Datasets:

timaeus
/

pile-dm_mathematics

Dataset card Data Studio Files Files and versions Community

Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
ulate the remainder when 106 is divided by (0 - (-2 + -52))a/(-4). 25 Suppose a = r + 9084, 15a + 5r = 10a + 45430. Calculate the remainder when a is divided by 32. 29 Let m(q) = -q*3 - 10q*2 + 29q + 446. What is the remainder when m(-9) is divided by ((-2 - -1) + 2)5? 4 Let d(m) = -m3 - 9m*2 - 22m + 12. Suppose -17w + 14 = -19w. Let j be d(w). Let c = 157 - j. Calculate the remainder when c is divided by 9. 8 Let y = 79184 - 79144. Suppose 0 = -3u + 205 + 26. Calculate the remainder when u is divided by y. 37 Suppose -846h = -818h - 1708. What is the remainder when 4507 is divided by h? 54 Let a(p) = 3p*2 + 37p + 84. What is the remainder when 1454 is divided by a(-10)? 12 Let j(b) = 6b3 - 532b*2 - 179b + 202. What is the remainder when 1461 is divided by j(89)? 105 Suppose -28i = -149 - 12731. Let j = -331 + i. Calculate the remainder when j is divided by 38. 15 Let x = 5221 - 5206. Calculate the remainder when 1378 is divided by x. 13 Let z be ((-12)/(-9))/((-28)/(-294)). Suppose -131 = -zb + 261. What is the remainder when b is divided by 3? 1 Let u = 437 - 933. Let r = -273 - u. Calculate the remainder when r is divided by 45. 43 Suppose -121 = -9v - 2v. Let s(w) = 22 - 2w2 - w2 - 26 + w3 - 8w + 2w. What is the remainder when s(5) is divided by v? 5 Suppose -5i - 648 + 697 = s, -s = -5i + 41. What is the remainder when 2481 is divided by i? 6 Let j(b) = 2b*2 + 168b - 609. What is the remainder when 339 is divided by j(-88)? 54 Let u(v) = v2 - v + 15. Let d = 919 - 879. Calculate the remainder when u(9) is divided by d. 7 Let d = -3373 + 3410. Calculate the remainder when 53 is divided by d. 16 Let l(i) = i2 + i - 8. Let a be l(-4). Suppose -g = 5s - 37, 0s + 5g = 2s - a. Calculate the remainder when ((-8)/(-2))/4 - -25 is divided by s. 5 Suppose 6q - 5 = 13. Let t(c) = 1. Let k(g) = -2g + 31. Let l(f) = -k(f) - 4t(f). Calculate the remainder when l(19) is divided by q. 0 Suppose 0 = 55t - 27t - 140. What is the remainder when 30 is divided by t? 0 Calculate the remainder when -14 + 11/(-33)-1914 is divided by 73. 40 Let q be (-48)/18 - 2/(-3). Suppose -5z + 2b = -81, -z - 4z = 2b - 89. What is the remainder when 4 - (-22 + -7 - (q + 1)) is divided by z? 15 Let y be 23 - (1 - 5)(-6)/8. Suppose 50a - 51a + y = 0. Calculate the remainder when 38 is divided by a. 18 Let o(c) = 93c + 2. Calculate the remainder when o(2) is divided by 206/20 + (-3366)/11220. 8 Let h = 19964 + -19952. Calculate the remainder when 107 is divided by h. 11 Suppose -3d - 5n + 103 = -0n, -3d + n = -91. Calculate the remainder when d is divided by (-13 + 975/26)/((-42)/(-24)). 3 Let n be 5646/(-15) + (-4 - 44/(-10)). Let w = 450 + n. What is the remainder when 288 is divided by w? 66 Let f = -171 + 1332. What is the remainder when f is divided by 7? 6 Let n = 69 + -35. Let p(s) = 4s - 29. Let y be p(8). Suppose 2o - 34 = 7z - yz, -o - 5z - 11 = 0. Calculate the remainder when n is divided by o. 7 Let f = -10 + 4. Let z be 860/54 - ((-380)/27 + 14). Let m = f + z. Calculate the remainder when m is divided by 2. 0 Suppose -22o + 860 = -4486. Calculate the remainder when o is divided by 104. 35 Suppose -51t - 37t = -66t - 528. Suppose -364 = -5f - 4x - 23, 4f = -4x + 272. Calculate the remainder when f is divided by t. 21 Suppose 3v = 4c + 257, -4c - 415 = 20v - 25v. What is the remainder when 160 is divided by v? 2 Let v(i) = 37i - 70i - 41 + 36i + 18i2 - i3. Calculate the remainder when 295 is divided by v(18). 9 Let d = -663 + 765. Calculate the remainder when 174 is divided by d. 72 Suppose -5t - 5i + 480 = 0, 4t + 37i - 40i - 377 = 0. What is the remainder when 1405 is divided by t? 75 Suppose 0 = 4g - 36 + 264. Calculate the remainder when 34 is divided by (-5 - -4)/(3 + 174/g). 15 Suppose -919 - 1094 = -767b + 734b. Calculate the remainder when 78 is divided by b. 17 Suppose -4i + 216 = -5z, 8z + 3i + 148 = 4z. What is the remainder when 141 is divided by (-9 - -1)/(z/200)? 21 Suppose 127f - 471754 = -117805. Calculate the remainder when f is divided by 17. 16 Suppose -3z = -2y + 2968, 5y + 2933 = -19z + 16z. Let s = z + 1017. What is the remainder when 212 is divided by s? 26 Suppose -5q - 60 = 10q. Let t(i) = 32i*2 + 8i + 26. Let d be t(q). Suppose 3c - 26c + d = 0. What is the remainder when 108 is divided by c? 20 Suppose -32m + 1803 + 3362 = 429. What is the remainder when m is divided by 20? 8 Let g be 5/(20/(-12)) + 3. Suppose a + 12 - 51 = g. Suppose 3n - 20 = 2n. What is the remainder when a is divided by n? 19 Suppose 41w + 26w = 2948. What is the remainder when 612/2 - (-1 + 1) is divided by w? 42 Suppose 48c + 160 = 64c. Suppose 3i - 11m = -cm + 34, i = 4m + 26. What is the remainder when 688 is divided by i? 8 Suppose 2d + 754 = 3v, -1265 = 14v - 19v + 5d. Let f = -232 + v. What is the remainder when 73 is divided by f? 9 Let o = 10005 - 9588. What is the remainder when o is divided by 102? 9 Suppose d - 49 = -2w, -4w + 54 - 274 = -4d. Suppose 160 = 5t - 115. Suppose o - t = -4o. What is the remainder when d is divided by o? 9 Let n = 15763 + -15715. What is the remainder when n is divided by (-104)/(-6) - 2/(-3)? 12 Suppose 46m - 2828 = -156m. What is the remainder when 3983 is divided by m? 7 Let b(t) = 88t*2 - 37t - 37. Calculate the remainder when b(-1) is divided by 63. 25 Suppose 3f = 4o + 570, -972 = -5f - 22o + 25o. Suppose g + 2g - 5l - 10 = 0, -5g - 2l + 58 = 0. What is the remainder when f is divided by g? 8 Suppose -i = 99n - 96n - 85, 0 = -2i + 2n + 194. What is the remainder when 560 is divided by i? 90 Let o(q) = 3q*2 - 17q - 5. Let g be o(6). Suppose -5p + 6 - g = 0, -3u + 166 = p. What is the remainder when 161 is divided by u? 51 Suppose -5j + 20 = 0, -2a + 11j = 15j - 174. What is the remainder when a is divided by 38? 3 What is the remainder when (-3)/4 - (-10)/(920/86641) is divided by 303? 32 What is the remainder when 600 is divided by 68 + (-3 + (6 - 3) - -8)? 68 Let q = 80 - 72. Suppose -579 = -4c + 5h, -5h = 3c + 80 - 488. Calculate the remainder when c/(0 + 2 - -1) is divided by q. 7 Let p(z) = -2z - 15. Let l be p(-10). Suppose -5d = ls - 100, -46 = -2d + 3s + s. What is the remainder when d is divided by ((-15)/6)/(15/(-36))? 3 Let p(v) = -v2 - 28v - 27. Let h be p(-27). Suppose h = y + 2t - 19, -3t = 9y - 7y - 43. Calculate the remainder when 152 is divided by y. 7 Calculate the remainder when 15 - 504/33 - 1260/(-22) is divided by 1. 0 Let h = 19 + 9. Suppose 8 + 128 = 2t. Suppose 0 = -td + 65d + 18. Calculate the remainder when h is divided by d. 4 Let r(u) = 3u*3 + 15u*2 - 10u - 42. What is the remainder when 2158 is divided by r(-4)? 42 Suppose -532 = -47f + 737. Suppose 2x - 25 = f. Calculate the remainder when 48 is divided by x. 22 Suppose -6l + 5l = t - 5, 0 = -5t - 15. Let x(o) = 32o*3 - 4o*2 - 952o + 1925. What is the remainder when x(2) is divided by l? 5 Suppose 23 = -2c - 5f, 0c + 11 = -4c - 3f. Let k be (-218)/(-6)(-2 - (c - 0)). Calculate the remainder when 6/(-18) - k2/6 is divided by 23. 13 Let q be 0/(4 - 2 - 0). Let w(x) be the third derivative of -x4/8 + 19x*3/6 - 3x*2 + 2x. What is the remainder when 54 is divided by w(q)? 16 Let d(l) = -7l2 - 87l + 32. What is the remainder when d(-6) is divided by 293? 9 Let n(v) = 4v2 + 2v + 3. Let h be n(-1). Suppose 0 = hb - 53 + 563. Let r = b + 159. Calculate the remainder when r is divided by 18. 3 Suppose -5u - 56 + 331 = 0. Let a(r) = -2r3 - 4r*2 - 4r + 36. What is the remainder when u is divided by a(0)? 19 Calculate the remainder when (-1)/(10/(-115))(813 + 17) is divided by 3178. 11 Suppose -18 = 4m - 106. Let j(z) be the second derivative of 2z4/3 - 2z3/3 + z2/2 + 6z. Calculate the remainder when j(3) is divided by m. 17 Suppose 1027 - 223 = 12r. Suppose 0 = -x + 6x - 2n - 80, -r = -4x + n. Suppose 3f + x = 63. What is the remainder when 87 is divided by f? 12 Let h = 500 + -384. Suppose -24a + 1244 = h. What is the remainder when 234 is divided by a? 46 Let s = -262 + 307. Suppose sz - 50*z = -120.	{ "pile_set_name": "DM Mathematics" }
x3 + x2 - 1. Let l(s) = -12s4 + 12s*3 - 16s*2 + 16. Let w(h) = l(h) + 16r(h). Find o, given that w(o) = 0. 0, 1 Let p = 103 - 100. Determine o so that 21/4o2 + 3/2o*p - 9o*4 - 3/4 - 6o*5 + 0o = 0. -1, -1/2, 1/2 Suppose t + 0t + 2 = 0. Let l(o) = -o4 + 8o*3 + 15o*2 + 8o + 2. Let n(b) = -b4 + b2. Let a(i) = tl(i) + 6n(i). Factor a(v). -4(v + 1)4 Let b(q) be the second derivative of q5/16 - q4/16 - q3/12 - q. Determine m so that b(m) = 0. -2/5, 0, 1 Let r(t) = 1 + 2t + 3t - 3t - 3t. Let s be r(-2). Factor 0 - d2 + d4 - 1/2d + 1/2d5 + 0d*s. d(d - 1)(d + 1)3/2 Let a(q) = 3q*3 - 2q*2 + 1. Let y be a(1). Let u(j) be the first derivative of 1/3j*3 - 2j - 1/2jy - 2. Factor u(h). (h - 2)(h + 1) Solve 0 - 3q2 + 9/2q + 1/2q3 = 0 for q. 0, 3 Let j = 18 + -18. Let d(i) be the second derivative of 0 + 0i*2 + ji*4 + 1/70i*5 + 0i*3 - 1/35i*6 + 2/147i*7 + i. Factor d(v). 2v*3(v - 1)(2v - 1)/7 Let m(r) be the second derivative of r*7/70 + 2r*6/25 + 9r5/50 + r4/5 + r*3/10 + 7r. Find n such that m(n) = 0. -1, 0 Let o(t) be the second derivative of -2/15t3 + 1/25t*5 + 1/5t*2 + 0 + 5t - 1/75t6 + 0t*4. Suppose o(p) = 0. What is p? -1, 1 Let t(k) = -6k*3 - 24k*2 - 4k - 2. Let s(z) = -5z3 - 23z*2 - 3z - 3. Let h(a) = 4s(a) - 6t(a). Determine m, given that h(m) = 0. -3, -1/4, 0 Let z = -7 + 9. Factor 3t + 3t*2 - 10t*3 + 3t*2 + 0t*z + t. -2t(t - 1)(5t + 2) Let a(r) be the third derivative of r7/160 + r6/240 - 7r5/160 - r4/16 + r*3/2 - 7r*2. Let n(g) be the first derivative of a(g). Factor n(b). 3(b - 1)(b + 1)(7b + 2)/4 Suppose 5p + 2g + 0g - 36 = 0, g - 30 = -4p. Let a = 8 - p. Find o such that ao + 0 - 1/3o3 - 1/3o*2 = 0. -1, 0 Suppose 5d + 6 = 21. Suppose -2q = -5p + 2 - 18, 3q + 3p = d. Factor -8/9f2 - 10/9f - 2/9fq - 4/9. -2(f + 1)*2(f + 2)/9 Let f(c) be the second derivative of -c7/840 + c6/240 + c5/20 + c4/4 - 3c. Let x(g) be the third derivative of f(g). What is t in x(t) = 0? -1, 2 Let d(i) be the second derivative of -i6/120 + i5/20 + i4/24 - i3/2 - 9i*2/8 + 7i. Factor d(u). -(u - 3)*2(u + 1)2/4 Let v(x) be the third derivative of -x6/360 - x*5/180 + 11x*2. Let v(j) = 0. Calculate j. -1, 0 Determine n so that 5n*3 + 5n*2 + 2n*4 + 4032n - 7n4 - 4037n = 0. -1, 0, 1 Suppose 3o + 3v - 15 = 0, 3o + 12v - 13v + 5 = 0. Determine z so that 3/4z*5 + 0z*2 + 0z + 1/2z3 - 5/4z4 + o = 0. 0, 2/3, 1 Let f(l) be the second derivative of l6/50 + 24l5/25 + 96l*4/5 + 1024l*3/5 + 6144l*2/5 - 16l. Factor f(i). 3(i + 8)4/5 Let v(g) be the first derivative of -g7/140 - g6/120 - 4g*3/3 + 3. Let x(d) be the third derivative of v(d). Factor x(c). -3c*2(2c + 1) Let a(w) be the third derivative of 5w8/336 + w7/14 + w6/8 + w5/12 - 18w2. Factor a(k). 5k*2(k + 1)*3 Let l(d) = 9d*3 - 63d*2 + 120d - 51. Let v(m) = -9m3 + 62m*2 - 119m + 52. Let a(i) = 2l(i) + 3v(i). Factor a(u). -3(u - 3)2(3u - 2) Factor -j5 + j4 - 45j*2 + 2j*5 - 4j*3 + 41j2. j2(j - 2)(j + 1)(j + 2) Let r(d) be the second derivative of -2d*7/21 + 3d*5/5 + 2d*4/3 - 4d - 1. Let r(h) = 0. Calculate h. -1, 0, 2 Let n(c) be the first derivative of -2 - 1/60c5 + 3c + 0c4 + 0c*3 + 0c*2. Let z(g) be the first derivative of n(g). What is h in z(h) = 0? 0 Let i(v) be the first derivative of 0v + v*3 + 9/2v2 + 8. What is w in i(w) = 0? -3, 0 Let b(o) be the first derivative of o7/105 + o6/60 - o5/15 + o*2 + 4. Let v(i) be the second derivative of b(i). Factor v(j). 2j*2(j - 1)(j + 2) Suppose 0 = -4w + 2b + 20, 3w - 20 = -w + 3b. Suppose 3n + 11 = 4k, -k = -4n + 2 - 8. Factor -2y3 - y2 + y2 - ky*w + 2y*2 + 4y*5 - 2y*4. 2y*2(y - 1)*2(y + 1) Let -51n + 19 + 42n*2 + 11n + 4n3 - 14n*4 - 11 = 0. What is n? -2, 2/7, 1 Let r = -587 + 15851/27. Let v(a) be the first derivative of 2/9a*2 + ra*3 - 1 + 2/9a. Factor v(m). 2(m + 1)2/9 Let h be (-20 + 20)4/(-16). Factor 1/4n3 - 3/4n*2 + hn + 0. n*2(n - 3)/4 Let y be 6/(-14)1248/(-117). Factor -16/7q - 2/7q2 - y. -2(q + 4)*2/7 Suppose 2o + 9 + 7 = -4u, 15 = 5o - u. Suppose -3 - 3 = -oi. Solve -d4 + 0d + 2di + 2d2 - d2 - 4d + 2d = 0 for d. -1, 0, 1, 2 Find f such that 3/2f3 - 1/2 - 3/2f - 1/2f2 + f4 = 0. -1, -1/2, 1 Let y(i) be the second derivative of -3i*7/14 - 3i*6/20 + 3i*5/40 + 7i4/72 + i3/36 + 8i. Suppose y(j) = 0. What is j? -1/3, 0, 1/2 Suppose a + 2 = -5h - 3a, -4a = -4h + 20. Factor 0m - m + 6 - 9mh + 3m*4 + 4m - 3m3. 3(m - 2)(m - 1)(m + 1)*2 Find d, given that 0d + 1/4d2 + 0 = 0. 0 Let l(g) be the second derivative of -1/48g*4 + 4g + 1/24g3 + 0 + 0g*2. Factor l(j). -j(j - 1)/4 Let y(b) = -4b4 - b2 - 3b + 2. Let c(s) = 9s4 + 3s*2 + 7s - 5. Let h(z) = 3c(z) + 7y(z). Factor h(x). -(x - 1)*2(x + 1)*2 Let m(g) be the first derivative of -3/2g*2 + 1 + 23/4g*4 + 12/5g*5 + 3g*3 - g. What is q in m(q) = 0? -1, -1/4, 1/3 Let t(i) be the third derivative of 1/945i*7 - 1/108i4 - i2 + 0 + 0i3 - 1/270i*5 + 1/540i*6 + 0i. What is c in t(c) = 0? -1, 0, 1 Let d(k) be the second derivative of k*6/5 + 9k*5/20 - 3k4/4 - k3 + 17k. Factor d(v). 3v(v - 1)(v + 2)(2v + 1) Factor 0q2 + 0 + 0q + 3/7q3 - 3/7q*4. -3q*3(q - 1)/7 Let c = 288 + -288. Factor 3/4p4 + c - 3/4p*2 + 3/4p - 3/4p3. 3p(p - 1)2(p + 1)/4 Let w(j) be the third derivative of -j*7/84 + 7j6/240 + j5/40 - 7j4/48 + j3/6 + 7j2. Suppose w(f) = 0. What is f? -1, 2/5, 1 Let r(z) = z2. Let k be r(2). Let s(f) be the first derivative of 1/2f + 1/2f*2 - 1/4f*k - 1/10f*5 + 2 + 0f*3. Factor s(g). -(g - 1)(g + 1)*3/2 Let v(r) be the third derivative of 0 - 1/60r*5 + 0r*3 + 1/24r*4 - 3r*2 + 0r. Suppose v(m) = 0. What is m? 0, 1 Factor 2/3k - 1/3k2 - 1/3. -(k - 1)2/3 Let r(t) be the second derivative of -243t6/10 + 243t*5/5 + 72t*4 + 104t*3/3 + 8t*2 + 6t. Let r(b) = 0. Calculate b. -2/9, 2 Let p(z) be the first derivative of z*5 + 20z*4 + 160z*3 + 640z*2 + 1280z + 3. Solve p(x) = 0 for x. -4 Let w = -440 - -443. Factor 1/5yw - 3/5y + 2/5 + 0y2. (y - 1)2(y + 2)/5 Let n(r) be the second derivative of -r5/30 + r4/9 - r*3/9 - 15r. Factor n(w). -2w(w - 1)2/3 Let d(m) be the first derivative of -m6/15 + 8m5/25 - m4/2 + 4m*3/15 - 9. Solve d(j) = 0. 0, 1, 2 Let c(j) = j - 1. Let l be c(1). Determine m so that lm3 + m3 - 2m3 + 2m*3 = 0. 0 Let n be ((-32)/28)/(-4)14. Let p be 36/10 + 4/10. Factor -2h3 + 3hp + h5 + h*5 - nh*2 + 0 + 1. (h - 1)(h + 1)*3(2h - 1) Factor 0 - 16/5g*3 + 16/5g*2 + 4/5g*4 + 0g. 4g2(g - 2)*2/5 Factor -6b*3 + 3b3 - b2 + 2b4 + b4 - 6b + b*5 - 10b*2. b(b - 2)(b + 1)2(b + 3) Let b(u) = -u*3 + 8u*2 + 8u + 11. Let v be b(9). Find o, given that -2o + o2 + 2o*2 + 0ov + o3 - 4o2 = 0. -1, 0, 2 Let y(h) be the second derivative of h9/12096 - h7/1680 + h5/480 - h3/3 + 3h. Let i(m) be the second derivative of y(m). Factor i(w). w(w - 1)2(w + 1)*2/4 Suppose 0 = -0d - 5d + 70. Solve 0o + 24o2 - do*3 + 4o + 4o = 0. -2/7, 0, 2 Let y(u) = -2u - 19. Let g be y(5). Let i = g + 117/4. Determine j, given that -1/2 - ij2 + 3/4j = 0. 1, 2 Let v(j) be the third derivative of -j7/1680 - j6/720 + j*5/120 + 5j*3/6 - 5j*2. Let l(u) be the first derivative of v(u). Solve l(d) = 0 for d. -2, 0, 1 Let p be 24/1051/414. Find l, given that 4/5l*5 + 0 - pl*3 + 0l + 0l2 + 0l*4 = 0. -1, 0, 1 What is y in y + 1/4y*2 - 1/4y*3 - 1 = 0? -2, 1, 2 Let d(h) = 3h5 + h4 + h2 + h + 1. Let v(q) = -q5 + q4 - q2 - q - 1. Let y(j) = d(j) + v(j). Factor y(x). 2x4(x + 1) Suppose -3q - 2q = 0. Suppose 3w + qw = 0. Factor 2/7k3 + 0k*2 + w + 0k. 2k3/7 Let p(s) = 3s + 1. Let w be p(1). Let n be (w/(-30))/((-12)/15). Solve 1/6u2 + nu*3 - 1/6 - 1/6u = 0. -1, 1 Let n = 9/5 - -4/5. Suppose 2/5 + 3/5t*4 -	{ "pile_set_name": "DM Mathematics" }
- 2dt*3 + dt*2 + 21t*2 wrt t? -2040dt2 - 12d Find the second derivative of -4235p4 - 4p - 39. -50820p2 Find the first derivative of -12b*4h*3 + 6b*4h*2 - 71h*3 + 2h wrt b. -48b3h*3 + 24b*3h*2 Differentiate 18f*2o*2w + 3f2ow + 59f*2 + 48fo2 wrt w. 18f*2o*2 + 3f*2o Differentiate 5001w - 3611 with respect to w. 5001 What is the derivative of 731y*4 - 861 wrt y? 2924y*3 What is the second derivative of -5nt2 + 206nt - 24t*5 wrt t? -10n - 480t3 Find the third derivative of -22a*4 - 2a*3j + 2a3t - 20a2jt - 3a*2j + a*2t wrt a. -528a - 12j + 12t What is the second derivative of 158z*3 + 986z wrt z? 948z Find the second derivative of -90p*2 + 50p. -180 What is the third derivative of 146o6 + 169o*2 wrt o? 17520o*3 What is the first derivative of by*3 - 131by2 + 18y*3 + 66y wrt b? y*3 - 131y*2 What is the third derivative of -2h*4 - 26h*3 + 691h*2 wrt h? -48h - 156 Find the second derivative of 837p2r + 16pr + 2p + 5r wrt p. 1674r Find the second derivative of 1337p*3x*3 - 8px3 + 3x*3 + 29 wrt p. 8022px3 What is the third derivative of 13d*6y + 17d3y + d*2y - 3d2 - 12y wrt d? 1560d3y + 102y What is the first derivative of -by*2 - 41by + 6700b - 2y2 - 10y wrt y? -2by - 41b - 4y - 10 Differentiate -433p2 + 4689 with respect to p. -866p What is the derivative of 20m4 + 2m*3 + 137 wrt m? 80m*3 + 6m*2 What is the second derivative of 4a*3f*2 + 3a*3 + 13a*2f*3q + 128af + f*4 + fq wrt f? 8a3 + 78a*2fq + 12f*2 What is the third derivative of -5052p*4 - 63p*2 - p + 25? -121248p Find the first derivative of -4h2 - 9h + 133. -8h - 9 What is the third derivative of 1473k*3n + k3 + k2n + 3k - 316n wrt k? 8838n + 6 What is the third derivative of -4f2ow + 2f*2w*6 - 4f*2w*2 + 497fow*4 + 2fow + 37fw*2 wrt w? 240f*2w*3 + 11928fow What is the second derivative of -3m2u + 332m2 - mu + 1538m wrt m? -6u + 664 Find the second derivative of -172i2 - 11i + 4. -344 Find the second derivative of 10i3w - 276i2p*3w + 95ip*3w + 2ip*2w + 6w wrt i. 60iw - 552p*3w Find the first derivative of -13a2r*3 + 4a*2 + ar*3 + 1318r*3 wrt a. -26ar3 + 8a + r*3 What is the third derivative of -3nr3 - 2nr2 - 21n - 149r3 + 4r*2 wrt r? -18n - 894 Find the second derivative of -41t2v*2 + 2180t*2v - 217tv*5 + 2v wrt v. -82t2 - 4340tv3 What is the first derivative of -2h + 156 wrt h? -2 Differentiate -524d + 253 wrt d. -524 Find the second derivative of 14a*3r*2 + 2a*3r + 84a2r + 2ar - 1174a - 4r*2 wrt a. 84ar2 + 12ar + 168r What is the second derivative of -64y3 + 199y? -384y Find the first derivative of -2610p*3y*2 + 596p*3 + 3py2 - 5p wrt y. -5220p3y + 6py What is the derivative of 433c + 609? 433 Find the second derivative of -271b*4 - 4b*2 + 4557b wrt b. -3252b2 - 8 What is the second derivative of 82d*5 + 879d wrt d? 1640d3 What is the first derivative of -9a*2u*3 + 4a*2u - 45u3 - 12u wrt a? -18au*3 + 8au Find the second derivative of 2o*3su + 116o*3u - o*2su - 268os - 2su wrt o. 12osu + 696ou - 2su What is the derivative of -3460hj*2 - 285h + 6 wrt j? -6920hj Differentiate -p*3q*2 - 362p*3 + 482q*2 with respect to p. -3p*2q*2 - 1086p2 Find the third derivative of -o3rx - 9o3r + 170o3x + 2o3 - 2o*2rx - 3o*2x + 28or - 9rx wrt o. -6rx - 54r + 1020x + 12 What is the second derivative of 113s3 + s2 - 2s - 64? 678s + 2 Find the second derivative of -39my2 + 5m - y*5 - 2y*2 - 28y wrt y. -78m - 20y*3 - 4 What is the third derivative of -217g*5p*2 - 8g*5 + 72g*2p*2 - 2g wrt g? -13020g2p*2 - 480g*2 What is the second derivative of -20g*3m*2 + 38g*3mw + 2g*3m + 5gm*2w + 9gm - m*2w - 4m wrt m? -40g*3 + 10gw - 2w Find the third derivative of 36bk*6 - 181bk2 - 4k6 - k2 wrt k. 4320bk*3 - 480k*3 What is the derivative of -660mw + 13w + 2 wrt m? -660w What is the third derivative of 17695p*2v*5 + 29p*2v*2 + 153p*2v wrt v? 1061700p2v*2 What is the first derivative of -27ch - 126c + h + 1 wrt h? -27c + 1 Differentiate -122u*4 - 2u*3 + 529 with respect to u. -488u*3 - 6u*2 Find the first derivative of -76ox2 - 589o - 7x3 wrt x. -152ox - 21x2 Find the third derivative of c3n3 + 49c*3 - 72cn3 + 2cn2 wrt n. 6c*3 - 432c What is the derivative of -2nsyz + 2nyz - 4nz + sy + 3sz - 2yz + 3z wrt n? -2syz + 2yz - 4z Find the first derivative of iw*2 + i + 5w*2 + 43w - 1830 wrt w. 2iw + 10w + 43 What is the derivative of 453x*4 - 1021 wrt x? 1812x*3 Differentiate 184y*4 - y + 37. 736y*3 - 1 Find the second derivative of 61q*2w*2x + 8q2w*2 + 6q*2 + 104qw2 - qwx - q - x - 2 wrt q. 122w*2x + 16w2 + 12 What is the third derivative of -3lq3 - 10lq2 + 617q*4 + 132 wrt q? -18l + 14808q Find the third derivative of 9863m*4 + 947m*2 + 3m wrt m. 236712m Find the first derivative of 18p*3 - 293 wrt p. 54p2 What is the derivative of -n2r3 - 45n*2r*2 - 3nr + 3568r*3 wrt n? -2nr3 - 90nr2 - 3r Find the second derivative of 1653r3 + 350r + 3 wrt r. 9918r What is the second derivative of -3l*5 + 2965l wrt l? -60l3 Find the third derivative of 2ah4 - 27ah3y - ah3 - 40ay - 8h*2 + 3hy wrt h. 48ah - 162ay - 6a What is the first derivative of 2g4 - 741g*3 - 12013 wrt g? 8g*3 - 2223g2 Find the second derivative of -a4v - 38a*3v*3 + 2a + 88v3 + 1 wrt a. -12a*2v - 228av*3 What is the derivative of 2h*2y2 - h2y - 3hy3 + 2h - 2y3 + 142y*2 + 19y wrt h? 4hy*2 - 2hy - 3y*3 + 2 Find the third derivative of -929g*3s*3 - 744g*2s*3 + 2g*2s*2 wrt g. -5574s*3 What is the second derivative of -36b*3i*2 + 10b*3i + 24b3 - 6bi2 wrt i? -72b*3 - 12b What is the first derivative of -596y3 + 208 wrt y? -1788y*2 Find the first derivative of 2ox4 - 4807o + 1047x4 wrt x. 8ox3 + 4188x*3 What is the second derivative of 2sy3 - 2sy2 + 60sy + 543y*3 - 6y wrt y? 12sy - 4s + 3258y Find the second derivative of 22a5 - 241a*4 - 14087a + 2 wrt a. 440a3 - 2892a*2 What is the second derivative of 13i*2o*2z2 + i2z2 + 5i*2 + 12io2 - 2ioz*2 - 2i + 69o wrt i? 26o*2z*2 + 2z2 + 10 What is the derivative of i3p + i2pq + 1323iq + 2pq - 81p wrt i? 3i2p + 2ipq + 1323q What is the first derivative of 4041g2 - 707 wrt g? 8082g What is the second derivative of 154k5 - 84k? 3080k3 What is the first derivative of 18s*2 + 199s + 10072 wrt s? 36s + 199 What is the first derivative of 93dm3u + 2dm*2u - 2dm + 2m3n - m*3 - 10m*2n - 2nu wrt u? 93dm*3 + 2dm2 - 2n Find the second derivative of 5q3w + q*2w + 144q2 - 2qw - 1263q wrt q. 30qw + 2w + 288 Find the second derivative of -90y*5 - 92y wrt y. -1800y3 Find the second derivative of -57r*5 - 2r*4 - 9r*3 - r + 2201 wrt r. -1140r*3 - 24r*2 - 54r What is the third derivative of -5t6 - 47t4 - t2 + 18t wrt t? -600t*3 - 1128t What is the second derivative of -2234d4k*2 - 3d*2 - 2dk2 - 12d - 15k wrt d? -26808d*2k*2 - 6 Find the first derivative of -2690r*3v + 4265r3 wrt v. -2690r*3 Find the first derivative of -4578n*3t - 2617n3 wrt t. -4578n*3 Differentiate 4191k*4 - 2685 with respect to k. 16764k*3 Find the second derivative of 705x*2 + 183x wrt x. 1410 Find the first derivative of 120j + 104. 120 What is the third derivative of -16071ao3 + 7ao2 + 3ao + 3a - 36o2 wrt o? -96426a Find the second derivative of 3243x2 - 2195x wrt x. 6486 Find the third derivative of 4r4v - r*4 + 13r*3v*3 + 227r*2v*3 - 2r*2 wrt r. 96rv - 24r + 78v*3	{ "pile_set_name": "DM Mathematics" }
the closest to f? (a) -5 (b) -4 (c) o b Suppose 3 = -5d - 3q + 18, 3d = -3q + 3. Suppose 8s = 5s - d. Which is the nearest to -0.1? (a) 1/6 (b) s (c) 2 a Let z be (-4)/18 - (-44)/36. Let i be -1 + 144/(-68) - -3. Which is the closest to z? (a) -2 (b) -4 (c) i c Let f(r) = -r*3 + 4r*2 + 4r + 2. Let n be f(5). Let k be 1/n5 + 1. Which is the nearest to k? (a) -0.3 (b) 0.3 (c) 4 a Let q = 0.39 + -0.44. Which is the nearest to 1? (a) -1 (b) q (c) -2/13 b Let j = -0.4 - -5.4. Let t = 182.7 - 175. Let v = t + -8. Which is the closest to 0? (a) 2 (b) j (c) v c Suppose -q + 3q - 56 = 0. Suppose -5j - i + 4 = -10, 5i - q = -4j. Which is the closest to 2? (a) 1 (b) j (c) -0.4 b Let i = 0.06 + -1.06. Let x = -10 - -6. Let b = -2 - -6. What is the closest to i in 3, x, b? x Let m = -159 - -157. Suppose -5n - 5h + 30 = 0, n - 5h = 3n - 24. Which is the closest to 2? (a) -0.1 (b) n (c) m b Let z(y) = y2 - 3y - 74. Let a be z(10). What is the nearest to -0.1 in 0.1, -0.4, a? 0.1 Suppose 0f = -3f + 12. Suppose 0 = -4b - 3p + 30, -b - p - 10 = -3b. Suppose -b = -2g - 2. What is the closest to -1 in f, g, 0.4? 0.4 Let f = -0.6 - -1. What is the nearest to 2 in -5, f, 0.04? f Let d = 6 - 5. Let n = d + -1. Let v = 0.2 - 0.3. Which is the closest to n? (a) 5 (b) -2 (c) v c Let q = -0.261 + 0.161. Which is the closest to q? (a) -0.4 (b) 4 (c) 0.7 a Let g = 0 + 0. Let p = 103 - 101. Let m be 3/6(-2)/(-9). Which is the nearest to p? (a) g (b) 5 (c) m c Let p = 29 - 201/7. Which is the nearest to 2? (a) 0 (b) p (c) -2 b Suppose k = -k - 8, -4q - k = 0. Let t be (-3 - -3)/(0 - q). Which is the closest to 1/6? (a) 0.3 (b) t (c) -3 a Let i be ((-1)/((-9)/302))/((-16)/24). Let w(p) = 50p3 - 2p - 1. Let d be w(-1). Let x = i - d. Which is the closest to 0? (a) -1/6 (b) -2 (c) x a Suppose -3n + 2n + 40 = 0. Let m be (-22)/n + (-2)/(-3). Let z = m + 2/15. Which is the nearest to z? (a) 0.1 (b) 2 (c) 2/15 c Suppose 0 = 9v + 2v + 33. Which is the nearest to 0? (a) v (b) 0.1 (c) 1 b Let y = -3.5 - -3.6. Which is the nearest to y? (a) 4 (b) 1/7 (c) 5 b Suppose 5o + 2f - 11 = 0, o - 5f + 18 = 4o. Let i be (-106)/108 - 1/(-1). Let c = i - 43/378. What is the closest to o in c, 4, -1? c Let s be (-2)/(-5)430/24. Let v = s - 7. Let f = 35 + -104/3. What is the closest to f in 0.4, v, 2? 0.4 Let z = 5.99 - 6. Let h = z - 2.99. Let v = -0.3 + 0.1. Which is the closest to -1? (a) 3 (b) h (c) v c Let y = -0.82 - 0.18. What is the nearest to 5 in -1/3, y, -0.2? -0.2 Let x = 2.9 + -3. Let q = -131 + 131.3. Let h = -1 + 2. What is the nearest to h in q, -2/3, x? q Let h = -29/8 + 245/72. What is the nearest to -0.1 in -4/7, h, -1? h Let w = -0.046 - -0.546. What is the nearest to -1/2 in 0.3, 2, w? 0.3 Let c be 0/1 + (-6)/9. Let l = 14 + -13. What is the nearest to l in c, -5, -2? c Let z = 4 - 7. Let r = 1.9 + 0.1. Let v = 248/3 + -82. What is the nearest to r in 0, z, v? v Let k = -2 - -5. Let u = -3.1 + k. Let m be 3 - ((-6)/(-15) + 2). Which is the nearest to -2/5? (a) u (b) 0.4 (c) m a Suppose 0 = -5g + 13 + 17. Suppose -p + 4p - g = 0. Which is the closest to -0.2? (a) 0.4 (b) 3/2 (c) p a Let n = -8 - -6. Let c = -312 - -312. What is the nearest to c in -0.2, n, 0.4? -0.2 Let m = 18.3 - 18. What is the nearest to 0 in -1/8, m, 0.2? -1/8 Let g = -142 - -141.8. Which is the closest to g? (a) -4 (b) 5 (c) 0 c Let n be 19/(-5) + 5 + -1. Which is the closest to 1? (a) -2 (b) n (c) 3/2 c Let o = 0.07 - -0.33. Let x = 4.06 + -4. Let v = x - 0.16. What is the nearest to v in o, -4, 0.5? o Let n be 11/(-2 - 6). Let y = 1.7 - 1.8. What is the closest to y in -2/11, -1/2, n? n Let u = 5.15 - 0.15. What is the nearest to 1 in u, 0.5, 2? 0.5 Let p = 27/10 + -6/5. Which is the nearest to 2? (a) -2/11 (b) p (c) 0.3 b Let i = -1 - -1.4. Let h = 3.4 - i. Let o = -3.4 + h. What is the closest to -2/7 in o, 0.5, 0.3? o Suppose 4z + 16 = 0, 5f + 0f + 4z + 16 = 0. Let k be 2 + (12/(-8) - f). Let h = 8 - 12. Which is the nearest to h? (a) 2 (b) -0.1 (c) k b Let j = 2 - 2.5. Let m = -135/8 + 2279/136. Which is the closest to 2? (a) j (b) m (c) -2/7 b Let u = 0.0322 - 0.2322. Let v = -0.7 - -1. Which is the closest to u? (a) -5 (b) -13 (c) v c Let u = 4.3 + -0.3. Which is the nearest to u? (a) -3 (b) -1/8 (c) 1 c Let i be (-15)/(1 + (-10)/4). Suppose i = w + w. What is the nearest to -1/2 in -1/4, w, 6? -1/4 Let h = -23.1 - -23. What is the closest to 0 in 0, h, 4? 0 Let t = 0.4 - 0.1. Let p = -2.94 - 0.06. Suppose 0 = 3j + j + 3o + 11, -5j + 3o = -20. What is the nearest to j in -2/9, p, t? t Let g be -1 + (-1)/(-3)-1. Which is the nearest to -1/3? (a) -1 (b) 2/9 (c) g b Let r(n) = -n2 + 4n. Let a be r(3). Let m = -1.1 + -2.7. Let x = m - 1.2. What is the nearest to 0 in a, 0.5, x? 0.5 Let s be 0 - (0 - (-6)/27). Let q = -53 - -56.7. Let h = q - -0.3. What is the nearest to -0.2 in -4, h, s? s Let z = 1.58 + -0.18. Let m = z + 4.6. Let d = -6 + m. Which is the closest to d? (a) -5/4 (b) -4 (c) 5 a Let b = -0.09 - -2.09. What is the closest to b in 0, 5, -3? 0 Let z = -58 + 50. What is the nearest to -2/9 in -4/3, 1/3, z? 1/3 Let n be ((-6)/4)/((-345)/92). What is the nearest to 4 in -0.3, n, 0.13? n Let v = -8 + -2.2. Let z = 10 + v. Let f(o) = o*3 + 7o*2 - 8o + 1. Let r be f(-8). What is the nearest to r in 0, z, -5? 0 Let j = -1.7 + 0.7. Let c = 0.6 + -1. Let f = -1 - -0.9. What is the nearest to f in j, 4/7, c? c Let t = -3.3 - -3.6. Which is the nearest to 3? (a) -1 (b) 2/9 (c) t c Let g be ((-5)/(-10)-2)/(-1). Let m be (1/(-3))/((-2)/12). Suppose 4 = mr + 2r. Which is the nearest to r? (a) g (b) 2/7 (c) 3/8 a Let n = -0.01 - 0.09. What is the nearest to 2/5 in -1/3, 2.2, n? n Let s = -114 + 99. Which is the nearest to 2? (a) -1/5 (b) s (c) 2 c Let v be 4/2 + 3/(-2). Let g = -4.2 + 4.5. What is the nearest to v in -0.4, 1/8, g? g Let s(n) = n2 - 7n - 4. Let p be s(4). Let m = -12 - p. What is the nearest to 1 in 3, m, -1/8? -1/8 Let g(k) = -k3 + k2 + k + 2. Let q be g(2). Let o = 7 + -18. Let d = 11.3 + o. Which is the closest to 0.1? (a) 1 (b) d (c) q c Let c = 77 + -77. Suppose 5k = -2v + v - 18, 0 = k - 5v - 12. What is the closest to k in -3, -0.2, c? -3 Let t = 263/2 + -134. Let d = -18 - -55/3. Let i = 0 - -1. What is the nearest to d in t, i, 0.4? 0.4 Suppose 5 = l + 2x, 3l + 0x - 5x - 4 = 0. Let z = 0.2 + 0.8. What is the closest to 1/2 in l, 0.2, z? 0.2 Let n = -5 - 0. Let d = -3 - -2. Which is the closest to d? (a) 0 (b) 5 (c) n a Let a(p) = -3p - 4. Let f be a(-3). Let t be ((-1)/10)/(2/f). Suppose 8y - 20 = 3y. What is the closest to t in -1, y, -3? -1 Let u = -0.7 + -0.3. Let g = 1.1 + -0.1. Let o = -1.4 + g. What is the nearest to 2 in u, 2, o? 2 Let q be (-831)/84 + (-9)/(-12). Let u = 66/7 + q. Which is the closest to u? (a) -3/8 (b) -1/2 (c) 3/7 c Let i = 11 - 8. Let s = 7 - i. What is the closest to 1 in -1/4, 0.1, s? 0.1 Let r be (0 + 1)1/(-3). Let k be 12/(-14)2/(-6). Let z = -42.8 + 37.8. Which is the nearest to k? (a) -0.1 (b) r (c) z a Let i = -3 - -7. Suppose iy = 3 + 1. Let t = 5/17 - 49/51. What is the nearest to t in -1/2, y, 0? -1/2 Let y = 0.04 + 2.46. Let v = y + 2.5. What is the nearest to 2 in -2, 0.3, v? 0.3 Let v be -3 - (362/(-72) - -2). Let p = 61/396 + v. Which is the closest to 1/3? (a) 4 (b) p (c) -3 b Let j be ((-3)/138)/((-1)/(-4)). Let r = -11.84 - 0.16. Let d = 17 + r. Which is the closest to 2/3? (a) j (b) d (c) -2 a Let u = 0.36 - -0.14. Which is the closest to 0.2? (a) u (b) 4 (c) 2/3 a Let v = 36.9 - 37. Let y = -6 + 10. What is the nearest to v in 2, y, -2? -2 Let o = 0.4 + -6.4. Let v = 10 + o. What is the closest to 0 in -4/3, -0.2, v? -0.2 Let g = -23 + 58. Let v = -31 + g. Let r = -2 + 1. Which is the nearest to r? (a) v (b) -2 (c) -2/11 c Let u be -3 + 16/12 - -2. Suppose 5f = -2m + 12, 24 = -2f + 6f - 2m. What is the closest to -1/4 in 0, u, f? 0 Let o = 18 - 18.3. Which is the closest to o? (a) -5 (b) 0.3 (c) -3 b Let n be (-3)/(-6)*4/(-6). Which is the closest to -2/3? (a) n (b) 0.4 (c) 2/3 a Let k = -27 - -17. Let j be (17/k)/(	{ "pile_set_name": "DM Mathematics" }
1. Solve -2 = -v - v - 4n, -4v - 4n = g for v. -5 Let c(z) = -2z - 2. Let x be c(-2). Let g be (x/(-6) + 0)3. Let r = 4 + g. Solve 2s + rj = 2j - 2, -3s = -j + 8 for s. -2 Let n = 10 + -40. Let y = n - -32. Solve -a + 7q - 8 = 3q, 0 = -q + y for a. 0 Let m = 7 - -32. Let c = m - 37. Solve -5z - 4b - 6 = 0, cb + 0 + 2 = -3z for z. 2 Let m(y) = 3y - 2y + y3 - 3y*2 - 3 + 7y*2 + 0y*2. Let r be m(-3). Suppose -4q = -14 - 2. Solve 4n = 2t, 0 = rt - 6n + qn for t. 0 Let c = 1 - -1. Let p(r) = r3 - 5r*2 + 6r - 4. Let f be p(4). Suppose 8x + 28x + 3 - 3 = 0. Solve l = cz - z, x = -z + fl for z. 0 Let s(d) = d*2 - 13d - 42. Let o be s(16). Solve -j - 4 = -q, j - 3q = -7q + o for j. -2 Let h(r) = r*3 + 7r*2 - 3r - 6. Let n be h(-7). Let c = n + -15. Let a be (16/10)/(4/10). Solve 4s + aq + 8 = c, q = -3s - 0 - 4 for s. -1 Suppose 0f + 6f - 7f = 0. Solve i + 2 = f, -3o + i - 2i = 8 for o. -2 Suppose -3g + 2f + 9 + 2 = 0, f = g - 4. Solve p + 0 + g = -3q, 6 = -2p - 4q for p. -3 Let y(u) = -3u - 5. Let c be y(-3). Let q(t) = -9t + 4. Let n be q(-4). Solve 4m = -s - 25, 4m + 0s = -cs - n for m. -5 Let s(m) = -5m - 6. Let b be s(-4). Let q = b + -13. Let r = 10 + q. Solve -5x + 2 = k, 4x + r = -6k + k for x. 1 Suppose -3s = -5d + 25, 2s - 5d + 0d = -25. Solve s = 3y + 9, -5l - 4y - 12 = 20 for l. -4 Let w be 20/(-30) - (-124)/6. Let m be w + (1 + -1 - 1). Solve -4v = -5o + 32, -o + m = -5v - 0o for v. -3 Let v be ((-57)/(-95))/((-6)/(-40)). Solve -vz + 4y = -16, -z - 6 = 6y - 2y for z. 2 Let b = 226 - 221. Solve 0 = bh + l - 25, 4h + 4l - 6l = 20 for h. 5 Let d(b) = 3b - 2b + b + 0b + 12. Let o be d(-6). Solve -4n + 4a - 20 = o, 0a + 2a = 5n + 16 for n. -2 Let y = -5 + 5. Let a be y/(0 + 4 - 5). Solve -5o = -3l + 22, 0 = 3o - 5l - a + 10 for o. -5 Suppose -z + 30 = 3h, -4h + 49 - 123 = -5z. Let t be (z/8)/(6/16). Suppose -2n = -4n + t. Solve -5j + m = -nj + 5, -j = -3m + 10 for j. -1 Let i be (0 + -4)(-54)/12. Solve -4o = -0o + p + i, -p = -2o - 6 for o. -4 Let c be (12/(-4))/((-3)/2). Suppose 0 = 4d + 5 - 17. Suppose -18 = -4v + 3b, -4v = -db - b - 20. Solve 2z = -ck - 0k + 8, vk = -5z + 20 for k. 0 Suppose 0g = 3c + 2g - 7, 2c - 4g = 10. Solve -f - cv = 8, 3f + 3v + 10 = f for f. -2 Let i = -83 + 87. Solve -x = iq - 6, x - 1 = -q + 2 for q. 1 Let j be -4 + 68/3. Suppose -5v = v - j. Solve -5f + 4m - 6 = v, 0 = 4m - 8 for f. 0 Let t(b) = 3b - 37. Let g be t(14). Solve 24 = 3m - 3v, -m - gv = 3 + 13 for m. 4 Let w = -8 - -8. Suppose 0c = -4o + c + 10, w = 2o - 4c + 2. Solve oq + 2q - v = 20, 2 = 4q + 2v for q. 3 Let w be (-2)/(-1) - (12 + -13). Solve 4n = -d + 5d, -n - wd - 12 = 0 for n. -3 Suppose -43 = -3o - 4o + 4a, 3o - 21 = 3a. Solve l = -4g + 14, 0g + ol = -g - 6 for g. 4 Let d be ((-5)/3)/((-370)/30 + 12). Solve -4k + 8 = 0, -dm = -7m + 3k + 4 for m. 5 Suppose -5 = 2t - 15. Let w be 8 - -1 - (-9 - -4). Solve -5n + 5 = 5s, -1 = -ts + 5n + w for s. 2 Let w = 387 + -381. Solve -4 = 4t, 3h + 18 - w = 3t for h. -5 Let h be (-1)/((9/6)/(-3)). Suppose -4 - 2 = -b - hf, 3b - 2f = 18. Solve 0 = -3t - b, 0 = -p + 3t - 0t + 11 for p. 5 Let v = 28 + 9. Let t = -35 + v. Solve -6r + tr - 10 = -2n, 5 = -5r + n for r. 0 Suppose 7r + 5x - 249 = 3r, -r + 2x = -59. Suppose -3t = -r + 16. Solve -3s + 8 = c - 3, t = -5s + 5c for s. 2 Suppose 9 - 45 = -4h. Let b be 2/4 + h2/12. Solve w - 4 = -4l - 3w, 4 = 3l + bw for l. 2 Let b be (-114)/(-2 + -2 - -6). Let j be -2 - ((-1)/5 + b/15). Solve -5a - jc = -28, -3a - c + 5c - 4 = 0 for a. 4 Let a(c) = 2c + 30. Let u(j) = -15j*2 + 2j - 1. Let t be u(1). Let i be a(t). Solve -3o - 2 = -ir, 0r + 25 = -5r for o. -4 Suppose -3c - 3 = -9. Suppose 3 + 1 = cr. Let t be -1(8/(-4) + -1). Solve 18 = -5u - b, u - tb - 12 = rb for u. -3 Let n be (6/9)/((-1)/(-12)). Let m = n + -3. Suppose a - 18 = -3s, 0 = 10s - 12s + 2. Solve 2d = 4z + 10 + 2, -a = -z + md for z. -5 Let i(x) = x*3 + 6x*2 - 2x - 8. Let u be i(-6). Suppose t + 3l = 9, -5t + u = -l - 25. Solve -4b = -2c - t, -c - 6b - 3 = -2b for c. -3 Suppose -5s + 4 = 3q - 17, 3q - 6 = 0. Solve -4v + sj + 10 = 0, -2v = -0v + 3j - 14 for v. 4 Suppose 3z = 5w - 2, 0z = -5z - w + 6. Solve -4 = 5u + 4n, 2u + z = -n - 0 for u. 0 Suppose -g + 29 = 3s + 2s, 5g = 2s + 10. Suppose -3h - 52 + 5 = -su, 2h + 48 = 5u. Solve -2j + t = 7, 3t + 1 - u = 2j for j. -3 Suppose -5c - 5i + 186 = 71, -3i = 2c - 51. Solve -4l = 16, 3l + c = -5f + l for f. -2 Let p = 0 - 0. Suppose 4x - 10 = 14. Suppose h = 4 + x. Solve -3m - u + 5 = p, -4u + h = -2u for m. 0 Let c(w) be the second derivative of -2w + 3/2w2 - 2/3w*3 + 0. Let z be c(-3). Solve -6u - 5v + z = -u, 0 = -2u + 4v - 18 for u. -1 Let i be 129/27 - (-8)/36. Suppose 7 + i = 6y. Solve -2z + 1 = yv + 7, 5v - 4z = 21 for v. 1 Let a be ((-4)/12)/((-6)/342). Solve h - 5j = -a, 2h + 0j + j = -5 for h. -4 Let n(c) = 0 - 38c + 2 + 32c. Let p be n(-2). Solve 5g + 3x = 37, g - p = -g - x for g. 5 Let r be 3/6 - (-9)/(-6). Let y be r + 6(3 - 21/9). Solve yv = -2h - 4 - 10, -10 = 5v for h. -4 Let s = 17 + -14. Suppose d + 5u = -18, 12 = su - 6u. Suppose 10 = dt - 3l, 0 = -t - 4t - l + 25. Solve -tf + 2m + 11 = 0, 2f + 4 + 3 = -3m for f. 1 Let u(j) = -2j*2 - 30j + 10. Let t be u(-15). Suppose 31v - 29v - t = 0. Let x = -1 - -6. Solve -vc = -n - 3c - 13, -c = -x for n. -3 Suppose -4u = -68 - 32. Let k = u - 20. Suppose -2g = -4a + k + 1, -9 = -3a. Solve 0 = 4b - gy + 5y + 6, -b + 3y = -9 for b. 0 Let c be -4 + 0/6 + 8. Let s(z) = z + 7. Let a be s(-5). Solve 2w + q - c = 0, 3w - 3q = aq + 32 for w. 4 Suppose 4o - 24 = -6j + 3j, 5o + j - 30 = 0. Solve -4a + 5 + 7 = 5q, a = -2q + o for a. -2 Let z = -68 - -81. Solve -g - 3i - z = 0, i = -2g - i - 10 for g. -1 Let d = -18 - -25. Let g(x) = -1 + dx - 6 + 4 - 6x. Let v be g(15). Solve -3y = -5f - 2y + 24, -3f + v = -3y for f. 5 Suppose 0 = -2x - 8, -3p - 2 = -0p + 2x. Solve pa - 16 = 3o - 8o, 4a - 12 = 0 for o. 2 Suppose -5x = -x - 4. Suppose -3g + 4p = -20, 4g = p + 17 + x. Let o be ((-348)/(-145))/((-6)/(-20) - 0). Solve n - 6 = -5l - 0, 4n + o = -gl for n. -4 Let p(q) = q2 + 12q - 1. Let c be p(-13). Suppose 20 = ck - 40. Solve j = 2s - 5s - 20, -2s = kj + 35 for s. -5 Let m(v) = -v2 - 5v + 39. Let k be m(4). Solve -4s = -2g - 16, kg - s - 3s = -16 for g. 0 Let f be (42/39)/(86/559). Solve -2u = f + 3, 3n + 5u + 19 = 0 for n. 2 Let p(l) = -l3 - 4l*2 + 11l - 3. Suppose 0 = 2q - 3u - 3, -q + 2u = -4q - 28. Let t be p(q). Solve tr = -z - 9, 0r - 2z = r - 2 for r. -4 Suppose 3q = 6q - 90. Solve 5a = -c + 2c - q, -2c - 5a = 15 for c. 5 Suppose 0 = -4q + 5 + 3. Solve 5h = qh + 2l + 2, -4l = 4h - 16 for h. 2 Let p = -12 + 17. Suppose pb = 6b + 5. Let u = 0 - b. Solve -2a - 4j - 2 = 0, 0 = -ua + j - 5j - 17 for a. -5 Suppose -20 = -6p + 4o, -2o - 2 = 4p - 3p. Solve 0 = -r - pm + 2, 4r + 0m + 12 = 2m for r. -2 Let g = -2 + 9. Suppose -5c - g + 32 = 0. Solve -cw - h = 4, 2w + 3w - 16 = 4h for w. 0 Let k be (46 - -1) + 10/(-5). Suppose -6o + k = -o. Solve -b - 13 = 4s, o = 5b + 4s + 42 for b. -5 Let w be 3/(0 + (-6 - -8) + -1). Solve t - u - wu = -11, -6 = -3u for t. -3 Suppose 9 = 2a + 3. Suppose 3 = -3x + 4x + o, 2o + 14 = 2x. Suppose xn = -j + 1, -2j + 0j = n - 11. Solve am - 3b + 6 = 2b, 0 = -3m + b - j for m. -2 Let d(x) = x2 - 4x + 1. Let z be d(5). Let q = -2 + z. Let g = -16 + 16. Solve -r + qr = 2c - 4, 4r - 4c + 8 = g for r. 0 Let r(k) = -k + 1. Let c be r(5). Let s be (c/(-8))/((-2)/72). Let d = -14 - s. Solve -3y = -3w, 3w + d + 6 = -2y for y. -2 Let r(g) = -g - 6. Let w be r(-9). Let n be (-129)/(-6) + 9/6. Let k = n - 14. Solve 2i = 4q - 2, -2i - wi + 3q = -k for i. 3 Let m be (-1 - (-4 - -12)) + 11. Let z = -4 + 8. Solve -3r + 23 = -zi, 19 = mr - 5i - 1 for r. 5 Let r(d) = d3 + 2d*2 - 3d + 1. Let a be r(-3). Suppose -n - a = -3. Solve z - 4g - n - 1 = 0, 0 = -3z	{ "pile_set_name": "DM Mathematics" }
j20 Simplify (s(-2/17)/(s(-3/7)/s))/(s(1/3))(-1/44) assuming s is positive. s(20711/15708) Simplify ((z(-1/11)/z)/z)/z23 assuming z is positive. z(-276/11) Simplify (y1/yy)(3/7) assuming y is positive. y(3/7) Simplify o(o(o(-1/7)/oo)/o)/ooo14 assuming o is positive. o(104/7) Simplify ((mm(m(2/21)/m)/m)/m)(11/2) assuming m is positive. m(-209/42) Simplify (d(-3/13)d)44 assuming d is positive. d(440/13) Simplify (k(-3/13)/k9)24 assuming k is positive. k(-2880/13) Simplify ((((kk*(-1/3))/k)/k)/kk)*(-1/68)((k*(1/2)/k)/kkkk)(-15) assuming k is positive. k(-2293/102) Simplify (m(-2/5))(4/21)/(m*(-2/3)m)(18/11) assuming m is positive. m(-718/1155) Simplify (hh/(h(-7)/h))/(h(17/4)/h) assuming h is positive. h(27/4) Simplify (b(-16)b)/(b19/b) assuming b is positive. b(-33) Simplify (c*(7/5)c*10)/((((cc/(cc/c(1/12)))/c)/c)/(((c/c(-4/11))/c)/c)) assuming c is positive. c(8369/660) Simplify ((tt(-3))(-3/8))(-1/18) assuming t is positive. t(-1/24) Simplify (k/k(1/4))4/(k*(2/3)kk)(-10) assuming k is positive. k(89/3) Simplify u/(u(-3)u)u8 assuming u is positive. u11 Simplify (z1z)(10/13)/(z(-2/7))15 assuming z is positive. z(530/91) Simplify ((i2)(3/5))(-4/23) assuming i is positive. i(-24/115) Simplify (x/x*(2/19)xxxx(-5/6))/(xxx/(((xx*(1/3))/x)/x)xx)(-9/5) assuming x is positive. x(7559/570) Simplify ((u(10/3)/u)/(u(-1)u))(15/7) assuming u is positive. u5 Simplify ((zzz*(2/13)zz)/zz(-4/3))/(z/((z(3/4)/z)/z)z(2/19)/z) assuming z is positive. z(1379/2964) Simplify (d/(d(-2/5)/d))/d(-6)(dd/(dd/d*(2/5))d)(-12/7) assuming d is positive. d6 Simplify (qq/q(-5/2)q)(2/33) assuming q is positive. q(1/3) Simplify (ww/((ww(-8))/w))(-4/3) assuming w is positive. w(-40/3) Simplify o(3/7)o(-30)/o assuming o is positive. o(-214/7) Simplify ((h7h)/h(-1/5))35 assuming h is positive. h*287 Simplify (l/(l/(l(ll/(l(-1/27)ll))/l)))(6/19) assuming l is positive. l(2/171) Simplify f1f(-20) assuming f is positive. f(-19) Simplify ((u/((u/((u1/u)/u))/u))/u)/u(-3/5)u0u/u*(-2/9)u assuming u is positive. u*(82/45) Simplify (xx/(xx6)x)/x*(-2)(xx(xx(-1/3))/x)(-25) assuming x is positive. x(-131/3) Simplify i3/((i/i1)/i) assuming i is positive. i4 Simplify (kk(2/51))/((k(-4/9)/k)/k) assuming k is positive. k(533/153) Simplify (x/(x(1/3)/x)xx)/x*2x*(-6)x(-3/10) assuming x is positive. x(-139/30) Simplify (g/(g*15g)gg(-6))47 assuming g is positive. g(-940) Simplify k(-1/13)/k(4/11) assuming k is positive. k(-63/143) Simplify v*(-4/3)/((v/((v/(v/(vv*(1/3))))/vv))/v)v(1/6)/(v0v) assuming v is positive. v(-5/6) Simplify (o(2/43))(-2/83) assuming o is positive. o(-4/3569) Simplify ((v*(1/2)v)(4/3))(2/3) assuming v is positive. v*(4/3) Simplify (bb(-18/5))(-40/9) assuming b is positive. b(104/9) Simplify (h12)16 assuming h is positive. h192 Simplify (a8/a)/(a4aa)(a(-1/2))(-19) assuming a is positive. a(21/2) Simplify ((((((n(-1/4)/nn)/n)/n)/n)/nn)(-22))7 assuming n is positive. n(1001/2) Simplify ((n(n/((n/n*(-1/3)n)/n))/nn)/n(2/9))35 assuming n is positive. n(140/9) Simplify (c/(c/((c/c(-3)c)/ccc)))/(c(((cc/(c*7cc)c)/c)/c)/c)(c/(((cc*(2/5))/c)/c)c)(-39) assuming c is positive. c(-437/5) Simplify ((t(-2/5))(-5/4))3 assuming t is positive. t(3/2) Simplify gg/(g/g47)g/g(-24/5) assuming g is positive. g(269/5) Simplify q/(q*(-2)/q)qqqqq((q/((qq/((qq(-3)q)/qq))/q)q)/q)/qqq(q/(q(-1)q))(-2/3) assuming q is positive. q(25/3) Simplify ((zz1)(-27))3 assuming z is positive. z(-162) Simplify (h(-7/2)h)/hh(-2/11)/hh assuming h is positive. h(-81/22) Simplify n(-5/2)nn*4/nn*8/(nn/n(-5)) assuming n is positive. n(5/2) Simplify (j/(j/j*(-6))jjj*(2/9)jj)/((jj(-1))/j(-1/2)) assuming j is positive. j(-41/18) Simplify (n(8/7)/nn)/n(1/4) assuming n is positive. n(25/28) Simplify ((ll*4lll)/l)/l*(3/4)(l/l0)10 assuming l is positive. l(65/4) Simplify ((a(3/8)aa)/a2)/((a/(a(2/11)/aa))/aaa(7/5)/a) assuming a is positive. a(-371/440) Simplify u16uu23 assuming u is positive. u40 Simplify ((zz/z*(-5)z)/z*(3/2))/(zzz(-1/4))(-12/7) assuming z is positive. z(19/2) Simplify ((g(-1/2)/g)/g)(-34)/(g(10/3)/g(-2)) assuming g is positive. g(239/3) Simplify q17qq/(qqq(-2/11)) assuming q is positive. q(189/11) Simplify (d/(d/d(-2/7)))(9/2) assuming d is positive. d(-9/7) Simplify t33tt29t assuming t is positive. t64 Simplify u5uu*5u(-2)/(u/(u(3/10)/u)) assuming u is positive. u(73/10) Simplify v(-6)v(-13) assuming v is positive. v(-19) Simplify (w(-1/45))14 assuming w is positive. w(-14/45) Simplify (pp*1pp)20/(p(p(2/7)/p)/p)(10/9) assuming p is positive. p(5090/63) Simplify ((f(-7)/f)/f)/f*4(f0/f)(2/55) assuming f is positive. f(-717/55) Simplify (l(2/69))(-5/12) assuming l is positive. l(-5/414) Simplify k(-10)/k(23/3) assuming k is positive. k(-53/3) Simplify (r(-1/4))*(8/9)r(-1/5)/(r/(r/((r(1/2)r)/r)r)) assuming r is positive. r*(7/90) Simplify a/((aa*(-1/14))/a)a43 assuming a is positive. a(617/14) Simplify (o(-1))2/(o/(oo(-4/7))o(-4)) assuming o is positive. o(10/7) Simplify (w(-35))33 assuming w is positive. w(-1155) Simplify l8/l(-16) assuming l is positive. l24 Simplify i9/(i/(i(-2/13)i)i) assuming i is positive. i*(102/13) Simplify (tt(3/8))/t11 assuming t is positive. t(-77/8) Simplify f(-4/9)/f*(-7)ff(-4/9)f(-1/6) assuming f is positive. f(125/18) Simplify (x(-1/8)/(x/(x/x(-2/7))x))/(x0)(-40) assuming x is positive. x(-47/56) Simplify t(16/7)/(tt/((tt(-16)/t)/t)) assuming t is positive. t(-117/7) Simplify ((x(x/(x*(-4)x))/x)/(x*(-7)x))(14/3) assuming x is positive. x(140/3) Simplify c*(-2/3)c*(3/4)(c(1/4))(2/17) assuming c is positive. c(23/204) Simplify (u(-15)uu/(u/u*12u))(-45) assuming u is positive. u135 Simplify (ggg(-1))(-1/9) assuming g is positive. g*(-1/9) Simplify ((p/(pp*(1/4)))/pp)*(1/2)/((((p/(p/(p/(pp*(6/5)))))/pp)/p)/pp(p1/p)/p) assuming p is positive. p(123/40) Simplify (c0)(-2)c/(c/(c1/c))c(-3/7) assuming c is positive. c(-3/7) Simplify (h(-1)/h)/(h/h(-1/9)) assuming h is positive. h*(-28/9) Simplify (xx(1/4))/x(-5) assuming x is positive. x(25/4) Simplify n(5/4)/(n(-11)/n) assuming n is positive. n(53/4) Simplify (j*(2/9)jjj*(1/7)j)/(j*(-2)(jj1)/j) assuming j is positive. j(275/63) Simplify (cc*(-1/10)c)/(c/(c/(c(c(c/(c*(-30)c))/c)/cc))) assuming c is positive. c(-291/10) Simplify ((a/(aa*(-4/13)a)a)/(a/(a(aa12)/aa)))(-6) assuming a is positive. a(-1038/13) Simplify ll/l14l28 assuming l is positive. l16 Simplify (t*(-3/5)t/t*(-1))/((tt(t/(t/(t/t1)))/t)/(t/(t/(t/t6tt)))) assuming t is positive. t(-13/5) Simplify ((o(1/5)/o)/oo*(6/11)o)/(o/(o/(o*(1/8)o))((oo*2o)/o)/o) assuming o is positive. o*(-1487/440) Simplify ss*(-3/5)ss(3/4) assuming s is positive. s(43/20) Simplify (z(-1/3)z/(z/z1))/(z(-1/4)/(zz(-2/5))) assuming z is positive. z(91/60) Simplify ((q/q(-7))/(q((qq(2/5))/qqq)/q))/((qq*(-2/7)q)/(((q*(-5)/q)/q)/qq)) assuming q is positive. q(-109/35) Simplify ((v(-12)/v)/v)/(v/(vv(4/15))) assuming v is positive. v(-206/15) Simplify w(6/13)w*23w assuming w is positive. w*(318/13) Simplify (d/(dd/d(1/3)))/d(-3/2)(d(-1)d)(1/11) assuming d is positive. d(5/6) Simplify (b(-2/7))(-1)(((b(bb/(b6b))/b)/b)/b)/(bb(2/5)b) assuming b is positive. b(-319/35) Simplify (t33)(-49) assuming t is positive. t(-1617) Simplify (d/(d*25d))/(d/d5) assuming d is positive. d(-21) Simplify n*(-2/9)nn(-2/5)/n assuming n is positive. n(-28/45) Simplify (y23y*y	{ "pile_set_name": "DM Mathematics" }
3 - 1 + 2m + 0. Let z be s(-3). Let n(u) = 17u + 2. Calculate the remainder when 73 is divided by n(z). 16 Let g = 120 - 48. Suppose -5u + 38 = 3z + 6, -4z + 3u = -91. What is the remainder when g is divided by z? 15 Let w(u) = 38u*2 - 7u - 6. Calculate the remainder when w(-1) is divided by 3. 0 Let s = 0 - -4. Suppose 4k = 3o - so + 7, 0 = -o + 5k + 16. Calculate the remainder when o is divided by -3(-16)/(-6) - (29 + -44). 4 Suppose -6m + 3m = -12. Let j be ((-22)/m)/((-8)/16). What is the remainder when j/(-5)(-4 - 1) is divided by 4? 3 Let h = 2100 + -1913. Calculate the remainder when h is divided by 15. 7 Let z(b) = 3b + 30. Calculate the remainder when 180 is divided by z(9). 9 Let p(b) = -b2 + 6b + 5. What is the remainder when 142 is divided by p(0)? 2 Suppose 0 = 43t - 16t - 5346. What is the remainder when t is divided by 34? 28 Suppose 185 = -2t + 75. Let n = -13 - t. What is the remainder when n is divided by 15? 12 Let d = 107 + -215. Let z = -24 - d. Suppose 4f - z = -2b - 0b, -3b = -4f - 156. Calculate the remainder when b is divided by 17. 14 Suppose 3t - 13 = -4. Suppose -4r + 236 = tk + r, 0 = 2k + 5r - 154. Calculate the remainder when k is divided by 21. 19 Let c = 2150 - 2049. What is the remainder when 905 is divided by c? 97 Suppose -4t = -2g + 45 + 1, 2g + 5t - 19 = 0. What is the remainder when 20 is divided by g? 3 Suppose -24a + 54 = -450. What is the remainder when 202 is divided by a? 13 Let r(n) = 40n - 5. What is the remainder when r(2) is divided by (-6)/21 + 540/28? 18 Suppose -13h + 94 + 49 = 0. Calculate the remainder when 0 + 39 - 1/(-1) is divided by h. 7 Let l = -104 + 153. Suppose 3r - 7b = -3b + l, 0 = 5r + 5b - 105. What is the remainder when ((-6)/4)/((-9)/444) is divided by r? 17 Let n(d) = -2d*3 + 41d*2 + 23d - 5. Calculate the remainder when 737 is divided by n(21). 34 Let u = 23 + -11. Let j be 2 + (3/3 - -1). Suppose 0 = 4o - 8, -3m = o - jo - 60. Calculate the remainder when m is divided by u. 10 Suppose -3c - 5 = -n - 0c, -5n - 5c - 15 = 0. Calculate the remainder when 78 is divided by 8-6n/3. 14 Let q = 20 + 0. Suppose -4y = 16, -6n - 2y = -2n + q. What is the remainder when (n/6)/((-1)/194) is divided by 25? 22 Let b = 22 - 18. Suppose 5z + g - 55 = 542, 0 = -z + bg + 111. What is the remainder when z is divided by 30? 29 What is the remainder when ((-30)/(-20))/(-2 + 191/94) is divided by 25? 22 Suppose 20a - 38 = 2. Calculate the remainder when (-13)/a(-15)/(105/154) is divided by 48. 47 Let c(o) = o3 - 2o*2 + 2o - 3. What is the remainder when 19 is divided by c(2)? 0 Suppose 10h = 334 + 16. Calculate the remainder when 40 is divided by h. 5 Let q = 35 - 12. Let b(j) = 8j*2 - j - 7j*3 + 4j + 6j3 - 12. What is the remainder when q is divided by b(8)? 11 Let r(p) = 71p - 462. Let s(y) = 16y - 4. Let v be s(5). Suppose -5h + 4z + v = -0z, -4z + 20 = 3h. Calculate the remainder when r(7) is divided by h. 11 Let s(d) = -33d + 145. What is the remainder when 154 is divided by s(4)? 11 Calculate the remainder when 243 is divided by 1/2 + 42809/178. 2 Suppose 11y - 5y = 174. Suppose 5z + 2g = -0g + 42, -5z = -3g - 37. What is the remainder when y is divided by z? 5 Let m(i) = -i + 11. Let s be m(5). Let y = -3 + s. Suppose -3z - yz + 90 = 0. What is the remainder when 42 is divided by z? 12 Suppose 146c - 3673 - 999 = 0. Calculate the remainder when ((-59)/4)/((-1)/4) is divided by c. 27 Suppose 4y + 4z - 405 = 7z, 335 = 3y + 4z. What is the remainder when y is divided by 12? 9 Suppose -4s - 2x = -162, -s = -5x - 13 - 0. What is the remainder when 138 is divided by s? 24 Let a(t) be the third derivative of t6/120 - t5/20 - t4/6 - 11t*3/6 + 4t*2. What is the remainder when a(6) is divided by 26? 21 Let x = -3 - -7. Suppose u + 0s - s = 110, xu - 431 = s. Let j(n) = 27n2 - n + 1. What is the remainder when u is divided by j(1)? 26 Let p(z) = z3 + 35z2 - 50z - 77. Let d be p(-32). Calculate the remainder when d/40 + 2/16 is divided by 13. 11 Suppose -2p + 4 = 0, 2k + 6 = -3p + 50. Suppose -g = -46 + k. What is the remainder when 53 is divided by g? 26 Let s(h) = h3 - 10. Let l be s(0). Let y = l - -21. Let t = 252 + -234. Calculate the remainder when t is divided by y. 7 Let j be (-27)/(-18)(-4)/(-3). Let g(x) = -12 - 3xj + 2x*2 + 8 + 8x. What is the remainder when g(6) is divided by 3? 2 Let f = -181 - -180. Let y be -5 - ((0 - 1) + 0). Calculate the remainder when 25 is divided by 8 - f - 0/y. 7 Suppose -2x = -4q - 70, -3x + 6x - 119 = -q. Let m = -798 - -913. What is the remainder when m is divided by x? 37 Let w = 11 + -23. Let v be (-128)/(-2)w/(-16). Let g = 87 - v. What is the remainder when g is divided by 21? 18 Let v be (2 + -4 + 0)-2. Suppose -3p - 5b + 93 = -2b, -139 = -vp - b. Suppose 6y - 2y = p. Calculate the remainder when y is divided by 5. 4 Let r(x) = -3x - 7. Let t be r(-3). Suppose -tz - 3 = -9. Suppose 3b - zq + 12 = 63, 5q + 7 = -b. Calculate the remainder when b is divided by 7. 6 Let w = -224 + 289. Let u be 276/10 + (-4)/(-10). Let b = w - u. Calculate the remainder when b is divided by 19. 18 Suppose 0p + 5w + 63 = 4p, 5p - 120 = -2w. What is the remainder when 62 is divided by p? 18 Let l(m) = m*2 - m - 5. Let i be l(6). Suppose -i = -8u + 7u. Calculate the remainder when u is divided by (20/2 - 0) + -1. 7 Suppose -5d - 5c + 30 = 0, 5c = d - 0d + 12. Suppose -5n + 4b + 41 = 0, -8n = -7n - b - 9. Calculate the remainder when n is divided by d. 2 Let g = 43 + -34. Let d(k) = -2k - 10. What is the remainder when d(-13) is divided by g? 7 Let a be 0/(3/(-3) - 0). Let r(l) = l + 14. Calculate the remainder when 37 is divided by r(a). 9 Let r be 29/9 + (-8)/36 - -2. Suppose -3h + 31 = -3j - 98, -rh = -j - 215. What is the remainder when 170 is divided by h? 41 What is the remainder when 83 is divided by -35 + 29 + 318? 35 Let s(a) = 11a2 - a - 3. Let c be s(-2). Suppose -3z = 2f + 5 - c, 5f - 18 = -2z. Let h = z - -1. What is the remainder when 37 is divided by h? 7 What is the remainder when 53 is divided by 3((-330)/9)/(-11)? 3 Let v = -44 + 21. Suppose -2d = d + 36. Let k = d - v. Calculate the remainder when 31 is divided by k. 9 Suppose 5u - 60 = 70. What is the remainder when 41 is divided by u? 15 Let r = 79 - 41. Let p = 56 - r. What is the remainder when p is divided by 4? 2 Let w = 39 - 7. Let y = -210 + 271. What is the remainder when y is divided by w? 29 Let f(m) = -m*3 + 4m*2 + 3m + 5. Calculate the remainder when 235 is divided by f(-3). 58 Let z be 7 + (0 - (1 - 0)). Let p(x) = x*2 - 4x + 8. Let j be p(z). Suppose 5i = -4k + 33, 2k + k - i = j. Calculate the remainder when 13 is divided by k. 6 Let x be -70(3/5 + -1). Let u(v) = v*2 - 26v + 38. Let h = 31 - 7. What is the remainder when u(x) is divided by h? 22 Suppose -b + 6h = 9h - 20, -4b = -5h - 165. What is the remainder when 66 is divided by b? 31 Suppose -o = 2o + 12, -5q = 3o - 43. Let p be (1 + -1)/(-9 + q). Suppose 5d - 91 - 164 = p. What is the remainder when d is divided by 13? 12 Let c = 650 + -514. Calculate the remainder when c is divided by 15. 1 Let l = 42 - 19. Suppose 0 = -t - 3r + 6, -t + 3r = -9 - 9. What is the remainder when l is divided by t? 11 Let i = -12 + 38. Suppose -16z = -14z - i. Suppose 0x + x - z = 0. What is the remainder when x is divided by 5? 3 Suppose -3q - 1610 = -4j + 930, -4j - 3q + 2564 = 0. What is the remainder when 12/10 - 2 - j/(-10) is divided by 11? 8 Suppose 21 = -3g + 57. Calculate the remainder when g is divided by 11/(-22)(1 + -9). 0 Let j = -36 + 83. Calculate the remainder when j is divided by 43. 4 What is the remainder when (824/12)/((-30)/(-135)) is divided by 49? 15 Let u = -185 + 262. Calculate the remainder when u is divided by 4. 1 Suppose 0 = -2o - 2 - 8. Calculate the remainder when 161 is divided by 22/(-8) + o/20 - -44. 38 Let y(n) = 20n2 + n. Let i = 2210 - 2188. What is the remainder when y(2) is divided by i? 16 Suppose 0 = -h + 2c - 123, h + 46 = c - 76. Let g = h + 200. Calculate the remainder when g is divided by 2	{ "pile_set_name": "DM Mathematics" }
82 + 8.918. Which is the biggest value? (a) i (b) n (c) -3 a Suppose 0 = -5p + 5m - 10, -3 + 1 = 3p - m. Suppose p = -27k + 14k + 52. What is the third smallest value in -2/21, -0.5, -3/4, k? -2/21 Let p = -783 + 862.6. Let u = p - 50.6. Which is the third smallest value? (a) -4 (b) -0.2 (c) u (d) 2 d Suppose -3v = 4l + 11, -8 = -64v + 65v - 3l. What is the third biggest value in 5, 2/3, v, -3.4? -3.4 Let y = 4269 + -4269. What is the fourth biggest value in 1/65, y, -3/2, 0.2, 2/17? y Let j = -157.5 - -207. Let p = -0.075 + -49.925. Let g = j + p. What is the second smallest value in g, -0.1, 0.7? -0.1 Let k = -45694 + 501708/11. Let p = -84 - k. Let r = 7143 - 7148. Which is the fourth biggest value? (a) 12 (b) p (c) r (d) 1 c Let v = 6463 + -6482. Which is the third biggest value? (a) -2/13 (b) 2/9 (c) -4/5 (d) 5 (e) v a Let y be (998/76 - 13)/((-15)/(-36)). Which is the second smallest value? (a) -53 (b) 0.4 (c) 0.3 (d) y c Let n = -1.2992 + -3.7008. What is the fifth biggest value in 0.3, n, 1/3, 37, 29? n Suppose 0 = -9i - 26i + 350 - 35. Which is the third smallest value? (a) -18 (b) i (c) 0.2 (d) 3 d Let f be -3 + (-16)/184 + 858/345. Which is the second biggest value? (a) f (b) 0 (c) -1/8 (d) -2 (e) 5 b Let i = -5960 + 5960.5. Which is the fourth smallest value? (a) -0.1 (b) i (c) 34 (d) -2/69 c Let f be (-1)/3(-6 - 0 - (-252)/60). Which is the second smallest value? (a) 0.3 (b) 1 (c) 0.4 (d) f (e) -3 a Suppose -7 = -5n + 3y, -5n - 2y + 6 = -3n. Let d = 60.6 + -42. Let h = d - 19. Which is the third biggest value? (a) -4 (b) h (c) n a Suppose -l + 11 = -4f, -3l - 8 = -29. Which is the fourth smallest value? (a) -0.19 (b) 3/2 (c) f (d) -2/5 b Suppose -18g + 17 = -19. Suppose 45q - 3v - 9 = 44q, -5v = gq + 26. What is the smallest value in 13, -5, q? -5 Let n = -0.052 + 7.052. Let d = 83.8 - 77. Let q = d - n. What is the second smallest value in 7/5, -0.1, q? -0.1 Let n = 1.721 + 59.279. What is the fourth biggest value in 1/3, n, -4, -2/9? -4 Suppose -2w = 5w + 126. Let u be (1/4)/(w/24). Which is the fourth biggest value? (a) u (b) 14 (c) -5 (d) -0.3 c Let m = -208 + 361. Let y = 761/5 - m. What is the smallest value in y, 0.01, -5? -5 Suppose 2h + 0h - 4u = 8, 8 = -h - u. Let r be (-96)/(-36)(-66)/h. Let q be 0 - (-8)/r-1. Which is the smallest value? (a) q (b) 5 (c) -0.4 c Suppose 60 = 38m - 33m. Let j(w) = 2w*2 - 25w - 7. Let t be j(m). Let o = 22 + t. Which is the third smallest value? (a) o (b) 1/5 (c) -4 (d) -1 b Let s = -65 + -12. Let r be (-4)/7 + (-352)/s. Which is the second smallest value? (a) r (b) 2 (c) 0.5 b Let o = 0 + -10. Let c be 4/o + (-18)/(-70). Let f = -10.2667 - 0.7333. What is the third smallest value in 0.1, f, c? 0.1 Suppose -38o + 20 - 134 = 0. What is the fourth biggest value in 5, -166, -4, o? -166 Let h = -308 + 307.8745. Let l = -4.8745 + h. Let r = 3/52 - 4/13. What is the biggest value in 0.6, r, l? 0.6 Let t = 31 - 30. Suppose 2z + 5a = 13, 0 = 5z + 4a - 8 + t. Let x be 5/z(-16)/(-20). What is the second smallest value in -0.2, x, 6, -2? -2 Let u = -439 - -439.1. Let v = -1.25 + 3.25. What is the third biggest value in v, u, -5, -13? -5 Let y = -669 - -1339/2. Let j = -0.01 + 11.01. Which is the second smallest value? (a) j (b) 1 (c) y b Let v = -10.4361 - -0.4361. Which is the second biggest value? (a) -0.022 (b) -3 (c) v b Let r = -0.078 + 2.078. What is the second biggest value in r, 226, 6? 6 Let i(f) = 4f2 + 12f - 12. Let q be i(1). Let t = 9 + -14. What is the third biggest value in q, -0.2, t? t Let a = 0.07 - 5.07. Let z = -2.64 + 2.84. Let u be -4 - (172/(-40) - (-1)/2). What is the fourth smallest value in a, u, z, -2? z Let r = 39.18 + -38. Let n = -1.28 + r. What is the second biggest value in 2/5, n, 1? 2/5 Let m = -2.11 + 1.78. Let z = m + 0.33. What is the third smallest value in -1/5, 1/2, z, -0.4? z Let v = 46.26 - 46.36. What is the third biggest value in 604, v, -3? -3 Let l = 0.2 - -1.8. Let d = 1.75 - l. Let z = d - -5.25. What is the third biggest value in 1, z, 2? 1 Let k = 1750.9 - 1751.9. Let i = 4 + -2. Which is the second biggest value? (a) 0 (b) k (c) 4 (d) i d Let k = 545 + -454. What is the third smallest value in k, -1, 31? k Let n be (-2)/8(-4)/(-51). Let y = 208559 + -208559.1. What is the biggest value in -4, y, n? n Let p = -6 - -6.03. Let v = -140.7 + -22.3. Let z = 163.2 + v. Which is the fourth smallest value? (a) -5 (b) z (c) p (d) -2/7 b Suppose -330 = -5y + 2b, -10y + 5y - 2b + 330 = 0. Suppose 77 = -11p + y. What is the second biggest value in p, 0.9, -0.1? -0.1 Let v = 3825.4 + -3825. What is the third smallest value in 39, -0.05, v? 39 Let h = 64 - -107. Suppose -7p + 25 = -h. Suppose 2y - p + 14 = 0. Which is the third smallest value? (a) 3/5 (b) y (c) -0.5 (d) -0.1 a Let o be (418/(-912))/((-4)/(-32)2). What is the biggest value in -0.74, -1, o? -0.74 Let s = -0.3 + -0.3. Let t = 45691.53 + -45691.5. What is the biggest value in t, 2, 7, s? 7 Let o be (-23 - -23)(-2)/(-4). Let d = -5.05 + 3.22. Let p = d + 0.03. What is the second biggest value in p, o, 4? o Let q = -4 + 3.9. Let t = 0.76 + -1.12. Let j = t + 1.36. Which is the biggest value? (a) q (b) -4 (c) 4/9 (d) j d Let m = -0.10528 + 1.10528. Suppose -3j - 10 = -y, -y + 5j = 3j - 6. Let v = -3 - y. Which is the second smallest value? (a) v (b) m (c) -2 a Let u be (-9)/27(-3 - 63/(-15)). Which is the third biggest value? (a) u (b) -2/67 (c) -0.3 (d) -0.2 (e) -1 c Let g be ((-28)/8 - -5)116/435. Which is the second biggest value? (a) -2/17 (b) 0.3 (c) -5 (d) g b Let i = -12.581 + 0.301. Let n = -8.28 - i. Let t = 47/7 - 7. Which is the biggest value? (a) n (b) 1/6 (c) -0.3 (d) t a Let x = 21735.9 - 21736. What is the third biggest value in 4.86, -5, x? -5 Suppose 49i + 11608 - 80845 = 0. What is the third biggest value in i, -0.3, 2/9? -0.3 Let u be ((-1)/3)/((-1)/(-39)). Let o = 15 + u. Suppose 2q - 2 = -2. Which is the third smallest value? (a) 3/5 (b) o (c) q b Let y = 4.08 + -0.08. Let x = -66.104 - -62.104. What is the third smallest value in -0.2, x, y, 103? y Let l = 0.5 + 0. Let r = l - 0. Let v be -1(-4 - -5) + 23/(-69). Which is the third biggest value? (a) r (b) v (c) -5 c Let i = -260685 - -260684.8. Let n = 4.4 - 4. Let p = 1.9 + -3. Which is the second biggest value? (a) 0.2 (b) n (c) i (d) p a Let w be 8 + -5 + 1 - (-2 + 5 - -5). What is the second biggest value in w, 5/7, 0.15, -3, -0.03? 0.15 Let j(y) = y3 + 5y*2 + 3y + 1. Let h be j(-4). Let s = -5357 - -5353. What is the second smallest value in s, -3, 4, h? -3 Let f = 9.3 - 9. Let p be 9768/777 - 39/3. Which is the biggest value? (a) f (b) -4 (c) -1 (d) p a Let v = 18214/15 - 6003/5. What is the third biggest value in -0.2, v, 5? -0.2 Let l = 2009/90 + -221/10. What is the second biggest value in 47, l, -0.5? l Let g = -64 - -53. Let o = 31 - 1. Let c = 25 - o. What is the smallest value in 3, c, g? g Let r = -15901/7 + 2272. Which is the second smallest value? (a) 0.18 (b) r (c) 5/4 b Let v be 10/45 - (13/30)/((-240)/(-160)). Let r = 4 + -22/5. What is the third biggest value in 8, v, r? r Let g be -61/10 + 24837/(-255). Let q = -173 - -539/2. Let r = g + q. What is the second smallest value in r, 0.4, 27? 0.4 Let w(l) = 2l*3 - 58l*2 - 418l - 72. Let q be w(35). Which is the second biggest value? (a) -82 (b) q (c) -0.2 (d) -1 d Suppose 0 = 2t - 3t + 262. Suppose 4z - 506 = 3m, 468z - 469z - 178 = m. Let x = t + m. Which is the smallest value? (a) 1/3 (b) -1/5 (c) x b Let y = 1894 - 1893.2. Let s = -34/11 + 600/187. What is the smallest value in 2/13, -1/8, y, s? -1/8 Let l = 3.6 - 4. Let v = 0.47576 + -0.37576. Which is the biggest value? (a) l (b) 1 (c) v (d) 6/11 b Suppose -70*s - 76 - 64 = 0. What is the second smallest value in s, -0.4, 3/13, 3, 1? -0.4 Let j = -414142 - -414023.9332. Let p = 0.0668 + j. Which is the smallest value? (a) -1/7 (b) 2/15 (c) p c Let y = -10.156 + 10.158. What is the fourth smallest value in -0.3, 13/2, -0.1, y? 13/2 Let v = -2637391/7 + 376770. Let j = -2.9 + 3. What is the third smal	{ "pile_set_name": "DM Mathematics" }
w - 5o - 35 = -12 for w. 1 Suppose 18 = -7t + 13t. Solve 2 - 14 = i + 5v, 24 = 5i - tv for i. 3 Let i be -3 - 3(-2)/2. Let k be 2 + (i - 1) + 4. Let v(n) = 2n - 7. Let g be v(5). Solve 4p = -ku - 0p + 4, -16 = -gu + p for u. 4 Let x(r) = 2r - 11. Suppose 0 = -a + 3a - 20. Let b be x(a). Suppose -6 = 3c - b. Solve -3i + 2i - 4m = c, -2i - 9 = m for i. -5 Suppose -5y - 22 = -2b, -5b + 47 = y + 19. Suppose 10d - 4d - b = 0. Solve -s + x = 4 + d, x = -4s for s. -1 Suppose 62y - 8y - 216 = 0. Solve w - 20 = yq - 3w, 3q + 5w = -7 for q. -4 Let p(d) = -d*2 + 10d + 9. Let v be p(7). Suppose 5u = -z + v, 3u - z = 7u - 25. Solve -us - 10 = 5g, 0s + 4 = -s for g. 2 Let w(b) = -2b + 26. Let c be w(12). Let g be c - (-6 + 1 + 2). Solve -4z - 16 = gq, 2z - 4q + 4 = z for z. -4 Suppose 3v - 4v = -2. Suppose vb = -2i - 2, 3i - i - 3b = 8. Solve i = 2j - 4h - 1, 10 = -5h for j. -3 Let j be (0 - 1 - (-2)/3)-6. Let z be ((-19)/j - -4)-6. Suppose -8 = -d - 3d. Solve 0u + 7 = p + 3u, z = -5p + du for p. -5 Suppose p + 4z = -43 - 52, 0 = -p - z - 86. Let x = 103 + p. Solve x = 4l - 3o - 8, -4l = 5o + 4 for l. 4 Let d be (-59)/(-7) + 18/(-42). Let w = 5 - 2. Suppose -a - wa = -d. Solve 2f + 2v = 5v + 11, 2f = -av + 6 for f. 4 Let i(n) = n*3 + 6n*2 - 7n + 5. Let v be i(-7). Solve 4r + 5 = 5k + 8r, -r = -v for k. -3 Suppose -232c = -211c. Solve c = -j + 2, 9b + 2 = 5b - j for b. -1 Let z(b) = b3 + 3b*2 - 5b - 10. Let l be z(-3). Solve 0 = 5k - 2f + 20, 0f - 33 = 4k - lf for k. -2 Let m = 30 + -18. Let a = -4 + m. Let x(r) = r - 6. Let s be x(a). Solve -2f + 3f = -5i + 4, 0 = 2i - sf - 4 for i. 1 Let m be (-10)/4(69 - 71). Solve -14 = -ms + 7a - 3a, 3a - 3 = -3s for s. 2 Let r(c) = 14c + 3c + 11c2 - 3c - c*3 + 10. Let z be r(12). Suppose -4f + 44 = x, 5f - 5x = -x + z. Solve -f = 4d - 5l, 3d + 17 = -0l - l for d. -5 Let z be (4/12)/(3/27) + -19. Let d be (z/28)/(2/(-7)). Solve -3f + 16 = -w, 0f - 16 = -2f + dw for f. 4 Let u(s) = s*3 - 2s*2 - 6s + 4. Let j be u(4). Let z = -449 - -452. Solve 11 = 4h - zo - j, o = 5h - 15 for h. 2 Let p = 403 - 277. Let g = p + -121. Solve gy + 2k = 6, -5k - 18 - 2 = -5y for y. 2 Suppose 39a - 58a = 0. Solve l - 4b = 2 - 13, -4l + 4b - 20 = a for l. -3 Suppose -2a = 6 - 16. Suppose aj = 6j - 2. Let o = j + 2. Solve -c + 2 = 4w - 0, 0 = -2c + o for w. 0 Let x be 75/(-5) + 32 - 14. Suppose 3m - 8 = -f, -2f - 11 + 0 = -3m. Solve -xi = 4u - 3, u + mu + 12 = 0 for i. 5 Let a(i) = -2i*3 + 6i*2 + 11i - 12. Let f be a(4). Solve f = k - 6k + 2l - 30, 6 = -4k - 2l for k. -4 Suppose 5x - 35 = -2a, 6a - 5x = a. Suppose at - h = 10, 2h = 6h. Suppose 2d = -td + 8. Solve 0 = -3o - 5w - 6, dw = -o + 2o - 9 for o. 3 Suppose -18 = -4c - d, 8d - 5 = -3c + 3d. Solve 5u = j - 18 - c, -4j + 4u = -12 for j. -2 Let m be 11/22 - (-106)/4. Let b = -25 + m. Solve 0 = 4l, bt - t = 3l - 2 for t. -2 Let l be (-4)/2 - (-1 - -1). Let y be 15/(-5) - (l + -6). Solve -h + 2 = 3c + 4, -15 = yc + 4h for c. 1 Suppose -4o = 13 - 45. Suppose -3n + o = -2p, -6p + 8 = -2p. Solve 3j + 0 + 9 = nv, 0 = j - v + 2 for j. 1 Let i be 17(-3 - -2)-1. Let b = 6 + -11. Let w(h) = h2 - 4h. Let x be w(b). Solve g - j = 0, 0 = -5g - 2j - x + i for g. -4 Let p(c) = c3 - c2 - 3c. Let j be p(2). Let g be (j - (-4)/3)/((-22)/759). Solve 4z = -t + g, 3t - 4z + 11 = -0 for t. 3 Let i(p) = -2p3 + p2 - 2p. Let o be i(2). Let r = o - -24. Let k = r - 8. Solve k = 2w - 4l - 12, -3l + 18 = 4w - 5l for w. 4 Let p = 274 - 271. Suppose -6 = -2j + 4. Solve -jc = -pc + 10, 3m - c = 20 for m. 5 Let h be (-6)/(-30) + (-124)/(-5). Suppose 5g = -h, 4g - 2 = -3w - 4. Solve 3u + 0u + 21 = -4n, 4n + w = 2u for n. -3 Suppose 4m + 84c = 81c + 20, 2 = 5m - 2c. Solve -2k + mj = 0, -k - 3j + 6j + 10 = 0 for k. -5 Let g(a) = 7a + 105. Let q be g(-15). Solve q = 3r + 3s + 3 + 9, 3r - 5s - 20 = 0 for r. 0 Suppose 76 = -10k + 6k. Let a be ((k - -2) + -1)/(-2). Let v be a/3 + -2 - 0. Solve o - 2z - v = 0, -o + 1 = 5z - 0 for o. 1 Suppose -24p = 4 - 52. Solve -5 = 4m - 3v, -pv + 3v = -2m + 5 for m. 1 Suppose 4t + 5a + 4 = 2a, 0 = -a - 4. Solve -tc - 3c = -g - 13, -5g + 5c = 25 for g. -3 Let c be -1 + 6 + (13 - 15). Solve -2i = -q - 3, 3q + 3 + 6 = ci for i. 0 Let s be (-194)/(-1261) + (-74)/(-26). Solve -3v - sp - 28 = -4, 3v - p = -4 for v. -3 Let k(g) = g*2 - g - 6. Let m be k(3). Suppose mj - 5j + b + 27 = 0, 3j - 3b = 9. Solve jx + 5r = 2x - 25, 0 = -2x + 3r - 7 for x. -5 Suppose 5b - i - 21 = 0, 0i - i - 11 = -3b. Solve 4q - 8 = 0, m + 0q + 2q - b = 0 for m. 1 Let c(o) = 15o - 10. Let r(a) = -7a + 5. Let v(k) = 6c(k) + 13r(k). Let n be v(5). Solve 2l - 2b - 6 = -nl, 8 = -4b for l. 1 Suppose 6h = 7h + 19. Let w = h - -20. Solve 0 = -t - 3 + w, -5t + 10 = 4a for a. 5 Let m = -1689 - -1695. Solve m = r + 2a, -r = -4r + 3a - 9 for r. 0 Let d be (20/3)/((-1)/3). Let q be d/50 + 94/10. Suppose qp - 5p = 0. Solve p = 3w - 5u + 10, 3u = w + u + 3 for w. -5 Let k be 6/(4 + (-1 - 1)). Let q be 5 + (-1 - 2)/(-1 + 2). Suppose -m = -13 + q. Solve 5g = -w + 21, 0g - m = -kg + w for g. 4 Let f(m) = m2 + 3m. Let p be f(-4). Let a be (-924)/(-8) + (-1)/(-2). Suppose 10n - a = 64. Solve 0k + 2v = pk + n, 0 = v - 3 for k. -3 Let x be (-17 - -17)/(-2 + 0/3). Solve 2l - 6l - 19 = -5n, x = 4n + 2l - 10 for n. 3 Suppose -30h + 241 = -479. Solve -4v = 3i - 6v + 3, -h = 4i + 4v for i. -3 Let m = -2 - -2. Let a(b) = 4b*3 - 7b*2 - 5b - 1. Let q be a(4). Suppose m = -3n + q - 30. Solve -3k = -2p + 6p - 1, -3k = -4p + n for p. 4 Let m(h) = 20h - 175. Let u be m(9). Let v(p) = p3 - 6p*2 + 7p - 5. Let n be v(5). Solve 2c - c + nf - 19 = 0, -25 = 5c - uf for c. -1 Let z = -846 - -848. Solve 3o + 4 = zj, 0o + 4j - 14 = 3o for o. 2 Let w be (-1)/(236/(-152) - (-3)/2). Let l(i) = -i3 + 17i*2 + 38i + 4. Let k be l(w). Solve -ky + y + 24 = 4n, -4y = -5n - 1 for y. 4 Suppose 0 = 4c - 5 + 1. Let f be (-5)/5-3c. Let o = 101 + -99. Solve 0 = 3a + 2w - 11, 0 = oa + 3w + f - 17 for a. 1 Suppose -2i - 9 + 1 = 0. Let y be 2 + (6/(-2) - i). Suppose 6s - 7 = -s. Solve -w = -c + y, c + 6 + s = -w for w. -5 Suppose -3t - 1 = -2v + 13, t = -4v. Let l be (v + 39/12 + -3)4. Solve x - 2 - l = -3y, -x + 1 = 0 for y. 2 Let t(g) = -g*2 - 15g + 3. Let d be t(-15). Let w be 2/(-3)-3 - -4. Suppose 3p + p - 20 = 0. Solve 3u - w = -dy, u + py - 3 = 3 for u. 1 Let z(f) = -f2 - 9f - 5. Let s be z(-8). Let p be 0 - 0 - s/(-1). Suppose -p = -k - 4h, -h - 10 = -4k + 2. Solve 5r - r + 3 = -a, 4r = ka - 7 for r. -1 Suppose 0 = -6a + a. Suppose 0 = -4n - 5q + 52, -20 = -3n + 4q - 3q. Solve 0 = -3u - 4f + n + 5, a = -5f + 5 for u. 3 Suppose 4p = 3l + 5, p - 5l + 3 = -0l. Let f(m) = 4m2 + 10m - 20. Let k be f(p). Solve -4z + 26 = 2w, -z - k = -5w + w for w. 5 Suppose z + z + 5u = -20, -3z - 20 = 5u. Suppose 16o - 17o = z. Solve -w - s - 3 = 0, 3w + s - 4 + 11 = o for w. -2 Suppose -14x + 204 = -6. Let n = 20 - x. Solve -2p + 10 = 2d, np = -2d + 4d + 18 for p. 4 Suppose -8m = -2m - 30. Suppose -u = mu. Solve 3g = -3j + 1 + 2, 2g - 2j - 10 = u for g. 3 Suppose 0 = -13z + 2z - 44, 3x - 3z - 15 = 0. Let r = 2 + 3. Solve 4w + x = -2u + 3w, -ru + 2w = -2 for u. 0 Suppose 0 = -2q - 2q - 2b - 4, -2q - 4 = 2b. Suppose q = u - 0u - 19. Suppose -2x - u = -3x. Solve 0o = 3o - 2f + x, -5o - 33 = -4f for o. -5 Let b = -1389 - -1393. Solve 0 = -z - 4h - 15, 0 = -z + bh - 9h - 20 for z. 5 Let t(x) = -x2 - 9x - 2. Let v be t(-8). Solve 20 = -y - 5p, 2p - 35 = -3y + vp for y. 5 Suppose -s + 4g = 6, 0g - 15 = -3s + g. Suppose 0m - 30 = -sm. Solve -f + 5f - 3o - 11 = 0, mf + 3o = 34 for f. 5 Let v be (-30)/(-3)9/6. Let g = -13 + v. Suppose -3w - g = -t + 5, -5t - 2w = -18. Solve 4k + 20 = m, 0 = tk - 2m + 1 + 19 for k. -5 Let i be (-10)/(-8) - ((-273)/(-28))/(-13). Solve 6j - 7j - 4 = 0, 0 = ir + 4j + 6 for r. 5 Let w be (-2 - -4) + -4	{ "pile_set_name": "DM Mathematics" }
-s + 5k for s. 0 Let g = 88 - 83. Solve z + 5b = -g, 5z = 6b - 2b + 33 for z. 5 Let g(q) = -7q - 1. Let m be g(-1). Suppose 2p - 2 = f - 8, m = -2p. Solve -3o = 5u - o - 33, f = u - 3o + 7 for u. 5 Let a(v) = -v3 - 3v + 1. Let r be a(2). Let c = r + 24. Solve -4z - 3h = 5, 3h + c = 5z - 3z for z. 1 Suppose -4h - 20 = 5a, 3h = 6h + 3a + 12. Suppose -2f - 6 + 32 = h. Let u be 22/(-187) + 140/34. Solve -z + ur = z + 2, -f = 5z - 2r for z. -3 Let f be 1/(5/(-6) + 1). Let l be (-2)/f0 - -24. Suppose -5o - l = -6o. Solve 3w + 5v = -o, -4w + 1 - 4 = -3v for w. -3 Suppose 4 + 6 = 5i. Suppose -14 + 2 = ia. Let n be 2/(-3) - 34/a. Solve 0 = -3d - 9, 0j - 25 = nj + 5d for j. -2 Let m be 1/(-2)10/(-1). Solve -l - 2y = -m, -y - 3 + 4 = 0 for l. 3 Suppose -a - a = -6. Let z = a + 0. Solve 4k - 5k - 3d = -z, 0 = -2k + 2d - 10 for k. -3 Let i be (-2 - (-4 + -2)) + 1. Solve 2k = -3f + 22, -5f + 4k + i = k for f. 4 Let u be 6/9 + (-3)/(-9). Let q = u - -3. Solve -d - b - 3 + q = 0, -1 = 2d + 5b for d. 2 Let r = -4 + 8. Solve -5n = c - 10, -3n - 4c = -3c - r for n. 3 Let h be (17 + -1)(-5)/(-10). Suppose -k = 3p - h, 0p - 3p - 3k = -12. Suppose 28 = 5b - 17. Solve -4q = pf - 13 - b, 13 = 4q - f for q. 4 Suppose 0i = 2g + i, 20 = 4g - 3i. Suppose -6 = -3q - 0. Suppose 2f - qd + 0d - 20 = 0, -4f + gd + 30 = 0. Solve 4j + 3v = 0, -v + 0v = -fj for j. 0 Let y(p) = -p + 2. Suppose t - 2 = 1. Suppose -2x - 2m = -6, 12 = -tx - m + 5m. Let u be y(x). Solve 1 = -3a + 5h, h = -2a - ua + 14 for a. 3 Let w be (-3)/(-6) - (-3)/(-6). Suppose 0 = 4h - h - 12. Suppose -hb + 5 = -3. Solve w = -ba + m + 6, 2a + 4m = 6m + 8 for a. 2 Let d be 12 + (-3 - -4). Suppose -1 = -2y - 7. Let i be 1 - -4 - (-3 - y). Solve -2f - df = -iw - 35, -3w - 18 = -2f for w. -4 Suppose -24 = 2l - 5z, 30 - 10 = 5z. Let t be -8l/(-8)-7. Solve 0 = -6y + 3y + x - 10, y - 3x = -t for y. -2 Suppose 4l + q = 5l + 1, 4l = -q + 16. Let j be 0/(-2 - (2 - l)). Solve -2a - 4x - 6 = -9x, -5a + x + 8 = j for a. 2 Let k(t) = t3 + 2t*2 - t + 1. Let w be k(-2). Let v = 5 - w. Solve -5g - v = -4l, -4g = 3l + l + 16 for g. -2 Suppose 0h - 4 = -2h. Suppose 0t - 8 = -2t + hk, k - 14 = -5t. Solve 0 = b + d + 1, b + td + 16 = 7d for b. -4 Let i = 4 + 0. Suppose b = -1 + i. Solve 0 = -2a - 2a, -5a = bx + 12 for x. -4 Let y = -4 + 6. Let h(n) = -n - 6. Let o be (7/(-2))/(2/4). Let t be h(o). Solve 2r + yr + 4 = 0, -4p - r = t for p. 0 Let o = 11 - 9. Suppose 0 = y + 2r - o - 7, 5r = -4y + 45. Suppose -5t + y = -5. Solve -3 = m - 2j, -tj + 15 = m - 0m for m. 3 Let v = 5 + -5. Let h = 9 - 3. Suppose -2a + 0a = -28. Solve a = -q + 5n, -2q + vq - h = n for q. -4 Let z(c) = c - 3. Let j be z(3). Let h be (j + -4 + -1)-1. Solve -hu = -5w, 0 = 4u + 3w - w + 24 for u. -4 Suppose 5o - 12 = 8. Suppose -5 = -c - oy + 3, 0 = -y + 1. Let i = 0 + 0. Solve i = n + cn + 4m + 3, 0 = 2n - 5m - 12 for n. 1 Suppose -4v - 5f = -45, 0 = v + 2f + 3f - 30. Suppose -vm + 1 = -14. Solve 2u - 3 = mu, 3n - 5u = 0 for n. -5 Let j(f) = 2f2 - 2. Let w(k) = 2k*3 - k + 1. Let c be w(1). Suppose 0 + 4 = cu. Let d be j(u). Solve -p + t = -dp + 12, -4p + 6 = -t for p. 2 Suppose 4s + 4z - 28 = 0, 0 = 3s + 5z - 18 + 1. Solve 5j = h - 12, -5h - 3j + 5j - s = 0 for h. -3 Suppose 19 = 2f - 3d, 3d - 12 + 1 = -4f. Suppose -4m + 11 = -t, -ft - 4 + 3 = -2m. Suppose -3q = 6 - 39. Solve 3z - q = -mh + 2z, -2h + 7 = z for h. 4 Let r be -6((-14)/24 - 2/(-8)). Solve 2x + r = 0, 4o + 2x - 7 = x for o. 2 Let l = 3 + -1. Let j be (-4)/(l - (-10)/(-4)). Solve 3w - j = -4t, t + 2 = 3w + 2t for w. 0 Let o(a) = a*2 + 4a - 8. Let c be o(-6). Suppose -12 = -2y + 2t, -cy - 5t + 18 + 6 = 0. Solve -yf + 3 = 4l - 3f, -4l + 4f = 32 for l. -3 Let o be ((-6)/4)/(3/(-10)). Solve -5a + 2 = u, -3u + a = -ou - 5 for u. -3 Suppose 2h = -2h + 16. Suppose 22 + 10 = -4b + hr, -11 = 2b - r. Let k(o) = -2o - 3. Let m be k(b). Solve 3v = mg + g - 10, -v = -4g + 14 for v. 2 Let w(o) = 3o*2 - o. Let b be w(-1). Suppose bm + 8 = 8m. Suppose 2 = 23s - 22s. Solve -h = x - 7, -sx = -3x + m for h. 5 Let j be 4/(-10) + 3611/115. Solve 5f - 5y = -10, 4f - j = -3y - 4 for f. 3 Let z(u) = 25u + 1. Let l be z(3). Suppose -4s + l = 5t, 0s - s = t - 16. Solve -5o - t = x, 0 = o + x + 5 - 1 for o. -2 Let z be (-22)/((-4)/4-2). Let q = z - -21. Let f = -4 - -4. Solve 3w + qd = 5d - 5, f = w - d - 1 for w. 0 Let r(g) = -19g - 1. Suppose -2s = -3s. Let q be 3 + -4 - s/1. Let a be r(q). Solve -5m + 5 = -3u, -5u + a = -7 for m. 4 Let s be (2 + -2)/1 - -1. Suppose r = 6r. Suppose r = -0l - l + s. Solve -2k + 2p = p + 7, -2k - 5p = l for k. -3 Suppose 15 = -2y + 1. Let b = -19 - -31. Let t = b + y. Solve -tj - 15 = -5d, 5d + 3j - 23 = -0j for d. 4 Let f be -3(10/(-3) - 2). Suppose 5h = g + f, 2h - 22 = 2g - 3h. Let j be (-2)/g(-1 - -10). Solve 20 = -jr - 5d, -9 - 5 = 3r - d for r. -5 Let n(q) = q3 - 4q*2 - 2q - 11. Let w be n(5). Solve -a + 18 = 2a - wy, 3y + 9 = 0 for a. 2 Let d = -9 - -9. Solve 7 = 4y - 5g, dg = 4y + g - 13 for y. 3 Suppose 4k + 2t + 0t - 28 = 0, 10 = 3k - 4t. Solve 2q - 7q = 4u + 15, -2q = k for u. 0 Suppose 0 = 2u + 2r - 16, 2u + r = 2 + 10. Let j = u - 1. Solve -g = 5n + 13, n - jn - 19 = 5g for g. -3 Let t = -8 + 9. Let f(i) = 32i3 + 2i*2 - i. Let r be f(t). Let x = 53 - r. Solve -2d - x = 4w, -5w = 3d + 35 - 9 for w. -4 Let o be (0/(3 + -5))/2. Suppose 3b - 4b + 5 = o. Solve 2k + 0k - 4j = -28, -9 = -4k - bj for k. -4 Suppose 2x - 7x + 20 = 0. Solve s = f + x + 1, -4f = -s + 14 for f. -3 Suppose -4i = -3t + 19, 4t - t = 5i + 20. Solve -4 = -5u + 5d + 1, 5d + t = -4u for u. 0 Let w = -8 - -11. Let g be (-5 + w)(-4)/2. Solve 0 = r - 4i + 24, 5r + 0r = -gi for r. -4 Let a be -2 + (8 + 1 - 2). Solve -h - 3h - 16 = -3p, 3h + 2p = a for h. -1 Let h(r) = -5r - 2. Let z be h(-1). Let x be (-2)/((-20)/(-8) - z). Solve xc = 3s + 7, 0 = -5c + 2s + 20 - 6 for c. 4 Let p(d) = -d2 + 7d - 1. Let g be p(7). Let x be (2 + 3)(-1)/g. Let j = -32 + 36. Solve 3s = xc + 29, jc + 0s = 4s - 28 for c. -4 Let c(a) = a - 2. Let w be c(4). Let r be 2/(-4)20. Suppose 3t + rv = -v + 17, -2t + w = -4v. Solve 0 = 2s - k + t, -2s - s = 4k + 2 for s. -2 Suppose 19 = 2c - 0c + m, -52 = -5c - 4m. Solve -2x = -c, 5h = -3x + 4x + 21 for h. 5 Suppose 15 = 4r - n, 5n - 11 - 10 = -4r. Solve -2w = 2c, 2 = rw - c + 6c for w. -2 Let d = 13 + -25. Let r = d + 12. Solve -3h + 9 = 3a, -h + r = 1 for a. 4 Let c = 9 - 6. Suppose 3 + 1 = m. Suppose 0 = -5u + 4o + 41, -2u = 5o - 6 + 16. Solve ct + 2 + u = -z, -t + 5 = mz for t. -3 Let l = -304 + 946. Let j be l/42 + (-4)/14. Solve 3b = -0b + j, -5h + 20 = b for h. 3 Let j(b) = -b - 7. Let x(f) = -5f*2. Let u be x(1). Let v be j(u). Let s be (v/(-3))/((-2)/(-57)). Solve -3a + 6 = -0a, s = -5h + 2a for h. -3 Let q(g) = -2g*2 - 3g + 1. Let a be q(-5). Let b = -14 - a. Suppose 0 = 3x + x - b. Solve r - xo = 3, r = 5o - 3o for r. -2 Let n(i) = i*3 - 2i*2 - i - 2. Let f be n(3). Suppose 5w = fw + 5. Solve -h + 0h = -2d + 10, 5h = wd - 35 for d. 3 Let m(j) = -4j + 3j + 3j - 2 - 5j. Let v be m(-5). Solve 22 = 2r - 4q, -q = -r - r + v for r. 5 Let q(d) = 8d + 2. Let v be q(2). Let x be -2 - (-2 - v/3). Solve -4b - 2u = 10, 2b + 29 = 5u - x for b. -5 Let o(x) = x*3 - 6x*2 + 3x + 2. Let v be o(6). Solve 5i + 2d = 3d + 5, 0 = -4d - v for i. 0 Let x be (-3)/1-2 + -1. Suppose 2s = s + 4. Solve 2f = 5r - 7, 3f - x = r + s for f. 4 Suppose -4w + 5g = -28, 0 = 3g - 4g. Solve 3f - 4q - 1 = 0, 2q + w = -2f - 3q for f. -1 Let n(v) = 3 - 6 + v*2 - 1 - 4v + 2. Let j be n(5). Solve 0h + 4l + 21 = -3h, l - j = 2h for h. -3 Let i(s) = -2s + s - 5 + 4. Let b be i(-8). Solve 3f + b = 2g, f - 12 = 5f for g. -1 Let t be 280/(-16)8/(-10). Let l = -14 + t. Solve q - 3r + 5r - 9 = l, 0 = -5q - 4*r + 15 for q. -1 Let z be ((-56)/6)/((-3)/9). Let v be (z/(-35))/((-2)/10). Solv	{ "pile_set_name": "DM Mathematics" }
28800)/423. 68 Evaluate (57 + -144)/(51/(-10) - 33/(-55)). 58/3 What is the value of (-2)/(-76)-113(-80)/4520? 1/19 What is the value of (-44 - (-4059)/164) + 18? -5/4 Evaluate (101/303)/((-1)/123). -41 What is 710/71 - 2844/(-54)13/(-11)? -48/11 4301/255 - (46/42 - 1030/721) 86/5 What is (50 + (4669056/1470)/(-64))(2 + 28)? 78/7 Evaluate (2(-27)/(-36))/((-3060)/(-816)). 2/5 What is (1/(54/(-25)))/(69 - (-12322)/(-183))? -5/18 Calculate 20/1353 - (-350)/(-18). -19 What is (22/143 - (-50)/182)(90 - 91)? -3/7 Calculate (-100)/6(-36)/30 + (-502472)/25828. 6/11 Evaluate (1176/(-56) - 585/(-27))/(14/(-1659)). -79 What is 4/(-10)(-401625)/12600 - 16? -13/4 (-324)/10004 - (-45 - (-42389)/943) 1/61 Calculate -8 + 9 - -9 - (-398)/(-134) - (67 + -60). 2/67 What is -29 - ((-2565)/54 - (0 + -16))? 5/2 Evaluate 47 + (0 - 4) + 356 + -342. 57 Evaluate 97/2 - ((-2484)/(-1449))/((-16)/(-42)). 44 3/964(-440 - -448) 1 (-30)/(-135) + ((-10)/27)/((-103)/7725) 28 Evaluate (226/(-4) - -10)/((-45)/(-30)). -31 Calculate (-7 - (-37 + 22))/(((-24)/14)/(-6)). 28 What is the value of (-30)/(4 + 2) + (-28175)/(-5425)? 6/31 Calculate 6/39 + ((-140)/1365)/((-8)/(-1728)). -22 What is -37(41/((-1435)/140) - (-31)/1)? 37 Evaluate 1104/(-38) - 121/(-2299). -29 Evaluate 3735/(-5644) - 100/170. -5/4 567455/523056/(-124) -49 What is the value of ((-45)/(-27))/((-420375)/(-7650) + -55)? -34 What is (-16)/110(((-30)/(-4))/(69/(-46)))/2? 4/11 What is the value of 20/(-140) + (-17202)/(-658)? 26 (-2374)/38080/280 + (-27)/(-15) 2/133 (58384/(-1107))/(-89) - 2/3 -2/27 Calculate -1 - 1/12 - (-338)/(2327468/21597). 3/22 18 + (-600)/35 + (46 - 44) 20/7 Calculate (7 + (-1498)/210)-13/4430. 43 Evaluate ((-7)/21)/((-20)/(-2688))(225/(-18))/5. 112 Evaluate (-18)/((-3154)/(-190) + 7 + -23). -30 Calculate (-10)/4(-45)/(-225)(17 + -35). 9 What is ((-3825)/(-16065))/(10/(-438))7? -73 23460/(-920)490/119 -105 (-5)/(-150)-5 - 8638/1056 -5 Evaluate 6/(-84)(-48224)/(-1096). -22/7 Evaluate 3/((-582)/1162) - (416/(-88) - (-658)/(-517)). 1/97 What is (87/(-150))/((-84)/90) + (-2040)/3570? 1/20 What is the value of (4 + -2)/(1124/(-27538))? -49 ((-180)/24 + 16 + -5)-2 -7 Calculate 3/(486/30248/3). 7 (-15)/(-4)(-269568)/56160 -18 Evaluate (-201203160)/(-20058024) - (0 + (-4)/(-23)). 69/7 What is the value of 2/(2/3) + 17 + -12 - (-184)/4? 54 What is the value of 4/((-7)/(-4641)52)? 51 Evaluate -274/(-18) + 88/(-10)(18 - 17). -14/5 Evaluate -20 + 1 + -356/(-21) - -60. 51 What is the value of ((-1)/(-4))/((24565/102)/(-289))? -3/10 (105/(-378))/(1/(-12)) - (-805)/15 57 ((-1790)/(-18258))/((-12)/(-272)) 20/9 Calculate (((-360)/3240)/(1/(-14)))/(2/90). 70 Evaluate 6/(-9)(192/2688)/(4/126). -3/2 (6954/(-28975))/((-279)/15) 2/155 What is the value of (3/2)/((-3)/(-8))(99157 - 99182)? -100 Calculate (-1)/(((-18005)/(-5720) - (-1)/(-8)) + (-3)/1). -44 Calculate 144/(-270) - (-52)/(-1950)-5. -2/5 Evaluate (-90)/(-17) - (1932/(-56) + 36)(-20)/(-6). 5/17 What is the value of ((-58)/8)/(1799/(-7196))? 29 Evaluate 381/(-36) + -136 + 147 + (-51)/108. -1/18 Evaluate 5 + (-69)/92(-1848)/18. 82 4/(43857/1023 + -43) -31 Calculate ((-3355)/(-242) - 14)(120/(-960) + (-83)/(-24)). -5/11 (-39696)/9924 - (-366)/92 -1/46 What is (1/(20/105))/(68(-30)/140 + 15)? 49/4 (-284482)/4422 - (-1)/3 -64 (-5 - (159 - 7)) + (-2079)/(-693) -154 What is 2 + -2(-14 + 0) + -91 + -3 + 89? 25 Evaluate (-11 - -1) + 48154/(-336). -32 What is ((-8)/7)/(18/(-35)(-1016)/(-4572))? 10 2/(-7) + (-16167)/(-2219) + ((-118)/19 - 1) -4/19 What is 144/588(-1092)/(-117)? 16/7 (8/2772)/(9812/99 + -99) 2/77 Calculate 7 + 1252/(-20) + 356/(-890). -56 What is the value of ((-108)/9 - -6) + -6 + 82? 70 Calculate 32732/2338 + (-38)/2. -5 What is (9/(-20) - ((-680)/(-100) + -8))5/9? 5/12 Calculate (-232)/(-28101)-193(-1)/(26 + 2). 2/119 (15228/1710)/18 + ((-192)/(-40))/(-8) -2/19 What is 37/(60/((-315)/(-21)) - 3)? 37 Calculate ((-14)/147 - (-9)/21)/(40/(-336)). -14/5 What is (-62751)/858 - (11 - (-1470)/(-132))? -73 Evaluate (392/(-347116)161)/(62/(-44)). 4/31 Calculate (1110/35890)/(3 + -1 - 3/6). 2/97 Calculate (-14)/(70/(-45)) + (0 - -62). 71 What is -5 - (-95)/2(-74)/185? -24 Evaluate ((-1370)/(-60) - 6) + ((-27)/36)/(63/(-14)). 17 (-5680)/(-160) + 4/(-8) 35 (-30)/(47460/1932 + -25) 69 44/88120/1056 5 Evaluate (1524/(-84) - 12) + 916/(-168). -31 Evaluate (-2004)/(-38) + (-4445)/(-16891). 53 What is the value of (10148/516)/((-8)/(-6)) - 15? -1/4 Calculate 342/(-180) + 242/(-22)1/(-11). -9/10 Calculate ((-20)/9)/((486/405)/((-18)/(-4))). -25/3 (-10984)/3(-1857)/(-165892) - -41 1/67 What is the value of (-843)/309122/12-222? 111 What is (-172533)/(-3519) - 16 - 33? 2/69 What is the value of (-2 + 19 - 10)((-365)/35)/(-1)? 73 (-112)/(-17892)(-180)/(-40) 2/71 114/684((-245)/329 + 1) 2/47 What is the value of 486/474 + 9 + (-390)/39? 2/79 Calculate (43677/(-690) + 64)/((-7)/(-1)). 1/10 What is the value of ((-711)/16116)/(54/48) + (-556)/(-306)? 16/9 What is (-317/68)/(12(-77)/(-1408))? -8/7 Calculate (652/13040 - (-47)/60)54. 45 -4665 + 4606 + 80 + 0 21 Evaluate 10000/(-375) - ((-26)/(-6) - 2). -29 1941 + -1958 + 27 + 1 - 242 -37 What is the value of 52 - (37 - 31114/(-2068))? -1/22 Calculate ((-1)/1)/(((-12)/2)/((-174894)/(-283))). 103 What is the value of (-118)/38 + (992/(-620))/((-304)/20)? -3 ((-4632)/1930)/((-198)/15) 2/11 Evaluate ((-1261)/194)/(5840/(-224) - -26). 91 What is -38 + (-3160)/(-79) - 122/62? 1/31 Calculate ((-30850)/(-350) - 82)/((-1)/(-7)). 43 Calculate (-2844)/62 - 2908/22537. -46 Calculate (-44352)/3584(6/18 + -3). 33 Calculate -14 - (-41)/15(-33864)/6640010/(-1). -3/50 132/(-36) + (132/18)/11 + 140/(-8) -41/2 What is (-26)/(-24)(-6 - (-4 - -6))? -26/3 What is the value of (-13200)/1056 + (-2)/(-4) + 15? 3 Calculate 8/(-18)46641/17768. -7/6 ((-351)/1365)/((-22)/3850) 45 Calculate (-7)/(-77)(30/(-55) - 923/143). -7/11 Calculate (-8340)/240 + (-8 + 31 - -1). -43/4 Evaluate 9/(18/142) + (-806)/2821 + 12/(-7). 69 What is (131/((-163488)/1768) - 1/(-12))(-282)/8? 47 Calculate (-13)/((-988)/(-1736)) + 1236/(-7828). -23 What is (-156)/(-288)10296/6006? 13/14 Calculate ((-3723)/(-365))/(11 - (-530)/(-50) - 2/20). 34 -4(-25)/(-200) + 11/18 1/9 What is (-1320)/4400 - (2169/(-30) - 4) - (-14)/(-1)? 62 What is the value of ((-1540)/(-30)24/132)/(((-44)/24)/(-11))? 56 (19656/3549)/(6/39) 36 What is 14(-11)/231 - (-1)/(105/259)? 9/5 Calculate 125/(201250/178756) + -111. 1/35 Evaluate (-7)/2(-120)/(-300) + (-3933)/(-2745). 2/61 What is the value of 9/7((-9856)/(-660))/32? 3/5 What is the value of -6 - ((-18)/(-14) - (-56 - -59))7? 6 Evaluate (-840)/((-13650)/(-130)) - (1 + -2)-1. -9 What is the value of ((-9213)/(-185) + -46)/((-69)/315 - (-8)/28)? 57 Evaluate ((-4)/9)/((300/(-90))/(440/(-24))). -22/9 What is ((-158)/(-553))/(4/(-196)-7)? 2 ((-21)/((-221130)/3267) + (-2)/26)72/(-1386) -2/165 Evaluate -4(858/(-156))/(4/2). 11 What is the value of (-2530)/(-176)(-1644)/(-2055)? 23/2 What is the value of (-936)/84 + 200/(-70)? -14 Calculate 6/(-24) - 28/(-336)483. 40 Calculate (-4)/9 + 2695/495 + (42/(-11) - 1). 2/11 ((-34)/51)/((-1589)/(-21792)) -64/7 Calculate -74 + (0 - 0 - (-7 - (29 - 35))). -73 What is (-29)/(261/4) + (-980)/(-2070)? 2/69 602/(-42) + 2584/304 -35/6 What is (-19 + (-14)/(-208)220640/784)/((-2)/48)? 18/13 Evaluate 21932/38381 + 4(-142)/14. -40 What is the value of ((-9951)/428)/(3/(-4))? 31 Evaluate 503300/(-3136) + 36 + (-8)/(-128) - 8/14. -125 What is (-401)/401 - (-63)/72? -1/8 -672(-258)/(-8127)((-108)/8)/(-3) -96 Calculate (4 + (-5590)/1204)-126. 81 What is (4945/645)/(1564/15300)? 75 1802/450515/16 3/8 9 - -3 - 0 - ((-184)/(-2))/(-23) 16 (-10)/(-90)5/450 0 What is (360/44 - 8/44) + (56610/37)/45? 42 Evaluate (39/(-6) + 2)/((-4341)/(-37622)). -39 What is (-8)/((-72)/(-81)) - ((-8)/6 + (-34825)/4515)? 2/43 Evaluate (-278)/14 - (-1979 + 1960). -6/7 Evaluate ((-22330)/(-957))/(1365/(-468)). -8 What is (4/66)/((-11505060)/956340)? -2/397 (12 - 50/8) + (120/15 - 19) -21/4 ((-62)/3)/1-3 + (86 + 563)/59 73 (17887/4039 + (-6)/14)/((-24)/258) -43 What is (-445632)/(-118800) - ((-596)/(-150) + -4)? 34/9 Evaluate 3410/(-60)2 - -101. 60 2679/537 -	{ "pile_set_name": "DM Mathematics" }
+ 3/4tf - 3/2t*2 - 3/4t = 0. -1, 1, 2 Let i(b) be the first derivative of -3b2 + 2/3b*3 - 8b - 172. Factor i(z). 2(z - 4)(z + 1) Let f(b) be the third derivative of b*5/240 - 139b*4/48 + 19321b*3/24 - 447b2. Factor f(c). (c - 139)2/4 Let w(i) be the first derivative of 37 - 8/3i2 - 2i + 2/15i5 + 0i*4 - 4/3i*3. Factor w(q). 2(q - 3)(q + 1)3/3 Suppose 10895 - 10499 + 33u - 8u - u2 = 0. Calculate u. -11, 36 Let t(m) be the first derivative of -m6/9 - 124m*5/5 - 5671m*4/3 - 47712m*3 + 242109m*2 - 333396m + 5008. Suppose t(y) = 0. Calculate y. -63, 1, 2 Let m(p) = -p*3 - 11p*2 - 3p + 13. Let n(c) = c*3 + c - 1. Suppose r = -2f - 4, 3f + 12r + 1 = 13r. Let l(u) = fm(u) - 2n(u). What is k in l(k) = 0? -1, 1, 11 Suppose 3o = -6, r - 553 = 4o + 230. Let z = r - 775. Suppose -8/19v + z + 8/19v3 - 2/19v*2 + 2/19v*4 = 0. Calculate v. -4, -1, 0, 1 Suppose 2i = -4z - z + 495, 3z - 2i = 281. Suppose -zq + 5q4 + 46q + 5q3 - 5q*2 + 46q = 0. Calculate q. -1, 0, 1 Let i be 10808/2316(-14/(84/9) + 1). Suppose -ij2 + 5/3j + 1/3j3 + 14/3 = 0. Calculate j. -1, 2, 7 Let z(o) be the first derivative of -27/14o*2 - 52/7o*3 + 3/7o + 43. Factor z(a). -3(4a + 1)(13a - 1)/7 Let k be 21/(-49) - ((-80)/64)/(63/5148). Determine r, given that 44r2 + 208/7 + kr + 30/7r4 - 418/7r*3 = 0. -2/3, -2/5, 2, 13 Let v = 52380 + -52380. Let q = 1 - -1. Suppose vr + 0rq + 0 + 4/3r*4 - 1/3r*3 = 0. Calculate r. 0, 1/4 Let p be 1392/522(-5)/(-24). Factor -1/9u2 + pu - 2/3. -(u - 3)(u - 2)/9 Let d = -25212 - -25215. Factor 1/2b*4 + 0 + 0b + 0bd + 0b2. b4/2 Let c(x) be the first derivative of -x5/5 - x4/3 + 2x3/3 + 2x*2 + 7x + 81. Let j(s) be the first derivative of c(s). Determine l, given that j(l) = 0. -1, 1 Let t(w) be the first derivative of 81w4/16 - 9w*3/2 + 3w*2/2 - 3w - 50. Let h(m) be the first derivative of t(m). Factor h(n). 3(9n - 2)*2/4 Let k be 4 - (-2 + (-4)/(-2)). Suppose -4x + 16 = -k. Solve -4r2 + xr*2 - 4r2 + r2 = 0. 0 Suppose -36p = 2n - 41p + 24, 22 = -5n + 3p. Let x(r) = 21r + 45. Let t be x(n). Factor 4/17u2 + 2/17u*t + 0u + 0. 2u2(u + 2)/17 Let c = 59671/9 + -6630. Let n(y) be the second derivative of 0 - cy4 + 0y*3 - 1/63y*7 + 0y*2 - 5y + 0y6 + 1/10y*5. Solve n(x) = 0. -2, 0, 1 Let r(i) be the first derivative of -5i7/14 + i6/3 + i*5/4 + 26i + 44. Let n(j) be the first derivative of r(j). Find m such that n(m) = 0. -1/3, 0, 1 Let w(c) = c*5 + 2c4 + c3 + c. Let k(y) = 39y4 - 114y*3 + 135y*2 + 3y. Suppose 0 = -4f + 7 - 19. Let t(x) = fw(x) + k(x). Solve t(v) = 0 for v. 0, 3, 5 Let s be (-64)/(-6)(-9)/(-6)1/4. Let w(i) be the third derivative of 0 + 2i3 - 5/8i*s + 0i + 1/20i5 + 6i*2. Factor w(u). 3(u - 4)(u - 1) Suppose -31u + 4u = 17u. Let q(c) be the second derivative of 12c + 4/3c*4 + 0c*2 + 1/5c*5 + 8/3c*3 + u. Find o such that q(o) = 0. -2, 0 Let k = 18820268570/1067 - 17638494. Let g = -6/97 - k. Factor -238/11u*4 + 98/11u*5 + 134/11u*3 - 32/11u + gu2 - 8/11. 2(u - 1)*3(7u + 2)2/11 Let o(q) = -q2 - 20q - 16. Let h be o(-19). Let a(w) be the second derivative of -6w + 1/6w*4 + 0 + 4w*2 + 4/3w*h. Suppose a(i) = 0. Calculate i. -2 Let r(a) be the first derivative of 2a*3/15 + 10a*2 - 3135. Factor r(f). 2f(f + 50)/5 Let u(q) be the third derivative of -q6/420 - q5/42 + q4/84 + 5q*3/21 + 1438q*2. Factor u(f). -2(f - 1)(f + 1)(f + 5)/7 Let i(s) be the first derivative of -s*3/9 + 1663s*2/12 - 277s/2 + 7115. Find k such that i(k) = 0. 1/2, 831 Suppose -2n - 3w = 2, 4w - 8 = 3n + 12. Let l be 1 + ((-203)/63 - n). Find i such that li - 14/9 - 2/9i*2 = 0. 1, 7 Suppose 5522927o + 162 = 5523008o. Factor -2/3 - 1/6b*3 - 11/6b - 3/2bo + 1/6b*4. (b - 4)(b + 1)*3/6 Let i = -67 + 79. Suppose 5n = -5g + 20, i = 4g - n - 9. Factor 121p2 - 2p*3 + 2p*g - 121p*2. 2p*3(p - 1)(p + 1) Find u, given that -u5 - 3u*4 + 31u*4 - 112u*2 + 282u*2 - 198 - 142u - 140u3 + 283u = 0. -1, 1, 3, 22 Suppose 0 = -p - 0p + 3. Suppose pk - 6k + 2q = -22, 0 = 3k - 5q - 28. Factor 5d - d + kd - 3d2 + 2d. -3d(d - 4) Let v(s) = 27s - 2860. Let d be v(106). Let q(r) be the first derivative of -2 + 2/39r*6 + 0r*4 + 0r + 0r3 + 2/65r*5 + 0r*d. Factor q(k). 2k*4(2k + 1)/13 Let z(k) be the second derivative of k5/60 + 277k*4/36 + 6k - 116. Factor z(h). h*2(h + 277)/3 Let b(w) = -94w2 - 2035w - 12446. Let o(x) = 131x2 + 3053x + 18670. Let t(l) = 7b(l) + 5o(l). Factor t(v). -3(v - 346)(v + 6) Let u(k) be the first derivative of -169k4/12 - 11609k*3/9 + 1792k*2/3 - 92k - 3033. Factor u(b). -(b + 69)(13b - 2)2/3 Let m(p) be the first derivative of p6/6 + p5/5 - p4/2 - 2p3/3 + p2/2 + p + 2665. Solve m(b) = 0 for b. -1, 1 Factor 326g + 70g2 - 648 - 78g - 892 - 74g2. -4(g - 55)(g - 7) Suppose -4f - l - 2267 = 2l, 3f - 4l + 1669 = 0. Let w = f + 566. Factor 0o + 0 + 1/2ow + 1/2o*2 - 1/2o*5 - 1/2o4. -o2(o - 1)(o + 1)2/2 Let w(x) be the first derivative of x3 + 108x2 + 3021x + 207. Factor w(k). 3(k + 19)(k + 53) Let n(l) be the third derivative of -l*6/1020 - 47l*5/510 - 67l*4/102 - 88l*3/51 - 3l*2 - 169l. Factor n(j). -2(j + 1)(j + 2)(j + 44)/17 Let g(a) be the third derivative of 3a*5/10 + 203a*4/3 + 60a*3 + 4449a*2 - a. Factor g(t). 2(t + 90)(9t + 2) Let y be (((-46)/22 - -2) + 47960/(-4840))/(-3). Suppose yi - 5 + 5/3i*2 = 0. Calculate i. -3, 1 Suppose -4k + 6k + 86 = 4j, 28 = 2j + 4k. Determine y, given that -jy + 0 - 4/3y2 = 0. -15, 0 Let b(c) be the third derivative of -c7/2520 + c6/1440 + c5/15 - 11c4/18 + 16c*3/9 + 1825c*2. Solve b(a) = 0 for a. -8, 1, 4 Let p be 234/19530/(-4). Let l(z) = -z*2 + 10z + 171. Let f be l(p). Factor f + 0g + 1/5g2. g2/5 Let c(q) be the third derivative of q6/60 + q5/60 - q4/12 + q3/6 + q*2. Let x be c(2). Solve -xh - 2h4 - 6h*2 + 13h + 4h4 = 0 for h. -1, 0, 2 Suppose -2b - 2s + 102 = 0, 3s + 202 = 4b + 5s. Let a be b/15(-6)/(-10). Solve 8/3i*a + 4/3i - 5/3i4 + 0 - 7/3i*3 = 0. -2, -2/5, 0, 1 Let i(l) = 4l*2 - 263l + 485. Let h(s) = -s*2 + 9. Let q(t) = -5h(t) - i(t). Let q(m) = 0. Calculate m. -265, 2 Let r(q) = 2q2 + 31q + 74. Let b be 1((-14)/28)/(1/2). Let f(w) = -w2 + w - 1. Let s(j) = br(j) + f(j). What is t in s(t) = 0? -5 Let r(a) be the third derivative of a6/1320 + a5/110 + 5a4/264 + 1942a*2. Factor r(k). k(k + 1)(k + 5)/11 Let c(y) be the third derivative of -y6/360 - y5/15 - 5y*4/8 - 31y*3 - 17y*2 + y. Let a(t) be the first derivative of c(t). Factor a(h). -(h + 3)(h + 5) Let n(b) be the first derivative of 7b4/12 - 25b*3/3 + 8b*2 + 20b/3 - 382. What is z in n(z) = 0? -2/7, 1, 10 Let x(f) be the third derivative of -2f - 1/84f*8 - 4/5f*5 + 0 + 4/3f*4 + 0f*3 + 1/15f*6 + 2/35f*7 + 104f*2. Find w such that x(w) = 0. -2, 0, 1, 2 Let x(m) = -256m*3 + 495m*2 + 786m + 237. Let w(p) = 1536p3 - 2975p*2 - 4717p - 1420. Let t(b) = -6w(b) - 38x(b). Factor t(v). 2(v - 3)(16v + 9)2 Factor -65687s*2 + 131368s*2 - 621 - 65684s*2 + 216s. -3(s - 69)(s - 3) Let y be 2107/(-903)(-2)/154. Let m(b) be the second derivative of 0 - 1/110b*5 + 1/66b*4 + yb*3 - 1/11b*2 + 14b. Factor m(w). -2(w - 1)2(w + 1)/11 Let u be 0 + (-740)/(-78) + -14 + 3420/247. Factor -8 - uw - 32/9w*2 - 4/9w*3. -4(w + 2)(w + 3)2/9 Find g such that -44/5g + 32/5 + g2 = 0. 4/5, 8 Let u(q) be the third derivative of -q8/2352 - 19q7/1470 - 13q6/140 + q5/3 + 25q4/21 + 17q*2 + 69q. Suppose u(d) = 0. What is d? -10, -1, 0, 2 Let k(r) be the third derivative of r7/2520 - r5/120 + r*4/36 + 17r*3/2 + 2r2 - 3. Let m(o) be the first derivative of k(o). Let m(z) = 0. What is z? -2, 1 Let c(i) be the second derivative of -i4/108 - 1306i3/27 - 852818i*2/9 - 6i - 318. Determine d so that c(d) = 0. -1306 Let q(v) be the first derivative of 0v*2 - 1/	{ "pile_set_name": "DM Mathematics" }
3, 2, -3, -6 Put -83, -1145, 1 in increasing order. -1145, -83, 1 Put 1, 1/7, -1/13, 5, -0.1 in increasing order. -0.1, -1/13, 1/7, 1, 5 Sort 2977, 1, 3, 5, 8, -2 in increasing order. -2, 1, 3, 5, 8, 2977 Put 0.35, -0.03, -0.5, 2, -4, 0.07 in decreasing order. 2, 0.35, 0.07, -0.03, -0.5, -4 Put -0.02, 0.04, 3, 0.2177, -4 in descending order. 3, 0.2177, 0.04, -0.02, -4 Put -5/4, -4, 8, -0.29, -1/7, 11 in descending order. 11, 8, -1/7, -0.29, -5/4, -4 Sort 5, -4, 74, 0, -11 in descending order. 74, 5, 0, -4, -11 Put 0, -4, 247, -6, -1/35 in decreasing order. 247, 0, -1/35, -4, -6 Sort 1/5, 0, -0.209 in descending order. 1/5, 0, -0.209 Sort -46, 0, 2/9, 1.86, -2 in descending order. 1.86, 2/9, 0, -2, -46 Put -1, 20, 5622 in descending order. 5622, 20, -1 Put 7, 69, 0, -7, 3, -40 in ascending order. -40, -7, 0, 3, 7, 69 Sort 3/2, 7, 5, -24, 2 in decreasing order. 7, 5, 2, 3/2, -24 Put -0.5, 0.2, 1, -10, -27 in increasing order. -27, -10, -0.5, 0.2, 1 Sort -3, 24, 0, 3, 4 in decreasing order. 24, 4, 3, 0, -3 Sort -3, -0.2222, -1, 0.5 in decreasing order. 0.5, -0.2222, -1, -3 Sort -113, -5, 0, -2, -0.42 in descending order. 0, -0.42, -2, -5, -113 Put -0.1, 2/9, 23, 10, -5 in decreasing order. 23, 10, 2/9, -0.1, -5 Put 5, -3, 10, -5, -189 in descending order. 10, 5, -3, -5, -189 Put 4, -3, -89, 1, -4, -79 in increasing order. -89, -79, -4, -3, 1, 4 Sort -4, -532, 2, 35 in ascending order. -532, -4, 2, 35 Sort 0.5, 6, -4, 3/4, -457 in decreasing order. 6, 3/4, 0.5, -4, -457 Sort 0, -87, -5, 17 in increasing order. -87, -5, 0, 17 Put -3, 0.3, -4, 64, 0.9, 1/10 in decreasing order. 64, 0.9, 0.3, 1/10, -3, -4 Sort 150, 38, 0.2, -2/83, -2/3, 4 in ascending order. -2/3, -2/83, 0.2, 4, 38, 150 Sort -15, -4, -57, -79. -79, -57, -15, -4 Sort 0.2, -325067, -5, 2, -0.4, 4 in decreasing order. 4, 2, 0.2, -0.4, -5, -325067 Put -4, 222, 1, 27 in decreasing order. 222, 27, 1, -4 Sort 5, -2, 23, 3, 11, -7 in ascending order. -7, -2, 3, 5, 11, 23 Put -5, -3, 550, 2, 16 in increasing order. -5, -3, 2, 16, 550 Put 18669, 0.4, 7/3, -2, 5 in decreasing order. 18669, 5, 7/3, 0.4, -2 Sort -2416, 3, 2 in ascending order. -2416, 2, 3 Sort 2.6, -32, -5, -2/3 in decreasing order. 2.6, -2/3, -5, -32 Put -27, 1/6, 1/11, -3, -5/2 in decreasing order. 1/6, 1/11, -5/2, -3, -27 Sort 5, -3, -0.019, -1, -85/7, -1/4 in increasing order. -85/7, -3, -1, -1/4, -0.019, 5 Put 1, 18, -1, -506 in ascending order. -506, -1, 1, 18 Put 2/9, -85, 0, -0.4, 0.08 in decreasing order. 2/9, 0.08, 0, -0.4, -85 Put -100, -18, -2 in increasing order. -100, -18, -2 Put -290, 4, -71, -4, -2 in descending order. 4, -2, -4, -71, -290 Put -5, -28, -43 in decreasing order. -5, -28, -43 Sort -3/5, -10, -0.2, 233, 4 in increasing order. -10, -3/5, -0.2, 4, 233 Sort -1, -905/12, -3 in ascending order. -905/12, -3, -1 Put -5, 3, -4, 168, 4 in decreasing order. 168, 4, 3, -4, -5 Put -19, -7540, -4 in descending order. -4, -19, -7540 Sort -43.3, 2, 24 in increasing order. -43.3, 2, 24 Sort 13, 3, -2, 1, -3, -12 in descending order. 13, 3, 1, -2, -3, -12 Put -0.3, 2, -390, -6, 0.4 in increasing order. -390, -6, -0.3, 0.4, 2 Sort -0.5, -566, 6/11 in descending order. 6/11, -0.5, -566 Sort 7, -19, -557. -557, -19, 7 Sort 264, 5, -186 in descending order. 264, 5, -186 Sort 2462, 1, -1 in descending order. 2462, 1, -1 Sort -1, 11, 5, -4, -16 in increasing order. -16, -4, -1, 5, 11 Sort -5, -2, -2/103, -60. -60, -5, -2, -2/103 Put 2, 3, -14312, 8 in descending order. 8, 3, 2, -14312 Sort -4, -5, -2, -10, 0, -2434 in ascending order. -2434, -10, -5, -4, -2, 0 Sort 16, 1/5, -0.2, 0.07, 0. -0.2, 0, 0.07, 1/5, 16 Sort 1/31, -82/7, -2 in descending order. 1/31, -2, -82/7 Sort -11, 2, 157, -1 in ascending order. -11, -1, 2, 157 Sort -18, 13, 458. -18, 13, 458 Sort 1/11, 1/382, -2/5, 6/11, -3 in ascending order. -3, -2/5, 1/382, 1/11, 6/11 Sort -1, 3, 0, 0.226, 0.5. -1, 0, 0.226, 0.5, 3 Sort 67/5, -1/10, -1/3, 1653 in increasing order. -1/3, -1/10, 67/5, 1653 Put 26, -2, -1, 38, -5, 6 in descending order. 38, 26, 6, -1, -2, -5 Sort 1868, 2, 5, 7 in increasing order. 2, 5, 7, 1868 Sort -186, -2, -63. -186, -63, -2 Sort 3, 31, 94, 2 in increasing order. 2, 3, 31, 94 Put 10, 3083, -5, -4 in decreasing order. 3083, 10, -4, -5 Put -62, -4, 10 in descending order. 10, -4, -62 Sort 299942/27, 0, 0.1 in decreasing order. 299942/27, 0.1, 0 Sort -2, -156, 5253. -156, -2, 5253 Sort 2/15, 149/3, 3, -4. -4, 2/15, 3, 149/3 Sort 0.3, -0.5, -0.06, 4, -2/9. -0.5, -2/9, -0.06, 0.3, 4 Sort 5, 85, -834 in decreasing order. 85, 5, -834 Put 2, 25, -0.16, 3, 0.09 in decreasing order. 25, 3, 2, 0.09, -0.16 Sort 797, 5/2, -121. -121, 5/2, 797 Sort 2, 4, -105 in decreasing order. 4, 2, -105 Sort 0.4, -2/563, 0.2, -2/9, -8 in descending order. 0.4, 0.2, -2/563, -2/9, -8 Put 5, -2, -143893, 1 in descending order. 5, 1, -2, -143893 Sort -40, 1/11, 3, 14.8, 0.5. -40, 1/11, 0.5, 3, 14.8 Sort 0, -242.91, -4 in descending order. 0, -4, -242.91 Sort 4, -1, 4902, 29 in increasing order. -1, 4, 29, 4902 Put -4984, -4, -1, 80 in decreasing order. 80, -1, -4, -4984 Sort -1662, 18, -11. -1662, -11, 18 Put -0.4, 0.088, 4, -0.3, -0.2 in descending order. 4, 0.088, -0.2, -0.3, -0.4 Put 229628, 0, 4 in increasing order. 0, 4, 229628 Sort -1/6, -119, -4, -34, -2/3 in decreasing order. -1/6, -2/3, -4, -34, -119 Sort -1, 11, -10, -5, 2, 1. -10, -5, -1, 1, 2, 11 Sort -151, 4, -2, 2, -16 in descending order. 4, 2, -2, -16, -151 Sort -3, 0, 8, 9, -147 in increasing order. -147, -3, 0, 8, 9 Put 0, -2, -7, 2, -1253, 5 in decreasing order. 5, 2, 0, -2, -7, -1253 Sort -3, -68, -1, 1755 in descending order. 1755, -1, -3, -68 Put 1, 127, 14, -76, -5 in increasing order. -76, -5, 1, 14, 127 Sort 15, -3, 0, 23 in ascending order. -3, 0, 15, 23 Put 13, 493, 1 in ascending order. 1, 13, 493 Sort 7, -17, 14, 76. -17, 7, 14, 76 Sort -5, -334, 1, 0, -6, 4 in decreasing order. 4, 1, 0, -5, -6, -334 Sort 3, -3, 1, -5, -1, 225. -5, -3, -1, 1, 3, 225 Sort 6, 8, 3, 101 in decreasing order. 101, 8, 6, 3 Sort -47, -1, 3, 4, -4. -47, -4, -1, 3, 4 Sort 42, 2, -10 in increasing order. -10, 2, 42 Sort -80, -1/3, -513/2, 0.4 in decreasing order. 0.4, -1/3, -80, -513/2 Put 5, 533, -5, 10 in ascending order. -5, 5, 10, 533 Sort -2, -19, 1, -4, -1, -9. -19, -9, -4, -2, -1, 1 Sort -741, -33, 0 in decreasing order. 0, -33, -741 Put 4, -4, 18, 0, 1 in decreasing order. 18, 4, 1, 0, -4 Sort -4.882, -3, 10, -1/2, 3. -4.882, -3, -1/2, 3, 10 Put 5, -3, 1454, 0 in descending order. 1454, 5, 0, -3 Put -1, -0.15, -3, -0.2, -21/23, 3 in decreasing order. 3, -0.15, -0.2, -21/23, -1, -3 Sort 4, 19, -78, -5, -4 in descending order. 19, 4, -4, -5, -78 Sort -5, -0.924, -1, 2/7 in descending order. 2/7, -0.924, -1, -5 Sort 2/13, 0.6, 4, -17, -3/2, -3. -17, -3, -3/2, 2/13, 0.6, 4 Put -0.051, 1/12, -0.24 in increasing order. -0.24, -0.051, 1/12 Put -2, -110, 8 in decreasing order. 8, -2, -110 Put -288, -25, -4, 2 in ascending order. -288, -25, -4, 2 Put -1/7, -1, 2/3, 5, -4/37 in decreasing order. 5, 2/3, -4/37, -1/7, -1 Sort 136, -20, -5, 3 in ascending order. -20, -5, 3, 136 Sort -730, -2, 12, 1. -730, -2, 1, 12 Put -5, -9, -8, -2, 5, 15 in descending order. 15, 5, -2, -5, -8, -9 Sort -198/13, -2/7, -5, -6 in decreasing order. -2/7, -5, -6, -198/13 Sort -9, -4, -7, -3, 5. -9, -7, -4, -3, 5 Sort -2, -19, 40 in increasing order. -19, -2, 40 Sort 0, -53, 3, 12, 49. -53, 0, 3, 12, 49 Put -15771, -1, -4, -3 in descending order. -1, -3, -4, -15771 Put 8.1, 132, 5 in ascending order. 5, 8.1, 132 Sort 13142, 2/13, 5 in ascending order. 2/13, 5, 13142 Sort 0.15, -839, 0.4, -2, 1/3 in descending order. 0.4, 1/3, 0.15, -2, -839 Sort -1733, -307, -0.2 in increasing order. -1733, -307, -0.2 Sort -423, 5, -1, -2 in decreasing order. 5, -1, -2, -423 Put -115, 1, -5, -0.07 in ascending order. -115, -5, -0.07, 1 Sort 2/213, 3/8, -1, -2, -7/5 in ascending order. -2, -7/5, -1, 2/213, 3/8 Sort 0.1, -1/5, -33, -14, 2/9 in ascending order. -33, -14, -1/5, 0.1, 2/9 Sort 0, -3, 2, 18, -4 in ascending order. -4, -3, 0, 2, 18 Sort -0.311, 27, -8, 0. -8, -0.311, 0, 27 Put 4, -4027, -3 in descending order. 4, -3, -4027 Sort 0, -3, -1953, -1 in increasing order. -1953, -3, -1, 0 Sort 2/3, 0.03, 1/128 in descending order. 2/3, 0.03, 1/128 Sort 5	{ "pile_set_name": "DM Mathematics" }
