Datasets:

timaeus
/

pile-dm_mathematics

Dataset card Data Studio Files Files and versions Community

Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
order. 2, 0, -3, -5.22 Put -1.2, 0.4, 2/13, -1, 10 in increasing order. -1.2, -1, 2/13, 0.4, 10 Sort 1, -13, 4, 11, -3 in decreasing order. 11, 4, 1, -3, -13 Put 2278, -3, 1 in descending order. 2278, 1, -3 Sort -3, -20, 1, 5 in descending order. 5, 1, -3, -20 Put -5, 0, -2, -41, -20 in increasing order. -41, -20, -5, -2, 0 Sort 1/2, 4, -628. -628, 1/2, 4 Sort 2, 292, 5 in ascending order. 2, 5, 292 Put 5.5, -4, -1/3 in descending order. 5.5, -1/3, -4 Sort 2/19, 0.5, 1/6 in decreasing order. 0.5, 1/6, 2/19 Sort 2, -5, -4, 26. -5, -4, 2, 26 Sort 95, -0.5, 0.01 in increasing order. -0.5, 0.01, 95 Sort 3, 1524, -1 in decreasing order. 1524, 3, -1 Put 2, -4, 0, 1, 51 in increasing order. -4, 0, 1, 2, 51 Sort -0.7, 5, 1, 0.03 in decreasing order. 5, 1, 0.03, -0.7 Put -0.4, -208, 3 in increasing order. -208, -0.4, 3 Sort -4, -3, -1, -29. -29, -4, -3, -1 Sort 0, 4, 10, 5, -44 in decreasing order. 10, 5, 4, 0, -44 Sort 2/7, -1, 0.3, -10/11 in descending order. 0.3, 2/7, -10/11, -1 Put -3, -2/3, -2, 2/15 in descending order. 2/15, -2/3, -2, -3 Sort -65, -4, 1, 3 in increasing order. -65, -4, 1, 3 Sort 4, -10, 7 in increasing order. -10, 4, 7 Sort -19, 4, -2, -1, 5 in increasing order. -19, -2, -1, 4, 5 Sort -1, 19, -2 in decreasing order. 19, -1, -2 Put -1/6, -5, 0.05 in increasing order. -5, -1/6, 0.05 Put 6, 17, -3, 1, 2 in increasing order. -3, 1, 2, 6, 17 Put -68, 0.3, 2, -1/10, 1 in increasing order. -68, -1/10, 0.3, 1, 2 Sort 3/8, 3, -1/157 in increasing order. -1/157, 3/8, 3 Put 17, 6/7, 16 in increasing order. 6/7, 16, 17 Put -2, -1, 1449 in decreasing order. 1449, -1, -2 Put -14, -5, -1 in decreasing order. -1, -5, -14 Put 15, 0, 4 in descending order. 15, 4, 0 Sort -103, -6, 0 in decreasing order. 0, -6, -103 Put -5, 2, 4 in descending order. 4, 2, -5 Put 7, -22, -11 in descending order. 7, -11, -22 Put -4, -1, -45, 124 in descending order. 124, -1, -4, -45 Put -9, -4, 63 in increasing order. -9, -4, 63 Put -1, -5/6, -122, -0.5 in increasing order. -122, -1, -5/6, -0.5 Sort 20, -6, -2 in decreasing order. 20, -2, -6 Put -5.3, 3, 4, 5 in descending order. 5, 4, 3, -5.3 Put 1, 3, 310 in ascending order. 1, 3, 310 Sort -5, -615, -5/4. -615, -5, -5/4 Sort 1, -33, 66 in decreasing order. 66, 1, -33 Sort 17, -2, -5, 3 in descending order. 17, 3, -2, -5 Put 2/15, 3/5, -28, -2/3 in increasing order. -28, -2/3, 2/15, 3/5 Put 202, -11, -3, -4 in descending order. 202, -3, -4, -11 Sort -9, -0.1, 0. -9, -0.1, 0 Sort 0.35, 0.03, -2/15. -2/15, 0.03, 0.35 Sort 136, -6, 2, -1 in ascending order. -6, -1, 2, 136 Put -7.6, 1/5, -6 in increasing order. -7.6, -6, 1/5 Sort 18, -1, -16, -5 in increasing order. -16, -5, -1, 18 Put -2/21, -18, -13, 3/4 in ascending order. -18, -13, -2/21, 3/4 Sort 1, 14, 0.4 in descending order. 14, 1, 0.4 Sort -0.4, -0.28, 34/7 in ascending order. -0.4, -0.28, 34/7 Put 3, 7, 2 in increasing order. 2, 3, 7 Put 5, 1, 62, 4, -2 in descending order. 62, 5, 4, 1, -2 Sort 2, 73, 9. 2, 9, 73 Sort 6, -4/21, 3. -4/21, 3, 6 Put -1/5, -0.1, 0, 2, -0.06 in ascending order. -1/5, -0.1, -0.06, 0, 2 Sort -4, 133, 5, -3/4 in ascending order. -4, -3/4, 5, 133 Sort -3, 158, 4 in descending order. 158, 4, -3 Sort 0.3, -3, -1/2, -0.084 in ascending order. -3, -1/2, -0.084, 0.3 Sort -2/27, -3, 0.06, -5/4 in descending order. 0.06, -2/27, -5/4, -3 Put -1/2, 8, 0.2, 4, -2 in ascending order. -2, -1/2, 0.2, 4, 8 Put 2/7, -0.3, -2, 14 in descending order. 14, 2/7, -0.3, -2 Sort 143, 1, 4, -3, -4. -4, -3, 1, 4, 143 Put -1/6, 0.2, -5, 61 in increasing order. -5, -1/6, 0.2, 61 Put 10, 8, -3, -1, 2 in descending order. 10, 8, 2, -1, -3 Sort -5, 27, 129 in decreasing order. 129, 27, -5 Sort -19, -4, 5, -3. -19, -4, -3, 5 Put -2, 2, 6 in decreasing order. 6, 2, -2 Sort 0, -3, -2, -22, -4 in ascending order. -22, -4, -3, -2, 0 Put 5, 85, -5, 2/5 in descending order. 85, 5, 2/5, -5 Sort 16, -2, 27 in descending order. 27, 16, -2 Sort -5, -2, 3, 381 in decreasing order. 381, 3, -2, -5 Sort -7, 1, 61, -4, -1 in ascending order. -7, -4, -1, 1, 61 Sort -34, 0, -150. -150, -34, 0 Sort -12, 46, -5 in increasing order. -12, -5, 46 Sort 0.4, 0.3, -1/5, -2, -0.05 in descending order. 0.4, 0.3, -0.05, -1/5, -2 Sort -3, 3, 4, 13, -26 in descending order. 13, 4, 3, -3, -26 Sort 0, -0.1, 1/4, -48/11. -48/11, -0.1, 0, 1/4 Sort 5, -6, 2, -2, 13 in ascending order. -6, -2, 2, 5, 13 Sort 33, 4, -2. -2, 4, 33 Sort -0.02, -2, 73. -2, -0.02, 73 Sort 13, 2, -10, 9, -4 in ascending order. -10, -4, 2, 9, 13 Put 5, 0.237, -0.1, 2 in ascending order. -0.1, 0.237, 2, 5 Put -4, -2, 123 in increasing order. -4, -2, 123 Put -4, 1, 4, -2, -1 in decreasing order. 4, 1, -1, -2, -4 Put 0.3, -5, 2, -3 in descending order. 2, 0.3, -3, -5 Put -8, 10, 28 in increasing order. -8, 10, 28 Put 2, -1/2, -0.1, -1 in decreasing order. 2, -0.1, -1/2, -1 Put 1, 1/4, 4157 in decreasing order. 4157, 1, 1/4 Sort -1, 1, -3 in descending order. 1, -1, -3 Put 2.8, -8, 4, 3 in ascending order. -8, 2.8, 3, 4 Put 71.5, 4, -0.5, -5/2 in ascending order. -5/2, -0.5, 4, 71.5 Sort -1/6, 0, -0.17, 0.1 in ascending order. -0.17, -1/6, 0, 0.1 Sort -1, 6, -2, 1. -2, -1, 1, 6 Put -2/3, 14.99, 2 in descending order. 14.99, 2, -2/3 Put -0.1, 2/5, 0.35, -2, 0 in decreasing order. 2/5, 0.35, 0, -0.1, -2 Sort 0.1, -3, -6, -5 in increasing order. -6, -5, -3, 0.1 Put -2, 2/3, -4, 6 in decreasing order. 6, 2/3, -2, -4 Put -561, -3, 0.5, 5 in increasing order. -561, -3, 0.5, 5 Put 2, 12, -4, 0 in decreasing order. 12, 2, 0, -4 Put -7, 3, -3 in descending order. 3, -3, -7 Sort -8, -239, 4 in increasing order. -239, -8, 4 Sort -57, -2, 0.5, 3/5 in ascending order. -57, -2, 0.5, 3/5 Sort -0.3, -1, -0.009 in decreasing order. -0.009, -0.3, -1 Put 0.2, 3, 2/25, -1126, 2 in descending order. 3, 2, 0.2, 2/25, -1126 Sort -1/5, 51, -2 in decreasing order. 51, -1/5, -2 Sort 125, 2, -4, 3. -4, 2, 3, 125 Put 5, -13, -0.01 in ascending order. -13, -0.01, 5 Sort 34, 1/6, 40. 1/6, 34, 40 Sort -1/6, 0.3, -1, -69, 1/6 in decreasing order. 0.3, 1/6, -1/6, -1, -69 Sort 0, 757, -4 in decreasing order. 757, 0, -4 Put 9, 4, 1 in ascending order. 1, 4, 9 Sort 5, 2, 0, -2 in decreasing order. 5, 2, 0, -2 Sort -20, 0, -2/9 in decreasing order. 0, -2/9, -20 Sort -4, -5, 1129, 5 in increasing order. -5, -4, 5, 1129 Sort 5, -89, -3 in decreasing order. 5, -3, -89 Sort -16, -3, 11, 3, 1 in descending order. 11, 3, 1, -3, -16 Sort 16, 0, 2.5. 0, 2.5, 16 Put -17, 10, -5, 0 in descending order. 10, 0, -5, -17 Sort 0, -3, -7, -1, -2. -7, -3, -2, -1, 0 Sort 1, 0.01, -4/5, 3, 7 in ascending order. -4/5, 0.01, 1, 3, 7 Put 1/6, -3, 5, -0.05, -18 in ascending order. -18, -3, -0.05, 1/6, 5 Sort -5, -3, 15, -8, 0 in decreasing order. 15, 0, -3, -5, -8 Sort 4, -5, 132 in ascending order. -5, 4, 132 Put -1/7, 4/9, 100 in descending order. 100, 4/9, -1/7 Put -25, 0.2, 2, -0.03 in ascending order. -25, -0.03, 0.2, 2 Put -0.7, 0.1, 16, -3 in ascending order. -3, -0.7, 0.1, 16 Put -490, 0, -5, -4, 1 in increasing order. -490, -5, -4, 0, 1 Put -11, 4, -1, 0 in decreasing order. 4, 0, -1, -11 Put 1, -5, 4, 5 in descending order. 5, 4, 1, -5 Put 3, 610, 0, -4, -2 in increasing order. -4, -2, 0, 3, 610 Sort -5, 5, -3, 2/13 in decreasing order. 5, 2/13, -3, -5 Put 3, -3/5, -4/3, -3 in ascending order. -3, -4/3, -3/5, 3 Sort 1, 7, -0.2, 23 in decreasing order. 23, 7, 1, -0.2 Sort -1/6, 0.5, 0.234 in descending order. 0.5, 0.234, -1/6 Sort 7, 8, 1 in descending order. 8, 7, 1 Put 1, -4, 5, -3, -158 in decreasing order. 5, 1, -3, -4, -158 Sort -1/3, 2, 0, -4, -2/5 in descending order. 2, 0, -1/3, -2/5, -4 Put -1, -2, -539 in ascending order. -539, -2, -1 Sort 12, -6, -17, -1, -4 in ascending order. -17, -6, -4, -1, 12 Sort -25, 0, -4, -0.01 in ascending order. -25, -4, -0.01, 0 Put 1, 20, 44 in descending order. 44, 20, 1 Sort -2, 4, -3, 0 in decreasing order. 4, 0, -2, -3 Sort -2/29, -28, 2 in decreasing order. 2, -2/29, -28 Put 1/3, -0.4, 0.08 in decreasing order. 1/3, 0.08, -0.4 Sort 12, -4, 5, 2. -4, 2, 5, 12 Put 11, -3, -3/5, -0.1, -0.2 in descending order. 11, -0.1, -0.2, -3/5, -3 Put -409, -3/7, -0.1, 5 in decreasing order. 5, -0.1, -3/7, -409 Sort -4, 12, -8 in decreasing order. 12, -4, -8 Sort 2, -30/7, 1 in decreasing order. 2, 1, -30/7 Sort 0.4, 12/11, 3, 0.2. 0.2, 0.4, 12/	{ "pile_set_name": "DM Mathematics" }
smallest value? (a) 2/21 (b) 2 (c) -0.2077 (d) 16 (e) -6 a Which is the second biggest value? (a) 2/11 (b) -26 (c) -1.8 (d) -2/9 (e) -4 (f) 2/3 a What is the fourth biggest value in 0.2, 553, 4/17, 5, 2/7? 4/17 Which is the smallest value? (a) 201 (b) 8/23 (c) -2/95 c What is the second biggest value in 6503, -1/2, -46? -1/2 Which is the smallest value? (a) 0.1 (b) -1/31 (c) -5/9 c Which is the fourth smallest value? (a) 0.03 (b) -2 (c) -51 (d) -3 (e) -20 (f) 0.5 b Which is the biggest value? (a) 3/460 (b) -2/13 (c) -1/11 (d) 11 d Which is the third smallest value? (a) 3 (b) 2 (c) 5 (d) 0.4 (e) 0.5 b What is the smallest value in -0.5, -0.2, 0, 114, 5? -0.5 Which is the biggest value? (a) -1/56 (b) 1/25 (c) -1 (d) 0 (e) -0.1 (f) -2/7 b What is the second biggest value in 70, -35, -1/3, -0.5, 4, -0.05? 4 Which is the second biggest value? (a) -2/9 (b) 1 (c) 4 (d) 931/4 (e) -1/6 c What is the fourth smallest value in 1/17, 1.5, -3, 0.24, 0.01? 0.24 Which is the biggest value? (a) 0.021 (b) 174 (c) 1/24 b What is the smallest value in 28, -25/96, -0.3? -0.3 Which is the third biggest value? (a) -10/9 (b) 1 (c) -3 (d) -0.16 a Which is the second smallest value? (a) -1/4 (b) 4130 (c) -10/9 (d) -1 d Which is the smallest value? (a) -33/8 (b) 0.032 (c) -5 c What is the biggest value in 0.36, 12, 0.9? 12 What is the third biggest value in 373, -1/4, 2/3? -1/4 Which is the second biggest value? (a) 4 (b) -0.5 (c) -5 (d) -158 (e) 1/7 (f) -12 e What is the smallest value in -0.2, 2/11, 0.07, 0.1, 0.05? -0.2 Which is the third biggest value? (a) 4 (b) 2/9 (c) -117 (d) 1/5 d Which is the fourth smallest value? (a) -0.5 (b) -1/4 (c) 2 (d) -15808 c What is the fourth smallest value in 7, 3, -2, 25? 25 Which is the biggest value? (a) 1/4 (b) 1/16 (c) 4 (d) -0.0312 c Which is the third smallest value? (a) -0.4 (b) 488 (c) -0.22 (d) 0.2 d Which is the fourth smallest value? (a) 10 (b) 5 (c) 8 (d) 0.0479 (e) 2 (f) -2/11 b What is the second smallest value in 2/2671, -0.4, 13, -4/5? -0.4 Which is the smallest value? (a) -0.08373 (b) 0 (c) 1/6 (d) 0.2 a Which is the third smallest value? (a) -2.3 (b) -1/11 (c) -0.02 (d) -4 (e) -0.2 (f) -0.6 f Which is the fifth smallest value? (a) 4 (b) 1 (c) -5 (d) 3 (e) -0.5 (f) 5 a Which is the fourth smallest value? (a) 2 (b) -1/2 (c) 1/15 (d) 0.04 (e) -56 c Which is the third smallest value? (a) -5 (b) -4 (c) 85723 (d) 8 d Which is the third smallest value? (a) -5 (b) 21.7 (c) -0.2 (d) -35 c Which is the second biggest value? (a) 4 (b) 102 (c) 3/7 (d) -12 (e) 1 a What is the third biggest value in -0.1, 2/9, 24736? -0.1 What is the fifth smallest value in -5, -22, 1, 10.3, -2? 10.3 Which is the smallest value? (a) 0.5 (b) 0.68 (c) -0.4 (d) 3 (e) -0.05 c Which is the fourth smallest value? (a) -5 (b) -1/4 (c) -3 (d) 1/8 (e) -1 (f) 14.1 b What is the smallest value in 10, -0.1, 1, -1/3, 134? -1/3 Which is the second smallest value? (a) -8 (b) -899 (c) 4 a What is the second biggest value in 7/22, 0.2, 5, -5, -10/7? 7/22 What is the third smallest value in 1/613, -14, 2/9? 2/9 What is the fifth biggest value in -3/8, -2/9, -1/5, 0.1, 7, -1/77? -2/9 Which is the biggest value? (a) 0 (b) 402 (c) 4 (d) 0.3 (e) 5 (f) 17 b Which is the fourth smallest value? (a) -3 (b) -1 (c) 180 (d) -123/2 (e) 5 (f) -1/7 f Which is the smallest value? (a) -4 (b) -10550 (c) 2 b What is the smallest value in -0.2, -406, 0.2, 7? -406 Which is the second smallest value? (a) -2 (b) 0.9 (c) -5 (d) 0.09 (e) 40 (f) 4 a What is the biggest value in 40, 1/4, -0.1245, -2, 1, -0.2? 40 Which is the second smallest value? (a) -2/11 (b) -1692/11 (c) 2 (d) -4 d What is the second smallest value in -5, -7, 1/3, 2/5, -269? -7 Which is the third biggest value? (a) 3/5 (b) 0.3 (c) 0.2 (d) 270/43 b Which is the fourth biggest value? (a) -18 (b) 4 (c) 0.2 (d) -120 (e) -2/3 (f) 2 e What is the second smallest value in 2/1171, -5, 8, -1? -1 What is the smallest value in -7, 1/2, 1/26420? -7 What is the fourth biggest value in 2, -4, -10/7, 1/5, -1/3, -31/2? -10/7 What is the fifth smallest value in 2/7, -5, 5, -4228, -1? 5 What is the biggest value in -0.212, 6, -0.2, 2/19, 3? 6 What is the second smallest value in 1, 2/5, 4328/5, -0.1, 1/4? 1/4 What is the fourth biggest value in 5, 2/3, 171316, 2/13? 2/13 What is the second biggest value in -1/150, -3, -0.2? -0.2 What is the smallest value in -2/11, -19, -64, 2? -64 Which is the sixth biggest value? (a) -1/8 (b) 2/3 (c) -51 (d) 0.5 (e) 48 (f) -0.3 c What is the smallest value in -1.3, -4/55, 497? -1.3 Which is the fifth smallest value? (a) 0.09 (b) -0.06 (c) 3/5 (d) -9 (e) -2/11 (f) 2.4 c What is the third smallest value in -5, -2/9, -0.079, 1.07, -0.1? -0.1 What is the fourth smallest value in -13, -3.2, -51/2, -3? -3 What is the second biggest value in -0.3, 0.11, -10.5? -0.3 Which is the smallest value? (a) 2548/19 (b) 5 (c) -0.5 c Which is the fourth smallest value? (a) 0.5 (b) 2/13 (c) -2 (d) -14/41 (e) 5 a Which is the second biggest value? (a) -2 (b) 5/3459 (c) -1/5 c What is the second biggest value in 301/5, 47, 5/3? 47 Which is the second biggest value? (a) -44 (b) -6.6 (c) 3 (d) -0.1 d What is the third biggest value in -53, -3/5, -329? -329 What is the fifth biggest value in -18/11, -1, -5, -2/3, -1.7, 3/4? -1.7 What is the third smallest value in -2, 695, 8? 695 What is the smallest value in 7, -0.13, -1201? -1201 What is the second smallest value in -1/6, 1/3, -154, -0.08, -199? -154 Which is the fourth smallest value? (a) 3 (b) 16 (c) -2/7 (d) 122 (e) 0.4 b What is the biggest value in -11.5, 0.047, -57? 0.047 What is the second biggest value in 2, -7/2, -2/3, 122? 2 What is the fourth biggest value in -1, 1/91, 0, 172? -1 What is the second smallest value in -170/4211, 1/2, -5/6? -170/4211 What is the fifth smallest value in 1/4, 1, -2/97, 2, 5? 5 Which is the fourth biggest value? (a) 5 (b) 32900 (c) -3 (d) -0.3 (e) 0.3 d What is the second smallest value in -4, 6306, -1/5? -1/5 What is the biggest value in 4/7, 19, -15/82? 19 What is the smallest value in 2, 2/11177, 0.3? 2/11177 What is the second smallest value in 6, 2739, -2/31? 6 Which is the third smallest value? (a) -4 (b) 2/31 (c) -0.07 (d) -0.4 (e) -5 (f) 0 d Which is the second biggest value? (a) -5 (b) 265 (c) 3 c What is the biggest value in 17, 0.054369, -5? 17 What is the biggest value in 12, -4.1, 66, 2/9? 66 Which is the third smallest value? (a) 42 (b) 0.02 (c) -8/9 a What is the third biggest value in -0.5, -2.105, -2/19? -2.105 What is the second smallest value in -2/5, 44, 39, -1? -2/5 Which is the third smallest value? (a) -3 (b) 13 (c) 3 (d) -8 (e) -5 a What is the smallest value in -11, 4, 204, -4? -11 What is the smallest value in 2, -0.5, -1538, 90? -1538 What is the second biggest value in 0, -0.076, 1, 3/4? 3/4 What is the fourth smallest value in -3/4, 4/3, 5, -0.3, 20/431? 4/3 What is the second smallest value in 5, 11/336, -1/10, -5? -1/10 Which is the second smallest value? (a) -3 (b) -1/2 (c) -9 (d) -2339 (e) 0.05 c What is the second smallest value in 38, -362, -1, -1/8? -1 What is the second biggest value in -0.37, 0.3, 2.4, -0.06? 0.3 Which is the third biggest value? (a) 0.3 (b) 1/89 (c) 3 (d) -1/8 (e) -118 b What is the smallest value in -1065, -0.4, 3, 1, 0.038, 2? -1065 What is the smallest value in -0.3, -13, -2/3, 14, 1/14, 1? -13 What is the third smallest value in 1, -15, -0.15, -0.2, 329? -0.15 Which is the second smallest value? (a) 274 (b) -8/9 (c) -5 b Which is the second biggest value? (a) 1/95 (b) -0.8 (c) 1252 a Which is the second smallest value? (a) 25 (b) -5 (c) -4 (d) -0.3 (e) -130 b What is the fourth smallest value in -3, 744, 4, 0.06, 16? 16 Which is the third biggest value? (a) 3 (b) 0.583 (c) 0.12 (d) -0.05 c What is the third biggest value in 4, 1, -1/4, -111/50? -1/4 Which is the fourth smallest value? (a) -1/4 (b) 4/109 (c) -0.2 (d) -5 (e) -4 c What is the fourth biggest value in 0.12, -201, -8/21, 1/4? -201 What is the biggest value in -6,	{ "pile_set_name": "DM Mathematics" }
4k - 2 + (-4k + 5k + k)(1 + 0 - 3) - 2k - 2k + 3k in the form m + uk and give m. 0 Rearrange -10d - 70d*2 - 11d + 21d to qd*2 + o + td and give q. -70 Rearrange 3m4 - 6m*4 + 1 - 2 + 4m*3 to the form um*2 + gm*4 + im*3 + pm + q and give g. -3 Rearrange 0 - 33f4 - 1 - 3f*3 + 15f*4 + 19f*4 to mf + pf3 + df*4 + nf*2 + x and give d. 1 Rearrange (-3 + 3 + 3)(2 + 2l2 - 2) + (2l - 3l2 - 2l)(-40 + 17 + 21) to gl + p + vl2 and give v. 12 Rearrange 0f + 3f3 + 0f + (-518 - 12f + 518)(4f + f2 - 4f) to the form cf + jf*3 + b + yf*2 and give j. -9 Express 0t + 3t - 6t + (28 - 1 - 5)(t + 2t - 2t) in the form kt + v and give k. 19 Rearrange -25o + 64o - 23o - 26o to the form yo + f and give y. -10 Express 17h - 8h + 32h as gh + y and give g. 41 Express (5a + 5a - 5a)(5 - 4 - 2) - 3a - 6a + 5a + 2a - 2 + 2 in the form l + ha and give h. -7 Rearrange 149i3 + 15 - 79i*3 - 71i*3 to the form ni + ui2 + ri3 + b and give b. 15 Rearrange p4 - 3p4 - 4p4 - p4 + p*4 + 3p*4 + (-2p*4 + 0p*3 + 0p*3)(-3 + 2 + 0) to the form xp3 + gp + wp2 + qp*4 + y and give q. -1 Rearrange (0w + 2w - 4 + 2)(-2w3 - 9w*2 + 9w*2) to the form nw*3 + xw + qw4 + pw*2 + d and give q. -4 Rearrange 2 - 2 + 6k - k3 - k3 to the form yk3 + nk*2 + x + ik and give y. -2 Express (3z - 2z + 2z)(-280z + 9z*2 + 280z) in the form iz2 + dz + hz3 + r and give h. 27 Express 68b + 18b2 - 68b in the form ub2 + xb + w and give u. 18 Express -40i - 3 + 1 + 3 in the form bi + s and give s. 1 Express 4f + 0f*3 - 2f*3 + 0f - f + 2 as xf3 + af*2 + sf + h and give h. 2 Express 74l2 + 50l*2 - 4l*2 as al*2 + s + vl and give s. 0 Express (x - x + 4x)(-3 + 2 + 3)(-2x*2 - 1 + 1) as yx + jx3 + n + ox*2 and give j. -16 Rearrange 0 - 1 - 2y*3 - 108y + 2 - y*4 + 107y to the form p + qy3 + xy*4 + zy*2 + uy and give x. -1 Rearrange -24u2 - 3u*3 + 5u + 26u2 - 8u - 8u to the form d + yu + ou3 + bu*2 and give y. -11 Rearrange -2y*3 + 8y*2 - 3y*3 - 7y*2 + (2 - 1 - 2)(-9y3 - 4y*3 + 0y*3) to ly*2 + h + qy + dy3 and give l. 1 Rearrange (1 - 5 + 2)(-o + 2o + 4o - 3) to the form uo + n and give n. 6 Rearrange 8k + 11k + 3k to ik + t and give i. 22 Rearrange -12a + 1 - 2a3 - 449a*2 + 449a*2 to the form oa*2 + ma + s + va3 and give v. -2 Express i + 9 + 4i - 4i as vi + b and give v. 1 Express -18v + 16v*2 + 18v as a + uv + lv*2 and give l. 16 Rearrange (-u + 0u + 7u)(-4u2 + u2 + 5u*2)(-7 - 24 + 67) to o + lu3 + ju*2 + du and give l. 432 Express (-2 + 4 + 3)(-i - 3 + 0i + 0) as p + ui and give p. -15 Express (4r - 6 - 2r + 3)(r2 - r2 - r*2) + 10r*2 - 10r*2 - 3r*3 as mr*2 + pr*3 + w + jr and give m. 3 Rearrange -17 + p + 9p2 + p + 13 to xp + wp2 + h and give w. 9 Express -46r*2 + 120 - 120 in the form gr + mr2 + o and give m. -46 Rearrange (-2j - j + 3 - 2)(-j - 1 + 0j - 3j) to the form t + nj + yj2 and give y. 12 Express (w - 3w + 0w)(5 - 5 + w)(0 + 0 + w) in the form dw*2 + lw*3 + mw + n and give l. -2 Rearrange 2q - 3q - 10q to the form jq + n and give j. -11 Rearrange -10i2 + 2i*3 + 6i + 13i2 - 5i to si3 + oi + f + hi2 and give h. 3 Express 53v + 3v2 + v3 - 53v + 2 in the form yv + xv*3 + cv*2 + f and give y. 0 Rearrange -3 + 1 - 3j + 4 + j to the form sj + h and give h. 2 Rearrange 5y*2 - 4y*2 + 13y*2 + 2y*2 to sy*2 + ny + q and give s. 16 Rearrange 4m3 - 3m*3 + 0m*3 + (-3 + 5 + 0)(-4 + 2m3 + 4) to the form f + bm + nm2 + tm*3 and give t. 5 Rearrange 4x - 4x - 5x - 3x + 1 to j + yx and give y. -8 Rearrange -s - 5 + 5 + (3s + 2s - 32s)(-2 + 2 + 2) to the form a + ts and give t. -55 Rearrange -5k*2 + 5k*2 - 6k*2 to lk*2 + qk + z and give l. -6 Rearrange -14p + 13p + 0p3 - 2 + 2p*3 to the form vp*2 + jp + m + ap3 and give m. -2 Express (-1 - 2 + 5)(r - r - 2r) + 2r + 0r - 4r - 12r + 0 + 0 + 4r - 2 + 3r - 3r as ar + p and give a. -14 Rearrange 3f - f + 9f + f to the form vf + i and give v. 12 Express (-6y3 - 8y*3 + 7y*3)(7 + 2 - 5)(1 - 5 + 5) in the form ay*2 + zy + m + ry3 and give z. 0 Rearrange (p - p - 2p)(-7p + p - p + (p + 0p + p)(6 - 20 + 8)) - 4p2 - p2 + 3p*2 to qp*2 + o + lp and give q. 36 Rearrange 118 - 118 + 15v to f + uv and give u. 15 Rearrange 31k2 - 7k*2 - k + k to the form r + hk + nk2 and give n. 24 Express 2 + 3h + 1 - 3 - 2 as j + vh and give v. 3 Rearrange -9y + 2 + 665y2 - 666y*2 + 0 + 0 - 2y*3 to f + zy*2 + by*3 + ly and give z. -1 Express -20l - 22l - 21l in the form r + ql and give q. -63 Express (43 - 19 - 35b - 26)(b - b + b) in the form rb + d + ab*2 and give a. -35 Express -5u*4 - 2 + 2u - 3u + 2u*4 + 0u as ru4 + bu + nu3 + h + gu*2 and give b. -1 Rearrange (-2 - 2 + 5 + (-1 - 1 + 1)(-4 + 1 + 1) + 4 + 1 - 2 + 2 + 1 + 2)(-4 + 4 + u) - 4u - 2u + 5u to v + ou and give o. 10 Rearrange 2q - 8q + 7q + 8q2 - 5q*2 to the form pq + hq2 + j and give p. 1 Rearrange 7y*2 + 2y - y*3 + 32y*4 + 37y*4 - 70y*4 to the form ty*3 + ky*4 + cy*2 + g + uy and give u. 2 Express -12f + 4 + 43f - 11 + 8 in the form tf + h and give t. 31 Rearrange -34 - 24 + 64 - 2r*3 - 2r to the form dr2 + m + tr*3 + vr and give v. -2 Rearrange (-3m + 5m - m)(11m - 12m - 54m) to the form om + gm*2 + y and give g. -55 Rearrange -40 - q + 40 + 2q*2 to the form b + lq + oq2 and give l. -1 Rearrange -b4 + 13 - 102b*2 + 102b*2 - 2b*3 to the form h + wb + lb4 + vb*3 + db*2 and give l. -1 Express 4y*2 - 4y*2 + 16y*2 as ly*2 + q + ty and give l. 16 Rearrange 4o - 2o - 6o + (2 - 3 - 1)(3o - o - 3o) to k + bo and give b. -2 Express (k + 0 + 0)(-2 + 2k2 + 2) + k3 + k3 + 0k*3 - 181 + 181 + 48k*3 in the form pk + hk2 + j + rk*3 and give p. 0 Rearrange -139g*4 - g + 2g*2 + 140g*4 - g + 0g*2 - 2 to the form yg*3 + lg + ug2 + d + xg*4 and give d. -2 Rearrange -2l4 + l4 + 13l - l2 - 11l to jl + sl*2 + ml*3 + rl*4 + a and give j. 2 Rearrange -38b + 14b - 41b - 22b to i + wb and give w. -87 Express -2s2 - 3s3 - 22 + 22 + (0 - s2 + 0)(4 - s - 4) + 3s3 - s3 - 3s3 as ks*3 + js + rs2 + q and give k. -3 Rearrange -54d - 6d + 24d to gd + j and give g. -36 Express -6s + 0 - 2 + 2s + (-5s + 3s + 0s)(3 + 0 - 1) + 1 - s - 1 in the form ls + g and give g. -2 Rearrange (-r2 + r2 - r*2)(-48r + 39r + 37r)(-4 + 0 + 2) to the form nr2 + l + hr + mr3 and give m. 56 Rearrange -21x - 2 + 2 - 1 + 0 to mx + j and give j. -1 Express ((0f + 2f - 3f)(1 - 1 - 2) + 0f + 0f + 3f - 1)(34 + 9f - 34) as s + vf + of*2 and give v. -9 Express -2 - 6p*2 + 4p*2 + 7 as gp*2 + tp + z and give z. 5 Express -5q - 24q - 3q + 4q in the form jq + g and give j. -28 Express (-3 + 0 + 2)(-2 + 2q + 2) - 6q + 0q + 4q as jq + r and give j. -4 Rearrange 3 - 2 - 8k - 9k - 3 to wk + i and give i. -2 Rearrange -36 - y*2 + 0y*2 + 36 - 9y to the form i + gy2 + wy and give g. -1 Rearrange 2g4 + g4 - 6g*4 + (7 - 6g - 7)(3g3 + g3 - 6g3) to bg + qg4 + s + ug*3 + wg2 and give q. 9 Express -h3 + 4h3 - 3h*3 + 11h + h*3 as fh*2 + p + kh*3 + ah and give a. 11 Rearrange 46t + 72t - 18t - 18t to the form p + ut and give u. 82 Rearrange c3 + c3 + 0 + 4 - 6 - 6c + c*4 to the form d + qc + zc4 + ic*3 + rc*2 and give i. 2 Express 4r - 2r + r + (-1 - 2 + 2)(-2r - 1 + 1) + 4r + 1 + 2 - 5r + r + 2 - 2 as a + hr and give a. 3 Express -7v4 + 5 - 5 - v2 + 9v*4 - 2v - v*3 as y + tv*3 + xv*4 + iv*2 + kv and give t. -1 Rearrange (-1 + 2 - 2 + (2 - 5 + 4)(0 + 2 - 4) - 3 + 6 + 4)(3o4 + 1 - 1) to co*2 + yo + n + bo3 + io*4 and give i. 12 Express (-3 + 3 + k)(-5k3 - 2k*3 + 4k*3) + (2k3 + k3 - 5k3)(2 - 2 - 4k) in the form yk*3 + z + fk*	{ "pile_set_name": "DM Mathematics" }
