-1)/6)16/(-72)? 2/3 4/(18 - 17) + -25 -21 What is the value of (-15)/(-30)(-15)/((-270)/156)? 13/3 Evaluate -10 - 1309/(-132) - 194/(-24). 8 What is 6(-5 + 19 - 12)? 12 Calculate (8 - (8 - 4))12/88. 6/11 What is the value of (-8)/6 + (7800/(-45))/(-13)? 12 What is the value of 1 - 29 - (-396520)/15085? -12/7 Calculate 4/58 + (-19688)/(-4669) + -4. 2/7 Calculate (4/(-4) + 6)/(5/6). 6 What is (-9)/27(8 - 8 - (-25 - -4))? -7 What is (-2)/42222 - (-5 + -5)? -4/7 (79/(-790) - 588/(-30))8/6 26 Calculate ((-272)/(-48))/((-493)/(-58)). 2/3 (7/12)/((-69)/(-828)) + -2 + 0 5 Calculate ((-10089)/(-1615) - 7) + 6/15. -6/17 What is the value of (108 + -111)(-2 + 895/450)? 1/30 Evaluate 6/4(-680)/255. -4 (31/(-124))/(2/6) -3/4 What is the value of 120/(-24) - 7 - 5? -17 Evaluate 30(-33)/39628/(-20). 7/2 Calculate ((-18)/(-4) + -3)(-9310)/1995. -7 131/(-6) + 2 - (-12 - (-1095)/90) -20 3/159(-144 - -142) -2/53 (29 - (-53971)/(-1860))5 -1/12 What is the value of 2/(((-30)/(-41))/(-5)) - 12/9? -15 What is the value of (-642)/68 + 83/(-57851)41? -19/2 Evaluate 419/76 + 36/4. 10 Evaluate (512/50)/((-27)/270). -12 (2/(-12))/(-7 + 6017/858) -13 What is (29 - (-144)/(-9))-1? -13 Calculate -182 + 194 + (-1 - (-9 + 0)). 20 Calculate (6 - 63/10) + ((-78)/(-12))/13. 1/5 Evaluate ((-35)/7)/(150/390). -13 Evaluate (-16)/7 + (-15982)/(-4585). 6/5 Calculate 3/36((-640)/30 + -4) + 2. -1/9 (70/(-42))/(3 - 124/8) 2/15 Evaluate 490/(-175) + (-6)/5. -4 Calculate ((-20)/6)/(3520/1056). -1 What is -24 + (-16 + -94)/(-10)? -13 What is the value of (-3)/(-5) + (88/5)/(-11)? -1 (33 + -34)(-1 + 10 - -3) -12 (5570/9625)/(2/(-135)) -27 What is the value of (241 + -244)/(-2(-2)/(-4) - -2)? -3 What is the value of (980/225)/7 + (-6)/15? 2/9 What is 16 - (-43)/(645/195)? 29 ((-2)/(-6)(-27)/(-15))/((-3)/30) -6 What is the value of (-113)/((-1921)/510) + 5/((-15)/12)? 26 What is (6/44)/(740/560)? 12 What is the value of (2 + (-26)/14)/(-1 + -1 + 3)? 1/7 -5 + 2 - (-561)/(-418)(2 - 4) -6/19 Calculate -10 + ((-3704)/(-6482) - 3/7-1). -9 What is the value of (396/(-1331))/((-10)/55)? 18/11 Evaluate 19944/792 + 6/(-33). 25 What is the value of 9/5(-8)/24 - 18/(-30)? 0 What is the value of (-612)/918(530/32 - 1) - -11? 5/8 Calculate ((-72)/792)/((3/(-2))/(-7 - -10)). 2/11 What is the value of (1791/398)/(((-6)/(-4))/3)? 9 Evaluate (-2)/(-33)3 - (148/88 - 3). 3/2 What is the value of 35 + -26 - (-249)/(-27)? -2/9 What is (-3275)/7074 + ((-3)/2)/1 + 2? 1/27 What is (-2)/396/30(-170)/68? 1/39 78/429 + (340/165)/(-4) -1/3 What is the value of (6/14)/(14/77 - 11/726)? 18/7 Evaluate (-20640)/1056 + (-95)/(-5). -6/11 What is (4/(-8))/(16 + 9940/(-616))? 11/3 What is (((-1)/30)/(86/774))/((-54)/15)? 1/12 What is 1/(-13) + ((-70224)/364)/(-38)? 5 Evaluate (15 + (-62)/4)-2. 1 What is 28 + -25 - (710/45 + 4/18)? -13 Evaluate 4(-110)/40 + (6 - -5). 0 Calculate -6 + (-280)/(-14)(-4)/(-16) - -26. 25 Evaluate (-19 + 10 + 11)22/4. 11 What is the value of 1/(-2) - (1674/(-36) - -41)? 5 What is ((-7)/(-385))/(21/210)? 2/11 What is 164/30336/(-1176) + (-6)/(-45)? -10/7 What is (174/(-145))/(4/40)? -12 What is the value of (1 - 2) + (16/1 - 21)? -6 3 - ((-448)/98 + 5)(-322)/(-36) -5/6 What is the value of (-814)/440 + (-612)/(-45) + -12? -1/4 (-5)/((-155)/(-2))(-1125)/(-750) -3/31 ((-3)/15)/((-273)/(-35) + -7) -1/4 Calculate (-3)/(-9)(-3808)/(-96) + (-2)/9. 13 (-2114)/(-906) + 26/(-6) -2 What is (-126)/(-21) + -27 - -14? -7 Calculate ((-63)/((-12348)/112))/(2/21) - -5. 11 What is (-2350)/282 - (10/6 + 0 + -2)? -8 What is (-6)/(-106)1312/(-1968)? -2/53 (-5 + (-36)/(-10) + 1)/(1/(-2)) 4/5 Evaluate (-2)/(-2 + (20 - -32)). -1/25 (-180)/(-28) + 1 - (-52)/91 8 What is 36/14(-58)/116? -9/7 (-90)/(-21)420/180 10 ((-26)/39)/(146/(-9)) 1/14 Evaluate (1/(-104))/((-642)/(-5136)). -1/13 (1/(-12))/((210/40)/7) -1/9 Evaluate 378/(-4725)(-10)/32. 1/40 Evaluate (192/56)/((-4)/(-14)). 12 Calculate 8/104 - (3520/130 + 2). -29 Calculate (1 + (-10)/6)/((-1032)/(-3096)). -2 What is 7739/(-1526) + (3 - -2)? -1/14 What is the value of (-180)/(-68) - 2748/(-7786)? 3 What is the value of (3/((-75)/10))/(31 + (-4118)/145)? -2/13 Calculate 0 - 9 - ((-60)/(-80))/((-9)/60). -4 (-20)/8236/605 -15 What is (-26)/(-143) - 1/66 - 105/990? 2/33 Calculate (-16 - -2)(-28)/(-245)-5. 8 What is (1792/(-7616))/(3/(-17))? 4/3 What is the value of 49/(-28) - (-33 + 26)? 21/4 Evaluate ((8 + 97)/4725)/(-2*1/(-6)). 1/15 -11 + 7182/735 + (-4)/20 -10/7 What is the value of 28/1900 - ((-430)/(-344))/((-190)/16)? 3/25 What	{ "pile_set_name": "DM Mathematics" }
rue Is 3220 a multiple of 14? True Does 13 divide 312? True Is 84 a multiple of 12? True Is 18 a factor of 2121? False Is 9 a factor of 585? True Does 57 divide 171? True Is 3 a factor of 147? True Does 197 divide 22458? True Is 27 a factor of 26236? False Is 40 a factor of 2360? True Is 10447 a multiple of 4? False Does 24 divide 16485? False Is 1692 a multiple of 18? True Is 77 a factor of 462? True Does 19 divide 30134? True Does 12 divide 3336? True Is 8 a factor of 123? False Is 11 a factor of 5005? True Does 25 divide 116? False Is 2 a factor of 519? False Is 7680 a multiple of 12? True Is 60 a factor of 2280? True Is 20 a factor of 13220? True Does 43 divide 1978? True Is 26 a factor of 1354? False Is 17 a factor of 1615? True Is 94231 a multiple of 16? False Is 24 a factor of 648? True Does 42 divide 93748? False Is 566 a multiple of 41? False Does 5 divide 731? False Is 39 a factor of 4095? True Is 5726 a multiple of 14? True Does 64 divide 7744? True Is 3710 a multiple of 14? True Is 4 a factor of 1652? True Does 16 divide 353? False Does 35 divide 1827? False Does 23 divide 11937? True Is 16 a factor of 212? False Is 66 a factor of 3828? True Is 12 a factor of 12221? False Is 10 a factor of 9402? False Is 139 a factor of 22331? False Is 65 a factor of 1386? False Is 521 a multiple of 25? False Does 119 divide 37247? True Is 120 a multiple of 4? True Does 10 divide 82? False Is 16960 a multiple of 76? False Is 28 a factor of 8106? False Is 49 a multiple of 22? False Is 526 a multiple of 27? False Is 5 a factor of 2660? True Is 4 a factor of 620? True Does 79 divide 33733? True Is 37674 a multiple of 117? True Does 28 divide 469? False Is 25 a factor of 595? False Is 83056 a multiple of 29? True Does 32 divide 3872? True Does 3 divide 9443? False Is 94320 a multiple of 240? True Is 36 a factor of 1501? False Does 20 divide 1080? True Is 48384 a multiple of 14? True Is 51 a factor of 2489? False Is 16041 a multiple of 147? False Is 17 a factor of 5395? False Is 24 a factor of 72343? False Is 3 a factor of 260? False Is 11620 a multiple of 12? False Is 17508 a multiple of 5? False Is 130 a multiple of 13? True Is 53 a multiple of 3? False Is 52 a factor of 34268? True Is 13 a multiple of 2? False Does 43 divide 237? False Does 4 divide 48? True Is 95 a factor of 32680? True Does 25 divide 723? False Is 29 a factor of 11874? False Does 55 divide 493? False Is 8694 a multiple of 17? False Is 247 a factor of 36062? True Is 381 even? False Is 25 a factor of 800? True Is 25 a factor of 369? False Does 154 divide 21689? False Does 4 divide 132? True Is 78 a factor of 5694? True Does 16 divide 64272? True Is 3410 a multiple of 55? True Is 1484 a multiple of 15? False Does 46 divide 628? False Does 7 divide 1162? True Does 12 divide 3144? True Is 3996 a multiple of 37? True Is 14 a factor of 114884? True Is 63 a factor of 18883? False Is 205 even? False Does 82 divide 611? False Does 33 divide 330? True Is 277 a factor of 18559? True Is 54 a factor of 40446? True Is 3 a factor of 841? False Is 37 a factor of 11470? True Is 10 a factor of 2695? False Is 71856 a multiple of 48? True Is 6 a factor of 34182? True Does 10 divide 5650? True Is 83 a factor of 4316? True Does 18 divide 1607? False Is 1985 a multiple of 9? False Is 7 a factor of 197? False Does 43 divide 2451? True Is 16 a factor of 2448? True Is 21 a factor of 106090? False Is 53 a factor of 1219? True Is 21 a factor of 273? True Is 1185 a multiple of 8? False Is 897 a multiple of 39? True Is 11 a factor of 572? True Does 5 divide 67? False Does 10 divide 6576? False Is 551 a multiple of 19? True Is 28 a factor of 1363? False Is 57989 a multiple of 149? False Does 28 divide 11778? False Is 196 a multiple of 7? True Does 110 divide 35640? True Is 15 a factor of 11239? False Is 4 a factor of 164? True Does 2 divide 1046? True Does 18 divide 435? False Is 3924 a multiple of 109? True Is 91 a factor of 248? False Does 135 divide 44658? False Is 37 a factor of 15879? False Is 16 a factor of 2384? True Does 6 divide 4675? False Is 67581 a multiple of 27? True Is 8 a factor of 64? True Is 5 a factor of 20? True Is 60 a factor of 4443? False Is 48 a multiple of 6? True Is 5 a factor of 484? False Is 5544 a multiple of 66? True Is 26 a factor of 13303? False Is 2216 a multiple of 9? False Is 212 a multiple of 31? False Is 14 a factor of 112? True Does 130 divide 52000? True Is 1341 a multiple of 7? False Is 664 a multiple of 19? False Does 12 divide 4278? False Is 5785 a multiple of 4? False Is 1593 a multiple of 2? False Does 9 divide 756? True Does 6 divide 1051? False Does 5 divide 948? False Is 20 a factor of 40328? False Does 9 divide 10899? True Is 17688 a multiple of 24? True Does 24 divide 3720? True Is 29 a factor of 125686? True Does 22 divide 611? False Is 24054 a multiple of 57? True Is 132 even? True Is 8 a factor of 608? True Is 2829 a multiple of 47? False Is 53 a factor of 3396? False Does 191 divide 2348? False Is 31278 a multiple of 32? False Is 5 a factor of 461? False Is 548 a multiple of 4? True Is 145 a multiple of 5? True Does 6 divide 480? True Does 6 divide 270? True Does 3 divide 163? False Is 7659 a multiple of 111? True Is 899 a multiple of 3? False Does 53 divide 20147? False Is 4 a factor of 8184? True Does 8 divide 586? False Is 244 a multiple of 31? False Is 6004 a multiple of 79? True Is 11 a factor of 25806? True Is 11 a factor of 77? True Is 16596 a multiple of 7? False Does 116 divide 7570? False Does 15 divide 321? False Is 59 a factor of 24745? False Does 16 divide 3056? True Is 31 a factor of 124? True Is 7 a factor of 3364? False Is 209 a factor of 5643? True Does 6 divide 2022? True Does 84 divide 1016? False Is 6 a factor of 8658? True Is 17 a factor of 6885? True Is 13 a factor of 48113? True Does 41 divide 11085? False Is 856 even? True Does 9 divide 22021? False Is 12 a factor of 598? False Is 58 a multiple of 29? True Is 1044 a multiple of 50? False Is 576 a multiple of 38? False Is 1375 a multiple of 37? False Does 51 divide 9295? False Is 2160 a multiple of 60? True Is 13 a factor of 429? True Is 19 a factor of 1437? False Is 18 a multiple of 18? True Does 3 divide 137? False Is 32 a factor of 7712? True Is 47 a factor of 7708? True Is 15 a factor of 52669? False Is 28 a factor of 2968? True Is 18 a factor of 1854? True Does 11 divide 605? True Does 12 divide 2280? True Does 21 divide 14070? True Is 15 a factor of 11520? True Is 18 a factor of 774? True Is 2304 a multiple of 6? True Is 811 a multiple of 91? False Is 194 a factor of 10864? True Is 1350 a multiple of 15? True Is 2 a factor of 3093? False Is 2088 a multiple of 29? True Is 493 a multiple of 29? True Is 84 a factor of 29568? True Is 7 a factor of 12222? True Does 10 divide 3784? False Is 13 a factor of 224? False Is 12 a factor of 14484? True Is 4995 a multiple of 111? True Is 45 a factor of 675? True Is 79 a factor of 2048? False Does 14 divide 30002? True Is 29 a factor of 232? True Does 7 divide 819? True Does 22 divide 829? False Is 828 a multiple of 15? False Is 13 a factor of 191919? True Does 14 divide 280? True Does 25 divide 15096? False Is 536 a multiple of 22? False Is 20178 a multiple of 19? True Is 17 a factor of 2533? True Is 16 a factor of 352? True Is 61104 a multiple of 46? False Is 27 a factor of 37371? False Is 53 a factor of 2226? True Does 4 divide 15404? True Is 55276 a multiple of 7? False Does 43 divide 6880? True Is 482 a multiple of 30? False Is 3 a factor of 149? False Is 1680 a multiple of 12? True Does 65 divide 3185? True Is 84 a factor of 2086? False Is 6 a factor of 52? False Is 23962 a multiple of 64? False Is 24 a factor of 10700? False Does 33 divide 1132? False Is 6976 a multiple of 134? False Is 184 a multiple of 46? True Does 40 divide 1841? False Is 17 a factor of 540? False Is 458 a multiple of 5? False Is 492 a multiple of 98? False Is 12 a factor of 56839? False Is 1233 a multiple of 3? True Does 23 divide 23? True Does 43 divide 7310? True Does 18 divide 1116? True Is 114 a factor of 2964? True Does 10 divide 410? True Does 87 divide 4489? False Is 8 a factor of 312? True Does 8 divide 26304? True Does 126 divide 7286? False Is 4 a factor	{ "pile_set_name": "DM Mathematics" }
305 Work out 6 * -9. -54 Work out 14709 * -5. -73545 Work out 5.75 * -4. -23 Multiply 605 and 3. 1815 Multiply -5.93 and 0.6. -3.558 Product of -11473 and 4. -45892 -0.477 times -0.071 0.033867 Product of 0.4 and 423. 169.2 Product of -0.7 and -4603. 3222.1 Multiply -0.448 and 4. -1.792 Calculate 159410. 0 8 -0.5 -4 Multiply -0.02 and 0.01. -0.0002 0-615 0 Multiply -4.07 and 2.6. -10.582 -1.3-160 208 Work out 0.1 * 489. 48.9 161.1 * -2 -322.2 What is 430 times -0.5? -215 -0.1-1.3 0.13 What is -138 times -0.4? 55.2 Work out -3223 -9. 29007 Product of 14.8 and -0.08. -1.184 Work out 0.0866 * 0.5. 0.0433 Multiply 0.1648 and -0.1. -0.01648 Work out -15 * 189. -2835 What is the product of -93.1 and -0.5? 46.55 Calculate -4-0.1095. 0.438 What is 11.74 times -0.01? -0.1174 Multiply 2078 and -0.3. -623.4 Multiply 0.4 and 319. 127.6 What is the product of 1 and 147? 147 Product of 1 and 0.009. 0.009 Multiply -0.3102 and 4. -1.2408 What is 2 times -83? -166 What is 0.67 times -0.8? -0.536 Calculate -3824. -1528 What is -1 times 82? -82 Product of 0.02 and 37. 0.74 Calculate 0.0822. 1.76 What is the product of 0.1 and -0.1756? -0.01756 -3-47 141 Product of 12 and -5.2. -62.4 Calculate 2670.3. 80.1 Multiply -42 and -1.2. 50.4 Calculate 1.4920. 0 Calculate -7-0.005. 0.035 -4135 -540 -20.20.5 -10.1 -0.61 -0.6 2.3 * 784 1803.2 -6.31 * 0.3 -1.893 -4 * -14.2 56.8 -530.5 -26.5 Calculate -3.7-5. 18.5 Product of -1.3 and 2.6. -3.38 0.039-539 -21.021 Work out 0.2 315. 63 Calculate 2-209. -418 145-56 -8120 Product of 316 and 0.3. 94.8 Work out -0.3 * 200. -60 Calculate -0.2-5.4. 1.08 -0.025 2.4 -0.06 What is 16922 times 0.1? 1692.2 Calculate -138. -104 What is the product of -0.4 and 1649? -659.6 -80 -1.3 104 Multiply -0.3 and 390. -117 -0.1 times -5.5 0.55 13180 0 What is the product of -0.2 and -0.047? 0.0094 What is 4 times -1896? -7584 -1.0811.5 -12.42 83 times -3.5 -290.5 Work out -2 * 334. -668 1203 * 3 3609 Calculate -282-0.5. 141 Work out 0.3 346. 103.8 272-4 -1088 Product of 70 and 0.5. 35 Multiply -1111 and 0.5. -555.5 What is the product of -509 and -20? 10180 -0.023 times -0.3 0.0069 Multiply -87 and -0.4. 34.8 Calculate -29-10. 290 What is the product of 29.99 and -0.3? -8.997 5 * 580 2900 Multiply -37 and -0.08. 2.96 Multiply -0.3 and 0.671. -0.2013 What is the product of 0.3 and 2.091? 0.6273 -5 times -53.6 268 Work out -3 * -3937. 11811 Product of 0.66 and -6. -3.96 Multiply -0.09 and 1. -0.09 Work out -4 * -930. 3720 Work out -9 * -186. 1674 3-265 -795 -29 times -0.3 8.7 Work out 467 -0.4. -186.8 Product of -4 and -1599. 6396 Work out 2588 * -0.4. -1035.2 Work out 44.6 * -1.1. -49.06 -0.53 * -0.7 0.371 16.7 * -1 -16.7 -100 times -1.1 110 What is the product of -3.805 and 0.5? -1.9025 Multiply 24 and -446. -10704 8 * 3 24 What is 0.132 times -0.06? -0.00792 -2.9 times 218 -632.2 2976 * 3 8928 Product of 0.04 and 50. 2 What is the product of 0.2 and 57? 11.4 Calculate 0.68-0.6. -0.408 Multiply 167 and 8.5. 1419.5 What is -30 times 22.5? -675 -0.0301 0.02 -0.000602 1-216 -216 -2-45 90 Multiply -15 and -29. 435 Work out 90 * 4. 360 -110.36 -3.96 Product of 316 and 33. 10428 Product of -0.4191 and 2. -0.8382 Multiply -97 and 5. -485 Calculate -0.30.011. -0.0033 Multiply -0.48 and 2. -0.96 Work out -0.4 * -35. 14 -0.1 * 6.65 -0.665 -5-872 4360 What is the product of 86 and -0.5? -43 0.14650.6 0.0879 Multiply 0.0179 and 1. 0.0179 164 64 What is 55 times 29.5? 1622.5 -80.24 -1.92 72 times 20 1440 Work out 1.807 * -1. -1.807 -0.7487 times 0 0 What is the product of -0.2 and 55? -11 2.91-13 -37.83 Product of -31 and 0.04. -1.24 What is the product of 0.0318 and 0.2? 0.00636 0-1.46 0 What is -137 times 0.1? -13.7 Multiply 0.03 and 82. 2.46 Work out 7 * 6.22. 43.54 Product of 2 and -919. -1838 What is -3 times 3.72? -11.16 Multiply 4 and -0.55. -2.2 0.91 times -2.4 -2.184 -8.212 * 0.4 -3.2848 What is the product of 1 and -101.9? -101.9 What is the product of -0.339 and -1? 0.339 Product of -10 and -102. 1020 15.240.1 1.524 What is the product of -34.9 and 0.2? -6.98 Calculate -75-2. 150 0.497 38.8 What is -2 times -82? 164 Work out -0.1 -0.166. 0.0166 Calculate -500.05. -2.5 Work out 109 171. 18639 Multiply 0.134 and 18. 2.412 What is the product of 485.2 and 0.1? 48.52 Product of 4 and 956. 3824 Multiply -5.94 and -1. 5.94 Product of -0.114 and 26. -2.964 -2 times 0.151 -0.302 -7083 -2124 Work out 3 -0.66. -1.98 Product of -1.792 and 2. -3.584 Multiply 4 and 42. 168 -372 * 0.2 -74.4 Multiply -4 and -19. 76 7910-4 -31640 What is the product of -14 and 25.8? -361.2 -66 0.0037 -0.2442 Multiply -354 and -1. 354 Multiply -4 and 1.17. -4.68 What is the product of 43.687 and 0? 0 What is the product of -0.4 and -29.1? 11.64 Multiply -28 and -0.1. 2.8 0.2-2.15 -0.43 Work out -1.15 0. 0 Multiply -0.142 and 0.2. -0.0284 What is the product of 9.16 and -0.1? -0.916 Calculate -17495. -8745 Calculate -159.4-5. 797 Multiply -1 and 153. -153 2 times -8.25 -16.5 Product of 3 and 49. 147 -1.07 * -0.8 0.856 What is the product of -0.03 and 0.0217? -0.000651 What is the product of 15 and -0.1? -1.5 0.214 * -2 -0.428 Multiply 72.2 and -18. -1299.6 Work out -2.8 * 0.5. -1.4 Calculate 5160. 800 -584 0.08 -46.72 What is -0.1 times 0.0191? -0.00191 What is 539 times 0.2? 107.8 Work out 3 * -0.16. -0.48 Calculate -0.06505. -30.3 -3 times -62 186 What is the product of -1 and -18.7? 18.7 0.01 0.02295 0.0002295 What is the product of -1254 and 0? 0 What is the product of -136 and 15? -2040 -418-1 418 Work out -131 -4. 524 0.9-3 -2.7 1.4022 times -0.3 -0.42066 What is -3034 times -1? 3034 What is the product of -0.0678 and -0.4? 0.02712 -78 -0.165 12.87 Multiply 19 and -92. -1748 Calculate -0.13.1. -0.31 Product of 1.3 and -0.22. -0.286 What is the product of -0.8 and -0.7? 0.56 Work out -1 0.0738. -0.0738 -13.89 * 0 0 -52742 -13710 Work out 97 2. 194 -152 * -0.06 9.12 What is the product of 0.2 and 96? 19.2 -1363 -408 Calculate 214-0.4. -85.6 What is the product of 5 and 0? 0 Calculate 140.4. 5.6 What is -0.2 times 138.2? -27.64 -3-4.4 13.2 Work out 0.238 * 0.6. 0.1428 Product of 658 and 3. 1974 What is -0.1 times 3.7? -0.37 What is 0.017 times -0.3? -0.0051 Multiply -0.12 and 0.11. -0.0132 What is the product of 6 and 2342? 14052 Work out 5 * 127. 635 Calculate 1110. 110 Work out -4.45 5. -22.25 196 96 0.5-2978 -1489 0.05121-5 -0.25605 What is the product of 0.03 and -2884? -86.52 51268 6340 What is 0.3 times -135? -40.5 -0.6 * -397 238.2 719-7 -5033 Calculate -0.1319. -31.9 Multiply -0.385 and 0.5. -0.1925 -63.38 * -0.1 6.338 Product of -0.0372 and -5. 0.186 Calculate 0.0280.5. 0.014 -13 -47 611 0.5 times 12.77 6.385 Multiply -12 and 37. -444 What is the product of 10242 and 5? 51210 -0.5132-2 1.0264 Multiply 0.5 and 519. 259.5 Work out -77 4. -308 Multiply 0.08 and 67. 5.36 Calculate 39.66. 28.98 -3 times 74 -222 Calculate 8.33. 24.9 Work out -3 * -1206. 3618 Work out -0.14 * 55. -7.7 What is -107 times -3? 321 Product of 55 and -4. -220 Work out 6 * -29. -174 3-21 -63 -757.4 0 0 Product of 203 and -0.2. -40.6 What is -184 times 24? -4416 Work out 0.1 * 181. 18.1 What is 6 times 0.3? 1.8 22.17 * -0.5 -11.085 Product of -743.5 and -0.2. 148.7 -0.1 times -2 0.2 4 times -1118 -4472 Work out -0.085 * -0.08. 0.0068 Work out -0.029 * -0.074. 0.002146 Work out -4 * -0.387. 1.548 What is 4896 times 5? 24480 What is the product of 3 and 390? 1170 -0.0446 * 0.3 -0.01338 Calculate 0.031260. 37.8 What is the product of -2.3 and 95? -218.5 22997 times 0.4 9198.8 -5 -1.46 7.3 Calculate 11480. 0 -50.31 -1.55 -47 * 8 -376 Work out 34.89 * -3. -104.67 What is the product of 2.33 and 0.1? 0.233 Calculate -2-2.57. 5.14 What is the product of 2.3 and 0.2? 0.46 0.381 24.3 Calculate -2.74-0.2. 0.548 Calculate -681.2. -81.6 What is the product of -13.693 and 0.1? -1.3693 2 * 991 1982 10 * -0.25 -2.5 What is 2.3 times -167? -384.1 0.0418 * -1 -0.0418 -42.4 * -1 42.4 4 times 375 1500 8.138 * 2 16.276 Multiply -0.3 and -0.076. 0.0228 What is 4.05 times 0? 0 Multiply -2 and 24.3. -48.6 Calculate -446-0.3. 133.8 Multiply -7.7 and 15. -115.5 -330.02 -0.66 -5 times -50 250 7 times -0	{ "pile_set_name": "DM Mathematics" }
= 4n3 + 38n*2 - 25n - 57. Determine q(-10). -7 Let o(s) = s*2 + 46s - 126. Give o(-50). 74 Let w(p) = -4p - 260. Calculate w(-19). -184 Let g(m) = -m3 + 3m*2 + 20m + 13. Determine g(6). 25 Let t(b) = 10b2 + 7b - 29. Give t(4). 159 Let s(f) = -23f2 - 3f - 5. Calculate s(-2). -91 Let i(w) = w*3 + 52w*2 - 778w - 590. Determine i(-64). 50 Let d(f) = 3f3 - 51f*2 - 3f + 14. Determine d(17). -37 Let f(h) = -h*3 + 24h*2 - 37h + 322. Calculate f(23). 0 Let i(j) = -30j - 857. What is i(-32)? 103 Let i(n) = 3n*2 + 30n + 5. Calculate i(-6). -67 Let h(b) = 2b3 - 7b*2 - 125b + 150. Calculate h(-7). -4 Let v(j) = -174j - 342. What is v(-2)? 6 Let o(g) = 387g*2 + 138g - 139. Calculate o(1). 386 Let i(j) = -j*3 - 3j*2 - 1064j - 2123. Determine i(-2). 1 Let a(l) = 17759l - 230867. Calculate a(13). 0 Let u(g) = -64g - 573. What is u(-10)? 67 Let h(o) = -194o - 2872. Calculate h(-14). -156 Let s(b) = 2b*3 + 272b*2 + 6b + 802. What is s(-136)? -14 Let w(m) = -4m2 + 653m - 10079. Calculate w(146). -5 Let s(a) = a3 - a2 + 2a + 186. Determine s(0). 186 Let u(n) = 10n*3 - 74n*2 + 89n - 37. What is u(6)? -7 Let q(i) = 44i3 + 790i*2 + 6i + 754. Determine q(-18). -2 Let o(g) = 11g2 - 37g + 10. Give o(2). -20 Let k(n) = -709n + 2872. Calculate k(4). 36 Let z(p) = -18p*2 - 117p + 61. What is z(-7)? -2 Let s(m) = 23m2 + 6m - 51. What is s(4)? 341 Let r(c) = -2c3 + 4c*2 - 6c - 1. Determine r(-3). 107 Let i(a) = -371a - 260. Calculate i(-1). 111 Let q(x) = 78x + 63. Give q(-1). -15 Let c(x) = -857x + 29984. Give c(35). -11 Let j(q) = 53q + 2388. Give j(-45). 3 Let j(p) = -9p2 - 4p - 22. What is j(5)? -267 Let v(o) = 25o2 - 14o + 32. What is v(2)? 104 Let s(z) = z*3 + 61z*2 + 334z + 169. Give s(-55). -51 Let i(g) = g*2 + 243g - 483. What is i(2)? 7 Let i(z) = -966z - 8687. Calculate i(-9). 7 Let p(g) = -3095g - 18567. What is p(-6)? 3 Let i(l) = 23l + 508. Give i(-25). -67 Let f(u) = -u3 + 14u*2 + 233u - 3117. What is f(13)? 81 Let x(v) = -2233v + 8929. Calculate x(4). -3 Let h(d) = 6d*2 + 4d - 6. Calculate h(-2). 10 Let v(j) = -1966j - 3928. What is v(-2)? 4 Let b(o) = -4o*3 + 4o*2 + o + 27. Determine b(4). -161 Let d(w) = -2w*2 + 3w - 31. Calculate d(3). -40 Let n(o) = 28o + 614. Calculate n(-13). 250 Let l(i) = 2i*2 + 20i - 444. Give l(-20). -44 Let b(n) = -n*3 + 16n*2 - 26n + 28. Determine b(15). -137 Let b(w) = -w*3 - 60w*2 - 117w - 64. What is b(-58)? -6 Let g(m) = -m*2 + 81m + 338. Determine g(-4). -2 Let x(r) = 115r + 13225. What is x(-115)? 0 Let k(t) = -101t + 606. What is k(6)? 0 Let d(j) = 2j2 + 109j - 89. What is d(-50)? -539 Let i(n) = 9n3 - n2 - 2n + 317. What is i(0)? 317 Let z(b) = -2b2 + 14b + 8. What is z(-4)? -80 Let q(m) = -15m3 + 390m2 + m - 25. What is q(26)? 1 Let n(o) = o3 + 20o - 17. Give n(2). 31 Let r(q) = q3 - 13q*2 - 46q + 459. Determine r(15). 219 Let c(t) = 20t2 - 251t + 42. Determine c(13). 159 Let f(g) = g*3 - 20g*2 + 31g + 69. What is f(18)? -21 Let r(q) = 2q3 - 80q*2 - 3q + 103. Give r(40). -17 Let l(y) = y*3 - 26y*2 - 60y + 12. Calculate l(28). -100 Let b(t) = -2t3 - 12t*2 + 25t - 496. Calculate b(-10). 54 Let o(i) = 301i - 294. Give o(1). 7 Let b(m) = m3 - 2m*2 - 17m + 16. Give b(4). -20 Let j(x) = -355x - 1008. Give j(-3). 57 Let d(a) = 2488a + 17450. What is d(-7)? 34 Let z(c) = -c - 100. Calculate z(64). -164 Let s(v) = -2v - 110. Give s(-34). -42 Let n(q) = 2q*3 - 67q*2 - 104q + 30. Calculate n(35). 65 Let w(o) = -94o + 613. What is w(7)? -45 Let q(z) = 7z*3 - 18z*2 - 41z - 5. Give q(4). -9 Let f(l) = 51l + 608. What is f(-12)? -4 Let g(s) = 37s - 226. Determine g(11). 181 Let k(h) = -10h + 68. Give k(20). -132 Let h(l) = -289l*3 - 4l*2 - 5l - 1. What is h(-1)? 289 Let a(s) = 55s + 290. What is a(-10)? -260 Let l(y) = -y2 + 112y + 2018. Calculate l(-16). -30 Let q(i) = -i*3 - 14i*2 + 14i + 38. What is q(-15)? 53 Let c(l) = -121l - 1081. Calculate c(-9). 8 Let n(y) = -y2 - 35y - 265. What is n(-11)? -1 Let m(h) = h*3 - 26h*2 - 46h - 77. Give m(28). 203 Let h(z) = -22z3 + 42z*2 + 50z + 8. Determine h(-1). 22 Let r(v) = -2v2 + 140v - 71. Determine r(69). 67 Let c(j) = j*3 + 29j*2 + 202j + 4015. Give c(-27). 19 Let j(n) = 56n + 375. Determine j(-7). -17 Let f(i) = 6i*3 - 16i*2 + 3i - 26. Give f(3). 1 Let i(u) = 11u2 - 39u + 13. Determine i(5). 93 Let j(l) = l*3 - 46l*2 + 301l + 1186. What is j(37)? 2 Let c(q) = 18q3 - 22q*2 + 22q - 1. Determine c(1). 17 Let f(d) = 3747d + 3764. Calculate f(-1). 17 Let f(x) = -8x*2 - 75x + 337. Give f(5). -238 Let q(c) = -c*3 - 66c*2 + 1703c - 1471. Determine q(-86). -9 Let t(y) = -3y2 + 4278y - 17076. What is t(4)? -12 Let r(b) = -10b3 + 4b*2 - 12b - 17. Give r(3). -287 Let r(y) = -y*3 + 4y*2 + 4y + 63. Give r(6). 15 Let t(d) = -d*2 - 140d + 1665. What is t(11)? 4 Let n(r) = 32r + 49. Give n(4). 177 Let a(u) = 14u - 412. What is a(31)? 22 Let q(f) = -f + 8. What is q(5)? 3 Let t(m) = -35m - 2062. Calculate t(-59). 3 Let z(p) = p3 - 90p*2 - 29p - 5661. Calculate z(91). -19 Let w(k) = -13k2 + 28k + 32. Calculate w(-1). -9 Let k(t) = t*3 + 18t*2 - 412t - 267. Calculate k(-31). 12 Let d(c) = -3c3 - 574c*2 + 363c - 4025. Determine d(-192). 7 Let r(s) = 7s2 - 5s - 5. Calculate r(-1). 7 Let u(p) = 3p - 27. What is u(16)? 21 Let f(u) = 3880u - 11691. Determine f(3). -51 Let z(r) = r*3 - 3r*2 + 16r - 61. What is z(7)? 247 Let n(h) = h*3 + 52h*2 + 107h - 108. Determine n(-50). -458 Let l(p) = p*3 - 4p*2 - 62p + 18. Calculate l(10). -2 Let x(j) = -2j3 - 13j*2 - 4j - 57. Determine x(-7). 20 Let u(w) = 12w2 + 394w + 17. Give u(-33). 83 Let k(q) = -1014q + 41574. Determine k(41). 0 Let k(z) = z2 - 166z + 6558. What is k(65)? -7 Let i(h) = -2h3 - 80h*2 - h + 93. Calculate i(-40). 133 Let q(h) = 2h*3 - 128h*2 + 170h - 2783. What is q(63)? -11 Let f(q) = 23q - 2070. Determine f(90). 0 Let a(p) = 6p*3 - 7p*2 - 4p + 22. Give a(3). 109 Let s(p) = p*2 - 26p - 728. What is s(-17)? 3 Let d(v) = -101v + 689. Give d(9). -220 Let p(g) = 23g - 345. Determine p(10). -115 Let n(f) = 90f - 1075. What is n(12)? 5 Let m(a) = a2 - 3a + 15. Calculate m(5). 25 Let z(g) = -1298g - 6501. Determine z(-5). -11 Let l(m) = -37m*3 - 12m*2 + 42m + 52. Calculate l(-1). 35 Let z(g) = g*3 - 75g*2 + 3g - 220. Give z(75). 5 Let j(t) = 90t - 2862. Give j(33). 108 Let s(g) = -607g + 3043. Give s(5). 8 Let y(v) = -v*2 + 1941v - 34615. What is y(18)? -1 Let y(s) = -s*2 + 114s + 869. Determine y(-8). -107 Let y(w) = w*2 + 7w. Calculate y(0). 0 Let z(q) = -7q - 137. Calculate z(-3). -116 Let o(w) = w2 - 17w - 10. What is o(7)? -80 Let l(h) = h*2 + 133h + 2866. Determine l(-27). 4 Let a(f) = f*2 - 30f + 48. What is a(28)? -8 Let z(b) = 224b - 613. Give z(3). 59 Let v(g) = g3 + 17g*2 + 73g - 42. Calculate v(-7). -63 Let w(f) = -f*2 + 111f + 834. What is w(-7)? 8 Let w(k) = -k*3 - 15k*2 + 31k - 47. Give w(-17). 4 Let k(q) = -67q + 318. What is k(7)? -151 Let y(j) = -j3 - 7j*2 - 30j - 71. Give y(-9). 361 Let j(z) = -z*3 - 16z*2 - 67z - 13. Determine j(-6). 29 Let d(s) = s*3 + 11s*2 + 12s + 43. Determine d(-10). 23 Let s(y) = -y*2 + 3y - 8. Give s(11). -96 Let y(c) = c*3 + 21c*2 + 119c + 1183. Give y(-18). 13 Let q(u) = 3615u - 25292. Determine q(7). 13 Let u(b) = -8b*3 - 7b*2 - 6b + 1. Calculate u(-2). 49 Let v(w) = w*3 + 17w*2 - 4w - 132. What is v(-9)? 552 Let y(f) = 60f + 835. Give y(-14). -5 Let q(x) = x3 - 180x*2 + 6338x - 271. Give q(132). -7 Let x(h) = -28h2 - 124h - 124. Calculate x(-1). -28 Let x(r) = 54r2 - 2r + 2. What is x(2)? 214 Let y(w) = -31w + 925. Give y(30). -5 Let t(i) = -67i*2 - 2210i + 31. Determine t(-33). -2 Let f(m) = m*3 - 13m*2 - 33m - 32. What is f(15)? -77 Let w(q) = q*3 + 10q*2 - 76q + 41. Determine w(-15). 56 Let l(t) = -23507t + 117545. What is l(5)? 10 Let w(m) = 13m - 239. Determine w(19). 8 Let x(i) = -152i + 1563. What is x(11)? -109 Let g(x) = -x*	{ "pile_set_name": "DM Mathematics" }
- 2. Let x(f) = 37f + 30f - 66f. Let h(b) = wq(b) - 4x(b). Let i(v) = 4v - 11. Calculate -5h(j) - 3i(j). -2j + 3 Let c(b) = b - 6. Let t = 45 + 0. Let x(d) = t - 3d + 5d - 58. Let v(k) = -3k + 2. Let q be v(2). Give qx(p) + 9c(p). p - 2 Let y(h) = 186h - 11. Let a(n) = 2. What is -5a(s) - y(s)? -186s + 1 Let a(c) = -8c*2 + 51c - 1. Let i(x) = 3x2 - 17x. Let f(z) = 6a(z) + 17i(z). Let l(j) = -j*2 - 6j + 2. Give -3f(r) - 8l(r). -r*2 - 3r + 2 Suppose -g - 28 = -4i, 0 = -2i - 2g + 4. Let k(r) = -2r*2 + 5r + 5. Let j(q) = 2q2 - 5q - 6. Give ik(b) + 5j(b). -2b2 + 5b Let f(k) = 2k3 + 46k*2 + 4k - 9. Let g(c) = -c*3 - 24c*2 - 2c + 5. Give 4f(n) + 7g(n). n*3 + 16n*2 + 2n - 1 Let r(t) = -3t - 1. Let m(j) be the third derivative of -j2 - 1/3j*3 + 0j + 0 - 1/8j4. Determine -2m(z) + 3r(z). -3z + 1 Suppose -22j - 58 = 8. Let q(n) = -9n + 7. Let h(y) = -y + 1. Determine jq(m) + 21h(m). 6m Let b(c) = -38c*2 - 5c + 1. Let d(p) = -112p2 - 14p + 3. Calculate -17b(y) + 6d(y). -26y2 + y + 1 Let v(a) = 2a*2 - 2a + 3. Let j(l) = -3l2 + 7l + 28. Let k be j(-2). Let m(r) = 2r2 - 2r + 3. What is kv(u) - 3m(u)? -2u2 + 2u - 3 Let n(t) = 99t - 41. Let l(a) = 20a - 8. What is -11l(g) + 2n(g)? -22g + 6 Suppose -b - 9 = 5q, b + 22q - 5 = 24q. Let v(l) = -l. Let n(f) be the third derivative of f*2 + 0f - 1/6f3 + 7/24f*4 + 0. Calculate bn(m) + 6v(m). m - 1 Let t(i) = i + 4. Suppose -3s - 9 = 0, u - 6u + 4s = -12. Suppose -5o - 3h - 23 = -o, 3o + 5h + 20 = u. Let c(p) = -p - 3. Calculate oc(n) - 4t(n). n - 1 Let f(d) = 7d + 2. Let n = 225 + -228. Let s(v) = -7v - 3. Give nf(m) - 2s(m). -7m Let k(y) = 4y*3 - 4y - 2. Let w(u) = 0 - 2177u3 - 3 + 2182u*3 - 4u. What is -3k(q) + 2w(q)? -2q3 + 4q Let t(d) = -5d2 - 7d + 11. Let p(j) = -3j2 + 16j - 6. Let u(w) = 4w2 - 18w + 6. Let r(i) = 7p(i) + 6u(i). What is 11r(s) + 6t(s)? 3s2 + 2s Suppose s + s = 2. Let o = -65 - -68. Let x(m) = 7m + o - 11m - 4 + 7m2 - 4. Let a(g) = g2 - g - 1. Determine sx(t) - 5a(t). 2t*2 + t Suppose -4 - 14 = -3c. Let h(k) = -3k2 - 6k - 6. Let s(j) = -j*2 - j - 1. Let q be (-40)/25 + (2-2 - 92/(-20)). Calculate cs(t) + qh(t). -3t2 Let z(d) = 23d + 2. Let f(i) = -27i - 2. Give -6f(a) - 5z(a). 47a + 2 Let k(r) = -5r - 2. Let z(x) = 2x*2 - 3x - 4. Let c be z(3). Let p = c - 8. Let g(v) = 6v + 3. Determine pg(h) - 4k(h). 2h - 1 Let k(r) be the second derivative of r4/8 - r3/2 - 9r2/2 - 6r. Let j(t) be the first derivative of k(t). Let z(w) = -w*2 + w - 1. Give j(u) - 3z(u). 3u2 Let x(u) = -2u + 23u2 - 4u - 24u2 - 4u*3. Let h be ((-20)/20)/((-1)/5). Let c(n) = 3n3 + n2 + 5n. Calculate hx(l) + 6c(l). -2l3 + l2 Let t(p) = -11p + 11. Let a(h) = -3h + 2. Let d(m) = 5a(m) - t(m). Let z(k) = 6k + 2. Give -7d(i) - 5z(i). -2i - 3 Let r(j) = -2j - 4. Let v(h) = 4h + 7. Let c be (-640)/(-100) + 4/(-10). Suppose 22 = -cw + 4. Calculate wv(q) - 5r(q). -2q - 1 Let l(o) = -o3 + o2 + 2o + 2. Let a be (-24)/(-12)(-6)/(-4). Let i(j) = 1 - 17 - 3j*2 + 5 + 6 + 3j*a - 5j. Calculate -2i(x) - 5l(x). -x3 + x2 Let s(b) = -8b3 + 6b*2. Suppose -15r + 19r + 4k = 0, 0 = -3r + 4k + 7. Let w(y) = -y*2. Give rs(v) + 6w(v). -8v*3 Let g(q) = 6 - 28q*2 + q + 8q*2 + 9q*2 + 9q*2. Let i(n) = -2n*2 + n + 5. Calculate 4g(w) - 5i(w). 2w*2 - w - 1 Let f(s) = -6s*2 + 57s + 4. Let t(p) = -8p2 + 58p + 5. Determine 5f(k) - 4t(k). 2k2 + 53k Let i(r) = -r. Suppose 0 = 3l - 5t - 0t - 11, -2l - 2t + 34 = 0. Let c(y) = 16y. Determine li(o) + c(o). 4o Let g(o) = 839o3 + 0o - 6o + 5o*2 - 841o3 + o2 + 13. Let y(n) = -2n3 + 7n*2 - 7n + 14. Calculate 7g(s) - 6y(s). -2s3 + 7 Let i = -1243 + 1232. Let s(l) = 6l*2 + 2l + 2. Let r(k) = 31k2 + 11k + 11. What is is(m) + 2r(m)? -4m2 Let s(x) = 12x*2 + 7x - 10. Let o(a) = 11a2 + 6a - 9. Suppose i + 29 = 2r + 3r, 2i - 26 = -4r. Give rs(z) - 7o(z). -5z2 + 3 Let r(o) = -o2 - o + 4. Let u(q) = -19q*3 + 4q*2 + 5q - 18. Give 4r(z) + u(z). -19z*3 + z - 2 Let p(c) = 24c*2 - 6. Let u(k) be the third derivative of -5k*5/12 + 7k*3/6 - 39k*2. What is -7p(y) - 6u(y)? -18y*2 Let w(y) = -3y + 3. Let t(b) = 5b - 210. What is t(i) + w(i)? 2i - 207 Let s(z) = 21z + 56. Suppose -a + x = -1, -11 = 3a - 5x - 6. Let u(j) = -2j - 5. Determine as(t) + 56u(t). -7t Let z(b) = -6b. Let t(f) be the second derivative of 7f3/6 + f2/2 - 234f + 1. What is -5t(a) - 6z(a)? a - 5 Let k(y) = 8y + 1. Let w = 249 + -232. Let z(j) = -3 - 11j + 34j + 6. Calculate wk(l) - 6z(l). -2l - 1 Let i(w) = -6w2 + w + 1. Let l = -1 - -5. Let q(x) = -8x*2 + x + 1. Let h(n) = -7n*2 + n + 1. Let z(u) = 3h(u) - 2q(u). What is li(o) - 5z(o)? o2 - o - 1 Let v(u) = -885 + 441 + 5u + 441. Let t(h) = -9h + 5. Calculate 6t(z) + 11v(z). z - 3 Let i(a) = 108a*3 + 10a2 + a - 5. Let n(s) = s3 + 2s2 + s - 1. What is i(f) - 5n(f)? 103f3 - 4f Let c(h) = -2. Let u(l) = -l*2 - 27l - 100. Let d be u(-22). Let o(m) = -m + 15. Give dc(k) + 2o(k). -2k + 10 Let o(c) = 2c*2 - 13. Let q be 5 + (0 + -1)2. Let m(z) = -z*2 + 3 + 6 - q. Let a be (2 - 261/(-54)) + 10/(-12). Determine ao(j) + 13m(j). -j2 Let m(y) = 550y*2 - 6y - 8. Let u(i) = -551i2 + 5i + 7. What is -5m(w) - 6u(w)? 556w2 - 2 Let k be ((-6)/(-1))/(867/(-123) - -7). Let s = k - -101. Let z(d) = d2 + 11d + 11. Let j(u) = 2u + 2. What is sj(i) + 4z(i)? 4i*2 Let i(k) be the third derivative of 11k4/24 + k3/6 - 429k2. Let s(p) = 7p + 1. Give -5i(b) + 7s(b). -6b + 2 Let d(s) = -5s*2 - 14. Let z(n) = 30771n*2 + 2 - 30773n*2 - 7. Suppose 0 = b - 6b + 40. Let y(x) = -3x3. Let l be y(1). What is bz(v) + ld(v)? -v2 + 2 Let u(f) = 0 - f - 3 - 3f*3 + 4 - 7f*3 + 11f*3. Let j be (-2)/(-3) + (-10)/6. Let z(c) = -c - 1. What is ju(o) - z(o)? -o*3 + 2o Let u(i) = 3i2 - 1. Let z(m) = -1 + 0m + 2m2 + 0m. Let l be ((-6 - 0) + -4)/(-2). Suppose -7p + l = -30. Calculate pz(o) - 4u(o). -2o*2 - 1 Let u(b) = 3b - 2. Let w(t) = -16t + 10. Suppose 26 + 1 = 4m + 3s, m + 2 = s. Suppose 2y - 9 = -y. Suppose 3l + y + m = 0. Calculate lw(j) - 11u(j). -j + 2 Let a(z) = 22z*2 + 3z. Let w(h) = 65h2 + 8h. Suppose 504i = 495i - 72. Give ia(m) + 3w(m). 19m2 Let x(z) = 13z - 15. Let a(y) = -7y + 8. Suppose -52 = 49b - 53b. Let r be (-4)/(-10)(b - (2 + -4)). Suppose -g = -5g + 44. Give ga(k) + rx(k). k - 2 Let q(c) = -1. Let a(r) = 2r - 15. Calculate a(l) + 6q(l). 2l - 21 Let s(j) = j + 7. Suppose 3r - 12 = -24. Let v(p) = 2. Give rs(o) + 14v(o). -4o Let o(r) = r + 1. Let x(d) be the third derivative of -d*4/8 - 4d3/3 + d2 - 5d. What is 14o(k) + 2x(k)? 8k - 2 Let q(t) = 2t - 3. Let n(u) = u - 140. Let s(p) = -p + 61. Let r(x) = -3n(x) - 7s(x). What is 5q(h) - 3r(h)? -2h + 6 Let w be 10/4(21 + -19). Suppose 0 = 2l - 3l - n + w, -2l + 3n = -10. Let f(q) = q - 1. Let i(r) = r2 + 5r - 3. Give lf(p) - i(p). -p2 - 2 Let m(f) = f2. Let k(i) = -i3 - 6i*2 - 2. Let a = -4 - -4. Suppose -30 = -3o + 5u, 3 = -au - u. Let v = o + -4. Give vk(g) + 6m(g). -g*3 - 2 Let b(q) = -12q*2 + 13q - 4. Let y(g) be the third derivative of g5/20 - g4/8 + g*3/6 - 5g*2. Give 2b(o) + 9y(o). 3o*2 - o + 1 Let n(m) = 6m + 1. Let w(o) = o. Let d(b) = 3n(b) - 24w(b). Let y(t) be the third derivative of -7t4/24 + 2t*3/3 + 8t*2. What is -5d(z) + 4y(z)? 2z + 1 Let t(z) = 1. Let a(y) = -10y + 9y - 311 + 308. Let i(q) = 3q - 1. Let s be i(2). Calculate st(j) + a(j). -j + 2 Let a = 566 + -567. Let g(b) = b*2 - 1. Let d(l) = 5l*2 + 2l - 3. Determine ad(q) + 4g(q). -q*2 - 2q - 1 Let g(f) = -5f2 - 2f. Let w(k) = -k*2 - 8k + 7. Let j be w(1). Let c(d) = -24d2 - 11d. What is jc(q) + 11g(q)? -7q2 Let y(b) = -b + 1. Let n(w) = -w - 2. Let l(z) = -z2 + 4z + 11. Let p(q) = l(q) + 6n(q). What is p(s) - 3y(s)? -s2 + s - 4 Let k(t) = t + t2 - 449 + 449. Let j(q) be	{ "pile_set_name": "DM Mathematics" }
rounded to the nearest one million? -5000000 Round 124.4685 to the nearest 100. 100 Round -1.420392 to one decimal place. -1.4 Round -0.000002162873 to seven dps. -0.0000022 What is -13605.912 rounded to zero decimal places? -13606 What is -0.00488141 rounded to three dps? -0.005 What is -15532600 rounded to the nearest one hundred thousand? -15500000 What is 227422 rounded to the nearest one thousand? 227000 What is 0.019238 rounded to 5 decimal places? 0.01924 Round 863778 to the nearest 1000. 864000 Round -137557400 to the nearest 1000000. -138000000 Round 0.669569 to 2 dps. 0.67 What is 0.033756875 rounded to three dps? 0.034 What is 28966330 rounded to the nearest one million? 29000000 Round 0.010269142 to four dps. 0.0103 What is 5227.22 rounded to the nearest ten? 5230 Round -27378.948 to the nearest one hundred. -27400 What is 0.0000571401 rounded to 6 decimal places? 0.000057 What is -7691.891 rounded to the nearest 10? -7690 Round -0.003264775 to three dps. -0.003 What is 0.03383629 rounded to 4 dps? 0.0338 Round 0.6725268 to three dps. 0.673 Round 3.854282 to two dps. 3.85 What is 4443975 rounded to the nearest one hundred thousand? 4400000 What is 64128.369 rounded to the nearest 100? 64100 Round 0.000017650332 to six decimal places. 0.000018 What is 0.01336273 rounded to 5 decimal places? 0.01336 Round 0.0031361927 to 5 decimal places. 0.00314 Round -0.000964514 to seven decimal places. -0.0009645 What is -51569.5 rounded to the nearest 1000? -52000 Round 11787.839 to the nearest ten. 11790 What is 587.093 rounded to the nearest integer? 587 What is 328.5804 rounded to the nearest 10? 330 Round -179.9059 to 1 dp. -179.9 Round -132.755 to 1 decimal place. -132.8 What is 8095.54 rounded to the nearest one thousand? 8000 Round -0.8441047 to three dps. -0.844 Round -229185.4 to the nearest 100. -229200 What is -0.0000316294 rounded to seven dps? -0.0000316 Round -509430 to the nearest 1000. -509000 What is 15821900 rounded to the nearest one hundred thousand? 15800000 What is 5102360 rounded to the nearest 100000? 5100000 What is 0.0016145464 rounded to 4 decimal places? 0.0016 What is 42.62372 rounded to 0 decimal places? 43 Round -0.000346421 to four decimal places. -0.0003 Round -316.4485 to the nearest ten. -320 What is -0.00035413 rounded to 4 dps? -0.0004 Round 3538713 to the nearest one hundred thousand. 3500000 What is -7.24732 rounded to 2 decimal places? -7.25 What is -96320300 rounded to the nearest one million? -96000000 What is 514.8743 rounded to the nearest 10? 510 What is 0.0230905 rounded to two decimal places? 0.02 Round 0.00032012541 to four decimal places. 0.0003 Round 0.04673281 to 2 dps. 0.05 What is -0.00002398223 rounded to seven decimal places? -0.000024 Round -12.26296 to two decimal places. -12.26 Round -0.11029 to 3 dps. -0.11 What is 22.6429 rounded to 1 dp? 22.6 What is 0.773337 rounded to two dps? 0.77 What is 12170.606 rounded to the nearest 10? 12170 Round -184700.44 to the nearest one hundred. -184700 Round -2.90216 to zero dps. -3 What is -0.010392329 rounded to five decimal places? -0.01039 Round -57526.56 to the nearest 1000. -58000 Round 0.520629 to three dps. 0.521 Round 187.7437 to one dp. 187.7 What is 0.27256 rounded to zero decimal places? 0 What is -0.001554983 rounded to 4 dps? -0.0016 Round -1.15696 to two decimal places. -1.16 Round 15094.66 to the nearest ten. 15090 Round 1.472185 to one dp. 1.5 What is 12324.9 rounded to the nearest one hundred? 12300 What is 8347.492 rounded to the nearest one thousand? 8000 What is 14.8402 rounded to the nearest integer? 15 Round -7079810 to the nearest 1000000. -7000000 What is 0.00079732 rounded to six decimal places? 0.000797 What is 1697.7677 rounded to zero dps? 1698 Round -0.000008269926 to six dps. -0.000008 What is -0.0000184665 rounded to 7 dps? -0.0000185 What is 42188736 rounded to the nearest 1000000? 42000000 What is -38360.7 rounded to the nearest one thousand? -38000 What is 2.46257 rounded to 2 dps? 2.46 Round 10225380 to the nearest 10000. 10230000 Round -0.0000693338 to five dps. -0.00007 Round -370729.1 to the nearest ten thousand. -370000 Round 0.104908 to three decimal places. 0.105 Round 0.02408386 to two decimal places. 0.02 What is 6352.3492 rounded to the nearest 10? 6350 Round -0.09609677 to four dps. -0.0961 What is -5.79136 rounded to 1 dp? -5.8 What is 10.795396 rounded to 1 dp? 10.8 What is -225446000 rounded to the nearest 1000000? -225000000 Round 298587.3 to the nearest one thousand. 299000 What is 15.780353 rounded to one decimal place? 15.8 What is 0.012885 rounded to 3 decimal places? 0.013 What is 162863.41 rounded to the nearest ten thousand? 160000 Round 0.00002096307 to 6 decimal places. 0.000021 Round 0.37574 to two decimal places. 0.38 What is 16831842 rounded to the nearest one hundred thousand? 16800000 Round -1097459 to the nearest 100000. -1100000 What is 173.8157 rounded to the nearest ten? 170 Round -0.00001020008 to seven decimal places. -0.0000102 What is 0.0001775497 rounded to seven decimal places? 0.0001775 Round 0.0000539594 to 5 dps. 0.00005 What is -0.0000029854895 rounded to seven decimal places? -0.000003 What is 0.1104 rounded to 1 dp? 0.1 Round 161.465 to the nearest 10. 160 What is -5764254 rounded to the nearest 100000? -5800000 Round -0.0307672 to 2 decimal places. -0.03 Round 0.00009186 to 4 dps. 0.0001 Round 3634.56 to the nearest 1000. 4000 Round 1581365.5 to the nearest 10000. 1580000 What is -0.69797718 rounded to 2 decimal places? -0.7 What is -0.0002823415 rounded to four decimal places? -0.0003 What is -0.00047445863 rounded to seven dps? -0.0004745 Round -0.000000796258 to seven dps. -0.0000008 Round -96117.5 to the nearest one thousand. -96000 Round 10.81765 to the nearest integer. 11 Round 0.105624498 to 4 dps. 0.1056 What is -1835.6745 rounded to zero decimal places? -1836 Round 0.02301638 to five decimal places. 0.02302 Round -0.00238062 to six decimal places. -0.002381 What is -0.03547873 rounded to four dps? -0.0355 Round -8816.7 to the nearest one hundred. -8800 What is -0.009386 rounded to one decimal place? 0 Round 0.372429 to 1 decimal place. 0.4 What is -21782 rounded to the nearest 100? -21800 What is 3654.15 rounded to the nearest one thousand? 4000 Round -0.005772399 to four decimal places. -0.0058 Round 0.00121144 to 4 dps. 0.0012 Round 23.8894 to the nearest 10. 20 What is -9636.9 rounded to the nearest 100? -9600 Round -2.159968 to one dp. -2.2 Round -75099.5 to the nearest one hundred. -75100 Round -181867 to the nearest 100. -181900 What is -1.040878 rounded to 2 dps? -1.04 What is 850.6916 rounded to one decimal place? 850.7 What is -0.0003819153 rounded to six dps? -0.000382 What is -622098 rounded to the nearest one thousand? -622000 Round 0.00000936601 to 6 decimal places. 0.000009 Round 452239100 to the nearest one hundred thousand. 452200000 What is -0.0000926037 rounded to four decimal places? -0.0001 What is -287834.55 rounded to the nearest one hundred? -287800 Round -1051869320 to the nearest 100000. -1051900000 What is 0.6516881 rounded to one decimal place? 0.7 Round 2.9234 to the nearest integer. 3 Round -0.000004615539 to 6 decimal places. -0.000005 Round 0.1091998 to two decimal places. 0.11 What is -737419.2 rounded to the nearest one hundred thousand? -700000 What is -2805.84 rounded to the nearest 10? -2810 Round 1.691965 to two dps. 1.69 Round 0.0614196 to five decimal places. 0.06142 What is 4.2577163 rounded to three decimal places? 4.258 What is 20252.934 rounded to the nearest 10? 20250 What is -328474.5 rounded to the nearest 100? -328500 What is -35060820 rounded to the nearest 1000000? -35000000 Round 150943.8 to the nearest ten thousand. 150000 Round 0.00842531 to five dps. 0.00843 Round 5633696300 to the nearest one million. 5634000000 What is -2507500 rounded to the nearest one million? -3000000 Round -7625375 to the nearest 100000. -7600000 Round 2859250 to the nearest ten thousand. 2860000 What is -88.088665 rounded to 0 dps? -88 Round -0.002011864 to five decimal places. -0.00201 Round -0.00013334 to 6 decimal places. -0.000133 Round -65.71701 to two decimal places. -65.72 Round -0.00003884642 to 5 dps. -0.00004 What is -7393	{ "pile_set_name": "DM Mathematics" }
= 2t for t. -5 Let s be 5/((-25)/15) - -7. Suppose 3x + 9 = -0n + 4n, -sx = 4n - 16. Suppose np - 4p = 0. Solve p = 3w + 15, 0w - 9 = -d + w for d. 4 Suppose 2w = -50 - 22. Let h = w - -38. Suppose -n + 10 = f, -5n = -6f + hf - 5. Solve 4d + 4 = 0, o - d + 0d = n for o. 4 Suppose 13 = -5o - 4i - 4, 0 = 2o - 2i - 4. Let b be (-2)/(-4) - o/2. Let s(k) = k*2 + 2k - 12. Let h be s(-6). Solve 2r = 5y - 18 + b, h = 4y for r. -1 Suppose 3h = -h + 8. Suppose -10 = 2v - 32. Solve 0 = 4x - hg - 10, 4x + g = 4g + v for x. 2 Let y be (-135)/(-75) - (-2)/10. Let k be 12 + -6 - y/2. Solve -ks - 3w - 37 = 0, 0s + 4s + 36 = -4w for s. -5 Let c(t) = t + 2. Let u be c(9). Suppose 3s - 38 = -u. Solve -3r + 0r + 17 = -4l, 0 = l + 4r + s for l. -5 Let y be (-1)/((-1)/3 + 0). Let x be y(8/12 - 0). Suppose 3m - 4m + 12 = 2v, 21 = xm + 3v. Solve -k = 0, -3g + k + k + m = 0 for g. 2 Let j(w) = 24w2 + 1. Let z be j(2). Let v = -85 + z. Solve 2c = 2h + v, -4c - h + 10 - 1 = 0 for c. 3 Suppose -3o = 5d - 4o - 140, d = -4o + 7. Solve -3p - d = 3b, 4b - 9p + 4p = 0 for b. -5 Suppose -90 = -22d - 46. Solve -5l + 4v + 11 = 0, l + dl + 19 = -4v for l. -1 Suppose -5c - 3z + 34 = 0, -c = -3z + 4 - 0. Let s be -1 - (1 + 1) - (c - 10). Solve -6w + sw = -2o + 4, w - 5o = -1 for w. -1 Suppose 0 = 2w - 3b - 47, -3w + 59 = w + b. Solve j + 8 = -2v, 5j - 4v = j + w for j. 0 Let c(r) be the second derivative of r3/6 + 3r*2 - 5r. Let p be c(-2). Solve 0 = -5s + ps + j + 6, -21 = -4s + j for s. 5 Let l be (-4)/(-6)((-105)/(-6) + -16). Solve -2v - l = 2v - 3p, 0 = 5p + 25 for v. -4 Suppose 5y = 5t + 15, -2y - 2t + 7 + 3 = 0. Solve -3q + 3 = 4i, 3q + 17 = yq - 4i for q. 5 Suppose -5b - 3p = 405, 0 = 9b - 4b - 2p + 380. Let l = 84 + b. Solve l = -f + y, 4f + 3y + 23 = 6y for f. -5 Suppose 8 = 18k - 10. Solve p + 7m - 9m = -k, 0 = -m - 2 for p. -5 Let c(k) = 3 - 7k + 2k*2 + 0k + 3k. Let q be c(2). Let t(g) = 71g + 710. Let i be t(-10). Solve 3p + 3m = i, -qm + 7m - 21 = 3p for p. -3 Let c be 2 + -1 - (1 - 0). Let h = 5 + c. Suppose -hs + 12 = -8. Solve -s = -3l - j, -6l - 3j + 12 = -2l for l. 0 Let w be 0/(-34)2/2. Solve -4 = -4j + 3h + 6, -4h - 8 = w for j. 1 Let b = 1417 - 1413. Solve 0 = f + 2w, 0f + 3w = -bf for f. 0 Let p(u) be the first derivative of u*3/3 + 23u*2/2 - 32u + 47. Let q be p(-25). Solve -t = 3k + q, -2 = k - 0k - t for k. -5 Let f(q) = -q*2 + 5q + 2. Let k be f(5). Suppose -2 = 5d - 3h - 12, d - k = 2h. Suppose -3 - 7 = -dn. Solve u = -i - 1, 3i = -u + nu + 4 for u. -1 Let i = 49 + -49. Suppose i = 5n - 3k - 71, 0 = -n + 2n - k - 13. Solve -4x - x = -3d + 32, -5d = x - n for x. -4 Let q be (9/(225/(-110)))/((-2)/5). Solve -3c = 5n - q, -c + 6 = -0c + 4n for c. 2 Let s(i) = i. Let v be s(5). Suppose h = -h, 3h + 35 = vr. Suppose -c + 11 = w, -404c + 406c + 5w = 43. Solve -4 = -2k - f - 3, r = ck + 3f for k. -2 Let k = 637 + -632. Solve -3a + 16 = c - 7a, -a + k = 2c for c. 4 Let o = -50 - -46. Let p(z) = -4z - 8. Let y be p(o). Solve 20 = 4s, 0j - y = -j - s for j. 3 Let t be (-240)/560(1 + -8). Solve 5h + m + 21 = 0, -3m + t = h + 10 for h. -4 Suppose -15 = -3r - 3. Suppose 13c = 11c + r. Solve -cl - 10 = 3p, p - 5 = l - 3p for l. -5 Suppose -4v - 3l + 7 = -32, 4l = v - 24. Suppose -3j + 9j = v. Solve q = 3w + 14, -jw + 2 = -2q + 18 for q. 5 Let t be (10 - -2) + 3/1. Let h = 15 - t. Suppose -2p - p + 9 = h. Solve 5g - 20 = s - ps, -4g + 16 = s for s. 0 Suppose 6g = 5g + 2. Suppose -2d = -38 + g. Let l be 12/d - 14/(-6). Solve 5r + 21 + 5 = -3x, -3r - 6 = -lx for x. -2 Let h = -183 - -190. Solve m - 12 = -3i, -hm + 8 = -3m + 2i for m. 0 Suppose -3w + 13 - 1 = 0. Suppose 0h - wh = 0. Suppose 5n + 9 + 2 = -3j, -5j - 2n + 7 = h. Solve 4r + b + 4 = -b, 0 = 3r + jb for r. -2 Suppose 5b = 3c + 2c - 20, 9 = 4c + 3b. Suppose -cl = -l + 2. Let q(s) = -6s - 2. Let f be q(l). Solve 0 = -3x + 7 - f, -5x + 25 = -4i for i. -5 Suppose -2l = 3w - 41, 4w - 3l + 7l - 48 = 0. Solve 0y - 2y = 5a - w, -a = -5y + 2 for a. 3 Let g = 1114 + -1112. Solve 11 = 4j - 5t, -10 = -j + 3t - g for j. -1 Let x be 1 + (-4)/3 + (-1075)/(-75). Solve -v + 5 = a + 1, -a + 5v = x for a. 1 Suppose 5z - 54 = -3v - 36, -2z + 9 = 3v. Solve 2p + 2t - 6 = 0, 15 = 5p - t + zt for p. 3 Let i(y) be the third derivative of -y5/60 - 3y*4/8 + 2y*3 + 5y*2. Let g be i(-9). Solve 3d = -3x, -3d = -4d - 4x + g for d. -4 Let b be (2 + 10)(-6)/4. Let c = b + 27. Solve -2z + 4j = -4z + 12, 3j = -z + c for z. 0 Suppose 3z = 0, 0 = 5n - 13z + 17z - 125. Solve 4d = 2c + 26, 20c - 17 = nc + 2d for c. -5 Let l be 4/14 - 30/105. Solve -h + 2q + 8 = -3h, l = -2h + 2q for h. -2 Let j = -57 + 55. Let o be (-15)/(-4) + -1 - j/8. Suppose 3v - v = 8. Solve -2k + n - o = 0, 9 = vk - 5k + 3n for k. 0 Suppose 2k - 5l = 266 - 223, -5k - 5l = -160. Solve -p + 4p = -4w + k, -3p = w - 14 for w. 5 Suppose -2x = -2 - 2. Let d be (-14)/63 - (-146)/9. Let a = 739 + -734. Solve v = -s + x, s - 2s - d = -av for s. -1 Suppose 12 = 5v + l, 4v + 3l - 1 - 2 = 0. Suppose 5b + vb = 16. Solve -5t - 27 = -h, t - h = -5 - b for t. -5 Suppose -5l + 100 = 20l. Solve 0 = -d + a + 6, 10 = la - 6a for d. 1 Let t(q) = 2q*2 + 14q - 30. Let j be t(-9). Let a(x) = 4x + 25. Let w be a(-6). Solve l - 5m - w - j = 0, 9 = 5l + m for l. 2 Suppose 16 = 12l - 8l + 4w, -2l + 16 = 4w. Solve l = -3p + 5i - 28, -5p + 0p + 15 = 4i for p. -1 Let y(b) = b2 - 5b + 3. Let p be y(3). Let j be (4 - -6)p/(-2). Solve 5v + 0f = -f + j, 2v - 29 = -5f for v. 2 Suppose z - 1 = -2q, 3z + 7q = 2q - 2. Let r = -6 - z. Let t be 1 - 1 - (-12 - -9). Solve 0j = -2p - j + 13, tp + rj = 27 for p. 4 Let r = 134 + -130. Solve 3s = 9, 3 = n + rs - 14 for n. 5 Let o = 23 - 15. Let f = 11 - o. Solve 0 = -4g + g + 2h, -5g - fh = 0 for g. 0 Suppose -5c + 40 = -c. Let q = 5 + c. Suppose 6h = h + q. Solve -3o - 3l - 24 = 0, 0l = -3o + hl - 6 for o. -5 Let i be (-8)/(-20) - (-84)/15. Let o = -4 + i. Solve 2s = 5s + g + 8, -2s - 4g = o for s. -3 Let v(r) = -r + 2. Let u be v(-2). Let j be (-225)/30u/(-6). Suppose -4x - 1 = 3h - 13, 0 = -jx - 2h + 15. Solve -xf - 2 = i + 14, 5i + 24 = -f for f. -4 Suppose 8p = 33p - 50. Solve 5o - pj = -19, 1 + 0 = -3o - 4j for o. -3 Let g = -2787 + 2787. Solve 5n - 2w = 1, -10 = n + 3w - g for n. -1 Let r be ((-30)/21)/((-75)/840). Solve -3u + r = 3p + 13, 3p + 2u = 0 for p. -2 Let c(j) = -2j + 71. Let g be c(34). Solve 0 = -4v - 3h - 3, -gh = -v - 12 for v. -3 Let d be -4 - (-2 - 7/1). Suppose 147 = 3h + 27. Solve 0 = -dm + 4g + h, 3g + 4 = -5m + 9 for m. 4 Suppose 2x = -3x + 75. Let s be (x/(-35))/(4/(-28)). Solve 2h - 2 = -0j - sj, -4h - j = 16 for h. -5 Let m(i) = i3 - 3i*2 - 4i + 2. Let l be m(4). Let y be 19/19 - (0 - 11). Suppose 26j = 30j - y. Solve jn - r = 7n - 6, -2n + 2r - l = 0 for n. 1 Let j = -280 - -285. Solve -x = 4k + 3x, jk = -3x - 6 for k. -3 Let x(n) = -n*2 - 32n - 251. Let l be x(-17). Solve 5k - 9 = -4m, 3m - lm + 3 = 2k for m. 1 Let j(z) = -3z*2 + 3z + 33. Let w be j(7). Let v = -68 - w. Solve 4d + 3x + 1 = 5d, 5x - v = -5d for d. 4 Suppose 19m - 83 = 31. Solve mf + 4c - 8 = 3f, 0 = 3f + 2c - 10 for f. 4 Let x be 25/2 + 1/2. Suppose -3o + 11 + x = 0. Suppose t = -4s - 10, 3s + o + 1 = 0. Solve 28 = 3j - 5b, 0j - 12 = -2j + tb for j. 1 Suppose 0 = 4c - h - h - 8, 0 = 4c + 2h - 24. Let r be 6 + 0 + c/2. Solve s - 5w + 7 = 0, -4s = -rs - 4w - 4 for s. -2 Let q(y) = y - 4. Let a be q(4). Suppose s - 7 = -2o, -2s - 10 = 18o - 22o. Solve ab + 11 = -og - b, 5b = 3g + 35 for g. -5 Let u(f) = -f*2 - 5f + 3. Let m be u(-5). Suppose -56 = -7o + mo. Solve 5t = -2w, 4w + 2t + o = 6w for w. 5 Let o(s) = -s3 + 3s*3 + 111s*2 + 1 - 3s*3 + 15s - 125s2. Let g be o(-15). Solve 0 = 3a - 6a + m + g, 4a - 6 = -m for a. 1 Let f = 740 - 740. Solve 2t = -2k, -k + f*k + t = -4 for k. 2 Let j(a) be the third derivativ	{ "pile_set_name": "DM Mathematics" }
c Which is the closest to -1? (a) 3 (b) -0.5 (c) 0 (d) 4 (e) 1/390 b What is the nearest to -1 in -15, 38, -974, 2/11? 2/11 What is the closest to 12.7 in 3, 15, 0.5, 0.2, 7/6, -1/4? 15 Which is the nearest to 2.1? (a) 3/4 (b) -15.91 (c) -4/9 a Which is the nearest to -0.13? (a) 0.018 (b) -12 (c) 1/7 (d) -1/5 d Which is the nearest to -3/9400? (a) 0.3 (b) 5 (c) 3 (d) 1/9 (e) 8 (f) -2 d Which is the nearest to 3/4? (a) -2/21 (b) 20 (c) 1058 (d) 5 (e) 0.3 (f) -5 e Which is the nearest to 51? (a) 0.7 (b) -1.324 (c) 0.2 a What is the closest to 9 in -5477, -6.3, 0.2? 0.2 Which is the nearest to -3.2? (a) 2 (b) 7 (c) 11 (d) -0.01 (e) 5 d Which is the nearest to -0.1? (a) 19 (b) -1 (c) 0.3 (d) -10185 (e) 0 e Which is the nearest to 7? (a) 0.2 (b) 3 (c) -13 (d) 0.3 (e) 10518 b What is the nearest to 0.4 in 875, 0.15, 4? 0.15 What is the nearest to -0.4 in 0, 1/155, -0.2, 1/9, -0.43, 2.5? -0.43 What is the nearest to -166730 in -2, -12, 10/7? -12 Which is the nearest to -3.1? (a) -4/9161 (b) 1 (c) -27 a Which is the closest to -2/3? (a) -7784 (b) -3 (c) -43 (d) 0.1 d What is the nearest to -1 in -727, -3/5, -1211, -0.8, 0? -0.8 Which is the closest to -105821? (a) 0.9 (b) -2/5 (c) -3/4 (d) 4 c Which is the closest to 2/7? (a) -17 (b) -1/12 (c) 836 (d) 0.12 (e) 0 d What is the nearest to 10.4504 in -3/23, 1, -7? 1 What is the nearest to 12958 in 3, 4, -0.3, -2/3, -0.2, 0.15? 4 Which is the nearest to 415? (a) -0.018 (b) -40/11 (c) 3 (d) -2 (e) -0.3 (f) 0 c What is the closest to -0.6 in 21, -2, 1860, -10/3, -3/5? -3/5 What is the closest to 2/7 in -1/4, 0.5, 2426, 2/29, -1? 0.5 What is the nearest to -0.233 in 0.7064, 1/3, 3/8? 1/3 What is the nearest to 0.4 in 6, -1224, 352? 6 Which is the nearest to 0.3? (a) 240 (b) 6/11 (c) 3 (d) -1/423 (e) -7/2 b What is the closest to 388 in 2/7, -2/9537, 5? 5 What is the closest to -18 in 0.5, 33/133, 0.8, 1? 33/133 Which is the nearest to -1? (a) 4 (b) 1 (c) -4421 (d) -5/3 d What is the closest to 1 in -312, 1.2, -3/14, 1/4? 1.2 Which is the nearest to 0.1? (a) 0 (b) 28 (c) -28/45 a What is the closest to -1/20 in 0, 4/1163, 5/3? 0 What is the nearest to 0 in 2/37, -10, -2.6, -908? 2/37 Which is the nearest to -2? (a) 2 (b) 5/6 (c) -1/14 (d) 2.2 (e) -2/3 (f) -0.28 e Which is the closest to -3? (a) 3/14 (b) 0.2 (c) 210 (d) -0.5 d What is the nearest to -29154 in -3.92, -1/8, 3, 4? -3.92 What is the nearest to 3/4 in 1/6, 90.4, -1, -161? 1/6 What is the closest to -0.03 in -6, -0.1055, -0.4? -0.1055 What is the closest to -1/2 in 3.943, -5, 218? 3.943 Which is the closest to -3? (a) -4 (b) 11 (c) -1977 a Which is the closest to -0.3? (a) 1/6 (b) -1/2 (c) -2 (d) -57/37 (e) 3 b Which is the nearest to 0? (a) -2 (b) -2/51 (c) -3/5 (d) -0.07 (e) 0 e Which is the closest to -1/3? (a) 3 (b) -1 (c) -570/13 (d) 9 (e) -24 (f) -2/5 f Which is the nearest to -1? (a) 0.2 (b) -79 (c) -0.11 (d) -0.0386 (e) 0.5 c What is the nearest to 2 in -2/33, -56/9, 0.1, 0, 8/17? 8/17 Which is the nearest to 95? (a) -0.4 (b) -36/5 (c) -8 (d) 3 (e) 0.2 d Which is the nearest to -5? (a) 3.8 (b) -4 (c) -91 (d) 327 b Which is the nearest to 531? (a) 0.9 (b) 2/7 (c) 0.4 (d) -1 (e) -8 (f) -0.1 a Which is the closest to -12? (a) 6/29 (b) 1/8 (c) -3 (d) 4 (e) 1/3 c Which is the closest to 2/7? (a) 1/6 (b) 1/142 (c) 90 (d) 3 (e) 2 a Which is the closest to -0.2? (a) -380 (b) -0.5085 (c) -2/13 c What is the closest to 0.3 in -3.5, -2/11, -26, 267, 0.5? 0.5 What is the closest to -1/3 in -5, 1/5, 23, 2/11, -131? 2/11 What is the nearest to -1/3 in 1, 52/437, 0.1? 0.1 What is the closest to 2 in -5, 0, -0.3, -1, 16770, -1.9? 0 Which is the closest to 1/3? (a) -5 (b) -1 (c) -0.2 (d) -0.5465 (e) -5/4 (f) 0.5 f Which is the closest to 3/5? (a) 219/2 (b) -0.05 (c) 2/63 (d) 14 c Which is the nearest to 215? (a) -1/2 (b) -2/9 (c) 0.4 (d) 15/194 c Which is the nearest to 0.076? (a) -1.5 (b) 0.1 (c) 36867 b What is the closest to 0 in -0.4, 484, 0, 3/5, 2.7, -5.2? 0 Which is the closest to -1? (a) 492 (b) 62 (c) 5 (d) -33 c What is the nearest to 2/3 in -4177/6, 1/33, -1, -1/2? 1/33 Which is the nearest to -2? (a) 36 (b) -1/7 (c) 2/13 (d) -3 (e) 8/5 (f) -5 d Which is the closest to 27416? (a) -2 (b) 2 (c) 5/7 (d) -5 (e) -1/2 b Which is the closest to -0.02? (a) 636043 (b) 1/4 (c) 3 (d) -0.01 (e) -2/13 d Which is the nearest to 0.3? (a) 0 (b) 4 (c) -3 (d) 1286 (e) -4 (f) -2/165 a Which is the nearest to -1/4? (a) -2/73 (b) 48 (c) -4131 a Which is the nearest to 1? (a) -2 (b) 0 (c) 0.14661 (d) -1 (e) -0.3 c Which is the closest to -1? (a) -1 (b) -0.1 (c) -2/4944905 a What is the nearest to -1/4 in 1/5, -748.59, 1, 3? 1/5 What is the nearest to 17 in 16.169, -1, 0, -0.5, 1? 16.169 Which is the nearest to 76? (a) -5 (b) -1 (c) 9/415 (d) 2/9 (e) -0.1 d Which is the nearest to -461? (a) -65 (b) -2/27 (c) -0.3 (d) -2/7 a Which is the closest to 2? (a) 3 (b) 12/13 (c) -4/807 (d) 0.2 a Which is the closest to -2? (a) 0.5 (b) 45 (c) -3/7 (d) 290 c What is the closest to 0.52 in -0.297, 0.4, 1/4, 3, 1/9? 0.4 Which is the nearest to -13/6? (a) 0.5 (b) 17326 (c) 2/7 c Which is the nearest to 108? (a) 4 (b) 0.3 (c) -0.23 a Which is the closest to -1? (a) 3 (b) 2/17 (c) -4/23155 c What is the closest to 1/46 in 1/2, -9765, 12, -1/5? -1/5 What is the nearest to -0.08 in 1/7, -3, -4, 9/44? 1/7 What is the nearest to 2/4373 in 0.08, -5.1, 1? 0.08 Which is the closest to 0.1? (a) -1 (b) -630349 (c) 9/2 a Which is the closest to -834? (a) 1 (b) 7 (c) 7/10 (d) 2 (e) -2/15 e What is the nearest to 3526 in -5, -3, -4, 0.16, -8? 0.16 What is the closest to 1 in 1, -4, 2/105, -1/1603, 0.5? 1 What is the closest to 1/3 in 0, -1617, 157? 0 Which is the closest to 0? (a) 23 (b) -6 (c) -1/24 c Which is the closest to 0? (a) 3/7 (b) 3081 (c) -21 (d) 1 (e) 1/6 e What is the closest to -8 in 2, -4, 0.068, 47? -4 What is the nearest to 442 in -3, -1/6, 0.3, -29.7? 0.3 What is the nearest to 1115 in -2/5, -143, 4? 4 Which is the nearest to 9? (a) -119 (b) -0.01 (c) -0.4 (d) -76 (e) -5 b What is the nearest to 0.03 in -2.3, 5, 13420, -0.04? -0.04 Which is the closest to -0.2? (a) -7 (b) 1.1853 (c) -2/3 c What is the closest to -111 in 4, -2, 5, -3, 2/3, 26/53? -3 What is the nearest to 135 in -40, -1/244, 2? 2 Which is the nearest to 61? (a) 0 (b) -2/7 (c) 206 (d) 8 (e) 0.4 (f) -0.1 d Which is the nearest to -2/5? (a) 18/19 (b) 2 (c) -33/455 (d) 3/2 c Which is the nearest to 1/9? (a) -19 (b) -1 (c) -7/10 (d) -9 (e) -0.1 e Which is the nearest to -3? (a) 4 (b) -56241 (c) -13 (d) 1/6 d What is the nearest to 2 in -16419, 88, 2? 2 What is the closest to -42 in -231467, -11, 2/3? -11 Which is the nearest to 1/2? (a) 353 (b) 3/7 (c) -0.25 (d) -40 b Which is the nearest to -2/3? (a) 33 (b) 0.529 (c) 0.3 (d) -0.3 (e) 2/19 d Which is the nearest to 9985? (a) -2/3 (b) -0.3 (c) -21 b Which is the nearest to -1? (a) -9 (b) 20 (c) 5/14 (d) -24.2 (e) 4/7 c What is the closest to 2 in 13321, 9, 8/7? 8/7 Which is the closest to -1/3? (a) -4 (b) 1 (c) -4951 (d) 675 b What is the nearest to -1 in -3/5, 141810, 0.3? -3/5 Which is the nearest to -2/117? (a) -2 (b) 1 (c) -1/20 (d) 7039 c What is the nearest to 6.626 in 0.1, 4/5, 284? 4/5 What is the nearest to 1.218 in 10, 2/13, -11, -2.3? 2/13 What is the closest to 0.2 in 18, 0.9, 1820/9, -3/5? 0.9 What is the closest to 41612/5 in 1/8, -1/7, -73? 1/8 What is the closest to 6 in 4.51, 4, 5, -3, -0.3? 5 What is the nearest to -2 in 16, -5, 11082/13, -3, -0.2? -3 Which is the closest to -1? (a) -99 (b) -13 (c) -223 (d) 3/7 (e) -0.4 e What is the nearest to 3 in 10, -9, 2/11, -1/7, 2.8? 2.8 What is the nearest to 3342 in -5, 5.2, 3/8, 3/10? 5.2 What is the closest to -48539 in 0.5, 2/21, 0.3? 2/21 Which is the closest to 2/9? (a) -9 (b) -2 (c) 5 (d) 2.1 (e) 1190 d What is the closest to 2 in 1/10, -1, -73, 344? 1/10 What is the closest to -0.14 in -1, -5, 7, 268, 0.2? 0.2 Which is the nearest to 3? (a) 16 (b) 2/3 (c) 10067 (d) -1 (e) 4 e Which is the closest to 8?	{ "pile_set_name": "DM Mathematics" }