(-6)h)/h(h/h(9/4))/h8 assuming h is positive. h(-163/12) Simplify (p15p)/pp6 assuming p is positive. p21 Simplify g14/((g/(g/(g/g(5/8))))/g) assuming g is positive. g(117/8) Simplify b/b5b*(2/9)b*(-7)/bb(1/9) assuming b is positive. b(-35/3) Simplify (g/g(-3/7))/g(3/7) assuming g is positive. g Simplify (dd28)/(dd37) assuming d is positive. d(-9) Simplify (j*(-14)j(-1/12))49 assuming j is positive. j(-8281/12) Simplify t4/t(-1/7) assuming t is positive. t(29/7) Simplify t/(t/(t*(-1/2)/tt))t/(t/t(2/3))(t(2/3))(-4/29) assuming t is positive. t(13/174) Simplify ((y2/yy)/y(-3/7))(8/3) assuming y is positive. y(136/21) Simplify z(-17)z(2/59) assuming z is positive. z(-1001/59) Simplify ((a1)(-4/7))37 assuming a is positive. a(-148/7) Simplify (a1)(2/21)(aa*(-2/23))/aa/(a/(aa(-2/13))aa) assuming a is positive. a(-7193/6279) Simplify ((uu*(-8)/uu)/uu)24 assuming u is positive. u(-168) Simplify aa*(-38)a(-12/11) assuming a is positive. a(-419/11) Simplify (o*(2/15)oo)(10/7) assuming o is positive. o(64/21) Simplify (x(1/2))(-2/31)/(x(2/3))11 assuming x is positive. x(-685/93) Simplify (p(pp/((p(-2/31)p)/pp))/p)(2/77) assuming p is positive. p(6/217) Simplify (vv(-11))/(v/(v/(v4/v)vv)v) assuming v is positive. v(-12) Simplify (v(1/4)vv)/((v/((v/v(-2/27))/v))/vv) assuming v is positive. v(143/108) Simplify ((i/((i/i7)/i))/i(-1/3))/(i(-3/10)ii(-1)) assuming i is positive. i(259/30) Simplify (p1/p)(-23)/((p/(pp(1/2))p)/(pp6)) assuming p is positive. p(13/2) Simplify (j(3/26)j)/(jj(jjj*(15/4)j)/j) assuming j is positive. j*(-345/52) Simplify (r/(r/(rr/r29)))/r5 assuming r is positive. r(-32) Simplify l12l(3/23) assuming l is positive. l(279/23) Simplify (ooo/o(-2/9))/(o1o)((oo*6o)/o)/(o/(o(o5o)/o)) assuming o is positive. o(119/9) Simplify (v/(v/v0)v/(vv/(v*(-1/5)v)))33 assuming v is positive. v(-33/5) Simplify (v(-10))(-26) assuming v is positive. v*260 Simplify (((t(t0/t)/t)/t)44)35 assuming t is positive. t(-3080) Simplify (s(-7/2)/s)(4/29) assuming s is positive. s*(-18/29) Simplify (((vv*(-6/7))/vv)/vv/(v(1/4)v))(-6/19) assuming v is positive. v(93/266) Simplify ((k(1/5)/k)(-2/79))(-18) assuming k is positive. k(-144/395) Simplify l*7/(l/((ll18)/l)) assuming l is positive. l24 Simplify (x*(-3/2)x)*(-48/7)x(-10)/(x(-6)/x) assuming x is positive. x(3/7) Simplify (s(-1/2))22 assuming s is positive. s(-11) Simplify (((u((uu/u*5u)/u)/u)/u)(1/44))38 assuming u is positive. u(-38/11) Simplify (((q(-6)/q)/q)/(q/((q/(qq(-2))q)/q)))/(q/q*(2/7)q)(-4/21) assuming q is positive. q(-327/49) Simplify (b/((bb5b)/b))/bb(-16)b assuming b is positive. b*(-21) Simplify (((j/(jj*(5/3)))/j)/(jj(-13)))(1/54) assuming j is positive. j(14/81) Simplify (r/r15)/r(-1/9) assuming r is positive. r(-125/9) Simplify (q(-3))(1/5) assuming q is positive. q(-3/5) Simplify ((((d(-6)d)/d)/d)/(d/d(-2/69)))(-2/123) assuming d is positive. d(1108/8487) Simplify (((f(-1/3)f)/f)/f(-1/3))/(f(3/2)f5) assuming f is positive. f(-13/2) Simplify (h0)(-2/21)/(hhhh/(h/(h/h*(-2/3)))hh(1/2)) assuming h is positive. h(-37/6) Simplify ((mm(-1/4))(-2/103))(-47) assuming m is positive. m(141/206) Simplify g(2/7)/(g0/g)(g/((g/(gg*(2/29)g))/g))/(gg/g(3/2)) assuming g is positive. g(1565/406) Simplify ((n(2/13)n)(20/11))(-6/13) assuming n is positive. n*(-1800/1859) Simplify ((nn/n0)/n)(-13) assuming n is positive. n(-13) Simplify q(-15)/(q/(q9/q)) assuming q is positive. q(-8) Simplify u(11/3)/u(-1) assuming u is positive. u(14/3) Simplify v5/(vvv(2/27)) assuming v is positive. v(79/27) Simplify (v(v(-2)/v)/vv)*(-40)/(vvv2vv/(v(-6)v)) assuming v is positive. v69 Simplify a/(a/a(-5))a/a(-7)aa/a(-3)aaa(2/17) assuming a is positive. a(172/17) Simplify (c1)(1/22)(cc(-2))(18/11) assuming c is positive. c(-35/22) Simplify (h/(h(-1/3)h))(31/2)/((h1/hh)/h)(-1/45) assuming h is positive. h(31/6) Simplify j*(12/11)((jj(-17))/j)/j assuming j is positive. j(-186/11) Simplify (q(-1/3))(1/31)(q/q(2/11))/q(-3) assuming q is positive. q*(3895/1023) Simplify (u/((uu*(-1/15)/u)/uu))(17/2) assuming u is positive. u(136/15) Simplify bbb*(-2/3)b(-4) assuming b is positive. b(-8/3) Simplify (r6/r3)2 assuming r is positive. r6 Simplify ((s(s3s)/s)/ss)/(ss*(-3/7))(s/s*5)/((s(ss(-1/8)s)/s)/ss) assuming s is positive. s(-137/56) Simplify y(-12)yy21/yy assuming y is positive. y10 Simplify (d(-2/11)/d)/ddd*2(((d*1d)/d)/d)2 assuming d is positive. d(9/11) Simplify (c/c*1c)/c*(-2/15)(c/(c/(cc(-2/5))))/(c/(ccc(cc(c*(-1)c)/cc)/cc)) assuming c is positive. c(86/15) Simplify ((j(-6)/jj)/jjjj/(j/(j/((((jj(-1/3)j)/jj)/j)/j))))13 assuming j is positive. j(-143/3) Simplify (mm/m*16)/(mm*(-20)/mmm) assuming m is positive. m4 Simplify m(8/7)/m(10/11) assuming m is positive. m(18/77) Simplify ((z(2/9)z)/zz(2/9)/z)33 assuming z is positive. z(-55/3) Simplify ((w/(ww*(-2)w))/(w(-2)/w))(-27) assuming w is positive. w*(-108) Simplify ((tt/(t*7t)t)/t2)(15/8) assuming t is positive. t(-105/8) Simplify (gg*(4/7))/(((gg(g37g)/g)/g)/g) assuming g is positive. g(-248/7) Simplify (s(-2/19))(-1/7) assuming s is positive. s(2/133) Simplify ((ggg/(g/(g/g*(-4/9)g)))/ggg(5/6))/(g1)(12/17) assuming g is positive. g(1399/306) Simplify (b/b*(1/3)bbb*(-2)b)/(b/b(-1/4))(5/2) assuming b is positive. b*(-35/24) Simplify mm*(-5)m*(-7)(m*(1/4)/mmm)(-5) assuming m is positive. m(-69/4) Simplify (m(-5)/(m/((m(1/15)/mm)/m)))(3/7) assuming m is positive. m(-104/35) Simplify ((k/(k*(-1)/k))/(kk/((k(-4)/k)/k)))32 assuming k is positive. k(-160) Simplify (m(4/7)/m)(-18/7) assuming m is positive. m(54/49) Simplify (m*(1/10)/(mm*(-5)m))(-8/7) assuming m is positive. m(-124/35) Simplify (u(-9/7)/u)/(u/(((u/(u(2/19)/u))/u)/u)u) assuming u is positive. u(-584/133) Simplify (oo(-10))(2/25) assuming o is positive. o(-18/25) Simplify ((i/i1ii)/i)/(i/(ii6))(i/i(-2/11))/i6 assuming i is positive. i(24/11) Simplify (i(-2/3))*(-49)ii(-6)i(1/7) assuming i is positive. i(584/21) Simplify ((p/(pp/p(-9))p)/p8)/(p(-1/3)/pp)35 assuming p is positive. p(-16/3) Simplify (s(2/23))(-13) assuming s is positive. s(-26/23) Simplify (r(-4)/r)9 assuming r is positive. r(-45) Simplify x((x/x*(-18))/xx)/x(x/(x/x(-4)))/xx assuming x is positive. x*15 Simplify (qq(-13))/q(2/11) assuming q is positive. q*(-134/11) Simplify kk*(-2/77)/kkkk/(k(-11/6)/k) assuming k is positive. k(2683/462) Simplify (nn/n(-2/7)nn(3/2))/(n1n(6/7)) assuming n is positive. n(41/14) Simplify (m/m11)/(m/(m37/m)) assuming m is positive. m25 Simplify (u2/uu(-6))/(u(-1/7)uu/(uu(1/9)/u)) assuming u is positive. u(-425/63) Simplify (p(-17))(-19) assuming p is positive. p*323 Simplify (w/(wwww*(-35)))/ww/(((ww(-4/11))/w)/w) assuming w is positive. w(378/11) Simplify ((v4v)/((v*(-1/4)v)/v))/(vv(-1))(3/19) assuming v is positive. v(21/4) Simplify (b(1/3)/b)42/(b(bb/(b/(b2b))b)/b)27 assuming b is positive. b(-163) Simplify (d2)(19/2)/((d(dddd0d)/dd)/d)(-5/3) assuming d is positive. d(77/3) Simplify (zz(-5))(1/16) assuming z is positive. z(-1/4) Simplify ((r(-2))21)(-28) assuming r is positive. r1176 Simplify ((p/(p/((p/p(-3))/p)))/p(-1/4))/(p(2/9)ppp(1/2)) assuming p is positive. p(19/36) Simplify n2n(9/7) assuming n is positive. n(23/7) Simplify b/(b/(b*7b))b(-4)/bb(b1)(-42) assuming b is positive. b(-38) Simplify v(-2/9)v((vv*(2/11)/vv)/v)/vvvv(3/8)v**(-1/3)/v assuming v is	{ "pile_set_name": "DM Mathematics" }
4o)(-3o4 + 197o*3 + 3 - 204o*3 - 6). -6o*5 - 14o*4 - 6o Expand 470u - 16u*4 - 470u + (-1 + 4 - 1)(-667u + 658u - 3u*4 + 5u*4). -12u*4 - 18u Expand 2d - 2d - 3d3 + (0 + 0 - d2)(-1 + 1 + 2d) + (3 + 0 - 1)(-13 + 6 + 4)(-4d*3 - 7 + 7). 19d*3 Expand 90s + 4s + 108s + (-1 + 5 - 2)(0s - 2s + 0s) - 3s + 5s - 4s - 59 + 59 - 49s. 147s Expand (1 + 37 + 88)(1 + 2m - 1 + (-2 + 2 - 6)(3m - 2m + m))(-1 + 1 + 2). -2520m Expand ((2 - 1 + 1)(1 - 1 - 2m) - 7m + 0m + m)(7 + 7 + 1)(m + m - 3m)(1 - 3 + 7). 750m2 Expand (32 - 32 - 12z*2)((0 - 1 - 1)(4z - 3 + 3) - 1 - 2z + 1) + 2z*3 + 0z3 - z3 + z*3 + 0z + 0z + (z2 - z + z)(-4z + z + 5z). 124z3 Expand (-4s*3 + 3 - 3)(s*2 + 0s*2 - 2s*2) + (-7s4 + s4 + 2s4)(-4s + 2s + 0s) + (-4s*2 + 0s*2 + 2s*2)(48s3 - 3s*3 - 11s*3). -56s*5 Expand (-1 + 0 + 2)((-2 + 0 + 0)(-5z*3 + 2z3 + z3) + 114z3 - 12z*3 - 36z*3). 70z*3 Expand -96y*2 + 78 - 78 - 5y2 - y2 + 0y2 + (-2 + 2 - y)(2y - 2y - 2y) + 2y*2 + 2y*2 - 6y*2. -102y*2 Expand -4i*2 - 7 + 2i*2 + 2i + 10 + (2i + 4i - 4i)(-2i - 33i + 17i). -38i*2 + 2i + 3 Expand (2 - 2 + 2)(-1118u + 2107u - 1176u). -374u Expand (-3 + 3 + s2)(-4s + 0s + 5s)(2 - 4 + 0) - 8132 + 300s3 + 8132. 298s*3 Expand (-138j*3 - 75j*2 + 260j*3 + 75j*2)(4j2 + 5j*2 + 5j*2). 1708j*5 Expand (0t - 1 - 3t + 0t)(90t*2 - 101t*3 - 90t*2). 303t*4 + 101t*3 Expand (32 + 3 - 1)(0 - 1 - 3)(-14 + 59 - 28)(-5o + o + 3o)(-2 - 1 + 1). -4624o Expand (-141 + 223 - 110)(3a + 2a - 1 - 3a + 6a - 3a - 2a - a + 4a - 4a + (3 - 1 - 3)(-4 + 4 - 2a) - 3 + 3 + a - a - 4a + 4a). -112a + 28 Expand (-195y - 219y + 481y)(y - 3y - 2y)(3 - 8 + 0). 1340y*2 Expand (-14333 + 14336 + 144k + 131k)(-6k2 - 2 + 2). -1650k*3 - 18k*2 Expand (4k*2 + 5k*2 - 4k*2)(2k2 + 1044 + 1846k - 1044) + 3k4 - 4k*4 + 4k*4. 13k*4 + 9230k*3 Expand (-13s + 4s - 6s)(-6 + 3s*4 + 6) + 2s*5 - 2s + 2s + (1 - 2s - 1)(-3s*4 + 0s*2 + 0s*2). -37s*5 Expand -2c*4 - 4c*4 + 5c*4 + (2135c*3 - 2135c*3 - 81c*4)(3 - 1 + 0 + (-2 + 3 - 3)(2 - 4 + 3) + (3 - 2 + 6)(-6 + 0 + 2)). 2267c4 Expand y2 - y2 + y2 + 0y + y*2 + 0y - 2y2 + y2 + 0y*2 + (5y - 2y - 2y)(3y - 7y + 2y) - 3y2 + 34y - 81y + 198y. -4y2 + 151y Expand (-5c + 2c + c)(-49c*2 + 3c*2 - 132c2) + c3 - 4c3 + 2c*3. 355c*3 Expand (-1079y*2 + 562y*2 + 555y*2 - 6y)(0 + 6 - 3). 114y*2 - 18y Expand 2d4 + 3 - 3d*4 + 3d4 - d3 + d*3 - 52d*4 + 2d4 - d4 + 0d4 + (-2 + 2d*3 + 2)(-d + 4d - d) + 4d4 - d4 - 6d4. -48d*4 + 3 Expand (-1 + 4 - 4)((2 + 0 - 1)(-1 + 1 + i) - 1249487 + 1709i + 1249487 + 4i + 3i - 5i + (2 - 2 - 2i)(3 - 1 - 3)). -1714i Expand (-9133 + 4584 - 3n + 4592)(-29n + 6n*2 + 29n). -18n3 + 258n*2 Expand (2823x - 18857 + 18857)(-5x + 4x + 3x). 5646x2 Expand (6d*3 - 3d*2 + 3d*2)(-5d2 + 11d - 11d) + 2d + d*5 - 2d + d*5 + 3d*5 - 3d5 + (d4 + 7d4 - 10d*4)(2d + 0 + 0). -32d*5 Expand (3 + 0 - 4)(b2 + b2 + 0b2) + 48b*2 - 29b*2 + 122b*2. 139b*2 Expand (0q*2 + 3q*2 + 0q*2 + (-3q + 6q - 2q)(0 + 0 - 2q))(-8 + 318 + 174 + (-1 + 3 + 0)(1 - 4 + 2) + 0 + 2 - 3)(2q*2 - 5q*2 + 4q*2). 481q*4 Expand (-72 + 94 + 152 - 1 - 2 + 1 + 3 - 1 + 0 + 4 - 6 + 1 + (1 - 4 + 2)(1 + 0 - 2) - 6 + 4 + 4)(1 - 5 + 3)(-11 + 2g + 11). -352g Expand (-92565 - 74c + 92565)(3c + 2c - 10c). 370c*2 Expand -23 + 23 - 28f - 2 - 2 + 2 + 3f + (-1 + 5 - 3)(-f + 0f + 2f) + 7f + 4f + 6f. -7f - 2 Expand ((-1 - q + 1)(3 - 5 + 1) + q - 4q + 4q)(0 + 0 + q*2)(44582q - 44582q + 1648q2). 3296q5 Expand -23 + 22 - b3 - 26b2 + 71b2 + (b2 + 5b2 - b2)(0b + 4b - 2b). 9b*3 + 45b*2 - 1 Expand (-3 + 1 - x + 3)((-3 + 113x - 156x + 94x)(-1 + 1 - 3) + 0x + 4x - 3x + (0 - 3 + 1)(2x + 4 - 4) + 5x + 0x - 3x - 3 + x + 3 + 1 - 2x - 1). 155x*2 - 164x + 9 Expand -181b4 - 3b + 3b + (0b*4 + 5b*4 - 2b*4)(1 - 4 + 0) + (-2 + 2 - b)(-2b*3 + 0b*3 + 0b*3). -188b*4 Expand (6 - 6 - 2w)(4w - 3w - 5w)(1 - 3 - 1)(-9w + 13w - 37w). 792w*3 Expand (4 - 3 + 1)(-25 - 87 - 32)(-5h + 2h - 4h). 2016h Expand (1 + 0 - 2)(-2 + 3 - 2)(-227568 + 1050q + 227568). 1050q Expand -4g - 2 + 2 + (6g - 2g - 2g)(2 - 4 + 0) + (-1 - 4 - 3)(10g - 7g + 18g). -176g Expand (168 - 539 - 47)(-3w - 5w + 11w)(-2w2 + 3 - 3 + w). 2508w*3 - 1254w*2 Expand (4v + 4v + 3v)(-5 + 4 + 0)(90v2 - 45v*2 - 3v*2 - 2 - 2v) + v*3 + 3v*3 - 3v*3. -461v*3 + 22v*2 + 22v Expand (-2i + 2i + i*2)(-589 + 285 + 282)(0 - 6 - 1 + 4). 66i*2 Expand (9 - 17 + 14)(-10 - 4 + 0 + a). 6a - 84 Expand (-1 - 2 + 5)(-4 + 4 - c)(4c*3 + 3c*3 - 3c*3 + (-301 + 64 - 339)(-2c + 2c - 2c3)). -2312c*4 Expand -153b*5 + 73b*5 + 77b*5 + (4 + 2b*2 - 4)(3 - 3 + 3b3) - 2b*5 + 4b5 - b5. 4b5 Expand (-3b + b + 0b)(115 - 855 - 747). 2974b Expand (-5 + 0 + 4)(3885d2 - 34d*5 - 3885d*2) - 3d*5 + 5d5 + d2 + 8d2. 36d*5 + 9d2 Expand (0 + 0 - g2)(-g + g - 2g) - 3g3 + 5g*3 - 3g*3 - 68g*3 + 157g*3 - 32g*3. 58g*3 Expand -12n + 5n + 24n - 120n2 - 17n + (-4 + 4 + 2)(-1 + 1 + n2) + 7n*2 + 8n*2 - 4n*2. -107n*2 Expand (1 + 2 - 4)(0 - 1 + 3)(25809t - 295t3 - 25809t - 1411t3). 3412t*3 Expand (15 - 3 - 44)(-45j - 7j + 15j). 1184j Expand (4 - 6 + 0)(16 - 16 + 2o*3) + (1 - 2o*2 - 1)(-58o + 137o - 67o) + 3o - 2o3 - 3o. -30o3 Expand 21 + 2d - 21 + (-2d + 1 - 1)(-4 - 1 - 5). 22d Expand (-3u*3 + 5u*3 - 4u*3)(2u - 2u - u) + (0 + 1 + 5)(42279u - 42279u + 333u*4). 2000u*4 Expand (6 + 10 + 19 - 35 + 16m*4)(33 - 6m - 33). -96m5 Expand -f2 + 4f2 - 2f*2 + (-39f*2 + 43f*2 + 91f*2)(0 - 2 + 0) + (5f - 2f - 2f)(2f - f + 0f). -188f2 Expand (-3k*2 + 12k*2 + 136k*2)(13k + 58 - 58). 1885k*3 Expand -5b*3 + 2b3 + b3 + (3b3 - 4b*3 + 0b*3)(2 - 5 + 2) + b*3 - 2b3 - b3 - 41b3 + 20b - 20b + (4b*3 - 3b3 + b3)(3 - 12 - 1). -64b*3 Expand (-4c + 3 + 3c + 2c)((-1 + 1 - 2c*2)(-70c - 68c - 59 + 135c) + c3 + c3 + c3). 9c*4 + 145c*3 + 354c*2 Expand (0g2 + g2 - 2g2 + (-87g + 165g - 90g)(-6g - 13 + 13))(-3g + 4g + 2 - 3g). -142g3 + 142g*2 Expand (-232z + 1773 - 215z + 445z)(-1 + 4 - 2). -2z + 1773 Expand (1032l - 169l - 49l)(2l4 + 4l*4 + 3l*4). 7326l5 Expand l - l3 - l + 17l + 30l*3 - 17l + 2l3 - 2l3 - l3 + (-2 - 1 + 5)(3l*3 + 3l*3 - 3l*3) - 3l3 + l3 + 0l3. 32l*3 Expand (-1 + 4 - 4)(-4 + 2 + 1)(0g + 29g + 8g + 9g). 46g Expand 1 - 1 + 2n - 2n + 2n + 2n + (1 + 1 - 4)(5n - 5n - 2n) + 4 - n - 4 - n + 4n - 2n + 2 - 3 + 2n + 3 + (0 - 1 + 3)(-3n + 6n + 0n). 16n + 2 Expand (2i3 + 0i + 0i)(-2i2 + 0i2 + i2) + (0i + 0i - 2i2)(1 - 1 + 2i3) + (0i2 - i2 + 3i2)(-534i3 + 1152i*2 - 1152i*2). -1074i*5 Expand ((0 - 3 + 1)(-4 + 4 + 2) + 0 + 1 + 1 + 2 - 4 + 3 + 2863 - 2221 - 7986 - 5500)(3q*5 - 4q*5 + 0q*5). 12845q*5 Expand -872n*5 - 243n*5 - 2n*4 + 2n4 + (n2 - 2n2 + 2n*2)(-3n + 3n + n*3) + 33n*3 - 33n*3 - 3n*5. -1117n*5 Expand (-6g*2 + 2g2 - g2)(2g*2 + 12327g*3 - 3g*2 - 12640g*3). 1565g*5 + 5g*4 Expand (-93u*2 + 139u*2 + 2u*3 - 44u*2)(-u - 4 + 4) + (5u - 2u - 5u)(-4u3 + 4u3 + u3). -4u4 - 2u*3 Expand (-748 - 231 - 97)(3j - 6j - j). 4304j Expand (-527r - 27r2 + 527r)(r - 5r + 2r)(-383r - 63r - 75r). -28134r*4 Expand (-3 - 2f + 3)(-35 + 109316f*2 + 109324f*2 - 218638f*2 + 19f*3). -38f*4 - 4f*3 + 70f Expand (-4s + 4s - s*3)(s - 3s - s) + (-s2 + 3s - 3s)(0s + 2s*2 + 0s) - 2s4 + 4s*4 - 3s*4 + 666260s + 400s4 - 666260s. 400s4 Expand (-2335 - 2282 + 3245)(r4 - r4 + r*4)(2 - 4 + 0).	{ "pile_set_name": "DM Mathematics" }
t b be l(-8). Let k(o) = -bo - 5o*2 + 3o - 2o3 - 1 + o3. What is the remainder when 23 is divided by k(-5)? 9 Suppose -17 = -4h + 3, -20 = -3l + 5h. What is the remainder when 27 is divided by l? 12 Let r be -1 + (-10)/(-14) - (-111)/21. Calculate the remainder when ((-20)/r)/2 + 47 is divided by 24. 21 Suppose -2q - 2t + 50 - 14 = 0, -3t - 15 = 0. Suppose 26 = -u - 5y, -y + q = 2u - 6y. What is the remainder when 29 is divided by -31 - 18/u? 14 Let g be -4 - (2/1)/2. Let r(o) = -49o + 5. Let x be r(g). Suppose t - x = -4t. What is the remainder when t is divided by 17? 16 Let f = 1320 - 724. Calculate the remainder when f is divided by 13. 11 Let z(h) = -17 + 3 + 1 - 4h + 2. What is the remainder when z(-12) is divided by 10? 7 Let j = 207 - 192. Calculate the remainder when 342 is divided by j. 12 Let k = 935 + -863. What is the remainder when 209 is divided by k? 65 Calculate the remainder when 181 is divided by 14/84(2 + 100). 11 Let x = 65 + -12. Calculate the remainder when x is divided by 14. 11 Let k(q) = -3q + 37. Let m be (12/10)/((-6)/(-15)). Suppose -mo = -2o - 10. Calculate the remainder when k(0) is divided by o. 7 Let x(t) = -t + 4. Suppose -2z + z + q = -23, -119 = -5z + q. Let w be (-46)/8 - 6/z. Calculate the remainder when 28 is divided by x(w). 8 Suppose -5f = -4g + 21, -4f - 20 = 3g - 59. Let v(d) = -2d + 31. What is the remainder when 88 is divided by v(g)? 10 Suppose -42 = -3a - 3f, -32 = 3a - 5f - 98. Calculate the remainder when 48 is divided by a. 14 Suppose -12f - 35 = -15f - 5a, -3a + 2 = -2f. Suppose -s + 35 = 5y + 4s, -2y + 5s = -49. Calculate the remainder when y is divided by f. 2 Suppose -19 = -w - 2l, -5w + 5l + 153 - 118 = 0. What is the remainder when 98 is divided by w? 10 Suppose -101 + 38 = -21d. Calculate the remainder when 59 is divided by d. 2 Let f = 2 - -13. What is the remainder when 154/(-2618) + 2008/34 is divided by f? 14 What is the remainder when (2 - -2) + -30 + 109 is divided by 17? 15 Suppose -5y + 28 = 4j, -3y + 8 = -j - j. What is the remainder when 66 is divided by y? 2 Suppose -6f - 391 = -29f. Calculate the remainder when 44 is divided by f. 10 What is the remainder when (-17)/(-136) + 4317/24 is divided by 37? 32 Suppose 2y + 2d = 84, 3y - 5y - 5d = -75. Let s(o) = -o*3 - 6o*2 + 5o + 10. Suppose 5q + 28 = q. Calculate the remainder when y is divided by s(q). 21 Let t = -143 + 161. What is the remainder when 232 is divided by t? 16 Suppose 4m - 622 = 46. Let r(q) = -9q2 - 95q - 8. What is the remainder when m is divided by r(-10)? 41 Suppose p - 973 = -6p. Suppose -358 = -3z - p. Calculate the remainder when z is divided by 20. 13 Suppose -4a = 25 - 13, 357 = 5q + a. What is the remainder when q is divided by 20? 12 Let u = 95 - 50. Calculate the remainder when 99 is divided by u. 9 Calculate the remainder when 49 is divided by (-4)/(-3) - (-5)/3. 1 Suppose -5u + 5 = 2b + 2b, -u + 5b - 28 = 0. Let z = u - -5. Suppose 0 = -zy + 2 + 4. Calculate the remainder when 13 is divided by y. 1 Let y be (-8)/(-3)6/405. Suppose -5b + 2a - 3a = -103, -ya + 86 = 4b. Calculate the remainder when 56 is divided by b. 16 Let m be (-150)/(-22) - 4/(-22). Suppose 5y - m - 8 = -5d, 0 = -3d - 6. Calculate the remainder when y is divided by 0 - 3/(6/(-8)). 1 Let h(t) = -t2 + 15t - 8. Let l be h(14). Suppose lg = 4g + 100. Calculate the remainder when g is divided by 14. 8 Let k(h) = h*2 - 4h - 11. Let p be k(6). Suppose 4 - p = t. Suppose tn + 62 - 359 = 0. Calculate the remainder when n is divided by 25. 24 Let f be 3 - (-34 + (-5 - -2)). Let d be (-17)/(-2) - 3/6. Suppose dg - f = 4g. Calculate the remainder when 38 is divided by g. 8 Let c(p) = -p2 - 28p - 104. Suppose 4j - 2g - 666 = 0, -5 + 0 = 5g. What is the remainder when j is divided by c(-22)? 26 Suppose 23g - 26g = -90. Suppose 0 = 3v - 0i - 5i - g, 6 = 2i. Calculate the remainder when 149 is divided by v. 14 Let m(r) = 70r - 92. What is the remainder when m(3) is divided by 7? 6 What is the remainder when (4/2)/(2/529) is divided by 13? 9 Let s(x) = -x + 67. Calculate the remainder when 186 is divided by s(14). 27 Suppose 5m + 0m + w = 28, 4m - w - 17 = 0. Suppose -2l = -4n + 122, 0n + 2n - ml = 65. What is the remainder when n is divided by 11? 8 Suppose -4q - 5w = -56, -5q - 15w = -13w - 53. Calculate the remainder when 70 is divided by q. 7 Suppose k = -10 + 36. Calculate the remainder when 79 - (-6 - -4)-1 is divided by k. 25 Let l(j) = -26j - 118. Calculate the remainder when l(-7) is divided by 3. 1 Let t(z) = -5z*3 + 5z*2 + 5z - 10. Let j(r) = 4r3 - 6r*2 - 4r + 11. Let m(w) = 6j(w) + 5t(w). Calculate the remainder when m(-11) is divided by 1. 0 Let a = -203 - -218. What is the remainder when 80 is divided by a? 5 Suppose 0 = -2z - z - 6. Let u(y) = y3 + y + 2. Let l be u(z). Calculate the remainder when (-2)/l + 86/8 is divided by 4. 3 Suppose -2r + 235 = 3r. Calculate the remainder when r is divided by 15/(-2)368/(-115). 23 Let o be 2(-2 - -3) - -2. Suppose -o - 4 = b. Let j(t) = -2t - 11. What is the remainder when 17 is divided by j(b)? 2 Let n(r) = r*2 - 18r - 12. Let x be n(19). Let b(f) = f*3 - 6f*2 - 6f - 1. What is the remainder when b(x) is divided by 4? 2 Let i = -144 - -112. Let y = -23 - i. Calculate the remainder when (5 + 2)/(1/5) is divided by y. 8 Let g(c) = 4c2 - c - 1. Suppose z = 3 + 8. Let f = 17 - z. Calculate the remainder when g(-2) is divided by f. 5 Suppose -4q + 0q = -144. Suppose 132o - 128o - 276 = 0. What is the remainder when o is divided by q? 33 Suppose r + 5 = 5p, 3r - 1 = 4p + 6. What is the remainder when p is divided by 120/54 - 2/9? 0 Calculate the remainder when 91 is divided by (-4)/14 + (8 - (-1190)/49). 27 Let w(f) be the first derivative of -8 + f + 81/2f2. Calculate the remainder when w(1) is divided by 21. 19 Let t(p) = 12p3 + p2 - p + 1. Let l be t(1). Let f(i) = i*3 - 13i*2 + 7i + 2. What is the remainder when f(l) is divided by 148/6 + (-6)/9? 21 Let r(q) = -q*2 + 7q - 9. Let h be r(6). Let w be -3 - 0/h - -7. Let t = w - -21. Calculate the remainder when 47 is divided by t. 22 Suppose -5o + 94 = -111. Suppose -2j - 2j = -4, -j - o = -2g. Calculate the remainder when 41 is divided by g. 20 Let s = -98 - -150. Suppose -s = -3m + 266. Calculate the remainder when 52 is divided by (-15)/(-20) + m/8. 10 Let w(c) = -c2 + 9. Let q(v) = 6v + 2. Let z be q(3). Suppose -4a + z + 48 = 0. What is the remainder when a is divided by w(0)? 8 Suppose -2g + 148 = -10v + 6v, 0 = -g + 5v + 74. What is the remainder when 369 is divided by g? 73 Let v = -4 - -12. Suppose y = -0y. Suppose -17q + 12q + 150 = y. Calculate the remainder when q is divided by v. 6 Suppose -6 = -p - 5. Suppose 4l + 2 = -4w - 14, l - 4w = 1. What is the remainder when 16 is divided by ((-3 + l)/p)/(-1)? 4 Suppose -8q - 100 = -340. What is the remainder when 54 is divided by (q + -15)/(-11-1)? 9 Let o(s) = s*2 - 44s - 293. What is the remainder when o(51) is divided by 32? 0 Suppose 394c - 392c - 46 = 0. What is the remainder when 90 is divided by c? 21 Let p = -534 - -547. What is the remainder when 79 is divided by p? 1 Suppose 0 = -16n + 56 - 8. Suppose t - 4 - 5 = -3q, 3t - 27 = -2q. What is the remainder when t is divided by n? 0 Let x(b) = 31b3 - b2 + b. Let z(o) = -2o*2 - 3o - 16. Let j be z(-5). What is the remainder when x(1) is divided by (-3 - j/9)/((-3)/(-18))? 15 Let k(c) = c*3 + 8c*2 + 10c + 8. Let r(u) = u + 37. What is the remainder when r(42) is divided by k(-6)? 19 Let a = 12 - -7. Suppose r = 6r - 4b - 29, 3r = 4b + a. Suppose 14f + 5f = 361. What is the remainder when f is divided by r? 4 Suppose -4v - 4 = -112. Let k = 75 - 68. What is the remainder when v is divided by k? 6 Let n be (-1 + -5)30/(-45). What is the remainder when 66 is divided by (n/(-6))/(4/(-114))? 9 Let v(r) = r*3 - 6r*2 + 4r - 1. Let z be v(4). Calculate the remainder when 1295/119 - 2/z is divided by 3. 2 Suppose -76 = -5r + r. Suppose 0 = -w - 2o + 32, 2w + 2w - 123 = -3o. Suppose -w = -z - 2z. Calculate the	{ "pile_set_name": "DM Mathematics" }
+ 1 - 1)(-2z + 3 - 3) + (1 - 4 + 1)(4z - z - z) - z - 3 - 3z + 5z + 2z - 3z - 2z. -4z - 3 Expand (-k2 - k2 + 4k2)(-2 + 2 - k*2) + (-5202 + 5202 + 2315k*2)(5k2 - 4k*2 + 0k*2). 2313k4 Expand (-z3 + 0z3 + 0z*3)(2z + 4 - 4)(-263z - 818z + 85z). 1992z*5 Expand (3r3 - r3 - 3r3)(-3 + 6 - 4) + (-r + 822r3 - 825r*3 + 6r)(-1 + 2 + 2). -8r*3 + 15r Expand (5 + 0 - 3)(6 + 0 + 2)(-240q4 - 1416q*4 + 392q*4). -20224q*4 Expand (0 - 1 + 0)(-225 + 37l2 + 225 + (-2 + 0 + 1)(-2l2 + l - l) + (-4 - 5l + 4)(2l + 2l + 3 - 6l)). -49l2 + 15l Expand (-2 - 4 + 2)(18 - 191 - 50)(5l + 3l + 0l). 7136l Expand (3 - 3 - 2w2)(-3w2 - 28w*2 - 81w*2) - 6w*4 - 22w*4 + 5w*4 + 4w*3 - 4w*3. 201w*4 Expand 7h*4 + 17h*4 - 8h*4 - 4h + 4h + 2h*4 + 109h*3 + 28h*4 - 109h3 + (-h2 + h*2 - 2h*3)(1 + 2h - 1). 42h*4 Expand (1707 + 1325 + 966)(-d*4 + 2d*4 - 3d*4). -7996d*4 Expand (25 - 2f*2 - 14 - 3)(0f - f + 0f) - 9f3 - 1316f + 1316f. -7f*3 - 8f Expand 3g - 6g + 2g + 13g + 7 - 7 + (-64 + 64 + 20g)(1 + 0 - 4) + (-4g - g + 6g)(0 - 1 + 0) - 3 + 2g + 3. -47g Expand (-45 + 5379g + 45 - 1452g)(4g - 2g - 6g). -15708g*2 Expand (-19 + 21y + 19 + (3 - 2 - 3)(y + 2y - 2y) + 1 - y - 1)(-15y - 252 + 252)(y*3 - 8y*2 - 2y*3 + 7y*2). 270y*5 + 270y*4 Expand (3 - 3 + 2g)(-1 - 4 + 3) + 3g - 30g - 107g + (3g + 2g - 2g)(1 - 2 + 3). -132g Expand (3a*2 - 7a3 - a3 + 15a3)(152 - 152 + 65a2). 455a*5 + 195a*4 Expand (9 + 42 + 19 + 2q)(15q + 26 - 26). 30q2 + 1050q Expand (-3p + 2p - 3p)(162p - 164p + 994p) + (3p - 5p + 0p)(-2p + 4p - 4p) + 4p2 - 5p2 - p2. -3966p2 Expand (0 - 4 + 1)(-8 - 9 + 14 - 4z)(-1 + 3 - 3)(-6 + 1 - 9). 168z + 126 Expand (-13 + 16d + 13)(3d3 + 12d*3 + 5d*3) + (-d - 2d + d)(-2d*3 + 2d*3 + 2d3) - d4 + 2d4 - 3d*4. 314d*4 Expand (10y - y + 19y)(2y + 0 + 0 + (3 - 1 - 4)(-y + 0y - y) - 3y - 4y + 2y). 28y2 Expand (-r + 2r + r)(439r - 8r + 920r). 2702r2 Expand -11 + 1936t + 6 - 1918t + (0t - t + 2t)(3 + 2 - 6). 17t - 5 Expand (-3s + 28s + 14s - 3s - 3s + 7s - 2s + 1 - 1 + (-4s + 3s - s)(0 + 0 - 2))(186s - 98s - 91s). -126s*2 Expand (-o - 53o*2 + 115o*2 - 52o*2)(o - o - 2o + 0o - 2o + 3o + (-1 + 1 + o)(-1 - 4 + 3) - 6o + 4o + o + 4o - 2o - 3o + 4o - 6 + 6). -10o3 + o2 Expand -72586t - 855t*3 + 72586t + 0t3 + 0t*3 - 2t*3 + (t + 0t - 2t)(-t*2 - t + t). -856t*3 Expand (-16q - 50q + 8q)(-3 + 6 - 9)(6 - 4 + 2). 1392q Expand (-2x + 2x4 + 5x + 8x4)(-3 + 7 + 1) - 29x + 29x - 47x4. 3x*4 + 15x Expand ((2 + 0 - 4)(-3 - 6p*2 + 3) - 20p*2 + 55p*2 + 14p*2)(12p2 + p3 - 8p*2 + 0p*3). 61p*5 + 244p*4 Expand (56175 - 56175 + 389h)(3 - 1 + 0)(5 - 4 - 2). -778h Expand -1507479 - 4080t*2 + 1507479 + (-3t - t + 6t)(4t + t - 3t). -4076t2 Expand (55865j*4 + 56168j*4 - 111082j4 + (-j2 + j*2 - 2j*2)(j*2 + 0 + 0))(-2 + 1 + 5). 3796j4 Expand (13 - 9 + 34)(-3 - 1 - 6)(-2n*2 + 3n*2 - 6n*2). 1900n*2 Expand (-2 + 2 + t)(-4 + 1 + 1) - 9889 + 9889 - 273t + t + 2t - t + 0 - 2t + 0 + (-2t + 0 + 0)(1 + 1 - 4). -271t Expand (4g - 2g + g)(1263g - 2773g - 2594g). -12312g2 Expand (6q*2 + 2q*2 - 3q*2)(38 + 445 + 11 - 121). 1865q2 Expand -132 + 104 + j4 - 6j*4 + (-228 + 228 - 15j)(-5 + 3 + 3)(j*3 - 5j*3 + 5j*3). -20j*4 - 28 Expand 1082w - 70143 + 70143 + (-3 - 1 + 3)(0w + 0w + 2w). 1080w Expand (6z2 - z2 - 4z2)(-z2 - z2 + 0z2) - z4 - 3z*3 + 3z*3 - 138z*2 - 527z*4 + 138z*2 - z - 2z*4 + z. -532z*4 Expand -3b + 3b - 2b*4 - 54b*4 - 55b*4 + 16b4 + (-b2 + b*2 - 2b*2)(-5b2 - 3b*2 + 4b*2). -87b*4 Expand (87z + 86z - 177z)(0z + 6z - z) + (-2 + 0 - z + 3z)(4z - z - z). -16z2 - 4z Expand (46i + 463i - 36i)((-2 - 3 + 2)(1 + 2 - 1) - 2 + 1 - 1). -3784i Expand (-7m2 - 8m*2 + 10m*2)(9 - 9 + 4m) - 2 + 2 - 2m*3 + (-3m2 - m3 + 3m2)(-2 - 1 + 2) + 41m3 + 566m*2 - 566m*2. 20m*3 Expand (-3 - 1 + 3)(3k4 - 4k*4 + 0k*4) - 31k*4 - 29k*4 + 55k*4 + (2k*2 + 3k - 3k)(-4k + 0k + 3k)(4k + 11k + 10k). -54k*4 Expand (-3c + c + 3c)(c - c + 5c3) - 6c + 6c + 5c*4 - 8c*4 + 50c - 50c + (-4c*2 + 4c*2 - 2c*3)(c - 5c + 3c) + c*4 + 4c*4 - 3c*4. 6c*4 Expand 9o2 + o3 - 9o2 - 2o*3 + 0o*3 + 4o*3 + (0o*2 + 2o*2 - 4o*2)(o + o + 0o) + (2o + 2 - 2)(0o*2 + 3o*2 + 5o*2). 15o*3 Expand -4 + 4 - 3o*4 + (-146o - 76o - 109o)(2o*3 + 3o*3 - 6o*3) + 1 + 2o*4 - 1. 330o*4 Expand (7k*2 - 5 + 5)(2165k - 867k + 445k - 676k). 7469k3 Expand (-3 - 2k + 5 - 3k)(-187 + 28 + 33 - 467). 2965k - 1186 Expand 2 + 3n*3 + 30n - 30n + (10n + 8n - 24n)(-11n*2 + 10n*2 + 14n2) - n3 - 3n2 + 3n*2 + (-3n + 0n + 2n)(2n - 2n + n2). -77n3 + 2 Expand (m5 + 0m2 + 0m*2)(3 - 3 + 1) + (0m2 - m3 + 0m*2)((2m2 - 3 + 3)(-1 - 1 + 0) + (5m - 2m + 0m)(6m - 4 + 4)). -13m*5 Expand (-2z + 3z + 2z)(-9 + 46 - 2z - 5z) + 0z*2 - 4z2 + z2. -24z2 + 111z Expand (-8w + 19w + 0w)(0 + 4 - 3)(-2w*3 + 2w3 + w4 + (-2w2 + 0 + 0)(w2 - 1 + 1) - w4 + w2 - w2 - 4w4 + 2w*4 + 0w*4). -44w*5 Expand (117 - 116 - 43s - 18s)(7s + 0s - s). -366s2 + 6s Expand (-17 - 8 - 28)(-61u*3 + 61u*3 - 82u*5). 4346u*5 Expand (113c - 134c + 437c)(-4c*2 + 3c*2 + 0c*2)(1 - 4 + 4). -416c3 Expand (3b4 + b2 - b*2)(0 + 1 + 1)(-93 - 178 - 593 - 2b). -12b5 - 5184b*4 Expand -78t*2 + 35t*2 + 35t*2 + 63t*2 - 1002 + 1002 + 4 - 4 - 2t*2 + (-t - t + t)(2t + 4 - 4) + 4t - 4t - t2. 50t*2 Expand (-5 - 6 + 8)(3a + 0a + 7a) + (3 - 2 - 2)(-a + 4a - 2a). -31a Expand (2 - 1640r*2 + 1640r*2 + 68r*3)(-56r2 + 19r*2 - 9r*2). -3128r*5 - 92r*2 Expand ((-1 + 1 + 2d)(0 + 0 - 2d) - 6185 + 6185 + 256d2)(-3d + 3d + 4d)(7d - 2d*2 - 7d - 1). -2016d5 - 1008d*3 Expand -143f*4 + 13f*3 + 5 + 142f4 - 3 + (f3 + 0f3 + 2f*3)(0f + f + f). 5f*4 + 13f*3 + 2 Expand (6c - c - 2c)(-27c - 42 + 42) - 30c*2 - 28c*2 + 19c*2. -120c*2 Expand (-306n*4 - 69564n*2 + 69564n*2 + (3n*3 - 2n3 + n3)(-4n - n + 3n))(7n - 6n + 12n - 2n + n + 2n + (4 - 1 - 2)(-3n - 2n + 3n)). -3720n*5 Expand (-2f + 2f - 2f*3)(9 - 2 - 1)(3 + 6 + 2)(2 + 3 - 3 + (0 - 1 + 0)(-11 + 11 + 4)). 264f3 Expand -z5 + 2z2 + 1115650z*3 - 20 - 1115650z*3 + (0 - 3 + 1)(z*5 + 0z5 + z5) - z*5 + 4z5 - z5. -3z5 + 2z*2 - 20 Expand (-325 + 256 + 2635)(15 + i - 15). 2566i Expand (4 - 1 - 4 + (-1 - 1 + 1)(-2 - 2 + 1) + 0 - 2 + 0 - 8 + 11 - 8)(-5m5 + m2 - m*2). 25m*5 Expand (101m2 + m2 + 13m2)(-15m3 - 22m*3 + 2m*3) + 0m*5 - 3m*5 + 2m*5. -4026m*5 Expand (-3b*2 - 2b + 2b)(35 - 35 + 17b3) + 415 - 415 + 28b*5. -23b*5 Expand (1 - t - 1)(7 - 4 - 7) + 8t - 2t + 5t. 15t Expand (-14 - 4 + 1)(26 + 22 - 13 - 6n). 102n - 595 Expand -544r + 2r2 + 3r*2 + 546r - 2r4 + (2r*2 - 5r2 + r2)(-2r*2 - r + r) + 2r4 + r4 + 9r4 + 2r*4 - 3r4 - r4. 12r4 + 5r*2 + 2r Expand (-5 - 47 - 44)(4c - 2c - c)(-10 - 3c + 0c + 0c). 288c*2 + 960c Expand 7p4 + 5 - 5 + (p3 + p4 - p3)(-1 - 5 + 4) + 3p2 - 3p*2 - 2p*4 + (0p + 0p - 2p*2)(0 + 0 - p)(68p - 10p + 21p). 161p4 Expand -21385f*2 + 24f - 1 + 21381f2 + 3 + (2f + f - 7f)(-3f + 3f - f) + 3f2 - 5f*2 + 4f*2. 2f*2 + 24f + 2 Expand (-2 + 2 - n*2)(-3n + 6n - 2n) + (-n - 2n + n)(-12220n + 12220n - 509n*2) + 0n*3 + 2n*3 - 4n*3. 1015n*3 Expand 23d*4 + 0d*4 - 45d*4 - 71d*4 + (64d*3 - 80d*2 + 80d*2)(4d + 0d - 2d). 35d*4 Expand (24x - 25x - 43x)((-6 + 2 + 2)(0 - 5 + 4) + (2 + 3 - 4)(1 + 1 + 0)(-2 + 4 + 2)). -440x Expand (5042u*2 - 10100u*2 + 5060u**2 + 231	{ "pile_set_name": "DM Mathematics" }
re between 8:45 AM and 7:45 PM? 660 What is 209 minutes after 7:08 AM? 10:37 AM How many minutes are there between 10:16 AM and 12:28 PM? 132 How many minutes are there between 5:26 AM and 12:07 PM? 401 What is 69 minutes before 1:26 AM? 12:17 AM What is 41 minutes after 7:10 AM? 7:51 AM How many minutes are there between 12:15 AM and 3:30 AM? 195 What is 76 minutes after 9:42 PM? 10:58 PM How many minutes are there between 9:10 AM and 10:38 AM? 88 What is 611 minutes before 2:46 AM? 4:35 PM What is 156 minutes before 11:13 PM? 8:37 PM What is 552 minutes after 8:04 PM? 5:16 AM What is 678 minutes after 3:20 PM? 2:38 AM How many minutes are there between 10:06 AM and 9:54 PM? 708 What is 386 minutes after 11:58 PM? 6:24 AM What is 300 minutes after 5:01 PM? 10:01 PM What is 491 minutes after 3:20 AM? 11:31 AM How many minutes are there between 5:53 AM and 7:40 AM? 107 What is 237 minutes before 3:28 AM? 11:31 PM How many minutes are there between 11:45 PM and 3:14 AM? 209 How many minutes are there between 1:42 AM and 12:29 PM? 647 How many minutes are there between 5:12 AM and 4:41 PM? 689 What is 203 minutes before 10:58 AM? 7:35 AM How many minutes are there between 8:09 PM and 9:39 PM? 90 How many minutes are there between 11:35 PM and 6:00 AM? 385 How many minutes are there between 4:17 AM and 4:02 PM? 705 How many minutes are there between 8:55 PM and 3:40 AM? 405 How many minutes are there between 2:32 AM and 2:18 PM? 706 How many minutes are there between 5:30 AM and 1:06 PM? 456 What is 605 minutes before 4:59 AM? 6:54 PM How many minutes are there between 4:14 AM and 10:09 AM? 355 What is 6 minutes after 6:43 PM? 6:49 PM How many minutes are there between 8:54 AM and 3:36 PM? 402 How many minutes are there between 10:48 AM and 1:54 PM? 186 How many minutes are there between 5:24 AM and 11:36 AM? 372 How many minutes are there between 10:08 AM and 12:36 PM? 148 What is 49 minutes before 1:19 PM? 12:30 PM How many minutes are there between 6:44 PM and 10:39 PM? 235 How many minutes are there between 4:01 PM and 11:35 PM? 454 What is 158 minutes after 11:05 PM? 1:43 AM What is 265 minutes before 6:13 AM? 1:48 AM What is 235 minutes before 1:17 AM? 9:22 PM What is 385 minutes before 7:46 AM? 1:21 AM What is 167 minutes after 6:42 PM? 9:29 PM What is 692 minutes before 5:48 PM? 6:16 AM How many minutes are there between 8:54 AM and 1:08 PM? 254 What is 408 minutes before 5:27 AM? 10:39 PM How many minutes are there between 8:43 AM and 7:45 PM? 662 What is 677 minutes before 6:42 AM? 7:25 PM What is 467 minutes after 8:53 PM? 4:40 AM How many minutes are there between 12:32 PM and 10:52 PM? 620 How many minutes are there between 1:07 PM and 11:24 PM? 617 How many minutes are there between 1:36 PM and 7:47 PM? 371 How many minutes are there between 5:29 AM and 1:29 PM? 480 How many minutes are there between 4:32 PM and 1:51 AM? 559 What is 444 minutes before 2:22 AM? 6:58 PM What is 514 minutes before 1:21 AM? 4:47 PM How many minutes are there between 8:23 PM and 8:34 PM? 11 How many minutes are there between 6:17 PM and 4:26 AM? 609 How many minutes are there between 6:13 AM and 6:55 AM? 42 What is 292 minutes before 12:56 PM? 8:04 AM What is 387 minutes after 11:37 PM? 6:04 AM What is 264 minutes before 5:02 PM? 12:38 PM What is 480 minutes before 9:11 AM? 1:11 AM How many minutes are there between 8:50 PM and 1:36 AM? 286 What is 386 minutes before 6:30 AM? 12:04 AM How many minutes are there between 11:21 PM and 4:39 AM? 318 How many minutes are there between 6:02 AM and 6:40 AM? 38 How many minutes are there between 7:14 PM and 2:13 AM? 419 What is 148 minutes after 12:04 AM? 2:32 AM What is 528 minutes before 10:16 PM? 1:28 PM How many minutes are there between 8:59 PM and 4:09 AM? 430 What is 703 minutes after 12:37 PM? 12:20 AM How many minutes are there between 7:45 PM and 2:31 AM? 406 What is 40 minutes after 5:31 AM? 6:11 AM What is 49 minutes after 1:19 AM? 2:08 AM How many minutes are there between 8:01 AM and 7:49 PM? 708 How many minutes are there between 10:09 AM and 2:22 PM? 253 What is 142 minutes before 7:43 AM? 5:21 AM What is 82 minutes after 6:21 AM? 7:43 AM How many minutes are there between 10:44 AM and 4:39 PM? 355 What is 709 minutes before 3:13 AM? 3:24 PM How many minutes are there between 2:00 AM and 9:08 AM? 428 What is 704 minutes after 6:01 AM? 5:45 PM What is 130 minutes after 5:59 PM? 8:09 PM How many minutes are there between 4:08 AM and 10:58 AM? 410 How many minutes are there between 10:10 AM and 5:35 PM? 445 How many minutes are there between 9:31 AM and 3:16 PM? 345 How many minutes are there between 9:38 AM and 11:28 AM? 110 How many minutes are there between 5:06 AM and 9:06 AM? 240 What is 144 minutes after 3:40 AM? 6:04 AM What is 300 minutes before 8:35 PM? 3:35 PM What is 467 minutes after 8:33 AM? 4:20 PM What is 657 minutes before 9:21 PM? 10:24 AM What is 202 minutes before 12:50 AM? 9:28 PM What is 175 minutes after 9:39 AM? 12:34 PM How many minutes are there between 7:22 AM and 8:39 AM? 77 How many minutes are there between 11:16 AM and 1:24 PM? 128 What is 394 minutes before 7:18 PM? 12:44 PM How many minutes are there between 9:56 AM and 9:17 PM? 681 How many minutes are there between 5:05 PM and 2:49 AM? 584 What is 485 minutes before 1:30 AM? 5:25 PM How many minutes are there between 7:39 AM and 9:47 AM? 128 How many minutes are there between 8:19 PM and 9:56 PM? 97 What is 50 minutes after 3:12 PM? 4:02 PM What is 398 minutes after 1:33 PM? 8:11 PM How many minutes are there between 2:39 PM and 3:21 PM? 42 How many minutes are there between 4:07 AM and 6:35 AM? 148 What is 191 minutes after 12:42 PM? 3:53 PM What is 496 minutes before 11:07 PM? 2:51 PM What is 126 minutes before 11:53 PM? 9:47 PM How many minutes are there between 8:22 PM and 1:22 AM? 300 What is 359 minutes after 12:36 AM? 6:35 AM How many minutes are there between 6:13 AM and 9:17 AM? 184 How many minutes are there between 7:22 AM and 7:32 AM? 10 What is 643 minutes before 4:58 PM? 6:15 AM What is 583 minutes before 10:43 AM? 1:00 AM What is 153 minutes after 11:46 AM? 2:19 PM How many minutes are there between 6:49 AM and 7:33 AM? 44 What is 400 minutes after 1:06 PM? 7:46 PM What is 331 minutes after 5:28 PM? 10:59 PM How many minutes are there between 6:47 AM and 2:25 PM? 458 What is 82 minutes after 4:31 AM? 5:53 AM How many minutes are there between 11:34 PM and 12:26 AM? 52 What is 286 minutes after 3:42 PM? 8:28 PM How many minutes are there between 3:50 PM and 5:41 PM? 111 What is 149 minutes after 6:04 AM? 8:33 AM What is 502 minutes after 3:07 PM? 11:29 PM What is 176 minutes before 2:44 AM? 11:48 PM What is 532 minutes before 3:43 AM? 6:51 PM What is 481 minutes after 2:53 AM? 10:54 AM How many minutes are there between 5:12 AM and 2:32 PM? 560 How many minutes are there between 7:43 PM and 6:27 AM? 644 How many minutes are there between 3:30 PM and 12:48 AM? 558 What is 117 minutes before 10:55 AM? 8:58 AM What is 322 minutes before 10:43 AM? 5:21 AM How many minutes are there between 4:58 AM and 1:23 PM? 505 What is 186 minutes after 8:08 PM? 11:14 PM What is 693 minutes before 5:20 AM? 5:47 PM What is 123 minutes after 7:02 AM? 9:05 AM How many minutes are there between 9:15 AM and 10:59 AM? 104 How many minutes are there between 4:36 AM and 2:22 PM? 586 How many minutes are there between 8:42 PM and 4:16 AM? 454 How many minutes are there between 11:40 AM and 5:25 PM? 345 How many minutes are there between 10:45 PM and 12:55 AM? 130 How many minutes are there between 11:47 AM and 7:13 PM? 446 What is 71 minutes before 5:33 AM? 4:22 AM What is 354 minutes before 4:51 AM? 10:57 PM What is 587 minutes after 2:52 AM? 12:39 PM What is 557 minutes after 6:24 PM? 3:41 AM How many minutes are there between 12:16 PM and 7:42 PM? 446 What is 707 minutes after 6:18 PM? 6:05 AM What is 12 minutes before 4:25 AM? 4:13 AM What is 482 minutes after 7:47 PM? 3:49 AM How many minutes are there between 1:29 PM and 12:24 AM? 655 What is 52 minutes before 12:50 AM? 11:58 PM How many minutes are there between 7:24 PM and 3:36 AM? 492 How many minutes are there between 10:28 PM and 7:45 AM? 557 What is 429 minutes be	{ "pile_set_name": "DM Mathematics" }
f? True Let j(d) = -d*2 - 8d - 2d2 - d2 + 5 + 3d*2. Let t be j(-8). Is 7 a factor of 67/t - (-8)/(-20)? False Let u(j) = 493j - 193. Does 11 divide u(7)? False Suppose 71u - 51u = 8820. Does 63 divide u? True Let r(j) = 102j - 180. Does 36 divide r(6)? True Let d(c) = -c2 - 11c - 5. Let x be d(-5). Suppose 2m - 113 = -x. Is 14 a factor of m? False Let w = 91 + -60. Let j = 2 - -7. Let i = w - j. Is i a multiple of 11? True Let l be (-5 + 3)/(1 - 2). Suppose 2 + 0 = -3g + 2z, -lz = -2g. Does 12 divide (g/(-6))/((-4)/(-372))? False Suppose -22t + 20t - g + 652 = 0, 5g = -t + 344. Is 35 a factor of t? False Let s(u) = -614u - 15. Does 11 divide s(-1)? False Let u = -17 + 15. Is 5 a factor of 84 - u(5 + -3)? False Suppose 4o - 67 = 5f, 3f + f + 50 = 3o. Suppose -2q - 2m = m + 16, 4q = 2m. Does 24 divide (-9)/q(o + -4)? False Let h(r) = 3 - r3 + 2 - 4 - 16r*2 + 15r. Is 5 a factor of h(-17)? True Suppose -6y - 348 = 456. Let w = y - -189. Is 13 a factor of w? False Let n(p) = p2 + 7p - 11. Let d be n(-8). Let f be 4/d(-9)/6. Suppose -35 = -3l - f. Is l a multiple of 4? False Suppose -r + 6r + 2f - 5 = 0, -4r + f - 9 = 0. Is 13 a factor of (26/6)/(r/(-6))? True Suppose 0 = -0b + 5b - 15. Suppose 10 - 1 = -by. Let u = 16 + y. Is 9 a factor of u? False Let v = -123 + 173. Let f be (((-80)/(-6))/8)/((-5)/(-6)). Suppose fa + 0a - v = 0. Does 10 divide a? False Suppose -z + 136 = -9z. Let a = z + 69. Is 20 a factor of a? False Suppose -13r - 50 = -3r. Does 39 divide 4545/27(-9)/r? False Let t(f) be the first derivative of -9f2 - 2f - 3. Does 33 divide t(-6)? False Suppose 4d - 191 + 19 = 0. Suppose -10 = -w - 2i, -4i = 5w - i - d. Suppose -u + 16 = -w. Is 8 a factor of u? True Suppose 2415 = 5u - 4o - 343, -3u + 1653 = -3o. Does 4 divide u? False Let d(z) be the third derivative of -z6/120 - z5/20 + z4/12 - z3/6 + 17z2. Let h = -1 + -3. Is 7 a factor of d(h)? True Suppose 321 = -4h + 5q, -2q + 6q + 202 = -3h. Let s = h - -45. Let c = -12 - s. Does 8 divide c? False Let p = -2281 + 1617. Let q = p + 1136. Suppose 134 = i - 3r + 10, -4i + 4r = -q. Is 30 a factor of i? False Let y(z) = 65z - 3. Let j be y(-2). Let o = -21 - j. Does 14 divide o? True Let b = 9 + -33. Let r = b + 58. Is r a multiple of 5? False Let h(x) = 7x3 + 2x*2 - 2x + 1. Let a be h(1). Suppose 2w - 26 = a. Is w a multiple of 11? False Let v be 0 - (-3)/2 - (-765)/6. Let f = -2 - -8. Suppose v = fm - 525. Is 25 a factor of m? False Let r = -16 - -15. Let i(a) = -5a3 - 3a*2 + 1. Let x be i(r). Suppose -xz - z + 220 = 0. Is 24 a factor of z? False Suppose -131 = 3y - 4y + z, y - 119 = -3z. Does 24 divide y? False Let l = 9 + -7. Suppose 4g - 8 = lg. Suppose -2f - 2f + x + 258 = 0, 4x = -gf + 268. Does 11 divide f? False Suppose -3t + 0t + 528 = 5x, 0 = -5x. Does 44 divide t? True Let v = -63 + 114. Suppose 3q = v + 15. Does 10 divide q? False Suppose 3k = 13 + 5. Let w be (10/4)/(1/10). Let l = w - k. Is 13 a factor of l? False Is 1578/9 - (-20)/(-15) a multiple of 3? True Suppose -16p + 9p = -1127. Is p a multiple of 16? False Let p be (-14)/(-49) + 15/21 + 2. Suppose -2062 = -5t + 3d, 2t + pd - 4d - 824 = 0. Does 41 divide t? True Suppose -14p + 1612 = 17p. Is 2 a factor of p? True Is 130/(-455) - (-8236)/14 a multiple of 7? True Let a = 3 - 0. Is 24 a factor of (-1 + a)(-4 - -98)? False Suppose 395 = h - 4a, -5h + a - 304 + 2336 = 0. Let c = h - 164. Is 33 a factor of c? False Suppose -5t + 4r = 6r - 373, t + r = 74. Is 25 a factor of t? True Let b be (-5 - (-3 + 0)) + 6. Let t = 4 - b. Let r = 15 + t. Is r a multiple of 3? True Suppose 11 = 4s - 3s - 5y, 0 = y. Let b(v) = v2 - 9v - 16. Does 6 divide b(s)? True Suppose -4z - 2852 = -5j, 1140 = 6j - 4j - 2z. Is j a multiple of 8? False Does 3 divide ((-634)/4)/(3(-22)/264)? False Let t(c) = c*2 - 6c - 5. Let a be t(10). Suppose 116 = m + a. Suppose 3k = 3y - 207, -2y + m + 85 = 5k. Does 19 divide y? False Let j be 0 + -2 - -3 - -28. Let z be 321/(18/21). Let w = j - z. Is 7 a factor of w? False Suppose 3u - 379 = 5b, 2u + 2b = -3b + 236. Suppose 2y + 5o = u, 3y - 222 = 2o - 47. Let r = y - 21. Is 8 a factor of r? False Let x be 0 + 1545/25 + (-3)/(-15). Suppose -3s = -x - 22. Does 7 divide s? True Suppose u + 2l = 5l + 9, 3u + l = 7. Let z = u + 101. Is 17 a factor of z? False Suppose -5p - 4t = -30, p - 7 = 4t - 1. Let r(s) be the third derivative of -s5/60 + s4/3 + 2s3/3 + 2s*2. Is 5 a factor of r(p)? False Suppose 0i - 9 = -3i. Suppose 4h = iv + 195, 0h + 66 = h + 5v. Suppose -3z + h + 57 = 0. Is z a multiple of 13? False Let t = 82 + -11. Let r = -42 + t. Is 2 a factor of r? False Let l be 6/1(-3)/9. Let d be 3/2l + 49. Suppose -j + 3q - 93 = -4j, 0 = -j - 4q + d. Does 13 divide j? True Let h(j) = j3 + 8j*2 + 10j + 6. Suppose l + 2 = -g, -4l = 2g - 3 + 1. Let d(u) = 2u + 4. Let f be d(g). Is 6 a factor of h(f)? True Let n(i) = 10i + 9i - 33 + 33 - 2i. Suppose -4j - 2 = -14. Is 17 a factor of n(j)? True Let j(u) be the second derivative of u3/3 + 11u*2/2 - 4u. Let p be j(-7). Is 6 a factor of (-10)/15 + (-38)/p? True Let q(u) = -6u2 - 12u - 1. Let h(b) = 6b2 + 12b. Let o(g) = 5h(g) + 4q(g). Is 29 a factor of o(-6)? False Let c(s) = 3s3 - 3s*2 + 11s - 8. Let k be c(4). Is 3 a factor of (-2)/(-14) + k/63? True Suppose 23n - 9 = 20n. Let w be ((-1)/(-3))/((-2)/(-12)). Is 9 a factor of (w - n)/(2/(-26))? False Suppose 111 + 99 = -3r. Let b = 115 + r. Is 13 a factor of b? False Let t = 827 - 377. Is 9 a factor of t? True Let n be (-6 - -7)(-12)/(-3). Suppose -37 = -3c + 2p, nc + 0c = -3p + 38. Is c a multiple of 11? True Let u be 12/(-5)(1 - 6). Let v(y) be the third derivative of y*4/4 - 2y*3 - 31y*2 + 3. Is v(u) a multiple of 15? True Suppose 893y - 890y = 612. Is 13 a factor of y? False Let m(o) be the third derivative of o5/20 + o4/12 - 16o2. Is m(-7) a multiple of 13? False Let v = 18 - 13. Let r(g) = -6 + v + 4 + g2 - 2g. Does 2 divide r(3)? True Let k = 1556 + -1072. Is k a multiple of 56? False Let h(l) = -9l - 17. Let c(m) = -m. Let s(f) = -2c(f) + h(f). Is 5 a factor of s(-7)? False Does 4 divide (2/(-6)14)/((-4)/162)? False Is 11 a factor of (31/5 - 5) + 2738/10? True Suppose -5x + 4 = -4x. Suppose -5k = 112 - 137. Suppose xn - 154 = -3r, -k = 5n - 4r - 213. Is n a multiple of 19? False Let u be (-8)/20 + (-81)/(-15). Suppose -26 + u = -i. Let v = i - -8. Does 10 divide v? False Let m(l) = 4l*3 + 4l*2 + 4l + 3. Let c be m(-2). Let w = -16 - c. Suppose -5g - b + 141 = 0, 3b - b + 138 = wg. Does 6 divide g? False Suppose 2j - 73 - 1043 = 0. Let t be 1/(-3) - j/27. Let i = t + 61. Does 20 divide i? True Let c be 0(-3)/(-6) - -72. Suppose 3b = 2j + c, -4b + 48 = -j - 48. Is 4 a factor of b? True Suppose -l - c + 124 = 0, -5l + 2c + c + 612 = 0. Let n = l + -73. Is 23 a factor of n? False Let z(d) = 5d2 + 74d - 15. Let o be z(-15). Suppose -35 = -3k - 5. Suppose -k = -a - oa. Does 5 divide a? True Let i = -3 - -8. Let s be 27/i + (-6)/15. Suppose -sc + r = -34, c - 5r = 2c + 14. Does 5 divide c? False Suppose -6c + 526 = 184. Suppose -6l + c = -3l. Does 2 divide l? False Let f(u) = 2u2 + u + 15. Let h(o) = -7o - 14. Let v be h(-3). Is f(v) a multiple of 30? True Suppose -o + 54 = 5p, -4p + 7 + 113 = 2o. Is 5 a factor of o? False Let t = 1390 - 200. Is 14 a factor of t? True Let n(o) = 5o*2 - 271o + 38. Is 23 a factor of n(57)? False Suppose -3i + q + 17 = 0, 6q = 4i + 4q - 24. Suppose 23 = ix + 3b - 475, 3x - b - 310 = 0. Is 17 a factor of x? True Let n = 16 + -8. Let y be ((-15)/(-12))/5n. Suppose 6 = 5a - 5t - 19, a = yt + 2. Is 8 a factor of a? True Suppose 14l - 26l = -14760. Is l a multiple of 17? False Let t(d) = 2d*3 + 10d*2 - 22. Let z be t(8). Suppose 5a - z + 402 = 0. Is a a multiple of 18? False Let s be 0/(-3 - (1 + -1)). Suppose 11t - 8t - 234 = s. Is t a multiple of 27? False Let f = 100 + -103. Let l(w) = 23w + 5. Let t(q) = -12q - 2. Let s(j) = 2l(j) + 5t(j). Does 22 divide s(f)? False Let v = -19	{ "pile_set_name": "DM Mathematics" }
as2 + os and give a. -1 Rearrange 0z + z3 + 0z + (1 - 1 + z)(-z2 + z2 + z2) + 13z*3 - 3z*2 - 11z3 + z2 to the form xz + sz*3 + uz*2 + w and give s. 4 Rearrange (0 + 0 + 1)(-5h2 + 0h + 0h - 3h*2 + 5h2 + h2 + (-6h2 + 2h*2 + 2h*2)(-3 + 3 + 2)) to uh2 + jh + b and give u. -6 Rearrange -20v2 - 3v + 2v + 0v - 8v2 to the form l + hv + sv2 and give l. 0 Rearrange (-1 + 4 - 2)(1 - 8 - 2)(-4 + 4 + 2)(-h + 3 - 3) to the form m + fh and give f. 18 Express -22 + 2g2 + 14 + 11 - g4 as og4 + ig + x + wg3 + dg*2 and give x. 3 Rearrange -4l - 27 + 5l - 1 to kl + w and give k. 1 Express (m + 3m3 - m)(8m + 0m - 48 + 50) in the form l + bm3 + zm + ym4 + jm*2 and give b. 6 Express 2a*2 + 10a - 14a + 33 - 32a*3 - 33 as ka*2 + n + da + sa3 and give s. -32 Express 34f + 2f - 189f in the form xf + b and give x. -153 Rearrange (4p + 3p - 2p)(-p3 + 7p*3 - 3p*3) - 3p4 + p3 - p*3 to the form hp*4 + mp*2 + w + xp*3 + lp and give h. 12 Rearrange -2x2 - 2x*3 + 11x - 31x + 7x to the form gx2 + lx + nx3 + v and give n. -2 Rearrange 3 - 6n*4 + 5n - 1 - 8n4 + 13n*4 - 2n*3 to the form a + fn*2 + xn*3 + kn + qn4 and give f. 0 Express -3a*4 - 8a2 - 13 + 15 + a4 in the form ua3 + ma*2 + w + ra*4 + qa and give r. -2 Rearrange 12q - 6q + q*2 - 6q to yq + bq*2 + m and give b. 1 Express (-3g*2 - 4g*2 + 2g*2)(-4 + 4 + g) + (1 - 1 - 2)(-2g*3 + 0g*2 + 0g*2) as sg*2 + wg + og3 + d and give o. -1 Express (3 - 2 + 1)(0 - 2 - 1)(-6 + 2 + 15)(3u + 4u - 6u) as du + a and give d. -66 Express (-2m + 5m - 2m)(-1 + 1 + 3m)(0 - 2 + 3) in the form qm + lm*2 + t and give l. 3 Rearrange -9 - 97p + 99p - 2p*2 + 2 to the form t + xp*2 + np and give n. 2 Express -3v2 + 1 + 1 - v2 as wv + av2 + h and give h. 2 Express (-4d*2 + 4d*2 - 2d*2)(-d + 0d - 4 + 3)(-60d - 23d + 9d) as kd*2 + xd*4 + md + c + pd3 and give p. -148 Express 0r + 7r2 + 0r*2 - 3r*2 - 3r + 2r3 as gr*2 + q + mr + ur3 and give g. 4 Rearrange 2y3 - y3 - 47y + 44y + 3y3 to the form zy*3 + xy*2 + my + s and give z. 4 Rearrange -h + 11 + 2h2 + h3 - 3 - 10 to kh*3 + lh*2 + bh + u and give u. -2 Express (z2 + z2 + 0z2)(4z - 6z + 4z) + (4z*2 - 5z*2 + 3z*2)(-3 + 3 - z) + 3 - 3 - z*3 as dz*2 + oz + lz3 + p and give l. 1 Express -8d*2 - 10d*2 + 13d*2 as kd*2 + bd + f and give k. -5 Rearrange (-1 + q + 1)(8 + 2 - 4) + q + 3q - 3q to the form gq + v and give g. 7 Rearrange -61h - 7 + 7 + 189h to the form l + xh and give x. 128 Rearrange -2 - 2 + 2s + 5 + 74s4 - 72s*4 - 2s*3 to ds*4 + ps*3 + fs*2 + xs + r and give x. 2 Rearrange (27o - 7o - 33o - 133o)(o + o - o) to the form wo*2 + yo + c and give w. -146 Express c*2 + 4 - 4 - 4 + 7c*2 + 4 - 2c*2 - c + c + (4c + 0c - 5c)(2c + 0c - c) as b + dc*2 + pc and give d. 5 Rearrange 4j3 + 3j*3 - 3j*3 + (1 - 1 - j)(-4 + j*2 + 4) + (-2j + 3j - 3j)(0 + 0 - j2) to k + cj*2 + yj*3 + oj and give y. 5 Rearrange (-168 - 2a - 213 + 816)(0a + a - 2a) to the form z + sa2 + ma and give m. -435 Rearrange 4v3 - 5v*3 - 7v*3 + 2v to the form h + rv3 + lv + fv2 and give r. -8 Express (5k - 3k - k)(-2 - 1 - 8)(-4 + 3 - 1) as ak + t and give t. 0 Express -5a2 + 6a*3 + 13a*3 - 20a*3 + 2a*4 + a in the form ia + ja4 + va*3 + sa*2 + m and give v. -1 Rearrange 48 - 48 - 35x to the form ux + f and give u. -35 Express a3 + 8 - 2a*2 - 1 - 6 + a in the form fa + o + ua2 + ia3 and give o. 1 Rearrange -y2 - 49y - 1 + 102y - 15 - 52y to the form zy + d + gy2 and give g. -1 Rearrange (1 - 1 - s)(0 - 3 + 7 + (5 - 5 + 2)(-2 + 2 - 4)) to the form w + gs and give g. 4 Rearrange (-4x + 2x + 0x)(5x - 3x + 0x) + 3x*2 + 20x - 49x + 20x to the form r + wx2 + zx and give w. -1 Express (4i - 5i - 2i)(-i*3 + 3i*3 + 2i*3) as xi + yi2 + ai*3 + ri*4 + v and give v. 0 Express 0y + 10y + 2y + (-2y + 2y - y)(3 - 2 + 1)(1 + 3 - 5)(-1 - 2 + 5) as iy + r and give i. 16 Express -2 - 15d + 441d*2 - 2d*4 - 2d*3 - 441d*2 as bd*4 + pd*3 + zd*2 + m + yd and give y. -15 Rearrange (2 - 1 + 0)(9s - 2 + s - 8s) to the form v + gs and give v. -2 Rearrange 4a - 7a - a*4 - 4a + 5a3 + 2a to the form l + pa4 + da*3 + va + ca2 and give d. 5 Express -2x*3 - 11x*2 - 13x*2 - 2 + 24x*2 + 66x as w + ax + sx*2 + ux*3 and give w. -2 Express 2y*2 - 6y - 5y2 + 8y in the form sy + wy*2 + v and give s. 2 Express -3h*4 - 2h*4 + 2h*4 + (5 - 5 + 2)(4h2 - 4h*2 + 2h*4) - 2h*4 + 5h4 - h4 in the form gh + rh*3 + wh*2 + q + xh*4 and give x. 3 Express 2h2 + h3 + h + h - 3h4 - h2 as t + ih*2 + ch*4 + dh + zh3 and give d. 2 Express -4q*3 + 7q*3 - 4q*2 + 2q*3 - q - 2 + 0q*2 in the form iq + a + rq3 + wq*2 and give a. -2 Express -1264n + 2 + 621n + 622n as gn + m and give m. 2 Rearrange -9q*2 - 11q*2 - 4q*2 + (-2 + 6 - 2)(2q - 2q - 2q2) to m + pq*2 + rq and give p. -28 Rearrange -37w + 4w - 90w - 8w to the form b + dw and give b. 0 Express 3q - 2 + 0 - q as jq + i and give j. 2 Rearrange (-2 + 7 + 8)(5 - 2 - 1)(-j3 - 2j*3 + 2j*3) to the form i + nj*2 + qj + xj3 and give x. -26 Express 4g - 35g2 + g3 + 38g*2 + 3g*4 + 0g*3 in the form a + sg + og2 + xg*3 + pg*4 and give p. 3 Express -4k + k + 2k + (0 - 2 + 1)(2k + k - 4k) - k + 0k - k - 29k + 1 + 39k + 1 in the form sk + y and give s. 8 Rearrange 4j - 2 + 3j*3 + 4 - 4 to gj*3 + rj*2 + n + ij and give n. -2 Express 23m + 23m - 8m - 8m in the form d + xm and give x. 30 Rearrange 2n - 3 - 3n + 1 + (5n - 5n - n)(-2 + 1 + 0) - 2n + 5n + 0n - n - 4n + 4n to j + cn and give j. -2 Rearrange 0m + 12m + 0m + 5m to the form b + tm and give t. 17 Rearrange -2s*3 - 3s + 6s3 + s2 - 1 + 2s*4 - 2s*3 - 3s*2 to the form fs*3 + is + us4 + l + as*2 and give i. -3 Express (1 - 1 - 2 - 3)(24 - 24 - 8l) in the form bl + s and give b. 40 Express -10d - 21d + 7d - 10d in the form zd + x and give z. -34 Express (-5 + 5 - 2)(3q + 0q - 2q)(0 - 1 + 0) in the form fq + n and give n. 0 Express 0 - 2 + 1 - 1 + 3b4 - b2 in the form jb2 + vb*3 + nb*4 + k + rb and give j. -1 Rearrange -11c4 - 52c*2 - 2c*3 - 1 + 7c*3 + 52c*2 + 2c to the form uc3 + z + xc + sc2 + pc*4 and give p. -11 Express 1 - 3 - 6d - 10d3 + 12d*3 in the form md*2 + sd*3 + cd + g and give s. 2 Express (-2w + w + 3w)(13w - 8w + 14w) as hw + b + xw*2 and give x. 38 Rearrange (-q + 2 - 2)(4q - 4q - 2q3 + (-3 - 2q*2 + 3)(-3q + 6 - 6)) to the form aq*4 + b + tq*3 + mq + zq2 and give a. -4 Express (6o + 0o - 2o)(-2o - 2o + 3o + 4o2) in the form ao + b + yo3 + ho*2 and give h. -4 Rearrange 1 - 1 - 2d*3 + 1208d4 - d2 - 1237d4 to the form kd + ud4 + ld*2 + bd*3 + m and give u. -29 Rearrange (-17x + 7x + 20x)(x + 4x - 4x) + (0 + 0 + 2)(3 - 3 + 2x2) to the form fx*2 + gx + s and give f. 14 Express 40 + 0q - 2q - 24 as cq + p and give p. 16 Rearrange 13u + 1 - 1 to the form lu + j and give l. 13 Rearrange -3a*2 + 0a3 + a3 - 3 + 5a2 to ua*3 + da*2 + na + h and give u. 1 Rearrange (n + 2n - 4n)(3 - 4 - 2)(-2n2 + 4n2 + n2) to the form gn2 + yn*3 + jn + z and give y. 9 Express (w2 - w2 + 10w2)(-3w + 4w - 2w) + (-4w*2 + 0w2 + w2)(0w + w - 3w) as iw*2 + l + vw*3 + sw and give v. -4 Rearrange 17o2 - 10o*2 + 28o*2 to the form go*2 + wo + l and give g. 35 Rearrange -2 + 3i2 - 22i + 22i to the form ci*2 + gi + p and give c. 3 Rearrange (-4 + 5 - 3)(q + 4 - 4)(0 - 2q + 0) to o + mq + wq2 and give w. 4 Rearrange 81t + 81t - 59t to yt + q and give y. 103 Express -3d*4 + 4d4 + d4 + (d*3 + 2 - 2)(2d - 4 + 4) in the form q + xd*2 + kd*3 + gd + nd*4 and giv	{ "pile_set_name": "DM Mathematics" }
and 124507630. 124507631 -2851+208.837 -2642.163 -1 + -4190443 -4190444 Work out 0.8 + -0.86471. -0.06471 Calculate 17.1 - 25772869. -25772851.9 What is -0.0952 take away -2.669? 2.5738 Total of -6491784 and 3. -6491781 1090949692 + 0.5 1090949692.5 Put together -0.2 and 6.385583. 6.185583 Add 5607823 and -0.2. 5607822.8 What is the difference between 911139 and -1061? 912200 Sum -123557712 and 0.1. -123557711.9 Subtract -18524753 from 8. 18524761 What is -18372.208 - 0.22? -18372.428 What is the distance between 703910 and -213.1? 704123.1 Work out 1599 + -19.5283. 1579.4717 -5.733 - -4987 4981.267 Add together 0.1 and 34210726756. 34210726756.1 Work out 6142439522 - 3. 6142439519 What is the difference between 6.629 and -428688? 428694.629 What is the difference between 5.5 and -5138.23? 5143.73 What is the distance between 3470251 and -2.8075? 3470253.8075 Work out 152269 + -420243. -267974 What is 11081257 plus 164? 11081421 -1320.8 + -0.112425 -1320.912425 What is the difference between -8481.23 and -1? 8480.23 Add together -2.246 and 474691. 474688.754 What is 3052 take away 15096? -12044 Work out 3.9 - 2.6427. 1.2573 Total of -14808 and 697.5. -14110.5 Work out -13410048 - -0.5. -13410047.5 Calculate -615 - 5218231. -5218846 What is -1.261 minus 13548? -13549.261 Add together 91.95013 and -287. -195.04987 What is 360154 plus 0.2267? 360154.2267 What is -558.6 - 44254? -44812.6 65452 - 11.5 65440.5 What is 3.158729 + 56? 59.158729 What is -11 take away 199.826022? -210.826022 Total of 2097 and -4508.78. -2411.78 Calculate 6778470289 - 1.9. 6778470287.1 Put together -408.74 and 144. -264.74 What is 0.17608 minus 80616? -80615.82392 What is 2400694 less than -615? -2401309 What is the difference between -14 and -644646.24? 644632.24 -27+21727955.3 21727928.3 What is 0.3 plus -30100.866? -30100.566 What is -8.556951 + 7? -1.556951 Work out 0.04634 - -12.61. 12.65634 What is 57553 take away -1.4352? 57554.4352 Sum -83224 and 11.8623. -83212.1377 Calculate 205054579 + -0.11. 205054578.89 Work out 0.1 + -161832666. -161832665.9 -248011 + -18 -248029 Calculate 1117 - -1772634. 1773751 Put together 1 and 762892. 762893 Subtract -4 from 68645826. 68645830 Put together 32424605 and 0.0443. 32424605.0443 What is 110.971806 plus 0.09? 111.061806 What is the difference between 19409 and 17525? 1884 Work out 0.255 - -12649.8. 12650.055 Add together 15 and 2663421. 2663436 What is the difference between -13.1233473 and 25? 38.1233473 Work out -742146625 - 0.4. -742146625.4 Put together 207 and -295086.2. -294879.2 What is the distance between -0.02 and -938187? 938186.98 Work out 28713050 + -6. 28713044 Calculate -0.05754 - -4699. 4698.94246 Subtract -0.03 from -1789340. -1789339.97 Add together -23.2 and 273.786. 250.586 Add together 6369 and 536. 6905 Work out -177.87379343 + -3. -180.87379343 -477.97+-1.45 -479.42 Add together -2.8612 and 0.691. -2.1702 Work out -0.13 + -25.0792537. -25.2092537 Calculate -89677063862 - 0.4. -89677063862.4 0.0187+-11042914.8 -11042914.7813 -676316837 - 0.1 -676316837.1 Work out 29.5 + -88122257. -88122227.5 Add 0.12 and -189294.982. -189294.862 Add -0.00351 and -311188. -311188.00351 What is -0.05 plus -247.08415? -247.13415 Work out 0.33 + -2042867605. -2042867604.67 What is the difference between 57537 and 32? 57505 Put together -8022259.6 and 0.055. -8022259.545 Subtract -0.4 from 10495.333561. 10495.733561 Work out -0.312233 - -25140. 25139.687767 76+367316.3 367392.3 Calculate -12.3465 - 2.6. -14.9465 What is 18952 + -0.4967? 18951.5033 Work out -9 + -405415875. -405415884 What is -11281 - -4584? -6697 -0.151+11657 11656.849 Add together -9190751029 and -0.4. -9190751029.4 Work out 0.1 - -14.485178. 14.585178 What is the difference between 23401 and -0.04928? 23401.04928 9822126 - -0.9 9822126.9 Work out -14.7793 - 0.7. -15.4793 What is -342 + 1974942.8? 1974600.8 What is 8 - 43.829? -35.829 What is the difference between 0.2 and -38255784? 38255784.2 What is 122436.82 take away 0.3? 122436.52 0.51284 - 11177 -11176.48716 Calculate 183864.7 - -0.227. 183864.927 Calculate -737.1126255 + 1. -736.1126255 Subtract 4060.1 from -192. -4252.1 What is -0.78702 take away -8877? 8876.21298 Subtract 422089 from -0.3. -422089.3 What is 57.4633 plus 0.29952? 57.76282 What is 64026414 minus 0.4? 64026413.6 What is -685834 take away -0.052? -685833.948 Total of 479187031 and 34. 479187065 -3.2 - -1652728 1652724.8 Calculate 0.28 - -3161926918. 3161926918.28 Work out -1134 - 43024.66. -44158.66 What is -0.0094383 + -35? -35.0094383 What is -22.05 - -2183? 2160.95 Add together 9712 and 0.17809. 9712.17809 What is 603.02 plus -6.91? 596.11 Calculate -7 + 6287348. 6287341 Calculate 461 - -5617. 6078 Put together 5 and -0.0510272948. 4.9489727052 Total of 0.1 and -2.410084. -2.310084 Put together 4.8 and 468.2723. 473.0723 Calculate -8 + -488039278. -488039286 Subtract -5 from 24439508. 24439513 What is 88 take away 0.193797? 87.806203 What is -1870542 - 0.8806? -1870542.8806 Put together 0.3 and 1898.2917. 1898.5917 453 + -33101.2 -32648.2 What is -0.06 - 0.239845? -0.299845 What is 143 minus 90606852? -90606709 Subtract -8.6 from 395. 403.6 Calculate -390824.9 + 0.03. -390824.87 What is 0.3 less than -38101247453? -38101247453.3 Add -3 and 46700.72. 46697.72 What is 1574275 less than 300? -1573975 Add together -151919 and -1040. -152959 Add -229.7 and 21.579. -208.121 What is 0.2458 - 5.266? -5.0202 What is -30216114.7 take away 0.9? -30216115.6 Subtract -0.1 from 74179735. 74179735.1 What is -17416.38 minus -5? -17411.38 Subtract -45.29895 from 0.8. 46.09895 Sum -0.188 and 24707.183. 24706.995 Work out -17685030 - 0. -17685030 What is 260243.57 + 196? 260439.57 Put together 26.53 and -38060248. -38060221.47 Work out -2.5 + -7731675. -7731677.5 What is -0.7 minus 19906191? -19906191.7 Calculate 37742.43 - -0.5. 37742.93 Put together 41.8096 and -3. 38.8096 Work out 478.72 + -31838. -31359.28 What is 0 plus -696584432? -696584432 What is -9021046 less than -3? 9021043 -5064126505 - 0.1 -5064126505.1 What is 35323 minus -3909? 39232 What is the difference between -4.252814035 and 5? 9.252814035 -3190+-4.786519 -3194.786519 Add together 60259 and 44. 60303 What is 585594918 less than -0.13? -585594918.13 What is -3980 - 2060.8? -6040.8 What is -0.1 - 5501400465? -5501400465.1 What is the distance between -5.63 and -8845144? 8845138.37 What is 3935907363 plus -5? 3935907358 Subtract -7688050 from 0.05. 7688050.05 Calculate 6025610632 - 0.1. 6025610631.9 What is 4 take away 1616415480? -1616415476 Put together 0.15 and 3054.89987. 3055.04987 What is -0.09 + -24642.2? -24642.29 What is -0.049 + 1207.1799? 1207.1309 Sum 17 and 0.087389671. 17.087389671 Add -16 and 67.41. 51.41 Add 1956 and 0.4264. 1956.4264 What is -4245.34 less than 136443? 140688.34 0.2 + 2937181699 2937181699.2 Put together 0.5 and -103714421. -103714420.5 What is 52.2087 plus -4.3? 47.9087 Calculate -43110.263 + -5. -43115.263 Add -1.5209 and -37.282. -38.8029 Total of -52526591.013 and 5. -52526586.013 What is 3764.519312 less than -0.2? -3764.719312 Sum 0.1 and 2770870117. 2770870117.1 Add -33980.8 and -235. -34215.8 What is the distance between -24 and -0.887133? 23.112867 -4528+-477 -5005 Calculate -19240306927 - 0.2. -19240306927.2 Add together 247.9 and 2154773. 2155020.9 Total of -0.5 and -260187639. -260187639.5 What is the distance between -721.4 and -34575? 33853.6 What is the distance between 133625.426 and -1070? 134695.426 -111 + -74666 -74777 What is -1933 - 45747? -47680 What is -6 + -28207376288? -28207376294 Add 4.4302053 and 6. 10.4302053 1619 - 14971 -13352 Work out -64435436 + -0.3. -64435436.3 What is 417065.28581 minus -0.2? 417065.48581 Work out 894320 - 0.024. 894319.976 What is 271 less than -3.11065? -274.11065 What is -38747.6451 minus 38? -38785.6451 What is -0.053 + 377378.054? 377378.001 0.58755 + -169774 -169773.41245 -3369364.4+0.43 -3369363.97 -0.09 - 66.1768 -66.2668 -8+2.286966 -5.713034 5257 + -8470.72 -3213.72 What is the difference between -5432 and 671.4? 6103.4 Subtract -1223 from -38884. -37661 What is 5.1 - 1883000? -1882994.9 What is the distance between 2479555.143 and -5? 2479560.143 What is the difference between 13	{ "pile_set_name": "DM Mathematics" }
81538? -181538 Is -345544/65 >= -5315? False Which is greater: 26088431 or 26088430? 26088431 Which is greater: 9/10 or -155.6? 9/10 Which is smaller: -53387017/13 or -4106693? -53387017/13 Which is smaller: -35/3416333 or 1? -35/3416333 Is -15051517 at most -165566677/11? True Which is smaller: -576440 or -576429? -576440 Which is smaller: 1001216 or 1001229? 1001216 Which is smaller: -19234462 or -19234460? -19234462 Which is smaller: 1250852 or 95? 95 Which is smaller: -21106/28249 or -1? -1 Are 260606519 and 521213037/2 unequal? True Is 94397 >= 94589? False Is -640666477 < -640666477? False Which is bigger: 10126865 or 10126868? 10126868 Which is smaller: -2 or -23069? -23069 Which is bigger: 2377 or 0.1206? 2377 Which is smaller: -1456414 or -52? -1456414 Which is greater: 1 or 2/175748333? 1 Is 69258/2825 bigger than 24? True Is 2/100278567 greater than 1? False Is 56 equal to -1577187? False Which is bigger: -18872 or -21713? -18872 Which is smaller: 3338/174507 or -1? -1 Is -93885 > -2.58? False Which is smaller: -21421 or -24380? -24380 Is 21290/1059 less than or equal to 19? False Is -26808724 at least as big as -3? False Which is smaller: -2109841 or -2109669? -2109841 Which is smaller: 66870 or 1025? 1025 Which is smaller: -225783 or -225978? -225978 Which is smaller: 18771142 or 18771156? 18771142 Is -2/7 bigger than 23306945/2? False Is 11/185 less than 3385? True Is 13 > -222832/27? True Are -1722402556 and -1722402558 nonequal? True Which is greater: 309448 or 309456? 309456 Which is smaller: 246666 or 338? 338 Which is smaller: -4474471 or -22372354/5? -4474471 Which is smaller: 105 or -2363891? -2363891 Is -172588 at least -174254? True Which is bigger: -122 or -194339? -122 Is -1 equal to -425/4636? False Which is smaller: 2/2336477129 or 1? 2/2336477129 Is 207004/349 >= 593? True Which is bigger: -1 or -12936/76801? -12936/76801 Is -2822 < 663/58? True Which is bigger: -8365890 or -8365877? -8365877 Is 983.282 at least as big as 0.0133? True Is -1262859 at most as big as -1262856? True Is -5 bigger than 73327521? False Which is bigger: 22/14560695 or 1? 1 Which is smaller: -3290/13869 or -1? -1 Is 1178668 > 5893334/5? True Which is smaller: 6408/4027 or 1? 1 Is 1525995 < 1525995? False Which is bigger: 2/104796165 or 1? 1 Is 2858128 greater than 2858134? False Which is greater: 9064325 or 45321624/5? 9064325 Is 4.7 > -51539/28? True Is 0 bigger than 658/99723? False Which is smaller: 0 or 3/10778950? 0 Do 3 and 95069784 have different values? True Which is smaller: -11029421 or -33088259/3? -11029421 Is 1 equal to -1/27612572? False Which is smaller: -16113/272 or -58? -16113/272 Is 4131919 at least as big as 45451101/11? True Which is smaller: -254515 or -253236? -254515 Which is smaller: 463322 or 463009? 463009 Which is bigger: -1 or 4806/11731? 4806/11731 Which is bigger: -1/70849897 or 0? 0 Is 5062978 >= 5062984? False Which is smaller: -0.03 or -2276781? -2276781 Which is smaller: -2788239 or -2788226? -2788239 Is 25600720 greater than 25600720? False Which is smaller: -69.6154 or -165? -165 Is -108401 at most as big as -108331? True Which is bigger: -7/24 or 78? 78 Which is bigger: -7 or -12692/2221? -12692/2221 Which is smaller: 18895 or 765? 765 Which is smaller: -145 or 282934? -145 Is 15.9534 != -6? True Is -9234 >= -456/11? False Is 20998 at least 20968? True Is 0 at least as big as 1/9752716? False Which is greater: 81823390 or 81823389? 81823390 Is 166/17 bigger than 890222? False Are -9745 and 29.5 unequal? True Which is smaller: -15556660 or 0? -15556660 Which is smaller: -903338 or -903260? -903338 Which is smaller: 1843/832 or 1? 1 Does -89959715 = -89959714? False Is 24057249 bigger than 24057251? False Which is greater: -218589 or -223561? -218589 Is -1.9 less than or equal to -20569? False Which is smaller: 659325/4 or 164831? 164831 Which is smaller: 63 or 434370? 63 Is -269141 >= 2184/11? False Which is greater: -3814089/13 or -293391? -293391 Which is smaller: 5409405 or 5409451? 5409405 Is 4449406 >= 4449408? False Which is smaller: 17315 or 16339? 16339 Is -309985 at most as big as -310008? False Is -68854138 at least -68854136? False Is -26961039 less than or equal to -26961040? False Do 221618 and 13 have the same value? False Is 3148048 < 78701234/25? True Does -222683 = -222604? False Which is smaller: 162400 or 496? 496 Is 3237394 at least 3237395? False Which is greater: 12906468 or 12? 12906468 Which is greater: 19.3009908 or -1/8? 19.3009908 Which is smaller: -373391 or -373354? -373391 Is 174054 at most as big as 174072? True Which is smaller: -13251 or 10382? -13251 Is 0 != 3/37078412? True Which is smaller: -31371674/15 or -2091444? -31371674/15 Which is smaller: 0.15 or -361113/7? -361113/7 Which is bigger: 4/105 or -217724? 4/105 Is 1379103 less than or equal to 1379224? True Are -1 and 1/983671834 non-equal? True Which is bigger: -58657 or -1818378/31? -58657 Is 2/349 less than 71/569? True Is -8808214 less than or equal to -8808213? True Is -147179 at least -146491? False Is 1 bigger than -2964/27515? True Which is smaller: -51/11 or -0.458677? -51/11 Is -270398 equal to -270450? False Which is smaller: 0.1 or -4486967? -4486967 Is 3 greater than or equal to 14385664? False Is 1.4585 at most -2552? False Do 3404/174121 and -1 have the same value? False Which is greater: 0 or 25/2684501? 25/2684501 Which is smaller: 132049.195 or -2? -2 Which is smaller: -211/41815 or 0? -211/41815 Is -138335 bigger than 122? False Is -53 > -66615? True Is 0.1 bigger than -3076228? True Are 2769957/4 and 5/4 non-equal? True Which is smaller: -5/2 or 91.78? -5/2 Which is greater: -20/9769 or 0? 0 Is 153308571 > 153308568? True Is 0.48 bigger than 67529? False Which is greater: -114810 or 3492? 3492 Which is bigger: -5707 or -0.0611? -0.0611 Which is bigger: -1 or -856/1149883? -856/1149883 Is -215662/291 at most as big as 1/3? True Which is bigger: 178/457423 or 0? 178/457423 Is 1 greater than 71/540561? True Is 368692207/3 at most as big as 122897401? False Is -212596891 at least as big as -212596890? False Is 8.571 > 450/59? True Are 1 and -1410/16393 non-equal? True Which is smaller: -971541 or -971529? -971541 Is -26 != 6390901/5? True Which is bigger: -1203.7 or 55/181? 55/181 Do -199 and -31392 have different values? True Which is smaller: -8190721/2 or -4095362? -4095362 Are 1117290 and 32401418/29 unequal? True Is -9069 > -10/10879? False Which is smaller: 3 or -2855099/45? -2855099/45 Is -165428/11287 greater than or equal to -14? False Is -10559532 not equal to -10559529? True Which is smaller: -2/10563655 or 1? -2/10563655 Do -315860414 and -315860416 have the same value? False Which is smaller: -4.077656 or -2? -4.077656 Which is smaller: 1688490 or 1688472? 1688472 Which is smaller: 168 or -225828? -225828 Is -4620971 at most as big as -4620964? True Which is smaller: -2 or -1303/2000? -2 Which is greater: -11 or -123319.6? -11 Are -91590 and -92055 non-equal? True Which is smaller: -44/940611 or -1? -1 Which is smaller: -4149557 or -4149506? -4149557 Which is smaller: 77 or 962667? 77 Is -175/50718 less than or equal to 1? True Which is greater: 18.54492 or -152? 18.54492 Is 12401550 at least as big as 12401549? True Are 24456 and 28309 non-equal? True Which is smaller: -4/143 or 1.41387? -4/143 Is 62817/2840 greater than 21? True Which is bigger: 591 or 29/15367? 591 Is 2/156576929 bigger than 1? False Which is smaller: -37/1707584 or 1? -37/1707584 Are -191579 and 30.7 equal? False Which is greater: -0.0080707 or -2.37? -0.0080707 Is 40/988283 at least as big as -1? True Is -3168477 less than -3168476? True Do -37169 and 2/7 have the same value? False Which is smaller: -18713 or 0.24? -18713 Which is bigger: -3858691 or -19293458/5? -3858691 Is 36979082 greater than 2/3? True Is 20366714/19 at most as big as 1071932? False Which is greater: -278443 or -282496? -278443 Which is smaller: -489/1697 or 1/60? -489/1697 Which is greater: 14396/5245 or 4? 4 Which is smaller: -589788 or -3.2? -589788 Is 0.1272 greater than -322.2? True Is 30336885 > 30336884? True Which is smaller: -236 or 5158? -236 Which is bigger: -65076742 or -65076744? -65076742 Which is smaller: -243078 or -5104646/	{ "pile_set_name": "DM Mathematics" }
: 3}? 3/26 What is prob of sequence ez when two letters picked without replacement from jceeczccezojcece? 1/24 Three letters picked without replacement from {c: 6, s: 1, m: 2, v: 3, j: 2, u: 1}. What is prob of sequence vsc? 3/455 What is prob of sequence ssse when four letters picked without replacement from {s: 7, e: 3, w: 9}? 35/5168 Two letters picked without replacement from uuccuuuuu. What is prob of sequence uc? 7/36 What is prob of sequence co when two letters picked without replacement from {y: 4, j: 4, c: 3, o: 2, b: 1}? 3/91 Calculate prob of sequence rvv when three letters picked without replacement from {b: 1, u: 1, q: 2, v: 7, s: 1, r: 5}. 7/136 Calculate prob of sequence eeer when four letters picked without replacement from {r: 3, j: 3, e: 5, q: 2}. 3/286 Calculate prob of sequence llrr when four letters picked without replacement from {l: 6, r: 6}. 5/66 What is prob of sequence xn when two letters picked without replacement from {n: 4, x: 10}? 20/91 Calculate prob of sequence jjc when three letters picked without replacement from juvuvjvvjcjjcuv. 4/273 Four letters picked without replacement from smsmsmwmwmsmmwmwmwmw. What is prob of sequence mmsw? 6/323 Calculate prob of sequence ew when two letters picked without replacement from eqjwweqwqeww. 5/44 Two letters picked without replacement from {x: 6, m: 4, v: 5}. What is prob of sequence mm? 2/35 Three letters picked without replacement from aykak. Give prob of sequence kka. 1/15 What is prob of sequence yyd when three letters picked without replacement from {d: 1, b: 3, y: 4, z: 5}? 1/143 Calculate prob of sequence uus when three letters picked without replacement from usuu. 1/4 Four letters picked without replacement from {p: 1, k: 1, x: 1, v: 2, e: 1, c: 1}. Give prob of sequence pvvx. 1/420 Four letters picked without replacement from {n: 2, z: 2, y: 5}. What is prob of sequence zyyy? 5/126 Calculate prob of sequence kkn when three letters picked without replacement from kknkikkiniiikiiiki. 7/408 Calculate prob of sequence qrsm when four letters picked without replacement from smssmsmsqmssqmzzrs. 1/918 Four letters picked without replacement from ffraar. What is prob of sequence ffra? 1/45 Two letters picked without replacement from xgoyyxyxxo. What is prob of sequence xx? 2/15 Calculate prob of sequence hhhh when four letters picked without replacement from hhyhyyyyyhyyhhhyhhhh. 22/323 Three letters picked without replacement from faaffaff. What is prob of sequence fff? 5/28 Two letters picked without replacement from {f: 2, x: 1, i: 14}. What is prob of sequence ix? 7/136 Two letters picked without replacement from iituggtgiug. What is prob of sequence ti? 3/55 Three letters picked without replacement from {a: 2, s: 1, j: 3, w: 2, f: 4}. Give prob of sequence fas. 1/165 Four letters picked without replacement from xxfxvnhxxf. What is prob of sequence hvxf? 1/504 Calculate prob of sequence zwz when three letters picked without replacement from {w: 4, s: 2, z: 4}. 1/15 Two letters picked without replacement from {l: 1, m: 1, s: 1, e: 3, g: 1}. Give prob of sequence mg. 1/42 Four letters picked without replacement from {d: 2, w: 3}. What is prob of sequence wwdw? 1/10 Calculate prob of sequence sms when three letters picked without replacement from {m: 4, w: 5, s: 6}. 4/91 What is prob of sequence fznk when four letters picked without replacement from zuuuzknuuzzuuuf? 1/8190 Two letters picked without replacement from {w: 1, j: 1, n: 2, t: 1, g: 2, m: 1}. Give prob of sequence mt. 1/56 Two letters picked without replacement from hhmhwmmmwmmhmmhm. Give prob of sequence hh. 1/12 What is prob of sequence sfj when three letters picked without replacement from fjkfwsy? 1/105 What is prob of sequence zd when two letters picked without replacement from zkdkzkdkbdkdkkkbd? 5/136 What is prob of sequence fif when three letters picked without replacement from {v: 5, k: 2, o: 1, i: 8, f: 2}? 1/306 Two letters picked without replacement from oooooooeoooo. What is prob of sequence oe? 1/12 Four letters picked without replacement from pmhkhkmkhhjb. What is prob of sequence pjmb? 1/5940 Calculate prob of sequence uaj when three letters picked without replacement from {j: 1, a: 7, q: 2, u: 4}. 1/78 Three letters picked without replacement from jjjjejjejjej. What is prob of sequence eej? 9/220 Calculate prob of sequence gf when two letters picked without replacement from {y: 1, v: 1, f: 1, g: 12}. 2/35 Calculate prob of sequence hd when two letters picked without replacement from hqhdd. 1/5 Calculate prob of sequence ggc when three letters picked without replacement from cggcl. 1/15 What is prob of sequence fpq when three letters picked without replacement from {p: 5, f: 12, i: 1, q: 1}? 10/969 Two letters picked without replacement from {n: 1, o: 1, j: 2}. Give prob of sequence oj. 1/6 Three letters picked without replacement from zzezzezz. What is prob of sequence ezz? 5/28 What is prob of sequence weu when three letters picked without replacement from ueeueeweuewewwee? 9/280 Calculate prob of sequence gb when two letters picked without replacement from bgbbbbbbbbbbbbbbbgbb. 9/95 What is prob of sequence bwii when four letters picked without replacement from bwiwbwbiwoowoobwwb? 7/7344 Two letters picked without replacement from hggghgggg. Give prob of sequence hh. 1/36 Two letters picked without replacement from {z: 14, h: 5, s: 1}. What is prob of sequence sh? 1/76 Four letters picked without replacement from zezbbkkbjz. Give prob of sequence zbjk. 1/280 Three letters picked without replacement from {d: 1, j: 1, w: 2, l: 3, x: 3, e: 2}. What is prob of sequence lwx? 3/220 Four letters picked without replacement from ryykyrmerreere. What is prob of sequence rmry? 5/2002 What is prob of sequence aq when two letters picked without replacement from qqeaqfqeqqqfq? 2/39 What is prob of sequence pvm when three letters picked without replacement from fispvfm? 1/210 Three letters picked without replacement from clnmml. Give prob of sequence lml. 1/30 What is prob of sequence hfn when three letters picked without replacement from fhnehffenknffhf? 9/455 Two letters picked without replacement from abbavbbabbmabbb. What is prob of sequence ma? 2/105 Two letters picked without replacement from eeeeeee. Give prob of sequence ee. 1 What is prob of sequence ffdd when four letters picked without replacement from fuduuuddddudf? 1/286 Two letters picked without replacement from {e: 1, q: 2, n: 3, c: 1}. Give prob of sequence nq. 1/7 What is prob of sequence zzz when three letters picked without replacement from tsfzftzzz? 1/21 What is prob of sequence hl when two letters picked without replacement from rsrhls? 1/30 What is prob of sequence vva when three letters picked without replacement from {a: 1, v: 7, t: 5, h: 1, s: 1}? 1/65 Calculate prob of sequence jonv when four letters picked without replacement from {v: 1, p: 1, o: 2, j: 1, n: 2, e: 2}. 1/756 Three letters picked without replacement from {k: 6, h: 2, x: 8, d: 2}. What is prob of sequence dhk? 1/204 What is prob of sequence dc when two letters picked without replacement from {c: 18, d: 1}? 1/19 Four letters picked without replacement from {s: 2, w: 1, d: 3, a: 4, i: 1, m: 1}. Give prob of sequence miad. 1/990 Calculate prob of sequence ii when two letters picked without replacement from {i: 2, l: 1, y: 1, f: 1}. 1/10 Two letters picked without replacement from {y: 9, l: 7}. Give prob of sequence yl. 21/80 What is prob of sequence jp when two letters picked without replacement from {j: 7, p: 6, t: 6}? 7/57 Two letters picked without replacement from sviww. What is prob of sequence sv? 1/20 What is prob of sequence vww when three letters picked without replacement from {b: 6, h: 2, v: 4, e: 4, w: 1}? 0 Calculate prob of sequence wewe when four letters picked without replacement from {e: 8, w: 2}. 1/45 Four letters picked without replacement from {k: 2, u: 2, g: 4}. What is prob of sequence uggg? 1/35 Calculate prob of sequence tk when two letters picked without replacement from qkqqqiqstqiti. 1/78 Three letters picked without replacement from wxfxfzfzxffncxf. What is prob of sequence znf? 2/455 What is prob of sequence cc when two letters picked	{ "pile_set_name": "DM Mathematics" }
a(d) wrt d? 813d2 Let d(t) = 2t3 - t2 + 3t - 6. Let p be d(2). What is the second derivative of -pr*2 + 0r*2 - 32r*2 - 13r - 13r2 wrt r? -114 Let p(l) be the first derivative of -7l6/30 + l3/2 - 5l2 - 5l + 4. Let s(u) be the first derivative of p(u). Find the second derivative of s(t) wrt t. -84t2 Let q(j) be the third derivative of -131/3j*3 + 0 - 193j - 31/6j4 - j2. What is the derivative of q(v) wrt v? -124 What is the derivative of 517d*2 + 103 - 232 + 950d*2 + 1374 + 691 wrt d? 2934d Let a(v) be the third derivative of v*8/336 - 1061v7/210 + v5/10 - 19v4/2 + 2012v*2. Find the third derivative of a(i) wrt i. 60i*2 - 25464i Suppose 0o = -3o + 2j + 22, -4o - 9 = 5j. What is the third derivative of 5h*3 + 2 - 5h*o + 28h4 + h2 - 7h3 + 14h*2 wrt h? 552h - 12 Let w = 5 - -17. Let f be (w5)/(-2)(-8)/20. Find the second derivative of -fq + 18q + 6q5 - 2q wrt q. 120q3 Let q(c) be the first derivative of -2063c*2/2 + 2399c + 3209. Find the first derivative of q(g) wrt g. -2063 What is the first derivative of 4n4 - 2739 + 1941 + n - 2845 - 1004 + 3n + 32n2 wrt n? 16n*3 + 64n + 4 Differentiate 3487 - 41089p - 37961p + 75348p with respect to p. -3702 Let i(w) = -2w*3 - 2w*2 - w. Let v be i(-1). Let k be (-7)/5 + v - 284/(-10). What is the second derivative of -68 + kd*2 - 8d + 68 wrt d? 56 Suppose -14f + 138 = -12f. Suppose -11 = -10b + f. What is the derivative of 8i*2 + 11 + bi*2 - 40i*3 - 16i*2 wrt i? -120i*2 Let s(h) = -48h + 215. Let z(w) be the third derivative of -w4/6 - w3/6 + 30w2 - 4w. Let j(b) = s(b) - 4z(b). Differentiate j(g) with respect to g. -32 Let c be (15/9)/(3/189). Find the third derivative of -48n*5 - c + 37n5 + 106 - n4 + 8n2 wrt n. -660n*2 - 24n Let f be (4 + (-95)/15)-3 + 6. Find the third derivative of -2487g*5 + 217g*2 + 2487g*5 + fg*6 wrt g. 1560g*3 Differentiate 3351t*3 - 995 + 911 + 590 wrt t. 10053t*2 Let h = -103 + 105. Find the second derivative of -25a*4 + 2a*h + 508a - 3a2 - 540a wrt a. -300a2 - 2 Let g(k) = k + 1. Let n be g(1). What is the third derivative of 62t*3 + 3 - 5 - 6t2 + tn wrt t? 372 What is the second derivative of 30t - 1444t*4 - 13 + 25t + 48t + 27t - 127t wrt t? -17328t2 Let b(z) = z2 - 3z - 1. Let x be b(4). Suppose -6h + 54 = xh. What is the derivative of 6w + 24 + 6w2 + 13w*2 - hw wrt w? 38w What is the second derivative of 0 - 7 + 6 + 23f + 120f3 + 2 wrt f? 720f Let u be (-5)/508-50. What is the derivative of -36 + ur - 14 + 55r - 17 wrt r? 95 Let r be -214/(-12) + -4. What is the third derivative of 40v*r - 9v*2 - 7v*2 + 57v*3 + 3v*3 wrt v? 600 Let s = 62 - 58. Suppose -st = 2t - 54. What is the second derivative of -27r + tr + 17r*2 + 0r*2 wrt r? 34 Let m(x) = 3x*4 + 18x*3 - 83x*2 + 6x - 1477. Let q(h) = -h4 - h3 + 6h2 - h. Let u(l) = -m(l) - 6q(l). What is the derivative of u(s) wrt s? 12s3 - 36s*2 + 94s What is the first derivative of 11732 - 15657 - g*4 + 67g*2 + 6g*4 + 6g*4 wrt g? 44g*3 + 134g Let i(c) = 77c2 - 1395c - 8. Let j(w) = -156w2 + 2789w + 14. Let f(r) = 7i(r) + 4j(r). Find the second derivative of f(b) wrt b. -170 Let b(f) be the second derivative of -16/7f7 + 0f*6 - 1/20f*5 + 0f*3 + 49f - 1 + 1/2f2 + 53/12f*4. Find the third derivative of b(w) wrt w. -5760w*2 - 6 Suppose -4k + 248 + 164 = -4s, -5k = -s - 507. What is the second derivative of 60p - 110p + kp - 22p*4 + 2 wrt p? -264p*2 Suppose 4u - 2g = 842, -9g = 5u - 12g - 1052. Find the second derivative of ui4 + 96i*4 - 10 - 34i*4 - 9i - 27i4 + 5 wrt i. 2952i*2 Let r(u) be the second derivative of 0u*3 - 34 - 28/15u*6 + 0u*4 + 0u*5 - 175/2u*2 + 2u. What is the first derivative of r(q) wrt q? -224q3 What is the second derivative of 5 - 1216j*2 - 82 - j + 30 - 106 wrt j? -2432 Suppose 22b - 25b = -12. Suppose 2t = -3f - 2t + 11, 0 = bt + 4. What is the second derivative of rf + 16r*5 + 12r*5 + 28r wrt r? 580r3 Let a(j) = -32j - 5. Let i(u) = -14u. Let n(c) = 5c. Let b(h) = -6i(h) - 17n(h). Let z(r) = -3a(r) - 21b(r). Differentiate z(l) with respect to l. 117 Suppose -3c + 37 = 5g, -2c + 11 = -5g + 28. Suppose -k - 24 = -gk. Find the third derivative of -a6 - 14a*2 + 5a*6 - 16a*6 - 12a*k wrt a. -2880a*3 Let b(o) = -61o - 295. Let s(v) = 5v. Let g = -164 + 165. Let x(w) = gb(w) - s(w). What is the derivative of x(q) wrt q? -66 Let s(x) = x - 6. Let c(p) = 7p2 - 15p + 304. Let y(m) = -c(m) - 6s(m). What is the first derivative of y(h) wrt h? -14h + 9 Let f = 11411 - 11407. Let t(o) be the second derivative of 0o3 + 0o*f + 0o*5 - 2/3o*6 + 0 - 5o + 9o2. Find the first derivative of t(y) wrt y. -80y*3 Let n(t) be the third derivative of 0t*3 + 19/6t*5 + 0 - 173t*2 + 1/210t*7 + 19/20t*6 + 0t + 0t4. What is the third derivative of n(v) wrt v? 24v + 684 Suppose -5c + 5y = -10, 0 = 4c + 7y - 3y - 32. Find the third derivative of 4 - 56 + 20z*c + 4z*2 - 3z*2 + 40z*5 - 8z*5 wrt z. 3120z*2 Let r(s) = -3s*4 + 2s*3 - 3. Let m(b) = 1905b*4 + 8b*3 - 20b*2 - 2. Let o(x) = -m(x) + 4r(x). Find the third derivative of o(u) wrt u. -46008u Let q(k) be the first derivative of k5/5 + 1063k*3 + 3k*2/2 + 877k - 3914. What is the second derivative of q(a) wrt a? 12a2 + 6378 Let u(j) = -208j*3 + 8j*2 - 6j - 13. Let w be u(-8). What is the third derivative of w - 107043 + 96z2 - 334z*3 wrt z? -2004 Let i(y) be the second derivative of -159y5/4 - y4/12 - y*3/3 + 1669y*2/2 + 1599y. Find the first derivative of i(d) wrt d. -2385d2 - 2d - 2 Let u(x) = -6020x2 + 20x - 400. Let y(h) = 6020h2 - 18h + 403. Let i(d) = -10u(d) - 11y(d). Find the second derivative of i(z) wrt z. -12040 Suppose 0 = -23f + 36f - 52. Find the third derivative of -3q3 + 4q*f + 46q - q*2 - 7q*3 + 0q*2 + 6q*3 wrt q. 96q - 24 Let t(g) be the first derivative of -475g2/2 - 1739g - 1153. Find the first derivative of t(a) wrt a. -475 Let t(c) be the first derivative of 40c6/3 + 25c*4/4 - 5860c*3/3 + 8571. Find the third derivative of t(b) wrt b. 4800b*2 + 150 Let i(l) be the first derivative of -29/2l*2 - 90 - 4/3l*3 - 1/2l*4 + 0l. What is the second derivative of i(n) wrt n? -12n - 8 Let g(x) = -x - 11. Let z be g(-19). Suppose 2i - z = -2b, -b - 3b + 14 = 5i. Find the third derivative of 8p2 - p4 + p*4 - 53p*6 + 44p*b wrt p. -1080p*3 Suppose 5t = -2r - 19, 4r - r = -4t - 18. Let f be 2/t(-7 - -4). What is the third derivative of 15k2 + 24k*f + 18k*5 - 42k*5 wrt k? -1440k*2 Let q(m) = 30750m*2 + 29229m - 27. Let v(g) = 7689g2 + 7307g - 6. Let k(f) = -2q(f) + 9v(f). What is the second derivative of k(u) wrt u? 15402 Let n(v) = 5v2 - 15v - 2. Let r(o) = -4o2 + 17o + 2. Let i = -96 + 94. Let w(l) = in(l) - 3r(l). Find the second derivative of w(k) wrt k. 4 Let t = -276 + 278. What is the second derivative of -29x2 + 5x*2 + 31x + 5xt - 118x*2 wrt x? -274 Let j = 536/867 + 14/289. Let c(l) be the third derivative of -9l*2 + 0l*3 - 1/30l*5 + jl*4 + 0 + 0l. What is the second derivative of c(i) wrt i? -4 Let h(u) = 1115u3 - 12u*2 - 924u + 8. Let s(p) = -p*3 - 3p*2 + 3p + 2. Let z(i) = -h(i) + 4s(i). What is the second derivative of z(l) wrt l? -6714l Let q = 49 - 44. Suppose qa + 6 = 7a. Find the second derivative of 23p3 - 7p*4 - ap + 35p - 23p*3 wrt p. -84p*2 Let d(w) be the third derivative of -71/2w*3 + 0w*4 - 1/60w*5 - 2w*2 + 19/40w*6 + 0w - 165. Find the first derivative of d(r) wrt r. 171r2 - 2r Find the second derivative of -486v2 - 658v*2 + 603v*2 + 1519v + 1093v - 734v*2 wrt v. -2550 Let x(h) be the second derivative of 787h*8/28 + 29h*4/12 + 95h + 5. Find the third derivative of x(c) wrt c. 188880c3 Suppose 0 = 52f - 92 - 64. Let w(d) be the second derivative of 0 + 0df - 13/6d*4 - 16d - 1/4d5 + 0d**2. What is the third derivative of w	{ "pile_set_name": "DM Mathematics" }
). What is k(r)? 1 Suppose 0 = 98g - 96g - 40. Suppose -j - 4t = -2j - 2, -3j = 2t + g. Let p(r) = -r*2 - 6r + 1. Give p(j). 1 Let w(i) be the third derivative of i*6/120 + 7i*5/60 - 5i*4/12 - 7i*3/6 + 7i2 - 3. What is w(-8)? 9 Let b(r) be the third derivative of -r4/2 - 18r2. Calculate b(2). -24 Suppose -s = -3h + 4s + 14, 0 = -3h + 3s + 12. Let r(v) = -3 - 3v*2 + 0v*3 + 7v - 6v + hv*3 - 2v*3. Determine r(3). 0 Let b = 41 - 35. Let w(s) = 2s*2 - 11s + 9. Let l(d) = d*2 - 5d + 4. Let u(k) = bw(k) - 13l(k). Determine u(-3). -4 Let b(y) = y*3 + 2y*2 - 4y - 5. Let q be b(-3). Let m = 2 - q. Let d(r) = r*2 - 3r - 1. Give d(m). 3 Let f(j) be the first derivative of -j3 + j2 + 3j + 1. Let t = -8 + 12. Suppose 0 - 8 = tr. Calculate f(r). -13 Let j(s) = s*3 + 9s*2 - 9s + 7. Let o be j(-10). Let p(w) be the second derivative of w*4/12 + 2w*3/3 + 3w*2/2 - 62w. Determine p(o). 0 Let p(u) be the second derivative of -5u + 0 + 1/2u*2 - 1/3u3. Let g be (-2 - 0) + 3 + -2. Calculate p(g). 3 Let y(r) = -r3 - r - 3. Suppose 78 - 72 = -3l. Calculate y(l). 7 Let k(j) = j + 1. Let y be k(2). Suppose -yq = 3a, 2q + 15 = 5q. Let u(t) be the third derivative of -t5/60 - t4/4 + 7t3/6 + t2. What is u(a)? 12 Let s = -7 + 11. Suppose -sc - 12 = -4. Let f(z) = -z + 1 - 21z3 + z2 + 38z3 + z2 - 15z*3. Give f(c). -5 Let y(a) = -10a - 96. Let f(k) = -2k - 25. Let u(b) = -11f(b) + 3y(b). What is u(-10)? 67 Let f = -80 + 83. Let v(j) be the third derivative of 0j - 1/15j5 + 2j*2 + 1/3j*3 + 1/120j*6 + 0 + 0j*4. Calculate v(f). -7 Let d(r) = 3r - 125. Let f(k) = -k + 46. Let g(p) = 4d(p) + 11f(p). Determine g(-4). 2 Suppose 14 = 9u - 7u. Let j = -8 - -15. Let r(p) = -1 - jp + 2p + up. What is r(5)? 9 Let x = 178 - 168. Let n(z) = -z3 + 10z*2 + z - 6. Calculate n(x). 4 Let v(i) = -2i*2 - 23i - 4. Let g(n) = 3n2 + 25n + 5. Let w(t) = -3g(t) - 4v(t). What is w(15)? 31 Let t(v) = -18v + 7. Let x be t(0). Let a be (2 - 0/(-2)) + 0. Let r(j) = 2j*2 - 3j - 10 - aj - j2. Calculate r(x). 4 Suppose 62h - 77h = 15. Let s(q) = -23q + 1. Determine s(h). 24 Suppose 9 = t + 2t. Let i(w) = -6w + 3. Let p(u) be the third derivative of u*4/4 - 2u*3/3 + 4u*2 - 32u. Let h(o) = ti(o) + 2p(o). Give h(-1). 7 Let g(w) be the first derivative of -w*3/3 - 11w*2/2 + 17w - 3. Let t be g(-12). Let x(s) = -t + 0s + 0s*2 + 5s*2 - 3s*2 + 4s. Give x(-4). 11 Let c(t) = t*3 - 2t*2 - 7t + 8. Let y be c(3). Let j(a) = -a. What is j(y)? 4 Let y(h) = -h*2 + 4h - 1. Let c(r) = r*2 - 6r - 8. Let a(g) = g*2 - 2. Let m be a(3). Let b be c(m). Let d be 5/((-3 + 2)b). Calculate y(d). -6 Let i(o) = -2o - 1. Let p(s) be the first derivative of -s4/4 + 5s*3/3 + 3s + 4. Let u be p(5). What is i(u)? -7 Let i(r) be the third derivative of -r*6/120 + 11r5/60 + r4/2 - 8r3/3 + 6r*2 + 9r. Determine i(12). -16 Let j(q) = -q*3 - 16q + 0q3 - 6q*2 - 3 - 5q*3 + 2q*3 + 5q3. Calculate j(8). -3 Let g(i) = i3 - 6i2 + 2i - 9. Let r be 4 + (-7 - 0) + 9. Calculate g(r). 3 Let n(k) = -k*2 + 4 - 2k + 4k + 0k*2 + 8k*3 + k - 6. Calculate n(1). 8 Suppose 4r = -0r - 96. Let h be -3 - (62/(-2) + 0). Let w = h + r. Let t(s) = -4s + 2. Calculate t(w). -14 Let o = 22 + -20. Suppose -on + 2z = 3z + 4, 4n + 4 = -z. Let r(h) = -9h + 2h*2 + nh - 4h + 12h. Calculate r(-2). 10 Let n be -2-4(-40)/64. Let b(w) = w*3 + 6w*2 + 6w - 1. Give b(n). -6 Let g(l) = 2l3 + 16l*2 - 19l. Let a be g(-9). Let m(r) = r*2 - 11r - 2. Determine m(a). -20 Suppose -x + 16 - 4 = 4h, -5x = -2h + 28. Let f be (h + 4 + -10)/1. Let t(p) = -2p*2 - 2p + 2. Give t(f). -2 Let x(g) be the first derivative of 10g + 1/4g*4 - 7/3g*3 + 5 - 1/2g2. Determine x(7). 3 Let n(u) be the first derivative of u3/3 - u*2/2 + 3u - 4. Let b be n(0). Let r = 8 - b. Let k(y) = -y + 5. Determine k(r). 0 Suppose 12f + 9 = 13f. Let t be ((-2)/4)/(f/(-36)). Let v(l) be the second derivative of l3 - l2 + 14l. What is v(t)? 10 Let x(z) = z2 - 7z + 3. Suppose 0j + 22 = 2j - 4f, -3j + 5f = -30. What is x(j)? -7 Let w(v) be the third derivative of 0v + 1/24v4 + 0v*3 + 25v*2 + 0 + 1/30v*5. Determine w(1). 3 Suppose -2872l + 2869l = 0. Let d(f) = f - 16. Calculate d(l). -16 Let n be (-30)/(-5) - (0 - 2)-1. Let a(v) = v + n - 7 + 0v. Calculate a(-7). -10 Let f = 17 + -16. Let k be -2f(-25)/10. Let m(t) = -4t + 5t - 5t2 + 3 - 2 + t3. Give m(k). 6 Let i(x) = 6 - x + x*2 - 6. Suppose -18 = -14a + 5a. Suppose -u + 5m - 9 = 12, -12 = 4u - am. What is i(u)? 2 Let m = -55 - -57. Let s be 0 + 1 - 7/(-2)m. Let k(y) = y2 - 8y - 7. Calculate k(s). -7 Let n(u) = 4u - 12 - u + 8 - 2u. Let g(l) = l*2 + 7l + 3. Let j be g(-8). Let i = j - 11. What is n(i)? -4 Let v(r) be the second derivative of r3/3 + r2/2 - 7r. Let x = 5 + 4. Suppose 2j = 4g + 2, j = -4g + 2g + x. What is v(g)? 5 Suppose -5s - 2g + 34 = 0, -5 = 2g - 9. Let a(r) = -r*3 + 7r*2 - 5r - 5. Calculate a(s). 1 Let x(o) = -2o - o2 + o2 - o2 - 1. Suppose -25 - 2 = -9k. Calculate x(k). -16 Let v(l) = 3l2 - 4l + 1. Let t be v(2). Let g(y) = -ty + 5y + y. Give g(-2). -2 Suppose 2y + 15 = -5d + 5y, 10 = 2y. Let b(a) be the second derivative of a5/20 - a3/6 - 11a2 - 9a. Give b(d). -22 Let z(v) = -3v + 6. Let t(b) = -3b*2 - 4b - 1. Let q be t(-2). Let h = 0 - q. Determine z(h). -9 Suppose 4g - t = g + 107, -4g + 164 = 4t. Let c(i) = -g + 15 - 4i + 20 - i*2. Let j be (-2)/7 + (-26)/7. What is c(j)? -2 Let k be (-6)/(-18)(-40 - -1). Let n = -16 - k. Let x be n(1-4)/(-12). Let g(c) = 2c2 + 2c + 1. Calculate g(x). 1 Let g(i) = 6 - 2 - 5 + 3i + 3. Suppose -8 = 8v - 4v. Calculate g(v). -4 Let y(s) = 3s - 3. Suppose i = 2q - 28, 2i + 6 + 5 = q. Let d be (q/9)/(2/24). Suppose 0 = -4p + d, -17 = -c - 2p - 3. Give y(c). 9 Let m = -32 - -35. Suppose m = 2f - 3j - 11, -j + 32 = 3f. Let i(s) = 0s - s2 - s - f + 14. Give i(0). 4 Let d(y) = -y3 - 2y2 + 2y + 2. Let f be ((-2)/(-2))/((-4)/(-28)). Suppose -f = 5q - u + 1, -2u - 10 = 3q. Determine d(q). -2 Let t(d) = -3d*3 - 5d - 6d2 + d3 + d3 + 0d*3 + 3. What is t(-4)? -9 Let t(g) = 9g*2 + 3g - 19. Let v(p) = 3p + 8. Let k be v(-5). Let y(i) = -4i*2 - 2i + 9. Let q(x) = ky(x) - 3t(x). Give q(-7). 8 Let d(k) = k*3 + 13k*2 + 13k + 13. Let i be d(-12). Let l(m) = -4m - 4m + 3 - 7m2 + m3 - 3 - i. Calculate l(8). -1 Let v = -89 + 94. Let l(j) = -j3 + 5j*2 + 2j - 7. Give l(v). 3 Let f(o) = 2o + 3. Let s(j) = 7j3 + j2 + 10j + 9. Let n be s(-1). Calculate f(n). -11 Let r(f) = 9f + 4. Let v(m) = -18m - 8. Let j(z) = 5r(z) + 2v(z). Give j(-3). -23 Let h(w) be the second derivative of -w6/120 + w4/24 - 3w3/2 - w2/2 + 8w. Let g(m) be the first derivative of h(m). Determine g(0). -9 Suppose -5a = -0a - 20. Let g(l) = -4l + 3917l2 + 6 + 3914l*2 - 7830l*2. Calculate g(a). 6 Let x(t) = -t + 29. Let w be x(24). Let k(g) = -wg*2 + 52g - g*3 - 98g + 51g - 4. Determine k(-6). 2 Suppose 0 = -2o + l + 14, -o - 2l + 26 = 9. Let d(p) = 3p - 16. Give d(o). 11 Let p(n) = -41n + 45n + 16 + 22 - 13n. Give p(4). 2 Let d(p) = 3p*2 - 14p - 19. Let a(c) = -c*2 + 7c + 9. Let r(k) = 5a(k) + 2d(k). Let v be r(-6). Let z(b) = 11b + 1. What is z(v)? 12 Let n(z) = -z2 + 4z + 247. Let y be n(18). Let h(i) = i*2 + 6i - 6. Calculate h(y). -11 Suppose 3g + 5z = -12, -4g - 3z = 15 + 12. Let h(c) be the second derivative of -c*5/20 - 2c*4/3 + 3c*3/2 + 2c*2 - c. Determine h(g). 4 Suppose -6n - 185 = -11n. Let i(y) = 31y*3 + y + ny*3 - 71y*3. Give i(-1). 2 Let a(r) be the second derivative of 1/6r*3 + 6r + 1/6r4 + 0 + 5/2r*2 + 1/60r5. Let q(y) be the first derivative of a(y). Calculate q(-5). 6 Let v(o) = -o3 + 6o2 + 18o - 14. Let i be 343/(-147) - (-93)/9. What is v(i)? 2 Let z(v) = -v*2 - v + 5. Let w = 89 - 85. Suppose wl = -4y + 8, 4l + 2 = -y + 10. Determine z(y). 5 Let k(z) = z*2 - 6z - 2. Let f(i) = i*2 - 7i - 3. Let j(w) = -2f(w) + 3k(w). Let x be 5*(7	{ "pile_set_name": "DM Mathematics" }