in base 11? -16275 24177 (base 13) to base 10 66177 What is 48a97 (base 11) in base 6? 1302304 Convert 44614 (base 11) to base 16. fc75 What is -54029 (base 12) in base 5? -12020000 Convert 513557 (base 8) to base 4. 221131233 Convert 1044322 (base 7) to base 3. 20112122221 Convert 45773 (base 11) to base 5. 4104041 What is -1020210122 (base 4) in base 9? -502658 What is -1122472 (base 8) in base 12? -128222 Convert 300121132 (base 4) to base 3. 101001221011 13997017 (base 10) to base 12 4830161 -20d33 (base 14) to base 4 -103121001 3143310 (base 6) to base 5 14404230 266186 (base 10) to base 5 32004221 Convert 1658887 (base 9) to base 4. 3201312223 Convert 14957c7 (base 15) to base 12. 4ba8097 Convert 131330223012 (base 4) to base 16. 77cac6 4b963 (base 13) to base 14 3904d What is -3063143 (base 7) in base 11? -231916 -1019b13 (base 12) to base 16 -2e23ff Convert 367209 (base 11) to base 2. 10001101101111010111 What is -54356166 (base 7) in base 10? -4652892 Convert -210202032213 (base 4) to base 15. -c92b23 -ba7752 (base 13) to base 5 -2110331322 What is b0495 (base 14) in base 11? 26a1a2 What is 21000120110 (base 3) in base 6? 2543450 -116505235 (base 7) to base 15 -9aba77 What is 4d238d (base 15) in base 14? 6c57b1 -8737726 (base 9) to base 16 -479148 What is 196be (base 16) in base 10? 104126 236415 (base 13) to base 5 203422040 Convert b2266 (base 13) to base 6. 10500443 What is -1100301444 (base 6) in base 15? -107aa1d Convert -2045235 (base 6) to base 10. -99671 What is -45450235 (base 6) in base 14? -282b5d Convert -7ebb04 (base 15) to base 4. -113020131223 What is -220432 (base 6) in base 9? -27102 What is -102114052 (base 6) in base 12? -71b928 -1201024210 (base 5) to base 3 -12011210202201 3523110 (base 6) to base 16 2c772 What is 2203531 (base 6) in base 8? 326217 1aca7 (base 15) to base 4 111103000 Convert 10412034 (base 5) to base 8. 262577 12320032300 (base 4) to base 10 1803184 What is 220003030 (base 5) in base 14? 1a5b22 -112176 (base 9) to base 15 -14db3 Convert -211011112 (base 5) to base 4. -3111310012 What is -1230164 (base 7) in base 3? -22001111122 34c2a (base 15) to base 12 81357 Convert -a6577 (base 12) to base 15. -44b44 Convert 12310313303 (base 4) to base 13. 4a8643 17a25b (base 13) to base 10 593604 Convert -1d358 (base 14) to base 6. -1334030 851d (base 14) to base 7 123636 Convert -175507 (base 10) to base 5. -21104012 What is 2676263 (base 8) in base 11? 474671 What is -10244532 (base 7) in base 13? -245361 What is 10010111011010000 (base 2) in base 3? 10221100010 Convert -21652107 (base 8) to base 12. -1695287 Convert -100001110010111010111 (base 2) to base 5. -240414130 -19ca6e (base 16) to base 15 -235c17 What is -16528632 (base 9) in base 2? -11111100111000001111001 Convert 68634a (base 12) to base 6. 55442134 Convert 15130042 (base 7) to base 6. 50435204 -26965 (base 12) to base 8 -147735 What is 12302640 (base 7) in base 10? 1110270 What is -12122101010 (base 3) in base 14? -2c6a5 -2836315 (base 9) to base 7 -16153622 -120002322 (base 4) to base 13 -35aa2 What is 3c571 (base 15) in base 4? 233101012 What is 210332120 (base 4) in base 3? 21200202012 16167 (base 15) to base 5 4234242 142120540 (base 6) to base 13 7a85c6 Convert 171127 (base 8) to base 15. 135ae -196353 (base 10) to base 9 -328310 43414 (base 11) to base 12 305a8 What is 1000012020101 (base 3) in base 5? 114112013 What is -14912638 (base 10) in base 9? -31048257 64038 (base 14) to base 2 111010111101110010 Convert -41b7 (base 16) to base 10. -16823 -321363 (base 13) to base 4 -10132210122 What is 1502b (base 12) in base 9? 44308 Convert 225410 (base 8) to base 11. 52573 What is 410442134 (base 5) in base 15? 22a999 -1819b3 (base 12) to base 5 -101333004 Convert -14cac0c (base 14) to base 4. -212303103230 What is -1010101110010010111010 (base 2) in base 6? -140130110 What is -669092 (base 13) in base 6? -123503052 Convert -680542 (base 9) to base 13. -113480 Convert 1554613 (base 7) to base 10. 215365 What is -212042320 (base 6) in base 3? -21000220212110 -102001001020 (base 3) to base 14 -59279 Convert -52187 (base 13) to base 7. -1152653 What is -b7a97 (base 13) in base 12? -13b918 -d21d6 (base 15) to base 6 -22132033 Convert 368499c (base 13) to base 9. 34800053 What is 11100111011111111101010 (base 2) in base 14? 10166ca -1001134 (base 5) to base 14 -5a82 What is 7406 (base 9) in base 14? 1da1 -21212331 (base 5) to base 13 -63693 What is -120500 (base 10) in base 6? -2325512 36782e (base 16) to base 12 124197a What is 61547 (base 10) in base 3? 10010102112 What is -101222110221 (base 3) in base 15? -4408d What is -3060116 (base 7) in base 15? -73ce5 Convert 10111010110011011 (base 2) to base 3. 11212012100 132126 (base 8) to base 3 2100022212 -1306447 (base 8) to base 11 -229381 What is -286394 (base 13) in base 3? -1212001000012 What is 10001011001000001000 (base 2) in base 14? 10b968 What is -110000111111100001 (base 2) in base 5? -22410143 -13737361 (base 8) to base 11 -1847a12 4228346 (base 10) to base 4 100020103322 What is 8542045 (base 9) in base 10? 4574516 -19723 (base 13) to base 14 -140b0 -124358 (base 11) to base 2 -101111110111110011 What is 1225252 (base 10) in base 8? 4531044 What is 11000111100111000000111 (base 2) in base 13? 1480200 Convert -c2972 (base 15) to base 9. -1138458 301425 (base 9) to base 7 1341413 816a9b (base 13) to base 4 23133310101 Convert -17102 (base 15) to base 14. -1d1db Convert -c2e50 (base 15) to base 3. -1011101000110 What is -163e1 (base 15) in base 10? -71761 Convert -cbc8c (base 15) to base 9. -1186126 Convert 453354242 (base 6) to base 14. 115aa30 -1f73c (base 16) to base 3 -20112201102 100110101100001101100 (base 2) to base 6 43101312 -295b731 (base 12) to base 4 -133302331111 -1211ba (base 16) to base 9 -2204352 31877623 (base 9) to base 3 1001222121200210 What is -42597 (base 11) in base 13? -22265 What is 486184 (base 11) in base 8? 2736773 Convert -45eb (base 15) to base 16. -39fe 102052163 (base 7) to base 13 1326b27 -222200012021222 (base 3) to base 6 -1223455512 Convert -1992c07 (base 14) to base 8. -60422527 What is -4601565 (base 7) in base 4? -2023222221 Convert 5c78 (base 13) to base 8. 31470 -118510 (base 12) to base 13 -9c429 Convert 9866 (base 15) to base 10. 32271 6335022 (base 10) to base 9 12825013 Convert -4033a2 (base 13) to base 9. -2724164 1c845a (base 16) to base 14 369122 Convert -874022 (base 9) to base 8. -1772047 What is 3613332 (base 9) in base 13? 537086 What is 42202421 (base 5) in base 16? 55899 What is 621742 (base 14) in base 2? 1100100111100110101110 What is -79787 (base 11) in base 6? -2250144 What is -10210323130 (base 4) in base 13? -330181 30106 (base 14) to base 5 12143300 Convert -140276 (base 11) to base 4. -311230210 What is 251871 (base 11) in base 15? 7cc74 Convert -254b0b (base 14) to base 13. -35b017 3334301002 (base 5) to base 3 111210210022222 What is f2a4 (base 16) in base 4? 33022210 Convert -43074 (base 8) to base 7. -103264 Convert -101111000010110110 (base 2) to base 8. -570266 Convert -11010110000111110111 (base 2) to base 9. -1576066 -204863 (base 15) to base 2 -101110110100010111111 What is 110210122220 (base 3) in base 2? 111101100001010100 What is -1440205 (base 11) in base 15? -33d31b Convert 10d5c3d (base 15) to base 2. 101110000010011000011111 Convert -6052888 (base 9) to base 5. -1311124022 -421043203 (base 5) to base 3 -10021021010120 What is -14157b7 (base 13) in base 16? -60efdc What is 1630230 (base 7) in base 5? 24211223 -39796 (base 13) to base 4 -122010022 What is 8b475 (base 13) in base 11? 163449 What is -15124652 (base 7) in base 6? -50431552 Convert 3045883 (base 10) to base 5. 1234432013 Convert 9e88 (base 16) to base 10. 40584 Convert -10224433 (base 5) to base 12. -41aab 1214433010 (base 6) to base 12 4802766 What is -50469 (base 13) in base 4? -203003100 -121063256 (base 7) to base 16 -732116 27182 (base 15) to base 13 44cc6 What is -551222 (base 6) in base 2? -1011001001011110 What is 101100000101100111000110 (base 2) in base 7? 200143543 Convert -177353 (base 12) to base 3. -202122201100 What is -228411c (base 13) in base 5? -10210234144 What is 1043221213 (base 5) in base 8? 10663467 Convert 2124512 (base 6	{ "pile_set_name": "DM Mathematics" }
Calculate -3v(h) - 2y(h). -2h2 - 3 Let r(q) = -7q + 19. Let x(w) = w. Determine r(k) + 5x(k). -2k + 19 Suppose -39o + 24 = -288. Let f(b) = b. Let n(z) = 5z. Let i(k) = 11f(k) - 2n(k). Let d(a) = 3a + 1. What is oi(p) - 3d(p)? -p - 3 Let j(r) = -r2 - 3r + 3. Let m(o) be the second derivative of o*4/4 + 13o*3/6 - 13o*2/2 + 10o + 2. What is 26j(u) + 6m(u)? -8u2 Let p(k) be the second derivative of -17k*5/20 + 17k*4/3 - 34k*3/3 + 386k. Let z(s) = s*2 - s. What is -p(r) + 68z(r)? 17r3 Let w(q) = -1. Let k(z) be the first derivative of -z2 - 90. What is k(x) - w(x)? -2x + 1 Suppose -3x + 5d - 22 = 0, 2x - 5x + 18 = 3d. Suppose 0 = -g - x. Let k(n) = -n2 - n - 1. Let p(v) = v + 2. Determine gp(o) - k(o). o*2 - 1 Let s(p) = 3359p - 6716p + 3358p + 4. Let h(g) = -1 + 3 - 3. Give -3h(j) - s(j). -j - 1 Suppose 3v - 9 = -k - 4, 2k - 9 = -5v. Let w be (-4)/(-14) + 416/112. Let z(c) = -3 - w + 5 + 1. Let d(y) = 2y - 2. Calculate kz(b) - d(b). -2b Let q(s) = -2s*2 + 7s. Let k(h) = 2h3 + 5h*2 - 21h. What is 4k(m) + 11q(m)? 8m3 - 2m*2 - 7m Let c = 37 - 26. Let s be ((-14)/(-6))/(c/(-33)). Suppose 5f = -0f - 20. Let l(x) = 6x2 + 4x - 4. Let w(y) = -11y2 - 7y + 7. Give fw(r) + sl(r). 2r2 Let p be (-6 - (2 - -1)) + -2. Let v(b) = 2 - 4 + 1. Suppose 2d = -0d - 4. Let h(y) = y + 5. Determine dh(c) + pv(c). -2c + 1 Let w(v) = -4v + 5. Let k(x) = x. Let o(y) = -6k(y) - w(y). Let s(a) = a + 3. Give -4o(i) - 7s(i). i - 1 Let m(i) = 290i + 6. Let y(r) = -1454r - 32. Calculate 11m(t) + 2y(t). 282t + 2 Let w(a) be the second derivative of 7a4/12 - a3/3 + a*2/2 - 37a - 2. Let c(z) = -6z2 + 2z - 1. What is 4c(q) + 3w(q)? -3q2 + 2q - 1 Let k(s) = -11s + 8. Let d(p) = 7p - 15. Let r(c) = -5c + 11. Let f(l) = 3d(l) + 4r(l). What is 24f(m) + 3k(m)? -9m Let w(d) = -13d - 2. Let q(a) = -67a - 9. Give -2q(f) + 11w(f). -9f - 4 Let p(o) = -o. Suppose -3 = 3c + 3m, -2c - m = -1 + 3. Let d(b) = b + 2. Let w be 1 + -8 + (0 - -1). Let f be 6/4(-4)/w. What is cp(j) + fd(j)? 2j + 2 Let k(j) = j + 5. Let y(d) = 1. Let o(g) = -2k(g) + 5y(g). Let w(b) = b + 4. What is -6o(u) - 7w(u)? 5u + 2 Let j(f) = -2f*3 + 7f*2 - f. Let w(z) = 48z*3 - 13z*2 + 3z. Let p(i) = -3j(i) - w(i). Let r(b) = -14b*3 - 3b*2. What is 3p(v) - 8r(v)? -14v*3 Let b(o) = 5o - 7. Let g(d) = -3d + 52 - 25 - 23. Suppose 3 = 2l + 5w, 4w - 4 - 8 = 0. Calculate lb(k) - 11g(k). 3k - 2 Let o(n) = -26. Let f(w) = -w + 52. Determine -4f(z) - 7o(z). 4z - 26 Let s(r) = 5r - 11. Let x(f) = 3f - 10. What is -2s(q) + 3x(q)? -q - 8 Let r(u) = -3u - 6. Suppose -2q - 63 = -87. Suppose 0 = 69p - 72p + q. Let y(j) = -2j - 5. Calculate py(o) - 3r(o). o - 2 Let y(r) = 7r*3 - 4r*2 - 4r. Let s(a) = a*2 + 11a - 156. Let k be s(-19). Let g(v) = -7v3 + 5v*2 + 5v. Give kg(w) - 5y(w). -7w3 Let v(a) be the second derivative of a3/6 - 2a. Let j(c) = 0c - 3c - 3c + 4c. Let m(f) = j(f) + 3v(f). Let n(t) = -2t - 1. Give 3m(u) + n(u). u - 1 Let h(q) = 0 - 4 - 4q - 3. Suppose -4v + 5l = -12, -303v = -307v - 4l + 12. Let c(o) = 2o + 4. Determine vh(s) + 5c(s). -2s - 1 Let m(f) = 5f*2 - 14f - 2. Let q(p) = 2p2 - p + 1. Calculate m(g) - 2q(g). g*2 - 12g - 4 Let t(g) = -6g3 - 8g*2 - 8g + 3. Let i(l) = 4l3 + 7l*2 + 6l - 2. What is 4i(w) + 3t(w)? -2w3 + 4w*2 + 1 Let o(w) be the first derivative of 33w*4/2 - 9w*3 - 27w*2/2 + 27w - 66. Let l(b) = 5b3 - 2b*2 - 2b + 2. What is 27l(z) - 2o(z)? 3z3 Let z(q) = -4q*2 + 3q - 13. Let r(f) = -f*2 + f - 4. Let t = 400 + -407. Give tr(c) + 2z(c). -c2 - c + 2 Let x(d) = 10d*3 + 4d*2 + 3d + 15. Let l(u) = -21u3 - 9u*2 - 7u - 32. What is -6l(v) - 13x(v)? -4v3 + 2v*2 + 3v - 3 Let o(a) = -4a3 - 29a*2 - 2a + 4. Let g(h) = -9h3 - 58h*2 - 5h + 9. Give -2g(l) + 5o(l). -2l3 - 29l2 + 2 Let h(y) = y2 + 2y - 1. Let k(b) = 1187b*2 - 8b + 4. What is -4h(i) - k(i)? -1191i*2 Let o(n) = -4n*2 + 2n + 2. Let v = -625 - -643. Let u(p) be the first derivative of 17p3/3 - 9p*2/2 - 9p + 3. Determine vo(i) + 4u(i). -4i2 Let a(f) = -2f*3 - 6f*2 + 2f. Let w be 6/5 + (-32)/(-40). Suppose wu + 0u = -8. Let p(t) = 2t3 + 5t*2 - 2t. Calculate ua(o) - 5p(o). -2o3 - o2 + 2o Let f = 15 + -12. Let d(n) = -n*2 - 2n - 2. Let q(t) be the first derivative of t - 31. What is fq(l) + d(l)? -l2 - 2l + 1 Let o(d) = -37d3 - 2d. Let n(i) = 19i3 + i. Give 7n(r) + 3o(r). 22r*3 + r Let p(l) = -14l*3 - 131l*2 + 17l. Let b(y) = -5y3 - 44y*2 + 6y. Determine 17b(k) - 6p(k). -k*3 + 38k2 Let a(z) = z2 - z - 1. Let b(o) = -15o2 + 8o + 13. Let f(l) = -13l2 + 8l + 12. Let j(g) = -4b(g) + 5f(g). What is -6a(q) - j(q)? -q2 - 2q - 2 Let z(k) = 31k2 + 43k - 52. Let b(m) = 11m2 + 15m - 18. Let a(i) = -17b(i) + 6z(i). Let d(p) = p - 1. Determine 2a(q) - 14d(q). -2q2 - 8q + 2 Let d(z) = 6z2 + 18. Let n(k) = -1. What is -d(i) - 6n(i)? -6i2 - 12 Let k be (-4)/1052. Let y(d) = -3 - 115d + 82d - 2. Let u(a) = -11a - 2. Let c(x) = 17u(x) - 6y(x). Let i(f) = -6f + 2. Determine kc(l) - 7i(l). -2l + 2 Let y(l) = -l*3 + 5l + 2. Let m(k) = -84k3 + 4k + 10 - 5k - 8 + 83k*3 + 5k. What is 6m(d) - 5y(d)? -d3 - d + 2 Let n(p) = p + 1. Let z(a) = -a3 + 7a2 - 6a - 2. Let b be z(6). Let x = b - -1. Let y(i) = 3i2 - 2i*2 + 6 + 4i - 2 + 0i. Give xy(d) + 4n(d). -d2 Let m(v) = -218v*3 - 19v*2 + 10v - 13. Let h(b) = 145b3 + 14b*2 - 7b + 9. Determine -7h(f) - 5m(f). 75f3 - 3f*2 - f + 2 Let w(s) = -2s*2 + s + 2. Let y(f) = -1 - 11f*2 - 18f*2 + 25f*2 + 4 + 2f. Determine -7w(u) + 4y(u). -2u2 + u - 2 Let x(t) = -6t*2 - 3t - 2. Let r(m) = 12m2 + 7m + 5. What is 2r(s) + 5x(s)? -6s2 - s Let c(u) = -3u - 7 - 2u + u. Let i(d) = 7d + 2d + 0 - 8d + 2. Let v(q) = 6q2 - q. Let t be v(-1). Determine ti(a) + 2c(a). -a Let o(v) = 52v*2 + 63v - 21. Let m(c) = -15c2 - 19c + 7. Let j(l) = 7m(l) + 2o(l). Let q(t) = -3t + 5t + 1 - 3t. What is 2j(y) - 14q(y)? -2y*2 Let b(m) = -5m*2 + 4m + 1. Let k(p) = -5p2 + 3p + 1. Calculate 4b(a) - 5k(a). 5a2 + a - 1 Let q(z) = -5z - 2. Let l = -5 - -3. Let u be 8 - 3 - (2 + l). Let r(c) = -4c - 4 + 9 - 2 - 5. Give uq(f) - 6r(f). -f + 2 Let f(u) = -9u*2 + 5u + 28. Let w(t) = -t*2 + t + 4. Let n(o) = -f(o) + 7w(o). Suppose 2m = -17 + 7. Let j(r) = -3r*2 - 4r. Give mn(l) - 3j(l). -l*2 + 2l Suppose -2l = 4 - 10. Let q(h) = l + h + 1 - 3h - 3. Let j(z) = -z. What is -3j(w) + q(w)? w + 1 Let d(m) = -m2 + 4m + 3. Let k(s) = -s*2 + 5s + 4. Suppose -x - 4x + 8 = -2i, 0 = x - 5i - 20. Suppose -2c - 2c + 20 = x. Calculate cd(z) - 4k(z). -z2 - 1 Let w(j) = -39j*3 + 117j2 + 117. Let h(b) = -b3 - b*2 - 1. Calculate -117h(f) - w(f). 156f3 Let m(v) = v. Let i(d) = -7d - 15. Let t(o) = 77o + 168. Let f(p) = 56i(p) + 5t(p). Determine f(l) + 2m(l). -5l Let r(q) be the first derivative of -4q3/3 + q2 + 7q - 91. Let a(z) = 2z*2 - z - 4. Let f = 4 + -7. What is fr(l) - 5a(l)? 2l*2 - l - 1 Let a(z) = 2z - 3. Let r be (-2 - -36)2/(-4). Let j = 13 + r. Let m(v) = -2v + 4. Determine ja(p) - 3m(p). -2p Let f(u) = -5u*3 + 4u*2 - 6u + 11. Let b(y) = y3 - y2 + y - 1. Give -4b(k) - f(k). k3 + 2k - 7 Let q(f) = 21f2 - 27f - 1. Let v(m) = 8m2 - 13m - 1. What is 3q(d) - 7v(d)? 7d2 + 10d + 4 Let w = -41 + 22. Let n = w + 14. Let q(b) = 4b - 1. Let v(y) = -6y + 2. Determine nv(h) - 8q(h). -2h - 2 Let d(y) = -17y*2 + 5y - 134. Let m(r) = 11r2 - 3r + 88. Determine -5d(o) - 8m(o). -3o2 - o - 34 Suppose 0 = 6r - r + 15. Let w(o) = 2o + 2. Let j(n) be the third derivative of n4/6 + n3/2 - 29n*2. Calculate rj(h) + 5w(h). -2h + 1 Let j(h) = 22h3 + 5h*2 - 8h + 2. Let v(w) = -11w3 - 2w*2 + 4w - 1. Calculate 2j(f) + 5v(f). -11f3 + 4f - 1 Let s(w) be the first derivative of -5w3/3 + 2w*2 + 6w + 13. Let j(t) = -5 + 1 + 14t - 6t**2 + 11 -	{ "pile_set_name": "DM Mathematics" }
t = 2.05 + -0.05. Put t, -0.4, -1/5 in decreasing order. t, -1/5, -0.4 Let k(m) = m + 3. Let w be k(-3). Let g(u) = u3 + u2 - 6. Let h be g(0). Let x = -4 - h. Sort -2, x, w in descending order. x, w, -2 Let q = 4 - 4.34. Let d = -1.94 - -2. Let t = d - q. Sort t, -1/2, 1 in decreasing order. 1, t, -1/2 Let b be (-10 + 11)/(1/(-2)). Sort 1, -5, b in decreasing order. 1, b, -5 Let h = 18 + -17. Let v = 5 - 10. Sort 5, h, v in descending order. 5, h, v Let i = -6.1 + 5.6. Sort 2/9, i, 0.1, -1/3 in increasing order. i, -1/3, 0.1, 2/9 Let h = -7 - -2. Let y = 0 - 2. Put y, h, 0 in descending order. 0, y, h Let b = -36 + 25. Let y = b - -7. Let r = 14.1 + -14. Put r, y, 2/9 in descending order. 2/9, r, y Let p = -8 - -8.8. Let z = p + 0.2. Let o = -10 - -7. Sort -0.3, z, o. o, -0.3, z Let r = 1.33 + -0.33. Put r, -4, 2/17 in decreasing order. r, 2/17, -4 Suppose -2b = -2y - 14, y + 5b - 16 = 1. Sort 0.02, y, 1/6 in decreasing order. 1/6, 0.02, y Let s be 3/(-30)10/4. Let r = -3.4 - -4. Let u = -1 + r. Put 0, s, u in increasing order. u, s, 0 Let g(c) = -2c3 + 2c + 1. Let t be g(-2). Sort 2, t, -4, -2 in decreasing order. t, 2, -2, -4 Let u = -355 - -6037/17. Sort -0.06, u, 3/4, 4. -0.06, u, 3/4, 4 Let v = -7 + 9. Let l(t) = -1. Let f(b) = -b - 2. Let q(c) = -3f(c) + 8l(c). Let g be q(v). Sort -3, 2, g in increasing order. -3, 2, g Suppose 3c + 19 = 13. Put 3, 13, c, -5 in ascending order. -5, c, 3, 13 Suppose -d = 2 + 2. Sort 2, 0, d, 7. d, 0, 2, 7 Let m = 15 - 43/3. Put 4, m, 0.4 in descending order. 4, m, 0.4 Suppose -3a + 1 = 10. Let h(p) = -p*3 + 5p*2 + 6p + 1. Let n be h(6). Suppose -1 = 2c - 3j, 2c - 5c = -5j + n. Sort -1, a, c in ascending order. a, c, -1 Let x = 3 + -11. Let g = x + 7.7. Let k = g + 0.4. Put k, 2/13, 0.4 in decreasing order. 0.4, 2/13, k Let i = 4.22 + -0.22. Sort -1, i, -2 in ascending order. -2, -1, i Let m = 0.069 - 33.069. Let d = -40.4 - m. Let p = d - -7. Sort p, 3, 0 in increasing order. p, 0, 3 Let y = -11/24 + 1/8. Put -1/7, y, 0 in descending order. 0, -1/7, y Suppose -14 = -3b + 4a, -4b + 7 = 2a - 5a. Let z = 2 + b. Sort z, -3, -4 in decreasing order. z, -3, -4 Let v = -2 - -1. Let j = -2 - v. Let s be 14/18 - (0 + 1). Put j, s, 0.3 in descending order. 0.3, s, j Suppose 5r - 4h - 93 = 0, 0 = 4r + 3h - 6h - 75. Sort -3, r, 1 in increasing order. -3, 1, r Let h be (-4)/(-14) - (-4)/(-14). Sort 1, h, 4 in increasing order. h, 1, 4 Let t = -0.21 + 0.13. Let j = t - 0.02. Put -4/9, 1/3, j in increasing order. -4/9, j, 1/3 Suppose 0 = -2h + 3w + 10, 4w - 8 = 2w. Sort -2, h, 2, 0 in ascending order. -2, 0, 2, h Let g be 1((-5)/(-2) + 24/16). Put -8, g, -1, 1 in ascending order. -8, -1, 1, g Let s = -27 + 19. Let c = 7.6 + s. Sort -1/7, c, 1 in decreasing order. 1, -1/7, c Suppose 8 - 1 = -3l - z, 5l + 3z + 13 = 0. Sort 5, 3, l in decreasing order. 5, 3, l Suppose -5k - 65 = 3i, 3i - 2k + k + 95 = 0. Let b be 2/(-7) - i/56. Sort -3, b, 2 in decreasing order. 2, b, -3 Let y = 300 + -298. Let w be (1/(-2)0)/1. Sort y, w, -14 in descending order. y, w, -14 Suppose 17 = 3x + 5. Suppose 0 = 3i - 12, -k + i = -3k + x. Put -2, k, 3 in descending order. 3, k, -2 Let b = 25370/329 + -435/47. Let m(x) = -x2 - 17x - 4. Let a be m(-8). Let j = a - b. Sort 4, 0.3, j in decreasing order. 4, 0.3, j Let f be 27/6 + (-2)/4. Let l be ((-2)/(-6))/(1/(-3)). Let q be -2(l - 6/(-4)). Put q, 1, f in increasing order. q, 1, f Let h(r) = 4r3 + r2 - 2r + 1. Let u be h(1). Let n be 0 - (-4)/41. Let t = 1 + n. Sort t, u, -2. -2, t, u Let k be (-3)/(((-18)/(-8))/(-3)). Suppose 3 - 5 = 2h. Suppose -3x + 6 = -w + 15, 0 = -4w + 2x - 4. Sort k, h, w in descending order. k, h, w Let c = -9 - -13. Suppose 0 = 3y - 2y + c. Let f = 9 + y. Sort -3, f, -1 in descending order. f, -1, -3 Let w(c) = -c*2 - 11c. Let r be w(-11). Suppose 25 = -0s + 5s - 3l, -4s + l + 13 = r. Let j = -7 + 5. Put 3, j, s in increasing order. j, s, 3 Let y(l) = -2l2 - 27l - 10. Let m be y(-13). Sort m, 0, -1, -3/7 in decreasing order. m, 0, -3/7, -1 Let k(t) = -t*3 + 11t*2 - 11t + 8. Let c be k(10). Let i = -3 + 6. Suppose u + 2 = iu. Sort u, c, 0 in descending order. u, 0, c Let u = 5 - 2. Suppose 0 = 4l + j - 45, 0l - 3j - 15 = -ul. Suppose 0 = -v + 5y - 11, 0 = -2y + 7y - l. Put -3, v, 2 in ascending order. -3, v, 2 Suppose 0 = 7p + 39 - 4. Sort p, -2, 0, 2 in ascending order. p, -2, 0, 2 Let r(z) = z2 + 18z. Let y be r(-18). Sort -3/2, y, -2/5 in decreasing order. y, -2/5, -3/2 Let h = 0.96 + -2.96. Let s = 0.1 - 0.3. Sort s, h, 1/2 in decreasing order. 1/2, s, h Let o = -5 + 4.97. Let n = -4.97 + o. Let l = -3.1 - -3. Sort l, -2, n in increasing order. n, -2, l Let y be (-26)/(-8) + 1/(-4). Let m(g) = -26g - 106. Let b be m(-4). Suppose 4a = 7 + 13. Sort a, y, b in descending order. a, y, b Let z = -1 + 1. Suppose d = -3y + 8, 5y + 2d - 7 - 7 = 0. Suppose 2n - y = 8. Sort -3, z, n in descending order. n, z, -3 Let v = -5 + 5.4. Put -0.2, v, -24 in descending order. v, -0.2, -24 Let w be 227/6 + -4. Sort w, -4, -12, -0.5 in decreasing order. w, -0.5, -4, -12 Suppose 48 = 4n - 4d, -5d = n - 12 - 6. Sort 2, 4, n. 2, 4, n Let f = 10 + -6. Put f, -5, 5 in descending order. 5, f, -5 Let z be (-4)/(-9)(-9 - 6). Let q = z - -13/2. Sort 0.5, q, -1/7 in decreasing order. 0.5, -1/7, q Let z(u) = -u2 - 11u - 16. Let h be z(-5). Put -1/3, 3, h in decreasing order. h, 3, -1/3 Let z = -82.7 - -83. Sort -3, 4, 0, z in decreasing order. 4, z, 0, -3 Let i = 46 - 46. Let k = -0.07 + 0.01. Put k, i, 1 in decreasing order. 1, i, k Let g(j) = -j*2 - 7j + 10. Let d be g(-9). Let i = d - -8. Sort -4, i, 2. -4, i, 2 Let l(m) = m*3 - 7m2 - m + 4. Let y be l(7). Let p(c) = -c2 - 2c. Let g be p(y). Let d = 2 + -1. Put 5, d, g in decreasing order. 5, d, g Let z = 9 - 4. Sort z, -3, -2. -3, -2, z Let h(u) = u - 2. Let g be h(5). Suppose gv - 8v = 5. Let m be 0/2v - -5. Put -4, -3, m in descending order. m, -3, -4 Let r = 0.4 - -0.3. Let v = r + -0.5. Sort v, 4, -2 in ascending order. -2, v, 4 Suppose -x = 2x + 15. Put 4, x, -2 in increasing order. x, -2, 4 Let k be 2/5 + 34/(-10). Sort 1, -1, 2, k in descending order. 2, 1, -1, k Let h be 24/(-7) - (-3)/7. Sort -2, -5, h in descending order. -2, h, -5 Suppose -3o + 3 + 9 = 0. Let z = o + -9. Sort z, 0.3, -0.03 in ascending order. z, -0.03, 0.3 Let p = 42 + -42. Put 10, p, -1 in decreasing order. 10, p, -1 Let k = -105.7 - -106. Sort 0, k, 0.2, -7 in descending order. k, 0.2, 0, -7 Suppose -2p + 2g = -130, 5p = -2g + 31 + 259. Let i be (-65)/p + 2/6. Put 2/11, 5, i in descending order. 5, 2/11, i Let d = -71.6 + 72. Sort 2/17, d, 7, -2 in descending order. 7, d, 2/17, -2 Let r be (-7 - -1)3/6. Let a = r + 1. Sort -1, a, 1 in ascending order. a, -1, 1 Let i = -3 - -1. Sort i, 5, 3. i, 3, 5 Let a(w) = -w2 - 1. Let h(r) = -r2 + r + 3. Let p(x) = -2a(x) - h(x). Let s be p(-1). Suppose sq + 2q = 25. Sort 4, q, -3 in descending order. q, 4, -3 Let k = -102 + 716/7. Suppose 4 = 5u - 6. Sort k, u, 1/5 in decreasing order. u, k, 1/5 Let s = -0.54 - -0.04. Let b = -0.6 - -1. Let h = b - 0.3. Put s, h, -2/7 in descending order. h, -2/7, s Suppose 0 = -5y - 5w + 4w - 12, 3w = 2y + 15. Let s = 5 + -7. Sort s, y, 2 in ascending order. y, s, 2 Let g = -5.8 - -0.8. Let a = g + 4. Put -2/3, -6/11, a in descending order. -6/11, -2/3, a Let h = 0.18 + -0.48. Let i = 0.2 - 0.3. Put h, i, 0.2 in descending order. 0.2, i, h Let i be 2 + (-2)/(-2) + 1. Suppose -ia - 2 = -6a. Sort a, 2, 3. a, 2, 3 Let t be (7832/48)/((-21)/6). Let q = -12413/3 - -4184. Let v = t + q. Put 0, v, 5 in decreasing order. 5, 0, v Let z = -1.02 - -1. Let l = 0.28 - z. Let v be ((-12)/(-10))/((-9)/(-30)). Put -0.2, l, v in descending order. v, l, -0.2 Let v(a) = a + 6. Let k be v(-5). Suppose -w = -k + 5. Sort -3, 3, w. w, -3, 3 Let f = -3 + 7. Suppose -x = x - f. Sort x, -2, -5 in ascending order. -5, -2, x Let l(f) = -2f + 14. Let x be l(6). Suppose 0 = xz - z - 3d + 10, 4d - 6 = 5z. Put 1/3, z, 3/5 in descending order. z, 3/5, 1/3 Let k be 6/(-4)(-72)/27. Put 3, k, 0.2 in decreasing order. k, 3, 0.2 Suppose 19 = -3*o + 4. Sort 0, 1, o, -4 in descending	{ "pile_set_name": "DM Mathematics" }