t 217 (base 8) to base 11. 120 Convert -a (base 11) to base 3. -101 What is 10011 (base 3) in base 8? 125 Convert 4 (base 14) to base 4. 10 What is 1 (base 8) in base 7? 1 -37 (base 16) to base 14 -3d What is -10111 (base 2) in base 11? -21 -24 (base 7) to base 12 -16 -123 (base 8) to base 7 -146 53 (base 13) to base 14 4c What is 1111 (base 3) in base 8? 50 1 (base 10) to base 16 1 Convert 4 (base 12) to base 16. 4 Convert -1 (base 12) to base 7. -1 Convert 40 (base 6) to base 16. 18 Convert -32 (base 7) to base 3. -212 What is 232 (base 5) in base 14? 4b Convert a (base 11) to base 13. a Convert 100 (base 2) to base 11. 4 What is -18 (base 9) in base 10? -17 3 (base 16) to base 11 3 What is 101 (base 3) in base 9? 11 What is 6 (base 12) in base 14? 6 2 (base 3) to base 15 2 What is 144 (base 16) in base 5? 2244 42 (base 9) to base 11 35 What is 312 (base 6) in base 11? a6 Convert 144 (base 5) to base 6. 121 1011011 (base 2) to base 15 61 11 (base 5) to base 4 12 Convert 1 (base 16) to base 12. 1 102 (base 3) to base 12 b Convert 217 (base 11) to base 7. 521 0 (base 8) to base 9 0 Convert 131 (base 5) to base 3. 1112 What is 1233 (base 6) in base 9? 373 What is -44 (base 14) in base 11? -55 Convert 5 (base 8) to base 6. 5 What is -1 (base 4) in base 7? -1 Convert 521 (base 6) to base 7. 364 What is 2 (base 11) in base 13? 2 d (base 15) to base 12 11 4 (base 13) to base 7 4 What is 10 (base 3) in base 7? 3 Convert a1 (base 14) to base 4. 2031 201 (base 6) to base 3 2201 What is 23 (base 16) in base 13? 29 0 (base 10) to base 8 0 10 (base 3) to base 5 3 31 (base 8) to base 13 1c What is -345 (base 7) in base 9? -220 Convert -166 (base 8) to base 5. -433 What is bf (base 16) in base 14? d9 -b (base 15) to base 16 -b What is -fe (base 16) in base 10? -254 6 (base 11) to base 3 20 Convert 13 (base 14) to base 11. 16 Convert -3e (base 16) to base 7. -116 14 (base 10) to base 7 20 Convert 11000 (base 2) to base 12. 20 Convert 33 (base 5) to base 14. 14 26 (base 14) to base 9 37 What is -59 (base 14) in base 16? -4f Convert 3 (base 9) to base 16. 3 What is -1 (base 8) in base 3? -1 Convert 4 (base 16) to base 2. 100 Convert -19a (base 11) to base 6. -1022 What is -36 (base 7) in base 13? -21 -15 (base 9) to base 6 -22 -1 (base 15) to base 14 -1 Convert 11 (base 16) to base 11. 16 Convert 1010000 (base 2) to base 3. 2222 Convert -11 (base 16) to base 3. -122 -1 (base 15) to base 10 -1 What is 10c (base 14) in base 13? 130 What is 9 (base 15) in base 14? 9 What is 1 (base 6) in base 16? 1 What is -6 (base 9) in base 14? -6 2 (base 11) to base 12 2 -12 (base 8) to base 12 -a What is -1 (base 16) in base 12? -1 What is -c4 (base 14) in base 3? -20101 41 (base 15) to base 11 56 Convert 3 (base 8) to base 14. 3 0 (base 12) to base 6 0 Convert 7 (base 8) to base 9. 7 Convert -2b (base 12) to base 10. -35 6 (base 16) to base 11 6 Convert -11 (base 8) to base 9. -10 What is 2002 (base 4) in base 2? 10000010 2b (base 12) to base 11 32 Convert 17 (base 9) to base 16. 10 What is 13 (base 10) in base 5? 23 Convert 13 (base 12) to base 2. 1111 What is 63 (base 7) in base 4? 231 Convert 96 (base 13) to base 3. 11120 What is -1 (base 11) in base 8? -1 What is -1211 (base 3) in base 15? -34 What is -20 (base 15) in base 9? -33 -28 (base 11) to base 4 -132 8 (base 10) to base 3 22 Convert -3 (base 11) to base 12. -3 Convert 350 (base 10) to base 15. 185 What is 14 (base 15) in base 2? 10011 -1 (base 4) to base 15 -1 443 (base 7) to base 10 227 1 (base 2) to base 8 1 1 (base 10) to base 5 1 What is 6 (base 9) in base 15? 6 Convert b (base 16) to base 15. b What is -27 (base 11) in base 9? -32 Convert -13 (base 12) to base 14. -11 What is -10010 (base 2) in base 16? -12 Convert -20 (base 4) to base 15. -8 What is -c (base 13) in base 5? -22 -122 (base 6) to base 14 -38 Convert -5 (base 16) to base 14. -5 -11010 (base 2) to base 8 -32 -20 (base 8) to base 6 -24 Convert -1 (base 11) to base 13. -1 101 (base 2) to base 9 5 What is 3 (base 13) in base 15? 3 What is 15 (base 7) in base 12? 10 What is 14 (base 7) in base 5? 21 Convert 5 (base 11) to base 8. 5 -3 (base 5) to base 6 -3 Convert -466 (base 7) to base 10. -244 What is 4 (base 16) in base 11? 4 Convert 7 (base 13) to base 15. 7 Convert a5 (base 13) to base 4. 2013 What is -16 (base 16) in base 11? -20 What is 0 (base 9) in base 16? 0 What is 4a (base 11) in base 4? 312 Convert -11 (base 10) to base 6. -15 1001011 (base 2) to base 3 2210 Convert -1 (base 16) to base 2. -1 -18 (base 11) to base 16 -13 40 (base 7) to base 2 11100 Convert -3 (base 8) to base 12. -3 Convert 7 (base 10) to base 14. 7 What is 3 (base 12) in base 16? 3 Convert 195 (base 10) to base 15. d0 What is 10011000 (base 2) in base 16? 98 Convert -6 (base 11) to base 14. -6 Convert -17 (base 16) to base 5. -43 What is 3 (base 15) in base 2? 11 15 (base 8) to base 3 111 What is 8 (base 9) in base 3? 22 Convert 10 (base 6) to base 15. 6 What is -10101 (base 2) in base 3? -210 -19 (base 12) to base 10 -21 What is 120 (base 12) in base 5? 1133 -133 (base 5) to base 3 -1121 Convert 105 (base 14) to base 13. 126 What is e (base 15) in base 7? 20 What is 10 (base 3) in base 4? 3 What is -3 (base 16) in base 9? -3 Convert -4 (base 9) to base 16. -4 What is 10 (base 3) in base 4? 3 Convert -3 (base 5) to base 11. -3 What is 12 (base 9) in base 4? 23 -2031 (base 5) to base 3 -100212 Convert 91 (base 16) to base 9. 171 Convert 10010 (base 2) to base 13. 15 Convert 1 (base 16) to base 11. 1 Convert 1 (base 9) to base 15. 1 What is 31 (base 15) in base 16? 2e -95 (base 14) to base 12 -ab 75 (base 12) to base 15 5e Convert 334 (base 6) to base 14. 94 Convert -8 (base 16) to base 3. -22 What is -1 (base 13) in base 4? -1 Convert 0 (base 3) to base 8. 0 -17 (base 8) to base 3 -120 Convert 15 (base 12) to base 8. 21 Convert 3 (base 12) to base 13. 3 Convert -120 (base 3) to base 14. -11 What is 124 (base 10) in base 2? 1111100 Convert 30 (base 5) to base 4. 33 -3 (base 14) to base 16 -3 Convert -3 (base 5) to base 15. -3 -2 (base 16) to base 4 -2 What is -1000 (base 3) in base 15? -1c Convert 3 (base 13) to base 16. 3 What is -134 (base 6) in base 16? -3a What is 63 (base 15) in base 12? 79 -410 (base 6) to base 13 -b7 Convert -1103 (base 5) to base 3. -12200 -65 (base 7) to base 3 -1202 What is 30 (base 5) in base 4? 33 Convert -19 (base 10) to base 4. -103 Convert 0 (base 11) to base 3. 0 Convert -102 (base 5) to base 2. -11011 Convert -40 (base 5) to base 9. -22 What is 39 (base 16) in base 15? 3c What is 15 (base 14) in base 4? 103 -4 (base 15) to base 16 -4 101 (base 2) to base 4 11 Convert 64 (base 8) to base 6. 124 2 (base 3) to base 8 2 What is 1102 (base 4) in base 13? 64 Convert 1132 (base 4) to base 10. 94 What is -7 (base 15) in base 16? -7 What is 42 (base 7) in base 8? 36 What is -2 (base 7) in base 13? -2 Convert 2 (base 4) to base 10. 2 What is -110 (base 5) in base 8? -36 What is 0 (base 16) in base 7? 0 Convert -1 (base 4) to base 2. -1 -356 (base 7) to base 14 -d6 -a (base 14) to base 6 -14 What is 15 (base 10) in base 14? 11 Convert -50 (base 9) to base 8. -55 Convert -20 (base 14) to base 5. -103 What is a8 (base 15) in base 2? 10011110 Convert -54 (base 11) to base 15. -3e 2 (base 6) to base 13 2 Convert 4 (base 7) to base 3. 11 Convert 10101 (base 2) to base 11. 1a What is 4 (base 14) in base 11? 4 Convert 3 (base 16) to base 7. 3 What is -7 (base 8) in base 16? -7 Convert 2 (base 9) to base 11. 2 Convert -3 (base 13) to base 12. -3 Convert 10 (base 4) to base 9. 4 -1a (base 11) to base 14 -17 What is 3 (base 7) in base 11? 3 -3 (base 10) to base 4 -3 33 (base 8) to base 5 102 Convert -2 (base 5) to base 15. -2 What is 32 (base 4) in base 2? 1110 Convert 10 (base 3) to base 13. 3 -1 (base 12) to base 5 -1 -11 (base 9) to base 6 -14 1a (base 16) to base 7 35 What is 7 (base 8) in base 6? 11 Convert 130 (base 5) to base 12. 34 Convert -2 (base 6) to base 5. -2 Convert 0 (base 14) to base 4. 0 c (base 16) to base 14 c -6 (base 8) to base 5 -11 What is -13 (base 5) in base 15? -8 Convert 0 (base 3) to base 11. 0 10 (base 2) to base 5 2 What is -14 (base 7) in base 9? -12 What is -201 (base 5) in base 7? -102 9a (base 14) to base 6 344 What is	{ "pile_set_name": "DM Mathematics" }
64 - -86. Let a = q - 18. Suppose 73 = w - k - 50, w - 138 = ak. What are the prime factors of w? 2, 59 Let l(o) = 580o - 648. List the prime factors of l(20). 2, 37 Suppose -53d + 230912 = -8d - 87148. List the prime factors of d. 2, 3, 19, 31 Suppose 15 = -v + 3i, 4v = 5i - 4i - 5. Suppose v = -8c + 13c - 10. Suppose cf = 42 + 20. List the prime factors of f. 31 Let n(l) = -3l3 - l2 - 1. Let i be n(1). Let x(c) = -235c - 2. Let z(q) = -470q - 3. Let r(s) = ix(s) + 3z(s). What are the prime factors of r(-1)? 2, 59 Let r(y) = -7y2 - 45y - 77. Let m be r(-19). Let g = m + 3075. What are the prime factors of g? 2, 3, 13, 17 Suppose -25551 = 428l - 445l. What are the prime factors of l? 3, 167 Let z = 33829 + -28545. What are the prime factors of z? 2, 1321 Let u = 8344 + -1042. What are the prime factors of u? 2, 3, 1217 Let a(u) = 7u2 + u + 427. Suppose 6k - 10 = 3k - 2n, 3k - 4n + 20 = 0. List the prime factors of a(k). 7, 61 Suppose -2v + 0v = 5t - 10, 2v = 2t - 4. Suppose v = -19f + 18f + 4. Suppose -fu + 692 = 4s, u - 2u = 2s - 345. What are the prime factors of s? 2, 43 Suppose 0l - c - 15 = 4l, 0 = -c - 3. List the prime factors of 4/(-6)l - (-275 + 8). 269 Suppose g - 13 + 15 = 0. Let c be 4/32746 - g/(-8). Suppose -s + c = 12. List the prime factors of s. 3 Let c = 1003 - 1006. What are the prime factors of -8 - (-156)/18 - 2326/c? 2, 97 Let w = 913 - -4025. Suppose -12520 = -17a - w. What are the prime factors of a? 2, 223 What are the prime factors of 462/(-308)10780/(-6)? 5, 7, 11 Let o be 11/((-5)/(-2)(-34)/(-85)). Suppose -1705 = -16h + oh. List the prime factors of h. 11, 31 Let j = -3033 - -3036. Suppose 2z - 39 = -z. Suppose -349 = -jt - z. What are the prime factors of t? 2, 7 Let o(f) = -5 + 35f3 - 1 - 30f*3 + 6f - 5f2. What are the prime factors of o(5)? 2, 131 Suppose -2z + 139 = 5i - 2i, 0 = -z - 2i + 71. Suppose -56m = -zm + 5445. List the prime factors of m. 5, 11 Suppose s - 17 = -1. Suppose -5957 = -sj - 7j. List the prime factors of j. 7, 37 List the prime factors of (64/10 + 0)/((-421)/(-593610)). 2, 3, 47 Suppose j + 352 = 2z + 64, 720 = 5z + 4j. Let f = z + -70. List the prime factors of 3/(-6)(0 - f). 37 List the prime factors of 6/(-123) + 5543739/123. 13, 3467 Let c(o) = 10061 - 10117 + 710o - 47o. List the prime factors of c(2). 2, 5, 127 Let k be ((-3)/9)/(-26/756). Let h = 355 - k. List the prime factors of h. 2, 167 Suppose -558u = -521u - 472971. What are the prime factors of u? 3, 4261 Let p be (-38)/19 - (-4 + (2 - 0)). Suppose 6a - 294 = -pa. List the prime factors of a. 7 Suppose 16 = -3v + 5v - 4s, 3s + 22 = 4v. Suppose 4r + 7k - 536 = 3k, -4k - 552 = -vr. Suppose 5d - r = d. List the prime factors of d. 2, 17 Suppose 59q - 656640 = 39q. Suppose -q = 4l - 28l. List the prime factors of l. 2, 3, 19 Let y = -65 + -542. Let t = y - -1003. What are the prime factors of t? 2, 3, 11 Let h(m) = 294m - 47. Let v be h(7). Suppose -v = -2r - 595. Suppose 21p = 15p + r. What are the prime factors of p? 2, 59 Let o be (7 - 119/21)/(1/3). Suppose -9p + 5l - 850 = -11p, 0 = -ol - 16. List the prime factors of p. 3, 5, 29 Let r(y) = -851y - 149. What are the prime factors of r(-3)? 2, 601 Let z(l) = l3 + l2 - 2l - 15. Let w(g) = -g2 - g + 1. Let a = 69 + -68. Let k(m) = az(m) + 2w(m). What are the prime factors of k(6)? 11, 13 Let d(a) = 4a + 97. Let f be d(-23). Let j(q) = 3976 + fq + 18q*2 + 2q*3 + 0q*3 - 3986. What are the prime factors of j(-7)? 151 Let u(n) = 2048n*2 - 24n - 49. List the prime factors of u(-2). 8191 Suppose 147 = 29m + 2. Suppose 3a = -mr + 5616, 4a + 6r = 3r + 7499. List the prime factors of a. 1877 Let f = 36 + -39. Let n be f + ((-15)/(-10) - (-747)/2). Suppose 16g = 13g + n. List the prime factors of g. 2, 31 Let j(v) = -3v3 - v + 0v*3 + 6v*3 + 2. Let g be j(1). Suppose 6 - 66 = -gf. List the prime factors of f. 3, 5 Suppose -108d = 141d - 775635. What are the prime factors of d? 5, 7, 89 Let a = 904 + -462. Let t = a + -141. List the prime factors of t. 7, 43 Let p(f) = -200f - 191. Let w(v) = 67v + 62. Let m(h) = 2p(h) + 7w(h). List the prime factors of m(11). 811 Let w(b) = -3b2 + 10b + 2. Let r be w(5). List the prime factors of 14/(-8)(r - 505). 2, 3, 7, 11 Suppose -l + 339 - 2 = -n, -4n = 2l - 674. Suppose j - 5s = l, -j = -0j + 4s - 346. What are the prime factors of j? 2, 3, 19 Let i(v) = 63v3 - 8v*2 + 127v - 456. List the prime factors of i(9). 2, 3, 47, 163 Let s = 2618 - -2764. List the prime factors of s. 2, 3, 13, 23 Let r(z) = 2z3 + 14z*2 - 23z + 57. List the prime factors of r(13). 2, 3259 Let p(w) = 18w - 3. Let f be p(18). Suppose -12y - f - 51 = 0. Let m = y - -52. What are the prime factors of m? 3, 7 Suppose 3c - 6408 - 5307 = 0. List the prime factors of c. 5, 11, 71 Suppose -134093 = 14b - 442709. Suppose 0 = 8r + 25r - b. List the prime factors of r. 2, 167 Let g(z) = 10z + 4z - 5z + 55. Let b = 3198 - 3187. What are the prime factors of g(b)? 2, 7, 11 What are the prime factors of 14 + -4 + (440289 - 0)/9? 167, 293 Let h = 229 - 229. Suppose h = -w + 428 - 160. List the prime factors of w. 2, 67 Let f = 37973 + -14381. What are the prime factors of f? 2, 3, 983 Let o be (-99)/21 - (-2)/(-7). Let w(g) = 5 - 1458g + 1464g + g2 - 5g*2 - 2g3. List the prime factors of w(o). 5 Let s(y) = y3 + 7y2 + 6y - 5. Let c be s(-7). Suppose 81 = 2t - t. Let r = c + t. What are the prime factors of r? 2, 17 Let s(x) = 17x*3 + 13x*2 + 17x + 55. What are the prime factors of s(12)? 7, 643 Let z = 2287 - 990. Let k = z - 574. What are the prime factors of k? 3, 241 Let w(c) = c*3 + 7479. What are the prime factors of w(0)? 3, 277 Suppose 1 = 16n - 63. List the prime factors of 229 - (-2 + -9 + n). 2, 59 Suppose 3g = 104 - 5. Suppose 4r + g = -5w, -w = -3r + 2 - 3. What are the prime factors of 2/(-5) - (r/5 - 3)? 3 Let h = -46 + 79. Let n(y) = 170y + 429. Let z be n(-2). Let i = h + z. What are the prime factors of i? 2, 61 Let a(q) = 89q*3 + 10q*2 - 19q + 93. List the prime factors of a(5). 3, 17, 223 Let u = 126 + -539. Let r = -200 - u. What are the prime factors of r? 3, 71 Let p be (2 - (63 + -4))-8. Let v = p + -127. What are the prime factors of v? 7, 47 Let x(i) = i3 + 15i*2 + 5i + 10. Let m(g) = 3g - 45. Let r(h) = -10h + 136. Let a(n) = 16m(n) + 5r(n). Let p be a(-13). List the prime factors of x(p). 2, 17 Let f(r) = -2r3 + 130r*2 + 159r - 315. List the prime factors of f(63). 2, 3, 7, 29 Let u(k) = k*2 - 157k + 1251. What are the prime factors of u(-139)? 5, 61, 139 List the prime factors of (125 - 130) + 0 + (-2)/2 - -5845. 5839 Let r(g) = -g*2 - 8g - 9. Let m be r(-6). Let j be 4/(16/(-6))(-1250)/25. List the prime factors of (j + 7)(-1)/(-2)m. 3, 41 Let r(z) = -123z - 2036. What are the prime factors of r(-30)? 2, 827 Suppose -10x + 101 = -129. Suppose x = 3i + 206. Let n = i - -136. List the prime factors of n. 3, 5 Let b = -19328 + 50475. List the prime factors of b. 31147 Suppose 0 = -566g + 17g - 123g + 39961824. What are the prime factors of g? 59467 Suppose 3b - 263 = -2t + 72, -317 = -2t + 3b. Let s = t + -159. List the prime factors of s. 2 Let t be 270 + (54/2)/(-9). Suppose tk = 260k + 6888. What are the prime factors of k? 2, 3, 41 Let w be -3 - -955/15. What are the prime factors of (-4)/10 + ((-209664)/w)/(-7)? 2, 499 Suppose -2s - 10 = 0, -2 = -3u - s - 1. Suppose l + 5 = -r, 3r - ul + 5 = -5. What are the prime factors of 1028/6 + r/12? 3, 19 Let q(l) = -4l2 + 4l - 4. Let s be q(1). List the prime factors of 5 + (-5 - s) + -4 + 567. 3, 7 Let s(b) = 3b - 12. Let n be s(5). Suppose -270 = nx + 7x. Let r = x - -173. What are the prime factors of r? 2, 73 Let b(p) = -346p3 + p2 + 3p + 3. Let s(u) = 3u*3 + 2u*2 - u - 1. Let n be s(-1). What are the prime factors of b(n)? 347 Let f(r) = 26r - 7. Let u(a) = a. Let p be ((-50)/(-15) - 4)/((-4)/6). Let i(l) = pf(l) + 5u(l). List the prime factors of i(4). 3, 13 Let g(t) = 272*t - 623. List the prime factors of g(9). 5, 73 Let i = -2686 + 1577. L	{ "pile_set_name": "DM Mathematics" }
Find the common denominator of (3 + 23/(-2))(-2)/10 and 7/8. 40 Let v(l) = l3 + 7l*2 + 5l + 8. Let p be v(-6). Let h = 2 + p. Calculate the least common multiple of h and 28. 112 Suppose -2i - 4k - 5 + 1 = 0, 12 = i - 5k. Suppose ig = -g - 354. Find the common denominator of (2/4)/((-9)/g) and 79/6. 18 Let t(c) = 101c3 + 3c*2 + 2c - 6. Let d be t(-5). Let w = 276361/22 + d. Calculate the common denominator of 91/18 and w. 198 Let v(z) = -z*2 - 10z - 4. Let a be 23 - (1 - (-2 - -2)). Suppose -3w + a = -14. What is the smallest common multiple of v(-8) and w? 12 Suppose 3q + 3v + 18 = 6q, -5q = -3v - 24. Let u(t) = t*3 - 2t*2 + 2. Let k be u(q). What is the least common multiple of k - 2(-1)/(-2) and 8? 40 Let x be (11961/30)/(132/10). Let b = x - 135/4. Let y = 29/39 - -246/13. Calculate the common denominator of y and b. 33 Let j be 2/6 - (-15)/9. Find the common denominator of 0 - (2 - 194/(-20)) and ((-267)/18)/1 + j. 30 Let t be -1 + 0 - 2103/(-5). Let p = 4219/10 - t. Let l = -2314 + 4539/2. Find the common denominator of l and p. 10 What is the common denominator of 2/9 and 790/(-120) - (-2)/33? 36 Let v(k) = 9k*2 - k. Calculate the lowest common multiple of 18 and v(1). 72 Let d = -6 + 10. Suppose 2i - d - 4 = 0. What is the least common multiple of i and 16? 16 Let h = 2 - 2. Suppose h = y + 2c - 20, 3y - 85 = -4c - 29. Suppose -b + 6 = -y. What is the lowest common multiple of b and 12? 132 Let l(j) = j2 - 15j + 54. Calculate the smallest common multiple of l(12) and 15. 90 Let r = 27 - 21. Calculate the least common multiple of 2 and r. 6 Let a = -218/123 - 3199/2706. Let n = 12 + 4. Find the common denominator of a and ((-6)/5)/(n/(-6)). 220 Let i(m) = 3m2 + 3m. Calculate the lowest common multiple of i(-2) and 12. 12 Let b be ((-6)/6)/(2/436). Let r = -598/3 - b. What is the common denominator of r and -40/11? 33 Suppose i + i + 4 = 0. Let n be i2/44. Calculate the smallest common multiple of 8 and 104/6 - n/6. 72 Suppose 7b - 2b + 65 = 0. Find the common denominator of (-1052)/416 + (-2)/b and 133/18. 72 Let j = -5 - -10. Suppose -jc = 20 - 5. What is the common denominator of 20/c(-28)/(-48) and 59/2? 18 Suppose -21 = k - 4k. Suppose 5s - 8 - k = 0. Calculate the smallest common multiple of 22 and 19 - 1 - (s + -1). 176 Let t = -3244 - -25895/8. Calculate the common denominator of t and (2/(-24))/((-2)/(-28)). 24 Suppose q + 3q - 36 = 5k, 4q + k = 12. Calculate the lowest common multiple of 7 and q. 28 Let b(q) = -q3 - 3q*2 + 9q + 10. Let u(y) = 3y - 2. Let g be u(-2). Let k be b(g). Calculate the smallest common multiple of (-1)/6 + k/36 and 5. 35 Let k be (-3 - 2)(-6)/(-5). Find the common denominator of (-4)/k - (-43)/(-6) and 99/20. 20 Suppose 4s = -5n + 14, 0 = 5s - s - 3n + 2. Suppose i - s = -0i. Calculate the common denominator of (5/42)/(i/51) and -63/20. 140 Suppose 4b + 1494 = 3b. Let p = 11971/8 + b. Calculate the common denominator of p and -21/10. 40 Let x = -25 - -37. Calculate the least common multiple of 16/((-4)/x-3) and 2. 16 What is the common denominator of 119/6 and 15/45(-190)/16? 24 Let v be 4/14 + (-36)/(-21). Suppose -90 = -vd - d. Calculate the least common multiple of 4 and d. 60 Let m = -5 + 7. Suppose g + 3 = mg. Let c = g - -1. Calculate the smallest common multiple of 7 and c. 28 Suppose -2q - 41 = -3q. Let r = q - -205. What is the common denominator of 4/(-3)r/(-16) and -33/4? 4 Suppose 0 = -i - 2i + 33. Let p = -30 + 11. Let v = p + 27. What is the lowest common multiple of v and i? 88 Let j = -7 + 4. Let x be ((-10942)/j)/(8/12). Let g = 87605/16 - x. Calculate the common denominator of -151/18 and g. 144 Let n = 6139/345 - 89/5. Let y = -931/17940 + n. Let k = -2123/156 + y. Calculate the common denominator of -62/5 and k. 15 Let o(q) = -19q - 5. Let p be o(5). Let d = -5041/5 - -1005. What is the common denominator of 1765/p - (-3)/(-5) and d? 20 Let c be 1/(-289)15721/(-317). Let x = 5350172797/1131420550 + c. Let u = -2/6175 + x. What is the common denominator of -37/11 and u? 110 Let u(z) = z2 - 4z + 4. Let f = -26 - -14. Let q = -10 - f. Calculate the smallest common multiple of u(5) and q. 18 Let w = -3 + 31. What is the least common multiple of 6 and w? 84 Suppose 0 = -4n + p + 71, 0p = -3n + p + 54. Find the common denominator of -65/4 and 4 + -7 - n/2. 4 Calculate the smallest common multiple of 9 and 6 + 80/(-14) - 80/(-14). 18 Suppose -s + 0 + 7 = 0. Suppose 5y - 4 - 6 = 0. Suppose -j - 12 = -3b + 4, -2j - y = -b. What is the least common multiple of b and s? 42 Let b = 53 - 41. Suppose -10 = -f - 0f. Calculate the least common multiple of b and f/6(1 - -11). 60 Let k(d) = d*3 - 7d*2 + 8d - 8. Let v(p) = -28p3 - p2 + p. Let q be v(1). What is the smallest common multiple of (5 - q)4/6 and k(6)? 44 What is the common denominator of (-10)/45 + 845/36 and 31/9? 36 Suppose -5i - 139 = 1001. Let m = i - -162. What is the common denominator of 81/8 and (-1 + -1)/(m/(-111))? 88 Let y(x) = -x2 + 6x - 6. Let z be y(5). Calculate the smallest common multiple of z2121/(-22) and 5. 55 Let d = -42 + 68. What is the smallest common multiple of d and 10? 130 Suppose 0 = 3v + y - 26 + 1, -4 = 2y. Suppose -6 - 9 = -3n. Calculate the smallest common multiple of n and v. 45 Calculate the least common multiple of 4/(-5)(845/(-10) - -2) and 14. 462 Let y be (1 - -25)/(4/33). Let p = -1223/6 + y. Find the common denominator of -1 + 3 - 2/(-8) and p. 12 Calculate the lowest common multiple of 20/35 - 680/(-35) and 86. 860 Suppose 3y + 4 = -4f, -2y + 5 = -f + 15. Let l = -4 + f. Let r = 8 - l. What is the least common multiple of 6 and r? 30 Calculate the common denominator of -71/4 and 6320/(-96)1/(-60). 72 Let x = -1585/12 + 10405/84. Calculate the common denominator of x and -61/8. 56 Let s = -243/20 - -87/5. Find the common denominator of s and (3/(90/25))/((-4)/90). 4 Let j(p) = -3 + 6p2 + p3 - 2p2 + 4 - p2. Let l be j(-2). Suppose 5s = -5n + 75, -ls - 3 - 12 = -4n. What is the lowest common multiple of n and 8? 40 Let c be 872021/36 + -1. Let b = -2429 + c. What is the common denominator of 11/8 and b? 72 Let i(a) = a3 + 7a*2 + 2a - 4. Let u be i(-6). Suppose d + 2n - u = -d, 28 = 3d + 4n. What is the lowest common multiple of d and 38? 228 Let x = -5 + 7. What is the lowest common multiple of (-6)/4 + (-30)/(-4) and x/4 + (-38)/(-4)? 30 Let c = -2/633 - 15178/4431. Calculate the common denominator of c and 73/6. 42 Let g = 132 + -345/2. What is the common denominator of 0 + 1 - (-144)/(-21) and g? 14 Let x(h) = 2h*2 + 9h + 14. Let i be x(-6). Suppose 0 = 5p - 3j - 54, 0p - i = -3p + 2j. Calculate the lowest common multiple of p and 6. 12 Find the common denominator of ((-8)/(-33))/((-5)/20) and 23/30. 330 Let d(t) = t3 - 2t*2 + 7t + 5. Suppose -3k - 24 = -4p + 2k, 0 = -k + 4. What is the lowest common multiple of d(0) and p? 55 Let p(i) be the third derivative of -i4/24 + i3/6 + 2i*2. What is the least common multiple of p(-5) and (1 - 2)-15? 30 Let r(j) = -3j - 11. What is the lowest common multiple of r(-9) and 2? 16 Let q = 2277/1090 + 6/545. Let m = 407845 - 1646567/4. Let d = m - -3817. Calculate the common denominator of d and q. 20 Calculate the common denominator of -79/4 and -2 - 15/(-10) - 13. 4 Suppose 8 = 3s - 2s. What is the smallest common multiple of (-1)/(0 + (-2)/12) and s? 24 Let v = -2633 + 18469/7. Calculate the common denominator of v and 82/7(-1)/2. 7 Let w = 6 + -2. Suppose 0n - 3n = -5i + 5, -5i - wn = -5. Find the common denominator of i and 1/3. 3 Let z = -78/77 + -683/770. Suppose -o = -2f - 12, f = -2o + 2f + 21. What is the common denominator of (-459)/(-10) + (-4)/o and z? 10 Calculate the least common multiple of 6/2 + (-10)/(-10) and 9. 36 Let g = -14293/4 - -3551. Find the common denominator of g and -65/4. 4 Let m be (-4 - -8) + 6/2. Let l = 14 - m. Calculate the smallest common multiple of l and 11. 77 Suppose -5l - 1 = -56. Let k = 3 - -1. Calculate the least common multiple of k and l. 44 Find the common denominator of -67/4 and (7 - 8)/((-22)/(-89)). 44 Let j = 93 - 193. Let n = j + 287/3.	{ "pile_set_name": "DM Mathematics" }
-14. Is s a multiple of 2? True Let c(x) = 162x - 9. Does 34 divide c(3)? False Let s(z) = z3 + 3z + 4. Let d be s(0). Suppose 0 = 4q - t - 39, -t = 2q - dq + 17. Is q a multiple of 8? False Suppose -22n + 1412 = -2460. Does 6 divide n? False Let c(m) = 51m - 282. Is 30 a factor of c(32)? True Let q(r) = 17r - 7. Let i be q(7). Suppose -2k - 59 = 2a - a, 0 = -2a - k - i. Let b = 78 + a. Is 10 a factor of b? False Let t(h) = -12 - h + 3 - 2h. Suppose -3n + 9 - 30 = -4b, 3n + 3b + 21 = 0. Does 4 divide t(n)? True Let y = -128 + 491. Is 41 a factor of y? False Let v(j) = -14j - 19. Let y be v(3). Let m = y + 113. Is 24 a factor of m? False Let b(l) be the third derivative of -l4/8 - l3/3 - 8l*2. Let a be b(0). Let r = 15 - a. Does 10 divide r? False Suppose 0 = -4g - 371 + 1347. Suppose 0 = -2w + 194 + g. Suppose w = 5t - 1. Does 11 divide t? True Let v(g) be the first derivative of 7g4/24 - g3/3 + g2 - 5. Let d(l) be the second derivative of v(l). Is 10 a factor of d(4)? False Let z(f) be the second derivative of f5/15 - f4/12 + 5f*3/6 + 3f*2/2 - 8f. Let y(m) be the first derivative of z(m). Does 17 divide y(-3)? False Suppose -2z = -3z + 81. Let k = -119 + z. Let g = -26 - k. Is 6 a factor of g? True Suppose 4r = -t + 4767, 4r = -0t + 2t + 4770. Is r a multiple of 70? False Suppose 0 = 7u - 6u - 9. Let h(s) = -2s + 1. Let z be h(-2). Suppose 4r = -zf + 160, 4f = -r + 20 + u. Is 26 a factor of r? False Suppose 3 = -2i + f - 1, -4f + 16 = 5i. Suppose 0 = 7s - is - 1421. Is s a multiple of 29? True Let a(u) = 21 + 23 - 84u + 64u. Is a(-6) a multiple of 8? False Let m = -28 - -47. Let v = m - -6. Suppose -3c + v = -20. Does 5 divide c? True Suppose 5v + 8 = 3. Let w(g) = -112g*3 - 2g*2 - g - 1. Is 10 a factor of w(v)? True Suppose -74z + 94z = 3680. Is z a multiple of 10? False Does 3 divide 29/319 - 196/(-22)? True Does 11 divide 4/(-34) - (1384530/51)/(-14)? False Suppose -4s + 3o = -564, -2s + 146 = -s - 2o. Suppose -h - 4h + 3u = -s, 3u = -3h + 78. Is 14 a factor of h? False Suppose -m = 4m - 1125. Suppose -4a - a = -m. Suppose 4b - b - a = 0. Is 4 a factor of b? False Suppose -3m = 13m - 80. Suppose 7 = -a + m, -q + 3a = -204. Is 15 a factor of q? False Suppose -3y + 21 - 21 = 0. Let c(w) = -w + 48. Is 12 a factor of c(y)? True Suppose u = -0t - t + 109, -2t + 222 = 4u. Is t a multiple of 32? False Does 10 divide (26/(-1))/(-5(-9)/(-1710))? False Suppose 4h - 3u = 473 - 1794, h + 339 = -u. Let r = 493 + h. Is r a multiple of 16? False Suppose 4d - 26 + 10 = 0. Suppose -4m - 240 = -dk, -6k = -5k + 2m - 72. Is k a multiple of 5? False Let o(p) = 5p - 7. Let s(u) = -4u + 6. Let t(z) = 3o(z) + 4s(z). Let f be t(0). Suppose -5l + y = -140 - 180, -215 = -fl - 4y. Is 13 a factor of l? True Let k = -2 + 8. Let o(a) = -5a*3 + 8 - 2a*2 + 2a*2 + 7a - 7a2 + 6a*3. Is o(k) a multiple of 6? False Let j be 0/((-2)/((-1)/1)). Suppose 20v - 7v - 2002 = j. Is 28 a factor of v? False Let a be 1/(-8) + 4575/120. Suppose 0 = s + a - 115. Does 7 divide s? True Let g = 9 - 12. Let w be g/2 - 390/(-20). Suppose s - 15 = 5d, s = -s + 4d + w. Does 5 divide s? True Let c(z) = 11z*3 - 6z + 20. Is 14 a factor of c(3)? False Let o(u) be the first derivative of 5u4/12 + u3/3 - 6u*2 - 4u + 6. Let y(b) be the first derivative of o(b). Does 27 divide y(5)? False Let u(m) = -5m3 - 2m*2 - m. Let b be u(-1). Suppose br = 2r + 70. Is 13 a factor of r? False Let m = -386 + 669. Is 31 a factor of m? False Suppose 0a = -a. Let m = a - -33. Suppose -b - 7 = -m. Is b a multiple of 26? True Does 24 divide (12/(-14))/(-8 + (-21390)/(-2674))? False Suppose -4v = -10v + 30. Let a(l) = 29l + 2. Let i be a(v). Suppose 7r = 4r + i. Does 23 divide r? False Suppose 0 = -2n - 20 - 34. Is 12 a factor of 6/n + 2524/18? False Let m(h) be the first derivative of -h*4/4 - 10h3/3 + h2/2 + 10h - 12. Does 37 divide m(-11)? False Suppose 297 = 4j - 1107. Is j a multiple of 27? True Suppose 0g + 17 = 4g - 3h, 0 = 5g + 3h - 28. Let r = -9 - -13. Suppose -2y - 72 = -2x - 4y, gx - ry = 180. Is 18 a factor of x? True Let h(o) be the third derivative of o*5/15 + 11o*4/24 - 14o*3/3 - 21o*2. Does 16 divide h(4)? True Suppose -2d + 3838 = -4p, 14d + 4p + 1927 = 15d. Is 39 a factor of d? True Suppose -4i + 240 + 44 = 0. Suppose -2g = d - 26, d = -8g + 3g + i. Is g a multiple of 5? True Let a(s) = -2 + 2 - 10 + s*2 - 1 - 9s. Let f be a(11). Let c(v) = -v*2 + 13v + 8. Is 10 a factor of c(f)? True Suppose 149 = 3z + 5x - 55, 4x + 204 = 3z. Does 32 divide z? False Let g(b) = -3b + 57. Let f be g(30). Let o = 75 + f. Is o a multiple of 4? False Does 168 divide (318/(-15))/((4 - -8)/(-2280))? False Let m be (5 + -3 - -4)/2. Suppose g - 160 = -mg. Suppose a - g = -3a. Does 3 divide a? False Let u(n) be the second derivative of n5/20 - 5n*4/6 + 10n*3/3 - 5n*2/2 - 25n. Does 3 divide u(8)? True Suppose -3d + 1015 = 5n, 805 = 3n + n + d. Suppose -205 - n = -5j. Does 6 divide j? False Let t(v) = 8v - 3. Let q be t(1). Suppose -qu + 3g + 498 = 0, -2g - 204 = -3u + 94. Is 35 a factor of u? False Suppose -3b = 2z + 23, 5z + 37 - 7 = -2b. Let u = b - -37. Does 16 divide u? True Suppose -20 = -4l - 3q, -5q = -q. Suppose -4i - 5v = -384, i + 4v - lv - 96 = 0. Does 16 divide i? True Suppose 33 = -9p + 3273. Does 10 divide p? True Suppose 5g + 5u = 3615, 0 = u - 66 + 71. Is g a multiple of 14? True Suppose 4h - 3497 - 9103 = 0. Is 10 a factor of h/27 + 4/(-6)? False Let h(k) = -2k3 - 11k*2 + 22k - 1. Is h(-9) a multiple of 8? True Suppose -9j + 7j = -378. Is j a multiple of 27? True Is 7 a factor of (-1751)/34(-91 + 1)? False Does 26 divide 312 - ((-9)/(-6) + (-6)/4)? True Let f be 6/4(-4)/(-3). Let b be f/(-3)3 + 2. Suppose 11o - 6o - 285 = b. Is o a multiple of 13? False Suppose 0 = -9x + 1645 + 4340. Is 35 a factor of x? True Suppose 10h + 1098 - 168 = 0. Let w = h + 111. Is w a multiple of 6? True Let x(y) = 7y2 + 3y - 8. Let t(g) = -3g2 - 2g + 4. Let b(c) = -5t(c) - 2x(c). Let l be b(-5). Is 22 a factor of l - (-2 + 1)43? True Let s be (2 - -256)8/16. Let f = 250 - s. Does 11 divide f? True Let j = -1238 - -2972. Is 11 a factor of j? False Let s be -22(4/1 - 5). Suppose 2q = -s + 34. Is 2 a factor of q? True Suppose -5c = -2o - 13991 - 289, 5o = -4c + 11391. Is c a multiple of 11? False Let y = 929 - 715. Is 22 a factor of y? False Suppose -7 = 3s - 10. Suppose -5k + 21 = s. Does 4 divide k? True Suppose 4s = -1 + 9. Suppose 0 = -k + 3 + s. Suppose -ki + 114 = -2i. Does 12 divide i? False Suppose -4 = 5d - 59. Let t(y) = 10y - 14. Does 24 divide t(d)? True Let r(k) = 3k*2 - k. Let m be r(-1). Let q be m/16 - 302/(-8). Does 9 divide q - (-1 + 3 - 0)? True Let q(y) = -y + 17. Let p be q(15). Suppose h + 3 = -w + 10, -5h + 28 = -pw. Is h a multiple of 5? False Let y(m) = 20m*2 + 22m - 176. Does 28 divide y(10)? True Suppose 0 = -2v + 2t, -3t + 14 = 4v - 0. Suppose 0 = -5r + vu + 4, 0r - 5u = -4r + 10. Suppose -5s = -5x + 230, s = -r + 2. Is x a multiple of 8? True Does 11 divide 1582956/351 + (-4)/(-26)? True Let s be 1 - 3 - (-42)/3. Does 10 divide -3 + -3(-236)/s? False Suppose -117 = -18x + 1395. Is x a multiple of 14? True Is 146 - (-7 - -9) a multiple of 11? True Let w = 37 - 35. Suppose -636 - 244 = -wv. Suppose 80 = -4y + v. Is y a multiple of 15? True Let a = 2620 - 1420. Does 30 divide a? True Does 78 divide 2 + 3875 + -13 + (-1 - 2)? False Suppose -4i = -i. Suppose ij + 4j = 20. Is 3 a factor of 8 - j - 4/(-2)? False Is 175/(-2)48/(-40) a multiple of 5? True Suppose -6f - 32 = -5f. Let z = -46 - f. Let h = z + 31. Is h a multiple of 11? False Suppose 56r + 25111 = 78479. Is r a multiple of 11? False Suppose -23 - 257 = -a - 5h, -4a + 1212 = -3h. Suppose 0 = 6l - 0l - a. Let f = l + -18. Does 6 divide f? False Let g be 1 + 7/((-14)/(-8)). Let q(t) = t*2 + 6t + 4. Let c(r) = r*2 - r. Let y(s) = -2c(s) + q(s). Is 19 a factor of y(g)? True Let f be (-1 - (-2)/3) + (-1939)/(-21). Suppose 5r - 2 - 12 = -2o, 5r = -4o + 8.	{ "pile_set_name": "DM Mathematics" }
nd g - 3g4 - g + (g - 3g + g)(32g*2 - 32g*2 - 11g*3). 8g*4 Expand (3y*3 + 3y*3 - 5y*3)(0y2 + y - y2 + 0y). -y5 + y4 Expand (-17 + 15 + 6)(-4f*3 + 3f*3 + 0f*3)(-f + 4f + 3f). -24f4 Expand (3 - m2 - 3)(-2 + 2 - 4m)(0m - 3m + 4m). 4m*4 Expand (-165x*3 + 31x*3 - 2205x*4 + 2207x*4)(2 - 1 - 2)(0x + 3x - 5x). 4x5 - 268x*4 Expand (12 - 2 + 0)(0q3 - 2q*3 + 0q*3)(0 + 0 - q)(-2 + 2 - 2). -40q*4 Expand (-4n + 4n - 2n)(-3n*4 - 2n*3 + 2n*3) + 0n*4 + 0n4 + n5. 7n5 Expand -2v*2 - 4v*2 + 4v*2 + (-8v - 3v + 2v)(-2v + 1 - 1). 16v2 Expand (-y + 10y - 2 - 7y)(-y*2 - 6y*2 + 4y*2). -6y*3 + 6y*2 Expand (-283b*2 + 283b*2 - 11b*3)(1 - 5 + 0)(-3 + 1 + 0). -88b*3 Expand (-2 + 2 + 2n)(3 + 8 - 2)(2 - 1 - 3). -36n Expand 11 - 8c*5 - 11 + (0c*2 + 0c*2 + 2c*4)(3c - c - c) + 3c - 3c - 2c*5. -8c*5 Expand 4h*4 + 2h*5 - 4h*4 + 2h*4 - 3h*5 - 2h*4 + (2h*3 - 4h*2 + 4h*2)(2h2 - 3h*2 + 3h2) - h5 + 0h5 - h5. h5 Expand (3f - 3f + f)(f*3 - 2f*3 + 0f*3) + 3f*4 - 5f4 - f4 - 4f4 - 23f + 23f. -8f*4 Expand (-3s - 2s + 4s)(6 - 12 + 29)(-s2 + 1 - 1 + 5 + s2 - 5 + (0 + 2 - 3)(0s + 2s2 + 0s) + 3s2 - s2 - 4s2 + s2 - 3s2 + 0s*2). 138s*3 Expand (-3 + 5 - 4)(-h + h + h)(-3 - 1 - 1). 10h Expand -1483n + 1482n - 3n2 - n4 + 3n*4 + (2n - 2n - 2n)(6n*3 + 2n*3 - 4n*3). -6n*4 - 3n*2 - n Expand a + 0a + a - 2a - 2a - 4a + (2a + 4a - 4a)(-2 + 4 - 4) + a - 2a + 0a. -11a Expand (2z2 - 2z*2 - 2z*4)(-7 - 5 + 4) + z*4 + 3 - 3 + (0 - 2 + 1)(-z*3 + 2z4 + z3). 15z4 Expand (-4 + 3 - 3)(-2m + 3m - 2m - 2m + m + 0m - 2m + 1 - 1 + 3m - 4m - m + (2 - 3 - 1)(-3 + 3 + 2m) + m + m - m + 2m + 11m - 2m). -8m Expand (-5 + 4 - 3)(-4x*3 + 2x*3 + 4x*3) + 5x*3 - 4x*3 - 3x*3 + 3x*2 - 3x2 - x3. -11x3 Expand (-2b*3 + 0b3 + b3)(-2b + 3 - 3) + 7b4 - b4 + 2b*4 + (0 + 0 + 2)(-2b2 + 2b2 + b4). 12b4 Expand (15 + 12 + 18)(x + x + 0x). 90x Expand (i - i + i)(i - i - i2 + (0 + i2 + 0)(-2 - 1 + 0)). -4i3 Expand (-1 + 2u + 1)(-3 - 2 + 3)(-u + 3 - u - 7). 8u2 + 16u Expand (-2d + 0 + 0)(-3d - 23 + 36 - 18). 6d*2 + 10d Expand (-3x - 2x + 4x)(14 + 3 + 28). -45x Expand (-5 + 5 + y)(3y - 9y - 5y). -11y*2 Expand (0w*2 + 0w2 - w3)(-19w*2 - 10w*2 + 53w*2). -24w*5 Expand (110 - 16p - 110)(3p + 0p - p)(p2 - p2 - p*2). 32p*4 Expand -3w4 - w3 + 2w3 - w4 - w4 + 0w*3 + 0w3 + (-5 + 5 + w3)(-w - w + 0w) - w*4 + 0w4 - w4. -9w4 + w3 Expand (18q*4 + 34q4 - q4)(-2 + 3 + 1). 102q*4 Expand (13b - 9b + 4b)(-b2 + 0 - 3b + 0). -8b3 - 24b*2 Expand (4y*3 - 5y*3 + 0y*3)(1 - 2y2 - 1) + 9y*5 - 6y5 - y5. 4y5 Expand (-4 + 31 + 13)(-1 + 1 - 1)(3n + 0n - n). -80n Expand (0 + 0 + 2u2)(-3 + 2u2 + 3) + 7u*4 + 33u*4 - 5u*4. 39u*4 Expand (-6 - 15 - 4)(6k - 3k - k). -50k Expand (-17m + 23m - 1 - 14m)(0 + 0 + 2). -16m - 2 Expand (-19l3 + 28l*2 - 28l*2)(4 - 2 - 1). -19l3 Expand (-2p*2 - 4p*2 + 5p*2)(2 - 2 - 2p) + 0p*2 + 0p2 + p3 - p*3 - 2 + 2 + 19p*3 + 9p - 9p + 5p*3 - 5p*3 + 4p*3. 25p*3 Expand -3 + 3 - 2i*2 + (-i - 2i + 4i)(2i - 3i + 2i). -i2 Expand (-a - 2a + 5a)((0 - 3 + 6)(-4 + 0 + 3) - 1 + 6 - 1)(-a + 4 - 4). -2a2 Expand -83t*3 + 83t*3 + 4t*4 + (1 + 3 - 3)(-2 - t*4 + 2) - 4t + 4t + 2t*4. 5t*4 Expand (0z + 2z + 0z)(-3z + 3z - z)(3 - 4 + 2). -2z2 Expand (n - 3n + n)(0 - 12 - 21)(3n + 2n - 3n). 66n*2 Expand 0h + 2h - h - 1 + (0 - 2h + 0)(-3 + 1 + 1). 3h - 1 Expand (w + w - 3w)(-3150w2 - 110w*4 + 3150w*2). 110w*5 Expand (-5481y + 5481y + 13y*4)(-4 - 1 + 3). -26y4 Expand (55 - 28 + 7l - 29)(l + 0l - 2l). -7l*2 + 2l Expand (1 - 1 + h*2)(h + 0h - 2h) - 2h3 + 61h*2 - 61h*2 + 18h. -3h3 + 18h Expand (4n3 - n3 - 2n*3)(2 + 2 + 0)(1 + 1 - 1). 4n*3 Expand (-2t*2 + 2t - 2t)(54t - 20 + 20) + 0t3 - t3 + 0t3. -109t*3 Expand (0n + 0n + 4n*2)(-10n3 - 4n*3 + 7n*3 + (2n*2 - 5n*2 + 2n*2)(-n + 1 - 1)). -24n5 Expand (-26 + 3 - 4l*2 + 2l*2)(-4l3 + l3 + l3). 4l*5 + 46l*3 Expand (1 - 1 + 4)(0m2 + 0m*2 - 3m*2). -12m*2 Expand (5 - 3 - 3)(2b - 2b - b). b Expand (-4 - 2 + 4)(-11 + s - 15 + 28). -2s - 4 Expand (0y2 + 2y*2 + 0y*2)(-3y - 3y + 4y) + (-y - 4y + 2y)(2y - 2y - y2). -y3 Expand (-y - 1 + 1)(4y + 0y - 5y)(1 + 2y3 - 1) + (y5 + 4y5 - 3y*5)(-6 + 4 + 4). 6y5 Expand (5p*2 - 2p2 - p2)(-2 + 2 + 2p + (0 + 1 + 0)(0 + 0 + 2p)). 8p3 Expand (3q - 2q - 4q)(-5q + 3q + q) + 2q*2 + 4q*2 - 3q*2. 6q2 Expand (t2 + 0 + 0)(5t2 + t2 - 5t2) + 5t - 5t + 19t*4. 20t*4 Expand 0l*2 + 0l2 - l3 + (6l - 2l + 9l)(0l2 - 2l*2 + 0l*2). -27l*3 Expand (-3 - 2 + 4)(-3k + 0k + 2k)(-6k3 - 14k*3 + 6k*3). -14k*4 Expand (2 + 0 - 4)(-1 + 1 - 1)(-1 - 2 + 1)(c*4 - 4c*4 + 7c*4). -16c*4 Expand (34 + 15 - 83)(-2p + 3p + 0p)(-2p + 0p + 5p). -102p*2 Expand -2y*3 + 3y*2 - 3y*2 + (2y*2 - 4y + 4y)(y + 3 - 3 + (-y - y + 4y)(-3 + 4 + 0) + 0y - 2y + y). 2y3 Expand -2 + 1 + x2 + x2 + 3x*2 - 2x*2 - 2x*2 + 3x*2 + 0x*2 - 2x*2 + (-4x + 3x + 3x)(3 - 3 - 2x). -2x2 - 1 Expand 1 - 1 + s2 + (s - 4s + s)(s + 0s + s) - 2s2 - 3s*2 + 3s*2 - 3s*2 + 4s2 + s2 + 7s2 - 2s + 2s - s2 - s2 + 4s*2. 6s*2 Expand (-w + 0w - 2w)(-27 + 2 + 4). 63w Expand (-5 + 2b + 5)(0 + 0 - 2) + 3b - 3b + b - 6 - b + 2b + 3. -2b - 3 Expand (75l + 10 - 2l3 - 75l)(l2 + 2l2 - l2). -4l5 + 20l*2 Expand 3v*5 + 2v*5 - 6v*5 + (3 - 2v*3 - 3)(-3v + 3v*2 + 3v). -7v5 Expand (-3p + p + 0p)(5 + 0 + p + p). -4p2 - 10p Expand (-3 - 2 + 3)(o + 0 + 0)(-6 + 6 + 6). -12o Expand (0 + 3c + 0 + (1 - 2 + 3)(-1 + 1 - c))(5 - 2 + 3)(2 - 7 + 3). -12c Expand (3l3 + 4l3 + l2 - 4l3)(9l - 6l + 8l). 33l*4 + 11l*3 Expand (-7k + k + 2k + k + 2k + 0k + (0 + 1 - 2)(-k - 4k + 3k))(0k - k - k). -2k2 Expand (-j5 + 2j5 + j5)(6 - 3 - 2)(0 - 1 + 6)(5 - 3 - 4). -20j*5 Expand (4k2 - k2 - k*2)(2k + 0k - 7k) - 2k + 2k + k3. -9k*3 Expand -56f*5 - 39f*5 - 15f*5 + (0f*4 + 4f*4 - 3f*4)(-f + 0 + 0). -111f5 Expand (2 - 2 + 1)(s + 4s - 3s)(-11 - 11 + 5)(-1 - 3 + 6). -68s Expand (-3f + 5f - 4f)(-2f + 5 - 5 + (3f - 4f - f)(-1 - 4 + 3) - 2 + 2 + f + 0 - f + 0 + 0f + f + f + 2f + f - 2f). -10f2 Expand (-f + 0f + 2f)(1 + 0 + 2)(-f + 3 - 3). -3f*2 Expand (-b + 2b - 3b)(0b3 - b3 + 0b*3) + 2b*3 + 4b + 4b4 - 4b. 6b4 + 2b*3 Expand (5c - c - 3c)(-2c + c + 0c)(3 - c2 - 3). c4 Expand (-z3 - z3 - 2z*3)(4z - 1 - 3z + 3z). -16z*4 + 4z*3 Expand 2d*4 - 2d*4 + 6d*5 + (2d3 - d4 - 2d3)(1 - 1 - 2d) + (-6d + 3d + 2d)(2d4 + d2 - d2) - 3 - d5 + 3. 5d5 Expand (-3c + c + 4c)(-2c + c + 3c + c - 4c + c + (-4 + 3 - 1)(2c + 4c - 4c) + (-c + 0c - c)(-5 + 1 + 5)). -12c*2 Expand (-2l*3 + 2l*3 - 5l*3)(2l - 2 + 2) + 2l*4 - 2 + 2 + 4l*3 + 2l*4 - 4l*3 + (-6l*3 + 0l*3 + 3l*3)(0l + 6l - 4l). -12l*4 Expand (7u*3 - 7u*3 - 4u*3)(0u - 6u + 4u). 8u*4 Expand (n - 1 + 1)(-n - 4 + 4)(5 - 2 - 2)(1 + 1 - 5). 3n2 Expand (0 + 0 - 3)(2l4 + 4l*4 - 4l*4)(4 + 0 + 0)(-2 + 2 - l). 24l*5 Expand (5t - t - 3t)(5t - 2t - 2t) - t + 2t*2 + t + 3t*2 + 0t*2 - 4t*2 + (3 - 5 + 4)(3t2 - 3t*2 + 2t*2). 6t2 Expand -l5 + 9l5 + 3l5 + (-l4 - 3l4 + 5l*4)(-l - 2 + 2) + 4l4 - 2l*5 - 4l4 - l5 + l5 - l5. 7l5 Expand (7g - 2g - 2g)(-7 + 1 + 2). -12g Expand 2f4 - 6f4 + f4 + f*4 - 3f4 - f4 + (5f2 - 4f2 + f2)(2 + f2 - 2) - 2f*4 + 2f*4 - 2f4 + 0 + 0 - f4. -7f4 Expand -2u*3 - 4u + 4*u	{ "pile_set_name": "DM Mathematics" }
) + sqrt(108) + -3 + 1 + sqrt(108))*2. -252sqrt(3) + 1021 Simplify (sqrt(9) + sqrt(576) + sqrt(576) + 2sqrt(576) + (sqrt(729)1 - sqrt(729)))/((sqrt(243)1 + sqrt(243))-3 + sqrt(243)). -11sqrt(3)/15 Simplify ((-4 + 2sqrt(176))2 - ((sqrt(176) - (sqrt(176) + sqrt(176) + 1 + sqrt(176)))2 + sqrt(176) + sqrt(176))3) + 1 + (3 + -2sqrt(176))*2. -681 - 184sqrt(11) Simplify (((sqrt(77)5)/sqrt(11))2 - (3sqrt(847))*2)3-5. 111720 Simplify (4-5-2sqrt(70))/((sqrt(80)-21)/sqrt(8)). -20sqrt(7) Simplify (((sqrt(252) + (sqrt(252) + 2sqrt(252) - sqrt(252)))-3)/sqrt(7))/(-2(sqrt(12) - sqrt(48))-6). 3sqrt(3)/4 Simplify 5 + ((-5sqrt(684)1 - (sqrt(684) - (sqrt(684) - (0 + -1 + sqrt(684))))) + 5)*2. -432sqrt(19) + 24665 Simplify (3(sqrt(153) - (2sqrt(153) - sqrt(153))6))/(sqrt(18)/(53sqrt(2))). -225sqrt(17) Simplify (0 + (sqrt(17) - -3(sqrt(17) - 2sqrt(17))))*2 + 0 + sqrt(17) + 4 + 4. sqrt(17) + 76 Simplify ((sqrt(91) + -6sqrt(91)-2)/(sqrt(14)/(sqrt(2) - sqrt(72))))2. 54925 Simplify (6sqrt(1100)-2 - (sqrt(110)/(1sqrt(5)))/sqrt(2))*2. 161051 Simplify -5(sqrt(300) + (sqrt(300) + (5 + 2sqrt(300) - sqrt(300)))2 + (-5 + sqrt(300) + sqrt(300) + 0)2). -12250 - 50sqrt(3) Simplify -1 + -2(sqrt(156) - 2(sqrt(156)3 - sqrt(156) - sqrt(156)))/(sqrt(84)/(sqrt(7) + sqrt(7)2)). -1 + 6sqrt(13) Simplify (-3((sqrt(85) + sqrt(85)-1)-5 - sqrt(85)))/((sqrt(720) + 2sqrt(720))-5). -sqrt(17)/60 Simplify (sqrt(121) + sqrt(121)-42)/(sqrt(1331)-2). 7sqrt(11)/22 Simplify (sqrt(20)/(sqrt(8) + sqrt(32)/sqrt(4)))/((sqrt(40)/(sqrt(2) + sqrt(32)))/sqrt(10)). 5sqrt(5)/4 Simplify (-3(-2 + sqrt(396) + -2 + 2))*2. -216sqrt(11) + 3600 Simplify (2 + -2sqrt(66)/((sqrt(18)1)/sqrt(3)))*2. -8sqrt(11) + 48 Simplify (1 + 2 + sqrt(1539) + 3 + 3sqrt(1539) + sqrt(1539))-4. -180sqrt(19) - 24 Simplify 4 + (sqrt(5) + sqrt(20)/sqrt(4))2 + 0 - ((sqrt(5) + 1)3 + sqrt(5) + 3). -4sqrt(5) + 18 Simplify -1(sqrt(52) + sqrt(208)/sqrt(4))*2-3 - (sqrt(39) - (sqrt(39) + sqrt(624))6)/(sqrt(12)/(sqrt(4)-1)). -29sqrt(13) + 624 Simplify -2(-5(3sqrt(19) + -1) + 3)5. -80 + 150sqrt(19) Simplify (3sqrt(33)-1 - sqrt(4752)1)/(-1(sqrt(44) + sqrt(176))/sqrt(4)). 5sqrt(3) Simplify 4 + ((-2sqrt(52))/sqrt(4) - (sqrt(325)-2 + sqrt(325)) - (sqrt(1872) + sqrt(1872) + -1 + sqrt(1872))-3)*2. -666sqrt(13) + 160186 Simplify -2 + (5 + (sqrt(1300)4 - sqrt(1300))1)*2 + 2. 300sqrt(13) + 11725 Simplify 2 + 4(sqrt(13) + 1 - sqrt(13))-3 - (-3 + (sqrt(1573)2-4 - sqrt(1573))*2). -127420 Simplify (4 + sqrt(1700) + 5(sqrt(1700) + 0) + 1)44. 80 + 960sqrt(17) Simplify (2sqrt(6050))/(-2sqrt(490)) + -4. -4 - 11sqrt(5)/7 Simplify (sqrt(36)/(-3sqrt(3)))/(sqrt(704)/sqrt(11)). -sqrt(3)/12 Simplify ((sqrt(165)/sqrt(3) + sqrt(55))/sqrt(11) - sqrt(5)) + sqrt(20) + -1 + ((sqrt(5)-1-4)2 - (-5 + sqrt(20)/sqrt(4))). 2sqrt(5) + 84 Simplify (((-1sqrt(70)/sqrt(2) - sqrt(35)) + sqrt(35))-4)/(sqrt(405)1 + sqrt(5) + sqrt(625)/sqrt(5)). 4sqrt(7)/15 Simplify sqrt(170)/(sqrt(40)2) + (sqrt(204) - (sqrt(204) + -6-4sqrt(204)))/sqrt(12). -95sqrt(17)/4 Simplify (3 + -5(2sqrt(45) + -2 - sqrt(45)) + (-2 + sqrt(45) + 1)-6)2. -1254sqrt(5) + 5806 Simplify (-3 + -1 + sqrt(891)-2 + sqrt(891))2-2-6-2. -21768 - 1728sqrt(11) Simplify (sqrt(315)/(sqrt(27)/sqrt(3)))/((sqrt(567) - sqrt(567)-2) + sqrt(7)) + 5. sqrt(5)/28 + 5 Simplify -1(-4 + 5 + (sqrt(1300) - -2sqrt(1300) - sqrt(1300)) + -4)*2-1. -120sqrt(13) + 5209 Simplify ((0 + sqrt(17))-5 + -5)3-4. 60 + 60sqrt(17) Simplify (1sqrt(20))/sqrt(4) + 0 - (0 + (sqrt(720)1 - sqrt(720)))2. sqrt(5) Simplify ((sqrt(2) - (-5 + (sqrt(4)/sqrt(2) - sqrt(2)) + sqrt(2))) + -1)2 + -2(sqrt(16)/(sqrt(8)-2))2. 15 Simplify sqrt(35)/((sqrt(7) + sqrt(7) + sqrt(175) - sqrt(7) - sqrt(7))6) - (4 + -3 + sqrt(15)/sqrt(3)). -29sqrt(5)/30 - 1 Simplify (-54sqrt(99)2)/((sqrt(432) - (sqrt(432) + (sqrt(432) - (1sqrt(432) - sqrt(432)))) - sqrt(432))/sqrt(12)). 10sqrt(11) Simplify (-5 + (-1sqrt(396) - sqrt(396))2 + sqrt(396) + -3)5 + -5. 30sqrt(11) + 7875 Simplify -1(((sqrt(153) + sqrt(153)-2)4)/((sqrt(72)-1 - sqrt(72))/sqrt(8)))2. -68 Simplify (sqrt(7) + -4 + sqrt(28)/sqrt(4) - (sqrt(70)-6)/sqrt(10))-5. -40sqrt(7) + 20 Simplify -34(((sqrt(325) + 3)*2 + sqrt(325) - sqrt(325)) + -2). -3984 - 360sqrt(13) Simplify (sqrt(14)/(sqrt(7)-3) + sqrt(72)-5)*2 + (sqrt(16)/(sqrt(32)/sqrt(4)) - sqrt(50)3). -14sqrt(2) + 16562/9 Simplify ((sqrt(275) + -1)-4)2 - ((sqrt(11) - (sqrt(396))2)-3 + -2). -157sqrt(11) + 3230 Simplify (-5sqrt(176) - (sqrt(396) + 0 + sqrt(396) + sqrt(396))2) + ((sqrt(11) - sqrt(22)/sqrt(2)) + 5)6. -3534 - 20sqrt(11) Simplify 3(sqrt(260)/sqrt(20) - ((sqrt(13) + (1sqrt(13) - sqrt(13))5 - sqrt(13)) + sqrt(39)/(sqrt(3) + (sqrt(6)/sqrt(2) - sqrt(3))))). 0 Simplify (-2sqrt(343))2 + 4 + -1 + 6-2sqrt(7). -12sqrt(7) + 1375 Simplify 2(sqrt(48) + 1) - -1sqrt(108)4. 2 + 32sqrt(3) Simplify -1 + (2(sqrt(98) + -1 - sqrt(98)) + -5 + 0)2-3. -148 Simplify ((sqrt(96)3)/sqrt(3) - (1sqrt(8)-3 + 3))2. -108sqrt(2) + 657 Simplify (((sqrt(91)/sqrt(7) - sqrt(13))-1 + sqrt(156)/(-4sqrt(12)) + 5)1)25. -25sqrt(13)/2 + 2065/16 Simplify ((1 + (sqrt(1872) + (1 + sqrt(1872) - sqrt(1872)) - sqrt(1872)) - sqrt(1872))2 + 5 + sqrt(1872) + 1)-2. -3764 + 72sqrt(13) Simplify (1 + (sqrt(17) - sqrt(68)) + (sqrt(17) - sqrt(153)/sqrt(36))2)-1 - sqrt(2057)2-1-6. -131sqrt(17) - 21/4 Simplify (-4(sqrt(153) - (sqrt(153) + sqrt(153)2))2)/((sqrt(108)-2)/sqrt(3)). -4sqrt(17) Simplify -2(sqrt(2) + (sqrt(12)/sqrt(6))*2 + -3 - -6-3sqrt(2)) + -5 + -2. -5 + 34sqrt(2) Simplify (5 + 1 + sqrt(108) + -2 + (-4 + (sqrt(108) - (sqrt(108) + 0)) - sqrt(108) - sqrt(108)))*2. 108 Simplify 4 + ((sqrt(1300) - (sqrt(1300) + -2))-4)*2 + 0. 68 Simplify -4 + -4(-1 + sqrt(304) - (2sqrt(190))/sqrt(10)). -8sqrt(19) Simplify (0 + -4-1sqrt(1008) + sqrt(1008) - (2(sqrt(1008) + (1sqrt(1008) - sqrt(1008))) + 3))*2. -216sqrt(7) + 9081 Simplify -2 + sqrt(33)/(((sqrt(11) - (sqrt(11)-2 - sqrt(11))) + sqrt(11))3) + sqrt(12)/(sqrt(400) + 3sqrt(400) + sqrt(400)). -2 + 13sqrt(3)/150 Simplify (sqrt(57)/(sqrt(3)-1) - sqrt(19))2 + sqrt(19) + -1 + sqrt(19) + 3 + -5. 2sqrt(19) + 73 Simplify (sqrt(200)/sqrt(4) + sqrt(50) - sqrt(50))*2 + -4 + -6(sqrt(10) - (sqrt(10)2 + sqrt(10) + sqrt(10)))/sqrt(5). 18sqrt(2) + 46 Simplify -2 + ((sqrt(243) - sqrt(243)3) + 2)2 + (sqrt(243) + (-3sqrt(243) - sqrt(243))-2)2. -72sqrt(3) + 20657 Simplify 3(-2 + ((sqrt(891)-2 + 2)*2 - (sqrt(891) + 1 + 1 + sqrt(891))) + 0). -270sqrt(11) + 10692 Simplify (-32sqrt(104) + 5(sqrt(104) - (sqrt(104) - (sqrt(104) - 1sqrt(104)))))/(sqrt(24)/(-4sqrt(6)/sqrt(2))). 24sqrt(13) Simplify -3(sqrt(1573) + sqrt(1573)2)6 + 1 + 0. -594sqrt(13) + 1 Simplify 5 + sqrt(48) + sqrt(48) + 4 - (4 + sqrt(2352)). -20sqrt(3) + 5 Simplify 6(-4 + sqrt(21)/(sqrt(15)/(2sqrt(5)))). -24 + 12sqrt(7) Simplify (31sqrt(153))/(sqrt(9) + (sqrt(9) - (sqrt(9) + 2sqrt(1296))))-6 + 4. 18sqrt(17)/23 + 4 Simplify (-6(1sqrt(99) - sqrt(99) - sqrt(99))-4)/((1sqrt(54))/sqrt(6)-2). 12sqrt(11) Simplify 5(sqrt(3)-3-6)*2 - (1sqrt(108))/sqrt(9). -2sqrt(3) + 4860 Simplify (16(sqrt(153) - -1sqrt(153)))/((sqrt(144)-6)/sqrt(4)). -sqrt(17) Simplify 4sqrt(68)-5 + (5(sqrt(17) + sqrt(85)/sqrt(5))-5)2. -40sqrt(17) + 42500 Simplify (sqrt(448)36 + -1 + -4)-3. -432sqrt(7) + 15 Simplify 1 + ((sqrt(847) - ((sqrt(847)4 - sqrt(847)) + sqrt(847)))2 - sqrt(847)) - ((-5sqrt(28))*2 + sqrt(7) - (sqrt(567) + 1sqrt(567))*2). -12sqrt(7) + 9192 Simplify 3 + -3sqrt(448)1 + (-1sqrt(448) - sqrt(448))2-3. -5373 - 24sqrt(7) Simplify -1 + (2 + (sqrt(176) - sqrt(176)-3) - sqrt(176) - (sqrt(176) - (2 + sqrt(176) + sqrt(176) - sqrt(176) - sqrt(176)))4)2. -80sqrt(11) + 275 Simplify (((sqrt(210) - (sqrt(210) - (1-1sqrt(210) + sqrt(210)))) + sqrt(210) + sqrt(210))/sqrt(6))/(-6(sqrt(80)2 - sqrt(80)) + sqrt(80)). -sqrt(7)/10 Simplify ((sqrt(65) - (-3sqrt(65) + sqrt(65))6)-1)/((sqrt(5) - -2(sqrt(15)/sqrt(3) - sqrt(5))) + sqrt(5) + (sqrt(5) - (sqrt(20)/sqrt(4) + sqrt(5))6)). 13sqrt(13)/9 Simplify (((2sqrt(88)-1)/sqrt	{ "pile_set_name": "DM Mathematics" }
3q). -136q*4 Expand (1496 - 31b - 1496)(-3b*2 + 3b2 + b4) + (0 + 2b2 + 0)(2b3 - b3 - 4b*3). -37b*5 Expand (3v - 4v - 4v)(-30v*2 + 108v*2 + 19v*2). -485v*3 Expand 0r*2 + 0r2 + r3 + (-2r + 4r + 0r)(-r + r - 2r2) - 2r*3 + 0r + 0r + (r2 - 3r + 3r)(-6r + 0 + 0) + 1 - 1 - 2r*3. -13r*3 Expand (-1 - 2 + 2)(-3x2 + 3x2 - x3) + x*3 - 5x*3 + 2x*3 + (0 - 5 + 4)(47x2 - 78x*3 - 47x*2) + (-1 + 2 + 0)(2x3 - 4x*3 - 2x*3). 73x*3 Expand (-38 + 21j + 38)(-12 + 5 - 6). -273j Expand (0m2 - m2 + 0m*2)(-3m2 + m2 + m2) - 8m*4 - 22m4 - m4. -30m4 Expand (-152 - 58 + 17 + 20)(3 - 3 - 2c). 346c Expand (0i - 4i + i)((-5 - 2 + 3)(i + 0i - 3i) - 218i + 16068 - 16068). 630i*2 Expand (-2v - 4v - 6v)(-15v + 19v + 31v). -420v2 Expand (3 - 4 - 1)(-3u + 7u + 7u)(4 + 1 + 1). -132u Expand (-180 + 125 - 161)(-3n2 + 3n - 3n) + (-3n*2 - 2n*2 + 3n*2)(-6 + 3 + 1). 652n2 Expand (-3331 - 92i*2 + 3331)(-4 + 4 - 7 - 1) - i*2 + 5 - 5. 735i*2 Expand (22 + 12 - 18)(-3v4 + 3v*3 - 3v*3)(3v - 3v + 5v). -240v*5 Expand (-17 + 17 + 2h)(6 - 6 - h) + 3h*2 - 3h*2 + 7h*2. 5h*2 Expand (4 - 3 - 3)(19p2 + 417p - 417p)(-p2 + p2 - p*3). 38p*5 Expand 4b*2 - 1 + 1 + 126 - 126 + 15b*2 + (-3b + 3b - b)(-3b + 4b - 2b) + 1 - 2b*2 - 1 + (0b - 3b + 2b)(4 + 2b - 4) - b*2 - 2b2 + b2. 14b2 Expand (-7u*3 - 4u*3 + 5u*3)(-106 + 106 - 12u). 72u*4 Expand (q - 2q + 2q)(147 - 309 + 123). -39q Expand (-3w + w + w + (3w - w - 4w)(0 + 1 + 1) + (4 + 1 - 3)(6w - 5w + 0w) + 3 + 2w - 3)(-2 + 2 + 2w). -2w2 Expand (5u - 5u - 7u*2)(4u - 4u + 5u). -35u*3 Expand (q + 2 - 2)(3q - 4q - q)(-20 + 9 + 8). 6q*2 Expand (936 - 2l - 3l2 - 936)(l + 5 + 0 - 2). -3l3 - 11l*2 - 6l Expand -161q3 + 30q*5 + 161q3 + (q2 - 3q2 + q2)(0q3 + 3q*3 + 0q*3). 27q*5 Expand (3d3 + d3 - 6d3)(-5d2 - 7d + 7d + (-d + d2 + d)(4 - 3 - 3) - 3 + 3 + d*2). 12d*5 Expand -26m*2 + 112 - 22m*2 + 49m*2 + (-2m + 3m + 0m)(0m + 0m + m). 2m*2 + 112 Expand (3 - 1 - 3)(-2l + 6l + 5l)(l*3 - 3l*3 - 2l*2 + 3l*2). 18l*4 - 9l3 Expand -u2 + 3u2 - u2 + ((-2u - 2u + 5u)(5u + 2u - 5u) + 3 - 3 + 3u2)(11 + 5 + 5). 106u2 Expand -19u*4 - 15u*4 + 3u*2 - 2 + 16u4 - u3 + u3 - u4 + (-u2 - u2 + 0u2)(0 + u*2 + 0). -21u*4 + 3u*2 - 2 Expand 2y*2 - 3y*2 - 2y*2 + (1 + 2y - 1)(4 - 3 - 2)(3y + 0y + 8y). -25y*2 Expand (-2l*2 + 2055l - 2051l + l2 + 12)(6l + l3 - 6l). -l*5 + 4l*4 + 12l*3 Expand (-9g - 9g - 10g - 2g + 3g)(-66g*2 + 128g*2 + 125g*2). -5049g*3 Expand (-2c + 2 - 5 + 1)(-36 + 54 + 90). -216c - 216 Expand -3p3 - 4p*4 + 3p*3 + (34 - 11 - 12)(4p4 + 1 - 1). 40p*4 Expand 21l*2 - 15l*2 - 7l*2 - 15 + (l - 2l + 2l)(-2l + 0 + 0) + 2l*2 - 5l2 + l2 + 4l - 4l - l*2. -6l*2 - 15 Expand (5 - 2 - w - 4)((0w - w - w)(4 - 5 + 0) - 39w + 230 - 230). 37w*2 + 37w Expand (-2 + 4 + 0)(10d + 2d - 3d)(3 + 0 - 1 + (1 - 2 + 3)(0 + 0 + 2) + 3 + 2 - 4 - 3 + 1 + 3 - 45 - 47 + 76). -144d Expand 325p + 296p - 584p + (0 - 2p + 0)(1 + 0 + 0) + 3 - 2p - 3 - 2 + 2p + 2 + 2 + 2p - 2 + (-2p + 3p + p)(-3 + 4 - 3) + p - 4p + 4p. 34p Expand (57s4 - s4 - 9s4)((-2s - 2s + 3s)(-1 + 4 - 5) + 2s - 2 + 2). 188s*5 Expand 0d*2 - 3d*2 + 2d2 + d2 - 8d2 - 7d*2 + 6d*2 - 4d*2 - 4d*2 - d + 3d*2 + d + (d - 2d + 3d)(d - d - d). -16d2 Expand 9s*4 - 38s*2 - 19s*4 + 9s*4 - 2s*4 - 2s*2 + 2s*2 + (-2s*3 + 3s*3 + 0s*3)(-s - 3s + 3s). -4s4 - 38s*2 Expand -14r*5 - 12r*5 + 44r*5 + (-2 + 2r + 2)(2r*2 + 3r*4 - 2r*2 + (1 - r - 1)(-2r3 + 4r3 - r3) - 4 + 2r4 + 4). 26r*5 Expand 0u*4 + 3u*4 - 5u*4 + (-u + 5u - 5u)(u*3 + 0u*3 - 3u*3) + 13u*4 + 17u*4 - 17u4 - u2. 13u4 - u2 Expand (0 - 2 - 24g*2 + 2)(g - 2g - 4g). 120g3 Expand (0 - s + 0)(3 - 13 - 29) + 3 + 4s - 3. 43s Expand (7 + 3k - 7)(2k2 - k2 - 2k*2)(-5 - 7 + 5). 21k3 Expand (-4o + 5o - 20o)(-2 - 3 + 4)(3o - o + o). 57o*2 Expand (4 - 2 - 3)(196f + 115 - 115) + 2 + 3 - f - 3. -197f + 2 Expand 0 - i*3 + 0 - 5 + 5 - 6i3 + (-i2 - 5i2 + 4i*2)(-2 - 2i + 2) + i3 + 0i*3 - 2i*3. -4i*3 Expand (4 - 5 + 6)(-15 + 12 + 25k + 4). 125k + 5 Expand (-1 - 5 - 1)(1 + 3 - 6)(-16 - 1 + 1)(-r + 3r - 4r). 448r Expand -5h + 5h - h*2 + (4h - 2h - h)(2h + 0h - 4h) + 72h*2 + 65h*2 + 12 - 10. 134h*2 + 2 Expand 0c + 7c - 2c + (0c + 0c - 2c)(2 - 4 + 0) - 2c + 0c + 0c. 7c Expand (-4 - 2 - 14)(-4x + 4x + x - x - 5x + 3x + (-3x - 3 + 3)(-1 + 0 - 1)). -80x Expand (-2 - 3 + 6)(-9k - 880 + 880) + 5k - 2 + 3 - 3k. -7k + 1 Expand (29f*2 - 14 + 14)(-3 + 3 - 2f) + 0 + 0 + 2f*3. -56f*3 Expand (4c - 5c + 6c)(-1 + 3c + c*2 - 2c + 0). 5c3 + 5c*2 - 5c Expand (j*3 + j - j)(-4 + 0 + 5) + 2664j2 + 914j*3 - 2664j*2. 915j*3 Expand (74 - 74 + 26k + 22k)(4k - 6 + 6). 192k2 Expand (v4 + 0v4 + 0v*4)(2v - v + 2v) + (0 - 2v + 0)((2v2 + 2v*2 - 3v*2)(6v2 - 11v*2 - 19v*2) + 0v*2 + 0v2 - v4). 53v5 Expand 2w*3 + 2w*3 - 5w3 + (w2 - w*2 - 2w*2)(-3w + 2w + 0w) - 293 + 18w*3 + 293 + (4w - 5w + 0w)(1 - 1 + 2w*2). 17w*3 Expand 60x*2 + 2585 - 2585 - 3x + 3x + x2 + (-2x*2 - x + x)(-5 + 4 - 1) - x*2 + 0x + 0x. 64x*2 Expand (-20 - f - 66 - 19 + 10)(-11f2 - 7f*2 - 3f*2). 21f*3 + 1995f*2 Expand (11 - 15 + 2j - 5)(-3 - 3 - 2)(10 - 10 - j). 16j2 - 72j Expand (4 - 1 - 5)(21 - 160z + 322z - 159z) + (4 - 2 - 1)(5z - z - 2z). -4z - 42 Expand ((-1 + 0 + 3)(-1 + 2 + 1) - 14 - 7 + 7)(-1 - q + 1)(q2 + 2q2 - q2). 20q3 Expand (-1 + 1 + q)(-2 + 0 + 1) - 5q + 4q + 0q + (q - 6q + 3q)(0 - 1 - 2) + 0q + 2q - q + (q + 3q - 3q)(4 - 2 - 1) - q + 2q - 3q. 4q Expand (-4d + 6d + 0d)(-3 + 5 + 2) - 5d - 4 - 2 + 6d. 9d - 6 Expand -4i*3 + 0i*3 + 5i*3 + i - 3i*3 - i + (-4i*3 + 4i3 + i3)(3 - 4 + 0) + 227 + 46i*3 - 227. 43i*3 Expand (s - 4s + s + 2s - 4s + s + (s - 4s + s)(5 + 0 - 3) + 2s + 2s - 6s)(5421 - 5421 - 22s - 3 + 3 - s + (-2 + 2 - 2s)(3 + 0 - 1)). 243s*2 Expand 0y*3 + 0y3 - y3 + (-3y + 3y - 2y)(y*2 + 3y - 3y) + (2y - 5y - 2y)(-26y*2 + 11y*2 + 0y*2). 72y*3 Expand (-3l + l + l)(-102 + 38 + 64 - 446l). 446l2 Expand (u - 3u + u)(2u*4 - 2u*2 + 2u*2) + 2u*2 - 2u*5 - 2u*2 + 2u*5 - 7u*5 + 4u*5 + 1374u*4 - 1374u*4 - 19u*5. -24u*5 Expand (1 - h - 1)(-5h + 0h + 3h) + 3 + h2 - 165h + 165h. 3h*2 + 3 Expand 2v*3 - 3v*3 + 629v - 822v + (0v3 + v3 - 2v3)(4 - 2 - 1). -2v3 - 193v Expand (17 + 52 - 129)(0 + 2p*2 + 0 + (-p + 3p - p)(-2p + 3 - 3) + 1 - 1 - 4p2) - p + p - 2p*2. 238p*2 Expand (-13k + 11k + 6 - k)(3k - 5k + 5k). -9k*2 + 18k Expand (-3q + 0q + 2q + q + 0 + 0 + 2q + 0 + 0 + (4q - 2q + 0q)(-3 + 2 + 2) + 3 - 3 + 2q - 4q - q + 3q + 3q - 6q + 2q)(-4q + 33 + 24 - 54). -12q2 + 9q Expand (5 - 2 - 2)(0 - 167w*4 + 130w*4 - 4). -37w*4 - 4 Expand ((0 + 4 - 2)(-1 + 4 - 2) + (-5 + 0 + 3)(4 + 1 - 4) + 2 - 1 - 2)(1177q + 489q + 293q). -1959q Expand (-3 + 3 - 3)(-6h - 3 + 3)(4 + 1 - 6). -18h Expand -2q2 + 4 - 4 + (3 - 3 - q)(-1203 - 143q + 1203). 141q*2 Expand (2g2 + g2 - g*2)(-5g + 2g + 2g)(-3845 + 3g - g + 3723). -4g*4 + 244g*3 Expand (-5i*2 - 10 + 38i2 + i2)(-4i*2 + 7i2 - i2). 68i4 - 20i*2 Expand 0o + 0o - o2 + (-3 + 3 + 2o*2)(-1214 + 2384 - 1247) - 2o2 - 2o*2 + 6o*2. -153o*2 Expand (-32 + 7 + 3)(-6 + 6 + 3u2). -66u*2 Expand (-2 + 6 - 1)(0v4 - 2v4 + v4) + 2v4 + 13v*4 - 6v*4. 6v*4 Expand -6j*2 - 7j*2 + 19j*2 + 7j*3 + (0 + 0 + 1)(2j3 + 2j*3 - 3j*3) + 4j*3 - 5j3 - j3 - j*3 - 32j + j*2 + 32j. 5j3 + 7j*2 Expand -3h*4 + 2	{ "pile_set_name": "DM Mathematics" }
9:56 PM? 10:27 AM How many minutes are there between 1:41 PM and 8:19 PM? 398 How many minutes are there between 1:19 AM and 11:31 AM? 612 How many minutes are there between 3:50 PM and 1:41 AM? 591 How many minutes are there between 5:12 PM and 2:48 AM? 576 What is 573 minutes after 9:00 PM? 6:33 AM How many minutes are there between 9:59 AM and 7:43 PM? 584 How many minutes are there between 11:04 AM and 5:32 PM? 388 How many minutes are there between 9:53 PM and 4:24 AM? 391 What is 152 minutes before 3:00 PM? 12:28 PM What is 553 minutes after 2:51 PM? 12:04 AM What is 446 minutes after 6:15 AM? 1:41 PM How many minutes are there between 5:14 AM and 1:04 PM? 470 How many minutes are there between 10:35 AM and 10:14 PM? 699 What is 56 minutes before 6:14 PM? 5:18 PM What is 679 minutes before 4:34 AM? 5:15 PM How many minutes are there between 11:11 PM and 10:21 AM? 670 How many minutes are there between 5:07 AM and 12:43 PM? 456 What is 236 minutes after 4:05 AM? 8:01 AM How many minutes are there between 12:04 AM and 9:22 AM? 558 How many minutes are there between 3:46 AM and 6:41 AM? 175 How many minutes are there between 1:36 AM and 1:23 PM? 707 How many minutes are there between 7:48 PM and 6:57 AM? 669 What is 49 minutes after 4:51 AM? 5:40 AM What is 405 minutes after 1:33 AM? 8:18 AM How many minutes are there between 12:59 AM and 11:10 AM? 611 What is 697 minutes after 11:09 AM? 10:46 PM What is 252 minutes after 11:15 AM? 3:27 PM How many minutes are there between 7:00 AM and 3:55 PM? 535 What is 444 minutes before 7:38 PM? 12:14 PM What is 33 minutes before 5:28 AM? 4:55 AM How many minutes are there between 4:00 AM and 7:29 AM? 209 What is 520 minutes after 1:29 PM? 10:09 PM What is 127 minutes after 7:32 AM? 9:39 AM How many minutes are there between 9:40 PM and 11:40 PM? 120 How many minutes are there between 6:25 AM and 7:03 AM? 38 How many minutes are there between 2:10 AM and 11:43 AM? 573 What is 610 minutes before 5:51 AM? 7:41 PM How many minutes are there between 7:20 AM and 2:02 PM? 402 How many minutes are there between 3:13 AM and 12:59 PM? 586 What is 576 minutes after 10:34 PM? 8:10 AM What is 646 minutes before 7:20 PM? 8:34 AM How many minutes are there between 3:21 AM and 3:59 AM? 38 How many minutes are there between 2:28 AM and 12:10 PM? 582 What is 236 minutes before 1:34 PM? 9:38 AM What is 170 minutes after 12:28 PM? 3:18 PM What is 643 minutes before 2:20 AM? 3:37 PM What is 419 minutes after 7:10 AM? 2:09 PM What is 624 minutes before 4:06 PM? 5:42 AM How many minutes are there between 7:28 PM and 8:07 PM? 39 What is 89 minutes before 8:20 AM? 6:51 AM How many minutes are there between 6:49 PM and 3:14 AM? 505 How many minutes are there between 8:23 PM and 2:17 AM? 354 What is 244 minutes before 5:41 PM? 1:37 PM How many minutes are there between 1:53 AM and 5:49 AM? 236 How many minutes are there between 12:36 PM and 7:21 PM? 405 What is 410 minutes after 1:55 PM? 8:45 PM How many minutes are there between 7:34 AM and 9:29 AM? 115 What is 399 minutes before 3:32 AM? 8:53 PM How many minutes are there between 10:39 PM and 12:40 AM? 121 How many minutes are there between 8:55 PM and 9:47 PM? 52 What is 11 minutes before 6:35 AM? 6:24 AM How many minutes are there between 12:53 AM and 6:59 AM? 366 How many minutes are there between 6:21 PM and 1:06 AM? 405 What is 359 minutes before 10:40 PM? 4:41 PM How many minutes are there between 1:39 PM and 2:42 PM? 63 What is 398 minutes after 8:16 PM? 2:54 AM What is 50 minutes before 3:37 PM? 2:47 PM What is 446 minutes after 5:36 PM? 1:02 AM How many minutes are there between 8:28 AM and 2:59 PM? 391 How many minutes are there between 7:24 PM and 1:50 AM? 386 How many minutes are there between 10:02 PM and 3:06 AM? 304 What is 605 minutes after 6:04 AM? 4:09 PM What is 454 minutes after 7:25 PM? 2:59 AM How many minutes are there between 3:31 PM and 2:35 AM? 664 How many minutes are there between 6:20 PM and 1:24 AM? 424 How many minutes are there between 1:50 AM and 10:42 AM? 532 What is 480 minutes after 11:50 AM? 7:50 PM What is 240 minutes before 5:17 PM? 1:17 PM How many minutes are there between 11:01 AM and 7:41 PM? 520 What is 244 minutes before 10:20 AM? 6:16 AM How many minutes are there between 9:52 PM and 2:44 AM? 292 What is 76 minutes before 5:55 PM? 4:39 PM How many minutes are there between 5:32 PM and 12:17 AM? 405 What is 321 minutes before 2:34 AM? 9:13 PM What is 142 minutes before 5:55 PM? 3:33 PM How many minutes are there between 10:52 PM and 2:58 AM? 246 How many minutes are there between 6:39 AM and 10:43 AM? 244 What is 155 minutes before 3:10 PM? 12:35 PM What is 610 minutes before 8:50 AM? 10:40 PM How many minutes are there between 3:24 AM and 2:21 PM? 657 How many minutes are there between 4:20 PM and 11:43 PM? 443 What is 172 minutes before 8:51 AM? 5:59 AM How many minutes are there between 6:28 PM and 11:45 PM? 317 What is 317 minutes before 12:41 PM? 7:24 AM What is 667 minutes before 1:56 PM? 2:49 AM What is 444 minutes after 3:25 PM? 10:49 PM What is 255 minutes after 3:35 PM? 7:50 PM What is 321 minutes before 4:24 PM? 11:03 AM What is 14 minutes after 10:34 PM? 10:48 PM How many minutes are there between 2:36 AM and 5:23 AM? 167 How many minutes are there between 6:12 PM and 9:04 PM? 172 How many minutes are there between 12:51 AM and 7:45 AM? 414 How many minutes are there between 8:59 AM and 11:02 AM? 123 What is 617 minutes after 9:33 PM? 7:50 AM How many minutes are there between 2:20 AM and 10:43 AM? 503 How many minutes are there between 1:39 AM and 2:28 AM? 49 What is 624 minutes after 4:39 AM? 3:03 PM What is 121 minutes before 4:55 PM? 2:54 PM What is 252 minutes after 5:24 AM? 9:36 AM How many minutes are there between 7:02 AM and 5:14 PM? 612 What is 599 minutes after 2:21 AM? 12:20 PM What is 160 minutes before 10:58 AM? 8:18 AM How many minutes are there between 7:52 PM and 10:21 PM? 149 How many minutes are there between 5:51 AM and 12:17 PM? 386 What is 372 minutes after 3:18 PM? 9:30 PM How many minutes are there between 10:03 PM and 10:43 PM? 40 How many minutes are there between 2:20 PM and 5:42 PM? 202 How many minutes are there between 9:22 PM and 11:41 PM? 139 What is 92 minutes after 3:22 PM? 4:54 PM What is 322 minutes before 5:07 AM? 11:45 PM What is 585 minutes before 4:41 AM? 6:56 PM How many minutes are there between 3:31 PM and 9:30 PM? 359 What is 680 minutes before 10:46 AM? 11:26 PM What is 298 minutes after 6:32 AM? 11:30 AM What is 243 minutes after 12:52 AM? 4:55 AM What is 670 minutes after 10:04 PM? 9:14 AM What is 697 minutes before 7:55 AM? 8:18 PM What is 505 minutes after 5:28 AM? 1:53 PM What is 69 minutes after 11:28 AM? 12:37 PM How many minutes are there between 6:45 PM and 4:42 AM? 597 How many minutes are there between 11:58 AM and 12:18 PM? 20 What is 709 minutes before 5:04 PM? 5:15 AM What is 709 minutes before 1:54 AM? 2:05 PM How many minutes are there between 8:03 PM and 7:12 AM? 669 How many minutes are there between 9:32 PM and 5:53 AM? 501 What is 59 minutes before 8:41 AM? 7:42 AM How many minutes are there between 10:47 PM and 9:49 AM? 662 How many minutes are there between 1:38 PM and 1:40 PM? 2 What is 418 minutes after 4:39 PM? 11:37 PM What is 371 minutes before 9:27 PM? 3:16 PM What is 704 minutes after 1:49 AM? 1:33 PM What is 597 minutes before 8:25 AM? 10:28 PM What is 463 minutes after 6:04 PM? 1:47 AM What is 36 minutes before 12:01 PM? 11:25 AM How many minutes are there between 11:12 AM and 9:58 PM? 646 What is 318 minutes after 5:40 AM? 10:58 AM What is 235 minutes before 11:45 AM? 7:50 AM What is 33 minutes before 11:04 PM? 10:31 PM What is 194 minutes before 5:33 PM? 2:19 PM What is 423 minutes after 2:11 AM? 9:14 AM How many minutes are there between 6:03 PM and 6:59 PM? 56 How many minutes are there between 1:12 PM and 6:25 PM? 313 What is 289 minutes before 11:03 PM? 6:14 PM What is 535 minutes before 6:46 PM? 9:51 AM How many minutes are there between 8:07 AM and 7:52 PM? 705 How many minutes are there between 9:00 AM and 8:10 PM? 670 How many minutes are there between 3:42 PM and 10:16 PM? 394 How many minutes are there between 9:10 PM and 4:06	{ "pile_set_name": "DM Mathematics" }
