Datasets:

timaeus
/

pile-dm_mathematics

Dataset card Data Studio Files Files and versions Community

Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
= -90. What is the tens digit of q? 9 Let z(o) = -o3 + o2 + 1. Let b be z(2). Let m(w) = -2w + 4. What is the tens digit of m(b)? 1 What is the units digit of (-1 - (-15)/9)3? 2 Let d be 1/2 + (-39)/6. Let t = -20 + 31. Let z = t + d. What is the units digit of z? 5 Suppose 93 = -z + 349. What is the tens digit of z? 5 Let i be (-27)/(-5) - 4/10. Suppose 0 = -3d - d - 5y + 15, 15 = -2d + iy. What is the units digit of -1 + 2 + (d - -1)? 2 Suppose 2v = 3m + 11, 10 = v - 4m - 3. What is the units digit of -4 + v + 43 + 2? 2 Let v = 5 + -2. Suppose -v - 1 = l. Let g(r) = -r. What is the units digit of g(l)? 4 Let k = 20 - -2. Let a = 11 - k. Let n = -5 - a. What is the units digit of n? 6 Let l(z) = 42z. What is the units digit of l(1)? 2 Let f(x) = -x*2 + 8x + 10. Let m = 9 + -1. What is the tens digit of f(m)? 1 Let l(c) = 18c - 9. Let p be l(7). Let i = -76 + p. What is the units digit of i? 1 Let h be (-4)/10 + 32/5. Suppose -4i + h = -i. Suppose -24 = -3c - iw, -c + 7 = -2w - 1. What is the units digit of c? 8 Let i be 76/(-4 + 2) + 2. What is the units digit of (-382)/(-8) - 9/i? 8 Let m = -8 - 0. Let x = m + 13. What is the units digit of x? 5 Let d(k) = -k3 + k2 + 2k - 3. What is the tens digit of d(-5)? 3 Let i = 78 - 207. What is the units digit of i/(-12) - 3/(-12)? 1 Let g(u) be the first derivative of -u5/60 - u4/4 - 2u3/3 + u2/2 - 1. Let r(p) be the second derivative of g(p). What is the units digit of r(-5)? 1 Let c be (-2)/(-5) + (-169)/(-65). Suppose -cw + 174 = 3w. What is the units digit of w? 9 What is the tens digit of 9 - (-1 + -5) - (2 - 1)? 1 Suppose -g + 0g + 3d + 4 = 0, 2g + 3d + 10 = 0. What is the tens digit of (4/5)/(g/(-35))? 1 What is the units digit of (6/9)/(2/207)? 9 Let h = -4 + -6. Let c = -7 - h. Suppose -2g = -cg + 22. What is the tens digit of g? 2 Suppose -2i - 20 = -7i. Suppose 0 = ij - 2j - 8. Let g(p) = p3 - 5p*2 + 7p - 5. What is the units digit of g(j)? 7 Let m be ((-1)/1)/(1/12). Let c = 1 - m. What is the units digit of c? 3 Let j = -18 - -11. Let k = j + 18. What is the units digit of k? 1 Suppose -2l + 4l = 0. What is the units digit of (1 - l)/((-4)/(-32))? 8 Suppose 2l - 4 = 3k - 10, -2k = -4. Suppose l = -3b + 33 - 9. What is the units digit of b? 8 Let t(w) = 4w2 - 3w - 1. What is the tens digit of t(-3)? 4 Suppose -p + 5p + 2l = 110, -l + 5 = 0. What is the units digit of p? 5 Let l = -18 - -39. Let h = l + -10. What is the tens digit of h? 1 Let a(z) = z*2 + z - 1. Suppose 2j + 3k = 18, 0 = -4j - 3k + k + 20. What is the tens digit of a(j)? 1 Let v(b) = 2b*2 - 1. What is the tens digit of v(-4)? 3 Let i = -213 + 416. What is the units digit of i? 3 Suppose 10z - 36 = 7z. What is the units digit of z? 2 Suppose -3p - 5f = -47, -3p + 0p = f - 67. Suppose 0 = -0u - 4u + p. Let n = u - 1. What is the units digit of n? 5 Let z(s) = 3s*2 + 3s - 5. What is the tens digit of z(-4)? 3 Suppose 109 = -5x + 414. What is the tens digit of x? 6 Suppose k = 3r - 575, r + 5k - k = 170. What is the tens digit of r? 9 Suppose 2t = -3y + 5t - 3, -3t = -15. What is the units digit of y? 4 Suppose -3a + 5x = 175, -6a - 120 = -4a - 4x. What is the tens digit of a/(-4) + 6/(-12)? 1 Let f(z) = -z + 2. Let b(r) = r*2 + 3r - 7. Let a be b(-5). Let t = a + -5. What is the units digit of f(t)? 4 Suppose 0 = 3j - 11 - 1. Let s = -1 - -1. Suppose sb + 40 = jb. What is the tens digit of b? 1 What is the tens digit of (9/(-4))/((-10)/240)? 5 Let y(c) = 16c*2 + c + 1. What is the tens digit of y(-1)? 1 Let s = 10 - 8. What is the units digit of s? 2 Suppose -q - 20 = -6q. Suppose -27 + 167 = qo. What is the units digit of o? 5 Suppose 2f = 5b - 0f - 246, -b = 3f - 39. What is the units digit of b? 8 Suppose 570 - 228 = 3i. What is the tens digit of i? 1 Let k(a) = 2 + 2 + 2 + 8a2 - a + 3 - a3. What is the units digit of k(8)? 1 Suppose 5w - 4j - 52 = 0, -4j = -w + 8 + 12. Let v = w - 0. Suppose 20 = -4t, -2d + 29 = -3t + v. What is the units digit of d? 3 Let y be 8/(-12)(1 + -13). Let s(m) = 2m - 3. What is the tens digit of s(y)? 1 What is the units digit of 2366/28 + 2/4? 5 Let s(x) = -8x + 2. What is the tens digit of s(-3)? 2 Let l be (211)/(4/8). What is the tens digit of ((-82)/(-8))/(11/l)? 4 Let j = 12 - 6. Suppose -2p = -jp + 16. Suppose 0c - pc + 44 = 4o, c - 20 = -2o. What is the units digit of o? 9 What is the units digit of ((-90)/25 + 4)50? 0 Let c(k) be the second derivative of 0 - 1/2k2 + 4k + 1/20k5 + 3/4k4 + k3. What is the units digit of c(-8)? 5 Suppose 5j + q - 856 = 0, 2j + 0q - 3q = 356. Suppose j = 4k - 4o, -2k = -3k + 3o + 45. What is the units digit of k? 2 Let z(f) = -24f. Let l be 5/(-3) + (-8)/(-12). What is the tens digit of z(l)? 2 Suppose 2i - 14 = 88. What is the units digit of i? 1 Let l = 18 - 14. Let v(s) = -s + 5. What is the units digit of v(l)? 1 Let t = 7 + -3. Suppose 25 = 5x - 5f, -5f + 28 = tx - 1. What is the units digit of x? 6 Let n = 5 - 5. What is the units digit of (2 - n) + 5 + -4? 3 Let m be 38/5 + (-2)/(-5). Let z = m + -5. Suppose zl = -l + 48. What is the units digit of l? 2 Let r(k) be the second derivative of k*4/6 - k. What is the units digit of r(1)? 2 Suppose -3x + x + 242 = 0. What is the hundreds digit of x? 1 Suppose 0y = -4y + 12. Let i = -3 + y. What is the units digit of (i - 8/6)-3? 4 Let k = 549 + -213. What is the units digit of k? 6 Suppose 0 = -4u + 1206 - 254. What is the units digit of u? 8 Suppose 0 = 5k - 3p - 317, 0 = -k - 3p + 2p + 57. What is the units digit of k? 1 Suppose -43 = 4o - 11. Let u be 8/o(1 + 1). What is the units digit of -2((-15)/6 - u)? 1 Suppose -z = 3x - 17, 0 = -0z - 5z - 4x + 52. What is the units digit of z? 8 Let n(x) = 1 + 6 + 6 + x. Let f = -22 + 10. What is the units digit of n(f)? 1 Let s(a) be the second derivative of -2a5/5 + a3/6 + a*2/2 + 2a. Let g be s(-1). Let j(q) = -q*3 + 7q*2 + 9q - 4. What is the units digit of j(g)? 4 Let a(j) = -1 + 2 - j + 8. Let y be a(7). Suppose 3w - 2p - 18 = -p, -yw + 19 = -3p. What is the units digit of w? 5 Suppose -2x + 5k + 494 = 94, -5k - 605 = -3x. What is the hundreds digit of x? 2 Let x(d) be the first derivative of -d*4/4 - 5d*3/3 + 9d*2/2 + 5d - 2. Let q be x(-6). Let f = q + 21. What is the units digit of f? 8 Suppose -2h + 5h = 42. Suppose -h = -2b - 0. What is the units digit of b? 7 Let o(p) = p2 + 8p - 8. Let k(u) = u3 + u2 - 4u. Let w be k(3). Suppose -2a + 0t + t - 19 = 0, -3a = 3t + w. What is the units digit of o(a)? 1 Suppose 7 = n - 5d, 0 = -3n - 0n + 3d + 9. Suppose nr - 16 = -2r. What is the units digit of r? 4 Let a(r) = 13r3 - r2 + 2r - 1. Let m be a(1). Let y = 21 - m. What is the units digit of y? 8 Let b be 2/(-9) - (-11)/9. Suppose b + 67 = 4h. What is the units digit of h? 7 Let r be 2/1 + 1 - -2. Let i = r - -2. What is the units digit of i? 7 Let l(n) = n*2 - 2n + 1. Let p be l(3). Suppose 9 = -o + pw, -2o + w = o + 5. Let y(u) = -u3 + u2. What is the units digit of y(o)? 2 Let z = -102 - -359. What is the tens digit of z? 5 Suppose -4w + 4h - 380 = -1284, -214 = -w - 3h. What is the tens digit of w? 2 Suppose 0 = -2o + 5 - 1. What is the units digit of (-60)/(-14) - o/7? 4 Suppose -5 = -4r - o - 4, -4 = 4r - 4o. Suppose g = -r + 10. What is the units digit of g? 0 Let a(s) = -2s*3 - 2s - 1. Let b(v) = -v3 + v2 + 1. Let q be b(1). Suppose 2 = -p + q. What is the units digit of a(p)? 3 Let d(m) = -m + 9. Let j be d(5). Suppose u = -ju + 65. What is the tens digit of u? 1 Let q(t) = 7t*3 - 16t*2 - 3t - 4. Let c(m) = -m3 + m2 - m - 1. Let p(u) = 6c(u) + q(u). What is the tens digit of p(11)? 1 Suppose 2f + 2n - 69 - 9 = 0, -2n - 97 = -3f. What is the units digit of f? 5 Suppose 0 = -3n - c + 18, -5n - 3c + 14 = -4n. Let z(s) = 4s - 3. Let o be z(2). Suppose 0i = oi - n. What is the units digit of i? 1 Let u(i) = 11i2 - 6i + 6. What is the tens digit of u(4)? 5 Let x(o) = 15o - 1. Let v be x(1). Suppose u = 3u - v. What is the units digit of u? 7 Suppose -4j = -10 - 2. Suppose -jk	{ "pile_set_name": "DM Mathematics" }
4 + 11v3 + 6v*2 - 6v - 6. Let l(u) = u5 - u4 - u3 - u2 + u + 1. Let g(r) = -6l(r) - z(r). Factor g(k). 5k*3(k - 1)(10k + 1) Let d = 25748/15 - 8566/5. Factor -34/3q4 - 22/3q*2 - 14q*3 + 0 - dq*5 - 4/3q. -2q(q + 1)*3(5q + 2)/3 Let o(n) be the second derivative of -n7/1890 + n6/270 - n5/135 + 2n*3/3 - 2n. Let t(u) be the second derivative of o(u). Let t(a) = 0. What is a? 0, 1, 2 Let z(w) be the first derivative of 8w6/3 - 116w*5/5 - 25w*4 + 32w*3/3 + 262. Determine o so that z(o) = 0. -1, 0, 1/4, 8 Let g(a) be the second derivative of 0 - 1/15a*6 + 3a2 + a4 - 8/3a3 - 15a + 0a5. What is d in g(d) = 0? -3, 1 Let w(l) be the first derivative of -l3/6 + 3l*2/2 - 9l/2 - 98. Factor w(t). -(t - 3)*2/2 Suppose 5q - 30 = -5c, -4c - q = 12 - 27. Factor -11kc - 9/2k - 75/4k2 - 7/4k*4 + 0. -k(k + 3)*2(7k + 2)/4 Let r(x) be the third derivative of -1/120x*6 + 0 + 0x*4 + 0x*3 + 11x*2 + 0x + 0x5. Factor r(b). -b3 Suppose -25c = -24c - 3. Let 4z3 + zc + 278z2 - 263z*2 = 0. What is z? -3, 0 Let x = 9713 + -38851/4. Factor -1/2r*2 + 1/2 + xr*3 - 1/4r. (r - 2)(r - 1)(r + 1)/4 Let a(x) be the first derivative of 2x6/3 - 16x*5/5 + 4x*4 + 102. Solve a(w) = 0. 0, 2 What is d in 0d - 15/2d3 - 5/6d*4 - 20/3d2 + 0 = 0? -8, -1, 0 Let u(l) be the second derivative of -l7/14 - 2l6/5 - 9l*5/20 + 11l + 20. Factor u(m). -3m3(m + 1)(m + 3) Suppose 446v - 5h + 5 = 445v, 0 = 2v - 2h + 2. Factor -4/3 + t*2 - 1/3t*3 + vt. -(t - 2)*2(t + 1)/3 Let g(t) be the first derivative of 3t4/4 + 6t*3 + 27t*2/2 - 371. Factor g(f). 3f(f + 3)2 Suppose 0 - 56/13v - 2/13v2 = 0. Calculate v. -28, 0 Let g(y) = -1. Let z(x) = 0x2 + 11 - x - x2 - 2 + 1. Let o(k) = 24g(k) + 3z(k). Factor o(l). -3(l - 1)(l + 2) Let u(o) be the first derivative of 3/2o2 + o3 - 3/5o*5 + 0o + 4 - 3/4o4. Suppose u(i) = 0. What is i? -1, 0, 1 Suppose 2g = 4 + 2. Let o be 4/g3/2. Solve -3a*o + 4a3 + a2 - 5a3 - a + 0a*3 = 0. -1, 0 Let w be 120/8 - 1/2. Find f, given that -413f3 + 0f*2 + 417f*3 + 12f*w = 0. -3, 0 Determine y so that -19 + 9 + 69y*2 - 40 - 74y*2 - 12y + 47y = 0. 2, 5 Let w(x) be the third derivative of -x5/150 + x4/60 + 4x*3/3 - 27x2. Find n such that w(n) = 0. -4, 5 Let q(v) be the second derivative of -v6/20 + 3v5/20 - v3/2 + 11v*2/2 - 10v. Let x(m) be the first derivative of q(m). Solve x(t) = 0 for t. -1/2, 1 Let d(i) be the third derivative of -i9/7560 - i8/3360 + i*7/630 + 11i*4/12 + 9i*2. Let b(m) be the second derivative of d(m). Factor b(f). -2f*2(f - 1)(f + 2) Let z = 92683/6 + -264407/18. Let s = z - 757. Factor 20/9f*2 - 16/9 - sf*4 - 2/9f*3 + 8/9f - 2/9f5. -2(f - 1)*2(f + 2)*3/9 Let j(a) be the second derivative of -1/7a*4 - 3/7a*2 + 3/140a*5 + 11a + 0 + 5/14a3. Determine h so that j(h) = 0. 1, 2 Let h(y) be the third derivative of y7/35 - y6/30 - 2y5/15 + y4/6 + y*3/3 + 94y*2. Factor h(t). 2(t - 1)*2(t + 1)(3t + 1) Let g(a) be the third derivative of 5a8/672 - 5a*7/84 + 7a6/48 - a5/8 + 3a2 - 3. Solve g(o) = 0. 0, 1, 3 Let f(x) be the first derivative of 0x*4 + 6 - 2/3x*3 + 2/5x*5 + 0x*2 + 0x. Solve f(h) = 0 for h. -1, 0, 1 Factor 0 - 3k - 1/4k*2. -k(k + 12)/4 Let x = 55 + -46. Find h, given that 4h3 - xh*3 - 14h*2 + 25h - 6h2 + 10h*3 - 10 = 0. 1, 2 Let i be (-6724)/(-40) - 1/10. Let k be (-3)/(-24) + 21/i. Factor -1/4 - kn*3 + 1/4n*2 + 1/4n. -(n - 1)*2(n + 1)/4 Let r(i) be the first derivative of -2/3i - i3 - 1/15i*5 - 7/6i*2 - 5/12i4 + 14. Factor r(q). -(q + 1)3(q + 2)/3 Suppose -2l + 7l - 15 = 0. Suppose 1 = 3g - 5. Factor -4 - n - n*g - ln + 0. -(n + 2)*2 Let x(t) be the first derivative of 4t5/25 + t4/5 - 4t3/15 - 2t*2/5 - 201. Solve x(h) = 0 for h. -1, 0, 1 Let k(z) = 3z + 57. Let w be k(-19). Suppose w = 8a + 4 - 4. Factor 4/5 - 4/5c*2 + ac. -4(c - 1)(c + 1)/5 Suppose 17/2i + 1/2i*2 + 15 = 0. What is i? -15, -2 Let y = -1830 + 1833. Let n(i) be the second derivative of -3i*2 + 1/5i*5 - 4/3i*y - 7i + 1/6i4 + 0. Find s such that n(s) = 0. -1, 3/2 Suppose 4g - 8x - 24 = -4x, 6 = 3g - x. Solve 8/17c*3 - 10/17c*2 + 4/17c - 2/17c4 + g = 0 for c. 0, 1, 2 Let v(f) = f3 - 7f*2 - 7f - 9. Let z(j) = -4j2 - 4j - 4. Let y = -83 - -88. Let x(a) = yz(a) - 2v(a). Factor x(q). -2(q + 1)3 What is t in t3 + 0t*3 + 2t*3 + 3t*2 - 9t*2 = 0? 0, 2 Factor 374/7g - 34969/7 - 1/7g2. -(g - 187)2/7 Suppose 0 = -3l - 5g + 341, 0l + 114 = l + 2g. Let i = -110 + l. Factor 1/3j*i - 2/3j - 1. (j - 3)(j + 1)/3 Suppose 1/4l*3 - 1 + 2l - 5/4l2 = 0. Calculate l. 1, 2 Suppose -3q - 120 + 132 = 0. Let o(j) be the second derivative of -1/20j5 - 1/3jq - j2 - 9j + 0 - 5/6j3. Factor o(b). -(b + 1)2(b + 2) Let b(c) be the first derivative of -2c*3/45 + 44c*2/15 + 6c + 86. Let b(x) = 0. What is x? -1, 45 Factor -89d3 + 84d*3 - 1725d - 5848 + 1348 - 170d2. -5(d + 4)(d + 15)2 Let w = -75 + 78. Factor 25y*3 - 10y3 + y5 - wy4 + 3 - 6y*2 + y - 17y*3 + 6y4. (y - 1)2(y + 1)2(y + 3) Let m be (-213)/12 + (-3)/12. Let n be (-3)/m + 11/6. Factor 0b2 - 5b*2 - 6b - 3b3 - 5bn + b2. -3b(b + 1)(b + 2) Suppose 426 + 102 = -12o. Let r = 44 + o. Factor -1/3p2 + r + 0p - 1/3p3. -p2(p + 1)/3 Let x(h) = h*3 - 23h*2 + 2h - 10. Let m be x(23). Factor -2d - 54d - m + 24d + 4d*2. 4(d - 9)(d + 1) Find m, given that 40m*2 + 0m + 0 - 38/5m4 + 32m*3 + 2/5m*5 = 0. -1, 0, 10 Find h such that 81/2h*4 - 21/4h*5 - 165/2h*3 + 567/4h - 27h2 + 81/2 = 0. -1, -2/7, 3 Suppose -2f - 5u - 22 + 6 = 0, -5f + 18 = -2u. Factor -3 - 140j*f + 149j*2 - 3j*3 + 6 - 9j. -3(j - 1)3 Let q(h) be the third derivative of -3/10h*5 + 0 - 1/40h*6 - 3/2h*4 + 21h*2 - 4h*3 + 0h. Factor q(j). -3(j + 2)3 Let b(o) be the third derivative of o6/720 - o5/60 + 8o*3/9 + 8o*2 - 23. What is a in b(a) = 0? -2, 4 Let a(x) be the first derivative of -15 + 1/2x*4 + 10/9x*3 + 1/3x*2 - 4/9x*6 - 2/3x*5 + 0x. What is i in a(i) = 0? -1, -1/4, 0, 1 Let y(u) = 118u + 19 + 28u*2 + 157 - 6u. Suppose 61m - 5 = 60m. Let d(p) = 9p2 + 37p + 59. Let h(a) = my(a) - 16d(a). Factor h(b). -4(b + 4)2 Let s(j) be the second derivative of -j4/84 + 3j*3/7 + 20j*2/7 + 380j. Factor s(b). -(b - 20)(b + 2)/7 Let l(g) be the second derivative of g5/100 + 7g*4/60 + 8g*3/15 + 6g*2/5 - 430g. Factor l(w). (w + 2)*2(w + 3)/5 Find u, given that -48/5u2 + 6/5u*4 - 6 + 1/5u*5 - 2/5u*3 - 71/5u = 0. -5, -2, -1, 3 Let z(y) be the first derivative of y4/8 + y3/6 - 10y2 - 56y + 162. Factor z(b). (b - 7)(b + 4)2/2 Let y(g) be the first derivative of 9/16g*4 + 6 - g + 1/10g*5 + 0g*2 + 11/12g*3. Solve y(a) = 0 for a. -2, -1, 1/2 Suppose -12 = -5q - 4z, 5q - 4q - 5z = 14. Suppose -2y + 5v = -6y + 3, 5y - 14 = qv. Factor o - 3o*3 - 16o*2 + 16o*y + 2o*3. -o(o - 1)(o + 1) Let -2/17a*4 + 0a + 0 + 12/17a3 - 16/17a2 = 0. Calculate a. 0, 2, 4 Let g(l) be the third derivative of l5/360 - l*4/24 - 4l*3/9 - 78l*2. Factor g(f). (f - 8)(f + 2)/6 Let b = 38 - 31. Factor 7n - n2 - 11n + n - 3 + bn. -(n - 3)(n - 1) Suppose g*3 + 20g + g*3 - 25g - 26g2 - 23g = 0. Calculate g. -1, 0, 14 Let h(u) = u - 29. Let a be h(29). Let s(r) be the second derivative of 2/9r3 - 6r - 1/3r2 + a - 1/18r*4. Let s(i) = 0. What is i? 1 What is n in 8/11n*2 + 0 - 2/11n*4 - 2/11n*5 + 12/11n*3 - 16/11n = 0? -2, 0, 1, 2 Let v(y) = -y - 9. Let n be v(-13). Let b(m) be the second derivative of 1/6mn + 0m*2 + 0 + 0m*3 + m. Factor b(w). 2w*2 Suppose -391 + 365 = -13a. Factor 0 + 4j3 + 8/3j*2 + 0j + aj4 + 1/3j5. j2(j + 2)3/3 Let 2/7m*2 - 108/7 - 50/7m = 0. Calculate m. -2, 27 Let f be (-8)/3(-159)/530. Factor 0 + fj - 2/5j2. -2j(j - 2)/5 Let k(c) = -c3 - 4c*2 + 10c - 9. Let d be k(-6). Let p = 215/154 - 17/14. Factor pw	{ "pile_set_name": "DM Mathematics" }
r and 12? 12 Let r be 2/(28/385)2. What is the highest common factor of 11 and r? 11 Let d(b) = -2b - 10. Let a be d(-9). Let q be a3(-1)/(-2). Suppose -3p = c - p - 34, -p = -5c + 115. Calculate the greatest common divisor of q and c. 12 Let d(n) = n + 12. Let x be d(-8). Let r be (1 - (-4)/(-16))4. Suppose -ro - o = 5m - 159, -9 = -3m. Calculate the highest common factor of o and x. 4 Let a = -46 + 48. Let t be ((-220)/50)/(a/(-30)). What is the greatest common divisor of t and 22? 22 Let r(v) = 3v + 3. Let b be r(-13). Let n = b - -113. What is the greatest common factor of n and 11? 11 Let m be 0/((-4 + 6)/(-1)). Suppose -7k + mk = -70. Calculate the greatest common factor of 30 and k. 10 Let k = 13 - -12. Let t be (-15)/120 - 1801/(-8). What is the highest common divisor of t and k? 25 Let v(u) = 124u - 160. Let b be v(4). Calculate the highest common factor of b and 48. 48 Let u(b) = -4b3 + 65b*2 + 34b + 12. Let m be u(15). What is the greatest common divisor of m and 61? 61 Suppose -4f + 179 = -1. Suppose -s + k - 15 = -2s, -f = -3s - k. Calculate the greatest common factor of s and 15. 15 Let s = -26 - -38. Let t = s + -10. Let v be 2/(-1) + 8t. What is the greatest common factor of v and 2? 2 Let g(j) = -j*3 - 16j*2 + 3j - 4. Let p be g(-16). Let d = p - -64. Calculate the highest common divisor of d and 8. 4 Let a be (-6 - 16/(-3))/((-2)/1110). Calculate the highest common divisor of a and 10. 10 Suppose 5f + 24 = -271. Let j = -53 - f. What is the greatest common divisor of j and 54? 6 Let u be (0 + -3)((-556)/(-12) + -4). Let n = u + 217. Calculate the highest common factor of 10 and n. 10 Let q = -348 - -351. Calculate the greatest common divisor of q and 48. 3 Suppose 5k = -o + 493, 9o = 11o + 4. What is the highest common factor of k and 18? 9 Suppose -31i + 33i = 3p - 1611, 4p = -3i + 2165. What is the greatest common factor of 98 and p? 49 Suppose -4z + 27 = -3i, -3z - 2i + 42 = 3i. Suppose zk - 4k = 280. What is the highest common divisor of 14 and k? 14 Let v be 1/6 + (-13667)/(-474). Calculate the highest common factor of 899 and v. 29 Suppose 4g = -4j + 64, 2g + 6 - 30 = 2j. Calculate the greatest common divisor of 357 and g. 7 Let p = 408 - 406. Calculate the greatest common factor of p and 8. 2 Suppose 3d - 13 = 2d. Let x(z) = z + 11. Let b be x(-7). Let g = b + 9. What is the greatest common divisor of d and g? 13 Let r(n) = n2 - 3n + 12. Let f be r(4). Let z be ((-6)/(-15))/(3/(-540)-3). What is the highest common divisor of f and z? 8 Let x(m) = 87m*2 - 11m + 26. Let p be x(2). What is the greatest common divisor of p and 32? 32 Let c = 1081 + -1075. Suppose -3p = -5u - 332 - 92, 3p + 3u = 408. What is the highest common factor of c and p? 6 Suppose h = -3x + 322 + 115, -x - 5h + 141 = 0. Calculate the greatest common factor of x and 73. 73 Suppose 2j - 4g = 64 - 26, 5j - 3g - 102 = 0. What is the greatest common factor of j and 84? 21 Suppose 4d + d - 205 = 5f, d - 2f - 36 = 0. Let g be -25 - (-18)/4(-84)/(-63). Let h = d + g. What is the highest common divisor of h and 3? 3 Suppose 4l = -2o + 32, -4o = -4l - 0l - 100. Suppose 7i = oi - 2025. What is the greatest common divisor of 90 and i? 45 Let c(m) be the first derivative of -m4 - 4m3/3 - m2/2 - 2m - 20. Let y be c(-2). What is the highest common factor of y and 160? 16 Let z(c) = -5c - 17. Let q = -36 - -30. Let p be z(q). Suppose -4r = -pr + 81. Calculate the highest common factor of 6 and r. 3 Let z be 11/(-3)(21 + -33). Calculate the highest common factor of z and 11. 11 Suppose 2l = -2l + 180. Suppose 4r - r - l = 0. Let u = 412 + -292. Calculate the greatest common factor of u and r. 15 Let c be (-2 - (-12)/5)5. Suppose -cq - l + 85 = 0, 5l - 25 + 0 = 0. What is the greatest common factor of q and 5? 5 Let r(g) = g2 + 38g + 349. Let q be r(-13). Let s(n) = n*2 + n - 4. Let i be s(-5). Calculate the highest common divisor of q and i. 8 Let j = 913 - 413. Calculate the highest common factor of j and 25. 25 Suppose -5x = 4g + 84, -5g - 9 = 5x + 91. Let h = 40 - g. What is the highest common factor of h and 8? 8 Let j be 15/22. Suppose -4 + 16 = 4c, 4u = 3c - 189. Let a = u - -50. Calculate the greatest common factor of j and a. 5 Let v be 3/((-6)/(-12)6/86). Suppose 5a - 162 = 53. Calculate the greatest common factor of a and v. 43 Let s = -687 - -701. What is the greatest common factor of 154 and s? 14 Let x(t) = -t*3 - 6t*2 + 6t + 12. Let w be x(-7). Let l = 19 - w. Suppose g + 3g - 120 = l. Calculate the greatest common divisor of g and 20. 10 Let f(q) = q3 - 4q*2 + q - 7. Let x be f(5). Let m be -44/(-16)-3 + x. Calculate the highest common divisor of 30 and m. 10 Let t(p) = 2p + 2. Let g be t(-1). Suppose g = -a - a + 108. Let f = 46 + -28. Calculate the greatest common factor of a and f. 18 Let z be 124(147/(-14))/(-21). Calculate the highest common factor of 558 and z. 62 Let r = 770 + -740. Calculate the greatest common factor of 165 and r. 15 Let h(k) = k2 - 29k - 52. Let m be h(31). Let n = 45 - -25. What is the greatest common divisor of n and m? 10 Suppose -13c = -6c - 4186. What is the highest common factor of 92 and c? 46 Let z be -10(-2)/12-3. Let j(h) = -21h - 6. Let b be j(z). Let v = b + -45. What is the greatest common divisor of v and 18? 18 Suppose -t + 4y + 491 + 42 = 0, t - 488 = -5y. Calculate the greatest common factor of t and 27. 27 Let s = 158 - 153. Suppose -4i - sb = -320, i = 2i + b - 80. Calculate the highest common divisor of i and 100. 20 Suppose -2h = -7h - 5, -5z + 87 = 3h. Suppose 7r - 2j - z = 3r, -5r + 27 = -j. Calculate the greatest common factor of 2 and r. 2 Let v = -119 - -641. Suppose -2j = -4t - 278, 3j - 4t - v + 97 = 0. Let m = -26 + j. What is the greatest common divisor of 11 and m? 11 Let n = -9 + 20. Suppose -h + n + 1 = 0. Let c = 26 + 70. Calculate the greatest common divisor of c and h. 12 Let l = -43 + 38. Let q be 4 - (l + -3) - 3. What is the highest common factor of 36 and q? 9 Suppose 12f - 448 = 5f. Let t = f + -63. Calculate the greatest common divisor of t and 6. 1 Let t be (-20)/(-6)798/70. What is the greatest common divisor of t and 19? 19 Let x = -11 + 40. Suppose v = x - 23. Calculate the greatest common factor of v and 3. 3 Let n = -22 + 34. Let f(b) = 4b*2 + 65b + 40. Let i be f(-16). Calculate the highest common factor of n and i. 12 Let i be 225/(-45)(-68)/10. Calculate the greatest common divisor of 34 and i. 34 Let l be -1((-3)/1 + -4). Suppose 4p - 36 = -2s, -3s - 2p + l = -43. Suppose 0 = -4t + 8, -y = t - 6 - s. What is the greatest common factor of y and 80? 20 Suppose -4s - 8b + 10b = -2238, s = -2b + 557. What is the highest common factor of 52 and s? 13 Suppose -3d + 3s + 124 = -110, 2d - 171 = -3s. What is the highest common divisor of 216 and d? 27 Let r = 23 - 13. Suppose -5c + 21 = -2h, -3h - 23 + 9 = -4c. Calculate the highest common factor of r and c. 5 Suppose -198 = 50c - 54c + 5y, -6c + 3y + 288 = 0. Let m be (-4)/((-92)/(-47) - 2). What is the greatest common factor of m and c? 47 Let q be 12/222 + 127920/481. Calculate the greatest common divisor of q and 14. 14 Suppose 8j = 925 - 109. Calculate the highest common divisor of j and 6. 6 Let h = 62 + 106. Suppose -4n = -4b - h, -3n + 2 = 2b - 114. Suppose 5x - n = -5l, x - 4l = -3l. What is the greatest common divisor of 8 and x? 4 Let p(o) = 2o*3 - 8o*2 + 10o - 3. Let g be p(3). Suppose -7c = -54 - g. Calculate the highest common divisor of c and 45. 9 Let q = 769 + -743. What is the greatest common factor of q and 962? 26 Let q(o) = 13o + 1. Let z be q(1). Suppose 0 = 3u - 4u + z. Let g = -12 + u. What is the highest common divisor of 1 and g? 1 Suppose 4v - 64 - 16 = 0. What is the greatest common factor of 260 and v? 20 Suppose 0 = 4a - 3w - 216, 2a + 2w - 154 = -46. What is the highest common factor of 45 and a? 9 Let s(t) = 2t*2 - 22t - 15. Let m be s(10). Let c = -23 - m. What is the highest common factor of 32 and c? 4 Let f be ((-8)/10)/(8/(-140)). Let q be (273/f)/((-3)/(-8)). Let w be 51156/10. What is	{ "pile_set_name": "DM Mathematics" }
- 195751r3 - 32rv2 + r wrt v? 186r*3v - 5r3 - 64rv What is the first derivative of -t4 + 2t*3 + 298t*2 - 57548? -4t*3 + 6t*2 + 596t What is the second derivative of -5825g3i*2 - 5g*3s*2 + 3g*2s*2 - 229i*2s*2 - 189421i wrt i? -11650g3 - 458s*2 What is the second derivative of -3k*3o*2 + 2k*3o + k*2o*2 + 41k*2o + 2378ko*2 + 17k - o*2 - 6o + 2 wrt o? -6k3 + 2k*2 + 4756k - 2 Find the second derivative of -30698c5 - 4c*2 - 1211c - 416 wrt c. -613960c3 - 8 Differentiate -83226d*2 + 766462 wrt d. -166452d Differentiate -61847c4q + 2c2q - 211990q + 2 with respect to c. -247388c*3q + 4cq What is the derivative of -2hkn + 15hk + 7hn - 585h - 28kn + 62k + 11n + 2 wrt k? -2hn + 15h - 28n + 62 Find the first derivative of 6143y3 + 16y*2 + 1493521 wrt y. 18429y*2 + 32y Find the third derivative of -r*2z*6 + 2339r*2z*4 + 2r*2z - 14r2 - 9rz2 + 2 wrt z. -120r*2z*3 + 56136r*2z What is the first derivative of 4fh*2u + 27fh*2 - 6fhu - 52fh + 12fu + f + 16u wrt u? 4fh2 - 6fh + 12f + 16 What is the second derivative of -337vw*3 - 10vw2 + 8vw + 2w*3 - 2w*2 - 380w + 4 wrt w? -2022vw - 20v + 12w - 4 Find the first derivative of 4165667g - 1290883. 4165667 Find the third derivative of -1215454o*5 - 739780o*2 wrt o. -72927240o*2 What is the derivative of 4hrt*2 + hrt + 28h - rt2 - 9r + 5t2 - 7 wrt h? 4rt2 + rt + 28 Find the second derivative of -109p5 + 715p*3 - 60896p - 2. -2180p3 + 4290p What is the third derivative of 2037581l5 - 792594l*2 wrt l? 122254860l*2 Find the first derivative of fnq + 67fn + 1184fq2 - 3f - nq + 3n + 115562q2 wrt f. nq + 67n + 1184q*2 - 3 What is the third derivative of -2bq4 + 2bq3 - 221bq2 - 2b - 6q4 + 39q3 + q2 + 3q wrt q? -48bq + 12b - 144q + 234 Differentiate 19a*2q - 18273a2 - 2aq + 560q with respect to q. 19a2 - 2a + 560 What is the second derivative of 27040a2k - 105a + 93k - 4 wrt a? 54080k What is the second derivative of 12359d*2l*2 + 4d*2l - dl2 + 109l + 2 wrt l? 24718d2 - 2d What is the second derivative of -959t4 + 19t*2 + 210717t? -11508t2 + 38 Differentiate -a2 + 8081an2 - an - 13n2 - 25455n wrt a. -2a + 8081n*2 - n What is the third derivative of -27174m*3 - 6123m*2 - 3m + 2? -163044 Differentiate 4854x2 + x + 151673 wrt x. 9708x + 1 What is the first derivative of 21414f4 + 16963 wrt f? 85656f*3 Differentiate -36357s*4 - 4s*2 - 911776 with respect to s. -145428s*3 - 8s Find the second derivative of -5214z3 - 81z*2 - 2097792z. -31284z - 162 Find the second derivative of gv*3 + 19gv2 - 338g + 471v3 + 10v - 1 wrt v. 6gv + 38g + 2826v Find the second derivative of 1612000v4 - 317623v. 19344000v2 What is the derivative of 479293p*2 + 438740? 958586p Differentiate -485cd*3 + 3c + 24d3 - 14040 wrt d. -1455cd2 + 72d*2 Find the second derivative of 7ai3lv2 - 3130ai3lv - 6ai2l - ai2v*2 + ilv + 177lv2 wrt v. 14ai3l - 2ai*2 + 354l Find the second derivative of 1708c2h*2 + 243228c*2h - 5ch*3 + 3ch2 - h3 wrt h. 3416c*2 - 30ch + 6c - 6h What is the first derivative of -3l*2m - 5l2 - 110lm + 37265m wrt l? -6lm - 10l - 110m Find the third derivative of -2655752a2j3 + a2j2 - 6a*2 - 6aj2 - 730 wrt j. -15934512a*2 Find the third derivative of -133i*3r*3 - 3i*3r*2 - 2i*2r*3 - 27r*3 + 14491r*2 wrt r. -798i*3 - 12i*2 - 162 Differentiate 260507v*2 + 345278 wrt v. 521014v What is the second derivative of 314n3u*2 + 472n*3v*2 - 33nuv*3 - 21nv3 + 1991u*2v*3 wrt u? 628n*3 + 3982v*3 Find the third derivative of 2o*5 - 6445o*3 + 5o*2 + 539o. 120o2 - 38670 Differentiate 3iy3 - 9iy2 - 4iy + 488i + 3y3 - 31098y with respect to i. 3y3 - 9y*2 - 4y + 488 Find the third derivative of 1029w5 + 6w*4 - 4w*3 - 52509w*2. 61740w*2 + 144w - 24 What is the derivative of -3qx*3 + 304qx2 - 32qx + q - 413456x*3 wrt q? -3x*3 + 304x*2 - 32x + 1 Differentiate -27a4 + 24a*3 + 5a*2 + 28616 with respect to a. -108a*3 + 72a*2 + 10a Differentiate -9s2w - 76s2 + sw + 2s + 305256w with respect to s. -18sw - 152s + w + 2 Find the third derivative of -4i*6 + 10710i*3 - 31i*2 - 92. -480i*3 + 64260 What is the second derivative of 208905u*4 - u + 273438 wrt u? 2506860u*2 Find the third derivative of 3p*5 + 3p*4 + 204p*3 - 21204p*2 wrt p. 180p*2 + 72p + 1224 What is the second derivative of 196127k2o*3 - 328ko3 - 2ko2 + 4ko - 2k + 7o2 wrt k? 392254o*3 What is the first derivative of 2a*4 - 23740a*2 - 122322? 8a*3 - 47480a Differentiate 2f3r + 1068f3 - 2f*2 - 389fr - 4f - 32r + 3 wrt r. 2f*3 - 389f - 32 What is the third derivative of 16558b5 - 8b*3 - 3b*2 - 3714b - 2 wrt b? 993480b2 - 48 Find the third derivative of 1015986w*3 + 262424w2 wrt w. 6095916 What is the second derivative of q5 - 217q4 + 3641q + 2 wrt q? 20q3 - 2604q*2 What is the third derivative of 277826h*4 - 4h*3 + 1233439h*2 wrt h? 6667824h - 24 Find the third derivative of -3770i6n*2 + 3i*3n*2 + 97i*2n*2 - 2i*2n - 6i2 - 3in2 wrt i. -452400i*3n*2 + 18n*2 What is the second derivative of 2k*3z*3 - 575k*3 - 13k*2z + k*2 - 2kz3 - 4kz2 - 270z*3 - 6 wrt k? 12kz3 - 3450k - 26z + 2 What is the second derivative of 41817q*5 + 12668q? 836340q3 Find the first derivative of -6s*2 + 31393s - 334458. -12s + 31393 Differentiate -27836bi3 + 2i*3 - 11974i*2 with respect to b. -27836i*3 What is the second derivative of -2597224j*3 - 2j + 106826? -15583344j Find the third derivative of -22877k*3l - 2409k2l - k*2 - kl wrt k. -137262l What is the derivative of 9z*4 + 1055z*3 + 2z*2 + 2z + 646984? 36z3 + 3165z*2 + 4z + 2 Find the third derivative of -32ikp3 + ip*3 - 43i - 86kp*3 - 3429kp2 wrt p. -192ik + 6i - 516k What is the second derivative of -5428964n*2 + 3718315n? -10857928 What is the second derivative of -a*5m + 1421a5 + 6am - a - 12m - 2 wrt a? -20a3m + 28420a3 What is the second derivative of -807155x4 - x2 - 16974x + 16? -9685860x*2 - 2 Differentiate -29cxz + cx + 2761cz2 - 52xz2 - 1069x with respect to c. -29xz + x + 2761z2 What is the second derivative of 3432w*2z3 - w2z - 13w*2 + 112wz2 - 11wz - z2 + z + 22 wrt z? 20592w*2z + 224w - 2 Find the second derivative of -319096c*2i*2k3 + c2i2k + 176158ck3 + i2k3 - 2ik3 wrt c. -638192i*2k*3 + 2i*2k Find the third derivative of 2z6 - 92212z*5 + 2z*4 + 67z*2 + 28z - 1. 240z3 - 5532720z*2 + 48z What is the second derivative of 20g4 - g3 - 1260g*2 - 44982g? 240g2 - 6g - 2520 Find the first derivative of -29493p2 - 8p + 3625993 wrt p. -58986p - 8 Find the third derivative of 10k*5 + 8615k*4 - 40k*2 - 2k - 197 wrt k. 600k2 + 206760k Find the third derivative of 2939233g2j3 + g2j2 + 143gj - 3g - 22j2 wrt j. 17635398g*2 Differentiate -21685j*2p*2 + 2j*2p + 19681p2 wrt j. -43370jp2 + 4jp What is the second derivative of -271135m*2o*2 - 35880m*2o wrt o? -542270m2 Find the first derivative of -1442789y + 2834438. -1442789 Find the first derivative of -122l4z - 2l2z*2 + 103884z*2 wrt l. -488l*3z - 4lz*2 What is the derivative of 5k*4 + 7585k*2 + 104794 wrt k? 20k*3 + 15170k What is the third derivative of 9g5 - 458g4 - g3 + g*2 + 8119g wrt g? 540g2 - 10992g - 6 What is the first derivative of -1922804z4 - 3220008? -7691216z*3 What is the derivative of -1411937p + 4014841 wrt p? -1411937 Find the third derivative of -565102l3 - 8l*2 + l - 3441 wrt l. -3390612 What is the first derivative of 11v*2 + 2918vx2 - 5x**2 - x - 5	{ "pile_set_name": "DM Mathematics" }
r? 5 What is 279883 to the power of 1/4, to the nearest integer? 23 What is 88517 to the power of 1/6, to the nearest integer? 7 What is 22881 to the power of 1/2, to the nearest integer? 151 What is 2886265 to the power of 1/3, to the nearest integer? 142 What is the ninth root of 68129 to the nearest integer? 3 What is 287635 to the power of 1/3, to the nearest integer? 66 What is the third root of 1393474 to the nearest integer? 112 What is the eighth root of 5735305 to the nearest integer? 7 What is the third root of 442673 to the nearest integer? 76 What is 123252 to the power of 1/4, to the nearest integer? 19 What is the cube root of 668623 to the nearest integer? 87 What is the ninth root of 29690 to the nearest integer? 3 What is the fourth root of 265685 to the nearest integer? 23 What is the seventh root of 98583 to the nearest integer? 5 What is 15141476 to the power of 1/9, to the nearest integer? 6 What is the sixth root of 10984238 to the nearest integer? 15 What is the square root of 3813091 to the nearest integer? 1953 What is 1992026 to the power of 1/10, to the nearest integer? 4 What is the square root of 340253 to the nearest integer? 583 What is 529690 to the power of 1/8, to the nearest integer? 5 What is the cube root of 15444796 to the nearest integer? 249 What is the third root of 40758 to the nearest integer? 34 What is the eighth root of 17872288 to the nearest integer? 8 What is 105155 to the power of 1/8, to the nearest integer? 4 What is the cube root of 828286 to the nearest integer? 94 What is the square root of 436163 to the nearest integer? 660 What is the square root of 8532603 to the nearest integer? 2921 What is 485055 to the power of 1/7, to the nearest integer? 6 What is the square root of 12457428 to the nearest integer? 3530 What is 312603 to the power of 1/9, to the nearest integer? 4 What is the square root of 5098654 to the nearest integer? 2258 What is 641780 to the power of 1/2, to the nearest integer? 801 What is the third root of 291777 to the nearest integer? 66 What is 123343 to the power of 1/5, to the nearest integer? 10 What is 350863 to the power of 1/7, to the nearest integer? 6 What is the ninth root of 2449092 to the nearest integer? 5 What is the square root of 11024551 to the nearest integer? 3320 What is the cube root of 384342 to the nearest integer? 73 What is the square root of 6198759 to the nearest integer? 2490 What is the third root of 962342 to the nearest integer? 99 What is the cube root of 8058976 to the nearest integer? 200 What is the fourth root of 159809 to the nearest integer? 20 What is the cube root of 935219 to the nearest integer? 98 What is the third root of 18555799 to the nearest integer? 265 What is the eighth root of 269157 to the nearest integer? 5 What is 4208578 to the power of 1/3, to the nearest integer? 161 What is the third root of 875227 to the nearest integer? 96 What is the cube root of 357389 to the nearest integer? 71 What is 53099 to the power of 1/8, to the nearest integer? 4 What is the sixth root of 1830407 to the nearest integer? 11 What is the square root of 396984 to the nearest integer? 630 What is 525651 to the power of 1/4, to the nearest integer? 27 What is the square root of 2028942 to the nearest integer? 1424 What is the third root of 642679 to the nearest integer? 86 What is the square root of 20172501 to the nearest integer? 4491 What is the fifth root of 1022663 to the nearest integer? 16 What is the fourth root of 16103422 to the nearest integer? 63 What is the square root of 582267 to the nearest integer? 763 What is 108397 to the power of 1/3, to the nearest integer? 48 What is 8267263 to the power of 1/9, to the nearest integer? 6 What is the cube root of 107546 to the nearest integer? 48 What is 37577814 to the power of 1/7, to the nearest integer? 12 What is the third root of 16435 to the nearest integer? 25 What is 4973992 to the power of 1/2, to the nearest integer? 2230 What is 502194 to the power of 1/2, to the nearest integer? 709 What is 10453269 to the power of 1/3, to the nearest integer? 219 What is 2984906 to the power of 1/3, to the nearest integer? 144 What is the third root of 16597345 to the nearest integer? 255 What is the square root of 285898 to the nearest integer? 535 What is 15496791 to the power of 1/7, to the nearest integer? 11 What is the fifth root of 2025702 to the nearest integer? 18 What is the eighth root of 2954284 to the nearest integer? 6 What is the fourth root of 563200 to the nearest integer? 27 What is 99324 to the power of 1/8, to the nearest integer? 4 What is 2659901 to the power of 1/6, to the nearest integer? 12 What is the ninth root of 2578965 to the nearest integer? 5 What is 4431474 to the power of 1/5, to the nearest integer? 21 What is the eighth root of 2865382 to the nearest integer? 6 What is the third root of 735275 to the nearest integer? 90 What is the cube root of 158963 to the nearest integer? 54 What is 3013911 to the power of 1/2, to the nearest integer? 1736 What is the cube root of 202978 to the nearest integer? 59 What is the square root of 7725118 to the nearest integer? 2779 What is 10165145 to the power of 1/6, to the nearest integer? 15 What is the square root of 4723045 to the nearest integer? 2173 What is 128877 to the power of 1/2, to the nearest integer? 359 What is 7981070 to the power of 1/2, to the nearest integer? 2825 What is 67127 to the power of 1/9, to the nearest integer? 3 What is 547548 to the power of 1/9, to the nearest integer? 4 What is 19634074 to the power of 1/3, to the nearest integer? 270 What is the third root of 1626697 to the nearest integer? 118 What is the square root of 1936486 to the nearest integer? 1392 What is the eighth root of 566783 to the nearest integer? 5 What is 646806 to the power of 1/7, to the nearest integer? 7 What is the third root of 263588 to the nearest integer? 64 What is 16433761 to the power of 1/8, to the nearest integer? 8 What is the tenth root of 478326 to the nearest integer? 4 What is 13675269 to the power of 1/10, to the nearest integer? 5 What is 61915 to the power of 1/2, to the nearest integer? 249 What is 4431114 to the power of 1/9, to the nearest integer? 5 What is 189595 to the power of 1/10, to the nearest integer? 3 What is the third root of 260040 to the nearest integer? 64 What is 42253584 to the power of 1/9, to the nearest integer? 7 What is the square root of 169732 to the nearest integer? 412 What is the square root of 725424 to the nearest integer? 852 What is the third root of 8172699 to the nearest integer? 201 What is the square root of 7977 to the nearest integer? 89 What is the fifth root of 1615641 to the nearest integer? 17 What is 1865307 to the power of 1/2, to the nearest integer? 1366 What is the square root of 2372995 to the nearest integer? 1540 What is the third root of 1493106 to the nearest integer? 114 What is 1006033 to the power of 1/9, to the nearest integer? 5 What is the fourth root of 9353102 to the nearest integer? 55 What is the tenth root of 2280722 to the nearest integer? 4 What is the tenth root of 5684939 to the nearest integer? 5 What is the sixth root of 881100 to the nearest integer? 10 What is 7676444 to the power of 1/3, to the nearest integer? 197 What is 206940 to the power of 1/3, to the nearest integer? 59 What is 461741 to the power of 1/2, to the nearest integer? 680 What is the square root of 13198487 to the nearest integer? 3633 What is the tenth root of 11165389 to the nearest integer? 5 What is the third root of 14500703 to the nearest integer? 244 What is the square root of 242963 to the nearest integer? 493 What is 97188 to the power of 1/2, to the nearest integer? 312 What is 131378 to the power of 1/2, to the nearest integer? 362 What is the eighth root of 452352 to the nearest integer? 5 What is the eighth root of 3441694 to the nearest integer? 7 What is the cube root of 3757743 to the nearest integer? 155 What is the cube root of 347731 to the nearest integer? 70 What is the square root of 12663963 to the nearest integer? 3559 What is the sixth root of 350737 to the nearest integer? 8 What is 22193434 to the power of 1/8, to the nea	{ "pile_set_name": "DM Mathematics" }
s x(5)? -4 Let l(o) = -o*3 - 9o*2 - 2o - 4. Let p be 371/159 - (-68)/(-6). Determine l(p). 14 Suppose -3o + 3 = d + 1, 16 = 4o - 2d. Let v be ((-4)/(-12))/(o/18). Let m(c) = -2 + 7c*2 - 2c*3 - 2c2 + 4 + cv - 3c. Calculate m(4). 6 Let z(g) = g3 - 4g*2 - 6g - 2. Let w be z(5). Let k(d) be the second derivative of -1/12d4 - 7/6d*3 + 0 + 2d + 9/2d2. Determine k(w). 9 Suppose -2n - o = -0n + 14, 12 = -3o. Let h(s) = 0s3 + 7 - 5 - 2s*2 + 117s - 116s + 7s2 + s3. Determine h(n). -3 Let f(n) = n + 15. Let m be f(-7). Let b(z) = z*2 + 3z - 2. Let r be b(-3). Let y = r + m. Let c(w) = -w*2 + 6w. What is c(y)? 0 Let h(y) be the second derivative of y*4/6 - 5y*3/6 - 145y. What is h(4)? 12 Suppose -9i = 70i + 790. Let r(k) be the third derivative of -k*5/60 - 5k*4/12 + 7k3/6 - k2. Determine r(i). 7 Let o(x) be the first derivative of x*2 - 5x - 2. What is o(6)? 7 Let c be (-12)/(-42) - (-38)/14. Let f(d) = -4 + 102d - 106d + c. Give f(-5). 19 Let d = 9 + -7. Suppose -2l + 30 = -d. Let g(z) = 6z + 18z2 - 2z - lz2. Determine g(-3). 6 Let q(p) be the first derivative of -p3/3 + 6p - 308. Calculate q(-6). -30 Let s(v) be the second derivative of 0 + 1/6v3 + 1/4v*4 + 1/2v*2 - 3v. Give s(-1). 3 Let h(j) = j*2 - 3j - 3. Suppose 7s = 10s + 99. Let a = s + 58. Let r = -21 + a. Give h(r). 1 Let j(h) be the third derivative of -11h2 + 0 - 1/120h*6 - 1/12h*4 - 2/3h*3 + 0h + 1/15h5. Give j(3). -1 Let i(x) be the first derivative of -2x*2 - 10x + 44. What is i(-4)? 6 Let z(i) = -i*2 - 25i + 7. Let b(o) = 3o2 + 71o - 18. Let v(m) = 3b(m) + 8z(m). Give v(-11). -20 Let w = 5 - 3. Let m(r) be the third derivative of -r5/120 + r4/8 - r*3/6 + 13r*2. Let y(l) be the first derivative of m(l). Give y(w). 1 Suppose 3y = 4y + 63. Let j = 510 + y. Let f(o) = -447 + j - 4o. Give f(5). -20 Let z = 7 + -5. Let y = z + 3. Let u(t) = y - 2t + 0 - 3 - 1. Calculate u(-1). 3 Suppose -26 = 4q - p, p - 4 = 2q - 4p. Let v(b) = 3b. What is v(q)? -21 Let g = -19 - -27. Let v(x) = g - 2x + 13x - 6 + 0x. Let l(h) = -5h - 1. Let u(k) = -9l(k) - 4v(k). What is u(-4)? -3 Let t(a) be the first derivative of 3a*2 + 13a + 479. Calculate t(-3). -5 Suppose -10u + u = -18. Let c(w) = 2w - 2. Calculate c(u). 2 Let h(u) = 5u2 + 1. Suppose -3q - 5z = -2q + 21, -q + z + 3 = 0. Determine h(q). 6 Let g(v) = 414v2 - 418v*2 - 4v + v*3 + v. Give g(5). 10 Let y(m) = -4m3 - m2. Let c be y(-1). Let w(s) be the second derivative of -2s2 + 1/6s*4 + 5s + 0 - 1/2s3. Determine w(c). 5 Let f(r) = 5 - 2 - 4r - 5r2 + 4r*2. Let o be f(-4). Suppose -3c + 9 = od, -4c = c + 3d - 17. Let k(i) = i2 - i - 4. Give k(c). 8 Let m(o) = -6o + 64. Let r(u) = 2u - 21. Let j(z) = -5m(z) - 16r(z). What is j(11)? -6 Let m = 30 - -2. Suppose -d + m = -5d. Let o(i) = i*2 + 10i + 12. Give o(d). -4 Suppose -6 + 32 = -2a. Let t(x) = -4x - 47. Calculate t(a). 5 Let j(b) = 8 + b*2 - 15 + 3b + 12. Give j(-2). 3 Let w(r) = 2r - 5. Suppose 5u = -2y - 20, u + 30 = -3y - 2u. Let d be (-7 + y)(-1 - 0). Suppose 0 = -a - 2a + 3, 4s - d = -a. Calculate w(s). 3 Let r(p) = 6p + 58. Let l(h) = -6h - 58. Let m(v) = -5l(v) - 6r(v). Let s be m(-9). Let n(f) = f*3 + 6f*2 + 6f + 1. Determine n(s). 9 Let t = 16 + 47. Suppose -27q = -20q - t. Let b(h) = h*3 - 9h*2 - 2h + 11. Determine b(q). -7 Let x(m) be the second derivative of -m*5/20 - 5m*4/6 - 2m*3 - 17m2/2 - m + 25. Determine x(-9). 10 Let l(n) = -n2 - 9n - 5. Let o be l(-5). Let z be ((-6)/(-4))/(o/50). Let m(r) = -7 + zr*2 + 5 + 3 + 2r. Give m(-1). 4 Let s(t) = -3t + 19. Let i(n) = -n. Let q(g) = -2i(g) + s(g). What is q(9)? 10 Suppose j - 4j = -9. Let i be 4/(4 - 8)(j - 2). Let q(n) = -17n3 + 2n2 + n. Calculate q(i). 18 Let o(u) be the third derivative of -u6/60 - u5/15 - u4/12 + u3/6 - u2. Let q be 1/(((-1)/(9 - 15))/((-1)/3)). Determine o(q). 5 Let a(r) = 5r - 3. Suppose 0 = -3w - 2h + 6 + 14, 5w = -2h + 36. Let o be (-4)/w(-30)/(-3). Let i = 7 + o. Calculate a(i). 7 Suppose 2v = 10, -i + 3v = -4i + 87. Suppose 16u - 24u = -i. Let l(w) = -w3 + 5w*2 - 2w + 4. What is l(u)? 16 Let x(f) = 14f2 - 24f + 62. Let g(q) = 3q2 - 6q + 15. Let a(d) = -9g(d) + 2x(d). Determine a(-9). 16 Let f(v) be the second derivative of v*3/2 + 9v*2/2 + 10v. Let l(g) = 5g2 - 61g + 5. Let t be l(12). What is f(t)? -12 Suppose -26q + 22q = -32. Let t be (q/10)/(26/65). Let d(j) = -tj + 0 - 6 + 2 + 6. Give d(6). -10 Suppose 0i + 5i = 35. Suppose -3o = -6, 0 = 5v - 4o + 31 + i. Let j(r) be the third derivative of r5/60 + r4/3 + r3 + r2. Calculate j(v). -6 Suppose -15 = -5w + 15. Let a(o) = -7o - o*2 + o - 14 - wo. Let b be a(-10). Let h(i) = -i*2 + 6i + 2. What is h(b)? 2 Let x = -3 + 4. Let r(u) = 1 + 14u - 1 - 2u. What is r(x)? 12 Let d(i) be the first derivative of -i5/40 - i4/24 - 5i3/3 - 2. Let q(a) be the third derivative of d(a). Determine q(-1). 2 Let u(z) be the second derivative of -z3/2 + z2 + 4z - 3. Calculate u(2). -4 Let x(y) = -10y - 27. Let p(c) = 7c + 19. Let u(q) = 7p(q) + 5x(q). Determine u(-2). 0 Let l(k) = -k + 1. Suppose 6g - 3g = 84. Let d = g + -27. Determine l(d). 0 Suppose -318 = -5h - h. Let o = h - 62. Let q(d) = d3 + 9d2 + d - 2. Determine q(o). -11 Let v(j) = -j3 + 4j2 + 3j + 7. Let b be (1/1)/((-6)/(-30)). What is v(b)? -3 Let i = -2 + 10. Let j be 1/5(15 - 5). Let d(g) = 5g - 4g - 5 + 1 - j. Determine d(i). 2 Let y(g) = -28g*2 + 4g - 11. Let m(z) = 13z2 - 2z + 5. Let i(n) = 13m(n) + 6y(n). Let q(a) = a*2 - 6a + 9. Let d be q(5). Determine i(d). 7 Let n(i) = i*2 - i - 5. Let j(p) = p + 1. Let m(b) = 2b + 1. Let g be (-4)/(-2) - (5 + -2). Let y(r) = gm(r) + 3j(r). Let x be y(-2). Determine n(x). -5 Let n = 37 + -1. Let s = n - 20. Let b(x) = s - x - 10 - 9. Determine b(-6). 3 Let c be 63/12(10 - 8). Let w(d) = -23d + 1. Calculate w(c). -68 Let q(u) = -3u - 3. Suppose -3n = 5n - 24. Determine q(n). -12 Let i = 4 - -2. Let g(a) be the third derivative of 13a2 + 0a - a*3 + 0 + 1/24a*4. What is g(i)? 0 Let p(z) = 3. Let l(v) = 6v*2 - 2v - 4. Let i(j) = -l(j) - p(j). Calculate i(-1). -7 Let d(r) be the second derivative of r6/120 + r3/6 + 4r2 - 14r. Let k(z) be the first derivative of d(z). Determine k(-1). 0 Suppose -2w = -5g + 32, w = 4w - 12. Let z(j) = g - 15 - j2 + 8j - 15j. Give z(-6). -1 Let r(n) = -n2 - n + 8. Let b(i) = 5i*2 + 14i - 38. Let q(o) = b(o) + 6r(o). Determine q(11). -23 Let x = -2 - -3. Suppose x = -4k + 17. Let b(p) = p*2 - 4p + 3. Determine b(k). 3 Let q(v) be the first derivative of -v3 - v2/2 + v - 305. Let m = 2 - 1. What is q(m)? -3 Let i(b) = -b*2 + b + 10. Suppose 20r + 5v + 45 = 24r, 3v = -5r + 10. Calculate i(r). -10 Let j(s) = -s - 3. Let b(f) = f*2 + 9f - 10. Let x(l) = -b(l) + 7j(l). Determine x(-13). 28 Let q(i) = 4i*2 - i - 1. Suppose -j - 2 = 0, 4r + 2j - 9 + 5 = 0. Give q(r). 13 Let a(s) = -s3 - 5s*2 - 10s - 6. Let z be -18(-5)/10 + 12. Let v(t) = 3t3 + 15t*2 + 29t + 18. Let d(q) = za(q) + 4v(q). Calculate d(-4). -2 Let k be (2/18)/(4/(-12))-33. Suppose 5 = 3f + k. Let n(x) = -x*2 - 4x - 2. What is n(f)? 2 Let m(s) = -10s2 - s - 1. Let j(u) = 28u*2 + 4u + 3. Let i(d) = -4j(d) - 11m(d). Let a(w) = w*2 - w + 1. Let y(t) = -2a(t) + i(t). What is y(-2)? -13 Suppose 13 + 20 = -3v. Let a = 9 + v. Let h be (a - -2)/(6/3). Let t(u) = -u2 + u - 1. What is t(h)? -1 Let k(i) = -2i - 24. Let b = 113 - 126. Give k(b). 2 Let d(m) = -547m3 + 7m + 1094m3 - 546m*3 + 8 + 7m2. Let l(h) = h3 + 2. Let i be l(-2). Give d(i). 2 Let s(o) = -3o2 - 4o + 1. Let l(w) = -4w2 - 4w + 1. Let g(b) = -2l(b) + 3s(b). Let q(j) = -j*2 - 20j + 39. Let x be q(2). Calculate g(x). -4 Suppose 0 = -2i + 68 - 20. Let f = i + -24. Let o(u) = u - 14. Calculate o(f). -14 Let z(n) = -n2 + 8n + 503. Let y be z(27). Let x(b) = b*3 + 10b*2 + 4b + 40. Calculate x(y). 0 Let m(c) = -c. Let q be m(-2). Let i(k) = 5k + 11. Let r(w) = -10w - 19. Let p(h) =	{ "pile_set_name": "DM Mathematics" }
-798 - -1255. Is h prime? True Suppose 4b + 2 = 3r + 3, -5b + 4r = 0. Suppose 9 = bi - 3. Suppose if + 3q - 54 = 0, -43 + 10 = -f - 4q. Is f prime? True Let g be (-2)/10 - (-7557)/(-15). Let o = g + 707. Is o prime? False Is 56/(-70) - 39748/(-10) prime? False Let m be 4/(-10) + (-2)/(-5). Suppose m = -3l + x + 371, 7x = 4l + 3x - 500. Is l a composite number? True Let v(l) = l*2 - l + 2l + 89 + 0l2. Suppose 10d - 2k = 5d + 8, 0 = -5d + 3k + 12. Is v(d) composite? False Let h(y) = 68y2 - 12y + 27. Is h(8) a composite number? False Let k(d) = -9d - 3. Let a(o) = 10o + 4. Let x(j) = 2a(j) + 3k(j). Let h(q) = -2q2 - q + 2. Let w be h(2). Is x(w) a prime number? False Let x(u) = u3 - 7u*2 - 8u + 3. Let c be x(8). Suppose r = cr - 106. Is r composite? False Suppose s + 3959 = 3i, 5i + s - 6587 = -3s. Is i a prime number? True Let h(t) = -6 + 2t + 12 - 1. Let b be h(4). Suppose -b = -2q + 29. Is q a composite number? True Let i = -3 + 1. Let s(y) = -212y3 + 2y*2 - 2y - 3. Let g be s(i). Suppose 0 = -2v + 7v - g. Is v prime? False Let p be 0/((-4)/(1 + 1)). Suppose -335 = -f - pf. Is f prime? False Suppose 0r + 4r + 804 = 0. Let m = r + 404. Is m composite? True Suppose -5q = -3q - 3722. Is q composite? False Suppose 2q - 5l = 550, 4l + l - 590 = -2q. Suppose z + 2z = q. Suppose 3k - z = 16. Is k prime? True Let x = 36 + 122. Is x prime? False Let j(i) = -i3 - i - 23. Let n be j(0). Let q(a) = 2a*2 + 6a - 2. Let b be q(5). Let m = n + b. Is m a composite number? True Let m(p) = -16p + 5. Let f be m(-4). Let r = f - -58. Is r a composite number? False Let k = 47 - 107. Is 5(-2 - k) + 3 a composite number? False Let z(x) = 2x2 + 7x - 4. Let a = -17 - -11. Is z(a) a prime number? False Suppose 0 = -4a - a. Suppose -4k = -h - 40, a = -k + h - 8 + 21. Suppose 55 - k = 2d. Is d a prime number? True Suppose n = -4r + 759, -5r = 2n - 373 - 572. Is r composite? False Let t be 32 - (-1 + -3 + 1). Suppose 0 = -3x + 2x + p + t, x = -5p + 47. Is x a composite number? False Let h = 125 - -788. Is h a prime number? False Suppose r - 4m - 8 = -0, -4r + m + 2 = 0. Suppose r = g - 4g - 5f + 420, 2f + 586 = 4g. Is g a prime number? False Let q be (638/6)/(3/(-9)). Is 0 + 0 - (q - 2) prime? False Let r(d) = 2d*3 - 8d*2 - 4d - 1. Let u be r(6). Suppose 3s = -2x + 317, -s + 0x - 4x + u = 0. Is s a prime number? True Suppose -144 = 4h - 0h. Let p = -26 - h. Is p composite? True Let d = -170 - -473. Is d composite? True Let w(f) = -f3 - f2 - 1 + f - 3f2 - 2f + 4f. Suppose -4y + 7y = -18. Is w(y) a prime number? True Let j be (2/3)/(1/3). Is (j + -5 - -216) + -2 composite? False Let t(y) = 4y - 9. Let z(o) = o*3 + 6o*2 + 2o*3 - 4 - 4o*3 + 9o. Let x be z(7). Is t(x) a composite number? False Let s(v) = 2v3 - 7v*2 + 8v - 9. Is s(6) a composite number? True Let s = 19 + -37. Let j be 12/s - (-28)/6. Suppose -jg + 57 = -g. Is g prime? True Let l = 1719 + -1012. Is l a composite number? True Let j(x) = -4x - 1. Let r be j(-2). Let t = r + -3. Suppose -5c + w + 615 = -4w, 3w = -tc + 492. Is c prime? False Suppose -3z - j + 404 = 0, -3j = z - 0j - 140. Is z a composite number? True Let h = -55 - -320. Is h a composite number? True Let o be 0 - -4(-4 + -1). Let a = 115 + o. Is a a composite number? True Suppose 2g + 4l = -4, -2g + 5 = -5l - 18. Suppose -4q + gb = -52, 5b = -0b. Is q prime? True Suppose -17 = -4v - m, -5v + 9v - 4m = -8. Suppose -vq = 2q - 785. Is q prime? True Let a be 213/12 + (-2)/(-8). Suppose -z + 157 - a = 0. Is z a prime number? True Suppose -4b + 6 = 3g - 18, 4b - 12 = 0. Suppose 3k - 5x = gk + 134, 2k = -x - 241. Is (0 - 0)/(-3) - k a composite number? True Let r = 242 + -123. Suppose 113 = 4z - r. Let w = -39 + z. Is w a prime number? True Let f = 17 - -19. Suppose j - 19 = f. Is j composite? True Let c(v) = 44v2 + 3v - 2. Let y be c(-3). Let a be (-23)/((-3)/2). Suppose 0 = -aq - 9 + y. Is q composite? True Suppose 2r - 24 = -2r. Let j be 2 + -5 + r/2. Is 21 - -5 - (1 - j) composite? True Suppose 2j - 139 = j. Is j a composite number? False Let i(x) = 5x + 2. Is i(15) a prime number? False Let y be (-18)/4 - (-3)/(-6). Let g be 1 + -1 - 5/y. Let b = g - -58. Is b prime? True Let w(l) = 47l - 3. Is w(2) a prime number? False Suppose 3d = 8d + 15, -2d = -4k + 1042. Is k a composite number? True Suppose -3a - 70 = -4a. Suppose 5v = q + a, -28 = 3v - 5v + q. Is v composite? True Let u = 5 - 2. Is -912u/(-6) composite? True Let d be -1212/(2 + 0). Let p = -26 - d. Is p prime? False Suppose i - 1938 = -5i. Is i prime? False Let l = 428 + -297. Is l a prime number? True Suppose -4k = 3q - 2369, -3q - 3809 + 841 = -5k. Is k a composite number? False Let n = -3 - -6. Suppose 15 = -3f, -73 = -5p - nf + 167. Suppose 3c - p = 12. Is c a composite number? True Is (-8)/(-28) + (-8961)/(-21) a composite number? True Suppose g - 3g - 14 = 0. Let i = 20 - 7. Let y = g + i. Is y a prime number? False Let s be 1 + (-3 + 2)4. Let p = -3 + s. Let k = p + 59. Is k composite? False Let b(x) = x*2 + 2x. Let s be b(-1). Let r(i) = -i - 1. Let w be r(s). Suppose w = 2j - 4j + 154. Is j composite? True Suppose -m = -5r - 15, 0 = -4m + m - 4r - 12. Let z be 514/(-4)(2 - m). Let t = -78 - z. Is t a prime number? True Let x(u) = -13u + 12. Is x(-22) composite? True Let u = -457 + 644. Is u prime? False Let j = 11 + -9. Suppose -k + 174 = jk. Suppose -x = 4x - 4c - k, 4x = 3c + 47. Is x prime? False Suppose 0 = 5f - 92 - 843. Is f prime? False Let f(r) = -r3 - 3r*2 + 4r + 2. Let s be f(-4). Let y(h) = 6h + 3h + 0h + s + 2h. Is y(5) a composite number? True Let t be (2 + -1)(1 + -1). Is 148 + (0 - (t - -3)) a prime number? False Suppose -4j = -3j + x - 30, -j + 46 = 5x. Let p = j + -16. Let n = p - -9. Is n a prime number? True Let n(m) = 50m - 1. Is n(3) a composite number? False Let a = 956 + -105. Is a composite? True Let n = -20 + 79. Is n prime? True Suppose c + 91 + 699 = 5b, -5b + 4c = -805. Is b prime? True Let m(f) be the first derivative of -f*3/3 - 29f*2/2 - 17f - 7. Is m(-12) a composite number? True Suppose -5y - 221 = -2o - 27, 5y + 188 = -o. Is 2/4-2 - y prime? True Let f be 2 - 5 - (0 + -4528). Suppose -f = -6o + o. Is o a prime number? False Is 3/(-5)(-54 + -1) prime? False Suppose 0 = 6i - 96 - 870. Is i composite? True Suppose -5i + 1 + 54 = 0. Is i a prime number? True Let l(v) = 1465v2 - 7v - 7. Is l(-1) a composite number? True Let b(o) = 15o2 + o. Let h be b(1). Let m = -30 + h. Is (-326)/(-14) + 4/m prime? True Suppose 4i = 6b - b + 720, -4i - 5b + 720 = 0. Let u(z) = 11z - 9. Let k be u(6). Suppose -k = -3l + i. Is l prime? True Let v(h) = -25h - 17. Is v(-4) prime? True Suppose 3o - 5h = 571, 247 + 319 = 3o - 4h. Let j = o - 51. Is j prime? True Is (1396 + 9)(-2)/10-3 prime? False Is (66/(-18))/((-1)/381) prime? False Let y = 2151 + -1264. Is y prime? True Suppose -25 = -q - s - s, 3s - 97 = -5q. Suppose q = -5p - 8. Let x(j) = j3 + 8j*2 + 3j - 1. Is x(p) a composite number? False Let z(y) = -32y3 - y2 - 2y + 1. Is z(-2) a prime number? True Let s = 7 - 7. Suppose s = 3j + m + 5, 4j + m + 2m = 0. Is 93 + -3 + j - 2 prime? False Is (401 - (-2 - -6))1 prime? True Let l be -4 + 6 - (1 - -9). Let x = 77 - l. Suppose -m - 2f + x = 2f, f + 1 = 0. Is m a prime number? True Is (-175824)/(-45) - ((-3)/(-15) + 0) composite? False Let g(t) = -t + 6. Let j be g(0). Let w(z) = 5z + 3. Let m be w(j). Suppose 0s = -3s + m. Is s a composite number? False Let v = -482 - -747. Let y = v + -119. Is y a prime number? False Let n = -46 + 137. Is n composite? True Let u = 15 + -8. Is u a prime number? True Let q(b) = 6b*3 - 4b*2 + 2b + 2. Is q(3) a composite number? True Let y(a) = -a*3 + 3a*2 - 4a + 1. Is y(-5) composite? True Let o = -2 - -6. Let h = 355 + -244. Suppose j - oj = -h. Is j composite? False Let r(z) = -25z*2 - 3z. Let k be r(-2). Is (k/(-3))/((-10)/(-15)) composite? False Suppose 0 = -3b + 5t + 12, 0 = t - 3t. Let r(d) = 23d - b - 1 - 1 + 4. Is r(5) prime? True Suppose 16	{ "pile_set_name": "DM Mathematics" }
4i, 0 = -4t + 5i + 174. What is the remainder when 217 is divided by -21 + t + (1 - 4)? 19 Let f = 5006 + -4859. Calculate the remainder when 890 is divided by f. 8 Suppose 1 - 11 = -5j. Suppose 80 = 5w - 3v, -5v = -jw - 3w + 80. Calculate the remainder when (455/(-10))/7(0 - 14) is divided by w. 11 Let u be 5/(0 + 5)85. Suppose -m + u = -70. What is the remainder when m is divided by 16? 11 Let h(j) = -223j*2 + 687j*2 - 228j*2 + 16j - 232j2 - j3 - 32. Let c = 91 + -56. Calculate the remainder when c is divided by h(2). 3 Suppose -4 = 2g, 15 = -10j + 11j - g. Let k = -8 + 8. Suppose km - 46 = -2m. What is the remainder when m is divided by j? 10 Let w(j) = -j - 6. Let y be w(-4). Calculate the remainder when -3 + 70/(4 - (-4)/y) is divided by 12. 8 Suppose -9u - 35 = -4u - 4g, -g = 0. Let l be (-12)/u + 16/56. Suppose -k = -2k - 3, -k = -la + 37. What is the remainder when 33 is divided by a? 16 Calculate the remainder when 257 is divided by (-3224)/(-72) - ((-20)/9 + 2). 32 Let b be (1 - 14/2)/(6/(-656)). Suppose -87l + b = -83l. Let c(o) = -6o + 3. What is the remainder when l is divided by c(-5)? 32 Suppose -8g = -r - 18 - 47, 5g - 36 = -4r. Calculate the remainder when 42 is divided by g. 2 Suppose 20k + 240 = 960. Suppose -12y + 45 = -7y. Let u(p) = p + 4. Calculate the remainder when k is divided by u(y). 10 Let h = 3 - 1. Let x be (10 + -9)/(h/(-8)). Calculate the remainder when 2290/110 - x/22 is divided by 8. 5 Let c be (767(3 + -2))/(-1). Let k = c + 800. Calculate the remainder when 296 is divided by k. 32 Let g(c) = 2c*2 - 309c - 9968. Calculate the remainder when 680 is divided by g(-29). 5 Let t(n) = -2n + 8. Let d be (-2)/(-6) - 11/(-3). Let g be t(d). Suppose -2l + 23 + 31 = g. What is the remainder when l is divided by 7? 6 Suppose -9l - l = 100. Suppose -3z - z + 332 = 0. What is the remainder when z is divided by l/10-21 + 1 + -1? 20 Suppose -28w - 8927 + 13967 = 0. What is the remainder when 680 is divided by w? 140 Suppose -26 - 16 = -7l. Let r(o) = -26o + lo + 12o + 35 + 7o. What is the remainder when r(26) is divided by 4? 1 Let r = -6291 + 7945. Calculate the remainder when r is divided by 36. 34 Let d(u) = -4u*2 - 3u - 4. Let f(k) = -1. Let p(m) = -d(m) - 4f(m). Calculate the remainder when 84 is divided by p(-3). 14 Suppose -12d + 3910 = 22d. Suppose -dk + 119k = 1752. What is the remainder when k is divided by 44? 42 Let u(w) = 112w - 134. Calculate the remainder when u(5) is divided by 107. 105 Suppose 97o - 5402 = 709. What is the remainder when 372 is divided by o? 57 Let t(b) = 60b*3 + 2b*2 + b. Let z be t(-1). Let l = z + -10. Let j = -24 - l. What is the remainder when j is divided by 24? 21 Let z be (2 - 9/3)-17. Suppose 15k - zk + 28 = 0. What is the remainder when 124 is divided by k? 12 Let b(u) = -u*3 + 16u*2 + 18u + 25. Let s be ((-4)/(-12))/(5/765). Suppose -s = 28r - 31r. What is the remainder when b(r) is divided by 16? 10 Suppose -g - 6w + w = -31, 3g - 5w = -7. Let v be (-561)/(-44)(-32)/g. Let d = v + 79. What is the remainder when 63 is divided by d? 8 Suppose 4b + 58 = 334. Suppose 0 = -16v + 176 + 1696. Let x = b + v. What is the remainder when x is divided by 21? 18 Let x(d) = -d*2 - 28d + 27. Let y be x(-29). Let w(k) = 3k2 - 12k - 21. Calculate the remainder when 69 is divided by w(y). 9 What is the remainder when (-5 + (-52)/(-13))(-2481 - (-4 - -4)) is divided by 64? 49 Let v(h) = 7h - 30. What is the remainder when v(15) is divided by 31 + 0 + (70 - 75)? 23 Suppose n - 80 = -11. Let z = 74 - n. Suppose -r - 3w - 3 = -16, z = -3r + 2w. What is the remainder when 3 is divided by r? 0 Suppose v + 7 = -4y, v - 5 = -4v. What is the remainder when 207 is divided by (y - 0)(3 - 2 - 16)? 27 Let d(s) be the first derivative of s3/3 - s2 - 2s - 1. Let c = 9422 - 9415. Calculate the remainder when d(-7) is divided by c. 5 Let d = 10375 - 10166. Calculate the remainder when 781 is divided by d. 154 Suppose 189 = -3a - 69. Let u = 92 + a. Calculate the remainder when (6 - (-114)/(-18)) + 176/u is divided by 8. 5 Let i = -3 - 38. Let n = 46 + i. Suppose 148 = nx - z, 0 = 5x - 0z - 5z - 160. What is the remainder when 115 is divided by x? 28 Suppose -3t - 95 = -3v - 17, -4v - 3t + 118 = 0. Let k = v + -23. Let z(x) = -x*2 - 5x + 16. What is the remainder when k is divided by z(-7)? 1 Let p(x) = -x + 19. Suppose -10 - 2 = -3v. Suppose 7 = 4a + vg - 1, 0 = -3g + 6. What is the remainder when 93 is divided by p(a)? 17 Let w(s) = -22s - 1628. What is the remainder when 432 is divided by w(-80)? 36 Suppose -265 = 10o - 655. Calculate the remainder when 1360 is divided by o. 34 Suppose -2x - 186 = -3n - 0x, -x - 3 = 0. Suppose 6r + 756 = 3r. Calculate the remainder when n is divided by (r/(-35) + 1/(-5))3. 18 Suppose 5a + 2d = 8a - 499, -2d + 670 = 4a. What is the remainder when 674 is divided by a? 6 Let w = -20 + 34. Suppose 0 = wo - 16o. Suppose o = s + 3s - 112. What is the remainder when 110 is divided by s? 26 Let y be (6 - 1704/(-18))(0 + 54). Suppose 12s - 4332 = y. Calculate the remainder when s is divided by 51. 49 Suppose -4b = b - 795. Let c(x) = 2x*3 + 60x*2 + 8x + 263. Calculate the remainder when b is divided by c(-30). 21 Let y = -4354 - -4649. What is the remainder when y is divided by 33? 31 What is the remainder when 326 is divided by (-588)/((-14)/(-2))12/(-18)? 46 Let k be 86/(4/3(-7)/(-14)). Let z = k + -117. What is the remainder when 25 is divided by z? 1 Suppose 0i + 14 = -2i. Let r(y) = y*2 + 7y + 16. Let v(z) = 13z - 251. What is the remainder when v(24) is divided by r(i)? 13 Let p be 1/4 - (627/12)/(-11). Calculate the remainder when -5 + (97 - (-5 + p)) is divided by 20. 12 Suppose 3o + 15 = 75. Suppose 22d = 16d + 48. Calculate the remainder when ((-785)/10)/((-4)/d) is divided by o. 17 Let s = -191 + 348. Let k = -113 + s. What is the remainder when 481 is divided by k? 41 Suppose 430d - 81843 = -541 + 85538. What is the remainder when 1221 is divided by d? 57 Suppose 434 = 10c + 2j, 3c - 76 - 47 = 3j. Let u be -1011/(-2). Suppose -51 = -ul + 4d, -4 + 0 = -4d. What is the remainder when c is divided by l? 10 Let k = -2370 - -4136. What is the remainder when k is divided by 29? 26 Suppose -2j - 8 = 0, 49j + 169 = c + 44j. Calculate the remainder when c is divided by 19. 16 Let x = -2 + 87. Let o(l) be the second derivative of l5/20 - l4/12 + 15l*2 + 26l. Calculate the remainder when x is divided by o(0). 25 Suppose -228s = -222s - 90. Calculate the remainder when 1364 is divided by s. 14 Suppose -32i + 68782 = -23506. Calculate the remainder when i is divided by 480. 4 Suppose s = 3k + 1022, s + 28k - 1028 = 29k. Calculate the remainder when s is divided by 74. 69 Let h(w) = -2w - 1. Let b be h(24). Let s = b - -75. Calculate the remainder when 43 is divided by s. 17 Suppose 5b + 5m = 1995, -39b + 42b - 4m - 1211 = 0. Calculate the remainder when b is divided by 14. 9 Calculate the remainder when (-7 - (-4)/(-1 + 5))(-123)/6 is divided by 64. 59 Let q(r) = r - 11. Let v be q(13). Suppose -10 = -4g - v. Suppose x - 57 = m - 3m, gx - 123 = 5m. What is the remainder when x is divided by 31? 28 Let j(d) = 6d3 - d2 + d - 26. Let y(q) = -5q3 + 3q*2 - q + 26. Let w(g) = 4j(g) + 5y(g). What is the remainder when 41 is divided by w(11)? 11 Let g = -4 - -22. Suppose 17 = -gn + 89. Suppose 2x - 74 = 3i, x + nx + 2i = 147. Calculate the remainder when 59 is divided by x. 28 Let o(r) = -r*2 + 2r + 82. What is the remainder when 558 is divided by o(-6)? 14 Let o = 34 + -32. Suppose 49 = 3v - of, -34 = -5v - 3f + 16. Suppose 5c + 0c = 15. What is the remainder when v is divided by c? 1 Let p(c) = c*2 - 21c - 22. Let a be p(22). Let r = 13 - a. What is the remainder when 28 - (-2 + -2 - -8) is divided by r? 11 Suppose 8v = 4k - 476, 476 = 4k - 23v + 27v. Calculate the remainder when k is divided by 354/15 - 8/(-20). 23 Let n(w) = -2w*2 + 71. Let r(g) = 4g + 17. Let h be r(-4). Let s(z) = -z*2. Let l(y) = hn(y) - s(y). Calculate the remainder when l(0) is divided by 38	{ "pile_set_name": "DM Mathematics" }
Let j(g) = 15g - 5. Let c(n) = -3j(n) - 2s(n). Find the first derivative of c(o) wrt o. -17 Let l(c) be the first derivative of -38c*3/3 - 35c + 31. Find the first derivative of l(w) wrt w. -76w Let w(b) = 5b*2 + 7b - 5. Let f(i) = i4 - i2 + 1. Let x(u) = 5f(u) + w(u). Find the second derivative of x(c) wrt c. 60c*2 Let h(l) = -73l*2 + 37l - 9. Let z(b) = -36b2 + 18b - 4. Let k(r) = 4h(r) - 9z(r). What is the second derivative of k(o) wrt o? 64 Let p = -3 - -6. Differentiate -2i3 - 2i*p + 4i*3 + 2 - 3i*3 with respect to i. -9i*2 Differentiate -9 + 0 - 3 - 8m*2 wrt m. -16m Let a(m) be the second derivative of -10m7/7 + 11m*4/12 + 2m*2 - 16m. Find the third derivative of a(r) wrt r. -3600r2 Find the second derivative of -5h*5 + 14h*4 - 14h*4 + 6h - 7h5 wrt h. -240h3 Let s(i) be the third derivative of -i4/24 - i*3/3 - 8i*2. Differentiate s(c) wrt c. -1 Let f be (-8)/(-12)(-5 + -1). Let p = f - -7. What is the derivative of 3 + c*2 - 3c*2 + pc*2 - 3c*2 wrt c? -4c Let f = 9 - 5. Find the third derivative of xf - x2 + 2x2 - 2x*2 - 2x*4 wrt x. -24x Suppose -6z - 5v = -2z + 17, 0 = 5z + v - 5. What is the second derivative of -3 + 0u2 + 3 - 6u*z - 7u wrt u? -12 Let w(s) be the first derivative of -2s6/3 - 10s*3/3 - 12. What is the third derivative of w(u) wrt u? -240u2 Let a = 4 + -10. Let n be (-2 - a - -2) + -2. What is the first derivative of -1 + mn + 6m - 6m wrt m? 4m3 Let a be -4(-12)/8 - 2. Find the second derivative of 1 - 7ia - 2i - 1 + i*4 wrt i. -72i*2 What is the second derivative of 0n - n*4 + 0n - 3n wrt n? -12n2 Let d(l) = l3 + l*2 + l. Let z(f) = -10f*3 - 3f*2 - 5f. Let p(k) = -5d(k) - z(k). What is the third derivative of p(w) wrt w? 30 Let b(m) = -m2 + 6m + 3. Let a be 2/(-7) + 92/28. Let g(l) = 1 + a + 7l + 0 - 2l*2. Let i(d) = -4b(d) + 3g(d). Find the second derivative of i(k) wrt k. -4 Suppose 5 = 2m - 3m. Let i = -3 - m. Find the third derivative of -2h*6 + 19h*i - 16h2 - h6 wrt h. -360h3 Let r(s) = -41s*3 - 10s*2 + 3s + 3. Let j(l) = l + 1. Let u(m) = 3j(m) - r(m). What is the third derivative of u(p) wrt p? 246 Let t(y) = -y4 + y3 + y2 + y - 1. Let z(n) = -7n*4 - 2n*3 - 2n*2 - 2n - 20. Let q(p) = 2t(p) + z(p). Differentiate q(x) wrt x. -36x3 Let v(y) = y2 + 7y + 5. Let c be v(-7). Suppose 0 = 2w + 4, cl - 3w - 73 = 63. What is the second derivative of -l - 2t4 + 26 - 3t wrt t? -24t2 Suppose 27 = 5f - 2f. Let u = -3 + f. Find the third derivative of -2i*5 - 4i*2 + 0i*5 + ui*2 wrt i. -120i*2 Let a(i) = -i - 4. Let n(m) = -6m - 21. Let z(j) = 11a(j) - 2n(j). Let c be z(4). What is the second derivative of 2q5 + q + 5q*2 - 5q*c wrt q? 40q*3 Let o(s) be the first derivative of -18s*7/7 + 11s*3/3 + 17. Find the third derivative of o(z) wrt z. -2160z*3 Let h(c) be the first derivative of 3c4 + c2/2 + 11. What is the second derivative of h(m) wrt m? 72m Let i(w) = 6w*2 + 3w - 3. Let k(g) be the third derivative of g5/60 - g3/6 + 3g2. Let d(b) = i(b) - 3k(b). Find the second derivative of d(j) wrt j. 6 What is the third derivative of 83y2 + 3y*3 - 3y*3 + 5y*6 - 74y*2 wrt y? 600y*3 Let x(k) = 9k*4 + 3k*2 + 7k + 3. Let i(r) = 10r4 + 4r*2 + 8r + 4. Let m(o) = -3i(o) + 4x(o). What is the second derivative of m(h) wrt h? 72h2 Let w(u) = u3 - 9u*2 + 7u + 10. Let h be w(8). Find the third derivative of -3k2 + k5 - 4k*2 - hk*5 wrt k. -60k*2 Suppose -3a + 4a = 6. Find the first derivative of -3w*2 + a + 5w*2 + 6 - 6 wrt w. 4w Differentiate 0l + 0l + 43l3 + 36 wrt l. 129l2 Let c(b) be the third derivative of b7/70 - b*4/6 + 6b*2. Find the second derivative of c(z) wrt z. 36z*2 Suppose -2 = -4x + 3x - 2k, 4x - 4k = 8. What is the derivative of 4 - xt + 2t + t - 2t wrt t? -1 Let y(j) = 16j*4 + 8j2 + 24. Let v(b) = b4 - b*2 + 1. Let a(n) = 8v(n) + y(n). What is the first derivative of a(d) wrt d? 96d3 Let r = -35 - -35. Let i(f) be the third derivative of rf + 0 + 1/2f3 + 1/12f*4 + 3f*2. Differentiate i(n) with respect to n. 2 Find the second derivative of 3l + 15l5 + 10l - 19l5 - 27l*5 wrt l. -620l*3 Let k(j) = j + 2. Let a be k(3). Find the third derivative of -71r*4 - 4r*a + 2r*2 + 71r*4 wrt r. -240r*2 Let p(s) = s - 10. Let k(q) = -11. Let j(d) = 2k(d) - 3p(d). Differentiate j(t) wrt t. -3 What is the second derivative of -51g*4 + 51g*4 + 24g - 43g4 - 73g wrt g? -516g2 Let w(a) be the first derivative of -22a*2 + 48a - 31. Differentiate w(d) with respect to d. -44 Find the third derivative of v*4 + 8v*5 - 4v*5 - 17v - 6v2 + 8v*2 + 0v*2 wrt v. 240v*2 + 24v Let y(s) = 4s3 - 2s*2 + 6. Let f(z) = 2 - 3z*2 + 2z*2 - 2 + 1. Let m(x) = -2f(x) + y(x). What is the first derivative of m(q) wrt q? 12q2 Let r(c) = 6c*3 - 5c*2 - 8. Let k(y) = 3y*3 - 3y*2 - 4. Let w be 24/(-8)3. Let a(g) = wr(g) + 5k(g). Differentiate a(p) wrt p. -9p*2 Let i(k) = -46k*4 + 3k + 44. Let m(a) = -47a4 + 2a + 45. Let u(j) = -2i(j) + 3m(j). Differentiate u(z) wrt z. -196z3 Let k = 5 + -4. Let x be ((-10)/(-4))/(k/2). Find the second derivative of xq3 - q4 + 2q - 5q*3 wrt q. -12q2 Let s = -5 - -7. What is the third derivative of -q6 - q*s - 2q*2 - 3q*6 wrt q? -480q*3 Let j(y) = -4y*2 - 5y + 6. Let l be (-1)/3 - 38/3. Let c(q) = -9q2 - 11q + 13. Let u(o) = lj(o) + 6c(o). What is the second derivative of u(s) wrt s? -4 Differentiate -9 + 5n + 2 + 0n + 3n wrt n. 8 Let n be (-14 + 0)5/(-10). Suppose -t = q - n, -2q - 1 = -2t + 1. Differentiate 2 + 2 + 2zq - 3 wrt z. 6z*2 Let x(h) be the first derivative of -9h*4/4 - 13h*2/2 + 1. What is the second derivative of x(o) wrt o? -54o What is the third derivative of -11s6 - 24s*6 - 19s2 - s6 wrt s? -4320s3 Let j(y) = -y3 + 6y*2 - 3y - 5. Let u be j(5). Suppose 0 = -4d, ul - l - 12 = -d. Find the third derivative of 2nl - 1 - 4n3 - n2 + 1 wrt n. -12 Let m be (-4)/2 - 12/(-3). Differentiate 3u2 + 0 - 5 + m - 1 wrt u. 6u Let z(b) be the first derivative of -3b4/2 - 10b - 12. What is the derivative of z(c) wrt c? -18c2 Let g(h) = -h5 + h3 + h + 1. Let z(d) = 4d*5 - 12d*3 + 12d*2 - 12d - 12. Let u(j) = -12g(j) - z(j). What is the third derivative of u(r) wrt r? 480r*2 Let i(g) be the third derivative of -8g*7/105 - 5g*4/12 - 3g*2. What is the second derivative of i(b) wrt b? -192b*2 Find the third derivative of 5u*5 + 0u*6 - 12u*2 + 5u*6 - 5u*5 wrt u. 600u*3 Let s(h) be the third derivative of 1/105h*7 + 0 + 3/2h*3 + 0h*6 + 0h*4 + 10h*2 + 0h*5 + 0h. Differentiate s(v) with respect to v. 8v3 What is the second derivative of 19g*5 + 19g*5 - 5g*5 + 12g wrt g? 660g3 Differentiate 10 - 5z*4 + 3z*4 + 0z4 + z4 with respect to z. -4z3 What is the first derivative of 110j*2 - 210j*2 + 44 + 131j*2 wrt j? 62j Let z(w) be the third derivative of w6/60 + w4/12 + 7w2. Find the second derivative of z(l) wrt l. 12l Find the second derivative of 3i + 0i*5 - 4i - 4i5 - 3i*5 wrt i. -140i3 Let f(o) = o2 + 1. Let l(q) = -6q2 - 3. Let a(w) = -12f(w) - l(w). Differentiate a(g) wrt g. -12g Let w(b) = -b3 + 4b2 - b + 2. Let y be w(4). Let q be y + (-2 - -1) - -6. Find the third derivative of s5 + 2s5 - 3s*5 + qs5 - s2 wrt s. 180s2 What is the third derivative of 6c*4 - 10c4 + c2 - 9c2 wrt c? -96c Let n(p) be the second derivative of 5p3/3 - p2 - 11p. Differentiate n(t) with respect to t. 10 Find the first derivative of 7 - 10 + 2l3 - l3 wrt l. 3l*2 Let y(f) = 3f*2 - 1. Let t be y(-1). What is the third derivative of 2d*5 - 4d*t - 4d*5 + 3d*2 wrt d? -120d2 Let a(n) be the first derivative of n7/105 - n*3/2 + 3n*2/2 + 1. Let q(i) be the second derivative of a(i). Find the first derivative of q(x) wrt x. 8x*3 Let f(a) = 3a*3 - 2a2 + 2. Let r(d) = d3 - d*2. Let o(b) = f(b) - 2r(b). What is	{ "pile_set_name": "DM Mathematics" }
d h. 18 Let w = -18 - -29. What is the common denominator of (-64)/(-128)(95/w)/(-1) and ((-4)/10)/((-36)/(-695))? 198 Let p = 31 + -14. Suppose o - 15 = -2o, f = 5o - p. Calculate the common denominator of -9/8 and ((-3)/(-35))/(f/300). 56 Suppose 5k = 4g + 180, k - 5g - 72 = -k. Let p(x) = -x*2 - 10x - 9. Let z be p(-7). What is the smallest common multiple of (4/z)/(1/k) and 12? 12 Suppose 3f - 3 = -24. Let q be 3/(0 + 3) + -4. Find the common denominator of q - ((-490)/(-4))/f and 58/9. 18 Calculate the smallest common multiple of 47/3 - (4 - (-40)/(-12)) and 201. 1005 Calculate the lowest common multiple of 77 and 8 - (-61 - (12 - 4)). 77 Suppose -x + 2s + 1 = 0, s = -2x + 3s + 12. What is the lowest common multiple of 3/(-5) + 3/5 - -7 and x? 77 What is the common denominator of 63/22 and (-7 - 175/(-28))(-62)/(-15)? 110 Let y = 14 + -8. Suppose yz = 5z - 1. What is the common denominator of 151/6 and -1 + 182/(-20) + z? 30 Suppose 2l + 6 = 4l. Suppose 11s - 8s - 99 = 0. Suppose 9u - 12u = -s. What is the least common multiple of l and u? 33 Let i(n) = -n3 - 16n*2 + 31n - 27. Calculate the lowest common multiple of 63 and i(-18). 63 Let g = 11 + -6. Suppose 4t = gm + 65, -3m + 55 = 3t - 8m. Let i(f) = -f2 + 7f - 4. What is the smallest common multiple of i(5) and t? 30 Let u = -286 + 3150/11. Let t = -1068 + 5278/5. Calculate the common denominator of u and t. 55 Suppose 6c - 3t - 99 = 4c, -3c + 149 = -5t. Calculate the lowest common multiple of 32 and c. 96 Find the common denominator of 94/304 - (-5)/(-10) and 83/10. 760 Suppose -5n - h - 100 = 4h, 2h - 93 = 5n. Let m = n + 31. What is the smallest common multiple of m and ((-24)/(-10) + 0)/(42/140)? 24 What is the common denominator of 56/126 + 73/(-342) and -46/9? 342 Let o be 3 - ((-12)/3 - -4). Suppose 3g = 2z + 106, -12 = -oz - 0z. Calculate the smallest common multiple of g and 12. 228 Let r = -3 - -5. Let n = 709 + -705. Calculate the lowest common multiple of n and r. 4 Suppose -3f = -7f + 8. Suppose -fw = w - 42. What is the smallest common multiple of w and 12? 84 Let g(l) = -2l2 + 41l - 47. Calculate the smallest common multiple of 3 and g(16). 291 Let c(p) = p*2 + 2p + 7. Suppose 2 = -2o - 4. What is the smallest common multiple of 56 and c(o)? 280 Let d be (-2)/55(-3 - -2). What is the common denominator of ((-4)/(-180))/(d/115) and 107/10? 90 Let c(t) = -2t - 3. Let n be c(-3). Suppose -2g - 57 - 9 = -ni, g + 43 = 4i. Let v = 7 - g. What is the smallest common multiple of v and 20? 340 Let p(f) = f3 + 9f*2 + f - 16. What is the least common multiple of p(-8) and 5? 40 Suppose 23p - 22p - 25 = 0. Calculate the lowest common multiple of p and 55. 275 Suppose -5r + 13519 = -3c, 5r + 3548 = c + 17061. Let j = 1178 - r. Let m = -13756/9 - j. What is the common denominator of -13/8 and m? 72 Suppose -1188 = -334g + 323g. Calculate the smallest common multiple of 18 and g. 108 Let i = -2/367 + 10679/6606. What is the common denominator of i and 31/4? 36 Let r = -2/46120427 - 6390953689789/645685978. Let z = r - -9903. Calculate the common denominator of 87/20 and z. 140 Calculate the common denominator of 115/108 and (2 - 9) + 15/(-42). 756 Calculate the lowest common multiple of 4 - (4 - 6 - (1 + -1)) and 16. 48 Let g = 2948 + -548. Let m = g + -9649/4. What is the common denominator of -87/22 and m? 44 Let j = -1399/3 + 487. What is the common denominator of -23/8 and j? 24 Let y(g) be the first derivative of g*4/4 - 7g*3/3 - 9g*2/2 + 10g + 1. What is the lowest common multiple of y(8) and 17? 34 Let f = -13/227 + -6401/3178. Find the common denominator of (-2)/((-588)/(-35))-318 and f. 14 Let v = -16331/456 + 610/19. What is the common denominator of 87/20 and v? 120 Let y be (-6)/(-8) - (-21)/112-4. Calculate the lowest common multiple of 3 and (y + 1)/((-12)/(-84)). 21 Let r(o) = o3 + 7o*2 + 6o + 2. Let i = -161 + 191. What is the lowest common multiple of r(-5) and i? 330 What is the common denominator of 16/(-4) + (-3)/(-54)137 and (-14)/10421 - (-9)/36? 234 Suppose 5z = -2m + 90, -7m + 3m = 5z - 100. What is the lowest common multiple of z and 40? 80 Let w = -2/863 + -31911/8630. Calculate the common denominator of w and 2 - ((-669)/(-744) - -2) - (-27)/72. 620 Suppose 4j = -2r + 38, 4j + 2r - 36 = -2r. What is the lowest common multiple of 9 and j? 90 What is the common denominator of -145/24 and (52(-3)/(-192))/(3/(-10))? 24 Let l = -1 + -2. Calculate the common denominator of 10/6 + (-2497)/(-66) and (-236)/12l/(-7). 14 Let k = -1336 + 26709/20. Calculate the common denominator of (-215)/(-210) - 2/7 and k. 420 Suppose -4n - 372 = -5j, 0 = -0j + 2j + 3n - 135. Suppose -2w + z = -3z - 30, 4w = -4z + j. Calculate the smallest common multiple of w and 8. 136 Calculate the least common multiple of (-4 + 78/15)15 and 10. 90 Let h(i) = -46i + 339. What is the lowest common multiple of h(6) and 6? 126 Suppose -7 = -j + 9. Let k = 19621 - 19549. What is the smallest common multiple of j and k? 144 Let b = 860 - 858. What is the least common multiple of b and 8? 8 Let f = 47 - 27. Suppose l - 10 + 3 = -2i, l = 4i - 29. What is the lowest common multiple of f and i? 60 Let d be (5 - 0)/(0 + 1). Suppose -67 = -dw - 2. Calculate the least common multiple of w and 2. 26 Suppose -4h = -3p - 732, -3h - 3p = 2p - 520. Let z = -13 - -28. Calculate the common denominator of -73/2 and (-3534)/h - (-2)/z. 2 Suppose g + 12 = -11. Calculate the common denominator of g/69(0 + 2/(-13)) and 83/4. 156 Let s be (62/4)/(21/42). Suppose -5 = -6u + s. What is the least common multiple of u and 9? 18 Let a(v) = -5v + 4. Let u be a(-5). Let l = 33 - u. What is the smallest common multiple of 22 and l? 44 What is the lowest common multiple of 8 and 17 + (-2 - 5) + 1? 88 Let f = 8609 + -309959/36. Find the common denominator of f and -173/60. 180 Suppose 2 = 2n - 6. Calculate the common denominator of 335/(-60) - n/6 and 188/64 - ((-45)/20)/9. 16 Let v be (-59600)/29804 - (-4)/63. Let d = 350213/59608 - v. What is the common denominator of d and 91/4? 8 Let m = -26 + 30. Suppose a + 466 = -4g, 2g + 458 = -ma + 3a. What is the common denominator of -3/2 and (-2245)/a + 6/15? 18 Let t be (-30)/165 - (-1588)/22. Let k be (-488)/t + (-4)/18. Calculate the smallest common multiple of (3 + k)1/(-4) and 6. 6 Suppose -190d + 215d = 1800. Calculate the least common multiple of d and 288. 288 Let t be (-6)/(-9)(-174)/(-4). Suppose -6 - t = 5s. Let l = s - -19. What is the smallest common multiple of 12 and l? 12 Let p(s) be the third derivative of s5/12 - 2s*3/3 - 20s*2. What is the least common multiple of 14 and p(2)? 112 Let w(d) = 3d*2 + 5d - 4. Calculate the least common multiple of w(-4) and 8 - 5 - (-2 + 0)/2. 24 Let x = -27 + 34. Suppose 0 = xv + 13 - 55. Calculate the least common multiple of v and 6. 6 What is the lowest common multiple of (1/4 + 182/8)/((-16)/(-16)) and -1 + -1 + (6 - 0)? 92 Suppose -5m = -4c + 148, 5c + 5m - 44 = 3c. Let o = -25 + c. What is the lowest common multiple of o and 4? 28 Let i = -205 - -211. Calculate the least common multiple of i and 111. 222 Suppose 85 + 11 = 12d. What is the lowest common multiple of 8 and d? 8 Suppose -3t - 3989 + 4097 = 0. What is the smallest common multiple of 144 and t? 144 Let n(q) = q*3 - 8q*2 + 8q + 1. Suppose -10v - 1395 = -1615. Calculate the smallest common multiple of v and n(7). 88 Let v(m) = -m2 + 7m - 7. Let k be v(7). Find the common denominator of (-2)/k - 1870/175 and -30/11. 55 Let h be (-1 + -1 + 2)/(-2). Let s be ((-6)/(-15) - h)5. Suppose 2v + 32 = 4l, sl + 0l - 5v - 16 = 0. What is the lowest common multiple of 2 and l? 8 Suppose 5f = r - 21, -27 = -2r - 2f - 3f. Let w = 93 + -77. What is the smallest common multiple of w and r? 16 Suppose -9 = -32y + 29y. Suppose -3h - 2k = 2k - y, 4h + k - 4 = 0. What is the smallest common multiple of 2/3 + (-96)/(-18) and h? 6 Suppose 0 = o + 3 - 7. Calculate the lowest common multiple of 1 - (o*(-3 + -8) - 3) and 12. 48 Let z = -46 - -22. Let m = -29 + 19. Let c = m - z. What is the smallest common multiple of 8	{ "pile_set_name": "DM Mathematics" }
ing order. -241, -2, 0, 1, 3, 5, 35 Sort 0.06, -0.5, -0.3, 32889/22, 1 in descending order. 32889/22, 1, 0.06, -0.3, -0.5 Sort 3, 15/58, 0.0007. 0.0007, 15/58, 3 Put -1, 7, -5, 3070, -6 in ascending order. -6, -5, -1, 7, 3070 Sort 78577, 3, 83, 0 in decreasing order. 78577, 83, 3, 0 Put -205207, -1/6, 0.4, -2, -1/11 in increasing order. -205207, -2, -1/6, -1/11, 0.4 Sort -19, 27, -1123, 33 in descending order. 33, 27, -19, -1123 Sort -669.23, 91, -0.4. -669.23, -0.4, 91 Sort -154, -900, 2. -900, -154, 2 Put -2/11, 29, 17, -1427, -5, 0.2 in decreasing order. 29, 17, 0.2, -2/11, -5, -1427 Put -58, 22, 5, -15 in descending order. 22, 5, -15, -58 Put 4, 6, 321, 1615 in descending order. 1615, 321, 6, 4 Put -6, -2, -133, -18, 2, 4, -17 in increasing order. -133, -18, -17, -6, -2, 2, 4 Sort -15, -1, 25, 6, -3, 4, 1434. -15, -3, -1, 4, 6, 25, 1434 Put 491, -14851, 0, 4 in increasing order. -14851, 0, 4, 491 Put 1/8, 1.2, -2/33, -354, 0.04, 0 in increasing order. -354, -2/33, 0, 0.04, 1/8, 1.2 Put 885, 2, -10381 in ascending order. -10381, 2, 885 Sort 1, -0.04, -26989, -30 in decreasing order. 1, -0.04, -30, -26989 Sort 7.13, 244, -9/2 in descending order. 244, 7.13, -9/2 Sort 523, 12, -22, 1 in descending order. 523, 12, 1, -22 Sort 4, -5, -3, 14, -2, -2331, -26. -2331, -26, -5, -3, -2, 4, 14 Sort 5/6, 0.2, -271, -2/3, 0.61. -271, -2/3, 0.2, 0.61, 5/6 Sort -3, 2, 50, 0, 9, -1/6, 2/11 in decreasing order. 50, 9, 2, 2/11, 0, -1/6, -3 Put -4, 0.125, 1, -1.2, 0.04, -0.2 in ascending order. -4, -1.2, -0.2, 0.04, 0.125, 1 Put -0.5, -0.2, -60293 in ascending order. -60293, -0.5, -0.2 Put 1, 4, 2, -3, 356, -17 in increasing order. -17, -3, 1, 2, 4, 356 Sort 1/2, 6, -5, 0, 3/11, -1699, 3. -1699, -5, 0, 3/11, 1/2, 3, 6 Put -0.13, 1.9, 9/8, 1/3, -3 in descending order. 1.9, 9/8, 1/3, -0.13, -3 Put -0.4, 91/1499, -0.3, -17, 5 in descending order. 5, 91/1499, -0.3, -0.4, -17 Sort -10, -0.1, -124, 87, 1/32, -4. -124, -10, -4, -0.1, 1/32, 87 Sort 3, -3377773, -2, 4 in ascending order. -3377773, -2, 3, 4 Sort -0.1, -17, -87/4, 872 in decreasing order. 872, -0.1, -17, -87/4 Put 14228.8, 2, 0.3 in descending order. 14228.8, 2, 0.3 Put 0, 3, -3721644 in ascending order. -3721644, 0, 3 Put 1/5, -5, 0.731, 56/15 in increasing order. -5, 1/5, 0.731, 56/15 Put -1, 13, 54273, 5 in descending order. 54273, 13, 5, -1 Sort 1, 1.133, 15.2. 1, 1.133, 15.2 Sort 2, -0.9, -7.1, 2/11, 3, 14, -7. -7.1, -7, -0.9, 2/11, 2, 3, 14 Sort 44804, 110, 4, 9. 4, 9, 110, 44804 Sort 5/2, 3/4, -3, 8905, 5, -20, 2 in decreasing order. 8905, 5, 5/2, 2, 3/4, -3, -20 Put 2, -24, -1442 in decreasing order. 2, -24, -1442 Sort 0.1, -4/7, 188, -1835, 2/17. -1835, -4/7, 0.1, 2/17, 188 Sort 4.2, 95, 1380 in decreasing order. 1380, 95, 4.2 Put 41, 4, -5, -2381, -6 in decreasing order. 41, 4, -5, -6, -2381 Put 2.6, -487917/4, 3, -0.3 in increasing order. -487917/4, -0.3, 2.6, 3 Sort 15, -1070, -3, 0 in increasing order. -1070, -3, 0, 15 Sort 619/4, -5/2, -3/4, -3/5. -5/2, -3/4, -3/5, 619/4 Put -3, -1954, -27, 3, -4, 5, -5 in descending order. 5, 3, -3, -4, -5, -27, -1954 Put 905/11, -0.4, 1/4, -0.095 in increasing order. -0.4, -0.095, 1/4, 905/11 Put 3, 443, 2, 6020 in descending order. 6020, 443, 3, 2 Put 55/3, 1/15, -2/3, 553 in increasing order. -2/3, 1/15, 55/3, 553 Put -762, -20, 6, -4, -3, 0 in decreasing order. 6, 0, -3, -4, -20, -762 Put -6, 14, 71, -89 in descending order. 71, 14, -6, -89 Put -4, -12, 0, 3, -949, 10, -1 in decreasing order. 10, 3, 0, -1, -4, -12, -949 Sort -29, 40, 3, -15, -7, -2, 4 in increasing order. -29, -15, -7, -2, 3, 4, 40 Put -184/19, -0.3, -0.1, 5 in ascending order. -184/19, -0.3, -0.1, 5 Put 5, 2724, 28, 1, 4, -4 in decreasing order. 2724, 28, 5, 4, 1, -4 Sort 27, -1, -3, -50, -18, 8, -2 in increasing order. -50, -18, -3, -2, -1, 8, 27 Put -2, 5/3003, 88, -1, -0.2 in increasing order. -2, -1, -0.2, 5/3003, 88 Sort 928314, 3, -12, -6, 0 in ascending order. -12, -6, 0, 3, 928314 Sort 12, -5, -7, -2099, 3, -1. -2099, -7, -5, -1, 3, 12 Put -5, -64, 312209, 3 in decreasing order. 312209, 3, -5, -64 Sort -3, -1, 4, -204, -10, -17 in decreasing order. 4, -1, -3, -10, -17, -204 Put 25, 2, -10, -101, -2, 4, 346 in decreasing order. 346, 25, 4, 2, -2, -10, -101 Put 50.7, 2, 59 in descending order. 59, 50.7, 2 Put -24/5, 1380.8, -144 in increasing order. -144, -24/5, 1380.8 Sort 0, -25, -13, 3848. -25, -13, 0, 3848 Put -21.3, 1617, 19, -2, 0.5, 1 in decreasing order. 1617, 19, 1, 0.5, -2, -21.3 Put -0.1, -2449, -132.1 in decreasing order. -0.1, -132.1, -2449 Put 1520.0717, -0.5, 4 in descending order. 1520.0717, 4, -0.5 Put -9, 206, -4, 18011 in decreasing order. 18011, 206, -4, -9 Sort -5, 75, 43, -3, 5, 1, 2 in ascending order. -5, -3, 1, 2, 5, 43, 75 Put 0, 5, 1, -35, -315 in descending order. 5, 1, 0, -35, -315 Put -6206, 3, -5, -25, -2, 5, 1 in descending order. 5, 3, 1, -2, -5, -25, -6206 Put 5, -2, 7, 1, -680, -1, 6 in decreasing order. 7, 6, 5, 1, -1, -2, -680 Sort -143, 1, 2, 14, 5 in increasing order. -143, 1, 2, 5, 14 Put -3, -18, 30, -5065 in increasing order. -5065, -18, -3, 30 Put 1, 5/2, 5, -0.4, 2/3, -49032 in descending order. 5, 5/2, 1, 2/3, -0.4, -49032 Sort -2/7, 0, 0.24359909, 4, 1/3 in ascending order. -2/7, 0, 0.24359909, 1/3, 4 Sort -5, 5, 9, 18, -109. -109, -5, 5, 9, 18 Put -4, 16, -3, 2172, -1, 3, -6 in decreasing order. 2172, 16, 3, -1, -3, -4, -6 Sort -6, 8/7245, 0.5, -0.5 in decreasing order. 0.5, 8/7245, -0.5, -6 Sort -4, 2, 9, 5, 0, -27, 145 in descending order. 145, 9, 5, 2, 0, -4, -27 Sort 0.5, -0.4, 5, 1/5, -5, 665.219 in decreasing order. 665.219, 5, 0.5, 1/5, -0.4, -5 Sort -0.1, -1166, -817, -33 in increasing order. -1166, -817, -33, -0.1 Sort -0.4, 3/4, 0.1763, -0.5, 1/15 in decreasing order. 3/4, 0.1763, 1/15, -0.4, -0.5 Sort -2, -1462, 25, 41 in decreasing order. 41, 25, -2, -1462 Sort -1/32, -1811, -5, 199 in descending order. 199, -1/32, -5, -1811 Sort 57, -456, -8 in decreasing order. 57, -8, -456 Sort 26, 5, -3, 10180, -5 in increasing order. -5, -3, 5, 26, 10180 Put -5, -2, 128, 62, -1, 0, 2 in ascending order. -5, -2, -1, 0, 2, 62, 128 Put -2, -161, -13, -7, -296 in decreasing order. -2, -7, -13, -161, -296 Put 2, 584, -4, -3, -1865, 8 in descending order. 584, 8, 2, -3, -4, -1865 Sort 1, -323, -6, -0.7, 94, -1/2 in decreasing order. 94, 1, -1/2, -0.7, -6, -323 Sort 1952, 4, 2, 1, 21, -6 in decreasing order. 1952, 21, 4, 2, 1, -6 Sort -15, -4, -12, 141, 114. -15, -12, -4, 114, 141 Put 4/11, -2409, 122/5 in decreasing order. 122/5, 4/11, -2409 Sort -1, -2, 129, -43839 in decreasing order. 129, -1, -2, -43839 Put -6, -36, 20, -4, 9, 1 in descending order. 20, 9, 1, -4, -6, -36 Sort 3, -16, 251644, -3, -1, 2 in increasing order. -16, -3, -1, 2, 3, 251644 Sort 52, -19, -4, -3, -27, 3 in increasing order. -27, -19, -4, -3, 3, 52 Sort 4, 3, -12, -2, 18, -8, -7. -12, -8, -7, -2, 3, 4, 18 Sort 12, -10, -33, 2605, -2 in ascending order. -33, -10, -2, 12, 2605 Sort -16, -12380, -20 in ascending order. -12380, -20, -16 Sort -12, 5, -1, -88, -4, 47423. -88, -12, -4, -1, 5, 47423 Sort -2, -751676, 10 in descending order. 10, -2, -751676 Put -10637, -3, -2, 3, 1, -4 in descending order. 3, 1, -2, -3, -4, -10637 Sort 1/3, 333, -9/4, -1857, -2/7 in increasing order. -1857, -9/4, -2/7, 1/3, 333 Put -4, -4061, 157 in descending order. 157, -4, -4061 Sort -5, 4, -4525495 in increasing order. -4525495, -5, 4 Sort -300, -2/4813, 0, -3 in descending order. 0, -2/4813, -3, -300 Put -3, -5, -6, 2, -2, -1, -167513 in ascending order. -167513, -6, -5, -3, -2, -1, 2 Sort 4085, -53, 18. -53, 18, 4085 Put 5, -13, -116, -1, -36 in descending order. 5, -1, -13, -36, -116 Sort -159, -1900, 2, 1/3 in descending order. 2, 1/3, -159, -1900 Sort 5, 1, -5, 1185887.8, 2 in ascending order. -5, 1, 2, 5, 1185887.8 Put -356, -2/7, -336734 in ascending order. -336734, -356, -2/7 Sort 3, -3/13, 4/97, -1, 11, 0 in ascending order. -1, -3/13, 0, 4/97, 3, 11 Sort -3/6346, 3/32, 0.1, -0.3. -0.3, -3/6346, 3/32, 0.1 Sort 2809, 80, -3. -3, 80, 2809 Put 3842, 5, 6/4075 in ascending order. 6/4075, 5, 3842 Put 9, 856020, -6 in descending order. 856020, 9, -6 Put -41/5, -10, 277, 2, -1 in descending order. 277, 2, -1, -41/5, -10 Put -9, -525, 4, 8, -1, 82 in increasing order. -525, -9,	{ "pile_set_name": "DM Mathematics" }
1905 and 1143? 5715 What is the common denominator of -127/23640 and -101/8? 23640 Find the common denominator of -117/95590 and -23/14. 669130 Calculate the common denominator of -39/61787 and 13/11234. 123574 Calculate the smallest common multiple of 28 and 41488. 290416 Calculate the common denominator of -16/366301 and -125/156. 4395612 What is the least common multiple of 176 and 20? 880 Calculate the common denominator of 82/6975 and -9/317750. 2859750 What is the smallest common multiple of 43 and 1074? 46182 Calculate the lowest common multiple of 614860 and 36372. 12912060 Calculate the smallest common multiple of 437346 and 2040948. 6122844 Calculate the common denominator of -157/1320 and -191/555060. 1110120 Calculate the lowest common multiple of 3672 and 5814. 69768 What is the lowest common multiple of 1529451 and 695205? 7647255 What is the common denominator of -19/8 and 7/244472? 244472 Find the common denominator of -121/516 and -39/688. 2064 Find the common denominator of -53/10392 and 7/696. 301368 What is the least common multiple of 3165 and 5697? 28485 Find the common denominator of -29/441896 and 9/56. 441896 What is the lowest common multiple of 81952 and 61464? 245856 What is the common denominator of -89/8854 and -77/10? 44270 What is the least common multiple of 4214 and 7224? 50568 Find the common denominator of -43/384430 and -111/40. 1537720 What is the common denominator of -113/30732 and -43/6? 30732 What is the common denominator of 47/844824 and -37/211206? 844824 Calculate the common denominator of 137/18 and -14/44901. 89802 What is the smallest common multiple of 7356 and 24520? 73560 Calculate the common denominator of 63/80 and 75/30934. 1237360 Calculate the common denominator of -11/1305465 and -127/74598. 2610930 Find the common denominator of -5/119 and -89/26928. 188496 What is the common denominator of 101/8370 and 73/117? 108810 What is the common denominator of 141/1750 and -73/5800? 203000 What is the smallest common multiple of 21 and 4473? 4473 What is the common denominator of 34/1161 and -1/26359? 711693 Calculate the smallest common multiple of 1500 and 1410. 70500 What is the lowest common multiple of 18 and 62? 558 What is the least common multiple of 864 and 975? 280800 Calculate the smallest common multiple of 18084 and 11. 18084 What is the lowest common multiple of 11364 and 3? 11364 Calculate the common denominator of 127/7788 and 89/24. 15576 Calculate the common denominator of 35/627 and 125/5358. 58938 What is the least common multiple of 24 and 14598? 58392 What is the smallest common multiple of 162 and 11628? 104652 Calculate the least common multiple of 47465 and 28479. 142395 Find the common denominator of 4/441 and 1/12. 1764 Calculate the lowest common multiple of 89775 and 179550. 179550 What is the lowest common multiple of 2250 and 80250? 240750 Calculate the smallest common multiple of 83002 and 415010. 415010 Find the common denominator of 13/567 and 22/2037. 54999 Find the common denominator of 113/6 and 68/105. 210 Calculate the lowest common multiple of 11134 and 513. 300618 What is the least common multiple of 350036 and 525054? 1050108 What is the lowest common multiple of 7266 and 2422? 7266 Find the common denominator of 17/14410 and 15/2677378. 13386890 Calculate the common denominator of -97/144580 and 61/115664. 578320 Calculate the least common multiple of 60 and 636. 3180 Find the common denominator of -19/962 and -133/936. 34632 What is the common denominator of 35/6112 and -59/332? 507296 Calculate the common denominator of -37 and 104/8085. 8085 Calculate the common denominator of 131/34992 and -101/288. 69984 Calculate the least common multiple of 5976 and 216. 17928 Calculate the common denominator of -62/85 and 1/21315. 362355 Calculate the least common multiple of 45880 and 60. 137640 What is the smallest common multiple of 755000 and 9060? 2265000 What is the common denominator of 7/136 and 51/108116? 3675944 What is the smallest common multiple of 9183 and 21? 64281 Calculate the lowest common multiple of 388 and 830. 161020 Calculate the smallest common multiple of 210 and 305160. 2136120 What is the lowest common multiple of 4496 and 384? 107904 What is the common denominator of 64/1579705 and 30/1637? 1579705 What is the smallest common multiple of 2870 and 2457? 1007370 Find the common denominator of -81/212 and 17/1202. 127412 Find the common denominator of -43/2040 and 49/1615. 38760 Calculate the least common multiple of 210945 and 14063. 210945 What is the common denominator of 71/426836 and -3/20? 2134180 Find the common denominator of 47/19355 and 57/7189. 251615 Calculate the lowest common multiple of 75 and 5050. 15150 Calculate the lowest common multiple of 5808 and 4752. 52272 Find the common denominator of -6/21707 and 51/8. 173656 What is the smallest common multiple of 3286 and 28302? 877362 Calculate the smallest common multiple of 87 and 17625. 511125 What is the least common multiple of 492645 and 120? 3941160 Calculate the smallest common multiple of 43578 and 9. 43578 What is the lowest common multiple of 1648 and 55620? 222480 Calculate the least common multiple of 45 and 8568. 42840 Calculate the common denominator of -115/20448 and 11/951. 6482016 Calculate the smallest common multiple of 782548 and 707. 5477836 What is the common denominator of 37/88 and 59/12320? 12320 What is the common denominator of -1/6608 and -113/440? 363440 Calculate the common denominator of -55/19064 and -53/147746. 590984 Calculate the common denominator of 101/2608 and 47/60636. 242544 What is the least common multiple of 70 and 4249? 42490 Find the common denominator of -2/3857 and 55/4959. 34713 What is the least common multiple of 72040 and 5403? 216120 What is the smallest common multiple of 10440 and 16704? 83520 What is the common denominator of 61/121446 and 31/6747? 121446 Find the common denominator of -71/183 and 157/5760. 351360 What is the smallest common multiple of 4700 and 40? 9400 What is the lowest common multiple of 30672 and 24992? 674784 What is the lowest common multiple of 6672 and 92? 153456 Find the common denominator of 131/431712 and 127/431712. 431712 What is the common denominator of -5/4 and 103/255510? 511020 What is the common denominator of 87/415696 and -57/103924? 415696 Find the common denominator of 83/364 and 16/357. 18564 Calculate the common denominator of -107/238278 and 73/5436. 1429668 What is the common denominator of 123/972430 and -17/62070? 2917290 What is the smallest common multiple of 160 and 11264? 56320 What is the smallest common multiple of 112 and 47024? 329168 What is the least common multiple of 1788 and 12? 1788 Find the common denominator of -95/29924 and -143/6. 89772 What is the lowest common multiple of 792 and 60? 3960 Calculate the lowest common multiple of 111 and 1008324. 1008324 What is the common denominator of -53/177289 and -85/151962? 1063734 Find the common denominator of -63/5 and -131/4860. 4860 What is the common denominator of -163/240 and -101/15570? 124560 What is the smallest common multiple of 1053 and 3042? 27378 What is the common denominator of -179/240 and -77/31464? 314640 Calculate the common denominator of 61/2282 and -29/17668. 2879884 Calculate the smallest common multiple of 11 and 456291. 456291 Calculate the common denominator of -25/874 and 9/52. 22724 Calculate the common denominator of 113/300 and -53/42024. 1050600 What is the smallest common multiple of 1405 and 207? 290835 Calculate the common denominator of 103/448 and 31/1216. 8512 Find the common denominator of 57/21275 and 71/4025. 148925 What is the smallest common multiple of 2350 and 9165? 91650 Calculate the common denominator of -83/1864938 and 121/18. 5594814 What is the lowest common multiple of 651 and 868? 2604 Calculate the lowest common multiple of 65162 and 14714. 456134 Find the common denominator of -61/1734 and 13/176188. 8985588 Calculate the least common multiple of 577176 and 8. 577176 Calculate the smallest common multiple of 26418 and 11396. 581196 What is the smallest common multiple of 230 and 670? 15410 What is the lowest common multiple of 270 and 3390? 30510 What	{ "pile_set_name": "DM Mathematics" }