3 - 4w4 + 16w3 + 28 - w3 to n + pw3 + dw + zw4 + jw*2 and give p. 1 Rearrange (-28u*3 + 151u*2 - 151u*2)(1 - 3 - 2) to the form fu + vu*2 + s + ru*3 and give r. 112 Rearrange 30 + 118b - 408b - 30 - 1010b to o + zb and give z. -1300 Rearrange -2 + 10d + 15d - 131d to the form s + id and give s. -2 Express (-32 - 17 - 14)(-5k2 - 5k2 - k2) + 3k2 + 3k*2 - 7k*2 as hk + vk2 + r and give v. 692 Rearrange -4s + 3s + 2s + (4 - 4 + 2)(-3s + s + 3s) + (3 - 4 + 3)(13s + 15s - 19s) to m + bs and give b. 21 Express -35 + 7 + 2a + 29 - 14a*3 - 2a*2 + 2a*4 in the form l + wa + qa3 + ca*2 + ya*4 and give q. -14 Express (-5o + 3o + 0o)(0o*3 - 3o3 + o3) - 2o4 - o4 + o4 + 76o*4 + 5o*4 + 27o*4 as fo*2 + bo + uo3 + x + po*4 and give p. 110 Rearrange 8 - 37l*2 - 17l*2 + 21l*2 + 1 - l - 4 to wl + n + il2 and give n. 5 Express (3 + 6 - 2)(-5 + 5 + 3)(-3j + 2j + 3j) + 2 - 2j - 2 as t + uj and give u. 40 Rearrange (-4 + 4 + 3s)(14 - 8 + 15) + 28 - 28 + 3s to os + n and give o. 66 Express (3 - 3 - 2)(-t + 5t - 3t) + 191t + 410t + 123t as gt + j and give g. 722 Express (-12n*2 + 193n*2 - 36n*2)(-3 + 2 + 3)(-n + 3 - 3) in the form h + wn + gn2 + xn*3 and give x. -290 Rearrange 3k - 2 + 2 + (-193k - 116k + 20k)(3 - 5 + 1) - 2k + 0k + k to pk + t and give p. 291 Express (-2d + 2d + 3d*2)(271 - 271 + 21d) + (3d + d - 5d)(d*2 + 3d*2 - 6d*2) in the form ud*3 + i + pd + sd2 and give u. 65 Rearrange 1377 - 1499i*2 - 537 + 1498i*2 to oi + di2 + w and give d. -1 Rearrange (-5 - 1 + 4)(-5h2 + 19h*2 + 7h2) - h2 - 9h + 3h - 11h to dh + f + vh2 and give v. -43 Rearrange 7g*2 + 9g*3 + 4g*3 + 3g*3 - 3g - 21g3 to fg*3 + cg + d + hg2 and give f. -5 Rearrange (2 + 3 - 4)((2 + 1 - 1)(1 - b - 1) - 4b - 2b + 4b + 229b - 227 + 227) to the form u + ob and give o. 225 Express (-o + 2o - 3o)(-9o - o - 10o) - 2o*2 - o - 2 + 2o*2 + 3o*2 as ho + l + so2 and give h. -1 Express -168p + 5 - 170p + 333p as jp + w and give w. 5 Express (2 + 1 - 5)(-233a - 6a*4 + 233a - 3) as ta4 + ha*3 + sa + x + oa2 and give x. 6 Express 2047j - 106 + j*2 - 2j*2 - 2047j in the form cj + hj*2 + m and give c. 0 Express -38u*2 + 79u*2 - 51u*2 - 75u + (3u + 2u - 7u)(-1 + 1 - 2u) in the form bu*2 + o + zu and give z. -75 Express (83t + 18t - 10t)(2 - 4 - 1) in the form w + at and give a. -273 Rearrange 2i*2 + 3i*3 - 4 + i + 75i*4 + 77i*4 - 2i*3 - 154i*4 to f + pi + xi2 + ti*3 + vi4 and give p. 1 Rearrange -4 + 4 + o2 + (-427 + 427 - 18o2)(3 + 0 + 0) to the form mo + i + ho*2 and give h. -53 Rearrange (173j - 383j - 283j)(-2 - 1 + 1)(2 - 2 - 2)(-4 - 1 + 3) to yj + o and give y. 3944 Express -321i - 737i - 583i - 339i + 274i as v + gi and give g. -1706 Express 5 - 5 + 8v + (-3 - v + 3)(0 - 1 + 3) + 2v - 3v - v + 0v + v - 2v as jv + d and give j. 3 Rearrange 226y*4 - 228y*4 - 2y + 19y - 12y*2 to the form xy*3 + wy*4 + py*2 + ty + n and give x. 0 Rearrange ((0w - w + 3w)(-170w*2 + 321w*2 - 207w*2) - 2w3 - w3 + w*3)(3w - w + 0w) to the form sw4 + aw*3 + tw*2 + jw + f and give j. 0 Rearrange (0 + 0 - 2n + n - 4n + 5n + (-5 + 3 + 3)(n - 2 + 2) + 2n - 4n + 3n - 4n + 2n + n)(-8n + 15n - 22n) to pn*2 + on + s and give p. -15 Express 14c - 53c*3 + 51c3 + c2 - 1 - 3c2 - c4 as qc*2 + x + mc*3 + tc*4 + zc and give z. 14 Rearrange 3b - 4b + 6b + (-5b + 3b + 0b)(2 - 3 - 1) - 2b + 0b + 4b - 1 + 0 - 10b + 7b to the form gb + z and give z. -1 Express (9u - 8u - 59u)(-1 - 1 - 1) - 2u + 4u + 0u as o + fu and give f. 176 Rearrange 49 - 17 - x3 - 17 + x4 - 11 + 5x*2 to the form qx*3 + y + jx*4 + ox*2 + sx and give y. 4 Express 25u2 - 63u*2 - 59u*2 - 38u*2 as p + iu + bu2 and give i. 0 Rearrange 5 - 5 - 2a + (-3 + 1 + 0)(a + 0 + 0) - a + 4 - 4 - 4a - 2a + 5a + (-3 - 2 + 7)(12a + 22a - 53a) to na + u and give u. 0 Express 2 + 22d*3 - 2d - 3 + 7d3 + 2d*3 + 4d*3 in the form rd + bd3 + i + wd*2 and give b. 35 Express ((2u + 2 - 2)(4u + 0u - 2u) - 21u2 + 28 - 28 + (3 - 3 - 1)(3u2 + 2u*2 - 6u*2))(12 - 8 - 7) in the form au + ou*2 + b and give o. 48 Rearrange 3h*3 - 5h*3 + 5h*3 + (-4 + 4 - 1)(2h3 - h3 - 3h*3) - 35h*3 - 49h*3 + 18h*3 to the form fh*3 + nh*2 + i + wh and give n. 0 Express (-19j + 58j - 25j)(40 - 20 + 61) as r + zj and give z. 1134 Express 6z + 0z - 7z*2 - 5z + z - 2z3 - 3 as uz*2 + vz*3 + az + n and give n. -3 Rearrange -2b4 + b4 + 3b*4 + (2 - 3 - 2)(-40b4 - 87b*4 - 79b*4) to the form vb + nb2 + ob*4 + m + cb*3 and give o. 620 Rearrange 455m + 13479 - 13479 to the form cm + b and give c. 455 Rearrange -58v + 8v - 132v*4 - 2 - 134v*4 + 261v*4 to the form zv*3 + kv*4 + l + pv + bv2 and give l. -2 Rearrange -6m*2 - 24m*2 - 4m*2 + (m - 2 + 2)(-m + 3m + m) to the form im*2 + pm + k and give i. -31 Express -k4 - k3 + 4k2 + 5k*3 + 12810 - 12813 as vk*2 + dk*4 + z + rk + jk3 and give j. 4 Rearrange c2 - c2 - 6c + 7c - 17 - 2c*2 - 10 to the form lc + sc2 + u and give s. -2 Express 2 - 9k*2 + 0k - 3k + 4k + 13k2 - 2k - 8k3 in the form sk*2 + ik + xk3 + h and give s. 4 Express (133y - 2y - 13y)(9 + 10 - 13) as s + vy and give v. 708 Express -47 + 4u3 + 3u - 5u3 - u3 + 49 - 19u*2 in the form o + zu*2 + wu*3 + yu and give w. -2 Express 16g + 44751 + 2g*2 - 44751 in the form k + ug*2 + cg and give u. 2 Express -2i3 + 2i*2 + 22i + 415 - 415 in the form wi2 + l + yi*3 + di and give w. 2 Express (b - 3b + 32b)(b2 - 3b - 3b2 + 3b*2) as t + kb + qb3 + rb*2 and give r. -90 Rearrange 145 + 162 - 322 + 4k to sk + j and give s. 4 Express 124z*2 - 609z*2 - 600z*2 + 358z*2 - 556z*2 as j + gz + xz2 and give g. 0 Rearrange -97h*3 + 37h*3 + 7h3 + (h2 + 0h2 + h2)(h - 3h + 3h) to the form yh + i + wh*2 + lh*3 and give l. -51 Rearrange -95g + 95g - 27 + 27 - 222g3 + g2 to pg + xg*3 + wg*2 + l and give x. -222 Express 69l - 13 + 0 + 8 + 9 as fl + r and give f. 69 Rearrange (-11g + g - 8g + 0 + 0 + g + (-2g + 0g + 4g)(-5 - 4 + 5) + g - 4g + 0g)(0g + 0g - g) to the form yg + r + kg*2 and give k. 28 Express 0g*2 + 48g + 2 - 2g2 - 55g + 5g2 in the form pg + n + bg2 and give p. -7 Rearrange (1 - 1 - 2x)(-814x*3 + 289x*3 + 6690x*3) to vx*4 + gx*2 + sx + ux3 + c and give v. -12330 Express (3 - 3y*2 - 3)(-17y + 49 - 49) - 3y*3 + 2y*3 - 3y*3 in the form jy + ay2 + d + ky*3 and give d. 0 Rearrange (-4n + 0n + 3n)(-49 + 10 + 2)(-7 - 3 - 3) to the form a + dn and give d. -481 Rearrange 51z - 99z + 335z to the form p + vz and give v. 287 Express -7 - 24 - 2a + 8 in the form pa + c and give p. -2 Rearrange (1 - 3 + 3)(2j - j + 0j) - 2089j - 7 + 4163j - 2093j to the form m + bj and give m. -7 Express 1205t + 234t*3 - 1203t + t*3 in the form v + ht + bt3 + nt*2 and give h. 2 Rearrange 21i*3 - 5 - 2i - i*2 - 17i*3 - 3 + 3 to the form d + pi*3 + oi + hi2 and give p. 4 Rearrange (-1 + 0 + 0 + 2x)((2 - 2 + 1)(-1 + 2 + 1) - 163 - 132 + 51 + 3 - 2 - 3 + (-6 + 2 + 3)(-4 + 5 - 3)) to f + hx and give f. 242 Express (x - 2x + 0x)(-611x - 154x + 68x) + (-3x - 4 + 4)(0x + 0x + x) in the form z + mx2 + gx and give m. 694 Rearrange ((3 - 3 - 2)(3 + 0 - 1) + 1 + 1 + 0)(87p - 43p + 77p) to the form m + rp and give r. -242 Express -3h2 - 3h - 3h2 + 203847h*4 - 203849h*4 as nh*2 + ih*3 + vh*4 + qh + b and give n. -6 Express (-3 + 3 - 1)(0a + 0a + a)(1086a3 + 472 - 472) in the form fa + v + ua4 + da*2 + ga*3 and give g. 0 Express 28 + 17 - 3m*2 - 23 as im*2 + ym + h and give y. 0 Express (791n2 - 1857 + 1857)(0 + 3 - 5)(-2n + 4 + n - 3 + (-3 + 4 + 0)(-1 + 1 - n)) as xn*3 + sn +	{ "pile_set_name": "DM Mathematics" }
Let v(d) = 2d + 10. Give v(7). 24 Let a(z) = 12z*2 + z - 2. Give a(-2). 44 Let r(y) = 24y*2 + y + 1. Calculate r(1). 26 Let j(y) = -50y + 102. Determine j(2). 2 Let a(w) = w*2 + 6w - 25. Calculate a(-8). -9 Let t(j) = -j*2 - j - 13. What is t(0)? -13 Let s(r) = 2r*2 - 5r - 4. What is s(3)? -1 Let h(k) = -3k + 82. What is h(28)? -2 Let a(m) = -2m*2 - 13m + 12. Calculate a(-11). -87 Let w(g) = g*2 - 4g - 20. Calculate w(-4). 12 Let g(z) = -60z3 - 5z - 4. Determine g(-1). 61 Let j(i) = -10i2 - 17i + 1. What is j(-2)? -5 Let k(v) = -3v2 + 4. Determine k(1). 1 Let s(y) = 2y*2 - 19y + 36. Determine s(3). -3 Let i(x) = 2x2 - 15x - 18. Calculate i(8). -10 Let g(p) = -p - 3. Calculate g(-6). 3 Let f(u) = 19u2 - 1. Give f(-1). 18 Let w(s) = -s2 + 3s + 24. Give w(-4). -4 Let t(h) = 10h - 121. Give t(13). 9 Let b(t) = -t2 - 9. What is b(0)? -9 Let c(g) = 2g*2 + 5g - 7. Calculate c(2). 11 Let g(a) = -3a - 149. What is g(0)? -149 Let d(q) = 3q*2 + 19q + 22. What is d(-4)? -6 Let w(n) = n*2 + 7n + 7. Calculate w(-6). 1 Let q(w) = -95w2 - 2w + 1. What is q(1)? -96 Let v(k) = -k*2 + 5k - 5. Determine v(4). -1 Let a(y) = 2y + 27. What is a(-19)? -11 Let h(j) = j2 - 11j + 28. Give h(9). 10 Let i(c) = 11c - 3. What is i(-2)? -25 Let a(n) = -4n + 18. What is a(8)? -14 Let i(h) = -3h - 1. Determine i(-3). 8 Let y(c) = -56c + 5. Give y(1). -51 Let b(o) = 66o - 390. What is b(6)? 6 Let w(x) = -x3 + 9x*2 - 2x + 8. Calculate w(9). -10 Let b(g) = g*2 + 10g + 20. Calculate b(-8). 4 Let j(f) = 15f - 313. Give j(20). -13 Let l(o) = 78o*3 + 2o2 - 1. What is l(1)? 79 Let z(u) = u2 + 7u + 10. Calculate z(-2). 0 Let l(c) = -3c - 48. Calculate l(-14). -6 Let h(u) = -u*2 - 5u + 9. Calculate h(-6). 3 Let x(a) = 5a2 + 2a - 3. Calculate x(1). 4 Let u(j) = j*3 - 16j*2 - 16j - 21. Determine u(17). -4 Let r(c) = 3c2 + 5c - 1. Give r(-6). 77 Let t(p) = 5p + 35. Give t(-7). 0 Let f(q) = -2q - 10. Determine f(0). -10 Let c(o) = o*3 + 9o*2 - 3o - 11. Give c(-9). 16 Let j(p) = -p*2 - 14p - 26. Give j(-12). -2 Let x(j) = j*2 - 8. What is x(-3)? 1 Let i(t) = 20t - 2. Determine i(0). -2 Let b(r) = -9r + 43. What is b(4)? 7 Let x(q) = q2 - 31q - 35. Calculate x(32). -3 Let h(g) = -2g3 + g2 + 2g. What is h(2)? -8 Let x(g) = -3g. Give x(3). -9 Let j(f) = -f3 + 29f*2 - 53f - 25. What is j(27)? 2 Let y(j) = -2j2 - 36. What is y(0)? -36 Let l(h) = h3 + 11h*2 + 2h + 11. Give l(-11). -11 Let b(o) = o*3 - 10o*2 + 3o + 10. Determine b(9). -44 Let q(l) = -l*2 - 9l - 11. What is q(-10)? -21 Let l(c) = -c*3 + 14c*2 - 13c - 8. Determine l(13). -8 Let j(l) = l*2 + 16l - 42. Give j(-18). -6 Let v(b) = 59b - 293. Calculate v(5). 2 Let t(k) = -k3 - 8k*2 + 9k - 15. Give t(-9). -15 Let s(z) = -4z - 19. Calculate s(-10). 21 Let g(z) = -2z*2 - 28z + 24. Give g(-15). -6 Let w(y) = 2y3 + 18y*2 - 3y - 5. What is w(-9)? 22 Let a(d) = -3d - 2. Calculate a(-3). 7 Let p(d) = 25d - 7. Calculate p(2). 43 Let v(t) = -t*2 - 5t + 4. Give v(-9). -32 Let o(h) = -5h + 63. Determine o(13). -2 Let g(z) = -z3 + 8z*2 + 9z - 5. Determine g(9). -5 Let a(c) = -3c3 - 6c*2 - 3c - 6. Determine a(-4). 102 Let p(w) = 24w2 - 13w + 1. What is p(2)? 71 Let v(j) = j*3 + 25j*2 - j + 4. Give v(-25). 29 Let t(x) = 6x + 67. Give t(-13). -11 Let x(t) = t*3 + 11t*2 + 12t - 13. What is x(-9)? 41 Let z(n) = n3 + 6. What is z(0)? 6 Let m(r) = -r2 + 13r - 35. Give m(10). -5 Let x(d) = -5d + 29. Give x(5). 4 Let c(u) = -u*3 + 7u*2 - 4u - 5. Give c(7). -33 Let z(s) = -s*2 - 29s - 74. Give z(-3). 4 Let m(s) = -17s3 - s2 + s. What is m(1)? -17 Let i(p) = p - 6. Calculate i(-3). -9 Let h(x) = 14x - 12. Calculate h(5). 58 Let n(s) = -s + 14. What is n(8)? 6 Let c(i) = 2i2 - 6i + 2. Give c(1). -2 Let z(d) = -4d + 3. What is z(2)? -5 Let t(r) = 13r + 28. Determine t(-6). -50 Let x(i) = 4i2 + i. What is x(2)? 18 Let j(f) = f2 - 2f - 4. What is j(8)? 44 Let f(u) = -u*3 - 10u*2 - 15u + 13. What is f(-8)? 5 Let i(c) = -23c - 66. Give i(-3). 3 Let j(h) = h3 - 5h*2 - 6. Give j(5). -6 Let i(y) = -2y*3 - 10y*2 - 6y + 4. Calculate i(-4). -4 Let s(y) = y*3 + 35y*2 + 47y + 432. What is s(-34)? -10 Let x(d) = -3d - 67. Calculate x(-22). -1 Let n(s) = -s3 - 31s*2 - 28s + 59. Calculate n(-30). -1 Let p(d) = d - 8. Calculate p(-9). -17 Let q(p) = p*2 + 53p + 612. Calculate q(-36). 0 Let z(i) = i*3 - 7i*2 - 6i - 2. Calculate z(7). -44 Let b(x) = -x*3 - 8x*2 - 10x - 10. Give b(-7). 11 Let l(u) = -u*3 + 6u*2 + 8u - 15. Determine l(7). -8 Let b(n) = n*3 + 4n*2 - 7n + 1. Give b(-6). -29 Let s(c) = -c3 - c2 - c + 11. Give s(2). -3 Let s(l) = 11l - 27. Determine s(2). -5 Let r(d) = -5d + 4. What is r(-2)? 14 Let t(w) = 8w + 2. Determine t(-9). -70 Let g(m) = -m - 2. Calculate g(3). -5 Let c(a) = 32a - 16. Determine c(-3). -112 Let f(z) = z*2 + 6z - 93. What is f(7)? -2 Let p(q) = -q*2 + 16q - 6. What is p(11)? 49 Let b(k) = k - 11. Determine b(10). -1 Let t(c) = 3c + 14. What is t(6)? 32 Let q(z) = -z3 + 9z*2 - 8z - 10. Give q(8). -10 Let p(c) = -7c2 + 33c - 33. Calculate p(1). -7 Let a(i) = -8i + 55. What is a(9)? -17 Let y(g) = g3 - 16g*2 - 2g + 39. Calculate y(16). 7 Let s(h) = -h - 14. Determine s(0). -14 Let c(z) = z*2 + 14z + 18. Give c(-14). 18 Let d(c) = c*3 + 8c*2 - 2c + 10. Determine d(-8). 26 Let s(k) = 2k2 - 3k - 5. What is s(-2)? 9 Let z(f) = 24f - 5. Determine z(1). 19 Let t(s) = -s2 + 19s - 20. What is t(17)? 14 Let s(x) = -26x + 6. Determine s(2). -46 Let z(m) = -m3 + 15m*2 - 13m - 19. Determine z(14). -5 Let c(f) = 4f + 102. Calculate c(-27). -6 Let s(c) = -3c*3 + 2c2 - 1. Calculate s(-1). 4 Let a(c) = c3 - 2c + 5. Calculate a(-3). -16 Let o(u) = u + 9. Determine o(-7). 2 Let j(y) = y3 - 17y*2 + 18y - 10. What is j(16)? 22 Let m(g) = -108g + 530. Determine m(5). -10 Let f(s) = -2s - 7. Give f(-7). 7 Let w(g) = g*2 - 27g + 104. Determine w(26). 78 Let b(i) = 22i - 3. What is b(2)? 41 Let j(u) = 2u*2 + 3u + 3. Calculate j(-2). 5 Let r(v) = v*3 - 9v*2 - 9v - 3. What is r(10)? 7 Let y(i) = -3i + 1. Give y(1). -2 Let k(u) = -u - 9. Give k(-12). 3 Let m(j) = j3 - 12j*2 + 2j - 3. What is m(12)? 21 Let w(b) = 89b3 - b2 + 1. Give w(1). 89 Let n(d) = -d - 83. Give n(0). -83 Let p(i) = i3 - 9i*2 + 15i + 30. Calculate p(5). 5 Let n(k) = 3k - 8. Give n(5). 7 Let u(m) = -m - 10. Calculate u(0). -10 Let s(r) = 2r*2 + 4r - 5. What is s(-4)? 11 Let q(v) = -177v + 1773. Give q(10). 3 Let b(z) = -2z3 + z2 - 2z. Calculate b(-2). 24 Let m(w) = -w2 - 8w + 32. What is m(3)? -1 Let r(o) = o*2 - 12o + 5. Calculate r(12). 5 Let w(g) = -g*3 + 3g*2 + 11g. Give w(5). 5 Let g(r) = -r*2 + 2r - 1. What is g(0)? -1 Let u(p) = 30p - 10. Calculate u(4). 110 Let l(i) = 2i3 + i2. What is l(0)? 0 Let i(k) = 3k - 27. Give i(8). -3 Let z(n) = n2 - 8n + 18. What is z(9)? 27 Let m(n) = -n*3 + 9n*2 - 7n - 11. Calculate m(7). 38 Let u(y) = -13y - 163. Determine u(-10). -33 Let d(s) = s - 2. What is d(-3)? -5 Let u(m) = m3 + 10m*2 + 12m - 6. Give u(-9). -33 Let b(c) = -c*3 - 9c*2 + 9c - 13. What is b(-10)? -3 Let o(h) = -5h + 24. Determine o(11). -31 Let z(o) = -4o + 9. Calculate z(4). -7 Let r(k) = -k - 16. Calculate r(0). -16 Let h(s) = -5s - 6. Calculate h(-11). 49 Let h(c) = -2c - 3. Determine h(8). -19 Let w(j) = 110j2 - 4j - 4. What is w(-1)? 110 Let n(f) = -2f3 + 23f*2 - 27f - 34. Calculate n(10). -4 Let u(m) = 10m2 - 4m + 5. Determine u(2). 37 Let m(d) = -6d2 - 3d + 2. What is m(1)? -7 Let o(q) = -2q3 - 16q*2 + 3q + 25. What is o(-8)? 1 Let v(u) = u*2 - 8u + 21. What is v(6)? 9 Let g(i) = 7i - 43. What is g(7)? 6 Let y(g) = -5g - 53. Give y(-7). -18 Let b(a) = 8a3 + 5a*2 - 5a - 7. Give b(-2). -41 Let t(w) = -2w + 23. Determine t(0). 23 Let g(i) = 5i*3 - 3i*2 + i - 2. What is g(2)? 28 Let d(i) = 65i + 200. Give d(-3). 5 Let q(m) = -12m - 903. Determine q(-75). -3 Let g(q) = 32q*2 - 2q + 1. Give g(1). 31 Let s(a) = -7a + 1. Determine s(1). -6 Let k(h) = -h*2 -	{ "pile_set_name": "DM Mathematics" }
147 - 5f2 + 0f*2 - 9686f + 9683f in the form l + qf*2 + vf and give v. -3 Express 42 - 23l2 + 23l + 28l2 + 24l + 23l - 81l as k + al2 + jl and give a. 5 Rearrange (4h - h - h)((-2 - 2 + 2)(-3 + 0 + 1) + 334 + 1456 - 3054) to the form yh + c and give y. -2520 Rearrange -444 + 444 + 21754y + 10962y - 175y to i + oy and give i. 0 Rearrange -15l2 + 27836 - 10l - 12l2 - 27836 to r + yl*2 + dl and give y. -27 Rearrange (-4w - 5w + 0w)(0 - 1 + 3) + 0w + w - 6w + (3w - w - 4w)(-4 + 5 - 2) to the form b + cw and give c. -21 Express 6v3 + 0v3 + v3 + (4v - v - 2v)(4v2 - v2 - 5v2) + (12 - 12 - 5v*2)(-9v + 0v - 22v) as nv + p + zv3 + sv*2 and give s. 0 Express (25a*4 + 92a*4 + 22a*4)(-42 + 37 + 114) in the form ua4 + ha*3 + r + xa*2 + pa and give u. 15151 Express -20n + 3 - 9 + 0 + 8 + 15 as x + kn and give k. -20 Express (g*3 - 2g*3 - 2g*3)((2 - 4 + 3)(0 + 1 - 3) + 1084 + 9868 + 8490 - 683 + 1999) in the form z + vg*2 + pg + ig3 and give i. -62268 Rearrange (2198l + 13 - 13 - 2877l)(-l*3 - 3l2 - l2 - l*3) to the form yl*2 + a + hl*3 + ml + cl4 and give h. 2716 Rearrange (3 + i - 3i + 0i)((-4 + 1 - 8)(i + 3i - 6i) + 21i - 4i + 0i + 1 + 3i - 1) to yi*2 + pi + g and give y. -84 Rearrange (-j3 - j3 + 4j3)(-427 + 33j - 32j + 6806) to the form uj3 + f + oj*4 + zj + qj2 and give o. 2 Express 183s - 510s - 1 + 773s + 1116s + 0 in the form ts + l and give l. -1 Rearrange 13x4 - 148x*4 - 9x*4 + (40x - 26x - 16x)(-5x3 - x3 + x*3 - 1) to the form lx*4 + cx + jx2 + u + yx*3 and give l. -134 Express 848 - 3106v - 2567 + 860 + 862 as z + nv and give z. 3 Express -1722o*3 - 1307o*3 - 15690 + 7845 + 7843 in the form f + xo*3 + to*2 + zo and give f. -2 Rearrange -6 + 4 - 2f + 4 + f2 + (5 - 5 + 27f)(468f - 387f - 411f) to bf2 + qf + z and give z. 2 Rearrange -3 + 2229o - 1577o + 3 + 2494o to the form vo + t and give v. 3146 Rearrange -d*4 - 3d*2 + 4d*2 + 2d*3 + d - 4 - 5d + 16d3 to the form ud*4 + nd + rd3 + h + zd*2 and give r. 18 Express -8239n + 23n3 - 8198n + 16389n in the form wn + f + xn3 + kn*2 and give x. 23 Rearrange (-17511j + 13520j + 7974j)(-4 + 3 - 3) to xj + c and give x. -15932 Express (9 + 8 + 4)(1 - 4 + 0)(2031g + 261g + 1857 - 1857) in the form h + cg and give c. -144396 Express -7t*2 + 253031 + 6t2 - t4 - 255579 as wt + m + jt*3 + pt*4 + st*2 and give m. -2548 Express (-162 + 109 + 503)(2 - 2d - 2)(1 - 3 - 1) as i + td and give t. 2700 Express (90w - 41w + 169w)(1 + 4 - 4)(522w2 - 522w*2 + 8w*3 - 3w) in the form c + bw4 + dw + zw2 + jw*3 and give b. 1744 Express -4h2 + 0 - h2 + 51h3 + 1 - 50h*3 + 6h*2 + 60h in the form zh + bh*3 + s + oh*2 and give b. 1 Express (37 - 31 - 65)(3o - 2o + 5o)(38 - 64 + 55) in the form z + bo and give b. -10266 Express -45 - 3 - 23n + 41 + 2 + 3 in the form an + x and give x. -2 Rearrange -3221k*2 - 5k - 2359k2 - 2 + 4k + k to the form f + lk2 + dk and give f. -2 Rearrange (g*2 - 2g2 - g2)(-5g - 3g2 + 5g) + 28202 - 9417 + 8g4 - 9401 - 9440 to ng + q + zg2 + dg*3 + ug*4 and give u. 14 Rearrange 12 - 36 + 1 - 52 - 19 - 31h to wh + x and give w. -31 Rearrange -196l + 8l2 + 48l*2 + 99l + 81l to vl*2 + a + dl and give v. 56 Rearrange -333s3 + 6 + 1041s*3 - 548s*3 - 402s*3 - 3 to hs + ls2 + js*3 + y and give j. -242 Rearrange (-3520 - 1051 - 4852 - 8113 + 1200)(-h*2 - 3h4 + h2) to the form jh2 + ph + lh4 + gh*3 + n and give l. 49008 Express -162 - 2f*4 + f + 6f*3 + 171 - 2f*2 + 8f as mf2 + if*4 + x + jf + zf3 and give j. 9 Rearrange -83347t*3 + 2t*2 + t - 153 + 0t*2 - 45 + 83347t*3 - 4t*4 to wt + lt4 + gt*3 + kt*2 + y and give y. -198 Rearrange -1423k*2 + 2846k*2 - 1421k*2 + 3776k*3 - 24950k*3 to zk*2 + lk + u + mk3 and give z. 2 Rearrange (-4 - 1 - y + 4 + (-7 + 24 - 10)(-40y + 77y - 96y))(3y - 3y - y*2)(1 - 1 + 2) to the form f + dy + hy*3 + ay*2 and give h. 828 Express 11g*3 - 7g*3 + 2g*4 + 104g + 2g2 + 36 - 106g as dg4 + n + hg*2 + rg + jg3 and give h. 2 Rearrange 3377l + 6856l - 443l to n + vl and give v. 9790 Rearrange -4334b - 2707b - 1705b + 946b - 56b to d + vb and give v. -7856 Rearrange 503g*2 - 1225g*2 - 442g*2 + (-78 + 21g + 78)(-2 + 2 + 2g) to the form pg2 + sg + l and give l. 0 Express 1014r3 - 3r*4 + 128r*2 - 45r*2 - 54r*2 - 30r*2 as a + yr + qr4 + kr*3 + fr*2 and give f. -1 Express (-4o - o + 6o)(3654 + 3892 - 7335) + (-1 + 1 - 2)(0o - 6o + 2o) as t + xo and give x. 219 Rearrange 861n + 10n2 - 439n + 62n2 - 13n*2 - 2 - 448n to s + yn + dn*2 and give d. 59 Express (-v - 3v + 2v)(268 - 73 - 69 + 1448v - 75 - 57) in the form pv + gv2 + z and give p. 12 Rearrange -862 + 2150 - 1080 + m + 3m to jm + q and give q. 208 Rearrange 84t - 25t + 321 - 323 + 59t + 37t + 3t*2 - 3t*3 to w + kt*2 + nt*3 + lt and give k. 3 Express -130g - g3 + 2388 + 4g*2 + 130g - 5g2 as sg*3 + wg + bg2 + y and give b. -1 Express 34 + t + 45 + 1492t*3 - 2983t*3 + 1488t*3 as o + at*2 + st + xt3 and give s. 1 Rearrange -53 - 1711q + 1713q + 57 - 3q*2 - 243 + 8q*2 to wq*2 + lq + c and give c. -239 Express 1065a - 67a*3 - 2129a + 1067a - 3a*2 + 65a*3 in the form oa*2 + b + qa*3 + ra and give r. 3 Rearrange (-182i + 982i - 255i - 26i + 874i)(-142i2 + 11i*3 + 142i*2) to ri*3 + v + ci*4 + ni + li2 and give c. 15323 Rearrange (-d3 + d + 5d*2 - 5d*2)(-26339 - 26504 + 1914 - 10989 + 6294) to kd2 + jd + s + rd3 and give j. -55624 Rearrange 9 - 673s + 4 + 282s + 322s to the form r + ps and give p. -69 Rearrange (5v + 42 - 42)(-335 - 583 + 249) to the form xv + a and give x. -3345 Rearrange -64525y + 1006 + 64525y - 153 - 15y3 + 4y*2 + 14y*3 to the form wy*2 + dy*3 + my + z and give z. 853 Express 39u3 - 41u*3 + 16 - u + 2u + 4u3 - 2u*2 in the form nu*2 + b + iu*3 + wu and give b. 16 Rearrange (-6m3 - 9m*3 + 3m*3)(-978 + 1197 + 1858 + 3077) to the form rm2 + o + ym*3 + sm and give o. 0 Express 144 + 970 - 102 + 9c + 150 as r + lc and give l. 9 Rearrange 10s3 + 11s*3 - 2s - 163s4 - s2 + 10s*3 - 68s*4 - 35s*3 to ds + vs4 + us*2 + ts*3 + q and give t. -4 Express -4i2 - i2 + 0i2 + (6 + 3 - 337i + 341i)(-2i + 3i + i) in the form l + mi2 + ki and give m. 3 Rearrange -4 + 20 + r*3 + 179r*2 + 16r*4 - 16 to the form g + hr*4 + mr + vr3 + dr*2 and give v. 1 Rearrange 68w*2 + 0w + 2 - 228w2 + 0w - 5w + 2w to bw2 + hw + x and give x. 2 Express (-5f2 + 3f*2 - 4f*2)(5f + 12f + 4f)(-5 - 8 + 0) as rf3 + xf + k + uf2 and give x. 0 Express (-1 + 3b + 1)(-4 + 4 - 6) + (b - 1 + 1)(1 - 2 + 2) + 2b + b - 5b + 196 - 21b - 196 - b - b - 2b as vb + s and give v. -44 Rearrange -937h - 606h - 1408h + 532h to the form u + xh and give x. -2419 Express -6s + 360s*2 + 3s + 0s + 1147s*2 + 772s*2 as ks*2 + m + js and give j. -3 Rearrange (-2t2 + 7t*2 + 0t*2)(3 - 3 + 3t) + 0t3 + t3 + 15t2 - 3920 + 3919 to rt*2 + yt*3 + gt + h and give h. -1 Express -38290u - 1 + u2 + 41913u + 1 as qu2 + zu + d and give z. 3623 Express -11150 - 11147 + 33450 - 11153 - 11325f in the form j + bf and give b. -11325 Express (-577y + 832y + 784y)(29 - 74 - 39 - 20 + (1 + 0 - 3)(-2 - 1 + 5)) in the form by + i and give b. -112212 Express -2951b - 2823b - b*2 - 2469b - 20b + 1482b in the form xb + mb*2 + i and give i. 0 Express 12g*3 + 534g*2 + 2 + 3g - 9g - 286g*2 - 278g*2 - 3g*3 in the form wg*2 + ug*3 + ag + o and give a. -6 Rearrange 5567 + 0l2 - 2l*2 + 2l*2 + 3l*3 + 2l - 5563 to kl3 + tl + u + jl2 and give k. 3 Express 44 - 429 - 358 - 92r*3 + 91r*3 + r + 67 as br + x + sr2 + fr**3 and give b. 1 Rearrange (1	{ "pile_set_name": "DM Mathematics" }