72 What is next in 23070, 23033, 22926, 22713, 22358? 21825 What is the next term in -3742, -3684, -3612, -3520, -3402, -3252? -3064 What is next in 1387, 1679, 2475, 4027, 6587? 10407 What is the next term in 181, 219, 277, 361, 477, 631, 829, 1077? 1381 What comes next: 1399, 1433, 1483, 1543, 1607, 1669? 1723 What comes next: -1386, -1370, -1328, -1248, -1118, -926? -660 What is next in -2556, -2547, -2512, -2439, -2316, -2131? -1872 What comes next: -121306, -242614, -363922? -485230 What is the next term in 109, 165, 271, 445, 705? 1069 What is next in 728, 649, 524, 359, 160? -67 What is next in -107, -516, -1197, -2150? -3375 What is the next term in 392, 502, 690, 956? 1300 What is next in -69, -18, 57, 156, 279? 426 What comes next: 726205, 726210, 726219, 726232, 726249, 726270? 726295 What is the next term in 740, 688, 638, 590, 544, 500, 458? 418 What is the next term in 3499, 3487, 3475, 3463? 3451 What is the next term in -21434, -21388, -21258, -21002, -20578, -19944, -19058? -17878 What is the next term in 14173, 14175, 14177, 14179? 14181 What is the next term in -578, -494, -302, 52, 622, 1462? 2626 What is the next term in -144, -257, -446, -711, -1052, -1469? -1962 What comes next: 9507, 9391, 9061, 8409, 7327, 5707? 3441 What is the next term in -124098, -248195, -372292, -496389, -620486, -744583? -868680 What is the next term in 7017, 7028, 7043, 7062, 7085, 7112, 7143? 7178 What comes next: -563, -1130, -1697, -2264, -2831, -3398? -3965 What comes next: -214, -502, -988, -1678, -2578, -3694, -5032? -6598 What is next in -643620, -1287241, -1930874, -2574525, -3218200, -3861905, -4505646? -5149429 What is next in -88, -662, -2170, -5068, -9812, -16858? -26662 What is the next term in -114334, -228677, -343020? -457363 What is next in 1675, 3350, 5029, 6712, 8399, 10090, 11785? 13484 What is next in 958, 2215, 3484, 4771, 6082, 7423, 8800, 10219? 11686 What is next in -175, -395, -587, -751, -887? -995 What is the next term in -12891, -12892, -12893, -12894? -12895 What comes next: 20, 4, -36, -112, -236, -420, -676, -1016? -1452 What comes next: -1186851, -2373699, -3560547? -4747395 What is the next term in 45222, 90443, 135664? 180885 What comes next: 19, 38, 69, 112, 167? 234 What is next in -87596, -87597, -87598, -87599, -87600? -87601 What comes next: 709, 2821, 6363, 11353, 17809, 25749, 35191? 46153 What is the next term in -46, -99, -172, -277, -426, -631? -904 What is the next term in 847, 1707, 2567, 3427, 4287? 5147 What is next in 993, 4084, 9237, 16452, 25729? 37068 What is the next term in 6340, 6404, 6464, 6520, 6572, 6620? 6664 What is next in -13734, -13725, -13708, -13683? -13650 What is the next term in -52424, -104845, -157266, -209687, -262108? -314529 What is the next term in -548, -1176, -1840, -2540, -3276, -4048? -4856 What comes next: -900, -1033, -1166, -1299, -1432, -1565? -1698 What is next in -12, 45, 162, 357, 648? 1053 What is the next term in -13511, -13504, -13511, -13538, -13591, -13676, -13799, -13966? -14183 What comes next: 2799, 5566, 8319, 11052, 13759, 16434, 19071, 21664? 24207 What comes next: 1505, 11743, 39527, 93629, 182821, 315875, 501563? 748657 What comes next: -3429, -4419, -6069, -8379, -11349, -14979, -19269? -24219 What comes next: 13724, 13728, 13736, 13748, 13764? 13784 What is next in 1759, 1777, 1795, 1813? 1831 What is next in -30, -85, -174, -297, -454, -645, -870? -1129 What is the next term in -3197, -12767, -28717, -51047, -79757? -114847 What is the next term in -75889, -303584, -683075, -1214362? -1897445 What comes next: 234, -23, -714, -2055, -4262, -7551, -12138, -18239? -26070 What is the next term in 322, -142, -916, -2000? -3394 What is the next term in -57686, -57689, -57694, -57701, -57710, -57721? -57734 What comes next: -334, -457, -588, -727? -874 What is the next term in 480, 1807, 4034, 7179, 11260, 16295, 22302, 29299? 37304 What comes next: -1251, -4954, -11125, -19764, -30871, -44446, -60489? -79000 What comes next: -2141, -4202, -6263, -8324, -10385, -12446? -14507 What is the next term in 5375, 10766, 16171, 21596, 27047, 32530, 38051, 43616? 49231 What is next in 10102, 10099, 10096, 10093? 10090 What is next in -83, 71, 315, 649, 1073, 1587? 2191 What comes next: -6538, -12941, -19344, -25747, -32150? -38553 What is next in -1462502, -1462504, -1462506, -1462508? -1462510 What is next in 381, 2132, 5047, 9126, 14369, 20776? 28347 What is the next term in 47219, 47216, 47213, 47210? 47207 What is the next term in -382, -476, -630, -844, -1118, -1452, -1846? -2300 What is next in -1014, -2057, -3098, -4137, -5174, -6209, -7242? -8273 What comes next: 707578, 1415155, 2122732, 2830309, 3537886, 4245463? 4953040 What comes next: -28198, -28215, -28242, -28279, -28326, -28383? -28450 What is next in 896, 1785, 2672, 3557, 4440, 5321? 6200 What comes next: -133, -109, -93, -85? -85 What is the next term in -811678, -811681, -811684? -811687 What is next in -533, -659, -863, -1145, -1505, -1943, -2459? -3053 What comes next: 20856, 41730, 62604? 83478 What is the next term in 5978, 5972, 5966, 5960, 5954? 5948 What is the next term in -26672, -53349, -80026, -106703, -133380? -160057 What is the next term in -457536, -915074, -1372612? -1830150 What is the next term in 1230, 3080, 5556, 8664, 12410, 16800, 21840, 27536? 33894 What is the next term in 418, 1671, 3770, 6727, 10554, 15263, 20866? 27375 What is next in 70006, 70059, 70206, 70495, 70974? 71691 What comes next: 317, 586, 857, 1130, 1405? 1682 What is next in 3125710, 3125715, 3125724, 3125737, 3125754? 3125775 What is next in -10821, -21650, -32481, -43314, -54149? -64986 What comes next: -430, -1738, -3904, -6916, -10762, -15430, -20908, -27184? -34246 What is the next term in 48974, 48977, 48980? 48983 What is next in 2424, 2417, 2410, 2409, 2420, 2449, 2502? 2585 What is next in -797, -561, -327, -95? 135 What is the next term in -128771, -128730, -128669, -128594, -128511? -128426 What is next in -56206, -56202, -56196, -56188, -56178, -56166, -56152? -56136 What is the next term in 944, 1900, 2866, 3842, 4828? 5824 What is next in -107, -338, -835, -1730, -3155? -5242 What is the next term in -152, -258, -360, -452, -528, -582, -608? -600 What is the next term in -161, -105, 69, 421, 1011, 1899, 3145, 4809? 6951 What comes next: -3472, -5793, -8114, -10435? -12756 What comes next: 55, 138, 283, 496, 783? 1150 What comes next: 6271, 6272, 6271, 6268, 6263, 6256? 6247 What is the next term in 50515, 101019, 151513, 201991, 252447, 302875, 353269? 403623 What comes next: -934, -1635, -2336, -3037, -3738, -4439? -5140 What comes next: 275, 296, 361, 494, 719? 1060 What comes next: 81, 1043, 3779, 9177, 18125, 31511? 50223 What is next in 3086, 3083, 3080, 3077, 3074? 3071 What is next in 38839, 77695, 116551, 155407, 194263, 233119? 271975 What is next in -82, -39, 52, 215, 474? 853 What is the next term in 197, 390, 597, 824, 1077, 1362, 1685? 2052 What comes next: 3, -322, -975, -1956, -3265, -4902? -6867 What is the next term in -765, -1383, -1863, -2205? -2409 What is the next term in -54845, -109668, -164491? -219314 What is the next term in -459, -859, -1247, -1617, -1963, -2279? -2559 What is next in 1934, 15457, 52162, 123641, 241486, 417289, 662642, 989137? 1408366 What is the next term in -5861, -5772, -5683, -5594, -5505, -5416? -5327 What is next in -1324, -1344, -1364, -1384? -1404 What comes next: -19859, -19857, -19855, -19853, -19851, -19849? -19847 What is the next term in 1254, 2397, 3540, 4683? 5826 What is next in -70320, -70323, -70328, -70335, -70344, -70355? -70368 What comes next: -56, -301, -748, -1397, -2248? -3301 What comes next: -143, -1153, -3911, -9293, -18175, -31433? -49943 What comes next: 54807, 109627, 164459, 219303, 274159? 329027 What is the next term in -509, -943, -1377, -1811, -2245, -2679? -3113 What is the next term in 13282, 13296, 13328, 13384, 13470? 13592 What is the next term in 16309, 32633, 48969, 65323, 81701? 98109 What is next in -119534, -239051, -358558, -478049, -597518? -716959 What comes next: -73977, -73979, -73981, -73983, -73985, -73987? -73989 What is the next term in -100272, -100271, -100270? -100269 What is the n	{ "pile_set_name": "DM Mathematics" }
ommon multiple of 33 and 99. 99 Calculate the least common multiple of 1064 and 22. 11704 Calculate the least common multiple of 192 and 36. 576 What is the common denominator of -7/152 and -33/380? 760 Calculate the common denominator of 107/24 and 95/24. 24 Calculate the least common multiple of 8 and 1752. 1752 Find the common denominator of 89/234 and -44/39. 234 Calculate the lowest common multiple of 230 and 18. 2070 Calculate the smallest common multiple of 6 and 25. 150 Calculate the smallest common multiple of 2197 and 65. 10985 Calculate the common denominator of -43/21 and -34/285. 1995 Calculate the common denominator of -1/4 and 7/66. 132 What is the common denominator of -44/1017 and 29/1243? 11187 What is the lowest common multiple of 3729 and 678? 7458 Calculate the lowest common multiple of 66 and 5. 330 What is the smallest common multiple of 36 and 6300? 6300 What is the common denominator of 41/30 and 11/425? 2550 Find the common denominator of 75/28 and 13/120. 840 What is the common denominator of -139/48 and -169/30? 240 Find the common denominator of -143/60 and 151/24. 120 Calculate the common denominator of 49/1180 and 39/80. 4720 Calculate the common denominator of 17/18 and -19/198. 198 Calculate the smallest common multiple of 2504 and 20. 12520 Calculate the common denominator of 47/20 and -1/160. 160 What is the common denominator of 43/98 and 23/56? 392 Calculate the least common multiple of 144 and 42. 1008 Calculate the least common multiple of 15 and 288. 1440 Calculate the smallest common multiple of 1340 and 12. 4020 What is the smallest common multiple of 24 and 66? 264 Calculate the least common multiple of 12008 and 760. 60040 What is the lowest common multiple of 6 and 2721? 5442 What is the common denominator of 75/344 and 77/1032? 1032 Calculate the smallest common multiple of 4 and 8. 8 What is the smallest common multiple of 39 and 130? 390 What is the common denominator of 2/333 and -41/18? 666 Calculate the common denominator of -19/15 and 91/31296. 156480 What is the smallest common multiple of 42 and 147? 294 Find the common denominator of 31/3342 and 49/16. 26736 What is the least common multiple of 4728 and 5319? 42552 Find the common denominator of 61/35332 and -59/10. 176660 Calculate the common denominator of 13/5700 and 163/2280. 11400 Calculate the common denominator of 4/63 and 25/24. 504 What is the common denominator of 19/10417 and 121/5682? 62502 Calculate the common denominator of -49/104 and -111/130. 520 Calculate the least common multiple of 535 and 1070. 1070 What is the lowest common multiple of 22 and 58? 638 Calculate the smallest common multiple of 4212 and 6. 4212 What is the lowest common multiple of 155 and 341? 1705 What is the least common multiple of 36 and 640? 5760 Find the common denominator of -41/18 and 101/122. 1098 Calculate the common denominator of -77/3510 and -13/330. 38610 What is the common denominator of -25/2 and 5/18? 18 Calculate the common denominator of 73/630 and 61/4900. 44100 Find the common denominator of 119/12 and 23/12942. 25884 What is the smallest common multiple of 9 and 26? 234 What is the smallest common multiple of 340 and 5100? 5100 Calculate the common denominator of 151/2808 and 139/468. 2808 Calculate the least common multiple of 100 and 40. 200 Calculate the smallest common multiple of 2898 and 4830. 14490 Find the common denominator of -73/12 and -113/48. 48 Calculate the least common multiple of 80 and 56. 560 What is the lowest common multiple of 2898 and 24? 11592 Find the common denominator of -77/10 and -41/51. 510 Calculate the least common multiple of 2 and 2552. 2552 Calculate the common denominator of -181/30 and 73/45. 90 Find the common denominator of 22/19 and -51/125. 2375 Calculate the smallest common multiple of 886 and 16. 7088 Find the common denominator of 8/429 and -54/77. 3003 What is the common denominator of 19/90 and 187/90? 90 What is the lowest common multiple of 1394 and 410? 6970 Calculate the common denominator of -37/110 and -9/121. 1210 Find the common denominator of 89/128 and -39/16. 128 Calculate the smallest common multiple of 59 and 729. 43011 Calculate the common denominator of -1/304 and 111/190. 1520 What is the common denominator of 103/372 and -23/310? 1860 Calculate the common denominator of 16/231 and -71/88. 1848 Find the common denominator of -57/2 and 89/930. 930 Calculate the lowest common multiple of 2508 and 1980. 37620 What is the lowest common multiple of 69 and 558? 12834 Find the common denominator of -113/14 and -19/336. 336 Calculate the lowest common multiple of 1107 and 9. 1107 Calculate the common denominator of -35/6 and 44/295. 1770 Calculate the smallest common multiple of 530 and 120. 6360 What is the smallest common multiple of 144 and 240? 720 Calculate the least common multiple of 1192 and 1. 1192 Find the common denominator of -65/3 and -61/36. 36 Find the common denominator of -35/1846 and -41/6. 5538 What is the smallest common multiple of 23 and 15? 345 Calculate the smallest common multiple of 88 and 24. 264 Calculate the common denominator of -3/1498 and -89/4280. 29960 What is the common denominator of 103/240 and -83/8? 240 Calculate the least common multiple of 9347 and 13. 9347 Find the common denominator of 143/60 and 73/564. 2820 Calculate the lowest common multiple of 45 and 3180. 9540 What is the smallest common multiple of 424 and 12? 1272 What is the common denominator of -22/575 and -37/75? 1725 Calculate the common denominator of -101/138 and 85/184. 552 Calculate the common denominator of -37/10 and 33/5. 10 Calculate the common denominator of -23/68 and 54/697. 2788 What is the lowest common multiple of 2 and 18? 18 Calculate the common denominator of 7/8 and -73/196. 392 What is the common denominator of 65/93 and 5/31? 93 What is the least common multiple of 744 and 2? 744 What is the lowest common multiple of 4 and 1499? 5996 What is the common denominator of 59/32 and -69/236? 1888 Find the common denominator of -91/12 and -5/1196. 3588 Calculate the common denominator of -25/22434 and -89/45. 336510 What is the common denominator of 19/264 and 85/24? 264 What is the lowest common multiple of 2 and 7726? 7726 Calculate the least common multiple of 120 and 1020. 2040 What is the common denominator of -89/28 and 77/124? 868 Calculate the least common multiple of 210 and 2952. 103320 Find the common denominator of 61/210 and -86/525. 1050 Find the common denominator of -81/16 and -15/6052. 24208 Calculate the smallest common multiple of 14 and 104462. 731234 Calculate the lowest common multiple of 21 and 387. 2709 Calculate the least common multiple of 36 and 48. 144 What is the smallest common multiple of 225 and 405? 2025 What is the lowest common multiple of 168 and 56? 168 Calculate the common denominator of -27/44 and -34/121. 484 What is the common denominator of 68/75 and -28/25? 75 Calculate the common denominator of 41/63 and 103/12. 252 What is the least common multiple of 437 and 9? 3933 What is the common denominator of -65/1104 and 47/1380? 5520 What is the least common multiple of 14624 and 2? 14624 Calculate the common denominator of -161/180 and -127/1890. 3780 What is the common denominator of -109/10 and 17/428? 2140 Find the common denominator of -121/84 and -7/348. 2436 Calculate the common denominator of -79/22 and -40/363. 726 Calculate the least common multiple of 49 and 63. 441 Find the common denominator of 151/204 and 3/8. 408 Calculate the common denominator of 43/85 and -107/102. 510 What is the common denominator of 49/345 and -74/45? 1035 Find the common denominator of -13/12 and 3/62. 372 Find the common denominator of 181/2880 and 23/6. 2880 Calculate the common denominator of -58/55 and 27/3140. 34540 What is the least common multiple of 22 and 10? 110 What is the smallest common multiple of 48 and 4? 48 Calculate the least common multiple of 145 and 20. 580 Calculate the lowest common multiple of 374 and 1088. 11968 What is the lowest common multiple of 24 and 114? 456 What is the smallest common multiple of 700 and 560? 2800 What is the common denominator of -109/250 and -23/400? 2000 What is the common denom	{ "pile_set_name": "DM Mathematics" }
92 and -49/1824. 12768 What is the smallest common multiple of 195 and 78? 390 What is the least common multiple of 423 and 47? 423 Find the common denominator of -19/358 and 83/6. 1074 What is the common denominator of -103/912 and -109/384? 7296 What is the smallest common multiple of 4 and 812? 812 Find the common denominator of -33 and -50/41. 41 Calculate the lowest common multiple of 168 and 12. 168 What is the smallest common multiple of 75 and 81? 2025 Find the common denominator of 121/812 and 61/1624. 1624 Calculate the least common multiple of 30 and 6. 30 What is the least common multiple of 4190 and 16? 33520 Calculate the common denominator of 37/16 and -113/1602. 12816 Calculate the lowest common multiple of 344 and 3483. 27864 Find the common denominator of -89/66 and -17/3. 66 Calculate the smallest common multiple of 44 and 24. 264 What is the lowest common multiple of 176 and 22? 176 What is the lowest common multiple of 112 and 8? 112 Calculate the common denominator of 37/22 and 41/20. 220 Calculate the least common multiple of 45 and 24. 360 Calculate the common denominator of -43/7 and -9/6979. 6979 What is the smallest common multiple of 12 and 24? 24 Calculate the lowest common multiple of 40 and 2460. 4920 Calculate the lowest common multiple of 376 and 752. 752 Find the common denominator of 23/5088 and -17/54. 45792 Calculate the least common multiple of 11376 and 32. 22752 Find the common denominator of -43/1083 and -4/21. 7581 Calculate the least common multiple of 441 and 441. 441 What is the smallest common multiple of 7900 and 1264? 31600 Calculate the common denominator of -58/2807 and 85/42. 16842 Calculate the common denominator of -62/5 and -37/578. 2890 What is the least common multiple of 168 and 96? 672 Calculate the common denominator of 58/105 and -61/60. 420 What is the common denominator of -1/9 and -53/5? 45 Calculate the smallest common multiple of 450 and 198. 4950 What is the common denominator of 89/8 and 3/20324? 40648 What is the common denominator of -51/5 and 99/11936? 59680 Calculate the lowest common multiple of 11913 and 6. 23826 Find the common denominator of 37/45 and 76/75. 225 What is the common denominator of 83/345 and 9/460? 1380 Calculate the lowest common multiple of 4 and 17664. 17664 What is the lowest common multiple of 62 and 190? 5890 Calculate the least common multiple of 11673 and 1297. 11673 Calculate the lowest common multiple of 205 and 123. 615 Calculate the lowest common multiple of 4 and 21. 84 Find the common denominator of 115/798 and -155/456. 3192 Calculate the common denominator of -109/24 and 91/372. 744 What is the common denominator of -13/18 and 25/2? 18 What is the lowest common multiple of 18 and 34? 306 What is the common denominator of 43/3696 and 73/672? 7392 What is the lowest common multiple of 24 and 488? 1464 What is the lowest common multiple of 2 and 1400? 1400 Calculate the lowest common multiple of 201 and 268. 804 Find the common denominator of -61/84 and 145/96. 672 What is the lowest common multiple of 1 and 75? 75 What is the lowest common multiple of 18 and 1158? 3474 Calculate the common denominator of 55/456 and -3/133. 3192 Calculate the lowest common multiple of 8 and 99. 792 What is the least common multiple of 155 and 155? 155 What is the least common multiple of 755 and 5? 755 What is the lowest common multiple of 444 and 120? 4440 Calculate the lowest common multiple of 33 and 561. 561 Find the common denominator of -115/154 and -53/7. 154 Find the common denominator of -127/162 and 35/54. 162 What is the lowest common multiple of 1240 and 310? 1240 What is the common denominator of 13/3116 and -107/114? 9348 What is the common denominator of -19/5 and 32/5? 5 What is the common denominator of -5/384 and 25/12? 384 Calculate the least common multiple of 300 and 39. 3900 Calculate the common denominator of -13/180 and 11/54. 540 What is the smallest common multiple of 456 and 9576? 9576 Calculate the common denominator of 8/153 and -16/15. 765 What is the lowest common multiple of 166 and 10? 830 Calculate the least common multiple of 1120 and 616. 12320 Find the common denominator of -143/12 and -19/40. 120 Find the common denominator of 181/7140 and -37/680. 14280 Calculate the lowest common multiple of 6 and 4029. 8058 Find the common denominator of -11/1220 and 39/1220. 1220 Calculate the common denominator of 74/33 and -139/18. 198 What is the common denominator of 13/682 and -73/198? 6138 What is the smallest common multiple of 30 and 213? 2130 Calculate the least common multiple of 176 and 55. 880 Calculate the common denominator of 9/6244 and 45/112. 24976 Calculate the common denominator of -61/6828 and 83/90. 102420 What is the common denominator of 117/10 and 43/907? 9070 What is the common denominator of 47/3 and 29/20? 60 What is the common denominator of -58/27 and 26/189? 189 What is the smallest common multiple of 9 and 256? 2304 Calculate the smallest common multiple of 498 and 13. 6474 Calculate the common denominator of -37/580 and -23/30. 1740 Find the common denominator of -53/88 and -9/544. 5984 Calculate the lowest common multiple of 64 and 124. 1984 Calculate the least common multiple of 154 and 5166. 56826 What is the least common multiple of 10 and 126? 630 Find the common denominator of -16/11 and 8/723. 7953 What is the common denominator of 11/422 and -15/16? 3376 Calculate the common denominator of 65/16 and 119/32982. 263856 Find the common denominator of -87/2354 and 51/107. 2354 Calculate the lowest common multiple of 513 and 19. 513 Calculate the smallest common multiple of 16 and 28. 112 What is the common denominator of -13/116 and 55/8? 232 What is the common denominator of 43/84 and -46/357? 1428 Find the common denominator of -47/22 and -57/52. 572 Calculate the lowest common multiple of 10059 and 5. 50295 Calculate the least common multiple of 2912 and 3536. 49504 Calculate the lowest common multiple of 8 and 72. 72 What is the common denominator of -28/36279 and -36/7? 253953 Calculate the least common multiple of 24 and 48. 48 Find the common denominator of 101/12150 and -151/180. 24300 Find the common denominator of -26/2079 and -4/1089. 22869 Calculate the least common multiple of 3 and 65. 195 Calculate the smallest common multiple of 792 and 792. 792 What is the lowest common multiple of 854 and 1220? 8540 Calculate the common denominator of 9/1210 and 181/990. 10890 Calculate the common denominator of 137/18 and -17/36. 36 What is the common denominator of 41/8 and 7/181? 1448 What is the lowest common multiple of 224 and 1547? 49504 Calculate the lowest common multiple of 512 and 352. 5632 What is the common denominator of 41/7 and -63/304? 2128 Calculate the least common multiple of 88 and 176. 176 What is the common denominator of 55/111 and 46/629? 1887 Calculate the common denominator of 36/667 and -23/203. 4669 What is the least common multiple of 27 and 6? 54 Calculate the common denominator of -5/48 and -25/12. 48 What is the least common multiple of 876 and 438? 876 What is the common denominator of 101/28 and 41/6156? 43092 Find the common denominator of 65/414 and 26/5. 2070 Calculate the least common multiple of 204 and 48. 816 What is the common denominator of 21/61 and -99/268? 16348 What is the smallest common multiple of 20 and 70? 140 Calculate the common denominator of 81/64 and 93/20. 320 Calculate the smallest common multiple of 32 and 106. 1696 Calculate the common denominator of 99/1952 and -35/61. 1952 What is the least common multiple of 24 and 87? 696 What is the lowest common multiple of 52 and 2? 52 What is the least common multiple of 8716 and 8? 17432 Calculate the lowest common multiple of 78 and 234. 234 Calculate the common denominator of 149/576 and -151/36. 576 Calculate the common denominator of 64/33 and -47/363. 363 What is the common denominator of 53/19 and 1/11? 209 Calculate the common denominator of -41/1368 and -68/81. 12312 Calculate the smallest common multiple of 114 and 3. 114 Calculate the common denominator of 111/1210 and 71/484. 2420 Calculate the least common multiple of 2 and 275. 550 Find the common denominator of -77/1024 and -1	{ "pile_set_name": "DM Mathematics" }
r g. -3 Let x(t) = 2t2 + 24t + 25. Let p be x(-11). Solve 0b = -j - 4b + 4, pj - 2b - 12 = 0 for j. 4 Let y = 20309 + -20300. Solve -s - 4 = g, -4s = -2g + 49 - y for s. -8 Let f be 32/6 + 34 + 6784/(-192). Solve 4 = 107h - 109h + 2l, 0 = fh + 4l for h. -1 Let c be 0/(-1) - 14/(-7). Suppose 91 = 5u - cf, 5u + 2f = -0f + 99. Suppose -u = -5o - 4. Solve r + 14 = oz - r, 2r = -3z - 2 for z. 2 Let q(b) = 2b - 1 - 3 + 3 + 3b3 - b2. Let c be q(1). Suppose -9z + 2s + 3s + 58 = 0, -5z = -s - 34. Solve i = o - c, 3o - zi - 11 = -2i for o. 2 Let t(b) = 37b - 12. Let z be t(6). Suppose -3v + 5w - z = 0, 3v + 3w = w - 231. Let k be (-5)/v56. Solve 1 - 13 = -3f, -18 = 5l - kf for l. -2 Suppose i - 14 = 2j, 3i - 5j = 34 + 4. Let p(n) = 17n - 96. Let z be p(i). Solve -4o = 3h - h + z, -h = -3o - 2 for h. -1 Let l(f) = f*2 + 118f - 607. Let k be l(5). Solve -3m - 10h = -9h - k, h = -m + 4 for m. 2 Suppose 37p - 32p + 145 = 3v, v - 3p = 43. Suppose -v + 10 = -15g. Let x(a) = a*3 + 1. Let s be x(-1). Solve 0 = 4f + c + 3, -gf + 3 + s = -c for f. 0 Let y(b) = b2 - 12b + 2. Suppose 16q - 48 = 12q. Let w be y(q). Solve 4d + 8 = -4n, wn + 4 = -3d + 1 for n. -3 Let g = 43728 - 43725. Solve -2l - 21 = 5c, 0 = 4l - 7c + 8c - g for l. 2 Let l be -2 + (-18)/(-6) + 4. Suppose lb - g + 4 - 16 = 0, 5g + 10 = 0. Solve -2c + 8 = -bj, 4j = c - 4 - 3 for c. 3 Suppose -13 = -3w - 4p, 4w = 6p - 2p + 64. Solve -8 = -4r, -5h + 12r - wr - 22 = 0 for h. -4 Let u(v) = 10v*2 + 75v - 29. Let f be u(-8). Solve 5 = -3b + 4b, -b - f = 4c for c. -4 Let v = 7 - 3. Let w be 16/(-3 + 5) + -2. Suppose -vb + b = -w. Solve -k + b = 4x, -12 = -2x + k + 4k for x. 1 Let x = -391 - -397. Let f be -7 + (x - (-6 - -2)). Solve -2m + fm - 2b = -3, b - 6 = -4m for m. 1 Let c = -391 + 231. Let r = 177 + c. Solve -m + 5 = -o, -4o + r = 4m - 3 for o. 0 Suppose -81f + 69f + 36 = 0. Solve -2t - 4k = ft + 7, 2t = -4k + 2 for t. -3 Let j be 225(20 - (-2970)/(-150)). Solve 4d + 17 = w, -jd - 4w + 12 = -12d for d. -4 Let a(p) be the first derivative of p*4/2 - 31p*3/3 + 7p*2 + 19p - 254. Let h be a(15). Solve -o - 5c = 3, -o + 9 = -ho - 3c for o. -3 Let p = 74 + -63. Let d be (p - 50)/(6/(-10)). Suppose -4v + d = -3m - 16, -v + 15 = m. Solve 3i - 4h = v, 2h = -1 - 5 for i. 2 Let p = -1857 - -1857. Solve t - 4 = f, pf - 4 = -4f for t. 5 Suppose -27 = -t - 5m, -5t + 6t - m - 3 = 0. Suppose -2n + n = -tn. Solve -r = -4j + 12, n = -r - 0r - 4 for j. 2 Let x be 2 - 3/60/7. Solve v - 24 = -f + 6v, -xf + 4v + 24 = 0 for f. 4 Let i(p) = 2p*2 - 3p - 7. Let u(j) = -j*2 + 31j + 35. Let g be u(32). Let x be i(g). Solve 3r + 0r + 3n = -3, n - 1 = -xr for r. 2 Let a = 117 - 117. Let s be (-3)/((-10)/(180/27)). Solve sq = -v - 2, a = 3q - 2v - 0v - 4 for q. 0 Let h(m) = m*3 + 4m*2 + 8. Let y be h(-4). Let i be y/(-4) - 0 - (-6)/3. Solve 4a + a + 20 = 4s, i = -4s for a. -4 Let a be (-1)/(-6) - 2/12. Suppose a = -t - 28. Let m be 21/t4(-1 - 0). Solve 5k - mk + 2c = 2, -5c = -2k - 12 for k. -1 Suppose -5b - 2323 = -3o, o + 3b = -b + 780. Suppose -4d + o = 168. Suppose -8u + 12u = d. Solve -4f = 2q - 6, -5f - 8 + u = -2q for f. 4 Let o be -3 - 1 - 5/((-5)/(-168)). Let u = -168 - o. Solve 4l + 4 = ux, -4l - 10 = -5x - 1 for l. 4 Let g(q) = -2q*2 + 5. Suppose -b - b + b = 0. Let k be g(b). Let i be ((-2)/k)/((-17)/170). Solve -iw = 5x - 40 + 7, w - 2 = 0 for x. 5 Let p = -28588 - -28591. Solve -2a - 130 = 4d - 118, 15 = -3d - pa for d. -1 Suppose 0 = 399x - 422x + 203 + 579. Solve -2d = 3t + 10, -5d - x = 3t - 27 for d. 1 Let n(j) = 3j*2 - 18. Let l be n(3). Suppose 0w = 3w. Suppose -v = -u, 3u - 12 = -wu - 3v. Solve -uy + 5y + l = g, 5g - 4y = 12 for g. 0 Let b be 7659/1449 - (-2)/(-7). Suppose -3d = -23 - 25. Solve 2y + bc - 20 = y, -y + 4c - d = 0 for y. 0 Let m be (3(-4)/10)/(29(-60)/14500). Solve 0 = 4x + 20, -4p + 13x = mx - 11 for p. -1 Let m be 5 + -7 - -7 - (11 + -10). Suppose 2f - 1 = -3. Let b be f + 3 - (-150)/15. Solve -5c - 52 = 5z - b, 3z - m = 4c for z. -4 Let f be 261/(-4). Let c be (-6)/8 - f/4. Solve 3i + 1 = -d, d - 3d + i + 12 = c for d. 5 Suppose 5z + 2y = 339, -80 = -3z + 3y + 115. Solve 3i - 2u = 17, -63i - 21 = -zi + u for i. 5 Suppose 0 = 12n - 3n - 36. Suppose -6a + a = -90. Suppose 3z + nr = a, 5r - 18 + 1 = -z. Solve 1 = x - zb, -x - 11 = -6x + 4b for x. 3 Let x(d) = -218 + 73 + 79 + d + 87 + d*3 + 19d*2. Let i be x(-19). Solve -in = 5f + 8, -3n + 3f = -5n - 8 for n. -4 Suppose 46v - 55v + 99 = 0. Suppose vm = 14m - 6. Solve -3u - my - 2y + 1 = 0, 4y = 16 for u. -5 Let c be -2(-3)/(-12)-6. Let f be -6 + 6 + -74 - 3. Let z = -72 - f. Solve zx + cw = 5, -x + 1 = -w + 5w for x. 1 Let x(p) = -p3 - 14p*2 - 52p - 32. Let u be x(-5). Solve 16t - uh + 20 = 15t, -3t - 2h = 5 for t. -5 Let h be (-8)/(-28) + 24/14. Let m(s) = s2 + 78s - 312. Let k be m(4). Solve 5 = hy - 0a + 5a, 3y - a - k = 0 for y. 5 Let p be 27 - (4/(-18) + 18/81). Let y(q) = -q*2 + 11q + 80. Let g be y(16). Solve -4f + 5k = -p, -4k + gk - 12 = 0 for f. 3 Let w(d) = -3d2 - 26d + 9. Let p be w(-9). Suppose -5x + 2h = -2 - 13, -x - h + 10 = p. Solve -xf = -2u - 3, u - 1 = 2f - 3 for u. -4 Suppose g - 296 = v, 5v + 1479 = 5g + v. Let b = 300 - g. Solve 2a = bm, -7 = -a - 2m + 2 for a. 5 Let q = -14793 + 14798. Solve 2d + q = -5r, -r - 12d + 22 = -7d for r. -3 Let n be (-84)/(-24)72/21. Suppose 5o + no = 476. Solve 0 = 3z - 2x + 6, z - 5z - o = 4x for z. -4 Suppose -p - 10p + 165 = 0. Let x be (10 - 2) + -11 + p. Solve -6z = -2z - 3k + x, -3k = -5z - 15 for z. -3 Let x(k) = k - 3. Let i be x(8). Let h be (1 + 1)/((-4)/(-10)). Solve -4l + id = -37, -hd - 14 = -3l - 4d for l. 3 Let j = -733 + 746. Solve 2i + 3 = 5v - j, -v = i - 6 for i. 2 Suppose 0 = -f - 4g - 25, -6g - 4 = -4g. Let j = f + 21. Suppose 5t = 19 - j. Solve -16 = 5s + 4c, -2s + c = -tc - 16 for s. 0 Let d(w) = 6w2 + 121w + 236. Let q be d(-2). Solve 5h - 22s - 5 = -qs, -30 = -2h - 4s for h. 5 Suppose -48 + 8 = p. Let c = 87 + p. Let y = c + -43. Solve -5r - 20 = -s, 2s + yr - 7r - 5 = 0 for s. -5 Suppose 15b - 1272 = 3b. Suppose -21y - 1 = -b. Solve yt + 2m = 11 - 4, t + 4 = 5m for t. 1 Let o = -1125 - -1155. Solve -c + 1 = 2d, 4d - 3c - o = -d for d. 3 Let c = 2303 + -2299. Solve 2j - a = -4, -cj = j - 5a + 5 for j. -3 Suppose 40 = 2z + 16. Suppose -105g + 104g + z = 0. Suppose 5a = 2u + 17, -4u - a + 9 = -g. Solve -7k + 2k = -h - 9, -3k - 13 = uh for k. 1 Let k = 1767 + -911. Let t = -854 + k. Solve -3r + 3p - 6 = -0r, -p + t = -3r for r. 0 Let x be (16 + (-616)/35)(-30)/4. Solve -86 = -n - 5o - 101, 0 = 4n + 4o + x for n. 0 Suppose -36l = -33l + 107l. Solve 5z - 3v + 6 = l, -3v + 8v + 18 = -z for z. -3 Let c be 140/(-40)(-160)/112. Solve -cf + 3d - 41 = -1, 0 = -f + 5d - 30 for f. -5 Let d(a) = a. Let b be d(3). Suppose 2z + 5i + 22 = 4z, 0 = -z - 2i - 7. Solve -2g - y = -g + z, y + b = -2g for g. -2 Suppose -3o + 25 = 5u - 8o, -u + 5o + 5 = 0. Let p = -62 + 65. Suppose 0 = 3n + ps + 3, -5n + 4s + 40 = 0. Solve -w - 5k = 4w + u, nw + 19 = k for w. -4 Suppose 5h - 2h - 4f = 163, -f = 4h - 211. Let a = -111 + 160. Let p = h - a. Solve 4t + 5l - 11 = 0, -pt - l + 6l - 19 = 0 for t. -1 Suppose -w = -5b + 33, -2b + 2w = -2w - 6. Let d be (-28)/(-42)90/(-4). Let g = 5 - d. Solve -4q = g, -3s + 5q + 6 = -b for s. -4 Let m be (-35)/9 + 3 - (-2)/(-18). Let z be 2/m170/(-20) - 1. Solve 0j - 4j - z = -2u, -u - 13 = 5j for u. 2 Suppose 3g + 5y + 4 = 0, -12y - 32 = -4g - 0y. Solve -r + 4r + 2m = -2, -5m + 14 = -gr for r. -2 Suppose 3803m - 3799m + 3n - 2019 = 0, 0 = 4m - 4n - 2012. Solve -x + 12 = -2v, -3x + mv + 30 = 499v for x. 0 Let t = 23 - -38. Suppose 4q - 4y - 300 = 0, 2q + 3y - t = 109. Let k = q + -78. Solve -d + 9 + k = -2u, -u - 4d = 5 for u. -5 Let z(o) = -o + 22. Let c be z(7). Let i(t) = -t + 3. Let l be i(c). Let d be (l/(-18))	{ "pile_set_name": "DM Mathematics" }
80f3g - 72fg3 Find the first derivative of b3 - 3bt*2 + 3btx*3 - 4t*2x - 3tx*3 wrt b. 3b*2 - 3t*2 + 3tx3 Find the second derivative of 8v*3 + 124v*2 - 5892v. 48v + 248 What is the second derivative of -601a*2z + 3az - 12z wrt a? -1202z What is the third derivative of -2gk*3r + 5gk*2r*2y - 3gkr3y + gkr*2 + 8gr2y + gr2 - 409k*3r*3y wrt r? -18gky - 2454k*3y Find the second derivative of 2a2d*2p - a*2dp + 2ad2p - 2adp + 3ap - 6 wrt a. 4d*2p - 2dp What is the derivative of 18cdu2 - 2cd + 7cu + 2du2 - 6d - 307u2 wrt d? 18cu2 - 2c + 2u2 - 6 What is the second derivative of 347b*2z*3 - 188bz3 - 3bz2 wrt b? 694z*3 Differentiate 134kqv*2 + 2kv3 - 12qv3 - 2v*3 - 9v*2 wrt k. 134qv2 + 2v*3 What is the third derivative of 7p*5v*3 - 91p*5v2 - p2v + 3p*2 - 24pv3 wrt p? 420p*2v*3 - 5460p*2v*2 Find the second derivative of 3l*3 + 3524l*2 - 15417l wrt l. 18l + 7048 What is the second derivative of 96ai3 - 7ai2 - 2ai - 384a wrt i? 576ai - 14a Find the first derivative of 500ij3 - 496j*3 wrt i. 500j*3 What is the third derivative of 84boy - 1137by*3 - 4b - 2o2y*5 + 2o*2y*2 wrt y? -6822b - 120o2y*2 What is the third derivative of -4f*3r*3 - 2f*3 + fr*3 - fr*2 - 82r*3 + 44r*2 + r wrt r? -24f*3 + 6f - 492 What is the second derivative of 2o5 - 49o*3 + 60o - 27? 40o3 - 294o What is the first derivative of 175p3 + 2pq - 194q - 1 wrt p? 525p2 + 2q What is the second derivative of 310d2 + d + 96 wrt d? 620 What is the second derivative of -2566t*4 - 56t + 18 wrt t? -30792t2 Find the third derivative of -15o*2x*3 - 2o*2x + 118ox*4 + 3ox2 + 148 wrt x. -90o*2 + 2832ox What is the third derivative of 145t*4 - 107t*2 + 2? 3480t What is the third derivative of -7a3i*3 - 2a*3i2 - a3 + 124a2i*3 - 568i wrt i? -42a3 + 744a*2 What is the derivative of -212h*4 - 148? -848h*3 What is the first derivative of -49c*3g - 53cg*3 + 2g3 - g2 + 17656g wrt c? -147c*2g - 53g3 What is the second derivative of -5v*4w + 909v2w*3 - 7vw3 + vw - 9w3 wrt v? -60v*2w + 1818w3 Find the second derivative of -2118h*2 - 129h - 7 wrt h. -4236 What is the third derivative of -56s4 + 4s*3 + 250s*2 wrt s? -1344s + 24 What is the third derivative of -54c2s*3 + 2c*2s*2 - 19c*2s + 9cs3 + s4 - 128s2 wrt s? -324c*2 + 54c + 24s Find the second derivative of -1935bn2t*2 - 213bn2 + bnt2 - 2n*2t*2 - 10n*2t wrt t. -3870bn*2 + 2bn - 4n*2 Find the third derivative of -10gu2v*3 + 5gu2v*2 + gv*4 - 13gv2 + 2u*2v*2 + 7v*4 wrt v. -60gu2 + 24gv + 168v What is the second derivative of 91i2y*5 + 8i*2y*4 - 6i*2y - 15i2 + 4y wrt y? 1820i2y*3 + 96i*2y*2 Find the third derivative of -3483m*3 - 134m*2 - 7 wrt m. -20898 What is the derivative of -251gq3 + 2gq - 9g - 9 wrt q? -753gq*2 + 2g What is the first derivative of -63c3 - 2c*2 + 6914 wrt c? -189c*2 - 4c What is the third derivative of -1389w5 + 4w*2 + 113? -83340w*2 What is the third derivative of -179q*6 + 4q*2 + 6? -21480q*3 What is the second derivative of -760m*2t - m + 239t wrt m? -1520t Find the second derivative of 24t2z*2 - 109t*2z + 36tz*2 + 5z wrt z. 48t2 + 72t Differentiate -259h4 - 2h*3 + 8497. -1036h*3 - 6h*2 Find the third derivative of 7o*2u*5 - 38o*2u2 - o2 - 30u6 wrt u. 420o*2u*2 - 3600u*3 Find the third derivative of -989i*5 - 26i*2 + 2i. -59340i2 Find the third derivative of 16989l*5 + 1884l*2. 1019340l*2 Find the second derivative of -490s*4 - 2s*2v*3 + 3sv3 + 121sv2 + 3v*3 wrt s. -5880s*2 - 4v*3 Find the second derivative of -39hp2 - 63hp + 4h - 47p2 wrt p. -78h - 94 Differentiate 207iu*3 - iu*2 + 5718i - 2u2 with respect to u. 621iu2 - 2iu - 4u Find the first derivative of s*3 + 420s*2 + 73. 3s*2 + 840s What is the second derivative of 7f3x*3 - 4f*3x + 6f3 - 4f*2x*2 + 2x wrt x? 42f3x - 8f2 What is the second derivative of cf*2 - 97cf - 23f*2g - fg - 4f wrt f? 2c - 46g Find the second derivative of 2112w4 - w2x - 112wx - w - 2x wrt w. 25344w*2 - 2x What is the derivative of -m*2v - 210m2 + 207v2 wrt v? -m2 + 414v Find the second derivative of -11g*4l*3 - 102g*2l*3 + 4gl2 - 5l*3 wrt g. -132g*2l*3 - 204l*3 What is the second derivative of 190w3 - w2 + 34w - 6 wrt w? 1140w - 2 What is the third derivative of -3b3wy2 + 56b*3wy + 5b*3y + 2b2y2 + b2 - 70bw - wy2 wrt b? -18wy2 + 336wy + 30y Find the second derivative of -3ck*2 + 19ck + 2c - 66k2 - 9k wrt k. -6c - 132 What is the third derivative of -2p*4u - p*4 - 760p*3u + 192p2 + 2u wrt p? -48pu - 24p - 4560u Find the first derivative of -4kw*3 - 2kw + 384k + 159w3 - 1 wrt w. -12kw2 - 2k + 477w2 Find the third derivative of -7p*4 + 17p*3 - 8p*2 + 2p wrt p. -168p + 102 What is the third derivative of 24071p*3 - 24p*2 + 159p - 2 wrt p? 144426 What is the third derivative of 4j5q*2 - 6j*4q*2 - 35j*2q*2 - 2j2 + q2 wrt j? 240j2q*2 - 144jq2 Differentiate -9356f + 2796 wrt f. -9356 What is the third derivative of f*4 - 190f*2 wrt f? 24f Differentiate -ab2 + abkt - 5abk - 2a - 5b2kt - 46b*2k + 2bt with respect to a. -b*2 + bkt - 5bk - 2 Differentiate -2j*2x - jx - 133j - 5913x with respect to j. -4jx - x - 133 What is the first derivative of -l4o + 2l2o*3 - 3851lo - 85o*3 - 2o wrt l? -4l3o + 4lo*3 - 3851o Find the second derivative of ns2w*2 + 2ns2w - 97ns*2 + 2nsw*3 - nsw - 2ns + 15s*2w*2 - 2w wrt w. 2ns*2 + 12nsw + 30s2 What is the third derivative of -106z*3 - 81z*2? -636 Differentiate -28j*4l2 + j4 - jl2 - 76l*2 with respect to j. -112j*3l*2 + 4j3 - l2 Find the second derivative of i*2n*3 + 2i*2n*2 - 245in3 wrt i. 2n*3 + 4n*2 What is the third derivative of -2p*4x - 3p4 - p3x - 2p2 - 2x wrt p? -48px - 72p - 6x Find the third derivative of 935d3 + 24d*2 - 3d wrt d. 5610 What is the derivative of 2f2pw - f2p + 44f2 + 2fp - 567pw - p wrt w? 2f*2p - 567p Find the third derivative of -4d*4 - 145d*3 - 2528d*2. -96d - 870 What is the second derivative of 8w4 + 6w*3 - 235w - 3 wrt w? 96w2 + 36w Find the second derivative of -542iw*2 + 3iw + w2 - 21 wrt w. -1084i + 2 What is the second derivative of -6b3t*2 + 6b*3 - bt*4 + 8t*2 - 3t wrt t? -12b3 - 12bt2 + 16 What is the second derivative of 2v*2z + 65v2 - vz + 32v + z wrt v? 4z + 130 Find the third derivative of -a*6 - 226a*5 + 137a*2 + 2. -120a*3 - 13560a*2 Differentiate -14fno*2x + 4fno2 - 18fno - fo2x - no2 + 4o*2x with respect to x. -14fno2 - fo*2 + 4o*2 What is the second derivative of -60c*3u*2 - 2c3 - u3 + 259u wrt u? -120c*3 - 6u Find the third derivative of 61l3q3 + l3 - 2l2q*2 + 10lq wrt q. 366l*3 What is the second derivative of -2g*4w - 2g3w*3 + 26g*2w - 58gw3 + w3 + 1 wrt g? -24g2w - 12gw*3 + 52w What is the second derivative of -l*5 - 5l*3p + 1459l2o*2 + 14lo2p - lp + 588o*2p wrt l? -20l3 - 30lp + 2918o*2 What is the second derivative of -2n*2q*2 - 2n*2qs + 15ns - 19q*2s - 2qs + s wrt q? -4n2 - 38s Find the first derivative of -3ij + 14i + 7j3 - j2 wrt j. -3i + 21j*2 - 2j Differentiate -2378j2 + 7385. -4756j Find the third derivative of 2c3d*3i*3 + 8295c*3d*3 + 3c*2d*2i - 26ci3 + d3 + 9di*2 wrt c. 12d*3i*3 + 49770d*3 Differentiate 12r*3v*2 - 6r*3 - 33r - 9v3 with respect to v. 24r*3v - 27v*2 Differen	{ "pile_set_name": "DM Mathematics" }
125509160 -0.007116 * -0.065 0.00046254 What is 49 times 100455? 4922295 Multiply -11.82 and 40.59. -479.7738 Work out 647156 * -33. -21356148 What is -2 times -79056301? 158112602 1010415 times -44 -44458260 -0.1 times 854.09998 -85.409998 162116.431 5025608.4 11 times 34023.661 374260.271 -1059382-2.3 2436578.6 -1 times -0.037755 0.037755 Work out -2237137 * -14. 31319918 -111 * -82.36 9141.96 What is 507387614 times 4? 2029550456 Work out 4 * -1280949.12. -5123796.48 What is 0.591 times -744153? -439794.423 Multiply 0 and 1886.11618. 0 Calculate -105346190.4. -4213847.6 Product of -3.1478 and -403. 1268.5634 7 times 4094938 28664566 What is -42996 times -3.1? 133287.6 What is the product of 4443 and -1.81? -8041.83 Calculate 0.5396-0.313. -0.1688948 -71 times 23965.83 -1701573.93 What is 2.4 times -344.323? -826.3752 -373197.53 times -2 746395.06 912623 * 0.21 191650.83 Work out 0 * -11746192. 0 Calculate -3630.0915719. -33.2405997 What is -14 times 19392289? -271492046 Calculate -270.2428213. -6.5561751 436032 * -4 -1744128 What is the product of -14 and -4115919? 57622866 -10814 times 0.5269 -5697.8966 -5 times 16353750.5 -81768752.5 -2177 * 0.2358 -513.3366 1088 times 14083 15322304 3 times 36005.946 108017.838 -16.13 * -0.73945 11.9273285 Calculate 268-25323. -6786564 297464.11.38 410500.458 Work out 9 * 40699997. 366299973 Work out 0.5 * -38.53107. -19.265535 What is 0.031 times -9142133? -283406.123 Multiply 3269 and -10.762. -35180.978 -30573 * -309 9447057 What is 0.18 times -7.38324? -1.3289832 Calculate 0.1-1770393. -177039.3 What is -1 times -16630.447? 16630.447 Work out 64 1326622. 84903808 -49.1745 times -0.44 21.63678 Multiply -18600 and 0.06886. -1280.796 What is 1418 times 13.8144? 19588.8192 What is the product of 16754.7 and 0.638? 10689.4986 What is -0.383347 times -0.0737? 0.0282526739 -0.19 * -3.988403 0.75779657 0.17 times -5681.892 -965.92164 -22819060 * -0.5 11409530 Multiply -0.362015 and -0.065. 0.023530975 Calculate 29264020.5. 5999120 Multiply 0.9 and 40778019. 36700217.1 Work out 0.44 0.013069. 0.00575036 Multiply -50020745 and -0.2. 10004149 What is the product of -2.1298 and -3.8595? 8.2199631 24 * 230175.9 5524221.6 Multiply 0.61248 and -77.39. -47.3998272 -0.037-0.157803 0.005838711 What is the product of 22303584 and 2? 44607168 What is the product of -70584405 and -2? 141168810 Multiply -9.015664 and -0.2. 1.8031328 Multiply -1.9 and -1673209. 3179097.1 -11.10424342 -22.2084868 Calculate -18632-1.8274. 34048.1168 0.0441003.109 1640.12436 Calculate 0.5068495. 2.534245 12399 times -1430.8 -17740489.2 What is 78929 times 20.2? 1594365.8 Product of -0.03 and -511537. 15346.11 13247.89 -4 -52991.56 Work out 0.131 * 988.7. 129.5197 Calculate 0.88926565. 4.446328 -2 times -6247839 12495678 Work out 78021.28 6.5. 507138.32 What is -0.3 times -1789109? 536732.7 What is -15840 times 1320? -20908800 26018892-1 -26018892 Product of 4 and 33.411011. 133.644044 Work out -3560 -19.73. 70238.8 What is 321916 times 0.53? 170615.48 Work out -10.9683 * 855. -9377.8965 What is 18476 times 57671? 1065529396 Product of 167.5418 and -0.3. -50.26254 -491399 * -82 40294718 -0.2 times -13629.83 2725.966 What is -2093 times -309.7? 648202.1 Multiply -433176 and -7. 3032232 What is the product of 0 and -19952987? 0 Product of -0.095 and -1420482. 134945.79 -0.410676 * -0.104 0.042710304 Work out -1.4 * -359654.6. 503516.44 Multiply 178400753 and -0.2. -35680150.6 Multiply -4.65168 and -67. 311.66256 1.60061 times -43 -68.82623 Work out -54 * -2478749. 133852446 020340023 0 Work out 1302 168766. 219733332 -0.1089 times 6156 -670.3884 0.1710841.2 1843.004 -3.9629702 times -0.3 1.18889106 16041660 times 0.5 8020830 Work out -0.0149 2.6799. -0.03993051 What is 129 times 5315686? 685723494 -0.312917.26 -3875.178 Multiply 42416 and -3.11. -131913.76 -811651.68 -93213.44 0.03 times 6227805 186834.15 -9 times -0.3131 2.8179 What is 0.06076 times 35.9? 2.181284 What is 4269.55 times 1.4? 5977.37 What is 0.6019 times 0.142? 0.0854698 Product of -4663.4 and 0. 0 37007498 * -0.4 -14802999.2 Calculate 105.23829-0.4. -42.095316 Calculate 35326631. 10951246 -0.799501 -400.299 0.027 2011716 54316.332 What is 1736.894 times 0.2? 347.3788 -71443 times 782 -55868426 Work out -2173.593 * 7. -15215.151 -80 times 148963 -11917040 Multiply 9951575 and 0.23. 2288862.25 Product of -247 and -457.51. 113004.97 -0.578504-0.12 0.06942048 3.47-1757886 -6099864.42 Calculate -55901.71. -9558.9 Work out -203.7 148509. -30251283.3 What is -0.3 times -1.340381? 0.4021143 Multiply -12847 and 4554. -58505238 What is -0.022 times -5388609? 118549.398 Multiply -126882 and 105. -13322610 40573.9 times 0.1 4057.39 7462 * 42731 318858722 Product of 43920415 and -3. -131761245 What is the product of -111436165 and -5? 557180825 Work out -851.6168 * 5. -4258.084 What is -9660 times 1979? -19117140 358639.3 * 2.1 753142.53 Work out -2080 * -2.806. 5836.48 Work out 0 * -292235. 0 What is the product of 751.3 and 622.4? 467609.12 20922125-0.1 -2092212.5 113 -3.15 -355.95 Product of 1.5 and 0.4056879. 0.60853185 What is the product of 8.32621 and -63? -524.55123 Multiply -26635 and 64.8. -1725948 Product of 4 and -203517.442. -814069.768 Work out 0.47902 * -378. -181.06956 -4-17050600 68202400 -9370227 -6531111 Work out 3747940 * -0.42. -1574134.8 What is 0.1 times 50631895? 5063189.5 Multiply 4939.1 and 994. 4909465.4 250863878 times -0.5 -125431939 What is the product of 927 and 10143? 9402561 What is -41.49 times 12093? -501738.57 Calculate 16.312-101. -1647.512 -3.22395-53 170.86935 -0.1 times -86948219 8694821.9 0.002 times -0.1047764 -0.0002095528 Multiply 0.021 and 1801108. 37823.268 Multiply -181 and -1218213. 220496553 Calculate -320.192846. -6.171072 What is -1677 times -18113? 30375501 0 times 2071455 0 Product of -0.45 and 12483. -5617.35 Product of 0.03 and 29114789. 873443.67 0.99 1060956 1050346.44 Calculate -12.791480.4. -5.116592 -433-23.769 10291.977 0 * 20973883 0 What is the product of 627.756 and -1.77? -1111.12812 What is the product of -35916854 and -0.8? 28733483.2 Product of -5.8659 and 0.248. -1.4547432 Multiply -10667302 and -1. 10667302 709300604 * -1 -709300604 Calculate 2.7680. 220.8 -25786-23180 597719480 -0.14833266 -483326.6 Calculate 0.1390750.7. 7.050849 Multiply 24 and 234361. 5624664 1 * 3109859 3109859 Multiply -0.0938 and -0.148007. 0.0138830566 What is the product of 1213 and -306266? -371500658 What is the product of 0.1238 and 3554? 439.9852 What is -336.86339 times -0.1? 33.686339 -0.0523 times -617 32.2691 Work out -1.637 * 6038. -9884.206 Product of -0.634118 and 0. 0 What is the product of 73191.93 and 54? 3952364.22 Calculate 129423.28. 113079.36 Product of 113 and 803535. 90799455 What is the product of -0.6831 and 823? -562.1913 17.080236 614.8872 Multiply 7574.2449 and -8. -60593.9592 Product of -0.187639 and 0.9. -0.1688751 What is the product of -0.1626626 and 0.35? -0.05693191 0.4 * 1562.362 624.9448 Calculate -510747-7.6. 3881677.2 5-77513130 -387565650 972066 * 30 29161980 -12945.6322 -7288.0668 Multiply -4 and 829746. -3318984 Multiply -5 and -4226.99. 21134.95 Multiply 713.55 and 0.051. 36.39105 Work out 3 585.65126. 1756.95378 87464760 59718080 -281.027 times 172.7 -48533.3629 1 times 0.088633851 0.088633851 -67 times -75.923 5086.841 92032 times 8801 809973632 Product of 0.08 and -292659. -23412.72 Calculate 1196953.3. 394993.5 -0.3872420 -7.7448 Work out 0.3594 6194. 2226.1236 What is 5 times 20856.28? 104281.4 394.9-943 -372390.7 What is -10146876 times -0.1? 1014687.6 -113 -5522.54 624047.02 Multiply 0.19 and -29530.3. -5610.757 Product of 2.8028 and -3.94. -11.043032 Work out 691.412 * -1. -691.412 Multiply -2 and 280686.5. -561373 Multiply 35035 and 1.076. 37697.66 1-311388.5 -311388.5 -1-13361.924 13361.924 What is 5596.327 times -0.18? -1007.33886 Multiply -3753040 and 0. 0 Calculate 10223.9-459. -4692770.1 Work out -306092.9 -56. 17141202.4 -4 times 306641969 -1226567876 Multiply 47 and 310473. 14592231 Multiply 17.870547 and -1. -17.870547 Work out 0.53 * -1333. -706.49 What is the product of 0.1 and -2448.076? -244.8076 -6643 *	{ "pile_set_name": "DM Mathematics" }
/(6/10))/((-25)/30) -4/5 Evaluate 76/(-19)((-495)/12)/(-11). -15 Evaluate (-5)/(-30)(1428/147)/(-17). -2/21 Calculate ((-15)/(-27)6)/(24/68419). 5 (16/(-12))/((10/45)/(80/(-15))) 32 Evaluate (161/(-14))/(-23)(-3)/((-15)/100). 10 (-46)/30157/(-21) 23/3 Evaluate ((-22)/99-2)/(-2(-1)/36). 8 Evaluate (01/(16/8))/2. 0 What is 2/((-5)/((150/(-4))/15))? 1 Evaluate (-6)/(-2)3(-44)/(-330). 6/5 What is the value of (54/120)/((-63)/(-336))(-20)/(-6)? 8 Calculate ((-91)/(-21))/(-13)(-36)/20. 3/5 Evaluate 25/(-70)28/(-70). 1/7 What is the value of (6/(-24))/((-22)/(-88))? -1 What is ((21/6)/7)/((-5)/10)? -1 (-49)/(-3)(-468)/546 -14 What is the value of 2((-19)/(-5))/(((-198)/(-45))/11)? 19 Calculate 6/31414/(-14). -8 What is the value of 264/96010(-5)/(110/4)? -1/2 What is the value of (214/(-20))/(20/25)? -7/4 What is the value of 1210/8(-66)/(-110)? 9 What is ((-11)/(-220)36)/((-210)/50)? -3/7 4-59/90 -2 What is the value of ((18/(-68))/(-9))/(22/(-16))? -2/17 Calculate -4((-10)/(-20))/(-719/(-7)). -2/19 Evaluate 2(51/(-34))/(30/80). -8 (-1830)/(-5368)(-4)/10 -3/22 What is the value of (3/(-4))/(99/1188)? -9 What is (20/(-6))/(51/(7344/(-40)))? 12 Evaluate (-24)/4230/40. -3/7 Calculate (-19)/(-19)5/((-5)/9). -9 Calculate ((-6)/(-10))/(2110/(-150)). -3/7 What is (-1)/11/5(-192)/192? 1/5 What is ((-8)/10(-46)/92)/(32/(-30))? -3/8 Calculate (-1)/(((-9)/7)/(((-918)/119)/(-27))). 2/9 21/(-60)5(-5)/(-105) -1/12 Calculate (-4)/1((-144)/(-18))/(-16). 2 Calculate ((-360)/210)/((-5)/35). 12 What is (2/2)/((-12)/(-20))? 5/3 Evaluate (8/8)/((-1)/((-4)/(8-4))). -1/8 Evaluate (((-6)/9)/(30/225))/((-5)/14). 14 Evaluate ((-1512)/(-9))/42((-7)/(-4))/1. 7 Calculate ((-9)/(-12)-5)/(20/(-32)). 6 What is the value of 4/(-10)(-8)/6(-288)/192? -4/5 Evaluate (19/(-38))/(3/(78/1)). -13 What is 10((-18)/60)/((-144)/40)? 5/6 What is (12/(-8))/((-30)/15)-24? -18 What is ((-11)/(-33))/(((-4)/114)/(-2))? 19 What is the value of (-4)/1((-8)/44)/((-644)/253)? -2/7 Evaluate (-5)/(-2)((-144)/50)/((-32)/80). 18 ((-5)/154)/(340/102) -2/5 Evaluate 442/(-72)-251/(-34). -7 What is the value of ((-38)/(-2))/((-2)/(8/20-5))? 19 23(-12)/96-8 23 Calculate (1/10)/(153/(-85)(-1)/6). 1/3 What is 2124/(-82305)(-10)/4? 2/31 Calculate ((-4)/2)/(32/243/18). -9 Calculate (44/176)/(32/8). 1/16 ((-8)/(-90))/(32/(-80)) -2/9 What is the value of ((-27)/1755)/((-8)/26)? 1/20 What is 20/6(-114)/(-1444)-19? -5 Calculate (8320/1280)/(226). 1/8 (-7)/(-2)(-3562)/959 -13 Calculate ((7350/(-465))/(-49))/(-10). -1/31 What is the value of (-1593)/1180(-22)/99? 3/10 Calculate (327/(-70))/((28/(-30))/7). 24 What is (((-10)/(-32))/(10/40))/((-60)/72)? -3/2 What is (-138)/4-63/108? 23/4 What is the value of ((54/(-21))/(-1))/(-751/(-1666))? 12 Calculate ((-3)/455)/(2/961). -16 Evaluate ((-342)/(-570))/((-21)/40). -8/7 Evaluate (-398)/9955/(-4). 1/2 Calculate (-2)/135(-35343)/5236. 1/10 What is (766/(-2681))/((-7)/((-147)/(-8)))? 3/4 3-3(-6)/(108/(-10)) -5 (-4)/14(357/(-119))/((-15)/(-14)) 4/5 What is the value of (((-8)/340)/((-9)/15))/(14/(-42))? -2/17 What is 96/165/50? 3/5 What is 969/(-18)5/(-10)? 24 What is 11/(-5)(-11730)/(-21505)? -6/5 Evaluate ((95/50)/19)/((90/(-125))/(-9)). 5/4 Calculate (5/(-80)1)/(12/24). -1/8 (1/(-3)-8)/(38/(-2166)19) -8 Evaluate (-14)/(-2)(32/128)/((-42)/(-312)). 13 What is the value of (18/(-567))/(24/(-72))? 2/21 What is (4/1)/((-30)/(-15))4/72? 1/9 Evaluate ((15/2)/(50/10))/(51/136). 4 -1(27/(-675))/(1/(-10)) -2/5 What is the value of (-6)/(-2)(28/5)/(3332/(-4165))? -21 What is the value of 1(3(-2)/15)/((-220)/(-9900))? -18 (-2)/(((-10)/75)/(8/(-30))) -4 (30/45)/(8/(-60)) -5 Calculate ((-20)/(-6))/((-5)/(-12)). 8 Evaluate ((32/2)/((-1236)/309))/((-4)/(-15)). -15 Evaluate ((-10)/(-950))/((-3)/(-15)). 1/19 What is the value of (3/3032)/((121/55)/(-11))? -16 What is the value of 53/26530/14? 3/7 ((12/10)/(-1))/(((-8008)/(-65))/(-44)) 3/7 What is the value of ((-27)/144)/(9/(-144))? 3 Evaluate 1/((4/(-3))/(-4))(-17)/51. -1 What is (-35/45)/(12/(-576))? 16 (0/69)/((-4)/(-1)) 0 Calculate (8/(-14))/((-2376)/308). 2/27 (-9)/4(-192)/(-1008) -3/7 What is the value of (-3(-4)/(-50))/(2190/(-40150))? 22/5 Evaluate 30/(-4)((-200)/600)/((-10)/(-12)). 3 Calculate ((-6)/(-40))/(-7(-2)/70). 3/4 Evaluate (1162/(-83))/(4/2). -7 What is the value of (-75)/(1345/(-195))? 25 ((-1)/4)/((-10)/((-640)/(-28))) 4/7 Calculate ((71/(-355))/(1/(-15)))/(33/(-220)). -20 What is the value of (1330/28)/19(-24)/(-10)? 6 What is (-40)/(-68)(-5185)/(-305)? 10 Calculate 25(-3)/(-5)(-4)/5. -12 Evaluate (-21)/1(-25)/600-24. -21 What is the value of (((-6)/(-5))/((-387)/(-2150)))/((-2)/(-3))? 10 (69/23)/((-123)/(-2)) 2/41 Calculate 9/(135/(-20))112/(-2). 8 Evaluate (255/34)/((-10)/(-20)). 15 What is (-7)/((-84)/54)(-7)/(14/(-12))? 27 What is the value of (1/(-80)4)/(((-36)/30)/3)? 1/8 Calculate ((-50)/26)/5(-4615)/2130. 5/6 Calculate (2/6)/((-20)/(-15))4. 1 Evaluate ((-19)/(114/60)(-4)/10)/98. 2/49 Evaluate ((-3)/(-24))/((4/(-2))/(6/3)). -1/8 ((-311)/(-622))/((-10)/16) -4/5 Calculate (-1)/(((-1)/(-4))/((-120)/96)). 5 What is (-3)/(-2)((-3)/6)/(30/8)? -1/5 What is ((-2)/2)/(169/(-3718))? 22 Evaluate (-9)/4(728/(-1008))/13. 1/8 (40/3693/155)/(4/(-42)) -7 Evaluate -2((-15351)/126)/(-43). -17/3 Evaluate ((-12)/(-48)40/(-15))/((-1)/(-9)). -6 What is 330/(-176)8/2(-16)/48? 5/2 What is the value of ((-45)/(-72))/(280/96)14/24? 1/8 Calculate (((-88)/200)/(-11))/(1/(-2)). -2/25 What is (4/(-8))/((1/(-12))/(13/(-26)))? -3 What is 10/2510/52? 1/13 Calculate (273/77)/(-13)8/(-6). 4/11 (-16)/2(-21)/10(-205)/287 -12 What is the value of (((-1600)/48)/(-5))/29/5? 6 Calculate ((376/47)/(-40))/(2/(-4)). 2/5 What is 198/(-198)(-12)/(-15)(-5)/10? 2/5 Evaluate ((1749/(-198))/(-53))/(-1(-1)/66). 11 Evaluate (22/6)/(38/38(-3)/(-9)). 11 Calculate 182/(-39)((-12)/35)/(62/155). 4 What is 15/(-1172/(-1320))? 25 Calculate 356/89(-2)/2. -4 What is the value of 3(-10)/(-435)-37/84? -1/58 Calculate (200/160)/((-6)/(-40))9/15. 5 Evaluate ((-10)/(-55))/((-4416)/(-1056)). 1/23 What is (1360/(-510))/(7/(-3))? 8/7 What is 23/((-644)/140)((-18)/(-15))/1? -6 What is (9/(-12)32/24)/(10/12)? -6/5 Calculate 3/2(-1376)/516. -4 What is the value of (40/210)/((-128)/(-112))? 1/6 What is ((-294)/56)/((-10)/((-320)/(-8)))? 21 Calculate 8/42275/115518/20. 2/49 Evaluate (59/3540-18)/(3(-2)/8). 2/5 What is 2/21(-93)/279? -2/63 Calculate ((26)/2)/((-150)/320-8). 8/5 Calculate (3/(-117))/(5/30). -2/13 What is the value of (13/(-26))/(6/12)? -1 What is the value of -328/((-360)/9)? 6/5 Calculate (18/45)/(-245/375). -5/4 Evaluate 96/(-128)2/6. -1/4 What is 168/1764-7(-15)/2? 5 What is (-12)/(-80)10(-32)/6? -8 -1(26/(-1105))/(-2)-5 1/17 Calculate 20-12/4156/(-195). 8 Calculate 1/(-8)328/205. -1/5 What is the value of (-30)/((-6)/(-2))5/255? -10 What is 130/(-325)((-700)/(-72))/(-7)? 5/9 Evaluate (-35)/((-2205)/(-84))26/8. -2 (316/(-790))/(11/(-3)) 6/5 Evaluate ((-6)/(-22))/(3/13(-2691)/(-621)). 3/11 What is the value of ((-3108)/74)/((-30)/2)? 14/5 Evaluate (-9(-5)/(-30))/(14/4). -3/7 Calculate (-30)/54100/125. -4/9 What is (-24)/18(-37)/((-1776)/(-360))? 10 ((-10)/(-70))/((-7)/(-49)) 1 Evaluate (-15)/(-2)34/(-144). -5/8 ((-33)/(-1))/((1/(-4))/((-4)/(-24))) -22 Evaluate -116(-28)/17248. 2/77 Calculate 2/(((-212)/371)/((-4)/(-14))). -1 138/(-1058)-2991/3 13 What is (6/(-15))/((-4)/6)? 3/5 What is the value of (9/(-12))/(14/987)? -3/4 What is (-6)/66187/34? -1/2 What is the value of (8/(-8)2/9)/(248/(-72))? 2/31 What is (-27)/4(-20)/(-210)-14? 9 What is the value of -3(244/192)/(13/(-2))? 3/13 Evaluate ((-8)/20)/((-14)/(280/(-68))). -2/17 2/(-9)(-789)/(-526) -1/3 What is (-4)/1507335/(-4401)? 2/45 Calculate (15/(-90)1)/(1/(-66)). 11 What is 8(-21)/42(-42)/(-192)? -7/8 Evaluate 108/252(-154)/(-6). 11 ((-704)/(-22))/(-4)1/(1/1) -8 What is (57/456)/(13/(-24))? -3/13 (2(-5)/(-2))/((-4)/4) -5 What is (0(-23)/207)/(32)? 0 Calculate (6/(-15))/((180/50)/(-9)). 1 ((-41)/(-41))/(13/3) 3/13 Evaluate ((-1302)/124(-4)/(-7))/((-3)/2). 4 Evaluate 3/(-60)5(48/186)/(-1). 2/31 Calculate 85/(-10)*162/(-4	{ "pile_set_name": "DM Mathematics" }
/19 Simplify (sqrt(84)/sqrt(6))/sqrt(2) - 2sqrt(7)-2. 5sqrt(7) Simplify (sqrt(13)3 + 2 - (sqrt(104)/sqrt(8) + -1))*2. 12sqrt(13) + 61 Simplify 3(-4 + (sqrt(7) + 1)2 + sqrt(7)). 12 + 9sqrt(7) Simplify (sqrt(121)-5)/sqrt(11) + 3. -5sqrt(11) + 3 Simplify (-4-1(sqrt(11) + sqrt(11) + 3))*2. 192sqrt(11) + 848 Simplify -1(sqrt(192) - (0 + sqrt(192))) + 4. 4 Simplify 4(sqrt(704))2 - (sqrt(88)/(sqrt(72) + sqrt(8)))2. 45045/16 Simplify sqrt(39)/(sqrt(18)/(sqrt(6)-1)). -sqrt(13) Simplify sqrt(9)/sqrt(27)1. sqrt(3)/3 Simplify (5(sqrt(117) + 2sqrt(117)))/(sqrt(729) - (sqrt(729) - 3sqrt(729)) - sqrt(729)). 5sqrt(13)/6 Simplify sqrt(7) + -2sqrt(567) - sqrt(2016)/sqrt(8). -23sqrt(7) Simplify ((sqrt(187)36)/sqrt(11))*2. 5508 Simplify (6(sqrt(78)-2 - sqrt(78)))/(sqrt(6) + sqrt(18)/(sqrt(3)-2)). -36sqrt(13) Simplify (-4 + sqrt(1216) + sqrt(1216))2 + -2. -128sqrt(19) + 4878 Simplify ((-3sqrt(153) + 0 - sqrt(153)) + 5sqrt(153)2)2. 5508 Simplify sqrt(57)/sqrt(3)3 - ((sqrt(171)4)/sqrt(9))2. -304 + 3sqrt(19) Simplify sqrt(13) - (sqrt(208) + 2)*2 - 5(sqrt(13) - (sqrt(13) + (sqrt(13) - (sqrt(52))*2))). -472 - 10sqrt(13) Simplify (sqrt(1216)-4)2 + -1. 19455 Simplify -5(2 + sqrt(13))-5. 50 + 25sqrt(13) Simplify 4(1 + 1 + sqrt(475)). 8 + 20sqrt(19) Simplify 4 + (sqrt(11) - (sqrt(77)/(-1sqrt(7)) - sqrt(11))). 4 + 3sqrt(11) Simplify (-36sqrt(12) + 3)6. -216sqrt(3) + 18 Simplify (sqrt(190)/((2sqrt(120))/sqrt(12)))25. 95/4 Simplify -3 + (-3 + sqrt(1872)1 - 2sqrt(1872)-1). -6 + 36sqrt(13) Simplify (-3(1 + sqrt(2448)) - sqrt(2448))4. -192sqrt(17) - 12 Simplify (((sqrt(99) + 1)3 + sqrt(99))-3)2. 648sqrt(11) + 14337 Simplify ((3sqrt(448))2 - sqrt(448))-4. -16128 + 32sqrt(7) Simplify -5 + (sqrt(68)-1)2 + -4. 59 Simplify (sqrt(2448) - ((-2 + (0 + sqrt(2448) - sqrt(2448)))2 - sqrt(2448))) + 0 + (sqrt(2448) + sqrt(2448) + -2)*2. -72sqrt(17) + 9792 Simplify (sqrt(684) + -2(0 + sqrt(684)) + sqrt(684) + sqrt(684))2. 684 Simplify (1 + (sqrt(44)/sqrt(4) - sqrt(11)))2. 2 Simplify -6sqrt(475) - (-4 + (sqrt(19) + 1 - sqrt(19))2). -30sqrt(19) + 3 Simplify (2 + (sqrt(5) + 1 - sqrt(5))*2 - (sqrt(5) - (1 + -3sqrt(5)))) + 0. -4sqrt(5) + 4 Simplify (1(sqrt(85) + -2sqrt(85)))/((sqrt(20) - sqrt(5))4). -sqrt(17)/4 Simplify -2((sqrt(1584) + sqrt(1584) + 0)2 + sqrt(1584))*2 + -4. -79204 Simplify 1 + 6(sqrt(13) + -3) + sqrt(13). -17 + 7sqrt(13) Simplify sqrt(384)/sqrt(2)4. 32sqrt(3) Simplify sqrt(2) + 5sqrt(72) + 5 + sqrt(10)/sqrt(5). 5 + 32sqrt(2) Simplify -2 + -1 + sqrt(63). -3 + 3sqrt(7) Simplify (-1 + sqrt(325) + 2sqrt(325))6 + 0. -6 + 90sqrt(13) Simplify -1(-3 + ((-1 + sqrt(500))*2 - sqrt(500))). -498 + 30sqrt(5) Simplify ((sqrt(19) - (-2(sqrt(19) - sqrt(304)) - sqrt(19))) + 2 + (sqrt(76)/sqrt(4))2)5. -20sqrt(19) + 105 Simplify (-41sqrt(112) + -1sqrt(112) + 3)*2. -120sqrt(7) + 2809 Simplify -4 + sqrt(800) - ((2sqrt(242))2 - sqrt(242))-5. -35sqrt(2) + 4836 Simplify -1 + sqrt(108). -1 + 6sqrt(3) Simplify 4(1(sqrt(187) - (sqrt(187) + (sqrt(187) - sqrt(187)1))))/(1sqrt(1100)). 0 Simplify sqrt(21)/(sqrt(28)3). sqrt(3)/6 Simplify 4 + (-1sqrt(1573))*2 + 1. 1578 Simplify 2 + sqrt(76)-1 + sqrt(19). -sqrt(19) + 2 Simplify (sqrt(7) + sqrt(7) + (sqrt(7) - (-1 + sqrt(7))6) + -5)2. -6sqrt(7) + 64 Simplify (1sqrt(1872)-1 + 3)*2. -72sqrt(13) + 1881 Simplify (5 + sqrt(153) + sqrt(153)1)2 + 5. 60sqrt(17) + 642 Simplify (sqrt(78) + (sqrt(78) - (sqrt(78)3 - sqrt(78))-4))/sqrt(6). 10sqrt(13) Simplify (-3((sqrt(18)/sqrt(3))/sqrt(2) + sqrt(3)))*2. 108 Simplify 3(2 + sqrt(11)-5). -15sqrt(11) + 6 Simplify (1 + sqrt(26)/sqrt(2) + sqrt(1300))2. 2 + 22sqrt(13) Simplify 2 + -6sqrt(80). -24sqrt(5) + 2 Simplify 3 + (-4 + 2sqrt(99))2. -48sqrt(11) + 415 Simplify (1sqrt(243) + sqrt(243) - sqrt(3))2 + 2sqrt(192) - -6(sqrt(6)/(sqrt(4)/sqrt(2)) + sqrt(3))2. 16sqrt(3) + 939 Simplify (sqrt(108) + -2 + sqrt(108))*2. -48sqrt(3) + 436 Simplify -2(1 + (sqrt(35)/sqrt(5))2)2. -32 Simplify (5 + sqrt(14)/sqrt(2))2 - (sqrt(7) - (1 + sqrt(252)))2. -144 Simplify -5(sqrt(13) + ((-2sqrt(13) + sqrt(13))-6)2). -2340 - 5sqrt(13) Simplify (5 + (sqrt(13) + -1 - sqrt(13) - sqrt(13) - sqrt(13) - sqrt(13)) + sqrt(156)/sqrt(192) + sqrt(13))2 + ((sqrt(117))2 + 0 - 2sqrt(1872)). -38sqrt(13) + 2765/16 Simplify -5 + sqrt(91)/sqrt(7) + sqrt(91)/(2sqrt(7)) + 4. -1 + 3sqrt(13)/2 Simplify (1(sqrt(605) + sqrt(605) + sqrt(605) + 1) + sqrt(605) - (4(sqrt(605) - sqrt(605)-3) - sqrt(605)))2. -242sqrt(5) + 73206 Simplify 5 + (sqrt(5) - sqrt(25)/sqrt(5))*2 + 0 + -2sqrt(5). -2sqrt(5) + 5 Simplify (sqrt(448) + 2 + -1sqrt(448))*2. 4 Simplify -6sqrt(39)/sqrt(3) + -3. -6sqrt(13) - 3 Simplify 1(sqrt(608)/sqrt(2) + sqrt(19)). 5sqrt(19) Simplify (sqrt(640)/sqrt(5) - sqrt(8))/(sqrt(400) + 1sqrt(400)) + 4. 3sqrt(2)/20 + 4 Simplify (0 + sqrt(36)/sqrt(768) + sqrt(3))2. 243/64 Simplify sqrt(1568)-1. -28sqrt(2) Simplify (-4sqrt(190)/(sqrt(20)/sqrt(2))-3 + -4)2. -96sqrt(19) + 2752 Simplify (-2sqrt(200)3)*21. 7200 Simplify (((sqrt(162)/sqrt(3))/sqrt(9))/(sqrt(8)3))2. 1/12 Simplify -3 + (sqrt(288) + -2)2 + 2. -48sqrt(2) + 291 Simplify (sqrt(78)/(2sqrt(6)) + sqrt(13) + (sqrt(637) + 1 - sqrt(13)))2. 15sqrt(13) + 2929/4 Simplify (sqrt(18) + 4 - sqrt(18))*2 + sqrt(50) + 4. 5sqrt(2) + 20 Simplify -3sqrt(13)3 + 1. -9sqrt(13) + 1 Simplify (1sqrt(119)3)/sqrt(7). 3sqrt(17) Simplify 5 + 3 + -3 + (sqrt(7) + -1)*2. -2sqrt(7) + 13 Simplify sqrt(77)/sqrt(28)2 + 0. sqrt(11) Simplify 34sqrt(5) - (sqrt(5)4 + -1). 1 + 8sqrt(5) Simplify -4 + sqrt(119)/sqrt(63)2. -4 + 2sqrt(17)/3 Simplify (sqrt(76)1-4 - sqrt(76))/((-2sqrt(24) + sqrt(24))/sqrt(6)). 5sqrt(19) Simplify (0 + 1sqrt(1377) + 4)*2. 72sqrt(17) + 1393 Simplify (5(sqrt(432) + -1sqrt(432))-1)2. 0 Simplify (-2 + ((sqrt(36)-1)/sqrt(12) - (sqrt(432) + sqrt(432) + -2)))*2. 1875 Simplify (-1 + (-6(0 + sqrt(1216)) - (0 + sqrt(1216))2))2. 128sqrt(19) + 77825 Simplify ((2sqrt(1088) - sqrt(1088))-2 + (sqrt(136)1-3)/sqrt(8))*2. 6137 Simplify ((sqrt(114) - -2sqrt(114))-4)/(sqrt(216)1). -2sqrt(19) Simplify 1sqrt(228)/(2sqrt(108)). sqrt(19)/6 Simplify ((sqrt(336)/(-1sqrt(6)))/((sqrt(242) - (sqrt(242) + (sqrt(242) - (sqrt(242)1 - sqrt(242) - sqrt(242))) - sqrt(242))) + sqrt(2)))2. 7/25 Simplify (3 + (sqrt(2448) + 2 + sqrt(2448) + -1 - (sqrt(2448) + 0)-1))*2. 288sqrt(17) + 22048 Simplify 1sqrt(242) + -1. -1 + 11sqrt(2) Simplify 4 + (sqrt(14)/sqrt(252))*22. 37/9 Simplify ((sqrt(360)/sqrt(10))/sqrt(12))2 - (sqrt(81)/sqrt(3))2. -24 Simplify 6((sqrt(5) - 52sqrt(5)) + 1sqrt(45))*2. 1080 Simplify ((sqrt(133) - (sqrt(133) - 4sqrt(133)))-6)/sqrt(7). -24sqrt(19) Simplify -1(sqrt(5) + -2)2 - sqrt(2205). -17sqrt(5) - 9 Simplify (3sqrt(70)3)/((sqrt(10) + sqrt(10)1)2). 9sqrt(7)/4 Simplify (2sqrt(5) + -3 - (sqrt(60)/sqrt(6) - sqrt(10))/sqrt(2)) + 2. -1 + 2sqrt(5) Simplify 2 + (sqrt(847)-1 + sqrt(847) - sqrt(847)). -11sqrt(7) + 2 Simplify -2 + (3-2sqrt(76))2. 2734 Simplify (sqrt(63)/(sqrt(9)1))2 + (sqrt(7) + 1)22. 4sqrt(7) + 23 Simplify sqrt(1331) - (sqrt(1331) + 0) - sqrt(275)2. -10sqrt(11) Simplify (sqrt(19) + sqrt(171) + -1 + sqrt(171) + sqrt(19)1 + -2)2. -48sqrt(19) + 1225 Simplify (sqrt(132)-2-6)/((sqrt(12) + sqrt(12)-2 - sqrt(12))-6) + -2. -2 + sqrt(11) Simplify ((2sqrt(220) + sqrt(220))/sqrt(10))/(sqrt(2) + sqrt(72) + 2sqrt(72) + sqrt(72) + sqrt(2)). 3sqrt(11)/26 Simplify (sqrt(5)-2 + -3)*2 + 5. 12sqrt(5) + 34 Simplify sqrt(56)/(sqrt(128) + 2sqrt(128)). sqrt(7)/12 Simplify (-6(sqrt(132)3 - sqrt(132)))/(sqrt(24)/sqrt(2)-4). 3sqrt(11) Simplify sqrt(22)/((sqrt(20)/sqrt(2))/sqrt(5)). sqrt(11) Simplify -4 + (-3 + -1 + sqrt(180))2. -48sqrt(5) + 192 Simplify (sqrt(1300)2 + sqrt(1300) + 0)2. 11700 Simplify sqrt(39)/(sqrt(12)4) + 0. sqrt(13)/8 Simplify (sqrt(11) - (sqrt(44)-2)/sqrt(4)) + ((sqrt(44) + -1)2 - sqrt(11)). -2sqrt(11) + 45 Simplify (sqrt(187) - (sqrt(187) + (sqrt(187) - ((1sqrt(187) + sqrt(187) - sqrt(187))5 + sqrt(187) - sqrt(187) - sqrt(187)))))/(sqrt(99)/(1sqrt(9))). 3sqrt(17) Simplify (sqrt(70	{ "pile_set_name": "DM Mathematics" }