2x3/9 - 218x*2/3 + 23762x/3 + 463. Find w, given that s(w) = 0. 109 Let v(n) = 17n - 9. Let d be v(3). Factor 11k + 26k2 - 43k - 48k2 - dk*2 - 4. -4(4k + 1)2 Let h be (1 - (-3 + 4)) + 18. Suppose 0 = 3a - h + 6. Factor 0 + 2/5ta - 2/5t - 6/5t3 + 6/5t*2. 2t(t - 1)3/5 Let p = -2663 - -21349/8. Factor 0 + 0m + pm4 + 3/4m*2 - 51/8m*3. 3m*2(m - 1)(15m - 2)/8 Let c = -42/1363 - -61629/9541. What is n in -cn2 + 39/7n + 6/7 = 0? -2/15, 1 Suppose 46n = -58n + 96n. Factor 2/5j*2 + 1/5j*5 + 0 + nj*4 - 3/5j*3 + 0j. j*2(j - 1)*2(j + 2)/5 What is j in 44 + 41/3j - 1/3j*2 = 0? -3, 44 Let r(g) be the second derivative of -3g*5/40 + 3g4/8 - g3/2 - 87g. Let r(n) = 0. What is n? 0, 1, 2 Let c be 20/(-10)-2 + -1. Let r(k) be the third derivative of 0 + 0k + 1/1140k*6 - 7k*2 + 1/114k*5 + 4/57k*c + 2/57k*4. Factor r(h). 2(h + 1)(h + 2)2/19 Let n be (256/32)/(1/5). Let m(g) be the first derivative of -35/4g*4 - 30g*3 - ng - 5 - g*5 - 50g*2. Factor m(u). -5(u + 1)(u + 2)3 Let b = 22/101 - 4194/707. Let k = b + 6. Factor -kt - 1/7t2 - 1/7. -(t + 1)2/7 Let m = 6/28253 + 109932381/197771. Let x = -555 + m. Factor -2/7y*3 + 2/7 + xy*2 - 6/7y. -2(y - 1)3/7 Let f(j) be the second derivative of j7/126 + j6/90 - j5/10 + j4/18 + 5j3/18 - j2/2 - 20j - 10. Factor f(d). (d - 1)3(d + 1)(d + 3)/3 Let c(o) = -2o3 + o2 + 7o - 7. Let u be c(2). Let w be u(24/(-6))/4. Suppose 1/6b4 - 1/6b*w - 1/6b*2 + 1/6b*3 + 0 + 0b = 0. What is b? -1, 0, 1 Find x such that -1/2x + 0 + 1/6x*2 - 1/6x*4 + 1/2x*3 = 0. -1, 0, 1, 3 Let h be ((-9)/(-54))/(1/(-6) - -1). Let y(o) be the first derivative of 1 + 0o*2 + 1/3o*3 - 1/6o*6 - ho*5 + 0o + 1/4o4. Factor y(a). -a2(a - 1)(a + 1)2 Let w(g) be the second derivative of -3g5/140 + g4/14 + 5g3/14 - 9g*2/7 - 127g. Factor w(x). -3(x - 3)(x - 1)(x + 2)/7 Let o(r) be the second derivative of r6/180 + r5/90 - r4/18 + r2 - 5r. Let c(l) be the first derivative of o(l). Solve c(w) = 0. -2, 0, 1 Factor -36 - 3211a2 - 682a + 361/2a3. (a - 18)(19a + 2)2/2 Find w, given that 0w*3 + 0w*2 - 15w - 2w2 + 11w + 2w3 = 0. -1, 0, 2 Let y = -14 - -17. Suppose -l - l + 2 = -yd, -l + 6 = d. Factor 2r3 + 0r*2 - dr - 2r4 - r2 + 3r*2. -2r(r - 1)2(r + 1) Let y be (-1)/(2/6) - (5 - 12). Let j(f) be the first derivative of -4/3f3 - 4f - yf2 + 5. Factor j(h). -4(h + 1)*2 Let y be (1/9)/((-256)/(-1536)). Solve -2/3j*4 + 2j*2 - yj*3 + 2/3j - 4/3 = 0 for j. -2, -1, 1 Let g(u) be the first derivative of -u*4/8 + 11u*3 - 129u*2/4 + 32u + 88. Solve g(j) = 0 for j. 1, 64 Suppose 1 - 7 = -3l. Let z be l + (-42)/(-9) - 4. Solve 2p - zp3 + 2/3 + 0p*2 = 0. -1/2, 1 Suppose 5n = 6n. Suppose d = 0, -4t + 8 = -nd - 4d. Factor -3z + 26 + 4z*t - 30 + 3z. 4(z - 1)(z + 1) Suppose 9 = 3x - 6. Let w be 22/x - (5 + -1). Determine b, given that 0 + 1/5b*2 + wb - 1/5b3 = 0. -1, 0, 2 Suppose 6h = 32 + 70. Suppose -5z = -hz + 24. Solve 1/3fz + 0f + 0 = 0 for f. 0 Factor 12/5x3 - 24x + 40 + 2/5x4 - 22/5x*2. 2(x - 2)*2(x + 5)*2/5 Let t be 8 + (2 - -1 - 2) - 2. Factor 0k + tk - 9k + 3k3 - 4k*3 - 3k*2. -k(k + 1)(k + 2) Suppose -2t + 17l + 20 = 21l, -l + 3 = 0. Determine v so that 3/4 + 3/8v + 3/4v*t - 3/2v*2 + 3/8v*5 - 3/4v*3 = 0. -2, -1, 1 Let w = 676 + -676. Let t(f) be the third derivative of wf - 1/144f4 - 1/240f*6 + 1/1260f*7 - 8f*2 + 1/120f*5 + 0 + 0f*3. What is k in t(k) = 0? 0, 1 Let s(r) be the first derivative of 0r + 1/240r6 - 1/16r*4 - 3 - 10/3r*3 + 0r*2 + 0r*5. Let p(v) be the third derivative of s(v). Factor p(f). 3(f - 1)(f + 1)/2 Let n(v) = 6v*3 - 276v*2 - 660v - 153. Let z(f) = f*3 + 2f*2 - 1. Let t(l) = n(l) + 15z(l). Determine j, given that t(j) = 0. -2, -2/7, 14 Let y(x) = -2x2 + 23x - 18. Let w(b) = -3b2 + 22b - 17. Let m(d) = 3w(d) - 2y(d). Factor m(n). -5(n - 3)(n - 1) Let v = 47 + -43. Let r(t) = 16t2 - 4t + 10. Let k(o) = -3o2 + o - 2. Let w(n) = vr(n) + 22k(n). Suppose w(d) = 0. Calculate d. 1, 2 Suppose 2t = -15 + 3. Let g be -3 - (-3 + 6 + t). Factor 0p + gp - p*2 + p + 1 - 2p3 + p3. -(p - 1)(p + 1)2 Let k(d) = 2d*2 + d. Let y(c) = -10c*2 - 10c + 20. Let t(j) = -4k(j) - y(j). Factor t(u). 2(u - 2)(u + 5) Let o = -48 - -72. Factor -60i + 15i3 - 8i*3 + oi*2 + 48 - 10i*3. -3(i - 4)(i - 2)2 Let d(m) be the second derivative of -1/160m*5 + 0m*2 + 0m*3 - 7m - 1/48m4 + 0. Suppose d(g) = 0. Calculate g. -2, 0 Suppose -259 + 126 = -9y - 124. What is f in 3/2f + 3/2f2 - f3 - y = 0? -1, 1/2, 2 Let s(m) be the third derivative of m5/15 + m3/2 + 2m2. Let i be s(-3). Factor 3a*3 - 6a*3 - 45a - 21a2 + 12 - i. -3(a + 1)(a + 3)2 Let o(v) be the first derivative of 2v*3/9 + 13v*2/3 - 20v + 27. Factor o(h). 2(h - 2)(h + 15)/3 Let h(j) be the second derivative of j7/126 - j6/15 + 2j5/15 + j4/18 - j3/2 + 2j*2/3 - j. Factor h(y). (y - 4)(y - 1)*3(y + 1)/3 Suppose 0 = 100k - 102k + 390. Let a be 4/(-22) + k/286. Solve 3/2c + 0 + 2c*2 + ac*3 = 0. -3, -1, 0 Let j(s) be the first derivative of 4s5/15 + s4 - 8s3/9 - 8s*2 - 32s/3 + 117. Solve j(l) = 0. -2, -1, 2 Let c(t) = -7t2 + 8t + 35. Let r(h) = 34h2 - 40h - 174. Let i(n) = -14c(n) - 3r(n). Factor i(w). -4(w - 4)(w + 2) Suppose g - 4 = 5x, 0g - 5x = -3g - 8. Let i be 19/10 + g/15. Factor io2 + 0 + 1/2o + 3/2o3 + 1/2o*4. o(o + 1)*3/2 Let x(u) be the first derivative of 4 + 0u*4 - 4/5u*5 - 2/3u*6 + 0u + 0u2 + 0u3. Suppose x(m) = 0. What is m? -1, 0 Let k(n) = n2. Let w(o) be the second derivative of 1/6o4 + 0o*2 + 0 + 0o*3 - o - 1/10o*5. Let l(s) = -2k(s) - w(s). Factor l(d). 2d2(d - 2) Let v(a) be the third derivative of 0a - 50a*2 + 0 - 128a*3 + 4a*4 - 1/20a*5. Factor v(w). -3(w - 16)*2 Determine h so that 5/8h + 1/8h3 + 25/4 - h2 = 0. -2, 5 Let m(k) be the first derivative of 0k - 3 + 9/2k2 + 1/3k*3. Let m(t) = 0. Calculate t. -9, 0 Factor 183t*3 + 189t*2 - 12 + 367t - 256t - 471t. 3(t - 1)(t + 2)(61t + 2) Suppose -x - 2x = 0. Suppose -4b = -2p + 14, 0 = 7p - 2p - 3b - 21. Factor 1/4kp - 1/4k + 0 + xk2. k(k - 1)(k + 1)/4 Suppose 0l*3 - 2/3l*5 + 0 + 0l*2 + 0l - 88/3l4 = 0. Calculate l. -44, 0 Let n(q) = 42q*3 + 69q*2 + 21q - 66. Let w(y) = y3 + y2 - y - 6. Let c(p) = -n(p) + 12w(p). Factor c(m). -3(m + 1)(2m + 1)(5m + 2) Let j(t) be the first derivative of 3t4/16 - 13t*3/2 + 507t*2/8 - 61. Solve j(n) = 0 for n. 0, 13 Let f(w) be the first derivative of 5w*4/12 + 10w*3/3 + 10w*2 - 13w - 3. Let b(o) be the first derivative of f(o). Suppose b(l) = 0. Calculate l. -2 Let d(j) be the first derivative of -j*4/20 - 2j3/15 - j2/10 + 151. Solve d(r) = 0. -1, 0 Let f(l) be the third derivative of 1/360l5 + 1/144l*4 - 1/720l*6 + 0 - 1/36l*3 + 0l + 11l2. Factor f(q). -(q - 1)2(q + 1)/6 Let w(m) be the third derivative of -9m2 + 0m*3 + 0 + 0m - 1/1848m8 + 1/1155m*7 + 1/660m*6 - 1/330m*5 + 0m*4. Factor w(i). -2i*2(i - 1)*2(i + 1)/11 Suppose -38/15i2 + 64/15i - 4/15i3 - 22/15 = 0. What is i? -11, 1/2, 1 Let p = -40/407 + 34708/5291. Let g = -1208/195 + p. Find v such that 14/5v*3 + gv - 32/5v5 + 2v*2 - 16/3v*4 + 0 = 0. -1, -1/4, 0, 2/3 Factor -47f*3 + 4f*4 - f + 39f*3 - 4f*2 + 9f. 4f(f - 2)(f - 1)(f + 1) Suppose 46j - 37 = 101. Let d(n) be the first derivative of 7/6n*j - 7/8n*2 + 7 + 1/4n - 1/2n4. Suppose d(m) = 0. What is m? 1/4, 1/2, 1 Let j(g) be the second derivative of 7g*5 + 74g*4/3 - 16g*3 + 61g. Determine t so that j(t) = 0. -12/5, 0, 2/7 Suppose 20p = 22p - 4. Factor -4c3 - 8c*2 - 11c*2 + 0c + 7cp - 8c. -4c(c + 1)(c + 2) Suppose -12i + 2i - 5 = -25. Factor 2/15g*3 - 2/15g*4 + 2/15g*i + 0 - 2/15g. -2g(g - 1)*2(g + 1)/15 Solve 4w2 + 72w + 2w2 + 0w*2 - 4w*2 = 0. -36, 0 Let -2/7i*5 + 2/7i**4 + 22/	{ "pile_set_name": "DM Mathematics" }
alse Which is bigger: 141/29 or 970? 970 Is 514656 greater than 514622? True Is 16855 >= 17332? False Which is bigger: -0.2 or 2/757297? 2/757297 Which is smaller: -264573 or -262824? -264573 Do -189768/17 and -11162 have different values? True Is 404 bigger than -68828? True Is 1/48 greater than or equal to 208521? False Is -748501 at least 5? False Which is greater: 4/23599219 or 0? 4/23599219 Which is smaller: 18/5791579 or 0? 0 Which is bigger: -68174 or -68206? -68174 Are 18677174 and 18677173 equal? False Which is greater: 31355 or 721147/23? 31355 Is -2 >= -14634/12305? False Is -5/1847258 <= 1? True Which is smaller: -4469206/789 or -5663? -4469206/789 Is -11835743 <= -11835739? True Which is smaller: -0.3 or 29391796? -0.3 Do -357580/153 and -2337 have different values? True Which is smaller: -4648044 or -4648011? -4648044 Which is smaller: 10827 or -1/483? -1/483 Is -2000822 equal to -2000822? True Is 2 < 7034564? True Is 41820417 >= 41820417? True Which is greater: 19329/4 or 48.8? 19329/4 Is 523 >= -447551? True Which is greater: 182340 or 181490? 182340 Which is smaller: -4840055 or -4840057? -4840057 Which is smaller: -1 or 76/9958817? -1 Which is greater: -311025 or -169? -169 Do 259110 and 259159 have the same value? False Are 41214991 and 41214995 non-equal? True Is -1 <= -19137/35998? True Which is bigger: 21704594 or 21704601? 21704601 Which is smaller: 2/135467271 or 1? 2/135467271 Which is bigger: 81396958 or 81396956? 81396958 Is -96436 >= -96541? True Is 4/15 less than or equal to -7240.67? False Is 9665.741 at most as big as -55? False Is -203155414 >= -203155412? False Which is bigger: -7 or -21848/3615? -21848/3615 Do -5516 and 88.44 have the same value? False Do -459659 and -459665 have the same value? False Which is smaller: 0.23207 or 1337? 0.23207 Which is greater: 10764 or 10833? 10833 Which is greater: -4 or -817/313? -817/313 Which is bigger: -572 or 67460? 67460 Which is smaller: -2/5096553 or 1? -2/5096553 Which is greater: 94681 or 108684? 108684 Which is smaller: -24.176377 or 0.16? -24.176377 Which is smaller: -245322 or -245024? -245322 Which is smaller: -59573129/6 or -9928854? -59573129/6 Is -1602 != 14254? True Is -8 greater than -50913521? True Is 112063 smaller than 112550? True Are 12812 and 633 non-equal? True Is 307788317 > 307788318? False Is 85497396 smaller than 85497396? False Is 2/1539672239 at least -1? True Which is bigger: 126 or 41423? 41423 Which is smaller: 71147 or 70545? 70545 Are -38402 and -38336 nonequal? True Which is bigger: -12762229 or -89335594/7? -89335594/7 Is 95721083 < 95721085? True Which is bigger: -9732/6979 or 0? 0 Which is greater: 1 or 1650014? 1650014 Which is smaller: 12142 or 12122? 12122 Are 2391489 and 2391433 non-equal? True Is 1 bigger than -2916/473665? True Which is smaller: -106.986 or -0.02727? -106.986 Which is smaller: -18921494 or -18921492? -18921494 Which is smaller: 63870535 or 63870533? 63870533 Which is smaller: 1/74322884 or 1? 1/74322884 Do 0.034637889 and -1/3 have the same value? False Is -79617/1460 equal to -54? False Is 4/233137 at least -1? True Is -566317/6 smaller than -94387? False Is -7192/1025 at least -6? False Is 84528 smaller than 84624? True Which is bigger: 129 or -90682? 129 Which is greater: -73/4 or 1/1687? 1/1687 Does -2 = 1704366/13? False Which is greater: -10 or 68740/27? 68740/27 Does -82 = -1593/32? False Which is greater: -16/166650935 or -1? -16/166650935 Which is greater: -47439 or -47214? -47214 Is -447894063 greater than or equal to -447894063? True Is 13788896 at most as big as 13788895? False Which is greater: 8842/2115 or 4? 8842/2115 Which is smaller: 186 or 232952/1245? 186 Are -1059775 and -1060007 unequal? True Is -2 at least as big as -73/31748? False Which is bigger: 124 or -2.6299? 124 Do 2917335 and 2917340 have the same value? False Which is smaller: -4.6759 or 142? -4.6759 Are -66254635 and -66254651 non-equal? True Are 43637919 and 43637920 nonequal? True Which is greater: 1 or -7/3336061? 1 Are 0.2 and -1/48520606 equal? False Is -2/31792267 < 1? True Is 0.019 greater than -261/53? True Is -1 bigger than 6/66077195? False Which is bigger: -247904 or -247907? -247904 Which is greater: 0 or -4/113047199? 0 Which is smaller: -46195361 or -46195364? -46195364 Is -5585353 > -5585361? True Does -1/2 = -25955/7? False Is 7833/14150 != 0? True Which is greater: 1 or -34/61059647? 1 Is 1/3 less than -1100458.79? False Is 1/241870690 at least as big as 0? True Which is bigger: 0 or -1/58280902? 0 Which is smaller: -1934953 or -1934951? -1934953 Does -32156 = -32263? False Which is smaller: 0 or 2/859228467? 0 Which is smaller: 0 or -25/4944379? -25/4944379 Which is smaller: -20614127 or -20614126? -20614127 Which is smaller: -2/9 or -171382300? -171382300 Do -0.01594 and 32 have the same value? False Is 2503759 > 2503732? True Is 1906418 at least 7? True Is 9560645 > 9560726? False Which is greater: 0 or -41/34876? 0 Are 43953921 and 43953913 nonequal? True Which is smaller: -9321363 or -9321364? -9321364 Is -5038861 less than -5038861? False Which is smaller: -3/425389832 or -1? -1 Do 1 and -6/102328201 have the same value? False Which is smaller: -284/5 or 1.2575? -284/5 Are -1/10 and -1/266125 equal? False Which is smaller: -85627 or -628? -85627 Is -589 not equal to 1120? True Which is smaller: -1 or 1/626813955? -1 Is -912376 at most as big as -912377? False Does 80203 = 450? False Is 807842172 at least 807842173? False Is -38373 greater than or equal to -38439? True Which is bigger: -15960 or -15803? -15803 Is -14018568 greater than -14018566? False Is -175920015 less than 0.2? True Is -10783 less than or equal to -10812? False Is 3591 equal to -178/121? False Which is smaller: -40241106 or -40241107? -40241107 Which is bigger: -10474 or 0.106? 0.106 Which is smaller: -1/96471159 or 0? -1/96471159 Which is bigger: 1 or 2/16523807? 1 Which is smaller: -15/16594 or 11.5? -15/16594 Is 3029/24690 greater than 0? True Which is smaller: 244/10917 or 0? 0 Is -1 at most as big as -1180/205983? True Are -3 and -6/181885 nonequal? True Is -3 != -151565525? True Does 7959294 = 7959294? True Is 3.758368 less than 1.3? False Is 15908561 less than 15908565? True Is -155085970 < -155085967? True Is -34 not equal to 4011933? True Is -416592 less than -416648? False Which is bigger: 0 or 52667944? 52667944 Which is smaller: -1745956 or 0.1? -1745956 Which is bigger: 0 or 134/455253? 134/455253 Which is greater: 1 or -16/395463? 1 Are 6080/49 and -3/2 equal? False Is 0 < 1739/10655? True Which is bigger: -63471 or 0.3? 0.3 Are -4449 and -22008 unequal? True Is -602926 not equal to -602520? True Which is smaller: 11002 or 107.52? 107.52 Is -3/2804018 smaller than 1? True Which is greater: -927235399 or -927235400? -927235399 Which is bigger: 3127207 or 3127191? 3127207 Which is bigger: -113631612 or -113631610? -113631610 Is 1 greater than -2548/136289? True Is 4222 >= 2639454/625? False Is -28987.6 less than or equal to -206? True Which is greater: -872459 or -872465? -872459 Does 0 = -2247/13861? False Is -1/93844853 at least as big as 1? False Which is smaller: -1142358 or -1142397? -1142397 Which is smaller: 363/183784 or -1? -1 Which is smaller: 22776563 or 22776562? 22776562 Is -10471 bigger than -11041? True Is 3.29184 less than -0.1153? False Is 0 greater than -2/30878897? True Which is bigger: -1767498 or -22? -22 Do 8002211/485 and 16499 have different values? True Is 265756683 greater than or equal to 265756683? True Is 72235 at most 72235? True Which is greater: 1006 or 14460? 14460 Is -13495632 equal to -13495641? False Is 2581 < 585753/227? False Which is smaller: 104986 or 104865? 104865 Which is bigger: -2095996 or -2096003? -2095996 Which is bigger: 2289967 or 43? 2289967 Is 635/399239 greater than or equal to 0? True Which is greater: 2/5 or -1323.5932? 2/5 Is 1766575 at least as big as 1766567? True Which is bigger: -27817913 or -27817899? -27817899 Is 3897168 <= 3897144? False Which is greater: 1/6 or -5856809? 1/6 Which is bigger: -1901/2279 or 0? 0 Is 1 at most as big as 209/192897? False Is 584/316767 > 1? False Is 0 less than or equal to -58/7832101? False Is -720015/941 at least as big as -765?	{ "pile_set_name": "DM Mathematics" }
+ 15 + (-10557)/759). 11/4 (65 + -67)((-2496)/(-15120) - (2 + -1)/7) -2/45 Calculate 48 + 35 + (-972)/27. 47 Evaluate 154/(-554400)90 - (-2301)/840. 19/7 What is the value of 7((-62)/46530/(-78))/((-12)/9)? -7/26 What is ((6/(-4))/(37 + 6195/(-168)))/((-30)/2)? 4/5 945 - 948 - (-43 - 2) 11 Evaluate ((-8502)/(-18421))/(((-2)/65)/((-4)/(-15))). -4 (3/4)/((-624)/1664) - (-1)/(11/46) 24/11 Calculate (27 + 0)/(-108)-252. 63 Evaluate 1 - 4 - (69/(-7))/(-61 - (-16092)/252). 9/20 Calculate ((-2405)/(-259))/(3/44121). 65 Calculate 9847/(-122057)-410 - 1(-2)/(-26). 33 Evaluate (17 + 3034/(-205))(-5)/(-33). 1/3 (-20)/10 + 1 + -1 - 31 -33 Evaluate (13 - 2/2)(-52216)/78324(-5)/(-12). -10/3 What is (-28 - 3786/(-135)) + (-4030)/(-450)? 9 What is 2310/44609/5684? 45/8 Evaluate (540/(-162))/(466/(-699)). 5 Calculate 2(2/(-8) - 1421/12)(-1512)/(-4032). -89 What is (209/121)/(156/(-8580))? -95 What is ((-11528)/720510/(-128))/((3/664)/3)? 83 Evaluate -2 - 325/85 - ((-2211)/3685)/(2/20). 3/17 What is 157/13 + 28728/(-756) + 55? -12/13 Evaluate 52/(-1482) - 1421/6612. -1/4 What is 6/(-2 + 0) + 21540/2513? 39/7 What is the value of -190860/(-32600) - (-31 - -36)? 2/163 Calculate ((-1953)/(-62))/(-30 + (-2079)/(-72)). -28 What is (851/(-368))/37(-152)/3? 19/6 What is the value of (-176)/(-660)(-2 - (-150)/12)? 14/5 What is the value of (-199)/((-102087)/4674) - 9? 1/9 Evaluate 304769/(-32948)(-2)/(-37). -1/2 Evaluate (0 + (-27)/(-27))/(132/(-360)). -30/11 What is the value of ((-1)/(-2))/(117/104)((-1530)/24)/(-17)? 5/3 9 + (-48 + (-11690)/(-245))(335/2)/5 -4/7 Calculate (-5 - -4)36/(-120)-25. -15/2 Calculate 1439011/(-11809) - 4/28. -122 Evaluate 92/(-42)(525/240)/(30/(-24)). 23/6 What is the value of 2/(-4) - (-41 + (-19 - -50) + (-217)/(-22))? -4/11 (0 + 11/(-6))(-12200)/(-167750) -2/15 ((-67312)/43272)/(19/(-9) + 1) - (-17)/(-12) -1/60 What is the value of (5-1 + (8 - 7))/(70/315)? -18 Evaluate 409/4499 - (72/(-528))/(2/12). 10/11 Calculate (-138)/11 + 209/((-2299)/(-154)). 16/11 Calculate (-14 - 364/(-21)) + 1219/(-345). -1/5 Calculate (-53970)/13878 + 2185/585. -2/13 (8/18)/(18760/(-60300)) -10/7 Evaluate 6/30 - 2/((-230)/(-4163)). -36 Calculate -2 + (-47 - -100) - -3. 54 Evaluate (-442)/442(-412)/(-249) + (-10)/(-6). 1/83 What is (656/8528)/((-5)/(910/(-6)))? 7/3 What is the value of ((-16)/(-12))/(192/(-288))? -2 -2415282/(-42768) - 300/(-275) 29/3 What is the value of 88 - 620/7 - (-151)/7? 21 What is (1 - 904/151) + (590 - 585)? 2/151 What is (84/(-1050))/(63861/3990 + -16)? -76/5 Calculate 19(-14)/(-133) - 29/(899/(-62)). 4 Calculate ((-14)/(-42))/((-125)/29175) + 16/(-5). -81 Evaluate 20097/4970 - (-510)/(-120) - 6/(-40). -4/71 Evaluate 7513 + -7529 - -14. -12 What is the value of (3/((-369)/12))/((-46)/8 + (-1463)/(-836))? 1/41 What is (125/14 - 1 - 35320/24724)172/13? 86 What is the value of 1/10 - (83 - 2196/40)? -28 What is (-128)/(-2) - (-836583)/(-13052)? -5/52 What is (-10638)/(-5040)-10 - 21-1? -3/28 Evaluate 2394/171 - 11716/841. 2/29 Calculate (2/29 - 1)/(207/138)76/114. -12/29 What is 1428/(-650) + 2 - (-18426)/239538? -3/25 Calculate 84/2(-4327)/(-30289). 6 Calculate (-32992)/(-5155) + 458/(-20). -33/2 ((-30)/(-1430))/(172/(-1118)) -3/22 What is the value of (-10)/498((-1614)/2690)/((-2)/(-4))? 2/83 Evaluate -52 - (55275/(-627) - -36). 3/19 Evaluate (-18 - (-165)/11) + 3 + -5 + -28. -33 What is 27728/(-38126)(-11)/4? 2 (60/(-14))/((-4495)/44051) 42 Evaluate ((-7)/(-6))/(2 + (-351)/162). -7 What is the value of (((-4)/372)/1)/(18425/(-450) - -41)? -6/31 348/(-21112)(-25 + 39) -3/13 Evaluate 7962/82 - 1572/16113. 97 What is ((-7)/3 - -1)(-365)/((-2555000)/840)? -4/25 -155 + (-2358)/(-18) + 65 41 Evaluate ((-48)/(-14688)54)/((-9)/24-2). 4/17 What is the value of (27/91 - 1/7) + (-6222)/221 + 20? -8 What is 312/80 + 4 + 21/(-70) - 6? 8/5 What is 107882/2004 + (-12)/(360/25)? 53 What is 497/(-588)4 + ((-144)/(-108))/((-14)/3)? -11/3 What is (91/3641984)/4? 124 What is (-3 - 1)((-30022)/3332 - -9)/(30/21)? 1/35 What is the value of 5980/(-805)7 + -34? -86 Calculate (20/(-4) - (60/(-3) - -18))/((-3)/14). 14 5/(-100) + (-6)/(-60) + (-111)/444 -1/5 What is the value of 4/35((-95)/10 + -2 - 1683/(-153))? -2/35 What is 17578/329 - (-88)/56? 55 What is the value of (1 - 1022/(-42))(-60)/(-40)? 38 Calculate (-105643)/1246 - -85 - (-3 - 89/(-14)). -22/7 What is the value of ((-3036)/(-322))/((-8)/(-28))? 33 What is the value of (-11)/(-1) + (-9)/((-324)/(-588))? -16/3 What is the value of (((-6)/35)/(1056/924))/(24/(-10))? 1/16 68 - 63745/46755 -3/17 What is the value of 14 + -5 - 6 - (0/(-53) - 13/(-5))? 2/5 (-204 - -170) + 6 + 10070/360 -1/36 (2314/5152)/((-446)/(-28) + -16) -7/8 Evaluate (-18325)/(-2932) - (-445)/(-68). -5/17 Evaluate 116 + 3366/(-935)(5 - 0/5). 98 What is the value of (-6)/(-11)26367/88689? 6/37 Evaluate (-18)/(-15)60500/1980030/(-4). -55/2 1/2 - (-39)/(-30) - 63(-396)/29260 1/19 (117343 + -117344)/(2/(-114)-1) -57 (-13 + 104 + -4)35/(-105) -29 What is (0/2)/(568/(-71))? 0 What is (-66)/24 + ((-14)/((-168)/(-171)) - -13)? -4 Calculate (-137764)/808(-172)/1333. 22 Evaluate 4((-48840)/(-80))/(-111). -22 What is 230/8 - (-3335)/(-115)? -1/4 Evaluate (-2 + 1/4)/(1241/(-2482)). 7/2 What is (5/2)/1329/(-13160)? -1/16 What is ((-51)/(-544))/(1/28) - (-135)/(-54)? 1/8 What is 124/(-2015)(1 + (-13)/8)-2? -1/13 Evaluate 572/(-2508)39 + 12/(-114). -9 455/7 - (-4704)/(-48) -33 Calculate (-58 + (-11120)/(-200))1225/28. -105 What is 192/6 + (73 - 106)? -1 33 + (-285012)/9936 + (-17)/4 3/46 Calculate ((-45)/(45/(-2)))/(18/(-423)). -47 Calculate 2 + (-14252)/1241 - 444/6882. -113 -98 + 0 - (-1318585)/14570 -15/2 What is 74/(-14) + (10/4)/(31 - (-4183)/(-188))? -5 What is the value of ((-9516)/312 + 29)/((-133)/130 - -1)? 65 What is ((-48)/(-1) - (47 - 50)) + -177 + 162? 36 What is the value of (-22848)/26112 - 834/16? -53 What is (-8748)/(-1728)16 - 111? -30 What is (3/(-4))/((8/(-100))/(768/(-432)))? -50/3 What is the value of (-4)/15 - (-346983)/(-4095) - -21? -64 Calculate (-5 + 1)/76 - (-18 - 8820/(-285)). -13 Evaluate (18/(-3) + -4)(-108)/(-1620). -2/3 (275/130 - 2)/(255/170) 1/13 ((-527)/(-11067))/(((-6)/(-56))/3)-42 -56 (-2176)/39168 - (-1 + (-759)/54) 15 What is -39 - (64 - (-8400)/(-48))? 72 What is the value of 96208/108234((-58)/20 + 2)? -4/5 What is -21 - ((-14 - -30) + -42 - -5)? 0 What is (-5 - (-31 + 7 - -6)) + 38 + -1? 50 Calculate 104/1300125 + (-51 - 3(0 + -1)). -38 What is (14/(-6))/((-1061)/19098)? 42 Calculate 27 + 9/((-36)/(-68)). 44 What is (3/(-72) - 4/12)(40 - 9416/132)? 47/4 What is -562 + 555 + 20/3? -1/3 What is the value of 1518/6831 + (-428)/(-18)? 24 What is 27 - (-35 - 0 - (-406 - -304))? -40 What is the value of 2420/770 + 72/(-63)? 2 What is (1(-15)/105)/(-1) - (-942)/21? 45 Evaluate -20(20/(-6) + 11521/246 + -44). 10 What is the value of (-62/(-15))/(206/(-3090)-46)? 6/23 Calculate (-30)/(-147)3367/2405. 2/7 What is the value of (-3 - 380/(-124))/((18/30)/(72/80))? 3/31 Calculate 37 + 26909/2130-3. -9/10 3-9 + (-4176)/(-72) 31 What is the value of 90(966/1127 + (-74)/70)? -18 What is the value of 111 - (136 - 46)/45125/(-5)? 61 Evaluate (((-3780)/456)/21)/((-1692)/(-5358)). -5/4 What is ((-2425)/75 - -11) + 21? -1/3 Evaluate 1360/(-2)(-426)/3408. 85 What is ((-49152)/(-112))/(-24) + 24/28? -18 Evaluate (-4)/51((225 - 321) + 90). 8/17 Evaluate 122166/13662 - 24/(-414). 9 What is (2796 - 2781) + (-9)/6(-17)/(-3)? 13/2 Evaluate (12/20)/(26/(-2496)18). -16/5 What is the value of 5215/(-475) - ((3570/(-867))/35 + (-185)/17)? 2/95 What is the value of 456228/75348 - 9/(-39)? 44/7 What is (-42)/(-1470)(-48 - -23)? -5/7 Evaluate (-680)/(-7) - ((-233)/(-3262))/(2/4). 97 Evaluate (-6)/9 + (-146)/2774 + 2321/57. 40 Calculate ((-12)/27-24 + 27/(405/(-165)))-3. 1 What is the value of (-1977)/(-36) + ((-12)/21 - 3/((-252)/55))? 55 What is the value of ((-10838907)/98715)/(18/10)? -61 What is the value of ((-2360)/(-1770))/(295/(-1020) + (-2)/(-8))? -34 21/(-15) + -3 + (-6026)/(-1380) -1/30 What is (-264)/(-900)45/(-4455)-180? 8/15 Calculate (-94/(-378))/((-70)/980) - (-2)/(-3). -2 10845/103950 + 31/(-7161) 1/10 (-17)/(-119) + (-321	{ "pile_set_name": "DM Mathematics" }
ng order. -4, a, 2/3 Let w(c) = c - 5. Let p be w(8). Sort -4, 2, p. -4, 2, p Suppose -2k + 3 = -3. Let n be (-3 - -3) + (-5)/(-1). Suppose 0d - 3d + 3 = 0. Sort d, n, k in ascending order. d, k, n Let z be (-3)/(-9) - 38/6. Let c = z + 6. Sort -2, -3, c in increasing order. -3, -2, c Suppose -5 + 20 = -3i. Let t(o) = 3o + 2o - o*2 - 3 - o. Let c be t(3). Put -4, c, i in descending order. c, -4, i Let q = -1.895 + -0.105. Let z = -2 + 2. Sort 2, q, z. q, z, 2 Let n = 103/9 + -11. Let q = -13/3 - -9/2. Sort 0.2, q, n in ascending order. q, 0.2, n Let o be (-22)/(-143) + 33/39. Sort o, 2/5, 5, 0.3 in decreasing order. 5, o, 2/5, 0.3 Let x(b) = 3 + 2b - 2b + b + 0. Let g be x(-4). Let v be 0 + (2 - (-22)/(-10)). Put g, v, 2 in decreasing order. 2, v, g Let a = 0.44 - 0.5. Let n = a - 0.24. Let h(x) = -x2 - 7x - 11. Let j be h(-2). Sort 5, n, j in descending order. 5, n, j Let p = 29 + -28.7. Put 1/3, -26, p, -1 in decreasing order. 1/3, p, -1, -26 Suppose 5n + 24 = 2w, n = -3w - 0 + 2. Put 5, w, 4 in increasing order. w, 4, 5 Let l(p) = -12p - 1. Let b be l(0). Put b, 4, -5 in descending order. 4, b, -5 Let y = 18.1 + -21. Let f = -0.9 - y. Put f, 0.4, 2/9 in descending order. f, 0.4, 2/9 Let m(i) = -2i + 14. Let d be m(7). Suppose -10r - 8 = -8r. Let n be (4/(-6))/(2/3). Put d, n, r in increasing order. r, n, d Suppose 0 = -2p + 6p. Let l be (-3)/(-6)-6 + p. Put 5, 2, l in descending order. 5, 2, l Suppose 3 = -5c - 2. Let s = -24/5 + 21/5. Put s, 1, c in decreasing order. 1, s, c Let r = 39 - 42. Let m be -1-1(-2)/6. Sort r, -0.3, m in decreasing order. -0.3, m, r Let w = -0.06 + -0.04. Let q = -15 + 10. Put w, 2/9, q in ascending order. q, w, 2/9 Let l be (-25)/(-9) - 6/(-27). Suppose 1 = -s + l. Sort -3, s, 4. -3, s, 4 Suppose -4z - 5 - 15 = 0. Suppose 5r = 1 - 16. Suppose -5o + 5 + 5 = 0. Put z, o, r in increasing order. z, r, o Suppose -4a = -120 - 0. Suppose -33 - a = -3w. Let f be w/(-9) - (-3 - -1). Put 0.5, 0.3, f in increasing order. f, 0.3, 0.5 Let m = -71 + 66. Sort -5/3, m, -4. m, -4, -5/3 Let x be (-2)/(-4)(-8)/26. Let s be (-7 + 6)/((-1)/(-1))0. Put -3, x, s in decreasing order. s, x, -3 Let n = 13 - 9. Suppose -nq = -17 + 5. Suppose -4j - 10 = -4g + 22, 2g = -3j - 4. Sort q, g, -2 in increasing order. -2, q, g Let r = 8 - 11. Suppose -32 = -4k + 5t, 8 = -4k - 0k - 5t. Put r, k, -1 in increasing order. r, -1, k Let n = -17 + 16.87. Let z = -0.63 - n. Put 5, z, -0.4 in ascending order. z, -0.4, 5 Let z be (-8)/(-36) + 43/9. Suppose -3p = 5b + 2p - 35, -2b = 5p - 23. Put 1, z, b in decreasing order. z, b, 1 Let h be (1 + -1 - 1)0/3. Let j be 5/42/10. Put j, h, 9 in decreasing order. 9, j, h Let f = -98/3 + 32. Sort -7/4, -1/10, f, 4 in decreasing order. 4, -1/10, f, -7/4 Let q = 1 - 11. Let h = -14 - q. Sort -1, -2/7, h in decreasing order. -2/7, -1, h Let h = -11 + 21. Let k(q) = 2q - 7 - 3q + 2q. Let i be k(h). Sort 3/2, 2/7, i. 2/7, 3/2, i Suppose -s - s + 2 = 0. Suppose -4m + 12 = 4. Suppose 0 = -4o - mi + 20, 5o - 11 = 2i + 14. Put s, o, 4 in ascending order. s, 4, o Let l = 2.02 - 0.02. Let z = 0.9 + -1. Let k = -134/3 - -45. Sort z, k, l in decreasing order. l, k, z Let z = -74 + 68. Put 2, 1/6, z, -3 in increasing order. z, -3, 1/6, 2 Suppose 0 = -2f - 4. Sort 5, -4, f in descending order. 5, f, -4 Let s be 5/2 - 0/(-11). Let z = 0.06 + 0.14. Sort z, s, -0.3 in descending order. s, z, -0.3 Suppose 2o = -0o + 8. Let b = -3.89 - 0.11. Let l = b - -9. Sort o, -2/3, l in increasing order. -2/3, o, l Let w = 14 + -16. Put 0, w, 3 in ascending order. w, 0, 3 Let i(a) = -3a - 1. Let m be i(3). Let n = m + 5. Let h = -7 - n. Put h, 4, 3 in decreasing order. 4, 3, h Suppose 2y - 2 = -3w + 7, 2w - 11 = -3y. Put w, -2/5, -4, -0.01 in descending order. w, -0.01, -2/5, -4 Let j = -15 + 14. Suppose -5v + 25 = -5o, 3o - 2 + 11 = -3v. Put j, 1, o in descending order. 1, j, o Let j be -413/105. Let b = j + 36. Suppose -3m = -q + 2q - 2, 0 = -2q + b. Sort -0.3, m, 4 in descending order. 4, -0.3, m Let c = 4 - 6. Let r = -7 - c. Let s(o) = 2o3 - 4o*2 + 3o - 1. Let w be s(2). Put w, 3, r in decreasing order. w, 3, r Let q(v) = -v*3 - 4v*2 + v + 2. Let y be q(-4). Let l be -53/((-15)/y). Sort l, -5, -4 in increasing order. -5, -4, l Let f = 51.2 + -58. Let d = 7 + f. Sort 3, 0.3, d. d, 0.3, 3 Let x(w) = w*2 + 4w - 7. Let g be x(-5). Suppose -19 = -5h + 2j, -h + 7 = -2h + 4j. Put 2, h, g in descending order. h, 2, g Let u = -0.1 + -0.9. Let v = u - 2. Let n = 4 + 1. Put v, 3, n in increasing order. v, 3, n Let s be -4 - (-4 - (-5 + 3)). Sort s, 2/7, 0.5 in increasing order. s, 2/7, 0.5 Let n = -9.8 - -8.8. Sort 2, n, 2/13, -1/5 in descending order. 2, 2/13, -1/5, n Let d = 1 + 3. Suppose 0 = -da - 31 + 95. Suppose 0 = an - 11n + 20. Sort 5, 1, n in increasing order. n, 1, 5 Let v = -99 - -70. Let u = -23 - v. Put u, 2, 4 in increasing order. 2, 4, u Let o = 8 - 10. Let j be 5 + -7 + 2/o. Put 2, j, -4 in descending order. 2, j, -4 Let d be (1/2)/(3/36). Suppose 3k = -i - 2i - 9, -3i + d = -2k. Sort i, -3, 1 in decreasing order. 1, i, -3 Let n = -0.96 - 0.04. Let h = -5 - n. Let t = -0.2 - 0.3. Put h, t, 5/3 in decreasing order. 5/3, t, h Let z = 5 + -3. Let y be 4 - (-2 - -110 - 0). Sort z, 3, y in increasing order. y, z, 3 Let d be (2/1)/(0 - -1). Sort -2, 11, d in descending order. 11, d, -2 Let j be 3 - (-23)/(-6) - -1. Put -5/3, -2, j in descending order. j, -5/3, -2 Let x be (-12)/(-18) - 60/63. Sort -0.3, -5, x in increasing order. -5, -0.3, x Suppose 3h + 144 - 6 = 0. Let v = -185/4 - h. Put v, 1, -0.2 in ascending order. v, -0.2, 1 Suppose -4x + 0x + 2v + 16 = 0, -2 = 2x + 4v. Put -5, x, 1 in descending order. x, 1, -5 Let b(n) = n*2 + 3n - 5. Let m be b(-3). Let p = 8 + m. Let z(o) = -o*3 + 4o*2 - 2o - 4. Let d be z(3). Put d, -3, p in descending order. p, d, -3 Suppose -4q + 4a + 24 = 0, -2a + 14 = 5q + a. Suppose 3r - qr - w = 2, -5w = -2r - 18. Sort -3, r, -1. r, -3, -1 Let z = -2 + 0. Put -1, z, 0 in decreasing order. 0, -1, z Let v = 125666/77 - 1632. Let o = v + 69/308. Sort 5, o, 0.2 in decreasing order. 5, o, 0.2 Let h be 4 - 1 - (-1 - -1). Suppose 3k = 2k. Let i be (-1)/(-12/(-8)). Sort h, i, k. i, k, h Suppose -2x + 5y - 3 = 0, 0 = -2y - y + 9. Let r be (6/(-9))/(1/x). Put r, -0.3, 1/2 in ascending order. r, -0.3, 1/2 Suppose 2k = -3s - 2k + 4, -4s = -2k + 2. Let u be (4/5)/(2/5). Put s, u, 1 in decreasing order. u, 1, s Let b = 19 - 13. Put 5, b, 3 in descending order. b, 5, 3 Suppose 4l = -2l + 30. Sort 4, l, 1 in descending order. l, 4, 1 Suppose 5y - 3y = -4y. Sort 5, 4, y. y, 4, 5 Let b(m) = -3m + 4. Let d be b(0). Sort d, 1, 5. 1, d, 5 Let s(i) = i2 + 13i - 3. Let p be s(-13). Put p, -15, 2 in increasing order. -15, p, 2 Suppose 3q - 4h + 108 = -2q, 8 = 4h. Let x be 2/(-2) - q/28. Sort x, 0.4, -4. -4, x, 0.4 Let r = 2 + 2. Suppose -5j = 5f - 0f + 5, 0 = -4j - 5f - 8. Suppose -4z + 5y = 29, 0z + jz + 23 = 4y. Put 3, r, z in increasing order. z, 3, r Let j = -292/7 - -42. Let k(y) = 2y2 + y + 1. Let v be k(-2). Let u = 4 - v. Put -2, u, j in descending order. j, -2, u Let b = 16 + -12. Let y = -8 + b. Put y, 0, 1 in ascending order. y, 0, 1 Suppose 4m - 8 = -2t, 3t + 4 = -t + 2m. Put -2/7, 1/6, t in descending order. 1/6, t, -2/7 Let l = 6 + -4. Suppose 4k - 2k + 5n = 0, 15 = 5k + 5n. Let p be (-7)/(-5) - 4/10. Put k, p, l in decreasing order. k, l, p Let q = -53/141 - -2/47. Put 4, -1/2, q in decreasing order. 4, q, -1/2 Suppose k = 2w - 1, -2w - 5k - 2 + 33 = 0. Suppose -3r - 2 = 4x, -4x - 5r + 2 = 8. Sort x, w, -3 in decreasing order. w, x, -3 Let m = -2.7 - -1.5. Sort -0.1, m, 1/4 in increasing order. m, -0.1, 1/4 Let k = -0.9 + 2.6. Let u = -1.98 + -0.02. Let l = k + u. Sort -5/4, -0.2, l in descending order. -0.2, l, -5/4 Let j(w) = -2w*2 + 22w - 1. Let k be j(11). Suppose 4d + 4r = -16, -5r - 13 = 3d + 1. Sort d, k, 2. d, k, 2 Let f = 24 - 19. Put 1, -5, f in ascending order. -5, 1, f Let l = -3 + 5. Suppose -2k = 5f - 26, 2k - 26 = -4f - 0f. Let m = k - 8. Put m, l, -4 in decreasing order. m, l, -4 Suppose 7t = 6*t + 1. Sort t, -1,	{ "pile_set_name": "DM Mathematics" }
0? -4997 What is next in 33746, 134973, 303684, 539879, 843558, 1214721? 1653368 What comes next: 7, -355, -1477, -3737, -7513, -13183, -21125, -31717? -45337 What is next in 11177, 11172, 11151, 11108, 11037? 10932 What comes next: 16445, 32872, 49293, 65708, 82117, 98520? 114917 What is next in 1628, 6393, 14334, 25451, 39744, 57213? 77858 What comes next: 111151, 111153, 111155, 111157, 111159? 111161 What is next in -5, -8, 21, 82, 175, 300? 457 What is next in -641, -1579, -2515, -3449, -4381? -5311 What is the next term in -191834, -383672, -575500, -767312, -959102, -1150864, -1342592, -1534280? -1725922 What is next in 5759, 23014, 51769, 92024? 143779 What is the next term in 1376, 10828, 36418, 86216, 168292, 290716, 461558? 688888 What is the next term in -65, -121, -183, -251, -325? -405 What comes next: -861, -7322, -24859, -59010, -115313? -199306 What is the next term in 18508, 18490, 18472, 18454, 18436, 18418? 18400 What is the next term in -211333, -845310, -1901939, -3381220, -5283153, -7607738? -10354975 What comes next: -1344, -2843, -4338, -5829? -7316 What comes next: -28251, -56619, -84987, -113355? -141723 What is next in 21848, 43706, 65564, 87422, 109280, 131138? 152996 What comes next: -382, -908, -1428, -1942? -2450 What comes next: -411, -396, -379, -360, -339, -316, -291? -264 What is next in 240, 354, 468? 582 What is next in 3971, 7547, 11121, 14693, 18263? 21831 What is next in -149, -260, -553, -1118, -2045, -3424? -5345 What comes next: 17869, 17902, 17935? 17968 What is next in -1169, -1200, -1231, -1262, -1293? -1324 What is the next term in 30992, 30986, 30980, 30974? 30968 What comes next: 576, 521, 434, 321, 188? 41 What is next in -19777, -19790, -19813, -19852, -19913, -20002? -20125 What is the next term in 38, 153, 372, 719, 1218, 1893? 2768 What is the next term in 20020, 20021, 20022, 20023, 20024, 20025? 20026 What is the next term in -2650, -2643, -2632, -2617, -2598, -2575? -2548 What is the next term in -2280, -9108, -20486, -36414, -56892, -81920? -111498 What is next in 258, 390, 598, 888, 1266, 1738, 2310? 2988 What comes next: -54552, -54530, -54494, -54438, -54356? -54242 What is the next term in 9530, 19134, 28748, 38378, 48030, 57710, 67424, 77178? 86978 What is next in 75, -256, -1151, -2892, -5761, -10040, -16011? -23956 What is next in 34486, 68969, 103454, 137941, 172430, 206921? 241414 What is next in -4647, -18462, -41487, -73722, -115167, -165822? -225687 What is next in 6031, 11973, 17915, 23857, 29799, 35741? 41683 What is the next term in 166789, 333581, 500373? 667165 What is next in 10995, 21988, 32971, 43938, 54883? 65800 What is next in 468, 461, 446, 423, 392, 353, 306? 251 What is next in 336, 681, 1028, 1377, 1728? 2081 What is next in 496, 1919, 4296, 7627? 11912 What comes next: -10702, -10708, -10714, -10720? -10726 What comes next: 9994, 19985, 29970, 39943, 49898? 59829 What is next in 428, 452, 476? 500 What is next in -980, -1011, -1060, -1127? -1212 What is the next term in -286372, -572744, -859116, -1145488, -1431860, -1718232? -2004604 What comes next: 1822, 2143, 2464? 2785 What comes next: -5412, -21673, -48784, -86745, -135556? -195217 What comes next: -15325, -30651, -45977, -61303, -76629? -91955 What is the next term in -2334, -2327, -2310, -2277, -2222, -2139, -2022? -1865 What is the next term in -41, 1, 73, 175? 307 What is next in -54005, -108008, -162011, -216014? -270017 What is next in -14402, -28803, -43204, -57605? -72006 What comes next: 442, 3564, 12036, 28534, 55734, 96312? 152944 What comes next: 23, 43, -59, -343, -869, -1697, -2887? -4499 What is the next term in 3946812, 3946810, 3946808, 3946806? 3946804 What is next in 190, 409, 632, 859, 1090? 1325 What is the next term in 31, -72, -207, -392, -645, -984, -1427? -1992 What is the next term in 124, 111, -62, -395, -888, -1541, -2354? -3327 What comes next: -65862, -131769, -197676, -263583? -329490 What comes next: -43777, -87551, -131321, -175087, -218849, -262607? -306361 What is the next term in 7819, 7824, 7825, 7822, 7815, 7804? 7789 What is the next term in -1227, -3836, -8185, -14274, -22103, -31672? -42981 What comes next: 256, 429, 530, 577, 588, 581, 574? 585 What comes next: 2192, 2180, 2170, 2162? 2156 What comes next: -2246, -8598, -19060, -33638, -52338? -75166 What is next in 4506, 8999, 13480, 17949, 22406, 26851, 31284? 35705 What is next in -2171, -4313, -6455, -8597, -10739, -12881? -15023 What comes next: 20540, 20617, 20694, 20771, 20848, 20925? 21002 What is next in -2324, -2515, -2706, -2897, -3088? -3279 What comes next: -122916, -122915, -122914? -122913 What is the next term in -555986, -555983, -555980? -555977 What is next in -418, -504, -736, -1186, -1926, -3028, -4564, -6606? -9226 What is the next term in 117, 507, 899, 1293, 1689, 2087, 2487? 2889 What is the next term in -379901, -759809, -1139721, -1519637, -1899557, -2279481? -2659409 What is next in 709, 2900, 6551, 11662, 18233, 26264? 35755 What comes next: -51278, -102470, -153662, -204854, -256046, -307238? -358430 What is next in 1043, 1569, 2439, 3647, 5187, 7053, 9239? 11739 What comes next: 718549, 718548, 718547, 718546, 718545? 718544 What is the next term in -93, 77, 369, 783, 1319? 1977 What comes next: 91, 115, 155, 217, 307, 431, 595, 805? 1067 What is next in -2939, -2950, -2975, -3020, -3091, -3194? -3335 What comes next: -22731, -22669, -22607, -22545, -22483, -22421? -22359 What is the next term in -7158, -7160, -7162, -7164, -7166? -7168 What is the next term in -67446, -67449, -67454, -67461, -67470, -67481, -67494? -67509 What is next in 81, 505, 1659, 3909, 7621, 13161, 20895, 31189? 44409 What is next in 26873, 53729, 80585, 107441, 134297, 161153? 188009 What is the next term in 3395, 3397, 3399, 3401, 3403? 3405 What is next in -179, -202, -239, -290, -355, -434? -527 What is the next term in -326, -1578, -2808, -4004, -5154, -6246? -7268 What comes next: 213, 205, 209, 237, 301, 413, 585, 829? 1157 What comes next: 517601, 1035198, 1552795? 2070392 What is the next term in 5542, 11089, 16636, 22183? 27730 What is the next term in -732, -1455, -2178? -2901 What comes next: -59733, -119476, -179225, -238980, -298741, -358508, -418281? -478060 What is the next term in -228, -147, 96, 585, 1404, 2637, 4368, 6681? 9660 What comes next: -3986, -15732, -35316, -62744, -98022? -141156 What is the next term in -3549, -2835, -1645, 21, 2163, 4781? 7875 What comes next: 12, -820, -2204, -4140? -6628 What is the next term in 2105, 8299, 18583, 32957, 51421? 73975 What is next in 9446, 18895, 28342, 37787, 47230, 56671, 66110? 75547 What is next in 588, 1234, 1926, 2664, 3448, 4278, 5154? 6076 What is the next term in 92449, 92446, 92441, 92434, 92425? 92414 What comes next: 89, 110, 183, 338, 605, 1014? 1595 What is the next term in -47, -119, -197, -281, -371, -467, -569? -677 What is next in 4504, 4495, 4472, 4429, 4360, 4259? 4120 What is the next term in 935, 635, 135, -565? -1465 What is the next term in -1559, -3092, -4627, -6164, -7703? -9244 What is next in -2693, -5405, -8103, -10781, -13433, -16053, -18635? -21173 What comes next: 280, 1066, 2374, 4204, 6556? 9430 What comes next: 456, 1724, 3786, 6600, 10124, 14316? 19134 What is next in -4807, -9617, -14427, -19237, -24047, -28857? -33667 What is the next term in 21, 25, 29, 33, 37, 41? 45 What is next in 346, 349, 356, 367, 382, 401, 424? 451 What comes next: 2850, 2851, 2852? 2853 What is next in -1199, -1324, -1453, -1586? -1723 What is next in 686, 912, 1286, 1808? 2478 What is the next term in 8665, 8660, 8653, 8644, 8633, 8620? 8605 What comes next: -12464, -12466, -12470, -12476? -12484 What is next in 3478, 6956, 10418, 13864, 17294, 20708, 24106? 27488 What is the next term in 334, 351, 362, 355, 318, 239, 106? -93 What is next in -216, -1657, -5570, -13191, -25756, -44501? -70662 What is the next term in 48652, 97305, 145958, 194611? 243264 What is next in -16330, -32653, -48976? -65299 What is the next term in -164, -204, -264, -344, -444, -564? -704 What is next in -12400, -12383, -12366, -12349, -12332? -12315 What comes next: -158590, -317177, -475748, -634297, -792818? -951305 What comes next: -154, -838,	{ "pile_set_name": "DM Mathematics" }
-3, 3p = 8p - 4d - 6 for p. 2 Solve 4h - 6v = -3v - 2, 5h - 7 = -v for h. 1 Solve 2r - t - 24 = 3t, 2r - 3 = -3t for r. 6 Solve 2d - 4q - 10 = -16, -5d + 33 = 2q for d. 5 Solve 5d + 3 = -0d + w, 4w = -5d - 13 for d. -1 Solve m - u = 2, 4 = 2m - 3u - 4 for m. -2 Solve 3w + 31 = -4a, 33a = -3w + 34a - 11 for w. -5 Solve -5r = -3h - 21, h - 5 = r + 5h for r. 3 Solve 0u - 3z = 2u + 2, u + 1 = -4z for u. -1 Solve 0 = j + u + 4, j - 16 = 5u - u for j. 0 Solve t = 2s + 6, -5t - 3s = 6 + 16 for t. -2 Solve 3b - 2k = k, 0 = -4b - 4k for b. 0 Solve -b - 1 = 0, -5h = 2b - 29 + 6 for h. 5 Solve -4o - 3c = c - 28, -o + 3c = 13 for o. 2 Solve 10d + 16 = 6d, 0 = o + 5d + 16 for o. 4 Solve -y - 6f + 9f = 1, f = -3y - 3 for y. -1 Solve 4j + 17 = -389o + 386o, -j = -o + 6 for o. 1 Solve 5y + 0f + 5 = f, -f - 1 = -2y for y. -2 Solve s + 96q = 94q + 12, -16 = 2s - 6q for s. 4 Solve 0 = -4w - 4s - 0 - 28, -4w = s + 19 for w. -4 Solve -f + 29y = 26y + 11, 5f + 3y = 35 for f. 4 Solve 31 = -3i - 2p + 6p, 0 = -3i + 2p - 23 for i. -5 Solve 0 = 2d + r - 2, 3d + 2r = 2d + 4 for d. 0 Solve -4i + 12 = 2n, 2n + 15 = -n + 5i for n. 0 Solve -3q = -2q - 3u - 10, -4q - 28 = 5u for q. -2 Solve 2t = -m + 8, t + 12 = 4t + 2m for t. 4 Solve 10z + 10 = 5c + 9z, 0 = -4c - 4z + 8 for c. 2 Solve -7a + 2a + h - 21 = 0, 5a = -5h - 45 for a. -5 Solve 0 = 5n + 13g - 8g - 15, g - 13 = 4n for n. -2 Solve 4s - 11 = -2u - 35, -3s = -2u + 25 for s. -7 Solve 3r + 3p + 24 = 0, 13p = 4r + 9p for r. -4 Solve 0 = 2z + 18 - 24, -5z + 15 = -2p for p. 0 Solve 2p - t = 0, -5p + 9 = 100t - 98t for p. 1 Solve 4t - 2t - 11 = x, 5t + 2x = 23 for t. 5 Solve -5o - 3b = 0, 5o = 2o + b for o. 0 Solve 5 = o + 5i, 10 = 2o - 4i + 6i for o. 5 Solve -28c + 23c + v = 1, -5c - 5v - 25 = 0 for c. -1 Solve -f = 4j - 2f - 7, 0 = -4j + 4f + 4 for j. 2 Solve 2u = b - 4b - 9, 16 = -4u - 4b for u. -3 Solve 0 = -x + h - 1, -3h = -3x + 6x - 15 for x. 2 Solve -p + 10k - 9k - 3 = 0, -p - 12 = -4k for p. 0 Solve 5v - 3r = 3, v - r - 2 + 1 = 0 for v. 0 Solve -3k - 2k - 11 = -n, 5k + 13 = 3n for n. 1 Solve -9f - 2m - 14 = -14f, -6 = f + 4m for f. 2 Solve 2v = 2x + 8 - 0, 2x = 2 for v. 5 Solve -5k = 4q - 98 + 107, -3k = -5q - 2 for k. -1 Solve -3s + 3d - 6 = 0, -4d = 66s - 63s - 8 for s. 0 Solve 5r + 3 = -2a - 1, -5r - 4a = 8 for r. 0 Solve -2b = 0, -3l + 61b - 58b = -9 for l. 3 Solve 5c + 4t + 24 = 0, 13c - 9c - 4t = -12 for c. -4 Solve 2d = -2w + 4, -6 = -2w + 19d - 22d for w. 0 Solve -5j = 4t - 45, 0 = 6j - 2j - 4t for j. 5 Solve -2q + 4c + 14 = 8c, -4c = -q - 5 for q. 3 Solve 27 = -2s + 5y, 17 - 42 = -5y for s. -1 Solve -5f = -4d + 24, -31d + 35d + 3f + 8 = 0 for d. 1 Solve -4o = 4x + 8, 5x + 2o - 7 = -2 for x. 3 Solve r + 5 = -4a, 10 - 9 = r - 2a for r. -1 Solve q = -2m - 12, -18 + 2 = -2q + 4m for q. -2 Solve 0 = 7g - 2g - t + 28, -3t + 34 = -5g for g. -5 Solve -5m + 3n = 23, m + 6n - 4n + 2 = 0 for m. -4 Solve 0 = -5o - 3r + 5 - 22, -5r - 11 = 4o for o. -4 Solve 3u = 2u + 3h + 11, u - 4h - 15 = 0 for u. -1 Solve -5v + 18r = 15r - 2, -3v = -3r - 6 for v. -2 Solve 3l - 5y = -4y + 10, 2y + 12 = 4l for l. 4 Solve 0 = 4o - 0s - s - 3, -2s = -3o + 6 for o. 0 Solve 4s = -5k - 12, -5k + s - 28 = -3s for k. -4 Solve 4b - 5w = -9, b - 1 = 4w - 17 for b. 4 Solve -z + 2 = 0, -3m + 3z = -2m + 7 for m. -1 Solve 0 = -4t - 12, 5v + 1 = -0t + 3t for v. -2 Solve -2d = 2m + 2d + 16, 20 = -5d for m. 0 Solve 0 = -t - 5l - 17, 2t + 4l + 2 = -14 for t. -2 Solve -3l + o = 7, -6l + 11l - 4o = 0 for l. -4 Solve y + 13 = -d + 5, 0 = -5y - 30 for d. -2 Solve 3r - 4 = -4g - 3, -11g - 10 = 4r for r. 3 Solve f - 3 = -0w + w, -3w - 3f = 3 for w. -2 Solve -3n - 3v + 9 = 3, 2n - v + 5 = 0 for n. -1 Solve 3z - z + 15 = -5i, -i - z = 0 for i. -5 Solve -4v - 4z - 13 = -25, 5z + 15 = v for v. 5 Solve -3c + 2w = -7, -56c = -51c - w for c. -1 Solve 2j + 1 + 7 = 4v, -3v - j + 6 = 0 for v. 2 Solve 0 = -3o + 2v - 12, 19o = 21o + 3v - 5 for o. -2 Solve -o = -0u - 3u - 2, -2o - 16 = 4u for u. -2 Solve 2i + 0 + 2 = -2h, 4h = 2i - 16 for i. 2 Solve 3u - 6 = 0, -3l + 2l - 2 = u for l. -4 Solve 3j + 3a - 21 = 0, -8 = -4a + 12 for j. 2 Solve 2y = -5r - 10, -20 = 2r + 3r for y. 5 Solve -5d - 2x - 5 - 5 = 0, 0 = -3d + 3x - 27 for d. -4 Solve -25 + 16 = 3d + 3p, 4d + 3p = -12 for d. -3 Solve 5z + 23h - 28h = 0, 3z - h = -2 for z. -1 Solve -9m = -2i - 13m, -i = -4m - 6 for i. 2 Solve 4r - 42 = -w - 34, -3w + 4r + 8 = 0 for w. 4 Solve -h - 2 - 12 = 5z, 4 = -2z - 2h for z. -3 Solve -5f = -4v - 4f + 4, 2v = 5f - 16 for v. 2 Solve 2g + 2a = -18, -2g = -5g + a - 11 for g. -5 Solve 0s - 3s - 6 = -3t, -4t = s - 13 for t. 3 Solve 6 = 3k + 189d - 192d, 0 = k - 4d - 14 for k. -2 Solve 4q - m - 4 = 5q, -3m - 12 = 0 for q. 0 Solve v - 4j = -8, 4v - 3j + 7 = -12 for v. -4 Solve 4d - 6 = m, 0m = 3m + 5d + 1 for m. -2 Solve 0 = -5n - 2y - 15, -3y - 5 = 2n + 2n for n. -5 Solve -n - 11 = -5h - 7, 0 = 4h - n - 4 for h. 0 Solve 65z - 8 = -2v + 64z, -3v = -2z - 5 for v. 3 Solve 5w - 12i - 20 = -7i, -12 = -w + 3i for w. 0 Solve 27j - 31j + 3y = 5, j - 10 = 3y for j. -5 Solve -5x + 30 = -5b, -5x - 4b + 40 = 37 for x. 3 Solve -3v - 19 = -2y, v + 4y = 4v + 29 for v. -3 Solve 5f = 8b - 4b + 20, 5b - 4f + 16 = 0 for b. 0 Solve -4p + x + 7 = 0, 61x - 3 = p + 56x for p. 2 Solve 3u = -3c + 7u + 20, -5u - 40 = 0 for c. -4 Solve -2w = 5u + 23, -2u + 8 = -4u - 2w for u. -5 Solve u - 2v = 4u + 10, -2u + 4v + 20 = 0 for u. 0 Solve 0 = -3x + 4j + 6 - 2, -x = 3j + 3 for x. 0 Solve 4u - 2f - 17 = 7u, 4f + 24 = -4u for u. -5 Solve 20m = 25m, 6 = -3y + 4m for y. -2 Solve 4s = -5t + 9, 0 = 3t - 18 + 3 for s. -4 Solve 0 = 3g - y + 8, -g = -3g + 4y - 2 for g. -3 Solve 0 = 2a - 4j + 8, 3 = 3a - 10j + 9j for a. 2 Solve 4c - 21 = -d, 2c - 4c - 3d = -23 for c. 4 Solve 0 = 4h - 20, 3k - 30h - 2 = -28h for k. 4 Solve -24 - 1 = -5u, -3u + 11 = -2m for m. 2 Solve -5r = 5i + 2 + 8, 5 = 5r for i. -3 Solve -5r + 4k = 1, 2k - 3k = -5r - 4 for r. -1 Solve -4o = -4t - 4, 2o - 22 = -28 for t. -4 Solve 81p - 4c + 13 = 82p, 3c = -2p + 16 for p. 5 Solve -w + 2w = -2p + 1, -2w + 6 = 0 for p. -1 Solve -2p + 59v = 54v + 10, 0 = -p - v - 5 for p. -5 Solve 42g - 20 = 47g - 2t, -4g + t = 13 for g. -2 Solve -3q = 2p + 10, 0 = -p + q - 5q - 10 for p. -2 Solve b - 4b + 3a - 6 = 0, 2b = -5a - 18 for b. -4 Solve 0 = -4a + 4b - 24, -2b - 3 - 10 = 3a for a. -5 Solve -3l + 5u - 45 = 0, -5l + 2l - 4u + 9 = 0 for l. -5 Solve -5y = -10, -5y + 2 + 4 = -2k for k. 2 Solve -5d = 3f + 28, -5f + 5d + 139 - 119 = 0 for f. -1 Solve 2r = -3s - 9, 4s - 5r + 5 + 7 = 0 for s. -3 Solve 6 = -4o + 5b, -5o + 4b - 37 + 25 = 0 for o. -4 Solve 0 = -66u + 70u + y - 9, 5u - 2y - 8 = 0 for u. 2 Solve w = 2, 115w = -2y + 112w for y. -3 Solve j + 4 = 4j + 2d, 3d = -3j + 9 for j. -2 Solve -o + 2 = 3o + 2b, -4o = -b + 13 for o. -2 Solve 0 = -5m + 3y, 5m - m = -2y for m. 0 Solve b = 3i + 1, -8i = 3b - 13i - 7 for b. 4 Solve -5t - x - 23 = 0, 41x - 43x + 2 = -2t for t. -4 Solve 19b = -5o + 24b + 5, 5o = -2b - 2 for o. 0 Solve -5p = -7x + 9x - 13, 0 = x + 4p - 11 for x. -1 Solve 43u = 42u + 2, z + u = 0 for z. -2 Solve v - 2w + 6 = -9, -w - 5 = 2v for v. -5 Solve -608f - 14 = -612f - 3t, 4t + 8 = 0 for f. 5 Solve 3i = -3, 0 = 2g - 6g + 5i + 21 for g. 4 Solve -t = -5i + 22, -10t + 2 = i - 9t for i. 4 Solve 0 = -4b + 5t - 30, -b + t - 3t = -12 for b. 0 Solve 4l - 3l + 9 = 4w, -4w - 6 = 2l for l. -5 Solve -6 = 2k, 2k - 5 - 4 = 5n for n. -3 Solve 0 = -q + l + 10, -2q = -25l + 28l + 5 for q. 5 Solve -3q = 7z + 16, -5q = 3z - 8z + 10 for q. -3 Solve 0w = 2i - w - 9, 0 = -2i - 5w - 9 for i. 3 Solve t - x - 5 = x, 3t = -2x - 17 for t. -3 Solve -a = -4c - 19, 31 = -2c + 21 for a. -1 Solve -4q + 2 = 14, -5g - 4*q	{ "pile_set_name": "DM Mathematics" }
m iieiiiiiieeiiii. Give prob of picking 2 i. 22/35 Three letters picked without replacement from juxhu. Give prob of picking 1 u, 1 x, and 1 j. 1/5 Calculate prob of picking 1 j and 1 c when two letters picked without replacement from {t: 1, j: 1, y: 1, n: 1, c: 1}. 1/10 Calculate prob of picking 1 b and 1 t when two letters picked without replacement from tttbattttatbtt. 20/91 What is prob of picking 1 g, 1 h, and 1 i when three letters picked without replacement from {n: 1, h: 2, g: 4, y: 4, i: 8}? 64/969 Two letters picked without replacement from {t: 7, r: 1, o: 5}. Give prob of picking 2 t. 7/26 Calculate prob of picking 4 g when four letters picked without replacement from {g: 4, t: 1, h: 3}. 1/70 What is prob of picking 1 n and 1 f when two letters picked without replacement from {n: 8, q: 1, u: 1, f: 2, d: 4}? 2/15 Calculate prob of picking 1 y, 1 n, and 1 t when three letters picked without replacement from yyidtitcinyct. 9/286 Four letters picked without replacement from izizziziziiizzizzi. What is prob of picking 3 z and 1 i? 21/85 What is prob of picking 2 j when two letters picked without replacement from {b: 6, j: 2}? 1/28 Three letters picked without replacement from pppppppllppppppllppl. What is prob of picking 3 l? 1/114 What is prob of picking 2 f and 2 r when four letters picked without replacement from {r: 6, v: 3, k: 2, f: 5, s: 1}? 15/238 What is prob of picking 1 t and 1 c when two letters picked without replacement from {z: 4, k: 4, o: 2, f: 6, c: 2, t: 1}? 2/171 What is prob of picking 3 w when three letters picked without replacement from wwwwwww? 1 Three letters picked without replacement from hbhhdhhhhhhhhh. Give prob of picking 1 b and 2 h. 33/182 Four letters picked without replacement from xxvxvfvvxvxfv. Give prob of picking 2 f and 2 v. 3/143 Two letters picked without replacement from xbsxxzmmsdsz. Give prob of picking 1 m and 1 d. 1/33 Four letters picked without replacement from {z: 4, r: 14}. What is prob of picking 2 r and 2 z? 91/510 Two letters picked without replacement from umdsskusduudsu. What is prob of picking 1 d and 1 s? 12/91 What is prob of picking 3 e when three letters picked without replacement from ejvejvjje? 1/84 Four letters picked without replacement from bxxxxxxxxbxxx. Give prob of picking 3 x and 1 b. 6/13 Calculate prob of picking 1 o and 2 m when three letters picked without replacement from mmommmmmmom. 24/55 Calculate prob of picking 3 s and 1 l when four letters picked without replacement from sshmshhsmshll. 4/143 What is prob of picking 2 r and 1 t when three letters picked without replacement from ddrrrddt? 3/56 Three letters picked without replacement from {x: 5}. What is prob of picking 3 x? 1 Calculate prob of picking 1 j and 2 z when three letters picked without replacement from {j: 7, z: 3, r: 4}. 3/52 Calculate prob of picking 1 o and 3 i when four letters picked without replacement from {i: 4, z: 3, o: 1, p: 3}. 2/165 Four letters picked without replacement from ttltbjtlttjlblbtlujt. Give prob of picking 3 t and 1 u. 56/4845 Two letters picked without replacement from fuuff. What is prob of picking 2 u? 1/10 What is prob of picking 1 f and 1 i when two letters picked without replacement from {f: 10, i: 2, z: 4}? 1/6 Three letters picked without replacement from vkktkkvtkkkv. What is prob of picking 2 k and 1 t? 21/110 Calculate prob of picking 1 j and 2 a when three letters picked without replacement from zjzebjzjjbzzjazabe. 5/816 Four letters picked without replacement from {z: 2, w: 2, s: 2, g: 2}. What is prob of picking 2 s and 2 g? 1/70 Four letters picked without replacement from {c: 8, n: 2, u: 8}. What is prob of picking 3 u and 1 n? 28/765 Calculate prob of picking 2 b and 1 y when three letters picked without replacement from yybyyyybbbyyyy. 15/91 Calculate prob of picking 3 e when three letters picked without replacement from eedeeeee. 5/8 Calculate prob of picking 1 a, 1 r, and 2 s when four letters picked without replacement from {a: 2, m: 3, s: 3, t: 1, r: 1, y: 2}. 2/165 Two letters picked without replacement from idiu. Give prob of picking 1 i and 1 d. 1/3 Calculate prob of picking 4 r when four letters picked without replacement from {h: 15, r: 4}. 1/3876 Calculate prob of picking 2 r when two letters picked without replacement from {r: 3, f: 13}. 1/40 Four letters picked without replacement from {s: 7}. Give prob of picking 4 s. 1 Two letters picked without replacement from ucisiicccuiciuicscic. Give prob of picking 1 c and 1 s. 8/95 Two letters picked without replacement from kdkkkkkkdk. Give prob of picking 2 d. 1/45 Calculate prob of picking 1 y and 1 v when two letters picked without replacement from {v: 3, d: 1, y: 3}. 3/7 Calculate prob of picking 3 w when three letters picked without replacement from wwwj. 1/4 What is prob of picking 1 k and 1 s when two letters picked without replacement from ssqsksqys? 5/36 Two letters picked without replacement from {y: 4, k: 5, a: 3}. Give prob of picking 1 y and 1 a. 2/11 What is prob of picking 2 q and 1 x when three letters picked without replacement from grqqqrrrgrgrrrrxxqr? 4/323 Four letters picked without replacement from erbbqbrbrebq. What is prob of picking 2 e and 2 q? 1/495 Two letters picked without replacement from sxvkvk. What is prob of picking 1 s and 1 k? 2/15 Calculate prob of picking 1 k and 1 x when two letters picked without replacement from {b: 1, p: 10, x: 3, a: 1, k: 2}. 3/68 Calculate prob of picking 4 u when four letters picked without replacement from {s: 2, u: 8}. 1/3 Two letters picked without replacement from {i: 1, k: 12, m: 2, j: 2, t: 2}. What is prob of picking 1 i and 1 k? 4/57 Calculate prob of picking 2 t when two letters picked without replacement from {s: 3, t: 10, m: 5, f: 1, g: 1}. 9/38 What is prob of picking 3 u when three letters picked without replacement from {u: 7, w: 1, g: 7, j: 2, c: 2}? 35/969 Calculate prob of picking 3 v when three letters picked without replacement from {x: 10, v: 9}. 28/323 What is prob of picking 2 b and 2 m when four letters picked without replacement from {b: 2, m: 10}? 1/11 Calculate prob of picking 1 v and 1 w when two letters picked without replacement from {v: 1, i: 1, q: 1, w: 1, f: 1, n: 2}. 1/21 Calculate prob of picking 1 x and 1 h when two letters picked without replacement from hxxsixxxhsiixxxixhh. 4/19 Two letters picked without replacement from {x: 4, a: 3, e: 4, r: 1, o: 1, l: 1}. Give prob of picking 1 a and 1 e. 12/91 Calculate prob of picking 3 q when three letters picked without replacement from qqqq. 1 What is prob of picking 3 e and 1 x when four letters picked without replacement from {e: 3, x: 2, v: 5}? 1/105 Calculate prob of picking 2 s and 1 m when three letters picked without replacement from {m: 2, p: 3, s: 9, r: 3}. 9/85 Two letters picked without replacement from {x: 7, d: 12}. What is prob of picking 2 x? 7/57 Two letters picked without replacement from {a: 1, h: 1, y: 2, z: 2, i: 1}. What is prob of picking 1 a and 1 z? 2/21 What is prob of picking 1 x and 1 s when two letters picked without replacement from {i: 1, d: 2, x: 1, p: 8, e: 3, s: 5}? 1/38 Calculate prob of picking 2 i when two letters picked without replacement from {i: 3, u: 2, b: 4, q: 1, x: 7}. 3/136 Four letters picked without replacement from {n: 4, k: 2}. What is prob of picking 1 k and 3 n? 8/15 Two letters picked without replacement from {x: 3, p: 4, c: 8, b: 1, h: 3}. What is prob of picking 1 x and 1 h? 1/19 Two letters picked without replacement from ezz. What is prob of picking 1 z and 1 e? 2/3 Four letters picked without replacement from bdddwnwlkwkbkbkbd. What is prob of picking 1 d and 3 w? 1/595 What is prob of picking 1 o and 1 q when two letters picked without replacement from qoroqrqq? 2/7 Two letters picked without replacement from bppyy. What is prob of picking 1 b and 1 y? 1/5 Calculate prob of picking 1 k and 2 c when three letters picked without replacement from {k: 5, c: 11}. 55/112 Three letters picked without replacement from ggqqqgxegxxxaggxgga. What is prob of picking 1 x, 1 g, and 1 a? 80/969 Three letters picked without replacement from {t: 4, y: 4, d: 6, u: 1, p: 2}. What is prob of picking 1 p, 1 y, and 1 t? 4/	{ "pile_set_name": "DM Mathematics" }
ors of (2(-16)/96)/(3/(-7362)). 2, 409 Suppose 2g - 11q + 12q = 1354, -5g + 3385 = -3q. Let u = -200 + g. List the prime factors of u. 3, 53 Let s(b) be the first derivative of 74b3/3 - 9b*2/2 - 7b + 1. Let a(w) be the first derivative of s(w). What are the prime factors of a(1)? 139 Let s(b) = -b*3 + 9b*2 + 8b + 23. Let f be s(10). What are the prime factors of (-1472 + -17)(0 + (2 - f))? 1489 Let p = -5049 - -13482. List the prime factors of p. 3, 937 Let f be (-29 + -3 + 1)/(4/12). Let z = f - -157. Let r = 98 - z. What are the prime factors of r? 2, 17 Let t be 1/2 + 5/(-10). Suppose -4o - 21 = -4d - o, -d - o = t. What are the prime factors of d/7 + 1560/35? 3, 5 Let f(i) = -259i*2 + 10i + 54. Let u be f(-4). What are the prime factors of 2(-3)/6u/5? 2, 7, 59 Let l(x) = -64 + x*2 + 38 + 7x + 34. List the prime factors of l(-7). 2 Let u(m) = m*2 - 2m - 7. Let c be u(-3). Suppose -2k + 4 = h, -3k = 5h + c + 7. List the prime factors of (-2)/h0 + 70. 2, 5, 7 Suppose 3f - 864 = -54. Suppose h - f = -9. What are the prime factors of h? 3, 29 Let v(l) = -l3 + 46. Let i be v(0). What are the prime factors of 1307/2 - (-115)/i? 2, 41 Let i = 2732 + -950. List the prime factors of i. 2, 3, 11 Let u = 5301 + 11442. List the prime factors of u. 3, 5581 Let y be (-54 + 26)4/(-7). Suppose yn + 16 = 20n. What are the prime factors of n? 2 Let w(v) = -v*2 - 5v + 1125. Let c be w(0). Suppose -c = -2j - 3p, 7p - 543 = -j + 12p. List the prime factors of j. 2, 3, 31 Let b be (-49)/(-6)(44 - 38). List the prime factors of 19047/b - 4/(-14). 389 Let o be (5/(-5) - -2) + 710. Let w = o + -30. List the prime factors of (254/6)/(-1)(-123)/w. 127 Let c(y) = y3 - 7y*2 + 8y - 4. Let a be c(3). Let q = -36 - a. List the prime factors of -130/25q/3. 2 Let h be (-65)/(-10) - 5/(-10). Let w be (-10)/2h/((-210)/36). What are the prime factors of (-1956)/(-8) + (-3)/w? 2, 61 Let p(s) = 33s - 70. Let y be p(11). Suppose -y = -k - 11u + 6u, -5u + 1217 = 4k. What are the prime factors of k? 2, 7, 11 Let g be 3/(-2)((-320)/(-12))/(-8). Let o(h) = -3 - g - 2 - 18h - 6 - h*2. What are the prime factors of o(-11)? 61 Suppose 186f = 191f + 40. What are the prime factors of f/(-18)-3 - 961/(-3)? 11, 29 Let q(h) = h*2 + 19h + 6056. What are the prime factors of q(0)? 2, 757 Suppose 293n - 297n + 46756 = -2k, 46748 = 4n - 4k. List the prime factors of n. 3, 433 Let h(t) be the third derivative of -t6/60 - t5/12 + t4/12 + t3/2 + 10t*2 - 15. Suppose 4 = -2b - 4. List the prime factors of h(b). 43 Suppose -542700 = 168n - 213n. List the prime factors of n. 2, 3, 5, 67 Let s(j) = j*2 - 31j + 127. Suppose 39b + 213 = 1266. What are the prime factors of s(b)? 19 Let a be ((-15)/15)/(1/5). Let d be (a/15)/((-14)/12 + 1). List the prime factors of 106 - -1 - (d - 6). 3, 37 Let t(y) = y3 + 3y*2 - 11y - 3. Let r be t(-5). Suppose 2c + 8 = -rc. Let i = c + 41. List the prime factors of i. 3, 13 Let f(j) be the first derivative of -j*4/4 - 2j*3 + 9j*2/2 + 14j + 12. Let a be f(-7). Suppose -2k - 3k + 140 = a. List the prime factors of k. 2, 7 Let z(f) = 26f2 + 18f - 15. Suppose -9x = 719 - 791. What are the prime factors of z(x)? 11, 163 Suppose -431k + 444k - 62472 - 476053 = 0. List the prime factors of k. 5, 1657 Let l = 229 - 1433. Let i = l + 92. List the prime factors of (-38)/(-171) - (-3)/((-54)/i). 2, 31 Let j(x) = 5x*2 + 8x + 48. Let s(h) = -h*3 + 3h*2 - 3h + 13. Let g be s(4). List the prime factors of j(g). 3, 13 Suppose -2q = l + 1056, -2q + 0l - 1052 = 2l. What are the prime factors of (0 - q)(8 - 6)? 2, 5, 53 Let l(k) = -2k*3 - 3k*2 + 5k + 3. Let c be l(-3). Let m be (-3)/7 - 152/(-28). Let u = c - m. List the prime factors of u. 2, 5 Suppose -55 + 23 = -8k. Suppose kl + 81 = 3433. List the prime factors of l. 2, 419 Let n(w) be the third derivative of 37w4/24 + 56w*3/3 + 136w*2. What are the prime factors of n(21)? 7, 127 Let q = 35 + -17. Let h be (-6)/(-36) - ((-1617)/q - 0). Suppose 0o = -9o + h. List the prime factors of o. 2, 5 Let a(m) = m3 - 5m*2 + 3m - 15. Let x be a(5). Suppose 3b + 16 + 30 = 4p, x = 5b + 3p + 38. What are the prime factors of 60/18(-12)/b? 2 Let c(u) = -2u*3 + 7u2 - u + 4. Let i(k) = k2 - k - 1. Let t(s) = c(s) + 4i(s). What are the prime factors of t(-4)? 2, 3 Suppose 14w - 12w - g = 20717, 0 = 4w + 5g - 41441. List the prime factors of w. 3, 1151 Let z(t) = -t3 - 2. Let w(f) = f3 - 9f*2 - 14f. Let k(d) = w(d) + 5z(d). What are the prime factors of k(-6)? 2, 307 Suppose -4305 = 240q - 241q - 5j, -12963 = -3q - 3j. List the prime factors of q. 5, 173 Let k be 0 - ((-9)/6)/(9/12). Suppose -4b = -5g + 1882, 4b + 576 = kg - 172. List the prime factors of g. 2, 3, 7 Let r(i) = 1365i2 + 149i - 461. List the prime factors of r(3). 7, 1753 Suppose -37905 + 12645 = -12p. Let b = 3205 - p. What are the prime factors of b? 2, 5, 11 Let d(p) = 2p*2 + 119p - 1709. What are the prime factors of d(20)? 1471 Let w = -53 + 38. Let o(x) = -x*2 - 16x - 17. Let a be o(w). List the prime factors of (-4 - -13)a(-19)/6. 3, 19 Let l be ((-789)/9)/((-9)/243). Suppose -23m + l + 255 = 0. List the prime factors of m. 2, 3, 19 List the prime factors of (1920/256)/((-5)/(-202)). 3, 101 List the prime factors of (-16)/(-10)18/(-54)(-25215)/2. 2, 41 Suppose 150 = 11o - 158. Suppose 33v = ov + 3845. List the prime factors of v. 769 Let r(p) = p + 1. Let m(a) = 2a + 2. Let c(f) = -m(f) + 3r(f). Let s be c(-4). List the prime factors of 98 - (s - 6/(-3)). 3, 11 List the prime factors of (-5535)/1(7 + 1 + -9). 3, 5, 41 Let d(x) = -23x*2 + 4x - 5. Let a be ((-18)/27)/(4/(-6)). Let f be d(a). Let g = 145 - f. What are the prime factors of g? 13 Let h(j) = 49j - 101 - 173 - 79j - 49j + 61. What are the prime factors of h(-12)? 3, 5, 7 Let l(b) = b3 - 14b*2 + b + 17. Let i be l(14). Suppose 0 = 37u - iu - 18. List the prime factors of 2436/18 + u2/9. 2, 17 Suppose 3n = 8n, 0 = 2i + 5n + 2352. Let c = i - -1785. What are the prime factors of (-5 - c)1/(-2)? 307 Suppose 5i - 7i = 120. Let l(u) = 2u*2 + 28u - 6. Let y be l(-13). Let s = y - i. What are the prime factors of s? 2, 7 Suppose -2 = -2p, -8a = -3a - 5p - 1335. Let d = a - 88. What are the prime factors of d? 2, 3, 5 Let i be (4/3)/(12/9). Let x = i - -6. Suppose -xu + 475 = -2u. What are the prime factors of u? 5, 19 Let b = -48 + 48. Let m be 2/(-4)(-6 + b). Suppose 4v - w - 199 = 0, -mw + 263 = 4v + 44. What are the prime factors of v? 3, 17 What are the prime factors of (-54775)/(-105)78/10? 13, 313 Suppose -m = -4, -40l + 2m = -45l + 45633. What are the prime factors of l? 5, 73 Let q be (11/2)/((-2)/(-4)). Let m = q + -19. List the prime factors of m/10 - 2233/(-35). 3, 7 Let c be (33/(-44))/(-11/4). Let t be (c/(-2))/(-1) - 16289/(-182). Let i = t + -18. What are the prime factors of i? 73 Let w = 2661 - 2368. What are the prime factors of w? 293 Suppose 4f + 738 = 2p, -3p - f = 4f - 1151. Suppose 4g + p = 1365. What are the prime factors of g? 13, 19 Let d(k) be the second derivative of -3k5/5 + k4/12 - 7k*3/6 - 10k*2 - 5k + 8. List the prime factors of d(-5). 2, 5, 7, 11 Suppose 114a = 18a + 130944. List the prime factors of a. 2, 11, 31 Let o(w) = w*3 + 8w*2 - 10w - 2. Let v be o(-9). Let b(j) = -2j + 8. Let l be b(v). Let x(q) = q2 - 8q - 4. List the prime factors of x(l). 2, 5 Let r = -16301 - -23894. What are the prime factors of r? 3, 2531 Suppose -4x - 80 = -4i, -5i + 14 = -2x - 38. Let w(y) = 5y - y3 + 11 - 10y*2 + 11y - 5y2. What are the prime factors of w(x)? 11 Let b(w) = w3 - w2 - 9w + 5. Let a(z) = 2z - 50. Let n be a(30). What are the prime factors of b(n)? 5, 163 Let g = 70 + -70. Suppose 4z - 5z - 2z = g. Suppose z = 6c - 1003 - 59. What are the prime factors of c? 3, 59 Let w(m) = -m2 - 8m - 9. Let r be w(-6). Let n = -8 - -253. Suppose 2y + x = 220, -3y + rx = -67 - n. What are the prime factors of y? 2, 3 Suppose -3i + 2b = -2714, -2i + 2b + 1796 = -2b. Let k = 1542 - i. What are the prime factors of k? 2, 317	{ "pile_set_name": "DM Mathematics" }
nd c. 11 Suppose 2h + 2b + 4 = 5h, 5b = -10. Suppose h = 5o - 0o - 50. Suppose -20 + 12 = -4a. What is the greatest common factor of a and o? 2 Let w be (34/28 + 33/(-22))-35. Calculate the highest common divisor of w and 10. 10 Let r(d) = -2d2 - 53d - 28. Let l be r(-22). What is the greatest common divisor of l and 30? 10 Let n(b) = b*2 + 9b - 3 + 3b - 6b. Let x be n(-6). Let m(i) = -2i3 + 2i*2 - 4i + 1. Let o be m(x). What is the greatest common divisor of o and 34? 17 Let j be 87/(84/9). What is the highest common factor of 69 and j? 3 Let l be (10/5 - -1) + 205. Calculate the highest common divisor of l and 32. 16 Let w = -292 - -346. Suppose 3d - 17 = 2d + h, -3d + 59 = 5h. What is the highest common factor of d and w? 18 Suppose -2t = 3t - 5f - 185, 4t - 154 = -2f. Suppose 4m + 10 - t = 0. Suppose 2r = 18r - 1008. What is the greatest common divisor of m and r? 7 Let u = 10 - -6. Let p = u + -6. Let f(j) = j2 + 3j. Let g be f(7). What is the greatest common factor of g and p? 10 Let d = -281 + 431. Calculate the greatest common divisor of d and 30. 30 Let t = 70 - 48. Suppose 3g + 3d - 58 = -t, -d = -4g + 58. Calculate the highest common divisor of 154 and g. 14 Let a(v) be the first derivative of -2v3/3 - v2/2 + v - 5. Let m be a(-2). Let s = m + 26. What is the highest common divisor of 84 and s? 21 Let b(u) = 2u + 12. Let r be b(11). Calculate the greatest common factor of 34 and r. 34 Let f = -301 - -457. Let j = f - 74. Suppose -3h = -313 + j. Calculate the greatest common divisor of 11 and h. 11 Let d = 136 + -33. Calculate the greatest common factor of d and 412. 103 Let w(l) = l*3 + 4l*2 + 4l + 17. Let m be w(-3). Calculate the greatest common factor of 686 and m. 14 Let b = 1 + -1. Suppose 34h - 29h - 55 = b. What is the greatest common divisor of 77 and h? 11 Let u(t) = -2t + 7. Let m be u(-5). Let b = 94 - m. Suppose -5i + 54 = -g, 0i + 30 = 3i - 3g. What is the greatest common divisor of b and i? 11 Let f = -2 + 6. Let c be 241 + (6/27 - 8/36). Suppose -c = -fi + 479. Calculate the greatest common divisor of 20 and i. 20 Let x(k) = 3k - 153. Let z be x(0). Let d = z - -293. What is the greatest common factor of 28 and d? 28 Suppose 3t - 7t + 80 = 0. Let g be t/10 + -1 + 3. Suppose -2j + 4a = -214, 0 = -j + ga + 152 - 55. Calculate the greatest common divisor of j and 13. 13 Let d(m) = m*2 - 28m - 42. Let c be d(35). Calculate the highest common divisor of c and 7. 7 Suppose 378 - 63 = 5a. Let u = -1841 + 1850. Calculate the greatest common divisor of u and a. 9 Let w = -1 + 16. Let n = 20 - w. Suppose 5h - 2a = 20, 3 = 2h - 4a - n. Calculate the greatest common divisor of h and 20. 4 Let h(a) = a3 + 10a*2 + 7a - 11. Let w be h(-9). Suppose -wy = -59 - 18. Let n = 99 - 33. Calculate the greatest common divisor of y and n. 11 Let j(q) = -2q + 34. Let k be j(16). Suppose -a - 2g + 219 = 0, 0 = 3a + kg - g - 672. What is the greatest common divisor of a and 15? 15 Let r be -2 - (314 - (5 + -2)). Let b = r - -49. Suppose 3n + 2n = -25, 0 = 2g - 2n - 186. What is the greatest common factor of g and b? 8 Let h(a) = 6a2 + 7a + 8. Let o be h(-6). Suppose 2f - 51 = 1. Calculate the greatest common divisor of f and o. 26 Let b(w) = -w3 - 30w*2 + 62w + 32. Let a be b(-32). What is the highest common divisor of a and 128? 32 Let d(b) = -2b3 + b2 + 3b + 4. Let w be d(-4). Let j be 10/(-4)34/(-5). Calculate the highest common factor of w and j. 17 Let f be (-1 + 0/(-1))-40. Suppose 0 = -14j + 153 + 407. Calculate the highest common factor of j and f. 40 Let i(z) = z3 + 7z*2 - 19z + 8. Let t be i(2). Calculate the greatest common factor of 750 and t. 6 Let q(m) = 89m2 + 7m + 9. Let c be q(-1). Calculate the greatest common factor of 65 and c. 13 Suppose 2o = -18y + 20y + 242, -141 = -o + 5y. Calculate the greatest common factor of 87 and o. 29 Let w = -5 + 5. Suppose 0v + 4v - 72 = w. What is the greatest common factor of 6 and v? 6 Let i be (72/10)/9 + 371/5. What is the highest common factor of 825 and i? 75 Let b(j) = -2j3 - 3j - 1. Let s be b(-2). Let d = 21 - s. Suppose 3 = -3v, 2r + dr = 2v + 14. Calculate the highest common divisor of r and 2. 2 Suppose 0 = 5a - b - 249, -63 = -2a + 2b + 35. Let g(w) = 2w - 6. Let y be g(4). Let r = 7 - y. What is the highest common divisor of a and r? 5 Let a be 7(-10)/(-70) - -284. Let o(k) = -4k - 5. Let g be o(-5). Calculate the greatest common divisor of a and g. 15 Let x(i) = -8i + 3. Suppose 0 = -5z + 4g + 10, z + 3z - 4g - 12 = 0. Let m be x(z). Calculate the greatest common factor of 209 and m. 19 Suppose 73t - 79t + 570 = 0. What is the highest common factor of t and 55? 5 Let s be 80/(-30)6/(-4). Let a(c) = c*2 + 3c. Let m be a(-7). Calculate the highest common divisor of s and m. 4 Let x(p) = -6p - 16. Suppose 3z - 13 - 2 = 0. Suppose -3i - 3g = 30, 0 = zi + 4g + 45 + 2. Let w be x(i). Calculate the highest common factor of 39 and w. 13 Suppose p - 9 = -2p. Let k = -24 + 28. Suppose pu - k = -u. Calculate the highest common factor of 6 and u. 1 Let p be (-72303)/(-539) - 24/21. Calculate the highest common factor of 2660 and p. 133 Suppose 5p - 415 = -5n, -p - 10n + 13n = -63. What is the greatest common factor of p and 117? 39 Suppose 1292 = -44b + 46b - f, -5b + 3230 = f. Calculate the greatest common factor of b and 38. 38 Suppose 0 = -2v - 4q - 47 + 367, -3v - 5q + 482 = 0. Calculate the greatest common factor of 1681 and v. 41 Let k be (-10)/(-12) + 11/(66/343). What is the greatest common divisor of 725 and k? 29 Let s(v) = 77v*3 - 3v*2 + 15v - 12. Let k be s(1). Suppose 0 = -2b - 3b - 2w + 25, -w + 23 = 4b. Calculate the greatest common divisor of b and k. 7 Suppose 0 = -4j - 3k + 51, -j + 24 = 30k - 33k. Calculate the greatest common factor of j and 75. 15 Let t be (2/(-4))/((-6)/4428) - -3. Calculate the highest common factor of 12 and t. 12 Let u(z) = 24z2 + 9z + 53. Let s be u(7). What is the greatest common divisor of s and 19? 19 Suppose -4n - 157 = -1217. Let z be 2 + (0 - 0 - -333). Suppose -n = -5p + z. Calculate the highest common divisor of p and 24. 24 Let k = 25 + -20. Suppose ki - 90 = -i. Let j(t) = 26t - 3. Let f be j(3). What is the highest common divisor of i and f? 15 Let b be -57/(-70)80/2. Calculate the greatest common divisor of 150 and b. 10 Suppose 0 = 5u - 15 + 5. Suppose 5 = 3x - q - 0q, 3x + 5q = 29. Suppose 0 = xb - b - 4. What is the highest common divisor of b and u? 2 Let j be (204/8)/((-1)/2). Let f = -26 - j. Suppose 0 = -5o - 3m + 1390, 4o - o = 2m + 815. Calculate the highest common divisor of f and o. 25 Suppose 4z = 8z - 168. Suppose -5r + 2s + 2304 = -0s, -3r - 5s + 1401 = 0. What is the greatest common factor of r and z? 42 Let t(v) = 73v + 3. Let w be t(3). Suppose -6 = 3n - 5n. Suppose w = ny - 3z, 4y - 199 = -4z + 65. What is the highest common factor of 28 and y? 14 Let n(f) be the first derivative of f*4/4 + 2f3 + f2 - 9f - 6. Let x be n(-5). Suppose 2u - 72 = -2u. What is the greatest common factor of u and x? 6 Let d be (2 - 0/(-3)) + 2. Suppose p + 3a - 4 = 0, 0p + dp = -3a + 7. Let s be (p/(-1))/(5/(-145)). Calculate the greatest common factor of 319 and s. 29 Let t be (-9)/3 - (-2 - 5). Let x be (t + 21)10/25. Suppose 0 - 330 = -3c. What is the highest common factor of x and c? 10 Suppose 0x = 3x - 132. Suppose 4v - 20 - x = 0. Let h = 77 + -29. Calculate the greatest common divisor of h and v. 16 Let d = 55 - 19. Let h be -2 - ((-12)/4 + -23). What is the highest common divisor of h and d? 12 Let a(j) = j*2 - 7j - 6. Let i be a(-2). Calculate the highest common factor of i and 52. 4 Let o(k) be the second derivative of k*3/6 + 25k*2/2 - 8k. Let x be o(-8). Suppose -5z = -10z + 595. Calculate the highest common divisor of z and x. 17 Let t = -707 + 715. Calculate the greatest common divisor of 156 and t. 4 Suppose 2b - 168 = -4t - 18, -279 = -4*b - t. What is the greatest common factor of 115 and b? 23 Let r be 4 - (-5 - -1 - -4 - 136). Calculate the highest common factor of r and 60. 20 Let q	{ "pile_set_name": "DM Mathematics" }
t(77)/(sqrt(847) - ((sqrt(847) - sqrt(847)-2) + sqrt(847))))2 + -3. -296/99 Simplify ((2(sqrt(252) - (sqrt(252) - sqrt(252)-1)))2 - sqrt(252))-1 - ((sqrt(112) + -1 - sqrt(7))*2 + ((-1sqrt(49))/sqrt(7))*2). -1079 + 12sqrt(7) Simplify -4((sqrt(13) + -2 + sqrt(13))2 + 0) - (5 + 4 + -2 + sqrt(13))2. -286 + 18sqrt(13) Simplify ((-1-1sqrt(56))/(sqrt(8)-52))*2. 7/100 Simplify -4(-1 + (-4 + sqrt(13))*2 - (sqrt(130)5)/sqrt(10)). -112 + 52sqrt(13) Simplify ((sqrt(405) - sqrt(405)1) + -2 + sqrt(405) + sqrt(40)/(sqrt(8)-1-5))*2. -184sqrt(5)/5 + 2136/5 Simplify -5 + (6-1sqrt(405) - ((sqrt(5) + 0)3 + sqrt(10)/sqrt(2) + 5)). -58sqrt(5) - 10 Simplify (sqrt(68)/(sqrt(16) + sqrt(4)) - ((2sqrt(119))/sqrt(7))2) + 4 + -2sqrt(833). -64 - 41sqrt(17)/3 Simplify ((sqrt(5) - -1sqrt(5)-1) + sqrt(245)-2 + sqrt(245) - (4 + sqrt(125) + 0))*2. 96sqrt(5) + 736 Simplify 1 + -5 + 1(1sqrt(208)6 + sqrt(208)). -4 + 28sqrt(13) Simplify -1(2(1 + sqrt(208)) + sqrt(208) + sqrt(208) + -5(4 + sqrt(208)))2. -532 - 144sqrt(13) Simplify -2(-3sqrt(2835) - sqrt(35))/(sqrt(35)/sqrt(5)1) + -3. -3 + 56sqrt(5) Simplify ((sqrt(88) - (sqrt(88) + -2sqrt(88))-3)-2)/((sqrt(96)/(sqrt(36)/sqrt(3)) + sqrt(8))3). 2sqrt(11)/3 Simplify (4(sqrt(77) + -5(sqrt(77)2 - sqrt(77)) + sqrt(77)))/(sqrt(11) - (sqrt(11) + (sqrt(11) - -2sqrt(99))) - sqrt(44)/sqrt(4)-3). 3sqrt(7) Simplify ((4(sqrt(486) + sqrt(486) + (sqrt(486) - (sqrt(486)-2 + sqrt(486)))) - sqrt(486))/(2sqrt(50)-5))2. 2187/100 Simplify 1 + 3(((-1 + sqrt(1053))-2 - sqrt(1053)) + (1(sqrt(1053) - (sqrt(1053) + 1)))*2). -81sqrt(13) + 10 Simplify 3(-32sqrt(171) + sqrt(2299)2 + 4). 12 + 12sqrt(19) Simplify ((sqrt(252) - (0 + sqrt(252) + sqrt(252)2))-4 + 5 + 0)2. 480sqrt(7) + 16153 Simplify -6((sqrt(891) + -1)2 + (sqrt(22)/sqrt(2) - sqrt(11) - sqrt(11)) + 2 + (-2 + 2 + sqrt(396))2). -7740 + 114sqrt(11) Simplify (sqrt(198)-6)/(-2sqrt(8) + sqrt(8)) + -5. -5 + 9sqrt(11) Simplify -3(-1 + sqrt(931) + -3)*2 - ((3(sqrt(228)-1 - sqrt(228)))/sqrt(12) + -3). -2838 + 174sqrt(19) Simplify (6(sqrt(48)/(sqrt(6)-1))/((sqrt(160)/sqrt(5))/sqrt(8)))*2. 72 Simplify (2-6(sqrt(495) + 2sqrt(495))/(1sqrt(44) + sqrt(11)))2. 6480 Simplify (5(6(sqrt(475) - 3sqrt(475)) + 4) + -2)*2. -10800sqrt(19) + 1710324 Simplify (sqrt(176)/sqrt(2))/(sqrt(72)1 + sqrt(72)) - ((sqrt(11) + sqrt(55)/sqrt(5) + -4)2 - (sqrt(66)-3)/sqrt(6)). -60 + 79sqrt(11)/6 Simplify ((sqrt(9) + (sqrt(9) + sqrt(27)/sqrt(3))-1)/(sqrt(12)2))26 + 0. 9/8 Simplify (sqrt(1053) + sqrt(1053) + sqrt(1053)3 + -3)2 - -6(sqrt(39)/(sqrt(3) + sqrt(3) + sqrt(108) + sqrt(3)))*2. -270sqrt(13) + 711044/27 Simplify (sqrt(40) + 3(sqrt(40) - -2sqrt(40)) + sqrt(80)/sqrt(2)-1)/(sqrt(128)/sqrt(4) - sqrt(24)/(1sqrt(3))). 9sqrt(5) Simplify ((1sqrt(2000) - (sqrt(720) + 0)) + (-2sqrt(120))/sqrt(6)-1)*2. 720 Simplify (-4(2sqrt(208) - sqrt(208)) + 3sqrt(13)-2 + -2sqrt(468))*2. 15028 Simplify (432(2(sqrt(684) + -1) + -1 + sqrt(684) + 4))2. 20736sqrt(19) + 3546432 Simplify (-5(-1(0 + sqrt(7) + 4 + sqrt(7)1-4)-1 + 1))2. -750sqrt(7) + 2200 Simplify 2 + sqrt(39)/(1sqrt(3))-5 + 4 + sqrt(468)-2. -17sqrt(13) + 6 Simplify (-1(2sqrt(252) + 1 - sqrt(252))-1-1)*2. 12sqrt(7) + 253 Simplify 3(21sqrt(143) + -1(-1sqrt(143) - sqrt(143) - sqrt(143)))/(-1sqrt(99)-4). 5sqrt(13)/4 Simplify (sqrt(192) - sqrt(192)-2)2 + 4 - (1(-1 + sqrt(108)))*2. 12sqrt(3) + 1623 Simplify 3(((sqrt(162) - (sqrt(162) + 0 + sqrt(162)))-2 - sqrt(162))*2 + (sqrt(162) - (sqrt(162) - sqrt(162)4)-6)2)-4. -563760 Simplify (((5-4sqrt(95) - sqrt(95)) + sqrt(95))-6)/(sqrt(605) - (sqrt(605)-2 + sqrt(605))5). 20sqrt(19)/11 Simplify ((4sqrt(110)-3)/(4sqrt(60)/sqrt(6)))2-3 + 4. -293 Simplify sqrt(30)/(sqrt(72)/(sqrt(48)/sqrt(4))) - sqrt(30)/(sqrt(96)-1). 5sqrt(5)/4 Simplify ((-5 + 2sqrt(57)/sqrt(3))-4 + 42sqrt(475)3)2. 4480sqrt(19) + 238736 Simplify 4 + (2sqrt(114))/sqrt(6) - -5sqrt(190)/(sqrt(40)/sqrt(4)). 4 + 7sqrt(19) Simplify (1(6sqrt(3)1 + sqrt(3) - -4sqrt(75)))2. 2187 Simplify ((1sqrt(50))/sqrt(5) - -4sqrt(10)-2)/(-3sqrt(4)/sqrt(2)4) + -5. -5 + 7sqrt(5)/12 Simplify 1 + ((-3 + sqrt(52) + 2-3sqrt(13))2)*2. 96sqrt(13) + 869 Simplify -4(3(53sqrt(108)/sqrt(4))*2 + 3). -72912 Simplify 1(sqrt(684) + 0)1 + 3 + (-1sqrt(684) - sqrt(684))*2 + -3. 6sqrt(19) + 2736 Simplify ((3 + (sqrt(637)-3 + 0 - sqrt(637)))2)*2. -672sqrt(13) + 40804 Simplify (sqrt(500)/(sqrt(810) - (-2sqrt(810) - sqrt(810) - sqrt(810)) - sqrt(810)))/(sqrt(50)/(sqrt(5) - sqrt(45)/(sqrt(9)-2) - sqrt(5))). sqrt(5)/72 Simplify (sqrt(60)/(-2sqrt(3)) - -1sqrt(180))/(sqrt(44)/(sqrt(77)/(sqrt(42)/sqrt(6)))). 5sqrt(5)/2 Simplify (-6-65(-4sqrt(2448)-2 - sqrt(2448)))*2. 3886444800 Simplify 4 + ((-4sqrt(1584)3 - -2sqrt(1584)4) + -2)2. 192sqrt(11) + 25352 Simplify 4(1sqrt(117)-3 + (sqrt(637) + (sqrt(637) - (-3 + sqrt(637) + 1 + sqrt(637))))2). -36sqrt(13) + 16 Simplify -2 + 2(-1sqrt(117)-5)/(sqrt(36)/(-1sqrt(4))). -10sqrt(13) - 2 Simplify ((sqrt(40)/(sqrt(18)4))/(-2sqrt(36)5))*2. 1/25920 Simplify (62sqrt(8))/(sqrt(8)/sqrt(162)). 108sqrt(2) Simplify (-1 + 1sqrt(700)-3 + sqrt(700) + ((sqrt(700) - 1sqrt(700)) + sqrt(700) + -1)2)6. -240sqrt(7) + 4200 Simplify (-32sqrt(190)2)/((6(sqrt(70) - -1sqrt(70) - sqrt(70)) - sqrt(70))/sqrt(7)) + -2. -12sqrt(19)/5 - 2 Simplify (-2 + ((sqrt(405) + 2)-3 + 1)-65)*2. 239760sqrt(5) + 3302404 Simplify 6(4 + (-5 + ((sqrt(162)2)*2 - sqrt(162)) + sqrt(162) - sqrt(16)/(sqrt(80)/(sqrt(10) + sqrt(30)/sqrt(3))))). -12sqrt(2) + 3882 Simplify ((sqrt(126) + 1sqrt(126) + sqrt(126) - sqrt(126))4)/(-1sqrt(2)-2)-5. -60sqrt(7) Simplify -32(-4 + sqrt(11) + (sqrt(11) - (1sqrt(11) + sqrt(11))) + sqrt(11))4. -24sqrt(11) + 96 Simplify -5 + (2-2sqrt(99))/((sqrt(9) + sqrt(36)/sqrt(4))-4) + -5. -10 + sqrt(11)/2 Simplify (sqrt(12)/(sqrt(6) - sqrt(486)) + ((sqrt(96)/sqrt(12))/sqrt(4))*2)-3. -6 + 3sqrt(2)/8 Simplify -6-5(-3 + -3(0 + sqrt(891) - sqrt(891))*2). -90 Simplify ((sqrt(144)/(-1sqrt(9)))/sqrt(4))/(4(sqrt(10)2)/sqrt(5)). -sqrt(2)/8 Simplify sqrt(114)/sqrt(24) + -3sqrt(76)/sqrt(4) + ((sqrt(95) + sqrt(95)1)-3 - sqrt(95) - sqrt(95) - sqrt(95))/sqrt(5). -23sqrt(19)/2 Simplify (3-3sqrt(91)5)/((sqrt(343)-2 - sqrt(343))-4). -15sqrt(13)/28 Simplify 0 + 1sqrt(28) - (4(sqrt(112)-3 - sqrt(112) - sqrt(112)) - sqrt(112) - sqrt(112))2. -54208 + 2sqrt(7) Simplify (-2(-5 + sqrt(336)/(-2-2sqrt(7))))2. -40sqrt(3) + 112 Simplify ((sqrt(136) - sqrt(136)-1)4)/(2sqrt(648)) + -5 + sqrt(34)/sqrt(2)2 + 5. 22sqrt(17)/9 Simplify -4 + -4 + (4(sqrt(33)/sqrt(3) + 0 - (sqrt(11) - (5 + sqrt(22)/sqrt(2)))))*2 + 2. 160sqrt(11) + 570 Simplify (4(-3sqrt(425)1 + (sqrt(425)-2 + 5 - sqrt(425))))*2. -4800sqrt(17) + 245200 Simplify 1-2(sqrt(143)/((sqrt(132) + 3sqrt(132))/sqrt(12)) + 1)2. -29/8 - sqrt(13) Simplify (-1sqrt(57)/sqrt(3) - -1sqrt(304)) + -4sqrt(76)/sqrt(4) + ((sqrt(304) + 1)*2 - sqrt(19)). 6sqrt(19) + 305 Simplify ((sqrt(40) + sqrt(160))/sqrt(10) + -4sqrt(16))/(sqrt(4)/sqrt(2)2 + 1sqrt(242)) + 0. -5sqrt(2)/13 Simplify (((sqrt(1053) - (-2 + sqrt(1053) + sqrt(1053))) + sqrt(1053))1 + sqrt(1053)-3-5)2 + -2. 540sqrt(13) + 236927 Simplify (1(sqrt(77) + sqrt(77) + (sqrt(77) - (sqrt(77) - 4sqrt(77))) - sqrt(77)))/(sqrt(99)/(sqrt(54)/sqrt(6))). 5sqrt(7) Simplify ((sqrt(27) - (sqrt(432)-3 + sqrt(432)))/(sqrt(108)/(sqrt(12)4)))2. 3888 Simplify ((sqrt(30) - -11sqrt(30)) + sqrt(30))/sqrt(10) - (1 + sqrt(243) + 5 + sqrt(243) - sqrt(243) - sqrt(243))2. -36 + 3sqrt(3) Simplify (2(sqrt(192) + -1) + 6((sqrt(192) - (sqrt(192) + (-3 + sqrt(192) - sqrt(192))) - sqrt(192)) + sqrt(192) + sqrt(192)) + -3)*24. 6656sqrt(3) + 49828 Simplify (-3 + sqrt(343))-6 - ((2sqrt(343)4 - sqrt(343))*2 + sqrt(343)). -16789 - 49sqrt(7) Simplify 0 + (0 + sqrt(700))-6 - (-4 + sqrt(700)-1 + (-2sqrt(700)1)*2). -2796 - 50sqrt(7) Simplify -1((sqrt(171)-11 + sqrt(171))/sqrt(9) + 5((sqrt(57)/sqrt(3) + 4 - sqrt(19)) + sqrt(19)))*2. -875 - 200sqrt(19) Simplify 3 + ((sqrt(182)/sqrt(7) + sqrt(26))/sq	{ "pile_set_name": "DM Mathematics" }
se Suppose 0s + s = 69. Let t = 105 - s. Let k = 197 - t. Is k prime? False Let d(l) = -4 - 4l + 3 + 0l. Let i be d(1). Let z = i + 72. Is z a prime number? True Let n be ((-82)/4)/(9/18). Let b = n - -76. Is b composite? True Suppose 2765 = 21u - 16u. Is u a prime number? False Let h(q) = -299q - 30. Is h(-7) a prime number? True Let w be 2 - (-6 + 3 + -2 + 2). Suppose -wr + 346 = -459. Is r prime? False Let n(l) = -l2 + 11l - 5. Let y be n(10). Suppose 3k - yk + 2098 = 0. Is k composite? False Suppose 0 = 7j - 4j - 6. Is (27/(-27))/(j/(-2758)) a prime number? False Is ((-143)/88)/(-13) - (-64622)/16 composite? True Is (-8)/(-26) - (-17048948)/2132 prime? False Is ((-30)/(-20))/(5/5685806) a prime number? True Suppose 0 = 117q - 122q + 31035. Is q composite? True Let i(p) = p3 - 29p*2 - 87p + 117. Is i(34) composite? False Suppose 2764 = 5d + 5q - 5976, d = 3q + 1744. Is d composite? False Is 49/(-14)(-1 - -3) + 65294 prime? True Let g be (-4 - 0) + (8 - 2). Is (9/27)/(g/11082) a composite number? False Let w be -1(7 + (-2 - 2)). Let h be 2/w(4 + -7). Suppose -2p - 4d + 918 = 0, 3d + 1412 = 3p + hd. Is p prime? False Let a(w) be the second derivative of -41w*3/6 + 4w*2 + 16w. Is a(-7) a composite number? True Let k(i) = -i*3 + 14i*2 + i - 37. Is k(13) a prime number? False Let o(u) = -33u*3 - 27u*2 - 3u + 1. Is o(-4) a prime number? True Let g = 9047 - 3920. Is g prime? False Suppose 50w - 45428 = -4878. Is w a composite number? False Suppose h + 0 = 1. Suppose -q + h = -1. Suppose 5f + 2s = 383, -qf + 159 = -4s - s. Is f prime? False Let o be 1/5 + 1876/70. Let x = 264 + o. Suppose -1467 = -6r + x. Is r a composite number? False Let t be ((-1)/(-4))/((-6)/24). Let s(l) = 9l2 + l + 156l*2 + 3l*2. Is s(t) prime? True Is (-1)/((9/18)/((-17846)/4)) composite? False Let b be (0 - 1)/((-1)/5). Suppose -6l + 26 - 2 = 0. Suppose bf = 2j - 128, 2f + 0 = -l. Is j prime? True Let b be 5(1 + 0 + 0). Let o(t) = 4t - 17. Let c(a) = a - 4. Let n(h) = 9c(h) - 2o(h). Is n(b) a prime number? True Let g(q) = 21q*2 + 12q + 11. Suppose 4f = 7f + 24. Is g(f) composite? False Suppose -t + 1191 = -f, t + 2f = -2f + 1201. Is t composite? False Let r(d) = -3d - 2. Let f be r(-1). Suppose 0 = o - 5 + f. Is ((-53)/o)/(7/(-28)) composite? False Let r(n) = -n3 + 5n*2 - 4n - 1. Suppose 15 = 4h + h. Let u be r(h). Suppose 5k + 4i - 361 = 2k, -uk = 4i - 615. Is k prime? True Suppose -5g = 5n - 195, 0 = 3n - g - 50 - 51. Is (-4175)/5n/(-25) composite? True Let y(s) = -2s3 - 22s*2 - 2s + 2. Is y(-16) composite? True Let b be (-22)/45130/25. Is (-38445)/b - (-4)/26 composite? False Suppose o + 197 + 399 = 0. Let c = 697 - o. Is c a composite number? True Suppose 2a = 7a - 1150. Let q = a + -112. Suppose -3l + s + 133 = -q, -2s = -2l + 170. Is l prime? True Let q be 1360/81/2. Suppose 80k = qk - 1175. Is k composite? True Suppose -5y = 3z - 3 + 12, -4z + y + 11 = 0. Suppose zp = 62 + 16. Is p a composite number? True Let c = 5 - 0. Suppose -2 + 12 = cj. Is 11/22 - (-109)/j a prime number? False Let l(k) = 3k + 2075. Let p be l(0). Is p/35 + (-4)/14 a prime number? True Let s be (-2 - (-3)/3) + -3. Is s - ((-158 - -4) + 4) a composite number? True Let v be (-1)/((-1)/3) + 515. Let x = 1039 - v. Is x a prime number? True Suppose -2k + 2h = -194 - 182, -2h = k - 182. Let t = 715 - k. Is t composite? True Let a be (-2)/(-8)74. Suppose 3j + 664 = o, 0 = 4o - ao - 5j + 1922. Is o a composite number? True Let w = 31 + -31. Is (-1)/(3/(-627) + w) composite? True Let f(r) = r3 - 3r*2 + 2r. Let a be f(2). Suppose -3x - 2j + 1437 = 3j, -j = a. Is x prime? True Let t = 6 + 4. Let r(j) = j3 - 8j*2 - 10j + 9. Is r(t) a prime number? True Let o(v) = 33v2 + 11v + 3. Is o(8) a prime number? True Let g be (-35)/(-11) + 6/(-33). Suppose gl - 7l = -3932. Suppose 176 = -3m + l. Is m a prime number? True Suppose 538p - 519p = 80731. Is p prime? False Let f = -8 - -22. Suppose 7604 = fc + 30. Is c a composite number? False Let j = 44 + 243. Suppose j = y - 566. Suppose -134 - y = -3x. Is x composite? True Let a = 229 - 226. Suppose 2l - s - 449 = 4s, 3s - 937 = -4l. Suppose -aj - j = -l. Is j a prime number? False Suppose 7a - 1200 = 10777. Is a prime? False Suppose -2g = 4m + 1370, -6g = -4m - 4g - 1366. Let j = -223 - m. Is j prime? False Let w(q) = 2q3 - 10q*2 + 10q + 2. Let z be w(7). Suppose -3g = -77 - z. Is g a prime number? False Let q = -958 - -1593. Is -4q/(-10)1 composite? True Let f(p) = 5p - 2. Let h be f(4). Let s be (-4)/(-18) + 8726/h. Suppose 0 = -5j - 0j + s. Is j composite? False Suppose 3l - 38385 = -3w, w - 11374 - 1397 = 5l. Is w a composite number? False Let u = 16093 + -9914. Is u prime? False Suppose 6d = 2d - 56. Let u = -14 - d. Suppose -4i = -0t - 2t - 62, u = -i - 2t + 3. Is i prime? True Let z(u) = 329u - 711. Is z(28) a composite number? False Let d = -8168 + 18277. Is d prime? False Suppose 2z = -3z + 20. Suppose -y - 2q + 7 = 0, 0 = -5q + z + 1. Suppose -2a - 658 = -4x, x + a = ya + 154. Is x prime? False Let q(g) = 22g*2 + 3g - 6. Let r be q(-4). Let i = r + -41. Is i a prime number? True Let t(o) = 44o2 + 2o + 7. Is t(-3) a composite number? False Suppose -3y = g - 85339, g + 57191 = 3y - 28152. Is y composite? False Let q(r) = -8 + 7 - 269r + 19 + 18 + 268r. Suppose -4t + 3j + 75 = 0, -j - 50 = -2t + 3j. Is q(t) composite? True Let b(l) = 71l + 4. Is b(18) prime? False Let r(g) = -23g*2 + 3g + 37. Let c(k) = -69k2 + 7k + 111. Let l(w) = -6c(w) + 17r(w). Is l(-11) a composite number? False Let c(n) = 16n + 34. Let h be c(-9). Let l = h - -1101. Is l a composite number? False Let a = 7825 - 3047. Suppose 2k - 5k + 3583 = -d, 4k - d = a. Is k a prime number? False Suppose 39l = 12l + 1121985. Is l a composite number? True Let i(f) = -3f2 - 4f*2 + 9f*2 - 11f + 13 + 7f2. Is i(6) composite? False Let f = -78 + 125. Suppose -2496 = -4x - 4h, -4h + 686 = x + f. Is x prime? True Let w = 32 + 92. Suppose -r + 5r = w. Is r a prime number? True Suppose -3n = -n - 2. Let m be (-55)/2(n - 11). Suppose -r = -6r + m. Is r composite? True Suppose 6c - 4c + 8 = 0. Is ((-287)/(-3) - (-6 - c))3 a composite number? False Let n(t) = -t3 + 14t*2 + 14t + 16. Let b be n(15). Is (3836/(-4))/(-2 + (b - 0)) prime? False Suppose r - 15420 = -5p, -19r + 21r - 30780 = 2p. Is r prime? False Suppose 2j + 17658 = 5k + 2429, 9153 = 3k + 4j. Is k a prime number? False Suppose 0 = 5r - 45 - 15. Suppose 3f + r = 0, 75 = 3p + 5f - 103. Let o = p - -17. Is o composite? False Suppose 4m - 2382 = -2s + 934, 3s - m = 5009. Suppose 0 = -3n + 369 + s. Is n prime? False Suppose 3518 = -77l + 79l. Is l a composite number? False Let t(g) = -5g3 - 12g*2 - 9g - 3. Is t(-8) a composite number? False Let w = -532 - -1186. Suppose 162 + 166 = 2q + v, 4q - w = -v. Is q a prime number? True Suppose 0 = 29d - 39d + 353630. Is d prime? True Let j = -16 + 20. Suppose 159 = 5m - jm. Suppose 0 = -p - 0p + m. Is p a prime number? False Suppose 0 = -6z + 24 + 78. Suppose 452 = zk - 13k. Is k a composite number? False Suppose -19 - 1 = 4v. Let j be (-13)/(2 - v/(-2)). Let u = -3 + j. Is u prime? True Let v(c) = 14c*2 + 18c - 69. Is v(10) a prime number? True Let q = -4944 + 10915. Is q a prime number? False Let f(t) = -3t - 7 - t2 - 2t*2 + 0t*2 + 4t*2. Suppose -p + 15 = 2i + 4p, 2p - 25 = 3i. Is f(i) a prime number? False Suppose -5v + 3a = 4a + 557, 5v = -5a - 565. Let b = 542 - v. Is b a prime number? True Let u(p) = -p*3 + 6p*2 + 8p - 2. Let g be (0/(-2))/(-2 + 4). Suppose g = -10d + 8d + 12. Is u(d) a prime number? False Let m(f) = -f3 - f2. Let t(x) = 5x3 + 19x*2 + 15x + 26. Let p(l) = -6m(l) - t(l). Is p(15) prime? True Let u(c) = 778c*2 + 4c + 11. Is u(6) composite? True Suppose 0 = 90p - 36p - 181062. Is p a composite number? True Let k = -4938 + 10322. Suppose 2648 = 3q - o - 1380, 2o = -4q + k. Suppose 5g - q - 419 = -3t, -2t = -3g + 1073. Is g a prime number? False Let n(d) = -51d*3 + 2d	{ "pile_set_name": "DM Mathematics" }
0.3 (b) -5 (c) g c Let w = -0.4 - 1.7. Let k = w - -2. Let o = 0.7 + -0.2. What is the nearest to k in o, -1/2, 0? 0 Let k = -287/4 + 72. What is the closest to -1 in k, -2/7, 0.2? -2/7 Let n = 21 + -18. What is the nearest to -3/4 in n, 2/3, -3? 2/3 Let i be (15/(-25))/((-2)/5). Let l = 41 - 699/17. Let n = -23/51 - l. Which is the nearest to n? (a) 0.5 (b) i (c) -1 c Let h(d) = -d - 5. Let y be h(-9). Let c be 1 - (y/(-22) + 1). What is the nearest to 0 in 2/5, 2, c? c Let u = -191/18 - -21/2. Which is the nearest to -2? (a) 2 (b) -3 (c) u b Suppose 0 = 3d - 3t + 12, 5d - 3t = d - 16. What is the closest to -1 in 0, d, 3/8? 0 Let q = 9 - 8.98. Let z = q + -0.01. Let j = z - -0.99. Which is the closest to j? (a) -4/3 (b) -1/9 (c) -5/6 b Let g(k) = k*2 - 8k + 15. Let o be g(6). Let p be ((-1)/(-5))/(o + -4). Which is the closest to -2? (a) -1 (b) p (c) -2 c Let n = 0.43 - -0.07. Let t = 12/23 - 202/299. What is the closest to -0.1 in n, t, -0.2? t Let u = -50 + 61. Which is the closest to 1? (a) 5 (b) 0.2 (c) u b Let x = -0.17 + 1.17. Suppose -2 = 3j - j. Which is the nearest to x? (a) 0 (b) 1 (c) j b Let c = -23/5 + 5. Let r = 6 + -2. What is the closest to -1 in r, c, 0.1? 0.1 Let x = -47/4 + 12. Let z be (-3)/(-12)2194. Let v = z - 482/5. Which is the closest to -3? (a) v (b) x (c) 5 b Let c = 71/2 + -35. What is the nearest to c in 9, -1, 0.2? 0.2 Let o = -14 - -22. Let p = o - 7. What is the closest to -0.1 in p, 1/7, 4? 1/7 Let u be (-1)/3 - 7/24. Let r = 272 + -6529/24. Let o = r + u. Which is the closest to o? (a) 2 (b) -2/7 (c) 0 b Let l(y) = -y2 + 11y + 4. Let f be l(12). Let r = f + 7. Let z be (r - 2) + (-74)/(-24). What is the closest to 0 in -0.2, -0.3, z? z Let p = 1.5 - 6.5. Let d = -6/7 - -44/35. Which is the closest to d? (a) -0.5 (b) 1 (c) p b Let y be -1 - ((-54)/14)/3. What is the closest to 2/3 in 1/5, y, -1? y Let o(s) = -2s2 + 6s - 2. Let c be o(4). Let j be (4/(-5))/(2/c). Let h be j/(-14) - 57/21. What is the closest to 1 in h, 0.4, 0? 0.4 Let g be -4 + 2 - (-7)/2. Let d = -8.3 - -1.3. Let m = 6.7 + d. What is the closest to -1 in -5, g, m? m Let p be 14/(-21) - (-16)/18. Let d = 0.07 + 1.53. Let g = -2 + d. Which is the closest to 0? (a) g (b) p (c) 1/10 c Let y = -20527/3 - -6756. Let h = y + 87. Let p = 0.07 - 0.37. Which is the nearest to -1? (a) 3 (b) p (c) h b Let o = -9.76 + 17.79. Let x = o - 0.03. Let p = 7 - x. What is the nearest to 0.1 in p, -1/3, 2/11? 2/11 Let d = -2.5 + 1.5. Let q = -4 - 1. What is the closest to -0.1 in -3, d, q? d Let m be (-80)/(-96) - (-2 + (-16)/(-6)). Which is the nearest to 1? (a) -2/5 (b) m (c) 1 c Suppose -x + m = -6, 5m + 8 = 3m. Let v be 24/(-16)x. What is the closest to v in -5, 1/3, -1/7? -1/7 Let v be (-9)/308 + 2. What is the nearest to -2/7 in 0.4, v, 2? v Let j be (-2 + 3)1/3. Let f = 19 + -60. Let t = f - -124/3. What is the closest to t in -5, 5, j? j Let q = -111 - -118. Let t be ((-4)/10)/((-4)/(-25)). Which is the nearest to 0.1? (a) q (b) t (c) -0.3 c Suppose -3i = -3y - 33, 2 = -4i + 5y + 45. Let h = i + -11. Which is the closest to -2/3? (a) 0 (b) -2 (c) h a Let j = 3 + -3.3. Let h = 2/269 + -556/2421. Let i = -0.2 - -2.2. Which is the closest to i? (a) -3 (b) h (c) j b Let g = 0 + -2. Let q = -8.3 + 8. Suppose 0 = 5p + 2 + 3. Which is the closest to p? (a) g (b) -1 (c) q b Let s = 0.1 - 0.1. Which is the nearest to 0? (a) -0.1 (b) 2 (c) s c Let u(f) = f2 - 2. Let w be u(2). Let z = 55 + -52. What is the nearest to 1 in w, -4, z? w Suppose 3x = -0x - 12, 0 = -4k - x - 16. Let r be -1 + (5/2 - 1). What is the nearest to r in 0, -3/7, k? 0 Let k = -1 - 0. Let s = 0.042 - -1.958. Which is the closest to 1? (a) k (b) 4 (c) s c Let q be (10/(-5))/42. Which is the nearest to q? (a) -2/21 (b) 1 (c) 2/21 a Let u be (8/410)/(22/(-10)). What is the nearest to 0.1 in 0, -0.3, u? 0 Let r = 2.8 - 4. Let s = 0.8 - r. What is the nearest to s in 1, -1/5, 0.5? 1 Let x be (0 - (-2)/(-4))/(-2). Let h be (1(-2)/6)/1. Let g = -21 + 26. Which is the closest to x? (a) g (b) h (c) 0 c Let y = -2 + -2. What is the closest to 1 in 2/17, y, -2/9? 2/17 Suppose 3b = -l - 2l + 24, l = -5b + 28. Suppose -25 = 5w + 5d, w - bd = 5w + 23. What is the closest to 0.1 in w, 5, -3? w Let c be (13/60)/((-24)/(-10)). Let a = 1/36 - c. Let u = 29/48 - a. What is the closest to 1 in 3/7, -4, u? u Let p = -1 + 1. Let w = p - 1. Let f = -23.1 + 22.6. What is the nearest to w in f, -3, 0.5? f Let u = 2 - 2. Let s = u - 0.1. Let q be (-1)/5(-10)/8. What is the closest to 0 in 5, q, s? s Let b(l) = -l + 1. Let u be b(5). Let m be (4 + -2)5/25. Let v = -4 + 1. What is the closest to m in u, 1, v? 1 Let d = -1.7 + 1.9. What is the nearest to d in 0.1, 0.4, 2/11? 2/11 Let h = -17 - -18. Which is the nearest to h? (a) 3 (b) 0.1 (c) 4 b Let h = -30 - -31. Let d = -3.06 + 0.06. What is the nearest to h in d, -1, 2/23? 2/23 Let l be (-4)/(-40)(9/6 - -1). Which is the closest to l? (a) 2 (b) -2/21 (c) -4 b Let p = -5707 - -251081/44. Let w = 4/11 + p. What is the nearest to 0.1 in -4, -3, w? w Let w = -2.88 - 0.12. Which is the closest to -0.2? (a) 5 (b) 2 (c) w b Let r = 144 + -148. Which is the nearest to 0.2? (a) r (b) 1 (c) -0.3 c Suppose -5 = -h - 2. Suppose -2x = -5l - 15, hx - 3l - 13 = x. Suppose -d + x = -0d. Which is the nearest to -1/2? (a) 2 (b) d (c) -0.4 c Let y = 0.107 + -2.107. What is the nearest to -0.1 in -2/13, 4, y? -2/13 Let j be (-1)/(-4) - 1/2. Let f = 252 - 748/3. Let o = -46/15 + f. What is the nearest to j in o, 1/4, 4? o Let q = 12 - 15. What is the closest to 0.1 in q, -0.1, 3/8? -0.1 Let d = 2.9 + -2.7. What is the closest to d in -5/4, -0.1, -4? -0.1 Suppose 0 = -8m + 4m. Suppose -2y = -my. Suppose -5d = -yd. Which is the nearest to 0? (a) d (b) 0.4 (c) 4 a Let m = -5.3 - -5.4. What is the closest to m in 2, -12, 2/9? 2/9 Let z = -0.3 - -0.1. Let w = -7 + 5. Let s be 2(-1 - 3/w). Which is the nearest to s? (a) z (b) 0 (c) -6/11 b Let w = 0.07 + 0.03. Let x = 0.06 - -0.54. Let t = -4.6 + x. What is the nearest to w in -1/4, 0.3, t? 0.3 Suppose 0 = -4u + 3 + 13. Suppose -20 = 5q - 5. Let h = 26/3 - 28/3. What is the closest to h in q, 2, u? q Let i = 0.38 - 0.58. What is the nearest to -0.4 in 3/7, 1, i? i Suppose 2t = 5 + 5. Let z = 0.7 - 0.4. Which is the nearest to 0? (a) t (b) 3 (c) z c Let g be (-2)/(-7) - (-19)/7. Suppose gr = -2r. Let w be (0 - r)(1 + -2). Which is the closest to w? (a) 0 (b) 4/3 (c) 0.5 a Let n = -0.34 + -0.06. Let f = 0.6 - n. Let u = 0.08 - -0.22. Which is the closest to f? (a) -2/3 (b) -4 (c) u c Let g = -1.3 - -1.2. What is the closest to 2 in 1, -5, g? 1 Let f = -9 - -8.93. Let o = f - 4.93. Let p be 3/(-6) + (-1)/(-2). What is the closest to 0 in p, 0.2, o? p Let k be (-3)/(3/((-9)/6)). Which is the nearest to 4? (a) k (b) -3 (c) 1 a Suppose 0 = 3h - 3, -5o - 3 = -h - 2. Let k = -31 + 63/2. Let z = 0 - 0. What is the nearest to z in 0.4, o, k? o Let z = 59.6 + -65. Let o = 5 + z. What is the nearest to -1/2 in -1, -4, o? o Let f be (8/(-20))/((-6)/30). Suppose c + f = -2v - 2, 0 = 3v + 3. Let t = 8 - 3. What is the closest to -0.3 in t, c, 0.4? 0.4 Let b(n) = n3 + 6n*2 - 6n - 4. Let x be b(-7). Let c = x + 56/5. Let y = 0.1 - 0. What is the closest to c in y, -2, -1? y Let b = 97 - 166. Let x = 481/7 + b. Let f = -10 + 7. What is the nearest to f in x, -0.4, 4? -0.4 Suppose 2l - 13 = 3y, l - 18 = 5y - 1. Let f be (-3)/6 + y/12. Which is the closest to 0? (a) -0.3 (b) 5 (c) f a Let q = -0.3 + 2.3. Which is the closest to q? (a) -2 (b) -5 (c) -0.3 c Suppose 13y = 26y + 13. Which is the nearest to 0.1? (a) y (b) -5 (c) -1/7 c Let g = 726/305 + 342837/3965. Let u = -89 + g. What is the nearest to -0.1 in -2, -5/2, u? u Let u = -47.7 - -48. What is the closest to 2 in u, 0.4, 14? 0.4 Let r = -2.944 + -0.056. Which is the nearest to -0.1? (a) -1/5 (b) 4/7 (c) r a Let g = -1.67 - 0.33. Which is the closest to g? (a) 5 (b) -3 (c) 2 b Let c be ((-16)/(-6) + -3)/(2-1). Let p = -0.04 + -2.96. What is the nearest to 0 in p, c, -5? c Let h = 1.61 - -2.27. Let m = h + 0.12. Let x	{ "pile_set_name": "DM Mathematics" }
4, -339, -576, -897? -1314 What is the next term in -2393, -9562, -21509, -38234, -59737, -86018? -117077 What is next in 113, 261, 409, 557? 705 What is the next term in 14, 2, -32, -100, -214? -386 What is the next term in -457, -460, -463? -466 What is next in -621, -1248, -1887, -2544, -3225, -3936, -4683, -5472? -6309 What comes next: -11, -11, -9, -5, 1, 9? 19 What comes next: 399, 408, 439, 504, 615, 784, 1023? 1344 What is next in 161, 317, 455, 569, 653, 701, 707? 665 What comes next: 15, -12, -39? -66 What is the next term in 31, 32, 33, 34? 35 What is next in 23, 118, 281, 518, 835, 1238? 1733 What comes next: 28, 60, 92, 124? 156 What comes next: 266, 524, 782, 1040, 1298, 1556? 1814 What is next in 45, 66, 105, 162, 237, 330? 441 What comes next: -70, -150, -230, -310, -390? -470 What is next in -78, -79, -80, -81? -82 What is the next term in -1, 6, 17, 32? 51 What is the next term in 2, 4, 6, 8, 10, 12? 14 What comes next: -24, -26, -28, -30, -32, -34? -36 What is the next term in 25, 68, 137, 232, 353, 500? 673 What comes next: 10, 108, 276, 520, 846, 1260? 1768 What comes next: 5, -34, -181, -490, -1015, -1810, -2929, -4426? -6355 What is the next term in 7, 61, 203, 475, 919, 1577, 2491, 3703? 5255 What comes next: 1, -11, -33, -71, -131, -219? -341 What comes next: 2389, 2388, 2387? 2386 What is the next term in 8, 15, 22, 29? 36 What comes next: 7, 27, 57, 103, 171, 267, 397? 567 What is next in -1101, -1099, -1091, -1071, -1033, -971? -879 What comes next: -21, -26, -31? -36 What is next in -24, -55, -86, -117, -148, -179? -210 What is next in 861, 1731, 2603, 3477, 4353, 5231, 6111? 6993 What comes next: 35, 44, 69, 116, 191? 300 What is the next term in 39, 64, 79, 78, 55, 4, -81? -206 What is the next term in 27, 85, 143, 201, 259? 317 What is next in -196, -389, -582, -775? -968 What is next in -1677, -3351, -5025, -6699, -8373, -10047? -11721 What comes next: -25, -20, 31, 152, 367? 700 What comes next: 11, -55, -277, -733, -1501, -2659, -4285? -6457 What is next in 121, 118, 115, 112, 109? 106 What is next in -5532, -5531, -5530, -5529, -5528? -5527 What is the next term in 36, 154, 352, 630, 988, 1426? 1944 What comes next: 0, -13, -50, -123, -244, -425? -678 What is next in 7, 15, 23, 31? 39 What is the next term in 28, 32, 36, 40, 44? 48 What is next in -13, -22, -31, -40, -49? -58 What comes next: 3979, 7949, 11919, 15889? 19859 What comes next: 212, 426, 640, 854, 1068? 1282 What is the next term in 27, 38, 49, 60? 71 What is the next term in 11358, 22714, 34070, 45426? 56782 What is the next term in 57, 104, 129, 120, 65? -48 What comes next: 18, 70, 150, 252, 370, 498? 630 What comes next: -203, -202, -201, -200, -199, -198? -197 What is next in 91, 74, 43, -8, -85, -194, -341, -532? -773 What is the next term in -19, -24, -33, -46? -63 What is the next term in -135, -580, -1325, -2370, -3715, -5360? -7305 What is the next term in 45, 71, 87, 87, 65? 15 What comes next: -149, -141, -123, -89, -33, 51, 169, 327? 531 What is the next term in 9, -3, -39, -111, -231? -411 What is next in 28, 50, 68, 82, 92, 98? 100 What is next in -21, -50, -85, -132, -197? -286 What is the next term in -80, -176, -288, -416, -560, -720? -896 What is next in -5, -34, -111, -260, -505, -870? -1379 What comes next: -7, -48, -107, -178, -255, -332, -403? -462 What is the next term in -29, -46, -73, -116, -181, -274, -401, -568? -781 What is the next term in -2, 7, 30, 73, 142? 243 What is next in -1797, -3580, -5361, -7140, -8917? -10692 What comes next: 45, 16, -25, -72, -119? -160 What comes next: -560, -576, -598, -626, -660, -700? -746 What is next in -99, -211, -397, -657? -991 What comes next: 8, 38, 90, 164, 260, 378, 518? 680 What is the next term in 149, 142, 135, 128? 121 What comes next: 42, 79, 110, 135? 154 What is the next term in 110, 227, 358, 509, 686, 895, 1142? 1433 What comes next: -25, -20, -11, 2, 19, 40, 65? 94 What is next in 48, 84, 120, 156? 192 What comes next: -46, -78, -110, -142, -174, -206? -238 What comes next: -1952, -3899, -5846, -7793, -9740? -11687 What is the next term in 8, 21, 34, 47, 60, 73? 86 What is the next term in 5795, 5799, 5805, 5813? 5823 What is the next term in -571, -570, -569? -568 What is the next term in -98, -409, -920, -1625, -2518, -3593? -4844 What is next in 117, 235, 353? 471 What is next in 2, 9, 20, 35, 54? 77 What is next in -357, -1441, -3247, -5775, -9025, -12997, -17691? -23107 What is the next term in -135, -203, -271? -339 What comes next: -853, -1702, -2547, -3388, -4225, -5058, -5887? -6712 What is the next term in 325, 313, 287, 241, 169, 65? -77 What comes next: -15, -35, -59, -87? -119 What is the next term in -22, -31, -38, -43? -46 What is the next term in -81, -91, -113, -153, -217? -311 What comes next: 56, 65, 74, 83? 92 What is next in 19278, 19274, 19268, 19260, 19250? 19238 What is the next term in -17, 24, 107, 238, 423, 668? 979 What is next in -193, -772, -1741, -3106, -4873, -7048, -9637? -12646 What is the next term in 8, -40, -172, -430, -856, -1492? -2380 What comes next: 86, 97, 110, 125? 142 What is next in -3, 0, -11, -48, -123, -248, -435? -696 What comes next: 224, 225, 226, 227, 228, 229? 230 What is the next term in -283, -290, -311, -352, -419, -518, -655? -836 What comes next: 3, 29, 73, 135, 215, 313? 429 What is the next term in 77, 148, 219, 290, 361? 432 What comes next: -30, -46, -62, -78, -94, -110? -126 What comes next: 8839, 8837, 8835, 8833, 8831? 8829 What is the next term in -31, -51, -61, -61, -51, -31? -1 What comes next: 160, 319, 480, 643? 808 What is the next term in 59, 117, 175, 233? 291 What is next in -64, -107, -224, -451, -824? -1379 What is next in 742, 744, 746, 748, 750? 752 What is next in 20, -2, -24, -46, -68? -90 What is the next term in -99, -825, -2801, -6651, -12999, -22469, -35685, -53271? -75851 What is the next term in -3499, -3501, -3503, -3505? -3507 What comes next: 17, -26, -69? -112 What is the next term in -27, -88, -185, -318, -487? -692 What comes next: -20, -25, -34, -47, -64, -85, -110? -139 What is next in 50, 103, 156? 209 What is next in 99, 83, 51, -3, -85? -201 What is next in -15, -68, -157, -282, -443? -640 What is the next term in 21, 42, 63, 84? 105 What is the next term in 40, 25, -14, -89, -212? -395 What is next in 217, 428, 639, 850, 1061, 1272? 1483 What is next in 11, 38, 83, 146, 227? 326 What is the next term in 193, 168, 117, 28, -111, -312? -587 What is the next term in 92, 125, 160, 197? 236 What is next in -40, -54, -74, -100, -132, -170, -214? -264 What is next in 318, 324, 330, 336? 342 What is next in 157, 222, 287, 352? 417 What is the next term in -401, -1593, -3579, -6359, -9933, -14301? -19463 What comes next: 10, 38, 106, 232, 434, 730? 1138 What is the next term in 504, 501, 500, 507, 528, 569? 636 What is next in -26, -143, -338, -611, -962, -1391? -1898 What comes next: -17, -27, -45, -71? -105 What is the next term in -17, -6, 5, 16, 27? 38 What is the next term in -10, -70, -170, -310, -490, -710? -970 What is next in -273, -553, -835, -1119? -1405 What comes next: 146, 288, 428, 566, 702, 836? 968 What comes next: 2486, 2484, 2472, 2444, 2394, 2316, 2204, 2052? 1854 What comes next: -198, -192, -176, -144, -90, -8, 108? 264 What is the next term in 461, 453, 431, 389, 321, 221, 83? -99 What is the next term in -35, -18, 13, 64, 141? 250 What comes next: 65, 23, -21, -67, -115, -165? -217 What is the next term in 109, 206, 287, 346, 377? 374 What comes next: -307, -630, -943, -1240, -1515, -1762, -1975, -2148? -2275 What is next in 3, -10, -13, 0, 35, 98? 195 What is the next term in -2908, -2906, -2904, -2902, -2900? -2898 What is next in 1584, 1591, 1598, 1605? 1612 What is next in -2491, -4981, -7469, -9955, -12439, -14921, -17401? -19879 What is next in 10, -1, -34, -101, -214? -385 What comes next: 60, 64, 68, 72? 76 What is next in 26, 102, 230, 410, 642, 926? 1262 What comes next: 158, 602, 1342, 2378, 3710, 5338? 7262 What is next in -13, -25, -53, -103, -181, -293, -445, -643? -893 What comes next: -59, -65, -71? -77 What is next in -91, -94, -97, -100, -103, -106? -109 What is the next term in 3137, 3141, 3147, 3155, 3165? 3177 What comes next:	{ "pile_set_name": "DM Mathematics" }