r? False Is 287763418091 composite? False Is 8618724139 a prime number? True Is 6274126343 a prime number? True Is 25277682581 a prime number? True Is 2820494553 a prime number? False Is 13896338231 prime? False Is 1281050735 prime? False Is 525473911 composite? True Is 127588799837 a prime number? True Is 2651727329 prime? False Is 82046317 a composite number? True Is 5115267973 prime? True Is 192827233 composite? True Is 5289115187 a composite number? True Is 9999942871 a prime number? True Is 15079584661 composite? False Is 2692782997 a prime number? False Is 912248719 a prime number? True Is 24185411647 prime? True Is 9331889209 composite? False Is 15431931839 prime? False Is 12895224401 prime? True Is 12045877601 a prime number? False Is 9426944161 composite? False Is 204194677 composite? False Is 791924537 prime? False Is 2929461197 composite? True Is 714230981 a composite number? False Is 1232304499 a prime number? False Is 11401115461 a prime number? False Is 17593603 composite? False Is 15977181907 a prime number? True Is 1492203919 a prime number? False Is 10647210181 prime? True Is 4749242065 a prime number? False Is 29623381 prime? True Is 436291454 a prime number? False Is 319195121 a composite number? True Is 4208109483 a composite number? True Is 1016089349 prime? False Is 47984273327 a composite number? True Is 11596581529 a prime number? False Is 58726438651 composite? False Is 684852465355 composite? True Is 3449489887 a prime number? True Is 1283945123 a prime number? False Is 640842227 a composite number? True Is 85451998 a prime number? False Is 6715931477 a prime number? False Is 6099544337 a composite number? False Is 2138536909 a prime number? False Is 195193273 prime? False Is 23682510274 composite? True Is 94844776057 composite? False Is 804123421 composite? False Is 10482024403 a prime number? True Is 25091137789 a prime number? True Is 3334374751 composite? False Is 30018127 prime? True Is 3990491963 prime? False Is 546679702 a composite number? True Is 202787587 a prime number? False Is 1196543213 a composite number? False Is 23744903305 a prime number? False Is 5339153227 prime? True Is 726978487 prime? True Is 3530909671 a composite number? True Is 11013051131 prime? True Is 13037419721 composite? False Is 7360366337 a prime number? True Is 6069961139 a prime number? False Is 21752343859 prime? True Is 3725171341 a composite number? True Is 3782638429 a composite number? True Is 131741369021 composite? False Is 48459503897 composite? True Is 13639171873 prime? True Is 3870579487 prime? True Is 613472216021 a composite number? True Is 480853123 a prime number? True Is 350022203 a prime number? False Is 1507078913 prime? True Is 516343291 composite? True Is 26760513023 composite? False Is 8732259631 a composite number? True Is 89746919 a composite number? True Is 7044781057 composite? True Is 590140051 a composite number? False Is 1000171339 composite? False Is 831724469 prime? True Is 2237330021 composite? True Is 2520917149 composite? False Is 36701260007 a prime number? True Is 194005010015 prime? False Is 3309008467 prime? True Is 27103583977 prime? True Is 420941933 prime? False Is 126473551 prime? True Is 5058145003 a composite number? False Is 116136545843 a prime number? True Is 1001028373 a prime number? True Is 62540851 a prime number? False Is 59107649 a composite number? True Is 557626513 a composite number? True Is 5411884993 a prime number? True Is 18593705909 a prime number? True Is 6545013157 composite? False Is 1866916481 a prime number? False Is 840034547 a composite number? True Is 169013653 a composite number? True Is 15031898801 a composite number? False Is 483672793 a prime number? True Is 841701251 composite? False Is 515119093 prime? True Is 19177869313 composite? False Is 339145977 prime? False Is 580373657 composite? False Is 9663966551 prime? True Is 207544981 composite? True Is 5487536741 a composite number? False Is 13874589983 prime? False Is 7978933217 a prime number? True Is 10746208607 a composite number? False Is 3294679447 a prime number? False Is 1885783049 composite? True Is 12322825997 a composite number? False Is 7628601637 a prime number? False Is 39857081351 a composite number? False Is 386476822867 composite? False Is 2263616711 a composite number? True Is 2832345521 prime? False Is 11440837271 a prime number? True Is 1489270537 a composite number? False Is 857202589 prime? False Is 9582987413 composite? False Is 18933776207 a composite number? False Is 14461440409 composite? True Is 3936404201 composite? False Is 2488822951 a prime number? True Is 686528119 prime? False Is 1584816673 a composite number? True Is 7094095933 a composite number? True Is 10479151667 a prime number? True Is 175560752929 a prime number? True Is 233706719 a composite number? False Is 26086603949 a composite number? True Is 2034550829 composite? True Is 6336123049 a composite number? False Is 14711918813 a composite number? True Is 9415424686 a prime number? False Is 62970276307 prime? False Is 3153998963 a prime number? False Is 7937725927 prime? False Is 147606457 composite? True Is 4384275839 composite? True Is 1033057621 a composite number? True Is 4513476399 composite? True Is 87292586153 a prime number? False Is 65830518013 prime? False Is 12155654737 a composite number? False Is 2742777647 prime? True Is 82607389 a composite number? True Is 717745591 prime? True Is 11563350493 a composite number? False Is 1964339033 prime? False Is 52038313133 a composite number? True Is 1415902289 prime? True Is 1624327393 a prime number? False Is 15987682813 prime? False Is 107980563247 a prime number? True Is 4099407569 composite? False Is 1730859217 composite? True Is 1215775139 a prime number? True Is 22207840387 a prime number? True Is 13816697 composite? False Is 1268643449 prime? False Is 46899403 a composite number? True Is 82070182723 composite? False Is 1860494473 a composite number? False Is 379667207 prime? False Is 4561560991 composite? True Is 80112076367 a composite number? False Is 2076657691 composite? True Is 8380716983 prime? False Is 7334612591 prime? True Is 305346421 prime? True Is 419969533 composite? False Is 26441229527 prime? True Is 210646425479 a prime number? False Is 1547630951 prime? False Is 686711423 a composite number? True Is 78243092251 composite? True Is 1385458733 composite? True Is 852858353 prime? True Is 5480256833 prime? False Is 18498403661 a composite number? False Is 33765532131 composite? True Is 227773219 a prime number? False Is 65746315861 a prime number? False Is 38713514899 a prime number? False Is 94337846971 a prime number? True Is 36325152637 composite? True Is 47849190289 a composite number? False Is 8210797687 a composite number? True Is 32125796489 composite? False Is 34538729 a prime number? False Is 2145003337 prime? True Is 7781245837 a composite number? True Is 172509844153 prime? True Is 5305081861 a prime number? True Is 938818955 a prime number? False Is 1266295801 a composite number? False Is 19960727053 a composite number? False Is 27399504233 prime? True Is 173128619 a prime number? True Is 1543720331 composite? False Is 3675413051 a composite number? True Is 2846471431 a composite number? False Is 1271573741 prime? True Is 1109724947 a composite number? False Is 70050776231 a composite number? False Is 867396028181 a prime number? True Is 84206120426 a composite number? True Is 1706744063 a prime number? True Is 2505415469 a prime number? True Is 58647431471 a composite number? False Is 1395230413 prime? True Is 635795857 prime? True Is 20384590687 a prime number? True Is 999527549 a prime number? True Is 42839773 prime? True Is 36891157249 a composite number? False Is 1813757241 a prime number? False Is 22663636217 a composite number? False Is 382672097 composite? False Is 12430903 a prime number? True Is 8679324331 prime? True Is 895051579 composite? True Is 58763048423 composite? False Is 68796210811 a prime number? False Is 15367658617 a prime number? False Is 30001523 prime? True Is 4305292531 composite? True Is 3152021009 a prime number? False Is 23171156741 prime? True Is 222906243215 a composite number? True Is 9398313623 compo	{ "pile_set_name": "DM Mathematics" }
t2 - t + 2 Let u(c) = -5c*3 + 7c*2 - 2c - 2. Suppose 0 = -2p - 5 - 1. Let h(i) = 6 - 4i*2 + 7i*2 - 15 - 2i*3 + 8 + 0i*3 - i. Determine pu(r) + 7h(r). r3 - r - 1 Let x(m) = 53m*3 + 0m - 2m + 2m*2 + 5m - 47m3. Let f(l) = -7l*3 - 2l*2 - 4l. Give 3f(n) + 4x(n). 3n3 + 2n*2 Let c(w) = -w + 4. Suppose -3h = 74 - 14. Let g be 36/10 - 8/h. Let v = -9 + g. Let o(m) = 2m - 9. Give vc(l) - 2o(l). l - 2 Let g(t) = -6t3 - t2 - 9t - 8. Let w be g(-1). Let b(u) = 6u. Let c(l) = l*2 - 7l. What is wc(f) + 7b(f)? 6f2 Let a(q) = 2q + 5. Let o(x) = 4x + 25 - 31 + x - 7x. Determine -3a(b) - 2o(b). -2b - 3 Let p(n) be the third derivative of -n5/30 - n4/8 + n3/6 - 49n*2 + 5n. Let c(y) = 3y2 + 7y - 3. Give -4c(o) - 10p(o). 8o2 + 2o + 2 Let h(f) = 167f + 4. Let u(s) = -44s - 1. What is -2h(n) - 9u(n)? 62n + 1 Let w(v) = 147. Let d(b) = 1472. Let t(k) = -d(k) + 10w(k). Let y(s) = s. Let c be ((-1)/2)/((-1)/2). Determine ct(f) - 2y(f). -2f - 2 Let x(p) be the third derivative of p4/4 + p3/6 + 15p*2. Suppose -26 + 6 = 5i. Let j = 485 - 490. Let l(b) = -7b - 1. Calculate il(w) + jx(w). -2w - 1 Let q(f) = -2f2 - f - 5. Let i = -2517 + 2525. Let j(y) = -6y*2 - 4y - 14. What is iq(o) - 3j(o)? 2o2 + 4o + 2 Suppose 4h = -8, 3u - 7u + 6 = 3h. Let v(o) = -u + o - 7o + 4o + 0. Let g(t) = -1. What is 4g(s) - v(s)? 2s - 1 Suppose -285u = -280u - 5. Let s(j) = -j*2 - 1. Let a(i) = 9i*2 + 2i + 5. Give ua(m) + 3s(m). 6m2 + 2m + 2 Let z(l) = 2l. Let b(j) = 9j*2 - 14j + 5. Let a(m) = 7m2 - 13m + 4. Let v(y) = -5a(y) + 4b(y). Give -2v(f) + 11z(f). -2f2 + 4f Let p(u) = 3u2 - u. Let r be p(-1). Let f(l) = -5l*2 - 20 + 0l*2 - 3l*3 + 25 + rl. Let g(b) = 1 + b2 + b - b2 - b*2. What is -f(n) + 5g(n)? 3n3 + n Let u(d) = 10d*3 + 5d. Let p(j) = 100j - 206j + 105j - j3. Calculate 10p(r) + 2u(r). 10r*3 Let y(n) = -3n - 3. Let k be 4(-1 + 1/(-1)). Let w(s) = 817257s + 0 + 1 - 817256s. Give kw(p) - 3y(p). p + 1 Suppose 0 = 4b - l - 7, 5l = b - 4b + 11. Let o(k) = 2k2 - 3k*b + 6k + 6k2 - 2k2 - 6. Let i(m) = m2 + m - 1. Determine -6i(f) + o(f). -3f*2 Let j(p) = -7p*3 - 2p*2 - 5p - 2. Let z(m) = m*3 + m + 1. Determine -j(w) - 5z(w). 2w3 + 2w*2 - 3 Let h(j) = 4j*3 + 6j - 6. Suppose -5g = 12 - 42. Let w(b) = -15b*3 + 4b + 30b3 - 18b*3 - 9b + 3 + 2. Give gw(d) + 5h(d). 2d3 Suppose -14n - 56 = -42n. Let f(s) = 3s*3 - 3s*2 + 2s + 2. Let o(w) = 11w3 - 13w*2 + 9w + 8. What is no(t) - 9f(t)? -5t3 + t2 - 2 Let a(n) = n3 - n2 + n. Let f(m) = 198m*3 + 2m*2 - 2m. What is -4a(c) - 2f(c)? -400c3 Let f(w) = -4w - 8. Let p(x) = -57x - 29. Let a(g) = 36g + 19. Let j(t) = -8a(t) - 5p(t). Determine 6f(d) - 7j(d). -3d + 1 Suppose 2j - 5d = -3, 5d = -2j + j + 21. Let i(y) = -6y + 23y - 10y - jy. Let p(q) = -4q. Let b = 11 + -8. Give bi(n) + p(n). -n Let r(q) = 3q - 16. Let w(f) = 99f + 5 + 97f - 197f. What is -2r(d) - 7w(d)? d - 3 Let z(g) = 10g*3 - 5g*2 + 4g - 3. Let t(p) = -31p3 + 16p*2 - 13p + 10. Give -2t(h) - 7z(h). -8h3 + 3h*2 - 2h + 1 Let t(n) = 13n3 - 16n*2 + 82n + 23. Let l(m) = -4m3 + 5m*2 - 27m - 7. Calculate 10l(h) + 3t(h). -h*3 + 2h*2 - 24h - 1 Let x(p) = -444p - 31. Let h(w) = 146w + 11. What is -8h(b) - 3x(b)? 164b + 5 Let y(r) = -14r + 11. Let f = 10 - 21. Let h be (f - 2) + (2 - 0). Let w(g) = 5g - 4. Let v be ((-8 - -3)/(-5))/(3/(-12)). What is hw(x) + vy(x)? x Let f(m) be the second derivative of 3m*5/40 - 7m4/24 - m3/3 + 6m. Let l(o) be the second derivative of f(o). Let r(i) = -3i + 2. Give 2l(g) + 7r(g). -3g Let l(i) = 2i + 1. Suppose -2m + 1 = -3. Let s be ((-3)/m)/((-18)/(-24)). Let v(o) be the first derivative of -o2/2 - 130. Determine sl(b) - 3v(b). -b - 2 Let b(n) = 2. Suppose 17u = -20 - 82. Let w(y) = -y - 6. Give uw(r) - 17b(r). 6r + 2 Let b = 496 - 505. Let o(k) = 4k*3 + 3k + 2. Let w(r) = r*2 - 4r*3 - 17r*3 - 9 + 4r*3 - 12r. What is bo(j) - 2w(j)? -2j3 - 2j*2 - 3j Let j(q) = -q*3 + 10q*2 + 9q + 25. Let n be j(11). Let r(m) = 2m + 5. Let i(z) = -2z - 6. What is ni(g) + 4r(g)? 2g + 2 Let k(g) = -4g - 1 + 3g2 + 8 - 3 - 4g*2 + 8g. Let m(h) = 3h + 3. Determine 3k(v) - 4m(v). -3v*2 Let r(h) = 15h + 8. Let u(b) = 9b + 4. Give 4r(x) - 7u(x). -3x + 4 Let x(s) = -4s + 11 + 6s*2 - s - 5 - 6s*3 - s. Let p(o) = 12o*3 - 13o*2 + 13o - 13. Let v = -1719 - -1725. Give vp(j) + 13x(j). -6j3 Let u(i) = -41i*2 - 39i - 30. Let v(j) = -10j2 - 10j - 7. Give 2u(k) - 9v(k). 8k2 + 12k + 3 Let m(x) = 11x2 + 16. Let w(t) = 16t*2 + t + 17. What is 4m(p) - 3w(p)? -4p*2 - 3p + 13 Let d(c) = -19c + 2. Let o(u) = -13u + 1. Determine 5d(w) - 7o(w). -4w + 3 Let p be ((-35)/(-15))/((-9)/27). Let m be 2/7 - (-33)/7. Let y(i) = -2i - 5. Let c(l) = -3l - 7. Calculate mc(h) + py(h). -h Let r(d) = 4d*2 - 7d + 9. Let a(b) = -3b2 + 6b - 7. What is -6a(p) - 5r(p)? -2p2 - p - 3 Let h(f) = f3 + 9f*2 + 19f + 978. Let o(v) = 2v2 + 4v + 245. What is -2h(r) + 9o(r)? -2r3 - 2r + 249 Let f(w) = -2w - 34. Let r(d) = -2d - 35. Determine -4f(g) + 5r(g). -2g - 39 Let j(a) = -2a*3 - 7a*2 + 3a - 3. Let w(b) = -2b3 - 6b*2 + 4b - 4. Give 4j(d) - 3w(d). -2d3 - 10d*2 Let o(w) = -2w*2 + 3w - 3. Let g(l) = 91l2 - 131l + 149. Let t(c) = 23c2 - 33c + 37. Let m(z) = -2g(z) + 9t(z). Give -3m(n) - 35o(n). -5n2 Let x(v) = -2v*3 - 4v*2 - 2v + 5. Let k be x(-2). Let j(r) = 7r. Let u(l) = 4l. What is ku(z) - 4j(z)? 8z Let y(v) = -6v*2 + 6v + 11. Let r(a) = -7a + 4a*2 + 6a2 + 8 - a3 - 2a2. Let w be r(7). Let h(t) = -2t*2 + 2t + 4. Determine wh(i) - 3y(i). 2i2 - 2i - 1 Let x(q) = 3q3 - 5q*2 + 4q + 2. Let a(p) = 4p3 - 4p*2 + 3p + 1. What is -4a(o) + 3x(o)? -7o3 + o2 + 2 Let t(p) = p - 5. Let n(h) = -2h + 6. Let f = 574 - 580. What is fn(v) - 7t(v)? 5v - 1 Let n(v) = -26v - 5. Let r(d) = 24d + 6. Calculate 6n(q) + 5r(q). -36q Let l(j) be the second derivative of j3/6 - j2/2 + 37j + 1. Let y(q) = 5q - 10. What is 4l(c) - y(c)? -c + 6 Let f(u) = -122u*2 + 2u - 7. Let b(n) = 62n2 - n + 3. What is -5b(x) - 2f(x)? -66x*2 + x - 1 Let k(x) = x - 1. Suppose -3o - 12 = 0, -5o - 30 - 38 = 4d. Let s(t) = -t + 1. Let w(z) = -4z + 4. Let i(l) = 2s(l) - w(l). What is dk(v) + 5i(v)? -2v + 2 Let m(r) = -3r*2 - 5r - 136. Let p(t) = -t*2 - 2t - 46. Calculate 4m(h) - 11p(h). -h*2 + 2h - 38 Let b(s) = -35s + 16. Let g(z) = 2z. Give -b(q) - 5g(q). 25q - 16 Suppose -2g + 13 = -2s + 15, 5g + 9 = 3s. Let w(u) = -13u3 + 16u*2 + 10u - 7. Let t(j) = -4j3 + 5j*2 + 3j - 2. What is sw(q) + 7t(q)? -2q3 + 3q2 + q Let z(q) = q2 + q - 1. Let g(p) = -7p2 + 6. Let s(j) = g(j) + 2z(j). Let a be (-14)/133 - (-51)/(-57). Let c(b) = -b*2 + 1. Calculate as(v) + 4c(v). v2 - 2v Let j(q) = q*3 + 3q - 2. Let g(z) = z*3 + 4z - 3. Let h = 13 - 11. What is hg(f) - 3j(f)? -f*3 - f Let a = -1 - 4. Let w be ((-226)/(-339))/(2/3). Let t(v) = -2v*2 + 2v + 5. Let f(d) = 1. Determine af(x) + wt(x). -2x2 + 2x Let s(j) = 7j - 1. Let g(l) = 36l - 845. Give -g(b) + 5s(b). -b + 840 Let k(p) = -19p*2 + 102p + 22. Let r(d) = 9d2 - 50d - 10. Calculate -6k(i) - 13r(i). -3i2 + 38i - 2 Let p(f) = -228f + 8. Let w(t) = 227t - 7. Give -6p(h) - 7w(h). -221h + 1 Let p(z) = z2 + 12z - 2. Let g be p(-12). Let a(f) = -f + 5. Let q(d) = 1. Let x(y) = -a(y) + 5q(y). Let o(c) = 4c + 1. What is go(r) + 6x(r)? -2r - 2 Let w(s) be the third derivative of 2s5/15 + s4/6 - 2s3/3 - 2s*2. Let p(x) = 2x*2 + x - 1. Determine 9p(v) - 2w(v). 2v2 + v - 1 Let w(q) = q2. Let h(d) = 9d2. Suppose 0 = 54n - 58n + 12, -5l - 7 = -4n. Calculate lh(c) - 18w(c). -9c*2 Let l(m) = 3m*3 + 4m*2 - 3. Suppose 5s - 60 = 5t - 45, 0 = 3s - 2t - 5. Let k(o) = o3 - o2 + 1. Give sl(j) - 2k(j). -5j*3 - 2j*2 + 1 Let b(z) = 2z*2 - 2	{ "pile_set_name": "DM Mathematics" }