(sqrt(2)1) - (-5sqrt(102)/sqrt(6) + 4-3sqrt(17)))*2. 8990 Simplify ((sqrt(255) - -1(1sqrt(255) - sqrt(255)))/((sqrt(245) - -2sqrt(245)) + sqrt(245) - sqrt(245)))/(6(sqrt(30)/(sqrt(5)-2))/sqrt(2)). -sqrt(17)/63 Simplify ((2sqrt(252)-1)/(2sqrt(588)))/((5sqrt(12)/sqrt(2))/(sqrt(2) + -2(sqrt(18) + sqrt(2)))). sqrt(7)/5 Simplify (1sqrt(5184) + sqrt(5184) - sqrt(5184))/(sqrt(24)/(sqrt(18) - sqrt(2))) + (3 + sqrt(75)-2)2 + (1 + 2sqrt(75))*2. -16sqrt(3) + 610 Simplify (-3(5 + (3sqrt(176))*2) + sqrt(176) + (-3(2 + sqrt(176)))*2 + (sqrt(176) + 2 + sqrt(176))-2)4. -12604 + 528sqrt(11) Simplify (1-3sqrt(540))/(sqrt(15)/(sqrt(3)3-3)) + -3. -3 + 162sqrt(3) Simplify (-4(sqrt(180) - (sqrt(180) + 1)) - (sqrt(5) + -2 + sqrt(5) + -2 + 4 + sqrt(720)))*2. -112sqrt(5) + 996 Simplify ((2 + (-3 + 1sqrt(99) - sqrt(99)) + -5 + 0 + -3)2)*2. 324 Simplify (5 + sqrt(192) + 1 + sqrt(192) + (sqrt(192) + 1)-1 - -1((sqrt(192) - (1 + sqrt(192))) + -1 + (1 + sqrt(192))-2))*2. -16sqrt(3) + 193 Simplify 3(-6-4(1 + (3 + -1sqrt(242) - sqrt(242) - (sqrt(242) - (sqrt(242) + -1 + -2))))5)2. -1900800sqrt(2) + 41860800 Simplify (1 + (sqrt(13) + -1sqrt(13) + 4 + (-1sqrt(143))/sqrt(11))*2 - (((sqrt(52) - sqrt(156)/sqrt(3)) + sqrt(52))2)/(-1sqrt(324))) + -5. -70sqrt(13)/9 + 25 Simplify 4 + -4((2 + -2sqrt(847) - (-3 + 2sqrt(847)))2 - (2sqrt(847)6 - 12sqrt(847))2). 1760sqrt(7) + 284496 Simplify (-2sqrt(130)5 + sqrt(130))/(sqrt(50)/sqrt(5)-3) + ((sqrt(104) + -2sqrt(104))5 + sqrt(104))/(sqrt(800)2). 14sqrt(13)/5 Simplify -6(1(3 + sqrt(72)1 + 2 - ((sqrt(72) - (sqrt(72) - (1 + sqrt(72))-3)) + 4-2sqrt(72))))2. -62592 - 6912sqrt(2) Simplify 3 + -2 + ((sqrt(170)-2)/sqrt(10) + 4 + 4 + sqrt(153)/(sqrt(36)/sqrt(4)))2 + 3. -16sqrt(17) + 85 Simplify (-62sqrt(1440)-6)/((-2sqrt(2304))/(-2sqrt(8)/sqrt(4))). 36sqrt(5) Simplify (3sqrt(539)265 - (sqrt(539) - (2 + sqrt(539))-2 - (sqrt(539) + 0 - sqrt(539))-3))*2. -9912sqrt(11) + 16886347 Simplify (4 + ((sqrt(640)-6)/((sqrt(5) - -3sqrt(5) - sqrt(5))-5))23 + 3)-4. -6844/25 Simplify (-3(-5(sqrt(832)-3 + 4) - ((2sqrt(832) + sqrt(832) - sqrt(832)) + -3 - sqrt(832))2))*2. -26208sqrt(13) + 1267236 Simplify ((5(sqrt(440) + -1sqrt(440) + sqrt(440) + sqrt(440)))/((sqrt(392) - -1sqrt(392) - sqrt(392)) + sqrt(392)))/(2sqrt(55)/(sqrt(704)/sqrt(4))). 10sqrt(11)/7 Simplify 4 + ((sqrt(90)/sqrt(5) - (-1 + sqrt(2))-4) + -1 + sqrt(242) + -1)*2 + -4 + 2. -216sqrt(2) + 686 Simplify ((-1sqrt(100)-1)/((sqrt(20) - 3sqrt(20))/sqrt(5)))/(sqrt(500) + (-1sqrt(500) - sqrt(500)) + sqrt(500) + 4sqrt(125)). -sqrt(5)/40 Simplify (4 + -3 + sqrt(34)/sqrt(2) + 2sqrt(2448) + 1 + -4 + sqrt(102)/sqrt(24) + 2)*2. 44217/4 Simplify (-1(-3 + sqrt(288) + 0 + 2sqrt(288)1 - (3 + 0 + sqrt(288) + -1sqrt(288)-3)) + 2)*2. 192sqrt(2) + 352 Simplify ((sqrt(19) + 0)-5 + 3 + sqrt(76) + ((sqrt(209)2)/sqrt(11) - (-1 + sqrt(475))) + 2)*2. -72sqrt(19) + 720 Simplify (-4(sqrt(19) - sqrt(19)-4))*2 + (sqrt(76)-4 + sqrt(76))/sqrt(4) + (5 + sqrt(19)-2 + sqrt(19))2 + (-3sqrt(133))/sqrt(7). -16sqrt(19) + 7644 Simplify ((-5sqrt(196)1)/(sqrt(28)-5))/(-3sqrt(100) - sqrt(100)-1). -sqrt(7)/20 Simplify (3sqrt(20)/sqrt(810) - ((sqrt(20)/(sqrt(40)/sqrt(4)))2 - ((sqrt(242)-2)*2 - sqrt(2)))) + 5. -2sqrt(2)/3 + 971 Simplify ((6(sqrt(68) + 1sqrt(68)))/sqrt(2))/(sqrt(8)/(sqrt(12)/sqrt(3)4)) + 3 + -3. 48sqrt(17) Simplify -3 + (63(2sqrt(91) + sqrt(91)))/((-4sqrt(28)/sqrt(4) - sqrt(7))5)-3. -3 + 162sqrt(13)/25 Simplify (-5 + (sqrt(243) + (-31sqrt(243) - sqrt(243)) + sqrt(243)-11)/((2sqrt(99)2 + sqrt(99))/(sqrt(11) + sqrt(11) + sqrt(539)-1)))*24. -480sqrt(3) + 1828 Simplify (sqrt(180) + -1)-5 + ((sqrt(180) + -2 + sqrt(180) - sqrt(180)) + -3)*2 - ((1 + sqrt(180) - sqrt(180))3 + -3 + 3)*2. -90sqrt(5) + 201 Simplify -2 + (3 + sqrt(180) + -1 + -3 - 4(sqrt(180) + ((0 + sqrt(180))2 + sqrt(180))5)) + 1. -3602 - 138sqrt(5) Simplify (-4((sqrt(567) + -1)5 + 1) - (2 + 5 + sqrt(567) + sqrt(567)-2 + 5))*2. -1368sqrt(7) + 204703 Simplify ((sqrt(44)-3)21 - ((sqrt(22)-1 - sqrt(22))/sqrt(2) + -3)) + 0 + -2. 2sqrt(11) + 397 Simplify ((sqrt(18) - sqrt(18)31) + sqrt(1800)-2)/(((2sqrt(12) - sqrt(12))-6)/sqrt(128)) + -2. -2 + 88sqrt(3)/3 Simplify -3(((sqrt(24) - 2sqrt(24))3)/(sqrt(432)2 + sqrt(432)) + (sqrt(1944)-2 + sqrt(1944))/(-4sqrt(192)))-4. 19sqrt(2)/4 Simplify 1 + 2((sqrt(75) + sqrt(75) + (sqrt(75) + 1)-1)*2 - (sqrt(75)-4 + -5)*2)-4. 1680sqrt(3) + 9193 Simplify ((3sqrt(66) + sqrt(66) + sqrt(66))-1-5)/((sqrt(66)-5-3 + sqrt(66))/sqrt(11)) + -5. -5 + 25sqrt(11)/16 Simplify ((sqrt(77) - (sqrt(77) - (sqrt(77) + (1sqrt(77) - sqrt(77))3)))2)/(-3-2sqrt(396)) + -5. -5 + sqrt(7)/18 Simplify (5(-4 + 4 + -6-2sqrt(1584))46-4)*2. 52553318400 Simplify ((sqrt(187) + 2sqrt(187)2)5-6)/(3-2sqrt(275)-1). -5sqrt(17) Simplify (1 + sqrt(2736) + 5 + (21sqrt(2736) - sqrt(2736) - sqrt(2736)) + sqrt(2736) + -3)2 + (-2 + (-1(sqrt(2736)-1 + sqrt(2736)))2 + sqrt(2736))4. 192sqrt(19) + 10945 Simplify -1 + (-6(-5 + 2(-1 + sqrt(605))) + -3)2-6 + 5. -531842 + 61776sqrt(5) Simplify 3((5 + sqrt(325)-1 - (sqrt(325)2-4)2) + (2sqrt(325)1 + -3(0 + sqrt(325) + sqrt(325)))*2)-5. 75sqrt(13) + 233925 Simplify 4(-5sqrt(130)-2-1)/(sqrt(640) - (sqrt(640) - ((sqrt(640)-2 + sqrt(640))5 - sqrt(640)))). 5sqrt(13)/6 Simplify 4((-6sqrt(228)-1 - sqrt(228))/(sqrt(24)/(-1sqrt(2))) + (-2 + 2sqrt(304) + -1)2) + -4. -212sqrt(19) + 4896 Simplify 6((sqrt(60) - (sqrt(180) - sqrt(180)1)/sqrt(3) - sqrt(60)) + (-2sqrt(240) + sqrt(240) + sqrt(240))/sqrt(4))/(sqrt(1200)1-5). 0 Simplify (5(sqrt(3645) + sqrt(3645)3) - sqrt(3645))/(sqrt(54)/sqrt(6)2-2)-5. 855sqrt(5)/4 Simplify ((-1 + -1 + ((sqrt(847) - (3 + sqrt(847))) + 1 - (sqrt(847) + 3)2))*2 + 3)-4. -13964 - 1760sqrt(7) Simplify -4-5(-4(1(sqrt(1300) - (sqrt(1300)-2 + sqrt(1300)) - sqrt(1300) - sqrt(1300)) + 2(3sqrt(1300) - sqrt(1300))))*26. 39936000 Simplify ((-3 + -3(sqrt(2268) + -2)-5)-3 + 3)2. -165240sqrt(7) + 4603104 Simplify -1 + 3(sqrt(1216)-2 + -5) + -5(sqrt(304) - (0 + sqrt(304) + 1)2). -28sqrt(19) + 1509 Simplify 3(4 + -3(sqrt(78)-1)/sqrt(6) - ((sqrt(1300)-1 - sqrt(1300))2 + (sqrt(65)/sqrt(80))2)). -249447/16 + 9sqrt(13) Simplify (sqrt(864)2)/sqrt(2)-6 + sqrt(3) + sqrt(3) + 3 + 0 + -2sqrt(3) + 1. -144sqrt(3) + 4 Simplify (3sqrt(1800) + (-1sqrt(100))/sqrt(2))/(6((sqrt(10) - sqrt(40)) + sqrt(10)) + sqrt(50)/sqrt(80)). 68sqrt(5) Simplify 2(-5(sqrt(308) - (sqrt(308) - (sqrt(308)-1 + sqrt(308)) - sqrt(308)))/sqrt(7))/(sqrt(8)/(-2sqrt(18))). 60sqrt(11) Simplify (3 + (2 + (3 + sqrt(4800) + 1)*2 + 2)5)3. 4800sqrt(3) + 72309 Simplify ((1sqrt(1536) - sqrt(1536)) + sqrt(1536))/(sqrt(32)/(sqrt(8)/sqrt(2))) - ((sqrt(27)/sqrt(3))/sqrt(3) - (1sqrt(432) - sqrt(3)))*2. -300 + 8sqrt(3) Simplify (3 + (-3(-4sqrt(114)/sqrt(3) - sqrt(38)))/((sqrt(2156)/sqrt(11))/sqrt(2)) + 2)*2. 150sqrt(19)/7 + 5500/49 Simplify ((sqrt(88) - (-2sqrt(88) - sqrt(88)))-56)/(-6sqrt(704)-22). -5sqrt(2)/4 Simplify (-1 + ((4(sqrt(72) - 2sqrt(72)) + sqrt(72) + sqrt(72))/sqrt(12))/(sqrt(4)/sqrt(2)6 - (sqrt(18)/(sqrt(36)/sqrt(4)) - sqrt(2))))*2. 2sqrt(3)/3 + 4/3 Simplify -5 + ((-2(sqrt(110) + (-1sqrt(110) - sqrt(110)))6)/(sqrt(70)/(-1sqrt(7)) + sqrt(10) - (sqrt(40)/sqrt(4)2 + sqrt(10)))2)*2. 699 Simplify 2(3 + -1 + (sqrt(1100) - (sqrt(1100) + 3)) + 1 + (-1 + sqrt(1100) + sqrt(1100) + 3 + sqrt(1100))*2) + 2. 240sqrt(11) + 19810 Simplify (-5 + -6((sqrt(243) - (sqrt(243) + -1)-4 - (1 + 2sqrt(243))) + -2(sqrt(243) + 1 + 1)))*2. -5292sqrt(3) + 11149 Simplify ((-3-3(sqrt(6) - sqrt(42)/(sqrt(21)/sqrt(3))))/((sqrt(27) - sqrt(189)/(-1sqrt(7)))-2))*2. 0 Simplify (((sqrt(1512)1 - sqrt(1512)) + sqrt(1512) + 4sqrt(126)/sqrt(3))-4)/(sqrt(1944) + sqrt(6) + sqrt(42)/(sqrt(7) - sqrt(252))). -100sqrt(7)/47 Simplify -1((sqrt(96)/(-4(sqrt(4) + (sqrt(4) - sqrt(36))) - sqrt(4)))/(sqrt(24)/(sqrt(9)/sqrt(3)) - (sqrt(8) + -21sqrt(8) - sqrt(8)))-6)*2. -4/3 Simplify (-3(sqrt(720) + -53sqrt(720) + (sqrt(720) - sqrt(720)*2 - sqr	{ "pile_set_name": "DM Mathematics" }
a - 619094 What is the p'th term of 72, 230, 662, 1506, 2900, 4982, 7890, 11762? 23p3 - p2 + 50 What is the f'th term of -6342, -6339, -6334, -6327? f2 - 6343 What is the s'th term of -1024, -878, -634, -292, 148, 686? 49s*2 - s - 1072 What is the b'th term of 400, 1586, 3560, 6322? 394b*2 + 4b + 2 What is the i'th term of -531, -2201, -5005, -8943? -567i2 + 31i + 5 What is the f'th term of -162515, -325039, -487563, -650087? -162524f + 9 What is the q'th term of 199954, 199955, 199956? q + 199953 What is the v'th term of 7230, 7250, 7270, 7290, 7310, 7330? 20v + 7210 What is the l'th term of 352001, 704004, 1056007, 1408010? 352003l - 2 What is the w'th term of -373, -783, -1457, -2389, -3573, -5003, -6673, -8577? w3 - 138w*2 - 3w - 233 What is the r'th term of 11148, 44628, 100424, 178536? 11158r2 + 6r - 16 What is the z'th term of 5429, 21611, 48579, 86333, 134873, 194199? 5393z2 + 3z + 33 What is the t'th term of 789177, 789173, 789167, 789159, 789149? -t2 - t + 789179 What is the t'th term of 3526, 3517, 3510, 3505? t2 - 12t + 3537 What is the q'th term of -162, -297, -654, -1341, -2466, -4137, -6462, -9549? -18q*3 - 3q*2 - 141 What is the o'th term of -25, -83, -211, -433, -773, -1255, -1903? -4o*3 - 11o*2 + 3o - 13 What is the u'th term of 146, 301, 476, 677, 910, 1181, 1496? u*3 + 4u*2 + 136u + 5 What is the k'th term of -119, -273, -393, -449, -411? 5k3 - 13k*2 - 150k + 39 What is the u'th term of -41167, -82306, -123445, -164584? -41139u - 28 What is the c'th term of 6819, 13626, 20421, 27198, 33951? -c3 + 6814c + 6 What is the k'th term of 2974, 2867, 2760, 2653, 2546, 2439? -107k + 3081 What is the k'th term of 6420, 6257, 5820, 4971, 3572, 1485, -1428? -23k3 + k2 - 5k + 6447 What is the x'th term of -1367, -2837, -4307, -5777, -7247, -8717? -1470x + 103 What is the h'th term of 689, 783, 873, 959, 1041? -2h2 + 100h + 591 What is the y'th term of -67, -136, -243, -382, -547, -732, -931, -1138? y*3 - 25y*2 - y - 42 What is the u'th term of -219, 214, 1391, 3684, 7465, 13106, 20979? 62u3 - u - 280 What is the q'th term of -39, -2, 45, 108, 193? q3 - q*2 + 33q - 72 What is the d'th term of 37, 123, 209, 295, 381? 86d - 49 What is the d'th term of -71, 40, 331, 796, 1429, 2224, 3175, 4276? -d3 + 96d*2 - 170d + 4 What is the z'th term of 417, 775, 1379, 2235, 3349, 4727, 6375? z*3 + 117z*2 + 299 What is the v'th term of -78408, -78405, -78402, -78399, -78396, -78393? 3v - 78411 What is the u'th term of -77872, -77871, -77870, -77869? u - 77873 What is the v'th term of -103193, -103179, -103147, -103091, -103005, -102883, -102719, -102507? v*3 + 3v*2 - 2v - 103195 What is the v'th term of -1472, -1466, -1464, -1466, -1472, -1482? -2v2 + 12v - 1482 What is the g'th term of -255, -442, -751, -1182, -1735? -61g2 - 4g - 190 What is the r'th term of -1365, -5332, -11937, -21174, -33037? r*3 - 1325r2 + r - 42 What is the s'th term of -72, -288, -502, -720, -948, -1192? -s3 + 7s2 - 230s + 152 What is the r'th term of -231141, -231139, -231137? 2r - 231143 What is the k'th term of 52448, 52452, 52456, 52460, 52464, 52468? 4k + 52444 What is the s'th term of 15020, 60107, 135246, 240431, 375656? -s*3 + 15032s*2 - 2s - 9 What is the u'th term of -282, -151, -24, 99? -2u2 + 137u - 417 What is the c'th term of -523960, -523959, -523958, -523957, -523956, -523955? c - 523961 What is the p'th term of -491, -476, -451, -416, -371, -316, -251? 5p2 - 496 What is the y'th term of 139114, 139115, 139116, 139117, 139118, 139119? y + 139113 What is the t'th term of -26299, -105189, -236679, -420775, -657483, -946809? -t3 - 26294t*2 - t - 3 What is the a'th term of 8, 268, 964, 2306, 4504, 7768? 35a*3 + 8a*2 - 9a - 26 What is the d'th term of -12485, -12489, -12493? -4d - 12481 What is the d'th term of 4640, 8845, 13050? 4205d + 435 What is the b'th term of -469, -967, -1465, -1963, -2461, -2959? -498b + 29 What is the m'th term of 90460, 180942, 271424? 90482m - 22 What is the i'th term of 1696793, 1696792, 1696791, 1696790? -i + 1696794 What is the g'th term of 1362, 1788, 2200, 2592, 2958? -g3 - g2 + 436g + 928 What is the z'th term of -575, -734, -903, -1088, -1295, -1530, -1799? -z3 + z2 - 155z - 420 What is the j'th term of 29922, 29926, 29930? 4j + 29918 What is the h'th term of -313235, -2505889, -8457375, -20047109, -39154507? -313236h*3 - 2h + 3 What is the t'th term of 2043973, 4087946, 6131919, 8175892, 10219865? 2043973t What is the l'th term of -60, -110, -142, -150, -128, -70? l3 + 3l*2 - 66l + 2 What is the j'th term of -43893, -87796, -131699, -175602? -43903j + 10 What is the t'th term of -51, -111, -281, -621, -1191, -2051, -3261, -4881? -10t*3 + 5t*2 - 5t - 41 What is the q'th term of 1762, 1697, 1634, 1573, 1514, 1457, 1402? q*2 - 68q + 1829 What is the k'th term of 1293, 2650, 4005, 5358, 6709, 8058? -k*2 + 1360k - 66 What is the p'th term of -43, -140, -295, -502, -755, -1048, -1375, -1730? p*3 - 35p*2 + p - 10 What is the o'th term of -312, -751, -1322, -2025, -2860? -66o*2 - 241o - 5 What is the d'th term of -31359, -62713, -94067, -125421, -156775, -188129? -31354d - 5 What is the c'th term of -2580, -3611, -4638, -5661, -6680, -7695? 2c*2 - 1037c - 1545 What is the z'th term of -100497, -100493, -100491, -100497, -100517, -100557, -100623? -z*3 + 5z*2 - 4z - 100497 What is the i'th term of 892, 1755, 2616, 3475, 4332, 5187, 6040? -i*2 + 866i + 27 What is the f'th term of -46594, -46689, -46784, -46879, -46974, -47069? -95f - 46499 What is the y'th term of -268, -278, -276, -256, -212, -138, -28, 124? y3 - 17y - 252 What is the h'th term of -50, -98, -114, -86, -2, 150, 382? 2h3 + 4h*2 - 74h + 18 What is the l'th term of -11004, -11059, -11112, -11163, -11212? l*2 - 58l - 10947 What is the b'th term of -71, -125, -119, -11, 241, 679, 1345, 2281? 7b3 - 12b*2 - 67b + 1 What is the s'th term of 14857, 29715, 44573? 14858s - 1 What is the v'th term of 27, 66, 179, 402, 771, 1322, 2091, 3114? 6v3 + v2 - 6v + 26 What is the y'th term of 11, 184, 669, 1622, 3199, 5556, 8849? 26y*3 - 9y - 6 What is the m'th term of -40288, -80574, -120860, -161146, -201432? -40286m - 2 What is the p'th term of -2253, -4337, -6407, -8457, -10481, -12473, -14427, -16337? p3 + p2 - 2094p - 161 What is the d'th term of 49092, 49093, 49094, 49095, 49096? d + 49091 What is the n'th term of 2311, 2334, 2379, 2452, 2559, 2706? n*3 + 5n2 + n + 2304 What is the m'th term of -27996, -28011, -28040, -28089, -28164? -m3 - m*2 - 5m - 27989 What is the t'th term of 1230, 1631, 2300, 3237, 4442, 5915? 134t2 - t + 1097 What is the h'th term of 65, 194, 421, 746, 1169, 1690, 2309? 49h*2 - 18h + 34 What is the j'th term of 22, 44, 84, 142? 9j2 - 5j + 18 What is the q'th term of 943, 749, 317, -473, -1741, -3607? -20q3 + q2 - 57q + 1019 What is the m'th term of -205, -1146, -3697, -8662, -16845, -29050, -46081, -68742? -134m3 - m2 - 70 What is the i'th term of 840045, 840046, 840047, 840048? i + 840044 What is the r'th term of 14020, 14319, 14608, 14881, 15132? -r3 + r2 + 303r + 13717 What is the t'th term of -180, -581, -1202, -2043? -110t2 - 71t + 1 What is the x'th term of -102129, -102098, -102055, -101994, -101909? x*3 + 24x - 102154 What is the r'th term of -50207, -50210, -50213, -50216, -50219, -50222? -3r - 50204 What is the p'th term of -1480, -5899, -13264, -23575, -36832, -53035? -1473p2 - 7 What is the v'th term of -27046, -27046, -27044, -27040, -27034, -27026, -27016? v2 - 3v - 27044 What is the q'th term of 653, 633, 555, 389, 105? -5q3 + q2 + 12q + 645 What is the u'th term of -111395, -222770, -334145, -445520? -111375u - 20 What is the z'th term of 1090, 2096, 3102, 4108? 1006z + 84 What is the j'th term of 1539, 3088, 4657, 6246, 7855, 9484, 11133? 10j*2 + 1519j + 10 What is the v'th term of -301689, -301687, -301685, -301683, -301681, -301679? 2v - 301691 What is the y'th term of -20949, -41853, -62761, -83673? -2y*2 - 20898y - 49 What is the u'th term of -3162, -6341, -9520?	{ "pile_set_name": "DM Mathematics" }
-7 8 + ((-5976)/504 - (-16)/(-14)) -5 Evaluate ((-169)/(-7) - -3) + 495/(-231). 25 What is the value of (0 + (-5 - -4))(-22 - -12)? 10 (4/((-12)/3))/(3 - 2) -1 What is ((-2)/(-24))/((-576)/3072)? -4/9 What is the value of 7/3 + (-1520)/528? -6/11 (85/68 + 3)/(1/(-4)) -17 Calculate 213/1136 - 3451/(-112). 31 1/20(-10)/(-150)100 1/3 What is the value of (11 - (22078/855 - 15))5/6? 4/27 What is (-1849)/1290 - (-184)/115? 1/6 Calculate 230/70 + -10 + 1 + 2. -26/7 (-10)/95 + 5/(95/(-17)) -1 (-70)/(-24) + (-18)/(-24) + (-113 - -109) -1/3 What is the value of (61 - 60) + -9 + 3 + -2? -7 Evaluate (-87)/1131 - (-1148)/52. 22 (48/(-112))/(351/91) -1/9 3/((-54)/(-4)) + (-9280)/(-360) + -26 0 What is the value of ((-18)/24)/((-513)/304)? 4/9 5 - 6 - 9/9 - 13/(-1) 11 What is (54 + 5076/(-90))25/4? -6 Calculate (10/(-60))/((-24)/504). 7/2 What is 27 + 68/(-408)186? -17 Calculate 1/5(-34)/((-1088)/(-540)) - -4. 5/8 What is ((-30)/9)/(14/(756/15))? -12 -34 + 38 + (-13)/(65/50) -6 Evaluate ((-36)/(-16))/(24/80) + (-4 - 3). 1/2 What is ((-10)/(-65) + 187/3094)/(16/(-168))? -9/4 Calculate 81/90-60(-10)/240. 2/9 Calculate 24/(-12) + (-5 - -2) + 14. 9 What is the value of ((-51)/(-374))/((-40)/60(-3)/4)? 3/11 Evaluate (17/((-680)/16))/(0 - (-45)/25). -2/9 -7 - (-12 - -2 - 150/(-125)) 9/5 1 - (2324/231 + -9) -2/33 Calculate (98/70)/(4/(-20)). -7 Evaluate 646/(-76) + (5/(-2) - -2). -9 What is the value of (6 - 5)(4 - (38/6 - 2))? -1/3 (2 - -1) + 6 - (11 + 23) -25 Calculate (1/10 - 2/(-5))(-6166)/30830. -1/10 Evaluate (-1 - 30/14) + 6 - (10 + -8). 6/7 214 - (49/10 - (-496)/4960) 23 Evaluate ((-3)/(-21))/(6/21). 1/2 26/110551(-5 - 0) -6 What is 1152/1008 + (-45)/21? -1 Evaluate (-12 - 804/(-68))/((-18)/(3 + 3)). 1/17 What is the value of (-2)/(27/(297/22))? -1 Calculate -91(154/(-308))/((-14)/12). -39 10/(((-24)/45)/((-2)/(-5))) + 7 -1/2 Evaluate ((12/6)/70)/((32/20)/(-4)). -1/14 Calculate -10 + 22 + 1638/(-140). 3/10 What is 168/(-147) - (-13)/(455/50)? 2/7 (-1864)/(-233) + (608/(-44))/2 12/11 What is (-844)/(-211) - 2/(-2 + 0)? 5 What is (-1 - 96/(-2 - -8))(-4)/(-4)? -17 Calculate (-4)/68 + (-31800)/1275. -25 What is the value of (-15)/(-35)22/(-6)-7? 11 What is the value of (16 - 18 - -7) + -1? 4 Evaluate (6/5)/(3346/3585). 9/7 Evaluate 54/450 - 12232/1100. -11 What is the value of (-9)/(-4)(-164)/(-2214)? 1/6 Evaluate 5/(-110) + (-1449)/34914. -2/23 8/3243/270 12/5 Calculate (-175)/10 - 450/(-30). -5/2 What is (1088/1408 + 3/(-11))/(2/(-44))? -11 What is the value of (6/468)/(43/559) - (-23)/(-210)? 2/35 What is the value of (60 + -67)((-17)/(-7) + -1)? -10 Calculate (1007/76 + -13)/((-9)/16). -4/9 Evaluate ((-44485)/(-93))/(-41) + (1 - -35)/4. -8/3 36/(-65) - 108/(-270) -2/13 What is -5 - (-8 + 5)1? -2 What is 55(-37)/(-20350)(-6)/9? -1/15 What is 32/1456 - 19680/1092? -18 Evaluate (-3)/121(-108)/81. 1/3 Evaluate 15 + 0 - 18 - (-70)/22. 2/11 Evaluate (6/(-8) + 60/(-80))(-16)/(-20). -6/5 2387/93 - 30 - 2/3 - 10 -15 What is the value of ((-5)/(-8)451/205)/((-5)/(-40))? 11 (24/(-9))/(31 - 2065/70) -16/9 Calculate (-6)/(-4)(-2)/(-6) + (-22482)/24980. -2/5 What is the value of 31 - (-15 + 20 + -14)? 12 Evaluate -11/(-5) + 119/(-119). -4/5 What is the value of (-22896)/(-6360) + 16/(-10)? 2 Evaluate (-901)/374 - (-15)/6. 1/11 What is (-16 + 8 - -2) + 6 + 13? 13 Calculate (184/(-40) + 4)/((-1)/10). 6 What is the value of ((-3825)/675)/(2/6)? -17 9 - (40/(-100) + -1121/(-15)) 4/3 What is the value of (-3)/((-108)/(-21)) + 83/(-498)? -3/4 Calculate (72/33 - 2) + 8(-642)/176. -29 ((-3)/(0 + -6))/(4 - (-1830)/(-460)) 23 Evaluate 36/(-12) - 4(-250)/(-40)-1. 22 What is (-75)/20((-21)/(-15) + 4 + -5)? -3/2 Evaluate (26/8)/(((-6)/(-21))/((-320)/(-280))). 13 What is the value of (-7)/14(-4 - -26 - (4 + -6))? -12 Evaluate 2 + -1 + (-7 + 4)(-4)/(-12). 0 What is the value of 286/52(-2)/1-1? 11 Evaluate -10 - (-23 + 476/84). 22/3 Calculate (28/(-168))/((-32)/(-7872)). -41 Evaluate (1 + 6/4)/(135/130). 5 Calculate (56/(-30))/(2/(24/(-102))). 2/17 What is -25 + 3427/138 + 1354/420 + -3? 2/35 What is (-296)/1591((-22)/8)/(-11)? -2/43 Evaluate ((-56)/(-77))/((-112)/(-616)). 4 -1 - ((-1269)/432 - (-1)/(-16)) 2 28/313684 + 2627/(-1608) -2/67 What is the value of (-504)/(-588)(-35)/(-30)? 1 Evaluate (-4)/((8/(-48))/((-3)/(-6))). 12 Calculate 1 + (7 - 5)(-78)/12. -12 Calculate (3393/260 + -13)-1. -1/20 What is (175/70)/(51/(-68))? -10/3 10 - (3 + -7)(-25)/100 9 Evaluate 1376/7826 - 12/26. -2/7 Calculate 148/185 + (4/(-2) - (-36)/20). 3/5 Calculate (4/(-12))/((-422)/(-60) - 7). -10 What is 28/56(-2 + (-6)/(-9))? -2/3 50860/10172 - (-57)/2(-8)/6 -33 -77(-7)/((-280)/(-16)) - 8/10 30 What is the value of 3/(-45)5(-30)/40? 1/4 (-6 - -1) + (-30)/75(-665)/54 -2/27 What is 2/(-42)((-220)/60 + 7 + -1)? -1/9 Evaluate 12/14 + 36/105 + 285/(-300). 1/4 What is ((-151)/(-604))/((-3)/(-172)) + -7? 22/3 What is (5530/(-474))/((-25)/45)? 21 8 - ((4 - 2 - -8) + (-30 - -23)) 5 Evaluate (0 + -3)/((-156)/(-8)). -2/13 What is the value of (15/(-63))/(-3 + (-81)/(-42))? 2/9 -9 + 24956/442 - 47 6/13 What is (-2 - (-39)/21)/(9/(-21))? 1/3 What is ((-1)/15)/(336/44520) - (-6)/4? -22/3 (-91)/(-39) + 2/(-1) - 27/108 1/12 What is ((-601)/8 + (-182)/(-1456))2/(-6)? 25 Evaluate 8/(-28) - ((-808)/1260 - 14/(-63)). 2/15 What is ((-375)/45 - -5)/(4/6)? -5 Calculate (-8)/(-6)576/(-256)(-2)/3. 2 Evaluate -5 + (1 - 406/105)/(3/(-5)). -2/9 What is (11 + -7)(451/(-44) + 7)? -13 Evaluate (-512)/128 + 25. 6 4624/256 - 5 - (3 + 10) 1/16 Evaluate (0(-5)/(-15)1)/(11 - 13). 0 Evaluate (((-27)/36)/((-3)/2))/((-152)/2432). -8 Evaluate -2 - ((19 - -2) + -1)/(-7). 6/7 What is the value of 39/(-104) - (-1107)/1442? 15 What is (-4)/114 + 329040/20520? 16 What is (-26)/455 - (-1)/5 - 16/308? 1/11 (744/(-84) - -9) + -1 -6/7 Calculate ((-378)/135 + 3)/(1/195). 39 Calculate (4 - 24)4/16. -5 Evaluate (-12)/(-63)(-225)/(-1000)(-15)/(-9). 1/14 Calculate -13 + 0 - (-17 - -179)/(-18). -4 (40 + -21)(2/6 - (-2)/3) 19 Calculate (-24)/(-16632)9(0 + 3 - 5). -2/77 What is 18/144 + -12 + 3213/280? -2/5 What is the value of (11/7)/((-32)/89612)? -1/3 What is the value of (-250)/(-32) + -32(-10)/(-40)? -3/16 Calculate 292 + -293 - ((-8)/3)/4. -1/3 Calculate (-40)/12((-8646)/(-1980) + 4/30). -15 What is the value of (-15)/(-55) + ((-160)/(-48))/(-10)? -2/33 What is the value of (-87)/(2349/216) + -1 + 30 + 2? 23 (1737/63 - 29)/(((-4)/(-6))/1) -15/7 Evaluate 14/12(509 + -503). 7 Evaluate ((-2)/15 - 9196/330)(-1)/(-2). -14 (-943)/123((-8)/(-16))/(2/12) -23 (-3)/((-15)/40) + (-319)/(-121) + -9 18/11 What is the value of ((-9)/12)/((-78)/1976)(-2 - -3)? 19 (44 - (-1079)/(-26))/(8(-10)/(-12)) 3/8 What is the value of (6 - (-780)/(-126))/((-2)/(-7))? -2/3 0 - 5 - (23 - 575/(-46)-2) -3 (-6392)/(-14280) - 1/21 2/5 What is 37/(-13) - (-1 - 2)? 2/13 Calculate 52 + (126 - 124). 12 What is (50/(-30))/((-2)/(-6)) + (-222)/(-45)? -1/15 Evaluate (8 + (114/(-532))/((-6)/(-220)))-10. -10/7 Calculate (((-6)/(-11))/1)/((-116)/(-232)). 12/11 4((-2821)/4732 - 2/13) -3 Calculate ((-7)/2)/(35/(-70)). 7 Evaluate (170/75)/((-130)/105 - (-20)/35). -17/5 What is the value of (-15 + 8 - (-14 + 4))/(-1)? -3 What is (-41)/10 + (-5)/(-50) - -25? 21 22/1129/(1305/(-10)) -4/9 Evaluate (-12 - -5) + 96/12. 1 What is (8 + -180 + -6)/((-88)/(-6)) + 12? -3/22 Evaluate -2(-12)/(-50)525/(-15). 4 What is the value of 1-7 + 1 - (10374/210 + -55)? -2/5 What is the value of (16 - 1248/80) + 48/55? 14/11 Evaluate ((-100)/15 - -7)/(-2). -1/6 Calculate (-4)/4(20 + -21)0. 0 What is the value of ((-18)/(-28) + 126/147)/(3/4)? 2 (-18)/(-4)(55/(-132))/(15/24) -3 What is the value of (-237)/(-18) + -5 + -8? 1/6 What is the value of 18 + (8/3)/(74/(-111)) - 6? 8 What is the value of (-12)/((-4)/18) + (131 - 139)? 1 Evaluate 1 + -8 - (2 - (-64 - -42)). -31 Calculate 690/50 - ((-47)/94 + 3/10). 14 What is (-84)/18 + -2 - 97/(-582)? -13/2 Calculate 9 + ((-3068)/221 - -5). 2/17 What is the value of (-6304)/(-576) - 33/3? -1/18 Evaluate (22/(-11))/((-3)/12) + 280/(-7). -32 What is (-26 + 19 + 8)/((-2)/(-52)*-1)? -26 What is the value of 15/30 + 55/30? 7/3 Calculate -15 + -18 - -34 - (-4 + 2 - 18). 21 Evaluate 19 + 47	{ "pile_set_name": "DM Mathematics" }
/14 What is the second smallest value in 36, 15, -5/4? 15 Which is the fourth smallest value? (a) -2/13 (b) -1 (c) -0.4 (d) 2 (e) 0.64 e Which is the third biggest value? (a) 2 (b) 4/3 (c) -0.47 (d) -5 c Which is the biggest value? (a) 4 (b) -19 (c) 0.4 a Which is the third smallest value? (a) 4 (b) -5 (c) -3 (d) 1/4 d What is the third smallest value in 5, 1, 4/881? 5 What is the third biggest value in 0, -4, 5, 25? 0 Which is the second biggest value? (a) -46 (b) 22 (c) -5 c What is the fourth smallest value in -0.5, -7, 6, -1? 6 What is the third smallest value in -1/2, -12, -37, -2/5? -1/2 Which is the third smallest value? (a) 5/3 (b) -1/4 (c) -1/2 (d) 0.2 (e) 3 d What is the biggest value in -0.4, -1/12, 2/77, 0.03? 0.03 Which is the smallest value? (a) 0.4 (b) -3 (c) -1.1 b Which is the fourth biggest value? (a) 0.3 (b) 47 (c) -1 (d) -5 d What is the biggest value in -45, -1/5, 1? 1 Which is the second biggest value? (a) -1 (b) -509 (c) -0.4 (d) -2 a Which is the third smallest value? (a) 4/7 (b) 2/9 (c) -3 (d) -1/9 (e) -0.3 d Which is the smallest value? (a) -2/5 (b) 6 (c) -1/4 a Which is the second smallest value? (a) 7 (b) 4 (c) 0 b What is the smallest value in 3, 6, 3/4, -2, -5/2? -5/2 What is the second biggest value in -1/17, -14, 0.4, -1, -5? -1/17 Which is the fifth smallest value? (a) -5 (b) 56/17 (c) 1/4 (d) -1 (e) 3 b What is the smallest value in -1, -6, 1/4, -1/9? -6 What is the second smallest value in -0.2, 0.4, 2/15, 2? 2/15 Which is the fourth biggest value? (a) 3/2 (b) -408/5 (c) 0.5 (d) -0.5 b Which is the second biggest value? (a) -5 (b) 0 (c) -2/73 c Which is the second smallest value? (a) -0.5 (b) -5 (c) -1/16 (d) -2.2 d What is the fourth smallest value in -0.3, 1/2, -11.9, -4? 1/2 What is the third biggest value in 0.3, 54/5, 2, -1/2? 0.3 Which is the smallest value? (a) 54 (b) 0 (c) -2/51 c What is the second biggest value in 4, -1/7, 0.3, -0.3? 0.3 Which is the third smallest value? (a) -2/7 (b) -3 (c) -2/15 (d) -0.3 a Which is the second biggest value? (a) -4/13 (b) 0.22 (c) -3/2 a What is the second smallest value in -135, -2, 0, -0.1? -2 What is the biggest value in 0.08, -0.1, -73/6? 0.08 What is the biggest value in 4, 3, -0.4, 19? 19 What is the fourth biggest value in -2, 0.3, -0.06, -441? -441 Which is the third biggest value? (a) 0.05 (b) -1 (c) 5 (d) -2 b Which is the biggest value? (a) -2/13 (b) -10 (c) -5 a What is the third smallest value in 2/7, -7, -0.8? 2/7 What is the second smallest value in -67, 0, 3? 0 Which is the second biggest value? (a) -2/691 (b) -3 (c) -0.07 c What is the third biggest value in -0.11, -13, 3/8? -13 What is the biggest value in -3, -1, -21? -1 Which is the smallest value? (a) 3 (b) -2 (c) -2/87 (d) 4 b Which is the second smallest value? (a) 0.3 (b) -455 (c) 4 a What is the fourth biggest value in 3, -3/5, 2.5, -4? -4 Which is the biggest value? (a) 1/6 (b) 10 (c) -1/10 (d) 0.4 b Which is the third biggest value? (a) 3/5 (b) -3/8 (c) -692 (d) -5 d What is the smallest value in 235, 3, -4? -4 Which is the third biggest value? (a) -2/11 (b) -0.618 (c) -2 (d) -5 c What is the smallest value in -0.19, -2, 0.04? -2 Which is the second smallest value? (a) 4 (b) -1/3 (c) -0.2 (d) -228 (e) -1/25 b What is the second smallest value in 1/4, -35, 5? 1/4 Which is the fourth smallest value? (a) -2/5 (b) 0.2 (c) -0.5 (d) 0.01 b Which is the biggest value? (a) -0.09 (b) -2/3 (c) -1/3 (d) 1 (e) -8.9 d Which is the second biggest value? (a) -28 (b) -3 (c) 1/3 (d) -14 b Which is the biggest value? (a) 3 (b) -7 (c) 0 (d) -1/10 (e) 2/5 a Which is the second smallest value? (a) 5 (b) -3/10 (c) -4 (d) 9 (e) 1 b Which is the third smallest value? (a) -1 (b) -0.5 (c) 8/9 c What is the second biggest value in -22, -1, 1/6? -1 What is the second biggest value in -1/6, -16, 4/7? -1/6 What is the third biggest value in -1, 4, -0.1? -1 Which is the biggest value? (a) -20 (b) -2 (c) 4 (d) -0.2 c What is the fourth biggest value in 2, -0.1, -1, 117/5? -1 What is the smallest value in -9, -4, 2, -2? -9 Which is the fourth biggest value? (a) 6/7 (b) 83 (c) 3/5 (d) 27 c Which is the second biggest value? (a) -31 (b) 0.8 (c) 5 b What is the smallest value in 0.7, 3/20, 1, 5? 3/20 Which is the third smallest value? (a) -3/74 (b) -0.6 (c) 3/5 c Which is the fourth smallest value? (a) -0.2 (b) 2/7 (c) -2/13 (d) -4 b Which is the third biggest value? (a) -0.5 (b) 0.5 (c) -3/8 (d) 6/11 c Which is the third biggest value? (a) -5 (b) -1/10 (c) 181 a Which is the biggest value? (a) 0 (b) 2/11 (c) -4.1 b Which is the fourth smallest value? (a) 0.3 (b) -2/11 (c) 4 (d) 2/497 c What is the smallest value in 2, -2, -1, 4? -2 What is the second biggest value in -0.4, 2, -3, 0.21406? 0.21406 Which is the fourth biggest value? (a) 3 (b) 0.2 (c) 3/7 (d) 4/11 (e) 2 d Which is the biggest value? (a) 0.7 (b) -2/7 (c) 10/9 c What is the third smallest value in -7555, 4/5, 2/7? 4/5 What is the second smallest value in 0.3, -43, 1, -0.1, 3? -0.1 Which is the third smallest value? (a) 2/3 (b) -0.03 (c) 3 c What is the fourth biggest value in -37, -4/5, -4, 0? -37 Which is the fifth biggest value? (a) 1 (b) -2/7 (c) -1/6 (d) 8 (e) -3/7 e What is the second smallest value in 3/5, 1, -4/5, 4? 3/5 Which is the second biggest value? (a) 1/2 (b) 0 (c) -2/21 (d) -12 b Which is the second biggest value? (a) 3/5 (b) 19/2 (c) 0.04 a What is the second biggest value in 4, 6, 2, 0.4? 4 What is the second smallest value in -0.3, -5, 26/5? -0.3 What is the smallest value in 4, 14.14, -2? -2 What is the fifth smallest value in 2, 1/8, -0.5, 0.5, 0.17? 2 What is the third biggest value in 14, 2, 2/91, 1/7? 1/7 What is the second biggest value in 103, 3, 0.1? 3 Which is the second biggest value? (a) -116 (b) 1 (c) -1/5 c What is the smallest value in 1, -56, -3, -0.2? -56 Which is the fourth smallest value? (a) -0.1 (b) 2/139 (c) 4 (d) 1 (e) 0.5 d What is the smallest value in -1/3, 0.4, 5, -3/4, 2/17? -3/4 Which is the fourth biggest value? (a) 1 (b) 0.2 (c) -1.6 (d) 2/7 c Which is the third smallest value? (a) -0.06 (b) -0.5 (c) 0.1 c What is the fourth biggest value in -27, 18, -0.1, -0.5? -27 Which is the smallest value? (a) 5 (b) 3 (c) 0.03 c What is the second smallest value in -0.1, -2/31, -0.3? -0.1 What is the fourth smallest value in 1, -11, 6, -1/3? 6 Which is the third smallest value? (a) -5 (b) 9 (c) 4 b Which is the fourth biggest value? (a) 20 (b) -1/2 (c) -1/6 (d) -3 d Which is the second smallest value? (a) 4 (b) 182 (c) 4/3 a Which is the third smallest value? (a) -1 (b) 1/2 (c) 6/53 b What is the second biggest value in -9, -5, 0.6? -5 Which is the second biggest value? (a) -0.9 (b) -4 (c) 2/171 a Which is the second smallest value? (a) 2 (b) 2/249 (c) -0.1 b What is the fourth smallest value in 5, -2/3, 8/7, -1/4? 5 Which is the second biggest value? (a) -4 (b) 13 (c) -0.2 c Which is the second smallest value? (a) -0.2 (b) -9 (c) -2/11 a Which is the third smallest value? (a) 2 (b) 1/5 (c) 0.5 (d) -0.01 c What is the second biggest value in -4/9, -54/7, 5? -4/9 Which is the second smallest value? (a) 0.003 (b) -3/2 (c) 1/8 a What is the fifth smallest value in 1/3, -4, 1/2, 7, -33? 7 What is the fourth biggest value in -0.3, -3, 1/7, -1755? -1755 What is the fourth smallest value in 2, -0.124, -1/7, 2/11, -1/4? 2/11 Which is the third smallest value? (a) 8 (b) -21 (c) 2/7 (d) 1/7 c Which is the biggest value? (a) -5 (b) -4/53 (c) -1 b Which is the smallest value? (a) -3/16 (b) -5 (c) 5 b Which is the smallest value? (a) 2/9 (b) 9/5 (c) 2.2 (d) -3/2 d What is the fourth smallest value in 0, 1, 4/3, 0.1? 4/3 Which is the fourth biggest value? (a) 1/7 (b) 4 (c) -4/3 (d) -0.9 c What is the second biggest value in -5, -95, -3? -5 What is the third smallest value in -2/15, -10/41, 2/7, 3? 2/7 What is the biggest value in 0.08, -2/3, -0.5, 1.5? 1.5 Which is the fourth smallest value? (a) -10/53 (b) 1/7 (c) 8 (d) 0.1 c What is the smallest value in 4, 7, 4.4? 4 Which is th	{ "pile_set_name": "DM Mathematics" }
0. Let b(d) = -d*2 - 20 + d + 20. Let j(l) = l + 1. Calculate pj(g) + b(g). -g*2 + 2g + 1 Let g(u) = -14u2 + 3u - 14. Let y be 7/((-28)/16) + 12. Suppose 2m - 2 = y. Let k(r) = 8r*2 + 7 - 2r + r*2 + 2. Give mg(h) + 8k(h). 2h*2 - h + 2 Let k be 15/20 - 1/(-4). Suppose 23 = -16w + 71. Let t(o) = -o - 1. Let q(u) = 5u + 1. What is kq(z) + wt(z)? 2z - 2 Let v(l) = l + 1. Let m be 14/(-56) + 2(-69)/24. Let x(n) = -2n*2 + 7n + 6. What is mv(w) + x(w)? -2w*2 + w Let x(q) = -16 - 62q + 16 + 105q. Let o(w) = 65w. What is 5o(h) - 8x(h)? -19h Suppose -3g + 10k = 5k + 58, 0 = -k + 5. Let o(u) = -u - 4. Let h(v) = -3v - 11. Let x(j) = go(j) + 4h(j). Let q(t) = 5t + 1. Give q(l) + 4x(l). l + 1 Let n(x) = -2x + 5. Let t(o) = 22o + 20. Let m(y) = 4y + 4. Let f(b) = -16m(b) + 3t(b). Determine -4f(g) - 3n(g). -2g + 1 Let z(r) = -3r*2 + 52r - 14. Let d be z(17). Let q(u) = 2u + 7. Let l(y) = -y - 2. Give dq(i) + 8l(i). -2i + 5 Let x(t) = 2t3 - 5t*2 + 3t. Let p = 37 + -35. Let n(d) = 6d - 2d + 2d3 - 4d*2 - 2d*p. Give -5n(g) + 6x(g). 2g*3 - 2g Let k(h) = -26h - 1. Let s(u) = 31u. Let p(j) = 6k(j) + 5s(j). Let z(w) = 3w + 12. Calculate 5p(y) + 2z(y). y - 6 Let u(g) = -7g*2 - 27g - 5. Suppose -5 = -5x + 10. Let w(h) = -4h*2 - 13h - 3. Calculate xu(i) - 5w(i). -i*2 - 16i Let w(m) = -2m - 4. Suppose 0 = -i - 4i + 40. Suppose in - 9n = -13. Let x(f) = 4f + 9. Give nw(d) + 6x(d). -2d + 2 Let d(q) = 8q2 + 4q. Let p(s) be the second derivative of 7/6s3 + 5/4s*4 + 0s*2 + 0 + 5s. Give -11d(t) + 6p(t). 2t2 - 2t Let a(y) be the third derivative of y*4/6 + 3y3/2 - y2. Let r(c) = 8 - 18 + 7 - 2c - 2. Calculate 3a(j) + 5r(j). 2j + 2 Let f(w) = -15w + 35. Let o(u) = 3u - 7. Give 2f(l) + 11o(l). 3l - 7 Let g(q) = 2. Let v(o) = o + 10. Give -g(h) - v(h). -h - 12 Let u(a) = a2 - 1. Let y(w) be the first derivative of 40 + 12w + 19w3 - 10w*3 - 11w*3. Give -12u(d) - y(d). -6d2 Let q(a) = 2a*2 + a + 4. Let u(l) = 4l*2 + 2l + 7. Let n be (-2 - 0)/(1 - 16/12). What is nu(o) - 11q(o)? 2o2 + o - 2 Let g(j) = -62j3 - j2 + 58j3 + 2j*2. Let z(s) = 5s3 - s2. Give 7g(k) + 6z(k). 2k3 + k2 Let p(x) = x + 1 - 3x + 3x - x2 - 3x. Let f(m) = -2m2 - 3m + 2. Suppose 3r = -r + 28. Determine rp(n) - 4f(n). n2 - 2n - 1 Let d(v) = -2v2 - 8v - 6. Let h(a) = 3a2 + 9a + 6. What is -2d(y) - 3h(y)? -5y2 - 11y - 6 Let l(d) = -20d3 - 7d*2 + 10d. Let c(u) = -10u3 - 3u*2 + 6u. Determine 10c(i) - 6l(i). 20i3 + 12i*2 Let j(d) = -3d - 9. Let s = 3 - -6. Let t = -96 - -94. Let q(a) = -a - 2. Calculate sq(p) + tj(p). -3p Let c(u) = -3417u*2 - 3420u*2 - u - 1 + 6838u*2 + 2. Let t(f) = 3f - 2 - 2 - 6f2 + 2f. Give -5c(a) - t(a). a2 - 1 Let w(p) = 153p*3 - 39p*2 - 39. Let i(r) = -3 - 117r*3 + 75r*2 + 1 - 77r*2 + 125r*3. Calculate -117i(f) + 6w(f). -18f3 Let x(p) = -p2 + 5p + 32. Let c be x(9). Let m(b) = 3b*3 - 4b*2 - 10b. Let w(d) = 4d3 - 5d*2 - 11d. Determine cw(u) + 5m(u). -u*3 - 6u Let r(s) = 19s - 3. Let z(m) = -60m + 10. Let v(i) = -16r(i) - 5z(i). Let c(q) = 4q + 2. Calculate 5c(h) + 4v(h). 4h + 2 Let w(m) = 122m3 + 3m*2 - 3. Let n(o) = -1463o*3 - 35o*2 + 35. Calculate -3n(d) - 35w(d). 119d*3 Let r(w) = -8w*3 - 3w*2 + 2. Let z = 1408 - 1406. Let a(v) = -7v*3 - 2v*2 + 2. Calculate zr(i) - 3a(i). 5i3 - 2 Let s(h) = h2 + h + 1. Let m(p) = -60p - 356. Let l be m(-6). Let o(f) = 7f*2 + 5f + 5. Determine ls(n) - o(n). -3n*2 - n - 1 Let v(d) be the first derivative of -30d*2 - 50d - 289. Let j(p) = p + 1. Determine 50j(i) + v(i). -10i Let f(k) = -14k2 + 2k - 200. Let u(l) = 12l2 - 2l + 201. Give -5f(q) - 6u(q). -2q2 + 2q - 206 Let w(r) = 91r + 721. Let j(o) = 16o + 120. Calculate 34j(v) - 6w(v). -2v - 246 Let z(o) = -49o - 1. Let g(x) = -196x - 4. Calculate -6g(r) + 22z(r). 98r + 2 Let g(x) = -12x - 2. Let j(u) = u. What is -g(k) + 4j(k)? 16k + 2 Let r(l) = l + 2. Let k be ((-16)/20)/(14/35). Let w(q) be the third derivative of -3q*2 - 1/2q*3 - 1/24q*4 + 0q + 0. Determine kw(f) - 3r(f). -f Let d(w) = -6w2 - w + 2. Let l(x) = -151x - x*2 - 157x + 308x. Determine d(y) - 3l(y). -3y2 - y + 2 Let g(t) = 17t*3 - 2t*2 + 13t + 13. Let y = 0 + 2. Let l(s) = 44s2 + y + 6s + 6s3 + 2s*3 - 45s*2 + 4. Calculate -6g(r) + 13l(r). 2r3 - r2 Let z(p) = 4p2 - 2p + 2. Let i(c) = 13c2 - 7c + 7. Suppose -7 - 8 = o. Let b(q) = q*3 + 17q*2 + 30q - 2. Let u be b(o). Give ui(j) + 7z(j). 2j2 Let p(r) = -11r*2 - 2r + 4. Let y(t) = -5t2 - t + 2. Determine 4p(o) - 9y(o). o2 + o - 2 Let g(m) = -m + 1. Let z(h) = -h3 - 7h + 6. Suppose -25a + 132 - 7 = 0. What is ag(j) - z(j)? j*3 + 2j - 1 Suppose -4p + 5w - 10 = 0, 18 = -2p - 0w - 4w. Suppose 18 = -21r + 18r. Let m(f) = 7f + 2. Let b(k) = -6k - 2. Determine pm(n) + rb(n). n + 2 Let a(k) = -k3 - k2 - k. Let h = -20 + 20. Suppose -4l = -q - 17, -q + hl + 2l - 9 = 0. Let p(z) = z*2 + 2z. Calculate qp(j) - 2a(j). 2j3 + j2 Let s(c) = 3418c - 7c3 + 5 - 3418c. Let y(v) = 1 + 0v3 + 3v*3 - 3. Let q be 7 - (3 - (-2)/(-2)). Give qy(r) + 2s(r). r3 Let m(k) = 2k*3 - 4k*2 + 2k - 4. Let s(z) be the first derivative of -z4/4 + z3 - z*2 + 3z - 124. What is -3m(d) - 4s(d)? -2d3 + 2d Suppose 0 = 5i - 0i + 20. Let k(h) be the second derivative of -h*2/2 + 33h - 2. Let z(b) = -3b + 6. Determine ik(f) - z(f). 3f - 2 Let f = 220 + -218. Let h(p) = -p + 5. Let d(c) = c - 1. Give fd(q) + h(q). q + 3 Let n(o) = -8o2 + 2o + 2. Let b(u) = 80u2 - 18u - 21. Let y(a) = -53a2 + 12a + 14. Let r(c) = -5b(c) - 8y(c). Calculate 7n(j) + 2r(j). -8j2 + 2j Let h(a) = a*3 - 6a2 + 4. Let k(l) be the third derivative of -l6/120 + l5/12 - l3/2 - 606l2. Calculate -5h(q) - 6k(q). q3 - 2 Let m(z) = 2z*2 + z. Let l(s) = 5s*2 + 3s + 1. Suppose -u - 4 = 2v, -17u = 2v - 13u + 4. Calculate vl(h) + 7m(h). 4h2 + h - 2 Let d(p) = -7p*2 + 4p. Let g(f) = 5f2 - 3f. Let j(o) = 3d(o) + 4g(o). Let a(i) = -5i2 + 5i + 1. Calculate -a(m) + 3j(m). 2m*2 - 5m - 1 Let u(y) be the third derivative of 0y - 9y*2 + 1/24y*4 + 1/2y*3 + 0. Let n(p) = p + 3. Calculate -3n(w) + 2u(w). -w - 3 Let o(u) = 29u*2 + 25u - 24. Let z(k) = 7k2 + 6k - 6. Let c(j) = 2o(j) - 9z(j). Let b(m) = -m*2 - m - 1. Calculate 4b(a) - c(a). a*2 - 10 Let s(c) = -13c + 199. Let t(v) = -7v + 100. Give -6s(u) + 11t(u). u - 94 Let o(r) = -2124 + 2124 + r. Let v(u) = 2u*3 + 12u. What is -6o(d) + v(d)? 2d*3 + 6d Let r(l) = l. Suppose 16k = 21k. Suppose -f + 2f - 3 = k. Let h(u) = 2 - 3u + 1 - f + 2. What is h(g) + 2r(g)? -g + 2 Let n(q) = -q - 4. Let g(j) = 3j - 13. Let b be g(8). Let m(p) = bp + 14p + 33 - 16p. Let i = -59 + 26. Calculate in(w) - 4m(w). -3w Let z(k) = 15k - 42. Let g(u) = -8u + 21. What is -5g(j) - 3z(j)? -5j + 21 Let o(a) be the first derivative of -3/2a*2 + 2/3a*3 - 2a + 1. Let j(l) = l3 + l2 - 1. Calculate 2j(q) - o(q). 2q*3 + 3q Let l(f) = 3f2 - 60f + 5. Let w(z) = 2z2 - 61z + 4. Give 3l(y) - 4w(y). y*2 + 64y - 1 Let v(j) = 4j + 4. Let h be (-2 - (0 + -2)) + 4 + 1. Let a(x) = 7x + 7. Let p(r) = hv(r) - 3a(r). Let d(n) = -n - 1. What is 6d(g) - 4p(g)? -2g - 2 Let n(r) = 2r*2 + 2r + 9. Let j(v) = -v*2 - v - 5. Let l = 514 - 511. What is ln(h) + 5j(h)? h2 + h + 2 Let j(o) = 120o + 356. Let n be j(-3). Let k(x) = 3x + 2. Let g(v) = -14v - 11. Determine ng(i) - 22k(i). -10i Let b(i) = -5i*3 + 3i*2 - 3i. Let z(s) be the second derivative of s5/20 - s4/12 + s3/6 - s2/2 + 75s. Give -b(w) - 3z(w). 2w3 + 3 Let t(r) = 4r*2 + 4r - 7. Let q be (-1 + (-2)/(-3))-21 + -6. Let b(l) = -l2 - l + 1. What is qt(k) + 6b(k)? -2k*2 - 2k - 1 Let i(y) = -y2 + 1. Let b(q) = q2 + 5q - 4. Suppose n - 1 = -z, -3z + 68 = -n + 69. Give nb(j) + 3i(j). -2j2 + 5j - 1 Let a(v) = -1. Let b(t) = -6t - 2. Calculate 12a(f) - b(f)	{ "pile_set_name": "DM Mathematics" }
a be 123(-5)/(-5). Let t be (-3)/9 - (-2)/a. Factor 4/5u - 2/5u2 + t. -2u(u - 2)/5 Suppose -96o + 144 - 3/2o3 + 21o*2 = 0. Calculate o. 4, 6 Let k(b) = 3b*4 + 43b*3 + 2b*2 - 48b. Let c(y) = -2y4 - 22y3 - y2 + 25y. Let u(r) = -10c(r) - 6k(r). Factor u(p). 2p(p - 19)(p - 1)(p + 1) Let g be 10/8 + 15/(-12). Suppose 7l - 28 = -gl. Suppose 1/2v*l + 0 - 3/4v*3 - 1/8v - 1/8v5 + 1/2v*2 = 0. Calculate v. 0, 1 What is i in -12i*3 - 164i*2 - 2 + 2 - 6i + 137i2 = 0? -2, -1/4, 0 Let s = 30/5747 + 17181/11494. Find o, given that 0 + 0o + 3/8o3 + so*4 + 9/8o*5 + 0o2 = 0. -1, -1/3, 0 Let a(y) = -y3 + 5y2 - 7y + 14. Let l be a(4). Suppose 0 = j - 5j. Let jn - ln4 + 4n2 - n5 + n - 2n2 = 0. What is n? -1, 0, 1 Let q = -255292/2385 - 76/477. Let g = 108 + q. Let 0 - go*3 + 0o + 2/5o2 + 2/5o*4 = 0. What is o? 0, 1 Factor 1/2n*2 + 1/8n*3 + 1/8n - 3/4. (n - 1)(n + 2)(n + 3)/8 Let k(g) be the second derivative of 3/8g3 + 3/80g*5 + 0 + 37g + 1/4g4 + 0g*2. Solve k(a) = 0. -3, -1, 0 Let g be -1(0/2)/(7 + -8). Suppose 4d + 0y - 21 = -3y, 3 = 4d - 3y. Let 3j*4 - 2j*4 - 8j*d + 3j*4 + 4j*2 + gj*2 = 0. What is j? 0, 1 Let v(f) = 2f*4 - 48f*3 - 78f*2 + 116f - 8. Let p(k) = 5k4 - 97k*3 - 157k*2 + 231k - 18. Let y(n) = -4p(n) + 9v(n). Let y(h) = 0. What is h? -20, -3, 0, 1 Let a(b) = 21b3 + 270b*2 + 627b + 378. Let x(i) = 6i3 + 77i*2 + 179i + 108. Let r(f) = -5a(f) + 18x(f). Let r(o) = 0. What is o? -9, -2, -1 Suppose 11n = -0n + 77. Determine k so that n + 20k + 5 + 0 + 2k*2 - 6k = 0. -6, -1 Let k be ((-4)/3)/((-2)/3). Let f(z) = -10z + 33. Let n be f(3). Suppose v2 + 6v*3 - nv*k - 20v*3 - 2v*2 = 0. Calculate v. -2/7, 0 Factor 0 + 42s*2 - 85/2s + 1/2s3. s(s - 1)(s + 85)/2 Let v = 111395/382228 + -71/6132. Let d = -5/51 + v. Let 0f + 0 + df2 = 0. Calculate f. 0 Factor 0 + 24/5m*3 + 0m - 4/5m4 - 32/5m*2. -4m*2(m - 4)(m - 2)/5 Let m(b) = -b4 - b3 - 1. Let k be (-1 + -2 + -3)/1. Let a(q) = -q5 - 10q*4 - 7q*3 + 14q*2 + 20q + 2. Let i(t) = km(t) + a(t). Factor i(d). -(d - 2)(d + 1)*2(d + 2)*2 Let w = -2 - -2. Let r = 5 + w. What is a in 0 + 3/4a*2 + 1/4a - 3/4a4 - 1/2a*r + 1/4a*3 = 0? -1, -1/2, 0, 1 Let k(i) be the third derivative of 1/2i*4 - 4/3i*3 + 0i + 0 - 1/10i5 - i2 + 1/120i*6. Solve k(n) = 0. 2 Let b be (0/12 - -1)/((-1)/(-3)). Find c, given that -8/5c + 0c2 + 0 + 2/5c*b = 0. -2, 0, 2 Let c(p) = -2p*2 + 1 - 36p - 16 + 8p2. Let o(i) = -i2 + 5i + 2. Let m(x) = 2c(x) + 15o(x). Suppose m(u) = 0. Calculate u. 0, 1 Let j be (-6 - 429/(-65))2. Suppose -jn*2 - 4/5n - 2/5n3 + 0 = 0. Calculate n. -2, -1, 0 Let b be ((-6)/(-4))/((-77)/(8470/(-132))). Let -2w*2 - w + bw*3 + 0 = 0. Calculate w. -2/5, 0, 2 Let p = 11 - 23. Let l be 13/4 - 231/p. Solve 5/2s - 1/4 + 8s*5 + ls*3 - 10s*2 - 20s*4 = 0 for s. 1/2 Let l = -246 + 252. Let i(d) be the second derivative of 0d*3 + 2d + 0d4 + 0d*2 + 2/5d*l + 2/5d*5 + 2/21d*7 + 0. Factor i(z). 4z*3(z + 1)(z + 2) Let y(r) = -9r + 26. Let x be y(14). Let t = x + 502/5. Find a such that 0 - 6/5a + ta2 = 0. 0, 3 Let c(u) = u2 + 6u + 10. Let a be c(-3). Solve -h2 - 1 - 3h*2 + h + a = 0. 0, 1/4 Let a(t) = 2t*2 + 16t + 5. Let j be a(-8). Factor 13z3 - 2z*4 - 18z*3 + 0z*4 + 7z*4 + jz - 5z2. 5z(z - 1)2(z + 1) Let b(o) = o + 7. Let g be b(-6). Suppose g = -3w + 7. Suppose 1 - ws*2 + 0s2 + s4 + 0s2 = 0. What is s? -1, 1 Let q(w) be the second derivative of 5w*7/42 - 2w*6/3 + 3w*5/4 - 8w + 5. Factor q(s). 5s3(s - 3)(s - 1) Factor 3/2r*4 + 500/3 - 1/6r*5 + 7/6r*3 + 25r - 205/6r2. -(r - 5)3(r + 2)(r + 4)/6 Let n(p) be the second derivative of 2p*7/147 - 16p*6/105 + 24p*5/35 - 32p*4/21 + 32p*3/21 + 5p + 7. Determine t, given that n(t) = 0. 0, 2 Let c(u) be the second derivative of u5/270 + u4/36 + u2 - u. Let d(o) be the first derivative of c(o). What is t in d(t) = 0? -3, 0 Let y(d) be the first derivative of -d8/84 - 2d7/35 + 4d*5/15 - 2d*2 + 7. Let z(a) be the second derivative of y(a). Factor z(w). -4w*2(w - 1)(w + 2)2 Let o(u) be the second derivative of 2u*6/105 - 23u*5/35 + 80u*4/21 - 152u*3/21 + 7u - 2. Factor o(x). 4x(x - 19)(x - 2)2/7 Let g be 1/23846/21 + -2. Let o = g - 89. Determine h, given that -4/7h + 0 + oh*2 = 0. 0, 1 Let r be (106/132 - (-56 - -55)) + (-2)/12. What is d in 0 + rd - 6/11d2 = 0? 0, 3 Let y be 13 + 0 + (-3)/3. Let j = -1344 + 1362. Determine q, given that -7 + 3q*3 + 25q*2 - yq + 1 - j - 19q2 = 0. -2, 2 Let m(l) = 2l - 9. Let t be m(6). Suppose 60 = 6k + 24k. Factor n*2 - tn2 - n3 - 3n + kn. -n(n + 1)2 Let f(b) = -b2 + 5b + 18. Let t be f(7). Let m be (t(-3)/6)/(4 - 8). Suppose 0 - 1/2w*2 - mw = 0. Calculate w. -1, 0 Let n(z) be the third derivative of 2/3z4 + 0 - 19z*2 - 1/30z*6 + 0z*3 + 0z + 0z5. Factor n(r). -4r(r - 2)(r + 2) Let j(o) be the second derivative of 5o4/24 + 65o*3/2 + 532o. Factor j(d). 5d(d + 78)/2 Let l(y) be the first derivative of -y*4/3 + 8y*3/3 - 6y*2 - 10y - 7. Let v(g) be the first derivative of l(g). Solve v(q) = 0 for q. 1, 3 Suppose 5b = -25, -22 + 32 = -4j - 2b. Let g(l) be the third derivative of -2/15l*3 + jl + 0 - 1/20l4 - 5l*2 - 1/150l*5. Factor g(u). -2(u + 1)(u + 2)/5 Suppose 28104 + 4f*2 - 64f - 28104 = 0. What is f? 0, 16 Suppose -4c + 2y = -0y - 0y, 0 = 4y. Let o(a) be the second derivative of ca*3 + 1/3a*4 - a + 0a*2 + 0. Solve o(s) = 0 for s. 0 Suppose -2u*2 - 705 + 69 - 160u - 644 - 3u2 = 0. What is u? -16 Factor c2 + 15c + 539c3 - 175c*3 - 179c*3 - 175c*3 - 26c*2. 5c(c - 1)(2c - 3) Solve 352/7o*2 + 4/7o + 0 - 356/7o3 = 0 for o. -1/89, 0, 1 Factor 62n*2 - 280 - 190n2 + n3 + 54n2 + 284n. (n - 70)(n - 2)2 Suppose 4s - 29 = -9. Factor sd2 + 2d - 2d2 - 5d*2 + 4d*2 - 12. 2(d - 2)(d + 3) Suppose -5p - 28 = -7p. Let 12j - 4j3 + p - 4 - 6j*2 + 2j*4 - 2 - 4j = 0. What is j? -1, 2 Let f = -2902/3 + 968. Factor -8/9 - fb2 - 16/9b. -2(b + 2)(3b + 2)/9 Let n be -4 + 110/10 + (416/(-20))/8. Factor 8/5 + 24/5d + 6/5d3 + nd*2. 2(d + 1)(d + 2)(3d + 2)/5 Let b(w) be the third derivative of w7/490 - w6/40 - 9w5/140 + w4/8 + 4w3/7 - 327w2. Determine d, given that b(d) = 0. -1, 1, 8 Let i(p) = -p2 + p + 9. Let v be i(0). Suppose 0 = 6n - 55 + 55. Solve -3 + nl*2 + 9l + 19l2 - 4l*2 - 12l*4 - vl*3 = 0. -1, 1/4, 1 Let g be (-1)/4 - (-15)/12. Let a be ((-4)/(-1))/(g - -1). Find l, given that -10 + 12l*3 + 58 + 11l*5 + 12l*3 - 48l - 2l5 + 39l*4 - 72l*a = 0. -2, 2/3, 1 Suppose -29 = -4q - 25, 4s - 5 = 3q. Factor -1/3v5 + v + v4 - 2/3v*3 - 1/3 - 2/3vs. -(v - 1)4(v + 1)/3 Let b(z) be the third derivative of z7/42 + 17z*6/12 - 3z*5 - 85z*4/12 + 175z*3/6 + 218z*2. Determine o, given that b(o) = 0. -35, -1, 1 Let d(q) = -4q*2 + 3q - 2. Let c be d(2). Let w be ((-15)/10)/(-3 + (-27)/c). Find s, given that 0s + 2s*3 + 2/3s*2 + 0 + 2/3s*5 + ws*4 = 0. -1, 0 Let g be 440/(-1920) - 1/(-4). Let c(z) be the second derivative of -1/2z*2 + 0 + 1/6z*3 + 15z - gz4. Factor c(h). -(h - 2)2/4 Let t(j) = -2j*3 + 26j*2 + 25j + 44. Let h be t(14). Let n(x) be the first derivative of -6 + x*3 - 5/2x*h - 2x. Determine m, given that n(m) = 0. -1/3, 2 Let q(m) = -900m2 - 846m - 199. Let t(o) = -2700o2 - 2536o - 596. Let z(i) = -8q(i) + 3t(i). Suppose z(j) = 0. Calculate j. -7/15 Let t(d) = d*2 - 4d + 3. Let p be t(4). Let q be 4/(44/(-25)) + p. Find y such that -26/11y2 + 24/11y - q + 12/11y3 - 2/11y*4 = 0. 1, 2 Let j = -771 + 773. Let s(n) be the second derivative of -2n*j + 3n + 0 + 1/4n4 + 0n*3 + 1/20n*5. Factor s(m). (m - 1)(m + 2)*2 Solve 52015l + 53045 + 289l3 - 133l*3 - 1025l*2 - 151l*3 = 0. -1, 103 Let i(w) be the second derivative of -7/30w*3 - 33w + 0 + 3/5w2 + 1/60w*4. Factor i(b). (b - 6)(b -	{ "pile_set_name": "DM Mathematics" }
2 - 2u + 1. Let r = 1 - 0. Let d be f(r). Solve -j + pj = d for j. -3 Suppose 2k + 31 = 3k. Suppose 4f - 2u + 84 = 0, 2f - 3u = 2u - 42. Let x = k + f. Solve -5g = -xg for g. 0 Suppose 7v - 15 = 4v. Let g(k) = -k3 - 4k*2 + 15k + 52. Let t be g(-5). Solve -t = vn - 22 for n. 4 Let a = 100 + -92. Solve -az + 3z = 15 for z. -3 Let k(d) = -d2 - 7d + 8. Let o be k(-8). Solve o = -4y - 2 - 2 for y. -1 Let p be ((-2)/3)/((-2)/6). Let i be (-5 + 3)/(p/12). Let h be (i/3)/(2-1). Solve -9 = -5u + hu for u. 3 Suppose 0s - s = -c - 7, 4s = -5c - 26. Let y be (c/4)/((-2)/4). Suppose -4i = -4k + 16, -k = -5k - 5i - 20. Solve k = -0r + yr + 3 for r. -1 Let p be (5 - -1)/(1 - -1). Suppose -4y = -pl, l - 3y + 1 = -4. Solve 3 = lb + 7 for b. -1 Let m = -3 - -7. Let g(q) = -2q - 5. Let y be g(-4). Let j = -2 + y. Solve mb - 5 + j = 0 for b. 1 Let p(u) = -3u*2 + 2u + 3. Let d be p(3). Let y be 4/d + 80/36. Solve -12 = 2j + yj for j. -3 Suppose -3f + 4 = -8. Solve -13 = fb - 33 for b. 5 Suppose -9r + 10 = -7r. Solve 4p = -r - 11 for p. -4 Let q be 10/822. Let w(n) = n3 - 6n*2 - 6n - 2. Let o be w(7). Solve 5f + q = -o for f. -2 Let h(z) = -z - 7. Let t be h(-8). Suppose -p + 3 + t = 0. Solve 9g = pg + 5 for g. 1 Let w(q) = -q2 + 7q + 5. Let j be w(7). Suppose 33 = -5i + 3u, 2i - ju + 23 = 6. Let y be 2/3 - 56/i. Solve 22 - y = -3g for g. -4 Let j = -10 + 15. Suppose 51 = jh - 49. Solve -4m - m = h for m. -4 Let s = 27 - 25. Solve s = 2b - 0b for b. 1 Let j(m) = m2 - m. Let u(r) = -r2 - 8r - 8. Let z be u(-7). Let k be j(z). Suppose 2t - c = c - 4, 3c - 30 = -5t. Solve 3i - t = ki for i. 3 Suppose -4r - 1 = -9. Solve -r = -y + 2 for y. 4 Suppose 2b = -6b. Solve 5m + bm = 15 for m. 3 Let m(q) = -q*3 - 13q*2 - 14q - 22. Let c be m(-12). Solve -ci - 25 = 3i for i. -5 Suppose -o - 7 = 4d, -d = -o - 3o - 11. Let v be ((-6)/(-4))/(o/(-12)). Solve -4j - v = -2j for j. -3 Let g(p) be the third derivative of p6/120 - p5/30 - p4/6 - p3/6 - 3p2. Let d be g(3). Let k = d + 8. Solve -2 = -3t + k for t. 2 Let c be -142/82. Let f be (-96)/(-42) - (-2)/c. Solve 5s = -f - 8 for s. -2 Let v be (-2)/(-6) + (-1)/3. Suppose -d + v = -4. Suppose dx = 3z + 3, 0 = -z - 3x - 0 + 12. Solve zr = -r + 4 for r. 1 Let s = 0 + 3. Suppose -2h - 7 = 21. Let m be (-38)/h + 4/14. Solve -mv - 6 = s for v. -3 Suppose -5u - 10 + 0 = 0. Let y(d) = -d*3 - 2d*2 - d + 2. Let t be y(u). Solve -1 - 3 = -ta for a. 1 Let w(g) = -g*3 - 14g*2 + 17g + 34. Let s be w(-15). Solve s = 4i - 0 for i. 1 Let d(s) = -s2 + 5s - 2. Let i be d(4). Solve -6 = p - i for p. -4 Let d be 1/(-4)6(-10)/15. Solve 0 = -2n - 9 + d for n. -4 Let k be 5 + 24/30(-5)/(-2). Solve -4 = -kl + 3l for l. 1 Suppose 0 = -3x + 179 - 26. Let l = x + -29. Solve 5k - 2 = -l for k. -4 Let i(a) = a*3 + 25a*2 + 2a + 50. Let o be i(-25). Solve -5v - 1 - 4 = o for v. -1 Suppose 5 = -2w - 3b, -2w + 4w - 4b = 16. Solve p = -wp - 6 for p. -2 Suppose 2 + 6 = 4d. Let b = 3 + d. Solve b = -a - 0a for a. -5 Suppose -6k + p = -k - 7, -4p = -3k - 6. Suppose -o - 5g = -5, 0 = -4o + kg - 6g + 100. Solve -4d - o + 10 = 0 for d. -5 Suppose 3o - 8o + 1210 = 0. Let c be (-6)/24 - o/(-8). Let b be ((-3)/(-2))/(9/c). Solve 0 = 3p - b + 2 for p. 1 Suppose 0 = 2c + 2c - 4. Solve -r = -c + 6 for r. -5 Let b(z) = 4z3 - 2z2 - 3. Let k(m) = -m3 + 1. Let s(l) = -b(l) - 5k(l). Let y be s(-2). Let i(j) = -2j - 2. Let a be i(y). Solve aq = -3 - 7 for q. -5 Let m = -10 + 10. Solve m = -6x + 2x for x. 0 Suppose 4d + 0 = 8. Let k = 7 - 5. Solve -d + 0 = kg for g. -1 Let r(a) = a2 + 4a + 5. Let o be r(-4). Let f(l) = 3l. Let w be f(0). Solve -o = -wp - p for p. 5 Let k = 5 - -1. Let f be (-3 + 6)/(k/2). Solve f = -4g - 11 for g. -3 Suppose -4b + s - 4s = -208, -3b - 5s = -156. Let d(j) = j. Let p be d(3). Suppose -pw - 3v + 57 = 0, 4w = -3v + 5v + b. Solve 0 = 2o + o + w for o. -5 Let n = 1 + 1. Let k be ((-4)/(-14))/(16/56). Solve no - k + 7 = 0 for o. -3 Let i(x) = 14x3 + x2 + x - 1. Let m be i(1). Suppose 2d + d - m = 0. Suppose dv = -2w - 0v, 0 = -2w - 4v. Solve w = -5n + 4n - 3 for n. -3 Suppose -5l + 13 = -4v, -5v = -2l - l. Solve vc - 4 = -1 for c. 1 Let h = 5 + -6. Let a be h/(0 + (-3)/6). Solve -ag + 4g = -4 for g. -2 Let j be (3 - 0) + -5 + 2. Solve 4v = -j + 4 for v. 1 Suppose 2q - 25 = -3f, 0q = 2f - 2q - 20. Suppose 0 = z - 2u - f, 0u + 3u = 5z - 17. Solve z = 2j - 3 for j. 2 Let w be 162/(-8) - (-9)/36. Let d be (-1)/(-5) - 76/w. Let b be (12)/(d/10). Solve 0 = 2m - bm + 12 for m. 4 Let s = 24 - 16. Suppose -4f + 0f = -s. Solve 0 = -j + fj for j. 0 Suppose -5n - 3v = 10, 15 = -2v - v. Suppose 0 = 8m - 10m. Solve m = -3w - 11 - n for w. -4 Suppose -3n + 2q = 7, -n + q - 19 = -3q. Solve 0 = x + 4 + n for x. -5 Suppose -4x = f - 14, -2 - 1 = -x. Let t(y) = 4y*3 + 0y*3 - 2 + 2y*2 + 2y - 3y3 + 2y*f. Let q be t(-2). Solve -qp - 2p + 20 = 0 for p. 5 Let f be ((-2)/4 + 0)2. Let k be f + (-1 - (-6)/3). Suppose 2z + kz = 0. Solve 4v + z = -12 for v. -3 Let m = -99 - -102. Solve -5 = -md + 2d for d. 5 Suppose -m + 6 = 5h + 1, -5m = -2h + 2. Solve -h = -3k - 4 for k. -1 Let w be (1 - 5)3/(-2). Suppose 43 = v + 2q, 2v - 3v + 18 = -3q. Let d be 2/(-4) + v/w. Solve 9 = -2h + dh for h. 3 Let p = -13 + 13. Solve p = -7f + 4f - 3 for f. -1 Let t(j) = 3j2 + 2j - 1. Let s be t(-2). Suppose 2c = sc. Solve 3g + g = c for g. 0 Let b(k) = k3 + 8k*2 - 2k - 12. Let g be b(-8). Let j = 9 + g. Let m = 28 - j. Solve 0 = -5z - m - 5 for z. -4 Let m be (-62)/10 - (-1)/5. Let x be m(0 - (-4)/(-3)). Suppose 0 = 5j - 6j + x. Solve -d = d - j for d. 4 Suppose -11 + 6 = -5x. Solve 0 = -u - x - 0 for u. -1 Let m(t) = t - 3. Let x be m(6). Let u be (4 + -14)/((-2)/1). Solve -17 = -us + x for s. 4 Let t(q) = q*3 - 20q*2 + q - 11. Let r be t(20). Let f = 14 - r. Solve -fv = 11 - 1 for v. -2 Let s(p) be the third derivative of -p4/24 + p3/6 + 2p2. Let k be s(1). Let g = 0 - k. Solve -5n + 0n - 5 = g for n. -1 Let c(v) = -v + 5. Let r be c(5). Let n(f) = -10f + 0f2 + 9f + f2 - f3 + 0f2 + 5. Let a be n(r). Solve 0 = -ak + 2k - 6 for k. -2 Let c(r) = -4r - 6. Let y be c(-9). Let x(b) = b*2 - b. Let v(k) = -7k*2 - k + 3. Let j(g) = -v(g) - 6x(g). Let q be j(-8). Solve 10 = -qh + y for h. 4 Let h be (-2 + 1)/(3/(-9)). Solve -3w = h + 12 for w. -5 Let b = -5 - -8. Let l be (-3)/(-12) + (-19)/(-4). Suppose lt = -3z - 3 - 7, 0 = 2z - t - 2. Solve b = -i - z for i. -3 Let y be 3/(-3) + 12/(-3). Let o(u) = -u3 - 4u*2 + 5u + 2. Let z be o(y). Solve -3i = -zi for i. 0 Suppose -4z + z - 16 = 4x, -x - 5 = z. Let d = 3 + x. Solve 5f + 7 = d for f. -1 Suppose 4w - 1 + 3 = -2j, j + 5 = 0. Solve -2f = wf + 8 for f. -2 Let a be (-114)/(-30) + 2/10. Let k = -1 + 4. Suppose 0 = kt + 2t. Solve -al - 2 - 6 = t for l. -2 Suppose -4 = -4z + 12. Suppose -3r = 5d - 12, -9 = 3r - 0r - 2d. Let s = 1 - r. Solve -zj + 3j = -s for j. 2 Suppose -5u = 3z - 31, -2z - 2 = -2u + 2z. Solve -u = -4l + 3 for l. 2 Suppose -2n = -5z + 58, 5z - 3 - 67 = 5n. Solve p + p = z for p. 5 Suppose -l - 3x = 2l - 3, -5x = 3l + 1. Solve 4n - ln = -3 for n. -3 Let v be (-33)/(-7) - 4/(-14). Let g(l) = l*2 - 5l + 4. Let d be g(v). Suppose 3p - 10 - 2 = 0. Solve -p = -3k + dk for k. -4 Let y be -1(-1)/2 - (-5)/2. Solve t - 2t = y for t. -3 Let q be (-194)/(-8) + 2/(-8). Let p(u) = 4u*2 - u + 1. Let x be p(1). Solve -xn = -q + 4 for n. 5 Suppose 12b = 15b - 45. Solve -5w = -b - 0 for w. 3 Suppose 5w = -4f - 0f, -4f = 3w. Solve 2n - 4 + w = 0 for n. 2 Let o be (-6)/(-27) - (-75)/27. Suppose 4f - 28 = -ov, -v - 13 - 3 = -5f. Solve 2k - f = k for k. 4 Suppose -z + 20 = 4z. Solve 8 = zn - 0n for n. 2 Let j = -16 + 10. Let p be (-4)/(13/j). Suppose 0 = 2r + r - s - p, 0 = -2s + 8. Solve u + 1 - r = 0 for u. 3 Let c be 4(-1)/2 - (-1 + -3). Solve -cp + 10 = -4p for p. -5 Let w = -152 - -154. Solve 0 = 4b - 2 - w for b. 1 Let s(q) = -2q + 3. Let g be s(0). Solve g =	{ "pile_set_name": "DM Mathematics" }
- 8j/3 - 22. Factor c(v). -4(v - 2)(v - 1)(v + 1)/3 Suppose -78b - 299 = -455. Factor 0d + 2/9d4 + 0 - 2/9d*b + 0d*3. 2d*2(d - 1)(d + 1)/9 Suppose -14p + 10p = -664. Find g, given that pg*3 - 89g*3 - 81g*3 - 16g - 48 + 28g2 = 0. -1, 2, 6 Let s(t) be the first derivative of 3t*4/16 + 3t*3/2 - 24t - 12. Factor s(d). 3(d - 2)(d + 4)*2/4 Let p be (-12)/(-18) + -1 + (-132)/9. Let n be (3 - (-54)/p)/((-3)/2). Factor -1/5c - n + 1/5c3 + 2/5c*2. (c - 1)(c + 1)(c + 2)/5 Let d = 215 - 215. Suppose 0 = -3r + 8r + 3p - 18, d = r + 2p - 5. Suppose 1/2y*r - 3/2y*2 - 1/2y + 3/2 = 0. Calculate y. -1, 1, 3 Let m(o) be the first derivative of -o*6/25 + 3o5/100 + o4/4 + o*3/5 - 19o + 4. Let f(n) be the first derivative of m(n). Solve f(k) = 0 for k. -1, -1/2, 0, 2 What is t in 0 + 2/5t2 - 58/5t = 0? 0, 29 Solve 4623z5 - 15z*3 - 6z*4 + 18z*2 - 2308z*5 - 2312z*5 = 0. -2, 0, 1, 3 Let r be 72/(-45)10/(-4). Let f(y) = -y4 - y2 - y + 1. Let g(t) = -t*5 + 14t*4 - 2t*3 + 11t*2 + 11t - 11. Let b(a) = rg(a) + 44f(a). Factor b(q). -4q3(q - 2)(q - 1) Let k = -245 - -245. Let o(n) be the first derivative of 0n + 2 + 1/10n4 + kn*2 - 2/15n3. Find h such that o(h) = 0. 0, 1 Let y(v) = v3 + v*2 + 6v + 18. Let d be y(-2). Factor -2/7id + 6/7 - 4/7i. -2(i - 1)(i + 3)/7 Suppose 19r - 10 = 17r. Suppose 7 = rd + a, -10a = d - 7a + 7. Let -2/11c*d + 4/11 - 2/11c = 0. Calculate c. -2, 1 Let h(w) = -5 - 12w + 10w - 3. Let p be h(-8). Factor 31g2 - 3g*2 - 2 - pg + 2. 4g(7g - 2) Let -84n*3 + 4n*5 - 1364n*2 + 64n + 16n3 + 1296n*2 + 4n*4 + 64 = 0. What is n? -4, -1, 1, 4 Let i(p) be the first derivative of -2p*5/25 - 3p*4/5 - 22p*3/15 - 6p*2/5 + 47. Determine c, given that i(c) = 0. -3, -2, -1, 0 Let c be (2/(-6))/((-2238)/558 - -4). What is u in 19u - 22u2 - 2u*2 - cu - 15u3 - 3u*4 = 0? -2, -1, 0 Let g(v) be the third derivative of -1/280v*6 + 0v + 11v2 + 0v*4 + 0v*3 + 1/140v*5 + 0. Factor g(q). -3q*2(q - 1)/7 Determine r, given that -272/9r2 - 458/9r*3 - 8r*5 - 58/9r - 104/3r4 - 4/9 = 0. -2, -1, -1/6 Let v be ((-15)/(-5) + -12)1 + (-329)/(-35). Factor 4/5y3 + 2/5 + 0y*2 - 4/5y - vy4. -2(y - 1)*3(y + 1)/5 Let z be (105/(-175))/(14/(-1000)). Solve 60/7o - 3/7o*2 - z = 0 for o. 10 Let k = 4257 + -4254. Determine l, given that 7/5l*2 + 0 - 3/5l*k - 7/5l*4 - 2/5l + l*5 = 0. -1, 0, 2/5, 1 Let l = -5753/2 - -2878. Determine w so that -l + w + 1/2w2 = 0. -3, 1 Let w(h) be the third derivative of h7/84 - 167h6/240 + 627h*5/40 - 7381h*4/48 + 1331h*3/6 - 13h*2 + 3. Let w(i) = 0. What is i? 2/5, 11 Let r = -13 + 15. Factor -12s*3 + 0s*r - 6s*2 - 8s + 14s3. 2s(s - 4)(s + 1) Let 25/2t3 + 0 - 9/2t*4 + 21t*2 + 4t = 0. What is t? -1, -2/9, 0, 4 Suppose -2j - 2 = -3j. Suppose 0 = -2r + r + j. Suppose -2a*3 + 6a*r + 4a*4 - 6a*4 + 2a + 0a4 - 4 = 0. Calculate a. -2, -1, 1 Suppose -4o - 26 = -5w, 20 = -2o - 3o. Let s(j) = -3j2 - j + 7. Let l(h) = h2 + h + 1. Let x(a) = wl(a) + 2s(a). Factor x(y). -4(y - 2)(y + 2) Let p(l) be the second derivative of l7/1260 + l6/720 - l5/360 - l4/144 - l*2/2 - 2l. Let y(f) be the first derivative of p(f). Factor y(s). s(s - 1)(s + 1)*2/6 Suppose 3g = 3u + 6, 4g + u + 8 = 21. Suppose 5t - gp - 9 = 0, 0p = -4t + 2p + 6. Find w such that 0w*4 + 0w + tw2 + 0 + 2/7w*3 - 2/7w*5 = 0. -1, 0, 1 Let w = 48 - -11. Let l = w + -57. Solve -2/7j*l + 12/7j - 18/7 = 0. 3 Let a = -2508 + 7528/3. Factor 2/3s3 + 2/3s - as2 + 0. 2s(s - 1)2/3 Let y(g) be the third derivative of -g9/70560 - g8/70560 - g5/60 + 8g*2. Let o(u) be the third derivative of y(u). Factor o(s). -2s*2(3s + 1)/7 Let -55 - 2t*2 + 62t - 43t + 23t - 21 = 0. Calculate t. 2, 19 Let l be (44/16 - 3)-20. Suppose -5 = -lb + 20. Let 4k2 + 0k*2 + 5 - 4k - b = 0. Calculate k. 0, 1 Let 21k3 - 1/2 - 5/3k*2 - 115/6k*4 + 25/6k*5 - 23/6k = 0. Calculate k. -1/5, 1, 3 Let n(k) = k*3 + k. Let t be n(1). Suppose -3p - p*t + 0 + 6p + 0p - 2 = 0. Calculate p. 1, 2 Let g = -1593 + 7971/5. Factor 3/5j - 3/5j2 + g. -3(j - 2)(j + 1)/5 Let i(q) = -2q*3 - 16q*2 + 2q + 11. Let d(m) = -9m3 - 66m*2 + 9m + 45. Let y(t) = -5d(t) + 21i(t). Determine x, given that y(x) = 0. -1, 1, 2 Let r = 30 + -27. Factor rv - 10 - 5v*2 - 9v - 9v. -5(v + 1)(v + 2) Let r(a) be the first derivative of 2a*6/27 - 16a5/45 - a4/9 + 16a3/27 + 386. What is f in r(f) = 0? -1, 0, 1, 4 Let n(b) = 36b + 2126. Let z be n(-59). Suppose -2/5 + 1/5o4 - o - 2/5o*5 + 7/5o*3 + 1/5o*z = 0. What is o? -1, -1/2, 1, 2 Determine c, given that -5c - 213 + 92c - 10c - 27 + 18c - 5c*2 = 0. 3, 16 Find f such that 13/6f*4 + 2f*5 + 40/3f - 8f2 - 34/3f*3 - 8/3 = 0. -2, 1/4, 2/3, 2 Suppose 5v = 2u - 3, -2v - 2u + 3 = -7u. Let s be v3/6-10. Factor -14g - 2g + 2g2 - 9g*3 + 14g*2 + sg*3. -4g(g - 2)2 Let r(k) be the second derivative of -k8/672 + k6/60 - k5/60 - k4/16 + k3/6 + 3k*2/2 - 2k. Let x(m) be the first derivative of r(m). Factor x(u). -(u - 1)*3(u + 1)(u + 2)/2 Let a(m) = 56m + 208. Let x(l) = -l*2 + 57l + 210. Let w(p) = -3a(p) + 4x(p). Let w(d) = 0. Calculate d. -3, 18 Let p(q) be the second derivative of -q4/12 + q2/2 + 17q. Suppose 24 + 81 = 5b. Let y(o) = 8o2 - 4o - 4. Let h(k) = bp(k) + 3y(k). Factor h(t). 3(t - 3)(t - 1) Solve 0z + 0 - 33/2z*2 - 3/4z*4 + 39/4z*3 = 0. 0, 2, 11 Suppose 16m - 14 = 9m. Factor 6 - 7p2 + p2 + 2p - 2 - 2p*3 + 2p*m. -2(p - 1)(p + 1)(p + 2) Let u(g) be the second derivative of g*5/5 + 22g*4/3 - 50g*3/3 - 92g*2 - 3g - 3. Factor u(z). 4(z - 2)(z + 1)(z + 23) Let c(f) be the first derivative of -f9/7560 + f8/4200 + f7/2100 - f6/900 - 10f*3 + 20. Let w(g) be the third derivative of c(g). Factor w(p). -2p*2(p - 1)*2(p + 1)/5 Let r be (-36)/6 - ((-275)/20 + 7). Solve -1/4d2 + r + 1/2d = 0. -1, 3 Suppose 0 = 4i - 6i + 24. Let s = i - 8. Factor -v*3 - 4vs - v5 + 0v4 + 6v4. -v3(v - 1)2 Let x(l) be the first derivative of l2 + 1/6l*4 + 2/3l*3 + 9 + 2/3l. Factor x(u). 2(u + 1)3/3 Let s(i) be the third derivative of 2/105i*7 + 0 + 0i + 8/3i3 - 2i*4 - 6i*2 + 13/15i*5 - 1/5i*6. Factor s(u). 4(u - 2)*2(u - 1)*2 Let i = -223199/180 + 1240. Let f(q) be the third derivative of 1/36q*4 - 1/18q*3 + 0q + 0q5 + 0 + 5q*2 - iq*6 + 1/630q7. Factor f(s). (s - 1)3(s + 1)/3 Let u(o) be the third derivative of -6o*2 + 0o - 1/42o7 + 1/12o*5 + 0 + 5/24o*4 - 1/24o*6 + 0o*3. Suppose u(r) = 0. What is r? -1, 0, 1 Let d(t) be the second derivative of -1/36t*4 + 0t*2 - 1/9t*3 + 0 + 10t. Factor d(y). -y(y + 2)/3 Let y = 65 - 65. Let k be 2 + -1 + y - (0 - 3). Let 0s - 6/5sk - 2/5s*3 + 0 + 4/5s*2 = 0. Calculate s. -1, 0, 2/3 Let l(n) be the first derivative of -6 + 32n + 2/3n3 - 8n*2. Factor l(z). 2(z - 4)*2 Factor 1/4n*4 + 64 + 17/2n*3 + 321/4n*2 + 136n. (n + 1)*2(n + 16)*2/4 Let n = 4225/3 + -1401. Factor -8w + nw2 + 2/3. 2(w - 1)(11w - 1)/3 Determine d so that -11552/11 - 304/11d - 2/11d*2 = 0. -76 Factor -6 - 2/5s*2 - 32/5s. -2(s + 1)(s + 15)/5 Let z(x) = -2x3 - 55x*2 - 31x - 106. Let t be z(-27). Factor 5ft - 25/3f + 10/3 - 5/3f4 + 5/3f*3. -5(f - 1)*3(f + 2)/3 Let s(t) = -144t3 + 44t*2 + 104t + 20. Let r(n) = 433n3 - 131n*2 - 312n - 58. Let y(c) = -6r(c) - 17s(c). Solve y(q) = 0. -2/3, -2/25, 1 Let h(o) be the third derivative of o6/900 - o4/45 + 2o2 + 3o. Determine y so that h(y) = 0. -2, 0, 2 Suppose 26a - 33a + 330 = 59a. Solve -3p*4 + 3/2 + 3/4p*a + 3p*3 + 3/2p*2 - 15/4p = 0. -1, 1, 2 Let p = 119 + -117. Suppose -8b3 - 1995b4 - b5 + 6b2 + 2000b*4 - pb*2 = 0. Calculate b. 0, 1, 2 Let s be (25 - (-278)/(-11))66/(-4). What is a in 0 + 3/4a3 - 21/4a - sa2 = 0? -1, 0, 7 Determine h so that -108h + 2916 + 87h + h2 - 87h = 0. 54 Factor 4o2 + 4o*5 + 0o**2 - 4	{ "pile_set_name": "DM Mathematics" }
, -979, -1053? -1145 What is the next term in 488, 982, 2328, 4952, 9280, 15738, 24752, 36748? 52152 What comes next: -2008, -4015, -6036, -8077, -10144, -12243? -14380 What is next in 61740, 61748, 61756, 61764? 61772 What is the next term in 12, 69, 172, 321? 516 What comes next: 38500, 77011, 115522, 154033? 192544 What is next in 4156, 8298, 12442, 16588, 20736, 24886? 29038 What is the next term in 48, 147, 314, 549, 852? 1223 What is the next term in 146820, 146825, 146828, 146829? 146828 What is the next term in -2434, -4506, -6578, -8650, -10722? -12794 What is next in 328, 511, 810, 1225, 1756, 2403? 3166 What is the next term in -24158, -24159, -24160, -24161? -24162 What is the next term in -18750, -18810, -18872, -18936, -19002, -19070? -19140 What is the next term in -14, -41, -100, -209, -386, -649? -1016 What is the next term in 1971, 3880, 5649, 7206, 8479? 9396 What is the next term in 161, 488, 1021, 1760, 2705? 3856 What is the next term in 540, 434, 328, 222, 116, 10? -96 What is next in -516670, -516668, -516666? -516664 What comes next: 3026, 12151, 27374, 48695? 76114 What comes next: -2368, -4265, -6162, -8059? -9956 What is the next term in 1714, 6892, 15520, 27598, 43126, 62104? 84532 What is the next term in -177, -322, -467, -612? -757 What comes next: 75, 298, 665, 1176, 1831? 2630 What is next in 2346, 1703, 632, -867, -2794? -5149 What is the next term in 85930, 171858, 257786? 343714 What is next in -1101, -2151, -3189, -4215? -5229 What is next in -611, -1206, -1759, -2270, -2739, -3166, -3551? -3894 What is the next term in 148095, 148091, 148087, 148083, 148079? 148075 What comes next: 369025, 369024, 369021, 369016? 369009 What is the next term in -156, -1402, -4832, -11538, -22612, -39146, -62232, -92962? -132428 What is the next term in -329819, -659639, -989459, -1319279, -1649099, -1978919? -2308739 What is next in 4462, 17343, 38802, 68833, 107430? 154587 What is next in -3021, -3022, -3033, -3060, -3109, -3186? -3297 What comes next: 1337, 5347, 12033, 21395, 33433, 48147, 65537? 85603 What is the next term in -432, -583, -734, -885, -1036? -1187 What is the next term in 721, 1253, 1785, 2317, 2849? 3381 What is next in 364, 373, 388, 409, 436, 469, 508? 553 What is the next term in 1727377, 1727378, 1727377, 1727374, 1727369, 1727362, 1727353? 1727342 What comes next: -19984, -39989, -59994, -79999, -100004, -120009? -140014 What is the next term in -223, -264, -307, -352, -399, -448, -499? -552 What comes next: -168, -138, -62, 84, 324, 682, 1182? 1848 What comes next: 3306, 3318, 3346, 3396, 3474, 3586? 3738 What is the next term in 140, 282, 468, 698? 972 What is the next term in -13609, -27261, -40911, -54559? -68205 What is the next term in 11, -111, -425, -1021, -1989? -3419 What is the next term in 11083, 11035, 10987, 10939? 10891 What comes next: -2835, -1610, 431, 3288, 6961? 11450 What comes next: -65838, -65814, -65776, -65724, -65658? -65578 What is the next term in 32863, 32876, 32889, 32902, 32915, 32928? 32941 What comes next: -14747, -14828, -15043, -15458, -16139, -17152, -18563, -20438? -22843 What comes next: -72, -388, -1052, -2178, -3880, -6272, -9468? -13582 What comes next: 12, 125, 238, 351? 464 What is the next term in -2154, -8594, -19330, -34362, -53690, -77314? -105234 What is the next term in -7783, -7729, -7675, -7621, -7567? -7513 What comes next: -1929, -3909, -6023, -8343, -10941, -13889, -17259, -21123? -25553 What is the next term in 7593, 15177, 22771, 30381, 38013, 45673, 53367? 61101 What comes next: 3305, 3425, 3555, 3701, 3869, 4065, 4295, 4565? 4881 What is the next term in -18491, -18468, -18443, -18416? -18387 What is next in 1541, 3009, 4477? 5945 What is next in -570945, -570951, -570959, -570969? -570981 What comes next: -516, -1135, -1860, -2691? -3628 What is next in 10475, 10473, 10471, 10469? 10467 What is next in 22761, 91039, 204835, 364149, 568981, 819331? 1115199 What is next in -560, -253, 54, 361? 668 What is next in -2529, -10084, -22661, -40260? -62881 What is next in -2515, -5041, -7567, -10093, -12619? -15145 What is next in -785, -769, -753? -737 What is the next term in 809, 1611, 2401, 3173, 3921, 4639? 5321 What is next in 144902, 144882, 144850, 144806, 144750? 144682 What is next in 252, 205, 96, -99, -404, -843, -1440? -2219 What is next in 35059, 70089, 105119, 140149, 175179, 210209? 245239 What is next in 122, 480, 1076, 1910, 2982, 4292? 5840 What is next in 142073, 142074, 142075? 142076 What comes next: -168781, -337560, -506339, -675118? -843897 What is next in -3595398, -7190795, -10786192, -14381589, -17976986, -21572383? -25167780 What is next in -331915, -663834, -995753? -1327672 What is next in 10058, 10060, 10062, 10064, 10066, 10068? 10070 What is the next term in -127, -354, -755, -1348, -2151, -3182, -4459? -6000 What is the next term in 579, 1159, 1737, 2313, 2887? 3459 What comes next: -146784, -146783, -146782, -146781, -146780? -146779 What is the next term in -1853, -3677, -5501, -7325, -9149, -10973? -12797 What is the next term in 106, 73, 34, -5, -38, -59, -62, -41? 10 What is next in -21582, -43162, -64742, -86322, -107902? -129482 What is the next term in 968, 1919, 2864, 3803, 4736? 5663 What is next in 815034, 1630076, 2445118, 3260160? 4075202 What comes next: -1026453, -2052904, -3079355, -4105806, -5132257? -6158708 What is next in -7813, -7778, -7711, -7612? -7481 What comes next: 787, 1581, 2387, 3205, 4035? 4877 What is next in -51, -95, -139, -183, -227? -271 What is the next term in -54, -155, -290, -447, -614, -779, -930? -1055 What is next in 1241, 1539, 2035, 2729, 3621, 4711, 5999? 7485 What comes next: -23, -190, -673, -1640, -3259, -5698, -9125? -13708 What comes next: 15, -88, -381, -960, -1921? -3360 What is next in 190046, 380091, 570136, 760181, 950226? 1140271 What comes next: 97, 353, 763, 1315, 1997, 2797, 3703, 4703? 5785 What is the next term in 15, 52, 115, 210, 343, 520, 747? 1030 What is next in -911, -747, -473, -89, 405, 1009? 1723 What is next in 38, -56, -150? -244 What comes next: -319, -645, -971, -1297, -1623? -1949 What comes next: 21938, 21929, 21920, 21911, 21902? 21893 What is next in 606, 1264, 1930, 2604, 3286, 3976? 4674 What is the next term in 92, 659, 2182, 5135, 9992, 17227, 27314? 40727 What comes next: 26386, 26413, 26448, 26485, 26518, 26541, 26548? 26533 What is next in -2792, -11157, -25098, -44615, -69708, -100377, -136622? -178443 What is next in 2758, 5527, 8296, 11065? 13834 What is the next term in 1800, 1777, 1754, 1731, 1708, 1685? 1662 What is next in -1105, -2504, -3903, -5302, -6701, -8100? -9499 What is the next term in -10126, -10063, -9966, -9841, -9694? -9531 What is next in 260, 694, 1394, 2342, 3520, 4910, 6494? 8254 What is next in -2039, -4070, -6101, -8132, -10163? -12194 What is next in 762, 750, 734, 708, 666, 602, 510? 384 What comes next: 1605342, 3210688, 4816034, 6421380, 8026726? 9632072 What is the next term in 366944, 366943, 366942, 366941, 366940? 366939 What is the next term in 5591, 5701, 5811, 5921? 6031 What comes next: -4113, -4083, -4043, -3999, -3957? -3923 What is the next term in -2403, -4822, -7255, -9702? -12163 What comes next: 2100, 4187, 6272, 8355? 10436 What comes next: 99, 211, 399, 663, 1003? 1419 What is the next term in 410054, 1640200, 3690444, 6560786? 10251226 What is next in 93284, 93282, 93278, 93272, 93264, 93254, 93242? 93228 What comes next: -153, -605, -1377, -2469, -3881, -5613? -7665 What comes next: -126425, -126423, -126421, -126419, -126417, -126415? -126413 What comes next: -1072, -2159, -3242, -4321, -5396, -6467, -7534? -8597 What is the next term in 6471, 5688, 4905? 4122 What is next in -2514571, -2514572, -2514573, -2514574, -2514575? -2514576 What is the next term in 1903, 7601, 17089, 30361, 47411, 68233, 92821, 121169? 153271 What is the next term in 166793, 166794, 166795? 166796 What is next in 2839, 11370, 25587, 45490, 71079, 102354? 139315 What is next in -11830, -23652, -35474, -47296, -59118? -70940 What comes next: -20932, -41839, -62746, -83653, -104560? -125467 What is next in 16966, 16969, 16972, 16975? 16978 What comes next: -3800, -3829, -3858? -3887 What comes next: -	{ "pile_set_name": "DM Mathematics" }
ive of g*4k*3 + 96g*4 + 3044gk3 wrt g. 12g*2k*3 + 1152g*2 Find the third derivative of 76g*3h*3 - 2g*3h*2 + 983g*2h*2 + 9gh3 wrt h. 456g*3 + 54g Find the second derivative of -5d3g + 211d2g + 36dg - d + 3g wrt d. -30dg + 422g What is the first derivative of -569x3 - 11x*2 - 1137? -1707x*2 - 22x What is the third derivative of 18q4 - q3 + 377q*2? 432q - 6 Find the third derivative of 5d5 + d4q3 + d4q - 148d*2q - dq3 wrt d. 300d*2 + 24dq3 + 24dq Differentiate -43l*3 + 246 with respect to l. -129l2 Differentiate -i3r - 4i*2r*2 + 7ir2 - 417r*2 wrt i. -3i*2r - 8ir*2 + 7r*2 What is the derivative of -11g*3r - 10g3 + 3g*2r - gr4 + 5 wrt r? -11g*3 + 3g*2 - 4gr3 Find the second derivative of -87g*2 - g + 114 wrt g. -174 What is the first derivative of 795cs - 691c + 1 wrt s? 795c What is the third derivative of 1674t*6 + 6t*4 + 3473t*2 wrt t? 200880t*3 + 144t What is the third derivative of -4i6 - 176i*3w + i*3 + 557i*2 + 2w wrt i? -480i3 - 1056w + 6 Find the third derivative of -75a5 + a4 - 3a*3 - 14484a*2 wrt a. -4500a*2 + 24a - 18 What is the derivative of -5610b3v - 5850b3 + 2b*2 wrt v? -5610b*3 What is the third derivative of -10o*5 + 12o*4 + 2411o*2 wrt o? -600o*2 + 288o Differentiate 58mw*2y - 2mwy - 8mw - 7w*2y - 2y wrt m. 58w*2y - 2wy - 8w What is the second derivative of 1435c*3v*3 - 8cv3 + 8v3 - v2 wrt c? 8610cv*3 What is the derivative of 3hty*2 - 33ht - hy*3 - 4hy - 3ty3 + 7ty2 + 5ty + 11y*2 wrt h? 3ty2 - 33t - y*3 - 4y Find the second derivative of 19f2ny + f2n + f*2y*3 - fy*3 + 6f + 2ny*3 wrt f. 38ny + 2n + 2y3 Find the first derivative of 874f*3 + 2f*2 - 10. 2622f*2 + 4f Find the second derivative of -20cd*3 + 2cd - 725c - 20d3 wrt d. -120cd - 120d Find the third derivative of -13207s6 + 19902s*2 wrt s. -1584840s*3 What is the third derivative of 2q*3w*3 + 36q*3 - 2q*2w*2 + qw*3 wrt w? 12q*3 + 6q Find the second derivative of 52j4 - j2 - 5j + 41. 624j2 - 2 Find the second derivative of -372m*2 - 3516m. -744 What is the derivative of -11l2mp + 3l*2m - 3l2p + lp - 9l wrt m? -11l2p + 3l2 Find the first derivative of -2k*3v - 16k3 - 9k*2v - 19k2 - kv - 3 wrt v. -2k3 - 9k*2 - k Find the third derivative of -254i*6u*3 + 2i*4u*3 + 7i*2u*3 + 78i*2 wrt i. -30480i*3u*3 + 48iu3 Differentiate 9c*3n*3 + 148c*3 - c - 4n*3 wrt n. 27c*3n*2 - 12n*2 What is the derivative of 7c*2pq2 - 2c*2p + 5c2q*2 + 162c*2q - 4cp - pq - 2q*2 wrt p? 7c*2q*2 - 2c*2 - 4c - q What is the first derivative of -5c2g + c*2t - 6285cg*2t + 2cg2 + 129 wrt t? c2 - 6285cg*2 What is the second derivative of -2f*3m + 2f3w*2 + 4f*3w + 2f2mw2 + f2mw - 23fmw*2 - 2fw + 15m + w*2 wrt w? 4f*3 + 4f*2m - 46fm + 2 Find the third derivative of 43w3 - w2 + 768w. 258 Find the second derivative of -2096j2v*3 + 2j*2v*2 - 4j*2 - 4649jv3 wrt j. -4192v*3 + 4v*2 - 8 Find the second derivative of 881l*4 - l - 449. 10572l2 What is the first derivative of -f3u + 471f*3 + 43fu wrt u? -f3 + 43f Find the third derivative of 82d3it3 - d3it + 4d*2 - 2dit*2 - 2dt2 - 7i + 22t4 wrt t. 492d*3i + 528t Find the second derivative of 4356b*2 + 3b - 272. 8712 What is the third derivative of -1005j4 - 2j*3 - 79j*2 + 3 wrt j? -24120j - 12 Differentiate 19144n4 + 9727. 76576n*3 Find the second derivative of -50n*5x - n*2x + n + x - 2 wrt n. -1000n3x - 2x What is the second derivative of 2d*4 + 11d*3 + 449d wrt d? 24d2 + 66d Find the third derivative of 2n2r*5 - 20n*2r + 140r5 - 2r*2 - r wrt r. 120n*2r*2 + 8400r*2 Find the third derivative of -3k*4 + 24k*3 - 3559k*2 wrt k. -72k + 144 Differentiate 5a3k - 6a3q3 + a3q - 27a*2kq3 + 2a*2q*3 wrt k. 5a*3 - 27a*2q*3 Find the second derivative of -11862h5 - h3 - 12995h wrt h. -237240h*3 - 6h Find the second derivative of 823y4 - 694y - 2 wrt y. 9876y2 Find the third derivative of -b5s + 3000b3s + 27b2s - 4b2 + bs - b wrt b. -60b2s + 18000s What is the second derivative of 371x*2 + 204x wrt x? 742 Differentiate -1067h - 169 with respect to h. -1067 Differentiate 224f*2 - 69. 448f What is the second derivative of 300d5 + 31d*3t*3 - 8dt3 + 4dt2 + 2dt + 23 wrt d? 6000d*3 + 186dt3 Find the second derivative of 19q*3t*3 - 2q*2t*2 - 3q*2 - 98qt3 + 16qt wrt q. 114qt3 - 4t*2 - 6 Find the second derivative of -12f*4k*2 + 381f*2k*2 - 32fk2 + 13 wrt f. -144f*2k*2 + 762k*2 What is the second derivative of -38pw4 + 3pw3 + 9p + 98w wrt w? -456pw2 + 18pw Find the first derivative of 16gm2 + 9gmw*3 + 2m*2w - 44w3 wrt g. 16m*2 + 9mw3 What is the derivative of -25h*2i - 55h2x*2 - ix3 - x3 wrt i? -25h2 - x3 What is the third derivative of -4097j*6u3 - j6u - j2u3 + j2u2 + 3j*2u - 25 wrt j? -491640j3u*3 - 120j*3u What is the second derivative of -h*2u*3 + 705h*2u - 344u3 - 2u*2 + 1 wrt u? -6h*2u - 2064u - 4 Find the second derivative of -72a*2f*2l + 43a2f*2 + 2a*2fl - 2af2l - 108af*2 - 2afl - 2fl - 3f wrt a. -144f*2l + 86f2 + 4fl Find the second derivative of -285i3 - i2 - 3i + 129. -1710i - 2 Find the second derivative of 2906a2q + 42aq + 5a wrt a. 5812q What is the second derivative of -130d4n*3 + 2d*4n*2 - dn*2 - 2dn - 7n*3 wrt d? -1560d*2n*3 + 24d*2n2 What is the second derivative of d3suv2 + 2d*3sv - 116d*3u*3v - d*3u3 - d3uv*2 + 2dsu*2v - 2u3v*2 wrt v? 2d*3su - 2d*3u - 4u3 What is the second derivative of -873j*2r - 256jr wrt j? -1746r What is the third derivative of -4b*3g2 + b3g - 11b3 - b2g2 + b2g - 31b2 + 22g*2 wrt b? -24g*2 + 6g - 66 What is the derivative of d*3p + d*3u4 + d3u + 103pu - 2p - 96 wrt u? 4d3u3 + d3 + 103p What is the third derivative of -2477b*4 + 2b*2 + 151b wrt b? -59448b What is the derivative of -2907j*2 + 6129 wrt j? -5814j Find the second derivative of 1645i2 + 1340i. 3290 What is the third derivative of 157k6 + 11k*3 - 463k*2? 18840k*3 + 66 Find the second derivative of -18t*2wz2 - t2wz + 2t*2z2 + t2 - 24tz*2 - 13t - 2z wrt z. -36t*2w + 4t2 - 48t Find the first derivative of -2i4 - 805iu + 1025u wrt i. -8i3 - 805u What is the third derivative of 497x3 + 792x*2 wrt x? 2982 What is the second derivative of -4405w*5 - 2973w wrt w? -88100w3 What is the third derivative of -6066sx5 - 6sx2 + 4sx + s - 38 wrt x? -363960sx2 What is the second derivative of -86l*2o*3 - 2l*2o - 2lo*3 + lo*2 - 27lo wrt l? -172o*3 - 4o What is the second derivative of -14aj*3 + 11aj2 - aj - 21 wrt j? -84aj + 22a Differentiate -13690q*2y*2 + 5q*2 + 1241 wrt y. -27380q*2y Differentiate 337j2 - 302 wrt j. 674j Differentiate 2hr + 191h + 880r wrt h. 2r + 191 Find the third derivative of 1179z*3 + 297z*2. 7074 What is the second derivative of 54o*3r*2 - 2o*3 - 2o*2r*2 + 4307or2 wrt o? 324or2 - 12o - 4r2 Find the second derivative of -40d*5 - 4d*2 + 3179d. -800d3 - 8 What is the second derivative of 11ad2m*2 + ad*2m + 3ad*2 - 15adm + 14am*2 wrt m? 22ad2 + 28a Differentiate 239w3 - w - 1196 wrt w. 717w*2 - 1 What is the second derivative of -2a*5g - 5a4 + a2g*3 + 2ag3 - 4ag2 - 4g*3 wrt a? -40a*3g - 60a2 + 2g*3 Find the third derivative of -625d*6 + 1319d*2 + 1 wrt d. -75000d*3 Find the third derivative of 65acz*3 + 2acz*2 - 41acz + 2ac - 21az**6 wr	{ "pile_set_name": "DM Mathematics" }
2c + 1. Factor b(u). -5(u - 528)(u + 2)2 Let o(j) be the first derivative of j5/70 + j4/14 - 13j*3/21 - 15j*2/7 + 95j + 84. Let p(n) be the first derivative of o(n). Factor p(w). 2(w - 3)(w + 1)(w + 5)/7 Let l(b) be the second derivative of b6/3240 - b5/27 + 50b*4/27 + 191b*3/6 + 5b - 2. Let k(x) be the second derivative of l(x). Solve k(u) = 0. 20 Let f(t) be the first derivative of 2/3t3 - 14 + t4 + 0t - t*2. Factor f(c). 2c(c + 1)(2c - 1) Factor -2 + 9/8s*4 + 21/4s - 29/8s2 - 1/8s*5 - 5/8s*3. -(s - 8)(s - 1)*3(s + 2)/8 Suppose -3t + j = 36, 4t - 2t + 24 = -j. Let q = -5 - t. Factor -qu2 + u2 - 1 + u*3 + 2u*2 + 3u + u2. (u - 1)3 Let t be 608/190(-25)/(-20). Let w be 126/57(-2)/(-6). Solve 2/19i*5 + 0 - 4/19i*2 - wi*t + 10/19i*3 + 0i = 0 for i. 0, 1, 2 Let h be (-270)/20(-2)/3. Suppose r - 11 = -h. Solve -2 - 2j2 + j2 + 3j2 - r - 2j = 0 for j. -1, 2 Factor 258 - 128y - 1/2y*2. -(y - 2)(y + 258)/2 Let f(m) = -8m2 - 1114m - 38083. Let q(k) = 52k2 + 7240k + 247540. Let h(t) = 32f(t) + 5q(t). Factor h(o). 4(o + 69)2 Let m = 355037/95100 - -1/31700. Let b(d) be the second derivative of 49/5d*4 - 8/5d*2 + md*3 + 0 - 14d. Factor b(l). 4(7l + 2)(21l - 2)/5 Let p(o) be the second derivative of -15o + 3/2o*2 - 1/4o*4 + 0 + 0o*3. Find j such that p(j) = 0. -1, 1 Suppose -4v = 2u - 1006, u - 2u + 3v + 493 = 0. Let f = u - 496. Suppose 16d*4 - 84/5d*5 + 236/5d*f - 72/5d*2 - 112/5d + 32/5 = 0. Calculate d. -1, 2/7, 2/3, 2 Let d(u) be the first derivative of u7/42 + u6/24 - u*2 - 25u + 44. Let j(b) be the second derivative of d(b). Factor j(i). 5i3(i + 1) Let q(f) = 36f - 108. Let m be q(4). Factor 15y + m - 6y - 9y - 4y2. -4(y - 3)(y + 3) Let c(b) be the second derivative of b6/450 + 29b5/300 - b4/4 + 19b3/3 - b + 3. Let n(r) be the second derivative of c(r). Solve n(u) = 0. -15, 1/2 Factor 55/7k*4 + 752/7 - 1/7k*5 - 1520/7k + 1160/7k2 - 400/7k*3. -(k - 47)(k - 2)*4/7 Let x be 03/9 - -5. Factor -7 + 0fx - 11f - 5 + f*3 + 3f + 2f3 + 13f2 + f5 - 5f4. (f - 3)(f - 2)*2(f + 1)*2 Let a be (-9)/171-19 - (-8)/(64/8). Factor 0ia - 4/13i + 2/13 - 2/13i4 + 4/13i*3. -2(i - 1)*3(i + 1)/13 Let f(n) = -2n3 - 20n*2 - 23n. Suppose 3h - 66 = 9h. Let l(c) = 9c3 + 100c*2 + 114c. Let a(r) = hf(r) - 2l(r). Solve a(d) = 0. -5/2, 0 Let o(x) = -91x2 - 16569x + 17189316. Let j(z) = 292z2 + 49704z - 51567948. Let q(v) = 5j(v) + 16o(v). Factor q(s). 4(s - 2073)2 Let x be (57/76)/(9/32)29/12. Factor 22/7i*x + 2/7 - 13/7i + 32/7i2 - 5/7i*5 - 38/7i3. -(i - 1)4(5i - 2)/7 Let w(y) be the first derivative of -4y3/3 + 1144y*2 - 327184y - 962. Factor w(g). -4(g - 286)2 Let u = 1 - -10. Let o(h) = h - 6. Let c be o(u). Factor 5d*3 + 62d*2 - 39 + 23 - 17d*2 - 92 - 5d4 - dc. -(d - 2)*2(d + 3)*3 Suppose -f + w + 6 = 0, -9f = -5f - w - 24. Factor -29h*4 - 9h*3 - fh*2 + 47h*4 - 21h*4. -3h*2(h + 1)(h + 2) Let t(v) be the second derivative of -v4/21 + 680v*3/21 + 682v*2/7 - 943v. Let t(f) = 0. Calculate f. -1, 341 Suppose 0 = -107r + 101r + 12. Factor -5jr + 3j + 5j4 + 25j*3 + 0j*2 - 28j. 5j(j - 1)(j + 1)(j + 5) Solve -3/4n2 + 423/4n + 435 = 0 for n. -4, 145 Suppose 0 = -26z + 34z - 40. Suppose zi = -5w + 35, 0w + 2w = -5i + 23. Determine m, given that 9/2m*2 - 27/2m - 27 + 1/2mw + 7/2m*3 = 0. -3, 2 Let r = -31781951/39 - -814995. Let i = 220/3 - r. Factor ih*3 - 2/13h - 2/13h2 + 2/13. 2(h - 1)*2(h + 1)/13 Let j be (-132)/(-352) - (-2762)/16. Let v = j - 327/2. Factor -2 - vr3 - 25/2r*2 - 7/2r*4 - 1/2r*5 - 8r. -(r + 1)*3(r + 2)*2/2 Let f(p) = -4409p - 13 - 5 + 4407p. Let s be f(-10). Let 999l*3 + 0l*s + 0l*2 + 5l*4 - 1009l3 = 0. What is l? 0, 2 Let x(v) be the third derivative of -v7/280 + 51v6/160 + 53v*5/40 + 637v2. Suppose x(l) = 0. Calculate l. -2, 0, 53 Let g(i) be the second derivative of i6/15 + 11i5/10 - 115i*4/6 + 193i*3/3 - 90i*2 - 5i - 55. Find n, given that g(n) = 0. -18, 1, 5 Factor 27/2l5 - 135l*4 + 194l*2 + 9 + 99l*3 + 151/2l. (l - 9)(l - 2)(3l + 1)3/2 Let g be (1974/(-98) - -21) + (-104)/(-42). Let t(d) be the first derivative of -15/2d*2 - 30 + gd*3 - 10d. Suppose t(h) = 0. Calculate h. -1/2, 2 Suppose -5f + 38 = 4a, 3f - 18 - 9 = -a. Let p(l) be the first derivative of 0l + 2/9l3 - 1/3l*2 - f. Factor p(o). 2o(o - 1)/3 Let o be (-370)/204/2. Let r = -35 - o. Factor 20 - 27s + 22s + 5s3 - 11s*r - 9s*2. 5(s - 4)(s - 1)(s + 1) Solve -996r + 308r*2 - 44r*2 + 1976 - 260r2 = 0 for r. 2, 247 Let m(y) be the second derivative of y7/70 + 23y6/30 + 531y*5/100 + 89y*4/60 - 11y*3 - 75y + 39. Find u, given that m(u) = 0. -33, -5, -1, 0, 2/3 Let s(f) = f*3 - 9f*2 + 24f - 18. Let n be s(6). Let p = 23 - 13. Factor pg + 3 - 7g*2 - 3 - 35g*3 - ng*2. -5g(g + 1)(7g - 2) Let f(h) be the first derivative of h8/504 + h7/63 - 13h*6/180 + 7h*5/90 - 100h*2 + 17. Let w(l) be the second derivative of f(l). Factor w(m). 2m*2(m - 1)*2(m + 7)/3 Let o(c) be the third derivative of -c*7/70 - 3c*6/5 - 41c*5/20 + 33c*4/4 - 2396c*2 - c. Solve o(p) = 0 for p. -22, -3, 0, 1 Suppose 0 = -n + 43 - 7. Suppose -7g + n - 1 = 0. Factor -3t3 + 0t + 0t2 + 0 + 3/2t*g - 3/2t*4. 3t*3(t - 2)(t + 1)/2 Let m(d) = -3d*2 + 5814d + 1687801. Let r(c) = 35c2 - 63955c - 18565810. Let v(j) = 45m(j) + 4r(j). Factor v(x). 5(x + 581)2 Let w be (4/(-3))/((-114)/171). Let f be 728/1260 - w/(-9). Find x, given that -6/5x*2 + fx + 2/5 = 0. -1/3, 1 Let x(q) be the first derivative of 2q3 + 31q*2 + 441q - 257. Let u(j) = -j*2 - 4j. Let g(v) = 5u(v) + x(v). Factor g(s). (s + 21)2 Let a = -1763/9 + 33515/171. Let z(b) be the second derivative of -15b + 5/114b4 + 0 + 1/19b*3 - ab*2. Find p such that z(p) = 0. -1, 2/5 Let x be 398/60 - 42/(-9072)36. What is r in xr3 + 2/5r*4 + 0r + 0 + 0r2 = 0? -17, 0 Factor 1/5y*2 + 462080 - 608y. (y - 1520)*2/5 Let x be 3(0 + 4/6). Suppose -3q + 1 = -2j - xq, -j = 2q - 12. Factor -1 + 213n3 + 14n + 3 + 30nj - 195n*3. 2(n + 1)(3n + 1)*2 Suppose 5g + 16 + 49 = 0. Let o(n) = n*3 + 12n*2 - 14n - 10. Let v be o(g). Factor 0z4 + z4 - z2 + 12z*3 + 17z*v - 28z*3 - z. z(z - 1)(z + 1)2 Let s = 912477 + -6383883/7. Suppose -792/7w*3 + 2592/7w*2 + sw - 2/7w5 + 10w4 + 0 = 0. What is w? -1, 0, 12 Let i(f) be the second derivative of -f5/140 + 17f4/14 - 867f*3/14 + 1150f. Suppose i(a) = 0. What is a? 0, 51 Let a = 2/2292545 + 2292537/9170180. Factor v - 3/4v2 - v3 + 1 - av*4. -(v - 1)(v + 1)(v + 2)2/4 Let h(x) be the first derivative of -2/3x*6 + 6x*2 + 4x - 71 - 12/5x5 + 8/3x*3 - 2x4. Solve h(n) = 0. -1, 1 Let c(w) be the second derivative of w6/80 + 2067w5/160 + 2061w*4/32 + 2059w*3/16 + 1029w*2/8 + 2222w. Find y, given that c(y) = 0. -686, -1 Let n be (((-7)/(-10))/(2149/614))/1. Solve 21/5w2 - nw*3 + 9w + 23/5 = 0 for w. -1, 23 Let u(v) = v*3 + 11v*2 - 11v + 16. Let d be u(-12). Let b be (-188)/(-46) - (-3 - -7). Factor -14/23sd + 0 + 30/23s*3 - 26/23s*2 + 8/23s + bs5. 2s(s - 4)(s - 1)*3/23 Let d be 2 + (-4 + 2 - -2) + -492. Let l be ((-2)/(-30))/(11 + d/45). What is w in lw - 2/5 - 1/5w2 = 0? 1, 2 Let n be (-6 + 7)/((-29)/(-116)). Suppose 5/3a*3 + 3a*2 + 1/3a*n + 2/3 + 7/3a = 0. Calculate a. -2, -1 Suppose 61g = 7g + 112 - 4. Let d(w) be the second derivative of 1/2wg - 1/6w*4 + 1/30w*6 + 17w + 0w5 + 0 + 0w3. Factor d(r). (r - 1)2(r + 1)2 Let q(c) be the third derivative of 0c + 71c2 + 1/100c*5 - 1/120c*4 + 1/600c*6 - 1/10c*3 + 0. Factor q(s). (s - 1)(s + 1)(s + 3)/5 Find u, given that -423/8u*2 + 0 - 3/8u*3 - 105/2u = 0. -140, -1, 0 Let u(h) be the first derivative of h5/140 + h4/14 - 56h*2 - 60. Let g(f) be the second derivative of u(f). Solve g(b) = 0 for b. -4, 0 Let v be ((-30)/14)/(-3) -	{ "pile_set_name": "DM Mathematics" }
s be -3 - 20/i - (-2 + 1). What is the second smallest value in n, s, 0? n Let t = -0.1 - -0.2. Let k = 5.9 - -32.1. Let b = 33 - k. What is the second smallest value in b, 2, t? t Let d = 647 - 645. Let h = -0.3 - -1.3. What is the second smallest value in h, d, 0.3? h Let s = 5 - 5.3. Let m = -305 + 2437/8. Let f = 43 - 45. What is the second smallest value in m, f, s? m Let a = -1.095 - -1.595. What is the second smallest value in a, 2/3, -4, 48? a Let v = 15/2 + -8. Let u = 0.063 - 1.963. Let r = u - -3.9. What is the third smallest value in r, -2, v? r Let k be (6/77)/(532/49 + -11). What is the second biggest value in k, -11, -0.1? k Let z be 7/(-31)10/(-4). Let h = z + -2/31. Suppose -7x + 2x - 15 = 0. Which is the third biggest value? (a) x (b) h (c) 0 a Let t = 40.9 - 43. Let h = t - -1.1. Let p = -6.4 + 6. What is the smallest value in h, -0.3, p? h Let i(k) = k - 13. Let y be i(-6). Let r = 19 + y. Suppose -3h + 2s - 19 = r, 3h + h + s = -7. Which is the second biggest value? (a) -1 (b) 0 (c) h a Let g = -2 - -3. Let l = g - -2. Let a = -219/2 + 110. What is the second biggest value in a, 0.3, l? a Let g = -0.02 + 1.36. Let q = g + -0.34. Which is the third smallest value? (a) -4 (b) q (c) 5/3 (d) 0.3 b Suppose 5t - t + 16 = 0. Let v = -529.3 - -529. Which is the biggest value? (a) v (b) 4 (c) -5 (d) t b Let g = 134 + -131. Which is the third smallest value? (a) g (b) 220 (c) 1 b Let w = 11/282 - -37/658. Let t = 0.3 + -0.3. Let c = t - -0.2. What is the third smallest value in -3/2, w, c? c Let c = 69 + -66. Suppose -4 = -cr - 10. What is the biggest value in 0, r, 0.5? 0.5 Let q = -0.7 - 0.3. Let g = 1.321 + 87.579. Let h = g + -89. Which is the smallest value? (a) -4 (b) h (c) q a Let h be (3 + (-16)/5)4. Let y = 8.06 - 8. Let v = 0.46 - y. Which is the third smallest value? (a) v (b) -2 (c) h a Let l = -1497 - -1481.94. Let b = l + 15. Let v = b - -0.16. What is the third biggest value in v, 0.5, -4? -4 Let j = 0.1498 + -0.0498. Let l = 0.1 - 0.5. Let k = -0.1 + l. Which is the second smallest value? (a) j (b) k (c) 3 a Let p be 11(-3)/9(18 + -3). What is the smallest value in -0.2, p, -2/3? p Let r = -0.15 - 0.15. Let t = -47.97 + 48. What is the second biggest value in t, -1/6, r? -1/6 Suppose 8 = 4g - 0g. Suppose 4v = v + 3. Let t be (-6)/(-10)(-1)/v. Which is the biggest value? (a) t (b) -2 (c) g c Let v = 140 + -144. Which is the fourth smallest value? (a) -5 (b) 15 (c) v (d) 2/9 b Let t = -30 - -28.1. Let g = 1.1 - t. Let o = -18.981 - 0.019. What is the third biggest value in o, g, 5? o Let t = 188 - 183. Let m = 37/120 + 1/40. Which is the second biggest value? (a) m (b) t (c) 2/9 a Let u be 2/(-3) + 12/15. Let f be -3 + 0 + ((-4)/(-2))/(80/115). Which is the third smallest value? (a) u (b) f (c) -7 (d) -0.5 b Let j be (-31)/(27/12). Let a = 0.024 - 1.344. Let n = a + -0.68. What is the third biggest value in n, j, 1? n Let d = -2947/3 + 982. What is the third biggest value in d, -1/11, 1/6, 1? -1/11 Let s = 0.1 + -5.1. Let i be (8/(-22))/(26 - 28). Which is the biggest value? (a) s (b) 1 (c) i b Let r = -35.777 + 35.4. Let b = -0.023 + r. What is the second biggest value in 0.1, -5, b, 1/7? 0.1 Let q = -0.33 - -2.93. Let p = -3 + q. Let u = 0.11 + -0.11. Which is the third biggest value? (a) u (b) p (c) 0.4 b Let n = -429.9 - -430. What is the third biggest value in 0.17, n, -0.1? -0.1 Let w be (-2)/(2 + -3)1. Let d = -6.6 - -6.4. Which is the second biggest value? (a) w (b) d (c) 0.3 c Let n = 27618/595 + -232/5. Which is the second smallest value? (a) n (b) -1 (c) 0.4 a Suppose 4m - 3k = 749, 488 - 121 = 2m + k. Let g be 8/28 + m/(-35). What is the second smallest value in -2, -2/19, g, 6? -2 Let i be (54/(-24) + 2)/(3/6). Let p = -7 + 7. Which is the third biggest value? (a) -0.01 (b) p (c) 0.4 (d) i a Let u = 4.87 - -0.13. Let p = 4.2 - u. Let x = 0.5 + p. Which is the second smallest value? (a) 4 (b) -5 (c) x c Let r = -0.2 + 0. Let d = 206.7 - 207. Let n be (2/5)/(3/(-45)). What is the third smallest value in r, d, n? r Suppose a = 4n - 112, -3n + 69 = -4a - 28. Let c = n + -298/11. What is the third smallest value in c, 4, -4? 4 Let m = 0.036 + 4.964. What is the second smallest value in 2, m, 0.21? 2 Suppose 0 = 4f - 4d - 4, 2f + 48 = 4d + 40. What is the second biggest value in -1, -4, f? -1 Let d = -18.01 + 16.31. What is the biggest value in -4, d, -1? -1 Let b = -436 - -437. Let q = 6 + -7. What is the biggest value in 4/3, -0.5, q, b? 4/3 Let z = -24.9 + 25.9. What is the fourth smallest value in 4, 5, 2, z? 5 Let k be -3(1 - 2)-1. Let j = 8.3 + 2.7. Let n = -7446 - -7446.2. Which is the second smallest value? (a) j (b) n (c) k b Let s = -1.255 + 1.435. Which is the third biggest value? (a) 2/9 (b) 0.24 (c) s c Let x = 0.1 + 0.1. Let i = 9.99 - 10. Let w(l) = l3 + 2l - 31. Let z be w(3). Which is the biggest value? (a) i (b) x (c) z c Let h = 1.4 + -1.2. Let d = -0.89 + 1.29. What is the second biggest value in 0.01, d, h? h Suppose 17b - 24b - 28 = 0. What is the smallest value in b, 10, 5? b Let k = -2.403 - 0.767. Let h = 1.17 + k. Suppose 4z - s - 3 = 0, -z + 3z + 5s - 29 = 0. Which is the second smallest value? (a) h (b) z (c) -3/4 c Let q(f) = -f3 - 7f*2 - 6f + 2. Let l be q(-6). Let h = -1333 - -1336. Which is the biggest value? (a) -3 (b) l (c) -0.01 (d) h d Let p(x) = 23x - 150. Let j be p(7). Which is the second biggest value? (a) 0 (b) j (c) 8 (d) -5 c Let q = 0.976 + 0.024. Let y be 46(-3)/(-42) + -3. Which is the biggest value? (a) 0.2 (b) y (c) q (d) 0.5 c Let s = 42 - 42.1. What is the third biggest value in 1/5, s, 6/11? s Suppose 0 = -0i - 5i. Let q = -1853 + 1860. What is the third biggest value in q, i, 3/7, -0.5? i Suppose 19x + 65 = 6x. What is the second biggest value in 0.5, 5, x, -3? 0.5 Suppose -11t = -17t + 546. Let g = t + -272/3. Which is the third biggest value? (a) g (b) 8 (c) 2 (d) -2 a Suppose -o - 42 = -22o. Which is the third biggest value? (a) o (b) 2/7 (c) 67 (d) 4 a Let u = 903 - 823.8. Let j = u + -68. Let a = 11 - j. What is the third biggest value in a, 2/7, 2/3? a Let x = 147 - 147.73. Let q = -0.29 - x. Let d = -0.06 - q. Which is the smallest value? (a) d (b) -5 (c) 3 b Let i = 1.3 - 0.3. Let m = -5.4 + 7. Let o = -3.6 + m. What is the second smallest value in i, -4, o? o Let y(d) = 13d*2 - 27d + 2. Let i be y(2). What is the second smallest value in 325/2, i, 0.1? 0.1 Let f = 6 + -10. Let v be (-7 - 63/(-27))/((-4)/6). What is the third biggest value in f, v, 1/7? f Let y = -1.13 - -1.13. Which is the fourth biggest value? (a) y (b) 0.2 (c) 2/11 (d) -5 d Let y = 408.7 - 409. Let l = -1.3 + 9.3. Which is the smallest value? (a) l (b) 2 (c) y (d) -4 d Let k be 4/7 + -4 + 156/42. Let z = 0.07 - 5.07. Let j be (-1)/4 - (-42)/8. Which is the smallest value? (a) z (b) k (c) j a Let y = 32.53 + -2.73. Let g = y + -24. Let c = -0.8 + g. What is the second smallest value in 0.2, c, -3? 0.2 Suppose 0 = -2r - 3m - 1 - 9, -3r + 3m = -15. What is the third smallest value in 9/7, -1, r? 9/7 Let x = 272.12 + -272. What is the second biggest value in -5, -2, x? -2 Let n = 3 - 4. Let d be 152/(-136) + (0 - n). Let h = -4.3 - 0.7. What is the second smallest value in h, 3/2, d? d Let y be (55/75)/((-14)/(-12)). Which is the third smallest value? (a) 13 (b) 1 (c) y (d) -0.4 b Let m be 2/(-5) + (-8)/5. Let p(c) = 4c + 22. Let q(r) = -5r - 27. Let y(v) = 6p(v) + 5*q(v). Let g be y(m). What is the third smallest value in 0, g, 1/2? 1/2 Let d = -25113686/86595 + -278/3765. Let f = d + 477739/1656. Let j = -5/72 + f. Which is the third biggest value? (a) -3 (b) 3 (c) j a Let z = -658/15 - -44. Let b = 5.3 - 5. Let p = -1/407 + -399/3256. What is the second biggest value in z, p, b? z Let m be (6 + 87/(-15))/((-12)/(-10)). Let g = -34/5 - -7. Let j = 0.03 + -1.03. Which is the second biggest value? (a) j (b) g (c) m c Let l = -156 - -155.6. What is the smallest value in -0.1, -0.3, l? l Let y = 229 + -228. What is the third smallest value in -3.1, 0.1, y? y Let j = -164 - -162.06. Let x = -2 - j. Let o = 0.53	{ "pile_set_name": "DM Mathematics" }
). 18 Suppose -2n + 5 = -1. Suppose 0 = 29u - 17 - 34 + 22. What is the smallest common multiple of u and n? 3 Let v(i) = -2i2 + 58i - 1. Let x be v(30). Let w = 69 + x. Calculate the least common multiple of w and 36. 72 Calculate the common denominator of (-13)/((-702)/(-4))(3 - (-637)/(-28)) and 25/4818. 43362 Let t(f) = -21 - 25 + 2f - 31f + 7f. Calculate the smallest common multiple of t(-4) and 35. 210 Let i be (-22 + 6)(-15 - -9). Suppose -285l = -277l - i. What is the lowest common multiple of l and 111? 444 Suppose -11x - 257 - 1437 = 0. What is the lowest common multiple of 3/((-7)/(x/3)) and 74? 814 Let n = -8989 - -9019. Calculate the lowest common multiple of 2685 and n. 5370 Let s = 3552134 - 16048541483/4518. What is the common denominator of s and -5/5271? 31626 Let n be (2/6)/((-4)/22804). Let c = n - -1880. Find the common denominator of c and (20076/252 - 79)117/(-8). 12 Suppose -272c + 10229 = -257c - 1561. Calculate the smallest common multiple of c and 2358. 2358 Suppose 0 = 3a + 5o - 1260, -5a + o - 732 = -2832. Calculate the least common multiple of 128 and a. 13440 Suppose 86 = 31g - 33g - 2n, 3n - 215 = 5g. Let o = -2645 + 21085/8. Find the common denominator of o and (-6)/51 + (-57)/(-408)g. 8 Let n = 519 - 549. Calculate the common denominator of 37/10 and 28/n115/60. 90 Let n(h) = 10h3 + h2 - 28h + 62. Let q(b) = -5b - 1. Let f be q(-1). Suppose -r + 45 = fr. Calculate the lowest common multiple of r and n(2). 90 Let x(a) = -a3 + 43a*2 - 94a + 56. Calculate the lowest common multiple of 8 and x(40). 1096 Calculate the common denominator of (-969)/(-741)1/40 and -119/20. 520 Suppose 1787t + 25 = 1768t + 1697. Let h(c) = 6c - 4. What is the smallest common multiple of t and h(6)? 352 Suppose -7q = -4q. Suppose q = n - 8 + 10. Find the common denominator of -87/10 and (n/24)/(4/(-1192)). 30 Suppose -t + 2b = -54, -4b = 10t - 5t - 186. Let j = -22 - -36. Let m = 24 - j. Calculate the lowest common multiple of t and m. 210 Let g(r) = 2r2 - 25r + 94. What is the smallest common multiple of 214 and g(7)? 3638 Suppose -4n - 4a = -0a - 2876, -3n + 2177 = -2a. Calculate the smallest common multiple of 48 and n. 11568 Calculate the lowest common multiple of 160 and 28/2178/(-104)-65. 2080 Let s = -889/186 + -43/31. Let p = 17524873/120 - 146042. Find the common denominator of p and s. 120 Let x(j) = 50j3 + j2. Let n be x(1). Let s = 367/4 + -87. Find the common denominator of s and n/77/10. 20 Let s(d) = -2d*2. Let p(n) = 11n*2 + 12n + 1. Let r(m) = -p(m) - 6s(m). What is the smallest common multiple of r(15) and 33? 132 Let v(w) = -w3 - w2 - 27w + 4835. What is the smallest common multiple of v(0) and 3? 14505 Let f = 10397/59 + -38107/236. Let r = -543/13 - 1631/26. Let q = r - -388/3. Find the common denominator of f and q. 12 Suppose 0 = 7b - 4 + 249. Let m be 7/((-49)/(-270)) - 15/b. Suppose -m = -r - 10. Calculate the least common multiple of r and 1. 29 Let l(s) = 18s + 30. Let n be l(-3). Find the common denominator of -23/9 and (-3)/n + 1455/40. 18 Let t = -4627 + 4864. Calculate the lowest common multiple of 869 and t. 2607 Let m be (-6)/(-5) - (7 + (-408)/60). Find the common denominator of (m/25)/(336/5110) and -55/8. 120 Let k = -11898/11 + 95569/88. Calculate the common denominator of -59/16986 and k. 67944 Suppose 2l + 1345 = 1347, -2l + 2927 = 5m. Calculate the smallest common multiple of 39 and m. 585 Let x = -83118/13 + 8975171/1404. Let w = 165013/14349 - -1/28698. Find the common denominator of w and x. 108 Let u = 10451602/6245 - 8368/5. Let q = -81281/19984 - u. Find the common denominator of q and -3/94. 752 Let w = 28474241/3778830770 - 18/332585. Find the common denominator of w and 47/9. 102258 Let a be ((-44175646)/(-912))/(((-27)/(-2))/3). Let r = 10763 - a. Calculate the common denominator of 125/6 and r. 108 Suppose -6073 = -19h + 6562. Let v = -657 + h. What is the smallest common multiple of 4 and v? 8 What is the common denominator of (-161)/16560012327 + 12 and 31/1500? 12000 Suppose 0 = -39r - 1729 + 1885. Let b = -2 - -3. Suppose k + b - 11 = 4z, -k = -3z - 9. What is the smallest common multiple of r and k? 12 Let i be (20/6)/(1/(-6)). Let m be i((-384)/36 + (-2)/(-3)). Suppose 7 = o + 3, m = 3k + 2o. Calculate the smallest common multiple of k and 28. 448 Let j = -172624/374395 - -28/2815. What is the common denominator of j and 63/152? 1064 Let f(j) = -j2 - 193j + 4544. Calculate the least common multiple of (0 + (-1 - -2))5 and f(21). 50 Suppose 0 = -5p - 2s + 5596, 9p - 5s + 2272 = 11p. What is the least common multiple of p and 1116? 1116 Let v = 47 + -34. What is the common denominator of (-70)/(-18) - 30/(-15) and (2/3 - 1)/(2/v)? 18 Calculate the common denominator of -43/4193 and (5539/(-2865))/((-14)/10). 12579 Suppose -33s + 35s - 84 = 0. Calculate the least common multiple of s and (-702)/(-45) + 80/(-50). 42 Let c = 46/245 + -751/294. Calculate the common denominator of ((-78)/45 + 3)12/(6 + -2) and c. 30 Let a = 597 - 556. Let f(v) = 4v - 132. What is the lowest common multiple of f(a) and (-1011)/(-1)? 160 Let b(n) = n + 10. Let o be b(-3). Let w be 3021/133 - (-2)/o. Let x = -7 + w. Calculate the smallest common multiple of 44 and x. 176 Let z = 399 + -317. Suppose 85d = zd - 5x - 16, d - 5x - 28 = 0. What is the least common multiple of 174 and d? 174 Calculate the least common multiple of (-24)/(-32) + 1149/4 and 396. 3168 Suppose 23 = y + 4k, 4y = -y + k + 10. Suppose 5i - 1060 = -s, 704 = yi + 2s + 61. Calculate the smallest common multiple of i and 1. 211 What is the lowest common multiple of (8 + 0)(166 - ((0 - 2) + 12)) and 624? 1248 Let v = 12 + -4. Suppose -3 = -3o - 0o + 2a, 0 = -5a - 15. Let j = o + 5. Calculate the lowest common multiple of v and j. 8 Let t = -13/491 - 953/19640. Calculate the common denominator of 45/44 and t. 440 Let g(n) = -2186n - 19656. Suppose -q + 510 = q. Calculate the least common multiple of q and g(-9). 1530 Let l be ((-3)/(32))/((-114)/1886510). Let p = l + -8292. What is the common denominator of p and 29/622? 1866 Suppose -3w = -0w - 66. Suppose 3n - w = -7. Suppose u + 2 - 10 = 0. Calculate the smallest common multiple of u and n. 40 Let o(r) = 11r - 1. Calculate the lowest common multiple of 4336320/12320 + (-10)/(-385) and o(1). 1760 Let f be (-2)/(-18) - (-8)/(-72). Suppose f = 2u - 4u + 66. Find the common denominator of -34/21 and (-2)/(2/3) - 39/u. 231 Let s = -17761/5 + 1136289/320. Find the common denominator of s and (-7250)/(-8960) + (-4)/14. 128 Let i = 110138496089/13234 - 8322389. What is the common denominator of -41/12 and i? 79404 Suppose -4w + 153 = -w. What is the smallest common multiple of w and 84 - (-163)/((-3097)/1026)? 510 Let r = -435 + 441. Suppose -p - 204 = -4s + 130, 3p - r = 0. Calculate the lowest common multiple of 4 and s. 84 Suppose c - 27 = 13. Suppose -5i = 25, 0 = f - 2f + 2f + 2i. Calculate the smallest common multiple of c and f. 40 What is the common denominator of (-2)/7 - (-564)/952 and 9/24(-130)/3? 476 Suppose -52i - 10 = -53i. Suppose 2o - 20 = 5k - 4, -4o + 4 = 4k. Suppose 4 = -4v, 2 + 3 = oz + v. Calculate the smallest common multiple of i and z. 10 Suppose 17 = 5g - 8, -39 = -p - 3g. Calculate the smallest common multiple of p and 108. 216 Let q = 8103 + -251144/31. What is the common denominator of 50/231 and q? 7161 Let k = -46749944851/9423491000 - -6/9423491. Let u = k - -42/125. Find the common denominator of -97/44 and u. 88 Let a(u) = u*2 + 51 + 545u - 6u2 - 568u + 4u2. What is the smallest common multiple of 27 and a(-24)? 27 Let t = -1 - -13. Suppose -d + 5240 = 5l, 0 = -2l - 0l - 4d + 2114. Suppose -21i + 675 = -l. What is the lowest common multiple of i and t? 492 Let f = -8187/7 + 1172. Let s(i) = -50i2 + i - 1. Let o be s(-1). Calculate the common denominator of o/9 - (-1 + 3)/(-1) and f. 63 Suppose 0 = -2w + g + 5, 5w - 5g + 354 = 349. Calculate the lowest common multiple of w and 3264. 3264 Suppose 7 = 3q - 2l + 1, -4q + 5l = -8. Let v be (-3)/q*2 - (-355)/135. Let a = -565/432 - v. Find the commo	{ "pile_set_name": "DM Mathematics" }