se 0 = -3d + 12, -5j = -7j - d + 58. Suppose -k = 16 - 97. What is the highest common divisor of j and k? 27 Let n(y) = -y3 + 15y*2 + 17y - 16. Let c be n(16). Suppose -s + cs = 4a - 115, -3a - 3s + 93 = 0. What is the greatest common factor of 14 and a? 14 Let z be (-1648)/12 + 3/9. Let j = z - -258. Suppose q - 5m - j = -2q, 4m - 214 = -5q. What is the greatest common factor of q and 28? 14 Let h(p) = -17p2 - 15p - 13. Let s be h(8). Let j be 4 + 28/(-8) + s/(-6). Calculate the highest common divisor of 51 and j. 51 Suppose 5x = -15, 3z - 8211 = -4x + 5709. What is the highest common factor of z and 108? 108 Let t(n) = n2 + 3n - 5. Let o be t(-5). Let m be o(-2 + 3) - -1. Suppose 0d = md - 192. What is the highest common factor of 16 and d? 16 Let p be 16776/288 - 1/4. Calculate the greatest common factor of 4 and p. 2 Let s = 166 + -145. What is the greatest common factor of s and 231? 21 Let b be (6 + -4)/((-4)/(-6)). Suppose -4o + 0n + 4n + 220 = 0, bn - 135 = -2o. Calculate the highest common factor of 24 and o. 12 Let b(d) = -46d2 - 3d + 3. Let j be b(-3). Let h be j/(-18) - ((-7)/(-3) - 1). What is the greatest common factor of 35 and h? 7 Suppose -14s + 5 = -9s. Let u(z) = 47z2 - z + 2. Let y be u(s). Calculate the highest common divisor of 6 and y. 6 Let t = 86 - 44. Suppose 11y = 14y - t. Calculate the greatest common factor of 14 and y. 14 Let d(l) = 9l*2 + 1. Let q be 1(-1 - 0)1. Let r be d(q). Let f = 43 - 33. Calculate the greatest common divisor of f and r. 10 Suppose 3p - 2j = -5j - 3, -3p + 3j = 3. Let q be (1 - p)3 + 1 + -1. Calculate the greatest common factor of q and 42. 6 Let v be ((45/20)/(-3))/(2/(-56)). Suppose -3b = -v - 144. What is the greatest common divisor of 5 and b? 5 Let g(y) = -2y2 + 21y - 4. Let h be g(10). Calculate the greatest common factor of h and 12. 6 Let z be (-13)/(-2)6-11. Let u = -297 - z. What is the highest common factor of 12 and u? 12 Suppose 13 + 8 = 3u - 3k, -2k = -3u + 20. Let z be 1348/28 - (-8)/(-56). What is the greatest common divisor of u and z? 6 Let n(q) = -3q + 55. Let r be n(17). Suppose 3b + w - 296 = 0, -rb = -5w + 58 - 459. Calculate the highest common factor of b and 9. 9 Suppose 14a - 1839 + 495 = 0. What is the greatest common factor of 36 and a? 12 Suppose 2j + 1600 = 4q, -19j = -15j. Calculate the greatest common divisor of 176 and q. 16 Let a = 20 - 10. Suppose 17v - 22v + 450 = 0. Calculate the highest common divisor of a and v. 10 Let c(m) = 2m*2 + 42m + 142. Let n be c(-30). What is the greatest common divisor of n and 62? 62 Suppose -5l - 21 = -3a, 2l - 4l = 2a + 2. Suppose 2w + 4y = 6w - 4, -2y + 10 = aw. Calculate the greatest common factor of 6 and w. 3 Let n(o) = o*2 - 3o + 25 - 52 + 26 + 2o2. Let z be n(3). What is the greatest common factor of z and 153? 17 Let f(s) = 13s3 + s2 - s - 1. Let r(p) = 2p + 0p + 2p + 8 - 3p. Let w be r(-6). Let h be f(w). What is the highest common factor of 15 and h? 15 Let q = -11 + 23. Let o = q - 0. Calculate the greatest common factor of 6 and o. 6 Let z be (-48)/(-408) - (-444)/(-17). Suppose -8 = 4v, 3c + 0c + 5v = 122. Let m = c + z. Calculate the greatest common divisor of 6 and m. 6 Let g be 10/(-45) + 542/9. Suppose 3o = 6o + 4s - 29, 3o - 2s - 53 = 0. What is the greatest common divisor of g and o? 15 Let m = -4 - -3. Let u(a) = -a - 1. Let q(s) = -3s - 5. Let f(z) = mq(z) + 4u(z). Let i be f(-8). Calculate the highest common divisor of 9 and i. 9 Let z be 1593/(-18)-4 - (-3)/(-1). Calculate the greatest common factor of 27 and z. 27 Let u be 9218/286 - 6/26. Calculate the greatest common factor of 64 and u. 32 Let d = 5 + -15. Let n = d + 0. Let m be (-2)/4n/1. Calculate the greatest common factor of 2 and m. 1 Let y = 1871 - 1759. Suppose -2j - 11 = 11. Let n = j - -25. Calculate the greatest common factor of n and y. 14 Suppose 0 = -h + 5h. Let u(d) = d3 + d2 - d + 198. Let z be u(h). Let t be 8/32 - z/(-8). Calculate the greatest common factor of t and 125. 25 Let g(a) = 11a - 13. Suppose z + 40 = 5t, 3t - 24 = -0z - 2z. Let w be g(t). Let q = -5 + 35. What is the highest common divisor of q and w? 15 Suppose 5j - 1068 = -8r + 4r, -2r + 426 = 2j. Let f be (9/155)/((-1)/(-90)). Suppose -23d = -13d - f. Calculate the highest common factor of d and j. 27 Let l be -1(-1 - -1) + 81. Let q be -1 + (-1 - -6) + 0. Suppose -5r - 25 = -0r, -w + qr + 29 = 0. Calculate the highest common factor of w and l. 9 Let s(x) = -5x + 6. Let h be s(2). Let a be (-14 - -15)/(2/h) - -18. Calculate the highest common factor of 40 and a. 8 Let j be 2/8 - (243/(-4) + 1). What is the greatest common factor of 100 and j? 20 Suppose -76 = -5j + 24. Let x be (-4)/(-30) + 374/(-330). Let h be 0 + 16/(x - -5). Calculate the greatest common factor of j and h. 4 Let t(n) = 7n - 10. Let i be t(4). Suppose 2v = -v + i. Suppose 2d + 3 = 3q - v, 2d + 7 = q. Calculate the highest common divisor of 3 and q. 1 Let s be 13/(-11) - -1 - (-3577)/11. What is the highest common divisor of s and 75? 25 Suppose -2s + u + 6 = 3s, -2 = s - u. Let w = s + -1. Let y = w - 0. What is the greatest common divisor of 5 and y? 1 Let w be 10161/117 + 4/26. What is the highest common factor of w and 174? 87 Suppose -v - v + 10 = 0. Suppose -vm - 5o = -35, 0 = -4m - 2o + 31 - 3. Let p = -397 + 418. Calculate the greatest common factor of m and p. 7 Suppose -3u - 9 = 4s + 27, -5s = 3u + 42. Let b(c) = c*2 + 4c + 16. Let p be b(s). Calculate the greatest common divisor of 42 and p. 14 Suppose 42i - 32i = 530. Calculate the greatest common divisor of 689 and i. 53 Let r(w) = -w + 23. Let b be r(-5). What is the greatest common divisor of b and 182? 14 Let k = 28 - 55. Let z be k218/(-54). Calculate the highest common factor of z and 9. 9 Let n = -624 - -631. What is the greatest common factor of 77 and n? 7 Let u(h) = 6h + 7. Let x be u(1). Let n = 20 + -19. What is the greatest common factor of n and x? 1 Suppose 0 = -5y + y - h + 474, -4y + 4h + 484 = 0. Let z be 32/2 + (-2)/(-2). What is the greatest common factor of y and z? 17 Suppose 0n = -2n + 200. Calculate the greatest common divisor of n and 80. 20 Let h(x) = x*2 - 7x + 14. Let c be (2 + -2)/((-2)/(-2)). Suppose -5a + 6a - 6 = c. Let l be h(a). Calculate the greatest common divisor of l and 88. 8 Let o(u) = -26u - 30. Let f = -47 - -36. Let x be o(f). Calculate the highest common divisor of 16 and x. 16 Let u(l) = -l3 - 14l*2 - 6l - 44. Let j be u(-16). Calculate the greatest common factor of j and 12. 12 Let u = 385 + -380. Calculate the greatest common factor of 5 and u. 5 Let x = 3 + 25. Let k = -27 + x. What is the highest common factor of k and 7? 1 Let z(a) = -161 + a + 87 - 5a2 + 0a2 + 91 - a3. Let h be z(-5). Calculate the highest common factor of 6 and h. 6 Let a(p) = -p*3 - 6p*2 - 8p - 17. Let h be a(-6). What is the greatest common factor of 124 and h? 31 Let s = -585 - -643. What is the greatest common divisor of 522 and s? 58 Suppose -15v - 9v = 0. Suppose 5r + 3u - 1 = 0, 3r + 3u = -2 - 1. Suppose vz + rz = 374. Calculate the greatest common divisor of 17 and z. 17 Let p = 3537 - 2022. Calculate the highest common factor of p and 15. 15 Suppose 0 = -3j - 4v - 2, -4v + 5v = j - 4. Let n be -5 + 17 + j + -1. What is the highest common divisor of n and 169? 13 Let k(d) = d*3 + d + 64. Let p be k(0). Let m = 529 - 513. Calculate the highest common factor of m and p. 16 Suppose -4b + 5412 = -4s - 364, -5767 = 4s - b. Let c = -935 - s. Calculate the greatest common divisor of c and 46. 46 Suppose -3h + 2d = -25 - 17, -4h = -4d - 52. Suppose -3y + 4v + 201 = v, 0 = 3v + 9. What is the highest common divisor of h and y? 16 Let i = 3 + 13. Suppose 2x - x - 4z = 615, 0 = -x + z + 630. Suppose 8u = -3w + 3u + 379, x = 5w + 5u. Calculate the greatest common factor of i and w. 16 Let b = 5 + -3. Suppose -v + 2h + 106 = 3v, 0 = -2v - h + 43. Suppose l + 2l = v. Calculate the greatest common divisor of b and l. 2 Suppose -9 = -5q - 55d + 56d, 6q + d - 13 = 0. Let f = -11 - -21. Calculate the	{ "pile_set_name": "DM Mathematics" }
-282? -443 What is the next term in 3, 47, 137, 285, 503, 803? 1197 What is next in 12371, 12373, 12375, 12377? 12379 What is the next term in 36, 56, 76, 96, 116? 136 What is the next term in 18, 16, 14? 12 What is the next term in -370, -365, -358, -349, -338? -325 What comes next: 10, -3, -40, -113, -234? -415 What comes next: -54, -147, -274, -435, -630, -859? -1122 What comes next: -106, -115, -130, -151? -178 What is the next term in -3189, -3179, -3155, -3111, -3041, -2939, -2799, -2615? -2381 What is the next term in 1188, 1190, 1192? 1194 What is next in -5, -2, 5, 16, 31? 50 What is the next term in -2, -8, -16, -26, -38, -52? -68 What is the next term in -342, -340, -338, -336, -334? -332 What is next in 3, -18, -35, -42, -33, -2? 57 What is the next term in 16, 21, 42, 85, 156, 261? 406 What is next in 8, 39, 94, 173, 276, 403, 554? 729 What is next in 22, 110, 198? 286 What comes next: -133, -272, -411, -550, -689? -828 What is next in 9, 8, -1, -24, -67, -136, -237? -376 What is the next term in -145, -319, -495, -673, -853, -1035, -1219? -1405 What is the next term in -175, -168, -161, -154, -147? -140 What is next in -151, -142, -133? -124 What is next in -166, -163, -158, -151, -142, -131? -118 What is next in 199, 194, 187, 178, 167, 154, 139? 122 What comes next: -4049, -4050, -4051, -4052, -4053, -4054? -4055 What comes next: 3003, 6008, 9013, 12018, 15023, 18028? 21033 What is next in 30, 64, 98? 132 What is next in 26, 25, 26, 29, 34, 41, 50? 61 What is next in -138, -292, -452, -618, -790, -968? -1152 What is next in 32, 34, 36? 38 What is the next term in -810, -807, -802, -795? -786 What is the next term in 8, 26, 44, 62, 80, 98? 116 What is next in -172, -173, -184, -211, -260? -337 What comes next: -17, -35, -71, -131, -221? -347 What is the next term in -13, -28, -43? -58 What is the next term in -151, -166, -181, -196, -211, -226? -241 What comes next: -732, -1469, -2216, -2979, -3764? -4577 What is the next term in -602, -600, -598? -596 What comes next: 37, 143, 321, 571, 893, 1287? 1753 What is next in -408, -813, -1218, -1623? -2028 What is next in 8, -139, -286, -433, -580? -727 What is the next term in 47, 348, 1171, 2780, 5439, 9412, 14963? 22356 What is the next term in -1816, -3630, -5444? -7258 What comes next: 38, 60, 82? 104 What is next in 4, 26, 62, 112, 176? 254 What is the next term in 247, 1030, 2343, 4192, 6583, 9522, 13015, 17068? 21687 What comes next: -2299, -2285, -2271? -2257 What comes next: 155, 323, 499, 683, 875, 1075, 1283? 1499 What is the next term in -5, -5, -3, 1, 7, 15, 25? 37 What is the next term in 16, 12, 6, -2, -12, -24, -38? -54 What comes next: -87, -75, -63, -57, -63, -87, -135, -213? -327 What is the next term in 128, 202, 276, 350? 424 What is next in 121, 88, 31, -50, -155? -284 What is the next term in 12167, 24351, 36537, 48725, 60915, 73107, 85301? 97497 What is next in 31, 103, 219, 379, 583? 831 What is next in 1560, 1559, 1558? 1557 What is next in 373, 357, 333, 301, 261, 213? 157 What is next in -195, -193, -189, -183, -175, -165? -153 What is the next term in 133, 262, 389, 514? 637 What is the next term in 38, 77, 116? 155 What is the next term in -1570, -1558, -1538, -1510, -1474, -1430? -1378 What comes next: -40, -152, -334, -580, -884, -1240, -1642? -2084 What is next in 561, 1128, 1697, 2268? 2841 What comes next: -5, -43, -151, -365, -721, -1255, -2003? -3001 What is the next term in -43, -82, -129, -178, -223, -258, -277? -274 What is next in 1460, 1457, 1464, 1487, 1532, 1605, 1712, 1859? 2052 What is the next term in -346, -450, -554, -658? -762 What is the next term in -317, -321, -331, -353, -393, -457, -551? -681 What is next in -123, -105, -69, -9, 81, 207? 375 What comes next: 25, 36, 9, -74, -231? -480 What is the next term in 55, 115, 185, 271, 379, 515, 685, 895? 1151 What is the next term in 806, 808, 810? 812 What comes next: -170, -183, -204, -233, -270, -315? -368 What is the next term in -11, -47, -113, -215, -359, -551, -797? -1103 What is the next term in 861, 854, 857, 876, 917, 986? 1089 What is next in 191, 382, 571, 758, 943? 1126 What is the next term in -7, -13, -19? -25 What comes next: 19, 41, 67, 97? 131 What is the next term in -283, -589, -891, -1189, -1483, -1773? -2059 What is next in -94, -96, -98, -100, -102, -104? -106 What comes next: 126, 183, 234, 273, 294, 291, 258, 189? 78 What is the next term in 36, 145, 326, 579, 904? 1301 What is the next term in -476, -915, -1354? -1793 What is the next term in -85, -98, -109, -118, -125, -130, -133? -134 What comes next: 976, 1956, 2938, 3922? 4908 What comes next: 3488, 3487, 3484, 3479, 3472, 3463, 3452? 3439 What is the next term in -552, -550, -548, -546, -544? -542 What comes next: 34, 58, 92, 142, 214? 314 What is the next term in -231, -232, -225, -204, -163? -96 What comes next: -42, -83, -130, -189, -266, -367? -498 What is the next term in 1212, 1213, 1214, 1215? 1216 What is the next term in -52, -67, -82, -97, -112, -127? -142 What comes next: -862, -869, -886, -919, -974, -1057? -1174 What is the next term in 251, 248, 233, 200, 143, 56, -67, -232? -445 What comes next: 127, 257, 397, 547, 707, 877? 1057 What comes next: 36, 96, 172, 270, 396? 556 What comes next: -15, -141, -357, -669, -1083? -1605 What is next in 50203, 50202, 50201, 50200, 50199? 50198 What is next in 8, 14, 14, 2, -28, -82? -166 What comes next: 6, -2, -32, -96, -206, -374, -612? -932 What is the next term in 1149, 2295, 3453, 4629, 5829, 7059? 8325 What is the next term in 132, 51, -172, -609, -1332, -2413, -3924? -5937 What is the next term in -159, -156, -165, -192, -243, -324, -441? -600 What is the next term in -124, -198, -272, -346, -420? -494 What comes next: -23, -47, -81, -131, -203, -303, -437? -611 What comes next: -35, -139, -311, -551, -859? -1235 What comes next: -2740, -2741, -2742, -2743, -2744? -2745 What comes next: 3034, 3030, 3024, 3016? 3006 What is next in -30, -49, -68, -87, -106? -125 What comes next: 95, 181, 267, 353, 439, 525? 611 What is the next term in 39, 77, 115? 153 What is next in -160, -317, -474, -631? -788 What is next in 620, 627, 638, 653, 672? 695 What is the next term in -48, -63, -90, -135, -204, -303, -438, -615? -840 What comes next: 52, 107, 162, 217? 272 What is the next term in -689, -1374, -2059, -2744, -3429? -4114 What is the next term in -12, -24, -36, -48? -60 What comes next: 963, 964, 965, 966, 967, 968? 969 What is next in -1, 13, 39, 77? 127 What comes next: 40, 79, 130, 187, 244, 295, 334? 355 What is the next term in 1109, 2217, 3325, 4433, 5541? 6649 What is next in -2, -6, -26, -74, -162? -302 What is the next term in -395, -868, -1331, -1778, -2203, -2600, -2963, -3286? -3563 What is the next term in 93, 140, 187, 234, 281, 328? 375 What is next in 33, 240, 797, 1878, 3657? 6308 What is next in -31228, -31231, -31236, -31243? -31252 What is the next term in 1254, 1253, 1264, 1293, 1346? 1429 What is the next term in 46, 65, 110, 193, 326, 521, 790? 1145 What is the next term in 575, 1142, 1705, 2264, 2819? 3370 What is the next term in -4474, -4471, -4468, -4465, -4462? -4459 What comes next: 107666, 107665, 107664? 107663 What is the next term in 160, 152, 132, 94, 32, -60? -188 What comes next: 1710, 3419, 5126, 6831, 8534? 10235 What comes next: -7531, -7532, -7533, -7534? -7535 What comes next: -197, -200, -205, -212, -221, -232, -245? -260 What is the next term in 7, 7, 3, -11, -41, -93? -173 What comes next: 175, 179, 193, 223, 275, 355? 469 What comes next: -38, -94, -154, -218, -286? -358 What comes next: 1274, 1273, 1272, 1271? 1270 What comes next: -726, -725, -724, -723? -722 What comes next: -4, 95, 184, 257, 308, 331, 320? 269 What is next in 45, 71, 65, 15, -91? -265 What comes next: -6, 12, 34, 60, 90? 124 What is the next term in -783, -1565, -2347, -3129? -3911 What is next in -1721, -1730, -1753, -1796, -1865, -1966? -2105 What comes next: -35, -56, -77, -98? -119 What is next in 334, 333, 332? 331 What comes next: 3728, 3720, 3698, 3656, 3588, 3488, 3350? 3168 What comes next: -58, -14, 30, 74? 118 What is next in 124, 121, 118, 115, 112? 109 What is next in 7, 13, -5, -59, -161, -323, -557, -875? -1289 What c	{ "pile_set_name": "DM Mathematics" }
31r + 129r for n. -4 Solve 5t + 3f = -505 + 482, -2t - 3f = 11 for t. -4 Solve -574g + 578g = 5l - 24, 0 = 5g + 8l - 27 for g. -1 Solve 4g = 5j - 4j - 2j, 0 = g - 2j - j for g. 0 Solve -6t + 2t + 3h - 4 = 0, -1 = t - 4h for t. -1 Solve 4h - 20 = 4i, -77 + 54 = -5i - h for i. 3 Solve -r + 17 = 2x, -3r + 5x + 25 + 32 = 72 for r. 5 Solve 11 = -5j - o, -4j - 93 = 5o - 101 for j. -3 Solve -8t - 3c + 41 = 0, 0 = 41t - 40t + 4c + 13 for t. 7 Solve 2u + 5g = -7, -80u + 79u + 3g + 13 = 0 for u. 4 Solve 202g - 2o = 198g - 32, -4o = -4g - 40 for g. -6 Solve 6h + 4y + 2 = 0, -3h + 8 - 10 = y for h. -1 Solve q + 52k + 1 = 49k, q + 2k = 0 for q. 2 Solve -x = -3j - 2x + 11 + 4, -18 = -x for j. -1 Solve 66 - 60 = 3r + 4h, 0 = -r + 4h - 14 for r. -2 Solve -3r + 5y = 36, -5r - y + 8 = 2y for r. -2 Solve -43j = -q - 45j - 11, 0 = -q + 3j + 14 for q. -1 Solve -4n - 71 = s, 2s + 42 = -4n - 32 for n. -17 Solve 218r - 221r + 4l = -24, 0 = -3r - 3l + 3 for r. 4 Solve 5x + 2r = -29, -157 = 2x - 2r - 165 for x. -3 Solve -2a = -5q - 54, 30q - 35q - 3a = 44 for q. -10 Solve 2434b - 35 = -4p + 2437b, -7p + 15 = 4b for p. 5 Solve 0 = 26147y - 26142y - 9u + 70, 2y - 3u = -25 for y. -5 Solve 9j = -i + 53, -39j - 64 = -47j - 3i for j. 5 Solve -15h + 13h = -4, f - 6h + 13 = -2h for f. -5 Solve 4t + 5w + 25 = -0w, -3t + 2w + 10 = 0 for t. 0 Solve -1584k = 5a - 1579k - 30, 4a = 3k + 17 for a. 5 Solve 14 = 3a - g, 197a - 192a - 38 = 3g for a. 1 Solve 10p + 4l - 18 = 13p, -2p + 311 = 105l for p. -2 Solve 2x - 5x + 86 = -5p, -2p - 38 = 0 for x. -3 Solve 5x = 2m + 24, -1465 + 1502 = x - 5m for x. 2 Solve -8 = 3h + 16q - 17q, 3h + q = 2 for h. -1 Solve -a + s = 2, 3a + 9793s = 9788s - 22 for a. -4 Solve -4o = -4p - 36, o - 2p - 24 = -13 for o. 7 Solve -c = 22a + 65, -1018a + 1014a = -2c + 14 for a. -3 Solve -199 + 187 = -5v - 4t, 2t = 4v - 20 for v. 4 Solve 3112y + 20 = 3v + 3110y, 0 = 5v - 3y - 31 for v. 2 Solve 4n - 10 = -5a, -592 = -3n - 4a - 583 for n. -5 Solve 4i + 4 = -8b, 0 = b - 56i + 51i + 28 for b. -3 Solve -4n - 35 = 3m, 15m + 341 = 5n + 291 for m. -5 Solve -5g = 3o + 10, 0 = -50g + 52g + 3o + 13 for g. 1 Solve -49 = 5j - 7k, 35j + 2k = 38j + 25 for j. -7 Solve -3w + 3 = 0, 4t - 2w + 335 = 365 for t. 8 Solve 3x = -v - 4, -11v + 12v = x + 4 for x. -2 Solve 47q - 51q = 4s - 4, -s - 3 = 3q for s. 3 Solve 2b + 194i = 195i - 10, 2i + 43 = -5b for b. -7 Solve -2s + 4 = 90o - 85o, 3s - 6 = 3o for o. 0 Solve -18 = 5c - 5i + 12, 0 = c + 3i - 6 for c. -3 Solve -33 = 2m - 5j, -167 + 170 = j for m. -9 Solve 1939p - 1942p + 4f + 63 = 0, -2f = 30 for p. 1 Solve 314k - 11 = 309k + 3i, -22k - 4i = -100 for k. 4 Solve -3a = -1237x + 1238x + 14, 28 = -5a - 4x for a. -4 Solve 39u - 36u + 4g = -22, 3g = 3u - 6 for u. -2 Solve -5d + 3s = -22, -4d - 23s + 16 = -25s for d. 2 Solve 0 = -d - 6, 5t + 63d = 69d + 41 for t. 1 Solve 7m - 15 = 12m, -12w + 4m = -72 for w. 5 Solve 90g - 118g + 17 = -3n - 111, 0n - 2n + 8 = 0 for g. 5 Solve -t + 10 = 11c - 6c, 2t + 2c - 4 = 0 for t. 0 Solve -r - 4r - 3c = -38, -4r = -3c + 29 for r. 1 Solve 3d - b - 123 = -111, 5d - 34 = -6b + 3b for d. 5 Solve 4 = -r + 5l, 31l - 26l = -2r + 7 for r. 1 Solve -37 = 4x - 21, x + 20 = 4n for n. 4 Solve -5l + 201 = -3t + 131, 3t = l - 50 for l. 5 Solve -2i + 20 = -4g, -22g - 110 = 109i - 108i for i. 0 Solve -2n + 52 = 5g, 2n - 3g - 122 + 150 = 0 for n. 1 Solve 2a - 3f - 4 = 0, -3f + 0f = -183 + 177 for a. 5 Solve 1363f - 6 = 1365f - 2n, 4f + 5n - 15 = 0 for f. 0 Solve -5z - 4i + 5 - 8 = -6, 0 = 4i + 12 for z. 3 Solve -12a - 15 = -17a + 5f, 8 = -2f for a. -1 Solve 0 = 3f + 18, 2a + 15 - 47 = 135f - 131f for a. 4 Solve 5s - 2r = 17, 3 = 9r - 3r - 2r + 7 for s. 3 Solve -2p - 27 = 3d, -42 = 94d - 89d + 3p for d. -3 Solve -2j - 9h + 13h = -22, 7h - 2 = -j for j. 9 Solve c = 5o + 23 + 10, -87 = 4o - 21c for o. -6 Solve 4u + 275 - 310 = -3i, -9i + 45 = 0 for u. 5 Solve -3l - 229o = -234o + 36, 5o - 54 = -3l for l. 3 Solve 0 = -3c - 19 + 4, 25r - 33 - 42 = -5c for r. 4 Solve 4n + 49973h - 49978h - 22 = 0, -5 = n + 4h for n. 3 Solve 31g + 46 = 5n, 4g - n + 221 = 214 for g. -1 Solve 20j - 3n + 50 = 19j, -2j + 4n - 70 = 0 for j. -5 Solve 6n + 2v = -18, -2v + 5 = 5n + 14 + 6 for n. -3 Solve -67x - l = -62x - 5, -4l = 5x + 10 for x. 2 Solve 3i - 3 = -3v, 4 = 14164v - 14159v + 4i for v. 0 Solve 2i + 2v = -18, i + 2v + 5 + 9 = 0 for i. -4 Solve -7h + 3h = 2f - 24, 0 = -2h - 3f + 28 for h. 2 Solve 3r - 15253s - 2 = -15255s, -3 = -2r - s for r. 4 Solve -748v + 746v = -6, 3v - 145 = -8q for q. 17 Solve 2474l = 2477l - c - 7, 0 = -l + 19c - 35 for l. 3 Solve 0 = b - 4m + 18 - 11, 4m + 13 = 5b for b. 5 Solve 0 = 9d + 2c + 11, 4d + 21c - 16c = -9 for d. -1 Solve -k + 35l = 33l + 8, -61l = 3k - 43 for k. -6 Solve -5f - 7 = -3b, 5f + 143b + 4 = 149b for f. -2 Solve 15q = 3d + 87, -1 - 6 = -q - d for q. 6 Solve -90d - 15 = -87d, -4s - 5d = 25 for s. 0 Solve -3r - 8x - 25 = 0, -5r + 9r + 24 = -6x for r. -3 Solve 3j = -5i + 12, -i + 4j + 19 - 12 = 0 for i. 3 Solve 110v = 112v - 4l - 42, 4l + 80 = 32 for v. -3 Solve 2a - 2477 = -4m - 2459, -7m - 2a + 30 = 0 for m. 4 Solve i = -3j - 16, 6j = 4j - 2j + 2i - 18 for j. -5 Solve 8s + 3u + 37 = 0, -4u + 34 = 4s + 50 for s. -5 Solve 129j - 3b = 127j + 16, 5b - 5 = -3j for j. 5 Solve -2f = -d - 19, -2d - 3 = -147f + 150f for f. 5 Solve c + 12 = 566t - 570t, 0 = 3t + c + 8 for t. -4 Solve 7r = -21, -4r = 4y - 76 + 88 for y. 0 Solve -4c - t = -35, -74c + 77c + 4t - 23 = 0 for c. 9 Solve -m - 2c + 37 = 51, -c = -3m for m. -2 Solve -61s = -z - 56s + 13, 3z + 36 = -10s for z. -2 Solve z = 4m - 9, -43 = 2m - 3z - 30 for m. 4 Solve 520r - 523r = -4l + 14, 0 = 4r + l + 6 for r. -2 Solve 50v - 46v = -5k - 10, 0 = 3k + v + 6 for k. -2 Solve -2 = -2p - 1247w + 1249w, -181 = -31p + w for p. 6 Solve 3i = 3a + 3, -3424a + 3423a = 3i - 15 for i. 4 Solve 7p = -t - 15, -p - 33 = -715t + 710t for t. 6 Solve 3g + 446x - 444x + 12 = 0, -4x - 8 = -2g for g. -2 Solve -5t - 2r + 70 = 74, -2t + 2r + 4 = 0 for t. 0 Solve 3y - q + 9 = -5, -5y = 3q for y. -3 Solve 19c + 9 = 22c, -4m + 16 = 12c for m. -5 Solve 4w = y - 25, 4w + 19y - 58 = 417 for w. 0 Solve p - 174a = -176a - 10, p + a + 6 = 0 for p. -2 Solve 5m = 4d + 16, -d + 715 - 719 = m for m. 0 Solve -692x + 708x + 37 = 5l, 0 = -2x + l - 5 for x. -2 Solve -6 = 2s + 4, 3z - 2s = 1 for z. -3 Solve k = -2w + 18, -1818 = 2w + 5k - 1844 for w. 8 Solve -65 = -5b - 60, 3q - 5b = -8 for q. -1 Solve 428g - 432g = -f + 3, 0 = 3g + 13f + 71 for g. -2 Solve 4w - 2a = -10, 5w + 8a - 60 = -104 for w. -4 Solve -173c + 7 = -171c - 3y, -c - 8y - 6 = 0 for c. 2 Solve g + 21 = -2m, 6m = 2g + 3 + 19 for g. -17 Solve 0 = -2h - 3d, 3h - 4d + 2753 - 2770 = 0 for h. 3 Solve -47l + 51l + 27 = -3k, k - l + 2 = 0 for k. -5 Solve 0 = -5q - 15, 4q = 9z - 5z - 8 for z. -1 Solve 4o - 5p + 7181 = 7185, 4p + 48 = -8o for o. -4 Solve -208 = -3d - b - 274, 0 = 4d + b + 87 for d. -21 Solve 65 - 60 = -f - 2u, -4f = 2u + 14 for f. -3 Solve 2q + 3 = -155t + 154t, 5t - 5q - 15 = 0 for t. 1 Solve 5m - 10 = 5p, 154 - 95 = 7m + 2p for m. 7 Solve -5 = -3n + 4a, -51a + 52a + 15 = -2n for n. -5 Solve -2x + 1172 = 3l + 1257, -3l = 75 for x. -5 Solve -12t = 149z - 148z - 50, -z + 18 = 4t for t. 4 Solve 0 = 5i + 3k + 15, -57 = -2i - 3k - 72 for i. 0 Solve 6 = -t + 3o, 60 = t + 5o + 58 for t. -3 Solve 56 = -12r - s, -38 + 10 = -r + 4s for r. -4 Solve -3o + 14 = k, -22 = -5o + 2211k - 2212k for o. 4 Solve 2t = 44m + 184, 5t - 29m = -27m + 28 for t. 4 Solve 5y = -4f - 84, -51410f = -51405f - 2y + 105 for f. -21 Solve 2y = 5d - 5, 2d - 225y - 40 = -228y for d. 5 Solve x - 3u = -0x - 0u + 12, 0 = 3x - 8u - 32 for x. 0 Solve 0 = 4n + 5g - 41, -7 = 2n + 497g - 500g fo	{ "pile_set_name": "DM Mathematics" }
s the least common multiple of (f/30)/((-1)/10) and 22? 88 Let z = 108 + -151. Calculate the common denominator of z and 73/9. 9 Let j(g) = g*3 + 8g*2 - 2g*2 + 0 + 2g - 4. Calculate the least common multiple of j(-5) and 2. 22 Let c = -9 - -21. Calculate the lowest common multiple of (96/20)/(15/50) and c. 48 Suppose 0 = -5q - 0 - 5, 3z + 647 = q. Suppose 2c = 4c - 3i - 36, 5c - 73 = -i. What is the common denominator of (z/(-220))/((-4)/c) and 71/12? 132 Find the common denominator of (-6)/15 + (-334)/(-160) and 4/6 + 106/84. 112 Suppose -258 = 4t - 6t. What is the common denominator of t/5(-6)/(-36) and (-3)/((-60)/(-214)) - -2? 10 Suppose 92 = 2i + 30. Calculate the least common multiple of i and 8. 248 Suppose 4q - 20 - 12 = 0. Let d = 14 - q. Calculate the lowest common multiple of (-35)/(-2) - (-3)/d and 6. 18 Suppose c = 5j + 14, c + 24 = 5c - 4j. Let w be 1 - (-1)/((-1)/(-2)). Suppose 5t + 3 - 21 = -v, -w = t - 2v. What is the lowest common multiple of c and t? 12 Calculate the least common multiple of 35 and (105/(-18))/((-1)/6). 35 Let x = 1/4152 + 222127/20760. Let z = 353/165 + -103/15. What is the common denominator of z and x? 110 Suppose c = -3l + 10, 0l - 5l + 4c = 6. Calculate the smallest common multiple of 4 and 2-10l/(-5). 8 Let t = -389 + 2365/6. Let k = -712 - -7791/11. Calculate the common denominator of t and k. 66 Let h(s) = -s*2 - 10s - 10. What is the smallest common multiple of 3 - (0 + -4 - -2) and h(-8)? 30 Let t = -3011/126 - -154/9. What is the common denominator of t and 33/2? 14 Suppose -h = -a + 23 - 4, -5a + h + 99 = 0. What is the lowest common multiple of 24 and a? 120 Calculate the common denominator of -10(-2)/24 - 0/11 and 75/8. 24 Let b be -2 + (-3)/((-3)/(-2)). Find the common denominator of (-11)/(-22) + (-195)/(-66) and (-2)/b + (-75)/14. 77 Let y be 2 + (2 - 26921/(-18)). Let j = -1500 + y. Calculate the common denominator of j and 59/2. 18 Suppose 0 = w + 4 - 15. What is the least common multiple of 1 and w? 11 Let g be 9007/(-1106) + 2/(-7). Let n = g + 40/553. Find the common denominator of n and (142/54)/(32/48). 126 Let r(x) be the second derivative of x*4/12 + 3x3/2 - x2 + 4x. Calculate the smallest common multiple of r(-10) and 8. 8 Suppose 10l - 24 = 86. Calculate the lowest common multiple of 9 and l. 99 Let v = 1027/3 - 5012/15. Find the common denominator of v and -37/5. 5 Let c = -3664/11 + 332. Calculate the common denominator of 31 and c. 11 Let m = -240119597823229/11337431196 + 4/218027523. Let h = -21180 - m. Let q = -1529/156 - h. Find the common denominator of q and 93/4. 12 Let z = 8 - 6. Suppose -3u - 4k = -u, -zu - k = 6. What is the smallest common multiple of 8 and 178/11 - u/(-22)? 16 Let d = -15274 - -305369/20. Find the common denominator of d and 63/20. 20 Let v be 2/3 + (-2468)/3810. Let l = 935/254 + v. Let h = -6163/1076 - 6/269. Calculate the common denominator of l and h. 20 Suppose 5809 + 3211 = -2i + 5n, -2n + 9014 = -2i. Let y = -90061/20 - i. Find the common denominator of y and -1/14. 140 Let x = -10 + 23/2. Let m(u) = -u. Let s be m(1). What is the common denominator of s(-2 + (-309)/(-18)) and x? 6 Suppose 3a = a - 2d + 818, -3 = -3d. Suppose 0 = -r + 266 + a. What is the common denominator of -61/8 and r/(-36) - 8/(-36)? 8 Let r = -3 + 4. Suppose -3q = k - 14, 2q - k - 10 = -2k. Suppose -qf = 5y - f - 34, 0 = -2y + 4f - 2. Calculate the least common multiple of y and r. 5 Let n be (-99)/27 - (-2)/3. Find the common denominator of n - (60/(-14) - -1) and 26/3. 21 Let n = 2467/4 - 597. Calculate the common denominator of ((-4)/(-6))/(72/1053) and n. 4 Let x = 91 - 58. Calculate the common denominator of -109/18 and (3/(-12))/(x/294). 198 Let i = 26 - 4. Let w = -6 + 26. Calculate the smallest common multiple of i and w. 220 Let d(y) = -y*2 + 18y - 15. What is the least common multiple of d(17) and 8? 8 Calculate the lowest common multiple of 2 and (4/10)/((-4)/(-20)). 2 Let j(f) = -f*3 + 4f*2 - 1. Let u be j(4). Let i be -2 - (-1)/(u + 0). What is the common denominator of 225i/24 and -103/12? 12 Let x = 573 + -1748/3. Find the common denominator of 16/21 and x. 21 Suppose 21 = 6a + 3. Calculate the least common multiple of 3 and a. 3 Let s be ((-11)/5 - -1)20. Calculate the common denominator of (-1)/(-3) + 14/9 and (-2)/3819/s. 36 Let d = 1814/99 + 1/99. Let w = 5177/8 - 651. Calculate the common denominator of w and d. 24 Let j(g) = -g - 14. Let i be j(-10). Calculate the common denominator of (-186)/(-20) + (-2)/2 and (1/i)/((-2)/73). 40 Suppose 16 = -4u + 40. Suppose d + 3 - u = 0. What is the smallest common multiple of 8 and d? 24 Let t = 5/7814 + -2000459/117210. Let l = -2819/210 - t. What is the common denominator of 93/22 and l? 154 Let l = 257 + -2825/11. Calculate the common denominator of -91/4 and l. 44 Let a be 2/(2/(-6) + 1). Find the common denominator of a/(-30)41 - 2 and 55/6. 30 Let g = 38701/10 + -3859. Calculate the common denominator of 73/12 and g. 60 Let b = 20 - -13. What is the least common multiple of b and 6? 66 Suppose 0 = 2o - 0o - 28. Let g(l) = 3l2 - 2l - 3. What is the smallest common multiple of o and g(3)? 126 Suppose -8b + 28 = -52. What is the smallest common multiple of 11 and b? 110 Calculate the common denominator of -1/9 and 10/(-4)(-11)/15. 18 Let t = 2 + 3. Suppose 2w + 3 + 5 = 0, -tw - 11 = 3d. Calculate the smallest common multiple of d and 33/(-2)10/(-15). 33 Let s = 10 - 6. Let l(x) = 1 + x*3 + 0 - 3 + 7x*2 - 9x. What is the least common multiple of s and l(-8)? 12 Let n = 192223/15255 + -2/3051. Let d(t) = -3t + 2. Let r be d(4). Let x = 48 + r. What is the common denominator of x and n? 5 Let x(g) = -8g. Let a be x(-2). Suppose -a = -q + 14. Find the common denominator of 6/10 + (-146)/(-40) and q. 4 Let w = 135 - 129. What is the lowest common multiple of w and 9? 18 Find the common denominator of 102/(-56) - (-9)/(-36) and 8/3. 42 Let i(n) = 3n3 + 2n*2 - n. Suppose 2s = 34 - 10. Calculate the smallest common multiple of s and i(1). 12 Let i = -13 + 19. Let n = -2 + i. What is the smallest common multiple of n and 8? 8 Let h = -1 + 2. Calculate the lowest common multiple of 19 - h(-1 - -2) and -1(-17 - (-1 - -4)). 180 Let i = -2/47 + -1065/376. What is the common denominator of -101/4 and i? 8 Calculate the lowest common multiple of 17 and (-2)/(-6) + 17/3. 102 Let g = 10668 - 149455/14. What is the common denominator of 65/14 and g? 14 Let i be (-1026)/(-5) - (-4)/(-20). Find the common denominator of (-5)/50i/(-4) and 35/8. 8 Suppose -s - 4k + 11 = 0, -3s + 5k - 69 = -17. Let b = s + 20. Suppose -12 = -2h - 2h. Calculate the least common multiple of b and h. 33 Let v(y) = -y*2 + 9y + 6. Let u be v(7). Calculate the common denominator of 0/4 + 73/u and -97/14. 140 Suppose -5 = q + 3n - 15, 0 = 4n. Let m be 86/q + 2/5. Find the common denominator of 2/(-6)159/m and -41/3. 9 Suppose 6 = 2x - 4. Let g be x(-2 - -1)-10. Suppose 4s = -s + g. What is the lowest common multiple of 9 and s? 90 What is the common denominator of 59/12 - (11 + -9) and 89/16? 48 Let m = 362678/1019 - 545989401/1569260. Let l = 13/220 - m. Let n = 191321/8796 - 2/2199. What is the common denominator of n and l? 28 Let l = 0 + 9. Calculate the smallest common multiple of l and 18. 18 Let v = -38 - -49. Suppose -2x - x = -18. Suppose 5s = 4k + 25, -s + 2k + x = -5s. Calculate the smallest common multiple of v and s. 11 Let s = 56 - 57. What is the common denominator of s and -61/16? 16 Let r(t) = 17t2 + 1. Let x(w) = w - 11. Let y be x(5). Let g = 8 + y. What is the lowest common multiple of r(-1) and g? 18 Let z(n) = n2 - 9n + 9. Let q be z(8). Let a = 5 - q. What is the common denominator of (5 - a) + 186/20 and 79/2? 10 Let d = 10198178 + -10208379903/1001. Let c = 6/1001 - d. What is the common denominator of c and 41/3? 33 Let i be 1/(-4) - (-2501)/252. Let u = -10/63 - i. What is the common denominator of u and (278/6 + 2)/2? 6 Find the common denominator of 63/8 and 3/682/8. 8 Suppose 2f + 14 = 3o, 8 = -3f + o - 20. Let v = -4 - f. Calculate the lowest common multiple of v and 16. 48 Let r be 4/(-6) + 33	{ "pile_set_name": "DM Mathematics" }
ert 96.65573 nanometers to micrometers. 0.09665573 How many millilitres are there in seven quarters of a litre? 1750 How many months are there in fifteen quarters of a decade? 450 How many millimeters are there in 26/5 of a meter? 5200 What is twenty-five quarters of a week in hours? 1050 How many grams are there in one fifth of a kilogram? 200 Convert 20.2038kg to milligrams. 20203800 What is 8.247789 litres in millilitres? 8247.789 How many minutes are there in 29/3 of a week? 97440 Convert 99584.62 litres to millilitres. 99584620 Convert 41.62401 decades to months. 4994.8812 Convert 3141.294mg to nanograms. 3141294000 What is 7/2 of a century in decades? 35 What is 1679.876 grams in micrograms? 1679876000 What is 2196.0234 milliseconds in days? 0.0000254169375 How many micrograms are there in 11/2 of a milligram? 5500 Convert 3770.63kg to micrograms. 3770630000000 What is one sixteenth of a kilometer in millimeters? 62500 How many kilometers are there in 244.4704 centimeters? 0.002444704 How many decades are there in 3/10 of a century? 3 How many millilitres are there in 571.6009l? 571600.9 How many nanometers are there in 21/5 of a micrometer? 4200 What is three tenths of a litre in millilitres? 300 How many nanograms are there in three tenths of a microgram? 300 What is 6/25 of a litre in millilitres? 240 What is seven eighths of a kilometer in meters? 875 How many hours are there in 0.1602189 seconds? 0.00004450525 What is 379418.5 centimeters in nanometers? 3794185000000 How many millilitres are there in seven eighths of a litre? 875 Convert 15.3501 centuries to millennia. 1.53501 What is 42843.3 kilometers in meters? 42843300 How many kilograms are there in sixty-three eighths of a tonne? 7875 How many kilometers are there in 0.0311694 nanometers? 0.0000000000000311694 How many grams are there in thirty-seven halves of a kilogram? 18500 How many decades are there in 2298840.3 months? 19157.0025 How many milliseconds are there in 614.9972us? 0.6149972 How many nanometers are there in one sixteenth of a millimeter? 62500 How many years are there in 21/2 of a millennium? 10500 How many grams are there in 44/5 of a kilogram? 8800 What is 1/16 of a minute in milliseconds? 3750 What is eleven quarters of a kilogram in grams? 2750 Convert 630405.2 grams to micrograms. 630405200000 How many centimeters are there in 7/8 of a kilometer? 87500 How many micrometers are there in nineteen tenths of a centimeter? 19000 How many milligrams are there in sixty-three eighths of a gram? 7875 What is 1/4 of a kilometer in centimeters? 25000 What is three tenths of a gram in milligrams? 300 What is 11/4 of a millennium in years? 2750 Convert 364.7416 micrometers to nanometers. 364741.6 What is 18818.21l in millilitres? 18818210 What is 7.620815 millimeters in centimeters? 0.7620815 How many weeks are there in 24.9609087 nanoseconds? 0.00000000000004127134375 How many hours are there in 0.1763852 days? 4.2332448 How many kilometers are there in 147.989 centimeters? 0.00147989 What is 5/4 of a year in months? 15 What is ten thirds of a decade in months? 400 What is 2.268331 micrometers in millimeters? 0.002268331 What is 205.3603mm in kilometers? 0.0002053603 How many minutes are there in 66.35815 days? 95555.736 What is 873.117 millimeters in nanometers? 873117000 What is 757492.2 seconds in nanoseconds? 757492200000000 Convert 587616.2 nanograms to micrograms. 587.6162 What is 15/4 of a litre in millilitres? 3750 How many nanograms are there in 385.5217t? 385521700000000000 Convert 17021.17ng to grams. 0.00001702117 Convert 481.33mg to grams. 0.48133 What is 9907.667km in centimeters? 990766700 What is three sixteenths of a centimeter in micrometers? 1875 Convert 2.486721 years to months. 29.840652 What is 18318.3 microseconds in nanoseconds? 18318300 What is 17/4 of a litre in millilitres? 4250 Convert 3674.444 millilitres to litres. 3.674444 What is 67/4 of a hour in minutes? 1005 What is 13/8 of a millennium in years? 1625 Convert 8200.54 decades to months. 984064.8 How many millennia are there in 758.2635 months? 0.063188625 Convert 331753.4 micrometers to centimeters. 33.17534 How many minutes are there in 28/3 of a hour? 560 How many milliseconds are there in 4.18065 hours? 15050340 Convert 0.876337 decades to millennia. 0.00876337 How many years are there in 25/4 of a millennium? 6250 What is 328334.5g in milligrams? 328334500 What is 5/24 of a millennium in months? 2500 Convert 47.51897 tonnes to micrograms. 47518970000000 What is thirty-seven halves of a litre in millilitres? 18500 Convert 0.3382984ml to litres. 0.0003382984 How many micrograms are there in 54/5 of a milligram? 10800 What is 5.413521 nanograms in kilograms? 0.000000000005413521 Convert 742547.4us to nanoseconds. 742547400 How many minutes are there in 5089.017 nanoseconds? 0.00000008481695 What is 4782.647 grams in micrograms? 4782647000 How many minutes are there in 5/14 of a week? 3600 How many milligrams are there in 358.0212g? 358021.2 What is 27/5 of a meter in centimeters? 540 How many meters are there in 62.08824 centimeters? 0.6208824 How many microseconds are there in five eighths of a millisecond? 625 How many millilitres are there in eleven quarters of a litre? 2750 Convert 68378.3 decades to millennia. 683.783 How many grams are there in 445273.5 micrograms? 0.4452735 How many micrometers are there in 3.214117 nanometers? 0.003214117 Convert 2.528416ns to seconds. 0.000000002528416 How many minutes are there in 8/3 of a week? 26880 What is 33.32758 decades in months? 3999.3096 How many hours are there in 1/4 of a week? 42 What is three fifths of a week in minutes? 6048 What is 392.7705 nanometers in centimeters? 0.00003927705 What is 3.486676 nanometers in micrometers? 0.003486676 How many seconds are there in three eighths of a hour? 1350 What is 0.4139851 micrograms in tonnes? 0.0000000000004139851 What is 2/15 of a day in minutes? 192 How many centuries are there in nine tenths of a millennium? 9 What is 6946.771 litres in millilitres? 6946771 Convert 98.7409t to kilograms. 98740.9 What is 14.95719 millennia in decades? 1495.719 How many millilitres are there in 9/10 of a litre? 900 How many seconds are there in 0.0025495us? 0.0000000025495 What is nineteen quarters of a millennium in decades? 475 How many meters are there in 670.836nm? 0.000000670836 How many nanograms are there in 186.4323 grams? 186432300000 How many micrometers are there in 3/5 of a centimeter? 6000 How many nanometers are there in 0.8416451 centimeters? 8416451 Convert 342.7477m to centimeters. 34274.77 How many years are there in 49.85468 centuries? 4985.468 How many litres are there in 39288.15ml? 39.28815 How many millilitres are there in 29/5 of a litre? 5800 How many tonnes are there in 91833.43ng? 0.00000000009183343 What is 0.3889069 tonnes in micrograms? 388906900000 How many weeks are there in 73.9926873s? 0.00012234240625 What is 25552.93 centimeters in millimeters? 255529.3 How many millennia are there in 813.3536 decades? 8.133536 How many seconds are there in 1/100 of a week? 6048 What is 7925.967 kilometers in micrometers? 7925967000000 How many grams are there in eighty-seven fifths of a kilogram? 17400 Convert 79644.7m to nanometers. 79644700000000 What is one fifth of a kilometer in meters? 200 What is 0.9057284ng in grams? 0.0000000009057284 What is one tenth of a micrometer in nanometers? 100 How many millilitres are there in 44563.95l? 44563950 What is two fifteenths of a minute in milliseconds? 8000 How many millimeters are there in three tenths of a meter? 300 What is 515.1969 months in decades? 4.2933075 Convert 3.545029 milligrams to micrograms. 3545.029 Convert 15521.7 nanometers to meters. 0.0000155217 How many centimeters are there in 1/20 of a meter? 5 What is 70.23647ml in litres? 0.07023647 What is 25/2 of a litre in millilitres? 12500 How many nanograms are there in 6/5 of a microgram? 1200 How many centuries are there in 0.2726172 decades? 0.02726172 Convert 0.5286391ug to nanograms. 528.6391 What is 0.4075365 millilitres in litres? 0.0004075365 Convert 0.7099679 milligrams to micrograms. 709.9679 How many millilitres are there in fifty-three fifths of a litr	{ "pile_set_name": "DM Mathematics" }
4p3 + 527p*2 - 897p - 1675. Determine z(130). 15 Let v(f) = -36f2 + 2378f - 150. Determine v(66). -18 Let b(x) = -57x + 989. Give b(22). -265 Let s(k) = -2789k + 19641. Give s(7). 118 Let a(r) = -12r2 + 31r + 1014. Determine a(-8). -2 Let i(f) = -f*2 - 47f + 9134. Determine i(75). -16 Let o(l) = -1672l + 653459. Give o(391). -293 Let p(w) = 432733w + 1730937. Determine p(-4). 5 Let j(o) = 3497o - 80430. Calculate j(23). 1 Let u(i) = -i2 + 512i - 35238. What is u(82)? 22 Let c(w) = -4587w + 46014. Give c(10). 144 Let j(t) = -t3 + 6t*2 - 368t + 1449. Give j(4). 9 Let j(y) = -y*2 - 1528y + 65873. Determine j(42). -67 Let d(j) = j*3 + 358j*2 + 6732j + 42. What is d(-20)? 602 Let a(o) = 5777o + 1005175. Give a(-174). -23 Let j(k) = -7k*2 + 109k - 329. Calculate j(11). 23 Let o(n) = 5040n - 75616. Give o(15). -16 Let k(i) = i3 - 131i*2 - 7318i - 2174. What is k(-42)? 10 Let o(g) = -88g + 16021. Calculate o(182). 5 Let i(w) = -820w + 6951. Determine i(9). -429 Let a(y) = 3060y - 79461. Determine a(26). 99 Let p(d) = d3 + 185d*2 + 34267d + 6339394. Determine p(-185). -1 Let q(s) = 4s3 - 50s*2 - 183s - 1682. Give q(17). 409 Let t(i) = 4i2 - 696i - 8599. Determine t(186). 329 Let k(h) = 287h - 164744. Determine k(574). -6 Let a(u) = 1975136u + 17776231. Calculate a(-9). 7 Let z(g) = -3g3 + 49g*2 + 204g + 117. What is z(20)? -203 Let y(v) = -1596v - 90045. Calculate y(-59). 4119 Let o(q) = -317q - 759. Give o(-3). 192 Let l(q) = -9937q - 437296. Give l(-44). -68 Let r(u) = -u3 - 520u*2 + 3692u + 1637. Determine r(-527). 56 Let o(t) = -2t2 + 39t - 724. Determine o(23). -885 Let r(l) = l*2 - 370l + 10772. What is r(32)? -44 Let f(b) = 36b2 + 171b - 256. Calculate f(-6). 14 Let c(f) = -467f - 5745. Calculate c(-13). 326 Let g(i) = -111i + 3414. What is g(30)? 84 Let c(j) = -393j + 907. What is c(2)? 121 Let x(m) = -710m*2 + 486m + 493. What is x(-1)? -703 Let t(m) = 44m2 + 650m + 69. Calculate t(-15). 219 Let x(h) = -4h3 - 943h*2 + 100h - 32094. Give x(-236). 2 Let s(u) = 3u3 - 255u*2 - 21u + 56. What is s(85)? -1729 Let x(m) = m*3 + 228m*2 + 5960m + 597. Give x(-30). -3 Let s(i) = -3i3 + 26i*2 - 27i - 4. Calculate s(3). 68 Let z(h) = 61815h + 61803. Calculate z(-1). -12 Let a(o) = 1489o - 19360. Determine a(13). -3 Let l(q) = 792q - 160. What is l(-4)? -3328 Let j(a) = 91a - 18546. Give j(207). 291 Let z(c) = 2134c + 89832. Determine z(-42). 204 Let q(p) = -2p*2 - 8195p - 32809. Give q(-4). -61 Let q(t) = -2t3 - 46t*2 + 1113t - 1018. Calculate q(-38). 8 Let g(f) = -179f - 2329. Calculate g(-7). -1076 Let k(a) = -8a*2 + 1305a + 57126. What is k(199)? 13 Let u(z) = -18z2 - 198z - 232. Give u(-6). 308 Let s(f) = 191807f - 1534455. What is s(8)? 1 Let z(f) = -3f*3 - 24f*2 + 135f - 150. Determine z(-12). -42 Let b(z) = 10290z + 18379. Determine b(-2). -2201 Let p(i) = -51i*2 - 1437i - 109. What is p(-28)? 143 Let l(y) = -380y3 + 762y*2 - 31y + 61. Give l(2). 7 Let y(j) = 55j2 + 403j - 106. Calculate y(-4). -838 Let n(t) = 2t2 - 317t + 353. What is n(162)? 1487 Let v(h) = -16h3 - 101h*2 + 13h + 125. Calculate v(-6). -133 Let f(l) = -2227l - 269468. Give f(-121). -1 Let r(v) = -4v*2 - 129v + 2294. Determine r(17). -1055 Let f(m) = m*3 + 26m*2 - 237m + 70. Determine f(7). 28 Let r(y) = 2953y + 52766. Determine r(-19). -3341 Let w(z) = 7z*2 - 2026z + 56766. Determine w(258). 6 Let z(g) = -g*2 - 139388g + 836369. Determine z(6). 5 Let y(s) = 377s + 106635. Calculate y(-283). -56 Let a(c) = 57c*2 + 515c + 31. What is a(-7)? -781 Let h(z) = -3z2 - 3398z - 219178. Give h(-1064). 6 Let z(x) = 2216x + 201638. Give z(-91). -18 Let n(c) = -5c*2 - 121c - 315. Give n(-26). -549 Let m(v) = 69929v - 2237717. Give m(32). 11 Let a(k) = 7k*3 + 10k*2 - 100k + 1. Determine a(-8). -2143 Let x(i) = -14347i - 73200. What is x(-5)? -1465 Let q(m) = 2101m + 41236. What is q(-20)? -784 Let h(y) = 29y2 - 181y - 206. Give h(-1). 4 Let z(n) = -6097n + 48378. Calculate z(8). -398 Let t(a) = -a3 + 40a*2 + 1165a - 738. What is t(-20)? -38 Let x(j) = -j*3 - 18j*2 - 4j + 531. Determine x(-16). 83 Let p(k) = -2k2 - 189k + 45309. Calculate p(-205). 4 Let j(l) = -2l3 - 15l*2 - 5878l - 41158. What is j(-7)? -61 Let x(t) = 11t2 + 1602t + 4163. Give x(-143). 16 Let v(r) = 523r + 180615. Give v(-346). -343 Let o(v) = -v3 - 112v*2 - 161v + 95951. Give o(-101). 1 Let h(l) = 17862l + 71634. What is h(-4)? 186 Let q(h) = -35h*2 - 373h + 1899. Give q(4). -153 Let w(f) = -1707f2 - 8527f + 55. Calculate w(-5). 15 Let v(t) = 4204t - 31953. Give v(8). 1679 Let x(y) = -5y*2 - 1021y - 31666. Calculate x(-38). -88 Let i(s) = -61s2 - 6134s - 42880. Calculate i(-93). -7 Let y(u) = 19u2 + 217u - 76518. Calculate y(58). -16 Let w(x) = -x*3 - 31x*2 + 3331x + 2335. Determine w(-75). 10 Let b(c) = -5c3 + 45c*2 - 91c - 41. Give b(4). -5 Let z(h) = -22h2 + 9691h - 29086. Calculate z(3). -211 Let c(h) = -7h3 - 51h*2 - 119h - 1275. Calculate c(-8). -3 Let h(a) = 3a3 - 1290a*2 + 10132a - 1653. Give h(422). 35 Let o(s) = 17s3 - 3467s*2 - 170s - 6912. Give o(204). 24 Let s(a) = 44a2 - 1847a + 75. Determine s(42). 117 Let i(f) = -3f3 - 249f*2 + 275f + 1930. Determine i(-84). -2 Let v(h) = 115273h - 1844376. Determine v(16). -8 Let l(k) = -19975k + 139807. Calculate l(7). -18 Let k(j) = -126569j - 379697. What is k(-3)? 10 Let o(f) = -2f*3 + 1468f*2 - 2900f - 20494. Calculate o(732). 2 Let c(t) = -24t2 - 20t + 4. Give c(-2). -52 Let i(t) = 4159t - 844186. Give i(203). 91 Let d(r) = -r3 + 171r*2 - 4724r - 4653. Give d(136). 243 Let j(n) = -36158n - 506209. Give j(-14). 3 Let d(i) = -2i*2 - 1104i - 47596. Determine d(-47). -126 Let r(g) = -499180g + 1996733. Calculate r(4). 13 Let k(x) = x3 + 13x*2 + 1706x + 5012. Calculate k(-3). -16 Let k(d) = -231694d + 2. What is k(0)? 2 Let m(a) = -489a - 565. Determine m(0). -565 Let z(r) = 10r2 + 43r + 43. Give z(-1). 10 Let k(c) = -4645c + 9297. What is k(2)? 7 Let m(f) = -3f*3 - 468f*2 - 28f - 4564. Determine m(-156). -196 Let n(j) = -300879j - 17450989. Give n(-58). -7 Let z(c) = 6c*2 + 6c - 1075. Determine z(-14). 17 Let w(i) = -154i2 + 38i + 59. Give w(-2). -633 Let u(v) = v*3 - 59v*2 + 872v - 51420. Give u(59). 28 Let r(g) = 2g3 + 2g*2 + 6g - 108. Determine r(0). -108 Let d(v) = -4v3 - 4v*2 + 1079v + 1081. Give d(-1). 2 Let y(h) = 2h3 - 193h*2 + 2846h - 50. Give y(16). 4270 Let r(b) = 46857b + 374872. Give r(-8). 16 Let w(n) = -43801n + 306619. Give w(7). 12 Let l(s) = 6482s - 45337. Calculate l(7). 37 Let r(i) = 2i*3 - 57i*2 + 262i + 16. Calculate r(6). -32 Let u(p) = 46p3 - 31p*2 - 70p - 14. Give u(-2). -366 Let z(y) = 2y2 + 13y - 60. Determine z(-18). 354 Let n(w) = -2w2 + 306w + 5177. Give n(168). 137 Let z(v) = -v*3 + 18v*2 + 399v - 6833. What is z(22)? 9 Let k(p) = -1790p + 159306. Give k(89). -4 Let l(m) = -2m*3 - 28m*2 - 2258m - 43230. What is l(-18)? 6 Let h(p) = -2p2 - 295p - 10166. Calculate h(-93). -29 Let u(q) = 3q3 - 160q + 985. Give u(5). 560 Let l(q) = 3q2 + 269q + 3688. Give l(-17). -18 Let c(f) = 23948f + 191595. Give c(-8). 11 Let s(o) = -o3 + 38o*2 - 307o - 691. Determine s(24). 5 Let v(c) = 293c + 13443. Calculate v(-46). -35 Let b(g) = 26g3 - g2 + 55g - 143. Determine b(3). 715 Let h(y) = -2y*3 + 7y*2 + 43y - 157. What is h(4)? -1 Let o(s) = 7487s - 52387. Give o(7). 22 Let f(a) = -433a*2 - 2530a + 402. Determine f(-6). -6 Let u(p) = p*3 + 12p*2 + 95p + 747. Calculate u(-11). -177 Let d(w) = -224740w + 224746. Calculate d(1). 6 Let b(j) = -j3 - 8j*2 - 70j - 929. Give b(-10). -29 Let r(f) = 17f2 + 338f + 454. Determine r(-16). -602 Let i(q) = -q*3 + 36q*2 + 371q - 14211. Calculate i(35). -1 Let b(t) = 44077t - 1058121. Give b(24). -273 Let a(p) = -4722p*2 - 42496p - 47. What is a(-9)? -65 Let z(c) = -74c2 + 29654c + 8021. What is z(401)? 1 Let q(p) = 22083p + 1612039. What is q(-73)? -20 Let u(d) = d*	{ "pile_set_name": "DM Mathematics" }
2)/sqrt(5))/(5(sqrt(12) + sqrt(192)))13. -6sqrt(17)/25 Simplify 5 + (((sqrt(80)/sqrt(5))/sqrt(8) - -2sqrt(8)) + -5(sqrt(162) + 1 - sqrt(2) - (0 + sqrt(242))))*2 + -5. -200sqrt(2) + 825 Simplify -4(3 + -4(sqrt(1584) + sqrt(1584) + (sqrt(1584) - (sqrt(1584) + 2))) + sqrt(1584) + sqrt(1584)1 + -4 + sqrt(1584) + -2 + sqrt(1584) + -4)2. -101380 + 384sqrt(11) Simplify (0 + (sqrt(65)-1-6)/sqrt(5) + (-4sqrt(104)/sqrt(8) - (-5 + sqrt(52)/sqrt(4))))2. 10sqrt(13) + 38 Simplify (-4(6(sqrt(147)-1 + 1 - (sqrt(147)-2 + 0)) + 0))*2-2. -170496 - 16128sqrt(3) Simplify ((sqrt(14) + 2sqrt(14))-2-51)/((sqrt(12) - (sqrt(12) + -4sqrt(36)/sqrt(3)))/(6sqrt(24)/sqrt(4))). 45sqrt(7) Simplify 4(-2((sqrt(1539) + 2)3 + 2-3sqrt(1539) + sqrt(1539))-4)*2. -55296sqrt(19) + 1585152 Simplify (2 + (1 + sqrt(1331) + -2 + sqrt(1331) + sqrt(1331)1 + 5 - 1(-6(0 + sqrt(1331)) + sqrt(1331))3))*2. 2376sqrt(11) + 431280 Simplify (-4(sqrt(204) - sqrt(204)-2) - (sqrt(204) - (sqrt(204) - (sqrt(204) - (51sqrt(204) - sqrt(204))))))/(-3(1sqrt(384))/sqrt(8)). 3sqrt(17)/2 Simplify ((2 + (-1sqrt(396) + sqrt(396))-4 + -1 + ((sqrt(396) - (sqrt(396) - (sqrt(396) + -1) - sqrt(396))) + sqrt(396))-6)-6)2. -54432sqrt(11) + 4620708 Simplify (sqrt(405)11 + -4 - -6(sqrt(405) + -21sqrt(405) - sqrt(405)))2-3. -147063 - 2376sqrt(5) Simplify ((1sqrt(88)-2)/(sqrt(4) + (5sqrt(16)/sqrt(4) - sqrt(4)) + sqrt(4)))/(6(6(-4sqrt(275) + sqrt(275)) + sqrt(275))). sqrt(2)/1530 Simplify (-3(sqrt(1053) + 5(-1 + sqrt(1053)) - sqrt(1053) - sqrt(1053)) + 3 + 1 + 4 + sqrt(1053) + 1 + -1 + sqrt(1053))2. -4140sqrt(13) + 105829 Simplify 4 + (sqrt(56) - (sqrt(616)-1)/sqrt(11))/sqrt(8) + -5 + (1sqrt(175)-4 + 1 + ((-1 + sqrt(175))2 + sqrt(175) - sqrt(175)))-5. -886 + 152sqrt(7) Simplify sqrt(5808) + 1 + 2 - (-3(sqrt(90)/(1sqrt(6)))/sqrt(5))2. -24 + 44sqrt(3) Simplify (4-6sqrt(468)-5 - -1(sqrt(325) + sqrt(325) + (-4 + sqrt(325) - sqrt(325)) + 0)*2) + 5. 1321 + 640sqrt(13) Simplify ((sqrt(88) - (sqrt(88)2-1 + sqrt(88)))/(-2sqrt(512)) - sqrt(33)/(sqrt(147)-3 - sqrt(147))-4)2-1. -2475/3136 Simplify -5((5-6sqrt(13)1-1 - (sqrt(130) - (sqrt(130)2 + sqrt(130))1)/(sqrt(10) - -1sqrt(490)))-1)2. -951665/16 Simplify (1(-2sqrt(3456) - sqrt(3456)) - (sqrt(3456) - (-12sqrt(3456) + sqrt(3456) - sqrt(3456))))/(52sqrt(800) + 31sqrt(800) + sqrt(800)) + 1. -18sqrt(3)/35 + 1 Simplify (4 + -4(sqrt(1300) + 3) - (1-1sqrt(1300) - (-2sqrt(1300)-6 + sqrt(1300))))2-2 + -3. -260131 + 3200sqrt(13) Simplify (3((1 + sqrt(75))6-4 + sqrt(75)-1 + -3 + -4) + -5)2. 73500sqrt(3) + 431479 Simplify (32(sqrt(891) - (sqrt(891) + -3sqrt(891)) - sqrt(891)) + sqrt(891) + -2 + 4 + 1 + -4)2. -234sqrt(11) + 150580 Simplify -4((-1sqrt(2299) + -1 - ((sqrt(2299) + sqrt(2299)2 + sqrt(2299))-4 + sqrt(2299)))*2 + ((sqrt(2299) + 0)5)*2 + 5) + -2. -2032342 + 1232sqrt(19) Simplify (-1sqrt(76))2 + -2 + sqrt(76)3-5 - (6(1 + sqrt(76) + 1 + sqrt(76) - -5-2sqrt(76)))*2. -175174 + 2274sqrt(19) Simplify 1 + (-5 + 1 + sqrt(2048) + -2 + 0 + sqrt(2048) + (sqrt(2048) + sqrt(2048)-1)-2-1)2. -768sqrt(2) + 8229 Simplify sqrt(170)/sqrt(90) + (sqrt(68))*2 + 3 - sqrt(34)/(sqrt(2) + sqrt(2) + (sqrt(2) - (sqrt(2) + -2sqrt(162))))2. 7sqrt(17)/30 + 71 Simplify ((sqrt(117)-3 - sqrt(117))/sqrt(9) - (sqrt(117) + 2 - sqrt(117))2) + ((sqrt(325) + 3)2 - (sqrt(78)/sqrt(24) + sqrt(13) - sqrt(13))2)5. 146sqrt(13) + 6599/4 Simplify (2(sqrt(96) - (sqrt(96) + (2((sqrt(96) - -1sqrt(96)) + sqrt(96)) - sqrt(96)) + sqrt(96)) - sqrt(96)))/(-2sqrt(3)-26-2). 7sqrt(2)/6 Simplify (sqrt(330)/(sqrt(55)/sqrt(5)) + sqrt(1920) + -1sqrt(1920) + sqrt(30))/(sqrt(54)-51) + -4. -4 - 2sqrt(5)/15 Simplify (((sqrt(72) + sqrt(72)-2 - sqrt(72))-3)/(sqrt(8) + sqrt(8)-2-4 - sqrt(8)))/((sqrt(90)/(sqrt(20)/sqrt(4)))/(2(sqrt(6) - sqrt(6)2))). -3sqrt(3)/2 Simplify ((sqrt(6) + sqrt(96)/sqrt(4))-14)/((sqrt(80) - (sqrt(80)1 + sqrt(80)) - sqrt(20))/(-6sqrt(20)/sqrt(2))). -24sqrt(3) Simplify -2((6(2sqrt(147) - sqrt(147)))*2 + 1 - ((2 + sqrt(147)-1 + sqrt(147) + sqrt(147))*2 + 0))3. -30852 + 168sqrt(3) Simplify 32(-4 + sqrt(117) + 1 + sqrt(117) + 3 - ((sqrt(117) + -2(sqrt(117) - -1sqrt(117)) - sqrt(117)) + 5)2)-4. -3024sqrt(13) + 45528 Simplify (-3(sqrt(204)/((sqrt(6) - sqrt(6)-1)-5))/((sqrt(288) + sqrt(288)-3)6))*2. 17/230400 Simplify -5((sqrt(363)-1 + 1)2 - (-5 + 0 + sqrt(363)) - (((sqrt(363) + 0 + sqrt(363) - sqrt(363))1)*2 + -5)). -55 + 165sqrt(3) Simplify -3 + (-1 + sqrt(153))*2 + sqrt(68)/(sqrt(36)/sqrt(144)) + (-3-2sqrt(612))2-1 + -3. -21884 - 2sqrt(17) Simplify (-4sqrt(675)2 + -2(sqrt(675) - (sqrt(675)2 + sqrt(675))))/((-13sqrt(72))/(sqrt(24)/sqrt(3)-1)). -20sqrt(3)/3 Simplify (-1sqrt(154)/(sqrt(11) + (sqrt(11) - -3sqrt(11)))-3)/(-6(sqrt(112) - 4sqrt(112))3). sqrt(2)/360 Simplify (-1sqrt(11)5 - (-1(sqrt(11)-1 - sqrt(11)) - sqrt(11)) - (-3 + sqrt(11) + 0 + sqrt(1100) + 3))2 + 2. 3181 Simplify 0 + -3 + (sqrt(171) + ((sqrt(171) + -2)-2 - sqrt(171)))*2 + -1(sqrt(171) - (0 + sqrt(171))) + -2 + -2. -48sqrt(19) + 693 Simplify (sqrt(315) + ((sqrt(315) + (sqrt(315)-2 - sqrt(315)))-2 - sqrt(315)))/(sqrt(20)/sqrt(4)2 + sqrt(5) + sqrt(320))-5 + 1. -60sqrt(7)/11 + 1 Simplify ((sqrt(77) - (sqrt(77) + (sqrt(77) - -1sqrt(77)) + sqrt(77)))-26-1)/(sqrt(35)/sqrt(80) - (sqrt(448) - sqrt(448)1)). -144sqrt(11) Simplify ((6(sqrt(152) + sqrt(152) + sqrt(152)-1 + sqrt(152)) - sqrt(152)2-2)/((sqrt(24)-1)/sqrt(3) + sqrt(32)4) + 2)2. 4 + 32sqrt(19)/7 Simplify (sqrt(14) - (-1sqrt(112))/sqrt(8))/((sqrt(48)/sqrt(4))/sqrt(6)) - (-4 + ((sqrt(77) + sqrt(77) + (sqrt(77) - 2sqrt(77)))1)/sqrt(11))-5. -20 + 7sqrt(7) Simplify (((-2 + sqrt(171))2 + sqrt(171) + sqrt(171)-2 + -4 + sqrt(171))2 - ((1 + 2 + sqrt(171))2 + 3 + sqrt(171) + 2)) + 3. -117sqrt(19) + 566 Simplify ((3((sqrt(6655) - sqrt(6655)2) + sqrt(6655))1)/(-3sqrt(275)-23))*2. 0 Simplify ((0 + sqrt(288) + 1 - sqrt(288)) + 2 + -3 - (sqrt(100)-2)/(sqrt(2) - sqrt(18)3))2 + -1. 17/8 Simplify (sqrt(228)-12)/(6sqrt(108)) - (-4sqrt(931)-5 + -5). -1261sqrt(19)/9 + 5 Simplify (-45(sqrt(136) + (sqrt(136) - (sqrt(136) - sqrt(136)2)))-6)/((sqrt(360)-3)/(sqrt(25)/sqrt(20))) + -2. -20sqrt(17) - 2 Simplify (sqrt(612)2 + 0 + (sqrt(612) - 1sqrt(612) - sqrt(612)) + -1 + 3 + (sqrt(612)3 + 1 - sqrt(612)))*2. 108sqrt(17) + 5517 Simplify (sqrt(3456)-3 - sqrt(264)/sqrt(539))/((sqrt(180)/sqrt(3)2 - sqrt(60))/(sqrt(25)/(sqrt(20)/sqrt(4)))). -253sqrt(2)/7 Simplify 4(2(sqrt(156)-1 - sqrt(156)) + (sqrt(156) - (sqrt(156) - -1sqrt(156)))4)/((sqrt(12) - 3sqrt(12)4)1)-2. -64sqrt(13)/11 Simplify ((sqrt(513)/sqrt(9) - sqrt(57))/sqrt(3) - -5(sqrt(1216) - sqrt(19) - sqrt(19))) + (4 + sqrt(57)/sqrt(3) - (sqrt(76) + 1)) + 0. 3 + 29sqrt(19) Simplify ((-5(sqrt(300) + -1sqrt(300)-4 + sqrt(300) + sqrt(300))/sqrt(10))/(-1(-1sqrt(120)2)/sqrt(12)))2. 3675/4 Simplify (-2(sqrt(132)3 - sqrt(132)) - (sqrt(132)2 + sqrt(132))1)/(sqrt(12)1-6 + sqrt(240)/sqrt(5) + sqrt(48)). 7sqrt(11)/2 Simplify ((1 + sqrt(405) + sqrt(405))1-3 + 4 - -6((sqrt(405) - -4(sqrt(405) - (sqrt(405) + 1))) + sqrt(405) + (sqrt(405) + 0)5))2. -14904sqrt(5) + 525409 Simplify -6(-4 + 4(-1 + sqrt(450)) + sqrt(450)-1 + -4 + -5(-1sqrt(450) + sqrt(450)))22. -50328 + 12960sqrt(2) Simplify (-2 + sqrt(171) + (sqrt(171) + sqrt(171) + -2)2 - (1 + 1sqrt(171) - sqrt(171))*2) + (-5sqrt(171)-12)*2 + 5. -21sqrt(19) + 17790 Simplify (2 + (0 + sqrt(147) + (sqrt(147) + -1 - sqrt(147)) + 5)*2 - ((sqrt(147) + (sqrt(147) + 1)1 + 3)*2 + 0)) + -1. -440 - 56sqrt(3) Simplify -1(2-2(sqrt(1008) + -1 + sqrt(1008) + 3)-6 + 5)*25. -11626205 - 305280sqrt(7) Simplify ((sqrt(1300)15)22 + (4 + 3sqrt(1300)1)*2)2. 480sqrt(13) + 153432 Simplify (-4sqrt(1050)1 + sqrt(1050) + (3(sqrt(1050) + 2sqrt(1050)) - sqrt(1050)))/(sqrt(48)/sqrt(8)-2 - -6(sqrt(96) + sqrt(6))). 25sqrt(7)/28 Simplify ((sqrt(100)/(1sqrt(10)))/(4sqrt(20)/sqrt(4)))*2 - (3sqrt(4050))*2-3. 874801/8 Simplify -3 + ((sqrt(35) - (sqrt(315) - (sqrt(315) + sqrt(315)*-1)))/(	{ "pile_set_name": "DM Mathematics" }
(a) 0.01 (b) -4/3 (c) 3/29 (d) 2/21 a What is the biggest value in 8, 4/9, 0.25? 8 What is the fourth smallest value in 0.1, -4, -0.1, 2/5? 2/5 What is the biggest value in 2/7, 0.08, 3, -5/7? 3 Which is the third smallest value? (a) -1 (b) 4 (c) 2 b Which is the fourth biggest value? (a) -2/3 (b) 5 (c) -2/5 (d) -1/3 a Which is the fourth smallest value? (a) -5 (b) 0.2 (c) -43 (d) -1.8 b What is the fourth biggest value in -7, -4, -3, -1/6, 0.1? -4 Which is the smallest value? (a) 0.1 (b) -31.1 (c) 0.5 b Which is the second smallest value? (a) -7 (b) 356 (c) -0.4 (d) -4 d Which is the smallest value? (a) 2/11 (b) 4 (c) -287/4 (d) 1 c What is the smallest value in -4, 1, 9, -23? -23 What is the second smallest value in 3, 0.2, -8/5? 0.2 What is the smallest value in 2/5, 1/103, -0.1? -0.1 Which is the fourth smallest value? (a) 0.09 (b) -0.1 (c) -5 (d) -2 (e) 1 a What is the third smallest value in 7.7, -0.3, 5? 7.7 Which is the smallest value? (a) 12 (b) 0.015 (c) -0.4 c What is the second biggest value in -2, 4, 3/4, 3/11, -13? 3/4 What is the smallest value in 2/7, 0.12, -1, -0.32? -1 What is the third biggest value in 3/5, -2/3, -68? -68 Which is the third smallest value? (a) 5 (b) 1/11 (c) -0.3 (d) -4 (e) 7 b What is the second smallest value in -6, -5, 21, -2/11, -0.2? -5 What is the fourth smallest value in 1/4, 7, 14, -0.2? 14 What is the smallest value in -3, -5, -12/55? -5 Which is the fourth biggest value? (a) 2/5 (b) 5 (c) 4 (d) -10 (e) 28 a What is the second smallest value in -12, 1, 0? 0 What is the third biggest value in 28, -5, 2/5? -5 What is the third biggest value in 1/7, -2016, 0.5? -2016 Which is the fourth smallest value? (a) -2/243 (b) -1 (c) 3 (d) 0.2 c What is the third smallest value in -4/3, 1180, -4/9? 1180 Which is the third biggest value? (a) -0.1 (b) 1/6 (c) -385 c Which is the second biggest value? (a) 3 (b) -836 (c) 5 a What is the second biggest value in -2/5, -5/2, -1/5? -2/5 What is the second smallest value in 3/2, -132, -8? -8 Which is the fifth smallest value? (a) -5 (b) -6 (c) -3 (d) 2 (e) -1 d Which is the smallest value? (a) 0 (b) 0.025 (c) 5 a What is the fourth smallest value in 2/153, -3/5, -2, 2? 2 Which is the fourth smallest value? (a) -2/9 (b) 4 (c) -0.0759 (d) 5 d Which is the third biggest value? (a) -9/5 (b) 1/22 (c) -5 (d) -14 c What is the third smallest value in 0.3, 2, 0.145? 2 What is the second smallest value in -1, 0.5, -525? -1 Which is the second smallest value? (a) 2 (b) 4 (c) -0.1 (d) 10 (e) 1/10 e Which is the third smallest value? (a) 17 (b) 2 (c) -0.2 a Which is the biggest value? (a) -4 (b) 31 (c) 6/11 (d) 0 b What is the second smallest value in -845, -5, -3, 0.1? -5 What is the third biggest value in 31, 2/5, -0.4, 2? 2/5 What is the third smallest value in 4, -5, -7, -1.2? -1.2 What is the fourth biggest value in 0.2, -7, -4/3, 4? -7 What is the fourth biggest value in -2/3, 2, 4/5, 3, -5? -2/3 What is the fourth smallest value in 4, 2, 7/5, 3? 4 What is the smallest value in 2, -3.75, -4? -4 What is the fourth biggest value in 0.4, -0.8, 65, -3, 1? -0.8 Which is the second biggest value? (a) 0.5 (b) 2/3 (c) -16 (d) -3/5 a Which is the fourth smallest value? (a) 20 (b) -18 (c) -1/5 (d) 2/5 a Which is the third smallest value? (a) 18.8 (b) -2 (c) -0.2 a Which is the fourth biggest value? (a) 0.2 (b) 1/25 (c) -2 (d) 3 c What is the third biggest value in 673/4, -4, -0.3? -4 Which is the third smallest value? (a) 1/3 (b) 3 (c) -1 (d) 0.3 a What is the smallest value in 2, -2/7, -3/5, -22? -22 What is the fifth smallest value in 3/4, -2/9, -29, 3, 2/5? 3 What is the fourth biggest value in -3, -2/31, 2, -1? -3 Which is the second smallest value? (a) -6 (b) -2/5 (c) 43 b What is the second biggest value in 1/13, -20, 0.06? 0.06 What is the fifth biggest value in -4, 2, -5/8, -7, 0? -7 What is the smallest value in 11, -74, 1/5? -74 What is the second biggest value in -2/9, 2/17, 0.1, -2/35? 0.1 Which is the biggest value? (a) -3 (b) -2/5 (c) -0.29 c Which is the second biggest value? (a) -9/7 (b) 0.2 (c) -1/3 (d) -2 c What is the fifth smallest value in -2/7, -215, -1/2, -3, 0? 0 What is the second smallest value in -74, -1/6, -1/4? -1/4 What is the fourth smallest value in 1/11, 4, -0.5, -4/5? 4 Which is the third biggest value? (a) -12 (b) -1 (c) 2/5 (d) -2/13 (e) 0.44 d Which is the second biggest value? (a) -0.4 (b) -5 (c) -44 (d) 0.3 a What is the smallest value in -9, -5, -1/7, -1/4? -9 What is the second biggest value in -1, 0.336, -0.1? -0.1 Which is the fourth smallest value? (a) -1/2674 (b) -3 (c) -0.5 (d) -1/4 a Which is the smallest value? (a) 85/91 (b) 3/7 (c) 2 b Which is the biggest value? (a) -2 (b) 3 (c) -1/3 (d) 40 d What is the second smallest value in -1/3, -35, 0.3, 5? -1/3 Which is the second biggest value? (a) -1/7 (b) -0.1 (c) 8 (d) 0.3 d What is the second smallest value in -3/11, 216, 3? 3 Which is the third biggest value? (a) 4 (b) 2 (c) 2/47 (d) 2/7 d What is the fifth smallest value in 0.1, -2/3, 3, -1, -2/7? 3 Which is the third smallest value? (a) -0.4 (b) 60 (c) -1/6 b Which is the biggest value? (a) -13 (b) 1 (c) 4 (d) -4 c Which is the biggest value? (a) -1/4 (b) 2 (c) -4 (d) 1/7 (e) 625 e Which is the fourth biggest value? (a) 0.3 (b) -0.1 (c) -5 (d) 3/5 (e) 28 b What is the third biggest value in 3/5, -4, 431, -5? -4 Which is the fourth biggest value? (a) -3 (b) -1 (c) 0.78 (d) 4 a What is the second smallest value in 21, 2/51, -2? 2/51 Which is the second smallest value? (a) 1 (b) -2 (c) -0.2 (d) -15 b Which is the second biggest value? (a) -5 (b) -2/29 (c) 18 (d) -4 b Which is the smallest value? (a) 2/17 (b) -2/5 (c) -32 c Which is the biggest value? (a) -0.3 (b) -311 (c) 3 (d) -3 (e) 2 c What is the third smallest value in -1/4, 0.1, 4/7, 73, -12? 0.1 What is the second biggest value in -1/521, 3, -0.5? -1/521 What is the biggest value in -4, 57, -2, 1? 57 Which is the third biggest value? (a) -2 (b) -1.85 (c) -2/3 a Which is the smallest value? (a) 2/3 (b) -1/321 (c) -0.4 c Which is the second smallest value? (a) -2/5 (b) 10.19 (c) 2 c What is the smallest value in 1, -2/7, 4, 15? -2/7 Which is the smallest value? (a) 56.5 (b) -2/13 (c) 3/5 (d) 1/6 b Which is the second smallest value? (a) -5 (b) 0 (c) 49.2 (d) 5 b Which is the fourth biggest value? (a) 5 (b) -13/5 (c) -0.05 (d) -0.4 b Which is the second smallest value? (a) 1/3 (b) 1/11 (c) -131 b Which is the third biggest value? (a) 8 (b) -153 (c) 3 b Which is the third smallest value? (a) -14 (b) -0.11 (c) -5 b Which is the fourth biggest value? (a) -1 (b) -1/3 (c) -3/7 (d) -0.5 a Which is the second biggest value? (a) -1/9 (b) -2.9 (c) 3 (d) -2 a Which is the second biggest value? (a) 0.08 (b) 7/8 (c) -2/7 a Which is the second smallest value? (a) -0.04 (b) 5 (c) -3/5 a What is the smallest value in -58, -0.2, -0.1? -58 What is the fifth biggest value in -1/4, 1.709, 1, 2, -0.4? -0.4 Which is the second biggest value? (a) 1366 (b) -1/2 (c) 0.5 c Which is the second smallest value? (a) 2 (b) -1 (c) 2/19 c Which is the second biggest value? (a) 0.5 (b) -5.9 (c) 0.3 c What is the fourth biggest value in -4, -2, -0.2, 1/3? -4 What is the fifth smallest value in 3, 5, 51, -0.1, -2/11? 51 What is the second biggest value in -22, 32, 0.3? 0.3 What is the third biggest value in 9.3, 0.1, -1? -1 Which is the fourth smallest value? (a) -0.5 (b) -1/3 (c) 96 (d) 2 c What is the fourth biggest value in 28, 1, 0.5, -1? -1 Which is the third smallest value? (a) 0.3 (b) -0.11 (c) -5 (d) 4 (e) -3/8 b Which is the fourth smallest value? (a) 17.3 (b) 3/5 (c) 5 (d) -4 a What is the third smallest value in -3, 0.14, 4? 4 Which is the second biggest value? (a) 1/6 (b) -8/3 (c) 28 (d) 2/7 (e) 2 e What is the fourth smallest value in -5, 0.5, 42, -12? 42 Which is the second biggest value? (a) 4 (b) 5 (c) -0.3 (d) 4/5 a Which is the second biggest value? (a) -6 (b) -40 (c) 1/2 (d) -0.5 d What is the third smallest value in -0.28, 5, -76, -2/7? -0.28 What	{ "pile_set_name": "DM Mathematics" }
-279))/((-2)/(-6))? 491 Let m(y) = 8y + 242. Let t = -12 + 12. What are the prime factors of m(t)? 2, 11 Suppose 0 = -41k + 37k + 1080. Let d = k - 104. What are the prime factors of d? 2, 83 Let k(x) = 53x*2 - x - 2. Suppose 3r + 7 + 2 = 0. Let v be -2 + (1 - (-3 - r)). List the prime factors of k(v). 2, 13 Let p = -1 + -6. Let x = 62 + p. List the prime factors of x. 5, 11 List the prime factors of (1 - 26724/(-32)) + 3/(-24). 2, 11, 19 Let m(z) = 7z + 12. Let s(l) = 4l - 10. Let v(i) = 3i - 7. Let t(j) = 5s(j) - 7v(j). Let r(u) = -m(u) - 5t(u). List the prime factors of r(-7). 7 Let u be (-60)/(-4) - (-3 + 1). Let a = 71 + -47. Let f = a - u. List the prime factors of f. 7 Let n be ((-565)/10)/((-2)/(-4)) - 6. Let b = -95 - 99. Let j = n - b. What are the prime factors of j? 3, 5 Suppose -4l - 5i - 469 + 2125 = 0, -3l - 3i + 1242 = 0. List the prime factors of l. 2, 3, 23 Let b(u) = u*3 + 5u*2 - 6u + 5. Let y be b(-6). What are the prime factors of (-32)/(-60)y/254? 2, 3 Let d(a) = 3a2 - a - 1. Let q be d(2). Let i(h) = h - 2. Let s be i(q). Suppose 3b - 5m = 12, 4b + 4m - 9 = s. List the prime factors of b. 2 Let j(s) = s2 - s. Let r(d) = -d3 - 12d*2 + 8d - 5. Let h(x) = -6j(x) - r(x). What are the prime factors of h(-6)? 17 Let g(t) = -t3 - 7t*2 + 1. Let u be g(-7). Let r(w) = -9w + 3w - 8w - u + 0w. What are the prime factors of r(-2)? 3 Suppose -5 = -q, 3u - 4q = -q + 207. Let d = u - -24. Suppose 0 = l + p - 33 + 7, d = 4l + p. List the prime factors of l. 2, 3 Let h = 431 + -122. What are the prime factors of h? 3, 103 Suppose -5j + 4h = -10 - 26, 2j = -h + 4. Suppose ju - 3 = 73. Let d = 27 - u. What are the prime factors of d? 2 Let k(p) = p*3 - 6p*2 + 6p - 7. Let f be k(5). Let a be (55 - -1)/((-1)/f). List the prime factors of 1/(-5) + a/10. 11 Let d be (2 - 2)6/(-6). Let h be (1 - 4 - -2)-3. Suppose da = ha - 75. List the prime factors of a. 5 Let d = 543 + -85. What are the prime factors of d? 2, 229 Let d be (-3)/9 - (-40)/12. Suppose j - 5i + 0 = 3, j - 4i = d. Suppose -jp + 220 = 2p. What are the prime factors of p? 2, 11 Let h be (-847)/22(-3 + 1) + 0. Suppose 6j = -h + 221. What are the prime factors of j? 2, 3 Suppose 0 = -3u + 2k + 548, 7k = -u + 5k + 172. What are the prime factors of u? 2, 3, 5 Let i = -14 + 18. Suppose -5z + z = -i. Let f(b) = 8b3 - b2 + 1. List the prime factors of f(z). 2 Let n(d) = -d*3 - 9d*2 - 6d - 8. Let a(y) = 4y3 + 37y*2 + 23y + 33. Let l(f) = 2a(f) + 9n(f). List the prime factors of l(-7). 2, 5 Suppose -209y = -249y + 20440. What are the prime factors of y? 7, 73 Let o be 2(-10)/5-2. Suppose q - 4 = -0n + 2n, -2n = 4. Suppose qt + o = t. List the prime factors of t. 2 Let g(q) = 21q3 - 341q*2 + 7q + 11. What are the prime factors of g(17)? 2, 2377 Let b(f) = f*3 + 33f*2 + 36f + 35. List the prime factors of b(-30). 5, 331 Suppose 3g + o + o - 16 = 0, 5o = 4g + 17. Suppose -4z - 5a + 4a + 11 = 0, -gz = -5a - 33. What are the prime factors of z? 2 Suppose -2g + 134 = -654. What are the prime factors of g? 2, 197 Suppose -5 = z, -2z + 0z = -4i + 2106. List the prime factors of i. 2, 131 Let o = 222 - 220. Let f(x) = x + 8. Let t be f(-6). Suppose -op + 120 = tp. What are the prime factors of p? 2, 3, 5 Let a be (2/(-5) - -1)/(6/210). List the prime factors of (-1)/((-5)/328) + a/(-35). 5, 13 Let u be (-2 - -2) + 4 + -4. Suppose 0a - v - 409 = -3a, u = -4a - 4v + 556. Suppose -3s - 344 = -5i, 0i = 2i - s - a. What are the prime factors of i? 67 Let k = -1650 + 2763. List the prime factors of k. 3, 7, 53 Let y = 282 + -150. Let a = y - 75. List the prime factors of a. 3, 19 Let f = -206 + 123. Let o = f - -175. List the prime factors of o. 2, 23 Let n = -792 + 2297. What are the prime factors of n? 5, 7, 43 Let j(w) = 11w - 3. Suppose 9q - 7 = 8q. Suppose 17 - q = 2k. What are the prime factors of j(k)? 2, 13 Let j be -17 + 5(-6)/(-10). Suppose -7a = -3a + 48. Let w = a - j. What are the prime factors of w? 2 Let z = -31 + 33. Suppose -za = 23 - 163. List the prime factors of a. 2, 5, 7 Suppose 3x - z - 13 + 4 = 0, z - 3 = -3x. Suppose -4t - 52 = 4m, t - 31 = xt - 5m. Let l = t - -31. What are the prime factors of l? 3, 5 List the prime factors of 5448/30 - (-4)/10. 2, 7, 13 Let q = -4 - -13. Let a(h) = 6h - 21. What are the prime factors of a(q)? 3, 11 Suppose 5f = 3f + 26. Let s = 3 + -6. Let c = f + s. List the prime factors of c. 2, 5 Suppose -2b - b = 0. Suppose -3v + 83 + 10 = b. Let m = v - -6. What are the prime factors of m? 37 Let u be 2 - (-1 + -2 + -1 + 2). Suppose -ux + 0x = 3r - 74, 70 = 3r + 5x. List the prime factors of r. 2, 3, 5 Suppose 2n + 35g - 37g - 1670 = 0, 3g + 841 = n. What are the prime factors of n? 2, 13 Suppose -6 = -4v + 6. Suppose -va = -a - 8. Suppose -am + 18 + 50 = 0. List the prime factors of m. 17 Let s(v) be the first derivative of 16v*2 - v - 6. List the prime factors of s(2). 3, 7 What are the prime factors of (-7713)/(-7) + (270/63)/(-5)? 3, 367 Let c = -10 - -22. Let u = c - 12. Suppose u = 5q + 25, 4z + 3q = 2q + 171. List the prime factors of z. 2, 11 Let u(b) = b3 - b2 - b + 1. Let p be u(-1). Suppose -3d + q + 226 = p, 0d + 3d = -2q + 214. List the prime factors of d. 2, 37 Let b be -5 - (-3 - -1)/(-1). Let m = -5 - b. Suppose -2g + 5g - mk = 58, 2k = -5g + 102. List the prime factors of g. 2, 5 Let c = -6 + 6. Suppose -77 = -u - cu. List the prime factors of u. 7, 11 Let o(b) = -23b3 + b2 - 2b + 2. Let w be o(1). Let m be (-40)/22 + 4/w. What are the prime factors of (m + 76/12)3? 13 Suppose 69j - 73j - 4b + 5472 = 0, 0 = j + 2b - 1367. What are the prime factors of j? 37 Let r be 6/9121/2. Suppose 4b + rc = 596, -147 = -2b + c + 139. List the prime factors of b. 5, 29 Let f(b) = b3 - b2 + 9b + 14. Let s be f(0). Let o be -6 + 2/(2 - 0). List the prime factors of s + (4 + o - -1). 2, 7 Let k be (-50)/(4/(-28)1). Suppose -3p = -8p - 5t + k, -5t = 2p - 146. List the prime factors of p. 2, 17 Suppose -10 - 8 = -3x. Let a(w) = -w3 + 7w*2 + 3w - 1. List the prime factors of a(x). 53 Let a(n) = 15n + 704. List the prime factors of a(0). 2, 11 Suppose z = 3, -5g - 5z + 374 + 4111 = 0. What are the prime factors of g? 2, 3, 149 Let c(i) = 100i - 433. What are the prime factors of c(23)? 1867 Let b(c) = c + 31. Let z be b(-16). List the prime factors of z + 74 + -31. 2, 43 Let s = 77 + 448. What are the prime factors of s? 3, 5, 7 Let s = 579 - 462. What are the prime factors of s? 3, 13 Suppose o + 14 - 4 = 0. List the prime factors of (186/(-9))/(0 + o/15). 31 Suppose a - 4m = 13, a - 2 = 2m + 5. Let t = a + 5. Suppose -o + 40 = -t. What are the prime factors of o? 2, 23 Suppose 0q - 1687 = -4q + 3t, -3q - 3t = -1239. List the prime factors of q. 2, 11, 19 Suppose -4v - 6 = a + 14, 0 = -2a + 2v + 10. Suppose -5f + 11 + 14 = a. List the prime factors of (f/2 - 2)26. 13 Suppose 3h - b = 3, 3h - 4b + 0b = -6. Suppose hc = c. Suppose co + o - 29 = 0. List the prime factors of o. 29 Let m be (300/(-15))/((-2)/3). Suppose 0u + 2u = -m. Let p(v) = v3 + 15v*2 - 3v + 21. What are the prime factors of p(u)? 2, 3, 11 Let z be 60 + 2 + 2 + -2. Suppose -5w - z + 322 = 0. Suppose 0 = -5l - 0l - 5k + 300, l - 3k = w. What are the prime factors of l? 2, 29 List the prime factors of ((-45)/6)/((-147329)/13390 + 11). 5, 103 Let d = 18 + -36. What are the prime factors of ((-9)/d)/((-1)/(-46))? 23 Let o = -3 - -13. Suppose -o = -f - d - 3d, 2d = -f + 6. Suppose r - 2 = 0, -3r = -x - fx + 54. What are the prime factors of x? 2, 5 Let c = 7 - -1. Let w(g) = -g3 + 11g*2 - 8g + 11. List the prime factors of w(c). 139 Suppose -2o = -0o + 2a - 2, 4a = 2o - 20. Suppose oh = h + 372. What are the prime factors of h? 2, 31 Let k = 69 + -48. Let r = 88 - k. Let x = 129 - r. What are the prime factors of x? 2, 31 Suppose 4s + 1012 = -3w, 2s + 528 = 5w - w. Let n = -74 - s. What are the prime factors of n? 2, 7, 13 Suppose 0 = -3b - 3 + 6. Let u(r) = 4 + 0 - 7 + b + 9r. What are the prime factors of u(3)? 5 Suppose 2648*a	{ "pile_set_name": "DM Mathematics" }
rom {s: 1, z: 2, y: 8, f: 3, u: 2, i: 1}? 1/1190 What is prob of sequence uhu when three letters picked without replacement from suhzu? 1/30 Calculate prob of sequence mvi when three letters picked without replacement from vvilmlihmhvhmvhvmvd. 8/969 Calculate prob of sequence ff when two letters picked without replacement from fffuufccfuuuufuffauf. 18/95 Calculate prob of sequence oz when two letters picked without replacement from tyotozttokz. 3/55 Calculate prob of sequence yim when three letters picked without replacement from {y: 4, p: 3, m: 1, k: 1, x: 3, i: 3}. 2/455 What is prob of sequence ddp when three letters picked without replacement from bbppdddbpbdddbb? 3/91 What is prob of sequence lq when two letters picked without replacement from qqleqqeqqqqqqq? 11/182 What is prob of sequence zj when two letters picked without replacement from zjxzzxzxzzxzxzzxt? 9/272 Three letters picked without replacement from zmhalle. Give prob of sequence hal. 1/105 What is prob of sequence uiye when four letters picked without replacement from uuyiiyjeyiyeyyyi? 1/390 Two letters picked without replacement from {k: 1, a: 1, z: 3, t: 2}. What is prob of sequence zt? 1/7 Four letters picked without replacement from {w: 1, s: 3, j: 1, l: 3, m: 2, p: 2}. Give prob of sequence wmms. 1/1980 What is prob of sequence oo when two letters picked without replacement from {o: 10}? 1 Four letters picked without replacement from miqiiiiig. What is prob of sequence qimg? 1/504 What is prob of sequence hll when three letters picked without replacement from thltthtlt? 1/126 Calculate prob of sequence ltll when four letters picked without replacement from {t: 5, l: 8}. 14/143 Two letters picked without replacement from {e: 3, y: 7}. Give prob of sequence ey. 7/30 What is prob of sequence cc when two letters picked without replacement from crcrrrcrrrrrrr? 3/91 Four letters picked without replacement from jynyndnn. Give prob of sequence njnd. 1/140 Three letters picked without replacement from {b: 3}. What is prob of sequence bbb? 1 Two letters picked without replacement from {n: 3, i: 1}. What is prob of sequence nn? 1/2 What is prob of sequence dddo when four letters picked without replacement from {d: 3, i: 5, o: 1}? 1/504 Two letters picked without replacement from bxl. What is prob of sequence bb? 0 Calculate prob of sequence jt when two letters picked without replacement from {t: 5, f: 4, j: 1}. 1/18 Two letters picked without replacement from {z: 1, a: 2, e: 5, o: 1}. Give prob of sequence eo. 5/72 What is prob of sequence mmmw when four letters picked without replacement from gmmmzzzwmhzjzjmjgzzw? 1/969 Three letters picked without replacement from snnbs. What is prob of sequence bnn? 1/30 Three letters picked without replacement from {r: 5, d: 1, o: 2, s: 5, z: 4, i: 3}. Give prob of sequence zzs. 1/114 Three letters picked without replacement from chbbhhhhcbhnhnh. What is prob of sequence bcn? 2/455 Three letters picked without replacement from {y: 7, x: 7}. Give prob of sequence yyx. 7/52 Calculate prob of sequence bytp when four letters picked without replacement from {b: 1, h: 1, p: 1, t: 1, y: 1}. 1/120 Calculate prob of sequence ag when two letters picked without replacement from {g: 1, b: 1, a: 2, t: 1}. 1/10 Two letters picked without replacement from xxqz. What is prob of sequence qx? 1/6 Three letters picked without replacement from vssssssssvsss. What is prob of sequence svv? 1/78 Four letters picked without replacement from ddddddddduddd. What is prob of sequence dddu? 1/13 Calculate prob of sequence la when two letters picked without replacement from {l: 1, n: 1, p: 1, a: 1, k: 1}. 1/20 Two letters picked without replacement from bswhs. Give prob of sequence wb. 1/20 What is prob of sequence lt when two letters picked without replacement from rltxr? 1/20 What is prob of sequence qqt when three letters picked without replacement from {q: 6, r: 3, t: 1, m: 8}? 5/816 Two letters picked without replacement from zzzzzzzzzuzz. Give prob of sequence zu. 1/12 Three letters picked without replacement from qqk. Give prob of sequence qkq. 1/3 Calculate prob of sequence nncn when four letters picked without replacement from nnncrnrcnnn. 7/132 Calculate prob of sequence xx when two letters picked without replacement from nxwnnwynwxwnnwybnn. 1/153 Three letters picked without replacement from {g: 6, j: 3, p: 1, z: 3}. What is prob of sequence jjj? 1/286 Calculate prob of sequence hrho when four letters picked without replacement from ohrogchrhtthrr. 4/1001 Calculate prob of sequence cn when two letters picked without replacement from {c: 2, n: 10}. 5/33 Calculate prob of sequence npip when four letters picked without replacement from {n: 3, p: 1, i: 13}. 0 Two letters picked without replacement from {y: 4, n: 3, x: 4, b: 5}. Give prob of sequence xy. 1/15 Three letters picked without replacement from {x: 3, z: 7}. What is prob of sequence zzz? 7/24 Calculate prob of sequence aama when four letters picked without replacement from akaaammam. 5/84 Calculate prob of sequence kzx when three letters picked without replacement from xzkxzzzenkzzkxxz. 1/40 Four letters picked without replacement from rvpvvvvpvpp. Give prob of sequence ppvp. 1/55 What is prob of sequence ii when two letters picked without replacement from {x: 7, i: 5}? 5/33 Calculate prob of sequence bx when two letters picked without replacement from {x: 2, b: 1, w: 1, g: 3}. 1/21 Two letters picked without replacement from zyzbzzzyyyzyb. Give prob of sequence bb. 1/78 Two letters picked without replacement from {v: 9, w: 3, j: 1, g: 3, y: 2}. What is prob of sequence vg? 3/34 What is prob of sequence dqdd when four letters picked without replacement from dddqqqqqqdddqqdq? 9/208 Calculate prob of sequence eq when two letters picked without replacement from rirqrrecrrmirrirrcc. 1/342 Three letters picked without replacement from gae. What is prob of sequence aeg? 1/6 Three letters picked without replacement from apqev. Give prob of sequence epv. 1/60 What is prob of sequence zit when three letters picked without replacement from {z: 4, l: 2, i: 1, m: 1, u: 1, t: 6}? 4/455 Two letters picked without replacement from qpkfuqeqquqfqq. What is prob of sequence qu? 1/13 Calculate prob of sequence smh when three letters picked without replacement from hhsihmm. 1/35 Calculate prob of sequence ll when two letters picked without replacement from lfllllllf. 7/12 Three letters picked without replacement from {p: 2, f: 9}. What is prob of sequence fff? 28/55 Four letters picked without replacement from ljwev. Give prob of sequence elwj. 1/120 Two letters picked without replacement from rsrjrrrjs. Give prob of sequence jr. 5/36 Three letters picked without replacement from yvyvyyv. Give prob of sequence vyy. 6/35 Two letters picked without replacement from {h: 1, z: 2}. Give prob of sequence hz. 1/3 Three letters picked without replacement from pvvpcvv. Give prob of sequence ppv. 4/105 Three letters picked without replacement from {z: 5}. What is prob of sequence zzz? 1 Two letters picked without replacement from vlvllvv. What is prob of sequence lv? 2/7 What is prob of sequence fdd when three letters picked without replacement from fddffd? 3/20 Two letters picked without replacement from wjwjwj. Give prob of sequence wj. 3/10 Two letters picked without replacement from uunuuuuuluuuuuuu. Give prob of sequence lu. 7/120 What is prob of sequence xmp when three letters picked without replacement from mmmkmmkmxkpxkkxpmkkm? 2/285 What is prob of sequence qb when two letters picked without replacement from {l: 16, b: 3, q: 1}? 3/380 Three letters picked without replacement from kkdkdkdkkdk. What is prob of sequence ddd? 4/165 Three letters picked without replacement from mxxfy. What is prob of sequence ymx? 1/30 What is prob of sequence zn when two letters picked without replacement from iiiozziixxxxnoix? 1/120 Three letters picked without replacement from {b: 5, q: 2, f: 1, y: 8, e: 3}. Give prob of sequence feq. 1/969 Two letters picked without replacement from hzw. Give prob of sequence wz. 1/6 What is prob of sequence nt when two letters picked without replacement from nnnntnnttnt? 14/55 Two letters picked without rep	{ "pile_set_name": "DM Mathematics" }
5g - 24, -4m = 5g - 46. Let u be (1 - 3) + (m - 6). Suppose -5p + 2r = 4r - 7, -2p - u = 3r. Solve px = 8x - 10 for x. 2 Let c(w) = -2w2 + 15w + 113. Let z be c(12). Solve 0 = -zq + 6q - 1 for q. 1 Let w be (-35)/14 + (-2)/4. Let d = w + 0. Let n be -828/(-8) + d. Solve 0 + n = 5l for l. 5 Let z(f) = 2f + 2. Let r be z(9). Suppose 5x - r = -s - 0s, -x + 23 = 4s. Suppose -3t = 15, xk + 4t + 2 = -9. Solve n + 20 = -kn for n. -5 Suppose 0 = g - l - 1, -8 = 936g - 940g + 3l. Let z = 4 - -4. Let h = z + -3. Solve -g = hn - 20 for n. 3 Let n = -26 + 28. Let j(a) = 4a2 - a + 1. Let g be j(n). Solve 9f = 4f - g for f. -3 Let c be (-20)/15(-15)/10. Suppose 4m + 0i - 3i + 1 = 0, cm + 2i = 10. Solve 2t + mt = 0 for t. 0 Let u = 606 + -600. Solve -4l - 30 = ul for l. -3 Let g = -3 - 2. Let o(s) = -4s3 - s2 + s. Let l be o(1). Let x = l - g. Solve -q - x - 1 = 0 for q. -2 Let m(s) = -s*3 + 5s*2 + 30s - 34. Let a be m(8). Solve h - a = -11 for h. 3 Suppose -2s = 4y + 4, 4y + 23 = 5s - 9. Solve 0 = -si + 10 - 14 for i. -1 Let b(l) = l2 - 8l + 8. Let w be b(8). Suppose ws - 3s = 0. Suppose 4r - 2r = s. Solve r = 5o - 14 + 4 for o. 2 Let c(k) = -k3 + 11k*2 - 20k + 19. Let q be c(9). Suppose -3b - 3t + q = -2, t = -2b + 7. Solve b = 3f - 5f for f. -3 Let w be (-3)/1 - (-56)/7. Suppose -5x + 2 + 33 = wv, -5v = 0. Let l(y) = 2y + 1. Let p be l(1). Solve -po - x - 2 = 0 for o. -3 Let u be 2 + (-1 - 1) + (1 - -6). Suppose -d + a - u = -3d, 5d + 5a = 20. Solve -g = -dg for g. 0 Suppose -3p + 25 = -8p - 5l, -25 = -5p + 5l. Suppose p = 2s + 4s - 12. Solve 13 + s = 3v for v. 5 Suppose -r + 8 - 2 = -5p, 4p = -r + 6. Solve 3w = 6w - r for w. 2 Let w = 51 - 46. Suppose 29 = -4s + ws - 5d, -17 = -3s + d. Solve -s = -2b + 2 for b. 3 Let v be 20 + (-3 - -1) - -2. Let t = 10 + -10. Let q(l) = -l. Let w be q(t). Solve -4p + wp - v = 0 for p. -5 Suppose -2g + 30 = -0g. Suppose -3i + s = -g, i + 0i - 10 = 2s. Suppose 0m - 15 = -3m. Solve mh + 29 = i for h. -5 Suppose 5h = 2y + 2, 0 = 3h + 4y - 8y + 10. Solve h = -3i - 4 for i. -2 Let p(r) = r3 + 6r*2 + 5r + 2. Let l be p(-4). Suppose -16 = -2f + l. Let m be ((-66)/f - -4)-30. Solve 0 = x - 5x - m for x. -3 Let m = -21 + 40. Suppose -2g - 1 = -m. Suppose 11i - 21i = -50. Solve 0 = -iz + g + 16 for z. 5 Suppose d + 39 = 2k, 0 = -k - 0 + 4. Let i = 35 + d. Solve -11 + 31 = iq for q. 5 Suppose 0 = -17g + 1196 - 1077. Solve 23 = -gf - 12 for f. -5 Suppose 43 = 10u - 37. Solve uj - 9 = -1 for j. 1 Suppose 27b = 8b. Solve b = 5d - 8 - 12 for d. 4 Let n(b) = 2b3 - 4b*2 + 2b + 1. Let f be n(2). Solve -1 - 4 = -fj for j. 1 Suppose 0 = 3c - 3 - 45. Suppose -5z + 3n - 4n + c = 0, 0 = z + 4n + 12. Solve 0j = j - z for j. 4 Let a be (-30)/((-12)/2) - (0 + 4). Let o(n) = 3n - 3. Let k be o(3). Suppose -k + a = -d. Solve -g = -d + 1 for g. 4 Let p(f) = f + 0f + 0f + 8 + 0f. Let r be p(6). Suppose -7w + 0w = -r. Solve h = wh for h. 0 Let b be -153/(9/(-2)). Let n = -3 + 12. Let j be 6 + n/(-3 - 0). Solve 1 - b = jh for h. -3 Suppose 0 = 9u - u - 128. Solve -6c = 2c + u for c. -2 Let d(c) = c - 12. Let l be d(15). Suppose -44 = -y - ly. Let u = y + -8. Solve o = -uo for o. 0 Suppose 6f - 12 = -0f. Solve -16 = -fx - 10 for x. 3 Let k = 537 + -534. Solve -6 = u - ku for u. 3 Let p be (4 - (-45)/(-12))/(3/60). Suppose 3i = 6i. Suppose 2d - 32 = -2s, d + 5s + is - 4 = 0. Solve -ph + d = 44 for h. -5 Suppose -2p + 12 = d, 7d - 2d + p - 15 = 0. Let k(t) = -t3 + 2t*2 + t + 3. Let z be k(d). Solve -5h - 20 = -z for h. -3 Suppose 1 = -5s - 19, -3s + 24 = 3z. Let q be (64/z)/13. Suppose 4b - 2t = q, -5b - 2t + t = -20. Solve 3o + b - 1 = 0 for o. -1 Let y = 29 + -25. Suppose -3t + 5t = 6. Suppose -tu = -3z - 27, 4u - 4z + 3z = 24. Solve -yq = q - u for q. 1 Suppose -5y + 179 = 2i, 2y - 111 = -y - 3i. Let h = 41 - y. Solve v = h - 3 for v. 3 Let w = 2791 - 2777. Solve -51 = -wc - 9 for c. 3 Let v be (1 + -1)/(0 + 1). Suppose -10w - 18 = -58. Suppose -z + 14 = wz + 2s, v = 3z - 3s. Solve -zf = f - 6 for f. 2 Let j(t) = -t*3 + 6t*2 + 3t + 33. Let x be j(7). Solve 0 = 6r + x - 5 for r. 0 Let t = -46 + -69. Let a = -107 - t. Solve 0 = -4k + a + 8 for k. 4 Let f be (290/40 + -8)(-2 - 2). Solve -3 - f = -6b for b. 1 Suppose 0 = -0q + 5q - 20. Let o be 8/((-72)/(-9)) - (0 + -5). Solve qa + o = 22 for a. 4 Suppose 5c + 1 = -147f + 146f, 3f - 69 = 3c. Solve 13v + 6 - f = 0 for v. 1 Suppose -2x + 2h = -3h + 2, 0 = 3x - 2h + 3. Let y be x14/2-1. Let p(d) = d*3 + 7d*2 + 3d + 23. Let w be p(-7). Solve yc = wc for c. 0 Suppose 11s - 274 = -175. Solve 9y + 0 = s for y. 1 Suppose -2r - 5 = -11, -3r = -4l + 71. Solve -lh = -16h - 16 for h. 4 Let k(t) be the third derivative of t6/120 + t5/10 - t4/24 - 3t*3/2 - 2t*2. Let q be k(-4). Let c = q - 23. Solve -c = 2i - 3i for i. 4 Let o be (-2 - -4) + (0 - 1). Suppose 57 = 22c + 6c - 83. Solve -4 - o = ci for i. -1 Suppose 4h - 8 + 27 = g, -4g = 5h + 8. Solve 0 = 2o - g + 5 for o. -1 Suppose -3u - 5 + 14 = 0. Let x(b) = -3b - 4. Let m be x(-2). Let t = 7 + m. Solve u - t = 3v for v. -2 Let y = 105 + -102. Suppose -yc - 4 = -13. Solve 2x + cx - 25 = 0 for x. 5 Let m(a) = 4a + 24. Let p be m(-14). Let o be ((-2)/(-1))/(4/p-4). Solve -ox + 1 = -7 for x. 2 Let i(b) = -b + 5. Let u = -1 - 17. Let w be 4/10 - u/(-45). Let l be i(w). Solve -7o = -2o + l for o. -1 Let y = -36 - -32. Let g be (y/3)/(1 - (-16)/(-12)). Solve -gs - s + 5 = 0 for s. 1 Let s(p) = -p*3 - 2p*2 + 1. Suppose 14i = 11i - 3. Let y be s(i). Solve 5o - 2 - 3 = y for o. 1 Let o be 378/77 + -5 + (-46)/(-22). Let y = 0 + 0. Suppose -r + 4 + 2 = y. Solve -o = -v - r for v. -4 Suppose -2y - 128 = -6y - 4f, -5y + 3f + 184 = 0. Solve -k = 6k + y for k. -5 Let u be (2/(-7))/(-1) + (-942)/14. Let f = 77 + u. Solve 2n - 4n = f for n. -5 Let z be 6/(-150)5 + (-16)/(-5). Solve 3o = -0o + z for o. 1 Let u be -4 + (-340)/(-90) + 2/9. Solve -w - w + 8 = u for w. 4 Let d be 6 - (-2 + 3 + (-4)/2). Solve 6g = dg for g. 0 Suppose 3s = -3k - 15, 0 = -5s + 2k + 14 - 4. Solve s = j + j for j. 0 Let g be (2 - 14/5)-5. Let c = -42 - -53. Suppose cx - 8x - 9 = 0. Solve 0 = gt - xt - 4 for t. 4 Let b = 29 - 28. Solve 2x - b = -11 for x. -5 Let m(i) = 8i*2 - 9i + 8. Let p(w) = -w + 1. Suppose -5 + 1 = -4s, 23 = -3a + 5s. Let h(n) = ap(n) + m(n). Let q be h(1). Solve -3 = -5g + q for g. 2 Let d(c) = 18c - 6. Let x be d(-2). Let g be (12/x)/(1/(-7)). Solve 0 = o - 0o - g for o. 2 Let z(a) = 2a - 4. Suppose -2i = 63 - 71. Let b be z(i). Solve -5d - b = -14 for d. 2 Let p(v) = v*2 + 3v + 2. Let b be p(-2). Let f be 2 - (-4 + 1)/(-1). Let i be f + (-2 - 1)/(-3). Solve 3j + bj = i for j. 0 Let r = -7 + 10. Suppose 126 = 9t + 9t. Suppose f = -r + t. Solve -fi - i = 0 for i. 0 Let h = 37 - 43. Let q(y) = -y2 - 7y - 6. Let x be q(h). Solve 0 = -xt + 2t - 10 for t. 5 Let o be 14/3 - 8/12. Suppose -2t = -3t - 3. Let z be (t/4)/(9/(-108)). Solve 20 = og - zg for g. -4 Suppose m - 6 - 2 = -d, -4d = -12. Solve 0 = mz - 8z + 9 for z. 3 Let j = -24 + 22. Let c be (-3 + -4)((-52)/14 - j). Solve -2x - c = -5x for x. 4 Let z(m) = -2m - 3m - 73 + 66. Let v be z(-2). Suppose vr - 4 = r. Solve 3i + 20 = -ri for i. -4 Let p(j) = -j3 - 4j*2 - 3j + 2. Let c be (6/5)/((-16)/40). Let h be p(c). Solve -4l + hl = 0 for l. 0 Let w(x) = -x*3 - 3x*2 - 3x - 6. Suppose -3q + 0q = i + 13, 2q + 3i = -18. Let j be w(q). Solve -15 = jf - 8f for f. 3 Suppose 4v - a + 3a + 12 = 0, v = -5a + 6. Let h be (v/(-7))/((-12)/(-42)). Solve -h + 7 = -p for p. -5 Let u be ((-3)/15)/((-7)/105). Solve -ur - 2r = 0 for r. 0 Let c = 545 + -527. Solve cf + 9 = 15f for f. -3 Let z be (966/207)/((-4)/(-6)). Solve zg = 10g for g. 0 Let i be 43/(1/(-4 + 3)). Let x = i + 44. Solve -t = -x - 0 for t. 1 Let k(i) = -i. Let h(s) = 3s. Let z(l) = -2h(l) - 5k(l). Let p(r) = r*2 - 1. Let b be p(-1). Let y be z(b). Solve y = -q - 3q - 12 for q. -3 Suppose 5u = -3d + 8, -4u - 3	{ "pile_set_name": "DM Mathematics" }
ing o is positive. o(-9) Simplify (q12(q/((q/(q/(q(-2/7)q))q)/q))/q)/(q(2/11))(-43) assuming q is positive. q(1471/77) Simplify (a(2/27)a/a12)/(a(-3)/a)(-12/13) assuming a is positive. a(-5131/351) Simplify ((t(t(-2/121)t)/t)/ttt(1/23))/(t(-4/11))(-41) assuming t is positive. t(-38634/2783) Simplify (p(1/4))(18/11)/(((p*0/p)/p)/(pp*11pp)) assuming p is positive. p(361/22) Simplify nn*(3/2)/nn*(7/4)(n*5/n)/nn(-1/7)/n assuming n is positive. n(143/28) Simplify (p0)33p(-5)p(-2) assuming p is positive. p(-7) Simplify (jj/(jj/j*(-6/7))(j*(-21)/jj)/j)/(j3/j(-6)) assuming j is positive. j*(-223/7) Simplify ((ii*5)/iii(-8))/(i((i/(i/i*(-2/3)ii))/i)/i)(-37) assuming i is positive. i(-413/3) Simplify (((f(-20))29)(-5/7))(-14) assuming f is positive. f(-5800) Simplify (((d2)(-25))48)(-43) assuming d is positive. d103200 Simplify (w(-32)/(w9www))/(w*(2/19)ww(1/5)/w) assuming w is positive. w(-4209/95) Simplify (((ii/i*(-2/7)i)4)(2/13))(-13/3) assuming i is positive. i(-184/21) Simplify (((s0)(-4/5))(-2/33))(1/21) assuming s is positive. 1 Simplify ccc/(c*(1/6)/c)c*(-22)(cc(-2/45))/(c(-9)c) assuming c is positive. c*(-829/90) Simplify (((cc(-14))(-39))(34/3))(4/13) assuming c is positive. c1768 Simplify (v1v(-3/5)/v(v/v*(-10)v)/v(-1/5))(-19) assuming v is positive. v(-1102/5) Simplify x7x11x*4/x((xx/(x(x*10x)/x))/x)/x assuming x is positive. x*10 Simplify (((tt*3/t)/(t/((tt/(t/(t/t*13)))/tt)))(-16))46 assuming t is positive. t6624 Simplify v(-11)vvv(2/19)vv(v/(vv/(v/(vv(-4)))))(-46) assuming v is positive. v(-2753/19) Simplify ((b(-1/8)/(bb6/b))(6/11))(2/23) assuming b is positive. b(-147/506) Simplify (m(1/3)mm(-2/9))/(m2/(m/(mm6))) assuming m is positive. m(-62/9) Simplify (x*(-16/3)x(2/15))/(x(2/67)/x31) assuming x is positive. x(8633/335) Simplify (v/(v/v*(5/7))vv)/vv*(1/4)v*(1/9)/(v/(vvvv/((v(vv*4/vvv)/v)/vv))v) assuming v is positive. v(-485/252) Simplify i(-3)i*(2/5)i(4/5)/(i(-8)i) assuming i is positive. i(26/5) Simplify ((i(-3/17)/ii)/(i/i(1/4)))/((i/((i/i(-1/3))/i))/i)1 assuming i is positive. i(-121/204) Simplify ((n/(n*(-2/5)n)n(-4))/((nn*(-5/2)n)/n(-1)))(-15) assuming n is positive. n(123/2) Simplify b(-2/11)b/b(2/85)(bbb*(3/7)bb)(-33) assuming b is positive. b(-951304/6545) Simplify ((u(-4)u1/u)/(u/(u/(u1u)))(-49))(-9) assuming u is positive. u(-846) Simplify ((m(m*(-7)/m)/mm)(-2/21))(4/15) assuming m is positive. m(8/45) Simplify ((v/v(-8)(v/(v/(v(1/13)v))v)/v)(-2/89))(14/3) assuming v is positive. v(-3668/3471) Simplify (ii(-9))/i(3/10)i(-1/10)(i*(-4/13)i)/ii assuming i is positive. i(-501/65) Simplify r(2/7)/(r/(((rr*(5/6))/r)/r))rr(-3/4)/rrrr/(r*(4/5)r) assuming r is positive. r(-181/420) Simplify (l(-1/13)l11)/((llll*(-1/15))/lll4) assuming l is positive. l(778/195) Simplify (mm(-13))/m(-1/4)m(3/2)mm(1/9) assuming m is positive. m(-329/36) Simplify (ll/(l*5l)l)36((l/l16)/l)/l3 assuming l is positive. l(-127) Simplify (r/r3)34/(r4)21 assuming r is positive. r(-152) Simplify ((v*(-15)/v)/(vv*(1/3)v))(-1) assuming v is positive. v(55/3) Simplify ((w/(w/w(-32)))/(w/(w(-3/20)w)))(-2) assuming w is positive. w(643/10) Simplify ((nnn/(n(-7/4)/n))/n)/(n(-2/21)n)n(-3/4)/(n(2/25)n) assuming n is positive. n*(1058/525) Simplify (rr*23/rr(-41)/r)38 assuming r is positive. r(-722) Simplify ((z/(z13/z))/(z(-13)/z))/(z(-10/7)z4/z) assuming z is positive. z(10/7) Simplify (x(1/10))(-30)x(-7)/((x(-4)x)/x) assuming x is positive. x(-6) Simplify (w(2/5)ww)(-33)/(w9/w(-1/4)) assuming w is positive. w(-1769/20) Simplify ((j/j(-3/2))/jjj(-8)jj/(jj*(-1/10))(jj/(j(2/13)j))/j)(1/7) assuming j is positive. j(-296/455) Simplify ((((pp(-4/15))/pp)/p)/p(-16/3))(-1/12) assuming p is positive. p*(-19/45) Simplify (hhh(2/13)h*(-2/13)((h*(-1)h)/h)(-17/3))39 assuming h is positive. h*299 Simplify (((iiii(2/9))(1/15))50)(-3/10) assuming i is positive. i(-29/9) Simplify (z6/z)(-33)/(z(-4/3))(1/4) assuming z is positive. z(-494/3) Simplify mm(-3/19)mm(-7)m*(-1/8)/((m/(mm*(-2/11)/m)m)/m) assuming m is positive. m*(-10809/1672) Simplify ((lll(2/5)/ll)/(ll(-3/2)/l))/(l(-4)l8) assuming l is positive. l(-1/10) Simplify ((hh/h(8/9))(-6/31))(6/11) assuming h is positive. h(-40/341) Simplify (((nn*(-1/10)n)/n(-1))(8/7))(-43) assuming n is positive. n(-4988/35) Simplify v/(v*(-30)vv)vv(-5/6)(v(4/3)/v)(12/11) assuming v is positive. v(1949/66) Simplify (j(-6/17)j)(2/63)/((j(-25)j)/jj25j) assuming j is positive. j*(-1049/1071) Simplify (((ii/i(7/5))/i(-6))/(i*(-2)/ii(6/7)))(9/5) assuming i is positive. i(2754/175) Simplify (b(2/55)/((b/(b24/b))/b))(-1/2) assuming b is positive. b*(-1267/110) Simplify b(b*(3/2)b)/bb/b(7/2)(bb/((bb*(-25)b)/b)b)/(b/(b((bb/b(-13)b)/b)/b)) assuming b is positive. b*41 Simplify (u/(uu/(uu1)))(-28)(u(-9/2)/u)/u0 assuming u is positive. u(-67/2) Simplify (m(-5)/m*(2/19)(m(-3))(8/9))(-34) assuming m is positive. m(15062/57) Simplify (b/b(-2/9))50(bbb(1/4))(-3/10) assuming b is positive. b(21757/360) Simplify ((q/q15)/(q/(q/(qq/(q*7q)))))/(q13/q(1/2)) assuming q is positive. q*(-41/2) Simplify (aa/(aa4/aa))(-15/2)/(a(5/3)a(a*0a)/aa) assuming a is positive. a(113/6) Simplify (tt/(ttt*16/tt)t/((tt/(tt/(t/(tt*(-1/3)))t))/t))/((ttt/(tt(-4)))/((t(26/7)t)/t)) assuming t is positive. t*(-328/21) Simplify (dd(d/(dd(2/3)))/d)(7/5)d(d*1/d)/ddd(d/(d(-2)/d))/d assuming d is positive. d(82/15) Simplify (s6)(-20/13)/(s4)(-45) assuming s is positive. s*(2220/13) Simplify (q(q(-4)/q)/q)(1/11)/((qq(-2))/(qq*12qq)) assuming q is positive. q(171/11) Simplify (((x/(xx*(-4)x))(1/65))(-6/13))(-5/6) assuming x is positive. x(3/169) Simplify (o(-1/9))(4/13)/(o/o(2/45))(-12) assuming o is positive. o(6688/585) Simplify (w3w(-1/22)w)/(w1/(w(1/5)w)) assuming w is positive. w(457/110) Simplify (s(-2))(-24/7)/(s6)(-48) assuming s is positive. s(2064/7) Simplify (((k/((kk/(k/(((kk5)/kk)/k)))/k))(-29))12)(3/20) assuming k is positive. k(1044/5) Simplify (((r*(-3/5)r)/r)/r)/rr(2/21)(r/(r*(-2/9)rr))(-42) assuming r is positive. r(3167/105) Simplify ((v(-1/25)v)4)11 assuming v is positive. v*(1056/25) Simplify vv*25v/((v/(v/((vv(11/6)/v)/v)))/v)(vv(-2/9)v)/vv(-12/7) assuming v is positive. v(3305/126) Simplify v(-28)/(v(-16)/v)((vvvv(-17)v)/v)29 assuming v is positive. v(-417) Simplify (l(1/35))29ll((lll(-5/3))/l)/lll30 assuming l is positive. l(3377/105) Simplify (h(1/27)h)/(hh/(((hhh/h(-9)hhhh)/h)/hh))h10h((hh/(h*(-7/3)/h)hh)/h)/h assuming h is positive. h(820/27) Simplify (j/((j/(jj*(-3)j))/j)j)(-23)/(j(1/10)j*(-2/35)/jj) assuming j is positive. j(-1613/70) Simplify (m8/((m/(m/m*(-2/5)))/m))/((m/(m/(mm*(-16))))/((m/(mm*5)m)/m)) assuming m is positive. m*(97/5) Simplify ((ll22)/l(-19/2))/(l/l*17ll3l) assuming l is positive. l(87/2) Simplify ((n(6/5)/n)/n(1/32))/((n/n5)/nn(-8/7)/n) assuming n is positive. n(8189/1120) Simplify (xx*(3/5)x/(x/(x/(x/(xx(x/(x/(x/(xxx*(2/3)xxxxx))))/x))xx)))/((x/(xx(-3/7)))/x4) assuming x is positive. x(158/105) Simplify ((f(-13/2)/(f(-1/26)f))(-2/13))46 assuming f is positive. f*(8924/169) Simplify vv/v*(7/2)vvv/v*(2/29)vv35v/v*20vv assuming v is positive. v(1185/58) Simplify ((c(-11)/c)/c10)/(c0)(-4/9) assuming c is positive. c(-22) Simplify (((j/(j((j/j(-3/2))/j)/j))/(j/j8))50)(2/7) a	{ "pile_set_name": "DM Mathematics" }