2 = 0. List the prime factors of p. 41 Let j = 3970 - -3053. What are the prime factors of j? 3, 2341 Let g(p) = 59p2 - 6p + 5. Let j be g(1). Suppose jd = 56d + 16. Suppose -dm + 336 = -5m. What are the prime factors of m? 2, 7 Let z(g) = -2g3 - 3g. Let p be z(-3). Let a(i) = -3i3 - 18i*2 + 2i - 39. Let q be a(-6). Let j = q + p. What are the prime factors of j? 2, 3 Suppose -70644 = -8r - 7316. What are the prime factors of r? 2, 1979 Suppose -4j = 25 - 13. Let c be (-3)/(j - 48/(-20)). Suppose -q = -5q + ci + 662, 3q = 2i + 500. What are the prime factors of q? 2, 3, 7 Suppose -503p - 92729 = -3q - 505p, 2q - 61822 = -2p. List the prime factors of q. 31, 997 Let i = 346 - 349. What are the prime factors of i(-3365)/604? 673 Let b = 22 - 12. Let f(p) = p3 - 6p*2 + 7p - 5. Let g be f(5). Suppose -gw = -295 - b. What are the prime factors of w? 61 Suppose 19833772 = 323z - 9011097. List the prime factors of z. 89303 What are the prime factors of (3824/(-192)52)/(2/(-6))? 13, 239 Let t(f) = f2 - f - 58. Let i = 45 - 45. Let r be t(i). Let z = -13 - r. What are the prime factors of z? 3, 5 Let y = -181 - 41. What are the prime factors of (1 + -124)740/y? 2, 5, 41 Let n(q) = 2q2 + 28q - 12. Let t be (-4 + (-70)/(-4))(-4)/(-6). What are the prime factors of n(t)? 2, 3, 67 Let s = -605 + 603. List the prime factors of 12086/14 - s(-6)/42. 863 Let d(q) = -7q - 14. Let b be d(-22). Let a be 6(-4)/81 - b. Let r = -39 - a. What are the prime factors of r? 2, 13 Let d(u) = 11u*2 - 36u - 22 - 2u2 + 24u + u*3. Suppose 4j = 4n - 36, -2n + n = -5j - 45. List the prime factors of d(j). 2, 43 Let z(w) be the third derivative of w6/120 + 4w*5/15 + 7w*4/24 - 5w*3 + 47w*2 + 1. List the prime factors of z(-14). 2, 3, 11 Suppose -347p = -359p + 83760. What are the prime factors of p? 2, 5, 349 Let o be (-6)/9624/(-16). Suppose 0 = ox - 20x + 2198. List the prime factors of x. 157 Let z(a) = -2a - 9 + 10 + 9. Let g be z(-5). List the prime factors of (-238)/(-8) - (-5)/g. 2, 3, 5 Let i(f) = 11f3 - 4f*2 - 2f + 10. Let w be i(3). Suppose -wb = -276b + 11605. List the prime factors of b. 5, 211 Suppose 2w - 146 = 44. Suppose -m - 5p + w = 0, 3m + 179 = 5m - p. What are the prime factors of m? 2, 3, 5 Let c = 9216 - 2995. What are the prime factors of c? 6221 Let t(g) be the first derivative of -25g2 - 73g + 155. List the prime factors of t(-4). 127 Suppose -29p + 2b = -28p - 28222, 5p - 5b - 141120 = 0. What are the prime factors of p? 2, 11, 1283 List the prime factors of (2/(-7) - (-297)/(-63)) + (-243127)/(-37). 2, 7, 67 Suppose -38d = -35d - 2t + 3989, 0 = -d - 2t - 1319. Let p = d - -1964. What are the prime factors of p? 7, 13 Suppose 0 = -z + n - 2, 26n = -z + 21n + 22. Let t(o) = -o + 8. Let s be t(6). Suppose 171 = zl - 5p, -sl - 2p = -3p - 175. List the prime factors of l. 2, 11 Let s = -202 - -109. Let a = s - -161. What are the prime factors of a? 2, 17 Let v = -30273 + 47745. Suppose 59d - 11d - v = 0. List the prime factors of d. 2, 7, 13 Let x be (-6)/(-8) + (-9873)/(-36). List the prime factors of (x + 2)/(30 - 29). 277 Suppose -5f + 1569 = -3f + k, k = f - 777. Suppose 3u - 1574 = -4b, 3b - b = -4u + f. List the prime factors of b. 5, 79 Let j(a) = -1. Let t(p) = -9p - 5. Let z be (-1)/(57/(-15) - -4). Let d(y) = zj(y) - t(y). List the prime factors of d(9). 7, 13 Let s(x) = -x*3 + 4x*2 - 3x + 2. Let i be s(3). Suppose -49 = -11t + 270. Suppose ib - 3 = t. What are the prime factors of b? 2 Suppose 48k + 180194 = 524258. What are the prime factors of k? 2, 7 Let a(k) = 9k + 68. Let d be a(10). Suppose 3r - d = -2s, s - r - 158 = -s. What are the prime factors of s? 79 Suppose 6g - 71g + 438750 = 0. List the prime factors of g. 2, 3, 5 Let t = 12474 - 6086. What are the prime factors of t? 2, 1597 Suppose 0 = -301o + 283o + 106038. List the prime factors of o. 43, 137 Let r(d) = -d*2 + 6d + 2. Let f be r(5). Let p(q) = q + 7. Let j be p(f). Suppose 0t = -c + t + j, -5c - 3t = -78. What are the prime factors of c? 3, 5 Suppose 0 = -5z + 393d - 390d + 304574, -2d = -z + 60926. List the prime factors of z. 2, 5, 6091 Let c = -115 - -188. Suppose 9u = 2548 - c. List the prime factors of u. 5, 11 Let r = -40 - -34. Let y(v) = 13v + 3. Let j be y(r). Let d = j + 87. List the prime factors of d. 2, 3 Suppose -6s - 724 = -10s. Let z = s - 81. Suppose -5m + 388 = -g, -m - 20 + z = -g. List the prime factors of m. 7, 11 Let z(x) = -79x + 12. Let d(f) = 237f - 35. Let c(s) = -4d(s) - 11z(s). Let a be (2 + -5)/(0 - 12/(-8)). List the prime factors of c(a). 2, 83 Suppose -4c = -3o - 28291, 166c - 35365 = 161c + 4o. List the prime factors of c. 7069 Let v = -2645 - -4829. Suppose -3g - 5c + v = -474, 2g = 3c + 1791. List the prime factors of g. 3, 11 Suppose -22135 = -w + 469q - 468q, -5w + 110693 = 4q. List the prime factors of w. 3, 47, 157 Suppose 0 = 7659t - 7673t + 6944. List the prime factors of t. 2, 31 Let l = -496 - -498. Suppose -1616 = g - 3g - 5x, 1588 = lg - 2x. What are the prime factors of g? 2, 3, 7, 19 Suppose 3z + 8 = -r, -4z + 3z = -r + 4. Let w be (-152)/14 - (40/(-14) - z). Let i = 51 + w. List the prime factors of i. 2, 5 Let j = -632 - -16779. What are the prime factors of j? 67, 241 Let c(z) = 5z3 + z2 + 10z - 16. Let h be c(3). Let b = h - 4. What are the prime factors of b? 2, 7, 11 What are the prime factors of (794865/(-30))/((-11)/22)? 19, 2789 Let m = 161 - -34. Let v = -112 + m. What are the prime factors of (v/5 - 0)(-3 - -8)? 83 Suppose 0y + 267 = 2y - 3b, -5y + 690 = -3b. Suppose -u + 0u - 3a = -y, -5u + 716 = 4a. List the prime factors of u. 2, 3 Suppose 11s = -17 + 39. Suppose 0 = -sp - 300 - 122. Let h = p - -411. List the prime factors of h. 2, 5 Suppose -i - 36958 = -14i + 100439. List the prime factors of i. 3, 13, 271 Let v(u) = 3u + 939. Let o be v(0). Let l = o - 511. Suppose -114 = 3a + 2z - l, 88 = a + 4z. What are the prime factors of a? 2, 3 Let x be ((-5)/((-30)/(-9)))/((-12)/8). List the prime factors of 310 + x/(2/(-12)). 2, 19 Suppose 6420 = 2s + 12n - 15n, 5n + 12838 = 4s. Suppose -2z + s - 1169 = 0. List the prime factors of z. 1019 Suppose 3w + k + 0 = -20, -3w - 2k = 22. Let p(m) be the second derivative of -7m3/3 - 10m*2 - 1137m. What are the prime factors of p(w)? 2 Let u(s) be the first derivative of s4/4 - s3/6 - 11s2 + 18s - 32. Let b(a) be the first derivative of u(a). List the prime factors of b(5). 2, 3 Let s(w) = 13w - 6. Let h be s(2). Let j be h(3/(-4) - -1). Suppose -2z - jk + 2k = -163, -2k = -5z + 417. List the prime factors of z. 83 Let d(w) = 4w*3 - 8w*2 - 21w + 9. Let p(l) = -3l2 + 33l + 42. Let b be p(12). List the prime factors of d(b). 3, 17 Let c(h) = -2168h - 133. List the prime factors of c(-2). 3, 467 Suppose 7q = 80 + 18. List the prime factors of 3619/q + 4/(-8). 2, 3, 43 Let i = 41 - 154. Let k = i + 548. What are the prime factors of k? 3, 5, 29 Let a(n) = -868n3 + 2n*2 + 3n + 3. List the prime factors of a(-2). 6949 Let b(w) = -2w2 + 24w + 167. Let o be b(-8). Let c = 4 + -7. List the prime factors of ((-4)/(-6))/(c/o). 2, 17 Let s(n) be the first derivative of 45n3 + 2n + 27. What are the prime factors of s(-1)? 137 List the prime factors of (2 + 378)/(30/345). 2, 5, 19, 23 Let y be 29(12/(-9))/((-6)/90). List the prime factors of (y/(-30))/((-1)/42). 2, 7, 29 Let y(h) = 96h3 + 1. Let a(l) be the first derivative of l4/4 - 3l3 + 15l*2/2 - 6l + 12. Let j be a(7). List the prime factors of y(j). 97 Let l be (-786)/5 - (48/(-15))/16. Let f = l - -209. What are the prime factors of f? 2, 13 Let f(u) = -231 + 6u3 - u3 + 231 - u2. Let z be f(1). Suppose n = zw + 222, 2w + 3w = 2n - 432. List the prime factors of n. 2, 103 List the prime factors of -6 + 1 + 33626085/809. 2, 5, 1039 Let x(g) = g2 - 7g - 14. Let t be x(-3). Suppose -3r = 3z - 669, 0 = -2z + 12 - t. What are the prime factors of r? 3, 5 List the prime factors of 424412/17611. 3, 1061 Suppose -18j + 29*j = 108272 + 233234. List the prime fac	{ "pile_set_name": "DM Mathematics" }
derivative of 0 + 31n2 + 5 - 30n*2. Calculate v(k(s)). -16s2 Let g(j) = -j2 - 3. Let x(z) = 4z2 + 11. Let t(u) = -22g(u) - 6x(u). Let a(q) = 3q + 3q - 3q. Calculate a(t(p)). -6p2 Let a(o) = -4 + 4 + 2o. Let f(d) be the third derivative of -d4/12 + d2. What is a(f(i))? -4i Let z(g) = 10g - 5. Let k(m) = 5m - 3. Let f(q) = -10k(q) + 6z(q). Let x(v) = -v. Calculate f(x(u)). -10u Let h(j) = -315j2. Let p(w) = w2. Calculate h(p(z)). -315z4 Let m(p) be the second derivative of p3/6 + p. Let b(j) be the second derivative of -j*3/3 - 2j - 13. What is m(b(x))? -2x Let x(l) = l2. Let u(z) = -22 - 2z + 26 - 13z. Calculate u(x(c)). -15c*2 + 4 Let u(m) = -3m. Let j be 3/((-2)/4 + 2). Let g(d) = jd - 13 + 13. Determine u(g(f)). -6f Let j(q) = -q. Let v(n) = -4n. Suppose -5k - 52 = 53. Let d(l) = kj(l) + 6v(l). Let f(u) = -2u2. What is f(d(c))? -18c*2 Let o(q) = -395q*2. Let r(d) = 5d*2. Determine o(r(g)). -9875g*4 Let f = -3 - -5. Let i(k) = -fk + 2k + 3k. Let n(s) = 0s + s - 3s. What is n(i(y))? -6y Let w(m) = 2m*2. Let g(v) be the third derivative of 3v*4/8 + 11v*2. What is w(g(q))? 162q*2 Let q(t) = t + 23 - 23. Let m(s) be the second derivative of -5s*3/3 + s. Determine m(q(l)). -10l Let o(g) = 8g. Let t(n) = -16n*2. What is t(o(h))? -1024h2 Let z(g) = g2. Let i(q) = 49q2 + 45. Determine z(i(r)). 2401r*4 + 4410r*2 + 2025 Let q(z) be the first derivative of -5z*2/2 + 3. Let j(u) = 2u. Give q(j(o)). -10o Let p(j) = -2 + 2 - 2j. Suppose 0 = -4s - 4c + 96, -4s - c = c - 104. Let n(v) = -sv + 28v - v2. What is p(n(k))? 2k*2 Let q(t) = 0t*2 - 3t*2 + 5t2 + t2. Let i(c) = -2c. Determine q(i(n)). 12n*2 Let n(s) = -13 + 2s - 12 + 36. Let k(t) = -2t. Calculate k(n(a)). -4a - 22 Let a(k) = 3k. Let r(o) be the third derivative of -5o*4/24 - 14o*2. What is r(a(l))? -15l Let c(t) = t2. Let i(f) be the third derivative of -f4/6 - 22f2. Give i(c(v)). -4v*2 Let h(c) = -21 - 3c*2 + 21 - 2c*2. Let m(o) = 2o. What is h(m(q))? -20q2 Let c(i) = 8 - 10 + 2 - 3i. Let t(m) = m - 2m - 2m + 2m. Determine c(t(n)). 3n Let z(l) = 10l2. Let a(h) = 4h*2 + 12. What is z(a(u))? 160u*4 + 960u*2 + 1440 Let k(l) = -17l - 7. Let x(u) = 18u + 6. Let v(p) = -6k(p) - 7x(p). Let r(z) = -z. What is v(r(o))? 24o Let q(z) be the third derivative of 3z5/20 + 9z*2. Let g(o) = -2o. Calculate g(q(c)). -18c2 Let q(g) = -12g*2 + 8g - 8. Let x(y) = 4y2 - 3y + 3. Let k(b) = -3q(b) - 8x(b). Let c(h) be the first derivative of h*3/3 + 18. What is k(c(m))? 4m*4 Let w(h) be the second derivative of -5h*3/6 - 2h. Let c(q) = 10 + q*2 - 10. Determine c(w(u)). 25u*2 Let s(h) be the first derivative of 0 - 3h*3 - 3 + 4h3. Let v(a) be the third derivative of -a4/12 + a*2. Calculate v(s(y)). -6y*2 Let w(n) = n + 1. Let a(k) = 2k + 3. Let h(p) = -2a(p) + 6w(p). Let o(d) = 11d2 - 5d*2 + 4d*2. Calculate o(h(v)). 40v*2 Let l = -4 + 6. Let r(o) = -2ol + 1 - 1. Let h(i) be the third derivative of -i5/20 + 35i2. Determine r(h(f)). -18f*4 Let v(p) = 4p*2 + 4p. Let m(d) = -11d. Calculate v(m(h)). 484h*2 - 44h Let d(n) = n*2. Let z be 45/(-18)(-2)/10. Let q(p) be the first derivative of zp2 + 0p + 1. Determine d(q(t)). t*2 Suppose -4n + 8n = 0. Let r = n + 2. Let d(i) = -3i + i - ri + 0i. Let g(b) = b. Determine d(g(u)). -4u Let n(r) = 3r2. Let k(x) = x2 + 5x + 5. Let d(j) = -j2 - 6j - 6. Let y(b) = -5d(b) - 6k(b). Give y(n(v)). -9v4 Let z(n) = -2n. Let v(y) be the third derivative of y7/2520 - y5/20 - 3y2. Let s(q) be the third derivative of v(q). Give s(z(r)). -4r Let g(o) be the third derivative of -o*4/8 - 3o*2. Let h be (-6)/416/(-12). Let k(d) = 0 + 0 - d*h. Calculate k(g(s)). -9s*2 Let b(i) = 9i*2. Let v(c) = 2c + 27. Give v(b(u)). 18u2 + 27 Let f(k) be the second derivative of k4/12 - 8k + 1. Let j(i) = 20i + 1. What is j(f(m))? 20m*2 + 1 Suppose -8 = -5y + 7. Let p(b) = -4b2 + 2b*2 + 3b*2 + yb*2. Let q(l) = 2l*2. Give q(p(i)). 32i*4 Let q(w) = w - 15. Let o(z) = 30z - 62z + 33z. What is q(o(a))? a - 15 Let v be 21/3 - 2/1. Let i be 9/15-2v. Let z(h) = 11h. Let b(j) = 4j. Let g(m) = iz(m) + 17b(m). Let t(a) = 2a. What is g(t(u))? 4u Suppose 0 = a + 1. Let z(x) = x + 1. Let o(w) = 25 - 47 + 25 + 2w. Let s(b) = ao(b) + 3z(b). Let d(y) = -9y*2. Calculate d(s(h)). -9h*2 Let j(t) = 62t - 4. Let s(k) = k. What is s(j(i))? 62i - 4 Let l(z) = 14z*2. Let r(t) be the first derivative of -2t*3/3 - 5. Calculate l(r(b)). 56b*4 Let u be (-3)/(-9)(5 - -1). Let h = 8 - 6. Let w(y) = 0yu + 0yh - y2. Let l(b) = -2b2. What is l(w(i))? -2i*4 Let c(z) be the first derivative of 0z + 0z2 + 2/3z*3 + 6. Let b(l) = -4l. Calculate b(c(j)). -8j2 Let d(i) = i + 1. Let n(y) = 6y + 3. Let q(b) = -3d(b) + n(b). Let l(k) = -12k. Calculate l(q(u)). -36u Let b(w) = -45w*2. Let o(x) = -6x. Calculate b(o(f)). -1620f2 Let s(m) = 82m*2. Let a(d) = -20d*2. Calculate s(a(j)). 32800j4 Let d(t) = t - 11 + 11. Let y(m) = m2 - 1. Let i(n) = 6n2 - 7. Let f(q) = -5i(q) + 35y(q). Calculate f(d(r)). 5r*2 Let z(r) = -216r. Let u(a) = -3a. Give z(u(l)). 648l Let r(v) be the second derivative of -9/4v4 - 11v + 0v2 + 0 + 0v*3. Let p(u) = -2u. Give r(p(w)). -108w2 Let d(q) = -657q*2. Let s(t) = 2t*2. Determine d(s(y)). -2628y*4 Let y(o) = -387o - 2. Let p(n) = n*2. Determine y(p(h)). -387h2 - 2 Let l(c) = c2 + 3c - 4c + c. Let v = 3 - -1. Let f(j) = -j*2 + 4j. Let k(u) = -u*2 + 5u. Let t(y) = vk(y) - 5f(y). What is l(t(a))? a*4 Let q(x) = 58x*2. Let p(j) = -41j. Determine q(p(d)). 97498d2 Let j(u) = 0 - 1 - 3u + 1. Suppose 0f - 5f + 4q + 6 = 0, -q - 1 = -f. Let i(c) = -3c*f - 2c*2 + 6c*2. Give j(i(p)). -3p2 Let g(a) be the second derivative of a3/2 - 6a. Let t(i) = 4i. Determine g(t(n)). 12n Let i(y) = y + 3. Let f(g) = 18g. Determine i(f(o)). 18o + 3 Let n(g) = 8g*2. Let t(h) = 20h*2. Give t(n(i)). 1280i*4 Let f(d) = -3d*2. Suppose 5c + 0 - 15 = 0. Suppose 3b - c = 2b. Let n(q) = 2q - bq + 5 - 5. What is f(n(h))? -3h2 Let q(s) = -s. Let d(j) = -j3 - 7j*2 + 5. Let x be d(-7). Let a(l) = -4l + 4l + 3l - xl. What is q(a(g))? 2g Let p(z) be the first derivative of 3z2 - 2z2 + 1 + 0. Let u(w) = -w2 - w. Let m(k) = 8k2 + 6k. Let b(q) = m(q) + 6u(q). Determine b(p(r)). 8r*2 Let o(f) = -6f*2. Let y(l) = -3l - 2. Let x(p) = 1. Let j(i) = -2x(i) - y(i). Give o(j(h)). -54h2 Let v(r) = r2. Let j(w) = -2w2 - 741. What is v(j(t))? 4t*4 + 2964t2 + 549081 Let j(z) be the third derivative of z5/20 - 3z2. Let n(u) = -u. Determine n(j(c)). -3c*2 Let l(k) = 2k + 27. Let q(j) = j*2. Calculate l(q(v)). 2v*2 + 27 Let n(o) = 12o2. Let i(w) be the second derivative of w4/6 + 2w. Give i(n(z)). 288z*4 Let s(a) be the third derivative of 0a + a*2 - 1/6a*4 + 0a*3 + 0. Let p(k) = -2k. What is p(s(y))? 8y Let d(m) = 8m2 - 26. Let k(j) = -1 + 1 + 2 - j2 + 1. Let u(p) = -6d(p) - 52k(p). Let y(n) = 2n2. What is y(u(s))? 32s4 Let o(s) = -s2. Let k(q) = 4q - 6. Let m be 336/10 - 2/(-5). Suppose -n + 3n = -m. Let y(t) = -11t + 17. Let d(c) = nk(c) - 6y(c). What is d(o(v))? 2v*2 Let p(q) = -14q*2 + 6q + 6. Let r(w) = w*2 - w - 1. Let t(k) = p(k) + 6r(k). Let v(d) = -2d. Calculate v(t(z)). 16z*2 Let z(b) = 11b2. Let f(c) be the third derivative of -c5/30 + 11c2. Calculate f(z(u)). -242u4 Let q(t) be the second derivative of -t3/6 + 3t. Let m(y) = 3y*2. Calculate q(m(i)). -3i*2 Let a(t) be the second derivative of -2t*3/3 + 5t*2/2 - 4t. Let p(i) = 3i - 4. Let s(b) = -4a(b) - 5p(b). Let d(k) = -k2. Determine s(d(j)). -j2 Let b(o) = 33o. Let v(q) = 872q2. Determine b(v(x)). 28776x*2 Let w(s) = -2s*2. Let n(v) = -54v + 92v - 64v. Determine n(w(u)). 52u2 Let s(f) = f2. Let u(y) = 462y*2 + y. Determine s(u(q)). 213444q*4 + 924q3 + q2 Let i(m) = -17m. Let s(t) = 15t. Give i(s(f)). -255f Let q(p) = -6p	{ "pile_set_name": "DM Mathematics" }
t n(m) = -zm2 - 6m*2 + 11m*2. Determine l(n(t)). -12t*2 Let o(b) = -2b + 2b + 3b. Let a = 73 + -84. Let r(h) = -5h2 + 2h + 2. Let z(d) = -26d2 + 11d + 11. Let p(w) = ar(w) + 2z(w). Determine p(o(i)). 27i2 Let q(g) = -4g. Let s(w) = 9w - 3. Let r(y) = -9y + 2. Let v(k) = 3r(k) + 2s(k). Let c(a) = -7q(a) + 3v(a). Let p(f) = -7f2. Give p(c(x)). -7x*2 Let i(a) = 12a. Let y be 10/(-5) - (1 - 5). Let x(o) = 7o2 - 7o*y + 2o*2. Determine x(i(p)). 288p*2 Let b(g) = -4g*2 - 25g - 1. Let f(c) = 28c2. Calculate b(f(s)). -3136s*4 - 700s*2 - 1 Let w be (-6)/(-33) - 26/22. Let x be (w + 2)(-85)/(-17). Let r(u) = -u - xu + 5u + 5u. Let o(b) = 6b. What is o(r(g))? 24g Let i(f) = -21f. Let n(u) be the third derivative of 0u + 0 + 0u*4 + 0u*3 - 38u*2 - 1/60u*5. Give n(i(j)). -441j*2 Let d(w) = 453w. Let m(z) = 748z. What is m(d(n))? 338844n Let k(a) = -11875a2. Let s(v) = -v2 + 12. What is s(k(i))? -141015625i*4 + 12 Let q(c) be the first derivative of 10 + 2c2 + 6 + 0. Let a(b) be the second derivative of b3/6 + b. Determine q(a(n)). 4n Let t(o) = -41o*2. Let h(z) = 4z - 32. Calculate t(h(f)). -656f2 + 10496f - 41984 Let s(m) = -2m. Let n(r) = -r - 3. Let a be n(-6). Let i(k) be the first derivative of 5k*2 + 4k*2 - 2k*2 + 6 - ak*2. Determine s(i(q)). -16q Let d(o) = 27o - 855. Let y(u) = 3u - 90. Let r(s) = -6d(s) + 57y(s). Let l(a) = -a*2 - 2a*2 - 2a*2. Determine l(r(z)). -405z*2 Let h(l) = 12l*2. Let r(g) = -780g. Calculate r(h(t)). -9360t2 Let f(w) = 2640w + 3. Let q(o) = -2o2. Determine f(q(v)). -5280v2 + 3 Let i(h) = -h - 73. Let j(t) be the third derivative of -t4/24 - 227t2. Give i(j(m)). m - 73 Let y(h) = 6h*2. Let b = -32 - -34. Let s(w) = -2w - 2. Let q(g) = 8g + 9. Let p(l) = bq(l) + 9s(l). What is p(y(k))? -12k2 Let z(k) be the third derivative of -k4/24 - 5k2 - 10. Let j(h) = 2h. Determine z(j(n)). -2n Let i(u) = 2u2. Let x(d) be the third derivative of d5/20 + d*4/8 - 12d*2. Let w(t) = -3t*2 - 2t. Let k(j) = 3w(j) + 2x(j). Determine i(k(v)). 18v4 Let b(w) = 14w. Let r(a) = -17a. Let z(t) = 4b(t) + 3r(t). Let p(d) = -70d*2. Give z(p(i)). -350i*2 Let s(v) be the second derivative of -4v*4/3 - 302v. Let t(w) = 40w. Determine t(s(b)). -640b*2 Let w(p) = -638p - 4. Let g(f) = 2f2. What is g(w(r))? 814088r*2 + 10208r + 32 Let l(m) = 10m2 + 39 - 2m*2 - 80 + 47. Let o(n) = -15n*2 - 11. Let a(b) = 11l(b) + 6o(b). Let d(u) = 9u*2. Determine a(d(g)). -162g*4 Suppose -4c = -c + 2i - 34, -c - i = -12. Let m(f) = cf*2 - 30f*2 + 10f*2 + 13f*2. Let s(t) = t. What is m(s(h))? 3h*2 Let y(o) = -7o + 5. Let p(v) = 4v - 3. Let w(s) = 5p(s) + 3y(s). Let i(m) be the first derivative of m2/2 - 529. Determine i(w(a)). -a Let q(s) = 3s. Let p(l) = 4l + 3. Let z(f) = -7f - 5. Let y = -58 - -61. Let d(w) = yz(w) + 5p(w). Give q(d(g)). -3g Let r(a) = -79a*2 + a - a + 86a*2. Let m(v) = -16v - 11. Let p(i) = -3i - 2. Let y(h) = -2m(h) + 11p(h). Determine y(r(c)). -7c*2 Let r(j) = -6j*2 + 20j + 9. Let c(p) = -10p. Give c(r(n)). 60n*2 - 200n - 90 Let o(c) be the third derivative of 7c4/24 + 672c*2. Let t(r) = -65r. Determine t(o(x)). -455x Let n(k) = -616k*2 + 1242k*2 - 624k*2. Let i(o) be the third derivative of -3o*4/4 - 2o*2. What is n(i(d))? 648d*2 Let h(z) = 627216z*2. Let d(v) = 4v*2. Calculate d(h(x)). 1573599642624x*4 Let m(x) = -11x - 3. Let n(s) = 10s + 2. Let c(j) = j3 - 3j*2 - 2. Let f be c(3). Let i(q) = fm(q) - 3n(q). Let t(p) = p. Calculate t(i(v)). -8v Let n(q) be the second derivative of -q*3/6 + 3q. Let m(z) = 13z2 - 3z + 3. Let g(v) = 26v2 - 7v + 7. Let l(b) = 3g(b) - 7m(b). What is n(l(y))? 13y2 Let b(h) = 4h*2. Let t(m) = 7m*2 + 13m. Let i = 22 + -16. Let z(r) = -ir - 44 - 3r*2 + 44. Let k(v) = -6t(v) - 13z(v). Determine k(b(s)). -48s*4 Let x(c) = -29c - 22c + 47c. Let l(s) be the first derivative of -s*2/2 + 5. Determine x(l(d)). 4d Let z(b) = 2b2. Let h = -8 - -12. Suppose o = 4j + j - 852, o - 678 = -hj. Let f(d) = 3d*2 - j + 170. What is z(f(u))? 18u*4 Let d(s) = -3s*2. Let c(m) = 3m + 1058. Give c(d(o)). -9o2 + 1058 Let y(r) = -4r*2 + 1615r - 1615r. Let j(v) = -5v. Calculate y(j(q)). -100q2 Let s(w) = -w3 - 50w*2. Let t be s(-50). Let d(i) be the second derivative of -1/12i*4 + 11i + 0i2 + 0i*3 + t. Let k(z) = 6z. Determine d(k(h)). -36h2 Suppose 151 + 29 = 10k. Let v(j) = -41j + kj + 21j. Let n(z) = -18z*2. What is n(v(s))? -72s*2 Let q(b) = 7b*2. Let d = -1 + 1. Let s be ((-16)/2)/(100/(-75)) + -3. Let i(n) = d + n - 3 + s. Determine i(q(h)). 7h2 Let m(r) be the second derivative of r3/6 - 9r - 2. Let n(d) = -29d. Give m(n(c)). -29c Let m(c) = c2. Let t(h) = h2 + 20h - 27. Determine t(m(o)). o*4 + 20o*2 - 27 Let z(s) = 55631s. Let w(v) = -2v2. Determine w(z(d)). -6189616322d*2 Let q(z) = -2z*2. Let h(a) = -11a2 + a2 - 18a2 + 3a*2 - 3a*2. Give h(q(m)). -112m*4 Let z(y) = 2y. Let s(m) = 2m. Let c(p) = -2s(p) + z(p). Let j(t) = -129t. Give c(j(o)). 258o Let k(u) = 2u2. Let l(i) be the first derivative of 0i + 0i2 + 4/3i*3 - 2. Give l(k(m)). 16m*4 Let b(f) be the first derivative of -14f*3/3 - 456. Let g(z) = 7z*2. What is g(b(m))? 1372m4 Let p(z) be the second derivative of z3/6 + 115z. Let q(v) = 3v*2 - 10v*2 - 20v*2. Calculate p(q(u)). -27u*2 Let f(s) = -322s*2. Let k(o) = -369o. What is k(f(l))? 118818l2 Let l(m) = -2m*2 - 45. Let w(r) = 685r*2. What is l(w(b))? -938450b*4 - 45 Let b(y) = 0y + 5y - 2y. Let i(t) be the first derivative of 0t - 2/3t*3 + 0t*2 + 2. Calculate i(b(m)). -18m*2 Let r(m) = 345m + 1. Let s(l) = l. Determine s(r(f)). 345f + 1 Let n(p) be the third derivative of -11p*6/720 - 5p*4/24 - 32p2. Let j(v) be the second derivative of n(v). Let w(a) = -a2. Determine j(w(x)). 11x2 Let d(y) = -2183y. Let s(t) = 145t2. Give s(d(q)). 690995905q*2 Let r(k) = -20k*2. Let i(c) = -717c*2 - 8. Calculate i(r(y)). -286800y*4 - 8 Let k(r) = 219r + 39. Let n(f) = -6f. Give n(k(t)). -1314t - 234 Let k(x) = 0x2 + 5x2 - x2 + 0x2. Suppose 2c = -4l + 26, 3c + 8 - 23 = 0. Let m(v) = -lv - 3v + 6v. What is k(m(w))? 4w*2 Let x(q) be the second derivative of 0q*2 + q + 0 - 1/6q*3. Let a(m) be the second derivative of 4m*3/3 + 3m + 55. Determine x(a(y)). -8y Let b(z) = 2994763z. Let a(y) = -3y2. Determine a(b(n)). -26905816278507n*2 Let w(g) = 6g - 4593. Let s(t) = 3t. Calculate w(s(r)). 18r - 4593 Let p(l) = 36l. Let m(k) = -9k. Let d(y) = -15m(y) - 4p(y). Let a(g) = -50g. What is a(d(r))? 450r Suppose -4l - 11 = 3m, -m - 3l = -4m + 24. Let q(z) be the second derivative of 0 + 7z + 0z*2 - 2/3z*m. Let i(b) = 3b*2. What is i(q(p))? 48p*2 Let a(r) = -2r*2. Let b(z) = -238652z*2. Calculate a(b(c)). -113909554208c*4 Let h(g) be the second derivative of 2g*3/3 + 2g + 19. Suppose o + 3r + 2 - 16 = 0, 3r - 16 = -2o. Let c(y) = -o + 2 + y. Determine c(h(p)). 4p Let i(x) = 8x. Let m(v) = -6v*2 + 56464v - 56464v. Give m(i(k)). -384k2 Let j(o) = -1. Suppose -z + 1 - 2 = 0. Let x(i) = -i2 - 4. Suppose -f + 4f = 12. Let b(d) = fj(d) + zx(d). Let v(m) = 8m. Determine b(v(a)). 64a2 Let f(l) be the third derivative of l7/2520 + l5/60 - l2. Let d(n) be the third derivative of f(n). Let y(i) = -318i + 318i + 18i*2. Give d(y(u)). 36u*2 Let i(u) = -542u. Let a(c) be the second derivative of c*3/6 + 153c. Give a(i(f)). -542f Let f(k) = -9k*2 - 12. Let g(r) = -25r*2 - 33. Let x(w) = -11f(w) + 4g(w). Let u(p) = 192p. Calculate x(u(m)). -36864m2 Let y(k) = -5850k. Let o(f) = -2f. Determine o(y(v)). 11700v Let c(b) = b. Let v(i) = 6i - 2. Let s(y) = -27y + 14. Let z(d) = -d - 1. Let f(j) = -s(j) - 3z(j). Let k(n) = 4f(n) - 22v(n). What is k(c(h))? -12h Let n(d) = d*2. Let c(a) = -8a + 9. Let t(b) = b - 1. Let k(u) = 0u + u2 + 2u + 3u + 2. Let w be k(-4). Let q(h) = wc(h) - 18*t(h).	{ "pile_set_name": "DM Mathematics" }
asing order. 8, 4, j Let i = -7 - -18. Let n = 9 - i. Let w = 0.9 - 1.3. Sort w, 0.08, n in descending order. 0.08, w, n Let y = 2.25 - 2.25. Put -4, 14/3, y in ascending order. -4, y, 14/3 Suppose 0 = 4k - s + 14, 20s = 4k + 18s + 16. Suppose 9h - 70 = 4h. Suppose -2r = 2a - h, 5a + 0r + 2r = 47. Sort a, 5, k. k, 5, a Let n be -1 - (3 - (-9)/2). Let y = 55/6 + n. Let i = -46 - -504/11. Put y, i, 0.4, 1 in increasing order. i, 0.4, y, 1 Let a be 77/98(0 + 6). Let f = -975 - -975.05. Let z(u) = -u2 - 7u + 1. Let d be z(-7). Sort f, d, a. f, d, a Suppose -123f - 73 - 296 + 0 = 0. Let u = 0.9 + -1. Let j be 27/(-27) - (1 + 7/(-2)). Put u, -2, f, j in descending order. j, u, -2, f Suppose -8o = -2s + 82, -31s = -35s - 3o + 69. Sort 0.2, 5, s, 1/7, -21 in ascending order. -21, 1/7, 0.2, 5, s Let j(f) = 2f2 - 3f. Let x be j(3). Let s = 0.349 + -146.249. Let c = s + 146. Sort x, c, -2/7 in decreasing order. x, c, -2/7 Let v(u) = u*2 + 8u + 4. Let j be v(-8). Suppose 2y = 3 + 3. Suppose -27 = -16p - 91. Put -1, y, p, j in ascending order. p, -1, y, j Let v be 0 - (8/9)/2. Let h(f) = -1344f + 6735. Let p be h(5). Sort v, p, -4. -4, v, p Let s be (-5)/(-1) - 2/((-2)/(-15)). Let f be (-5)/s(0/(-1))/(-3). Sort f, 1/15, 5 in ascending order. f, 1/15, 5 Suppose -315 + 339 = 3b, 8z = 5b - 40. Let j be (13 - 1)/(-3)1. Sort z, 5, j in ascending order. j, z, 5 Let i be 6/(-1 - -43) + ((-3542)/(-294))/23. Let q be -1662/3. Sort -0.1, 4, q, i. q, -0.1, i, 4 Let r = -6.751 + 7.8. Let m = r + -0.949. Let o = 8 + -3. Sort 0.3, o, m, 2/21 in increasing order. 2/21, m, 0.3, o Suppose -4l = -9l - 4x - 6, -2l + x = -8. Suppose -5u = s + ls + 14, -5s - 12 = -3u. Sort 5, u, 3, -5 in decreasing order. 5, 3, u, -5 Let a = 128 - 221. Let i = -281/3 - a. Put i, 5, 29 in descending order. 29, 5, i Let z(c) = -16c + 41. Let j be z(3). Sort 5, j, 0, 4, -34. -34, j, 0, 4, 5 Let j = -8 - -10.2. Let o = 2 - j. Let v = -54299 + 651589/12. Sort v, -4, o in decreasing order. v, o, -4 Let u = -4.43 + -6.66. Let b = 11 + u. Let f be (-57)/285 + (-21)/(-30). Put -2, f, b, 1/9 in ascending order. -2, b, 1/9, f Let w = -4208 + 4179. Sort -2, 5, -0.21, w. w, -2, -0.21, 5 Let d = -9552 + 9566. Put 1, d, 8, 4, -2 in increasing order. -2, 1, 4, 8, d Let h = 5810 - 5806. Put h, 0, -1, -28, 2/11 in increasing order. -28, -1, 0, 2/11, h Suppose -2q - 3u + 2 = 2u, 39 = -3q + 3u. Suppose -m - 3s + 25 = 4m, 5s = 0. Sort q, 1, m in decreasing order. m, 1, q Let d be (5 + -8)/(2 - (-1)/(-2)). Put 15, d, -10, -4, -5 in descending order. 15, d, -4, -5, -10 Suppose 4 = -3x + 19. Let b = 3.65244 - 0.65244. Sort b, x, 29, -0.4 in decreasing order. 29, x, b, -0.4 Let g = -101161 + 101178. Suppose -2t = 3s - 28 + 5, -t + 3s = 11. Sort t, g, 3 in decreasing order. g, t, 3 Suppose -4d + 2m - 15 = m, 3 = 4d + 5m. Let k = 17 - -3. Suppose -5y + 10y + k = 3c, 0 = 3y + 3. Sort 2, c, d, 1 in descending order. c, 2, 1, d Let g be (-7 - -3 - -118)((-32)/12 - -2). Sort 0, g, 30. g, 0, 30 Let r = -14.2 + 14. Let z = -1559 - -1557. Sort -10, -5, z, r. -10, -5, z, r Let r = -541.5 - -624.5. Sort -1/3, 16, r in descending order. r, 16, -1/3 Let p = 0.085 - -0.035. Let g = 0.02 - p. Let m be (414/(-42) + 6)(-2)/6. Sort m, g, -3 in descending order. m, g, -3 Let o(c) = 24c*3 + 5c*2 - 2c - 4. Let v be o(-1). Put v, 1, 4 in decreasing order. 4, 1, v Let x be (-50 - 1)/(-2(-15)/(-10)). Let u(a) = a3 - 11a*2 - 104a + 26. Let g be u(x). Put 1, g, -44 in ascending order. -44, g, 1 Let c be (-204)/50 - 128/(-1600). Put -1, c, 1709 in descending order. 1709, -1, c Let c = 325 + 726. Let h = c - 1053. Sort h, -1, 2 in decreasing order. 2, -1, h Let l = 0.632 - 4.522. Let o = l - -3.39. Put o, 2/21, 8, 3/7 in increasing order. o, 2/21, 3/7, 8 Let q be (1/(-4))/(9/(-144)). Suppose 5r = q + 6. Let j = -93 - -89. Sort j, -1, r, -5 in descending order. r, -1, j, -5 Let u be 2/(-10)-1 + 0. Let t be 2((-2)/(-40))/((9 - 42) + 31). Sort t, -0.5, u in increasing order. -0.5, t, u Let b be 12 - (-31 + 35). Suppose -5n + f = -0 - 19, -5n + 23 = 3f. Sort 3, n, b in ascending order. b, 3, n Suppose 0 = 6i - 10i - 5k + 28, 4k + 21 = 3i. Sort 0, -1, i, 4 in increasing order. -1, 0, 4, i Suppose y + 3q = -4, -3y - q + 2q = 42. Suppose -2s = s - 5o + 16, 4s + 13 = 5o. Sort s, y, -3 in decreasing order. s, -3, y Let h be 20/70-142/4. Suppose 2o + 3g + 3 = -0g, -2g = 3o - 3. Suppose 5t + 2n - 20 = -on, -3t + 2n = -12. Put 1, t, h, 3 in increasing order. h, 1, 3, t Let m(s) = 4s*2 - 56s - 226. Let q be m(-4). Sort 0.5, 6, q in descending order. q, 6, 0.5 Let j be 3/(-24)-1 - 2/16. Suppose j = 3z + 22 - 1. Let n be 1/z11/22. Put 1, n, 4, -0.5 in increasing order. -0.5, n, 1, 4 Let w be 2/(-2) + (-7)/(-5). Let t = 65338 - 65335. Sort -2, -0.4, t, w in decreasing order. t, w, -0.4, -2 Let l = -1 + 1.2. Let s = -843.81 - -843.41. Put l, -5, s, 3 in increasing order. -5, s, l, 3 Let u = 142 - 156. Let a be 114/21 - (3 - (-36)/u). Put -25, -2, a in descending order. a, -2, -25 Suppose 104r - 107r + 2515 = -4m, r = m + 630. Put -7, 0, m in increasing order. m, -7, 0 Suppose 4j = 2r + 10, 0 = 117r - 112r + 5. Sort 0, -1, j, 50. -1, 0, j, 50 Let r = -1420 + 4259/3. Sort 13.4, r, -5/2 in descending order. 13.4, r, -5/2 Suppose -54m = 94 + 14. Suppose -3 = -2q + 5q. Let h be (11 - (3 + -1)) + -2. Put h, q, m, 1 in increasing order. m, q, 1, h Let r = -4.228 + 50.228. Let q = 5.6 + 40.2. Let b = q - r. Sort b, 0.3, 31. b, 0.3, 31 Suppose 8 = z + k + 1, 17 = z + 3k. Let p = -452 + 452. Put p, -130, z in decreasing order. z, p, -130 Let s(p) = -199 - 3p2 - 11p - 201 + 391. Let w be s(-3). Sort 11, 4, w in decreasing order. 11, 4, w Suppose 23g + 24 = 35g. Let p = -23 - -27. Let r be (p/10)/((-21)/35). Put -1, g, -2, r in increasing order. -2, -1, r, g Suppose 3u + 5a - 14 = 0, 80 = 4u - 5a + 3. Let z = 206 - 203. Put -1, u, -4, z in descending order. u, z, -1, -4 Let z = -0.13 + 2.13. Let k = 1 + -4. Suppose 0 = -9g + b + 134, g - 2g = -5b - 10. Put z, k, 1/3, g in descending order. g, z, 1/3, k Let a = 18726 - 130974/7. Sort -0.1, a, 5, -0.14 in decreasing order. a, 5, -0.1, -0.14 Let v(t) = -t3 - 35t + 77. Let k be v(2). Put -0.3, 45, k, -0.1 in decreasing order. 45, -0.1, -0.3, k Suppose c = -2z - 35, 5c + 4z + 62 = -131. Let i = 44 + c. Suppose -5 = -iq - 2. Sort -5, 4, q in descending order. 4, q, -5 Let h = 19 + -17. Let w = 39 + -39.5. Let o = 45 - 48. Sort h, w, o in descending order. h, w, o Suppose 21k + 2 = 23k. Let m be 12/4 - (1 + k). Suppose -280j - c + 12 = -285j, -2 = 3j + 2c. Put -0.4, j, m in descending order. m, -0.4, j Let s = 455369/6 - 75895. Let g be (-2)/5 - (-19)/(-15). Sort -1, 1, s, g. g, -1, s, 1 Let n = -11763 + 11776. Sort -1/3, n, 1.6, -4 in decreasing order. n, 1.6, -1/3, -4 Let c = 5163 - 5158. Sort 4, 35, -4, -3, c in decreasing order. 35, c, 4, -3, -4 Suppose -805 = 141c - 164c. Sort c, -4, 0, 3. -4, 0, 3, c Let q = 18199 - 891757/49. Sort 0.1, 4, q, 1, 10. q, 0.1, 1, 4, 10 Let o = -3 + 2. Let t = -11926 - -11930. Sort t, 21, o in increasing order. o, t, 21 Let b = -49407 - -691351/14. Let x = -47/2 - b. Let g = 2/119 - 264/1547. Sort -4, x, g in descending order. x, g, -4 Let o = -40 - -43. Let v(u) = 2u3 + 10u*2 + 4u - 5. Let x be v(-4). Suppose -5r = -4g + x, -4r + r - 8 = -g. Sort r, -44, o in descending order. o, r, -44 Let b = -27 - -50. Let y = b + -22.95. Let g = -1.05 + y. Sort g, -4, -2 in descending order. g, -2, -4 Let b = 1.39 - 25.79. Let i = b - -2.4. Let l = i + 6. Sort -0.5, 0, 2, l. l, -0.5, 0, 2 Let x = 23.4 + 1.6. Let f = x - 24.79. Let d = 0.31 - f. Put d, 0, -0.1 in decreasing order. d, 0, -0.1 Suppose 5v - 225 = 5f, 17v - 18v = f - 31. Put 4, v, -5, -3, -1 in descending order. v, 4, -1, -3, -5 Let l = -3204.2 - -3202. Put 1, l, -1 in ascending order. l, -1, 1 Let a = -828 + 827.6. Let q(v) = v - 19. Let l be q(7). Let p be (l/(-81))/((-8)/12). Put a, -0.1, -2/19, p in decreasing order. -0.1, -2/19, p, a Suppose 257c - 10844 = -9816. Let q = 0.97 + -1. Sort 1, q, c in increasing order. q, 1, c Suppose 38*x + 1283 = -2973. Sort x, 1, 5. x,	{ "pile_set_name": "DM Mathematics" }
31 (c) 1/5 (d) 0 c What is the biggest value in 1/18, -3, -2/3, 1, 4? 4 What is the fifth biggest value in 0.3, -1/5, 1/4, 2/73, 0.4? -1/5 Which is the fifth biggest value? (a) 2 (b) -5 (c) 0.1 (d) -8 (e) 4/9 d What is the third smallest value in 0, 5, 0.3, -12? 0.3 What is the third biggest value in 1, -5, 0.2, -6? -5 What is the smallest value in -0.05, -2/3, 0.61, -0.5? -2/3 What is the third biggest value in -3, -0.2, 0.4, -2? -2 What is the third smallest value in 0.58, -3/2, -0.5, 4? 0.58 What is the second smallest value in 2/21, -1/3, -3, -1/4, 0? -1/3 Which is the second smallest value? (a) -5 (b) 0.5 (c) -193 a What is the second smallest value in 152, 2/13, 0? 2/13 What is the second biggest value in -3, -10, 0.04? -3 Which is the smallest value? (a) -5 (b) 0.02 (c) -21 (d) -3 c Which is the third biggest value? (a) 2/3 (b) -0.1 (c) -13 (d) 0 (e) 1 d What is the second biggest value in -2, 0.28, 5, -5, 3? 3 Which is the third biggest value? (a) 3/4 (b) 0.007 (c) 4 b Which is the fifth biggest value? (a) 0.0971 (b) 0.1 (c) 0.3 (d) 2/3 (e) 1/2 a What is the fourth biggest value in 3, -1/44, -6, 5/6, -0.3? -0.3 Which is the third smallest value? (a) 2 (b) -11 (c) 3 c What is the biggest value in -1.4, 1, 2, 1/2? 2 Which is the third biggest value? (a) 6 (b) 1 (c) 1/26 (d) 3/4 d Which is the third smallest value? (a) 1/4 (b) 104 (c) 6 b What is the second biggest value in 91, -2, -1? -1 Which is the second smallest value? (a) 1 (b) 0.15 (c) -1 (d) -8/9 (e) -2/7 d What is the fifth smallest value in -1/2, 1/9, -3, -4/7, -1/8? 1/9 Which is the fourth biggest value? (a) -800 (b) -0.5 (c) 0.4 (d) 3/4 (e) 4/7 b Which is the fourth biggest value? (a) -4 (b) -0.2 (c) -9/4 (d) 1/5 (e) -0.9 c What is the smallest value in 3, -1/15, -6, 2/7? -6 Which is the third biggest value? (a) -3 (b) 1.9 (c) 3 (d) -0.01 d Which is the third biggest value? (a) -0.5 (b) 1/4 (c) 5 (d) -4/7 a What is the third smallest value in 0.1, -4/77, 3/7? 3/7 What is the smallest value in -2, 4/5, -182/29? -182/29 What is the biggest value in -9/44, 5, -1/2? 5 Which is the fourth smallest value? (a) -2 (b) 7 (c) -6.7 (d) 2 b Which is the third smallest value? (a) 1 (b) -0.4 (c) 31 (d) -0.3 (e) 5/2 a What is the third smallest value in -2/9, -2/3, -5, 4/7, 18.6? -2/9 What is the second smallest value in -1, 42, 9? 9 Which is the biggest value? (a) 4 (b) 17 (c) 0.5 b What is the second biggest value in -3, 21, 3/5? 3/5 What is the third smallest value in -0.3, 3, 113? 113 Which is the fourth smallest value? (a) -0.1 (b) -2/7 (c) -3 (d) -12 a Which is the second smallest value? (a) 1/3 (b) -3 (c) 3092 a What is the fourth smallest value in 4, 14, -2, -1? 14 What is the third smallest value in 0.3, -1/6, -50, -0.5? -1/6 What is the fourth smallest value in 3/4, -4/5, 1, -1/4? 1 Which is the third smallest value? (a) 0 (b) 0.08 (c) 1.8 c Which is the third biggest value? (a) -2/11 (b) 0.7 (c) -1/21 a Which is the second smallest value? (a) -4 (b) -3 (c) -0.4 (d) 0.3 b Which is the third biggest value? (a) 306 (b) 0.1 (c) -2/7 c What is the fifth smallest value in -0.1, -4, -796, 3, 2/5? 3 What is the fourth smallest value in -4, -2, 48, -0.1? 48 Which is the fourth biggest value? (a) 0 (b) 4288 (c) -1/3 (d) 0.3 (e) -3 c What is the second smallest value in 0.4, -0.1, 0, -0.11, -9? -0.11 Which is the biggest value? (a) -15 (b) 2/5 (c) -0.2 (d) 0.2 b What is the second smallest value in -0.3, -5, -2/7, -0.003? -0.3 What is the third biggest value in -37, -3/4, 3, 0.5? -3/4 What is the biggest value in -0.73, 2/5, -1/5? 2/5 Which is the fourth smallest value? (a) -5/2 (b) 5 (c) 1 (d) 6/11 (e) -0.4 c Which is the biggest value? (a) 23 (b) -57 (c) 1/2 a Which is the second biggest value? (a) 6/7 (b) 3 (c) 2/17 a Which is the third smallest value? (a) 3/4 (b) -11/2 (c) 1/4 a Which is the smallest value? (a) 3 (b) 1/4 (c) 1/3 (d) -2 d Which is the second smallest value? (a) 5 (b) 4 (c) 122 a Which is the second biggest value? (a) 5 (b) 37 (c) -1/6 a Which is the biggest value? (a) -0.2 (b) 0.1 (c) 1/14 (d) 2/7 d Which is the smallest value? (a) 5/2 (b) -11.5 (c) 1 (d) 4 b What is the third smallest value in 75, 2/9, 1/4? 75 What is the fifth biggest value in 5, -7, 8, 4, 0.2? -7 Which is the second smallest value? (a) 90 (b) -1 (c) -0.33 c Which is the smallest value? (a) 16/9 (b) 1/7 (c) -79 c What is the third biggest value in -2/9, -6.1, 4/5, 2/7? -2/9 Which is the fourth biggest value? (a) 4/5 (b) 2/73 (c) 3 (d) -1/6 d What is the second smallest value in 2, 0.5, 1, -0.97? 0.5 What is the smallest value in 3, -2/9, 1.3, -1? -1 What is the fifth biggest value in -4, -1/3, 2/11, -2/5, 0.3? -4 Which is the smallest value? (a) -0.4 (b) -4 (c) 2/23 b Which is the third biggest value? (a) 15 (b) 10 (c) 2/5 c What is the second biggest value in -0.005, -5, -13, 3/2? -0.005 Which is the fourth biggest value? (a) 1 (b) -121 (c) -0.4 (d) 0.5 b What is the third smallest value in 2, -3, 1/2, 7? 2 Which is the smallest value? (a) -3/2 (b) -0.05 (c) -32 c Which is the smallest value? (a) 0.1 (b) 5 (c) 0 (d) 8/9 c What is the second biggest value in -1/12, -16, -1? -1 Which is the smallest value? (a) -126/23 (b) -1/2 (c) -5 a Which is the second smallest value? (a) 0.1 (b) -1/4 (c) -62 b Which is the third biggest value? (a) 1/11 (b) 0.3 (c) 17 a Which is the third smallest value? (a) 3 (b) -1 (c) -3 (d) 0.42 d Which is the fourth smallest value? (a) 1 (b) -2 (c) 0.16 (d) 2 (e) -0.5 a Which is the third smallest value? (a) 1 (b) -106 (c) 48 c What is the biggest value in 2/7, -119, 0? 2/7 What is the second smallest value in 6.9, -6, 2, 2/11? 2/11 Which is the smallest value? (a) 6 (b) 1/8 (c) 4 b What is the smallest value in 2/13, 6, -2/9? -2/9 Which is the second biggest value? (a) 1 (b) -0.2 (c) 28 (d) -2 a Which is the smallest value? (a) -36 (b) 2/15 (c) 0.2 a What is the third biggest value in 2, -8, 3/94? -8 Which is the third biggest value? (a) -8 (b) -0.2 (c) -11 c What is the third biggest value in 0.2, -25, -1/9? -25 What is the third smallest value in -45, 11, -5? 11 Which is the second smallest value? (a) -2/5 (b) 3/4 (c) -185 a What is the biggest value in 0.3, -4, -7.2, 3? 3 Which is the second smallest value? (a) 0.33 (b) -0.01 (c) 1/3 (d) 2/9 d What is the biggest value in -0.13, 0.3, 1/11? 0.3 What is the fifth smallest value in 2, 114, -2, 5, 2/3? 114 What is the smallest value in 1/4, -0.04, 49, 0.7? -0.04 What is the third smallest value in 1.85, 3/2, 3/7? 1.85 What is the second biggest value in -3, 1317, -4? -3 Which is the second biggest value? (a) -16 (b) -10/7 (c) 4 (d) -5 b What is the second biggest value in -3.5, -0.4, 3/7, 4? 3/7 What is the second biggest value in 7, -1/527, 0? 0 Which is the third biggest value? (a) -21 (b) 13 (c) -0.1 (d) 3 c What is the third smallest value in 0.3, 0.2, -16, 4? 0.3 Which is the second smallest value? (a) 5 (b) -7/3 (c) -16/3 (d) 2/3 b What is the third smallest value in 22/7, -12/7, -5, 5, 4? 22/7 What is the third smallest value in 1, -0.5, 0.12, 0.3, 6? 0.3 What is the second smallest value in 5, 3/14, 3/10? 3/10 Which is the smallest value? (a) 3 (b) 5 (c) -1/8 (d) 4 c Which is the fourth smallest value? (a) -0.4 (b) -13/33 (c) 7/3 (d) 0.4 c What is the biggest value in 575/4, -3, -1, 4? 575/4 What is the fourth smallest value in -0.3, 0, -0.6, -1/8? 0 What is the third smallest value in 72/11, 4, -4? 72/11 What is the third smallest value in -2/107, -0.4, 2/9, -0.1? -2/107 What is the biggest value in 0.2, -51, 3, -4? 3 Which is the smallest value? (a) -4 (b) 40 (c) 2/7 a What is the smallest value in -8, 0.4, -0.19? -8 Which is the third smallest value? (a) -1 (b) -6/11 (c) 5 (d) -8 b Which is the smallest value? (a) 0.28 (b) -2 (c) 26 (d) 1/3 b What is the biggest value in -30, 0.2, -1/4, 6? 6 Which is the smallest value? (a) 692 (b) -0.2 (c) 5 b Which is the second smallest value? (a) -0.3 (b) 1/2 (c) 323 b Which is the second biggest value? (a) -1/2 (b) -3/4 (c) 50/7 a What is	{ "pile_set_name": "DM Mathematics" }
c is divided by 22. 14 Suppose -1073 = 77b - 106b. What is the remainder when 103 is divided by b? 29 Let m(v) = 2v2 - 6v - 71. Calculate the remainder when m(-7) is divided by 14. 13 Suppose 0p + p = 5. Let a be 0((-3)/(-2) - (-5 - -7)). Suppose j - 1 - p = a. What is the remainder when 22 is divided by j? 4 Suppose 0 = m + v + 3v - 148, 0 = 2m + 4v - 316. What is the remainder when m is divided by 19? 16 Let r(p) = 76p*2 - 2p - 1. Suppose -4x = -34 - 46. Calculate the remainder when r(-1) is divided by x. 17 Suppose 7q - 2q - 95 = 0. Let k(v) = 2v - 9. What is the remainder when q is divided by k(9)? 1 Suppose 2c + 4w + 404 = 8w, -w + 596 = -3c. What is the remainder when 21 is divided by 4/6 + c/(-27)? 5 Suppose 7o + 0o - 336 = 0. What is the remainder when 476 is divided by o? 44 Let k = 65 + -125. Let g = 65 + k. Calculate the remainder when 12 is divided by g. 2 Suppose 4b + s - 103 = 0, -31b + 30b + 5s = -52. Calculate the remainder when 311 is divided by b. 14 Let j(o) = -o*2 + 8o + 1. Let d(h) = -3h2 + 17h + 19. What is the remainder when d(6) is divided by j(7)? 5 Let u = 866 + -817. What is the remainder when 435 is divided by u? 43 Suppose 2v = 3m + 1, -5m - v = -5v - 1. Suppose 30 = x + 4x. Let p = x + m. Calculate the remainder when p is divided by 1. 0 Let u = -37 - -61. Let a be (4/(-16))/(5/(-80)). Suppose -b + ab = u. Calculate the remainder when 31 is divided by b. 7 Let q(u) = -2u3 - u2 - u. Let p(r) = r + 1. Let g be p(-2). Let f be q(g). Suppose fw - 7 = 19. What is the remainder when 51 is divided by w? 12 What is the remainder when (24/(-5))/(18/(-630)) is divided by 34? 22 Let k be (-4)/(-10) - (-38)/5. Suppose 3g + 75 = kg. What is the remainder when (-168)/1030(-10)/90 is divided by g? 11 Suppose 0 = 3a + 5f - 956, 2f - 3f - 332 = -a. Calculate the remainder when a is divided by 28. 19 Suppose 3q - 5q = -14. Suppose -121 + q = -3x. Suppose -56 = -8d + 24. Calculate the remainder when x is divided by d. 8 Let d = 580 + -344. Suppose 0s = -4s + d. Let l(u) = -u2 + 9u - 2. What is the remainder when s is divided by l(7)? 11 Suppose 0 = -p - 3d + 13, -5p + 18 = d - 19. Let r = -4 + p. Suppose -ry + 106 = -140. What is the remainder when y is divided by 21? 19 Suppose 157 = 3m + 7. Suppose 41 - m = -y. Calculate the remainder when 13 is divided by y. 4 Let u(h) = 2h2 + h + 1. Let d(c) = -c2 + 3c - 1. Let q be d(2). Calculate the remainder when 54((-8)/(-6) - q) is divided by u(2). 7 Let k(z) = 63z + 653. Suppose -2p + 54 = 2. What is the remainder when p is divided by k(-10)? 3 Suppose -3n - n = -24. Suppose 44 = 3b - 5a, -6 + 2 = a. What is the remainder when b is divided by n? 2 Let d be (-1)/(((-4)/(-22))/2). Calculate the remainder when (-1 + -1)d/2 is divided by 1/(680/56 + -12). 4 Suppose 4t - 3p + 9 = -38, 3t + 2p = -14. Let c = t - -11. Suppose -8q + 10 = -cq. What is the remainder when 3 is divided by q? 1 Suppose -n + 14 = -5c, c - 10 = 3n + 4. What is the remainder when 47 is divided by 3 - (-12 - (n - -3))? 11 Calculate the remainder when (-64)/(-3)(-18)/(-12) is divided by 85/8 + (-36)/(-96). 10 Let k(h) = h*2 - 17 - 2h*2 - 3 - 87h + 99h. Calculate the remainder when 33 is divided by k(8). 9 Suppose -39n - 99 = -1581. Calculate the remainder when 721 is divided by n. 37 What is the remainder when (7 + 20/(-3))390 is divided by 44? 42 Let m be (-3)/12 - 274/(-8). Suppose -3p = -4d - 68, -5d = -d + 5p + 68. Let r = d + m. Calculate the remainder when r is divided by 4. 1 Suppose -u - 4 = -6. Let i = u - -11. Calculate the remainder when 22 is divided by i. 9 Let i = -41 - -58. What is the remainder when 0 + -1 + 153 + 0 is divided by i? 16 Let x(j) = j2 - 5j + 4. Let o be x(6). Let y = 16 - o. Calculate the remainder when 22 is divided by y. 4 Suppose 0 = -39j + 43j. What is the remainder when (j - 1)(12/4 - 14) is divided by 6? 5 Let x = -26 - 5. Let f = 32 + x. Calculate the remainder when 4 is divided by f. 0 Suppose 0 = -n + 5w - 329 + 386, 2n - 114 = -2w. Calculate the remainder when n is divided by 27/(-6)(-16)/6. 9 Suppose 16v - 15v - 177 = 0. Let t = -110 + v. What is the remainder when t is divided by 35? 32 Let d = 275 + -248. Calculate the remainder when 103 is divided by d. 22 Let x be 10 + 3/(3/2). What is the remainder when (2 + (2 - -9))1 is divided by (-1 - 0)/((-3)/x)? 1 Suppose 4i - 4w = -24, -2w + 3 = 4i + 21. Let v = i - -5. Suppose -3a = -q + a + 9, -a + 5 = v. Calculate the remainder when q is divided by 16. 13 Let t = 11 + -9. Suppose 4q + 16 = tq. Let w(k) = -6k. Calculate the remainder when w(q) is divided by 25. 23 Let m(a) = 2a3 - 4a*2 + 11a - 48. Calculate the remainder when m(5) is divided by 28. 17 Let w = 3 + 7. Let q = -62 - -48. Calculate the remainder when 7 is divided by ((-8)/w)/(q/35). 1 Suppose -5s = -6s - 3z + 28, -4z + 60 = 2s. Let x(y) = y3 - 7y*2 + 11y + 7. What is the remainder when s is divided by x(5)? 10 Suppose -5a = 2x - 3, a = -2x - a + 6. What is the remainder when 18 is divided by x? 2 Suppose 2c = 5x + 11, 5c = -0x - 2x + 13. Calculate the remainder when 6 is divided by c. 0 Let d(t) = 9t2 + 4t + 105. Calculate the remainder when d(-6) is divided by 29. 28 Let l = -90 + 138. Let a = -15 - 3. Let n = a + l. Calculate the remainder when n is divided by 16. 14 Let p = -1049 + 1055. What is the remainder when 333 is divided by p? 3 Suppose 2 = 2z - 5h - 30, 5z = 4h + 97. Calculate the remainder when 57 is divided by z. 15 Calculate the remainder when (-4)/(-3)351/52 - -4 is divided by 8. 5 Let q(b) = 3b*2 - 3b + 4. Let x be q(3). Suppose -6z + x + 8 = 0. Suppose -5 = -zo + 50. Calculate the remainder when o is divided by 7. 4 Let i(q) = q + 11. Let c be i(-6). Calculate the remainder when (-1)/c + 391/5 + -3 is divided by 26. 23 Calculate the remainder when 52 is divided by (88/33 + -4)/((-2)/9). 4 Calculate the remainder when ((-1)/1)/1-127 is divided by 45. 37 Suppose -h + 11t + 14 = 15t, -h + 14 = 2t. What is the remainder when (161/28)/((-1)/(-4)) is divided by h? 9 Suppose 144p = 142p + 106. Calculate the remainder when p is divided by 13. 1 Let j = 1181 + -678. What is the remainder when j is divided by 63? 62 Let n = 6 + 59. Let o be -1 - -26/4. Let d(s) = 4s*2 + 1. What is the remainder when n is divided by d(o)? 14 Suppose -5f = 2o - 4455, 6f - 5o = 11f - 4440. Calculate the remainder when f is divided by 64. 61 Let r(i) = 13i - 31. Suppose -4n + 2 = -3n. Let w(u) = 4u - 10. Let q(z) = nr(z) - 7w(z). Calculate the remainder when q(-10) is divided by 6. 4 What is the remainder when ((-24)/4)/((-6)/70) is divided by 18? 16 Let w = 1710 - 1131. What is the remainder when w is divided by 14? 5 Let o = -2 + 5. Let j(v) = 2v3 + 8v*2 - 28v - 90. What is the remainder when j(-3) is divided by o? 0 Let t(c) = 3c2 - 16c + 28. What is the remainder when 159 is divided by t(5)? 21 Suppose 2p + 4 = 26. Let u be 1 + 31 + 13 + -9 - 3. Let v = 74 - u. What is the remainder when v is divided by p? 8 Suppose 580 = 2w - 160. Calculate the remainder when w is divided by 96. 82 Suppose -5o + o - 4i = -184, -o = -i - 38. What is the remainder when o is divided by 12? 6 Let s(w) = -24w - 38. Suppose 2 - 5 = 3d. Let o(y) = 19y2 + 2y + 1. What is the remainder when s(-3) is divided by o(d)? 16 Suppose 4 = 64a - 68a, 0 = k + 3a - 42. What is the remainder when 108 is divided by k? 18 Suppose 22w - 84 = -5a + 21w, -5w - 60 = -5a. Calculate the remainder when (1791)/1 is divided by a. 15 Let g(z) = -49z3 + 3z*2 + 2z + 2. Let c be g(-2). Suppose -4a - a + c = 3p, 4p = 16. What is the remainder when a is divided by 20? 18 Let p = 104 + -44. Let m = p + 98. Let w = 8 + 32. What is the remainder when m is divided by w? 38 Suppose 5q + 63 = -4k, 0 = -2k - 6q + 2q - 36. Let u(j) = -21j + 1. Let a be u(2). Let b = k - a. Calculate the remainder when b is divided by 8. 5 What is the remainder when 43 is divided by 2/8 - 5564/(-208)? 16 Suppose 0 = -2m + 26. Let t(i) = 16i + 37 + 1 - 10i - 4*i. Calculate the remainder when t(0) is divided by m. 12 Let f(d) = -12	{ "pile_set_name": "DM Mathematics" }
of 2086? 2, 7, 149 What are the prime factors of 1128? 2, 3, 47 What are the prime factors of 7219? 7219 List the prime factors of 1487. 1487 What are the prime factors of 1666? 2, 7, 17 List the prime factors of 548. 2, 137 What are the prime factors of 166? 2, 83 List the prime factors of 55919. 199, 281 What are the prime factors of 2885? 5, 577 What are the prime factors of 598? 2, 13, 23 List the prime factors of 104. 2, 13 List the prime factors of 17017. 7, 11, 13, 17 What are the prime factors of 24780? 2, 3, 5, 7, 59 What are the prime factors of 90855? 3, 5, 673 What are the prime factors of 4699? 37, 127 What are the prime factors of 1596? 2, 3, 7, 19 What are the prime factors of 377? 13, 29 What are the prime factors of 54634? 2, 59, 463 What are the prime factors of 1068? 2, 3, 89 List the prime factors of 2192. 2, 137 What are the prime factors of 73192? 2, 7, 1307 What are the prime factors of 505? 5, 101 List the prime factors of 788. 2, 197 List the prime factors of 1970. 2, 5, 197 List the prime factors of 11746. 2, 7, 839 What are the prime factors of 498? 2, 3, 83 What are the prime factors of 127635? 3, 5, 67, 127 List the prime factors of 411. 3, 137 What are the prime factors of 14796? 2, 3, 137 What are the prime factors of 38948? 2, 7, 13, 107 List the prime factors of 119. 7, 17 What are the prime factors of 14872? 2, 11, 13 List the prime factors of 817. 19, 43 List the prime factors of 8834. 2, 7, 631 List the prime factors of 5278. 2, 7, 13, 29 What are the prime factors of 7440? 2, 3, 5, 31 List the prime factors of 563. 563 What are the prime factors of 2616? 2, 3, 109 List the prime factors of 29824. 2, 233 List the prime factors of 1301. 1301 What are the prime factors of 93606? 2, 3, 15601 List the prime factors of 37815. 3, 5, 2521 What are the prime factors of 16101? 3, 1789 What are the prime factors of 5865? 3, 5, 17, 23 What are the prime factors of 13980? 2, 3, 5, 233 List the prime factors of 664. 2, 83 What are the prime factors of 1235? 5, 13, 19 What are the prime factors of 74945? 5, 13, 1153 List the prime factors of 3792. 2, 3, 79 What are the prime factors of 902? 2, 11, 41 List the prime factors of 1444. 2, 19 List the prime factors of 4228. 2, 7, 151 List the prime factors of 659. 659 List the prime factors of 1693. 1693 What are the prime factors of 368? 2, 23 List the prime factors of 672. 2, 3, 7 List the prime factors of 5848. 2, 17, 43 What are the prime factors of 1088? 2, 17 What are the prime factors of 33720? 2, 3, 5, 281 What are the prime factors of 2354? 2, 11, 107 What are the prime factors of 2101? 11, 191 List the prime factors of 161. 7, 23 What are the prime factors of 75759? 3, 25253 List the prime factors of 11688. 2, 3, 487 What are the prime factors of 788? 2, 197 What are the prime factors of 9594? 2, 3, 13, 41 What are the prime factors of 4928? 2, 7, 11 What are the prime factors of 3108? 2, 3, 7, 37 What are the prime factors of 398? 2, 199 What are the prime factors of 20175? 3, 5, 269 What are the prime factors of 468? 2, 3, 13 What are the prime factors of 53687? 37, 1451 List the prime factors of 1901. 1901 List the prime factors of 1172. 2, 293 What are the prime factors of 1203? 3, 401 What are the prime factors of 43835? 5, 11, 797 List the prime factors of 14030. 2, 5, 23, 61 List the prime factors of 3297. 3, 7, 157 List the prime factors of 1906. 2, 953 List the prime factors of 4822. 2, 2411 List the prime factors of 23049. 3, 13, 197 What are the prime factors of 147? 3, 7 What are the prime factors of 3253? 3253 What are the prime factors of 49356? 2, 3, 457 List the prime factors of 3032. 2, 379 What are the prime factors of 2860? 2, 5, 11, 13 List the prime factors of 76132. 2, 7, 2719 List the prime factors of 361. 19 What are the prime factors of 20549? 20549 List the prime factors of 21894. 2, 3, 41, 89 List the prime factors of 1372. 2, 7 List the prime factors of 130049. 47, 2767 What are the prime factors of 90048? 2, 3, 7, 67 List the prime factors of 22593. 3, 17, 443 What are the prime factors of 86416? 2, 11, 491 List the prime factors of 13105. 5, 2621 List the prime factors of 81. 3 List the prime factors of 20933. 11, 173 List the prime factors of 113118. 2, 3, 17, 1109 List the prime factors of 975. 3, 5, 13 What are the prime factors of 1208? 2, 151 What are the prime factors of 42? 2, 3, 7 What are the prime factors of 17212? 2, 13, 331 What are the prime factors of 2673? 3, 11 What are the prime factors of 1336? 2, 167 What are the prime factors of 18179? 7, 53 What are the prime factors of 14341? 14341 List the prime factors of 9. 3 What are the prime factors of 66017? 7, 9431 List the prime factors of 95881. 95881 What are the prime factors of 46855? 5, 9371 What are the prime factors of 398? 2, 199 List the prime factors of 59207. 59207 What are the prime factors of 2089? 2089 List the prime factors of 1107. 3, 41 What are the prime factors of 63232? 2, 13, 19 What are the prime factors of 4304? 2, 269 List the prime factors of 329. 7, 47 What are the prime factors of 27358? 2, 13679 List the prime factors of 2548. 2, 7, 13 List the prime factors of 2110. 2, 5, 211 What are the prime factors of 26560? 2, 5, 83 What are the prime factors of 491? 491 List the prime factors of 25657. 25657 List the prime factors of 1149. 3, 383 What are the prime factors of 10444? 2, 7, 373 List the prime factors of 9080. 2, 5, 227 List the prime factors of 40447. 11, 3677 List the prime factors of 25905. 3, 5, 11, 157 List the prime factors of 935. 5, 11, 17 List the prime factors of 4068. 2, 3, 113 What are the prime factors of 775? 5, 31 What are the prime factors of 46699? 17, 41, 67 What are the prime factors of 1633? 23, 71 What are the prime factors of 11352? 2, 3, 11, 43 What are the prime factors of 8952? 2, 3, 373 What are the prime factors of 2912? 2, 7, 13 List the prime factors of 17118. 2, 3, 317 What are the prime factors of 1132? 2, 283 List the prime factors of 15647. 15647 What are the prime factors of 670? 2, 5, 67 What are the prime factors of 4235? 5, 7, 11 List the prime factors of 956. 2, 239 List the prime factors of 14102. 2, 11, 641 List the prime factors of 36714. 2, 3, 29, 211 List the prime factors of 630. 2, 3, 5, 7 List the prime factors of 1545. 3, 5, 103 List the prime factors of 2021. 43, 47 List the prime factors of 2813. 29, 97 What are the prime factors of 1582? 2, 7, 113 List the prime factors of 53545. 5, 10709 What are the prime factors of 2012? 2, 503 What are the prime factors of 54756? 2, 3, 13 What are the prime factors of 105457? 11, 9587 List the prime factors of 10244. 2, 13, 197 List the prime factors of 9082. 2, 19, 239 What are the prime factors of 738? 2, 3, 41 What are the prime factors of 936? 2, 3, 13 What are the prime factors of 1245? 3, 5, 83 What are the prime factors of 475? 5, 19 List the prime factors of 29615. 5, 5923 List the prime factors of 21289. 61, 349 What are the prime factors of 4292? 2, 29, 37 List the prime factors of 53357. 229, 233 What are the prime factors of 1450? 2, 5, 29 List the prime factors of 24844. 2, 6211 What are the prime factors of 1298? 2, 11, 59 What are the prime factors of 8235? 3, 5, 61 What are the prime factors of 981? 3, 109 List the prime factors of 106816. 2, 1669 What are the prime factors of 17192? 2, 7, 307 What are the prime factors of 106? 2, 53 What are the prime factors of 497? 7, 71 List the prime factors of 24030. 2, 3, 5, 89 List the prime factors of 2088. 2, 3, 29 List the prime factors of 8404. 2, 11, 191 List the prime factors of 512. 2 List the prime factors of 821. 821 List the prime factors of 259. 7, 37 What are the prime factors of 976? 2, 61 List the prime factors of 3264. 2, 3, 17 What are the prime factors of 3921? 3, 1307 What are the prime factors of 28937? 19, 1523 What are the prime factors of 4751? 4751 What are the prime factors of 620? 2, 5, 31 What are the prime factors of 209180? 2, 5, 10459 What are the prime factors of 2784? 2, 3, 29 List the prime factors of 114958. 2, 229, 251 What are the prime factors of 97214? 2, 13, 3739 List the prime factors of 65963. 65963 List the prime factors of 42345. 3, 5, 941 What are the	{ "pile_set_name": "DM Mathematics" }
424? 13 What is the greatest common factor of 887222 and 176646? 998 Calculate the highest common factor of 39446088 and 264. 264 Calculate the greatest common divisor of 706988055 and 642. 321 Calculate the highest common factor of 2423634 and 1537137. 8133 Calculate the highest common factor of 258 and 9873789. 129 What is the greatest common divisor of 79962 and 1284? 6 Calculate the greatest common factor of 84 and 3100044. 12 Calculate the greatest common factor of 20255677 and 13. 13 Calculate the greatest common factor of 217500 and 2919720. 1740 Calculate the greatest common factor of 451 and 515821. 41 Calculate the highest common factor of 5596298707 and 10957. 10957 Calculate the greatest common factor of 172 and 135378104. 172 What is the greatest common factor of 72 and 6184338? 6 Calculate the highest common factor of 7437730 and 7930. 610 What is the highest common factor of 672329 and 68698? 49 Calculate the greatest common factor of 31588 and 121370. 106 Calculate the greatest common factor of 14045392 and 40. 8 What is the greatest common divisor of 11665997 and 121602? 1559 What is the highest common divisor of 25543 and 29254033? 3649 Calculate the greatest common divisor of 1076 and 1868. 4 Calculate the greatest common factor of 221 and 208975169. 221 What is the greatest common divisor of 873475 and 75? 25 What is the greatest common divisor of 48953461 and 141? 47 What is the highest common divisor of 32815803 and 98187? 4269 What is the greatest common divisor of 31558027 and 1217? 1217 What is the greatest common divisor of 1352939832 and 2448? 1224 Calculate the greatest common divisor of 3230185 and 893647. 2251 What is the highest common factor of 2502 and 5287143? 417 Calculate the highest common divisor of 681688 and 882. 98 Calculate the greatest common factor of 1 and 6445981. 1 Calculate the greatest common factor of 11888 and 74231644. 2972 Calculate the highest common factor of 4605678 and 14. 14 Calculate the greatest common divisor of 1228399248 and 5776. 5776 Calculate the greatest common divisor of 444300 and 300. 300 Calculate the greatest common factor of 3405 and 2819113. 227 What is the greatest common divisor of 37466741 and 13? 13 What is the greatest common divisor of 1372952 and 70? 14 What is the highest common divisor of 20 and 97618120? 20 Calculate the highest common divisor of 40 and 72936. 8 Calculate the highest common divisor of 126380 and 5751. 71 Calculate the highest common factor of 10450 and 11258830. 2090 What is the greatest common divisor of 5157 and 1804086? 27 Calculate the greatest common divisor of 34 and 5233603. 17 Calculate the greatest common factor of 1598 and 72141710. 1598 Calculate the greatest common factor of 15771866 and 36784. 242 Calculate the greatest common factor of 62902 and 2716. 14 What is the highest common divisor of 574308 and 3904404? 4452 What is the highest common factor of 161131 and 29321? 269 Calculate the greatest common divisor of 894 and 7730418. 894 Calculate the highest common factor of 7224 and 640411212. 3612 What is the highest common factor of 80 and 12524510? 10 Calculate the greatest common factor of 22952016 and 336. 48 Calculate the greatest common factor of 3913 and 10931804. 559 What is the greatest common divisor of 37592 and 286004? 508 Calculate the greatest common divisor of 2544 and 140609. 53 What is the greatest common divisor of 2 and 107266? 2 Calculate the greatest common divisor of 929448 and 117234. 702 What is the greatest common divisor of 13 and 69156165? 13 What is the greatest common divisor of 326637688 and 6136? 6136 Calculate the greatest common factor of 862891 and 76153. 23 Calculate the greatest common divisor of 417 and 714172409. 139 What is the greatest common factor of 1125084 and 192516? 732 What is the highest common factor of 266 and 1264618397? 133 What is the highest common factor of 748 and 8846596? 748 Calculate the highest common divisor of 403796 and 2813. 29 What is the highest common factor of 1422985 and 850? 85 What is the greatest common factor of 136 and 473342084? 68 Calculate the highest common divisor of 288 and 19166112. 288 Calculate the highest common factor of 350942112 and 1080. 216 What is the highest common factor of 6105436 and 2502? 278 Calculate the greatest common factor of 31408 and 2028. 52 What is the greatest common factor of 216 and 1068312? 24 Calculate the greatest common factor of 905833930 and 15599. 15599 Calculate the greatest common divisor of 13490 and 671305. 355 Calculate the highest common factor of 449599 and 1272. 53 Calculate the greatest common divisor of 1075 and 90284305. 215 Calculate the highest common factor of 94 and 1226888. 94 Calculate the greatest common divisor of 17996 and 897556. 44 Calculate the greatest common factor of 1417 and 1040962. 13 What is the highest common factor of 5577155 and 460? 115 Calculate the greatest common factor of 41552 and 24592. 848 Calculate the greatest common divisor of 25802 and 1434727. 679 Calculate the highest common divisor of 592 and 3698742. 74 What is the highest common factor of 434508 and 228? 12 Calculate the highest common divisor of 63185 and 19080. 5 What is the greatest common factor of 15680 and 54220? 20 What is the greatest common factor of 27750 and 5593500? 750 What is the greatest common factor of 4669 and 124262999? 203 What is the greatest common factor of 68039734 and 392? 98 Calculate the greatest common divisor of 45 and 6642576. 9 What is the highest common divisor of 251558330 and 10? 10 Calculate the greatest common divisor of 41258763 and 504. 63 What is the greatest common divisor of 5607807 and 306? 51 What is the greatest common divisor of 4672225 and 150? 25 Calculate the highest common divisor of 145262 and 3094. 26 What is the greatest common divisor of 18404 and 578656? 428 Calculate the greatest common factor of 990 and 124364295. 495 What is the highest common factor of 221730 and 157035? 285 Calculate the greatest common factor of 6851 and 90389. 221 Calculate the greatest common divisor of 477 and 37241934. 159 Calculate the highest common divisor of 3232 and 261893. 101 What is the highest common factor of 117 and 918486? 9 Calculate the highest common divisor of 16283 and 5514795. 857 Calculate the greatest common divisor of 1125984 and 12876. 444 Calculate the greatest common factor of 10606446 and 228. 114 What is the highest common divisor of 552 and 222872208? 552 Calculate the greatest common factor of 7308527 and 35313. 79 What is the highest common divisor of 78588 and 1289268? 2124 What is the greatest common divisor of 18 and 42950394? 18 What is the highest common factor of 82068784 and 2576? 2576 What is the greatest common factor of 100073 and 497743? 437 What is the highest common factor of 784440 and 250200? 360 Calculate the greatest common divisor of 594891 and 12771. 297 Calculate the highest common divisor of 5755176 and 240597. 1197 What is the highest common factor of 20 and 1265338510? 10 What is the highest common divisor of 756 and 1615992? 84 Calculate the greatest common factor of 69081 and 2049. 3 What is the highest common divisor of 687 and 125300785? 229 Calculate the highest common factor of 57 and 664394109. 57 Calculate the highest common factor of 600 and 637866240. 120 What is the greatest common factor of 35584 and 420892? 556 What is the greatest common factor of 906 and 130640217? 453 What is the greatest common divisor of 30807780 and 78690? 1290 What is the greatest common divisor of 287202414 and 326? 326 Calculate the greatest common factor of 698 and 88184273. 349 What is the highest common factor of 22244 and 4785282? 166 What is the greatest common factor of 223232583 and 147? 147 Calculate the highest common divisor of 280235 and 237185. 205 Calculate the highest common factor of 630305368 and 308. 308 Calculate the highest common divisor of 13062 and 35677920. 1866 Calculate the highest common divisor of 1852240 and 72. 8 Calculate the greatest common factor of 16446 and 14046. 6 Calculate the greatest common factor of 60586 and 10. 2 Calculate the highest common divisor of 873933 and 76881. 1569 What is the greatest common d	{ "pile_set_name": "DM Mathematics" }