et z(h) = -12h2 + h + 6. Let a(u) = -10u*2 + 10u*2 - 5 + 11u*2 - u. What is 7a(y) + 6z(y)? 5y2 - y + 1 Let a(b) = b3 + b + 1. Let y(p) = -30p3 + 60p + 60. What is 60a(u) - y(u)? 90u*3 Let r(x) = 6x + 102. Let j(q) = -10q - 153. Determine 5j(m) + 8r(m). -2m + 51 Let h(m) = 151 + 15m3 - 128 - m3. Let l(i) = 5i*3 + 8. Suppose 2u - 5u = -9. Suppose -2k + 76 = -4y, -2k + k = -uy - 55. Determine yl(j) + 6h(j). -j3 + 2 Let f(q) = 13q + 0 - 9q - 1 - 2. Let j(l) = l - 1. What is -2f(c) + 7j(c)? -c - 1 Let f(v) = v3 - v2 - v. Let n(r) = -r3 + 4r*2 + 5r - 3. Give -3f(k) - n(k). -2k3 - k2 - 2k + 3 Let p(o) = -77o*3 - 8o*2 - 20o - 6. Let w(y) = -26y3 - 3y*2 - 7y - 2. What is 6p(d) - 17w(d)? -20d3 + 3d2 - d - 2 Let p(i) be the second derivative of -i3/3 + i*2/2 + 28i - 3. Let v be -1(0 + -1) - 0. Let d(j) = 2 + 2 + 0 - 3. Determine vp(o) - 2d(o). -2o - 1 Let p(i) = -136i3 - 28i*2 - 11i - 3. Let z(s) = 45s3 + 10s*2 + 4s + 1. Give -4p(x) - 11z(x). 49x3 + 2x*2 + 1 Let j(a) = -319a*3 - 6a + 6. Let f(l) = -319l3 - 5l + 5. Give -6f(s) + 5j(s). 319s3 Let d(r) = -r + 16. Let m be d(11). Let p(t) = 19t*2 + 5t + 5. Let i(k) = 9k2 + 2k + 2. What is mi(c) - 2p(c)? 7c2 Suppose 6z + 78 = 102. Let x(t) = -5t3 + t2 - 11t. Let w(r) = 2r3 + 4r. Suppose 0 = -5v + 21 + 34. Determine vw(k) + zx(k). 2k*3 + 4k*2 Let o(w) = 39w + 16. Let s(t) = t + 3. Calculate -2o(i) + 10s(i). -68i - 2 Let y(m) be the third derivative of m6/40 + m5/30 - m4/24 - m3/2 - 2m*2. Let j(l) = 13l*3 + 9l*2 - 5l - 13. Calculate -4j(b) + 18y(b). 2b3 + 2b - 2 Let y(b) = -3b + 4. Let j(g) = -1. Let z(h) = 6j(h) + 3y(h). Let i(s) = 8s - 5. What is 5i(x) + 4z(x)? 4x - 1 Let j(q) = -q + 5. Let w(o) = 1. Let t = -7 + 9. Suppose 0 = -5p + 20, -10 = -4r + tr + 2p. What is rw(b) - 2j(b)? 2b - 1 Let p(a) = -3a3 + 6a*2 + 5a - 3. Let x be ((-2)/4)/(6/60). Let k(n) = -3n3 + 5n*2 + 4n - 2. Determine xp(r) + 6k(r). -3r3 - r + 3 Suppose -4c - 2t = -18, -t + 5 = 4t. Let x(l) = 2l + 0l - 5l + l2 + cl. Suppose 3r = 2r + 3. Let m(a) = -2a2 - 2a. Give rm(v) + 5x(v). -v*2 - v Let g(n) = -8n*3 - 5n. Let y(f) = f + 1. Determine -2g(k) - 10y(k). 16k3 - 10 Let v(y) = -y3 + 5y - 2. Let n(r) = -r. Let k(x) = -5n(x) - v(x). Let u(a) = 1 - 2 + 4. Determine 3k(w) - 2u(w). 3w*3 Let g(q) be the first derivative of 78q*4 + 143q*3/3 + 143q*2/2 - 143q - 265. Let v(x) = -13x3 - 6x*2 - 6x + 6. Determine 6g(a) + 143v(a). 13a3 Let f(l) be the first derivative of l3 + l2/2 - l + 718. Let n(t) = -t. Give -f(h) - n(h). -3h*2 + 1 Let f(w) = w + 2. Suppose -4d + 5 = -3t, -10 = -d + 2t - 5. Let l(b) = b - 1. What is df(o) - 4l(o)? -5o + 2 Let t(i) = 6 - 6i - 11 + 14. Let x(n) = 9n - 14. Give -8t(y) - 5x(y). 3y - 2 Let g(j) = -185j + 2. Let i(a) = -a. Determine g(s) - 4i(s). -181s + 2 Let z(h) = -h + 3. Let v(r) = r2 + 3r + 24. Calculate v(g) + z(g). g*2 + 2g + 27 Suppose 2 = 2j - 12. Let m(o) = -6o*2 + 7o - 4. Let h = 20 + -2. Let y = h + -13. Let d(a) = 4a2 - 5a + 3. What is jd(z) + ym(z)? -2z2 + 1 Let w(r) = -6r*2 - 31r - 15. Let l(k) = -k*2 - 6k - 3. What is 11l(d) - 2w(d)? d*2 - 4d - 3 Let g(j) = -2j3 + 2j*2 + 51. Let n(l) = 7l*3 - 9l*2 - 205. Give -9g(w) - 2n(w). 4w*3 - 49 Let q be (-10)/((6/(-8))/(18/16)). Suppose 4p = -4m, 5p + m = p - q. Let f(t) = 5t3 - t2. Let n(d) = -9d3 + d2. Give pf(v) - 3n(v). 2v3 + 2v*2 Let b(u) = -2u - 4. Let z(l) = 3l - l + 5 + l. Let s(a) = -a3 + 44a*2 + 43a + 87. Let n be s(45). Determine nz(v) - 4b(v). -v + 1 Let r(t) = t. Let s(w) = -w*2 + w - 2. Suppose -14 = -5i + q, 0 = 5q + 29 - 9. Determine ir(z) - s(z). z*2 + z + 2 Let g(t) = -3t + 3t - t. Let b(i) be the first derivative of -i3/3 - i2 + 1522. Let s be 1/((-5)/4 + 1). Calculate sg(m) + 2b(m). -2m*2 Let d(y) = 31y*2 - 26y*2 + 1 + 4 - 5y. Suppose -l - 4u - 13 = 0, -2l - 4 = -20u + 17u. Let a(i) = i3 - i2 + i - 1. Determine la(h) - d(h). -5h3 Let y be (-2)/(-4) - (-432)/288. Let b(k) = k3 - 2k2 - 2k - 2. Let h(x) = -2x3 + 3x*2 + 3x + 3. Calculate yh(g) + 3b(g). -g*3 Suppose 0 = 16r - 95 - 17. Let o(a) = -a - 3. Let j(d) = 2d + 4. Determine ro(y) + 5j(y). 3y - 1 Let o(x) = -15x2 - 9x - 63. Let d(u) = 7u2 + 4u + 32. What is 13d(r) + 6o(r)? r*2 - 2r + 38 Let c be (88/44)/(2/4). Let n(a) = -14a2 - 14a - 20. Let o(l) be the second derivative of -5l4/12 - 5l*3/6 - 7l*2/2 - 4l. Give cn(h) - 11o(h). -h*2 - h - 3 Let z(l) = -l. Suppose -4v + 2s = 4s - 376, 4s = 2v - 208. Let c be v/40 - (-2)/(-5). Suppose 4 = ca + 2. Let g(i) = 2i*2 + 4i. Give ag(h) + 4z(h). 2h2 Let q(t) = 1. Let j(b) = -3b + b + b + 3. Give -j(w) + 5q(w). w + 2 Let i(m) = 527m*3 - 14m*2 + 4m - 14. Let u(v) = -176v3 + 4v*2 - v + 4. Give 2i(z) + 7u(z). -178z*3 + z Let q(c) = 4c*3 - 19c*2 + 3. Let b(m) = -5m*3 + 20m*2 - 4. Determine 5b(g) + 6q(g). -g3 - 14g*2 - 2 Let d(f) = 21f - 3. Let x(p) = -p - 2. Determine -2d(m) + 4x(m). -46m - 2 Let v(o) = 7o - 10. Let g(k) = k*2 - 8k + 13. Determine -4g(q) - 5v(q). -4q2 - 3q - 2 Let m(f) = 4f3 + f2 - f + 10. Let b(v) = -6v*3 - 2v*2 + 2v - 19. Determine 3b(q) + 5m(q). 2q3 - q2 + q - 7 Let x(b) = 30b*2 - 2b + 8. Let y(g) = 29g2 - 2g + 10. Determine 4x(s) - 3y(s). 33s2 - 2s + 2 Let x(t) = -13t - 12. Let n(l) = -13l - 11. What is 3n(g) - 2x(g)? -13g - 9 Let b(p) = -p + 1. Let m(r) = -8r - 18. Let z(u) = 39u + 96. Let i(a) = -21m(a) - 4z(a). Give -4b(h) - i(h). -8h + 2 Let k(c) = 10c + 63. Let t(a) = -12a - 63. Determine 5k(r) + 4t(r). 2r + 63 Let w(j) = -j3 + j2 + j. Suppose 5 + 3 = z. Suppose zu + 24 = 11u. Let n be (2/u)/(5/(-20)). Let y(o) = o*3. Determine nw(t) + y(t). 2t3 - t2 - t Let v(x) = 5x*2 + 7x + 1. Let m(n) = -4n2 - 6n + 1 - 2 + 0n. Let s = 25 + 8. Let d = s + -38. Determine dv(z) - 6m(z). -z2 + z + 1 Let h be (1/2)/(-36/(-612)). Let v(n) = -15n + 4 + 29n + 3n2 - hn - 1. Let o(c) = -c3 - c2 + c - 1. What is -3o(p) - v(p)? 3p*3 Let d(n) = 3n*3 - 5n*2 + 5n + 6. Let u(q) = -13q3 + 22q*2 - 23q - 23. Determine 9d(y) + 2u(y). y3 - y2 - y + 8 Let h(j) = -11j + 2. Let z(f) = 3f - 17. Let d be z(5). Let r(u) = 45u - 9. What is dr(a) - 9h(a)? 9a Let n = -58 + 71. Suppose -13p = -0 + n. Let l(a) = -a. Let z(q) = -2q + 2. Determine pz(i) + 3l(i). -i - 2 Let a(t) = 1978 - 7t - 985 - 988 - 8t*2. Let r(f) = -7f*2 - 6f + 4. What is 4a(v) - 5r(v)? 3v2 + 2v Let y(v) = -17v2 + 409v + 22. Let d(f) = 6f2 - 137f - 8. What is 11d(r) + 4y(r)? -2r2 + 129r Let p(i) = -i2. Let q(l) = -l3 + 13l2. Let d be 0 + 0 - (9 - 9). Suppose d = -11w - 790 - 68. Determine wp(m) - 6q(m). 6m3 Let f(o) = 5o*3 + 3o*2 + 5. Suppose -2t = -m - 3, t = 2m - 3 - 0. Let s(p) = -11p*3 - 5p*2 - 9. What is ms(g) + 5f(g)? -8g*3 - 2 Let k be (-88)/40 - 2/(-10). Suppose 5x - 2h = 25 + 2, 0 = -4x - 4h + 16. Let c(f) = 2f + 1. Let d(l) = 4l + 3. Give kd(s) + xc(s). 2s - 1 Let k(s) = -2s3 + s2 - 2s. Let q(c) = -55c2 - 3c + 36c2 + 21c*2 - 4c*3. What is 5k(m) - 3q(m)? 2m3 - m2 - m Let o(y) = -19y2 - 2y - 8. Let z(d) = 10d2 + d + 4. Determine -6o(s) - 11z(s). 4s*2 + s + 4 Let p(k) = -119k. Let j(a) = 35a - 84. Let m(y) = 2y - 4. Let l(r) = -j(r) + 21m(r). What is 70l(b) + 4p(b)? 14b Let x(g) = -g*3 - 3g2 + 3. Let i(v) = v2. Calculate 5i(s) + x(s). -s3 + 2s*2 + 3 Let d(o) = -14o3 - o - 1. Let l(a) = a3 - a. Suppose -3n + 67 - 79 = 0, g = 2n + 9. Determine gd(v) - l(v). -15v*3 - 1 Let g be (-4)/16(4 + 36)/10. Suppose x + 0 = -6. Let j(u) = u*3 + u. Let t(p) = -4p*3 - 4p - 1. What is gt(m) + xj(m)? -2m3 - 2m + 1 Let g be 4/18 + (-11)/(1287/377). Let l(i) = -2i2 - i + 3. Let p(o) = -o2 - 2o + 4. What is gp(a) + 4l(a)? -5a2 + 2a Suppose 0 = -2y - 4w, -14 + 11 = y + 5*w. Suppose -33 =	{ "pile_set_name": "DM Mathematics" }
(2/101) assuming n is positive. n(-26/101) Simplify (x/(xx(-2/3)x))0/(x0)(-11) assuming x is positive. 1 Simplify s25s(1/55) assuming s is positive. s(1376/55) Simplify (j(1/7)jjj(-4))(-1/43) assuming j is positive. j(13/301) Simplify (h(-13)h)/h(-14) assuming h is positive. h2 Simplify o(2/31)ooo*33/oo assuming o is positive. o(1087/31) Simplify (l(-3/2)/l12)(-2/11) assuming l is positive. l*(27/11) Simplify ((ii/(i/i(1/11)))/(i/(i/i(2/5))))1 assuming i is positive. i(38/55) Simplify (j(-16))10 assuming j is positive. j*(-160) Simplify ((ss(-10/7))50)(23/5) assuming s is positive. s(-690/7) Simplify (s/(s/((s/(s/(ss(-1/17))))/ss)))(-16) assuming s is positive. s(-256/17) Simplify ww(-2/5)w(-35)/w assuming w is positive. w(-177/5) Simplify (l5)(28/5) assuming l is positive. l*28 Simplify zzz/(z/z(-4/5))zz2z(z(1/4))(3/7) assuming z is positive. z(743/140) Simplify l(-11)ll(4/9)/l assuming l is positive. l(-95/9) Simplify ((i(2/11)i)/i(1/14))(-2/137) assuming i is positive. i(-171/10549) Simplify ((r2/r)/r)/r(-21) assuming r is positive. r21 Simplify s*(-5)/ss*(-3)s*(-6)s(-3/2) assuming s is positive. s(-33/2) Simplify (k/(k/((k/k(-4/23))/k)))/k19 assuming k is positive. k*(-433/23) Simplify ((mm*3)/(mm3))(9/7) assuming m is positive. 1 Simplify (uu(1/3))(-9)u/(u*(-6)/u)u(1/12) assuming u is positive. u(-47/12) Simplify (pp/p7pp(-1/7))(-6/19) assuming p is positive. p(174/133) Simplify v(-33/7)/(vvv/v(3/5)v) assuming v is positive. v(-284/35) Simplify o1/o(-5/3) assuming o is positive. o(8/3) Simplify (q(1/4)/(q0q))(4/11) assuming q is positive. q(-3/11) Simplify ((n(-2/3)/n)(-34))6 assuming n is positive. n340 Simplify ((r/(rr(3/2)))/r(7/2))/(rrr(-1))(-29) assuming r is positive. r24 Simplify (r(2/9)r/r4)/(rrrr*(-5)rr/(r(-1/15)/r)r) assuming r is positive. r(-218/45) Simplify f/f(5/3)(f/f(1/9))/f(f(-1))(-34) assuming f is positive. f(299/9) Simplify ((y(-1/2)/y)(-2/11))(17/2) assuming y is positive. y(51/22) Simplify (r/(r(2/5)/r)rr(r5rr)/r)/(r0r)(-3/17) assuming r is positive. r(831/85) Simplify (x(-2/7))(1/3)(x(-1))(2/21) assuming x is positive. x(-4/21) Simplify i(-2/5)/(i(3/5)i)(ii3)/i(2/11) assuming i is positive. i(20/11) Simplify (g(-1/8)/(ggg/g*(-2/5)g))/((g/g*(-1/5))/(((g/((g/(((g(g/((gg(-2/13)gg)/gg))/g)/g)/g))/g))/g)/gg)) assuming g is positive. g(-4977/520) Simplify ((d(dd(2/7))/d)/(d/(ddd/(d(-4/3)d)ddd)))45 assuming d is positive. d(2085/7) Simplify ((nn*(-1)nn)(-2/53))(-15) assuming n is positive. n(60/53) Simplify ((z/(z/(z(9/4)z))z)/z)/(z(-2/19)z) assuming z is positive. z(179/76) Simplify (n(2/5))*(2/35)(nn(-9)nnn)/nn(-1/5) assuming n is positive. n(-1081/175) Simplify s/s(3/7)(s/(ss/(s/s(-2/5))s))/s assuming s is positive. s(-36/35) Simplify ((c(-10)c)/c(2/17))(-2/99) assuming c is positive. c(310/1683) Simplify x(8/7)/x(1/8) assuming x is positive. x(57/56) Simplify ((k(-16)/k)/k)(3/4) assuming k is positive. k(-27/2) Simplify (u(-2/7)/(uuu/(u/((u(-6)/u)/u))))/(u3u(7/2)) assuming u is positive. u(-11/14) Simplify vv(2/21)v/(v/(vv(1/38))) assuming v is positive. v(1693/798) Simplify (g(2/9)/g(1/6))/(gg*(2/3)gg)(-1/36) assuming g is positive. g(17/108) Simplify (dd(3/16))/d(-2/7) assuming d is positive. d(165/112) Simplify b5b(-1)bb(-5)bb((b*(-6)bb)/b)/bb assuming b is positive. b(-3) Simplify u21/(u/(((uuu*13)/uu)/u)) assuming u is positive. u34 Simplify (a/a(-3))(1/23) assuming a is positive. a(4/23) Simplify ((v(-1/3)/v)/(v(-4)/v))(-1) assuming v is positive. v(-11/3) Simplify (((j(2/9)/j)/j)(3/26))(-41) assuming j is positive. j(328/39) Simplify (ii11)/iii(i(-3)/i)/i assuming i is positive. i8 Simplify ((zz(-16))/zz)/z3 assuming z is positive. z(-18) Simplify (j/(jjj*(-3/13)))/(jjj(jj1)/j) assuming j is positive. j(-62/13) Simplify ((h(h/(h/h*(2/13)))/h)/h)/(h/(hh(-26)/h)) assuming h is positive. h(-362/13) Simplify g/(g/(gg11)gg)g(18/13) assuming g is positive. g(148/13) Simplify j*(5/6)/jj(3/5)/j assuming j is positive. j(-17/30) Simplify ((i/((ii/i(1/20)i)/i))/i)/ii/((ii*(-7/9)i)/i)i assuming i is positive. i(-211/180) Simplify ((hh*15h)/h(7/5))(-4/9) assuming h is positive. h(-104/15) Simplify (l(-7/4)/(ll/(l(-7)l)l))/((ll/(l*9/l))/(ll/((ll/l(9/2))/l))) assuming l is positive. l(3/4) Simplify (((u/u(-1/22))/u)/uu(-12))(2/23) assuming u is positive. u(-285/253) Simplify ((m5m)/m(-1))/(mm*(-2/15)m(-6)) assuming m is positive. m(182/15) Simplify (t/(t*(-16)t))(-27) assuming t is positive. t(-432) Simplify (q(-2/5)/q(-6))/(q*2qqq6/q) assuming q is positive. q(-17/5) Simplify (g*(-5/3)/(gg(-1/3)/g))/(g(1/2))(4/5) assuming g is positive. g(-26/15) Simplify (j*(-1/24)/j)/(jj(j34j)/jj) assuming j is positive. j(-913/24) Simplify h(-2/9)/(hh/(h/((h/(((hh(-2/15)h)/hh)/h)h)/h))) assuming h is positive. h(-61/45) Simplify h(-1/14)hhh/(hh/h(-23)) assuming h is positive. h(-309/14) Simplify (tt(-3))/t(-3/8) assuming t is positive. t(-13/8) Simplify (f5f(3/5))/(f7f0) assuming f is positive. f(-7/5) Simplify ((ii/(i*0i))2)(-34) assuming i is positive. i(-68) Simplify l(-1/6)l33 assuming l is positive. l(197/6) Simplify ((g(8/3)/g)/g)(1/4) assuming g is positive. g(1/6) Simplify z/(zz/(z*(-8)/zz)zzz)z(-12) assuming z is positive. z(-24) Simplify (b(-1/4))(17/2)(b(-1/3)b)(-2/9) assuming b is positive. b(-491/216) Simplify ((l(1/5))(21/4))(-2/23) assuming l is positive. l(-21/230) Simplify (d*(-1/3)/(d/(d/(dd*4d))))35 assuming d is positive. d(-665/3) Simplify (b/((b*6b)/b)b(((b*(-5)b)/b)/b)/b)(-3/11) assuming b is positive. b3 Simplify (i/i(-1/5))(-1/7)/(i(-2/5))(-2/3) assuming i is positive. i*(-46/105) Simplify (h/(h/(h(h/h*16)/hhh)))/h(-10) assuming h is positive. h(-3) Simplify (v/((v/v(-1/2))/v))/(v/(((vvv(2/23))/v)/v))(v(2/3))(3/25) assuming v is positive. v(-383/1150) Simplify f(-2/33)/(f/f(-22)) assuming f is positive. f(-761/33) Simplify (tt(6/7))(-50) assuming t is positive. t(-650/7) Simplify (s/(s0/s))(6/5)/(((ss*(-6))/s)/ss4) assuming s is positive. s(27/5) Simplify (hh(-1/4)hhh*(2/11)h)/(h(3/11)/((((h/h(-1/5))/h)/h)/h)) assuming h is positive. h(409/220) Simplify g(-2/27)g(-27)g assuming g is positive. g(-704/27) Simplify (l(-1))*39(l/l*(4/5))/ll(-2/17) assuming l is positive. l(-3393/85) Simplify (w*(3/7)w*19ww)(-2/7) assuming w is positive. w(-300/49) Simplify ((j/(j(3/5)jj))(3/2))(-18/7) assuming j is positive. j(216/35) Simplify (uu*(6/11)u)/(uu(3/4))u*(-3)uuu7 assuming u is positive. u(299/44) Simplify c(c/(cc*(7/2)/c)cc)/ccc(-24) assuming c is positive. c(-47/2) Simplify i(-2/17)/i(5/6) assuming i is positive. i(-97/102) Simplify (ff*27f)/f15 assuming f is positive. f14 Simplify ((zz2)/z)/z(-1/24) assuming z is positive. z(49/24) Simplify ((q/(q(-2/5)/q))/((q(q6/q)/q)/q))/(q2/qqq(-7)) assuming q is positive. q(17/5) Simplify ((p((p/(p1/p))/p)/pp)/p(ppp(-5)p)/p)/(p*2/(pp/(p/p*2)pp)) assuming p is positive. 1 Simplify x(1/12)x19 assuming x is positive. x(229/12) Simplify ((l*(2/9)l)(-42))35 assuming l is positive. l(-5390/3) Simplify (s(2/7))*(-23)((s(s((s*(-3)sss)/s)/s)/ss)/s)/s(-5) assuming s is positive. s(-18/7) Simplify (t/(t(-9)t)tt/(tttt/(t/((t/t6)/t))tt)t)/(t*(1/11)/(tt(1/2))) assuming t is positive. t(317/22) Simplify ((bb1b)/b)(-43) assuming b is positive. b(-86) Simplify ((((ii(-4/7))/i)/i)/i6)(-3/17) assuming i is positive. i*(159/1	{ "pile_set_name": "DM Mathematics" }
= -45213v2 - 1617. Let t(h) = 1222h*2 + 44. Let g(r) = 4c(r) + 147t(r). Let p(n) = -2n*2. Give p(g(q)). -2967048q*4 Let z(w) = 9w*2. Let t(o) = -9o*2 - 29o*2 + 70o*2 - 7 + 6 - 55o*2. Determine z(t(j)). 4761j*4 + 414j*2 + 9 Let b = -3126 + 3126. Let q(v) be the first derivative of bv + 9 - 1/2v2. Let u(r) = 2r*2. Determine u(q(k)). 2k*2 Let r(l) = -9l*2. Let z(w) = -3 - 4 + 2 + 219w - 29w + 7. Determine z(r(f)). -1710f*2 + 2 Let g(j) = -2j. Let t(h) be the first derivative of -24 + 136h + 2h4 + h4 + 131h - 298h. Let y(k) be the first derivative of t(k). Determine y(g(n)). 144n2 Let t(q) = 13q*2. Let b be -4 + 4 + -4 - -44. Suppose 43m = bm + 21. Let n(k) = 2k - 3k2 + mk - 9k. Calculate t(n(p)). 117p*4 Let d(m) = -55m. Let x(w) = 3w2 - 2w. Let p(f) = 11f2 - 9f. Let a = -498 - -507. Let c(n) = ax(n) - 2p(n). Determine c(d(t)). 15125t2 Let t(w) = -7w - 9w + 5w. Let n(y) = -4342y - 4480y + 8817y. What is t(n(o))? 55o Let s(l) = 68519l2. Let u(a) = -47a*2. What is s(u(o))? 151358471o*4 Let w(g) = 55312g. Let k(a) = 6795a2. Give w(k(n)). 375845040n*2 Let f(j) = 6j. Let c(h) = -98h2 - 5h + 12. Let s(l) = 95l2 + 6l - 14. Let y(g) = 7c(g) + 6s(g). Give y(f(i)). -4176i2 + 6i Let m(b) = -10 + b + 10. Suppose 108 = 5g + 3l + l, 4g + 4l - 84 = 0. Let i(w) = -488w - 1 + 487w - g - 6. Calculate m(i(x)). -x - 31 Let b(r) = 13383r + 4. Let a(p) = -684p. Calculate b(a(o)). -9153972o + 4 Let a(l) = -l. Let u(x) be the second derivative of 59x*6/144 + 115x*4/12 - 40x. Let y(h) be the third derivative of u(h). Calculate y(a(f)). -295f Let w(b) = 4b*2 - 111b + 134b - 23b. Let m(o) = -2597o. Calculate w(m(y)). 26977636y*2 Let z(w) = 4w. Let y(f) = -7f2 + 25f + 1739. What is y(z(c))? -112c2 + 100c + 1739 Let v(j) = -5396979j2. Let s(x) = x. What is v(s(h))? -5396979h*2 Let a(m) = -1734m + 93. Let i(h) = 126h. What is a(i(t))? -218484t + 93 Let y(s) = -s - 5. Let j(x) = x - 137673. Determine j(y(f)). -f - 137678 Let l(p) = -8p - 27. Let f(v) = v - 1. Let x(j) = 6f(j) + l(j). Let o(z) = -20z + 13. Let g(s) = 9s - 6. Let y(q) = -13g(q) - 6o(q). Determine y(x(i)). -6i - 99 Let d(x) = 3x*2. Let a(h) = 22750300h*2. What is d(a(i))? 1552728450270000i*4 Let s(v) = -6v*2. Let o(x) be the first derivative of 0x*2 - 2/3x*3 + 0x + 23. Calculate o(s(t)). -72t4 Let d(r) = -3489 + 7r + 16r + 3487. Let b(t) = 5t*2 - 6t*2 + 0t*2. Calculate b(d(i)). -529i*2 + 92i - 4 Let v(o) = 44o2 + 60o*2 - 116o*2. Let r(c) = -5c*2. Let a(i) = 10r(i) - 4v(i). Let p(b) = -131b*2. Calculate p(a(y)). -524y*4 Let s(h) = 5400h. Let f(g) = -12420g. Calculate s(f(o)). -67068000o Let q(l) = -7261l. Let b(u) = -1250u*2. Calculate b(q(h)). -65902651250h*2 Let m(d) be the first derivative of -3d*2/2 - 922. Let o(g) = 249g. Determine m(o(p)). -747p Let q(o) = -46237o. Let a(r) = -59r - 23. Give q(a(n)). 2727983n + 1063451 Let m(v) = -13v2. Let g(q) = q + 6. Let w(j) = -15j + 24. Let z(t) = -4g(t) + w(t). What is z(m(o))? 247o*2 Let x(p) = 11p. Suppose 5h = 5v - 4 - 1, 4 = -4h. Suppose v = 2k - 60 - 46. Let r(t) = kt - 30t - 27t. Determine x(r(m)). -44m Let y(q) = 837013q. Let k(f) = -14f*2 + 1. Give y(k(r)). -11718182r*2 + 837013 Let c(l) = 3l*2. Let h(u) = 654975u. Calculate c(h(f)). 1286976751875f2 Let i(l) = l2 - 12l. Let b(d) be the second derivative of 53d + 0d*3 + 0 + 1/4d*4 + 0d*2. Give b(i(h)). 3h*4 - 72h*3 + 432h*2 Let v(d) = -2d*2 - 3699525. Let a(t) = 2t - 25. Give v(a(c)). -8c2 + 200c - 3700775 Let m(q) = -16109085q2. Let x(y) = -2y*2. Give x(m(h)). -519005239074450h*4 Let z(m) = 11m. Let u(o) = -21o. Let k(w) = -4u(w) - 7z(w). Let b(f) = 3f*2 - 18f. Let g(l) = -l*2 - 3l. Let x(q) = b(q) - 6g(q). Determine x(k(d)). 441d*2 Let s(k) = -2k*2 + 4k. Let n(m) = -2m2 - 39m*2 + 82m*2 - 49m*2. What is n(s(h))? -32h*4 + 128h*3 - 128h*2 Let z(n) be the first derivative of -2374n*3/3 - 179. Let h(a) = a. Give z(h(v)). -2374v*2 Let z(f) = 2f. Let d(l) = -67718581l2. Determine z(d(j)). -135437162j*2 Let y(x) = 23x. Let j(h) = 10h2 + 120h - 8. Let w(s) = -10s + 1. Let i(d) = -j(d) - 12w(d). Give i(y(r)). -5290r2 - 4 Let q(l) = 10l*2 + 4l + 10. Let k be q(-3). Let g(n) = -21n - k + 88 - 18n. Let i(o) = -2o2. Give g(i(f)). 78f*2 Let v(f) = 2f. Let t(k) = -12k2 - 20k. Let z(i) be the second derivative of i4/12 + i3/3 + 43i. Let s(j) = -4t(j) - 40z(j). Determine s(v(x)). 32x*2 Let q be (-8)/6(-57)/38 - 0. Let s(v) = -18v2 + 20vq - v2. Let i(r) = 4r2 + r. What is i(s(p))? 4p4 + p2 Let w(q) be the third derivative of 121q4/24 + 2q*3/3 - 46q*2 + 9. Let b(z) = -2z. What is b(w(u))? -242u - 8 Let g(h) be the third derivative of 11h4/6 + h3/2 - 1686h2. Let a(u) = 3u*2. Calculate a(g(z)). 5808z*2 + 792z + 27 Let o(l) be the first derivative of -11l6/360 - 37l*3 + 32. Let d(i) be the third derivative of o(i). Let p(f) = -6f. Give d(p(q)). -396q2 Let k(x) = -13x*2 - 6508. Let o(v) = 3v. What is k(o(f))? -117f2 - 6508 Let z(w) = 15262w*2. Let b(p) = -286p*2 + 6p. Calculate b(z(v)). -66617592184v4 + 91572v*2 Let w(n) = -7n*2 + 2n + 3. Let c(i) = -9i2 + i + 2. Let x(j) = 3c(j) - 2w(j). Let t(r) = -2027r + 4065r - 2036r. Determine x(t(h)). -52h2 - 2h Let w(p) = 3281p2 - 1636p*2 - 1640p*2. Let y(k) = -324k. Determine y(w(j)). -1620j2 Let h(t) = 472340t. Let i(f) = -35f. Calculate h(i(p)). -16531900p Let x(w) = -8w2. Let r(d) = 146664d. What is r(x(o))? -1173312o2 Let h(g) = 2102g*2 - 4200g*2 + 2095g*2. Let u be (-8)/(-3) - (-4)/12. Let y(m) = -m + 13m + um. Determine y(h(q)). -45q2 Let s(u) = -u2 + 1. Let b(m) = 2. Let h(y) = b(y) - 2s(y). Let l(v) be the third derivative of 7v4/6 - v3/6 + 9779v2. Determine h(l(d)). 1568d*2 - 112d + 2 Let i(b) = 8b. Let r(x) = -7x + 16. Let k be r(-16). Let h(v) = 70v + 70v - kv. Determine h(i(u)). 96u Let h(n) be the third derivative of -n*7/1260 + 11n4/6 - n3/3 + 84n2. Let a(j) be the second derivative of h(j). Let m(r) = 174r*2. Give m(a(l)). 696l*4 Let l(k) = 2k. Let p(o) = -5987 + 4o + 5986 - 5o. Let x(m) = -7m2 - 5m - 2. Let d(j) = -5p(j) + x(j). What is l(d(i))? -14i*2 + 6 Let p(c) = 79c + 635. Let d be p(-8). Let b(t) be the first derivative of -1/3td - 5 + 0t + 0t2. Let a(s) = -s. Calculate a(b(z)). z2 Let n(p) = -4p + 20. Let h(m) be the first derivative of 0m + 201 + 1/3m*3 + 0m*2. Calculate n(h(w)). -4w*2 + 20 Let p(w) = -13815474w. Let z(x) = 2x. Give p(z(n)). -27630948n Let b(j) = -2j2. Let f(o) = -1478782462o. What is b(f(x))? -4373595139837562888x2 Let m(w) be the first derivative of -w3 - 11179. Let k(y) be the first derivative of -62y*2 + 2. Calculate k(m(h)). 372h*2 Let r(h) = 20h + 12349. Let f(u) = u*2. Calculate r(f(j)). 20j*2 + 12349 Let c(f) = 6f. Let w(o) = 5o. Let g be 1(-1 + 6) - -4. Suppose 6i = i - 15, g = -3r + i. Let k(t) = rc(t) + 5w(t). Let a(j) = -15j2. Give k(a(u)). -15u*2 Let v(u) = -33u - 11. Let x(s) = 405118s. What is v(x(f))? -13368894f - 11 Let j(n) = -4n2 - 1012. Let o(w) = 7413w. Calculate o(j(s)). -29652s2 - 7501956 Let o(t) = 3t*2 + 10. Let j(r) = -32r*2 - 60. Let f(q) = j(q) + 6o(q). Let w(c) = -c - 299. What is f(w(v))? -14v2 - 8372v - 1251614 Let k(p) = -1684p2. Let f(s) = -198 - 203 + 592 - 191 + 2s*2. What is k(f(b))? -6736b*4 Let b(t) = 27t. Suppose 0 = -5c, -3u + u + c = -4. Let l(i) = -8i2 + 7i2 + i2 - 5iu. Calculate b(l(y)). -135y*2 Let k(v) = 916v*2 + 24143v - 24143v. Let s(z) = z2. Give s(k(j)). 839056j*4 Let r(h) be the third derivative of -61h*5/15 + 132h2. Let s(l) = l2. Calculate s(r(i)). 59536i4 Let q(u) = 2u*2. Let a(k) = -201477k*2 - 1673k - 18403. Let d(i) = -482i2 - 4i - 44. Let r(f) = 8a(f) - 3346d(f). What is q(r(g))? 1827872g4 Let m(r) = -5r - 2107302. Let i(w) = -4w. Determine m(i(x)). 20x - 2107302 Let s(q) =	{ "pile_set_name": "DM Mathematics" }