ve of 0d - 3/2d*o - 6 + 1/2d3. What is c in j(c) = 0? 0, 2 Let p(s) be the first derivative of -s7/630 + 13s6/270 - 2s5/15 + s3 - 56. Let y(h) be the third derivative of p(h). Find o such that y(o) = 0. 0, 1, 12 Let u = 452/27 + -224/27. Let b = -137/18 + u. Factor -5/6 - 5/6s4 - 5/6s*5 + 5/3s*3 + 5/3s*2 - bs. -5(s - 1)2(s + 1)*3/6 Suppose 0 = 4s + 2g - 44, 4s - 6s + 22 = 2g. Suppose 17 = 14k - s. Factor -26o*k + 45o*2 - 17o*2 - 2. 2(o - 1)(o + 1) Let f(k) be the second derivative of -k2 + 1/36k*4 + 0 + 132k + 1/18k3. Let f(t) = 0. What is t? -3, 2 Let q = -64 - -68. Find t such that 4 + q - 25t - 4t2 + 13t + 8t = 0. -2, 1 Factor 3/8s*3 + 0 - 99/8s*2 + 105/2s. 3s(s - 28)(s - 5)/8 Let b(z) be the second derivative of 39/2z*2 + 0 + 9/10z*6 + 37/2z*4 - 114z - 1/14z7 + 69/10z*5 + 51/2z*3. Determine h so that b(h) = 0. -1, 13 Suppose 444y + 342y + y - 3148 = 0. Factor 0 - 49/3q*5 + 0q - 91qy - 20/3q*2 - 48q3. -q2(q + 5)(7q + 2)2/3 Let q = -10 - -150. Find f such that 200f - 4f4 - qf + 54f2 + 24 + 21f*3 + 7f*4 = 0. -2, -1 Let w = -64 + 82. Let q = w + -15. Let p(a) = -5a*2 - 8a - 9. Let g(m) = 9m2 + 16m + 17. Let j(z) = qg(z) + 5p(z). Solve j(h) = 0. -3, -1 Let f(s) = 838s + 21790. Let p be f(-26). Factor -p + 1/4c*3 + 17/4c - 5/2c2. (c - 8)(c - 1)2/4 Let s(n) = n3 + 20n2 - 53n + 56. Let x be s(-23). Let r be (-14/21)/(x/364). Factor 0 + 2/9i*5 + 0i*4 + 0i*2 - 4/9i*3 + ri. 2i(i - 1)*2(i + 1)*2/9 Let r(f) be the first derivative of 0f - 73 + 0f2 - 6/5f*5 - 25/8f*3 + 15/4f4. Find g such that r(g) = 0. 0, 5/4 Let f(b) be the third derivative of b8/13440 + 3b7/2240 + 7b*6/1440 + 25b*3/3 + 14b2 + b. Let o(r) be the first derivative of f(r). Factor o(c). c2(c + 2)(c + 7)/8 Suppose 41n - 35n = 6210. Let a = 5179/5 - n. Factor -12/5f3 - af*5 + 36/5f*2 + 0f - 4f4 + 0. -4f*2(f - 1)(f + 3)2/5 Let f(t) be the second derivative of t6/20 + 3t*5/40 - 11t*4/4 - 10t*3 - 785t. Factor f(w). 3w(w - 5)(w + 2)(w + 4)/2 Let d be (-18 + 29 - 19)(-5)/(-6)-7. Determine u so that -80/3 - du + 100/3u*2 + 55u*3 - 15u*4 = 0. -2/3, 1, 4 Suppose -5h - 5 = 3u, 86 = -4u - 2h + 84. Let s(j) be the third derivative of 1/30j*5 + 3j*2 + 0j*3 + 0j*4 + u + 0j. Let s(c) = 0. What is c? 0 Factor -2310x3 + 301137536 - 2319x*3 + 3192x*2 - 1698144x + 4627x3. -2(x - 532)*3 Let p(b) = 6b + 16. Let z be p(0). Let y(n) be the second derivative of zn + 1/16n*4 + 0 - 1/4n*3 + 3/8n*2. Factor y(j). 3(j - 1)2/4 Let l(o) be the second derivative of -o4/84 - 32o3/21 + 40o + 2. Let l(b) = 0. Calculate b. -64, 0 Let g(q) = q*3 - 32q*2 + 7. Let i be g(32). Let h = 4 + -2. Suppose 8n*3 - 8n*4 - 3n*2 + in*2 + 4n*4 - 8nh = 0. Calculate n. 0, 1 Let c(b) be the first derivative of -b7/2310 + b6/660 - b5/660 - 39b2/2 + 2. Let y(m) be the second derivative of c(m). Suppose y(u) = 0. Calculate u. 0, 1 Let r(k) be the second derivative of -3k5/80 + k4 + 217k3/8 + 75k*2 - 3793k. Factor r(n). -3(n - 25)(n + 1)(n + 8)/4 Let c(v) be the third derivative of -v6/200 + v5/25 + 3v*4/40 - 9v*3/5 + 1845v*2 - 2. Factor c(k). -3(k - 3)*2(k + 2)/5 Let o = 401933/4 - 2009233/20. Let -36/5i + o + 3/5i*2 = 0. What is i? 6 Factor 667p + 293p - 2127 + 735 + 5p*2 - 548 + 0p*2. 5(p - 2)(p + 194) Factor -568g*2 - 180g + 376 + 19g3 - 542g*3 + 511g*3. -4(g + 1)(g + 47)(3g - 2) Let t be (7 + -8)(-2 + (-6)/(-3)). Suppose 0 + 21 = 5m + 4i, -3i - 3 = t. Factor 4x - 16x5 - 5x*4 + 21x*m - 10x*3 - 4x. 5x3(x - 2)(x + 1) Let u(c) = 30c + 270. Let s be u(-9). Suppose 9r - 1113 + 1095 = s. Factor -4/7l + 0 - 4/7lr. -4l(l + 1)/7 Let d(i) = -2i*3 + 11i*2 + 33i - 8. Let v be d(8). Let k = v + 64. Find y, given that ky3 - 1/6y + 1/6y5 - 1/3y*2 + 1/3y*4 + 0 = 0. -1, 0, 1 Let j(o) = -8o*3 + 37o*2 - 6. Let r = 59 + -33. Let c(n) = 2n*3 - 9n*2 + 2. Let p(q) = rc(q) + 6j(q). Factor p(l). 4(l - 2)*2(l + 1) Let g(n) be the third derivative of 13 + 0n + 8/3n*3 - 7/12n*4 - 8n*2 - 1/30n*5. Solve g(k) = 0 for k. -8, 1 Suppose 0 - 38/7c*2 - 30/7c*3 + 2/7c*5 + 6/7c*4 + 60/7c = 0. Calculate c. -5, -2, 0, 1, 3 Let w be (5/4)/(67/(2680/25)). Factor -265302/7 - 2/7f3 - 306/7f*w - 15606/7f. -2(f + 51)3/7 Let r(z) = z3 - 10z*2 - 9z - 11. Let t be 1/(32/66). Let s be r(t). Let 30f*3 + 14f*4 + 16f*2 - 32 + 2f*3 - sf + 2f5 - 21f = 0. What is f? -2, 1 Let q(z) be the third derivative of -40/3z3 + 1/24z*6 - 5/24z*4 + 4/3z*5 + 0z + 49z2 + 0. Solve q(h) = 0. -16, -1, 1 Factor -12c*3 - 32c*3 - 21420c2 - 288 - c3 - 2c4 - 480c - c*4 + 21186c*2. -3(c + 1)(c + 4)2(c + 6) Let o(m) be the first derivative of m*4/2 + 160m*3/3 + 453m*2 + 1332m + 346. Factor o(u). 2(u + 3)2(u + 74) Let m(z) = -z*2 - 16z + 26. Let l be m(-17). Let f be 8/l + -1 + 456/216. Factor 0 + 3/5rf - 3/5r. 3r(r - 1)/5 Let h(r) be the first derivative of 21r3 - 439r*2/2 - 128r - 36. Let g(z) = -31z2 + 219z + 64. Let d(x) = -7g(x) - 3h(x). Let d(q) = 0. Calculate q. -2/7, 8 Suppose 0 = s - 2t + 4, -t = -5s + 4t. Suppose 0 = -5v + 4 - 14, s = -w - 3v. Let 4374/11 - 6/11o*3 + 162/11o*w - 1458/11o = 0. What is o? 9 Find d such that 311/3 - 1/3d2 + 310/3d = 0. -1, 311 Let s be (4 + 63/(-18))8. Let v(q) be the second derivative of 16q + 0q3 + 0q*2 + 0 - 1/54q*s. Factor v(y). -2y*2/9 Factor 1183m*2 - 622m - 6m5 + 67 - 652m*3 - 235m*2 + 32 + 178m*4 + 31 + 24. -2(m - 1)*4(3m - 77) Let w(t) = 2t*4 - 47t*3 - 42t*2 + 112t - 85. Let k(f) = 3f4 - 47f*3 - 55f*2 + 113f - 86. Let j(i) = -5k(i) + 6w(i). Factor j(x). -(x - 1)*2(x + 16)(3x + 5) Let y(w) be the second derivative of -1/2w4 + w + 0w*3 + 10 + 9/20w*5 + 0w*2 - 1/10w*6. Suppose y(r) = 0. What is r? 0, 1, 2 Suppose 2k - 3n = 28, -60 = -8k + 2k + 3n. Let g(d) be the first derivative of -108d2 + k + 12d*3 - 1/2d*4 + 432d. Suppose g(u) = 0. Calculate u. 6 Let v = 2/1795 - -628/80775. Let o = v + 98/225. Factor -2/3w3 + 10/9w*2 + 0 + 2/9w*5 - 2/9w*4 - ow. 2w(w - 1)*3(w + 2)/9 Factor 1740 - 4g4 - 2505 + 964g*2 + 1485 + 1564g + 116g3. -4(g - 36)(g + 1)2(g + 5) Let l(h) be the third derivative of -h*7/350 + 3h*6/100 + 3h*5/100 - 2h*4/5 - 6h*3/5 - 64h*2 + 1. Let l(c) = 0. What is c? -1, 2, 6 Let v be (-86)/((-4 - 1) + 3). Let c = -39 + v. Suppose -2b*2 + 4b - 12 + 2b2 - 4b*3 + 8b*2 + cb*2 = 0. Calculate b. -1, 1, 3 Let r(d) = -2d*3 + 90d*2 + 378d + 302. Let z = -24 - -19. Let v(f) = f*3 - 60f*2 - 252f - 201. Let n(j) = zr(j) - 8v(j). Factor n(w). 2(w + 1)(w + 7)*2 Suppose -11q + 6 = -9q. Suppose -p = -qp + 4. Find b such that -4b2 - 6b*2 + 12b*p - 2b*3 = 0. 0, 1 Let u = 329250 + -658493/2. Find v such that uv + 1/2v2 + 6 = 0. -4, -3 Solve 20/3s*3 + 6s*2 - 104/3s + 64/3 + 2/3s4 = 0. -8, -4, 1 Let s be 746/115 - (-992)/(-11408). Determine b, given that 0 + 1/5b*4 - 6/5b*3 + sb + 0b2 = 0. -2, 0, 4 Let i(f) = -13f*2 + 34f + 131. Let o(k) = 2k - 1. Let w(u) = -2u*2 - u. Let b(y) = -o(y) - w(y). Let a(l) = -4b(l) - i(l). Let a(j) = 0. Calculate j. -3, 9 Let j = 0 - -7. Factor -4d2 - d2 + jd*2 + 10d + 8d. 2d(d + 9) Determine k, given that 0k*3 - 3349k - 3k3 + 571 + 1104 + 4k*3 + 0k*3 + 1673k*2 = 0. -1675, 1 Let v be 72/720 + ((-518)/(-20) - -2). Let a be (-1422)/(-237) + v/(-5). Factor 1/5o*4 - ao*2 + 1/5o*5 + 1/5o + 1/5 - 2/5o3. (o - 1)2(o + 1)3/5 Let v(p) be the third derivative of p7/70 - 9p6/20 + 87p*5/20 - 19p*4/4 - 72p*3 + 331p*2. Solve v(x) = 0. -1, 2, 8, 9 Factor -549/7m*2 - 2916/7 + 6m*3 + 324m - 1/7m4. -(m - 18)2(m - 3)*2/7 Find c, given that 0 + 8/5c*3 - 10c*2 - 56/5c + 2/5c4 = 0. -7, -1, 0, 4 Let l(q) be the third derivative of q8/168 - 2q*7/21 + 23q*6/60 - 7q*5/15 + 206q**2. What is z in l(z) = 0? 0, 1, 2, 7 Le	{ "pile_set_name": "DM Mathematics" }
2500r/7 - 5875000/7 = 0 for r. -25/2, 94/7 Factor -2m*2/7 + 102768556m/7 - 1320172012790642/7. -2(m - 25692139)2/7 Let -v4/2 + 149v*3/2 - 3034v*2 + 22160v - 19200 = 0. Calculate v. 1, 8, 60, 80 Factor 5s4 + 2315s*3 + 84395s*2 - 86715s. 5s(s - 1)(s + 41)(s + 423) Determine o, given that 2o3 - 119252o*2/3 - 10130758o + 3381336 = 0. -252, 1/3, 20127 Suppose 3r5 + 206613r*4 + 3555654213r*3 - 60499439397r*2 + 110331089688r - 53387511120 = 0. What is r? -34444, 1, 15 Solve -20d3/3 + 61958d*2/3 + 192256d/3 + 6202 = 0. -3, -1/10, 3101 Factor 5n2/3 + 3067912900n/3 + 470604478099320500/3. 5(n + 306791290)2/3 Solve g4/3 + 1486g*3/3 - 13617g*2 = 0 for g. -1513, 0, 27 Factor 5j*2 - 11101150j - 11101155. 5(j - 2220231)(j + 1) Let 60m3 + 66664m*2 + 71044m + 4440 = 0. What is m? -1110, -1, -1/15 Determine s so that -s*4/3 + 14s*3 + 627s*2 + 13118s/3 - 11360 = 0. -16, -15, 2, 71 Factor -3x2 - 51600414x + 206401704. -3(x - 4)(x + 17200142) Determine u so that u*4 + 19476u*3 - 97418u*2 - 253260u - 136367 = 0. -19481, -1, 7 Find l, given that 3l2/2 - 11283l/2 + 134532 = 0. 24, 3737 Find n, given that -n*4 - 28568n*3 - 204289462n*2 - 3666162600n + 12837864375 = 0. -14275, -21, 3 Solve k*3/4 - 3745k*2/4 - 174113k/4 - 1034943/4 = 0 for k. -39, -7, 3791 Determine o, given that 4o2/5 - 55592o/5 + 5573988/5 = 0. 101, 13797 Factor 62m2 - 633032m + 122520. 2(m - 10210)(31m - 6) Let f5/3 - 42f*4 + 1805f*3/3 + 4960f*2 + 4848f - 10368 = 0. Calculate f. -4, -3, 1, 24, 108 Determine i, given that -7i3/4 - 468941i*2/2 - 31381840319i/4 + 557084722396 = 0. -67027, 496/7 Factor -3t2/2 + 1115727498t - 207474641632223334. -3(t - 371909166)2/2 Determine f so that 12800f*5/7 + 4185280f*4/7 + 10296366f*3 + 302746574f*2/7 - 7602482f/7 + 6798 = 0. -309, -11, -7, 1/80 Find h, given that h*2/5 + 9418h/5 + 1608456/5 = 0. -9244, -174 Let -876s2 + 3689s/2 - 185 = 0. Calculate s. 185/1752, 2 Factor p*4/8 + 3223p*3/8 + 2676345p*2/8 + 860624725p/8 + 48273246125/4. (p + 355)*3(p + 2158)/8 Determine i, given that -5i3 + 4217200i*2 - 889323130000i + 35566178000000 = 0. 40, 421700 Factor 4f5 + 156068168f*4 + 1522329566429764f*3. 4f*3(f + 19508521)*2 Solve 2636w*2/3 - 27724w/3 + 25088/3 = 0 for w. 1, 6272/659 Solve -3w5 + 1941w*4 + 554727w*3 + 1091919w*2 - 2765772w - 3304908 = 0. -213, -3, -1, 2, 862 Let u*3/6 - 16231u*2/6 + 137789u/3 + 162140 = 0. Calculate u. -3, 20, 16214 Find q such that -3q2/2 + 150300q + 12329643/2 = 0. -41, 100241 Suppose 4z5/7 + 132204z*4/7 + 1717972z*3/7 - 132204z*2/7 - 1717976z/7 = 0. Calculate z. -33038, -13, -1, 0, 1 Let -r*5/6 + 1132r*4/3 - 23486r*3/3 - 146927r*2/3 + 46973r/6 + 145795/3 = 0. Calculate r. -5, -1, 1, 26, 2243 Suppose f*5/3 + 122f*4/3 - 131390f*3/3 + 13532788f*2/3 + 27460229f/3 + 13795930/3 = 0. What is f? -466, -1, 155, 191 What is k in -k*5/7 + 2565k*4/7 + 15453k*3/7 - 69417k*2/7 = 0? -9, 0, 3, 2571 Let -5s*5/3 - 287s*4/3 - 1268s*3 - 4320s*2 = 0. Calculate s. -40, -12, -27/5, 0 What is l in -2l*3 + 2918946l*2 - 5837886l + 2918942 = 0? 1, 1459471 Find y such that 2y3/7 - 3070y*2 - 7857386y/7 - 7835894/7 = 0. -353, -1, 11099 Factor 5j3 - 10885j*2 + 5551510j + 5562400. 5(j - 1360)(j - 818)(j + 1) Find o such that -80o*4 - 476o*3 + 4348o*2 - 1056o = 0. -11, 0, 1/4, 24/5 Determine u, given that u*2 - 1413792u - 9896593 = 0. -7, 1413799 Determine l so that 6l2 + 87055l/6 + 433475/3 = 0. -86695/36, -10 Solve -7n5 - 705n*4 + 9694n*3 - 2712n*2 = 0 for n. -113, 0, 2/7, 12 Find u such that -4u*2/5 + 127616u/5 + 39805648 = 0. -1490, 33394 Let -t*2 + 1936t - 455388 = 0. What is t? 274, 1662 What is j in -5j5 - 5200j*4 + 226015j*3 - 1324810j*2 - 22772000j - 54100000 = 0? -1082, -4, 25 Find v such that 2v4/13 + 181668976v*3/13 + 4125452286780044v*2/13 + 8250904028553168v/13 + 4125451923442098/13 = 0. -45417243, -1 What is c in 2c2 - 21260c - 1153872 = 0? -54, 10684 What is h in 123h3 - 4964508h*2 + 14165955h + 2179386 = 0? -6/41, 3, 40359 Suppose -2d2/19 + 46857752d/19 - 274456115311688/19 = 0. What is d? 11714438 Suppose 106d4/23 - 4150d*3/23 - 220492d*2/23 - 25648d + 94080/23 = 0. What is d? -28, -3, 8/53, 70 Solve 5j3 - 172260j*2 - 62663405j + 62835660 = 0. -361, 1, 34812 Solve 3o5 - 834o*4 - 12885o*3 + 179220o*2 + 615252o + 423984 = 0. -22, -2, -1, 11, 292 Factor -2q2/7 + 76368q/7 - 839806/7. -2(q - 38173)(q - 11)/7 Determine l, given that -l*5/8 + 929l*4/8 + 117259l*3/4 + 1637826l*2 - 1844532l - 10007712 = 0. -108, -2, 3, 1144 Determine t, given that t*4 + 26553t*3 + 1828683t*2 + 34088175t + 86523228 = 0. -26484, -33, -3 Factor 5y2 + 558645y - 34095950. 5(y - 61)(y + 111790) Find p, given that -p*3/4 + 19973p*2/2 + 59932p - 159808 = 0. -8, 2, 39952 Suppose -3n5 + 171n*4 - 1245n*3 - 52875n*2 + 523968n - 470016 = 0. What is n? -17, 1, 9, 32 Find v, given that 4v5 + 10700v*4 + 159460v*3 - 372460v*2 - 159464v + 361760 = 0. -2660, -17, -1, 1, 2 Factor -5h2/2 - 73845h/2 + 998730. -5(h - 27)(h + 14796)/2 Factor -3w2 + 282108726w - 6632111107111923. -3(w - 47018121)2 Let -6h*5 - 605271h*4 + 7566789h*3 - 3632076h*2 = 0. What is h? -100891, 0, 1/2, 12 Let -3n*2 - 100387272n - 839800364966832 = 0. What is n? -16731212 Solve 3d3/8 + 219d*2/2 + 26883d/8 + 73143/4 = 0. -258, -27, -7 Determine m so that -5m4 + 335m*3 - 4975m*2 - 16655m + 86100 = 0. -5, 3, 28, 41 Suppose 195z5 + 9350z*4 + 21165z*3 - 206250z*2 + 256220z - 12600 = 0. Calculate z. -45, -7, 2/39, 2 Solve -5z3 + 159891640z*2 = 0. 0, 31978328 Find f such that -39f*5/5 + 501f*4 + 4572f*3/5 - 1188f2/5 = 0. -2, 0, 3/13, 66 Factor i2/3 - 16179484i/3 + 65443925626564/3. (i - 8089742)2/3 Factor -g3/6 - 54890g*2/3 - 1097725g/6 - 457375. -(g + 5)*2(g + 109770)/6 Determine l, given that -5l3 + 62405l*2 = 0. 0, 12481 Factor -6x*2/7 - 4128x/7 - 94176. -6(x + 252)(x + 436)/7 Let 4j2 - 179584j - 3593280 = 0. What is j? -20, 44916 Let 4r5 - 308r*4 + 500r*3 + 29108r*2 - 29304r = 0. Calculate r. -9, 0, 1, 11, 74 Let -4v2 - 165412v - 1157688 = 0. What is v? -41346, -7 Suppose j*5/3 - 268733j*4/3 + 18052340728j*3/3 + 90275409464j*2 + 433343250096j + 650029387536 = 0. Calculate j. -6, -3, 134374 Suppose 3r2 + 4338r + 1523535 = 0. Calculate r. -845, -601 Solve 140h5 - 374508h*4 + 249904180h*3 + 742497004h*2 - 2553333744h + 143433680 = 0 for h. -5, 2/35, 2, 1339 Suppose h*3/6 - 90899h*2/6 + 2068245235h/6 - 39198277579/2 = 0. Calculate h. 57, 45421 Solve 4f3/3 + 28223168f*2/3 + 56446324f/3 + 9407720 = 0. -7055790, -1 Factor -o*3/4 + 183379o*2/4 + 1283751o/2. -o(o - 183393)(o + 14)/4 Let -3h4/2 - 1769832h*3 + 9h*2/2 + 5309493h - 3539664 = 0. Calculate h. -1179888, -2, 1 Find b, given that 4b4 - 380968b*3 + 4190308b*2 - 13713408b + 13713264 = 0. 2, 3, 6, 95231 Solve -5i3 - 557785i*2 - 7250290i + 7808080 = 0. -111544, -14, 1 Factor 4y2/3 - 3932y - 606816. 4(y - 3096)(y + 147)/3 Suppose -5l3 + 89175l*2 - 7541970l - 31595000 = 0. Calculate l. -4, 89, 17750 Solve -p*2 - 620315p + 2481276 = 0. -620319, 4 Solve 1053t3/5 - 4458399t*2/5 - 4472157t/5 - 2541 = 0. -1, -1/351, 4235 What is g in 3g2/7 + 17337897g/7 + 17337876 = 0? -5779292, -7 Factor 2f3/13 - 7716f*2/13 + 15354f - 99632. 2(f - 3832)(f - 13)2/13 Suppose g2/2 - 32145g/2 + 2701972 = 0. Calculate g. 169, 31976 Suppose r2/9 - 2054r/9 + 1054693/9 = 0. Calculate r. 1021, 1033 Let -57s4/8 - 1959s*3/8 + 1004571s*2/4 - 158517s = 0. Calculate s. -206, 0, 12/19, 171 Suppose -4u3 - 8104u*2 + 886080u = 0. Calculate u. -2130, 0, 104 Solve -6y5/7 + 160768y*4/7 - 12619826y*3/7 + 263816432y*2/7 - 86436472y - 231467424/7 = 0 for y. -1/3, 3, 38, 26716 Factor 2a2 - 24787276a + 76801131437522. 2(a - 6196819)2 Let -4i*3 + 103556i*2 - 103552i = 0. What is i? 0, 1, 25888 Determine q so that	{ "pile_set_name": "DM Mathematics" }
1215 and 225. 45 What is the greatest common factor of 10237 and 1? 1 What is the greatest common factor of 2520 and 245? 35 What is the highest common factor of 15 and 15? 15 What is the greatest common factor of 17 and 68? 17 Calculate the greatest common factor of 104 and 2340. 52 Calculate the highest common factor of 144 and 6912. 144 Calculate the highest common factor of 13 and 832. 13 What is the highest common factor of 150 and 180? 30 Calculate the greatest common factor of 2938 and 13. 13 What is the greatest common factor of 414 and 18? 18 Calculate the greatest common factor of 34375 and 110. 55 Calculate the highest common factor of 273 and 182. 91 What is the greatest common divisor of 518 and 154? 14 Calculate the highest common factor of 270 and 2400. 30 What is the greatest common factor of 1240 and 20? 20 What is the highest common divisor of 12 and 1362? 6 Calculate the greatest common factor of 1600 and 50. 50 What is the greatest common factor of 138 and 46? 46 What is the highest common factor of 299 and 65? 13 Calculate the greatest common divisor of 210 and 70. 70 Calculate the greatest common factor of 492 and 12. 12 What is the highest common factor of 87 and 6? 3 Calculate the greatest common factor of 210 and 165. 15 What is the highest common factor of 1 and 99? 1 Calculate the greatest common factor of 477 and 106. 53 What is the greatest common divisor of 909 and 189? 9 Calculate the greatest common divisor of 74 and 333. 37 What is the greatest common factor of 533 and 65? 13 What is the highest common divisor of 363 and 3828? 33 Calculate the greatest common divisor of 32 and 592. 16 What is the highest common divisor of 485 and 7857? 97 Calculate the highest common factor of 10 and 1010. 10 What is the greatest common divisor of 11872 and 53? 53 What is the highest common divisor of 200 and 54800? 200 Calculate the greatest common divisor of 175 and 625. 25 Calculate the highest common factor of 17 and 544. 17 Calculate the highest common divisor of 493 and 425. 17 What is the greatest common divisor of 25 and 2? 1 What is the greatest common factor of 130 and 510? 10 Calculate the highest common factor of 32 and 104. 8 Calculate the greatest common factor of 528 and 144. 48 What is the highest common factor of 18 and 1728? 18 Calculate the greatest common divisor of 36 and 4842. 18 Calculate the greatest common factor of 122 and 793. 61 Calculate the greatest common divisor of 320 and 880. 80 Calculate the highest common divisor of 13 and 1651. 13 What is the greatest common factor of 285 and 1349? 19 Calculate the greatest common divisor of 36 and 882. 18 What is the greatest common factor of 26082 and 84? 42 What is the greatest common factor of 395 and 474? 79 Calculate the greatest common divisor of 384 and 36. 12 What is the greatest common divisor of 5478 and 264? 66 What is the highest common factor of 341 and 11? 11 What is the greatest common factor of 2256 and 846? 282 Calculate the greatest common divisor of 110 and 100. 10 What is the greatest common divisor of 39 and 13? 13 What is the highest common divisor of 328 and 2419? 41 What is the greatest common factor of 105 and 5295? 15 Calculate the highest common factor of 16 and 664. 8 What is the highest common divisor of 8 and 298? 2 Calculate the greatest common factor of 2980 and 20. 20 What is the highest common factor of 2916 and 36? 36 Calculate the greatest common factor of 50 and 6950. 50 Calculate the highest common divisor of 187 and 102. 17 What is the greatest common factor of 2034 and 150? 6 Calculate the highest common factor of 4 and 8. 4 Calculate the highest common factor of 15652 and 182. 182 Calculate the highest common factor of 16 and 40. 8 What is the greatest common factor of 69 and 414? 69 Calculate the highest common factor of 1120 and 70. 70 What is the greatest common factor of 37 and 1591? 37 What is the highest common divisor of 14 and 37744? 14 Calculate the highest common factor of 1815 and 1485. 165 What is the greatest common divisor of 91 and 39? 13 Calculate the greatest common factor of 2544 and 53. 53 What is the highest common factor of 20 and 52? 4 What is the highest common divisor of 474 and 6? 6 Calculate the greatest common divisor of 18 and 657. 9 What is the greatest common factor of 3 and 15? 3 Calculate the highest common factor of 31 and 2. 1 Calculate the greatest common factor of 2418 and 31. 31 Calculate the highest common divisor of 986 and 306. 34 What is the highest common divisor of 20 and 18490? 10 What is the highest common factor of 250 and 160? 10 What is the greatest common factor of 9325 and 25? 25 What is the highest common divisor of 97225 and 25? 25 Calculate the highest common divisor of 108 and 2943. 27 What is the highest common divisor of 164 and 2788? 164 Calculate the highest common divisor of 5609 and 158. 79 Calculate the greatest common divisor of 55 and 1045. 55 Calculate the greatest common factor of 12804 and 22. 22 Calculate the greatest common divisor of 570 and 19. 19 Calculate the highest common divisor of 15 and 1569. 3 Calculate the highest common factor of 7 and 203. 7 What is the greatest common factor of 145 and 355? 5 Calculate the greatest common divisor of 232 and 1056. 8 What is the greatest common factor of 46 and 10649? 23 What is the greatest common divisor of 64 and 8? 8 Calculate the greatest common factor of 138 and 1150. 46 Calculate the greatest common divisor of 552 and 69. 69 Calculate the highest common factor of 7742 and 196. 98 Calculate the highest common divisor of 2250 and 9. 9 Calculate the greatest common factor of 189 and 140. 7 Calculate the greatest common factor of 732 and 12. 12 What is the highest common factor of 36 and 92? 4 What is the greatest common factor of 2592 and 320? 32 Calculate the greatest common divisor of 118 and 1298. 118 Calculate the greatest common factor of 3320 and 380. 20 What is the greatest common divisor of 370 and 10? 10 What is the highest common factor of 38 and 285? 19 What is the highest common divisor of 682 and 22? 22 Calculate the greatest common factor of 15 and 10080. 15 What is the highest common factor of 105 and 375? 15 What is the highest common factor of 34 and 102? 34 Calculate the highest common factor of 3 and 93. 3 What is the highest common factor of 156 and 429? 39 What is the highest common divisor of 77196 and 84? 84 What is the highest common divisor of 796 and 12? 4 Calculate the greatest common factor of 86 and 69746. 86 What is the highest common factor of 68 and 170? 34 What is the highest common factor of 584 and 2482? 146 Calculate the highest common factor of 100 and 12. 4 What is the highest common factor of 120 and 320? 40 Calculate the greatest common divisor of 2592 and 28. 4 What is the highest common divisor of 12 and 174? 6 Calculate the greatest common divisor of 59 and 2065. 59 What is the highest common factor of 56 and 64? 8 Calculate the greatest common divisor of 4 and 304. 4 What is the greatest common factor of 348 and 30972? 348 Calculate the highest common factor of 188 and 799. 47 What is the greatest common factor of 16 and 2? 2 What is the highest common factor of 10 and 15? 5 Calculate the highest common divisor of 4382 and 14. 14 What is the highest common divisor of 462 and 42? 42 Calculate the greatest common divisor of 976 and 61. 61 What is the greatest common divisor of 546 and 936? 78 Calculate the highest common divisor of 165 and 28545. 165 Calculate the greatest common factor of 5706 and 18. 18 Calculate the highest common factor of 2868 and 60. 12 What is the greatest common divisor of 1280 and 10? 10 What is the highest common factor of 160 and 440? 40 What is the greatest common factor of 7 and 413? 7 What is the greatest common divisor of 144 and 414? 18 What is the greatest common factor of 270 and 8235? 135 Calculate the greatest common factor of 35 and 1. 1 Calculate the greatest common divisor of 28 and 544. 4 What is the greatest common divisor of 32 and 72608? 32 Calculate the greatest common factor of 216 and 40. 8 Calculate the highest common factor of 4536 and 96. 24 What is the highest common factor of 4023 and 81? 27 What is the	{ "pile_set_name": "DM Mathematics" }
arest integer? 1644 What is 141207612 to the power of 1/2, to the nearest integer? 11883 What is the square root of 1111784787 to the nearest integer? 33343 What is 26411508 to the power of 1/8, to the nearest integer? 8 What is 3259578628 to the power of 1/8, to the nearest integer? 15 What is 2053433908 to the power of 1/4, to the nearest integer? 213 What is the ninth root of 41215105 to the nearest integer? 7 What is 186198632 to the power of 1/3, to the nearest integer? 571 What is the third root of 35193447 to the nearest integer? 328 What is 6176234155 to the power of 1/2, to the nearest integer? 78589 What is 13629693 to the power of 1/4, to the nearest integer? 61 What is 1098916681 to the power of 1/10, to the nearest integer? 8 What is the third root of 6442883 to the nearest integer? 186 What is the square root of 1084036418 to the nearest integer? 32925 What is 41772327 to the power of 1/3, to the nearest integer? 347 What is 80643108 to the power of 1/3, to the nearest integer? 432 What is 236337114 to the power of 1/2, to the nearest integer? 15373 What is the third root of 97319229 to the nearest integer? 460 What is 270993907 to the power of 1/2, to the nearest integer? 16462 What is the square root of 58854287 to the nearest integer? 7672 What is the third root of 172713051 to the nearest integer? 557 What is 565044995 to the power of 1/10, to the nearest integer? 8 What is 3074566132 to the power of 1/7, to the nearest integer? 23 What is the fifth root of 58743930 to the nearest integer? 36 What is the third root of 50432759 to the nearest integer? 369 What is the seventh root of 3099249316 to the nearest integer? 23 What is the cube root of 1944523451 to the nearest integer? 1248 What is the cube root of 4469497007 to the nearest integer? 1647 What is the cube root of 1378652890 to the nearest integer? 1113 What is the cube root of 49153191 to the nearest integer? 366 What is 3282426718 to the power of 1/2, to the nearest integer? 57292 What is 325099719 to the power of 1/3, to the nearest integer? 688 What is the square root of 400447686 to the nearest integer? 20011 What is 12971373 to the power of 1/7, to the nearest integer? 10 What is 36211033 to the power of 1/3, to the nearest integer? 331 What is the third root of 823533924 to the nearest integer? 937 What is the fourth root of 747343947 to the nearest integer? 165 What is 756267701 to the power of 1/3, to the nearest integer? 911 What is 25154012 to the power of 1/2, to the nearest integer? 5015 What is the cube root of 155440778 to the nearest integer? 538 What is 143704376 to the power of 1/3, to the nearest integer? 524 What is 6116659 to the power of 1/3, to the nearest integer? 183 What is the third root of 658740084 to the nearest integer? 870 What is the square root of 669626344 to the nearest integer? 25877 What is the eighth root of 93845328 to the nearest integer? 10 What is 178564452 to the power of 1/2, to the nearest integer? 13363 What is 93585791 to the power of 1/7, to the nearest integer? 14 What is the third root of 874950488 to the nearest integer? 956 What is 7509076901 to the power of 1/6, to the nearest integer? 44 What is the square root of 1008147180 to the nearest integer? 31751 What is the fifth root of 276596863 to the nearest integer? 49 What is the third root of 2455335091 to the nearest integer? 1349 What is 31000865 to the power of 1/10, to the nearest integer? 6 What is 49510585 to the power of 1/2, to the nearest integer? 7036 What is the cube root of 481886027 to the nearest integer? 784 What is 32274360 to the power of 1/5, to the nearest integer? 32 What is the square root of 59035934 to the nearest integer? 7683 What is 265756649 to the power of 1/4, to the nearest integer? 128 What is 28203634 to the power of 1/7, to the nearest integer? 12 What is 89093108 to the power of 1/2, to the nearest integer? 9439 What is the cube root of 190651660 to the nearest integer? 576 What is the seventh root of 471602824 to the nearest integer? 17 What is the third root of 196620817 to the nearest integer? 581 What is the sixth root of 613246302 to the nearest integer? 29 What is the cube root of 634244829 to the nearest integer? 859 What is the cube root of 628321739 to the nearest integer? 856 What is 58254559 to the power of 1/8, to the nearest integer? 9 What is the tenth root of 4823154401 to the nearest integer? 9 What is 30794154 to the power of 1/2, to the nearest integer? 5549 What is 69652637 to the power of 1/5, to the nearest integer? 37 What is 3361250992 to the power of 1/9, to the nearest integer? 11 What is the fourth root of 437063656 to the nearest integer? 145 What is the sixth root of 284737288 to the nearest integer? 26 What is the cube root of 53272374 to the nearest integer? 376 What is the third root of 7306152279 to the nearest integer? 1940 What is the square root of 5095758822 to the nearest integer? 71385 What is 127471280 to the power of 1/3, to the nearest integer? 503 What is the eighth root of 28403108 to the nearest integer? 9 What is the sixth root of 50651577 to the nearest integer? 19 What is the eighth root of 1100525455 to the nearest integer? 13 What is 3957645375 to the power of 1/2, to the nearest integer? 62910 What is 2567392160 to the power of 1/10, to the nearest integer? 9 What is the eighth root of 23955984 to the nearest integer? 8 What is 70069899 to the power of 1/2, to the nearest integer? 8371 What is the square root of 1496163230 to the nearest integer? 38680 What is the square root of 41543879 to the nearest integer? 6445 What is the fifth root of 68578597 to the nearest integer? 37 What is the square root of 456364111 to the nearest integer? 21363 What is 342912429 to the power of 1/3, to the nearest integer? 700 What is 408831223 to the power of 1/5, to the nearest integer? 53 What is 22589981 to the power of 1/2, to the nearest integer? 4753 What is 19247894 to the power of 1/6, to the nearest integer? 16 What is the fifth root of 1468760284 to the nearest integer? 68 What is 94110309 to the power of 1/2, to the nearest integer? 9701 What is 4665195 to the power of 1/6, to the nearest integer? 13 What is 2775236318 to the power of 1/6, to the nearest integer? 37 What is the sixth root of 7637926 to the nearest integer? 14 What is 319031587 to the power of 1/9, to the nearest integer? 9 What is 51847796 to the power of 1/2, to the nearest integer? 7201 What is the third root of 4260482295 to the nearest integer? 1621 What is the cube root of 599166735 to the nearest integer? 843 What is the sixth root of 378457735 to the nearest integer? 27 What is 3014407955 to the power of 1/3, to the nearest integer? 1445 What is 9755434 to the power of 1/9, to the nearest integer? 6 What is the cube root of 319459318 to the nearest integer? 684 What is 1906502539 to the power of 1/2, to the nearest integer? 43664 What is 8183086298 to the power of 1/2, to the nearest integer? 90460 What is 4134393398 to the power of 1/2, to the nearest integer? 64299 What is the square root of 1125995615 to the nearest integer? 33556 What is the cube root of 262449374 to the nearest integer? 640 What is 179346419 to the power of 1/2, to the nearest integer? 13392 What is the cube root of 454332602 to the nearest integer? 769 What is 17844643 to the power of 1/9, to the nearest integer? 6 What is the cube root of 115164751 to the nearest integer? 487 What is the cube root of 269600051 to the nearest integer? 646 What is 120383635 to the power of 1/2, to the nearest integer? 10972 What is the seventh root of 80795819 to the nearest integer? 13 What is 753117789 to the power of 1/4, to the nearest integer? 166 What is the tenth root of 14054017 to the nearest integer? 5 What is the cube root of 528540214 to the nearest integer? 809 What is the seventh root of 15554532 to the nearest integer? 11 What is the cube root of 223571984 to the nearest integer? 607 What is 399941552 to the power of 1/10, to the nearest integer? 7 What is the square root of 167937025 to the nearest integer? 12959 What is the third root of 208386281 to the nearest integer? 593 What is 593767030 to the power of 1/3, to the nearest integer? 841	{ "pile_set_name": "DM Mathematics" }
39, 1, 3 Put -7, 2, -1, 5, 65, 19, 51 in decreasing order. 65, 51, 19, 5, 2, -1, -7 Sort 1, 0, 5, -3, -2, -71/3, -1/9 in increasing order. -71/3, -3, -2, -1/9, 0, 1, 5 Sort 20, -16, -13, 9, -2 in ascending order. -16, -13, -2, 9, 20 Sort 1, 414, -12127. -12127, 1, 414 Put 2/5, -40/43, 1.7, 6, 3/2 in descending order. 6, 1.7, 3/2, 2/5, -40/43 Sort -0.1, -40/7, 74, -2.8. -40/7, -2.8, -0.1, 74 Sort 1267, -2, -5, 8, -59 in ascending order. -59, -5, -2, 8, 1267 Put -3, -4, 42, -7, 2, 3, 12 in decreasing order. 42, 12, 3, 2, -3, -4, -7 Sort 2/29, 1360, 6.95 in descending order. 1360, 6.95, 2/29 Sort 30, -4, 17, 3, -28 in decreasing order. 30, 17, 3, -4, -28 Sort -4, 489, -23, 4, -16 in decreasing order. 489, 4, -4, -16, -23 Put 172, 672, 4, -42 in increasing order. -42, 4, 172, 672 Put 1.1, -0.5, -0.3242, -0.3, -2 in increasing order. -2, -0.5, -0.3242, -0.3, 1.1 Sort -19/24, 22, 0.1, 3, -2/239. -19/24, -2/239, 0.1, 3, 22 Put 16, -5, 19, 4, -3, -3509, 1 in decreasing order. 19, 16, 4, 1, -3, -5, -3509 Sort 1210514, 1, 8, 0 in descending order. 1210514, 8, 1, 0 Sort -3, -51, -37, 2, -5, -13 in decreasing order. 2, -3, -5, -13, -37, -51 Sort -9442, -4, 0.452, 1 in descending order. 1, 0.452, -4, -9442 Sort -5, -4, -330, 49742 in decreasing order. 49742, -4, -5, -330 Sort 3, 35241, -5, -2, 29 in descending order. 35241, 29, 3, -2, -5 Put -121622, 5, -1, -4, 1 in ascending order. -121622, -4, -1, 1, 5 Put -172, 5, -15, -5/2, 1/2 in descending order. 5, 1/2, -5/2, -15, -172 Put -5, 5, -2, -1, -4, 4, -48454 in ascending order. -48454, -5, -4, -2, -1, 4, 5 Sort -2585, -83.67, 0.9 in ascending order. -2585, -83.67, 0.9 Sort -4, -2, -3, -58805, -5 in increasing order. -58805, -5, -4, -3, -2 Sort 3, 4/13, -4, -8.962. -8.962, -4, 4/13, 3 Sort 2, 97199871, 1 in decreasing order. 97199871, 2, 1 Sort 16771902, 2/3, 1/4 in ascending order. 1/4, 2/3, 16771902 Put 4156, 8, 561 in increasing order. 8, 561, 4156 Sort -2, -4, 552, -19151 in ascending order. -19151, -4, -2, 552 Sort 14513, 1, -0.1, -3/7, -12.6 in ascending order. -12.6, -3/7, -0.1, 1, 14513 Put 2227, 1594, -7 in ascending order. -7, 1594, 2227 Sort 0.2, -662, 4/51, 8 in descending order. 8, 0.2, 4/51, -662 Put -0.022923, 1/17, 8 in decreasing order. 8, 1/17, -0.022923 Sort -11, -98, 2, -269006, -2 in ascending order. -269006, -98, -11, -2, 2 Sort -3, -7151, 10 in increasing order. -7151, -3, 10 Put 83, -2, 2, -30, -3, -21 in descending order. 83, 2, -2, -3, -21, -30 Sort 3/2, -2, 480303, -0.1. -2, -0.1, 3/2, 480303 Put 3, 0, -4, 832, -9, -115 in increasing order. -115, -9, -4, 0, 3, 832 Sort 1, 19, -145, 31, 5, 3 in ascending order. -145, 1, 3, 5, 19, 31 Put -2, 14, -963, 19 in ascending order. -963, -2, 14, 19 Put -220, -1, 12, -10, -4, -11, 4 in decreasing order. 12, 4, -1, -4, -10, -11, -220 Sort 143, 10, 15, -35, -4, -3, 4 in descending order. 143, 15, 10, 4, -3, -4, -35 Put 18147, -2, 4, 227 in descending order. 18147, 227, 4, -2 Sort 2/322755, 5, 4/9, 0.2. 2/322755, 0.2, 4/9, 5 Sort 0.1, -1, -2, 5, 257, 38 in increasing order. -2, -1, 0.1, 5, 38, 257 Put 1/5, 0.3, -0.2, 136, -1, 20 in descending order. 136, 20, 0.3, 1/5, -0.2, -1 Sort 2, -26, 4, 3897, 3. -26, 2, 3, 4, 3897 Sort 2/5, 4, -356, 1259 in decreasing order. 1259, 4, 2/5, -356 Sort 0, -1, -2781, -4, -0.06 in decreasing order. 0, -0.06, -1, -4, -2781 Put 10, 28, -105, -5 in descending order. 28, 10, -5, -105 Sort -0.3, -1/7, -2/3, -2/19192833 in ascending order. -2/3, -0.3, -1/7, -2/19192833 Sort -765, -171, 2 in decreasing order. 2, -171, -765 Sort -0.5, 1/9, -0.2, 2/9, 80937 in descending order. 80937, 2/9, 1/9, -0.2, -0.5 Sort -1, 1722, -4, 509, 5, 3 in decreasing order. 1722, 509, 5, 3, -1, -4 Put -1.3, -4/7, 121508, -0.17 in descending order. 121508, -0.17, -4/7, -1.3 Sort -0.06, 90, -43504/39. -43504/39, -0.06, 90 Put 58, 28, 1, -3, 31 in decreasing order. 58, 31, 28, 1, -3 Sort 7, 172, -2, -4, 2327. -4, -2, 7, 172, 2327 Sort 2/5, 1/9982, -75/2, 1/4. -75/2, 1/9982, 1/4, 2/5 Put -5, 2/21, 323, -1, 0 in decreasing order. 323, 2/21, 0, -1, -5 Put 382/3, -5/4, 659, 5 in ascending order. -5/4, 5, 382/3, 659 Sort 9, 5, 2.4, -5, 0.1, -544 in descending order. 9, 5, 2.4, 0.1, -5, -544 Sort -1/1738, 0.5, 2616/11 in descending order. 2616/11, 0.5, -1/1738 Sort -10, -0.5, 8, -10506, 3, 0.1. -10506, -10, -0.5, 0.1, 3, 8 Sort -18, 0, -0.16, 0.06, 48, 0.5 in decreasing order. 48, 0.5, 0.06, 0, -0.16, -18 Put 40, 493, 0, 17, 10 in ascending order. 0, 10, 17, 40, 493 Sort -166, 1, 4, 891, -8 in decreasing order. 891, 4, 1, -8, -166 Put -6, -617, -4, 202, -3 in descending order. 202, -3, -4, -6, -617 Sort 8, -0.04, 215/3, -1/9 in descending order. 215/3, 8, -0.04, -1/9 Put -0.3, 44, 8, 7/20 in descending order. 44, 8, 7/20, -0.3 Put 21.2, 8, -75.6 in increasing order. -75.6, 8, 21.2 Sort 11, 126, 1/23, 17, 16 in descending order. 126, 17, 16, 11, 1/23 Sort -76, 0, -3, 4, 3, 36, 99 in ascending order. -76, -3, 0, 3, 4, 36, 99 Sort 7134, -0.5, 54/13, 4 in decreasing order. 7134, 54/13, 4, -0.5 Sort -5, -3, -6, 0, -1540, 8 in descending order. 8, 0, -3, -5, -6, -1540 Sort 634, 4, 5, -2, -6, -4 in increasing order. -6, -4, -2, 4, 5, 634 Sort -1863, -13, -3, -8, -2 in increasing order. -1863, -13, -8, -3, -2 Put -0.2516, -3, 1, 516 in increasing order. -3, -0.2516, 1, 516 Sort -92740, -4, 211 in decreasing order. 211, -4, -92740 Sort 3, -4, 0.12, -51013/12 in ascending order. -51013/12, -4, 0.12, 3 Put -6, -90090, 5, 4, 2, -2 in descending order. 5, 4, 2, -2, -6, -90090 Put 4, 3, -203009, 1, 0, 2 in increasing order. -203009, 0, 1, 2, 3, 4 Put 5, -394, 8, -3, -1, 4, 2 in decreasing order. 8, 5, 4, 2, -1, -3, -394 Sort -24949, -36, 0, 4, -5, 18 in increasing order. -24949, -36, -5, 0, 4, 18 Put 30, -25, 1, 3, -29, -2 in ascending order. -29, -25, -2, 1, 3, 30 Put -504, 442, -7, 3, 0 in increasing order. -504, -7, 0, 3, 442 Sort 0, 3, -8/7, -0.09, -1, -49.1. -49.1, -8/7, -1, -0.09, 0, 3 Sort 48, -1, 2, -3, 4, -4, 3 in descending order. 48, 4, 3, 2, -1, -3, -4 Sort 1, 2, -20821, -2, -3, -11 in descending order. 2, 1, -2, -3, -11, -20821 Put -17, -248470, 0, 5, -5, -4 in increasing order. -248470, -17, -5, -4, 0, 5 Sort 54, 2/3, -5, -2/137, 0, -0.092 in increasing order. -5, -0.092, -2/137, 0, 2/3, 54 Put -14/25, -3.5, -2/7, 13 in decreasing order. 13, -2/7, -14/25, -3.5 Put 18.19, 0, -2/11, -3778, -0.2 in increasing order. -3778, -0.2, -2/11, 0, 18.19 Sort 3, 0, -1054912, -4. -1054912, -4, 0, 3 Put 3, -3/2, 6, 8, 1/136, -0.3 in decreasing order. 8, 6, 3, 1/136, -0.3, -3/2 Put 47, 12.32, 0, -2, -1, 2 in descending order. 47, 12.32, 2, 0, -1, -2 Put -19, 5, 364, 230 in increasing order. -19, 5, 230, 364 Sort -4, 2, -7, -1, 0, -5, 117647 in decreasing order. 117647, 2, 0, -1, -4, -5, -7 Sort 610, -0.4, 1, 3, 4/7, -3, 5 in increasing order. -3, -0.4, 4/7, 1, 3, 5, 610 Sort -8/21, 1, -14960 in ascending order. -14960, -8/21, 1 Sort -204, 7, 9992 in descending order. 9992, 7, -204 Sort 191, 7, -27, 26 in decreasing order. 191, 26, 7, -27 Sort 2, 3/7, -27429. -27429, 3/7, 2 Put -1/3, -343, 5, -0.12, -0.2 in decreasing order. 5, -0.12, -0.2, -1/3, -343 Sort -103, 29569, -35 in descending order. 29569, -35, -103 Sort -28, 1, 44734, -1, 2, -4, 7. -28, -4, -1, 1, 2, 7, 44734 Put 5, 2/3, 2, -0.022, -65/232 in ascending order. -65/232, -0.022, 2/3, 2, 5 Sort -1, 6, 15, -5/4, -17.03 in descending order. 15, 6, -1, -5/4, -17.03 Sort -7, 1075, 36, -13. -13, -7, 36, 1075 Sort -14686184, 3, -1. -14686184, -1, 3 Sort -5, 4, 118, -49, 1, -1 in ascending order. -49, -5, -1, 1, 4, 118 Put -5, 49292, 132, -2/3, 0.1 in descending order. 49292, 132, 0.1, -2/3, -5 Sort -2, -24, -0.0619, 3/13 in increasing order. -24, -2, -0.0619, 3/13 Sort -88, -16, -4, 0, -3, -937, 4. -937, -88, -16, -4, -3, 0, 4 Put -56, -9803, -34, -5, -1 in ascending order. -9803, -56, -34, -5, -1 Sort -497, -0.4, 0, 0.4, 78 in descending order. 78, 0.4, 0, -0.4, -497 Put -3, 69901, 11 in ascending order. -3, 11, 69901 Sort -3/32, 7/5, 0.06, 0.082 in descending order. 7/5, 0.082, 0.06, -3/32 Put 4, 100, -6.5, -9/8, -2, 1, 0 in descending order. 100, 4, 1, 0, -9/8, -2, -6.5 Put -3/5, -7, 1, 0, 4, -0.37 in decreasing order. 4, 1, 0, -0.37, -3/5, -7 Put -0.5, -84, 13.8, 0.0468, 5 in decreasing order. 13.8, 5, 0	{ "pile_set_name": "DM Mathematics" }
o 0.2? (a) 0.5 (b) -1/6 (c) 2800068 (d) -1/4 a What is the closest to 1 in -1/119820, -2.5, -5? -1/119820 Which is the closest to 2? (a) -20 (b) 0 (c) 2/65 (d) -0.02 (e) 45 c What is the nearest to 2 in 7, -3/2, -5/986, 6, 2? 2 What is the closest to 1 in 0.7, 4/34541, -5/4, -3/8? 0.7 What is the closest to -0.4 in 213, 3/38, -2/5, 63? -2/5 What is the closest to 127 in 5, -0.64, 9, -0.1? 9 Which is the closest to 517.9? (a) -28 (b) 43 (c) 5 b What is the nearest to -24 in 0.047, -1/4, 0.2, 13.4, 0.3, -2/9? -1/4 What is the closest to -1 in -169893, 0.7, 17? 0.7 Which is the closest to -55? (a) -0.079 (b) -61 (c) 4 b What is the nearest to 2136 in -44, 55, -3, -5? 55 Which is the closest to 1/3? (a) -1 (b) 1/3 (c) 2 (d) 2/23 (e) -2/363 b Which is the nearest to 2/3? (a) 7/187 (b) 0.5 (c) -4 (d) -5 (e) -0.4 (f) 6/29 b What is the nearest to -71 in -29096, -7, -4, 1? -7 Which is the closest to -586? (a) -3/5 (b) 7/15 (c) 1/3 a What is the closest to -19 in 0.1, -234, -1, 0.22, -2/15? -1 What is the closest to -1 in 346.9, 3, -0.05, 4, -2? -0.05 What is the closest to 2/5 in 1, 4/107, 10215, 4/3? 4/107 Which is the closest to 3? (a) 1.5 (b) 2/11 (c) -318 (d) -0.65 a What is the closest to -7.11 in -4.2, -0.4, -1/5, 9? -4.2 Which is the nearest to 3/4? (a) -9 (b) 1 (c) 621 (d) 5.4 b What is the nearest to -1/2 in 100666, 2/13, 1/3, 3? 2/13 What is the nearest to -25 in -3/4, 0, 13601? -3/4 What is the closest to -1/3 in -2/13, -74, -2/7, -0.156, -0.2? -2/7 What is the nearest to 154 in -10556/3, -1, -0.5? -0.5 What is the nearest to 0.31 in 7/3, -2/6185, -42, 0.2? 0.2 Which is the nearest to 0.1? (a) -481794 (b) -0.5 (c) 2/9 c What is the closest to 854 in -4/5, 1/7, -0.5, 3? 3 What is the nearest to 7 in -0.07, 1, 20.74, -9? 1 Which is the nearest to -6/11? (a) 0.4 (b) 10 (c) -0.054398 c Which is the closest to 0.06? (a) 7 (b) -11 (c) 0.2 (d) -5/8 (e) -1.2 c What is the nearest to 72 in 1/8, 2605.4, 0.1? 1/8 Which is the nearest to -8? (a) 0.2 (b) -3/19 (c) 2/1375 (d) 5 b Which is the closest to -0.1? (a) 37539 (b) 3/7 (c) 2/73 c Which is the nearest to -3? (a) 16 (b) 0.5 (c) -5 (d) 124/15 (e) 13 c What is the nearest to 0.9 in -75, 11/9, -0.286, 2/21? 11/9 Which is the nearest to -13? (a) 64 (b) 2 (c) -0.22229 c What is the closest to 11.199 in 1.5, 0.06, 2? 2 What is the nearest to 1 in 6, -7, -0.1, 3, -766? -0.1 What is the closest to 1 in 0, -98, 422.83, 1/2? 1/2 What is the closest to -0.4 in -2/3, -517.016, -3/4? -2/3 Which is the closest to 0? (a) -1/4 (b) -0.1 (c) 654/31 (d) -3.3 b What is the closest to -0.5 in 11, 94, -0.1, 1, -180? -0.1 What is the closest to -67 in 198, -0.3, -13? -13 Which is the closest to -1913? (a) 4 (b) 1 (c) 0.3 (d) 1/4 d Which is the closest to 0? (a) -9/4 (b) -0.2 (c) -42 (d) -3869 b What is the closest to 1 in -31.087, 4, 34, -1/7, -4? -1/7 What is the closest to 1/2 in -0.03, 4, 3, 2/1585, 0.3, 56? 0.3 Which is the closest to -454? (a) 3/4 (b) -0.03 (c) -88 c Which is the nearest to 0.3? (a) -13 (b) 5.6091 (c) -2 (d) -3 c Which is the nearest to 0.13? (a) -2 (b) -0.4 (c) 0 (d) -1/3 (e) 4354 c What is the closest to -0.1 in 3/7, 4/108417, 4/7? 4/108417 What is the closest to 1 in 66, -0.05, 0.7, 4/9, 33, 1/2? 0.7 What is the nearest to -3 in -5, -95, -176, 5/4, -2, 3? -2 Which is the nearest to -334? (a) 468 (b) 11 (c) 3 c What is the nearest to -4 in 0.3, -1/3397, 1, -1/9, -3? -3 Which is the closest to 29.404? (a) 2/11 (b) -0.1 (c) -7 (d) 4 d What is the nearest to -387 in -3/5, -0.5, -0.07, 5? -3/5 Which is the nearest to -310.58? (a) 0.36 (b) -1/7 (c) 1/5 b What is the closest to 2 in 5, 95, -291, 3/7, 3? 3 What is the closest to 2345/3 in -2/7, -1, 0.1, 5/2? 5/2 Which is the closest to -3/4? (a) 8 (b) 0 (c) 5 (d) -0.0323 (e) -0.64 e Which is the nearest to 5245? (a) 9 (b) -2/11 (c) -0.4 (d) 1.2 a Which is the closest to -0.11? (a) -0.1 (b) 2/9 (c) -4 (d) -6/11 (e) 6 (f) 21 a What is the closest to -115 in -4, -3/65185, -3? -4 Which is the closest to -0.1? (a) 0.06 (b) 1 (c) 778 (d) 0.1249 (e) 1/2 (f) 0 f Which is the nearest to 19? (a) -17 (b) 1/2 (c) 2767 b What is the closest to 43 in 5, -2/11, 4, -1.3, -4.8? 5 What is the closest to -28 in -5/2, -1, -0.077, -12, -2/75? -12 Which is the nearest to 4/19? (a) 2/7 (b) 0.4 (c) 0 (d) -3/5 (e) -199 (f) -1213 a What is the nearest to 0.2 in -0.1, 1115, 2/15, 2, -1/2941? 2/15 What is the closest to -24 in -0.4, 1/3, 0.1, 2, -9/581? -0.4 What is the closest to 2 in -5, -619, -7.844? -5 Which is the closest to -116489? (a) 0 (b) 5 (c) -50 c Which is the nearest to -495? (a) 9 (b) 2 (c) -0.5 (d) 0.06 c What is the closest to -5/4 in -0.09, -2/9, -219, 2, -27? -2/9 What is the closest to 2/7 in 9, 62004, -0.5, -5, -4? -0.5 What is the closest to -0.2 in 0.07, 265, -21, 2/9, -4? 0.07 What is the closest to -0.3 in 1/22, -0.26, -4, -0.4, -0.42? -0.26 Which is the nearest to 3? (a) -3/5 (b) -4 (c) -134 (d) -8 (e) -0.2 (f) -2.2 e What is the nearest to -0.712 in -5604, 5, -4? -4 What is the closest to -1 in -592, 2/53, -0.5? -0.5 What is the closest to 1 in 7588, -2, -46, -0.3? -0.3 What is the nearest to -46 in -54, -28, -0.3, -2? -54 Which is the closest to 1? (a) 3 (b) -5 (c) -0.1 (d) -13/6 (e) -8/17 c Which is the closest to -1? (a) 374 (b) -1/5 (c) -0.195 (d) 0.4 b What is the closest to 198 in -2/9, 0.45, 0.3, 5? 5 What is the closest to 1/8 in -3, 1/22968, -5, 0.4, -1? 1/22968 What is the nearest to 1 in -4, 3, 21756480? 3 What is the nearest to 9927 in -3, -0.1, -2/33, -0.5? -2/33 Which is the closest to 0.3? (a) 102 (b) -293 (c) -315 a What is the closest to 1 in -263, 3, 1035, 3/7? 3/7 Which is the closest to -3/5? (a) -1/6 (b) 1/6 (c) 1/21 (d) 13 (e) -2 a What is the nearest to 0.08371 in -0.05, -1, 0.4? -0.05 Which is the closest to -3? (a) 21427 (b) -0.1 (c) -3/19 c Which is the nearest to -1? (a) -765 (b) -5 (c) 16 (d) -0.1 (e) -3/2 e Which is the nearest to -0.1? (a) 2143 (b) -162 (c) 12 (d) 9 d Which is the nearest to 1? (a) 17 (b) -5/2 (c) 0.244 (d) -20.4 c What is the closest to -8 in -2, 3, -3/61, 150, -30/7, 0.4? -30/7 What is the nearest to 2/7 in 4/3, 0, -3, 3/8, -287, 6? 3/8 What is the nearest to 20641 in 0.7, 1, -3/8? 1 What is the nearest to 344 in 0, 1, 4, -153.31, 1/4? 4 What is the closest to -10 in 4, 7, -4, 9058? -4 What is the closest to 7/580 in -5, -2/15, -8, -0.12, 3? -0.12 What is the nearest to -0.4 in -0.2, 4, 15, -15, -378.1? -0.2 What is the nearest to -1/7 in -0.1, 1/3, -0.3, 2.6881, -0.4? -0.1 What is the closest to 1678 in 4, 3, 13/5, 5/8? 4 What is the closest to 2 in -1/2, 2/15, 348, 32/41? 32/41 Which is the nearest to 1561/72? (a) -1/4 (b) -3/7 (c) 2/37 c Which is the nearest to -0.1? (a) -0.5 (b) 0 (c) -661 (d) -1/3 (e) -8.2 b Which is the nearest to -4? (a) 16 (b) 141 (c) -1 (d) -3 (e) -34 (f) 9 d What is the nearest to 0.2 in -11, 0.7, -951, -1? 0.7 What is the nearest to 0.1 in 40.001, 7/3, -2, 0.06? 0.06 What is the nearest to 2.4 in -2/77, 0, 1/1099, -0.4? 1/1099 Which is the nearest to 7/6? (a) -3/4 (b) -0.125 (c) -2/11 (d) -0.2 (e) 4 b Which is the closest to 378? (a) 0 (b) 1 (c) -4 (d) -0.08 b What is the closest to -1/4 in 4, 0.1, -0.0868, 0.4, -0.792? -0.0868 Which is the nearest to -38? (a) 0.091 (b) 5 (c) -0.1 (d) -1/14 c Which is the nearest to 0? (a) -12412 (b) -0.3 (c) 1.1 b What is the closest to 1 in -200, 538, -3, 1/4, 0.4? 0.4 What is the closest to -0.2 in 0.01, 6622, -0.4, -1/14? -1/14 What is the nearest to -258618 in -5, -3, 0.2? -5 What is the closest to -4/1507 in -5, -11, 94? -5 What is the closest to 79 in 0.05, -4, 6/7, 3/2, 4? 4 Which is the closest to 3? (a) 5/2 (b) 5 (c) -80 (d) -4 (e) -3.3 a What is the closest to 2 in -74.1, 0.6, -10/149? 0.6 What is the closest to -1256 in 70, 0.2, -1/13, 1/3? -1/13 Which is the nearest to -0.1? (a) 1 (b) 14552300 (c) 5 a Which is the closest to -0.07? (a) 1 (b) 36 (c) 969 (d) -3/2 (e) 2/5 e What is the closest to -5 in -1.6, -1.1, 0.3, -187.4, 0.4? -1.6 Which is the closest to -209? (a) -75 (b) 7 (c) -0.33 (d) -0.21 a Which is the c	{ "pile_set_name": "DM Mathematics" }
-179530946 -2 What is 5596154 divided by -41? -5596154/41 What is -6818083 divided by 1? -6818083 Divide 2912648 by -1. -2912648 15644219 divided by -4987 -3137 What is 462 divided by -539890? -231/269945 Divide -20616431 by 1874221. -11 Divide -78367159 by 13. -6028243 Divide -13573460 by 3393365. -4 -173033946 divided by -2841 60906 Divide -990996 by 921. -1076 What is 76407 divided by 173? 76407/173 Divide -257547774 by -56013. 4598 125907 divided by -425 -125907/425 Calculate 8914846 divided by -9014. -989 Calculate 598809320 divided by -5. -119761864 Divide 156 by 73972. 39/18493 Divide 68 by 68699. 68/68699 Calculate -35745249 divided by 11915083. -3 What is 10066 divided by -3777? -10066/3777 Calculate -558345 divided by 186115. -3 Calculate 107680841 divided by 1006363. 107 Calculate -28651932 divided by 36. -795887 What is -641 divided by -952038? 641/952038 Divide -270281820 by -2740. 98643 Calculate -649061532 divided by 4676. -138807 Divide -2245782 by 42. -53471 What is 5954580 divided by 66162? 90 Calculate -2 divided by 150114408. -1/75057204 -6 divided by 17614498 -3/8807249 What is 2269207 divided by 1? 2269207 -144 divided by -84880 9/5305 Divide -273 by -10767. 91/3589 -7537014 divided by -151 49914 Calculate 5 divided by 6519756. 5/6519756 Calculate 357332070 divided by 94. 3801405 Calculate 2112400 divided by 5281. 400 -219507998 divided by 6 -109753999/3 Calculate 214129080 divided by 2024. 105795 Divide -39870150 by 157. -253950 Divide -1 by -3898338. 1/3898338 What is -6485 divided by 4838? -6485/4838 568320540 divided by -142080135 -4 What is 7146552 divided by 294? 24308 Divide 28225758 by 957. 29494 Calculate 10 divided by 5328147. 10/5328147 Calculate -1584792 divided by -8. 198099 What is 852002175 divided by -85? -10023555 -549522136 divided by 68690267 -8 What is -27385901 divided by -129791? 211 What is 827708 divided by 721? 1148 Divide -13 by 5743548. -13/5743548 Divide -183205155 by 1505. -121731 360721392 divided by 318 1134344 Calculate -7723513 divided by -7723513. 1 -1356316 divided by -74 678158/37 3 divided by -195238 -3/195238 What is -10724182 divided by -5362091? 2 Calculate -57657 divided by -1498. 57657/1498 -407 divided by -113982 37/10362 Calculate 81116352 divided by -2534886. -32 Divide 275931648 by -91977216. -3 -721971 divided by -17 721971/17 What is 0 divided by 270518? 0 1027973 divided by 1 1027973 -2216985 divided by 1 -2216985 Divide 4051 by 6091. 4051/6091 Divide -98 by 29907. -98/29907 What is -48 divided by -1221002? 24/610501 379 divided by 443063 379/443063 188621 divided by -35 -188621/35 What is -1 divided by -851282? 1/851282 Calculate 263367738 divided by 586. 449433 Divide 698 by -47. -698/47 What is -94035335 divided by -5? 18807067 Divide -228319 by 4536. -32617/648 Calculate -31716741 divided by -3. 10572247 Divide 85521615 by -555. -154093 Calculate -2479287 divided by 1. -2479287 What is -4 divided by 1694093? -4/1694093 Divide 116549 by 364. 116549/364 20923935 divided by 8961 2335 Calculate 55774540 divided by -20. -2788727 Calculate 25 divided by -33154144. -25/33154144 1474 divided by 8099 1474/8099 What is 173 divided by 14148? 173/14148 Calculate -8 divided by -2846381. 8/2846381 Divide 418 by -66154. -19/3007 -3949 divided by 1739 -3949/1739 Calculate -9018030 divided by -69. 3006010/23 Divide -2 by -133317204. 1/66658602 -77081157 divided by -3 25693719 Calculate -131002 divided by 30. -65501/15 What is -379354932 divided by -63225822? 6 Calculate 8220644 divided by -8599. -956 Divide 205467 by -2815. -205467/2815 Divide 12824157 by -21481. -597 What is -230991822 divided by -1? 230991822 Divide -4524 by 15507. -1508/5169 Calculate 229428599 divided by 29. 7911331 What is 656448720 divided by 2? 328224360 What is -7132954 divided by -33? 7132954/33 Calculate -31240836 divided by -44. 710019 Divide -44 by 138712. -11/34678 -1488292 divided by 372073 -4 38579 divided by 341 38579/341 Divide -6 by -24001236. 1/4000206 Divide 11 by 1285845. 1/116895 32207186 divided by -2927926 -11 What is 9260463 divided by 81951? 113 Calculate -10706959 divided by 9. -10706959/9 What is -6536685 divided by -9? 2178895/3 -18691266 divided by 566402 -33 Calculate -339446316 divided by 15429378. -22 What is 13170784 divided by 193688? 68 -12187 divided by -203 1741/29 Divide 3330327 by -7763. -429 Calculate 0 divided by -23801. 0 Calculate 24239130 divided by -1986. -12205 Divide 1823083 by -14. -1823083/14 Divide -21832272 by 15036. -1452 What is 411 divided by -105202? -411/105202 4407865 divided by -629695 -7 What is -2 divided by 32067258? -1/16033629 Calculate -4767 divided by 2629. -4767/2629 734699030 divided by -2 -367349515 -35706888 divided by -348 102606 Calculate 267991 divided by 49. 267991/49 -4781976 divided by -207912 23 Divide 1268465 by 23063. 55 Calculate 27 divided by -1609509. -9/536503 What is 10584406 divided by 5292203? 2 7 divided by 701263 7/701263 11 divided by -25662491 -11/25662491 Calculate -9795 divided by -1644. 3265/548 213120 divided by -576 -370 What is -4028891820 divided by 2? -2014445910 Divide 294965 by -173. -1705 What is -5 divided by -9222429? 5/9222429 35593529 divided by 450551 79 -5723400 divided by -1907800 3 What is -391310643 divided by -3? 130436881 What is -4613196 divided by 2306598? -2 1557 divided by -2601 -173/289 What is 182 divided by 87250? 91/43625 Calculate 1 divided by -14623889. -1/14623889 Divide 76956 by 103. 76956/103 Calculate 1106659172 divided by 4. 276664793 What is 213891060 divided by 587? 364380 Calculate -432506 divided by 8. -216253/4 115 divided by -11034601 -115/11034601 Divide -3845031 by 1. -3845031 Calculate -9383968 divided by 11066. -848 Calculate -85438380 divided by 4. -21359595 Divide -4422966 by -2. 2211483 What is -3555783 divided by -6597? 539 Calculate -100861 divided by 677. -100861/677 Divide -3146853 by 208. -3146853/208 -24784 divided by 681 -24784/681 20702060 divided by 4 5175515 Divide -13031465 by 277. -47045 What is -147922536 divided by 40044? -3694 Calculate -1561 divided by -852. 1561/852 Divide 25 by 34523682. 25/34523682 -49179238 divided by 49179238 -1 Calculate 324 divided by 52102. 162/26051 Calculate 104055 divided by 195. 6937/13 -503412 divided by -2035 503412/2035 Calculate -12249072 divided by -55176. 222 What is 227 divided by -28791? -227/28791 Divide 4297 by 13061. 4297/13061 What is -1 divided by 13651792? -1/13651792 What is -33173290 divided by 6634658? -5 Divide 412777970 by -82555594. -5 -9439675 divided by -5 1887935 -341 divided by -4071 341/4071 -11 divided by -6512073 11/6512073 16 divided by 554264 2/69283 10333545 divided by 43 240315 Calculate -337220 divided by 4. -84305 Divide -91759280 by 178520. -514 What is -47 divided by 286071? -47/286071 What is -45768789 divided by 462311? -99 What is -166 divided by 842199? -166/842199 Calculate -15441195 divided by -3088239. 5 Divide -181225344 by 90612672. -2 Calculate -82104519 divided by -3. 27368173 Calculate -23330679 divided by -47711. 489 What is 778 divided by -105148? -389/52574 Divide -6637 by 42302. -6637/42302 -101187704 divided by 2 -50593852 Calculate 1221706 divided by 16. 610853/8 Divide 19994 by 3307. 19994/3307 Calculate 372 divided by -221688. -31/18474 23212480 divided by -5 -4642496 84940107 divided by 28313369 3 45090048 divided by -176133 -256 What is -44700656 divided by -1001? 44656 Divide 38748726 by 18. 2152707 What is -260611110 divided by -17374074? 15 Calculate -28468140 divided by -65444. 435 What is -490314660 divided by 11660? -42051 Calculate -38442114 divided by -2. 19221057 Calculate 1408 divided by 16695. 1408/16695 Calculate 1359855310 divided by -5. -271971062 Calculate -1165 divided by -386. 1165/386 What is 2605808 divided by -15? -2605808/15 -13 divided by 2066715 -13/2066715 Calculate -2 divided by -11197149. 2/11197149 40332 divided by -28 -10083/7 11218 divided by 1383 11218/1383 Divide 137154099 by 3. 45718033 Calculate 262267 divided by 119. 262267/119 31323024 divided by 7830756 4 What is 0 divided by -2710369? 0 -2 divided by -26407202 1/13203601 Calculate 38768 divided by 82. 19384/41 5678530 divided by -1430 -3971 -429232074 divided by 6 -71538679 Calculate 11 div	{ "pile_set_name": "DM Mathematics" }
14 In base 7, what is -5 - -12? 4 In base 14, what is -5 + 0? -5 In base 3, what is 22 - 1211001? -1210202 In base 8, what is 5 + 42? 47 In base 15, what is 0 + 16? 16 In base 4, what is -211 + 22? -123 In base 3, what is -12 - -221121? 221102 In base 16, what is -1c - -2? -1a In base 16, what is b - 867? -85c In base 13, what is 0 - 17? -17 In base 3, what is -101 - 101012? -101120 In base 16, what is -1 + -b8? -b9 In base 8, what is 4 + -1535? -1531 In base 7, what is 14 + 15? 32 In base 2, what is -10010011100 - -10110? -10010000110 In base 13, what is 5 - -3? 8 In base 7, what is 1150 + 1? 1151 In base 7, what is 45 - -360? 435 In base 14, what is 5 - 2593? -258c In base 8, what is 1250 - -4? 1254 In base 9, what is -2622 + -5? -2627 In base 4, what is 31 + 220? 311 In base 11, what is 5 - 44? -3a In base 14, what is 89 + -5? 84 In base 12, what is -4 - 32a? -332 In base 8, what is -225 - 54? -301 In base 6, what is -2 + 404? 402 In base 10, what is -47 - -2? -45 In base 9, what is 58 + 2? 61 In base 14, what is -3a + -6? -42 In base 6, what is -3 + -55305? -55312 In base 4, what is 10 - 20001? -13331 In base 4, what is -10 - 2311? -2321 In base 7, what is 2 + 6? 11 In base 8, what is -3 + 1? -2 In base 8, what is 125 - -252? 377 In base 4, what is 1303 + -2? 1301 In base 2, what is 1110 - -10001111? 10011101 In base 6, what is 3 + -3234? -3231 In base 14, what is 28 - c? 1a In base 16, what is -49 - 1? -4a In base 14, what is -12 - 155? -167 In base 16, what is 4 - 15? -11 In base 3, what is 2 + 12110010? 12110012 In base 11, what is -158 - -5? -153 In base 8, what is -11 + -27? -40 In base 10, what is 3 + -150? -147 In base 6, what is 3024 + -5? 3015 In base 10, what is -45962 + 1? -45961 In base 15, what is 1a - 1d? -3 In base 2, what is 111111 + -10110100? -1110101 In base 8, what is 1 - -5000? 5001 In base 2, what is -1100 - -101101100? 101100000 In base 9, what is -21 + 374? 353 In base 16, what is 3 - -87? 8a In base 8, what is 2 - 1242? -1240 In base 15, what is -892c - 3? -8930 In base 10, what is 5 - -131? 136 In base 2, what is -10 - -1110? 1100 In base 5, what is -300 + 114? -131 In base 16, what is 3 - -a0? a3 In base 11, what is -8231 + -1? -8232 In base 6, what is 3020 + 11? 3031 In base 6, what is 214 - 13? 201 In base 15, what is 2ba + 8? 2c3 In base 7, what is -3416 - -25? -3361 In base 15, what is -282 + -12? -294 In base 9, what is 5 - -150? 155 In base 15, what is -d - -19? b In base 8, what is -135 + 10? -125 In base 15, what is 5d + 0? 5d In base 14, what is -611 - -3? -60c In base 11, what is 13a05 - 0? 13a05 In base 7, what is -134 + 2? -132 In base 3, what is -1201100 - 110? -1201210 In base 3, what is -111 - -2? -102 In base 15, what is -351 + -37? -388 In base 11, what is -1 + -33? -34 In base 11, what is -92 - -105? 23 In base 3, what is 10 + -11212? -11202 In base 12, what is -119 - -4? -115 In base 6, what is -3 + 1440? 1433 In base 14, what is 2 - 538? -536 In base 3, what is 10 - -100010? 100020 In base 6, what is -5 - -12542? 12533 In base 12, what is 138 - -2? 13a In base 6, what is -3 + 2521? 2514 In base 15, what is 7 + 6bb? 6c3 In base 4, what is 10020 - -1? 10021 In base 3, what is -2011001 - -12? -2010212 In base 4, what is -22 + -1003? -1031 In base 11, what is -21 + 6? -16 In base 6, what is -111 - 11? -122 In base 11, what is -19 - -8a? 71 In base 9, what is -740 + -43? -783 In base 12, what is 0 - 17b? -17b In base 9, what is 0 + 4? 4 In base 5, what is 4 + -34? -30 In base 7, what is 4 - 56? -52 In base 4, what is -332001 + -11? -332012 In base 9, what is -771 - -38? -732 In base 14, what is -333 - 1? -334 In base 12, what is 3 + -1803? -1800 In base 14, what is -108 - 0? -108 In base 13, what is 13 - 6aa? -697 In base 16, what is 30f + -a? 305 In base 15, what is -1 + 3d? 3c In base 3, what is 0 + 1022220? 1022220 In base 16, what is -12b6 + 3? -12b3 In base 14, what is 10 - 22? -12 In base 8, what is -2 + -44? -46 In base 13, what is 8 - -cc? 107 In base 2, what is 1101101001011 - 10? 1101101001001 In base 13, what is 89 + 4? 90 In base 8, what is -463 + 2? -461 In base 2, what is 10 + -10001010? -10001000 In base 15, what is 4 - -1b5? 1b9 In base 5, what is 0 - -13? 13 In base 14, what is 1 + 23? 24 In base 12, what is 19 + -4? 15 In base 7, what is -53444 + 0? -53444 In base 4, what is 10 - -202? 212 In base 8, what is 712 - 133? 557 In base 14, what is -5 + -397? -39c In base 5, what is -10 - 244? -304 In base 16, what is 7c - 9? 73 In base 6, what is 111 - 145? -34 In base 7, what is 261 + 13? 304 In base 10, what is 2 + 34? 36 In base 15, what is -a5 - -1? -a4 In base 8, what is -56 + -17? -75 In base 6, what is -5 + 1053? 1044 In base 11, what is 11 - 5? 7 In base 11, what is 23a - 2? 238 In base 8, what is 3 + 152? 155 In base 16, what is 9 - a? -1 In base 2, what is 100001 - 110110? -10101 In base 2, what is 1100 + -11111? -10011 In base 14, what is 21 + 266? 287 In base 16, what is -e5 + -2? -e7 In base 12, what is -5 - -463? 45a In base 4, what is 131 + -232? -101 In base 8, what is -1712 - -1? -1711 In base 12, what is 158 - 0? 158 In base 2, what is 0 + -10100101000? -10100101000 In base 11, what is 3 - -31? 34 In base 13, what is -32 + -4? -36 In base 5, what is 1301 - 10? 1241 In base 2, what is 1011001001000 - 100? 1011001000100 In base 11, what is -370 + 4? -367 In base 9, what is 716 - 2? 714 In base 7, what is -16 - -422? 403 In base 11, what is 27 + 747? 773 In base 3, what is -21021 - 1211? -100002 In base 12, what is -3052 + -2? -3054 In base 7, what is -60 - -4? -53 In base 3, what is 221 - 2102? -1111 In base 13, what is 54a - -1? 54b In base 15, what is 2 - -c45? c47 In base 8, what is -5 - 3753? -3760 In base 4, what is -313 - 13? -332 In base 15, what is 156 + 4? 15a In base 3, what is 112110 + 100? 112210 In base 16, what is 5 + -21? -1c In base 16, what is 2af - 9? 2a6 In base 13, what is -c64 - 4? -c68 In base 16, what is -4 + 16fc? 16f8 In base 14, what is 6d97 + 5? 6d9c In base 13, what is -a1 + -59? -12a In base 5, what is -2343 - 134? -3032 In base 14, what is 119 - -b? 126 In base 2, what is -100110 - -101? -100001 In base 13, what is 40 + -9? 34 In base 7, what is 3 + -1505? -1502 In base 8, what is -2324 + -3? -2327 In base 16, what is 3 - -12? 15 In base 2, what is -10 + -10111001? -10111011 In base 12, what is -2 + -660? -662 In base 14, what is bc - -5? c3 In base 14, what is 3 - -5b? 60 In base 7, what is -20 + 511? 461 In base 3, what is 21 + -1002200? -1002102 In base 15, what is -49 - 3? -4c In base 9, what is -5 - -1? -4 In base 10, what is 29 + 12? 41 In base 4, what is -202211 - 13? -202230 In base 3, what is -121 + -101? -222 In base 5, what is -100 - -1021? 421 In base 8, what is -2341 + -3? -2344 In base 6, what is 2 - 11? -5 In base 12, what is -1014 - -5? -100b In base 10, what is 2 + 1997? 1999 In base 6, what is 255 - -31? 330 In base 2, what is 10 + 1000? 1010 In base 13, what is -29 - 117? -143 In base 11, what is -5 - 569? -573 In base 11, what is -331a - 0? -331a In base 15, what is -9 - 2a? -34 In base 3, what is -21222 + -11? -22010 In base 6, what is -21 + 4? -13 In base 6, what is -240430 + 3? -240423 In base 11, what is -1059 + 5? -1054 In base 4, what is 2301 + -230? 2011 In base 10, what is -25 - 19? -44 In base 14, what is 24 + 7? 2b In base 4, what is -3001 - -3? -2332 In base 2, what is -110010 + -100001? -1010011 In base 16, what is 1 + 43? 44 In base 2, what is -1100 + 1001000101? 1000111001 In base 3, what is 21220120 + -11? 21220102 In base 3, what is -210 + -21220? -22200 In base 16, what is -106 + -2? -108 In base 7, what is 453 + 3? 456 In base 13, what is -30 - -15? -18 In base 7, what is 11 + 2555? 2566 In base 11, what is -a10 + 11? -9aa In base 15, what is -5 + -56? -5b In base 9, what is -2751 - 5? -2756 In base 7, what is 1231 + 6? 1240 In base 11, what is -840 - 2? -842 In base 4, what is -21302 - -32? -21210 In base 8, what is 131663 - -5? 131670 In base 5, what is -4 + -2022? -2031 In base 13, what is -16 - 0? -16 In base 16, what is 0 + 3e3? 3e3 In base 7, what is 3033 - -16? 3052 In base 10, what is 5 + 3? 8 In base 7, what is 4 + -101? -64 In base 6, what is 102 + 321? 423 In base 3, what is -101210 + 11	{ "pile_set_name": "DM Mathematics" }
1 Suppose 4i - 13 = -5. Suppose 15 = 5n - 2k, ik = -6n + 3n + 9. Suppose u - 5u = -6u. Solve u = -z - 0 + n for z. 3 Let s(h) = -7h + 38. Suppose p = 16p - 75. Let i be s(p). Solve 0w + 15 = iw for w. 5 Suppose 24 = -r - r. Let u = -12 - r. Let p = -11 + 15. Solve -py + 8 + 8 = u for y. 4 Suppose -3l + 221 = -4m, l - m = 23 + 49. Let i = l - 54. Solve 3s + 4 = i for s. 3 Let z(i) = -i*3 - 4i*2 + 7i + 12. Let f be z(-5). Suppose -4c + 2o - 4 = 0, -2o + 0o = -fc - 4. Solve r + 4r = c for r. 0 Suppose -6 = -13q + 14q. Let v(c) = -c*2 - 6c - 2. Let y be v(q). Let s be (y/(-3))/(1/9). Solve sb - b = -15 for b. -3 Let q(x) = -x. Let j be q(-4). Suppose -3c = w - 8, j - 16 = -4w - 2c. Solve 0 = -h + w for h. 2 Let p(l) = 6l3 - l2 - l + 1. Let g = 2 + 2. Suppose -gw + 23 = 19. Let n be p(w). Solve -3r + nr + 6 = 0 for r. -3 Let t(n) = -2n. Let c be t(-2). Suppose 5m + c = 39. Let z be 1 + -2 + (m - 4). Solve zg - 1 = 7 for g. 4 Suppose 0 = 4q - 122 - 70. Suppose -5u + u = -q. Solve 3z + z = u for z. 3 Suppose 2x + 3 = 17. Suppose -xh + 4 = -5h. Let b = h + 1. Solve bl - 1 = -4 for l. -1 Let t be (-8)/(-5) + 2/5. Suppose -11 - 4 = -3h. Suppose 3k - 3f + 2 = -1, -2k = -hf + 11. Solve -tb = -0b + k for b. -1 Suppose -10q + 13q + 5y - 27 = 0, q = 4y - 8. Suppose 5d = -5h + 3h + 12, -3 = -3d + 3h. Suppose -v = dv - 9. Solve -3z = -qz - v for z. -3 Let m be (8/(-10))/(2/(-5)). Suppose -9f - 7f = -80. Solve mc = 3c - f for c. 5 Suppose -m - 4 = 6. Let f = 12 + m. Suppose fs = 1 + 7. Solve 3n - 1 = -s for n. -1 Let k be 1 - -1 - (-18)/9. Let l = 14 - k. Solve c + c + l = 0 for c. -5 Let c = -13 - -28. Suppose -3h - c = 0, n - 20 = 6n + 5h. Suppose n = -2r + 5. Solve -rs - 5 = 5 for s. -5 Suppose 2s + 29 = 15. Let v(o) = o2 + 7o + 3. Let q be v(s). Solve -qw + 2 = -7 for w. 3 Let y(z) = 14z - 70. Let m be y(6). Solve 0 + m = -14q for q. -1 Let o = 183 - 179. Solve -4b + 12 - o = 0 for b. 2 Let o be (-70)/28 - 148/(-8). Solve ok - 11 = 5k for k. 1 Suppose 4n + 5p + 0 - 1 = 0, -2n = 5p + 7. Suppose -ng - 29 = 5u, -3u - 21 = 5g + 12. Let y = g - -9. Solve -3 = yt - 0t for t. -1 Let l = -17 + 21. Suppose -4o - 5i = -22 + 2, 0 = -li + 16. Solve ov - 2v + 6 = 0 for v. 3 Suppose 0 = -3y - 5a - 3 + 29, 0 = -2y - 5a + 24. Suppose -7k = -3k + 12, -ym - 3k = 5. Solve mt - 2 = t for t. 2 Suppose 5w = -0w. Let z be (2 + -11)/(-3) - w. Suppose 0 = -9p + 7p. Solve -zr + pr = -9 for r. 3 Suppose 390 = 9w + 318. Solve 2 = -wf + 18 for f. 2 Let t = 4 + -1. Solve 0 = 2j + 9 - t for j. -3 Suppose -24 - 96 = -12r. Solve 7l - r = 2l for l. 2 Let y = 90 + -75. Solve yl - 10l + 15 = 0 for l. -3 Let y be (-60)/(-8)90/75. Solve 0 = yt - 7 - 2 for t. 1 Suppose -77x + 64x + 78 = 0. Solve -3r + 3 = -x for r. 3 Let n be 1 - (5 + -6) - -8. Solve n = 2k + 3k for k. 2 Suppose -4h + 4w = -12, h - 9 = -w - w. Suppose 11 = 2c + h. Solve 2m - c - 5 = 0 for m. 4 Suppose -q = -4m - 13, m = -2q + 8 - 0. Let s be 4/(-6)(-33)/m. Let j = s - -14. Solve 2x = 1 + j for x. 2 Let g = -131 - -135. Solve 0 = gp - 0p - 20 for p. 5 Let l(m) = -m2 + 9m + 6. Suppose 0 = -4r + 16 + 20. Let c be l(r). Solve 2 + c = 2k for k. 4 Let u(x) = 4x - 42. Let o be u(11). Solve -r = or - 6 for r. 2 Suppose 334 - 422 = -11z. Solve z = 4b - 4 for b. 3 Let o = 29 - 13. Suppose -6i = -2i - 3v - 4, -2i = 2v - 16. Let a = -8 - -11. Solve -o + i = ap for p. -4 Suppose 2z = -3g - 10, -2z = 3z + 25. Suppose 0f = -2f - 4, 73 = 5c - 4f. Let n = 16 - c. Solve g = nh + 2h for h. 0 Suppose 0 = 4j - 7j + 9. Suppose js + 84 = -4g, -4s - 113 = -0s + 5g. Let c be (s/(-20))/(4/10). Solve cw + 0w - 4 = 0 for w. 1 Suppose 4x + 29 - 34 = -n, -3n = -3x + 15. Let g(r) = 5r - 1. Let m be g(-1). Let q be 150/45 + x/m. Solve qd + 6 = -0 for d. -2 Let i(t) = -t*2 + 7t - 2. Let q be i(6). Let b = -45 + 105. Suppose -4h = -h - b. Solve qw + h = -w for w. -4 Let p(m) = -3m + 43. Suppose -7j = -45 - 46. Let a be p(j). Solve -6t + at = 0 for t. 0 Suppose 2 = 3y - 7. Suppose 0 = -yr + 12r. Suppose 0v = 5v. Solve vu + 4u = r for u. 0 Suppose -3o + 128 = -k + 60, 2o = -2k + 56. Solve o = -10n + 4n for n. -4 Suppose -48 = -4r + 4u, -25 - 7 = -3r + 4u. Solve rb = -b + 85 for b. 5 Suppose 0 = -a + 4a - 2v + 8, 3v - 12 = 4a. Suppose ao = -o. Let y be (o + -3)/(-6)4. Solve t + t = y for t. 1 Let t be 3930/(-75) + (-4)/(-10). Let g = 52 + t. Solve gv - 5v = 20 for v. -4 Suppose p - 2a - 2 = -a, 0 = 4a. Let r be (-120)/(-100)1/(3/10). Suppose -i + r = po, -o + 3 = -2i + 31. Solve b - i = -3b for b. 3 Let p = 131 - 127. Solve -27 + 19 = pf for f. -2 Let t(d) = d*2 - 7d + 2. Let x be t(8). Suppose -5r = -0r - x. Solve -u = -r + 3 for u. -1 Let z be (-9 - -9)((-8)/(-10))/4. Suppose 4g - 44 = 16. Solve z = -5y - 0 + g for y. 3 Suppose -5y + n + 89 = 3n, -5y = 5n - 95. Let s(o) = o3 - 18o*2 + 18o - 16. Let k be s(y). Solve 5 = 4i + k for i. 1 Let h be (-4)/6 - (654/18 + 0). Let c = h + 47. Let y be ((-8)/4)/((-4)/10). Solve 0 = 5x + c + y for x. -3 Suppose 4f = 3t + f + 66, 3t + 60 = f. Let v = 5 + t. Let d be (-3)/9(5 + v). Solve -dr = -19 + 7 for r. 4 Suppose -3o - 3z + 6 = 0, -z + 17 = 64o - 60o. Solve -41 = ot - 61 for t. 4 Let u = 53 - 43. Let a(k) = k - 19 - 2k + k2 + 21. Let v be a(0). Solve -7y + vy = u for y. -2 Suppose -13d = -3d + 7d. Solve 3w + 0w = d for w. 0 Let j = 23 - 13. Suppose -v = 3k, -4k + j + 0 = -2v. Solve 4 = g + k for g. 3 Suppose 0 = -7n + 8n + 2b - 2, -3n + 7 = 5b. Solve -11s + 35 = -ns for s. 5 Suppose 0 = -2f + 5f - 6. Let q = 7 - f. Suppose 13a + 11975 - 12131 = 0. Solve -r - a = -qr for r. 3 Let q(a) = 4a - 32. Let m(u) = 3u - 21. Let d(v) = 7m(v) - 5q(v). Let g be d(-11). Solve 0 = gt - 3 - 3 for t. 3 Let v(p) = p + 21. Let c be v(-17). Suppose -3x - c = n, n - 8 = -2x + 3n. Solve 0 = -xu - 4u for u. 0 Let z(v) = v*3 + 3v*2 - 4v - 5. Let j be z(-3). Solve -j = -2l - 9 for l. -1 Let w = 40 - 24. Suppose 0 = m + 4y - w, -2y - 58 = -4m - m. Let s be m/36(-15)/(-1). Solve -su = -0u + 10 for u. -2 Suppose 4t - t = 21. Let l be 6t/(28/24). Let a be (l/(-21))/(2/(-7)). Solve -aj = -2j for j. 0 Let b = -23 - -29. Suppose 12 = -0c + bc. Solve -ct + 7t = -10 for t. -2 Let b(i) = -i2 - 4i. Let t be b(-2). Suppose 0 = 4z - 20, l - tz + 14 = -0l. Solve 3g = 6 + l for g. 4 Suppose 2q = -0q + 4n - 20, -10 = 4q - 2n. Suppose q = -0r - 4r. Solve -3k + 12 = -r for k. 4 Let o be 9 + -2 + 1 - 2. Solve 9b = 12b - o for b. 2 Let o be ((-65)/(-39))/((-10)/(-12)). Suppose -7l = -2l - 85. Let c = l - 11. Solve -c = 4f - of for f. -3 Let r be (-30)/(-9)(-6)/(-5). Solve -5c = -4c + r for c. -4 Let m be 5 + (-4 - (-5 + (4 - 1))). Suppose 35 = mn - 6s + s, 5n = 5s + 45. Solve -2 = np + 3 for p. -1 Let g = 8 + -6. Let l = -237 + 252. Solve f = -gf - l for f. -5 Suppose 28w = 8w + 400. Solve -4q + 0q - w = 0 for q. -5 Let i(m) = -m3 + 8m*2 + m + 31. Let z be i(8). Solve -5t - z + 14 = 0 for t. -5 Let i(k) = -k*2 + 9k - 14. Let g be i(7). Suppose g = -4c + 7c. Solve cn = -n for n. 0 Let p = -31 - -33. Suppose a = pa - 4. Solve v = -0v - a for v. -4 Suppose 0 = 5t - t. Let a be (2 + (-4)/4)3. Suppose b - 4h = -2h + 23, 2h - 29 = -ab. Solve t = -5d + b + 2 for d. 3 Suppose 44 = l - 0. Let p be ((-6)/(-8))/(3 - l/16). Solve -pn = -8 - 1 for n. 3 Suppose -5h + 30 = d, 9d - 4d - 12 = -2h. Suppose 5x - 4v = h + 14, 3v - 8 = -2x. Solve p = -p + x for p. 2 Suppose -6 = f - 4f. Suppose 4g = 5m + 26, 0 = -4g - fm + 16 - 4. Suppose 5y - 6 = g. Solve 3u = y + 1 for u. 1 Let o(s) = -2s - 2. Let t be o(-2). Suppose 5p - 38n - 85 = -33n, 0 = -p - 2n + 8. Solve -4h - t = -p for h. 3 Suppose -11 = 9u - 65. Let g = -15 - -12. Let z = g + u. Solve -zh + 8 - 2 = 0 for h. 2 Let z(n) = -n*2 - 11n + 33. Suppose -3w - 2k - 75 = 2w, -w - 8 = -k. Let c be z(w). Solve -cy - 20 = -3y for y. -5 Suppose -137m = -162m + 525. Solve 5q + m = -2q for q. -3 Let t be ((-6)/(-9) - (-4)/(-6))-1. Suppose 21 + 30 =	{ "pile_set_name": "DM Mathematics" }
/z)))/z)/(z/z*(-2/5)(z/(zz(3/5)zz))/z) assuming z is positive. z Simplify ii*(-18)i/i(2/53) assuming i is positive. i(-850/53) Simplify (h*(-2/9)/hh(h(2/3)/h)/h)/(h0)20 assuming h is positive. h(-14/9) Simplify y(-1)/(y/((y/(y(11/3)/y))/y)y) assuming y is positive. y*(-17/3) Simplify n/((nn*(-17))/n)n*(-3/10)/nn assuming n is positive. n(177/10) Simplify (g(-2/3)/gg/(g/(((g/g(1/3))/g)/g)gg)gg)/((gg(g/((g/g(2/17))/g))/gg)/(gg/g4)) assuming g is positive. g(-138/17) Simplify jj/j*(-10)jjj/(jjj/j*(1/5)j) assuming j is positive. j(56/5) Simplify (((v/v3)/v)(-16/5))(3/2) assuming v is positive. v(72/5) Simplify ((w(2/7)w)(2/3))(-1/4) assuming w is positive. w(-3/14) Simplify h(1/21)h(-19) assuming h is positive. h(-398/21) Simplify (ttt*(2/9)tt)0/(t(-7)t(-2)) assuming t is positive. t9 Simplify o*(-1/2)o/(o*(-19)o) assuming o is positive. o*(37/2) Simplify (y(y*(-1)yy)/y)(-1/30)/((yy*(-4))/y(yyyyy(2/9))/y) assuming y is positive. y(67/90) Simplify ((q*(-3)q)/q(-8))/(q3/q)(3/5) assuming q is positive. q(24/5) Simplify (u(-7)/u)32 assuming u is positive. u*(-256) Simplify ((mm/(m/(mmmm0m))m)(-2/73))0 assuming m is positive. 1 Simplify (o(-3)oo(-10))(10/7) assuming o is positive. o(-120/7) Simplify h22h(3/11) assuming h is positive. h(245/11) Simplify b/b*33b/(bb(-17)b) assuming b is positive. b(-16) Simplify h(-38)hh/h6 assuming h is positive. h(-42) Simplify (ll/l(-2)ll)(-2/141)/(l/((ll*(1/5))/l)l/(l(2/7)/l)) assuming l is positive. l(-4276/1645) Simplify (d13/d(-16))(-8/9) assuming d is positive. d(-232/9) Simplify (ss/(ss/s(-8)))/(s(-2)/s)(s(-3/5))45 assuming s is positive. s(-32) Simplify y(-5)/(y/(y/(y(1/5)/yyy)))(y/((yy8)/y))/(y(3/10)y) assuming y is positive. y(-29/2) Simplify (z/(z(-6/13)z))/((z/z2)/z)z/(z*3/z)z1 assuming z is positive. z(32/13) Simplify (o*4/ooo/(ooo(-2/5)oo)o)/(o*2/oo(-2/9)) assuming o is positive. o(73/45) Simplify (a/((aa(1/5))/a))/(a/a(-3))a*(-2)/(a/(aa(-7))) assuming a is positive. a(-61/5) Simplify (c*(-3/2)cc(-2/17))/((c(cc1/cc)/c)/c5) assuming c is positive. c(81/34) Simplify (j0/(j/j15))(-25) assuming j is positive. j(-350) Simplify (t/t*(1/9)t)/t(3/11) assuming t is positive. t(160/99) Simplify (b*(8/7)/(((bb*0)/bb)/bb))/(b(1/3))(-1) assuming b is positive. b(10/21) Simplify ((pp12/p)/((p(-3/4)p)/p))(-15/4) assuming p is positive. p(-765/16) Simplify (g(2/7)gg(-4))/((g/(g/((gg/(gg/(g(-2/3)/g)gg))/g)))/(g/(gg/((g*(-9)g)/gg)))) assuming g is positive. g(-148/21) Simplify (j(3/4)j)/(jj/(jj22)) assuming j is positive. j(91/4) Simplify z*15z(-2) assuming z is positive. z13 Simplify (i(-2/3)/(i/(i(-5)/ii)))/((i(2/21)/i)/(((ii*0i)/i)/i)) assuming i is positive. i(-121/21) Simplify (v/((v/(v/v(-1/9)))/v))/(vv(-16)v) assuming v is positive. v*(145/9) Simplify ((ll*(-25)l)/l)(3/8) assuming l is positive. l(-9) Simplify (yyy8)/y(8/7) assuming y is positive. y(62/7) Simplify ((l(17/6)/l)/l)/l(((l(ll16)/ll)/l)/l)/l assuming l is positive. l(89/6) Simplify r1/rr/(r/(r/(r/(r(5/3)rr)))r)r(2/23)r(-3) assuming r is positive. r(-17/69) Simplify (c(2/7))(-1/6)cc*(-2/23)/cccccc(-5) assuming c is positive. c(-548/483) Simplify l*(3/4)ll(-2/17)(ll2)/ll/(l/(ll(-3/5))ll) assuming l is positive. l(691/340) Simplify l8/ll11/l assuming l is positive. l17 Simplify b/((b/(bb(4/11)/bb))/b)bb(3/7) assuming b is positive. b(292/77) Simplify (t/(t*(-1/4)t))/(t/(((t/t(-6/7))/t)/t)) assuming t is positive. t(-25/28) Simplify z41/z(-1/16) assuming z is positive. z*(657/16) Simplify ((cc(-3))(-1/8))(-9/4) assuming c is positive. c(-9/16) Simplify ((g/(g/g*33))/g)/(gg*(-30)g) assuming g is positive. g*60 Simplify c/(c/(ccc44))cccc(-36) assuming c is positive. c13 Simplify s(-28)ss9 assuming s is positive. s(-18) Simplify (k(((k/((k/(k*31/kk)k)/kk))/k)/k)/k)(-1/6) assuming k is positive. k(-14/3) Simplify (b/b*(-13)bb)/((b/(b/(bb(2/53))))/b) assuming b is positive. b(846/53) Simplify ((s7)(-27))30 assuming s is positive. s(-5670) Simplify (r*(2/13)r*4r)48 assuming r is positive. r(3216/13) Simplify o(((oo/o*(-1/6))/o)/o)/ooo/(o(-1/12)o) assuming o is positive. o(5/4) Simplify (((s/s(-5/4))/s)/s)(-26) assuming s is positive. s(-13/2) Simplify s*(-1)(s*(5/3)/s)/s(ss1s)(1/6) assuming s is positive. s(-5/6) Simplify ((x/(xx6/x))/x(2/7))/(x3x(-4/7)) assuming x is positive. x(-54/7) Simplify w/(w*17ww)ww/w(-6/23) assuming w is positive. w(-362/23) Simplify q(-5/7)/((q/(q(q(q24q)/qq)/qq))/q) assuming q is positive. q*(184/7) Simplify (oo(-3))46 assuming o is positive. o(-92) Simplify ((g0)(-2/15))25 assuming g is positive. 1 Simplify a/(aa17)aa(-2) assuming a is positive. a(-18) Simplify (n(-2/5)n)*(-7)(n*(-2/11)n)/n9 assuming n is positive. n(-681/55) Simplify (d(-1)/d)6(d/d(-2/21))/dd/(dd(-1)) assuming d is positive. d(-229/21) Simplify ((t/t(-2/5))/t)(-14)(t(-1))37 assuming t is positive. t*(-213/5) Simplify ((cc/c*(1/2)c)/ccc)36/(c(1/5)cc3) assuming c is positive. c(609/5) Simplify (c/(cc/(c((c*(-1/32)c)/c)/c)))/c(-7) assuming c is positive. c(191/32) Simplify ((p*(-4)p)/p)/((p/(p/(p*(-4)/p)))/p)p/p*(-2)p(2/5) assuming p is positive. p(27/5) Simplify s8/(s/(s/s(2/15))) assuming s is positive. s(118/15) Simplify d2/(d/(d/d*(-2/9)))d/(dd/(d/(d(d/d*(2/9))/dd)d)dd)(ddd(-1/2))/d assuming d is positive. d(-1/18) Simplify (w(1/5)/(w(2/7)w))/(w0w/w6) assuming w is positive. w(137/35) Simplify (lll/(l/l*(-4)))/lll(2/3)l/l*(-1/6)l1/l assuming l is positive. l(-1/6) Simplify (((f(-4)/f)/f)(-25/2))(-42) assuming f is positive. f(-3150) Simplify (w*(1/3)w*7)/(ww(-3/5)/w)(-35) assuming w is positive. w(-41/3) Simplify ((v/v(2/9))/v)37 assuming v is positive. v(-74/9) Simplify q(1/6)/((q/q(-1))/q) assuming q is positive. q*(-5/6) Simplify (ll*(-1/15)ll)/(ll/(lll(2/33))) assuming l is positive. l(494/165) Simplify ((x/(x8/x))(-4))(-38) assuming x is positive. x(-912) Simplify ((aa/((a(-2/17)/a)/a))/a)/(aa/(a(a(-8)aa)/a))a5/(a/(a/(a/(a(-3)a)))) assuming a is positive. a(-49/17) Simplify (fff(2/11)ff)/(f(3/4)f) assuming f is positive. f*(107/44) Simplify (ff*(1/17)fff)/ff(5/8) assuming f is positive. f(501/136) Simplify (a2)0a*(-2/39)aa(3/2)a assuming a is positive. a(269/78) Simplify (((((m(-2/3)m)/m)/m)/m)/(((m(m3/m)/m)/m)/m))/(m/((m(-4)m)/m)m(m(-1)/m)/m) assuming m is positive. m(-17/3) Simplify m4m*(-1/18)m assuming m is positive. m(89/18) Simplify (t(-1/12)t)/(ttt(2/35))t*(2/7)t/(t/(tt(-10))) assuming t is positive. t(-4139/420) Simplify (x/x(17/4)x)/x(-2/41) assuming x is positive. x(-361/164) Simplify ((vv(-6))/v(2/13))/(v0)1 assuming v is positive. v(-67/13) Simplify v(7/5)/(vv/(v/(vv(-5/6)))) assuming v is positive. v(7/30) Simplify b(-5)/(b6/bb)(b(-1/2)/b)(3/4) assuming b is positive. b(-97/8) Simplify (k/(k(1/16)k))/(k6/k) assuming k is positive. k(-81/16) Simplify (xx(-1/5))/x4(x/((x(-1)/x)/x))8 assuming x is positive. x(144/5) Simplify (d8d(-5))/(d(-1/2)/d(-6)) assuming d is positive. d(-5/2) Simplify ((q/q(1/6))/(qq(q/(qqq4q))/q))(13/3) assuming q is positive. q(455/18) Simplify (s7/s)(2/19) assuming s is positive. s(12/19) Simplify (v(-4/3)v(-2/9))/(v(-2/13)/(v(-1)/vv)) assuming v is positive. v(-281/117) Simplify y(-28)/(y/(y*28y)y) assuming y is positive. 1/y Simplify p(2/7)p/(p*(-1/3)/p)p(-6)/(p/(p/p(3/8)p)p) assuming p is positive. p(-631/168) Simplify (k/k(-16))**0 assu	{ "pile_set_name": "DM Mathematics" }
of 11619 to the nearest integer? 108 What is the eighth root of 2990 to the nearest integer? 3 What is the square root of 3480 to the nearest integer? 59 What is 5089 to the power of 1/3, to the nearest integer? 17 What is 598 to the power of 1/2, to the nearest integer? 24 What is 65011 to the power of 1/3, to the nearest integer? 40 What is the cube root of 497 to the nearest integer? 8 What is 2753 to the power of 1/2, to the nearest integer? 52 What is the third root of 5406 to the nearest integer? 18 What is 556 to the power of 1/3, to the nearest integer? 8 What is 148020 to the power of 1/3, to the nearest integer? 53 What is the square root of 1065 to the nearest integer? 33 What is 17251 to the power of 1/4, to the nearest integer? 11 What is the square root of 30435 to the nearest integer? 174 What is the square root of 94680 to the nearest integer? 308 What is the tenth root of 123105 to the nearest integer? 3 What is 1182 to the power of 1/3, to the nearest integer? 11 What is 10959 to the power of 1/3, to the nearest integer? 22 What is the seventh root of 1047 to the nearest integer? 3 What is 7783 to the power of 1/4, to the nearest integer? 9 What is the third root of 50790 to the nearest integer? 37 What is 168 to the power of 1/2, to the nearest integer? 13 What is 64939 to the power of 1/2, to the nearest integer? 255 What is the cube root of 1931 to the nearest integer? 12 What is the sixth root of 1120 to the nearest integer? 3 What is 42432 to the power of 1/4, to the nearest integer? 14 What is the cube root of 706 to the nearest integer? 9 What is 921 to the power of 1/2, to the nearest integer? 30 What is 45835 to the power of 1/2, to the nearest integer? 214 What is 61648 to the power of 1/3, to the nearest integer? 40 What is the square root of 10844 to the nearest integer? 104 What is 10532 to the power of 1/2, to the nearest integer? 103 What is the sixth root of 4380 to the nearest integer? 4 What is 47 to the power of 1/10, to the nearest integer? 1 What is the cube root of 10886 to the nearest integer? 22 What is 9842 to the power of 1/3, to the nearest integer? 21 What is the square root of 29574 to the nearest integer? 172 What is the third root of 88859 to the nearest integer? 45 What is 5626 to the power of 1/8, to the nearest integer? 3 What is 3069 to the power of 1/2, to the nearest integer? 55 What is 10673 to the power of 1/2, to the nearest integer? 103 What is 22149 to the power of 1/10, to the nearest integer? 3 What is 3012 to the power of 1/7, to the nearest integer? 3 What is the tenth root of 429 to the nearest integer? 2 What is the fifth root of 1687 to the nearest integer? 4 What is 787 to the power of 1/3, to the nearest integer? 9 What is 4157 to the power of 1/9, to the nearest integer? 3 What is 2952 to the power of 1/3, to the nearest integer? 14 What is the third root of 511 to the nearest integer? 8 What is the third root of 4358 to the nearest integer? 16 What is 23557 to the power of 1/8, to the nearest integer? 4 What is the cube root of 20288 to the nearest integer? 27 What is the square root of 3239 to the nearest integer? 57 What is 1675 to the power of 1/7, to the nearest integer? 3 What is the square root of 4930 to the nearest integer? 70 What is the cube root of 4315 to the nearest integer? 16 What is 1420 to the power of 1/10, to the nearest integer? 2 What is the seventh root of 3125 to the nearest integer? 3 What is 3459 to the power of 1/8, to the nearest integer? 3 What is the square root of 6747 to the nearest integer? 82 What is the square root of 594 to the nearest integer? 24 What is 10756 to the power of 1/2, to the nearest integer? 104 What is 1522 to the power of 1/8, to the nearest integer? 2 What is the square root of 17915 to the nearest integer? 134 What is the cube root of 11510 to the nearest integer? 23 What is the fourth root of 40544 to the nearest integer? 14 What is 23580 to the power of 1/3, to the nearest integer? 29 What is 58 to the power of 1/3, to the nearest integer? 4 What is the cube root of 41627 to the nearest integer? 35 What is the square root of 103882 to the nearest integer? 322 What is 4650 to the power of 1/2, to the nearest integer? 68 What is the eighth root of 1328 to the nearest integer? 2 What is the square root of 93158 to the nearest integer? 305 What is the cube root of 169017 to the nearest integer? 55 What is 16651 to the power of 1/3, to the nearest integer? 26 What is the square root of 79920 to the nearest integer? 283 What is 328 to the power of 1/3, to the nearest integer? 7 What is the square root of 217 to the nearest integer? 15 What is the third root of 3935 to the nearest integer? 16 What is the cube root of 115062 to the nearest integer? 49 What is the square root of 1203 to the nearest integer? 35 What is the ninth root of 6975 to the nearest integer? 3 What is 1722 to the power of 1/2, to the nearest integer? 41 What is 1545 to the power of 1/2, to the nearest integer? 39 What is the cube root of 1150 to the nearest integer? 10 What is 49029 to the power of 1/8, to the nearest integer? 4 What is 52221 to the power of 1/2, to the nearest integer? 229 What is the square root of 14976 to the nearest integer? 122 What is 53465 to the power of 1/9, to the nearest integer? 3 What is 1923 to the power of 1/2, to the nearest integer? 44 What is the cube root of 1008 to the nearest integer? 10 What is the cube root of 7215 to the nearest integer? 19 What is 2310 to the power of 1/8, to the nearest integer? 3 What is 877 to the power of 1/6, to the nearest integer? 3 What is the cube root of 30133 to the nearest integer? 31 What is 9322 to the power of 1/2, to the nearest integer? 97 What is the cube root of 216 to the nearest integer? 6 What is the cube root of 50288 to the nearest integer? 37 What is 3940 to the power of 1/7, to the nearest integer? 3 What is the ninth root of 834 to the nearest integer? 2 What is the tenth root of 29950 to the nearest integer? 3 What is the cube root of 16323 to the nearest integer? 25 What is 1420 to the power of 1/2, to the nearest integer? 38 What is the ninth root of 94 to the nearest integer? 2 What is the square root of 62463 to the nearest integer? 250 What is the cube root of 23961 to the nearest integer? 29 What is the third root of 1317 to the nearest integer? 11 What is 3690 to the power of 1/2, to the nearest integer? 61 What is the sixth root of 743 to the nearest integer? 3 What is the ninth root of 6145 to the nearest integer? 3 What is 3917 to the power of 1/2, to the nearest integer? 63 What is 10 to the power of 1/2, to the nearest integer? 3 What is the fourth root of 1783 to the nearest integer? 6 What is 3100 to the power of 1/2, to the nearest integer? 56 What is 3693 to the power of 1/4, to the nearest integer? 8 What is 1435 to the power of 1/10, to the nearest integer? 2 What is 3744 to the power of 1/2, to the nearest integer? 61 What is 69366 to the power of 1/10, to the nearest integer? 3 What is 616 to the power of 1/7, to the nearest integer? 3 What is the square root of 12328 to the nearest integer? 111 What is the square root of 4684 to the nearest integer? 68 What is the square root of 710 to the nearest integer? 27 What is 662 to the power of 1/4, to the nearest integer? 5 What is the third root of 4626 to the nearest integer? 17 What is the tenth root of 133 to the nearest integer? 2 What is 18585 to the power of 1/2, to the nearest integer? 136 What is the third root of 1148 to the nearest integer? 10 What is the third root of 3103 to the nearest integer? 15 What is 578 to the power of 1/2, to the nearest integer? 24 What is the eighth root of 898 to the nearest integer? 2 What is 4993 to the power of 1/2, to the nearest integer? 71 What is 2267 to the power of 1/3, to the nearest integer? 13 What is 27522 to the power of 1/2, to the nearest integer? 166 What is the square root of 4157 to the nearest integer? 64 What is 4352 to the power of 1/2, to the nearest integer? 66 What is 568 to the power of 1/3, to the nearest integer? 8 What is the eighth root of 2010 to the nearest integer? 3 What is the fourth root of 64951 to the nearest integer? 16 W	{ "pile_set_name": "DM Mathematics" }
v(p) = 149p - 4032. Determine v(27). -9 Let c(m) = m2 - 35m - 163. Determine c(-6). 83 Let w(g) = g*2 - 34g - 92. Give w(-7). 195 Let d(h) = -2h2 - 1413h - 5637. Calculate d(-4). -17 Let v(m) = -2m3 - 93m*2 + 20m - 1263. Give v(-47). 6 Let f(w) = 19w - 22. Give f(0). -22 Let t(j) = -2j*2 - 42j - 208. Determine t(-9). 8 Let k(h) = -18h2 - 252h - 1. Determine k(-14). -1 Let z(t) = -22t2 + 100t + 521. Give z(-5). -529 Let n(p) = p*2 + 8p - 236. Determine n(-23). 109 Let g(q) = q*2 + 33q - 101. What is g(7)? 179 Let r(n) = 59n + 11389. What is r(-193)? 2 Let w(t) = -t2 - 16t + 286. What is w(-27)? -11 Let x(f) = 5f2 + 111f + 24. Calculate x(-22). 2 Let h(g) = -708g + 15489. Determine h(22). -87 Let i(l) = 1107l + 15485. What is i(-14)? -13 Let y(w) = 157w + 7666. Calculate y(-49). -27 Let v(y) = y3 + y2 + y + 39. What is v(-4)? -13 Let o(n) = -39n + 1140. Determine o(29). 9 Let v(j) = 3j3 + 9j*2 - 11j - 42. Calculate v(-4). -46 Let s(n) = 181n + 10306. Give s(-57). -11 Let y(q) = 4q*2 + 541q + 697. Give y(-134). 27 Let k(j) = j*2 + 13j + 33. Give k(-7). -9 Let x(s) = -195s + 487. What is x(3)? -98 Let x(h) = -h2 - 27h - 26. What is x(-24)? 46 Let w(m) = -m*2 - 9m + 81. Determine w(-15). -9 Let r(t) = -13t2 - 70t - 4. What is r(-5)? 21 Let f(m) = -m*2 + 544m + 2188. Determine f(-4). -4 Let u(v) = 890v - 139728. What is u(157)? 2 Let d(q) = q3 - 10q*2 + 24q - 53. Determine d(8). 11 Let k(v) = -2390v + 4779. Determine k(2). -1 Let i(o) = o3 - 6o*2 - 11o + 28. Calculate i(6). -38 Let f(k) = 15k2 - 15k - 627. Determine f(7). 3 Let b(s) = -35s2 - 170s + 43. Calculate b(-5). 18 Let y(k) = -k*2 - 25k + 1728. Calculate y(-56). -8 Let j(t) = -37t3 + 4t*2 - 6t + 4. Determine j(2). -288 Let g(o) = o*3 - 8o*2 + 21o - 5. Determine g(6). 49 Let b(d) = -d*3 - 75d*2 + 90d + 587. What is b(-76)? -477 Let p(r) = -3r2 - 38r + 73. What is p(-15)? -32 Let d(q) = 44q + 154. Calculate d(-4). -22 Let v(g) = -101g*2 - 653g - 291. Determine v(-6). -9 Let g(a) = 5a2 + 51a + 31. Determine g(-8). -57 Let q(v) = 53v - 7180. Determine q(135). -25 Let q(y) = y3 + 4y2 + y + 9. Determine q(-4). 5 Let k(z) = z2 + 89z - 11589. Determine k(72). 3 Let r(z) = -z2 + 34z - 61. Calculate r(29). 84 Let t(a) = 113a2 - 145a - 147. Give t(-1). 111 Let z(w) = -4w3 + 58w*2 + 100w - 82. Give z(16). -18 Let h(p) = -2p2 + 53p + 541. What is h(35)? -54 Let u(i) = 82i + 72. Determine u(-1). -10 Let g(r) = r2 + 40r + 189. What is g(-10)? -111 Let m(q) = -13q + 64. Determine m(4). 12 Let s(c) = -4c*3 - 16c. What is s(4)? -320 Let d(m) = -m*3 - 5m*2 + 10m - 13. Calculate d(-7). 15 Let y(k) = -133k2 + 8k + 9. Determine y(-1). -132 Let u(c) = 8c2 + 252c + 578. Give u(-29). -2 Let h(q) = q*3 - 18q*2 - 17q - 46. Give h(19). -8 Let v(m) = -4m + 36. Determine v(10). -4 Let i(o) = -36o*2 + 293o + 286. Calculate i(9). 7 Let t(u) = 204u + 800. Determine t(-4). -16 Let o(r) = 157r + 1722. What is o(-11)? -5 Let s(b) = 6b - 88. Determine s(7). -46 Let a(l) = -2l*3 + 23l*2 + 10l + 11. Give a(12). -13 Let y(d) = 59d + 939. Give y(-15). 54 Let t(h) = 6h*2 + 22h + 7. Determine t(-3). -5 Let c(a) = -6a2 + 192a + 41. Determine c(32). 41 Let c(y) = 399y + 1589. What is c(-4)? -7 Let x(l) = 28l - 209. Calculate x(6). -41 Let s(g) = 12g2 - 12g + 9. Determine s(1). 9 Let d(f) = -f*3 + 153f*2 + 955f - 150. Calculate d(159). 9 Let b(d) = -5292d - 47627. Determine b(-9). 1 Let h(u) = -8u*3 - 2u*2 + 3u - 2. Determine h(1). -9 Let h(f) = -f*3 + 3f*2 + 100f - 475. Calculate h(8). 5 Let z(n) = -7n - 101. Determine z(-17). 18 Let v(b) = -7b*2 + 41b + 49. Determine v(9). -149 Let c(m) = 3m3 - 3m*2 - 8m + 10. Determine c(-3). -74 Let s(r) = -r*3 + 19r*2 - 20r + 25. Calculate s(19). -355 Let q(a) = a*2 - 13a - 7. Give q(0). -7 Let p(t) = -t3 - t2 + 10t + 17. What is p(-5)? 67 Let z(b) = -18b*2 - 8b + 1. What is z(5)? -489 Let j(b) = 149b + 1575. Determine j(-11). -64 Let m(l) = 27l*3 + 8l*2 + l - 1. Calculate m(-1). -21 Let q(v) = 4261v + 4263. Give q(-1). 2 Let w(h) = -18h + 129. Give w(7). 3 Let b(s) = -25s*2 - 174s + 7. Give b(-7). 0 Let x(h) = 15h2 - 1863h + 374. Give x(124). 2 Let u(p) = -2p2 + 12p + 30. Give u(10). -50 Let a(y) = -5y3 + 40y*2 + 40y - 8. What is a(9)? -53 Let h(a) = a*2 + 57a + 816. Give h(-18). 114 Let g(q) = 1338q + 5362. What is g(-4)? 10 Let o(n) = 7102n - 28423. Determine o(4). -15 Let d(v) = v*3 - 48v*2 - 38v - 385. Determine d(49). 154 Let m(f) = f*3 - 17f*2 + 55f - 28. Give m(5). -53 Let p(g) = 20g - 181. What is p(10)? 19 Let l(i) = 221i - 236. Determine l(3). 427 Let h(l) = -18l2 - 53l + 96. Give h(2). -82 Let h(s) = -s*3 + 20s*2 - 59s + 132. Give h(17). -4 Let d(g) = -617g - 4324. Give d(-7). -5 Let o(a) = -a3 - 23a*2 - 41a - 38. Determine o(-21). -59 Let r(b) = -b*3 + 8b*2 + 64b + 2. Calculate r(13). -11 Let f(t) = 3t3 + 7t*2 - t - 12. Determine f(-2). -6 Let q(g) = -2g*2 - 176g - 2088. Give q(-74). -16 Let m(r) = -r*3 + 23r*2 - 95r + 362. Calculate m(19). 1 Let h(i) = 2i2 - 598i + 43997. Determine h(131). -19 Let c(z) = -z*2 - 37z - 338. Give c(-17). 2 Let q(r) = 257r + 5133. Calculate q(-20). -7 Let d(g) = 18g*2 + 702g + 23. What is d(-39)? 23 Let m(f) = 55f2 + 14f + 5. What is m(3)? 542 Let p(o) = 4o - 20. What is p(-21)? -104 Let i(n) = n3 - 95n*2 + 96n - 183. Give i(94). 5 Let u(m) = -4m2 - 14m - 12. Determine u(-10). -272 Let i(q) = 252q2 - 22683q + 260. Calculate i(90). -10 Let h(q) = -3q2 + 15q + 24. Determine h(15). -426 Let q(d) = -d*3 + 11d*2 - 47d + 24. Determine q(5). -61 Let h(g) = 8g2 + 83g + 506. Determine h(-6). 296 Let l(r) = -r*3 - 24r*2 - 43r + 90. Determine l(-22). 68 Let w(l) = -837l2 + 11l - 11. Determine w(1). -837 Let x(m) = -75m - 3908. Calculate x(-52). -8 Let l(j) = j3 - 36j*2 + 182j + 13. Determine l(30). 73 Let k(q) = -33q - 80. Give k(-4). 52 Let h(t) = 34t3 + t2 - 48t - 94. Give h(-2). -266 Let a(p) = p3 - 32p*2 + 60p - 42. Determine a(30). -42 Let t(v) = 925v + 1865. Give t(-2). 15 Let n(d) = d2 - 30d + 178. Determine n(23). 17 Let r(s) = 97s + 186. What is r(-1)? 89 Let p(l) = -2l*2 - 194l - 1611. Give p(-9). -27 Let g(b) = b*3 + 2b*2 - 29b - 18. What is g(5)? 12 Let y(d) = 683d + 7509. Determine y(-11). -4 Let y(p) = 24p + 550. Calculate y(-26). -74 Let c(y) = -54y + 1345. Calculate c(26). -59 Let z(q) = q3 + 36q*2 + 63q - 2086. Determine z(-32). -6 Let b(s) = s*2 - 59s - 4672. Calculate b(104). 8 Let v(f) = 2f2 + 115f + 268. Determine v(-58). 326 Let r(u) = 2u3 + 4u*2 + 16u + 2. Determine r(0). 2 Let g(z) = -z - 56. Give g(-13). -43 Let g(i) = -4i2 + 54i + 55. Determine g(-1). -3 Let o(i) = -534i - 7926. Give o(-15). 84 Let b(a) = -a3 + 182a*2 + 196a - 2378. Give b(183). 1 Let m(w) = -w*3 + 30w*2 - 118w - 65. Determine m(25). 110 Let z(b) = b*3 + 18b*2 + 33b - 37. What is z(-16)? -53 Let v(b) = 2b3 - 123b*2 + 66b - 321. Determine v(61). -16 Let g(h) = -2h3 - 3h*2 - 2h. Give g(3). -87 Let f(u) = 18u - 1244. Give f(73). 70 Let u(k) = 440k - 2993. Determine u(7). 87 Let u(a) = -160a + 1185. Calculate u(8). -95 Let c(a) = a2 + 4a - 65. Give c(16). 255 Let o(x) = x*3 + 17x*2 + 61x + 63. Give o(-10). 153 Let s(t) = t*3 - 69t*2 - 287t - 39. Calculate s(73). 326 Let h(i) = 2i2 - 66i - 753. What is h(42)? 3 Let n(y) = 2y3 + 126y*2 - y - 54. Determine n(-63). 9 Let w(g) = 2g*3 - 43g*2 - 67g + 43. What is w(23)? 89 Let q(m) = 13m2 - 7m - 49. Determine q(-8). 839 Let z(x) = -80x - 1647. What is z(-22)? 113 Let n(g) = 40g - 181. Calculate n(5). 19 Let o(g) = -g*2 - 49g + 1759. Determine o(-73). 7 Let v(u) = u*3 + 4u*2 - 9u - 24. What is v(-4)? 12 Let n(a) = 6991a + 13979. Calculate n(-2). -3 Let n(p) = -p3 - 17p*2 + 8p + 54. Determine n(-17). -82 Let g(z) = 6z2 + 27z + 17. Determine g(-4). 5 Let a(y) = 1081y - 82177. Determine a(76). -21 Let h(j) = -j3 + 2j*2 + 68j - 261. Calculate h(5). 4 Let h(f	{ "pile_set_name": "DM Mathematics" }