What is (-1)/((-10)/(-128))(3825/(-90))/(-17)? -32 Evaluate (420/24)/7(-5)/(15/2). -5/3 What is 15/((-720)/(-112))31? 7 Evaluate ((-2)/(-22))/(1309/(-2057))15. -15/7 Calculate ((-30)/(-275))/((-24)/3204). -4/11 What is the value of -143/(-180)(-3)/1? -1/5 Calculate (12/(-28)2730/156)/((-2)/4). 15 Calculate 63/35(24/72)/((-1)/30). -18 Calculate ((-315)/28)/(453/(-604)). 15 What is the value of (40/60)/((-36)/2435)? -9/10 Calculate (-115/8)/((-36235)/28988). 3/2 What is the value of (2/(-34)18/(-9))/((-78)/117)? -3/17 What is 21/30(-24)/(-42)? 2/5 Evaluate (19/38)/(((-4)/80)/(3/(-6))). 5 What is ((-45)/360)/((4/(-16))/(6/(-8)))? -3/8 What is the value of (81/6)/(327/(-218))? -9 What is the value of (70/(-21))/((-14)/84-2)? -10 What is ((-48)/5)/(200/(-250))? 12 What is (-34)/(-2176)24(-24)/(-9)? 1 (((-80)/32)/(10/(-4)))/(7/(-203)) -29 (177/944)/((-3)/(-8)) 1/2 What is (15/((-1320)/(-22)))/((-6)/200)? -25/3 Calculate 1312/(-820)4/(-80). 2/25 Calculate ((-45)/12)/((-615)/2952). 18 What is (-2)/4216/108(-2)/(-1)? -2 What is the value of 19/(4617/(-18))(-18)/4? 1/3 What is the value of ((-3)/(-4))/((-2583)/(-574))(-4)/1? -2/3 What is (36/15)/(-718/315)? -6 Calculate ((-110)/110)/((-3)/1)1/3. 1/9 Calculate (360/405)/((-4)/(-18)). 4 What is the value of (12(-6)/2405)/(6/(-5))? 5/4 Evaluate (88/(-1232))/(372/(-168)). 1/31 10/8(-7)/(-35)156/3 13 (615/7380)/((-7)/6) -1/14 Calculate (22/55-2)/(1/10). -8 Calculate ((-1911)/3822)/(((-2)/(-28))/(-1)). 7 Calculate ((-56)/30)/(-4)(-2360)/(-472). 7/3 What is the value of ((-28)/(-35))/(14/(-5))-7? 2 What is (-40(-2)/480)/(3/99)? 11/2 (-80)/(-96)(2/10)/(3/9) 1/2 What is the value of (-9)/(2/2)(-30)/90? 3 Calculate ((-3)/14)/(177/1510416). -8/7 What is the value of (5/((-45)/(-3)))/((-25)/100)? -4/3 Evaluate (-4)/(-1)(-5)/4. -5 What is the value of ((-39)/13)/(34/170)? -15 (-134/26)/(1/(-8)) 16 Calculate ((-11)/(-88)-2)/(13/13). -1/4 Calculate (-1782)/277212/(-27). 2/7 What is the value of (-63)/14(8/(-6))/1? 6 Calculate ((-9)/5)/(((96/16)/6)/1). -9/5 6/((-42)/(-7))(-32)/81 -4 ((6/10)/(12/(-8)))/((-3)/210) 28 Calculate -6((-391)/345)/(-17). -2/5 What is (29/((-1421)/(-224)))/4? 8/7 Evaluate (19/((-228)/18))/((-90)/(-228)). -19/5 Evaluate ((63/336)/3)/((-3)/12). -1/4 ((-22)/(6732/(-510)))/((-2)/(-12)) 10 (6/4)/(((-7938)/(-56))/(-27)) -2/7 Calculate -1(2/(-36))/((-17)/136). -4/9 Calculate ((-360)/(-75))/4-1. -6/5 Evaluate ((-22)/(-9))/(-1651/3672). -11 Evaluate (100/250)/(2/2)15. 6 What is the value of (-72)/21(-559)/1677? 8/7 Evaluate ((-8)/(-4))/(41/(1886/4)). 23 What is 2035/(-1628)16/130? -2/13 Calculate 119/175/5-1. -7 What is (-23/39)/((-674)/26286)? 6 What is the value of (-3996)/229771/(-2)? 2/23 Evaluate ((-69)/2024-22)/(91/(-4)). -1/3 What is (-9)/154(-65)/(-104)8? -12 (7486/76)/(-197)1(-6)/(-14) -3/14 90/1533/(-154)1 -9/7 Calculate (270/1155)/(-513/455). -18/11 Evaluate 334/(-6)(-1)/4. 17/4 What is the value of ((504/(-77))/(-4))/(9/(-99))? -18 What is (-390)/(-13)(-10)/(-400)? 3/4 Calculate -4((30/(-8))/1)/(6/(-4)). -10 Calculate ((-400)/210)/((32/24)/((-84)/18)). 20/3 What is (((-589)/186)/(-19))/((-2)/(-276))? 23 (385/2009729)/(-52/(-24)) 4/3 Calculate (9/(108/(-8)))/(16/6)4. -1 Evaluate (140/(-1638))/((-160)/576). 4/13 Calculate (47/((-10575)/(-50)))/((-1)/(-27)). 6 (270/30)/(126/14) 1 What is the value of (-252)/31515/(-12)? 1 (-1)/((110/11)/90-1) 9 Evaluate ((-123)/2952)/((-2)/(-4)). -1/12 What is the value of 70/(-2450)207/6? -2/3 Evaluate ((-15)/(-36))/((3/(-40))/((-576)/72000)). 2/45 What is 53/53-4(-203)/28? 29 30/(-8)1(-32)/8 15 What is 13/((-33)/(-770)7)? 10 (14/(-49)7)/((-9)/3) 2/3 What is the value of (-3(-5)/60)/((3/48)/1)? 4 ((-2)/4)/((-10)/(-220)) -11 What is (5/(-330)(-18)/12)/((-3)/(-18))? 3/22 Evaluate 6/39(-6)/12-3. 3/13 What is the value of 90/1218/27? 5 What is (((-1)/(-3))/1)/(152/456)-7? -7 What is 19/((-475)/70)210/(-147)? 4 Calculate ((-5)/(-15))/(-1(-1)/(9/(-27))). -1/9 ((-3)/6)/((525/30)/35) -1 ((-2)/(-4)1)/((-35)/(-26460)-21) -18 Calculate 3/(-4)(322/207)/7. -1/6 Calculate 12((-2)/(-3))/(((-50)/(-15))/5). 12 (51)/(31/((-1302)/105)) -2 What is ((-10)/(-16))/(345/(-46))? -1/12 Calculate (7/(168/(-8)))/(507/(-234)). 2/13 (-6)/(-126)352/(-35) -2/21 Calculate (-67)/((-1273)/76)4. 16 (((-3564)/5103)/((-10)/45))/((-2)/(-7)) 11 76/(-57)(-11)/(-44) -1/3 ((-27)/6140/525)/(2/5) -3 What is the value of ((3/18)/(2-1))/((-94)/752)? 2/3 ((-53)/742)/((20/42)/1) -3/20 What is ((-227)/7264)/(9/484)? -1/24 (332/913)/((-24)/(-18)) 3/11 What is (-54)/(-42)(-3)/(18/(-1))2? 3/7 What is the value of (70/(-84))/((-12)/72)? 5 What is the value of (-28)/1818/(-8)? 7/2 Evaluate 228/6(36/(-2))/(-36). 19 What is the value of (0(-8)/(-24))/(-123/(-12))? 0 Evaluate -43/60(-26)/(-26). -1/5 What is the value of (304/7600)/((-12)/459)? -1/60 Calculate ((-3)/(-2))/((-180)/1080). -9 What is the value of ((-120)/50)/(63/525)? -20 What is ((-15)/6)/(690/(-276))? 1 What is ((-792)/(-1782))/(20/(-54))? -6/5 What is the value of -3210/(-100)(-25)/20-2? 8 What is the value of 242/(-242)(8/24)/((-4)/6)? 1/2 (9/((-18)/(-6)6))/((-5)/2) -1/5 Calculate 12(-19)/(-1596)(-1)/2. -1/14 ((-3)/(-27))/(1960/(-2520)) -1/7 Calculate 3(-17)/(-5967)-9. -1/13 Evaluate (8/20)/(133/380). 8/7 (((-143)/(-33))/(-13))/(14/12) -2/7 What is the value of (30/550)/((12/100)/((-6)/(-45)))? 2/33 ((-16)/16)/((-26)/130) 5 What is the value of ((-5)/40)/(-1)3468/(-102)? -17/4 What is the value of 2/(-30)(4536/42)/18? -2/5 What is ((-20)/6)/((492/4428)/(1/2))? -15 Evaluate 78/4908/681. 26 Calculate (-2)/(1/((-42)/(-616))). -3/22 Calculate 77/(-2)(-30)/55. 21 What is the value of (-192)/24025/(-180)-10? -10/9 Calculate (((-44)/33)/(8/(-6)))/((-63)/1197). -19 Calculate -203/(-6)27/45-2. -12 (200/(-8))/(3/(18/(-15))) 10 Evaluate ((-26)/12)/((18655/105)/(-41)). 1/2 (-3)/(1/(15/30)) -3/2 (2288/(-429))/(4/1815) -8/5 What is the value of (2-2)/448/(-704)4? 3/11 Evaluate ((18/(-15))/3)/((-2037)/(-183330)). -36 Calculate ((-2795)/(-2236))/((-490)/(-16)). 2/49 What is the value of (2/(-13))/((-456)/1482)? 1/2 What is (-105)/245(182/36)/(-13)? 1/6 Evaluate (1/(-21)3)/((144/27)/(-16)). 3/7 What is ((-5)/(-20))/(132/48(-3)/(-12))? 4/11 (-42)/4(-1960)/(-1715) -12 Calculate (43/(-215))/(6/526/9). -13/5 What is (((-24)/14)/(-6))/((-192)/(-2352))? 7/2 What is ((60/(-14))/(4/(-7)))/((-6)/2)? -5/2 -40(21/(-84))/((-4)/(-18)3) 15 What is (-7(-255)/(-238))/((-30)/5)? 5/4 What is the value of (-4)/(-2)15/((-225)/(-15))? 2 What is ((-106)/371)/((-264)/(-84))? -1/11 Calculate 25/10-13114/35815. -3/29 (1/((-25)/105))/(120/(-400)) 14 Evaluate (-2)/36-45272/(-20). -34 (16/((-624)/221))/((-4)/(-12)) -17 Calculate 21(-8)/28(-1)/111. 2/37 67/67(30/(-45))/(1/15) -10 Evaluate ((-14)/5)/(-4(-5)/100). -14 486/432010(-1)/6 -3/16 Evaluate 88(-6)/(-18)5/(80/12). 22 Evaluate (15/(240/(-64)))/(7/((-21)/16)). 3/4 Calculate ((-7)/(-18))/(29/(5220/40)). 7/4 What is the value of 39/(-52)2(-7)/128? 7 ((-5)/(-8))/(246/(-5904)) -15 Calculate (-24)/1316(-91)/(-39). -2/47 Calculate (4146/(-69100))/((-2)/4). 3/25 (-1)/((840/14)/20) -1/3 Calculate (2/(-8))/(4/(-320)4). 5 What is (-189)/(-90)524/(-18)? -14 ((-15)/(-35))/(576/(-1568)) -7/6 What is the value of (1425/(1050/24))/(-14)? -4/7 What is the value of (99/363)/(-3-398/693)? 3/14 Evaluate ((-4)/4)/(-3)(-24)/1. -8 Calculate ((-8)/10)/((-40)/(-26600)38). -14 What is the value of 2((-2)/(-37))/((-5)/(105/(-42)))? 2/37 What is the value of (-3)/15228/((-176)/(-55))? -11 (((-378)/(-24))/(-21))/(1/860) -1/10 Calculate (-315/((-150)/5))/((-3)/28). -14 ((-3)/6)/((-14)/(-308))-1 11 Evaluate 1/(-3)(-11904)/248. 16 (29/(-203))/((-3)/2) 2/21 Evaluate 10/81456/546. 10/3 Evaluate (1160/(-348))/((-5)/(-18)). -12 Calculate ((-9)/18)/(3(-2)/24). 2 Calculate -725/(-525)-12(-6)/(-4). -6 Evaluate ((-6)/(-213))/((-7)/21(-3)/(-1)). -2/71 ((-6)/105)/((-10)/14) 2/25 What is (-10)/(-3)(2/(-6))/((-1420)/30672)? 24 Evaluate (-104)/(-1053)15/20. 2/27 2/(3/3((-3)/(-1))/(-3)) -2 Evaluate (-2)/1(-40)/(-800). -1/10 What is the value of 29/(-638)48/3? -8/11 What is (-4)/(((-3042)/9)/13)? 2/1	{ "pile_set_name": "DM Mathematics" }
e b(l(t)). -7350t2 - 1911t - 66 Let b(z) be the second derivative of -z5/10 - z3/6 + 28z. Let r(w) be the second derivative of b(w). Let c(x) = 0 - 4x*2 + 0 + 2x*2. Calculate c(r(a)). -288a*2 Let o(q) = -3q + 409168. Let l(g) = 2g2. Calculate o(l(y)). -6y*2 + 409168 Let f(t) = 28t*2 + 447t - 447t. Let w = -96 - -98. Let m(b) = 79b*2 - 43b*w - 38b*2. Calculate f(m(l)). 112l*4 Let o(v) = 7276v. Let j(c) = -677c2. Give j(o(h)). -35840499152h2 Let b be 0 + 5078 + 2/(4/10). Let h(z) = -z2 - 5083z + bz. Let o(u) = 96u2. What is h(o(a))? -9216a*4 Let t(o) be the third derivative of -397o5/30 + o2 - 441. Let a(h) = -h. Give a(t(g)). 794g2 Let q(j) = -2j*2 - 125. Let g = 87 + -85. Let d(z) = gz - 1063 + 531 + 532. Give q(d(r)). -8r2 - 125 Let c(l) = -1 - 56281l - 56280l + 112601l - 2. Let u(y) = -y. Give c(u(i)). -40i - 3 Let s(o) = 19o*2. Let u(x) = 78x + 9025. Calculate u(s(w)). 1482w2 + 9025 Let p(u) be the first derivative of -5u*3/3 - 805. Let s(y) = 74y*2. Give s(p(r)). 1850r*4 Let n(c) = -17c*2. Let t(w) be the first derivative of -25w*3 + 2 + 14 + 11w*3 + 12w*3. Give n(t(m)). -612m*4 Let v(b) = 0b + 3b + 17 - 4b. Let o(y) be the second derivative of -y*3/6 - 10y*2 + 2y + 172. Let r(l) = 5. Let h(k) = o(k) + 4r(k). What is v(h(c))? c + 17 Let b(m) = m + 34. Let x(d) = -2d*2 + 20d + 2. Let z be x(11). Let c(q) = -48q + 16. Let v be c(z). Let w(g) = v - 976 - 2g. Give w(b(y)). -2y - 68 Let t be (-1)/((6 + -12)/(-12)-1). Let r(h) = -142h2 + 101h*2 - 41h*t. Let y(c) = -6c*2. Calculate r(y(l)). -2952l*4 Let i(k) = -2k*2. Suppose 0 = -h + 6h + 195. Let u be 6/h + (-29388)/(-52). Let a(f) = uf2 - 1136f*2 + 582f*2. Give i(a(j)). -242j*4 Let r(c) = -5c. Let a(i) = 0i + 6i*2 - 4i*2 + 3i - 5i2 + 3. Let l(g) = g2 + g + 1. Suppose -4 = f - 1. Let x(p) = fl(p) + a(p). Give x(r(o)). -150o2 Let z(s) be the first derivative of s3 + 5709. Let n(a) = 2a*2 + 27a + 3. Determine n(z(g)). 18g4 + 81g*2 + 3 Let r(u) be the second derivative of 0u*4 - 1/15u*5 + 4u*2 + 0u*3 + 0 + 6u. Let k(l) be the first derivative of r(l). Let g(i) = -7i2. Give g(k(t)). -112t*4 Let u(p) = 67p - 8. Let x(b) = -345b + 42. Let h(l) = -21u(l) - 4x(l). Let j(q) = 85q. Determine h(j(v)). -2295v Let v(j) = -3j - 5j + 5j. Let r(y) = 96y + 94y - 358y + 76y + 107y. Calculate v(r(k)). -45k Let b(n) = -26159n2 + 2n. Let p(k) = 1559k - 1. Give p(b(u)). -40781881u*2 + 3118u - 1 Let r(n) = n. Let f(i) = i. Let u be (2 - -4)/(-2 + 0). Let j = -518 - -520. Let x(l) = jf(l) + ur(l). Let o(w) = -82w. Determine x(o(b)). 82b Let j(y) = 1129845y. Let d(c) = -38c*2. What is d(j(i))? -48508889512950i*2 Let r(l) = 8l2. Let v(t) = -t2 - 144294. Give v(r(q)). -64q4 - 144294 Let q(p) = -p2. Let v(i) be the second derivative of -2i*3/3 + 45i*2 + 33i + 9. Calculate v(q(a)). 4a2 + 90 Let v(z) = 82z + 6. Let l(b) = 43b + 4. Let s(y) = 3l(y) - 2v(y). Let t(j) = 60j*2. Calculate t(s(a)). 73500a*2 Let l(j) = 2j. Let c(s) = 8705281s2. Calculate c(l(d)). 34821124d*2 Let n(g) = 31 + 210g*2 - 31 + 140g2. Let y(u) be the second derivative of u3/6 + 41u. Give n(y(v)). 350v*2 Let j(t) = -7t. Let q(g) be the second derivative of 19g4/4 + g3/2 + 5602g. Calculate q(j(v)). 2793v2 - 21v Let d(v) = 2v2 - 12828v. Let y(n) = 7n. Give y(d(l)). 14l*2 - 89796l Suppose 9r = -r + 1250. Let h(u) = -ru + 295u - 93u. Let z(k) = -5k + 6. Let f(n) = n - 1. Let b(s) = 6f(s) + z(s). What is b(h(p))? 77p Let g(l) = 9l + 2. Let c(u) be the first derivative of u*5/30 + 6u*2 - 61. Let y(i) be the second derivative of c(i). Calculate y(g(k)). 162k*2 + 72k + 8 Let r(t) = t + 71. Let d(h) be the first derivative of -17h3/3 - 1860. Determine d(r(i)). -17i*2 - 2414i - 85697 Let a(b) = -b*2. Let z(v) = -205234v - 2. Calculate z(a(j)). 205234j2 - 2 Let l(n) = -n2 + 2849n. Let h(a) = -238a. What is h(l(p))? 238p*2 - 678062p Let a(h) = -85h2 - 16h - 13341. Let t(u) = -2u2. Determine a(t(p)). -340p*4 + 32p*2 - 13341 Let x(t) be the first derivative of -14t*3 + 15t*3 + 11 + 16 + 83. Let d(r) = -50r*2. Determine d(x(y)). -450y*4 Let l(f) = -2f. Let b(t) be the third derivative of 17t4/8 + t3 - 161t*2. Let v(p) = -53p - 7. Let z(d) = 7b(d) + 6v(d). Determine z(l(u)). -78u Let o(f) = -16f - 126. Let t(c) = -7c - 56. Let q(s) = 4o(s) - 9t(s). Let l(d) = 112d*2 - d. Give q(l(p)). -112p2 + p Let x(h) = -h3 + 9h2 + 13h - 15. Let w be x(10). Let p = 17 - w. Let s(c) = -30c2 - 26c*p + 49c*2. Let z(y) = -2y*2. What is s(z(u))? -28u*4 Let r(h) = -40h - 4. Let d(b) = -3b + 1. Let n(y) = 20d(y) + 5r(y). Let c(z) = 5z*2. Give c(n(v)). 338000v*2 Let u(n) = 8n*2 + 8n. Let r(g) = 112300g. What is r(u(c))? 898400c*2 + 898400c Let t(o) be the first derivative of o*4/4 + 2o*3/3 + 3o*2/2 + 5o + 19. Let q be t(9). Let j(z) = 10z + q - 923. Let b(a) = -5a*2. Give b(j(l)). -500l*2 Let g(y) = -28y*2. Let q(k) = -4k*2 - 1369 + 1366 + 28k - 28k. What is g(q(x))? -448x*4 - 672x*2 - 252 Let n(q) = -139q*2 + 2. Let c(r) = 3r*2 - 3r - 42. Let s(a) = -3a2 + 4a + 56. Let h(x) = -4c(x) - 3s(x). Determine h(n(o)). -57963o4 + 1668o*2 - 12 Let z(u) = -20u. Let v(r) = 389r2 - 20518. What is z(v(q))? -7780q2 + 410360 Let z(x) = x2 - 2x - 2. Let t(q) = -20q*2 + 36q + 36. Let y(u) = -2t(u) - 36z(u). Let r(k) = -25k + 137. Determine y(r(o)). 2500o*2 - 27400o + 75076 Let n(m) = m*2 - 6m*2 - 6m*2. Let w(o) = 12o - 4o - o + 0o - 3o - o. Calculate w(n(u)). -33u*2 Let j(v) = -9 - 10 - 3311v*2 + 24 - 5 + 3478v*2. Let a(g) = 0g + 0g + 2g*2. Calculate j(a(h)). 668h*4 Let q(m) = -27m + 4. Let n(s) = 7s - 1. Let y(f) = -4n(f) - q(f). Let r(j) = -1332j2. Calculate r(y(l)). -1332l*2 Let k(w) = w. Let y(z) be the first derivative of -922z3/3 + z2/2 + 1425. Determine k(y(n)). -922n2 + n Let c(q) = 20167q*2. Let d(n) = -48994n. What is c(d(f))? 48409109530012f2 Let s(m) = 40m*2. Let h(n) = -14n*2. Let u(o) = -17h(o) - 6s(o). Let t(k) = -9116k + 4523k + 4558k - 2k2. Calculate u(t(q)). -8q*4 - 280q*3 - 2450q*2 Let h(s) be the second derivative of -439s*3/3 - 2s - 2. Let a(f) = -3f2. Determine h(a(q)). 2634q*2 Let i(y) = -156y. Let u(n) = 1174n - 3527n + 1167n + 1170n. Determine i(u(a)). 2496a Let n(j) = -9j*2 + 2014. Let o(b) = 38b. Calculate o(n(v)). -342v2 + 76532 Let q(t) be the first derivative of -2t*3/3 - 8114. Let l(k) = -81k. Let v(r) = r. Let x(z) = -l(z) - 162v(z). Calculate x(q(m)). 162m2 Let f(y) = -y2 - 61922y. Let l(w) = -w + 18. Give l(f(s)). s2 + 61922s + 18 Let k(w) = 5w - 18. Let p(v) be the first derivative of -v + 137. Let u(f) = -k(f) + 6p(f). Let b(z) = 2z2. Calculate u(b(r)). -10r2 + 12 Let y(h) be the third derivative of h5/30 + h*4/4 - 286h*2. Let x(i) = -3i*2 + 0i2 + i2. What is y(x(k))? 8k4 - 12k*2 Let f(m) = m + 4. Let o(b) = -4b - 20. Let l(v) = -5f(v) - o(v). Let c(h) be the second derivative of 127h*3/2 - 2h + 45. What is c(l(r))? -381r Let b(g) = 123g + 3. Let s(t) = -218t - 5. Let i(y) = -5b(y) - 3s(y). Let q(o) = -5o*2 + 16. Determine i(q(h)). -195h*2 + 624 Let f(u) be the third derivative of -23u*4/24 - 802u*2. Let y(j) = -3j + 2. What is f(y(w))? 69w - 46 Let s(i) = 7i*2 + 11i. Let k(d) = -48d2. Let y(l) = -33l*2. Let v(n) = 7k(n) - 10y(n). What is s(v(z))? 252z*4 - 66z*2 Let o(r) = 16014r. Let g(b) = 5b2 + 27b + 1. Calculate g(o(f)). 1282240980f2 + 432378f + 1 Suppose 51x + 5 = 52x. Let i(r) = -xr + 5r - 30r. Let s(k) = -5k*2 + 0k*2 + 3k*2 + 3k*2. Give s(i(q)). 900q*2 Let s(b) be the third derivative of 5b*2 + 1 + 48 - 3b*2 + 78 + 0b*4 + 3b*4. Let j(d) = -5d*2. Give j(s(p)). -25920p*2 Let s(h) = -13h + 1. Let i(c) be the third derivative of -23c5/60 + 1873c*2. Give s(i(w)). 299w*2 + 1 Let j(x) = -21x*2 - 8x + 4. Let f(l) = 2l + 342. Give f(j(t)). -42t*2 - 16t + 350 L	{ "pile_set_name": "DM Mathematics" }
Let m(t) = -t*3 - 6t*2 - t - 1. Suppose -11 = 3f + 25. Let k be (9/4)/(f/32). What are the prime factors of m(k)? 5 Suppose 0 = -3q + 5 + 1. Suppose -5m + qm + 6 = 0. What are the prime factors of m? 2 Let y(p) = 6p*2 + 5p + 3. List the prime factors of y(-2). 17 Suppose 4w = 28 + 116. What are the prime factors of w? 2, 3 Let s = 7 + 29. What are the prime factors of 2/(-8) + 1845/s? 3, 17 Suppose 2q = 5q. Let n = 4 + q. What are the prime factors of n? 2 Let k be (-4)/8 - 11/2. Let b(h) = -h2 - 9h + 12. List the prime factors of b(k). 2, 3, 5 Suppose 0 = -2w + 83 + 7. What are the prime factors of w? 3, 5 Let h(i) = 5i - 6. List the prime factors of h(4). 2, 7 Suppose 0 = -3h + 16 + 11. What are the prime factors of h? 3 Let s = 4 - 14. Let t = -6 - s. List the prime factors of t. 2 Let d(m) = -m3 - 2m*2 - 4m + 1. Let s be d(-4). Let a be -1(-3 - 1 - 0). Suppose -3i - 3x + 18 = -0x, x + s = ai. List the prime factors of i. 11 Let n = 14 - 21. Let w(l) = 7l*2 + 12l - 4. Let g(v) = 3v2 + 6v - 2. Let y(s) = 5g(s) - 2w(s). List the prime factors of y(n). 5 Let i(q) = 2q + 1. Let p be i(6). Let h = p - -20. Suppose z - h = -2z. What are the prime factors of z? 11 Let n(m) = -m + 10. Let y be n(5). Suppose -b = -y - 23. List the prime factors of b. 2, 7 Let b(v) = -5v2 + v2 - 18v + v*3 + 19v + 4. List the prime factors of b(5). 2, 17 Let h be (-2452)/(-34) - 36/306. Suppose -15j - h = -17j. What are the prime factors of j? 2, 3 Let g(s) = -3s - s2 + 4s + 6s2. Let v(x) = -x3 - 6x*2 + 6x - 6. Let c be v(-7). What are the prime factors of g(c)? 2, 3 Let q = 465 + -128. List the prime factors of q. 337 Suppose 634 = 5d + 114. What are the prime factors of d? 2, 13 Suppose -55 = d - x - 3x, -215 = 5d - 5x. Let y = d + 58. Suppose 2a - y = 1. What are the prime factors of a? 2, 5 Let p = 7 - 6. Suppose 23 = 2l - p. List the prime factors of l. 2, 3 Let o(u) = -u*3 - 9u*2 - 2u + 2. List the prime factors of o(-9). 2, 5 Suppose -2b + 40 = 4m, 2m - 86 = -3b - b. List the prime factors of b. 2, 11 Let t(c) = c*2 + c - 1. Suppose -3r = -6r + 12. List the prime factors of t(r). 19 Let c be (7 - 1) + (-3 - -1). What are the prime factors of 2/(-1)(-6)/c? 3 Let a be (-704)/6 + 7/21. Let o = -83 - a. List the prime factors of o. 2, 17 Suppose 0 = -b + 4b - 159. What are the prime factors of b? 53 Suppose -2c = -5j - 16, -5j = 2c + c + 26. Let x(y) = -6y*2 + y - 2. Let v be x(2). List the prime factors of (v/(-20))/(c/(-10)). 2, 3 Let n(o) = o + 1. What are the prime factors of n(15)? 2 Suppose 10h = 5h + 25. Suppose 3p - 3 = 4x - 2, -x + h = 0. List the prime factors of p. 7 Suppose 18g = 13g + 255. What are the prime factors of g? 3, 17 Suppose 0 = -3j - 5m + 900, -j - 3m - 13 + 317 = 0. List the prime factors of j. 5, 59 Suppose -5c = 4h - 1178 - 59, -2c = -3h + 899. List the prime factors of h. 3, 101 Suppose -8j + 310 = -826. List the prime factors of j. 2, 71 Let j(t) = 3t*2 - 3t. Let q be j(2). Suppose -b + 10 = 3x, 5x + q = 7b - 3b. What are the prime factors of b? 2 Suppose 0 = -4m + 9m + 2h - 364, 3m + 2h - 220 = 0. Suppose c + c = m. What are the prime factors of c? 2, 3 List the prime factors of (148/6)/((-36)/(-54)). 37 Suppose 4y = 2z + 3z + 3, 0 = -4z - 12. What are the prime factors of (0 + y)(-6 + 3)? 3 Suppose 0c = 5c - 70. What are the prime factors of (-3 - 10/(-2)) + c? 2 Let x = -4 + 7. Suppose 5s = -5, t + 2t - xs = 63. List the prime factors of t. 2, 5 Suppose -x = -4i - 39, -5x = i + i - 107. What are the prime factors of x? 23 Let v be -31 - (1 + -6). Suppose -3q - 4t = -15, 5q + 0t = -vt + 39. List the prime factors of q. 3 Suppose -w + g = -2g - 20, -3w = 2g - 16. Suppose 0 = -0j - 2j + w. Suppose 3 = -2q + q, 3h - 42 = -jq. What are the prime factors of h? 2, 3 Let x = 19 - 3. List the prime factors of x. 2 Suppose 0y + y + 1 = 0. Let g be y/(2 - 62/30). What are the prime factors of -5(18/g)/(-3)? 2 Let n(q) = -q2 - 15q + 4. List the prime factors of n(-5). 2, 3 Let x(y) = -y*3 - 6y - 2. Let j be x(-6). List the prime factors of 3/4 - j/(-8). 2 Let n be (9/3)/33. What are the prime factors of (n/2)/(4/8)? 3 Suppose 0 = 3k + k - i - 45, 4k = 3i + 47. What are the prime factors of k? 11 Let r = 13 + -9. Suppose 2d - d = -c, -d = -c - r. List the prime factors of d. 2 Let k be (-16)/88 + 1324/22. Let u = k - 37. List the prime factors of u. 23 Let m(s) = 2s*2 + 2s - 2. Let n be -2(-1)/1-1. Let c = n - 0. List the prime factors of m(c). 2 Suppose 0 = -3r - i + 140, -3i = -0i - 15. Suppose m - 4m + r = 0. List the prime factors of m. 3, 5 Let r(k) = -6k3 - k2 - 2k. Let x be r(-2). Suppose 3a = -a + x. What are the prime factors of a? 2, 3 Let g(k) = 18k*2 + 3k + 3. Let u be g(-2). Suppose 2a + 4t - 115 = -3a, u = 3a - 2t. What are the prime factors of a? 23 Suppose 5t = -4o + 1043, 0 = 2o + 3o - 10. List the prime factors of t. 3, 23 List the prime factors of 15/((-1)/((-12)/9)). 2, 5 Let r(x) = 2x*2 + 7x - 3. Let f be r(-6). Let o = -19 + f. Suppose c + 0c - 5t = 10, -c + o = -3t. What are the prime factors of c? 5 Let q be -5(-2 + 1)1. Suppose -n - 4a = -22, -qn = 2a + 1 - 39. List the prime factors of n. 2, 3 List the prime factors of (-2 + 4/8)-2. 3 Let u = -9 - -4. Let n = u - -8. Suppose -c = -3c + ni + 3, 2 = 2i. What are the prime factors of c? 3 Let n(b) = 47b2 - 6b + 1. What are the prime factors of n(-2)? 3, 67 Let k = -51 + 88. What are the prime factors of k? 37 Let u = 10 + -5. Suppose 0 + 5 = ud. Let v = 12 + d. What are the prime factors of v? 13 Suppose 11b - 258 = 10b. What are the prime factors of b? 2, 3, 43 List the prime factors of 3/9486/2. 3 Let k(v) = 5v2 - 13v + 6. Let z(c) = -4c2 + 12c - 6. Let y(n) = -5k(n) - 6z(n). Suppose o + d - 6d = 9, 3 = o - 3d. List the prime factors of y(o). 2, 3 What are the prime factors of 3 - (-36 + 4/1)? 5, 7 Suppose -3u + 25 = -8. Let q = u - 15. List the prime factors of (-144)/(-14) + q/14. 2, 5 Suppose 3a = 2u + u - 6, 2a = -2u + 4. List the prime factors of 24/u(-2)/(-3). 2 Let l be (-2362)/(-18) - 10/45. Suppose -2a + 235 = 5v + 3a, a - l = -3v. Suppose 22 = 4c - v. What are the prime factors of c? 2 What are the prime factors of (-2 - -20)24/9? 2, 3 Let a(w) = 3w2 - 6w + 5. What are the prime factors of a(-5)? 2, 5, 11 Let o(z) = -z*3 + 6z*2 - z + 5. Let i = -7 - -12. What are the prime factors of o(i)? 5 Suppose 0 = -4g - g + 25. Suppose 5o - 137 = -b, b + g = 2. List the prime factors of o. 2, 7 Suppose 3f = 98 - 38. What are the prime factors of f? 2, 5 Let k be 2/(-1)(-18)/4. Suppose -3 - k = -2b. List the prime factors of (1 + (-4)/b)27. 3 List the prime factors of 49569/155 - (-2)/10. 2, 5 Suppose 5g - 5w - 170 = 0, 3g - 54 - 40 = w. List the prime factors of g. 2, 3, 5 What are the prime factors of (-435)/(-9) + (-1)/3? 2, 3 Suppose i + 808 = 5i. What are the prime factors of i? 2, 101 Let t(y) = -7y - 1. Let p(d) = 3d. Let m(l) = -5p(l) - 2t(l). Let s = -2 - -2. What are the prime factors of m(s)? 2 Let v(s) be the first derivative of -s7/840 - s6/360 - s5/60 - s3 + 2. Let u(a) be the third derivative of v(a). List the prime factors of u(-2). 2 Let f(i) be the third derivative of i4/24 + 5i3/3 + i2. Let w = -19 + 19. What are the prime factors of f(w)? 2, 5 Let w = 79 + -61. What are the prime factors of w? 2, 3 Let d(j) = 11j2 - 14j - 12. List the prime factors of d(5). 193 Let p(h) = h*3 + 5h*2 - 2h - 6. Let u = 7 + -12. Let i be p(u). Suppose -ic + 41 = 5q, 2c - 22 = -2q - c. What are the prime factors of q? 5 Let n(j) be the first derivative of -3j2/2 - j - 4. Suppose 3l = -5h - l - 13, h = 5l + 9. List the prime factors of n(h). 2 Suppose -10 - 20 = -5k. What are the prime factors of k? 2, 3 Let l(f) = 16f*2 - 3f - 3. Let x be l(-3). Suppose -2c = 4p - x, 0c = 4p + 5c - 141. What are the prime factors of p? 3, 13 Suppose 2g + 28 = 6g. Suppose 0 = -v + 2m + g, -m + 21 = 5v + 3m. List the prime factors of v. 5 Suppose -2z - 7 = 11. Let c(p) = -p3 - 8p*2 + 8p - 10.	{ "pile_set_name": "DM Mathematics" }
11s - 8s - o = 5z. Which is the smallest value? (a) 36 (b) 0.2 (c) z c Let f = 394 - 5908/15. Let a = -502 - -462.3. Let q = a - -34.7. What is the second biggest value in q, -2/7, f? -2/7 Let n = -619423 + 619427. Let m = -0.3 + -0.2. Let j = 2759/11 - 251. Which is the biggest value? (a) m (b) j (c) n c Let p = 216.04 + -0.04. Let m = -216.3 + p. Let z = -0.13 + -11.87. Which is the second biggest value? (a) -2/5 (b) m (c) z a Let u(y) be the third derivative of 0 - 12y*2 + 1/24y*4 + 0y + 7/6y3. Let i be u(-11). Which is the biggest value? (a) -3 (b) -0.1 (c) i b Let f be 14/(-21)((-1068)/516 - -2). Which is the third smallest value? (a) 3 (b) 0.5 (c) f a Let g = -712 - -714. Let l = -217 - -217.01. Which is the third biggest value? (a) 5 (b) l (c) g (d) -3 b Let d = -6405.5 - -6406. Which is the third biggest value? (a) 81 (b) -2 (c) d b Let a = -560 - -13998/25. Let g = -53/14 - -23/7. Let z = -813 + 808. What is the third smallest value in z, g, a, 0.3? a Let g = -616 - -1056. Let p = 416 - g. Which is the second smallest value? (a) -1 (b) 1/5 (c) p a Let y be (0 - 2/14) + (-3348)/(-2170). What is the third smallest value in 1, 41, y? 41 Let z = 0.05 + -0.35. Let j = -238 - -238.3. Let b = 574 + -574. What is the third smallest value in j, z, 3/2, b? j Let a = -11982 + 11566. What is the third smallest value in 0.2, 0.5, -3/7, a? 0.2 Let m = -382 - -362. Let f(r) = r*3 + 22r*2 + 41r + 22. Let j be f(m). Let o = -2 - -3.3. What is the biggest value in o, 1/4, j? j Let o = -102544/21 + 34186/7. Let i be 176/(-63) - (-2)/9. Which is the third biggest value? (a) i (b) o (c) 2 a Let a = -11 + 10.85. Let d = 0.85 - a. Let u = 5.1099 - 0.1099. What is the biggest value in d, u, -1/8, -11? u Let n = 1/16 - 19/48. Let x = -21.46 - -18.9. Let k = x - -2.56. What is the fourth biggest value in n, k, -1/15, -0.4? -0.4 Let x = 2 + -5. Let m be 6 + -3 + 183/(-6). Let h be 2/3 - (-3 + (-22)/m). Which is the smallest value? (a) x (b) 2 (c) h a Let l = -145.25 - -1.25. Let c = 149 + l. What is the smallest value in -1/4, c, -2/29? -1/4 Let n = 2.4 - 2.7. Let i = -171 - -168. What is the fourth smallest value in -1, i, n, -0.6? n Let h = 8 - 8.3. Let q = -78206 + 78217. What is the smallest value in h, q, -2/9? h Suppose -49 = -4d - 37, 2t = -4d - 14. What is the second biggest value in t, -12, 15? -12 Let j = -48538 + 7038124/145. Let n = 12/29 + j. Suppose 4p = 9p - 10. What is the fourth smallest value in p, n, 2/15, -3/7? p Let r = -23 - -25. Let i = 25 - 22.9. Let p = -1.6 + i. Which is the smallest value? (a) 0 (b) p (c) r a Let z = 222 + -221.11. Let t = -0.69 + z. Let a = 1.5 - 12.5. What is the smallest value in t, -2/21, a? a Let o = -0.5 + 1.6. Let a = -10310 - -10310.2. What is the third smallest value in 0.1, a, o? o Suppose -10 = 4n - 5i + 4, -2n - 18 = 3i. Let q = 80575 + -80579. Which is the biggest value? (a) -0.3 (b) n (c) q a Let x = -36.05091 + -0.01309. Let r = x + 0.764. Let y = r - -35. What is the second smallest value in -0.2, y, 1? -0.2 Let n = 1048.5 - 1048. Which is the biggest value? (a) n (b) -2 (c) 0.4 (d) 0.338 a Let r = 553 - 957. Let v = 402 + r. What is the second biggest value in 11, 1/7, v? 1/7 Let u be 5 - ((-414)/(-45) - 4). Which is the third smallest value? (a) u (b) -0.03 (c) -7 (d) -0.06 d Let l = 15.95 + -16. Let t = l + -0.15. Which is the fourth biggest value? (a) t (b) 0.5 (c) 0.4 (d) 1/7 a Let y = 15575 - 15583. Which is the third biggest value? (a) -66 (b) 2 (c) y (d) -3 c Let g = -439.4 + 439. What is the third biggest value in -5, g, 5, 9, -2/11? -2/11 Let g = 1631.4 + -1631. Which is the fourth biggest value? (a) -0.5 (b) g (c) -0.04 (d) 5 a Let j = 5 + -5. Suppose -3w - 6w - 279 = j. Which is the third smallest value? (a) w (b) 0 (c) 1 c Suppose 0 = -4k - 5x + 1, k - 2x = -8 + 18. What is the fourth biggest value in 66, -2/3, k, 0.1? -2/3 Let m = -1450 + 1449.9. Let i = -15 - -14.89. Let v = -0.199 - -3.199. What is the fourth smallest value in -1, i, m, v? v Suppose 5n = -f - 15, -f - 5n = -6f - 15. Let s = -0.1 - 0.2. Which is the third smallest value? (a) f (b) s (c) 8 c Let y = -0.3229 - -0.2429. Which is the second smallest value? (a) -2/177 (b) y (c) 0.5 (d) 2 a Let g = -18 + 35. Let m = 5/692 - 1439/7612. What is the third biggest value in m, g, 0.4? m Let y = -60041/2 - -30021. What is the third smallest value in 102, 3/7, -2/5, y, -1/4? 3/7 Let k = -263 + 262.7. Which is the third smallest value? (a) -1 (b) 1 (c) k (d) 3/7 d Let m be -6 + (-140)/(-21) + (4 - (-292)/(-60)). What is the smallest value in 0.409, m, 0.06? m Let a be 3/(-2) + 2/4. Let t = 122 + -122. Suppose t = -186z + 191z. What is the second biggest value in z, 0.2, a? z Suppose 210 = 8c - 23c. Let i be -1(5 + -3)/(-1). Let p be (i + 7/(-5))/(21/c). What is the third biggest value in p, 2, 3? p Let n be 1(-7)/9(-38)/(-133). Let y be 12/(-28) + 66/56. Which is the second smallest value? (a) y (b) n (c) 5 a Let h = 42 - 20. Suppose -h + 28 = 3t. What is the second smallest value in -9, 2/9, t, -3/4? -3/4 Suppose -10r = -276 - 195 + 131. What is the third biggest value in r, 0.3, 1/5, 0.5, 1? 0.5 Let c be 21/(-15) + (0 - -1). Suppose -8v - 99 = 3v. Let l be (v + 7)/(1 + (-3 - 0)). What is the second smallest value in l, 0.5, c? 0.5 Let z = -7005 - -6634.3. Let r = -371 - z. What is the third smallest value in 0.1, 0, r, -0.5? 0 Let i = 0.58 + -0.26. Let q = 2.08 + i. Let t = 2.2 - q. What is the smallest value in -8, 3/4, t? -8 Let s = -73 + 72.965. Let g = 13.3 - 18.265. Let c = s + g. What is the second smallest value in -3/4, 4, 2/7, c? -3/4 Let v = -175 - -118. Let x be (2/4)/(-3 + v/(-18)). What is the fourth smallest value in -0.3, -2/7, x, 13/5? x Let v = 6883/6 - 3440/3. Which is the second smallest value? (a) -2 (b) 2/5 (c) 2.64 (d) v (e) 1 b Suppose -12w - 4010 + 4034 = 0. What is the fourth smallest value in 65, 5, w, 4/7, 0.1? 5 Let g = 189/122 + -3/61. Let y be (-4)/21 + (-6)/9. Let v = -280 - -275. Which is the third biggest value? (a) g (b) v (c) y b Let d = -2599 + 2674. Which is the second biggest value? (a) 0 (b) 4 (c) d b Let o = 0.09254 + -45.09254. Which is the third smallest value? (a) 0 (b) o (c) -10 a Let s be (-21)/4 + 2 - (2553/(-92))/(-37). Let d = -116 - -117. Let u be ((-2)/(-6))/(2/(-3)). What is the biggest value in u, d, s, 5? 5 Let o = -95.3 - -89. Let f = -12.013 + 9.013. Which is the second smallest value? (a) o (b) f (c) -5 c Let q = 57 - 13. Let h = -6 + q. Let u = 24 - h. What is the biggest value in u, 0.1, -0.4? 0.1 Let f = -286 - -70. Let u = -212 - f. Let c = 2/65 + 124/195. What is the smallest value in c, u, -18, 4/5? -18 Let v be ((-1528 - -13) + 9)3. What is the fourth biggest value in 2/5, 3/2, v, -0.3, -1? -1 Let t = -3 + 6. Let h = 0.137 - 0.112. Let p = -0.275 - h. Which is the biggest value? (a) p (b) 5 (c) 0.6 (d) t b Let m = 11 + -6. Let s = -0.3014708 + -0.0985292. Let c(n) = n + 4. Let p be c(0). What is the smallest value in s, m, p? s Let t = 2.269 - -2.731. Let g be 1/3(-6)/(-6). Which is the fourth biggest value? (a) t (b) -1.6 (c) -0.2 (d) g b Let o = 4.2885 - -0.0415. Let x = -4.4 + o. What is the second biggest value in 2, 4, x? 2 Let j = 49 + -45.59. Let v = j + -3.51. Which is the biggest value? (a) v (b) -2/11 (c) -2/7 a Let g = 1.453 - 0.862. Let k = g + -0.191. What is the second smallest value in 5, 0.1, 0.2, k? 0.2 Let i = 65813 + -65815. Let n = 0.4 + -0.7. What is the second biggest value in -5, n, -3/4, i? -3/4 Let y = -163.31 - -163.508. Which is the second biggest value? (a) 2/5 (b) -4 (c) y (d) 1 (e) -0.5 a Let p = -105.8619 - -105.7. What is the second smallest value in 4, -0.5, p? p Let p = -288 - -281. Let s be ((p - 1) + 6)/(-4) - -1. Which is the third smallest value? (a) -2/3 (b) s (c) -0.85 b Let m = 0.105 - -0.255. Let w = 0.56 - m. Which is the smallest value? (a) 1/8 (b) -2 (c) 0.15 (d) w b Let h be 1/((-2)/(-10)) + (-2660)/950. What is the third biggest value in 1/3, 5, h? 1/3 Suppose 34*t + 10557 = 10727. Which is the third biggest value? (a) 0.4 (b) -10 (c) 2 (d) -4 (e) t a Let	{ "pile_set_name": "DM Mathematics" }
om mppppmpppppppmp. Give prob of picking 3 p. 44/91 Four letters picked without replacement from {i: 2, r: 1, b: 1, p: 1, f: 2, v: 1}. Give prob of picking 2 i, 1 v, and 1 f. 1/35 What is prob of picking 1 q and 1 h when two letters picked without replacement from {q: 1, h: 1, v: 7, k: 2, w: 4}? 1/105 Calculate prob of picking 1 b and 3 g when four letters picked without replacement from {b: 1, g: 12}. 4/13 Calculate prob of picking 2 g when two letters picked without replacement from {g: 4, b: 1, q: 2, e: 2, z: 5}. 6/91 Two letters picked without replacement from {k: 1, i: 1, p: 3, n: 4, r: 2}. What is prob of picking 1 i and 1 p? 3/55 Four letters picked without replacement from {u: 2, f: 17}. Give prob of picking 4 f. 35/57 Three letters picked without replacement from {r: 5, o: 5, t: 7, q: 2}. What is prob of picking 1 q and 2 o? 20/969 Calculate prob of picking 1 r, 1 x, and 1 m when three letters picked without replacement from {g: 5, a: 3, e: 1, r: 2, x: 2, m: 6}. 8/323 Calculate prob of picking 2 l and 1 a when three letters picked without replacement from {i: 1, d: 3, f: 3, a: 2, l: 2, h: 3}. 1/182 Calculate prob of picking 2 o when two letters picked without replacement from ogggog. 1/15 Three letters picked without replacement from {a: 5, e: 3, q: 1, c: 5, t: 6}. What is prob of picking 1 t and 2 e? 3/190 Calculate prob of picking 4 z when four letters picked without replacement from {k: 3, z: 4, d: 2}. 1/126 What is prob of picking 1 j and 1 e when two letters picked without replacement from bbjjweqbjjbqjqjj? 7/120 Three letters picked without replacement from alllekc. Give prob of picking 1 k and 2 e. 0 Two letters picked without replacement from {o: 5, t: 4, v: 3}. What is prob of picking 2 t? 1/11 What is prob of picking 2 v and 1 o when three letters picked without replacement from oviivr? 1/20 What is prob of picking 1 t, 1 x, and 1 c when three letters picked without replacement from tcatxtccaucu? 3/55 Calculate prob of picking 2 s and 1 r when three letters picked without replacement from shshrhssshhshss. 4/65 What is prob of picking 3 e when three letters picked without replacement from {r: 1, e: 11}? 3/4 Three letters picked without replacement from {s: 5, g: 3, w: 7, t: 4}. What is prob of picking 1 s and 2 g? 5/323 Four letters picked without replacement from zotzzzztztttztz. What is prob of picking 1 t and 3 z? 16/65 Four letters picked without replacement from uxcmcuuczpuxxu. Give prob of picking 1 z and 3 x. 1/1001 What is prob of picking 1 i and 1 r when two letters picked without replacement from riirrri? 4/7 Calculate prob of picking 1 p and 1 a when two letters picked without replacement from aldlaaldapldll. 4/91 Four letters picked without replacement from fsasfafafasfafsfsf. What is prob of picking 1 f and 3 a? 4/153 Two letters picked without replacement from zzzzz. What is prob of picking 2 z? 1 Calculate prob of picking 1 s, 1 k, and 2 l when four letters picked without replacement from {l: 2, t: 1, r: 1, s: 1, k: 2}. 2/35 Three letters picked without replacement from qmmmqmqqmqmmumqmm. What is prob of picking 1 q and 2 m? 27/68 Calculate prob of picking 2 t when two letters picked without replacement from dudddrkdddtddtuddtd. 1/57 Two letters picked without replacement from dlreeefdrrol. Give prob of picking 1 r and 1 o. 1/22 What is prob of picking 2 t and 1 a when three letters picked without replacement from {e: 1, a: 1, t: 2, z: 1, l: 2}? 1/35 Three letters picked without replacement from xxrvkrxxcxr. Give prob of picking 3 r. 1/165 Two letters picked without replacement from vvvvvvbcvyccvvbv. Give prob of picking 1 b and 1 y. 1/60 Calculate prob of picking 1 n, 2 f, and 1 y when four letters picked without replacement from {k: 1, n: 2, f: 3, o: 3, y: 1}. 1/35 Three letters picked without replacement from {w: 5, b: 3, c: 8, j: 1, t: 3}. Give prob of picking 1 t, 1 c, and 1 j. 2/95 Four letters picked without replacement from {c: 7, s: 1, b: 6}. Give prob of picking 1 b and 3 c. 30/143 Two letters picked without replacement from xknakdkkdk. What is prob of picking 2 k? 2/9 What is prob of picking 2 c when two letters picked without replacement from {i: 2, q: 1, t: 1, e: 7, c: 3}? 3/91 Four letters picked without replacement from sslqqsqsqqqllsqlbql. Give prob of picking 3 s and 1 b. 5/1938 What is prob of picking 1 a, 1 j, and 1 w when three letters picked without replacement from jlwoalw? 2/35 What is prob of picking 3 y and 1 a when four letters picked without replacement from bybabyybyb? 2/105 Calculate prob of picking 4 n when four letters picked without replacement from {n: 7, k: 6}. 7/143 What is prob of picking 1 s and 1 f when two letters picked without replacement from sfcffccc? 3/28 Three letters picked without replacement from tmhttzhzzthtzthttzh. What is prob of picking 1 m and 2 z? 10/969 Calculate prob of picking 3 h when three letters picked without replacement from lhlhhhh. 2/7 Four letters picked without replacement from dpdppvvwp. What is prob of picking 3 p and 1 d? 4/63 What is prob of picking 1 d, 1 f, and 1 p when three letters picked without replacement from {f: 5, w: 1, z: 7, d: 1, p: 1, i: 5}? 1/228 What is prob of picking 1 i, 1 v, and 2 x when four letters picked without replacement from {v: 3, x: 3, i: 1}? 9/35 What is prob of picking 1 r and 1 p when two letters picked without replacement from {p: 3, u: 1, t: 2, r: 1, j: 3}? 1/15 What is prob of picking 2 a and 1 u when three letters picked without replacement from oohpooupphoaooooooao? 1/1140 Three letters picked without replacement from {x: 2, q: 1, i: 5, j: 1, p: 2, c: 2}. Give prob of picking 1 q and 2 x. 1/286 Calculate prob of picking 1 w and 2 c when three letters picked without replacement from {c: 9, j: 4, w: 4}. 18/85 Two letters picked without replacement from bbnnatncna. Give prob of picking 1 c and 1 b. 2/45 Calculate prob of picking 1 c and 1 t when two letters picked without replacement from {b: 5, w: 7, t: 1, p: 1, c: 2}. 1/60 Three letters picked without replacement from atatataataaataaaaa. What is prob of picking 2 t and 1 a? 65/408 Three letters picked without replacement from uoweowjowwouwou. What is prob of picking 1 w, 1 u, and 1 o? 15/91 What is prob of picking 1 d, 1 f, 1 r, and 1 n when four letters picked without replacement from dfnhfdffrnd? 4/55 Two letters picked without replacement from ddekbjdudjjdukbddk. Give prob of picking 2 u. 1/153 Two letters picked without replacement from {k: 1, v: 1, a: 2, q: 1}. What is prob of picking 2 a? 1/10 What is prob of picking 1 v and 1 g when two letters picked without replacement from {v: 1, k: 1, t: 5, u: 1, g: 4}? 2/33 Two letters picked without replacement from vnvnvvnnvv. What is prob of picking 2 n? 2/15 What is prob of picking 2 b when two letters picked without replacement from {b: 2, i: 1, d: 4, z: 1, j: 2}? 1/45 Three letters picked without replacement from ffsffsfsfs. What is prob of picking 3 s? 1/30 Calculate prob of picking 2 f and 1 r when three letters picked without replacement from fgffrgfrf. 5/21 What is prob of picking 2 n when two letters picked without replacement from uyjdnnybj? 1/36 Four letters picked without replacement from {s: 1, d: 4, l: 3, x: 3}. Give prob of picking 1 d, 1 l, and 2 x. 6/55 What is prob of picking 1 l, 1 z, and 2 j when four letters picked without replacement from jfjjjjfffjjfjlfzfj? 1/85 Calculate prob of picking 2 m and 1 i when three letters picked without replacement from {m: 8, i: 5}. 70/143 What is prob of picking 2 p, 1 q, and 1 z when four letters picked without replacement from vqvzgpzlpvqq? 2/165 Four letters picked without replacement from mykufylffklkyymmm. Give prob of picking 1 f, 2 l, and 1 k. 9/2380 Two letters picked without replacement from {z: 5, p: 4, f: 2}. What is prob of picking 1 f and 1 z? 2/11 Two letters picked without replacement from {s: 3, b: 17}. What is prob of picking 2 b? 68/95 What is prob of picking 4 l when four letters picked without replacement from adkljkalkkkdlkl? 1/1365 What is prob of picking 1 a and 3 f when four letters picked without replacement from {f: 4, x: 2, a: 2, l: 1}? 4/63 Calculate prob of picking 1 k, 1 d, and 1 z when three letters picked without replac	{ "pile_set_name": "DM Mathematics" }
ded by 5? 4 Let x(v) = -3v + 3. Let f be x(2). Calculate the remainder when 6 is divided by f/(-9) + (-22)/(-6). 2 Let x = -69 - -153. Suppose -x = -w - w. Calculate the remainder when w is divided by 11. 9 Calculate the remainder when 13 is divided by (-3)/4 + (-190)/(-40). 1 Let y = 235 - 218. Let j(z) = -3z*2 - 8z + 2. Let q(r) = 16r2 + 41r - 9. Let f(a) = 11j(a) + 2q(a). What is the remainder when y is divided by f(-5)? 8 Let o = -10 - -6. Let t = 50 - 27. Calculate the remainder when t is divided by ((-2)/o)/(3/72). 11 Let i = 8 + 0. Let q(s) = -4s - 1 - 5 + 3. Calculate the remainder when i is divided by q(-2). 3 Let a = -28 + 69. What is the remainder when a is divided by 11? 8 Suppose 10a - 109 = 71. Calculate the remainder when 35 is divided by a. 17 Suppose -x - 4f + 27 = 0, -99 = -4x + f - 8. What is the remainder when x is divided by 8? 7 Suppose 25 = -4h - 71. What is the remainder when 14 is divided by -4-2(-15)/h? 4 Let v = -12 - -49. Calculate the remainder when v is divided by 20. 17 Suppose s = -q + 3q + 17, 0 = -5s - q + 30. What is the remainder when s is divided by 5? 2 Suppose -4o = -2o - 52. Suppose 3t + 2t = 0. Suppose -4k + k + 27 = t. What is the remainder when o is divided by k? 8 Let w(u) = u*2 - 4u - 3. Let c be w(5). Let r(a) = -3a + 1 - 23a*3 + 8a*2 - 2a*2 + 22a*3. Calculate the remainder when r(c) is divided by 4. 3 Suppose 7k - 136 = 74. Calculate the remainder when 57 is divided by k. 27 Let r(u) = 3u + 0u - 5u - 5 - 3. Calculate the remainder when r(-6) is divided by 2. 0 Let y(v) = -10v + 3. Let g = -17 - -14. What is the remainder when y(g) is divided by 9? 6 Let j = -40 - -50. What is the remainder when j is divided by 3? 1 Suppose 3j - b + 2b + 9 = 0, -b = 4j + 12. Let l = 6 - j. Calculate the remainder when 15 is divided by l. 6 Let g = -85 - -90. Let n(c) = -c - 3. Calculate the remainder when g is divided by n(-6). 2 Let z(j) = 315j3 + j2 - j. Let v be z(1). Suppose -400 = -5y + v. Suppose -y = -3t - 53. Calculate the remainder when t is divided by 8. 6 Let r(v) = -13v - 21. What is the remainder when r(-8) is divided by 21? 20 Let n = 132 - 103. What is the remainder when 108 is divided by n? 21 Calculate the remainder when 21 is divided by ((-18)/(-8))/((-42)/(-112)). 3 Calculate the remainder when 112 is divided by ((-3)/2)/((18/40)/(-9)). 22 Let u(k) = 2k*2 - 6k - 3. Let z = 1 - 5. Let i(a) = 8a + 2. Calculate the remainder when u(z) is divided by i(2). 17 Let t(m) = m3 + m2. Let a be t(-1). Suppose a = -7i + 4i + 18. Let h = 36 - 20. Calculate the remainder when h is divided by i. 4 Calculate the remainder when 6 is divided by (-2 - 0)-2(-3)/(-4). 0 Let i be (70/21)/((-2)/3). Let v = i + 9. Calculate the remainder when 6 is divided by v. 2 Let h(g) = -g3 - g2 + 3g + 2. Let k be h(-2). Suppose f + 3f - 44 = k. Calculate the remainder when 21 is divided by f. 10 Let o(z) = 3z*3 + 8z + 1 + z*3 - 8z*2 - 5z3. Let r(x) = x3 + 2x2 - x - 3. Let h be r(-3). What is the remainder when 28 is divided by o(h)? 8 Let y = -10 + 20. Calculate the remainder when y is divided by 4. 2 Let z(u) = -7u + 4. Let k be (-4)/(-6) - (-87)/(-9). What is the remainder when z(k) is divided by 17? 16 Suppose -5d - 2v + 37 = -3, -2d = 4v - 16. What is the remainder when 26 is divided by d? 2 Let f(n) = -n*3 - 5n*2 + 10n - 2. Let y be f(-7). Suppose 0 = g - 2v + 6v - 11, 5v + 9 = 2g. What is the remainder when y/2 + 2/(-2) is divided by g? 5 Let u = -20 - -48. Let h = u - 40. Let w = 10 - h. Calculate the remainder when w is divided by 8. 6 Suppose 0 = -2u - u + 39. Suppose 6m - 110 = m. Calculate the remainder when m is divided by u. 9 Calculate the remainder when ((-2)/4)/((-4)/56) is divided by 5. 2 Let p(b) = 3b - 14. Calculate the remainder when p(6) is divided by 3. 1 Suppose 3n - 12 - 3 = 0. Calculate the remainder when 12 is divided by n. 2 Let j(a) = a*3 - 11a*2 + 7a + 10. What is the remainder when j(11) is divided by 22? 21 Let f(a) be the first derivative of 3a2/2 + 11a - 2. What is the remainder when f(9) is divided by 14? 10 Let c(w) = 62w2 - w + 1. What is the remainder when c(1) is divided by 13? 10 Let c = 10 + -17. Let o = c - -13. Calculate the remainder when 22 is divided by o. 4 What is the remainder when 39 is divided by 15/10(32/6 + 2)? 6 Suppose v + x + 7 = -3v, 4v = 5x + 11. Let s = v - -8. Calculate the remainder when s is divided by 5. 2 Let o = -2 + 7. Suppose 5a - 3n - 130 = 0, 4n + o + 47 = 2a. Let f = -22 + 73. What is the remainder when f is divided by a? 25 Let w(o) = -o3 - 4o*2 - 2. Let x be w(-4). Let q be 6/2 - (x + 2). Suppose q = -z + 18. What is the remainder when 29 is divided by z? 14 Suppose -5s = t - 9 - 25, 4t = -2s + 64. Let c(y) = 7y3 - y2 + 2y - 3. What is the remainder when c(2) is divided by t? 11 Let o = -206 - -220. Calculate the remainder when o is divided by 1/3 - (-42)/9. 4 Let w = -706 + 196. What is the remainder when 14/(-21) + w/(-9) is divided by 15? 11 Let a(w) = -w*3 + 10w*2 - 8w - 5. Let d be a(9). Suppose db - 30 - 78 = 0. What is the remainder when 53 is divided by b? 26 Let l = 11 - -19. Let w be -1 + (-2)/2 + 5. Suppose -2q + q = -4s + l, 0 = -ws - 2q + 28. What is the remainder when 15 is divided by s? 7 Suppose 4z - 43 = 17. Let k = 46 - z. What is the remainder when k is divided by 16? 15 Let p(h) = -5h + 1. Let i(f) = -f3 - 4f*2 + 2f + 4. Let l be i(-4). What is the remainder when p(l) is divided by ((-3)/2 - -1)-22? 10 Suppose 3i = 5i - 44. Calculate the remainder when i is divided by 8. 6 Let x = -15 - -22. Let a = -40 + 120. Suppose 3h - a = -h. What is the remainder when h is divided by x? 6 Let b(r) = r. Suppose 5x + 2f = -f + 25, 4f = x + 18. What is the remainder when 3 is divided by b(x)? 1 Let x(f) = -f3 - f2 - f + 17. Suppose 3n - 20 = -2n. Suppose -6q + 10 = -nq. Calculate the remainder when x(0) is divided by q. 2 What is the remainder when 42 is divided by 12 + -112/4? 6 Let b = -38 - -54. What is the remainder when 47 is divided by b? 15 Let c(d) = -d*3 - 2d + d*2 + 7d + 4 + 0d2. Let j be c(-3). Suppose 3z - 172 = -j. Calculate the remainder when z is divided by 17. 15 Suppose -35 + 10 = -k + 4g, 3g = k - 21. What is the remainder when 33 is divided by k? 6 Let c = 63 - 37. What is the remainder when 101 is divided by c? 23 Let t be (-2 - -2)/(-3 - -1). Let z be 2 + (0 - 1 - -2). Let q = z + t. Calculate the remainder when 8 is divided by q. 2 Let s be (0 - 2)(-30)/12. Suppose -o - 2 = 0, -sv - 65 = -8v - 5o. Calculate the remainder when 98 is divided by v. 23 Let y(a) = -a*3 - 4a*2 + 8a + 5. Let g be y(-6). Suppose -3p + g = 2. Let w = 62 + -36. What is the remainder when w is divided by p? 8 Let i(t) = t + 6. Suppose -2w = -5x + 99, 5 + 5 = -5w. What is the remainder when x is divided by i(4)? 9 Let d = 16 - 15. What is the remainder when 2 is divided by d? 0 Let n be (-4)/20 - 81/(-5). Suppose n = 4j - 8. What is the remainder when 38 is divided by (3/j + 0)26? 12 Suppose 57 = 7a - 76. Calculate the remainder when a is divided by 4. 3 Let y be (7 - 5) + 8/2. What is the remainder when 101 - 18/y is divided by 5? 2 Let w = 15 - 10. Suppose 325 = -0a + 5a + 2x, 227 = 4a - wx. Calculate the remainder when a is divided by 13. 11 Let d be 1/((-1)/1) + -2. Let i(u) = -2u - 1. What is the remainder when i(d) is divided by 3? 2 Let n = 91 + -44. Suppose -4b - 3g = 17, 7b = 3b + 3g - 47. Calculate the remainder when n is divided by b1/3-6. 15 Suppose g - 8 = -0g. Let m(y) = -y*3 + 6y*2 + 2. Let c be m(6). Suppose 3 = cq - 43. Calculate the remainder when q is divided by g. 7 Suppose -9k + 90 = -108. Calculate the remainder when 43 is divided by k. 21 Suppose -37 = -v - 3z, -33 - 9 = -v + 2z. Let u(r) = -2r - 1 - 6r - 7r. Calculate the remainder when v is divided by u(-1). 12 Suppose -36 = 31n - 33n. What is the remainder when 66 is divided by n? 12 Let m be -3 - (-3 + -4)1. Let t = m - 0. What is the remainder when 10 is divided by t? 2 Let y(p) be the third derivative of p4/12 - p3/6 - 8p*2. Suppose -4w + 3*w + 7 = 0. Calculate	{ "pile_set_name": "DM Mathematics" }
t from cyucvyqr. Give prob of picking 1 v, 2 y, and 1 c. 1/35 Calculate prob of picking 3 z when three letters picked without replacement from {a: 1, j: 1, z: 5, r: 4, k: 1, y: 3}. 2/91 Four letters picked without replacement from xxawxnnwhiinnxwxxx. What is prob of picking 2 x and 2 n? 7/170 What is prob of picking 1 l and 1 e when two letters picked without replacement from mmel? 1/6 Two letters picked without replacement from aiaiaiiiiiaiaaai. Give prob of picking 2 i. 3/10 Two letters picked without replacement from {c: 7, e: 2}. Give prob of picking 1 e and 1 c. 7/18 Calculate prob of picking 1 y, 1 o, and 1 l when three letters picked without replacement from slsysccyyoyiiyysl. 3/170 Calculate prob of picking 1 h, 1 f, and 1 p when three letters picked without replacement from {p: 1, h: 8, f: 6}. 48/455 Four letters picked without replacement from vxyhy. Give prob of picking 1 v, 2 y, and 1 h. 1/5 Three letters picked without replacement from {m: 5, x: 3, c: 5, o: 6, e: 1}. What is prob of picking 2 m and 1 e? 1/114 What is prob of picking 1 o and 1 e when two letters picked without replacement from {o: 1, l: 1, v: 1, a: 6, e: 4}? 2/39 Three letters picked without replacement from {e: 2, q: 1, t: 3, u: 1}. What is prob of picking 1 e, 1 t, and 1 q? 6/35 Calculate prob of picking 1 d and 2 b when three letters picked without replacement from bfpfpbfbbhdb. 1/22 What is prob of picking 2 x when two letters picked without replacement from ywryrgxx? 1/28 Four letters picked without replacement from hfhssssehrsfs. What is prob of picking 2 s, 1 e, and 1 h? 9/143 Calculate prob of picking 1 v and 1 g when two letters picked without replacement from vvvvvvgvvggvvvvvvv. 5/17 What is prob of picking 1 n, 1 w, and 1 x when three letters picked without replacement from xwnonxwxxxnpnonxj? 3/34 Three letters picked without replacement from {d: 4, r: 3, m: 1, k: 1, e: 5}. What is prob of picking 1 m and 2 d? 3/182 Three letters picked without replacement from zbobfgg. Give prob of picking 1 b, 1 f, and 1 o. 2/35 Calculate prob of picking 1 p and 1 d when two letters picked without replacement from {d: 5, p: 3, v: 3}. 3/11 Four letters picked without replacement from {k: 1, c: 2, v: 1, t: 7, z: 5, g: 1}. Give prob of picking 1 g, 1 k, 1 v, and 1 z. 1/476 Calculate prob of picking 2 w when two letters picked without replacement from {x: 1, w: 2}. 1/3 Calculate prob of picking 2 t when two letters picked without replacement from {i: 6, l: 9, t: 3, v: 1}. 1/57 Calculate prob of picking 2 g when two letters picked without replacement from ggpgp. 3/10 Two letters picked without replacement from {i: 7, d: 7, z: 1, o: 1}. Give prob of picking 1 o and 1 d. 7/120 What is prob of picking 1 p, 2 m, and 1 j when four letters picked without replacement from jddzmzjpvmjv? 1/165 Three letters picked without replacement from {z: 10, h: 1, q: 3, v: 4, m: 1}. What is prob of picking 1 v, 1 z, and 1 m? 40/969 Two letters picked without replacement from goeggeeeegggbgggegoe. Give prob of picking 2 e. 21/190 Two letters picked without replacement from {w: 2, f: 1, c: 1, t: 1}. Give prob of picking 1 f and 1 c. 1/10 What is prob of picking 2 i and 2 p when four letters picked without replacement from {m: 6, u: 1, p: 3, i: 2, w: 1, l: 2}? 1/455 Four letters picked without replacement from xooxxoxoox. What is prob of picking 2 x and 2 o? 10/21 Two letters picked without replacement from {h: 1, m: 2, g: 4, d: 1}. Give prob of picking 1 g and 1 m. 2/7 Calculate prob of picking 1 z and 1 v when two letters picked without replacement from zazzvlamvuzvz. 5/26 Four letters picked without replacement from wjowlwojxjhooowo. Give prob of picking 1 o, 1 x, and 2 w. 9/455 What is prob of picking 1 s, 1 v, and 1 h when three letters picked without replacement from hevhsveeeehhe? 4/143 What is prob of picking 2 y when two letters picked without replacement from ulmnmyyn? 1/28 Calculate prob of picking 2 h and 2 x when four letters picked without replacement from {j: 2, h: 2, x: 5}. 5/63 What is prob of picking 2 x and 1 z when three letters picked without replacement from zxxx? 3/4 Two letters picked without replacement from {w: 2, z: 4, i: 1}. What is prob of picking 1 i and 1 z? 4/21 Two letters picked without replacement from uvvu. Give prob of picking 1 u and 1 v. 2/3 Calculate prob of picking 1 n and 1 q when two letters picked without replacement from {n: 2, l: 1, q: 1, p: 2, e: 3, u: 6}. 2/105 Two letters picked without replacement from uufufu. Give prob of picking 1 u and 1 f. 8/15 Three letters picked without replacement from vwwqybwqyw. What is prob of picking 1 b, 1 v, and 1 q? 1/60 What is prob of picking 2 u and 1 q when three letters picked without replacement from {v: 1, k: 6, w: 3, u: 4, q: 4, s: 2}? 2/95 Three letters picked without replacement from {h: 2, g: 13, z: 5}. What is prob of picking 1 h and 2 z? 1/57 Two letters picked without replacement from {d: 1, p: 5, a: 3, i: 1, b: 2, u: 3}. Give prob of picking 1 u and 1 i. 1/35 Three letters picked without replacement from {z: 4, d: 1, k: 3, i: 2, g: 2, r: 3}. What is prob of picking 2 r and 1 d? 3/455 Calculate prob of picking 1 m and 1 d when two letters picked without replacement from {k: 1, m: 1, d: 2}. 1/3 What is prob of picking 1 t and 1 h when two letters picked without replacement from {k: 6, t: 3, b: 1, h: 1, d: 4, l: 1}? 1/40 Calculate prob of picking 1 z and 2 a when three letters picked without replacement from aaajazaaceaojezaaje. 24/323 What is prob of picking 2 w and 1 c when three letters picked without replacement from cwwwcwwwwwwwwwwow? 91/340 Calculate prob of picking 1 d, 1 e, and 2 g when four letters picked without replacement from {d: 11, g: 4, e: 4}. 22/323 Two letters picked without replacement from oolbhollbbobbc. What is prob of picking 1 b and 1 o? 20/91 Four letters picked without replacement from xacxxacxa. Give prob of picking 4 x. 1/126 Four letters picked without replacement from {v: 1, n: 1, k: 2, q: 2}. What is prob of picking 1 n, 2 q, and 1 v? 1/15 Four letters picked without replacement from nnnniniinfnifi. What is prob of picking 1 f, 1 n, and 2 i? 20/143 Two letters picked without replacement from {t: 4, v: 4, p: 6}. Give prob of picking 1 p and 1 v. 24/91 Calculate prob of picking 2 f when two letters picked without replacement from {j: 2, v: 1, x: 2, r: 1, f: 2}. 1/28 Three letters picked without replacement from {g: 1, e: 1, c: 4, y: 2, w: 2}. What is prob of picking 1 y and 2 c? 1/10 What is prob of picking 2 r, 1 e, and 1 h when four letters picked without replacement from hereeeeeheere? 18/715 Three letters picked without replacement from hshssshhsshh. Give prob of picking 3 s. 1/11 What is prob of picking 2 s when two letters picked without replacement from {r: 2, i: 1, s: 2, k: 1, e: 2, o: 1}? 1/36 Three letters picked without replacement from nnnnn. What is prob of picking 3 n? 1 Three letters picked without replacement from {h: 2, k: 3, y: 1, b: 5, x: 6, r: 2}. Give prob of picking 1 x, 1 r, and 1 b. 20/323 Three letters picked without replacement from vvvvvvvvvvzvz. Give prob of picking 2 v and 1 z. 5/13 Two letters picked without replacement from {y: 3, f: 3, a: 5}. What is prob of picking 2 y? 3/55 What is prob of picking 1 e and 1 c when two letters picked without replacement from {b: 1, t: 2, e: 3, c: 1}? 1/7 Four letters picked without replacement from {p: 3, m: 2, a: 12}. What is prob of picking 2 p and 2 m? 3/2380 Four letters picked without replacement from xxiixjcjxji. Give prob of picking 1 x, 2 i, and 1 j. 6/55 Calculate prob of picking 1 j and 1 k when two letters picked without replacement from {k: 19, j: 1}. 1/10 What is prob of picking 1 l and 1 w when two letters picked without replacement from {y: 2, l: 4, v: 3, b: 4, w: 1, u: 1}? 4/105 Calculate prob of picking 1 t and 1 d when two letters picked without replacement from dtttbbbtttot. 7/66 Four letters picked without replacement from krrkkkkk. Give prob of picking 2 r and 2 k. 3/14 Calculate prob of picking 2 z when two letters picked without replacement from {w: 7, l: 3, z: 3}. 1/26 Two letters picked without replacement from ddwdwddddd. Give prob of picking 2 w. 1/45 Calculate prob of picking 1	{ "pile_set_name": "DM Mathematics" }
9 Let f(c) = -5c + 13c + 0c - 2c - 2 - c*2. Suppose 5o + 10 = -5a, 2o = -4a - 13 + 3. Let y be a(-3)/((-9)/(-4)). Determine f(y). 6 Let p(m) = 8m3 + m2 + m + 1. Suppose 0 = 9n - 106 + 115. Give p(n). -7 Let j(p) be the second derivative of -p5/60 - p4/3 - p*3/3 - 3p*2/2 + 11p. Let t(a) be the first derivative of j(a). Give t(-9). -11 Let q(y) = 12y - 3. Let j(r) = 17r - 4. Let d(l) = 5j(l) - 7q(l). Suppose 2b = 3n - 22, 2n = -4b + 2 - 14. Determine d(n). 5 Let b = 0 - 1. Let v be (2/6)/(b/(-6)). Let l(o) = -vo + 0o - o*2 - o + 2 - 2o. Give l(-5). 2 Let q(z) = z*2 + 5z + 9. Let i be q(-6). Suppose -x - 5k - 9 = 0, -k - i = -3x - 2k. Let p(r) = -r2 + 6r - 1. Determine p(x). -1 Suppose 24q = 35q - 25q + 14. Let w(j) = 6j + 1. Let t(o) = -o. Let f(a) = 4t(a) + w(a). Calculate f(q). 3 Let u(s) be the third derivative of s5/60 + s4/3 - 17s*3/6 - 378s2. Give u(-9). -8 Let f(g) = g2 + 5g + 6. Let l be f(-2). Let r(p) = p + lp + p. Determine r(-4). -8 Let v(l) = -9l - 4. Suppose 2 = 2g - 6b + 4b, -b = 3g + 1. Give v(g). -4 Let o be (-3 - -2)(-4 + 2). Let y be o4/8 - -1. Let c be -5 - (y + (-4)/2). Let u(f) = -f3 - 3f*2 + 6f - 7. Calculate u(c). 13 Let x(f) = -10 - 2 - f + 0f2 - f2. Let m = 47 + -86. Let p = m - -39. Determine x(p). -12 Suppose -5u + 8u = 114. Let i = u + -44. Let s(n) = -n - 1. Let k(c) = 6c + 11. Let o(z) = -k(z) - 4s(z). Give o(i). 5 Let n = 873 - 890. Let m(q) = q + 18. Give m(n). 1 Let t(c) = -c2 + 5c + 1. Suppose 4a - 18 = -2. Let z be a/(-6) - (-1012)/33. Suppose 5 = -5h - b + z, 0 = -h - b + 9. Calculate t(h). 5 Let f(j) be the first derivative of -j4/2 - j3/3 + 2j2 + 3j + 2. Suppose 0 = -46u + 45u - 2. Give f(u). 7 Let z(a) = -198 + 5a2 + 17a2 + 197. Determine z(-1). 21 Let r(m) = m2 + 19. Let u = -174 + 174. Determine r(u). 19 Let m(i) = -i*3 - i - 7. Let n be (0/(-1)1)/((-10)/(-10)). Calculate m(n). -7 Let c(y) = y*2 + 5y. Let r = -172 - -128. Let u be 110/r((0 - -1) + 1). Calculate c(u). 0 Let y(r) = 0r2 + r3 - r*2 + 5r - 4r2. Let d = 12 + -13. Let l be 9/2 - d/(-2). What is y(l)? 4 Let a(k) = 7k - 4k - 5 + 3k - 7 - 2. What is a(3)? 4 Let x(w) = -4w3 + 9w*2 + 4w + 3. Let o(i) = -i3 + i2 + i. Let h(m) = -5o(m) + x(m). Let r be (-19)/4 + 3/4. Determine h(r). 7 Suppose 2 = 7g - 4g + 4x, -5 = -2g + x. Let u(h) = 6h*g - 2h*2 + 8h - 2h2 - h2. Give u(-9). 9 Let c(b) be the third derivative of -b4/12 + b3 - 22b*2. What is c(6)? -6 Suppose w + 24 = 7w. Let b(a) = -wa - 2 - 3 + 0a2 - a2 + 2a2. What is b(4)? -5 Let n(m) = 10m*2 - 19m + 1. Let g be n(2). Let h(u) be the second derivative of -5/2u2 - 7u - 4/3ug + 1/20u*5 + 0 + 5/12u*4. What is h(-6)? 7 Let w(u) = 4u + 11. Let n(i) = -5i - 11. Let r(t) = -3n(t) - 4w(t). Let b(s) = 6s + 56. Let y(j) = 2b(j) + 11r(j). What is y(8)? -1 Suppose -4f - 10 = -8z + 10z, 0 = -f - 4z + 15. Let l(x) = -x*3 - 5x*2 - 6x + 5. Give l(f). 35 Let q(n) = -3619n2 - 3 + 1812n*2 + n + 1808n*2. What is q(0)? -3 Suppose 2q - 3j = -35, -14j = -5q - 11j - 65. Let a(k) = k*2 + 8k - 18. Give a(q). 2 Let h(j) = j*2 - 2j + 3. Let t(g) = 8g2 - 48g + 3. Let s be t(6). What is h(s)? 6 Suppose -4h - 8 = -2p + 4, 3h - 4p + 4 = 0. Let r(u) = -4u + 7. Give r(h). 23 Let z(y) be the first derivative of y3/3 - 27y*2/2 + 11y - 305. Give z(27). 11 Let r(p) = 14p - 20p - 3 - 16 + 0p + 5p. Determine r(-10). -9 Let k(r) = -5r + 3r + 3r + 9 - 19. Give k(15). 5 Let g(w) = w3 - 13w*2 - 14w + 3. Let s(t) = -4t2 + 68t + 14. Let r be s(17). Calculate g(r). 3 Suppose 3z + 4 = 4z. Suppose 2s = -2v + 22, zv + 7s - 34 = 5s. Let d(f) = -vf - 5f2 + f + 1 + f3 - 4. Calculate d(6). 3 Let z(f) = -f3 - 7f*2 - 6f + 5. Let r = 11 + -9. Suppose rn + 30 = -3n. What is z(n)? 5 Let p(u) = u*3 - 6u2 - u + 2. Let w = -4 + -19. Let z = w - -29. Calculate p(z). -4 Let c(s) = s2 + 3s + 3. Let b be c(-2). Let r(w) = -19w*3 + 3w*2 - 2w. Let t(v) = -21v3 + 4v*2 - 3v. Let k(d) = 3r(d) - 2t(d). Determine k(b). -14 Let a(r) = 2r - 8r - 3359 + 3357. Calculate a(4). -26 Let y(b) = -10b + 7. Let l = -385 - -389. Determine y(l). -33 Let w(c) = 2c*3 + 35c*2 - 22c - 76. Let n be w(-18). Let v(y) = y3 + y2 - 2y + 1. What is v(n)? -39 Let r = -1 - -2. Let b(k) be the third derivative of -7/24k*4 + 4k*2 - 1/6k*3 + 0 + 0k. What is b(r)? -8 Let q(j) be the first derivative of j*4/4 + 17j*3/3 + 17j*2/2 + 14j + 76. What is q(-16)? -2 Let y be 30/8 + -13 + 539/44. Let t(o) = -3o - 7. What is t(y)? -16 Let h = -11 + 23. Suppose 8q - 4q - h = 0. Let z(g) = g3 - 2g*2 - 4g + 2. Determine z(q). -1 Let w(a) be the second derivative of -a*6/360 + 5a4/24 - a3/2 - 21a. Let c(n) be the second derivative of w(n). Calculate c(0). 5 Suppose 0 = -0s + 5s + 20. Let w(n) be the third derivative of n4/24 - n3/6 - n2 - 2575. Calculate w(s). -5 Let i(h) = -h3 - 5h*2 + 3h + 1. Let f be (9/(63/2))/(2/(-28)). Give i(f). -27 Let f(j) = -3j + 17. Let w be f(8). Let p = w - -13. Let q(t) = -t3 + 7t*2 - 5t - 3. Determine q(p). 3 Let f(g) = -g*2 - 3g + 8g + 3281 - 3276. Give f(4). 9 Let t(i) = -i + 5. Suppose 3f - 3k = 87, 4f = -4k + 3k + 136. Let r = f - 20. Let v = r + -7. What is t(v)? -1 Let r(x) be the first derivative of -x*3/6 - 5x*2 - 36x + 4. Let g(q) be the first derivative of r(q). Calculate g(-9). -1 Suppose 2q + 2q = 4, 4c = -5q + 401. Let n = 97 - c. Let w(j) = -5j2 - 2j + 1. Determine w(n). -15 Let b(w) = -w*3 - 9w*2 - 7w - 9. Let p be (3 - (-8)/2)/(-1). Give b(p). -58 Let k(q) = -4q - 1. Suppose -5i + 28 = -b, -2b + 3i - 108 = b. Let t = b + 36. What is k(t)? 7 Let z(n) = n*3 - 3n*2 - 13n + 39. Let x be z(3). Let p(t) be the third derivative of 0t - 7t*2 + 1/60t*5 + x + 3/2t*3 + 1/24t*4. Calculate p(0). 9 Let k(d) = -25d - 4. Let w(a) = 17a + 3. Let r(q) = 3q + 4. Let b be r(-3). Let p(v) = bk(v) - 7w(v). Determine p(1). 5 Let b(a) = -16a2 + 8a - 158. Let u(c) = 5c2 - 3c + 50. Let l(t) = -6b(t) - 19u(t). What is l(-6)? -20 Let h(x) = x*3 - 4 - 19195x*2 + 4 + 19195x2 + x. Calculate h(-1). -2 Let i(n) = n3 - 17n2 + 26n + 57. Let k be i(15). Let r(u) = 5u + 7. What is r(k)? -8 Let j(k) = -2k3 - k2 + k*2 + k + 9866 - 9867. Determine j(1). -2 Let m(s) = 13s*2 + 38s + 20. Let c(f) = 7f2 + 20f + 11. Let y(j) = 11c(j) - 6m(j). What is y(-7)? 8 Let s(m) = 3m - 23. Suppose 8z - 7z + 8 = 0. Let y(d) = 5d - 34. Let o(r) = zs(r) + 5y(r). Determine o(-8). 6 Let w be (0 - -6)/(-3) - -4. Let y be -3w/(-12)6. Let n = y - 5. Let v(t) = -2t3 - 3t*2 - 2t - 2. Calculate v(n). 6 Suppose -3s = 4s - 35. Let p(o) = o*3 - 5o*2 - 2o + 7. Let t be p(s). Let x(i) = -2i2 - 2i. Determine x(t). -12 Let b(f) be the third derivative of -f6/120 + f5/15 - f4/12 - f3/2 + 10f2 - 2f. Determine b(3). 0 Let d(o) = -9o + 7 - 9 + 2o. Let i be (-3 - (-1 - 6)) + -2. Suppose -5z - i = -4z. What is d(z)? 12 Let l(j) = j - 14j3 + 7j*3 + 1 + 4j*3. What is l(-1)? 3 Let t(n) = -3n*3 - 12n*2 - 12n + 13. Let o(x) = -2x3 - x2 + 1. Let b(i) = -2o(i) + t(i). Give b(11). 0 Let w(z) = -z + 19. Suppose 348s + 26 = 350s. Give w(s). 6 Let z(f) = -f + 3. Let m(t) = -6t + 8. Let k(a) = -m(a) + 2z(a). Give k(-3). -14 Let g be 1 - 3 - 3(-4)/3. Let f(o) = 21 - go - 7 - 14. Determine f(-4). 8 Let n(o) = 1 + 7o + 0o*2 - 15o - 2o2 + 0o2. Let c be n(-4). Let t(g) = g3 + g2. What is t(c)? 2 Let z(l) = -l2 - 8l - 1. Let v(a) = -a2 - 7a. Let f(u) = -4v(u) + 3z(u). Determine f(-4). -3 Suppose -2i - 2r + 42 = 0, -3r + 8r + 10 = 0. Let o = -28 + i. Let m(k) = k*2 + 3k - 6. Determine m(o). 4 Let m(o) = o*3 - 11o*2 + 12o - 11. Let i = 5 + 5. What is m(i)? 9 Let o(q) be the third derivative of q5/60 - q4/8 + q*3/2 - 250q*2. Let r be (-7)/3 + (-4)/6. Calculate o(r). 21 Let w be 0 + -2 - (-3 + 3). Let d(p) = 11p + 2. Let v(s) = 23s + 5. Let h be 6/10 - (-140)/(-25). Let c(m) = hd(m) + 2v(m). Calculate c(w). 18 Let n(p) = 7p2 - p3 + 2p	{ "pile_set_name": "DM Mathematics" }