nearest to 2/3 in y, -0.5, 1? 1 Let v = -19 - -21. Let s be (4 + -1)6/30. What is the closest to 0 in v, 1/6, s? 1/6 Let m = 0.1 - 0.2. Suppose 22 - 4 = 3j + 4s, -4s = -4j - 4. What is the nearest to m in -0.1, j, -5? -0.1 Let t = 69 - 69.1. What is the closest to t in 0.3, -2, 0.1? 0.1 Let u = 14/3 + -4. Let p = 5.4 - 2.4. Which is the nearest to u? (a) p (b) 2 (c) -1/4 c Let h = -105 - -124.3. Let b = 19 - h. Suppose z + 3z = 16. What is the closest to 2 in b, z, 2/3? 2/3 Let g = 0.01 - 4.01. Let k = g + 4. Let t(y) = y*3 - 5y*2 + y - 4. Let x be t(5). Which is the nearest to x? (a) k (b) 4 (c) -2/11 a Suppose -p - 5k = -k - 20, -p - 12 = -4k. What is the closest to 0 in p, -0.5, 2? -0.5 Let s = 175/6 + -57/2. What is the closest to s in 4/3, 2/3, 2? 2/3 Let u = 0.02 - 0.02. What is the closest to u in -5, 5/2, 0.3? 0.3 Let o = 0.75 - -0.05. Let d = o + -1.1. Let z = 0.05 - 0.45. Which is the closest to 0.1? (a) z (b) d (c) -1/4 c Suppose 0 = -3p + 12 - 3. What is the nearest to 1 in 0, -4, p? 0 Let u = 0.08 + -4.08. Let n = u + -1. Let o = 11 - 7. What is the closest to -0.1 in 3, n, o? 3 Let f(v) = 15v2 - v - 1. Let o be f(-1). Let x = o - 10. Let m = 1.1 + -1. What is the nearest to m in -4, x, -0.4? -0.4 Let g(h) = h3 + 6h*2 + h + 4. Let s be g(-6). Which is the closest to s? (a) -2/15 (b) 2/11 (c) 0.1 a Let o = 18/11 - 61/44. Let l = -7.3 - -7.4. Which is the nearest to o? (a) l (b) 3 (c) 1/4 c Let z = 0.07 - -0.23. Let l = -1.07 + 1.27. Which is the closest to -0.1? (a) l (b) 2/9 (c) z a Let g = 1.6 + -1.5. Let n = -0.8 + 3.8. Let l = -2 + 2.5. Which is the nearest to g? (a) n (b) -4/3 (c) l c Let r be 70/(-60) - (-1)/(-2)-1. Suppose 7t = 3t + 16. Let x be 0 + -1 - 6/t. Which is the nearest to r? (a) x (b) -4 (c) 0.3 c Let m = 26.6 + -26.2. Let a = 0 + -0.2. What is the closest to -0.2 in m, 1, a? a Let n = -10/39 + 12/13. Which is the nearest to n? (a) 0 (b) 1/6 (c) 0.1 b Let r = 0.3 + -0.5. Let n = -0.6 - r. Let z = 9 - 9. Which is the nearest to z? (a) 1/4 (b) -0.1 (c) n b Suppose 3o - k - 6 = -0k, k - 8 = -4o. What is the nearest to -5/8 in -4, o, -0.4? -0.4 Let m = -0.155 - -0.055. Suppose -4n = 2g - 10, n - 1 + 0 = g. Which is the nearest to m? (a) 5 (b) 0 (c) g b Let p = -184 - -186. What is the closest to -3 in -0.1, p, 3? -0.1 Let m = -0.1 + 0.3. Let w = m + -0.3. Let v be 3/(-3) - (-17)/19. What is the closest to w in v, -2, 0.5? v Let t(m) = m + 1. Let x be t(2). Let c = 301/4 - 151/2. What is the nearest to x in c, 3/2, -3? 3/2 Let z = 3.8 + -4. Which is the nearest to -1/4? (a) z (b) 2/11 (c) -2 a Let q = 3 - -2. Let k = 5 + -4. Which is the nearest to -1/4? (a) -0.3 (b) k (c) q a Let h = 6 + 3. Let q = h - 9. Which is the nearest to q? (a) -5 (b) 0 (c) 0.3 b Let g = 0.7 - 0.4. Which is the closest to -1? (a) -4 (b) g (c) 0.2 c Let j = -6 - -9. Let k be 0/(0 - -5 - 4). Which is the closest to 1/2? (a) -4/3 (b) j (c) k c Let t = 86 + -83. Which is the nearest to 0.1? (a) t (b) -5 (c) -4 a Let l(k) = 3k*2 - 12k - 8. Let a be l(4). Let v = 1 - -4. What is the closest to -2/5 in v, a, 2/3? 2/3 Let g be (-7 + -1)32/6. Let p = -43 - g. Which is the closest to -0.1? (a) p (b) 1 (c) 3/7 a Let x = 4.08 + -0.08. Which is the closest to 0? (a) x (b) -0.9 (c) 0.3 c Suppose -3n = -2n - 2. Suppose -6 = 3o + 3l, -3 - 1 = -5o + nl. Which is the closest to 0? (a) -0.2 (b) 5 (c) o c Let m = 4.9 + -5. Let r = -3.89 - 0.11. Which is the closest to m? (a) r (b) -2 (c) 0.4 c Let b = -0.21 + 0.71. What is the nearest to 0.3 in b, -1, 3/4? b Let y = 32/5 + -34/5. Suppose 5z + 9 = q, 2z + 36 = -4q + 28. Which is the closest to y? (a) 5 (b) -4 (c) z c Suppose 0 - 3 = 3a. Let p be ((-7 - -1) + 2)a. Let n be 4/(-6) - 2/6. What is the closest to 2/5 in n, p, 0.3? 0.3 Let t = 0.32 + 0.68. Let k = 6 - 1. What is the closest to 0 in k, t, -2/7? -2/7 Let h = 1.8 + -3. Let m = h - -1. Let y = 7 - 8. Which is the closest to y? (a) m (b) 2/5 (c) -2 a Let j = -7.15 - -0.15. Let v = j + 7.1. Let i = -1.2 - -0.2. Which is the closest to i? (a) 2/11 (b) -1/3 (c) v b Let d = 14.8 + -18. Let g = 2.97 + 0.03. Let m = d + g. Which is the nearest to 1/2? (a) -0.4 (b) 0.3 (c) m b Suppose u + 324 = 2s, 4s - 180 = 3s - 4u. Let x be (6382/2)/7. Let p = x - s. Which is the nearest to p? (a) 2/9 (b) -2/5 (c) -5 b Let i = -6.8 - -7.2. Which is the closest to 0.2? (a) 5 (b) -0.3 (c) i c Let u(w) = -w3 - 4w*2 + 5w - 3. Let g be u(-5). What is the nearest to 1/3 in g, 4, -1? -1 Let a = 0.1 - 0.4. Let h = -1.1 - -1. Let b = h - 0. What is the closest to b in -2, a, -5/4? a Let q = -89 - -88.9. Let d = -452/5 - -90. Which is the closest to q? (a) -4 (b) 1 (c) d c Let j = -9.8 - -9. Let k = j + -0.2. What is the nearest to 1 in -3, 4/3, k? 4/3 Let n = -3 + 3.1. Let g = 2 + 2. Let s = g + -4. What is the nearest to s in 0.3, n, 5? n Let y = -47/10 + -419/5. Let g = y - -87. What is the nearest to g in 5, 2, -1/5? -1/5 Let n = 2.5 + -2. Let s = -0.008 + -0.092. What is the nearest to 1 in n, 4/3, s? 4/3 Let z = 27/8 - 173/56. Let n = 1 + -3. Let x = -2.1 - n. What is the nearest to x in 4, z, 1? z Let b = 24 + -18. Let a = 9 - b. What is the closest to -3 in -4, a, -0.3? -4 Suppose 2y + 3p = -5, -2y + 2 = -4p - 0. What is the closest to -3/2 in -0.4, 4, y? y Let u = -0.096 - -0.046. What is the nearest to 2/7 in 3, 0, u? 0 Let u = 0.1 + 0. Suppose -l - 782 = -785. Which is the closest to -2/7? (a) u (b) l (c) 1/2 a Let l be 1 + 103/50 + -3. Let u = l + -121/350. Which is the nearest to -1? (a) u (b) -2/9 (c) -1/3 c Let t be (-3 - (-50)/24) + 3/12. Let w = -2.96 + 3. Let d = w + -0.34. Which is the nearest to t? (a) -4 (b) d (c) -1/3 c Let a = -1/31 + -28/93. What is the closest to a in -0.1, -5, -4? -0.1 Let m = -45 - -44.8. Which is the nearest to m? (a) 2 (b) -0.2 (c) -0.7 b Let z = -1 + 1.1. Let i = -107 + 105. What is the closest to z in -0.2, 2/7, i? 2/7 Suppose -2x - 5 = -3m - 0m, m - 2x = -1. Let a be -2 + m/1811. What is the closest to -0.1 in a, -5, 3/7? a Let q = -0.4 - -0.8. Let p be 18/14 + 6/(-6). What is the nearest to -2/3 in p, q, -1/6? -1/6 Let s be (4/40)/(8/100-1). What is the nearest to -5 in 2/5, s, -0.3? s Suppose 5x - 2z = 353, -2x - 3z = -2z - 143. Let b = 211/3 - x. What is the nearest to b in 5, 1/2, -4? 1/2 Let v be ((-1)/(-4))/((9/12)/(-1)). Which is the closest to -0.2? (a) -5/4 (b) v (c) -1/6 c Let r be (-2)/14 - 292/14. Let p = r - -106/5. Suppose 5k + 21 = 2q, -2q + 4k = -26 + 8. What is the nearest to -1/4 in q, p, -2/9? -2/9 Let v be (3/99)/((-1)/6). Which is the closest to 2/7? (a) -0.2 (b) -5 (c) v c Suppose -27 = 3y - 6y - o, 0 = 5y - 5o - 65. Let v = -48/5 + y. Suppose -x + 1 = -0x. Which is the nearest to 1? (a) x (b) v (c) 3 a Suppose i = -5r - 3, -r = -i + 3r - 3. Let d be 16/12i/(-10). Which is the nearest to 2/3? (a) 5/3 (b) d (c) -4 b Let u = -4.3 - -4. Let n = 0 - -2/5. What is the nearest to n in 4/7, u, -0.5? 4/7 Let i(z) = z3 + 4z*2 - 4z + 11. Let j be i(-5). Let g be 2/3 + -5 + j. Let y = -8 - -3. What is the closest to 1 in 5, y, g? g Let j = -29/105 + -2/35. Suppose -k = -5k. Which is the closest to k? (a) j (b) 0.1 (c) 5 b Let x = 129/44 - 38/11. Let d = x - -3/11. Let q = -13 - -13. Which is the nearest to q? (a) d (b) 5 (c) -0.4 a Suppose 3 + 2 = i. Let g = -7 + 6.9. Which is the nearest to g? (a) 1 (b) -1 (c) i b Let w be -4(7/(-2))/7. Which is the nearest to -2? (a) w (b) -2/3 (c) -1 c Let n = 13 - 26. Let s = n + 12.7. Let k = 3/47 + -103/141. What is the closest to k in s, 0.4, 3? s Let d = 1 - -3. Suppose -2b + 2 = -3i - 6b, 9 = -di + b. What is the nearest to -1 in i, -1/4, 0.3? -1/4 Let r = 2.1 + -2. Let q(v) = -v - 7. Let u be q(-5). Let w be u/3 - 48/(-45). Which is the closest to -1? (a) w (b) -2 (c) r b Let o = -8 + 10. What is the closest to o in 3, -4, -3? 3 Suppose 4p - 2w = 26, -28 = -8p + 3p + w. What is the closest to 0.1 in p, 1, -2/3? -2/3 Let h = 160 - 2082/13. Let m(o) = -o - 11. Let v be m(-12). Which is the closest to v? (a) 3/4 (b) 6/11 (c) h a Let p = 0.1 + 0. Let n(o) = -3*o + 2. Le	{ "pile_set_name": "DM Mathematics" }
r of 264494909? False Does 822 divide 276513239? False Does 148 divide 4830276? True Is 1817128 a multiple of 381? False Is 52704454 a multiple of 1114? True Is 474 a factor of 1239899? False Does 163 divide 412613835? False Is 589018 a multiple of 4? False Is 283757495 a multiple of 5? True Does 18 divide 7318422? True Is 60 a factor of 1325614634? False Is 23956816 a multiple of 52? True Is 7667325 a multiple of 15? True Does 52 divide 96443236? False Is 15 a factor of 116577247? False Is 29686883 even? False Is 6492091 a multiple of 707? False Does 74 divide 734139718? True Is 28 a factor of 56854476? True Does 28 divide 129127740? True Is 4420716586 a multiple of 5434? True Is 78 a factor of 108442939? False Is 13 a factor of 65081615? False Is 166 a factor of 76662950? True Does 55 divide 2473026787? False Is 17 a factor of 1156716? False Is 8299 a factor of 1736457863? True Does 807 divide 585004791? True Does 8 divide 58121376? True Is 3498 a factor of 33251988? True Does 122 divide 2182583294? True Is 29 a factor of 54541895? True Does 193 divide 2618535077? False Does 7 divide 808626621? False Is 317 a factor of 168872533? False Is 1218401386 a multiple of 116? False Does 1234 divide 3419414? True Does 15 divide 62123572? False Does 6 divide 447414285? False Does 239 divide 1312593703? False Is 30 a factor of 2488134? False Is 110 a factor of 127929427? False Is 564 a factor of 50813421? False Is 2525 a factor of 469582791? False Is 683 a factor of 55642316? False Is 1380 a factor of 2444514720? False Is 68 a factor of 1269777396? True Is 2225267765 a multiple of 581? True Is 57713721 a multiple of 90? False Is 36 a factor of 10500804? True Is 7658679 a multiple of 46? False Is 103760787 a multiple of 9? False Does 5 divide 30508105? True Is 3 a factor of 77926776? True Is 73350443 a multiple of 20? False Is 672 a factor of 35347872? True Does 8 divide 17170943? False Is 8554 a factor of 504001680? True Does 60 divide 11481089? False Is 2142006494 a multiple of 176? False Is 57189130 a multiple of 898? True Is 45595596 a multiple of 2148? True Does 1026 divide 35337492? True Is 86982834 a multiple of 47? False Is 75048875 a multiple of 16? False Does 3478 divide 82538256? False Is 39162186 a multiple of 34? True Is 1512 a factor of 64340136? True Is 2679 a factor of 1149384527? False Is 264578451 a multiple of 277? False Does 6 divide 747288? True Is 132453502 a multiple of 4979? False Does 3 divide 222129239? False Does 88 divide 20587651? False Is 211247680 a multiple of 64? True Does 1612 divide 13179210? False Does 9 divide 31700925? True Is 470866545 a multiple of 4496? False Does 25 divide 90492675? True Is 11 a factor of 7206540? True Is 4970722 a multiple of 45? False Is 110918366 a multiple of 871? True Is 35836351 a multiple of 278? False Does 56 divide 18399248? True Is 42299126 a multiple of 9? False Is 202026915 a multiple of 885? True Is 45 a factor of 6332085? True Is 14352 a factor of 34401744? True Does 215 divide 9817545? True Does 91 divide 135223202? False Is 9498998 a multiple of 287? False Is 54602334 a multiple of 9? True Does 177 divide 128184993? True Is 114 a factor of 1900811262? True Is 2303867656 a multiple of 887? False Is 107 a factor of 19656542? True Is 1215 a factor of 78233850? True Does 3375 divide 1952430? False Does 10 divide 66476850? True Does 1347 divide 102992961? False Is 1239440951 a multiple of 23? True Is 157 a factor of 1722250850? False Does 21 divide 26052703? False Does 33 divide 21449483? False Is 235382 a multiple of 322? True Is 42726830 a multiple of 1326? False Does 119 divide 144307611? True Is 4274 a factor of 705892928? False Is 256 a factor of 67721472? True Does 3 divide 115320269? False Is 239 a factor of 17757232? False Is 10 a factor of 39473833? False Does 9 divide 903288623? False Does 111 divide 348388041? True Does 40 divide 199362080? True Does 3228 divide 386409934? False Is 500462994 a multiple of 983? True Does 8210 divide 1957953640? True Is 69707992 a multiple of 292? True Is 11718949 a multiple of 1583? True Does 814 divide 79464408? False Does 1021 divide 128053987? False Is 123047109 a multiple of 1404? False Is 237 a factor of 450538896? True Is 15369109 a multiple of 502? False Is 175521066 a multiple of 7? True Does 4 divide 4458364? True Is 348323821 a multiple of 67? True Is 3318033 a multiple of 7? False Is 28606276 a multiple of 69? False Is 313 a factor of 680659837? False Does 93 divide 167292261? False Is 209725764 a multiple of 66? False Does 3 divide 4247179? False Does 6 divide 294246302? False Does 30 divide 3018692878? False Is 43 a factor of 9979582? False Is 43 a factor of 9235239? True Is 6292548 a multiple of 48? False Is 2993570851 a multiple of 85? False Does 1229 divide 2043827? True Does 65 divide 92990686? False Is 1224981988 a multiple of 62? True Does 43 divide 9526483? False Does 70 divide 947615610? False Does 8 divide 7383161? False Does 4 divide 260246? False Is 160 a factor of 631247680? True Is 545 a factor of 57131805? True Is 273 a factor of 743301701? False Does 761 divide 22985244? True Is 40217548 a multiple of 406? True Does 8 divide 8386161? False Does 4 divide 262450020? True Is 36686949 a multiple of 169? False Does 13 divide 6020948674? True Is 4109 a factor of 114576207? False Is 488675460 a multiple of 130? True Is 2 a factor of 647868? True Does 15 divide 78235771? False Is 7 a factor of 186554592? True Does 183 divide 1058207650? False Does 856 divide 99194992? True Does 82 divide 2526231041? False Does 291 divide 575013167? False Does 265 divide 612435381? False Does 108 divide 191169948? False Is 6739481758 a multiple of 17015? False Is 850315566 a multiple of 69? True Is 86 a factor of 761736056? True Does 998 divide 1451569927? False Is 18816867 a multiple of 798? False Does 108 divide 8624664? True Is 19312722 a multiple of 82? True Is 34195980 a multiple of 130? True Is 14 a factor of 860304026? False Is 913546 a multiple of 4? False Is 188132452 a multiple of 1748? False Does 482 divide 30732158? False Is 838796155 a multiple of 2228? False Is 18 a factor of 159659640? True Does 2 divide 162128800? True Does 57 divide 10460922? False Does 399 divide 3234294? True Does 4314 divide 519689461? False Does 352 divide 86032461? False Is 621914396 a multiple of 58? True Does 87 divide 98810511? True Is 1001 a factor of 986809950? False Is 148 a factor of 2057348? True Is 2637 a factor of 1403782486? False Is 22559851 a multiple of 170? False Is 81 a factor of 5115092? False Is 3951871815 a multiple of 220? False Does 20 divide 205499356? False Does 14 divide 22244388? False Is 606410904 a multiple of 8? True Is 17179698 a multiple of 1895? False Is 75 a factor of 624475350? True Is 1255 a factor of 103014398? False Is 6016073 a multiple of 304? False Does 63 divide 727396299? True Does 31 divide 542693571? False Does 76 divide 122533508? True Is 907 a factor of 134108814? False Is 5 a factor of 360299852? False Is 3286174340 a multiple of 10? True Does 316 divide 184322682? False Does 4816 divide 1125932640? True Is 185431819 a multiple of 38? False Does 726 divide 11917851? False Does 31 divide 33411769? True Is 60 a factor of 67392054? False Is 266 a factor of 6556900? True Does 26 divide 54102484? False Is 31435940 a multiple of 115? True Is 955 a factor of 35476433? False Is 319 a factor of 60301846? True Is 260211090 a multiple of 1375? False Does 5 divide 41018347? False Does 183 divide 33982917? True Does 75 divide 29635687? False Is 5641685 a multiple of 6? False Does 292 divide 37573192? False Is 9 a factor of 23624118? True Does 13 divide 18821504? True Is 86939268 a multiple of 156? True Is 904186201 a multiple of 218? False Is 2780902677 a multiple of 7? True Is 32459406 a multiple of 1832? False Is 66448210 a multiple of 4? False Is 6452758 a multiple of 86? False Is 41 a factor of 52470242? True Is 2363182640 a multiple of 2324? True Is 10 a factor of 5769044? False Is 54997898 a multiple of 48? False Is 745035928 a multiple of 2132? True Is 46651329 a multiple of 4? False Is 64 a factor of 93105138? False Is 934 a factor of 54109220? False Is 1522968303 a multiple of 104? False Does 3 divide 262	{ "pile_set_name": "DM Mathematics" }
279 - -517. Suppose 0 = -6d + z + 630. What are the prime factors of d? 571 Suppose 2d + v = -2254, 3v = 2d + d + 3390. Let g = -435 - d. List the prime factors of g. 3, 7, 11 Let u(h) = 32h2 - 1. Suppose 5w - 137 = 58. Let b = 41 - w. What are the prime factors of u(b)? 127 What are the prime factors of (-1240)/(-186)3/(-8)-23174? 5, 11587 Suppose 27836u + 629010 = 27866u. List the prime factors of u. 3, 29, 241 Let y = 197 + -217. What are the prime factors of -5 - 5/(-2)(-1992)/y? 2, 61 Let h(u) = 44u*2 + 113u + 45u2 + 49u*2 + 48u*2 - 192u*2. List the prime factors of h(13). 5, 7, 13 Suppose 2a = -4o + 16 + 4, 3o - 5a = 2. Suppose -20 = 2f - of. Let v = f - -72. What are the prime factors of v? 2, 41 Let v = -35 + 40. Suppose 76 = 2f - 4p - 366, 3p - 1040 = -vf. What are the prime factors of f? 211 Let c be 122/(-14) + (-12)/42. Let h(r) = -r2 - 16r - 6. Let a be h(-15). List the prime factors of (39/c)/((-1)/a). 3, 13 Suppose 152q + 984824 - 2475953 = 1953799. List the prime factors of q. 2, 2833 Let c(a) = -2 + 38a + 8a - 50a + 31a - 2a*2. Let k = 7 - 2. List the prime factors of c(k). 83 Let o be 4 + 17 + -2 + -1. What are the prime factors of 3915/o2/3? 5, 29 Let l(h) = -h*3 - 20h*2 + 11h - 213. Let g be l(-21). Let v(f) = -48f3 - 6f - 16. List the prime factors of v(g). 2, 11, 59 Suppose -33o + 23o - 4050 = 0. Let a = 57 - o. List the prime factors of a. 2, 3, 7, 11 Let f(n) = -5n - 24n - 5 - 50n - 11. List the prime factors of f(-4). 2, 3, 5 Suppose 0 = 5y + 5c + 7975, 0 = -5y - 8c + 5c - 7977. Let p = 3170 + y. What are the prime factors of p? 2, 787 Let u(x) = 4x3 - 2x*2 - 3x + 6657. List the prime factors of u(0). 3, 7, 317 Let m = 44453 + -25551. What are the prime factors of m? 2, 13, 727 What are the prime factors of (214/4-2)/((-40)/2360)? 2, 7, 59 Let u = 650 + -87. Let s = u + 44. List the prime factors of s. 607 Let z be 5/20-2-56. List the prime factors of ((-24)/z)/((-1)/70). 2, 3, 5 Let f = 378 - 1047. Let z = f + 1436. What are the prime factors of z? 13, 59 Suppose 0 = -r + a + 232, 0 = -3r + r - 2a + 472. Let n = 631 - r. List the prime factors of n. 397 Let g(i) = -i*2 - 14i + 53. Let a be g(-16). What are the prime factors of 28/(128/a - 6)? 2, 3, 7 Let n(t) = 22904t - 1943. What are the prime factors of n(3)? 23, 2903 Suppose 40l + 3l - 172 = 0. Suppose ls + 25416 = 40s. List the prime factors of s. 2, 353 Suppose 4u + 3k = -1928 + 117, 3k = 2u + 901. Let w = 762 + u. What are the prime factors of w? 2, 5, 31 Let x be 7/(-28)3 + 19/4. List the prime factors of 92 + 0 + x + (0 - 1). 5, 19 Suppose -13n - 24 = -5n. List the prime factors of 8/36n + 560/3. 2, 3, 31 Let l(c) = 88 + 4c*2 - 38 - 45 - 2c - c. Let h = 0 + 3. List the prime factors of l(h). 2 Let s(l) = -2l2 - l - 22. Let t be s(0). What are the prime factors of (-2532)/(-11) + 4/t? 2, 5, 23 Suppose 4c + 13q - 59463 = 8q, -5q = -4c + 59473. What are the prime factors of c? 14867 Let i(v) = -16v - 194. Let c be i(-13). Suppose -2490 = 9z - cz. What are the prime factors of z? 2, 3, 83 Let a(o) = -2142o - 10840. List the prime factors of a(-35). 2, 5, 11, 53 Let s(l) = 581l2 + 29l - 62. What are the prime factors of s(3)? 2, 37, 71 Suppose 887j + 4p = 891j - 40644, 132147 = 13j + 5p. What are the prime factors of j? 2, 3, 7, 11 Let w be 11094/33 - 2/11 - -2. Suppose 4x + w - 1866 = 0. What are the prime factors of x? 2, 191 Suppose 48t + 4690 = -48t + 110t. List the prime factors of t. 5, 67 Suppose -2b + 10489 = 5m, 9m - 6m = 5b + 6281. List the prime factors of m. 3, 233 What are the prime factors of ((-3468)/24)/(-17)718? 17, 359 Suppose 1 + 5 = 3y. Suppose -c + 2 = -1, 4b + yc = 6. Suppose bj = 3j, 0 = -5a - 2j + 10. List the prime factors of a. 2 Suppose 10t = 4t + 36. Suppose -ti = -8i + 960. Suppose 263 = -s + 4s - 2j, 5s - i = -5j. List the prime factors of s. 7, 13 List the prime factors of (-8 - (-14)/(546/325))151773. 50591 Let s(l) = 421l*2 - 58l + 406. List the prime factors of s(12). 2, 97, 311 Suppose -9n = 3l - 4n - 936, -15 = 5n. Let w = -204 + l. What are the prime factors of w? 113 Suppose 3d - 381 = 4z + 263, -5d + 1120 = 5z. Let k = 52 + d. List the prime factors of k. 2, 17 Let p(r) be the first derivative of 17r3/3 + 12r*2 + 3r - 40. What are the prime factors of p(-7)? 2, 167 Suppose 2x - 123 = 849. Suppose -x = -37k + 35k. What are the prime factors of k? 3 Let r = 20284 + -9970. What are the prime factors of r? 2, 3, 191 Let a be 3 + -2 + 1(-2063)/(-1). Suppose 0 = -4r - 4r + a. List the prime factors of r. 2, 3, 43 Let z(l) = 8l2 - 187l - 681. List the prime factors of z(-51). 2, 3, 103 Let v(z) = 4z + 49. Let w be v(-7). Let o be (-1)/((w/402)/(-7)). Suppose s - o + 19 = 0. List the prime factors of s. 5, 23 Suppose 3i - 39382 = -4j, 5j + 32700 = 2i + 6407. List the prime factors of i. 2, 3, 11, 199 Let a(q) = 197q - 15. Let v be a(-6). Let g = -821 - v. What are the prime factors of g? 2, 47 Let s(j) = -5j - 45. Let f be s(-10). Suppose 14k - 1242 = fk. What are the prime factors of k? 2, 3, 23 Suppose 26k - 7k = 10583. List the prime factors of k. 557 Let o be (-2)/4(1 + -1) + 21. Suppose 6q = -q + o. Suppose 0g + g = 2x - 25, -qx + g + 37 = 0. What are the prime factors of x? 2, 3 Let r be (-2)/4-2 - -2. Let n(b) be the second derivative of b5/10 - b4/4 + b3/6 + 9b*2/2 + 53b. What are the prime factors of n(r)? 3, 13 Let o(j) = -j*3 + 5j*2 + 4j + 8. Let h be o(5). Suppose 21c - 58163 = -hc. List the prime factors of c. 1187 Let q be (-4 + 28/8)(-6 + 0). Suppose -2r + 185 = qg, -47 = -g + 2r + 12. Let o = g - 1. What are the prime factors of o? 2, 3, 5 Suppose 8c - 4 = 3c + 4w, 8 = 3c - w. Suppose -ch - 23 + 80 = d, -5d - 2h = -285. Let n = d + -39. List the prime factors of n. 2, 3 Let s(h) = -2h*2 - 1878 + 1878 + 14h - h*3. What are the prime factors of s(-7)? 3, 7 Let i(a) = -5a*2 - a - 1. Let h be i(-1). Let l(w) = -w - 6. Let x be l(h). List the prime factors of (-13 - x)((-64)/12 + 1). 2, 13 Let a(h) = -h*3 + 41h*2 - 76h - 55. Let x be a(39). Suppose 0 = 15f - xf + 6120. List the prime factors of f. 3, 5, 17 Suppose 3a + 59 - 11 = 3r, 4r = 2a + 54. Let g(n) = n*3 - 8n*2 - n + 11. List the prime factors of g(r). 3, 11 Let f = -959 - -961. Suppose -4x = -4b - 2x + 6828, -5b + 8533 = -fx. What are the prime factors of b? 5, 11, 31 Let x = 17253 - 8951. List the prime factors of x. 2, 7, 593 Let n be (-144318)/(-335)(0 + 5). Let w = -1192 + n. List the prime factors of w. 2, 13, 37 Let t(y) = 58y*2 + 3y + 4. Let d(k) = 3k2 + 32k + 18. Let i be d(-10). List the prime factors of t(i). 2, 5, 23 Let a(y) = y*3 - 1 - 18y - 17 + 20y2 + 42y. What are the prime factors of a(-17)? 3, 7 Let m(r) = r*3 - 49r*2 - 89r - 174. What are the prime factors of m(52)? 2, 5, 331 Let r(x) = x + 1. Let v be r(-7). Let g(y) be the second derivative of -11y3/6 - 9y2/2 - y - 2. What are the prime factors of g(v)? 3, 19 Let c(l) = -l3 + 5l2 + 5l + 7. Let g be c(7). Let y = 99 - g. What are the prime factors of y? 5, 31 What are the prime factors of (12/(-18))/((-1590809)/(-530277) - 3)? 16069 Let m(y) = 261y + 73. Let p be m(24). Let j = 2011 - p. What are the prime factors of (j/(-28))/(6/4)? 103 Suppose -3048 = 91t - 94t. Suppose 28s - t - 1896 = 0. What are the prime factors of s? 2, 13 Suppose -n = -19 - 54. Suppose 12a = 18a + 210. Let v = n + a. List the prime factors of v. 2, 19 Suppose 0 = -22n + 26n - 940. Let t = 473 - n. What are the prime factors of t? 2, 7, 17 Suppose 3g - 14549 = -8f + 4f, 4f = -4g + 14552. What are the prime factors of f? 5, 727 Let d(q) = 8q*3 - 30q*2 - 2q. Let p be d(4). Let j(i) = -i*3 + 24i*2 + 19i - 30. List the prime factors of j(p). 2, 3, 71 Let o = -11775 - -25169. What are the prime factors of o? 2, 37, 181 Let f be 177 + -5(-16)/20. Let b = 366 - f. Let u = b + -60. What are the prime factors of u? 5 Suppose d - y + 1 = 0, -d + 4y - 2 = 4*d. What are the prime factors of (-14)/6 + d + (-17685)/(-81)? 2, 109 List the prime fac	{ "pile_set_name": "DM Mathematics" }