- 1919o4 - 290o wrt o. 10580o3 Find the third derivative of 2u*4 - 3u*3 + 2u*3 - 12u*4 - 39u*4 + 37u*2 wrt u. -1176u - 6 What is the derivative of -42 - 44 - 8r + 6r + 12 + 51r2 wrt r? 102r - 2 Let z = -27 - -29. What is the first derivative of -8 + 173cz - 366c*2 + 176c*2 wrt c? -34c Let i = 18 - 16. Find the third derivative of -3h4 + 12hi + h4 + 10h4 + 2h*4 wrt h. 240h Let z(m) be the second derivative of -3m5/2 - 71m*4/12 - 23m - 2. What is the third derivative of z(q) wrt q? -180 Suppose 0 = 2p - 13 - 23. Find the second derivative of pr*2 - 44 - 42 - r + 86 wrt r. 36 Find the first derivative of -4m + 2m - 62 - 308m*3 + 206m*3 wrt m. -306m*2 - 2 Suppose 20 = l - 4k - 0k, -l - 5k - 16 = 0. Suppose b - l = -2. Find the third derivative of -2r2 + 9r*6 - 7r*b + 0r*6 wrt r. 1080r3 Let d(f) = -5 - f4 - 2f4 - 39f + 48f. Let r(l) = -5l*4 + 13l - 8. Let s(k) = -8d(k) + 5r(k). What is the second derivative of s(n) wrt n? -12n2 What is the first derivative of 62b*4 - 175 + 95 - 23 wrt b? 248b*3 Suppose 0 = 5v + 20, -r - 6 = 4v + 3. What is the third derivative of -rz*5 - 11z - 4z2 + 11z wrt z? -420z2 Let w(h) = -145h + 127. Let m(q) = 438q - 383. Let b(f) = 3m(f) + 8w(f). Find the first derivative of b(a) wrt a. 154 Let t be (-15)/((-45)/6) - (-47 + -1). What is the derivative of -11 + t - 15s*3 + 9s*3 - 8s*3 wrt s? -42s*2 Let w = 107 - 84. What is the second derivative of 18n - 43n + 14n*3 + wn wrt n? 84n Let m(r) = r + 21. Let w be m(-9). Let u be -7 + (5 - 1) + w. What is the second derivative of -15y*4 + 7y*4 - 3y - 4y + uy*4 wrt y? 12y*2 Suppose z + 4z - 5 = 0. Let y = 3 - z. What is the third derivative of 0c3 + 4c*3 + yc*2 + 0c*3 wrt c? 24 Let q(m) be the second derivative of -13m8/28 + m4/4 - m - 2. What is the third derivative of q(r) wrt r? -3120r3 Find the first derivative of f3 + 26 - 20f*3 + 6 + 22 wrt f. -57f*2 Let z(w) be the second derivative of 11/6w*3 - 3/2w*5 + 0 + 0w*4 + 0w*2 - 16w. Find the second derivative of z(q) wrt q. -180q Find the first derivative of -262 - 206s*3 - 112 + 116s*3 + 7 - 3s*2 + 20 wrt s. -270s*2 - 6s Let c = -16 - -14. Let j be c + (17/1 - 0). What is the third derivative of 3s2 - 28s*6 + js*6 + 14s*6 wrt s? 120s*3 Suppose -13h + 9h + 8 = 0. What is the second derivative of 8y - 53 + 18yh + 53 wrt y? 36 Suppose -10u = -9u - 3. Suppose u = 4c - 5. What is the third derivative of -12zc + 2z*2 + 172z*5 - 161z*5 wrt z? 660z*2 Let n(h) be the first derivative of 16h + 19/5h5 + 0h*3 + 0h*2 + 0h*4 + 2. Differentiate n(v) wrt v. 76v*3 Let r = 11 + -8. Find the second derivative of -2y - 9y3 - 3y*3 + 0y*r wrt y. -72y Suppose -16 = -3u - u + 4p, 0 = 2u + 3p - 28. What is the derivative of -36b2 + 6 - 19 - u - 11 wrt b? -72b Let l = -2 + -6. Let w be -4(-1)/(l/(-6)). What is the derivative of 7b*2 + 2 - wb*2 + 3 wrt b? 8b Let p be -4 - (4 + -7 + -22). Let v be (-2 - 0)(-2 + 1). What is the derivative of 21j - 6 + 2jv - pj wrt j? 4j Find the third derivative of -16d*6 + 999d - 3d4 - 997d + 6d2 + 20d*2 - 4d*3 + 3d*4 wrt d. -1920d*3 - 24 Suppose q = 5h - 2q - 337, 4 = 4q. What is the second derivative of -h + 68 - 10o3 + o wrt o? -60o Let x = 5/22 + 14/11. Let n(b) be the first derivative of xb2 + 6 - 2b*3 + 0b. What is the second derivative of n(l) wrt l? -12 Let v(q) = -q*3. Let g(x) = 6x*3 - 26x - 19. Let h(z) = g(z) - 6v(z). Let o(s) be the first derivative of h(s). Find the first derivative of o(y) wrt y. 72y Find the third derivative of -45y2 + 10y*3 - 56y*2 - 39y*2 + 5y*3 + 6y2 wrt y. 90 Let o(r) be the third derivative of r7/35 - r*6/30 - 26r*3/3 - 4r*2 + 3r. Find the first derivative of o(u) wrt u. 24u3 - 12u*2 Let u(h) = h. Let r be u(1). Let f(t) = 2t + r - 2 + t + 2. Let v(y) = 1. Let o(a) = -f(a) - 3v(a). Find the first derivative of o(c) wrt c. -3 Let m = 797/2 + -394. Let p(j) be the first derivative of -5 - j + mj*2. Find the first derivative of p(o) wrt o. 9 Let q(v) = -71v*4 - 2v*3 + 2v + 53. Let f(s) = s4 + s3 - s + 1. Let n(p) = 2f(p) + q(p). Differentiate n(c) wrt c. -276c3 Let w = 218 + -202. Let l(c) = -c2 - 7c + 6. Let d be l(-7). Differentiate -w + 8 + d + 9q*3 with respect to q. 27q*2 Let x(a) be the first derivative of 18a3 - a2 + 2a + 158. What is the second derivative of x(r) wrt r? 108 Let o(h) = -h2 + 3. Let q(s) = -93s*4 - 5s*2 + 37s + 15. Let y(w) = 5o(w) - q(w). Find the second derivative of y(l) wrt l. 1116l*2 Let v(q) be the second derivative of 15q + 11/6q4 + 0q*3 + 0 + 1/2q*2. Differentiate v(n) wrt n. 44n Let o(l) be the first derivative of -35l4/4 - 125l - 167. Differentiate o(t) wrt t. -105t2 Suppose -c = -3q - 12, 5c - q - 1 - 3 = 0. Let j(g) be the second derivative of -5/12g*4 - 2g*2 + cg*3 + 2g + 0. Differentiate j(i) with respect to i. -10i Let q = 74 + -69. Let m(z) = 78z*2 + 5z + 27. Let j(i) = 39i2 + 3i + 13. Let s(c) = qj(c) - 3m(c). Differentiate s(a) with respect to a. -78a Let k(i) be the first derivative of -289i*3/3 - 337i + 164. What is the first derivative of k(v) wrt v? -578v What is the third derivative of 247w*2 + 282w*5 - 116w*5 - 16w*2 wrt w? 9960w*2 Differentiate 301f*3 - 1863f*2 + 3727f*2 + 162f*3 - 1862f*2 - 293 - 325 wrt f. 1389f*2 + 4f Let w(f) = -2f3 - 4f*2 + 2f - 6. Let a(l) = -2l3 - 5l*2 + 4l - 7. Let t(n) = -2a(n) + 3w(n). Find the second derivative of t(c) wrt c. -12c - 4 Let z(i) be the second derivative of 0i*2 + 3i + 0 - 1/4i5 + 5/6i*3 + 0i*4. Find the second derivative of z(u) wrt u. -30u Let j(z) = -3z + 1. Let x(s) = 901s - 146. Let p(c) = 4j(c) + x(c). Differentiate p(a) wrt a. 889 Find the third derivative of -49y*2 + 49y*4 - 24y*2 - 64y*4 - 3y*3 + 4y*3 wrt y. -360y + 6 What is the first derivative of 0u2 - 9u - 1540 + 1044 + 11u3 + 0u*2 wrt u? 33u*2 - 9 Find the first derivative of 39l*3 - 39l*3 + 12 - 184l*4 wrt l. -736l*3 Suppose -2k = q - 9, 3q - 3k = 2q + 9. What is the derivative of 1 - 2 + 5 + q + 11d*4 wrt d? 44d*3 Suppose 5t + 5 = 20. Let z(m) be the first derivative of -3m2 + 2m2 - mt - 1 + 4 + 0. What is the second derivative of z(n) wrt n? -6 Let q be 23/1 + (-36)/12. Let r = 23 - q. What is the derivative of -3 + r - 6g2 - 4 wrt g? -12g Suppose 23v - 8 = 19v. What is the second derivative of 11o2 - 26o + 16ov + 2o*2 wrt o? 58 What is the second derivative of s - 486s*5 - 184 + 69 - 5s + 6s + 30s*5 wrt s? -9120s*3 Let y(u) be the third derivative of -107u*5/30 - 7u*4/2 + 98u2. Find the second derivative of y(w) wrt w. -428 What is the third derivative of i2 + 106i5 - 25 + 12 + 129 + 25i*5 - 24 wrt i? 7860i*2 Let d = -11 - -3. Let t = 10 + d. Find the second derivative of -6pt - p2 + 3p2 + 3p + p*2 wrt p. -6 Let g = 15 + -7. Find the third derivative of -7i + i + gi3 - i2 + 6i wrt i. 48 Let k(j) = 3j3 + 14j*2 + 7j - 1. Let g(t) = -6t3 - 29t*2 - 14t + 2. Let v(f) = 4g(f) + 9k(f). What is the second derivative of v(a) wrt a? 18a + 20 Let b(q) be the third derivative of q8/1440 - q6/120 - 2q*5/15 + 14q*2. Let s(r) be the third derivative of b(r). Differentiate s(v) wrt v. 28v Let m be ((-4)/6)/((-10)/(-45)) + 98. Find the second derivative of 93v4 - 184v*4 + mv*4 - 26v wrt v. 48v2 Suppose p - 5 + 3 = 0. What is the second derivative of 15z*2 + 9z - 14zp - 17z*2 wrt z? -32 Suppose 0 = -2y - 40 + 44. Find the second derivative of -a + 8a - 3a*y + 8a - 5a wrt a. -6 Let t(o) = 9o - 4. Let d be (8/16)/(2/4). Let y(j) = -1. Let k(m) = dt(m) - 5y(m). Find the first derivative of k(v) wrt v. 9 What is the second derivative of 3279b2 + 11b - 1703b2 - 1709b*2 wrt b? -266 Let a(u) = -22u*3 + 6u*2 + 107u + 5. Let b(s) = 2s3 - s2 - 2s - 1. Let n(p) = 2a(p) + 10b(p). What is the second derivative of n(o) wrt o? -144*o + 4 Fi	{ "pile_set_name": "DM Mathematics" }
2 + 31h. -4979h*2 + 25h + 2 Collect the terms in -2g + 1271g*3 - 2763g*3 + g + 1490g*3. -2g*3 - g Collect the terms in 1928187f*2 - 302804f*2 + 145780f*2. 1771163f*2 Collect the terms in 66211824q - 33105968q - 33105915q. -59q Collect the terms in 77366m*2 - 4m*3 - 77366m*2 - 123m*3. -127m*3 Collect the terms in 1225 - 2c + 41c - 2466 + 1240. 39c - 1 Collect the terms in -5 + 6 + 993h - 29 + 37 - 1016h - 9. -23h Collect the terms in 1839502x*2 + 1838996x*2 - 3679010x*2. -512x*2 Collect the terms in 765d*3 - 4236d*3 + 3515d*3. 44d*3 Collect the terms in -19o2 + o2 - 12081o - 11989o + 24070o. -18o*2 Collect the terms in -20897b - 947b - 19671b + 1785b. -39730b Collect the terms in -38084n + 103833n + 126135n. 191884n Collect the terms in -1 - 6 - 11 + 3n2 + 3n*2 - 101 + 119. 6n*2 Collect the terms in -3522g - 1076g + 455g. -4143g Collect the terms in -163482j + 97 - 97. -163482j Collect the terms in -1430t + 32t2 - 1147t - 1161t + 3738t. 32t2 Collect the terms in -184 - 156 - 9d - 179 + 4d + 509. -5d - 10 Collect the terms in 21307 - 7417 + 11104 + 9848 - 3329 + 2h. 2h + 31513 Collect the terms in 1639x - 6550x + 6 + 1634x + 1642x - x*2 + 1635x. -x*2 + 6 Collect the terms in u - 9 + 3 - 13 + 5 - 1 - 1. u - 16 Collect the terms in -3u*2 - 3 + 1066237227u + 3 - 1066237209u. -3u*2 + 18u Collect the terms in 521g2 + 610g*2 - 255g*2 + 346g*2. 1222g*2 Collect the terms in 4780 + o - o - 9576 + 4796 - 817o*2. -817o*2 Collect the terms in -337 + 1104 + 57p + 519p - 388 - 379. 576p Collect the terms in -33318 - 155v + 125v + 33318. -30v Collect the terms in 0y - 6y + y + 17y - y + 19y + 0y - 2. 30y - 2 Collect the terms in 137823x - 57859x - 80016x. -52x Collect the terms in -1967k*2 + k + 9k*3 - k + 1823k*2. 9k*3 - 144k*2 Collect the terms in 2 + 263l*2 - 40967l + 40970l - 255l*2. 8l*2 + 3l + 2 Collect the terms in -22691v - 21843v + 2981 + v2 - 2981. v2 - 44534v Collect the terms in -46r*2 + 18183r*3 - 100r*2 - 18182r3. r3 - 146r2 Collect the terms in -959p + 80p - 572p + p. -1450p Collect the terms in -2j*2 - 39j - 9j2 - 3j + 154j - 2j*2. -13j*2 + 112j Collect the terms in -24f2 + 75f*2 - 19f*2 - 13039f*3 + 26113f*3 - 13075f3. -f3 + 32f2 Collect the terms in -3748235s + 3748235s - 15s*2 - 225s*2 - 13s*2. -253s*2 Collect the terms in 991496i*2 + 4i - 4i - 990529i*2. 967i*2 Collect the terms in 69i - 240i + 149i. -22i Collect the terms in -9 + 17478u - 4 - 6 + 19. 17478u Collect the terms in -24l*2 + 195l - 198l - 27l*2 + 215l*2 - 156l*2. 8l*2 - 3l Collect the terms in -99431 + 92o - 416o + 109o + 128o + 99431 + 123o. 36o Collect the terms in -4 + 589g - 4g*3 + 1041g - 351g + 879g. -4g3 + 2158g - 4 Collect the terms in 36 - 428291l - 36. -428291l Collect the terms in -1736u3 + 46 - 3229u*3 + 1044u*3 - 2395u*3 - 2080u*3. -8396u*3 + 46 Collect the terms in 12z - 76 - 69 - 105 + 250. 12z Collect the terms in 136420x*2 + 11 - 11. 136420x*2 Collect the terms in -45 + 96y*2 - 49 - 79 - 50 + 223. 96y*2 Collect the terms in 28533f + 69678f - 12019f + 48298f. 134490f Collect the terms in -2u3 + 0u*2 - 73729631u + 0u2 + 73729631u. -2u3 Collect the terms in -174 + 36h*3 + 26 + 134. 36h*3 - 14 Collect the terms in 173 - 36 + 129 - 2i + 27. -2i + 293 Collect the terms in -4148y*3 + 3004y*3 - 27118y*3 + 1549y*3. -26713y*3 Collect the terms in -14a + 7a + 8a - 45751 + 45751 - a - 3a2. -3a*2 Collect the terms in 611i - 191i - 208i - 88i3 - 212i + 89i3. i3 Collect the terms in 8a + 173493a3 + 214270a*3 - 8a. 387763a3 Collect the terms in -2n*2 - 21276 - 40383n - 21286 + 20186n + 20197n + 42562. -2n2 Collect the terms in 2298p*2 - 40p*3 + 2287p*2 + 2297p*2 - 57p*3 - 6882p*2. -97p*3 Collect the terms in -181p*2 - 1996p + 3993p - 8p*2 - 2002p. -189p2 - 5p Collect the terms in 28 + 218g + 4 - 873g + 219g + 222g + 220g. 6g + 32 Collect the terms in 19z + 470 + 10z - 473 - 5z. 24z - 3 Collect the terms in 7 - 13 - 3 - 28w3 + 2 + 7. -28w*3 Collect the terms in -42o*2 - 5o*2 + 19o*2 + 147o*2 - 18o*2. 101o*2 Collect the terms in 5325 - 6400p - 5325. -6400p Collect the terms in 21 + 0s - 545400s2 + 545402s*2 + 0s. 2s2 + 21 Collect the terms in -25065 + 74637 - 24766 + 6z - 24806. 6z Collect the terms in 27756c*2 + 27789c*2 - 55398c*2. 147c*2 Collect the terms in -1 + 79l - 482l + 0 - 10. -403l - 11 Collect the terms in -144 - 11a - 43a + 41 + 56 + 43. -54a - 4 Collect the terms in -3266c + 7 - 13 + 805c + 5 + 220c - 3535c. -5776c - 1 Collect the terms in 1 - 5 + 286416762n + 4 - 286416762n - n3. -n3 Collect the terms in 127 + 81o - 115 + 279 + 9o. 90o + 291 Collect the terms in -16q + 6q + 11q + 1 - q - 10852q3. -10852q*3 + 1 Collect the terms in 3 + 67458x - 4 - 191130x - 110094x. -233766x - 1 Collect the terms in -56m*3 + 51m*3 - 9m + 13m + 60m - 14. -5m3 + 64m - 14 Collect the terms in 39l + 4l*3 + 25l - 93l + 30l. 4l3 + l Collect the terms in -103117n + 412465n - 103116n - 103112n - 103122n. -2n Collect the terms in -o + 62 + 51 - 138 + 90 + 50 - o. -2o + 115 Collect the terms in 225b3 + 292 + 228b*3 - 451b*3. 2b*3 + 292 Collect the terms in 2261 - 4695 + 3n*2 + 2324 - 2n2. n2 - 110 Collect the terms in -111g + 3g - 66g - 40 - 6g + 40. -180g Collect the terms in -15o*3 - 6o*3 - 12o*3 - 35o*3 + 38o*3. -30o*3 Collect the terms in -3p + 118p3 + 3p + 427p3 - 550p*3. -5p*3 Collect the terms in -1367f*2 - 206 - 48 - 212 + 465. -1367f*2 - 1 Collect the terms in 36y + 7y3 + 64y*3 - 79y*3 - 36y + 5y3. -3y*3 Collect the terms in -205n - 82 + 172 - 87. -205n + 3 Collect the terms in 2649j*2 + 11j + 18644j2 - 11j. 21293j2 Collect the terms in 12 - 551546d - 135314d - 15. -686860d - 3 Collect the terms in -1144 - 1405 - 1160 - v + 4139. -v + 430 Collect the terms in -27 + 15z - 66z - 21 + 49. -51z + 1 Collect the terms in -5695539n*2 - 1 + 1. -5695539n*2 Collect the terms in -1050z*3 - 1963z - 1693z + 3656z. -1050z3 Collect the terms in -5y - 19y + 2y + 4y2 + 24y - 6y. 4y*2 - 4y Collect the terms in -2p2 + 5p*2 + 2p*2 + 8080 - 24242 + 8075 + 8087. 5p*2 Collect the terms in -4 + 5 - 152869i*3 + 151901i*3 - 1. -968i*3 Collect the terms in 8s*2 - 52880s + 26439s + 3 + 26441s. 8s2 + 3 Collect the terms in 67148u - 20972u - 23073u - 23090u. 13u Collect the terms in 32 - 788g3 - 94 - 14g*2 + 62. -788g*3 - 14g*2 Collect the terms in 323 - 254n - 245n + 508n. 9n + 323 Collect the terms in 1613 - 301y*3 + 307y*3 - 1614. 6y*3 - 1 Collect the terms in 33693w*3 + 33519w*3 - 67228w*3. -16w*3 Collect the terms in -4b*3 + 2b*3 + 397b - 9610b + 9213b. -2b3 Collect the terms in -294c*2 - 706718 + 1413442 - 706724. -294c*2 Collect the terms in 177354v - 354701v + 177347v - 52v3 - 36v*3. -88v*3 Collect the terms in -18200z*2 + 8492z*2 - 9153z*2 - 19115z*2 + 3235z*2. -34741z*2 Collect the terms in -1 - 1 + 119924004s + 119923978s + 2 - 239847981s. s Collect the terms in 7874c - 15099c - 12639c. -19864c Collect the terms in 4425b + 9568b + 13628b. 27621b Collect the terms in 15h + 47 + 4139h*2 - 15h - 47. 4139h2 Collect the terms in -28 - 229s*3 + 36 - 206s*3 + 101s. -435s3 + 101s + 8 Collect the terms in 125702u + 128618u - 254137u. 183u Collect the terms in -24l3 - 549 + 56l*2 + 284 + 262. -24l*3 + 56l*2 - 3 Collect the terms in -1458j - 187457 + 187457 - 2539j. -3997j Collect the terms in 25 + 29 - 8531o + 8533o. 2o + 54 Collect the terms in -550 - 29p + 85 + 77 + 82 + 306. -29p Collect the terms in 1589935 - 865r - 606r - 1589937. -1471r - 2 Collect the terms in -46 + 126r + 104r + 130r + 5 - 415r. -55r - 41 Collect the terms in -5270p*2 + 129801p**2 +	{ "pile_set_name": "DM Mathematics" }
ate -15 - 7 - -15 - (-1)/(4/27). -1/4 What is the value of (-9102)/(-205) + (-1118)/26? 7/5 Evaluate -22 - (-54)/(-45 + 39). -31 What is the value of 165/(-22)(-13)/(104/16)? 15 Evaluate 8/14 - (-57)/(17556/2288). 8 ((-512)/(-12))/(-4) - -7 -11/3 What is 2 + -5 + 135 + -140? -8 Evaluate ((-3)/258)/(-6 + 4/4878). -1/43 Evaluate 14 - 9 - (-1 - -4) - -6. 8 5/(-20) - ((-7595)/(-372) + (-4)/6) -20 What is 3/(-2) - 184/36(-72)/(-32)? -13 1((-1)/(7/((-1148)/(-20))) + 8) -1/5 What is the value of 81/(-15) + (34 - 31 - -3)? 3/5 What is (-33559)/16326 + (8/(-6))/(2/(-3))? -1/18 What is 2/(-4)(-240)/8 + -5? 10 -1 - 20/(-4)18/(-15) -7 What is 144/2160 - (-1)/10? 1/6 What is the value of 190 - 214 - (-3 + -2)? -19 7/((-252)/16) - (242/(-99) - -4) -2 What is 4 + 8 + -2 + 154/11 + -10? 14 385/22(-28)/(-49) 10 What is the value of 198/(-18) - 536/(-48)? 1/6 What is 21/(-77) - ((-5)/(-4) + (-64487)/38940)? 2/15 (-12 + 700/56)(-4)/6 -1/3 What is ((-2575)/125 + 21)(-10)/(-13)? 4/13 Evaluate ((-16)/600)/((-1)/(-3)). -2/25 Evaluate (116/20 - 6)/(5 - 4). -1/5 -89(-35)/(-245) + (-2)/7 -13 Evaluate (-40)/(-3) + (179075/285)/(-145). 9 Evaluate -2((-598)/(-26))/(-575). 2/25 Evaluate 4 + -7 - (-19)/19. -2 Evaluate (-36)/(-42) + 20541/(-861). -23 133/285 - (-7)/(-147)7 2/15 Calculate -4 + (-1)/(9 + 490/(-55)). -15 What is ((-650)/(-165) + -4)3 - (-86)/(-11)? -8 What is (-112)/(-8(-19 - -20))? 14 What is the value of (-55)/(5115/(-62))(-2 - (0 - -1))? -2 Evaluate (11 + (-442)/39)145. -15 What is (-14)/(-16) + -1 - 16891/(-78232)? 1/11 Evaluate 10/(-125) - (-16390)/(-1375). -12 Calculate (-12 + -22)(-6)/(-12). -17 Calculate (-52)/(-6) - (-12 - (-261)/27). 11 (322/770 - 12/(-66))/((-2)/(-50)) 15 What is the value of (-18 - 3984/(-216))/(4/(-18))? -2 What is (-1 + -1)9(0 + (-26)/52)? 9 What is ((84/(-2030))/(-3)-5)/(-2 + 4)? -1/29 (494/9633)/(2/(-6)) -2/13 What is the value of (-26)/2(270/1989)/(-15)? 2/17 What is the value of 42 + -24 + 0 + -2? 16 What is the value of ((-613)/9195)/((-2)/(-6))? -1/5 Evaluate ((-7)/5 - -1) + (-29134)/(-10405). 12/5 What is the value of 210 + -189 - 7/(2/2)? 14 Evaluate ((660/(-24))/(-55))/((-1)/(-26)). 13 What is the value of 270/(-432) + ((-135)/(-20))/9? 1/8 Evaluate 2/12 - (-191)/(-8022). 1/7 What is (312/3146)/((-6)/(-33))? 6/11 Evaluate (-1120)/80 + 226/16. 1/8 Evaluate 108/(-198) + 1239/154 + -6. 3/2 What is 13 + -13 + 5 + 8? 13 Calculate 2/7 - 497/196. -9/4 Calculate 4/(-6)(539/22 + -5). -13 What is the value of (-8 + (-992)/(-120))/(6/(-5))? -2/9 What is 1/(-5) + (-41)/(-55)? 6/11 Evaluate (-30090)/(-11033) + (-439)/165. 1/15 What is (12/(-84)7)/((200/48)/25)? -6 What is the value of 2((-989)/(-46) + -23)? -3 What is the value of (-68)/(-4) + 8/(-6)15/10? 15 What is 19/4(-540 + 536)? -19 Calculate 5202/756 + (-2)/12 + -7. -2/7 ((-2 - 0) + 0)(-366 - -364) 4 (3 + (-10)/253)5 9 (342/10)/(-3) - (104/40 - 2) -12 What is 2/522(366 - 365)? 1/13 (5984/(-143) - -42)(-1)/4 -1/26 Evaluate 3588/1248 - (-1 + (-14)/(-16)). 3 Calculate 1 + 2 + -22 + 12 + -8. -15 (-450)/(-180) + 15/(-3) + 9 13/2 What is ((-12)/22)/((-189)/(-1386))? -4 Calculate (-80)/260(-4)/(-24). -2/39 Calculate 91 + (326/(-40) - 502/2008). 3/5 What is the value of (-200)/6416/2 + 14? -11 Evaluate 360/(-825) - (854/70 - 13). 4/11 What is the value of ((-40)/(-48))/(6/(24/5))? 2/3 What is (-7004)/578 - (-7)/((-238)/(-4))? -12 What is the value of 130/(-72) + (-2350)/(-1880)? -5/9 Calculate (-2)/(22 - 420/18)136/(-6). -34 29 + -38 - -7 - ((-10)/(-7) - 3) -3/7 Evaluate (8/130)/(38/(-95)). -2/13 What is 17 - ((-4)/(-6))/((-21)/((-1890)/12))? 12 Evaluate -17 + (32 - -10) + -27. -2 Evaluate (-82615)/1365 + 60 - (1 - (-13)/(-7)). 1/3 What is 1 + 41 - (-4 + 44)? 2 Evaluate ((-37)/259)/(4/24). -6/7 What is the value of 42/119-17 + 1 + 13? 8 (-120)/(-46)73/1095 4/23 Evaluate ((-75)/250)/((-42)/60). 3/7 Calculate 110/352-1010/25. -5/4 What is (-6 - -8)/((-140)/77 - -6 - 4)? 11 Evaluate 1017/(-3955)2/(-12)5. 3/14 What is (-4872)/(-288) + 5/60? 17 What is 3 + -14 + (-4900)/(-441)? 1/9 What is the value of (3 + (-37)/12)88/44? -1/6 What is (-3874)/(-130) - (-3 + (-126)/(-45))? 30 What is the value of (-21)/((231/22)/(9/(-6)))? 3 What is 1 + (-102)/112 - (8708/224 + -39)? 3/14 Evaluate 20/3624/20 + (-29)/3. -9 What is the value of 12/30 - (-1081)/(-1840)? -3/16 Calculate 10 - 1 - ((-48)/(-8))/2. 6 What is the value of 15/(-5) - -3 - (-28)/(-4)? -7 What is the value of (238/1309)/(21/77)? 2/3 Calculate (2 - -13)-3(4 - 205/45). 25 What is the value of (-406)/42 + 15 - 3? 7/3 ((-75)/300)/(1/52) -13 Evaluate 35/(-14)(19 - (-770)/(-50)). -9 (1/111)/(267/1602) 2/37 (8 + -188)/(-9) - (-5 - -13) 12 Evaluate 2/(-7 - 47/(-8) - 14/(-112)). -2 What is the value of ((-26)/(-15) - 80/60)2/4? 1/5 (-720)/(-270) - (6/9)/1 2 (38 + -40)70/(-6)(-6)/(-7) 20 Calculate -74 + 109 - (-1 + 17). 19 Evaluate (-3)/106(-1404)/1053. 2/53 Calculate 8 + (-2183)/74 - -22. 1/2 What is 20 - (28 + (-4 - -23))? -27 Calculate 3615/(-1687)210/(-18). 25 What is the value of ((-2)/16)/(134/(-3216))? 3 What is the value of 686/30 + (-6 - (-17 + 5))/45? 23 What is (51/(-238)-406)/3? 29 What is the value of -48(-12)/1056 + 10/(-99)? 4/9 Calculate ((-22)/220)/((-21)/30). 1/7 What is ((-1)/(-7))/(((-2)/(-7))/(120/(-900)))? -1/15 What is -13 + (189/(-12))/((-65)/52)? -2/5 Calculate ((-452)/132 + 7)(-9)/6 + 5. -4/11 Calculate 29 + (99/(-18) - 14). 19/2 What is (-186)/1581 - (32/17 - (-4 + 5))? -1 What is the value of 2106/702052/(-3)? -26/5 What is the value of 85(-6)/210 - 4/7? -3 Evaluate ((464/(-87))/(-16))/(((-11)/90)/11). -30 What is 9 - (14 - -10) - -26? 11 (45/12)/(315/70)12/(-15) -2/3 Evaluate (-47)/52 - ((-10)/4 - 539/(-308)). -2/13 Evaluate (-10)/22 + (336/154)/24. -4/11 What is 4/16 + (6 - 9072/1472)? 2/23 What is the value of (0 - 24)(10612/(-756) - -14)? 8/9 (7/(-8))/(-25 + 5391/216) 21 Calculate (-3 - 25 - -15) + 11. -2 (-65)/21 + (-20)/(-210) -3 Evaluate (-700)/(-5082)33 - (1 - (-3 - 0)). 6/11 What is the value of (-157 + 166 - (-858)/(-68)) + (-4)/(-34)? -7/2 Calculate (2/13)/(17/663). 6 406/21 - 18 - 2/(-3) 2 2 + (-1500)/80 + 19 9/4 Evaluate (177/(-118))/(((-3)/10)/((-48)/220)). -12/11 What is (-4 + 2 + (-4)/(-6))(-3)/(-62)? -2/31 (55 - (-19656)/(-392))/(-36/(-63)) 17 What is (0 + (-3)/5)(38 - (23 - 10))? -15 What is the value of ((-9)/14)/(1007/(-42294))? 27 What is the value of -32/(-8) - (-8)/((-3360)/335)? -1/21 Calculate (-6 - 0) + (-23)/(2024/(-462)). -3/4 What is the value of (-1)/(-10)(-40)/40? -1/10 (-61 - -66)((-1)/(-2))/(5/(-2)) -1 What is -25 + 21 + (-48 + 8)/5? -12 -12 + (0(-10)/(-100))/(2/(-1)) -12 Evaluate (-400)/14 + (-567 - -599). 24/7 (0 - -2)(5/4)/((-11)/(-22)) 5 What is the value of (-4)/10 + 8/(-30) - 40/(-168)? -3/7 Evaluate 18/(13/(-4) - ((17 - 10) + -11)). 24 Evaluate 5 - (-13)/(52/(-64)). -11 Evaluate (-8 - 109)/(-13)1/(-3). -3 What is the value of (-4 - -2)(-12)/(-84)? -2/7 Evaluate (-11)/(88/56) - (-4)/((-84)/(-133)). -2/3 Evaluate ((-75)/30)/(2/4). -5 What is -42(-3)/6(-8)/24? -7 (50/6525)/((-24)/216) -2/29 What is (-8)/44 + ((-415)/77 - -6)? 3/7 (-8 + 7)/(513/(-1235)) 19 Calculate 16/448 - (-1335)/(-2100). -3/5 ((-2130)/(-284))/((-6)/(-4)) 5 (-3)/(-60)-2 - (-16)/32 2/5 What is the value of (42(-2)/(-4) - 0) + -444 + 447? 24 Calculate (-5)/(-26)(-45)/6(-60)/375. 3/13 Calculate 6/(-3) + ((-4)/(-24) - 185/30). -8 What is the value of 33/(-22)(-4)/12 - (-312)/(-688)? 2/43 What is the value of 3/(-24) - (71/8 + -1)? -8 What is the value of (3/90)/((-13)/(-156))? 2/5 What is (-169)/27 + 11651/(-1647) + 7? -19/3 Calculate ((-540)/(-25))/(1464/1220). 18 Evaluate 28/10 - 4263/3045. 7/5 What is the value of 3069/63 - 22 - 26? 5/7 (-4 - -1)((-2)/(-15))/((-16)/(-80)) -2 What is the value of (3/9 - 1885/(-285)) + -7? -1/19 What is the value of (-4)/(-3)(-108)/(-1224)? 2/17 Calculate (12 + -6 - -4) + (3 + -3 - 6). 4 (-1331)/55 + 38 + -14 -1/5 Calculate (-12)/(-14) - 7176/483. -14 2/(-8) - (((-329)/(-28))/1 + -11) -1 Evaluate (-187 - -186) + 23. 5 What is ((-15)/2)/(-10 + (-340)/(-40))? 5 (1/2)/(6/(-51)) + (-24)/(-96) -4 (7 - 3 - 4 - -19) + -1 18 What is 1183/4394(-1)/(14/(-4))? 1/13 13/(-39)(-36)/84 1/7 Calculate 2 - -1 - (6	{ "pile_set_name": "DM Mathematics" }
65 - 5431517. Let v = -2132953.2999946 - l. Let f = -1.3 - v. Round f to 6 dps. -0.000005 Let y = -10253 + 10278.165. What is y rounded to one dp? 25.2 Let m = 193150 + -193302.027. Let v = -0.027 - m. Let i = v - 152.0000186. What is i rounded to six dps? -0.000019 Let g = -6274 - -6274.1392. What is g rounded to one dp? 0.1 Let a(v) = -75682v3 + 165v*2 + 5v - 12. Let h be a(4). What is h rounded to the nearest one hundred thousand? -4800000 Let i = 8257.2 - 8257.2056147. What is i rounded to three dps? -0.006 Let w(u) = 1321u2 - 12u - 245. Let x be w(17). What is x rounded to the nearest ten thousand? 380000 Let l(v) = 28964v + 936. Let y be l(26). Round y to the nearest 1000000. 1000000 Let t = 1750.24 - 1698. Let v = -52 + t. Round v to two decimal places. 0.24 Let u = -3362.132 - 210146.568. Let t = -213798.7542 - u. Let c = t + 290. Round c to 2 decimal places. -0.05 Let f = 7164.468 + -7176. Round f to one dp. -11.5 Let g = -45904077679.99999779 + 45904077393. Let k = g + 287. What is k rounded to 6 dps? 0.000002 Let h(s) = 7 + 224565s - 231886s - 162771s - 727001s. Let l be h(-1). Round l to the nearest one hundred thousand. 900000 Let z = 1.47 + -8.37. Let t = z + 6.884. Let i = -0.0247 - t. What is i rounded to three dps? -0.009 Let b(c) = 2c - 24. Let h be b(10). Let m be (14/h)/((-12)/(-93600)). Round m to the nearest 10000. -30000 Let t(n) = 4n + 33 - 13 - 18n + 7 - 1400n2 + 39. Let j be t(19). Round j to the nearest one hundred thousand. -500000 Let w = 649.504 - 639. Round w to 1 decimal place. 10.5 Let g = 18.90207075 + -18.57207. Let y = -0.21 - -0.54. Let n = g - y. Round n to 7 decimal places. 0.0000008 Let u = -0.0481 - 761.9519. Let h = u - -762.0000974. What is h rounded to 4 dps? 0.0001 Let x = -2.486 - -3.05. Let s = 1.401 + x. Let q = -2.87 + s. What is q rounded to 1 dp? -0.9 Let w = -820222.39 + 815408. Let n = -4845 - w. What is n rounded to the nearest integer? -31 Let s = -16449 + 16748.88. Round s to the nearest integer. 300 Let l = -81902 + -205558. What is l rounded to the nearest 1000? -287000 Let g = -886.7 - 2864.8. Round g to the nearest one thousand. -4000 Let o = 4697.099 + -0.899. What is o rounded to the nearest one thousand? 5000 Let n(f) = 49f*2 + 6f - 7. Let y be n(5). Let l = -688 + y. Suppose 5m - l - 35 = 0. Round m to the nearest ten. 120 Let n = -106 + 153. Suppose 5r = -53 - n. Let b = -22 - r. Round b to the nearest 10. 0 Suppose -72d - 249d = -635990880. What is d rounded to the nearest one hundred thousand? 2000000 Let v = -420.197 + 2.997. Round v to the nearest ten. -420 Let z(y) = -267y + 44. Suppose -12 = -2f + 6f - 4n, -n + 5 = 0. Let w be z(f). What is w rounded to the nearest one thousand? 0 Let h = 429.564 + -431. Let f = h + 1.6. Round f to two decimal places. 0.16 Let m = -3239 + 3238.996408. Round m to 3 dps. -0.004 Let x = 7877 + -7875.7596. Round x to one decimal place. 1.2 Let n = -3.599 + -0.371. Let g = n + 3.8686. What is g rounded to 2 decimal places? -0.1 Let a = 2373047250601.4 + -2373045963974.5010063. Let j = a - 1286627. Let i = -0.101 - j. Round i to six dps. 0.000006 Let t = 154204 - 84399. Let u = -69746.042 + t. Let z = u + -59. What is z rounded to 2 dps? -0.04 Let k = -396.4 + 396.388596. Round k to 3 dps. -0.011 Let v = -77188.8 - -90354. Round v to the nearest 1000. 13000 Let o = -2202.1 - -2016. Let k = o + 185.9639. Round k to two dps. -0.14 Let z = -0.001 + -41.099. Let c = -41.099907 - z. Round c to six dps. 0.000093 Let o = -40.55 + 36.8. Let d = o + 3.7617. Round d to 2 dps. 0.01 Let b = 10247.7 + -10792. What is b rounded to the nearest 10? -540 Let t = 401.77 + -345.7. Let u = 0.07 - t. Let o = u - -55.9558. Round o to 3 decimal places. -0.044 Let q = 140.5 - -3.5. Let j = -3.213 - -147.783. Let g = q - j. Round g to 1 dp. -0.6 Let h = -0.3356 - -0.33555987. What is h rounded to 6 decimal places? -0.00004 Let y = 1237 + -1229.51. Let b = -1.41 - y. Let k = b + 8.8999922. What is k rounded to 6 dps? -0.000008 Let t = -1895 + 1894.9031. Let z = t - -0.038. Round z to 2 dps. -0.06 Let y = -22000 + 36934. Let o = -49766 - y. What is o rounded to the nearest 1000? -65000 Let i = 194.445 + -195. Let v = 0.4248 + i. Let g = v + 0.1302721. What is g rounded to five dps? 0.00007 Let w = -294507 + 294344.0364. Let y = w + 163. Round y to 2 decimal places. 0.04 Let h(q) = -10784q2 + 144q + 748. Let c be h(-6). What is c rounded to the nearest one thousand? -388000 Let v = -6187.7835 + 6186. Round v to 1 decimal place. -1.8 Let n = -1.27 - -6.37. Let i = n + -5.932. Let m = 0.84 + i. Round m to 3 dps. 0.008 Let d = 553.2 + -481. Let y = d - -1.8. Let b = -74.0069 + y. Round b to four dps. -0.0069 Let u = 48.76 + -48. Let a = 0.06 - u. Let h = -0.02 + a. Round h to 1 decimal place. -0.7 Let u = -2643.54864 + 2645. What is u rounded to 1 decimal place? 1.5 Suppose 0 = 4j - 119 - 13. Let c = j - 33. Let h be 4502 - (2 + c)(6 + -5). Round h to the nearest 1000. 5000 Let l(k) = 232k3 - 2k*2 - 2k - 1. Suppose 2x - 1 = 5w - 2, 0 = 3w - x. Let q be l(w). What is q rounded to the nearest one hundred? -200 Let l = 113.3 - 118.61. Let f = 5.310462 + l. What is f rounded to 4 decimal places? 0.0005 Suppose -t = -5j + 22, -56j + 52j - t + 14 = 0. Suppose 0 = 2i - 5d - 61585, 0d = 2i + jd - 61612. What is i rounded to the nearest one thousand? 31000 Suppose 0 = 5i + 5i - 12106140. Suppose -2f - 5m = -2805093, -f + 191934 + i = m. Suppose 4l + f = 438549. What is l rounded to the nearest ten thousand? -240000 Suppose 232h + 463881760 + 848453103 = -2957625137. Round h to the nearest one million. -18000000 Let k = 241.05 + -242. Let o = 7.32 + k. What is o rounded to the nearest integer? 6 Let k = 73491.453 - 73435. Let f = -1189.7 + 1133. Let x = k + f. What is x rounded to two dps? -0.25 Let x = -50.15 + 0.15. Let a = -16522.15285 + 16472.15. Let z = x - a. What is z rounded to 4 decimal places? 0.0029 Let p = 5.66 - 5.71433. What is p rounded to 3 dps? -0.054 Let d = -213.78 - -30.74. What is d rounded to the nearest ten? -180 Let x be (24/24)/(2/778). Suppose 0 = -2s + 6, 1647 = -4p + s - 684. Let i = x + p. Round i to the nearest ten. -190 Let j = -843.3674 + 842.1. What is j rounded to one decimal place? -1.3 Let u = 16.955 - 17. Let j = -3990.405 + 3990. Let r = u - j. What is r rounded to one decimal place? 0.4 Let m = -14373.405 - 18.595. Let o = -14393.9966 - m. Let u = o - -2. What is u rounded to 3 decimal places? 0.003 Let a(w) = 1243694w*3 - 5w*2 + 3w - 4. Let s be a(3). Suppose -10j - 39160932 = s. Let b = -3814063 - j. Round b to the nearest 1000000. 3000000 Let s = 0.7538006945 - 0.7538. What is s rounded to six decimal places? 0.000001 Let p = 54.92 - -0.08. Let h = p + -54.9999528. Round h to 5 decimal places. 0.00005 Suppose 2f = -5z - 28080, 103f = 104f + z + 14046. Round f to the nearest 100. -14100 Let w = -548 - -538. Let t be (790/3 + w)/((-2)/(-29850)). Round t to the nearest one hundred thousand. 3800000 Suppose 3q + 1298700 = i, -5i + 7 = 7. What is q rounded to the nearest 100000? -400000 Let b be (50/(-700) + 626/(-56))(4 - -43460). What is b rounded to the nearest 10000? -490000 Let l be (-121 + 1)/((-8)/(-1704460)). What is l rounded to the nearest 1000000? -26000000 Let c = -7 + 7.02. Let z = c - 0.03. Let g = z - -0.009802. Round g to five dps. -0.0002 Let s = -49 - -58. Let h = s + -9.00272. Round h to four dps. -0.0027 Let f = 38.89016 - 738.66896. Let r = f + 700. Round r to 2 dps. 0.22 Let c be -1(0(2 + -1) - 0). Let y be (4/(-2))/((-1)/2). Suppose -3k - 2a = -4a - 1462, -5k + ya + 2434 = c. Round k to the nearest one hundred. 500 Let j = 59 - 69. Let p be 60/(-150) - (0 + 37744/j). Let b = p - 6434. Round b to the nearest 100. -2700 Let j = -83 - -180. Let l = j - 139. Let g = l - -41.929. What is g rounded to two decimal places? -0.07 Let i = -281 - -280. Let o be 1654 + (-1)/((-10)/(-8) + i). What is o rounded to the nearest 100? 1700 Let a(z) = -4z - 6. Let p be a(-2). Suppose px + 2 = 6, c - 77 = -3x. Round c to the nearest integer. 71 Let b = 6.996725958 + -6.9968. Round b to five dps. -0.00007 Let r = -5.243 + 5.34258. What is r rounded to two dec	{ "pile_set_name": "DM Mathematics" }
ers picked without replacement from uuquuuququuuuuquuuuu. 1/4845 Three letters picked without replacement from mmtmmmmmmmmm. Give prob of picking 3 m. 3/4 What is prob of picking 2 i and 1 o when three letters picked without replacement from hhiohhiohihhhhoo? 3/140 Calculate prob of picking 1 m, 1 l, and 1 h when three letters picked without replacement from keeekkemmhheelk. 4/455 What is prob of picking 2 l when two letters picked without replacement from {l: 6, o: 7}? 5/26 What is prob of picking 1 p and 1 r when two letters picked without replacement from {p: 11, r: 2}? 11/39 What is prob of picking 1 t, 1 k, and 1 p when three letters picked without replacement from {k: 3, r: 10, p: 4, t: 1}? 1/68 Calculate prob of picking 1 s, 1 p, 1 t, and 1 w when four letters picked without replacement from {i: 2, t: 1, s: 1, p: 3, w: 4}. 2/55 Four letters picked without replacement from itzzzmmitziiztmm. What is prob of picking 2 m and 2 i? 9/455 What is prob of picking 1 o and 1 a when two letters picked without replacement from eoeaooeaoaeooeeao? 7/34 Three letters picked without replacement from {i: 1, a: 1, y: 2, t: 6, e: 8}. What is prob of picking 2 e and 1 y? 7/102 Two letters picked without replacement from ynqkbnz. Give prob of picking 1 b and 1 n. 2/21 Calculate prob of picking 2 q and 1 s when three letters picked without replacement from eflqllsqqqflllqslfef. 1/57 Four letters picked without replacement from {p: 4, i: 6, e: 2, n: 1}. What is prob of picking 1 n, 1 e, and 2 i? 6/143 What is prob of picking 1 z, 1 y, and 2 q when four letters picked without replacement from {y: 1, q: 7, g: 3, z: 1}? 7/165 Two letters picked without replacement from ooomoomooooomommmo. What is prob of picking 2 o? 22/51 What is prob of picking 1 l and 2 i when three letters picked without replacement from {l: 1, w: 1, i: 2}? 1/4 Four letters picked without replacement from vfffvfvvvvvfv. Give prob of picking 3 f and 1 v. 16/143 What is prob of picking 1 s and 1 h when two letters picked without replacement from hhhhhhhhhhhhs? 2/13 What is prob of picking 1 l and 2 i when three letters picked without replacement from {e: 5, l: 1, i: 3, o: 1, z: 4, v: 1}? 3/455 Three letters picked without replacement from afgzf. What is prob of picking 1 a and 2 f? 1/10 What is prob of picking 1 a and 1 s when two letters picked without replacement from {h: 1, i: 2, n: 1, s: 1, z: 1, a: 1}? 1/21 Calculate prob of picking 2 u when two letters picked without replacement from ububbuuubu. 1/3 What is prob of picking 1 x and 2 w when three letters picked without replacement from {x: 3, w: 3}? 9/20 Three letters picked without replacement from {z: 3, u: 3, s: 5, y: 2}. What is prob of picking 1 y, 1 z, and 1 u? 9/143 What is prob of picking 2 v and 1 u when three letters picked without replacement from {u: 1, z: 1, v: 7}? 1/4 Two letters picked without replacement from qqqfqqfqtqfqqftq. What is prob of picking 2 q? 3/8 What is prob of picking 1 u and 1 w when two letters picked without replacement from wulwauw? 2/7 Calculate prob of picking 1 m and 2 h when three letters picked without replacement from mmhmmmmmmhmmhhmmmmm. 30/323 What is prob of picking 1 h and 1 c when two letters picked without replacement from {h: 7, g: 1, a: 3, c: 6}? 21/68 Calculate prob of picking 4 r when four letters picked without replacement from {i: 2, r: 17}. 35/57 Calculate prob of picking 2 i when two letters picked without replacement from iiiiriiiriiirr. 45/91 What is prob of picking 1 k, 2 u, and 1 n when four letters picked without replacement from ulqnunqek? 1/63 What is prob of picking 1 d and 1 t when two letters picked without replacement from kupdt? 1/10 What is prob of picking 4 i when four letters picked without replacement from {i: 10}? 1 Three letters picked without replacement from avatttzrtt. Give prob of picking 2 a and 1 v. 1/120 Four letters picked without replacement from ddddlddddlddid. What is prob of picking 1 d, 1 l, and 2 i? 0 What is prob of picking 1 y and 1 g when two letters picked without replacement from vgygvyvvyyvgygyvy? 7/34 Three letters picked without replacement from {q: 2, a: 1, v: 3, y: 1, h: 9, o: 3}. Give prob of picking 1 a, 1 y, and 1 h. 3/323 Two letters picked without replacement from {f: 3, n: 1, w: 6, s: 1, y: 4}. What is prob of picking 1 w and 1 y? 8/35 Two letters picked without replacement from {k: 5, h: 2, q: 12}. Give prob of picking 2 k. 10/171 What is prob of picking 3 c when three letters picked without replacement from {c: 10}? 1 Calculate prob of picking 4 p when four letters picked without replacement from tppppppppppppttptp. 1001/3060 What is prob of picking 3 k when three letters picked without replacement from {e: 1, c: 11, t: 3, k: 5}? 1/114 Two letters picked without replacement from uouoooouuoo. Give prob of picking 2 o. 21/55 Four letters picked without replacement from uujwrjjwvwwwrauvwu. Give prob of picking 1 r, 1 a, and 2 v. 1/1530 Two letters picked without replacement from ddchddwdiededhcddh. Give prob of picking 1 c and 1 d. 2/17 Three letters picked without replacement from vvohqvqvvojhvooo. What is prob of picking 1 h and 2 q? 1/280 What is prob of picking 1 v and 1 i when two letters picked without replacement from {x: 1, m: 1, v: 4, i: 1, q: 5}? 2/33 Two letters picked without replacement from mmzvzevsnezemvvevm. What is prob of picking 2 e? 2/51 What is prob of picking 1 r and 2 l when three letters picked without replacement from {l: 6, y: 1, r: 2, u: 2}? 2/11 What is prob of picking 1 t and 2 e when three letters picked without replacement from tgeteeeeeeegee? 45/182 Three letters picked without replacement from kttqmkt. What is prob of picking 2 k and 1 q? 1/35 Calculate prob of picking 2 m when two letters picked without replacement from mmmmmmmmmm. 1 Four letters picked without replacement from cicicicicciilciciiii. What is prob of picking 2 c and 2 i? 308/969 Calculate prob of picking 3 t and 1 d when four letters picked without replacement from {d: 5, c: 8, t: 5}. 5/306 Two letters picked without replacement from vavvaa. What is prob of picking 2 a? 1/5 Calculate prob of picking 2 g and 1 h when three letters picked without replacement from nnuhnhnnnngnhunhghg. 5/323 Four letters picked without replacement from vvvvivivvvi. Give prob of picking 2 i and 2 v. 14/55 What is prob of picking 1 s and 2 t when three letters picked without replacement from wtwwastw? 1/56 Calculate prob of picking 1 b and 1 m when two letters picked without replacement from {m: 1, b: 1, l: 3, a: 4, t: 7}. 1/120 Three letters picked without replacement from {g: 1, y: 1, l: 7}. What is prob of picking 1 g and 2 l? 1/4 Calculate prob of picking 2 j when two letters picked without replacement from {j: 3, u: 15, m: 2}. 3/190 What is prob of picking 3 s and 1 z when four letters picked without replacement from {s: 4, z: 6}? 4/35 Three letters picked without replacement from pppmppppmpppp. What is prob of picking 2 p and 1 m? 5/13 Three letters picked without replacement from {w: 2, b: 2, f: 1}. What is prob of picking 2 w and 1 b? 1/5 What is prob of picking 2 f and 1 w when three letters picked without replacement from {w: 5, f: 4, s: 8}? 3/68 What is prob of picking 1 w and 1 g when two letters picked without replacement from woawgoiowaw? 4/55 What is prob of picking 2 s and 1 x when three letters picked without replacement from {s: 17, x: 2}? 16/57 What is prob of picking 2 l when two letters picked without replacement from jaolplll? 3/14 What is prob of picking 2 b when two letters picked without replacement from {b: 7, a: 3}? 7/15 Two letters picked without replacement from {v: 1, e: 3}. What is prob of picking 2 e? 1/2 What is prob of picking 3 b and 1 e when four letters picked without replacement from eeexxxxebbbbbxxbb? 1/17 Two letters picked without replacement from oft. What is prob of picking 1 f and 1 o? 1/3 Two letters picked without replacement from {b: 3, r: 5, o: 1, p: 1}. What is prob of picking 2 r? 2/9 Three letters picked without replacement from yykyfydkf. Give prob of picking 2 f and 1 k. 1/42 What is prob of picking 1 o and 2 i when three letters picked without replacement from {r: 2, o: 7, i: 6}? 3/13 Two letters picked w	{ "pile_set_name": "DM Mathematics" }
t is the closest to -3 in -1/5, -3/5, -0.5? -3/5 Which is the nearest to -5? (a) 3 (b) -3/5 (c) 2/7 (d) 2 b Which is the closest to -0.1? (a) 4.3 (b) 3/2 (c) 0 (d) 2 c What is the closest to 0 in -1/6, -0.03, 0.2, 1? -0.03 What is the closest to -1 in -1/9, 19, -4? -1/9 What is the closest to 1 in -2, -19, -0.5, 0.2? 0.2 Which is the nearest to 0.11? (a) -0.5 (b) 2/11 (c) -1 (d) 0.4 b What is the closest to -31/5 in -2, 2/13, -4? -4 What is the closest to -0.1 in 0, -0.207, 5? 0 What is the nearest to 0 in -2/7, -1/4, 3, -2? -1/4 Which is the closest to -3/10? (a) -4 (b) 0.02 (c) -24 b What is the closest to 0.2 in -4, -3/14, 3? -3/14 Which is the nearest to 0.1? (a) 2/5 (b) 2.7 (c) -3 a Which is the closest to 1? (a) -0.002 (b) -5 (c) 4/5 c What is the closest to -0.1 in 1.15, 3, -5, 1/4? 1/4 What is the closest to 110 in -2, 4, 3? 4 What is the closest to -2 in -8, -0.3, 1/3, -1/7? -0.3 Which is the nearest to -0.3? (a) -2/17 (b) -0.2 (c) 2 (d) -473 b What is the nearest to 12 in -66, -0.2, 5, 1? 5 Which is the nearest to 0.04? (a) 0.01 (b) -1 (c) 0.2 a Which is the closest to -2/3? (a) 3 (b) 0.07 (c) 3.3 (d) 2/11 b What is the closest to 1/3 in 1/5, -4, -30, 5/2? 1/5 What is the nearest to 24 in -2/7, -0.05, -0.3? -0.05 Which is the closest to 0? (a) -2/11 (b) -898 (c) 3/5 (d) -6 a What is the closest to -1/2 in -3, 6, 4/13, 0.1? 0.1 What is the closest to -5 in -2/11, -0.3, -2, 0.4? -2 What is the closest to 0 in 0.1, 13/4, 4, 2? 0.1 What is the nearest to 1/4 in -0.3, -0.1, 6? -0.1 Which is the closest to -0.5? (a) 1/6 (b) 27.8 (c) 2 a Which is the closest to 2/3? (a) 4/5 (b) 3.15 (c) -2 a What is the closest to 1 in 3/2, 1/41, -2/19? 3/2 Which is the closest to -1/2? (a) 0.61 (b) 1/5 (c) 2/7 (d) -0.1 d Which is the closest to -10? (a) 1 (b) 22 (c) 1/4 c Which is the nearest to 1? (a) -0.05 (b) -2/13 (c) -40 (d) 0.4 d What is the closest to -0.29 in -5, -1, -2/21, 3? -2/21 What is the closest to 1 in -64, 4, 0.1, -0.5? 0.1 What is the closest to 0 in -3/5, -2, -3, -7/4? -3/5 What is the nearest to 0.05 in 2, 4, 0.1? 0.1 Which is the closest to -1? (a) 98 (b) -1 (c) 1/4 b What is the closest to 6 in 2/3, -7, -4? 2/3 What is the nearest to 1/4 in -2/5, 22, -1/6, -2/35? -2/35 What is the nearest to 13 in -5, 3, 2, -0.3? 3 What is the nearest to -1/116 in 5, 16, -0.1? -0.1 What is the closest to 0 in -11/2, -4, -1? -1 What is the closest to 3 in -1/9, -1/21, 6/11? 6/11 What is the closest to -2/3 in 10, 0.2, -2/15? -2/15 What is the closest to -0.1 in -5/2, -6, 3/5, -3? 3/5 Which is the nearest to 0.269? (a) -3/7 (b) -0.1 (c) 1 b What is the closest to 0.1 in 2, 3/44, 0.4, -4? 3/44 What is the nearest to 0.02 in -4, -0.37, 0? 0 What is the closest to 1 in 0.104, -5, 10, -2? 0.104 What is the nearest to -2/3 in -2, 5, 164? -2 Which is the nearest to 0.1? (a) -16 (b) 0.5 (c) -1 b Which is the nearest to 1? (a) -0.3 (b) -6 (c) -9 a What is the closest to 2 in -22, 1/4, 4? 1/4 What is the nearest to 1 in 3, -0.4, 0.13? 0.13 What is the closest to -2/5 in -9, 2/3, 0.2? 0.2 What is the nearest to -0.1 in -0.02, 0.5, -0.3, 10? -0.02 Which is the closest to -1/6? (a) -2/9 (b) -0.5 (c) -2 (d) -54/7 a Which is the closest to -1? (a) -45 (b) 0.6 (c) -6 (d) 3 b What is the nearest to -0.1 in 0.2, -4, 2, 0? 0 What is the closest to 2/3 in -4/3, 17, -4, -1/5? -1/5 Which is the nearest to -1/4? (a) -0.06 (b) 0 (c) -4 (d) -1/7 d Which is the nearest to -2? (a) -1 (b) 1 (c) -0.09 (d) -2 d Which is the nearest to -0.2? (a) -0.9 (b) 10 (c) -5 (d) 0.2 d Which is the closest to -0.1? (a) -28 (b) -4/5 (c) -1/3 (d) 2/9 c What is the closest to 0.6 in 0.1, 1/8, 0.02, 0.4? 0.4 Which is the nearest to 0? (a) 1 (b) 0.08 (c) -4 (d) 0.24 b What is the closest to -6/7 in 0.2, 2/9, 2? 0.2 Which is the nearest to -1? (a) -0.2 (b) 2/3 (c) -8 a What is the closest to -4 in -0.5, -5, 2, 5/2? -5 Which is the nearest to -8? (a) 0.6 (b) -2 (c) 4 b Which is the nearest to 6/11? (a) 1/17 (b) 8 (c) 2/7 c What is the closest to 2 in 1, 0.05, -4, 12? 1 Which is the closest to 0? (a) 0 (b) 1 (c) -5 a Which is the nearest to 10? (a) -3 (b) 8/13 (c) -1/7 b What is the closest to 11 in 2, 4, -2/11? 4 What is the nearest to 1 in 24, -4, 5? 5 What is the closest to 1/3 in -0.1, 0.2, -3, 1/11? 0.2 Which is the nearest to -5? (a) -0.07 (b) -4 (c) -1/3 b What is the nearest to 0.3 in -1, 3, -1/4, 0? 0 Which is the nearest to 3? (a) -3/7 (b) 22.3 (c) -3/4 (d) -3 a What is the closest to 13 in 2, -4, 8? 8 What is the nearest to -132 in 2/5, -0.1, 3? -0.1 Which is the nearest to 2? (a) -1 (b) -0.3 (c) 12 b What is the nearest to 0.3 in 2/61, -4, -3? 2/61 Which is the nearest to -1? (a) -1 (b) -3 (c) 2 (d) -3/4 a Which is the nearest to 0.17? (a) -4 (b) 3 (c) 5 b Which is the closest to 0.1? (a) -3 (b) -1/17 (c) 1/4 (d) 1/5 d Which is the closest to 5/6? (a) 5 (b) 0.2 (c) -0.3 (d) 1 d Which is the nearest to 1? (a) -5.5 (b) 5 (c) -0.5 c What is the closest to 0 in -34.5, 1/5, 1? 1/5 Which is the nearest to 0.1? (a) -3/79 (b) -1 (c) 5/3 a What is the closest to -1/3 in 0.1, 0.7, 7? 0.1 Which is the nearest to -1/6? (a) -315/8 (b) -1/2 (c) -2 b Which is the closest to 1/5? (a) -3 (b) 34 (c) -1.3 c What is the nearest to -0.9 in -2, 12, -4? -2 What is the nearest to 2/7 in 0.2, 2, -10? 0.2 Which is the closest to -2/5? (a) -2/61 (b) -0.4 (c) -6/11 (d) 5 b Which is the closest to -1/2? (a) 5/3 (b) 0.11 (c) -0.1 (d) -1 c What is the closest to -2/5 in 2/5, -0.5, -30, 30? -0.5 What is the nearest to -0.1 in 22, 7, 0.2, 2/5? 0.2 Which is the closest to -0.1? (a) 2/9 (b) 1/10 (c) -0.4 (d) -2/7 d What is the closest to -0.1 in -2, -5/4, -3/8, 1/8? 1/8 Which is the nearest to -3/4? (a) 5 (b) -0.1 (c) 10 b Which is the nearest to 2? (a) 3 (b) -1/4 (c) 1.7 (d) 4 c Which is the nearest to 2? (a) 5 (b) 2 (c) 12 b Which is the nearest to 0? (a) -4/9 (b) 0.1 (c) 19 b What is the closest to 1.37 in -0.2, -0.06, -3? -0.06 What is the closest to 9 in -2/5, -0.5, 5, -89? 5 What is the nearest to -0.1 in -4, 1/3, 4, -0.8? 1/3 What is the nearest to 2/3 in 1/8, -3, 0.5, -2/9? 0.5 Which is the closest to -1/2? (a) 2 (b) -2 (c) -1/4 c Which is the closest to 4? (a) 2 (b) 73 (c) -1/4 (d) 5 d What is the nearest to -1 in 21, 2, -2, 1/4? -2 Which is the nearest to 6? (a) 0.3 (b) -3 (c) -1 a Which is the closest to 2? (a) 0.2 (b) -15 (c) 0.641 c What is the nearest to 0.2 in -1, 351, -0.1? -0.1 Which is the nearest to 0.5? (a) -3 (b) -0.2 (c) -1 (d) 2/5 d Which is the nearest to -6? (a) -1/3 (b) -0.2 (c) -2/13 a What is the closest to -1 in 0, -5/4, -8, 2/9? -5/4 What is the closest to -2 in -2, 5, 1/10, -3/5? -2 What is the nearest to -0.02 in 1, -3/4, -4? -3/4 Which is the nearest to 151? (a) -5 (b) 0.5 (c) 3/4 (d) -1 c Which is the closest to 3? (a) -3 (b) 4 (c) 0.4 b Which is the closest to 1? (a) -0.5 (b) 28/365 (c) -0.2 b What is the nearest to -24 in -2, -0.4, -5? -5 Which is the nearest to 1? (a) 3/4 (b) -0.4 (c) 46/3 (d) 4 a Which is the nearest to -0.4? (a) -0.01 (b) 0.1 (c) 0.2 a Which is the closest to -4? (a) 3/10 (b) -0.2 (c) 5 b What is the closest to 0.1 in -1/110, 0.4, 4? -1/110 What is the nearest to -1/3 in 6, -0.2, -2, 0.4? -0.2 Which is the nearest to 6.8? (a) 2 (b) 0 (c) 4 c What is the closest to 0 in -3/5, 1, 0.2? 0.2 What is the closest to -0.2 in -10, -18, -4, 0.4? 0.4 Which is the closest to 1? (a) -3 (b) 4 (c) 0.3 c Which is the closest to -0.2? (a) 0.1 (b) 1/2 (c) -0.042 c What is the nearest to 0.08 in 5, -2, -11, 3/4? 3/4 What is the nearest to 0.09 in 170, -3, 3? 3 Which is the closest to -0.1? (a) 10/3 (b) -3/2 (c) 0.1 c Which is the closest to -1446? (a) -4 (b) -3 (c) 0.4 a Which is the closest to 2/5? (a) -0.041 (b) -0.1 (c) 3/8 (d) 0 c What is the nearest to 26 in 0, 1/2, 0.2? 1/2 Which is the nearest to -2/7? (a) -7 (b) 0.4 (c) -5 (d) 5 b What is the nearest to -0.1 in 0.4, 2, -117/68? 0.4 What is the closest to -0.01 in -2, 2/3, 1/3? 1/3 Which is the closest to 32? (a) -4 (b) 21 (c) 4/3 b Which is the nearest to -0.04? (a) -2/11 (b) 4 (c) 0.1 (d)	{ "pile_set_name": "DM Mathematics" }
y w*(-2/9)w(ww*7w)/ww(w/(www/w(-1/2)))(3/46) assuming w is positive. w(7961/828) Simplify a(-1/5)/(aaa*(-1/3)aa)(aa/a(3/5)a)25 assuming a is positive. a(842/15) Simplify (dd(dd(2/7)/d)/dd)*(24/11)(d*(-6)/d)/((d(dddd/(dd*6d))/d)/d) assuming d is positive. d(230/77) Simplify q(-10)q(-5)(q/(q/((q((q0q)/q)/qqqqqq)/q)))(-8/11) assuming q is positive. q(-197/11) Simplify (((ll*(7/2))/l)/l)/((l/(ll*(5/11)))/ll) assuming l is positive. l(65/22) Simplify ((j/j0)/j(-4))/(j/j(-8)j(4/3)) assuming j is positive. j(-16/3) Simplify (s31s)/(s/(sss*25s)) assuming s is positive. s*59 Simplify j/((j/(jj*(-3/2)))/j)j*(-2)(j*(-5)j)/((j/((j(j4/jj)/jj)/j))/j) assuming j is positive. j(-3/2) Simplify ((y/y(5/4))/(y/y(-2/5)))(-4/15) assuming y is positive. y(11/25) Simplify (l21)(2/85) assuming l is positive. l(42/85) Simplify ((zzz(-1/6)zz)/z(-3/7))(-1/12) assuming z is positive. z(-179/504) Simplify (s/(ss/(s/s*(1/12)ss)))/((ss/(s*(-16)/s)s)/s) assuming s is positive. s(-205/12) Simplify (v(-3/7)v(-8))/((v/(v/(v5v)))/v(-1/5)) assuming v is positive. v(-512/35) Simplify (x/x(-2/19))(-2/173) assuming x is positive. x*(-42/3287) Simplify (c/(cc*(-3/4)))/(cc*(-3))c(-1)/((c/(c(1/2)c))/c) assuming c is positive. c(13/4) Simplify f(-15)/ff/(f/f18) assuming f is positive. f2 Simplify ((h/((h/h(-3))/h))/h(2/7))(8/7) assuming h is positive. h(-128/49) Simplify (a(-4/31))(2/119) assuming a is positive. a(-8/3689) Simplify (b0)*32bb(b/(b/(b*(-1/4)/b)))/bbb(1/5)b assuming b is positive. b*(39/20) Simplify ((c/((cc*(-1/4)/c)/c))/cc)*(-25)(c1)30 assuming c is positive. c*(-105/4) Simplify ((ss(-1))39)(-16) assuming s is positive. 1 Simplify (y(1/3)yy)*15(y/(yy/(y1/y)))(-44) assuming y is positive. y79 Simplify n(-5/2)/nn(n/(n/(n/(n/((n19nn)/n)n))n))/nn assuming n is positive. n*(31/2) Simplify (c(c/(cc/c(4/11)cc))/c)/cc(-17) assuming c is positive. c(-227/11) Simplify (f6)(2/17) assuming f is positive. f*(12/17) Simplify ggg7g*(-1/4)(gg1g)(2/117) assuming g is positive. g(1373/156) Simplify ((ff(-2/3))(-10/7))(-10/3) assuming f is positive. f(100/63) Simplify (t/(t/t(7/8)))(-2/11) assuming t is positive. t(-7/44) Simplify q/(qq*(-2/11)/qqq)q*(2/3)q*(-1/7)qq/(q5/q) assuming q is positive. q(-530/231) Simplify (a(1/4))(-1/11)/((a/(((aa/a*(2/7)aa)/a)/a))/(aaaaa(1/3)aa)) assuming a is positive. a(6491/924) Simplify (d(-10)/((d(2/33)/d)/d))(-31) assuming d is positive. d(8246/33) Simplify ((b/((b(-1)b)/b))/(b/b(-1)))/((b(3/4)/b)/bb(1/7)/b) assuming b is positive. b(59/28) Simplify ((n/n1)(15/4))(-2/9) assuming n is positive. 1 Simplify ((y/(yy(y(y/(((y*13/y)/y)/y))/y)/y)y)/(y/y5))(-16) assuming y is positive. y(-224) Simplify d(4/9)/d(2/13) assuming d is positive. d(34/117) Simplify ((v0)(3/5))*(21/4) assuming v is positive. 1 Simplify g(((g/g*22)/g)/g)/gg/(g*10g) assuming g is positive. g*(-33) Simplify (dd/((dd(-4/5)dd)/d))/d(10/11) assuming d is positive. d(-6/55) Simplify (yy*(-8)/yy)/(y*(-7)/y)y*(2/9)/yy1 assuming y is positive. y(11/9) Simplify s(-7/8)/(s/(s7/s)) assuming s is positive. s(33/8) Simplify (q(3/2)qqqq*(-7))/((qqq(1/4)q)/q(1/2)) assuming q is positive. q(-21/4) Simplify (kkk*(-9)/k(k*(2/23)k)/k)/(k/(k/(kk/(k(-9)/kkk)))(k/k*(1/3)k)/k) assuming k is positive. k(-1282/69) Simplify s(-9/5)/(ssss/(s/(s(-17)s))) assuming s is positive. s*(56/5) Simplify (i/((i(ii(2/5))/i)/i)i(-7))/(i1)46 assuming i is positive. i(-262/5) Simplify ((x(-12)/x)/(x(-1/4)x))(-41) assuming x is positive. x(2255/4) Simplify ww*(-1/5)w(w(w*(3/5)w)/w)/w assuming w is positive. w*(12/5) Simplify ((rr/(r/(r/(r/((r/(r((r(r*(-1)/r)/r)/r)/r))/r))rr)r))(-2/13))(5/11) assuming r is positive. r(-50/143) Simplify m(-4)/mm(-8) assuming m is positive. m(-13) Simplify (x4x)/(x/x*(-3)x)(x(-4/3)/x)/xx(1/4) assuming x is positive. x(-37/12) Simplify j*(1/9)j(j/(j2/jj)j)/jj(jj*2j)/(jj(-2)/j) assuming j is positive. j(64/9) Simplify u/(u/u(-8/7))u*(2/15)(((u0/u)/u)/u)(-3) assuming u is positive. u(839/105) Simplify (k11k)/kk(1/15) assuming k is positive. k(166/15) Simplify (w/((www/(ww26w))/w))(-10/9) assuming w is positive. w(-30) Simplify (w(w34w)/ww)/(w/(w/(ww*(2/87)www))) assuming w is positive. w*(2782/87) Simplify ((gg*(-7/2))/gg/((g/(g*(-8)g))/g)g)/(g(-2/29)/(g(-10)g)) assuming g is positive. g*(-1011/58) Simplify ((xx/x*(-7)x)/(x/x(1/4)))/((x/(x/x(3/10)))/(((x/(x/(x/x*(-3/7)))x)/x)/x)) assuming x is positive. x(1313/140) Simplify (g(-2)(g7gg)/g)/((gg(-3)/g)/g(-4)) assuming g is positive. g5 Simplify m(-2/3)mm(-26) assuming m is positive. m(-77/3) Simplify k(-7)/k1(k(1/3))(8/11) assuming k is positive. k(-256/33) Simplify (r/r5r2)/(r(-2/11)rr(-3)) assuming r is positive. r(2/11) Simplify ((c/c(-1))/(c(-1/2)/c))/(c2)4 assuming c is positive. c(-9/2) Simplify (v/v(-6)v/((vv*(-3)v)/v))/(v*(1/3)/vv/(vvvv/(v(vv4v)/vv)vvv)) assuming v is positive. v(29/3) Simplify u(7/2)u(1/5)uu0uu/(u/((u/(u(1/6)u))/u))u assuming u is positive. u(83/15) Simplify r(-28)/rr*(4/3)r assuming r is positive. r*(-80/3) Simplify (ll(2/3)/l)(9/8)l6/l(1/5) assuming l is positive. l(131/20) Simplify (zz(1/56))13 assuming z is positive. z(741/56) Simplify (p/p(1/36))/((p/(p/p(11/4)))/p) assuming p is positive. p(-7/9) Simplify (jj(2/37)/j)/(j/(j(4/3)j))(j(-2/9)j)8 assuming j is positive. j(2534/333) Simplify ((ff(-1)ff)20)(2/27) assuming f is positive. f(80/27) Simplify ((x/x(-1/5))/(x/(x/(x/x(-12))x)))39 assuming x is positive. x(-2106/5) Simplify b*(-9/5)/(bbb/b(-1/19)) assuming b is positive. b(-461/95) Simplify (h(1/2)/(h(-2/5)h))44 assuming h is positive. h(-22/5) Simplify (z(-2)/z0)/((zz(4/3))/(z(-5/4)z)) assuming z is positive. z(-55/12) Simplify (g/g21)(-1/39) assuming g is positive. g(20/39) Simplify (m/(((m*(3/2)/m)/m)/m)mmmm(-2)mmm)/(m/(m/(m/(mmm*(-4/5)mm)))m/(mm8)) assuming m is positive. m(167/10) Simplify (tt(9/2))/t(6/7) assuming t is positive. t*(65/14) Simplify zz*5zzz/(z*(-6)/z)(z/(zzz/(z*0/z)z)z)(1/44) assuming z is positive. z(701/44) Simplify uuu(-2/21)uuu/(uu/u(9/4)) assuming u is positive. u(433/84) Simplify (h0/(h/(h/(hhh(10/9)hh))h))(-25) assuming h is positive. h(1375/9) Simplify ((xx1x)/x)*44x*(-2/9)x3/x assuming x is positive. x(808/9) Simplify ((u/u*(-10))/u)/(uuu(-2/39)u) assuming u is positive. u(275/39) Simplify (u(-1/15)u8)(-8) assuming u is positive. u(-952/15) Simplify (ii*(6/7)i)(-2/39) assuming i is positive. i(-40/273) Simplify ((vv/(v/(vv/v*(-9)v)))/v)/((vv/(vv/v6))/v) assuming v is positive. v7 Simplify w*9/(ww(-14)) assuming w is positive. w22 Simplify (x/(xx3x))/xxxx/x(6/13) assuming x is positive. x(-32/13) Simplify (h/(h((h/h*0)/h)/h)h(-2/3))/(h(-2)/hh(-6)hh) assuming h is positive. h(22/3) Simplify (ww*4w/w(-5))(22/5) assuming w is positive. w(242/5) Simplify (w/(w/(w/(w/w(-1/2)w)ww)))(1/13)/(((ww(-1/13))/w)/w2) assuming w is positive. w*(55/26) Simplify g/(gg*(-17))gg(-1/12)gg assuming g is positive. g(239/12) Simplify (rr*(24/7)/rr)(-37) assuming r is positive. r(-1147/7) Simplify (b/(b/b*11)b)/(b/b13) assuming b is positive. b24 Simplify d*(-5)/dd/(d/(d/(d*19d)d)) assuming d is positive. d(-24) Simplify (t0)(1/16)/(t/t(-3/5)tt/(t/(t/t(-2/15))t)t) assuming t is positive. t(-56/15) Simplify (z(-1/4)/(((z/(((z/z(2/11))/zz)/zz))/z)/z))(-50) assuming z is positive. z(-1725/22) Simplify (f(-1)/ff)**(-5/12)	{ "pile_set_name": "DM Mathematics" }
ive of 2883p5 + 2p*4 - 24p*2 + 48444p wrt p. 57660p3 + 24p*2 - 48 What is the first derivative of -877657q + 3169005 wrt q? -877657 What is the first derivative of -63ny*3 - 179ny2 - 55y*3 - 13y*2 wrt n? -63y*3 - 179y*2 What is the second derivative of -3037uv2 + 26uv - 7u - 30v2 + 13v - 4 wrt v? -6074u - 60 What is the derivative of 49663iz + 153858z wrt i? 49663z What is the second derivative of -72237j*4l - jl - 4j - 436l - 1 wrt j? -866844j*2l What is the derivative of -404q3t + 444470q3 - 3t*2 wrt t? -404q*3 - 6t Find the second derivative of -254209a4 - 165141a + 1. -3050508a2 Find the second derivative of -75720v*4 - 541836v wrt v. -908640v2 What is the first derivative of 201pu2x*2 + 5pu + 37u*2 - 35u + 680x2 wrt x? 402pu2x + 1360x What is the third derivative of -2g*2j*4 + 2g*2j - 288gj*4 - 109gj2 - 7gj - 2g + j*3 wrt j? -48g*2j - 6912gj + 6 What is the first derivative of 60430gt - 25g - 4660 wrt t? 60430g What is the second derivative of -9181d3s*2 - 4d*2s*3 + 66ds2 - 19ds + 2d + 15s3 - 1 wrt d? -55086ds2 - 8s*3 Differentiate 1155g*2x*3 - 196260g*2 - 103gx3 wrt x. 3465g*2x*2 - 309gx2 What is the second derivative of u3 + 39214u*2 - 3u + 5988? 6u + 78428 What is the second derivative of 10h*3k*2 + 535h*2k*3 + 4h*2k - 2hk*3 + hk - 2k3 - 3219k wrt h? 60hk*2 + 1070k*3 + 8k What is the derivative of a*3z + 6a3 - 394a*2 + 147z2 + 1 wrt z? a3 + 294z Find the third derivative of 8g*4 + 5427g*3 - 23304g*2 wrt g. 192g + 32562 What is the second derivative of -2913g2q*2 - 22g*2 + 26gq2 + 69gq wrt g? -5826q*2 - 44 Find the third derivative of -36094c*3 + 3c*2 + 23c - 18. -216564 Find the third derivative of -12m2x*6 - 952m*2x*4 + 5m*2x + 3088mx*2 wrt x. -1440m*2x*3 - 22848m*2x Find the third derivative of 202613jw*3 - jw*2 - 58jw - j + 191w*2 wrt w. 1215678j What is the third derivative of -1383f3v*3 + 9f*3v*2 - 31f*2 + 7fv5 - 2v*2 wrt v? -8298f*3 + 420fv2 Find the third derivative of 3045y*4 + 4y*2 - 572y + 3 wrt y. 73080y What is the first derivative of -2i*2n + 68i2q + 61351inq + 11q + 7 wrt n? -2i2 + 61351iq Find the third derivative of 10304v*3w3 + v3 + v*2w*5 + 3vw2 + v + 879w wrt w. 61824v3 + 60v*2w*2 Find the first derivative of -170bq4 - 3b - 11q4 - 824 wrt q. -680bq3 - 44q*3 What is the derivative of -568gh3i + 175828gh + 64gi - 5h3i + h*3 wrt i? -568gh3 + 64g - 5h3 Find the second derivative of -194b*3 + 33b*2c + b*2 + 2bc - b + 2c - 1044 wrt b. -1164b + 66c + 2 Find the second derivative of 242o2x*3 - 1918o*2x*2 - 9243ox3 - 38ox - 3o - 2x3 wrt o. 484x*3 - 3836x*2 What is the third derivative of -48b*6 - 6579b*4r*3 + 34b*2r + 21b2 - 90r*3 wrt b? -5760b*3 - 157896br3 Differentiate 7b*3g - 17b3 + 27b - 5618g - 3 wrt b. 21b*2g - 51b2 + 27 Find the second derivative of -17658x*3 + x + 23274 wrt x. -105948x Find the second derivative of 2n5 + 3787n*2v*2 + nv*2 + n - 67v*2 - 54 wrt n. 40n*3 + 7574v*2 What is the second derivative of 29041u*3 + 165u - 8 wrt u? 174246u What is the second derivative of 12fo5 + 29470f + 2o5 + 29o*2 - 2o wrt o? 240fo*3 + 40o*3 + 58 Find the first derivative of -240368q*2 - 112455 wrt q. -480736q What is the derivative of -4706751b3g*3v + 180b3g3 - b3g + b3 + 494 wrt v? -4706751b*3g*3 What is the third derivative of -6326fw5 - 2fw2 + 2fw + 4934w*2 wrt w? -379560fw2 Find the second derivative of -5y5 + y4 - 512y2 + 2y + 17221. -100y3 + 12y*2 - 1024 What is the second derivative of -2q*3rv2 - 2q*3rv + 6q*3v + 53q2r + 20qv*2 + 3q + 5870rv*3 - rv - 3 wrt v? -4q3r + 40q + 35220rv What is the first derivative of -94i*3 + 3i*2 + 273i - 771565 wrt i? -282i2 + 6i + 273 What is the third derivative of 4cu*5y + 2cu*2y + 2cuy - 198cu + 14996fu3y + fu2 + 3u*2 wrt u? 240cu2y + 89976fy What is the second derivative of -639k2q*4 - 6k*2q*3 - 24k*2q - 361q wrt q? -7668k*2q*2 - 36k*2q What is the third derivative of 1022623n3 + n2 - 340n - 161? 6135738 Find the first derivative of 11u3 - 70u*2 - 8u - 4656 wrt u. 33u2 - 140u - 8 Find the first derivative of -2r4 - 21r*3 - 215r*2 + 12r - 643943. -8r3 - 63r*2 - 430r + 12 Find the second derivative of -485483w3 + 2w*2 - 1184415w wrt w. -2912898w + 4 Find the third derivative of 3z*5 + 1145z*4 + 27337z*2 wrt z. 180z*2 + 27480z Find the second derivative of -173m3 - 2579m*2 - 2674916m. -1038m - 5158 Find the first derivative of -8018d*2y + 2d2 - d - 68203y wrt d. -16036dy + 4d - 1 What is the third derivative of -7w*4y*2 - 6190w*3y*2 + 3w*2y*2 - 279w*2y - 12w2 - 3 wrt w? -168wy2 - 37140y2 What is the third derivative of g5 + 927837g3 - 12g*2 - 11g - 14? 60g2 + 5567022 What is the second derivative of -90487d*2 + 95369d? -180974 What is the derivative of -2dp - d - 5535p2 + 24p + 1966206 wrt p? -2d - 11070p + 24 What is the third derivative of 6o4 + 8772o*3z*3 - 2o*2 - 115oz2 + 308z*3 wrt o? 144o + 52632z3 Find the second derivative of 274332t*5 + 136t - 701. 5486640t3 What is the third derivative of -284dg2x*3 - 33dgx*3 + 7dgx*2 + 2577g*2x wrt x? -1704dg*2 - 198dg What is the second derivative of 37078m*3 - 311974m - 1? 222468m What is the second derivative of 23273m*2pu2 + 2m*2u*2 + 2m*2u + 3mpu2 - 3mu - 3m + 172pu + 2u wrt u? 46546m*2p + 4m2 + 6mp Find the second derivative of -1080mw3 - 5mw2 + 112mw + 16m + 47w2 - 8w - 2 wrt w. -6480mw - 10m + 94 Differentiate 871c4 - c2 - 26c + 80076 wrt c. 3484c*3 - 2c - 26 What is the third derivative of 2o5y + 24537o4y*2 - 2o*2y*2 - 3o*2y + 4482o2 wrt o? 120o*2y + 588888oy*2 Find the second derivative of 1823h*4 - 33h*3 + 2h*2 + 608102h. 21876h2 - 198h + 4 Find the third derivative of -53616w5 + 3w*2 + 951w - 1. -3216960w2 What is the second derivative of 2g*3yz2 - g3yz - 2g*3y + 292g2yz - 187g*2y - 2gz - 84794yz*2 wrt z? 4g*3y - 169588y Differentiate -3163h*4 + 2h*3u - 69608u - 3 with respect to h. -12652h*3 + 6h*2u Find the second derivative of 2c5 + 27913c*4u*2 + 24602cu2 wrt c. 40c*3 + 334956c*2u*2 What is the first derivative of 4482772q*3 + 3831273 wrt q? 13448316q*2 What is the third derivative of 13785t*4 + 21t*3 + 1751837t*2 wrt t? 330840t + 126 What is the second derivative of 2532k3 - 104k*2 - 19762k - 5 wrt k? 15192k - 208 What is the second derivative of 3v*3 - 6520v*2 - 32798v? 18v - 13040 Find the first derivative of 224s*2y + 158s2 + y + 75462 wrt s. 448sy + 316s What is the second derivative of 9q2r*2 + 166q*2r + 3q2 + 4192qr2 - 18qr + 2r*2 wrt r? 18q*2 + 8384q + 4 What is the third derivative of -6881g4 + 9g*3 + 448173g*2? -165144g + 54 Differentiate 3912591j - 5564421 with respect to j. 3912591 What is the second derivative of -3h*2i*2k*3 + 2h*2ik2 + 60h*2i + 2h2k + 2hik3 - hik2 - 123968i*2k*3 - 8 wrt i? -6h*2k*3 - 247936k*3 Find the third derivative of -35301r*3 - 87r*2 + 58r. -211806 Find the second derivative of -27453d3y + d*2y + dy + 101642d wrt d. -164718dy + 2y What is the second derivative of 34862x*4 - 27923x wrt x? 418344x2 What is the third derivative of -86371g*3 - 67706g2? -518226 What is the second derivative of g3 - 5007g2x - 4298gx + 6x wrt g? 6g - 10014x Find the second derivative of -4du3 + 3185du - 196d - 8044u3 + 3u wrt u. -24du - 48264u Differentiate c2n + 68c2 + cn*4 + c - 34437n + 1348 with respect to n. c**2	{ "pile_set_name": "DM Mathematics" }
= 4. Let r(l) = -4k(l) + 3u(l). Determine jr(b) + zc(b). 2b + 1 Let v = 15 + -8. Let n(b) = 0 - 9b - 3b3 + 15b - 13b + 0. Let h(k) be the third derivative of k6/120 + k4/12 - 5k*2. Calculate vh(d) + 2n(d). d3 Let n(t) = t. Let h(b) = 46. Calculate -h(y) + n(y). y - 46 Let g(h) be the second derivative of -2/3h*3 + 0 + 4h + 1/2h2. Let u(j) = -9j + 1. Give 5g(t) - 2u(t). -2t + 3 Let a(o) = o3 - 3o*2 + 3o + 1. Let r(c) be the third derivative of c5/30 - c4/12 - c*3/3 + 32c*2. Suppose -10 = -k - 8. Determine ka(y) + 3r(y). 2y*3 - 4 Let o(q) = -12q*3 - 13q*2 + 11q. Let v(p) = 80p3 - 39p*3 + 6p*2 - 35p*3 - 5p. Determine 6o(h) + 13v(h). 6h3 + h Let s(p) = p3 + 21p*2 + 37p - 23. Let j be s(-19). Let q(b) = 0b2 + 2b*2 - 9 + 0b*2 + 5. Let c(m) = -4m*2 + 9. Determine jc(i) - 9q(i). -2i*2 Let n(k) = k + 2. Let p = 47 - 51. Let z(c) = 6c + 11. Give pz(t) + 22n(t). -2t Let r(i) = 24i + 8i - 10 - 2. Let s(h) = h2 + 3h - 66. Let p be s(-9). Let k(v) = -13v + 5. Determine pk(j) - 5r(j). -4j Let f(j) = -5j - 7. Let o(l) be the second derivative of -l3/2 - 2l*2 + 10l. Suppose -45 = 4w + 5p + 19, 2w = 3p - 10. Give wo(k) + 6f(k). 3k + 2 Let n(j) = 23j*2. Let t(g) = -323g*2. Suppose -37l - 4u - 4 = -34l, -4l - 5u = 4. Calculate lt(q) + 57n(q). 19q2 Let a(t) = -23t*2 - 4t - 18. Let v(u) = -u*3 - 22u*2 - 3u - 13. Determine -3a(h) + 4v(h). -4h3 - 19h*2 + 2 Let l(q) = 7q. Let h(j) = j. Let c(v) = 6h(v) - l(v). Let a(g) = 2g*2 - 5g + 3. Let f = 10 + -11. Determine fa(s) + 5c(s). -2s2 - 3 Let y(c) = -2c*2 - 2c - 4. Let w(l) = l*2 + 3l + 5. Let g(p) = p*3 - 9p*2 - 9p - 13. Let d be g(10). Determine dy(o) - 2w(o). 4o2 + 2 Let b(q) = 9q*2 - 2. Let r(l) = 2l2 + l - 3. Let w(n) = -n2 - n + 4. Let c(j) = r(j) + w(j). Determine b(y) + 2c(y). 11y*2 Suppose -20c + 5c = 60. Let y(b) = 5b + 4. Let r(n) = -5n - 3. Calculate cr(g) - 3y(g). 5g Let m = -961 - -966. Let u(g) = 0g2 + 8g2 + 5 - g2. Let a(t) = -10t2 - 7. Give ma(x) + 7u(x). -x2 Let f(u) = 17u + 7. Let x(w) = 2w - 1. Give f(m) + x(m). 19m + 6 Let i = 319 + -149. Let p(k) = 174 + k - 340 + i. Let l(t) = -t - 3. What is 3l(g) + 2p(g)? -g - 1 Suppose 0 = -80l + 84l - 4. Let c be -5 - (3 + -5)l. Let f(t) = -3t - 4. Let v(s) = 4s + 5. Determine cf(x) - 2v(x). x + 2 Let a(o) = 2o*3 + 5o2 - o + 5. Let i(w) = -w3 - w*2 - 1. Let u be (15/6)/((-3)/(-12)-2). Give ui(k) - a(k). 3k*3 + k Let k(t) = -3t - 2. Let l(j) be the third derivative of -2j4/3 - 5j3/3 + j2 + 30j. Give -14k(d) + 3l(d). -6d - 2 Let b(s) = -s3 + s2 + s. Let l(j) = -7j3 - 4j. Let n(z) = -2b(z) + l(z). Let t = 979 - 985. Let h(w) = -w3 - w. Give th(g) + n(g). g*3 - 2g*2 Let j(a) = 9a - 3. Let n(h) = 10h - 3. What is -7j(s) + 6n(s)? -3s + 3 Let y(i) be the first derivative of i*3/3 - 8i*2 + 29i + 39. Let d be y(14). Let m(x) = -2x - 2. Let s(u) = 1. Determine dm(a) + s(a). -2a - 1 Let o(x) = 2x*2 - 2x + 1. Let v(i) = 19i2 - 9i + 14. What is 4o(q) - v(q)? -11q*2 + q - 10 Let t(s) = -3s*2 + 2s - 2. Let h(p) = 5p - 3p - 6 + 2p + 8p - 10p2 - 5p. Suppose -2j - 1 - 3 = 0. Calculate jh(q) + 7t(q). -q2 - 2 Suppose 3d = -5o + 10, 5d + 30 = -21o + 22o. Let t(z) = -8z3 - 10. Let v(p) = 3p*3 + 4. Determine ot(x) + 12v(x). -4x*3 - 2 Let k(n) = 0n*3 + 2n*3 + 0n*3. Let f(i) = -28 + 2i*3 + 28 - 8i*3. Suppose 3q + 0l + 22 = 5l, 0 = -5l - 20. Give qk(p) - 5f(p). 2p*3 Suppose -117h + 39h = -234. Let p(d) = -7d*2 + 2d + 7. Let y(l) = 6l2 - l - 6. Determine hp(q) + 4y(q). 3q*2 + 2q - 3 Let f(v) = 8v2 - 24v + 24. Suppose -63c = -61c + 2. Let i(a) = a*2 - a + 1. Give cf(s) + 24i(s). 16s*2 Let t(a) = -14a*2 - 6a - 6. Let y(w) = 7w2 + 12w - 3. Let v(s) = 11s2 + 19s - 5. Let m(k) = -5v(k) + 8y(k). Determine -6m(b) - t(b). 8b*2 Let v(m) = -2m*2 + 7m + 8. Suppose 0 = 5p - 25n + 22n - 24, n - 3 = -2p. Let s(c) = c*2 - 3c - 4. Give pv(q) + 7s(q). q*2 - 4 Let n(x) = -1. Let r(f) = -4f + 4. Let j(d) = d - 2. Let b(t) = 3j(t) + r(t). Determine b(v) - 3n(v). -v + 1 Let n(w) = -6w2 + 9w + 3. Let z(b) = 5b2 - 8b - 3. Suppose -49 = 5u - 14. Give uz(q) - 6n(q). q2 + 2q + 3 Let q(o) = -5o - 3. Let h(l) be the first derivative of 3l*2 + 4l - 4. Let r(f) = -6h(f) - 5q(f). Let d(t) = -5t - 4. Determine 7d(g) - 3r(g). -2g - 1 Let m(z) = -15z2 + 6z - 6. Let l(w) be the first derivative of w3/3 - w2/2 + w + 272. What is -6l(t) - m(t)? 9t*2 Let i(a) = 2a + 1. Let s(w) = -w - 1. Let x be 2/(2/(4 + -2)). Let n(h) = -45h + 50h - 5 - x. Let t be n(2). Calculate ti(m) + 5s(m). m - 2 Let n = 210 - 215. Let o(f) = 7f3 - 5f*2 + 5f - 5. Let c(i) = 60i3 - 42i*2 + 42i - 42. What is nc(p) + 42o(p)? -6p3 Suppose 95o - 88o - 7 = 0. Let u(b) = -2b*3 - 6b2 - b. Let x(a) = -a2 + a. Give ox(k) + u(k). -2k*3 - 7k*2 Let l(w) = -2w*2 + 2w + 2. Let b(d) = -d*2 + 4d + 52. Give -b(t) + 2l(t). -3t*2 - 48 Let a(x) = 860x2 - 1290. Let r(v) = -v2 + 2. What is a(o) + 645r(o)? 215o*2 Let n(g) = -3. Let v(j) = 37j*2 - j - 14. Calculate 4n(b) - v(b). -37b2 + b + 2 Let b(d) = 2d*2 + 35d + 118. Let w be b(-13). Let r(s) = -7s - 6. Let g(z) = -z - 1. What is wr(n) - 5g(n)? -2n - 1 Let n be -3 - (-1 - (-1 + -1)). Let q(t) = 62 + 61 + 94 - 220 - 5t. Let x(f) = -2f - 1. Determine nq(i) + 9x(i). 2i + 3 Suppose 145o + 6 = 143o. Let a(f) = -f2 - 3f + 4. Let r(u) = -u*2 - 3u + 5. Determine oa(w) + 2r(w). w*2 + 3w - 2 Let s(b) = -11b2 - 2b - 4. Let d(z) = z3 - z2 - z - 1. Calculate 2d(i) - s(i). 2i*3 + 9i*2 + 2 Let f(o) = -4o - 1. Let h(t) = 11t + 3. Suppose 3u - 207 = -2y - 640, -3u = 3y + 432. Let p be (3/(-5))/((-29)/u). Determine ph(r) - 8f(r). -r - 1 Suppose 4w = 5n - 7, -5w + 0w = 4n - 22. Let h(c) = 3c + c - 4 + wc - 3c. Let g(y) = 9y - 11. Determine 6g(s) - 17h(s). 3s + 2 Let i = -2211 - -2207. Let l(a) = -3a*3 - 4a*2 + 5a - 5. Let s(c) = 7c3 + 9c*2 - 11c + 11. Determine is(w) - 9l(w). -w*3 - w + 1 Let v(s) = -s + 1. Let y(w) = -1. Let l(m) = -2v(m) - 2y(m). Suppose 2h - 205 = -189. Let n(z) = -5z - 1. Determine hl(b) + 3n(b). b - 3 Suppose -36g - 7 = -29g. Let w(j) = -1. Let x(l) = -2l + 2. Determine gw(c) - x(c). 2c - 1 Let d(j) be the third derivative of j4/6 + j3/6 + 186j2. Let v(k) = -3k - 5. Let u(c) = -c - 2. Let b(w) = 5u(w) - 2v(w). Give -6b(m) + 2d(m). 2m + 2 Let l be 0 + -1 - (-2 + 0). Let u = -91 - -89. Let g(w) = w - 1. Let n(f) = 4f - 3. What is ln(c) + ug(c)? 2c - 1 Let h(n) = -3n*2 - 1. Let m(o) = -43o*2 + o - 4. Calculate 2h(y) - m(y). 37y2 - y + 2 Let l(u) = u - 1. Let c(q) = q3 + q2 + 3q - 1. What is 2c(f) + 2l(f)? 2f3 + 2f*2 + 8f - 4 Let t(i) = -3i2 - 2. Let x(r) = 3r*2 + r. Let p be x(-1). Suppose -n + 9 = pn. Suppose -nk = -k + 10. Let a(j) = -6j*2 - 5. Calculate kt(b) + 2a(b). 3b*2 Let m(q) = 8q*3 - 6q*2 + 2q + 73. Let y(p) = -7p3 + 5p*2 - 2p - 72. Determine -5m(s) - 6y(s). 2s3 + 2s + 67 Let j(p) = 19p - 57. Let c(r) = -72r + 228. Give -4c(h) - 15j(h). 3h - 57 Let r(o) = 2o2 + 17 - o3 - 4o2 - 6o*2 - 23o - 31o3 + 2o*2. Let l(i) = -11i*3 - 2i*2 - 8i + 6. Calculate -17l(f) + 6r(f). -5f3 - 2f*2 - 2f Let r(o) = -20o + 8. Let q(u) = 1458u + 8756. Let a be q(-6). Let z(c) = -c - 1. Let b(p) = -17p + 1. Let n(j) = b(j) - 4z(j). What is an(k) - 5r(k)? -4k Let r(s) = -2s + 26. Let v(w) = 7w - 101. Determine -22r(u) - 6v(u). 2u + 34 Let w(x) = -65x2 - 47x - 13. Let s(k) = 13k2 + 9k + 2. Let q(l) = 11s(l) + 2w(l). Let u(n) = -39n2 - 14n + 11. Calculate 11q(d) + 4u(d). -13d2 - d Let b(h) = -2h3 - h2 - 7h + 7. Let z(s) = -s3 - s2 - 3s + 4. Give 3b(y) - 5z(y). -y*3 + 2y*2 - 6y + 1 Let k(l) = 2l + 2. Let g(t) = -89t - 4. Give g(o) + 3k(o). -83o + 2 Let h(a) = -2 + 5a2 - 4 - 1 + 7a + 2. Let k(p) be the first derivative of 2p3/3 + 3p*2/2 - 2	{ "pile_set_name": "DM Mathematics" }
- 3). List the prime factors of ((-2)/(-4) - -1)/((-12)/g). 2, 3 Let c = 10081 + -5267. List the prime factors of c. 2, 29, 83 Let n(v) = 7v3 - 8v*2 + 6v - 5. What are the prime factors of n(4)? 3, 113 Let h(w) = -3w - 1. Let m be h(-2). Suppose 5t - 6 - m = 2l, 0 = -2l + 3t - 13. What are the prime factors of ((-492)/48)/(2/l)? 41 Suppose -3270 = -64o + 59o. What are the prime factors of o? 2, 3, 109 Suppose 0 = 3g + 5h - 2h - 252, 0 = -3g - 2h + 254. What are the prime factors of g? 2, 43 Let d(m) = m*3 + 11m*2 + 9m - 7. Let u be d(-10). Suppose 0 = -ub + 13 + 74. List the prime factors of b. 29 Let v(y) = y3 - 6y - 6. Let c(b) = b + 1. Let s(i) = -3c(i) - v(i). What are the prime factors of s(-3)? 3, 7 Let o be 2 + -3 - -3 - 29. Let v = o + 48. List the prime factors of v. 3, 7 Suppose 0 = 5p - 20, 27p - 8696 = -4z + 30p. What are the prime factors of z? 7, 311 Let z(s) = -s3 - 24s*2 + 211s + 64. List the prime factors of z(-31). 2, 5 Let m = -3977 - -6934. What are the prime factors of m? 2957 Let k = -16 + 13. Let t be 6/k + 180/2. Suppose t = 5c - c. What are the prime factors of c? 2, 11 Let d = 6717 + -2210. List the prime factors of d. 4507 Let s(n) be the third derivative of n6/120 + n5/15 + n4/12 + 2n*3/3 - 2n*2. Let f be s(-4). Let b = f - -6. List the prime factors of b. 2 Let o(w) = 5w*2 + 6w + 20. List the prime factors of o(-7). 223 Let u be 93 + (-4)/(-1). Suppose -w + u + 16 = 0. List the prime factors of w. 47 Suppose -h + 1422 = -477. List the prime factors of h. 3, 211 Suppose -n + 2n = 0. Let f be 2/(4/(-2)) + n. List the prime factors of 28 + 1 + -1 + f. 3 Let c = -101 + 159. Let b(v) = 8v + 20. Let l be b(-6). Let k = c + l. What are the prime factors of k? 2, 3, 5 Suppose 4 = -2t, n + 3t - 365 = 99. What are the prime factors of n? 2, 5, 47 Let z = 41 - -123. Let a = -100 + z. What are the prime factors of a? 2 Suppose 11z - 12z - 8 = 0. List the prime factors of (z/6)/(14/(-735)). 2, 5, 7 Let u = 7 + -4. Suppose un = -10 + 4. List the prime factors of (-2 - -12) + 4/n. 2 Suppose 0 = 2k + 7k. Suppose ky + 2y - 6 = 0. Suppose -2g = yg - 360. What are the prime factors of g? 2, 3 Suppose 854 = 5r - 2871. Suppose 5v + 2b = r, -5b + b = 0. List the prime factors of v. 149 Let y = 0 - 22. Let x = y + 38. Suppose 9q = 8q + x. List the prime factors of q. 2 Suppose -9i = 2r - 8i - 395, r - 4i - 220 = 0. What are the prime factors of r? 2, 5 Let v(i) = 3i2 - 10i - 29. What are the prime factors of v(-6)? 139 Let p(t) be the second derivative of t5/10 - t4/2 + t3 - t2/2 - 3t. Let m be p(4). Suppose 11l - 6l = m. List the prime factors of l. 11 Let t = -906 + 1046. What are the prime factors of t? 2, 5, 7 Suppose b + 4x - 190 = 0, 3b + 190 = 4b + 2x. Let z = -95 + b. What are the prime factors of z? 5, 19 Let p(r) = -12r + 5. Let m be p(-4). Suppose 0 = -3y + o + 420, -m - 244 = -2y - 5o. List the prime factors of y. 3, 47 Let l = -21 - 0. What are the prime factors of 2/(-3) - 749/l? 5, 7 Let x(l) = l3 + 6l*2 + 4l + 26. Let s be x(-6). List the prime factors of (1/4s)/((-3)/(-696)). 2, 29 Let a(z) = 624 - 2z - z - 589. What are the prime factors of a(6)? 17 Let i(z) = z*3 + 15z*2 + 11z - 22. Let s be (1/(-2))/(-4 - 339/(-84)). What are the prime factors of i(s)? 2, 5 Suppose -3r + 2 = -2r. Suppose rv + 0i = -4i - 6, 15 = -v - 5i. List the prime factors of ((-4)/(-5))/(v/50). 2 Suppose 7287 = 5l + 3m + 1384, -m - 3539 = -3l. Let k be 6/21 + l/35. List the prime factors of k/3 + 22/33. 2, 3 Let r be 34/10 - 4/10. Suppose 21i + 11 = 53. Suppose 5a - 119 = -im, 5a - 123 = -rm - m. What are the prime factors of a? 23 What are the prime factors of ((-30)/12 - -1)/((-10)/18700)? 3, 5, 11, 17 Suppose -n = b + 4, 4b - 2b + 4 = 2n. Let d(t) = -2t + 34t2 - 14 + t + 12. What are the prime factors of d(n)? 3, 11 Let f = 1597 + -1599. Let x(d) = 0 - 2d - 3d + 3d*2 - 5. List the prime factors of x(f). 17 Suppose 5l = 3v - 0l - 71, 5l = v - 7. Suppose vz + 81 = 33z. What are the prime factors of z? 3 Suppose -2k + 9 = k, k - 15 = 3v. What are the prime factors of ((-202)/v)/(3/(-12)-1)? 2, 101 Suppose -19d + 27252 = 1849. What are the prime factors of d? 7, 191 Suppose 2u + 0u + 2456 = 4r, 4u = -3r + 1853. List the prime factors of r. 3, 5, 41 Let r(l) = 125l2 + 24l - 87. List the prime factors of r(4). 7, 41 Suppose 3l - 5663 = 1045. List the prime factors of l. 2, 13, 43 Let h = -275 - -377. What are the prime factors of h? 2, 3, 17 Let m(r) = r2 - 19r - 14. Let y be m(9). Let v = y - -168. List the prime factors of v. 2 What are the prime factors of 477/(-636)11048/(-3)? 2, 1381 Suppose 0 = -11k + 52k - 29397. List the prime factors of k. 3, 239 Let s(g) = 22g*3 + 2g*2 - 2g - 2. Let c be s(-2). List the prime factors of (-3 + 2)1/(2/c). 83 Let m(z) = 11z - 2 - 3 - 9z. Let h be m(12). Suppose 3n - h = 41. List the prime factors of n. 2, 5 Let c = -862 + 1232. Suppose -5z - q = -621, z + 2q + c = 4z. List the prime factors of z. 2, 31 Suppose 1349g - 1357g = -232. List the prime factors of g. 29 Let j(k) = k + 1. Let w be j(2). Let b = 0 + 3. Suppose -4q = -6s + 3s - 25, -wq + 24 = bs. List the prime factors of q. 7 Suppose 2c - 5u = -c + 3873, -2c + u = -2575. List the prime factors of c. 2, 643 Let g = 773 - -243. What are the prime factors of g? 2, 127 Suppose -z + 32 = 2b, 5b - 81 = -0z - 2z. Let q = b + 12. Suppose 2i + q = 3i. List the prime factors of i. 29 Let y(r) = r3 + 43r*2 + 93r + 8. List the prime factors of y(-40). 2, 17 Let i be (-17)/(-4) + 2/(-8). Suppose 3r + 0r = 3o + 21, -5r - 1 = 4o. Suppose rv = 5q - 33, -2 = -q - 0v - iv. List the prime factors of q. 2, 3 Suppose 219 = 4w - 193. Suppose 3l + w = 325. List the prime factors of l. 2, 37 Suppose 0 = 4f + f - 55. Suppose -12k = -fk - 237. List the prime factors of k. 3, 79 Let k(q) = q*3 + 6q*2 + 4q + 2. Let p be k(-2). Let b be p/4 - 1/(-2). List the prime factors of (-9)/(b - 0) + 24. 3, 7 Suppose 11v - 36 + 14 = 0. Suppose -8x - 312 = -4n - 4x, 5n = 4x + 393. Suppose f + vf = n. List the prime factors of f. 3 Let m be 1149(10 + -11). What are the prime factors of (0 - 3830/(-14)) + 308/m? 3, 7, 13 Suppose 2x + 3569 = g, 0 = -4g + 3g - 3x + 3574. What are the prime factors of g? 3571 Suppose -b - 4b = -195. Let q(o) = -o*2 - 12o - 26. Let x be q(-4). Suppose xy + b = w + y, -y = -4w + 213. List the prime factors of w. 2, 3 Let n be (36/126)/(2/14). Suppose -4m + 1030 = -nk, 1301 = 5m + 2k - 0k. List the prime factors of m. 7, 37 Let w(c) = -17c*3 - 5c*2 + 2c + 1. Let u(k) = 17k3 + 4k*2 - k. Let z(i) = -5u(i) - 4w(i). List the prime factors of z(-1). 2 Let x be (-74)/(-26) - 14/(-91). Suppose -d + 2 = -x. Suppose dc = -4b + 110, b + 0b = -c + 23. List the prime factors of c. 2, 3 Suppose -5v + 3y + 5 = 0, 0y = -5y + 25. Let s(j) = 4j2 - 2j + 3. Let w be s(4). Suppose -vn - n = -r + w, r = -n + 41. List the prime factors of r. 2, 11 Let k = -25 - -24. List the prime factors of (4 + 0 + k)12. 2, 3 Let r be (11 - 7) + 2 + -2. Suppose -63 = rz - z. Let y = z - -24. What are the prime factors of y? 3 Let i(l) = -35l - 208. Let p be i(-6). Let a be (21/(-4))/(5/(-20)). Suppose -3 = -pv + a. List the prime factors of v. 2, 3 Suppose 3z = 55z - 31720. List the prime factors of z. 2, 5, 61 Let x(c) = -c3 + 14c*2 + 17c - 12. List the prime factors of x(9). 2, 3, 7, 13 Let k(f) = 574f + 235. List the prime factors of k(6). 13, 283 Suppose -s = -4s + 9, 51 = -2f + 3s. What are the prime factors of (22/6 + 1)/(f/(-315))? 2, 5, 7 Suppose -5y - 5h + 50 = 0, -3y + 4h + 14 = -37. Suppose -f + 2d + 5 = 0, y = 3f - 4d - 8. Suppose -2j = -j - f. List the prime factors of j. 11 Let b = -90 - -230. What are the prime factors of b? 2, 5, 7 What are the prime factors of (-6590)/(-15) - 84/63? 2, 3, 73 Suppose 944o = 943o + 941. What are the prime factors of o? 941 Suppose -24n - 47518 = -47n. List the prime factors of n. 2, 1033 Let h(d) = d*3 - 16d*2 + 4d - 3. Let c = 50 - 34. What are the prime factors of	{ "pile_set_name": "DM Mathematics" }
omposite number? False Is 47546 prime? False Is 170081 prime? True Is 511369 prime? False Is 640499 composite? False Is 20914 composite? True Is 6433 prime? False Is 676723 prime? False Is 11819 a composite number? True Is 176629 prime? True Is 148091 a prime number? True Is 3341 a composite number? True Is 5003 composite? False Is 200891 prime? True Is 54479 prime? False Is 3244951 a prime number? True Is 83813 a composite number? False Is 23531 prime? True Is 17761 a composite number? False Is 3137 prime? True Is 331481 a composite number? True Is 53353 a prime number? True Is 7669 prime? True Is 103333 a composite number? False Is 166983 composite? True Is 443 a prime number? True Is 56359 a prime number? True Is 67679 a composite number? False Is 3251 composite? False Is 6349 a composite number? True Is 47407 composite? False Is 38953 a prime number? True Is 21467 a composite number? False Is 64669 prime? False Is 1763 a prime number? False Is 141829 a composite number? False Is 66221 a composite number? False Is 922 composite? True Is 110342 a prime number? False Is 3271 a prime number? True Is 2843 a prime number? True Is 1449647 a composite number? False Is 1071419 a prime number? True Is 4709 composite? True Is 76207 a composite number? False Is 388991 composite? False Is 14909 a composite number? True Is 1069 composite? False Is 18947 prime? True Is 13259 prime? True Is 11015 composite? True Is 500083 a composite number? False Is 12449 composite? True Is 356077 a composite number? False Is 32117 prime? True Is 18587 composite? False Is 4141 prime? False Is 134933 a composite number? True Is 99321 a composite number? True Is 1817 prime? False Is 12071 composite? False Is 160501 a composite number? True Is 199021 a composite number? False Is 21055 a composite number? True Is 202281 a prime number? False Is 65371 a prime number? True Is 272893 prime? False Is 30449 a prime number? True Is 199337 prime? True Is 83911 a prime number? True Is 402889 composite? True Is 1793 a composite number? True Is 7789 a prime number? True Is 217823 composite? False Is 22663 composite? True Is 2186 a composite number? True Is 13589 a prime number? False Is 312989 a composite number? False Is 136301 prime? False Is 941 a prime number? True Is 138617 a prime number? True Is 1036307 a prime number? True Is 741641 a composite number? False Is 260849 a prime number? True Is 2777 prime? True Is 4242539 a prime number? False Is 21449 a prime number? False Is 3650887 a composite number? False Is 281283 a prime number? False Is 22403 a composite number? True Is 33851 a prime number? True Is 99331 prime? False Is 106823 a composite number? False Is 6689 prime? True Is 68777 prime? True Is 158177 a prime number? False Is 10063 a composite number? True Is 1073441 a composite number? False Is 4487 a prime number? False Is 828587 composite? False Is 160807 composite? False Is 139 prime? True Is 282143 a composite number? False Is 223 a composite number? False Is 7993 a prime number? True Is 257731 a prime number? True Is 20987 a prime number? False Is 177343 a prime number? False Is 1269641 a prime number? True Is 14521 a prime number? False Is 45995 composite? True Is 21865 prime? False Is 22469 composite? False Is 1352957 prime? True Is 3499 a composite number? False Is 1517695 prime? False Is 15571 prime? False Is 255527 prime? False Is 101777 a prime number? False Is 1361 a prime number? True Is 1243111 composite? False Is 35285 composite? True Is 2153 a prime number? True Is 55429 composite? True Is 39409 prime? True Is 63419 prime? True Is 106089 a prime number? False Is 15601 a composite number? False Is 1967 a composite number? True Is 71501 a prime number? False Is 23703 composite? True Is 1973 a prime number? True Is 315509 a composite number? True Is 8383 a composite number? True Is 236377 a prime number? True Is 7235 a prime number? False Is 2309 a prime number? True Is 71387 prime? True Is 129782 a prime number? False Is 7349 prime? True Is 24763 prime? True Is 2687521 a composite number? False Is 13483 composite? True Is 53657 a prime number? True Is 3221137 prime? True Is 369743 composite? True Is 4133761 a prime number? True Is 109867 a composite number? True Is 536813 composite? True Is 235645 composite? True Is 115963 a prime number? True Is 509461 prime? False Is 45134 composite? True Is 428693 a prime number? True Is 17729 composite? False Is 1550747 a composite number? True Is 178643 a composite number? False Is 211427 prime? True Is 63197 a composite number? False Is 3410611 prime? True Is 390913 a composite number? True Is 22693 a composite number? True Is 41267 a prime number? False Is 214121 prime? False Is 2833 composite? False Is 19031 composite? False Is 556211 prime? True Is 529213 prime? True Is 725501 a composite number? True Is 108391 prime? False Is 59159 a composite number? False Is 11537 a prime number? False Is 22739 composite? False Is 200227 prime? True Is 85049 a prime number? True Is 26473 prime? False Is 125459 composite? True Is 641 prime? True Is 3079 composite? False Is 18839 a composite number? False Is 12889 prime? True Is 386887 composite? False Is 26 a composite number? True Is 25693 composite? False Is 1524259 a composite number? True Is 35023 prime? True Is 81053 composite? True Is 17211 prime? False Is 305341 prime? False Is 394046 a composite number? True Is 100999 prime? True Is 8944691 a composite number? True Is 2631 a prime number? False Is 7121 composite? False Is 215893 a composite number? False Is 45281 a composite number? False Is 103099 a prime number? True Is 150743 composite? False Is 16886 composite? True Is 109333 composite? True Is 2219 composite? True Is 73493 a composite number? True Is 8033 a prime number? False Is 353099 a prime number? True Is 229193 a composite number? True Is 1682329 composite? True Is 1144927 composite? True Is 74687 a composite number? False Is 22291 a composite number? False Is 14767 a composite number? False Is 35201 a composite number? False Is 62663 composite? True Is 22337 a composite number? True Is 248917 a prime number? False Is 1409335 composite? True Is 1361 composite? False Is 68557 composite? True Is 673 composite? False Is 578353 a composite number? False Is 4037 prime? False Is 34459 prime? False Is 37423 prime? True Is 107021 a prime number? True Is 1710505 a composite number? True Is 817 a prime number? False Is 205079 composite? True Is 170497 composite? False Is 70723 a prime number? False Is 87473 prime? True Is 58031 a composite number? False Is 72445 a prime number? False Is 2081 composite? False Is 36415 a prime number? False Is 466853 composite? False Is 23 a composite number? False Is 42953 composite? False Is 146513 prime? True Is 295 a composite number? True Is 921 a prime number? False Is 444579 composite? True Is 43133 a prime number? True Is 27329 a prime number? True Is 552889 a composite number? True Is 80299 composite? True Is 235615 prime? False Is 797 prime? True Is 9811 prime? True Is 257591 a prime number? True Is 967 a prime number? True Is 989441 a prime number? True Is 869 composite? True Is 81071 prime? True Is 869905 a prime number? False Is 1355 a prime number? False Is 18527 prime? False Is 10687 composite? False Is 3943 prime? True Is 131381 composite? False Is 3389 prime? True Is 34793 prime? False Is 5581 a prime number? True Is 541 a prime number? True Is 2909 a composite number? False Is 33037 prime? True Is 153817 a prime number? True Is 52339 a composite number? True Is 1331619 a composite number? True Is 2963 a prime number? True Is 112459 a composite number? False Is 2676259 a prime number? False Is 3295 prime? False Is 20861 a composite number? True Is 2978429 prime? True Is 11549 prime? True Is 118387 composite? False Is 47491 prime? True Is 162511 a composite number? True Is 41047 prime? True Is 195989 composite? True Is 216259 prime? True Is 55501 prime? True Is 441421 a prime number? True Is 399851 a composite number? False Is 8761 a composite number? False Is 5801 a composite number? False Is 16547 composite? False Is 4897 a prime number? False Is 235453 prime? False Is 4667 composite? True Is 10427 prime? True Is 9	{ "pile_set_name": "DM Mathematics" }
. -1 Let o be (-2 - -6 - 1) + -2. Let s be o/((-5)/(-90)-3). Let h(w) = -3w - 19. Let u be h(s). Let l(t) = 6t2 - t - 1. Determine l(u). 6 Suppose 6h = 2h + 16. Suppose -h = -5j + 3j. Let v(c) = 3c*j - 2c*3 - 4c + 2 + c*2 + 0c*3. Give v(2). -6 Let r(p) = 1 + 0p*2 - 9p + 18p + 5 + p2. Let j be (-10)/30 + (-17)/3. Calculate r(j). -12 Let u(m) = m2 + 13m + 4. Let w be u(-6). Let t = -33 - w. Let c(b) = -b*3 + 4b*2 + 6b - 7. What is c(t)? -2 Let g(h) = -4 + 6 + 4h - h2 + 5 + 0h*2. Give g(5). 2 Let a(b) = -15b + 72. Let p(i) = 14i - 61. Let t(r) = -6a(r) - 7p(r). Give t(-10). 75 Let s(a) = -a3 + 3a*2 + 5a + 2. Suppose 13h + 12 = 3q + 9h, 3h = 0. Determine s(q). 6 Let i be 0 + 172/42 - 4/42. Let r(v) = -v*2 + 10v - 9. What is r(i)? 15 Let z(n) be the first derivative of -1/2n2 + 2n + 42. Give z(2). 0 Suppose -2w + 0w + 0w = 0. Let u(o) = -o + 1. Let n = -9 - -15. Let i(h) = 1. Let s(j) = ni(j) + u(j). Calculate s(w). 7 Let c(n) = -6n. Let q(f) = 7f + 1. Let k(m) = -m*2 + 4m + 7. Let r be k(6). Let s(o) = rq(o) - 6c(o). Determine s(4). -1 Suppose 3z - 4s - 22 = 2z, -2z = -3s - 59. Let w(c) = -z - c2 - c + 26 - c3 - 6c2. What is w(-7)? -1 Let z(m) = m3 - 4m2 - 2m - 7. Let w be z(5). Let f be (w/12)/((-1)/(-9)). Let s(y) = 8y2 - fy + 7 - y*2 - 6y*2. Determine s(5). 2 Let v(g) = -g - 2. Suppose 2f = 3a - 79, 0 = 5a + 5f + 5 - 145. Suppose 0 = -5h + 3l - 2l - 15, a = -3h - 3l. Calculate v(h). 2 Let u be ((-70)/35)/((-2)/(-3))-1. Let m(j) be the first derivative of 1/2j*2 + uj + 1. Determine m(-3). 0 Let m(s) = -2s + 1. Let r be m(-2). Suppose rb + 8 = 2p, b = 5p + 2b - 20. Let f(n) = 14n + n*3 - 8n - 3 - 2n3 + 3n2. Calculate f(p). 5 Let z be 1/3 + (-44)/(-12). Let n(q) = q3 - 4q2 + q - 1. Let m be n(z). Suppose -ml = 3w + 15, 5l - w + 33 = 2w. Let x(a) = a2 + 8a + 4. Give x(l). -8 Let l(c) = 3c - 19 + 13c - 6c - c2. Let h be l(6). Let r(u) = -u2 + 2u + 6. What is r(h)? -9 Let d(l) = -5l2 + 6l - 3. Suppose -40 = -403t + 393t. What is d(t)? -59 Let v(k) = -k*3 - 4k*2 - 11k + 2. Let r(j) = j*3 + 3j*2 + 10j - 2. Suppose 0 = -9h - 25 - 38. Let l(t) = hr(t) - 6v(t). Let z = -1 - -4. Give l(z). -10 Let u(h) = -5h*2 - h. Let c be 4 - (4/1 + -32). Suppose -4w + c = -2w. Let d = 17 - w. Determine u(d). -6 Let w = -43 - -51. Let a be (w/10)/((-8)/(-5) + -2). Let s(j) = -j - 2 + 0 - 3 + 4. Give s(a). 1 Let h(d) = -7d*2 + 11d - 1. Let t(v) = v*2 - v. Let z(a) = -h(a) - 6t(a). Suppose -109 + 13 = -24u. Give z(u). -3 Let g be -6 + (-8 - (-40)/((-24)/(-6))). Let x(u) = u3 + 5u*2 + 3u + 3. What is x(g)? 7 Let z(r) = -15r2 - 8r + 3. Let s(v) = 23v2 + 12v - 4. Let w(j) = -5s(j) - 8z(j). Let g(t) = t*2 + 1. Let p(x) = -4g(x) + w(x). What is p(-6)? 4 Let q(a) = -4a + 3. Let f(h) = -6h + 5. Let u(o) = 5f(o) - 7q(o). Suppose -1 = 3b + 14. Let j = -8 - b. Give u(j). 10 Let m(l) = -58l + 2. Suppose 2c - 3n = -1, 18n - 6 = -2c + 14n. Calculate m(c). -56 Let q(t) = 2t*3 - 17t*2 - 8t - 14. Let x(b) = b*3 - 8b*2 - 4b - 6. Let r(g) = -4q(g) + 9x(g). What is r(5)? 7 Let b be 8/((-10)/5) - -4. Let y(w) = 2w - 30. Determine y(b). -30 Let l = -79 + 79. Let x(n) = -12n*2 + ln*3 - 10n + 17 - 24 + n*3 - 2n. Determine x(13). 6 Let l = -725 + 725. Let v(r) be the third derivative of 0r + l + 1/120r*6 + 7r*2 + 0r*4 + 0r*5 + 1/3r*3. What is v(2)? 10 Let q be 5((-4)/30)/(12/(-1818)). Suppose -q = 4w - 77. Let a(v) = -v - 14. Determine a(w). -8 Let k(z) = -2z - 263 + 131 + 130 + z. Give k(-11). 9 Let j(l) be the third derivative of l5/60 - l4/24 - 2l3/3 - l2. Suppose 13 = -y - 3. Let i = y + 16. Calculate j(i). -4 Let h = -2 - 1. Let b(t) be the first derivative of t2/2 + 2t + 4. Let p(n) = n. Let v(x) = -b(x) - 4p(x). Give v(h). 13 Let w(a) = -3a*3 + 3a*2 - 16a + 1. Let n(y) = -2y3 + y2 - 9y. Let x(t) = 7n(t) - 4w(t). Calculate x(-4). 40 Let h(a) = a*2 + 7a + 1. Let o = 1 + -1. Let u(z) = z*2 + 4z + 12. Let y(p) = p*2 + 5p + 14. Let n(l) = -4u(l) + 3y(l). Let d be n(o). Determine h(d). -5 Let q(h) be the third derivative of h*5/60 - 7h4/24 + h3/2 - 125h2. Calculate q(4). -9 Let t(z) = -z3 + 9z*2 - 14z + 3. Let w(v) = -v*2 - 10v + 238. Let h be w(11). Calculate t(h). 3 Let s(x) be the first derivative of -x*4/4 - 2x3 - x2/2 + 1. Let j be 1046/(-10) + 28/(-70). Let f be 660/j + 4/14. What is s(f)? 6 Let x(m) = 3m - 2. Let t(y) be the first derivative of -7y*2/2 + 4y - 5. Let d(i) = -2t(i) - 5x(i). Let v be 0/(-3)3/(-6). Calculate d(v). 2 Suppose 0 = -4x + 13x + 261. Let s = 37 + x. Let l(w) = 2w - 10. Calculate l(s). 6 Let m(c) be the second derivative of 0c3 + 0 - 1/720c*6 + 0c*2 - 1/12c*4 + 3c - 1/30c5. Let g(u) be the third derivative of m(u). Give g(5). -9 Let a be (-6)/(-27) + (-50)/(-18). Let w(o) = o3 - o3 + 1 - oa - 2o - 5o2 + 2. Let p be 4/10 - (-27)/(-5). Give w(p). 13 Let l(m) = -29m*2 + 3m + 34m2 + m3 + 0m*3 - 2m - 7. Calculate l(-5). -12 Let o(x) = 2x2 + 26x - 3x2 - 27x + 0x2. Let g(f) = -6f*2 - 2f + 3. Let l(d) = g(d) - 5o(d). Suppose 0 = -2q + q - 2. What is l(q)? -7 Let a(s) = -s*2 + 5s. Suppose 0 = h - 2n + 8, 4h + 20 + 4 = 4n. Let j(d) be the third derivative of d5/60 + d4/8 + 8d*2. Let k be j(h). What is a(k)? 4 Let d(t) be the first derivative of -3t*2/2 + 96t + 288. What is d(29)? 9 Let q(r) = 2r2 - 4. Let x(v) = -v2 + 3. Suppose 37j + 4 = 35j. Let y(m) = jq(m) - 3x(m). Determine y(-1). -2 Let b = -2 - 34. Let p = b + 38. Let j(s) = 1 + 2 - s3 - 2s + 2s3. Calculate j(p). 7 Suppose 4k + 3s - 59 = 0, 5k - 3s - 72 = -5s. Let i = k - 14. Let h(t) = 2 - t + 8 - 1 - 5. What is h(i)? 4 Let s(q) = -7q - 81. Let m be s(-11). Let y(k) = -3k*2 - 5k + 1. Give y(m). -27 Suppose -a - 4 + 7 = 0. Suppose -10g - 2 = -11g. Let o(f) = 347f2 + f3 - 352f*2 - g + 6 + 2f. Give o(a). -8 Let q(c) = -c*3 - 3c*2 + 4c - 2. Let b be q(-4). Let l(t) = 5t2 - 1 + 508t*3 + 5t*2 - 7t*2 - 509t*3. Give l(b). 19 Let d(x) = 2x + 2. Let y = -11 - -17. Suppose 5p = 2p + y. What is d(p)? 6 Let d(v) = -9v + 6. Let z(o) = 8274 - 8274 - o. Let l(w) = -d(w) + 4z(w). Give l(5). 19 Suppose 10m = 6m + 8. Suppose -5i = -2i + 4k - 34, 17 = mi - 3k. Let n(w) = 2w - 12w + w + iw + 3. What is n(-8)? -5 Let h(j) = 2j2 - j + 1. Let v(f) = 5f*2 - 3f + 19. Let z(m) = 3h(m) - v(m). Give z(0). -16 Suppose 0 = 14i + 462 - 602. Let z(w) = -3w + 13. What is z(i)? -17 Let x(a) = -3a + 7. Let r(f) = -f + 3. Let d(s) = -2r(s) + x(s). Determine d(5). -4 Let i(f) = 14f*2 + 17f - 5. Let u(v) = -5v2 - 6v + 2. Let b(h) = 4i(h) + 11u(h). Let q(z) = -z*3 - 11z*2 + 13z + 8. Let n be q(-12). Give b(n). 10 Let i(c) = c - 3. Let n(j) = -j. Let z(p) = -3p + 4. Let m(h) = -4n(h) + z(h). Let g be m(-6). Let v(d) = -d + 2. Let q(o) = gi(o) - 3v(o). Calculate q(-4). -4 Let y(q) = 2q - 14. Let h(s) = -1. Let d(j) = 42h(j) - 3y(j). Let c be d(-1). Let k(a) be the second derivative of a3/3 - 3a*2/2 - 2a. Calculate k(c). 9 Suppose -2w - 140 = m, -4m + 3w = 5w + 590. Let r be 1/(-6) - m/(-180). Let v(i) = -4i3 - i. Determine v(r). 5 Let m(y) be the third derivative of -y6/120 + y5/10 - y4/8 - y3/6 - 21y*2. What is m(6)? -19 Let j(n) = -3n. Let i be j(-1). Suppose -3v + 2a = -14, -2v + 3a + 7 = -9. Let y(m) = -im + 2m - 9 + v. Determine y(-5). -2 Let i(k) be the second derivative of -k*5/20 - 7k*4/6 - 2k*3 + 4k*2 - 5k - 10. What is i(-13)? -5 Suppose 44r - 36 = 8. Let k(f) = 10f - 7. What is k(r)? 3 Let q(r) = r*2 - 12r. Suppose 93 = 14a - 75. Determine q(a). 0 Suppose 0 = 3k + 15, 3k + 42 = 4l + k. Suppose -lh = 14h + 110. Let d(z) = z*3 + 5z2 - z - 5. Calculate d(h). 0 Let s be (40/(-16))/((-1)/(-2)). Let i(y) = y2 + 9y + 10. Give i(s). -10 Let j(g) = 0 - 4 + g + 7. Let r be j(6). Let k(u) = -3u + 5. Let h(t) = 7t - 11. Let c(l) = rk(l) + 4h(l). Determine c(6). 7 Let g(a) = -a3 + 4a*2 + 4a - 4. Let k(p) = -6p3 + 19p*2 + 21p - 21. Let f = -47 + 36.	{ "pile_set_name": "DM Mathematics" }
(r) = -5r2 + 7r + 2. Let u be n(0). Sort u, 15, h. h, u, 15 Let o = -7 + 10. Suppose 2z - 3 - o = 0. Suppose 5u - 2w = 14, -4u - 3w = -u. Sort u, 0, z in decreasing order. z, u, 0 Let t = 2 - -1. Let d = -67 + 203/3. Sort t, d, 1/9 in decreasing order. t, d, 1/9 Suppose -2i + 12 = -n, 0 = -4i - 53n + 51n + 16. Let d = 1 - 3. Put d, i, -1 in ascending order. d, -1, i Let c = -16 + 18. Suppose 5y = -3a - 10, 3a - 5y - 4 = -3y. Sort a, c, 3, -3 in descending order. 3, c, a, -3 Let z = -14 + 9. Sort z, 2, -2/31, 0.3 in ascending order. z, -2/31, 0.3, 2 Let j(d) = -d*3 - 8d*2 - 13d - 7. Let r be j(-6). Let m be (r + -1)(3 - 68/24). Sort 1/5, -10, 1/4, m in decreasing order. 1/4, 1/5, m, -10 Let f(w) = -w2 + w + 2. Let g be f(-2). Suppose -4h + 2h = -3i + 40, 20 = 2i + 2h. Suppose -19 = -iy + 17. Put y, 4, g in ascending order. g, y, 4 Let b = -1503 - -1498. Put 17, b, -4, 5 in descending order. 17, 5, -4, b Let j = -0.062 - 2.538. Let w = j - -0.6. Let i = -2.8 - -3. Put i, 0.5, w in decreasing order. 0.5, i, w Let z = 3 + -5. Let p be ((-4)/(-5))/(-2)12(-5)/(-156). Let i be (-2)/(-8) - (-1)/(-2). Put i, p, z in ascending order. z, i, p Let d(f) = f3 + 13f*2 + 11f - 9. Let v be d(-12). Let i be (-20)/(-2) + 0/2. Suppose k = -4s + 8, 5s = -k - 0s + i. Sort k, -1, v. -1, k, v Suppose 17x = 23x + 12. Let b be (-8)/20 - 90/25. Put b, x, 2, 1 in increasing order. b, x, 1, 2 Let j = -915 - -912. Let q be 2/5 - (-37)/(-5). Put 1, j, q in decreasing order. 1, j, q Let r = -148 - -150.95. Let u = r + 0.05. Let c = u - 3.2. Sort c, -0.3, 1/7 in ascending order. -0.3, c, 1/7 Let o = -58.22 + 1.22. Let u = 61 + o. Let r = -2 + -3. Put u, r, -0.13 in ascending order. r, -0.13, u Let w(b) = -b2 - 10b - 17. Let p be w(-4). Let s(y) = -23 + 17 + y + 0y. Let z be s(6). Put p, z, 3 in ascending order. z, 3, p Let f = -216 + 214. Put 5, f, 7 in descending order. 7, 5, f Suppose 25 = -5a - 2i - 2i, 5a + 30 = -5i. Suppose x - p = 1, -4x - 50 + 12 = 3p. Sort x, -3, a in descending order. a, -3, x Let g = 95/12 + -23/3. Put g, -0.2, -9 in decreasing order. g, -0.2, -9 Let j = -619/762 - 8/381. Put j, 1/6, -5, 0.6 in ascending order. -5, j, 1/6, 0.6 Let l = -2 - -7. Suppose d = l - 0. Suppose -3r - 25 = 2r. Sort d, -3, r in decreasing order. d, -3, r Suppose l - 10 = 2v - 2l, -4v + 3l = 32. Suppose 0 = -4w - 3w. Suppose -3s + 3 + 0 = w. Sort s, v, 5. v, s, 5 Let c = -303 + 302.5. Put 0, 0.44, c, -5 in ascending order. -5, c, 0, 0.44 Let x(n) = -7n*2 - 20n + 7. Let y be x(-3). Sort 2, -17, y in ascending order. -17, 2, y Let q be -35 - -31 - (-6 - 2). Put 2, 62, q, -1 in descending order. 62, q, 2, -1 Let d(f) = f*2 - 21f + 18. Let m(r) = 19r + 1. Let t be m(1). Let j be d(t). Sort j, -1, -5 in increasing order. -5, j, -1 Suppose 10q = 15q + 20. Suppose -2b + 1 = -j, 5 - 20 = 5j. Let k be (-1 + b)1/(-2). Put k, 0, q in increasing order. q, 0, k Let q be 0/(76/21) - -4. Sort q, -5, 2, 131 in descending order. 131, q, 2, -5 Let o = -1.53 + -1.47. Sort 14, o, -1. o, -1, 14 Let b = 1 - 7. Let t(u) = -u - 3. Let g be t(0). Let x be 31/5 + -9 + 4/2. Sort x, b, g in increasing order. b, g, x Let b be (-3)/(-45) - 62/30. Let a be 11/5 - (-2)/(-10). Sort a, 0, b, 1 in increasing order. b, 0, 1, a Let p(w) = w3 - 5w*2 + 4w + 4. Let o be p(4). Let h = 1380 - 1382. Sort 3, o, h. h, 3, o Let p = 29 - 41. Let h(c) = -c*2 - 10c - 6. Let u be h(-9). Let q = p + u. Put q, -3, -2 in ascending order. q, -3, -2 Let u = -6 + 8. Let h(n) = n*3 - 5n*2 - 4n + 1. Let g be h(6). Let j = g + -10. Sort u, 0, j. 0, u, j Let w be (-78)/(-7 + 4) + 2. Suppose 0 = -8g - 4 - w. Put 3, 5, g in ascending order. g, 3, 5 Suppose -7h - 152 = -96. Let k be 6/(-4)(-80)/30. Sort -4, 2, h, k. h, -4, 2, k Let l = -16.6 - -13.6. Let r = -0.08 - -1.08. Put r, 2, 0, l in decreasing order. 2, r, 0, l Let q be (-4)/20 + 62/10. Let r be ((-332)/q)/((-15)/9). Let p = r - 33. Put -2/9, 4, p in descending order. 4, p, -2/9 Let y = 3 + -3. Let p(j) = -j3 + 5j*2 - 6j + 3. Let d be p(2). Let f = 6 - d. Sort y, -2, f. -2, y, f Let n = 0 - 3. Let c be (-3)/n - 2 - 4. Let h = 94.7 + -95. Put 1/5, c, h in decreasing order. 1/5, h, c Let f be ((-19)/39 - 28/(-182))-1. Let s = -8.7 + 1.7. Let q = -11 - s. Sort f, q, 3 in decreasing order. 3, f, q Let b be -1 + 1 + (1 - -3). Let v be (-4 - 66/(-24))/(1/b). Let j(y) = y - 4. Let c be j(6). Put v, 3, c in increasing order. v, c, 3 Let u = 0.03 + -0.43. Let g be ((-4)/6)/(7/(-21)). Let n = g - 12/7. Put u, 0.5, n in ascending order. u, n, 0.5 Let j(c) = -2c*3 - 15c*2 + 17c + 64. Let s be j(-8). Sort -4, 4, -2, s in decreasing order. 4, -2, -4, s Suppose o + f = -26, f - 7 = -5. Put -1, -2, 0, o in descending order. 0, -1, -2, o Let t(h) = -h*3 - 2h*2 + 24h + 62. Let n be t(-4). Put 54, 2, n in decreasing order. 54, 2, n Let u(z) = 2z2 - 4z - 9. Let a be u(6). Let s = a + -36. Put -4, 5, s in decreasing order. 5, s, -4 Suppose 3b - 8b + 153 = 4z, 6 = 3z. Let m = -14 + b. Let q be (-8)/(-6) - m/(-9). Sort q, 4, -1 in ascending order. -1, q, 4 Let p(h) = -h - 5. Let i be p(-5). Suppose 7l + 49 + 21 = i. Let y = l - -13. Put -4, y, 2 in increasing order. -4, 2, y Let t = 41 - 27. Let w = t + -13.9. Let m = 0.1 - 0.5. Put -3, w, m in ascending order. -3, m, w Let v = 6 - 7. Let g = 10 + -6. Let l be 2/(-5) + ((-4)/(-15))/4. Put l, v, g in descending order. g, l, v Suppose 3s = 6s - 3y - 12, -3y - 15 = 0. Put 1, 81, s in decreasing order. 81, 1, s Let p = 342 - 339.9. Let t = -0.9 + 0.5. Sort -4, 0.2, p, t. -4, t, 0.2, p Let g = 1.02 - -57.98. Let d = -57 + g. Put 0.03, d, -0.4, 0.5 in ascending order. -0.4, 0.03, 0.5, d Let b = 314 - 301. Sort 1/6, 2/19, b, 5. 2/19, 1/6, 5, b Let c(x) = -x3 - 2x*2 + 27x + 17. Let t be c(-6). Put t, -1/8, 5, 0 in ascending order. t, -1/8, 0, 5 Let f(c) = -c*2 - 15c - 19. Let n be f(-5). Put n, 0, 2, 1 in increasing order. 0, 1, 2, n Let f be (12/(-20) - 0)-5. Let a(w) = -4w3 - w2 - w + 1. Let o be a(1). Sort f, o, -4 in ascending order. o, -4, f Let c = 610 + -3052/5. Sort 1/6, 11.8, c in increasing order. c, 1/6, 11.8 Let t = 939 - 1644. Let y be t/(-55) + 42/44. Sort 1, -3/7, y in ascending order. -3/7, 1, y Let g = -1.999 - -1.909. Let k = 24 + -49/2. Sort k, 0.2, 0.5, g in increasing order. k, g, 0.2, 0.5 Let q = -0.05 - -3.95. Let f = -4.6 + q. Put -3/5, f, 4 in ascending order. f, -3/5, 4 Suppose -7z - 8 = -8z - 4a, 16 = -3z - 2a. Put 21, -3, z in decreasing order. 21, -3, z Let m = -28 - -68. Let n = m + -40.5. Sort 0, n, 5 in descending order. 5, 0, n Let a be (-15)/(-9) - (-4)/(-6). Let t = 13 + -16. Let k = t - -5. Sort k, -5, a in increasing order. -5, a, k Let y(b) = -3b2 - 11b - 20. Let r be y(-7). Let x be (23)/(r/(-20)). Let s be ((-1)/5)/((-3)/(-5)). Sort s, x, -2. -2, s, x Let f be (-8)/(-10) - 24/5. Put 5, -3, -16, f in ascending order. -16, f, -3, 5 Let z = 1247 - 1250. Sort z, -25, -1 in descending order. -1, z, -25 Let q = -2.48 - -2.5. Let m = q - -18.98. Let z = 26 - m. Sort 2, z, 4 in increasing order. 2, 4, z Let p = -0.047 + -15.953. Let r = p - -16.4. Put r, 5, -2/17 in decreasing order. 5, r, -2/17 Suppose 2n - 32 = -24. Let y(u) = -u*3 - 6u*2 - 6u - 6. Let g be ((-10)/(-6))/(2/(-6)). Let k be y(g). Put k, n, 8 in decreasing order. 8, n, k Let c = 15 - 40. Let h be ((-20)/c)/((-4)/(-10)). Suppose 2t + 1 = -q - 0t, q - 2t + 1 = 0. Sort q, h, -4 in descending order. h, q, -4 Let i = -337803889/1017 + 332157. Let k = i + -2/339. Sort 0.3, k, -2/5. -2/5, k, 0.3 Let l(t) = -3t*2 + 45t - 8. Let v be l(14). Let a = 203/6 - v. Sort a, -2/27, -4 in descending order. -2/27, a, -4 Let z = -187 + 2059/11. Let c(n) = n - 33. Let d be c(15). Let p be (d/(-45))/((-28)/(-30)). Sort p, z, -0.2 in descending order. p, z, -0.2 Let j = 172 + -169. Sort -0.2, -6, j, 1/2 in ascending order. -6, -0.2, 1/2, j Let j be (10/(-4))/(13/26). Suppose 0t + t = -2. Let p be 1 - (-2 + 5 + t). Put p, j, 5 in ascending order. j, p, 5 Let t(b) = -b2 + 8b + 1. Let a(s) = -s - 1. Let v(p) = -2a(p) - t(p). Let q be v(5). Sort q, -3, 9. q, -3, 9 Suppose 13o - 9 = -35. Put o, -3, -29, 2 in decreasing order. 2, o,	{ "pile_set_name": "DM Mathematics" }