16105961 Calculate 32540706 divided by -986082. -33 Divide 26907 by 212. 26907/212 What is 3667635 divided by -547? -6705 What is 37007520 divided by -7824? -4730 Divide 33581285 by -5. -6716257 What is 246358767 divided by -31? -7947057 Calculate -7994010 divided by -532934. 15 641817250 divided by 3 641817250/3 What is 46331430 divided by -138? -335735 Divide -107 by 353570. -107/353570 Divide 59222205 by 680715. 87 Divide -125402420 by -5380. 23309 Divide -1979 by 65700. -1979/65700 Divide -514624 by 117. -514624/117 -9481537 divided by -231257 41 -11 divided by 252266 -11/252266 What is 3317754600 divided by -3? -1105918200 What is 3934296 divided by -477? -8248 What is 33390230 divided by 5? 6678046 What is -26558 divided by -3401? 26558/3401 Divide -4092785 by -818557. 5 What is -4965237 divided by 53? -4965237/53 2 divided by 2700440 1/1350220 Divide -158876870 by -565. 281198 Divide 3072 by 116. 768/29 Calculate 18 divided by 229439. 18/229439 Calculate -36849 divided by -60. 12283/20 508839639 divided by -15419383 -33 -1960169830 divided by -392033966 5 What is 251279 divided by -1377? -251279/1377 17816092 divided by 120379 148 -390305584 divided by -34 11479576 Calculate -406 divided by 33944. -203/16972 Calculate 74875618 divided by 38. 1970411 512 divided by 917272 64/114659 288581 divided by 201 288581/201 -14599223 divided by 4 -14599223/4 Calculate 4 divided by 197251639. 4/197251639 -1277407578 divided by -6 212901263 Divide -218 by 384709. -218/384709 -713340 divided by 11889 -60 14266 divided by 621 14266/621 What is -840967 divided by 1? -840967 Calculate 0 divided by 82810929. 0 What is 21368380 divided by 1? 21368380 Calculate -30 divided by -20396734. 15/10198367 -283656303 divided by 4502481 -63 Calculate 3 divided by -3860378. -3/3860378 -15405728 divided by 66404 -232 Calculate -664290102 divided by -55293. 12014 Divide -2933 by -2437. 2933/2437 What is -22188597 divided by 1? -22188597 Divide 468 by 7997. 468/7997 What is -82659825 divided by -25? 3306393 Divide 85160780 by -8516078. -10 -6011 divided by 1006 -6011/1006 3 divided by -141734406 -1/47244802 2160 divided by -93566 -1080/46783 208 divided by 323546 104/161773 -2439543 divided by 1011 -2413 -89885 divided by -101 89885/101 Calculate 0 divided by -3905760. 0 Calculate -10225661 divided by 352609. -29 Calculate 24083124 divided by -1902. -12662 7920786 divided by -1 -7920786 What is 15961218 divided by -9269? -1722 Calculate 151280058 divided by 368078. 411 What is 624574440 divided by -4461246? -140 What is 630939285 divided by 126187857? 5 Calculate 65024608 divided by 8888. 7316 -5 divided by -18977864 5/18977864 Divide -475228775 by -175. 2715593 456 divided by 86692 114/21673 What is -59478531 divided by -21? 2832311 Calculate -325510808 divided by 7939288. -41 -1 divided by 167955749 -1/167955749 Divide 31414 by 3318. 15707/1659 Calculate 14184334 divided by 25. 14184334/25 Calculate -21060884 divided by -172. 122447 -228 divided by 9994 -6/263 -489394 divided by 194 -244697/97 Divide 4653120 by 16. 290820 Divide -6 by -7064054. 3/3532027 What is 234749767 divided by 6? 234749767/6 What is -69061 divided by 7586? -69061/7586 Divide 1256184 by -628092. -2 What is 1502753 divided by -74? -1502753/74 What is 79996 divided by -99? -79996/99 -107750784 divided by -64832 1662 What is -944980452 divided by 351? -2692252 -5 divided by 1176626 -5/1176626 752152435 divided by 3 752152435/3 What is 13267097 divided by 5? 13267097/5 Calculate 75908 divided by -1079. -75908/1079 What is -3526710 divided by -3? 1175570 Divide -57797446 by 32507. -1778 26170970 divided by 5234194 5 124200416 divided by 4 31050104 12235808 divided by -4 -3058952 What is -3368 divided by 8700? -842/2175 -195 divided by 658468 -195/658468 Divide -670603 by 3. -670603/3 Divide -192738828 by -2. 96369414 Calculate 329887 divided by 73. 4519 Calculate 300945 divided by 16. 300945/16 279096006 divided by -7 -39870858 Divide 50590728 by -36. -1405298 Divide 64833258 by 4630947. 14 Divide -23 by 485821. -23/485821 0 divided by -4310253 0 Calculate -54384150 divided by 6. -9064025 29310128 divided by -3663766 -8 Divide -51292410 by -30. 1709747 Calculate -312550290 divided by -924705. 338 What is -20163012 divided by -6? 3360502 What is -647167 divided by 518? -17491/14 Divide 145707810 by 3530. 41277 28642158 divided by -1602 -17879 1498782 divided by -749391 -2 Divide -435 by -729259. 435/729259 What is 11283 divided by -2863? -11283/2863 Divide -39 by -10308. 13/3436 What is 859233 divided by -3? -286411 -4 divided by 14111965 -4/14111965 What is -985842 divided by 11? -89622 Divide -914322 by -27. 304774/9 Calculate -282053 divided by -334. 282053/334 What is -286308 divided by -22? 13014 31079610 divided by -5 -6215922 Calculate -87424542 divided by -6. 14570757 13016808 divided by -4338936 -3 904957 divided by -79 -904957/79 Calculate -1953828 divided by -229. 8532 What is 2741952 divided by -1370976? -2 -1090092668 divided by -15001 72668 Calculate -58772 divided by 33. -58772/33 Calculate 75671 divided by 101. 75671/101 Divide 3824204 by -33. -3824204/33 Divide -87544224 by 29181408. -3 346813188 divided by 282 1229834 9931 divided by -247 -9931/247 24393988 divided by 215876 113 What is 10703878 divided by 16? 5351939/8 Calculate -1171094 divided by -178. 585547/89 3943787 divided by -59 -3943787/59 Divide 8373105 by 36. 930345/4 19990 divided by -1735 -3998/347 -27566700 divided by -78762 350 -17873600 divided by 1 -17873600 -652 divided by -19937 652/19937 Divide 0 by -10541718. 0 -518210724 divided by 2 -259105362 What is 171314835 divided by -5189? -33015 Divide -448663264 by -51737. 8672 Calculate 155 divided by 535925. 31/107185 What is 595452702 divided by 6? 99242117 Calculate -1077824874 divided by 147. -7332142 Calculate -321215 divided by -8. 321215/8 -23188232 divided by 5797058 -4 Calculate -62107640 divided by 2. -31053820 222722652 divided by 74240884 3 Divide 29409172 by 28636. 1027 Divide 24054912 by 42. 572736 Divide 2054669 by 119. 2054669/119 Divide 9861 by -20946. -3287/6982 What is 79726140 divided by -10? -7972614 Calculate 18594172 divided by -149953. -124 3303928 divided by 6 1651964/3 What is -1803714 divided by 1? -1803714 Divide -462 by -935619. 154/311873 Divide 4943376 by -16. -308961 What is -934044096 divided by -311348032? 3 Calculate -68843133 divided by -9. 7649237 Calculate 90841 divided by 1153. 90841/1153 What is 4763150 divided by -217? -21950 158764 divided by 83 158764/83 Divide 40528710 by -2701914. -15 8364265 divided by -1672853 -5 0 divided by -2124962 0 What is 79 divided by 37712? 79/37712 9571 divided by -23430 -9571/23430 What is 11238184 divided by 8? 1404773 -14639956 divided by 192631 -76 Divide -12237246 by 31059. -394 Calculate -3 divided by 176180. -3/176180 Calculate -95000 divided by -12. 23750/3 42825744 divided by 5 42825744/5 Calculate 28877245 divided by -985. -29317 Calculate -32707060 divided by 4. -8176765 Divide 295963668 by 1287. 229964 Calculate -1 divided by 52082677. -1/52082677 Divide 1 by 94386853. 1/94386853 Calculate -2 divided by 558408. -1/279204 What is -6219499 divided by -478423? 13 What is -39 divided by -306? 13/102 Divide -12606688 by -3151672. 4 Divide -308 by 6542. -154/3271 Divide -148251156 by 14023. -10572 What is 49425839 divided by 1? 49425839 Calculate -4923155 divided by -58. 4923155/58 Divide 2588190 by -3630. -713 -705 divided by 45414 -235/15138 What is -62 divided by 288599? -62/288599 Divide 45279324 by 3. 15093108 What is 758 divided by 66445? 758/66445 What is 3 divided by 2149753? 3/2149753 Divide -23792510 by -3398930. 7 -614 divided by 1133 -614/1133 -429278199 divided by 56941 -7539 -61141538 divided by -2894 21127 Calculate -1351627272 divided by 6. -225271212 What is -5 divided by 163194? -5/163194 -64 divided by -402797 64/402797 319975 divided by -428 -319975/428 -1844017 divided by -235 1844017/235 Calculate -692652916 divided by -4. 173163229 -7743188 divided by -1 7743188 Divide 94889216 by -11861152. -8 8119 divided by 165 8119/165 0 divided by -21236748 0 What is 46515085 divided by -5? -9303017 Divide 22 by -2011273. -2/182843 58007912 divided by 1 58007912 -757 divided	{ "pile_set_name": "DM Mathematics" }
m uwuuutuxtntnuqutw. Give prob of sequence xt. 1/68 Calculate prob of sequence ioi when three letters picked without replacement from iiamiiiooiiii. 12/143 What is prob of sequence ak when two letters picked without replacement from {w: 1, t: 3, k: 2, d: 5, m: 1, a: 1}? 1/78 Two letters picked without replacement from {i: 4, b: 2, p: 4}. What is prob of sequence ip? 8/45 Two letters picked without replacement from aanttttllbandb. Give prob of sequence lb. 2/91 What is prob of sequence efzf when four letters picked without replacement from zzefzzefeee? 1/198 Two letters picked without replacement from {k: 7, a: 6}. What is prob of sequence kk? 7/26 What is prob of sequence oy when two letters picked without replacement from owowowowwyoyy? 5/52 What is prob of sequence ff when two letters picked without replacement from nmcmmcfnfcc? 1/55 What is prob of sequence vrb when three letters picked without replacement from {o: 4, v: 3, s: 1, r: 2, b: 6}? 3/280 Calculate prob of sequence jr when two letters picked without replacement from kmmrmumrmrrrmjrkm. 3/136 Calculate prob of sequence xx when two letters picked without replacement from xxxxxx. 1 Calculate prob of sequence ttp when three letters picked without replacement from {p: 3, t: 9}. 9/55 Four letters picked without replacement from szvxzsvxvxsxx. Give prob of sequence svxz. 3/572 Four letters picked without replacement from eefbyzeyyfbyzbeyzy. What is prob of sequence zzef? 1/1530 What is prob of sequence kdt when three letters picked without replacement from ditttkvvktktkvit? 1/140 Four letters picked without replacement from ssssvspkvwspwp. Give prob of sequence vwsv. 1/1001 What is prob of sequence cqcj when four letters picked without replacement from {c: 2, q: 1, j: 1, x: 3}? 1/420 Four letters picked without replacement from rlwrvrmlmmzlz. Give prob of sequence mwmr. 3/2860 What is prob of sequence kx when two letters picked without replacement from oxk? 1/6 What is prob of sequence wx when two letters picked without replacement from xxttxxttxtwxwxtt? 7/120 Two letters picked without replacement from {x: 1, k: 4, m: 3, p: 2, d: 1}. Give prob of sequence md. 3/110 Calculate prob of sequence ib when two letters picked without replacement from {i: 4, b: 1, a: 2, c: 2, e: 5, m: 1}. 2/105 What is prob of sequence eutf when four letters picked without replacement from {f: 2, p: 1, t: 6, u: 1, e: 2}? 1/495 Two letters picked without replacement from xollxxxlxlxxoxxo. What is prob of sequence ll? 1/20 Calculate prob of sequence dx when two letters picked without replacement from {z: 1, c: 5, x: 5, d: 1}. 5/132 Four letters picked without replacement from {r: 2, k: 3, i: 6, z: 2}. Give prob of sequence krir. 3/1430 Two letters picked without replacement from dylyqydy. What is prob of sequence ql? 1/56 Three letters picked without replacement from dzzdzcccddgdzcdz. Give prob of sequence zzd. 1/28 What is prob of sequence iif when three letters picked without replacement from {i: 5, f: 14}? 140/2907 Calculate prob of sequence vte when three letters picked without replacement from eniebnvtv. 1/126 What is prob of sequence zk when two letters picked without replacement from zkkzzzzkzkzk? 35/132 What is prob of sequence ffff when four letters picked without replacement from fffffff? 1 Calculate prob of sequence uwnu when four letters picked without replacement from {n: 2, w: 1, l: 1, u: 5}. 5/378 Three letters picked without replacement from {p: 4, d: 3, g: 6, l: 1}. Give prob of sequence gpd. 3/91 What is prob of sequence ayu when three letters picked without replacement from yxauu? 1/30 Three letters picked without replacement from xiisgxi. What is prob of sequence gxi? 1/35 Two letters picked without replacement from {w: 8, u: 2, r: 4, i: 1}. Give prob of sequence ri. 2/105 Calculate prob of sequence ahkn when four letters picked without replacement from nwhkann. 1/280 Two letters picked without replacement from {f: 6, h: 12}. What is prob of sequence hf? 4/17 Two letters picked without replacement from ppccc. Give prob of sequence pc. 3/10 Calculate prob of sequence wwa when three letters picked without replacement from ecwwaaww. 1/14 Calculate prob of sequence ll when two letters picked without replacement from {l: 2, a: 4, w: 4}. 1/45 Calculate prob of sequence xpxp when four letters picked without replacement from ppppxppppppxxp. 5/182 Three letters picked without replacement from bbpbprbuoxbuubuou. Give prob of sequence ruo. 1/408 Calculate prob of sequence bbt when three letters picked without replacement from bbtb. 1/4 Two letters picked without replacement from nlhfvrn. Give prob of sequence ln. 1/21 Two letters picked without replacement from {e: 2, g: 1, i: 2, q: 1, w: 1, u: 1}. Give prob of sequence qu. 1/56 What is prob of sequence yjmu when four letters picked without replacement from jruuuuurrurrmyyrulm? 7/23256 Three letters picked without replacement from skyksyss. Give prob of sequence sky. 1/21 Three letters picked without replacement from {z: 5}. What is prob of sequence zzz? 1 Three letters picked without replacement from {k: 1, u: 1, x: 1, t: 2, m: 1, l: 1}. What is prob of sequence muk? 1/210 Two letters picked without replacement from xcbxbcxx. What is prob of sequence xc? 1/7 What is prob of sequence cay when three letters picked without replacement from {a: 6, l: 5, y: 3, c: 3}? 9/680 Two letters picked without replacement from eceshnz. What is prob of sequence he? 1/21 Four letters picked without replacement from {y: 2, a: 2, h: 1, f: 1, i: 1, r: 2}. Give prob of sequence ahrr. 1/756 Two letters picked without replacement from {b: 2, d: 2, k: 5, g: 1, n: 6, y: 1}. What is prob of sequence bd? 1/68 Four letters picked without replacement from {h: 1, p: 1, l: 3, w: 4, o: 2}. What is prob of sequence lwpl? 1/330 What is prob of sequence hpwh when four letters picked without replacement from qpukhhuw? 1/840 Three letters picked without replacement from mtntn. Give prob of sequence tnn. 1/15 Four letters picked without replacement from {z: 14, p: 5}. Give prob of sequence pzzz. 455/3876 Four letters picked without replacement from ddtdv. Give prob of sequence ddvt. 1/20 Three letters picked without replacement from {t: 4, s: 2, u: 3}. What is prob of sequence tus? 1/21 Three letters picked without replacement from jwwzwjcwuczwvzwzu. What is prob of sequence zvj? 1/510 What is prob of sequence cl when two letters picked without replacement from cclclc? 4/15 What is prob of sequence zvz when three letters picked without replacement from {v: 2, z: 2}? 1/6 Calculate prob of sequence zzuy when four letters picked without replacement from {u: 1, z: 3, y: 11}. 11/5460 Two letters picked without replacement from cqcykcqvvvyjkkvvkvc. What is prob of sequence qc? 4/171 Calculate prob of sequence lll when three letters picked without replacement from llll. 1 Calculate prob of sequence ggff when four letters picked without replacement from {f: 2, g: 4}. 1/15 What is prob of sequence bok when three letters picked without replacement from {o: 2, k: 1, b: 3, y: 4}? 1/120 Calculate prob of sequence qkc when three letters picked without replacement from {q: 3, c: 3, k: 2}. 3/56 What is prob of sequence st when two letters picked without replacement from xgbts? 1/20 Two letters picked without replacement from {d: 2, q: 3, c: 7, a: 5}. Give prob of sequence qc. 21/272 What is prob of sequence fz when two letters picked without replacement from gpafapfffzpffpf? 1/30 What is prob of sequence uz when two letters picked without replacement from krkkkkulzkrr? 1/132 What is prob of sequence zzz when three letters picked without replacement from {z: 5}? 1 Four letters picked without replacement from rssssssssssss. What is prob of sequence ssrs? 1/13 Calculate prob of sequence ool when three letters picked without replacement from {p: 3, l: 4, o: 4}. 8/165 Three letters picked without replacement from {j: 1, n: 1, x: 10, y: 2}. What is prob of sequence xxy? 15/182 What is prob of sequence qb when two letters picked without replacement from bbqbqq? 3/10 Three letters picked without replacement from {y: 6, r: 6}. Give prob of sequence ryr. 3/22 Calculate prob of sequence sv when two letters picked w	{ "pile_set_name": "DM Mathematics" }
4)/714/813/((-39)/12)? 14 Evaluate 1/(((-2432)/144704)/((-12)/14)). 51 What is (-14)/119(4352/(-3120))/16? 2/195 What is the value of (-13)/(324/108)(-15049)/149? 101 What is the value of ((-3)/((-36)/(-2)))/(141/(59220/(-10)))? 7 Calculate (-7)/(-46)(-1968)/820(-15)/21. 6/23 What is (-6)/10(5130/621)/(-38)? 3/23 Evaluate ((-62)/((-992)/60))/((-3)/24)3/5. -18 Calculate (4/3)/(8/1272)(-20)/(-80). 53 (((-1220)/(-15))/(-2))/(47/((-846)/(-12))) -61 (-148)/(((-4488)/(-1870))/((-12)/(-10))) -74 Evaluate (119/(3570/(-7440)))/(1-4). 62 What is (120/(-72))/((39/(-65))/(24/100))? 2/3 Calculate ((-126)/(-1029))/((-55)/385). -6/7 (8/(-6))/(-2)(-1458)/(-216)(-1280)/(-1440) 4 Evaluate (-10)/1714/(-196)(-99)/(-54). 55/6 Calculate ((-1405)/281)/((-45)/207). 23 Evaluate (-36)/(((-240)/(-4))/6)-156/(-6). -54 Calculate ((-156)/(-143))/((-84)/3388). -44 Calculate (5/60-1)/(108/3564). -11/4 What is the value of 63/11(-15)/(-50)405/729? 3/11 What is the value of (-6)/10(-71850)/(-38799)? -10/9 ((-84)/(-441))/((6/(-28))/((315/(-868))/15)) 2/93 What is the value of (2/1266/4)/(23/156434)? 1/21 What is the value of (-246)/41(-39)/(-45)? -26/5 Evaluate (84/8467221)/((-2)/(-16)). 1/6 Calculate (6(-9)/72)/(((-84)/154)/1). 11/8 What is the value of -424(-1559)/(-31180)(-5)/(-2)? -53 ((-1311108)/546295)/(-4(-22)/180) -54/11 Evaluate (180/108)/((-705)/18). -2/47 What is ((-9117)/121561/(-6)-3)/((-9)/1608)? 67 -12(((-8)/(-84))/2)/(46/(-161))49 98 What is the value of (((-4784)/(-506))/(-52))/(2/(-22)(-15)/(-10))? 4/3 Calculate 2068/39611/1551. 1/27 Calculate (((-65)/60)/13)/(386/(-1544))80-3. -80 Evaluate (-49)/315-9(-132)/154. -6/5 Evaluate ((-10)/(200/30))/((-2025)/(-100)). -2/27 What is the value of 4/2050320/(-32)(-5)/10? 2/205 Evaluate ((-60)/240)/(5/((-5700)/15)). 19 Evaluate ((-45)/(-756)-6)/((-1380)/113022). 117/4 What is the value of 1/1(688200/(-150))/148? -31 (6/(-726)-176)/(2/22) 16 ((-500)/40)/((-64/(-80))/(11/(-55))) 25/3 What is the value of (5572/7164)/(119/6)? 2/51 2200/4500((-336)/(-1980))/(-14)-25 4/27 What is (12/(-160))/((-357)/2856)? 3/5 (-5)/((2250/(-645))/(-30)) -43 Evaluate (-190)/(-14896)74/(-10). -1/28 Evaluate 189/270-25(160/35)/8. -10 Evaluate 12/16(-25104)/1569. -2 What is (-95095)/5852(-88)/(-1573)? -10/11 What is ((-149)/(-75096)1428)/(2/(-2))? -17/6 Calculate ((-11468)/3172)/((-3)/(-39)-11). 47 What is (104/36)/(-1340/260)(-6)/2? 13/3 What is the value of ((-8848)/(-15161048))/(1/23)? 2/149 (12/147)/((3/(-4))/((2205/120)/7)) -2/7 Calculate ((-1)/(2/(-6)))/(-4)336/(-6426)-238. -28/3 Calculate (((-27670950)/199)/150)/(27/(-3)). 103 Calculate -20((-216)/24)/23130. 2/257 What is (168/2)/249/42? 49 (6(-9)/(-8))/(2619435/(-349258)) -9/10 What is (-36(-28)/5040)/((-102)/(-15))? 1/34 What is the value of -85(20/(-119))/(34/357)(-2)/3? -100 Calculate (-3)/(-6)(-1)/(-5)3300/13530. 1/41 What is the value of (3(-496)/72)/(20/1680-28)? 62 Calculate (3/(-6)1)/(975/(-6000)-40). -1/13 Calculate ((-7)/(-1))/((696/(-24))/(-87)). 21 What is (-236)/3(-28089)/(-37452)? -59 Evaluate (-1708525/(-8820))/(10/6). 61 What is 9/2(-3)/(-45)11021/5544? 1/8 What is ((-1008)/80)/(-7)((-25)/(-285))/1? 3/19 Calculate (-51)/(1683/6)3(-5)/30. 1/11 (234/65)/(783/(-12180)) -56 Calculate (-39)/((-658/1624)/(2/7)). 52 Calculate 440/11220(-3)/4-8. 4/17 Evaluate (-1851)/9872344/(-6)(-8)/2-1. 43 What is the value of 1925/(-106260)-276(-2)/((-4)/38)? 95 What is the value of (79/(-948))/(30/(-4656))75/10? 97 What is 2/31(-14542)/58168? -1/62 What is 1/631602/(-89)? -2/7 What is (-82/(-4)4/14)/(5/7)? 8/5 35/(-70)11704/627 -28/3 What is ((-26)/(-1508))/((-3760)/32712)? -3/20 What is (12/((150/(-4))/(-5)))/(-36(-62)/8370)? 6 (-11)/(1848/(-672)(-4)/(-66)-3) -22 Evaluate (-3)/(-18)213/(-18)120/63. -10/9 What is the value of (129/(65016/144))/(10/(-5))? -1/7 What is (-11056)/(-11056)-115/12-92? 115 (4704/504)/((8/(-15))/((-476)/(-70))) -119 What is the value of 301/(-5)280/273039? -24 What is the value of ((330/1032570)/(3/543))/((-12)/28)? -2/447 Evaluate (-59092)/(-2607)(-372)/(-68). 124 ((-1888)/60)/((-7712)/(-9640)) -118/3 Evaluate 9/(432/16)85/10. 17/6 Calculate (((1343/510)/79)/(18/10))/(105/84). 2/135 Evaluate (-231)/(-14)10/272184/(-1820). -22/3 What is (314/18212-203)/(21/29)? -29/6 What is 1085/217(-4)/(-115)? 4/23 Evaluate 12/3(-48)/10848/2176. -2/51 Calculate ((-50)/35217)/10. -31 What is ((-98)/6)/(((-3710)/(-75))/(-53))? 35/2 (2/47)/((-3)/(-39)29/(667/598)) 1/47 (1656/144)/(37/148) 46 Calculate 30/(-50)(-385)/(70/(-10)). -33 Evaluate 3608586/(-6913)2/36-1. 29 (1725/8050)/((-12)/(-616)) 11 Calculate 369/2091(-140)/84. -5/17 Calculate 16(-2)/128304/(-24). 19/6 What is the value of 1/(((-48)/(-18360))/((-26)/117))? -85 Calculate ((-17)/((-680)/30))/((-30)/(-16))(-9610)/62. -62 What is the value of 66/(-306)(-1551)/(-5687)? -1/17 (-702)/1497646/207 -1/96 Calculate 19932/27181116/(-66). -124 Evaluate (144/(-220))/((-78)/26). 1/15 (10/35(-5)/(165/(-77)))/((-6)/531) -59 Calculate (13/(-4)6)/(((-27)/105)/(132/(-154))). -65 What is the value of (-550)/60972/(-99)? 90 ((-16)/(-20)(-2745)/1464)/((-45)/(-3)) -1/10 Calculate ((-17020)/2775)/(108/1215). -69 40768/224(-9)/(-63) 26 Calculate 23876/421631. 57 (((-612)/60)/17)/(((-462)/(-4340))/(-11)) 62 (42/(-7))/(-72)(-136)/102595/(-1384) 17/8 ((-125)/(-875))/(126/(-294)) -1/3 -21(-10)/(-11)(-31)/(-6975)45 -4/11 Calculate 9((-20)/54)/((-410)/1845). 15 Evaluate ((-1048)/(-1445716))/((-3)/(-93)). 2/89 Evaluate (8910/54)/((-88)/(-16)). 30 What is the value of (-3486)/(-664)(12/(-24))/(6/(-176))? 77 ((-8173)/29722/33)/(53/24) -4/15 Evaluate (((-355)/142)/(5/(-6)))/((210/(-6))/5). -3/7 Evaluate (-6624)/5796(-966)/32/16. 46 What is ((152/6)/(-2))/((-576)/(-1728))? -38 What is the value of (161/(-138)4)/(4/(-6))? 7 What is (-28)/(-1)(-4)/((-303)/90942/4)? 32 What is 36/(-18)(70/360)/((-147)/(-56))? -2/27 What is the value of (((-36)/((-5508)/17))/((-1)/6))/(3288/24)? -2/411 Evaluate (2/4)/(((-22)/264)/((-11)/(-440))). -3/20 Evaluate ((-234)/(-351)18/8)/((-135)/48). -8/15 What is (((-10686)/(-936))/137)/(1-31)? -1/36 (8/(-56)129)/(((-121)/11)/77) 29 What is 10/((-70)/203)(-450)/225? 58 Calculate -14-114(-11)/(-462). 38 What is the value of 34/((-14)/84-24)? 17/2 (-50)/(-95)(-10)/190(-437)/115 2/19 50850/(-2034)(-72)/(-20) -90 What is the value of 88/(-4532)(((-6)/2)/(-6))/((-81)/54)? 2/309 What is ((-2)/(-2))/(37/((-185)/(-125))1)? 1/25 (-5)/((-20)/18027)(-3)/100 -1/20 What is the value of (-28)/((15/(-45))/(5/((-1995)/(-38))))? 8 What is the value of 123/18((-10530)/(-45))/(-39)? -41 2/(((-10)/(-28))/(((-2)/14)/(17/102))) -24/5 What is 256/120(-57)/15210/(-15)3? 8/5 Calculate 90/(-3)(-4184)/(-9414)2/(-8). 10/3 Evaluate 1((-36)/4)/188/(-84744). 1/107 What is the value of (-2)/2283720/13842/(-10)? 41 10/24(-64)/(-4960)62(-6)/14 -1/7 What is the value of ((-3(-13)/(-117))/((-15)/(-108)))/((-15)/(-400))? -64 (55/(-154))/((-3180)/(-5194)) -7/12 What is (243/(-27)1)/((2/(-4))/(39/(-26)))? -27 What is ((53/3)/1)/(19/(-57))? -53 Evaluate ((55/5)/(-55))/(((-594)/(-30))/11). -1/9 Calculate ((-1)/60)/((-26)/(-2886)74). -1/40 Calculate ((-13607)/7422)/(66/16). -4/9 What is the value of (12/27216/120)/((-18270)/525)? -2/87 Evaluate 202608/603(-2)/(-24). 28 What is the value of 1/7((-302)/453)/((-8)/(-42))76? -38 Evaluate (16/((-3)/(-6)-3))/(74(-152)/33744). 32 ((-8)/((-1824)/(-4)))/((-22)/132) 2/19 What is the value of (-5)/(-2501)374/(-187)? -1/25 Calculate (420/(-3640))/((-2)/24(-18)/(-8)). 8/13 ((-8)/2)/(4581/1018((-4)/153)/(-1)) -34 Evaluate 32/13-32543/(-1075). 32 Calculate (7728/920(-40)/14)/((-6)/9). 36 What is ((-35)/(-15))/(74501/2202)? 2/29 Evaluate (-816)/(-1224)63/(-28)(-138)/(-9). -23 What is the value of -70(1716/(-104))/33? 35 Evaluate (-11174/(-3190))/(1104/40). 1/46 Evaluate 6(-525)/264621. -25 What is the value of (-306)/(-108)1050/((-250)/(-10))? 119 Evaluate 9/(-297)12(-108)/(-288)8/138. -2/253 43665/(-2911)184/(-24) 115 Evaluate ((-1)/(-3))/1-7(-4050)/465031. 63 (-16)/37*((-7)/(-24))/(17668/(-11358)) 3/37 What is the value of 70	{ "pile_set_name": "DM Mathematics" }
7/2, 2, 0.2, -12.65 in increasing order. -12.65, -7/2, 0.2, 2 Put -7, -27, 35, 3, -3, 4 in descending order. 35, 4, 3, -3, -7, -27 Sort -4, 13, -1/2, -5, 21/23 in increasing order. -5, -4, -1/2, 21/23, 13 Sort 1, -1/7, 3/10, -131, -2 in decreasing order. 1, 3/10, -1/7, -2, -131 Sort -3, -12, 2751 in increasing order. -12, -3, 2751 Put 2/501, -4/11, 89, 5 in increasing order. -4/11, 2/501, 5, 89 Sort 19, 0.043, -1. -1, 0.043, 19 Put 5/3, 3, 26, 0.5, 6, -5/7 in decreasing order. 26, 6, 3, 5/3, 0.5, -5/7 Sort -4, 4, 1333264. -4, 4, 1333264 Put 4, 337, 6, 1 in descending order. 337, 6, 4, 1 Put -10, 1/30, -14 in increasing order. -14, -10, 1/30 Put 4, -12/53, 8/7, -1 in increasing order. -1, -12/53, 8/7, 4 Sort 8/5, -7, 4, -1/3, -2/3, 0.2 in decreasing order. 4, 8/5, 0.2, -1/3, -2/3, -7 Put -71, -2, 1386 in decreasing order. 1386, -2, -71 Sort -3, 15065, -1, -5 in decreasing order. 15065, -1, -3, -5 Sort 1, -2, 1/322 in increasing order. -2, 1/322, 1 Sort 1/3, 0.482, -1/2, 0, 4 in decreasing order. 4, 0.482, 1/3, 0, -1/2 Put -16, 82, 1, 6, -4 in increasing order. -16, -4, 1, 6, 82 Put 27, 26, -935 in ascending order. -935, 26, 27 Sort 54, -1, -18, 15, -3. -18, -3, -1, 15, 54 Sort 1, -19, 66619 in increasing order. -19, 1, 66619 Sort 78, 32, 0, -1 in decreasing order. 78, 32, 0, -1 Sort -31, 14, -1, -5, -3, -7 in increasing order. -31, -7, -5, -3, -1, 14 Sort 4, 0, -8, -38, -4. -38, -8, -4, 0, 4 Sort -5, -1/9, -0.279, -1.919 in descending order. -1/9, -0.279, -1.919, -5 Sort -4/3, -16/7, 0.56 in descending order. 0.56, -4/3, -16/7 Put 33, -27, 2, 0, 4 in descending order. 33, 4, 2, 0, -27 Sort -6, -2, 1, 23, -1, 0 in increasing order. -6, -2, -1, 0, 1, 23 Put 8/9, 1, -1/5755, 1/4 in decreasing order. 1, 8/9, 1/4, -1/5755 Put -4, 0.03, 0.055, 21 in decreasing order. 21, 0.055, 0.03, -4 Put 47/4, 85.5, -4 in increasing order. -4, 47/4, 85.5 Put 17, -3, 0, 4, 234, -5 in decreasing order. 234, 17, 4, 0, -3, -5 Sort 89975, 0, -5 in decreasing order. 89975, 0, -5 Sort -5672, -2, -5, 2 in descending order. 2, -2, -5, -5672 Sort 41, -16680, 2 in descending order. 41, 2, -16680 Put -2, 5, -380 in descending order. 5, -2, -380 Sort 3/11, 1/3, -37/4. -37/4, 3/11, 1/3 Sort 2, 0.3448, -13, -1/4, 0.4 in increasing order. -13, -1/4, 0.3448, 0.4, 2 Sort 2, 1, 6, 56, -6, 3. -6, 1, 2, 3, 6, 56 Put 1/2, 20, -487, -4, -1/5, 2 in descending order. 20, 2, 1/2, -1/5, -4, -487 Sort 1, -3, 4, -80754 in decreasing order. 4, 1, -3, -80754 Sort -562.29, 1, -2, -5, -2/15. -562.29, -5, -2, -2/15, 1 Put -3, 5, -5/2, 2, -2361, 1/17 in decreasing order. 5, 2, 1/17, -5/2, -3, -2361 Sort -5, 6, 11, 2, -3, 0 in increasing order. -5, -3, 0, 2, 6, 11 Sort 2/282109, -5, 5 in increasing order. -5, 2/282109, 5 Sort 36, 5, -32/5 in decreasing order. 36, 5, -32/5 Put -1, 4, 5, 3, -309 in ascending order. -309, -1, 3, 4, 5 Put 49, 0.6, 3, -2, 45/4 in ascending order. -2, 0.6, 3, 45/4, 49 Put 42, 70/19, 2/9 in descending order. 42, 70/19, 2/9 Sort -170, -4/13, 0.03 in increasing order. -170, -4/13, 0.03 Sort -3, 36, 4, 1, 633, -5 in increasing order. -5, -3, 1, 4, 36, 633 Put -38, -9, -1 in increasing order. -38, -9, -1 Put -2, 0, -36, 18, -8 in decreasing order. 18, 0, -2, -8, -36 Sort 3, 4, -5, -3, 104, 1 in decreasing order. 104, 4, 3, 1, -3, -5 Put -1/2, -7, 84, 21/5 in descending order. 84, 21/5, -1/2, -7 Put -64, -4, 0, -1, 4, 3 in descending order. 4, 3, 0, -1, -4, -64 Sort 0.5, -4, 2, 1, -1.32, 5 in increasing order. -4, -1.32, 0.5, 1, 2, 5 Put -42, 3.5, 0.2 in descending order. 3.5, 0.2, -42 Put 0.1, 0.21, -10, 0.2, 12/19 in descending order. 12/19, 0.21, 0.2, 0.1, -10 Sort -4, -1, -81, 4, 346, 2 in decreasing order. 346, 4, 2, -1, -4, -81 Sort 0.26, -9, 0.38. -9, 0.26, 0.38 Put 5, 0, 154, -265 in decreasing order. 154, 5, 0, -265 Put 6/1207, -1/5, -3, 0.09 in descending order. 0.09, 6/1207, -1/5, -3 Sort -0.1, -0.2, -15.48, -78 in decreasing order. -0.1, -0.2, -15.48, -78 Put -330, -0.5, 86, 2/11 in decreasing order. 86, 2/11, -0.5, -330 Put -79, 4, 14, -14 in ascending order. -79, -14, 4, 14 Put 7, -0.2, -78/5 in descending order. 7, -0.2, -78/5 Put -379.3, -28, 0.2, 0 in descending order. 0.2, 0, -28, -379.3 Put 6/5, 2, -19017, -0.2 in descending order. 2, 6/5, -0.2, -19017 Put 29, -2, 3, 0, 15 in decreasing order. 29, 15, 3, 0, -2 Put 0.5, -2/9, -9.6, 0.3, 0.01, -1 in increasing order. -9.6, -1, -2/9, 0.01, 0.3, 0.5 Put -1.6, -0.4, -129, -3, -5 in decreasing order. -0.4, -1.6, -3, -5, -129 Put -1/2, 0.182, 1/63 in descending order. 0.182, 1/63, -1/2 Sort 0, -4, -11, 539 in decreasing order. 539, 0, -4, -11 Put 511, -0.137, -2, 0.4 in decreasing order. 511, 0.4, -0.137, -2 Put -3, -0.274, 2/87 in descending order. 2/87, -0.274, -3 Sort 3, 1662, 1.2 in descending order. 1662, 3, 1.2 Put -2, -3, -4, -5, 26, 15 in increasing order. -5, -4, -3, -2, 15, 26 Put 4, 3, -0.1, -0.2, 12 in increasing order. -0.2, -0.1, 3, 4, 12 Sort 0, 3, 3353, -4, -2 in decreasing order. 3353, 3, 0, -2, -4 Put -2/11, -8, -0.159, -0.5, 2 in decreasing order. 2, -0.159, -2/11, -0.5, -8 Put 5, -11.7, 0, 83 in descending order. 83, 5, 0, -11.7 Sort 246, 7, -2/11, 2/9, 0.5, -4 in ascending order. -4, -2/11, 2/9, 0.5, 7, 246 Sort 3, -5/6, 2/5, -2, -3, 6 in descending order. 6, 3, 2/5, -5/6, -2, -3 Put 7, 3/4, 5, -0.6, 1.7 in decreasing order. 7, 5, 1.7, 3/4, -0.6 Put -5, -28, 15, -395 in increasing order. -395, -28, -5, 15 Sort 1360, 4, 0, -2. -2, 0, 4, 1360 Sort -0.07, 1, -3, -92 in descending order. 1, -0.07, -3, -92 Put -5, 4, -3, 0, 73, 14 in ascending order. -5, -3, 0, 4, 14, 73 Put 42, -2, 6.4 in ascending order. -2, 6.4, 42 Put -25, 5, 33 in descending order. 33, 5, -25 Sort 0.1, 23, 7/6, 4, -5, -2 in descending order. 23, 4, 7/6, 0.1, -2, -5 Sort 3354, -1, 10, -3, 5 in descending order. 3354, 10, 5, -1, -3 Put -2/12201, 0.2, 20 in decreasing order. 20, 0.2, -2/12201 Sort 4, 3, -41, -228/17 in decreasing order. 4, 3, -228/17, -41 Put 2, 11, -2, -10, 4 in descending order. 11, 4, 2, -2, -10 Sort 33, 1, 0, -5, -1, 4. -5, -1, 0, 1, 4, 33 Put 8, 23, -30, 0 in descending order. 23, 8, 0, -30 Sort 2, -2, 79, 7 in decreasing order. 79, 7, 2, -2 Put 65, 3, -15, 9, -5 in descending order. 65, 9, 3, -5, -15 Sort -1, -5, 0, -436, 50. -436, -5, -1, 0, 50 Sort -3, -1.6, 357 in descending order. 357, -1.6, -3 Sort -3, 3, -9, 107, -5, -4. -9, -5, -4, -3, 3, 107 Put -23801, -2, 9, 3 in ascending order. -23801, -2, 3, 9 Put -18626, -1, 3 in descending order. 3, -1, -18626 Sort 331, 142, 5. 5, 142, 331 Sort 2/7, 2, -0.06, -1/3, 3, -3246 in decreasing order. 3, 2, 2/7, -0.06, -1/3, -3246 Sort 479.7, -2.6, 4, 12, -5 in decreasing order. 479.7, 12, 4, -2.6, -5 Sort -2, -92.3, 0.04. -92.3, -2, 0.04 Sort 180, -3, 0, -10/9. -3, -10/9, 0, 180 Put -2, 3, 0, -23, 4 in increasing order. -23, -2, 0, 3, 4 Put 185, -15, 4, 0, 2, 1 in decreasing order. 185, 4, 2, 1, 0, -15 Put 0, 59, -3, -35 in descending order. 59, 0, -3, -35 Put 1, 98, -720 in ascending order. -720, 1, 98 Sort 2/818507, -0.2, -0.1. -0.2, -0.1, 2/818507 Put 1, -1, -5936 in descending order. 1, -1, -5936 Put 7, -0.5, -10.746 in increasing order. -10.746, -0.5, 7 Put -6, -3, 6, 20 in decreasing order. 20, 6, -3, -6 Put 2, -0.16, 297, 1/5, 0.5, 1/3 in descending order. 297, 2, 0.5, 1/3, 1/5, -0.16 Sort 0.4, -0.2, 11, 690 in descending order. 690, 11, 0.4, -0.2 Put -5, 5, 266, -8 in increasing order. -8, -5, 5, 266 Sort -5, 136, -14, 10, -4, 2 in descending order. 136, 10, 2, -4, -5, -14 Sort 3/7, -0.24, -1/395. -0.24, -1/395, 3/7 Put -11, -2, 613, 5 in descending order. 613, 5, -2, -11 Sort 0, 93, -5, -2, 51. -5, -2, 0, 51, 93 Sort 0.5, -14, 2/373, 0.4, 4 in increasing order. -14, 2/373, 0.4, 0.5, 4 Put -18, -1/2615, 1 in increasing order. -18, -1/2615, 1 Sort 23608, -2, 5 in decreasing order. 23608, 5, -2 Sort 5, -824, -0.5, 1, 2, -2. -824, -2, -0.5, 1, 2, 5 Put 3, 3849, 41 in increasing order. 3, 41, 3849 Put -9, 3, -0.47, -0.3, 1/7, -4 in increasing order. -9, -4, -0.47, -0.3, 1/7, 3 Sort 3, 1, 76, -32, -5, 4. -32, -5, 1, 3, 4, 76 Put -4, 8, -38623 in increasing order. -38623, -4, 8 Sort 1.7, 16/7, 10. 1.7, 16/7, 10 Sort 3, -15, 174 in descending order. 174, 3, -15 Put 5, 1181, -11 in descending order. 1181, 5, -11 Put -1/6, -0.27, 5, -4, -3, 15/2 in increasing ord	{ "pile_set_name": "DM Mathematics" }
of 9129? 3, 17, 179 What are the prime factors of 99459? 3, 43, 257 List the prime factors of 23794. 2, 11897 List the prime factors of 657. 3, 73 List the prime factors of 9920. 2, 5, 31 What are the prime factors of 888? 2, 3, 37 What are the prime factors of 1536? 2, 3 List the prime factors of 76121. 163, 467 List the prime factors of 6994. 2, 13, 269 What are the prime factors of 3650? 2, 5, 73 What are the prime factors of 727? 727 What are the prime factors of 581? 7, 83 What are the prime factors of 15234? 2, 3, 2539 List the prime factors of 26049. 3, 19, 457 What are the prime factors of 2227? 17, 131 What are the prime factors of 3043? 17, 179 What are the prime factors of 26935? 5, 5387 List the prime factors of 28469. 7, 83 List the prime factors of 6204. 2, 3, 11, 47 List the prime factors of 10687. 10687 What are the prime factors of 33229? 7, 47, 101 List the prime factors of 3793. 3793 List the prime factors of 90626. 2, 113, 401 What are the prime factors of 10486? 2, 7, 107 What are the prime factors of 174? 2, 3, 29 What are the prime factors of 1357? 23, 59 List the prime factors of 1234. 2, 617 List the prime factors of 6530. 2, 5, 653 What are the prime factors of 144542? 2, 72271 List the prime factors of 2452. 2, 613 List the prime factors of 337. 337 What are the prime factors of 30584? 2, 3823 List the prime factors of 248. 2, 31 List the prime factors of 6490. 2, 5, 11, 59 What are the prime factors of 21341? 21341 List the prime factors of 312. 2, 3, 13 List the prime factors of 45784. 2, 59, 97 List the prime factors of 72640. 2, 5, 227 List the prime factors of 23637. 3, 7879 What are the prime factors of 3736? 2, 467 List the prime factors of 6003. 3, 23, 29 List the prime factors of 47. 47 What are the prime factors of 4992? 2, 3, 13 What are the prime factors of 4148? 2, 17, 61 List the prime factors of 1504. 2, 47 What are the prime factors of 21306? 2, 3, 53, 67 What are the prime factors of 1662? 2, 3, 277 What are the prime factors of 56084? 2, 7, 2003 What are the prime factors of 1635? 3, 5, 109 What are the prime factors of 1671? 3, 557 What are the prime factors of 13401? 3, 1489 What are the prime factors of 32889? 3, 19, 577 What are the prime factors of 1923? 3, 641 List the prime factors of 108724. 2, 7, 11, 353 List the prime factors of 708. 2, 3, 59 List the prime factors of 3450. 2, 3, 5, 23 What are the prime factors of 1212? 2, 3, 101 What are the prime factors of 4594? 2, 2297 List the prime factors of 25768. 2, 3221 What are the prime factors of 36920? 2, 5, 13, 71 What are the prime factors of 891? 3, 11 List the prime factors of 11832. 2, 3, 17, 29 What are the prime factors of 24402? 2, 3, 7, 83 What are the prime factors of 14419? 14419 List the prime factors of 888. 2, 3, 37 What are the prime factors of 5621? 7, 11, 73 List the prime factors of 51091. 19, 2689 What are the prime factors of 9713? 11, 883 List the prime factors of 2673. 3, 11 List the prime factors of 122606. 2, 11, 5573 What are the prime factors of 76? 2, 19 List the prime factors of 7071. 3, 2357 List the prime factors of 82. 2, 41 List the prime factors of 10533. 3, 3511 What are the prime factors of 24870? 2, 3, 5, 829 List the prime factors of 176181. 3, 58727 List the prime factors of 2821. 7, 13, 31 List the prime factors of 57048. 2, 3, 2377 What are the prime factors of 111576? 2, 3, 4649 What are the prime factors of 15139? 15139 What are the prime factors of 4059? 3, 11, 41 What are the prime factors of 2266? 2, 11, 103 What are the prime factors of 2086? 2, 7, 149 What are the prime factors of 5329? 73 List the prime factors of 87886. 2, 43943 List the prime factors of 202. 2, 101 What are the prime factors of 878? 2, 439 List the prime factors of 16064. 2, 251 What are the prime factors of 124615? 5, 24923 What are the prime factors of 2648? 2, 331 What are the prime factors of 657? 3, 73 What are the prime factors of 2230? 2, 5, 223 List the prime factors of 1536. 2, 3 What are the prime factors of 1369? 37 What are the prime factors of 713? 23, 31 What are the prime factors of 26136? 2, 3, 11 What are the prime factors of 3601? 13, 277 List the prime factors of 1680. 2, 3, 5, 7 List the prime factors of 179913. 3, 59971 What are the prime factors of 469? 7, 67 What are the prime factors of 13252? 2, 3313 What are the prime factors of 2671? 2671 List the prime factors of 101. 101 What are the prime factors of 74141? 151, 491 What are the prime factors of 563? 563 List the prime factors of 7374. 2, 3, 1229 What are the prime factors of 100763? 13, 23, 337 What are the prime factors of 1991? 11, 181 List the prime factors of 244. 2, 61 List the prime factors of 472. 2, 59 What are the prime factors of 1344? 2, 3, 7 What are the prime factors of 1513? 17, 89 What are the prime factors of 13693? 13693 What are the prime factors of 1639? 11, 149 List the prime factors of 1778. 2, 7, 127 List the prime factors of 23928. 2, 3, 997 List the prime factors of 2664. 2, 3, 37 List the prime factors of 104829. 3, 83, 421 List the prime factors of 13833. 3, 29, 53 List the prime factors of 74844. 2, 3, 7, 11 What are the prime factors of 735? 3, 5, 7 What are the prime factors of 828? 2, 3, 23 What are the prime factors of 124? 2, 31 List the prime factors of 9348. 2, 3, 19, 41 List the prime factors of 2201. 31, 71 List the prime factors of 26322. 2, 3, 41, 107 List the prime factors of 27696. 2, 3, 577 List the prime factors of 13913. 13913 List the prime factors of 14949. 3, 11, 151 List the prime factors of 35986. 2, 19, 947 List the prime factors of 1142. 2, 571 What are the prime factors of 2520? 2, 3, 5, 7 List the prime factors of 68798. 2, 41, 839 What are the prime factors of 41080? 2, 5, 13, 79 What are the prime factors of 148181? 11, 19, 709 List the prime factors of 2155. 5, 431 List the prime factors of 6595. 5, 1319 What are the prime factors of 9389? 41, 229 List the prime factors of 74800. 2, 5, 11, 17 List the prime factors of 57150. 2, 3, 5, 127 What are the prime factors of 54552? 2, 3, 2273 What are the prime factors of 91276? 2, 19, 1201 List the prime factors of 532. 2, 7, 19 List the prime factors of 5478. 2, 3, 11, 83 What are the prime factors of 819? 3, 7, 13 List the prime factors of 820. 2, 5, 41 What are the prime factors of 17922? 2, 3, 29, 103 List the prime factors of 10360. 2, 5, 7, 37 List the prime factors of 917. 7, 131 List the prime factors of 632. 2, 79 List the prime factors of 2142. 2, 3, 7, 17 What are the prime factors of 9006? 2, 3, 19, 79 List the prime factors of 11589. 3, 3863 What are the prime factors of 15192? 2, 3, 211 What are the prime factors of 11342? 2, 53, 107 List the prime factors of 6329. 6329 What are the prime factors of 839? 839 What are the prime factors of 6462? 2, 3, 359 What are the prime factors of 8787? 3, 29, 101 List the prime factors of 5026. 2, 7, 359 What are the prime factors of 39677? 11, 3607 What are the prime factors of 1972? 2, 17, 29 What are the prime factors of 1136? 2, 71 What are the prime factors of 23020? 2, 5, 1151 List the prime factors of 36086. 2, 18043 What are the prime factors of 24795? 3, 5, 19, 29 What are the prime factors of 10301? 10301 List the prime factors of 7968. 2, 3, 83 List the prime factors of 18488. 2, 2311 What are the prime factors of 18937? 29, 653 List the prime factors of 12396. 2, 3, 1033 What are the prime factors of 12251? 12251 List the prime factors of 1618. 2, 809 What are the prime factors of 90636? 2, 3, 7, 13, 83 List the prime factors of 6036. 2, 3, 503 List the prime factors of 763. 7, 109 What are the prime factors of 22546? 2, 11273 List the prime factors of 31300. 2, 5, 313 List the prime factors of 180. 2, 3, 5 List the prime factors of 4293. 3, 53 What are the prime factors of 1083? 3, 19 List the prime factors of 3129. 3, 7, 149 What are the prime factors of 1269? 3, 47 List the prime factors of 2684. 2, 11, 61 What are the prime factors of 151? 151 What are the prime factors of 5601? 3, 1867 What are the prime factors of 308? 2, 7, 11 List the prime factors of 17988. 2, 3, 1499 List the prime factors of 76681. 11, 6971 List the prime factors of 11049. 3, 29, 127 List the prime facto	{ "pile_set_name": "DM Mathematics" }
th smallest value? (a) -1 (b) h (c) 2 (d) 0.1 (e) -0.2 c Let x = -0.23 + -0.07. Let s be (-1)/(-2)(-12 - (-4117)/345). What is the third biggest value in x, s, -3? -3 Let i = 3.5 + -3. Let k = -1919.28 + 2128.3. Let n = 209 - k. Which is the third biggest value? (a) n (b) -0.5 (c) i (d) -1/3 d Let l be (28/(-24))/(((-756)/(-24))/(-9)). Let r = -0.8 + 1. Which is the third smallest value? (a) r (b) l (c) 0.5 c Let h = 0.422 + -4.392. Let j = 0.97 + h. What is the second biggest value in j, 0.03, -2/3, -4/5? -2/3 Let c be (-4)/(-18) + 8/(-90). Let j(f) = 14f - 16. Let q be j(1). Let a be 4 + 1032/(-270) + q/5. What is the third biggest value in -0.3, a, 0.5, c? a Suppose -4d - 3q + 718 = -455, 2d + 5q - 583 = 0. Let l = 1763/6 - d. What is the fourth smallest value in -27, 0.2, -5, l? 0.2 Let m = 1.93 + -1.9. Let k = 8.29 - 8.49. Let l = 0.5 - 0.5. What is the second smallest value in m, k, l? l Let u = -1.05706 - -0.05706. Which is the third biggest value? (a) 1/9 (b) u (c) 1 b Let k be (-14)/6 + 39/13. Let j = -3 - -3.08. Let o = j + 0.32. What is the second smallest value in o, -1, k, -7? -1 Let p = 56 - 29. Let q = 27 - p. Suppose 0 = 4y - u + 1, 2u - 7 = 3y. Which is the smallest value? (a) q (b) y (c) 2 a Let w = -204/35 - -45/7. Let n = 3364 + -3366. What is the second biggest value in -1, -3/4, n, w? -3/4 Let o = 3.2076 - -0.0024. Let j = o - 0.21. Let r = 1.016 - 1.416. Which is the fourth smallest value? (a) r (b) -4/5 (c) j (d) 1/9 c Let n = 3671.2 - 3671. Which is the second biggest value? (a) 1/3 (b) n (c) 7.2 a Let s = 1/334 - -77/2171. Let l = 6/13 + s. Let n be 16/(-6) + 2 - 40/30. Which is the second smallest value? (a) -1/11 (b) l (c) n a Let y = 6.9 - 3.9. Let u = -0.1543 - -0.0543. Which is the smallest value? (a) u (b) y (c) 2 a Let i = -16291 - -16290.7. Which is the third smallest value? (a) 3/5 (b) i (c) -2/13 (d) -2/121 d Let q = 691 - 691.411. Let z = -0.311 - q. Let g = -9 - -4. Which is the smallest value? (a) g (b) -3/4 (c) z (d) -3 a Let n = 8.2 - 7.9. Let j be 3/(-6)-1-3. Which is the fourth smallest value? (a) j (b) n (c) 0 (d) 4 d Suppose -15 = r - 4d, -3r - 3d = -6r. Let z be 4(180/88 + -2). Let m = 19/44 - z. What is the third biggest value in r, -2/3, m? -2/3 Let p = 0.4 - 0.8. Suppose -12 = 27u + 150. Let k be (u/9)/((-16)/56). Which is the third biggest value? (a) k (b) 0.4 (c) p c Let j = 3452 + -3122. Which is the second smallest value? (a) 2/11 (b) j (c) 2/7 c Let m = -8.22 + 8.42. Which is the third biggest value? (a) -2 (b) 2 (c) m (d) -51/2 a Let n = 198 - 118. Let z = 98 - n. Which is the smallest value? (a) 0.2 (b) z (c) 4 (d) 0 d Let b = -9333.2 - -9333. What is the fourth smallest value in -2, -1, b, 19/2, 2/5? 2/5 Let s = 423 + -425. Which is the third biggest value? (a) 4/3 (b) s (c) 4 (d) -3 (e) 7/2 a Let h = 18 - 17.6. Let g = -620 + 1093. Let n = g + -3305/7. Which is the third smallest value? (a) h (b) 0.5 (c) 4 (d) n d Let u = 248 + -248.363. Let z = u + 0.263. Which is the fourth biggest value? (a) z (b) 0.3 (c) -19 (d) 2/3 c Suppose -5k + 3u + 12 = 0, k + 11 = 5k - u. Let t be (5 - k) + 10/(-8). Suppose -149w - 40 = -129w. Which is the second biggest value? (a) 4 (b) t (c) w b Let k be 7 - (-6)/54-18. What is the fourth smallest value in 3, k, -5, 447? 447 Let x be (-9)/(11 + -8)7/21. Which is the second biggest value? (a) x (b) -0.1 (c) 1/10 (d) 2/23 (e) -1/3 d Suppose 2g - 8 = -4h, -5h + g - 17 = -g. What is the third biggest value in -4, h, -26, -2, -0.5? -2 Let m = -4.241 + 5.141. What is the second biggest value in -4/7, -18/19, m? -4/7 Let j be 2/(-5)(-20)/6. Let d = -1954 + 1954.3. Let x = 3.93 - -0.07. What is the second smallest value in d, -3, j, x? d Let t = 70.82 + -71.04. What is the biggest value in 2, -35, t? 2 Let r be 48995/(-325) - 9/(-15). Let u = -150 - r. Let z be 1/(-14)8/(-2). Which is the third biggest value? (a) z (b) -2/9 (c) -0.2 (d) u c Let g = 286.346 + -286. Let j = -0.154 - g. Suppose -7 = -2x - 3z, -x + 2x + 2z - 6 = 0. Which is the smallest value? (a) x (b) 2/11 (c) j (d) 5 a Let w = 3454 + -3458.9. Which is the second smallest value? (a) w (b) 1/2 (c) -1 c Let o = 42092 + -42092.3. Let h = -2 - -1. Which is the third biggest value? (a) 1.8 (b) -4 (c) o (d) h d Let l(q) = -2q*2 + 57q + 219. Let t be l(32). Which is the biggest value? (a) 0.2 (b) t (c) 193 (d) 5 c Suppose 15 = o + 4y, 5o - 3o + 9 = 5y. Let t = 7709 - 7699. Which is the second biggest value? (a) t (b) -1 (c) o c Let f = -0.34 + 0.34. Let c = 9.03 + -12.03. What is the smallest value in c, -2/17, f? c Let h = 13.2 + -1.2. Let u = h + -16. Which is the second smallest value? (a) -2/7 (b) u (c) 1/8 (d) -0.5 d Let u = -1018/15 - -68. Let z = -2.96 - -2.8. Let v = z + 9.16. What is the third smallest value in u, v, 0.3, 3? 3 Let z be (-1275)/(-3740) - (-2)/(-8). Let k be -5 - (-2 - -2 - 3). Let r be k + 3/((-6)/(-4)). Which is the second biggest value? (a) z (b) r (c) -2 b Let n = -0.0151 - 3.9849. What is the second smallest value in -0.02, n, -1/293? -0.02 Let t = -0.7742 - 61.2258. What is the second smallest value in t, 4, -2? -2 Suppose m + 1 = 3q - 1, 20 = -4m. Let a be q - (100/55 - 3). What is the biggest value in 0.5, -2, a, -3? 0.5 Let s = 6898 + -6971. Which is the third smallest value? (a) s (b) -4/9 (c) -0.1 c Let n(g) = 10g - 9. Let u be n(1). Let o be (-2)/(-3)(u - (-13)/(-22)). Let z = o + -23/44. Which is the biggest value? (a) z (b) -3 (c) 6 c Let g = -18.3 + 18.7. Suppose -56y + 26 = -43y. Let k(h) = h*3 - 4h*2. Let m be k(4). Which is the second biggest value? (a) m (b) g (c) y (d) -15 b Let o be (4/(-28))/(1/2). Let s be (-18)/484((-76)/(-57) - -6). Which is the second smallest value? (a) -0.4 (b) s (c) o (d) 0 a Suppose -46 = -6r - 70 - 42. Which is the second smallest value? (a) 29 (b) 0.3 (c) 4/3 (d) -2 (e) r d Let w be (1/2(-31)/62)/1. Let i = -3.5 - -4. What is the second biggest value in w, -17, 1/4, i? 1/4 Let f(t) be the second derivative of t4/12 - t3/2 - 5t*2 - t - 30. Let r be f(5). What is the fourth biggest value in r, 5.4, -3, 0.3? -3 Suppose -3n + 3o - 546 = 945, 0 = -3n + 4o - 1487. Let i = -507 - n. Which is the biggest value? (a) 0 (b) -2/11 (c) i (d) 0.5 d Let r = 24184 - 24184. Let f be 2 - (-3 - 136/(-26)). What is the smallest value in r, 0.3, f? f Let s = 9.178 + -8.518. Which is the biggest value? (a) s (b) 5 (c) 1/4 (d) 12 d Let u = 142 + -223. Let w = u - -81.012. Let m = w - -0.088. What is the second biggest value in -0.2, m, 0? 0 Let i = 3.177 + -1.177. Which is the fourth biggest value? (a) -19 (b) -4/7 (c) i (d) -1/3 a Let g = -440.123 - -440. Let x = -14.977 + 15. Let h = x + g. Which is the third biggest value? (a) h (b) -2 (c) -1/5 (d) 4 c Let j = 15347.99 + -15348. What is the second smallest value in j, 361, 0? 0 Let q = -7748 + 54233/7. Let h be (-1 - 39/(-42))2. Let n = 0.8 + -0.3. Which is the smallest value? (a) h (b) -0.2 (c) n (d) q d Let l(v) = v*2 + 30v - 876. Let y be l(18). What is the fifth biggest value in -0.3, 0.1, -1/3, -2, y? y Let m(h) = 30 + 14 + 20 - 3h + 7h. Let g be m(-12). Suppose g = -15f + 11f. Which is the third biggest value? (a) -1/2 (b) 2 (c) f (d) -2/7 a Let c = 154/13 - 2336/195. Let p = -299 - -299.5. Suppose -3a = -5 - 1, 6l + 2 = -5a. What is the smallest value in p, l, 2/19, c? l Suppose 9k - 519 = 93. Let a = k + -68. What is the smallest value in a, -1/3, -1, 5? -1 Let l be (-4)/(-8)(-53 + 52). Which is the third biggest value? (a) -5/3 (b) l (c) 2 (d) -19 a Let s = 15647 + -15731. What is the third biggest value in 1, s, -4/7? s Let k be 5(-5)/70 + (-2)/14. Suppose 0a - 4g = 4a + 12, 2a - 2g + 14 = 0. What is the second biggest value in a, 5, k? k Let i = 20237.9 + -20238. What is the third smallest value in 0.1206, 0.2, i, -2? 0.1206 Let r = 12556 - 12553. Which is the smallest value? (a) 3248 (b) -3 (c) r b Let h be -219/(-27 + 8). What is the third smallest value in h, -0.37, 36/7, 1? h Let s(u) = 18u3 - 990u**2 - 5. Let h be s(55). Which is the fourth bigges	{ "pile_set_name": "DM Mathematics" }
1893 a multiple of 13? False Does 14 divide 1241777? False Does 101 divide 116286? False Is 8 a factor of 10145984? True Is 10 a factor of 10734133? False Does 319 divide 1734083? False Does 28 divide 66005? False Is 77 a factor of 485254? True Is 781454 a multiple of 7? False Does 166 divide 458577? False Is 48818 a multiple of 14? True Is 66 a factor of 1091970? True Does 12 divide 72768? True Is 171 a factor of 2747336? False Is 313690 a multiple of 68? False Does 396 divide 1308526? False Is 2765373 a multiple of 559? True Does 15 divide 135883? False Does 519 divide 8584316? False Does 527 divide 7249318? False Does 232 divide 6714264? False Is 464590 a multiple of 14? True Is 9 a factor of 442593? True Is 44 a factor of 185108? True Is 128 a factor of 125952? True Does 207 divide 6497937? True Is 1167586 a multiple of 14? True Is 5097888 a multiple of 571? True Does 157 divide 362188? False Is 234325 a multiple of 91? True Does 115 divide 74980? True Is 10 a factor of 833393? False Does 70 divide 9454270? True Does 734 divide 5826328? False Is 24 a factor of 5894308? False Does 2189 divide 11820600? True Is 11 a factor of 295064? True Is 24480 a multiple of 17? True Is 16 a factor of 31664? True Is 1778715 a multiple of 45? True Is 3768864 a multiple of 66? True Is 8 a factor of 508352? True Is 131 a factor of 424446? False Is 83748 a multiple of 2? True Is 109381 a multiple of 54? False Is 232 a factor of 152424? True Does 15 divide 217620? True Does 9 divide 25761? False Is 416059 a multiple of 35? False Does 853 divide 17836887? False Is 17 a factor of 35903? False Is 4127735 a multiple of 297? False Is 12 a factor of 765094? False Is 61 a factor of 745176? True Is 355755 a multiple of 111? True Is 183 a factor of 11874557? False Is 125 a factor of 7072668? False Does 3 divide 68322? True Does 159 divide 9524211? False Does 1165 divide 20641470? True Does 71 divide 110973? True Is 2014 a multiple of 53? True Is 118005 a multiple of 25? False Is 106392 a multiple of 78? True Is 3184076 a multiple of 438? False Does 119 divide 1899854? False Is 590052 a multiple of 12? True Is 74 a factor of 874680? True Is 110 a factor of 382202? False Is 80444 a multiple of 26? True Is 9984438 a multiple of 18? True Is 196150 a multiple of 2? True Does 61 divide 98033? False Is 16100 a multiple of 13? False Is 29 a factor of 1790257? True Is 2513856 a multiple of 8? True Is 19 a factor of 42988? False Is 762 a factor of 2362962? True Does 5 divide 443645? True Does 3 divide 1298231? False Does 108 divide 1480958? False Does 171 divide 4353831? True Does 13 divide 93424? False Is 38997 a multiple of 2? False Is 816595 a multiple of 65? True Is 93 a factor of 38302? False Does 136 divide 19312? True Does 16 divide 24343663? False Is 175 a factor of 131312? False Is 168410 a multiple of 11? True Does 242 divide 726? True Does 19 divide 283309? True Is 812896 a multiple of 76? True Is 225277 a multiple of 189? False Is 192 a factor of 937927? False Is 14 a factor of 84588? True Is 5631080 a multiple of 14? True Does 10 divide 218243? False Is 270873 a multiple of 17? False Is 2 a factor of 3077429? False Is 66 a factor of 1168464? True Is 27210 a multiple of 6? True Is 13838160 a multiple of 22? False Does 48 divide 9716? False Is 71 a factor of 707089? True Does 64 divide 657664? True Does 841 divide 21806289? True Is 140 a factor of 1701146? False Does 12 divide 676032? True Is 207945 a multiple of 14? False Does 44 divide 811580? True Is 224 a factor of 2636575? False Is 40 a factor of 149478? False Is 1936421 a multiple of 155? False Does 106 divide 81264? False Is 10868 a multiple of 22? True Is 41175 a multiple of 45? True Is 43 a factor of 128621? False Is 2186485 a multiple of 35? True Does 4 divide 1162436? True Does 378 divide 521640? True Does 91 divide 114478? True Does 67 divide 650972? True Does 56 divide 475384? True Is 14 a factor of 2043900? False Does 68 divide 271361? False Is 23 a factor of 336616? False Is 13606514 a multiple of 7? False Is 78980 a multiple of 265? False Is 970752 a multiple of 158? True Does 154 divide 2496032? True Does 24 divide 5381184? True Is 17370 a multiple of 21? False Does 7 divide 59120? False Does 22 divide 894644? False Does 46 divide 250286? True Is 57 a factor of 2897595? True Is 148249 a multiple of 3? False Does 20 divide 122543? False Is 16936 a multiple of 72? False Is 604990 a multiple of 599? True Does 73 divide 180797? False Is 445 a factor of 439908? False Is 28 a factor of 59976? True Is 125 a factor of 119559? False Is 65151 a multiple of 19? True Does 398 divide 26208478? False Is 4209 a multiple of 2? False Does 127 divide 1275618? False Is 256 a factor of 273317? False Does 20 divide 750240? True Is 11 a factor of 405229? True Is 35037 a multiple of 19? False Is 89 a factor of 168121? True Does 369 divide 25419303? True Is 35 a factor of 275875? False Does 176 divide 7241520? True Is 159 a factor of 380964? True Is 408450 a multiple of 1167? True Is 30 a factor of 228962? False Is 13439469 a multiple of 51? True Is 1432 a factor of 12585848? True Is 2954328 a multiple of 1028? False Is 2 a factor of 6289? False Is 1127046 a multiple of 64? False Does 93 divide 1360311? True Is 10 a factor of 494071? False Does 83 divide 676616? True Does 14 divide 10363042? False Does 3 divide 15023? False Is 179 a factor of 250247? False Is 488797 a multiple of 12? False Is 40 a factor of 2135720? True Is 1455 a multiple of 4? False Is 2 a factor of 71858? True Is 11531043 a multiple of 57? True Is 188 a factor of 710640? True Does 69 divide 334167? True Is 7 a factor of 207257? False Is 277160 a multiple of 13? True Is 44687 a multiple of 102? False Is 169 a factor of 130130? True Does 15 divide 561885? True Does 22 divide 24222? True Is 14 a factor of 421092? True Is 199102 a multiple of 47? False Is 8 a factor of 14592? True Does 63 divide 24580298? False Is 630 a multiple of 5? True Does 15 divide 58530? True Is 17 a factor of 1363315? True Is 237667 a multiple of 271? True Does 12 divide 15891? False Is 497092 a multiple of 8? False Is 29 a factor of 114280? False Is 233709 a multiple of 50? False Does 3 divide 4005754? False Is 27 a factor of 54189? True Does 14 divide 14493010? True Does 7 divide 8978600? False Does 19 divide 6122256? True Is 14 a factor of 96544? True Is 4 a factor of 75252? True Is 27 a factor of 295326? True Is 405 a factor of 9184774? False Is 51 a factor of 23154? True Does 7 divide 6710220? False Is 547074 a multiple of 25? False Is 1279634 a multiple of 16? False Does 217 divide 243084? False Is 22 a factor of 298408? True Is 1038425 a multiple of 365? True Does 66 divide 120780? True Does 1275 divide 15242625? True Is 215138 a multiple of 154? True Is 281815 a multiple of 12? False Is 3114038 a multiple of 10? False Is 516014 a multiple of 110? False Is 106359 a multiple of 2? False Does 43 divide 5186887? False Is 126 a factor of 4487742? True Does 880 divide 11685520? True Is 11 a factor of 73447? True Does 125 divide 14236? False Is 13 a factor of 106312? False Is 34 a factor of 49708? True Is 1720723 a multiple of 127? True Does 20 divide 2599703? False Is 27 a factor of 8692918? False Is 494363 a multiple of 7? False Is 9950 a multiple of 5? True Does 5 divide 50350? True Is 484228 even? True Is 2127 even? False Is 336580 a multiple of 42? False Does 4 divide 430990? False Does 86 divide 294206? True Is 678208 a multiple of 14? False Is 1496 a multiple of 11? True Is 126 a factor of 928620? True Does 3 divide 14649? True Does 176 divide 37664? True Is 8 a factor of 1002343? False Is 257 a factor of 716002? True Is 172 a factor of 281684? False Is 565676 a multiple of 412? True Is 11 a factor of 13827? True Is 11628 a multiple of 38? True Is 9 a factor of 210671? False Does 30 divide 288210? True Is 2220676 a multiple of 68? True Is 11 a factor of 1832067? False Does 620 divide 329245? False Does 33 divide 98307? True Is 99221 a multiple of 206? False Is 225837 a multiple of 9? True Is 217 a factor of 232624? True Is 76995 a multiple of 87? True Is 245525 a multiple of 35? True Is 159320 a multiple of 7? True Is 50890 a multiple of 140? False Is 15 a factor of 59507	{ "pile_set_name": "DM Mathematics" }
07, -4502, -7777, -12348, -18431? -36m3 + m - 7 What is the l'th term of -2386, -4774, -7162? -2388l + 2 What is the k'th term of -152, -408, -824, -1394, -2112, -2972, -3968? k*3 - 86k*2 - 5k - 62 What is the m'th term of 9092, 9078, 9060, 9044, 9036? m*3 - 8m*2 + 3m + 9096 What is the y'th term of 60, 149, 224, 279, 308, 305? -y3 - y2 + 99y - 37 What is the c'th term of -21, 3, 27, 51? 24c - 45 What is the u'th term of -29, -40, -63, -104, -169, -264? -u*3 - 4u - 24 What is the r'th term of 318, 638, 958, 1278, 1598, 1918? 320r - 2 What is the s'th term of -208, -430, -666, -922, -1204? -s3 - s2 - 212s + 6 What is the k'th term of 326, 330, 334, 338, 342? 4k + 322 What is the r'th term of 121, 238, 355? 117r + 4 What is the t'th term of -5, 21, 93, 235, 471, 825? 4t3 - t2 + t - 9 What is the w'th term of 347, 700, 1059, 1424, 1795, 2172, 2555? 3w*2 + 344w What is the t'th term of 68, 70, 72, 74, 76, 78? 2t + 66 What is the p'th term of 1416, 1418, 1420? 2p + 1414 What is the h'th term of 5419, 5416, 5411, 5404, 5395? -h2 + 5420 What is the w'th term of -11, -18, -11, 16, 69, 154, 277, 444? w3 + w*2 - 17w + 4 What is the o'th term of 2, 0, -4, -10? -o*2 + o + 2 What is the c'th term of -21, -100, -313, -726, -1405? -11c3 - c2 + c - 10 What is the x'th term of -5, -13, -35, -77, -145? -x3 - x2 + 2x - 5 What is the u'th term of 86, 136, 218, 332, 478, 656, 866? 16u*2 + 2u + 68 What is the j'th term of -1, 38, 105, 200, 323, 474, 653? 14j2 - 3j - 12 What is the d'th term of 97, 194, 293, 394, 497, 602, 709? d*2 + 94d + 2 What is the i'th term of 36, 43, 54, 69, 88, 111, 138? 2i2 + i + 33 What is the w'th term of -46, -38, -18, 20, 82, 174, 302, 472? w3 + w - 48 What is the w'th term of -2600, -2598, -2594, -2588? w2 - w - 2600 What is the x'th term of -14091, -14087, -14073, -14043, -13991, -13911, -13797? x3 - x2 - 14091 What is the w'th term of 81, 160, 239, 318, 397, 476? 79w + 2 What is the q'th term of 676, 1350, 2024? 674q + 2 What is the q'th term of -62, -276, -646, -1172, -1854, -2692, -3686? -78q*2 + 20q - 4 What is the z'th term of 2263, 2264, 2265, 2266? z + 2262 What is the g'th term of 1205, 2412, 3619, 4826? 1207g - 2 What is the a'th term of -944, -943, -942, -941, -940, -939? a - 945 What is the r'th term of -633, -632, -631? r - 634 What is the i'th term of 343, 693, 1043, 1393? 350i - 7 What is the i'th term of -25, -42, -49, -28, 39? 3i3 - 13i2 + i - 16 What is the h'th term of 26, 33, 38, 41, 42? -h2 + 10h + 17 What is the a'th term of 346, 1375, 3090, 5491, 8578? 343a2 + 3 What is the w'th term of -90, -111, -134, -159, -186, -215? -w2 - 18w - 71 What is the m'th term of -76, -88, -102, -118, -136? -m2 - 9m - 66 What is the b'th term of -23, -13, 3, 25, 53? 3b2 + b - 27 What is the q'th term of 31, 43, 67, 103, 151, 211, 283? 6q*2 - 6q + 31 What is the m'th term of -22, -24, -26? -2m - 20 What is the k'th term of -32, -106, -236, -428, -688, -1022, -1436, -1936? -k3 - 22k*2 - k - 8 What is the j'th term of -25, -29, -33, -37, -41? -4j - 21 What is the f'th term of -16, -30, -60, -112, -192, -306? -f*3 - 2f2 - f - 12 What is the n'th term of 312, 311, 304, 285, 248? -n3 + 3n2 - 3n + 313 What is the m'th term of 3075, 6148, 9221, 12294, 15367? 3073m + 2 What is the u'th term of -183, -699, -1543, -2703, -4167, -5923? 2u*3 - 176u*2 - 2u - 7 What is the k'th term of -132, -547, -1240, -2211, -3460? -139k2 + 2k + 5 What is the d'th term of -1174, -1170, -1162, -1150, -1134, -1114? 2d2 - 2d - 1174 What is the z'th term of 29, 56, 101, 164, 245? 9z2 + 20 What is the m'th term of 109, 100, 79, 40, -23? -m3 - 2m + 112 What is the y'th term of 163, 159, 153, 145, 135, 123, 109? -y*2 - y + 165 What is the a'th term of 5691, 11380, 17069, 22758? 5689a + 2 What is the r'th term of 36, 139, 302, 519, 784, 1091, 1434, 1807? -r*3 + 36r*2 + 2r - 1 What is the i'th term of 114, 209, 316, 441, 590, 769? i*3 + 88i + 25 What is the m'th term of 2499, 2493, 2483, 2469, 2451, 2429, 2403? -2m2 + 2501 What is the v'th term of 148, 290, 430, 568, 704? -v2 + 145v + 4 What is the k'th term of -4, -15, -26? -11k + 7 What is the n'th term of -503, -515, -537, -575, -635? -n3 + n2 - 8n - 495 What is the q'th term of 45, 46, 49, 54? q*2 - 2q + 46 What is the m'th term of 333, 317, 275, 195, 65, -127, -393, -745? -2m3 - m2 + m + 335 What is the o'th term of 3, 64, 233, 564, 1111? 9o*3 - 2o - 4 What is the b'th term of 757, 756, 755, 754, 753, 752? -b + 758 What is the w'th term of 36, 102, 204, 342, 516? 18w2 + 12w + 6 What is the k'th term of -1912, -3812, -5722, -7648, -9596, -11572, -13582? -k3 + k2 - 1896k - 16 What is the p'th term of -102, -207, -310, -411, -510? p2 - 108p + 5 What is the c'th term of -73, -66, -59, -52? 7c - 80 What is the u'th term of -677, -641, -605? 36u - 713 What is the g'th term of 29, 41, 61, 89, 125, 169, 221? 4g2 + 25 What is the t'th term of 195, 208, 229, 258, 295, 340, 393? 4t2 + t + 190 What is the z'th term of 27, 51, 77, 105, 135, 167, 201? z2 + 21z + 5 What is the b'th term of -188, -178, -156, -116, -52? b3 + 3b - 192 What is the t'th term of -633, -632, -631, -630? t - 634 What is the s'th term of 756, 729, 700, 669, 636, 601, 564? -s*2 - 24s + 781 What is the n'th term of 820, 3303, 7450, 13267, 20760, 29935, 40798? n*3 + 826n*2 - 2n - 5 What is the l'th term of 9, 12, 15? 3l + 6 What is the x'th term of -41, -153, -349, -635, -1017? -x3 - 36x*2 + 3x - 7 What is the x'th term of 974, 1949, 2924? 975x - 1 What is the r'th term of -46, -89, -132, -175? -43r - 3 What is the o'th term of -14, -6, 38, 136, 306? 3o3 - 13o - 4 What is the c'th term of -145, -284, -425, -568, -713? -c*2 - 136c - 8 What is the u'th term of -69, -129, -189? -60u - 9 What is the x'th term of -8, -75, -188, -347, -552, -803, -1100? -23x*2 + 2x + 13 What is the g'th term of 38, 67, 96, 125? 29g + 9 What is the h'th term of -21, -61, -103, -147, -193, -241? -h2 - 37h + 17 What is the f'th term of -57, -549, -1905, -4557, -8937, -15477? -72f3 + 12f + 3 What is the l'th term of 9, -1, -23, -63, -127, -221, -351? -l*3 - 3l + 13 What is the p'th term of 513, 512, 511, 510? -p + 514 What is the m'th term of -731, -735, -749, -779, -831? -m3 + m2 - 731 What is the n'th term of 59, 74, 89, 104, 119, 134? 15n + 44 What is the p'th term of -17068, -17069, -17070? -p - 17067 What is the h'th term of -559, -558, -557? h - 560 What is the q'th term of -843, -842, -841, -840, -839? q - 844 What is the n'th term of -49, -53, -57, -61? -4n - 45 What is the c'th term of -5219, -5211, -5189, -5147, -5079, -4979, -4841? c3 + c2 - 2c - 5219 What is the n'th term of 73, 166, 247, 310, 349, 358? -n3 + 100n - 26 What is the m'th term of 15, 61, 141, 261, 427, 645, 921? m*3 + 11m*2 + 6m - 3 What is the j'th term of 832, 1664, 2496, 3328? 832j What is the n'th term of -18, -124, -404, -942, -1822, -3128, -4944? -14n*3 - 3n2 + n - 2 What is the r'th term of 9, 35, 77, 141, 233? r3 + 2r2 + 13r - 7 What is the c'th term of 56, 121, 186? 65c - 9 What is the s'th term of -27, -45, -63, -81, -99, -117? -18s - 9 What is the q'th term of 21, 72, 161, 294, 477, 716, 1017? q*3 + 13q*2 + 5q + 2 What is the s'th term of 1161, 1171, 1195, 1239, 1309, 1411, 1551, 1735? s3 + s2 + 1159 What is the k'th term of 21, 24, 27, 30, 33? 3k + 18 What is the t'th term of -693, -697, -713, -747, -805, -893, -1017, -1183? -t3 + 3t - 695 What is the o'th term of -11, -13, -13, -11, -7, -1? o*2 - 5o - 7 What is the a'th term of 277, 288, 299, 310, 321, 332? 11a + 266 What is the r'th term of 451, 906, 1361, 1816, 2271? 455r - 4 What is the h'th term of 4705, 9400, 14081, 18742, 23377? -h3 - h2 + 4705h + 2 What is the n'th term of 0, 21, 28, 15, -24, -95, -204, -357? -n3 - n2 + 31n - 29 What is the v'th term of -87, -152, -215, -276, -335, -392? v*2 - 68v - 20 What is the a'th term of 13, 33, 91, 205, 393, 673, 1063? 3a3 + a2 - 4a + 13 What is the b'th term of 16, 24, 46, 88, 156, 256, 394? b*3 + b	{ "pile_set_name": "DM Mathematics" }