47 List the prime factors of 7226128. 2, 7, 13, 709 What are the prime factors of 24306344? 2, 3038293 What are the prime factors of 15594596? 2, 41, 95089 List the prime factors of 423037. 127, 3331 What are the prime factors of 2634750? 2, 3, 5, 1171 What are the prime factors of 29194? 2, 11, 1327 List the prime factors of 4502760. 2, 3, 5, 157, 239 What are the prime factors of 9163385? 5, 7, 11, 23801 What are the prime factors of 24564119? 59, 223, 1867 What are the prime factors of 29329255? 5, 19, 23, 31, 433 List the prime factors of 291725. 5, 7, 1667 What are the prime factors of 1478706? 2, 3, 41, 6011 List the prime factors of 474062. 2, 17, 73, 191 List the prime factors of 166694. 2, 11, 7577 What are the prime factors of 54858? 2, 3, 41, 223 What are the prime factors of 328777? 328777 What are the prime factors of 5910031? 1231, 4801 What are the prime factors of 74681? 17, 23, 191 What are the prime factors of 345403? 47, 7349 What are the prime factors of 93534? 2, 3, 7, 17, 131 List the prime factors of 5068520. 2, 5, 126713 What are the prime factors of 8573888? 2, 133967 List the prime factors of 164857. 7, 11, 2141 List the prime factors of 2168043. 3, 83, 8707 List the prime factors of 27755. 5, 7, 13, 61 What are the prime factors of 187320? 2, 3, 5, 7, 223 List the prime factors of 203910. 2, 3, 5, 7, 971 What are the prime factors of 1285123? 7, 26227 What are the prime factors of 38032073? 71, 535663 What are the prime factors of 446946? 2, 3, 163, 457 List the prime factors of 20405019. 3, 37, 183829 What are the prime factors of 4034289? 3, 7, 19, 10111 List the prime factors of 7251980. 2, 5, 362599 What are the prime factors of 11690874? 2, 3, 13, 47, 1063 List the prime factors of 640430. 2, 5, 7, 1307 List the prime factors of 31171. 7, 61, 73 What are the prime factors of 2310600? 2, 3, 5, 3851 List the prime factors of 444355. 5, 181, 491 List the prime factors of 2851670. 2, 5, 199, 1433 List the prime factors of 12082338. 2, 3, 223747 List the prime factors of 85552. 2, 5347 What are the prime factors of 38741949? 3, 1434887 What are the prime factors of 7640075? 5, 305603 List the prime factors of 1653915. 3, 5, 110261 What are the prime factors of 7337513? 269, 27277 List the prime factors of 692136. 2, 3, 9613 What are the prime factors of 287653? 179, 1607 List the prime factors of 8891850. 2, 3, 5, 11, 17, 317 List the prime factors of 482640. 2, 3, 5, 2011 What are the prime factors of 6332575? 5, 439, 577 List the prime factors of 3182280. 2, 3, 5, 23, 1153 What are the prime factors of 17540161? 2339, 7499 List the prime factors of 4448624. 2, 31, 8969 List the prime factors of 1293666. 2, 3, 11, 17, 1153 List the prime factors of 65571. 3, 11, 1987 What are the prime factors of 283694? 2, 83, 1709 What are the prime factors of 112438? 2, 17, 3307 What are the prime factors of 3161521? 11, 97, 2963 What are the prime factors of 621402? 2, 3, 103567 List the prime factors of 9328. 2, 11, 53 What are the prime factors of 664712? 2, 83089 What are the prime factors of 12157629? 3, 11, 601, 613 What are the prime factors of 1089144? 2, 3, 7, 2161 List the prime factors of 9772107. 3, 37, 88037 List the prime factors of 19345618. 2, 293, 33013 List the prime factors of 121321. 121321 List the prime factors of 653830. 2, 5, 151, 433 What are the prime factors of 224550? 2, 3, 5, 499 List the prime factors of 101421. 3, 59, 191 List the prime factors of 2682606. 2, 3, 447101 List the prime factors of 2706647. 691, 3917 List the prime factors of 139824. 2, 3, 971 What are the prime factors of 468480? 2, 3, 5, 61 List the prime factors of 2802284. 2, 700571 List the prime factors of 1453803. 3, 13, 37277 What are the prime factors of 368128? 2, 719 List the prime factors of 3575066. 2, 11, 17, 79 List the prime factors of 352053. 3, 13, 17, 59 List the prime factors of 4673010. 2, 3, 5, 53, 2939 What are the prime factors of 11820? 2, 3, 5, 197 List the prime factors of 10542403. 10542403 What are the prime factors of 546831? 3, 43, 157 List the prime factors of 2556411. 3, 11, 13, 59, 101 What are the prime factors of 1612105? 5, 11, 29311 What are the prime factors of 21758573? 21758573 List the prime factors of 13569036. 2, 3, 13, 86981 What are the prime factors of 16253128? 2, 67, 30323 List the prime factors of 866872. 2, 108359 List the prime factors of 9676740. 2, 3, 5, 17, 53, 179 List the prime factors of 1313618. 2, 656809 What are the prime factors of 3637229? 67, 54287 List the prime factors of 1716499. 1716499 What are the prime factors of 207836? 2, 223, 233 List the prime factors of 7315019. 19, 385001 What are the prime factors of 33011? 11, 3001 What are the prime factors of 44386? 2, 22193 What are the prime factors of 150095? 5, 11, 2729 What are the prime factors of 16744417? 2069, 8093 What are the prime factors of 264118? 2, 132059 List the prime factors of 8252662. 2, 11, 375121 What are the prime factors of 10572235? 5, 877, 2411 List the prime factors of 1533621. 3, 17, 30071 List the prime factors of 34306796. 2, 8576699 List the prime factors of 858066. 2, 3, 11, 13001 What are the prime factors of 37321571? 7, 23, 59, 3929 What are the prime factors of 454235? 5, 90847 List the prime factors of 4570394. 2, 337, 6781 What are the prime factors of 77361? 3, 107, 241 What are the prime factors of 1530501? 3, 7, 31, 2351 List the prime factors of 6365610. 2, 3, 5, 70729 What are the prime factors of 3708667? 19, 195193 What are the prime factors of 2214077? 2214077 What are the prime factors of 2952642? 2, 3, 7, 11, 83 List the prime factors of 300299. 300299 What are the prime factors of 110791? 23, 4817 List the prime factors of 852588. 2, 3, 11, 2153 List the prime factors of 98430. 2, 3, 5, 17, 193 What are the prime factors of 2045498? 2, 7, 13, 11239 List the prime factors of 7046240. 2, 5, 47, 937 What are the prime factors of 8642602? 2, 61, 70841 What are the prime factors of 263883? 3, 87961 What are the prime factors of 35459199? 3, 29, 135859 What are the prime factors of 12469272? 2, 3, 519553 What are the prime factors of 6509131? 107, 127, 479 List the prime factors of 321769. 7, 43, 1069 List the prime factors of 3097756. 2, 774439 What are the prime factors of 113797? 113797 What are the prime factors of 17657912? 2, 167, 13217 What are the prime factors of 887960? 2, 5, 79, 281 What are the prime factors of 428786? 2, 269, 797 List the prime factors of 6313520. 2, 5, 78919 What are the prime factors of 4340737? 4340737 What are the prime factors of 625553? 97, 6449 List the prime factors of 10087887. 3, 331, 10159 What are the prime factors of 74325? 3, 5, 991 What are the prime factors of 28643? 28643 What are the prime factors of 1495760? 2, 5, 7, 2671 List the prime factors of 2149625. 5, 29, 593 What are the prime factors of 2409181? 19, 23, 37, 149 List the prime factors of 4049816. 2, 41, 12347 What are the prime factors of 997566? 2, 3, 53, 3137 List the prime factors of 450075. 3, 5, 17, 353 List the prime factors of 37568. 2, 587 What are the prime factors of 983351? 31, 31721 List the prime factors of 21501930. 2, 3, 5, 716731 What are the prime factors of 341203? 341203 List the prime factors of 5857014. 2, 3, 29, 41, 821 What are the prime factors of 296150? 2, 5, 5923 What are the prime factors of 501654? 2, 3, 83609 What are the prime factors of 303323? 303323 What are the prime factors of 43187? 19, 2273 List the prime factors of 827525. 5, 79, 419 List the prime factors of 53958. 2, 3, 17, 23 List the prime factors of 317581. 11, 28871 List the prime factors of 61983. 3, 71, 97 What are the prime factors of 2228418? 2, 3, 29, 1423 What are the prime factors of 43847? 163, 269 List the prime factors of 6344417. 17, 29, 757 What are the prime factors of 67954? 2, 61, 557 List the prime factors of 185601. 3, 13, 4759 List the prime factors of 2816913. 3, 11, 85361 List the prime factors of 163406. 2, 81703 List the prime factors of 1664303. 23, 269 List the prime factors of 25375323. 3, 8458441 List the prime factors of 29455563. 3, 1699, 5779 What are the prime factors of 344650? 2, 5, 61, 113 What are the prime factors of 358889? 191, 1879 List	{ "pile_set_name": "DM Mathematics" }
4). Calculate the common denominator of -47/2 and 6/z - (-483)/(-60). 20 Let t(s) = -s*3 - 8s*2 + 6. Let k be t(-8). Find the common denominator of 11/9 and 129/k(-2)/11. 99 Suppose -k + 10 = 4. What is the least common multiple of k and 32? 96 Let w be 83/(-53)7/(-4). Let o be (2/(-424))/(1/2). Let f = w - o. Calculate the common denominator of f and 61/4. 4 Let r be (35/6)/(2/(-4)). Let q = -13 - r. Find the common denominator of 11/3 and q. 3 Suppose l = 4l - 12. Suppose 0 = -q + m + 17, -2q + lm + m + 19 = 0. Calculate the smallest common multiple of 38/(-6)-2 and q. 88 Let s(w) = w - 4. Let l be s(6). Let k(t) = t + 9. What is the smallest common multiple of (-10)/((1 - l)1) and k(-5)? 20 Let o be 2/(-8) - (-9)/4. What is the lowest common multiple of 20 and (-8)/(-10)55/o? 220 Suppose 5c + 2090 = 465. Find the common denominator of -45/14 and c/(-880) - (-4)/(-22). 112 Suppose 5t = 3i + 65, -3t + 35 = t + i. Suppose -z - 3z = -72. Suppose f = -2l + 2, 2f = -0l + 3l + z. What is the least common multiple of f and t? 30 Let v = 11 + -9. Let l(h) = h2 + 3h - 7. Let f be l(-5). Suppose 2 + 40 = fa. Calculate the least common multiple of a and v. 14 Let c be 357/12 - (-1)/4. Suppose c = 4g - 2. Calculate the least common multiple of 9 - 6 - -31 and g. 24 Let i be ((-22)/(-4))/((-1)/(-2)). Let o = -5 + i. What is the lowest common multiple of o and 1? 6 Let s(z) = z3 - 7z*2 - 2z - 6. Let u be s(7). Find the common denominator of 101/(-3)(-6)/u and -65/8. 40 Let n(c) = c2 + 6c - 7. What is the least common multiple of n(-8) and (-9)/(-1 + 4 - 4)? 9 Suppose 2l - 3n + 5 = 0, 2l - n - 5 = -0l. Suppose lb + 80 = 3b. Let p = 8741/798 + -16/133. Calculate the common denominator of p and b. 6 Let l(o) = -o - 1. Let u be l(-6). Let v = 182507/198 - 8324/9. Calculate the common denominator of v and 1/u455/10. 110 Suppose -4r = -0o + 4o - 220, -131 = -2r + 5o. Let b = -40 + r. What is the lowest common multiple of 10 and b? 90 Let t(y) = 163y2 + y + 11. Let h be t(9). Let g = h + -132341/10. Calculate the common denominator of -23/6 and g. 30 Let m(w) = 6w*2 + 5w + 3. Let v be m(-3). Find the common denominator of -1 - (v/(-20))/(-3) and ((-5662)/(-280))/19 - (-4)/14. 20 Let u = 10 + -5. Let z = -19 + 30. What is the lowest common multiple of z and u? 55 Let j = 1235/87 - 54/29. Calculate the common denominator of j and 30. 3 Find the common denominator of (-20)/(-50) + (-383)/(-130) and -125/12. 156 Let g(a) = -a*2 - 16a + 1. Find the common denominator of 55/3 and g(-13). 3 Suppose 4q + 0q - 4 = 0. Find the common denominator of q3 - (-87)/18 and 115/6. 6 Let v be (-440)/(-24) + (-2)/6. What is the common denominator of -151/18 and 152/v - 2/4? 18 Let j = 92 - 72. What is the smallest common multiple of j and 18? 180 Let i(t) = 15t - 89. Calculate the smallest common multiple of i(7) and 1/(-2) + (-13)/(-2). 48 Let z = 16 + 8. Calculate the lowest common multiple of 4 and z. 24 Let j be 20123/15(-6)/8. Let k = -1009 - j. Find the common denominator of k and (1 + -10)85/60. 20 Let w(c) = c. Suppose 0 = 15d - 10d - 40. What is the lowest common multiple of d and w(6)? 24 Let n = -254 + 531/2. Calculate the common denominator of n and 99/10. 10 Suppose -4k - 4o = 19 + 1, 0 = 5o. What is the common denominator of ((-109)/(-22))/(-1) - -2 and (-201)/16k/(-15)? 176 Let q be (-232)/(((-12)/(-1887))/4). Let x be q/(-48) + (-3)/(-4). Let r = 3043 - x. Find the common denominator of -31/10 and r. 60 What is the common denominator of -29 and (-62)/(-66) - (-3 - -2)? 33 Let p = 57 + -101. Let d = -1/1704 - -31099/1704. What is the common denominator of (-129)/p + 1/(-4) and d? 44 Let w = 1687/10 + -167. Let n = 1487 + -5849/4. Find the common denominator of n and w. 20 Let w = 45 - 363/8. Calculate the common denominator of -37/32 and w. 32 What is the smallest common multiple of 5 and 4/6(1215/(-6))/(-9)? 15 Let z = 1743 + -8758/5. Let j be (16)/((-32)/(-22570)). Let k = -4242 + j. Find the common denominator of z and k. 40 Let z(k) = k*2 + 3k + 2. Let g be z(-4). What is the least common multiple of 20 and (-3)/g2 - -21? 20 Let o(l) = -l3 + 12l*2 + 2l - 12. What is the least common multiple of (-4)/(-3 + 1 + 0) and o(12)? 12 Let o(u) = -u*3 + 4u*2 - 2u. Suppose 5a = -0a - 10. Calculate the least common multiple of (-18)/(-3) + a + 2 and o(2). 12 Let g be 19681/20262 + (-4)/(-24). Let q = -1/614 + g. Calculate the common denominator of 13/12 and q. 132 Suppose -l + 41 = 17. Calculate the lowest common multiple of 12 and l. 24 Let j = -15864 + 285415/18. Find the common denominator of -29/2 and j. 18 Suppose 2k + 5r = k + 27, 0 = -4k - 2r + 90. What is the smallest common multiple of 8 and k? 88 Suppose 23 = 5w - 4w. Let u = 41 - w. Calculate the smallest common multiple of u and 20. 180 Let p = -9189790016/45152021 + -1704/75379. Let z = 85534271/67088 - p. Let k = z + -10322/7. What is the common denominator of -103/18 and k? 144 Let w = -1049/3 - -23141/66. Calculate the common denominator of (-286)/12 - 2/3 and w. 22 Suppose -2f = 3 + 1. Let m(d) = -402d*3 + 3d*2 + 2d + 3. Let n be m(f). Let v = n - 16186/5. What is the common denominator of -45/2 and v? 10 Let o = -2573 - -84850/33. What is the common denominator of -50/3 and o? 33 Suppose 0 = -3l + 1 + 5. Suppose 0 = 2q - 5c - 6, -2q = lq + 3c - 38. Calculate the least common multiple of q and 14. 56 Let x(l) = -l*3 - 8l*2 - 3l + 6. Let p be x(-8). Calculate the common denominator of -61/12 and -1 - ((-171)/p - 3). 60 Let o(k) = 2k2 + 2k + 2. What is the least common multiple of o(-1) and 5? 10 Let y = 2 - 0. Suppose 12 = 3j + 2i, 2j + 3j + 3i - 19 = 0. Suppose s + j - 4 = 0. What is the lowest common multiple of y and s? 2 Let v = -29 - -31. Calculate the lowest common multiple of 10 and v. 10 Let u(x) = -1097x + 1. Let q be u(-2). Calculate the common denominator of 139/6 and q/50 - (-4)/(-10). 6 Let q(w) = -108w. Let f be q(-3). Let s be (-4)/(-26) - f/2275. Let o = s - 2311/3150. What is the common denominator of 97/2 and o? 18 Let t = -647/4 - -159. What is the common denominator of t and 69/10? 20 Suppose -r = 40 - 120. Suppose 4g + 3o - 82 = 6o, -4o = -4g + r. Suppose 0n = 3n - 30. Calculate the lowest common multiple of g and n. 110 Let p(a) = a3 - a2 + 10. What is the smallest common multiple of p(0) and (0 - 2) + (-44)/(-2)? 20 Let l be -33 + -3 + 0 + 0. Let d = 59/132 - 7/12. What is the common denominator of d and (-110)/l - (-6)/(-18)? 198 Let p be (17/(-9220))/(7/(-26198)). Let b = p - 2/3227. What is the common denominator of b and (-9)/(-10)-3 - 0? 10 Let c = 25 - 21. Calculate the common denominator of 81/20 and c/(-14) - 9945/(-5236). 220 Let o(n) = -n2 + 4n*2 + 4 + 7n + n*3 + 2n*2. Let a = 239/42 - 11/21. Find the common denominator of a and o(-4). 6 Suppose 28 = 3s - 5g, -3s + 8s - g = 32. Suppose -2d - 56 = -4b, -2d + 2b = 26 + 38. Let i = -26 - d. Calculate the lowest common multiple of i and s. 30 Let t = 559/36 + -250/9. Calculate the common denominator of 127/48 and t. 48 Let j be 1 + 0 + (-185)/(-20). Let a = 14 - j. What is the common denominator of a and -49/2? 4 Suppose 0 = 4t - 4k - 12, -5t + k = -0k - 27. What is the lowest common multiple of 14 and t? 42 What is the common denominator of 97/12 and 1 + (-418)/(-138) - (3 - 0)? 276 Let g(d) = d3 + 6d*2 - 8d + 3. What is the smallest common multiple of 1 and g(-7)? 10 Let g = -6 - -36. What is the least common multiple of 7 and g? 210 Calculate the common denominator of -25/24 and (2/6)/1 - (-5)/(-3). 24 Let v = 2 - 6. What is the common denominator of v/(-10) - (-16)/110 and 35/9? 99 Let c = 713/8 - 91. Let g = -283/8 - c. What is the common denominator of 25/22 and g? 22 Let y(v) = -v + 4. Suppose -84 - 41 = -5g. Let a = g + -14. What is the least common multiple of y(3) and a? 11 Let t(v) = -43v3 - v2 + v + 1. Let l = 22 - 237/11. What is the common denominator of t(-1) and l? 11 Suppose -2x = -4k + 60, -19 - 17 = -2k - 2x. Suppose 0 = 4w + 36 - 140. Calculate the lowest common multiple of w and k. 208 Let x(v) = -v3 - 6v*2 + 3v. Let n be x(-4). Let q = n	{ "pile_set_name": "DM Mathematics" }
Let j = 90464 - f. Round j to the nearest 1000000. 0 Let a = -62.9 + 35.6. Let r = 6.9 + a. Let c = r + 13. Round c to the nearest integer. -7 Let n(w) = -7549w - 15. Let b be n(-5). What is b rounded to the nearest 10000? 40000 Let d = -39 + 39. Let p = 0.22 + d. What is p rounded to one decimal place? 0.2 Let v = -1722 - -1721.5581. Let y = v - 0.1011. Let x = y - -0.52. What is x rounded to 2 decimal places? -0.02 Suppose -4k + 731340 = 5r + 146360, 0 = -5r + k + 585005. What is r rounded to the nearest 10000? 120000 Let w = -33 - -84. Let q = w - 51.0000066. Round q to 6 dps. -0.000007 Let f = 764 + -764.000000842. Round f to seven dps. -0.0000008 Let v = -60.237137 + 0.246637. Let b = -60 - v. Round b to three decimal places. -0.01 Let l = 0.143 + -0.072. Let q = l + -32.071. Let i = 30.81 + q. What is i rounded to one decimal place? -1.2 Let g = -17 - -93. Let y = g - 70.9. What is y rounded to zero decimal places? 5 Let u(b) = 11b. Let o be u(-1). Let j be (-2)/o - 879996/(-22). What is j rounded to the nearest 100000? 0 Let m = 0.79 - -0.01. Let z = 26 + -25.26. Let k = z - m. What is k rounded to two dps? -0.06 Let s = -486.8 + 48.8. Let w = -256 - s. Let r = w + -181.07. Round r to one dp. 0.9 Let i(n) = 3n - 1. Let f be i(1). Suppose 2h = -5w + 4 - f, -3 = -2w - 3h. Suppose 2y + wy = 50000. Round y to the nearest 10000. 30000 Let j = 205 - 1036. Let h = j + 831.491. What is h rounded to one dp? 0.5 Let m(s) = -3s - 4. Let b be m(6). Let h = 13 + b. Let w(l) = 1889l + 1. Let f be w(h). Round f to the nearest ten thousand. -20000 Let b(i) = i*2 - 18i + 14. Let w be b(13). Let d = w + 442. Round d to the nearest ten. 390 Let k = -5 + 16. Suppose s = d - 2, -4d + 2s = s - k. Suppose 36 = 5q - dq - i, -4i - 42 = -2q. What is q rounded to the nearest 10? 20 Let k = 0.22 + -2.52. Let o = 0.301 - 2.5948. Let b = o - k. What is b rounded to three dps? 0.006 Let i = 156 + -106. Let w = 160349.1 + -160399.10102. Let z = i + w. What is z rounded to 4 dps? -0.001 Let t(k) = -74k + 341. Let y be t(6). What is y rounded to the nearest 100? -100 Let u = -998 + 998.0001466. What is u rounded to five decimal places? 0.00015 Let l = -0.039 - 0.021. Let n = -55.8720922 + 55.8121. Let j = l - n. What is j rounded to 6 dps? -0.000008 Let g = -18250 + 17396.79. Let p = g - 15.79. Let v = 869.0000397 + p. What is v rounded to 6 dps? 0.00004 Let l = -3.4808 + 4.154. Round l to 1 decimal place. 0.7 Let o = -12.38 + 9.9. Let q = o - -2.4800214. What is q rounded to 6 dps? 0.000021 Let x(d) be the second derivative of 2d*3/3 - 15d*2/2 - 9d. Let f be x(5). Suppose fy + 15315 = -204685. Round y to the nearest ten thousand. -40000 Let r = 6.1 + -6.39. What is r rounded to 2 dps? -0.29 Let k = 22 - 26.7. Let x = -3 - k. Round x to zero decimal places. 2 Let x = 1388252 - 3178252. What is x rounded to the nearest 1000000? -2000000 Let r = -131218.973276 - 0.026724. Let p = 131221.70055 + r. Let o = 2.7 - p. Round o to four dps. -0.0006 Let v = 4 - 3.979. Let d = 0.142 - v. What is d rounded to 1 dp? 0.1 Let p(q) = -76q*2 + 31q - 123. Let l be p(4). Round l to the nearest one hundred. -1200 Suppose 0 = -2k - k + 9. Let b(g) = 233334g*3 - 2g*2. Let n be b(k). What is n rounded to the nearest one million? 6000000 Let f = -227.6 + 167. Let x = -68 - f. Let m = x + 15.6. What is m rounded to zero dps? 8 Let k = 137.79 - 142. What is k rounded to 0 dps? -4 Let q = 268185.4 - 268184.8599942. Let h = q + -0.54. Round h to six decimal places. 0.000006 Let w = 802.436 - 802. Round w to 1 dp. 0.4 Suppose -2v = -2r + 855198, -v + 4v - 1282803 = -3r. Round r to the nearest ten thousand. 430000 Let n = 0.1 + 0.04. Let g = n - -0.05. Let i = g - 0.202. Round i to two decimal places. -0.01 Suppose -3h = -4z - 0z + 33, 12 = -3h - 3z. Let c(s) = 41s2 + 8s - 6. Let v be c(h). Suppose p = 1853 + v. Round p to the nearest one thousand. 4000 Let w = 426817.1100012 - 426817. Let i = -0.11 + w. What is i rounded to seven dps? 0.0000012 Suppose 0 = -0k - 10k + 20. Let m be 6/10 + k + 1794/10. What is m rounded to the nearest one hundred? 200 Let a(p) = -16165p + 5. Let q be a(-5). Let t be (581950/15)/(1/9). Let d = q + t. What is d rounded to the nearest 100000? 400000 Let y = -153.002289 - -153. What is y rounded to 3 dps? -0.002 Let g = 1.29 + 57.71. Let x = 37.2 - g. What is x rounded to the nearest integer? -22 Let b = 26.017582 - 0.017182. Let t = 26 - b. Round t to three dps. 0 Suppose 0 = 5z + 5, 0z = q - 4z - 1068. Let k be (-246)/((-57)/q(-4)/750). What is k rounded to the nearest one hundred thousand? -900000 Let o = 1033697 - 1943697. Round o to the nearest one hundred thousand. -900000 Let m(g) = 8g - 23. Let k be m(3). Let l be ((-263)/7 - k)/((-15)/70). What is l rounded to the nearest 100? 200 Let x(o) = 168o - 6. Let w be x(6). Let m be (w + -2)/((-10)/(-200)). Round m to the nearest 100000. 0 Let c = -32 + 66. Let g = -33.99999981 + c. Round g to 7 decimal places. 0.0000002 Let z = -533.1865 + 533. Let b = -154.4865 - z. Let u = 148 + b. Round u to zero decimal places. -6 Let l = 7821.17 - 7893. What is l rounded to the nearest 10? -70 Let r be 4/(-14) + 638400006/21. Suppose -5j + a + 7 = 4, 0 = -j + 3a + 9. Suppose j = 5m - m - r. Round m to the nearest one million. 8000000 Let p = -0.29908639 + 0.2991. What is p rounded to six decimal places? 0.000014 Let s = -21.6 - -3.8. Let n = s + -120.2. Let g = n - -116.2. Round g to the nearest integer. -22 Let w = 26594 - 26511.449. Let p = w + -82.9. Round p to two dps. -0.35 Let n = -2.481 - -5.644. What is n rounded to the nearest integer? 3 Let w = -124.7728251 + -2.2276849. Let i = w - -127. What is i rounded to 4 dps? -0.0005 Let c = 0.2075 + -0.20121. Round c to 2 decimal places. 0.01 Suppose -3h = -2m + 1202, 0h - h + 4m = 404. Let c be (-7215)/(-1)h/12. Round c to the nearest 10000. -40000 Let j = -1415 + 2907. Suppose 3d = 6862 + 5174. Suppose 0 = 3z - j + d. Round z to the nearest one hundred. -800 Let v be (-24)/12 + 10 + -1. Suppose -v = -3k - 1. Let b(z) = -2z + 4. Let q be b(k). Round q to the nearest one thousand. 0 Let x = 235653 + -134353. What is x rounded to the nearest 10000? 100000 Let q = 11.93 + -12. Let f = 0.07 + q. Let n = f - 0.0065. What is n rounded to 3 decimal places? -0.007 Let l = 109.956 - 108.1. What is l rounded to one dp? 1.9 Let b = -34 - -36. Suppose -4l - 106 = bw, -96 + 5 = 4l - 3w. Let t = l - -3. What is t rounded to the nearest 10? -20 Let u = 19.01414 + -18.845. Round u to 3 dps. 0.169 Let u = -13 + -15. Let t = u + 11. Let l = t + 17.00005. What is l rounded to 4 decimal places? 0.0001 Let g = -1490 - -1461.91. What is g rounded to zero dps? -28 Let j = -78 + 78.032. Let d = j - 0.03199966. Round d to 7 decimal places. 0.0000003 Let o = -0.151 + 0.176. Round o to 3 dps. 0.025 Let a = -189 + 189.00000216. Round a to seven decimal places. 0.0000022 Let y = -18 - -39. Let u = y - 20.99999879. Round u to 7 dps. 0.0000012 Let i = -41.700172 + 41.7. Round i to five dps. -0.00017 Let y = 20.313 + -19.514016. Let w = y + -0.8. Round w to four decimal places. -0.001 Let l = -9 - -8.888. Let r = 0.902 + l. What is r rounded to the nearest integer? 1 Suppose -5u + 6135 = -5l, 2l - 1384 = -3u + 2317. What is u rounded to the nearest 1000? 1000 Let m be -480011/(132/(-13000)). Round m to the nearest 100000. 5200000 Let z(b) = -2b + 18. Let g be z(12). Let c be (8/(-7))/(g/21). Suppose 172 = co + 38972. Round o to the nearest one thousand. -10000 Let j(i) = 3i*2 - 20i*2 + 4i - 5i - 2i*2. Let m be j(1). Let z = m + 29. Round z to the nearest 10. 10 Let v = -20.03 - -0.03. Let q = -9 + -8.1. Let p = v - q. Round p to 0 dps. -3 Suppose 0f + 6 = 3f. Let o be 5/((-5)/(-7)) - f. Suppose 0 = -ox - l + 199996, 5l = 3x + l - 120016. Round x to the nearest one hundred thousand. 0 Suppose -233 - 210 = -5q + 2j, -5q + 5j = -440. Suppose q - 343 = x. What is x rounded to the nearest 100? -300 Let a = 1.4 - 2.8. Let l = 1.34 + a. Let o = 0.065 + l. Round o to 2 dps. 0.01 Let n = -134.99423 + 135. What is n rounded to four dps? 0.0058 Let z = -114 - -70. Let n = z - -43.9999835. Round n to six dps. -0.0000	{ "pile_set_name": "DM Mathematics" }
et p(u) = 1183u3 + 3u*2 - 4u - 7. Let w(m) = p(m) - 3z(m). What is the second derivative of w(b) wrt b? 7152b - 6 Suppose 3j + 1 = z - 17, -5j = -2z + 31. What is the third derivative of 78g*2 + 48g*3 - 4gz + g3 - 19g2 wrt g? 270 Let a = -2649 + 2649. Let s(o) be the first derivative of 0o*4 + ao + 25 - 7/6o6 - 7o*2 + 0o*3 + 0o*5. What is the second derivative of s(i) wrt i? -140i*3 Let l(q) = -5q - 44. Let h be l(-10). What is the third derivative of -42s2 - 23s*2 + 2s*5 - 3sh - s5 - 5s5 wrt s? -360s*3 - 240s*2 Let r(u) be the second derivative of 28u*6/15 - 25u*4/6 + 4u*3/3 + 487u*2/2 - 297u - 14. What is the second derivative of r(h) wrt h? 672h2 - 100 Let l(k) be the first derivative of k7/7 + k6/3 - 2371k*5/5 - 3541k*3/3 + 861. What is the third derivative of l(y) wrt y? 120y*3 + 120y*2 - 56904y Let x = 582 + -561. Let k = -47 - -82. Find the second derivative of xm + km - m*5 - 42m wrt m. -20m3 Let y be 2 + 3 + 39/3. Suppose 2u - t - 1 - 9 = 0, -t - 4 = 0. Find the first derivative of 6 + q3 + 13 - qu + yq4 wrt q. 72q3 Let u(m) be the third derivative of m7/105 - 7m6/120 + 508m*5/15 - 81m*2 - 8. What is the third derivative of u(v) wrt v? 48v - 42 Differentiate 514 + 67 + 163043z2 - z - 162822z*2 + 218 with respect to z. 442z - 1 Find the second derivative of -11f3 - 281f - 43f2 + 13f*3 + 86f*2 wrt f. 12f + 86 Suppose -4x + 16 = 3t, -9t - 20 = -5x - 6t. Find the second derivative of -p - 18p*x - 126 + 125 + 2p wrt p. -216p2 Let c(h) be the first derivative of 64h*6/3 - 104h*3 - 1873. What is the third derivative of c(i) wrt i? 7680i*2 Let i be (-45)/(-135)(1064 - -1). What is the third derivative of -175a4 - 177a*4 - 59a*3 + 10a*3 - 192a*2 + ia*4 wrt a? 72a - 294 Suppose -5t + 15 = s, -12t + 15t + 37 = 4s. What is the third derivative of 27m5 + 14m*2 - 5 - sm*2 - 15m*5 - 11m*5 + 48m*4 wrt m? 60m*2 + 1152m What is the first derivative of -633v + 252v - 2676 + 204v wrt v? -177 Let y be ((-24)/10)/((-4)/10). Suppose 2f + 8 = yf. Find the second derivative of 4s - 38s2 + 32s*f + 6s wrt s. -12 Let x(f) be the first derivative of -f4/2 + f3/3 + 1411f2/2 - 1064. Find the second derivative of x(z) wrt z. -12z + 2 Let a(t) = -3544t2 - 1480t + 6. Let m(y) = 708y2 + 296y - 1. Let q(x) = 2a(x) + 11m(x). What is the second derivative of q(f) wrt f? 1400 Let w(c) be the first derivative of 2c6/3 + 71c*3/3 + 553c*2/2 - 536. Find the second derivative of w(n) wrt n. 80n*3 + 142 Let p(o) be the third derivative of 47o*6/24 + 395o*3/3 - 1031o*2. Find the first derivative of p(k) wrt k. 705k*2 Let r(w) be the second derivative of 2w - 11/6w3 + 3w*4 - 1 + 0w*2. What is the second derivative of r(y) wrt y? 72 Let b(l) be the third derivative of 913l*6/120 + 52l4/3 - l2 + 93l. Find the second derivative of b(h) wrt h. 5478h Let t(r) = 73r2 + 9r - 9. Let b(x) = -36x2 - 4x + 5. Let y = -387 + 392. Let d(u) = yb(u) + 3t(u). What is the second derivative of d(h) wrt h? 78 Let q(m) = 2m - 5. Let l be q(-2). Let f = l + 17. Differentiate f + 27 + 11v - 17 wrt v. 11 Let h(y) = -4y2 - y + 6. Let g(z) = 2852z*2 - 1399z + 17. Let a(j) = -g(j) + 3h(j). What is the second derivative of a(d) wrt d? -5728 Let d(g) = 5289g*3 + 185g*2 + 7g + 14. Let k(z) = 2643z3 + 93z*2 + 4z + 7. Let i(b) = 4d(b) - 7k(b). What is the third derivative of i(c) wrt c? 15930 Let j(d) = -14d + 11. Let b be j(0). What is the second derivative of 2 - bm*2 + 23m*4 + 4m*2 + 7m*2 - 53m wrt m? 276m2 What is the third derivative of 8205q*2 + 2078q*6 + 2420q*5 - 4162q*6 - 753q*5 + 2086q*6 wrt q? 240q*3 + 100020q*2 Let x(f) = 2f*2 + 10f + 98. Let h be x(-6). Find the second derivative of 130b - 7b + hb - 3b*3 + 0b*3 wrt b. -18b Let x = 29 + -29. Let b = 8 - x. Find the first derivative of 141 + bu4 - 153 + 11u*4 wrt u. 76u*3 Let z = -46 - -67. What is the second derivative of -1 + zi*3 + 15i*3 + 2i - 39i3 wrt i? -18i Let c(a) be the third derivative of 0a4 + 0 + 66a*2 - 11/12a*5 - 61/3a*3 + 0a. Differentiate c(z) wrt z. -110z What is the derivative of -911z - 1934z - 280 + 1064z - 130 - 1151z wrt z? -2932 Let g = -56 + 63. Suppose gv = 4v + 18. Find the first derivative of 4 + k + v + 3k - 5k wrt k. -1 Find the second derivative of 3486q - 19q3 - 270q*4 - 284q*4 + 604q*4 wrt q. 600q*2 - 114q Suppose -3f = 5f - 1272. What is the first derivative of 2a4 + f - 88 + 24a - 195 wrt a? 8a3 + 24 Let b be (-16)/(-56)(3 + 4). What is the first derivative of 60g3 + 0g + 29g2 - 29g*b - 171 - g wrt g? 180g*2 - 1 Let v(c) be the first derivative of 207c*4/4 - 5c*2/2 - 1663c - 884. Differentiate v(h) with respect to h. 621h2 - 5 Let v(z) = -13z + 71. Let d be v(6). Let s(g) = 2g2 - 6g - 13. Let y be s(d). Find the third derivative of 16q4 - q4 - 34q*2 - 127q + yq wrt q. 360q Let f(j) be the first derivative of j*5/5 + 11j*2 - 664j + 623. Differentiate f(z) wrt z. 4z3 + 22 Differentiate 1176 - 14554p*4 + 11837p*4 + 536 wrt p. -10868p*3 Let d(c) = -10c + 2 + 10c + 3c*2 - c - 2c*2. Let f(k) = -33k*3 - 6k*2 + 7k - 3. Let z(j) = -6d(j) - f(j). What is the derivative of z(p) wrt p? 99p*2 - 1 Suppose 0 = 4v - 14 - 30. Suppose vr - 14r + 12 = 0. What is the second derivative of -30q5 + 20q + 12q5 + 4q*4 - 4q*r wrt q? -360q*3 What is the derivative of -3372 + 7197 - 635 + 1769s wrt s? 1769 Let y(i) be the first derivative of -50 - 83/2i2 + 77i. What is the derivative of y(z) wrt z? -83 Let a(v) = 298v2 - 36v - 2. Let q(s) = s*2 + s + 10. Let c(l) = -a(l) + q(l). What is the second derivative of c(z) wrt z? -594 Let b(t) be the first derivative of 347t*4/4 + 5t*3/3 - 62t*2 - 7t + 733. What is the second derivative of b(d) wrt d? 2082d + 10 Let f(k) be the first derivative of -566k5/5 - k2/2 - 32k + 951. What is the second derivative of f(w) wrt w? -6792w*2 Let t(b) be the second derivative of -2/3b*3 - 184b + b*4 + 15b*2 + 0. Find the first derivative of t(c) wrt c. 24c - 4 Let g = -3308/15 + 662/3. Let i(o) be the third derivative of 0o + 0 - 4o*2 + 0o*5 - go*6 + 4/3o*3 + 0o*4. Differentiate i(a) with respect to a. -48a*2 Let f(w) be the first derivative of -94/3w*3 + 281w + 1/4w4 + 309 + 0w*2. Differentiate f(c) wrt c. 3c*2 - 188c Let w(b) = -92b3 + 40b*2 - 5051b. Let l(y) = 75y3 - 40y*2 + 5051y. Let x(z) = -6l(z) - 5w(z). Find the second derivative of x(d) wrt d. 60d + 80 Suppose -25o + 20o - 10 = 0. Let i be -12o12/9. Find the second derivative of 17w - 22w2 + 27w - iw wrt w. -44 What is the third derivative of 1339b*2 - 2b - 868b2 + 5b + 2495b3 - 5b wrt b? 14970 Let x(y) be the second derivative of y*8/14 + 15y7/14 - y4/6 - 295y3/6 + 3y - 18. Find the third derivative of x(n) wrt n. 480n3 + 2700n*2 Let v(f) be the second derivative of 19f*2 - 79/10f*5 - 130f + 0f4 + 0f*3 + 0. What is the first derivative of v(p) wrt p? -474p2 Let u(w) = w3 - 6w2 + 3w - 4. Let a be u(6). Suppose 0 = al - 26 - 2. Find the third derivative of -2n*3 + 11n*2 + 6n*2 + 5nl + n2 wrt n. -12 Let l(k) be the third derivative of 277k6/120 + 6443k*4/24 - 2543k*2. Find the second derivative of l(q) wrt q. 1662q Suppose 8q - 27q + 2185 = 0. Find the second derivative of qy3 - 2y*2 + 41y + 108y3 - 225y*3 + 2 wrt y. -12y - 4 Find the third derivative of 2045x3 + 1022x*3 + x + x - 2x - 7 + 128x2 wrt x. 18402 What is the third derivative of -381k - 3923k3 - 4278k*2 + 276k + 105k wrt k? -23538 Let a(p) be the second derivative of -481p*7/42 + 563p*4/6 - p - 28. What is the third derivative of a(k) wrt k? -28860k*2 Let d(u) be the second derivative of 2u6/5 - u5/4 - 643u4/4 + 60u + 1. Find the third derivative of d(s) wrt s. 288s - 30 Let p be (-5 + 183/9)3. Find the second derivative of 15k3 + 26k*3 - 57k - 11k*3	{ "pile_set_name": "DM Mathematics" }
w)? 3 Let t be 6/(16 + 2) - 16/(-6). What is the tens digit of (10/(-8))/(t/(-204))? 8 Let m = 3433 + -462. Let w = -2059 + m. What is the units digit of w? 2 Suppose -5o + 37p = 31p - 97941, 0 = 2o - 4p - 39178. What is the units digit of o? 7 Suppose 40a = 58a - 64782. What is the tens digit of a? 9 Suppose 1456 = v + 3j, -5v + 4j = -v - 5808. What is the tens digit of v? 5 Let b be (-1 + (-471)/2)/(2/4). What is the units digit of 3 + b/165 - (-613)/15? 1 Let b = 5175 + 4914. What is the units digit of b? 9 Suppose -3v + 147 = 3h, v + 167 = 3h - 0h. Let s = 152 - h. Suppose -2g + g + s = 0. What is the tens digit of g? 9 Suppose 0 = 9m + 261 - 1755. Suppose 156y = my - 15380. What is the tens digit of y? 3 Let z = 2462 - 1304. What is the tens digit of z? 5 Let p(s) = 3s3 - 7s*2 + 5s - 42. Let b be p(5). What is the hundreds digit of 244/b(-942)/(-2)? 6 Let j be ((-536)/20)/(6/(-390)). Let z = j - 1147. What is the hundreds digit of z? 5 Let p be (-1)/((-1)/10(3 + -5)). Let u = p + -74. Let f = u - -290. What is the hundreds digit of f? 2 Let z = -10 + -37. What is the tens digit of -1 - (9z - -1)? 2 Let r = 7634 - -5486. What is the thousands digit of r? 3 Suppose 2k = -2w + 18344, 2k - w - 2342 - 16020 = 0. What is the tens digit of k? 7 Let i = -27 + 47. Let d be (-4)/(3 + -7)i. Let m = d - 18. What is the units digit of m? 2 Suppose 2b = -2v + 88, 3b - 5b = 5v - 223. Suppose -4u = -0u + 2q - 60, 3u - 3q = v. Suppose 0 = uz - 18z + 855. What is the tens digit of z? 8 Suppose -5i - 35 = 0, 4z + i - 138065 - 95268 = 0. What is the thousands digit of z? 8 Suppose -556 = 4g - 4b, -6b - 12 = -3b. Let z = g - -278. What is the hundreds digit of z? 1 Suppose 0 = -180w + 177w. Let h(m) = 2m*3 + 4m*2 - m + 927. What is the hundreds digit of h(w)? 9 Let g(x) = 8x*2 + 327x - 17. What is the hundreds digit of g(19)? 0 Suppose 10611 = -157x + 160x. Suppose 4251 = 12d - x. What is the units digit of d? 9 Suppose -5g + 58 = 3z, -3g - 5z = -g - 27. Suppose 16l = gl + 255. What is the units digit of -4 - 2l/(-2)? 7 Let m = 342 - 90. Let o = m - -428. What is the hundreds digit of o? 6 Suppose n = b + 32363, -n = 2705b - 2704b - 32351. What is the tens digit of n? 5 Suppose 0 = -3x + 5y - 182, -y - 3y + 70 = -x. Let i be (x/(-4))/(2/12) + -3. What is the tens digit of (4/10)/(i/75 - 1)? 1 Let s(i) be the third derivative of 7i*5/40 + 23i4/24 - i3/2 + 2i2 - 30i. Let q(z) be the first derivative of s(z). What is the tens digit of q(13)? 9 Suppose -70g + 67g = 5t - 7, -4g = -t - 17. What is the tens digit of ((-682)/(-6) + t)/((-48)/(-144))? 3 Let j = 11639 + 53. What is the tens digit of j? 9 Let b = 14004 + -8969. What is the hundreds digit of b? 0 Suppose -45b + 764310 + 450680 = 25b. What is the tens digit of b? 5 Let v be 0 + (1 - (-6)/3). Suppose 3s - vn = 21780, -7s + 3s - 3n = -29005. What is the tens digit of (s/(-9))/(-5) + (-10)/45? 6 Let d(t) = t3 - 12t*2 + 4t - 12. Suppose 22s + 50 = 27s. Let o be d(s). Let k = -70 - o. What is the units digit of k? 2 Let y(f) be the third derivative of 4f4/3 - 30f*3 - 31f*2. What is the units digit of y(24)? 8 Let b(x) = -6x3 + x2 + 3x + 243. What is the units digit of b(-10)? 3 Suppose -26 = -2t - 4. Let h(l) = -l*2 + 14l - 12. Let s be h(t). What is the units digit of ((1608/9)/(-2))/((-14)/s)? 4 Let y(p) = 4p + 95. Let l be y(0). Let x = 100 - l. Let z(h) = h3 + h2 - 3h + 17. What is the hundreds digit of z(x)? 1 Let f = 80 + 11174. What is the hundreds digit of f? 2 Let t = 6 + -45. Let r be 6/(-21) + ((-21120)/56)/(-4). Let f = r + t. What is the units digit of f? 5 What is the thousands digit of 8/14 + (-3233430)/(-630)? 5 Suppose 42g - 37g - 93247 = 3h, -16 = 4h. What is the hundreds digit of g? 6 Suppose z = 4c + 3 - 12, 5z = -c + 18. Let b be 544 - ((0 - 1) + 0). Suppose -zv - k = -b, -2v - 3k = -3v + 185. What is the units digit of v? 2 What is the ten thousands digit of ((-14484)/639)/(-2 - (-349)/174610)? 1 Suppose -5t + 5j + 22125 = 0, 16j - 22127 = -5t + 20j. What is the units digit of t? 7 Suppose 5b = -2m - 32, 8 - 5 = -b + 3m. Suppose -4t = 2u + 14, -u + 3t + 17 + 1 = 0. What is the units digit of (b - -4) + 14 - 1u? 9 Suppose 2a = 2j - 8, -16 = -j - 5a + 6. Suppose -jz + 6z + 47 = -b, -z - 4b + 72 = 0. What is the tens digit of z? 5 Let b = 9534 + -411. What is the hundreds digit of b? 1 Let o = -184 + 206. Suppose -29j = -oj - 2226. What is the units digit of j? 8 Let i = 139 - 71. Suppose -v = 4j + v + 60, 5j - v + i = 0. What is the units digit of (-5430)/(-42) - (-4)/j? 9 Suppose 3u - 5 = -4m + 6, -4m = 4. Suppose 3r + z + 0z = 192, -3z = ur - 324. Suppose 5c - 72 = r. What is the tens digit of c? 2 Let v be -6(-7551)/(-18)2/6. What is the units digit of (-1 + 1 + -1)v? 9 Let p(l) = 674l - 12. Suppose 0i = -w - 2i + 1, -2 = -2w + 5i. What is the hundreds digit of p(w)? 6 Let s be 28/(-8) - -6 - (-2)/4. Suppose sj = 3z + 2z - 2707, -3j + 1066 = 2z. What is the tens digit of z? 3 Let h(o) = -o*3 - 12o*2 - 29o - 21. Let l be h(-10). Suppose -63c - 2034 = -lc. What is the tens digit of c? 3 Suppose 5655926 = f + 256f - 7877951. What is the tens digit of f? 6 Suppose 79y - 307y + 2510508 = 0. What is the units digit of y? 1 Let v(w) = 2w + 8. Let y be v(0). Suppose 0 = yz - 5z. Suppose n - 3 = 4j, z = -3n + 3j + 2j + 30. What is the tens digit of n? 1 What is the ten thousands digit of ((-7 - -15) + 7332)(-21)/(-12)? 1 Let n(q) = -459q - 437. Let c be n(-7). Suppose -1382 - c = -42a. What is the tens digit of a? 9 Suppose -8 = 2k + d + 1, -5k = 4d + 21. Let w(a) = 62a - 25. Let o(s) = 21s - 8. Let l(f) = 17o(f) - 6w(f). What is the units digit of l(k)? 9 Suppose -2a - 3l + 1675 = 0, 2a - 944 = -5l + 729. Suppose -10n - a = -3959. What is the hundreds digit of n? 3 Let o be -1 + 2 + 2 + 2. Let r be (-1)/(-5) - (-532)/190. Suppose -ol = -2g + 88, -rg + 6l + 141 = 3l. What is the units digit of g? 9 Let g be (-4)/(8/(-1))308. Let h = g - -295. What is the tens digit of h? 4 Let v(d) = -3d + 4. Let z be v(0). Let b be (z + 6-2)/(-2). Suppose 0 - b = -2p, h = -p + 34. What is the tens digit of h? 3 Let c be (-17)/(22/(-32)). Suppose 5t - 5n + 355 = 0, 3t + 3n = -0n - 243. Let m = c + t. What is the tens digit of m? 6 Let p be 3/3 - (-2 + -3 + 1). Let b be -2(-768)/301p. Suppose 5x - b = 3x. What is the tens digit of x? 2 Let n(c) be the third derivative of c6/4 + c5/20 - c4/6 + 5c*3/6 + 4c*2. Let y be n(2). Suppose -2h - 39 = -y. What is the hundreds digit of h? 1 Suppose 15f = 13f - 66. Let q = f + 47. What is the units digit of 2 + q/(-6) - (-125)/15? 8 Suppose 77o - 637105 + 273117 = 968343. What is the thousands digit of o? 7 Suppose -46836 = 4718i - 4736i. What is the thousands digit of i? 2 Suppose -x = -z - 12, 7 + 9 = 2x + 2z. Suppose 0 = -27a + xa + 935. Let r = a + 19. What is the units digit of r? 4 Let v(c) = 7c - 3. Let y be v(1). Suppose 3q - 1272 = q - yg, 5q - 3g - 3206 = 0. What is the units digit of q? 0 Let o(f) = f*2 - f - 25. Let d be o(6). Suppose 2s = -dy + 293, 0 = 3s + 3y - 411 - 42. What is the hundreds digit of s? 1 Let z(h) = -4h*3 + 4h*2 - 5h + 4. Let b be z(3). Let n = b - -87. Let y(u) = 57u + 11. What is the hundreds digit of y(n)? 2 Let w = 739 + 80. Let j = w + -300. What is the tens digit of j? 1 Let f = 5939 + 948. What is the thousands digit of f? 6 Let z be 0 + (7/3 + -3)-105. Let l be (-5)/(z/(-4)) - 10/35. Suppose f + 4b = -0f + 18, l = 4f - 5b - 93. What is the units digit of f? 2 Let s be -8(-10)/(2 - 0). Let x = s + -40. Suppose x = 5j + 5, -p + 3j + 2j + 82 = 0. What is the units digit of p? 7 Let y(f) = -f*3 + 8f*2 + 11f - 15. Let m be y(9). Suppose -8v = -2l + 992, -3l - 8v + mv + 1522 = 0. What is the hundreds digit of l? 5 Let f be (-1 - -2)/((-9)/(-27)). Suppose -fy + 8y - 280 = 0. What is the units digit of (-118)/(-14) - (-32)/y? 9 Let r = 637 + 5749. What is the units digit of r? 6 Suppose 2v = -3d + 32807, 118v - 122*v - d + 65579 = 0. What is the ten thousand	{ "pile_set_name": "DM Mathematics" }
- 4. Let y(k) = -3k + 2. Calculate -2q(t) - 3y(t). t - 4 Let h(z) = 5875z*3 - 376z*2 + 376z - 376. Let t(n) = -47n3 + 3n*2 - 3n + 3. Give 3h(s) + 376t(s). -47s3 Let b(t) = -8t3 + t2 + 5t. Suppose 5s - 3w = 10, -22 = -3s - 5w + 10w. Suppose -18 = 4y - y. Let c(n) = n3 - n. Determine sb(m) + yc(m). 2m3 - m2 + m Let d(f) = -f*3 + 6f*2 - 6. Let h(v) = 2v*3 - 13v*2 + 13. Suppose 10u = 5u. Suppose 2m - 3l + 9 = u, 2m + 16 = -5l - 1. Give mh(r) - 13d(r). r3 Let b(x) be the third derivative of -x5/30 + x4/12 + x3/3 - x2. Let u(r) = 1. Suppose 4a - 4 = z - a, 2a - 1 = z. What is zb(k) - u(k)? -2k2 + 2k + 1 Let w(k) = -2k - 5. Let g = 2 + -2. Let m(v) = -4 + gv + 3v - 5v. Let q be 4(-3)/(-6) - 0. Calculate qw(n) - 3m(n). 2n + 2 Let o(u) = -u*2 + 3u - 2. Suppose -2q + z + 12 = q, -z + 18 = 3q. Let v(b) = -5b - 4b + 2b2 - b + 3b + 4. What is qo(x) + 2v(x)? -x*2 + x - 2 Let a(u) = -1. Let t(q) = -3q + 4. What is -2a(c) - t(c)? 3c - 2 Let p(d) = d*2 - 2d + 2. Let f = 6 - 7. Let h(l) = -l + 1. What is fp(c) + 2h(c)? -c*2 Let o(y) = y + 1. Suppose 2f - 4q = 4, 3f = q - 1 + 2. Let p(x) be the third derivative of 0x + 1/8x*4 + 1/2x*3 - 3x*2 + f. What is 10o(v) - 4p(v)? -2v - 2 Let w(h) = 1. Let o(n) = -5n - 4. Let q(a) = -11a - 7. Let c(v) = -5o(v) + 2q(v). Give c(p) - 6w(p). 3p Let c(g) = 2g2 + 8g - 4. Suppose 0r + 5 = -r. Let o be c(r). Let y(q) = 3q3 + 6. Let t(x) = x3 + 1. Calculate ot(d) - y(d). 3d*3 Let c(f) = 5f - 5. Let y = -8 + 15. Suppose -4w - y = -3w. Let l(q) be the second derivative of -q3/3 + q2 - q. Determine wl(d) - 3c(d). -d + 1 Let m(u) = -6u2 - 40u - 2. Let o(v) = v*2 - v + 1. Calculate -m(f) - 4o(f). 2f2 + 44f - 2 Let m(f) = -f3 + f2 + 2. Let y(q) = -q3 + q2 + 1. Let b be 0/(-3) + 7 + -4. Give bm(d) - 5y(d). 2d3 - 2d*2 + 1 Let b(x) = 8x - 3. Let r(c) be the third derivative of 23c4/24 - 3c*3/2 + 5c*2. Give -17b(v) + 6r(v). 2v - 3 Let l(u) = u*2 + 2u + 2. Let n(a) = 4a2 + 9a + 9. Let i(w) = w - 14. Let f be i(13). Let s be (0 + 9)/(f - 0). What is sl(h) + 2n(h)? -h2 Let t(u) be the first derivative of u3 - 2u2 + 4u + 18. Let q be 129/27 - (-2)/9. Let f(o) = -o - 8o + 4 + 7o*2 + q. Give 4f(i) - 9t(i). i2 Let w(s) = 2s - 1. Suppose x = -2l + 3l - 5, -2 = x. Let y(o) = -3o + 2. Determine ly(m) + 5w(m). m + 1 Let h(g) = -3g - 11. Let x(f) = f + 5. Give -6h(a) - 15x(a). 3a - 9 Let w(i) = 3i*3 - 2i - 2. Let v(y) = -8y3 + 9 + 11y*3 + 9y - 16y3. Give -2v(p) - 9w(p). -p3 Let x = 6 - 6. Suppose x = -2g - 3 - 9. Let o(s) = -17s + 13. Let b(p) = 4p - 3. Determine go(a) - 26b(a). -2a Let w(j) = -36j*3 - 27j*2. Let x(f) = 5f*3 + 4f*2. Determine 4w(d) + 27x(d). -9d*3 Let f(h) = -4h + 3. Let k = -2 - 1. Let s = 5 + k. Let q(d) = -3d + 2. Give sf(y) - 3q(y). y Let n(p) = -4p*3 + 4p*2 + 2p - 2. Let g(j) = j3 - j2 + j. What is 3g(v) + n(v)? -v3 + v2 + 5v - 2 Let x(l) = -l*2 + 2l. Suppose 4k + 8 = -0k. Let u(f) = 2f2 - 3f. What is ku(a) - 3x(a)? -a*2 Let t(s) = -68s + 4. Let o(l) = 68l - 3. Determine -6o(m) - 5t(m). -68m - 2 Let f(j) = j - 3. Let u be f(5). Let a(h) = 3h - 4h + 6h. Let l(g) = 4g. Calculate ua(c) - 3l(c). -2c Let t(r) = -2r*3 - 2r*2 - 2r + 5. Let g(k) = k*3 + 3k*2 + 2k - 4. Give -3g(y) - 2t(y). y*3 - 5y*2 - 2y + 2 Let t(m) = 9m + 6. Let p(k) = -9k - 7. Determine -4p(c) - 5t(c). -9c - 2 Let h(k) = 4k3 - k2. Suppose -8 = 2d + c, -2d + 3d + 3c + 14 = 0. Let g(x) = 17x3 - 4x*2. Give dg(q) + 9h(q). 2q3 - q2 Let l(n) = n - 1. Let w(v) = 60v - 35v - 6v2 + 3 - 28v. What is 3l(z) + w(z)? -6z*2 Let h(t) = 12t*2 + 11t. Let f(w) = w*2 + w. Let k be (-3 - -2)(-2)/(-1). Determine kh(c) + 22f(c). -2c2 Let n(o) = o2 + o + 1. Let w(h) be the first derivative of 4h*3/3 + 3h*2/2 + 4h - 14. Give 3n(j) - w(j). -j2 - 1 Let j(g) = -7g*2 + 2g + 4. Let y(d) = 20d2 - 6d - 11. Determine 17j(i) + 6y(i). i*2 - 2i + 2 Suppose v = 6v - 3f + 60, -60 = 5v - f. Let i(a) = -4a*2 - 9a - 5. Let m(u) = -10u2 - 22u - 12. What is vi(k) + 5m(k)? -2k2 - 2k Let p(t) = 4t3 - 6t*2 - 6t + 8. Let b(q) = -q3 - q2 - q + 1. Let w(o) = 4o3 + 6o*2 + 6o - 6. Let u(n) = -5b(n) - w(n). Give p(a) - 6u(a). -2a3 + 2 Let h(y) = 0y*2 - 4y*2 - 2y - 3y2 - 5y*3. Let i(k) = -2k*3 - 3k*2 - k. Calculate 3h(f) - 7i(f). -f3 + f Let q(k) = 12k - 1. Let n(w) be the second derivative of w*3/6 + w. What is 22n(l) - 2q(l)? -2l + 2 Let g(b) = -91b + 13. Let l(i) = -15i + 2. Determine -4g(x) + 26l(x). -26x Let p(k) = -8k2 - 13. Let l(f) = f2 + f - 1. Let y(r) = -4r2 - 2r - 1. Let d(c) = 2l(c) + y(c). Give -9d(v) + 2p(v). 2v*2 + 1 Let s(x) = -1. Let k(b) = 3b + 7. Let w be (-2)/(-6) + (-1)/(12/16). Calculate wk(h) - 6s(h). -3h - 1 Let b(h) = 2h + 3. Suppose -2c = 7c - 135. Let o(l) = l + 1. Give co(s) - 5b(s). 5s Let m(k) = 11k*2 - k + 2. Let p(f) = 22f*2 - 2f + 4. Give 5m(t) - 3p(t). -11t2 + t - 2 Let a(x) = -x3 + x2 - x + 1. Let q(r) = -6r*3 + 18r*2 - 8r + 8. What is 8a(y) - q(y)? -2y*3 - 10y*2 Let c = 22 - 17. Let q(p) = 4. Let n(o) = -3. Let v(s) = 3n(s) + 2q(s). Let g(f) = -f + 6. Give cv(x) + g(x). -x + 1 Let m(l) be the second derivative of l*3/3 + 2l*2 + 5l. Let z(d) = -d*2 + d - 11. Let f be z(0). Let v(w) = -4w - 7. Calculate fm(s) - 6v(s). 2s - 2 Let h(r) = 8r*2 + 3r + 4. Let w(t) = -t*2 - 1. Determine -h(d) - 4w(d). -4d2 - 3d Let b(g) = -g*3. Let u(m) = -3m*3 - m. Calculate -6b(q) - u(q). 9q3 + q Let a(g) be the second derivative of 3g5/20 - g4/4 + 2g2 + g. Let n(s) = -2s*2 - 3s*2 + 5s*3 + 0s*3 + 7. What is 7a(m) - 4n(m)? m3 - m2 Let n(i) = -i2 + 3i + 81. Let f(l) = -2l2 + 5l + 163. Give -3f(r) + 5n(r). r*2 - 84 Let r(v) = 2v + 1. Let s(j) = -1. Let g(q) = q*2 + 14q + 6. Let d be g(-14). Let p(t) = -t*2 + 7t - 7. Let n be p(d). Give nr(o) - 2s(o). -2o + 1 Let s(v) = 3v*3 - 5v*2. Let h(u) be the first derivative of -13u*4/4 + 7u*3 + 2. What is -2h(k) - 9s(k)? -k3 + 3k*2 Let q(r) = -22r - 10. Let w(h) = 5 - 3 + 7h + 1 + 0. Let n be (-2)/(-3) + 150/(-9). Determine nw(m) - 5q(m). -2m + 2 Let s be (-10)/(-4) - (-7)/14. Let q(n) = 3 + 1 - n*2 - s - 2. Let o(w) = 3w*2 + w + 3. Calculate -2o(c) - 4q(c). -2c*2 - 2c - 2 Let o(a) = -2a3 - 8a. Let m(k) = -k*3 - 7k. Determine 6m(l) - 5o(l). 4l3 - 2l Let d(a) = 7a2 - 2. Let h(b) = -1. Calculate -d(i) + 3h(i). -7i2 - 1 Let q(i) = i - 4. Let a(x) = -x + 4. Let s(y) = 4a(y) + 3q(y). Let m(t) = -2 + 0 + 4 - 4. Calculate -5m(p) - 2s(p). 2p + 2 Let q(v) = -1. Let a(j) = -5. Let b(x) = a(x) - 3q(x). Let k(d) = -d. What is -b(g) + 2k(g)? -2g + 2 Let z(l) = -4l + 2. Let p(k) = -k*2 + 5k - 3. Suppose 6t - 7t = -2. Determine tp(v) + 3z(v). -2v2 - 2v Let x(f) = -2f2 + 5f + 4. Let o(y) = y*2 - 4y - 3. Let t be 7/(-9) - (-2)/(-9). Let l = -4 - t. Give lo(j) - 2x(j). j*2 + 2j + 1 Let g(r) = -4r + 1. Let k(j) = 5j - 2. Let h(u) = -3u - 30. Let d be h(-9). Give dg(q) - 2k(q). 2q + 1 Let a(z) = 89z3 - 4z*2 + 4z + 4. Let n(u) = 13884u3 - 623u*2 + 623u + 623. Calculate 623a(t) - 4n(t). -89t3 Let z(k) = -2k - 47k2 + 54k*2 - 2k. Let w(c) = -c*2 + c. Calculate -4w(u) - z(u). -3u2 Let a(u) = 2u*2 - 19. Let n(d) = -3d*2 + 28. Calculate -7a(z) - 5n(z). z2 - 7 Suppose -4s - 6 = -2z + z, -2z = -4s - 4. Let g(j) = 16j + 21. Let k(n) = 0 - 3n + 2 - 4 - 2. Calculate sg(h) - 11k(h). h + 2 Let b(n) = 2n*2 - n + 1. Let p = 18 + -13. Let a(o) = 4o*2 - 2o + 2. Determine pb(h) - 3a(h). -2h2 + h - 1 Let q(r) = -r3 + r2 + r + 1. Let u(b) be the third derivative of b5/60 + b4/24 + b3/6 + 13b2. Determine q(t) - u(t). -t3 Let q(c) = -13c2 + 10c. Let z = 1 - -6. Suppose -1 - 3 = 2i. Let y(p) = -4p*2 + 3p. What is iq(j) + zy(j)? -2j2 + j Suppose -25 = -s - 20. Let a(n) = 6n*2 - 2n*3 + 3n*2 + 5 + 5n - 4*n	{ "pile_set_name": "DM Mathematics" }
531107 wrt u. 4u + 4293503 What is the third derivative of 791f*2g*4 + 24f*2g*3 - 31f*2g + 2g3 - 7226g*2 wrt g? 18984f*2g + 144f2 + 12 What is the derivative of -2t*4 - 7664017t - 8053036? -8t3 - 7664017 What is the second derivative of d3z*2 - 724d*3 + 12994309dz5 + dz + 331d - 10 wrt z? 2d*3 + 259886180dz3 Find the second derivative of -351289221p*3 + 612660725p wrt p. -2107735326p What is the third derivative of 20018291h*3 + 2h*2 - 1304h + 784 wrt h? 120109746 Find the second derivative of -41818961w3 - 44548426w. -250913766w Differentiate -16311597c*2 + 15891335 wrt c. -32623194c What is the second derivative of 5a2ci3 - 1831239a*2i*3 - 17666ac + 5ai3 + 4ai - a - i3 wrt a? 10ci3 - 3662478i*3 Find the third derivative of 241354260k*3p - 2k2p - 4k2 + 6kp + 538p - 1715 wrt k. 1448125560p What is the first derivative of 645963y + 4607307? 645963 What is the second derivative of -30080128w3 + 24293101w? -180480768w Find the second derivative of 61061nu2x - 3228nux2 + 3nx3 + 391u*2x*3 + 3ux3 - 59ux2 + u - 2x wrt u. 122122nx + 782x3 Find the third derivative of -8656620o*3q + 684o2q - 39oq + 2o + 2 wrt o. -51939720q Find the second derivative of -243657004d3 + 17802d - 1075 wrt d. -1461942024d What is the first derivative of 10152325u*2 + 10339730 wrt u? 20304650u Find the first derivative of -2w4 - 597w*3 + 5453w*2 - 22356520 wrt w. -8w*3 - 1791w*2 + 10906w Find the first derivative of 193131430x - 1098844382. 193131430 Find the first derivative of 2587953jsy - 2jy - 860s + 5y + 148 wrt j. 2587953sy - 2y Differentiate 36942s*4 + 11s*3 - 80s + 14913491 with respect to s. 147768s3 + 33s*2 - 80 Differentiate -699756i*4 - 260i*2q - 513748112q with respect to i. -2799024i*3 - 520iq Find the second derivative of 56077296f*3 - f - 73745010 wrt f. 336463776f What is the second derivative of 14045443l2 - 37745658l? 28090886 Differentiate 2n4 - 339825n*3 + 2n - 2555166 with respect to n. 8n3 - 1019475n*2 + 2 What is the second derivative of -3q*3 - 955279q*2 + 5837766q wrt q? -18q - 1910558 What is the first derivative of -648498q*3 - 62q*2 + 1452963649? -1945494q*2 - 124q Find the third derivative of -244923786b4 - 2b*3 + 96169b*2 - b - 337 wrt b. -5878170864b - 12 What is the first derivative of -fi2 - 3fi + 6f - 687487i3 + 662071 wrt i? -2fi - 3f - 2062461i2 Find the second derivative of 78979772u*5 + 86767012u. 1579595440u3 What is the third derivative of 5416430m*4 - 615m*2 + 14652m? 129994320m What is the third derivative of 47n*5 - 8276n3 + n2 + 122n - 3498? 2820n*2 - 49656 What is the third derivative of 177785n*6 - 15n*4 + 89n*2 + 42416 wrt n? 21334200n*3 - 360n Differentiate -4q3 - 83330665q*2 + 83189702 with respect to q. -12q*2 - 166661330q Differentiate 31136311d2 + 38086670 wrt d. 62272622d Find the second derivative of -2v5 + 1295877v*3 - 16v*2 - 479718296v. -40v3 + 7775262v - 32 Find the second derivative of 8999842p4 - 2443p + 6969 wrt p. 107998104p2 What is the third derivative of 37813n*4p*3 - 93n*4p*2 - 4n*2p*2 + 4np2 + np - 52p3 + 171 wrt n? 907512np3 - 2232np2 Find the second derivative of -3a*4 - 5a*3 - 457110a*2 - 256a - 5909 wrt a. -36a2 - 30a - 914220 Find the first derivative of -53436r3u + 2r3 + 16ru + 44637240u wrt r. -160308r2u + 6r2 + 16u What is the third derivative of -378984715h3t*3 + 2h*2t*3 + 2429h*2t*2 - 238t*3 + 3 wrt h? -2273908290t*3 What is the derivative of 168157524f - 70063212? 168157524 What is the first derivative of -1881390x2 + 9327242? -3762780x What is the third derivative of -20485891g3 + 4g*2 - 28835g? -122915346 What is the third derivative of 26620913a3 - 34247553a*2? 159725478 What is the third derivative of 62x*6 + 8627212x3 + x2 + 24485866x - 5? 7440x*3 + 51763272 Find the third derivative of 635063p*5 + 3p*4 + 3p*3 - 52921834p*2 wrt p. 38103780p*2 + 72p + 18 Find the third derivative of 314647509r4 - 2r*2 - 13618964. 7551540216r Differentiate 18p2 - 335606p - 375255085 with respect to p. 36p - 335606 What is the first derivative of -118b*2 + 3735b + 33955949? -236b + 3735 Differentiate -2249q*4 + 63505q + 186347448 wrt q. -8996q3 + 63505 Find the third derivative of -28074393y*3 - 42082277y*2 wrt y. -168446358 What is the derivative of 810138d*4 - 8380360? 3240552d*3 Find the third derivative of 27715021m*5 - 60407220m*2 wrt m. 1662901260m*2 Differentiate 3760007n*2 - 19056512 with respect to n. 7520014n What is the second derivative of -3j3 - 3227749j*2 + 242055686j wrt j? -18j - 6455498 What is the third derivative of -371282o*5 - 1689o*3 + 99o*2 - 828o + 15 wrt o? -22276920o2 - 10134 What is the third derivative of 44725349r*5 - 8r*2 + 2814r + 47? 2683520940r2 What is the third derivative of -11hx6 - 10hx2 - 3hx - 346900h - 3456564x6 wrt x? -1320hx3 - 414787680x*3 What is the third derivative of 500435649ry3 + 259427r + 4y2 - 4 wrt y? 3002613894r What is the derivative of 49047w4 + 9w*3 - 3w*2 + 6270516 wrt w? 196188w*3 + 27w*2 - 6w What is the second derivative of 3407l2y*2z*2 + 3l*2y*2z - l*2y*2 - 48108l*2z*2 - 93l*2z - 20006ly*2z + 4yz wrt z? 6814l2y*2 - 96216l*2 Find the third derivative of 29u*6 - 88561u*3x*3 - 10487u*2x*3 + 595x*3 + 3x*2 wrt u. 3480u*3 - 531366x*3 Find the third derivative of 317a*4 - 1081593a*3 - 5440563a*2 + 2a - 14 wrt a. 7608a - 6489558 What is the first derivative of -8h*2 + 935537h - 18268558 wrt h? -16h + 935537 Differentiate 21494364t*2 + 7t + 63074069 wrt t. 42988728t + 7 What is the second derivative of a2n*2x + 6393a2nx + 1938a*2x + 88an*2 + 3an + 4688ax - 2nx + 8n wrt a? 2n2x + 12786nx + 3876x Find the second derivative of -12541690x*2 + 928x - 1264 wrt x. -25083380 What is the second derivative of 9696946f2l - 38fl + 6108f + 2l + 2 wrt f? 19393892l Find the second derivative of -y4 + 692y*3 + 326y*2 - 26990813y. -12y2 + 4152y + 652 Differentiate -1099777h2 - 3h + 1566465. -2199554h - 3 What is the second derivative of -8145c*3 - 7739c*2 - 325140c - 201? -48870c - 15478 What is the first derivative of -120950dhy - 3dy*3 + 139dy - 6hy3 + 3hy - 2y*2 - 11655y wrt h? -120950dy - 6y3 + 3y What is the third derivative of 25l6 + 255800l*3 - 524l*2 - 11610l wrt l? 3000l3 + 1534800 Find the third derivative of 37ax4 - ax*2 - 83593728ax + 25x*4 - 9250x*3 - 2x wrt x. 888ax + 600x - 55500 Find the second derivative of 12676g*2i*2 - 67g*2i - 365gi*2 + 14gi - 21g + i*2 + 441i wrt i. 25352g2 - 730g + 2 Differentiate -51941mu*2 - mu - 4466012m - 2u*3 wrt u. -103882mu - m - 6u*2 Differentiate 19071595o - 943755. 19071595 Find the second derivative of -259163l4 + 2l*3 - 1902l*2 + 878200806l. -3109956l2 + 12l - 3804 Differentiate -9320vz*2 - 2vz - 8v - 9603511z2 with respect to v. -9320z*2 - 2z - 8 Find the first derivative of -t*3 - 23439016t*2 + 31809115. -3t*2 - 46878032t Differentiate 12fu*2 - 637fu + 377935842f + 2077u2 + 2u wrt u. 24fu - 637f + 4154u + 2 What is the second derivative of 6168390i2 + 4732270i? 12336780 Find the third derivative of 541642470s3 + 21741s*2 + 366s + 4 wrt s. 3249854820 Find the second derivative of 1663086h4 + 4223h + 593. 19957032h2 What is the derivative of -101h*2 + 14211h - 8095874? -202h + 14211 What is the derivative of -204576642k*4l + 2k3l + 12l + 2769393 wrt k? -818306568k*3l + 6k2l Find the first derivative of -936a4 - 11a*3 + 39a*2 - 61066898 wrt a. -3744a*3 - 33a*2 + 78a What is the third derivative of 390942615t3 + 24620t*2 - 54t - 84 wrt t? 2345655690 What is the derivative of -r*2 - 894367r -	{ "pile_set_name": "DM Mathematics" }
1.9? (a) 0.3 (b) -2 (c) -0.3 (d) -0.1 (e) -0.145 b Which is the closest to 247? (a) -1 (b) 1 (c) -2/3 (d) -3 (e) 3 e What is the nearest to 5 in 3/43, 9, 2/3, -5, -3/5? 9 Which is the closest to 2? (a) -27/5 (b) -85 (c) 12 (d) -0.1 d Which is the nearest to -2? (a) -0.2 (b) 4 (c) -89 (d) 1 a What is the nearest to 0.3 in -2/9, 115, -360? -2/9 What is the nearest to -145 in -1, 0.334, 0.5? -1 Which is the closest to -14? (a) -5 (b) -0.4 (c) 0 (d) -53 (e) 5 a What is the nearest to -0.3 in 0.3, -2/5, 3/8, -1? -2/5 What is the closest to -0.197 in -130, -2/13, -0.5? -2/13 What is the nearest to -26/43 in -59, -5, -2? -2 What is the nearest to -0.1 in -3/4, -5, 410, 0.1? 0.1 What is the closest to 2/7 in 0.1, 2/11, -2/11, -435? 2/11 Which is the closest to -0.075? (a) 0.1 (b) -3/4 (c) 70 a Which is the nearest to 2/11? (a) -3/2 (b) 0.08 (c) 102 (d) 0.5 b Which is the nearest to -1/5? (a) 22/15 (b) 5 (c) 2/27 c Which is the nearest to 0.009? (a) 0.0309 (b) -0.4 (c) -2 a Which is the closest to -3/2? (a) -4/3 (b) 188 (c) -0.3 (d) -22 a Which is the closest to 3/8? (a) -3 (b) 1 (c) 0.8 (d) 5 (e) 71 c What is the closest to 1/30 in -4, 1/4, -0.3, -20? 1/4 What is the nearest to -2.2 in -9/17, -0.5, -1, 6? -1 Which is the closest to -0.1? (a) -43 (b) 1/5 (c) 0 (d) 8 c Which is the closest to 0? (a) -12 (b) 1796 (c) 0.4 c What is the nearest to -9 in -1/5, 18.79, 0.5? -1/5 Which is the closest to 2? (a) -1091/5 (b) -5 (c) 0.5 (d) -1 c Which is the closest to -13? (a) 3/28 (b) -0.3 (c) 0.3 (d) 2/7 (e) 0 b What is the nearest to 0.1 in 2, -2/17, -2, 5/4, -5/18? -2/17 What is the nearest to -682/3 in 0, 15/8, -2/9, -3/5? -3/5 Which is the nearest to 0.1? (a) 2/9 (b) 2 (c) -877 a Which is the nearest to -9? (a) -1/11 (b) 117 (c) 18 (d) 0 a What is the closest to -0.1 in -360, -4, 2, -3? 2 Which is the nearest to -518? (a) 0.5 (b) 7/4 (c) 2 (d) -0.3 d What is the nearest to 1 in -0.5, -1, 2/31, 76? 2/31 What is the nearest to 25 in -1.47, -0.6, 2/9? 2/9 Which is the nearest to -3/4? (a) 0.062 (b) -5 (c) -164 a Which is the closest to -70? (a) -2 (b) 34 (c) 6 a Which is the nearest to 3? (a) 1 (b) 3 (c) -2/3 (d) 0.136 b Which is the nearest to 2? (a) 2/11 (b) 5/3 (c) -4 (d) -33 b Which is the closest to 0.3? (a) -2 (b) -1/4 (c) 26 (d) -2/19 (e) -5/4 d Which is the closest to -1? (a) 0 (b) 0.54 (c) 15 (d) -4 (e) -3 a What is the nearest to 0.2 in -0.09, 17, -5, -1, 8/9? -0.09 Which is the closest to 0.1? (a) 132 (b) -1535 (c) -0.3 (d) -3 c Which is the nearest to 0.25? (a) 0.4 (b) -1/2 (c) 3/22 (d) 0.7 (e) -2 c Which is the closest to 0? (a) -0.07 (b) 712 (c) 2/3 a Which is the closest to 10/11? (a) 468/7 (b) -0.3 (c) 3 b What is the nearest to -1 in 27/8, -0.12, -0.2, -0.3, 5? -0.3 What is the nearest to 1 in -2, -61, 1/5, -4? 1/5 Which is the closest to 1/3? (a) -89 (b) 4746 (c) 6 c Which is the closest to 2? (a) 5.9 (b) -227 (c) 0 c Which is the closest to 415? (a) -2 (b) -2/3 (c) -0.15 (d) 0.07 d What is the closest to 41 in 1/2, -4, 267, 5, -0.1? 5 Which is the closest to 9? (a) 2 (b) -3 (c) 1.52 (d) 8 d What is the nearest to -1.12 in -6, 3/7, 9, -0.5? -0.5 Which is the nearest to -10? (a) -0.5 (b) -0.247 (c) -2 (d) 29 c Which is the nearest to 1.1? (a) -24 (b) 4 (c) 0.22 c What is the closest to -430690 in -1, -2, 2? -2 What is the closest to 0.027 in -0.329, 5, 0.5? -0.329 Which is the nearest to -1? (a) 2930 (b) -3 (c) -1/19 c What is the closest to -12 in 3, -71, 8, 1/2? 1/2 What is the closest to -1/2 in 5, -4, -9, 0.17? 0.17 Which is the nearest to -855? (a) 3 (b) 18 (c) -1 c Which is the closest to 0.3? (a) 0.2 (b) 3/1028 (c) -7 a What is the closest to -1 in 1/55, -239, -2? -2 What is the nearest to 9/8 in 10, -9, 2, 6.2? 2 What is the nearest to 1/2 in 4, 7199, -0.5, 0.4? 0.4 What is the nearest to -0.1 in -0.092, 6, 3, -30, 1? -0.092 What is the nearest to 7589 in -3, 1, -1, 0, -4? 1 What is the nearest to 1/4 in 0, -0.4, -1653? 0 What is the nearest to -8/43 in 3/19, 6/7, 4, -0.5, 2? -0.5 What is the nearest to 1/6 in -2/13, 0.55, 2? -2/13 What is the nearest to -0.25 in -8, 1213, 3? 3 What is the closest to 163 in 2, -2, -8/5? 2 What is the closest to -3/5 in -4/135, -1/4, 3? -1/4 Which is the closest to -0.3? (a) -0.042 (b) -4/3 (c) -5 (d) 0.024 a What is the nearest to -31 in 6, -2/115, -2? -2 Which is the nearest to -1? (a) 2/7 (b) 1 (c) 3073 a Which is the nearest to -14? (a) -25.2 (b) 3 (c) 1 (d) -4 (e) 6 d What is the closest to -4 in 0.07, -2/7, -0.2, 65? -2/7 Which is the closest to 0.5? (a) 4 (b) -46 (c) 0.2 (d) -4/7 c What is the closest to 0.1 in 0.2, 11, -11, 0.3, 13/3? 0.2 What is the closest to -22 in -1/283, -0.5, 21/8? -0.5 Which is the nearest to 0.23? (a) 409 (b) 2 (c) 0.5 (d) 6 (e) 5 c Which is the nearest to -1/10? (a) 2/13 (b) -2.3 (c) -66 a Which is the nearest to -2? (a) 5717 (b) 4/7 (c) -1 (d) -0.3 c What is the closest to -2/195 in -2, -23, 0.4, 2/9, 2? 2/9 Which is the nearest to -3? (a) 5 (b) -0.3 (c) 78 b Which is the closest to -0.08? (a) -4 (b) 1 (c) -48/13 (d) 0.8 d Which is the nearest to -1/29? (a) -1/6 (b) -5 (c) 0.04 (d) 1 c What is the nearest to -3/31 in -0.24, -4, -1.78? -0.24 Which is the nearest to 4? (a) -2/9 (b) -15 (c) -1/55 (d) -1 (e) 1/2 e Which is the closest to -117? (a) 0.04 (b) -0.3 (c) 4 b What is the closest to -0.5 in 2, -66, -1/19, 0? -1/19 What is the nearest to -12/7 in -1/29, -115, 4? -1/29 What is the nearest to 3 in -0.06, 5, -86, -3/4? 5 What is the closest to -5/2 in -94/21, 4, 5, 2, -3/2? -3/2 What is the nearest to 2 in -1/11, -0.4, -0.3, -6, 46.7? -1/11 Which is the closest to -1/3? (a) -0.138 (b) -0.12 (c) 0.012 a What is the nearest to 1 in -3, -24, 1.4? 1.4 Which is the nearest to 1? (a) -0.04 (b) -164 (c) 4 (d) 3 (e) -0.6 a What is the closest to 0 in -49, -457, 4/7, 1? 4/7 What is the closest to -4/11 in -6, 4/5, 2/5? 2/5 What is the closest to 8 in -2, 0.1, -0.1, 12, 0.004? 12 What is the closest to -0.5 in -5/118, 1, -1/5, 0.03? -1/5 What is the nearest to 1361 in 6, 5/17, -1/10, 0? 6 What is the nearest to -96 in 2408, 2, -3? -3 Which is the closest to 0.18? (a) -2.3 (b) -0.4 (c) -8 (d) -1/2 (e) -0.3 e What is the nearest to 10355 in 2, -1/9, 5, 0.25, -0.5? 5 What is the nearest to -1/4 in -1/8, 0, -732/7? -1/8 Which is the closest to -0.1? (a) -12 (b) 3 (c) -36017 (d) 0.1 (e) -1/7 e Which is the closest to 1? (a) -2 (b) -1 (c) -0.5 (d) 362 (e) 2 e Which is the closest to 720? (a) 5 (b) -2/3 (c) -0.3 a Which is the closest to -9? (a) -4/7 (b) 1 (c) -5/71 a Which is the closest to 0.1? (a) -5.3 (b) -0.1 (c) 5 (d) -3 b What is the nearest to 0.2 in 0, -0.1, -0.5, -865, -1/5? 0 What is the closest to 3 in 11, 0.002, -3, -2/5? 0.002 What is the nearest to 0.5 in -7036/11, 0.5, 0, -0.3? 0.5 Which is the closest to 3? (a) 0.4 (b) 1/222 (c) -0.1 a Which is the nearest to -1/5? (a) 1/4 (b) 0 (c) 1/3 (d) -1917 b What is the nearest to 2/11 in -15, 5, 16, -0.1? -0.1 What is the nearest to -9/230 in -30, 2, -5? 2 What is the nearest to 93 in 8, -5, 5, 1/4? 8 Which is the closest to 2.5? (a) 0.1 (b) 0.4 (c) -66 (d) 2/7 b What is the nearest to -10 in -2, 3/2, 3, -1.77? -2 Which is the nearest to -1.9? (a) 2/5 (b) 0.1 (c) 1647 b What is the closest to 1 in 0, -3/8, -15276? 0 Which is the closest to 710? (a) -4 (b) 3/4 (c) -2/19 (d) 2 d Which is the nearest to -68? (a) 1/89 (b) -3/7 (c) 2 (d) -4 d Which is the closest to 0.1? (a) -14 (b) 3660 (c) -1 c What is the closest to 0.24 in -0.4, 4, 2, 0.4? 0.4 What is the closest to 1 in 0.1, -1126, -5? 0.1 What is the nearest to -0.3 in -5, -1/806, -3, -0.3, 2? -0.3 Which is the closest to 4? (a) 3 (b) 4/7 (c) -930 (d) 0.1 a Which is the nearest to -2? (a) -2 (b) 0.47 (c) 2.6 a What is the nearest to 6 in 25, 5, -0.04, -2? 5 What is the nearest to -0.042 in -5, -1, 0.03, 2/7, 0.3? 0.03 What is the nearest to 1392.3 in 3, 0.5, 0.2? 3 What is the closest to 0 in 3, 52, 1, -170? 1 What is the nearest to -1/136 in 19, -1, 1, 2/3, -3/8? -3/8 Which is the nearest to 1? (a) 0.5 (b) 1 (c) -1829	{ "pile_set_name": "DM Mathematics" }
*2(n - 1)(n + 1)/5 Let f(m) be the first derivative of m5/150 - m4/30 + 3m*2/2 - 2. Let n(v) be the second derivative of f(v). Factor n(p). 2p(p - 2)/5 Let k(y) = -39y*2 - 117y - 78. Let v(s) = 3s2 + 9s + 6. Let x(r) = 2k(r) + 27v(r). Determine i so that x(i) = 0. -2, -1 Let b(o) = -o3 - o2 - 3o - 3. Let a be b(-1). Factor ar + 2/7r2 + 0 - 2/7r*3. -2r*2(r - 1)/7 Suppose -5v + 0v + 11295 = 0. Suppose 4q - v = -j, 3q + 6j = 2j + 1678. Factor -qw3 - 1483w*4 + 233w*4 + 32 + 160w - 434w3. -2(5w - 2)(5w + 2)3 Let a(g) be the first derivative of 0g*2 - 2 + 2/21g*3 - g - 3/14g*4 + 1/10g*5. Let h(q) be the first derivative of a(q). Factor h(f). 2f(f - 1)(7f - 2)/7 Suppose -4 - 5p*2 - 25p + 11 + 23 = 0. What is p? -6, 1 Find w such that 0w + 0 - 2/7w*3 + 2/7w*5 + 4/7w*2 - 4/7w*4 = 0. -1, 0, 1, 2 Let h = -4 + 2. Let b be (-1)/(h2/8). Factor 6x + x4 + 3x - 2 - x*2 - 4x - x*3 - 2xb. (x - 1)3(x + 2) Let o(w) = w2 - 1. Let h(y) = -4y*2 - 2y + 3. Let p(q) = -8q2 - 4q + 5. Let a(l) = 7h(l) - 3p(l). Let r(i) = -a(i) - 5o(i). Factor r(u). -(u - 1)2 Let u(z) be the first derivative of -z6/36 - z5/15 + z3/9 + z2/12 + 7. Factor u(v). -v(v - 1)(v + 1)3/6 Let s = -3481/3 + 1163. Factor 0l - 2/3l2 + s. -2(l - 2)(l + 2)/3 Let g = -1/38 + 311/266. Suppose 0 = -j - 7 + 9. Factor -10/7v*j + 2/7 - gv. -2(v + 1)(5v - 1)/7 Let z be (3/(-36))/(1/(-8)15). Let b(d) be the first derivative of 0d2 - zd*5 + 2/27d*3 - 1/18d*4 + 1/27d*6 + 0d - 3. Factor b(r). 2r2(r - 1)*2(r + 1)/9 Let h be (-18)/(-27)((-11)/(-2) - -2). Factor 4/9z*3 + 4/9z*2 - 2/9z*h - 2/9z - 2/9 - 2/9z4. -2(z - 1)*2(z + 1)*3/9 Factor 1/3 - 1/6k + 1/2k3 - 2/3k2. (k - 1)2(3k + 2)/6 Let n(g) be the second derivative of 2g6/15 - 2g*5/5 + 4g*3/3 - 2g*2 - 7g. Solve n(z) = 0. -1, 1 Let d = 2/57 - -43/399. Let o(w) be the second derivative of w + dw2 + 0 + 0w*3 - 1/42w*4. Suppose o(l) = 0. Calculate l. -1, 1 Let k = 577/12 + -48. Let f(p) be the third derivative of -1/30p*5 + 0p + 1/60p6 + 3p*2 - kp*4 + 0 + 1/3p*3. Factor f(w). 2(w - 1)*2(w + 1) Let i(f) be the third derivative of -f7/840 + f6/240 + 3f5/80 - f4/48 - f3/3 - 9f*2 + 2. Determine k, given that i(k) = 0. -2, -1, 1, 4 Factor 482s - 64s3 + 44s*2 + 4 + 28s*4 - 490s - 4. 4s(s - 1)*2(7s - 2) Let y = -1/61 + 63/122. Let u(v) be the second derivative of -3v + 0v2 - 5/3v*6 + 8/3v*4 + 0 + yv*5 + 4/3v*3. Factor u(t). -2t(t - 1)(5t + 2)2 Let d = 10 - 5. Suppose 4y + 21 = 3v + 2, -5v + 2y + 27 = 0. Let -3r5 - rv - r*4 + dr*5 = 0. What is r? 0, 1 Let b = 158 - 154. Determine n, given that 1/4 - 1/2n*3 - 3/4n*b - 1/4n*5 + 1/2n*2 + 3/4n = 0. -1, 1 Let q(g) be the first derivative of -2g - 1/3g*3 - 3/2g2 - 3. Suppose q(o) = 0. Calculate o. -2, -1 Let w = -3 - -5. Determine c so that -c2 + wc2 - c + 0c*2 + 0c2 = 0. 0, 1 Let p(v) be the first derivative of -v5/10 - v4/2 - 34. Factor p(d). -d3(d + 4)/2 Let z be 8/(11 + (-12)/(-4)). Let r = 89/91 - 9/13. What is o in -zo + 0 - ro2 = 0? -2, 0 Let g(j) be the third derivative of -1/48j*4 + 0 - 1/120j*5 + 1/6j*3 + 0j + 3j2. Factor g(v). -(v - 1)(v + 2)/2 Let u(b) be the third derivative of b*7/35 + 11b*6/60 + 11b5/30 + b4/12 - 2b3/3 + 4b*2. Factor u(v). 2(v + 1)*2(v + 2)(3v - 1) Suppose 3l = -i + 11, 3l - 5i = 1 - 20. Factor 1/7m + 1/7 - 1/7m3 - 1/7m*l. -(m - 1)(m + 1)*2/7 Solve 28u*4 + 4u*3 - 40u*4 - 4u*3 + 3u*3 - 3u + 12u2 = 0. -1, 0, 1/4, 1 Let q(s) be the second derivative of -s7/5040 - s6/1440 - s4/12 + 2s. Let u(f) be the third derivative of q(f). Let u(y) = 0. Calculate y. -1, 0 Let h(r) be the first derivative of 2r5/25 + r4/10 - 2r3/5 - r2/5 + 4r/5 - 2. Factor h(p). 2(p - 1)*2(p + 1)(p + 2)/5 Let j(w) = 2w*2 - 6w + 20. Let i(m) = -m*2 + 4m - 13. Let k(v) = -8i(v) - 5j(v). Suppose k(a) = 0. What is a? -2, 1 Suppose -2/3s3 + 10/3s*2 + 4s + 0 = 0. Calculate s. -1, 0, 6 Let n(k) be the third derivative of k9/504 - k8/120 + k7/210 - k3/2 + 3k2. Let f(v) be the first derivative of n(v). Suppose f(l) = 0. Calculate l. 0, 1/3, 2 Let s(n) be the first derivative of -1 + 0n*2 + 0n - 1/12n4 - 2/3n*3 + 0n*5 + 1/180n*6. Let p(v) be the third derivative of s(v). Factor p(a). 2(a - 1)(a + 1) Let h(q) be the first derivative of q5/15 - q4/6 + q3/6 - q2 + 5. Let p(v) be the second derivative of h(v). Factor p(t). (2t - 1)*2 Let p be (2/8)/(7/56). What is h in -2/5h*p + 2/5 + 0h = 0? -1, 1 Solve 0o + 1/6o*2 - 1/6 = 0 for o. -1, 1 Let q(m) = -6m*4 + 6m3 + m2 + 4m - 5. Let n(y) = 2y*3 - 1 + 3y*3 + y - 4y3 - y4. Let i(b) = 5n(b) - q(b). Determine t so that i(t) = 0. -1, 0, 1 Let 1/4f*2 + 0f*3 + 1/8f - 1/8f5 - 1/4f*4 + 0 = 0. What is f? -1, 0, 1 Let x be (-4)/7 + 2 - (6 + -5). Let w(s) be the first derivative of -2/7s*3 - 2/7s - 1 + 1/14s4 + xs*2. Factor w(m). 2(m - 1)*3/7 Let k(v) = -6v - 1. Let j be k(-1). Let a be (-34)/(-4) - (-6)/(-12). What is n in 6n + an*2 + 6n*5 - 4n*4 + jn*3 - 13n*3 - 4 - 4n3 = 0? -1, 2/3, 1 Let v(o) be the second derivative of o6/360 + 7o5/480 - o4/48 - o3/2 + 6o. Let r(w) be the second derivative of v(w). Find m, given that r(m) = 0. -2, 1/4 Let a(q) be the second derivative of q*5/35 - 2q*4/21 + 12q. Find x such that a(x) = 0. 0, 2 Let y = 46 + -46. What is u in 0u + yu*3 - 2/7u*4 + 4/7u*2 - 2/7 = 0? -1, 1 Let r be (-6)/(6/(-2))2. Suppose q + 3q2 - 3q3 - 1 - q3 + q - 4qr = 0. What is q? -1, 1/2 Let d = 6 - 4. Factor dt*2 - 31t + 31t - 2. 2(t - 1)(t + 1) Let g(k) be the third derivative of k8/252 - k7/63 + k6/60 + k5/90 - k4/36 - 5k*2. Suppose g(h) = 0. Calculate h. -1/2, 0, 1 Factor 0 - 2/11f - 1/11f2 + 1/11f*3. f(f - 2)(f + 1)/11 Let d = 113 - 113. Let y(k) be the first derivative of dk + 1/8k2 + 3 + 1/16k*4 + 1/6k*3. Factor y(v). v(v + 1)*2/4 Let w = 2/27 - -23/54. Factor -1/2c - c*2 + wc*3 + 1. (c - 2)(c - 1)(c + 1)/2 Let v be (-62)/(-110) - 8/40. Let w = -48 + 48. What is m in 2/11m + 2/11m5 + 0m*4 + w + 0m*2 - vm*3 = 0? -1, 0, 1 Let v(h) be the first derivative of -9h*5/5 - 25h*4/4 - 7h*3 - 3h*2/2 + 2h - 3. Let v(b) = 0. Calculate b. -1, 2/9 Suppose 96 = 10f + 14f. What is a in 2/9af + 0a + 4/9a3 + 2/9a*2 + 0 = 0? -1, 0 Let k(r) be the third derivative of 5r*2 + 1/96r*4 + 0r*3 + 3/160r*6 + 0r + 0 + 1/40r5. Solve k(p) = 0 for p. -1/3, 0 Suppose 0x - 9 = -3o + 3x, -4o - 4x = -28. Let l(a) be the third derivative of -a*2 + 1/2a*3 + 1/4a*4 + 0 + 0a + 1/20ao. Factor l(g). 3(g + 1)*2 Factor 16/3 + 76/3w*2 - 160/3w. 4(w - 2)(19w - 2)/3 Let f(h) = h3 + 8h*2 + 7h + 3. Let z(u) = -u*3 + 2u*2 + 2u - 4. Let v be z(3). Let s be f(v). Factor 4/5 - 6/5ds - 14/5d + 16/5d2. -2(d - 1)*2(3d - 2)/5 Suppose -6 - 9/2s*2 - 3/4s*3 - 9s = 0. What is s? -2 Let l(h) be the third derivative of -h7/350 - h6/100 + h4/20 + h3/10 - 10h2. Factor l(b). -3(b - 1)(b + 1)3/5 Let a(w) be the second derivative of w5/10 - w4/6 - w3/3 + w2 - 9w. Determine f so that a(f) = 0. -1, 1 Let n(k) be the third derivative of -k7/5880 + k5/280 + k*4/24 - 5k*2. Let l(s) be the second derivative of n(s). Solve l(c) = 0. -1, 1 Factor 10/7a - 12/7a2 + 0. -2a(6a - 5)/7 Let w(b) be the first derivative of 3b5 - 3b*4/2 - 23. Find c such that w(c) = 0. 0, 2/5 Suppose -9 = -3j + 9. Suppose 0 = -5y + 4q + j, 0q - q + 1 = 0. Factor 2m*4 + 2m*4 - 9m5 - m3 + ym4. -m3(3m - 1)2 Find o such that -o - 1/2o*4 + 1/2o2 + o3 + 0 = 0. -1, 0, 1, 2 Let 6r3 - 5r*3 + 86r*2 - 82r*2 + 5 - 3 + 5r = 0. What is r? -2, -1 Let u(h) be the third derivative of 3h7/1400 - h6/150 + h5/200 - h3 - 5h*2. Let i(p) be the first derivative of u(p). Factor i(b). 3b(b - 1)(3b - 1)/5 Let s(u) = u3 - u2 - 2u + 2. Let q be s(2). Suppose -4p + 2x = -12, -x = q*p - p	{ "pile_set_name": "DM Mathematics" }
5 (c) -2/109 (d) -2 (e) 1 a Which is the second smallest value? (a) -1/6 (b) -2/11 (c) -1 b What is the second biggest value in -27, -3, -5? -5 What is the third smallest value in 0.5, 3, 4/25, -2, 0.057? 4/25 What is the fourth biggest value in -12/71, -0.2, -2/11, 2, 0? -2/11 What is the fourth biggest value in -2, -0.2, -11, -4? -11 Which is the fourth smallest value? (a) 0 (b) 150 (c) 1/5 (d) 0.3 (e) 4 e What is the third biggest value in 4, -0.3, 2, 53? 2 Which is the third biggest value? (a) -5 (b) 1 (c) 21 a Which is the biggest value? (a) 11 (b) -4 (c) 2 a Which is the smallest value? (a) -7 (b) 2 (c) 2/9 a What is the biggest value in -0.9, 1, 25? 25 What is the second biggest value in -3, -0.3, -1/5, 4? -1/5 Which is the biggest value? (a) 0 (b) 0.02 (c) 42 c Which is the second smallest value? (a) -4 (b) -0.5 (c) -2/9 (d) -1 d What is the third smallest value in 99, 0.3, -2? 99 What is the fourth smallest value in -4, -2/7, -130, -0.2? -0.2 Which is the fourth smallest value? (a) 2/9 (b) 1/7 (c) 2/3 (d) -4 (e) -3/20 a What is the third smallest value in 1, 0.098, 3? 3 What is the fourth smallest value in 23, -1/5, 4, -0.1, 1/2? 4 Which is the smallest value? (a) -1/132 (b) 24/11 (c) -4/5 c What is the smallest value in -5, 1/3, 40, -1/5? -5 Which is the smallest value? (a) 1/87 (b) -3/7 (c) 13/5 (d) 3/4 b Which is the second smallest value? (a) -0.1 (b) -6/11 (c) 2806 a What is the third smallest value in -223/5, 0.2, 2/11? 0.2 Which is the third biggest value? (a) -0.3 (b) -0.2 (c) -2.4 (d) 2/115 a Which is the biggest value? (a) -376 (b) -0.2 (c) -5 b Which is the third biggest value? (a) -1 (b) -3 (c) -5/56 b Which is the fourth biggest value? (a) 0.1 (b) -0.3 (c) 2/3 (d) 4 b What is the second smallest value in 5/2, 6, -8/7, -5? -8/7 Which is the third biggest value? (a) -0.3 (b) -8 (c) 0 (d) -1/4 a Which is the smallest value? (a) 1/4 (b) -1.2 (c) -0.28 (d) 1 b What is the fourth smallest value in 2/13, 0.2, -2/5, -8? 0.2 Which is the biggest value? (a) 576 (b) -0.06 (c) -0.3 a What is the biggest value in -50, 1, -4? 1 Which is the biggest value? (a) 24 (b) 5 (c) 0.2 (d) 89 d What is the third smallest value in 9/2, 5/6, 3/5? 9/2 Which is the second smallest value? (a) 0.5 (b) 0 (c) -2 (d) -131 c What is the second smallest value in 7, 0.044, 0.4, 2/3? 0.4 What is the smallest value in -0.41, -0.04, 0.2? -0.41 What is the smallest value in -2/17, -2, -0.2, 9? -2 What is the smallest value in -0.5, -3, -1/3? -3 Which is the third smallest value? (a) -2/5 (b) 4 (c) -75 (d) -5 a What is the biggest value in 0.2, -13/2, 3? 3 Which is the fifth smallest value? (a) -0.3 (b) 0.5 (c) -10/3 (d) 0.05 (e) 1 e Which is the third biggest value? (a) 88 (b) 3/10 (c) 4 (d) -7 (e) 0 b What is the third biggest value in 3/4, -2/5, -135/26? -135/26 Which is the third smallest value? (a) 150 (b) 2/3 (c) 5/3 a Which is the second smallest value? (a) 5 (b) 8 (c) 9/8 a Which is the fourth biggest value? (a) 1.1 (b) 0.5 (c) 0.04 (d) -5 d What is the second smallest value in 1, 5/24, -1? 5/24 Which is the third smallest value? (a) -1/3 (b) -0.3 (c) -2.46 b Which is the fourth smallest value? (a) 1/6 (b) 3/2 (c) -0.2 (d) 5/9 (e) -2 d Which is the third smallest value? (a) -1/4 (b) -5 (c) -634/7 a What is the fourth smallest value in -7, 8, 4, -2, 0.2? 4 What is the second smallest value in 0.26, -1.4, 3? 0.26 Which is the smallest value? (a) 18 (b) -2/13 (c) -6 (d) 3 c Which is the second smallest value? (a) 2 (b) 0.4 (c) -2/5 (d) -18 c Which is the second smallest value? (a) 0 (b) -4 (c) 9 (d) 6/59 a Which is the fourth smallest value? (a) 3 (b) -3 (c) -1 (d) -2/9 a What is the fourth smallest value in 1/8, 1/2, 2, 4/7? 2 What is the second smallest value in 1/3, 0.3, -0.2, -0.5? -0.2 What is the third biggest value in -0.5, 1/5, -1670? -1670 Which is the second biggest value? (a) -2/43 (b) 0.4 (c) 5.5 b What is the second smallest value in 1/140, -1, -4? -1 What is the second smallest value in -0.091, 5, 0.04? 0.04 Which is the fifth smallest value? (a) 0.5 (b) -4 (c) 2 (d) 390 (e) -5 d Which is the third smallest value? (a) -1/4 (b) 4 (c) 2/5 (d) 3/2 d Which is the third biggest value? (a) 5 (b) -66 (c) -1 (d) -4 d Which is the second biggest value? (a) -1/4 (b) -2 (c) -2/103 a Which is the second biggest value? (a) 0.085 (b) 0.1 (c) -2/9 (d) 0.4 b Which is the third biggest value? (a) 273 (b) 5 (c) -3 (d) 0.2 d What is the smallest value in 5.26, -0.7, -1? -1 What is the fourth smallest value in -12, -5, 4, -4? 4 What is the second smallest value in -2/5, 0.3, 5, -3/13? -3/13 Which is the third biggest value? (a) -2/5 (b) 5 (c) 32 a Which is the second biggest value? (a) 0.02 (b) -1/8 (c) -1/5 (d) 1 a Which is the fourth biggest value? (a) -1.1 (b) 0.1 (c) -5 (d) -1 c Which is the second biggest value? (a) -0.3 (b) -41 (c) 7 (d) -1/4 d Which is the smallest value? (a) -2/13 (b) -2 (c) 4.9 (d) -0.7 b Which is the fourth biggest value? (a) 2/9 (b) 1/6 (c) 3 (d) -6/11 d What is the second smallest value in 5, -3, -4, 0.5, -2/3? -3 What is the fourth smallest value in -7, 2, -5, 5? 5 Which is the fourth smallest value? (a) -8 (b) 0.01 (c) 2 (d) -5 c What is the fourth smallest value in 2, -3, 1/6, 0.241? 2 Which is the third biggest value? (a) 3/2 (b) -3 (c) -65 c What is the second biggest value in 4, 0.5, 0.3, -24/13, -3? 0.5 Which is the smallest value? (a) 27/10 (b) -0.1 (c) -27 c What is the second smallest value in -0.086, 0, 2/5, -2? -0.086 Which is the biggest value? (a) -0.4 (b) 69 (c) 12 (d) -1 b What is the second biggest value in 1, -1, -1160? -1 What is the second smallest value in -4, 1/10, -1, 1, 3? -1 Which is the second smallest value? (a) 4 (b) 0 (c) 7 (d) -1 b What is the second biggest value in -0.5, -0.4, -1.6, 0.4? -0.4 What is the second smallest value in 4, 1, 160, -1? 1 What is the fourth smallest value in 0.4, -1/6, 0.05, -0.4? 0.4 Which is the third smallest value? (a) 0.3 (b) 2 (c) 5 (d) 4 d Which is the second biggest value? (a) 1/5 (b) -0.5 (c) -6057 b What is the biggest value in 0, 2/7, -5/17, 0.4, -4? 0.4 What is the second biggest value in 0, -0.0533, -0.5? -0.0533 Which is the second biggest value? (a) 26 (b) -4 (c) 3/4 (d) 5 (e) -0.05 d What is the third smallest value in -2, -2/3, -8/3, -3/7? -2/3 What is the biggest value in -178, 0, 0.1? 0.1 Which is the third smallest value? (a) 2 (b) -2/107 (c) -1/3 (d) -4 b Which is the second biggest value? (a) -4 (b) 8 (c) -28 a What is the smallest value in -6, -4, 0.13, 2/13? -6 What is the second biggest value in 5, -98, 2? 2 What is the smallest value in 95, 0.4, -2, -1/7? -2 Which is the smallest value? (a) 257 (b) 3 (c) 5/3 c What is the second smallest value in -2/153, -3, 2, -4, -1/5? -3 Which is the third biggest value? (a) -1/2 (b) -3 (c) 1 (d) -1 (e) -35 d Which is the biggest value? (a) 7 (b) 2 (c) 2/11 a Which is the smallest value? (a) -2 (b) 986 (c) 0.4 a Which is the third smallest value? (a) -2/9 (b) -3 (c) 0.5 (d) -2 (e) -35 d Which is the third smallest value? (a) 3/5 (b) -0.2 (c) -0.12 (d) 1.1 (e) -1 c What is the second biggest value in 3, 0.3, 4/183? 0.3 What is the second biggest value in -2/17, -0.091, 2, -2/3, -0.4? -0.091 Which is the smallest value? (a) -3 (b) 2/13 (c) -4 (d) -7 d Which is the smallest value? (a) -62/5 (b) -5 (c) 3 a What is the fourth smallest value in 0.913, -1/3, 3, 1? 3 What is the third biggest value in -2, -1/136, -2/15? -2 Which is the fourth smallest value? (a) -1 (b) 0.06 (c) 4 (d) -2/17 (e) -0.1 b Which is the fifth smallest value? (a) -2 (b) 2 (c) -1/2 (d) -3/23 (e) 3 e What is the biggest value in -0.1, -2.86, 1? 1 Which is the second biggest value? (a) -4 (b) 47 (c) 0.2 (d) 0 (e) 2 e Which is the biggest value? (a) -3 (b) -17 (c) 1.2 c What is the fourth smallest value in 540, 1/4, 4, -3? 540 Which is the second biggest value? (a) 17 (b) 0.4 (c) -0.2 (d) -3 b Which is the second smallest value? (a) 3 (b) 2.05 (c) 2 (d) -2/9 (e) -0.4 d Which is the s	{ "pile_set_name": "DM Mathematics" }
our letters picked without replacement from aaaayyyaaayayyya. Give prob of picking 1 a and 3 y. 9/52 Three letters picked without replacement from {c: 2, n: 3}. What is prob of picking 1 n and 2 c? 3/10 Calculate prob of picking 1 g and 3 l when four letters picked without replacement from {g: 9, l: 3}. 1/55 Three letters picked without replacement from djhjyjjjfhh. What is prob of picking 1 j, 1 y, and 1 d? 1/33 What is prob of picking 4 k when four letters picked without replacement from kikkkii? 1/35 What is prob of picking 1 r and 1 d when two letters picked without replacement from dhrrwwrwhjajhrj? 4/105 Calculate prob of picking 2 o when two letters picked without replacement from llooolollll. 6/55 Two letters picked without replacement from jjkjjjjmjjj. Give prob of picking 2 m. 0 Calculate prob of picking 2 x when two letters picked without replacement from vevvevxxvvssevx. 1/35 What is prob of picking 1 x and 1 e when two letters picked without replacement from eeeeeexeeeeeeeeeeee? 2/19 Two letters picked without replacement from {c: 1, p: 1, z: 7, x: 2, n: 2, v: 1}. Give prob of picking 1 x and 1 z. 2/13 What is prob of picking 2 p when two letters picked without replacement from wpwap? 1/10 What is prob of picking 1 m and 1 d when two letters picked without replacement from dbqmbjc? 1/21 Two letters picked without replacement from ffffaoafooioifaia. Give prob of picking 2 o. 3/68 Three letters picked without replacement from tchsjqsshshsc. Give prob of picking 1 j, 1 t, and 1 q. 1/286 What is prob of picking 3 i when three letters picked without replacement from ibiibxbbiiix? 1/11 Calculate prob of picking 2 m when two letters picked without replacement from qqqqmmqqqqqqqqmmmq. 10/153 Four letters picked without replacement from {e: 1, v: 1, n: 2, z: 2}. What is prob of picking 1 v, 2 z, and 1 e? 1/15 Three letters picked without replacement from fffqffqff. What is prob of picking 1 q and 2 f? 1/2 What is prob of picking 2 x when two letters picked without replacement from zxxxlxzszvfxx? 5/26 Calculate prob of picking 1 z and 1 m when two letters picked without replacement from zmzkkkzkzzz. 6/55 Two letters picked without replacement from xxffffxfxxxxxfxf. What is prob of picking 2 x? 3/10 Two letters picked without replacement from {b: 1, e: 1, m: 1, i: 1, n: 1}. What is prob of picking 1 i and 1 n? 1/10 Four letters picked without replacement from kxrdrxdxkdexkmx. What is prob of picking 2 x, 1 d, and 1 r? 4/91 Four letters picked without replacement from {j: 7, v: 8, a: 1, t: 1}. What is prob of picking 3 a and 1 t? 0 Four letters picked without replacement from {s: 1, r: 14}. Give prob of picking 3 r and 1 s. 4/15 What is prob of picking 1 m and 1 v when two letters picked without replacement from {s: 1, c: 1, m: 1, x: 2, v: 2}? 2/21 Four letters picked without replacement from yksshyzkzjhzkyh. Give prob of picking 1 y and 3 h. 1/455 Calculate prob of picking 1 n, 2 a, and 1 h when four letters picked without replacement from aaaxxnxxaaxaxahaaax. 15/1292 Two letters picked without replacement from iiieewiiiiiim. What is prob of picking 1 w and 1 m? 1/78 Calculate prob of picking 1 s and 2 o when three letters picked without replacement from ssssosssssososssso. 7/68 What is prob of picking 1 p and 1 m when two letters picked without replacement from pbffyfm? 1/21 What is prob of picking 1 o and 1 p when two letters picked without replacement from ppppopppo? 7/18 What is prob of picking 1 q, 2 j, and 1 h when four letters picked without replacement from rjkqrqhhjjjqqhhr? 24/455 Four letters picked without replacement from qhlhqhvqhlvqqhqqqql. Give prob of picking 1 q, 1 l, and 2 h. 45/646 Three letters picked without replacement from {c: 8, s: 2}. Give prob of picking 2 s and 1 c. 1/15 Four letters picked without replacement from {d: 7, l: 1, c: 1, x: 3}. What is prob of picking 1 c, 2 x, and 1 d? 7/165 What is prob of picking 2 o and 2 c when four letters picked without replacement from ocjocccjccccc? 36/715 Two letters picked without replacement from {i: 3, r: 6, s: 4, q: 6}. What is prob of picking 2 i? 1/57 Calculate prob of picking 2 k when two letters picked without replacement from ckcciikckcccikci. 1/20 Calculate prob of picking 1 g and 1 m when two letters picked without replacement from {f: 1, m: 1, p: 3, g: 2}. 2/21 What is prob of picking 3 g when three letters picked without replacement from ggggg? 1 Three letters picked without replacement from {g: 4}. Give prob of picking 3 g. 1 What is prob of picking 2 o and 2 r when four letters picked without replacement from oorrrrorororroooroo? 135/323 Calculate prob of picking 1 e, 1 o, and 1 q when three letters picked without replacement from eeogdqd. 2/35 Two letters picked without replacement from jlefje. Give prob of picking 1 f and 1 e. 2/15 Two letters picked without replacement from igige. What is prob of picking 2 g? 1/10 Two letters picked without replacement from {c: 2, m: 3, g: 13}. Give prob of picking 2 m. 1/51 What is prob of picking 2 t when two letters picked without replacement from {t: 5}? 1 Calculate prob of picking 1 g and 2 z when three letters picked without replacement from {d: 5, n: 1, l: 3, g: 2, y: 4, z: 5}. 1/57 Three letters picked without replacement from bggg. What is prob of picking 1 b and 2 g? 3/4 Two letters picked without replacement from {b: 16, m: 2}. What is prob of picking 1 m and 1 b? 32/153 Three letters picked without replacement from nnsv. Give prob of picking 2 n and 1 s. 1/4 Calculate prob of picking 1 g and 1 u when two letters picked without replacement from uguvugggvggg. 7/22 Calculate prob of picking 4 u when four letters picked without replacement from {c: 2, u: 11}. 6/13 Three letters picked without replacement from {g: 6, t: 7}. What is prob of picking 3 g? 10/143 What is prob of picking 3 e when three letters picked without replacement from iileeen? 1/35 What is prob of picking 1 b and 1 u when two letters picked without replacement from babduddd? 1/14 Three letters picked without replacement from hajhhhhahjhhh. What is prob of picking 2 j and 1 h? 9/286 Two letters picked without replacement from gcggcgcgccggcccgggcc. What is prob of picking 2 g? 9/38 Two letters picked without replacement from {w: 3, o: 2, r: 1, i: 2, s: 4}. What is prob of picking 1 w and 1 r? 1/22 Two letters picked without replacement from rarrarrarraaaarraaa. What is prob of picking 1 a and 1 r? 10/19 Two letters picked without replacement from {r: 1, h: 2, w: 2}. What is prob of picking 1 w and 1 r? 1/5 Calculate prob of picking 2 c when two letters picked without replacement from {c: 17, o: 3}. 68/95 Three letters picked without replacement from {o: 5, l: 14}. Give prob of picking 1 l and 2 o. 140/969 Two letters picked without replacement from odd. Give prob of picking 2 d. 1/3 What is prob of picking 1 v, 1 m, and 2 b when four letters picked without replacement from vmvsbub? 2/35 What is prob of picking 1 p, 1 b, and 1 i when three letters picked without replacement from {p: 3, k: 3, b: 1, i: 5}? 3/44 Two letters picked without replacement from qcxmcmmqqmmqmqqcc. Give prob of picking 1 q and 1 x. 3/68 Four letters picked without replacement from {c: 12, o: 2, g: 2, l: 2}. What is prob of picking 2 o and 2 l? 1/3060 Three letters picked without replacement from ututututuu. Give prob of picking 1 u and 2 t. 3/10 Four letters picked without replacement from {r: 2, m: 7, b: 2}. Give prob of picking 4 m. 7/66 Three letters picked without replacement from {d: 9, l: 1, s: 2, r: 3, z: 4}. Give prob of picking 1 s, 1 z, and 1 d. 24/323 Two letters picked without replacement from {j: 6, g: 5, u: 1, s: 2, q: 1, p: 2}. Give prob of picking 1 p and 1 q. 1/68 Three letters picked without replacement from nmmdndndndndd. Give prob of picking 1 n, 1 m, and 1 d. 30/143 What is prob of picking 1 f and 1 o when two letters picked without replacement from {s: 1, f: 7, o: 6}? 6/13 Calculate prob of picking 4 i when four letters picked without replacement from iiiiiiisissiiiiiisii. 364/969 Three letters picked without replacement from {i: 1, m: 1, k: 1, q: 2, h: 1, p: 1}. Give prob of picking 1 m, 1 i, and 1 h. 1/35 Two letters picked without replacement from zvz	{ "pile_set_name": "DM Mathematics" }
c - 3c + 24. Calculate the remainder when s is divided by c. 8 Suppose 4l - 76 - 156 = 0. What is the remainder when l is divided by 16? 10 Suppose 2p - 2a + 5a - 5 = 0, -15 = -4p - 5a. Let o = p + -4. What is the remainder when 10 is divided by o? 4 Let t be (1 + 1)/((-4)/(-22)). Let g = t + -15. Calculate the remainder when 14/g(0 - 2) is divided by 3. 1 Let g(u) = -u*3 + 4u*2 + 2u - 2. What is the remainder when g(4) is divided by 3? 0 Let p(m) = m + 8. What is the remainder when p(-5) is divided by 2? 1 Let j(p) be the third derivative of p*5/30 + 3p*4/8 - 5p*3/3 - 17p*2. Suppose 0 = c + 2 + 5. Calculate the remainder when j(c) is divided by 14. 11 Let x be (0 - (-30)/(-9))-3. Suppose 5f + x = 85. What is the remainder when f is divided by 1/(-4) + (-33)/(-4)? 7 Let u = 0 - 7. Let g(n) = n3 + 6n*2 - 7n - 4. Let a be g(u). Calculate the remainder when 3 is divided by (-1 - 0)/(2/a). 1 Suppose 0a + 4a = 16. Suppose 22 = 2g + 5f - 33, -ag + 35 = -5f. Calculate the remainder when 26 is divided by g. 11 Let i(p) = 22p2 + 4p - 2. Let k be i(3). Let f = -129 + k. Suppose 3z + 28 = f. What is the remainder when z is divided by 9? 8 Let b be (-492)/(-44) + 4/(-22). Suppose o - b = -4j + 10, 24 = 4j + 4o. Calculate the remainder when 15/2 - (-2)/4 is divided by j. 3 Let c(v) = -v*2 - 10v. Let w be c(-10). Suppose 1 = -4l - 3m, w = 3l - m + 6m + 9. What is the remainder when 2 is divided by l? 0 Let n be (2/(-2))/((-1)/15). Suppose -3c + 0 = -n. Calculate the remainder when 13 is divided by c. 3 Let c(b) = -16b*3 - 5b*2 - 3b + 1. Let a(p) = 28p + 1. What is the remainder when a(2) is divided by c(-1)? 12 Suppose -200 = -5r - 0r. What is the remainder when r is divided by 14? 12 Suppose -2n = 2t - 40, -5t = -3 - 2. Let q = 84 - 29. What is the remainder when q is divided by n? 17 Let q(z) = 45z + 2. What is the remainder when q(1) is divided by 16? 15 Let q = 27 + -17. Calculate the remainder when 37 is divided by q. 7 Let a = 27 - 10. Calculate the remainder when a is divided by 441/91 - (-2)/13. 2 Suppose 3n + 15 = 45. Suppose l + 5t - 2t = -n, 2l = t + 15. What is the remainder when 8 is divided by l? 3 Let k(w) = w2 - 11w - 17. Calculate the remainder when 34 is divided by k(13). 7 Let p = -6 + 8. Let m(g) = -3g + 27. Calculate the remainder when m(5) is divided by (-2 - 0)(-7)/p. 5 Let z(y) = 4y + 5. Let m be ((-4)/(-6))/((-22)/(-165)). What is the remainder when (296/(-20))/((-2)/10) is divided by z(m)? 24 Let l(w) = 2 + 2 - w - 2. Let j be l(4). Let o = j - -13. What is the remainder when o is divided by 6? 5 Suppose -3t + 21 = -18. Let c be (-8)/(-12) + (-453)/(-9). Suppose 5i = -j + 30, -2j + c = -0j + i. Calculate the remainder when j is divided by t. 12 Suppose 5u - 10 = 0, 5d + 0u = -2u + 514. Calculate the remainder when d is divided by 15. 12 Let y(z) = -3z + 2. What is the remainder when 58 is divided by y(-5)? 7 Suppose 0y - 2y = 8. Let n = 3 - 0. Calculate the remainder when 4(-1 - 13/y) is divided by n. 0 Let q = 100 + -80. What is the remainder when q is divided by 9? 2 Calculate the remainder when (9/36)/(1/100) is divided by 4. 1 Suppose -126 = -4l + l. Suppose -39 = -5c + 4j, -2j + 3j - 59 = -5c. Calculate the remainder when l is divided by c. 9 Suppose i - 18 = 4i. Suppose h = -z - 22, -4h = -2z - z - 45. Let s = i - z. Calculate the remainder when s is divided by 5. 3 Let o(n) = -n*2 + 4n + 3. Let w be o(4). Let f(l) = 4l + 2. Calculate the remainder when 4/14 + (-556)/(-14) is divided by f(w). 12 Suppose -6w - 6 = -18. Let t = 3 + -7. Calculate the remainder when w is divided by (-3 - 1)2/t. 0 Suppose 12j = 13 + 95. What is the remainder when 21 is divided by j? 3 Suppose -3s + 1 + 1 = 4y, -5s + 5y + 50 = 0. What is the remainder when 14 is divided by s/(-12) - 22/(-4)? 4 Suppose -13 = -r + 84. Calculate the remainder when r is divided by 20. 17 Let y = -4 - -2. Let u(w) = -34w - 3. Calculate the remainder when u(y) is divided by 22. 21 Let r = 6 - 2. Let z(g) = g2 + 1. Calculate the remainder when z(r) is divided by 6. 5 Suppose 2p = p + 1. Let o be ((-2)/p)/(6/(-6)). Suppose n + 3d = 18, 4n + od + d - 36 = 0. Calculate the remainder when 16 is divided by n. 4 Let d = -23 - -38. Calculate the remainder when (18/(-8))/((-1)/12) is divided by d. 12 Suppose 0 = 2w - 4 - 20. Suppose -5y + 5v + 20 = 3v, -w = -3y + 2v. Let m(u) = -u3 + 9u*2 - u + 12. What is the remainder when y is divided by m(9)? 1 Suppose 0k = 4k - 136. Calculate the remainder when k is divided by 18. 16 Suppose -2w + l + 37 = 0, l - 15 = -2l. Let f = 62 + 0. Calculate the remainder when f is divided by w. 20 Suppose o - 5x = -0o + 17, 3o = x + 107. Suppose -o + 5 = -2u. Let w(r) = r3 - r2 - 4r. What is the remainder when u is divided by w(3)? 4 What is the remainder when -1(-1)/(-4) - (-441)/4 is divided by 28? 26 Let q = 138 - 73. Calculate the remainder when q is divided by 17. 14 Suppose -2c = -c - 3d - 13, -2d = -5c. Calculate the remainder when 18 is divided by c/7 - (-357)/49. 4 Suppose 3 - 2 = -c - 5s, -5c - 4s = -37. Suppose -c = 3l, -v + 2v + 4l - 33 = 0. Calculate the remainder when v is divided by 16. 13 Let w = -30 + 48. Calculate the remainder when 51 is divided by w. 15 Let z be (-2)/6 + 43/3. Suppose -r = x - 0r + z, 0 = 5r + 15. Let q = x + 28. What is the remainder when q is divided by 6? 5 Let h(i) = 8i3 + i2. Let u(w) = -w*2 + 3w + 5. Let c be u(4). Calculate the remainder when 25 is divided by h(c). 7 Suppose -28 + 4 = -2b. Let c be 1/((1 - 0)/2). Let z = 20 + c. Calculate the remainder when z is divided by b. 10 Let l(b) = -3b - 5. Let h be l(-4). Let r(c) = c*2 - 6c + 8. Calculate the remainder when 42 is divided by r(h). 12 Let k = 43 + -26. Let z(s) = -s*2 + 20s + 30. Calculate the remainder when k is divided by z(21). 8 Let d(a) = -2a + 81. Let b be (0/7)/((-4)/(-2)). What is the remainder when d(b) is divided by 21? 18 Let g(f) = -2 - 3 + 3 - 4f - f*2 - 2f. Calculate the remainder when g(-5) is divided by 2. 1 Let w = 10 + -7. Let l(n) = 0n3 - 3n*2 - 1 + 7n - n*w - 4n. Calculate the remainder when 11 is divided by l(-4). 2 Let q(g) be the second derivative of g5/20 - g4/12 + g3/6 + g2 + 3g. What is the remainder when 30 is divided by q(2)? 6 Let i = 17 + -12. Let x be -3(-1 + i/3). Calculate the remainder when 68 is divided by 163/7 + x/7. 22 Suppose -2t + 203 = 5t. Calculate the remainder when t is divided by 1/4 + (-39)/(-4). 9 Let r be (6/(-21))/(4/(-28)). Suppose 4 + 1 = 3i + 4j, -ri + 3j = -26. Calculate the remainder when 25 is divided by i. 4 Suppose -3u + 3s = -8u + 190, -25 = -u + 2s. Suppose -5z + 72 + 23 = 0. What is the remainder when u is divided by z? 16 Let w = -16 - -1. Let i be (-93)/w - (-2)/(-10). Suppose ih - 7h = -27. What is the remainder when h is divided by 14? 13 Let h be -9(-3)/(-27)3. Suppose 3w - 4o = -7, -w + 0o + 1 = 2o. Let c = w - h. Calculate the remainder when c is divided by 2. 0 Suppose -2v = -v - 2l - 92, 4v = l + 361. Suppose -6y + y - v = 0. Calculate the remainder when 38 is divided by 4 - y - 21. 18 Let f = -5 + 7. Suppose -fd + 5g + 48 = 11, 0 = 4d - 5g - 79. What is the remainder when d is divided by 12? 9 Let b = 232 + -405. Calculate the remainder when (-335)/(-9) - (-12)/(-54) is divided by b/(-9) - (-4)/(-18). 18 Let i(f) = 21f + 1. What is the remainder when i(1) is divided by 6? 4 Suppose 0 = -2m - 2, j + 12 = m + 34. Calculate the remainder when 61 is divided by j. 19 Let w be 6/(-21) - 52/14. Let j(l) = -l - 6. Let d be j(-7). What is the remainder when 15 is divided by d/w - (-165)/20? 7 Suppose 2i + 17 = j, -j = 7i - 3i - 23. Suppose -2s = -v + j, -2v + 5s + 70 = 2v. What is the remainder when 43 is divided by v? 13 Suppose -4v - 32 = -3q, 0q + 3q = -5v - 13. Let a(s) = -8s + 2. What is the remainder when a(v) is divided by 22? 20 Suppose 2i - 2 = i - 4j, 3i - 6 = 2j. Suppose -il - 4z + 0 - 6 = 0, l = -4z - 11. Calculate the remainder when 14 is divided by l. 4 Let i(k) = -4k + 2. Suppose -s - 4s = 35. Let g be i(s). Suppose 2 = m - g. What is the remai	{ "pile_set_name": "DM Mathematics" }