xvxgfpf. 3/182 Calculate prob of sequence fr when two letters picked without replacement from rrrfffrttrftrrfrf. 3/17 What is prob of sequence oro when three letters picked without replacement from {o: 2, r: 3}? 1/10 What is prob of sequence qo when two letters picked without replacement from {q: 2, o: 1, p: 2, z: 1}? 1/15 Calculate prob of sequence ef when two letters picked without replacement from fbfebe. 2/15 Two letters picked without replacement from xxmzrxxzxzixixixxxb. What is prob of sequence zm? 1/114 Two letters picked without replacement from dzzzdddzictd. What is prob of sequence zt? 1/33 What is prob of sequence fxt when three letters picked without replacement from fxt? 1/6 Two letters picked without replacement from {q: 6, a: 2, i: 1, w: 9}. Give prob of sequence aq. 2/51 Three letters picked without replacement from {l: 7, c: 1, d: 1, s: 3}. Give prob of sequence lds. 7/440 What is prob of sequence gg when two letters picked without replacement from {y: 1, d: 4, c: 3, n: 4, g: 1}? 0 Two letters picked without replacement from wwowwwqdqoqwwo. What is prob of sequence ow? 3/26 Three letters picked without replacement from {h: 3, o: 2}. What is prob of sequence hho? 1/5 Calculate prob of sequence mr when two letters picked without replacement from fffmurmmkuvff. 1/52 Two letters picked without replacement from {m: 4, d: 4, b: 1, x: 2}. What is prob of sequence mb? 2/55 What is prob of sequence zaur when four letters picked without replacement from {z: 2, o: 3, u: 7, a: 3, r: 5}? 7/3876 Calculate prob of sequence ii when two letters picked without replacement from {i: 4, h: 2}. 2/5 What is prob of sequence rxx when three letters picked without replacement from rfgfxggrgrrxr? 5/858 Two letters picked without replacement from {m: 10, y: 9}. What is prob of sequence yy? 4/19 Calculate prob of sequence yv when two letters picked without replacement from yvyb. 1/6 Calculate prob of sequence bm when two letters picked without replacement from mbqmqmbqmqqbbmq. 2/21 What is prob of sequence qmmz when four letters picked without replacement from {m: 2, q: 8, z: 4}? 8/3003 What is prob of sequence zez when three letters picked without replacement from zezzzzzz? 1/8 Four letters picked without replacement from jhnuu. Give prob of sequence jnhu. 1/60 Calculate prob of sequence pv when two letters picked without replacement from {p: 1, m: 5, k: 1, v: 1, g: 1}. 1/72 Calculate prob of sequence yoo when three letters picked without replacement from ooyooooyoooyoooooo. 35/272 Calculate prob of sequence cc when two letters picked without replacement from {z: 2, x: 2, t: 1, d: 1, p: 1, c: 2}. 1/36 What is prob of sequence hr when two letters picked without replacement from {v: 2, c: 1, r: 3, i: 3, e: 1, h: 1}? 3/110 Three letters picked without replacement from {n: 10, g: 1, r: 5, b: 2, k: 2}. What is prob of sequence bbn? 1/342 What is prob of sequence xwk when three letters picked without replacement from {k: 9, m: 1, w: 3, x: 2, c: 3, l: 2}? 3/380 Three letters picked without replacement from rrkivakaakkd. What is prob of sequence dkr? 1/165 Calculate prob of sequence jjj when three letters picked without replacement from jjjjjjjjj. 1 Two letters picked without replacement from {k: 1, j: 12}. What is prob of sequence jk? 1/13 What is prob of sequence dcd when three letters picked without replacement from {o: 7, d: 10, c: 1, p: 2}? 1/76 Two letters picked without replacement from kikikkiiiiiiekikkkii. What is prob of sequence ei? 11/380 Three letters picked without replacement from {b: 2, l: 1, j: 1, o: 1}. Give prob of sequence lob. 1/30 Two letters picked without replacement from {x: 5, u: 14}. What is prob of sequence ux? 35/171 Calculate prob of sequence sy when two letters picked without replacement from {s: 1, d: 3, v: 4, z: 2, y: 2}. 1/66 Two letters picked without replacement from ovfoncww. Give prob of sequence wn. 1/28 Calculate prob of sequence yx when two letters picked without replacement from {y: 6, x: 2}. 3/14 Three letters picked without replacement from {e: 2, k: 1, c: 1}. What is prob of sequence eck? 1/12 Calculate prob of sequence xxxl when four letters picked without replacement from {x: 7, l: 4, c: 6}. 1/68 Two letters picked without replacement from {k: 2, z: 1, r: 1}. What is prob of sequence kk? 1/6 Calculate prob of sequence qh when two letters picked without replacement from {a: 3, q: 3, h: 1}. 1/14 What is prob of sequence zys when three letters picked without replacement from syzpkkp? 1/210 What is prob of sequence oo when two letters picked without replacement from googoooggg? 2/9 Two letters picked without replacement from {y: 6, v: 4}. What is prob of sequence vv? 2/15 Two letters picked without replacement from {x: 1, n: 2, h: 3, s: 3, j: 7, k: 1}. What is prob of sequence nk? 1/136 Two letters picked without replacement from {n: 5, m: 2, i: 5, l: 1, g: 4, v: 3}. Give prob of sequence iv. 3/76 Calculate prob of sequence jn when two letters picked without replacement from {j: 6, p: 2, i: 3, n: 2}. 1/13 What is prob of sequence yyl when three letters picked without replacement from {y: 2, w: 4, e: 3, l: 2}? 2/495 Three letters picked without replacement from jssssjssss. What is prob of sequence sss? 7/15 Calculate prob of sequence dddd when four letters picked without replacement from ddsdsdddsdddddsssqd. 165/1292 Three letters picked without replacement from uuuuhbbjbjb. What is prob of sequence uju? 4/165 Three letters picked without replacement from mmlszlwzzawz. What is prob of sequence mzl? 2/165 Two letters picked without replacement from {c: 2, r: 7}. What is prob of sequence cc? 1/36 Two letters picked without replacement from kvuvkptppkpnvknpn. What is prob of sequence vu? 3/272 Two letters picked without replacement from {d: 18, h: 1}. Give prob of sequence dh. 1/19 Two letters picked without replacement from {j: 4, n: 1, x: 3, b: 4, g: 1}. What is prob of sequence jx? 1/13 Calculate prob of sequence ddu when three letters picked without replacement from yuddm. 1/30 Two letters picked without replacement from {f: 4, a: 7}. Give prob of sequence fa. 14/55 Calculate prob of sequence vv when two letters picked without replacement from xwcevxwceewkxexwvecx. 1/190 Calculate prob of sequence ns when two letters picked without replacement from {n: 7, s: 3, h: 1, c: 3}. 3/26 Four letters picked without replacement from {a: 7, d: 3, t: 8}. What is prob of sequence ddda? 7/12240 Four letters picked without replacement from tztzttttttt. What is prob of sequence ztzz? 0 What is prob of sequence obr when three letters picked without replacement from baborjbbr? 1/63 Calculate prob of sequence zkb when three letters picked without replacement from {k: 1, b: 1, g: 1, z: 1, p: 2, f: 1}. 1/210 Two letters picked without replacement from {q: 2, j: 1, m: 1, s: 2, u: 1}. Give prob of sequence jq. 1/21 Three letters picked without replacement from {r: 1, c: 2}. Give prob of sequence rcc. 1/3 Calculate prob of sequence rrx when three letters picked without replacement from srsrlgxlxbxgxxgxg. 1/340 Two letters picked without replacement from gonoqn. What is prob of sequence gq? 1/30 What is prob of sequence qtrq when four letters picked without replacement from {q: 4, r: 2, t: 1}? 1/35 What is prob of sequence oj when two letters picked without replacement from {o: 1, r: 1, j: 1}? 1/6 What is prob of sequence gg when two letters picked without replacement from vvvgvovovvvogvvogvgv? 3/95 What is prob of sequence klm when three letters picked without replacement from vlnnvvnvnlklkvlm? 1/420 What is prob of sequence bi when two letters picked without replacement from {j: 3, i: 3, k: 3, h: 3, c: 5, b: 2}? 1/57 What is prob of sequence kx when two letters picked without replacement from {s: 3, b: 1, k: 10, x: 1, g: 2}? 5/136 Three letters picked without replacement from ieuuuvue. Give prob of sequence iuu. 1/28 Calculate prob of sequence eee when three letters picked without replacement from feaeeqeeaeaae. 35/286 Three letters picked without replacement from hkh. Give prob of sequence khk. 0 Two letters picked without replacement from ppdnp. What is prob of sequence dp? 3/20 Three letters picked without replacement from aazyozykp.	{ "pile_set_name": "DM Mathematics" }
d biggest value in 3, -1, -48, -4, -3? -3 What is the third biggest value in -42/19, 0, -0.3, -1? -1 What is the biggest value in -1, 1/4, -0.1, 50? 50 What is the second smallest value in -7, 5, 6, -2/11, 0.1? -2/11 Which is the fourth smallest value? (a) 4 (b) 0.1 (c) 4/169 (d) 5 d Which is the third smallest value? (a) 4 (b) -3 (c) 1.4 (d) -1/4 c What is the smallest value in 11, -3.2, 2/7? -3.2 Which is the fourth smallest value? (a) 1/8 (b) -1/4 (c) -13/2 (d) 4 d What is the biggest value in 5, 4, -1/2, 0.11? 5 Which is the biggest value? (a) -1/3 (b) 2 (c) -3/226 (d) -5 b Which is the fifth smallest value? (a) 0 (b) 0.2 (c) -1/6 (d) 4/3 (e) -5/37 d What is the fourth biggest value in -0.2, 5, 0.1, 9, 2? 0.1 What is the second biggest value in 3, -6, 2? 2 What is the third smallest value in 0.0307, 4, 0.3? 4 What is the biggest value in -4, -0.218, 2? 2 Which is the second smallest value? (a) 1/2 (b) -0.4 (c) -4/5 (d) 1 b What is the third smallest value in -2/9, -318, 3/5, -1, -7? -1 What is the biggest value in 2/7, -2/3, 14? 14 Which is the smallest value? (a) 0.5 (b) 103 (c) 3/22 c Which is the fourth smallest value? (a) 2/291 (b) -1/6 (c) 3 (d) 0 c Which is the fourth smallest value? (a) -4 (b) 0.18 (c) 4 (d) -1/3 c Which is the third smallest value? (a) 72 (b) -2.6 (c) 1/6 (d) 0 c Which is the third smallest value? (a) 0 (b) -2 (c) -0.1 (d) -12 c What is the third smallest value in 2, 57, -3/14, 0.08, -3? 0.08 Which is the biggest value? (a) 8 (b) -0.3 (c) -469 a What is the smallest value in 0.1, 1, 165? 0.1 Which is the third biggest value? (a) 0.1 (b) 1/6 (c) 0.14 (d) -2 a Which is the third smallest value? (a) 0.4 (b) 481 (c) -1/5 b Which is the second biggest value? (a) -13 (b) -0.1 (c) 1/5 (d) -5/3 b What is the smallest value in -0.13, 5, 0, 0.2? -0.13 Which is the third biggest value? (a) 0 (b) 0.01 (c) -2/9 c Which is the biggest value? (a) 4 (b) -2 (c) 0.2 (d) -0.035 a What is the fourth smallest value in 1, 91, 0.4, -3/4, 3? 3 Which is the fourth biggest value? (a) -1/7 (b) 9 (c) -2/13 (d) -0.6 (e) -3 d Which is the second biggest value? (a) 1/14 (b) 1 (c) -12 (d) 5 b Which is the smallest value? (a) -1 (b) 44 (c) -2 (d) 4 (e) -1/5 c Which is the biggest value? (a) -22 (b) 4/5 (c) 1/5 b What is the smallest value in 58, 0.2, -96? -96 What is the fourth biggest value in -1, -1/21, -29, 1? -29 Which is the third smallest value? (a) -2/5 (b) -8 (c) -12 (d) 3/7 (e) -4 e What is the third smallest value in -5, 4, 1/4, 161? 4 Which is the smallest value? (a) -14 (b) 0.8 (c) -0.2 (d) 8 a What is the third smallest value in -1/11, 6, -35, 0.1? 0.1 What is the smallest value in 2/7, 95, -1, 2/9? -1 Which is the fourth smallest value? (a) 4 (b) -1/2 (c) -0.1 (d) -2 (e) 0.1 e Which is the fifth biggest value? (a) 208 (b) 1/2 (c) 1/4 (d) -1 (e) 0.1 d What is the third biggest value in 1/4, 0.1, 3, -5? 0.1 Which is the smallest value? (a) 0 (b) -0.1 (c) -0.046 b Which is the third smallest value? (a) -0.1 (b) -0.263 (c) 5 (d) -4 a What is the third smallest value in -3, 17, 2? 17 Which is the second biggest value? (a) -2/7 (b) 19 (c) 6 (d) 15 (e) 4 d What is the third biggest value in 97, -5, -0.1, -1/3? -1/3 What is the smallest value in 1/2, -0.4, -0.275? -0.4 What is the biggest value in -5, 11, -2, -0.01? 11 Which is the fifth biggest value? (a) 2/13 (b) 4/5 (c) -0.06 (d) -2/13 (e) 0.4 d Which is the third smallest value? (a) 4 (b) 1/12 (c) 2/9 (d) -3 c What is the fifth smallest value in 3, 0.3, -2/11, 3/4, 0.03873? 3 Which is the third biggest value? (a) 25 (b) -56 (c) 4 b Which is the biggest value? (a) 36 (b) 0.2 (c) 2 (d) -0.2 a Which is the third smallest value? (a) 4 (b) 0 (c) -75 (d) -4 b Which is the second biggest value? (a) -1/2 (b) -4 (c) 1/19 a Which is the fourth smallest value? (a) -4/7 (b) 0.51 (c) -0.2 (d) 5 (e) -0.5 b Which is the biggest value? (a) 2/11 (b) -0.01 (c) -5 (d) 0.5 d Which is the third biggest value? (a) -1 (b) 6 (c) 0.06 a What is the third smallest value in -21, 0.3, -4/7? 0.3 What is the second biggest value in 0.17, 3, -3/5? 0.17 What is the smallest value in 0.8, 1/10, -0.43? -0.43 What is the fourth smallest value in -3/7, 5, -43, 4, -2/3? 4 Which is the third biggest value? (a) 2/11 (b) -0.5 (c) 12 (d) -1/6 d What is the third smallest value in -6/11, -1/7, 3/8, -2? -1/7 What is the fourth biggest value in -4, -0.3, 4, -1/3? -4 What is the biggest value in -1, 236, 0.4? 236 Which is the third biggest value? (a) 0.5 (b) -0.04 (c) -1/3 (d) -1/11 d What is the third smallest value in 11, -5, -0.4, -2? -0.4 What is the third smallest value in 0.01, -2/15, -2, 4? 0.01 Which is the fourth biggest value? (a) 19 (b) -2 (c) 0.04 (d) -5 d Which is the fourth biggest value? (a) 7 (b) -0.3 (c) -103 (d) -4 c Which is the smallest value? (a) 4 (b) 3297 (c) 0.3 c Which is the second smallest value? (a) 3 (b) -5 (c) 430 (d) -4 d What is the smallest value in -2, 0, 0.6, -13? -13 Which is the fourth smallest value? (a) 36.9 (b) 1 (c) 1/11 (d) -3/2 (e) 1/2 b Which is the second smallest value? (a) -0.2 (b) 1/5 (c) -2/925 c What is the second biggest value in -13, -1, -2/7, 1/8, 2/3? 1/8 Which is the smallest value? (a) 0.3 (b) -5 (c) -0.4 (d) 29 (e) 2/13 b What is the smallest value in 0.3, 0.12, 6? 0.12 What is the fourth smallest value in 0.1, -29, -16, 2/7, 0.3? 2/7 What is the third smallest value in -0.1, -3, -0.9, -0.4? -0.4 Which is the biggest value? (a) 16 (b) -0.1 (c) -5 (d) 0 (e) -1 a Which is the third biggest value? (a) 3/7 (b) -4 (c) -3/7 (d) -2091 b What is the smallest value in 1/4, -41/3, -1? -41/3 What is the smallest value in -0.1, 44, -1/7? -1/7 Which is the smallest value? (a) -2/9 (b) -4 (c) 4 (d) 0 (e) 0.05 b What is the third biggest value in -1/307, -1, -4, 3? -1 Which is the third biggest value? (a) -3/76 (b) 4 (c) 23 a What is the third biggest value in -0.5, 3, -3/7, -0.3? -3/7 Which is the third biggest value? (a) 8 (b) -1 (c) -18 (d) 0.1 b Which is the smallest value? (a) 0.5 (b) 1 (c) 2 (d) 2/281 d Which is the biggest value? (a) -0.1 (b) -449 (c) -3/2 (d) 1/3 d What is the smallest value in -4/7, 3, 1, -4? -4 What is the fifth smallest value in -0.3, -5, 0.01, 0.073, 2/5? 2/5 Which is the second biggest value? (a) 37 (b) -1/4 (c) 0.08 (d) -1 c Which is the third biggest value? (a) -4/9 (b) 61 (c) -0.2 a Which is the second biggest value? (a) -5 (b) -4.4 (c) 5 b Which is the smallest value? (a) -2/17 (b) 0.1 (c) -2/135 a Which is the fourth biggest value? (a) 3/7 (b) -4/7 (c) -3/4 (d) 2.9 c Which is the third biggest value? (a) -1/3 (b) -0.4 (c) -5 (d) 0.06 (e) 0 a What is the third smallest value in 5, 3, -4, -0.22? 3 What is the third smallest value in -2, -3, 0.3, -1, 2/35? -1 What is the third smallest value in 0.3, 0, -1, 0.08, 1? 0.08 What is the third biggest value in -0.2, 67/3, -3/5? -3/5 Which is the smallest value? (a) 0.1 (b) 0.2 (c) 279 a Which is the smallest value? (a) -0.5 (b) 2/13 (c) -3 c Which is the second smallest value? (a) -3/7 (b) -3 (c) 3 a What is the biggest value in 4, -4, -0.2, -0.22? 4 Which is the smallest value? (a) -1/2 (b) -4 (c) 0.2 (d) -2 (e) -174 e Which is the third smallest value? (a) -3/2 (b) -2/19 (c) 3 (d) -5 b What is the third smallest value in 0.1, 1, 4, 12, -8? 1 Which is the third biggest value? (a) 15 (b) -2 (c) -4 c What is the third smallest value in -2, 3.5, -1/5, 5? 3.5 Which is the biggest value? (a) -3 (b) -0.4 (c) 4 (d) -21 c Which is the second biggest value? (a) -0.2 (b) 3/4 (c) 0.1 (d) 0.3 d Which is the smallest value? (a) -0.1 (b) -2/9 (c) 23 (d) 0 b What is the second smallest value in 4, 0, 50/9? 4 Which is the fourth smallest value? (a) -3 (b) 1 (c) -0.5 (d) -2 (e) 84 b What is the biggest value in 89, -0.1, -2/3? 89 Which is the third smallest value? (a) 2/5 (b) -5 (c) -30 a What is the third smallest value in -10, 4, -2, -1/4? -1/4 Which is the smallest value? (a) -1/408 (b) 1/5 (c) 1 (d) 5 (e) 4 a Which is the fourth biggest value? (	{ "pile_set_name": "DM Mathematics" }
6). 12 Let t(r) = 3r - 7. Let d be t(3). Let k(y) = -dy2 + y2 - 3y + 2y. What is k(-3)? -6 Let d(n) be the second derivative of -n6/360 - n5/120 - n*4/6 + 3n. Let t(w) be the third derivative of d(w). Let m = -12 + 17. What is t(m)? -11 Suppose -3k = -2s + 19, -3s - 7k = -3k - 37. Suppose 5t = r - 10 - 3, -s = 5t - 2r. Let q(l) = l*2 + 7l + 3. Calculate q(t). -9 Let r(g) = 14g3 + 29g*2 + g - 5. Let u(z) = -5z*3 - 10z*2 + 2. Let d(y) = -6r(y) - 17u(y). Suppose n + 4f = -f + 5, f + 25 = 5n. Calculate d(n). -9 Let g(v) = -v3 + 4v*2 + 6v + 1. Let b be g(5). Let y(k) = k + 2. Determine y(b). 8 Suppose 0 = -2m + 2 + 2. Let n(v) be the second derivative of -1/6v*4 + 0v*3 - 1/2vm - v + 0. What is n(-2)? -9 Let w(u) be the first derivative of u6/360 - u5/30 + u4/8 + 8u3/3 + 4. Let z(m) be the third derivative of w(m). Suppose 6h = 2h + 12. Give z(h). 0 Let t be (-2 + 8)3/9. Let b(v) = -2 - 2v2 + 3v + 0vt + v2 - 9v. Calculate b(-5). 3 Let t(d) = 0d2 - d + d3 - 1 - 3d + 3d2. Give t(-4). -1 Let q(t) = t2 + 3t - 7. Let b be q(-5). Let p(m) be the first derivative of m4/4 - m3 - m*2/2 + 3m - 1. What is p(b)? 0 Suppose 3n = 7n - 76. Let l(g) = -3g - g2 + n - 16 - g. Calculate l(-4). 3 Let f(w) = -19w*3 - 13w*2 - 5w - 9. Let j(b) = 5b3 + 3b*2 + b + 2. Let q(h) = -2f(h) - 9j(h). Give q(1). -7 Let m(z) = 13z3 - z2 - 3z + 15. Let r(y) = -7y3 + y2 + y - 8. Let c(l) = -6m(l) - 11r(l). What is c(-6)? -8 Let n(f) = 7f3 - 5f*2 + 6. Let c(l) = 7l*3 - 4l*2 + 5. Let s(w) = 7c(w) - 6n(w). Suppose 4q = -5x - 17, 1 = q + 4. What is s(x)? -6 Let f(z) = z + 7z + 5 + z - 2. Let k(g) = -g. Let v(l) = f(l) + 6k(l). What is v(-3)? -6 Let q = 5 + -3. Let h(m) = -4 + 2 + 1 + 0. Let k(z) = -2z - 2. Let u(g) = 5h(g) - k(g). Give u(q). 1 Suppose -4o - 3w + 4 = 0, o - 6o + 3w + 32 = 0. Let r(f) = 6f + 1. What is r(o)? 25 Let r = -10 - -8. Let x(j) = 0j3 - 6j + j*3 + 3j - 3. Let i be x(r). Let f(c) = c*3 + 6c*2 + 3c - 7. Calculate f(i). 3 Suppose -5x - 46 + 11 = 0. Let p = x - -4. Let c(s) = -s2 - 4s - 2. Let a be c(p). Let t(v) = -v + 1. What is t(a)? 0 Let d(w) = -27w + 6w*2 + 14w + 3w - 1 + 9w. Determine d(-1). 6 Suppose 0 = f + 6 - 14. Suppose 1 = -2y - 5q, -3y + 5q = -4y - f. Let l = 8 - y. Let s(o) = 8o. Determine s(l). 8 Suppose 16 = -5o - 9. Let c(i) be the second derivative of 0 + i2 - 1/3i*4 - 1/20i*5 + 2/3i*3 + 4i. What is c(o)? 7 Let z = -3 + 5. Let w(d) = 5 + 2 + dz - 3. Calculate w(0). 4 Let s(t) = -t3 - 6t2 - 2t - 1. Let u = -25 - -19. Determine s(u). 11 Let a(x) = -x*3 + 4x2 - x - 2. Let l be a(4). Let t be (-4)/l + (-4)/(-3). Let o(c) = 5 + c - c3 + 2c3 - 5c*2 - 4 - tc*3. Determine o(-5). -4 Suppose 0 = -3p - 4 + 10. Let c(x) = -1 + x*3 + 0x*3 + 0x*p - 2x + x3 - x2. Determine c(-1). -2 Let y(n) = -4n + 498 - 505 + 6n. Let w = -5 - -10. What is y(w)? 3 Let o(n) = 3n - 1. Suppose 7 + 1 = 8j. Give o(j). 2 Let q(x) be the first derivative of x6/120 + x5/20 - x*4/24 + 2x3/3 + x2/2 + 6. Let y(z) be the second derivative of q(z). Calculate y(-3). 7 Let m(y) = 3y2 + 1. Let w be m(-1). Let o(k) = k3 - 4k*2 - 2k + 3. Give o(w). -5 Let f(n) = -n*3 - 9n*2 - 8n - 6. Suppose -5o + 49 = -3m, -4m + 4o = 10 + 42. Give f(m). -6 Let z(g) be the second derivative of 1/20g5 + 2g + 1/2g2 + 1/3g*3 + 1/4g4 + 0. Calculate z(-3). -5 Let q(n) = n2 - 5n - 7. Suppose -5g + 15 = 5t, 4g - 4t = -g + 42. Calculate q(g). -1 Suppose -u - 1 + 4 = 0. Let c(x) = 3x + 3. Let g be c(u). Suppose -2a = -d - g, -3a + 13 = -d - 3. Let w(s) = s*3 - 4s2. Give w(a). 0 Let j = -16 - -14. Let h(r) = r3 + 2r2 + r - 2. Give h(j). -4 Let a be (-1)/3(1 - 40). Let i = 18 - a. Let y(q) = -6q2 + 3q - 4 + 2q + 3q*3 - 2q*3. Give y(i). -4 Suppose -8 = -5t + f, -3f = -4t + 17 - 4. Suppose 5h + t = 6, 0 = 5k + 2h - 27. Let b be 0 + 2/(2/k). Let o(l) = l3 - 6l*2 + 2l + 7. Give o(b). -8 Suppose r = -2r - 6, -3v + 38 = -r. Let x = v + -17. Let u(p) = p. Let s(m) = -m*2 - 11m + 4. Let d(w) = -s(w) - 6u(w). Give d(x). -4 Suppose -3p - 5 = -2p. Let y(q) = -q3 - 4q*2 - 5q - 2q2 + 0q3 + 5 + 1. What is y(p)? 6 Let o(d) = -d2 + 13d + 15. Let m be o(14). Let q be m + (0 + 0 - -3). Let b(w) = w2 - 2w - 2. Give b(q). 6 Let k(n) = -15n. Let o(t) = 23t. Let d(b) = -8k(b) - 5o(b). Determine d(1). 5 Let p(w) be the third derivative of w6/120 + w5/10 + w*4/24 + 7w*3/6 - 30w*2. Give p(-6). 1 Let q be 170/40 + (-1)/4. Let s(u) = -3 - 7u + 4u2 + qu*2 - 9u2. Calculate s(-3). 9 Let z(u) = u3 - 12u2 + 11u - 4. Let a be z(11). Let p(b) be the first derivative of -1 + 0b - 3/2b*2 - 1/3b*3. What is p(a)? -4 Let s be (-2 + 0 - -1) + 2. Let h(l) = -2l - 6. Let y(w) = 1. Let u(j) = sh(j) + y(j). Determine u(-6). 7 Let k(w) = w. Let z(n) = -7n + 12. Let p(v) = -6k(v) - z(v). What is p(0)? -12 Suppose -30 = 5g - 4n, 0g - 2g - 5n = -21. Let q(l) = -2l2 + 2l + 3. What is q(g)? -9 Let q(z) be the third derivative of -z4/4 - z3/6 - 3z2 + 7z. Suppose -s = 4s - 5. Suppose -x - s = -0x. Determine q(x). 5 Let n = -3 + 3. Let p = n - -2. Let j(c) = -6 + 5cp + c2 - 2c - c*3 - c. Give j(5). 4 Let n(c) = -c + 2. Let u(r) = -r + 3. Let x be u(5). Determine n(x). 4 Let t(k) = -5k*2 + 2k + 1. Let n be (3/2)/(7/14). Let g = n - 4. Determine t(g). -6 Let t = 2 - 5. Let g(u) = -5u + u - u2 + 0u. Calculate g(t). 3 Let y = 17 - 10. Suppose -2o = -yo. Suppose o = 2r + 4, 2g + r + 12 = -0r. Let a(j) = -j3 - 5j2 - j - 7. Determine a(g). -2 Let k(z) = z2 - 6z + 5. Let h(r) = 1. Let d(x) = -2h(x) - k(x). Give d(7). -14 Let r = 13 - 8. Let f(o) be the second derivative of o3/3 + o2 + 2o + 153. Give f(r). 12 Let n(c) = 3c + 7. Let g be (-112)/20 + 4/(-10). Let d be 120/(-16)(-4)/g. Determine n(d). -8 Let y be (-1 + -3)3/(-12). Suppose -m + y = 5. Let w = m + 6. Let s(k) = -k*2 + k. Determine s(w). -2 Let i(w) be the second derivative of 0 + 1/3w*3 - 1/20w5 - w2 - w - 1/12w4. Determine i(-3). 10 Let w be ((-4)/(-6))/((-8)/(-36)). Let b(a) = 5a*2 - 2a + 1 + 2a3 + 0 - 3aw. Let h be 3 - 7/((-14)/4). Calculate b(h). -9 Let b(g) = -g2 + 15g - 6. Let h be b(0). Let t(q) = q. Calculate t(h). -6 Let l(k) = -k3 - 4k*2 - 3k - 5. Let y(s) = -s*2 + 9s + 7. Let r(d) = -d*2 + 14d + 11. Let i(v) = -5r(v) + 8y(v). Let g be i(-1). Determine l(g). 7 Suppose n = -2, 2b = 3n + 8 + 8. Let m(l) = 2l2 - 14l + 12. Let x(f) = f*2 - 7f + 6. Let r(j) = -3m(j) + 7x(j). Determine r(b). -4 Let t(h) = -5 + 0 - h*2 - h - 5h. Suppose -2c - 4s = 22, 3s = -2c - 2s - 25. Give t(c). 0 Let a(c) = -c2 + 1. Let j(v) = -5v*2 + 6v + 3. Let b(z) = -4a(z) + j(z). Give b(5). 4 Let r(s) = -s - 1 + 2 + 5s. Let p(n) = -n*2 + 6n - 6. Let l be p(4). Suppose -3u + 10 = lu. Give r(u). 9 Let z(n) = -n + 5. Let p(q) = q - 4. Let r(x) = -4p(x) - 3z(x). Give r(6). -5 Let m(b) = -b*2 - 6b + 1. Let o be m(-6). Let p(w) = 2 + o - 3w + 2w - w. Let z = -8 + 11. Determine p(z). -3 Let f(l) = -l*2 + 11l - 10. Let r be f(9). Suppose -j + 3s - r = -5j, -5j + 37 = -3s. Let x(q) = q*2 - 7q. Give x(j). -10 Let x(j) be the second derivative of j*3/6 + 5j*2/2 - 2j. Let q = 25 + -18. Let z be (-2)/4(q - -1). What is x(z)? 1 Let h(m) = -m2 + 5. Suppose -4f = -3y + 15, -25 = -f - 3f - 5y. Determine h(f). 5 Suppose 19 - 7 = 4h. Let l(y) = 4y - 1. Let r(u) = 21u - 6. Let g(a) = -11l(a) + 2r(a). Determine g(h). -7 Let v(b) = -3b2 - 1 + 0b*2 + b - 12b2. Let k be 5/10 - 3/(-6). Give v(k). -15 Let x(g) = -g2 + 8g - 5. Let o(u) = 3u*2 - 4u + 2. Let y be o(2). What is x(y)? 7 Suppose 0b = -3b + 15. Let m(h) = -4h2. Let x(i) = 7i*2 - i - 1. Let c(w) = -5m(w) - 3x(w). Calculate c(b). -7 Suppose 6 = -3c - 12. Let f(p) = 5p. Let t(v) = -6v + 1. Let n(m) = -5f(m) - 4t(m). Calculate n(c). 2 Let x(a) = -3a + 3. Let l(h) = -h2. Let r(w) = l(w) - x(w). Suppose -m + 5 = -f - 4f, 25 = 5m - 3f. Calculate r(m). -13 Let i(w) be the third derivative of	{ "pile_set_name": "DM Mathematics" }
+ 29n(x). Let u(t) = t. Calculate u(y(r)). -13r + 67 Let a(q) = 660355q2. Let j(o) = -10o*2. Determine a(j(p)). 66035500p*4 Let x(f) = -757f*2 - 48f - 29. Let z(d) = -151d2 - 10d - 6. Let t(l) = 6x(l) - 29z(l). Let j(g) = 2g + 6. Determine t(j(n)). -652n*2 - 3908n - 5856 Let n(k) be the second derivative of 0k3 + 3/8k*4 - 13/2k*2 + 0 - 17k. Let r(q) be the first derivative of n(q). Let c(y) = -2y2. Give c(r(x)). -162x*2 Let c(z) = 9z. Let k(l) = -159449l2. What is c(k(y))? -1435041y*2 Let r(d) be the second derivative of 0 - 25/6d*3 + 0d*2 - 115d. Let m(n) = 2n. Calculate m(r(x)). -50x Let q(x) = 6x. Let p(m) = 3m*2 + 4m - 17. Let y be p(3). Let i(v) = 44 - yv - 44. Calculate q(i(w)). -132w Let g(u) be the third derivative of -u*4/24 + 2u*2. Let s(v) = -1397v - 1403v - 1392v - 1394v + 5565v. Determine g(s(j)). 21j Let o(q) = -48q*2 - 15q. Let z(x) = 25x2 + 6x. Let f(c) = 2o(c) + 5z(c). Let y(b) be the third derivative of -b*4/6 + 18b*2 - 2b. Give f(y(n)). 464n2 Let s(a) = -109a*2 - 8a - 16. Let r(x) = 13x2 + x + 2. Let b(o) = 8r(o) + s(o). Let k(u) = -10u2. Determine k(b(g)). -250g*4 Let s(f) = 14f - 1813. Let a(q) = 2q2 - 207q - 4. Determine s(a(h)). 28h2 - 2898h - 1869 Let h(v) = -v2. Let m(q) be the second derivative of -q3/2 - 26q2 - 412q. What is h(m(u))? -9u2 - 312u - 2704 Suppose 11v - 1694 - 2376 = 0. Let j(u) = v - 370 + 5u. Let y(r) = -68r2. Give y(j(s)). -1700s*2 Let p(f) be the first derivative of 15f2/2 + 8. Let t(y) = -y2 + 15927 + 3y2 - 31844 + 15917. Determine t(p(l)). 450l*2 Let u(c) = c. Let z be (-11 - -4)/(66/88). Let h(m) = z + 5m + 9 - 9. Calculate h(u(o)). 5o + 4 Let k(i) = -368567i. Let o(f) = -17f*2. Give o(k(v)). -2309307769313v*2 Let c(m) = -212m - 219m - 237m + 879m - 231m. Let w(x) = -9x - 12. Calculate c(w(a)). 180a + 240 Let u(r) = 70r. Suppose v + 53 = 5k, 32 = 5k - 4v - 30. Let y(m) = -29 + 3m2 + 18 + 1 + k. Calculate u(y(g)). 210g*2 Let f(r) = -r. Let y(u) = 352327106u*2. What is y(f(i))? 352327106i2 Let w(c) be the second derivative of c3/3 - 36c + 42. Let s(g) = -1629g. Determine w(s(v)). -3258v Let p(x) = 2x*2 - 65. Let r(t) = -32 + 2t*2 - 31 + 100 - 37. What is r(p(c))? 8c*4 - 520c*2 + 8450 Let a(h) = 2h*2. Let n(k) = 50k - 86k + 117k + 714k + 109k. What is a(n(z))? 1634432z2 Let s(j) be the third derivative of -7j*5/60 - 7j4/8 + j2 - 140. Let i(t) = t. Calculate s(i(k)). -7k2 - 21k Suppose 20n - 21n = 4k - 52, 5n - 13 = -k. Let x(c) be the first derivative of 0c2 + 0c + 1/3c3 - k. Let f(m) = -2m. Calculate x(f(w)). 4w2 Let q = 408 - 406. Let t(k) = 50 + 12k*2 - 6k*q - 52. Let l(j) = -7j*2. Give t(l(r)). 294r*4 - 2 Let x(c) = -40c + 5. Let z(r) = -15r + 2. Let a(m) = 2x(m) - 5z(m). Let d(y) be the second derivative of 0 + 0y*2 + 6y - 2/3y3. Calculate d(a(g)). 20g Let h(x) = -24x. Let n(k) = 194k*2 - 33k + 44. Let z(s) = 97s2 - 18s + 24. Let a(w) = -6n(w) + 11z(w). Determine h(a(v)). 2328v2 Let t(f) = -258f*2 + 2f - 2. Let v(b) = -4b2 + 15b. Let r(c) = -9c2 + 35c. Let n(m) = 3r(m) - 7v(m). Determine t(n(u)). -258u4 + 2u*2 - 2 Let q(y) be the first derivative of -2/3y*3 + 0y*2 - 57 + 0y. Let x(t) = 12t2. Give q(x(v)). -288v*4 Let g(s) = -2s*2. Let t(l) = -13508377l. Calculate t(g(c)). 27016754c2 Let h(l) = -2587l*2. Let i(n) = -1970n - 2. Give i(h(w)). 5096390w2 - 2 Let s(f) = 21f*2 - 5. Let n(z) = -43z + 14. Let t(x) = 30x - 10. Let w(m) = 5n(m) + 7t(m). Determine w(s(a)). -105a2 + 25 Let v(h) be the second derivative of h5/12 + 119h2/2 - 68h. Let p(s) be the first derivative of v(s). Let l(x) = -x2 - x2 - 2x2. Calculate l(p(t)). -100t4 Let j(l) = l2 - 8. Let q(c) = 5c2 - 44. Let t(k) = -22j(k) + 4q(k). Let r(a) = 445a*2. Determine r(t(d)). 1780d*4 Let s(x) = 3x*2. Let y(g) be the first derivative of -1268g*2 - 5271. Determine s(y(m)). 19293888m*2 Let l(q) = 2q. Let v(o) be the second derivative of -19/12o4 + 0 - 1/2o*2 + 74o + 0o3. Give v(l(c)). -76c*2 - 1 Let d = 57 - 57. Suppose 4y - 9y + 10 = d. Let u(p) = -12p - yp + 4p. Let f(q) = -4q. Give u(f(c)). 40c Let n(g) be the first derivative of -g*3/3 + 1. Let l be (1-2)/(41/(-1312)). Let t(p) = -34 - 5p + l - 30. Determine n(t(w)). -25w*2 Let q(p) = p. Let s(g) be the third derivative of -61g6/360 - g4/3 + 5g3/6 - 15g*2. Let j(m) be the second derivative of s(m). Give q(j(v)). -122v Let f(l) = -3l + 2l - 2l. Let z(q) = q2 + 3. Let k(v) be the third derivative of v5/15 + 3v*3/2 - 74v*2. Let x(a) = k(a) - 3z(a). What is x(f(s))? 9s2 Let k(z) = z2 + 40. Suppose 3h - 4h - 4v - 10 = 0, 5v = -4h - 7. Let i(l) = hl2 - 3l2 + 748 - 748. Determine i(k(c)). -c4 - 80c2 - 1600 Let s(b) = -16b*2 - 12b - 51. Let h(l) = 18l2 + 10l + 49. Let v(n) = 6h(n) + 5s(n). Let g(z) = z. Determine g(v(q)). 28q2 + 39 Let v(s) = 2s*2 - 10. Let h(b) = 10b - 49. Let j(m) = 2m - 7. Let r(g) = -2h(g) + 14j(g). Determine r(v(y)). 16y*2 - 80 Let g(w) be the third derivative of 2w*2 - 28 + 0w*4 + 0w*3 + 1/15w*5 + 0w. Let t(x) = 3x2. Determine g(t(u)). 36u*4 Let s(x) = 3x - 11. Let f(p) = 174p - 37. Let r(q) = 14q - 3. Let w(u) = 6f(u) - 74r(u). Calculate w(s(l)). 24l - 88 Let y(i) = -3i*2. Let w(r) = 360r*2 - 25316. Calculate w(y(v)). 3240v*4 - 25316 Let q(s) = 2s*2 + 37925199s - 1. Let v(g) = -2g. Give v(q(k)). -4k*2 - 75850398k + 2 Let s(d) = d. Let g(m) = -3m2 + 32m + 271. Let k(b) = -b*2 + 7b + 68. Let a(l) = 2g(l) - 9k(l). Determine s(a(j)). 3j2 + j - 70 Let h(p) = 266p - 5. Let o(d) = 873d - 15. Let z(s) = -8h(s) + 3o(s). Let j(u) = -u. Give z(j(x)). -491x - 5 Let z(j) = -2811j2 - 236j + 18. Let y(t) = 24t. Give y(z(l)). -67464l*2 - 5664l + 432 Let i(h) = -17h. Let l(k) = -2266345k*2. Give l(i(v)). -654973705v*2 Let g(c) = -3c - 23c + 71 - 33 - 38. Let a(x) = -x - 92. What is a(g(b))? 26b - 92 Let u(p) = -5p2 + p. Let f(n) = 21n*2 - 4n. Let y(q) = 2f(q) + 9u(q). Let r(k) = 5k. Give y(r(o)). -75o*2 + 5o Let p(n) = -19n2. Let c = 18543 + -18541. Let v(m) be the first derivative of -38 + 0m + 0mc - 2/3m*3. Give v(p(q)). -722q*4 Let d(k) = -5k*2. Let a(b) = -5b + 2 + b + 3b + 2b. Let y(m) = 7m + 10. Let j(p) = -5a(p) + y(p). Give j(d(v)). -10v2 Let j(h) = 23156046h. Let s(u) = -2u2. What is j(s(o))? -46312092o*2 Let h(u) = u. Let m(o) = 6o + 2. Let r(v) = -41v - 15. Let s(j) = -30m(j) - 4r(j). Give s(h(d)). -16d Let d(o) = -18o2. Let t(f) = 86f + 2295. Determine t(d(s)). -1548s2 + 2295 Let t(s) = s2 + 178s + 177. Let i be t(-1). Let b(g) be the second derivative of -31g + 1/6g*3 + i + 0g*2. Let f(l) = -31l*2. What is f(b(c))? -31c*2 Let a(v) = -21v*2. Let o(x) be the first derivative of 51x*2/2 - 1615. Give o(a(k)). -1071k*2 Let v(s) = 9463175s*2. Let a(q) = -2q. Determine a(v(g)). -18926350g2 Let r(a) = -175a. Let u(p) = -p*2 + 3944p + 3. Calculate u(r(d)). -30625d2 - 690200d + 3 Let d(x) = 3x + 1. Suppose 90 = 2g - a, -27g + 30g - 121 = 5a. Let i(n) = -3n*2 - gn + 4n2 + 47n. What is i(d(s))? 9s2 + 6s + 1 Let y(d) = -4955d. Let a(p) = -30640p. What is a(y(u))? 151821200u Let o(j) = -2j*2. Suppose 3m - 4x + 5458 = 41224, -2x = 5m - 59636. Let y(g) = -g - 12g + 11926 - m. Determine o(y(p)). -338p2 Let h(t) = 5t. Let u(v) = -17683272v. Give h(u(z)). -88416360z Let m(i) = -i. Suppose 10x + 2x - 348 = 0. Let b(q) = -2q + xq - 14q + 39q. Give b(m(t)). -52t Let n(i) be the third derivative of -i7/1260 + 7i*5/5 - 2i*2 - 4i. Let x(r) be the third derivative of n(r). Let d(h) = 2h. Calculate d(x(u)). -8u Let i(m) = 2m - 6. Let j(t) = -4t + 13. Let y(w) = -13i(w) - 6j(w). Let k(c) be the first derivative of -22c2 + 54 + 28c*2 + 6. Calculate y(k(z)). -24z Suppose -119 = -4z - 11b + 16b, 4z + 2b - 98 = 0. Let m(a) = -11a - 14a - 10a + za. Let l(f) = -6f. Determine m(l(s)). 54*s Let y(	{ "pile_set_name": "DM Mathematics" }
+ -14563/36395. What is the third smallest value in y, r, -0.06? y Let p = 16.1 + -16.08. Which is the second biggest value? (a) -3 (b) 1 (c) p c Let y = 0.0367 + -0.5437. Let h = y - -0.307. Let k(l) = l*2 + 4l - 5. Let g be k(-5). Which is the second smallest value? (a) -0.05 (b) h (c) g a Let n be 13 + 2(5 - 3) + -8. Let y(i) = i3 - 11i*2 + 19i - 6. Let f be y(n). Let h = 2.5 - 0.5. What is the fourth biggest value in -1/6, h, f, -5? -5 Let l = 3483 + -3483.2. Let s = -9671263/60 + 161199. Let v = 56/5 - s. Which is the second smallest value? (a) l (b) v (c) 3 b Let w = -3 + 6. Suppose -g - 16g + 391 = 0. Suppose 18 = 17t - gt. Which is the third smallest value? (a) t (b) -2 (c) w c Suppose -8j + 2j = 4j + 10. What is the fourth biggest value in 2/5, 0.2, -4, 3/2, j? j Suppose -3v - 2 = 4. Let d be (14/(-6) - v)/1. Suppose -17 - 12 = 5g + x, 12 = -3x. Which is the third smallest value? (a) -2/5 (b) g (c) d c Suppose 5q - 4n + 24 = -21, -2q + 2n - 20 = 0. What is the smallest value in -24, 0.3, q? -24 Let n = 2.528 + -2.63. Let k = -0.198 + n. What is the fourth biggest value in 0, 0.4, 14, k? k Let g be -3 - 7/4380/(-225). Let t = 3.4 + 6.6. Let s = t - 11. Which is the third smallest value? (a) s (b) g (c) -2/11 b Let u = 0.1 + 0.4. Suppose 166 = 4h + i, -19i + 24i = 30. What is the third biggest value in u, h, 1, -1/6? u Suppose -4g + 22 = -4d - 2g, g = 3. Let k be 12/d + 30/8. Let q = -1775 - -1775.2. Which is the biggest value? (a) k (b) -5 (c) q a Suppose 125u = 120u - 980. Let y be (-15)/(-20) - (-203)/u1. Which is the smallest value? (a) y (b) 2 (c) 1 a Let k = -31273/7 - -4455. Which is the second smallest value? (a) -7 (b) k (c) 2 a Let y = 8 - 13. Let w = -5.5 - y. Suppose 651l - 656l + 15 = 0. Which is the second biggest value? (a) -9 (b) w (c) l b Let j be 134/603 - (-303)/(-1242). Which is the fifth smallest value? (a) 0.7 (b) -3 (c) -2 (d) 1/4 (e) j a Let p = -179.51 + 178.51. Which is the fourth biggest value? (a) p (b) -2 (c) -8 (d) 1/55 c Let w be (1/(-26))/(799/(-94)). Let z = w - -437/1105. What is the biggest value in z, 4, -1? 4 Let t = 11.41 - -38.29. Let k = t + -53.7. Let h = 5 - 2. Which is the second biggest value? (a) k (b) 0.06 (c) -0.1 (d) h b Let z = -44919 + 44907. Let i = -0.2 - -1.2. What is the biggest value in z, i, -3? i Let r = -2.603 - -2.503. Let v = 9.2 + -5.31. Let u = 0.11 + v. Which is the smallest value? (a) u (b) r (c) 9 b Let n = -22.61 + 22.81. What is the biggest value in 5, n, 5/7, -3/4? 5 Suppose -2k = l - 7, 0k = -k - 2l - 1. Suppose 42 + 3 = 3b + 5w, -4b + kw = -60. Let h be 1/212/b. What is the biggest value in 1, h, -0.09, 5? 5 Let d = -7701 - -2564435/333. Which is the biggest value? (a) d (b) -2/5 (c) -4/3 a Let z = 22038 - 22067. Which is the fifth biggest value? (a) 1.5 (b) 1/3 (c) 3/4 (d) z (e) -4 d Let t = 1.31 + -0.21. Let d = -14.8 + 13.2. Let k = d + t. Which is the third biggest value? (a) 7 (b) k (c) -0.2 b Let o = 90.187 - 3.187. What is the second biggest value in -4, o, -3, 6/11? 6/11 Let g be 0 + -1 + (3 - -1). Let y(i) = -17i - 259. Let m be y(-11). Let o be (-6)/g - m/38. What is the second biggest value in -2/13, 2, o? o Let s = 8 - 6. Let o = 4.6 + 15.4. Let f = o - 23. Which is the fourth biggest value? (a) 3/2 (b) -4 (c) f (d) s b Let x = -220.71 - -221.21. Which is the second biggest value? (a) 4448/7 (b) -3 (c) -2 (d) x (e) -4 d Let m be -22 - (-58 - -30) - (-19)/(-3). Which is the fourth biggest value? (a) m (b) -1/2 (c) 1/69 (d) -8 d Let j be (-10)/42 - (555/21 - 26). What is the second biggest value in 5, -0.158, 1, j, -0.5? 1 Let m(s) = 4070s - 8119. Let j be m(2). Which is the second smallest value? (a) j (b) 2/17 (c) -405 b Suppose -33 = 7a + 2. Let b = 108 + -107. What is the second biggest value in 0.25, b, a, -0.5? 0.25 Let p = 3830 - 3828. What is the second biggest value in 358, p, -2/29? p Let h = -22712.4 - -22713. Suppose 3x + x - 8 = 0. What is the second smallest value in x, 2/37, h? h Let w = -1.1745 - 0.8255. What is the biggest value in 29, -4, 5, w, 0.3? 29 Let g = 0.08 + -191.08. Let u = g - -190.8. Which is the third biggest value? (a) 7 (b) -4 (c) u b Let f = 2417.21 + -2417. Which is the fourth smallest value? (a) 0.06 (b) f (c) -4 (d) -0.2 b Suppose 0 = 2t + 87 - 247. Let r be (-3)/45 - (-32)/t. Which is the third biggest value? (a) -1/2 (b) r (c) 3/20 a Let y = 17 - 12. Let o = 0.011 - -35.989. Let n = o + -32. Which is the smallest value? (a) n (b) y (c) -3 c Let t = -6218 + 6226. What is the second smallest value in 5, t, -1? 5 Let d = 91.4 - 88.4. What is the second biggest value in d, 176, -1? d Suppose 16x - 237 + 77 = 0. Let t be (-262)/(-131) + (-2)/x7. What is the fourth biggest value in -0.1, -4, t, 1/6? -4 Let o = 0 - -26. Let j = -11 + o. Let t = j - 15.1. What is the second biggest value in 1, 3/8, 1/3, t? 3/8 Suppose -t - 5f = 23, -3t + 3198f = 3193f - 11. What is the fifth smallest value in -3/5, -0.04, t, 27, 0.5? 27 Let x = -57.6561 + 53.6561. Let y = 0.2 + 0.8. Let t = -4 - -2. Which is the fourth smallest value? (a) x (b) -2/5 (c) y (d) t c Let u = 7764.5 - 7764. Which is the fourth smallest value? (a) -0.5 (b) 50 (c) 0 (d) -4/3 (e) u e Suppose 0o = -5u - 4o - 7, 2u = -5o - 13. Which is the smallest value? (a) 5 (b) u (c) -1/104 c Let x = 17697 + -17653. What is the third smallest value in -2, -5, x, 2, -4? -2 Let n be ((-8)/2)/((8 + -15 - -4) + -11). Which is the smallest value? (a) 1/2 (b) 0.1 (c) -17 (d) n (e) -0.05 c Let v = 0.1759 - 82.4759. Let r = 82 + v. Which is the second smallest value? (a) r (b) 0.5 (c) -4 (d) 5/6 a Let g = 80713421/950 + -84963. Let w = -2/475 - g. Let f = -9 + 11. Which is the smallest value? (a) f (b) -1 (c) -4 (d) w c Let n be (-48)/119 + (-2)/(-7). Let y = 256 - 272.7. Let z = y + 16.6. What is the smallest value in n, -0.5, z? -0.5 Let o be -6 + 8/(3(-4)/(-12)). What is the second smallest value in 3/8, -1/2, -14, o, -1/12? -1/2 Let f = -7.85 + -0.15. Let g = 12 - f. Let l = -24 + g. Which is the third biggest value? (a) 2/5 (b) 4 (c) l (d) 0.1 d Let r = -2131 - -2132. Which is the smallest value? (a) 5 (b) -4/237 (c) r b Let p = -4.936 - -6.936. Which is the second biggest value? (a) p (b) -6 (c) -1/9 (d) 121 a Suppose -104 = -4s - m + 18, -s + 4m = -22. Which is the biggest value? (a) -9 (b) -5 (c) -0.5 (d) s d Let v = 716 + -715.375. Let m = v - 0.325. What is the fourth biggest value in -0.06, 4, -0.3, m? -0.3 Let u be (-6 + 26/5)/((-119)/85). Which is the second biggest value? (a) 0.7 (b) 2/5 (c) 1 (d) u (e) -1 a Let d = 18 - 18.05. Let w = -136 + 58. Let l = w - -83. Which is the second biggest value? (a) -4 (b) d (c) l b Let m = -6.3 - -6. Let w = -232177/4 - -58044. What is the second smallest value in w, 1.3, 5, m? w Let v = 5096 + -5215. Let o be ((-65)/(-25) - 2)/3. Which is the second smallest value? (a) 2/3 (b) -2 (c) v (d) o b Suppose 0 = 3i - 15i + 24. Suppose 0 = -3p + p - 2s + 2, -14 = -ip + s. What is the third biggest value in 0.27, -1/3, p? -1/3 Suppose 14z - 328 = 10z + 2m, -3m + 12 = 0. What is the fourth smallest value in z, 1, -0.2, -5? z Let g = -237.43 - 1.57. Let p = -235 - g. Let z = 9 + -4. Which is the smallest value? (a) z (b) p (c) -0.11 c Let k be (-12)/(-1) - (-11 - -17). Let d be (k(-8)/(-660))/(2/5). Let l be (0/(-2 + 5))/(-1). Which is the smallest value? (a) l (b) 0.1 (c) d a Let m = 6384 + -6478. Let z = 1014 + -920.2. Let n = z + m. Which is the fourth biggest value? (a) 0.2 (b) n (c) 1/6 (d) -0.4 d Let x(m) = m*2 - 5m. Let r be x(4). Let p be 1914/(-1015) + (-2)/21-3. Let h = p + 2. Which is the smallest value? (a) 2 (b) h (c) r c Let q = -0.22 - -0.62. Let w = -1102 - -1101.78. What is the biggest value in q, 0.2, w? q Let u = 20 - 19.7. Let r be 2 + 788/12. Let h = -217/4 + r. Which is the biggest value? (a) h (b) 2/25 (c) u c Let f(x) = -x + 8. Let u be f(6). Let w = 400647 + -4407123/11. What is the biggest value in u, w, 8, 10? 10 Let n = 17716 - 17706. What is the second biggest value in 36, 7, n? n Let g = 3256	{ "pile_set_name": "DM Mathematics" }
- 1/420i5 + 0 + 5/6i4. What is a in l(a) = 0? 70 Let v(n) = -n5 + n*4 + 6n*3 - 6n. Let u(r) = -3r5 + 3r*4 + 17r*3 - 17r. Suppose 0k - 5k + 85 = 0. Let x(c) = kv(c) - 6u(c). Factor x(o). o*4(o - 1) Let x(u) = -11u3 - 42u*2 - 73u + 36. Let m(h) = 20h3 + 85h*2 + 145h - 60. Let v(q) = 3m(q) + 5x(q). Factor v(c). 5c(c + 2)(c + 7) Let q(v) be the third derivative of -v6/420 - 17v*5/105 - 80v*4/21 - 512v*3/21 - 1132v*2. Factor q(b). -2(b + 2)(b + 16)2/7 Let g be (9 + 1 - -1) + 3. Let p be g/((-700)/(-90))(-10)/(-12). Suppose -pr3 + 3r*2 + 6r - 12 = 0. Calculate r. -2, 2 Let j(n) be the second derivative of n*7/84 + 61n*6/30 + 5737n*5/40 + 16108n*4/3 + 342784n*3/3 + 1384448n*2 - 1761n. Let j(g) = 0. Calculate g. -32, -13 Let b(l) = -l*3 + 7l*2 - 6l. Suppose 79o - 48 = 71o. Let y be b(o). Suppose ya2 + 8/17a + 0 - 6/17a4 - 14/17a*3 = 0. What is a? -2, -1, 0, 2/3 Let i = -711692 - -4981846/7. Let -if*4 + 8/7f - 8/7 - 10/7f3 + 10/7f*2 + 2/7f5 = 0. Calculate f. -2, -1, 1, 2 Let m(h) = -h3 + 19h2 + 24h - 77. Let p be m(20). Let d(z) be the second derivative of 8zp + 0z*2 + 3/20z*5 + 0 - 2z*4 - 19z. Factor d(w). 3w(w - 4)2 Let i(q) be the second derivative of -q5/5 + 9q4 + 164q*3 - 544q*2 + 2137q. Factor i(a). -4(a - 34)(a - 1)(a + 8) Let g(z) be the first derivative of z7/2100 - z6/225 + z5/75 - 17z*3/3 - 3z*2/2 + 62. Let w(y) be the third derivative of g(y). Factor w(d). 2d(d - 2)2/5 Let b be (5 - 15)/((-10)/28). Suppose bk = 9k. Factor 0g - 2/11g2 + 2/11g*3 + k. 2g*2(g - 1)/11 Let v(u) = 3u3 - 23u*2 + 16u + 57. Let k = 218 - 225. Let y(b) = -2b3 + 12b*2 - 8b - 28. Let p(t) = ky(t) - 4v(t). Let p(c) = 0. What is c? -4, -2, 2 Suppose 2a - 3v = 135, 15 = 5v - 0v. Let z be 2 + a/21 - 3/7. Let 77n - 45n*3 - 77n + 30n4 - 5n*z + 20n*2 = 0. Calculate n. 0, 1, 4 Suppose -3936 = -50f - 3136. Let w(n) be the first derivative of -f + 2/21n3 - 3/7n*2 - 20/7n. Determine r, given that w(r) = 0. -2, 5 Solve 420677 + 7r2 + 365492 - 7r*2 + 2r*2 - 2260r - 147719 = 0. 565 Let o(q) = q*3 + 24q*2 - 25q + 4. Let f be o(-25). Solve 70 - 4 + fp2 + 30 + 44p = 0 for p. -8, -3 Let t be 3/(-9) - (88/(-12) - 5). Factor 38a2 - 91a*2 - ta + 45a2 + 20a*3. 4a(a - 1)(5a + 3) Solve -222o*2 - 147o*4 + 22o - 8o - 62o*3 + 9 + 0o + 398o3 + 10o = 0. -1/7, 3/7, 1 Let l = -12847/3 + 4299. Solve -5/3t2 + 0 - lt = 0 for t. -10, 0 Let i(n) = -5 + 13n3 - 29n*2 - 12n*2 + 32n + 4n2. Let h(q) = 1871q + 2 - 1887q + 1 - 7q*3 + 19q*2. Let y(z) = 5h(z) + 3i(z). Factor y(v). 4v(v - 2)2 Suppose -4448 + 2232l + 1229l3 - 1921l*3 - 6668l*4 - 1552l*3 + 677l*2 + 10439l*2 + 12l*5 = 0. Calculate l. -1, 2/3, 1, 556 Suppose 279 = -20o + 79. Let u be 12/(-18)5/o. Factor 0 - 1/3w*3 + 2/3w - uw2. -w(w - 1)(w + 2)/3 Solve -31h5 - h3 + 98h5 + 13h*3 + 6h*4 - 75h - 32h5 - 36h*5 - 70h2 = 0 for h. -3, -1, 0, 5 Let y(z) be the third derivative of -z6/120 + 35z5/12 - 29z*4/4 - 1654z*2. Let y(x) = 0. What is x? 0, 1, 174 Let o(s) be the third derivative of 98s*3 + 0s - 91/6s4 - 116s*2 - 1/30s*6 + 17/15s*5 + 0. Suppose o(d) = 0. What is d? 3, 7 Let l be 0((-13)/(-22) + 173/(-1903)). Factor 10/3x + 2/3x*2 + l. 2x(x + 5)/3 Suppose 0h - 50 = -2h + 5o, 29 = 3h + 4o. Factor 8x2 + 18x*2 - 7x*3 + 14x*2 - 8x*3 - 10x*4 - hx. -5x(x - 1)(x + 3)(2x - 1) Factor -2u*5 - 590u*2 + 901u - 682u - 206u*3 - 400 + 5u5 - u5 + 777u + 198u*4. 2(u - 1)*3(u + 2)(u + 100) Let h(o) be the second derivative of -10/7o*2 + 0 - 2/7o4 + o3 + 19o + 1/70o*5. Solve h(z) = 0 for z. 1, 10 Let d(z) = 6z*2 - 185z - 834. Let l be d(-4). Let 7/11 + 3/11r2 - lr = 0. Calculate r. 1/3, 7 Let i(v) be the second derivative of v7/84 - v6/30 - 31v5/40 - 7v*4/6 + 529v. Factor i(p). p*2(p - 7)(p + 1)(p + 4)/2 Let u = -23101 + 23103. Let b(y) be the second derivative of -4/5yu - 2/5y*3 + 18y + 0 - 1/15y4. Factor b(i). -4(i + 1)(i + 2)/5 Let v be ((-2)/8)/1(-12)/9. Let s(u) = u*2 - 5u + 6. Let f be s(6). Determine l so that f - 4l + vl*2 = 0. 6 Suppose -21r + 8r = -6r + 28r. Let g(c) be the second derivative of 3/10c*4 + 0c*2 + 1/5c*3 + r + 9/50c*5 - c + 1/25c*6. Let g(i) = 0. What is i? -1, 0 Let f(y) = 5362y + 418238. Let z be f(-78). Factor 20b + 212/3b*z + 7/3b*3 + 0. b(b + 30)(7b + 2)/3 Let b(c) be the second derivative of -c*4/15 - 106c*3/15 - 104c*2/5 + 2094c. Find r, given that b(r) = 0. -52, -1 Let z = 92 - 91. Let p(y) = -y3 + y2 + y. Let u(k) = 4k4 + 33k*3 + 51k*2 + 23k. Let s(v) = zp(v) + u(v). Factor s(d). 4d(d + 1)2(d + 6) Suppose -7p + 2d - 141 = -8p, -4 = -d. Let i be (p/105 - 1)/((-2)/(-5)). Factor 0x*3 + 0x + 4/3x2 - 2/3 - ix*4. -2(x - 1)*2(x + 1)*2/3 Let y(m) be the third derivative of -7/300m*6 + 0m - 2/525m7 - 2/75m*5 + 1/840m*8 + 0 + 0m*4 + 0m*3 + 43m*2. Factor y(w). 2w*2(w - 4)(w + 1)2/5 Let z = -314806 - -1574056/5. Factor -5g + z - 1/5g2. -(g - 1)(g + 26)/5 Factor 0w - 2/13w*5 - 12798/13w*3 + 0 + 12482/13w*2 + 318/13w*4. -2w*2(w - 79)*2(w - 1)/13 Let l(p) = 80p2 - 210p + 5545. Let q(g) = -49g2 + 104g - 2772. Let s(r) = 3l(r) + 5q(r). Suppose s(o) = 0. What is o? -37, 15 Factor -2649/2 + 663w2 - 3/4w*3 - 2643/4w. -3(w - 883)(w - 2)(w + 1)/4 Let b = -40037 - -160151/4. Determine f so that -3/2f*3 + 0f*4 + 0 + bf + 3/4f5 + 0f*2 = 0. -1, 0, 1 Factor -18y*2 - 151079008y + 151079008y + 27y3 + y5 - 10y4. y2(y - 6)(y - 3)(y - 1) Let h(a) be the second derivative of 3/5a2 + 1/6a*3 + 1/60a*4 + 1 - 13a. Solve h(o) = 0 for o. -3, -2 Let y(q) be the first derivative of -2q6/3 - 56q*5/5 + 86q*4 - 656q*3/3 + 262q*2 - 152q - 6645. Determine x, given that y(x) = 0. -19, 1, 2 Solve -40s2 - 34 + 14370s*3 - 85s - 28742s3 - 16 + 14367s*3 = 0. -5, -2, -1 Let -1444/3 - 545d*2 + 3686/3d + 157/6d3 - 1/3d*4 = 0. Calculate d. 1/2, 2, 38 Let -63739c*2 + 855c*3 + 3c*5 + 12c*5 + 600c - 200c4 + 62469c2 = 0. Calculate c. 0, 1, 4/3, 5, 6 Let n(z) = z4 - 2z2 - 2z + 1. Let c(f) = 54f4 + 6f*3 - 969f*2 - 1206f - 219. Let t(p) = -c(p) + 33n(p). What is u in t(u) = 0? -6, -1, -2/7, 7 Suppose 0 = -6c - 144 + 156. What is m in 33 - 19m2 - 63m - 9m3 + 19m*c + 0m*3 - 105m*2 = 0? -11, -1, 1/3 Let q(k) = 18k - 365. Let v be q(21). Suppose -24o + v + 83 = 0. Determine l, given that 0l - 16/3l2 + 32/3 + 2/3l*o + 0l3 = 0. -2, 2 Let q(k) = -k2 + 3k + 40. Let a be q(5). Suppose 6u - 2u = w + 15, 0 = -4w - 2u + a. Factor 597m*3 - 599m*3 + 0m5 - m4 + mw. m3(m - 2)(m + 1) Suppose 4r = d + 3804, -909 - 33 = -r - 2d. Let p be 2/25 + 1824/r. Factor 1/9y - 1/9y*4 + 1/3y*3 - 1/3y*p + 0. -y(y - 1)*3/9 Let w(g) = -g + 40. Let t be w(21). Suppose tc = 14c + 2p + 5, -4p + 11 = -3c. Factor 1/3ac - 4/3a*2 + a + 0. a(a - 3)(a - 1)/3 Factor -394/9 + 395/9q - 1/9q2. -(q - 394)(q - 1)/9 Let i be (-2 - (-7)/2)/((-9)/12). Let a(m) = -m - 2. Let s be a(i). Factor -6o - 3o*5 + 29o*3 + 21o*2 + 15o*4 - 56o*3 + so. -3o(o - 2)(o - 1)3 Let v(k) = -4k*2 + 3266k - 1331704. Let s(x) = -9x2 + 6533x - 2663404. Let f(t) = 4s(t) - 10v(t). Determine a, given that f(a) = 0. 816 Let p be -2 + -2 + -1 + 14352/2576. Find c such that 4/7c - pc*3 + 4/7c*2 - 4/7 = 0. -1, 1 Let z(p) = -8p*3 + 48p*2 + 194p + 234. Let r(u) = -9u3 + 51u*2 + 195u + 233. Let o(s) = -12r(s) + 14z(s). Solve o(f) = 0 for f. -3, -2, 20 Let f(s) be the third derivative of -330s2 + 3/70s*5 - 17/84s*4 - 2/21s*3 + 0s + 0. Factor f(i). 2(i - 2)(9i + 1)/7 Let l(j) be the first derivative of 0j + 1/7j6 + 81 + 0j*2 + 9/35j*5 + 3/28j*4 + 0j*3. Find t such that l(t) = 0. -1, -1/2, 0 Let b(x) be the second derivative of 2x*7/21 - 16x*6/3 + 112x*5/5 - 34x*4/3 - 226x*3/3 + 148x*2 - 152x + 1	{ "pile_set_name": "DM Mathematics" }
ltiple of 140 and 20? 140 Calculate the common denominator of -113/72 and 55/468. 936 What is the least common multiple of 575 and 25? 575 Find the common denominator of -163/168 and 107/72. 504 What is the smallest common multiple of 480 and 10? 480 Find the common denominator of -15/3839 and -24/8027. 88297 What is the common denominator of -8/39 and 137/2730? 2730 Calculate the common denominator of 145/18 and -21/110. 990 Calculate the common denominator of 18/403 and -23/1560. 48360 Calculate the lowest common multiple of 243 and 2. 486 Calculate the smallest common multiple of 30 and 245. 1470 Calculate the common denominator of 47/1512 and -24. 1512 Calculate the common denominator of -55/63 and 64/7329. 21987 What is the common denominator of -65/16 and -31/16? 16 What is the common denominator of 57/5635 and 64/5635? 5635 What is the common denominator of 61/27 and -11/111? 999 Find the common denominator of -35/1006 and -9/2. 1006 What is the least common multiple of 153 and 306? 306 Calculate the common denominator of -169/378 and 91/162. 1134 Calculate the common denominator of 3/50 and -105/22. 550 Calculate the common denominator of 151/396 and -61/324. 3564 What is the common denominator of -47/250 and -47/225? 2250 Find the common denominator of 17/60 and -101/150. 300 What is the common denominator of -137/60 and -109/1200? 1200 Find the common denominator of 99/98 and -173/84. 588 Calculate the smallest common multiple of 135 and 4875. 43875 What is the lowest common multiple of 1524 and 21? 10668 Calculate the common denominator of -151/114 and -59/1026. 1026 What is the lowest common multiple of 365 and 584? 2920 Find the common denominator of -91/120 and -97/400. 1200 Calculate the common denominator of 8/41 and 11/9. 369 What is the smallest common multiple of 7 and 275? 1925 Calculate the least common multiple of 8 and 21. 168 Calculate the common denominator of -1/4 and 95/16. 16 Calculate the smallest common multiple of 53 and 1. 53 Find the common denominator of -77/2664 and 41/7104. 21312 Calculate the common denominator of -61/1606 and -65/1022. 11242 Find the common denominator of -77/74 and 33/7. 518 Calculate the common denominator of -127/600 and 113/1200. 1200 What is the common denominator of -79/6 and 43/468? 468 Calculate the common denominator of 5/111 and 79/2424. 89688 Calculate the smallest common multiple of 18 and 108. 108 Find the common denominator of 71/45 and 32/415. 3735 Find the common denominator of 47/24 and -4/9. 72 Calculate the least common multiple of 99 and 14388. 43164 What is the common denominator of -99/32 and 67/32? 32 What is the smallest common multiple of 58 and 9? 522 Calculate the lowest common multiple of 188 and 10. 940 What is the common denominator of -16/11 and 29/3? 33 Find the common denominator of -67/354 and 179/1770. 1770 Find the common denominator of -13/136 and 101/14. 952 Find the common denominator of -77/39 and -31/156. 156 Calculate the common denominator of 149/54 and -9/2. 54 Calculate the smallest common multiple of 8 and 156. 312 What is the smallest common multiple of 6 and 2255? 13530 Find the common denominator of -65/644 and -85/3542. 7084 Calculate the smallest common multiple of 21 and 321. 2247 Calculate the common denominator of -109/198 and 97/1050. 34650 Calculate the common denominator of -23/2 and -10/29. 58 Calculate the lowest common multiple of 30 and 6354. 31770 Calculate the smallest common multiple of 1808 and 20. 9040 Find the common denominator of 99/346 and 75/26. 4498 Find the common denominator of 17/72 and 79/33. 792 What is the common denominator of 29/3860 and 113/180? 34740 What is the smallest common multiple of 21 and 111? 777 Calculate the common denominator of -169/1938 and -113/418. 21318 What is the common denominator of -87/10 and 121/10? 10 Calculate the common denominator of 103/30 and -107/150. 150 Calculate the least common multiple of 348 and 132. 3828 What is the smallest common multiple of 10 and 244? 1220 Find the common denominator of 63/2782 and 121/78. 8346 Calculate the lowest common multiple of 1470 and 42. 1470 What is the common denominator of -31/5870 and -99/40? 23480 What is the common denominator of -57/1048 and 1/40? 5240 Find the common denominator of -5/184 and 107/108. 4968 What is the common denominator of 34/5677 and -43/7299? 51093 Calculate the smallest common multiple of 3368 and 8. 3368 Calculate the smallest common multiple of 8 and 946. 3784 Calculate the lowest common multiple of 16 and 174. 1392 What is the common denominator of -73/400 and 51/608? 15200 Calculate the common denominator of -73/346 and 113/12. 2076 Find the common denominator of -67/272 and -3/646. 5168 What is the lowest common multiple of 39 and 13? 39 What is the lowest common multiple of 20 and 76? 380 Calculate the lowest common multiple of 364 and 260. 1820 Find the common denominator of 91/8 and -67/43390. 173560 Calculate the lowest common multiple of 490 and 30. 1470 What is the lowest common multiple of 48 and 620? 7440 Calculate the common denominator of 41/2784 and -191/840. 97440 What is the lowest common multiple of 203 and 435? 3045 Find the common denominator of 48/13 and -1/16. 208 Calculate the smallest common multiple of 19 and 126. 2394 Calculate the common denominator of 121/1450 and 3/250. 7250 What is the common denominator of 3/272 and 49/64? 1088 What is the smallest common multiple of 48 and 24? 48 Calculate the common denominator of 37/76 and -61/164. 3116 What is the smallest common multiple of 10 and 53? 530 Calculate the least common multiple of 12 and 610. 3660 What is the common denominator of -181/360 and 167/180? 360 Calculate the lowest common multiple of 70 and 80. 560 Find the common denominator of -69/22 and 61/51774. 569514 Calculate the smallest common multiple of 16 and 56. 112 Find the common denominator of -52/2973 and -61/27. 26757 What is the lowest common multiple of 520 and 52? 520 What is the least common multiple of 48 and 6? 48 Calculate the common denominator of 81/8 and -59/44. 88 What is the common denominator of 4/3 and -28/1165? 3495 Find the common denominator of 49/730 and 109/50. 3650 Find the common denominator of 21/2 and -103/30. 30 Calculate the least common multiple of 6 and 264. 264 What is the lowest common multiple of 5919 and 33? 65109 Find the common denominator of -107/1720 and 37/2408. 12040 What is the smallest common multiple of 75 and 500? 1500 What is the common denominator of -7/313 and 21/5? 1565 What is the common denominator of 125/36 and 38/1041? 12492 Find the common denominator of -145/6 and -91/150. 150 Find the common denominator of 155/264 and -9/20. 1320 What is the least common multiple of 24 and 4? 24 Find the common denominator of 73/117 and 5/286. 2574 Calculate the least common multiple of 308 and 693. 2772 Find the common denominator of 7/466 and -63/16. 3728 Find the common denominator of 3/1115 and 47/150. 33450 Calculate the lowest common multiple of 136 and 102. 408 Find the common denominator of 39/107 and 67/8. 856 Find the common denominator of -29/2132 and -19/104. 4264 Calculate the lowest common multiple of 661 and 9. 5949 What is the least common multiple of 8 and 13? 104 Find the common denominator of -79/2808 and -71/1404. 2808 What is the smallest common multiple of 576 and 8? 576 What is the common denominator of 31/109 and 149/6? 654 Calculate the lowest common multiple of 531 and 15. 2655 What is the common denominator of -31/1491 and -19/8? 11928 Calculate the lowest common multiple of 232 and 145. 1160 Calculate the common denominator of -1/1960 and 29/1540. 21560 Calculate the common denominator of -40/231 and -25/12. 924 Find the common denominator of 109/2436 and -145/12. 2436 Calculate the common denominator of -29/25 and -15/2. 50 What is the common denominator of 31/30 and -133/18? 90 Find the common denominator of 9/4352 and -69/112. 30464 Calculate the common denominator of 39/20 and -157/78. 780 Calculate the common denominator of -99/340 and 79/100. 1700 Calculate the lowest common multiple of 110 and 8. 440 Calculate the least common multiple of 697 and 187. 7667 What is the common denominator of 67/10 a	{ "pile_set_name": "DM Mathematics" }
Calculate the remainder when q is divided by m. 25 Suppose 0 = -8m + 4m + 120. Let p(n) = n + 16. Calculate the remainder when m is divided by p(-5). 8 Let a(u) = -u*3 + 31u*2 + 221u + 90. Suppose 0 = -3q + 24 - 6. Suppose qf - 2f = 56. Calculate the remainder when a(37) is divided by f. 11 Let j = -68 + 72. Calculate the remainder when 18 is divided by j. 2 Let j = -43 - -71. Let o be 3/625. Let w(t) = -t2 + 4t + 13. Calculate the remainder when j is divided by w(o). 4 Let h be (-9)/(-36) + (-187)/(-4). Let p = -42 + h. What is the remainder when 36 is divided by p? 1 Let u(j) = 9j3 + 1. Let a be 0 + (-4 + 4 - 0). Suppose 0 = h + 4k - 22, ah + 4k = 2h + 4. Calculate the remainder when u(1) is divided by h. 4 Let m be 12/(-10)(-2480)/(-12) + 3. Let a = m - -360. Calculate the remainder when a is divided by 13. 11 Let g = -137 + 149. Calculate the remainder when 65 is divided by 285/g + 14/(-8) + 2. 17 Let b(p) = -3p2 - 8p - 7. Suppose -3i + 15 = -6i. Let t be b(i). Let f = 72 + t. Calculate the remainder when f is divided by 11. 8 Suppose 3b = -z - 0b, 3z + 3b = 0. Suppose z = 3f - f. Suppose f = -h + 5 + 27. What is the remainder when h is divided by 11? 10 Let z(t) = t3 + 22t2 - t - 5. Calculate the remainder when 32 is divided by z(-22). 15 Let x(s) be the second derivative of s5/20 + 5s4/3 - s3/6 - 17s*2/2 + 10s. Calculate the remainder when 17 is divided by x(-20). 2 Let h = -10 - -10. Let f be h(-1 + 0)/2. Suppose -x + 3x - 38 = f. What is the remainder when x is divided by 11? 8 Suppose 5g + g + 3240 = 0. Calculate the remainder when 298/4 + 3/(-6) is divided by 1 + 85/6 - (-90)/g. 14 Let x(y) = -5y + 8. Let h be 12/(-20) - (-69)/15. Let g be x(h). Let r = -1 - g. Calculate the remainder when r is divided by 4. 3 Calculate the remainder when 2 + (-1 - -2) + 21 + 60 is divided by ((-58)/8)/((-3)/12). 26 Let p(b) = 5 - 3b + 5 + 5b*2 - 1 - 3b*2. Let d be p(6). Suppose 2 = 2o - 0a - 5a, 5o = -2a + d. What is the remainder when 43 is divided by o? 10 Suppose 0 = -4u + 2z + 2 + 6, -5z - 20 = 0. Suppose l - 1 - 12 = u. What is the remainder when 36 is divided by l? 10 Let v be 8/(-3)(7 - (-3 - -40)). Let u = 127 - v. Calculate the remainder when u is divided by 18. 11 Let n = -57 + 57. Let h(m) = 104m2 - m. What is the remainder when h(1) is divided by (-2)/((-1)/13 - n)? 25 Suppose 24 = 3m + 11v - 14v, -2m - 2v + 12 = 0. Calculate the remainder when 34 is divided by m. 6 Suppose -8k + 4g = -9k + 24, 3k - 111 = g. Calculate the remainder when 176 is divided by k. 32 Let k be (-1)/2 + (-4)/(-8). Suppose -5r + kr + 25 = 0. Suppose -2q + 3t + 60 = 2q, rt = -20. Calculate the remainder when 33 is divided by q. 9 Let b(r) = 2r2 - 22r - 2. What is the remainder when 57 is divided by b(-2)? 7 Let s(r) = -2r2 + 7r - 5. Let i be s(4). Calculate the remainder when i/6 + 2 - (-831)/6 is divided by 35. 34 Suppose 200 = 24k - 664. Suppose -5t + 4t - 1 = 0, 0 = 4h + 4t - 556. What is the remainder when h is divided by k? 32 Calculate the remainder when -3 - (-16 - (4 + -2)) is divided by (-6)/27 - 166/(-18). 6 Let q = 2 + 4. Let a = q + -5. Calculate the remainder when 12 is divided by a3 + -7 + 9. 2 Calculate the remainder when 50 is divided by 10 - -2 - (-12)/12. 11 What is the remainder when ((-80)/14)/4(-161)/1 is divided by 11? 10 Suppose 3m + 3a = 33, 4m + 4 = 3a + 13. Let p(k) = 20k2 - k - 1. Calculate the remainder when p(-1) is divided by m. 2 Let j(q) = q2 + 4q + 7. Let x be j(8). Suppose -d - 4v + 9 + 4 = 0, -5d = v - x. What is the remainder when d is divided by 12? 9 Suppose 2m - 4o = 8, -o - 1 = -3m + 16. What is the remainder when 147 is divided by m? 3 Let r(a) = 3a2 - 5. What is the remainder when r(2) is divided by (-15)/12(-16)/4? 2 Suppose 4n - 2 - 18 = 0. Suppose nw - 8 = -4d + 5, d - 3 = -w. What is the remainder when -38(-1 - w/(-2)) is divided by 11? 8 Let q(x) = -x*2 - 15x + 5. Let d be q(-14). Suppose -221 = -5k - 4v, 5v + d = -k + 80. What is the remainder when k is divided by 7? 6 Calculate the remainder when 37 is divided by 12/2 + -7 + 5 + 6. 7 Let c(y) = -2y*3 + 11y - 10. Calculate the remainder when c(-6) is divided by 17. 16 Let g be 21/28 - (-13)/4. Suppose 0 = 5v + 5, 104 = 2i + 2i + gv. What is the remainder when i is divided by 7? 6 Let c = -162 + 177. What is the remainder when 132 is divided by c? 12 Calculate the remainder when (65/25 - 7)15/(-6) is divided by 2. 1 Let b = -1493 + 1504. What is the remainder when (-180)/(-27)(-18)/(-4) is divided by b? 8 Suppose 0 = 6r - 5r + 6. Calculate the remainder when (252/(-30))/(r/20) is divided by 8. 4 Let k be (2/(-6))/(6/(-108)). Let h(j) = 2j - 11. Let u be h(k). Suppose 5n - 46 = -u. What is the remainder when 15 is divided by n? 6 Let c(g) = g*3 + g + 19. What is the remainder when 32 is divided by c(0)? 13 Suppose -92 = -18z - 20. Calculate the remainder when 48 is divided by z. 0 Calculate the remainder when 158/6 - (-70)/105 is divided by 24. 3 Suppose 114b - 111b - 210 = 0. What is the remainder when b is divided by 33? 4 Let s = 11 + -4. Suppose f = 4q - 117, 119 + 4 = 4q + f. Let w = -3 + q. Calculate the remainder when w is divided by s. 6 What is the remainder when 7 + (1 - (-4 + -4)) is divided by 1 + (1 - -2 - 0)? 0 Let q = -55 + 63. Calculate the remainder when (12 - 5 - 5) + (1 - -17) is divided by q. 4 What is the remainder when 34 is divided by (640/56)/(-16)-14? 4 What is the remainder when -9 + 221/26 + (-195)/(-2) is divided by 49? 48 Suppose 28 + 50 = 6s. Let x(a) = -2a - 9. Let z be x(-6). Suppose 200 = 4q + 5m, -3q = -2m + zm - 150. What is the remainder when q is divided by s? 11 Suppose -38v - 43v + 64314 = 0. What is the remainder when v is divided by 19? 15 Let p = -27 + 48. Let l(t) = t*3 + 15t*2 + 13t + 47. What is the remainder when l(-14) is divided by p? 19 Let p = 1912 - 1829. What is the remainder when p is divided by 7? 6 What is the remainder when (24 + -11 - 10)/((-1)/(-52)) is divided by 32? 28 Let v be ((-5)/20)/(3/(-36)). Suppose 2b = -3g + 67 - 16, -47 = -2g + vb. Let t = 133 + -80. Calculate the remainder when t is divided by g. 15 Suppose 20d = 17d + 15. What is the remainder when (-2 - (-402)/d) + (-12)/(-20) is divided by ((-2)/4)/((-1)/32)? 15 Let l = -1772 - -1814. Calculate the remainder when l is divided by 9. 6 Let k = 106 + -97. Suppose 29 = b + 5. Calculate the remainder when b is divided by k. 6 Suppose 0 = 16j - 199 - 121. Calculate the remainder when (j/4)/563 is divided by 22. 19 Let d = -391 - -411. Calculate the remainder when 48 is divided by d. 8 Suppose 4j + 161 - 177 = 0. What is the remainder when 6 is divided by j? 2 Suppose -282 = -367w + 361w. What is the remainder when 232 is divided by w? 44 Let l = -262 + 304. What is the remainder when 65 is divided by l? 23 Calculate the remainder when (2/(-8))/(53/(-13568)) is divided by 35. 29 Let g = 858 + -834. What is the remainder when 692 is divided by g? 20 Suppose -17w = -1130 - 2304. Calculate the remainder when w is divided by 66. 4 Suppose 3z = z + 118. Suppose -65 = -3g + 5c, -13g + 12g = c - 11. Calculate the remainder when z is divided by g. 14 Let o = -8 - -10. Suppose 0 = 2u + ov - 64, v - 39 = -2u + 25. Calculate the remainder when u is divided by 10. 2 Suppose -60 = 2o - 3o. Let z(w) = -w*3 - 21w*2 - 54w + 21. Calculate the remainder when o is divided by z(-18). 18 Let p = -788 + 797. Calculate the remainder when 78/(((-3)/2)/(-1)) is divided by p. 7 Let o = -60 + 43. Let i = o - -29. Suppose -16j = -ij - 172. Calculate the remainder when j is divided by 11. 10 Let x = 82 - 68. Suppose 3k = 2t + 9, 2k - 5k + t = -12. Calculate the remainder when (-4)/(-10) + 193/k is divided by x. 11 What is the remainder when (261/(-51) - -5) + (-14460)/(-85) is divided by 36? 26 Let f be (-2)/12 + (-31)/(-6). Suppose 5d - 13 = -fh + 12, 29 = 3h - 4d. What is the remainder when h is divided by 5? 2 Let d(r) = 2r2 - 17r + 40. Calculate the remainder when d(8) is divided by 9. 5 Let v = 65 + -52. What is the remainder when 67 is divided by v? 2 Suppose -4*n - z + 122 =	{ "pile_set_name": "DM Mathematics" }
= 3 + -7. Let t be -2(15/6)/(-5). Let k(x) = -3x*2 + x. Let y be k(t). Sort y, 2, u. u, y, 2 Suppose 0 - 52 = -4u. Suppose -u = v - 2b - 2b, 1 = -v + b. Put -4, 0, v in ascending order. -4, 0, v Let o = -142/205 + 12/41. Put o, 2, -3, 4 in ascending order. -3, o, 2, 4 Let g = 17 + -15. Suppose s - 5u - 7 = 0, 28 = gs + 2s + 5u. Sort s, -2, -3 in increasing order. -3, -2, s Suppose 0 = 53k - 50k + 69. Sort 2, k, -4 in descending order. 2, -4, k Suppose -5u = -31 - 14. Let f = 7 - u. Put 5, f, 0 in ascending order. f, 0, 5 Let c = -1.3 - -0.3. Let f = -12.5 + 11. Let w = f - c. Sort w, 1, 1/5 in descending order. 1, 1/5, w Let s = -5 - -5.06. Let z = -0.34 - s. Put -1, 0.02, z in increasing order. -1, z, 0.02 Let x = 35 + -12. Let h = 23.1 - x. Put -0.5, h, -4/7 in increasing order. -4/7, -0.5, h Let f be (-5 - (-480)/95)2. Put f, -1/4, 1/9 in decreasing order. 1/9, f, -1/4 Suppose -3g - 5s + 14 = 0, g - 14 = -3s - 4. Let p be g/(-10) + (-2)/10. Put p, -3, -0.3 in increasing order. -3, -0.3, p Let q = 0.9 + 4.1. Let a = q + -2. Let n = 0.3 - 2.3. Sort -1, n, a in decreasing order. a, -1, n Suppose 0 = i - 2t - 7, 4t + 5 + 15 = 0. Sort 3, i, 1 in descending order. 3, 1, i Let s be 1/(0 - 1)5. Sort 2, -3, s in increasing order. s, -3, 2 Let z = 391 + -395. Let u = 1 - 3. Sort u, z, 5. z, u, 5 Let w = -5 + -1. Let p be (-32)/(-6) - (-2)/w. Suppose 0 = -t + 1, 5b + 3t - 4t = -21. Sort p, b, 3. b, 3, p Let d = -34 - -34. Put -1/4, -0.5, d, 3 in descending order. 3, d, -1/4, -0.5 Suppose 4t + 4g - 8 = 6g, -4 = t - 2g. Put -8, 0, t in ascending order. -8, 0, t Let j = -25401 - -126563/5. Let r = -88 - j. Sort r, -0.2, -0.3 in descending order. r, -0.2, -0.3 Let k = 27.1 - 26. Let c = 1 - k. Sort -5, 0.1, c in ascending order. -5, c, 0.1 Suppose -3f = -2w - 79 - 30, -4f + 149 = w. Suppose -5i - 3d = -f, 10 = -i + 5d - 5. Let o = 0 - -0.2. Put i, o, 0.5 in descending order. i, 0.5, o Let a be ((-10)/(-6))/((-6)/(-18)). Let s be (1 - 1/1)/(-2). Sort 1, s, a in descending order. a, 1, s Let k = -1.1 + -4.6. Let i = -6 - k. Put i, 0.1, 5 in ascending order. i, 0.1, 5 Suppose 20r + 35 = 27r. Put -4, -34, r in descending order. r, -4, -34 Let z = 17 - 15. Sort -2, -3, z in decreasing order. z, -2, -3 Let d = 3.89 + 0.11. Let g = 4 + -5. Put d, g, -4 in ascending order. -4, g, d Let m = -146 - -2480/17. Put -5, 2, m, 1 in decreasing order. 2, 1, m, -5 Let i = 0.15 + 5.85. Let x = i + -6. Let v(j) = 4j*3 - 2j*2 + j. Let y be v(1). Put 3/2, x, y in increasing order. x, 3/2, y Let k be -6(-9)/((-243)/6). Put 0.12, k, 4 in decreasing order. 4, 0.12, k Suppose 5l = r + 9, -87 = 3r + 2l + 3l. Let a = r + 23. Put -3, a, 2 in increasing order. -3, a, 2 Suppose 3j = -0n - 3n - 6, 0 = 2n + 4. Put j, 4, -1, 1 in descending order. 4, 1, j, -1 Let k(j) = 2j3 - j2 + 1. Let g be 2/1(-14)/(-4). Suppose 2p = m + g, -p - 3 = -3m - 19. Let n be k(p). Sort -1, n, 4 in ascending order. -1, n, 4 Let r = -0.98 + -0.02. Sort -0.3, r, -2/7 in decreasing order. -2/7, -0.3, r Let c be 0/2 + (0 - -1). Suppose -4z + 6 = -6. Sort -2, z, c in descending order. z, c, -2 Let a be ((-2)/(-5))/(3/(-5)). Let k = -43 - -42. Sort 3/2, a, k. k, a, 3/2 Let b be (-1)/2((0 - 0) + 1). Put -11, -3, -1, b in descending order. b, -1, -3, -11 Let r be 156/(-21) - -5 - 4/7. Sort 5, r, -5, 6 in descending order. 6, 5, r, -5 Let z = 156 + -148. Sort z, 5, -1, -4 in decreasing order. z, 5, -1, -4 Let w(h) = h*3 - 7h*2 - 2h + 11. Let p be w(7). Sort p, 2, -1, 0. p, -1, 0, 2 Let c = 8.2 + -8. Let v be 1/(-4) + (-15)/4. Sort 1/4, c, v. v, c, 1/4 Let a be (-2)/(-12) - (-3)/((-90)/(-145)). Sort 4, a, 1. 1, 4, a Suppose -34r + 39r + 5 = 0. Sort -3, r, 2, -4 in descending order. 2, r, -3, -4 Let g = -4 - -8. Suppose -2o + 0o + g = 0. Sort 1, 3, o in ascending order. 1, o, 3 Let v = 0.066 + -5.066. Sort 4/5, -2, 2, v. v, -2, 4/5, 2 Suppose 5m = -5, -6j + 3m - 17 = -j. Sort -7, j, 2, 4 in decreasing order. 4, 2, j, -7 Suppose 3t - 2t + 2 = 0. Let s(l) = -2l + 8. Let b be s(6). Sort 2, t, b. b, t, 2 Suppose 2 = c - 3. Suppose -2y = -4l - 16, l + 3y = -3l + 4. Let u be l - (9 - -1)/(-2). Put 1, c, u in descending order. c, u, 1 Suppose 1 + 23 = -2i. Let f = i - -8. Let w be (-2)/((8/6)/2). Put w, -1, f in decreasing order. -1, w, f Let s(m) = 45m. Let h be s(2). Put -1, h, 3 in decreasing order. h, 3, -1 Let g = -38 - -38. Sort -11/3, g, 2, -0.5. -11/3, -0.5, g, 2 Suppose -z - 5 + 6 = 0. Sort z, -4, -9 in descending order. z, -4, -9 Let n = 0.05 - 4.05. Let w = -4 - 1. Sort n, -3, w in descending order. -3, n, w Let s = 3 - 0. Put 6, 0.4, s, 0.02 in descending order. 6, s, 0.4, 0.02 Let q be (-51)/(-15) - 4/10. Suppose -7 + 1 = qb. Put b, -4, 4 in descending order. 4, b, -4 Let v(w) = w2 - 13w + 7. Let q be v(12). Sort q, 2, -3. q, -3, 2 Suppose -g + 5y = 1, -3y + 15 = -0g + 3g. Suppose 0 = -3l + 10 - 1. Sort l, g, -2/11 in decreasing order. g, l, -2/11 Let i be (-2)/(-3 + 18 - 0). Let c = -85/438 + 2/73. Sort i, c, 5 in ascending order. c, i, 5 Let w = 0.12 - -0.08. Put w, -5/7, -1/4 in decreasing order. w, -1/4, -5/7 Let p = -2 + -2. Let v be (p/6)/(2/(-6)). Suppose 0 = 3u + vu. Sort -2, 2, u in descending order. 2, u, -2 Let m = -1663/9 - -185. Suppose 0q = -q + 5. Sort m, -3, q. -3, m, q Let i = 36 - 37. Sort 7, i, 0. i, 0, 7 Let v = -0.01 - -7.01. Let b = 133.3 - 140. Let z = v + b. Sort -3/5, z, 0.2 in increasing order. -3/5, 0.2, z Let n = -929/5 + 186. Put 3, -14, n in descending order. 3, n, -14 Let r = 4 + -4. Let q be (r + 5 + -3)/2. Suppose s + 5x = -4 - 8, x = -4s + 9. Sort -4, q, s. -4, q, s Let k(n) = -n*3 - 7n*2 - 7n - 9. Let t be k(-6). Sort t, 3/4, 2/11, -13 in decreasing order. 3/4, 2/11, t, -13 Let g = -0.2 + 1.9. Let u = g + -0.7. Put u, -1/6, -2/11 in decreasing order. u, -1/6, -2/11 Suppose -2q + 5 = 4v + 1, 2q - 24 = v. Sort q, -1, 5 in ascending order. -1, 5, q Let x = -49 - -51.7. Let m = -3 + x. Let r = -0.6 - 1.4. Sort 0.1, m, r in descending order. 0.1, m, r Let t = 0.038 - 0.138. Let d = 43 + -29. Let l = d + -21. Sort t, l, 1/4 in decreasing order. 1/4, t, l Let l be 2/(-11) + 3652/121. Sort 5, l, -2 in decreasing order. l, 5, -2 Suppose -p = 4p + c - 24, 0 = 4p + 5c - 36. Sort p, 2, -3 in decreasing order. p, 2, -3 Let d be 1/(-12) + 3 + -3. Let z = d - 1/4. Put z, 0, -5 in decreasing order. 0, z, -5 Let z(a) = a*2 + 7a + 11. Let g be z(-6). Put 3, g, 0, -26 in decreasing order. g, 3, 0, -26 Let w = -2.9 - 0.1. Let f = -6 - w. Sort -1/6, -2/7, f in decreasing order. -1/6, -2/7, f Suppose -4z = 3t - 20, -4z + 20 + 0 = t. Put t, -1, -3, -2 in increasing order. -3, -2, -1, t Let u be 34/(-66) + (-3)/(-9). Put -3, -4, u in descending order. u, -3, -4 Suppose d - 6d + 10 = 0. Put 4, 3, d in increasing order. d, 3, 4 Let v = -18 - -52/3. Let g be 36/(-19) + -3 + 5. Put g, v, -0.3 in increasing order. v, -0.3, g Let n = -0.1 - -1.9. Let h = 2 - n. Sort h, -3, -1 in decreasing order. h, -1, -3 Let j be (-2)/3(-12)/(-8). Let o = 122/3 - 40. Sort o, -2/7, j in ascending order. j, -2/7, o Let n = 20 - 2. Let a = n + -16. Let c be -1(3 + -1)2. Sort -5, c, a. -5, c, a Let a = -24 - -43. Let b = a + -19.5. Put b, 0.4, -1 in descending order. 0.4, b, -1 Let r = 0.024 - 10.024. Sort -3, -0.4, r in increasing order. r, -3, -0.4 Let r = 0 + -4. Suppose 10 = 2x, 5n = n + 4x - 24. Let t = -1/2 - n. Sort r, t, -2/13 in increasing order. r, -2/13, t Let r = 16.3 + -16. Sort 3, r, -2, -3/2. -2, -3/2, r, 3 Suppose -3o - 4 - 2 = 0. Put -3, -5, o in descending order. o, -3, -5 Suppose 4t = -0t + 16. Suppose 2k = -4o + 2, -5k + 4 = to - 7. Let j be ((-1)/k)/(21/(-18)). Put 0.2, j, 3 in decreasing order. 3, j, 0.2 Let d = -116 - -113. Let o = 9 - 5. Sort 3, d, o in increasing order. d, 3, o Let v = 3.5 - -1.5. Put v, 0.05, 3 in descending order. v, 3, 0.05 Let a = -17.44 - -18. Let u = a + -0.06. Sort u, -3/2, 2/5 in descending order. u, 2/5, -3/2 Let n be (7 - 1)/(0 + -2). Suppose 6p - 35 = -p. Sort 4, p, n in descending order. p, 4, n Let i = 48 - 48. Sort 3, i, 0.5 in ascending order. i, 0.5, 3 Let c(h) = -3*h - 4. Let k be c(-4). Let g be ((-18)/24)/(2/k). Sort 1, -5, g in decreasing ord	{ "pile_set_name": "DM Mathematics" }
4/5? 80 Let u = 1774 - 1760. What is the smallest common multiple of u and 130? 910 Let k = 44/133 + -1219/3857. Find the common denominator of k and 95/28. 812 Suppose -t + 106 = t. Let l = t + -37. Suppose 0 = -2d + 5s + 14, 4d + 34 - 48 = 3s. Calculate the least common multiple of l and d. 16 Let v = -251 + 359. Calculate the lowest common multiple of v and 9. 108 Suppose -24x + 89 = -103. Calculate the lowest common multiple of 12 and x. 24 Suppose 0b = q + 2b - 93, -5q = 4b - 447. What is the common denominator of (-176)/26(5 - q/18) and -50/11? 429 Let s = 806 - 8083/10. What is the common denominator of 81/152 and s? 760 Let n(o) = -o*3 + 12o*2 + 15o + 3. Let p be n(12). Suppose -181 - p = 4x. Find the common denominator of 13/10 and (-209)/x - 17/119. 130 Let b(f) = -4f*3 + 0f + 1 - f3 + f + f3. Suppose -36 = -5z - 4i, 2z + i - 14 = -i. Calculate the lowest common multiple of z and b(-1). 8 Suppose -5h - 5u = -0h + 95, 3h - 2u = -62. Calculate the smallest common multiple of 7 and 15-62/h. 63 Let s = -4 - -2. Let d = s + 19. Calculate the least common multiple of 10 and d. 170 Suppose 5q - 40 = -4p, 2p + 12 = 2q - 4. Suppose -g + 8g = 140. What is the smallest common multiple of q and g? 40 Let i(l) = 46l3 + l2 - l - 1. Let q = -1 + 0. Let d = -31/171 + -4105/1881. What is the common denominator of d and i(q)? 11 Suppose 508 = 4w + 4n, -4w - 5n = -0n - 507. Let x = 32 + w. Calculate the common denominator of -3 + 4/(x/604) and -61/14. 70 Suppose 337 = 3r + 2p - 12, r + 5p = 125. Suppose -4j - 27 = -r. What is the smallest common multiple of 4 and j? 44 Let f be (-4)/(-20) + (-69)/395. Let l = 683/1106 + f. Calculate the common denominator of 2/3 + 82/12 and l. 14 Calculate the lowest common multiple of 822 and (26/(-52))/(1 + (-23)/22). 9042 Let r = 196427/4850 + -1/2425. Let m be (-30593)/8(-8)/(-20). Let d = -1530 - m. Calculate the common denominator of d and r. 20 Let c = -13 - -16. Let q(b) = b - 4. Calculate the smallest common multiple of c and q(7). 3 Calculate the lowest common multiple of (9/4)/((-7)/(-56)) and 8. 72 Let v be 0 - 1 - (-105)/57. Let f = 337/209 + v. What is the common denominator of 0 - ((-82)/(-18) + (-46)/4) and f? 99 Let k be ((-4)/(-12))/((-1)/(-78)). Let l = k - 16. Let p(b) = b3 + 4b*2 + 4b + 6. What is the least common multiple of p(-3) and l? 30 Let t be 1077798/228 - 2/(-4). Let j = t - 453890550/96007. Let h = j + -722723/60636. Calculate the common denominator of h and 25/6. 12 Let k be 15 + -18 - (-4 + 1). Suppose -u + k + 36 = 2d, 0 = d - 3. Calculate the least common multiple of u and 33. 330 Suppose -d + 5p = -3d - 15, 3d = 3p + 30. Suppose -5r + 4s + 1 + 6 = 0, -4s = dr - 23. Calculate the smallest common multiple of r and 21. 21 Calculate the common denominator of 19/7 and -28514/(-3717)(-6)/(-8). 826 What is the common denominator of -119/30 and 1-2 - 13/(5200/(-1112))? 150 Let h = -632549/5 - -128661. Let b = 4293/2 - h. Calculate the common denominator of b and 42. 10 Suppose 0 = 14k - 473 + 375. What is the least common multiple of k and 11? 77 Let o(j) = -7j*2 - 5j - 5. Let s be o(-2). Let r = s - -25. What is the least common multiple of r and 24? 24 Let d(m) = -33m - 76. Let a be d(13). Find the common denominator of (-10)/5a/(-100) and 230/(-21) + 4/14. 30 Let b(a) = 1457a2 + 2a*3 - 1460a*2 + 4 - 3a*3. Suppose 5v = 2v + 3. Calculate the least common multiple of v and b(-3). 4 Let q(h) = 154 + h2 + 11h + 8h - 154. Suppose -51 = -4s - 19. Calculate the smallest common multiple of s and q(-20). 40 Let o = 12/205 + -8596/6765. Calculate the common denominator of o and -52/63. 693 Let p = -40 - -42. Suppose 3m = d - 13, -2m = pd - m - 19. What is the least common multiple of 64 and d? 320 Let g = -416725 + 27086512/65. Let k = g + 71/26. Calculate the common denominator of k and -57/22. 110 What is the least common multiple of 8 and 90/21 - 30/105 - -164? 168 Let g(x) = x + 17. Let u = 24 - 11. Suppose -v = -u - 5. Calculate the least common multiple of v and g(-11). 18 Find the common denominator of 25/27 and 7/(-49) - (6 - (-21310)/(-3444)). 2214 What is the lowest common multiple of ((-7)/(-3) - 0)/((-2)/(-12)) and 2? 14 Let a be ((-2)/(-2))/((3 + 0)/102). Suppose 0 = 3t + 2n - a, -t + 5n = 3n - 22. Let s = -12 - -26. Calculate the smallest common multiple of t and s. 14 Suppose 31 = 5r + 11. Suppose 4q + 32 = rc, 3c + c - 30 = 3q. What is the least common multiple of 11 and c? 66 Find the common denominator of 0/6 + 57/30 and 245/(-28) - 4/2. 20 Suppose -4v + 5 = 5i - 40, 0 = -i - v + 9. Calculate the smallest common multiple of 15 and i. 45 Suppose 0 = -2n - 4n. Suppose 4p - 21 = 5c, 0 = -2c - nc - 2. Suppose 4 = 2i + 2. Calculate the least common multiple of i and p. 4 Let l = -219 - -112. Let j = l + 147. What is the least common multiple of j and 20? 40 Let s = -2/4381 + -442461/43810. Suppose -10v = -2v + 4320. Calculate the common denominator of (-3)/(-50)(v/(-8))/1 and s. 20 Let t be -1 + -2 + 915158/(-40). Let z = t - -22877. Let v = -20/13 + 667/104. Find the common denominator of v and z. 40 Let b be ((-3)/2)/(15/(-40)). Let q(p) = -p*3 + 5p*2 - 3p - 4. Let k be q(b). Calculate the common denominator of ((-82)/2)/(-3 + k) and 43. 3 Let a = 2593487/96 + -27016. Let r = 1033/60 - 47/3. Find the common denominator of a and r. 480 Let a(u) = u*3 + 12. Suppose -4 = 3f + 4m, 0f - m = -f + 1. Calculate the least common multiple of 20 and a(f). 60 Suppose c + 16 = 21. What is the common denominator of 5/(c/2) + (-213)/(-54) and -115/12? 36 Let b be (-3 + -1)(-22423)/(-5). Let c = 17794 + b. Let x = -149 - c. What is the common denominator of x and 77/2? 10 Let r(h) = -h2 - 3h + 8. Let k be r(-9). Let i = k - -64. Calculate the common denominator of (-12)/i + 422/48 and -71/2. 8 Let r = -108 + 731/6. Calculate the common denominator of 59/4 and r. 12 Suppose 2p - 48 = -3t - 0p, 2t - 3p = 45. Calculate the smallest common multiple of 18 and t. 18 Let k = 1349 - 1249. Calculate the lowest common multiple of 44 and k. 1100 Suppose i + 80 = 112. What is the smallest common multiple of i and 136? 544 What is the common denominator of -139/18 and 39/(-54) - (-350)/132? 198 Suppose 4l = 2l - 2. Let k be 68/4 - l3. Find the common denominator of 8/3 and 922/k + 6/15. 6 Let n = 1425251/54450 + -1309/50. Let f = n + 75211/15246. Calculate the common denominator of f and (-78)/417/306. 84 Let a be ((-3)/15 + 12/10)/16686. Let h = -203017/66744 + a. Calculate the common denominator of -5/12 and h. 24 Let k be 2/4 - 34/116. Let r = k + 388/87. Let x = -49897/10 + 4985. Calculate the common denominator of r and x. 30 Let u be (-389966)/2730 - (-4)/(4 - -16). Let l = u - -1842/13. Calculate the common denominator of -11/3 and l. 21 Suppose 3 = 2c - 3z, -c - z - 2 = -2c. What is the common denominator of 4/((-192)/87) + c/(-12) and -77/16? 16 Let c(j) = -2j*2 + j + 9. Let w = 0 - -1. Suppose 3r - 31 + w = 0. Calculate the lowest common multiple of c(0) and r. 90 Let g = 60449/1480 + -1917/40. Let q = g + -1339/370. What is the common denominator of q and 170/(-24) - (-2)/6? 20 Suppose -17y + 13y = 36. What is the common denominator of (-109)/12 + 2 - y/(-12) and 57/46? 138 Calculate the smallest common multiple of 9 - (-165)/(-22) - 319/(-2) and 115. 805 Suppose -2t - t = -12. Suppose -2g = -22 + t. Suppose 4i + i - 18 = -3d, -i + 4d - 1 = 0. Calculate the lowest common multiple of i and g. 9 Find the common denominator of 161/24 + 14 + -17 and 14/9. 72 Let c = -1042 - -2127/2. Let s = 4623 + -9315/2. Calculate the common denominator of c and s. 2 Calculate the least common multiple of 16 and (-3 - -34)/(12/24). 496 Let l(h) = -6h - 58. Let x be l(-6). Let y(m) = -306m3 - 2m*2 - 2. Let k be y(-2). Find the common denominator of -91/22 and (-4)/x - k/220. 110 Calculate the common denominator of (-3)/35(-195)/(-2) and -107/14. 14 Let l = -47643/8 + 5964. Calculate the common denominator of l and 79/14. 56 Calculate the common denominator of 301/(-210)*(-5)/6 and ((-488)/24 - -11)/(10/6). 180 Let y = 284 + -272. Calculate the lowest common mult	{ "pile_set_name": "DM Mathematics" }
(-2k2 + 6k*2 + 6k*4 - 21k*2)((-2 - 1 + 4)(2 + 3 - 4) + (-7 + 5 - 3)(11 + 2 + 3)) in the form ik + p + tk*2 + jk*3 + gk*4 and give i. 0 Rearrange 8a*2 + 62a - 171a + 40757a*3 - 40764a*3 to the form ra*2 + z + va + ba3 and give b. -7 Rearrange 150i*2 - 2i*3 + 0i*4 + 147i2 - i4 - 294i2 + 12i + 0i3 - 2 to q + vi*4 + mi*3 + ki + hi2 and give k. 12 Express (6j - 6j + 17j)(-1 + 2 - 3)(24499 - 92j - 24499) in the form rj + w + kj2 and give k. 3128 Express (2382 - 1245 - 1302)(t*4 + 2t*4 - 4t*4) as ht + st2 + xt*3 + f + zt*4 and give z. 165 Rearrange (-5j*2 + 14j*2 - 46j*2)(2j2 - j2 - 2j*2) - 7j*4 + 5j*4 - 64j*4 to the form m + aj + pj4 + sj*2 + tj*3 and give p. -29 Express -74t - 2 - 3t4 + 77t - 110t2 + 113t*2 as rt*4 + yt + n + st3 + vt*2 and give n. -2 Express (3v - v + 0v)(9 + 5 + 19) + v + 6v - 3v + 3v as i + yv and give y. 73 Express 153w + 6531 - 6531 + (-w + 2w - 2w)(-2 + 4 - 1) + (-6 + 0w + 2 + w)(-3 + 8 + 0) as ow + v and give v. -20 Express -29u + 2u3 - 3 + 647u - 1229u - 215u - 1079u in the form du*2 + vu + n + ou3 and give v. -1905 Rearrange 3 - 706w*2 - 226w - 13 + 703w2 to rw + kw2 + b and give k. -3 Rearrange -20528k*2 - 9 + 41093k*2 - 20541k*2 - 8k to the form lk2 + t + ck and give t. -9 Rearrange -4234q4 + 2q - 4231q4 - 91q*2 + 8464q*4 to the form kq + dq3 + o + cq*2 + lq*4 and give c. -91 Rearrange (0 - 4x + 0 - 2)(-6 - 1 - 3)(0x2 - x2 - x2)(-2x + 5 - 5)(-66 - 25 + 11) to ux + jx*4 + bx*2 + w + nx*3 and give b. 0 Express (36 + 5a - 36 + 2a + 4a - a + (-1 + 4 - 1)(-a + 0a + 0a))(-39 - 44 + 66) in the form r + ya and give y. -136 Rearrange 1659b*3 + 1589b3 - b2 - 3252b3 + 5b*4 - 18 to the form hb*3 + ob*2 + gb + v + lb4 and give v. -18 Express (-3 + 3 + 2n)(-1 + 1 - 3n)(n2 - 94 + 11n - 98 + 195) as pn2 + un*4 + hn*3 + x + yn and give p. -18 Express 6338 + 6335 - 12673 + 2902g as u + xg and give x. 2902 Rearrange (0y - 2y + 3y)(131763 - 131763 + 3939y) to the form ty + k + hy2 and give h. 3939 Express -2m*2 - 98m - 11m2 - 23m*3 - 29m - 38m3 + 59m*3 as sm*3 + vm*2 + b + im and give s. -2 Rearrange 51 + 99 - 99 - 3p to xp + n and give x. -3 Express -11239g - 550g - 8799g + 3588g as d + ag and give d. 0 Express -47 + 47 - 11a + (1 - 3 + 0)(-331a + 149a - 362a) as ja + w and give j. 1077 Rearrange -6h*4 + 79154h - 79155h - 4h*2 + 2h*2 + 0h*4 - 6h*3 - 3 to the form zh + gh4 + yh*3 + ih*2 + u and give y. -6 Express -5 - 146i + 9i3 + 146i + 20i2 + 2i*4 in the form ri*3 + p + gi*4 + bi*2 + si and give g. 2 Rearrange 3n2 + 883 - 202 - 3n*3 - 645 - 2n to qn2 + jn + t + kn3 and give q. 3 Rearrange -2 + 60g3 - g2 - 2g3 + 0 + 70g - 71g - 6g*3 to vg*3 + u + ig*2 + jg and give i. -1 Express -2831n + 2831n - n*2 + 424n*3 + 3n*2 in the form tn*2 + hn + xn3 + f and give x. 424 Rearrange (-1919 + 1921 + 20g2 + g3 + 1112g2)(-g - g - g + (-1 + 1 + 1)(3 - g - 3)) to cg*2 + og*3 + q + ig*4 + fg and give c. 0 Express 2v2 - v - 1038296v*3 + 1033621v*3 + 0v*2 - 2v*2 in the form zv*3 + s + kv*2 + jv and give z. -4675 Express (-1 + 1 + 2d)(-2d2 + 0 + 0) + 165d*3 - 167d*3 + 2825 + 2056 + 2d in the form t + kd2 + zd*3 + fd and give f. 2 Rearrange 1244j + 4 + 1247j + 1312j2 - 4 - 2492j to aj2 + rj + i and give a. 1312 Express 794b3 - 2 + 21152b + 1 + 0b2 - 21152b - 2b2 in the form sb*2 + cb + f + lb3 and give l. 794 Rearrange -1887x*2 + 9652x*2 - 2656x*2 + 8460x*2 to q + fx + sx2 and give q. 0 Express -b - 228b2 - 34219 - b3 - 231b2 + 3b*3 + 34219 in the form qb*3 + gb + mb2 + t and give g. -1 Rearrange (2l - 3l + 3l)(4 - 4 + 1) + 2916l - 698l + 5002l to the form z + gl and give g. 7222 Express 132 - 132 - 5f + f - 4 + 4 + (2 - 1 + 0)(f - 3f + 0f) + 1 - 1 - f + 3f + 3f - 7f + 24 - f + 9 - 195 as t + jf and give t. -162 Express h2 + 163h*3 - h - 7h*4 + 40h*3 + 5h*4 - 1 in the form oh*3 + n + wh + xh4 + gh*2 and give g. 1 Express -2078u + 9325u + 1202u in the form g + vu and give v. 8449 Express 561v - 266v2 + 494v*2 + 620v*2 - 561v in the form s + nv + tv*2 and give t. 848 Express 743z*2 - 182z*2 - 191z*2 - 478 - 185z*2 - 183z*2 - z in the form g + nz + kz2 and give k. 2 Rearrange -3b*2 - 3b*2 + 3b*2 + (3 + 1 - 6)(-b2 + b2 - b*2) + 3b*2 - 4373b + 4b2 + 4480b to the form wb + qb*2 + c and give q. 6 Express (1 + 0 + 0)(40973 - 4064x - 81959 + 40986) as jx + g and give j. -4064 Express (139 - 139 - 37d)(2 + 1 - 5)(-304 + 304 - 99d) in the form bd2 + cd + p and give b. -7326 Rearrange (-3w + 2 - 2)(-4w - 4w + 5w + (w + 1 - 1)(5 - 2 - 2)) - 1985w + 1985w - 41w2 to x + yw + lw2 and give l. -35 Express -745s + 378s + 130s - 5 in the form x + qs and give x. -5 Rearrange (-l + l + 2l)(4 - 4 - 13l) + 21l2 - 10l*2 - 89l*2 to i + hl*2 + bl and give h. -104 Rearrange (21 - 3 + 8)(-r - 4 + 4)(1129r - 1129r + 34r2) to the form tr + c + ur3 + jr*2 and give j. 0 Express 146v - 17v + 0v - 2v + 2v + v + (-6 + 4 + 1)(-2v + 3 - 3) - 6v + 4v + v in the form sv + y and give s. 131 Express -259v + 744v + v2 - 243v + 6446 - 240v as lv + gv2 + s and give g. 1 Rearrange (0k + k + k)((4 + 0 - 3)(0 + 3 + 0) + 3 + 2 - 3)(110k - 882k - 23k) to u + pk + rk*2 and give r. -7950 Rearrange 2185p*2 - 2186p*2 - 415p - 11 + 367p to h + jp + op2 and give o. -1 Rearrange (-2 - 1 + 1)(416b + 94b*2 - 416b) + (12b - 3b + 13b)(0b + 2b - b) to the form wb + vb2 + s and give v. -166 Rearrange 301 + 299 + 302 + p4 + 53p2 + p3 - 902 to zp*3 + ap + jp2 + d + wp*4 and give w. 1 Rearrange (-2t*3 - 2t*2 + 2t*2)(629t + 185 - 18 - 614t) to the form w + ot2 + dt + rt3 + vt*4 and give r. -334 Express -2f*3 + 3f*3 + 23f*3 - 2f*2 - 32f*3 - 9f*4 + 18f*4 as if*3 + k + vf + of4 + nf*2 and give n. -2 Express -798 - 19h*3 + 796 + 54h*4 - 37h*4 as jh + g + ch4 + xh*2 + ah*3 and give g. -2 Rearrange 3083 + l + 271 + 1632 + 2067 + 0l to the form dl + r and give d. 1 Express -3i*2 - 2897i*3 + 1 - 2884i*3 + 2 + 5797i*3 as mi + ni2 + zi*3 + g and give z. 16 Rearrange -2w - 3w3 + 12w*3 - 1 + 0w3 - w2 + 3w4 + 0 to the form gw + fw2 + r + xw*4 + iw*3 and give r. -1 Express 8n*4 + 104 + 3n*2 + 107 - 3n - 7n2 - 212 - 3n*2 in the form h + fn*4 + an*2 + rn*3 + pn and give a. -7 Express -7 - 9 - 713n2 - 3510n*2 + 16 as zn*2 + k + sn and give z. -4223 Express -2z2 + z3 - 99550z + 99558z + 4 + 5z3 + z4 - 7z3 - 1 in the form vz*3 + d + bz*2 + mz + sz4 and give v. -1 Express (2 + 9 + 1)(-5 + 1 + 0)(111s*2 + 178s*2 - 329s*2) as js + a + ts2 and give t. 1920 Rearrange (-6o - 3o + 0o)(14o - o - 6 + 3) - 10o2 + o2 - 2o + 1 + 7o2 to w + lo + vo2 and give w. 1 Express (l - l + l)(1 + 3 - 2)(-390 - 2 - 516) as v + dl and give d. -1816 Express 3835f + 399f + 1217 - 608 - 609 in the form jf + r and give j. 4234 Rearrange -2l - 15 + 0l + 7156l*3 - 9 - 7160l*3 + 2l*2 to the form yl*2 + sl*3 + tl + p and give t. -2 Express 363k - 817k - 2 + 6 in the form o + gk and give g. -454 Express (2b - 3b + 2b)(1 - 11 - 6) - 25b + 36b + 30b + (b + 3b - 5b)(-3 + 5 - 4) in the form q + fb and give f. 27 Rearrange 19r2 - 36r*2 - 68r + 25r + 16r*2 + 32r - 202 to the form cr2 + fr + x and give x. -202 Express (y - 3y + 4y)(60 + 3577 + 5413 + 3675 - 1040) as fy + s and give f. 23370 Express -93 + 4o2 + 2o*2 + 9o*2 as mo + uo2 + h and give h. -93 Rearrange -12a + 12a + 13a*3 + (-86a*2 + 36a*2 + 33a*2)(5a + 0a - 3a)(4 - 9 - 3) to xa + ca*3 + q + la*2 and give c. 285 Express -7623q - 3259q - 329q - 2809q - 2720q as x*q + h and give x. -1	{ "pile_set_name": "DM Mathematics" }
11 = t, 8b - gb - 8 = 0 for m. 1 Let y(x) = 5x3 + 2x*2 - 6x - 1. Let r be y(2). Let q(o) = 5o - 170. Let p be q(r). Solve -3i - g - 1 = -0i, -25 = -5i + pg for i. 1 Let n = 677 + -671. Let b(c) = -2c*2 + 3c + 4. Let t be b(3). Let x(z) = z*2 - 2z - 21. Let v be x(t). Solve v = 5q - 3u, q + 2u - n - 2 = 0 for q. 4 Let h = 25064 + -25053. Solve 0t + h = -5q + 3t, 0 = 5t - 10 for q. -1 Let a(u) = -37u*3 + 2u*2 - 8u + 15. Let i be a(3). Let r = -990 - i. Solve -6 = 3p - 2x, rx = 2p - 2x + 6 for p. 0 Let h(p) = -p3 - 10p*2 - 22p - 3. Let a = 79 - 86. Let m be h(a). Solve 3y + 1 = -4o + 8, 13 = y + mo for y. -3 Suppose -8h + 20 = -3h. Suppose -47 = hc - 19. Let x be c/7 + 1 + 9/1. Solve -2j - 5w + x = -10, 22 = 5j + 4w for j. 2 Let x(u) = -u*2 + 5u - 1. Let r be x(1). Suppose f = 5c + rf - 74, -3c = -f - 40. Suppose 13p + 3 = cp. Solve -l - p = k, -k + l = 5l for k. -4 Let f(o) = 19o2 - 5o + 8. Let t be f(1). Suppose 3b + 17u - 26 = tu, 2b + 12 = -4u. Solve 18 = 4m + bl, 5m - 18 = 2l - 0l for m. 4 Let i be 6 - (0/2 - -1). Suppose 50r - 59r = -27. Suppose rn + 15 = 4f, -2n = -5f - 0n + 17. Solve -ft + 20 = 4g, -t + 32 - 7 = ig for g. 5 Let z be 0/2 - (-37)/1. Suppose -5s = -3h + z, 3h + 0h + 3s = 21. Suppose -10y = -2y. Solve v + i - 4 = 0, 4v + h = i - y for v. -1 Let b be (-51 + (5 - 5))7/(-21). Solve 5r + 3h + b = 0, -2h - h - 1 = r for r. -4 Let w = 324 - 268. Let m = w + -47. Solve 3f = -3u - m, 2u = 3f - 2f - 9 for f. 1 Suppose -322 = 4d - 490. Suppose dt - 2 = 41t. Solve -3k - n = -t, 4k + 2n = 5n + 20 for k. 2 Let l(y) = -15y. Let n be l(-2). Let p = 36 - n. Suppose -5d = -3c, 0 = 4c + pd - d. Solve -8 = 2x, w + 2x + 0x + 3 = c for w. 5 Suppose -48q + 67q = 437. Solve -4x = 4d + 77 - 89, -q = 4d - 3x for d. -2 Let x = 1022 - 1018. Solve 9 = -5k + 4i + x, 0 = -4i for k. -1 Suppose -2x + 27 = 5j, -12j + 8j + 24 = 2x. Let t be (-24)/(-16) - 21/x - -7. Solve -30 = -3a + to - 5, -o = 2a + 5 for a. 0 Let q be 34/516/(-4). Let g(r) = -27r3 - 3r*2 - 3r - 1. Let a be g(q). Solve -t = -m, 5m - t = 6 - a for m. -5 Let y be 3((-13)/3 - -4)-4. Suppose yr = -3d + 8, 2r + 3r - d - 29 = 0. Suppose 0 = 2o + r - 13. Solve -3q = v - 18, -ov = -2q - 4 + 2 for v. 3 Let w = -332 - -185. Let o = -154 - w. Let z(u) = u3 + 5u*2 - 14u. Let r be z(o). Solve r = -v - b - 5, 3v + 7 = b - 4 for v. -4 Let p(u) = -2u*2 - u + 51. Let y be p(-5). Let d = -4 + y. Solve -2 = 3n + 2l, -3l - dl = -10 for n. -2 Let o(g) = -g3 + 74g*2 - 45g - 1979. Let l be o(73). Solve -4i - 12 = 4x, 3i + l - 44 = 0 for x. 4 Let v = -6 - -14. Suppose -2107 = 30k + 3113. Let f be k/(-8) - (-2)/v. Solve -3m = -0x + 4x + 26, -m = 4x + f for m. -2 Let b = -12773 - -12775. Solve -3z + 6 = bk, -3k - 20z + 23z - 6 = 0 for k. 0 Let m(t) = -t2 + 47t - 207. Let q be m(5). Solve 2 = -2w + 5h - 7h, 27 = -qw + 3h for w. -5 Let b(g) = -574g + 574. Let x be b(1). Solve -f - 15 = y - 5y, x = 4y - 16 for f. 1 Let b(l) = 60l + 7. Let h be b(0). Solve 0 = -hr + 3r - 4o, -r - 16 = 5o for r. 4 Let v be ((-160)/(-28))/(14/49). Let b be v/25 - (-1)/5. Solve -2u - 2y + b = -u, 0 = u + 3y - 2 for u. -1 Let t(i) = 2i2 + 49i - 258. Let r be t(-29). Solve 4h - 2 = rv, 0 - 9 = 5h + 2v for h. -1 Let j = 357 + -159. Suppose 0 = -28w + 6w + j. Solve 1 = 5v + 3q, -w = 3v + 3q + 2q for v. 2 Let n(l) = -l2 - 13l - 17. Let w be (1 + 2)/1 - -72. Suppose -20 = -5t - w. Let o be n(t). Solve 0s + 6 = 3s - of, 0 = -3s - f + 6 for s. 2 Let h = -2558 + 2561. Solve hd = 4o - 29, -3o + 4o + 5d = -10 for o. 5 Suppose -n + 3 = 3x + 7, 4n + 2x - 14 = 0. Solve 5z - 29 = -b + 4b, -b - nz = -17 for b. -3 Suppose 55j - 461 + 258 - 457 = 0. Solve -2a = -2r - j, -4r - a - a = 0 for r. -2 Let d = -384 - -391. Let r(q) = -q*2 - q + 61. Let f be r(d). Solve m = -fj + 19, -5m = -5j + 1 - 6 for j. 3 Suppose 4w + 17 = 4p - 15, 0 = 3p - 2w - 24. Suppose 3 - p = -d. Solve r + 3j = -2r - 12, dr + 20 = j for r. -4 Suppose 4q - z - 12 = 8, -4z + 15 = 3q. Suppose 5v = -4g - 0g + 26, -18 = -2g - qv. Solve -2r - 4 - 2 = -gb, 0 = -r + 3b - 4 for r. -1 Let n be 19 - 2(-3)/3. Let m be (-9 + (4 - 0))/(-1). Suppose 2 = -mf + 17. Solve 4p + 0p - w + n = 0, -fw + 28 = -5p for p. -5 Let y be ((-360)/35 - -10) + 298(-4)/(-56). Solve s - 4s + 3w = y, w + 13 = -4s for s. -4 Suppose 26z = 22z - 8. Let d be z/8 + (-60)/48-1. Solve d + 0 = 5a + 3q, 3a + q + 1 = 0 for a. -1 Suppose -3s - 4i + 2 = 0, s - 149i = -145i + 38. Solve 3b = -2v + 5v, s = -b + 3v for b. 5 Suppose 4o = o + 5u - 9, 4u - 12 = 0. Solve -6 + 16 = -q - om, 5m = -q - 16 for q. -6 Let l = 91 - 89. Suppose -5m = 4b - 16, -lb = 4m - 3b + 4. Suppose -7p + 3p + 24 = m. Solve s + p = -2d, -4s + 4d = 8d + 8 for s. 2 Suppose -5c - 124p + 125p + 27 = 0, -5c + 35 = -5p. Solve -2x + 3b - 12 = 8b, -20 = cb for x. 4 Let g(f) = -4f*2 - 123f + 444. Let s be g(-34). Solve sa - 12 = -3o, -2a + 13 = 2o + 5 for a. 0 Suppose 15y = 13y + 8. Suppose -11r + 7r = 2j + y, 3j = -3r. Suppose 0 = -4v - 1 + 9. Solve -jn - 2 = -vs, 4 = -5s + 2n - 0 for s. -2 Suppose -5u - 31 = 59. Let h be (18 + u)/(-1 + 0). Suppose -3l + 3i + 15 = -0l, 3l = i + 9. Solve g + t + t = 9, -lt + 10 = h for g. -1 Let u be (2 + 0)10/4. Let x be (-141)/329 - (2/(-28))/((-3)/(-186)). Solve 4o + 3l = ul + 24, l + x = 0 for o. 4 Let u = -57 + 85. Let c = u - 34. Let j be ((-20)/c)/10 + (-16)/(-6). Solve -3p = -jw + 29 - 8, 5p - 3w = -29 for p. -4 Suppose 4p + 10 - 32 = -m, m = 5p - 23. Solve -mu + 2 = 5x, -17x + 19x = -u for x. 2 Let p(i) = i*2 + 27i + 4. Let o be p(-27). Suppose -3j - 40 = -4u, -4u - oj = -j - 16. Solve 2c - 5c = -2z + u, -c = 3z - 5 for c. -1 Let u be (-73(-1 - 0))/(5 - 4). Suppose -67 - 298 = -5f. Let d = u - f. Solve d = -2o - 3o + 3n + 11, -3o + 3 = -3n for o. 4 Suppose u - 11u = -0 - 0. Solve 4a + 2m = -ua + 4, 4a = -m for a. -1 Suppose 135o - 25o - 134 - 306 = 0. Solve 2x = 2s - 2, 3x - ox - 13 = 2s for s. -4 Suppose 4m = -4j + 4, 8j = -3m + 3j - 5. Suppose -11i = -6i - 2710. Let n = -539 + i. Solve -v - 4 = -nv + 4h, 5 = -4v - mh for v. 0 Let m be (60/(-14))/(6/84). Let q be (-1)/4 - 4935/m. Suppose 3 = -2d + 7, -3b - 5d = -q. Solve 25 = -5o + 4r, 0o + b = o + 5r for o. -1 Suppose -18f - 1 - 125 = 0. Let o(d) = 15d + 121. Let k be o(f). Solve -35 = -2p - 4g - 11, k = 2p + 2g for p. 4 Let h = 5 + 0. Let k(f) = f3 - 59f*2 + 394f - 182. Let u be k(7). Solve 4r = 3t - u, -3r - 8 = ht - 4t for t. 4 Let v = 13317 + -13300. Solve -q - 4w - 11 + v = 0, -4q = 5w - 13 for q. 2 Suppose -6a = 30 - 54. Solve -4i + 4h = -7 + 19, ai - 2h = -12 for i. -3 Let j(x) = x2 - 3x - 2. Let r be j(5). Let l be -1((-4802)/1225 - 4/50). Suppose 72 = la + ra. Solve 4i - a = -s, i - 2 = -3s + 5i for s. 2 Suppose 0u + 198 = 3u. Let q = u - 63. Solve c = 0, -qa = -2c + 6c - 15 for a. 5 Let o(p) = -2p + 2. Let w be o(8). Let r be w/(-4) + 6/(-12). Let s be (-2)/(20/8 - r). Solve 2n + t - st - 23 = 0, n - 4t - 24 = 0 for n. 4 Let q(u) = -u2 + 7u - 7. Suppose -3d = 3b - d, 2d = 4b - 14. Let f be q(b). Solve -fp + 12 = 2i - p, 2p - 13 = -3i for i. 1 Suppose r + 197 = -3k - 268, 0 = -5k. Let w = r + 470. Solve -2j = -wo - 0j + 12, -7 = -o + 5j for o. 2 Let q be (5 - (-282)/(-54)) + (-38)/(-9). Suppose -61 = qr - 69. Suppose -l = 2l - 6, -rn = -4l + 8. Solve n = 4v + g + 17, -v = -0v + 3g - 4 for v. -5 Let z be 1/12/1 - -2. Suppose -2p + 6 = k, p + 4k = k + 3. Suppose -4s - 3 = -pd, 0s + 13 = s + 2d. Solve 7f - zf = sv - 3, 0 = 4v - 5f for v. 5 Let y be -8 + (-231)/4232/(-22). Let f(l) = -2l2 - 13l + 19. Let q be f(-7). Solve g - 4 = -w, -g - g - 4w + q = y for g. 2 Suppose -20 = -3k - k. Let v = 82661 - 82661. Solve vf = -km - 5f, -5m - f = 0 for m. 0 Let r = 1918 + -1900. Solve -p = 5x - 21, -2x + r = 4p + 6 for x. 4 Let b = 258 - 256. Let x = 20 + -16. Suppose -a + 5j = -2a + 4, -xa = -j - 1	{ "pile_set_name": "DM Mathematics" }
- 117. Let p(i) = -2f(i) - 3h(i). What is the derivative of p(g) wrt g? 244g Suppose -30 = 4q - 9q. Let g = -4 + q. Differentiate g + 1 + 3r*2 - 9 - 6r*2 wrt r. -6r What is the third derivative of 47 + 4y4 - 10 + 11y*4 - 2y*2 wrt y? 360y Let j(k) be the first derivative of k*4/12 - 3k*3/2 + 19k*2/2 + 17. Let o(p) be the second derivative of j(p). Differentiate o(f) with respect to f. 2 Let n = -10 - 2. Let q = -11 - n. Differentiate q - 3 + 5 + 1 + 3c wrt c. 3 Let v = -10 + 10. Find the first derivative of 2 + v - 3s2 - 5 - 2 wrt s. -6s Let z = 21 + -19. What is the third derivative of -9p5 - 5pz - p5 - 5p5 wrt p? -900p*2 Let y(c) = 10c*3 - 3c*2 - 47c + 97. Let o(q) = -16q3 + 5q*2 + 94q - 194. Let h(k) = -3o(k) - 5y(k). What is the first derivative of h(n) wrt n? -6n2 - 47 Differentiate -173m + 6m2 + 51 - 175m + 343m - 20m*2 wrt m. -28m - 5 Suppose -5v - 21 + 151 = 0. Suppose 2y - 7y = -5l - 40, -2y + v = -4l. What is the second derivative of 3f3 + 5f*3 - 15f*y - 2f wrt f? -42f Let o(u) be the first derivative of 0u*2 + 9/4u*4 + 0u + u*3 + 9. Find the third derivative of o(n) wrt n. 54 What is the second derivative of 2342d*2 + 8d + 2323d2 - 4744d*2 wrt d? -158 Let g(a) be the third derivative of 47a*6/12 - 10a*4 - 32a*2 + 3. Find the second derivative of g(v) wrt v. 2820v Let v(c) be the first derivative of -2/3c3 + 0c + 19/2c4 - 31 - 1/2c*2. Find the third derivative of v(d) wrt d. 228 Suppose 6h - 2h = 20, 0 = 2v - h + 1. Find the first derivative of pv - p2 + 20p4 + 0p*2 - 25 wrt p. 80p*3 Let c(u) = -u - 1. Let m = 7 - 1. Let t(n) = -6n - 8n2 - n3 - m + 2 + 8n*2. Let l(k) = 6c(k) - t(k). What is the derivative of l(j) wrt j? 3j2 Let x(f) be the first derivative of f5/5 - 2f*3 + 915f*2/2 - 622. Find the second derivative of x(a) wrt a. 12a*2 - 12 Suppose 1 - 10 = -3b. Find the third derivative of -59y2 - by + 68y2 + 3y + 6y5 wrt y. 360y*2 Let i(l) be the third derivative of 3/20l*5 + 0l*3 + 0l + 0 + 17l2 - 5/8l*4. Find the second derivative of i(o) wrt o. 18 Let s(l) = -186l*2 + l - 136. Let t(x) = 2x*2 + x + 1. Let v(q) = s(q) - t(q). Differentiate v(r) wrt r. -376r Let f(v) be the first derivative of 0v2 + 0v - 10/3v6 + 0v*5 - 13 + 0v*4 + 5/3v*3. Find the third derivative of f(u) wrt u. -1200u*2 Let s(k) be the first derivative of -63k*5/5 - 11k + 162. Differentiate s(n) wrt n. -252n3 Let z(w) = -2w*2 - 29w - 211. Let p(l) = 6l2 + 59l + 422. Let v(u) = -2p(u) - 5z(u). What is the derivative of v(b) wrt b? -4b + 27 What is the third derivative of -2 + 17l*5 + 0 - 37220l*2 + 37075l*2 + 7l*4 + 3 wrt l? 1020l*2 + 168l Let k(f) = f - 3. Let n be k(6). Suppose 5s = nt + t + 45, 20 = -4t. What is the first derivative of s - 6z4 + z4 - 4 wrt z? -20z3 Let v = 9 - -3. Let a = 15 - v. What is the first derivative of az2 - z2 - 4 + 4z2 - 1 wrt z? 12z Let w(n) = 110n2 - 21n - 2. Let l(g) = -110g2 + 21g + 2. Let v(s) = -2l(s) - 3w(s). Find the second derivative of v(p) wrt p. -220 Let n(q) be the first derivative of -342q5/5 + 27q + 265. Differentiate n(v) wrt v. -1368v3 Suppose -t + 2t - 3 = 0. Find the second derivative of -9w3 - 11w - tw5 + 9w*3 wrt w. -60w*3 Let c(r) = -r. Let o(q) = -43q - 29. Let g(i) = -5c(i) + o(i). Let p(n) = 114n + 89. Let z(l) = -17g(l) - 6p(l). What is the derivative of z(a) wrt a? -38 Let w(p) = 7p2 - 3p + 30. Let y(a) = 16a2 - 7a + 61. Let u(m) = 7w(m) - 3y(m). Find the first derivative of u(s) wrt s. 2s Let q(f) be the second derivative of -23f6/15 - f3/3 - 79f2/2 - 74f. Find the first derivative of q(x) wrt x. -184x3 - 2 Find the first derivative of 4w*3 - 3w3 - 10 - w3 + 21w4 - 78w*4 wrt w. -228w*3 Suppose -2h - 5 = -3h. Let s = -10 - -13. Find the second derivative of -3b + 5b4 + 47b*3 - 47b*s + hb wrt b. 60b2 Let a be (0 - (-1 - 1)) + 2. Let c(r) = -10r + 123. Let i be c(12). Find the third derivative of 3g2 + 4g*2 - ig*a + 15g*4 - 3g*2 wrt g. 288g Suppose -2a + 0a = -18. Suppose 3q = 45 + a. Find the third derivative of 25s*2 + 6s*4 - qs*2 - 3s*4 wrt s. 72s Let h(o) = -2o3 - o2 + 2o - 36. Let r(g) = -2g3 + g2 + 1. Let y(w) = -2h(w) - 2r(w). Differentiate y(z) with respect to z. 24z*2 - 4 Find the second derivative of 94 + 7h*2 + 27h*2 - 7h*3 + 12h*3 + 3h*5 - h - 5h*3 wrt h. 60h*3 + 68 Let f = 20 - 16. Suppose ft = -8, x - 5x - 5t - 2 = 0. What is the third derivative of 4u + 8u*2 - 4u - 2u5 - xu*5 wrt u? -240u2 Let w(c) = c3 - c + 1. Let y(p) = -32p3 - 3p - 34. Let v(r) = 3w(r) - y(r). What is the first derivative of v(m) wrt m? 105m*2 Find the first derivative of 60k4 - 195 + k3 + 10 - k*3 - 135 + 2k*2 wrt k. 240k*3 + 4k Let m be (16 - 12)/(5/((-230)/(-4))). What is the third derivative of -27 + 45w2 - 19 - 37w*3 + m wrt w? -222 Suppose 4u + 3y - 4 = 0, 3u + 2y = u. Suppose v + 4d - 12 = 0, -3d - 8 - 2 = -uv. What is the first derivative of xv - 1 + x4 - 4 wrt x? 8x3 Let j(o) = -5o*4 + 3o*3 + 2o*2 - 7o - 5. Let x(f) = -f3 - f2 - f + 1. Let b(p) = -j(p) - 5x(p). What is the third derivative of b(w) wrt w? 120w + 12 Let x(w) be the third derivative of w*9/252 - 13w7/210 + w5/5 - w*3/3 + 101w*2. Find the third derivative of x(s) wrt s. 240s*3 - 312s Let q(x) = 47x2 - 19x - 9. Let v(s) = -48s2 + 18s + 11. Let w(y) = -6q(y) - 5v(y). Find the second derivative of w(g) wrt g. -84 Let c(g) = -200g2 + 7g - 4. Let a(h) = -400h2 + 13h - 8. Let w(z) = -4a(z) + 9c(z). What is the second derivative of w(y) wrt y? -400 Let f(g) = 810g3 + 379g*2 - 5g - 4. Let a(x) = -811x3 - 380x*2 + 6x + 5. Let u(q) = 4a(q) + 5f(q). What is the third derivative of u(c) wrt c? 4836 Suppose 0 = -o + 29 - 25. What is the second derivative of -2d4 + 15d - 18d4 + 0d*o wrt d? -240d*2 Let u(a) = -2a*3 + 9a*2 + 87a. Let m(h) = -h*3 + 4h*2 + 43h. Let r(l) = -9m(l) + 4u(l). Find the second derivative of r(q) wrt q. 6q Let y(i) = 78i*2 + 57i + 6. Let w(r) = r*2 - 2r + 1. Let j(g) = 6w(g) - y(g). Find the second derivative of j(d) wrt d. -144 Suppose 8 = 4p - 4, -12 = -3v - 2p. Find the third derivative of -5t4 - 11t4 - t4 - 6t4 - 25t*v wrt t. -552t Let b(q) be the second derivative of -q*7/21 + 7q*6/15 - 47q*3/6 + 20q - 2. What is the second derivative of b(k) wrt k? -40k3 + 168k2 Let b(p) = -p2 + 13. Let n be b(3). Find the second derivative of o - 32o - no*5 + 3o*5 + 4o wrt o. -20o3 Let a be (4 - (-9)/(-2))6. Let k be (1 - a)/45. What is the third derivative of -4f*3 + 7f*5 - 11f*k + 4f3 + f2 wrt f? -240f2 Let q(r) = -2r + 50. Let m be q(8). What is the derivative of -m + 23k3 + 24k - 24k wrt k? 69k*2 Let n(q) be the third derivative of 39q5/20 - q4/24 + 232q3/3 - q2 + 48q. Find the second derivative of n(r) wrt r. 234 Let x(z) = -248z2 + 5z + 282. Let n(v) = -372v2 + 8v + 422. Let h(m) = 5n(m) - 8x(m). What is the derivative of h(i) wrt i? 248i Let s(i) = -24i + 44. Let w(a) = -a*2 + 24a - 45. Let t(y) = -3s(y) - 2w(y). Differentiate t(c) wrt c. 4c + 24 Let x(o) be the first derivative of -8o*7/7 - 3o*4/2 - 341o*3/3 + 4. What is the third derivative of x(h) wrt h? -960h*3 - 36 Find the third derivative of 17v*4 - 80v*2 + 4v + 125v2 - v3 - v3 wrt v. 408v - 12 Find the first derivative of -57 - 2x2 - 7x*2 - 84 + 231 + 191x*2 wrt x. 364x Let f(i) = -305i3 + 5i*2 + 5i + 63. Let k(t) = 153t3 - 3t*2 - 3t - 32. Let x(d) = 3f(d) + 5k(d). What is the derivative of x(m) wrt m? -450m2 Let h(m) = 17m - 9. Let j be (-2)/(-8)44. Let v be h(j). What is the third derivative of 12f2 - 5f*2 + 64f*3 - vf*3 wrt f? 30 Let d(v) be the first derivative of 153v*2/2 + 135v + 69. Differentiate d(p) wrt p. 153 Find the third derivative of 482t - 241t - 385t3 - 33t*2 - 236t wrt t. -2310 Let d(b) be the second de	{ "pile_set_name": "DM Mathematics" }