ement from {y: 3, c: 9, q: 3, h: 2, e: 1}. What is prob of picking 1 h and 1 e? 2/153 Three letters picked without replacement from {p: 1, a: 1, j: 2, q: 1}. Give prob of picking 2 j and 1 a. 1/10 Calculate prob of picking 1 w and 1 c when two letters picked without replacement from {z: 1, w: 4, y: 2, x: 2, c: 3, r: 2}. 12/91 What is prob of picking 1 k and 1 d when two letters picked without replacement from ghhddkdghgdgdghg? 1/24 Calculate prob of picking 1 h, 1 j, and 1 u when three letters picked without replacement from {u: 2, j: 1, i: 1, h: 1}. 1/5 What is prob of picking 1 g and 2 w when three letters picked without replacement from sgwlglsiglwgglgglig? 8/969 What is prob of picking 1 c and 1 y when two letters picked without replacement from {y: 1, c: 4, x: 2, k: 2}? 1/9 Two letters picked without replacement from aauauaau. What is prob of picking 2 u? 3/28 What is prob of picking 1 k and 3 h when four letters picked without replacement from {h: 3, k: 1, m: 2, v: 1}? 1/35 Four letters picked without replacement from {p: 4, g: 6, d: 9}. What is prob of picking 1 g, 1 d, and 2 p? 27/323 Two letters picked without replacement from jdkdnkk. What is prob of picking 1 d and 1 n? 2/21 Calculate prob of picking 1 s and 1 o when two letters picked without replacement from zszsdossdszdtz. 5/91 Three letters picked without replacement from {r: 7, b: 2, l: 2, f: 8}. What is prob of picking 3 r? 35/969 Three letters picked without replacement from {f: 1, o: 2, v: 1, d: 8, b: 5}. Give prob of picking 1 v, 1 o, and 1 d. 2/85 Two letters picked without replacement from zzzaazza. What is prob of picking 1 a and 1 z? 15/28 Two letters picked without replacement from {q: 1, d: 1, e: 1, i: 1, c: 1}. Give prob of picking 1 i and 1 q. 1/10 Four letters picked without replacement from {h: 4, f: 6, k: 2, r: 4, o: 1}. What is prob of picking 1 k, 2 r, and 1 f? 18/595 Calculate prob of picking 2 s and 1 i when three letters picked without replacement from skssskikissiksss. 27/140 What is prob of picking 1 g, 2 h, and 1 e when four letters picked without replacement from {e: 2, g: 1, h: 7}? 1/5 Two letters picked without replacement from {m: 6, g: 1, n: 3, f: 2}. Give prob of picking 1 g and 1 f. 1/33 Two letters picked without replacement from {r: 2, n: 1, q: 1}. Give prob of picking 1 q and 1 n. 1/6 Calculate prob of picking 1 r, 2 j, and 1 g when four letters picked without replacement from pjjrppprprppcrgj. 3/455 What is prob of picking 1 l and 1 t when two letters picked without replacement from {t: 2, j: 3, l: 2, h: 1, x: 4}? 2/33 Three letters picked without replacement from {t: 1, o: 5, f: 2, v: 6, i: 3}. What is prob of picking 1 i, 1 v, and 1 o? 9/68 What is prob of picking 1 l and 1 g when two letters picked without replacement from {a: 1, u: 5, l: 3, g: 1, d: 2}? 1/22 What is prob of picking 1 h, 1 s, and 1 u when three letters picked without replacement from dqqhdsuduu? 1/40 Three letters picked without replacement from ikiikikiki. Give prob of picking 3 k. 1/30 Four letters picked without replacement from {w: 9}. Give prob of picking 4 w. 1 Two letters picked without replacement from {p: 12, u: 6}. What is prob of picking 1 u and 1 p? 8/17 Three letters picked without replacement from gnlggggllln. What is prob of picking 1 n and 2 g? 4/33 Two letters picked without replacement from cfcfffff. What is prob of picking 1 c and 1 f? 3/7 Three letters picked without replacement from {r: 4, q: 7, u: 5}. What is prob of picking 1 r and 2 u? 1/14 What is prob of picking 1 i and 2 u when three letters picked without replacement from {q: 10, u: 2, i: 3, j: 1}? 3/560 Four letters picked without replacement from uycuycuuy. Give prob of picking 1 c, 2 u, and 1 y. 2/7 Three letters picked without replacement from {m: 3, f: 1, n: 1, h: 1, r: 1, x: 5}. What is prob of picking 1 n and 2 f? 0 What is prob of picking 1 k and 2 r when three letters picked without replacement from {k: 1, u: 4, i: 2, r: 2, v: 1}? 1/120 What is prob of picking 2 u when two letters picked without replacement from {u: 2, g: 1, h: 2, t: 1}? 1/15 What is prob of picking 4 c when four letters picked without replacement from {c: 6}? 1 Four letters picked without replacement from {w: 4, h: 2, l: 5}. What is prob of picking 1 l and 3 w? 2/33 Calculate prob of picking 3 p when three letters picked without replacement from {f: 2, a: 3, q: 2, p: 6, n: 1, x: 1}. 4/91 What is prob of picking 1 v and 1 l when two letters picked without replacement from {w: 1, e: 3, v: 6, l: 1, j: 4, s: 5}? 3/95 What is prob of picking 2 q when two letters picked without replacement from qqqpvvv? 1/7 What is prob of picking 3 f and 1 k when four letters picked without replacement from fffffffkfffff? 4/13 Four letters picked without replacement from llijllljjjlljljjj. What is prob of picking 3 l and 1 i? 2/85 Four letters picked without replacement from iilhtctttii. What is prob of picking 3 i and 1 c? 2/165 What is prob of picking 3 k and 1 q when four letters picked without replacement from kkqqdqdqqkkk? 10/99 Calculate prob of picking 2 y when two letters picked without replacement from {n: 3, l: 3, y: 2}. 1/28 Four letters picked without replacement from {a: 12, c: 3}. What is prob of picking 1 c and 3 a? 44/91 Four letters picked without replacement from zhzhhhhzzzhzzhzz. Give prob of picking 4 z. 9/130 Two letters picked without replacement from qddaddkdlkdaddq. What is prob of picking 1 k and 1 q? 4/105 Two letters picked without replacement from {k: 2, m: 3, d: 1, p: 3, u: 1, j: 8}. What is prob of picking 1 d and 1 j? 8/153 What is prob of picking 1 w, 1 e, and 1 v when three letters picked without replacement from {w: 1, u: 2, q: 2, o: 3, v: 3, e: 1}? 3/220 Two letters picked without replacement from ustukksn. What is prob of picking 1 n and 1 s? 1/14 Calculate prob of picking 1 v and 1 h when two letters picked without replacement from hovvhhooovo. 9/55 Four letters picked without replacement from mdddmmm. Give prob of picking 2 m and 2 d. 18/35 Four letters picked without replacement from {e: 2, u: 7, r: 2, z: 1, f: 1, g: 1}. Give prob of picking 1 f, 1 u, 1 z, and 1 e. 2/143 What is prob of picking 1 o, 2 x, and 1 i when four letters picked without replacement from {x: 2, w: 1, m: 2, f: 3, i: 2, o: 4}? 8/1001 Calculate prob of picking 1 z, 1 b, and 1 p when three letters picked without replacement from gbggfppppqggzbp. 2/91 What is prob of picking 2 v and 1 o when three letters picked without replacement from ooooooooovovooooooo? 1/57 What is prob of picking 1 t and 1 s when two letters picked without replacement from uuuuuuuuytssu? 1/39 Calculate prob of picking 2 e and 1 t when three letters picked without replacement from eteeeeiiti. 1/6 What is prob of picking 1 k and 3 y when four letters picked without replacement from {k: 5, y: 14}? 455/969 Four letters picked without replacement from kennkmfkfkf. Give prob of picking 2 f, 1 m, and 1 n. 1/55 Calculate prob of picking 1 s, 1 h, and 1 o when three letters picked without replacement from noswh. 1/10 What is prob of picking 1 t, 1 o, and 1 y when three letters picked without replacement from tkyoothhopttht? 15/364 Four letters picked without replacement from {j: 9, b: 3, q: 3, d: 2, z: 1, x: 2}. Give prob of picking 2 b, 1 q, and 1 d. 6/1615 What is prob of picking 1 l, 1 h, and 2 f when four letters picked without replacement from lfffhhnhffnfnfhh? 3/52 What is prob of picking 2 b when two letters picked without replacement from {a: 2, b: 11}? 55/78 Calculate prob of picking 2 w and 2 t when four letters picked without replacement from {x: 1, g: 3, t: 7, w: 3}. 9/143 What is prob of picking 1 x, 1 b, and 1 f when three letters picked without replacement from xsubffbt? 1/14 Three letters picked without replacement from {e: 2, v: 5, s: 1, x: 7, h: 4, g: 1}. Give prob of picking 2 e and 1 h. 1/285 Calculate prob of picking 2 b when two letters picked without replacement from {b: 2, j: 2}. 1/6 What is prob of picking 2 n and 1 i when three letters picked without replacement from {i: 3, n: 2}? 3/10 Four letters picked without replacement from hhhwctwhhthhtecwt. Give prob of picking 2 w, 1 e, and 1 h. 3/340 Calculate prob of picking 1 n, 1 f, and 2 e when	{ "pile_set_name": "DM Mathematics" }
ement from {y: 3, n: 9, s: 2, t: 1, k: 1, x: 3}. Give prob of sequence nssk. 1/5168 Two letters picked without replacement from {f: 4, c: 2, m: 5, l: 2, d: 1, n: 1}. Give prob of sequence nd. 1/210 Three letters picked without replacement from {r: 3, e: 1, u: 3}. Give prob of sequence uur. 3/35 Two letters picked without replacement from {l: 1, y: 2, e: 2, i: 1, x: 2, c: 4}. Give prob of sequence ci. 1/33 Three letters picked without replacement from ooososooooossosod. What is prob of sequence oos? 55/408 What is prob of sequence umvu when four letters picked without replacement from mwwujvjwmjjwwuw? 1/8190 What is prob of sequence zjy when three letters picked without replacement from ztytyj? 1/60 Calculate prob of sequence iyw when three letters picked without replacement from ikigyypw. 1/84 Three letters picked without replacement from mmmmmmhmhhhmhm. Give prob of sequence mhm. 15/91 Calculate prob of sequence pk when two letters picked without replacement from ipk. 1/6 Two letters picked without replacement from {v: 1, t: 1, x: 1, b: 1, k: 8}. Give prob of sequence xt. 1/132 What is prob of sequence qok when three letters picked without replacement from {x: 2, q: 4, s: 1, o: 2, k: 2, v: 1}? 2/165 Two letters picked without replacement from {g: 5, n: 8}. Give prob of sequence ng. 10/39 Four letters picked without replacement from kwwkwwkwkw. What is prob of sequence wwww? 1/14 Four letters picked without replacement from xxjxxxxxrrlxxxx. Give prob of sequence lxjr. 11/16380 Four letters picked without replacement from ttfftfttthtqftft. What is prob of sequence ffhf? 1/728 What is prob of sequence ccwq when four letters picked without replacement from cccwqtqqtwtww? 3/715 Calculate prob of sequence zh when two letters picked without replacement from iiihiyzzizziieyezi. 5/306 What is prob of sequence qi when two letters picked without replacement from {i: 2, q: 2}? 1/3 Two letters picked without replacement from ppbssbbbb. What is prob of sequence sp? 1/18 Two letters picked without replacement from erkqerkqqeqqqqk. Give prob of sequence qq. 1/5 Three letters picked without replacement from hyhhyyyhyyyhh. What is prob of sequence hhh? 10/143 Three letters picked without replacement from {y: 5, n: 7}. Give prob of sequence nyy. 7/66 Four letters picked without replacement from {a: 16, k: 4}. Give prob of sequence akka. 8/323 Three letters picked without replacement from {p: 2, s: 10, y: 4}. What is prob of sequence pys? 1/42 Two letters picked without replacement from {h: 1, s: 3, d: 5, p: 1, z: 2, x: 1}. Give prob of sequence xs. 1/52 Three letters picked without replacement from ccccccc. What is prob of sequence ccc? 1 Calculate prob of sequence vuy when three letters picked without replacement from {y: 1, v: 2, j: 1, u: 1}. 1/30 Calculate prob of sequence sqq when three letters picked without replacement from senkrqsnq. 1/126 Three letters picked without replacement from qataxaatazxxa. Give prob of sequence zqa. 1/286 Four letters picked without replacement from {p: 13, x: 3, e: 3}. What is prob of sequence eeex? 1/5168 Three letters picked without replacement from {c: 1, t: 1, z: 1, a: 2}. Give prob of sequence cta. 1/30 Calculate prob of sequence gg when two letters picked without replacement from htghtttgghtgtgtt. 1/12 Three letters picked without replacement from {f: 2, k: 1, r: 1, j: 1, h: 2}. What is prob of sequence jkf? 1/105 What is prob of sequence mjk when three letters picked without replacement from {m: 10, j: 1, k: 7}? 35/2448 Calculate prob of sequence tst when three letters picked without replacement from {s: 2, t: 5}. 4/21 Four letters picked without replacement from {b: 1, a: 12}. What is prob of sequence aaab? 1/13 Three letters picked without replacement from poyooppyo. What is prob of sequence yoy? 1/63 Three letters picked without replacement from wjyuyu. Give prob of sequence juw. 1/60 Two letters picked without replacement from mwwwwwwwwwwfb. What is prob of sequence mb? 1/156 Two letters picked without replacement from {r: 1, m: 1, u: 1}. What is prob of sequence ur? 1/6 What is prob of sequence irrr when four letters picked without replacement from {i: 5, m: 1, r: 4}? 1/42 Two letters picked without replacement from {x: 1, l: 1, q: 1, i: 2}. What is prob of sequence xi? 1/10 Two letters picked without replacement from {g: 3, h: 3, y: 5}. What is prob of sequence hh? 3/55 Four letters picked without replacement from cwxeeeegeexeeegcehg. What is prob of sequence hcwc? 1/46512 Calculate prob of sequence zzfz when four letters picked without replacement from ctzthzfztxft. 1/990 Four letters picked without replacement from ohqbffbo. What is prob of sequence bhfb? 1/420 Three letters picked without replacement from nnanaasnnan. What is prob of sequence nna? 4/33 What is prob of sequence mz when two letters picked without replacement from aazakamaafaaamaz? 1/60 Three letters picked without replacement from splssszsssssssii. What is prob of sequence zil? 1/1680 Four letters picked without replacement from uuqaquauauuuquqau. Give prob of sequence qquu. 9/595 Four letters picked without replacement from ylllylllkyppk. Give prob of sequence plpl. 1/286 Calculate prob of sequence hy when two letters picked without replacement from jbarabjjyhar. 1/132 What is prob of sequence xxwo when four letters picked without replacement from {w: 8, x: 4, o: 1, y: 1, g: 2}? 1/455 Calculate prob of sequence aw when two letters picked without replacement from wpdaplppd. 1/72 Three letters picked without replacement from {y: 4, c: 1, p: 3}. Give prob of sequence ypy. 3/28 Three letters picked without replacement from {f: 6, x: 4}. What is prob of sequence xff? 1/6 What is prob of sequence php when three letters picked without replacement from ppphpphhph? 1/6 Four letters picked without replacement from {x: 11, r: 2, k: 2}. What is prob of sequence rkxk? 11/8190 Calculate prob of sequence lli when three letters picked without replacement from hruirgrrgggulrhg. 0 Calculate prob of sequence bbm when three letters picked without replacement from mbbbm. 1/5 Four letters picked without replacement from {w: 2, l: 2, c: 1, q: 1, o: 1}. Give prob of sequence locw. 1/210 Calculate prob of sequence hllh when four letters picked without replacement from llllhlllllllhlllhlh. 35/1292 Four letters picked without replacement from {x: 4, a: 4, z: 3, s: 1, q: 2}. Give prob of sequence qqsx. 1/3003 What is prob of sequence csi when three letters picked without replacement from {h: 2, s: 3, c: 1, i: 1}? 1/70 Two letters picked without replacement from xnnqxxnana. Give prob of sequence xx. 1/15 Four letters picked without replacement from {w: 3, k: 2, s: 2, h: 2, e: 2, b: 4}. Give prob of sequence wbwk. 2/1365 What is prob of sequence gggw when four letters picked without replacement from {t: 2, g: 5, w: 3, l: 3}? 3/286 Calculate prob of sequence xm when two letters picked without replacement from {b: 1, y: 1, m: 1, x: 2}. 1/10 Calculate prob of sequence dad when three letters picked without replacement from {a: 1, z: 1, t: 2, d: 4, e: 1}. 1/42 Four letters picked without replacement from {c: 2, b: 4, h: 4, z: 4}. What is prob of sequence zzhb? 8/1001 Calculate prob of sequence betb when four letters picked without replacement from {t: 1, d: 1, b: 5, e: 10}. 5/1428 Three letters picked without replacement from bqbbqbbbb. Give prob of sequence bqq. 1/36 Two letters picked without replacement from {t: 6, z: 3, v: 1, a: 2}. Give prob of sequence vv. 0 Calculate prob of sequence ct when two letters picked without replacement from tddddccccidddtct. 1/16 What is prob of sequence ll when two letters picked without replacement from lulull? 2/5 Calculate prob of sequence vn when two letters picked without replacement from {v: 1, i: 3, n: 1}. 1/20 Calculate prob of sequence urr when three letters picked without replacement from nurrrur. 4/35 Four letters picked without replacement from {p: 7, o: 5, y: 2}. Give prob of sequence yopy. 5/1716 Calculate prob of sequence dsld when four letters picked without replacement from pppppdpysspppdljpy. 1/18360 Four letters picked without replacement from {f: 3, d: 2}. Give prob of sequence dfdf. 1/10 Two letters picked without repl	{ "pile_set_name": "DM Mathematics" }
-3j = -5m + 16518. Calculate the remainder when m is divided by 57. 54 Let k = -48 - -120. Suppose 373 = 13i + 61. Let z = 49 - i. Calculate the remainder when k is divided by z. 22 Let z be 466/(-29) - ((-6)/87 + 0). Let p(g) = 3g - 19. Let w(u) = u - 1. Let b(c) = -p(c) + 2w(c). What is the remainder when b(z) is divided by 9? 6 Suppose 0 = -21g - 9g + 300. Suppose 197 = gm + 7. Calculate the remainder when 53 is divided by m. 15 Let t(g) = -17g + 56. Let y be t(3). Suppose 2n - 3j - 69 = 0, -yj = 3n - j - 95. Calculate the remainder when n is divided by 1. 0 Let a(i) = -77i + 7171. Calculate the remainder when a(67) is divided by 9. 5 Let z(t) = -40t + 1. Let x be z(1). What is the remainder when (2/(-6))/(1/x) is divided by 0/(10 + 4) - 1(-14)/2? 6 Suppose -20g + 23g - 90 = 0. Suppose -19q - 55 = -gq. Suppose -s + 4 = -4o + 34, 5o - s = 38. Calculate the remainder when o is divided by q. 3 Suppose 27530 = 26g - 317230. What is the remainder when g is divided by 89? 88 Let p(n) = -24 + 0n + 11 - 4n + 5n. Let k be p(5). Calculate the remainder when (-3 + (-78)/(-8))/((-2)/k) is divided by 12. 3 Let a(m) = 3m2 + 94m + 138. Calculate the remainder when a(-32) is divided by 6. 4 Let z(m) = -m*3 + 34m*2 + 35m. Let u be z(35). Suppose -5g + 34 + 1 = u. Calculate the remainder when 16 is divided by g. 2 Suppose 2r - 5d - 94 = 0, -r + 40 = -2d + 3d. Suppose r = 11o - 321. Calculate the remainder when 96 is divided by o. 30 Let d(i) = 318i - 2373. What is the remainder when 1196 is divided by d(8)? 170 Let d be 34 + (-4 - 3 - -1). Suppose -175 = -dq + 3q. Let c(y) = -y3 + 3y*2 + 4y + 4. Calculate the remainder when q is divided by c(4). 3 Suppose 6c - 162 - 144 = 0. Calculate the remainder when -9 - -12 - (-91 - -1) is divided by c. 42 Suppose 3u - 2k = 111, 20u + 5k = 16u + 171. What is the remainder when u is divided by 14? 11 Suppose -138c + 38243 = -199807. Calculate the remainder when c is divided by 12. 9 Let t(x) = -10 + 1 + 3x + 5 + 3x2 - x. Suppose 3s + 3 = -2n - n, 0 = -n - 5. What is the remainder when t(s) is divided by 19? 14 Suppose -5w - 328 = -3s, 2s - 8w + 6w - 216 = 0. What is the remainder when s is divided by 25? 6 Suppose 19g - 91g = 60g - 20988. Calculate the remainder when g is divided by 82. 77 Let d = 680 + -639. Suppose l - 1 = 16. Calculate the remainder when d is divided by l. 7 Let w = -123 + 125. Suppose 303 = 5n - 4x, -4x = -wn + 19 + 95. What is the remainder when n is divided by 4? 3 Let h = -7124 + 7179. Let g = -54 - -82. Calculate the remainder when h is divided by g. 27 Let p = -108 + 166. Suppose 3v = 4k + 82, 2v = 2k - k + p. Calculate the remainder when v is divided by 21. 9 Let z(x) = -5x*3 + 401x*2 + 332x - 163. Calculate the remainder when z(81) is divided by 40. 5 Let h(f) = 27f - 870. Calculate the remainder when h(57) is divided by 220. 9 Let o(u) = 5u + 55. Let l(k) = 4k + 58. Let y(d) = 3l(d) - 4o(d). What is the remainder when 42 is divided by y(-10)? 8 Let s(r) = -9r + 24. Let h be s(0). Let o = 140 + -22. What is the remainder when o is divided by (25/10)/(-2 - (-50)/h)? 28 Let w(n) = -301n - 4476. What is the remainder when 353 is divided by w(-15)? 2 Suppose -2x - 47 - 22 = -r, -3r - x = -207. Let l = -51 + r. Calculate the remainder when 120 is divided by l. 12 Suppose 0 = -26v - 48v + 2220. Calculate the remainder when 488 is divided by v. 8 Suppose 3u = -0z - 5z, -z = u. Suppose 2w - 136 - 122 = u. Let r(i) = 3i + 54. What is the remainder when w is divided by r(-7)? 30 Let m = 900 - 471. What is the remainder when m is divided by (16 + (-25 - -6))/((-2)/18)? 24 Suppose -38y = -204 - 100. Suppose 157 = yg - 43. Calculate the remainder when 218 is divided by g. 18 Let g(o) = -52o3 + o2 - 11o + 16. Calculate the remainder when g(-6) is divided by 88. 86 Suppose u + m + 6 = 0, 5u + 31 = -2m + 1. Let c(d) be the third derivative of -7d4/24 + 6d*2 - 1. Calculate the remainder when c(u) is divided by 11. 9 Let k be (15/(-10))/(1/2). Let p be (-3)/(k(-5)/(-10)). What is the remainder when 23 is divided by p/5 - (-28)/5? 5 Suppose 100s = 98s + 18. Suppose -210 = sx - 3x. What is the remainder when 102 is divided by (-7)/x + (-4)/(-5) + 25? 24 Let y(m) = 13m3 - 4m*2 - 17m*3 + 5m - m - 2 + 5m3. Let p be y(4). Suppose -p = -5u + 3u. What is the remainder when 10 is divided by u? 3 Let w(k) = 10k*3 - 11k*2 - 11k + 65. Calculate the remainder when w(10) is divided by 41. 40 Let s be (3 - 0)(-150)/(-9). Let q = -15 + s. Suppose -171d + 2808 = -144d. Calculate the remainder when d is divided by q. 34 Calculate the remainder when (2 - 5/(30/507))160/(-3) is divided by 9. 8 Let y be (25/(-50))/((-1)/(-2)). Let n be 7 + y + 3 + 2. Let t(f) = -f*2 + 19f - 33. What is the remainder when t(n) is divided by 31? 24 Suppose -4a + 0a - 24 = 0. Let o = a - -11. Let j = -5866 - -5883. What is the remainder when j is divided by o? 2 Let o(m) = -125m3 + 51m*2 - 1. Calculate the remainder when o(-1) is divided by 104. 71 What is the remainder when 351 is divided by 2/14(-112)/(-32)(-602)/(-7)? 7 Let l(f) = -2f*2 - 4f + 2. Let d be l(0). Suppose dw - 4k - 34 = 0, 0w - 9 = -2w - k. Calculate the remainder when 40 is divided by w. 5 Let c = 22 + -9. Suppose 82w = 8390 + 26706. What is the remainder when w is divided by c? 12 Let v(h) = -11h*2 - 45h + 14. Calculate the remainder when 214 is divided by v(-4). 16 Suppose m + 10 = v + 2v, 4v = m + 14. Suppose -2w + 5w - 207 = 0. Suppose w = 5k + 3f - 45, f = -m. Calculate the remainder when 44 is divided by k. 20 Let p(c) = c*3 + 5c*2 - 4c - 5. Let n = -75041 - -75114. Calculate the remainder when n is divided by p(-4). 19 Let m = 447876 - 447456. Suppose -3k + k + 192 = 4j, -5j + 237 = k. Calculate the remainder when m is divided by j. 44 What is the remainder when 58/(((-660)/(-195))/22 - 0/(-2)) is divided by (-365)/(-3) + -1? 57 Let g be 122 - (-8)/(-40)10. Calculate the remainder when 52 is divided by g/10(-4)/(-6). 4 Suppose -5t = -4t - 3y - 161, -3t = -y - 523. Suppose -73o + 2510 = -994. What is the remainder when t is divided by o? 32 Let u be (-3736)/(-10) + ((-4)/(-5))/2. Suppose 4p - 5v + 233 = -138, -4p = -2v + u. What is the remainder when 100 is divided by (-2 - p/(-4))6/(-9)? 15 What is the remainder when ((-16)/1)/(2012/(-1687062)) is divided by 189? 186 Let b(a) = 15a2 + 260a - 175. Calculate the remainder when b(-19) is divided by 23. 1 Let p(b) = 4 + 19 - 19b + 74. Calculate the remainder when 34 is divided by p(5). 0 Let z be ((-14)/(-8))/(3/12). Suppose -5a - 76 = -za. What is the remainder when a is divided by (25 - 35)/((-5)/11)? 16 Let m = 158 - 146. Let f be 1011(-1)/(-1). Suppose 5b = -5n + b + 170, 2b = 4n - f. What is the remainder when n is divided by m? 6 Suppose -4y - k - 5 = 0, -3y = -4k + 8k + 7. What is the remainder when 31 is divided by y - (2 - (0 + 19))? 15 Let j be 16/10(-13 - -43). Suppose 0 = -3z + j. Calculate the remainder when 46 is divided by z. 14 Let i = 53 - 42. Let t be (i - 15) + 23-1. Calculate the remainder when 45 is divided by 0/5 - (3 + t). 21 Calculate the remainder when (1752/(-22))/((-1098)/8052) is divided by 255. 74 Suppose -439 - 1139 = -5w + 2w. Calculate the remainder when w is divided by 22. 20 Suppose -9o - 18 + 864 = 0. Suppose 5y - 115 = 4v + 122, -2y + 2v = -o. Calculate the remainder when y is divided by 4. 1 Suppose 11 = -6p - 19. What is the remainder when (-666)/(-9) + (p - 0) is divided by 9? 6 Let h(p) = -p*2 + 3p - 13. Let k be h(0). Let a(t) = 3t2 + 27t - 42. Calculate the remainder when a(k) is divided by 23. 22 Let s be -34 - (4 + -10 + 3). Let v = 66 + s. Suppose -39 = 10q - 15q - 3w, -2q - w + 15 = 0. What is the remainder when v is divided by q? 5 Let a(j) be the third derivative of -j*4/24 + 5j*3/3 - 59j*2. Let f = -2 + -4. Calculate the remainder when a(f) is divided by 9. 7 Suppose 4k - 561 = -13k. Let z(d) = 128d + 9. Calculate the remainder when z(3) is divided by k. 30 Suppose 0 = -g + f + 59, -22g = -19g - 5f - 179. Suppose -3i = 46 - 4. Let v = i - -34.	{ "pile_set_name": "DM Mathematics" }