p(2/17)p*(-2/19)p(-2) assuming p is positive. p(650/323) Simplify ((u/(((((u*6/uu)/u)/u)/u)/u))/((u/(uu(2/9)uu))/u))/(u(-7)/u4) assuming u is positive. u(119/9) Simplify (f(1/4)/((f0f)/f))(-1/4) assuming f is positive. f(-1/16) Simplify (oo(-1)/o)40/((oo/o6)/(((o/(((o/((((o(-5)o)/oo)/o)/o))/o)/o))/o)/ooo)) assuming o is positive. o(-40) Simplify (i(-7))45 assuming i is positive. i(-315) Simplify (g(1/19))(14/3) assuming g is positive. g(14/57) Simplify y/(y(-18/5)y)y(16/7) assuming y is positive. y(206/35) Simplify ll(-4/5)/ll*(-2)l(2/3)/((l/(l(-1)ll))/l) assuming l is positive. l(-17/15) Simplify o/(o2/o)o3(oo(1/3))8 assuming o is positive. o(41/3) Simplify (((c/c(-2/5))/c)(-2/25))(1/32) assuming c is positive. c(-1/1000) Simplify (vv/v*(2/81)v)/(v/v*20v) assuming v is positive. v(1699/81) Simplify (w/w(1/6))/(((w(-4/7)/w)/w)/w) assuming w is positive. w(185/42) Simplify (x*9/xx(xxx(-2/13)x)/xx)(-1/5) assuming x is positive. x(-154/65) Simplify ((b(2/3))(-3/5))(-3/7) assuming b is positive. b(6/35) Simplify z(14/5)/(zzzz*(-6/11)/zz) assuming z is positive. z*(19/55) Simplify (d/(dd*(-4/13)d))/dddd(-29) assuming d is positive. d(-373/13) Simplify ((ff*(-2)/ff)/f)38 assuming f is positive. f(-76) Simplify ((f(-2/5))(-44))(-13/3) assuming f is positive. f(-1144/15) Simplify (y/(y14/y))/y(-18/7) assuming y is positive. y(-66/7) Simplify r(1/3)rr16/r assuming r is positive. r(49/3) Simplify pp/p(-7)p/(((p*(-3)p)/p)/p)((ppp(-1/2))/p)(-1) assuming p is positive. p(27/2) Simplify (z(-2/55)/z)/(z(z/z(-1/2))/z) assuming z is positive. z(-279/110) Simplify (t(1/4))(1/55) assuming t is positive. t(1/220) Simplify l(1/3)(l/l(-19/3))/ll assuming l is positive. l(23/3) Simplify (n/n(-4/9))10 assuming n is positive. n(130/9) Simplify ((o/o*(-7))/(oo/(o/o*(-1/2))oo))/(o1)(-44) assuming o is positive. o(99/2) Simplify ((((o/o7)/o)/o)27)(-3/13) assuming o is positive. o(648/13) Simplify q0q*(-28)q assuming q is positive. q(-27) Simplify (r(-4)r4)/((r/(rr*(3/2))r)/(r/r4)) assuming r is positive. r(-5/2) Simplify p*7pp(-14) assuming p is positive. p(-6) Simplify (((i(2/11)/i)/i)/i)(-1/35) assuming i is positive. i(31/385) Simplify (t/(t0t))*(-40) assuming t is positive. 1 Simplify (nn/(n*0n))*(-1/15)/(n/(n/(nn*1)n))(-6/35) assuming n is positive. n(11/105) Simplify (p/(p/p*(-3))pp)/(pp/(p(p/(p/p(18/5)))/p)p) assuming p is positive. p(-2/5) Simplify z34/z(-3/8) assuming z is positive. z(275/8) Simplify c*(-12)cc(-12/5)c assuming c is positive. c*(-62/5) Simplify ((y/(yy*6/yy))/y(-1/7))33 assuming y is positive. y*(-1353/7) Simplify ((x/(x/((xx*(-8))/xx)))/((x(-1)/x)/x))(3/11) assuming x is positive. x(-12/11) Simplify (d(21/2))3 assuming d is positive. d(63/2) Simplify nnn*(19/5)n(-29) assuming n is positive. n(-116/5) Simplify (z(1/2))(-6)(zz(-2/5))(-11) assuming z is positive. z*(-48/5) Simplify ((r((r/r*(-1/14))/rr)/r)/r)/r*(-11)r/r*(-1/10)r11 assuming r is positive. r(811/35) Simplify (s*(-4)s(-1))/(s/((s/s(-2/21)s)/s)s/(s*(2/7)s)s) assuming s is positive. s(-118/21) Simplify (((j(-8)/j)/j)/j(-8))/(j(-5)/jjj/(j(-6)/j)) assuming j is positive. j(-5) Simplify (s(-6)/sss/(s5/s)s)33 assuming s is positive. s(-264) Simplify (a(1/7)/a(-6))/(a*2/(a/(aa*(-3)a))) assuming a is positive. a(43/7) Simplify q(-2)q0 assuming q is positive. q(-2) Simplify (i2)(-3)(ii(-1/3))/iiii4 assuming i is positive. i(-1/3) Simplify ((j(-3)/j)/(j/(j/(j/j(6/7)))))/(j*(-1/4)j/j(-5)) assuming j is positive. j(-277/28) Simplify ((h*(-2)/h)/hh)*(2/5)h(-2/15)/(h/h(-4/9)) assuming h is positive. h*(-25/9) Simplify (jj*(-2/11)/jj)/j*(-4)j*(-5)j(-2/3) assuming j is positive. j(-28/33) Simplify ((o*(-5)/ooo)/(o/(o(-2/5)/o)o))(4/5) assuming o is positive. o(-148/25) Simplify (t0)(-38)/((t9/t)/t(2/3)) assuming t is positive. t(-22/3) Simplify (t(-9)/(tt(-4)/t))/(t(1/10)tt(-1/2)/t) assuming t is positive. t(-23/5) Simplify (z/(z(-11)/zz))(-21) assuming z is positive. z(-252) Simplify s*7/ss(9/4) assuming s is positive. s(33/4) Simplify k*0/kkk24 assuming k is positive. k24 Simplify c(-4/7)/cccc(-13) assuming c is positive. c(-88/7) Simplify (t*(-2)t)*(-2)(t(t/(t(-2/19)t))/t)/(tt(-8)) assuming t is positive. t(173/19) Simplify (uu2)/u5(u(1/6)/u)/(u/(uu/u*(3/8)u)) assuming u is positive. u*(-29/24) Simplify (kkkk/k*(2/5)kkk*(4/7)k)/(k1)28 assuming k is positive. k(-729/35) Simplify (j18)24 assuming j is positive. j432 Simplify ((g/(g/(gg/(g(-1/13)g)))g)/ggg)/ggg(-2/9)/g(gg/g2)7 assuming g is positive. g(217/117) Simplify x(-2/3)x(x(-1)/x)/xx(-4/3)/x(2/17) assuming x is positive. x*(-70/17) Simplify ((hh/(hh(1/14)))/h(1/2))/(h(-2/3))(-2/37) assuming h is positive. h(305/777) Simplify (z/z17)32 assuming z is positive. z(-512) Simplify n(-6)nn(-10)n*10n*(2/21)n assuming n is positive. n(-82/21) Simplify (g/g(-1/4))*(-16)/(gg*(4/9)gg(-1/9)) assuming g is positive. g(-67/3) Simplify (v(-3/5))(-13/5) assuming v is positive. v(39/25) Simplify (ggg(-1/6)gggg(-2/19))(4/5) assuming g is positive. g(1078/285) Simplify (m/m0)40/(m2)(-11/7) assuming m is positive. m(302/7) Simplify (d(-7)/(dd*(-4)))/(dd/(ddd*(-2/7))ddd(-1/10)) assuming d is positive. d(-433/70) Simplify (www*(1/7)w)(-5/3) assuming w is positive. w(-110/21) Simplify z11/((((z/(z(-1/12)z))/z)/z)/z) assuming z is positive. z(167/12) Simplify (((xx*(-6))/xx)/xx)21 assuming x is positive. x(-105) Simplify ((u(-37)u)/u)/u0 assuming u is positive. u(-37) Simplify (oo(-2/3))42o/(ooo*(-1)oo)ooo6 assuming o is positive. o20 Simplify (rr(-6)/rr*(2/9))/(rr0)(-2/157) assuming r is positive. r(-8146/1413) Simplify i(1/2)(i8i)/i assuming i is positive. i(17/2) Simplify j(-3)j/(j/((((j(j/((j/j*(1/7))/j))/jj)/jj)/jj)/j))j(-1/4)/((j(3/7)/j)/j) assuming j is positive. j(-15/28) Simplify (o(-1/4)o)*(-28)(o(2/3))9 assuming o is positive. o(-15) Simplify (d1d)(-1/13)dd/(dd*7)d*6d assuming d is positive. d(11/13) Simplify ((p(-1))(7/3))41 assuming p is positive. p*(-287/3) Simplify (kk/((kkk*(-2/3)kkk)/kk))/k(-2/49) assuming k is positive. k(-337/147) Simplify ((qq6/q)/q8)(-23) assuming q is positive. q46 Simplify o*(-2/7)oo/o4 assuming o is positive. o(-16/7) Simplify (b30/bb)(-47) assuming b is positive. b(-1410) Simplify ((k/(k*(6/5)k))/k)/(k/(k/k*(-1/5)))k/((k/k*(-10/7))/k)kk(-1/7) assuming k is positive. k(-11/7) Simplify c(-7)/c(-6)(c/(ccc*(-2/5)c))/cccc(2/5) assuming c is positive. c(-6/5) Simplify y(-1)y*(-7)/y(y(2/7)/y)(-34) assuming y is positive. y(107/7) Simplify (l(-34))(-15) assuming l is positive. l510 Simplify p(-5)/p(-1/12)(p(pp(2/3)/pppp)/pp)/p(2/7) assuming p is positive. p(-15/28) Simplify (y/((y/y(2/15))/y)y5)18 assuming y is positive. y*(552/5) Simplify (tt*3)/(tt(-1/5)/t) assuming t is positive. t(21/5) Simplify (f/(ff(-3/4)/f))/f(-5)(ff(-1/4)ff)/ffff*(5/2)f assuming f is positive. f14 Simplify (l(-5/8))19 assuming l is positive. l(-95/8) Simplify z*(1/11)z(7/2) assuming z is positive. z(79/22) Simplify t(-1/4)/(t(-32)/t) assuming t is positive. t*(131/4) Simplify (m/((mm/m*(-5)m)/mm))/mmmm/(mmm*(3/7)mm) assuming m is positive. m(-66/7) Simplify ((i/i(-2/9))/i)/(i(-13/4)/i) assuming i is positive. i(161/36) Simplify ((g(7/3)g)/(g/(gg(-1))))2 assuming g is positive. g(14/3) Simplify ((z/(z6/z)zz)/zz)23 assuming z is positive. z(-46) Simplify xxx/(xx(4/3)/x)xxx/((x	{ "pile_set_name": "DM Mathematics" }
3o5/20 + 5o4/12 + o3/3 - 32o + 7. Calculate g(-3). -42 Let f(v) = v3 - 8v*2 + 7v + 8. Let o be f(7). Let l = 4 - o. Let t(i) = -5i - 9. Let c(j) = 2j + 4. Let w(m) = -7c(m) - 3t(m). Give w(l). -5 Let n(b) = -b*3 - 9b*2 - 8b + 1. Let l be 8/6 + (-1540)/165. Calculate n(l). 1 Let x(w) = -45 - 47 + 90 + w. Suppose 5 = 3u + 23. Give x(u). -8 Let u be (-4)/10 + (-27)/(-5) + -5. Let t(g) = -g2 - g - 6. Calculate t(u). -6 Let s(c) be the first derivative of c5/60 - c4/8 + c3/2 - 3c*2/2 - 24. Let z(f) be the second derivative of s(f). What is z(5)? 13 Suppose -3w = -4w - 5. Let k(h) = 13h + 11. Let q(s) = 22s + 18. Let u(l) = 5k(l) - 3q(l). Determine u(w). 6 Let v = 5 - 2. Suppose vo = -2o. Suppose -4t + 4i + 28 = o, -i - 29 = -3t + 4i. Let n(q) = q3 - 4q*2 + 2q + 2. Calculate n(t). -1 Let l(k) = 16k3 + 2k*2 + k. Let u = 33 - 30. Suppose -2c + n + u = -3c, -c + 4n = -7. Calculate l(c). -15 Let m(x) = x*3 - 13x*2 + 15x - 34. Let i be 504/45 - (-4)/51. Let a be m(i). Let q(c) = 2c*2 + c - 1. Give q(a). 9 Let k = -10 + 12. Let c(u) = 22u*3 + 2 - 2u + 0 + u*2 - 21u*3 + 0u. Calculate c(k). 10 Let t be (-1 - -1 - 0)/(10/10). Let n(c) = -c + 1. Give n(t). 1 Let j(c) = -6c - 48. Let m be j(-7). Let p(o) = o2 + 3o - 2. Calculate p(m). 16 Let h be (-13)/(-5) + (-4)/(-10). Let f(l) = 3 + l*2 - 9 + 3l*2 + hl + 2l2 + l3. Let d(g) = 2g*3 + 3g*2 + g + 1. Let k be d(-2). What is f(k)? 4 Let v = -9 - -15. Let n be (2 + -5)v/9. Let c(h) = 0h2 - 2 + 0h2 - h2. Calculate c(n). -6 Let i be (-71 - -92)((-10)/14 - -1). Let l(t) = t2 - 4t - 11. Give l(i). 1 Let w = 0 - -5. Suppose -11 = wq - 6q. Let p(u) = q + 1 - 9 - u. What is p(4)? -1 Let u(y) = 250 + 257 - 513 - 2y. Calculate u(-5). 4 Suppose -a + 9g = 7g + 3, -g + 3 = -2a. Let p(q) = 29q + 1. Give p(a). -28 Let g(b) be the first derivative of 3b*2 + b + 31. Let i = 13 + -9. Let u be i/(-8) - (-4)/(-8). What is g(u)? -5 Let d(u) = 13u + 3 - 61u - 14 - 4. Let s(q) = 3q + 1. Let n(v) = 2d(v) + 33s(v). Calculate n(-4). -9 Let p be 9 + -4 - (1 + -3). Let v(j) = 2j2 - 14j - 1. Let d(a) = -3a2 + 21a + 2. Let z(h) = pv(h) + 5d(h). Determine z(8). -5 Let c(m) = -4 - 5m + 7 - 2m. Let h(x) = x*3 - 3x - 3. Let w be h(-1). Let d be -1 - ((w - 2) + 0). Give c(d). -11 Suppose 0 = -2l - l - 3s, 0 = -5l - s + 12. Suppose -5x + 28 = 9x. Let u(t) = 0t*2 - 30t*3 + 60t*3 - 2t + xt2 + 1 - 31t*3. Calculate u(l). -14 Let u(f) = f + 8. Let b be u(-6). Suppose 0 = -6z + 20 - b. Suppose -zr - 1 = -7. Let m(i) = i2 + 3i - 1. Give m(r). 9 Suppose 2u + 0f + 7 = f, -5f = -25. Let i(t) be the second derivative of -t3/2 + 3t - 5. What is i(u)? 3 Suppose 0 = -2z - 2u - 14, 7 = -6z + 3z + 4u. Let j(h) = -h2 - 3h + 7. Give j(z). -3 Suppose -5h = -2r - 0h - 23, 4r - 3h + 11 = 0. Let w(f) = -18f + 1. Determine w(r). -17 Let m(l) be the third derivative of l*4 + 138l2. Determine m(-1). -24 Let c be 259/296 - (-3)/24. Let k(r) = r2 + 3 - 5 + 2 - r. Give k(c). 0 Let x(q) = 3q + 1. Let f(s) = -10s - 2. Let h(d) = 5f(d) + 16x(d). Give h(8). -10 Let p(i) = i*3 - 11i*2 + 7i + 34. Suppose -26 = -16h + 13h - 4q, 12 = h - 2q. Give p(h). 4 Let q(y) = 84 - 27 - 33 + 4y2 - 3y + 2y - 26. Calculate q(2). 12 Let m(t) = -t2 + 6t + 0 + 5 + 0t2. Let s(w) = -w2 - 12w - 30. Let n be s(-5). Suppose 0 = 2v - nd - 7, 7 = -2v + d + 18. What is m(v)? 5 Let n(v) = 13v - 8. Let y be (-7 - -2)/(5/(-6)). Let z(g) = -11g + 8. Let k(i) = yz(i) + 5n(i). What is k(6)? 2 Let n(h) = 1. Let l(s) = -7s + 7. Let t be (1 - 6)(-3)/3. Let c(i) = tn(i) - l(i). Suppose -5x + 4 = 3g, x + 9g + 8 = 4g. Calculate c(x). 12 Let b(u) = -u*2 - 5u + 1. Suppose -7 = -4n + 5. Suppose 2y + 0y = 2j + 6, -4j = -ny + 14. Let i be b(j). Let m(t) = 3t2 + 1. Calculate m(i). 4 Let a be ((-4)/(-14))/((-5)/(-70)). Suppose 9j = -5c + aj + 20, 5j - 4 = 3c. Let t(u) = 4 + 2u - 3 + cu*2 - 4u3 - u2 - 3u. Determine t(1). -3 Let o(d) = 23d - 4d2 - 16d - 409d3 + 408d*3. Calculate o(-6). 30 Let v(k) = 5k + 37. Let i(q) = 4q + 25. Let h(p) = 7i(p) - 5v(p). Let j(c) = -2c + 9. Let s(w) = 3h(w) + 4j(w). Calculate s(-7). -1 Let v(p) = p*3 - 5p*2 + 7p - 4. Suppose -143 + 122 = -7t. What is v(t)? -1 Suppose 26u + 8 = 86. Let v(a) = a*2 - 2a + 10. What is v(u)? 13 Suppose 6m - 19 = m - 2s, 4s - 17 = -3m. Let j(y) = 5y - my - 2 + 2. Calculate j(-2). -4 Let m(i) be the second derivative of -i4/4 + i3/6 - 4i2 - 4i. Let l(r) = r*2 + 4. Let w(a) = -7l(a) - 3m(a). Calculate w(-3). 23 Let f = -388 - -390. Let x(i) = -i3 - 3i*2 + 2i - 2. Give x(f). -18 Let a(y) = -2y - 57. Let p be a(-30). Let w(u) = -3u*2 + 1588u + 6u2 - p - 1591u. Give w(3). 15 Let v be ((-13)/26)/(2/(-4)). Let m(a) = 4a + 1. Calculate m(v). 5 Suppose -67 = 7l - 88. Let t(j) = j*2 + 4. Determine t(l). 13 Suppose -4x + 5x = -5o + 6, 0 = -3x + 4o - 20. Let q(h) = 2h + 2. Determine q(x). -6 Let t(v) = -97v - 584. Let h be t(-6). Let r(i) = -i*3 - 3i*2 - 5i - 2. Determine r(h). 4 Let l(p) = -2p2 + 2p. Let x(c) = -2c2 + 4c - 11. Let u be x(4). Let i = 29 + u. Determine l(i). -4 Let i(d) = 15d + d3 + 10d - 2 + 8 + 6d2 - 32d. Give i(-7). 6 Suppose 0 = -68u + 71u - 5x - 3, 4u - 21 = x. Let k(s) = -2s - 1. Calculate k(u). -13 Suppose -4o = -3 + 15. Let t(w) be the third derivative of w6/120 + w5/20 - w*3/6 - 293w2. What is t(o)? -1 Let p(u) = u3 - 5u2 + 5u - 1. Let l be p(4). Suppose -lx = r - 16, 0r + 2x = 2r. Let i(c) = -1 - 1 + 2c - 1. Calculate i(r). 5 Let l(v) = 2v*2 + 3v - 1. Let h be 60/(-48) + (33/(-12) - -3). Let b(o) = 1. Let z(q) = q - 5. Let k(f) = -4b(f) - z(f). Let g be k(h). Determine l(g). 13 Let i(b) = -64 + 2b - 75 + 138 - b2. Let p(n) = -n2 - n. Let y be p(-3). Let u(t) = -t*2 - 5t + 8. Let o be u(y). Give i(o). -1 Suppose 0 = -5v + 13 + 2. Suppose -3y - v = -21. Let m(a) = -a*2 + 12a - 6. Let k(j) = 2j2 - 25j + 12. Let g(b) = 4k(b) + 9m(b). Give g(y). 6 Let r = -6 + 9. Let b(f) = -f*2 - 4f - 1. Let d be b(-3). Let p(m) = 0m + dm*r + 2m - m - 2m2. Determine p(1). 1 Let d(g) = -5g + 0g + 3g2 - g2 + 11g - 4g - 6. Give d(-5). 34 Let t(v) be the second derivative of v*3/2 - 16v*2 - 8v - 9. Give t(14). 10 Let x be (25/6)/563/105. Let h(v) be the second derivative of xv2 + 0 + v3 - 1/2v4 - 5v - 1/20v5. Calculate h(-7). 8 Suppose 166 = 2t + 42. Suppose -5r + t = 17. Suppose 4d - r = 7. Let k(f) = -f*3 + 3f*2 + 6f - 5. Determine k(d). 3 Let d = 1627 - 1631. Let h(p) = -p*2 - 3p + 8. What is h(d)? 4 Let d(c) = -23c + 43c + 2 - 21c. Calculate d(-1). 3 Suppose 0 = 36g - 16 - 20. Let l(n) = -12n2 - 2n + 2. Give l(g). -12 Let t(k) = -2k2 - 38k + 19. Let o(w) = -4w2 - 76w + 34. Let n(p) = -3o(p) + 5t(p). Give n(-19). -7 Let w(m) = -8m3 - 2m*2 - 2m - 1. Let h be (-2 - 0)10/(-4). Let d(z) = -3z + 73. Let l be d(23). Suppose lc + h = -c. What is w(c)? 7 Let m be (-5)/150 + 4. Let s(v) = 63v - 32v + mv2 - 35v + v*3 - 5. What is s(-5)? -10 Let t(l) = -4l*2 - 9l + 6. Let a(h) = h2 - 2. Let j(w) = -a(w) - t(w). What is j(-4)? 8 Let v = 266 + -271. Let s(q) = -q3 - 3q2 + 2q - 6. Determine s(v). 34 Let l be (-55)/(-15) + (-1)/(-3). Let j(z) = 18z3 - 1 + l - 4 - 21z3. What is j(-1)? 2 Let t(y) = 4 + 6 - y2 - 1. Let d(b) = -3b3 - 10b*2 + 9b + 4. Let o be d(-4). Calculate t(o). 9 Suppose 0 = -4g - 3p + 57, -4g - 71 + 107 = -4p. Let u(n) = -n*3 + 11n*2 + 11n + 16. Determine u(g). 4 Let m(n) be the first derivative of -5n2/2 - n + 58. Calculate m(2). -11 Let m(n) = -11 + 61n - 174n + 58n + 56n. Determine m(10). -1 Let i(s) = s2 - 4s + 4. Let w be -2(-2)/(-4)-2. Suppose -wp + 0p - 18 = 0. Let q(v) = -4v2 + 15v - 16. Let f(c) = pi(c) - 2q(c). Determine f(4). 4 Let c(v) = 6v2 + 0v*2 - v - 4 - 2v + 1 + 5. Calculate c(1). 5 Let o be 70/490 - (-12)/14. Let u = 5 - 3. Let k(n) = -4n + 9n - 7n + o - un2. Calculate k(-2). -3 Let z(i) be the first derivative of i2/2 - 6i + 14. Suppose 4	{ "pile_set_name": "DM Mathematics" }
3o2 to the form zo*3 + mo*2 + c + so and give z. 3 Rearrange (-s*2 - 5s + 5s)(80 - 63 + 4s - 89) to ns*3 + d + gs + fs2 and give n. -4 Express (2 - 4 - 1)(g - g - g) + 33 - 70 - 30g + 35 - 4 + 4 - 7g in the form n + zg and give z. -34 Rearrange (-2 + 3 + 0)(7 + 4r - 7) to kr + w and give k. 4 Express (-2m + 2m + m*2)(127m - 40 - 34 + 76) in the form nm*2 + cm*3 + lm + k and give c. 127 Express 297s3 - 101s - s*2 - 295s*3 - 20s as i + gs2 + bs*3 + fs and give f. -121 Express (-a - 3a + 6a)(-67 - 70 + 43)(-1 + 2a + 1) as la + ia2 + b and give i. -376 Rearrange (-585m - 447m + 1189m)(0 + 2m*2 + 0) to the form fm*2 + u + gm*3 + nm and give g. 314 Rearrange (-258 - 75 + 98)(3l - 5l + 0l)(0l + 5l - 3l) to the form bl2 + sl + a and give s. 0 Express -340n - 3055 + 3055 - 413n - 165n as xn + s and give x. -918 Express (x*2 + 4x2 - x2 + (-9x + x - 5x)(3x + 4 - 4))(-2x - 5x + 2x) as ax + f + ix*3 + qx*2 and give i. 175 Rearrange (y - y - 2y)(49 - 629y - 105 + 56) to the form vy2 + j + by and give v. 1258 Express 52h4 - 20 + 6 - 50h*4 + 2h*3 + h as b + vh + jh2 + kh*3 + oh*4 and give v. 1 Express 40o*2 + 83o*2 + 114o*2 + 58o*2 in the form l + mo + yo2 and give y. 295 Express 0a4 + a2 - a*3 + 49a - 4a3 - 57a + a*4 - 2 as ma*4 + ya + sa2 + n + va*3 and give m. 1 Express -51w - 144 + 145 - 181w in the form j + rw and give r. -232 Rearrange 4l3 - 4l*2 - 1 + 1 - 3l + 5l2 to ml + o + rl2 + ql*3 and give r. 1 Express 22q*3 - 39q*3 - 6q + 24q + 2q + 19q3 as g + fq*3 + oq + sq2 and give g. 0 Rearrange 23 - 19 - 62k - 8 + 4k to b + ik and give b. -4 Rearrange (-y + y + 2y)(-y + 0y + 4y + (2y - y + 0y)(18 + 4 - 8)) + (0y + y + 0y)(y + y - y) - y + y - 2y2 to qy + uy2 + h and give u. 33 Rearrange 15 - 121o + 243o - 124o to the form do + a and give d. -2 Express (0 + 2 - x + 0x)(-3x + 2x + 0x)(-1189x*2 - 1364x*2 + 2295x*2) as bx*2 + cx*3 + a + mx*4 + gx and give m. -258 Express (5 - 1 + 2y - 3)((14 - 6y - 14)(-4 + 5 + 2) + 10 - 7y - 10) + y2 + 4 + y - 4 in the form s + hy + wy2 and give h. -24 Rearrange -20 + 10 + 13 + b2 + 20b - 2b2 to the form fb*2 + r + ub and give r. 3 Rearrange -2f2 + 2f*2 + 2f*2 + (f + 7f - 3f)(-1348f + 1350f + 0 - 1) to uf + bf*2 + p and give p. 0 Express -52t - 14 + 113t - 62t in the form bt + m and give m. -14 Express -179p + 0p2 - 27p - 2p2 + 0p*2 as o + xp*2 + jp and give x. -2 Express (8 - 8 + 4o)(2 + 3 + 8) - 6 - 3o + 1 + 4 as z + ho and give z. -1 Express -15 + 1 + 94y - 104y as uy + v and give v. -14 Rearrange 49349 + 24q*3 + 0q + q - 49343 + q*2 to the form zq*3 + wq*2 + y + uq and give z. 24 Express -6g3 + 4 + 1 + 2g*2 + 77g*4 - 161g*4 + 87g*4 as b + ag + qg4 + yg*3 + jg*2 and give y. -6 Rearrange -58y*2 + 113y - 50y2 + 174y*2 - 5y - 60y2 to the form o + xy + hy2 and give x. 108 Rearrange -2 - 2y + 2 - 2y4 + 2 + 2y*2 - 66y*3 - 2 + 2 to gy*4 + oy + qy3 + ty*2 + j and give g. -2 Rearrange 56i*3 - 4i*2 - 35i*3 - 26i*3 + 20i - i*2 + 1 to li*3 + s + ai + bi2 and give b. -5 Express -36809 + 28l + 50l + 36809 as o + yl and give y. 78 Express 4g3 + 8 - 20 + 13 + g - 34g*3 in the form dg + tg3 + o + ag*2 and give o. 1 Rearrange (-9s - 15s - 53s - 35s + 21s)(-7 + 9 + 13) to m + ds and give d. -1365 Rearrange (-14i + 14i - 8i2 + 4i*2)(-834i + 337i + 103i)(-4 + 6 - 1) to t + zi2 + ji*3 + hi and give j. 1576 Rearrange 6c - 9 + 10 + 2c*3 - 4 to y + vc*2 + gc*3 + oc and give y. -3 Express -34y - 1 - 17y - 558y2 + 51y in the form uy + t + py*2 and give p. -558 Rearrange 666d*2 + 3 - 396d*2 + 212d*2 - 3 to the form jd + qd2 + w and give q. 482 Rearrange 116q - 131q - 1867q to dq + a and give d. -1882 Rearrange 96r*2 + 6 - 190r*2 + 284r*2 - 4 to the form tr*2 + xr + n and give n. 2 Rearrange -5 + 119r2 + 0 + 5 to the form sr*2 + nr + j and give s. 119 Rearrange 4o3 - 10o*2 + 52o*2 - 113o*2 - 128o*2 - 5o*3 to do + yo3 + to*2 + w and give y. -1 Express -3525l*2 + 5 + 1763l*2 + 8l + 1767l2 in the form h + fl*2 + xl and give h. 5 Express 13 + 12z2 + 2z*3 - 7z - 9 + 15z2 - 4 as fz + iz2 + lz*3 + u and give f. -7 Express 2 + 4 + 7a - 13a2 + 19a*2 - 4 in the form c + ka*2 + va and give c. 2 Rearrange (0x + 0x + 2x)(x - 2x - x)(26x - 26x + 18x2) to sx + l + vx4 + tx*2 + ax*3 and give v. -72 Express (-12 + 6 - 7)(0x + x - 2x)(-14 + 8 - 13) as cx + h and give c. -247 Express 3i + i - i - 309i*2 - 3i in the form ni + ai*2 + w and give a. -309 Rearrange 7z - 37z - 26z - 4z to x + pz and give p. -60 Rearrange -642x2 + 337x*2 + 323x*2 - 57 to r + ix*2 + dx and give i. 18 Rearrange 46a2 + 27 - 8a - 27 - 40a2 - a3 to the form ba*3 + ia + va2 + g and give i. -8 Rearrange 4p*3 - 62p*4 + p + 6p*2 + 46p*4 - 7p*2 to the form rp*3 + qp + k + fp2 + zp*4 and give q. 1 Express -9 + 5n*2 - 4n*2 + 664n*3 - 4n - 644n3 as tn*2 + d + mn + ln3 and give l. 20 Express (10m - 5m + 5m)(-9 + 0 - 5) as wm + t and give w. -140 Express -96c + 4 + 11 - 14 - 287c as gc + l and give l. 1 Express 4 + 14t*4 - 34t*4 + 2t*2 + 19t*4 - 4 - 2t*3 in the form lt*2 + kt*4 + i + ct*3 + ft and give c. -2 Express (v*2 - 2v2 - v2)(-4v*2 + 3v*2 + 0v*2) - 32v + 2v4 - 3v + 8v - 4v*3 as o + fv*4 + tv*2 + rv + uv3 and give u. -4 Rearrange 452d*3 - 5 - 455d*3 - 3d*2 + 2d*2 to the form gd + yd2 + id*3 + c and give y. -1 Express (-1 - 2 + 4)(0a + 4a + 13a)(4a + 62a + 71a) as ha*2 + g + ua and give h. 2329 Rearrange 4j2 - 1 - 4j + 325j3 - 4j*2 - 5j + 11j to the form bj + dj2 + rj*3 + m and give m. -1 Rearrange -653295 + 653295 - 2267v to jv + g and give g. 0 Express 8l*4 - 1 - 9l*4 - 4l*2 + 3l*4 + 7 - 4 in the form a + zl + vl2 + ql*4 + bl*3 and give q. 2 Rearrange -1 - 8t + 7t - 1 - 11t*2 + 5 to the form k + it + yt2 and give k. 3 Rearrange -5 - 2b + 0b4 + 14b*2 - 13b*2 + 13b*4 + 0 to zb*2 + m + rb*4 + nb*3 + ab and give r. 13 Express 3 - 4h3 + 0h3 + h3 as f + uh + qh*2 + oh*3 and give f. 3 Express 6b*4 + 3b*3 + 2b*2 - 9b*4 - 4b*3 + 2b in the form t + wb2 + rb + ob3 + cb*4 and give c. -3 Rearrange (-151 + 151 - 105q)(5q + 2q3 - 5q + (4q - 3q + q)(-2q*2 - 3 + 3)) to fq*3 + iq*2 + r + yq + hq4 and give f. 0 Rearrange -27s + 40s - s2 - 3s*2 - 19s to the form cs + ws*2 + b and give w. -4 Rearrange 133 + 403 - 15v - 24v + 38v + (0 - 1 - 2)(3v - v - 3v) to fv + i and give f. 2 Express (-2 + 2 - 3)(0s + 0s + 2s*2) + 3s*2 + 0 + 0 + (2 - 2 - s)(-3s + 0s + 4s) - 15s*2 - 23s*2 + 17s*2 as gs*2 + b + cs and give g. -25 Rearrange (-5 + 0 + 3)(-5 + 20 + 11)(3 - 3 - 8q) to the form rq + o and give r. 416 Rearrange -12t4 + 127t*2 + 11t4 + t3 - t*3 + 2t3 - t3 to jt4 + d + qt + xt3 + vt*2 and give v. 127 Rearrange f + 3f*3 + 0 - 6f3 - f4 + 2 + 2f4 to the form cf*3 + sf*4 + df*2 + zf + w and give w. 2 Express 8x2 - 37x*2 + 2x*3 - 3x*3 - 11x*2 - x in the form l + cx*2 + ax + ux3 and give a. -1 Express (2s - 5s + 2s)(-11 + 1 - 13)(11s + 21 - 21) in the form h + ks + ms2 and give m. 253 Express 4p*4 + 4 + 17p*3 + 110p - 52p3 - 6 - 108p as lp3 + op + xp4 + jp*2 + g and give x. 4 Express 7i*3 + 20 + i + 196 - 2i*3 - 2i*3 - 23 in the form ui + xi2 + b + ji*3 and give b. 193 Express 4i2 - i2 - 4i2 - 87i - 11i2 + 87i + (3 - 2 + 0)(-i + i2 + i) + (2 - 2 - i2)(0 - 2 + 1) as gi2 + hi + d and give g. -10 Express -3 - 15i2 + 491i - 246i - 243i in the form yi2 + li + x and give x. -3 Rearrange 107k - 76 + 118k + 80 to the form b + pk and give b. 4 Rearrange -n2 - n - n3 + n3 + 1189	{ "pile_set_name": "DM Mathematics" }
136? False Does 211 divide 1899? True Is 24 a factor of 3312? True Does 3 divide 2013? True Does 31 divide 2666? True Is 104 a multiple of 13? True Does 9 divide 236? False Is 34 a multiple of 17? True Is 364 a multiple of 14? True Does 2 divide 269? False Is 11 a factor of 3280? False Is 79 a factor of 5305? False Does 32 divide 766? False Is 6200 a multiple of 62? True Does 20 divide 510? False Is 9297 a multiple of 9? True Does 23 divide 345? True Does 34 divide 121867? False Is 14 a factor of 14? True Is 38 a factor of 2796? False Does 16 divide 832? True Does 242 divide 18876? True Is 32 a factor of 20501? False Does 61 divide 1017? False Is 58 a factor of 24418? True Does 48 divide 176? False Is 55 a factor of 33440? True Does 57 divide 11400? True Does 37 divide 20202? True Is 7823 a multiple of 106? False Is 643 a multiple of 4? False Is 813 a multiple of 3? True Is 126 a multiple of 63? True Is 3 a factor of 176? False Is 83 a factor of 6557? True Does 6 divide 5133? False Is 21 a factor of 1198? False Is 21328 a multiple of 78? False Does 20 divide 7510? False Is 27 a factor of 5540? False Is 512 a multiple of 8? True Does 36 divide 17403? False Does 98 divide 14543? False Is 139 a factor of 7367? True Is 19223 a multiple of 104? False Does 4 divide 642? False Is 50 a factor of 72920? False Is 1371 a multiple of 15? False Does 6 divide 35109? False Is 24 a factor of 8639? False Does 18 divide 2880? True Is 7600 a multiple of 10? True Does 20 divide 3199? False Is 1562 a multiple of 22? True Is 350 a multiple of 35? True Is 8208 a multiple of 8? True Is 2 a factor of 51? False Does 14 divide 13072? False Is 182 a multiple of 2? True Does 32 divide 3555? False Is 7344 a multiple of 11? False Is 1581 a multiple of 31? True Does 11 divide 22785? False Is 32 a factor of 11072? True Is 15 a factor of 3732? False Does 142 divide 8378? True Does 32 divide 15919? False Is 22 a factor of 64? False Is 120 a factor of 3480? True Is 28 a factor of 532? True Is 1128 a multiple of 47? True Is 28 a factor of 6580? True Is 2422 a multiple of 14? True Does 22 divide 110? True Is 12646 a multiple of 44? False Does 2 divide 146? True Is 22 a factor of 220? True Is 32615 a multiple of 55? True Does 34 divide 612? True Is 98135 a multiple of 112? False Is 4565 a multiple of 11? True Is 22 a factor of 1649? False Is 60 a factor of 9743? False Does 22 divide 24464? True Does 14 divide 505? False Does 159 divide 18444? True Does 215 divide 19600? False Does 18 divide 8593? False Is 386 a factor of 74158? False Is 89 a factor of 2228? False Is 98 a factor of 65275? False Is 751 a multiple of 2? False Is 2040 a multiple of 136? True Is 15050 a multiple of 86? True Is 14825 a multiple of 25? True Is 7 a factor of 18132? False Is 37815 a multiple of 263? False Is 67 a factor of 1407? True Is 27808 a multiple of 22? True Is 891 a multiple of 81? True Is 17891 a multiple of 139? False Is 38 a factor of 114? True Does 33 divide 9570? True Is 59 a factor of 2646? False Is 2736 a multiple of 18? True Is 201 a factor of 9849? True Does 9 divide 837? True Is 1179 a multiple of 4? False Is 26 a multiple of 2? True Does 8 divide 11300? False Does 13 divide 3107? True Does 4 divide 1352? True Does 15 divide 14044? False Does 70 divide 186? False Is 5 a factor of 229? False Is 82 a factor of 4871? False Does 29 divide 1163? False Does 10 divide 945? False Does 11 divide 1554? False Is 9800 a multiple of 23? False Is 3 a factor of 19504? False Does 6 divide 204? True Is 6850 a multiple of 10? True Is 7 a factor of 73? False Is 4 a factor of 205? False Is 6 a factor of 6605? False Is 60522 a multiple of 6? True Does 16 divide 224? True Is 17 a factor of 29937? True Is 108 a factor of 5724? True Is 156624 a multiple of 24? True Is 483 a multiple of 7? True Is 64 a factor of 1280? True Is 28756 a multiple of 14? True Is 69 a factor of 1966? False Is 19 a factor of 14348? False Does 46 divide 1791? False Is 2057 a multiple of 37? False Is 376 a multiple of 6? False Does 17 divide 2322? False Is 1660 a multiple of 83? True Is 4 a factor of 730? False Is 10 a factor of 3940? True Is 13908 a multiple of 114? True Does 3 divide 339? True Does 7 divide 348? False Does 32 divide 73312? True Is 32 a factor of 9809? False Is 4095 a multiple of 117? True Is 202 a multiple of 15? False Does 431 divide 117587? False Is 52 a factor of 520? True Does 55 divide 5436? False Is 49 a factor of 1421? True Is 28 a factor of 840? True Is 7 a factor of 1127? True Is 28472 a multiple of 141? False Is 177 a factor of 11859? True Is 186 a multiple of 6? True Is 11 a factor of 132? True Does 112 divide 3033? False Does 34 divide 1698? False Is 29673 a multiple of 24? False Is 24 a factor of 960? True Is 25 a factor of 652? False Does 72 divide 3096? True Is 14 a factor of 924? True Is 27 a factor of 243? True Does 14 divide 328? False Is 9249 a multiple of 26? False Does 19 divide 598? False Does 33 divide 462? True Is 22805 a multiple of 11? False Does 2 divide 359? False Is 54 a factor of 906? False Is 748 a multiple of 113? False Is 23848 a multiple of 8? True Does 23 divide 269? False Does 4 divide 1294? False Does 6 divide 455? False Does 28 divide 516? False Is 4 a factor of 42? False Does 12 divide 45? False Is 885 a multiple of 15? True Is 174 a multiple of 9? False Is 136 a factor of 2584? True Is 3674 a multiple of 10? False Does 107 divide 20321? False Does 8 divide 4625? False Is 106560 a multiple of 20? True Does 24 divide 960? True Does 14 divide 947? False Is 4 a factor of 1928? True Does 30 divide 295? False Does 115 divide 8791? False Is 25451 a multiple of 31? True Is 994 a multiple of 71? True Is 10 a factor of 9703? False Does 3 divide 1049? False Is 1760 a multiple of 62? False Does 12 divide 1266? False Does 42 divide 546? True Is 7308 a multiple of 21? True Is 9957 a multiple of 3? True Does 3 divide 33? True Is 2240 a multiple of 112? True Does 9 divide 14778? True Is 20497 a multiple of 70? False Is 73 a factor of 1246? False Is 31 a factor of 186? True Does 156 divide 3615? False Is 1595 a multiple of 11? True Does 24 divide 264? True Is 8107 a multiple of 20? False Does 100 divide 917? False Does 8 divide 10528? True Is 22008 a multiple of 3? True Does 4 divide 80? True Is 513 a multiple of 3? True Does 172 divide 22532? True Is 26 a factor of 247? False Does 33 divide 91966? False Is 72 a multiple of 11? False Does 9 divide 9? True Is 71 a factor of 781? True Is 94 a factor of 23926? False Is 25 a factor of 315? False Is 1809 a multiple of 67? True Is 439 even? False Does 9 divide 648? True Is 20 a factor of 100? True Is 20 a factor of 26004? False Is 19 a factor of 1292? True Is 65 a factor of 13455? True Does 91 divide 3938? False Is 94544 a multiple of 19? True Does 7 divide 174? False Is 161 a factor of 28224? False Is 28 a factor of 1764? True Does 26 divide 300? False Does 7 divide 5460? True Is 3108 a multiple of 8? False Is 14 a factor of 31751? False Is 7191 a multiple of 51? True Does 56 divide 410? False Is 15 a factor of 1845? True Is 2852 a multiple of 105? False Is 2 a factor of 937? False Does 24 divide 10248? True Does 61 divide 906? False Is 7320 a multiple of 61? True Is 3621 a multiple of 7? False Is 4590 a multiple of 9? True Does 14 divide 210? True Is 41 a factor of 3362? True Is 243 a multiple of 9? True Is 9167 a multiple of 18? False Is 11813 a multiple of 21? False Is 18073 a multiple of 53? True Is 9 a factor of 68316? False Does 89 divide 1869? True Is 487 a multiple of 8? False Is 18 a factor of 2786? False Does 69 divide 125? False Is 7 a factor of 84? True Is 21147 a multiple of 183? False Is 72 a factor of 2160? True Does 30 divide 180? True Does 83 divide 535? False Is 25039 a multiple of 17? False Is 55 a factor of 4425? False Is 1298 a multiple of 22? True Is 585 a multiple of 23? False Is 9 a factor of 459? True Does 34 divide 680? True Does 137 divide 37780? False Is 581 a multiple of 14? False Is 2150 a multiple of 50? True Does 44 divide 23452? True Is 13076 a multiple of 6? False Is 6 a factor of 4914? True Is 241 a multiple of 2? False Does 25 divide 559? False Does 18 divide 684? True Does 2 divide 130? True Is 44 a factor of 74	{ "pile_set_name": "DM Mathematics" }
4 + 0 + 2). 120s Expand (56 - 109 + 58 + (-3 + 0 + 5)(-2 - 3 + 3))(-6056k*2 - 8k*3 + 6056k*2 + 2k + 2k4). 2k*4 - 8k*3 + 2k Expand -u3 - u3 + u*3 + (-3u*2 - 1 + 1)(2u + u - u) + 20398u - 20398u + 387u*3 + 4u*2 + 2u - 4u2 - 2u*3 + 2. 378u*3 + 2u + 2 Expand (0 + 8 + 1)(-1 + 4 - 2)(-168031m2 + 168031m*2 + 2478m*3). 22302m*3 Expand (134x*3 - 77x*3 + 99x*3)(2x - 2 - 2 + 7). 312x*4 + 468x*3 Expand (-4z3 - z3 + z*3)(0 + 0 - 2z) + 10750z - 10750z + 263z4 - z3. 271z4 - z3 Expand (0k + 6k - 4k)(13k + 0k - 3k)(-17 - 2 - 3)(k + 2 - 2)(-4k*2 + 2k*2 + 0k*2). 880k*5 Expand (261j*3 + 236j*3 - 302j*3)(-j - 2j + j). -390j*4 Expand (4w + 1 - w - 5w)(-3898w + 615w + 1671w). 3224w*2 - 1612w Expand (4m - 7m + 17m + 1 - 1 - 2m + (2m - 2 + 2)(-2 - 1 + 2))((1 - 2 - 1)(-1 - 9 + 0) - 7 + 1 + 4). 180m Expand (-2x*5 + 4x*3 - 4x*3 + (2x5 - x3 + x*3)(3 + 1 - 5) + 0 + 0 - x*5)(1284 + 1027 - 318). -9965x5 Expand (-4u - u + 6u)(10 - 21 - 20)(-5 - 1 - 2)(0u + 4u - 2u + (3u - 3u + u)(0 + 1 + 1) + 2u - 3u - u). 496u2 Expand (-7 + 21 - 62 - 73 - 72)(l + l - l)(-5l + 2l - 7l). 1930l2 Expand -66 - 5h*3 + 66 - 2h*3 - 1 + 1 + (-4h + 5h + h)(2h2 + h2 - 5h*2) + (7h*2 - 2h*2 + 14h*2)(-2h + 3h - 6h). -106h*3 Expand 81 - 19i*2 - 81 + (-2 + 2 - 3i*2)(2 + 0 + 0) - i*2 + 8 + 2i*2 - 78. -24i*2 - 70 Expand (29n - 8n + 0n)(4 - 14n - 4)(19n*2 - 42n*2 - 23n*2). 13524n*4 Expand -195r - 143r + 1007r + 2092r - 117r + (-1 - 3 + 3)(-r - r + 3r). 2643r Expand (3 + 2 + 4)(10 - 2 - 7 + 2s) + (5 - 4 + 4)(-41 + 41 + 8s). 58s + 9 Expand 133864w - 130728w - 2 + 2 - 3w + 0w + 2w + 2w + 0w - 3w + (2w - 5w + 6w)(1 - 3 + 3) + 0w + 3w - w + 2w - w + w. 3141w Expand (2d - 3d + 3d)(-7 + 7 - 3d) + 123d*2 + 202d*2 - 157d*2. 162d*2 Expand (-8 - 29y*3 + 8)(18y - 57y - 24y). 1827y*4 Expand (-8f*4 + 0f*4 - 3f*4)(-4 + 5 + 0 + (3 - 1 + 0)(-3 + 1 + 3) + 0 - 3 + 1)(-83f - 86f + 149f). 220f*5 Expand (-44h + 187h - 79h)(-2h*3 + 209h*2 - 209h*2). -128h4 Expand (-55 + 55 - z2)(z2 - 5z*2 + 2z*2) + (119z*2 - 38z*2 - 62z*2 - z)(-3z2 + 2z2 - z2). -36z4 + 2z*3 Expand (3 - 6 + 1)(49d2 + 4 - 3 + 44d - 98d2 + 93d*2). -88d*2 - 88d - 2 Expand (-13c + 13c - 9c2)(-c - 4 + 4 + (12c - 16c + 6c)(0 + 1 + 2)). -45c3 Expand 42w*2 + 21435 - 8w - 21435 + (2 + 3w - 4w + 3w + (2 + 2 - 2)(-w - 5w + 4w))(0 + 3 - 4)(-2w + w + 0w). 40w2 - 6w Expand (2118 - 527 + 2465 + 477 + 1756)(0x + 3x - 5x). -12578x Expand m - 5m + 2m + (-m - 1 + 1)(-3 + 0 + 5) + 1 - 61m - 52m + 100m. -17m + 1 Expand -11t2 + 7t*2 - 13t*2 - 2t*2 + 4t*2 - 3t*2 + (-3 + 3 - 2t*2)(0 + 0 - 1) - 10t - 6t*2 + 10t + 2t2 + 4t*2 - 5t*2. -21t*2 Expand (1 + 3 - 3)(-462 + 462 + 55p) - 3p + 3p - 2p. 53p Expand (4n*2 - 4n2 + n3)((-5 + 4 - 1)(-235 - 336 - 3) - 2 - 3 + 4 + 2 - 3 + 2 + (5 - 3 + 0)(1 - 2 - 1) + 2 + 1 - 1 - 1 + 0 - 1). 1144n*3 Expand (3y + 0 + 0)(-1 + 0 + 3 + (0 + 2 - 1)(4 + 4 - 2) - 2 - 2 - 2). 6y Expand 2c - c + c + (2c + c - c + (-4 - c + 4)(-1 + 3 - 4) - 4c + 4c - 2c)((-2 - 1 + 5)(0 + 2 - 3) - 7 - 12 + 3). -34c Expand (-4u2 + 4u*2 + 2u*2)(172u - 35 - 21 + 60). 344u*3 + 8u*2 Expand 3n + 0n + n + (6 - 1 - 3)(4n - 3n - 2n) + n - 2n - 6n. -5n Expand -x + x + x + (1 - 2x - 1)(2 - 5 + 2) - 1 + x + 1 + x - x + x + (1 + 2 + 5)(-4 + 1 - 3)(10 - 4x - 10). 197x Expand (0f + f - 3f)(28f*2 + 2f - 2f) - 4f - 35f3 + 4f. -91f3 Expand (607s - 408s - 3 - 497s)((6 + 3 - 2)(-2s3 + 2s*2 - 2s*2) + 3s*3 - 5s*3 + 0s*3). 4768s*4 + 48s*3 Expand ((-4 + 4 + 2m)(-2 + 1 + 2) + m + 3m - 2m + 0m + 0m + 2m)(2m - 1 + 1)(323m + 7m + 66m). 4752m3 Expand (u2 - 2u*2 + 3u*2)(-2u2 + 0u*2 + 4u*2)(-346u - 12 + 12)(0 + 1 + 1 + (-1 + 3 - 1)(0 + 5 - 3)). -5536u*5 Expand (-16o - 7o4 + 16o)(-18 - 8o + 18 + (0 + 0 - o)(5 - 2 - 2)) + 12o*5 - 2o*5 - 2o*5. 71o*5 Expand (3 + 41c - 22c - 27c)(-22c*2 - 22c*2 + 11c*2 + (0c - 4c + 6c)(-2c + 0c + 4c) - 4c2 + 2c*2 + 3c*2). 224c*3 - 84c*2 Expand -5f*3 - 1 - 33f*4 + 7f*3 + 12f*4 + (26 + 5f - 26)(-5f*3 - 2f*3 + 4f*3). -36f*4 + 2f*3 - 1 Expand ((-2l + 6l + 5l)(-1 + 4 - 5) - 5 + 5 + 4l)(7 + 5 + 3)(-2 - 4l + 2). 840l*2 Expand (-3n3 - n3 + 8n3)(1 + n - 1)(2 - 2 + 2) + (0n2 - n3 + 0n2)(-11 - 16 + 4)(-2n + 5n - n). 54n*4 Expand -28i + 28i - 21i*2 + 22i - 26i2 + 17i*2 + 10i*2 + (i - 2i - i)(0i + i + 0i) + 0 + 0 - i2. -23i*2 + 22i Expand (-r*4 - 4r*4 + 4r*4 + (2 + 1 - 5)(292r2 - 292r*2 - 3r*4))(21 - 21 - 11r) - 3r*3 - 2r*5 + 3r*3. -57r*5 Expand (10483w*2 - 1261 - 1266 + 2527)((0w - 2w + 4w)(3 + 1 - 3) - 4 + 4 + 2w + (2 + w - 2)(-2 + 1 - 1)). 20966w3 Expand (-2026 + 2g*2 + 1011 + 8g4 - g3 + 1013)(0 + 0 + g). 8g5 - g4 + 2g3 - 2g Expand (-1897 + 790 - 2585 + 384)(b - 1 + 1 + 1 + b - 1 + (-5 + 4 + 3)(4b - 6b + 3b) - 4b + 2b + 3b). -16540b Expand (-331s + 696s2 + 689s*2 - 1 + 329s - 1445s2)(2s + s2 - 2s). -60s4 - 2s3 - s2 Expand (1 - 1 - 1)(-3k - 2k + 3k)(11 + 6 - 4)(5k2 + 0k*2 + 0k*2). 130k*3 Expand (-511r + 278r - 395r - 186r)(8r - 6r*4 + 1 - 8r). 4884r5 - 814r Expand (4 - 4 + 2)(-12480y - 2057y + 189633 - 189631). -29074y + 4 Expand (-6r + 0 + 0)((0 - 2 - 2)(-3 + 4 + 0) - 4 + 3 - 3)(-3r4 + r4 + 14r*4). 576r*5 Expand (11t - 18t - 64t)(4 - 4 - 4) + (t - 5t + 2t)(-3 + 2 + 2) - 11 + 11 - 3t. 279t Expand 2b - 3138 - 3948 + 5567 + (3 + 1 - 3)(3b - 2b + 0b). 3b - 1519 Expand (-49 + 3s2 - 4s*2 + 207720s - 207726s)(s3 + 7 - 7). -s5 - 6s4 - 49s3 Expand (-p4 - 2p3 + 2p*3)(2 - 3 + 0) - 265p4 - 696p*4 - 113p*4. -1073p*4 Expand (-f + 0 + 0)(22 - 26 + 82 + (3 - 3 + 2)(0 + 1 - 3))(-2 + 2 - 3) - 2f - 3f + 0f. 217f Expand (119s - 243s - 98 + 96 + 120s)(-3s + 5s - 3s). 4s*2 + 2s Expand (-75t2 - 982 - 108t*2 + 980)(-2 - 2t + 2) + (-2t*2 + 3 - 3)(-4t - 2 + 2t + t + (-5 + 0 + 2)(0 + 0 - t)). 362t*3 + 4t*2 + 4t Expand (2r + 2r - 3r)(-6r + r + r + (-7 + 2 + 2)(-1 + 1 + 3r) + 7 + 5r - 7). -8r2 Expand (0j*2 - 2j2 + j2)(654 - 1354 + 182j + 700 + 5287j)(3 - 2j - 3). 10938j*4 Expand (32a - 39a + 28a)((1 + 1 - 3)(1 - 4 + 2) - 3 - 1 + 2)(-3 + 3 - 2)((5 - 3 - 4)(-2 + 3 + 2) + 5 + 1 - 1). -42a Expand (-1191p + 24343 - 48698 + 24353)(3p2 - 5p*2 + 2p*2 - 4p*2)(2p2 - 3p2 - p2). -9528p5 - 16p4 Expand -s3 + 2s3 + s3 + (0s*2 + 3s*2 - 2s*2)(-6 + 6 + 2s) + 4s + s*3 - 4s + 51 - 86s3 - 51. -81s*3 Expand (238h + 3404 - 3404)(-254h*2 - 3h*3 + 4 + 254h*2) + (0h*2 + 2h*2 + 0h*2)(2h - 2h - h*2). -716h*4 + 952h Expand (u + u*2 - u)(-2u3 - u3 + u3) + 4u*4 - 4u4 - u5 + (-1 + 1 + 3u2)(4u3 + 0u*3 - 3u*3) - 552u*5 - 728u*5 + 949u*5. -331u*5 Expand (0 - 2 - 4)(-135n - 64 + 64)(n*3 - 4n*3 + 4n*3 + (3n2 - n2 - 3n2)(-n - 3n + 2n) - n3 - n3 + 3n3 + 3n*3 - 2n*3 + 0n*3). 4050n*4 Expand (k - 3k + 0k)(119 - 10801 + 1068 - 4674 - 4496). 37568k Expand (-2y - 2y + 7y)(1 - 3 + 1) - 40y - 29y - 122y - 303y. -497y Expand (-2 + 2 + 1)(2x + x - 2x) + x - 3x + 0x + 2x + x - 4x - 14x - 5x - 5x - 41x - 35x + 31x + 4x + 2x - 4x + (-5 + 3 + 0)(-x + 3x - 3x). -67x Expand (-6 - 1 + 3)(-2o*2 + 3o2 + o2)(0o - o*3 + 0o) + (-2o + 2o + o*2)(o3 - o3 + o*3) + 129o*3 + 76o*5 - 129o*3. 85o5 Expand (-l2 + l*2 - 2l*2)(2l3 - 3l*3 + 3l*3) - 2l*5 + 14l*3 - 14l*3 + 1 + (-132l - 2400 + 2400)(-3l*2 + 3l*2 - 4l*4). 522l*5 + 1 Expand ((-2 - 1 + 1)(-m + 4m - 4m) + 3m + m - m + (4 - 2 - 1)(0 + m + 0) - 4m + 2m + 3m)(-355m + 105510 - 105510). -2485m*2 Expand (2j +	{ "pile_set_name": "DM Mathematics" }
)*2(g + 201534)/3 Factor h*5/2 + 23h*4 - 39819h*3/2 - 464002h*2 + 203495138h. h(h - 131)2(h + 154)2/2 Find j, given that j3 + 559j2 + 69384j - 2506644 = 0. -294, 29 Determine l so that 7l4 + 90l*3 + 65l*2 - 930l - 792 = 0. -11, -4, -6/7, 3 Factor -u*3 + 1143u*2 + 56592u + 686016. -(u - 1191)(u + 24)2 Find h, given that 2h*3/5 + 382h*2/5 + 22518h/5 + 380538/5 = 0. -81, -29 Factor v*2/3 - 901v/3 - 11882/3. (v - 914)(v + 13)/3 Solve -5u*2 - 35640u + 750645 = 0. -7149, 21 Factor 2x2 + 451730x - 903468. 2(x - 2)(x + 225867) Factor -t*5 - 4t*4 - 2t*3 + 4t*2 + 3t. -t(t - 1)(t + 1)*2(t + 3) Find z, given that 2z3 + 952z*2 - 565862z + 59447300 = 0. -850, 187 Factor -2x2 - 137116x - 2350099682. -2(x + 34279)2 What is g in g3/4 + 4741g*2/4 + 9470g + 18932 = 0? -4733, -4 Factor 22g2/13 + 356g/13 - 2928/13. 2(g - 6)(11g + 244)/13 Determine w so that -2w*4/9 - 94w*3/9 - 1210w*2/9 - 2018w/9 + 3220/3 = 0. -23, -21, -5, 2 Factor -2b3 - 45068b*2 + 90142b - 45072. -2(b - 1)2(b + 22536) Factor 3p3 - 501p*2 - 8190p. 3p(p - 182)(p + 15) Factor -60p*2 - 21125p - 1760. -5(p + 352)(12p + 1) Let 4t*3/9 - 20t*2/9 - 32t - 64 = 0. Calculate t. -4, -3, 12 What is l in -2l3 - 13558l*2 + 40692l = 0? -6782, 0, 3 Factor 2f3/9 - 326f/9 + 308/3. 2(f - 11)(f - 3)(f + 14)/9 Solve -2p*2/5 - 2292p/5 + 1840 = 0 for p. -1150, 4 Let -2m2 + 13480m - 40422 = 0. What is m? 3, 6737 Factor 3c3 - 212c*2 + 4405c - 27300. (c - 39)(c - 20)(3c - 35) Determine c, given that -c5 - 2267c*4 + 13663c*3 + 56843c*2 + 40914c = 0. -2273, -2, -1, 0, 9 Find w, given that 2w4/7 - 97708w*3/7 + 227287416w*2 - 8632829592208w/7 - 34556780813248/7 = 0. -4, 16286 Solve 4i2 - 180i + 2016 = 0. 21, 24 Solve 84h5 - 49916h*4 + 9891272h*3 - 654383664h*2 + 153366048h + 124198272 = 0. -1/3, 4/7, 198 Find s, given that s*4 - 1670s*3 + 3336s*2 = 0. 0, 2, 1668 Factor 3s*2 + 103794s - 1661472. 3(s - 16)(s + 34614) Find u such that 4u4 + 2865u*3 - 10804u*2 - 2880u = 0. -720, -1/4, 0, 4 Solve -16k3 + 133272k*2 - 1398033k + 3668679 = 0. 21/4, 8319 Suppose 3v5 + 2112v*4 + 375885v*3 + 1459500v*2 - 1837500v = 0. Calculate v. -350, -5, 0, 1 Determine a so that a*5 + 35a*4 - 825a*3 + 3085a*2 + 824a - 3120 = 0. -52, -1, 1, 5, 12 Find x such that 5x5/4 - 1163x*4/2 + 12009x*3/4 - 5645x*2 + 4603x - 1380 = 0. 1, 6/5, 2, 460 Suppose -v*2/3 + 71v/3 - 68 = 0. Calculate v. 3, 68 Suppose -2t3/5 - 626t*2/5 + 1152t - 11592/5 = 0. What is t? -322, 3, 6 Suppose 20x4 - 19205x*3 - 149935x*2 - 101640x = 0. What is x? -7, -3/4, 0, 968 Solve 2w4/3 - 50w*3/3 - 398w*2/3 + 2450w/3 + 4900 = 0 for w. -7, -5, 7, 30 Suppose 88i4 + 7052i*3 + 27916i*2 + 19008i - 10944 = 0. Calculate i. -76, -3, -3/2, 4/11 Factor 3r3/7 + 61221r*2/7 + 367218r/7. 3r(r + 6)(r + 20401)/7 Find o, given that 4o*4 + 340o*3 + 6108o*2 - 47812o + 41360 = 0. -47, -44, 1, 5 Factor 2h3/7 + 1492h*2/7 - 24256h/7 + 97536/7. 2(h - 8)2(h + 762)/7 Determine y, given that -4y2 + 64180y + 256784 = 0. -4, 16049 Factor -9j2 - 5730591j - 1910196. -3(j + 636732)(3j + 1) Let -1875l*4/2 - 16365150l*3 - 71419478406l*2 - 11426802336l - 457067904 = 0. What is l? -8728, -2/25 Factor -19v2/4 - 1747v/2 + 92. -(v + 184)(19v - 2)/4 Suppose 3j4 - 564j*3 - 26847j*2 - 301080j - 274800 = 0. Calculate j. -20, -1, 229 Find u such that 4u4 + 1280u*3/7 - 42900u*2/7 - 4520u + 12512/7 = 0. -68, -1, 2/7, 23 Let -4m2 - 1004m + 49224 = 0. What is m? -293, 42 Let -4i5/3 - 614i*4/3 - 2102i*3/3 - 286i*2/3 + 702i + 300 = 0. What is i? -150, -3, -1, -1/2, 1 Solve -15g5 + 25g*4 + 655g*3 - 1705g*2 + 620g + 420 = 0. -7, -1/3, 1, 2, 6 Factor -3k2/7 + 223899k/7 + 895644/7. -3(k - 74637)(k + 4)/7 Suppose u*4/10 + 81u*3/10 - 2544u*2/5 - 42104u - 207936/5 = 0. What is u? -76, -1, 72 Factor -4o3 - 2387236o*2 - 356179788860o + 356182176100. -4(o - 1)(o + 298405)*2 What is a in -5a*4 - 655a*3 - 10405a*2 - 26705a - 16950 = 0? -113, -15, -2, -1 Factor -3b2/7 - 126b - 63855/7. -3(b + 129)(b + 165)/7 Find a such that -6597a4 + 138531a*3 - 448470a*2 - 408a = 0. -2/2199, 0, 4, 17 Suppose 5h2 + 684140h + 23402376980 = 0. What is h? -68414 Determine g, given that g*4 - 8605g*3/2 + 2151g*2 = 0. 0, 1/2, 4302 Find v such that -35v*4 - 865v*3 - 3415v*2 + 865v + 3450 = 0. -138/7, -5, -1, 1 Solve -u*3 - 14u*2 + 1337u - 2610 = 0 for u. -45, 2, 29 Solve -q*2/4 + 877q/2 - 15705/4 = 0. 9, 1745 Solve -5y3 - 8900y*2 - 96995y + 530700 = 0 for y. -1769, -15, 4 What is r in -r*2/4 - 4195r/4 - 4193/2 = 0? -4193, -2 Factor 5i3 - 150i*2 + 645i - 500. 5(i - 25)(i - 4)(i - 1) Factor -5p*4/2 - 3475p*3/2 - 598535p*2/2 + 1827015p/2. -5p(p - 3)(p + 349)2/2 Factor 3x*2 + 1125x + 47088. 3(x + 48)(x + 327) Let -k*5/10 + 77k*4/10 - 85k*3/2 - 77k*2/10 + 213k/5 = 0. What is k? -1, 0, 1, 6, 71 Factor 2l3/7 - 936l*2/7 - 6686l/7 + 17100/7. 2(l - 475)(l - 2)(l + 9)/7 Factor 1058o*3/7 + 31924o*2/7 + 5528o/7 + 240/7. 2(o + 30)(23o + 2)2/7 Factor h2 + 1236h - 3717. (h - 3)(h + 1239) Let 4i*3 + 3340i*2 - 13412i + 10068 = 0. Calculate i. -839, 1, 3 Find t, given that 14t3 + 7214t*2 + 16424t + 4104 = 0. -513, -2, -2/7 Factor -2f5 + 10138f*4 + 10140f*3. -2f*3(f - 5070)(f + 1) Suppose -2i*3/7 + 10180i*2/7 + 52632i + 3321648/7 = 0. What is i? -18, 5126 Determine x so that -2x3/5 - 596938x*2/5 - 238774x - 596934/5 = 0. -298467, -1 Factor 357139538b2/11 + 53452b/11 + 2/11. 2(13363b + 1)*2/11 Solve 405t*5/2 - 30870t*4 - 50300t*3 + 276400t*2 - 114040t + 12320 = 0 for t. -4, 2/9, 2, 154 Factor 5a3 - 111050a*2 + 616716160a - 1232988160. 5(a - 11104)2(a - 2) Suppose 14q4 - 2138q*3 + 91974q*2 - 770350q + 504100 = 0. Calculate q. 5/7, 10, 71 Suppose x*5/2 - 512x*4 - 17409x*3 - 33280x*2 - 32767x/2 = 0. Calculate x. -31, -1, 0, 1057 What is i in 20i5 + 1424i*4 - 305652i*3 + 9893600i*2 - 33970000i + 21000000 = 0? -175, 4/5, 3, 50 Let 2i4/3 - 358i*3 - 5420i*2/3 = 0. What is i? -5, 0, 542 Factor 4q*2 - 15948q - 127840. 4(q - 3995)(q + 8) Let 2n2 - 15210n + 560032 = 0. Calculate n. 37, 7568 Find n such that 3n4/5 + 85563n*3/5 + 610213893n*2/5 + 1829529513n/5 - 2439828972/5 = 0. -14259, -4, 1 Factor -5g2 - 1785g - 116530. -5(g + 86)(g + 271) Solve p*2/6 + 301p/6 + 50 = 0. -300, -1 Solve 2g4/9 - 3634g*3/3 + 1648926g*2 + 4957686g = 0. -3, 0, 2727 Let -3r4 + 9r*3 + 2259r*2 - 4533r + 2268 = 0. Calculate r. -27, 1, 28 Factor -2z2/5 - 7736z/5 - 15464/5. -2(z + 2)(z + 3866)/5 Factor 2x2/3 + 142x/3 - 1288. 2(x - 21)(x + 92)/3 Factor 36x3 - 207984x*2 + 277264x - 92416. 4(x - 5776)(3x - 2)2 Solve -14k*3/11 + 3042k*2/11 - 6888k/11 + 1720/11 = 0 for k. 2/7, 2, 215 Factor 2p4 + 22p*3 - 1604p*2 + 11264p - 21312. 2(p - 18)(p - 4)*2(p + 37) Suppose -3a2 + 204a - 3168 = 0. Calculate a. 24, 44 Suppose -123b5 - 851b*4 - 1037b*3 + 951b*2 + 1160b - 100 = 0. Calculate b. -5, -2, -1, 10/123, 1 Factor a*3/2 + 949a*2 + 3790a + 3788. (a + 2)*2(a + 1894)/2 Find v such that 2v2 - 238200v + 238198 = 0. 1, 119099 Suppose 3i5 + 114i*4 + 1404i*3 + 5070i*2 - 6591i = 0. What is i? -13, 0, 1 Suppose 6z4/5 - 1272z*3/5 - 3894z*2/5 + 5088z/5 + 3096 = 0. Calculate z. -3, -2, 2, 215 Find u, given that 2u4/15 - 298u*3/5 - 4504u*2/15 - 2408u/5 - 3616/15 = 0. -2, -1, 452 Factor -v*2 - 388v - 3411. -(v + 9)(v + 379) Factor 2w*2/5 - 2622w/5 - 29084/5. 2(w - 1322)(w + 11)/5 Factor -39l2/8 - 4674l + 8631/8. -3(l + 959)(13l - 3)/8 What is g in -g2 + 502g + 63024 = 0? -104, 606 Find v, given that 2v3/9 + 586v*2/9 + 2270v/9 - 4046/3 = 0. -289, -7, 3 Factor -5l3 + 4095l*2 + 16440l + 16460. -5(l - 823)(l + 2)*2 Solve -2f*2/13 - 51368f/13 - 51366/13 = 0 for f. -25683, -1 Solve -2t3/3 - 1684t*2/3 - 115304t + 1209	{ "pile_set_name": "DM Mathematics" }
lve -xr - 8 = -3r for r. -2 Let z be 56/1610/7. Solve 0 = q + z for q. -5 Suppose 0 = 2j - 8, 2p - 14 = 6j - 2j. Suppose 5u + 49 = 19. Let m = u - -11. Solve mv - p = -0v for v. 3 Let u(a) = 4a + 140. Let q be u(-35). Solve 0 = -qx + x - 3 for x. 3 Suppose 2w = d - 2, 3w + 6 = 2d + 2. Solve 0k - 10 = dk for k. -5 Suppose 4q - 4u = 3q - 18, 0 = 4u - 20. Solve ql + l = -12 for l. -4 Let s(w) be the third derivative of w*5/15 - 43w*4/24 - 3w*3/2 + 16w*2. Let v be s(11). Solve 2b - v = 4 for b. 3 Let f(d) = d*2 + 18d + 3. Let i be f(-18). Suppose 0 = 3v - 2v - i. Solve 0 = s + 2s - v for s. 1 Suppose 3m + 11 = 5a - 2, 3a - 3 = 3m. Solve 7y = my - 3 for y. -1 Suppose -15z + 6z + 54 = 0. Solve zq + 146 = 158 for q. 2 Let t = 25 - 21. Suppose 0p = tp - 2a - 14, -3p = a - 13. Solve -p + 10 = 3k for k. 2 Let y be 1(4 + -8 + 4). Suppose p + 4s - 12 = 2s, 2p - s = -1. Suppose 8 = d - pa, 6a + 16 = 2a. Solve d = h - yh for h. 0 Let s = -254 - -254. Let i be (-2)/6 - 14/(-6). Solve s = 3q + 1 + i for q. -1 Suppose 7v - 12 - 23 = 0. Suppose -10y + 15y = v. Solve -y - 2 = g for g. -3 Suppose -6u + 12 = -2u, 3d - 27 = -4u. Let s(z) = -z2 - 9z + 22. Let o be s(-11). Suppose o = -2r + 26 - 18. Solve -1 + d = rq for q. 1 Let x = -19 - -21. Let f be 2/(x - 16/12). Solve -fc + 4c - 4 = 0 for c. 4 Let b be 4-21 + (7 - 6). Let y = b + 86. Solve -yc + c + 2 = 0 for c. 1 Let g = 411 + -339. Solve -71o + go = 1 for o. 1 Suppose -h + 13 = -3q, 15 = h - 0h - 4q. Solve 0 = 5z + h - 2 for z. -1 Let c = 5 - 5. Let v be c/(15/(6 + -1)). Solve 0 = -m - vm - 2 for m. -2 Let q = -324 + 345. Solve -qn - 12 = -17n for n. -3 Suppose 3u - 42 = -a + u, 4a = -3u + 168. Let m = -41 + a. Solve 0 = -2v - 1 - m for v. -1 Let s = -22 + -34. Let h = s + 56. Solve b - 1 + 3 = h for b. -2 Let p be 55/2216/5. Solve 8 = px - 8 for x. 2 Suppose 2i + 0 = -76. Let x = i + 38. Solve -2n = -xn + 2 for n. -1 Let g(s) = 10s + 398. Let i be g(-39). Solve 4a - 12 = i for a. 5 Let y(s) = 13s - 6. Let j be y(-5). Let v = 73 + j. Solve -v = -2x + 2 for x. 2 Suppose 0 = 4o - 5o + 13. Suppose oq - 24 = q. Solve -qf + 1 = -3f for f. -1 Let v(n) = 5 - n2 - 5n + 8n + 14 - 8n. Let q be v(-7). Solve 0 = qr + 2 + 8 for r. -2 Suppose 3a + 5x - 10 = 9, -2a + 4x = 2. Let l be (20/25)/(2/40) - 0. Suppose 6c - 4c - l = 0. Solve -c = -5v - a for v. 1 Suppose -2l + 10 = -3b - 0l, -2b = -3l + 10. Let m = b - -7. Suppose 5q + 20 = 0, -2y + mq + 20 = y. Solve i - 3i = y for i. 0 Suppose -4w = -13w. Solve -25 = -5x - wx for x. 5 Let p(h) = -2h*2 - 54h + 12. Let f be p(-27). Let l = -1 - -4. Let j = -6 + 13. Solve f = -jx + lx for x. -3 Suppose 5 = -12z + 5. Suppose 4b - 3a - 20 = 0, -2b + 5a = a - 20. Solve -f + bf + 4 = z for f. -4 Let x = -23 - 14. Let r = x + 37. Let b be (-4)/(-8) + 10/4. Solve 3w + b + 3 = r for w. -2 Let k be 32 + (-3)/6 + 42/(-28). Solve 36a + 6 = ka for a. -1 Let j = 146 + -118. Solve 4v + j = -3v for v. -4 Let o(g) = -51g + g*2 + 35g + 5 + 21g. Let s be o(-5). Solve -5 - s = -2p for p. 5 Suppose -13u = -32u + 114. Solve 0 = -6t - u + 6 for t. 0 Let t(q) be the third derivative of q6/120 - 23q*5/60 - 23q*4/24 - 11q*3/3 + 5q*2 - 2. Let r be t(24). Solve -11 = ri - 1 for i. -5 Suppose v - 9 = n - 2n, -3v + n = -43. Let t = v - 9. Suppose 0 = -o - 2w - 8, -2o = -w - 0 - t. Solve 4s - 20 = -os for s. 5 Suppose 15 = 6o - 9. Solve -ov = -5v for v. 0 Let b be 1/((-1)/(-10)) + -4 - -27. Solve 10i + i - b = 0 for i. 3 Let l(v) = -2v + 4. Let q = -27 + 30. Let w(n) = -3n + 7. Let p(o) = qw(o) - 5l(o). Let y be p(1). Solve -3d = 1 + y for d. -1 Suppose -2y - y = -180. Let i be 14/(-49) - y/(-14). Let d be 3/(-6) + 2/i. Solve dh = h - 4 for h. 4 Let f(o) = -o3 - 5o*2 - 7o + 1. Let i be f(-3). Suppose -h + 0 = -i. Suppose -5y + g + 3 = -hy, -3g = -5y + 9. Solve -4 + y = -q for q. 4 Suppose 3l + t - 21 = -6, 5l - 5t - 5 = 0. Solve -1 = -lp + 7 for p. 2 Let s(u) = u*2 - 4u - 3. Let r be s(-2). Solve 3x = r - 0 for x. 3 Let n be (0 - 2/(-7)) + (-660)/(-140). Suppose -3f - 2o - 1 + 0 = 0, -3o = -3. Let j = 3 + f. Solve ny + 15 = jy for y. -5 Suppose 0 = 2y - v - 12, -2y - 3v + 10 = -5v. Let r(m) = 2m3 + y - 9m - 3m3 + 8m*2 + 2m*2. Let j be r(9). Solve j + 1 = 2s for s. 4 Suppose 0 = 3a - 3z, 0z - 4 = 2a - z. Let p = -2 - a. Suppose -9 = -9u + 6u. Solve -n = -un + p for n. 1 Let h be 1 - 1 - (1 - 1). Let o be (9/18)/(2/84). Let y = o - 18. Solve h = yw - 7w - 8 for w. -2 Suppose 17g - 2g - 30 = 0. Solve -2b - gb = 5b for b. 0 Let i = 34 + -33. Suppose b = 3 - i. Solve 16 = bq + 2q for q. 4 Let o be (-26)/(-2) + 10 + -17. Solve -8u + 2u = o for u. -1 Let s = -69 - -76. Solve 4h + 9 = sh for h. 3 Suppose -f - d + 11 = -0d, -2d - 8 = -3f. Let p = -2 + f. Solve a = -pa + 25 for a. 5 Suppose 0 = 3m - 0m - 3h - 33, 3 = -h. Let g = 1 - m. Let y(p) = -p3 - 6p*2 + 8p + 11. Let u be y(g). Solve -u = 3c + c for c. -1 Suppose -7h = -386 + 281. Solve 0 = 12m - hm - 9 for m. -3 Let t = -17 + -1. Let n = t + 21. Let g = 8 - n. Solve gz + 9 = 29 for z. 4 Let n(r) = -6r + 6. Let h be n(3). Let d = h - -23. Suppose 3v = 1 + d. Solve -6z = -vz for z. 0 Let m be (-45)/1214/63-12. Solve my = -7y + 51 for y. 3 Let y = -1002 + 1021. Solve 5c + 44 - y = 0 for c. -5 Suppose q + 36 = 7q. Solve -2 = -2r + q for r. 4 Suppose 0 = 2w - 2 - 2. Suppose -24c + 65 - 17 = 0. Solve n - w = c for n. 4 Let p(b) = b + 6. Let v be p(-6). Let c = -2035 - -2037. Solve j + cj = v for j. 0 Let n = 16 + -16. Suppose n = 4y + 16, 4 = -j - y - y. Solve v = -jv for v. 0 Suppose 4z - 2z = -4h + 20, -5h = 3z - 25. Let i be z - 4 - (-7 + 2). Solve -p = -i - 1 for p. 2 Let d(h) = h*2 + 15h + 38. Let n be d(-12). Solve 2s - n = 3s for s. -2 Let k = 6 + -4. Let j = 353 + -352. Solve b - kb = -j for b. 1 Let t(z) be the third derivative of z6/120 - 2z*5/15 + 3z*2. Let j be t(8). Solve -3d + 12 = -jd for d. 4 Let g be (4 - 8) + (-6 - 0). Let a be g/(340/(-153) + (-2)/(-9)). Let o = -8 + 12. Solve a = -oh - 3 for h. -2 Suppose 3o + 5d - 39 = 0, 2o + 4d - 12 = 16. Solve -7y + o = 1 for y. 1 Let t = -135 + 136. Let i = -8 + -22. Let c be (i/(-25))/((-1)/(-5)). Solve n + c = t for n. -5 Let v(a) = -8a - 64. Let m be v(-8). Solve 5r - 25 = -m for r. 5 Let p(q) = -q2 + 5q. Let h be p(4). Suppose hc = c. Suppose 0k + 24 = 4k. Solve 0 = -cj + 3j + k for j. -2 Suppose 3h = 5h. Suppose -5r - 39 - 11 = h. Let j = r - -12. Solve k + j = 2k for k. 2 Let c = -3 - -5. Suppose -c = -3j + 1. Suppose 0f = 7f - 35. Solve 24 + j = -fp for p. -5 Let t(r) = -r2. Let o be t(3). Let x be (6/4)/(o/(-84)). Solve 6 + x = 5f for f. 4 Suppose j = 45 - 58. Let s(q) = 2q2 + 26q + 5. Let m be s(j). Solve -z + m = 1 for z. 4 Let d = 19 - 23. Let w be 0(7 + d - 2). Solve -3o + 3 = -wo for o. 1 Let t(u) = 2u*3 + 13u*2 - u + 50. Let p be t(-7). Solve pa - 4a + 16 = 0 for a. -4 Suppose -39 = -3r + 69. Let w = -36 + r. Solve -25 = -wo + 5o for o. -5 Let f(u) = -13u + 164. Let i be f(12). Solve -s + 3 = i for s. -5 Let z(w) = -w3 + w2 + w + 45. Let o be z(0). Let x be ((-1)/(-3))/((-3)/o). Let c = 6 + x. Solve 0 = -3v + 2v + c for v. 1 Let l(z) = 2z*2 - 9z + 1. Let a be l(5). Solve 4 = 2h + a for h. -1 Let w = 25 - 23. Suppose -p = -4z + p + 20, p - 14 = -wz. Solve m + 15 = zm for m. 3 Suppose -2354 = -115d + 22256. Solve 7n = -249 + d for n. -5 Let g = 1339 + -1304. Solve -34f + 4 = -gf for f. -4 Let k(f) = 2f3 - 7f*2 + 5f - 11. Let d be k(4). Solve -18g = -13g + d for g. -5 Suppose -2f + f - 3s = -2, 16 = 3f - s. Suppose -f = -w + 14. Let a be (18/(-4))/(3/(-4)). Solve a + w = -5h for h. -5 Let n be (-43)/(-5) + 80/200. Solve -nd - 3d + 36 = 0 for d. 3 Let r be (-14)/(-21) + 57/9. Let n be (-340)/119(r/(-2) + 0). Solve m - n = -m for m. 5 Let m be (-1)/(-24/(-120)-3). Solve -7q + 8q - m = 0 for q. 5 Let d(o) = 2o - 6. Let l be d(4). Suppose -57b - 2k + 5 = -56b, -9 = -2b - 3k. Solve -bw + 25 = lw for w. 5 Let h be (-12)/(-10)40/24. Su	{ "pile_set_name": "DM Mathematics" }
What is prob of picking 1 s and 2 x? 1/28 Calculate prob of picking 1 b and 1 q when two letters picked without replacement from qkzkzkb. 1/21 What is prob of picking 1 s and 1 q when two letters picked without replacement from {q: 9, s: 3}? 9/22 What is prob of picking 3 o and 1 m when four letters picked without replacement from {m: 9, o: 11}? 99/323 Calculate prob of picking 1 m and 2 e when three letters picked without replacement from espmxpespew. 1/55 Two letters picked without replacement from ggjllgggllgjjj. Give prob of picking 1 l and 1 j. 16/91 Two letters picked without replacement from {y: 1, l: 3, a: 1, c: 2}. Give prob of picking 1 c and 1 l. 2/7 What is prob of picking 1 h and 1 q when two letters picked without replacement from dydkhyhykyhhkdqyhq? 10/153 What is prob of picking 1 m and 1 h when two letters picked without replacement from {m: 1, h: 1, b: 1}? 1/3 Calculate prob of picking 1 y and 1 w when two letters picked without replacement from zwfykwkwktt. 3/55 Calculate prob of picking 2 u and 1 c when three letters picked without replacement from ccrrucrrrccrrrru. 1/112 What is prob of picking 3 l when three letters picked without replacement from llllldd? 2/7 Calculate prob of picking 1 x and 1 r when two letters picked without replacement from {x: 1, h: 1, r: 2, g: 2}. 2/15 Four letters picked without replacement from wwswswwwwwwwswwwww. Give prob of picking 3 s and 1 w. 1/204 Calculate prob of picking 2 k when two letters picked without replacement from rkkrrrk. 1/7 Three letters picked without replacement from {f: 4, c: 2, u: 3}. What is prob of picking 2 c and 1 u? 1/28 Two letters picked without replacement from qqqpqpqpttqtt. What is prob of picking 1 q and 1 p? 3/13 What is prob of picking 1 r and 1 u when two letters picked without replacement from uururr? 3/5 Two letters picked without replacement from {n: 4, i: 1, c: 6}. What is prob of picking 1 i and 1 c? 6/55 Calculate prob of picking 1 z and 2 w when three letters picked without replacement from {z: 5, w: 8}. 70/143 Three letters picked without replacement from oossojoojvqjg. What is prob of picking 1 j, 1 q, and 1 o? 15/286 Three letters picked without replacement from ggaggggggggggggggg. Give prob of picking 2 g and 1 a. 1/6 Two letters picked without replacement from {h: 8, c: 1, x: 6, g: 3}. What is prob of picking 1 x and 1 h? 16/51 What is prob of picking 4 x when four letters picked without replacement from zxxxzzzxzxzzxx? 5/143 What is prob of picking 4 i when four letters picked without replacement from oioqofioioioooo? 1/1365 Two letters picked without replacement from nyqvvgvvvnnvv. Give prob of picking 1 n and 1 y. 1/26 Three letters picked without replacement from {q: 1, f: 1, c: 1, m: 1, e: 2, z: 1}. Give prob of picking 1 f, 1 z, and 1 m. 1/35 Calculate prob of picking 2 d when two letters picked without replacement from {r: 4, q: 1, g: 5, d: 10}. 9/38 Two letters picked without replacement from tjfjtjoojjyjt. What is prob of picking 2 j? 5/26 Two letters picked without replacement from {m: 2, p: 1, x: 1, e: 1}. What is prob of picking 1 x and 1 m? 1/5 What is prob of picking 1 o and 2 z when three letters picked without replacement from zzoozzzozozzzozooooz? 33/76 Two letters picked without replacement from {g: 11, x: 2, o: 1, j: 2, h: 1, r: 2}. Give prob of picking 1 h and 1 j. 2/171 Calculate prob of picking 2 h when two letters picked without replacement from {h: 2, k: 7}. 1/36 Calculate prob of picking 4 f when four letters picked without replacement from zzffzfzzffffzzfzzfzf. 14/323 What is prob of picking 1 k, 1 h, 1 x, and 1 e when four letters picked without replacement from helkghxgk? 2/63 What is prob of picking 1 l and 2 p when three letters picked without replacement from zpplpislps? 1/10 What is prob of picking 1 v and 3 c when four letters picked without replacement from {c: 9, v: 5}? 60/143 Calculate prob of picking 2 q and 1 s when three letters picked without replacement from qqsqvqvss. 3/14 What is prob of picking 2 i, 1 t, and 1 h when four letters picked without replacement from {h: 1, i: 2, d: 5, x: 5, v: 1, t: 1}? 1/1365 What is prob of picking 1 x and 1 c when two letters picked without replacement from {x: 4, a: 5, c: 1}? 4/45 What is prob of picking 1 e, 1 g, and 1 z when three letters picked without replacement from {e: 1, g: 1, z: 2}? 1/2 Two letters picked without replacement from {o: 1, p: 1, i: 1, j: 1, v: 2, c: 2}. What is prob of picking 1 p and 1 i? 1/28 What is prob of picking 1 m and 2 o when three letters picked without replacement from mmkmmomkkmomomkko? 6/85 Calculate prob of picking 1 l, 2 q, and 1 w when four letters picked without replacement from qwqqqwwqwwl. 5/33 Three letters picked without replacement from uznuiussnsysuss. Give prob of picking 1 z, 1 u, and 1 s. 24/455 Three letters picked without replacement from {i: 4, q: 8, v: 5}. Give prob of picking 1 i and 2 q. 14/85 Calculate prob of picking 2 o and 1 d when three letters picked without replacement from iidddooo. 9/56 What is prob of picking 2 t when two letters picked without replacement from {k: 4, x: 4, t: 3, o: 6}? 3/136 Three letters picked without replacement from kkyybbykkbyyyyybkb. Give prob of picking 1 y and 2 b. 5/51 Three letters picked without replacement from {z: 3, f: 4, j: 7, p: 1, n: 2}. What is prob of picking 1 p and 2 f? 3/340 Calculate prob of picking 2 y when two letters picked without replacement from qyqqqyyyqyqqyyqyqy. 4/17 Two letters picked without replacement from xmxxxxmxxxxxxmxxxxxx. What is prob of picking 2 m? 3/190 What is prob of picking 2 j when two letters picked without replacement from jpjpjjjppjpjmppm? 7/40 Three letters picked without replacement from ffrmvmmdffrmvmm. Give prob of picking 1 v and 2 r. 2/455 Two letters picked without replacement from {w: 6, d: 2, r: 1, u: 3}. What is prob of picking 1 u and 1 r? 1/22 Calculate prob of picking 1 n and 1 i when two letters picked without replacement from boobdbbnbnbbidonbnbo. 2/95 Three letters picked without replacement from {h: 1, d: 2, g: 1, w: 1, q: 11, f: 3}. What is prob of picking 1 q and 2 d? 11/969 What is prob of picking 2 o when two letters picked without replacement from {o: 3, q: 3, n: 1}? 1/7 Two letters picked without replacement from ggdggdgggdggdggggg. Give prob of picking 1 d and 1 g. 56/153 Calculate prob of picking 2 r when two letters picked without replacement from {n: 1, v: 4, r: 8, x: 6, z: 1}. 14/95 What is prob of picking 3 o when three letters picked without replacement from {o: 5, r: 2}? 2/7 Calculate prob of picking 2 q and 2 b when four letters picked without replacement from {q: 4, l: 3, t: 4, m: 2, b: 3}. 9/910 Three letters picked without replacement from {o: 3}. Give prob of picking 3 o. 1 Calculate prob of picking 2 d and 1 n when three letters picked without replacement from nndnnndddn. 3/10 Calculate prob of picking 2 q when two letters picked without replacement from {a: 5, q: 2}. 1/21 Calculate prob of picking 2 z and 1 b when three letters picked without replacement from zzzbbzzbzbbbz. 63/143 Two letters picked without replacement from {f: 3, z: 2, k: 1, o: 1}. Give prob of picking 1 z and 1 o. 2/21 Calculate prob of picking 1 e and 1 p when two letters picked without replacement from uiuiipeititieip. 4/105 Three letters picked without replacement from ueneoeeeozeeunuao. Give prob of picking 1 z and 2 e. 21/680 Four letters picked without replacement from {c: 2, u: 7, z: 7}. Give prob of picking 2 c and 2 u. 3/260 Two letters picked without replacement from aaaaauymuduaupaa. Give prob of picking 1 a and 1 d. 1/15 Two letters picked without replacement from qqqx. Give prob of picking 2 q. 1/2 Calculate prob of picking 4 c when four letters picked without replacement from {x: 7, c: 5}. 1/99 Four letters picked without replacement from ajbajnbbaabbbnjbjj. What is prob of picking 2 a, 1 n, and 1 j? 1/51 Four letters picked without replacement from lzltltztlllt. What is prob of picking 1 l and 3 t? 8/165 Calculate prob of picking 1 f and 1 e when two letters picked without replacement from fffefefglgegfflff. 27/136 What is prob of picking 1 m and 1 i when two letters picked without replacement from {m: 2, i: 5}? 1	{ "pile_set_name": "DM Mathematics" }
08 What is the common denominator of -31/108 and -34/81? 324 Find the common denominator of -169/60 and -64/75. 300 Calculate the common denominator of -23/88 and 47/88. 88 What is the smallest common multiple of 108 and 9? 108 What is the smallest common multiple of 5 and 318? 1590 What is the common denominator of 23/24 and -37/1124? 6744 Calculate the smallest common multiple of 81 and 45. 405 What is the common denominator of 14/145 and -13/2900? 2900 What is the least common multiple of 120 and 42? 840 Calculate the least common multiple of 63 and 1926. 13482 Calculate the least common multiple of 630 and 252. 1260 Find the common denominator of 79/8 and -47/455. 3640 What is the smallest common multiple of 60 and 195? 780 What is the common denominator of 43/24 and 5/6? 24 Calculate the common denominator of -71/342 and 73/570. 1710 What is the common denominator of 9/1276 and 1/143? 16588 What is the common denominator of 131/384 and -67/36? 1152 What is the common denominator of -89/28 and 55/1004? 7028 Calculate the common denominator of 1/72 and 99/28. 504 Find the common denominator of 67/2158 and 65/9. 19422 What is the common denominator of -131/24036 and -7/22? 264396 Calculate the least common multiple of 261 and 58. 522 What is the common denominator of -179/7728 and -85/5313? 85008 What is the least common multiple of 157 and 1099? 1099 Find the common denominator of -16/15 and -71/33. 165 Find the common denominator of -145/7488 and 49/64. 7488 Calculate the lowest common multiple of 414 and 1150. 10350 Find the common denominator of -13/32 and -103/80. 160 Calculate the common denominator of 87/44 and -173/84. 924 What is the smallest common multiple of 1950 and 325? 1950 What is the lowest common multiple of 18 and 1186? 10674 What is the common denominator of -5/706 and 2/1059? 2118 Find the common denominator of 127/36 and -75/3736. 33624 Find the common denominator of 87/22 and 103/20. 220 Calculate the smallest common multiple of 30 and 1848. 9240 What is the lowest common multiple of 138 and 132? 3036 Calculate the common denominator of -13/4 and -21/52. 52 Calculate the common denominator of -29/34 and 35/153. 306 What is the least common multiple of 12 and 2298? 4596 What is the common denominator of 109/1566 and 17/5394? 48546 What is the common denominator of -97/960 and -143/108? 8640 What is the least common multiple of 4437 and 145? 22185 What is the lowest common multiple of 12 and 94? 564 What is the smallest common multiple of 8 and 496? 496 What is the common denominator of -49/16 and 8? 16 Calculate the common denominator of -91/110 and 59/10. 110 What is the common denominator of -13/147 and 41/10? 1470 What is the lowest common multiple of 1932 and 644? 1932 What is the least common multiple of 62 and 93? 186 Calculate the smallest common multiple of 440 and 165. 1320 What is the common denominator of 19/4985 and -43/15? 14955 Calculate the least common multiple of 4030 and 1085. 28210 What is the smallest common multiple of 85 and 884? 4420 What is the common denominator of -17/120 and 119/150? 600 What is the lowest common multiple of 273 and 30? 2730 What is the common denominator of 101/10 and -7/108? 540 Calculate the common denominator of -37/6 and 5/3. 6 What is the smallest common multiple of 360 and 216? 1080 What is the common denominator of -101/798 and 111/1064? 3192 What is the smallest common multiple of 4 and 24046? 48092 What is the least common multiple of 2 and 63? 126 Calculate the common denominator of -61/30 and 79/1023. 10230 Calculate the smallest common multiple of 396 and 72. 792 Calculate the common denominator of -47/1137 and -7/3. 1137 What is the common denominator of -65/6 and 33/1343? 8058 Find the common denominator of -1/63 and -59/108. 756 Find the common denominator of 27/20 and -35/4918. 49180 What is the common denominator of -27/136 and -37/68? 136 Calculate the least common multiple of 76 and 190. 380 What is the least common multiple of 12 and 1? 12 Calculate the common denominator of -129/154 and -58/399. 8778 What is the smallest common multiple of 24 and 40? 120 Calculate the smallest common multiple of 18 and 1647. 3294 Find the common denominator of -115/42 and -36/5. 210 Find the common denominator of -63/344 and -29/44. 3784 Find the common denominator of 45/4282 and -161/30. 64230 Calculate the least common multiple of 572 and 220. 2860 Calculate the smallest common multiple of 8 and 2170. 8680 What is the least common multiple of 92 and 146? 6716 Calculate the smallest common multiple of 35 and 497. 2485 Calculate the smallest common multiple of 134 and 14. 938 Calculate the least common multiple of 215 and 1. 215 Calculate the common denominator of -169/330 and -181/1320. 1320 Calculate the lowest common multiple of 236 and 11. 2596 Find the common denominator of 38/7557 and -69/4. 30228 Calculate the common denominator of 117/28 and 6/11. 308 Find the common denominator of 125/6 and -149/4956. 4956 Calculate the least common multiple of 344 and 12. 1032 Calculate the common denominator of -67/400 and 31/650. 5200 Calculate the smallest common multiple of 390 and 45. 1170 Calculate the common denominator of 59/1284 and 53/40. 12840 Calculate the least common multiple of 18 and 147. 882 What is the common denominator of 72/175 and 99/100? 700 Calculate the least common multiple of 432 and 7. 3024 Calculate the common denominator of 6/77 and 125/1078. 1078 What is the least common multiple of 1638 and 90? 8190 Calculate the common denominator of -73/297 and 37/990. 2970 What is the smallest common multiple of 96 and 32? 96 Find the common denominator of 39/476 and 25/588. 9996 Find the common denominator of 30/7 and 58/35. 35 What is the smallest common multiple of 28 and 4240? 29680 Calculate the least common multiple of 4 and 32. 32 Calculate the least common multiple of 360 and 750. 9000 Calculate the lowest common multiple of 3 and 3. 3 Find the common denominator of -87/2710 and -57/542. 2710 Calculate the lowest common multiple of 1812 and 755. 9060 Calculate the smallest common multiple of 240 and 270. 2160 Calculate the least common multiple of 8 and 20. 40 What is the smallest common multiple of 144 and 48? 144 Calculate the smallest common multiple of 4 and 373. 1492 What is the least common multiple of 3 and 627? 627 Calculate the least common multiple of 1864 and 64. 14912 Calculate the common denominator of -11/9 and -25/6803. 61227 What is the least common multiple of 2 and 38914? 38914 Calculate the smallest common multiple of 63 and 7. 63 Calculate the common denominator of 17/7 and -22. 7 Calculate the least common multiple of 15 and 18. 90 Find the common denominator of 49/544 and 11/2. 544 Calculate the common denominator of 3/28 and -65/77. 308 What is the common denominator of -125/24 and -16/8409? 67272 What is the smallest common multiple of 3176 and 1588? 3176 Calculate the smallest common multiple of 26 and 260. 260 Calculate the lowest common multiple of 200 and 3000. 3000 What is the common denominator of -64/3 and 83/26? 78 What is the common denominator of -13/5 and 17/11? 55 What is the smallest common multiple of 16 and 74? 592 Calculate the least common multiple of 297 and 93. 9207 Calculate the common denominator of 13/4988 and 11/8. 9976 Find the common denominator of 57/902 and 23/4182. 46002 What is the common denominator of -97/3135 and -47/15? 3135 Calculate the least common multiple of 6 and 4. 12 Find the common denominator of -71/360 and 65/2. 360 What is the common denominator of -39/25 and 47/30? 150 What is the lowest common multiple of 6531 and 5? 32655 What is the smallest common multiple of 357 and 42? 714 Find the common denominator of 46/97 and -18. 97 What is the lowest common multiple of 125 and 175? 875 What is the least common multiple of 273 and 273? 273 Calculate the common denominator of -23/435 and 65/348. 1740 What is the least common multiple of 24 and 104? 312 What is the smallest common multiple of 11 and 332? 3652 Calculate the smallest common multiple of 1296 and 11. 14256 Calculate the smallest common multiple of 56 and 154. 616 What is the least common multiple of 144 and 126? 1008 Calcula	{ "pile_set_name": "DM Mathematics" }
) v (b) -79/5 (c) -0.4 a Let o = -2/1871 + -1867/3742. Which is the biggest value? (a) 17 (b) -35 (c) o a Let f = -53.3 - -50. Let s = 0.7 - f. Let x = -192.5 - -188.5. Which is the smallest value? (a) -3/7 (b) x (c) s b Let g = -2.18 - 64.82. Let v = -76 - g. Suppose -30 = -2z + 4z + 5i, 2z - 2 = 3i. Which is the smallest value? (a) -0.5 (b) v (c) z b Let r = 553 - 550.79. Let k = r - 1.91. Let s = -0.4 - 0.1. What is the smallest value in k, s, 7? s Let n be ((-10)/(-15))/((-2)/12). Let t = 14.5 - 92.5. Let v = 78.1 + t. Which is the smallest value? (a) v (b) 3 (c) n (d) 1 c Let n = -10207.3 - -10207. Which is the smallest value? (a) 0.4 (b) -17 (c) n (d) -4 b Let u = -994 + 993.7. Let o = -0.1 + 0.2. Which is the biggest value? (a) -0.5 (b) o (c) 2/11 (d) u c Let u = 17 - 16. Let v be (4/6 - 1) + (-1122)/(-18). Let q = v + -58. What is the third smallest value in q, u, 0.7, 2? 2 Let d = 12141 - 12143. What is the second smallest value in 103, d, -3? d Let i = -379/5 - -76. Let r = 1 + -3. Let m(s) = 2s*3 + 230s*2 - 240s - 929. Let w be m(-116). Which is the third biggest value? (a) i (b) w (c) r c Let o = 9/2 - 3. Suppose 102v - 14v = 279 + 73. Which is the second biggest value? (a) o (b) 8 (c) v (d) -1/2 c Suppose 344p - 15 = 349p - 5o, -p - 3o = -21. Let r = 5/8 - 31/24. Which is the second biggest value? (a) r (b) -0.9 (c) 5 (d) p d Let d = -10 + 6. Let x = 152164/3 + -50722. Which is the smallest value? (a) x (b) -15 (c) d b Let o = -234 + 259.2. Let q = -35 + 60. Let v = o - q. Which is the second biggest value? (a) -2 (b) 0.3 (c) v c Let k be (-137)/(-27) + 246/(-3321). What is the second biggest value in -1/3, k, 0.18? 0.18 Let y = -130 - -7. Let c = y - -120. Suppose 5r - 10 = 2d, d + 2r + 2 = 6. What is the fourth biggest value in 1/7, d, c, 4? c Let g = 648.1 + -648.4. Let w = 6 + -3. Let u be (1 - w) + 12 + -10. Which is the second smallest value? (a) 0.05 (b) u (c) g (d) 0.4 b Let t be (-91)/10 - (6 + (16 - 28)) - -3. Let h = -0.04 - 0.96. Let m = -0.5 - h. Which is the third smallest value? (a) t (b) m (c) -1/3 (d) 0.4 d Let t = 20173/385 - -866/55. Let r = t + -68. What is the smallest value in r, -3, -3/10? -3 Let o be 8513/(-780). What is the smallest value in o, -1929, 0? -1929 Let b = 0.369 - 37.669. Let p = 34 + b. Let n = p + 3.4. What is the biggest value in n, -1, 0.2? 0.2 Let q be 54/(-45) - (-44)/20. Let y be (-1)/(q + -4)48/24. Suppose -3 = 5f + 7. What is the third smallest value in -5, -0.1, y, f? -0.1 Let k = -0.26 + -0.04. Let y = -1.3635 + 59.3635. What is the smallest value in y, k, 1? k Let w = -34.415 - -31.415. Let j = 4.93 - -0.07. What is the biggest value in w, -1/6, -7, j? j Let p = 6 + -8. Let k = 50212 + -50211. Which is the biggest value? (a) -10 (b) p (c) -0.4 (d) k d Let l be 9 + 0 + 140 + -146. What is the fourth biggest value in -1/7, l, -3, 1? -3 Let x = -3.246 - -0.246. Let m be 49/(-21) + 0 + 1. Let r = m + 23/6. Which is the second biggest value? (a) x (b) 3 (c) -1/5 (d) r d Let v = -12.26 - -0.26. Let g = 0.2735 - 1.2735. Which is the biggest value? (a) v (b) g (c) 1 c Let g be 6/(-14) + (5967/189)/13. What is the third biggest value in 1/4, g, 0, -111? 0 Let v = 13359 + -13364. Let k = -0.63 - -0.7. Which is the third smallest value? (a) k (b) -0.2 (c) -3 (d) v b Let k be 1452/(-484) + 2/((-222)/(-117)). What is the third smallest value in k, -2, -3/7? -3/7 Let i = -7990 - -7989.8. What is the biggest value in 7, i, -3, 0.09, 5? 7 Let w be (6 - 7)/(4/(-8)10). Let d be 4(0 + (-2)/(-4)) + -2. What is the third smallest value in -2/15, d, w? w Let v = -17310 + 17315. Which is the biggest value? (a) v (b) -2/15 (c) 515 c Let m = 892 + -891.38. Let g = 0.72 - m. Let h = 2.9 - -0.1. Which is the second smallest value? (a) g (b) 4 (c) h c Let h = -0.4004 - -0.3004. Which is the smallest value? (a) 16 (b) h (c) 5/2 (d) 10 (e) 4/3 b Let i = 2811719/10 - 281172. Let b = -3 + 2.98. Let l = 0.38 - b. What is the fourth smallest value in 1, l, i, 5/4? 5/4 Let v = -2467/17367 - 2/2481. Which is the fourth smallest value? (a) -0.8 (b) 0.04 (c) v (d) 2 d Suppose 21j = -6j. What is the smallest value in -0.11, -5/14, j? -5/14 Let x = -17224/7 - -292822/119. Which is the second smallest value? (a) x (b) -426 (c) -2 (d) 0.1 c Let p = -5831 + 5830. What is the biggest value in p, 0.235, 0.3? 0.3 Let y be (-9)/(-3 + 0)2/3. Suppose -23 = -yb - 3b + 3s, 4b - 3s = 19. Suppose bd - 20 = 5t + d, 0 = -d. What is the third smallest value in 0.4, t, 0.3? 0.4 Let t = 7.67 - 53.77. Let b = t - -42.1. What is the third smallest value in -0.2, -0.35, -0.3, b? -0.3 Let y be -5 - (-7 - (1 + 1)). What is the second smallest value in y, -442, -3/7, -4? -4 Let u be -16 - (-2 - -1 - -1). Let z = -264.6 + 264.3. What is the second smallest value in z, -2/7, u? z Let l = 3289.5 + -3289. What is the third smallest value in 1/3, -77, 3/2, 2, l? l Let m = -877.4 - -913.841. Let s = -0.441 + m. What is the third smallest value in -1, -2, s? s Let i be (30/24 - 2)(66/(-18))/(-11). What is the biggest value in i, 61.7, 3/7? 61.7 Let g = -23.86 - -18.86. Let j = 24 + -26. Which is the third smallest value? (a) j (b) g (c) 0.5 (d) -8 a Let v(w) = w*3 - 40w*2 + 35w + 153. Let y be v(39). Which is the biggest value? (a) 284 (b) -0.4 (c) y (d) 2 a Let n = 236/43 + -8516/1677. Which is the second smallest value? (a) n (b) 4/5 (c) 2 b Let o = -17.99 - -17.69. Which is the smallest value? (a) -1/4 (b) o (c) 7/5 (d) -0.1 b Let p be (-639)/(-27) + 2/(-3). Let f(k) = k*2 - 24k + 22. Let q be f(p). Let a = 0.09 + 1.41. What is the biggest value in -1/2, q, a? a Let p = 563 - 2267/4. Let q = 109/28 + p. Let s = 0.43 - -0.07. Which is the fourth biggest value? (a) s (b) 3/4 (c) 0.1 (d) q c Let i = 0 + -0.3. Let u be (114/2223)/(12/(-39)). Which is the second biggest value? (a) u (b) -2/5 (c) i c Let j = -5/6 + 1. Let q be ((-3060)/(-13770))/(4/(-27)). Which is the second smallest value? (a) -0.1 (b) q (c) -2 (d) j b Suppose 5 = -7s + 2s. Let w = -0.055 + -0.005. Let o = -7.06 - w. Which is the third smallest value? (a) s (b) 5 (c) o b Suppose -11p = 4i - 6p - 211, -3p - 40 = -i. Let m be (-7)/i + (-69)/(-42). Which is the smallest value? (a) -2/9 (b) m (c) 6/5 (d) 12 a Let o = 453 - 28. Let g = o - 429. Which is the smallest value? (a) g (b) -1/4 (c) 2 a Let i = -0.0215 - 0.0243. Let l = i + 0.4458. What is the smallest value in -1, l, 0.52? -1 Suppose q + 2u - 17 = 6q, 5q + 4u + 11 = 0. Suppose 2f = -10i - 20, i - 71 = 2f - 73. What is the biggest value in q, f, -0.4? f Let d be -7 + (0 + 2)(-555)/(-150). What is the third smallest value in 0.3, d, 3.3? 3.3 Let t = -63 + 63.019. Which is the smallest value? (a) -3 (b) -4 (c) t (d) 3/4 (e) 0.4 b Let o = 15.512 + -15.952. Let z be (-2)/3 + (-38)/(-3). Suppose 4q - 6 = r - 3r, -q = -3r - z. What is the second smallest value in o, -1/3, q? -1/3 Let d = -11327/4 - -2833. What is the smallest value in -2/11, d, 0.4, 2/7, 2/11? -2/11 Let v = 0.2 - 0.3. Let m = 7304 - 7320.1. Let r = v - m. Which is the fourth smallest value? (a) 0 (b) r (c) 1/3 (d) -5 b Let t be 0 + (-32)/20 + 2. Let p = -12 + -4. Let v = 16.1 + p. What is the biggest value in t, -2, v? t Let s = 4514 + -4510. Which is the third smallest value? (a) -0.5 (b) -2 (c) s (d) -483 a Let j = -343.71 + 325.71. Which is the third biggest value? (a) 13/8 (b) 0.3 (c) j c Suppose 93l - 95l = -2z - 18, -30 = 2l + 4z. Suppose 5s + 0q + 4q = -116, -q = 2s + 44. Which is the biggest value? (a) s (b) 3 (c) l b Suppose -93 + 114 = -3r. What is the smallest value in r, -3, -6? r Let k = 6824 - 40943/6. Which is the third smallest value? (a) -0.4 (b) 1 (c) 1/23 (d) k d Let z = -2 - -2.2. Let f = -70211.7 + 70214. What is the third smallest value in 0, z, f? f Let a(f) = -105f - 2946. Let t be a(-28). What is the fourth biggest value in 0.4, -5, -2/21, -0.5, t? -5 Let u = 4.17702 + -0.17702. What is the fourth biggest value in 0.3, 0, 0.4, 20/9, u? 0.3 Let i = -25867.7 + 25868. Which is the fourth smallest value? (a) -1 (b) 2/7 (c) -15 (d) i d	{ "pile_set_name": "DM Mathematics" }
e -3n + 3t + 168 = 0, -g + 162 = 2n + t. What are the prime factors of n? 59 Let g = -17 - -9. Let q = -5 - g. List the prime factors of 70(q - (-15)/(-6)). 5, 7 Let b(a) = -a*2 - 6a + 4. Let n be b(-6). List the prime factors of 48/32 - (-586)/n. 2, 37 Suppose 23600 = 149j - 141j. List the prime factors of j. 2, 5, 59 Let l = -54 + 58. List the prime factors of 21l/121. 7 Let g be 8/(-20) + (-2044)/(-10). Let q be 780/14 + 10/35. Suppose -4r - 3t + g = 0, 0t - q = -r - 2t. List the prime factors of r. 2, 3 Let a = 2379 - 937. List the prime factors of a. 2, 7, 103 Let i = 187 + -64. Suppose 2q = -q + 3c + i, -197 = -5q + c. Let b = -18 + q. List the prime factors of b. 3, 7 Let s = 24 + -12. Let c(o) = 10 + 4o + 11 + 13 - 25. What are the prime factors of c(s)? 3, 19 Let z(c) = -c*3 + 23c*2 - 14c + 37. List the prime factors of z(9). 5, 11, 19 Let x be 1/(-3) + 38/6. Let r be x/9 - (-226)/(-6). Let h = r + 55. List the prime factors of h. 2, 3 Let t = -17 + 87. Let k = -38 + t. List the prime factors of k. 2 Let f = -180 - -858. List the prime factors of f. 2, 3, 113 Suppose -5n + 32 = -63. Suppose 4x = 3x - 3j + n, -41 = -4x - 5j. What are the prime factors of x? 2 Let z(b) = 31b + 10. Let x(k) = 10k + 3. Let c(j) = -8x(j) + 3z(j). What are the prime factors of c(12)? 2, 3 Suppose 0 = -5s + 10, -5d + 572 = 2s + 98. Suppose 5c - d = -359. Let x = -26 - c. What are the prime factors of x? 3 Let i = 48 + -26. Suppose -4l - i = -106. What are the prime factors of l? 3, 7 Let j(u) = 44u*2 - 6u + 26. List the prime factors of j(5). 2, 137 Suppose 0 = -2v - 2j + 2986, v + 4j = 1527 - 49. List the prime factors of v. 2, 7, 107 Let l(j) = -339j*3 + 7j + 16. List the prime factors of l(-2). 2, 23, 59 Let o be (-2)/(-6)21 + 3. Let k(a) = 16a - 11. What are the prime factors of k(o)? 149 Suppose 3z = -4l + 255, -2l = 3l - 4z - 280. List the prime factors of 1/((16/l)/4). 3, 5 Let j be 2 + (-2 - -4)2. Suppose -6i + 18 = j. Suppose -15 = -if - 9. What are the prime factors of f? 3 Let d = 94 - 66. Let c = d - 12. List the prime factors of c. 2 Let j(v) = 3v2 - 24v - 23. List the prime factors of j(-8). 19 Suppose -3c = -5a + c + 26, -4c - 22 = -3a. Suppose 5u + af = -120, 0 = -5u - 0f - f - 120. List the prime factors of (7/(-21))/(2/u). 2 Let o(f) = -2f + 179. What are the prime factors of o(-19)? 7, 31 Suppose -504 = -7u - 0u. Suppose 3a - 3j = u, -a - 5j - 60 = -3a. Suppose aw + 70 = 25w. List the prime factors of w. 2, 7 Suppose 3g = -5c + 2858, -c - 2 = -3. What are the prime factors of g? 3, 317 Let j be (-9)/(-3 + 156/56). Suppose 0l + 3l - j = 0. Let r = l - -11. List the prime factors of r. 5 Let l = 28 - 25. Suppose -lp = 3z + p - 462, 3 = -p. List the prime factors of z. 2, 79 Let q(j) = -14j - 8. Suppose 2v = 6v + 12. List the prime factors of q(v). 2, 17 Let i be 3/7 + 144/56. What are the prime factors of (-1 - 1) + (i - -3) - -58? 2, 31 Suppose 14m - 380 = 18m. Let f = 187 + m. What are the prime factors of f? 2, 23 Let y(f) = -f. Let c(x) = -x*2 - 21x - 21. Let k(p) = -c(p) + y(p). Let d be k(-19). List the prime factors of 40 - (-3 - -3)/d. 2, 5 Let n(u) = -8u - 44. Let x be n(-6). Suppose xk = -k + 655. List the prime factors of k. 131 Suppose -q + y = -0y - 1333, 2q - 3y - 2671 = 0. What are the prime factors of q? 2, 83 Suppose 23w + 1092 = 25w. List the prime factors of w. 2, 3, 7, 13 Let y(p) = 13p*2 - 11p - 39. List the prime factors of y(-6). 3, 5, 11 Let x(y) = -238y - 214. What are the prime factors of x(-4)? 2, 3, 41 Let x(y) = -y3 - 8y*2 - 7y - 1. Let p = -6 + -1. Let v be x(p). List the prime factors of 2 - 12(v + 0). 2, 7 Let g = -186 - -262. Suppose 0 = 3v - 4v + g. List the prime factors of v. 2, 19 Let i(d) = 129d - 257. List the prime factors of i(11). 2, 7, 83 Let p = -41 + 38. Let a(u) = -4u3 - 3u*2 - 2u + 1. What are the prime factors of a(p)? 2, 11 Let k be 3 - 4/(-6)18. List the prime factors of 1k/204. 3 Let p(m) be the first derivative of -m4/2 - 7m*3/3 + 5m*2/2 - 10m - 22. List the prime factors of p(-7). 2, 149 Suppose -7j = -4913 + 783. What are the prime factors of j? 2, 5, 59 Let a(f) = -f2 - 7f + 3. Suppose -3v + 7v + 20 = 0. What are the prime factors of a(v)? 13 Let i(x) = -x*3 - 11x*2 - 2x - 16. Let o be i(-11). What are the prime factors of (3/o)/(1/62)? 31 Let y(b) = -b*2 - b - 7. Let w(i) = -1. Let c(h) = 2w(h) + y(h). Let p be c(0). Let q(j) = -j. List the prime factors of q(p). 3 Suppose -2w = 27 - 125. Let u = w - -16. What are the prime factors of u? 5, 13 Let l be ((-10)/15)/(1/(-3)). Suppose 17 = 4y + 3r, -2y + lr = -r - 13. Suppose -5v - yz = 74 - 244, -181 = -4v + 5z. What are the prime factors of v? 3, 13 Suppose -167 - 706 = 3m - 5x, 0 = 2x + 6. Let a = -202 - m. List the prime factors of a. 2, 47 Let p(y) = y + 13. Let l be p(-11). Suppose a - 6a - lv - 15 = 0, v = 0. Let q = 34 + a. List the prime factors of q. 31 Suppose -4k + 630 = 2j, -2k + 4j - 49 = -349. Suppose 3d - 4x = 6d - k, 0 = -2d - x + 99. List the prime factors of d. 2, 3 Let z(h) = -h3 + h2 - 8h. List the prime factors of z(-8). 2, 5 What are the prime factors of -51/(-5)1622? 2, 3 Let q = 619 - -237. What are the prime factors of q? 2, 107 Let p be (0/(-2))/(2 + -4). Suppose p = -3o + 2x + 98, 3x + x = o - 16. Suppose 4r + 41 = 2l + 7r, -2l + 2r + o = 0. List the prime factors of l. 19 Suppose -k = -5a - 1813, 4a - 8974 = -4k - 1698. What are the prime factors of k? 2, 3, 101 Suppose 5b + a - 235 = 0, -2b + b + 71 = 5a. Suppose -2k = -c - 22, -3c - b = -k - 3k. What are the prime factors of k? 2, 5 Let c(a) = a2 - 4a + 10. Let h be ((-4)/4 + 1)/(-2). Suppose -4m + 28 = -hm. List the prime factors of c(m). 31 Suppose 5y + 0y = 0. Suppose 4d - 4 = 0, 5g - 413 = -yd + 2d. List the prime factors of g. 83 Let f be (-5 - -6)(0 - 101). List the prime factors of ((-272)/(-6))/(f/(-15)). 2, 17 Let p(c) = -22c - 11. Let b(t) = 45t + 22. Let z(h) = -4b(h) - 9p(h). What are the prime factors of z(5)? 101 Suppose 2g - 7g = 25, -3t = -3g + 6. Suppose -3c - 2b = 15, -2b + 5b = 5c + 44. List the prime factors of (-8)/tc/(-2). 2 Suppose 0 = -0y - 4y. Suppose -4f = 8, 0 = 3s - yf + 2f - 14. Let h = -3 + s. What are the prime factors of h? 3 Let d = -280 + 689. Suppose -5x + 437 = 3q, 7q = 5x + 3q - d. What are the prime factors of x? 5, 17 Suppose -16x - 60 = -15x. Let p = x + 74. What are the prime factors of p? 2, 7 Let p be 1/(-5) + 102/10. Suppose -py + 854 = -546. List the prime factors of y. 2, 5, 7 Suppose f - 1750 = 4u, 13f - 8f + 2u - 8750 = 0. List the prime factors of f. 2, 5, 7 Let j = -3 - -4. List the prime factors of (j + 1)/(13/377). 2, 29 Let v be ((-48)/(-10))/((-6)/(-20)). Suppose g + 0g = -v. Let c = g + 40. What are the prime factors of c? 2, 3 Suppose -3t - 363 = -3r, -3t - 343 = -5r + 270. Let q = -78 + r. List the prime factors of q. 47 Suppose -292 + 1995 = 3t - a, 0 = t + 5a - 573. What are the prime factors of t? 2, 71 What are the prime factors of 823 - -3 - 4/((-8)/10)? 3, 277 Let m = -139 - -46. Let p = m + 182. Let o = p - 49. List the prime factors of o. 2, 5 Suppose 12j - 17286 = 18006. What are the prime factors of j? 17, 173 Suppose -3q - 756 = 4q. Let z = q + 170. List the prime factors of z. 2, 31 Suppose -2o = -3o + 5m + 3, -4o + 12 = -3m. Let z be 13/o + 3/(-9). Suppose -n + 0f = 2f - 4, 0 = -zn - f + 16. List the prime factors of n. 2 Let b(f) = -14f - 8. Let s be b(9). List the prime factors of s(-4 + 14/4). 67 Let r be (-6)/(4 + -1) - -4. Suppose 2h + r = 12. Suppose -hv = -34 - 16. What are the prime factors of v? 2, 5 Let a be (0 - -1) + -1 + -1. What are the prime factors of -72a/64? 2, 3 Suppose 19 = 3p - 29. Suppose -p = 3t - 1. Let d(k) = -6k - 4. List the prime factors of d(t). 2, 13 Let c = -94 + 183. Let j = c - -19. What are the prime factors of j? 2, 3 Let j(s) = -6s*3 + 4s*2 + 2s + 8. Let q be j(-4). Suppose -23b + q = -9b. What are the prime factors of b? 2 Let v = -39 + 125. Suppose -21y + v = -19y. What are the prime fact	{ "pile_set_name": "DM Mathematics" }
0086328144 to seven dps. 0.0008633 Round -0.0016400773 to 5 decimal places. -0.00164 Round 829.83525 to the nearest one hundred. 800 Round -15.7947415 to the nearest ten. -20 Round -85048129 to the nearest one hundred thousand. -85000000 What is 0.0058832735 rounded to four dps? 0.0059 Round 263701526 to the nearest 1000000. 264000000 Round -13.249495 to zero dps. -13 What is -0.000242236412 rounded to five dps? -0.00024 What is -0.136239371 rounded to 3 dps? -0.136 What is -86572.19775 rounded to the nearest ten? -86570 What is 4.03198806 rounded to the nearest integer? 4 Round -14.26722809 to 3 dps. -14.267 What is 1871418358.3 rounded to the nearest 1000000? 1871000000 Round -6747.268281 to the nearest integer. -6747 Round 1.756020664 to 1 dp. 1.8 Round 120143.06788 to zero decimal places. 120143 What is 0.8201731791 rounded to 5 dps? 0.82017 What is -0.0000000752401517 rounded to seven decimal places? -0.0000001 Round -0.000992647652 to 6 dps. -0.000993 What is -0.001341190503 rounded to 4 dps? -0.0013 What is 73.0070758 rounded to one decimal place? 73 Round -35007.418 to the nearest ten thousand. -40000 Round 0.000478924277 to 4 decimal places. 0.0005 What is 0.00024946095 rounded to five dps? 0.00025 Round -10336.42814 to the nearest 100. -10300 Round -10493.92293 to the nearest one thousand. -10000 Round -20454632.36 to the nearest 100. -20454600 What is -0.146670449 rounded to three decimal places? -0.147 What is 1949512.4 rounded to the nearest ten thousand? 1950000 Round -4186.444293 to the nearest integer. -4186 Round -0.093362779 to three dps. -0.093 Round 3185.445078 to the nearest integer. 3185 What is -0.040775802 rounded to 5 decimal places? -0.04078 Round -0.000166516215 to 6 decimal places. -0.000167 Round -81.5229136 to the nearest ten. -80 Round 2436.632864 to zero decimal places. 2437 What is -65.86025497 rounded to the nearest 10? -70 Round 4452.77437 to the nearest 10. 4450 Round -293.63543 to the nearest ten. -290 Round 4012.8268 to the nearest 1000. 4000 Round 0.0966584208 to 3 dps. 0.097 Round -385.104935 to the nearest 10. -390 What is 14167541.7 rounded to the nearest one thousand? 14168000 Round 2247143234 to the nearest 100000. 2247100000 What is 102032708 rounded to the nearest ten thousand? 102030000 Round 1239473.111 to the nearest 100000. 1200000 What is 7040785.86 rounded to the nearest ten thousand? 7040000 What is -97.650683 rounded to one dp? -97.7 What is 94442460 rounded to the nearest 1000000? 94000000 Round 2857.1908 to the nearest 10. 2860 Round -436053.28 to the nearest 100000. -400000 Round -519415960 to the nearest one hundred thousand. -519400000 Round -39.273711 to 2 decimal places. -39.27 Round -2065503.19 to the nearest 1000000. -2000000 Round 120.0918319 to the nearest one hundred. 100 What is -18.647723 rounded to the nearest 10? -20 What is 0.004394103 rounded to five decimal places? 0.00439 What is 22529762.56 rounded to the nearest one hundred thousand? 22500000 Round -150.49913 to two dps. -150.5 What is 0.00105776337 rounded to seven dps? 0.0010578 Round 34.7902844 to 3 decimal places. 34.79 Round 97224.0781 to the nearest ten thousand. 100000 Round -147336.1396 to the nearest 1000. -147000 What is 2098.09228 rounded to the nearest 1000? 2000 Round 0.02106139668 to four decimal places. 0.0211 What is 49854.682 rounded to the nearest one hundred? 49900 Round -7571684.1 to the nearest one million. -8000000 Round -0.0000170753163 to 5 dps. -0.00002 Round -187.9314156 to 2 dps. -187.93 Round 93076.2881 to the nearest 10000. 90000 Round 7000.6398 to the nearest one thousand. 7000 What is -37.2613744 rounded to 1 decimal place? -37.3 Round -0.0000285002904 to 6 dps. -0.000029 What is -8.8851347 rounded to two decimal places? -8.89 Round 0.0000019044307 to seven decimal places. 0.0000019 What is 156729.845 rounded to the nearest ten thousand? 160000 What is -0.205910252 rounded to 5 decimal places? -0.20591 Round -5773886.4 to the nearest ten thousand. -5770000 Round -3.4047021 to two dps. -3.4 What is -10893.63168 rounded to zero decimal places? -10894 What is -0.432535699 rounded to 3 dps? -0.433 Round 543305553 to the nearest 10000. 543310000 Round -0.232461647 to four decimal places. -0.2325 Round -60698.93584 to 0 decimal places. -60699 Round 560512447 to the nearest 100000. 560500000 What is 0.064031806 rounded to 4 dps? 0.064 Round -0.0009553807 to six decimal places. -0.000955 What is -0.006991734603 rounded to three dps? -0.007 Round -520378122 to the nearest one hundred thousand. -520400000 Round -290215273 to the nearest ten thousand. -290220000 Round 51458275.15 to the nearest ten thousand. 51460000 Round -372.192653 to the nearest ten. -370 What is 703262410.4 rounded to the nearest one million? 703000000 Round -89.12201 to two dps. -89.12 What is -0.000012240805407 rounded to seven decimal places? -0.0000122 What is -0.84542911 rounded to three dps? -0.845 Round 10.83236106 to one dp. 10.8 What is 48.2669311 rounded to one dp? 48.3 Round -4196504163 to the nearest one hundred thousand. -4196500000 What is -49.445898 rounded to the nearest ten? -50 What is -18334.5251 rounded to the nearest 10? -18330 Round 160198831 to the nearest ten thousand. 160200000 Round -11402.6777 to the nearest one thousand. -11000 What is 0.000426381742 rounded to 5 dps? 0.00043 What is 14101069920 rounded to the nearest 1000000? 14101000000 What is -37.975783 rounded to the nearest 10? -40 What is -1075776.76 rounded to the nearest one hundred? -1075800 Round 2170.09366 to the nearest ten. 2170 Round -122.655071 to the nearest ten. -120 What is 30.03236 rounded to the nearest integer? 30 Round -738.059007 to the nearest 100. -700 Round 849.668 to the nearest 1000. 1000 Round 8249322400 to the nearest one million. 8249000000 What is -0.4678563423 rounded to three dps? -0.468 Round 0.012815719627 to seven decimal places. 0.0128157 Round 1370.7260533 to 0 dps. 1371 Round 0.010988535 to four dps. 0.011 What is -7301719 rounded to the nearest one thousand? -7302000 Round -642.022272 to the nearest 10. -640 Round 0.00000164332321 to 7 decimal places. 0.0000016 What is 0.0001602269971 rounded to five dps? 0.00016 What is -93846.7288 rounded to the nearest 100? -93800 What is 524788.0708 rounded to the nearest 100? 524800 What is 15.6415191 rounded to the nearest integer? 16 What is 101912.66015 rounded to the nearest ten thousand? 100000 Round 1053068220 to the nearest 100000. 1053100000 Round 0.004097141779 to six decimal places. 0.004097 Round 3.032647464 to 3 decimal places. 3.033 What is 0.017625634 rounded to two decimal places? 0.02 What is -49033249.6 rounded to the nearest 100000? -49000000 Round -0.000087792142 to 7 dps. -0.0000878 What is 5.775159 rounded to 2 dps? 5.78 What is -111012797 rounded to the nearest 1000000? -111000000 What is 0.0518645239 rounded to 6 decimal places? 0.051865 Round 124866.6075 to the nearest 1000. 125000 Round 0.05377188 to two dps. 0.05 What is 5839186.9 rounded to the nearest one million? 6000000 What is 0.000446319944 rounded to six decimal places? 0.000446 What is -6.005313881 rounded to two decimal places? -6.01 Round -1.58465943 to one decimal place. -1.6 What is -0.00000014764785 rounded to seven decimal places? -0.0000001 What is 0.08145090522 rounded to two dps? 0.08 What is 0.1614430082 rounded to 4 decimal places? 0.1614 What is -0.0000199641419 rounded to 6 dps? -0.00002 What is -5227911.814 rounded to the nearest 100000? -5200000 Round 643521.43 to the nearest ten thousand. 640000 Round -0.0001338212705 to four dps. -0.0001 Round -691023.0229 to the nearest 10000. -690000 Round 0.821415405 to 1 dp. 0.8 What is -0.03081748657 rounded to two dps? -0.03 Round -979683.188 to the nearest 1000. -980000 Round -0.000242914268 to 7 dps. -0.0002429 What is 0.02423398747 rounded to four dps? 0.0242 What is 0.00000510010443 rounded to seven decimal places? 0.0000051 Round 6.3807356 to two dps. 6.38 Round -0.0006437231721 to four decimal places. -0.0006 Round -21.1752407 to the nearest 10. -20 What is 53.40057548 rounded to 0 dps? 53 Round 4152168457 to the nearest 100000. 4152200000 What is 1120.560174 rounded to the nearest ten? 1120 What is -994.00436 rounded to	{ "pile_set_name": "DM Mathematics" }