multiple of 20 and (4 - l)/((-2)/28). 140 Let p(q) = -q - 5. Let v(l) = -l - 5. Let s(b) = -3p(b) + 2v(b). What is the lowest common multiple of 9 and s(6)? 99 Let l = -4497/3514 + -3/502. Let m = -340 + 2003/6. Find the common denominator of l and m. 42 Calculate the least common multiple of (6 - 8)/(-12) and 7. 7 Let c = 3 + 12. Let p be c(370/(-3))/5. What is the common denominator of p/(-55)(-1)/(-2) and -89/4? 44 Suppose -11698 = -5k - 3723. Suppose k = 4c - m, -2m - 1993 = -5c - 0m. What is the common denominator of (-2)/8 - c/(-36) and 55/6? 6 What is the common denominator of (1/(-18))/((-8)/(-69))-3 and 101/30? 240 Suppose 3z + 1 - 17 = 5k, 3k = -3z. What is the common denominator of 115/14 and k? 14 Let o = -1667 - -13239/8. What is the common denominator of -95/106 and o? 424 What is the common denominator of -2(-1 - 174/8) and 45/12(-3)/30? 8 Let d be 82/66/59. Let n = d - -2494/413. Let z = -3415/388 + 5/97. What is the common denominator of n and z? 28 Suppose 2v - 38 + 14 = 0. Let b(o) = -o + 20. What is the lowest common multiple of b(0) and v? 60 Let r be 2 - 6(-2)/(-4). Let a be (-1 + (r - -2))/(-2). Suppose -n + an = 4b - 11, -5n = -3b - 9. Calculate the common denominator of b and 12/11. 11 Calculate the common denominator of 18/12 - (-471)/(-54) and -53/6. 18 Let t be (7/(-2))/((-2)/(-4)). Let n = t - -19. Calculate the least common multiple of 16 and n. 48 Suppose 3p + 0p - 2t - 24 = 0, 0 = -t. Calculate the lowest common multiple of 22 and p. 88 Suppose 0 = -3o + 9 + 21. What is the common denominator of 25/6 and ((-5)/o)/((-8)/73)? 48 Let g = 353899/5 + -70504. Let r = -16753/60 + g. Find the common denominator of -1/8 and r. 24 Let s be (-7254)/(-33) + 2/11. Let y = 2/413 + 49961/2478. Calculate the common denominator of 1514/s - 12/66 and y. 30 Let q = 12 + -8. Suppose z = -t + 3t + q, 4z - 4t = 28. What is the lowest common multiple of z and 8? 40 Let b(f) = f2 + 4f - 8. Calculate the smallest common multiple of (-1 - (1 - 1))(1 + -6) and b(-6). 20 Let t(a) = -4a - 11. Let u(k) = k. Let b(h) = t(h) + 5u(h). Calculate the lowest common multiple of b(12) and 6. 6 Let k = -3 - 4. Let d = k - -18. What is the smallest common multiple of 11 and d? 11 Suppose -4 = t + 3y, 4t - t + 3y = -6. Let z = 4 - t. What is the smallest common multiple of 3 and z? 15 Let c = -11519 + 357056/31. What is the common denominator of c and 5/9? 279 Suppose 0 = -4p + 3p. Suppose p = 2z + 3z + 5h, 3z - 2 = -h. Find the common denominator of 119/(-2)z/10 and 13/6. 60 Let x(v) = v3 + 2v + 1. Let o be x(-2). Suppose -2g + g = 5y - 12, -5y = -5g. Let a = o - g. Find the common denominator of a and -95/6. 6 Let o = 3027 - 42461/14. Let n be (-9887)/(-6) - 2/(-6). Let m = n - 1657. What is the common denominator of m and o? 42 Let m be (-9)/(-3) - 193. What is the smallest common multiple of 14 and m/(-4)4/5? 126 Let u = 6 + 0. Suppose 0 = -4h - 4, 2x + 5h + 41 = ux. Let z(i) = i + 1. Calculate the lowest common multiple of z(1) and x. 18 Let s(k) = -k*2 - 7k - 6. What is the least common multiple of 24 and s(-4)? 24 Let o = -5603 - 1381. Let f = -69783/10 - o. What is the common denominator of f and (20/48)/(2/18)? 20 Let x be (-1214)/(-120)99398316/409196. Let r = x - 230/102299. Let n = r + -2453. What is the common denominator of -43/14 and n? 140 Let x = -2 + 22. Let c(u) = u2 - 9u + 2. What is the smallest common multiple of x and c(9)? 20 Let m(x) = 2x2 - 2x - 1. What is the smallest common multiple of m(2) and 27? 27 Let x = 2 - -3. Suppose 4a - 56 = -2n, xn - 3a + 0a = 101. Suppose -19 = -4j + 37. Calculate the smallest common multiple of n and j. 154 Suppose -2f + 8 = 4. Calculate the least common multiple of f and 2/(-2 + 24/9). 6 Suppose 30 = 5w - 3t, -8w + 24 = -4w - 5t. Let j be w/(-10) + (-38042)/(-20). Let y = 1857 - j. Find the common denominator of y and 17/7. 14 Let y = 3 - -3. Let c be y20/3 + 1. Calculate the lowest common multiple of 7 and c/4 - 3/12. 70 Suppose -2c - 2c - 36 = 0. Let v = -4398 - 6591. Let s = 109801/10 + v. Calculate the common denominator of s and c. 10 Find the common denominator of (-1)/3 + (-77)/(-9) and -107/10. 90 Let v = -12 - -21. Let i(r) = -r3 + r2 + 2r - 1. Let m be i(2). Let z = 8 - m. What is the least common multiple of z and v? 9 Let v(s) = 3s + 8. What is the lowest common multiple of 8 and v(0)? 8 Suppose 0 = 3h - 0k - 4k, 3h + k = 15. Calculate the smallest common multiple of (0 - 2/(-4))2 and h. 4 Let b(c) = -c3 + c3 + 0c - c - c3. Calculate the smallest common multiple of 20 and b(-2). 20 Suppose -3 = -j + a, -a - 17 = -3j - 0j. Calculate the least common multiple of 9 and j. 63 Let n = -6/305 + 39991/1830. Calculate the common denominator of n and -95/14. 42 What is the common denominator of -49/30 and ((18/20)/3)/((-36)/(-570))? 60 Calculate the common denominator of 895/(-120)-2 + -3 and -59/4. 12 Let a be (-94)/18 - (-2)/9. Let d be 2/a + 7938/20220. Let f = d - 31995/2696. Calculate the common denominator of f and 18/7. 56 Let o = 564/31 - 2261/310. Let p = 71240/15113 - -1/2159. Find the common denominator of o and p. 70 Let d(h) = h3 + h2 - 2h + 1. Suppose -3c = -7 - 20. Suppose 4w + 40 = cw. What is the smallest common multiple of w and d(-2)? 8 Let o = -2355 + 25854/11. Calculate the common denominator of o and 48/7. 77 Suppose 3t + 24 = -t. Let u be -1016 + ((-2)/t)/1. Let h = 1007 + u. Calculate the common denominator of h and 81/2. 6 Let h(q) = q3 - 8q*2 - 2q + 3. Let y be h(8). Let b = -6 - y. Let t = b + -3. What is the smallest common multiple of 11 and t? 44 Let m be 4/(-10) + (-52204)/5940. Let l = m + 118/27. Calculate the common denominator of l and -58/5. 55 Find the common denominator of ((-41)/3)/(132/(-18)) and 93/4. 44 Let d = -1803/4 + 431. What is the common denominator of (906/27)/((-4)/(-3)) and d? 12 Let x = -32/19 + 1173/76. Let z = -2596/35 + 393/5. What is the common denominator of x and z? 28 Suppose 3c + 3a - 2a - 54 = 0, -2a = -4c + 62. Let g = c + -13. What is the lowest common multiple of g and 8? 8 Let i(q) = -3q - 7. Let p(y) = -y*3 - 3y*2 + 3y + 4. Let t be p(-3). Calculate the least common multiple of 8 and i(t). 8 Let r = -16569/22 + 753. Let g = r - -23/88. What is the common denominator of ((-82)/(-15))/(24/(-10)) and g? 72 Let j(x) = x*3 + 2x*2 - 3x + 2. Suppose 5 - 13 = -4z. What is the least common multiple of 2 and j(z)? 12 Let o = 103 + -46. What is the lowest common multiple of o/(3/1) - -3 and 10? 110 Calculate the common denominator of 12/(-15) + (-503)/(-10) and ((-50)/2)/(-14). 4 Let r(u) = -3u2 - 11u - 4. Calculate the least common multiple of 7 and r(-3). 14 Let s = 72 + -64. Calculate the lowest common multiple of 8 and s. 8 Let h = 8828439/10 + -883602. Let m = h + 763. Find the common denominator of m and 17/16. 80 Let h = -329 - -1957/6. Calculate the common denominator of 69/2 and h. 6 Let i = 0 + -1. Let m be (i + 9/3)1. Let y(b) = b2 + 4b - 3. What is the least common multiple of y(m) and 8? 72 Suppose -4c + 0c - m + 9 = 0, -3c - 3m = -9. Find the common denominator of (-37 + -6 + 2)/c and 59/7. 14 Let y be (-4)/(-2) - 2020/8. Let h = y + 233. Calculate the common denominator of ((-1)/10)/((-3)/(-42)) and h. 10 Suppose -4p + 2j + 21 - 3 = 0, -2p = 3j - 5. Suppose -po = s - 48, 5s + 0s - 60 = -5o. What is the lowest common multiple of o and 12? 12 Suppose 0q - 3q = -69. Let s = 3 + q. Let r = -39/2 + s. Calculate the common denominator of 95/2 and r. 2 Let c = 18 - 4. Calculate the lowest common multiple of 6 and c. 42 Find the common denominator of 618/154 + (-4)/14 and -11/8. 88 Let h = -7 + 12. Let l(u) = u3 - u2 + 11. Let k be l(0). Suppose -hb + k = -29. What is the smallest common multiple of 4 and b? 8 Let b(g) = g2 + 4g + 1. Suppose 0 = 57d - 55d - 32. What is the least common multiple of d and b(3)? 176 Let c = 132959/16 - 8315. Calculate the common denominator of 5/(-20) + (-410)/(-24) and c. 48 Let m = 7 - 0. Suppose -4x + 76 = 4i, -4x + 2i + 52 = -2i. Suppose j + 3q = 2, 2*q - x = -j - j. What is the least common multiple of j and m? 77 Let	{ "pile_set_name": "DM Mathematics" }
= 88g + 32 for g. -4 Solve 44s + 64 = 28s for s. -4 Solve 0 = -29t + 26t - 15 for t. -5 Solve -45n + 10 = 10 for n. 0 Solve 3 = -6l - 21 for l. -4 Solve -57a = 9 + 447 for a. -8 Solve -14h + 144 = 10h for h. 6 Solve 2n = -6n - 2n for n. 0 Solve 6r = 3r + 6 for r. 2 Solve 0 = -223g + 204g for g. 0 Solve -68b = -64b for b. 0 Solve 78w - 80w - 2 = 0 for w. -1 Solve -37p - 10 = -84 for p. 2 Solve -359 = -4x - 363 for x. -1 Solve 8 = -27a - 19 for a. -1 Solve 504 - 48 = 57b for b. 8 Solve -57 + 25 = 8v for v. -4 Solve 166 - 126 = 10g for g. 4 Solve 26 = n + 22 for n. 4 Solve 0 = 174y - 175y + 9 for y. 9 Solve 16w = -718 + 606 for w. -7 Solve -76q + 114 = -57q for q. 6 Solve -90 = 18s + 18 for s. -6 Solve -26z + 149 + 111 = 0 for z. 10 Solve 0 = -5m + 9m - 20 for m. 5 Solve 0 = 8b - 6b + 10 for b. -5 Solve 12b - 33 = -117 for b. -7 Solve -8q + 13q + 5 = 0 for q. -1 Solve -8c + 3c = -15 for c. 3 Solve -89 = -4f - 69 for f. 5 Solve a - 25 = -27 for a. -2 Solve 0 = 5o - 2 + 22 for o. -4 Solve -844 = 9q - 898 for q. 6 Solve 0 = 15n + 35 + 115 for n. -10 Solve 10t = 7t - 3 for t. -1 Solve 3x - 85 = -76 for x. 3 Solve 3u + 18 - 9 = 0 for u. -3 Solve 6 + 19 = -5c for c. -5 Solve 14k - 32 = 6k for k. 4 Solve -15b + 25 = -35 for b. 4 Solve -9g + 19 = 10 for g. 1 Solve 6 = -7n + 20 for n. 2 Solve -6 + 1 = 5h for h. -1 Solve 11m - 14m = -12 for m. 4 Solve 6w = 16 + 8 for w. 4 Solve -7l = -0l - 14 for l. 2 Solve 11p = 17p - 24 for p. 4 Solve 0 = -43m + 24m + 76 for m. 4 Solve 1 = -2b - 5 for b. -3 Solve -18h + 53 = -73 for h. 7 Solve -12i = -44i for i. 0 Solve 21c + 205 = 100 for c. -5 Solve 18 = 2m + 4m for m. 3 Solve -5288w = -5300w + 36 for w. 3 Solve 0 = -157x + 169x + 96 for x. -8 Solve 15 - 15 = -5t for t. 0 Solve 367y - 3 = 368y for y. -3 Solve 0 = -3i + 8i + 30 for i. -6 Solve -14 = 3j + 1 for j. -5 Solve c + 5c = 30 for c. 5 Solve -w + 13 = 16 for w. -3 Solve 9x - 50 = -x for x. 5 Solve 0 = 39g - 35g for g. 0 Solve -20y + 14y = 18 for y. -3 Solve -11t + 999 = 955 for t. 4 Solve 4 = -3s + s for s. -2 Solve -59 - 65 = -31k for k. 4 Solve -150o + 144o = 54 for o. -9 Solve -538 + 506 = -4h for h. 8 Solve 0 = 5z + 2z - 2z for z. 0 Solve -3n = 26 - 14 for n. -4 Solve 24 = 6r + 12 for r. 2 Solve -60 = -15r + 60 for r. 8 Solve -27x = -15x - 12 for x. 1 Solve -97 - 127 = -56x for x. 4 Solve 7w = 23w - 16 for w. 1 Solve -3c + 16 = 5c for c. 2 Solve 0 = -11s + 614 - 537 for s. 7 Solve 1219k = 1211k - 56 for k. -7 Solve 74t + 34 = 57t for t. -2 Solve 0 = -10j + 6j for j. 0 Solve 5j - 649 = -664 for j. -3 Solve 35z - 75 = -320 for z. -7 Solve 42m - 351 = 3m for m. 9 Solve -6w = -13w + 4w for w. 0 Solve 47x = -27 - 67 for x. -2 Solve -34 = 67t - 235 for t. 3 Solve 47t = 11t - 108 for t. -3 Solve 13j - 21j = 0 for j. 0 Solve -9i + 25 = -4i for i. 5 Solve 95x + 219 = -66 for x. -3 Solve r + 0 = -1 for r. -1 Solve 2c + 72 = 64 for c. -4 Solve 0 = 4g - 11g + 2g for g. 0 Solve 4u - u - 6 = 0 for u. 2 Solve 0 = 37n - 2 - 35 for n. 1 Solve 0 = 53u + 50 + 3 for u. -1 Solve 13 = 13z - 0 for z. 1 Solve 0 = 17f + 4f - 63 for f. 3 Solve 0 = -7a - 60 + 74 for a. 2 Solve 3i + 32 = 26 for i. -2 Solve t - 43 + 49 = 0 for t. -6 Solve -38s - 108 = -20s for s. -6 Solve -83 + 88 = -w for w. -5 Solve 7b = 6b + 2 for b. 2 Solve 4 = -8p + 7p for p. -4 Solve -6g = -56 + 68 for g. -2 Solve 12l + 44 = l for l. -4 Solve 18g = 32 + 22 for g. 3 Solve 0b = -6b + 2b for b. 0 Solve -126b - 36 = -135b for b. 4 Solve -7m - 748 + 783 = 0 for m. 5 Solve -18 - 18 = -12f for f. 3 Solve 3g + 137 = 125 for g. -4 Solve -41 - 3 = 11o for o. -4 Solve 6d + 2d - 40 = 0 for d. 5 Solve 0 = 7o + 13 + 22 for o. -5 Solve 11i = 8 + 47 for i. 5 Solve 0 = -l - 15 + 18 for l. 3 Solve 14 - 2 = -12z for z. -1 Solve 109f - 64f = 135 for f. 3 Solve -65 = -44y + 67 for y. 3 Solve 29r - 33r = 16 for r. -4 Solve -8 = m + m for m. -4 Solve 26 = -5i + 6 for i. -4 Solve -140 = 23h + 21 for h. -7 Solve 0 = 19r + 169 + 40 for r. -11 Solve -44u = -42u + 4 for u. -2 Solve -7c - 348 = -369 for c. 3 Solve 12 = t + 7 for t. 5 Solve -10k = -3k for k. 0 Solve 0z = 4z + 16 for z. -4 Solve 195 - 185 = -5p for p. -2 Solve 6y + 1 = 31 for y. 5 Solve 6 + 30 = 6n for n. 6 Solve -16l - 6l - 176 = 0 for l. -8 Solve 2c + 1 = 3c for c. 1 Solve 28f = 107f + 158 for f. -2 Solve 3s - 87 = -108 for s. -7 Solve 4o = -33 + 17 for o. -4 Solve 0 = -8c + 12c + 12 for c. -3 Solve -8y = -5y + 6 for y. -2 Solve -24k - 14k = -38 for k. 1 Solve -6i + 3i = 21 for i. -7 Solve 23c = 10c for c. 0 Solve -269j + 273j - 44 = 0 for j. 11 Solve 2i - 56 = -48 for i. 4 Solve 35s - 39s = -20 for s. 5 Solve -53y = -21y - 192 for y. 6 Solve -73m = -85m - 48 for m. -4 Solve -59k + 58k - 4 = 0 for k. -4 Solve 50f + 279 = 79 for f. -4 Solve -5t + 2t + 9 = 0 for t. 3 Solve 2j - 26j + 192 = 0 for j. 8 Solve -51 = 21k - 240 for k. 9 Solve 134 = 4j + 162 for j. -7 Solve -2v + 3v = 2v for v. 0 Solve 22d - 2 = -68 for d. -3 Solve 85 = 8f + 101 for f. -2 Solve -4q + 114 - 130 = 0 for q. -4 Solve 21j - 88 - 38 = 0 for j. 6 Solve 0 = 46d - 16d + 180 for d. -6 Solve -4m - 6m = -10 for m. 1 Solve 8f + 11 = 3 for f. -1 Solve -16n + 5n = 0 for n. 0 Solve 0 = -27c - 279 + 360 for c. 3 Solve -60l - 85l = 145 for l. -1 Solve 0 = -7j + 9j for j. 0 Solve 131k + 154 = 109k for k. -7 Solve -222 = 54i + 102 for i. -6 Solve -6 + 6 = 38u for u. 0 Solve -31m = -37m + 36 for m. 6 Solve -7b + 47 = 61 for b. -2 Solve 22c - 9c = -91 for c. -7 Solve 108v + 46 = 154v for v. 1 Solve 6h + 25 - 43 = 0 for h. 3 Solve -66d + 65d - 4 = 0 for d. -4 Solve 8z = -5 - 19 for z. -3 Solve -2 = -i - 9 for i. -7 Solve 0 = 28j - 29j + 1 for j. 1 Solve -7m + 59 = 24 for m. 5 Solve 0 = 43p - 64 + 365 for p. -7 Solve 10 = -3z - 7z for z. -1 Solve -14 - 10 = -8o for o. 3 Solve 1630j - 1625j = -25 for j. -5 Solve -2 = -2z - 8 for z. -3 Solve -4j = -j - 25j for j. 0 Solve -68 = -265g + 282g for g. -4 Solve -5b + 33 = 23 for b. 2 Solve 5p = 6p - 5 for p. 5 Solve 24h = 4h + 60 for h. 3 Solve -27 = 11p - 20p for p. 3 Solve -11v = 1 + 43 for v. -4 Solve -9w + 18 + 18 = 0 for w. 4 Solve 25i = 23 + 127 for i. 6 Solve 0 = -2425i + 2418i - 42 for i. -6 Solve 0 = -7r - 38 + 17 for r. -3 Solve 32h + 9 = 35h for h. 3 Solve x + x - 10 = 0 for x. 5 Solve 35 = 4b + 67 for b. -8 Solve 0 = 6y + 8y + 28 for y. -2 Solve 69w = 28w + 369 for w. 9 Solve -62x = -65x - 15 for x. -5 Solve 0 = -35a - 266 - 49 for a. -9 Solve -13 + 45 = 8q for q. 4 Solve 269k - 273k = 32 for k. -8 Solve 76 - 85 = 9q for q. -1 Solve 21x - 278 = -194 for x. 4 Solve 8b + 7 = 31 for b. 3 Solve -31b + 92b = 183 for b. 3 Solve -267y = -236y - 248 for y. 8 Solve 0 = -10t + 2t - 8 for t. -1 Solve 187 = 29z + 129 for z. 2 Solve 0 = 2q - 7 + 5 for q. 1 Solve t = 3t - 7t for t. 0 Solve -9 = -3n - 0n for n. 3 Solve -68g + 74g = -18 for g. -3 Solve -10 - 36 = -23x for x. 2 Solve -9v + 20 + 7 = 0 for v. 3 Solve 3u = 1 - 4 for u. -1 Solve -5x + 4 = 24 for x. -4 Solve -83 + 943 = -86j for j. -10 Solve 34x + 85 = -119 for x. -6 Solve -7h - 2 = -5h for h. -1 Solve 3g - 3 = 4g for g. -3 Solve -2h - 15 = -5h for h. 5 Solve -31h + 112 = -17h for h. 8 Solve 50i + 47i = 97 for i. 1 Solve -8t - 12 = -11t for t. 4 Solve -12 = -31h + 34h for h. -4 Solve 0 = -6v + 11v for v. 0 Solve -10d + 50 = 110 for d. -6 Solve 84g - 12 = 87g for g. -4 Solve -350 = 14h - 392 for h. 3 Solve 2060h = 2052h for h. 0 Solve -3w + 1 - 4 = 0 for w. -1 Solve 138 = 24z - 47z for z. -6 Solve -28t + 37t = -18 for t. -2 Solve -2u + 5 = 3 for u. 1 Solve -150 = 57b - 7b for b. -3 Solve 10j - 9j = 1 for j. 1 Solve -20 = -8o - 36 for o. -2 Solve 8 = -4u - 8 for u. -4 Solve -7k - 23 + 2 = 0 for k. -3 Solve 11w - 18w = 28 for w. -4 Solve 9y = 41 - 50 for y. -1 Solve -2a - 8 = -0a for a. -4 Solve 732 = 4a + 700 for a. 8 Solve 9i - 4i - 10 = 0 for i. 2 Solve -5 = -r - 3 for r. 2 Solve 141f = 130f + 11 for f. 1 Solve 11v - 329 + 373 = 0 for v. -4 Solve -6*z = -180 + 156	{ "pile_set_name": "DM Mathematics" }
260797f/2 - 15064623/2 = 0. -1467, 1/2, 7 Solve -3l*2/5 + 3474l - 5028615 = 0. 2895 Suppose 3n5 - 1998n*4 + 294360n*3 = 0. Calculate n. 0, 220, 446 Find m such that -2m*5/11 - 856m*4/11 - 2514m*3/11 + 15364m*2/11 + 27008m/11 - 81600/11 = 0. -425, -4, 2, 3 What is z in 2z4/15 - 1864z*3/5 - 5598z*2/5 - 8z/15 + 7464/5 = 0? -2, 1, 2799 Determine w, given that -4w3 + 176w*2 - 2452w + 10920 = 0. 10, 13, 21 Factor -3g2 - 237g + 5238. -3(g - 18)(g + 97) Solve -3a3/7 - 499377a*2 - 1018289253705a/7 + 1018292749347/7 = 0 for a. -582607, 1 What is n in -43n2 + 162n + 576 = 0? -96/43, 6 Determine q, given that -q*5/6 - 47q*4/2 - 2515q*3/3 - 2375q*2/3 + 1677q/2 + 4891/6 = 0. -73, -67, -1, 1 Solve -55q5 - 630q*4 - 1565q*3 + 1050q*2 = 0 for q. -7, -5, 0, 6/11 Solve -8f*3 - 9784f*2 + 9790f - 2448 = 0 for f. -1224, 1/2 Suppose -12n5 - 64n*4 + 16n*3 + 168n*2 - 68n - 40 = 0. What is n? -5, -2, -1/3, 1 Let -2g3/15 - 278g*2/15 - 3888g/5 - 43848/5 = 0. What is g? -63, -58, -18 Factor -p*4/2 + 158p*3 - 17271p*2 + 799254p - 26852985/2. -(p - 145)(p - 57)3/2 Let b4/9 - 14b*3/9 - 363b*2 - 3220b/9 + 6500/9 = 0. What is b? -50, -2, 1, 65 Determine i, given that -2i2/9 + 17684i/9 - 247184/9 = 0. 14, 8828 Solve -5g2/7 - 604g/7 - 569 = 0. -569/5, -7 Solve 2y4/5 - 112y*3/5 + 1316y*2/5 + 3456y/5 - 4662/5 = 0. -3, 1, 21, 37 Find h, given that -3h5/4 - 47859h*4/4 - 95472717h*3/2 - 286274589h*2/2 - 572453475h/4 - 190801875/4 = 0. -7975, -1 Find k such that -4k2 + 3944k - 23520 = 0. 6, 980 Factor 1865n4 - 9345n*3 + 100n*2. 5n*2(n - 5)(373n - 4) Find h such that 5h2 + 85690h + 367138805 = 0. -8569 Let -165n4 - 8915n*3 - 8945n*2 + 3515n + 3710 = 0. Calculate n. -53, -1, -2/3, 7/11 Factor 29z2/3 + 151z/6 - 23/2. (z + 3)(58z - 23)/6 Factor -35c3 - 80c*2 + 405c + 450. -5(c - 3)(c + 1)(7c + 30) What is z in -2z4 - 2z*3 + 412z*2 + 1968z + 2304 = 0? -12, -3, -2, 16 Determine y so that 2y2/3 - 1160y/3 - 100750 = 0. -195, 775 Determine d so that 3d3/7 + 1635d*2 + 57132d/7 - 68580/7 = 0. -3810, -6, 1 Factor 5o4 - 180490o*3 + 1629012480o*2 - 3257303040o. 5o(o - 18048)*2(o - 2) Factor -4f2 - 1850832f - 214098693264. -4(f + 231354)2 Let 4q*4 + 204q*3 + 2304q*2 + 704q - 53760 = 0. What is q? -35, -12, -8, 4 What is r in 2r4 + 796016r*3 + 105605585316r*2 + 4669914171268192r - 23352211095477110 = 0? -132671, 5 Factor -2g2 - 586g - 41300. -2(g + 118)(g + 175) Factor 3q3/8 - 225q*2/8 + 1947q/4 + 1089. 3(q - 44)(q - 33)(q + 2)/8 Factor -y2 + 787y + 23664. -(y - 816)(y + 29) Factor d3 - 412d*2 + 20697d - 58410. (d - 354)(d - 55)(d - 3) Factor -w*2/3 - 72787w/3 + 72788/3. -(w - 1)(w + 72788)/3 Let -m3 + 9362m*2 - 46791m + 56142 = 0. What is m? 2, 3, 9357 Factor -i*2 + 47077i. -i(i - 47077) Factor f4 - 779f*3 + 150537f*2 + 457079f + 305762. (f - 391)*2(f + 1)(f + 2) Factor -2q*4 + 66q*3 + 1218q*2 + 4606q. -2q(q - 47)(q + 7)2 Suppose -265i*3/2 + 103877i*2/2 - 5089532i - 57624 = 0. What is i? -3/265, 196 Determine y, given that 10y2 - 14256y + 8550 = 0. 3/5, 1425 Factor -j*2 - 1541576j - 594114140944. -(j + 770788)*2 What is o in -5o*4 - 400o*3 + 74365o*2 + 74760o = 0? -168, -1, 0, 89 Factor u*4 + 74u*3 + 1629u*2 + 9504u + 13068. (u + 2)(u + 6)(u + 33)*2 Suppose -3j*2 - 20979j/2 - 5244 = 0. What is j? -3496, -1/2 Factor 3d2 + 2742d - 16560. 3(d - 6)(d + 920) Let 2l2 - 168l - 11960 = 0. What is l? -46, 130 Factor 2h3/7 - 4020h*2 + 98643906h/7 + 2383690032/7. 2(h - 7047)2(h + 24)/7 Let -2m2 + 36400m - 109182 = 0. Calculate m. 3, 18197 Let 2r5 + 3619r*4/5 + 330846r*3/5 + 123552r*2 + 38880r = 0. Calculate r. -180, -3/2, -2/5, 0 Suppose -6z3/19 + 6020z*2/19 + 46478z/19 + 28308/19 = 0. Calculate z. -7, -2/3, 1011 Let 4g5 - 228g*4 + 628g*3 + 1092g*2 - 632g - 864 = 0. Calculate g. -1, 1, 4, 54 Solve -3q2/7 - 1668q/7 - 32160/7 = 0 for q. -536, -20 Let -3y5/2 - 741y*4 - 1473y*3/2 + 1479y*2 = 0. What is y? -493, -2, 0, 1 Solve 2y*4 + 942y*3 + 139340y*2 + 6115656y - 12796240 = 0 for y. -194, -85, 2 Let 7o5 + 688o*4 + 8295o*3 - 455290o*2 + 746468o + 250632 = 0. What is o? -59, -2/7, 2, 18 Suppose -2r4/7 + 680r*3/7 + 15254r*2/7 - 33212r/7 = 0. What is r? -23, 0, 2, 361 Find k such that 4k5 + 100k*4 - 156k*3 - 1348k*2 + 152k + 1248 = 0. -26, -3, -1, 1, 4 Solve 4m5 + 1300m*4 - 37172m*3 + 294748m*2 - 822080m + 563200 = 0 for m. -352, 1, 5, 16 Factor -123u3 + 3678u*2/5 + 72u/5. -3u(u - 6)(205u + 4)/5 What is m in 2m3 + 7166m*2 + 7160m - 14328 = 0? -3582, -2, 1 Factor 5v2 + 5935v + 58850. 5(v + 10)(v + 1177) Find o, given that 5o5/3 - 95o*4/6 + 20o*3 + 605o*2/6 - 170o/3 - 50 = 0. -2, -1/2, 1, 5, 6 Solve -h*2 + 131h/4 = 0 for h. 0, 131/4 Factor -2w3/9 + 164w*2/9 + 880w/3 + 512. -2(w - 96)(w + 2)(w + 12)/9 Factor 4y*5 + 372y*4 + 1544y*3 - 18512y*2 + 43296y - 30976. 4(y - 2)3(y + 11)(y + 88) Suppose 3g*3 + 386118g*2 - 386121g = 0. What is g? -128707, 0, 1 Let -8v4 - 388v*3 + 5316v*2 - 12240v = 0. Calculate v. -60, 0, 3, 17/2 Solve -4m4/7 - 60m*3/7 + 328m*2 + 2976m/7 - 27648/7 = 0. -32, -4, 3, 18 Find a, given that -a*5/5 + 14a*4 - 133a*3/5 - 212a*2/5 + 548a/5 - 272/5 = 0. -2, 1, 2, 68 Let v*5/4 + 7249v*4/2 + 26346359v*3/2 + 262149531v*2 + 1939176081v/4 + 471628089/2 = 0. Calculate v. -7239, -18, -1 Factor 4f3 - 205764f*2 + 2646279360f - 2646073600. 4(f - 25720)2(f - 1) Factor x*4/3 - 90x*3 - 272x*2 - 818x/3 - 91. (x - 273)(x + 1)3/3 Suppose 3z*3 - 876z*2 + 65664z - 248832 = 0. Calculate z. 4, 144 Factor 4g2 + 1584g + 156816. 4(g + 198)2 Solve 6i*2 + 2649i + 197505 = 0. -693/2, -95 Factor -3d2/5 - 2040114d/5 - 346838761083/5. -3(d + 340019)2/5 Factor 2h*2 - 11200h - 565000. 2(h - 5650)(h + 50) Suppose 2u2/3 - 345010u/3 + 345008/3 = 0. Calculate u. 1, 172504 What is a in -5110a5 - 15325a*4 + 15a*3 + 20440a*2 - 20a = 0? -2, 0, 1/1022, 1 Let 2n2/11 - 2490n/11 + 224812/11 = 0. What is n? 98, 1147 Let 5y5 + 292y*4 + 3281y*3 + 12246y*2 + 12492y + 3240 = 0. Calculate y. -45, -6, -1, -2/5 Factor -5a5 + 5560a*4 - 22180a*3 + 22160a*2. -5a*2(a - 1108)(a - 2)2 Solve u2 + 87534u + 1915550289 = 0. -43767 Factor 15q2 - 759835q + 506550. 5(q - 50655)(3q - 2) Factor -z2/5 + 9254z/5 - 55488/5. -(z - 9248)(z - 6)/5 Factor -3f*2 + 336f + 14892. -3(f - 146)(f + 34) Suppose f*5 - 229f*4 + 13771f*3 - 63399f*2 - 1228104f - 2957040 = 0. What is f? -4, 15, 111 Factor 9d3 - 41d*2 - 790d + 1672. (d - 11)(d - 2)(9d + 76) Factor -2j*3 + 928j*2. -2j*2(j - 464) Factor c*2/11 - 25105c/11. c(c - 25105)/11 Let 87l*5/2 + 615l*4/2 + 21l*3 - 1566l*2 - 108l = 0. What is l? -6, -3, -2/29, 0, 2 Factor 2j3/3 - 40j*2 - 17666j/3 - 5848. 2(j - 129)(j + 1)(j + 68)/3 Let 3s*5/2 + 501s*4/2 - 70707s*3/2 + 1908795s*2/2 = 0. What is s? -265, 0, 49 Find q, given that -3q*3/7 + 138q*2 + 1944q/7 = 0. -2, 0, 324 Determine q so that -q*2 - 4524q - 9044 = 0. -4522, -2 Suppose 2a4/7 - 118a*3/7 - 1462a*2/7 - 5370a/7 - 900 = 0. What is a? -5, -3, 70 Let 7d5/2 - 111d*4/2 - 1031d*3/2 - 2637d*2/2 - 1144d - 138 = 0. What is d? -3, -2, -1/7, 23 Solve -p*4/4 + 601p*3/4 + 1809p*2/4 + 1811p/4 + 151 = 0 for p. -1, 604 Factor 4j3 - 4016j*2 + 418836j - 11566440. 4(j - 890)(j - 57)2 Factor g2/2 - 28167g/2 - 14084. (g - 28168)(g + 1)/2 Factor w*3 + 1237w*2 + 77286w. w(w + 66)(w + 1171) Solve 4n3 + 14356n*2/5 + 40028n/5 - 1716 = 0. -715, -3, 1/5 Suppose -4l2/3 + 2392l/3 + 9632/3 = 0. What is l? -4, 602 Factor -3s2 - 99954s - 832566843. -3(s + 16659)2 Suppose -3y*4 + 60690y*3 - 307242975y*2 + 3067879500y - 7665907500 = 0. What is y? 5, 10110 Let -25m4 - 705m*3 - 2475m*2 + 35785m - 52020 = 0. What is m? -17, 9/5, 4 Factor 1808o4/3 - 436o**3/3 - 4	{ "pile_set_name": "DM Mathematics" }
s prob of sequence ii? 5/22 Calculate prob of sequence ddgd when four letters picked without replacement from gdgdddg. 3/35 Three letters picked without replacement from {o: 2, h: 5, i: 2}. Give prob of sequence ihh. 5/63 Calculate prob of sequence ooee when four letters picked without replacement from oeoeoeooee. 5/63 Two letters picked without replacement from {m: 2, r: 1, p: 1}. What is prob of sequence pm? 1/6 Three letters picked without replacement from mmmmmmmmmvmmmmmmmm. What is prob of sequence mvm? 1/18 Calculate prob of sequence yg when two letters picked without replacement from {h: 2, g: 1, y: 1, i: 1, o: 4}. 1/72 Calculate prob of sequence fg when two letters picked without replacement from nnffgffffgfgg. 7/39 Two letters picked without replacement from {c: 6, b: 6, r: 3}. Give prob of sequence bb. 1/7 Calculate prob of sequence kwr when three letters picked without replacement from zrwkkwwwzkjzwy. 5/728 Calculate prob of sequence lqll when four letters picked without replacement from qqqqqlqqlqlll. 4/143 Four letters picked without replacement from {b: 1, y: 2, x: 1, d: 2, k: 6}. What is prob of sequence kdxx? 0 Calculate prob of sequence hhq when three letters picked without replacement from hhqhqqqqqqqqqqqq. 13/560 Four letters picked without replacement from {q: 17, r: 3}. Give prob of sequence rqrq. 4/285 Three letters picked without replacement from cccc. What is prob of sequence ccc? 1 Three letters picked without replacement from kaaa. Give prob of sequence aka. 1/4 Two letters picked without replacement from rll. Give prob of sequence rl. 1/3 Four letters picked without replacement from {c: 14, i: 1, f: 5}. Give prob of sequence icff. 7/2907 Three letters picked without replacement from {y: 3, c: 13}. What is prob of sequence ccc? 143/280 Three letters picked without replacement from {f: 4, s: 1, o: 1, y: 4}. What is prob of sequence yyf? 1/15 Three letters picked without replacement from kkkffff. What is prob of sequence kfk? 4/35 Two letters picked without replacement from {k: 7, x: 4}. What is prob of sequence xx? 6/55 Three letters picked without replacement from {p: 1, g: 3, k: 1, y: 4, s: 2}. What is prob of sequence ssg? 1/165 Three letters picked without replacement from {r: 3, d: 5, w: 5, c: 1, u: 1}. Give prob of sequence dww. 10/273 Three letters picked without replacement from zdddddzdzdnddddddn. Give prob of sequence dnn. 13/2448 Calculate prob of sequence pn when two letters picked without replacement from pqnq. 1/12 What is prob of sequence hghg when four letters picked without replacement from {u: 2, g: 2, h: 10}? 15/2002 Two letters picked without replacement from lllllll. What is prob of sequence ll? 1 Calculate prob of sequence uju when three letters picked without replacement from {j: 13, u: 5}. 65/1224 Calculate prob of sequence aaha when four letters picked without replacement from {a: 6, e: 7, h: 1}. 5/1001 Two letters picked without replacement from {g: 1, c: 2}. What is prob of sequence cg? 1/3 What is prob of sequence oo when two letters picked without replacement from {d: 1, o: 3, i: 7, t: 5, m: 2}? 1/51 Two letters picked without replacement from {z: 5, i: 7}. Give prob of sequence ii. 7/22 Calculate prob of sequence dodo when four letters picked without replacement from doddddddddoddoddddod. 8/323 Calculate prob of sequence qnqk when four letters picked without replacement from {q: 2, n: 4, k: 7}. 7/2145 Calculate prob of sequence nixi when four letters picked without replacement from nxixnfixnfxnfifixfxi. 4/969 Calculate prob of sequence jkah when four letters picked without replacement from {x: 1, a: 1, v: 1, h: 1, j: 1, k: 2}. 1/420 What is prob of sequence ullu when four letters picked without replacement from qluoqqtulfqf? 1/2970 Two letters picked without replacement from ggffgfgg. What is prob of sequence gg? 5/14 Three letters picked without replacement from sccjjyyjyc. What is prob of sequence ycj? 3/80 Calculate prob of sequence bm when two letters picked without replacement from {j: 2, b: 1, u: 2, o: 2, m: 1, x: 1}. 1/72 What is prob of sequence ppps when four letters picked without replacement from {z: 1, s: 1, p: 5, l: 1, i: 1}? 5/252 Three letters picked without replacement from {r: 9, s: 3}. Give prob of sequence rss. 9/220 Two letters picked without replacement from rgrggr. What is prob of sequence rr? 1/5 What is prob of sequence yy when two letters picked without replacement from {y: 2, d: 4}? 1/15 Three letters picked without replacement from {x: 3, c: 5, y: 2}. What is prob of sequence cyc? 1/18 Calculate prob of sequence ujjj when four letters picked without replacement from uujjauajauj. 2/165 What is prob of sequence zzo when three letters picked without replacement from yoyyyyzozyyoz? 3/286 What is prob of sequence xkqi when four letters picked without replacement from pqqqkpkxqik? 1/660 Three letters picked without replacement from gfmcgffffxfcxgfggxf. Give prob of sequence ggm. 10/2907 Four letters picked without replacement from {y: 9}. What is prob of sequence yyyy? 1 What is prob of sequence oil when three letters picked without replacement from {r: 3, i: 1, o: 2, h: 2, l: 2, k: 2}? 1/330 Calculate prob of sequence iod when three letters picked without replacement from idiiiiodddidoid. 2/65 Two letters picked without replacement from {c: 3, k: 1}. What is prob of sequence cc? 1/2 What is prob of sequence rzlr when four letters picked without replacement from zlrlllvlrvlvllllllv? 1/3876 Calculate prob of sequence rb when two letters picked without replacement from ccggbyr. 1/42 Two letters picked without replacement from irwlr. Give prob of sequence lw. 1/20 Two letters picked without replacement from utfvvue. Give prob of sequence tv. 1/21 What is prob of sequence rry when three letters picked without replacement from rrrrrrrryyrrr? 5/39 Calculate prob of sequence zzgk when four letters picked without replacement from {p: 2, k: 1, g: 3, z: 13}. 13/2584 What is prob of sequence mxm when three letters picked without replacement from fmmxflxxxmfmmxmxx? 7/136 Three letters picked without replacement from {a: 6, l: 7, k: 1}. What is prob of sequence aka? 5/364 What is prob of sequence bj when two letters picked without replacement from jjjbbbbjjjbjj? 10/39 What is prob of sequence aq when two letters picked without replacement from {r: 2, a: 2, z: 1, n: 1, q: 1}? 1/21 Calculate prob of sequence bz when two letters picked without replacement from zzwbe. 1/10 Calculate prob of sequence oxo when three letters picked without replacement from {o: 2, x: 1, b: 1, k: 2}. 1/60 What is prob of sequence lo when two letters picked without replacement from {j: 2, d: 2, o: 1, l: 1}? 1/30 Calculate prob of sequence pjn when three letters picked without replacement from {z: 2, u: 2, p: 1, n: 1, j: 1, k: 1}. 1/336 Calculate prob of sequence qbz when three letters picked without replacement from {z: 2, q: 8, b: 2, r: 1}. 8/429 Two letters picked without replacement from {h: 1, s: 4, m: 1, p: 2}. Give prob of sequence hp. 1/28 Four letters picked without replacement from xmmmmmmmmmmmmxmmmm. Give prob of sequence xmxx. 0 Calculate prob of sequence eed when three letters picked without replacement from {r: 1, e: 2, d: 1}. 1/12 Calculate prob of sequence nvvv when four letters picked without replacement from {t: 4, v: 4, n: 1, j: 2, g: 5}. 1/1820 Calculate prob of sequence ugs when three letters picked without replacement from sugssssuss. 7/360 Four letters picked without replacement from jmjmjj. What is prob of sequence jmjj? 2/15 Four letters picked without replacement from {a: 19, l: 1}. Give prob of sequence alaa. 1/20 Three letters picked without replacement from oooorr. Give prob of sequence ror. 1/15 What is prob of sequence hxh when three letters picked without replacement from {x: 2, h: 6}? 5/28 Four letters picked without replacement from {z: 9, x: 2}. Give prob of sequence zzzx. 7/55 Three letters picked without replacement from vvyyyvvvvvvvvkvvkpv. What is prob of sequence kkv? 13/2907 Two letters picked without replacement from kuoojjjhjhoujnoonon. Give prob of sequence ko. 1/57 What is prob of sequence fxx when three letters picked without replacement from {o: 1, f: 9, a:	{ "pile_set_name": "DM Mathematics" }
v) = v + 34. Let j be p(-15). Suppose j = -2k - 21. Is k < -22? False Let v = 0.044 - 0.044. Is 1/136 at most as big as v? False Let j(s) = 11s + 1. Let o be j(2). Suppose -l - 4a = -18, -2l + 9a = 4a - o. Let g be 12 - ((3 - 3) + -2). Is g > l? False Let j be 30/225 + (-182)/15. Let f be (-26)/(-8) - (-3)/j. Are f and 3 unequal? False Let r(v) be the first derivative of -v*4/4 - 13v*3/3 - 25v*2/2 - 24v + 29. Let w be r(-11). Is 7 not equal to w? True Suppose 12g - 15g + 5s + 15 = 0, 5g - s = 3. Suppose 1 = -0a - a. Which is smaller: a or g? a Let n be 7/(-2)2-2. Let j = 8 - n. Let d = -8 - j. Do d and -7/3 have the same value? False Let w be (-28)/10 + (-1 - -3). Let s = -10 + 15. Suppose s = -3a + 2. Is a smaller than w? True Let q be 3 - (4 + -2) - 20. Let c = q - -9. Let v be 6/(-30)c/(-4). Which is bigger: v or -1? v Let k = 30.8 - 30.5. Is -3.5 at most k? True Let h = 462 + -396. Which is smaller: h or 592/9? 592/9 Let f = 6.15 + -6.01. Which is smaller: 4 or f? f Let p be 2/60(-106)/(-530). Is -5/21 greater than p? False Let v be (-1)/4 - 66/24. Suppose 0h = h. Is h at least v? True Let d be -12 + 5 + -112 + -4. Are -122 and d equal? False Let s(t) = 4t - 43. Let i be s(11). Let n be (-33 - -3) + i - 1. Which is smaller: n or -0.1? n Let z = -1194 + 1193. Is z > 3/895? False Let h(t) be the third derivative of -t6/120 - t5/15 - t4/8 - t3/2 + 10t*2. Let a be h(-4). Let v(p) = -p + 7. Let b be v(a). Is b not equal to -1/2? True Let h = 29 + -29.08. Let i = -4 - -5.08. Let d = h + i. Which is smaller: -0.5 or d? -0.5 Suppose 5k - 5 - 10 = 0. Suppose x + 6 = kg, -4x = -x - g - 6. Suppose x = l + 2. Is l greater than or equal to 21? False Suppose 5i + 343 + 472 = 0. Let v = i + 229. Which is smaller: 68 or v? v Suppose 12k = 17k + 1395. Which is bigger: -280 or k? k Suppose -4y - r = -67 - 96, -4r = -12. Which is greater: y or 42? 42 Let l = -275 - -296. Which is bigger: l or 8? l Let h be -1 + (-40)/18 + 3. Let v(f) = f + 2. Let j be v(-1). Let a be (1/(-5))/((-1)/5j). Which is smaller: h or a? h Suppose -4j + j = -n - 83, 91 = 3j - 5n. Suppose -4c + j = -3z, 4z + 36 = -c + 2c. Let r be 2/(1/8-2). Which is smaller: r or z? z Let v be (8/60)/(3/(-3930)). Let q = 15202/87 + v. Is -1 <= q? True Suppose -2j - z - 2z = -13, j - 11 = 3z. Suppose j = -5h - r - r, -2r - 8 = h. Suppose a + h = -1. Which is smaller: -3/8 or a? a Let y = -560837/309 - -1815. Do 1 and y have the same value? False Let l = -28771 - -38812076/1349. Which is greater: l or 1? 1 Suppose -3f + 6 = 5u, -f + 3 = -2f. Suppose d = ud - 20. Suppose 0 = 3l + d - 7. Do 0 and l have different values? True Let p be (5 - 0)-1 + 1. Let h = 90 + -84. Let w(o) = o3 - 4o*2 - 14o + 7. Let r be w(h). Which is greater: r or p? p Let w(n) = 528n - 29. Let i be w(15). Let x be (i/26)/((-6)/4). Let m = -204 - x. Which is greater: m or -1? -1 Let c = -655 - -17683/27. Which is smaller: 3 or c? c Let u be (-10)/(-10) + (-4312469)/(-5681). Let y = -3138/437 + u. Let a = -752 + y. Is a at most as big as 2? True Let r(n) = -n2 - 8n - 9. Let o be r(-2). Let p = o + -4. Which is greater: p or -5/7? -5/7 Let s(m) = -m*3 - 2m*2 + 13m + 60. Let w be s(-4). Let y be (-19)/(-4) - (-2)/8. Let o be 82/w + (y - 7). Which is bigger: o or -1? o Suppose -876r + 450 = -861r. Which is smaller: r or 25? 25 Let a be ((-66)/605)/((-366)/15). Is a at most as big as -0.1? False Let t = 6 + -2.9. Let m = -2.1 + t. Let d = -3.5 - 0.5. Is m at least d? True Let d be (-112)/(-12)21/2. Let n = d + -99. Which is smaller: n or 1/41? n Let v(y) = y3 + 24y*2 - 25y + 1. Let x be v(-25). Let i = 15885/13 - 1221. Which is smaller: x or i? i Let s = 386 - 296. Is 90 at most as big as s? True Let m = -381/2 + 187. Let k = 112 + -92. Let t = -21 + k. Which is smaller: t or m? m Suppose b = 5b + 3o + 19, -3b + 5o - 36 = 0. Let u(x) be the first derivative of -7x2/2 + 6. Let w be u(1). Is b >= w? True Let f = -27 + 223/10. Let j = 21/5 + f. Is j greater than 0? False Suppose 28 = -5o + p, 8o + 40 = 3o - 5p. Let f be o - (-4)/(-1 - 1). Which is smaller: -9 or f? -9 Let c = -566 - -571. Do c and -139 have the same value? False Let v be 0/(-1) - 1-5. Suppose 5a - 10 = -2d + 11, 3d = 3a. Which is bigger: a or v? v Let y = -72 - -73. Is y smaller than 0.007? False Let o(b) = 2b + 15. Let y be o(-17). Let p = y + 18. Let d = p + 4. Which is greater: 2 or d? d Let g = 32 - 14. Suppose -12i = -14i + 10. Suppose 3q - 93 = -id, 0 = -2d - 4q - 0 + 40. Is d at least g? True Let u = -1.78 - 6.22. Are u and -0.3 equal? False Let r = -400 - -404. Let c = 3.05 - 3. Is c at least r? False Let d(t) = 10t - 8. Let k be d(3). Which is greater: 9 or k? k Let d = 150.94 + 0.06. Does d = -1? False Suppose 3g - 22 = -o - o, 2 = -2g + 2o. Let x(i) = -i3 - 7i*2 - 6i + 3. Let f(w) = -2w2 + 8w - 6. Let t be f(4). Let u be x(t). Is u not equal to g? True Let p = 1/286 + -487/16588. Does p = -3? False Let b(w) = 16w2 + 23w - 50. Let j be b(2). Is j bigger than 60? False Suppose 0 = 5n + l + 4l - 5, 3n - 2l = 13. Let w(s) = s*2 - 3s. Let m be w(n). Which is bigger: m or -1/8? m Let z be (3/6 - 0)-10. Let m(a) = 5a*2 - 22a - 4. Let u(q) = -2q2 + 7q + 1. Let b(i) = -4m(i) - 11u(i). Let s be b(z). Which is greater: s or 3/4? 3/4 Let m = -2.3 + 2.52. Let r = -0.78 - m. Is 9 equal to r? False Let y be 44 - ((-12 - -11) + 3). Let c be (-2 + 3 + -44)-1. Which is bigger: y or c? c Let g be 2(5 - 52/8). Let l be (-2 + -3 - g)/((-5)/(-20)). Which is smaller: -4 or l? l Suppose 17o + 2374 = 19o. Is 1187 greater than o? False Let k(p) = -p*3 + 4p*2 + 14p + 43. Let x be k(7). Which is greater: -10 or x? x Suppose 0 = -2j - j + 3q - 15, 0 = -4j - q - 15. Let r be (j/78)/((-10)/45). Suppose 3p = -2p + 15, 0 = k + 5p - 16. Is r less than k? True Let q = -82.019 - -82. Let d = q + 0.019. Do -6.5 and d have the same value? False Let y = -40.7 + 38.7. Is 3/20 bigger than y? True Let d be 3 - 39(-15)/(-198). Let a(n) = -n2 - 2n + 3. Let w(v) = v*3 + 5v*2 + 4v - 3. Let c be w(-4). Let u be a(c). Which is greater: d or u? d Suppose -6g - g = 0. Suppose 3t + h - 3 = -g, -2t + 3h - 9 = 0. Which is smaller: 3/8 or t? t Let c(f) = f + 23. Let y be c(-16). Suppose yo - 5o + 4 = 0. Which is greater: o or -5/6? -5/6 Suppose 219g - 224g = 205. Does -2 = g? False Let d be 0/((-2)/2 - -3) - -5. Which is bigger: d or -4? d Let n(z) = z*3 - 31z*2 + 25z + 81. Let i be n(30). Which is greater: -55 or i? -55 Let c = 1764 - 1740. Which is smaller: c or 177/7? c Let r be (-2)/(-10) - (-192)/15. Suppose 66 = 9t - 3t. Which is greater: t or r? r Let r = -54 + 592/11. Let i(y) = -y*2 + 6y. Let o be i(5). Suppose 5l = -0 - o. Is l greater than r? False Suppose 0 = 2p, 3x - 17p + 19p = 2874. Which is greater: x or 959? 959 Let c(w) = -2w - 13. Let v be c(-7). Let d(u) = -u*2 + u + 70. Let g be d(0). Let o be 1 + (-1)/g74. Which is bigger: v or o? v Let w = -83 - -128. Let j be 9/426/w. Are j and 1 non-equal? True Let y be (-10)/(-45) - 21/(-27). Let x = 1/1775 - 3639/157975. Is x smaller than y? True Let m = -10 - -12. Suppose -18 + 3 = -5a. Let l be 0 + a - (-8)/(-2). Which is greater: l or m? m Suppose 2c + 1 = -9. Suppose 0 = 9j - 6j - 60. Suppose 4l = -j - 0. Are c and l unequal? False Let n = 25 - 32. Let f be (-8)/(-28) - (-261)/n. Which is smaller: f or -1? f Let n be (3/(-9)4)/((-6)/(-567)). Let r be (-7)/(n/(-24)) + 2/6. Is -1 greater than or equal to r? True Suppose -133x + 119x - 154 = 0. Which is smaller: x or 53? x Suppose 4m = -l, -2m + 3l - l = 0. Suppose 3 = 3n - m. Let j be (n - 0)3/(-27). Are -1 and j nonequal? True Suppose -8 = -4h - 0. Suppose 5j + 2t = hj - 9, -11 = -j + 4t. Let a be (-1)/5 - j/(-5). Is -0.05 at least a? True Let i = 111 - 111.2. Do i and -2/5 have the same value? False Let r be -2(-2)/403. Suppose -a = -4b, -3a = 4b - 2 - 14. Which is smaller: r or b? r Suppose 3g - 24 - 13 = -j, -2g + 172 = 5j. Let f be -1 - j/(-4) - (-8)/8. Which is smaller: 9 or f? f Suppose 5y = -5p - 15, 4y - 73 = -2p - 81. Which is bigger: -2/533 or y? -2/533 Let u be (-86)/(-3)(6	{ "pile_set_name": "DM Mathematics" }
- 12g2. Let h(k) = 2j(k) - 5z(k). Let o(y) = 2y*2. What is o(h(l))? 72l*4 Let v(f) = -5f. Let z(o) = -o*2 - 5o. Determine v(z(y)). 5y2 + 25y Let c(r) = -17r2 - 8r. Let s(o) = 11o2 + 5o. Let x(d) = 5c(d) + 8s(d). Let a(f) = -f*2. What is x(a(t))? 3t*4 Let y(d) = 2d*2. Let s(p) = -2162p + 207. Let g(w) = 21w - 2. Let i(n) = -207g(n) - 2s(n). What is i(y(a))? -46a*2 Let k(o) = -3o + 2. Let p(n) = 2n - 3. Let d(m) = -3k(m) - 2p(m). Let i(f) = 1. Let a(t) = -t + 11. Let h(w) = -2a(w) + 22i(w). Give d(h(x)). 10x Let o(d) = 5d2. Let m(q) = -11q*2. Let y(p) = 4m(p) + 9o(p). Let l(r) be the second derivative of -r4/12 - r. What is y(l(h))? h4 Let p(t) = -3t. Let f(v) = -5v + 4. Let l(s) = 4s - 3. Let m(w) = -3f(w) - 4l(w). Give p(m(q)). 3q Let n(h) be the second derivative of h6/60 - h3/6 + 4h. Let q(v) be the second derivative of n(v). Let o(t) = t*2. Give o(q(m)). 36m*4 Let a(d) be the second derivative of 10d + 0d2 + 0 + 0d*3 + 1/6d*4. Let r(o) = 8o. Determine a(r(z)). 128z2 Let f(v) = 7v. Let x(k) be the first derivative of -7k3/3 + 3k*2 + 1. Let q(z) = -13z*2 + 11z. Let d(l) = 6q(l) - 11x(l). Give d(f(i)). -49i2 Let x(h) = -h2 + 3h. Suppose -5u + 3r = 0, 0 = 2u - 5u - 4r + 29. Let i be x(u). Let q(y) = i + 2 - 2 + y. Let w(d) = d. Determine q(w(g)). g Let o(r) = 7r. Let h(q) = -11q2. What is o(h(p))? -77p*2 Let w(f) = -91f - 95f + 184f. Let i(g) = -20g. Calculate i(w(s)). 40s Let f(q) be the second derivative of -5q4/12 + 23q. Let b(u) = 2u2. Determine f(b(i)). -20i*4 Let g(f) = 5f*2. Let a(k) = -4k*2 + 5k - 5. Let q(d) = 10d2 - 12d + 12. Let l(v) = -12a(v) - 5q(v). Determine g(l(u)). 20u4 Let z(k) = -5k*2. Let l(u) = -50u*2. Give l(z(w)). -1250w*4 Let s(u) be the first derivative of -5u*3 - 7. Let a(x) = -x. Give a(s(m)). 15m*2 Let k(g) = 8g*2 + 0g + 0g - 6g*2. Let w(h) = -14h*2. What is w(k(z))? -56z*4 Let d(j) = -16424j. Let f(g) = -3g. Give f(d(q)). 49272q Let f(k) = k2. Let w be (6/5)/((-15)/(-50)). Let m(n) = n2 + 5n2 - wn*2. What is f(m(l))? 4l*4 Let v(m) = -m. Let b(q) = -26q*2 + q. Give b(v(h)). -26h*2 - h Suppose -3f = 2 - 8. Let k(d) = -2 - d2 + f. Let s(q) be the first derivative of -q2 - 1. Calculate s(k(m)). 2m2 Let x(h) be the second derivative of 5h*3/6 + 4h + 1. Let c(m) = 9m. What is x(c(r))? 45r Let a(u) = -4u. Let b(f) = 21f. Calculate b(a(r)). -84r Let u(z) = z2 - 3z*2 + 40 - 107 + 3z*2. Let s(f) = -2f*2. Determine s(u(j)). -2j*4 + 268j*2 - 8978 Let j(q) = -q. Let i(n) = 2n*2 + 3n + 3. Let x be i(-2). Let w(f) = -f - 3f2 + xf*2 + f. What is j(w(v))? -2v2 Let a(g) = g2. Let u(s) = -4s + 4s + 0s - s. What is a(u(p))? p2 Let j(i) = 66i. Let h(d) = -3d2. Determine h(j(r)). -13068r*2 Let y(c) = -6c - 8c + 9c*2 + 11c. Let s(j) = j*2. Calculate y(s(i)). 9i*4 - 3i*2 Let s(h) = 20h*2. Let j(b) = -14b*2. Give j(s(a)). -5600a*4 Let b(x) be the second derivative of -5x*3/6 + 8x. Let j(a) = 4a2. What is j(b(c))? 100c*2 Let n(g) = 162g. Let a(z) = 5z2. What is n(a(c))? 810c*2 Let f(z) = 2z*2 + z + 1. Let u(y) = -15y*2 - 6y - 6. Let m(h) = -6f(h) - u(h). Let j(p) be the third derivative of p5/20 + p2. What is j(m(i))? 27i*4 Let g(w) be the first derivative of -2w3/3 + 2. Let v(m) = m3 - 4m2 - 2. Let y be v(5). Let r(b) = -y + 2b*2 + 23. Determine g(r(j)). -8j*4 Let w(g) = 22g*2. Let v(f) = -413f. Determine w(v(h)). 3752518h2 Let w(n) = -5n - 4. Let l(q) be the second derivative of q*3/3 - 15q. What is l(w(r))? -10r - 8 Let a(d) = 8d2 - d2 - 4d2. Let f(b) = -b2. Determine f(a(q)). -9q4 Let s(m) = -m2 - 1. Let k(f) = -3f2 - 2. Let d(c) = 3k(c) - 6s(c). Let g(n) be the second derivative of n4/12 + 2n. Give g(d(t)). 9t4 Let t(p) = 8p*2 - 4p*2 - 7p*2. Let q(l) = -7l*2. Determine t(q(y)). -147y*4 Let c(f) = 8f*2. Let z(l) be the second derivative of 5l*3/6 + 4l - 1. Calculate z(c(p)). 40p2 Let j(c) be the second derivative of 4c*3/3 - 8c. Let m(s) = 2s. Determine m(j(w)). 16w Let p(v) = -38v2 - v + 6. Let r(b) = -3b. Give r(p(o)). 114o2 + 3o - 18 Let n(q) = 3q2. Let k(g) be the third derivative of g7/2520 - g5/30 + 6g*2. Let v(u) be the third derivative of k(u). Calculate n(v(o)). 12o*2 Let n(o) = -19882o. Let r(u) = u*2. Give r(n(b)). 395293924b*2 Let o(s) = -14s*2. Let h(f) = 4 - 4 + 4f*2 - 3f*2. What is h(o(y))? 196y*4 Let c(o) = -2o*2 + 6. Let w(y) = -4y*2 + 10. Let n(h) = -5c(h) + 3w(h). Let f(p) = -32p*2. Determine f(n(k)). -128k*4 Let f(g) = 9g. Suppose 5n - 5d = 30, -d = 3d + 20. Suppose -3j + n = 5a + 3, 5a = -2j + 2. Let q(y) = a + y2 + y2 - 2. Give q(f(c)). 162c*2 Let l(r) = 3r*2. Let j(w) = 7w*2 - 6w*2 - 3w*2. What is l(j(n))? 12n*4 Let k(x) = -9x*2 - 3. Let l(r) = 27r. Give l(k(h)). -243h2 - 81 Let o(c) = -38c. Let s(u) = -u. Give s(o(t)). 38t Let j(b) = b. Let l(q) = 500q - 1. Determine l(j(i)). 500i - 1 Let x(r) = 6r. Let s(l) = 2l + 56l*2 - 2l - 45l2. Give s(x(k)). 396k*2 Let o(b) = -77b2. Let t(u) = u2. Give o(t(a)). -77a4 Let u(b) be the first derivative of -3b*2/2 - 3b + 14. Let i(g) = 2g. Give i(u(p)). -6p - 6 Let y(v) = -143v2 + 2v + 2. Let k(a) = -2a2. What is y(k(z))? -572z*4 - 4z*2 + 2 Let r(v) = -2v*2. Let f(m) = 7m + 2m + 4m. What is r(f(j))? -338j2 Let d(k) = -72k + 19 - 41 + 22. Let q(r) = -r*2. What is q(d(s))? -5184s*2 Let c(v) = -2v - 3. Let r(p) = 3p + 5. Let q(o) = -5c(o) - 3r(o). Let g(w) = -4w*2. Give q(g(l)). -4l*2 Let i(o) = 2050o. Let v(p) = p*2. Determine i(v(c)). 2050c2 Let h(z) = -z2. Let l(i) = 7i2 + 7i. Let x(q) = -4q2 - 3q. Let t(a) = 6l(a) + 14x(a). Calculate h(t(s)). -196s4 Suppose -4r = -0r + 24. Let y be 1 - (r/(-3))/(-2). Let q(i) = 3i + 0i - yi. Let t(n) = -n2. Calculate q(t(u)). -u2 Let t(v) = -2v2. Let o(l) = -l2. Let r(w) = -4o(w) + 3t(w). Let q(k) be the second derivative of 0k*2 - 1/3k*3 - 3k + 0. What is r(q(i))? -8i2 Let g(d) = d. Let j(v) be the third derivative of v4/8 + 13v*2. Calculate g(j(u)). 3u Let k(y) = -y*3 - 5y*2 - 6y - 6. Let j be k(-4). Let t(w) = -2 + j + 0w + w. Let d(h) = 2h. Give t(d(r)). 2r Let j(k) = -84k*2 + 3. Let g(a) = 2a. Determine g(j(f)). -168f2 + 6 Let v(j) = 3j. Let g(s) = -35s - 23. What is g(v(n))? -105n - 23 Let j(h) = -228h - 227h + 459h. Let w(o) = -2o. Give w(j(r)). -8r Let d(q) be the third derivative of 0q + 0q3 - 6q*2 + 0 - 1/24q4. Let f(j) = j2. Give f(d(y)). y*2 Let g(w) = 9w. Let v(d) = 4d + 6. Let c(t) = -4t - 7 + t - 2t. Let j(i) = 6c(i) + 7v(i). What is g(j(z))? -18z Let q(o) = -6o + 3o - 2o2 + 3o. Let a(l) = -3 + 3 + 4l. Determine q(a(z)). -32z*2 Let o(z) = -5z*2. Let h(c) = 21c. What is h(o(t))? -105t2 Let y(w) be the first derivative of w2/2 + 13w + 13. Let j(v) = -2v. Calculate y(j(g)). -2g + 13 Let y(b) = 5b. Let d(q) = 4q - 2. Suppose 2m = -3p, -m + 0m + 1 = 2p. Let r = 3 - 6. Let i(k) = 5k - 3. Let s(c) = pi(c) + rd(c). Calculate y(s(o)). -10o Let k(v) = -v*2 - v - 1. Let s(b) = -12 - 14b - b + 2b + b - 24b*2. Let c(f) = 12k(f) - s(f). Let p(j) = 2j2. Determine c(p(a)). 48a*4 Let w(s) = 13s. Let k(z) = 19z - 1. Determine k(w(q)). 247q - 1 Let q(b) = 3b. Let j(w) = -4w. Let u(i) = -5j(i) - 7q(i). Let y(p) = p2 - 21. Determine u(y(d)). -d2 + 21 Let g(a) = a. Let w(h) = h*2 - 2h + 2. Let y be w(0). Let u(k) = -2 - 12k + y + 10k. Give g(u(j)). -2j Let r(z) be the third derivative of z5/12 - 3z*2. Let a(t) = t. Calculate a(r(h)). 5h*2 Let o(q) = -q - 2. Let l(r) = 3. Let y(v) = -4l(v) - 6o(v). Let n(m) = m. Determine n(y(u)). 6u Let f(s) = -2s2 - 6s*2 + 2s2. Let c(r) = -r2 - 1. Let k(o) = o*2 + 2. Let a(w) = 2c(w) + k(w). Determine f(a(b)). -6b4 Let j(f) = -2f*2. Let o(k) be the third derivative of -7k*6/360 - 5k*4/12 + 4k*2. Let x(c) be the second derivative of o(c). Give x(j(m)). 28m*2 Let q(h) = -3h**2	{ "pile_set_name": "DM Mathematics" }
l) + 37 + 6 + l - 6. -241l + 37 Expand (5f - f - 3f)(f + 9f - 14f)(14 + 12 - 1). -100f*2 Expand (4m*4 + 5m - 5m + (4m*2 - 2m*2 + 0m*2)(m*2 + 3m - 3m) - 2m*3 + 2m*3 + 2m*4)(-1908 + 2512 - 1804). -9600m4 Expand (-24d*2 - 2 - 46d*2 + 12d*2)(7d - 6d + 9d)(0 - 3 + 1). 1160d3 + 40d Expand (2 + 2p - 2)(-5p2 + p2 + 6p*2) - 3p*3 + 1 - 1 - 736p*3 - 1337p*3 + 2857p*3. 785p*3 Expand (240 + 291 - 160 + 126)(4z + 2z - 3z)(-z*2 - 3z*2 + 0z*2). -5964z*3 Expand (2864 + 374f - 2864 - 846f)(-f2 - f2 + 3f2). -472f*3 Expand (-1 + 5 - 11)(0f3 + f3 + f3)(-6 - 1 + 6)(9f + 12f - 4f). 238f4 Expand (4839 + 2117 - 1189 + 5482 + 2382)(t - 4t - 6 + t). -27262t - 81786 Expand (-z*3 - 2z*3 + 12z*3)(0 + 6 - 3)(3 + 3 - 2). 108z*3 Expand -19 + 6 - 2l + 21 + (2 - 2 - 2)(-63l + 23l - 105l). 288l + 8 Expand -79235g*2 + 79235g*2 - 3214g*4 + (5g3 + g3 - 4g3)(-3g + 2 + 0 + 0). -3220g*4 + 4g*3 Expand (-46 + 46 + n)(4 + 2 - 2 - 7 + 8 + 15 + (0 - 1 + 0)(1 - 2 + 2) + 1 - 2 + 3). 21n Expand (-1 - 8 + 2)(-4 + 4 + 3n + (-56405 + 56405 - 155n)(4 + 0 - 6)). -2191n Expand -1 - x2 + 1 - 3x*2 - 2x*2 + 3x*2 + (4x - x - 2x)(-x + 2x + 0x) + (-1 + 1 + 2x)(3 - 5 - 10)(8x - 3 + 3). -194x2 Expand (927k + 233k - 19k)(-k + 5k - 2k)(-1 + 5 - 2). 4564k2 Expand (27 + 226 + 156)(7s - 9s - 1 - 3). -818s - 1636 Expand (-97 + 97 - 3j)(j2 + 4j*2 + 2 - 2j*2)(2j + 0j + 0j)(6 - 2 - 1). -54j4 - 36j*2 Expand (5r + 29 - 66 + 3r)((3r2 + 2r*2 - 3r*2)(0r2 - 4r*2 + 2r*2) - 11r*4 + 2r*4 - 11r*4). -192r*5 + 888r*4 Expand (2u - 5u + 18u)(14u*4 - 28u*4 + 21u*4). 105u*5 Expand -3w*2 + 0 + 0 + (0w*2 + 5w*2 - 3w*2)(2 - 2 + 1) - 2w + 2w + 2w2 + (-5200 + 2947 + 2623)(-w*2 - 2w*2 + 0w*2). -1109w*2 Expand (-95r - 75r + 16r)(-42r*2 - 5r*3 + 42r*2) + (3r - r - r)(-2r3 - r3 + 4r3) + r2 - 3r4 - r2. 768r4 Expand (2 + 1 - 5)(-2q2 + 2q*2 + 2q*2) + 5q*2 - 5q2 + q2 + 4q2 - 2q*2 - 3q*2 - 3q*2 - 5986q - 403q + 4q*2. -3q*2 - 6389q Expand (-2 - 1 + 4)(-162u + 9 + 8 + 164u). 2u + 17 Expand d*4 - 2d*4 + 2d*4 - 23d*4 + 12d*4 + 9d4 + d - d - d4 + d3 - d3 + d*4 + (-2d*2 + 0d*2 + 3d*2)(-d*2 - 5d*2 + 4d*2). -3d*4 Expand (-5d + d*2 + 5d)(1 - 1 + 2d*2) + (5d*2 - 4d*2 - 2d*2)(915d - 136519 + 136519)(2 - 2 + 2d). -1828d*4 Expand (16 + 19 - 1283z - 36)(-5 + 0 + 2). 3849z + 3 Expand (o - o + 3o2)(-144 - 186 + 78) + (-10o + 10o - 9o2)(-2 - 1 + 1). -738o2 Expand (-3g + 2g + 2g)(4g*4 - 7g*4 + 4g*4) + (-5g - 2g4 + 5g)(-132g + 109g + 110g). -173g5 Expand (2r - 5r + 2r)(-r2 + r - r)(5144r + 1087r - 262r). 5969r*4 Expand (-4 + 4 - 1 + (0 + 2 + 0)(-2 - 2 + 5) - 5 + 1 - 17 - 3 + 5 + 0)(-9k + 24k - 60k). 810k Expand (5v - 2v - 2v)(378v - 370v + 2 + 0). 8v*2 + 2v Expand (-3m + 0m + 2m)(-733 + 1527 + 1443)(0 + 0 - 6). 13422m Expand (-2 + 617n + 4 - 342n)(-n - 4n + 4n) + (-n + n - 2n)(0n - 3n + 2n) + 5n2 - 4n*2 + 0n2 + n2 + 0n2 + 0n*2. -271n*2 - 2n Expand (2d2 - 3d*2 + 2d*2)(4 - 3 - 8) + 25d2 - 1473 + 1473. 18d*2 Expand (-j - 79 - 3j + 6j)(8 - 1 - 3). 8j - 316 Expand (-2 + 4 + 1)(5f - f - 29f)(-3 + 2f + 3)(-2f + f - f). 300f3 Expand (71h - 106h + 33h + 891)(-1 - 2 + 4). -2h + 891 Expand (j + 3j - 3j)(-11 - 3 - 1) - 220 + 16j - 225 + 441. j - 4 Expand -3p3 + 0p + 0p + (-2p + p + 7p)(-2 + 2p2 + 16 + 0) - p3 - 1 + 1 + (p2 + 4p*2 - 7p*2)(-p - 1 + 1) + 0 + 0 - p*3. 9p*3 + 84p Expand (1205j - 634j - 613j)(1 - 1 + 1 + (-3 + 6 - 1)(-5 + 1 + 2) - 3 - 1 + 3) + (-6 + 3 + 2)(-j + 3j - j). 167j Expand (553p + 806p - 1361p - 2441)(3 + p*4 - 3). -2p*5 - 2441p*4 Expand (-3w + 4w - 2w)(-1 + 1 - 2w) + 46006 + 1948w2 - 46006. 1950w*2 Expand (2n - n + 0n)(n*3 + 0n3 + n3) + ((-n*2 - 3n + 3n)(0n - n + 3n) - 3n3 + 2n3 - n3 - 5n3 + 8n*3 - 9n*3)(2n - 12n - 5n). 152n*4 Expand (0 - 2 + 0)(0 + 0 + x)(43 + 40 - 53). -60x Expand ((-l + 0l + 3l)(0 + 0 - 5) + 0l + 3l - 6l)(127l*3 + 19l*3 + 159l*3). -3965l*4 Expand (4 - 4 + s)(3 + 4 - 1 + (0 - 1 + 3)(-2 + 1 - 1)) + (s + 8s - 6s)(0 + 5 - 2). 11s Expand (2q - 2q - 2q*2)(-1 + q + 1) - 5q3 + 4q*2 - 4q*2 + 54q - 17q3 - 54q + (0 + 3 - 5)(4q*3 - 2q3 - q3). -26q3 Expand (-3q + q + 4q)(105q2 + 221q*2 - 70q*2)(1 - 1 - 4q). -2048q4 Expand n2 - n*2 + 3n*2 + (-n + 3n + 0n)(-5n - 4 + 4) + 2n*2 - 3n + 3n + (0n2 + n2 - 3n2)(-1 + 2 + 2) + n*2 - 3n*2 + n + 0n. -13n2 + n Expand (-3g2 - g2 + 6g2)(-6 + 7g2 + 6) + (86g - 83g + 37g)(2g*3 - 4g + 4g) + 0g4 + 4 - 6 - g4. 93g4 - 2 Expand 2k*3 + 9k*2 - 9k*2 + (-5 + 5 + 4k*2)(3k - 3k + k)(-113 - 267 - 86). -1862k*3 Expand (1 + 0 + 1)(-746k + 885k + 854k)(-2 + 0 + 0)(0k - 5k + 3k). 7944k2 Expand (0 + 4 - 3)(-3w - w + 5w) + (5w - 5w - 2w)(1181 - 2625 + 933) - 9w + 1 + 1 - 4. 1014w - 2 Expand (-4q - 3 + 3)(-2 + 1 + 5)(-q2 + q2 - 2q3) + (-q4 - 1 + 1)(1 + 123 + 28). -120q*4 Expand (353g*2 + 22g - 27 + 24 - 356g2)(18g - 634 + 634). -54g*3 + 396g*2 - 54g Expand 874z4 - 2z*2 + 39 - 872z*4 - 13 + (2z*4 - 4z + 4z)(4 + 3 - 5) + 3z4 - 2z*4 - 2z*4 + 3z*4 - 3z*4 + 2z*4. 7z*4 - 2z*2 + 26 Expand (3h*4 - 8h*4 - 3h4 + (-h2 + 0h2 - 2h*2)(-4h2 + 2h*2 + 4h*2))(-2h + 1 - 1)(-7 + 11 - 9). -140h5 Expand (4p*2 + 116p - 116p + 47)(2p2 + p2 + 0p*2) + 6p*4 - 4p*4 - 3p*4. 11p*4 + 141p*2 Expand -15g*2 - 16g*2 + 29g*2 + 10g + (-59 - 17g + 59)(-g - 1 + 1). 15g2 + 10g Expand 2a + 2a*4 - 2a + 5a + 3a*4 - 5a + (-4a3 + 3a*3 + 4a*3)(19a + 0a + 15a). 107a*4 Expand (3s*2 + 2s - 3s - 4s*2)(-5s + 4s - 5s) - 663 + 191s*3 + 663. 197s*3 + 6s*2 Expand 4q*4 - 2q*4 - 5q*3 - 4q*4 + (-9q + q + 13q)(10q3 + 3q*3 + 2q*3). 73q*4 - 5q*3 Expand 7a - 3a - 2a + (-5 - 20 + 7)(-21a + 903 - 903) + (1 - 1 - 1)(3a - 4a - a). 382a Expand (4 - 4 - 2)(q - 2q*3 - q) - 1542q + 812516 + 2q3 - 812516. 6q*3 - 1542q Expand (133 - 133 - 61k2)(-2 + k - 6k + 9k). -244k3 + 122k*2 Expand -3i*3 + 4i*3 - 3i3 + (-i2 - 2i2 + i2)(-2i + 2i + 4i) + 0i*3 - 340i*2 + 4i*3 + 228i*2 - 446i*2. -6i*3 - 558i*2 Expand (3 + 0 - 1 + (12 + 0 + 7)(-2 + 2 - 1) - 1 + 4 - 1 + (-5 + 0 + 4)(-3 + 4 - 3) + 1 - 5 + 0)(9f - 13f + 0f + (5 - 1 - 2)(-f + f - f)). 102f Expand (-2b + 0b + b)(30b - 243b - 1483b) - 4b*2 + 5b*2 - 3b*2. 1694b*2 Expand (-193 + 2 + 16)(-d*3 + 3d*3 - 4d*3)(-4d + d + d)(25 - 27 + 17). -10500d4 Expand (-1 + 1 + 2v*2)(2 - 11 - 17) + (-72 + 72 - 17v)(-v + 0v + 2v). -69v2 Expand (0 + 1 + 0)(-12j - 15j + 18j)(3j + 13 - 13) + (-2 + 6j + 2)(-1 + 1 + j) + 2j2 - j2 - 3j2. -23j*2 Expand (720 - 720 - 162o)(9o*4 + 21o*4 + 3o*4). -5346o*5 Expand (-5j + 0j + 3j)(1 - 19 - 7) - 5j - 2j + 5j + 35j - 14j - 18j. 51j Expand (-2 - 1 + 4)(2 + 3 - 4)((2j + 0j - j)(-1 + 0 - 1) + 44j - 29j - 44j). -31j Expand (-20u*2 + 53u - 53u + (-9u + 326 - 326)(-2u + 2u + u))(-u - 3 + 3). 29u3 Expand (-9 - 11 - 3)(73b2 + 240b*4 - 73b*2 + 1194b*4). -32982b*4 Expand (20 + 43 + 0)(-b - 8b + b) + (-4b + 0b + 5b)(2 + 2 - 6). -506b Expand (3a + 2a - 4a)(-8a + 8a - 6a2) - a3 - 2a*3 + 0a*3 - 4 + 3a*3 + 4 + (-3 + 2a*2 + 3)(3a + 0a - a) - 4a3 + a3 + a + a3. -4a*3 + a Expand (-2i*3 + 75i*2 + 31i*2 - 52i*2)(2 - 2 + i) + (1 - 3i2 - 1)(3 + i*2 - 3). -5i*4 + 54i*3 Expand (-1 - 2 + 1 + (22 - 37 + 21)(-1 + 0 - 1))(-4l - 3l - 5l)(-l2 - 4 + 4). -168l*3 Expand (2q + 0q - q)(-3q3 + 2q*3 + 2q*3) - 36q*4 + 245q*4 + 283q - 284q. 210q*4 - q Expand (-3n - 4n + 4n)(n4 + 2n*4 + 2n**	{ "pile_set_name": "DM Mathematics" }
. What is prob of sequence ege? 1/3 Two letters picked without replacement from {n: 1, j: 8, a: 4}. Give prob of sequence na. 1/39 Two letters picked without replacement from {m: 5, w: 5}. Give prob of sequence ww. 2/9 Calculate prob of sequence eccc when four letters picked without replacement from ocecc. 1/20 What is prob of sequence eie when three letters picked without replacement from {e: 2, a: 7, i: 1}? 1/360 Four letters picked without replacement from {p: 6, q: 6}. What is prob of sequence pppq? 2/33 Four letters picked without replacement from kkykkyvkkykkyyykkvyk. Give prob of sequence kvkk. 11/646 Calculate prob of sequence iin when three letters picked without replacement from ninni. 1/10 Calculate prob of sequence yy when two letters picked without replacement from {h: 1, y: 3}. 1/2 Calculate prob of sequence cco when three letters picked without replacement from {o: 6, c: 2}. 1/28 What is prob of sequence vxr when three letters picked without replacement from {v: 2, r: 2, x: 2}? 1/15 Two letters picked without replacement from ftwmwwwbmwwwtw. What is prob of sequence fm? 1/91 Three letters picked without replacement from kcckuccukkcukukkkck. What is prob of sequence kkk? 28/323 Calculate prob of sequence ett when three letters picked without replacement from {e: 3, t: 2}. 1/10 What is prob of sequence fm when two letters picked without replacement from mffmffmmmmfmfbfmfmfm? 9/38 What is prob of sequence sss when three letters picked without replacement from kkqssskkk? 1/84 Calculate prob of sequence gggz when four letters picked without replacement from {z: 13, g: 5}. 13/1224 Three letters picked without replacement from {l: 4, c: 6}. Give prob of sequence llc. 1/10 Three letters picked without replacement from {c: 7, a: 4, g: 3, w: 1, o: 2}. What is prob of sequence cwo? 7/2040 What is prob of sequence eic when three letters picked without replacement from eeyuewcwiucc? 3/440 What is prob of sequence feef when four letters picked without replacement from {f: 2, e: 3}? 1/10 What is prob of sequence ms when two letters picked without replacement from {e: 2, s: 1, h: 1, y: 4, m: 2}? 1/45 Four letters picked without replacement from {c: 1, u: 3, r: 8, k: 3, g: 3}. What is prob of sequence kugk? 1/1360 What is prob of sequence vw when two letters picked without replacement from luuwwuuwuwqlwvu? 1/42 What is prob of sequence hlz when three letters picked without replacement from {l: 9, z: 1, h: 1, u: 1}? 3/440 Calculate prob of sequence nrp when three letters picked without replacement from dsnspxr. 1/210 Four letters picked without replacement from xrrcxc. Give prob of sequence rxrc. 1/45 What is prob of sequence jyo when three letters picked without replacement from {v: 1, j: 3, y: 2, f: 3, o: 2, x: 1}? 1/110 Three letters picked without replacement from {u: 1, n: 1, q: 2, b: 2, s: 2, e: 1}. Give prob of sequence qeq. 1/252 What is prob of sequence sb when two letters picked without replacement from hhhbbsbs? 3/28 Two letters picked without replacement from ddrrhdhtdrhhhh. What is prob of sequence td? 2/91 What is prob of sequence ptt when three letters picked without replacement from pppttptpppp? 8/165 Four letters picked without replacement from iiiiiiijiiiji. Give prob of sequence jjii. 1/78 Calculate prob of sequence ccc when three letters picked without replacement from {c: 4, m: 2, i: 2, w: 2, x: 3}. 2/143 What is prob of sequence xqq when three letters picked without replacement from {x: 2, b: 1, q: 2}? 1/15 Two letters picked without replacement from tddrdtddtcgry. Give prob of sequence dg. 5/156 Four letters picked without replacement from tklmttmkttfmtwtlwtww. Give prob of sequence fmmw. 1/4845 Four letters picked without replacement from {j: 5, y: 14}. Give prob of sequence jjyy. 455/11628 Four letters picked without replacement from {u: 1, p: 3}. Give prob of sequence pupp. 1/4 Four letters picked without replacement from ppkpppkp. Give prob of sequence kpkp. 1/28 Four letters picked without replacement from {t: 7, x: 4}. What is prob of sequence xttt? 7/66 Four letters picked without replacement from {f: 13, m: 3}. What is prob of sequence mmff? 3/140 Calculate prob of sequence yqnq when four letters picked without replacement from {y: 6, n: 2, q: 5}. 2/143 Three letters picked without replacement from {i: 3, n: 5, p: 4}. Give prob of sequence npi. 1/22 Three letters picked without replacement from {b: 1, j: 1, e: 2, d: 1, f: 1, a: 2}. Give prob of sequence abj. 1/168 Three letters picked without replacement from {l: 3, g: 1, h: 2, q: 1}. Give prob of sequence lhq. 1/35 What is prob of sequence vlyr when four letters picked without replacement from {r: 1, y: 2, l: 2, v: 1, z: 1}? 1/210 What is prob of sequence tbi when three letters picked without replacement from {b: 3, w: 2, t: 5, i: 5}? 5/182 What is prob of sequence zzzz when four letters picked without replacement from {z: 5}? 1 Two letters picked without replacement from iiiiii. What is prob of sequence ii? 1 Three letters picked without replacement from {m: 12, r: 4, n: 2, v: 1}. Give prob of sequence nmr. 16/969 What is prob of sequence yjj when three letters picked without replacement from {y: 3, j: 2}? 1/10 Four letters picked without replacement from gggiddggigiiigii. What is prob of sequence dggg? 1/104 What is prob of sequence um when two letters picked without replacement from uvudehmv? 1/28 Calculate prob of sequence cyz when three letters picked without replacement from {v: 3, k: 4, z: 1, h: 1, c: 2, y: 1}. 1/660 Two letters picked without replacement from {l: 2, p: 2, f: 9, y: 3}. What is prob of sequence lp? 1/60 Three letters picked without replacement from {p: 7, j: 4, d: 5}. What is prob of sequence djp? 1/24 Three letters picked without replacement from xokkxkok. Give prob of sequence oxo. 1/84 Calculate prob of sequence jl when two letters picked without replacement from pmdmmmjmddmdlmmdjl. 2/153 Three letters picked without replacement from hppe. What is prob of sequence pph? 1/12 Calculate prob of sequence gggg when four letters picked without replacement from {g: 7}. 1 Four letters picked without replacement from yryyyryeyy. Give prob of sequence rryy. 1/60 What is prob of sequence uu when two letters picked without replacement from {e: 1, y: 2, k: 4, r: 1, g: 2, u: 2}? 1/66 What is prob of sequence utt when three letters picked without replacement from tutuuuuuuuuuuuuuut? 5/272 What is prob of sequence vuv when three letters picked without replacement from vvuccuvc? 1/28 Two letters picked without replacement from {i: 2, y: 1, q: 1, o: 1}. What is prob of sequence yi? 1/10 Four letters picked without replacement from ggakctxggxcx. What is prob of sequence aggc? 1/495 Calculate prob of sequence asss when four letters picked without replacement from {s: 9, p: 2, a: 6}. 9/170 What is prob of sequence bc when two letters picked without replacement from abgcbcgaaacggcggcg? 5/153 Four letters picked without replacement from {s: 1, d: 2, z: 2, j: 1, c: 1}. What is prob of sequence scjc? 0 Two letters picked without replacement from {g: 2, d: 1, c: 1, v: 1, r: 1, e: 2}. What is prob of sequence ce? 1/28 Calculate prob of sequence yoi when three letters picked without replacement from {y: 2, o: 1, d: 12, i: 1, p: 1}. 1/2040 What is prob of sequence ccrr when four letters picked without replacement from crcsccscccrcxczccsr? 55/7752 Four letters picked without replacement from frrrrrrxrrrrrx. What is prob of sequence rfxx? 1/1092 What is prob of sequence gg when two letters picked without replacement from glxgl? 1/10 What is prob of sequence hqqq when four letters picked without replacement from {p: 2, q: 1, h: 1, a: 1}? 0 Four letters picked without replacement from {g: 9, t: 3}. Give prob of sequence tgtt. 1/220 Three letters picked without replacement from {e: 9, f: 1, d: 1}. What is prob of sequence eef? 4/55 What is prob of sequence fp when two letters picked without replacement from gpvhgpfpfppghhfhhfhf? 5/76 Four letters picked without replacement from vfgqpff. Give prob of sequence fggf. 0 Two letters picked without replacement from {o: 3, m: 1, x: 1, u: 12, t: 1, q: 1}. Give prob of sequence qm. 1/342 Two letters picked without replacement	{ "pile_set_name": "DM Mathematics" }