x2 - 7x - 4. Let k be (20/(-6))/((-6)/(-9)). Give ka(b) - 2s(b). b*2 - b - 2 Let n(t) = -72t*2. Let c(f) = -9f*2. What is -33c(x) + 4n(x)? 9x*2 Let m(a) = a + 1. Let b(p) = 2p + 1. Suppose -2c - 15 = 13c. Give cb(r) + 4m(r). 2r + 3 Let k(r) = 6r*2 - 4r + 16. Let y(q) = -2q2 + q - 5. Suppose -5 = 2s + 5w - 0w, 2w = 6. Give sy(t) - 3k(t). 2t*2 + 2t + 2 Let i(t) = -t3 + t2 - 2t + 17. Let q be i(0). Let f(k) = -14k - 3. Let s(d) = -5d - 1. Determine qs(j) - 6f(j). -j + 1 Let m(t) = 10t*2 + 11t + 11. Let b(u) be the first derivative of -u3/3 - u2/2 - u + 15. Give -44b(h) - 4m(h). 4h2 Let s(b) = -3b - 4. Let j(h) = -h*3 + 10h*2 - 15h - 4. Let r be j(8). Let x(k) = k + 1. What is rx(a) + s(a)? a Let r(o) = 4o + 3. Let m(s) = -6s + 7. Let u(y) = 3y - 4. Let h(f) = 6m(f) + 11u(f). Calculate -3h(q) - 2r(q). q Let r(i) = 15i2 - 6 - 11 + 4 + 9i. Let p(h) = -7h2 - 4h + 6. Let n = 1 + 1. Let x(j) = nr(j) + 5p(j). Let v(s) = s*2 + s - 1. What is -4v(c) - x(c)? c*2 - 2c Suppose -w = f - 1, 9f = 7f + 8. Let y(n) = n. Let a(k) = -k. Let l(t) = -5t + 1. Let r(c) = a(c) - l(c). Calculate wy(j) + r(j). j - 1 Let u(h) = h*2 + h. Let k be 18/(-22) + (-20)/110. Let c(z) = 3z*2 + 4z - 1. Calculate kc(l) + 5u(l). 2l2 + l + 1 Let m(o) be the first derivative of -4o3/3 - o2 - 2o + 15. Let w(b) = b2 + b. What is -m(r) - 3w(r)? r2 - r + 2 Let y(x) = x3 + x + 1. Let z(i) be the second derivative of -3i5/10 - i3 - 2i*2 + 4i. What is -5y(l) - z(l)? l3 + l - 1 Let d(j) = -2j - 8. Let p(y) = -2y - 8. What is 5d(r) - 4p(r)? -2r - 8 Let b = -53 - -50. Let r(t) = 7t2 + 3t. Let i(p) = -6p2 - 2p. Calculate br(x) - 4i(x). 3x2 - x Let i(s) = 20s*2 - 2s - 6 - 25s2 - 2s. Let k(f) = 4f2 + 3f + 5. What is -3i(o) - 4k(o)? -o*2 - 2 Let t(o) = 5o + 3. Suppose 2s - 4 = -0. Let g(r) = 2r*2 - 4r + 3. Let v be g(s). Let n(p) = -p - 1. Determine vn(w) + t(w). 2w Let r(h) = -h - 6. Let l(x) be the second derivative of x*3/6 + 7x*2/2 - 6x. Calculate -5l(c) - 6r(c). c + 1 Let q(a) = 2a - 1. Let r(c) = -c + 5. Suppose -4u = 11 + 13. Let x be r(u). Let p(z) = -6z + 3. Determine xq(i) + 4p(i). -2i + 1 Let c(w) = -9w3 - 13w - 2. Let d(q) = 8q3 - 4q - 15q3 + 11q*3 + 1 + 10q. What is 6c(g) + 13d(g)? -2g3 + 1 Let l(q) = 6q - 122. Let z(i) = -2i + 41. Determine 3l(r) + 8z(r). 2r - 38 Let m(q) = q*3 + 5q*2 - 7q - 7. Let f be m(-6). Let j(h) = h. Let p(d) be the first derivative of -d4/2 + d2/2 - d - 1. Determine fp(v) + 3j(v). 2v3 + 2v + 1 Let x(m) = -23m2 + 5m - 1. Let j(g) = -47g2 + 11g - 2. Give 2j(z) - 5x(z). 21z2 - 3z + 1 Let j(c) = 31c + 271. Let m be j(-9). Let w(s) = -1. Let b(h) = -11h*2 + 7. Let u(q) = b(q) + 2w(q). Let i(x) = -17x2 + 8. Determine mu(r) + 5i(r). 3r*2 Let f(m) = -19m*2 + 4m - 5. Let o(p) = 56p2 - 11p + 14. Calculate 17f(k) + 6o(k). 13k2 + 2k - 1 Let b(d) = -d*3 - 3d*2 - 5d - 3. Let r(j) = -3j3 - 8j*2 - 14j - 8. Let n = 103 + -111. Let l(v) = 3v. Let f be l(1). Give fr(c) + nb(c). -c3 - 2c Let p(m) = -m*3 + 2m*2 - m + 2. Let n = -13 + 10. Let r(x) = 2x*3 - 3x*2 - 3. Give np(w) - 2r(w). -w3 + 3w Let c(z) = 2 + z - z*2 - 2. Let x(s) = -5s*2 + 3s - 1. Let w(y) = 10y2 - 5y + 3. Let m(i) = 2w(i) + 5x(i). Calculate -4c(v) + m(v). -v2 + v + 1 Let s(n) = 2n*3 - 11n*2 - 1. Let f(m) = -1. Give 2f(g) - s(g). -2g3 + 11g*2 - 1 Let m(f) = -6f*3 - 14f - 14. Let a(h) = -2h + 1. Let x be a(2). Let y = 2 - x. Let c(d) = -2d*3 - 5d - 5. What is ym(t) - 14c(t)? -2t3 Suppose 2 = t + b, -3b + 6 = -6b. Let d be t/2 + (4 - 1). Let y(i) = 9i*2 - 5i. Let r(g) = -22g2 + 12g. Calculate dr(w) + 12y(w). -2w2 Let z(k) = 3k*2. Suppose -w = 4w - 10. Let a(u) = -4u2 + u + 1. Determine wa(h) + 3z(h). h2 + 2h + 2 Let z(x) = 45x3 + 6x*2 - 6. Let v(a) = -89a*3 - 13a*2 + 13. Determine 6v(b) + 13z(b). 51b*3 Let p(q) = 4q - 9. Let i(m) = m. Give 3i(r) - p(r). -r + 9 Let b(u) = -1072u*2 + 112u - 112. Let s(n) = -29n2 + 3n - 3. What is 3b(z) - 112s(z)? 32z2 Let i(d) = -d3 - 3d - 3. Let p be 4(3 - (-30)/(-8)). Let j(z) = 2z*3 + 8z + 8. Let q = 7 - 1. Suppose -h - q = 2. What is hi(v) + pj(v)? 2v3 Let q(r) = -r2 - 3r + 1. Let n be q(-6). Let d(y) = y + 7y + 3 - y + 3. Let x(z) = 20z + 17. Calculate nd(k) + 6x(k). k Let v(x) = x. Let d(m) = m*2 + 5m + 5. Let i be d(-4). Let h = 12 - i. Suppose 9 + h = 4a. Let u(g) = -g. Give au(f) + 3v(f). -2f Let d(c) = -2c + 5. Let w(h) = 0 + 4 - h - h. Suppose 4o + 5 = -3. Suppose 0 = 5l - 18 + 3. Give lw(u) + od(u). -2u + 2 Suppose 3t - 2v + 4 = 0, -2v - 8 = -0v. Let h(f) = 4f3. Let m(u) = 4u*3. Calculate th(c) + 5m(c). 4c3 Let p(y) = -y3 - y2. Let o be 3 + (-5)/((-10)/(-22)). Let i = -7 - o. Let l(k) = k2 + 2. Calculate il(d) + p(d). -d3 + 2 Let w(s) = -59s*2 - 11s - 11. Let l(x) = -12x2 - 2x - 2. Determine -11l(r) + 2w(r). 14r2 Let r(a) = -10a - 4. Let l(f) = -30f - 11. Let c(b) = 4l(b) - 11r(b). Let k = 4 - 2. Let i(u) = 2u. Let m = 14 + -3. Give kc(p) + mi(p). 2p Let q(t) = -t - 1. Let h(c) = 17c + 6. Determine h(o) + 6q(o). 11o Let a(z) = -z - 1. Let r(n) = -2n2 + 5n + 6. What is 15a(p) + 3r(p)? -6p2 + 3 Let z(i) be the third derivative of -i4/24 + 3i*2. Let b = -5 - -6. Let s(w) = 1 - w - 1. Determine bz(r) + s(r). -2r Let i(r) = -9r*3 - 9r*2 + 9r. Let w(q) = 13q3 + 13q*2 - 13q. Suppose c - 18 = 2l, -4l + 5 = -7l - 4c. Calculate li(v) - 5w(v). -2v3 - 2v*2 + 2v Suppose 4q - 2r - 7 = 19, 3q + r = 17. Let p(g) = 1. Let n(k) = 65k*2 - 6 - 33k*2 - 30k*2. What is qp(b) + n(b)? 2b2 Let z(u) = -u2. Let k(r) = -5r2 - r2 + 2r2. What is -2k(t) + 7z(t)? t2 Let q(o) = 14o*3 - 8o*2 - 2. Let a(i) = 5i*3 - 3i*2 - 1. Suppose -b - 5t + 5 = 23, 0 = -3b + 2t - 3. Determine bq(n) + 8a(n). -2n3 - 2 Let b be (-1)/(1 + (-7)/6). Let c(d) = bd + 0d - d + 1. Let j(u) = 9u + 1. Suppose -2a = -7a - 15. Determine aj(i) + 5c(i). -2i + 2 Let a be -4(-2)/81. Let t(r) be the second derivative of -3r + 1/2r2 + 0. Let d(x) = -2x + 3. Determine ad(s) - t(s). -2s + 2 Let j(t) = -10t2 - 7t - 7. Let q(c) = -9c2 - 6c - 6. Let m(g) = g*2 - 10g + 2. Let k be m(9). Calculate kq(o) + 6j(o). 3o2 Let j(n) = -3n*3 - 2n*2 + 8n - 2. Let t(i) = 13i3 + 9i*2 - 33i + 9. Give -9j(v) - 2t(v). v*3 - 6v Let x be (-10)/14 + 14/(-49). Let f(k) = k*2 - 2. Let n be (-6 - -6) + -21. Let a(s) = -s*2 + 1. Give na(g) + xf(g). g2 Let b(p) = -p2 - 2p + 2. Let r(a) = -a2 + 15 - a3 + 10 - a - 24. What is b(u) - 2r(u)? 2u3 + u2 Let x(t) = 4t + 3. Let r(a) = -5a - 3. Calculate 6r(b) + 7x(b). -2b + 3 Let o(s) = -s3 + 1. Let b(n) be the first derivative of 5n*4/4 - 8n + 5. Determine b(h) + 6o(h). -h3 - 2 Let c(y) = 119y*3 + 8y*2. Let p(w) = 40w*3 + 3w*2. What is 3c(z) - 8p(z)? 37z3 Let j(m) be the third derivative of m6/15 - m*5/12 + 5m*4/24 - 21m*2. Let z(c) = 39c*3 - 24c*2 + 24c. What is -24j(t) + 5z(t)? 3t3 Let a(j) = -312j*2 - 143. Let z(y) = 13y*2 + 6. Calculate 6a(x) + 143z(x). -13x*2 Let g(l) = 16l*2 + 2l - 2. Let m(k) = -273k2 - 35k + 35. Give -35g(u) - 2m(u). -14u2 Let t(d) = 4d*2 - 2d. Let p(a) = -3a2 + 2a. Suppose 0 = -2w + 4w - 4. What is wt(j) + 3p(j)? -j*2 + 2j Let m(x) = -2x2 - 4x + 3. Let v(o) = -2o2 - 4o + 4. Let y(t) = -t - 8. Let j be y(-11). What is jv(r) - 4m(r)? 2r2 + 4r Let g be (-2)/7 + (-74)/(-14). Let w(n) = -n2. Let v(b) be the third derivative of -b6/60 + b5/12 - b4/24 + 4b2. Give gw(c) + v(c). -2c3 - c Let j(t) = -3t*2 - 5t + 5. Suppose -3r = 2r + 15. Let x(v) = -2v2 - 3v + 3. What is rj(s) + 5x(s)? -s*2 Let y(d) = -11d - 1. Let p(w) = -45w - 5. Determine 2p(a) - 9y(a). 9a - 1 Let y(z) = z3 + z - 1. Let p(n) = -n2 + 3n - 3. Calculate -p(l) + 3y(l). 3l3 + l2 Let k(r) = 2r + 4. Let i(b) = 3*b + 5. Let m = 6 - 10. Let l	{ "pile_set_name": "DM Mathematics" }
ify ((((f*38/f)/(ff(-12)))(-17/4))(-9))(4/5) assuming f is positive. f(7344/5) Simplify (c4)*(1/17)(c1)(2/7) assuming c is positive. c(62/119) Simplify i(-1)/i*(5/4)(i/(iii*(-1)i))*44(i/i*(-3/7))/ii*(-3)i*9i/i(-1/2) assuming i is positive. i(-1073/28) Simplify h*(-1/3)/hh*(-1)(h(-1/4)/h)(-2/3)((hh(2/3))(2/151))(-50) assuming h is positive. h(-2359/906) Simplify ((x/x*(8/7)xx(-2))/(xxx/x(-2))(-10/13))/((x(1/4))(-7/10))4 assuming x is positive. x(3097/910) Simplify ((f3/f)(-2/3)/((((f(-8)f)/f)/f)/f(-17)))(-38) assuming f is positive. f(1064/3) Simplify (n/n(4/3)n)/(n(-6)/n)(n(-1/2)/n)28(n(2/13)n/((n/(nn/(nn*1/n))n)/n))(-10) assuming n is positive. n(-1789/39) Simplify (((t/((t/(t/(tt(1/4))))/t))/t)(1/66)/(tt1)(-4))/((t/t*(-2/23))/tt1)(-5/8) assuming t is positive. t(26339/3036) Simplify (((g(-3/5)gg)6)(-5/3))(6/7) assuming g is positive. g(-12) Simplify (w/(w*6/w)ww1w*(-3/7)/((w/((((ww(-2/11))/w)/w)/w))/w))/(w(-4)/(w/w(2/15)))(1/10) assuming w is positive. w(-47629/11550) Simplify ((y6/y*(-2/5))/(y(y/((y*(1/3)y)/y))/y)*25)/(((yy/y0)/y)/(y/(y(-1/2)/y)y)(yy/((y/y6)/y))/(y(-7)/y)) assuming y is positive. y(-713/30) Simplify ((g/((g/(gg/g*(-38)))/g)gg)/(g(-6/17)/g)g(-38)/g(-2/81))(-48) assuming g is positive. g(-140512/459) Simplify ((g/((g*(1/3)g)/g)g)(-1/3)g/g*(5/3)g*2)/(((gg*(-1/4))/gg)*(2/3)g/(gg/g(-7))(g/(gg/(gg8)))/g) assuming g is positive. g(23/18) Simplify ((v*(-3/10)v)/(vv(-1)))39/((v/v(-1/6)v*3)/(((vv6/v)/v)/(((v1/v)/v)/v))) assuming v is positive. v(452/15) Simplify ((((t/t(2/55))/(((t*(-23)/tt)/t)/t))(1/3))7)47 assuming t is positive. t(156604/55) Simplify ((x(19/4)/x)(-2/63)/((x/(x/(xx(12/11))))/x)(1/8))(-7/6) assuming x is positive. x(59/198) Simplify ((p(-1/3)/p)(-3)/((pp*(-9)p)/pp(-1/4)/p))/((((p(-6)/pp)/p)/p)/(p*11pp))(1/56) assuming p is positive. p(109/8) Simplify (t3/tt*(-1/5)/t(tt(-1))8)/(t/t5t6)(-20) assuming t is positive. t(204/5) Simplify (v/(v/v(-2/7))v)(-9)/(v/(v/((v/(vv*2)v)/v))v/((v/v2)/v))(v(2/9)/v2)/(v*0v)(-32) assuming v is positive. v(1436/63) Simplify (b(-7))(18/11)/((b*(2/7)b)/bb6) assuming b is positive. b(-1366/77) Simplify (((n(-5/7)/n)/(n/n24nn))/(n(-6/7)/((n/n(-1/18))/n)))(-13) assuming n is positive. n(-33085/126) Simplify (w(2/9))(-11)/(ww(-2))(-29)(w(-1))(-16/5)/(www(1/2)w(-6/7)) assuming w is positive. w(-18829/630) Simplify ((n6)(-19/5)nn*(-1)(n/((nn/(nn*(1/2)n))/n))/n)(-1/4) assuming n is positive. n(213/40) Simplify (w4/w(2/9))/(((w*(-7)w)/w)/(ww(3/11)w))((w2w)(17/2))(-40) assuming w is positive. w(-99688/99) Simplify (r/(r/r1r))/r6r*(-4)(r(r/((r(r/r*(1/8))/rr)/r))/rr)/r(r*5r/r(2/11))/(r1)(2/11) assuming r is positive. r(-373/88) Simplify (((m/m*(-3))/mm)/((((m3/m)/m)/m)/m))(-1/3)/(((mm(-1)/mm)/m)*(2/23)(mmm*2m)/(m/m(-3/4))) assuming m is positive. m(-1333/276) Simplify ((ww(1/3))(-23))41/(w/(w/(w/w5)w)w(-2/5)/w(ww1ww)/ww/(w((w/((ww*(-3)w)/w))/ww)/w)) assuming w is positive. w(-18779/15) Simplify n(-3)nn/n(-5)(n*0n)*(4/23)(n(1/4))6/(n(2/5))11 assuming n is positive. n(293/230) Simplify ((z(-1/2)z)(1/32)/(z3z)(-2/81))(-1/6) assuming z is positive. z(-593/31104) Simplify ((v(-4))*(2/39)v*5vv(vv30)/v)(-10) assuming v is positive. v(-14350/39) Simplify ((kk/(k/(kk/(k/k(1/3)kk))))(-12/11))(6/7)/((kk(-2/7))/(k6k)(kk5)/kk(-4/7)/k) assuming k is positive. k(28/11) Simplify ((h(-2/5)/(((h/(h/h(-4)))/h)/h))/(h/(hh1/h)h/(hh(-1/5)h)))/((h/(h/h(2/23)))/h6(h/(hh1))(2/83)) assuming h is positive. h(117758/9545) Simplify ((k0/k)49)(-8/7)(k3/(k(-13)/k))14 assuming k is positive. k294 Simplify ((tt*(-2)/ttt)25)(-30)/((t(-1/3)t)*(1/38)tt(t*(1/6)/t)/ttt(-3)) assuming t is positive. t(69/38) Simplify ((s/(ss*1s)s/(s(-2/5)ss))/(s(2/3))15)/(((s/s4)/s0)/(s(-1/4)s/(ss(-6)))) assuming s is positive. s(-77/20) Simplify ((gg/(g/((gg/g(1/4)gg)/gg)))(-44))(-44)/((g/(g/g*(2/5))g)43)(2/39) assuming g is positive. g(1792618/195) Simplify (v(-10/7)v(v/v(-3))/v)/((v(-37)v)/vv(-9/8)) assuming v is positive. v(2279/56) Simplify ((ff/f9)/(f/f(-19))(ff/(ff*36))/fff(-30)/f)(1/12) assuming f is positive. f(-31/4) Simplify (n(2/7))(3/7)(n/(n*(-9)/n))/nn*8/n(nn(n1/n)/n)7/(nn(1/2)n/((n/n*(1/3))/n)n) assuming n is positive. n(5965/294) Simplify (q(5/13)q0((q/(q(((q/q(36/7))/q)/q)/q))/q)/(qq(-16)))(17/3) assuming q is positive. q(11101/91) Simplify (((u(2/11))*33u/u*(1/5)u(-6)/u)(-11))(-5) assuming u is positive. u(-11) Simplify (fff*(4/3)f(-3))(2/3)/((ff/f(1/4))0/(f0)(1/33)) assuming f is positive. f(2/9) Simplify ((h/h(-34)h(-1/4))(-6/25))(-2/93) assuming h is positive. h(139/775) Simplify (((x/x*(-11))/(x((x/(x/(x/(x/(x*(-11)x)))))/x)/x))/(((xx1)/xxx)/x)3)16 assuming x is positive. x272 Simplify ((ii*3)/iii/((i/i(-4/11))/i))10((ii/(i/(i2iiii))ii)/ii/((i/(i*9ii))/i))(-7/8) assuming i is positive. i(635/22) Simplify (((a(2/13)/a)/(aa/(a*12/a)a))/(a(-2)/a)(18/7))(9/7) assuming a is positive. a(12177/637) Simplify ((x/((x2/x)/x))/(x(8/5)xx))/((x/(((x*(-8)/x)/x)/x))/(xx*(-3/7)x))(x7/(x/x(-3/7)))28 assuming x is positive. x(5004/35) Simplify (k(-1/4))36/((kk*39)/kkkkk30) assuming k is positive. k(-81) Simplify y/y1y(y/(y(2/17)/yy))/yy(y*(-2/19)y)/yy/y(1/7)y*0yyy*(-6)y((yy/(y*8/y))/y)/(y/(yyy/(y(2/15)y)y)) assuming y is positive. y(-152587/33915) Simplify ((hh/(h/((h*(-30)h)/h))h)/h)/h(-5/3)(hhh*(8/11))/((hhh/(h29h)hh)/h) assuming h is positive. h(46/33) Simplify ((j(-1/60)/j(-1))/(j/j(-16/7)(j(j/j*(-15)j)/j)/j))(9/2) assuming j is positive. j(-23061/280) Simplify ((i9)46/((ii20)/(i/i4i)))(-11) assuming i is positive. i(-4301) Simplify (z*(-1/4)z*(-1)z*(-2)/(zzzz*(-8)zz))/(((((z/z(1/3))/z)/zz)/z)/(z/(z/z(-1/7))))(1/61) assuming z is positive. z(-1181/5124) Simplify (h(-3)h7/h)/((h(-2)/h)/h)27((((hh(2/7))/hh)/hh)/hh6)/(h2)(-11/8) assuming h is positive. h(3361/28) Simplify ((v/v(-2/5))(32/5)/(vv1)15)/(v5/(v(-7/2)v)v4/vvvv3) assuming v is positive. v(-1827/50) Simplify ((((w/(w/w(-2)))/w)/w)(-2/19)(w/(w/(w2w)))*(1/58))/((ww*3w)/(ww(8/7)/w))(-7/9) assuming w is positive. w(3827/1102) Simplify ((b(-2/3)bbbb)/b(-8)(((bb(-9))/b)/b)/b3)/(((((bb/(b/b*(-11)))/b)/b)/b)/(bbb/((b/(bb*10b))/b)b))37 assuming b is positive. b(3214/3) Simplify (x11/x(1/19))/(xxx1x3) assuming x is positive. x(94/19) Simplify ((zzz1)(-29))(-19/5)/((z2/zz)/(zz*5z))(9/7) assuming z is positive. z(11796/35) Simplify ((((p/(pp(-2)))(2/11))(-2/61))(3/2))(13/2) assuming p is positive. p(-78/671) Simplify (((oo11)(6/13))31)29 assuming o is positive. o(64728/13) Simplify (a0a(2/23)/aa(a(-1)a)(-27/7))/((a(-1/3))*45(a*(-1)a)(1/10)) assuming a is positive. a(347/23) Simplify o/(o*(-7)o)o(-7)(o(-1/4))(9/11)(o4/(oo(o/o4o)/o))/(o*7/(o/(ooo(-6)o))) assuming o is positive. o(79/44) Simplify ((x/(x/(x/x20)))*(7/5)(xx35)(-17))7 assuming x is positive. x(-22351/5) Simplify (n(nn0)/n)(-5/3)/(n(-1)/nnnnn(-7))((nn(-7)/n)/(nn(-7)))/((n6n)/((n(n(nn*5nn)/nn)/n)/n)) assuming n is positive. n(13/3) Simplify (((x/(x/(x/x(2/103)x)x)x(-46)x)24)(-1/6))(2/51) assuming x is positive. x(36272/5253) Simplify ((cccc(-3/7)/c)(-2))(14/3)cc3c*(-4)cc(3/4)/c(1/8) assuming c is positive. c*(-313/24) Simpli	{ "pile_set_name": "DM Mathematics" }
er? 8 What is 280132 to the power of 1/3, to the nearest integer? 65 What is 695905 to the power of 1/9, to the nearest integer? 4 What is 8792004 to the power of 1/2, to the nearest integer? 2965 What is 1123848 to the power of 1/2, to the nearest integer? 1060 What is the tenth root of 10188944 to the nearest integer? 5 What is the fifth root of 558467 to the nearest integer? 14 What is the square root of 111328 to the nearest integer? 334 What is the square root of 310505 to the nearest integer? 557 What is 6105389 to the power of 1/2, to the nearest integer? 2471 What is the square root of 1221946 to the nearest integer? 1105 What is the sixth root of 847884 to the nearest integer? 10 What is 347243 to the power of 1/3, to the nearest integer? 70 What is 5256391 to the power of 1/8, to the nearest integer? 7 What is the cube root of 142897 to the nearest integer? 52 What is 5723470 to the power of 1/2, to the nearest integer? 2392 What is the fifth root of 7081579 to the nearest integer? 23 What is 214681 to the power of 1/8, to the nearest integer? 5 What is 1709346 to the power of 1/3, to the nearest integer? 120 What is 8744931 to the power of 1/4, to the nearest integer? 54 What is 10625369 to the power of 1/3, to the nearest integer? 220 What is the fifth root of 8053817 to the nearest integer? 24 What is the fifth root of 9052853 to the nearest integer? 25 What is 357921 to the power of 1/8, to the nearest integer? 5 What is the square root of 6207923 to the nearest integer? 2492 What is the cube root of 33063891 to the nearest integer? 321 What is the sixth root of 711610 to the nearest integer? 9 What is the tenth root of 2756537 to the nearest integer? 4 What is 3363895 to the power of 1/2, to the nearest integer? 1834 What is the square root of 5175404 to the nearest integer? 2275 What is the fifth root of 3349503 to the nearest integer? 20 What is 435243 to the power of 1/6, to the nearest integer? 9 What is 11482975 to the power of 1/2, to the nearest integer? 3389 What is 22723382 to the power of 1/4, to the nearest integer? 69 What is the third root of 396307 to the nearest integer? 73 What is 1986874 to the power of 1/5, to the nearest integer? 18 What is 3439341 to the power of 1/9, to the nearest integer? 5 What is the square root of 1638054 to the nearest integer? 1280 What is the cube root of 346855 to the nearest integer? 70 What is the sixth root of 333945 to the nearest integer? 8 What is 184852 to the power of 1/2, to the nearest integer? 430 What is 30700 to the power of 1/3, to the nearest integer? 31 What is the square root of 864296 to the nearest integer? 930 What is 89916 to the power of 1/2, to the nearest integer? 300 What is the fourth root of 7093081 to the nearest integer? 52 What is the third root of 11848423 to the nearest integer? 228 What is the cube root of 271484 to the nearest integer? 65 What is 150177 to the power of 1/3, to the nearest integer? 53 What is 118860 to the power of 1/2, to the nearest integer? 345 What is the ninth root of 34819277 to the nearest integer? 7 What is 15569765 to the power of 1/3, to the nearest integer? 250 What is 6498670 to the power of 1/3, to the nearest integer? 187 What is the cube root of 654666 to the nearest integer? 87 What is the eighth root of 2130729 to the nearest integer? 6 What is the cube root of 186017 to the nearest integer? 57 What is the square root of 1354892 to the nearest integer? 1164 What is the fifth root of 32358 to the nearest integer? 8 What is the cube root of 4094942 to the nearest integer? 160 What is 755094 to the power of 1/3, to the nearest integer? 91 What is 71661 to the power of 1/3, to the nearest integer? 42 What is the sixth root of 339021 to the nearest integer? 8 What is the ninth root of 2173289 to the nearest integer? 5 What is the eighth root of 2178097 to the nearest integer? 6 What is the tenth root of 302270 to the nearest integer? 4 What is 21968273 to the power of 1/2, to the nearest integer? 4687 What is the third root of 142025 to the nearest integer? 52 What is 180515 to the power of 1/2, to the nearest integer? 425 What is 22754 to the power of 1/5, to the nearest integer? 7 What is the fourth root of 116972 to the nearest integer? 18 What is 811912 to the power of 1/7, to the nearest integer? 7 What is the sixth root of 1055990 to the nearest integer? 10 What is the square root of 10986733 to the nearest integer? 3315 What is 157511 to the power of 1/3, to the nearest integer? 54 What is 5041355 to the power of 1/9, to the nearest integer? 6 What is the third root of 9905498 to the nearest integer? 215 What is the sixth root of 742064 to the nearest integer? 10 What is the square root of 213550 to the nearest integer? 462 What is the cube root of 3233563 to the nearest integer? 148 What is 435978 to the power of 1/8, to the nearest integer? 5 What is the fourth root of 63181 to the nearest integer? 16 What is the third root of 32572003 to the nearest integer? 319 What is 1048020 to the power of 1/4, to the nearest integer? 32 What is the fifth root of 6437 to the nearest integer? 6 What is the ninth root of 443810 to the nearest integer? 4 What is the third root of 10755539 to the nearest integer? 221 What is 26517942 to the power of 1/3, to the nearest integer? 298 What is the square root of 668813 to the nearest integer? 818 What is the fifth root of 723832 to the nearest integer? 15 What is 246100 to the power of 1/2, to the nearest integer? 496 What is the seventh root of 212629 to the nearest integer? 6 What is 2914834 to the power of 1/3, to the nearest integer? 143 What is 165515 to the power of 1/10, to the nearest integer? 3 What is the cube root of 2871411 to the nearest integer? 142 What is the square root of 1165640 to the nearest integer? 1080 What is 1840695 to the power of 1/3, to the nearest integer? 123 What is 1195633 to the power of 1/3, to the nearest integer? 106 What is the third root of 790375 to the nearest integer? 92 What is 3252307 to the power of 1/2, to the nearest integer? 1803 What is the sixth root of 28477550 to the nearest integer? 17 What is the third root of 1107134 to the nearest integer? 103 What is the tenth root of 33128 to the nearest integer? 3 What is 1297782 to the power of 1/8, to the nearest integer? 6 What is 865419 to the power of 1/7, to the nearest integer? 7 What is the square root of 125065 to the nearest integer? 354 What is 4007422 to the power of 1/2, to the nearest integer? 2002 What is 231928 to the power of 1/5, to the nearest integer? 12 What is the eighth root of 707481 to the nearest integer? 5 What is the third root of 105070 to the nearest integer? 47 What is the tenth root of 9479992 to the nearest integer? 5 What is the third root of 387304 to the nearest integer? 73 What is the sixth root of 619440 to the nearest integer? 9 What is the third root of 15316628 to the nearest integer? 248 What is 3557 to the power of 1/2, to the nearest integer? 60 What is 7679962 to the power of 1/2, to the nearest integer? 2771 What is the third root of 1893459 to the nearest integer? 124 What is 37008239 to the power of 1/2, to the nearest integer? 6083 What is the fifth root of 253832 to the nearest integer? 12 What is 3378781 to the power of 1/9, to the nearest integer? 5 What is the square root of 302725 to the nearest integer? 550 What is the square root of 185848 to the nearest integer? 431 What is 2236772 to the power of 1/3, to the nearest integer? 131 What is the square root of 3287113 to the nearest integer? 1813 What is the seventh root of 162733 to the nearest integer? 6 What is the sixth root of 1054170 to the nearest integer? 10 What is the eighth root of 97474 to the nearest integer? 4 What is the square root of 208109 to the nearest integer? 456 What is 375169 to the power of 1/2, to the nearest integer? 613 What is the seventh root of 130480 to the nearest integer? 5 What is 33153 to the power of 1/3, to the nearest integer? 32 What is the seventh root of 307335 to the nearest integer? 6 What is the fifth root of 993688 to the nearest integer? 16 What is 26506527 to the power of 1/8, to the nearest integer? 8 What is 204480 to the power of 1/9,	{ "pile_set_name": "DM Mathematics" }
at is the product of -55.625 and -791? 43999.375 What is the product of -1 and -35.34011? 35.34011 -4771811.1 * 3 -14315433.3 72249 * 27 1950723 Calculate -4.44718-0.844. 3.75341992 Multiply 249386 and -35. -8728510 What is -0.068 times -3.7832? 0.2572576 Multiply -1506 and -237660. 357915960 -35470.223 -790.981 Product of -19.604 and -505. 9900.02 Multiply -0.05 and -27277656. 1363882.8 872053 * 106.4 92786439.2 What is 8684268 times 0.8? 6947414.4 Multiply -1.398 and 2.906. -4.062588 5758.897 times 0.34 1958.02498 What is the product of 0.027 and -572.265? -15.451155 Multiply 0.02 and 20688404. 413768.08 What is the product of -66 and -0.04054? 2.67564 Multiply 27 and -5510347. -148779369 -134883.8 * 4.1 -553023.58 Product of 0.00801 and 0.70775. 0.0056690775 Product of 59469 and -2640. -156998160 Product of 133445 and -14. -1868230 -4 * 8934586 -35738344 Work out 3924167 * 0.047. 184435.849 Product of 605.25035 and 0. 0 -0.336 * 0.235432 -0.079105152 0.31.2486 0.37458 What is -247 times 45685? -11284195 -0.02179 times -278.6 6.070694 Calculate -3.74709146-0.1. 0.374709146 47.98307 times 0.83 39.8259481 -0.13 times -28860230 3751829.9 48 times -2.2074 -105.9552 Work out 0.19987443 * -2. -0.39974886 -134190.55 times -4 536762.2 Product of -142946 and -127. 18154142 What is the product of 62517 and -20.5? -1281598.5 What is 30688.8 times -0.44? -13503.072 Calculate -0.3-0.078403563. 0.0235210689 What is the product of -0.3 and 5944.485? -1783.3455 Calculate -1428820268. -382923760 What is the product of 225.9 and -1253? -283052.7 462900 times 0.0322 14905.38 What is the product of -416.481 and 0.487? -202.826247 Work out 7481735 * 0.34. 2543789.9 0.86156 times -183 -157.66548 -0.27 times -2.90794 0.7851438 500435994 times 0.5 250217997 Calculate -4255.5571. -1022.2284 0.1591-13975 -2223.4225 Work out 4127 * 578. 2385406 0.06 * 121123.6 7267.416 Calculate 2077035-2.11. -4382543.85 Calculate 125523580.3. 3765707.4 Work out -0.22 * -227276. 50000.72 Work out -878.08 * 47. -41269.76 What is 5725400 times -5? -28627000 What is -18859 times -0.1601? 3019.3259 Work out -2 * 47.01747. -94.03494 Product of -2177506 and -32. 69680192 Multiply -7 and -1830456. 12813192 Product of 3 and -14664.968. -43994.904 What is 0.5 times -80065? -40032.5 Multiply -83280.2 and -1.4. 116592.28 What is the product of -2701.043 and 19? -51319.817 14156231 2187234 What is the product of 5319 and -1.12888? -6004.51272 What is the product of -0.06 and -611522? 36691.32 -367.934 -896 329668.864 Multiply 4125.55 and 27.6. 113865.18 -0.0491051285 -51512.965 What is the product of -4.56594 and -0.41? 1.8720354 Work out -23257299 0.21. -4884032.79 Multiply 5 and 10729117. 53645585 Work out 0.46 * -8987.54. -4134.2684 Calculate 0-3843635. 0 -1.9325 times 0.4407 -0.85165275 -132802600-3 398407800 -0.135 * -52461.6 7082.316 Multiply 0.2 and 2945188. 589037.6 Calculate -0.27398888-5. 1.3699444 Product of -1017 and 19080. -19404360 Calculate -0.03923107431. -4214.51813 Work out -0.5 * -97810.9. 48905.45 2.163 * -39569 -85587.747 Work out 49 * -253919. -12442031 3 * -7957182 -23871546 What is the product of 4931.67 and 928? 4576589.76 What is 42720 times -2? -85440 34.4682 * -4 -137.8728 Product of 1288053 and -6. -7728318 What is the product of 5577207 and 5? 27886035 What is -115048.349 times -0.3? 34514.5047 Product of 2084.3301 and -3. -6252.9903 -109 times -569478 62073102 Work out 1027.315 * 7. 7191.205 -1709-122 208498 Work out 3 -5600863. -16802589 Multiply 2136 and -62.56. -133628.16 893732.2 times 1 893732.2 -5558153 times -0.6 3334891.8 Product of -1348465 and 7. -9439255 -8.0949-3850 31165.365 What is the product of -6.01 and 8845? -53158.45 What is -135994.8 times -4? 543979.2 Product of -4 and 65978.15. -263912.6 -7857086-1 7857086 What is 984609.3 times -0.31? -305228.883 What is the product of 0.124146944 and 2? 0.248293888 What is -0.032 times 2588313? -82826.016 What is the product of -0.4151473 and 0.1? -0.04151473 26.569 times 23 611.087 -5-11412318 57061590 -3-3991041 11973123 What is 201155898 times -3? -603467694 -111247303 -11247303 What is -64403414 times 0? 0 Multiply 45 and 12.90931. 580.91895 Multiply -24392 and 111. -2707512 What is 0.633 times -1.37917? -0.87301461 Product of -0.578 and -27561. 15930.258 What is the product of 2091994 and 76? 158991544 What is 1062465 times 7? 7437255 -462.1 times -20567.2 9504103.12 0.0379-103.596 -3.9262884 -545938.34 * 0 0 -10.650.286246 -3.0485199 Work out -42496202 0.1. -4249620.2 Calculate -0.315966-49. 15.482334 Product of 0.7 and -291551. -204085.7 Product of 358 and 969.13. 346948.54 Product of -7.31 and 8480. -61988.8 -2.9 256.518 -743.9022 Calculate -98171849-7. 687202943 -57 times -0.92068 52.47876 What is the product of -10.2 and 3879451? -39570400.2 251101245 31261950 339608 times 0.16 54337.28 Work out 4 * -5273851. -21095404 What is the product of -400456891 and -0.5? 200228445.5 Multiply -291930 and -991. 289302630 Calculate 211244340. 26131140 359-87599 -31448041 What is the product of -0.6847 and 72.015? -49.3086705 What is -392537 times -116? 45534292 What is -2730 times -5434.6? 14836458 What is the product of -52788 and 203? -10715964 Product of -38409.03 and -4. 153636.12 What is 0.5 times 2.41118? 1.20559 -2023774 times 112 -226662688 Product of 61 and -29554. -1802794 Calculate -0.3-203895. 61168.5 Product of 1860.75 and 1543. 2871137.25 3 times -18262934 -54788802 -693 0.6102 -422.8686 -298321.3 times -1.17 349035.921 Work out 39.0701 * -4. -156.2804 What is 100147220 times -5? -500736100 Multiply -166 and 41843. -6945938 What is the product of 39711 and 55.2? 2192047.2 Product of -24.8 and -3578117. 88737301.6 Product of 286 and -22.365. -6396.39 0.2 times 10266.4398 2053.28796 2289 * -214899 -491903811 -16870 times -3.59 60563.3 0.030411-25 -0.760275 Product of 1.369 and 340930. 466733.17 What is the product of -87080 and 2.166? -188615.28 10259589 16 164153424 What is 11226935 times -16? -179630960 What is the product of 169 and 0.4051? 68.4619 What is the product of 40732.8 and -2.99? -121791.072 -15 times 2463727.9 -36955918.5 Work out 7789 * -1399. -10896811 What is the product of -0.1144 and 10.22? -1.169168 Work out -20.39 * -319. 6504.41 What is the product of 1.621 and 100270? 162537.67 Work out -0.05 * -3399800. 169990 Calculate 1014-180.668. -183197.352 Product of -6.0995 and 3.05. -18.603475 Product of -1.25877 and -0.101. 0.12713577 Multiply -3835834 and -4.63. 17759911.42 Work out -5 2798.59. -13992.95 What is 0.59 times -1516486? -894726.74 What is -1395.4 times 57575? -80340155 -0.7 times 0.431704 -0.3021928 Work out -2.19660269 * -0.4. 0.878641076 6.9 * 575021 3967644.9 -88 * 185.94 -16362.72 -1916.634 * 0.09 -172.49706 -0.2 times -1.6303016 0.32606032 What is the product of -170695 and 299.5? -51123152.5 -0.2 * 0.051129397 -0.0102258794 Calculate 0.066-637318. -42062.988 What is 2526.6797 times -2? -5053.3594 What is -9977712.2 times -0.5? 4988856.1 Calculate -10222112-9. 91999008 Product of 50.81247 and -0.2. -10.162494 1-272814351 -272814351 What is -0.4631788 times -10? 4.631788 15450065.61 15450065.6 -215.91 * -322.4 69609.384 2.4 times -0.0820768 -0.19698432 1727244 times -979 -1690971876 Product of -15.712325 and 20. -314.2465 230297897 times 5 1151489485 2655 times 3886 10317330 Calculate 6977.886-42. -293071.212 Multiply -8438 and 0.05501. -464.17438 What is the product of 2466 and 0.405892? 1000.929672 Work out -418 27053.6. -11308404.8 Calculate -1377129.8. -410375.8 What is 1383.35 times 944? 1305882.4 -2 times 101292 -202584 2.5145 times -0.09571 -0.240662795 Product of -2501399 and 0.1. -250139.9 177025910.1 1770259.1 166 times 142532 23660312 What is 10093.2017 times -3? -30279.6051 1604 * -14.289 -22919.556 1 * 39.30412 39.30412 What is the product of -8 and 3099097? -24792776 What is the product of 2.34628 and 36? 84.46608 Product of -264062 and -0.1. 26406.2 Work out 9 * -0.11248146. -1.01233314 Multiply 0.507 and 79178. 40143.246 Product of -215499736 and 0.5. -107749868 Product of -0.3 and -0.5771685. 0.17315055 What is the product of -3 and -12408949? 37226847 Multiply 616 and -2.88165. -1775.096	{ "pile_set_name": "DM Mathematics" }
v = 6 + -4. Suppose 0 = vq - 5 + 3. Calculate the greatest common divisor of q and h. 1 Let f = 84 + -29. Suppose 3m + 3n - 4 = 8, -2n + 4 = 0. Let u = m + 3. Calculate the highest common divisor of u and f. 5 Let f = 22 - 4. Calculate the highest common factor of 6 and f. 6 Suppose -3t = 2t + 4g - 2, -5g - 4 = 3t. What is the highest common divisor of t and 14? 2 Suppose 0 = -5m - 0m + 10. Let w = m - -1. Suppose wf = 16 + 26. What is the highest common divisor of f and 84? 14 Let x(t) = t*3 + 4t*2 + 4t + 3. Let q be x(-2). Suppose -qs + 22 = 3u + 4, 2s = 4u + 6. Calculate the highest common factor of 25 and s. 5 Suppose 4k = 3k + 9. Suppose -d = s - 6d - 73, -s + 4d + 71 = 0. Calculate the greatest common factor of s and k. 9 Let u = 17 - 18. Let t be 8u/((-4)/10). What is the greatest common divisor of t and 120? 20 Let x = -4 - -6. Let n = 18 - 13. Suppose -h - 2f - 2f = -22, nh - f = 68. Calculate the greatest common factor of x and h. 2 Let q = -3 + 8. Calculate the highest common factor of q and 5. 5 Let t be 94/6 + (2 - 15/9). Calculate the highest common divisor of 80 and t. 16 Let x = 253 - 148. Calculate the highest common factor of x and 35. 35 Let i = -2 - -37. Suppose i = 2d - d. What is the greatest common divisor of 7 and d? 7 Let u be (-118)/(-4) - 1/(-2). Let b(t) = -t2 - 11t - 5. Let r be b(-10). Suppose -rz + 54 = -6. Calculate the highest common divisor of u and z. 6 Let l = -10 + 13. Calculate the greatest common divisor of 1 and l. 1 Let u(l) = -l2 + 6l + 5. Let o be u(5). Calculate the highest common factor of 100 and o. 10 Let j(a) = a*3 + 5a*2 - 9a - 8. Suppose -5k + 2x - 3 - 19 = 0, 3k - 2 = 5x. Let b be j(k). What is the highest common divisor of 15 and b? 5 Let f = -21 + 95. Suppose 0 = 4i + d - f, 4d + d = 10. Let g = -22 - -49. What is the greatest common factor of i and g? 9 Let n(j) be the third derivative of j6/120 + j5/12 - j*4/12 - 2j*3/3 - 2j*2. Let u be n(-3). What is the highest common divisor of u and 10? 10 Suppose 0 = -2x - 5c + 70, -112 = x - 4x - 4c. What is the highest common divisor of x and 2? 2 Suppose -4j = 4f + f - 10, 2 = f - 2j. Let n(p) = 4p3 + 3p*2 - 3p + 1. Let b be n(f). Calculate the highest common factor of 13 and b. 13 Suppose -3h - 5p = -104 - 149, -h + 96 = 4p. Let x = h - 40. Calculate the highest common factor of 54 and x. 18 Suppose -180 = -5i - 0i. Let o(s) = -s2 + 12. Let z be o(0). What is the highest common divisor of i and z? 12 Suppose k = 4b + 44, -b = -5k - 6b + 170. Calculate the greatest common factor of 18 and k. 18 Let i = 17 - 0. Let z(v) = 1 + 2v2 - 3 - 1 + 3v. Let h be z(-4). What is the highest common divisor of i and h? 17 Let d = 167 - 243. Let s = d - -148. What is the highest common divisor of s and 8? 8 Let m(x) = 6x3 + x2 + x + 1. Suppose 0 = 2o + 4, 6t + 2o + 9 = t. Let j be m(t). Let s = j - -6. What is the greatest common factor of 4 and s? 1 Suppose 3r + 3 = 4r. Let d be (r/6)/((-2)/(-20)). Suppose 25 = 5z - d. Calculate the highest common divisor of 6 and z. 6 Let n be (-2)/(-4) - 3/(-6). Suppose 3c = 10 - n. Calculate the greatest common divisor of c and 3. 3 Let q(r) = -r*2 + 11r - 11. Let v(y) = y. Let z(m) = -q(m) + 5v(m). Let g be z(7). Calculate the highest common factor of 36 and g. 18 Let k(n) = -4n - 24. Let a be k(-12). Calculate the greatest common factor of 168 and a. 24 Let k(m) = m*3 - 8m*2 + 7m - 6. Let s be k(8). What is the greatest common divisor of 20 and s? 10 Let k(n) = -9n3 + n2 + 3n + 2. Let c be k(-1). What is the greatest common factor of 1 and c? 1 Let l be 194/6 - 1/3. Suppose -4j - k + 18 = 0, 0 = -2k + 4. What is the highest common factor of j and l? 4 Suppose 5 = -4t - 3. Let j be (-1)/t + 308/8. What is the greatest common factor of 26 and j? 13 Let r(g) = g - 1. Let m be r(-2). Let q = 13 + m. What is the greatest common factor of q and 30? 10 Suppose 0 = -3j - 4 - 14. Let l(f) = 4f2 + f - 2. Let d be l(j). What is the highest common factor of 17 and d? 17 Let a = 23 + -13. Calculate the highest common divisor of 25 and a. 5 Let r be (0/(-2)-1)/1. Let x be (0 - -10) + r + 0. Suppose -2v = -4v - x, -3h + 47 = -v. Calculate the highest common factor of h and 7. 7 Suppose 0 = y + 2h - 1, 0 = -4y - h + 20 - 2. Suppose -yv - 3l + 330 = -4l, l - 264 = -4v. Calculate the highest common divisor of v and 44. 22 Let r(c) = c3 + 3c + 3. Let t be r(3). Calculate the highest common divisor of 13 and t. 13 Suppose -5 = 2i + 3, 2i = l + 53. Let k = 111 + l. Let a(x) = 4x2 - x + 2. Let n be a(-2). Calculate the greatest common divisor of n and k. 10 Let v = 172 - 91. Calculate the greatest common divisor of 9 and v. 9 Let o(y) = -y2 + 7y - 1. Let s be o(5). Suppose 3b + d = -125, 4b + d = -3d - 180. Let h = b - -85. Calculate the highest common divisor of s and h. 9 Suppose -5d + 3t + 641 = 0, -3d - 5t = -4d + 115. What is the greatest common divisor of 26 and d? 26 Suppose -12s = -609 + 129. What is the greatest common divisor of 200 and s? 40 Let d be (-80)/10(-1)/2. Suppose -48 = -7z + dz. Calculate the highest common factor of 24 and z. 8 Suppose -h + 3h = -4k + 36, -3h - 2k = -42. What is the highest common factor of 12 and h? 12 Suppose -q = -2d - 3q + 2, 0 = 5d - 5q - 45. Suppose 2j + 3j = 75. What is the highest common divisor of d and j? 5 Let d = 5 + -3. Suppose -8 = -2m - 0h - dh, -5m = 4h - 24. Suppose 60 = -7v + 10v. Calculate the greatest common divisor of m and v. 4 Let w be 6/(-4)(-2 - 38). What is the greatest common factor of w and 12? 12 Suppose -3k = 2k - 265. Let u = k + -17. Suppose 0 = -4o + o + u. Calculate the highest common factor of o and 132. 12 Let r(j) = j + 7. Suppose 0 = q - 4q - 15. Let t be r(q). Suppose 0 = -th - 20 + 56. What is the highest common factor of h and 12? 6 Let s be ((-26)/(-3))/((-4)/(-6)). Let z(u) = 15u*2 - u - 1. Let o be z(1). Calculate the highest common divisor of o and s. 13 Let k be (-3)/(-9) - 78/(-9). Suppose 5w - 3i - 9 = 5, 0 = 3i + k. What is the highest common factor of 7 and w? 1 Suppose -2v + 16 = 2h - 12, -3v - 6 = 0. Calculate the greatest common factor of 8 and h. 8 Suppose -5f = -5 - 5. Suppose -2z + 27 = 3w, z - fz = -3w - 27. Calculate the highest common factor of 2 and z. 2 Let s(g) = 5g + 2. Let c be s(-3). Let b = c - -18. Suppose -2j = -4h + 176, h - 3j + 0j = 39. Calculate the highest common factor of b and h. 5 Suppose 0 = -4p - 134 + 450. Let l be (-1)/(1/2) + p. Calculate the highest common factor of 7 and l. 7 Let f be 0 + 28 + 2 + 3/(-1). What is the greatest common divisor of 189 and f? 27 Let j be 26 + ((-6)/(-3))/(-1). Let d(k) = -4k3 - 2k*2 - k. Let y be d(-1). Calculate the highest common factor of j and y. 3 Let l(b) = -15b. Let d be l(-1). Calculate the highest common factor of d and 75. 15 Suppose 0x = x - 3. Suppose t - 2t = -x. What is the highest common divisor of 1 and t? 1 Suppose 0s = 2s - 274. Suppose -h + 4h = 5u - s, -2h + 117 = 5u. Calculate the highest common divisor of u and 10. 5 Let d(v) = v + 34. Let n be d(29). Let r = 22 - 13. Calculate the highest common factor of n and r. 9 Suppose -2l + 6u + 16 = u, -5l - 3u = -102. What is the greatest common divisor of l and 12? 6 Suppose 5z + 23 + 27 = 0. Let t = 1 - z. Calculate the greatest common divisor of t and 99. 11 Let k(i) = -i3 - 4i*2 - i - 1. Let w be k(-4). Suppose -5r + 0a - 4a + 92 = 0, wr - a - 45 = 0. Calculate the highest common divisor of 48 and r. 16 Let f(y) = -y + 1 - 2 + 2. Let x(m) = -7m. Let v(l) = -5f(l) + x(l). Let b be v(-4). Calculate the greatest common divisor of b and 9. 3 Let q(x) = -x3 - 9x*2 + 10x + 2. Let b be q(-10). Suppose 4u + 12 = 0, 4m - 5u = -bu + 129. What is the highest common divisor of 270 and m? 30 Let i = 183 + -154. What is the highest common divisor of i and 145? 29 Let z be (-4)/10 - (-110)/25. Suppose -zh + 5 = -11. Suppose -25 - 107 = -ha. What is the greatest common factor of 3 and a? 3 Suppose 76 = 2l - o, 2l - 5*o = -o + 88. Calculate the highest common factor of 24 and l. 12 Let w = -23 - -28. Calculate th	{ "pile_set_name": "DM Mathematics" }
en 519 is divided by 179. 161 What is the remainder when 19749 is divided by 290? 29 Calculate the remainder when 682373 is divided by 5. 3 What is the remainder when 6717 is divided by 1087? 195 Calculate the remainder when 9821 is divided by 2451. 17 Calculate the remainder when 3547 is divided by 49. 19 Calculate the remainder when 379040 is divided by 79. 77 Calculate the remainder when 2397 is divided by 39. 18 What is the remainder when 72706 is divided by 6? 4 Calculate the remainder when 27158 is divided by 406. 362 Calculate the remainder when 591187 is divided by 153. 148 Calculate the remainder when 357483 is divided by 6620. 3 What is the remainder when 84504 is divided by 506? 2 Calculate the remainder when 3066122 is divided by 25. 22 Calculate the remainder when 112625 is divided by 361. 354 Calculate the remainder when 17990 is divided by 3594. 20 Calculate the remainder when 26697 is divided by 1226. 951 Calculate the remainder when 6459 is divided by 5. 4 Calculate the remainder when 9341249 is divided by 661. 658 What is the remainder when 386566 is divided by 78? 76 Calculate the remainder when 153995 is divided by 100. 95 Calculate the remainder when 15324 is divided by 1664. 348 What is the remainder when 3441 is divided by 1136? 33 What is the remainder when 57501 is divided by 16? 13 What is the remainder when 3412 is divided by 132? 112 What is the remainder when 261913 is divided by 353? 340 Calculate the remainder when 97317 is divided by 199. 6 Calculate the remainder when 69881 is divided by 1426. 7 Calculate the remainder when 4873 is divided by 112. 57 Calculate the remainder when 218268 is divided by 167. 166 Calculate the remainder when 634087 is divided by 12. 7 What is the remainder when 45807 is divided by 777? 741 What is the remainder when 2123 is divided by 1057? 9 What is the remainder when 1565 is divided by 24? 5 Calculate the remainder when 19803 is divided by 129. 66 What is the remainder when 16304 is divided by 291? 8 What is the remainder when 851 is divided by 617? 234 Calculate the remainder when 14573 is divided by 18. 11 What is the remainder when 28418 is divided by 9464? 26 What is the remainder when 51730 is divided by 24? 10 Calculate the remainder when 222 is divided by 20. 2 What is the remainder when 204676 is divided by 1651? 1603 What is the remainder when 5989799 is divided by 804? 803 What is the remainder when 2539 is divided by 1898? 641 Calculate the remainder when 8207 is divided by 2729. 20 Calculate the remainder when 7671 is divided by 220. 191 Calculate the remainder when 37975 is divided by 233. 229 What is the remainder when 9427 is divided by 69? 43 What is the remainder when 8048 is divided by 8034? 14 Calculate the remainder when 726335 is divided by 26901. 8 What is the remainder when 2004033 is divided by 548? 545 What is the remainder when 3481 is divided by 75? 31 What is the remainder when 13720 is divided by 979? 14 Calculate the remainder when 349121 is divided by 95. 91 What is the remainder when 63940 is divided by 5? 0 Calculate the remainder when 80523 is divided by 20126. 19 Calculate the remainder when 51610 is divided by 42. 34 What is the remainder when 57894 is divided by 28894? 106 What is the remainder when 2088 is divided by 938? 212 Calculate the remainder when 135421 is divided by 67642. 137 What is the remainder when 100637 is divided by 148? 145 Calculate the remainder when 19878 is divided by 170. 158 Calculate the remainder when 13503 is divided by 3229. 587 Calculate the remainder when 9700 is divided by 336. 292 Calculate the remainder when 135176 is divided by 51. 26 What is the remainder when 169061 is divided by 169058? 3 What is the remainder when 2415118 is divided by 347? 345 What is the remainder when 12061 is divided by 98? 7 What is the remainder when 25103 is divided by 1475? 28 Calculate the remainder when 57728 is divided by 62. 6 What is the remainder when 718 is divided by 599? 119 What is the remainder when 42509 is divided by 5312? 13 Calculate the remainder when 2344 is divided by 690. 274 What is the remainder when 363436 is divided by 13? 8 Calculate the remainder when 1748 is divided by 124. 12 What is the remainder when 401 is divided by 21? 2 What is the remainder when 25264 is divided by 12631? 2 What is the remainder when 20995 is divided by 9? 7 What is the remainder when 31532 is divided by 108? 104 Calculate the remainder when 225 is divided by 83. 59 What is the remainder when 182 is divided by 162? 20 What is the remainder when 23887 is divided by 11943? 1 What is the remainder when 40659 is divided by 10103? 247 Calculate the remainder when 53775 is divided by 55. 40 Calculate the remainder when 541743 is divided by 29. 23 Calculate the remainder when 7410 is divided by 157. 31 Calculate the remainder when 1407 is divided by 202. 195 What is the remainder when 69782 is divided by 4361? 6 Calculate the remainder when 1544 is divided by 1503. 41 What is the remainder when 4286 is divided by 1419? 29 Calculate the remainder when 197827 is divided by 2826. 7 Calculate the remainder when 638 is divided by 38. 30 Calculate the remainder when 928814 is divided by 112. 110 What is the remainder when 33249 is divided by 16622? 5 What is the remainder when 73951 is divided by 510? 1 Calculate the remainder when 2345 is divided by 821. 703 What is the remainder when 4240 is divided by 90? 10 Calculate the remainder when 29404 is divided by 9755. 139 Calculate the remainder when 1255060 is divided by 50. 10 Calculate the remainder when 925 is divided by 249. 178 What is the remainder when 31434 is divided by 7? 4 Calculate the remainder when 14167 is divided by 7083. 1 What is the remainder when 729 is divided by 99? 36 Calculate the remainder when 387816 is divided by 96946. 32 Calculate the remainder when 8201 is divided by 2044. 25 What is the remainder when 3362 is divided by 668? 22 Calculate the remainder when 771491 is divided by 182. 175 What is the remainder when 1129294 is divided by 221? 205 Calculate the remainder when 60731 is divided by 1786. 7 What is the remainder when 3219830 is divided by 313? 312 What is the remainder when 11701 is divided by 298? 79 What is the remainder when 39571 is divided by 22? 15 Calculate the remainder when 4031 is divided by 2009. 13 What is the remainder when 14832 is divided by 316? 296 Calculate the remainder when 381 is divided by 33. 18 What is the remainder when 245016 is divided by 81672? 0 What is the remainder when 22331 is divided by 5375? 831 Calculate the remainder when 19066 is divided by 1077. 757 Calculate the remainder when 162551 is divided by 128. 119 What is the remainder when 3183 is divided by 3043? 140 What is the remainder when 4410 is divided by 119? 7 Calculate the remainder when 11807 is divided by 368. 31 What is the remainder when 24515 is divided by 40? 35 Calculate the remainder when 5074 is divided by 452. 102 What is the remainder when 8044 is divided by 1974? 148 Calculate the remainder when 2420 is divided by 2401. 19 Calculate the remainder when 91143 is divided by 66. 63 What is the remainder when 23212 is divided by 11468? 276 What is the remainder when 22815 is divided by 326? 321 Calculate the remainder when 458 is divided by 150. 8 Calculate the remainder when 447 is divided by 8. 7 Calculate the remainder when 337609 is divided by 22. 19 What is the remainder when 205573 is divided by 3068? 17 What is the remainder when 813 is divided by 215? 168 What is the remainder when 1803 is divided by 23? 9 Calculate the remainder when 1197 is divided by 276. 93 What is the remainder when 86292 is divided by 134? 130 What is the remainder when 5472 is divided by 452? 48 Calculate the remainder when 34755 is divided by 39. 6 What is the remainder when 12553 is divided by 3967? 652 What is the remainder when 3273 is divided by 566? 443 What is the remainder when 4276 is divided by 186? 184 What is the remainder when 5267 is divided by 78? 41 What is the remainder when 87206 is divided by 17368? 366 Calculate the remainder when 10934 is divided by 74. 56 What is the remainder when 2762 is divided by 115? 2 What is the remainder when 955 is divided b	{ "pile_set_name": "DM Mathematics" }
+ (-3 - -7) + -8. -5 What is the value of -5 + (-3 - (-7 - -5)) + 5? -1 Calculate -10 + 4 + 4 - -6. 4 Calculate -5 - (-8 + 1 + 3) - -2. 1 Evaluate (7 - -1) + (0 - 1) + -2. 5 Calculate 7 + (1 - (-1 + 5)). 4 Evaluate (-31 - -20) + (-1 - -3). -9 Evaluate -2 + (3 - 4) + (-4 - -12). 5 What is the value of 10 - (-6 + 11) - 11? -6 Evaluate (1 - -5) + (30 - 35). 1 What is the value of (21 - 24) + (-2 - (-1 - 1))? -3 -1 - -9 - 4 - (-8 - -5) 7 (-10 - (-2 - 16)) + -7 1 2 + 0 - (-67 - -61) 8 What is -4 + 13 + (-3 - 2) - 3? 1 What is the value of 0 + (1 - 1) + 0? 0 -1 - (-5 - (-6 + 7 + -1)) 4 Calculate -1 + -6 + (9 - 6). -4 What is the value of (2 - (2 - 0)) + -1 + 1? 0 Evaluate 0 - (1 + (-4 - 5) + 2). 6 0 + (-2 - -5) + -7 -4 Evaluate 4 + -3 - (-4 + 5 - -1). -1 Evaluate (1 + -5 - -1) + 7. 4 Calculate -150 - -154 - (0 - 3 - -1). 6 What is the value of 5 + -10 - (-5 - -2)? -2 Calculate (-5 + 1 - -2) + 2 - -3. 3 What is -17 - (-24 - -14 - 5)? -2 What is -4 - -2 - (-2 - 1)? 1 4 - ((-5 + 2 - -3) + 10) -6 What is the value of (-5 - (-3 - -1)) + 0 - 0? -3 What is -3 + (1 - -4 - 2)? 0 What is -2 - -9 - (3 + -1)? 5 What is the value of -1 + 5 + -10 - -11? 5 What is 6 + -2 + 1 + -4? 1 What is the value of (1 - (1 + 0)) + (14 - 11)? 3 Evaluate 7 + -2 + -8 + -2. -5 Calculate -1 + (1 - (3 - 2)). -1 What is the value of (-1 - 0) + (-1 - (-3 + 0))? 1 What is the value of -8 + (4 - 2 - -1) + 0? -5 What is the value of 0 + -36 + 44 + 0 + -5? 3 -11 - (-3 - -3 - 6) -5 What is -2 - (-2 + 0 - (13 + -8))? 5 Calculate -7 + 5 - (-2 - 6). 6 What is 0 - 4 - (-2 - -1 - -2)? -5 Calculate 2 + -3 + -2 + (1 - 3). -5 What is (10 + -7 - 1) + 4? 6 Calculate 13 + 1 + -7 + -11. -4 What is -2 + 1 - (-2 + -10 + 9)? 2 What is the value of 5 + 0 + (-1 - 2) + -5? -3 Calculate -4 + 1 + -3 - -6. 0 3 + -3 - 7 - -3 -4 What is 4 - (3 - 1) - 3? -1 What is the value of 0 + (-1 + 1 + 3 - 0)? 3 Evaluate 8 - ((32 - 31) + (6 - 1)). 2 Calculate -2 - -8 - (-7 + 13). 0 What is the value of 23 + -24 + (-3 - -1) + -1? -4 7 - (9 + (0 - (7 + -2))) 3 (1 - -4) + (13 - (-1 - -14)) 5 What is 3 + (0 - 1) + (-13 - -9)? -2 (6 + 3 - 13) + 2 + 0 -2 1 + -5 + 4 + -3 -3 What is the value of 1 + 11 - (2 + 3)? 7 Evaluate (-5 - (-3 - (-2 + -1))) + 1. -4 Calculate (0 + 1 - -2) + 7 + -7. 3 Calculate 13 - 11 - (-3 - -7). -2 What is -1 + -2 + (6 - 1)? 2 What is the value of 2 - ((-7 - -4) + 6)? -1 What is 12 + -11 - (0 + 4)? -3 3 - (-6 + 7) - 7 -5 Evaluate (0 - -4) + (-8 - (-5 + 3)). -2 Evaluate (-7 - (-14 - -3)) + 1. 5 6 - (3 - (-9 - (-5 - -1))) -2 Calculate 1 + -8 - (26 + -15 + -14). -4 (20 - 7 - 10) + -4 -1 What is the value of 0 - -7 - (86 + -73)? -6 Calculate -10 - (-2 + -7 + 3). -4 What is the value of 11 - 14 - (-1 + 4) - 1? -7 (33 - 35) + -1 + -3 -6 Evaluate -4 + (6 - -1) - (0 - -6). -3 Evaluate -4 + 4 + -6 + 2. -4 (0 - (6 - (4 - 1))) + 1 -2 What is 3 + (2 - 3) + 7 + -4? 5 Calculate 17 - (3 - (6 + -9)) - 2. 9 -1 - -8 - (20 + 14 + -32) 5 8 + -19 + 0 + 6 + 8 3 7 - 2 - ((2 - 6) + 11) -2 What is (1 - (-1 - -8)) + 0? -6 0 - 2 - (2 - (0 + 2)) -2 What is the value of 2 + 3 - (-8 + 7) - 6? 0 Evaluate -21 + 4 + 24 - (-1 + 11). -3 Calculate -1 - (-13 - -5) - 10. -3 Evaluate -3 + 2 - (-29 - -28). 0 Calculate -2 + 4 + -3 + 10 - 6. 3 1 + -1 + 3 + -1 + -1 1 -2 + (7 - (2 + 5)) -2 What is 0 + 15 - (15 - 7)? 7 -2 + (-10 - -5) + -1 + 3 -5 What is the value of (-6 - (-11 - -4)) + 0? 1 Calculate (55 - 64) + 14 + -2. 3 What is 3 + (3 + 3 - (13 - 6))? 2 What is the value of 0 - (-2 + 3) - (24 + -23)? -2 What is 2 - 0 - (7 + (-10 - -11))? -6 What is (135 - 126) + (1 - 2)? 8 Calculate 0 - (0 - -4) - (-3 - -1). -2 What is the value of (8 - 9) + (-3 - (-1 + -1))? -2 Calculate 11 + -1 + (-37 - -28). 1 -2 + (0 - -5) + -6 -3 What is the value of 4 - -1 - -1 - (-1 - -2)? 5 Evaluate -1 + 8 - (5 + (9 - 12)). 5 Calculate -15 + (-1 - -2 - -6) - -8. 0 (2 - 7) + 8 - (1 - 1) 3 102 + -98 + (-1 - 11) -8 Calculate -1 + 4 - (5 + -1). -1 What is the value of 3 - 7 - (5 - 7)? -2 38 + -37 + 0 + 0 + 4 5 Calculate 3 - (0 - -1 - -1). 1 (2 - 1) + -6 + 5 - 2 -2 Calculate -1 - 2 - (-2 - 2). 1 -1 - (3 + (-4 + 4 - 10)) 6 What is the value of 2 + -6 + (0 - 2)? -6 Calculate 5 + 0 + -2 + (11 - 10). 4 What is (-9 + 7 - -7) + -3? 2 Evaluate (-5 + -5 - -12) + -5. -3 What is the value of 1 + -23 + 14 + 0? -8 Evaluate 5 + -3 + 9 + -1 + -3. 7 What is the value of (-5 - (-7 + -2)) + -11? -7 Calculate (2 - -2 - 3) + -6 + 2. -3 What is 7 - (9 + -9 - -7)? 0 What is -3 + 9 - (9 - 6)? 3 -12 + (2 - (4 + -5)) -9 -12 - (-21 - (-6 - 3)) 0 What is the value of (-4 - (-6 - -2)) + 3 + 0? 3 17 + (-5 - 1) + -3 + 1 9 Calculate 4 + (3 + -1 - 3). 3 What is the value of -9 - -10 - (9 - 3)? -5 What is the value of 0 + (-3 - (-8 + 6))? -1 What is the value of 0 + (-1 - (1 + -6))? 4 Calculate 1 + 3 + -4 + (1 - -4). 5 Evaluate 27 + -36 + (-1 - -8). -2 2 - (-9 + 6) - (12 + 0) -7 (0 - -2) + 3 + -48 + 39 -4 -8 + 14 + -3 + -3 0 14 - (7 - 21 - -23) 5 Evaluate 5 + (-5 - (0 + -2)). 2 Calculate 1 + (-17 - -17) + 1 + 2. 4 2 + -7 + -2 + 3 -4 -2 + 1 - (-8 + 8) -1 Calculate -9 + (-5 - (-30 - -9)). 7 Evaluate (1 - 4) + 0 - (-2 + 1). -2 -1 + (0 - 8 - (-10 - -6)) -5 Evaluate 0 + (10 - 5) + -4. 1 What is -6 + (1 - (4 - 4))? -5 Calculate -1 - (5 - 5) - 4. -5 Evaluate -3 + (-1 - -8) + -2 - 1. 1 Evaluate (1 - -4) + -1 + (0 - 9). -5 What is the value of -1 + 0 + 15 + -8 - 6? 0 5 + -2 - 5 - -6 4 Calculate 4 - 2 - (-2 + 0). 4 What is the value of 1 + -10 + 10 + 1 + 4? 6 What is the value of (-1 - -4) + 1 + (63 - 63)? 4 Evaluate 0 + -3 - (8 - 14). 3 0 + 0 + -1 + 4 + -5 -2 Evaluate -2 + -4 - (-3 + 7 + -5). -5 2 + 1 + -3 + 3 + -1 2 Calculate -15 + (4 - (3 + -8)). -6 6 + 7 - 4 - (7 + -5) 7 Calculate -4 + (4 - 5 - -3) + 1. -1 What is the value of -2 - (3 - 3) - (-6 - -2)? 2 What is 0 - 2 - -2 - -8? 8 Calculate 2 - ((-2 - -2) + -1). 3 Evaluate (-2 - (5 + -2)) + 3. -2 What is the value of (4 - (-6 - (1 - -3))) + -8? 6 155 + -146 + (1 - 13) -3 What is 1 + 0 + 42 + -40? 3 Calculate 5 + (3 - ((6 - -4) + -5)). 3 What is the value of -25 + 5 + 7 + 7? -6 Calculate -10 - -4 - (1 + -9). 2 8 + 0 - (2 - -2) 4 What is the value of 15 - (-12 - (-35 + 12))? 4 2 - (5 + 7) - -9 -1 Calculate -11 + (11 - (3 + 3)). -6 What is the value of -3 - (1 + (-6 - -3) - -6)? -7 -1 - (-1 - -2 - 8) 6 What is 6 - ((2 - -7) + -5)? 2 15 + 0 + -16 + (7 - -2) 8 What is 4 - (0 + 3 - 1)? 2 What is the value of -5 - (6 + -9) - (-6 + -1)? 5 What is the value of 0 + (-6 - -2) + -1? -5 Calculate (9 - (5 - -1)) + 0 + -7. -4 What is the value of -6 + (15 - (19 + -10))? 0 9 + (0 - 18) + 7 -2 What is the value of (13 - 8) + -3 + 0? 2 What is the value of 1 - (-1 - -2) - (23 - 26)? 3 What is the value of (2 - -4) + 27 + -29? 4 What is 11 + -5 - (4 + -1)? 3 What is the value of 2 - 0 - (1 - (-1 + 0))? 0 What is 4 + (0 - -2) - 4? 2 What is the value of -5 + 2 + -2 + 8? 3 Evaluate 2 + 0 - (6 + 2 + -1). -5 What is the value of 14 - 9 - (-1 - -9)? -3 Evaluate -4 - 3 - (1 + 1 + -3). -6 Evaluate 8 + 8 + -13 + -3. 0 What is the value of -2 + 4 + (3 - 8)? -3 What is 9 - (-6 + 15 + -7) - -2? 9 What is the value of (1 + -7 - (-7 + 0)) + 4? 5 Evaluate (-4 - 2) + 0 + 11. 5 Evaluate (-3 - 0) + -5 + 0 + 7. -1 15 - 9 - (-1 + 7) 0 What is -7 - (1 - 4) - (-3 - 0)? -1 Evaluate -6 - -2 - (0 + 0 - 9). 5 Calculate 0 - (0 + 1 + -1 - -2). -2 Calculate 2 + 0 + 2 + -1. 3 Evaluate 2 - 2 - (-3 - -6) - 1. -4 What is -1 + (-4 - (2 + -17 + 5))? 5 Calculate -11 + 5 + 4 - (-1 + -2). 1 Calculate 3 + -4 + 2 + -2. -1 -5 - (2 + 0 - 3) -4 Calculate (2 - 9 - (2 + -6)) + 8. 5 (1 - 6 - -10) + 2 7 2 + (6 - (-5 - -8)) + -1 4 Calculate -1 + 0 + (2 + -6 - -2). -3 1 + (-6 - (-1 + -2)) -2 What is the value of (3 - 0) + 3 + -11 + 10? 5 Calculate -7 + -1 + -1 - -5. -4 Calculate 3 + 2 + 2 + -3 + -2. 2 Calculate (-15 - -14) + (1 - 1) + 7. 6 Evaluate -9 - -2 - (-5 + 0). -2 Calculate -1 + 11 - (69 + -66). 7 Calculate (-1 - -5) + (1 - 6). -1 What is the value of 2 - ((0 - 2) + 3) - 0? 1 What is 5 + -3 - (6 + -1) - -5? 2 What is the value of 3 - 5 - 3 - -2 - 2? -5 Evaluate 10 + -7 + (4 - 2). 5 What is the value of 0 + -8 - -10 - (2 - -2)? -2 What is -2 + 1 + 2 - (-23 - -28)? -4 What is -6 - (-2 + -7) - 1? 2 Evaluate -2 + -3 + 10 + -2. 3 What is -3 - -15 - (-20 + 26)? 6 Evaluate (8 - 10) + -1 - -11. 8 Evaluate 2 - (-2 + 6 + -7).	{ "pile_set_name": "DM Mathematics" }
- 1 What is the q'th term of -6631078, -6631076, -6631074, -6631072, -6631070, -6631068? 2q - 6631080 What is the y'th term of -2314227, -2314198, -2314169, -2314140? 29y - 2314256 What is the v'th term of -42618, -170453, -383510, -681789, -1065290, -1534013? -42611v2 - 2v - 5 What is the r'th term of 4802350, 4802360, 4802382, 4802416, 4802462, 4802520? 6r2 - 8r + 4802352 What is the d'th term of 989246, 989268, 989290, 989312? 22d + 989224 What is the g'th term of -40743, -70683, -100625, -130569, -160515? -g2 - 29937g - 10805 What is the w'th term of -593954, -2375823, -5345610, -9503309, -14848914, -21382419, -29103818? w*3 - 593965w*2 + 19w - 9 What is the u'th term of 476, 3635, 12160, 28733, 56036, 96751? 447u3 + u2 + 27u + 1 What is the k'th term of 1890, 578, -1614, -4692, -8662, -13530? -k*3 - 434k*2 - 3k + 2328 What is the p'th term of -248698, -497438, -746184, -994936, -1243694? -3p2 - 248731p + 36 What is the p'th term of 18710, 18673, 18610, 18521? -13p2 + 2p + 18721 What is the i'th term of 793799, 1587610, 2381421, 3175232? 793811i - 12 What is the h'th term of -2491986, -2491916, -2491848, -2491782? -h2 + 73h - 2492058 What is the j'th term of 119336, 238617, 357898, 477179? 119281j + 55 What is the d'th term of -1871, -2664, -3451, -4226, -4983, -5716, -6419, -7086? d3 - 3d*2 - 791d - 1078 What is the s'th term of 9337, 31450, 68299, 119878, 186181, 267202? -s*3 + 7374s*2 - 2s + 1966 What is the t'th term of -91499, -183390, -275297, -367226, -459183? -t*3 - 2t*2 - 91878t + 382 What is the y'th term of 121084, 242239, 363466, 484765, 606136, 727579, 849094? 36y2 + 121047y + 1 What is the h'th term of 549375, 4395113, 14833543, 35161011, 68673863? 549391h3 + h - 17 What is the y'th term of 2536, 1796, 1150, 646, 332? 8y3 - y2 - 793y + 3322 What is the d'th term of -582278, -582236, -582166, -582068, -581942? 14d*2 - 582292 What is the m'th term of 7989, 26060, 54213, 92448, 140765? 5041m*2 + 2948m What is the o'th term of -124037, -124090, -124143, -124196, -124249, -124302? -53o - 123984 What is the h'th term of -2459, 885, 15809, 48103, 103557? 965h*3 - 3411h - 13 What is the h'th term of 11987, 12097, 12217, 12347, 12487, 12637, 12797? 5h2 + 95h + 11887 What is the x'th term of -922349, -1844758, -2767225, -3689750? -29x2 - 922322x + 2 What is the p'th term of 62897, 62823, 62759, 62717, 62709? 2p3 - 7p*2 - 67p + 62969 What is the b'th term of 165040111, 330080223, 495120335, 660160447, 825200559? 165040112b - 1 What is the z'th term of 96687, 193346, 290011, 386682, 483359, 580042? 3z*2 + 96650z + 34 What is the c'th term of -41558, -41682, -41806, -41930? -124c - 41434 What is the j'th term of -6248652, -12497310, -18745968? -6248658j + 6 What is the g'th term of 123, 39, -37, -111, -189, -277, -381? -g*3 + 10g*2 - 107g + 221 What is the j'th term of 162320, 324764, 487208, 649652, 812096? 162444j - 124 What is the t'th term of -2000574, -2000602, -2000630, -2000658, -2000686, -2000714? -28t - 2000546 What is the f'th term of -341251, -341236, -341221, -341206? 15f - 341266 What is the w'th term of -56081, -56104, -56159, -56252, -56389? -w3 - 10w*2 + 14w - 56084 What is the k'th term of -3437613, -3437617, -3437621? -4k - 3437609 What is the g'th term of -162864, -162859, -162852, -162843? g2 + 2g - 162867 What is the u'th term of 1594631, 3189260, 4783895, 6378536, 7973183, 9567836, 11162495? 3u2 + 1594620u + 8 What is the p'th term of 1420, 6094, 13918, 24892, 39016, 56290? 1575p2 - 51p - 104 What is the y'th term of -42347, -42152, -41849, -41444, -40943, -40352, -39677, -38924? -y*3 + 60y*2 + 22y - 42428 What is the y'th term of -5155, -20243, -45245, -80167, -125015, -179795, -244513? -y*3 - 4951y*2 - 228y + 25 What is the z'th term of 101541, 201583, 301625, 401667, 501709, 601751? 100042z + 1499 What is the g'th term of -66748, -66620, -66278, -65614, -64520? 18g3 - g2 + 5g - 66770 What is the o'th term of -283114, -284704, -286294, -287884, -289474, -291064? -1590o - 281524 What is the c'th term of -2007, -15197, -50791, -119991, -233999, -404017, -641247? -1867c3 - 121c - 19 What is the n'th term of 207923, 415830, 623737, 831644, 1039551? 207907n + 16 What is the p'th term of 2117526, 2117536, 2117546? 10p + 2117516 What is the m'th term of -78766, -90517, -110102, -137521, -172774, -215861? -3917m2 - 74849 What is the d'th term of 11871, 11235, 10599, 9963, 9327? -636d + 12507 What is the x'th term of 25620, 22599, 19578? -3021x + 28641 What is the c'th term of -213, -1385, -4329, -9855, -18773, -31893, -50025, -73979? -135c*3 - 76c*2 + c - 3 What is the t'th term of -16615, -13728, -10841, -7954, -5067? 2887t - 19502 What is the w'th term of 27360650, 27360644, 27360638, 27360632? -6w + 27360656 What is the p'th term of 2986, -10032, -23040, -36032, -49002, -61944, -74852? p3 - p2 - 13022p + 16008 What is the p'th term of 175487, 701886, 1579195, 2807408, 4386519, 6316522, 8597411? -p*3 + 175461p*2 + 23p + 4 What is the u'th term of 1004132, 2008202, 3012272, 4016342, 5020412, 6024482? 1004070u + 62 What is the x'th term of -49570, -396432, -1337940, -3171418, -6194190, -10703580, -16996912? -49554x3 + x2 + 13x - 30 What is the o'th term of 1189451, 1189459, 1189467? 8o + 1189443 What is the f'th term of -865, -3360, -7313, -12556, -18921, -26240, -34345? 28f3 - 897f*2 + 4 What is the x'th term of -37167, -297112, -1002591, -2376372, -4641223? -37128x3 + x2 - 52x + 12 What is the v'th term of 30597, 61355, 92113, 122871? 30758v - 161 What is the y'th term of -461006, -922273, -1383540? -461267y + 261 What is the n'th term of -60781, -243198, -547245, -972922, -1520229, -2189166? -60815n*2 + 28n + 6 What is the x'th term of -92016, -93385, -94754, -96123, -97492? -1369x - 90647 What is the x'th term of 1993, 8945, 20853, 37717, 59537? 2478x*2 - 482x - 3 What is the d'th term of 24251, 79098, 170509, 298484, 463023? 18282d2 + d + 5968 What is the k'th term of -3439827, -13759305, -30958425, -55037181, -85995567, -123833577? k3 - 3439827k*2 - 4k + 3 What is the r'th term of 229, 912, 2067, 3706, 5841, 8484, 11647? 2r3 + 224r*2 - 3r + 6 What is the k'th term of 471346, 942957, 1414566, 1886173? -k*2 + 471614k - 267 What is the t'th term of 88169, 91381, 94593, 97805, 101017, 104229? 3212t + 84957 What is the m'th term of -850841, -1701619, -2552393, -3403163, -4253929, -5104691? 2m*2 - 850784m - 59 What is the u'th term of -15807, -61108, -136609, -242310? -15100u2 - u - 706 What is the s'th term of -24968, -24973, -24982, -24995, -25012? -2s*2 + s - 24967 What is the d'th term of -1286221, -2572432, -3858647, -5144866, -6431089, -7717316, -9003547? -2d*2 - 1286205d - 14 What is the k'th term of 7991, 16723, 25453, 34181, 42907, 51631? -k*2 + 8735k - 743 What is the f'th term of 11501958, 11501934, 11501910? -24f + 11501982 What is the j'th term of 11842, 14069, 16296, 18523? 2227j + 9615 What is the j'th term of 22420, 22461, 22502? 41j + 22379 What is the g'th term of -777854, -777949, -778044, -778139, -778234, -778329? -95g - 777759 What is the t'th term of -600, -2386, -5342, -9468, -14764, -21230, -28866? -585t2 - 31t + 16 What is the j'th term of -20612686, -20612688, -20612690? -2j - 20612684 What is the a'th term of -140592, -280334, -420078, -559824? -a2 - 139739a - 852 What is the f'th term of -58267, -233509, -525579, -934477, -1460203? -58414f2 + 147 What is the q'th term of 12518, 50093, 112706, 200357, 313046, 450773? 12519q*2 + 18q - 19 What is the h'th term of -6286683, -12573367, -18860049, -25146729? h*2 - 6286687h + 3 What is the x'th term of -1043, -2, 1039, 2080? 1041x - 2084 What is the l'th term of 572, 2989, 7034, 12719, 20056, 29057, 39734? 2l*3 + 802l*2 - 3l - 229 What is the a'th term of -12628, -26813, -44094, -66019, -94136, -129993, -175138? -258a3 - 12379a + 9 What is the d'th term of -344899, -689808, -1034717, -1379626, -1724535, -2069444? -344909*d + 10 What is the b'th term of -160981610, -321963220, -482944830, -643926440, -	{ "pile_set_name": "DM Mathematics" }
-t + 3. Suppose -5p - 4d + 8 = 0, 18 = lp - 3d - 7. Factor 3n2 + 2n*4 - 5 + 5 + 3n*3 - 3n - 5np. -3n(n - 1)2(n + 1) Let g be (12/42)/(1/21). Suppose -11i + 15 = -gi. Determine y, given that y - 12y2 - yi + y2 + 3y*4 + 8y*2 = 0. -1, 0, 1/3, 1 Let p(h) = -9h*2 + 25h + 17. Let j(o) = -4o2 + 12o + 9. Let y(m) = 7j(m) - 3p(m). Let f be y(10). Factor 8w4 + w3 + 5w*5 - 2w2 - w2 + wf. w2(w + 1)2(5w - 2) Let w = 17565/4 + -4391. Solve -1/4i*3 + wi + 1/2 - 1/2i2 = 0 for i. -2, -1, 1 Let q(y) be the third derivative of y7/210 + y6/60 - y5/60 - y4/12 + 8y*2 - 19. Solve q(c) = 0 for c. -2, -1, 0, 1 Let g(w) = -12w + 770. Let j be g(64). Find l, given that 20/3l3 - 20l*4 + 0 + 0l*j + 0l + 25/3l5 = 0. 0, 2/5, 2 Determine f, given that 2f*5 + 0f*5 + 44f*4 + 118f*3 - 528f*2 + 242f - 92f4 + 214f*3 = 0. 0, 1, 11 Factor 0 + 1/2a*2 + 47/2a. a(a + 47)/2 Suppose -5c = 5z - 0c - 10, -3z - 2c = -5. Factor -16i - 3i2 - z - i2 - 11. -4(i + 1)(i + 3) Factor -5v3 + 26v*2 + 12v*2 + 21v*2 - 44v*2. -5v*2(v - 3) Factor 1251 - 10139 + 48092 + m*2 + 396m. (m + 198)*2 Suppose -2i + 6 = -58. Suppose 2k = -6k + i. What is u in -1/2uk + 0u + u*3 + 0 - 1/2u*2 = 0? 0, 1 Let w = 208772/5 + -41890. Let l = w + 136. Factor -2/5o*2 + 2/5o*4 + 0 + 2/5o - lo3. 2o(o - 1)2(o + 1)/5 Let y(t) be the first derivative of -4t3/15 - 58t*2/5 + 24t + 79. Determine x, given that y(x) = 0. -30, 1 Let t(l) = -l*3 - 12l*2 + 12l - 6. Let b(o) = 3o3 + 36o*2 - 34o + 17. Let g(k) = -6b(k) - 17t(k). Factor g(h). -h*2(h + 12) Suppose -p + 4 - 1 = 0. Let j(z) be the second derivative of 0zp - 5z + 0z2 + 1/12z4 + 0. Determine c so that j(c) = 0. 0 Let a(z) = z2 + 11z + 4. Let j be a(-10). Let n be (-8)/129/j. Suppose -17b2 - 2b + 1 + 16b2 - n = 0. Calculate b. -2, 0 Let s(j) be the second derivative of -1/120j*4 + 3j*2 - 1/30j*3 - 5j + 0 + 1/150j5. Let p(k) be the first derivative of s(k). Factor p(i). (i - 1)(2i + 1)/5 Let x be 5((-55)/(-22))/((-10)/(-4)). Let f(p) be the third derivative of -2p2 + 0 - 1/8p*3 + 1/240p*x + 0p - 1/48p4. Solve f(z) = 0. -1, 3 Let a(f) be the first derivative of -f5/4 - 5f*4/2 + 55f*3/12 + 45f*2/4 - 54. Factor a(z). -5z(z - 2)(z + 1)(z + 9)/4 Let u(q) be the first derivative of 2/9q*3 + 2/5q*5 - 1/18q*6 - 11/12q*4 + 2q*2 + 10 - 8/3q. Factor u(c). -(c - 2)*3(c - 1)(c + 1)/3 Let o(x) = -x4 + x3 - 4x*2 - x - 1. Let l(c) = -2c*4 + 4c*3 - 13c*2 - 4c - 3. Let y(k) = -l(k) + 3o(k). Let y(h) = 0. Calculate h. -1, 0, 1 Let k = -15 - -15. Let n = 0 - k. Factor 17s + 3s - 16s*2 + 4s*3 + 4 - 12 + ns*3. 4(s - 2)(s - 1)2 Determine a, given that 0a*3 - 14a*2 - 144 + 4a*3 - 6a*2 - 213a + 226a - 141a = 0. -2, 9 Let d(l) = l3 + l2 - 2l + 2. Let u(c) = -226c*3 - 451c*2 - 225c + 4. Let a(s) = d(s) - u(s). Find y, given that a(y) = 0. -1, 2/227 Factor 22/7w3 - 62/7w*2 + 0 - 2/7w*4 + 6w. -2w(w - 7)(w - 3)(w - 1)/7 Suppose 0 = -2i + 5y + 15, 4i - 4y + 15 = 27. Let w(j) be the first derivative of ij3 + 0j*2 - 3 - 1/45j*6 - 2/75j*5 + 0j + 0j4. Factor w(a). -2a*4(a + 1)/15 Factor 79/4t + 5t*2 + 15 + 1/4t*3. (t + 1)(t + 4)(t + 15)/4 Suppose -4l = 5 - 41. Let q = 13 - l. Factor -2f5 + 0f*3 - 4f*q + 4f*5 - 3f*3 + 5f*3. 2f*3(f - 1)*2 Let t = -3212/39 + 1296/13. Solve -tp + 16/3 - 14/3p2 = 0 for p. -4, 2/7 Let g = -3159/35 - -452/5. Let s(r) be the third derivative of gr*3 - 1/21r*4 - 11r*2 + 0 + 0r + 1/210r5. Factor s(q). 2(q - 3)(q - 1)/7 Let j(g) be the first derivative of g4/5 + 16g*3/5 - 24g*2 + 256g/5 - 557. Find x such that j(x) = 0. -16, 2 What is b in 84/5b4 + 6/5b*2 + 99/5b*3 + 3b*5 + 0 - 24/5b = 0? -4, -1, 0, 2/5 Let s = 70 - 68. Solve 26 - 11 - 16p - 29 - 2ps = 0 for p. -7, -1 Let t(q) be the third derivative of q7/70 + 11q6/20 + 121q*5/20 - 2q*2 + 2. Factor t(h). 3h*2(h + 11)*2 Let z(h) be the third derivative of 1/112h*8 + 0 - 8h*2 + 0h*5 - 1/40h*6 + 0h + 0h4 + 0h*7 + 0h*3. Factor z(m). 3m*3(m - 1)(m + 1) Let x(a) = 6a - 35. Let g be x(-7). Let v be 10/(-15) + (4 - g/(-24)). Find j such that 0 - 1/8j2 - vj = 0. -1, 0 Let y = 923/310 + -135/62. Let 6/5 - ys - 2/5s*2 = 0. What is s? -3, 1 Let q(d) be the first derivative of -4d*5/5 + 8d*4 - 8d*3 - 16d*2 + 28d - 745. What is u in q(u) = 0? -1, 1, 7 Let 116/7l4 + 4/7l*5 + 2344/7l*2 + 2132/7l + 1000/7l3 + 676/7 = 0. Calculate l. -13, -1 Let f(h) = 4h*2 - 212h - 62. Let w(r) = 15r2 - 847r - 248. Let k(j) = 26f(j) - 6w(j). Solve k(s) = 0. -2/7, 31 Let s(g) = -2g2 - 4g - 8. Let d(j) be the second derivative of -j4/6 - j3/2 - 4j2 + 12j. Let y(z) = -4d(z) + 5s(z). Suppose y(h) = 0. What is h? -2 Let i(w) = w*3 - 3w*2 + 2w + 6. Let u(m) = 2m3 - 5m*2 + 4m + 11. Let y(d) = 11i(d) - 6u(d). What is r in y(r) = 0? -2, -1, 0 Let q(z) = 8z2 - 36z + 170. Let j(f) = f*2 - 4f + 19. Suppose 57 + 3 = 10v. Let a(t) = vq(t) - 52j(t). Solve a(p) = 0. -4, 2 Let x be (-1 - -11)/((-4)/(-2)). Let a be (x - -2) + 0 - 3. Determine f, given that -3f*2 + 0f2 + f3 - af3 = 0. -1, 0 Let u(m) = -19m*3 + 47m*2 - 52m + 8. Let q(w) = 64w2 - 39w*3 + 49w*2 - 105w - 20w2 + 15. Let c(z) = 4q(z) - 9u(z). Factor c(v). 3(v - 2)(v - 1)(5v - 2) Factor -20x*2 - 1523x + 5x3 + 1523x. 5x2(x - 4) Let i(q) be the second derivative of 0 - 1/15q3 + 6q + 1/30q4 - 2/5q*2. Factor i(o). 2(o - 2)(o + 1)/5 Let a(w) be the first derivative of -1/12w*6 + 0w*2 + 2/5w*5 + 0w + 11/8w4 - 51 + w3. Let a(s) = 0. What is s? -1, 0, 6 Factor 332/7m*3 + 0m*2 + 2/7m*4 + 0m + 0. 2m3(m + 166)/7 Let i(n) be the second derivative of n9/15120 - n7/2520 + 11n4/12 + 20n. Let z(u) be the third derivative of i(u). Solve z(w) = 0. -1, 0, 1 Factor 361/8j3 - 17j*4 - 225/8j*2 - 27/8 - 189/8j + 2j5. (j - 3)3(4j + 1)2/8 Factor 104/7 + 8/7a*2 + 212/7a. 4(a + 26)(2a + 1)/7 Let 18 - 5d*3 + 3d - 19d2 + 2d*3 + 3d*4 - 25d*2 + 23d2 = 0. Calculate d. -2, -1, 1, 3 Let p(q) = -q2 - 12q + 19. Let r(m) = -12m + 21. Let k(b) = -3p(b) + 2r(b). Factor k(l). 3(l - 1)(l + 5) Let b(u) be the third derivative of u*5/12 + 5u*4/12 - 5u*3/2 - 332u*2. Factor b(q). 5(q - 1)(q + 3) Let j(l) be the third derivative of l9/15120 - l8/6720 - l7/2520 + l6/720 + 5l*4/8 - 8l*2. Let i(f) be the second derivative of j(f). Factor i(n). n(n - 1)*2(n + 1) Let q be (2 + 1 - 3) + -1. Let y be 0(q - (2 + -2)). Factor -7g + 3g2 + yg3 - g3 + 4g3 + g. 3g(g - 1)(g + 2) Let t(w) = w*3 + 2w*2 - 7w + 6. Let u be t(-4). Factor -5ku + 3k*2 + 31k + 14 - 19k. -2(k - 7)(k + 1) Factor -30y*2 + 312y - 4056/5. -6(5y - 26)*2/5 Let m be ((-16)/(-5))/(18/135). Factor mg*3 + 2763g*2 - 2779g*2 - 16g*4 + 3g*5 + 4g + g*5. 4g(g - 1)4 Let v = -4779 - -4781. Factor 27/5l*v + 0 - 6/5l. 3l(9l - 2)/5 Find r such that 11r*3 + 25r + 24r2 + 14r - 3r - 3r*4 - 14r*3 = 0. -2, 0, 3 Let m be 10(12 - 230/20). Factor -3/7t3 - 1/7t*2 - 1/7t*m - 3/7t*4 + 0t + 0. -t*2(t + 1)*3/7 Let i = 20493 + -20491. Suppose 4/11 - 14/11n + 2/11n4 + 18/11n*i - 10/11n*3 = 0. What is n? 1, 2 Factor -2u + 5u2 + 80 + 9u - 64u - 28u. 5(u - 16)(u - 1) Let w be 5/((-800)/632) - -4. Let y(t) be the third derivative of -1/30t5 + 0t + 5/36t4 + 0 - wt*6 - 1/9t*3 + 4t*2. Find l such that y(l) = 0. -1, 1/3 Let y(j) = 3j*4 - 5j*3 - 4j*2 + j - 5. Let z(v) = 3v*4 - 6v*3 - 3v*2 - 6. Let h(t) = 6y(t) - 5z(t). Determine c, given that h(c) = 0. -2, 0, 1 Let h(s) be the third derivative of -s6/60 + s5/6 - s4/2 + 107s2 + s. Find w such that h(w) = 0. 0, 2, 3 Let i(w) = -w2 + 13. Let f be i(0). Determine t so that 6 - 1 + ft2 + 2t*2 - 8t - 12t = 0. 1/3, 1 Let r be (-1)/(4/(-24)) - 0. What is s in -rs*3 - 9s*2 + 7s2 + s3 = 0? -2/5, 0 Let u(i) be the second	{ "pile_set_name": "DM Mathematics" }
-1162955, -1162945? a*2 + a - 1162975 What is the m'th term of -230592, -461174, -691756, -922338, -1152920, -1383502? -230582m - 10 What is the j'th term of -1212, -1252, -1314, -1392, -1480? j*3 - 17j*2 + 4j - 1200 What is the o'th term of -11999, -24256, -36511, -48764? o*2 - 12260o + 260 What is the c'th term of 12007, 11977, 11945, 11911, 11875, 11837? -c*2 - 27c + 12035 What is the j'th term of -3080, -11727, -26132, -46289, -72192, -103835, -141212, -184317? j*3 - 2885j*2 + j - 197 What is the h'th term of -231, -473, -715? -242h + 11 What is the i'th term of 8562, 17120, 25676, 34230, 42782? -i*2 + 8561i + 2 What is the g'th term of -165635, -662534, -1490701, -2650136, -4140839, -5962810? -165634g2 + 3g - 4 What is the g'th term of -6224527, -6224528, -6224529? -g - 6224526 What is the k'th term of -446, -877, -1310, -1745, -2182? -k*2 - 428k - 17 What is the g'th term of -6294, -6415, -6536, -6657, -6778? -121g - 6173 What is the u'th term of 387, 1261, 2693, 4665, 7159, 10157? -3u*3 + 297u*2 + 4u + 89 What is the n'th term of 285, 1156, 2607, 4626, 7201? -2n3 + 302n*2 - 21n + 6 What is the l'th term of 4514, 9029, 13544, 18059, 22574, 27089? 4515l - 1 What is the b'th term of 336, 619, 902? 283b + 53 What is the a'th term of -857, -922, -1017, -1136, -1273, -1422, -1577? a*3 - 21a*2 - 9a - 828 What is the j'th term of 11596, 23187, 34778, 46369? 11591j + 5 What is the n'th term of -120452, -240902, -361352? -120450n - 2 What is the s'th term of -1041, -1635, -2229, -2823, -3417, -4011? -594s - 447 What is the k'th term of -7940, -7971, -8000, -8027? k2 - 34k - 7907 What is the s'th term of 1021, 1009, 1011, 1033, 1081, 1161? s3 + s2 - 22s + 1041 What is the p'th term of 698, 2212, 4736, 8270, 12814, 18368, 24932? 505p*2 - p + 194 What is the w'th term of 428, 259, 90, -79, -248, -417? -169w + 597 What is the x'th term of 2647, 5396, 8147, 10900? x*2 + 2746x - 100 What is the l'th term of -115, -147, -179, -211? -32l - 83 What is the k'th term of -942630, -1885252, -2827872, -3770490? k2 - 942625k - 6 What is the l'th term of 1548, 3095, 4634, 6165, 7688? -4l2 + 1559l - 7 What is the l'th term of 1265, 1626, 2617, 4556, 7761, 12550, 19241, 28152? 53l3 - 3l*2 - l + 1216 What is the f'th term of 2363508, 4727016, 7090524, 9454032, 11817540? 2363508f What is the u'th term of -7776, -7298, -6820, -6342, -5864? 478u - 8254 What is the n'th term of -1013, -4014, -9007, -15986, -24945, -35878, -48779, -63642? n3 - 1002n*2 - 2n - 10 What is the j'th term of 435, 319, 125, -147? -39j2 + j + 473 What is the h'th term of -52, -169, -324, -535, -820, -1197, -1684? -3h3 - h2 - 93h + 45 What is the p'th term of 1016, 1638, 2258, 2876, 3492, 4106? -p2 + 625p + 392 What is the o'th term of 1224, 2206, 3172, 4116, 5032, 5914, 6756, 7552? -o*3 - 2o*2 + 995o + 232 What is the a'th term of -21291, -42423, -63553, -84681, -105807? a*2 - 21135a - 157 What is the k'th term of 301, 738, 1367, 2284, 3585? 16k3 + 325k - 40 What is the i'th term of -2840, -5675, -8514, -11357? -2i2 - 2829i - 9 What is the x'th term of 577, 1073, 1449, 1645, 1601, 1257, 553? -10x3 + 566x + 21 What is the v'th term of 16599, 16642, 16685, 16728? 43v + 16556 What is the m'th term of -685, -688, -679, -646, -577, -460, -283, -34? 2m*3 - 6m*2 + m - 682 What is the g'th term of 161, 629, 1409, 2501, 3905, 5621, 7649? 156g*2 + 5 What is the i'th term of 12, 230, 834, 2016, 3968, 6882, 10950, 16364? 32i3 + i2 - 9i - 12 What is the a'th term of 83765, 167538, 251311, 335084, 418857? 83773a - 8 What is the o'th term of -714, -1459, -2204, -2949, -3694, -4439? -745o + 31 What is the k'th term of -504, -904, -1304? -400k - 104 What is the b'th term of -5143, -5150, -5167, -5200, -5255, -5338, -5455, -5612? -b3 + b2 - 3b - 5140 What is the o'th term of 8094, 8091, 8088, 8085, 8082? -3o + 8097 What is the g'th term of 1169183, 2338365, 3507547, 4676729? 1169182g + 1 What is the k'th term of 16766, 16747, 16724, 16697? -2k*2 - 13k + 16781 What is the p'th term of -134, -233, -262, -185, 34, 431? 6p3 - p2 - 138p - 1 What is the a'th term of 59, 106, 155, 206, 259, 314? a*2 + 44a + 14 What is the v'th term of -69, -54, -35, -12, 15, 46? 2v2 + 9v - 80 What is the j'th term of -610, -1223, -1832, -2437, -3038, -3635? 2j2 - 619j + 7 What is the l'th term of -21, -14, 37, 156, 367, 694? 4l3 - 2l*2 - 15l - 8 What is the x'th term of 5636, 11206, 16776? 5570x + 66 What is the s'th term of -37022, -37023, -37026, -37031, -37038, -37047, -37058? -s2 + 2s - 37023 What is the y'th term of 140203, 140210, 140213, 140206, 140183, 140138, 140065, 139958? -y*3 + 4y*2 + 2y + 140198 What is the b'th term of -12, -17, -22? -5b - 7 What is the u'th term of 11296883, 11296880, 11296875, 11296868? -u2 + 11296884 What is the j'th term of -786, -1574, -2364, -3156, -3950, -4746? -j2 - 785j What is the j'th term of 186348, 186360, 186374, 186390? j*2 + 9j + 186338 What is the q'th term of -3649, -3874, -4099, -4324, -4549? -225q - 3424 What is the i'th term of -1991, -3976, -5961, -7946, -9931, -11916? -1985i - 6 What is the c'th term of -837, -3917, -9237, -16797, -26597, -38637, -52917? -1120c2 + 280c + 3 What is the w'th term of -8553, -8512, -8445, -8352, -8233, -8088? 13w2 + 2w - 8568 What is the v'th term of -1519, 0, 1519, 3038, 4557, 6076? 1519v - 3038 What is the y'th term of 1028, 2065, 3112, 4175, 5260, 6373? y3 - y2 + 1033y - 5 What is the z'th term of 1254, 1310, 1366, 1422? 56z + 1198 What is the a'th term of 3323, 6635, 9939, 13235? -4a*2 + 3324a + 3 What is the m'th term of -5369, -10762, -16179, -21632, -27133? -2m3 - 5379m + 12 What is the t'th term of -279, -2020, -6571, -15282, -29503? -225t3 - 55t2 - t + 2 What is the u'th term of 187, 566, 1203, 2104, 3275, 4722, 6451? u3 + 123u2 + 3u + 60 What is the s'th term of -56997, -56995, -56993, -56991, -56989? 2s - 56999 What is the p'th term of -2360, -2366, -2376, -2390? -2p2 - 2358 What is the b'th term of 5228, 5218, 5198, 5162, 5104, 5018, 4898? -b3 + b*2 - 6b + 5234 What is the m'th term of -36103, -36106, -36109? -3m - 36100 What is the o'th term of -54, -58, -16, 72, 206, 386, 612? 23o*2 - 73o - 4 What is the t'th term of 2840, 5685, 8530, 11375, 14220? 2845t - 5 What is the g'th term of 18838, 37675, 56524, 75391, 94282, 113203, 132160, 151159? g3 + 18830g + 7 What is the h'th term of -42296, -84587, -126876, -169163? h*2 - 42294h - 3 What is the u'th term of 81, 140, 185, 216? -7u2 + 80u + 8 What is the p'th term of -9950, -79529, -268354, -636047, -1242230, -2146525? -9937p3 - p2 - 17p + 5 What is the x'th term of 31210, 31196, 31182, 31168? -14x + 31224 What is the g'th term of -8837, -17675, -26513? -8838g + 1 What is the f'th term of -4500, -18062, -40670, -72324? -4523f2 + 7f + 16 What is the f'th term of 9506, 9444, 9382, 9320? -62f + 9568 What is the a'th term of 1476, 5862, 13180, 23436, 36636? a3 + 1460a*2 - a + 16 What is the i'th term of 170870, 341743, 512616, 683489? 170873i - 3 What is the g'th term of -1, -111, -103, 83, 507, 1229, 2309, 3807? 10g3 - g2 - 177g + 167 What is the s'th term of 711, 724, 735, 744, 751, 756? -s*2 + 16s + 696 What is the u'th term of 4459, 8922, 13397, 17890, 22407, 26954, 31537, 36162? u*3 + 4456u + 2 What is the i'th term of -239, -163, -87, -11, 65? 76i - 315 What is the j'th term of 102956, 103031, 103156, 103331, 103556, 103831? 25j*2 + 102931 What is the p'th term of -4249, -16991, -38227, -67957, -106181? -4247p*2 - p - 1 What is the a'th term of 271, 1808, 4605, 8662, 13979? 630a*2 - 353a - 6 What is the s'th term of 2743, 2742, 2733, 2710, 2667? -s*3 + 2s*2 + 2742 What is the o'th term of 1383, 2826, 4269, 5712? 1443o - 60 What is the n'th term of -326, -1278, -2852, -5048, -7866, -11306? -311n2 - 19n + 4 What is the r'th term of 54388, 54395, 54408, 54427, 54452? 3r2 - 2r + 54387 What is the l'th term of 1259, 1171, 1025, 821, 559, 239, -139? -29l*2 - l + 1289 What is the b'th term of -405, -1701, -3851, -6849,	{ "pile_set_name": "DM Mathematics" }
1 + r + 1 - 90r - 78r + 63r)(5 - 4 + 1 + (3 - 1 - 1)(-2 - 2 + 2) - 2 + 0 + 1). 102r Expand (103k3 - 158k*2 - 27k*2 - 101k*3 - 2k)(4 - 4 + 2k + (2 - 3k - 2)(-5 + 0 + 4)). 10k4 - 925k*3 - 10k*2 Expand (-2x3 + x3 + 8x3)(0x + 0x - 2x) + x4 - x4 - 3x*4. -17x*4 Expand (-1 + 0 - 7)(-22p2 + 19p*2 + 19p*2). -128p*2 Expand (6q + 13500 - 13500)(0 + 0 - 4)(-2 + 1 + 2). -24q Expand (6 + 3 - 5)(5p2 + 2p*2 - 6p*2 - 3 - 2p). 4p2 - 8p - 12 Expand -2 + 2 - 2g5 + (-g4 + 5g*3 - 5g*3)(-g - g + 4g) - 134g*2 + 8g*5 - 9g*3 + 134g*2. 4g*5 - 9g*3 Expand (-3 + 6 + 1)(-31l2 - 15l*3 + 31l*2). -60l*3 Expand (13 + 5 - 5 + 1 - 1 + 1 + (2 + 2 - 3)(2 - 3 + 0))((8k*2 - 30 + 30)(2k2 - 4k2 - k2) + k*4 - 2 + 2). -299k*4 Expand (-2s - 2 + 2)(-29 + 29 - 9s) - 4s2 + 4s*2 - 2s*2 + 2s*2 + 3s*2 - 6s*2. 15s*2 Expand (-2 + 2 + 2j)(6 - 6 + 2j)(9j - 6j + 6j). 36j3 Expand 24 - 24 + 2s + (4 - 4 - 1)(-3s + 4s - 2s) + s - 9s + s. -4s Expand (-1 + 5m + 4m - m)(m2 + 4m*3 - 6m*2 + 6m*2). 32m*4 + 4m3 - m2 Expand (-34 - 15 + 18)(-l + 0 + 0 + (-2 + 2 - 2)(-3l + 3l - l)). -31l Expand (c - 12 - 13 - 2c)(0 - 2 - 1)(1 + 9 - 1). 27c + 675 Expand (i - 2i + 2i)((-1 - 2 + 6)(2 + 3i - 2) + i - 2i + 3i)(56 - 34 + 2)(-1 - 2 + 1). -528i2 Expand (18j*3 - 25j*3 - 10j*3 - 2j*3 + 2j3 + j3 + j3 - j3 - j*3 + (2j + j*2 - 2j)(2j + 0 + 0) + 9j3 - 11j*3 + 10j*3)(3 + 1 - 5). 7j3 Expand (-2m + 3m + 0m)(25m - 47m + 31m). 9m2 Expand 14z*4 - 18z*4 + 11z*3 - 10z*3 + (-3z*2 + 3z*2 - 2z*2)(-z2 + z2 + 2z2). -8z4 + z3 Expand (-t - t + 0t)(-196t3 + 1503t*2 - 1503t*2). 392t*4 Expand -2w*5 - 12 + 12 + (3w - 5w + 0w)(84w*4 - 41w*4 + 55w - 41w4). -6w*5 - 110w2 Expand (r5 - 2r5 + 2r*5)(-3 + 0 + 0) + (3 + 2 - 1)(2r5 - r5 - 3r5). -11r*5 Expand (10 + 1 + 5n - 2n)(9n3 + 5n3 + n3)(-3 + 3 - 2). -90n*4 - 330n*3 Expand (a + 3a - 2a)(-2 - 7a + 2 + 5a - 2a - 4a + (-1 + 2 - 2)(a - 2 + 2)). -18a*2 Expand (-4g*3 + 7g3 + g3 - g)(-5g - 3g - 58g). -264g4 + 66g*2 Expand -4u + 31 - u - 31 + (-14 + 2 - 5)(3u + u - 3u). -22u Expand 186u3 - 10u*3 + 227u*3 + (2u2 + u2 - 4u2)(-1 - u + 1). 404u3 Expand (-m3 + 2m3 + m3)(3m + 5m - 5m)(-4m + 3m + 2m) + (-m*2 + 5m*2 - 3m*2)(31m3 + 31m*3 - 8m*3). 60m*5 Expand (-11 + 188 + 74)(3u - 2u + u). 502u Expand (0 + p + 0)(-2p3 + p3 - 483p*4 + 99 - 97). -483p5 - p4 + 2p Expand (-176 - 74z*3 + 176 - 2z*4)(-2 - 3z + 8z + z). -12z5 - 440z*4 + 148z*3 Expand (-g + 0g + 3g)(-6 + 0 + 0)(285 - 68 - 131). -1032g Expand -87 + 11t + 87 + (-t + 0t + 0t)(-3 - 1 + 8). 7t Expand 2w*3 + 0w3 - w3 + (-3w + 2 + 1 - 1)(12w2 - 18w*2 - 12w*2). 55w*3 - 36w*2 Expand 5g*2 + 4 - 4 + 6g2 - g2 - 3g2 + (-6 + 4 - 5)(-2g + 2g + 4g2). -21g*2 Expand (5z*3 + 3z*3 - 7z*3)(-37z2 + 67z*2 - 37z*2 + 1 - 2z*2 - 1 + (1 + 2z - 1)(6z - z - 3z)). -5z*5 Expand (-6 + 70 + 10)(2c3 + 4c*4 - 5c*4 - 3c*4). -296c*4 + 148c*3 Expand 0n*2 - 2n*2 + 4n*2 + (n + 0n - 3n)(-2n - 3 + 3) + (-4n - 11n + n)(2n + 0n + n) + 4n2 + 3n*2 - 5n*2. -34n*2 Expand (5i*2 + 12i + 47i5 - 3i*2 - 78i*5)(2 - 1 + 1). -62i5 + 4i*2 + 24i Expand (18 + 11 + 14)(-2q + 5q - 2q). 43q Expand (3 - 1 + 0)(-41 + 148 - 29n - 67). -58n + 80 Expand -f + 0f2 + 53 - 4f*2 - 55 + (2f + f - 2f)(0f - f + 4f). -f*2 - f - 2 Expand (-4s*2 + 4s2 - s2)(-36s*2 + 170s*2 + 67s - 68s). -134s4 + s3 Expand (-111z + 94z + 72z)(-z + 4z - 2z)(-5 + 2 + 1). -110z*2 Expand -3t5 - t3 + t*3 + (3t + 4t - t)(-3t4 + 7t*4 - 3t*2 - 3t*4). 3t*5 - 18t*3 Expand -3j*5 + 3j5 + j5 + (-j*5 + 3j*5 - 3j*5)(8 + 2 + 2). -11j5 Expand 5y + 1 - 3 + 3 + (26y + 43y - 2 + 2y)(-5 + 1 + 5). 76y - 1 Expand (5q + 3q3 - 5q)(3q - 4q + 3q) + 7q4 + q4 + 61q*4. 75q*4 Expand -27607p*2 + 0p*3 + 27542p2 + p3 + (-1 + 2p + 1)(0p2 + 0p*2 - 2p*2). -3p*3 - 65p*2 Expand (-3s - s*2 + 3s)(528s - 4 + 9s2 + 2 - 530s). -9s4 + 2s*3 + 2s2 Expand -v4 - 2v4 + v4 + (-52 + 160 - 56)(-v4 - v3 + v*3 + 2v*3). -54v*4 + 104v*3 Expand 14 + 22u*3 - 39 + 23 + (2u + u - 2u)(u*2 + u - u) + 2u*3 + 2u*3 - 2u*3. 25u*3 - 2 Expand (6w*3 - 3w*3 + 2w*3)(9w - 5w + 6w) + 10w*4 + 0w4 - w4. 59w4 Expand -2g4 - g4 + 2g4 + 6g*4 - 3g*4 - 2g*4 + (-2g*3 + 3g3 + g3)(-2g + g + 0g) + (2 - 3 + 2)(-2g4 - g4 + 4g4). -g4 Expand (5r2 - 4r*2 + 0r*2)((1 - 1 - r)(r + r - 4r) + 3r2 - 9 + 9). 5r*4 Expand (3s3 + s3 - s*3)(3s2 - 4s*2 + 3s*2) + 21s*4 + 32s*4 + 97s*5 + 2s*3 - 53s*4. 103s*5 + 2s*3 Expand (3 - 3 - 2d*4)(7 + 7 - 3)(-26d + 53 - 53). 572d5 Expand k + 2k - 6k - k + k + 2k + (-3 + 1 + 4)(-3k + 3k - 2k) + (60 - 85 + 70)(0k + 2k - 3k). -50k Expand (2 - 2 - 2u*3)(5 + 16 - 9) + (1 - 2 + 2)(-3u*3 + 4u*3 - 3u*3). -26u*3 Expand (196d*3 + 182d*3 + 320d*3 + 55d*3)(-2d2 + d2 - d2). -1506d*5 Expand (5 + 11 - 8)(73h + 53 - 53). 584h Expand (-76 + 37 + 42)(-6n + 2n + 3n)(4n*3 + 0n*3 + 4n*3). -24n*4 Expand (-1 + 1 + k)(2 + 0 - 1)(-6 - 12 - 46)(-1 + 1 - 2). 128k Expand (k - 2k*2 - k)(173 - 89 - 76 + 26k). -52k*3 - 16k*2 Expand 187 - 187 - 302z + (0z - 2z + 4z)(1 - 1 + 1). -300z Expand -r + r - 19r + 4r - 4r - 2r + (3 - 1 + 0)(-1 - r + 1). -23r Expand -o4 - o + o + (o3 - 2o*3 - 2o*3)(368o - 179o - 180o). -28o*4 Expand (-110 + 27x + 110)(2x - x - 2x)(x - x + x) - 6x + 6x + 6x3. -21x*3 Expand (0o - 5o + 0o)(-13 + 18 - 48) + (0 + 0 + 1)((-2 + 2 + 1)(4o - 3o - 3o) - o - o + 0o). 211o Expand w + 1 - 1 - w + 0w - w + 2w + 4 - 4 + (-2 + 2 + 1)(-3w + 3w - w) + 32w + 56w + 47w. 135w Expand (0k + k - 3k)(-4 + 31k + 36k*2 - 31k). -72k3 + 8k Expand 333m + 330m - 651m + m3 + (5m2 - m2 - 2m2)(m + 2m - 4m). -m*3 + 12m Expand (1 - 4 + 4)(2 + f - 2) + 3 - 2f - 3 + 2 - 2 - 7f + 0 - 3f + 0 + (-2f + 0f + 3f)(-2 + 6 - 2) - 1 + 1 + 3f. -6f Expand (-3y + 8y - 2y)(-3y3 + 0y*3 - 5y*3) - 2y*4 + 3y*4 + 0y*4. -23y4 Expand (p3 - p3 - p3)(p2 - 4p*2 + 2p*2) + 2p*4 - 2p4 + p5 + 3p5 + 5p*5 - 5p*5. 5p*5 Expand -29590i - 1417i3 + 29590i + (-2 + 2 + 2)(3i*2 + 2i*3 - 3i*2). -1413i*3 Expand (-56y + 56y + 66y*2)(-y*2 - 2y2 + y2 + (-2y + 5y - 2y)(y - 2 + 2)). -66y4 Expand ((4 - 5 - 2)(-3w - 1 + 1) + (4 + 0 - 5)(14w + w - 5w))(1 + 3 - 3). -w Expand (s - 2s*2 - s)(5s + 0s - 3s) + (-2s + 0 + 0 + (3s + 0s + 3s)(1 + 3 - 5))(0s*2 + 11s*2 - 6s*2). -44s*3 Expand 2f*5 + 4f - 4f + (-2 - f3 + 2)(f*2 + 0 + 0) - 11f*5 - 8f*5 - 7f*5 + (-3f + 2f + 0f)(-f3 + f3 + 2f*4). -27f*5 Expand (14 - 15 - 9)(-4v2 + 5v*2 + 4v*2)(0 + 0 - 2v2). 100v*4 Expand (0 - 6 - l + 3)(2l2 - 3l*2 + 4l*2 + (2l + 2l - 3l)(-3l + 0l - l))(1 - 1 - 2). -2l3 - 6l*2 Expand o - 2 + 2 + (-4 + 4 - 1)(37o + 8o + 35o). -79o Expand 2r3 + 2r*3 - 2r*3 + (4 - 3r - 4)(0 + 0 - 2r*2) - 12r*3 - 14r3 + r3 - r. -17r3 - r Expand (4h*2 + 6h - 6h)(-1 + 0 + 3)(1 + 0 + 1)(13h2 - 66 + 66). 208h4 Expand (a3 - 4a3 - 3a*3)(30 + 32a - 30) - 4a*4 - 4a*4 + 6a*4. -194a*4 Expand -3i*5 - 2 + 2 + (-2i*5 - 2i*5 + 3i*5)(3 - 5 + 3) + 11i5 + 3i - 3i + 4i*5 - 2i*5 + 0i*5. 9i*5 Expand (2i*2 + 4i - 4i)(3i + i - 5i)(152i*2 + 138i*2 - 114i*2). -352i*5 Expand (3x*3 - 4x*3 + 2x*3)(3x + 0x - 4x) + (0x2 - x2 + 0x2)(5x2 + 21 - 21) + (-x3 + 0x*3 + 2x*3)(-x + 3 - 3). -7x4 Expand (-3 + 0 + 8)(-f - 4 + 4)(-3 - 2 - 4) - f - 3f + 5f. 46f Expand (-4 + 4 - m)(-3 + 3 - 2) + 6m -	{ "pile_set_name": "DM Mathematics" }
vative of u(y) wrt y. -718 Let f(m) be the first derivative of -2m3 + 3m*2/2 + 92m - 36. Differentiate f(t) wrt t. -12t + 3 Let n(q) be the first derivative of 41q*5/5 + 24q*3 + 2. What is the third derivative of n(y) wrt y? 984y Find the third derivative of -24u6 + 23u*2 + 2u*6 - 66u*2 - 43u*2 wrt u. -2640u3 Let f(j) = -j2 - 5j - 2. Let q be f(-3). Suppose -2n = -qg + 16, 3n - 1 - 5 = g. Find the first derivative of 0 + 5 + 1 + gr2 wrt r. 12r Suppose -4p + 18 = 5r - 2p, r + 2p = 2. Suppose -r = i, -6i + 2i - 41 = -5q. Find the second derivative of 2o + 5o5 + 5o - 4oq + 3o*5 wrt o. 80o*3 Let f(b) be the second derivative of -151b*3/6 + 37b*2/2 - 4b - 2. Find the first derivative of f(a) wrt a. -151 Let f = 98 + -54. Find the first derivative of -25l - 25l - 6 + fl wrt l. -6 Let z(o) = -99o*2 + 46o - 3. Let i(x) = -x - 1. Let r(f) = 3i(f) - z(f). What is the second derivative of r(k) wrt k? 198 What is the first derivative of w2 + 3w - 78w - 141w - 773 - 25w + 40w wrt w? 2w - 201 What is the second derivative of -61z*4 - 57z*4 + 15z*5 - 52z*4 + 170z*4 - 134z wrt z? 300z3 Let c(t) = 139t*3 - 13t*2 - 11. Let y(j) = 46j*3 - 4j*2 - 3. Let a(o) = 2c(o) - 7y(o). Find the first derivative of a(d) wrt d. -132d*2 + 4d Let f(t) be the first derivative of -3t6/40 + 3t*4/4 + 14t*2 + 7. Let s(j) be the second derivative of f(j). What is the second derivative of s(l) wrt l? -54l Let r(t) be the third derivative of 23t6/120 + t5/60 - 11t4/24 - t3/3 - 2t2 - 3. Find the second derivative of r(l) wrt l. 138l + 2 Let m(u) be the second derivative of -31u4/6 - 150u*2 + 21u + 12. Differentiate m(t) wrt t. -124t Let c = 0 - -8. Suppose 0 = 6q - 2q - c. What is the third derivative of 2m*4 - 4m*4 + 3m*q - 2m*4 + 2m*2 wrt m? -96m Suppose -2w = -5w + 60. Find the third derivative of -2p3 - 47 + wp*3 + 47 + 8p*2 wrt p. 108 Let n(y) be the second derivative of -5y6/6 + y3/6 + 225y2/2 + 69y. What is the first derivative of n(b) wrt b? -100b3 + 1 Let a(m) = -m3 - m2 + 1. Let f(u) = 25u3 + u2 + 186u - 2. Let i(p) = -2a(p) - f(p). What is the third derivative of i(o) wrt o? -138 What is the first derivative of 57 - 7p + 3p*4 + 3p + 154 + 35 wrt p? 12p3 - 4 Let l(v) be the first derivative of v3/3 + 11v*2/2 + 8v + 18. Let r(z) be the first derivative of l(z). Find the first derivative of r(n) wrt n. 2 Let j be ((-6)/4)/((-6)/48). Let a = -6 + j. Find the third derivative of 147 - 147 - 4t4 - 2t*2 + at*2 wrt t. -96t Let j(t) be the second derivative of -t9/3024 - t6/45 - t*3/2 - 6t. Let x(g) be the second derivative of j(g). What is the third derivative of x(h) wrt h? -60h2 Let y(i) be the first derivative of 425i*6/6 + 14i*3 + 2i + 401. Find the third derivative of y(p) wrt p. 25500p2 Let g be 16/(-28) - (-36)/14. Find the third derivative of 17w2 + w3 - 11wg - 21w*2 wrt w. 6 What is the second derivative of -62y + 2 + 113y + 2y*5 + 2y*4 - 51y - 31y wrt y? 40y*3 + 24y*2 Let f be (-8)/12 - (-52)/6. Suppose 0v - f = -2v. Find the second derivative of 2j*4 - 32j + 37j - 7j*4 + 0j*v wrt j. -60j*2 Let n(c) be the second derivative of 537c*5/20 - 160c*3/3 + 650c. What is the second derivative of n(s) wrt s? 3222s Let x(q) be the third derivative of -q6/60 + 101q*5/60 + 30q*3 + 6q*2 - 4q. What is the first derivative of x(k) wrt k? -6k2 + 202k Let b(z) be the third derivative of -241z5/60 + 8z*3/3 + 194z*2 + 1. What is the derivative of b(o) wrt o? -482o Let o(c) be the second derivative of -3c5 - 45c*4/4 - 7c - 5. Find the third derivative of o(g) wrt g. -360 Let x(n) = -n*5 + 2n4 - n2 + 1. Let u(o) = -22o5 + 6o4 - o2 - 281o + 1. Let i(q) = -u(q) + x(q). What is the second derivative of i(h) wrt h? 420h*3 - 48h*2 Let f(d) = 29d + 2. Let q be f(1). Find the third derivative of -qb2 + 3b*5 - 209 + 209 wrt b. 180b2 Let r(y) be the second derivative of -y6/180 - y*5/20 - 5y*4/12 + 9y. Let n(k) be the third derivative of r(k). Differentiate n(h) with respect to h. -4 Let k(y) be the second derivative of 1/3y3 - 13/24y*4 - 6y*2 + 0 + 2y. Let i(a) be the first derivative of k(a). Differentiate i(g) wrt g. -13 Let c be ((-405)/(-36) + -9)/((-6)/(-8)). Let l(m) be the third derivative of -4m2 + 0m - 1/3m4 - 5/6m*c + 0. What is the derivative of l(x) wrt x? -8 What is the derivative of -2z*3 + 34z + 205 + 6z + 51 wrt z? -6z2 + 40 Let t(b) = b2 + 10b + 23. Let w be t(-7). Find the first derivative of -10 - 23l2 - lw + 29 + 0l2 wrt l. -48l Let b(r) = r4 - r3 + r + 1. Let g(i) = 15i4 + 3i*3 - 3i - 164. Let y(t) = -3b(t) - g(t). What is the derivative of y(q) wrt q? -72q*3 Let x(v) be the third derivative of 34v*2 + 0v + 0v4 + 0 + 0v*5 - 2/3v*3 - 7/40v*6. Differentiate x(k) with respect to k. -63k*2 Suppose 22 = 2y - 6. Let i be 4/y + (-80)/(-14). Find the third derivative of ij6 - j5 - 5j*2 + 0j5 + j5 wrt j. 720j3 Let w(h) = -15h - 128. Let j(y) = 6y + 64. Let q(v) = -10j(v) - 6w(v). Find the first derivative of q(n) wrt n. 30 Let j(g) be the second derivative of 4g6/15 - g3/3 + 301g2/2 + 119g. Differentiate j(r) with respect to r. 32r3 - 2 Let h = 21 + -17. What is the third derivative of 4d*h - 762 + 762 - 34d*2 + 8d*2 wrt d? 96d What is the second derivative of -18s3 - 13s + 67s + 9s*2 - 12s*2 wrt s? -108s - 6 Let h(f) be the third derivative of 0f3 - 1/20f*5 + 9f*2 + 11/120f*6 + 0f + 0 + 0f4. Find the third derivative of h(y) wrt y. 66 Let q(z) be the second derivative of -1/2z*4 - 6z + 5/3z3 + 0 + 0z*2. Find the second derivative of q(m) wrt m. -12 Let r = 10 + -6. Suppose 3l - 7 = -7x + 6x, -4l = -5x - 22. Differentiate -10h4 + 9 + 10h*4 - lh*r with respect to h. -12h*3 Let o = -22 + 24. Differentiate 2 + o + 0 + 6b + 4 wrt b. 6 Let a(u) be the third derivative of 23u7/105 - 20u3/3 - u2 + 4. Differentiate a(q) with respect to q. 184q3 Let n be 24/(-16) - (-10)/4. Let u be (n - (3 + 0))-2. Find the third derivative of -5zu - 163z*2 + 14z*4 + 153z*2 wrt z. 216z Suppose -s = -4s + 9. Suppose 0 = -0f - f - 5v + 7, 3f = 3v + s. Find the second derivative of 5n*3 + 9n - 2n + fn wrt n. 30n Suppose 4j - 2137 = 3l, -2j = -l - 1244 + 173. What is the derivative of 259 - 5c3 - j + 249 wrt c? -15c*2 Find the second derivative of -74y*2 - 6y*2 + 973y*5 + 553y - 971y5 wrt y. 40y*3 - 160 Find the second derivative of 175c + 324c - 100c*4 - 62c*4 wrt c. -1944c*2 Let t(a) be the first derivative of -239a3/3 + a2 + 137a - 383. Find the second derivative of t(o) wrt o. -478 Let v(j) = -2j5 + j3 + 1. Let z(b) = -2b5 - 2b*3 - 11b*2 + 34b - 4. Let u(q) = -2v(q) - z(q). Find the second derivative of u(p) wrt p. 120p*3 + 22 Let m be 144/546/4. Find the second derivative of 2hm + 4h*4 - 37h + 21h4 wrt h. 324h2 Let r(w) be the second derivative of w7/21 + 4w6/15 + 179w*3/6 - 97w. Find the second derivative of r(h) wrt h. 40h3 + 96h*2 Suppose 3w + 3m = 2m + 2, 0 = -3w + 5m - 10. Suppose 4k = 4x + 22 + 2, 4k + 2x = w. What is the first derivative of k - 4 + 0 - 3 - 4a4 wrt a? -16a*3 Find the third derivative of -274582y*3 - 159y*2 - 272y*4 + 274582y*3 wrt y. -6528y Let y be (28/49)/((-4)/(-14)). Suppose 11 - y = 3u. Find the third derivative of -3g*2 - ug*5 + 0g*2 - 3g*2 + 9g*5 wrt g. 360g2 Let h(w) be the second derivative of -w9/3024 + w*6/360 - 7w*4/6 + 9w. Let j(s) be the third derivative of h(s). Find the second derivative of j(t) wrt t. -60t2 Let o(l) = -l3 + 12l*2 - 3l - 7. Let x be o(6). What is the second derivative of 16r4 - 191r*3 + 19r + xr3 wrt r? 192r*2 Suppose 1 = -c - f + 6, -2c = f - 8. Let p(r) = r. Let d(g) = -11g + 2. Let b(o) = cd(o) + 24p(o). What is the derivative of b(y) wrt y? -9 Let q(y) = 152y*2 + 225y - 2. Let k(d) = -457d2 - 674d + 7. Let o(n) = -2*k(	{ "pile_set_name": "DM Mathematics" }