14/3 = 0. 2/5, 7 Factor z*2/3 - 184z/3 + 413. (z - 177)(z - 7)/3 What is l in -4l*2 - 244l - 1872 = 0? -52, -9 Solve 3u4/5 + 163u*3/5 - 111u*2/5 - 11u = 0. -55, -1/3, 0, 1 Solve -90p5 - 645p*4 + 620p*3 + 140p*2 - 160p = 0. -8, -1/2, 0, 2/3 What is g in 2g2 - 174g + 3640 = 0? 35, 52 Let 9y5/2 + 15y*4 - 3y*3 - 24y*2 - 3y/2 + 9 = 0. Calculate y. -3, -1, 2/3, 1 Determine w so that -w*3/5 + 47w*2/5 + 97w/5 + 49/5 = 0. -1, 49 Determine l, given that 9l3/2 - 21l*2/2 - 9l/2 + 21/2 = 0. -1, 1, 7/3 Factor 3y3/7 - 18y*2/7 + 15y/7 + 36/7. 3(y - 4)(y - 3)(y + 1)/7 Find f such that f2/5 - 4f - 21/5 = 0. -1, 21 Suppose 4p5/9 - 8p*4/9 - 4p*3/3 + 16p*2/9 + 16p/9 = 0. Calculate p. -1, 0, 2 Factor 4m2 - 164m - 168. 4(m - 42)(m + 1) Solve -2r5/5 - 688r*4/5 + 2076r*3/5 - 416r*2 + 694r/5 = 0. -347, 0, 1 Factor -3t2/2 - 5772t - 5552664. -3(t + 1924)2/2 Factor 5h*3 + 70h*2 - 75h. 5h(h - 1)(h + 15) Find l, given that -243l*2 - 1638l - 120 = 0. -20/3, -2/27 Factor -3f5/5 + 81f*4/5 - 117f*3 + 507f*2/5. -3f*2(f - 13)*2(f - 1)/5 Factor -y*3/4 - 11y*2/4 - 10y - 12. -(y + 3)(y + 4)2/4 Suppose -5r*4/2 - 49r*3/2 + 15r*2/2 + 49r/2 - 5 = 0. What is r? -10, -1, 1/5, 1 Factor -k*3/2 + 6k*2 - 23k/2 - 18. -(k - 9)(k - 4)(k + 1)/2 Factor 4i2/5 - 296i/5 + 5476/5. 4(i - 37)2/5 Determine r so that 8r*3 - 1708r*2 + 7504r + 4180 = 0. -1/2, 5, 209 Factor m*4/3 + 58m*3/3 + 56m*2/3 - 58m/3 - 19. (m - 1)(m + 1)2(m + 57)/3 Suppose 5t3 + 550t*2 + 14560t - 31360 = 0. Calculate t. -56, 2 Find k, given that 3k5 - 33k*4 + 99k*3 - 111k*2 + 42k = 0. 0, 1, 2, 7 Suppose 14n5/3 + 20n*4 + 58n*3/3 - 44n*2/3 - 24n - 16/3 = 0. Calculate n. -2, -1, -2/7, 1 Factor 2f4/9 + 10f*3/3 + 16f*2/9 - 56f/3. 2f(f - 2)(f + 3)(f + 14)/9 Suppose 5b2 + 75b = 0. Calculate b. -15, 0 Determine n so that 2n5/13 - 180n*4/13 + 528n*3/13 - 524n*2/13 + 174n/13 = 0. 0, 1, 87 Factor 25o4 - 3280o*3 + 106264o*2 + 86592o + 17424. (o - 66)*2(5o + 2)2 Determine y, given that 28y*3 - 92y*2 - 88y + 32 = 0. -1, 2/7, 4 What is n in n*2/3 + 1684n/3 + 708964/3 = 0? -842 Factor -3i5/7 + 33i*4/7 - 57i*3/7 + 27i*2/7. -3i*2(i - 9)(i - 1)2/7 What is v in -2v*3/7 + 12v*2/7 - 18v/7 + 8/7 = 0? 1, 4 Find r, given that -2r2/9 + 4r/3 + 80/9 = 0. -4, 10 Factor -4k3 + 4k*2 + 20k + 12. -4(k - 3)(k + 1)*2 Suppose -4d*5/5 + 196d*4/5 - 3712d*3/5 + 33872d*2/5 - 148736d/5 + 50176 = 0. Calculate d. 5, 8, 14 Factor -5h5 + 115h*4 + 245h*3 + 125h*2. -5h*2(h - 25)(h + 1)2 Find r, given that 4r*5 - 68r*4 - 32r*3 + 2544r*2 + 8064r + 6912 = 0. -3, -2, 12 Suppose -t*2 - 5t + 36 = 0. Calculate t. -9, 4 Suppose 5u5 + 30u*4 + 55u*3 + 30u*2 = 0. Calculate u. -3, -2, -1, 0 Let -79f*2/4 + 19f + 3/4 = 0. Calculate f. -3/79, 1 Factor 3i5/2 - 3i*4 - 9i*3/2 + 6i*2 + 6i. 3i(i - 2)*2(i + 1)2/2 Find a such that -a4 - 7a3 + 20a*2 + 132a - 144 = 0. -6, 1, 4 What is g in -4g5 + 12g*4 - 8g*3 - 8g*2 + 12g - 4 = 0? -1, 1 Suppose 4r5 + 80r*4 + 468r*3 + 1080r*2 + 864r = 0. Calculate r. -12, -3, -2, 0 Let -5h5 + 25h*3 - 20h = 0. What is h? -2, -1, 0, 1, 2 Find y, given that -20y3 - 175y*2 + 245y - 50 = 0. -10, 1/4, 1 What is w in -2w5 - 76w*4 - 70w*3 + 148w*2 = 0? -37, -2, 0, 1 Factor -3b*3/7 + 36b*2/7 + 1296b + 22848. -3(b - 68)(b + 28)*2/7 Suppose -10y*2 - 386y + 156 = 0. Calculate y. -39, 2/5 Factor 2i2 - 2650i - 2652. 2(i - 1326)(i + 1) Suppose 2i3 + 12i*2 - 702i + 3888 = 0. What is i? -24, 9 Determine z, given that z*5/2 - 23z*4/2 + 139z*3/2 + 135z*2/2 - 972z - 1458 = 0. -2, 9 Find o such that 4o4/3 + 4o*3/3 - 4o*2/3 - 4o/3 = 0. -1, 0, 1 Suppose -2n2/9 - 32n/9 = 0. Calculate n. -16, 0 Find w, given that 16w5 - 12w*4 - 36w*3 - 8w*2 = 0. -1, -1/4, 0, 2 Factor -5m*4 + 30m*3 + 275m*2. -5m*2(m - 11)(m + 5) Factor 2b*2/5 - 2634b/5. 2b(b - 1317)/5 Determine d, given that 4d3/9 + 520d*2/9 - 1052d/9 + 176/3 = 0. -132, 1 Suppose 5p5 - 145p*4 + 1230p*3 - 2390p*2 - 1235p + 2535 = 0. What is p? -1, 1, 3, 13 Find f, given that -f*3 + 22f*2 + 48f = 0. -2, 0, 24 Let -3o4/5 - 36o*3/5 - 129o*2/5 - 36o - 84/5 = 0. What is o? -7, -2, -1 Solve -40u2 + 44u - 4 = 0. 1/10, 1 Solve d*2/6 - 49d/3 + 2401/6 = 0. 49 Solve -a*2 + 80a - 700 = 0 for a. 10, 70 Determine r, given that 4r4/5 + 112r*3/5 + 476r*2/5 + 368r/5 = 0. -23, -4, -1, 0 Solve -12q5 + 40q*4 + 152q*3 - 256q*2 - 44q + 120 = 0. -3, -2/3, 1, 5 Let -h*3/9 + 5h*2/9 - 7h/9 + 1/3 = 0. What is h? 1, 3 Find n, given that 3n3 - 138n*2 - 141n = 0. -1, 0, 47 Factor 5r4 + 2015r*3 + 204015r*2 + 202005r. 5r(r + 1)(r + 201)2 Solve -2n*2/5 - 1256n/5 = 0. -628, 0 Let -2z4 - 18z*3 - 22z*2 + 42z = 0. Calculate z. -7, -3, 0, 1 Suppose h*3 + 4h*2 - 11h + 6 = 0. Calculate h. -6, 1 Suppose 5m5 - 10m*4 - 340m*3 + 840m*2 + 2880m = 0. What is m? -8, -2, 0, 6 Factor -m*3/4 + 19m*2/4 + 35m/2 - 22. -(m - 22)(m - 1)(m + 4)/4 Factor -2x2/11 - 10x + 600/11. -2(x - 5)(x + 60)/11 Let 14p2 - 262p - 76 = 0. Calculate p. -2/7, 19 Find y such that 4y4 - 24y*3 + 52y*2 - 48y + 16 = 0. 1, 2 Determine f so that -4f2 + 32f - 64 = 0. 4 Factor -r*3/5 + 39r*2/5 + 8r. -r(r - 40)(r + 1)/5 Suppose 3q4/4 + 15q*3/4 - 93q*2 - 672q - 576 = 0. Calculate q. -8, -1, 12 Solve -q*4/6 + 35q3 + q2/2 - 316q/3 + 70 = 0. -2, 1, 210 Let 5m*2 + 35m = 0. Calculate m. -7, 0 What is w in 2w5 + 26w*4 + 98w*3 + 86w*2 - 100w - 112 = 0? -7, -4, -2, -1, 1 Factor f*2 + 424f + 423. (f + 1)(f + 423) Determine q so that 32q*5 - 208q*4 + 514q*3 - 602q*2 + 336q - 72 = 0. 3/4, 1, 2 Solve 2h3/15 - 736h*2/15 + 67712h/15 = 0. 0, 184 Factor 2z2 - 120z + 118. 2(z - 59)(z - 1) Factor 4p2 - 512p + 16384. 4(p - 64)2 Solve -64i*4/5 + 224i*3/5 + 124i*2/5 + 16i/5 = 0. -1/4, 0, 4 Solve 16d2 - 4300d + 3216 = 0 for d. 3/4, 268 Determine r so that 5r3/6 - 125r*2 + 9855r/2 - 53290/3 = 0. 4, 73 Determine j so that -512j3/13 + 192j*2/13 - 18j/13 = 0. 0, 3/16 Solve 4n3 - 108n*2 + 368n = 0 for n. 0, 4, 23 Factor -y*3/3 - 22y*2/3 - 127y/3 - 70. -(y + 3)(y + 5)(y + 14)/3 Factor t*5 + 3t4 - t3 - 3t2. t2(t - 1)(t + 1)(t + 3) Solve a*4 + 5a*3 - 16a*2 - 68a - 48 = 0. -6, -2, -1, 4 Factor -2v2/9 + 278v/9 - 548/9. -2(v - 137)(v - 2)/9 Factor -4d2/7 - 80d/7 + 492. -4(d - 21)(d + 41)/7 Factor -n*5 + 72n*4 - 141n*3 + 70n2. -n2(n - 70)(n - 1)*2 Find a, given that -5a*3 + 115a*2 + 2345a + 9065 = 0. -7, 37 Suppose 3c2/2 - 927c/2 - 1404 = 0. Calculate c. -3, 312 Let -10j5/9 - 32j*4/3 - 70j*3/3 + 100j*2/9 = 0. What is j? -5, 0, 2/5 Factor 16m*3/15 - 6m*2/5 + 2m/15. 2m(m - 1)(8m - 1)/15 Suppose 156v4 - 72v*3 - 117v*2 + 15v + 18 = 0. Calculate v. -1/2, 6/13, 1 Factor -2m2 + 144m - 2592. -2(m - 36)2 Factor -6657i*2/8 + 465i/2 + 3/2. -3(7i - 2)(317i + 2)/8 Factor -55j5 + 670j*4 - 2100j*3 + 360j*2. -5j*2(j - 6)*2(11j - 2) Find l, given that 4l*3 - 68l*2 - 96l + 4032 = 0. -7, 12 Factor x4/6 - x2/2 + x/3. x(x - 1)2(x + 2)/6 Factor -o*4/4 + 7o*3/4 + 17o*2/4 + 9o/4. -o(o - 9)(o + 1)*2/4 Let 2z*3/3 + 16z*2 - 158z/3 + 36 = 0. Calculate z. -27, 1, 2 Factor -2q2/5 - 6q/5 + 56/5. -2(q - 4)(q + 7)/5 Suppose -r*2/7 - 41r/7 + 120 = 0. What is r? -56, 15 Factor i*3/3 + 11i*2/3 - 4i. i(i - 1)(i + 12)/3 Determine c so that 2c2/13 + 18c/13 - 20/13 = 0. -10, 1 Factor -j*5/2 + 6j*4 - 16j*3 - 8j*2 + 72j - 64. -(j - 8)(j - 2)3(j + 2)/2 Factor m*4/3 + 7m*3/9 - 4m/9. m(m + 1)(m + 2)(3m - 2)/9 Factor 16u2 - 216u + 729. (4u - 27)2 Let w2 + 62w = 0. What is w? -62, 0 Let r*2/5 - 1566r/5 + 613089/5 = 0. What is r? 783 Factor 4p4 - 68p*3 - 504p*2 - 1072p - 736. 4(p - 23)(p + 2)*3 What is k in 2k*4/3 - 20k*3/3 - 6k*2 + 60k = 0? -3,	{ "pile_set_name": "DM Mathematics" }
base 7? -142 -100 (base 4) to base 11 -15 Convert 11 (base 2) to base 16. 3 What is -21 (base 14) in base 16? -1d What is 1 (base 7) in base 15? 1 2a (base 13) to base 12 30 What is -2e (base 16) in base 6? -114 2 (base 11) to base 6 2 What is -27 (base 15) in base 14? -29 Convert 22 (base 10) to base 8. 26 2102 (base 4) to base 10 146 -38 (base 12) to base 4 -230 What is 31 (base 5) in base 2? 10000 Convert -10 (base 4) to base 12. -4 What is 1 (base 4) in base 16? 1 Convert -5 (base 6) to base 12. -5 Convert 41 (base 9) to base 12. 31 -13 (base 9) to base 13 -c Convert -11001110 (base 2) to base 11. -178 Convert -45 (base 6) to base 16. -1d -3 (base 14) to base 13 -3 1b (base 13) to base 10 24 What is -221 (base 4) in base 11? -38 What is -db (base 16) in base 11? -18a Convert 36 (base 13) to base 6. 113 Convert -372 (base 9) to base 16. -134 Convert 2010 (base 3) to base 13. 45 Convert -1 (base 11) to base 13. -1 Convert -7 (base 14) to base 13. -7 Convert -113 (base 11) to base 8. -207 What is -2a (base 13) in base 11? -33 Convert -73 (base 10) to base 5. -243 Convert -88 (base 11) to base 8. -140 2 (base 4) to base 2 10 Convert 10000 (base 2) to base 8. 20 Convert -132 (base 4) to base 11. -28 Convert 44 (base 11) to base 4. 300 What is 14 (base 8) in base 2? 1100 Convert 111 (base 4) to base 15. 16 Convert 101000 (base 2) to base 14. 2c -1 (base 8) to base 3 -1 Convert -3113 (base 5) to base 16. -198 Convert -111110 (base 2) to base 6. -142 What is 1e (base 15) in base 12? 25 Convert 136 (base 12) to base 7. 354 What is 3 (base 15) in base 5? 3 20 (base 4) to base 13 8 Convert 4 (base 10) to base 5. 4 Convert 110 (base 4) to base 10. 20 -222 (base 4) to base 14 -30 What is 20 (base 5) in base 7? 13 Convert -10100001 (base 2) to base 11. -137 Convert 7 (base 13) to base 2. 111 32 (base 4) to base 3 112 -122 (base 8) to base 7 -145 Convert 1 (base 2) to base 10. 1 263 (base 7) to base 15 98 Convert 131 (base 4) to base 10. 29 Convert -3 (base 16) to base 9. -3 -6 (base 12) to base 14 -6 What is 2 (base 3) in base 5? 2 What is -4 (base 12) in base 4? -10 Convert 19 (base 15) to base 11. 22 What is 7 (base 8) in base 10? 7 11 (base 12) to base 14 d Convert b2 (base 12) to base 11. 112 Convert 2 (base 15) to base 2. 10 What is -28 (base 11) in base 8? -36 24 (base 16) to base 9 40 What is -1 (base 7) in base 13? -1 Convert 4 (base 5) to base 16. 4 Convert 20 (base 4) to base 8. 10 Convert -10011 (base 2) to base 7. -25 -14 (base 13) to base 16 -11 2 (base 5) to base 3 2 -100110 (base 2) to base 10 -38 What is 235 (base 6) in base 12? 7b 31 (base 10) to base 13 25 What is -2 (base 11) in base 5? -2 -3 (base 8) to base 4 -3 2 (base 14) to base 10 2 What is -8b (base 12) in base 11? -98 5 (base 12) to base 2 101 -277 (base 9) to base 10 -232 Convert -312 (base 5) to base 13. -64 126 (base 13) to base 14 105 Convert 24 (base 16) to base 15. 26 What is -5 (base 16) in base 6? -5 Convert 10 (base 3) to base 9. 3 Convert -4 (base 7) to base 14. -4 What is 66 (base 15) in base 12? 80 -1 (base 3) to base 2 -1 -2 (base 3) to base 10 -2 26 (base 8) to base 2 10110 Convert 0 (base 14) to base 16. 0 Convert 10 (base 6) to base 12. 6 Convert -1 (base 12) to base 13. -1 11 (base 2) to base 16 3 Convert -6 (base 12) to base 16. -6 -1 (base 8) to base 2 -1 -3 (base 11) to base 16 -3 -1 (base 15) to base 10 -1 108 (base 11) to base 8 201 Convert 8b (base 13) to base 4. 1303 -4 (base 7) to base 6 -4 Convert 16 (base 9) to base 5. 30 What is 0 (base 8) in base 10? 0 Convert -2 (base 7) to base 10. -2 Convert -100 (base 2) to base 14. -4 What is -59 (base 13) in base 11? -68 3 (base 7) to base 5 3 What is -1 (base 9) in base 4? -1 -1 (base 2) to base 8 -1 Convert -53 (base 6) to base 4. -201 What is 27 (base 9) in base 16? 19 Convert -1 (base 13) to base 15. -1 25 (base 15) to base 12 2b What is -5 (base 14) in base 11? -5 -10 (base 4) to base 8 -4 What is 12011 (base 3) in base 10? 139 Convert -4 (base 9) to base 15. -4 Convert d (base 15) to base 8. 15 4 (base 7) to base 15 4 -9 (base 14) to base 8 -11 -14 (base 6) to base 14 -a What is 11 (base 11) in base 14? c 168 (base 12) to base 7 440 Convert -5 (base 13) to base 10. -5 What is 0 (base 5) in base 11? 0 12 (base 13) to base 7 21 What is 53 (base 6) in base 9? 36 Convert -426 (base 7) to base 15. -e6 What is 6 (base 12) in base 8? 6 Convert -1010 (base 2) to base 12. -a What is 2 (base 10) in base 2? 10 What is -200 (base 3) in base 16? -12 Convert -3 (base 6) to base 5. -3 What is -21 (base 5) in base 14? -b Convert -6 (base 8) to base 9. -6 Convert 4 (base 10) to base 16. 4 What is -2 (base 14) in base 2? -10 What is -166 (base 7) in base 9? -117 What is 9 (base 11) in base 4? 21 Convert 2 (base 16) to base 5. 2 -75 (base 9) to base 4 -1010 What is -7 (base 14) in base 8? -7 Convert 2 (base 9) to base 3. 2 1 (base 14) to base 12 1 -3 (base 4) to base 12 -3 What is 5 (base 7) in base 9? 5 -7 (base 10) to base 4 -13 Convert 8 (base 14) to base 16. 8 -220 (base 5) to base 2 -111100 -1 (base 15) to base 13 -1 What is -1 (base 14) in base 7? -1 100100 (base 2) to base 12 30 -233 (base 4) to base 15 -32 Convert 10021 (base 3) to base 5. 323 Convert 31 (base 8) to base 16. 19 Convert -47 (base 8) to base 15. -29 Convert 5 (base 6) to base 12. 5 -12 (base 14) to base 11 -15 70 (base 8) to base 11 51 -20 (base 6) to base 7 -15 What is b (base 14) in base 5? 21 What is 200 (base 7) in base 8? 142 Convert 25 (base 8) to base 7. 30 What is 2 (base 7) in base 3? 2 b (base 16) to base 9 12 -1 (base 7) to base 14 -1 -1 (base 2) to base 13 -1 2 (base 16) to base 9 2 257 (base 8) to base 2 10101111 Convert -5 (base 11) to base 6. -5 Convert 10 (base 3) to base 9. 3 What is -1c (base 16) in base 14? -20 -12 (base 16) to base 4 -102 c (base 16) to base 8 14 -2 (base 12) to base 14 -2 Convert -1 (base 6) to base 3. -1 Convert -1 (base 11) to base 13. -1 -3 (base 11) to base 8 -3 Convert 2 (base 10) to base 13. 2 What is 71 (base 15) in base 7? 211 -13 (base 6) to base 9 -10 2 (base 12) to base 3 2 What is -1 (base 12) in base 6? -1 -423 (base 5) to base 11 -a3 Convert -11 (base 5) to base 16. -6 Convert 2 (base 13) to base 11. 2 What is -1 (base 5) in base 10? -1 Convert -10 (base 9) to base 3. -100 3 (base 12) to base 3 10 What is 321 (base 4) in base 12? 49 What is -34 (base 16) in base 3? -1221 55 (base 10) to base 16 37 61 (base 11) to base 5 232 What is -35 (base 12) in base 2? -101001 Convert -ab (base 13) to base 11. -119 What is 111 (base 2) in base 4? 13 Convert 11002 (base 3) to base 10. 110 What is -16 (base 14) in base 5? -40 What is 4 (base 5) in base 6? 4 What is 3 (base 13) in base 16? 3 Convert 40 (base 11) to base 7. 62 26 (base 9) to base 6 40 What is 5 (base 10) in base 3? 12 2 (base 10) to base 7 2 -3 (base 16) to base 11 -3 What is 1 (base 15) in base 4? 1 What is -102 (base 3) in base 15? -b What is 2 (base 3) in base 9? 2 -30 (base 16) to base 12 -40 12 (base 4) to base 12 6 Convert -101 (base 3) to base 12. -a What is 65 (base 15) in base 7? 164 1 (base 10) to base 14 1 What is -1020 (base 4) in base 6? -200 -20 (base 6) to base 14 -c Convert 0 (base 4) to base 13. 0 1b (base 14) to base 8 31 -30 (base 4) to base 7 -15 101001101 (base 2) to base 10 333 -420 (base 7) to base 11 -181 -5 (base 8) to base 4 -11 100000 (base 2) to base 10 32 28 (base 16) to base 4 220 Convert 3 (base 4) to base 13. 3 What is 2 (base 15) in base 10? 2 24 (base 5) to base 10 14 Convert -51 (base 8) to base 5. -131 -32 (base 5) to base 16 -11 Convert 3 (base 8) to base 4. 3 What is 62 (base 13) in base 10? 80 What is 100 (base 2) in base 7? 4 Convert -1e (base 15) to base 7. -41 What is 20 (base 13) in base 8? 32 Convert 3 (base 13) to base 16. 3 Convert -103 (base 6) to base 16. -27 Convert -26 (base 8) to base 12. -1a What is -5 (base 8) in base 3? -12 -333 (base 5) to base 15 -63 What is -15 (base 11) in base 10? -16 -b (base 13) to base 16 -b Convert 10000000 (base 2) to base 11. 107 What is 11 (base 8) in base 13? 9 49 (base 13) to base 14 45 What is -19 (base 10) in base 12? -17 -1 (base 11) to base 6 -1 What is -4 (base 8) in base 5? -4 Convert -54 (base 9) to base 8. -61 208 (base 9) to base 13 101 -5 (base 10)	{ "pile_set_name": "DM Mathematics" }
76 Collect the terms in b + 46b2 - 52b*2 - b. -6b*2 Collect the terms in -6y - 4y + 2y. -8y Collect the terms in 1293 - 83g - 1293. -83g Collect the terms in 1514 - 1514 - r2. -r2 Collect the terms in -10i*2 + 5i*2 - 2i*2. -7i*2 Collect the terms in -5u*2 + 2u*2 - 10u*2. -13u*2 Collect the terms in -286x*3 + 579x*3 - 290x*3. 3x*3 Collect the terms in -98d*3 + 10d*2 - 95d*3 - 10d*2. -193d*3 Collect the terms in -10z - 22z + 40z. 8z Collect the terms in 30l - 6l - l + 12l. 35l Collect the terms in 14l - 10l + 2l + 0l + 2l. 8l Collect the terms in -74u - 68u + 196u - 55u. -u Collect the terms in 31y*2 + 19y + 5y2 - 5y - 15y. 36y*2 - y Collect the terms in 42w*3 + 17w*3 + 45w*3. 104w*3 Collect the terms in -21f*2 - 20f*2 - 6f*3 - 3f2 - f3. -7f3 - 44f*2 Collect the terms in -3m2 + m2 + 5m2 + 7m*2 - 10m*3. -10m*3 + 10m*2 Collect the terms in 7y*2 + 7y*2 - 16y*2. -2y*2 Collect the terms in -6v2 - v2 - 2v2 + 7v*2. -2v*2 Collect the terms in -211j*2 - 215j*2 + 429j*2. 3j*2 Collect the terms in -66j - 38j + 76j - 1 + 1. -28j Collect the terms in -21 + 21 + 7d. 7d Collect the terms in 2273r - 2273r + 21r*3. 21r*3 Collect the terms in -14p*2 - 31 + 63 - 32. -14p*2 Collect the terms in -r + r + 188r*3. 188r*3 Collect the terms in 1 + 2r - 16r2 - 1 + 0. -16r*2 + 2r Collect the terms in -27t + 27t - 228t3 + 227t3. -t3 Collect the terms in 16u - 3227 + 1613 + 1614. 16u Collect the terms in -3 - 4 - 6j3 + 4. -6j*3 - 3 Collect the terms in 66512k - 2 - 66514k + 2. -2k Collect the terms in -5k2 + 16k*2 - 10k2. k2 Collect the terms in 8r + 16 + 18 - 33. 8r + 1 Collect the terms in 8 + 17b3 - 12 + 4. 17b*3 Collect the terms in -40a + 91 - 91. -40a Collect the terms in 19z*3 - 5z*3 - 2z*3. 12z*3 Collect the terms in -2 - 3260w + 2 + 3262w. 2w Collect the terms in 8g3 - 20g*3 + 0g*3 + 7g*3. -5g*3 Collect the terms in -81o + 81o - 2o*2 + 85. -2o*2 + 85 Collect the terms in 1042 - 520 - 522 + 20n + 4n3. 4n*3 + 20n Collect the terms in -5z - 2z + 17z + 0z. 10z Collect the terms in 14q - q - 13q - 6q*2. -6q*2 Collect the terms in 6 - 6o + 17 - 23. -6o Collect the terms in -5a - 11a - 12a + 27a. -a Collect the terms in 4p + 0p - p - 4p. -p Collect the terms in 46 - 77 + 31 - 9y2. -9y*2 Collect the terms in 26o + 20 - 20 - 25o. o Collect the terms in 7535 - 7535 - 3s. -3s Collect the terms in -2u + 10u - u + 5u. 12u Collect the terms in -18i*2 + 4 + i - i + 0i*2. -18i*2 + 4 Collect the terms in -18y - 12y - 18y + 6y. -42y Collect the terms in -3 + 3 + 8l + 64l. 72l Collect the terms in 294j2 - j3 + 285j2 - 579j*2 - 5j*3. -6j*3 Collect the terms in 0b + 5b2 - b2 + 0b. 4b2 Collect the terms in 7c*2 - 5c*2 + 1 + 1 - 18c*2. -16c*2 + 2 Collect the terms in -10y*3 + 28y*3 + 11y*2 - 13y*2. 18y*3 - 2y*2 Collect the terms in 7u*2 + 889 - 889. 7u*2 Collect the terms in 0n*2 - 4 + 10n*2 + 4. 10n*2 Collect the terms in 8u + 6u - 2u + 5u. 17u Collect the terms in 3d2 + 16d - 26d + 10d. 3d2 Collect the terms in -6b*3 + 10b*3 - 5b3. -b3 Collect the terms in 89v + 34v - 119v. 4v Collect the terms in -j + 1405 - 1405. -j Collect the terms in 2 + 16 + 3a3 - 18. 3a*3 Collect the terms in 97t - 39t - 31t. 27t Collect the terms in 155 + 2r*2 - 155. 2r*2 Collect the terms in -10l - 7l + 22l - 4l. l Collect the terms in -11d + 3d - 2d*2 + 5d + 3d. -2d*2 Collect the terms in -11x*3 + 73x - 73x + 26x*3. 15x*3 Collect the terms in 193 + 3f*2 - 95 - 98. 3f*2 Collect the terms in -20 + 22 + 18c*2 - 2. 18c*2 Collect the terms in -33 + 74 - 41 - 57a*3. -57a*3 Collect the terms in 4u + 39 - 39 - 35u. -31u Collect the terms in 11874 - 3z3 - 11874. -3z*3 Collect the terms in -2 + 1 - 10j - 18j + 0. -28j - 1 Collect the terms in -28h3 + 51h*3 - 27h*3. -4h*3 Collect the terms in -55w*3 + 88w*3 + 34w*3. 67w*3 Collect the terms in -7f3 - f3 + 2f3. -6f*3 Collect the terms in 838y*3 - 408y*3 + 535y*3. 965y*3 Collect the terms in 29i - 19i - 11i. -i Collect the terms in -119x2 + 2x*3 + 119x*2. 2x*3 Collect the terms in 20l*3 + 8l*2 + 16l*2 - 22l*2. 20l*3 + 2l*2 Collect the terms in -10g + 6g - g. -5g Collect the terms in -5l + 4l + l - 13l3. -13l*3 Collect the terms in 41j - 11j - 18j - 13j. -j Collect the terms in -70d + 141d + 2d*2 - 71d. 2d2 Collect the terms in -5f*2 + 4f2 + f2 - 79f3. -79f*3 Collect the terms in -3 + 5 + 34x - 10x. 24x + 2 Collect the terms in -67 - 10 + 3z2 + 77. 3z*2 Collect the terms in -1 - 69n + 6 + 12n. -57n + 5 Collect the terms in -22 - 4b2 + 22 + 13b*2. 9b*2 Collect the terms in 1291d - 2588d + 1299d. 2d Collect the terms in 4d*3 - 7d*3 + 0d*3. -3d*3 Collect the terms in 4j - 461j2 - 6j + 2j + 463j*2. 2j*2 Collect the terms in c - 6c + 9 - c. -6c + 9 Collect the terms in 0a*3 - 2a3 - a3 + 0a3. -3a*3 Collect the terms in -6 - 22p*2 + 6. -22p*2 Collect the terms in 5y*3 + 0y*3 - 15y3 + y3. -9y3 Collect the terms in 0 + 0 - 4172h*2 + 4169h*2. -3h*2 Collect the terms in 3 + 8a - 31a - 3. -23a Collect the terms in -11n3 + 6n*3 + 21n*3 - 13n*3. 3n*3 Collect the terms in -2y - 3 + 2y - 8y*2. -8y*2 - 3 Collect the terms in 3q*2 - 10q*3 - 9q*2 + 6q*2. -10q*3 Collect the terms in -6 + 6 - 30v. -30v Collect the terms in 8p*3 + 39 - 42 - 2p*2 + 2p*2. 8p*3 - 3 Collect the terms in -8t + 8t + 5t*2. 5t*2 Collect the terms in 201l + 160l + 204l - 564l. l Collect the terms in -h2 + 410 - 410 - 2h*2. -3h*2 Collect the terms in -3 - 5k*2 + 0 - 20k*2. -25k*2 - 3 Collect the terms in 9k*2 + 12k*2 - 25k*2. -4k*2 Collect the terms in -4n*3 - 5n*3 - 15n*3. -24n*3 Collect the terms in 6 - 12 + 6 + 11s. 11s Collect the terms in -362d + 1098d - 366d - 367d. 3d Collect the terms in 3o3 + 103082o - 103082o. 3o*3 Collect the terms in -38s*2 + 159s*2 - 36s*2 - 45s*2 - 42s*2. -2s*2 Collect the terms in 3792 - i - 3792. -i Collect the terms in -27m*3 + 11m3 + m3. -15m3 Collect the terms in -6w*3 - 133325w*2 + 133325w*2. -6w*3 Collect the terms in 22j*2 - 86j*2 + 23j*2 + 14j*2 + 28j2. j2 Collect the terms in -3b + 12 - 31b*2 + 3b. -31b2 + 12 Collect the terms in 4n - 4n + 5 - 6n - 1. -6n + 4 Collect the terms in -5 + 6 - 24l - 1 + 31l. 7l Collect the terms in -29n + 7n + 7 - 7. -22n Collect the terms in 62 - 30 - 32 + 6j*2. 6j*2 Collect the terms in -140 + 140 + 70v. 70v Collect the terms in 239 - 239 + p. p Collect the terms in 3 + 5j - 8j - 3. -3j Collect the terms in 16h3 + 17h*3 + 16h*3 - 28h*3. 21h*3 Collect the terms in -682 - 6t + 682. -6t Collect the terms in -57g - 3g - 34g. -94g Collect the terms in 4 - 2t + 0t - 4. -2t Collect the terms in -3736 + 3736 - 7h3 + 11h*3. 4h*3 Collect the terms in -2d + 55500 - 55500. -2d Collect the terms in -76r + 13r + 8 - 9 + 2. -63r + 1 Collect the terms in -21652u + 21652u - 5u3. -5u*3 Collect the terms in 4a + 1752a2 - 1750a*2 - 4a. 2a2 Collect the terms in 2911 - n - 2911. -n Collect the terms in 2p - 3p - 12p - 3p. -16p Collect the terms in 2 + i - 1 + 2 + 1. i + 4 Collect the terms in -1 + 362c2 + 1 - 361c2. c2 Collect the terms in -6 + 45r - 64r + 6 + 20r. r Collect the terms in -16p - 19p - 18p + 79p - 24p. 2p Collect the terms in -40o*3 + 6o*2 + 14o*3 + 0o*2. -26o*3 + 6o*2 Collect the terms in 420 + 2d*3 + 414 - 834. 2d3 Collect the terms in 2800 - 1399 - 1401 - z. -z Collect the terms in 845927 - 845927 - f. -f Collect the terms in i2 + 19i3 - 60i3 + i2. -41i3 + 2i*2 Collect the terms in -28z*3 - 4z*3 + 4 - 4. -32z*3 Collect the terms in 8 + 3117c - 8 - 3120c. -3c Collect the terms in -106l*2 - 1	{ "pile_set_name": "DM Mathematics" }
s the third smallest value in d, 1, 46/13? 46/13 Let o = 26 + -22. Let t(q) = q*3 - 6q*2 - 6q - 2. Let s be t(7). Which is the second smallest value? (a) 1 (b) s (c) o c Let k = -3.413 - -10.413. Let q = 18/11 - 101/55. Which is the fourth smallest value? (a) q (b) -2 (c) k (d) -0.1 c Let h = -103/92 - -43/23. Let j be 1 + 7/5-1. Which is the second biggest value? (a) 3 (b) j (c) h c Suppose -4 = -2n + 2s, 0 = 3n - 5s - 0s - 14. Let m = 2366 + -2366.4. Which is the second biggest value? (a) -11 (b) m (c) n c Let o = 662 + -564. Which is the second smallest value? (a) 1/5 (b) o (c) 0 a Let j = 162.977 - 163. Which is the biggest value? (a) 3/8 (b) j (c) 3 c Let c be ((-3)/(108/(-10)))/((-565)/(-452)). What is the second biggest value in -2/15, c, -7/5, 3? c Let l = -8/131 - 190/1179. Suppose -4v + 5 + 3 = 0. Let m be -2v/(-26) - 0. What is the second biggest value in l, m, 4? m Let j = -35 + 36. Let h = 1.48 + -1.58. What is the fourth biggest value in 3, h, -1/3, j? -1/3 Let p be 61 - 10/(-15)-6. Let q = 398/7 - p. What is the biggest value in -2/61, q, 1, -0.5? 1 Let o be ((-12)/(-78))/(32/52). Let g = 4.8 - 0.8. Which is the biggest value? (a) o (b) -0.7 (c) g c Let u = 7 + -4. Let g = 0.05 + -4.05. Let p = 100/3 + -34. Which is the biggest value? (a) p (b) u (c) g b Let d = 5.8 + -6. Let l = 5.1 - -1.1. Let g = -6 + l. Which is the third smallest value? (a) -1 (b) g (c) d b Let p = -25 - -23.75. Let w = -0.25 - p. Let y = 0.01 - 0.41. What is the second smallest value in w, y, 1/2? 1/2 Let f = -47 - -50. Suppose -3s + 16 = 4w, -5s - 4w + 27 - f = 0. Let p = 2 - 0. Which is the third biggest value? (a) s (b) p (c) -0.3 c Let a be 140/(-294)21/35. Let v = 2.9 - -9.1. What is the third biggest value in v, 5, a? a Let r = 38/5 - 157/20. Let p = -67 - -67.5. Which is the third biggest value? (a) -2 (b) p (c) r a Let i = 109.8 + -109.9. What is the second smallest value in i, 3/5, 4, 0? 0 Let u be 279/510 + 4(-3)/30. Let n = u + -11/306. Which is the second smallest value? (a) -0.1 (b) n (c) 0.25 b Let o = 1002.3 + -1002. Let n = 1 + -16. Which is the biggest value? (a) n (b) 0.2 (c) o c Let n = -8 - 3. Let r = n + 11.5. Let w = 215 + -219. Which is the third biggest value? (a) r (b) w (c) -0.6 b Let q(p) = -4p + 13. Let n be q(6). Let d = -10 + n. Let h = d + 24. Which is the biggest value? (a) 0.3 (b) h (c) 0 b Let c be (-52)/(-72) + (-1)/2. Let a = -86 + 253/3. Let l = -8 - -3. What is the third biggest value in l, a, c? l Let a = -11 - -53. Let i = 37 - a. What is the biggest value in 0.1, i, 1.1? 1.1 Let k = -9 + 12. Suppose -k = 8w - 9w. Suppose -12x + 15x = w. Which is the second biggest value? (a) 2/9 (b) 3 (c) x c Let y = 20 + 6. Let c = 22 - y. What is the third biggest value in 3, c, 0.4? c Let c(k) = -k*2 - 7k + 4. Let q be c(-5). Let u be (-56)/q + 52/14. Let b = 40 + -119/3. What is the third biggest value in u, 6, b? u Suppose 24 = -2s - 2s - 4o, 0 = 2s + 5o. Let q be 0(s/(-4) - 3). Let z = -2.2 - -2. Which is the biggest value? (a) z (b) q (c) -5 b Let w = 67.2 - 67.5. What is the third biggest value in 2, 2/3, 0.24, w? 0.24 Suppose 4a + 9 = 3c, -25a - 12 = -21a. What is the second smallest value in c, -3/421, -4? c Let x = 11 + -12.95. Let i = -49 - -48.95. Let r = x + i. Which is the smallest value? (a) 2/9 (b) r (c) 0.6 b Let j be 15(-4)/(-18)3. Let z = -2.4 + 13.8. Let n = z + -11.6. Which is the second biggest value? (a) n (b) -4 (c) j a Let z = 0.21 + 24.79. Let g = z - 22. Suppose 29 = 5n - 4m, -n = 3n + 4m - 16. Which is the third biggest value? (a) g (b) 0.2 (c) n b Let t = 1.71 - 5.71. Which is the smallest value? (a) t (b) 0.5 (c) -1 a Let t = 48/265 - -1/53. Let b = t + 1/5. Let l = 3 + -2.9. What is the smallest value in -5, b, l? -5 Let n be (-5)/(-33) - 36/(-198). What is the second biggest value in -1, 4, 0.4, n? 0.4 Let v = -0.2 + 0.2. Let y be 2((-4)/(-84))/(3/(-9)). Which is the second smallest value? (a) v (b) y (c) 1/4 a Let s = -3.75 - -4.25. Which is the fourth smallest value? (a) s (b) 1 (c) -0.25 (d) -2 b Let d = 231 + -123. Let z = d - 133. Which is the third smallest value? (a) -4 (b) 0.5 (c) z b Let u = -1.7 + 1.52. Let d = -86 + 90.82. Let m = u - d. Which is the smallest value? (a) -0.2 (b) 1 (c) m c Let l = 0.161 + -0.261. What is the second smallest value in 1, -0.2, l, 0.3? l Let x = -1.6 + 0.6. Which is the third biggest value? (a) -0.5 (b) x (c) 16 b Let w = -0.18 - -2.18. Let t = 5 + w. Let q = -5 + 4. What is the second biggest value in t, 1/2, q? 1/2 Let t = -0.415 - -0.315. Let p = -279/1391 + 5/107. What is the smallest value in 4, -1.3, t, p? -1.3 Let a = -288/25 + 2229/200. What is the fourth smallest value in 306, a, -5, -1/7? 306 Let n(g) = 4g - 132. Let r be n(34). What is the smallest value in 19, r, 0.4? 0.4 Suppose -4 + 64 = 10p. Suppose s - 1 = -h + 3s, -3h + 3s + p = 0. Which is the third biggest value? (a) h (b) -3/10 (c) -0.5 (d) 2/7 b Let x = 152.9 - 141. Let w = x + -9.9. Let n = 1 + 0. Which is the second biggest value? (a) w (b) n (c) -2 b Let v(w) = w*3 + 17w*2 - 17. Let u be v(-17). Let k(t) = t + 17. Let x be k(u). Which is the smallest value? (a) x (b) -2/3 (c) -3 c Let u = -4.2 + 4.21. Let a = u - -3.99. What is the third smallest value in -3, 0, -1/20, a? 0 Let p = 74.2 + -74.3. Let t be (-1 - -4)8/(-6). Which is the fourth smallest value? (a) 3/5 (b) p (c) -1/7 (d) t a Let q = -0.73 - -0.93. Let p = -3 - -2. What is the smallest value in -3/2, p, q? -3/2 Let f = 634.5 - 634. What is the third smallest value in -0.14, 2/5, f? f Let n be (-3 - 2/(-1))/(159/(-6)). What is the third biggest value in n, -0.3, 3/2, 1? n Let v = 0.8 - 0.3. Let t = -31.39 - -0.39. Let n = -30.6 - t. Which is the third biggest value? (a) n (b) -0.2 (c) v b Let f = 20 + -24. Suppose -2k - k = 0. Suppose k = -2j - 2 + 8. What is the second biggest value in j, f, -0.2? -0.2 Let s be (-10)/45 - (-1 + 14/18). Suppose -2p - 2p = s. What is the second smallest value in -0.1, -5, p, -0.2? -0.2 Let q = 112 + -30.2. Let f = q + -82. Which is the third smallest value? (a) 0.1 (b) 0.04 (c) f a Let j = -509 + 508.7. What is the biggest value in -4/3, j, 27? 27 Let f be (-18)/(-24) + 284/(-368). Let u = 85/322 - f. Let o(d) = d - 1. Let c be o(3). What is the smallest value in -0.3, c, u? -0.3 Let k = 10/3 + -101/33. What is the second smallest value in 0.05, 2/9, k, -3? 0.05 Let v = 3.3 - 0.3. Let m = 1 - v. Let f = 29/4 - 269/36. Which is the second biggest value? (a) f (b) m (c) -1 c Let r = -0.0561 + 0.2561. Which is the second smallest value? (a) 2/9 (b) -233/5 (c) r c Let r = 3.5 + -3. Let l be 2/(9/(27/6)). Let z(k) = 7k - 2. Let m be z(l). What is the biggest value in r, m, -1/2? m Let g = 184.4 + -205. Let m = 21 + g. What is the second biggest value in m, 2, -2/13, 0.3? m Let u = -690.3 - -746. Let m = 56 - u. Let r be 2/(-7) - 25/35. What is the third biggest value in 3, m, r? r Let z be (-1)/(-1) - (4 - 19/6). What is the fourth smallest value in z, -10, -2, 0.2? 0.2 Let m(v) = -33v - 1287. Let z be m(-39). Let i = 18 - 5. Which is the fourth smallest value? (a) z (b) -0.5 (c) i (d) -5 c Let t = 424 - 425. Which is the third biggest value? (a) 4 (b) t (c) 0.27 b Let n(z) = -8z - z3 + 2z*3 + 8z*2 + 6 + 0z*3. Suppose -8q = -2q + 54. Let b be n(q). What is the second smallest value in b, 3, 5? 3 Let q = -4.8 - -5. Let l = -12 + 14. Which is the third smallest value? (a) q (b) -0.6 (c) l c Suppose q + 7 = -3n, 0 = 3n - 6q + 3q + 3. Let w be -2 + 0 + n + 52/14. Suppose y + 0 = -1. What is the third smallest value in -0.3, w, y? w Let w = 1832 + -1831. Which is the third biggest value? (a) -2/7 (b) w (c) 0.2 (d) 8 c Let j = -6.7 - -1.7. Suppose -k = g - 2, -2k = -0k - 4g - 22. Which is the third smallest value? (a) j (b) 3/7 (c) -25 (d) k b Let o = 13 - -23. Let v = -35.9 + o. What is the second biggest value in v, -1, 5? v Suppose -138 = 23b - 184. What is the second smallest value in b, 3, 1/9, 0.2? 0.2 Suppose 0 = -2g, -2*t + g + 0 + 6 = 0. What is the second smallest value in -1, t, -12? -1 Let	{ "pile_set_name": "DM Mathematics" }
48616/3 Calculate -1862146 divided by 5. -1862146/5 Calculate 10941 divided by 3. 3647 Divide 11 by -668. -11/668 Divide -144 by 565. -144/565 -12890 divided by -2 6445 Divide 35640 by -2. -17820 Divide 1051732 by 2173. 484 Calculate 19799 divided by 1523. 13 What is 39416 divided by -4? -9854 -52 divided by 187 -52/187 What is -71118 divided by 1? -71118 What is -19740 divided by -20? 987 What is -40 divided by 90? -4/9 Calculate -10054 divided by -9. 10054/9 Divide -3219115 by 5. -643823 Divide 153 by -9729. -17/1081 -610041 divided by -3 203347 Calculate -101331 divided by -81. 1251 What is -108 divided by 2050? -54/1025 What is 6 divided by -151? -6/151 -527772 divided by -14 37698 Calculate 330260 divided by 33026. 10 Divide -89984 by -8. 11248 Divide 5632 by -62. -2816/31 Calculate 249 divided by -506. -249/506 36 divided by 468 1/13 Divide -6967 by 3. -6967/3 Calculate -171798 divided by 627. -274 Calculate 3412263 divided by 1137421. 3 Calculate -10193 divided by 10193. -1 What is -78854 divided by -39427? 2 Divide -2927 by -1. 2927 -118660 divided by 1 -118660 Divide 10 by 4848. 5/2424 What is 4962 divided by 307? 4962/307 What is -297904 divided by -74476? 4 Calculate 55482 divided by -6. -9247 Divide 327612 by -17. -327612/17 Divide 2519248 by 4. 629812 Divide 2620013 by -3. -2620013/3 Calculate 205313 divided by 4. 205313/4 What is -91987 divided by -12? 91987/12 What is 5210 divided by 133? 5210/133 Divide -352672 by -856. 412 What is 1369760 divided by -3? -1369760/3 130282 divided by -18 -65141/9 What is 3 divided by -77749? -3/77749 What is -2708650 divided by 38695? -70 Divide -20673 by -3. 6891 Divide 413 by 1820. 59/260 Divide 68561 by 5. 68561/5 Divide -23088 by 296. -78 What is -280872 divided by -47? 5976 What is -1 divided by 9413? -1/9413 Calculate 38817 divided by 3. 12939 What is -3814580 divided by -7? 544940 Divide 402566 by -1. -402566 223270 divided by -830 -269 Divide 1 by 89009. 1/89009 -28667 divided by 109 -263 Calculate 205410 divided by -41082. -5 What is 45831 divided by -46? -45831/46 Divide 4303 by 1. 4303 Divide 85125 by 85125. 1 What is 0 divided by 33029? 0 -1158414 divided by -102 11357 Divide -3391030 by 5. -678206 Divide 79439 by 4. 79439/4 -9594 divided by -3 3198 -37808 divided by -16 2363 Calculate -300664 divided by -2548. 118 What is -3057640 divided by 3? -3057640/3 20964 divided by 10482 2 -19908 divided by 158 -126 Divide 607215 by -5. -121443 What is 3 divided by 378217? 3/378217 Divide 842284 by 19588. 43 Calculate 14 divided by -191. -14/191 What is -2598 divided by 33? -866/11 What is -3309 divided by -59? 3309/59 -448704 divided by -288 1558 Divide -15114 by -19. 15114/19 What is -211 divided by -4308? 211/4308 Calculate 48372 divided by 12093. 4 Divide 2126912 by -3184. -668 What is 11 divided by 586011? 11/586011 -706386 divided by -4 353193/2 Divide 44968 by 1022. 44 Calculate -1 divided by 1079042. -1/1079042 4 divided by -28945 -4/28945 360223 divided by -360223 -1 -4 divided by 276123 -4/276123 Calculate 192540 divided by 9627. 20 622160 divided by -2222 -280 Divide -65 by -106. 65/106 Calculate 489258 divided by 9. 54362 Divide -172270 by -4. 86135/2 460 divided by 269 460/269 What is -817880 divided by -20447? 40 Calculate -24063 divided by -8021. 3 What is 31558 divided by -31558? -1 Calculate 2425 divided by 99. 2425/99 What is 25200 divided by -11? -25200/11 Divide -1710 by 23. -1710/23 Divide -2531952 by -6. 421992 -99416 divided by -34 2924 Calculate -62 divided by -2593. 62/2593 Divide -7295 by -5. 1459 Calculate -36432 divided by 22. -1656 What is 45216 divided by -48? -942 Divide -42 by 15676. -21/7838 What is 451420 divided by 4? 112855 Calculate 2152374 divided by 2152374. 1 19782 divided by 5 19782/5 What is 5 divided by -761? -5/761 Divide 89700 by -20. -4485 Calculate -52 divided by -727. 52/727 Calculate -3 divided by -3074. 3/3074 -13 divided by -4765 13/4765 Calculate 0 divided by 46224. 0 Calculate -181924 divided by -45481. 4 What is 7 divided by 17413? 7/17413 What is 2 divided by -7906? -1/3953 Calculate -8236 divided by 26. -4118/13 What is -11534 divided by -3? 11534/3 Calculate 22 divided by 23205. 22/23205 What is 82320 divided by 13720? 6 Calculate 172 divided by 993. 172/993 Divide 251604 by 9. 27956 Calculate 104 divided by -285. -104/285 Divide -3 by -46107. 1/15369 Calculate 3983 divided by -1. -3983 What is 167966 divided by 6? 83983/3 -335070 divided by 1 -335070 What is -962 divided by 43? -962/43 2 divided by 97959 2/97959 Divide -1164 by -124. 291/31 Divide -6108814 by 3. -6108814/3 What is 15749235 divided by 5? 3149847 -6 divided by -32251 6/32251 -5 divided by 25783 -5/25783 -29646 divided by -3 9882 Divide -51584 by -248. 208 Divide -28158 by -3. 9386 16240 divided by -203 -80 What is 26 divided by 83801? 26/83801 -613252 divided by -6 306626/3 Calculate 1400952 divided by 28. 50034 Divide -1001262 by 6. -166877 Calculate -9180 divided by 18. -510 -2855 divided by -7 2855/7 Divide 33 by -1644. -11/548 -8415 divided by -495 17 7600 divided by -1520 -5 Divide -530172 by -4. 132543 Calculate 2 divided by 192191. 2/192191 5 divided by -73120 -1/14624 What is 5 divided by 13577? 5/13577 Divide 144666 by -48222. -3 What is 2034081 divided by 5229? 389 Calculate -19380 divided by 3876. -5 Divide -154327 by 1. -154327 423739 divided by 4 423739/4 5 divided by 6208 5/6208 22074 divided by 13 1698 Divide -8760 by 30. -292 4 divided by 3567 4/3567 Calculate 408 divided by 74. 204/37 -1951 divided by 1175 -1951/1175 Divide -4 by -838. 2/419 Calculate 8430 divided by 141. 2810/47 -1250858 divided by 14 -89347 Divide -3 by -4088. 3/4088 801458 divided by 38 21091 36069 divided by -11 -3279 Divide -100742 by -2. 50371 -3276 divided by -26 126 958902 divided by 3 319634 -1147 divided by 625 -1147/625 Calculate -36 divided by 64147. -36/64147 Calculate 502740 divided by -10. -50274 Calculate 367052 divided by 14. 26218 Divide -2621 by 13. -2621/13 20700 divided by -276 -75 -5 divided by 122956 -5/122956 What is 233055 divided by -5? -46611 What is 285 divided by 2528? 285/2528 Divide 1202 by 86. 601/43 Divide 187996 by 6. 93998/3 Divide 60368 by -2. -30184 Divide -6926 by -8. 3463/4 Calculate -406533 divided by -3. 135511 What is 13607 divided by 1237? 11 5099448 divided by 2 2549724 -7506 divided by -6 1251 Calculate -5334 divided by -3. 1778 Divide -13 by 79163. -13/79163 What is -271002 divided by 90334? -3 Divide 493312 by 656. 752 Divide 60647 by -4. -60647/4 What is 518456 divided by -6? -259228/3 What is -7074 divided by 9? -786 Calculate -134998 divided by 3. -134998/3 Calculate 844600 divided by 5. 168920 What is 57439 divided by -71? -809 2 divided by 4663 2/4663 125735 divided by -25147 -5 Calculate 452640 divided by 6. 75440 What is 425200 divided by 40? 10630 Calculate -4 divided by 1804. -1/451 Divide 321620 by -4. -80405 What is 71330 divided by -14266? -5 Divide 62335 by 4795. 13 Divide -84993 by -691. 123 Calculate -198 divided by 818. -99/409 Calculate 182 divided by -882. -13/63 What is 13111 divided by -13111? -1 Calculate 17 divided by -2966. -17/2966 Calculate 8 divided by 37425. 8/37425 -8720 divided by 218 -40 Calculate 0 divided by 57605. 0 What is 31748 divided by 2? 15874 Calculate 4753 divided by -9. -4753/9 What is 64236 divided by -3? -21412 What is 0 divided by -7142? 0 Calculate -349041 divided by 21. -16621 -5599 divided by -62 5599/62 Calculate 80 divided by -260. -4/13 Divide -2528595 by -505719. 5 -6131 divided by 80 -6131/80 Calculate 16 divided by 1959. 16/1959 36493444 divided by 4 9123361 What is 14301 divided by 9? 1589 Calculate -161 divided by 8484. -23/1212 Calculate -1406 divided by -222. 19/3 Divide -6130845 by -875835. 7 Divide -601 by 262. -601/262 Divide 117990 by 57. 2070 Divide -17390 by 2. -8695 Calculate 2075 divided by 175. 83/7 83 divided by -134 -83/134 Divide -1 by 11825. -1/11825 Calculate 436195 divided by 6. 436195/6 What is -65 divided by -332? 65/332 16102 divided by -1 -16102 Divide -28930 by 14465. -2 Calculate -267801 divided by -3009. 89 Divide -41562 by -3. 13854 -535204 divided by -267602 2 Divide 27771 by -9257. -3 Calculate 3 divided by 59077. 3/59077 3421683 divided by -3 -1140561 -4	{ "pile_set_name": "DM Mathematics" }
5 to the nearest 100000. -200000 What is 103366.64 rounded to the nearest ten? 103370 Round 54151980 to the nearest ten thousand. 54150000 What is -0.00000129771 rounded to 7 decimal places? -0.0000013 Round 874469 to the nearest 100. 874500 What is -0.844827 rounded to one dp? -0.8 Round 0.000004754374 to seven dps. 0.0000048 What is 0.001168151 rounded to six dps? 0.001168 Round 592770 to the nearest one million. 1000000 Round 0.002199126 to 5 dps. 0.0022 What is -11391.7 rounded to the nearest one hundred? -11400 What is 0.03399795 rounded to 3 dps? 0.034 What is 1.092519 rounded to three dps? 1.093 What is 0.01296 rounded to 5 decimal places? 0.01296 Round -0.0002525826 to 6 dps. -0.000253 Round 0.0026512559 to 4 decimal places. 0.0027 Round -0.06165215 to 2 dps. -0.06 What is 0.05943 rounded to 1 dp? 0.1 Round -22.469956 to 1 decimal place. -22.5 What is -2625064000 rounded to the nearest 1000000? -2625000000 Round 0.010910387 to three dps. 0.011 What is 0.0009179758 rounded to 5 dps? 0.00092 Round -748442 to the nearest 100000. -700000 What is 0.00377153 rounded to five dps? 0.00377 What is 73.1099 rounded to zero dps? 73 What is 79.31908 rounded to 1 decimal place? 79.3 Round -2915190 to the nearest 100000. -2900000 Round -0.0000686752 to 6 dps. -0.000069 Round 13.0953 to the nearest integer. 13 What is -0.0001518338 rounded to 6 dps? -0.000152 Round 12240380 to the nearest one million. 12000000 Round -0.00158501 to 5 dps. -0.00159 What is -46189000 rounded to the nearest 1000000? -46000000 What is 180524000 rounded to the nearest 1000000? 181000000 What is -43.9881 rounded to the nearest ten? -40 What is -89.083752 rounded to two dps? -89.08 What is -135840 rounded to the nearest 100000? -100000 Round 406974 to the nearest one hundred thousand. 400000 Round 183.6161 to zero dps. 184 Round 2.5774009 to three dps. 2.577 Round -4.48001 to the nearest integer. -4 What is 0.457508 rounded to 3 dps? 0.458 Round -6.337352 to the nearest integer. -6 Round 0.001218421 to five decimal places. 0.00122 Round 0.00000142088 to 7 dps. 0.0000014 Round -3323871500 to the nearest 1000000. -3324000000 What is 0.0368457 rounded to four dps? 0.0368 What is 0.04406978 rounded to 5 decimal places? 0.04407 Round -61100.6 to the nearest 100. -61100 Round 55.4801 to 0 decimal places. 55 What is 11.79912 rounded to 2 decimal places? 11.8 What is 18.63391 rounded to zero decimal places? 19 Round -104.7541 to the nearest 10. -100 Round 200582800 to the nearest one million. 201000000 What is 0.0029706 rounded to four dps? 0.003 What is 80869000 rounded to the nearest one million? 81000000 What is 51.700057 rounded to the nearest 10? 50 Round 0.0001253084 to 5 decimal places. 0.00013 What is -8159.22 rounded to the nearest one hundred? -8200 Round 4493844 to the nearest 100000. 4500000 Round -61.3177 to the nearest integer. -61 What is -0.000002106243 rounded to seven dps? -0.0000021 What is -2404548.2 rounded to the nearest 1000? -2405000 What is -21467.39 rounded to the nearest 100? -21500 Round -875833 to the nearest ten thousand. -880000 Round -0.00000644691 to six dps. -0.000006 What is -0.000250246 rounded to 5 dps? -0.00025 Round -0.0000317836 to three dps. 0 Round 1057142.55 to the nearest 100000. 1100000 What is 0.7355701 rounded to four dps? 0.7356 What is -0.04520052 rounded to 4 dps? -0.0452 What is -0.00009963217 rounded to 5 decimal places? -0.0001 Round -111105900 to the nearest one million. -111000000 Round -46281 to the nearest 1000. -46000 What is -0.006619337 rounded to 4 decimal places? -0.0066 Round -0.0004501389 to 7 decimal places. -0.0004501 What is 116863.3 rounded to the nearest one hundred? 116900 Round -4871.82 to the nearest 100. -4900 Round -6983.44 to the nearest 10. -6980 What is 4243752 rounded to the nearest 100000? 4200000 Round -0.02525636 to 2 decimal places. -0.03 What is -352092.8 rounded to the nearest 10000? -350000 What is -0.00005256068 rounded to 6 decimal places? -0.000053 Round 0.094632991 to 2 decimal places. 0.09 What is 0.0219035 rounded to four dps? 0.0219 Round 2580383000 to the nearest one million. 2580000000 What is 0.001798006 rounded to 5 dps? 0.0018 Round 0.05655616 to four decimal places. 0.0566 What is -1047.737 rounded to the nearest one hundred? -1000 What is -4325840 rounded to the nearest one hundred thousand? -4300000 Round 54549.6 to the nearest 1000. 55000 What is -91.5147 rounded to 1 decimal place? -91.5 What is -0.256549 rounded to three dps? -0.257 What is 4979040 rounded to the nearest 1000000? 5000000 What is 0.0136138 rounded to 4 dps? 0.0136 Round -7885080 to the nearest one hundred thousand. -7900000 Round 0.00818339 to 3 decimal places. 0.008 Round 27.08922 to 1 decimal place. 27.1 Round -0.003349676 to 3 decimal places. -0.003 Round 23305.86 to the nearest 1000. 23000 Round -6979840 to the nearest ten thousand. -6980000 What is 57025.04 rounded to the nearest 10000? 60000 What is 0.0001151764 rounded to five dps? 0.00012 Round -0.0000648617 to 7 dps. -0.0000649 Round 0.1617819 to 3 dps. 0.162 What is -0.000376757 rounded to six decimal places? -0.000377 What is 1570.816 rounded to the nearest one hundred? 1600 What is -829.71 rounded to the nearest 10? -830 What is 39.7638 rounded to one decimal place? 39.8 What is -3.407446 rounded to 2 decimal places? -3.41 Round -0.2749783 to four dps. -0.275 Round -985295.5 to the nearest one thousand. -985000 What is -557.5369 rounded to 0 dps? -558 What is 0.279429 rounded to 3 dps? 0.279 Round 7.1997401 to 1 decimal place. 7.2 Round -1780240 to the nearest one hundred thousand. -1800000 What is -1809.03 rounded to the nearest 10? -1810 What is 69910000 rounded to the nearest one million? 70000000 What is 179.602 rounded to the nearest 10? 180 What is 6767594.8 rounded to the nearest 1000000? 7000000 Round 0.18377416 to 4 decimal places. 0.1838 What is -0.2546847 rounded to three dps? -0.255 Round 55.20752 to one decimal place. 55.2 Round -0.21982448 to three dps. -0.22 What is 1768.085 rounded to the nearest 10? 1770 What is 0.00003354076 rounded to 7 dps? 0.0000335 What is -1367704 rounded to the nearest one hundred thousand? -1400000 What is 2073.86 rounded to the nearest one hundred? 2100 Round 2995727.6 to the nearest ten thousand. 3000000 Round -0.994187 to one decimal place. -1 Round -1.11035 to 3 dps. -1.11 What is -0.06117352 rounded to three decimal places? -0.061 What is 0.00004722321 rounded to six decimal places? 0.000047 Round 428.844 to 0 dps. 429 What is 114242400 rounded to the nearest 100000? 114200000 What is 0.00000616803 rounded to 6 decimal places? 0.000006 What is -0.0017402226 rounded to five dps? -0.00174 Round 0.2999741 to two dps. 0.3 Round 0.172289 to 2 decimal places. 0.17 What is 13877.0417 rounded to zero dps? 13877 Round -434932.7 to the nearest one thousand. -435000 Round -40.69333 to 0 dps. -41 What is 388115.3 rounded to the nearest 1000? 388000 What is -1384194 rounded to the nearest 1000? -1384000 Round -21971.08 to the nearest one hundred. -22000 Round 0.003506881 to 5 dps. 0.00351 Round -202.1458 to 1 dp. -202.1 Round 0.00007536348 to 7 dps. 0.0000754 Round -0.000005723 to 5 decimal places. -0.00001 What is -0.5469935 rounded to 3 dps? -0.547 Round 0.0024815922 to three decimal places. 0.002 What is 0.0662069 rounded to two dps? 0.07 Round -7470160 to the nearest ten thousand. -7470000 What is -0.053426 rounded to four dps? -0.0534 Round 0.000000070109 to 7 decimal places. 0.0000001 What is 0.5839426 rounded to one dp? 0.6 Round -1969.75 to the nearest one thousand. -2000 What is 0.00660125 rounded to five dps? 0.0066 What is 0.34304214 rounded to 3 dps? 0.343 Round 6281760 to the nearest one million. 6000000 What is -8111.141 rounded to the nearest 1000? -8000 What is 0.0001384304 rounded to seven decimal places? 0.0001384 Round 38.178691 to the nearest integer. 38 Round -5.488805 to 2 decimal places. -5.49 Round -0.00000740546 to seven decimal places. -0.0000074 Round 30120980 to the nearest one million. 30000000 Round 1576187000 to the nearest one million. 1576000000 What is 0.0005545752 rounded to seven decimal places? 0.0005546 What is 152.557 rounded to the nearest one hundred? 200 Round 53958880 to the	{ "pile_set_name": "DM Mathematics" }
llect the terms in 65326m3 + 0m*2 - 65282m3 + m2. 44m3 + m2 Collect the terms in -5137g - 2 + 2 + 0. -5137g Collect the terms in 29 - 15 + 47 + 2l*3 + 103. 2l*3 + 164 Collect the terms in -862g + 1349g - 487g - 3g2 - 3 + 3. -3g*2 Collect the terms in 1346f - 725f - 622f. -f Collect the terms in 10 - 4 - 8 - 6 + 66j2 + 57j*2. 123j2 - 8 Collect the terms in i2 + 23 + 3i - 19i + 9i + 5i*2 + 9i. 6i2 + 2i + 23 Collect the terms in -556 + 546 - 71y2 + 70y2. -y2 - 10 Collect the terms in 2f - 4f + 2f - 3258 + 2f + 3316. 2f + 58 Collect the terms in 8y - 3y - 7y + 73 + y - 4y. -5y + 73 Collect the terms in 1650j2 - 553j*2 - 549j*2 - 11 - 544j*2. 4j*2 - 11 Collect the terms in 81d - 723683 + 723683 - 78d. 3d Collect the terms in 1034v - 539 - 14v + 539. 1020v Collect the terms in 253369 - 253369 - 37n. -37n Collect the terms in -8149p*2 - 8238p*2 + 16166p*2. -221p*2 Collect the terms in -1276 + 1276 + j + 0j. j Collect the terms in 3q + 19 + 17 - 39. 3q - 3 Collect the terms in 571h3 - 10h - 266h3 - 279h*3. 26h*3 - 10h Collect the terms in -677s - 666s + 5 + 1330s - 5. -13s Collect the terms in 737p2 - 424p*2 - 298p*2. 15p*2 Collect the terms in -6661x + 3316x + 3320x. -25x Collect the terms in -4812t + 327t - 1690t. -6175t Collect the terms in 0l*3 - 138l - l*3 + 9968l. -l*3 + 9830l Collect the terms in 280 - 245 - 345b + 346b. b + 35 Collect the terms in -78148w - 21588w - 6692w. -106428w Collect the terms in 693y - 338y - 348y. 7y Collect the terms in 2118 + 751 + 1816 - 2g2. -2g*2 + 4685 Collect the terms in -2518u*2 + 2u + 2526u2 - 7u + 5u. 8u*2 Collect the terms in 85k*2 - 731k*2 - 464k*2 - 150k*2. -1260k*2 Collect the terms in 1431n + 3823n + 1249n - 1329n. 5174n Collect the terms in 374787 - 9z - 374787. -9z Collect the terms in 50f + 55f + 61f - 303f + 53f + 62f. -22f Collect the terms in -2l + 0 - 96 - 9l. -11l - 96 Collect the terms in 2091643938 + 5d2 - 2091643938. 5d*2 Collect the terms in -9f - 12f + 64f - 16f - 7f. 20f Collect the terms in -9l*3 - 4 + 4 + 23l*3 + 173l*2. 14l*3 + 173l*2 Collect the terms in -376i + 115i + 143i + 110i. -8i Collect the terms in 35w + 15w - w*2 - 88w + 38w + 0w2. -w2 Collect the terms in 31q - 120 + 592q + 120 + q2. q2 + 623q Collect the terms in 52246790 - 55s*3 - 52246790. -55s*3 Collect the terms in -14x*3 - 123x*3 - 64x*3 - 52x*3. -253x*3 Collect the terms in 54 + 57 - 146 + 14o*3 + 35. 14o*3 Collect the terms in 108z*3 + 38z*3 + 44z*3 + 90z*3. 280z*3 Collect the terms in -8g + 5 + 2 + 16g - 19g - 7. -11g Collect the terms in 1556g*2 + 185g - 185g + 14068g*2. 15624g*2 Collect the terms in -27396u*2 + 54738u*2 - 27318u*2. 24u*2 Collect the terms in 178 + 19 - 218 + 21 + 2l*2. 2l*2 Collect the terms in 8i - 464 - 454 + 918. 8i Collect the terms in 3 - 29r - 2 - 14r + 18r. -25r + 1 Collect the terms in -348c - 430c - 559c + 129c. -1208c Collect the terms in -2037d3 - 1155d*3 - 351d*3 - 714d*3. -4257d*3 Collect the terms in 33m - 117m + 13m + 55m + 37m. 21m Collect the terms in -25q*3 - 6q + 6q - 1924q*2 + 1924q*2. -25q*3 Collect the terms in -10i + 15i2 + 3i*2 + 0i + 10i + 90i*2. 108i*2 Collect the terms in -15p*2 + 11p2 - p2 - 7p2. -12p2 Collect the terms in -p3 + 1 + 12p2 + 110p*2 + 20p*3 + 3. 19p*3 + 122p*2 + 4 Collect the terms in -153n + 449n - 149n - 1 - 149n. -2n - 1 Collect the terms in 24x3 + 73615x*2 - 73615x*2 - 22x*3. 2x*3 Collect the terms in 2k*3 - 2k*3 - 2k*3 + k + 0k*3. -2k*3 + k Collect the terms in 1088 - 547 - 541 + 10u*3 + 7u*3. 17u*3 Collect the terms in 6l + 12005l2 - 11995l*2 - 6l. 10l2 Collect the terms in 74j - 155j + 63j + 52j. 34j Collect the terms in -976j2 - 1114j*2 - 1097j*2 + 4033j*2 - 1065j*2. -219j*2 Collect the terms in 8f*2 + 47859709674f*3 - 47859709672f*3 - 6f*2 - 2f*2. 2f*3 Collect the terms in 9564 - 2d - 3d2 - 2255 + 4d*2 - 3d*2. -2d*2 - 2d + 7309 Collect the terms in 31t2 + 156t + 36t2 - 71t*2. -4t*2 + 156t Collect the terms in 30v + 630v + 655v - 56v. 1259v Collect the terms in 481n + 330n + 41n + 204n. 1056n Collect the terms in 5 - 3 - 2 - 5971i3. -5971i*3 Collect the terms in -4134z - 4133z + 8266z + 239. -z + 239 Collect the terms in -t - 44t2 + 2t + t - 301t2. -345t*2 + 2t Collect the terms in -7850 + 23576 - 3s2 - 7875 - 7851. -3s*2 Collect the terms in 955 - 12v - 6v + 0v + 4v - 955. -14v Collect the terms in 6b3 + 322b*2 - 641b*2 + 319b*2 - 2b*3. 4b*3 Collect the terms in 2186c*2 - 6566c*2 + 2193c*2 + 2186c2. -c2 Collect the terms in 80r2 + 84r*2 + 8r*3 + 157r*2 - 321r*2. 8r*3 Collect the terms in 206 - 206 - 5022c*2 + 2c. -5022c2 + 2c Collect the terms in -9z2 + 27z*2 - 5z*2 - 8z*2 - 9z*2 + 8z*2. 4z*2 Collect the terms in -15 + 7 - 5x*2 + 12x*2 - 5. 7x*2 - 13 Collect the terms in 5z + 13 - 11z2 + 18 - 31 - 5z. -11z2 Collect the terms in -133u + 32u + 35u + 33u + 34u. u Collect the terms in -l*3 + 5l*3 - 9l*3 + 13l*3. 8l*3 Collect the terms in 2d*3 - 28 + 15 + 22. 2d*3 + 9 Collect the terms in 13 - 4 - 66w + 68w - 1 - 8. 2w Collect the terms in 76 - 35 - 37 - 59d. -59d + 4 Collect the terms in 165x2 - 1510 + 1510. 165x*2 Collect the terms in -148w*3 + 506w - 533w3 - 506w. -681w3 Collect the terms in -99h - 6h2 - 10h*2 + 55h + 44h. -16h*2 Collect the terms in -575o*3 + 4 - 1 - 7o - 3. -575o3 - 7o Collect the terms in 17v - 8v + 86 - v + 99 - 9v. -v + 185 Collect the terms in 252 + 232 - 728 - 6p*2 - 6p*2 + 244. -12p*2 Collect the terms in -12i*2 + 12i*2 - 4i*2 + 13i*2 + 6i*2. 15i*2 Collect the terms in -14 + 14 + 8004u. 8004u Collect the terms in 445x + 1 - 1 + 0 - 939x. -494x Collect the terms in -12u2 - 27u + 4u + 22u. -12u2 - u Collect the terms in -4909643m + 2454825m + 2454822m. 4m Collect the terms in -5m - 27 - 57 + 22. -5m - 62 Collect the terms in -262k + 1050k - 255k - 531k. 2k Collect the terms in -16f2 - 3f - 161755313 + 161755313 + 3f. -16f*2 Collect the terms in 18f - 5 + 10f - 27f - 5f2. -5f*2 + f - 5 Collect the terms in 17 + 11 - 40512g*3 - 29. -40512g*3 - 1 Collect the terms in 402b*2 - 582b*2 - 992b*2. -1172b*2 Collect the terms in -6d + 259013 - 259013. -6d Collect the terms in -279 - 180 - 189 + 2s + 769. 2s + 121 Collect the terms in -120785p + 74784p - 126830p. -172831p Collect the terms in 6j*2 + 9j - 10j + 18j*2 - 2j. 24j2 - 3j Collect the terms in -135f - 441f - 646f - f3. -f3 - 1222f Collect the terms in 195r2 + 198r*2 + 194r*2 - 771r*2 + 188r*2. 4r*2 Collect the terms in 92m*2 - 12m*2 + 59m*2. 139m*2 Collect the terms in 838q*2 - 41q - 841q2 + 41q. -3q2 Collect the terms in 16 + 9s*2 + 1793s - 1793s. 9s*2 + 16 Collect the terms in 2t*2 + 21t*2 + 36t*2 + 2t3 - t3. t*3 + 59t*2 Collect the terms in -2f + 2158 + 3f + 0f - 2158. f Collect the terms in 0g - 84646g*2 + 84647g*2 - 47g. g*2 - 47g Collect the terms in 85j - 21j - 25j - 11j - 2j2 - 28j. -2j2 Collect the terms in -2 + 151h*2 + 738h*2 + 2. 889h*2 Collect the terms in 31 - 88 + 7j*3 + 55. 7j*3 - 2 Collect the terms in -25s*2 + 853861 + 5s*2 - 853861. -20s*2 Collect the terms in 271j - 14j3 - 271j - 10j3. -24j*3 Collect the terms in -247w - 5w3 - 241w - 240w + 728w. -5w3 Collect the terms in 248k*2 + 55k*2 + 225k*2 - 557k*2. -29k*2 Collect the terms in 82638 - 41291 - 41347 + 10x*3. 10x*3 Collect the terms in -3119945 + 3119945 - 5i. -5i Collect the terms in 1864g - 1864g + 226g*3. 226g*3 Collect the terms in 7h*3 + 280h + 2 - 136h - 14 - 144h. 7h3 - 12 Collect the terms in -22 - 200k - 52 + 74. -200*k Collect the terms in 1653	{ "pile_set_name": "DM Mathematics" }
of b(-2)? 7 Let w = 193 + -188. Suppose -1328 = -3h + wg, -42 + 482 = h + g. What is the units digit of h? 1 Let p be -9 + 6 - (-45)/1. Let u be 4/(2 - 80/p). Let v = -5 + u. What is the tens digit of v? 3 What is the tens digit of (-20 + (-60)/4)(-7)/(147/9216)? 6 What is the units digit of (2 - 41508/(-30))/(18/90)? 8 Suppose 20i + 2294 = 74. Let q = 228 + i. What is the units digit of q? 7 Let w be (-4 + 8)(-129)/4. Suppose 112k = 123k - 3300. Let u = w + k. What is the hundreds digit of u? 1 What is the units digit of (29950 - (-11 + -6)) + -12 + 4? 9 Suppose -81y + 607345 = -766658. What is the hundreds digit of y? 9 Let r be (-5 + -959)2/(-4). Suppose r - 74 = 6d. Suppose -j - 212 = -4j - k, -3k + d = j. What is the tens digit of j? 7 Let w = -39847 + 69514. What is the thousands digit of w? 9 Let w be -1(-2)/(-6)0. Suppose 3z - 1275 = 4c, 4z - 3c - 2c - 1700 = w. What is the tens digit of z? 2 Suppose 398l - 649l = -374l + 1499985. What is the thousands digit of l? 2 Suppose -4i + 5723 = o, -8 + 5 = i. What is the tens digit of o? 3 Suppose 424 - 22 = 6z. Suppose 0m + i - 277 = -4m, -z = -m + 2i. What is the tens digit of m? 6 Let v be (-7)/42 + (174845/6)/11. Let z = 4426 - v. What is the units digit of z? 7 Suppose 3w + 765 = 3z, 4w - 1210 = -4z - 222. What is the tens digit of z? 5 What is the hundreds digit of (-870)/12(-9234)/135? 9 Let o = -35 - -33. Let w(a) = -2a - 1. Let d be w(o). Let y = d + 53. What is the tens digit of y? 5 Suppose 20y - 3705 - 5235 = 0. What is the tens digit of y? 4 Let g be (0 + (-68)/(-6))/(16/48). Suppose 36 = gc - 31c. Suppose 5n = 3n, -3o + c = -5n. What is the units digit of o? 4 Suppose -5m = 97s - 115s - 374735, -15 = 3s. What is the hundreds digit of m? 9 Suppose 2 = 5y - 4y. Suppose -5s - 24 = -ys. Let k(p) = p*3 + 9p*2 - 4p - 20. What is the tens digit of k(s)? 7 Let y = 84 + -80. Suppose -yz = 4, -l = -3z + 6z + 20. Let j = 135 + l. What is the units digit of j? 8 Let r(u) = 19u*2 - 2u - 7. Suppose -5x - 10 = -5b, 8b + 2x = 7b - 10. What is the units digit of r(b)? 3 Let r = 79 - 77. Suppose 0 = 4d + 3x - 12, -rx - 4 = 4. What is the tens digit of 392/d + (-3)/9? 6 Let d = -84 - -1. Let m = 79 + d. Let z = 5 + m. What is the units digit of z? 1 Suppose -5x = -0c + c + 66, -4x = -2c - 146. Let j = 75 + c. Suppose 0t - 42 = -jq + 3t, 3q - 29 = t. What is the units digit of q? 9 Suppose 0 = -31l + 32l + 490. Let c = 708 + l. What is the hundreds digit of c? 2 Let s(o) = -1076o + 6193. What is the units digit of s(-43)? 1 Let y be 1/((3/6)/1). Suppose 9 + 33 = -yl. What is the tens digit of 12/10(-2170)/l? 2 Suppose 0 = -o + 2942 + 1965 + 3310. What is the hundreds digit of o? 2 Suppose -3h + 6482 + 11797 = -3b, -12186 = -2h + b. What is the units digit of h? 3 Let g(x) = -x*3 - 13x*2 - 12x + 3. Let p be g(-12). Suppose 15 = -f - 4f, 5z + 1294 = -pf. Let u = z - -365. What is the units digit of u? 8 Let t be 4264/(-32) - (-1)/4. Let w = -55 - t. Suppose 3l - 303 - w = 0. What is the hundreds digit of l? 1 Let f be (28 + 5)3/9. Suppose -1488 = fo - 15o. What is the units digit of o? 2 Let z(p) = -p2 - 10p - 26. Let x be z(-5). What is the hundreds digit of x/(-8) - 20025/(-120)? 1 Let f(w) = 6w - 72w - 49w - 2 - 29. What is the tens digit of f(-3)? 1 What is the thousands digit of 3 - -9298 - 18/((-198)/(-55))? 9 Let c be (-4712)/(-19)((-46)/(-8) - 0). Let u = c - 793. What is the hundreds digit of u? 6 Let h(j) = 371 - 290 - 428 + 37j. What is the units digit of h(29)? 6 Let i be -3(-12)/27-126. Let x = 286 + i. Suppose 0 = 4f - 2k - x, -2f + 3f = 5k + 7. What is the tens digit of f? 3 Let u(d) = -8184d + 28. What is the tens digit of u(-4)? 6 Let s = 5316 - 3362. What is the thousands digit of s? 1 Let v = -7552 + 7550. Let y = 7 + -4. What is the units digit of (y + 0)((-5)/3 - v)? 1 Suppose 19h = 1243 + 904. Let q = -252 - -558. Let v = q - h. What is the hundreds digit of v? 1 Let r = -4 + -2. Let g be r/(-4) - (75/(-10) - 1). Suppose 0 = 6f - gf + 312. What is the tens digit of f? 7 Let v(z) = 43 - z - 6z + 11z + z. Let r be v(-8). What is the units digit of 1/r + (-3 - 1500/(-9))? 4 Suppose 2c - 4 = g, 5c = g + 2 + 2. Suppose -16a + 11a - 30 = c. Let t(p) = p3 + 7p*2 + 8p + 14. What is the units digit of t(a)? 2 Suppose 14b - 12b - 834 = 0. Let m = b + -18. What is the tens digit of m? 9 Let c = -7879 - -14492. What is the tens digit of c? 1 What is the ten thousands digit of (-728234)/(-37) + 2(-1)/2? 1 Suppose 23i - 38i + 2715 = 0. Suppose -2f + 238 = 4z, 3z = -3f + 129 + 225. Let o = i - f. What is the units digit of o? 4 Let u(w) = w3 - 33w*2 + w - 28. Let i be u(33). Suppose b - 3359 = -ip, 0p - 3p + 2b = -2005. What is the tens digit of p? 7 Suppose -u - 5b + 172 = 0, 5u + b = -278 + 1114. Let z be ((-3)/6)/((25/3240)/(-5)). Suppose -u = -2t + 3i, -3i = 4t + i - z. What is the tens digit of t? 8 Suppose 4n + 10 = 5n. Let k(i) be the first derivative of i4/4 - 10i*3/3 + 7i*2/2 - 15i + 16. What is the tens digit of k(n)? 5 Let w(o) = -31 + 383o2 - 758o*2 + 379o*2 - 5o*3 - 4o. What is the tens digit of w(-6)? 1 Suppose j - 5616 = -4w, 128w = 2j + 124w - 11220. What is the tens digit of j? 1 Suppose 3a + 6 = 45. Suppose 0v + 21 = 5b - 4v, 0 = 3b - 2v - a. Suppose bi - 4f - f + 5 = 0, 23 = 2i + 3f. What is the units digit of i? 4 Let j(w) = 36w + 124. Let p be (-1)/((-5)/(-15) + (-57)/144). What is the units digit of j(p)? 0 Let p(f) = 6f - 4 + 10f - 32f + 10f. Let j(x) = 36x + 25. Let b(o) = -6j(o) - 39p(o). What is the units digit of b(2)? 2 Let i = 42 + -32. Suppose 9x - 23 = ix. Let n = x + 49. What is the tens digit of n? 2 Let k(c) = -5c - 3. Let a be k(-4). Suppose 0 = -as + 6s + 7447. What is the hundreds digit of s? 6 Let x(b) be the second derivative of 11b5/20 - b4/24 + 8b2 + 13b. Let r(s) be the first derivative of x(s). What is the tens digit of r(1)? 3 Let m(h) = 926h + 2807. What is the units digit of m(8)? 5 Let g = 2302 - 9256. What is the units digit of (g/95)/((-1)/5)? 6 Let x(m) = 30m + 240. Let a be x(-8). Suppose -5c - 3n + 59 = a, 9c - 2n = 10c - 16. What is the tens digit of c? 1 Let n = 14601 - 2747. What is the hundreds digit of n? 8 Suppose -r = -r + 4r. Let b be (3 - r) + (22 - 26). What is the tens digit of 115(-4 + 3)/b? 1 Suppose -3g + 146 = 5u - 200, -u + 59 = 4g. Let f = 306 - u. What is the hundreds digit of f? 2 Let r(a) = 0a + a3 - 1 - 4a*2 + 3 + 8a. Let n = -822 + 826. What is the tens digit of r(n)? 3 Suppose -2x + 59033 = 3g, 11x = 3g + 10x - 59048. What is the thousands digit of g? 9 Suppose 12r - 7r = 4m - 37415, -5r = -5m + 46770. What is the hundreds digit of m? 3 Let b(z) be the first derivative of z*4/4 - 10z*3/3 + 10z*2 + 12z - 14. Let j be b(8). Suppose -ji + 119 = -43i. What is the units digit of i? 9 Let d be (-2 + 3)/(1356/(-194) - -7). Let v = 103 - d. Suppose vn - 186 - 84 = 0. What is the tens digit of n? 4 Let x(s) = 13s*3 + 4s*2 - 23s + 32. What is the thousands digit of x(7)? 4 Suppose -22f + 267624 + 287898 = 0. What is the hundreds digit of f? 2 Let j(x) = -4x + 97x - 99 + 6x. What is the tens digit of j(5)? 9 Suppose -14 - 14 = -7h. What is the hundreds digit of 627/5 + (-6)/(-40)h? 1 Let w be (1 + (-5)/3)/((-36)/(-1134)). What is the hundreds digit of (60/w)/((-6)/1407)? 6 Suppose 0 = 7u - 9u + 12, -266990 = -5y - 5u. What is the tens digit of y? 9 Let w = 2725 - -9772. What is the units digit of w? 7 Suppose -2f + 3j = -66, -j - 118 = -4f - 6. Suppose -fl = -33l + 462. Let d = -27 + l. What is the units digit of d? 0 Let p be (5 - (0 + 152))-1. Let g = 320 - p. What is the units digit of g? 3 Suppose 0 = -70u + 8u + 1068508. What is the tens digit of u? 3 Let t = -858 - -2987. What is the thousands digit of t? 2 Let d(o) = -31o3 - 11o*2 + 9o - 42. What is the hundreds digit of d(-9)? 5 Let f = -3260 - -4703. Suppose -29t = -4n - 32t + 1923, 0 = -3n - 3t + f. What is the tens digit of n? 8 Suppose 2r - 10h + 5h = 10, 0 = -2r - 3h + 26. What is the units	{ "pile_set_name": "DM Mathematics" }
n descending order. 5, -3, -4, -32 Put 2, 4/5, -2/15 in increasing order. -2/15, 4/5, 2 Sort 5, -54, -12 in descending order. 5, -12, -54 Sort 3, -22, -1 in ascending order. -22, -1, 3 Sort -0.4, -58, -2/3 in descending order. -0.4, -2/3, -58 Put 4, -58, 5, -7 in increasing order. -58, -7, 4, 5 Put 5, 0, -2019, 2, -5 in decreasing order. 5, 2, 0, -5, -2019 Put -3, -1, -1430, 5 in descending order. 5, -1, -3, -1430 Sort 0, -5, -10, 0.05 in ascending order. -10, -5, 0, 0.05 Sort -5, 5, 4842 in increasing order. -5, 5, 4842 Put -1/8, -4, 4, 7, -1.5 in ascending order. -4, -1.5, -1/8, 4, 7 Sort 2/15, -0.03, -2/7 in increasing order. -2/7, -0.03, 2/15 Sort 4, -3, -2 in decreasing order. 4, -2, -3 Put -17, 0.5, -47/2 in ascending order. -47/2, -17, 0.5 Put 3, 0, 5, 34 in descending order. 34, 5, 3, 0 Sort 0.3, 179, 2 in descending order. 179, 2, 0.3 Sort -54, 3, -4 in decreasing order. 3, -4, -54 Put -2, 0, -5, -1 in ascending order. -5, -2, -1, 0 Sort 10, -39, 2 in ascending order. -39, 2, 10 Sort -5, -1, 3, 503. -5, -1, 3, 503 Sort 5, -5, -3506 in ascending order. -3506, -5, 5 Sort 6, 4/9, 6/11. 4/9, 6/11, 6 Put -0.5, 2/13, 16, 0.11, 2/15 in decreasing order. 16, 2/13, 2/15, 0.11, -0.5 Sort -3, -1/2, 5, -0.8 in decreasing order. 5, -1/2, -0.8, -3 Sort 3, -54, -2, -4. -54, -4, -2, 3 Sort 3, 5, 545 in increasing order. 3, 5, 545 Sort 43/2, 0, 4/7 in increasing order. 0, 4/7, 43/2 Sort -11, 1/6, 52 in ascending order. -11, 1/6, 52 Put 3, 1, 0, 2 in decreasing order. 3, 2, 1, 0 Sort -2/5, -152, 5 in decreasing order. 5, -2/5, -152 Sort 3, -1, 9, -2, 5. -2, -1, 3, 5, 9 Put -1/4, -1/3, -79/5, 1 in descending order. 1, -1/4, -1/3, -79/5 Put 2, -312, -1 in descending order. 2, -1, -312 Put -5, -1, 12, 1 in ascending order. -5, -1, 1, 12 Put 1/8, -8.89, 5, -0.1 in decreasing order. 5, 1/8, -0.1, -8.89 Sort -4, 4, -24 in descending order. 4, -4, -24 Sort -0.52, -3, 0.3, 1/4, -1/2. -3, -0.52, -1/2, 1/4, 0.3 Sort -4, -85, -1 in ascending order. -85, -4, -1 Sort 6, 131, -4 in decreasing order. 131, 6, -4 Sort -4, 4, 2, 1, 5. -4, 1, 2, 4, 5 Put 3, -1, 4, 2880 in increasing order. -1, 3, 4, 2880 Sort 5/4, 3, -0.4, -0.5, -0.06 in decreasing order. 3, 5/4, -0.06, -0.4, -0.5 Put -121, -5, 0.5, 4 in descending order. 4, 0.5, -5, -121 Sort 4, -0.23, 8/3, -6/5 in descending order. 4, 8/3, -0.23, -6/5 Sort 3, -12, 16 in ascending order. -12, 3, 16 Sort -3, 4, 195. -3, 4, 195 Put -3/7, 3, 4 in ascending order. -3/7, 3, 4 Sort 3, 17, 0, -5. -5, 0, 3, 17 Put -159, 0, -15 in descending order. 0, -15, -159 Put 0.1, 0.07, 4 in ascending order. 0.07, 0.1, 4 Sort -1, 5, -3, -19, 4 in descending order. 5, 4, -1, -3, -19 Put -6, 0.7, 6/11 in ascending order. -6, 6/11, 0.7 Sort -4, -2, -6, 0, 14 in increasing order. -6, -4, -2, 0, 14 Sort 0, -5, 6, -0.1. -5, -0.1, 0, 6 Put 4, -4, -2, 5 in decreasing order. 5, 4, -2, -4 Put -4, 2, 131 in descending order. 131, 2, -4 Sort -8, -7, 0, 2, -4. -8, -7, -4, 0, 2 Sort 0.08, -0.01, -4, 2, 3 in descending order. 3, 2, 0.08, -0.01, -4 Sort -5, -4, -220 in descending order. -4, -5, -220 Sort 1, -6/11, -36 in increasing order. -36, -6/11, 1 Sort 0.1, 1/4, -0.4, -72/5 in ascending order. -72/5, -0.4, 0.1, 1/4 Put 2, 0, -0.4, -5 in increasing order. -5, -0.4, 0, 2 Sort -0.31, 4, -3 in ascending order. -3, -0.31, 4 Sort 2, 12, 5 in ascending order. 2, 5, 12 Put -1/3, -0.8, 2, -2/15 in decreasing order. 2, -2/15, -1/3, -0.8 Sort -5, 2, -1, 3 in decreasing order. 3, 2, -1, -5 Sort 0, -1, 5, 29 in decreasing order. 29, 5, 0, -1 Sort 1, -9, -3, 44. -9, -3, 1, 44 Put -4, -3, -36, 4 in decreasing order. 4, -3, -4, -36 Sort -41, -4, 9, -2 in descending order. 9, -2, -4, -41 Sort 0.3, 239/2, -0.5, -2 in ascending order. -2, -0.5, 0.3, 239/2 Sort -0.3, -2/13, -2/5, 13, 3 in increasing order. -2/5, -0.3, -2/13, 3, 13 Put 8, -8, -5, 2 in decreasing order. 8, 2, -5, -8 Put 7, 66, 1 in decreasing order. 66, 7, 1 Put 5, 3, -209, 4, 2 in descending order. 5, 4, 3, 2, -209 Sort 4, 0.32, -0.3, 1, 3 in increasing order. -0.3, 0.32, 1, 3, 4 Sort -0.1, -4, -2, -1/12, 2/35. -4, -2, -0.1, -1/12, 2/35 Put 2, -5, 31, 1 in ascending order. -5, 1, 2, 31 Sort 29, 1/24, 0 in increasing order. 0, 1/24, 29 Sort -2, -1, -5, 2, -7. -7, -5, -2, -1, 2 Sort 3, 2, 72 in ascending order. 2, 3, 72 Sort -2, 2169, -1 in decreasing order. 2169, -1, -2 Put 5, 0.2, -2/9, -6/11 in decreasing order. 5, 0.2, -2/9, -6/11 Sort 1, -32, 4 in increasing order. -32, 1, 4 Sort -0.2, 2/3, 63. -0.2, 2/3, 63 Sort 2, -5, 4, -421 in descending order. 4, 2, -5, -421 Sort 0.2, 2, -5, 1/19. -5, 1/19, 0.2, 2 Sort 1.92, -1, 3/2, 1, 2 in descending order. 2, 1.92, 3/2, 1, -1 Put 20, 15, 0, 3 in decreasing order. 20, 15, 3, 0 Sort -20, -3, 46 in increasing order. -20, -3, 46 Put -13, -1, 4 in ascending order. -13, -1, 4 Put -3/2, 1, 22, 0.4, 1/8 in increasing order. -3/2, 1/8, 0.4, 1, 22 Sort -46, 5, -5 in descending order. 5, -5, -46 Put -5, 1, 14, -4 in decreasing order. 14, 1, -4, -5 Sort 3/5, -2, -0.7, 3. -2, -0.7, 3/5, 3 Sort -0.3, -1/2, -64. -64, -1/2, -0.3 Sort 9, -2, -3, 3, -5 in decreasing order. 9, 3, -2, -3, -5 Sort -41, 1, 0 in decreasing order. 1, 0, -41 Sort -1/4, -0.3, -19, 3. -19, -0.3, -1/4, 3 Sort -0.5, -48, 0, -0.2 in ascending order. -48, -0.5, -0.2, 0 Put 18, -3, 15 in increasing order. -3, 15, 18 Put -2, 3, -14, 4 in ascending order. -14, -2, 3, 4 Put 739, 3, 0 in ascending order. 0, 3, 739 Sort -477, 2, 4, 3 in ascending order. -477, 2, 3, 4 Put 3, -45, -1 in increasing order. -45, -1, 3 Sort -4, 0.044, -0.067, -0.3 in increasing order. -4, -0.3, -0.067, 0.044 Sort -4/9, -2, 1 in increasing order. -2, -4/9, 1 Put -1/5, -15, 136, 4 in descending order. 136, 4, -1/5, -15 Sort -3, -35, -17. -35, -17, -3 Sort -7, -1/2, 4/7, -1/3 in descending order. 4/7, -1/3, -1/2, -7 Put 3/7, -8/7, -3, -2/9 in decreasing order. 3/7, -2/9, -8/7, -3 Sort -2/11, -18/11, 0.1, -12 in descending order. 0.1, -2/11, -18/11, -12 Put 8, -0.3, 4/7, 1 in increasing order. -0.3, 4/7, 1, 8 Sort -0.4, -25, -0.11. -25, -0.4, -0.11 Put -5, -3, -21, 2 in increasing order. -21, -5, -3, 2 Sort 1, -36, 3 in ascending order. -36, 1, 3 Sort 4, 5, -27, 1 in descending order. 5, 4, 1, -27 Put 2, 5, -4, -5, -650 in descending order. 5, 2, -4, -5, -650 Put 1, 4, -1, 0.4 in ascending order. -1, 0.4, 1, 4 Sort 1, 46, -2, 0, -6. -6, -2, 0, 1, 46 Put 3, 35, 1 in decreasing order. 35, 3, 1 Sort -8, 4, 1, 956 in ascending order. -8, 1, 4, 956 Put 1/10, 5, -0.1, -1/15, -1 in descending order. 5, 1/10, -1/15, -0.1, -1 Sort 5, 1, -9, -2, -35 in increasing order. -35, -9, -2, 1, 5 Sort -2, 2, -9, 1, -4 in ascending order. -9, -4, -2, 1, 2 Put 3, 11, -7, 0.3 in ascending order. -7, 0.3, 3, 11 Put -5, 3, 7 in decreasing order. 7, 3, -5 Sort 1, 4, -2954 in decreasing order. 4, 1, -2954 Put -4, 5, 2391 in descending order. 2391, 5, -4 Sort -12, -0.1, -0.29, -5 in descending order. -0.1, -0.29, -5, -12 Sort 5, -1, 0, -4 in decreasing order. 5, 0, -1, -4 Put -22, 12/13, -0.3 in increasing order. -22, -0.3, 12/13 Sort 89, 1, -4, 2 in ascending order. -4, 1, 2, 89 Put -3, 4, -34, -5, 0 in decreasing order. 4, 0, -3, -5, -34 Sort 11, -4, 7, -2 in ascending order. -4, -2, 7, 11 Sort -2, -27, 4, -1, 5 in descending order. 5, 4, -1, -2, -27 Sort -242/5, 0.3, 0, -1. -242/5, -1, 0, 0.3 Sort -29/23, 0.2, 1/4 in increasing order. -29/23, 0.2, 1/4 Sort -17, -4, 49. -17, -4, 49 Sort -1, 5, -2196 in descending order. 5, -1, -2196 Sort -1/3, 120, 0.1 in decreasing order. 120, 0.1, -1/3 Put 110, 9, 2 in descending order. 110, 9, 2 Sort 0, -2, 2, 0.2, -21. -21, -2, 0, 0.2, 2 Sort 306, 1, 5 in ascending order. 1, 5, 306 Sort -2/29, 310, 1/6, -2/9 in increasing order. -2/9, -2/29, 1/6, 310 Put -23, 0, -7, 5 in descending order. 5, 0, -7, -23 Put 2/25, 0.5, 1, -2, -3 in ascending order. -3, -2, 2/25, 0.5, 1 Sort 3, -3/4, -3/2, 0.5, -0.2. -3/2, -3/4, -0.2, 0.5, 3 Sort 146, -4, 2, 1 in increasing order. -4, 1, 2, 146 Put 3, 2/13, 0.3, 0, 2 in decreasing order. 3, 2, 0.3, 2/13, 0 Sort -5, 0.5, 384. -5, 0.5, 384 Put -3, -0.134, -4/3 in increasing order. -3, -4/3, -0.134 Put -3, -1, -5, -4 in decreasing order. -1, -3, -4, -5 Put -14, -2/5, -0.1, 1/7 in descending order. 1/7, -0.1, -2/5, -14 Sort 5, 64, -2 in decreasing order. 64, 5, -2 Put -0.5, -0.3, -3 in descendin	{ "pile_set_name": "DM Mathematics" }
409 How many weeks are there in 147327749.1 seconds? 243.59746875 What is 72.785ug in milligrams? 0.072785 Convert 2082.562 centuries to years. 208256.2 Convert 342734.1s to microseconds. 342734100000 Convert 2.220387 millilitres to litres. 0.002220387 What is 22/9 of a week in minutes? 24640 How many hours are there in 44.706438ms? 0.000012418455 How many months are there in 3/25 of a century? 144 What is 6.251331 millilitres in litres? 0.006251331 How many months are there in five quarters of a decade? 150 What is two ninths of a day in minutes? 320 How many years are there in 17/10 of a millennium? 1700 What is twenty-one halves of a milligram in micrograms? 10500 Convert 0.3962835 nanometers to centimeters. 0.00000003962835 How many kilograms are there in 31/2 of a tonne? 15500 What is 6/25 of a kilometer in meters? 240 How many micrograms are there in 46/5 of a milligram? 9200 How many centimeters are there in 25/4 of a meter? 625 What is 208636.6l in millilitres? 208636600 What is twenty-one eighths of a litre in millilitres? 2625 Convert 0.971275ug to grams. 0.000000971275 How many hours are there in 27/4 of a day? 162 How many millilitres are there in 3/50 of a litre? 60 What is 60840517.5ms in weeks? 0.10059609375 How many millilitres are there in 3/5 of a litre? 600 What is 17313.08 decades in centuries? 1731.308 Convert 4108.617 months to centuries. 3.4238475 How many millilitres are there in twenty-one halves of a litre? 10500 How many months are there in 60166.33 years? 721995.96 How many tonnes are there in 210311.2 micrograms? 0.0000002103112 What is three sevenths of a week in days? 3 What is 8464.528 decades in centuries? 846.4528 How many months are there in 7/16 of a millennium? 5250 What is one fifteenth of a day in minutes? 96 How many minutes are there in 243.17637ns? 0.0000000040529395 What is three tenths of a litre in millilitres? 300 How many seconds are there in twenty-five quarters of a hour? 22500 What is sixty-nine halves of a litre in millilitres? 34500 What is three sevenths of a week in minutes? 4320 How many kilograms are there in three fifths of a tonne? 600 How many tonnes are there in 48951.3kg? 48.9513 How many millilitres are there in 0.6806601 litres? 680.6601 How many millilitres are there in fifty-four fifths of a litre? 10800 What is 91.29 millilitres in litres? 0.09129 What is 129.0334ns in seconds? 0.0000001290334 Convert 0.9349309 millilitres to litres. 0.0009349309 How many millilitres are there in 3/8 of a litre? 375 Convert 7.255948nm to micrometers. 0.007255948 How many centimeters are there in fourty-eight fifths of a meter? 960 How many months are there in 27/2 of a decade? 1620 Convert 2944.889 millilitres to litres. 2.944889 What is 0.3298452m in millimeters? 329.8452 How many millilitres are there in 438145.4 litres? 438145400 What is seventeen halves of a millennium in decades? 850 Convert 3589.28 litres to millilitres. 3589280 How many millimeters are there in 9.450409 kilometers? 9450409 Convert 644.9424 weeks to hours. 108350.3232 What is 2/15 of a decade in months? 16 What is 3/10 of a century in years? 30 Convert 569173.4 decades to millennia. 5691.734 What is 4703.59 milliseconds in microseconds? 4703590 How many micrometers are there in 3/16 of a centimeter? 1875 How many litres are there in 370.0297ml? 0.3700297 What is 22928.517s in hours? 6.3690325 How many millilitres are there in 7.776337 litres? 7776.337 What is twenty-nine fifths of a milligram in micrograms? 5800 Convert 175.8384 millilitres to litres. 0.1758384 How many kilograms are there in 18/5 of a tonne? 3600 What is 7995.735ms in minutes? 0.13326225 How many minutes are there in twenty-five ninths of a week? 28000 How many seconds are there in 17/2 of a hour? 30600 What is twenty-one eighths of a milligram in micrograms? 2625 What is twenty-five quarters of a century in years? 625 How many nanometers are there in 7/4 of a micrometer? 1750 How many millilitres are there in 15/4 of a litre? 3750 How many millilitres are there in 3/8 of a litre? 375 How many centimeters are there in 99.50645nm? 0.000009950645 What is 94216.81 kilometers in meters? 94216810 How many millilitres are there in 47/4 of a litre? 11750 Convert 60300.67 milligrams to grams. 60.30067 What is five eighths of a day in minutes? 900 What is 2483.668 seconds in milliseconds? 2483668 Convert 402.1349m to nanometers. 402134900000 What is 11/8 of a centimeter in micrometers? 13750 Convert 704.9716 centuries to millennia. 70.49716 What is 3/25 of a tonne in kilograms? 120 How many millilitres are there in 1/4 of a litre? 250 Convert 441.333ms to microseconds. 441333 How many millimeters are there in eighteen fifths of a centimeter? 36 How many millilitres are there in 279570.5 litres? 279570500 What is fifty-nine quarters of a year in months? 177 How many millennia are there in 5.5322 decades? 0.055322 How many litres are there in 27.14315 millilitres? 0.02714315 Convert 8473.71 days to weeks. 1210.53 What is 8/3 of a century in months? 3200 What is 976328.9 nanograms in grams? 0.0009763289 How many micrometers are there in 7/4 of a centimeter? 17500 How many months are there in 17/4 of a year? 51 How many grams are there in 4603.61 tonnes? 4603610000 What is 76/5 of a litre in millilitres? 15200 What is 59/5 of a litre in millilitres? 11800 How many millilitres are there in 26/5 of a litre? 5200 How many seconds are there in 21/2 of a minute? 630 How many meters are there in 1/100 of a kilometer? 10 What is ten ninths of a day in seconds? 96000 Convert 1280.733552s to weeks. 0.002117615 What is 36.69756 millilitres in litres? 0.03669756 How many meters are there in three eighths of a kilometer? 375 What is one fifth of a kilogram in grams? 200 What is 1/20 of a decade in months? 6 How many seconds are there in 2/27 of a day? 6400 How many months are there in 0.7555604 millennia? 9066.7248 Convert 5.923485l to millilitres. 5923.485 What is 61690.67 hours in microseconds? 222086412000000 What is 668.6ml in litres? 0.6686 How many seconds are there in 41/2 of a minute? 1230 How many milligrams are there in 25/4 of a gram? 6250 Convert 36294.6 nanometers to centimeters. 0.00362946 What is 17/4 of a day in minutes? 6120 How many months are there in 169.6603 years? 2035.9236 What is thirty-four fifths of a kilogram in grams? 6800 How many millilitres are there in 1/4 of a litre? 250 Convert 214.711ng to micrograms. 0.214711 How many micrograms are there in three fifths of a milligram? 600 How many litres are there in 0.5989251ml? 0.0005989251 What is 601.2552t in grams? 601255200 How many millilitres are there in 612115.1 litres? 612115100 How many centimeters are there in 8/25 of a kilometer? 32000 How many kilometers are there in 471532.7 millimeters? 0.4715327 How many nanograms are there in fifteen quarters of a microgram? 3750 How many seconds are there in 80963.53ns? 0.00008096353 How many centimeters are there in 314973.7nm? 0.03149737 How many micrograms are there in seven quarters of a milligram? 1750 How many hours are there in ten sevenths of a week? 240 How many months are there in 19/4 of a year? 57 How many millilitres are there in 2/125 of a litre? 16 How many decades are there in 59/5 of a century? 118 What is five quarters of a litre in millilitres? 1250 What is seven thirds of a day in hours? 56 How many months are there in 5/6 of a millennium? 10000 What is 7/2 of a gram in milligrams? 3500 Convert 0.3026801l to millilitres. 302.6801 Convert 923.2377 milligrams to kilograms. 0.0009232377 What is 46.5296 meters in centimeters? 4652.96 What is three sevenths of a week in minutes? 4320 How many nanoseconds are there in 0.9257845 microseconds? 925.7845 How many micrograms are there in 25/2 of a milligram? 12500 How many micrograms are there in 3/32 of a gram? 93750 What is 78602.18 nanoseconds in microseconds? 78.60218 How many months are there in thirteen quarters of a millennium? 39000 What is seven halves of a second in milliseconds? 3500 How many months are there in one twentieth of a decade? 6 What is 766.187cm in nanometers? 7661870000 What is fifty-seven halves of a microgram in nanograms? 28500 How many milligrams are there in 9.61	{ "pile_set_name": "DM Mathematics" }
k = -1.2 + 0.7. Let z = -0.1 + -0.1. Let p = -3.8 + z. Put -4/7, k, p in descending order. k, -4/7, p Let m be 15/(-25) - (-57)/45. Let z = 2.1 - 4.1. Sort m, z, -6/7 in descending order. m, -6/7, z Suppose 21b - 56 = 7b. Put -4, b, -2 in ascending order. -4, -2, b Let j = -5 - -9. Let o be (10/(-15))/(j/(-18)). Suppose 3d = -2n, -5n + 0d = -od. Sort n, -0.3, 5. -0.3, n, 5 Let n = -190 - -946/5. Put -1/3, 4, n, 1/2 in descending order. 4, 1/2, -1/3, n Let g = 87 + -87. Put -1, g, 2 in decreasing order. 2, g, -1 Let k = 0.86 - 0.66. Sort k, 5, -1, -2. -2, -1, k, 5 Suppose 1 + 5 = -3a. Let t(q) = 3q2 + q - 1. Let h be t(1). Sort a, -5, h in decreasing order. h, a, -5 Suppose 4t + 6 - 22 = 0. Suppose 2 = -3g + tg. Let b = -115/3 + 38. Sort g, -4, b in decreasing order. g, b, -4 Let a = 9 + -6. Let k = a + -3. Let q be 2/4(-8)/3. Put -1/5, k, q in decreasing order. k, -1/5, q Suppose -2 = i + i. Suppose -j - j + s - 7 = 0, -2s + 4 = j. Put i, j, 4 in ascending order. j, i, 4 Let m = 0.1 - -4.9. Let t be ((-16)/24)/((-2)/9). Suppose tk + 7r - 4r + 6 = 0, -3k = -2r - 4. Put k, m, 4 in increasing order. k, 4, m Let f = 142 - 140. Sort -2, 5, 69, f. -2, f, 5, 69 Let i(m) = 0m2 + m2 + 7m + 9 - 1. Let r be i(-6). Sort 1, r, 0. 0, 1, r Suppose 101 + 464 = -5a. Let w = a + 46. Let r = w - -336/5. Put -2, 3, r in descending order. 3, r, -2 Let y = 25 + -23. Sort -0.1, 0.02, y. -0.1, 0.02, y Let n(k) = -k - 10. Let w be n(-12). Let f = -2 + w. Suppose f = -5g + p - 11 + 1, 5g + 35 = -4p. Sort 3, g, -1 in descending order. 3, -1, g Let l be 1 - -4(2 - 3). Let g(w) = -w*3 - 11w*2 - 11w + 3. Let a be g(-10). Suppose -3 + a = 5v. Sort l, v, -2 in descending order. v, -2, l Suppose 3u - 4 = u, 0 = 3k + 2u - 16. Let i(c) = -c*2 + 4c + 1. Let v be i(2). Suppose n = vn + k. Put 4, -2, n in descending order. 4, n, -2 Suppose -9g - 330 = 13g. Sort g, -1, -3. g, -3, -1 Suppose -1 = -5j - 11. Let l be ((-3)/(-9))/(j/18). Suppose -5 = 5t - 15. Put l, t, 5 in decreasing order. 5, t, l Let r = 0.85 - 4. Let g = r - -0.15. Put 2, g, -0.1 in decreasing order. 2, -0.1, g Let j = 15 + -19. Put j, 5, 4 in descending order. 5, 4, j Suppose 0 = -3d + 3g - 6, 0 = -d + 5g - 12 - 6. Suppose k = 2k - di - 8, 3k - 9 = i. Put 0, k, 1 in decreasing order. k, 1, 0 Let y = 3 + 0. Let j = y + -2. Let f(m) = m - 1. Let v be f(j). Put v, 7, -4 in descending order. 7, v, -4 Let k be -1 - -11 - -1. Suppose -18n + 3n + 30 = 0. Suppose 2u + 2 = 2q, -u + nq = 1 + k. Sort u, -4, -1 in descending order. u, -1, -4 Let k(o) = -o + 1. Let c(i) = -3i + 13. Let p(s) = -c(s) + 4k(s). Let h be p(-7). Suppose -4 = 3j + 5. Sort j, h, 2. j, h, 2 Suppose 0i - 2 = 2f - 2i, -4i - 10 = 3f. Sort -1, f, -3. -3, f, -1 Let s = 0.1 - 0. Suppose 463f - 10 = 468f. Let n = 0.06 - 5.06. Put n, f, s in increasing order. n, f, s Let j(f) = -3f*2 + 3f - 2. Let o be j(3). Let l be 6/10 - (-52)/o. Sort -0.5, 5, l. l, -0.5, 5 Suppose 11 = 5g + 4i, 5g + 13 = -0g + 2i. Let k = 3133 - 21971/7. Let d = k + 353/63. Sort g, 2/7, d in ascending order. g, d, 2/7 Let n be (-10)/25 - (0 - 12/5). Sort 1, 0, -2, n. -2, 0, 1, n Suppose -6 = -2a + r, 5a - r = -4r + 26. Suppose 4h - ad = -20, 2d = -4h + 5d - 16. Sort h, 4, 0.2 in descending order. 4, 0.2, h Suppose -2 = b - 3o + 4, 0 = -o + 2. Let g(i) = i*2 - 5i - 9. Let l be g(7). Let p = -7 + l. Sort p, b, -3. -3, p, b Let b = 6 - 3. Let t = b - 8. Let a = -0.1 - -1.1. Sort t, a, -1. t, -1, a Let l = -3.7 + -0.3. Suppose 4t + 20 = 2v, -2t = -3v - v + 22. Let g = 27/7 - v. Put 0, g, l in ascending order. l, g, 0 Let h = -0.666 - -0.166. Sort h, -1, 1/42 in decreasing order. 1/42, h, -1 Suppose 0 = 5c + 5 - 0. Let j(o) = o3 - o2 - 2o + 3. Let k be j(2). Put k, -3, c in ascending order. -3, c, k Let m = 14 - 10. Let k be 2 - 2/2-2. Let j be (-2)/k + m/(-8). Sort 4, j, -0.1 in ascending order. j, -0.1, 4 Let r(n) = n + 3. Let m be r(5). Let a = 9 - m. Suppose 10 = -5j - 5h, -a - 1 = -5j - h. Sort -5, j, 3. -5, j, 3 Let v = -21 - -20.9. Suppose -3p + 8 = 23. Sort v, p, 4 in descending order. 4, v, p Let l = 86 - 88. Sort -5, l, 3. -5, l, 3 Let y be 2/(-3) + 5/3. Suppose 1 = -f - y. Suppose -3c - 5a - 8 = 1, 4c = -a + 5. Put 3, c, f in descending order. 3, c, f Let w = 3 - 2.8. Let k = -0.2 + -0.4. Let r = k + 1.6. Sort r, 2, w in ascending order. w, r, 2 Let c = 1655755/8109 - 3474/17. Let i = c + -3/53. Sort 0.1, -0.5, i. -0.5, i, 0.1 Suppose -8m - 8 = -4m. Suppose 5q + 23 - 3 = 0. Sort 1, q, m. q, m, 1 Let o be (6/(-4))/((-6)/36). Let z be (16/(-3))/((-6)/o). Sort z, 1, 0 in ascending order. 0, 1, z Let i be (164/(-40) - -4)-8. Let y be (2/(-6))/((-1)/2). Sort y, 2/13, i in ascending order. 2/13, y, i Let w = -0.5 + 0.3. Let h(y) = 3y2 + 19y - 21. Let l(c) = 5c2 + 29c - 32. Let b(k) = 8h(k) - 5l(k). Let z be b(6). Put z, -1/9, w in increasing order. z, w, -1/9 Let y(m) = -m*3 - 6m*2 - 7m. Let w(c) = -2c3 - 5c*2 - 6c. Let u(v) = 2w(v) - 3y(v). Let l be u(9). Sort -2, l, 1. -2, l, 1 Let c = 0.2 + -0.4. Put 2, c, -0.4 in descending order. 2, c, -0.4 Let p = -104 - -106. Suppose 3g + 2 + 1 = 0. Sort 0.2, g, p. g, 0.2, p Let m be (63/(-28))/(6/(-4))2. Put -2, 5, m in descending order. 5, m, -2 Let z(x) = x*2 + 2x + 6. Let y be z(-4). Suppose 10 + y = 4l. Sort l, 3, 5 in descending order. l, 5, 3 Let o(y) = -y2 - 33y + 1. Let x be o(-33). Let k = -18 + 145/8. Sort x, k, 0 in decreasing order. x, k, 0 Let s = -7 + 1. Let i = s + 5. Sort -3, 1, i in descending order. 1, i, -3 Let y = -5 + 4. Let u = -4 - y. Suppose 2a + 3f - 4f = -9, -3f = 5a + 17. Put a, 0, u in ascending order. a, u, 0 Let g = -33.05 + 33. Sort g, -3, -2/3, 5 in descending order. 5, g, -2/3, -3 Let g(w) = -w2 + 6w - 2. Let f be g(6). Sort 2, -1/8, f, 1.2 in descending order. 2, 1.2, -1/8, f Let v(f) = -f + 14. Let w be v(12). Suppose 2d = w, 5n - 2n + 12 = 3d. Sort 4, n, 2 in decreasing order. 4, 2, n Suppose -z - 4z - 15 = 0. Let l(k) = 2k*2 + 4k - 1. Let t be l(-3). Suppose -2 = -to + 3u, -5o + 9 = -5u - 1. Put o, z, 0 in decreasing order. 0, o, z Let x be (-4)/(-10) - 99/135. Sort -5, x, -1 in increasing order. -5, -1, x Let c = -22 + 23. Sort -5, -1, c in descending order. c, -1, -5 Suppose -2y + 0m = -m + 6, 4y = 4m - 4. Sort 3, 1, y. y, 1, 3 Suppose 0 = -5t + 4t + 9. Let n be (t/12)/((-15)/(-8)). Let k = -0.46 + 0.36. Sort -2/19, k, n in decreasing order. n, k, -2/19 Let c = -80 + 82. Sort -1, -3, c in descending order. c, -1, -3 Let j = -0.09 + -0.91. Suppose -4n = 3i - 1, -3n - 2n + 15 = i. Sort -2, j, i. i, -2, j Let b = -9/4 + 11/4. Sort b, -1, 3/5 in decreasing order. 3/5, b, -1 Let y = 13 - 13.2. Put y, 0.4, -0.4 in decreasing order. 0.4, y, -0.4 Suppose 1 = 2k + a + 15, -20 = -5a. Put 1, k, -5 in decreasing order. 1, -5, k Let k = -9 + 6. Let j be (0 - -1)/(1/(-5)). Suppose 4f - 10 = -3n, 0 = 3f - 2n + n - 1. Put f, k, j in ascending order. j, k, f Let q(o) = -2o - 13. Let i = -32 - -26. Let f be q(i). Sort 2/7, -0.5, f in decreasing order. 2/7, -0.5, f Let q be ((-11)/(-11))/(0 + 1). Sort 2/11, q, -2 in ascending order. -2, 2/11, q Let w(b) = 2b + 8. Suppose 2 = -4x - 22. Let i be w(x). Suppose -4u - 40 = -5q, -2u = -7u + 5q - 45. Put i, -3, u in increasing order. u, i, -3 Suppose 0 = -z - 3k - 6, -2z - 4k = z + 8. Suppose za - 4x + 23 = -5a, 2a = 5x - 16. Put -2, a, 4 in increasing order. a, -2, 4 Suppose 2l - l = -4j + 16, 0 = -5l - 20. Suppose 3o - 1 = -s, 3o - 2o + 3s + 13 = 0. Sort -5, j, o in ascending order. -5, o, j Let i = 84 - 81. Put i, 10, -1, -4 in decreasing order. 10, i, -1, -4 Let x be ((2 - 2 - 1) + 0)2. Sort -1, x, 1 in descending order. 1, -1, x Let z = 35 + -12. Let k be z/3 + (-2)/(-6). Let s be 22/(-8) + (-2)/k. Sort 2, 0, s in decreasing order. 2, 0, s Suppose -16 = -i + 4v, 2i = 6i - 3v - 12. Suppose -13 = -x - 4r, ix - 8 = -2x - 2r. Suppose 3*s + 6 = -f, -s - 3 = -x. Put 1, 2, f in descending order. 2, 1, f Let w = -10 + 12. Let a = -0.06 - -0.36. Sort a, w, 3/2 in decreasing order. w, 3/2, a Let o be (-3)/18 - (-1013)/(-42). Let d = -24 - o. Sort 1/6, -0.3, d in increasing order.	{ "pile_set_name": "DM Mathematics" }
. 3/404086 What is -5802 divided by -5034? 967/839 Divide -1442350 by 910. -1585 What is 0 divided by 9966492? 0 What is -4226 divided by 498? -2113/249 Calculate 54779 divided by -239. -54779/239 Calculate 413561825 divided by 25. 16542473 Divide 3555524 by -2. -1777762 Divide -1 by -139796911. 1/139796911 -129744200 divided by 25948840 -5 Divide -40431368 by -10107842. 4 Calculate -76148 divided by -60. 19037/15 -174662 divided by -837 174662/837 What is 111160920 divided by 5? 22232184 What is 31213903 divided by 234691? 133 What is -5115660 divided by -7751? 660 Calculate 20136998 divided by -1. -20136998 Calculate -91892 divided by -34. 45946/17 Calculate -20464566 divided by 3. -6821522 Divide -43438485 by 8687697. -5 Divide 5023314130 by 5. 1004662826 What is -9108192 divided by -3? 3036064 Divide 6329915 by 15. 1265983/3 Calculate 11189394 divided by 621633. 18 Calculate -83307840 divided by 6942320. -12 Calculate 6351798 divided by 1658. 3831 1 divided by 191714195 1/191714195 22407137 divided by -5 -22407137/5 3 divided by -6778417 -3/6778417 -72126696 divided by 6 -12021116 -396744876 divided by 44082764 -9 What is -96408560 divided by -2410214? 40 Calculate 1 divided by 40031326. 1/40031326 -9 divided by -1996793 9/1996793 What is -3672160 divided by 3890? -944 -55512420 divided by 6 -9252070 What is 166725104 divided by 83362552? 2 What is 14255529 divided by 19? 750291 Divide 45792954 by 18783. 2438 What is 20558 divided by 5543? 20558/5543 Divide -176440 by 2. -88220 352842 divided by 2 176421 -20881 divided by 1951 -20881/1951 -454407840 divided by 718 -632880 Divide 1503446156 by -4. -375861539 Divide 273766518 by -2. -136883259 -12292126 divided by 154 -79819 1925 divided by 102580 385/20516 Divide -20 by -69461. 20/69461 Divide 64775816 by -32387908. -2 What is 1043082248 divided by 3141814? 332 Calculate 39235 divided by -6. -39235/6 Divide 7797 by -5152. -339/224 -24759273 divided by -1179013 21 Calculate 1381049040 divided by 540528. 2555 Divide 348658872 by 2. 174329436 What is -4879272120 divided by -6? 813212020 -97 divided by 142666 -97/142666 Calculate -5340972 divided by -381498. 14 7768390 divided by 28 554885/2 Divide -299947 by -373. 299947/373 Calculate -4862645 divided by 48145. -101 27132315 divided by 9044105 3 Calculate -11870 divided by -294. 5935/147 What is 0 divided by 4190417? 0 What is -208 divided by -7406? 104/3703 What is 144236 divided by 467? 144236/467 Calculate 10371296 divided by 466. 22256 Divide 11395611 by -110637. -103 Calculate 7329 divided by 6. 2443/2 Calculate -129334940 divided by -10. 12933494 Calculate 3 divided by 16599240. 1/5533080 198671327 divided by -1 -198671327 Divide 29189538 by 1113. 26226 Divide 51005160 by 10201032. 5 Divide -430540739 by 3. -430540739/3 4 divided by -216731389 -4/216731389 Calculate 26 divided by 21142019. 26/21142019 -3 divided by -115331666 3/115331666 What is -19867860 divided by 12? -1655655 Divide 132244032 by 77608. 1704 Divide -4193010 by 279534. -15 Divide -10767401 by -6. 10767401/6 531862 divided by -11 -531862/11 -1046 divided by 8266 -523/4133 Calculate -54 divided by -7517. 54/7517 112391255 divided by 5 22478251 Calculate 83409318 divided by -2. -41704659 -5 divided by -10805482 5/10805482 Calculate 3 divided by -1003303. -3/1003303 What is 25884720 divided by -30? -862824 18271203 divided by -18271203 -1 13047381 divided by -1 -13047381 Divide -10190772 by -5. 10190772/5 Calculate 8163477 divided by 21. 388737 Divide -125354665 by -1. 125354665 -10126956 divided by 2 -5063478 What is -10487840 divided by 11? -953440 8 divided by 7555615 8/7555615 -884815980 divided by -32269 27420 Calculate 0 divided by 1254064. 0 Calculate 34772869 divided by 1. 34772869 694618818 divided by -115769803 -6 -2543360 divided by 20 -127168 Calculate -10486 divided by -1460. 5243/730 170536 divided by -24 -21317/3 -672 divided by 9148 -168/2287 What is -653795 divided by -451? 653795/451 Divide -1 by -84916. 1/84916 Calculate -5639656 divided by 76. -74206 Divide 6 by 1432751. 6/1432751 -187 divided by 497704 -187/497704 Divide 176243760 by 839256. 210 Calculate 5 divided by 1775818. 5/1775818 Divide 102541 by -1695. -102541/1695 Calculate -5494581 divided by 3. -1831527 Divide 239164 by -65. -239164/65 Divide -1066952 by -149. 1066952/149 What is 11936576 divided by -2984144? -4 -7654755 divided by 1455 -5261 Divide 60470704 by -220696. -274 -33 divided by 201702 -11/67234 What is 14187334 divided by 9? 14187334/9 Divide -21406968 by 9966. -2148 What is 3 divided by -11781693? -1/3927231 107823966 divided by 61 1767606 Divide -3978 by 2449. -3978/2449 170528952 divided by 1254 135988 Calculate 208595876 divided by 52148969. 4 What is 896385627 divided by 9? 99598403 -41644485 divided by 2 -41644485/2 What is 2447383 divided by 5? 2447383/5 Calculate 0 divided by 8046359. 0 Divide -11 by -102065. 11/102065 Divide 6 by -966136. -3/483068 Calculate -16409594 divided by 6. -8204797/3 Divide 197056416 by 49264104. 4 Divide -14363776 by 156128. -92 What is -10524600 divided by 70164? -150 2114296148 divided by 2 1057148074 Divide -30 by -59384. 15/29692 Calculate -39009708 divided by -21636. 1803 3 divided by -5609896 -3/5609896 What is 132102705 divided by 5? 26420541 Calculate 223353524 divided by 6. 111676762/3 What is -40239210 divided by -22? 1829055 What is 107 divided by 94260? 107/94260 Calculate 1548 divided by 89381. 1548/89381 What is 589578 divided by -91? -589578/91 Divide 62433266 by 31216633. 2 What is -1308552 divided by -56? 23367 Divide -483850 by -245. 96770/49 Calculate -360621 divided by 126. -40069/14 920733 divided by -6 -306911/2 What is 99512832 divided by 1088? 91464 Calculate -25782812 divided by 379159. -68 What is -10131740 divided by -30244? 335 What is -17062840 divided by 3260? -5234 Divide 265 by -133234. -265/133234 Calculate -6767330 divided by 2. -3383665 What is 9093056 divided by -7? -1299008 -292099808 divided by -121 2414048 Calculate -20806246 divided by -12139. 1714 Divide -25626 by -266. 12813/133 38288522 divided by 6 19144261/3 -22207441 divided by -857 25913 Calculate -96194400 divided by 1192. -80700 Divide -1 by -11061262. 1/11061262 What is 23792117 divided by 2? 23792117/2 Calculate -377629 divided by 111. -377629/111 3147 divided by -1013 -3147/1013 2058144042 divided by 6 343024007 Divide 2 by 14304708. 1/7152354 What is -643859469 divided by -7757343? 83 Divide 0 by -1685740. 0 -35975553 divided by -5 35975553/5 Calculate -602309727 divided by 3. -200769909 What is 1038699320 divided by -4? -259674830 Divide 17247501 by -556371. -31 Calculate 12 divided by 1338986. 6/669493 Divide -10911975 by -3. 3637325 Calculate -11061225 divided by -81935. 135 Divide -50620224 by -12655056. 4 -130629800 divided by -28 4665350 What is 23491158 divided by 83? 283026 Divide -10269804 by 31. -331284 Calculate -516442532 divided by -1905692. 271 Calculate 157353 divided by 9. 52451/3 What is -585112332 divided by -28903? 20244 Calculate -22698321 divided by 3. -7566107 What is 21 divided by 1582629? 7/527543 174362595 divided by -15851145 -11 What is 9540800 divided by -5963? -1600 What is -37 divided by -2072440? 37/2072440 122416500 divided by 2 61208250 Calculate -9429576 divided by -9429576. 1 Divide 297 by -46995. -99/15665 4934385 divided by 986877 5 -4 divided by 12559009 -4/12559009 Divide -91110 by 35. -18222/7 Calculate 12013165 divided by 1. 12013165 What is 151411 divided by 1017? 151411/1017 Calculate 29296800 divided by -3120. -9390 Divide -621174 by 86. -310587/43 Calculate -10760406 divided by 5380203. -2 Divide -995 by 1794179. -995/1794179 Calculate -19151735 divided by 10. -3830347/2 -220410 divided by -333 24490/37 What is -11888389 divided by 263? -45203 -469451484 divided by 13040319 -36 Divide -463790 by -2. 231895 What is 47 divided by -7968578? -47/7968578 -6750326 divided by 6750326 -1 What is -568 divided by -363841? 568/363841 Divide 16179570 by 6094. 2655 What is -235294065 divided by 81? -2904865 What is 52647639 divided by -33? -1595383 Divide 123262335 by -54565. -2259 What is -145628204 divided by -44237? 3292 Calculate -309369090 divided by -2398210. 129 9561416 divided by -2390354 -4 Divide	{ "pile_set_name": "DM Mathematics" }
9)/9)/((-28)/(-3)). Let f = -575/3 - z. Let y = f - -1/7. Which is the smallest value? (a) y (b) 3 (c) -3 c Let d = -10.9 + -2.1. Let r = d - -8. What is the second smallest value in -0.2, r, 0.3? -0.2 Let x = 0.56 + -0.06. Which is the third smallest value? (a) 2 (b) x (c) 3/8 (d) 0.16 b Let s(t) = t*2 + 7t + 6. Let b = 9 + -14. Let d be s(b). Let m = 6 + -5.6. What is the smallest value in m, 5, d? d Let l be 370/(-4)36/(-30). Let g = -889/8 + l. What is the third biggest value in g, 3, 0.02? g Let d be (-8)/9(-3)/2. Let o be 406/150 + (-3)/1. Let l = o - -692/825. What is the third smallest value in l, 2/9, d? d Let g = 1 + -1. Let u = 2.9 + 2.1. What is the third biggest value in u, g, 1/4? g Let q = 7 - 7.5. Which is the second biggest value? (a) -2 (b) 0.3 (c) q c Let m be 12/(-15)(-5)/2. Let d be 1 - ((-6)/14 + m). Which is the biggest value? (a) -8/3 (b) d (c) 5 c Let o(d) = d3 + d2 + 2d + 4. Let y be o(-3). Let x be ((-8)/(-14))/(y/(-14)). What is the smallest value in 3, 0.1, x? 0.1 Let a = -0.6 - -0.7. Let q = -0.01 + 0.91. Let m = -3.1 - q. What is the second biggest value in -1/7, a, m? -1/7 Let j = 0.1 + 0.1. Let x = -9 + 5. Let s = 0.2 - 3.2. Which is the biggest value? (a) x (b) j (c) s b Let u = -15 - -46/3. Which is the fourth smallest value? (a) u (b) -1 (c) -4 (d) -5 a Let v be 5/(5/2) - 4. Let w be (-78)/(-66) + (-2 - -1). Which is the second smallest value? (a) v (b) w (c) -0.4 c Let y(c) = -5c2 - 2c - 3. Let n(p) = 11p2 + 3p + 5. Let r(a) = -4n(a) - 9y(a). Let u be r(-5). What is the second smallest value in u, 2/5, 3? u Let u be 1/((9/15)/(-3)). Which is the third smallest value? (a) 0 (b) -3/4 (c) u (d) -0.3 d Let z = 0.06 + 4.94. What is the second smallest value in -0.2, z, 4/7? 4/7 Suppose 2f = 5f + 2o - 8, 3f - o + 4 = 0. Which is the second smallest value? (a) 7 (b) 3 (c) f b Let j be (2 + 6/(-4))/(-2). What is the second biggest value in -3/7, j, 0.2? j Let b = 31 + -33. What is the third biggest value in -2/11, 2/5, b? b Let r(y) = y*2 - 5y - 6. Let s be r(6). Suppose -c = -5 - s. Let o be 3 + (-2 - (-11)/(-8)). What is the smallest value in c, -1/6, o? o Let i(q) = -q - 9. Let l be i(-7). What is the smallest value in l, -3/7, -2/5? l Let g be (-15)/6 + (-364)/(-152). What is the second biggest value in 0.4, g, 4? 0.4 Let r = -4.6 - -5. What is the second smallest value in 3, r, -3/4? r Let v = 9 + -6. Let l = v - 2. Which is the third biggest value? (a) -1 (b) -3 (c) l b Let f = 2 + -4. Let o be (-6)/(-35)(-200)/60. Which is the smallest value? (a) f (b) o (c) -0.4 a Let i be 13/33 - 1. Let u = -6 + i. Let c = 7 + -4. What is the third smallest value in c, u, 0.1? u Let w = 4.3 + -6. Let h = 2 + w. What is the third biggest value in h, -0.3, -2/9? -0.3 Let y = 40 - 33. Which is the third biggest value? (a) y (b) 1 (c) 4/9 (d) -2 c Let d(x) = -x*3 - 6x*2 - x - 4. Let v be d(-6). Let r = 20 - 20.2. Which is the second smallest value? (a) v (b) r (c) 1 c Let n = -7.9 + -0.1. Let z = 3 + n. Let q = 3 + z. What is the biggest value in q, -3/5, 4/5? 4/5 Let r = 19 + -16.3. Let j = r + -3. Let d = 0.5 + j. What is the smallest value in -0.1, 3, d? -0.1 Let a be 24/28 - 3/6. Let v = -3/14 + a. What is the second smallest value in v, 0.4, 2/15? v Suppose -z = z - 8. Let x = -4.003 + 0.003. Which is the smallest value? (a) -2/17 (b) z (c) x c Let u = -7.9 + -0.1. Let s = u - -7. What is the third smallest value in 2/7, -3, s? 2/7 Let o be (-225)/120(-8)/(-6). Which is the third biggest value? (a) -4 (b) o (c) -2/17 a Let u be -82/(-8)-2. Let g be (-14)/(-6) + u/(-6). Let m = 0.999 - -0.001. Which is the third biggest value? (a) g (b) 1/4 (c) m b Let x = -2 - -2. Let p = x + 0. Let m be 3((-32)/60)/(-4). Which is the third biggest value? (a) m (b) p (c) -5 c Let k = -4.5 + 4. Which is the third smallest value? (a) 2/3 (b) 0.1 (c) k a Let x = -27.9 + 31. Let b = 0.1 - 0. Let y = b - x. What is the second biggest value in -3/2, -2/3, y? -3/2 Let v = 0.7 + -0.4. What is the third biggest value in v, -0.3, -4? -4 Let q be (7 + 1)(-12)/(-168). Let l = -11/20 - -4/5. Let n = 0.3 - 3.3. Which is the smallest value? (a) q (b) l (c) n c Suppose -5 = 77z - 82z. What is the second biggest value in 0.2, z, -3/5? 0.2 Let n = -2 + 1.5. Which is the third biggest value? (a) n (b) -2 (c) 1/4 b Let r(g) = -2g2 + 5. Let z be r(2). Which is the smallest value? (a) 4 (b) 0.2 (c) z c Let t = -0.19 - -0.49. Let r = 6 - 9. What is the third biggest value in t, 3, r? r Let s = -3.964 + -0.036. Let l = -0.33 - -0.03. Let n = 2.3 + l. What is the biggest value in s, n, 4? 4 Let o = 0.3 + 1.7. Let h = -0.2 - 0.2. What is the third biggest value in o, -4, h? -4 Let h = 17 - 12. Suppose -7 - 4 = k - hv, 4v = 8. Let m be (-10)/(-35) - (k + 1). Which is the second smallest value? (a) 0.4 (b) m (c) -5 b Let m = -0.2 - -0.7. Let f = 4 + -2. Let k = f - 1.6. Which is the biggest value? (a) k (b) m (c) 2 c Let o be ((-6)/27 + 0)/((-8)/12). Let n be 2/(-24) - (-4)/(-6). What is the smallest value in o, n, 1? n Let u = 4.6 + 0.4. Let q = 8 + -8.3. Let h = q - 1.7. Which is the second biggest value? (a) 4 (b) h (c) u a Let y = -39 + 26. Let k = y + 13.3. What is the second smallest value in k, -0.01, 1? k Let p = -0.2 + 0.1. Let q(h) = -4h. Let g be q(-1). Suppose 0d = 5d - 2l - 4, 0 = -d - gl + 14. What is the second smallest value in p, d, 0? 0 Suppose 12n = 9n + 9. Let z be 2/5(-5)/(-9). What is the third smallest value in n, z, 0.3? n Let r = 0.44 - 0.04. Let y = 61/3 - 314/15. What is the smallest value in 3, r, y? y Let n = 2.6 - 2.6. Which is the second biggest value? (a) 0.8 (b) -1 (c) n c Let s = -0.025 - -0.025. Which is the fourth biggest value? (a) 1 (b) -3/7 (c) 3/7 (d) s b Let a(m) = m3 + 10m*2 + 8m - 4. Let g be a(-9). What is the third biggest value in g, -3, 1? -3 Let n = -5.9 - -3.9. What is the smallest value in 1/4, -4, n? -4 Let x = 15 - 10. Let f be (0 + 1)1/1. Suppose 0 = d - 5i + f, 0 = d + 2d - i + 3. What is the smallest value in d, -0.3, x? d Let z = 6 - 4. Let q be (3 - (143 + 2))/(-6). Let v = q - 24. Which is the second smallest value? (a) v (b) z (c) -4 a Let l = -14 + 25. Let i = -11.3 + l. Which is the biggest value? (a) 0.4 (b) i (c) 5 c Let p = 7 + -2. Which is the second smallest value? (a) 0.5 (b) p (c) -1/4 a Suppose -k + 17 = 5g + 5, -3g - 2 = -4k. Suppose -kx + 4 = -x. What is the biggest value in -1/7, 1, x? x Let k = 1 - 0.6. Suppose -5n + 0n + 27 = 3l, 3n + 5l = 29. Suppose -3w + 2v + 2v + 7 = 0, -4w = v - 22. What is the biggest value in k, n, w? w Let w = -26 - -7. Let m = 14 + w. Which is the second biggest value? (a) m (b) -1/3 (c) -3 c Let y = -0.8 - -2.8. Let k = y - 7. Which is the second smallest value? (a) 1/4 (b) k (c) 0 c Let p = 0.05 + -3.05. Let m = 993/5 - 198. Let r = 4.3 + -4.8. Which is the second biggest value? (a) m (b) p (c) r c Let r = -23 - -22.91. Let c = 4.91 - r. Let i be 13/15 - (-2)/(-3). What is the second biggest value in c, i, -2? i Let z = -0.14 - -0.14. Which is the third smallest value? (a) 5 (b) -0.4 (c) z a Let m be ((-18)/(-24))/((-2)/(-88)). Let o be 2/3m/(-55). What is the second smallest value in -3, o, -1? -1 Let p = -2 - -2. Which is the biggest value? (a) -4/3 (b) p (c) -4 b Let z = 17 + -12. What is the biggest value in z, -5, 0.5? z Let q = -28 - -37. Which is the smallest value? (a) q (b) 0.1 (c) 3 b Let a be (-2 - (-6)/(-15)) + 2. What is the fourth smallest value in 6, a, 3, 0.2? 6 Let f = -0.91 + 0.71. What is the biggest value in f, 1, 0.1? 1 Let r = -19 - -21. Which is the third smallest value? (a) 11 (b) -1/10 (c) 0.3 (d) r d Suppose -2i - 2m = -0i + 2, 0 = 3i - 4m - 32. Let r(o) = 17o2 + o - 1. Let v be r(i). Let u be (-5)/(-2)20/v. What is the biggest value in -2, 4, u? 4 Let q = -7/68 - 631/476. Let o = -0.052 + -0.148. Which is the smallest value? (a) 1/4 (b) q (c) o b Let l(m) = 2m2 - 13m + 9. Let r be l(6). Let f = 1 - 1. Which is the biggest value? (a) f (b) -1 (c) r c Let p be (-3016)/(-14) - (-1)/1. Let m = 216 - p. What is the second biggest value i	{ "pile_set_name": "DM Mathematics" }