Differentiate -842676q4 + q3 + q - 267121. -3370704q*3 + 3q*2 + 1 What is the derivative of -2q*4 + 5872q*3 - 2154 wrt q? -8q*3 + 17616q*2 What is the first derivative of -3k*3 - 646k*2 - 2k + 15708 wrt k? -9k2 - 1292k - 2 Differentiate -7699d2 + 25861 wrt d. -15398d What is the first derivative of 4483c2d*2 - 38c*2d + 956702c2 wrt d? 8966c*2d - 38c2 Find the third derivative of -2064066y*5 - 6y*2 - 108837y wrt y. -123843960y2 What is the third derivative of -22c*3hz2 - 9798c*3hz - c2hz + c2h - c*2z - 305chz2 - 6cz2 - 5z wrt c? -132hz*2 - 58788hz Find the second derivative of -66271r*4 + 2r*3 + 14039r. -795252r2 + 12r What is the second derivative of -187512n5 + 5n + 302470 wrt n? -3750240n3 What is the second derivative of -437f*3s + 4f3 + 2f*2s - 2f2 + 18fs + 83f - 4s wrt f? -2622fs + 24f + 4s - 4 What is the third derivative of -x5 + 21x*4 - 120x*3 + 83724x*2 wrt x? -60x*2 + 504x - 720 What is the first derivative of -531m3w + 15mw*2 - 4w*2 - 23 wrt m? -1593m*2w + 15w2 Find the first derivative of 20n*3 - 2n*2 + 8470n + 5573476. 60n2 - 4n + 8470 Find the second derivative of -2944u3 - 370u*2 - 723627u + 1 wrt u. -17664u - 740 Find the first derivative of -230851w*3 - 80235. -692553w*2 What is the third derivative of 8069j*6 + 2j*4 + 3j*3 - 323123j*2? 968280j*3 + 48j + 18 What is the third derivative of -66b4 - 13213b*3 - 54457b*2 + 5b? -1584b - 79278 What is the third derivative of 1379848f*5 - 720365f*2? 82790880f*2 Find the first derivative of -126072cx + 21447c - 1 wrt x. -126072c Find the second derivative of -1550917q*3 - 515121q wrt q. -9305502q Find the second derivative of -13l*4 - 3l*3 + 17l*2 + 19869l. -156l2 - 18l + 34 What is the second derivative of 195m3r + 430m2r*2 + 102mr2 - 2mr + 25r*2 - 5r wrt m? 1170mr + 860r2 Find the second derivative of 2d*2hi + 8d*2h - d*2i + 292di + h + 10i wrt d. 4hi + 16h - 2i What is the derivative of 63h*2 + 4772h + 833061? 126h + 4772 Find the second derivative of -177416cr2 + 29cr - 14c - r*2 - 47 wrt r. -354832c - 2 What is the derivative of 5x4 - 64160x*2 + 1633473 wrt x? 20x*3 - 128320x What is the second derivative of -2n4 + 6n*3 - 205n*2 + 8n + 3932? -24n2 + 36n - 410 Find the first derivative of -11gwz + 43gw + 69g + 41w + 14776z wrt w. -11gz + 43g + 41 Find the third derivative of 2m*4 + 608072m*3 + 1073725m*2 wrt m. 48m + 3648432 Find the second derivative of -5390l4y*2 - 17l*2y*2 - 198ly2 - 28y*2 wrt l. -64680l*2y*2 - 34y*2 Find the second derivative of -13089z*2 - 45698z wrt z. -26178 What is the second derivative of 7b4u - 21466b3u*2 - 5bu2 + 2bu + 2u - 2205 wrt b? 84b2u - 128796bu*2 Find the third derivative of -43i*5 - 3302i*3 - 6191i*2 - 2i - 6. -2580i2 - 19812 Find the first derivative of -309379d*4 - 213477 wrt d. -1237516d*3 What is the second derivative of 80g*3l3 + g3l2 + 129g*3l - 3gl*2 - 2gl - 2l*2 + 18 wrt l? 480g*3l + 2g3 - 6g - 4 What is the second derivative of -80110q2 + 54936q? -160220 What is the second derivative of 179661tu*4 + 11tu + 2t - 28u - 70 wrt u? 2155932tu2 Find the second derivative of 833px2 + 142px + 249x*3 + 415x - 4 wrt x. 1666p + 1494x What is the second derivative of 33l3 - 1478l*2 + l - 176596 wrt l? 198l - 2956 What is the first derivative of -26553s3 - 43950 wrt s? -79659s*2 What is the third derivative of -304293l*3n*5 - 2l*3n + l*3 + 129l*2n*2 - 4l*2 - l wrt n? -18257580l*3n*2 Find the third derivative of 187389d*3 + 3d*2 - 16138. 1124334 What is the second derivative of -40v*3 + 1036v*2 - 245v - 183? -240v + 2072 Find the third derivative of -1158f*4m + 584f3m*2 - 1888f*2m*2 + m wrt f. -27792fm + 3504m*2 Find the second derivative of -272w*2y*3 + 198w*2y - 3wy*3 - 691077wy wrt w. -544y*3 + 396y Find the second derivative of -44425l5 + 31781l wrt l. -888500l3 What is the third derivative of -121887i*3 - 62i*2 + 2i - 392 wrt i? -731322 Find the third derivative of -1354707t3 + 5545607t*2 wrt t. -8128242 Find the third derivative of -246r*4v - 10r3v + 32r3 - 2r*2v + 48r2 - 1731rv + 3r wrt r. -5904rv - 60v + 192 Differentiate -29236cd + 2c + 102618d with respect to c. -29236d + 2 Find the second derivative of -5608421j2qw + 6801jqw - 2jq + 9qw + q + 2w wrt j. -11216842qw What is the derivative of -4s*3x*3 - 288003s*2x*3 + 78920x*3 wrt s? -12s*2x*3 - 576006sx3 What is the third derivative of -2x*6 + 2x*5 - 1004x*4 + 3027x*2 + 1 wrt x? -240x*3 + 120x*2 - 24096x What is the third derivative of 165331j5 - 3j*4 - 21315j*2 - 6j wrt j? 9919860j2 - 72j What is the second derivative of -433791y2 + 490373y? -867582 What is the second derivative of 1468k2p*2z*2 + 2k*2pz2 + 151kp4z - kpz*2 + 29kp + 4kz2 + 41pz wrt p? 2936k*2z*2 + 1812kp2z Differentiate 469726fo*2 + 3701435o*2 with respect to f. 469726o*2 Find the third derivative of -85925a*3 - 5563a*2 wrt a. -515550 Find the second derivative of 2b*2s*3 + 214b*2s*2 + 41b*2 - 2bs2 - 10b + 4s2 - 8s wrt s. 12b2s + 428b2 - 4b + 8 Find the third derivative of 43a3m*3u + 40a3m3 + a3mu - 2a2m*2u + a*2mu - 8a*2m + 12amu + m3 wrt a. 258m*3u + 240m3 + 6mu What is the third derivative of 23ho4 - 2ho3 + 93291h + 1013o5 - o2 + 2o wrt o? 552ho - 12h + 60780o*2 Find the third derivative of -3d*3j*3 + 119d*3j*2 + 5d*2j*3 - 46dj3 + 30j*2 wrt j. -18d*3 + 30d*2 - 276d Find the third derivative of -122828x3 - 25x*2 - 5x + 4. -736968 Find the first derivative of -47ls*3 - 98730l - 256s3 wrt s. -141ls2 - 768s*2 What is the derivative of 2ag2 - 170ag + 193a - g*2 - g - 430 wrt a? 2g*2 - 170g + 193 What is the third derivative of -r*2v3 - r2v2 - 73r*2v - 70568rv*5 - 4rv2 - 53r wrt v? -6r2 - 4234080rv2 What is the second derivative of -375r*3t*3 - 28r*3t*2 - 2r*3t + 2r2 + 9rt - 26r wrt t? -2250r3t - 56r3 Find the second derivative of 29131u3 + u2 + 2u + 215526 wrt u. 174786u + 2 What is the second derivative of 331262o3 - 67o + 154 wrt o? 1987572o What is the third derivative of 39d*4 + 33d3 + d2 + 4140d wrt d? 936d + 198 Differentiate -65o2w - 17o2 + 39ow - w + 16254 with respect to o. -130ow - 34o + 39w What is the derivative of 102r*3 - 26r*2 + 2r + 134268? 306r2 - 52r + 2 What is the derivative of -1269966b - 670350 wrt b? -1269966 What is the third derivative of -4kor*2 + 5196kr3 - 7k + 7o2r*3 - 14o*2r*2 - 3r wrt r? 31176k + 42o*2 What is the first derivative of 27363a*4 + 42465? 109452a*3 Find the second derivative of 294r*5 + 544r*3 - 2656534r. 5880r3 + 3264r Find the third derivative of -a*2u*3 + 61a*2u2 - a2u - 2au3 - 18au2 + 70a - 793681u3 wrt u. -6a*2 - 12a - 4762086 Find the second derivative of -2f3nx2 - 2382f*3n - 15031f3x*2 - 2f*2x + n wrt x. -4f3n - 30062f3 Find the second derivative of 381715t*4 + 591432t wrt t. 4580580t2 What is the derivative of 2t*4 + 267t*3 - 22t*2 - 39241? 8t*3 + 801t*2 - 44t Find the third derivative of -231q6 - 3q5 - q3 + q*2 - 3252q + 1. -27720q3 - 180q*2 - 6 Find the second derivative of 7z*4 + 6z*3 - 76z*2 + 1969z + 7 wrt z. 84z2 + 36z - 152 What is the derivative of -2t2 - 52334t + 156673 wrt t? -4t - 52334 Find the first derivative of p3 + 2p*2 + 155p + 29397. 3p2 + 4p + 155 What is the third derivative of -1305a3o*3y + a*3o*3 + 409a*3oy + 59a*3o - 4o3y + 2o2 wrt o? -7830a*3y + 6a3 - 24y Find the third derivative of -113h4u + 6h4 + 2h*3u -	{ "pile_set_name": "DM Mathematics" }
e -156k = 133k - 258k. What is the smallest value in -25, -1/11, -1/3, k? -25 Let d = 485/4 - 120. Let t = -2251.3 - -2248.3. What is the biggest value in t, d, 4, -2? 4 Suppose -4b - 2f + f - 60 = 0, 0 = -2b + 5f - 52. Let u = b + 19. Suppose -14 = -us - 5h, s - 6 = -4s - 4h. What is the smallest value in s, 0.4, -4, 5? -4 Suppose -2102h = -2104h + 6. What is the second biggest value in h, -1, -63? -1 Let b = 2950 - 2950. Let p = -1.3 - -7.3. What is the third biggest value in 5, b, p, -3? b Let q = -11.1 - -0.1. Let y = q - -11. Suppose -12g - 6 = -18g. What is the third smallest value in y, g, -5? g Let y = -5489/120 + 688/15. Which is the fourth smallest value? (a) y (b) 3 (c) 5 (d) -4 (e) 6/13 b Let p = -1.4382 - -164.4382. Which is the third biggest value? (a) 9 (b) p (c) -0.4 c Let q = -0.13 + -0.38. Let i = q - -0.31. Let h = -1.6 + 2. What is the biggest value in i, h, -3/7? h Let o be (-2)/(((76/(-10))/19)/(4/(-110))). What is the second biggest value in -0.3, o, -3, -2? -0.3 Let u = -0.3846 - -0.3846. Let d = 49 + -48. Which is the second biggest value? (a) -1/16 (b) u (c) d b Let z = -29 - -27. Let o = z + -3. Let f = 0.027 - 0.127. What is the second smallest value in o, f, 0? f Let v = -0.04 + -3.96. Let g be (-4)/22 + (-820)/451. Which is the third biggest value? (a) -3 (b) v (c) g b Let m = -8.84 - -9. Let i = m - 4.16. Let g = -0.184 + 0.384. What is the smallest value in 0, -1/3, g, i? i Let z be 11 + (0 - (-1010)/(-90)). Which is the second smallest value? (a) -1 (b) -3/2 (c) 1/9 (d) -7.2 (e) z b Let n = -29931.2 + 29932. Let q = 6 + -3. Let v = -2 + q. Which is the second smallest value? (a) -2 (b) 0 (c) v (d) n b Let h = 3631.3 - 3631. What is the fifth smallest value in 0.1, h, 2/7, -1.7, 0.5? 0.5 Let o = -4 - -8. Let p = -0.000729 + -0.099271. Let g = -28 - -89/3. Which is the second smallest value? (a) 2/11 (b) g (c) p (d) o a Let l be (51/18 - 2)/(545/436). What is the fifth smallest value in 28, 1/8, l, -4, 3? 28 Let k be 1/(-7) - ((-120)/(-378))/4. What is the fourth smallest value in 1/12, -1.5, k, 0? 1/12 Let o = -1.5 + 179.5. Let l = o - 180. Which is the third biggest value? (a) 3/4 (b) 0.4 (c) l c Let d = -10569 - -10569.5. What is the biggest value in -227, d, 5? 5 Suppose -20 = 8j - 4. Let z be j - 0 - 2321/(-33). Let v = z + -69. What is the second biggest value in -2/5, v, 4? -2/5 Let l = 3.6 - 4.63. Let h = l - -6.03. Which is the third smallest value? (a) h (b) 3/8 (c) -1/7 a Let v be 12814/894 + (-16 - -2). What is the fifth biggest value in v, 0.4, 4/3, -0.8, -2? -2 Let z = -319.467 - 6.533. What is the biggest value in -0.5, 3, z? 3 Let g be (-10 - -7)-13. Let v be (1 - 4g) + -1. Let l be v/14 + (-15)/(-5). Which is the biggest value? (a) l (b) 3 (c) 2 b Let w = -1144.8 - -1145. Let t be (-1)/(1(-2 - 1)). Which is the second smallest value? (a) t (b) w (c) 13 a Let w be 32/138 + -2 + 2. Let m = -3/46 + w. Let j = 38/3 - 12. Which is the biggest value? (a) -3 (b) m (c) j c Let z(y) = -10y - 2. Let w be ((-5)/((-45)/(-6)))/(2/3). Let k be z(w). Suppose 20 = -kd + 3d. What is the third smallest value in 0.4, d, 5, -0.1? 0.4 Let c be (-3)/(-6) - (-1690)/(-20). Let p be c/(-378) + (20/(-18))/2. Let m be (-3)/(-12) - (-7)/4. What is the second biggest value in m, p, -2? p Let y = 131.438 - 131. Let d = y + -0.238. Which is the second smallest value? (a) 0.83 (b) d (c) -1/4 b Let z = 32.44 - 29.44. What is the biggest value in -0.2, -0.057, 1, z? z Let f = 2.5714 + -0.5714. Which is the fourth biggest value? (a) -106 (b) 0 (c) -1/6 (d) 3 (e) f c Let u = -196.115 - -196. Let m = u + -0.285. Let o = 0.47 + 0.03. What is the fourth biggest value in 2/3, -1/3, m, o? m Let v = 25.38 - 35.38. Which is the smallest value? (a) 0.3 (b) -177 (c) v b Let v = -0.15326 + 5.15326. Which is the second biggest value? (a) 1/7 (b) v (c) 3 (d) -23/6 c Let l = -31.7 - -29.7. Let o = -18.9 - -20. Let i = 1 - o. What is the smallest value in 2/7, i, l, 4? l Let n = 3688/8589 + -1/1227. What is the fourth smallest value in n, 38, -3, -0.2? 38 Let y = 149.78 + -269.78. Which is the fourth biggest value? (a) -2/15 (b) -4 (c) 2 (d) y d Let h(a) = -a2 - 2a + 3. Let r be h(2). Let b = 216 + -212. What is the smallest value in -4, r, b? r Let j = -80.5 + 95. Let m = 14.6 - j. What is the third smallest value in -23, 1/8, m? 1/8 Let j = -18354009 - -175372554736/9555. Let k = j - 1/637. What is the third smallest value in -16, k, 0? 0 Let g = 0.01314 - 27.01314. Let r be 1 + 0 + 31. What is the third biggest value in -1, g, r? g Let f be (3/(-6))/(1(15/(-10) + 7)). Which is the fifth biggest value? (a) f (b) -0.4 (c) -5 (d) 3 (e) 0.7 c Suppose 2u + 305 = -1041. Let v = -661 - u. What is the third smallest value in 5, v, 0.1? v Suppose -2a = -5r - 16, 0 = -2a + 2r + 4 + 6. What is the third biggest value in a, -1/8, -2, -4/9? -4/9 Suppose -3h + 41 = -4h. Let c = h + 165/4. Let s = 151 - 151. What is the fourth smallest value in c, -1/8, 5, s? 5 Suppose -144733d + 144712d = -105. Let o = -4 + 3.4. Let m = -1 - o. Which is the second smallest value? (a) -13 (b) d (c) m c Let q = 430694 + -430700. Let j = -3 + 0. What is the third smallest value in q, 2/9, j, 0.2? 0.2 Let i = -15881 + 15883. What is the second biggest value in -6, -1, 1/7, i? 1/7 Let m = -2753 + 2751. Which is the third biggest value? (a) 2 (b) 3 (c) -0.2 (d) m c Let v = 57670 + -57669.74. Let k = 26 - 53/2. Which is the second smallest value? (a) v (b) 4/3 (c) k (d) 1/2 a Let k be 0 - (3 + 4 + -4). Let r = k + 5/2. Let d be 1(-15)/6 - -3. What is the third biggest value in -17, 0.2, d, r? r Let n = -4.451 - -5. Let h = n + -0.349. What is the third smallest value in h, -0.2, 1/104? h Suppose -s - 27 = r, -3r = -8s + 6s + 111. Which is the fourth smallest value? (a) -4 (b) 0.5 (c) 2 (d) r c Let l = -861.5 + 861.4. Which is the second smallest value? (a) 3 (b) l (c) 1325 a Let x = -136.271 + 133.4. Let h = 0.079 - x. Let p = h + 0.05. Which is the second smallest value? (a) -3/4 (b) -1/4 (c) p b Let y be 224/168 - (-13)/6. What is the second smallest value in 2, y, -0.1, -4? -0.1 Let k = -52 + 46.95. Let u = -8.95 - -9. Let o = u + k. Which is the smallest value? (a) -1/3 (b) o (c) -0.2 b Let j = -3191 - -3232. Which is the biggest value? (a) 0 (b) -3 (c) 0.05 (d) -5 (e) j e Let r = 764.7 + -702.7. What is the fourth smallest value in r, 1, 5, 1/6, 2/17? 5 Let s = 1 - 0.8. Let t be (-1464)/420 + 1568/490. What is the fourth smallest value in 0.4, -8/5, s, t? 0.4 Let j = 1.7446 + -1.2446. What is the smallest value in 6, -121, j? -121 Let o be 2(-68)/8 + 13. Let f be 32/(-39) + (-1 - 35/(-21)). What is the second smallest value in 0.15, o, -2/17, f? f Suppose -127v - 58v - 564 = 3v. Which is the biggest value? (a) 0 (b) -88 (c) v (d) 5 (e) -0.2 d Let h = 255 - 255. Suppose 0s = 4n - 3s - 3, h = 5s - 15. Let z be (-2)/5 - (-32)/30. What is the third biggest value in n, -0.5, z? -0.5 Let n = -4 + 3.6. Which is the third smallest value? (a) n (b) -0.7 (c) -13 a Let m = 11135.5 + -11136. Which is the third smallest value? (a) 4 (b) m (c) -8/13 a Let r = 1431 - 511. Let c = 920.5 - r. What is the smallest value in c, 0, 0.21? 0 Let d be 75/(-35) - (-29382)/9086. What is the smallest value in -4, 1, d, 2? -4 Let o = 1540 + -1535. Let w = -0.0105 - -0.5105. Which is the third smallest value? (a) w (b) o (c) 1 (d) -36 c Let m(d) = -d3 + 77d*2 - 720d - 200. Let j be m(66). What is the third biggest value in j, -0.2, 0? -0.2 Let p = -757.03 - -757. Which is the smallest value? (a) p (b) 1/4 (c) -72 c Let d = 0.117 - 4.637. Let w = d - -3.62. Which is the third biggest value? (a) w (b) 5 (c) 3 a Suppose -2x - 11 = -f, 3x + 12f + 21 = 45. What is the smallest value in 6.4, x, 1/2, 0.4? x Let l = -14 - -20. Let n = -6.4 + l. Let h = 1931 + -1931.5. What is the third biggest value in 3, -4, h, n? h Let q(k) = -k3 + 40k*2 - 43k - 1283. Let z be q(38). Which is the second biggest value? (a) -4 (b) z (c) -8/5 (d) 2/7 c Let p = -2282/19 + 11486/95. Which is the fourth smallest value? (a) p (b) 2/3 (c) -4 (d)	{ "pile_set_name": "DM Mathematics" }
ine -5j(q) - 3v(q). 2q2 + 3q - 15 Let y(q) = -15q3 - q2 + 5q + 4. Let m(j) = -j - 1. What is 5m(z) + y(z)? -15z3 - z2 - 1 Let t(c) = -c*2 - 9c + 4. Let a(v) = -v*2 + 9v - 9. Let h be a(7). Suppose 2m = 7m - 25, hn + 40 = 2m. Let l(o) = o - 1. Give nl(j) - t(j). j2 + 3j + 2 Let m(y) = -4y + 22. Let o(t) = -t. Give -m(b) + 2o(b). 2b - 22 Let v(i) = 4i*3 - 7i + 7. Let o(q) = -5q3 + 6q - 3. Let b(m) = 6m3 - 7m + 3. Let y(s) = 3b(s) + 4o(s). Determine -6v(g) - 14y(g). 4g3 Let q(m) be the first derivative of -9m*2/2 - 4m + 18. Let a(x) = 14x + 6. What is -5a(h) - 8q(h)? 2h + 2 Suppose 4z = 5t - 9, -3t - 2z + 4 = -3z. Let b(u) = -3u*2 - 6u + 4. Let n(q) = q*2 + q - 1. Give tb(a) + 4n(a). a2 - 2a Let k(u) = -u + 12u3 - u3 - 4u*3 + 3u. Let a(i) = 15i3 + 5i. What is 2a(t) - 5k(t)? -5t3 Let p(g) = 20g - 13. Let u(z) = -7z + 4. Give -6p(s) - 17u(s). -s + 10 Let m(s) = 11s*2 - 14s - 11. Let a(x) = 4x2 - 5x - 4. Calculate 17a(k) - 6m(k). 2k2 - k - 2 Let l(g) = -g2 + 3g*2 - 2g + 0g + 6. Let q(z) = -z2 - 4z + 5. Let b(d) = -4d2 - 13d + 15. Let n(w) = -2b(w) + 7q(w). What is -3l(y) + 4n(y)? -2y2 - 2y + 2 Let r(l) be the first derivative of -3l2/2 + 13. Let o(y) = -16y + 1. What is -2o(h) + 11r(h)? -h - 2 Let y(z) = 2z - 6. Let d(j) = 2j - 5. Let q(f) = 4f + 29. Let s(g) = -2g - 14. Let n(a) = 3q(a) + 7s(a). Let x be n(-8). What is xd(k) - 4y(k)? 2k - 1 Let n(x) = 12x*3 - 16x. Suppose 0 = 4t + 5b - 0b + 9, 0 = -3t + 2b - 1. Let w(j) = j3 - j. What is tn(p) + 16w(p)? 4p*3 Let k = 79 + -83. Let u(f) = -2f*2 + 5f + 2. Let n(w) = -5w2 + 14w + 6. Give kn(b) + 11u(b). -2b2 - b - 2 Let h(i) = 3i*2 + 2i + 3. Let u(j) be the third derivative of -j5/30 - j4/24 - j3/3 + j2 + 8j. Give -3h(b) - 5u(b). b2 - b + 1 Let l(x) = -6x*2 + 5x. Let k be 1 - 3 - -7 - 3. Let y(g) = -9g2 + 5g + 2gk + g. Determine 4l(m) - 3y(m). -3m*2 + 2m Let s(i) = -1. Let v(c) = c - 5. Let m(x) = -5x + 26. Suppose -5f - 7j + 67 = -3j, 3f = 2j + 27. Let r(d) = fv(d) + 2m(d). Give -2r(u) + 6s(u). -2u Let k(c) = -5c. Suppose -3v + 3n = -18, -5n + 40 = 3v + 2v. Let b be 48/(-9) + 2/(-3). Let d(p) = -4p - 1 + 1. What is bk(r) + vd(r)? 2r Let y(g) = g. Suppose 8 - 2 = 3h. Let u(b) = -3 + 5 - 4b - h + 2. Let d = -10 - -5. What is dy(q) - u(q)? -q - 2 Let z(y) = 7y2 - 3y + 5. Let v(h) = -4h + 5h2 - h2 + 4h2 + 6. Calculate 5v(t) - 6z(t). -2t*2 - 2t Let t(z) = z*3 - 4z*2 + z - 2. Let y(l) = 2l*3 - 5l*2 + l - 3. Determine 3t(x) - 2y(x). -x3 - 2x2 + x Let k(v) = v3 + 1. Let i(z) = -z*3 - z - 3. What is -i(p) - 3k(p)? -2p3 + p Let o(z) = 1 + 18z*2 - 17z*2 + 4z + z. Suppose 3r = 7r - 320. Let i be (-2)/(-9) + r/(-36). Let j(n) = 2n. Calculate io(k) + 5j(k). -2k*2 - 2 Let h(d) = -d - 1. Let u(z) = 4 + 3 - 5 + 3z + 0. Give -11h(f) - 4u(f). -f + 3 Suppose -5f - c - 34 = -5c, -4c = -4. Let r = 9 - 20. Let n(q) = 15q*2 + 15q - 11. Let h(j) = -8j2 - 8j + 6. Calculate fn(t) + rh(t). -2t2 - 2t Let u(i) = -30i2 - 21i + 21. Let f(c) = -3c2 - 2c + 2. Give 63f(r) - 6u(r). -9r2 Let a(f) = -7f*2 - 5f - 6. Let q = -21 + 7. Let o(z) = z*3 + 14z*2 + z + 8. Let r be o(q). Let n(h) = 8h*2 + 6h + 7. What is ra(x) - 5n(x)? 2x2 + 1 Let a(j) = j + 7. Let x(t) = t + 6. Give 5a(f) - 6x(f). -f - 1 Let i(u) = -7u - 3. Let a(s) = -8s - 4. Let b be (-1)/3 - (-10)/3. Give ba(t) - 4i(t). 4t Let v = -91 - -86. Let q(j) = 3j - 4. Let g(c) = -7c + 9. What is vq(f) - 2g(f)? -f + 2 Let v(w) = w*2 + 2w - 2. Let t(l) = 2l2 + 6l - 6. Let r(c) = -c*3 - 7c*2 - 4c + 4. Let m be r(-6). Give mv(x) + 3t(x). -2x2 + 2x - 2 Let o(a) = 13a - 2. Let v(i) = 26i - 4. Give 5o(k) - 3v(k). -13k + 2 Let r be 3 + 0/(-2) - 6. Let s(f) = 2f + 6. Suppose -6 = -3z + 6. Let x(p) = p + 5. Give rs(i) + zx(i). -2i + 2 Suppose 0i = -i. Let n(a) = ia*3 + 3a*3 + 5a + 0a3 + 7a*2. Let o(s) = -12s*2 - 7s + s2 + s2 - 4s3. What is -7n(w) - 5o(w)? -w3 + w2 Let k(q) = -q2. Let m be (-6)/39 - (-223)/13. Suppose -5a - 5z + z = -m, -10 = 2a - 4z. Let v(w) = -2w*2 - w + 1. What is av(r) - 4k(r)? 2r2 - r + 1 Let o(f) = -f2 - f - 1. Let t(i) = -4i3 + 3i*2 + 2i + 1. What is o(y) + t(y)? -4y3 + 2y*2 + y Suppose 1 = -2i + 7. Let r(a) = -7 + 2a - 7a - 6a + 4a. Let v(f) = 4f + 4. Calculate ir(q) + 5v(q). -q - 1 Let w be (0 + 1)/(4/8). Let z(y) = 6y - 4 - 2y + 5y - wy. Let r(d) = -3d + 2. What is 9r(x) + 4z(x)? x + 2 Let z(q) = 13q3 - 75q - 7. Let x(i) = -9i3 + 50i + 5. What is -7x(g) - 5z(g)? -2g3 + 25g Let i(b) = 3b3 + b2 - b + 5. Let t(a) = -a3 - 1. Determine -2i(j) - 4t(j). -2j*3 - 2j*2 + 2j - 6 Let p(u) = -1 + 15u - 17u + 5. Let b(o) = -o. Give -4b(g) + p(g). 2g + 4 Let t(a) = -2a + 3. Suppose -19 = 5c + 11. Let w be c/(-10) + (-28)/5. Let m(g) be the first derivative of -g*2 + 4g + 1. Determine wm(r) + 6t(r). -2r - 2 Let d(p) = 2p*3 - 4p*2 - 4p. Let l(a) = -4a3 + 7a*2 + 7a. Give 7d(h) + 4l(h). -2h3 Let p(j) = -j. Suppose i - 2i = -4. Let c(y) = 4 - i - 2y - y. What is -c(s) + 5p(s)? -2s Let n(c) be the second derivative of -c5/4 - c3/3 + c2 + c. Let o(y) = y3 + y - 1. Let x be ((-3)/(-12))/(2/8). Determine xn(f) + 4o(f). -f3 + 2f - 2 Let v(a) = 3a - 1 + 0a - 6a - 3. Let k(w) = 6w + 9. What is 6k(c) + 13v(c)? -3c + 2 Let y(v) = 3v*3 - 6v*2 + 5v - 1. Let p(u) = -4u3 + 7u*2 - 6u + 1. Suppose -5j + 5h - 30 = 0, -5j - 2h - 26 = -3. Determine jp(o) - 6y(o). 2o3 + o2 + 1 Let o(l) = l3 - l2 - l + 1. Let i(h) be the first derivative of -4h*3/3 - 2h*2 + 3h + 7. Calculate i(f) - 3o(f). -3f3 - f2 - f Let b = 3 + 0. Let g(a) = a*2 + 2a - 3. Let z(o) be the third derivative of -o5/60 - o4/8 + 5o3/6 - 2o*2. Calculate bz(n) + 5g(n). 2n*2 + n Let c(y) = y - 1. Let i be c(5). Let r(a) = 6a*2 + 2a - 3. Let f(b) = -b*2 - b + 1. What is if(t) + r(t)? 2t2 - 2t + 1 Let v(c) = -2c. Let o = -178 - -124. Let h be -2(-5)/((-5)/18). Let i = h - o. Let x(m) = -m*2 - 17m. Determine iv(n) - 2x(n). 2n2 - 2n Let d(j) = -5j2 + 18j. Let p(t) = 9t2 - 35t. Determine -7d(h) - 4p(h). -h*2 + 14h Let z(p) be the first derivative of -p - 3. Let s(k) = k - 1. What is -s(t) + 3z(t)? -t - 2 Let c(i) = -i3 - 2i*2 + 2i + 5. Let g(m) = 3m3 + 5m*2 - 5m - 11. Determine 5c(x) + 2g(x). x*3 + 3 Let w(m) = 10m*3 + 5m. Let l(j) = 5j3 + 2j. Determine 9l(t) - 4w(t). 5t3 - 2t Let u(g) = -g + 1. Let n(o) = o - 1. Let h be 6/(-18) + (-7)/(-3). Give hu(x) + n(x). -x + 1 Let k(j) = -j2 + j + 1. Suppose -4s - 11 = -5r, -5r + 5 = 2s - 4r. Let d(g) = -3g2 + 6g + 6. What is sd(a) - 6k(a)? 3a2 Let x(l) = 3l*2 - 5l - 1. Let m be ((-2 - -4) + -3)0. Let t(p) = 2p + mp + 3 - 3p*2 - 5p*2 + 12p. Let v be 0 - 11 - (2 - 2). What is vx(y) - 4t(y)? -y*2 - y - 1 Let s(j) = -7j + 2. Let z(t) be the third derivative of t*4/24 + 38t*2. Calculate -s(u) - 6z(u). u - 2 Let c(u) = u + 2. Let b(y) = 2y + 1. Determine 4b(w) - 3c(w). 5w - 2 Let c(w) = -w2 - w - 1. Let q(b) = -b2 - 5b. Let x be q(-4). Let t(g) = -6g*2 - 3g - 1. Determine xc(p) - t(p). 2p*2 - p - 3 Let o(b) = 16b - 9. Let w(l) = 30l - 17. Let r(k) = -11o(k) + 6w(k). Let n(t) = 12t - 8. What is -5n(j) + 14r(j)? -4j - 2 Let v(y) = -3y*3 - 7y*2 + 7y - 5. Let t(f) = 3f3 + 6f*2 - 6f + 5. Determine 7t(k) + 6v(k). 3k3 + 5 Suppose -9 = 3y - 0. Let k be 3 + 4/(y + 2). Let z(n) = -3 - 1 + 5 - n. Let p(o) = o*3 - 4o + 4. What is kp(b) + 6z(b)? -b*3 - 2b + 2 Let g(p) = 2. Let s(k) = -k - 1. Give g(m) + 5s(m). -5m - 3 Suppose 15 = -d + 4u, -4d - 2u - 5 + 17 = 0. Let x(j) = j. Let h(w) = -w2 + 3w - 1. Let t(s) = s*2 + 8s + 13. Let v be t(-4). Give dh(o) + vx(o). -o*2 - 1 Let b(o) = 5o*2 - 6o + 6. Suppose x - 2x = -3. Let u(v) = 4v*2 - 5v + 5. Calculate xb(q) - 4u(q). -q*2 + 2q - 2 Let s(w) = -w*2 - 4w - 2. Suppose -2	{ "pile_set_name": "DM Mathematics" }
h Collect the terms in -1 + 72721304h3 + 1. 72721304h*3 Collect the terms in 1960w*3 - 9 + 5 + 4 - 3867w*3 + 2196w*3 - 2w*2. 289w*3 - 2w*2 Collect the terms in 2b*3 - b - 5b*3 - 5630b*2 + b - 76932b*2. -3b*3 - 82562b*2 Collect the terms in -47d*2 - 49d*2 + 151d*2 - 54d*2 + 928d. d*2 + 928d Collect the terms in 34158k + 34004k - 68159k. 3k Collect the terms in 195680575p3 - 7p + 195680572p3 - 391361145p*3. 2p*3 - 7p Collect the terms in 2s + 29 + 117 + 549 - 263 + 750. 2s + 1182 Collect the terms in p - 5 - 118p3 - 2p + 3 - 245p2 - 39p*3 - 91p*3. -248p*3 - 245p*2 - p - 2 Collect the terms in -41118r*2 - 40584r*2 + 81701r2. -r2 Collect the terms in -343 - 341 - 348 - 539c + 1032 + 44c. -495c Collect the terms in -5v2 + v2 + 2v2 - 261 + 252. -2v*2 - 9 Collect the terms in 368q + 134q - 74q - 33q + 376q - 46q. 725q Collect the terms in 1610g2 - 3359g*2 + 1749g*2 - 64g*3. -64g*3 Collect the terms in -6386575a*2 - 4384 + 4384. -6386575a*2 Collect the terms in -750070w + 375036w + 0 + 375020w + 0. -14w Collect the terms in -1 + 1136u*2 + 1 - 3887u*2 - 12427u*2. -15178u*2 Collect the terms in 1630271 + 869w - 1630271. 869w Collect the terms in 5l + 18216 + 18217 + 18213 - 72865 - 4l + 18219. l Collect the terms in -3j + 4j + 1113 - j - j + 3130. -j + 4243 Collect the terms in -16468 - n3 - 17378 + 51223 - 17377. -n3 Collect the terms in -8725b*2 - 8719b*2 - 10047b*2 + 27493b*2. 2b*2 Collect the terms in 4857l - 9l2 - 22l3 + l2 + 4743l + 8l*2 - 9600l. -22l3 Collect the terms in -329b*3 + 27b + 54b + 6880b*3 - 22b. 6551b3 + 59b Collect the terms in -102q3 + 360q*3 - 101q*3 - 153q*3. 4q*3 Collect the terms in 58966s - 324s2 - 29491s - 29475s. -324s*2 Collect the terms in 4031y*3 + 4699y*3 + 298y*3 + 967y*3 + 2y - 1156y3. 8839y*3 + 2y Collect the terms in 7067l - 6209l + 2931l + 5197l + 14741l. 23727l Collect the terms in 10d + 790 + 11d - 839 - d*2 - 27d + 6d. -d2 - 49 Collect the terms in 104491252o + 3o3 - 104491252o. 3o3 Collect the terms in -132188567g*3 + 264377172g*3 - 132188606g3. -g3 Collect the terms in 4 + 57g - 12g - 18g - 40g. -13g + 4 Collect the terms in -15w + 276 - 779 + 252 - 17w + 251. -32w Collect the terms in -74h2 + 9 - 145h - 5 + 26h - 4. -74h*2 - 119h Collect the terms in -114j3 - 90j*3 - 9j*3 - 20j*3. -233j*3 Collect the terms in -2580s - 2586s + 7645s - 2485s. -6s Collect the terms in 145h3 + 553h*2 - h + 146h*3 + 84h*3 + 151h*3 - 528h*3. -2h*3 + 553h*2 - h Collect the terms in 130n*2 - 433n*2 + 73n*2 + 86n*2 + 77n*2 + 82n*2. 15n*2 Collect the terms in 6650p - 2073p + 146p + 30 + 18376p. 23099p + 30 Collect the terms in 7k2 - 16k*2 + 6k*2 - 22k*3 + 6k*3. -16k*3 - 3k*2 Collect the terms in 2 + 9 - 61c - 143c. -204c + 11 Collect the terms in 95d + 459 + 2320 + 100d - 46d. 149d + 2779 Collect the terms in 9203d + 5d*3 + 9236d + d*3 - 18515d - d*3. 5d*3 - 76d Collect the terms in 399l - 142l + 69l - 152l - 155l. 19l Collect the terms in -86360t2 - 3t + 172723t2 - 67t*3 - 86363t*2. -67t*3 - 3t Collect the terms in -6800g3 + 2350g*3 + 2591g*3 + 2651g*3. 792g*3 Collect the terms in 313 - 658p - 229 - 546p - 84. -1204p Collect the terms in 1183k3 + 926k*3 - 441k*3 + 286k*3. 1954k*3 Collect the terms in 2322d + 255d - 687d + 1508d. 3398d Collect the terms in -a*3 + 79778a*2 - 73518a*2 + 2a3. a3 + 6260a2 Collect the terms in 54o*3 + 9o*3 - 30o*3 + 11o*3 + 10o*3 - 630o*2. 54o*3 - 630o*2 Collect the terms in -141312 + 141312 - 8808q*2 + 8835q*2. 27q*2 Collect the terms in 279c*2 + 115c*2 - 83c + 83c + 1 - 1. 394c*2 Collect the terms in 74n*3 + 5n - 878n3 + 306466n*2 - 306466n*2. -804n*3 + 5n Collect the terms in 826562y - 826562y + 0y2 + 883y3 - y2 + y*2. 883y*3 Collect the terms in 18476u - 36957u + 31u*3 + 18477u. 31u3 - 4u Collect the terms in -4668g + 1576g + 1496g + 1522g. -74g Collect the terms in 23834 - 11u*3 + 23820 - 47628. -11u*3 + 26 Collect the terms in -210j*2 - 179j*2 - 155j*2 - 195j*2 - 181j*2 + 941j*2. 21j*2 Collect the terms in -33t + 31t2 + 23 - 16 - 4t - 34t2 - 51t. -3t2 - 88t + 7 Collect the terms in -422j2 - 415j*2 + 1248j*2 + j + 2j - 428j2. -17j*2 + 3j Collect the terms in 16160z2 - 64626z*2 - 2 + 16156z*2 + 16150z*2 + 2 + 16155z*2. -5z*2 Collect the terms in -5220t*3 - 5220t*3 - 117t*2 + 10439t*3 - 111t*2 + 228t2. -t3 Collect the terms in -119032h3 - 151790h*3 - 183889h*3. -454711h*3 Collect the terms in -3294985 + 1262o*3 + 3294985 - 1276o*3. -14o*3 Collect the terms in 7 - 5860o + 2 - 40372o. -46232o + 9 Collect the terms in -384297n - 384222n + 768660n. 141n Collect the terms in -89 + 112635620w + 89 - 112635622w. -2w Collect the terms in 174k*3 - 814k*3 - 9926k + 9926k. -640k*3 Collect the terms in -266p + 71p2 + 110p*2 + 6 - 183p*2 - 8 + 5 + 266p. -2p2 + 3 Collect the terms in -2085h*3 + 1249h*3 + 838h*3. 2h*3 Collect the terms in -149148 + 149148 - 8p - 6p3. -6p*3 - 8p Collect the terms in -19 - 21c + 67 - 36c + 30. -57c + 78 Collect the terms in -3204y - 1151y - 8247y. -12602y Collect the terms in -2n*3 + 15 + 1117524747n - 1117524747n. -2n*3 + 15 Collect the terms in 1790 + 16381i - 1790. 16381i Collect the terms in -1423l*3 - 1410l*3 - 1424l*3 + 4241l*3. -16l*3 Collect the terms in 7y - 164y + 42y - 56y + 23y. -148y Collect the terms in 24386l + 652l2 - 3 - 612l*2 - 24386l. 40l2 - 3 Collect the terms in 498478n*3 - 1930310n*3 - 676633n*3 - 659583n*3. -2768048n*3 Collect the terms in 0 + 0 + 9548371i*3. 9548371i*3 Collect the terms in -26 - 12 - 147f*3 + 158f*3. 11f*3 - 38 Collect the terms in 2295 + 4t - 1672 - 276. 4t + 347 Collect the terms in 6k*2 + 2100483k + 2k2 - 12k*2. -4k*2 + 2100483k Collect the terms in 6336x - 18973x + 6317x + 6327x. 7x Collect the terms in 235c*2 - 662c*2 + 159c*2 + 208c*2 + 173c*2. 113c*2 Collect the terms in 1512i - 14408i - 9642i - 21420i. -43958i Collect the terms in 4b3 + 13b*2 - 68b*2 + 71b*2 + b + 49b*2. 4b*3 + 65b*2 + b Collect the terms in 20a*3 + 782020197a*2 - 782020197a*2. 20a*3 Collect the terms in -2907193l*2 + 969063l*2 + 969061l*2 + 969070l2. l2 Collect the terms in -40769a3 + 121994a*3 - 40761a*3 - 40472a*3. -8a*3 Collect the terms in -2 + 0 - 4279039m + 4272241m. -6798m - 2 Collect the terms in 441n - 4730n*2 - 10928n*2 - 441n. -15658n2 Collect the terms in -304044 - 3969v*3 + 304044. -3969v*3 Collect the terms in -t - 4t*2 - 4t*3 + 4t - 230t2 + 60t*2. -4t*3 - 174t*2 + 3t Collect the terms in 33y3 - 8y*3 + 86895 - 173795 + 86896. 25y*3 - 4 Collect the terms in 56044o*3 + 628o - 628o + 8340o*3. 64384o*3 Collect the terms in 20l + 26l + 68l - 445l2 - 114l. -445l2 Collect the terms in 74c - 333c2 + 198c + 113c. -333c*2 + 385c Collect the terms in -1067 + 2136 - v + v + v*3 - 1069 + 10v*3. 11v*3 Collect the terms in 2 + 534u + 666u2 - u - 2 - 282u*2. 384u*2 + 533u Collect the terms in 7071 + 67x - 127x + 68x. 8x + 7071 Collect the terms in 5 - 1362j - 5 - 1380j + 4104j - 1382j. -20j Collect the terms in -47 + 215o2 + 45 - o2 + 9o - 93o*2. 121o*2 + 9o - 2 Collect the terms in -8 - 125a + 125a + 190143a3. 190143a*3 - 8 Collect the terms in -1353 + 0y*2 + 240y + 692 - 240y - 6y*2 + 661. -6y*2 Collect the terms in 120235s*2 + 101210s*2 - 221442s*2. 3s*2 Collect the terms in -416 - 415 + 831 + 23744l + 10662l. 34406l Collect the terms in 353125q + 353120q + 353124q + 43 - 34 - 1059370q. -q + 9 Collect the terms in 2111w2 - 511w*2 - 9w*3 + 30 + 15w*3 - 18 - 13. 6w*3 + 1600w**2 - 1 Collect the ter	{ "pile_set_name": "DM Mathematics" }
ivative of -p + 5 + 4v - fv wrt v? 2 Let f be -3 + -1 + 6 - -3. What is the third derivative of -3xf + 2x*6 - 14x*2 + 10x*2 + 3x*5 wrt x? 240x*3 Suppose -5o - 43 = 3d - 6d, -5d + 3o = -45. Let t = d - 3. Find the third derivative of 0x3 + 3x*t + 3x*2 - 4x3 - x2 wrt x. -6 Let g(k) be the first derivative of -2k3/3 + 5k + 1. What is the first derivative of g(u) wrt u? -4u Let z(o) = -o2 + o + 1. Let c(w) = 37w*3 + 6w*2 - 6w - 18. Let f(k) = -c(k) - 6z(k). What is the first derivative of f(j) wrt j? -111j*2 Find the first derivative of 8 - 53f*2 - 45 + 95f*2 wrt f. 84f Let s(m) be the third derivative of -3m6/40 + 5m*3/3 + 13m*2. What is the first derivative of s(t) wrt t? -27t2 Let m(d) be the second derivative of d4/6 - 4d2 - d. Differentiate m(y) with respect to y. 4y Let s be 129/15 - (-8)/20. Let m be (1 - 3) + s - 3. Find the second derivative of 5u3 - 5u*5 - 5u*3 + 2u + mu5 wrt u. -20u3 What is the third derivative of z2 - 5z2 - 4z2 + z5 wrt z? 60z2 What is the second derivative of -2w*5 - 6w + w5 - w2 + w*2 wrt w? -20w3 Let g(d) be the third derivative of d4/12 + 7d3/3 - 5d2. Find the first derivative of g(l) wrt l. 2 Let z be 4 - 0 - 3/(-1). Let v(j) = -j3 + 5j - 4. Let f(m) = -2m*3 + 7m - 6. Let w(l) = zv(l) - 5f(l). Find the first derivative of w(r) wrt r. 9r2 Let r(m) be the third derivative of 13m8/336 + m5/15 + 10m2. What is the third derivative of r(s) wrt s? 780s*2 Suppose -2g + 21 = -5w, -6g = -5g + w. What is the second derivative of gq*4 + 4q - 11q5 + 8q*5 - 3q*4 wrt q? -60q*3 Let a(s) = -s. Let f be a(-4). Suppose -2p + f = -4. Find the second derivative of -w*3 + 2w*3 - pw + w3 - w3 wrt w. 6w What is the derivative of -39 - 3a*3 + 3a*3 + 24a*4 + 4a*4 wrt a? 112a*3 Let l(n) be the second derivative of 17n7/42 + n3/6 + 11n. What is the second derivative of l(j) wrt j? 340j*3 What is the third derivative of 29l*3 + 4l*2 + 2l*2 - 15l*2 - 17l*2 wrt l? 174 Let i be 18/45 - 8/(-5). Find the third derivative of -6c*5 + 4c*5 + ic2 + c5 wrt c. -60c2 Let z(w) be the second derivative of -7w6/30 - w2/2 + 6w. Differentiate z(t) wrt t. -28t*3 Let v(s) = 204s*2 + 102. Let b(h) = 24h*2 + 12. Let m(d) = -42b(d) + 5v(d). What is the first derivative of m(p) wrt p? 24p What is the third derivative of 0d2 - d2 - 18d*4 + 4d*2 + 10d*4 wrt d? -192d Let r(v) be the third derivative of v*8/84 + 5v*4/24 + 4v*2. What is the second derivative of r(t) wrt t? 80t*3 Let m(u) = 2u*3 - 6u2 + 3. Let k(i) = -i3 + 7i2 - 2. Let o(p) = -3k(p) - 2m(p). Find the third derivative of o(q) wrt q. -6 Let l(b) be the second derivative of b8/8 + 2b*4/3 - 2b. What is the third derivative of l(k) wrt k? 840k3 Let x(d) = -1 - d2 - 4 + 2d*2 + 3d. Let o be x(-5). What is the third derivative of -3j5 + 3j5 + j2 - j*o wrt j? -60j*2 Let f be 1/1 - 6 - 3. Let u = -6 - f. Find the second derivative of -4b + 4b3 + 5b + ub2 - 2b*2 wrt b. 24b Let n(w) be the third derivative of -2w7/35 + w5/15 - 12w*2. Find the third derivative of n(d) wrt d. -288d Let n = 4 - 2. Suppose 2r - 4r + 6 = 0. Differentiate r - 3k2 - 7 + kn wrt k. -4k Let z(o) be the second derivative of 0o6 + 0o*3 - 3o + 0o5 + 0o*2 + 5/42o*7 + 1/6o*4 + 0. What is the third derivative of z(l) wrt l? 300l*2 Let z(n) be the first derivative of -13n*4/4 + 10n - 12. Differentiate z(b) with respect to b. -39b2 Let g(z) = 6z*2 + 2z - 3. Let u(t) = 12t2 + 5t - 6. Let x(v) = -5g(v) + 2u(v). Differentiate x(k) with respect to k. -12k Let f(j) = 8j - 1. Let y be f(1). Suppose 2c + 6 = 4o, 3c + y = 2o + 3o. Find the third derivative of 2v*o + 2v*4 + 7 - 7 wrt v. 48v Let y(p) = -10p - 6. Let g(c) = 19c + 12. Let i(k) = -3g(k) - 5y(k). What is the derivative of i(d) wrt d? -7 Let z(y) be the third derivative of y*5/20 + 7y*4/24 + 2y*2. What is the second derivative of z(g) wrt g? 6 Suppose -21 = -3i + 3x, 0 = 2i + 4x + 2 - 4. Find the second derivative of -ic4 + c2 + 4c - c2 + 2c*4 wrt c. -36c*2 Let d(n) be the first derivative of 0n*4 - 3/5n*5 + 0n + 0n2 - 1/3n*3 - 4. What is the third derivative of d(a) wrt a? -72a Suppose -v = 6f - 5f - 7, 4f - v = 3. Let h = 4 - f. What is the third derivative of 0k*h + 4k*2 - 5k*2 - 2k*3 wrt k? -12 Let o be 2/(-8)0/(-2). Let w(a) be the first derivative of -1/3a3 + oa - 2 + a*2. Find the second derivative of w(v) wrt v. -2 What is the second derivative of 2b*3 - 4b - 2b + 2b*3 wrt b? 24b Suppose -y + 15 = 4y. What is the second derivative of -4c + 0c + 3c + c*y wrt c? 6c Let t(w) be the first derivative of -17w7/7 + 50w*3/3 - 47. Find the third derivative of t(z) wrt z. -2040z*3 Suppose 5l - 3d = 4, -d = 4l + 3d - 16. Find the third derivative of 6w*2 + 2wl + w2 + 2w6 - 6w*2 wrt w. 240w*3 Let u be (-10)/4(-6)/5. What is the second derivative of 6y + 2y*3 - 3y*3 - 4y - uy wrt y? -6y Let m(j) = -3j3. Let g = 3 - 9. Let n(h) = -4h*3 - h. Let c(a) = gm(a) + 5n(a). What is the second derivative of c(r) wrt r? -12r Let b(q) be the second derivative of 3q5/10 + 5q*2/2 - 4q. Find the first derivative of b(i) wrt i. 18i2 Let y(s) = s2 - 3s + 4. Let j be y(4). Suppose 0 = jc - 3c + g - 2, g = 2. Differentiate c - 1 - 2l2 - 3 wrt l. -4l Find the second derivative of -9s - 9s*4 - 55s*3 + 55s*3 wrt s. -108s*2 Let u(j) = -4j*3 + j + 1. Let w = 0 - 1. Let t be u(w). Find the third derivative of 2y*3 - 2y*3 - 2y*t - 2y*2 wrt y. -48y Suppose 32 = -0y + 4y. Let c = -6 + y. What is the third derivative of 4v2 + 3v6 - vc - 2v2 wrt v? 360v*3 Let r(o) = 10o*3 + 4o*2 + 3o. Let i(d) = 29d3 + 11d*2 + 8d. Let a(g) = -4i(g) + 11r(g). What is the second derivative of a(q) wrt q? -36q Let x(s) be the first derivative of -s6 - 5/2s*2 + 0s*3 + 0s + 0s5 + 9 + 0s*4. Find the second derivative of x(w) wrt w. -120w3 Find the third derivative of h3 + 3h2 - 3h*2 + 3h3 + h2 wrt h. 24 Let v(p) = -16p2 - 5p - 87. Let u(w) = 8w2 + 2w + 43. Let q(r) = -5u(r) - 2v(r). Differentiate q(d) wrt d. -16d Let g(w) = -4w - 2w + 6w - w + 8. Let k(o) = -2o + 15. Let z(l) = -11g(l) + 6k(l). What is the derivative of z(a) wrt a? -1 What is the derivative of -3 + 10 - 2z2 + z4 + 2z2 wrt z? 4z*3 Let z(a) = -12a*4 + 2a*3 - 17a*2 - 2. Let p(b) = 23b*4 - 5b*3 + 33b*2 + 5. Let s(c) = 2p(c) + 5z(c). Find the third derivative of s(v) wrt v. -336v What is the third derivative of 2w2 - 2w*2 + 7w*4 - 2w2 - w2 wrt w? 168w Let i(g) be the third derivative of -g5/4 - 10g*3/3 + 17g*2. Differentiate i(a) wrt a. -30a Suppose -5n - 2h = h + 47, -30 = 2n + 4h. Let q be 2n1/(-2). Find the second derivative of -7 + m - 3m + m3 + q wrt m. 6m What is the third derivative of 4q2 + 2q*2 + 0q2 + q4 wrt q? 24q Let n(i) = 4i*4 - 6i*3 + 7i2 - 6. Let k(g) = g3 - g*2 + 1. Let x(u) = -6k(u) - n(u). Find the third derivative of x(p) wrt p. -96p Suppose 0 = -4j - 1 + 13. What is the second derivative of -7u2 - 2u + u + ju + 0u wrt u? -14 Find the third derivative of t*5 + 5t*2 - 2t*2 - 4t*2 wrt t. 60t*2 Let h = -3 + 13. Find the second derivative of -4i*2 + hi*2 + 1 - 4i - 1 wrt i. 12 Let x(n) be the second derivative of -n*7/6 + 13n*4/12 + 11n. What is the third derivative of x(s) wrt s? -420s2 Let s(r) = 76r*4 + 16r*3 - 141r*2. Let n(v) = 25v*4 + 6v*3 - 47v*2. Let u(a) = -8n(a) + 3s(a). Find the third derivative of u(x) wrt x. 672x Let d be (-1)/5 - (-77)/35. Let j = 19 - 13. Find the third derivative of drj + 0r6 - r6 - 3r2 wrt r. 120r*3 Let a(v) = -10v*5 + 4v*4 - 4v*2 + 4v. Let s(i) = 19i5 - 9i*4 + 8i*2 - 9i. Let d(o) = 9a(o) + 4s(o). What is the third derivative of d(k) wrt k? -840k2 Let r(j) be the first derivative of -5j*2 + 8j + 5. Differentiate r(s) with respect to s	{ "pile_set_name": "DM Mathematics" }
sp + w + qp*2 + np*3 + up4 and give w. 3 Express s3 - 2s2 - 3s3 + s4 + 3s2 - 3s in the form ps2 + ks*3 + as*4 + qs + o and give p. 1 Express -13i + 0 + 1 - 1 as q + yi and give y. -13 Rearrange 3 - q*3 - 2q*2 - 2q*4 + 6q*4 - 1 + 2 to tq*2 + k + aq*4 + fq*3 + sq and give k. 4 Rearrange 0f2 + f3 + 2f3 + f2 - 2f3 + 3 - f to u + of*2 + yf*3 + vf and give o. 1 Rearrange (-4v + 5v + 2v)(2v2 - 2v + 2v) + (-v2 + 2 - 2)(0v + 0v + v) to the form fv2 + zv + x + jv3 and give j. 5 Rearrange (-10 + 2 - 11)(0b - b - 3b) to the form r + fb and give f. 76 Express -37 - 36 + 73 + 206b in the form kb + w and give k. 206 Express -19i*2 - 22i*2 - 4i*2 + 11i*2 in the form c + vi + ti2 and give t. -34 Rearrange 4w - 4w + 2w + (-10 + 6w + 10)(-2 + 7 + 1) to the form yw + i and give y. 38 Express (-2h*2 + 0 + 0)(-4 - 2 + 4)(-7h*2 + 5h*2 - 7h*2) as kh*2 + ih + uh4 + sh*3 + v and give u. -36 Rearrange (2f + 3f - 3f)(f2 + 5f*2 - 5f*2)(-3f + f + 11 - 10) to u + of + df2 + xf*4 + nf*3 and give x. -4 Rearrange (0h - 4h + 8h)(-h2 + 3h*2 - 6h2 + h2 + 2h2 + 0h*2 + (0h + 2h + 0h)(-h - 4h + 3h)) to qh*2 + ph + n + dh3 and give d. -20 Rearrange 0g - 2g2 + 7g*2 + 2g - g*2 to qg + fg2 + u and give u. 0 Express 0n2 - n2 - 37 + 0n + n3 + 31 + n in the form ln*2 + f + bn + qn3 and give b. 1 Express -9u2 + u2 + u*2 + (1 - 2 - 2)(-u*2 - 4u*2 + 4u*2) as au + vu2 + m and give v. -4 Express 4f + 18f + 11f in the form kf + a and give k. 33 Express 1 + 4h*4 - 1 + (5h - 3h - h)(-h*2 + 5h*2 - 5h*2)(-2h - h - h) as mh*2 + gh*4 + nh*3 + wh + d and give g. 8 Express (-4 + 4 - 1)(1 - 1 - 2 + (-3 + 7 - 3)(-22 + 18 + 15))(-q + 4q - 5q) in the form hq + w and give h. 18 Express (-1 + 11o - 2 + 2 + (3o + 1 - 1)(1 - 1 - 2))(-2 + 4 - 4) as to + k and give k. 2 Rearrange 37z + 7z + 56z to nz + b and give b. 0 Express -5t - 2t - 5 + 9t as bt + h and give b. 2 Rearrange (4 - 5 + s + s)(16s2 - 12 - 2s*3 + 12) to the form zs + fs2 + hs*4 + rs*3 + x and give h. -4 Express -348o - 3o3 + 176o + 177o as ho + xo2 + jo*3 + r and give h. 5 Rearrange 0v - 2v2 + 0v + (-5 + 0 + 2v + 4)(-3v + 4v - 2v) to the form c + gv*2 + hv and give h. 1 Express 2 + 20v2 - 20v*2 - 3v + v*3 in the form pv + av3 + s + lv*2 and give p. -3 Rearrange -988 + 491 + 486 + 5u*2 to the form s + au + nu2 and give n. 5 Express -7 - 2v - 107v2 + 54v*2 + 32 + 52v*2 as xv + s + mv2 and give s. 25 Rearrange 0a*2 + 4a*2 - 5a*3 - 3a*2 to xa*2 + ba*3 + f + ha and give x. 1 Rearrange (-239 + 118 - 340)(0 + 0 + u) - u + 2u + 0u to the form vu + c and give v. -460 Express (7i4 - 9i + 9i)(1 + 3 - 2) + 5i4 + i4 - 4i*4 in the form h + qi*3 + ti*2 + ui*4 + pi and give u. 16 Rearrange 1 - k*4 + 10k + 8k + 13k*2 - 30k + 11k + k3 to the form f + zk*3 + jk*4 + dk*2 + uk and give d. 13 Express 7l - 5l - 12l + 2 in the form ql + d and give q. -10 Rearrange -999 + 47v + 999 - 2v - 2 + 2 - 5v + 3v + 0v + (v - 2 + 2)(4 - 2 - 1) - 4v + 0v + 3v to the form f + tv and give t. 43 Rearrange 54k3 + 4 - k + 2k*4 - 2 - 3k*4 - 58k*3 to the form yk*3 + bk*4 + tk + pk2 + c and give y. -4 Rearrange 72f*3 - 72f*3 + 3 - 2f*4 - f to the form bf + af3 + cf*2 + uf*4 + h and give u. -2 Express 0h - 7h - 3h + 0h2 - h2 in the form qh + b + th2 and give b. 0 Express y4 - 4y*4 + 2y*4 + (35y - 2y + 21y)(2y*3 - 5y3 + y3) in the form uy3 + cy*4 + f + gy + zy2 and give c. -109 Rearrange (-k + 2k + 0k)(-k + 4k - k)(1 - 1 - 3)(8k*2 + 9k*2 - 7k*2) to the form m + ck*4 + yk*3 + gk*2 + jk and give j. 0 Express (1 + 9 - 3 + 1 - 4 - 2 + (-2 + 1 + 2)(-3 + 5 - 1))(-2i - 3i + 3i) as v + bi and give v. 0 Express -4b2 + 33b*2 + 6b*2 + 4b*2 in the form c + yb + lb2 and give l. 39 Express 2c*3 + 39 - 2c*2 - c - 39 as d + mc*2 + jc + hc3 and give j. -1 Rearrange (4 - 4 + 2)(0x2 - 2x*2 + 4x*2) + (3 + 11x - 5x - 9x)(0 + 0 + 2x) to the form a + vx + gx*2 and give g. -2 Express ((-3y - 2y + 3y)(-17 + 2 + 11) + 1 + y - 1)(0y + 0y - y) in the form iy + j + hy*2 and give h. -9 Rearrange -2b*3 + 0b*3 + 4b*3 + (5b*2 - 2b2 + b2)(5b + b - 4b) - 4b*3 + 5b + 3b3 - 7b to gb2 + pb + v + fb3 and give p. -2 Express 0z + 2z + 2z + 3z as cz + k and give c. 7 Rearrange -2c3 - 3c - 3c + 0c + 5c - 1 to the form sc + pc2 + bc*3 + o and give b. -2 Rearrange 2v*2 - 4v*2 - 3v3 + v4 - 3v4 - v + 2v*3 to the form pv*4 + yv*3 + av*2 + u + hv and give y. -1 Rearrange -20z - 14z - 20z - 7z to the form v + fz and give f. -61 Express -71w - 390w3 + 36w + 388w3 - 67w as qw + yw*2 + iw*3 + c and give i. -2 Express (-3 - 1 - 1)(13 + m*3 + 2m*3 - 14) in the form cm*3 + dm + tm2 + n and give c. -15 Express (v2 + 4v - 4v)(0 - 3v + 0)(8v - 3v - 3v) as nv + kv2 + jv*4 + mv*3 + d and give j. -6 Express 5 + 0a*4 - 2 + 5a2 - a4 + a*3 in the form ja*2 + f + va*3 + ka + pa4 and give p. -1 Express -3201 - 59a + 3201 as o + ja and give j. -59 Express -80 + 80 - 16c as hc + a and give a. 0 Rearrange (-2f - 2f + f)(3f - 10f + 5f + 5) to the form tf*2 + sf + c and give s. -15 Rearrange 3 - 1 + 5w2 + 0w*2 + 11w*2 to the form y + lw*2 + dw and give l. 16 Express 6u2 + 6u2 + u2 in the form au2 + iu + h and give a. 13 Rearrange (-2h2 - 5h + 5h + (2h + 3 - 3)(-2h - 5 + 5) + 3 - 3 + 2h2)(2h + h - 4h) to the form th + zh*2 + f + lh*3 and give l. 4 Rearrange ((-1 + 3 - 1)(0f + 5f - 3f) + f - 2f + 0f)(-f*2 + 2 - 2 + (-3f + 2f + 3f)(2f - 5f + 4f)) to kf2 + v + df + yf3 and give v. 0 Rearrange 425g*2 - 2g + 2g4 + 4 + 3g*3 - 2g*3 - 422g*2 to kg + sg4 + ug*2 + fg3 + v and give f. 1 Express -m2 - 82 + 164 - 82 - 75m as n + ym + zm2 and give y. -75 Express 5 + 2 - 1 - 1 - b4 + b - 2b*2 in the form pb*4 + nb*3 + mb*2 + a + kb and give m. -2 Express (-19 + 7n3 + 19)(2n + 3n - 3n) + (-2n + 0n + n)(0n3 + 0n*3 + 3n*3) in the form qn*3 + hn + pn2 + an*4 + o and give h. 0 Express (5a*2 - 4a*2 + 0a*2)(-28a - a2 + 44a + 41a) in the form va*4 + m + ba*2 + ta + za3 and give z. 57 Express -z2 + 7z - 8z + 6z as dz + sz*2 + t and give d. 5 Express (3 + 1 - 2)(6p - 17p + 28p)(-2p2 + 2p*2 - 2p*3) in the form rp + dp2 + n + tp*4 + qp3 and give t. -68 Rearrange (-4 + 4 + t3)(-2 + 0 + 1) + 0 - t3 + 0 to the form v + ot*3 + ct*2 + rt and give o. -2 Rearrange 10 + 3f2 - 7 - 2f*2 to the form hf + a + jf2 and give j. 1 Express (-1 + 1 + z2)(2 - 1 + 2)(-6z + 5z + 0z + (-3 + 4 - 2)(-4z + 3z - z))(-2 + 4 + 2) as az + uz*3 + b + cz*2 and give u. 12 Express -1 - 25s*3 + 46s*3 - 3s + 0s - 27s3 + s4 as xs + gs*2 + cs*3 + os*4 + n and give n. -1 Rearrange (-6k + 3k + k)(3 - 2k - 3) + 3k*2 + 0k2 - k2 + k + k*2 - k - 2k to the form wk + f + nk2 and give n. 7 Express p3 - 29 - p + 57 - 30 in the form op + h + dp*2 + wp3 and give w. 1 Rearrange 139 - 60 - 24 + q3 + 2q to the form b + wq + vq2 + mq*3 and give b. 55 Express -2d*4 + 4016d - 2 + d*2 - 4013d + d*3 + 0d*2 in the form id*4 + sd + ud3 + hd*2 + p and give h. 1 Rearrange 1431c*2 - 2878c*2 + 1439c*2 - 6 - 3c*2 + 2c*2 + 0c*2 + (3 - 5 + 0)(-4c2 + 3c2 - c2) to the form l + dc + uc*2 and give u. -5 Express (3t + 107 - 107)(2 + 0 + 1) in the form jt + w and give w. 0 Rearrange (-1 + 1 + 3y)(-11 - 5 + 23) - 2 - y + 2 - 2 to i + qy and give i. -2 Rearrange (2 + 0 - 3)(-11u2 + 88u*2 + 56u*2) to the form ku + mu2 + i and give m. -133 Express (6c + 9c3 - 6c)(2c + 2c - 5c) in the form ac4 + gc*2 + d + pc*3 + qc and give a. -9 Rearrange s*2 - 7s**3 + 8	{ "pile_set_name": "DM Mathematics" }
p(y)). -3y Suppose -u = -2u - 8. Let x = 5 + -4. Let l(r) = 4r + 8. Let h(b) = b + 1. Let z(k) = uh(k) + xl(k). Let d(w) = -2w*2. Give d(z(m)). -32m*2 Let y(u) be the third derivative of 7u*4/24 - 15u*2. Let q(d) = -3d*2. Determine q(y(i)). -147i*2 Let f(d) = -11d*2. Let a(z) = 119z*2 + 4. Determine a(f(k)). 14399k4 + 4 Let h(r) = r2. Let i(d) = 4d + 48. Determine h(i(a)). 16a*2 + 384a + 2304 Let r(q) = 2q. Let s(j) = -9136j*2. What is s(r(y))? -36544y2 Let v(f) be the second derivative of -f6/240 + f*4/6 + f. Let u(s) be the third derivative of v(s). Let k(g) = -82 + 82 + 2g*2. What is u(k(m))? -6m*2 Let t(f) = -5f. Let s(r) = 2r2 + 115r. Give s(t(w)). 50w2 - 575w Let t(y) = -8y. Let a(g) = 196g. What is t(a(s))? -1568s Let q(b) = 24b. Let j(o) = 62o. Determine j(q(a)). 1488a Let j(a) = -a*2 - a + 1. Let n(v) = -6v*2 - 5v + 5. Let k(c) = -10j(c) + 2n(c). Let y(z) = 5z2 - 2z2 - z2. Determine y(k(p)). 8p4 Let o(j) = j2. Let u(a) = -a2 - 2a + 2. Let t(y) = -y + 1. Let m = -4 - -2. Let b(g) = mt(g) + u(g). Determine o(b(q)). q4 Let q(b) = 5b*2 + 6b. Let r(w) = 4w2 + 5w. Let z(p) = -5q(p) + 6r(p). Let c(t) be the second derivative of t*4/6 + t. Determine z(c(d)). -4d*4 Let x(j) = 556j. Let a(s) = 3s2. Determine x(a(r)). 1668r*2 Let j(c) = 4c*2. Let f(i) = 24i. What is j(f(p))? 2304p2 Let b(x) = -4x. Let r(c) = -133c - 56. Let k(q) = 7q + 3. Let j(a) = -56k(a) - 3r(a). Calculate j(b(p)). -28p Let v(i) = i2. Let b(m) = 2m*2 + 3. Let t(q) = 1. Let r(c) = -2b(c) + 6t(c). Give v(r(l)). 16l4 Let q(g) = -g2 + 4g. Let i = 5 - 3. Let y be q(i). Let v(x) = 4 + x2 - y. Let s(n) = -2n*2. Give s(v(t)). -2t*4 Let c(r) = -4r2. Let a(n) be the first derivative of -n2 - 1. Determine c(a(u)). -16u2 Let u(c) = c2 - c + 1. Suppose -4 = -2f - 0. Let t(w) = -w + 1. Let d(l) = ft(l) - 2u(l). Let p(j) = 20j2. What is p(d(n))? 80n4 Let m(s) = s2. Let n(l) be the third derivative of l7/2520 - l4/24 - l2. Let k(u) be the second derivative of n(u). Give m(k(a)). a4 Let f(n) be the second derivative of -n*3/6 - n. Let i(d) = -1. Let c(a) = 2a - 6. Let b(t) = c(t) - 6i(t). Calculate b(f(h)). -2h Let q(z) = -3z2. Let n(m) = -41m*2. What is q(n(v))? -5043v*4 Let t(l) be the third derivative of 11l*4/24 + 7l*2. Let z(s) = 4s*2 + 5s + 5. Let n(a) = -2a2 - 2a - 2. Let i(q) = 5n(q) + 2z(q). Give i(t(p)). -242p2 Let q(l) = -6l*2. Let a(h) = -2h*2 - 92. Determine a(q(k)). -72k*4 - 92 Let h(w) = -2w. Let b(k) = 1861k. Calculate b(h(n)). -3722n Let y(x) = x2 - x2 - 4x2. Let o(i) be the second derivative of -i4/6 + 21i. Give y(o(d)). -16d4 Let a(d) be the third derivative of d4/24 - 8d*2. Let l(i) be the second derivative of 5i*4/12 + 2i. Determine l(a(s)). 5s2 Let z(t) = -5t*2 + 2t*2 + 2t*2. Let a(c) = 8c - 8c - 15c. What is a(z(y))? 15y2 Let s(q) = 6q*2 + 4q. Let k(u) = 5u. Give k(s(a)). 30a*2 + 20a Let r be (3/1 - 3)/2. Let b(k) = 7k2 - 5k*2 + 0 + r. Let u(y) = 2y*2. Calculate u(b(j)). 8j*4 Let b(o) = -2 + 2o*2 - 3o*2 + 2. Let i be (2 - 2 - 0)-1. Let r(a) = ia - a + 5a. Give r(b(u)). -4u2 Let n(m) = m2. Suppose -32 = -2z - 2z. Let o(x) = -8x + 4x + zx. Determine o(n(l)). 4l2 Let l(j) = 3j - 2. Let k(c) = 39c - 27. Let r(a) = -4k(a) + 54l(a). Let h(g) = 10g*2. What is r(h(i))? 60i*2 Let k be 3 + -2 - (-1 - -1). Suppose -s - k = 2. Let i(j) = 2j2 + j. Let f(t) = t2 + t. Let x(c) = si(c) + 3f(c). Let b(n) = n*2. Determine b(x(a)). 9a*4 Let q(v) = 16v2 - v2 - 13v2. Let g(j) = 13j*2. Determine q(g(x)). 338x*4 Let a(m) = -3m. Let r = -4 + 6. Let w(g) = rg + g - g. Determine w(a(b)). -6b Let u(m) be the second derivative of 0 - 4m + 1/24m*4 + 0m*3 - 1/2m*2. Let k(r) be the first derivative of u(r). Let i(x) = x. Determine k(i(f)). f Suppose 4h - 14 = 2. Let a(b) = -2b2 - 4. Let v(d) = d2 + 3. Let u(r) = hv(r) + 3a(r). Let q(t) = -5t. Give u(q(j)). -50j2 Let o(u) = -26u + 11. Let t(f) = 5f - 2. Let z(a) = 6o(a) + 33t(a). Let g(j) = 35j + 32j - 66j. Give g(z(q)). 9q Let z(q) = -2q2. Let l(w) be the first derivative of -w2/2 + 3. Give l(z(j)). 2j2 Let r(a) = -10a. Let c(y) = y*2 + 288. Calculate c(r(g)). 100g*2 + 288 Let i(q) = -3q*2. Let j(y) be the first derivative of 1/2y*2 + 2 + 0y. Give i(j(x)). -3x2 Let k(z) = -18z. Let h(f) = -135f. Give k(h(j)). 2430j Let c(q) = -q*2. Let v(w) = -5534w*2. Give c(v(j)). -30625156j*4 Let n(k) = 2k. Suppose 0 = -6l + 3l. Let o(d) be the third derivative of -1/24d4 + 0 + 0d + ld3 + d2. Give n(o(x)). -2x Let p(u) be the first derivative of -u*2/2 + 9. Let t(x) = 5x*2. Determine p(t(y)). -5y*2 Let u(h) = -3h. Let m(x) = -99x. Determine m(u(a)). 297a Let d(n) = -2n2. Let x(p) = 3p - 1. Let l be x(1). Let r(v) = lv - 4v - 3v. What is d(r(c))? -50c*2 Let k(g) = 19g + 10. Let j(m) = 2m2. Determine k(j(x)). 38x*2 + 10 Let s(z) = 154z. Let q(t) = -t*2. Calculate s(q(r)). -154r*2 Let c(j) = 47j + 1. Let f(a) = -19a. Determine f(c(b)). -893b - 19 Suppose -4 = -z - 1. Let n(u) = -zu - 184 + 184. Let t(o) = -o2 + 2o*2 - 2o*2. Give n(t(f)). 3f*2 Let v(h) = -h + 5. Let l(i) = 3. Let y(r) = -5l(r) + 3v(r). Let d(m) = -2m*2. Determine y(d(x)). 6x*2 Let c(m) = 3m*2 + 3m. Let w(r) = 3r2 + 2r. Let h(k) = -2c(k) + 3w(k). Let b(o) be the third derivative of -o*5/20 + 4o*2. What is b(h(q))? -27q*4 Let c(m) = -4m2. Let t(n) be the first derivative of -n5/30 + n*2 + 6. Let j(g) be the second derivative of t(g). Determine j(c(y)). -32y*4 Let j(v) = -2v. Let f(d) = -2d - 625. Determine f(j(q)). 4q - 625 Let r(b) = b*2. Let g be 3/3-1 - -7. Suppose 4 = 2o, 3o - 16 + g = -2p. Let j(a) = 0a - a*p + 0a + 4a2. Give j(r(q)). 3q4 Let i(w) = -w2 + 57w. Let v(y) = 3y*2. Determine v(i(p)). 3p*4 - 342p*3 + 9747p*2 Let f(w) = w. Let h(o) = 98o*2 - 44. Calculate h(f(p)). 98p*2 - 44 Let s(k) = -17k - k + 6k. Let x(t) = -3t. What is s(x(g))? 36g Suppose 46 - 31 = 5s. Let j(h) = sh2 + h2 - 4h2 - h2. Let w(c) = 10c2. Determine j(w(z)). -100z*4 Let c(p) = -3p. Let n(f) be the third derivative of -1/12f4 + 0 + 0f*3 + 0f - f*2. What is n(c(v))? 6v Let o(v) = -2v + 4v + 6v - 6v. Let u(m) = 1 - 1 - 6m2. Determine o(u(w)). -12w*2 Let w(t) = 5t. Let y(b) = 30b2. Determine y(w(n)). 750n2 Let i(p) be the first derivative of p4/6 - 2p2 - 3. Let b(x) be the second derivative of i(x). Let z(q) = q2. What is z(b(s))? 16s*2 Suppose 0f - 1 = -f. Let q(a) = 4 - 3 - f - 9a2. Let v(n) = 2n. Determine v(q(l)). -18l2 Let m(h) = h2. Let b(w) = 7w + 14. Let i(g) = g - 13. Let v be i(8). Let n(j) = 2j + 5. Let a(f) = vb(f) + 14n(f). Calculate m(a(l)). 49l*2 Let m(l) = l - 6. Let s(i) = 10i - 55. Let p(y) = -55m(y) + 6s(y). Let g(o) = -2o2. Give p(g(n)). -10n*2 Let l(m) = -3m + m - 7m + 0m. Let w(t) = -4t. Let n(p) = 2l(p) - 5w(p). Let y(b) = 2b. Calculate n(y(j)). 4j Let q(u) = -2u. Let t(s) be the second derivative of 35s4/12 + 23s. What is q(t(a))? -70a2 Let k(j) = -2j. Let b(d) = d*2 + d + 8. Give b(k(y)). 4y*2 - 2y + 8 Suppose -g - 6 = 2r + 3r, -10 = -3g - r. Suppose k + l = 6, -l = -9k + gk + 18. Let b(x) = -kx2 + x2 + 4x2. Let w(n) = -n. Determine w(b(j)). -j2 Let r(d) = 178d. Let f(z) = 4z. What is r(f(i))? 712i Let f(u) = -7u2. Let s(p) = p + 2. Let v(z) = -2z - 3. Let d(l) = 3s(l) + 2v(l). Give d(f(y)). 7y2 Let s be (4-1)/((-9)/(-36)). Let z(b) = -7b2 + 5b - 5. Let g(d) = 22d2 - 16d + 16. Let h(l) = sz(l) - 5g(l). Let f(v) = 3v. Give h(f(k)). 18k*2 Let a(n) = n. Let g(j) = 12j. Let t(f) = 6a(f) - g(f). Let c(d) = 2d*2 - 2d. Let o(m) = -4m2 + 5m. Let b(k) = -5c(k) - 2o(k). Determine t(b(i)). 12i2 Let t(z) = 35z. Let q(g) = 4g2. Calculate t(q(y)). 140y*2 Let v(o) be the third derivative of 8o*2 + 0 + 0o + 0o3 + 0o*4 + 1/30o*5. Let h(j) = -2j. Determine v(h(s)). 8s2 Let b(h) = -2h*	{ "pile_set_name": "DM Mathematics" }
1, l: 1, i: 3}. What is prob of sequence iq? 3/44 What is prob of sequence rr when two letters picked without replacement from {r: 2, w: 3, m: 2, i: 5}? 1/66 What is prob of sequence apwa when four letters picked without replacement from wpmphwwaoowooopahowa? 1/1292 Three letters picked without replacement from {n: 10, q: 2, r: 6, x: 2}. What is prob of sequence xqx? 1/1710 Calculate prob of sequence mq when two letters picked without replacement from qqqqmfffmfqmqqffqfmf. 8/95 What is prob of sequence wvwv when four letters picked without replacement from {v: 4, w: 3}? 3/35 Three letters picked without replacement from fqmziqpf. What is prob of sequence iiq? 0 Calculate prob of sequence yky when three letters picked without replacement from {f: 1, k: 4, y: 1, p: 2}. 0 Three letters picked without replacement from {j: 1, n: 2, t: 2, c: 1}. Give prob of sequence tnt. 1/30 What is prob of sequence owdo when four letters picked without replacement from dwaowdwodddda? 3/1430 Four letters picked without replacement from {q: 3, c: 1}. What is prob of sequence qqqc? 1/4 Three letters picked without replacement from nddeulrul. Give prob of sequence nud. 1/126 Four letters picked without replacement from ddcdccccddcddccdddc. What is prob of sequence cccd? 35/646 Two letters picked without replacement from {x: 6, a: 4}. Give prob of sequence xa. 4/15 Two letters picked without replacement from qqwwwwhqmqmmqwm. Give prob of sequence mq. 2/21 What is prob of sequence cc when two letters picked without replacement from ccqccccccccc? 5/6 What is prob of sequence tzz when three letters picked without replacement from {t: 8, z: 3}? 8/165 Calculate prob of sequence lhbr when four letters picked without replacement from hahbxhaahraalrr. 1/2730 Two letters picked without replacement from psmommssomp. Give prob of sequence ps. 3/55 Three letters picked without replacement from ijguifujifijjj. Give prob of sequence ufg. 1/546 Four letters picked without replacement from {s: 1, n: 5, g: 1, j: 4, i: 4, l: 3}. What is prob of sequence nnli? 1/306 Two letters picked without replacement from iyiaeppb. What is prob of sequence pi? 1/14 What is prob of sequence eeyy when four letters picked without replacement from eyyeeyeyyyeee? 21/286 Two letters picked without replacement from iiyeiuuiuiuu. Give prob of sequence iu. 25/132 Calculate prob of sequence zzz when three letters picked without replacement from zxzxxxxzzxxxzxxx. 1/56 What is prob of sequence kk when two letters picked without replacement from nbbnkkkkkkbkbbnbbb? 7/51 Two letters picked without replacement from fllzzzllfzflzfzzzf. What is prob of sequence fl? 25/306 Three letters picked without replacement from qhmmhjhhjqjjqmqhmh. Give prob of sequence jhq. 1/51 Calculate prob of sequence yef when three letters picked without replacement from kykkkkkkfeykeytky. 1/510 Two letters picked without replacement from {j: 2, k: 4, m: 4, r: 2}. Give prob of sequence mm. 1/11 Calculate prob of sequence bxb when three letters picked without replacement from {b: 3, x: 2}. 1/5 What is prob of sequence sbfa when four letters picked without replacement from {f: 2, b: 9, a: 1, s: 7}? 7/5168 What is prob of sequence cjj when three letters picked without replacement from {c: 3, j: 2}? 1/10 Calculate prob of sequence np when two letters picked without replacement from ggpn. 1/12 Three letters picked without replacement from exexeexexgxee. Give prob of sequence eee. 35/286 Two letters picked without replacement from {q: 6, b: 6}. What is prob of sequence qq? 5/22 What is prob of sequence vm when two letters picked without replacement from {v: 3, m: 4, f: 1}? 3/14 Three letters picked without replacement from ggsggss. What is prob of sequence ggs? 6/35 Three letters picked without replacement from mwmwwwww. Give prob of sequence wmm. 1/28 Calculate prob of sequence tuku when four letters picked without replacement from uuututkkttk. 1/55 Two letters picked without replacement from yyvccyyyyyyyyv. Give prob of sequence vv. 1/91 Two letters picked without replacement from ebrrbtbrbbbbbretbrr. Give prob of sequence er. 2/57 Calculate prob of sequence qx when two letters picked without replacement from {q: 4, w: 11, x: 4}. 8/171 Two letters picked without replacement from {t: 1, d: 1, h: 1}. What is prob of sequence td? 1/6 Calculate prob of sequence twdx when four letters picked without replacement from txndw. 1/120 Four letters picked without replacement from {x: 5, u: 15}. What is prob of sequence xxxx? 1/969 What is prob of sequence lxxi when four letters picked without replacement from {x: 6, b: 1, i: 3, l: 4}? 15/1001 Three letters picked without replacement from gttgtggtggtt. Give prob of sequence gtt. 3/22 Two letters picked without replacement from nnkknkxnnnnnk. What is prob of sequence xk? 1/39 Four letters picked without replacement from {w: 6, r: 1, t: 4, c: 2, f: 2, l: 4}. What is prob of sequence lcwr? 1/1938 Two letters picked without replacement from xyxkauykyukkhkkukk. What is prob of sequence uu? 1/51 Three letters picked without replacement from {y: 4, n: 3, h: 3, l: 6, p: 2}. Give prob of sequence hpl. 1/136 What is prob of sequence dixc when four letters picked without replacement from dixiicg? 1/280 Two letters picked without replacement from ahhaoeaqhhohheq. What is prob of sequence hq? 2/35 Three letters picked without replacement from fnfnnnnnff. What is prob of sequence fnn? 1/6 Four letters picked without replacement from {i: 7, g: 2, c: 3}. What is prob of sequence cici? 7/330 Three letters picked without replacement from afaaffaaaa. Give prob of sequence faf. 7/120 Two letters picked without replacement from {z: 1, a: 1, l: 1}. What is prob of sequence al? 1/6 Calculate prob of sequence us when two letters picked without replacement from jjpsjujsusjj. 1/22 What is prob of sequence oe when two letters picked without replacement from eoooooooeoooo? 11/78 Four letters picked without replacement from yaayyaaa. Give prob of sequence yaay. 1/14 Calculate prob of sequence qbqx when four letters picked without replacement from qixqxxiqbxxiqqb. 5/819 Three letters picked without replacement from {u: 1, m: 2, x: 2, g: 1, n: 2}. What is prob of sequence umn? 1/84 Calculate prob of sequence hcc when three letters picked without replacement from {h: 1, c: 2, l: 1, y: 4}. 1/168 What is prob of sequence lhl when three letters picked without replacement from {h: 1, l: 9, p: 1, b: 4}? 12/455 Calculate prob of sequence ei when two letters picked without replacement from {n: 7, v: 1, i: 1, e: 4}. 1/39 Calculate prob of sequence lg when two letters picked without replacement from llkklgkgkkjlglgl. 1/10 Four letters picked without replacement from {s: 2, z: 1, u: 4, q: 4, f: 6}. Give prob of sequence sfsq. 1/1190 Calculate prob of sequence rlr when three letters picked without replacement from {x: 1, l: 1, r: 2, b: 2, e: 2}. 1/168 Two letters picked without replacement from {a: 8, l: 4, r: 8}. Give prob of sequence lr. 8/95 Two letters picked without replacement from {i: 3, k: 8, u: 3, b: 3}. Give prob of sequence kk. 7/34 What is prob of sequence zl when two letters picked without replacement from mzmjmljmljbmlmmj? 1/80 What is prob of sequence mm when two letters picked without replacement from gsmssggssmgusm? 3/91 What is prob of sequence zjz when three letters picked without replacement from {j: 7, z: 10, y: 1}? 35/272 What is prob of sequence am when two letters picked without replacement from {a: 10, m: 9}? 5/19 Two letters picked without replacement from ljjllljp. What is prob of sequence lj? 3/14 Two letters picked without replacement from {j: 2, t: 4}. Give prob of sequence tt. 2/5 Four letters picked without replacement from egeesgzxszesssseggxs. What is prob of sequence zxxz? 1/29070 Two letters picked without replacement from {m: 6, p: 2, t: 2, b: 3}. What is prob of sequence bt? 1/26 Three letters picked without replacement from fnhnfff. Give prob of sequence nhf. 4/105 What is prob of sequence ru when two letters picked without replacement from {g: 1, s: 1, u: 2, x: 2, r: 1, m: 2}? 1/36 What is prob of sequence eje when three letters picked without replacement from {j: 3, e: 9}? 9/55 Calculate prob of sequen	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.