). 3k + 2 Let u(q) = q + 44 - 43 + 0q. Suppose 238 = f + 5y, -f = -5f + 2y + 930. Let r(o) = 11 + 11o + 233o2 - fo2 - o3. Give 2r(g) - 22u(g). -2g3 Let m(d) = 7d*3 + 2d*2 - 4d + 31. Let b(p) = 2p3 + p2 - p + 1. Calculate 2b(u) - m(u). -3u3 + 2u - 29 Let y(u) = 1729u - 19. Let c(l) = -576l + 7. Give 11c(g) + 4y(g). 580g + 1 Let w(f) = -70f - 4. Let a(n) = -47n - 3. Determine 7a(l) - 5w(l). 21l - 1 Let j = -1 + -2. Let p(y) be the third derivative of -y6/120 + y4/8 + 5y3/6 + 14y*2. Let i(d) = -2d*3 + 4d + 6. What is ji(m) + 4p(m)? 2m3 + 2 Let u(c) = 5c3 - c2 - 1. Let f(r) = 37r3 - 4r*2 - 11r - 4. Calculate -f(g) + 4u(g). -17g*3 + 11g Let o(r) = 430218 - 5r3 - 4r + 2r - 430218 + 7r*2. Let j(z) = 0z3 + z3 - z*2 + 0z*3. Give -4j(i) - o(i). i*3 - 3i*2 + 2i Let p(w) = -12w2 - 6w - 9. Suppose -k = 9k + 70. Let x(g) = 11g*2 + 5g + 8. Determine kx(s) - 6p(s). -5s2 + s - 2 Let q(w) = 0 - 2 - 301w + 300w + 1. Let a(p) = -7p - 5. Suppose 4l - 17 = -13. Give la(r) - 5q(r). -2r Let s(y) = 3y2 + 6y + 11. Let n = 13 - 4. Let l(w) = 16 - w*2 - 7 - 5 - 3w - n. Calculate 7l(h) + 3s(h). 2h2 - 3h - 2 Let o(u) = -291479u. Let y(j) = -445j. Determine -2o(i) + 1311y(i). -437i Let c(i) = i3 + i2 - i + 2. Let d(m) = 5m*3 - 4m*2 + 5m - 5. Determine -2c(g) - d(g). -7g*3 + 2g*2 - 3g + 1 Suppose 4r + 4 - 16 = 0. Let b(u) = -u + 32. Let j be b(-16). Let q be 20r4/j. Let p(t) = -2t - 1. Let x(o) = -2o - 2. Give qp(n) - 4x(n). -2n + 3 Let u = 350 + -349. Let d(m) = -m*3 - 2m*2 - 3m + 2. Let l(g) = g*3 + g - 1. Determine ud(f) + 2l(f). f3 - 2f*2 - f Let c = 334 + -329. Let u(w) = -9w*3 + 4w*2 + 5w - 4. Let t(x) = -10x3 + 5x*2 + 6x - 5. Determine cu(i) - 4t(i). -5i3 + i Let r(p) = 3p*3 + 5p*2 - 11p + 5. Let c(j) = -4j3 - 6j*2 + 12j - 6. Suppose 34 = 5d + 64. Give dr(o) - 5c(o). 2o*3 + 6o Let t(j) = -23j + 4. Let s(i) = 70i - 10. Calculate -3s(d) - 8t(d). -26d - 2 Let a(y) = -718y - 6. Let p(g) = 295814g + 2471. Give -2471a(h) - 6p(h). -706h Let g(c) = -3c + 9. Let v(k) = -2k + 5. Let z = 92 - 96. Calculate zg(w) + 7v(w). -2w - 1 Let t(v) be the first derivative of v4/4 - v3 - v2/2 + 4. Let k(s) = s3 - 2s*2 - 2s. Calculate 3k(y) - 2t(y). y*3 - 4y Let j(c) = -15c3 + 9c*2 + 28. Let l(d) = 8d*3 - 4d*2 - 14. Determine -2j(v) - 5l(v). -10v*3 + 2v*2 + 14 Let c(i) = 6 + 5i*2 + i - 3i + i. Let y(r) = -6r2 + 2r - 7. Let l(u) = u*3 + 81u*2 - 15u - 1211. Let z be l(-81). Determine zy(n) + 5c(n). n*2 + 3n + 2 Let m(h) = -h*3 + 2h - 35. Let j(u) = -5u3 + 10u - 176. Give -2j(x) + 11m(x). -x*3 + 2x - 33 Let s(y) = 210y3 + 5y*2 - 5y - 6. Let k(z) = 525z3 + 12z*2 - 12z - 15. What is -5k(p) + 12s(p)? -105p3 + 3 Let j(t) = -71t*3 - 3t*2. Let l(v) = -1276v*3 - 55v*2. What is 55j(d) - 3l(d)? -77d*3 Let r(l) = 4 + 3l*2 + 15580l + 4l2 - 15576l. Let s = 15 - 19. Let w(o) = 6o2 + 3o + 3. Determine sw(v) + 3r(v). -3v2 Let s(c) = 8c - 2. Let q(r) = -13r - 7. Let m(h) = -4h - 3. Let n(i) = 8m(i) - 3q(i). Give 3n(x) - 4s(x). -11x - 1 Let f = -29 - -26. Let g(v) = -v. Let u(n) = -n. Suppose 2b - 81 = -7. Suppose 0 = -5p - 7 + b. Calculate fg(h) + pu(h). -3h Let a(p) be the first derivative of -2p3/3 - p2/2 + 2p - 24. Let f(u) = u3 + u2 + u - 1. Suppose 243q + 2 = 244q. Determine qf(w) + a(w). 2w*3 + w Let a(h) = -16h*3 - 13h*2 - h - 7. Let b(q) = -7q*3 - 6q*2 - q - 3. Give -3a(d) + 7b(d). -d3 - 3d*2 - 4d Let i(q) = -q + 1. Suppose -4j - 51 + 22 = 5r, -r - 6 = j. Let n(u) = 35u - 30. Calculate jn(a) - 30i(a). -5a Let m(t) = -t + 1. Let k(o) be the third derivative of o5/60 - o4/12 + 2o3/3 + 2o*2. Let j be (-6)/(-8)(-20)/(-15). What is jk(f) - 4m(f)? f*2 + 2f Let a(r) = 16r3 + 12r*2 - 10r + 8. Let n(s) = s3 + s2 - s + 1. Calculate a(i) - 12n(i). 4i*3 + 2i - 4 Let d be -3 + -2 + (-7 - -2 - -5). Let k(q) = q*2 - 4q - 5. Let m(z) = -2z - 2. What is dm(g) + 2k(g)? 2g*2 + 2g Let t(q) = -444q - 430q + 866q - 65q*2. Let s(l) = 22l*2 + 3l. Give 8s(u) + 3t(u). -19u2 Suppose 5m - 4r + 15 = -0r, -3r = 3m + 9. Let v(n) = -n*3 + 3n*2 - 3n + 3. Let k(u) = u*3 - 4u*2 + 4u - 3. What is mk(a) - 4v(a)? a*3 - 3 Let o(t) = 14t + 12. Let r(h) = 19h + 18. Give 8o(u) - 5r(u). 17u + 6 Let v(x) = 206x + 7. Let z(a) = 137a + 4. Calculate -5v(h) + 8z(h). 66h - 3 Let u(g) = -5g*3 + 4g + 4. Let r(m) be the first derivative of 3m4/2 - 5m*2/2 - 5m + 75. Let n be 22/4 - 6/4. Determine nr(v) + 5u(v). -v*3 Let o(t) = 3t - 70. Let k(j) = 8j - 139. Give -2k(c) + 5o(c). -c - 72 Let f(j) = 7j. Let u(o) = 10o - 1. Give 2f(q) - u(q). 4q + 1 Let o(r) = -r - 1. Let p(k) be the third derivative of k3 + 0 + 0k + 3k2 + 1/8k*4. Calculate 4o(w) + p(w). -w + 2 Let p(v) = -v*2 - v. Let a(k) = 3k*3 - 2k*2 - 3k. Let b = -44 - -46. Suppose 6x + 8 = b. Calculate xa(s) + 3p(s). -3s3 - s2 Let v(j) = -8j3 + 3j*2 + 3j. Let i(k) be the second derivative of 7k5/20 - k4/6 - k3/3 + 9k. What is 3i(r) + 2v(r)? 5r3 Let b(z) = -375z*3 - 5z*2 + 5z. Let y(v) = -5811v3 - 78v*2 + 78v. What is -78b(l) + 5y(l)? 195l3 Let g(w) = -9w*3 + 8w2 + 3. Let l(y) = -y3 + y*2 + 1. Give g(c) - 3l(c). -6c3 + 5c2 Let n(g) = g3 - 1. Let p(c) be the first derivative of -3c4/4 - c3 + 2c - 201. What is -2n(t) - p(t)? t3 + 3t*2 Let a(i) = -3 - 2 + 2 - 1 - 3i. Let b(r) = 4r + 6. Let o be (28/6)/(7 - (-285)/(-45)). What is oa(n) + 5b(n)? -n + 2 Let s(w) = -160w*3 - 16w*2 - 14w + 51. Let b(h) = -54h3 - 5h*2 - 5h + 18. Give -17b(a) + 6s(a). -42a3 - 11a2 + a Let m(a) = -1. Let z(t) = t2 + 2t - 7. What is m(u) - z(u)? -u2 - 2u + 6 Let u(j) = 1. Suppose 4 = 2t - 2. Let w(i) = 2 + 0 + 0 + t - 4i. Determine -5u(c) + w(c). -4c Let o(a) = -13a2 + 3a - 3. Let c(p) = 13p2 - 4p + 4. Suppose j = -4u + 4, 5u + 0 = -j + 6. What is jo(m) - 3c(m)? 13m2 Let z = 37 + -35. Let y(l) = l - 3 + l - l + 2l + 2lz. Let n(t) = t - 1. What is -2n(i) + y(i)? 2i2 + i - 1 Let d(y) = 4 + 4y - 24y + 26y. Let n(k) = -k - 1. Calculate -2d(f) - 10n(f). -2f + 2 Let u(d) = -2d*2 + 15d - 6. Let b(k) = k*2 - 13k + 5. What is 3b(s) + 2u(s)? -s*2 - 9s + 3 Let o(z) = -z*2 + 48z + 3019. Let p be o(84). Let j(f) = 3f2 + 3f - 7. Suppose -3w - 3 = -4w. Let y(m) = 2m2 + 2m - 4. What is py(g) + wj(g)? -g*2 - g - 1 Let c(p) = 3p*3 + 4p - 2. Let s(q) = 16q3 + 21q - 11. Let t(u) = 23u2 + 133u - 8. Let k be t(-6). What is kc(v) - 4s(v)? 2v3 + 4v Let y(j) = -3j3 - 4j - 2. Let n be (-2)/(((-12)/(-10))/(87/145)). Let s(h) = h. What is ny(d) - 5s(d)? 3d3 - d + 2 Let w(s) = 0 - 2s - 7 + 4s + 5 + 2s. Let v(a) = 3a - 3. What is 2v(t) - 3w(t)? -6t Let d(o) = -43o - 35. Let i(x) = -x + 9. Calculate d(m) + 4i(m). -47m + 1 Let h(n) = n. Let g(c) = -23c. What is -6g(o) + 30h(o)? 168o Let s(u) = 57u*3 - 3u - 8. Let p(v) = 57v3 - 4v - 12. Determine 2p(w) - 3s(w). -57w3 + w Let c(g) = -3g*2 - 108g - 4. Let o(z) = -z*2 + z - 1. Determine -c(f) + 6o(f). -3f2 + 114f - 2 Let y(x) = 3x2 + 5. Suppose -3h - 35 = 5p, 3h = -p + 8h - 7. Let u(g) = 1 + 4g*2 - 2 + 8 + 0. Give py(b) + 5u(b). -b2 Let f(w) = 6w*2. Suppose 20 = 3u + 14. Suppose 0 = j + 3b + 4, uj - 2b = 3j + 1. Let h(t) = 3 + 0t2 + jt*2 - 3. Calculate -4f(a) + 5h(a). a2 Let n(h) = 97831h*2 + 1083h + 3249. Let m(u) = -361u2 - 4u - 12. What is 1083m(r) + 4n(r)? 361r2 Let o(p) = 7p - 1. Let v(a) = -4a + 2. Give 4o(k) + 3v(k). 16k + 2 Let m(w) = -21w3 + 6w*2 - 116w - 11. Let y(s) = -4s3 + s2 - 23s - 2. Determine 2m(r) - 11y(r). 2r3 + r2 + 21r Let a(q) be the second derivative of -q5/10 - q4/2 + 4q3/3 + 2q*2 + 53q. Let k = -1 + 5. Let w(d) = -3d3 - 7d*2 + 9d + 5. Give kw(m) - 5a(m). -2m3 + 2m*2 - 4m Let t(h) = 4h2 + 118h - 2. Let d(w) = w**2. Cal	{ "pile_set_name": "DM Mathematics" }
of -450259u3v - 2110940u3 - 2uv4 wrt v? -450259u*3 - 8uv3 Find the third derivative of -2369a*3j*3p*3 + 8a*3j*3p*2 - 3a*3j*2p - 2a3jp2 - 12a*3p*3 - 2a*2j*3 + 19j*2p wrt p. -14214a3j*3 - 72a*3 Find the second derivative of -jl*4 - 2566jl3 - 37005jl - 2l wrt l. -12jl*2 - 15396jl Find the second derivative of -12b*5 + 159b*4 - 2b*2 - 73401b. -240b3 + 1908b*2 - 4 What is the third derivative of 8892pw4 - 3pw3 + 85pw2 - pw + 2w2 - 5w wrt w? 213408pw - 18p Find the third derivative of -2539465r*3 + 3r*2 - 3r + 890 wrt r. -15236790 Find the second derivative of 1285it*3 + 4it - 8i + 17t3 + 2t - 208 wrt t. 7710it + 102t What is the third derivative of -2d*4n + 3d3n*2 - 4521d*3n - 24d2n + 401n2 wrt d? -48dn + 18n*2 - 27126n Differentiate -4g2x + 94g2 + 5329gx - 14g - 25 with respect to x. -4g2 + 5329g What is the second derivative of 10424a3 - 73a*2 - 33569a + 2 wrt a? 62544a - 146 What is the third derivative of -181287f*3 - 3133f*2 + 65? -1087722 Find the second derivative of 8a*5 - 9184a*4 - 2a*2 + 18a + 8883. 160a3 - 110208a*2 - 4 Differentiate -225gh2 + 60gh - 4g - 19680h2 + 3h wrt g. -225h2 + 60h - 4 What is the second derivative of 3121d3sw + 11d*3s - 9d2w - 394dsw + ds + 2d + 356sw + 3w wrt d? 18726dsw + 66ds - 18w Find the third derivative of 164153q3 + 2751495q*2. 984918 Differentiate -5g*3 + 1592g + 58308. -15g2 + 1592 What is the derivative of 13575a*2 + 300049 wrt a? 27150a Differentiate -27984j4y - 3j2y*2 - 32935y*2 - y wrt j. -111936j*3y - 6jy*2 What is the second derivative of -24n*2x3 + n2x2 + 219n*2x + 3nx*3 + 19nx + 94x*3 - 2 wrt n? -48x*3 + 2x*2 + 438x What is the third derivative of 20r6 + 219r*4 - 13r*2 - 12r - 16 wrt r? 2400r3 + 5256r What is the third derivative of 52583u3 + 41949u*2 wrt u? 315498 Find the third derivative of -8212ch3 - 2ch2 + 35ch - 45h*2 wrt h. -49272c What is the third derivative of 29525d6 - 9d*5 + 4d*3 - 99d*2 - 5179 wrt d? 3543000d*3 - 540d*2 + 24 What is the third derivative of 340917x*3 + 226x*2 - 2x - 117? 2045502 Find the third derivative of -3n5 - 13411n*3 - 4n*2 - 447 wrt n. -180n*2 - 80466 What is the third derivative of -3b*5g - 983b4g + 2b2g + 903b2 + bg wrt b? -180b2g - 23592bg What is the second derivative of 319174v3 + 2v*2 - 512793v? 1915044v + 4 What is the derivative of -44967d - 35848? -44967 What is the third derivative of 342219g3 + 349264g*2? 2053314 Differentiate -76028n*2 + 9959. -152056n Find the third derivative of 9gs*4 + 2663gs3 + 2gs2 + 2gs - 3g + 757s2 wrt s. 216gs + 15978g What is the first derivative of -2k2p*2 - 2k*2p + 161861k2 - kp + 447p2 wrt p? -4k*2p - 2k2 - k + 894p What is the third derivative of -227574q5 - 9143q*2 + 5q? -13654440q2 Find the third derivative of -1441930d*2k*3 - 2d*2 + dk*6 + 544dk2 - 3d + 67 wrt k. -8651580d2 + 120dk3 What is the second derivative of 5z*5 + 42z*3 + 2z*2 - 2z + 3322 wrt z? 100z3 + 252z + 4 Find the first derivative of 2o2v*3 + 166o*2 + ouv - 235ou - 12uv - 122v*3 - 386v*2 wrt o. 4ov3 + 332o + uv - 235u Find the first derivative of 95927bc - 3b + 48228 wrt c. 95927b What is the derivative of -19d4 - 11d*3 - 2815d - 318830 wrt d? -76d3 - 33d*2 - 2815 Find the third derivative of -25m*4 + 1212m*3 + 66m*2 + 9m + 5 wrt m. -600m + 7272 Find the second derivative of -95c*3 - 1931c*2 + 2069c - 6 wrt c. -570c - 3862 Find the third derivative of 3759937h*4 + 35h*2 + 4h - 785 wrt h. 90238488h What is the third derivative of 2i*4t + 1332i4 + 67i*3t*2 - 14063i*2t*2 + 25i*2 wrt i? 48it + 31968i + 402t2 Find the second derivative of -99x*5 + 3252x*2 + 2634648x wrt x. -1980x3 + 6504 Find the first derivative of -2dm - 380189d - 4351m2 + 89m wrt m. -2d - 8702m + 89 What is the second derivative of 229a4o - 364a2mo + 37amo + 34a + 8o wrt a? 2748a2o - 728mo Find the second derivative of 101558c2n3 + c2n2 - 3c*2n - 35c2 + cn*3 + 10cn + 5n - 2 wrt n. 609348c2n + 2c2 + 6cn What is the first derivative of 5052203r*4 - 1090853 wrt r? 20208812r*3 What is the first derivative of -1289783a - 1210311? -1289783 What is the third derivative of 4f6 - 4f*4 - 494f*3 - 2f*2 - 27063? 480f*3 - 96f - 2964 What is the third derivative of 1173039h3 + 11h*2 - 17999h wrt h? 7038234 Find the second derivative of 111459i2j*2 + 27365i*2 - 2ij wrt j. 222918i*2 Differentiate 359t*4 - 27t3 + t2 + 3t - 1731618. 1436t*3 - 81t*2 + 2t + 3 Differentiate -247x3 - 2294xz - 3331715z with respect to x. -741x2 - 2294z Find the second derivative of 31g5 + 9603g*2 - 152g + 3058. 620g3 + 19206 What is the third derivative of 2g*4 - 1608169g*3 + 853760g*2? 48g - 9649014 Differentiate in2 + 112878in + i + 24212 with respect to n. 2in + 112878i What is the second derivative of -27504t5 + 7t*3 + 8t - 2506? -550080t3 + 42t What is the second derivative of -7281v5 + 8v*3 + 1334856v? -145620v3 + 48v Find the second derivative of 25g3t*2 - 3g*3t - 74g2t*2 + 2gt2 - 20231g + 2t2 + 2 wrt g. 150gt2 - 18gt - 148t*2 What is the derivative of 15a*2j - 6a2 - 5242aj - 65a - j + 139 wrt j? 15a2 - 5242a - 1 What is the second derivative of 585758u4 + 674437u? 7029096u2 Find the third derivative of -148h*5 + 1080h*3 + 446h*2 - 2h + 12. -8880h2 + 6480 Find the third derivative of c4u + 378c4 + c3u - 6c3 - 22c*2u - 32c2 + 16c wrt c. 24cu + 9072c + 6u - 36 What is the first derivative of -2c4 + 4c*3 - 3333c*2 + 272427 wrt c? -8c*3 + 12c*2 - 6666c Find the third derivative of 775898i4 + i3 - 546i*2 + i + 80. 18621552i + 6 Find the second derivative of 46n4 - 58n*3 - 61n*2 + 2062606n wrt n. 552n2 - 348n - 122 What is the second derivative of 2dg*3 - 74dg2 + 3dg - d + g3 - 214g*2 + 17649g wrt g? 12dg - 148d + 6g - 428 Differentiate -56748d3 - 44216 with respect to d. -170244d*2 Differentiate 48112n*2 + 30015 with respect to n. 96224n What is the third derivative of 14744q6z*3 + 15q*2z*2 + 128z*3 wrt q? 1769280q*3z*3 Find the third derivative of -3427i*3pv3 - i3v*2 - 21i*2pv3 + 3i*2pv2 - 4345i*2v*2 - 2ip wrt v. -20562i*3p - 126i2p Find the third derivative of 24941h3 - 39232h*2 wrt h. 149646 What is the third derivative of 97945m*5 + 4m*3 - 4m*2 + 84958m? 5876700m2 + 24 What is the third derivative of 94748d*4 + 5d*2 + 562? 2273952d Find the first derivative of -3159h2 - 37h + 186615. -6318h - 37 Find the second derivative of 163280i*2q*2 - 66i*2q - 5iq + 118i wrt q. 326560i*2 Find the third derivative of 84549t*3z*3 - 11t*2 - 1744tz3 wrt t. 507294z*3 Find the second derivative of 56805s*3v*2 - 26s - 57v2 - v wrt s. 340830sv2 What is the second derivative of -169a*3 + 1499a*2 + 184605a - 1? -1014a + 2998 What is the first derivative of 10d*2v*2 - 38d*2v + 161048v2 wrt d? 20dv2 - 76dv Differentiate -741780n*4 + 205659 wrt n. -2967120n*3 Find the first derivative of 132a*3n + 1970an + 1234066n wrt a. 396a*2n + 1970n Find the second derivative of -25519u*5 - 124u + 42. -510380u3 What is the first derivative of j3u*2 - 66j3 - j2 + 1253ju*2 + 31j + 5u2 wrt u? 2j*3u + 2506ju + 10u What is the second derivative of -o5 + 3o*4 - 12734o*3 - 53826o + 7? -20o3 + 36o*2 - 76404o What is the second derivative of -djl*2 + 7djl + 5dj + dl2 - 24081jl2 - 3l*2 + 1067l wrt l? -2dj + 2d - 48162j - 6 Find the second derivative of 123087r3 + 124r - 70 wrt r. 738522r Differentiate -67313cl*3 - 2217	{ "pile_set_name": "DM Mathematics" }
152336c3 Collect the terms in 4882v*2 - 2v - 4207v2 + 10810v*2. 11485v*2 - 2v Collect the terms in -14342c - 696c3 - c2 + 697c3 + c2. c3 - 14342c Collect the terms in -7 - 5205s - 5216s + 15672s - 5219s. 32s - 7 Collect the terms in -2956y*3 + 1063y*3 + 1097y*3 + 797y3. y3 Collect the terms in -4 + 2 + 2 + 67f3 - 1018f*3 + 6. -951f*3 + 6 Collect the terms in 9216 - 18430 - 57s + 9216 - 230s. -287s + 2 Collect the terms in -42225912n2 - 317n*3 + 42225912n*2. -317n*3 Collect the terms in 8 - 4679c + 7 + 11 - 430c - 43. -5109c - 17 Collect the terms in -14446q + 28728q - 14421q. -139q Collect the terms in 51362 - 352s - 2s*2 + 352s. -2s2 + 51362 Collect the terms in -468373 - i2 + 234162 + 234211. -i2 Collect the terms in 152134q - 4998 - 76066q - 76066q. 2q - 4998 Collect the terms in -213 - 217 + 126 + 175248363a - 563 - 175248366a. -3a - 867 Collect the terms in -1413n2 - 1327n*2 + 4264n*2 + 49n*3 - 1418n*2. 49n*3 + 106n*2 Collect the terms in 31831 + 31835 - 63677 + 943u - 952u. -9u - 11 Collect the terms in -1896c3 - 8c*2 - 152c*2 + 161c*2. -1896c3 + c2 Collect the terms in -k + 17371k2 - k - 7854k*2 + 5k - 3k. 9517k*2 Collect the terms in 12t*2 + 36t*2 + 440 - 215 - 211 + 31t*2. 79t*2 + 14 Collect the terms in -4787q + 4787q - 470156q*3. -470156q*3 Collect the terms in -249v*2 - 308v*2 + 304v*2 - 338v*2 - 345v*2. -936v*2 Collect the terms in -88567o + 271338o - 7o*2 - 91386o - 91385o. -7o*2 Collect the terms in 28810t - 9475t - 9658t - 9657t - 1 + 3. 20t + 2 Collect the terms in -3 + 3 + 1087465854y - 1087465850y. 4y Collect the terms in 22915 - k - 11462 - 11453 + 13k*2 + k. 13k*2 Collect the terms in 1041u - 910u + 9u*2 - 131u. 9u2 Collect the terms in 2f + 2514f3 + 3244f*3 + 155f*3 + 8819f*3. 14732f*3 + 2f Collect the terms in o*3 - 1079659o + 539780o + 539879o. o*3 Collect the terms in 1566t*2 + 1563t*2 + 1588t*2 - 6262t*2 + 1572t*2. 27t*2 Collect the terms in -1298970u + 1298970u - 430 + 3u*3 - 2u*2 + 2u*2 + 430. 3u*3 Collect the terms in 581v*3 + 455v*3 + 427v*3 - 1728v*3. -265v*3 Collect the terms in -1035r*2 + 926r - 502r - 424r. -1035r2 Collect the terms in 2458i*3 + 76 - 2457i*3 - 77 + 737i2. i3 + 737i2 - 1 Collect the terms in -6118y*2 + 2298y*2 + 2290y*2 + 1534y*2 - 12. 4y*2 - 12 Collect the terms in 924k*2 + 1114k*2 + 480k*2 - 2539k*2. -21k*2 Collect the terms in 24h*3 - 1001h + 502h - 2h*2 + 499h + 5h2. 24h*3 + 3h*2 Collect the terms in 11g - 23g2 - 5g + 0g - 7g*2 - 8g - 6g. -30g*2 - 8g Collect the terms in -35747 - 8s2 + 447s + 35745 + 3s2. -5s*2 + 447s - 2 Collect the terms in 138801z3 + 85314z*3 - 13834z*3 + 114308z*3. 324589z*3 Collect the terms in 201o + 195o + 203o + 211o + 203o - 1015o. -2o Collect the terms in -14p2 + 423p + 3207p + 344p + 48p2 + 93p. 34p2 + 4067p Collect the terms in 1853 - 7344 + 1841 + 195y2 + 1851 + 1799. 195y*2 Collect the terms in 178326 - 4p*3 + 184p*2 + 3p3 - 178326 - p2. -p*3 + 183p*2 Collect the terms in -21b2 + b2 - 22b2 - 17b*2 - 29b*2 + 72b*2. -16b*2 Collect the terms in -43653653 + 43653653 + 482u*3. 482u*3 Collect the terms in 5408r - 7411r3 - 10812r + 5404r. -7411r*3 Collect the terms in -2o2 + o2 - 4494059755122 + 4494059755122. -o*2 Collect the terms in -1 - 11126h - 26h2 + 9h*2 - 20h*2. -37h*2 - 11126h - 1 Collect the terms in -91280797d - 4 + 91280135d + 4. -662d Collect the terms in 8 + 37052z + 14 + 13 - 1 - 37057z. -5z + 34 Collect the terms in 4 - 4 + 2739d3 - 2730d*3 + 90d*2 - 9d*2 - 81d*2. 9d*3 Collect the terms in -1161h + 7 + 20 - 25. -1161h + 2 Collect the terms in -21167x + 21137x - 2x*2 - 8 + 13. -2x*2 - 30x + 5 Collect the terms in -27v2 - 85v*3 - 11v*2 - 629v*3 + 1 - 34v*2 - 73v*2. -714v*3 - 145v*2 + 1 Collect the terms in 2824669752 - 2824669752 + 979p*3. 979p*3 Collect the terms in 366 - 710 + 344 - 1369n*3. -1369n*3 Collect the terms in -10 - 11345x - 28 + 125 - 87. -11345x Collect the terms in 543j*2 - 575j*2 - 41j - 850j2 - 1863j*2 + 45j. -2745j2 + 4j Collect the terms in -66x - 16242 + 3490x*2 + 66x + 16242. 3490x2 Collect the terms in 262v + 1124v + 239v - 1488 + 101v. 1726v - 1488 Collect the terms in 30b3 + 264b*3 + 265386b - 265386b. 294b*3 Collect the terms in -32p*3 - 17 - 441911442p + 441911442p. -32p*3 - 17 Collect the terms in -57o*2 - o - 6o + o + 5o + 770. -57o*2 - o + 770 Collect the terms in -41z*3 - 30z*2 + 62z*2 + 83z*3 - 46z*3 + 49z*2. -4z*3 + 81z*2 Collect the terms in 156a*2 - 5a + 208a2 + 12a - 7a. 364a*2 Collect the terms in -293g*2 + 7 - 7 + 212g*2 - 923g*2. -1004g*2 Collect the terms in -138m + 424m - 297m - 234m - 519m - 785m. -1549m Collect the terms in 2998 - 1002 - 67b3 - 1008 + 71b*3 - 1000. 4b3 - 12 Collect the terms in r3 + 276887340 - 553774682 + 276887342. r*3 Collect the terms in -50088s*2 - 618s*2 - 50208s*2. -100914s*2 Collect the terms in 2073 - 41d + 2119 + 36d - 4192. -5d Collect the terms in 101 + 96 + 126 + 7m2 - 427 + 104. 7m*2 Collect the terms in -162a - 3 - 163a - 171a + 854a - 166a - 164a. 28a - 3 Collect the terms in f + 82431190 - 82431190. f Collect the terms in -32q + 9654q*2 - 42333q*2 + 30q. -32679q2 - 2q Collect the terms in -550j + 765j - 186j. 29j Collect the terms in 0a + 3a - 3a - 805528a*3. -805528a*3 Collect the terms in -19250 + 9543 + 9702 + 7w. 7w - 5 Collect the terms in 1190124 - 1190124 - 61624g. -61624g Collect the terms in -145s*2 + 21 + 479s*2 - 151s*2 - 136s*2 - 21. 47s*2 Collect the terms in 56h - 386 - 304 + 691. 56h + 1 Collect the terms in 17t - 16t - 2982t*2 - 1279t*2 - t. -4261t*2 Collect the terms in 28913984150z*3 - 14456992071z*3 - 14456992078z3. z3 Collect the terms in -1368 + 687 - 6a3 + 194a + 681 - 200a. -6a*3 - 6a Collect the terms in k2 - k2 - 37k3 + 27 - 87k*3 + 45k*3. -79k*3 + 27 Collect the terms in 23v*3 + 0v*3 - 56v*3 + 5v*3 + 90v*3 - 8v*3. 54v*3 Collect the terms in -6060h + 3057h + 4 + 8h*2 + 3003h. 8h2 + 4 Collect the terms in 9a*2 - 3a*2 + 5a*2 + 95a*2 - 118a2 + a2. -11a2 Collect the terms in -19 + 49 - 14 - 34 - 18 - a. -a - 36 Collect the terms in 537 - 537 - 335671y*3. -335671y*3 Collect the terms in 53174 - 159520 + 53175 + 53171 + 3k. 3k Collect the terms in 43t + 914t2 + 182t*2 + 601t*2 - 83t + 45t. 1697t*2 + 5t Collect the terms in -7y - 14y + 28y - 9y + 10952 - 3195. -2y + 7757 Collect the terms in -8 - j2 + 104j - 6 - 12 + 27 - 25. -j*2 + 104j - 24 Collect the terms in -28150 - 28106 + 56256 - 5s3 + 9s*2. -5s*3 + 9s*2 Collect the terms in 4t*2 - 8149072t - 8149044t + 16298116t. 4t2 Collect the terms in -9 + 6 - 484j + 1208j + 1074j. 1798j - 3 Collect the terms in -38136w*2 - 38058w*2 + 76324w*2. 130w*2 Collect the terms in 52 - 125 + 1447o - 75. 1447o - 148 Collect the terms in 94 + 41t + 47 - 141 - 98t. -57t Collect the terms in -9l2 - 162 - l3 - 41 - 119 + 0l3. -l3 - 9l2 - 322 Collect the terms in 61740y*3 - 81676y*3 + 19933y*3. -3y*3 Collect the terms in 7915d*2 - 24356d*2 + 7911d*2 - 3d + 8532d2 + 3d. 2d2 Collect the terms in -9p*2 - 27 - 4p*2 + 20p + 23p - 42p. -13p2 + p - 27 Collect the terms in 1300t + 5t2 + 1245t - 5158t + 1299t + 1314t. 5t*2 Collect the terms in -1469s - 767s + 2256s. 20s Collect the terms in -l + 1046 + 1017 - 2064. -l - 1 Collect the terms in 35u*2 + 45u*2 - 3u*2 + 2u - 2u + 10u*2. 87u*2 Collect the terms in -8 - 2 - 9w - 13w - 4w + 29w. 3w - 10 Collect the terms in 46 + 0 - 4 - 32 + 61x - 11 - 3x. 58x - 1 Collect the terms in -4l*2 + 63 - 42 + 0l + 304l + 79. -4l*2 + 304l + 100 Collect the terms in -9569*	{ "pile_set_name": "DM Mathematics" }
x be 4/z(1 - 7). Solve -pk - x = -2a - 2a, 0 = 4a - 2k + 2 for a. -2 Let p(a) = a*3 - 23a*2 - a + 27. Let f be p(23). Solve -4n + 2j - 4j - 20 = 0, -j - 16 = fn for n. -3 Let l(r) = -r2. Let x be l(-2). Let v = 5 + x. Let f be (-1 - 1 - -18)/v. Solve 4b = -4t + f, 2t - 3b + 4 = b for t. 2 Let y(a) = a3 + 2a2 + 2. Let v(n) = -n2 - 3n - 3. Let w be v(-2). Let h = w + -1. Let j be y(h). Solve 0 = 3i - 8i + 5g + 10, -6 = jg for i. -1 Suppose 4t - 5 = 3t. Solve 20 = tq, 2l + 3q - 11 = 9 for l. 4 Suppose 5m - 5 = -j - 1, -4m + 20 = -2j. Let t be (-2)/j - 2/6. Suppose -a + 3u - 3 = 0, -u - u + 4 = t. Solve b + b - ai = -17, -3b = i - 2 for b. -1 Let d be -4 - 43/(-4) - 2/(-8). Solve -q - d = 2l, -l = 5 - 3 for q. -3 Suppose 3h - 5 = 10. Solve 0 = -4n - 3g + h, -n = g - 4g + 10 for n. -1 Suppose -3k + 7k = -40. Let t = k + 18. Solve -5f - 15 = -4r + 16, 0 = -2r + t for f. -3 Suppose -4h + 13 = -0h + 3i, 2i = -10. Suppose -13 - h = -4j. Solve 4 = -2v - 6, 0 = 5r + 2v - j for r. 3 Let p be ((-3)/(-9)0)/1. Let g be 0 - -1 - -31. Suppose 32 = gu - 28. Solve -s - u + 5 = -y, p = -s - y for s. -5 Suppose 2 = 4a + 6. Let x be ((-8)/(-6))/(a/3). Let u be (-3)/1 + 10 + x. Solve -b + g = u, -3g + 4 = -5b - 3 for b. 1 Let a(d) = -d*2 + 5d - 7. Let r be a(5). Let s = r - -3. Let f be (-665)/(-45) - s/18. Solve -5p + 0p = -2q + 17, 0 = 3p + f for q. -4 Let a = -14 - -18. Solve -g = -aq + 7, -2q + 1 = -g - 0 for g. 5 Suppose 7 - 13 = -2b. Solve m + 0m = -j, bm - 2 = -5j for m. -1 Let r be (-96 - -95)/((-2)/81). Suppose n + 2 + 3 = 0. Let m = 0 - n. Solve -3g - r = -d, -3d - 3g - 9 = -mg for d. -5 Let s = 4 - 2. Suppose 0 = -g - s. Let n be (3/g)/(12/(-56)). Solve t = 3l - 9, l - 5l - 5t = n for l. 2 Let o(k) = k*3 + 3k*2 - 3k - 5. Let w be o(-4). Let i = 14 + w. Solve 0 = in - 0z - z + 21, -5n = 3z + 17 for n. -4 Let x be (93/(-12))/(2/(-8)). Suppose 3y = x + 134. Suppose -2f = 3f - y. Solve c = 2a - 9, -3a + c + 3c = -f for a. 5 Suppose 0 = -4d + 3w + 3, 4w - 6 = 6. Solve 0 = -2a - dm + 16, -a + 5m - 12 = 3a for a. 2 Suppose -3q + 1 = -2l - 0l, 0 = 3l - 4q. Solve -v + 5o + 22 = 0, 5v = o - lo - 30 for v. -3 Let f = -122 + 123. Solve -4v - 3q - 6 = f, 4v - q = -3 for v. -1 Let g = 90 + -86. Solve 3o - 6 = gq, 0o - 3o = 3q + 15 for q. -3 Suppose -5d - 3 = -23. Suppose -5j = -2c - 120, -dc = -2j + 5j - 46. Solve p + 0m + 14 = 5m, -3m + j = -4p for p. -4 Suppose 4n = -190 - 170. Let u be ((-12)/10)/(27/n). Solve -4 = b - 0b, 4b - 4 = -um for m. 5 Suppose -13c = -7c - 18. Solve 0 = 3s + 2h + 17, 4s - ch = -6h - 23 for s. -5 Let h = -15 + 11. Let z = -4 - h. Suppose 3b + 2i = -zi + 4, -4 = 4b - 2i. Solve 3q + 6 = b, u + 2 = -4q - 9 for u. -3 Let s(g) = g3 - 7g*2 - g + 1. Let n be s(8). Suppose -5x = b - 71, -3b - n = -x - 2x. Solve 5o = 4r + x, -3o + 2o - 26 = 5r for o. -1 Let a(u) = -u3 + 7u2 + u - 7. Let t(k) = -k2 + 8k - 5. Let p be t(6). Let v be a(p). Solve 6 = -3n - vn - 3z, -4z = -2n + 2 for n. -1 Let n(w) = -w*2 + 4w - 6. Let b be n(3). Let k = 8 + b. Solve 0s - y + 13 = -3s, -5y = -3s - k for s. -5 Let z(d) = d + 5. Suppose k = 3u + 21, -2k + 36 = -5u - 0k. Let l be z(u). Let i be (-17)/l - 6/(-3). Solve -3j = -2c + 3c + i, -c = 4 for j. -5 Suppose -3 = -k, 2m + 5k = -4 + 55. Solve -3c + 0c = d - 2, -3d = -3c - m for c. -1 Suppose -120 = -3z - z. Suppose i + z = n + 9, -4i + 84 = 4n. Solve -n = 5l + 2w, l - w - 5 = -6w for l. -5 Let y(m) = m + 14. Let w be y(-10). Solve -2x = -wc - 3x, -2c = x for c. 0 Let n(y) = y + 33. Let t be n(-24). Solve t = -p + 4b, 3b = -5p + 34 - 10 for p. 3 Suppose -t - 3t = -4. Suppose -4h - 3k = -6h + t, -3h + 21 = 2k. Solve -3n = -4x - 17, 3n - 16 = hx + 6 for x. -5 Let f(g) = -g. Let u be f(-2). Solve 3y - 3k = -7k, uk = 0 for y. 0 Let i = -15 - -12. Let u = -3 - i. Solve 4w - 3o + 11 = u, -o - 1 = -w - 4o for w. -2 Let q(n) = n2 - 4n - 3. Let j be (4/6)/((-1)/3). Let v be q(j). Suppose -5i + 5 = -2y - 6, -4y = i - 11. Solve 4b + 14 = 2g, -2b - yg = -g + v for b. -4 Let x = 0 + 5. Suppose 0j = 2j - 24. Solve 3a - j = 0, -6 = -2f - xa + 3a for f. -1 Let b be -2((-2)/2 - 1). Let l = 4 + b. Solve -4y + 5z = l, 0 = 3z - 11 - 1 for y. 3 Let q be 6 - ((1 - 1) + 0). Let r be (-8)/(-4) - 0(-1)/(-4). Solve q = -rx, d - 4x = 4d + 15 for d. -1 Let s be (54/24 - 2)/((-2)/(-16)). Solve 2k - 4 = -0f - sf, 3f - 5k = 14 for f. 3 Let c be -23/6-1. Let q be 7 + -1 + c/(-1). Solve 4t + qi + 11 = -24, i = -3t - 18 for t. -5 Let u(n) be the second derivative of -n4/12 - 2n*3/3 - 9n. Let m be u(-4). Solve 0 = -4v - 2l - 20, m = -4v - l - 0l - 16 for v. -3 Suppose -v = 2v - 30. Let a be (-12)/(-10)v/3. Let q be 0(4 - 2 - 1). Solve q = 3p - 4s - 23, -5p + 3p + a = 3s for p. 5 Suppose -8n = -4n + 12. Let q be (-3)/n - 2 - -1. Let u = q - -2. Solve 4a + 2b = u, 3a - b - 12 = b for a. 2 Let k = -4 - -7. Let i(w) = w2 + 7w + 7. Let r be i(-5). Let c = r + k. Solve -x - 2 = -ct - 3t, -3t - 8 = x for t. -1 Let q(o) = o2 + 16o - 1. Let n be q(-17). Solve 5f = y - 16, -5y - 3f - 16 = n for y. -4 Let t = -14 + 23. Solve 2s + o - t = 0, -3s + 0o = 2o - 15 for s. 3 Suppose 0 = -p + 2w, p = -0p + 3w + 1. Let f be p/(2/2 + -3). Solve 0 = -4l + 4v - 28, v + 8 = -3l - f for l. -4 Let y(d) = 0d*2 + 6d*2 - 1 - 6d + 1 - d*3 + 2. Let i be y(5). Let q = i - -3. Solve -c - 3 = -3n - 4, 2n - 2c + 6 = q for n. 1 Suppose -u + 2d = -23, 0 = -3u - 2u - 3d + 128. Solve -3z - 6 = 3h - 6h, -2z - 5h = u for z. -5 Suppose 15 = -2i + 7i + 5o, 2o = i. Suppose u + 0 = -i. Let n be 2 - (u/1 + 1). Solve 0 = -2d - 3q - 5, 5d - 5q + n = -3q for d. -1 Suppose 0 = 3d - d - 2. Solve t = -2i + d, 5t + 28 = -i + 2i for t. -5 Suppose 0 = -5q + 7 + 3. Solve -qd = 3s + 1, 2d + 2 = -s - s for s. 1 Suppose 5f - a - 24 = 0, 2f + 6a = 4a. Let y be (-11)/(-44) - (-91)/4. Solve -3w + y = 5d, 14 = -d + fd + 2w for d. 4 Let y = -4 + 7. Let g = -2 - -5. Suppose 5k + 2b - 3b = 11, 0 = 4k - gb - 11. Solve 2i + 3z + 3 = -3, -yi + kz = -17 for i. 3 Let l be (-4)/6 + 34/6. Solve 5r + 2k - 4 = 9, -k + l = r for r. 1 Suppose -l = 3c + 7, 4l + 2c + 0c = 2. Solve 2y = o, -o + 3o = -ly for y. 0 Let v be (4/10)/(8/40). Solve 3n = -a - 0n - 5, 5n + 7 = -va for a. 4 Suppose 0 = 2z - 22 - 8. Let a be 2/(-2) + 0 - -1. Solve 3p + o = -z, o + o + 6 = a for p. -4 Let q = -13 + 23. Suppose 5j = -2b - q, -5b + b - 2j = -12. Solve 0 = 4i - 4k + 4, i - 4i - bk - 35 = 0 for i. -5 Suppose -p - p = -6. Solve pw = k - 2 - 2, -w - 20 = -5k for w. 0 Let s be 8/(112/102) + 2/(-7). Solve p + 2p + s = 4a, 5a - 10 = 4p for a. -2 Suppose -5n + 17 + 8 = 5l, 5n = -l + 17. Let s = -39 + 41. Solve -b + l = -sb, -5c = 5b + 10 for c. 0 Suppose -10 + 30 = 5u. Suppose 0c = c + 3m - 1, 2c - 12 = 4m. Suppose 0k - 8 = -ck. Solve -kr - 5b - 29 = 0, 25 = -r - ur - 3b for r. -2 Suppose 0q + 3s + 66 = 3q, -5q + 112 = -4s. Solve -4j - 3l = -q, -1 - 7 = 4j - 5l for j. 3 Let x(i) = -i*3 - 6i*2 - 7i - 4. Let v be x(-5). Suppose v + 0 = k. Suppose 0 = -2f + kf. Solve -3r = -6z + 4z - 10, -2z - 5r + 22 = f for z. 1 Let a = -7 + 10. Let l = 49 - 47. Solve -3o - 11 = -lj, -o - 2o + aj - 12 = 0 for o. -3 Let a = -33 + 54. Solve 4l - 4s + 1 = -3, 3s = -3l - a for l. -4 Let p be ((-3)/6)/(1/(-8)). Solve -2w + 5b - 11 = 0, -pw + b - 8 = 5b for w. -3 Suppose -19 = -3o + 2. Let k = 0 + o. Let g(t) = t*3 - 6t*2 - 6t - 4. Let r be g(k). Solve rc - c = -2m, 2c - 4m = 24 for c. 4 Suppose 0m + 2m + 0m = 0. Solve -12 = -2p + 4p - 3h, p - 2h + 7 = m for p. -3 Let s(k) = -k3 - 4k*2 + 2k + 2. Let j be s(-2). Let p be 6 + (2 - (5 - 1)). Let z be ((-12)/j)/(p/10). Solve 3d + 3i = -3 + 9, -6 = -zd + 5i for d. 2 Let r = 22 - 19. Solve 2s + 3 = rs + 4g, 3g - 4 = s for s. -1 Suppose h + 3h = -8. Let j be (h/3)/((-4)/30). Solve jd = 4i + d - 16, 0 = 3i - 4d - 13 for i. 3 Suppose 8r - 3r = 15. Suppose -rm - 72 = -4*f -	{ "pile_set_name": "DM Mathematics" }
4, -4a - 8 = -16q + 19q for q. -8 Solve -q - 5t + 48 = 0, -4t + 42 + 4 = -3q for q. -2 Solve -483q + 17 = -481q + 3b, 3b = 5q - 11 for q. 4 Solve -19t + 14t - 2 = -4n, -5n = -125t + 120t for n. -2 Solve 21 = 18x - 17x - 4f, 6f + 34 = 4x for x. 1 Solve 5v - 4p = 54, 0 = 5v + 1807p - 1804p - 47 for v. 10 Solve -3h + 3g = 51, 2h + 106g + 85 = 111g for h. 0 Solve 5v = 5y, -18v - 83y + 48 = -85y for v. 3 Solve 5r + 5b - 35 = 0, -2r - 25b - 10 = -27b for r. 1 Solve -g - 9 = 3a, -4104a + 51 = -5g - 4122a for g. -3 Solve -80j = b - 89j - 13, -3j = -2b + 11 for b. 4 Solve -4j - 2o - 37 = -15, 0 = -3j + 2o - 34 for j. -8 Solve -14u + 30u - 20u - 12 = 0, u = -4f + 17 for f. 5 Solve -57a + 58a + 3d - 7 = 0, -2d = -3a - 23 for a. -5 Solve -5o - 6y = -59, -6o - 252 + 308 = -2o - 4y for o. 13 Solve 0 = -5x - 5u + 316 - 271, 3x - 2u - 7 = 0 for x. 5 Solve y + p = 14, -3112y + 6 = -3115y + p for y. 2 Solve -7 = 5z + 4s, -4 = 11z + 51s - 46s for z. 1 Solve -19894c + 7 = -19897c + 5u, u = 4c - 19 for c. 6 Solve -6 + 18 = 4l, w + 5l - 5 = 10 for w. 0 Solve 2u = u + 5w + 44, u = -w - 10 for u. -1 Solve 0 = -5g - n + 44, -1027 = 5g + 4n - 1083 for g. 8 Solve -5m = 2w + 558 - 580, -9w + 4m = 7 for w. 1 Solve 3x + h - 1982 = -2009, 7h = -3x - 45 for x. -8 Solve -3299y + 3295y - 8 = 0, -5b - 18 = 4y for b. -2 Solve 44g = 2o + 43g - 7, 4o = -g - 1 for o. 1 Solve 10 = 4534f - 4530f - 2j, 2f + 4j + 50 = 0 for f. -3 Solve 2r + 10480c - 10475c = 9, -15 = -5c for r. -3 Solve -5p = -4k - 94 + 88, 5p - 5k - 5 = 0 for p. 2 Solve 0 = -4866h + 4865h + m - 4, 2h + m = -8 for h. -4 Solve 5g - 59 = -10i + 23i, -3g + 4i + 24 = 0 for g. 4 Solve 5o - 3x - 6 = 0, -12273x - 6 = -4o - 12271x for o. 3 Solve -5f = 20, 5o + 39f = 41f + 33 for o. 5 Solve 0 = -2d + y - 120 + 130, -8 = -d + 2y for d. 4 Solve 2r + 2v = -18, -11r - 24 = 652v - 656v for r. -4 Solve -51m - 4 = -52m - k, 0 = -2k + 4 for m. 2 Solve -b = 2k + 4, 2b - k = -721 + 723 for b. 0 Solve 451h = 454h - 9d + 24, -5d = 2h - 17 for h. 1 Solve -3z + 31 = 5m, -39694m + 39699m = -7z + 39 for z. 2 Solve 3o + 20 = 5d + 24, 5d = 5 for o. 3 Solve -5w + 5k + 102 = 12w, 6 = w + k for w. 6 Solve 11f - 7 = 4a, -93a + 89a - 5f = -9 for a. 1 Solve 0 = 4c + 21i - 17i + 12, 0 = 4c + 3i + 14 for c. -5 Solve 4l - 64 + 92 = 0, -33 = -5t + 4l for t. 1 Solve -l - 2j = -853 + 856, 0 = 4l + 3j - 8 for l. 5 Solve 31k + 12x = 33k - 10, -5x - 5 = 0 for k. -1 Solve 4m + 5j + 18 = 0, -330j = -323j + 14 for m. -2 Solve 4t + 80 = 16n, 2n - 15 + 5 = -139t + 140t for n. 5 Solve -5m + 15 - 22 = -b, 4b = 3m - 23 for b. -8 Solve -b + 17 = m + 29, 6m + 69 = -5b for b. -3 Solve 3p - 102 = -6y, -7y + 161 = -5p + 59 for p. 2 Solve 4y + 118z - 106z = -32, y - 4z = 20 for y. 4 Solve 44 = -2u + 10v, 183 = -3v + 192 for u. -7 Solve 3o - 4j + 9 = 0, 4j = -o + 5028 - 5031 for o. -3 Solve -11 = 3o + 2r, 3o + 22 = 2r + 3 for o. -5 Solve 0 = 65y - 66y - 24s - 71, -2s - 10 = -4y for y. 1 Solve 2y + 4i + 24 = 0, -33i + 35i + 10 = 0 for y. -2 Solve -31d = -27d + 4p + 16, 5d - 4 = p for d. 0 Solve 22o = -g + 20o - 10, 5g + 38 = -4o for g. -6 Solve -11 + 0 = 23w - 22w - 10b, 0 = -5w - 7b + 2 for w. -1 Solve -4n = 2m + 46, -13m = -17m + 4n + 28 for m. -3 Solve 5u + 28 - 24 = h, -4u + 16h = 64 for u. 0 Solve -4j - h + 27 = 18, h = 2j + 3 for j. 1 Solve 2j = 0, 0 = -w + 53j - 52j - 2 for w. -2 Solve 4 = 2f + 2c, 1983f - 1982f - 3c = -14 for f. -2 Solve 3c + 6 = 3y, -48y + 44y - 62 = 6c for y. -5 Solve 0 = 5t, 8t + 12 = 652w - 656w for w. -3 Solve -4s = -4p + 8, -48p = -3s - 44p - 10 for s. 2 Solve 0 = -2l + 5o - 27, 4l + 165o - 16 = 161o for l. -1 Solve -5t - 23 = -v, 8v = -4t + 11v - 25 for t. -4 Solve 15c - 3s = -45 - 30, 0 = -2c + 3s - 10 for c. -5 Solve 35 = 2f - 3w, -3f - 211w - 30 = -208w for f. 1 Solve -2r - 20 = 0, 1863t - 3r - 14 = 1861t + 8 for t. -4 Solve -3 = 3p - b, 4b = 5p + 36 - 38 for p. -2 Solve -25 = -2l - 147b + 152b, -5l - b - 5 = 0 for l. 0 Solve -3y + 19 = -78h + 82h, 4y = 4h + 16 for y. 5 Solve -65w = -64w + 4, -5 = 3h + 4w - 4 for h. 5 Solve k + 70 = 74c, -5c - 2k + 72 = 59 for c. 1 Solve 3m + 3j = -15 + 12, j = 0 for m. -1 Solve -3t = -4l + 16, -4t = -5l - 111 + 132 for l. 1 Solve -1971c + 1973c - 2q = 2, 5c = q - 7 for c. -2 Solve 0 = 26q - 21q + 3h + 25, 3h + 17 = -q for q. -2 Solve 3h = s + 19, -16 = 926h - 930h - s for h. 5 Solve -r - 2y = -10, 37r = r + y - 151 for r. -4 Solve 4w - 96 = 8h, 5h - 54 = 3w - 123 for w. 18 Solve 2t - 37f + 39f - 2 = -0t, 5f - 13 = -3t for t. -4 Solve 2f - 14 = -3p - 6, 0 = -9f - 4p - 2 for f. -2 Solve 0 = 21j - 20j - 4x - 21, j - 13 = 2x for j. 5 Solve r = -4q - 14q - 11, -14 = -2r for q. -1 Solve -14 = -2a + 4m + 4, 6a - 2m = 4 for a. -1 Solve 7l - 100 = -4o, 0 = o - 222l + 223l - 16 for o. 4 Solve -25 = -5h, p + 0h + h - 8 = 0 for p. 3 Solve 0 = a - 3t - 19 + 11, -5a + t = -26 for a. 5 Solve 1092c = 1089c - 3d + 18, -3c - 4d + 15 = 0 for c. 9 Solve 2s = -4h - 63 + 11, 328 = -27h - 2s for h. -12 Solve -3z + 14 = 4n, -z + 2 = -4n + 4z for n. 2 Solve -80 = 4a + 4t, -15t = 111a - 116a + 240 for a. -3 Solve -5q + 19 = -105y + 109y, 0 = 4q + y - 2 for q. -1 Solve -2x - 4h = 0, 4h - 1202 = 2x - 1170 for x. -8 Solve -g - 5m + 15 = 0, 3g - 192 + 219 = 3m for g. -5 Solve 146j - 141j = -4t - 6, 17t + 4j = -60 for t. -4 Solve 1833f - 1834f = -8, f = x + 5 for x. 3 Solve 0 = -4a + 3x + 25, 340a = 339a + 2x + 15 for a. 1 Solve d = 4j + 10, 21d + 5j = 18d - 21 for d. -2 Solve -s = 4t - 3, 2105s - 2104s = -7t + 3 for s. 3 Solve 2i - 5q + 30 = 0, -203q + 99q = 4i - 101q + 8 for i. -5 Solve -3p = -3f - 33, 2p + 965f = 956f - 77 for p. 2 Solve 0 = -4t + 2t, -10t = 2v - 11t - 6 for v. 3 Solve 24m + 7 = 5x + 27m, -1 = x + m for x. 5 Solve c = 5o - 1, -2c - 8099 = 21o - 8128 for o. 1 Solve 0 = -27p + 32p + b + 7, 8 = -2p - 3b for p. -1 Solve -8 = -5k + 10k + 3i, i - 8 = k for k. -4 Solve 50 = -10d, -34 + 36 = 2k - 2d for k. -4 Solve 3w = -4i + 4688 - 4666, 20 = 2i - 3w for i. 7 Solve -5l - 14 + 20 = -2r, -4l + 16 = 4r for r. 2 Solve 69 = 14k + 55, -2k = -c - 4 for c. -2 Solve -2f = q + 40, 4q + 116f = 111f - 106 for q. -4 Solve -12847w + 4x = -12843w - 8, 8w = -6x - 12 for w. 0 Solve 15o - 4u = 4o + 38, 16o - 2u = 20o for o. 2 Solve -34t = -4u - 188, -2t + 4u + 514 = 518 for t. 6 Solve -22 = -2k + 3p, -5k - 3p = 80 - 93 for k. 5 Solve x = -17, -243p + 100 = -246p - 5x for p. -5 Solve -5v + 4z + 9 = 0, -4254z = -4256z - 2 for v. 1 Solve 0 = -i + 8b + 25, 756b - 760b = -5i - 19 for i. -7 Solve 22g = 27g - 25, -13 = -2x - 3g for x. -1 Solve 17w - 12w + 70 = -5j, 11w - 3j = 6w + 10 for w. -4 Solve 11m = 155h - 159h + 103, -3h + 4m - 33 = 0 for h. 1 Solve 24 = 98b - 96b + 4f, 3b = -3f + 15 for b. -2 Solve 20s - 120 = 15s + 5b, -99 = 2s + 5b for s. 3 Solve -1346d + 1345d = a - 2, -5d = -5a - 40 for a. -3 Solve 0 = -3y - 2i - 14, -4y = 3i + 432 - 414 for y. -6 Solve 82k - 3 = 83k, -6k - 42 = 5b - 4 for b. -4 Solve -8 = 2v - 2k, 5v + k + 3472 - 3458 = 0 for v. -3 Solve 0 = 5p + 4l - 178 + 121, -35 = p - 5l for p. 5 Solve 4m - 864 + 841 = -z, 15 = 3m for z. 3 Solve 0 = 4j - o + 23 + 11, j + 33 = 2o for j. -5 Solve -37 = -2t + 3h, 0 = 2t + 5h + 1 + 34 for t. 5 Solve 9a - 70 = -88, 2s = -4a - 22 for s. -7 Solve -2d = -3y + 7, 439y + 69 = 440y - 14d for y. -1 Solve 3s - 171y + 170y = -10, -41s - 12s - 2y - 39 = 0 for s. -1 Solve -5b + 1 = -4u, -13b + 2u = -7b - 4 for b. 1 Solve -5i - 4t - 18 = 0, 3i - 14t = -14 - 46 for i. -6 Solve 4a + 42 = -11y, -12y + 8y - 43 = 10a - 3a for y. -2 Solve -3 = h, -34h = 2b - 36h + 10 for b. -8 Solve -282326w + 282327w = 4u - 7, 0 = -4w + 2u + 14 for w. 5 Solve 0 = -3d + 2b + 10, 2d + 4b = -1918 + 1930 for d. 4 Solve -2b - 22 + 3 = -3c, 2c = -2*b	{ "pile_set_name": "DM Mathematics" }
k2 - 5. Suppose -26w = -189 + 33. Let h(t) = 9t2 + 10. Calculate wh(s) + 13c(s). 2s2 - 5 Let c(i) = i2 - 6. Let o(h) = 26h2 - 16h + 13. Calculate -2c(t) - o(t). -28t*2 + 16t - 1 Let l(p) = -5p3 + 8p*2 + 8. Suppose 16a + 4 = 18a. Let t(n) = 3080 + 5n*a - 2n3 - n3 - 3075. What is -5l(b) + 8t(b)? b*3 Let a = 3739 + -3733. Let q(j) = -9j*3 + 7j*2 + 6j - 4. Let l(n) = -n3 + n2 + n - 1. Calculate al(m) - q(m). 3m3 - m2 - 2 Let h = 25 + -14. Suppose 13q + 20 = hq. Let n be 6/q + (-2268)/(-105). Let z(k) = 5k - 2. Let f(p) = 51p - 21. Calculate nz(v) - 2f(v). 3v Let z(p) = -p - 2. Let f(n) = 2n + 5. Let w = -35 - -112. Suppose 11 = 3j + w. Let i = -14 - j. Determine iz(x) + 3f(x). -2x - 1 Let i(a) be the third derivative of -a*4/6 - 2a*3/3 - 2a*2. Let p be (-7)/(10/((-80)/28)) + -4. Let f(l) = 13l + 11. Calculate pf(j) - 7i(j). 2j + 6 Let g(j) = -39j*3 + 5j*2 + 44j - 8. Let n(s) = 77s3 - 9s*2 - 77s + 15. Calculate 7g(u) + 4n(u). 35u3 - u2 + 4 Let o(f) = 54f - 51. Let k(m) = -17m + 16. Let c(a) = 19k(a) + 6o(a). Let l = 2 - 0. Let z(y) = -y + 0y + ly - 5. Determine 5c(i) - 2z(i). 3i Let y(q) = -1732q - 67. Let c(f) = -5194f - 214. Determine -5c(k) + 16y(k). -1742k - 2 Let p(i) = 2i + 1. Let j(x) = 31x2 + 8x + 39. What is j(w) - 4p(w)? 31w*2 + 35 Let n(m) = 3m + 19. Let k(h) = -72 - 84 + 157. Give -2k(r) + n(r). 3r + 17 Let z(w) = 53w2 - 29w - 2. Let m(d) = -d*2 + 6d + 1. Calculate -5m(i) - z(i). -48i*2 - i - 3 Let o(s) = 3s*3 + 2s*2 + 679s - 70. Let h(w) = 4w3 + 3w*2 + 678w - 108. Give 2h(d) - 3o(d). -d*3 - 681d - 6 Let v(g) = 6531g3 - 5g*2 + 5g + 5. Let f(p) = 303688p3 - 232p*2 + 232p + 232. Calculate 5f(t) - 232v(t). 3248t3 Let g(s) be the first derivative of -s3/3 + s + 1. Let z(j) = 4j*3 - 5j*2 + 3. Let i be (-40)/(-3480)319 - (-8)/6. What is ig(q) - z(q)? -4q*3 + 2 Let v(l) = 8l - 9. Let f(t) = -t + 1. Suppose 3a = -0a. Suppose -11u + 12u - 10 = a. Let c be (-1024)/(-160) + (-1)/(u/4). Give cf(q) + v(q). 2q - 3 Suppose m + 45 = -4m. Let v be 11 - m/((-45)/(-20)). Let h(l) = -31 + 15 + v. Let q(y) = -2y*2 - 5. Determine -5h(j) + q(j). -2j2 Let v(y) = 112y - 6828. Let l be v(61). Let i(t) = 4t3 + 8. Let d(s) = 5s*3 + 8. Give li(c) - 3d(c). c3 + 8 Let y(s) = 415s + 25. Let p(j) = 138j + 9. Calculate -7p(o) + 2y(o). -136o - 13 Let t(v) = -44v3 - v2 - 5v - 49. Let a(d) = 43d3 + d2 + 5d + 34. Calculate -3a(k) - 2t(k). -41k3 - k2 - 5k - 4 Let n(z) = 628z - 3. Let i(l) = -616l + 4. Calculate -2i(w) - 3n(w). -652w + 1 Let t(n) = -20n*3 + 9155n*2 + 4n + 14. Let h(v) = 14v3 - 6103v*2 - 3v - 10. Calculate 7h(k) + 5t(k). -2k3 + 3054k*2 - k Let c(w) = -1118w*2 + 4w - 42. Let f(i) = -2239i2 + 9i - 105. Give 5c(k) - 2f(k). -1112k2 + 2k Let d(m) = 6m3 + 9m2 - m - 9. Let r(k) = -1 + k2 + 3k3 + 0k*3 - 2k*3. Let n = -225984 - -225966. What is nr(f) + 2d(f)? -6f*3 - 2f Let y(k) = -532k2 - 1. Let n(x) = 177x*2. What is -8n(l) - 3y(l)? 180l*2 + 3 Let c(u) = -99u + 36. Suppose 3l - 5m - 118 = 0, -426 = -12l + 81m - 84m. Let q(h) be the first derivative of -7h*2 + 5h - 2. Give lq(s) - 5c(s). -9s Let u(j) = 68j*2 + 422j + 7. Let v(f) = -27f2 - 211f - 4. Give -2u(m) - 5v(m). -m*2 + 211m + 6 Let q = 9 - 18. Let v(u) = -2u - 22. Let l be v(q). Let x(c) = 4c*3. Suppose 45g = 190 + 125. Let b(k) = 2k3. Calculate gb(f) + lx(f). -2f3 Let d(y) = -y3 + 7y2. Let s(i) = 11i*3 - 2i*2 - i + 1. Let x(a) = -53a*3 + 3a*2 + 6a - 5. Let n(h) = -5s(h) - x(h). Calculate 3d(z) - 2n(z). z3 + 7z*2 + 2z Let a(n) = 160n2 - 28n + 11. Let g(o) = 79o2 - 13o + 5. What is 4a(f) - 9g(f)? -71f2 + 5f - 1 Let b(z) = -3z2 - 3z. Let h(j) = 11j2 + 13j. Let y(s) = s*2 - 29s - 6590. Let v be y(97). Determine vh(d) + 26b(d). -12d2 Let c(a) = -1659a - 16. Let d(s) = -419s - 4. Give 2c(h) - 9d(h). 453h + 4 Let t(d) = -d*2 - 15d + 9. Let j(y) = -y*2 - 19y + 11. Let a(w) = 4j(w) - 5t(w). Let k(o) = -8o2 + 5o + 11. Calculate -6a(b) - k(b). 2b*2 + b - 5 Let f(q) = -7q - 11. Let i(s) = 9s + 109. Let t(d) = 28d + 360. Let k(p) = -10i(p) + 3t(p). Determine 5f(v) - 6k(v). v + 5 Let t(z) = -107 + 169 + 2z - 63. Suppose 3j + 8 = 2j. Let f(d) = 3d - 2. Calculate jt(q) + 5f(q). -q - 2 Let a(s) = s*2 + s + 3. Let h(k) = 3k*2 + 3k + 6. Suppose f = -5f. Suppose 2v + 7 + 3 = f. What is va(x) + 2h(x)? x*2 + x - 3 Let l(z) = -24z*2 - 5z - 8. Let v(p) = 16p2 + 3p + 5. Let d(i) = 6i - 60. Let s be d(14). Suppose -8q + s = -5q. Determine qv(r) + 5l(r). 8r*2 - r Let o(n) = n - 3 + 2 + 4. Let j(m) = -1. Let d(x) = 8. Let f(s) = d(s) + 5j(s). Let i = 22705 + -22703. Determine io(k) - 3f(k). 2k - 3 Let d(s) = 268s + 1338. Let u be d(-5). Let b(k) = 13k2 + 35k + 13. Let c(q) = -4q2 - 12q - 4. Give ub(a) - 7c(a). 2a2 + 14a + 2 Let j be (26/6 - 4(-13)/(-156))/(-2). Let f(z) = 17z*2 + 2. Let h(i) = -152i*2 - 19. Give jh(t) - 19f(t). -19t*2 Let q = 687 + -665. Suppose -5w = -f - 0 - q, -2w + 12 = -2f. Let u(t) = -t*2 + 2t - 2. Let x(h) = -h*2 - h + 1. What is fx(p) - u(p)? 3p2 Let d(u) be the third derivative of u6/10 + 3u*3/2 - 3u*2. Let t(a) = 3a*3 + 2. Let k = 51 + -48. Suppose -6q - 15 = -k. Give qd(s) + 9t(s). 3s3 Let g(n) = 45n*3 - 13n*2 - 632n - 8. Let i(o) = -27o3 + 8o*2 + 379o + 5. Give -8g(m) - 13i(m). -9m3 + 129m - 1 Let c(g) = -12 + 6842g3 + g2 - 7 - 6841g*3 + 2g2. Let t(x) = x2 - 1. What is -c(q) + 3t(q)? -q3 + 16 Suppose 0 = -n - 6 + 8. Let w(h) be the first derivative of -h2/2 - h + 6. Let v(z) = 1. Let d(y) = -y. Let g(c) = d(c) - 3v(c). Determine ng(o) - 5w(o). 3o - 1 Let p(s) = 22s*2 + 7s. Let r(c) = -11c2 - 4c. Let t(w) = 14w2 + 13w + 21 - 62 + 23 + 22 + 0w3 + w3. Let m be t(-13). Give mp(n) + 7r(n). 11n*2 Let h(w) = 2087w*2 + 2w. Let l(j) = 10440j2 + 11j. Determine -11h(m) + 2l(m). -2077m2 Let z(k) = 52k*2 - 60k - 7. Let r(l) = 51l2 - 48l - 6. Give -5r(n) + 4z(n). -47n2 + 2 Let v = -637 - -648. Let y(z) = 6 - 17 - 1 + v. Let w(p) = 2p*2 - p - 1. Give -w(t) + 3y(t). -2t2 + t - 2 Let w(m) = 2257m*3 - 2m*2 - 2m - 4. Let b(u) = 13541u3 - 13u*2 - 13u - 26. Calculate 6b(i) - 39w(i). -6777i3 Let a(b) = -130b. Let g(f) = 33f. Let k(n) = a(n) + 4g(n). Let p(t) = -2t. Let x(y) = -y3 + 9y - 5. Let h be x(3). Determine hp(c) - 6k(c). -2c Suppose 3q = p + 32 - 3, 3p = 3q - 33. Let k(h) = 4h + 1. Let l(x) be the second derivative of -17x*3/6 - 3x*2/2 + 337x. Determine qk(d) + 2l(d). 2d + 3 Let x(t) = 3t*2 - 59t - 401. Let o be x(25). Let f(l) be the first derivative of 6l3 + 5. Let h(q) = q2. Give of(w) + 9h(w). -9w*2 Let k = -540 - -544. Let x(o) = 6o - 1. Let s(m) = m - 1. Let d(v) = -3s(v) + x(v). Let b(w) = -8w - 7. Give kb(h) + 14d(h). 10h Let u(x) = -51. Let j(i) = -411i - 95. Calculate -j(g) + 2u(g). 411g - 7 Let g(r) = -8r + 2. Let n(k) = 3k + 1. Let j(m) = -g(m) - n(m). Let c(d) = 157 - 79 - 77 - d. Give -3c(o) - j(o). -2o Let t(b) = -b3 - b2 - b + 1. Let r(f) = -4f3 - 5f*2 - 5f + 5. Let v(p) = -2p. Let m be v(1). Determine mr(s) + 10t(s). -2s*3 Let o(n) = -9482760n*3 + 20405n*2. Let j(w) = -1859w*3 + 4w*2. Determine 20405j(y) - 4o(y). -1855y*3 Let t be -4882 - -4888 - (14 - (-1 - -2)). Let y(p) = -p + 0p - 5 + 2p. Let a(v) = 2v - 16. Give ta(q) - 10y(q). -4q + 2 Let o(z) = 453z + 7. Let l(q) = -1813q - 31. Give -2l(r) - 9o(r). -451r - 1 Suppose -1 = 7t + 125. Let d be (-27)/t - 1/(-2). Let j(n) = n*3 + 3n*2 + 2n + 6. Let m(r) = -r*3 - 2r*2 - 2r - 5. Give dj(h) + 3m(h). -h*3 - 2h - 3 Let p(d) = -26100d2 - 37d - 130. Let q(x) = -8700x2 - 13x - 46. Calculate -6p(t) + 17q(t). 8700t2 + t - 2 Let n(h) be the second derivative of -4h*3/3 - 3h*2 + 378h. Let w(d) = d + 1. Determine -n(c) - 6w(c). 2c Let s(a) = -10a - 2915. Let d(w) = -2w - 728.	{ "pile_set_name": "DM Mathematics" }
ssuming i is positive. 1 Simplify ((k/(kk(-19)))/kk7)25 assuming k is positive. k625 Simplify (((f/f(-7/6)f)/f)1)20 assuming f is positive. f(130/3) Simplify d/((dd*(-2/17))/d)d*5(d/(dd(2/27))d)/(((d/((d/((d/(d/(d/(d((d(dd4d)/ddd)/dd)/d))))/d))/dd))/d)/d) assuming d is positive. d*(7823/459) Simplify ww/(w/(w/(w*(-14)ww)))w*(-6/5)w/(w/w*(1/16))ww(ww(ww(w/(w*16w)w)/w)/www)/ww assuming w is positive. w*(309/80) Simplify ((ooo(o/(oo(oo10/ooo)/oooo))/ooo)/oo29)/(o/(o(o/(((o*(-12)oo)/o)/o))/ooooo)ooo(2/25)/o) assuming o is positive. o(798/25) Simplify (m*(2/31)/mm(-1/9))(7/4) assuming m is positive. m(-511/279) Simplify a(-1/4)a(-16)(aa27aaaa)/a(-7/4) assuming a is positive. a(35/2) Simplify (u(-5))(-36)((u(u(-10)/u)/u)/u)/u(-1/14) assuming u is positive. u(2353/14) Simplify b(-2/35)/bbb(-2/9)b/(b*(-12)/b)b(7/4) assuming b is positive. b(19493/1260) Simplify n*(2/3)nn((n/n*(7/5))/n)/nn*(9/4)/(n/(nn*7n)) assuming n is positive. n*(631/60) Simplify kk*15/kkk(-12)(k(2/7))(-2/13) assuming k is positive. k(360/91) Simplify (p29p)/(p(-6)/p)(p/((pp/p(-18))/p)p)/(p/(pp11)) assuming p is positive. p31 Simplify v(vv(-4)v)/vvv(v/((v/((((v/(vv*(-2/49)))/v)/vv)/v))/v))/vvv/v*9vv/(v/((v/((v(1/7)/vvv)/v))/vv)) assuming v is positive. v(-348/49) Simplify ((p(11/4)/pppp)/p(1/4))/(pp/p(4/13))38 assuming p is positive. p(-1555/26) Simplify (q/q(-4/7)q(-8/11))(-18/13) assuming q is positive. q(-90/77) Simplify ((r/(rr/((rr0rr)/r)rr)r)/r)*2r(1/7)/r1 assuming r is positive. r*(-20/7) Simplify (lll(-2/3)l*5l(l(1/3))(-1/3))(-6) assuming l is positive. l(-130/3) Simplify (((p(3/2)p)/p)*(-4/21)(pp(-3)p)(-2/83))(1/23) assuming p is positive. p(-152/13363) Simplify (r26/rr(((r/(r/(r/(((r/((r(r(r/r*3)/r)/rr)/r))/rr)/r)))r)/r)/rr)/r)(-4) assuming r is positive. r(-96) Simplify ((m/(mmm(-3)mmmm))/(m(1/3)mm)m*(-1/2)m(-1/2))(3/2) assuming m is positive. m(-8) Simplify (h(-3)/h)*31(h(-1/8))(3/41) assuming h is positive. h(-40675/328) Simplify (l3ll/l12)/(l(-4)l)(3/41) assuming l is positive. l(-278/41) Simplify (j(-1))(-44)/(((j(3/7)j)/j)/j8) assuming j is positive. j(361/7) Simplify s*13s(s/(s(1/5)/sss))/s(s/(s/(ss(-14))))/s(2/65) assuming s is positive. s(-3/13) Simplify (f(-2))33(f/(fff2))(-23) assuming f is positive. f*3 Simplify (jjj/(j(-1/4)/j))(2/79)/(((j/j5)/j)/(j(1/6)/j)) assuming j is positive. j(1013/237) Simplify (g1g*(2/3)gg(gg/(g/(g(-1/3)g)g))(-8/17))(2/97) assuming g is positive. g(114/1649) Simplify (((hh/h19)/h(-8))(1/7))(-10/9) assuming h is positive. h*(10/7) Simplify k/(kk*(-2/9)k)kk*(-3/8)/k(k/(kk(-6)))(-17) assuming k is positive. k(-7427/72) Simplify (k/(k/(k(1/9)k)))*(2/23)(k(kkk20k)/k)/(k*(-13)k) assuming k is positive. k(7265/207) Simplify (c36c/(((c/(c(-25/4)/c))/c)/c)c)/(((c/c*(-18)c)/c)/c)(-41) assuming c is positive. c(3079/4) Simplify (b9/b(-1/4))/(b/b*(-2/7)b8) assuming b is positive. b(-1/28) Simplify (p/(pp(-2)))/(p(ppp*(1/15))/p)(p(-14)/p)/p(-4) assuming p is positive. p(-166/15) Simplify (f(-3)f)(2/9)/((f/(f/f11))/(f/(f(-3)/f))) assuming f is positive. f(-58/9) Simplify (a/a(-1/5))(-5/4)/(((a/(aa(a/((a(-1/23)a)/a))/aaa)a)/a)/(aa(-2/7))) assuming a is positive. a(727/322) Simplify ((dd/(ddd1dd))(-4)d*(-3/8)/((dddd*(3/4)dd)/dd))(1/5) assuming d is positive. d(47/40) Simplify ((o1)48(o0ooo)(-33))(-7/8) assuming o is positive. o*(357/8) Simplify ((aa*(-6))/(a/(aaaa*(-9)a)))/((a*(-3/8)a)/a19) assuming a is positive. a(59/8) Simplify g/g*(-1)(g/(gg(-6)))/g(gg/((((g/g(-9))/g)/g)/g))/gg(-3/13) assuming g is positive. g(10/13) Simplify (((jj(-7))/j(-2/11))(-24))(-36) assuming j is positive. j(-55296/11) Simplify (ww*(-7)www/w*(-6)www(w(2/3)w)(-50))24 assuming w is positive. w(-1856) Simplify (x5(xx*(-3)/x)/xx2/x(1/3))(-8/15) assuming x is positive. x(-64/45) Simplify (i/i11)/(i(6/11)i)i*1ii/i7i assuming i is positive. i*(-160/11) Simplify (((bbb/b3)/(b/(b/(b(-2)/bb))))2)(-4) assuming b is positive. b*(-16) Simplify (p/((pp/p*(1/3))/p)pp(-2/43))/((p(2/23)/p)/(p/(ppp/(ppp/p(-8))ppp))) assuming p is positive. p(24329/2967) Simplify ((v(-4/3)/((v(-11)/v)/v))(-48))(-4/3) assuming v is positive. v(2240/3) Simplify (ww(-2))(6/17)/((w(www(-9))/w)/(w/(w(-1/13)/w))) assuming w is positive. w*(1928/221) Simplify ((((((ll*(-6)/l)/l)/lll)/l)/(l(-2/7)ll))(-23))36 assuming l is positive. l(50508/7) Simplify (n(-28)n(-12)/n)/(n5n24) assuming n is positive. n(-70) Simplify (c(2/9)c)*44(cc/c4)(-9) assuming c is positive. c(646/9) Simplify (z/((((zz*(-2/3))/z)/z)/z)z22)/(((z(-2/25)/z)/z)/(z/(z/((z/(z/(zz29)))/z))z)) assuming z is positive. z*(4331/75) Simplify ((g/(gg*(-1/6)/g))/((g/(gg*(2/13)gg))/g))/(g(-1/2)gg)(28/9) assuming g is positive. g(-9/26) Simplify (xx*(-1/3)x/x*(3/11)(x(-1))(-5/19))(-3) assuming x is positive. x(-1039/209) Simplify (k*(-2/55)k23)(4/23) assuming k is positive. k(5052/1265) Simplify ((u/u17u)/uu)/uuu*(-9/5)(u/(u/(u5/u)))19 assuming u is positive. u*(296/5) Simplify (c(c/(c/c*18c))/ccc/((c/(cc(-12/17)cc))/c))(-11/5) assuming c is positive. c(-3982/85) Simplify ((q(-10)q)/(q*(-2/63)qq))(-5) assuming q is positive. q(3455/63) Simplify ((k/(k(k*(-10)k)/k))/k(1/14))/((k(-3/13)/kk)/k(-1/13)) assuming k is positive. k(1835/182) Simplify ((((n0/n)/n)/nn)*(-36/5)(nnnnn*0/nn)(3/16))(31/3) assuming n is positive. n(3131/20) Simplify (o(5/4)/oo(4/7)(o*(-1)/ooo)/(oo*(-5/6)ooo))(3/26) assuming o is positive. o(-197/728) Simplify (((x(2/3))(-4/3))(2/9))(-47) assuming x is positive. x(752/81) Simplify (f(-28))(-3/2)/(f(-2/5)/(f/(((f*(-2/33)f)/ff)/f)f)) assuming f is positive. f(7336/165) Simplify ((h/h11)/(h*7hh))/(h11h/(hh(3/2))) assuming h is positive. h(-57/2) Simplify (r(6/5)r)*12/(rrrr*(2/7)rr)(-5/7) assuming r is positive. r(7393/245) Simplify (ii(((i/(i/(i/(ii*(-1/14)))))/i)/i)/ii)(-3)/(i15i)44 assuming i is positive. i(-9859/14) Simplify (((((h/h7)/h)/hh)/h)/h(hh*(-4/7)h)/hh)/(hh*4hh)7 assuming h is positive. h(-396/7) Simplify k(-2/29)/(k/k(-3/5))k*(2/3)(kk(-1))/kk assuming k is positive. k(-436/435) Simplify ((m/m(-9))/m*(-8)m*7m(1/5)/m)(-5/2) assuming m is positive. m(-121/2) Simplify l(-1/61)l(9/2)(ll0)(-14/5) assuming l is positive. l(1027/610) Simplify ((lll(1/11)ll)/(l/l(-4/3)))/(ll/l*(1/3)ll)(-3/16) assuming l is positive. l(1291/528) Simplify (u(18/5)/(u(u*(-9)u)/u))32 assuming u is positive. u(1856/5) Simplify (i(3/4))31/(ii/((i/i(-1/6))/i)i)(-1/2) assuming i is positive. i(74/3) Simplify t*(2/9)t/(t/(t/(t/(ttt/(t*(-7)/tt)))t))(t(1/2)/t)(-38) assuming t is positive. t(272/9) Simplify (i1/(i/i*(-6))i*(2/13)i(1/5))(-3) assuming i is positive. i*(1101/65) Simplify (((p/(p/(p/(pp/(p*(-4/5)p)p))))/pp/p(-2/5))/(p(-2/9)/(pp(-1/2))))35 assuming p is positive. p(-427/18) Simplify ((uuuu/(u*(-1/2)/u)uu/(uu/((u*(-1)u)/u)u))(4/35))(-28) assuming u is positive. u(-56/5) Simplify m(-5/3)m*(-8)(m/(mmm*(-4/11)m))(-1/16) assuming m is positive. m(-2525/264) Simplify ((u(-1/3))45u2uu/u8u)(1/11) assuming u is positive. u(-18/11) Simplify (((cc(2/19)/c)/(cccc/c(-5)))(-37))(-36) assuming c is positive. c(-225108/19) Simplify (k*(2/5)k(1/31))/((k2k)/k(-13)) assuming k is positive. k(-2413/155) Simplify (pp*11pp(-9/2))/((p/(p(-1/4)p))/ppp*(-21)/pp*p) assum	{ "pile_set_name": "DM Mathematics" }
36o)((0 - 5 + 3)(5 + 0 - 3) + 4 + 3 - 4) in the form g + no and give n. 402 Express k + 4k - 3k + (-2 + 2 - 6k)(2 - 2 - 10) + 3k + 0k - k as zk + u and give z. 64 Rearrange -6k + 2k + 3k + (-178k - 140k + 89k)(-1 + 0 + 3) to the form ik + m and give i. -459 Express -1 - v2 - 3152v - 10v3 + 3v*2 - 19v*3 + 3150v in the form rv2 + mv + av3 + c and give r. 2 Rearrange -87d*2 + 75d2 + d3 - 423d4 + 421d*4 + 44d to the form s + qd3 + kd*2 + od*4 + md and give m. 44 Express -18k2 + 10k*2 + 11k*2 - 167 + 479 as f + qk*2 + pk and give q. 3 Rearrange (1 - 4 + 0)(3v*3 + 25v - 27v - 2v*3) + 26v*2 - 26v*2 - 7v*3 to the form dv*3 + x + yv*2 + pv and give d. -10 Rearrange 32 - 28v2 + 88v*2 + 25 - 31v*2 - 26v*2 to nv + uv2 + g and give n. 0 Express 575f - 105f - 252f + 621f as kf + n and give k. 839 Express (-4 + 1 + 1)(18u - 37u + 20u) - 14 - 7u + 14 in the form m + pu and give p. -9 Rearrange (0 + 3 - 5)(158b - 21116 + 21116) + (-4 + 2 + 4)(3 + 2b - 3) to the form db + u and give d. -312 Rearrange (-3i + 3i - i)(4 - 1 - 1) + (5i - 4i + i)(-2 - 5 - 3) - 4i + 7i + 4i - 2i + 4i + 0i to ki + w and give k. -13 Rearrange 56u + 113u - 26u + 18u to lu + c and give l. 161 Express 4s - 9s3 + 7s*4 + 7s*4 - 13s*4 in the form cs*2 + h + gs + ns4 + js*3 and give c. 0 Express (4f*3 - 2f3 - f3)((-1 + 3 + 0)(-2 + 2 + 2) + 1 + 2 + 0) in the form mf + j + rf*3 + if*2 and give m. 0 Rearrange (0p + 4p - 3p)(2p + 0p + 0p)(-1 + 0 - 2)(-12 + 22 + 36) to cp + ap*2 + j and give j. 0 Rearrange -46 - 4s*3 + 98 - s + 4s*4 - 54 + 2s - 3s3 to the form gs*2 + os*3 + zs*4 + ms + n and give n. -2 Rearrange -2v3 + 162v*2 - 90v*2 - 81v*2 + 1 + 2v*4 to the form kv*3 + hv*4 + j + zv*2 + cv and give j. 1 Express y*3 + 0y*2 + 0y*2 + 2y*3 + 0 + 0 + (0y*2 + 0y2 + y2)(2y + 0 + 0) + 67 - 67 - 9y3 in the form xy*3 + o + sy + zy2 and give o. 0 Rearrange -9 + 1 + 10 + 35b*2 to ab + zb2 + m and give m. 2 Express 1 - 13l - 13l + 1 - 115l*3 + 27l in the form w + sl + tl*2 + il*3 and give w. 2 Rearrange -7h*2 - 25h*2 - 3h*3 - 10 + 6 to the form dh + ah3 + qh*2 + t and give a. -3 Express -43 + 6 + 1 + 4069o4 + o3 - 4068o4 in the form ko + yo2 + d + so*3 + bo*4 and give y. 0 Rearrange 56v - 83v - 1 + 37v + 20v to the form r + mv and give r. -1 Rearrange (3a - 2 + 1 - 2a)(23a + 23 - 30 + 13a + (-a - a + 0a)(1 + 3 - 3)) to the form va + ua2 + d and give v. -41 Express x + x + 0x + (-2x - 3 + 3)(2 - 3 + 0) - 218x - 466x + 86x + (-4 + 4 - x)(-4 + 1 + 1) + 1 - 1 + 2x as sx + h and give s. -590 Express -7m2 + m3 + 133m - 5m2 - 134m + (-4 + 7 + m*2 - 4)(3m + 0 + 0) in the form qm + wm3 + c + sm*2 and give s. -12 Rearrange (-2a + a - a)(-261 + 45a + 261 + (-11 - 2a + 11)(0 + 3 - 4)) to w + ma2 + ka and give m. -94 Rearrange 43k - 72k - 98k to mk + c and give m. -127 Express (-4b + b + 0b)(-2 + 2 - b)(-2b + 4b - 6b) as xb + yb3 + ib*2 + d and give y. -12 Express -16j - 26 + 17j + 26 as hj + k and give h. 1 Rearrange (22 + 8 - 3)(2 - 1 + 4)(u + 3u - 2u) to the form ju + r and give j. 270 Express (15q + q - 4q)(7 + 1 + 0)(1 + 6 + 3) in the form mq + f and give m. 960 Rearrange -4 + 12 - 2k2 + 0k2 - k2 to mk + fk*2 + g and give g. 8 Rearrange -5240x - 5877x + 12458x to the form b + ix and give i. 1341 Express (-5f*2 - 2f*2 + 8f*2)(0f2 + 0f*2 - 2f*2) + (-2f + 5f + f)(6f3 - 8 + 8) in the form of*4 + bf*3 + af + y + lf2 and give o. 22 Express -124 + 131 - 3l*4 + 7l*4 + 0l*4 + 4l*2 in the form dl*2 + x + yl + hl3 + jl*4 and give d. 4 Rearrange -1 - 356b*2 + 379b*2 + 3 + (0b + 3b2 + 0b)(4 + 0 - 2) - 2b*2 + 0b*2 + 0b*2 to the form rb + o + kb2 and give o. 2 Rearrange (-268 - 50p + 133 + 129)(-4 + 3 + 2) to the form gp + o and give g. -50 Rearrange (0v - 2v - v)(1 - 1 - v) + (-4 + 4 + 2)((0 + 6 + 0)(v2 + 2v*2 - 4v*2) + 21 - 21 + 15v*2) to the form u + fv + nv2 and give n. 21 Express 0d*2 + 3d*2 - 274d*3 + 248d*3 as f + ad*3 + id + qd2 and give q. 3 Rearrange -2 + 16p*2 + 43p*2 + 16p*2 + 5p*2 to w + hp*2 + jp and give h. 80 Rearrange 15 + 11n2 - 16 + n2 + 6n - 4n to the form jn + p + cn2 and give j. 2 Express (43r + r - 18r + 1)(-4 + 3 + 2)(3 + 28 + 45) as pr + c and give c. 76 Rearrange 562 - 71 + 24 + 2p2 to zp*2 + jp + k and give z. 2 Express (-8d + 67d + 41d)(7 - 4d - 7) as sd + hd2 + u and give h. -400 Rearrange 3384d*4 - 1 + 4 - 2 - 2d*3 - 10d - 3386d4 to pd + wd4 + q + gd*3 + cd*2 and give p. -10 Express 62 + 31b + 10 + 24 + 26b - 56b in the form j + zb and give j. 96 Express (3 + r - 3 + (2r - r - 3r)(0 - 4 + 3))(105r*2 - 195r*2 + 89r*2 + 347) in the form mr + hr2 + jr3 + o and give m. 1041 Rearrange -b4 + 1439 - 719 - 714 - 4b + b3 to the form vb + pb4 + zb*2 + u + nb*3 and give v. -4 Express 3v - 7v + 4 - 2v*3 + 0v*3 - 5v - 39v as bv*2 + cv + mv3 + o and give o. 4 Express -28k + 3 - 55k - 27k - 52k in the form v + mk and give m. -162 Rearrange 447z - 2 + 2 - 81z + 245z to the form wz + c and give w. 611 Express 11t2 - 25t - 107t - 20t*2 + 11t*2 as pt + v + jt2 and give j. 2 Rearrange 12o*3 - 2o + 108o2 + 2o*4 - 17o*3 - 107o*2 + 32o*3 to f + zo*2 + jo*3 + ko + go4 and give j. 27 Express 459z*2 - 8 + 0 - 8 + 16 in the form q + oz*2 + gz and give o. 459 Rearrange -21 - 10 - 9 + 7 + 7a3 to the form ja*3 + pa + sa2 + w and give w. -33 Express (21l - 62l - 60l - 5l)(0 - 4 + 2 + (2 - 4 + 0)(0 - 1 + 4)) in the form m + il and give i. 848 Rearrange 3 + 44w2 - 9w*2 + 10w*2 - 1 to the form qw*2 + yw + a and give q. 45 Rearrange 2o3 - 25o - o*2 + 23 - 24 + 3o*2 + 26o to the form w + do3 + ho + bo2 and give b. 2 Express (-2 + 3 - 3)(8563 - 8563 - 659l) in the form il + x and give i. 1318 Express (12x - 366x - 424x + 1480x)(5 - 5 + 6x) in the form fx + l + bx*2 and give b. 4212 Express 15x - 21x - 6x - 17x - 18x - 23x2 as w + ux + dx2 and give u. -47 Express (w + 0w - 3w)(-36611w - 3 + 38768w + 6) as d + iw + gw*2 and give d. 0 Rearrange 39 - 82 + 12x + 43 + 50x to cx + g and give c. 62 Express -1 + 62w + 7 + 53w - 20w - 4 as b + yw and give b. 2 Rearrange (-4q2 - 16q + 1 + 16q)(5q2 - 13q*2 - 9q*2) to the form tq*4 + p + sq*2 + vq + mq3 and give t. 68 Express (k3 - k2 - 16k2 + k2)(6 + 14k - 6) - 4k4 - k2 + k2 as l + ak*3 + xk + rk4 + jk*2 and give a. -224 Rearrange 205c*2 + 2c*3 + 0 + 2c*4 + 2 - 412c*2 + 23c + 204c2 to the form gc + yc4 + d + nc*3 + qc*2 and give d. 2 Rearrange (5g - g + 1395 - 1425)(4g - 3g + 0g) to the form mg + ig2 + z and give z. 0 Express b + b3 + 2b - 2b + 4b3 as ub + db2 + lb*3 + k and give u. 1 Express (-9 + 14 + 3)(2f + f - 4f)(f + 2f - 4f) in the form n + qf + rf2 and give r. 8 Rearrange 4z2 + z2 - 18406z - 2z*3 - 4z*2 + 18405z - 2 to the form bz2 + kz*3 + hz + w and give b. 1 Express -1 + 22g3 - 27g*3 + 3 + 30g - 26g as xg*2 + f + ug + vg3 and give u. 4 Rearrange -8f - 2f + 12 - 7 to the form m + nf and give n. -10 Rearrange -135 - 200d2 + 636 + 202d*2 to the form b + qd*2 + sd and give q. 2 Express -8 - 4x2 + 19x*2 - x - 3 + 14 in the form ix + px2 + s and give p. 15 Rearrange (-1 - 2 + 5)(0o + 3o - 4o) + 4 - 4 + 6o + 2o + 3o - o + (1 + 3 - 2)(-3o + 4o - 2o) to the form lo + f and give l. 6 Express (0n - 4n - 2n)(-1 + 1 - 2n*2) + (-3n*2 + 0n*2 + 0n*2)(6n + 7n - 15n) as un*2 + d + pn*3 + fn and give p. 18 Rearrange -6 - 2t2 - 2t - 3t3 - 8t*3 + 3t*2 + 3 + 4t to the form m + xt3 + ft + kt2 and give f. 2 Rearrange (-80h + 163h + 111h)(3h - 2h - 3h) to nh2 + ph + l and give n. -388 Rearrange -5z + 9	{ "pile_set_name": "DM Mathematics" }
802n - 3 What is the b'th term of -230, -822, -1582, -2510, -3606? -84b*2 - 340b + 194 What is the u'th term of -1645603, -3291220, -4936837, -6582454? -1645617u + 14 What is the l'th term of 30097, 58141, 86185, 114229? 28044l + 2053 What is the n'th term of 472594, 945189, 1417782, 1890373, 2362962? -n*2 + 472598n - 3 What is the m'th term of 91791381, 91791386, 91791391, 91791396, 91791401, 91791406? 5m + 91791376 What is the p'th term of 413160, 826317, 1239500, 1652721, 2065992, 2479325, 2892732? 2p3 + p2 + 413140p + 17 What is the m'th term of 930260, 1860701, 2791142, 3721583, 4652024? 930441m - 181 What is the r'th term of 2168819, 4337677, 6506557, 8675471, 10844431, 13013449, 15182537, 17351707? 2r3 - r2 + 2168847r - 29 What is the f'th term of -131580249, -131580247, -131580245, -131580243? 2f - 131580251 What is the n'th term of 2576301, 2576298, 2576295? -3n + 2576304 What is the x'th term of -25647, -51020, -76393, -101766? -25373x - 274 What is the u'th term of 221521, 221677, 221929, 222271, 222697, 223201, 223777, 224419? -u3 + 54u*2 + u + 221467 What is the b'th term of 146659, 586791, 1320381, 2347429, 3667935, 5281899, 7189321? 146729b*2 - 55b - 15 What is the q'th term of -5597130, -5597123, -5597112, -5597097, -5597078, -5597055, -5597028? 2q2 + q - 5597133 What is the w'th term of 813774088, 813774084, 813774094, 813774124, 813774180, 813774268, 813774394? w3 + w2 - 14w + 813774100 What is the g'th term of 144471, 144607, 144743, 144879, 145015? 136g + 144335 What is the f'th term of 7397, 29519, 66353, 117899, 184157, 265127? 7356f*2 + 54f - 13 What is the b'th term of 13, -639, -1291, -1943? -652b + 665 What is the h'th term of -5435692, -10871337, -16306982, -21742627, -27178272? -5435645h - 47 What is the i'th term of 2374066, 2374083, 2374114, 2374159, 2374218, 2374291, 2374378? 7i2 - 4i + 2374063 What is the c'th term of 3706, 2677, 1648, 619, -410, -1439? -1029c + 4735 What is the g'th term of -5869, -7884, -9899? -2015g - 3854 What is the p'th term of -550890, -1101777, -1652664, -2203551, -2754438, -3305325? -550887p - 3 What is the r'th term of -18384, -36687, -54986, -73287, -91596, -109919? -r3 + 8r*2 - 18320r - 71 What is the m'th term of -391888, -3134940, -10580300, -25079122, -48982560, -84641768? -391859m3 - 39m + 10 What is the k'th term of 21896151, 43792302, 65688453, 87584604? 21896151k What is the h'th term of 284565, 2276574, 7683457, 18212652, 35571597, 61467730, 97608489, 145701312? 284573h3 - h2 + h - 8 What is the f'th term of -35747314, -35747289, -35747264, -35747239? 25f - 35747339 What is the m'th term of 3950, 15835, 35632, 63341, 98962, 142495, 193940? 3956m*2 + 17m - 23 What is the g'th term of 6182023, 6182022, 6182021, 6182020, 6182019? -g + 6182024 What is the k'th term of -13611, -55982, -127119, -227022, -355691? -14383k2 + 778k - 6 What is the c'th term of -7556, -7491, -7388, -7253, -7092, -6911, -6716, -6513? -c*3 + 25c*2 - 3c - 7577 What is the a'th term of -29198644, -29198643, -29198642, -29198641? a - 29198645 What is the d'th term of 266882, 266829, 266770, 266699, 266610, 266497, 266354, 266175? -d*3 + 3d*2 - 55d + 266935 What is the g'th term of -556134, -556090, -556046, -556002, -555958? 44g - 556178 What is the b'th term of -3855, -7775, -11687, -15585, -19463, -23315, -27135, -30917? b3 - 2b*2 - 3921b + 67 What is the v'th term of 25, -88, -329, -728, -1315, -2120? -5v3 - 34v*2 + 24v + 40 What is the j'th term of 209467, 418728, 627989, 837250, 1046511, 1255772? 209261j + 206 What is the h'th term of -7746, -67473, -231118, -550641, -1078002, -1865161, -2964078? -8660h3 + h2 + 890h + 23 What is the q'th term of 29941, 30077, 30301, 30613, 31013, 31501? 44q*2 + 4q + 29893 What is the d'th term of 370, 935, 1746, 2797, 4082, 5595? -d*3 + 129d*2 + 185d + 57 What is the w'th term of 16420, 19332, 24186, 30982, 39720, 50400, 63022? 971w2 - w + 15450 What is the u'th term of -28467, -28623, -28779, -28935? -156u - 28311 What is the v'th term of 312232, 624446, 936660, 1248874? 312214v + 18 What is the o'th term of 193196010, 386392022, 579588034, 772784046? 193196012o - 2 What is the s'th term of -160993849, -160993848, -160993847, -160993846? s - 160993850 What is the m'th term of -1007, -1872, -2579, -3128, -3519, -3752? 79m2 - 1102m + 16 What is the d'th term of -101042081, -101042080, -101042079, -101042078, -101042077? d - 101042082 What is the i'th term of -5433, -9502, -13569, -17634? i*2 - 4072i - 1362 What is the a'th term of -66722, -266815, -600296, -1067159, -1667398, -2401007, -3267980? a*3 - 66700a2 - 23 What is the q'th term of 4326, 4116, 3904, 3690, 3474, 3256, 3036? -q2 - 207q + 4534 What is the s'th term of 315, 2876, 9859, 23484, 45971, 79540, 126411, 188804? 370s*3 - 9s*2 - 2s - 44 What is the o'th term of 7051814, 14103607, 21155400, 28207193, 35258986, 42310779? 7051793o + 21 What is the a'th term of 1334048, 2668078, 4002108, 5336138? 1334030a + 18 What is the u'th term of -23754213, -23754213, -23754203, -23754177, -23754129, -23754053? u3 - u2 - 4u - 23754209 What is the p'th term of 280156, 560292, 840428, 1120564, 1400700? 280136p + 20 What is the d'th term of -5917, -12145, -18373? -6228d + 311 What is the a'th term of -19319, -78163, -176533, -314429, -491851, -708799? -19763a*2 + 445a - 1 What is the d'th term of 2781, 1631, 459, -747, -1999, -3309? -2d3 + d2 - 1139d + 3921 What is the u'th term of 9856, 32273, 69634, 121939, 189188, 271381, 368518? 7472u2 + u + 2383 What is the k'th term of -148795, -595197, -1339193, -2380777, -3719943, -5356685? k3 - 148803k*2 + 7 What is the l'th term of -482, -1032, -1586, -2144, -2706? -2l*2 - 544l + 64 What is the p'th term of 7849451, 15698904, 23548361, 31397822? 2p2 + 7849447p + 2 What is the z'th term of 302, 2009, 6598, 15497, 30134, 51937, 82334, 122753? 238z3 + 13z*2 + 2z + 49 What is the f'th term of -49341, -49885, -50429, -50973? -544f - 48797 What is the b'th term of -48256, -96535, -144838, -193165, -241516, -289891? -12b*2 - 48243b - 1 What is the h'th term of -154598874, -154598878, -154598884, -154598892, -154598902, -154598914? -h*2 - h - 154598872 What is the t'th term of 321747, 321741, 321731, 321717, 321699, 321677? -2t2 + 321749 What is the g'th term of 4058, 16262, 36594, 65048, 101618? -g3 + 4070g2 + g - 12 What is the l'th term of 2489, 4837, 7203, 9599, 12037, 14529, 17087? 2l*3 - 3l*2 + 2343l + 147 What is the o'th term of -261973528, -523947053, -785920578? -261973525o - 3 What is the i'th term of -1387627, -1387640, -1387661, -1387690, -1387727? -4i2 - i - 1387622 What is the v'th term of -18758, -37487, -56204, -74903, -93578? v3 - 18736v - 23 What is the w'th term of 2470701, 2470708, 2470715, 2470722, 2470729, 2470736? 7w + 2470694 What is the t'th term of 1548, 1487, 1426, 1365? -61t + 1609 What is the a'th term of 4540, -3890, -17948, -37640, -62972, -93950, -130580? -a3 - 2808a2 + a + 7348 What is the d'th term of 47163196, 47163201, 47163218, 47163253, 47163312, 47163401? d3 - 2d + 47163197 What is the o'th term of 15851882, 15851861, 15851826, 15851777, 15851714, 15851637? -7o*2 + 15851889 What is the w'th term of -3492, -9714, -15936, -22158, -28380? -6222w + 2730 What is the n'th term of -21602, -30791, -39980? -9189n - 12413 What is the y'th term of -8293, -15613, -22933, -30253, -37573, -44893? -7320y - 973 What is the x'th term of 13764791, 13764793, 13764795, 13764797, 13764799, 13764801? 2x + 13764789 What is the h'th term of 15283, 15360, 15489, 15670? 26h2 - h + 15258 What is the z'th term of 8433, 6768, 4027, 216, -4659, -10592, -17577? z3 - 544z2 - 40z + 9016 What is the v'th term of -22649, -25385, -28121? -2736v - 19913 What is the w'th term of 1166990, 1166989, 1166982, 1166963, 1166926, 1166865? -w3 + 3w*2 - 3w + 1166991 What is the d'th term of 4427, 16741, 35533, 59387, 86887, 116617, 147161, 177103? -236d3 + 4655d**2 + d + 7 What is the y'th term of 108039, 432178, 972415, 1728756, 2701207, 3889774, 5294463, 6915280? y	{ "pile_set_name": "DM Mathematics" }
(-37)/63 - 12/216-8? -1/7 What is (-5(-9)/45)/((-2)/(-8))? 4 What is the value of (-1)/2 + (-2)/(8/(-6))? 1 Calculate (497/(-35) + 14)/(6/(-5)). 1/6 What is 72/154 + (-30)/105? 2/11 Evaluate 3 + 4 + 160/(-25) + 0. 3/5 (3/2)/(18/(-120)2) -5 Calculate (-99)/665/(-3). 5/2 Evaluate 13/3 - (20/(-3) - -7). 4 ((-5)/(-3))/(8/12 + -1) -5 18/(-243) - (-520)/(-270) -2 What is (2(15/54)/5)/(-1)? -1/9 What is the value of (5 + -2)/(0 + 1)? 3 ((-287)/(-35) - 7)/((-6)/(-20)) 4 Evaluate (1 - 2)-2 - (-692)/(-519). 2/3 -1 + (1 - -4)/5 0 Evaluate ((-30)/210)/(((-1)/(-7))/(-1)). 1 Evaluate (136/(-84))/173. -2/7 What is (-6)/(-7)((-315)/(-30))/21? 3/7 What is -71/(-21)3? 1 Evaluate 11/9 + (-52)/234. 1 What is (4/6)/((-16)/96) - -5? 1 Evaluate ((-1)/((-3)/2))/(1340/(-603)). -3/10 1/(6/(-4 + 10))1 1 Evaluate (-5 - -7 - 1)(-6)/15. -2/5 Calculate -2 + 4/(-24)-4. -4/3 Calculate 340/1275(-10)/28. -2/21 -9(-4)/182 4 What is the value of (28/(-20) + 1)(4 + 1)? -2 ((-2)/4)/((-11)/11) 1/2 Evaluate ((-140)/15)/(120/(-90)). 7 What is the value of -10 + 7 + 8 - 32/6? -1/3 Evaluate 812/(-87)3/(-4). 7 Calculate (0 + -2)-2(-293)/2930. -2/5 What is the value of 16/(-5) - -1 - (-11 + 9)? -1/5 Calculate (208/234)/((-8)/(-6)). 2/3 What is (1 + 0)/((-164)/1148)? -7 Evaluate -344/48. -1 What is the value of (30/20)/((-18)/8)? -2/3 What is the value of 5/(-50)(-2 - -4)? -1/5 Calculate 12/(-30)(-15)/21. 2/7 What is the value of (-22)/4468/(-429)? 6 What is (-22)/(-16) + (9/(-24) - 0)? 1 Evaluate (3 + 105/(-45))9/(-33). -2/11 Evaluate (-93)/(-21)1 - (-28)/49. 5 Evaluate -3 + (4 + (-9)/3)4. 1 (-8)/1171/342 -4 Calculate (35/14)/((-172)/48 + 4). 6 (-546)/(-168) - (-6)/8 4 What is the value of -3 + 6/3 + 0/(-7)? -1 Calculate (1(-3)/(-18))/(1/(-3)). -1/2 What is 1-4(-2)/88? 1/11 Evaluate (-2)/(-3)(-4 - (-100)/16). 3/2 Evaluate 1((-60)/(-4) + (1 - 9)). 7 Evaluate (-25)/10(-3 + (-69)/(-15)). -4 Calculate ((49/(-35))/1)/(5/(-5)). 7/5 Calculate 8/(-44) - (-75)/(-11). -7 Calculate (-34)/(-10) - (-5 - (-54)/10). 3 Calculate 12/20 + 63/(-30). -3/2 Calculate -3 - (1 - (2 - -3)) - 6. -5 What is (12(2 - 1)/(-2))/2? -3 What is 29/22 + (-13)/(143/(-2))? 3/2 Evaluate 41(-675)/450. -6 What is the value of (-4)/(-12) + (-2)/9? 1/9 What is the value of 5/(-2)(-16)/20? 2 What is 2/(-6) - (0 + 66/(-306))? -2/17 Evaluate (3/4)/(360/96). 1/5 1-1 - (-8)/14421 1/6 Evaluate (20/(-65))/(10 + -8). -2/13 Calculate (18/15)/(-1) + (-57)/(-60). -1/4 What is the value of -9 + 94/18 - (-2)/(-9)? -4 What is (-20)/(-6) - 291/97? 1/3 Calculate 2(-3)/72-4. 1/3 Calculate -3 - (0 + 6/4-2). 0 (5124/(-300) - -17)/(14/10) -2/35 Evaluate (20/30)/(2/(-3)). -1 Evaluate (54/(-756))/(2/12). -3/7 Calculate (-12/18)/(28/(-56)). 2/9 What is (-9 - -13) + (1 - -1)/(-2)? 3 What is 42/(-35) + 384/270? 2/9 What is the value of 72/288 + -139/12? -3 436/(-190) + 2 + 12/30 2/19 What is 1/(-2) + (-5)/(30/(-27))? 4 What is 0 - 2/9 - 88/(-72)? 1 What is (10/(-35))/((-6)/14)? 2/3 What is (-9 - 2) + 3 + -1 + 3? -6 What is (3/(-9))/(1/(-3))? 1 Evaluate (-1)/(-1)(-2 - 13 - -11). -4 What is the value of 72/45(-5)/2? -4 Calculate 10/(-12) - 25/(-75). -1/2 What is 15/(-27)2/5? -2/9 11/66 - (-33)/18 2 What is the value of 1(5 - 2) + -69 + 68? 2 0/(4 - (-20)/(-4)) 0 What is (-200)/(-75) - 2/3? 2 What is 2/16 - (3 + 324/(-96))? 1/2 37/(-18)-3 - 6 1/6 What is ((-1)/(-14))/((-4)/(-42)) + 0? 3/4 3/(72/124) + -5 1/6 (-275)/(-33) + -11 - -12 -2/3 What is -5(-2)/44/20? 1/2 4 - (-6 - 3/((-12)/28)) 3 43/(-12)4 -4 What is the value of ((-6)/(-4))/(56/20)? 1 What is (-6)/(-4) - ((-375)/(-40))/5? -3/8 What is the value of (-205)/49218/(-10)? 3/4 Evaluate 6 - (6 + (-264)/18)/(-2). 5/3 (15/20)/(42/448) + -1 7 (-36)/(-10) - (6 - (-2 + 5)) 3/5 0 - (4 + -1) - -3 0 Calculate (-468)/(-182) + (-12)/(-28). 3 What is the value of (-4)/(-2 + -6 + -10)? 2/9 What is the value of (28/70)/(1/((-15)/42))? -1/7 What is the value of -27(-4)/12 - (0 + 5)? 4 What is 2/(-4) + 5/(-6)? -4/3 What is the value of (16/10)/(122/(-305))? -4 What is (-6 - -2)/(-2) - (-390)/(-210)? 1/7 Calculate (-7)/((-14)/3)(-32)/(-12). 4 What is the value of -3 + (6 + -2 - 2)? -1 Calculate 444/(-306) + 2 - 4/6. -2/17 What is the value of -18 - -21 - (-71)/(-23)? -2/23 What is the value of ((-45)/6)/(-1(-2 + -4))? -5/4 Evaluate 3/(-12) + 4510/72. 6 What is the value of (2 - 65/30)/((-6)/(-54))? -3/2 What is (9(-40)/30)/(6/(-4))? 8 What is (-5)/(-1) - 2/2? 4 What is (13 - 16) + (8 - 1)? 4 What is the value of 0/2 - (-6 + (-360)/(-64))? 3/8 What is the value of ((-16)/18)/(-9(-4)/(-324))? 8 What is the value of (2 - 17)/(10/(-4))? 6 (-95)/(-60) + 14/(-189)-9 9/4 What is (-1)/(-4) - ((-328)/(-32) - 10)? 0 What is the value of (-2)/(-12)-11 - 100/(-60)? -1/6 ((-13)/4 - -4)/((-9)/72) -6 Calculate ((-1)/(-3))/(-9 + 963/108). -4 What is the value of 0/1 - ((-405)/30 + 13)? 1/2 What is the value of -1 + (6/15 - 17/5)? -4 (9/(-44 - -8))/(7/(-4)) 1/7 What is (6/(-4))/(-78(-9)/72)? -2/13 What is the value of (61 - 68) + (-52)/(-6)? 5/3 What is the value of (-43)/(-6) + (-118 - -111)? 1/6 What is -1 + 390/48 - 7? 1/8 (2/(4/27))/((-894)/(-298)) 9/2 144/1682/6 2/7 (6/(-21))/(-6(-11)/(-462)) 2 What is (-14)/35 - (-6)/((-360)/(-39))? 1/4 What is the value of (-4 - -5)((-40)/14 - -2)? -6/7 24/(-1980)-115/(-3) -2/9 2/4((-4896)/85)/(-24) 6/5 Calculate 48/(-192)8/(-18)-1. -1/9 Evaluate (8/(-9))/4(-3)/(-2). -1/3 What is 1/(-2) + (-1)/6? -2/3 48/(-44)3/6 -6/11 Evaluate -165/(-10) - 6. 2 ((-440)/(-110))/((-1)/2) -8 -3 - 1 - (11 + 918/(-63)) -3/7 (-64)/(-14) - (10 + -6) 4/7 Calculate (22/55)/(142/15). 1/7 What is the value of (-36)/6 - (-3 - 1) - -5? 3 (-9)/3 + -6 + 10 1 Evaluate 0/((-2)/4(-5 - -3)). 0 What is (10/(-50))/(5/5)? -1/5 Calculate 3(45/27 - 1)1. 2 What is the value of (-15 - 31/(-2))0/(-1)? 0 Evaluate (-40)/2454/(-45). 2 Evaluate (-6)/18 - 2/(-18)1. -2/9 Calculate (5 - (-20)/(-5)) + 7/(-6). -1/6 Evaluate 276/(-26) - -6. 2/13 What is 4/(-30) - 3149/(-1005)? 3 What is (3/15)/(16/(-20))? -1/4 What is the value of 0 - (11/(-7) - (6 + -7))? 4/7 What is the value of 16/(-416)(-1 + 5)/1? -2/13 Calculate (6/(-10) - 1/(-5))-5. 2 Calculate (288/88)/(-18) - 70/(-22). 3 -7(-22)/(-231)3/(-7) 2/7 Evaluate 2/(-17) + (-252)/(-119). 2 (-8)/4 + (-3)/(1/1) -5 ((-264)/40 + 7)10 4 Evaluate (546/18)/(-7) - -4. -1/3 Calculate 31/(-15)10/3. -2/3 Calculate 6/(-15) + ((-88)/20)/(-1). 4 Evaluate 2/66/7. 2/7 (56/21 + -2)(-3)/5 -2/5 4((-12 - -7) + 4)1 -4 Evaluate (0 - 4) + 2(-36)/(-20). -2/5 What is the value of (-1 + 0)/((2-1)/(-2))? -1 Calculate (-46)/8 - ((-38)/8 + 4). -5 Calculate (-46)/42 - (2 + (-88)/42). -1 (12/(-9))/((-130)/117) 6/5 What is the value of (-11)/(-33)(3 + 0)? 1 Evaluate ((-20)/(-24) - 1)(-12)/16. 1/8 What is -8 + 26 + -13 + -15? -10 Evaluate 135/180 - ((-4)/3 - -2). 1/12 (2 + (-12)/(-9))9/6 5 What is 14/78 - 1411/(-1001)? 1/3 What is (-6)/9((-2)/(-2) - -2)? -2 What is the value of (-6 + (-2 - -5))/1? -3 (-1(-4)/12)/((-11)/(-6)) 2/11 What is (-116)/14 + (-168)/(-21)? -2/7 Evaluate 0 - -1 - (45/10 - 4). 1/2 Evaluate ((-6)/105)/(5/25). -2/7 What is the value of (-4)/(-10) - (-345)/75? 5 What is the value of (-4)/(-54)-3(-483)/(-322)? -1/3 Calculate (1/10)/((-6)/(-15))2. 1/2 10 - ((-7)/14 - 7/(-2)) 7 What is the value of -46/(-9)3/(-14)? -4/7 What is the value of 8/(-9)(-1332)/(-296)? -4 What is (-44)/(-12) - 4 - -1? 2/3 What is 1/2 + (-3)/12? 1/4 18/(-5) + 72/24 -3/5 Evaluate 2(-4)/32 - (-17)/4. 4 Calculate 3(86/30 - 3). -2/5 What is the value of (-26 + 16)/((-4)/(4/(-2)))? -5 What is the value of 49/(-42) + 1 + (-62)/(-84)? 4/7 Calculate (-8)/(-6) + 26/(-6). -3 (-1)/(-4)22 + -5 1/2 (-51)/(-21) - (0 - (-4)/2) 3/7 What is the value of 35/28(-3 - (-1)/(-1))? -5 (-66)/(-60)2 + 8/(-4) 1/5 What is the value of (-8)/(-48)12 - (-12)/(-2)? -4 What is the value of 7 - ((7 - 5) + 2)? 3 What is the value of 4/(-3)21/(-308)2? 2/11 30/2255/1 2/3 What is (3/(-24))/(-2(-3)/36)? -3/4 What is the value of 2 + (8 + -14)2/4? -1 What is 553/(-79) + 9/2? -5/2 Evaluate (18/24)/(12/(-64)). -4 Calculate 2/16 + (3223/264 - 12). 1/3 Evaluate 10/3(-192)/128. -5 Evaluate (-374)/(-88) + 4/(-1). 1/4 What is the value of (-2 - -3)/(5/(-6)3)?	{ "pile_set_name": "DM Mathematics" }
rkmz. 1/21 Calculate prob of picking 3 z when three letters picked without replacement from {e: 7, z: 3}. 1/120 Two letters picked without replacement from {s: 2, w: 1, m: 1}. Give prob of picking 1 s and 1 w. 1/3 Calculate prob of picking 2 y and 1 v when three letters picked without replacement from {f: 2, v: 3, y: 4}. 3/14 Calculate prob of picking 1 j and 1 h when two letters picked without replacement from {h: 1, m: 2, j: 1}. 1/6 Four letters picked without replacement from {v: 4, o: 15}. Give prob of picking 1 o and 3 v. 5/323 Two letters picked without replacement from {h: 1, q: 2, x: 1, z: 2, y: 1, w: 2}. Give prob of picking 2 z. 1/36 Three letters picked without replacement from lmmnhxhhlmr. What is prob of picking 1 l and 2 m? 2/55 What is prob of picking 1 t and 1 e when two letters picked without replacement from tie? 1/3 What is prob of picking 1 g and 1 k when two letters picked without replacement from gtkkgggtttktzkgktttt? 5/38 Two letters picked without replacement from {h: 6, w: 10, u: 4}. Give prob of picking 2 h. 3/38 Two letters picked without replacement from {e: 3, o: 2, a: 5}. Give prob of picking 2 o. 1/45 Two letters picked without replacement from {v: 8, t: 8, q: 1}. Give prob of picking 1 q and 1 v. 1/17 What is prob of picking 2 q and 1 u when three letters picked without replacement from wqfqqwqu? 3/28 What is prob of picking 1 v and 1 b when two letters picked without replacement from {b: 2, n: 3, d: 7, f: 3, i: 3, v: 1}? 2/171 What is prob of picking 2 i and 1 u when three letters picked without replacement from uuuiuuiu? 3/28 Calculate prob of picking 1 w, 1 g, and 2 x when four letters picked without replacement from xyygigyxgxwxgwxwxi. 1/17 Two letters picked without replacement from {w: 6, g: 2}. Give prob of picking 1 w and 1 g. 3/7 Three letters picked without replacement from {n: 2, j: 3, i: 1, q: 1, v: 5}. Give prob of picking 2 n and 1 i. 1/220 Calculate prob of picking 2 n and 2 z when four letters picked without replacement from {n: 7, j: 2, z: 2}. 7/110 Three letters picked without replacement from nnlllpplnlnl. What is prob of picking 3 l? 1/11 Calculate prob of picking 2 o when two letters picked without replacement from {o: 12, b: 7}. 22/57 Calculate prob of picking 1 q and 1 n when two letters picked without replacement from {g: 4, u: 1, c: 4, n: 5, q: 1, b: 3}. 5/153 Three letters picked without replacement from {l: 8, h: 3, i: 2, a: 1, s: 1, w: 2}. What is prob of picking 1 i, 1 s, and 1 a? 1/340 Calculate prob of picking 1 i and 1 f when two letters picked without replacement from bbsifbsabsisaffsf. 1/17 Calculate prob of picking 1 a and 1 m when two letters picked without replacement from mxaxaxmmamaxxmxmm. 7/34 Three letters picked without replacement from egfeemellmeefgf. What is prob of picking 2 l and 1 g? 2/455 Two letters picked without replacement from {b: 1, x: 2, e: 2, a: 1}. Give prob of picking 1 b and 1 x. 2/15 Calculate prob of picking 4 o when four letters picked without replacement from {o: 9, h: 9}. 7/170 Four letters picked without replacement from eeeleeeoeeeeeo. What is prob of picking 2 e, 1 l, and 1 o? 10/91 Three letters picked without replacement from kikkiiiiiiiiiikiiik. What is prob of picking 3 k? 10/969 What is prob of picking 1 k and 1 p when two letters picked without replacement from {p: 4, w: 6, k: 2, c: 1}? 4/39 Calculate prob of picking 1 b and 3 q when four letters picked without replacement from {t: 1, q: 1, b: 2}. 0 Three letters picked without replacement from yyyjyjyjjjjyyyyjyyy. Give prob of picking 3 j. 35/969 What is prob of picking 1 y and 2 w when three letters picked without replacement from wywwwwwwwwwywwwwyw? 105/272 Calculate prob of picking 2 d when two letters picked without replacement from {v: 1, h: 1, d: 1, w: 3, m: 1}. 0 Three letters picked without replacement from aaaeaeeeaeaeaaeeae. Give prob of picking 3 a. 7/68 Calculate prob of picking 1 i and 2 o when three letters picked without replacement from niniiodiiondoni. 18/455 Calculate prob of picking 1 p, 2 q, and 1 r when four letters picked without replacement from pqpqrqp. 9/35 Calculate prob of picking 1 c and 2 x when three letters picked without replacement from xububbbcxxcbxbvvbxb. 20/969 Two letters picked without replacement from {n: 1, k: 2, d: 4, o: 1}. Give prob of picking 2 d. 3/14 Four letters picked without replacement from {m: 1, k: 1, f: 3}. What is prob of picking 1 k and 3 f? 1/5 Two letters picked without replacement from ghhhr. Give prob of picking 1 h and 1 g. 3/10 What is prob of picking 1 f and 1 s when two letters picked without replacement from {a: 3, w: 1, e: 1, s: 2, f: 7}? 2/13 Three letters picked without replacement from uccxxpxxpppxqxu. What is prob of picking 1 p and 2 u? 4/455 What is prob of picking 2 z when two letters picked without replacement from {z: 13, i: 6}? 26/57 Calculate prob of picking 4 q when four letters picked without replacement from {q: 4, n: 3}. 1/35 What is prob of picking 1 j and 1 h when two letters picked without replacement from {j: 1, h: 2, y: 1, g: 10}? 2/91 What is prob of picking 3 a when three letters picked without replacement from {v: 5, w: 3, f: 1, a: 11}? 11/76 Two letters picked without replacement from zzqzzzqq. Give prob of picking 2 q. 3/28 Three letters picked without replacement from nannanxxannnnana. Give prob of picking 2 n and 1 a. 9/28 What is prob of picking 3 e when three letters picked without replacement from eeeheeehchehkek? 8/65 Calculate prob of picking 1 u and 1 r when two letters picked without replacement from {l: 1, u: 1, r: 8, w: 7}. 1/17 Three letters picked without replacement from hjujhjjhhhqhuhhjhq. Give prob of picking 1 u, 1 h, and 1 q. 3/68 Calculate prob of picking 2 j, 1 f, and 1 u when four letters picked without replacement from {u: 1, f: 3, j: 13}. 117/1190 Calculate prob of picking 1 m and 1 q when two letters picked without replacement from {q: 1, f: 2, m: 1, e: 1, z: 2, n: 2}. 1/36 Three letters picked without replacement from nnexnxnefjfeenjenn. What is prob of picking 3 e? 5/408 Calculate prob of picking 2 f and 2 t when four letters picked without replacement from {t: 7, f: 5}. 14/33 What is prob of picking 1 w and 1 h when two letters picked without replacement from {j: 2, w: 1, b: 5, h: 4, t: 2}? 4/91 Calculate prob of picking 1 o and 2 l when three letters picked without replacement from {n: 1, l: 2, o: 2, i: 4}. 1/42 Three letters picked without replacement from {h: 2, f: 1, n: 1, o: 1, a: 2, j: 2}. What is prob of picking 1 n, 1 a, and 1 f? 1/42 Two letters picked without replacement from {c: 2, l: 2, n: 1, b: 6}. Give prob of picking 1 l and 1 b. 12/55 Four letters picked without replacement from {g: 2, r: 2, p: 6, u: 3}. Give prob of picking 2 r and 2 p. 3/143 Calculate prob of picking 1 r and 1 s when two letters picked without replacement from {r: 3, s: 2}. 3/5 Calculate prob of picking 1 k and 1 f when two letters picked without replacement from {f: 7, k: 4, l: 1, b: 2}. 4/13 What is prob of picking 2 s when two letters picked without replacement from sssjujusjuusssuuju? 7/51 Four letters picked without replacement from kpvepqqvhqp. What is prob of picking 1 e, 1 p, 1 q, and 1 h? 3/110 What is prob of picking 1 f and 2 y when three letters picked without replacement from fymmyfmf? 3/56 Four letters picked without replacement from gggogtsugggg. Give prob of picking 1 u, 2 g, and 1 o. 28/495 Three letters picked without replacement from wwcwcwwwcwcwwccwwww. What is prob of picking 3 w? 286/969 Three letters picked without replacement from {p: 2, l: 5, a: 3}. What is prob of picking 1 l, 1 a, and 1 p? 1/4 Three letters picked without replacement from {w: 2, v: 6, k: 2, n: 1}. What is prob of picking 1 n, 1 k, and 1 v? 4/55 What is prob of picking 2 v when two letters picked without replacement from {k: 8, v: 2, d: 2, n: 2}? 1/91 Calculate prob of picking 1 r and 1 u when two letters picked without replacement from cbucqrq. 1/21 What is prob of picking 2 w when two letters picked without replacement from scwccwwcc? 1/12 Calculate prob of picking 2 h when two letters picked without replacement from hhchchhuhchu. 7/22 What is prob of picking 1 c and 1 y when two letters pi	{ "pile_set_name": "DM Mathematics" }
713c2 + 29090c*2 + 4. -12c*2 Collect the terms in 2f - 4624f2 + 5f + 3f - 10f. -4624f2 Collect the terms in 159528106r*2 - 54979848r*2 + 121326024r*2. 225874282r*2 Collect the terms in 37a*2 - 2114 + 1058 + 46a*2 + 1056. 83a*2 Collect the terms in 276f*3 - 6f + 2f2 - 29f + 84f3. 360f*3 + 2f*2 - 35f Collect the terms in 4h2 - 4221h + 4291h + 4h*3 + 4h*2. 4h*3 + 8h*2 + 70h Collect the terms in 23683f - 46173f + 24107f. 1617f Collect the terms in 193q2 - 334q + 801q + 88q*2 - 467q - 171q2. 110q*2 Collect the terms in -91a*3 - a + 27a*3 + a - 5a + 39a3. -25a*3 - 5a Collect the terms in -704q3 + 5q - 610q3 + 20q*3 - 2q. -1294q3 + 3q Collect the terms in 2 - 4006q - 2 - 3934q + 7941q. q Collect the terms in -1493 - s2 + 596 + 225 + 221 + 228 + 223. -s2 Collect the terms in -837w*2 + 41214w + 41214w - 82426w. -837w2 + 2w Collect the terms in -643n + 142 + 210n + 3n3 + 219n + 53n2 + 214n. 3n3 + 53n*2 + 142 Collect the terms in -14q - 192291345385727 + 192291345385727. -14q Collect the terms in 341c + 43277c + 9510c. 53128c Collect the terms in 371u - 118u - 205u - 118u. -70u Collect the terms in 58z3 - 198z*3 + 20z*3 - 15z*3 + 38z*3. -97z*3 Collect the terms in 3974p - 8009p + 3612p. -423p Collect the terms in 9442474m - 1 + 7428644m - 9m*2 + 8m2. -m2 + 16871118m - 1 Collect the terms in 7l*3 - 9l*3 + 3563l*2 - 3l*3 + 7l*3 - 3568l*2. 2l*3 - 5l*2 Collect the terms in -5691r - 11693r + 17391r. 7r Collect the terms in 93d - 1917d - 108626 + 108626. -1824d Collect the terms in 1262 + 2t + 1495 - 3294. 2t - 537 Collect the terms in -2u3 + 127u - 4 + 4 - 192u2 - 129u. -2u3 - 192u*2 - 2u Collect the terms in -268v + 74 - 53v*3 + 266v + 38v3. -15v*3 - 2v + 74 Collect the terms in 3j2 - 2650j + 85j + 546j + 2j2 + 433j + 473j. 5j*2 - 1113j Collect the terms in -5216 + 2606 + 477f + 2607. 477f - 3 Collect the terms in -9405w2 + 693w*2 - 3181w*2 + 1018w*2. -10875w*2 Collect the terms in -373515 - 66b + 2b2 + 373515 + 0b*2. 2b*2 - 66b Collect the terms in -517 + 282 + 2x + 2291x*2 + 234. 2291x*2 + 2x - 1 Collect the terms in -34360 + 4102 + 8b + 38b. 46b - 30258 Collect the terms in 12 - 4 + 462f - 39f2 - 1401f + 468f + 2f*2 + 469f. -37f2 - 2f + 8 Collect the terms in 65g - 17g - 15g - 15g - 9g - 10g - 4g. -5g Collect the terms in -3r2 - r2 + 397926117 + 4r*2 - 397926113 + 19r*3. 19r*3 + 4 Collect the terms in -10w*2 + 3w - 19w2 - 11w*2 + 163. -40w*2 + 3w + 163 Collect the terms in -7f + 2f - 2f + 1032516805f*3 + 8f - f - 1032516826f3. -21f*3 Collect the terms in -17266h + 2607h + 2922h + 7400h. -4337h Collect the terms in -42810 - 42805 + 128430 - 42815 + 16t - 10t. 6t Collect the terms in -11998u + 2 - 12124u + 35813u - 11910u. -219u + 2 Collect the terms in 24y3 + 625111250y - 625111250y. 24y*3 Collect the terms in -201i*2 + 947i*2 - 2i - 182 + 31. 746i2 - 2i - 151 Collect the terms in -40318 - 40887t + 40318 - 4t*2. -4t*2 - 40887t Collect the terms in -9982 - 9966 + 7l + 49827 - 9974 - 9935 - 9970. 7l Collect the terms in 6 - n2 + n2 + 2n2 - 538n*3 + 570n*3. 32n*3 + 2n*2 + 6 Collect the terms in -6157895g - 16g2 + 6157895g - 2. -16g2 - 2 Collect the terms in -180r + 21 - 150r - 150r - 4r - 12r. -496r + 21 Collect the terms in 311 + 308 + 299 - 34m - 920 + 11m. -23m - 2 Collect the terms in 90 + 96 - 186 + 1092049q. 1092049q Collect the terms in -79 + 16l + 11l + 21l - 36l. 12l - 79 Collect the terms in 1176472l - 588461l - 588011l - 3l3 + 0l*3. -3l*3 Collect the terms in c + 32c + 10c + 6c + 48c. 97c Collect the terms in 4m + 6880861383 - 20m*3 - 6880861383. -20m*3 + 4m Collect the terms in 6l2 + 94 + 3l*2 + 7l*2 - 16l*2 - 424l*3 + 427l*3. 3l*3 + 94 Collect the terms in -26 + 55i - 100i + 15 + 11 + 21i. -24i Collect the terms in -10787492c*2 - 10787494c*2 + 21574978c*2. -8c*2 Collect the terms in -2t + 33t - 18t + 1738t2 - 13t. 1738t2 Collect the terms in 26m*2 - 55m*3 + 77m + 69m3 - 12m*3 - 26m*2. 2m*3 + 77m Collect the terms in -231 + 132 + 72 + 0d - 2d. -2d - 27 Collect the terms in -1 - 398421404d + 0 - 1 + 398421497d. 93d - 2 Collect the terms in -947r3 + 212r*2 + 5 + 5 - 212r*2 + 921r*3 - 10. -26r*3 Collect the terms in 23347460786153g + 0g2 - 2g*2 + 0g*2 - 23347460786153g + 3g2. g2 Collect the terms in 23y*2 - 42y*2 + 12y*2 + 156y + 9y2 + 19. 2y*2 + 156y + 19 Collect the terms in -62895n3 - 524872n*3 - 874663n*3. -1462430n*3 Collect the terms in 5522 + 114c*2 - 5522 - 18c. 114c2 - 18c Collect the terms in 12 - 14 - 35n2 - 42172n + 34n2 + 42172n. -n*2 - 2 Collect the terms in -231959g + 4 - 4 + 463928g - 231962g. 7g Collect the terms in 54 - 122a - 28 - 159a - 155a - 25. -436a + 1 Collect the terms in -9579b + 4768b - 186 + 4809b + 186. -2b Collect the terms in 373f - 1529f + 383f + 376f + 391f. -6f Collect the terms in 9h*2 + 30h*2 - 8h*2 - 45h - 19h2. 12h*2 - 45h Collect the terms in 136372c3 - 6272c + 6272c - 135893c*3. 479c*3 Collect the terms in 8 + 19p + 22 + 3 + 16 + 27p - 61. 46p - 12 Collect the terms in -32221d3 + 18885d*3 - 22787d*3. -36123d*3 Collect the terms in -15626j - 29971j - 92249j. -137846j Collect the terms in 4680q - 1155q - 1151q - 1111q - 1146q. 117q Collect the terms in 18821p - p*3 + 1202p*2 - 6276p - 6270p - 6275p. -p*3 + 1202p*2 Collect the terms in 36i*2 + 248i*2 + 499i*2 + 475i*2. 1258i*2 Collect the terms in 2 - 7322713o*3 + 0o + 0o - 2 + 7323373o*3. 660o*3 Collect the terms in -6 - 9t*2 + 615t*3 + 4t + 18t2 - 587t*3 - 9t*2. 28t*3 + 4t - 6 Collect the terms in 0r2 + 3798323r*3 - 3798314r*3 + 0r*2 + 0r*2. 9r*3 Collect the terms in -762f*3 + 417f*3 - 2f*2 + 866f*3 + 432f*3 + 2f*2. 953f*3 Collect the terms in -6898 - 2449j + 13741 - 6843. -2449j Collect the terms in 1271375u*2 - 1271375u*2 - 159400u*3. -159400u3 Collect the terms in -l3 - 277l2 - 361l*2 - 2 + 987l2. -l3 + 349l2 - 2 Collect the terms in -130u - 1 - 69u + 1 - 65u + 478u. 214u Collect the terms in 39689t + 39624t - 11t2 + 12t*2 + 6 - 79313t. t*2 + 6 Collect the terms in -11721o + 8512o - 80748o - 47597o. -131554o Collect the terms in 7d + 4d - 2373d3 + 18d - 29d. -2373d*3 Collect the terms in 16r + 25r - 314393 + 30r - 70r + 314393 - 3r*2. -3r*2 + r Collect the terms in 2915w - 2874w - 25 - 24 + 96 - 19 - 26. 41w + 2 Collect the terms in -735 + 11i + 1450 + 61i*2 - 715. 61i*2 + 11i Collect the terms in -263390t - 138768t - 55537t - 43685t. -501380t Collect the terms in 52267t*3 + 53487t*3 - 105758t*3. -4t*3 Collect the terms in -19739m + 39674m - 19809m + 40. 126m + 40 Collect the terms in -2o*2 + 44 + 98o - 10 - 25. -2o2 + 98o + 9 Collect the terms in 69n - 2 + 51n - 89n - 421n. -390n - 2 Collect the terms in 154510080n + 2809n2 - 154510080n. 2809n2 Collect the terms in d2 - 642 - 737 - 721 + 2015. d2 - 85 Collect the terms in 2042 - 1220b*2 + 397b*2 + 412b*2 + 413b*2. 2b*2 + 2042 Collect the terms in 8459x*3 - 17219x*3 + 2x*2 + 8661x*3 - 3x*2. -99x3 - x2 Collect the terms in -14 + 10z3 + 8 - 245779z*2 + 245778z*2 + 6. 10z3 - z2 Collect the terms in -28 + 28 - 12735q + 12735q + 17q2. 17q*2 Collect the terms in 11372b - 2344b + 6225b + 2. 15253b + 2 Collect the terms in 366z - 182z + 365z*3 - 181z*3 - 184z - 181z3. 3z*3 Collect the terms in -17r*2 - 18672r*3 + 12r*2 + 2 + 18376r*3. -296r*3 - 5r*2 + 2 Collect the terms in -10066n*3 - 58682n*3 + 10888n*3. -57860n*3 Collect the terms in -562u + 13u3 + 104u*2 - 104u*2 + 15u*3 - 29u3. -u3 - 562u Collect the terms in -26 + 15 - 5g*3 + 11 - 3g**3 + 447	{ "pile_set_name": "DM Mathematics" }
136, 14, 6, 5, 4, -2 Sort 4, 19, -7268/109, 0.3 in descending order. 19, 4, 0.3, -7268/109 Put -54, -2, 2, -12 in ascending order. -54, -12, -2, 2 Put -32, -31, -22, -7 in descending order. -7, -22, -31, -32 Sort 4, -182, -15, -6, 31 in ascending order. -182, -15, -6, 4, 31 Sort -1154, 3, -1, -28, -20 in ascending order. -1154, -28, -20, -1, 3 Sort 1.6, 0.1, -6044, -7, -58 in descending order. 1.6, 0.1, -7, -58, -6044 Sort 7, -176, 1, -3, 5, -36, 2 in descending order. 7, 5, 2, 1, -3, -36, -176 Put -2/13, -0.4, 18031, -2 in decreasing order. 18031, -2/13, -0.4, -2 Put -1/4, 0.5, 17, -2, -12, -3/29 in decreasing order. 17, 0.5, -3/29, -1/4, -2, -12 Sort -0.1, -0.01505266, 4. -0.1, -0.01505266, 4 Sort -942, -4, 4, 372, 2 in ascending order. -942, -4, 2, 4, 372 Sort 374, 222680, -3 in decreasing order. 222680, 374, -3 Put 4, 2.97, -6, -2, -7, -31 in decreasing order. 4, 2.97, -2, -6, -7, -31 Put 0.5, 43.193, 30.04 in ascending order. 0.5, 30.04, 43.193 Put -2, -7, -362, 123, -5 in decreasing order. 123, -2, -5, -7, -362 Put 4, 349, -8626 in increasing order. -8626, 4, 349 Sort -65, 4, 3, 7, 0.07, -17, -1/3 in ascending order. -65, -17, -1/3, 0.07, 3, 4, 7 Put -28, -103, -634 in decreasing order. -28, -103, -634 Sort 3/2, 0.154, 2, 0.3, -186, -4/7. -186, -4/7, 0.154, 0.3, 3/2, 2 Put -33, -5, -3/2, 1, 2, -1 in descending order. 2, 1, -1, -3/2, -5, -33 Put -2, -70, 106300 in decreasing order. 106300, -2, -70 Put 2, 12781, -3, 1, 0, 116, -4 in ascending order. -4, -3, 0, 1, 2, 116, 12781 Put 0, 93, 4, 5, 3 in increasing order. 0, 3, 4, 5, 93 Put -41, 124274, 21 in decreasing order. 124274, 21, -41 Sort 7, -113, -34265. -34265, -113, 7 Put -0.02, 0, -2, 3, 8266 in increasing order. -2, -0.02, 0, 3, 8266 Sort -32, 42294, 2 in ascending order. -32, 2, 42294 Sort 3754, 1, -2, 618 in descending order. 3754, 618, 1, -2 Sort 25, -2, 77, -25, -5, -1 in ascending order. -25, -5, -2, -1, 25, 77 Put 0.3, 3/5, -3/86441, 2/7 in decreasing order. 3/5, 0.3, 2/7, -3/86441 Sort -0.97, 4, -224942 in increasing order. -224942, -0.97, 4 Sort 1382, 1/5, 2, -60, -72, 0. -72, -60, 0, 1/5, 2, 1382 Put 8, -302144, 19 in decreasing order. 19, 8, -302144 Sort -5, 417, 0, 5, -417, 3, -1 in increasing order. -417, -5, -1, 0, 3, 5, 417 Put 0.4, -11.37, -652/39 in ascending order. -652/39, -11.37, 0.4 Sort 155291, -176, 0. -176, 0, 155291 Sort 38, 10, 2, -2, -113, 1, 3. -113, -2, 1, 2, 3, 10, 38 Put 23268, -77, -5, 1 in increasing order. -77, -5, 1, 23268 Put -6, -5, -19308, -10 in descending order. -5, -6, -10, -19308 Put 10152, 4, -2, 146, 2, -1 in decreasing order. 10152, 146, 4, 2, -1, -2 Put -3, -5, -1518, 118 in descending order. 118, -3, -5, -1518 Put -64537198, -2, 5, 3 in descending order. 5, 3, -2, -64537198 Put -5, -7, 2, -3, 39878 in descending order. 39878, 2, -3, -5, -7 Put -0.1, 2, -3, 2/7, -5, 642009 in ascending order. -5, -3, -0.1, 2/7, 2, 642009 Sort 5, -5, -2, -274, -110, 1 in descending order. 5, 1, -2, -5, -110, -274 Sort 5, -1, 83, 27, -0.2, 647 in increasing order. -1, -0.2, 5, 27, 83, 647 Sort -23, -113.5, -4/5, -56 in decreasing order. -4/5, -23, -56, -113.5 Sort 1, -0.3, -3, 29, -1/5, 4, 1267 in ascending order. -3, -0.3, -1/5, 1, 4, 29, 1267 Sort 11, -9, -1, -220, -2 in increasing order. -220, -9, -2, -1, 11 Sort -18, -2, -1309, 172, -3. -1309, -18, -3, -2, 172 Put -3, 1493, 37, -8, 2 in increasing order. -8, -3, 2, 37, 1493 Sort 9, -3, 1, -30, 5, 4, 12 in decreasing order. 12, 9, 5, 4, 1, -3, -30 Sort 215/13, 0, -2, 25.7 in decreasing order. 25.7, 215/13, 0, -2 Sort 0.3, -19/13, -1/6, -276, 36. -276, -19/13, -1/6, 0.3, 36 Put -570, -1, 4, 3, -32, 10 in ascending order. -570, -32, -1, 3, 4, 10 Put 32, -12, 10/17, -111 in decreasing order. 32, 10/17, -12, -111 Put -0.06, 0.191, -1.5, 6 in descending order. 6, 0.191, -0.06, -1.5 Put 10, 1, -2, 8, -125275 in decreasing order. 10, 8, 1, -2, -125275 Sort 8, 4, -2, -222, -5, -65 in descending order. 8, 4, -2, -5, -65, -222 Put -19, -4, 3, 0, 5, 359394 in decreasing order. 359394, 5, 3, 0, -4, -19 Sort 2, -2, -4, 4, 0, -341, 2624 in ascending order. -341, -4, -2, 0, 2, 4, 2624 Sort 0.106, 2/3, 0, 1138.6, 1/4, 4 in descending order. 1138.6, 4, 2/3, 1/4, 0.106, 0 Put 97/15, 172, -0.1, -0.3 in decreasing order. 172, 97/15, -0.1, -0.3 Put 95, -47, 2/9, -103 in decreasing order. 95, 2/9, -47, -103 Sort 10, 237, 0.8, -3, 0, -1, 1/8. -3, -1, 0, 1/8, 0.8, 10, 237 Sort -1, 379, 338043 in ascending order. -1, 379, 338043 Put -15928, 9, 5, 1 in decreasing order. 9, 5, 1, -15928 Sort 0.3, 6/241, 9471, -4 in decreasing order. 9471, 0.3, 6/241, -4 Put -3/2, 18.3, 2/11, 3/4, 240/13 in decreasing order. 240/13, 18.3, 3/4, 2/11, -3/2 Sort -141, 3802, 1, -34 in ascending order. -141, -34, 1, 3802 Sort -19, -754, -14, 4. -754, -19, -14, 4 Sort -3, 0.5, -3591, -115 in ascending order. -3591, -115, -3, 0.5 Put -99, 0, -48571 in increasing order. -48571, -99, 0 Sort 339, -5, 149, -32. -32, -5, 149, 339 Sort 1, -2483, -6, 0, -8 in descending order. 1, 0, -6, -8, -2483 Sort 17, 3, 1, 5, -47, -20 in descending order. 17, 5, 3, 1, -20, -47 Put -1142, 4, 485, 1 in ascending order. -1142, 1, 4, 485 Sort -5, -5644, -9, 2, 12, -1 in decreasing order. 12, 2, -1, -5, -9, -5644 Put 4, 1, 40, -5, 78, -4, -2 in increasing order. -5, -4, -2, 1, 4, 40, 78 Put -0.2, 3, -4.7, 16, -2/7, 12/11 in ascending order. -4.7, -2/7, -0.2, 12/11, 3, 16 Sort 365, 0.5, 156, 2/7, 4 in descending order. 365, 156, 4, 0.5, 2/7 Sort -4/249, 1/9, 1/5, -3/13, 5, -1 in decreasing order. 5, 1/5, 1/9, -4/249, -3/13, -1 Sort -1, -5, -20, -3, -4, 91/11 in ascending order. -20, -5, -4, -3, -1, 91/11 Put -7548, -42953, -5 in ascending order. -42953, -7548, -5 Sort -5, -0.3, -82/4283, 160 in ascending order. -5, -0.3, -82/4283, 160 Put 2581, -9, 4, 0.1, 105 in descending order. 2581, 105, 4, 0.1, -9 Put 18, -32, -1/30, 104 in descending order. 104, 18, -1/30, -32 Sort -8, -3, 5, 9, 12, -6, -18 in decreasing order. 12, 9, 5, -3, -6, -8, -18 Sort 0, 2, 1552, 16 in increasing order. 0, 2, 16, 1552 Sort 2, 4, 0.07, 145.9, -14/3, 5 in increasing order. -14/3, 0.07, 2, 4, 5, 145.9 Sort 0, 4, -2753/4, 2, -111 in increasing order. -2753/4, -111, 0, 2, 4 Sort 13, -5, -7993, -0.5, 1/2, 2 in decreasing order. 13, 2, 1/2, -0.5, -5, -7993 Put -8, -24, -6, -195, 2 in descending order. 2, -6, -8, -24, -195 Sort -141, -26, 3, 4, 5, -62, 28 in ascending order. -141, -62, -26, 3, 4, 5, 28 Sort 31, 19.9, 1.1, 24. 1.1, 19.9, 24, 31 Put 18, -596, 1, -94 in increasing order. -596, -94, 1, 18 Sort 1, 14.831, 9/59. 9/59, 1, 14.831 Sort -2, 2/13, 2/3, 1/293434. -2, 1/293434, 2/13, 2/3 Sort -2/3, -2/13, -4/5, 1, 8, -421 in increasing order. -421, -4/5, -2/3, -2/13, 1, 8 Sort 1, 6, 1058673, 3 in ascending order. 1, 3, 6, 1058673 Put 34/7, -2/17, -0.372, 3.8, -5 in ascending order. -5, -0.372, -2/17, 3.8, 34/7 Sort -708694, 3, -2/39. -708694, -2/39, 3 Sort 0.5, -1/146, -1, -3346, -5 in descending order. 0.5, -1/146, -1, -5, -3346 Sort -1, -3, 8, 3, -4, -2, 4 in descending order. 8, 4, 3, -1, -2, -3, -4 Sort 66/13, -625, -1/3, -5 in descending order. 66/13, -1/3, -5, -625 Sort 3, 2/7, -5/6, 1/4, -0.14. -5/6, -0.14, 1/4, 2/7, 3 Put 0.012, -0.03, 1740, -7/4 in ascending order. -7/4, -0.03, 0.012, 1740 Sort 71, 2, -75918 in increasing order. -75918, 2, 71 Put 2, -20020, -2, -1 in decreasing order. 2, -1, -2, -20020 Sort 4368, -1, -5, 0.1, -21 in descending order. 4368, 0.1, -1, -5, -21 Put 1024, 190, 6 in decreasing order. 1024, 190, 6 Sort 0, -7, 9, -551041 in descending order. 9, 0, -7, -551041 Put 0, 421, 208, 7, -5 in increasing order. -5, 0, 7, 208, 421 Sort -190, 3, 13, -2568 in descending order. 13, 3, -190, -2568 Put 3, 19, 7, 793, -5 in descending order. 793, 19, 7, 3, -5 Sort 6, -13, 0, -1, 291, -5 in increasing order. -13, -5, -1, 0, 6, 291 Sort -3, 477, 1381, 0 in decreasing order. 1381, 477, 0, -3 Sort -31, -691, 0, -1, 4 in descending order. 4, 0, -1, -31, -691 Put -36, 2, 9144, -2, -1 in descending order. 9144, 2, -1, -2, -36 Sort 2, -1, -2, -0.1, 12, 0.47694 in decreasing order. 12, 2, 0.47694, -0.1, -1, -2 Sort -1048, -3/10, 84 in descending order. 84, -3/10, -1048 Sort -4, 2, 6, 5, 7, 1, 459. -4, 1, 2, 5, 6, 7, 459 Sort 788, 1, -304, 3, -32. -304, -32, 1, 3, 788 Put -5, 1/4, 0.2, -1/	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.