. 2 Evaluate 18/287/6-4. -3 Evaluate 14/7(-6)/(-10). 6/5 ((-672)/70)/(-24)(-2)/(-4) 1/5 Evaluate (-5)/44/1. -5 Calculate (-20)/12456/190. -4 What is 8/(-3)30/(-400)-20? -4 Calculate ((-12)/16)/(51/(-136)). 2 2(-2)/(-2)7/14 1 1/((-32)/241/(-4)) 3 Evaluate 5/(-40)8(-7)/(-1). -7 (-30)/(-4)26/39 5 4/6(-2)/(4/3) -1 What is (-227/(-450))/(6/5)? 1/10 Evaluate (05/20)/((-2)/2). 0 What is ((-5)/(-20))/(26/16)? 2/13 2/3(90/(-4))/5 -3 Evaluate ((-4410)/108)/492/15. -1/9 Evaluate (12/(-30))/((-14)/(-10)). -2/7 Calculate 1/(-2(-10)/(-8))-2. 4/5 Evaluate (-6)/8-1864/(-8208). -2/19 20/15(1530/24)/(-17) -5 Evaluate 1/(-3((-8)/6)/(-4)). -1 Calculate (-52)/(-312)(-4)/(-2). 1/3 What is the value of ((-5)/((-25)/5))/(1/1)? 1 36/(-99)((-6)/4)/3 2/11 Calculate (4/(-4))/((-2)/(-8)). -4 3/(1/4(-18)/6) -4 Evaluate 40/(-110)(-12)/(-8). -6/11 (1/(-12))/(25/(-40)) 2/15 Calculate (-3)/2(-1)/((-15)/10). -1 Calculate 2/(-8)559/(-59). 5/4 Evaluate (-3(-6)/(-63))/((-2)/2). 2/7 (((-20)/12)/(-5)1)/1 1/3 Calculate (4/10)/((-15)/((-1350)/(-24))). -3/2 Evaluate (29/116)/((-4)/2). -1/8 Evaluate -8(-4)/16-2. -4 What is the value of 12/2(-3)/99? -2/11 Calculate (28/42)/(-1(-14)/9). 3/7 Calculate (-2)/(75/(-3)12/(-30)). -1/5 What is -2(-2)/(-16)-210? 5 What is ((-9)/(-4))/(171/456)? 6 ((-1)/(-1))/(-15) -1/5 What is the value of (4/(-22))/(11/(-11))? 2/11 What is -64/(-180)-5? -2/3 (100/(-50))/((-4)/(-14)) -7 (-27)/(-9)2/(-6) -1 4/(-2)62/(-124) 1 What is (-16)/(-40)35/98? 1/7 What is the value of ((-326)/(-978))/(((-2)/2)/(-18))? 6 15/33(24/20)/(-3) -2/11 What is the value of 4/244/1? 2/3 Calculate -5(-2)/(-5)8/88. -2/11 What is the value of (-9)/(-8)8/6? 3/2 Calculate (2(-5)/6)/(30/(-4)). 2/9 (6/3)/(2/5) 5 Evaluate ((-27)/(-18))/((-3)/((-12)/(-2))). -3 Calculate (-6)/(-1)12/25214. 4 What is 8/(-12)(6/(-4))/3? 1/3 What is ((-47)/141)/((-2)/6)? 1 4/(-6)252/(-168) 1 Evaluate (-4)/((6/3)/(5/5)). -2 Evaluate (-2)/(-3)-1150/(-200). 1/2 (2/8)/(-6(-5)/120) 1 What is (-138)/(-207)(-6)/28? -1/7 What is (8/(-3))/(-2)36/24? 2 Calculate (-10)/(-6)132/88-2. -5 6/(-5)25/10 -3 What is 8/(-182)35/(-30)3? 2/13 Calculate (0(-5)/15)/1. 0 Calculate 7/((-21)/(-2))12/(-52). -2/13 What is the value of 7/(4/1614)? 2 What is the value of ((272/(-17))/224)/(2/2)? -1/14 What is the value of ((-1)/8)/(13/13)? -1/8 Calculate 36/126(-21)/15. -2/5 (-5)/3(-316)/1185 4/9 Evaluate 9/(-48)-48/(-12). -1/2 Calculate (27/(-18))/((-14)/4). 3/7 Calculate ((-27)/(-9))/(-1(-9)/6). 2 Calculate ((-6)/18)/((-15)/(-27)). -3/5 65/156(-4)/(-10) 1/6 (10/200)/(-1)-8 2/5 Calculate 1/7463/(-72). -1/2 Evaluate (-38)/114(60/16)/(-5). 1/4 8/18(-3)/2 -2/3 Evaluate (-17)/((-1190)/(-20))(-14)/(-40). -1/10 What is ((-6)/12)/((-4)/2)? 1/4 Evaluate ((405/(-10))/(-9))/(54/72). 6 Calculate (-2)/3-112/8. 1 What is 7/((-105)/5)3? -1 Evaluate 0/((-2)/3(-57)/38). 0 Calculate 1215/24-4. -5 Evaluate (-29)/((-348)/24)6/(-4). -3 What is the value of ((-7)/((-63)/(-6)))/((-6)/63)? 7 What is (2/(-6))/((39/(-2))/13)? 2/9 ((3/9)/(9/(-108)))/(-4) 1 What is (-2)/6(-18)/(-15)? -2/5 What is 3/((-5)/((-10)/(-3)))? -2 What is (30/(-15))/(22/10)? -5 Evaluate ((16/(-28))/(-2))/(13/(-91)). -2 What is -2(-1)/(-1)-1? 2 Evaluate (16/(-96))/((-6)/(-12)). -1/3 Calculate (38/76)/(10/4). 1/5 What is 30/(-12)4/(-25)? 2/5 What is the value of 64/(-4)3/24-2? 4 Calculate 63/81-33. -7 Evaluate (-1)/((5/10)/(2/36)). -1/9 (-3)/6((-6)/(-15))/2 -1/10 (-3)/2(-16)/144 1/6 Evaluate (-2)/(-6)-415/(-20). 1 Calculate (2/(-6))/(64/(-48)). 1/4 What is 1/((-20)/2(-14)/(-175))? -5/4 Calculate 3/((-4)/(40/(-75))). 2/5 What is the value of (-117)/13(-15)/544? 10 What is -2-12/1? 4 (-5)/(-4(-3)/12) -5 Evaluate (-1)/550/(-20). 1/2 What is the value of ((-3)/51)/((6/(-3))/4)? 2/17 What is the value of 2(-6)/24-2? 1 (-4)/18(-3)/2 1/3 What is (30/5)/(6/(-8)-18)? 4/9 3/(27/6)36/24 1 0/(9/(-9))(-2)/2 0 Calculate (4/3)/((2520/(-27))/20). -2/7 What is the value of ((-5)/(-10)0)/(4/(-2))? 0 Evaluate (0/1)/((-15)/5). 0 Evaluate (-3(-3)/(-30))/(363/(-605)). 1/2 Calculate 1/(((-1)/6)/((-4)/(-8))). -3 (10/153)/(-2) -1 What is the value of (62/651)/(2/6)? 2/7 Calculate 0/(-1(-6)/(-6)). 0 What is 144/32(-6)/(-9)? 3 What is the value of (-5)/(-2)19/380? 1/8 Calculate (14/6)/((-56)/(-168)). 7 What is the value of (-5)/(-4)3/(-45)-6? 1/2 Evaluate (-10)/10(-2)/5-1. -2/5 What is the value of (-26)/(-13)1(-2)/18? -2/9 What is the value of (3/(-15))/((-9)/225)? 5 Evaluate (-1)/268/(-153). 2/9 (-4)/6144/32 -3 Calculate (51/10)/((-3)/4). -2/3 Evaluate (-3)/((30/4)/(-15)). 6 What is the value of (((-18)/(-15))/(-6))/(1/1)? -1/5 10/18114/190 1/3 Evaluate (-1)/(5/48/2). -1/5 What is the value of (-2)/128/56? -1 8/(-64)202 -5 (2(-14)/35)/(36/(-10)) 2/9 What is the value of ((-1)/2)/(25/20)? -2/5 (52/(91/7))/((-4)/2) -2 Calculate -1(-6)/(-14)(-54)/81. 2/7 -3(-98)/756(-4)/(-7) 2/9 Evaluate -1-4(-12)/16. -3 What is 40/150(-10)/4? -2/3 What is the value of (380/38)/((-5)/(-5))? 10 Calculate ((0/5)/4)/1. 0 What is (-4)/(-9)(-189)/(-252)? 1/3 Evaluate ((-2)/(-14)5)/(18/126). 5 What is -13(-18)/11713? 6 Evaluate -12(-10)/(-16)(-3)/30. 3/4 (-5)/(6/6-1) 5 What is the value of (-404)/1616(-1)/((-2)/(-2))? 1/4 What is the value of 14/168(-16)/(-10)? 2/15 What is 6/112/(-24)? -3 ((-13)/(-39))/(1/((-2)/4)) -1/6 ((-5)/((-25)/(-6)))/((-426)/(-2840)) -8 Calculate (-49)/214/143. -2 Evaluate ((384/30)/(-8))/((-12)/(-30)). -4 ((0/(-4))/(-41))/(-2) 0 Evaluate ((-4)/12)/(((-4)/15)/4). 5 Calculate ((-2)/(-6))/(9/27). 1 Calculate 15/(-6)40/150. -2/3 Calculate ((-352)/(-792))/(-2(-1)/9). 2 What is (((-77)/7)/(-55))/(3/15)? 1 What is the value of (6/(-49))/(7(-2)/49)? 3/7 1/(35/(-45)) -3 Evaluate (5/75)/((-4)/12). -1/5 What is ((-288)/(-240))/((-6)/20)? -4 What is the value of 42/(-63)6/(-26)? 2/13 Evaluate (93/(-62))/(11/(-12)-3). -6/11 Evaluate (18/(-6))/30(-180)/(-24). -3/4 Calculate ((-5)/305)/((-1)/6). 5 What is the value of ((-18)/15)/(-63/60)? 4 What is the value of (-4)/(-21)-2(-9)/(-12)? -2/7 What is the value of (((-15)/6)/1)/(2/4)? -5 Calculate 0/(-2)-4(-24)/(-288). 0 Calculate 11/((-55)/(-2))10/(-4). -1 What is the value of 0/(-1)(-11)/33? 0 Evaluate (-184/35)/((-2)/5). 6 Calculate (-187/(-42))/((-63)/(-12)). 4/7 What is the value of (-22)/77(-7)/(-3)-6? 4 What is 5/(-20)0-1? 0 What is (42/(-21))/(2/3)? -3 Evaluate ((-29)/290)/(6/(-10)). 1/6 What is (12/(-3))/2(-15)/(-6)? -5 What is the value of 13/(6/2)3? 3 What is ((-8)/(-6))/((-6)/(-9))? 2 Calculate ((-2)/2)/(49/441). -9 What is the value of ((-12)/21)/(4/(-14))? 2 Calculate 44/(-66)3-1. 2 What is the value of 2/13(20/20)/1? 2/13 Evaluate 112/140(-5)/1. -4 Evaluate (-94)/94(-2)/6. 1/3 Calculate (-36)/481/((-18)/192). 8 Evaluate 1(4/(-1))/4. -1 Calculate (1/12)/(3/(-8)). -2/9 What is the value of (21/(-3))/3? -2/9 (36/36)/((-2)/(-2)) 1 Evaluate (72/32)/(3/2)-2. -3 ((-4)/(-7))/(1386/(-539)) -2/9 Calculate (-15)/(-6)((-288)/100)/(-12). 3/5 Evaluate (-32/(-12))/(1/1). 1/2 15/6(-2)/1 -5 What is ((-5)/20)/(54/48)? -2/9 Calculate ((-15)/(-10))/((-5)/((-50)/5)). 3 Evaluate ((-20)/15)/(322/(-21)). 2/23 What is (713/(-91))/((-1)/(-3))? -3 Calculate (8/6)/((-3)/(45/10)). -2 Calculate (-5)/(30/(-4))(-120)/80. -1 What is the value of -6(5/12)/((-190)/(-57))? -3/4 Evaluate (-3)/((-14)/(7/((-35)/(-10)))). 3/7 (-4)/3(-6)/8 1 What is the value of 30/55(-220)/(-30)? 4 Calculate (-14)/(-42)1/1. 1/3 Calculate (-4)/(32/(-12))2. 3 Calculate ((-24)/3)/(-2)2/12. 2/3 Evaluate ((-8)/(-15))/(-8)-6. 2/5 What is ((4/(-4))/5)/((-2)/(-2))? -1/5 60/1688/(-10) -2/7 120/(-80)4/6 -1 Evaluate ((-15)/(-20))/((-1)/((-16)/18)). 2/3 What is 12/((-36)/(-99)(-55)/(-10))? 6 Calculate 115/4624/20. 3 Evaluate (27/18)/((-5)/(-10)). 3 Evaluate -5(-63)/(-45)-1. 7 Calculate 4/(-2)(-10)/(-4). -5 (-16)/249/(-16) 3/8 Calculate 1(-2)/(-9)225/400. 1/8 What is the value of 3/(16/(-6)3)? -3/8 Evaluate (4/((-32)/(-2)))/(63/(-24)). -2/21 Evaluate ((-2)/(-14))/((-34)/68). -2/7 What is the value of (12/2)/(4/2)? 3 What is the value of (-42)/61/(5/5)? -7 Evaluate ((-26)/663)/(2/(-6)). 2/17 What is the value of ((-2)/3)/(14/21*	{ "pile_set_name": "DM Mathematics" }
(-1/2)/(b(2/11)/bb(-1/2))) assuming b is positive. b(-263/66) Simplify (w(-6)/www12w(ww(-3)/w)(-1/29))(-29) assuming w is positive. w(-206) Simplify ((l(-33)/l(1/49))/(l*(-2/97)/((ll(10/7))/l)))16 assuming l is positive. l(-2400928/4753) Simplify (x8x/((x/(x/((x(3/13)/x)/x)x))/x)(x(-2)/x)(10/7))(-38) assuming x is positive. x(-29336/91) Simplify ((xx1)(-33)x(-2/9)/xxx/((x(x(x/(xx/(x/x*(-9)x)))/x)/x)/x))45 assuming x is positive. x(-3340) Simplify ((jj(-6)j)/j)/j*(2/21)(jj/(j(3/5)/j)j)/(jj/(j/j5j)jj)((j/j(2/15))/(jj(-5)))1 assuming j is positive. j(-134/35) Simplify (((o3/o)(2/47)/(o(-2/5))(-25))37)24 assuming o is positive. o(-413808/47) Simplify (ssss(s/s*(2/9)s)/sss0)/(s(-1))*(-9/5)(ss5sss3)(-7/2) assuming s is positive. s(-3107/90) Simplify ((s(1/3))(-2/109))(-1/10)(s6ss4)/((s(-2)s)/s(-7)) assuming s is positive. s(8176/1635) Simplify (q*(-1)q*9(qq26)/(qq(-3/13)))(7/4) assuming q is positive. q*(3115/52) Simplify (i/(ii(3/7)/i))/i(1/5)(ii/(i(iii(-5)/i)/i)i)/i*(2/11)((i/(i*(-5)i))/i(2/11))(1/5) assuming i is positive. i*(3139/385) Simplify ((uu(2/5))36)*11/(uu/u*(-7)(u/(uu(-5)))/uu(u(1/4))(-23)) assuming u is positive. u(10923/20) Simplify (g7g*(-3/7)g(1/7)/(g/g7))/(((g*(5/2)/gg)/g*(-7))/((ggg4)/(g(1/11)g))) assuming g is positive. g(1251/154) Simplify (x(-9/2)xx(xxx38)/x)/(x(3/7)xx(1/22)) assuming x is positive. x(2697/77) Simplify ((g/((g(-1/5)/g)/gg)g)/g(4/7)(gg(4/3))/(gg/((g/(gg(2/19)))/g)))/((g(-2)/gg)42/(g(2/7))9) assuming g is positive. g(25202/285) Simplify ((u*(-2/19)u)*(-2/49)u/(u/u*(6/11)u)(u/(uu/u*(-2/17))u)/uu)(-5/6) assuming u is positive. u(176625/348194) Simplify ((o(-4)/o)22(oo0/o)46)2 assuming o is positive. o(-220) Simplify ((v/((v/v(-3))/v)vvv7)/(v(-2/5)v(-6/7)/v))/(v(-4/7)/(v(2/5)v)(vv*(1/3)vv)/(v/(v/(v/((v/v1)/v))))) assuming v is positive. v(1039/105) Simplify ((h(2/15)/h)/(h/((((hh*(1/9))/h)/h)/h))(h*(-2)hh)(15/4))/(((h(-2/7)h)/h)(-2/73))(-2) assuming h is positive. h(-85999/22995) Simplify ((t/(t(-3)/t))(-7))(-13)(t0)(-1/23)/(ttt/(t/t(-2/7))tt(-1/4)) assuming t is positive. t(12671/28) Simplify (i18i(i(2/87)i)/ii(-8)i(-2/33))(1/13) assuming i is positive. i(269/319) Simplify (((i/(i/i(-1))i)/i)(-18))(6/11)(i/((i*(-3)/i)/ii)iii/(i/(ii3)))7 assuming i is positive. i*(955/11) Simplify dd*(-2/31)d*8(d(-16))19 assuming d is positive. d(-9147/31) Simplify (g8/(g(g10/g)/ggg)(g*(-7)gg)/(g/(g/((gg*(-18)g)/g)g)))13 assuming g is positive. g130 Simplify (o4/oo/o(-1))(10/13)(o0o*(2/9)o)/(oo/(o(-3)/o)oo/o0) assuming o is positive. o(-343/117) Simplify ((pp*(-18)p*(3/16))/(p/(p/(p/(pp*(3/7)p)))p21))(-10) assuming p is positive. p(20375/56) Simplify w(-2)/((w/w(-1/6))/w)w*5(ww(2/15)ww)/w(w/(w/(wwww(2/11)www)))/(w/w*2)(w/w6)/((w/w(2/3)www)/w) assuming w is positive. w(1589/330) Simplify ((l/(l0ll))/ll)*9ll(-4)ll/l(-1/4)((l(-2))13)6 assuming l is positive. l(-663/4) Simplify ((c/(c*(-3)/cc)c(-14)/c)/(c/c1c/(c(c(-2/5)c)/c)))(-3/23) assuming c is positive. c(171/115) Simplify (l*(1/7)l*(-6)(ll(-2))2)/((ll/(ll(-2/7)/l))(-2/3)/((ll/(l*(1/3)l))/(l*(-2/11)l))) assuming l is positive. l(-214/33) Simplify (s(-6)ss/s*(2/11)(s/(sss(-2/5)))(4/17))/(s*(-1/2)/((s(s/(sss*(1/2)s)s)/sss)/s))15 assuming s is positive. s(-4042/935) Simplify ((s(-2/3)s(-5))/((s/(s/(s/s25)))/s(-4)))(2/29) assuming s is positive. s*(86/87) Simplify ((gg5)/((g/((g(-5)/g)/gg)g)/g)(g(g/g0)/g)(-14))/((g(3/11)/((g(-1/10)/g)/g))/(g(2/5))(-22)) assuming g is positive. g(-2879/110) Simplify ((v(19/2)vv(1/22))/(v/v(7/6))(-47))(-15) assuming v is positive. v(-895/22) Simplify (d43/dd)/(d/((d(-1/4)/d)/dd))d(1/6)/d(2/27) assuming d is positive. d(4411/108) Simplify (((xx(-16/3))/x(-2/79))/((x/x*(-1/2))/(xx*(-9)xx)))(-1/18) assuming x is positive. x(5597/8532) Simplify (u(-6)u1)/(u(-1)/u*(3/5))(u*(-4)/(uuu6))(-2) assuming u is positive. u(103/5) Simplify ((((v29/v)/(v(-31)v))14)(5/7))(1/20) assuming v is positive. v29 Simplify ((f(1/3)/f(-1/8))/(f(-1))(-1/20))/((f1/f)10)(-16) assuming f is positive. f(49/120) Simplify ((v*(-2)vvv*(-1/3))/((vv*(-3)vv)/(v/(v/(v/(v0/v))))))/(v(1/8)/vv/v*5(v(-1/5)/v)/v5) assuming v is positive. v*(1529/120) Simplify (((yy(8/5))/y(-19))/(y(2/11))(-3))(-26) assuming y is positive. y(-31668/55) Simplify u(-2/3)/(u/(u(-5)u))(uu(-3)u)/u*(1/3)(u/(u/(uu(-2/3)))u/u*(1/2)u)(-36) assuming u is positive. u(-73) Simplify ((ff((f*31f)/f)/f)/((f/(f(f(-29/2)/f)/ff))/f))/(f*(-2/11)f(-36)) assuming f is positive. f(1181/22) Simplify (f(-3)/((f/(f/f(-4/11)f)f)/ff))(-17)((ff/(f(-8)/f)f)/f)/f*(-8)(ff(-1))/f(-2) assuming f is positive. f(724/11) Simplify (c(-2)/(c8c)cc*(-1)cc(1/7))/(((cccc*(-6)c)/c*(-2/15))/(c/(cc(1/4)))(-1/16)) assuming c is positive. c(-53591/6720) Simplify (q(2/9)/q)/q*(5/2)(q1)(-8/15)((q/((q/(qq*1))/qq))(4/23))41 assuming q is positive. q(21631/2070) Simplify m2/(m/(mm(-2/13)))m*5(m/(m*(-2)/m))/mm(-4)/m0(m/m7)/(m(-1/4)/m) assuming m is positive. m(57/52) Simplify (d(-21)d*(-2/15)(d/d(6/23))(-47))17 assuming d is positive. d(-327692/345) Simplify ((((kk(-7)k)/k0)/((k/k3)/k(-6)))(1/15))30 assuming k is positive. k(-18) Simplify (((u(-3))(-1/60)/(u(-2)/(u(-8)/u)))48)34 assuming u is positive. u(-56712/5) Simplify ((b(2/25)/b)/bb32(b((b(-23/5)/b)/b)/b)/(b0/bb))(3/13) assuming b is positive. b(1761/325) Simplify (c/c5)/(c(2/9)/c)(c(-2/5)/c)/(c/(c(5/4)/c)c)c(-6)c*3c/(c/c*1)c/(c/c7) assuming c is positive. c(-247/180) Simplify ((x(-2))(-14))*(5/12)(x0)(-15)/(x(-1))(-41) assuming x is positive. x(-88/3) Simplify ((((l27l)/l)/l(-17))/(l(-5/4)/((ll/l*(3/8)l)/l)))(-22) assuming l is positive. l(-4125/4) Simplify ((s*(1/17)/ss)/(ss(-1)s))/((ss(-4)s)/s*(2/5))((s/(ss(-1/6))s)/s)/(ss(-4))s*0s(1/4) assuming s is positive. s(4973/1020) Simplify r*39/rrr/((r/(r/((r(r*(1/15)/r)/rrr)/r)))/r)(r(r/r(1/6))/r)39 assuming r is positive. r(2203/30) Simplify ((ll/l*(-1/5))/(ll*(-1/8)ll))(2/63)(ll(-1))/(lll6)l*(-6)/lll/(l/(l/l4)) assuming l is positive. l(-2383/140) Simplify ((a/a0)(-1/77))(-15)/((aa(1/4))(-48)/(a(-1/4))(1/18)) assuming a is positive. a(333643/5544) Simplify (x(-12))*(-12)(x/x29)(31/5) assuming x is positive. x(-148/5) Simplify (x(-8)/x8)/(x0/xx(-8))(x(-2)/(x(-6)x))13 assuming x is positive. x32 Simplify ((i(-2/7))(-48))(-9)(i*(-8)/iii(ii(-1/4))/ii)8 assuming i is positive. i(-1214/7) Simplify ((z*(-6)/zzz)/zz(z/((z(-5/3)/z)/z))/z)(6/7)/((z(-7)/z(-8/7))/(z/z(-1))(-46)) assuming z is positive. z(-611/7) Simplify (r(-3/2)rrr*(-4)r)(-9/5)/((r(2/3))6/(r0/r(-1/9))) assuming r is positive. r(11/18) Simplify (m/(mm(2/5)m))(3/4)/((m/(m(-2/3)/mm))/(mm*(-2)m))((m(2/9)/m)/m(-5/4))(1/49) assuming m is positive. m(-5969/2205) Simplify p(-2)ppp*(-4/3)(p/p*(4/9))/ppppp/(p/(p(p/p*(11/3))/p))ppp assuming p is positive. p(14/9) Simplify t2tt*1tt/(tt/(tt/t(-2/5)))t*(2/3)t(t(ttt*(-2/7)/tt)/t(t/t(5/2))/t)/(t/(t(-4/7)/t)ttt6) assuming t is positive. t(-691/210) Simplify ((xxxx1)/(x(x*(-2/31)x)/x)x(-8)/(x(27/4)/x))(10/13) assuming x is positive. x(-6625/806) Simplify ((q(-7)/qq)/(q/(q/(q/q*24)))(q/((qqq*(-2/41)qq)/qqq))16)*(-49) assuming q is positive.	{ "pile_set_name": "DM Mathematics" }
uming t is positive. t*(-855/2) Simplify ((pp/(ppp*1p))/pp)(-44)(p*5/p)/pp(-4/3) assuming p is positive. p(269/3) Simplify ((b/b*(5/2)b)/b)(5/8) assuming b is positive. b(-15/16) Simplify g*(-4/3)/(g/(gg19)) assuming g is positive. g(53/3) Simplify (d*(3/4)/d)/d(d/d0)/d assuming d is positive. d(-5/4) Simplify qq/(qq*0)qq/q(-1/4)(qq/((q(2/15)q)/q)q)/q(1/10) assuming q is positive. q(361/60) Simplify x11/x(-7/2) assuming x is positive. x(29/2) Simplify ((b/b1)(-24))13 assuming b is positive. 1 Simplify (a(2/13)/(a/(a/a(-1/9))))/(a(-2))22 assuming a is positive. a(5179/117) Simplify s(2/25)/s(1/6) assuming s is positive. s(-13/150) Simplify ((rr*(-3)r)/r)14 assuming r is positive. r(-28) Simplify (l*3/ll(-5))30 assuming l is positive. l(-90) Simplify (d(-1/2))(28/3)/((d(-1)d)/(d(-1/12)/d)) assuming d is positive. d(-23/4) Simplify (f/(ff*7f)fff(-6/5))/(f5(ff(3/4))/f) assuming f is positive. f(-259/20) Simplify ((b5/b)/(b(2/7)bb))/(bb*(-4/5)bbb6) assuming b is positive. b(-227/35) Simplify s8/(s/(s(1/4)sss))(s(1/4))(-12/7) assuming s is positive. s*(275/28) Simplify (nnn(2/5)/nn)*(-24)(nnn*3)/(n(n/((n/n7)/n))/n) assuming n is positive. n(-303/5) Simplify (j*(-2/31)j)(-12) assuming j is positive. j(-348/31) Simplify ((s/(s/s(-15)))/s)(-6/11) assuming s is positive. s(96/11) Simplify ((w(-2/9))(-47))(2/119) assuming w is positive. w(188/1071) Simplify (s0)*(-9/2)(ss5)/s(2/13) assuming s is positive. s(76/13) Simplify (p(1/4)p)/(ppp/p*(-3/2))((pp/((pp*(-1/6))/pp))/p)/ppp/(pp(-8)) assuming p is positive. p(59/12) Simplify (u(-22)uu)/uuu28u assuming u is positive. u9 Simplify (v/v(13/4)v)/(vv(-3/5)) assuming v is positive. v(-33/20) Simplify ((ii/(i/(i/(i/i0)))i)(-4/3))46 assuming i is positive. i(-368/3) Simplify (r(2/19)/r(-8))/(r/r(-1))(-40) assuming r is positive. r(1674/19) Simplify ((i*(-1/2)i)(2/39))31 assuming i is positive. i(31/39) Simplify ((p/p5)/(p/((pp(3/2))/pp)))(-3/23) assuming p is positive. p(15/46) Simplify (j*(2/7)jj)0(j/j(-3))/j(-2) assuming j is positive. j*6 Simplify ((c/((cc/(c*6/c)c)/c))/(c*5/c))/((c/(cc(-1)))/c0) assuming c is positive. 1/c Simplify ((ff(2/5))/f)(3/7)(ff1f)(4/3) assuming f is positive. f(146/35) Simplify (k/k*(1/3)kk(-6))/(k(1/4))(-1/23) assuming k is positive. k(-1193/276) Simplify m/(m(m/(m/m*0))/mmm)m(8/7) assuming m is positive. m(1/7) Simplify v*(-3/16)vv(18/7) assuming v is positive. v(379/112) Simplify ((rr*6r)/rrr/r*(-7))/((r/(rr/(r(-7)/r)))/r(-2/5)) assuming r is positive. r(123/5) Simplify (m/m(-1)m)(4/11)/(m(-6)/m(m/(mm(-1/4)))/m) assuming m is positive. m(389/44) Simplify (p1)(-8/5)/(pp/p*1ppppppp/(p*4p)ppp) assuming p is positive. p(-38/5) Simplify aa*(-21/2)a22/a assuming a is positive. a(23/2) Simplify (q(-8))(4/7) assuming q is positive. q(-32/7) Simplify (h(1/3))18 assuming h is positive. h6 Simplify l*(9/11)/(ll/(l/(l(((ll*(-11/4))/l)/ll)/l)l)l) assuming l is positive. l*(113/44) Simplify (ff*0ff(2/5)/f)(-44) assuming f is positive. f(-308/5) Simplify (a8a)(-50) assuming a is positive. a(-450) Simplify (m/(m/((((m/(m(mm/m*(-4/7)m)/mmmm))/m)/m)/m)))/mm/(m/(m*(1/5)m))(m(1/4))(-23/4) assuming m is positive. m(-5493/560) Simplify (g/(g(2/11)/g))(-36) assuming g is positive. g(-720/11) Simplify a11/a(-3) assuming a is positive. a14 Simplify (h9h*(-5)hhhh)(-36) assuming h is positive. h(-288) Simplify x(2/83)/(x/(xx(-28))) assuming x is positive. x(-2322/83) Simplify (ff(-22))(-11) assuming f is positive. f231 Simplify l14l(-1/27) assuming l is positive. l(377/27) Simplify r*1rr(-3)(r(2/3))38 assuming r is positive. r(73/3) Simplify (o(-1/3)o/(o/o0)o)/((oo/o(-10))/((oo/o*2o)/o)) assuming o is positive. o(-34/3) Simplify (u(2/15)/(u/((u/((uuuu4u)/u))/u)))/(u/u*0u(-1/3)) assuming u is positive. u(-128/15) Simplify (z/((zz/(z(-1)/z))/z))/z13 assuming z is positive. z(-15) Simplify j(-4)/(jj*(-1))j*(2/7)j(-1/5) assuming j is positive. j(-137/35) Simplify o*(-32)o(-7/2) assuming o is positive. o(-71/2) Simplify (f1/f)39(f/((ff/(f/(f*(2/7)/f)))/ff))(-2/3) assuming f is positive. f(-10/21) Simplify (b/b6)(-17/3) assuming b is positive. b(85/3) Simplify z(2/117)z(-18)z assuming z is positive. z*(-1987/117) Simplify p/(p(((pppp(1/4))/p)/p)/p)p(-6/11) assuming p is positive. p(-35/44) Simplify q*1qqq(-1) assuming q is positive. q2 Simplify ((l*(2/11)/llll)(-18))(27/5) assuming l is positive. l*(-11664/55) Simplify o/(oooo/((oo(-3)o)/o))(o(-6)/o)/ooo(1/10)(((o*(-6)o)/o)/o)/o assuming o is positive. o*(-199/10) Simplify (rr1)(-1/63)/(r/r(-2))(21/5) assuming r is positive. r(-3979/315) Simplify (l22l)/(ll/l(-29/3)) assuming l is positive. l(34/3) Simplify ((((j/(jj(12/11)))/j)/j)/(j/(jj(3/2)/j)))(6/11) assuming j is positive. j(-171/121) Simplify (((c/c(-18)c)/ccc)/c)/((c(6/13)c)/c) assuming c is positive. c*(254/13) Simplify ((r/(rr/((r/r(-1))/r)))/r(4/7))/(rr1)(-1/2) assuming r is positive. r(3/7) Simplify h(-17)h(2/3) assuming h is positive. h(-49/3) Simplify b*7/(bb*(-16)b) assuming b is positive. b21 Simplify (o/o(1/4))/((o*(1/5)/o)/o)o*2oo1 assuming o is positive. o(131/20) Simplify (o1)7/(((ooo0)/o)/o)(-25) assuming o is positive. o7 Simplify (i(-1)i/(i/(i/i6)))(1/72) assuming i is positive. i*(-1/12) Simplify (zzz(-5)z((((zz(-2/3))/z)/z)/z)/z)(-36) assuming z is positive. z204 Simplify (p(-26/3)p)/(ppp(-3/10)) assuming p is positive. p(-281/30) Simplify ((c3)(-3/17))(-2/15) assuming c is positive. c(6/85) Simplify ((a/a(-1/4)a)/(a/(a/((a*(2/3)a)/a))))(-2/11) assuming a is positive. a(-19/66) Simplify (o*(2/5)oo4)(-4) assuming o is positive. o(-108/5) Simplify (jj(3/13))(-4/7) assuming j is positive. j*(-64/91) Simplify (j/(jj*(1/4)j))(-29)/(j8/j(5/2)) assuming j is positive. j(123/4) Simplify ((pp(1/15))(-34))13 assuming p is positive. p(-7072/15) Simplify f(-8/3)f(-13/2) assuming f is positive. f(-55/6) Simplify ((o*(-1/6)o)/o*(-5))/(oooo*1o)50 assuming o is positive. o(-1465/6) Simplify ((dd(2/7)d)31)45 assuming d is positive. d(22320/7) Simplify (w/w(-3)w/(ww/(w/((ww7)/w)))ww)(-37) assuming w is positive. w37 Simplify ((gg*(-1/2)g)/g)*(-16)(g/(g/(gg(-2/21)))g)/(g/g*9gg) assuming g is positive. g(-2/21) Simplify (u(-2/11)u/u(-2))/(u(-3/4)/(u(1/4)/u)) assuming u is positive. u(31/11) Simplify (v*(-5)v(v/(v/v5))/v)/(v0)13 assuming v is positive. 1 Simplify (m/(m3/m))/(m(3/2)/mm)m(1/6)m/m*(-1)m assuming m is positive. m(2/3) Simplify ((z/(z/(z/((z/z1)/z))))(1/50))(-1/6) assuming z is positive. z*(-1/150) Simplify (a(a/(a/a*(-8/7)))/a)/(aa*(-3/11)/aa) assuming a is positive. a(-144/77) Simplify c/c(-3/34)c(3/25) assuming c is positive. c(1027/850) Simplify (k(-2/15))(-46) assuming k is positive. k(92/15) Simplify (g(-2/11))12 assuming g is positive. g(-24/11) Simplify ((r1)(-2/15))(-45) assuming r is positive. r6 Simplify (vv(-34))/(v(-27/4)/v) assuming v is positive. v(-101/4) Simplify (((r/r1)/r)17)47 assuming r is positive. r(-799) Simplify (a(8/9)a)/aa(-25) assuming a is positive. a(-217/9) Simplify b*(-4)(b/b*(-4))/b(b1)(-35) assuming b is positive. b*(-35) Simplify (ll(2/3)/l)(-2/7)(ll/((l*(-2/7)ll)/l)l)(-6/19) assuming l is positive. l(-52/57) Simplify ((qq/(qq2))(-1))(-8/13) assuming q is positive. q(-8/13) Simplify ((o*(3/5)o)/o(-1/2))30 assuming o is positive. o*63 Simplify ((rr/(rr(2/13)r))/(rr(2/5)))/(r1)*(-47) ass	{ "pile_set_name": "DM Mathematics" }
y - 48 + i. Is y a composite number? False Is 723/6 - 4/(-8) a composite number? True Let o(m) = 4m2 + 8m - 17. Let g(a) = -7a2 - 16a + 34. Let i(k) = -3g(k) - 5o(k). Is i(6) prime? True Let f(s) = s + 9. Let z be f(0). Is (z - 590)(-2 + 1) a composite number? True Let i(q) = q2 - 3q - 5. Let b be i(5). Suppose -6t + bt + 37 = 0. Is t composite? False Is 13990/60 + (-1)/6 a prime number? True Let n(w) be the second derivative of w*4/6 + 3w*3/2 + 2w*2 + 3w. Is n(-6) a prime number? False Suppose 0 = -z + 2i - 215 + 1158, -5i = -5z + 4715. Is z composite? True Let w(f) = 27f*2 + 7f + 4. Let i be w(-5). Suppose 2s = -2s + i. Is s a composite number? True Suppose 2b + 18 + 5 = -5v, -3v - 15 = 0. Let g = b + 22. Is g prime? True Let f = 3 - 3. Suppose fp - 24 = 2p. Is 2 + 2 + -2 - p a prime number? False Suppose -2g - 4g = -2022. Is g a prime number? True Let p(c) = c2 - 10c - 2. Let j be p(10). Is (j - (-2 - 77)) + 2 composite? False Let q = -1587 + 2324. Is q a prime number? False Let y(l) = -l*3 - 5l*2 - 3l - 4. Let n be y(-3). Let q = 25 - n. Is q a composite number? True Let w(l) = l*2 - l + 2. Let y be w(2). Suppose u - 224 = -4c - yu, u = 0. Suppose -k + c = -21. Is k prime? False Suppose 0 = g + 5 + 3. Let l(x) = -24x + 10. Let j(w) = -w + 1. Let n(z) = gj(z) + l(z). Is n(-2) a composite number? True Let a = -790 + 1121. Is a a prime number? True Let z(h) = -76h + 4. Let g be z(-9). Suppose 0 = -2o - 2o + g. Suppose o = -s + 5s. Is s a prime number? True Suppose 1781 + 7487 = 4r. Is r a prime number? False Let c be 408/(-20) + 6/15. Is (79/(-5))/(4/c) prime? True Let b(k) = 32k + 9. Is b(5) composite? True Let u(b) = b3 + 4b*2 - 6b - 5. Let j be u(-4). Let t(c) = -c + 10 - c3 + 62 - j. Is t(0) a composite number? False Let c(u) = -u3 + 9u2 - 9u + 11. Let d be c(8). Suppose 133 = dv + o + 24, -5v = -4o - 193. Is v prime? True Suppose 5j - 10 - 15 = 0. Suppose -b - 5v = -0v + 25, -jb = -v - 5. Suppose 0 = 2m - 3s - 3, -4m + 6s - 2s + 8 = b. Is m composite? False Let c be 1/(0 - 1/(-8)). Let f = -5 + c. Suppose -a + 217 = 3n, fa - 4n = -6n + 665. Is a a composite number? False Let r = 307 + -201. Suppose -5t + 21 = r. Is (2 + t + 2)-3 a composite number? True Let j(k) be the third derivative of -k6/120 + k5/10 + k*4/12 + 7k*2. Is j(-7) a composite number? True Let g be (3 + -2 + 98)-1. Let i = g + 656. Is i a composite number? False Let r be (-3 - 0)782/6. Let g = 840 + r. Is g a prime number? True Let m(p) = -p2 + 42. Let z be m(0). Suppose v - 3k - z = 97, -k + 250 = 2v. Is v composite? False Suppose 3s - 6717 = 2388. Is s composite? True Suppose -2i + 0i - 2 = -3d, d - 4i + 6 = 0. Is d prime? True Let f = -28 + 97. Is f composite? True Suppose 0 = -2x + 2056 + 54. Is x a prime number? False Suppose 5v - 6v + 149 = 0. Is v a composite number? False Suppose -r - 1001 - 105 = -3c, 0 = 4c - 3r - 1483. Is c composite? False Suppose 5t - 5o = 5765, t - 5t = -3o - 4610. Is t a composite number? False Suppose -2z - 5h + 138 = 0, 5z - 43 = -5h + 272. Is z prime? True Suppose 10r - 5r + 5 = 0. Is 7((-2 - -4) + r) prime? True Suppose 12 = -0g + 3g. Suppose -gi = -m - 2m - 5, -3m = -2i + 1. Is (-19i)/(6/(-3)) prime? True Suppose 11662 = 5o - 3z, -4o + 14z = 9z - 9327. Is o composite? False Is 10/40 - 3030/(-8) composite? False Suppose 0 = -2f + 36 - 4. Let r = -10 + f. Is r composite? True Let p = 721 - 384. Is p a prime number? True Let h(n) be the third derivative of 1/60n6 - n2 + 0n*5 + 0n + 0 + 5/6n3 - 1/8n4. Is h(4) a composite number? True Let f = -31 + 128. Is f a prime number? True Let i(t) = -t3 - 10t2 - 2t + 6. Is i(-11) a composite number? False Let y(z) = 23z2 + 9z + 5. Is y(10) a composite number? True Let g = 16 + -11. Let i be g + 4 + -1 + -1. Is (-75)/(-7) + 2/i a composite number? False Suppose 3r - 2 = -q, 5r + 0r + 4 = 2q. Let k be ((-16)/(-12))/(q/12). Let s(g) = -g*2 + 11g - 10. Is s(k) a composite number? True Let a(y) = 13y2 + 3y + 17. Is a(-9) composite? True Let u = 116 - 47. Is u composite? True Suppose -21331 = -13x - 3248. Is x a prime number? False Suppose 3r - 17 - 7 = 0. Let m = 39 - r. Is m a composite number? False Let r(u) = 2u2 + 8u - 4. Is r(-7) a prime number? False Let o(k) be the first derivative of k*4/4 + 10k*3/3 - 5k*2/2 + 3k + 2. Is o(-6) composite? True Let d(m) = -m*3 - 13m*2 - 15m - 16. Is d(-13) a composite number? False Let f(r) = -4r3 - 4r*2 - 2r + 1. Let k(m) = m3 - m2 - 1. Let v(z) = f(z) + 2k(z). Let n = -12 - -7. Is v(n) composite? False Let c = -19203 - -28126. Is c a composite number? False Suppose 0 = -5w - 2d + 28, 2d - 21 + 1 = -3w. Is w/(-10) - 514/(-10) prime? False Let b be 2(-4 - -1 - 1). Let f = 11 - b. Is f prime? True Let m = 1993 - 1420. Is m prime? False Suppose 4c + l - 858 = 0, 0 = c + l + l - 211. Let h(a) = a3 - 2a*2 - 10a + 12. Let u be h(6). Let o = c - u. Is o a prime number? False Suppose 49 = -u + 3j, -5u + 2j - 3j - 277 = 0. Let n = -33 + 33. Let b = n - u. Is b composite? True Let v be 2 + 0/((-1)/1). Is 3/v2212/21 a prime number? False Let o(c) = 91c*3 + 2c + 1. Let x be 9/4 + (-2)/8. Let d be o(x). Suppose 0 = 3s + 4n - 431, 4s - 3n = 9s - d. Is s a composite number? False Let b(y) = -190y - 5. Let u be b(4). Is u/(-6) - (-2)/(-4) prime? True Suppose -3w = -8w + 190. Suppose -k + 2h + 8 = 0, 3k + 20 = 7k - 5h. Suppose -f - f + w = k. Is f prime? True Let a(l) = -l + 8. Let w be a(7). Let c(d) be the second derivative of 3d5/20 - d4/12 + d3/3 - d2/2 - 2d. Is c(w) composite? False Suppose -7g + 25901 = 10998. Is g a prime number? True Let k = 5 - 5. Suppose kd = -3d + 9. Is 10(-1 + 4)/d a prime number? False Let n(x) = -x3 - x2 - x + 48. Let s be n(0). Let p = -11 + s. Is p a prime number? True Let k(v) = -v*2 - 4v + 5. Let s be k(-4). Suppose -sy + 6b - b = -170, 0 = 2b - 6. Is y composite? False Let r = -1 - -1. Suppose -4x - 16 + 4 = r. Let p(m) = 2m2 + 3m - 3. Is p(x) composite? True Let m(r) = r*3 - 5r*2 + 6r - 7. Is m(6) prime? False Suppose -4d - 20 = 3v - 7, 4v - 24 = 5d. Is v + 0 - 100/(-4) prime? False Let c(h) = 38h3 + 5h*2 - 1. Let i(k) = k. Let j(s) = -c(s) - 4i(s). Is j(-2) a prime number? True Let l(h) = 385h - 9. Let a be l(5). Suppose d - 5d + a = 0. Is d composite? False Let b be (10 + -15)(-6)/10. Suppose br - 191 = 2r. Is r a composite number? False Let i be (2/4)/(2/24). Let o(n) = 157n + 6. Let q be o(i). Is (q/18)/(2/3) a prime number? True Let y(c) = 131c2 + 4c - 1. Is y(-2) prime? False Let d be (-18)/((1 - 0)-1). Suppose -2 = 4t - d. Suppose -t = -4x, 3x = 5s - 2x - 165. Is s prime? False Suppose -2g + 1 = 5o, 2o - 2 - 68 = 5g. Is (-834)/g4/2 composite? False Suppose -4s = -0s + 5o - 1311, -s = o - 329. Suppose s = 2t + 22. Suppose -x = 5a - t, -4a - x = 7 - 132. Is a a prime number? True Is (-3147)/(-4) - 3/(-12) prime? True Is 12504/(-36)(-9)/2 prime? False Let k(h) = -h2 - h. Let j(d) = d3 + 8d2 + 9d + 10. Let u(y) = -j(y) + 2k(y). Let z be u(-10). Is (-3)/2z/(-6) a prime number? False Suppose -3t + v + 2770 = 0, -2v - v - 4610 = -5t. Suppose t = 5w - 2z, 2w + 3z = 187 + 183. Is w a composite number? True Let s(t) = -t2 - 8t - 9. Let r be s(-6). Suppose -5h + 2 = rv - 4, 5v = -5h. Is (-22)/(3 - (-11)/v) a composite number? True Suppose f + 6s - 370 = 3s, -5f - 4s + 1872 = 0. Let t = f + -184. Is t/15 - (-1)/5 a prime number? True Let b be (-1482)/(-15) + 4/20. Suppose 0 = -3a - 3k + b, a + 5k = -2a + 99. Suppose -2q + 5 + a = 0. Is q a composite number? False Suppose 9275 + 2829 = 5n - 3t, 5t - 12080 = -5n. Is n a prime number? False Let v(p) = p2 - 23p - 49. Is v(-15) a composite number? False Is (1676/(5 - 3))/2 - 0 composite? False Suppose 0 = 3h + 2h - 395. Is h a prime number? True Let h(f) = 5f3 - 7f*2 + 13f + 35. Let v(p) = -3p3 + 5p*2 - 9p - 23. Let l(b) = -5h(b) - 8v(b). Let c be -1*(2 + 7 + -1). Is l(c) prime? False Let m = 485 - 81. Let c = -262 + m. Is c a composite number? True Let u(	{ "pile_set_name": "DM Mathematics" }
hird derivative of -741a3h*4 + 15a*3h + 52a3 - 19a*2h*4 - 10ah2 wrt h. -17784a*3h - 456a2h What is the second derivative of -447d5 + 85d3 + d2x2 + 3155dx2 - 3dx - x2 - 9x wrt d? -8940d3 + 510d + 2x2 What is the second derivative of 486n*3u*2 - 954n*3 + 8228nu2 - 6nu + 2u*2 - 2u - 2 wrt n? 2916nu*2 - 5724n What is the third derivative of -3h2i*3 - 5h*2i - 8037hi3 - i3 - 6i2 - 143i wrt i? -18h2 - 48222h - 6 What is the first derivative of -6948n2 - 47nr + 4r + 59604 wrt n? -13896n - 47r Find the first derivative of 1571h2 - 3hz2 - 353338z*2 wrt h. 3142h - 3z2 What is the second derivative of -o3p*3 - 44777o*3p - 26o2p + 235139op*3 + 7p*2 wrt p? -6o*3p + 1410834op + 14 Find the second derivative of -169859t2 + 57689t - 2 wrt t. -339718 Find the second derivative of -17oq*3 - 12oq2 + oq - o + 553q2 - q + 76022 wrt q. -102oq - 24o + 1106 What is the third derivative of 3n4 - 17609n*3 - 874957n*2 wrt n? 72n - 105654 Find the second derivative of -k*3 - 4k*2v + 7276k2 - 536kv - 75k + 6 wrt k. -6k - 8v + 14552 Find the third derivative of 4276c3h*3 + 20502c*2h*3 - ch + c wrt c. 25656h3 What is the third derivative of 33m*2o*2v3 + m2oz - 2mo*2vz - mov2z + 2510mv*3z + 1266o2 wrt v? 198m*2o*2 + 15060mz Find the third derivative of 8z*6 + 13z*5 + 3z4 + z3 - 365217z2. 960z*3 + 780z*2 + 72z + 6 Find the third derivative of 72p4q - 1328p3q - 171p2 - 404pq wrt p. 1728pq - 7968q What is the third derivative of -974318t3 - 3454t*2 + 23 wrt t? -5845908 What is the third derivative of 17211m*3 + 6360m*2 + 3 wrt m? 103266 Differentiate 1151870k + 968322 with respect to k. 1151870 Differentiate 10697q3z2 + q3z - 49236q*3 with respect to z. 21394q*3z + q*3 Differentiate 57m*4 + 1466m*2 + 5m + 4030072 with respect to m. 228m3 + 2932m + 5 Find the third derivative of -515167b3 - 33b*2 + 598b wrt b. -3091002 What is the third derivative of 20b3c*3 - 344b*3c*2m*3 + 2b*2c*3 + 2bc3m*3 - 16995bc3 wrt b? 120c*3 - 2064c*2m*3 Find the third derivative of -80168y*3 - 89y*2 - 13y - 4. -481008 What is the derivative of 3742t3 + t2 + t - 14943? 11226t*2 + 2t + 1 Find the third derivative of -10627j3s*2 - 2j*3v2 - j2sv*2 - 14803js2v - 2jsv2 wrt j. -63762s*2 - 12v2 What is the second derivative of -i2y3 + 8i*2y*2 - 386i*2y + i*2 + 59iy3 - i - 23y3 + y2 wrt i? -2y3 + 16y*2 - 772y + 2 Find the first derivative of 2l3m + 2l3 - l2m - 128lm + 65l + 105m - 4647 wrt m. 2l3 - l2 - 128l + 105 What is the first derivative of -128284x3 - 191241? -384852x*2 Find the second derivative of 2i*3mv3 - 10i*3mv - i3v - 32i2m + 1061i2v*3 + 2i*2v - 4mv wrt v. 12i3mv + 6366i*2v Find the second derivative of p*4 + 4p*3 + 475p*2 + 8324p. 12p2 + 24p + 950 What is the second derivative of 7c2r*2u + 9529c2r + c*2 - 5cr2u - 2cru + 3r*2u - 294r2 - 2u wrt r? 14c2u - 10cu + 6u - 588 What is the second derivative of -182a*5 - 98a*3u - 5au + 5a + 8u + 89 wrt a? -3640a3 - 588au Find the second derivative of 2h*3n*3 - 3h*3n + 72h3 + 356172hn3 + n3 + 3401 wrt n. 12h*3n + 2137032hn + 6n What is the third derivative of -4121f*4h - 101f3h + 3f2h + f*2 - 5867fh + 2h - 1 wrt f? -98904fh - 606h Find the first derivative of -2j*3 + 3447j*2 + 101j + 2665089 wrt j. -6j2 + 6894j + 101 Find the second derivative of -2a4 + 64a*3 - 17a*2 - 3643a - 5 wrt a. -24a2 + 384a - 34 What is the derivative of 17gz - 1197g - 154065z wrt g? 17z - 1197 Find the second derivative of -183062s*5 + 14054s wrt s. -3661240s3 What is the third derivative of -559a*5c*3 - 666a*3c*3 - 2a*2c*3 + 5ac3 + 21738c*3 wrt a? -33540a*2c*3 - 3996c*3 Find the third derivative of -74726s*5 + 161795s*2 wrt s. -4483560s*2 What is the derivative of 20k*3p + 8k3 - 13k*2p - 1952p + 63 wrt k? 60k*2p + 24k2 - 26kp What is the third derivative of 5947w5 - w4 + 2w2 + 22993w wrt w? 356820w2 - 24w What is the derivative of -17s2 + 1245s - 34755? -34s + 1245 What is the first derivative of 45a*2g - 29a2 + 10ag2 + 88768g*2 wrt a? 90ag - 58a + 10g2 Find the third derivative of -28697b*3o*4 - 248b*3o*2 - 53b*2o*2 wrt o. -688728b*3o Find the third derivative of -31d5 + 2d*4 + 4d*3 - 13d*2 + 16 wrt d. -1860d*2 + 48d + 24 Find the third derivative of -136216g4 - 92g*2 + 1488g. -3269184g Differentiate -70c*3n*2 - 3754c*3n - 81073c3 with respect to n. -140c*3n - 3754c3 Find the second derivative of 1002419j*2 + 620013j. 2004838 What is the derivative of 5aot2 - 9ao - 173at2 - 2a - 10ot*2 - 22t wrt o? 5at*2 - 9a - 10t2 What is the first derivative of -30667m*2oqw + 59m2ow + m2w - 2m2 + 632mow - 4mqw + oq wrt q? -30667m2ow - 4mw + o What is the second derivative of -156442m*2 + 167460m? -312884 What is the third derivative of h*6m - 48474h5m + 85413h2m wrt h? 120h3m - 2908440h2m What is the third derivative of -39987nu*6 - 2nu3 + 108nu2 - 13nu + 15u*2 - 3u wrt u? -4798440nu*3 - 12n Find the second derivative of -8963d3o3 - d3o2 - 2do3 - 6do + 36d - 3o2 wrt d. -53778do3 - 6do2 Find the third derivative of -345a*4x - 274a3x*3 + 47a*2x*3 - 2a*2 - 82ax3 wrt a. -8280ax - 1644x*3 What is the third derivative of -3z*4 + 1731z*3 + 4z*2 - 66z - 1 wrt z? -72z + 10386 Find the second derivative of 2555353k*4 + 7746k - 380 wrt k. 30664236k2 What is the third derivative of -85s*2y*3 - 2s*2y - 15sy*4 - sy*2 - 586y*2 wrt y? -510s*2 - 360sy What is the derivative of 45n*3t*3 - 30nt2v*2 - 4t*3v*2 + 80t*3v wrt n? 135n2t*3 - 30t*2v*2 Find the second derivative of 415609n*3 + 14n + 15738. 2493654n Find the first derivative of 1739y*4 + 3y - 13191. 6956y3 + 3 Find the second derivative of 45j*3 - 5116j*2 - j + 8598 wrt j. 270j - 10232 Find the third derivative of -d*3n*3 - 3d*3 + 456dn3 - 19n*3 + 4687n*2 wrt n. -6d*3 + 2736d - 114 Find the third derivative of g*6 - 9286g*5 - 34g*3 - 27941g*2 + 9. 120g*3 - 557160g*2 - 204 What is the second derivative of 2649243v*2 + 3146915v wrt v? 5298486 Find the first derivative of 512191m3q*3 - 2m*2q*3 - 3111486q*3 wrt m. 1536573m*2q*3 - 4mq3 Differentiate -ku*3 + 53ku2 - 87k + 823u3 - 2u + 2 wrt k. -u*3 + 53u*2 - 87 What is the third derivative of 20i*4 - 97803i*3 + 384628i*2 + 2i + 2 wrt i? 480i - 586818 Find the third derivative of -g4 - 2g*3h + 46317g3 + 16g*2h - 791h wrt g. -24g - 12h + 277902 What is the second derivative of 93375v*4 + 132483v wrt v? 1120500v2 Find the second derivative of 41i*3t*2 - 1050i*3 + 21i*2t*2 + 3i*2 + 6it2 - 5it wrt t. 82i*3 + 42i*2 + 12i Find the second derivative of -421761x2 + 21722x - 5 wrt x. -843522 Differentiate l*3 + 353l*2 - 78l + 69505. 3l2 + 706l - 78 Find the third derivative of -1825g4 - 2g*3 + 269351g*2 wrt g. -43800g - 12 Differentiate -175833q + 179404 wrt q. -175833 Find the second derivative of 1106b*3 + 3b*2 + 16471b wrt b. 6636b + 6 What is the third derivative of -121023l*6 - 76734l*2 wrt l? -14522760l*3 Find the first derivative of 661c*3s + 87c3 + 6c*2 - 44cs - c - s + 135 wrt s. 661c*3 - 44c - 1 Find the second derivative of -3194l3 + 20l*2 + 209652l wrt l. -19164l + 40 What is the derivative of -65399y*2 - 55461? -130798y Find the second derivative of h*3 - 54738h*2 - 186h - 287 wrt h. 6h - 109476 Find the second derivative of 186b*2m*3 + 396b*2m*2 - 1244bm3 - 4bm2 wrt b. 372m*3 + 792m**2 Find t	{ "pile_set_name": "DM Mathematics" }
9 Rearrange (154 - 154 - 9d3)(7d - 7 + 7) + (2d*3 - 5d3 + d3)(-2d + 2d - 2d) to pd3 + yd + h + rd2 + nd*4 and give n. -59 Express 65o*2 + 71o*2 - 137o*2 + 18o*3 + 12o - 9o3 as t + wo*3 + xo*2 + so and give s. 12 Rearrange (0g2 + 2g2 + g2)(3 - 1 - 3 + (-2 + 8 + 0)(-5 + 2 + 1) - 2 + 2 - 2 + (-4 + 2 + 1)(2 + 2 - 3)) to hg + m + ug2 and give u. -48 Rearrange 424u*3 + 4u*2 - 207u*3 - 4u*2 + 20 - 2u - 208u3 + 2u*4 to lu + tu4 + mu*3 + yu*2 + s and give m. 9 Rearrange ((2 - 2 - v)(6 - 12 + 3) - 6v + 9v + 5 - 2v)(3 - 2 + 0) + v + 2v - v to zv + n and give z. 6 Rearrange (18c + 0c - c)(2 - 5 + 7)(5c - 3c - c)(20 - 20 - 3c*2) to the form gc*4 + a + sc*2 + jc*3 + zc and give z. 0 Express (2z2 + 2z*2 - 3z*2)(0 + 1 + 0) - 2z2 - z2 + z2 - 6z*2 + 4z*2 + 8z*2 - 15 + 15 + 11z*2 in the form yz + az2 + v and give a. 16 Express -2 - 59 + 45 + 11 + 41a + (-1 + 4 - 4)(-3 + 3 + 2a) + a - 1 + 1 as ca + r and give c. 40 Rearrange 4u*2 + 6 - 4u*2 - 2u + 12u2 - 4 to the form z + hu*2 + gu and give z. 2 Express -36x2 + 26x*2 - 77 + 156 - 74 in the form jx*2 + qx + f and give j. -10 Express -2j - 143j*2 + 601j*2 - 217j*2 - 156j2 - j4 - 210j2 + 2 in the form b + qj*4 + pj*3 + tj + mj2 and give q. -1 Express (900t - 900t + 14t*3)(2 + 4t - 2) + 0t*4 + 0t*4 - 5t*4 as gt*3 + n + it*4 + wt + qt2 and give i. 51 Express (3 - 1 + 2)(-l*2 + 2l*2 + 2l2 - l2 + 2l2 + l2 + (-2l + 1 - 1)(5l - 28 + 28)) as sl + v + al*2 and give a. -20 Rearrange (-3y + y + 3y + (3 - 4 + 3)(-2y + 0y + 0y) - y - 3y + 5y - 2 + 2 - y - 9y + 0 + 0)(0 - 3 + 5)(5y + 1 - 1) to n + qy*2 + cy and give q. -120 Rearrange (-1119a + 450a + 533a)((-1 + 2 - 3)(-4a2 - a2 + 3a2) + 6a2 - a2 - a*2) to oa*3 + ja + za2 + v and give o. -1088 Rearrange (-33l*2 + 3l + 70l2 - 34l*2 + 2)(-l - l - l) to the form ul2 + yl + zl3 + v and give u. -9 Express -31w*2 + 14w*2 + 14w*2 - w - 11 + 8 as kw + r + ow2 and give k. -1 Express o + 0o - 1960o3 + 1293 - 1293 as s + fo + co2 + xo*3 and give x. -1960 Rearrange -4 - 4q + 132q2 + 0q + 138q2 + 2q*4 - 328q*2 + 3q to the form nq + lq*4 + jq*3 + bq*2 + u and give b. -58 Rearrange -137n + 54n + 51n + 58n + 8n*2 to the form cn + qn2 + t and give c. 26 Express (34 + 2487h - 34 + 537h + 108h)(0 - 2h + 0) as l + ah + ch*2 and give c. -6264 Rearrange -2g*3 - 9g + 248g2 - 432g*2 + 8g + 273g2 to kg + bg2 + cg*3 + l and give c. -2 Rearrange -424l*3 + 2 + 306l*3 + 3l - 3l to bl*3 + fl + m + yl2 and give m. 2 Rearrange -494 + 33z*3 + 3z*3 + 4z*4 + 495 to tz + k + xz2 + hz*4 + fz*3 and give x. 0 Express -2u + 22u2 - 135u*2 - 164u*2 as su*2 + m + ku and give s. -277 Rearrange -6 - 2x + 19 - 2x*2 - 3x - 2 + x*3 + 6 to v + ox*3 + ux*2 + zx and give v. 17 Express -47t + 149t - 106t - 79 as mt + j and give m. -4 Express -287449r2 + 4 - 2 + 287591r*2 as w + fr + vr2 and give v. 142 Express 1 - 789q + 395q + 398q in the form hq + c and give h. 4 Rearrange -47w + 31w - 25w - 57w to jw + l and give j. -98 Rearrange 57h3 + h - h4 + 61h*3 + 10 - 120h*3 to oh*3 + gh + bh4 + ph*2 + j and give b. -1 Express -39z - 82z - 159z in the form v + iz and give i. -280 Rearrange (2 + 8h + 0h - 4h)(-2 + 2 + h)(-12 + 11 + 44) to l + fh + oh*2 and give o. 172 Express -31m + 19673 - 19673 + (2 + 0 + 0)(-3 + m + 3) + 3 - 3 + 3m as om + i and give o. -26 Express (-2 - 4 + 4)(2 + 0 + 0)(2496m + 1136m + 587 - 586) as im + j and give i. -14528 Express -117u2 - 104u*2 + 22u*2 - 22u*2 in the form m + iu*2 + vu and give i. -221 Express (-745 + 197m + 745)(m3 - m3 + 2m3)(0 - 1 - 1) in the form xm + sm*3 + nm*4 + t + qm*2 and give x. 0 Express -2m*2 + 0m*4 + 2m*2 - 1 - 3m - 2m4 - m3 in the form um + cm2 + pm*4 + om*3 + r and give r. -1 Express ((-2g + 0 + 0)(-2g + 0g - g) + (-4g - g + 2g)(-5 + 5 - g))(9g + 2g - 10g - 1) as mg3 + q + og*2 + cg and give m. 9 Rearrange -120 + 120 + 44d3 + (-2 - d + 2)(-d*2 + 3d2 - d2) + d*3 + 1 + 1 - 5d*3 to the form qd*2 + vd + z + bd3 and give q. 0 Rearrange 1399i + 1 - 2 + 1389i - 2780i + 14i3 to the form hi*3 + a + vi*2 + ui and give h. 14 Express (182 - 182 + 21d)(0d + 2d + 0d)(3d - 3d - d*2) - 12d*4 - d + d in the form x + od*2 + hd*3 + rd*4 + kd and give r. -54 Express (403i3 + 8i*2 - 390i*3 + 10i - 12i)(i - 4i + 4i) as ni2 + yi*4 + r + ai + oi3 and give n. -2 Express 42y*2 - 38y2 - y3 - 5 - y - y*4 + 6y*2 in the form cy*3 + gy*2 + ty*4 + k + uy and give u. -1 Express 8x - 98 + 6x + 19 - 13x as cx + v and give v. -79 Rearrange 19 - 19 + 24q + (6q + 0q - 4q)(-2 + 0 + 1) + 2q - 2q + 2 - 3q to the form iq + s and give s. 2 Express (8y - 14y + 9y)(1 + 4 - 12)(-2 + 0 + 4) in the form jy + v and give j. -42 Express -712t + 82 - t*2 - 339 + 712t as w + bt2 + st and give b. -1 Express 124w - 14 + 63w - 155w in the form yw + o and give y. 32 Express (-2q + 3q + q)(-7 + 7 - 3q)(1 - 1 + q + (3q + 0q - q)(-1 + 2 + 0) - 4q + 3q - 6q) as yq*3 + i + vq*2 + nq and give y. 24 Rearrange (2a + a - 15a)(2 - 3 + 2)(-2 - 2 + 0) - a + 4a + 0a + (4a + 2a - 5a)(1 + 0 + 1) + 2 + 3a - 2 to r + oa and give o. 56 Express (0 + 14p + 0)(-68 + 28 + 31) as f + ap and give a. -126 Express -3h*4 + 1 + 5h*4 - 2h*4 + 11h3 - h4 - 12h3 + 4h + 2h2 as q + ch*4 + ih*3 + zh*2 + fh and give i. -1 Express 9t3 - 98t*2 - 2t*3 + 9t - 11t3 + 101t*2 - 47t in the form dt3 + ot*2 + i + yt and give o. 3 Rearrange (-c + c + 4c4)((6 + 2 - 2)(3 - 3 - 3) + (3 - 3 - 1)(1 - 1 + 2) - 3 + 0 + 1) to ic3 + wc*4 + vc*2 + oc + m and give w. -88 Rearrange 18 - 53 - 425o3 + 33 - o2 to wo*2 + ko + lo3 + y and give y. -2 Rearrange -48l*3 + 145l3 - 5 + l2 - 2l2 - 2l*2 + 5l2 + l4 to sl3 + pl*4 + zl*2 + gl + i and give s. 97 Express -763 + 253 + 253 + 248 + 2w2 in the form vw + m + sw2 and give s. 2 Express (0n + 0n + n)(18890 - 37790 + 552n + 1528n + 18900) as i + jn2 + sn and give j. 2080 Express (6 + 3 - 2)(-6w + 0w + 3w + (-4w + 4w + 2w)(1 - 2 + 4)) as l + fw and give f. 21 Rearrange 0s*2 - 1112s + 1111s + 13 - 2s*3 - 6s*2 to the form ks + ls3 + as2 + w and give l. -2 Rearrange -x3 + x*2 + 47x + 13x2 - 7x*2 - 6x*2 to r + lx + ux3 + kx*2 and give l. 47 Express 236y*2 - 86y*2 - 33y*2 + (2 + 2 - 7)(-2y2 + 0 + 0) - 4y2 + y2 + 2y2 in the form p + hy*2 + ly and give h. 122 Rearrange 11b2 + 8b*2 + 18b*2 - 3b*2 - 4 to the form w + mb + sb2 and give s. 34 Rearrange (9 - 23 + 8)(2 + 0 - 3)(0r + 11r + 0r) to f + sr and give s. 66 Rearrange (1 - 2 + 5)(-3 - 2 + 0)(2 - 5 + 0)(1 - c - 1) + c + 3c - 3c + (-1 + 1 + 2)(0 + 0 + 2c) to the form g + sc and give s. -55 Rearrange ((-c + 2c - 2c)(1 + 2 - 4) - 5c - 4 + 3 + 0)(-1226 + 1226 + 391c) to bc + kc2 + a and give b. -391 Rearrange (1 - 6 + 3)(6l4 - 3l4 - l4) - l*4 + 2l*3 - 2l*3 - 178l*4 + 177l*3 - 177l*3 to r + il*3 + sl*2 + pl + yl4 and give y. -183 Express (1 - 5 + 2)(-104 - 14d + 9d + 4d) as g + qd and give q. 2 Express 1 + 71l - 4 + 4 - 6 + 10l as sl + o and give s. 81 Express -3 - 2897m + 2897m - 667m*2 + 3 as zm + vm2 + b and give v. -667 Rearrange -3o - 64o3 + 7o*2 + 3o + 73o3 to ao*3 + r + yo*2 + co and give c. 0 Rearrange (5 + 2 - 5)(-2 + a + 2) + (145 + 224 - 217)(0 + 0 + a) to the form c + ya and give c. 0 Rearrange -3 + 2z + 3 + (0 + 0 - 2z)(-6 + 4 + 0) - 5z - z + 5z - z - 36 + 36 + (1 - 4 + 0)(5z + 3z + z) to the form vz + f and give v. -23 Express (4x - 5x + 6x)(-489x2 - 531x*2 + 960x*2 + 2x) + 0x - 2x*3 + 0x as zx3 + k + cx + yx2 and give c. 0 Rearrange 2s**3 -	{ "pile_set_name": "DM Mathematics" }
16 = -2u. Let q = g - -4. What is the units digit of q? 8 Let a(n) = -n2 + 22n - 40. What is the tens digit of a(14)? 7 Suppose -5i + 7 = -3. What is the units digit of -1 + 9 - i - -3? 9 What is the tens digit of (-2)/((-4)/6) - (-80 - -2)? 8 Let v = 1 - -7. Suppose -v = -r - 4x + 5, -3x + 10 = r. What is the units digit of r? 1 Let r(j) = j3 - 7j*2 - 5j - 8. Let s be r(8). Suppose 3g = -f + 31, -g + 4f = g - s. What is the tens digit of g? 1 Suppose 3q = 22 + 5. Suppose 0 = -3l - q, 3a + 4l - 36 = 2l. What is the units digit of (a + 2)(-2)/(-4)? 8 Let a = 704 + -427. What is the tens digit of a? 7 Let s = 20 - -55. What is the tens digit of s? 7 Suppose t + 0t - 3 = 0. Suppose tr - 1 = 2. What is the units digit of r? 1 What is the units digit of -1(4 + 26/(-6))153? 1 Let v(n) = n*3 + 6n*2 + 5n - 2. Let h be v(-5). Let a be (h/6)/(1/(-12)). What is the units digit of (-10)/a(1 - 3)? 5 Suppose -4d - 134 = -2f, 61 = f - d - 1. What is the tens digit of f? 5 Suppose -2y + 0y = -18. What is the units digit of ((-6)/4)/(y/(-30))? 5 Let m be (2/6)/(1/6). Suppose -2t = 4l, t - m = -l - 0t. Let o = l - -3. What is the units digit of o? 1 Let j be -1 - -4(-1 - -3). Let g = 13 - j. What is the units digit of g? 6 Suppose -21 = -4h + 4y + y, -2h + y = -15. Suppose 5z = h + 1. What is the units digit of z? 2 Let d = 4 + 0. Let h(a) = -a2 + 3a*2 + 6 + da - 3a2. What is the units digit of h(5)? 1 Suppose -2x + g - 2 = 0, g = -3x + 6g - 10. Suppose -w + 5 - 1 = x. What is the units digit of w? 4 Suppose h - 6 = -2h, -4l + 2h = -168. What is the units digit of l? 3 Let u(o) = -6o - 12. What is the units digit of u(-5)? 8 Let q be 3/1 + (-12)/6. Let u be q/(-1) - (4 - 2). Let r(z) = -z*3 - 2z2 + 1. What is the units digit of r(u)? 0 Suppose -v - 5 = -42. What is the tens digit of v? 3 Let i(g) = -g3 - 5g2 + 6g + 2. Let a be i(-6). Let m(b) be the first derivative of b*4/2 - 2b*3/3 + b - 7. What is the units digit of m(a)? 9 Let x = -86 - -162. What is the tens digit of x? 7 Let c be ((-7)/14)/((-1)/6). Let t = 6 + -6. Suppose 0 = cu - 5h - 4, t = -3h + 2h + 1. What is the units digit of u? 3 Let c = -4 - -7. Let p = c - 1. Let r = 4 - p. What is the units digit of r? 2 Let i = 98 + -52. Let p = -32 + i. What is the units digit of p? 4 Let r(q) = -2q + 0q2 + 1 + q2 - 2q*2. Let p be r(-2). What is the units digit of 4 + 0 - (p - 0)? 3 Suppose 4q = -m + 434, 2m + 331 = 5q - 2q. What is the hundreds digit of q? 1 What is the units digit of (-109)/(-4) + (0 - (-1)/(-4))? 7 Let n(l) = 5l*2 - 6l. Let s be n(4). What is the units digit of (1/(-2))/((-1)/s)? 8 Let c = -6 - -4. Let u = c - -3. Let y = 0 + u. What is the units digit of y? 1 Let i = -1 + 1. Suppose -h + 3u + 11 = i, u + 17 = -0h + 2h. What is the units digit of h? 8 Let h = -140 + 262. What is the tens digit of h? 2 Let a = -8 + 5. Let y = -2 - a. What is the units digit of y? 1 Let v = 26 + -36. Suppose -7 = 5q + 3m + 28, -3q = m + 17. What is the units digit of v/(q + 6/3)? 5 Let d(i) be the third derivative of i6/120 - i5/20 + i*4/12 + 5i*3/6 - 4i*2. What is the units digit of d(4)? 9 Suppose 19 - 5 = 2j. Let f be 32/(-3)-1. Let l = f + j. What is the units digit of l? 9 Let o be (1 - 3)/(2/5). Let k = o - -2. What is the units digit of 16/6 - (-2)/k? 2 Let h(r) = r*3 + 12r*2 - 13r - 38. What is the units digit of h(-12)? 8 Let i(u) = -u + 24 + 4u2 - 10u*2 + 5u*2. What is the tens digit of i(0)? 2 Suppose -2w - 3d + 46 = -6d, -2w = -4d - 46. What is the tens digit of w? 2 Suppose -3o - 3o = -294. What is the units digit of o? 9 Suppose -3c + 6p = 2p + 6, -2c - 8 = -4p. Suppose 4b - c - 2 = -4w, -5b = -w + 19. What is the units digit of w? 4 Let u be 0 + -2 - 0/1. Let z be 3/((-9)/(-15)) + u. Suppose 35 = 2b + zb. What is the units digit of b? 7 Let i(l) = -l + 47. What is the tens digit of i(0)? 4 Suppose -11d + 15d - 112 = 0. What is the tens digit of d? 2 Let n(q) = -q*2 + 10q + 14. Let y(j) = j*2 + j - 2. Let l be y(3). What is the units digit of n(l)? 4 What is the hundreds digit of (1 - (-33)/(-9))15-4? 1 Suppose 2x + 1 = -1. Let y be 15 + x + 0 + 1. Suppose f = 2f - y. What is the tens digit of f? 1 Suppose 4u = 3g + 103, 5u + 0u - 3g = 125. Suppose -2t + 3h - 2h + 7 = 0, -3t - u = 5h. What is the units digit of (t - -6 - 1) + 1? 7 Suppose -3t + 0k = -2k - 15, -k + 3 = 2t. Suppose tu + 3r + 54 + 24 = 0, -u + 5r = 2. What is the units digit of -2 - u(-1)/(-2)? 9 Let w(j) = j3 + 9j*2 - j + 4. Let o be (-6)/24 - (-35)/(-4). What is the units digit of w(o)? 3 Suppose 3v + 23 + 19 = 0. Let g be (v + -2)-1 - -2. Suppose -j - 2t = j - g, j + 4t - 15 = 0. What is the units digit of j? 7 Suppose 11 = -l - 30. Let y = 65 + l. What is the units digit of y/3 - (-4)/2? 0 Let u(h) = 8h + 6. What is the units digit of u(4)? 8 Let b(v) = v*2 + 13v + 76. What is the tens digit of b(-21)? 4 Let m = -104 - -230. What is the tens digit of m? 2 Suppose -4b + 15 = -b. Suppose l - bl + 36 = 0. What is the units digit of l? 9 Let p = -2 + 46. What is the units digit of p? 4 Suppose 2 = 4f + 2l - 0l, 5l = -2f + 21. Let p = -2 - f. Suppose 2m - 10 + 2 = p. What is the units digit of m? 4 Suppose -5w + 2l + 875 = 0, -5w + 3l + 547 + 323 = 0. What is the units digit of w? 7 Let l(y) = -y*2 + 5y + 8. What is the units digit of l(0)? 8 Let d(l) = -7l2 - 3 - l3 + 2l*2 + 2l*2. Suppose 0 = 5w - 3w + 8. What is the units digit of d(w)? 3 Suppose -3k + 0g + 9 = g, -2k - 2g + 6 = 0. Suppose -kn - 3 = 2s - 32, 3 = 3s. What is the units digit of n? 9 Suppose 6h + 242 = 8h. What is the units digit of h? 1 Suppose -2w + 17 + 15 = 0. Suppose 3i + 0i = 0, i - w = -4k. Suppose -ku + 100 - 20 = 0. What is the tens digit of u? 2 Suppose -u - 14 = -5p, 0u - 4u = 4p + 80. Let h = u + 35. What is the units digit of h? 6 Let z = -49 - -94. What is the units digit of z? 5 Let r(o) be the second derivative of o5/20 - o4/2 - o3/2 + 3o*2 + 5o. What is the units digit of r(7)? 4 Let x(t) = t*3 + 3t*2 - 2t. Let f be x(-4). What is the units digit of f/(-20) - (-76)/10? 8 Suppose 3l - 102 = -3q, q + 3l - 32 = -0l. What is the tens digit of q? 3 Let o = 70 + -39. What is the units digit of o? 1 What is the tens digit of (-340)/(-6) - 2 - (-10)/(-15)? 5 Let i(r) = r*3 + 7r*2 + 4r - 4. What is the tens digit of i(-5)? 2 Let t = -2 - -2. Suppose tv - 3v = 9. Let d = 8 + v. What is the units digit of d? 5 Suppose -12v + 7v = -160. What is the units digit of v? 2 Let y(p) = p*2 + 5p + 9. What is the units digit of y(-8)? 3 Let a be 4/(-10) + 54/10. Suppose 3r - ac - 49 = 0, 0 = r + 2c + 2 - 0. What is the units digit of r? 8 Let s = 32 + -33. Let u(a) = -4a*3 - a - 7a*3 + 0a3. What is the units digit of u(s)? 2 Let n(t) = -t3 - 7t2 + 9t + 10. Let h be n(-8). Suppose ho + 30 = -2s - 2s, o - s = -18. Let b = -8 - o. What is the units digit of b? 9 Suppose -3y + 18 = 3. Suppose 0 = -yd - 3w + 16, -w + 3 = 1. What is the units digit of (0 - -2)/d + 5? 6 Let q be 6(1 - 8/4). Let x = q - -25. What is the tens digit of x? 1 Suppose 0 = 5f - 2f - 36. What is the tens digit of f? 1 Suppose -3s + 112 = s. What is the tens digit of s? 2 Suppose -5b = -2d - 275, 2d = 3b - 205 + 36. Suppose 3n - b - 28 = 0. What is the tens digit of n? 2 Let p = 110 - -4. What is the units digit of p? 4 Let j(n) = n3 + 4n*2 - 3n - 2. What is the units digit of j(-4)? 0 Let u(j) = j*3 - 2j*2 + 2j - 1. Let m be u(1). Suppose -5g = -5x + 85, -x + 3g = -mg - 25. What is the tens digit of x? 1 Let f(z) = -z*3 + 8z*2 - 4z + 7. What is the tens digit of f(7)? 2 Suppose 28 = p - 30. What is the units digit of p? 8 Let l be (2/5)/((-1)/40). Let d be (l/(-6))/(2/3). Suppose -dn + 4j + 56 = 0, 0n = 2n - j - 33. What is the units digit of n? 9 Let z(s) = 4s2 + 5s - 2. Suppose 2 = 2n - 0n. Let h(f) = -f*2 - f. Let i(l) = nz(l) + 3h(l). What is the units digit of i(2)? 6 Let g be ((-5)/10)/(2/(-8)). Suppose gf + 3*a + 11 = 2, -2 = f + a. What is the units digit of f? 3 Let o(l) be the second de	{ "pile_set_name": "DM Mathematics" }
hat are the prime factors of 33791? 33791 List the prime factors of 165227. 127, 1301 What are the prime factors of 377576? 2, 109, 433 List the prime factors of 448215. 3, 5, 29881 List the prime factors of 310290. 2, 3, 5, 10343 List the prime factors of 35275. 5, 17, 83 What are the prime factors of 212211? 3, 17, 19, 73 List the prime factors of 192908. 2, 29, 1663 What are the prime factors of 524181? 3, 7, 109, 229 List the prime factors of 108302. 2, 54151 What are the prime factors of 18780858? 2, 3, 367, 2843 List the prime factors of 6643622. 2, 653, 5087 List the prime factors of 4088579. 11, 53, 7013 What are the prime factors of 252611? 252611 List the prime factors of 288911. 7, 149, 277 List the prime factors of 557361. 3, 7, 983 What are the prime factors of 115409? 7, 16487 List the prime factors of 808401. 3, 11, 17, 131 What are the prime factors of 8147680? 2, 5, 50923 What are the prime factors of 823739? 7, 16811 What are the prime factors of 860770? 2, 5, 86077 What are the prime factors of 5066952? 2, 3, 11, 17, 1129 What are the prime factors of 61091? 61091 List the prime factors of 9265243. 13, 712711 What are the prime factors of 18806? 2, 9403 List the prime factors of 6717479. 6717479 What are the prime factors of 5521891? 5521891 What are the prime factors of 18594726? 2, 3, 701, 4421 What are the prime factors of 5099103? 3, 566567 What are the prime factors of 173429? 173429 List the prime factors of 3654813. 3, 17, 71663 List the prime factors of 253965. 3, 5, 16931 List the prime factors of 307622. 2, 7, 43, 73 What are the prime factors of 1289568? 2, 3, 7, 19, 101 List the prime factors of 2690803. 2690803 What are the prime factors of 86178? 2, 3, 53, 271 List the prime factors of 11901710. 2, 5, 61, 109, 179 List the prime factors of 57142. 2, 28571 What are the prime factors of 4001840? 2, 5, 50023 What are the prime factors of 1682969? 853, 1973 What are the prime factors of 1229625? 3, 5, 1093 What are the prime factors of 7908249? 3, 223, 11821 What are the prime factors of 617903? 11, 13, 29, 149 List the prime factors of 4836657. 3, 7, 109, 2113 List the prime factors of 4052536. 2, 37, 13691 List the prime factors of 176580. 2, 3, 5, 109 List the prime factors of 75315. 3, 5, 5021 What are the prime factors of 1062279? 3, 17, 53, 131 List the prime factors of 356922. 2, 3, 79, 251 What are the prime factors of 304101? 3, 7, 1609 What are the prime factors of 8501061? 3, 2833687 What are the prime factors of 1188570? 2, 3, 5, 39619 List the prime factors of 571365. 3, 5, 12697 What are the prime factors of 530587? 17, 23, 59 List the prime factors of 2928918. 2, 3, 488153 List the prime factors of 706482. 2, 3, 7, 89 List the prime factors of 2320458. 2, 3, 7, 55249 What are the prime factors of 745341? 3, 248447 List the prime factors of 513156. 2, 3, 7, 41, 149 What are the prime factors of 10979671? 17, 23, 28081 What are the prime factors of 371810? 2, 5, 37181 List the prime factors of 97389. 3, 3607 List the prime factors of 870797. 211, 4127 List the prime factors of 13432997. 13432997 What are the prime factors of 993702? 2, 3, 165617 What are the prime factors of 35253? 3, 3917 What are the prime factors of 1104923? 47, 23509 List the prime factors of 157163. 157163 What are the prime factors of 285408? 2, 3, 991 What are the prime factors of 1150180? 2, 5, 131, 439 What are the prime factors of 4590106? 2, 2295053 What are the prime factors of 478126? 2, 11, 103, 211 What are the prime factors of 1136751? 3, 7, 11, 19, 37 List the prime factors of 513763. 31, 16573 List the prime factors of 25371. 3, 2819 What are the prime factors of 7951062? 2, 3, 7, 189311 What are the prime factors of 7743516? 2, 3, 11, 5333 What are the prime factors of 224024? 2, 41, 683 List the prime factors of 7838129. 13, 67, 8999 List the prime factors of 22781802. 2, 3, 17, 149, 1499 List the prime factors of 8744648. 2, 11, 99371 List the prime factors of 3549320. 2, 5, 89, 997 What are the prime factors of 11604089? 7, 29, 57163 What are the prime factors of 610484? 2, 7, 21803 List the prime factors of 14641209. 3, 11, 49297 What are the prime factors of 640009? 640009 What are the prime factors of 9225630? 2, 3, 5, 47, 727 List the prime factors of 302714. 2, 151357 List the prime factors of 77049. 3, 7, 1223 What are the prime factors of 1126316? 2, 281579 What are the prime factors of 193084? 2, 48271 What are the prime factors of 10784639? 10784639 List the prime factors of 1366662. 2, 3, 11, 20707 What are the prime factors of 1128938? 2, 163, 3463 What are the prime factors of 930960? 2, 3, 5, 431 List the prime factors of 10889713. 10889713 List the prime factors of 130448. 2, 31, 263 List the prime factors of 31935. 3, 5, 2129 What are the prime factors of 400774? 2, 11, 18217 List the prime factors of 12253392. 2, 3, 85093 List the prime factors of 620572. 2, 167, 929 List the prime factors of 3051730. 2, 5, 11, 27743 List the prime factors of 236667. 3, 78889 What are the prime factors of 179098? 2, 149, 601 List the prime factors of 1269427. 1269427 List the prime factors of 5954204. 2, 139, 10709 What are the prime factors of 541064? 2, 47, 1439 What are the prime factors of 277925? 5, 11117 What are the prime factors of 9638685? 3, 5, 7, 37, 827 What are the prime factors of 361129? 239, 1511 List the prime factors of 649083. 3, 23, 409 List the prime factors of 4725051. 3, 23, 31, 47 What are the prime factors of 3707065? 5, 741413 List the prime factors of 1034482. 2, 517241 What are the prime factors of 4426778? 2, 2213389 What are the prime factors of 10130? 2, 5, 1013 What are the prime factors of 5869969? 7, 59, 61, 233 List the prime factors of 29214513. 3, 29, 12437 What are the prime factors of 46093? 46093 What are the prime factors of 6036? 2, 3, 503 List the prime factors of 3160817. 11, 287347 What are the prime factors of 1587627? 3, 127, 463 List the prime factors of 201173. 7, 29, 991 List the prime factors of 5649905. 5, 31, 36451 What are the prime factors of 527070? 2, 3, 5, 17569 What are the prime factors of 1864621? 11, 337, 503 What are the prime factors of 41885? 5, 8377 List the prime factors of 974309. 7, 139187 What are the prime factors of 60393? 3, 41, 491 What are the prime factors of 32530913? 32530913 List the prime factors of 83169. 3, 9241 List the prime factors of 633141. 3, 103, 683 List the prime factors of 9488667. 3, 3162889 What are the prime factors of 81235? 5, 7, 11, 211 List the prime factors of 3979818. 2, 3, 221101 List the prime factors of 907041. 3, 19, 15913 List the prime factors of 5353262. 2, 113, 23687 What are the prime factors of 879912? 2, 3, 11, 101 What are the prime factors of 29194149? 3, 53, 183611 List the prime factors of 2827121. 11, 43, 139 What are the prime factors of 372542? 2, 186271 What are the prime factors of 307139? 7, 17, 29, 89 What are the prime factors of 9311555? 5, 11, 15391 What are the prime factors of 100082? 2, 163, 307 List the prime factors of 893422. 2, 103, 4337 List the prime factors of 1289190. 2, 3, 5, 7, 877 List the prime factors of 8169. 3, 7, 389 List the prime factors of 22453732. 2, 7, 41, 19559 What are the prime factors of 7303743? 3, 270509 List the prime factors of 8455656. 2, 3, 11, 32029 What are the prime factors of 11790941? 11790941 List the prime factors of 51935. 5, 13, 17, 47 List the prime factors of 24711. 3, 8237 List the prime factors of 1318646. 2, 7, 131, 719 What are the prime factors of 655374? 2, 3, 109229 List the prime factors of 257016. 2, 3, 10709 What are the prime factors of 9266757? 3, 149, 20731 List the prime factors of 11574134. 2, 11, 13, 283 List the prime factors of 16863586. 2, 8431793 List the prime factors of 1331565. 3, 5, 88771 What are the prime factors of 11619799? 11619799 What are the prime factors of 244569? 3, 13, 6271 What are the prime factors of 1246305? 3, 5, 19, 4373 What are the prime factors of 288530? 2, 5, 11, 43, 61 What are the prime factors of 1439312? 2, 7, 71, 181 What are the prime factors of 126189? 3, 7, 2003 List the prime factors of 121739. 23, 67, 79 List the prime factors of 2567074. 2, 1283537 List the prime factors of 6295497. 3	{ "pile_set_name": "DM Mathematics" }
ivide j? True Let n be (8/10)/((-2)/45). Let c = -7 - n. Let b(v) = -2v2 + 29v + 7. Is b(c) a multiple of 14? True Let d = 13 + -9. Suppose 0u = -ds - 3u + 31, 2u = 3s - 2. Suppose sp = -h + 209, 4p - 5h = -h + 184. Is 10 a factor of p? False Is 30 a factor of (3/7)/1 - (-12197514)/8134? True Let m(c) = -c3 - c2 - 9c - 33. Let u be m(-3). Is 12 a factor of (u/7)/((-10)/9660-2)? True Let d(u) = -2u + 4. Let h be d(0). Suppose -258 = -g + 4i - 2i, -1060 = -hg + i. Suppose -9a + 7a = -g. Does 19 divide a? True Let g(z) = z*3 + 12z*2 + 7. Let v be g(-12). Suppose -vs + 3s + 2l - 146 = 0, s + l = -44. Let q = 85 + s. Is q a multiple of 42? False Let x(i) = 3i - 20. Let y be x(9). Let o(q) = -q2 - 3q - 10. Let b be o(y). Is (-2 - b/(-14))308/(-33) a multiple of 15? False Let x = -3 - -9. Is (356/(-7))/(x/(-21)) a multiple of 31? False Suppose -11z + 8z - 6 = 0, -z + 22 = 3i. Suppose 0 = 3u + 9h - ih - 1795, -2390 = -4u - 2h. Is 8 a factor of u? True Let b = -31850 + 34812. Does 3 divide b? False Is 16 a factor of (-103 - -99) + 926/2? False Let i be -6 + 1 + (12 - 0). Suppose ix - 2343 + 404 = 0. Is x a multiple of 17? False Suppose 2h - 6 = -2g, -7 - 21 = -h + 4g. Suppose 0 = hw - 4w - 0w. Suppose w = -2k + 49 + 45. Is k a multiple of 19? False Suppose 4v + 5 = 9v, 0 = -2x - 4v + 24. Let i(n) = 19n + 82. Is i(x) a multiple of 14? False Let v = 12257 - 7990. Is v a multiple of 17? True Let z(w) = w*3 + 8w*2 + 8w + 17. Let k(g) = g*3 - 5g*2 + 5g + 6. Let o be k(3). Suppose -3f - 3 = 3n, 19 = -of - 3n + 4n. Is 14 a factor of z(f)? False Suppose 0 = 3o + 15 + 15. Let g be (o - -20)((-3)/(-2) + -1). Does 24 divide (-1062)/(-27) - (2 + g/(-3))? False Suppose -2h + 3i + 172 = -i, 0 = h + 2i - 74. Let r = h + -32. Is r a multiple of 24? True Suppose 4z - 5y = 26517, 4z - 26509 = 3y - 6y. Is 2 a factor of z? True Let a = 7 - 2. Suppose -j = h - 142, -3j + 141 + 573 = ah. Does 12 divide h? True Let w(u) = 3u2 - u2 - 5u - 23 + 8u - 18u. Let q(c) = c3 - 7c*2 + 52c - 263. Let f be q(6). Is w(f) a multiple of 8? True Suppose 0v + 3v = 5b + 19, -2b - 3v - 16 = 0. Let o be 47/5 - (-2)/b. Let x = 54 - o. Does 15 divide x? True Let r(i) = -i3 + i2 + 4i - 3. Let m = -148 - -126. Let p(o) = o*2 + 21o - 28. Let b be p(m). Is r(b) a multiple of 22? False Suppose 5j = -j + 84480. Suppose -56b - j = -72b. Is 20 a factor of b? True Let n(u) = -u2 - 12u + 30. Let d be n(-6). Suppose -61z = -dz + 2535. Is z a multiple of 39? True Suppose -23x + 15x + 216 = 0. Suppose -7b + x = -36. Is (-6)/b - 110/(-3) a multiple of 24? False Let c(o) = 44o*2 - 139o - 267. Does 33 divide c(20)? True Let f = 48 + -38. Suppose 0 = h - 5d - 4, -h + 2d = 3d - f. Suppose 114 = -hg + 10g. Does 19 divide g? True Suppose -p = y - 68687, 4p - 18356 = -3y + 256396. Is 21 a factor of p? True Let q = -2831 + 8601. Suppose -5x - 11z + 6z + q = 0, 5z = 10. Does 48 divide x? True Is (-38)/(-247) + 13/(1183/862848) a multiple of 4? False Suppose 49 = -4u - 5w + 126, -w - 47 = -4u. Suppose -7887 = -ub - 737. Does 21 divide b? False Suppose 24g - 16g - 5k - 49781 = 0, 3k + 3 = 0. Does 34 divide g? True Suppose -1117 = 16a - 42a + 11753. Is 7 a factor of a? False Suppose 4o - 51070 = -9c + 4c, -2o - 51100 = -5c. Is 21 a factor of c? False Let p = 180 - 194. Let z(n) = -41n + 67. Does 54 divide z(p)? False Is 5 a factor of (1/4(-64)/6)/((-16)/4344)? False Suppose -48 = 280f - 284f. Is ((-216)/f)/(-2 + 99/50) a multiple of 90? True Suppose -4059 = 20a - 23a. Is a a multiple of 59? False Let s = -22 + 33. Suppose -sn = -3418 - 1246. Suppose 0 = 8f - n - 1088. Is f a multiple of 21? True Let u(k) = -11k2 + 7k*2 + 26 - 13k + 5k2. Is 28 a factor of u(15)? True Suppose 5y + 2p - 150533 = 0, 5y + 0p + 4p = 150541. Is y a multiple of 102? False Let c be 2/3 - (-500)/6. Suppose 168 = 4g + 2j, -3g + 5g + 3j - c = 0. Is 7 a factor of g? True Let l be 5(-10)/(-25)2/1. Suppose 0 = -p - lp + 3p. Suppose -2c = c + 3b - 537, p = -c - 4b + 191. Is 25 a factor of c? True Suppose 0 = 5n + 5o - 25, -2n + 6n - 3o = -1. Let h(w) = -10 + 81w*n + 15 - 7 + w. Does 8 divide h(1)? True Suppose -5f = 5f - 2f. Suppose 7y - 2y - 695 = f. Suppose -h + 41 = -y. Does 10 divide h? True Let f be 1 - -13 - (-2 - -9). Suppose -22u + fu = -3450. Is u a multiple of 23? True Let z(g) = 21g + 340. Suppose 567j + 66 = 561j. Is z(j) a multiple of 6? False Let h(m) = 20m - 105. Let x be h(13). Suppose -448 = -3s - 2t - 0t, s = 5t + x. Is s a multiple of 10? True Let x = -19 + 20. Suppose -x = d - 2. Let j(w) = 91w + 3. Is 10 a factor of j(d)? False Is 337 a factor of (64030/15)/(((-24)/63)/(-4))? True Suppose 4i - 14 = 2k, 0k = -2k - 6. Suppose 0 = 3v + 4d + 5, -4v - id - 20 = -6v. Let u(l) = 3l2 - 12l - 4. Does 11 divide u(v)? True Let v be (-100)/(-8)544/40. Let g = v - 44. Is g a multiple of 4? False Suppose -4w - 102 = -366. Let m = -61 + w. Suppose -3c - 505 = -ms, 5c + 180 = s + 57. Is 14 a factor of s? True Let d(u) = 2u*3 - 57u + 8 - 17u2 - u3 - 26 + 0u*3. Does 7 divide d(20)? True Suppose 2t - 3a - 148 = 0, -4a + 150 + 38 = 3t. Suppose -33 - 47 = -5n. Let v = t - n. Is v a multiple of 14? False Let k = -290 - -282. Let u(f) = f*3 + 8f*2 - 20f - 13. Is u(k) a multiple of 10? False Let b(q) = 61q + 3. Let h be b(-9). Is 14/(-2)52494/h a multiple of 12? False Let u(j) be the third derivative of -j*6/120 - 17j*5/60 - 19j*4/24 + 3j3 + j2. Let y be 236/(-16) + -1 - 4/16. Does 12 divide u(y)? False Suppose 2n - f - 109 = -8, -3n + 2f + 149 = 0. Let k = 47 - n. Does 6 divide (k/9)/(3/162-1)? True Is 2041 - (-1 + (-70)/7) a multiple of 9? True Let b(k) = 5 + 2748k - 17 - 2769k + k2 + k3. Does 13 divide b(-4)? False Let m = -22 - -26. Let d(l) = -l*3 - 3l*2 + 6l + 12. Let x be d(-4). Suppose 5v - 954 = -mw, w = -3v - xw + 575. Is 38 a factor of v? True Let d be ((-3)/2)/(39/130) + 155. Let x(l) = 2l2 - 3l. Let k be x(2). Suppose 171 = 3y - 5m - 59, -ky = -5m - d. Does 10 divide y? True Let q(i) = 37i2 + 9i + 20i - 7i + 137. Is q(-5) a multiple of 17? True Let a = 14 - 10. Suppose -60 = -as - s. Suppose s = -v + 30. Is v a multiple of 6? True Let p be 9/5 + 4 + (-57)/15. Suppose -3q + 4q - l + p = 0, 2q + 4l + 10 = 0. Is 1/(4/452) - q a multiple of 18? False Let i be ((-132)/14)/((-1)/91). Let x = -564 + i. Is x a multiple of 39? False Suppose 3k + 2t - 1466 = 0, 2k - 3k - 3t + 491 = 0. Suppose d = -d - 4z + k, -478 = -2d + z. Is 5 a factor of d? True Suppose -3i = 2h - 1614, 4h - 3i = 2972 + 220. Is h a multiple of 2? False Let x = -114 + 612. Suppose 8i - 7i = x. Is 10 a factor of i? False Does 48 divide (82 - -2)(13 + 19)? True Let z = -44 - -47. Suppose 3o = 2v - 85, -v = -zo - 35 - 54. Let r = o - -68. Is 16 a factor of r? False Suppose -160 = 4m + 3t + 1229, t + 1391 = -4m. Let a = -204 - m. Is a a multiple of 8? True Let j(y) = y3 - 15y*2 + 34y - 42. Let p(r) = 7r2 - 17r + 21. Let k(t) = 4j(t) + 7p(t). Let w be k(6). Let z = w - 365. Is z a multiple of 8? True Suppose -14 = -6n - 2. Suppose 3b + np = -5, 0 = -4b + 2p - 0p - 16. Does 2 divide ((-4)/(-2) - -4) + b? False Suppose 4q - g - 30 = 0, 4q - 4g - 12 = 24. Suppose -qx + 596 = -790. Is 22 a factor of x? True Suppose 5m = k + 8605, 116m - 109m - 12079 = -5k. Is 125 a factor of m? False Suppose -5r = -179 - 1. Let t(b) = b3 + 31b*2 + 35b + 236. Let w be t(-30). Let x = w - r. Does 10 divide x? True Suppose -840 = 3f - 6f + 3y, -3f + 5y + 834 = 0. Let s = f - 152. Suppose s = 4w - 189. Is 41 a factor of w? False Let r be -373 + 4/(-8)0. Let k be 3/(-11 + 2)(-16 + 4). Is 34 a factor of k/(-2) - (31 + r)? True Let s(d) = -d*3 - 9d*2 - 9d - 20. Let a be s(-9). Let z(n) = 35n2 + 52 - 3n*3 - 26n - an2 + 2n*3. Is 11 a factor of z(-25)? True Let k be 1/(-6)-15330. Suppose -3z + 2w + k = 0, -4z + 551 = -2z - w. Is z a multiple of 7? False Let x(j) = 5j*2 + 108j - 148. Is x(25) a multiple of 16? False Let x(c) = 45*c - 945. Is 15 a fact	{ "pile_set_name": "DM Mathematics" }
Solve -47m - 2p - 78 = -43m + 154, 0 = 7p + 812 for m. 0 Solve 15u = 2g - 157, 11g = 12g + 2u + 8 + 18 for g. -4 Solve 26c = 45c - 3w - 63, 0 = -4c + 2w + 16 for c. 3 Solve 4d + 4n = -120, 4n = 847d - 849d - 50 for d. -35 Solve -97y = -10b - 95y - 42, 7b + 47 = -3y for b. -5 Solve -4y = 84, -5z - 411757y + 411758y = -41 for z. 4 Solve 3v = 312x - 252x - 114, x + x + 18 = 6x + 5v for x. 2 Solve 3b - 5v = 39, -v = -4b + 1183 - 1114 for b. 18 Solve -3s - 21 = -3v, 232s = 235s + 13v - 59 for s. -2 Solve -4734i + 4 = -2z - 4719i, 45 = 3z + 3i for z. 13 Solve -2658u - 6s + 75 = -2655u, -5u - 5s = -55 for u. -3 Solve -5p - 3b = 29, 2p + 9 = 43175b - 43176b for p. 2 Solve -8i + 7i + 8i + 23 = 4c, -4c - 16i = 0 for c. 4 Solve 17f = 5o - 151, 14f = 4o + 13f - f + 7 - 35 for o. 3 Solve 0 = 15b + 5c + 220, 6b = 3285c - 3290c - 94 for b. -14 Solve -32g - 195 = -n, -5g - 10n + 7n = 21 for g. -6 Solve 0 = -3b - 9y - 105, -1970 = -3b + 5y - 1921 for b. -2 Solve 0 = -4o - 19f + 127, -f - 300 = -3o - 281 for o. 8 Solve 20 = 2w - 2s, -2701w + 5s + 46 = -2697w + 4s for w. 12 Solve -h = 2h + 2y - 291 + 304, -247 = -3h + 50y for h. -1 Solve 0 = -3z - 4q - 2, 4z + 5q + 19 - 8 = 8 - 6 + 7 for z. 2 Solve -2p = 2c + 20, -163c - 168c = -335c + 16p for c. -8 Solve -4h - 6 - 4 - 4 = -f - 7, h = 19f + 242 for h. -5 Solve -195i + 4c + 43 = -230i, 19i + 21 = -c for i. -1 Solve 6f = 2799c - 2804c - 92, -c = 3f + 13 for f. 3 Solve -50z + t = -51z, -3z - 65t + 248 = -0z for z. -4 Solve -16q = 42h - 14q + 306, 2q + 21 = -3h - 7 - 5 for h. -7 Solve 0g - 3g - 2w - 127 = 11, -170g + 12w = 8w + 7820 for g. -46 Solve 6g = -371h + g - 9 + 40 + 59, -3h = g - 18 for h. 0 Solve r = 4v - 0r - 7683 + 7666, 0 = -2v + 72r + 366 for v. 3 Solve 4j = -42g + 2, 36j + 39j - 54 = -0g - 4g + 80j for g. 1 Solve 82507 = 96j - 5s + 81557, 5s = -4j + 50 for j. 10 Solve -89g = -4u - 91g - 30, 7u - 5g - 24 = 0 for u. -3 Solve 423o = 3p + 422o - 54, 4o + 2 + 5 = p for p. 19 Solve 5416n = 5412n + 28r - 96, 0 = 19r - 76 for n. 4 Solve -2a + 60 = 0, 0 = -2b + 15a - 20a + 146 for b. -2 Solve -n - 104 - 99 = -2k - 199, 0 = -4k + 4 for n. -2 Solve -11 = -3d - 4w, 10d + 3w + 4 = 36d - 129 for d. 5 Solve 130c - 127c + 27 = -3u, -2u - 4 = c for u. 5 Solve g = -6p + 1276 - 1208, 2g + 2p - 16 = 0 for g. -4 Solve 2a + 28 = 9m, -a - 793m + 794m = 0 for a. 4 Solve 0 = 3f + 6887i - 6891i - 16, 78f + 6i + 24 = 0 for f. 0 Solve -8w + 425 = -3q, 6w - 5q + 14624 = 14929 for w. 55 Solve 1486i + 2g = 1485i + 5 + 18, -i - 3g + 33 = 0 for i. 3 Solve 1064u - 1067u = -44z - 161, -5u - 33 = 2z for u. -5 Solve -2t + 28p = 32p + 39 + 5, -3t - 3p = 39 for t. -4 Solve 2a - 10 = -76022o + 76024o, -2o - 2 = 2a for o. -3 Solve 4a + 5p = 6, -2a + 4p = -126 + 110 for a. 4 Solve 2i - 6i + 244 + 328 = 36t - 3i, 12 = -3i for t. 16 Solve 4n - y + 55 = 0, 15n - 71n - 1389 = 43n + 3y for n. -14 Solve 2s = 27 + 13, 47n - 3s = 17n + 2s + 20 for n. 4 Solve 238 - 263 = -4d + 2p - 49, -30 = 2d - 4p for d. -3 Solve 8f = 5k + 17, 5f - 5k - 28 = 33f - 25f for f. -1 Solve 2x = -4055f + 4067f + 220, 0 = 7f + 2x + 141 for f. -19 Solve 4q + 29 = 3u, 2u - 1066998q - 28 = -1066995q - 7 for u. 3 Solve -w = -3768c + 3773c - 34 - 21, 2w - 2c + 22 = 0 for w. 0 Solve w + 7s - 4s = 10, -32w + 5s = 19754 - 19670 for w. -2 Solve 0 = -16k - y - 2y - 85, -2k - 85y = -87y - 6 for k. -4 Solve 4t = -18p - 40 - 32, 17p - 4 = -t + 18p for t. 0 Solve -3a + 17p - 19 = 0, -6850a + 6845a - 2p = -29 for a. 5 Solve 0 = 8m - u + 171, -5m + 1223 = u + 1338 for m. -22 Solve -551g - 332 = -2w - 541g, -5w = 2g + 88 for w. -4 Solve -57 = -5t + 8q, 6836710t = 6836708t - 5q - 10 for t. 5 Solve -1569d + 13 = -1574d + c, 4d + c + 5 = 0 for d. -2 Solve -615l - 18 = -3b - 618l, 0 = 2b + 46l - 100 for b. 4 Solve 12v - 52 - 28 = 2i - 20, -2v + 3v + 2i = 5 for v. 5 Solve 3j = 3q + 2j + 5j + 127 - 130, 136 = -4q + 18j for q. -7 Solve 4i - 25 = -5d, -i + 3d + 54355 - 54353 = 0 for i. 5 Solve s - 2s - 22 = 33145p - 33147p, 0 = -4s + p - 53 for s. -12 Solve k + 4n = 6k - 37, -168n + 171n + 44 = 7k for k. 5 Solve -361b = 3z + 6, 35b = -5z - 3z + 4z + 34b - 8 for z. -2 Solve 2v = -5m + 9, 0 = 13721v - 13719v + 48m - 52 for v. 2 Solve 128m - 15z - 21 = -10z - 6, 4m + 15 = -5z for m. 0 Solve -162 = 2v - 6i - 14i, 0 = 5i - 1 - 19 for v. -41 Solve -5o + 10 = -3g + 51, 24o - 36 = -5g for o. -1 Solve -2l - l + 13 = -4l - 26z - 13, 4z = 2l - 4 for l. 0 Solve 660 = r + 57b + 1234, 0 = -r + b + 6 for r. -4 Solve -3i + 50 = -11z, -182i + 179i + 18 = -3z for i. 2 Solve 8d + 5h - 811 = -809, 0h - 4h = -5d - 13 for d. -1 Solve -2s + 4s - 285r - 8 = -302r, 0 = 10s - 2r - 40 for s. 4 Solve -4u + 14 = 2d + 34, -2u - 64d + 260 = 2u + 43d + 35d for u. -6 Solve 0 = 2q + 2q - q - 7i + 67, -4q - 2i - 81 = -3i for q. -20 Solve -20u - 42 = -62i + 61i, -7u - 3 = 2i + 7 for u. -2 Solve -1421d + a = -1418d + 6, -3d - a = -6 for d. 0 Solve 0 = m - 6m - 3n + 9, 45m + 6n + 30 = -58m + 109m for m. 3 Solve 34 - 20 = 94d - 96d - 2f + f + 14, -2f = 5d for d. 0 Solve 3l - 49 = -5b, 147b + 51 = 5l + 163b for l. 23 Solve -3j - 5a + 15 = -3, 5j + 2a + 23 = 15 for j. -4 Solve -4f + 5y + 2 + 7 = 0, -5y = -346f + 335f + 51 for f. 6 Solve 2m + 0m - 97 = -51u - 2m, 21m + 4m + 336 = m for u. 3 Solve -2n = -21i + 17i + 3 + 9, -191 = 11n + 3i for n. -16 Solve 3s - 3295 = -4a - 3303, -4a - 39s = 3s - 148 for a. -5 Solve 4x = -j - 31, -2x - 2j - 44 - 12 = 0 for x. -1 Solve 50i - 53i + 3b - 14 - 6 = 4, 46 = -2i + 7b for i. -2 Solve -3m - 2r = -21, 1064m + r = 1067m - 12 for m. 5 Solve -4d - 2d + 12d + 5x + 2 = 3d, 21d = 4x + 142 for d. 6 Solve 2c - 6v = -3v + 2v - 19, 5c - 6v + 48 - 20 = 0 for c. -2 Solve -g + 139t - 137t = -6, -g = -t + 6t + 1 for g. 4 Solve 7i = 17b - 34 - 9, 4b + 39 = 5i + 29 for b. 5 Solve -17208p = -17212p - d + 113, -4p = 5d - 101 for p. 29 Solve -2x - 25 = 3j, 2j - 4x + 0x = -6x - 20 for j. -5 Solve -c + 4h = -57, 150c = 155c - h - 38 for c. 5 Solve 4p = 2k + 200, 29p - 3k - 2068 = -11p for p. 52 Solve 2a + 1253 = 3f + 1254, 2a - 4 = 2f for a. 5 Solve 3w - 4 = -b - 48, -760w + 753w - 109 = -4b for b. 1 Solve 0 + 11 + 1 = 4m + 4, 3m - 6 = -7u for u. 0 Solve 16f + 1166l + 16 = 585l + 582l + 99, 3f - 5l - 107 = 0 for f. 4 Solve 5n = -c + 13, 2n + 442 - 278 = 9c for n. -1 Solve 9674w - 9670w + 116 = -l, -3l - 6w - 174 = 0 for l. 0 Solve -14c - 17a = -20a + 51, c - 25a + 1150 = -129a for c. -6 Solve 3r + 28m - 2985 = -3165, -3r + 5m + 18 = 0 for r. -4 Solve 0 = -5032s + 5028s + 8g + 72, -2g = 5s + 42 for s. -4 Solve -4o + 216 = 5j, 19j + 9796 = -3o + 4o + 10633 for o. -1 Solve -102911t + 3 = -102912t - q, -t = 4q + 18 for t. 2 Solve w - 53 = -5p, -1263627p = -1263623p - 4w - 52 for p. 11 Solve -29494o + 46 = -29491o - 2g, -2o = -2g - 34 for o. 12 Solve -966m + 326 = -98r - 970m, -3r + 5m = -31 for r. -3 Solve 1299f = 1296f - 5z + 78, 0 = 9f - 2z + 72 for f. -4 Solve -22f = 5k + 164, 29253f - 29250f = -5k - 31 for f. -7 Solve -64u + 18 = -3z - 69u + 21 + 53, 0 = -2z - u + 28 for z. 12 Solve 1294r - 1292r + 44 = -4i, -134r + 134r + 5i - 25 = 0 for r. -32 Solve 3n = 4n - 1, 273n = -3s + 20n + 36n + 202 for s. -5 Solve 5r - 10 = -46v + 29v, -r + 3v + 4 = 2 for r. 2 Solve 11755m - 11752m = 0, -5p + 29m + 355 = 0 for p. 71 Solve 217g + 3c - 1133 = -67g - 0c, 0 = -4g + 3c + 19 for g. 4 Solve 5y = -5c - 40, -2y + 5c + 2987 - 3010 = 0 for y. -9 Solve 12v + 9c + c + 4 = -31v + 41v, -c + 32 = 2v for v. 18 Solve 161l - 157l + 3g = 59, 67g - 81 = -l for l. 14 Solve 4h - 16 = 7f - 35, -5f - 3h + 22 - 13 + 28 = 0 for f. 5 Solve 5s = -5, 2h - 68 = 5h - h - 0h + 6s for h. -31 Solve 14q + 1264 = -2u, 5q - 5u + 438 = 312 - 314 for q. -90 Solve 0 = -5z -	{ "pile_set_name": "DM Mathematics" }
r = -3o - 15 for r. 0 Solve 3f = -12, 0 = -j + 2j + f for j. 4 Solve 2t + 3i = -18, -2i = 5t + i + 27 for t. -3 Solve 5w + 19 = -s + 5, 2 = 2w + 8s for w. -3 Solve 3t - 5a + a = -17, -4t - a = 10 for t. -3 Solve -4a = -4r - 51 + 95, 0 = 7a - 3r + 65 for a. -8 Solve 0 = 3u + 4n, 3u - 5n + 23 = u for u. -4 Solve 2u + 86 - 95 = -5v, -1 = u - 3v for u. 2 Solve 4i - 13 - 8 = -5j, 0 = -4i - 3j + 19 for i. 4 Solve -4h - 41 = -2v - 3v, 0 = -3v + 4h + 31 for v. 5 Solve 3q = 4j - 11, 27 = -2q - 3q - 2j for q. -5 Solve 12x + 4a + 8 = 0, 15x - 10x = 2a - 18 for x. -2 Solve -3s + 13 = -2a + 3, -7 = a - 2s for a. 1 Solve 12 - 42 = 4q - 5i, 2i + 1 = -q for q. -5 Solve -3b + 3r + 11 = 26, -5r + 19 = -2b for b. -2 Solve -16 = -4x + 19p - 17p, 0 = -5x + 5p + 20 for x. 4 Solve -5b - 5a = -2a, -4b + 5a = 37 for b. -3 Solve 0 = -6i + 11i + 4u + 34, 3i - 24 = 5u for i. -2 Solve -3o = 5a + 21, -5a - 3o - 17 = -2o for a. -3 Solve 0 = -5m - 6 + 26, m - 4 = 5z for z. 0 Solve 3b - 3 = v, 0 = 5b + 5v - 26 + 1 for b. 2 Solve z - 4j - 16 = -3z, -2j - 12 = -3z for z. 4 Solve 4x = -3a + 20, -a + 3x = 2a - 6 for a. 4 Solve 5p - r - 20 = 0, 3p - 4r = -2r + 5 for p. 5 Solve 2c + 2w = -4, -4c + 7 + 0 = w for c. 3 Solve 0 = 5m + 4l, -10l + 7l = -2m for m. 0 Solve 65g = 61g - 3k - 12, -16 = 5g + 4k for g. 0 Solve -3a + 5m + 4 = -5, -a - 8 = 2m for a. -2 Solve -4a - 10 = 2v, 4 = -v - 5a - 16 for v. 5 Solve 0 = 3k + 13u - 14u + 11, -k + 3u + 7 = 0 for k. -5 Solve 15 = 5o - 2u + 10, -11 = -2o - u for o. 3 Solve -2m = 2s - 12, -3m + 10 = -3s + 4s for s. 4 Solve -2c - 12b + 7b + 15 = 0, 2b = 2c - 8 for c. 5 Solve -5w - 5j = 10, 5w = 2j + 35 - 10 for w. 3 Solve 0 = -3j, 6v - 18 = 9v - 3j for v. -6 Solve -3c + 4c - 2r = 0, 20 = -3c - 4r for c. -4 Solve -58l - 30 = -53l - r, -3r = -l - 20 for l. -5 Solve 0 = 2i - 8, -29 = -4o - 2i - 5 for o. 4 Solve -4u = 2y - 24, 0y + 4 = -3y + 2u for y. 2 Solve 0 = 5h + 25, -3j - 4h - 75 = -37 for j. -6 Solve 0 = 4n + y - 10, 4y = -20n + 16n + 4 for n. 3 Solve 3z = -5i + 22, -6z + 4i = -11z + 28 for z. 4 Solve 2a = -6, -31o + 33o = -a + 9 for o. 6 Solve 6d = 4c, 8d - 7d - c - 1 = 0 for d. -2 Solve 192h - b = 195h + 8, 3h + 4 = b for h. -2 Solve 13 = -5l + 8, 4l + 14 = -2g for g. -5 Solve -3y + 3a - 4a + 10 = 0, -4y = -a - 18 for y. 4 Solve 0 = i - 3s + 9, 2s = 2i - 0s + 6 for i. 0 Solve 14d - 9d - 4 = 4a, 0 = 3a - 3d + 3 for a. -1 Solve -4g + u = -5g, 5u = g - 12 for g. 2 Solve 21q = 18q + 2t - 21, 0 = 5q - t + 28 for q. -5 Solve 21 = -5f + 2p, 4f + 2p + 13 + 11 = 0 for f. -5 Solve -2b - 2c = 0, 0 = -2b + 60c - 56c + 30 for b. 5 Solve -2h + 9 = 3o, 0 = 3o - 5o + 2h + 6 for o. 3 Solve -3y + 15 = 5c + 27, -2y = 4c + 10 for c. -3 Solve -5d - 4t - 18 = 0, -2 = 2d + 4t + 10 for d. -2 Solve 4y - 2f - 28 = 0, 2f - 11 = 2y - 23 for y. 8 Solve 2p = 5n - 7 + 27, n + 4 = 0 for p. 0 Solve 4 + 7 = 4o - 5n, -o + 9 = 5n for o. 4 Solve -2v = 32s - 39s + 34, 5v - 3s = 2 for v. 4 Solve 3 = -2g - f, 2f - 10 = 4f for g. 1 Solve 28 = -4x - 3q, 2q + 3 - 7 = 3x for x. -4 Solve -4h - 14 = 2t, 3t + 19 = 22 for h. -4 Solve -2q - 10 = 4k, 0 = -4k - 363q + 359q for k. -5 Solve -2u - 4 = -6, 2p + 3u - 11 = 0 for p. 4 Solve 3r = -5w + 34, 4 = -23r + 26r - w for r. 3 Solve 2j - 4j - 4 = 2u, -4j = 5u + 7 for j. -3 Solve 4u - w = 4w - 12, 12 = -4u + 4w for u. -3 Solve u + 9 = 4u - 3a, -4u = 5a + 33 for u. -2 Solve -5f = -4i - f + 28, 3f + 9 = -3i for i. 2 Solve 0 = 11h - 7h + 8, 3m - 6 = 3h for m. 0 Solve 8 = 5l + h - 9, h = -4l + 13 for l. 4 Solve 16 = -5k + 4g + 39, 5g = -3k - 38 for k. -1 Solve 2d + 2c - 18 = 0, 3d = -c + 38 - 19 for d. 5 Solve -4b = -2u + 14, -6u + b + 42 = 22 for u. 3 Solve -4w + 10k - 9k = -7, 13 = -2w - 5k for w. 1 Solve -b = g + 1, -39b + 43b - 3g = -25 for b. -4 Solve x = -0x - 3j + 8, 4j = 8 for x. 2 Solve 2q = -3r + 4r + 8, 6 = -4r - 5q for r. -4 Solve 3j + 3g - 10 = 4g, -j - g = 2 for j. 2 Solve -2f + 5r - 19 = 16, 30 = -4f + 2r for f. -5 Solve 3d = -9, -47t + 42t - 4d = 37 for t. -5 Solve -4j + 2 = -3l, -3j - l = 3 - 11 for j. 2 Solve 5r + 5 = a + 2a, -4r = 3a + 31 for r. -4 Solve 6j = 4p + 2j + 28, 0 = 2p - 4j + 24 for p. -2 Solve 3m + 49 = 8m + 3d, 0 = 4m + 3d - 44 for m. 5 Solve -2i - g = g, 0 = 4i - 4g - 24 for i. 3 Solve 2q - a - 3a = -22, 5a - 27 = 2q for q. -1 Solve 0 = -2v - 10, -5v + 10v = 5k - 45 for k. 4 Solve 41 = 4d + 5f - 10f, -3f = -2d + 23 for d. 4 Solve 2i - 15 = 4h + i, -4h = i + 25 for h. -5 Solve 0 = 2a + o - 6, -30 = 5a - 10a + 5o for a. 4 Solve 5l - 4l - u - 2 = 0, 5u + 15 = 0 for l. -1 Solve -6 = -n + 5x, n + 2x - 4 = -5 for n. 1 Solve 0 = 4l + 5x + 48 - 11, -2l + 2x = -4 for l. -3 Solve 4p + 7 = l, -4l - 10 = 3p - 0l for p. -2 Solve -4v + 2h - 17 = -5, v + 3h = 4 for v. -2 Solve 30c + q = 28c - 3, -3c - q = 4 for c. -1 Solve -4a - 1 = u, 3a + 102 - 115 = 2u for a. 1 Solve -16 = -4w + 2v - 26, 0 = -5w - 5v + 10 for w. -1 Solve -7j + 5x = -3j - 15, -2x = -4j + 6 for j. 0 Solve -5m = -5d + 15, -5d + 1 = -5m + 7m for d. 1 Solve -5o + 8b = 5b - 19, o = 2b + 1 for o. 5 Solve 0 = -j + 2, -3k + 307j - 302j = -5 for k. 5 Solve 0 = -r - 3h + h, 4r - 5h - 13 = 0 for r. 2 Solve v - 6v = 5, -x - 4v = 0 for x. 4 Solve w - 2j + 8 = 0, -w - 2w + 4 = j for w. 0 Solve -v + 2m = -6v + 14, 2m = 4v - 4 for v. 2 Solve -4t + 4s = -16, -11t = -6t - 3s - 22 for t. 5 Solve -5h = -4k + 5, -3 = 4h - 5k + 1 for h. -1 Solve 5u = -4g + 9u - 28, -5u + 5 = 5g for g. -3 Solve -45s + 46s + 3 = j, -2s - 6 = 2j for j. 0 Solve 4p = -4s + 8, -44p - 10 = -49p - 4s for p. 2 Solve -6 = -3r - 3m, -3 + 6 = 2r + 3m for r. 3 Solve -p + 1 = -4f, 0 = -4f + f + 5p - 22 for f. 1 Solve -3j - 1 = -4y + 16, -3j - 3y - 3 = 0 for j. -3 Solve -4i + 0g - 12 = -5g, g = -2i - 6 for i. -3 Solve 3q - 9 = -c - 0c, 2c = -4q + 12 for c. 0 Solve -4t - 3g + 6 = 0, -42t + g - 2 = -43t for t. 0 Solve -w = -4v + 23, -16v = -14v + 5w + 5 for v. 5 Solve 5l - 202g = -205g + 14, l = -2g for l. 4 Solve -2l = -g + 4, g - l - 4l = 7 for g. 2 Solve -2j + 4a - 6 = 0, 6 = 4a - 2a for j. 3 Solve 0 = 3b - 16w + 20w + 36, 5b - 4w + 28 = 0 for b. -8 Solve -4z + u + 16 = -0z, 5z + 2u = 20 for z. 4 Solve z + 5v = -z + 19, -3z - 19 = -2v for z. -3 Solve -209w - 3b = -207w - 8, -4w - b = -16 for w. 4 Solve 0 = -2q + c - 8, 26 = -2c + 38 for q. -1 Solve 0 = -4t - 12u + 9u - 18, 2t + 3u + 12 = 0 for t. -3 Solve 5t = 5, -4o + 7 = -0t - t for o. 2 Solve 2l - 57 = -p - 42, 2l = 4p - 10 for p. 5 Solve -5i + a - 3a - 2 = 0, -3i - 5a = -14 for i. -2 Solve -2a + 5w = -10, 2a - 3w = w + 6 for a. -5 Solve 0 = -2t - 2n - 12, -2n = -t - 0n for t. -4 Solve 2a + 11f - 10f = -2, 2a = 4f + 8 for a. 0 Solve -3l + 9 = 0, -18g + 19g = -l for g. -3 Solve -5a = -l - 20, 21a - 17a - 16 = 4l for a. 4 Solve 15 = 3t, -49t + 51t - 6 = -2h for h. -2 Solve 5s - 24 = -3d, -18s + 22s = 2d + 6 for s. 3 Solve -4v = -5m - 5, -2v + 2 = 2 for m. -1 Solve 0 = 3f - t + 13 + 1, 0 = -2f + 5t - 18 for f. -4 Solve -20 = -4c, -5n + c + 4 = -8n for n. -3 Solve -19v + 8 = 3a - 21v, 5v + 1 = -2a for a. 2 Solve 7n - 9n - 9 = -l, n + 3 = 0 for l. 3 Solve -25 = 5b + 3k, -7 + 22 = -3k for b. -2 Solve 2 = -s, -2s + 0s - 8 = p for p. -4 Solve -9 = z + p, 40 = -47z + 43z - 5p for z. -5 Solve -4y + 9q + 4 = 5q, -8 = 4q for y. -1 Solve -3u = -3y + 3, 0 = 5y + 4u - u + 3 for y. 0 Solve -3w + 5 = -m + 16, 2w - 5m = -3 for w. -4 Solve -i + 3i = -2a + 2, 0 = -4i + a + 9 for i. 2 Solve m - g = -0g + 4, -4g = m + 21 for m. -1 Solve -3j - 6 = 3a, -4j + 5a + 10 = -0j for j. 0 Solve 3t - 4o - 1 = 0, 4t + 2o = 3 + 13 for t. 3 Solve -22 = -3f + 5m, -15f + 18f - m - 14 = 0 for f. 4 Solve -3g + 17w - 22w + 6 = 0, 0 = 2g - w + 9 for g. -3 Solve 25 = -5v, -18d - v - 30 = -23d for d. 5 Solve 0 = -3*n + d	{ "pile_set_name": "DM Mathematics" }
(w + 1)*2/4 Suppose 285z - 156z = 138 + 120. Solve 121/4c*z + 4 + 22c = 0. -4/11 Suppose -216 = 5k + 3k. Let t = k - -30. Find s such that 21s3 - 6 - 42s*3 + 9s + 18st = 0. -2, 1 Suppose 0 = -i - 2c + 9, -2i - 9c + 4c = -21. Determine w so that 33w*i + 8w*2 - 234w*4 - 13w*3 + 242w*4 = 0. -2, -1/2, 0 Solve -54o*4 + 1425o + 250 + 2279/4o3 + 7/4o*5 - 4385/2o*2 = 0 for o. -1/7, 1, 10 Let x(g) be the first derivative of -1/10g*5 + 15/4g*4 - 98g + 105g2 + 25 - 253/6g3. Factor x(k). -(k - 14)2(k - 1)2/2 Let n be (534/9)/(1456/312) + -11. Determine w, given that -3w*3 - 3/7w*5 + 24/7w + 15/7w4 - 3/7w2 - n = 0. -1, 1, 2 Determine o so that -156 + 65 + o2 + 572 + 43o - 61 = 0. -28, -15 Let n(t) = 57t*2 - 9t*3 - 112t*2 + 55t*2 - 2t - 2. Let s be n(-2). Suppose 80 - 5m - s - 2m*2 + m = 0. What is m? -3, 1 Let l(k) be the second derivative of 5/24k*4 + 3k*2 + 0 - 37k - 1/12k5 - 1/2k*3 + 1/72k*6. Let h(z) be the second derivative of l(z). Factor h(c). 5(c - 1)*2 Factor 0 - 1041/4f*2 + 3/2f*3 - 261/2f. 3f(f - 174)(2f + 1)/4 Let c(j) be the second derivative of j6/1080 - j5/90 + j*3/6 + 3j*2/2 - 11j - 2. Let w(m) be the second derivative of c(m). Suppose w(l) = 0. What is l? 0, 4 Let b be (-1)/((-11)/(-4)) - (-5698)/1694. Determine i, given that -2/9i4 - 2i*2 + 14/9i - 4/9 + 10/9ib = 0. 1, 2 Let l(i) = -75i + 227. Let t be l(3). Let b be (t/20)/(12/(-12)). Factor 3x*2 + 9/4x + b + 3/4x3. 3x(x + 1)(x + 3)/4 Suppose 3716s = 3709s + 28. Let m(u) be the second derivative of 0 - 13u + 0u*2 + 1/9u*s + 1/30u*5 + 1/9u*3. Factor m(x). 2x(x + 1)2/3 Let s = 400 + -397. Find i such that 12i*3 - si*3 - 5i*3 - 200i - 34i2 - 6i*3 - 6i*2 = 0. -10, 0 Let w(a) = -a - 12. Let s be w(-6). Let u be (-2)/s + (-2 - 22/(-6)). Find k such that -3k*u - 169 + 6k + 169 = 0. 0, 2 Let r(g) be the third derivative of g*8/112 + 13g*7/105 + 9g*6/40 - 14g*5/15 + 351g2. Factor r(y). y2(y - 1)(y + 7)(3y + 8) Let b(g) = -7g2 + 4982g - 1245009. Let z(n) = -36n2 + 24906n - 6225047. Let v(t) = -11b(t) + 2z(t). Factor v(d). 5(d - 499)2 Let u = 3561 - 17801/5. Determine k, given that 2/5k*3 + 4/5k*2 - u - 2/5k = 0. -2, -1, 1 Let l(a) be the first derivative of -5a4/12 + 70a*3/3 + 145a*2/2 - 79a - 204. Let v(y) be the first derivative of l(y). Factor v(r). -5(r - 29)(r + 1) Suppose -5v - 2g = -0v - 14, -3v + 10 = 2g. Determine m so that 7m + 594 + 30m4 - 290 - 5m*3 - 2m - 40mv - 294 = 0. -1, -1/2, 2/3, 1 Suppose -73k = 378k. Factor 0y + 1/3y5 + k + y3 + 0y*2 + 4/3y4. y3(y + 1)(y + 3)/3 Let s(x) be the third derivative of -x9/120960 - x8/40320 + x*7/5040 + 7x5/6 + x2 + 5x. Let p(q) be the third derivative of s(q). Factor p(v). -v(v - 1)(v + 2)/2 Let p(z) be the third derivative of z5/480 - 227z*4/24 + 51529z*3/3 + 357z*2 + 4z. Factor p(r). (r - 908)2/8 Let i(d) be the first derivative of -d3/12 + 27d2/4 + 295d/4 + 2133. Factor i(g). -(g - 59)(g + 5)/4 Let w = -9129 + 2802597/307. Let t = w + 5556/1535. Suppose 2/5a*2 + 12/5a + t = 0. What is a? -3 Let h be 1257273/1935 + 8 + (-342)/43. Let -969/5b3 + 2526/5b*2 + 1476/5b + 216/5 - hb4 = 0. What is b? -2/3, -6/19, 1 Factor 0 + 91/4f*4 - 95f*3 - 29f*2 + 0f. f*2(7f + 2)(13f - 58)/4 Let p = 699 - 687. Suppose 0 = 5r - 4m - p + 17, 2m - 7 = r. Factor -3/8ir + 0i + 0 + 0i2. -3i*3/8 Factor -136/7 + 26/7g + 2/7g2. 2(g - 4)(g + 17)/7 Let h(g) be the third derivative of -11/1575g*7 + 8/225g*5 + 0g*3 + 0g + 1/45g4 + 76g*2 + 0 - 1/300g*6 + 1/630g*8. Suppose h(d) = 0. What is d? -1, -1/4, 0, 2 Let v be (26/65)/(25/((-375)/(-9))). Let o be (-2)/5(-15)/9. Factor -o + va2 + 0a. 2(a - 1)(a + 1)/3 Let p(o) be the first derivative of 4o5/5 - 37o*4 + 416o*3/3 - 136o*2 - 10679. Factor p(s). 4s(s - 34)(s - 2)(s - 1) Let t = 21324 - 21320. Let l(q) be the third derivative of 1/960q*6 + 0q*5 + 0q + 0 + 1/1680q7 + 0q*3 - 39q*2 + 0qt. Factor l(s). s3(s + 1)/8 Let q(u) = u2 + 3u + 2. Let m be q(-9). Let x = m - 47. Factor xc - c2 + 0c + c*2 + 3c*2. 3c(c + 3) Let b(j) = 181j*2 - 27j + 174j2 + 54 - 6j*3 - 560j*2 + 157j2. Let a(i) = i3 + 7i2 + 4i - 8. Let s(v) = -27a(v) - 4b(v). Factor s(u). -3u2(u - 1) What is v in 10/9v3 + 0v + 8/9v2 + 2/9v*4 + 0 = 0? -4, -1, 0 Let f be (-2)/(-2)(0 + 2). Let y be (-414)/115((-8 - -1) + f). What is p in yp + 3p3 - p4 - 4p*5 + 3p*5 - 16p + 5p2 = 0? -1, 0, 2 Let a(b) = 47686b - 190726. Let o be a(4). Find r such that 111/5r - 3/5r*3 - 18/5r*2 - o = 0. -10, 1, 3 Suppose -17/2f*3 + 72 + 8f - 153/2f2 + 9/2f*4 + 1/2f5 = 0. What is f? -9, -4, -1, 1, 4 Let v(u) be the first derivative of u6/3 - 2u5/5 - u4 + 1161. Let v(i) = 0. What is i? -1, 0, 2 Suppose 25f + 32f + 109383 = 0. Let i = -13421/7 - f. Find x such that ix*2 + 0x + 0 - 3/7x3 = 0. 0, 4 Let a be 5(6 - 7) + 7. Let 120ta + 30t*4 + 54t*4 - 132t*2 + 60t*5 - 81t*3 + 12t = 0. What is t? -2, -2/5, 0, 1/2 Suppose 3k = -4d + 89, 2k = -5d + 69 - 12. Let i = 34 - k. Factor 19f - 4f*4 + 12f*2 + 5f*3 + 10f*3 - if - 16 - 23f3. -4(f - 1)*2(f + 2)*2 Suppose -456s + 450s = 2352. Let b = 829/2 + s. Factor -bh + 405/4 + 5/4h2. 5(h - 9)*2/4 Let h(y) = 14y*4 - 296y*3 + 778y*2 - 622y + 156. Let s(k) = 3k4 + k3 + k2. Let i(q) = -2h(q) + 12s(q). Find z, given that i(z) = 0. -78, 1/2, 1 Let o = -2/39203 - -39363/3136240. Let c(j) be the second derivative of -12j + 5/8j3 - j2 + 0 - oj*5 - 1/8j*4. Solve c(l) = 0 for l. -8, 1 Let d be 64/((-192)/(-15))(2 + (-24)/15). Factor -4n + 1/3n*d + 20/3. (n - 10)(n - 2)/3 Let k(r) be the first derivative of -2r3/27 + 307r*2/9 - 68r + 1940. Solve k(d) = 0. 1, 306 Suppose 19c - 575 = -537. Let g = 4162/13 - 320. Determine p so that -8/13p - 6/13 - gpc = 0. -3, -1 Let o(j) be the second derivative of -j6/60 + 2j*5/5 - 3j*4 + 108j*2 + 991j. Find d such that o(d) = 0. -2, 6 Let s(a) be the first derivative of -a*5/10 + 11a*4/6 - 8a*3 - 36a*2 + 49a + 17. Let d(i) be the first derivative of s(i). Factor d(c). -2(c - 6)2(c + 1) Let b(x) be the second derivative of 12x - 3 - 1/2x*3 - 21x*2 + 3/20x*5 + 7/2x*4. Factor b(w). 3(w - 1)(w + 1)(w + 14) Suppose 49f = 46f + 9. Let m(v) be the first derivative of 1/16v4 + 13 + 1/4v*f + 3/8v*2 + 1/4v. Factor m(h). (h + 1)*3/4 Let u(z) = 2z*2 - 66z - 2. Suppose 5g - 3v - 14 = 8, g + 5v = -18. Let l(s) = -s2 + 67s + 3. Let b(p) = gl(p) + 3u(p). Factor b(t). 4t(t - 16) Determine l so that -286l2 + 1602l - 578 - 3916l - 283l*2 - 283l*2 + 844l*2 = 0. -289, -1/4 Let r be (-366)/(-12) - (-115)/(-5). Let t(z) be the first derivative of -18 + rz*2 + 0z - 5/3z3. Factor t(y). -5y(y - 3) Find r such that 18/5r*3 + 93/5r*4 - 279/5 - 534/5r*2 - 3/5r*5 - 147r = 0. -1, 3, 31 Let o(u) be the first derivative of -2u5/45 - 13u*4/18 - 22u*3/9 - 31u*2/9 - 20u/9 - 3641. Factor o(j). -2(j + 1)3(j + 10)/9 Factor -7586/3j - 7592j*2 - 632/3 - 24j*3. -2(j + 316)(6j + 1)*2/3 Let k(o) be the third derivative of 0o*3 + 25/132o*4 + 178o*2 + 0o + 49/330o5 + 23/660o*6 - 1/1155o*7 + 0. Factor k(v). -2v(v - 25)(v + 1)*2/11 Let u(b) = -2b*2 - 11b + 10. Let i be u(-6). Suppose -p - p + 6 = -q, -iq - 3 = -p. Solve 3/4w*2 + 3w - p - 3/4w3 = 0 for w. -2, 1, 2 Let u(p) = 172p - 339. Let l be u(2). Let o(t) be the first derivative of 0t2 + 0t - 1/2t6 + 0t*3 + 26 + 6/5t*l - 3/4t*4. Factor o(x). -3x*3(x - 1)*2 Suppose 94q = 48q + 276. Let a(v) be the third derivative of 0v*3 - 18v*2 + 0v*4 + 0 + 0v - 1/360vq + 0v*5 + 1/630v7. Factor a(j). j3(j - 1)/3 Let a(g) be the third derivative of g6/1440 + 23g*5/480 + 13g3/6 + g2 - 5g. Let o(y) be the first derivative of a(y). Factor o(q). q(q + 23)/4 Let a(y) be the third derivative of 121y6/240 + 5401y*5/120 - 247y**4/6 + 1	{ "pile_set_name": "DM Mathematics" }
+ -5(sqrt(396)-2 - sqrt(396))-2 + -2. -180sqrt(11) + 1 Simplify ((-4sqrt(960) - sqrt(960) - sqrt(960))/sqrt(5))2 + (sqrt(1152) + -4sqrt(1152))/sqrt(6). -24sqrt(3) + 6912 Simplify (sqrt(81)2-5)/(((sqrt(3) - sqrt(27))-3 - sqrt(3)) + sqrt(12)2). -10sqrt(3)/3 Simplify -3(-3 + sqrt(363)-2) - ((5 + (sqrt(363)-1 - sqrt(363)))2 - (sqrt(363) + (sqrt(363)-2-1)2 + sqrt(363))). -16 + 308sqrt(3) Simplify 5(0 + (sqrt(68) + -2 + -5)3). -105 + 30sqrt(17) Simplify -2sqrt(19) + 1 + -4 - (sqrt(76)/(sqrt(100) + sqrt(100)2 + sqrt(100)))2. -2sqrt(19) - 1219/400 Simplify (-1sqrt(84))/((sqrt(3) + -2sqrt(3))-4) + -4(1sqrt(448) + -1). -65sqrt(7)/2 + 4 Simplify 2((sqrt(525)/sqrt(7) + sqrt(3))2 + sqrt(3)) - -3(-5 + 1 + sqrt(3))*2. -22sqrt(3) + 273 Simplify 4 + -1 + sqrt(224)/sqrt(7)5 + 1. 4 + 20sqrt(2) Simplify 2(sqrt(5445) + (sqrt(5445) + sqrt(5445)1 - sqrt(5445)) - sqrt(720)-1)/(-4(sqrt(729) - (sqrt(729)1 - sqrt(729)))). -13sqrt(5)/9 Simplify (((sqrt(7) - (3 + sqrt(7))) + -2 - (sqrt(7) + 2 + 4)) + -3 + 2sqrt(112) + sqrt(112))2. -308sqrt(7) + 1043 Simplify 2sqrt(7)-1 + sqrt(84)/(-1sqrt(12)) + 2 + 2. -3sqrt(7) + 4 Simplify ((sqrt(1100) - (sqrt(1100) - sqrt(1100)-3-1)) + (sqrt(1100)2 + -3 + sqrt(1100))2)4. -600sqrt(11) + 39636 Simplify 0 + 3 + -1 + sqrt(4800) + 0 + 4. 6 + 40sqrt(3) Simplify (2 + sqrt(396) + 3sqrt(396))2 - ((-3sqrt(88))/sqrt(8) + sqrt(11) + 0). 98sqrt(11) + 6340 Simplify 4 + ((1sqrt(75))*2-2 + (sqrt(75) + sqrt(75)-2)-2 - (sqrt(75) + (sqrt(75) - -5(-1 + sqrt(75))) + sqrt(75)-24)2). -246 - 40sqrt(3) Simplify -5(-5 + 5 + -1(0 + sqrt(208)))*2. -1040 Simplify 2((-4 + sqrt(343) + 1)5 + -2 + 0). -34 + 70sqrt(7) Simplify 3 + (sqrt(2736) - sqrt(2736)-3) - (-4 + (sqrt(76) + (sqrt(76) - sqrt(76)2) + sqrt(76) + sqrt(76))/sqrt(4)). 7 + 46sqrt(19) Simplify ((sqrt(150)-3 + sqrt(150) - sqrt(150))1)/(sqrt(24)/(sqrt(12) + (sqrt(48)2)/sqrt(4))). -45sqrt(3) Simplify (3-3sqrt(448) + 2sqrt(448) + 3 + 1)*2. -448sqrt(7) + 21968 Simplify ((sqrt(180) - (sqrt(180) + 3(sqrt(180) - sqrt(180)1) + sqrt(180) + sqrt(180)))/(sqrt(64)-1))2. 45/4 Simplify (((sqrt(84) - (sqrt(84) + sqrt(84)2 + sqrt(84)))-2 + sqrt(84))-1)/(-5(sqrt(1452)2 + sqrt(1452))). 7sqrt(7)/165 Simplify 5 + -2(sqrt(275) + 0) + 0. -10sqrt(11) + 5 Simplify ((4 + (sqrt(1900) - (sqrt(1900)-2 + sqrt(1900)) - sqrt(1900)) + sqrt(1900) + 4)4)2. 5120sqrt(19) + 122624 Simplify -3 + (-5 + sqrt(170)/sqrt(160))*2 + -5 + -5. -5sqrt(17)/2 + 209/16 Simplify sqrt(76) + -4 + sqrt(19) + sqrt(19) + sqrt(19) + 4sqrt(76)/sqrt(4) + 0 + sqrt(190)/sqrt(90). -4 + 28sqrt(19)/3 Simplify (-1 + sqrt(180) - (-2sqrt(270))/sqrt(6) - ((1 + sqrt(45))23 - (sqrt(405) + -1)))-2. -6sqrt(5) + 280 Simplify (6(sqrt(95) - (sqrt(95) + -1sqrt(95) + sqrt(95) + sqrt(95)))5)/(4sqrt(5)-26). 5sqrt(19)/8 Simplify ((sqrt(102) + sqrt(102)3 - sqrt(102) - sqrt(102))6)/(sqrt(6) - (sqrt(600) + 1sqrt(600) - sqrt(6))) + -5. -5 - 2sqrt(17)/3 Simplify (((sqrt(95) - (sqrt(95)1 + sqrt(95)))-1 + sqrt(95) - sqrt(95))/(sqrt(25)/sqrt(5)-4)3)2. 171/16 Simplify (-32sqrt(68)-5)/(3(sqrt(100)-1 + sqrt(100) + sqrt(100))). 2sqrt(17) Simplify (-2((sqrt(224) - (sqrt(224) - 3sqrt(224))-5) + sqrt(224))/sqrt(7)-6)2. 294912 Simplify ((sqrt(88) + sqrt(88)-24 - sqrt(88)) + sqrt(88) + (-1sqrt(88) + sqrt(88) + sqrt(88))6)/(1sqrt(24)/sqrt(3)3). -sqrt(11)/3 Simplify (6(sqrt(220) - ((sqrt(220)2 + sqrt(220) + sqrt(220) - sqrt(220)) + sqrt(220))))/(-2sqrt(121)/sqrt(11)). 18sqrt(5) Simplify ((sqrt(126)/(sqrt(9)-2) - sqrt(14))/sqrt(7) - ((sqrt(96)-1)/sqrt(3))2) + 0. -32 - 3sqrt(2)/2 Simplify ((32sqrt(1296))/(-5(sqrt(300) + sqrt(300)-2)))*2. 3888/625 Simplify 5(-46(3 + sqrt(176) + (sqrt(176) - (sqrt(176) - (-1 + sqrt(176))))))*22. 184320sqrt(11) + 4078080 Simplify (-2sqrt(228)-2)/sqrt(12) + ((-1sqrt(684) + sqrt(684))*2 - sqrt(38)/(sqrt(8)/sqrt(4))). 3sqrt(19) Simplify (3(0 + 51(-1 + sqrt(72))))2. -2700sqrt(2) + 16425 Simplify -1 + sqrt(2448) + -2 + (-1 + -6(1 + sqrt(17)))2. 96sqrt(17) + 658 Simplify -6((sqrt(832) - (sqrt(832) + sqrt(832) + (-4(-2 + sqrt(832)) - sqrt(832))))6)2-4. -442368sqrt(13) + 11556864 Simplify 5 + 5((sqrt(684)-1 + -5)2 + sqrt(684) + -3 + 5). 330sqrt(19) + 3560 Simplify -2(sqrt(1539)2-6 + 1) + 3. 1 + 216sqrt(19) Simplify 2 + (sqrt(192)/sqrt(6) - (sqrt(288) + -3)*2). -295 + 76sqrt(2) Simplify -3 + 42sqrt(56)/(sqrt(16)/sqrt(2)-5). -8sqrt(7)/5 - 3 Simplify -4 + (sqrt(243) - 1(3 + sqrt(243))) + (sqrt(243) + sqrt(243) + -2)2-5. -4887 + 360sqrt(3) Simplify (((-2sqrt(144))/sqrt(4))/(sqrt(50) + sqrt(150)/sqrt(3) + sqrt(2))2)2. 288/121 Simplify ((sqrt(121)1 - sqrt(121))1)/sqrt(11) - ((sqrt(440)3)/sqrt(8))/sqrt(5). -3sqrt(11) Simplify 4 + (sqrt(32) - (sqrt(2592) + -4 + sqrt(2592)))2 + 3. -544sqrt(2) + 9271 Simplify (sqrt(180) - (3 + sqrt(180)1) - (sqrt(5)-2 + -4 + sqrt(5))-2)2. 44sqrt(5) + 141 Simplify ((sqrt(68) + -1 + 3 + sqrt(68))4)2 + -5 + -52sqrt(68). 236sqrt(17) + 4411 Simplify (-3sqrt(2240))/(sqrt(35)/(sqrt(245) + sqrt(5))). -192sqrt(5) Simplify ((sqrt(2160) - sqrt(2160)2-3) + sqrt(2160))/(sqrt(300)25). 24sqrt(5)/25 Simplify -5 + (5(sqrt(119) + sqrt(119) + sqrt(119)4 - sqrt(119)) - sqrt(119))/(sqrt(175)4 - sqrt(175)). -5 + 8sqrt(17)/5 Simplify 5 + (sqrt(6336) - sqrt(6336)-3 - sqrt(44))/(-4sqrt(8)/sqrt(2))-2. 5 + 47sqrt(11)/2 Simplify (1 + sqrt(162)1 + sqrt(162) + (sqrt(2) - (2 + sqrt(2) + 3 - sqrt(2)))-4)2. 588sqrt(2) + 833 Simplify (2 + (sqrt(2448) - (1 + sqrt(2448))-1) + 0)2. 144sqrt(17) + 9801 Simplify ((-6(sqrt(567) - (sqrt(567) - (1 + sqrt(567)))) + 0 + sqrt(567) + -1)-2 + 4)*2. 3240sqrt(7) + 57024 Simplify 1(((sqrt(65) - 2sqrt(65))/sqrt(5) - (sqrt(13) + 0)-2) + sqrt(117)/(sqrt(90)/(sqrt(10)-2))). -sqrt(13) Simplify ((2(2sqrt(448) + sqrt(448))-3-5 + 1)1)2. 1440sqrt(7) + 3628801 Simplify 2 + (-2(sqrt(209) - (1sqrt(209) - sqrt(209))))/(sqrt(1584)-3 - sqrt(1584)). sqrt(19)/24 + 2 Simplify sqrt(98) + 1 + sqrt(2) + (sqrt(18) + 1)2 + -4. 16 + 14sqrt(2) Simplify (-1sqrt(128) + sqrt(24)/sqrt(27))/((-5sqrt(24)-2)/sqrt(6)). -11sqrt(2)/30 Simplify -4(-3 + 2sqrt(76)1)2. -1252 + 96sqrt(19) Simplify ((-2sqrt(65)-6 + sqrt(65) + 1(sqrt(65)-2 + sqrt(65)))/(sqrt(500) + -1sqrt(500)-2))*2. 52/25 Simplify (sqrt(5) - sqrt(50)/(sqrt(360) - sqrt(10)) - -4sqrt(50)/sqrt(10))*2 + 3. 591/5 Simplify ((sqrt(76) + sqrt(76) + 1 - sqrt(76))-4 + -2 - sqrt(76)26-6)2. -1632sqrt(19) + 351460 Simplify (sqrt(20) - (-4sqrt(720) + sqrt(720)))/(-1sqrt(196)). -19sqrt(5)/7 Simplify (4sqrt(684) + (sqrt(133) - (sqrt(133) - (sqrt(133) + sqrt(133)-4)))/sqrt(7) + sqrt(19))2 + -2. 9194 Simplify ((sqrt(171) + sqrt(171) + -4 + -1sqrt(171) - sqrt(171))6 + -3(1 + sqrt(171) + 4))*2. 702sqrt(19) + 3060 Simplify 4(sqrt(15)/(sqrt(20)-1) + 2-1sqrt(3) + sqrt(3) + sqrt(3) + 1 + sqrt(3) + 1). 2sqrt(3) + 8 Simplify (sqrt(228)/(sqrt(384)-2))/(2sqrt(8)-1). sqrt(19)/64 Simplify (-2 + sqrt(112) + (sqrt(112) - (sqrt(112) + 3 - sqrt(112) - sqrt(112))) + sqrt(112) - (sqrt(112) + 2sqrt(112))-4)*2. -640sqrt(7) + 28697 Simplify (-3 + -1 + (sqrt(5) - (sqrt(5) + -1sqrt(180)) - ((sqrt(5)-1 + sqrt(5))-4 - sqrt(5))) + -1)2. -70sqrt(5) + 270 Simplify (4(-3 + sqrt(567) + 2 + -2))2 + 1. -864sqrt(7) + 9217 Simplify -5 + 6sqrt(2)1 - (2 + 2 + sqrt(288)). -9 - 6sqrt(2) Simplify ((-1sqrt(704)2 + 4sqrt(704)2)2)*2. 101376 Simplify (1sqrt(1088)3 - (sqrt(1088) - (2 + 2sqrt(1088) + sqrt(1088))) - -2(sqrt(68)1 + sqrt(68))1)2. 192sqrt(17) + 39172 Simplify 3(-4 + 2 + (-2 + sqrt(1300))6 + 0)*2. -5040sqrt(13) + 140988 Simplify (sqrt(2695) - (sqrt(2695) - (sqrt(2695)-1 - sqrt(2695))-2))/((sqrt(132) - (sqrt(132) + (sqrt(132) - -2sqrt(132))3))/sqrt(12)). -28sqrt(5)/9 Simplify -5 + ((-1sqrt(12)/(sqrt(2)-2))/(sqrt(22)/sqrt(99) - (sqrt(98) + 2sqrt(98) + sqrt(98))))*2. -137753/27556 Simplify ((1(-2sqrt(288) - sqrt(288) - sqrt(288)) + 2)61)2. -6912sqrt(2) + 166032 Simplify -5(3(sqrt(343) + 1 + 1)-4)2. -249840 - 20160sqrt(7) Simplify -2(sqrt(847) + 4 - (sqrt(77) + 3sqrt(77))/sqrt(11))*2-4. 4	{ "pile_set_name": "DM Mathematics" }
c - 5. Determine -7s(y) - 4z(y). 5y - 1 Let g(w) = 8w2 + 3w - 5. Let p(h) = 4h2 + 2h - 3. Suppose l = 4j - 15, 3j = -4l + 26 - 10. Give jg(x) - 7p(x). 4x*2 - 2x + 1 Let z(o) = 4o + 2. Let g(r) = r. Calculate 2g(i) + z(i). 6i + 2 Let t(a) = -6a*3 - 3a*2 + 3a. Let j(w) = -w*3 + w. Let s(k) = 10k*3 + 2k*2 - 7k. Let g(c) = -5j(c) - s(c). Determine -3g(q) + 2t(q). 3q*3 Let a(q) = q + 6. Let f(c) = -c - 1. Let b = -25 + 24. Determine ba(j) - 3f(j). 2j - 3 Let q(z) = 0 - 3z - 3z + 3z + z2 + 1. Let a(n) = -n. Determine 5a(c) - q(c). -c*2 - 2c - 1 Let b(s) = s*2 - s - 1. Let t(h) = h + 2. Determine -3b(o) - 2t(o). -3o*2 + o - 1 Suppose -17 = -2j - 27. Let x be 3/9-3 - j. Let y(b) = 6b*3 - 4b*2 - 4b + 2. Let o(d) = 7d3 - 5d*2 - 5d + 3. Determine xo(k) - 5y(k). -2k3 + 2 Let o(s) = -3s*3. Suppose 0 = -0y - 2y. Let t = -4 - -7. Let b(g) = -4g*t + 5g*3 + yg*3. Determine -2b(w) - o(w). w*3 Let a(l) = 5l*2 + 6l - 6. Suppose 4b - 2b = -12. Let v(i) = -14i2 - 17i + 17. Calculate bv(z) - 17a(z). -z*2 Let p(q) = 4q*3 - 8q*2 - 2. Let l(k) = 3k*3 - 5k*2 - 1. Give 8l(a) - 5p(a). 4a*3 + 2 Let g(k) = 4k*3 + 5k*2 + 8k - 6. Let m(w) = -2 + 3 - w - 3w2 + 2w2 - w3. Give g(o) + 6m(o). -2o3 - o2 + 2o Let h(p) = -3p*3 - 3p*2 + 5p - 5. Let z(v) = -9v - v2 - 1 + 23v - 13v. Determine h(s) - 5z(s). -3s3 + 2s*2 Let x(k) = 6k*3 - 3k + 4. Let u(h) = 9 - 27h - 16h - h*3 + 37h + 14h3. Calculate -4u(f) + 9x(f). 2f*3 - 3f Let q(l) = l + 3. Let d be q(8). Let f(z) = 30z2 - 30z*2 - 14z + 14 + 14z3. Let p(c) = 5c*3 - 5c + 5. Calculate dp(i) - 4f(i). -i*3 + i - 1 Let p(g) = -7. Let w(f) = 6. Let u(q) = 5p(q) + 6w(q). Let r be (-2)/80 - 3. Let m(x) = -x - 1. Determine ru(s) - 3m(s). 3s Let u(o) be the third derivative of o4/24 - o3 - 6o*2. Suppose 0 - 4 = t. Let r(v) = v - 5. Give tu(z) + 5r(z). z - 1 Let n(t) = -17t + 13. Let h(w) be the third derivative of -w4/3 + w3 - 8w2. What is 9h(x) - 4n(x)? -4x + 2 Let a = 734/273 + -2/91. Let q(p) be the first derivative of -3 + 0p + ap*3 + 1/2p*2. Let b(t) = -7t*2 - t. Determine -6b(m) - 5q(m). 2m2 + m Let x(o) = -o + 1. Let n(i) = -i2 + 5i - 6. Determine -n(f) - 4x(f). f*2 - f + 2 Let j(q) = 3q*2 + 9q + 9. Let l(r) = -r*2 - 4r - 4. What is 2j(z) + 5l(z)? z*2 - 2z - 2 Let v(x) = -5x2 + 2x*2 + 4x*2 - 2x. Let z(u) = -u*2 + 5u - 2. Let m be z(4). Let d(t) = -t*2 + t. Give md(j) + v(j). -j*2 Suppose -5 = -2q + q. Suppose qc - 35 = -2s, 4c - 20 = -c + s. Let g(x) = 3x - 9. Let n(l) = -5l + 14. Determine cn(r) + 8g(r). -r - 2 Let x(y) = 16 - 6y + 16y2 + 1 + 7y - 6. Let g(j) = 3j2 + 2. Give 22g(t) - 4x(t). 2t*2 - 4t Suppose -3 = -a - 1. Let m(j) = -5j2 + 3j*2 - 2ja. Let i(q) = q2. Give -6i(l) - m(l). -2l*2 Let z(c) = c + 3. Let k(j) = 6. Let m(v) = -1. Let h(t) = k(t) + 5m(t). What is -7h(u) + 2z(u)? 2u - 1 Let i(a) = -9a*3 - 5a*2 + 4a - 7. Let t be 0 + 0 + (-6)/(-2). Let u(s) = -10 + 6s - 1 - 6s*t - 7s3 - s3 - 8s2. Determine 8i(c) - 5u(c). -2c*3 + 2c - 1 Let f(t) = 2t2 - t + 1. Let d = -140 - -143. Let k(z) = -6z*2 + 4z - 4. Determine dk(b) + 10f(b). 2b2 + 2b - 2 Let g(o) = 3o - 1. Let x(w) = -4 - 8w*2 + 9w*2 + 5 - 4w. What is -3g(f) - 2x(f)? -2f2 - f + 1 Suppose 6 = -3i + 15. Let d(q) = -2q + 3. Let k(x) = -2x + x - 2x + 4. Let o be (-1)/(-3) - 104/24. Determine ik(u) + od(u). -u Let t(c) = 2c2 - c + 2. Let o(n) = n2 + 1. Give -o(h) + t(h). h*2 - h + 1 Suppose 0 = -3u - 50 + 11. Let l(i) = 4i3 - 13i*2 + 11i + 2. Let p(w) = 2w3 - 6w*2 + 5w + 1. Let g = 12 + -6. What is gl(b) + up(b)? -2b3 + b - 1 Suppose -11 + 9 = c. Let q(h) = -h2 - 3h + 3. Let f(s) = -s*2 - 2s + 2. Let l(b) = cq(b) + 3f(b). Let x(i) = 6i2 - 2i + 1. Determine 4l(j) + x(j). 2j*2 - 2j + 1 Let n(f) = -f - 2 + 2f - 3f + 6f2. Let z = 7 - 3. Let h(o) = -7o*2 + 3o + 3. Determine zh(b) + 5n(b). 2b2 + 2b + 2 Let x be 18/(-4) + 9/18. Let f(z) = -2z3 + 4z*2 - 2z - 4. Let s be 6/((6 + -2)/2). Let u(h) = -h*3 + 3h*2 - h - 3. Calculate sf(y) + xu(y). -2y*3 - 2y Let k = 21 - 9. Let v be k/(4(-1)/(-2)). Let z(x) = x2 - x - 1. Let m(p) = 7p*2 - 5p - 6. What is vz(q) - m(q)? -q2 - q Let t(b) = -190b - 55. Let u(i) = 7i + 2. Let y(j) = -2t(j) - 55u(j). Let a(z) = 5z. Calculate -6a(s) - 5y(s). -5s Let c(u) = -u2 - u - 1. Let a(p) = p3 + 3p*2 + 2p + 1. Suppose 5j + 0 + 1 = -y, -2j = y + 1. Determine yc(n) - a(n). -n3 - 2n2 - n Let b = 1 + 5. Let s(n) = n3 + 7n2 + 5. Let p be s(-7). Let t = p - b. Let y(q) = 3q + 2. Let m(d) = -d. Determine ty(r) - 2m(r). -r - 2 Let k(t) = t*3 + 9t*2 + 10t + 17. Let r be k(-8). Let y(d) = d*2 - 2. Let u(x) = 1. Give ry(j) + 2u(j). j2 Let c(l) = -l3 - 2l*2 + 2l + 2. Let i(y) = 4y3 + 0y*2 - 3y*2 - 9 - 9y + 12y2. Determine -18c(f) - 4i(f). 2f3 Let h(g) be the second derivative of -g3/6 + 2g. Let u be -1 + (12 - -2)/2. Let b be (u/4 - 2)-2. Let a(j) = 4j - 1. Calculate ba(c) + 6h(c). -2c - 1 Let z(w) = -8w2 + 5w + 4. Let v = -50 - -56. Let j(i) = -24i2 + 10 + 14i + i*2 + 1. Give vj(p) - 17z(p). -2p*2 - p - 2 Let h(v) = -10v*3 - 2v*2 + 5v + 4. Let c(t) = -10t3 - t2 + 4t + 3. Calculate 4c(i) - 3h(i). -10i3 + 2i*2 + i Let n(p) = -22p*2 + 4p. Let k(x) = 22x2 - 5x. Determine 4k(j) + 5n(j). -22j2 Let c(h) = 119h*3 - 85h. Let d(g) = -g*3 + g. What is -2c(q) - 170d(q)? -68q*3 Let d(h) = -h. Let z(v) = -15v + 2. Let g(r) = 7r - 1. Let p(u) = 7g(u) + 3z(u). Determine 6d(o) + p(o). -2o - 1 Let n(h) be the third derivative of 11h4/24 + h2 - 2h. Let g(y) = -2y. Calculate -34g(a) - 6n(a). 2a Let j(r) = -1 - 2r*2 + 0 + 2r2 - r2. Let o(q) = 2q2 + 4. Give -6j(k) - o(k). 4k2 + 2 Let s(x) = -3x2 + x - 15. Let z(l) = -l2 - 1. What is s(f) - 2z(f)? -f2 + f - 13 Let q(w) = 4w*3 - 3w*2 - 8w. Let n(j) = -2j3 + j2 + 4j. Let r(b) = 9n(b) + 4q(b). Let v(m) = -5m3 - 8m*2 + 11m. Calculate -11r(y) + 4v(y). 2y3 + y2 Let q(m) = 11m*3 + 7m*2 + 5m - 9. Let g(f) = 6f3 + 4f*2 + 3f - 5. Determine 7g(t) - 4q(t). -2t3 + t + 1 Let h(k) = 11k*2 + 4k + 6. Let q = -49 + 43. Let m(y) = 21y2 + 7y + 11. Give qm(l) + 11h(l). -5l2 + 2l Let j(a) = -7a - 9. Let c = -9 + 10. Let x(k) = -2 + c - 4k - 4. Determine 3j(s) - 5x(s). -s - 2 Let v(d) = d - 1. Let t(r) = 5r - 7. What is -t(l) + 2v(l)? -3l + 5 Let p(j) = -j + 1. Let g = -164 - -169. Let s(d) = 4d - 4. Calculate gp(y) + s(y). -y + 1 Let t(p) = -3p3 + p2 - 3p + 2. Let c = -3 + 1. Let b(k) = -7k*3 + 2k*2 - 7k + 5. What is cb(v) + 5t(v)? -v3 + v2 - v Let w(x) = -x + 6. Let k(h) = 3h - 15. Give 5k(a) + 12w(a). 3a - 3 Let l(k) = k2 + k - 1. Let g(a) = -a2 + 1 + 3a + 3a - 3a - 4a. Suppose -5j - 3p = 20, -2j - 2p - 3p - 27 = 0. Give jg(n) + l(n). 2n2 + 2n - 2 Let s = 29 + -25. Let p(m) = -7m. Let u(r) = 8r. Determine sp(z) + 3u(z). -4z Let s(c) = -9c + 2. Let m(n) = -9n + 2. Give 3m(i) - 4s(i). 9i - 2 Let p(a) = -a + 2 - 5 + 4a + 3a*2 - 6a*3. Let l(m) = -11m*3 + 5m*2 + 5m - 5. Give 3l(z) - 5p(z). -3z3 Let j(n) = n2 + 1. Let u(t) = 5t*3 - 26t*2 - 12. Let o(f) = 2f*3 - 9f*2 - 4. Let y(r) = 8o(r) - 3u(r). Determine 4j(m) - y(m). -m*3 - 2m*2 Let z(n) = 4n*3 - 4n*2 - 2n + 2. Let f be ((-5)/1)/(-2 + 1). Let y(k) = -9k3 + 9k*2 + 5k - 5. Calculate fz(c) + 2y(c). 2c3 - 2c*2 Let t(i) = -5i*3 - 2i*2 + 3i. Let s(v) = 5v3 + 3v*2 - 4v - 1. Give 3s(l) + 4t(l). -5l3 + l2 - 3 Let v(t) = -t3 - t2 + 1. Let a be 1/(-2) + (-2)/4. Let u(b) be the second derivative of b5/10 - b3/3 - b2/2 + 110b. Determine av(f) - u(f). -f3 + f2 + 2f Let a(r) be the third derivative of -r5/12 + r2. Let u be (-6)/15 + (-12)/(-5). Suppose -2k + u = -14. Let t(f) = -14f*2. Calculate ka(h) - 3t(h). 2h*2 Suppose 0 = -l + 2 - 0, i + 3 = 2l. Let w(d) = i + d + 2*d +	{ "pile_set_name": "DM Mathematics" }
516 In base 13, what is -6427239 + 3? -6427236 In base 11, what is -109 + 2a823? 2a715 In base 10, what is -34651 + -740? -35391 In base 14, what is 9 + -191800? -1917d5 In base 5, what is 4 + -213443111? -213443102 In base 7, what is 233253 + -105235? 125015 In base 5, what is -1141441 + 402132? -234304 In base 13, what is -c4310678 + -3? -c431067b In base 6, what is 10 + -11035304? -11035254 In base 13, what is 226 + c862? ca88 In base 12, what is 70 - b5a7? -b537 In base 2, what is -101101100100010 - 10000011? -101101110100101 In base 14, what is 8 - -3860176? 3860180 In base 4, what is -10032301 - 23102? -10122003 In base 14, what is -1581 - -50b? -1074 In base 9, what is -1422746 + 2? -1422744 In base 6, what is 2123 + -412151? -410024 In base 11, what is 3 + 3a62163? 3a62166 In base 9, what is 72 - 64141? -64058 In base 12, what is 6552b9 + 24? 655321 In base 6, what is -311 - -141551305? 141550554 In base 4, what is -3030302322 - 3? -3030302331 In base 6, what is 1211 + 1452344? 1453555 In base 6, what is 2 + 1302345042? 1302345044 In base 7, what is 3 + 154216205? 154216211 In base 7, what is 2022600045 + -6? 2022600036 In base 5, what is 12012 + 1211401? 1223413 In base 7, what is 64634 - 1511? 63123 In base 6, what is 312430 - 11310? 301120 In base 14, what is 13a6977 + 2? 13a6979 In base 4, what is -2103 - -31321131? 31313022 In base 14, what is -1 - 2b26cc0? -2b26cc1 In base 12, what is 4432 - -1707? 5b39 In base 3, what is 201010202212 - -10102? 201010220021 In base 11, what is a - 54157? -54148 In base 5, what is 142422212243 + -2? 142422212241 In base 12, what is 39644957 + 3? 3964495a In base 9, what is 20023 - 1777? 17135 In base 3, what is -1100111201 + 22211? -1100011220 In base 11, what is a077a - -115? a0894 In base 15, what is -53500 + -d59? -54359 In base 16, what is 3f8 - -3f4b4? 3f8ac In base 13, what is 2809c + -1? 2809b In base 9, what is 658 + 1688735? 1700504 In base 14, what is 70b6 + a3b? 7b13 In base 14, what is -4992570 - 7? -4992577 In base 7, what is 655046 - -636? 656015 In base 9, what is 1028 + -833654? -832625 In base 13, what is c9 + -192046? -191c4a In base 7, what is -1521434 + 123? -1521311 In base 11, what is 1786659 + -46? 1786613 In base 16, what is 6 - -3664ec? 3664f2 In base 11, what is 2 - 1327563? -1327561 In base 9, what is -16020415 - 50? -16020465 In base 11, what is -2778 + -676a? -9437 In base 3, what is -2020221200200 + 1220? -2020221121210 In base 14, what is 3a4934 + 5? 3a4939 In base 9, what is -1160504 + -16? -1160521 In base 4, what is 10202 - -20002212? 20013020 In base 7, what is 4 - 2136330434? -2136330430 In base 12, what is 2 + 83293? 83295 In base 11, what is 0 + 32a5614? 32a5614 In base 16, what is -32e6985 + 2? -32e6983 In base 2, what is -111011 + -10001010111100101110? -10001010111101101001 In base 3, what is 210220100222 - 21? 210220100201 In base 16, what is 5 + 11ba375? 11ba37a In base 7, what is -5150236 - 4? -5150243 In base 14, what is 16177 - 5b7c? 103d9 In base 16, what is 15cef + 35? 15d24 In base 16, what is -21d0 + 1ac22? 18a52 In base 11, what is 78 - -2a9190? 2a9258 In base 2, what is 100110111111000 - -110011011110? 101101011010110 In base 8, what is 1 - -2307467? 2307470 In base 9, what is 2 - 1872448? -1872446 In base 12, what is -8 - -1899839? 1899831 In base 10, what is -11137 + 25? -11112 In base 13, what is 1b + -634c706? -634c6b8 In base 15, what is -1da + 84ed? 8313 In base 9, what is 4843672 - -8? 4843681 In base 12, what is -21 - 62111? -62132 In base 16, what is -45edc - 47? -45f23 In base 11, what is -4 - -6a3236? 6a3232 In base 14, what is -4c77 + -305? -517c In base 9, what is 111048710 - 10? 111048700 In base 13, what is -1187 + 61b5? 502b In base 5, what is 141334321 + -33? 141334233 In base 8, what is -3 + -2076350? -2076353 In base 2, what is 10011010001110 - -11001101100? 10110011111010 In base 5, what is 12013112 - -242? 12013404 In base 13, what is 17924 - 78? 17879 In base 5, what is -1403043 + -22334? -1430432 In base 9, what is -546817 - 206? -547124 In base 5, what is 11 - -13440344324? 13440344340 In base 4, what is -2202133130 + -211? -2202200001 In base 15, what is 2b320 + -11b5? 2a15a In base 9, what is 5 + 5532400? 5532405 In base 12, what is 23 + 111b5a? 111b81 In base 14, what is -4 + 27466d6? 27466d2 In base 13, what is -2c8495 - 1a? -2c84b2 In base 8, what is 3 - 1006413031? -1006413026 In base 11, what is 3 - 19413721? -19413719 In base 7, what is 23452 + 63044? 116526 In base 10, what is -26688 - -669? -26019 In base 7, what is -1632253 - 2? -1632255 In base 3, what is 121020010 - 1120010? 112200000 In base 12, what is -9891b + -8? -98927 In base 5, what is 301343 + 230124? 1032022 In base 12, what is 7284b06b + 4? 7284b073 In base 16, what is 11c2bc - -3? 11c2bf In base 8, what is 4 - -54200542? 54200546 In base 7, what is 0 + 2501311250? 2501311250 In base 13, what is 14 - -141aba56? 141aba6a In base 7, what is -254445011 - 10? -254445021 In base 16, what is -82dccc + 5? -82dcc7 In base 11, what is 2711827 + -19? 2711809 In base 11, what is -44156 - -28? -44129 In base 4, what is -12012320003211 - 2? -12012320003213 In base 12, what is -93527 - 52b? -93a56 In base 15, what is 7 - -37cd679? 37cd681 In base 4, what is -1333312 - -3222? -1330030 In base 5, what is 322210 + -12? 322143 In base 11, what is -155 - -1033255? 1033100 In base 3, what is 12110110 + -12121000? -10120 In base 10, what is -3 + -43173764? -43173767 In base 4, what is -212203011312 + 1? -212203011311 In base 6, what is -4 - 144045504? -144045512 In base 13, what is bc3b6 + -41c? bbc97 In base 3, what is 12010121020 - -202220? 12011101010 In base 6, what is 132110 - 5015? 123051 In base 2, what is 1000111011010000010110 + 10? 1000111011010000011000 In base 12, what is -2992 + -30166? -32b38 In base 9, what is 86 + 25015? 25112 In base 2, what is 101 + 110011101101011010000001? 110011101101011010000110 In base 13, what is -18192ca7 + 3? -18192ca4 In base 15, what is -c13c1 - 1a? -c13db In base 6, what is 423214 - -112? 423330 In base 16, what is -10 + 5df70? 5df60 In base 10, what is -168 + 90153? 89985 In base 15, what is 7edbe - -13c6? 81295 In base 15, what is 9b11c8 - 14? 9b11b4 In base 7, what is 131303023 + -14? 131303006 In base 3, what is 120 + 212100220011022? 212100220011212 In base 2, what is 10110010010100011110001010 + 11111? 10110010010100011110101001 In base 16, what is -b + -d6ba8e? -d6ba99 In base 10, what is 15 - -753612? 753627 In base 4, what is -310200302123 - 0? -310200302123 In base 12, what is 667220 + 1? 667221 In base 3, what is 12 + 101212021100012122? 101212021100012211 In base 3, what is -12121220022101 + 12? -12121220022012 In base 7, what is 35324 - 2642? 32352 In base 9, what is 20 - 21211377? -21211357 In base 6, what is 4 - -20100540324? 20100540332 In base 4, what is -301 - 3300333312? -3301000213 In base 5, what is -24124 + -220221? -244400 In base 8, what is -17173273 + -5? -17173300 In base 7, what is 13 - -4563262? 4563305 In base 8, what is 5 - 1074052? -1074045 In base 10, what is -633 - 2688? -3321 In base 2, what is 11010100100110011110 + -1001? 11010100100110010101 In base 4, what is 11330122003301 + 2? 11330122003303 In base 14, what is -31 - ca5c? -ca8d In base 9, what is 16762081 - -1? 16762082 In base 5, what is -12 + -124104142? -124104204 In base 4, what is 123 + -223001120? -223000331 In base 8, what is 356143 + -15? 356126 In base 4, what is -2200102310103 - 0? -2200102310103 In base 6, what is -41310 + 350140? 304430 In base 2, what is -101100000011 + 110110101001010? 110001001000111 In base 16, what is 2bed7 + 10? 2bee7 In base 14, what is -1d88567 + -9? -1d88572 In base 7, what is -5 - -100136504? 100136466 In base 12, what is -2b06 - -601? -2505 In base 5, what is 3022 + -21032324? -21024302 In base 16, what is 20d2f7 + 3? 20d2fa In base 4, what is -2201313310 + -10? -2201313320 In base 3, what is -112021102122 - -12? -112021102110 In base 2, what is 1110110011 + -1110101011010? -1100110100111 In base 4, what is -21211022 + -10110? -21221132 In base 8, what is -334550 + 6? -334542 In base 12, what is -156 - 35b13a? -35b294 In base 14, what is 93 + -d30a2? -d300d In base 2, what is -10000101100001	{ "pile_set_name": "DM Mathematics" }
d - 114 What is the n'th term of 431, 1270, 2525, 4196, 6283, 8786, 11705? 208n*2 + 215n + 8 What is the r'th term of 236, 227, 212, 191? -3r2 + 239 What is the c'th term of -233, -667, -1103, -1541, -1981? -c2 - 431c + 199 What is the s'th term of 119, 446, 973, 1700? 100s2 + 27s - 8 What is the s'th term of 5624, 10329, 15034, 19739? 4705s + 919 What is the k'th term of 352, 1418, 3190, 5662, 8828, 12682, 17218? -k3 + 359k*2 - 4k - 2 What is the g'th term of -72216, -72217, -72218? -g - 72215 What is the i'th term of -1282, -2643, -3998, -5347, -6690? 3i2 - 1370i + 85 What is the a'th term of 47713, 47731, 47751, 47773, 47797, 47823? a*2 + 15a + 47697 What is the x'th term of -2411, -4777, -7143, -9509, -11875, -14241? -2366x - 45 What is the n'th term of 7153, 28690, 64611, 114916, 179605, 258678? 7192n*2 - 39n What is the y'th term of 2, -55, -158, -313, -526? -y*3 - 17y*2 + y + 19 What is the k'th term of 447, 1534, 3261, 5628, 8635, 12282, 16569? 320k*2 + 127k What is the u'th term of -126871, -253753, -380647, -507559, -634495, -761461, -888463? -u*3 - 126875u + 5 What is the u'th term of -2897, -11482, -25783, -45794, -71509, -102922? u*3 - 2864u*2 - 34 What is the a'th term of 268, 522, 940, 1522, 2268? 82a*2 + 8a + 178 What is the n'th term of 8747, 17492, 26237, 34982, 43727? 8745n + 2 What is the v'th term of -2838, -2952, -3142, -3408, -3750, -4168, -4662? -38v*2 - 2800 What is the q'th term of -1074, -3542, -7656, -13416, -20822, -29874? -823q2 + q - 252 What is the l'th term of -426, -618, -588, -330, 162, 894? l3 + 105l2 - 514l - 18 What is the f'th term of -90, -149, -250, -393, -578? -21f2 + 4f - 73 What is the r'th term of -5166, -5125, -5062, -4977? 11r2 + 8r - 5185 What is the j'th term of 52, 1151, 2990, 5575, 8912, 13007? j*3 + 364j*2 - 313 What is the y'th term of 6255, 5899, 5543, 5187, 4831? -356y + 6611 What is the u'th term of 1323, 1343, 1377, 1425? 7u2 - u + 1317 What is the u'th term of 5361, 10724, 16087? 5363u - 2 What is the p'th term of 18497, 18501, 18505, 18509, 18513, 18517? 4p + 18493 What is the x'th term of -1766, -3495, -5224, -6953, -8682? -1729x - 37 What is the o'th term of 820049, 1640095, 2460143, 3280193? o*2 + 820043o + 5 What is the u'th term of -917077, -3668312, -8253703, -14673250, -22926953, -33014812, -44936827? -917078u2 - u + 2 What is the q'th term of 20721, 20667, 20515, 20217, 19725? -8q3 - q2 + 5q + 20725 What is the c'th term of -380508, -380512, -380518, -380526, -380536, -380548? -c2 - c - 380506 What is the p'th term of 250384, 250382, 250378, 250372, 250364, 250354, 250342? -p2 + p + 250384 What is the c'th term of 55096, 110185, 165288, 220411, 275560? c3 + c2 + 55079c + 15 What is the j'th term of -362, -464, -562, -656, -746? 2j2 - 108j - 256 What is the b'th term of -1979, -3883, -5787? -1904b - 75 What is the h'th term of -199, -204, -209, -214? -5h - 194 What is the d'th term of -44118, -88056, -131994, -175932, -219870, -263808? -43938d - 180 What is the a'th term of -32339, -32334, -32329, -32324, -32319? 5a - 32344 What is the r'th term of 83, 383, 1199, 2789, 5411, 9323, 14783? 43r3 - r + 41 What is the f'th term of 108, 238, 378, 528, 688, 858, 1038? 5f*2 + 115f - 12 What is the p'th term of -126592, -253181, -379770, -506359, -632948, -759537? -126589p - 3 What is the a'th term of -91030, -364127, -819290, -1456519, -2275814, -3277175, -4460602? -91033a*2 + 2a + 1 What is the a'th term of -9402, -9409, -9416, -9423, -9430, -9437? -7a - 9395 What is the y'th term of -1891, -1881, -1857, -1813, -1743, -1641? y3 + y2 - 1893 What is the r'th term of 33, 90, 213, 426, 753, 1218? 4r*3 + 9r*2 + 2r + 18 What is the t'th term of -51532, -103078, -154624? -51546t + 14 What is the d'th term of -169, -375, -509, -535, -417? 6d*3 - 248d + 73 What is the m'th term of -88459, -88458, -88457? m - 88460 What is the b'th term of -367, -1414, -3159, -5602? -349b2 - 18 What is the o'th term of -16607, -16574, -16517, -16436, -16331, -16202? 12o*2 - 3o - 16616 What is the f'th term of -1067561, -1067563, -1067567, -1067573, -1067581, -1067591, -1067603? -f2 + f - 1067561 What is the m'th term of -10713, -21431, -32163, -42915, -53693, -64503, -75351, -86243? -m3 - m*2 - 10708m - 3 What is the l'th term of -2124, -2146, -2168? -22l - 2102 What is the k'th term of -34819, -34821, -34823, -34825, -34827? -2k - 34817 What is the r'th term of 42, 671, 2472, 6033, 11942, 20787, 33156? 98r3 - 2r*2 - 51r - 3 What is the k'th term of -28507, -28497, -28481, -28459? 3k2 + k - 28511 What is the w'th term of -2144, -4297, -6446, -8585, -10708, -12809, -14882? w3 - 4w*2 - 2148w + 7 What is the x'th term of 212, 178, 152, 134, 124, 122? 4x2 - 46x + 254 What is the f'th term of 2903, 5805, 8703, 11597? -2f2 + 2908f - 3 What is the a'th term of 128, 216, 294, 362, 420, 468? -5a2 + 103a + 30 What is the a'th term of 823, 1012, 1199, 1384, 1567? -a*2 + 192a + 632 What is the o'th term of -1098, -1146, -1218, -1308, -1410, -1518? o*3 - 18o*2 - o - 1080 What is the f'th term of -1674294, -1674293, -1674292, -1674291? f - 1674295 What is the b'th term of 620, 2053, 4444, 7793, 12100, 17365? 479b*2 - 4b + 145 What is the s'th term of 472, 929, 1396, 1873? 5s2 + 442s + 25 What is the b'th term of 316903, 633793, 950675, 1267543, 1584391, 1901213? -b*3 + 2b*2 + 316891b + 11 What is the g'th term of -23106, -23122, -23138, -23154, -23170, -23186? -16g - 23090 What is the b'th term of -19047, -38097, -57139, -76167, -95175? b3 - 2b*2 - 19051b + 5 What is the a'th term of -414, -1725, -3932, -7035, -11034, -15929? -448a2 + 33a + 1 What is the v'th term of 98, 200, 328, 494, 710, 988, 1340, 1778? 2v3 + v2 + 85v + 10 What is the t'th term of -223, -422, -967, -2032, -3791, -6418, -10087, -14972? -29t3 + t2 + t - 196 What is the k'th term of -8607, -8604, -8599, -8592, -8583, -8572, -8559? k2 - 8608 What is the x'th term of -811891, -1623782, -2435673, -3247564, -4059455? -811891x What is the s'th term of -9, -176, -633, -1518, -2969, -5124, -8121? -23s3 - 7s*2 + 15s + 6 What is the a'th term of 2594, 5229, 7864? 2635a - 41 What is the v'th term of 610778, 610778, 610780, 610784, 610790, 610798? v2 - 3v + 610780 What is the d'th term of -49, 46, 143, 236, 319, 386, 431, 448? -d*3 + 7d*2 + 81d - 136 What is the k'th term of -417, -812, -1181, -1524, -1841? 13k2 - 434k + 4 What is the a'th term of 1266, 2552, 3858, 5184, 6530? 10a2 + 1256a What is the o'th term of -21540, -21546, -21554, -21564, -21576, -21590? -o*2 - 3o - 21536 What is the m'th term of 15799, 15807, 15815, 15823, 15831, 15839? 8m + 15791 What is the a'th term of 739, 6153, 20833, 49411, 96519? 772a3 + a2 + 7a - 41 What is the c'th term of -4683, -9358, -14031, -18702, -23371, -28038, -32703? c2 - 4678c - 6 What is the x'th term of 422946, 422944, 422934, 422910, 422866, 422796, 422694? -x*3 + 2x*2 - x + 422946 What is the b'th term of 39392, 39399, 39406, 39413, 39420, 39427? 7b + 39385 What is the c'th term of 1860, 3729, 5598, 7467, 9336, 11205? 1869c - 9 What is the n'th term of 12940, 12944, 12948, 12952, 12956? 4n + 12936 What is the r'th term of 33, 431, 1511, 3615, 7085, 12263, 19491? 57r3 - r2 + 2r - 25 What is the t'th term of -1824, -3566, -5274, -6948? 17t2 - 1793t - 48 What is the k'th term of -262025, -524049, -786073, -1048097, -1310121, -1572145? -262024k - 1 What is the c'th term of 30106, 60209, 90312? 30103c + 3 What is the z'th term of -362, -1484, -3348, -5948, -9278, -13332? z*3 - 377z*2 + 2z + 12 What is the t'th term of -11307, -11316, -11325, -11334, -11343, -11352? -9t - 11298 What is the l'th term of 6397, 51035, 172195, 408139, 797129, 1377427, 2187295, 3264995? 6377l3 - l2 + 2l + 19 What is the b'th term of 1685, 6736, 15115, 26792, 41737, 59920, 81311? -5b*3 + 1694b*2 + 4b - 8 What is the p'th term of 2084, 8341, 18772, 33377, 52156, 75109, 102236? 2087p2 - 4p + 1 What is the u'th term of -830, -1356, -1880, -2408, -2946, -3500, -4076, -4680? -u	{ "pile_set_name": "DM Mathematics" }
-124.99. Let u = -1 + 23. Let w be (-6)/(-9) - u/6. Which is the third biggest value? (a) w (b) 6/11 (c) k a Let t = -36.6 + 37. Which is the second smallest value? (a) t (b) -5/2 (c) -0.1 c Let m = 1.3 - 1.7. Which is the second smallest value? (a) m (b) 3 (c) 0.5 c Let v = -19/9 - -22/9. Let a = 1 - 5. What is the second biggest value in a, v, 0.2? 0.2 Let d be ((-2)/(-1))/44. Suppose -dw - 3o = 4 + 6, 2w = 2o + 10. What is the biggest value in -0.4, w, 1/3? w Let k = -395/6 + 66. Suppose 2b = -0b + 8. What is the second smallest value in 1/2, b, k? 1/2 Let j = -0.053 - 0.147. Let o be 3/44/(-6). What is the third smallest value in j, 0.4, o? 0.4 Let s = 6 + -8. Let j be (-8)/(-32) + s/40. Which is the third smallest value? (a) -0.4 (b) j (c) 4/3 c Let f = 0 - -0.1. Let g = 149/1053 + 1/81. What is the second smallest value in -2/9, g, f? f Suppose 4q = 3g - 12, -3q - 5g = -29 + 9. What is the third biggest value in q, 0.2, -0.1? -0.1 Let o = -17 + 49/3. Which is the second smallest value? (a) -0.03 (b) o (c) -0.2 (d) 0.4 c Let u = 6 + -9. Let y = 157.2 - 157. What is the biggest value in u, y, -5? y Let f be 2 - -1(9 + -1). Suppose -6 = 2t, f = v - 4t - 2. Let n = 1 + v. Which is the biggest value? (a) n (b) -0.1 (c) 4/7 a Let v(t) = t2 + 5t - 2. Let g be v(-5). Which is the second smallest value? (a) g (b) 2/3 (c) -1/2 c Let c = -59 - -36. Let z = -22.9 - c. What is the third biggest value in z, 1/3, 4/5? z Let x = 0 - -4. Let d = 21.9 - 25.89. Let v = d - 0.01. Which is the biggest value? (a) 0.2 (b) x (c) v b Let l = 11 - 16. Which is the smallest value? (a) 0.1 (b) -1 (c) l c Let n be ((-4)/6)/(6/27). Let f be (2 + 84/(-39))/1. Which is the smallest value? (a) f (b) n (c) -0.4 b Let i = 3 - 0. Which is the biggest value? (a) i (b) 0.2 (c) -0.4 a Let u = 87 + -87. What is the fourth biggest value in 3, -0.14, u, 2? -0.14 Let w = 180 + -179. What is the third smallest value in -1/6, w, 2? 2 Let h = 15.9 - 20.78. Let f = -0.12 + h. Which is the smallest value? (a) 0 (b) f (c) 3 b Let c = -1.5 - -1. Let s = 893/1480 - 1/296. What is the second smallest value in s, c, 1/7? 1/7 Let n = -2.6 + 1.6. Which is the smallest value? (a) n (b) 1/3 (c) -3 c Let d be ((-2)/(-8))/1(-32)/(-14). What is the third biggest value in d, -5, 3, 2/3? d Let t = 428/21 - 62/3. Which is the fourth smallest value? (a) -5 (b) t (c) 3 (d) -1 c Let h = -0.02 - -1.02. Let g = 2/9 - 1/18. What is the third biggest value in h, 3, g? g Let n be 20/(-24) + (-4)/(-6). Let q = -5/26 + -4/13. Which is the biggest value? (a) n (b) q (c) 2 c Let n = 0.4 + 0. Suppose h - 2 = 3t - 8t, 0 = -4t - h + 2. Let v be (1 - t)/((-52)/(-8)). What is the second biggest value in -2/7, v, n? v Let w = -8 + 12. Let o be (w/(-10))/((-56)/(-40)). What is the second smallest value in 0, o, 3? 0 Let z = -1.5 + 1. Let f = 0.4 + z. Let i = -1 - -5. Which is the second smallest value? (a) f (b) i (c) 0.1 c Let p = -1 + 0.6. Suppose 2u + 3h - 14 = 9, -10 = -2h. What is the third smallest value in p, 0.4, u? u Let t = 0.44 + 0.06. Let p = 2.5 - t. Let h = -0.04 - -0.04. Which is the third biggest value? (a) 1/4 (b) p (c) h c Let o = 0.91 + -1.21. What is the second biggest value in -32, 1/3, o? o Let k be ((-249)/(-18))/1 - -1. Let c = k - 1771/120. Let p = -71/120 - c. What is the smallest value in p, 5, 3/5? p Let s be -1 + (-2)/(-2) - 1. Let q = -2 - s. Let m be (q/6)/(12/(-16)). What is the second biggest value in -0.1, -4, m? -0.1 Let x = -0.01 + -0.49. What is the third biggest value in 0, -1/10, x? x Let k(j) = -5j. Let x be k(1). Let n = 9 - 0. Let i be 10/12n/(-30). Which is the second smallest value? (a) x (b) 0.1 (c) i c Let n be (-7)/6 + 4/4. Let w = -1.17 - -0.17. Let g = -2 + w. What is the third biggest value in n, g, 1? g Suppose -5v = 3 + 2. Let p = 1.03 - 0.03. Let y = p - -2. What is the second smallest value in -3, y, v? v Let i be (2/(-3))/((-1)/(-15)). Let n be (-1)/(-6)(-8)/i. Let q = 0.1 + 0.2. Which is the second smallest value? (a) -2 (b) n (c) q b Let g = 18.8 + -19. Let v be (-33)/(-18) - 2/4. Which is the third biggest value? (a) g (b) v (c) -5 c Let l = 368/5 + -74. Which is the third biggest value? (a) l (b) 3/8 (c) -6 c Let u = -19 - -19.3. What is the biggest value in 0, 4, u? 4 Let x = -53 + 53.1. Let u = -3.06 + 0.06. Let c = -0.27 + 0.07. What is the smallest value in c, x, u? u Let r = -0.12 - -0.62. What is the third smallest value in -66/7, 3/2, r? 3/2 Suppose -4j - 15 = 5q, -3q + 4q = -3j - 3. What is the third biggest value in 3/2, q, -1/2, 4? -1/2 Let m = 23/60 - 1/20. Suppose -9 = 5u + 1. Which is the smallest value? (a) m (b) -0.2 (c) u c Let f be 1/(-6)(-12)/(-9). Let q be 6/5(-20)/(-6). Let p(i) = i3 - 3i*2 - 3i + 1. Let j be p(q). What is the third biggest value in j, 2, f? f Let f(n) = n*3 + 5n*2 + 5n + 6. Let x be f(-4). Let z = -32 + 32.3. What is the third smallest value in z, x, -4? x Let r be 30/(-32)(-8)/6. Let h = -5.84 - 0.16. Let z = h + 1. Which is the second smallest value? (a) r (b) z (c) -2/7 c Let t = -292 + 3794/13. Let m = -0.34 + 0.14. What is the second biggest value in 2, t, m? t Let y = -0.252 - -0.042. Let v = 0.08 + y. What is the third biggest value in 5, v, -0.3? -0.3 Let g = -0.12 - 3.98. Let z = g + 0.1. Which is the smallest value? (a) -4/5 (b) z (c) -2/5 b Let r = -2 - -4. Suppose -5a - 13 = 2l + 2l, -l = -ra - 13. What is the third smallest value in 2/5, -3, l? l Let b(y) = -2y*2 + 10y - 8. Let q be b(6). Suppose 0 = 4w + 3g + 6, 0 = 4w - 5g + 22. Let l be w/8q/6. What is the second smallest value in -0.2, 0, l? 0 Let i = 13 - 17. Suppose j = 4j + 9. Let o = 0 + j. Which is the third smallest value? (a) 2 (b) i (c) o a Let b = 0.21 - 0.2. What is the smallest value in 2/5, b, -2/15? -2/15 Let z(v) = -v + 3. Let c be z(0). Let m be (-4)/(-1)c/4. What is the third biggest value in -3/7, 1/4, m? -3/7 Let s = 41/315 + -2/105. Suppose -2d - 3 = 5j, -3j + 3d - 9 = 6d. Which is the smallest value? (a) s (b) -1/2 (c) j b Let q be (-1)/218/3. Let d = -7 - q. What is the biggest value in 4, 0.1, d? 4 Let s = 182 + -182.99. Let d = s + 1. Let g = d + 3.99. What is the second smallest value in g, -4, -1/6? -1/6 Let u = -1505/9 - -167. Let p(b) = -b3 - 7b*2 - 6b + 1. Let q be p(-6). Let m be q + 33/21 + -2. What is the second smallest value in 4, u, m? m Let g = -0.2 + 0.4. Suppose -t + 0t = 0. Which is the biggest value? (a) -0.1 (b) t (c) g c Let g = -1 + 1.1. Let q = -1.3 + g. Let p = q + 0.7. Which is the smallest value? (a) p (b) -0.1 (c) -1/3 a Let t be -4 + (-87)/(-15) + 2 - 4. Which is the smallest value? (a) t (b) 5/2 (c) 6 (d) 1 a Suppose -15 = -w - 4w. Suppose -wn + 5 - 2 = 0. Let v be (4/(-8))/(2/(-8)). Which is the second biggest value? (a) -1/9 (b) v (c) n c Let k = 10 - 14.5. Let g = k + 5. What is the second biggest value in 1, 0.2, g? g Let m(l) = l - 9. Let p be m(10). Let g = 0.06 + -0.46. Which is the third smallest value? (a) 0 (b) p (c) g b Let x = -6.9 + 7.2. What is the third smallest value in 0.5, -5, x? 0.5 Let g = -163.8 + 164. Which is the fourth biggest value? (a) g (b) 1/3 (c) 27 (d) -4 d Let i = 6648/19 - 350. Which is the fourth smallest value? (a) i (b) 3 (c) 4/3 (d) 2/17 b Let z = -0.8 - -0.3. Let h = 0.3 + -0.5. Let d = -7 + 10. What is the biggest value in h, z, d? d Let l be 40/336 + (-2)/(-12). Suppose 0d = -2d + 12. Let c(q) = q - 8. Let v be c(d). What is the third biggest value in 5, l, v? v Suppose -5y + 3v + 0v = 2, v = 2y. Let m be 3(-2 - -5 - y). Which is the smallest value? (a) 5 (b) m (c) 1/7 c Let u = 22 - 22.4. Let l = u - -0.45. Which is the third smallest value? (a) -3 (b) 0 (c) l c Let y(h) = -2h + 3. Let m be y(4). Let q = -4 - -4.5. Let k = -0.8 + q. Which is the smallest value? (a) k (b) 1 (c) m c Suppose 5c + 3n = 34, 2c + 0c + 5n = 25. Let x = 0 + c. What is the smallest value in 0, x, 1? 0 Let t be 7/(-3) + 6/(-9). Let w = -4 - -4. Which is the biggest value? (a) -4/5 (b) t (c) w c Let c = -39 - -42. What is the second smallest value in c, -4, 2/5, -3? -3 Let k = 0.3 + 0.2. Le	{ "pile_set_name": "DM Mathematics" }
e common denominator of -47/1008 and -73/168. 1008 Find the common denominator of 74/69 and -77/2553. 2553 Calculate the lowest common multiple of 12 and 72. 72 What is the lowest common multiple of 8 and 1258? 5032 Calculate the common denominator of -181/960 and -145/756. 60480 What is the smallest common multiple of 1814 and 6? 5442 What is the smallest common multiple of 210 and 10? 210 Calculate the common denominator of -61/850 and -123/20. 1700 Calculate the least common multiple of 112 and 10. 560 Calculate the least common multiple of 57 and 2584. 7752 Calculate the smallest common multiple of 441 and 1176. 3528 Find the common denominator of 113/5616 and -67/2304. 89856 Calculate the smallest common multiple of 86 and 154. 6622 What is the common denominator of -5/6391 and -62/91? 83083 What is the least common multiple of 105 and 364? 5460 What is the lowest common multiple of 4 and 16? 16 Find the common denominator of 197/660 and 59/660. 660 What is the common denominator of 8/27 and -41/9? 27 Find the common denominator of 111/1064 and -37/56. 1064 Calculate the least common multiple of 64 and 176. 704 What is the common denominator of 97/504 and 167/1080? 7560 Calculate the common denominator of -56/111 and 56/3. 111 Calculate the common denominator of -95/78 and -79/621. 16146 Find the common denominator of 89/18 and -49/19. 342 What is the smallest common multiple of 5 and 10? 10 What is the common denominator of -50/1041 and -157/60? 20820 Find the common denominator of -58/9 and 83/663. 1989 Calculate the common denominator of -43/114 and 9/26. 1482 What is the least common multiple of 132 and 144? 1584 Calculate the smallest common multiple of 16 and 12. 48 What is the common denominator of 143/2646 and 137/1008? 21168 What is the common denominator of 5/9 and 113/48? 144 What is the smallest common multiple of 225 and 1325? 11925 What is the common denominator of -7/13 and 81/10? 130 Calculate the common denominator of 49/39 and -24/7. 273 What is the smallest common multiple of 3312 and 2024? 36432 What is the common denominator of 119/10 and 85/18? 90 What is the common denominator of 41/18 and 41/4690? 42210 Find the common denominator of 85/2583 and -13/369. 2583 Calculate the least common multiple of 700 and 11. 7700 What is the smallest common multiple of 890 and 4? 1780 Calculate the common denominator of -37/5100 and -169/660. 56100 Calculate the common denominator of -41/2892 and -37/10. 14460 What is the smallest common multiple of 1 and 69? 69 Calculate the common denominator of 29/758 and 47/8. 3032 Calculate the common denominator of -11/570 and -25/57. 570 What is the lowest common multiple of 12 and 4020? 4020 Calculate the least common multiple of 1188 and 56. 16632 What is the least common multiple of 208 and 3289? 52624 Find the common denominator of 39/878 and -3/14. 6146 Find the common denominator of -115/18 and -1/72. 72 What is the common denominator of 137/42 and 13/24? 168 Calculate the lowest common multiple of 2149 and 70. 21490 Calculate the smallest common multiple of 6 and 276. 276 Find the common denominator of 23/20 and 3/334. 3340 Calculate the lowest common multiple of 55 and 704. 3520 Calculate the lowest common multiple of 134 and 38. 2546 Calculate the common denominator of -107/108 and -31/198. 1188 Find the common denominator of 50/33 and -109/2190. 24090 Calculate the lowest common multiple of 14 and 10. 70 What is the common denominator of 121/48 and -75/2768? 8304 What is the lowest common multiple of 14 and 80? 560 What is the common denominator of -1/11935 and -22/7? 11935 Calculate the least common multiple of 36 and 40. 360 Find the common denominator of 39/64 and 123/20. 320 What is the smallest common multiple of 1565 and 110? 34430 What is the lowest common multiple of 157 and 8? 1256 What is the smallest common multiple of 14 and 9996? 9996 Calculate the common denominator of -57/28 and 31/1071. 4284 Calculate the common denominator of 93/130 and 49/741. 7410 Calculate the common denominator of 53/287 and -47/14. 574 What is the least common multiple of 142 and 1? 142 Calculate the lowest common multiple of 24 and 78. 312 Calculate the least common multiple of 40 and 16. 80 Calculate the common denominator of -19/50 and -59/1390. 6950 What is the lowest common multiple of 28 and 10? 140 Calculate the lowest common multiple of 130 and 1326. 6630 Calculate the common denominator of -40/3 and 32/55. 165 What is the common denominator of -81/4 and -25/33? 132 Calculate the common denominator of -29/1274 and 33/910. 6370 Calculate the lowest common multiple of 128 and 32. 128 What is the common denominator of 115/56 and -107/96? 672 Calculate the smallest common multiple of 1056 and 44. 1056 Calculate the smallest common multiple of 7 and 2822. 19754 What is the least common multiple of 30 and 114? 570 Find the common denominator of -61/161 and -24/253. 1771 Calculate the lowest common multiple of 22 and 832. 9152 Find the common denominator of -179/90 and -47/84. 1260 What is the common denominator of -87/82 and -41/10? 410 Calculate the common denominator of -11/4 and 59/100. 100 Calculate the lowest common multiple of 1 and 30. 30 Find the common denominator of 181/420 and -7/225. 6300 Calculate the lowest common multiple of 6 and 1434. 1434 Calculate the lowest common multiple of 79 and 9. 711 Calculate the least common multiple of 150 and 70. 1050 What is the smallest common multiple of 40 and 6? 120 What is the common denominator of 80/63 and 71/490? 4410 Find the common denominator of 25/1542 and -43/3. 1542 Calculate the smallest common multiple of 1242 and 3. 1242 Calculate the smallest common multiple of 552 and 207. 1656 What is the least common multiple of 7550 and 200? 30200 What is the smallest common multiple of 744 and 6? 744 Calculate the common denominator of -34/249 and -119/1494. 1494 What is the smallest common multiple of 132 and 354? 7788 What is the smallest common multiple of 66 and 12? 132 Find the common denominator of 5/106 and -77/477. 954 What is the least common multiple of 92 and 40? 920 What is the common denominator of 37/90 and -9/70? 630 What is the lowest common multiple of 446 and 19? 8474 What is the common denominator of 61/48 and -149/102? 816 What is the lowest common multiple of 102 and 68? 204 What is the common denominator of -65/18 and 58/27? 54 What is the lowest common multiple of 432 and 3? 432 What is the smallest common multiple of 720 and 1368? 13680 What is the least common multiple of 195 and 25? 975 Calculate the common denominator of 47/18 and -38/9. 18 What is the lowest common multiple of 14 and 98? 98 Find the common denominator of -86/105 and -79/60. 420 Find the common denominator of -39/7 and 52/483. 483 What is the lowest common multiple of 9 and 2? 18 What is the smallest common multiple of 212 and 5? 1060 Find the common denominator of -53/64 and 43/296. 2368 Find the common denominator of -91/24 and -31/237. 1896 What is the smallest common multiple of 645 and 6450? 6450 Calculate the least common multiple of 18 and 24. 72 Find the common denominator of -41/192 and -83/32. 192 Find the common denominator of 35 and -64/9. 9 Calculate the common denominator of 2/27 and -32/45. 135 Calculate the lowest common multiple of 69 and 18. 414 What is the smallest common multiple of 12 and 1168? 3504 Find the common denominator of 64/363 and -26/7. 2541 Calculate the common denominator of 59/70 and 23/84. 420 What is the least common multiple of 72 and 14? 504 What is the common denominator of 59/1650 and -61/495? 4950 Calculate the common denominator of -71/726 and 46/9. 2178 Calculate the lowest common multiple of 2100 and 24. 4200 Find the common denominator of -59/24 and 55/2826. 11304 Find the common denominator of -109/15970 and 22/35. 111790 Find the common denominator of 36/737 and 25/134. 1474 What is the least common multiple of 12487 and 6? 74922 What is the common denominator of -19/35 and 26/45? 315 What is the common denominator of 41/1152 and -59/704? 12672 What is the smallest common multiple of 560 and 80? 560 What is the common denominator of -22/95 and -20/19? 95 Calculate the common denominator of 31	{ "pile_set_name": "DM Mathematics" }
+ 1) as od + id*3 + p + cd*2 and give i. -23334 Rearrange (-163x + 288x - 191x)(-4 + 9 + 2 - 2x*2) to the form u + wx + yx2 + cx*3 and give w. -462 Express (132p - 132p - 6p*2)(-15p + 30p + 35p)(3 - 4 - 1) in the form qp2 + r + up*3 + kp and give u. 600 Express -265250 - 5144n + 265250 as o + rn and give r. -5144 Rearrange -7001t - 9484t + 65t to the form vt + n and give v. -16420 Express -2 + 0i2 - 3863i - 3861i + 9i*2 - 2i3 - i4 + 7727i - 1 in the form fi + li2 + ai*4 + v + oi*3 and give a. -1 Express 1623t - 1 + 1638t - 3262t - 15t2 in the form v + yt*2 + ot and give o. -1 Rearrange (-1329 + 444 + 438 + 5255d + 447)(1 + d - 1 + (-1 + 3 + 0)(3d + 0d - d) + 0 + 0 + 2d) to pd + fd*2 + c and give f. 36785 Rearrange 2k - 2 + 4k4 - 6k*4 - 2761k*2 + 2762k*2 - 3k3 - k4 to the form gk3 + nk*2 + uk + tk4 + i and give u. 2 Rearrange -130x2 + x4 - x*3 + 4 + 2x - 132x2 + 264x*2 to z + gx*4 + mx*3 + kx*2 + jx and give z. 4 Rearrange -2885s + 5799s - 2886s to the form j + rs and give r. 28 Rearrange -4702v - 1 + 1 - 81v to the form rv + s and give r. -4783 Express (1 - 1 + a)(-22a + 2a + 1234280 - 1234341) as xa + w + fa*2 and give f. -20 Express 5v + 0v + 0v - 4 + 4 - 2v + (-9v - 25v - 5v)(3 + 4 - 5) as m + qv and give q. -75 Express 755f4 - 3f*2 + 13 - 2f*3 - 369f*4 - 385f*4 + 5f*2 as jf*4 + mf*3 + cf + l + yf2 and give l. 13 Express 12915u - 19749u + 12291u as yu + k and give y. 5457 Rearrange (5 + 4 + 13)(164 + 1777 - 698)(3 - 2a - 3) - 3a + 0a + 2a to wa + m and give w. -54693 Rearrange (-140 + 742 + 484)(-22y - 18y + 7y - 22y + 7y) to the form fy + k and give f. -52128 Express 532g*2 + 21 - 2g - 3117g3 + 3132g*3 - 533g*2 in the form kg*2 + p + mg + dg3 and give p. 21 Rearrange -3 + 1 - 101f*2 + 79f + 38f2 + 65f*2 - 4 to the form tf*2 + g + wf and give g. -6 Express (2 + 5w - 2)(-12338745 - 3458w + 12338745) in the form m + vw + kw2 and give k. -17290 Rearrange -63 + 129 - 68 - 143r*2 - 5r2 - r2 + 4r2 + (11 - 11 + 7r)(-1 + 1 - r) to the form v + wr*2 + ar and give v. -2 Rearrange 11284d + 4306d + 18509d to y + zd and give z. 34099 Express 80 - 3340x - 216 + 136 as y + lx and give l. -3340 Rearrange z*2 + 635 - z + 644 - 281z*3 - 1276 to the form wz*3 + az*2 + fz + b and give b. 3 Rearrange (-5116 - 13596c + 517 + 13595c)(2 + 2 - 2) to q + yc and give y. -2 Rearrange -7o + 6o - 79o2 - 192o*2 + 19o*2 - 5o to g + ro + qo*2 and give q. -252 Rearrange -4b + 4b + b + (68 + 1 + 5)(-1 - b + 2 - 6) - b - b - 2b to the form db + n and give n. -370 Rearrange (0 + 3 - 1)(49n*2 - 402945n + 402945n) + (2 - n - 2)((-n + 3n - 4n)(-2 + 3 - 3) - 1 - n + 1) to the form pn*2 + i + gn and give p. 95 Express -6 - 38d4 + 5d*3 + 55d*2 + 2d - 19d2 + 3 - 19d*2 - 20d*2 in the form md*4 + cd*2 + td + n + wd3 and give n. -3 Rearrange -1524k + 1391k + 2739k to the form gk + o and give g. 2606 Rearrange (-37k*2 - 57k*2 + 142k*2)(-4 + 0 + 2)(-40 + 85 - 28)(2 - 2 + 1) to rk + uk*2 + m and give m. 0 Express (2r - 1 + 1)(1477 - 4478r - 2946 + 1467)(-2r + r - 2r) + (2r*2 - r + r)(-1 + 1 - 2r) in the form nr*2 + q + fr + vr3 and give v. 26864 Express (-4 + 5 + 0)(-299 + 299 + 159f)((-2f + 2f + 3f)(0 + 2 - 4) - 4f - 3f + 5f - 5 + 4 + 2f + 4) as bf + gf*2 + n and give b. 477 Rearrange 964i - 699i + 573i to the form p + ai and give a. 838 Express 8364201w*2 - 142 - 8364219w*2 - 19 in the form o + vw + pw2 and give p. -18 Rearrange (0 - 2x*3 - 2 + 4)(17x - 417x + 28x)(-3 + 0 + 1) to the form zx + t + dx*2 + rx*4 + ix*3 and give z. 1488 Express (1718o + o*2 - 1718o)(o2 + 0o*2 + 0o*2)(0 - 9 - 6) as yo3 + do + qo4 + a + so*2 and give a. 0 Express -398l*4 - 3l2 + 25781 - 25781 + l3 as fl3 + jl*4 + xl*2 + ql + w and give j. -398 Rearrange -145o + 262o + 2o4 + 2o*2 + 1030o*3 - 1031o*3 to the form wo*4 + yo*2 + do + u + jo3 and give y. 2 Rearrange 2185m - m*2 + 219 - 2083m - 218 + 4m3 to km*2 + pm*3 + n + hm and give p. 4 Rearrange (9719 - 4858 - 4861 - 2428v)((4 - 4 - 2)(4v - 5v + 3v) + v + 0v - 2v + 3v + 2v - 3v + 2v + v - v) to qv2 + zv + u and give q. 2428 Express 4f + 0f + 0f + (2 - 2 + 1)(-15f + 65f - 24f) + (-2 - 3 + 2)(2f + 1 - 4f + 0f) in the form c + hf and give h. 36 Rearrange 467m3 - 938m*3 - 5 + 473m*3 + 382m*2 to the form w + rm*3 + sm*2 + gm and give w. -5 Rearrange -4175y - 2y*3 - 2y*3 + 2y*4 - 1 + 4177y to the form m + iy3 + by*4 + gy*2 + qy and give m. -1 Express 36o - 269 - 147o + 36o + 35o + 35o in the form mo + y and give y. -269 Express 12 - 3k4 - 10 - 4k + k*3 - 3212k*2 + 3211k*2 as jk*3 + bk*2 + tk*4 + c + ik and give t. -3 Express 17r3 - 3 + r + r2 - 15074r*4 + 4 + 15093r*4 in the form br*2 + m + fr*3 + dr + lr4 and give m. 1 Express -15353 + 7670 - 3z + 8z2 + 7654 as dz + k + bz2 and give d. -3 Express -112c - 51c + 72 + 163c - 117c3 as kc + pc3 + ac*2 + b and give b. 72 Rearrange (0 - 2h + 0 - 2)(69624 + 58728 - 143824) to xh + g and give x. 30944 Rearrange (-13 - 2 + 4)(-146c + 77c - 404c) to xc + m and give x. 5203 Express (2f + 3f + 0f)(9f*2 - 5f*2 + 16f*2 + (1 - 3 + 4)(-3 + 3 + 3f2)) as zf*2 + w + hf*3 + lf and give h. 130 Express (12w + 16w + 5w + (-1 - 4 - 3)(319 + 27w - 319))(-4 + 3 + 3) in the form x + gw and give g. -366 Rearrange 16s*4 - 271s*2 - 16 + 268s2 - s3 + s*3 + 13 to q + ms*3 + cs*2 + ls + ns4 and give n. 16 Express (4p + 12p - 6p)(614 - 614 + 57p*2) + 2p3 + p3 + 2p3 in the form zp*2 + up + r + cp3 and give u. 0 Rearrange (6 + 81 - 250)(65 - 65 + 115i2) to the form bi*2 + ui + m and give b. -18745 Express (-50 + 2o + 50)(-478o2 + 209o*2 + 151o*2) in the form n + ho*2 + ko + vo3 and give h. 0 Express (13 - 6 + 8 + (5 - 1 - 2)(2 + 3 - 4))(0 + 0 + g)(-330 - 599 - 11 - 745) as ng + f and give n. -28645 Express 318h*2 + 8439h - 3088h2 - 8439h + (-h - 3 + 3)(-h + 3h + 0h) + 1 - 1 + h2 in the form vh*2 + r + jh and give j. 0 Express -206 - 261 + 692 + 91z - 279 in the form u + fz and give u. -54 Express 15m2 + 37m*3 - 26m*2 - 2m - 9m4 + 10m*2 + 56m*3 - 9m*3 in the form lm + xm3 + z + vm*4 + cm*2 and give l. -2 Rearrange -3l + 0l + 2l + (17981l - 4582l - 4392l)(5 + 2 - 1) to b + hl and give h. 54041 Rearrange -2897l + 7825l - 3949l to yl + x and give y. 979 Express (-156f + 106f - 167f)(-2f + f + 0f) + (0 - 2f*2 + 0)(2 + 0 - 4) in the form pf2 + zf + j and give p. 221 Rearrange (0 + 2 - 3)(6353z*2 + 6322z*2 - 12432z2) - 1 + 1 - z2 to hz + x + gz*2 and give g. -244 Rearrange 12o*2 - 3o*3 + 0o*3 + 161o + 67 - 65 - 13o2 to the form po*3 + q + no + xo2 and give q. 2 Express (-3v - v + 0v)(-1 - 1 + 1)(38v*2 + 36181v - 36181v)(0 + 0 - 1) in the form mv2 + fv*3 + i + jv and give f. -152 Express (4 - 3 + 0)(-s4 + s4 + s4) + 69s*4 + 6229s*3 - 6229s*3 as fs*2 + ls + ys3 + x + ts*4 and give x. 0 Rearrange -2y*2 - 80528y*3 + 86357y*3 + 24y + 2 - 24y to the form ay*2 + by*3 + wy + h and give a. -2 Rearrange 0u - 5u + 3u + (1 - 5 + 2)(u + 0u - 2u) - 2u - 3u - 2u + 166 - 166 - 49u to fu + k and give f. -56 Express 81s*2 + 6s2 - s3 + 205s2 - 9s*3 - 254s*4 + 255s*4 as is*4 + os*2 + h + ws + qs3 and give o. 292 Express 4s - 1784s3 - 1 + 3627s*3 - 11s - 1815s3 - s2 as ts*3 + qs + n + ms2 and give t. 28 Express -15 - 24 + 574u*2 + 40 + 63u*2 as qu*2 + o + ru and give o. 1 Rearrange -474r2 - 2141r*2 - 164r*2 - 989r*2 + 441r*2 to fr + s + xr2 and give x. -3327 Express 824u*2 + 3 + 2u - 466u2 - 3297u*2 as hu + j + tu2 and give h. 2 Rearrange -216w*2 + 218w*2 + 121w*3 + 1 + 27w*3 to the form zw**2 + s	{ "pile_set_name": "DM Mathematics" }
-70? 1175 Divide 7327 by 11. 7327/11 32 divided by 2041 32/2041 Divide -33108 by -93. 356 Divide -47 by -25773. 47/25773 Calculate -54 divided by -421. 54/421 Calculate -105518 divided by -1. 105518 What is 143 divided by 5695? 143/5695 Calculate -42354 divided by -15. 14118/5 Divide -10213194 by -6. 1702199 What is 5 divided by -2938? -5/2938 -10 divided by -119203 10/119203 What is -109875 divided by -5? 21975 Divide -8084620 by -4. 2021155 What is 18181 divided by 250? 18181/250 What is 141906 divided by 6? 23651 Divide -4 by -598202. 2/299101 What is -32346 divided by -1198? 27 Calculate -15 divided by 18980. -3/3796 What is 4 divided by -155926? -2/77963 What is -76185 divided by -5? 15237 What is 106959 divided by -5? -106959/5 Divide -90 by 2861. -90/2861 Calculate 58372 divided by -14593. -4 -45 divided by 1654 -45/1654 Divide 56 by 784. 1/14 10749 divided by -21 -3583/7 Calculate 36804 divided by -2. -18402 Calculate -611 divided by 490. -611/490 Divide 0 by 111160. 0 Calculate -50 divided by 31. -50/31 What is 409650 divided by 3? 136550 1392744 divided by -232124 -6 Divide 7 by 3684. 7/3684 Divide 500213 by -500213. -1 What is -2286 divided by -116? 1143/58 Divide -708000 by -1770. 400 What is -77131 divided by -137? 563 Calculate 183106 divided by -406. -451 Calculate -2870 divided by 287. -10 -353823 divided by -1999 177 Divide -9 by 18390. -3/6130 Calculate -9 divided by -1619. 9/1619 Calculate 120048 divided by -656. -183 -134 divided by 366 -67/183 What is 32934 divided by 10978? 3 Calculate -5 divided by -728273. 5/728273 -412670 divided by -41267 10 -3 divided by 2680 -3/2680 Divide -242813 by -9. 242813/9 Calculate -2309 divided by 72. -2309/72 Divide -1124781 by 3. -374927 Divide 108 by -11833. -108/11833 Divide 0 by 26161. 0 What is -733155 divided by -111? 6605 Divide 1942866 by 971433. 2 -5376 divided by -12 448 Calculate -188600 divided by 943. -200 Divide -10 by -54317. 10/54317 Calculate -39348 divided by 2. -19674 54877 divided by 62 54877/62 Calculate 807 divided by -39. -269/13 Divide 51541 by -11. -51541/11 What is -3276 divided by -3276? 1 Divide -109400 by -25. 4376 -52 divided by 58092 -13/14523 What is -21 divided by -553? 3/79 Calculate 109770 divided by 5. 21954 -1189 divided by -104 1189/104 Divide 887311 by -1. -887311 What is 43 divided by -557? -43/557 Calculate 52650 divided by -270. -195 What is 11 divided by 113549? 11/113549 Divide -3790080 by 768. -4935 What is 69252 divided by -348? -199 182589 divided by -60863 -3 What is 230 divided by 762? 115/381 What is 314681 divided by -10? -314681/10 -5789652 divided by -125862 46 -152442 divided by 81 -1882 Divide -368127 by 9. -40903 Calculate -84695 divided by -13. 6515 What is -864144 divided by -12? 72012 Calculate -10 divided by -24074. 5/12037 Divide -23400 by 26. -900 What is -84970 divided by 145? -586 What is -7108 divided by -4? 1777 Divide -2 by -470276. 1/235138 Calculate -9 divided by -908894. 9/908894 Calculate 53 divided by -34219. -53/34219 Divide 5150269 by -5. -5150269/5 What is -569028 divided by 6? -94838 Divide 44676 by -7446. -6 What is 2308 divided by -28? -577/7 Divide -4870 by 974. -5 What is 195464 divided by 4? 48866 5 divided by 12039 5/12039 What is 59906 divided by 1? 59906 What is 6992 divided by -3? -6992/3 What is -7 divided by -3253? 7/3253 Divide 13190 by 6595. 2 Divide -18734 by 1. -18734 What is -13079 divided by 319? -41 What is -273960 divided by -4? 68490 What is 538177 divided by -23? -23399 What is 2894955 divided by -7? -413565 What is 31 divided by 10342? 31/10342 Divide -257106 by 1174. -219 1203 divided by 301 1203/301 -76769 divided by -77 997 Calculate 4 divided by 238595. 4/238595 Calculate 5704 divided by -4. -1426 Divide -430 by -1773. 430/1773 -1261062 divided by -114642 11 -88290 divided by 45 -1962 5 divided by -28978 -5/28978 Divide 896640 by 15. 59776 What is 882280 divided by -25208? -35 1322272 divided by 82642 16 -11 divided by 4118 -11/4118 Divide 26 by 1697. 26/1697 Calculate -32375 divided by -52. 32375/52 Calculate -30 divided by 2007. -10/669 Calculate 1476600 divided by 73830. 20 What is -80899 divided by -6223? 13 What is 0 divided by -66606? 0 Calculate -182 divided by 539. -26/77 What is -2953832 divided by -421976? 7 4 divided by 41135 4/41135 What is -4 divided by -17998? 2/8999 Calculate -59292 divided by -3294. 18 Divide 7187358 by 3. 2395786 -481045 divided by -2047 235 Divide 115280 by 5764. 20 What is 176576 divided by -356? -496 Divide 343948 by -2. -171974 What is -3241504 divided by 115768? -28 Divide 273847 by -1. -273847 0 divided by -142402 0 What is 410811 divided by -5? -410811/5 Calculate 34520 divided by -8. -4315 Divide 3726208 by -29111. -128 What is 6106 divided by -180? -3053/90 -105185 divided by -21037 5 Divide -409578 by -31506. 13 Calculate 42 divided by -23693. -42/23693 Divide -9785 by 464. -9785/464 60524 divided by -60524 -1 Divide 47400 by 6. 7900 Divide -507262 by 19. -26698 Divide -1970725 by 3. -1970725/3 What is 39430 divided by -3? -39430/3 -302352 divided by 4 -75588 -1032 divided by 98 -516/49 1148 divided by 348 287/87 Calculate -20132 divided by 116. -5033/29 What is -602 divided by 3044? -301/1522 Calculate 12465 divided by -4. -12465/4 What is -21120 divided by -528? 40 -498 divided by 64 -249/32 -80850 divided by 165 -490 What is 1 divided by -90384? -1/90384 What is -4 divided by 50634? -2/25317 Divide -342 by -11. 342/11 Calculate -846337 divided by 2269. -373 Divide -1643025 by 86475. -19 -1 divided by 4381 -1/4381 Divide -3014865 by -3. 1004955 126312 divided by 42104 3 What is 5852021 divided by 1? 5852021 What is -793690 divided by 5710? -139 What is -1 divided by -454? 1/454 Calculate 49962 divided by 33. 1514 Divide 1987 by -2. -1987/2 Divide -1480659 by 6761. -219 Calculate -32 divided by -43033. 32/43033 Divide -93248 by -11. 93248/11 -13052 divided by 5 -13052/5 What is -2594080 divided by 248? -10460 -263 divided by 325 -263/325 What is -42194 divided by 4? -21097/2 What is 146916 divided by -36? -4081 Divide 34677 by -1. -34677 Calculate 6973 divided by -108. -6973/108 Calculate 2304183 divided by -3. -768061 Divide 399300 by 1100. 363 What is 47985 divided by -2? -47985/2 What is 2229920 divided by 557480? 4 12 divided by -110 -6/55 -3 divided by -8260 3/8260 1309952 divided by -3808 -344 -179368 divided by -4 44842 What is -28805 divided by -35? 823 -11 divided by -6430 11/6430 Calculate 4032 divided by 4032. 1 Calculate 348892 divided by -348892. -1 What is 0 divided by -839? 0 Calculate 33345 divided by -2565. -13 Calculate 0 divided by -3067. 0 What is -2 divided by 512425? -2/512425 1061226 divided by 261 4066 What is -21594 divided by -177? 122 -119 divided by -693 17/99 4 divided by 6543 4/6543 What is -27248 divided by 5? -27248/5 Calculate 5405 divided by 18. 5405/18 Calculate 11214 divided by -5607. -2 What is 127512 divided by 12? 10626 Divide -496281 by 3. -165427 Divide -4517 by -26. 4517/26 516 divided by -174 -86/29 Divide -851424 by 1. -851424 Divide 2104270 by -1307. -1610 Calculate -835 divided by 2562. -835/2562 -473479 divided by 5 -473479/5 78876 divided by 8764 9 Calculate -2055 divided by -43. 2055/43 0 divided by -569118 0 -104730 divided by -20946 5 18355464 divided by 4 4588866 Divide 11919 by 694. 11919/694 -341621 divided by 259 -1319 Calculate 625 divided by -3. -625/3 Divide 22 by -1429. -22/1429 Divide 434675 by -2. -434675/2 Divide 48729 by -111. -439 -136 divided by 6752 -17/844 Calculate 1 divided by -2525. -1/2525 Divide 1164273 by 1. 1164273 22066780 divided by 5 4413356 Calculate 21287 divided by -21287. -1 Divide -921 by 8. -921/8 1343 divided by 134 1343/134 Calculate -1140429 divided by -4. 1140429/4 What is -12480 divided by 6? -2080 Calculate 1352270 divided by -58. -23315 What is -8364 divided by -4? 2091 Calculate 264 divided by 3544. 33/443 What is -4 divided by 7827? -4/7827 Calculate -26574 divided by 3. -8858 1 divided by 46151 1/46151 Divide 150993 by -883. -171 40776 divided by -2 -20388 -2204405 divided by -440881 5 Calculate 5 divided by -18320. -1/3664 Calculate -529794 divided by -176598. 3 Divide 99 by -1505. -99/1505 Calculate 7048716 divided by -2. -3524358 0 divided by -16	{ "pile_set_name": "DM Mathematics" }
vative of 13l + 0l*2 + 0 + 0l*3 - 1/12l*4. Let d(f) = 18f*2. What is d(n(a))? 18a*4 Let l(f) = -3291f + 1099f + 1099f + 1094f. Let m(g) = 12g + 1. Determine l(m(d)). 12d + 1 Let v(d) = -d - 47. Let f(r) = -2r*2 + 7r + 0r - 7r. Determine v(f(c)). 2c2 - 47 Let j(a) = 5573a*2 - 25a - 50. Let t(h) = -1393h2 + 6h + 12. Let w(d) = 6j(d) + 25t(d). Let i(y) = y. Give w(i(r)). -1387r2 Let i(c) = -c2 + 2c - 2. Let j(g) = -1 + g - g*2 + g - g. Let h(r) = i(r) - 2j(r). Let f(v) = 9 + 5v - 9 + 0. Determine f(h(n)). 5n*2 Let g(q) = -5q*2 + 159 - 159 + 0q*2. Let b(l) = 4l. Determine b(g(h)). -20h2 Let h(j) = 59327j. Let k(f) = -4f. What is h(k(y))? -237308y Let z(d) = 715d. Let m(h) = -2h - 2. Calculate z(m(p)). -1430p - 1430 Let i(x) = 5x*2. Let a(h) = -2444h*2. Determine a(i(n)). -61100n*4 Let r(v) = -7v. Let f(a) = 10a2. Let g(b) = -b3 - 4b*2 - 3b - 3. Let s be g(-3). Let u(n) = -2n2. Let j(w) = sf(w) - 14u(w). Determine j(r(i)). -98i2 Let y(k) = k2 + 0k2 + k2. Let b(q) = q2 - 2q - 2. Let z = 12 + -9. Let f(s) = 2s2 - 3s - 3. Let c(t) = zb(t) - 2f(t). Determine y(c(j)). 2j4 Suppose 4d = 2r + 22, 26 = -d + 3d - 4r. Let s(q) = -13q - q + 2q - dq. Let a(t) = 6t. What is a(s(b))? -90b Let p(m) = 6m2 + m + 1. Let d(o) = -o - 1. Let g = 25 - 26. Let x(r) = gd(r) - p(r). Let s(f) = -3f. Determine x(s(a)). -54a*2 Let d(n) = 8346n + 2. Let j(u) = 53u. Determine j(d(r)). 442338r + 106 Let i(b) = b. Let v(g) = -637238g2. Determine i(v(f)). -637238f*2 Let v(s) = 13s - 1. Let o(m) = 8237m2 - 2m + 2. What is v(o(c))? 107081c2 - 26c + 25 Let m(s) = 1954s - 1. Let y(f) = 4f*2. Determine m(y(c)). 7816c*2 - 1 Let p(o) = 7o - o - 10o. Let j(u) = 11u. What is p(j(s))? -44s Let k(z) = -2z*2. Let o(q) = 2q*2 + 5. Let d(j) = -3j*2 - 6. Let y(t) = -5d(t) - 6o(t). Give y(k(a)). 12a4 Let w(x) be the third derivative of -x4/12 - 15x2 - 4x. Let l(o) = -5o2. Give w(l(y)). 10y2 Let t(s) = -s2. Let q(y) be the second derivative of 215y3/6 - 5y + 1. Calculate q(t(a)). -215a2 Let u(c) be the second derivative of -c4/6 - 290c. Let j(y) = -485y2. Give j(u(x)). -1940x*4 Let m(p) = -12p*2. Let i(v) = 25221v - 2. Give i(m(c)). -302652c2 - 2 Let l(n) = -17n2. Let p(f) be the third derivative of -f6/360 + 7f3/3 + 2f*2. Let m(j) be the first derivative of p(j). Give m(l(z)). -289z*4 Let l(y) = 1152y*2. Let z(o) = 270o. Give z(l(f)). 311040f2 Let d(s) be the first derivative of 390s*3 - 689. Let y(t) = -t. Give d(y(w)). 1170w*2 Let p(m) = 2m*2. Let k(r) = -65794r. Give p(k(s)). 8657700872s2 Let n(j) = 2j*2 - 108j. Let a(q) = 2q2 - 3q + 6. Let o(v) = -v*2 + v - 2. Let s(m) = -a(m) - 3o(m). Calculate s(n(p)). 4p4 - 432p*3 + 11664p*2 Let n(i) = i + 8. Let g(r) = -r + 1. Let d(l) = g(l) - n(l). Let c be d(-7). Let j(m) = cm + m + 0m - 3m. Let h(v) = v*2. Determine j(h(w)). 5w*2 Let o(d) = 2735d. Let i(w) = -57w. Give o(i(r)). -155895r Let a(f) = -223f2 + 116f*2 + 105f2 + 11. Let x(z) = -z2. Give a(x(v)). -2v4 + 11 Let n(y) = 25y - 4. Let p(u) = 81u + 1. What is n(p(s))? 2025s + 21 Let p(y) be the first derivative of -y5/40 - y3 - 13. Let s(g) be the third derivative of p(g). Let t(x) = -2x + 5x - 2x. Give s(t(m)). -3m Let t(l) = -11148l2. Let f(c) = -224c*2. Determine f(t(m)). -27838250496m*4 Let c(t) = 2t*2. Let u(m) = -5m - 4. Let q(z) = -24z - 22. Let f(y) = -4q(y) + 22u(y). Calculate f(c(a)). -28a*2 Let r(w) = 7w. Let k(x) = x. Let c(g) = -g*2 - g + 10. Let z(t) = c(t) + k(t). What is z(r(d))? -49d*2 + 10 Let g(v) = -4v + 779 - 1557 + 778. Let w(t) = 7t. Determine g(w(d)). -28d Let s(a) = 51a2. Let q(l) = 47l*2. Let d(z) = 3q(z) - 2s(z). Let x(g) = -g - 1. Let f(m) = 5m + 4. Let k(c) = -f(c) - 4x(c). What is d(k(n))? 39n*2 Let q(o) = 3312o. Let y(s) = 2s2 - 33. Determine y(q(x)). 21938688x*2 - 33 Let w(y) = -221y. Let k(v) = 185v + 189v + 0 + 0 - 371v. What is k(w(s))? -663s Let f(g) = 435351g. Let x(k) = 2k*2. Determine x(f(o)). 379060986402o2 Let y(m) = -m2. Let o = 110 + -97. Let f(u) = -ou + 21u + 4u + 27u. Calculate f(y(p)). -39p2 Let v(o) = -2o - 1. Let s(z) = -23z - 11. Let d(y) = -2s(y) + 22v(y). Let k(i) = -20i*2 + 5i. Determine d(k(x)). -40x2 + 10x Let q(a) be the second derivative of -64a3/3 - 3a - 35. Let z(f) = f*2. Determine q(z(v)). -128v*2 Let t(h) = 4h2 + 35. Let s(v) = -v2 + 10v. Determine s(t(l)). -16l*4 - 240l*2 - 875 Let g(m) = -30m + 80m + 2 - 2 - 37m. Let h(v) = -20v. Calculate g(h(j)). -260j Let u(h) = -9h2 + 16h2 - h2 - 5h2. Let w(q) = -2q*2. Let a(g) = 5g*2. Let o(i) = 3a(i) + 5w(i). Give o(u(y)). 5y*4 Let v(d) = -3d. Let i(p) = 13p - 212. Give i(v(t)). -39t - 212 Let u = -4 + 39. Let m be u + -1 + 3 + -3. Let a(v) = -2v2 + v2 + mv - 34v. Let n(o) = -8o*2. What is a(n(p))? -64p*4 Let c(l) = 7l + 2l - 692l*2 + 684l*2 - 4l. Let p(u) = -2u. Calculate c(p(s)). -32s*2 - 10s Let d(l) = 2l. Let n(h) = h - 2h*2 - 6h*2 - h. Let z(k) = -58 + 58 - 7k*2. Let q(x) = -5n(x) + 6z(x). Determine q(d(v)). -8v*2 Let u(i) = 8i. Let c(k) = -11264k2 - 2k + 2. Calculate u(c(y)). -90112y2 - 16y + 16 Let p(v) = 192774v2 - 2v. Let w(r) = 10r. Determine p(w(h)). 19277400h*2 - 20h Let v(i) = -11i. Let s(n) = -82245n. Calculate s(v(m)). 904695m Let t(c) = 3c. Let y(p) = 2p2 - 29216p. Determine t(y(n)). 6n2 - 87648n Let o(k) = 3k. Let b(i) = 9i + 198. Let g be b(-22). Let q(f) be the first derivative of 2/3f3 + 0f + 1 + gf2. Determine o(q(h)). 6h*2 Let s(q) = -35 - 2q*2 - 36 - 41 + 112. Let l(a) = -85a*2 + a. Give l(s(h)). -340h*4 - 2h*2 Let l(d) = -17d - 45. Let p(r) = 13r + 46. Let s(u) = 4l(u) + 5p(u). Let m(o) = -o2. Give s(m(h)). 3h*2 + 50 Let b be 6/36 - 33/(-18). Let q(m) be the third derivative of -3m*b - 3/20m*5 + 0 + 0m*3 + 0m + 0m4. Let u(y) = -2y*2. What is q(u(w))? -36w*4 Let x(m) = 2m. Let z(g) = 91779g. Give x(z(s)). 183558s Let c(u) = 2u. Let n(q) be the first derivative of q3 + 71. Calculate c(n(i)). 6i*2 Let n(f) = 11f + 2. Let s(b) = b + 77. Give n(s(l)). 11l + 849 Let d(v) = -16v. Let m(z) = -685z2 + 2z + 1. Calculate m(d(i)). -175360i2 - 32i + 1 Let d(z) = 62z. Let h(j) = 1210j*2. What is h(d(m))? 4651240m*2 Let a(l) = 2l - 5. Let o(s) be the third derivative of s*5/30 - 93s*2. Give a(o(y)). 4y*2 - 5 Let h(d) = 5d - 15d + 12d. Let v(n) be the first derivative of n*3/6 + n - 3. Let w(m) be the first derivative of v(m). Determine h(w(f)). 2f Let t(l) = 10l. Let i(g) = -g - 1. Let p(f) = 3f + 4. Let a(d) = 12i(d) + 3p(d). Give a(t(r)). -30r Let w(f) = -11 + 11 - 2f. Let t(d) = d. Let h(r) = 1 + 5r - 1 - 4r. Let b(l) = -3h(l) + 2t(l). What is b(w(k))? 2k Let k(q) = -455q*2 + 14q. Let z(v) = -5v2. Determine k(z(c)). -11375c*4 - 70c*2 Let g(z) = -6031z. Let x(a) = 10a. Determine x(g(l)). -60310l Let z(o) = -2o2 - 2o + 1. Let t(n) = 120n2 + 4n - 2. Let l(k) = -t(k) - 2z(k). Let j(w) = 2w*2. What is l(j(q))? -464q4 Let c(w) be the third derivative of -w5/30 + w*2 - 4. Let n(g) = 189g - 2. Determine n(c(t)). -378t2 - 2 Let d(p) be the first derivative of -p3/3 - 72. Let c(h) = -20h*2 - 10h. Let o(j) = -j*2 - j. Let v(k) = -2c(k) + 20o(k). Give v(d(n)). 20n*4 Let k(a) = -40a*2. Let w(z) = 9z + z - 8z. Calculate w(k(m)). -80m2 Let c(r) be the third derivative of r5/60 - 28r2. Let x(w) = -58w*2. Give c(x(o)). 3364o*4 Let t(r) = 7r*2. Let h(j) = -5j*2 - 594613j + 594613j. Determine t(h(l)). 175l4 Let k(i) be the third derivative of -i4/12 - i*2. Let h(x) = 225x - 121. Let p(q) = -41q + 24. Let y(g) = 2h(g) + 11p(g). Give k(y(s)). 2s - 44 Let r(q) = -12q. Let z(l) be the first derivative of -l5/30 + 16l*3 - 28. Let b(c) be the third derivative of z(c). Give r(b(u)). 48u Let y(o) = 15o + 35339 - 35339. Let u(m) = 3m - 3m + m2. Give y(u(a)). 15a*2 Let j(t) = 2t. Let b(l) = 12l*2 +	{ "pile_set_name": "DM Mathematics" }
Factor -5/2i2 - 180 - 365/2i. -5(i + 1)(i + 72)/2 Let q = 197111/26282 + 2/13141. Determine u, given that -25/2u2 + 10u*5 + 0 + 25/2u*4 - 5/2u - qu3 = 0. -1, -1/4, 0, 1 Let v be 2/14 + 340/119. Suppose -32/3j*2 + 0 - 20/3j*v - 4/3j*4 - 16/3j = 0. What is j? -2, -1, 0 Let g be (-27)/(-6)(27 - -7). Find r, given that -gr*2 + 156r*2 + 7r - 16r = 0. 0, 3 Let z be (-3)/60 - (-20)/80. Solve -2/5i - zi2 - 1/5 = 0 for i. -1 Let a be ((-1)/7 - (-2261)/(-1666)) + (-564)/(-56). Factor -ay + 18/7 + 50/7y2. 2(5y - 3)2/7 Let o(b) be the first derivative of -b6/10 + 3b*5/4 - 9b*4/4 + 7b*3/2 - 3b*2 - 12b + 4. Let t(w) be the first derivative of o(w). Factor t(q). -3(q - 2)(q - 1)*3 Let l = -1555/357 + 244/51. Find z, given that 0 - 18/7z*5 - 3/7z*4 + 18/7z*3 + lz*2 + 0z = 0. -1, -1/6, 0, 1 Let g be ((-242)/(-55) + -4)16. Factor -2/5x*2 + 16/5x - g. -2(x - 4)2/5 Let q = 272/5 + -54. Let c be (-24)/(-5) - 32/40. Factor -2/5a*3 - qa*2 + 0 + 2/5a + 2/5ac. 2a(a - 1)2(a + 1)/5 Let o(x) = -112x - 1568. Let n be o(-14). Factor 3/4y*2 + 3/4y*3 - 9/2y + n. 3y(y - 2)(y + 3)/4 Suppose 37m + 18 = 43m. Let j(b) be the third derivative of 0b + 0 + 1/6b4 + 0b*7 + 1/84b*8 - 1/15b*6 - 2b*2 + 0b*m + 0b*5. Factor j(i). 4i(i - 1)2(i + 1)*2 Let c(u) be the first derivative of -2 - 4/3u*2 - 2/9u*3 - 8/3u. Solve c(j) = 0. -2 Let p(o) be the second derivative of 0 - 21o + 1/315o*6 + 0o*3 + 1/210o*5 + 0o*2 + 0o*4. Factor p(f). 2f*3(f + 1)/21 Let l = 35476/3 + -11818. Factor 1/3t2 + 121/3 - lt. (t - 11)*2/3 Factor -1/2c*2 + 9 + 1/4c*3 - 15/4c. (c - 3)*2(c + 4)/4 Let m(s) = -2s3 - s2 - s - 1. Let p be m(-1). Determine j, given that -5j*2 - p + 28j - 14 - 8j = 0. 1, 3 Factor -1/2o*3 + 5/2o + 1/2o4 - 1 - 3/2o2. (o - 1)3(o + 2)/2 Let c(x) be the second derivative of x5/40 + x4/8 + x3/4 - 4x*2 - 6x. Let j(i) be the first derivative of c(i). Factor j(b). 3(b + 1)2/2 Suppose 12 = 4s - s. Let b(k) = -9k - 79. Let t be b(-9). Factor -tc*4 - 7c*2 + sc - 11c2 + 2c*2 + 10c*3 + 4c. -2c(c - 2)*2(c - 1) Let c(i) be the first derivative of -i6/8 - i5/4 + 23i4/16 - 19i3/12 + i2/2 + 146. Solve c(a) = 0 for a. -4, 0, 1/3, 1 Let x(m) be the first derivative of 1/5m2 - 37 + 2/3m*3 + 0m + 7/10m4 + 6/25m*5. Find v, given that x(v) = 0. -1, -1/3, 0 Let 115/7v*2 + 16/7v*5 + 129/7v*3 + 51/7v + 9/7 + 72/7v4 = 0. Calculate v. -1, -3/4 Let g(m) be the second derivative of m4/4 + 11m*3/2 - 39m*2 - 2m + 273. Suppose g(b) = 0. What is b? -13, 2 Solve 1/5x2 + 1/5x*3 - 2/5x + 0 = 0 for x. -2, 0, 1 Determine s, given that 0 - 1/4s3 + 1/4s5 - s2 + s*4 + 0s = 0. -4, -1, 0, 1 Suppose 0 = m - 5m + 8. Let i be (8/10)/(m/5). Determine k, given that 1 - k4 - 29k*2 - 2k + 29ki + 2k*3 = 0. -1, 1 Let u(g) be the first derivative of -25g*4/38 + 520g*3/57 - 101g*2/19 + 20g/19 + 150. What is o in u(o) = 0? 1/5, 10 Let n(c) be the third derivative of -c*5/150 + 4c*3/15 - 215c*2. Factor n(i). -2(i - 2)(i + 2)/5 Let z(w) be the second derivative of -w5/90 + 13w*4/54 + 14w*3/27 + 203w. Solve z(u) = 0 for u. -1, 0, 14 Let p(k) be the third derivative of k*5/15 + 11k*4/6 - 8k*3 - 359k*2. Factor p(y). 4(y - 1)(y + 12) Suppose 0 - 17/5r*2 - 33/5r*3 + 6/5r + 4r4 = 0. Calculate r. -3/5, 0, 1/4, 2 Suppose 3z - o = 14, 0 = o - 14 + 10. Let i be ((-10)/1255)/(z/(-10)). Factor 0 + 0w*2 + 2/3w*3 - iw. 2w(w - 1)(w + 1)/3 Let t(n) be the third derivative of -n6/24 - n5/3 + 35n*4/24 + 25n*3/3 + 71n*2. Let t(k) = 0. What is k? -5, -1, 2 Let t be (6/(-2) - -3)(-17 - -16). Suppose -1/7s2 + t - 3/7s = 0. What is s? -3, 0 Let 5/2k4 + 0k + 25/2k3 + 15k2 + 0 = 0. Calculate k. -3, -2, 0 Let r(j) be the third derivative of j6/20 - 19j5/30 + 4j*4/3 + 20j3/3 + j2 + 46j. Factor r(v). 2(v - 5)(v - 2)(3v + 2) Let j(p) be the third derivative of p5/20 + 11p*4 + 968p*3 + 14p*2 - 6. Suppose j(t) = 0. What is t? -44 Suppose 107 = 16c + 27. Let l(g) be the second derivative of 0g3 + 3g - 1/130gc - 1/78g*4 + 0g2 + 0. Determine t so that l(t) = 0. -1, 0 Let f(x) = x4 + x*3 - x + 1. Let i(w) = 18w*4 + 118w*3 + 112w*2 - 134w + 6. Let o(z) = -6f(z) + i(z). Factor o(p). 4p(p + 2)(p + 8)(3p - 2) Let h be ((-3)/(-2))/((-36)/(-480)). Let z = 23 - h. Solve 3/7b - 3/7b*z + 0 + 0b*2 = 0 for b. -1, 0, 1 Determine n, given that 5n*5 - 80 + 45n - 25n3 + 4n*3 - 37n*2 - 15n*4 - 55 - 29n*3 + 187n*2 = 0. -3, -1, 1, 3 Let c be (0 - 5)((-168)/20)/7. Let y(g) be the second derivative of 0g2 - 1/5g*c + 2/5g*5 - 1/6g*4 + 0 + 0g*3 - g. Let y(q) = 0. What is q? 0, 1/3, 1 Let f be 29/6 + 2/12. Factor -20a*f - 4a*3 + 23a*5 - 2a*3 + 3a. 3a(a - 1)*2(a + 1)*2 Let m(x) be the third derivative of -4x*2 + 0 - 3/8x*4 + 5/112x*8 - 2/5x*5 + 11/20x*6 + 0x - 9/35x7 + x3. Factor m(v). 3(v - 1)*4(5v + 2) Suppose -18 + 2 = -5r - w, 5r = 5w + 40. Factor -6i + 27i*3 + ri*2 - 8i*2 - 25i*3. 2i(i - 3)(i + 1) Let h be (5(-13)/130)/((-14)/16). Suppose -hd*2 + 4/7d*4 + 12/7d*3 - 8/7d + 0 - 4/7d5 = 0. Calculate d. -1, 0, 1, 2 Let x(a) be the third derivative of -1/80a*5 - 1/48a*4 + 0 + 1/60a*6 + 0a*3 + 0a - 7a2 - 1/280a7. Suppose x(b) = 0. Calculate b. -1/3, 0, 1, 2 Let c(j) be the third derivative of -j5/12 - 95j4/24 + 42j*2. Factor c(x). -5x(x + 19) Let a(z) be the first derivative of -z5/20 + 2z*4 - 32z*3 + 6z2 - 36. Let g(k) be the second derivative of a(k). What is i in g(i) = 0? 8 Let n(b) be the third derivative of -b5/20 - 15b4/8 - 7b*3 - 61b*2. Factor n(v). -3(v + 1)(v + 14) Find g such that -12 - 1 - 2g*2 - 8g - 10 + 16 + 17 = 0. -5, 1 Let s(b) be the first derivative of b*4/6 + 8b3/9 + b2 - 1039. Factor s(v). 2v(v + 1)(v + 3)/3 Let z(i) be the first derivative of i5/4 - 5i*3/12 - 31. Factor z(n). 5n*2(n - 1)(n + 1)/4 Let y(v) be the first derivative of -9/2v*4 - 3/5v*5 - 5 + 9v + 14v3 - 33/2v*2 + 1/2v6. Determine f so that y(f) = 0. -3, 1 Let t(w) be the second derivative of -w5/50 - w*4/10 + 3w*3 - 81w*2/5 - 378w. Let t(u) = 0. Calculate u. -9, 3 Let r(x) be the first derivative of 320x5 - 920x*4 + 2596x*3/3 - 276x*2 + 36x + 25. Find g, given that r(g) = 0. 3/20, 1 Suppose 3r + 2j + 1 = 0, -3r + 0r + 34 = -5j. Let 9 - rp*3 + 8p*2 - 2p*2 + 21p + 3 = 0. What is p? -1, 4 Let c be 4/30-3 + (-255)/(-75). Suppose 2r - 13 = -7p + 6p, p = cr - 7. Let -12y - 8/3 - 40/3y2 - ry*3 = 0. What is y? -2, -1, -1/3 Find p, given that -6 - 15/4p*4 + 3/2p - 3/4p3 + 39/4p*2 - 3/4p5 = 0. -4, -2, -1, 1 Let q(m) be the third derivative of m7/504 + m6/36 + m5/8 - 5m4/6 - 18m*2. Let f(d) be the second derivative of q(d). Factor f(a). 5(a + 1)(a + 3) Factor -27 - 5347l + 5457l - 88 + 5l*2. 5(l - 1)(l + 23) Let w = 66 + -51. Factor -21i*2 - 4i*2 + 11 + 20i*4 - 2 + 15i - 4 - wi3. 5(i - 1)*2(i + 1)(4i + 1) Suppose 13q = 6q - 7. Let k be -1 - q - (96/(-156))/4. Determine u, given that 0 + 2/13u4 + 0u - 4/13u3 + ku*2 = 0. 0, 1 Let u be (-40)/(-12) - 4/(-6). Suppose 3a = -2c + 23, -ua - 3 = -2c - 3a. Factor 2/9nc - 8/9n*3 + 4/3n*2 + 2/9 - 8/9n. 2(n - 1)4/9 Let q be (-4 + (3 - 1))/(-1). Determine c so that 2c - 90c2 + 1 - 82c*2 + 173c*q = 0. -1 Suppose 73 + 7 = 8p. Factor 85l + 8 - 39l*2 + 2 + 209l*2 - pl + 105l3. 5(l + 1)(3l + 1)(7l + 2) Let o = -5536 - -5539. Suppose 4/7 + 6/7f2 - 10/7f*4 + 2f*o - 2f = 0. What is f? -1, 2/5, 1 Let n(q) be the second derivative of -q*4/54 - 16q*3/27 + 17q*2/9 - 109q. Factor n(z). -2(z - 1)(z + 17)/9 Let x(q) be the first derivative of q*4/20 + 4q*3/15 - 3q*2/2 - 18q/5 + 39. Factor x(c). (c - 3)(c + 1)(c + 6)/5 Suppose -4f = -2a - 14, -a - 32 = -4f - 5a. Solve 13sf - 92s*2 + 28s*4 - 9s*5 + 29 + 35 + 28s*3 - 32s = 0 for s. -4, -1, 1 Suppose 5 = -x + 4i, -x + 0i - 5*i + 13 =	{ "pile_set_name": "DM Mathematics" }
pand -t - t + t + (5 + 7t - 16t + 8t)(-1 + 1 + 1). -2t + 5 Expand (3a - 4a + 2a + 11)(2 - 3 + 0)(-5 + 3 + 4). -2a - 22 Expand 0y3 + y3 + 0y3 + (4y2 + y2 - 4y2)(-y - 4y + 3y) + (-2y + 2y - 3y)(0y + 0y - 2y2). 5y*3 Expand 1 - 2t - 1 + (2t - 1 + 1)(-2 - 8 + 0). -22t Expand (0 + 2 - 1)(d*5 - 3d5 + d5) + (-2d + d + 5d)(4d + 2d4 - 4d). 7d5 Expand 0x*5 + 2x*5 + 0x5 + (x - x + x2)(2x*3 - 2x3 + x3) + 10x5 + 3 - 3. 13x*5 Expand 2l*5 - 3135l + 3135l + 1 - 32l*2 + (2l3 - l2 + l*2)(0l2 + 4l*2 - 3l*2) - l + 2l*5 + l. 6l*5 - 32l*2 + 1 Expand (2 - n - 2)(-4 - 1 + 2) + 1 + 1 - n - n. n + 2 Expand (2 + 8 - 6)(5 + 2p4 - p3 - 5). 8p4 - 4p*3 Expand (-2 + 3 - 3)(-g + 0g + 2g) + 4g + 0g - 3g - g - 3g + 3g - 3g + 2g + 1 - 2 + 2g - 2g + 2g. -g - 1 Expand (-3i2 + 5i*2 - 4i*2)(-i*3 - 3i*3 + 5i*3) + i - i - 2i*5 - 2i*5 - 4 + 8 - 3 - i. -6i*5 - i + 1 Expand 46h - 33 + 33 + (1 - 1 + 2h)(0 - 1 + 0) + 7h - h - h. 49h Expand -n - 2n + n + (-1 + 0 + 3)(5 - 5 + 2n). 2n Expand (2j + 2 - 2)(-1 + j + 1) + j*2 - 5j*2 + 9j*2 - 2j*2 + 6j*2 - 5j*2. 6j2 Expand i4 + 0i4 - 4i*4 + (-3i3 - i3 + 2i3)(3i - i + 0i) + i*4 - 2i*4 + 6i*4. -2i*4 Expand 0j*3 + 2j3 - j3 + 4j3 + j3 - 3j*3 + 5j*2 + 3j*3 - 5j*2 + (3j - 5j + 3j)(-5j*2 + 3j*2 + 0j*2). 4j*3 Expand 4u*2 - 4u*2 - 3u3 - u3 - 4u + 4u + (2u + 2u - 5u)(2u2 - 4u*2 + 4u*2) + (-1 + u + 1)(-60 + 60 + 4u2). -2u*3 Expand (2y*2 + 2y - 3y4 - 4y2 + y4)(4y - 3y + 5y). -12y5 - 12y*3 + 12y*2 Expand 0s*5 + 3s*5 - 2s*5 + (2 - 19 + 9)(4s5 - s5 - 5s5 - s5 - 3s5 + 2s5 + (s5 + 0s5 + 0s*5)(-2 + 4 - 1)). 25s5 Expand -98n*2 - 4n*3 - 97n*2 + 191n*2 + (1 - 1 - n)(0n2 + 2n*2 - 3n*2). -3n*3 - 4n*2 Expand (1 + h - 1 + 3 + 2h - 3 + (3 + 1 - 5)(3h - 5h + 0h) + 4 - 2h - 4)(-3h3 + 3h3 - h4). -3h5 Expand -h3 + 3h3 + h3 - h*2 + (-2h + h*2 + 2h)(h - 5h - 7h)(-3 + 2 + 3). -19h3 - h2 Expand (2b + 4b - 4b)(2 - 5 + 1) + 2 - 4b - 4 + 4. -8b + 2 Expand (5y - y - 5y)((0y + 2y - 3y)(2y2 + y2 - 2y*2) + 10 - 10 + 8y*3). -7y*4 Expand (0c + 0c - c)(-3c + c + c) + 0c2 + c2 + 0c2 - 7c*2 + 308c - 308c + 0c + 0c + 3c*2 + (0 - 3 + 1)(c*2 - 1 + 1). -4c*2 Expand (-11 - 2 + 5)(2 - j + 3j + 0j). -16j - 16 Expand (0o + o + 3o)(-o - o + 8o3 - 11o*3). -12o*4 - 8o*2 Expand (-3y + 3y + y2 + (-3y - 2y2 + 3y)(2 - 2 - 2))(9 - 2y2 - 9). -10y*4 Expand (-5 - 3 + 6 + x + (0 + 2 - 3)(-2x + x - x) - 3x - x + 3x)(-9x + 6x - 6x). -18x*2 + 18x Expand (7a - 3 + 3)((-2 + 0 + 4)(-1 + 4 - 1) + 1 + 0 - 2 + 1 - 3 + 3 + 4 - 1 + 1)(-3 + 6 - 1). 112a Expand (2c*2 - 4c*2 - 2c*2)(-5c2 + 4c*2 + 2c2) - c4 + 2c4 + 0c*4. -3c*4 Expand (0d - d - d)(5 + d - 5)(-5 + 0 - 1)(-4 + 3 - 1). -24d*2 Expand (3f*3 + 0f3 - f3)(2f - 2f + 2f) + 4f4 - 3f4 + f4 - 5f4 - 30f*2 + 12f*4 + 29f*2. 13f4 - f2 Expand (-n*4 - 4n*4 + 4n*4)(1 - 2n - 1 - 4 - 2n + 4 + (0 + 2 - 4)(3n - n + 0n) - 2n + 0n + 0n + n - 5 + 5)(-7 - 8 + 4). -99n5 Expand (2 - 1 + z2 - 2 - 11z)(-3z - 1 + 1). -3z*3 + 33z*2 + 3z Expand (5c - 5c - 2c4)(2 - 1 - 3)(2 + 1 - 2). 4c*4 Expand (3 - 3 + 2n*2)(n + 3 - 3) - 8 + 8 - 3n3 + (-2n*2 + 3n2 + n2)(-2n + 2n + 2n). 3n3 Expand (1 + 1 + 0)((5p - 3p - 3p)(2p3 - 2p*3 + 2p*3) + 6p4 - p3 + p*3). 8p*4 Expand (-3u + 4u - 3u)(0u - 3u + 0u)(-3 + 2 + 6). 30u*2 Expand 0i*2 + 8i*5 + 0i2 + (i3 + 3i3 - 6i*3)(2i2 + i - i). 4i*5 Expand (3h3 - h3 - h*3)(-34h + 9h + 17h). -8h*4 Expand 4s - 9s + 2s + (-4s + 0s + s)(-1 + 3 - 1) + 5s - 3s - s. -5s Expand (-4j + 0j + j)(4j - j - 2j) + 3j*2 + 0j*2 + 0j*2 + (-2 + 2 - 3)(-3j2 + 5j*2 - 4j*2). 6j*2 Expand 2v + 4v - 5v - 2 - 3v + 2 + (4v - v - v)(4 + 2 - 3). 4v Expand (3 - 35y + 29y - 2)(0y + 2y + 0y)(-2y + 0y + y). 12y*3 - 2y*2 Expand (-1 + 0 + 2 + 1 + 1 + 0 + (1 - 4 + 4)(2 + 1 - 2) + 4 + 3 - 5 + 5 + 1 - 2)(-10y - 9y + 2y). -170y Expand (-y - 2y*2 + y + (-3 + y + 3)(-4y + 6y + y))(9y*3 - 8y*3 + 4y*3). 5y*5 Expand -3b + 3b - 2b*3 + (-3b + 2b - b)(-2b2 + 0b*2 + 4b*2) - 10b*3 - 10b*3 - 7b*3. -33b*3 Expand (-3i*2 - 2i + 5i2 + 0i)(1 - 3 + 3)(-2 + 4 + 0). 4i2 - 4i Expand (4t5 - t4 - t4 - 2t*5)(3 - 3 - 1). -2t5 + 2t*4 Expand (4 - 2 + 5)(1 + 4 + 1)(-u - 3u + 5u). 42u Expand -2 + 2s5 - 19s + 19s + (5s - s - 2s)(0s4 - 2s*4 + 0s4) - s2 + s*2 + 2s*5 + 0s4 - s5 + 0s4 - 2s*5 - 3s*5 + 3s*5. -3s*5 - 2 Expand (1 - 16v + 23v + 31v)(-1 - 2v + 1)(v3 - 3v*3 + 4v*3). -152v*5 - 4v*4 Expand (-1 + 1 - s + (-2 - 2s + 2)(4 - 1 - 2) - 2 + 2s + 2)(s - 3s + 3s)(7s3 + 0s*3 - 3s*3 + (6s + 0s - 4s)(7s*2 - 2s*2 - 4s*2)). -6s5 Expand v5 - 6v5 + 7v*5 + (2v + 0v - 3v)(0v - 2v4 + 0v) + (3 - 3 - 2v)(-v2 + v2 - v*4). 6v5 Expand 1 + o2 - 1 + (-5o2 + 3o2 + o2)(-3 - 1 + 3) + (4o - 5o + 3o)(0o - 2o + o) + 2 + o - 2 + o2. o2 + o Expand (110c*2 + 118c - 56c - 63c)(-4 + c + 4). 110c3 - c2 Expand (-17 + 8 - 13)(0 + 0 + s + (1 - 1 - 2s)(-6 + 1 + 3) + 1 + 2s - 1). -154s Expand (13 - 6s*3 - 13)(2 - 2 + 2s) - 3s*4 + 3s*2 - 3s*2. -15s*4 Expand (2t*3 + 0t*2 + 0t*2 - 2t + 2t + t3 + (-2t + 0t + 4t)(-2t2 - t2 + 4t2) - t + t - t3)(-5 + 1 + 2). -8t3 Expand (-2 + t + 2t*2 + 2 + (3 - t - 3)(2t - t - 2t) - 4t2 + 2t*2 - 3t*2)(1 - 3 + 1). 2t2 - t Expand (-b + 3b - b)(-b + 3b - 5b + 4b - 4b + 2b + (-1 + 1 - 2b)(2 + 2 - 6) - b + 0b + 2b - b + 2b - 3b)(0 + 2 - 4). -4b*2 Expand (-2s*4 + 4s*3 - 4s*3)(-6 + 46s - 47s + 3). 2s5 + 6s*4 Expand (-3 - 1 + 3)(j4 + 6 - 6). -j4 Expand (z - z - z)(-2 + 2 + 2) + (4 + 1 + 1)(-z - z + 0z). -14z Expand (2l2 + 4l*2 - 4l*2)(-28l - 35l + 10l). -106l*3 Expand (4 + 1 - 3)(12 - 6 - 10c - 11)(0c2 + 2c*3 + 0c*2). -40c*4 - 20c*3 Expand (-1 - 4 + 3)(63 - 192h4 - 63). 384h*4 Expand 5b - 1 + 1 + (-1 - 2 + 5)(-7b + 2b + 3b). b Expand ((3 - 2 - 5)(3u + 2u - 2u) + (0u - 4u + 2u)(0 + 2 + 0))(0u + 0u - u). 16u*2 Expand (-u + 0u - u)(-3u + 5u - 5u) + 11 - 11 - 15u2. -9u*2 Expand (0w + 3w - 4w)(-2w*4 + 4w4 - w4). -w*5 Expand (1 - 4 + 1)(-2t5 + 0t*4 + 0t*4) - 2t*5 + 0t*5 - 3t*5 + (5t*4 - 2t4 - t4)(-3t + 3t - t). -3t*5 Expand ((0 + 1 - 3)(4 + 1 - 4) + 0 - 2 + 1 - 2 - 5 + 6)(3 + 2 + 3)(2 - 2 + 2q). -64q Expand (-4x + 4x + x)(2x*2 - 1 + 1) - 11x*2 - 3 + 11x*2 - 8x*3 + (4 - 4 - 2x)(-3x*2 + 6x2 - x2). -10x3 - 3 Expand (0n*2 - 5n*2 + 0n*2)(2n2 - 5n*2 + 2n2) - n4 - n*4 + 4n*4. 7n*4 Expand (-5z*3 + 4z - 4z)(-3z + 5z - 4z) + 7z*4 - 2z + 2z. 17z*4 Expand (2l + 2l - l)(13 - 11 + 17). 57l Expand (2 - 2 - h)((-h2 - h2 + h*2)(0 + 0 + h) + (4 - 3h - 4)(h*2 + 2h*2 - 4h*2)). -2h*4 Expand (0 + 2j + 0)(-3j*3 + 3j*3 - 2j*3) + 3j*4 + 2j*4 - 6j*4 + (-5j + 5j + j)(-j*3 - 2j3 + j3). -7j4 Expand (1 + 0 + 0)(-2 - 7 + 3)(3k*3 - 3k*3 + 2k*4). -12k*4 Expand (-4 + 4 + 1)(3s2 - 5s2 - s2) + (s - 3s + s)(-s + 0s - s). -s2 Expand (4n*2 - 1 + 1)(4 + 1 - 4)(-6 - 1 + 17). 40n*2 Expand (6 - o + 3 - 8)(3o4 + 2o*4 - 4o*4) + 4 - 4 + 2o5. o5 + o*4 Expand (-2b + 2b - b3)(-4b + 4b - 2b2) - 5b*5 - 2b*5 + 3b*5 + (-2b + 2b + 3b*3)(b2 + 0 + 0). b5 Expand (-4 + 4 - 3r)(-6 + 2 - 1)(-1 - 2 + 4). 15r Expand (-3m - 2m + 4m)(-3 - 1 + 2) - 2 - 3 + 4m + 4. 6m - 1 Expand (-5 + 2 + 1)(81s*2 - 81s*2 - 3s*4) + (2s + 0s - s)(-s2 + s2 - 2s3). 4s*4 Expand -2d*2 + 6d*2 - 3d*2 + (1 + 4 - 4)(-2d2 - d2 + 2d**2) + 3 -	{ "pile_set_name": "DM Mathematics" }
Rearrange 41917 - 83849 - 122u3 + 41912 to the form pu + k + ou3 + wu*2 and give k. -20 Express -10n*3 + 77 - 150 + 77 - 3n*3 + 2n*3 + 2n*3 + (-1 + 2 - 3)(-4 - 8n3 + 4) in the form qn*3 + mn + f + tn2 and give f. 4 Rearrange -65g*2 + 129g*2 + 1584g*3 - 62g*2 + 1761g*3 to mg*2 + wg + tg3 + o and give o. 0 Rearrange -294z*4 + 4z - 285z4 + 2z*3 + 13 + 580z*4 to qz + x + wz3 + tz*2 + jz*4 and give j. 1 Rearrange 1563r + 688r - 46r - 4 + 4 + 3r + 4 - r - 4 + 3 + r - 3 + (2r - 2 + 2)(4 + 1 - 4) + 4r - 2r - 3r to f + sr and give s. 2209 Rearrange 2a*3 - 3 - 65a*2 + 214a*2 - 63a - 73a2 - a3 - 64a*2 to ga + ja3 + o + ta*2 and give t. 12 Rearrange ((1 - 4 + 4)(4 - 4 + 3) - 2 + 4 + 2)(-346b + 53b + 28b) to h + rb and give h. 0 Express -352226o*2 + 352440o*2 + 9 - 9 in the form qo*2 + j + bo and give q. 214 Rearrange -69 - 70 + 7a + 189 - 83 to ua + z and give u. 7 Express (44 - 33 + 29)(-2097 + 2097 + 331d*3 + (-5 + 0 + 4)(4d3 - 4d*3 + 2d*3)) as od + zd2 + w + rd*3 and give r. 13160 Express -7a4 - a3 + 20a4 + 1 - 13a + 2a4 - 8a*4 + 48a as ba + sa*2 + ka*3 + h + ga*4 and give h. 1 Express -a + 28a*2 - 10a*3 + 3a*3 + 0a4 + a4 - 23a2 as v + ra*4 + ha*3 + pa + ma2 and give h. -7 Rearrange 69v*2 + 246 - 68v*2 - 15v - 3048 + 17v to u + bv*2 + tv and give t. 2 Express (37 - 37 + i*2)(27i + 12i - 12i) + (-6 + 8i + 6)(2 + 2i*2 - 2) in the form vi + oi3 + z + li*2 and give o. 43 Rearrange (w - 2w - 3w)(3 + 2 - 4) - 2 + 2 + 2w - 2w - 1 + 1 + (-9w - w - w)(-1 - 5 + 4) to p + cw and give c. 18 Rearrange (-1 + 5 - 2)(13i + 14i - 22i) to the form gi + p and give g. 10 Rearrange (4j3 + 0j*3 - 3j*3)(-11 + 10 + 12 + (2 - 6 + 0)(6 + 1 - 3)) to the form lj + nj3 + i + pj*2 and give n. -5 Rearrange -5y*2 + 36y*2 - 32y*2 + 567y*3 to qy*3 + n + sy*2 + ty and give s. -1 Rearrange (-2 + 3x - 2x - 9x)(-447x - 921x - 742x) to the form sx + kx2 + d and give k. 16880 Rearrange (-12l*2 + 30l*2 - 12l2 - l3)(22 - 10l + 11 - 17) to sl2 + ml + il4 + f + pl*3 and give p. -76 Express 98 - 26o + 27o + 9 - o + 2o + o + (0 + 1 + 1)(0o + 2o - 9o) in the form w + ao and give a. -11 Rearrange 99 - 358 - 441q*3 + 229 to the form i + nq*3 + pq*2 + xq and give i. -30 Express 5 + 580734t - 490t*2 - 290367t - 290367t in the form at + yt2 + x and give a. 0 Rearrange (-4a + 4a + 2a*3)(-374a + 5713a + 14063a) to qa*2 + h + fa*4 + ua*3 + la and give f. 38804 Express (-4 - 4 + 2)(-62a - 64a + 3a)(-a + 3a + 0a) - 3a*2 + 3a2 - a2 as ha2 + v + ka and give v. 0 Rearrange (-78c - 154c - 180c)(-2c3 + 4c*3 + 10c*3) to the form mc*2 + u + qc*3 + wc + kc4 and give k. -4944 Rearrange (-3y*2 - 3y*2 + 3y*2)(2y2 - 2y*2 - 3y*2) + 5942y*4 + 175y*4 + 276y*4 to fy*3 + gy*2 + jy + oy4 + n and give o. 6402 Express -71u*2 + 64u*2 - 2509 + 3u*2 in the form fu*2 + w + lu and give w. -2509 Express 54m + 18063 - 325m - 18064 in the form am + n and give n. -1 Rearrange -359q*4 - 8q*3 - 30q - 22q - 4q*2 + 3q*2 + 342q*4 + 57q to the form pq + iq*3 + mq*2 + h + vq*4 and give m. -1 Rearrange -18z*3 + 2z*3 + 3z*3 + (8 + 1145z*2 - 1145z*2 - 7z*3)(-1 - 3 + 6) to the form mz2 + uz + lz3 + x and give l. -27 Rearrange -2113c*2 + 10957c*2 + 3702c*2 + 8311c*2 to vc*2 + pc + b and give p. 0 Express -91z2 + 290z*2 - 96z*2 + z - 105z*2 - 22 in the form rz + x + bz2 and give b. -2 Rearrange (5k + 5k - 3k)(-876 + 2513 - 937) to ik + w and give i. 4900 Rearrange -4n2 + 25 - 8 - 5 - 12 - 184n to the form un2 + an + p and give a. -184 Express 1 - 8d4 - 29 + 12 - 11d*3 + 14 + 3d*2 in the form i + bd*2 + nd*3 + kd + cd4 and give b. 3 Rearrange i + 372i*3 + 0i - 371i3 - 261i*2 + 5 + 264i*2 to the form li*2 + yi + bi3 + r and give r. 5 Rearrange 501907x*3 - 1 - 501905x*3 - 2x*2 - 2 - 11x*4 to the form rx*4 + sx*3 + yx*2 + c + ux and give y. -2 Express -7d3 - 9d*3 + 8d*2 + 19d*3 + (d - 3d + d)(-7d*2 - 29d*2 + 29d*2) in the form s + bd*3 + cd*2 + zd and give c. 8 Rearrange (0 + 2 + 0 + (18 + 21 - 5)(-3 - 1 + 3))(-2j2 - 2j*2 + 7j*2)(-19j - 5j + 11j) to m + ij + oj3 + qj*2 and give o. 1248 Express (0o*2 - 5o*2 + 0o*2)(-201 - 368 - 161 + 206) in the form xo2 + i + po and give x. 2620 Rearrange 16g2 - 14g - 774 - 2g2 + 10g + 806 to the form mg + og*2 + z and give z. 32 Express -38170r + r*3 + 0r*2 + 38156r + 2 - 5r2 - 6r*3 as lr + v + tr2 + cr*3 and give l. -14 Express -33782857l*3 - 198l*2 + 3 + l + 2l - 5l + 33782859l*3 in the form xl + ql2 + ol3 + z and give z. 3 Rearrange (-s2 - 4 + 4)(26609 + 26485 - 53297) to as*2 + p + bs and give a. 203 Rearrange -54p + 2p*2 + 103p - 5p - 44p + 2037 to lp + x + ap*2 and give a. 2 Express -3o*3 + 1805 + 15o*2 - 4o - 12o2 - 1794 in the form xo + po3 + j + no*2 and give p. -3 Express -488a + 3760a + 261a + 3656a in the form za + u and give z. 7189 Express -4x + 2x - 5x + (305 - 305 - 238x)(-2 + 0 + 0) in the form ix + o and give i. 469 Rearrange 542 - 13 + u - 51 to f + tu and give t. 1 Rearrange (-6 + 6 + 2c + 0c + 2c - 4c + (1 + 0 - 3)(6c - 2c - 2c))(5c - c - 25c + (-4 + 2 + 4)(4c + 0c - 3c)) to b + kc + qc*2 and give q. 76 Express 535y*4 - 564y*4 + 0 - 1 + (6y + 2y - 3y)(10y*2 - 2y*3 - 10y*2) in the form by*2 + uy + f + cy3 + ny*4 and give n. -39 Rearrange (-4n + 0 + 0 + (n - 3n + 4n)(-2 + 0 + 0) + n + 2 - 2 - 2n + 0 + 0)(0n - 3n + 2n)(-20 - 5 - 4) to zn*2 + k + on and give z. -261 Express 3j3 - 1826 + 1212 - 7j*3 + 3742j*2 - 3740j*2 in the form aj*2 + f + xj + pj3 and give p. -4 Express -884b*2 + 30100b - 2 - 15043b - 15055b in the form o + nb2 + lb and give o. -2 Express -71170 - 71173 + 3377k2 + 142340 in the form xk + d + tk2 and give t. 3377 Express -7a*2 - 1615a*2 - 675a*2 - 1151a*2 + 559a*2 as ba*2 + l + ia and give b. -2889 Express -16s - 21 + 279s*2 - 11 + 6 + 2 + 2s*3 - 282s*2 in the form ls*3 + h + ms + ks2 and give k. -3 Rearrange -8 + 255n + n*2 - 47n*4 + 44n*4 - 264n to an + l + dn*2 + in*3 + un*4 and give l. -8 Express (-2g*2 - 31 + 31)(2 + 0 - 4)(-108 - 108 + 38) in the form qg*2 + yg + u and give q. -712 Rearrange 77 + 0q2 + 10q*2 + 103 - 9q*2 to the form nq*2 + kq + x and give k. 0 Express (-54494v + 54494v - 628v4 + 2)(0 + 2 - 1) in the form fv2 + l + rv + gv4 + yv*3 and give l. 2 Express -1 + 240q + q*4 + 280q*3 - 268q*3 + 4q*2 - 13q*3 as sq*4 + uq*3 + g + mq + aq2 and give u. -1 Express -65 - a + 2a*3 - 131 + 556 + 95 in the form x + ka + la2 + ga*3 and give g. 2 Express 20394 + 9z*2 + 13z*2 - 20331 as kz*2 + h + uz and give k. 22 Rearrange 0 - u*2 + 0 + (56 - 54 - 511)(5u - 7u*2 - 5u) + (3u2 - 4u*2 + 2u*2 + 2u)(1 - 5 + 3) to p + cu + lu2 and give p. 0 Rearrange 54u*3 + 2u*2 + 100u - 79u - 2u*2 to ju*3 + cu*2 + x + ru and give j. 54 Rearrange (g - g - g)(-10263g + 44199g + 1 - 7 + 63750g + 6) to i + fg + sg*2 and give s. -97686 Rearrange -111 + 111 - 183l*2 + (-2l2 - l2 + 4l2)(-7 + 3 + 2) - l*2 - 4l*2 + 2l*2 to hl*2 + zl + d and give z. 0 Rearrange (6o + 330314 - 330588 - 3o)(-4 + 11o + 12 - 8) to ro + no*2 + a and give r. -3014 Rearrange -7 - 518841d - 7 + 518461d to xd + y and give y. -14 Express -18144908z3 + 1 + 18144911z*3 - 283z + 0 as vz3 + uz + s + rz2 and give s. 1 Express t + 1151 + t - 12t + 2t + 4t in the form o + rt and give r. -4 Rearrange g2 - 9g*2 + 4230g + 2712g + 7g*2 to sg*2 + v + ug and give s. -1 Rearrange 180572u2 - 9 - 11u - 180572u2 + 5u*3 to xu*3 + pu*2 + ju + y and give j. -11 Express -585a3 + 304a*3 - 1689a*2 + 277a*3 as ma + ga*2 + d +	{ "pile_set_name": "DM Mathematics" }
k3 + 165817k*3 with respect to c. 12ck2 - 4477k*3 What is the second derivative of 10958q*5 - 112939q? 219160q3 What is the derivative of -6p*4v*3 + 3496pv3 - 2611v3 - v2 + 8 wrt p? -24p3v*3 + 3496v*3 Find the first derivative of -4486s4 + s3 - 4461. -17944s3 + 3s*2 Find the second derivative of 65d*2i*3o2 + d2io + 498d2o + di3 + 2di2 + 2dio*2 + 7do2 - 896do wrt d. 130i*3o*2 + 2io + 996o What is the second derivative of -d*3y*3 - 21039d*2y*3 + 73554dy3 + dy - d + 4 wrt d? -6dy*3 - 42078y*3 What is the second derivative of 9271y*3z + 4y3 - 107yz - 95y - 2z + 2 wrt y? 55626yz + 24y Find the third derivative of -10c3o*3p + 16c3o*2p*3 + 9c*2o*2p*3 - 2co2p - 2084o3p*3 wrt o. -60c*3p - 12504p3 Find the second derivative of d5 - 3d*3 + 1037d*2 + 1431d + 1. 20d3 - 18d + 2074 What is the third derivative of 40bv*3 + 4474bv + 196v3 - v2 wrt v? 240b + 1176 Find the first derivative of f2r + 323233f2 + 88450r + 2 wrt f. 2fr + 646466f Find the third derivative of 636443p*3 - 512p*2 - 488. 3818658 What is the second derivative of -35036p*2u*2 + 3p*2u + p*2 + 73pu - u4 - 38u wrt u? -70072p2 - 12u*2 Find the third derivative of 419175cx6 - 221c + 1062x2 wrt x. 50301000cx3 What is the first derivative of 9627x - 64081? 9627 Find the second derivative of 187706f2 + 71291f. 375412 Differentiate 2738crx - 2cx - 3rx + 29r - 30x - 5415 wrt r. 2738cx - 3x + 29 Find the second derivative of -141303f2 + 30725f + 1. -282606 What is the derivative of -15945c4 - 43036 wrt c? -63780c*3 What is the second derivative of 199596j*3 - 2j*2 - 1705726j wrt j? 1197576j - 4 Find the second derivative of -f5 - 6f*4 - 231f*2 - 97882f wrt f. -20f3 - 72f*2 - 462 What is the third derivative of -jn*3 + 2jn - 6n*3 - 14n*2 + 8 wrt n? -6j - 36 Find the third derivative of -105g4t*3 + 28g*4 - 2g*3 - 66g*2t - 75gt*3 wrt g. -2520gt3 + 672g - 12 Find the third derivative of 48628a3p*3w*3 - 2a*3p*3w - 3a3pw - 14ap2w*2 - 568pw3 wrt p. 291768a*3w*3 - 12a*3w Find the second derivative of 4195y5 - 25y*2 + 142y + 545. 83900y3 - 50 What is the third derivative of 186343i*3 - 1564i*2 - 7i - 1? 1118058 Find the third derivative of 11007n5 - 3409n*2 + 10n wrt n. 660420n2 Find the first derivative of 1434487p*2 + 2108941 wrt p. 2868974p Find the first derivative of 7279j2 + 161298 wrt j. 14558j What is the first derivative of -5745o2s3 - o2s + 4os3 + 23626s*3 + s wrt o? -11490os3 - 2os + 4s*3 Find the third derivative of -2s*6 + 3s*4 - 2161s*3 - 55350s*2. -240s*3 + 72s - 12966 Differentiate 63849h2 + 40540. 127698h Find the second derivative of -393547x4 + 2x*2 + 2x + 390803. -4722564x2 + 4 Differentiate -1362277bc2 + 817c*2 - 189c with respect to b. -1362277c2 Find the third derivative of 2mrw*3 - 2mrw - 4mw*3 - mw + 5105rw*5 + 20w*2 + w + 52 wrt w. 12mr - 24m + 306300rw*2 What is the second derivative of -63588z*5 - 10z + 90 wrt z? -1271760z3 Find the second derivative of -6c*5 + 1371c4 - c2w + 510cw + 2c - w - 2 wrt c. -120c3 + 16452c*2 - 2w What is the first derivative of -5l2 + 4392l - 32863 wrt l? -10l + 4392 Find the third derivative of 864510lq4 - 128lq - q4 - 2844q*2 - q wrt q. 20748240lq - 24q Find the second derivative of -36595d5 + 1030d + 7 wrt d. -731900d3 Find the second derivative of -26s4 + s3 - 1022s2 + 1760674s. -312s2 + 6s - 2044 What is the second derivative of 3434955m5 - 316197m - 3? 68699100m3 What is the third derivative of 14v*6 + 668v*5 + 79489v*2? 1680v*3 + 40080v*2 What is the third derivative of 20538y5 - y4 + y*3 + 35y*2 + 30y - 102? 1232280y2 - 24y + 6 What is the third derivative of -2q2t*5 - 948332q*2t*2 - 1137195t*5 wrt t? -120q*2t*2 - 68231700t*2 Find the third derivative of -12500i*3k*3 - 6i*3 + 2i*2k*2 + 208547k*3 wrt i. -75000k*3 - 36 What is the third derivative of 64619p*5 + 28960p*2 wrt p? 3877140p*2 What is the third derivative of -41511kt6 + 2kt2 + t6 + t2 + 2371 wrt t? -4981320kt3 + 120t*3 Find the third derivative of 188971g3 - g2 + 61368g + 1 wrt g. 1133826 Differentiate 4442lu - 6l - 421363u wrt l. 4442u - 6 What is the second derivative of -35869go*2q*2 - 2goq*2 + 77goq - go - 130gq2 - 7o*3q*2 + 2o wrt o? -71738gq*2 - 42oq2 What is the second derivative of 2248f*4 - 4f*3 + 155636f wrt f? 26976f2 - 24f What is the second derivative of -286338u2 - 122075u wrt u? -572676 Find the third derivative of -10h2r*3 - 2h*2r - 3h2 - 80hr2 - 9441r*5 + 28r wrt r. -60h2 - 566460r*2 What is the second derivative of 68a*4 - 240a*3 - 2a + 148620 wrt a? 816a2 - 1440a Find the third derivative of -401228g3t + 225g2t - 3g2 + 2gt wrt g. -2407368t Differentiate -8fgi - fg - 29fi + 2gi - 257g + 1345i wrt g. -8fi - f + 2i - 257 What is the second derivative of -2014877d*2 + 18d - 85836 wrt d? -4029754 Find the first derivative of 2246ly*2 + 2ly + 151l + y*3 - 9y + 187 wrt y. 4492ly + 2l + 3y*2 - 9 Differentiate -4339o*2 + 8o + 165760 with respect to o. -8678o + 8 What is the derivative of 609n*2p*2 - 2n*2p - 2np*2 - 75953p*2 + 1 wrt n? 1218np2 - 4np - 2p*2 Find the third derivative of -62885j*3w - 2j2w - 70j2 + j - 9w wrt j. -377310w What is the second derivative of -5276bc2 - 12bc - 4b + c*2 + 2c + 53 wrt c? -10552b + 2 Find the third derivative of 13317s*4 + 14s*3 - 39423s*2 - s. 319608s + 84 Find the third derivative of -3802209c3n*3 - 103c*2n*3 - 2cn3 - 11cn2 - 3c + 11n wrt c. -22813254n*3 Find the second derivative of 5gh4 + 28975gh3 + 4gh + 161g + 59h wrt h. 60gh2 + 173850gh What is the third derivative of -27984r*4 + 3r*3 - 975628r*2 wrt r? -671616r + 18 What is the third derivative of 25590h3m*3 - 14382h*2m*3 wrt h? 153540m*3 What is the first derivative of 24122a*3v*4 + 3a*3v*2 - 202735a*3 wrt v? 96488a*3v*3 + 6a*3v Find the second derivative of 46585a3 - 22764a. 279510a Find the second derivative of 127240o*4 - 5o - 5039. 1526880o2 What is the third derivative of -308t*5y - 24t3y*3 + 5913t*2y - 8y3 wrt t? -18480t*2y - 144y3 What is the second derivative of 104447n*3 + 136931n + 1 wrt n? 626682n Find the second derivative of k3 + 26662k*2 - 29k + 701. 6k + 53324 Differentiate 11p*2t + 1132p2 - 2831pt + 2p + 5t + 8 wrt t. 11p*2 - 2831p + 5 What is the second derivative of f*5 - 6f*4 + 35f*2 - 90347f wrt f? 20f3 - 72f*2 + 70 Find the third derivative of 2257035i*3k*3 + 10i*2k3 - i2k2 - 63467i wrt i. 13542210k3 What is the third derivative of -176o*5 - 21o*3w - 1582o2 - 14w wrt o? -10560o2 - 126w What is the third derivative of -b*4 + 7591b*3 + 4096b*2 - 2 wrt b? -24b + 45546 Find the second derivative of 966l3u*2y*3 + 2l*3uy2 + l3y*2 - 16u*2y*3 - 47uy3 + 11uy wrt u. 1932l*3y*3 - 32y*3 What is the third derivative of 20805mn3p + 290mn*2 + mnp + 2n*2 wrt n? 124830mp Find the third derivative of -16032o*4 - 13228o*2. -384768o What is the third derivative of 2bn*6 + 3bn3 + 630794bn2 - 292767n*3 wrt n? 240bn3 + 18b - 1756602 Find the second derivative of -1581743g2 + 3100g - 61. -3163486 What is the derivative of 2m2v + 7168mv + 14m + 238517v wrt m? 4mv + 7168v + 14 Find the first derivative of 522l*4 + 12lp3 + 47p*3 - 4p*2 + 11p wrt l. 2088l3 + 12p*3 Find the third derivative of -3n*5 + 55n*4 - 251n*3 + 268639n*2. -180n*2 + 1320n - 1506 Find the third derivative of 397ry*4 + 68ry2 - 86ry - 2y*5 + 9y3 + y2 + 6y wrt y. 9528r*y -	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.