)(-x2 + 2x*2 + 0x*2) in the form ax*3 + kx*2 + o + wx and give a. -5 Rearrange (y + 4y - 4y)(-1 + 2 + 1)(1 + 3 - 2)(1 + 2 + 1) to gy + m and give g. 16 Express 5w - 96 - 5w - 3w2 + 99 in the form c + jw + xw2 and give c. 3 Rearrange (n - 3n + 3n)(-2 - 2n + 2) + n2 - 3n*2 + 0n*2 - 5n*2 - 11n*2 + 2n*2 to tn + in2 + j and give i. -18 Rearrange 2t + 2 + t*4 + 5t*3 - 4t*3 + t to the form n + it + st2 + qt*4 + yt*3 and give i. 3 Rearrange -6v - 54v + 7v to the form kv + q and give k. -53 Express -3q*4 + 43q*2 + 5q*3 - 5q*3 + 2 - 41q*2 as mq*2 + iq*3 + c + tq*4 + lq and give c. 2 Rearrange 29c3 + 2 - 31c*3 - 3 - 5c*4 + 2c*4 - 2c to tc + y + mc*3 + kc*2 + jc*4 and give m. -2 Rearrange 2n*4 - 511n*3 - 3n*2 + 2n*2 + 512n*3 + 2n + 1 + 0 to the form tn4 + sn + cn2 + rn*3 + d and give t. 2 Express -2f + 4f + f2 + 6f*2 in the form af + y + df2 and give a. 2 Express ((-1 + 2 - 2)(-2h2 + 4h*2 - 4h*2) + (-h - h + 3h)(-2h + 3h - 2h))(6h - 2h - 2h) in the form yh3 + lh + qh2 + t and give y. 2 Express -1 + 5f*2 - 2 + 3 in the form xf + d + af2 and give a. 5 Rearrange -5p + 5p - p + (1 + 1 - 3)(-2 + 2 - 2p) + 13p + 11p - 6p to u + cp and give c. 19 Express 10 - 55s + 13 - 23 as d + xs and give x. -55 Rearrange -l3 - l + 108l*2 - 103l2 - l3 to the form zl + s + vl*3 + pl2 and give p. 5 Express 1 + 0 - n2 + 1 + (2n + 13n - 4n)(n - n + n) in the form jn2 + s + dn and give j. 10 Express -27p4 + 18p*4 + 3 - 2 + 10p*4 - 17p*2 in the form m + hp*3 + bp*2 + jp*4 + np and give b. -17 Rearrange -4u3 - 3 + 10u - 10u to the form qu*3 + yu*2 + n + wu and give n. -3 Rearrange 0q3 + 0q*3 + 8q3 + q4 + (q*2 + 0q*2 - 2q*2)(-2q2 - 2q*2 + 3q*2) to the form gq*4 + mq*3 + o + hq + iq2 and give m. 8 Rearrange (0 + 2n + 0)(192n + n*2 + 2 - 192n) to t + jn2 + sn + bn3 and give b. 2 Rearrange (d2 + d2 - d2)(-1 - 1 + 1) - 5d - 4d*2 + 5d - 3d2 - 4d*2 + 4d*2 to the form kd*2 + ad + z and give k. -8 Express (-35 + 35 + 37z2)(-2z + 0 + 0) in the form pz + rz3 + f + hz*2 and give r. -74 Express -3l*2 + 0l*2 - 2l2 - l2 + 0 + 0 + (-4l - 2l*2 + 4l)(0 + 5 - 3) - 4 - l2 + 4 + 0l*2 - 3l*2 - 3l*2 as ql + kl2 + j and give k. -17 Express (2d + 2 - 2)(6 - 2 + 4)(2d - 3d + 2d) as kd + u + sd2 and give s. 16 Express -419g + 5 + 3g3 + 419g in the form mg3 + lg*2 + i + qg and give m. 3 Express -3q + 4q - 2q + (-q - 3q + 3q)(-5 - 1 - 5) + 0q - 3q + q + (1 - 1 - 1)(2q - 2 + 2) - 4q + 3q + 2q as pq + r and give p. 7 Express (n4 + n4 - 4n4)(-1 + 1 + 1) + (-1 + 0 + 2)(-8 - 7n*4 + 8) in the form ln*2 + xn*3 + in*4 + tn + z and give i. -9 Rearrange (18 - 46 - 29)(-d - 3d + 2d)(-d*2 + 0d2 - d2) to m + zd3 + qd + kd2 and give z. -228 Rearrange 15g*4 + 2g2 - g3 + 4g4 + 4 - 4 to the form t + vg*4 + qg*3 + lg*2 + kg and give q. -1 Express -28v3 - v2 + 14v*3 + 4v*2 + 4v3 - v3 - 2v3 + (v - 4v + v)(-2v2 - v2 + 4v2) as zv + jv2 + m + dv*3 and give j. 3 Rearrange -5l3 - 6 - l + l3 + 4l3 + 2l*2 + 2l*4 to xl*3 + il*4 + z + bl + kl2 and give i. 2 Rearrange -9 - 6 - y + 32y*2 + 15 to ty + iy2 + n and give t. -1 Express 3t*4 - t - 5t*3 + 5t*4 + 4t*3 in the form z + bt + pt2 + at*4 + wt*3 and give b. -1 Rearrange -21x*2 + 44x*2 - 2x*3 + 0x*3 - 20x*2 to a + nx*2 + wx*3 + jx and give n. 3 Rearrange 21o - o3 - 4o + 0o3 - 2o to the form fo + g + po*2 + bo*3 and give b. -1 Express 14 - 6y - 2y3 + 4y + 3y in the form ly + qy3 + iy2 + h and give h. 14 Express (-y2 + 3y2 + 0y*2)(1 + 1 - 6) as vy + u + ly*2 and give l. -8 Express -48p + 48p - 6p*2 in the form xp + lp2 + i and give i. 0 Express (4x - 2x - 3x)(-7x + 13x - 8x) in the form o + zx + wx*2 and give w. 2 Rearrange -8w*3 + 3 + 3w3 + w2 + w*2 to the form zw*3 + i + sw + dw2 and give i. 3 Rearrange 0j*2 + 0j*2 - 17j*3 + 36 - 35 to z + fj + lj3 + oj*2 and give f. 0 Rearrange 11 - 11 + 13b*2 to x + ub + yb2 and give y. 13 Express 2q*2 + q + 2q*4 + 3q*2 + 5q - 4q2 as wq*3 + x + sq*2 + hq + yq4 and give y. 2 Express 26d*2 + 0d - d - 7d2 + (1 + 0 + 1)(2d2 - d2 - 2d2) - d2 + 1 - 1 in the form md + id*2 + x and give i. 16 Rearrange -94y*2 - 132y + 132y to g + by*2 + cy and give b. -94 Rearrange -9r2 + 16r*2 + 19r*2 to cr + h + tr2 and give t. 26 Rearrange (-6 - 2 + 3)(-5y + y + 3y)(-2y - 3y + 2y) to x + oy2 + ny and give o. -15 Express (2n2 - n3 - 2n*2)(15 - 38n - 28n + 69n) in the form o + tn*3 + fn*4 + kn*2 + sn and give f. -3 Express 20g - 18 + 18 + 2 - 2 - g + (-g + 0g + 3g)(-2 - 3 + 4) + (2g - g - 4g)(-1 + 0 + 0) in the form i + jg and give j. 20 Express -2w3 - 19w + w*2 + 22w - w*3 in the form sw*2 + uw*3 + p + iw and give i. 3 Express -7 - 1 - 19k4 + 7 + 2k3 - k3 in the form lk2 + xk*4 + yk*3 + p + ak and give x. -19 Rearrange -27o + 11o + o to the form no + q and give n. -15 Express -17x + 3x - 2x + 13x + 13 in the form qx + g and give g. 13 Rearrange (-2 + 5 - 1)(-b + 4b*2 + 2838 - 2838) to the form ub + pb2 + h and give u. -2 Express (-1 + 2n - 20 + 4)(6n - 2n + n) in the form o + in*2 + xn and give i. 10 Express -o*3 - 16o + 0o3 - o3 in the form vo*2 + ao*3 + go + h and give g. -16 Rearrange (-74z - 3 + 73z - 3)(-5z*2 + 2z2 + z2) to the form lz + az*2 + f + hz3 and give a. 12 Rearrange 0 + z4 + 0 + (-3z3 + 4z*3 + 3z*3)(-3z + 0 + 0) + 0z*4 - 3z4 + z4 to the form jz3 + hz*4 + fz*2 + az + b and give h. -13 Rearrange (1 + o - 1)(-4 + 11 - 28) to y + jo and give j. -21 Express -60h - 17 + 3h*3 - 3 + 61h - h*3 as ch + fh3 + j + qh*2 and give f. 2 Express 5w*3 + 4w + 7w3 - 2w*4 + 1 - 2 - 14w*3 in the form u + aw*2 + qw*4 + fw*3 + vw and give v. 4 Express (3j + 13 - 13)(5j3 - 4j*3 - 2j*3) in the form tj*3 + ij*2 + kj + pj4 + v and give p. -3 Rearrange (0 - 1 + 3)(1 - 1 + 2t) + (-9 - 14 + 12)(t - 3t + 4t) to the form at + k and give a. -18 Rearrange x3 + 28x - 2x4 + 1 - 29x + 1 to the form lx + ix*4 + v + nx*2 + dx*3 and give i. -2 Express -2u*3 - 91u*2 - 1 + 91u*2 + 2u in the form k + fu2 + vu*3 + zu and give v. -2 Express -147l2 + 33l*4 + 147l*2 + (-3 + 3 - 3l*2)(2 - l*2 - 2) as wl*3 + p + ol + tl2 + rl*4 and give r. 36 Express 2o*2 + 0o*2 - 5o*2 + (-3o + 5o - 4o)(4o - 2o + 0o) as go + yo*2 + r and give y. -7 Express -2n*2 + 2n2 - n2 + (27n2 - 5n*2 + 104n*2)(0 + 3 - 1) in the form w + on2 + vn and give o. 251 Express 0 + 3n - 20n3 - 2 - n2 - 19n3 + 35n*3 as kn + o + dn2 + an*3 and give o. -2 Express 16y*2 - 2y + 2y + 0y as dy + v + my*2 and give m. 16 Express 12t*3 + 2t3 - t2 - 6t3 + t as s + ct + zt3 + wt*2 and give w. -1 Rearrange (2 - 2 - 2u*2)(59 + 38 - 21) to zu2 + d + su and give z. -152 Rearrange 810 - 810 + 6o3 + 3o - 2o2 to the form io + do3 + n + to2 and give d. 6 Rearrange (-u2 - 4u + 4u)(2 + 1 - 2) + 0u - 2u2 - u2 + 2u to fu + w + nu*2 and give f. 2 Express 2 - 4 - 1 + 0f*2 + 2f2 + f3 as p + df3 + wf*2 + kf and give p. -3 Rearrange -l - l4 + l2 + 3l3 - 5l - 4l3 + 1 to o + kl*4 + ql + zl2 + gl*3 and give g. -1 Express o + 12o + 12o as t + ho and give h. 25 Rearrange 3 + 5x2 - 3 + (2 + 2x - 2)(-2x + 4x + 0x) to the form q + wx2 + px and give w. 9 Express -1 - 2o2 - 509o + 2o4 + 0 + 509o + 4o3 as ko*3 + s + go + lo4 + mo*2 and give l. 2 Express (5 - 2 + 1)(3b2 - 5b*2 - 2b*2 + (-1 + 3 - 1)(0b2 - 5b*2 + 2b*2)) as sb + a + kb2 and give k. -28 Rearrange -24 + 90m*2 - 2m + 2m - 91m*2 to the form sm + l + nm*2 an	{ "pile_set_name": "DM Mathematics" }
Collect the terms in -174h2 + 8h*3 - 1320h + 1320h - 7h3. h3 - 174h2 Collect the terms in 4b + 49 - 7b - 31 - 24. -3b - 6 Collect the terms in -28t + 81t + 10t - 21t + 124t. 166t Collect the terms in 2x2 + x2 - 3x*2 - 13x*2 + 16x. -13x2 + 16x Collect the terms in 3137u - 708u + 604u + 3322u. 6355u Collect the terms in -597j + 20j + 581j. 4j Collect the terms in 862y*2 - 2y*3 + 769y*2 - 1631y*2. -2y*3 Collect the terms in 1341s*3 - 626s*3 - 666s*3. 49s*3 Collect the terms in -7 - 6 + 1 + 8 + 58j*2. 58j*2 - 4 Collect the terms in 200j + 197j - 574j + 170j. -7j Collect the terms in 1 - 1 + 25u3 - 33u*3 + 0. -8u*3 Collect the terms in 2 + 9709f*2 - 10312f*2 - 2. -603f*2 Collect the terms in -2 - 156r*2 + 149r*2 + 2. -7r*2 Collect the terms in -26560 - 5p + 26560. -5p Collect the terms in -2r*2 + 739392758 - 739392758. -2r*2 Collect the terms in 34v*3 + 10v - 5v2 + 12v + 0v. 34v*3 - 5v*2 + 22v Collect the terms in 245o + 6o*2 - 245o - 2o2 - 6o*2. -2o*2 Collect the terms in -1475f*3 + 782f*3 + 701f*3. 8f*3 Collect the terms in 1791l - 1150l + 433l + 2165l. 3239l Collect the terms in 44m + 104m + 347m - 82m. 413m Collect the terms in -3j + 2j + 1634j*2 + j. 1634j*2 Collect the terms in -7i - 577 - 5305 + 3i + i. -3i - 5882 Collect the terms in 17i2 + 11i*2 + 20i*2 + 25i*2 - 21 - 56i*2. 17i*2 - 21 Collect the terms in 200f + 466f - 132f. 534f Collect the terms in 15u*2 - 12u*2 + 8u*2 - 2u*2 + 9u*2. 18u*2 Collect the terms in 11h - 2h - 344h*2 + 5h - 2. -344h2 + 14h - 2 Collect the terms in 12d2 - 46d*3 + 11d*3 + 0d*2 + 7 + 2d. -35d3 + 12d*2 + 2d + 7 Collect the terms in 22x3 - 9397x + 9397x. 22x*3 Collect the terms in -6695n*3 + 3317n*3 + 3342n*3. -36n*3 Collect the terms in 5 + 3173m*2 - 1 - 4. 3173m*2 Collect the terms in 2 + 52279m*3 - 52284m*3 - 2. -5m*3 Collect the terms in 98 - 98 - 11914s + 11923s. 9s Collect the terms in 2157p3 - 1052p*3 - 1083p*3. 22p*3 Collect the terms in -4x - 17 - 20 - 13 - 16 + 60. -4x - 6 Collect the terms in -13y*3 + 256y*2 - 21y*2 + 12y3. -y3 + 235y2 Collect the terms in -8l - 266 + 7l + 266. -l Collect the terms in 825d*3 - 5300d + 5300d. 825d*3 Collect the terms in 236 - 462 + 102z*3 + 224. 102z*3 - 2 Collect the terms in 3h - 76621h2 + 38308h*2 + 38314h*2 - 3h. h*2 Collect the terms in -1 + 19 - 22 + 2o + 3 + 17. 2o + 16 Collect the terms in -51 + 51 - 14428r + 14434r. 6r Collect the terms in -2u2 + 0u*2 - 21u*2 + 36u*2 - 12u2. u2 Collect the terms in -348x - 962x + 387x. -923x Collect the terms in 8066 - 34r2 - 8066. -34r*2 Collect the terms in 0g + 2 + 0g + 55g*3 + 741g*3. 796g*3 + 2 Collect the terms in 223c + 6 + 15 - 33 + 13. 223c + 1 Collect the terms in -24 + 200f*2 + 24. 200f*2 Collect the terms in -181p - 434 + 124p + 433. -57p - 1 Collect the terms in -293g3 - 3 + 2031g*3 + 3. 1738g*3 Collect the terms in -719q*3 - 241q*3 + 931q*3. -29q3 Collect the terms in w2 + 4w2 - 1730w - 4w2 - 5w*2 + 1. -4w*2 - 1730w + 1 Collect the terms in 10j + 0 - 16j - 1 + 4. -6j + 3 Collect the terms in 4n - n - 3n + 1065019113n*2 - 1065019114n2. -n2 Collect the terms in -473b - 472b - 479b + 1426b - 23. 2b - 23 Collect the terms in -7332o - 16911o - 4 + 4. -24243o Collect the terms in 2698h2 - 1346h*2 - 1349h*2 + 13h + 3h. 3h*2 + 16h Collect the terms in 3061k2 + 1 - 3 + 0 + 2. 3061k*2 Collect the terms in -1352w*3 + 27w - 972w3 - 27w. -2324w3 Collect the terms in 57u + 12u - 52u + 20u. 37u Collect the terms in 10t + 17t + 13t + 5t - 6t. 39t Collect the terms in -131i2 - 53i*2 - 17i*3 + 184i*2. -17i*3 Collect the terms in 713x - 713x - 6348931x*2 + 6348932x2. x2 Collect the terms in -115h + 222h - 6 - 149h + 3. -42h - 3 Collect the terms in 1083k3 + 22k*3 + 3k*2 + 554k*3 - 3k*2. 1659k*3 Collect the terms in 27a*2 - 24a*2 + 49a*2 + 2. 52a*2 + 2 Collect the terms in -8n + 11n - 10n - n - 4n. -12n Collect the terms in -274555 - 568p + 274555. -568p Collect the terms in 7751f3 + 7746f*3 - 15517f*3. -20f*3 Collect the terms in -12v + 6v + 5v + 5v - 2 + 13v. 17v - 2 Collect the terms in 3z*3 - 50z*2 - 40z*2 + 129z*2 - 39z*2. 3z*3 Collect the terms in -6t - 32t + 283t. 245t Collect the terms in -16 + 16 - 16509v. -16509v Collect the terms in -906m*2 - 920m*2 + 1852m*2. 26m*2 Collect the terms in -7y - 1313 + 3814 + 2y - 1189 - 1312. -5y Collect the terms in -5o + 6 + 5o + 10o - 9. 10o - 3 Collect the terms in -1514f + 2968f - 2f3 - 1495f. -2f3 - 41f Collect the terms in -42 + 43 + 1138d - 3 + 2. 1138d Collect the terms in -16q2 + 12q*2 + 6q*2 + 46 - 43. 2q*2 + 3 Collect the terms in -3r - 5r - r + 11r + 31r2 - 295r*2. -264r*2 + 2r Collect the terms in 92720y3 - 33 + 17 + 16. 92720y*3 Collect the terms in 2276w*2 - 1 - 5106w*2 - 5285w*2. -8115w*2 - 1 Collect the terms in 24l - 19l + 32l - 5l - 1. 32l - 1 Collect the terms in 160q - 15q + 4q + 91q + 2q2. 2q*2 + 240q Collect the terms in 2613y - 1305y - 1305y. 3y Collect the terms in -97g + 169g - 1 - 161g. -89g - 1 Collect the terms in -t2 + 4924 - 1639 - 1644 - 1641. -t2 Collect the terms in 18b3 + 432 + 428 + 430 + 419 - 1709. 18b*3 Collect the terms in -11431680j*2 + 290j*3 + 11431680j*2. 290j*3 Collect the terms in -2582 + 2d*3 + 2582. 2d*3 Collect the terms in -17 + 1 - 160a + 83a + 12 + 84a. 7a - 4 Collect the terms in -115238o*2 + 41o*3 + 230482o*2 - 115244o*2. 41o*3 Collect the terms in 0u*2 - 1698u3 - u2 + u*2. -1698u*3 Collect the terms in 23l*2 - 144l*2 + 2l*3 - 32l*2. 2l*3 - 153l*2 Collect the terms in 1359k*2 - 315k*2 + 820k*2. 1864k*2 Collect the terms in 94 + 27a + 20a + 10a*2 - 47a. 10a2 + 94 Collect the terms in -6 + 3 + 28959z*3 + 4545z*3 + 1. 33504z*3 - 2 Collect the terms in -116 + 584j + 12 + 103. 584j - 1 Collect the terms in 23 - 2p - 2p + 62p. 58p + 23 Collect the terms in 3l - 1335667 + 667834 + 667833. 3l Collect the terms in -1594a*2 + 16a*3 + 24 - 6 + 1594a*2. 16a*3 + 18 Collect the terms in 61r*3 + 55r*3 + 66r*3 + 65r*3 - 246r3. r3 Collect the terms in -68 - 547d2 + 25 + 43. -547d*2 Collect the terms in 10066 - 2519 - 2520 - 2515 + m - 2512. m Collect the terms in -265t*3 - 960t*3 - 4t*3. -1229t*3 Collect the terms in -25r + 11r + 213r*2 - 210r*2. 3r*2 - 14r Collect the terms in -172 + 578 - 170 - 236 - 3b3. -3b*3 Collect the terms in 0 + 5 - 1 - 221g + 240g. 19g + 4 Collect the terms in 1034u2 + 983u*2 - 2020u*2. -3u*2 Collect the terms in -2x*2 + 3x*2 + 213x3 - x2 - 212x3. x3 Collect the terms in -69 + 67 - 11169x*2 + 11168x2. -x2 - 2 Collect the terms in 2960 - 2y2 - 8882 + 2957 + 4y*2 + 2965. 2y*2 Collect the terms in -6m - 8m - 25m - 14m - 9m. -62m Collect the terms in 379a*3 + 97a*3 - 205a*3 + 51a*3. 322a*3 Collect the terms in 213l - 6l + 250l + 2l3 - 1. 2l*3 + 457l - 1 Collect the terms in 42c3 - 1022c + 1022c. 42c*3 Collect the terms in 16 + 1189s - 1 + 18 - 1188s. s + 33 Collect the terms in -38 + 22w*2 - 8w*2 - 16. 14w*2 - 54 Collect the terms in 89995h - 4h2 + 2h*2 - 89995h. -2h2 Collect the terms in 0 + 45v + 0 + 14v - 66v. -7v Collect the terms in 126j*2 + 2j + 133j2 - 2j. 259j2 Collect the terms in -25y - 42y + 67y - 128y2. -128y*2 Collect the terms in 60p*2 - 11p*2 - 13p*2 + 67p*2. 103p*2 Collect the terms in -4226c + 2055c + 2174c. 3c Collect the terms in -1028q*3 - 947q*3 + 1967q*3. -8q*3 Collect the terms in 522j - 9450 + 9450 - 546j. -24j Collect the terms in 11v3 - 111v*3 - 539v*3. -639v*3 Collect the terms in -61i*3 + 13 - 32 + 19. -61i*3 Collect the terms in -118s - 2 + 5 - 497*s	{ "pile_set_name": "DM Mathematics" }
+ 59 + 79 + (-1 - 1 + 4)(2 - 1 - 4) - 1 - 2 - 4)(0 + 6 + p + 0p) to the form vp + n and give n. -414 Express (30356g2 + 23876g*2 + 31589g*2 - 4092g*2)(1 - 1 + 2) as og + mg*2 + s and give m. 163458 Express (5 + 1 - 2)(19z - 11z - 90z)(-14z + 2 + 11z - 4) in the form a + tz + oz*2 and give t. 656 Rearrange -1220h - 1251h - 655h to the form rh + l and give r. -3126 Rearrange -52n*3 + 108n*3 - 58n*3 + 1 - 9n*2 - 9n*4 - 2n to zn4 + kn*2 + rn + b + tn3 and give k. -9 Rearrange 3538f*2 - 986f*2 - 693f*2 - 1081f*2 - 2f + f*3 to jf*2 + h + qf + nf3 and give q. -2 Express 13p*4 - 8 + 10 - 14p*4 - p - 284p*3 as up*3 + qp*2 + c + xp + bp4 and give u. -284 Express -683k - 92 + 90 + 40k2 - 39k*2 in the form bk*2 + l + gk and give b. 1 Express -33n + 6584n*2 - 6585n*2 - 9n*4 - 9 + 7n*4 - 1 in the form k + qn*2 + yn*4 + sn + hn3 and give y. -2 Rearrange (n - 35 + 35)(3 - 3 - 2n)(534n + 12 - 8 - 438n) to gn + vn*3 + mn*2 + z and give v. -192 Rearrange -28347r + 17152r + 14455r - 3 to the form k + ir and give k. -3 Rearrange -78 - 82 - 76 + 14687x + 236 to the form jx + a and give j. 14687 Express -107564 - 11y + 11y + 45y*2 + 107566 + 22y as l + gy + hy*2 and give l. 2 Express -104 + 303 - 2k - 162 + 3k + (-50k - 34k + 16k)(3 - 2 - 3) in the form u + yk and give u. 37 Rearrange 145p - 165p*2 + 2p*3 + 1 + 404p - 543p to the form np + k + yp2 + cp*3 and give c. 2 Express 2493w + 4 - 7 + 1 + 0 in the form m + dw and give m. -2 Express 80b*2 - 3b + 3b - 76b*2 + 262 + 344 as gb + s + vb2 and give s. 606 Rearrange (4i + 0i - 3i)(-2194 - i3 + 1092 + 1099 + 187i*2) to the form yi*2 + ai*4 + d + mi + vi3 and give a. -1 Express 747 + b3 + 2b*2 - 8425b + 0b3 + 8424b - 3b3 as ib*2 + nb + lb3 + r and give r. 747 Rearrange (8 - 3 - 2)(-447q2 - 487q*2 + 545q*2) to the form pq*2 + d + cq and give p. -1167 Express 2096o - 33 - 87 + 2o*2 + 120 in the form lo + vo2 + y and give l. 2096 Rearrange 123x + 339x - 2x*2 + 6x*3 - 198x to v + fx3 + zx + ux2 and give f. 6 Express 14c + 6213c3 - 6024c*3 - 16c as n + tc2 + wc*3 + rc and give r. -2 Express 9784i - 5031i - 4750i - 4i*2 - 84 + (2i*2 - 7i*2 + 3i*2)(2 + 2 - 2) as wi2 + m + ki and give k. 3 Rearrange 65j2 + 301j*2 + 330j*3 - j - 368j*2 to nj + oj3 + f + qj*2 and give o. 330 Rearrange -8w + 8w + 10w*2 - 9w*2 - 8w*2 + 15w*2 + (6w - 14w + 6w)(-2w - 2w + 2w) to the form f + lw2 + iw and give l. 12 Express 173w - 364w*2 - 926w - 930w + 363w*2 in the form z + sw + qw2 and give q. -1 Rearrange -3y + 17y3 + 529y*2 + 2y - 499y2 - 20y*3 + 0y*4 - 13y*4 to the form c + hy + vy3 + wy*2 + ry*4 and give h. -1 Rearrange z - 2z*2 - 14690z*3 - 609z*4 + 1 + 2z*2 + 29385z*3 - 14694z*3 to rz*3 + c + sz + dz4 + nz2 and give r. 1 Express -k4 - 7k2 + 11k*3 - 320 + 5k*2 + 322 as sk*2 + q + gk*3 + ak*4 + xk and give a. -1 Rearrange -7w2 - 67w*3 - 7w + 8 - 9 + 2w2 + 15w to the form xw2 + iw*3 + yw + j and give y. 8 Rearrange -274 - 11q3 - 287 + 557 - 32q*2 to the form wq*3 + i + jq*2 + gq and give w. -11 Express -26l4 - 1 + 2l + 115l4 - 6l*2 - 104l*4 as al*2 + n + wl*3 + xl + fl4 and give f. -15 Express (20v - 42v - 63v - 50v)(-2v + 0v + 3v - 4v + v + 2v + 32v - 27 + 27 + (1 - 1 - 2v)(0 - 1 - 1)) as yv2 + wv + m and give y. -4860 Express (-2t + 2t + t)(-2t + t + 3t) + (4t - 2t - 3t)(0t - t + 2t) + 31t*2 + 28t*2 - 12t*2 as d + bt + zt2 and give z. 48 Rearrange -15 + 4 - 113z + 11 + (-z + 0z + 2z)(7 - 1 - 3) to xz + v and give x. -110 Express 27 - 2y2 - 347 - 165 + 1 - 31 in the form u + oy + hy2 and give u. -515 Rearrange -330y*2 - y - 119y*2 - 2y*3 - 143y*2 - 37y*2 + 0y*3 to xy + i + uy3 + ry*2 and give r. -629 Express (-6p + 39 - 39)(-40p*2 - 348p*2 + 1 + 96p*2) in the form sp + cp2 + a + xp*3 and give s. -6 Rearrange -1708n*2 - 1508n*2 - 1317n*2 - 5 + 5 to the form f + dn*2 + rn and give r. 0 Rearrange (-7q + 27q + 25q)(-1 - 5 + 2)(0 - 1 + 3)(-2q + 6q + 5q) to the form sq + dq2 + t and give d. -3240 Express -590k - 930k - 1609k + 835k - 819k in the form b + ik and give i. -3113 Rearrange 3j*4 + 2j*3 - 8184j*2 - 3j - 4j4 + 8168j*2 to the form q + zj*4 + lj*3 + xj + tj2 and give l. 2 Rearrange -1711202y + 1711201y - 2y*2 - 9 - 2y*2 - 105 to the form vy*2 + k + ny and give k. -114 Rearrange -113n2 + 141n*2 - 114n*2 - 7 - 39n*2 to tn*2 + k + zn and give t. -125 Express 66567q2 - 2 - 2q*4 - 14q*3 - 66569q*2 + q + 4q*3 in the form fq*3 + d + hq*2 + wq + lq4 and give f. -10 Rearrange -9v - 45v3 - 241v*3 - 47v*3 to t + av + hv2 + gv*3 and give a. -9 Rearrange 39050z*3 + 101z*2 + 39046z*3 - 2 - 6z*4 - 78096z*3 to the form sz*2 + iz + h + tz3 + xz*4 and give h. -2 Rearrange -44d*2 + 12d*2 + 4d + 10d2 + 6d*2 + 20d*2 + 43 to l + rd*2 + td and give r. 4 Express 30 - 48f2 - 10 - f - 1 - 11 - 7 as jf*2 + of + c and give o. -1 Rearrange d*2 + 5d - 1998 + 1315 - 4d - 3d*2 to the form t + nd*2 + id and give n. -2 Express -6o + 8o*2 + 6o + 691o2 in the form ro + mo2 + g and give r. 0 Rearrange (-3743 - 636 - 1886)(-4w + 2w + 0w) to s + yw and give y. 12530 Express (-11s - 28s + 9s + (-s - s + 3s)(0 + 1 + 0))(-83 + 26 + 25 + 481s + 32) in the form a + is*2 + fs and give i. -13949 Rearrange -1058d - 405d - 246d - 784d to the form z + td and give z. 0 Rearrange -n + 4 + 1 + 3n + (0n + 0n + 2n)(11 + 90 + 193) to o + mn and give o. 5 Express 7o - 2o2 - 3o*3 + 12o*2 - 5o - 12o2 + 0o + 39 as vo2 + j + ko*3 + ro and give v. -2 Express -10124 - 10147 + 430b + 20265 in the form l + yb and give l. -6 Express (-1 + 4v3 + 3v*3 - 6v*3)(-v + 2v + 2v) + 929v + 104v*2 + 2v*4 - 790v - 99v2 as cv + hv3 + dv*4 + yv*2 + u and give y. 5 Rearrange -2513 + 1271 + 4858d + 1242 to n + hd and give h. 4858 Rearrange 6 + 58n + 18 + 12n + 18 + 8 to the form a + ln and give l. 70 Rearrange -306r + 9248 - 18499 + 9252 to lr + q and give q. 1 Rearrange -128l2 - 4942l + 4947l - 75l*2 to the form bl + pl2 + d and give b. 5 Rearrange 6008w - 3020 + 3020 + (-1 - 1 + 3)(5w - 11 + 11) to the form tw + j and give t. 6013 Express ((-2 - 3 + 4)(-5 + 5 - 3)(0 - 2 - 5b + 1) - 5b + 3b - 2b)(-6 + 6 - 22b3) as xb*2 + lb*4 + q + nb*3 + cb and give l. 418 Express 94 + 544k - 179 + 398k + 85 + 2k + 3 - 3 + 2k - 3k - k + (-2 - 2 + 2)(k + 0 + 0) in the form jk + h and give j. 940 Rearrange (-321d - 212d + 44d + 2d2)(-28d + 4d - d - 41d) to the form md*3 + zd + fd2 + i and give f. 32274 Rearrange -74f2 + 1 - f4 - 105f3 + 110f*3 + 10f*2 + 2f to uf2 + r + zf*3 + kf + nf4 and give k. 2 Rearrange -13113v - 2660 + 2660 to tv + z and give t. -13113 Rearrange (4797 + 2872 + 823)(m*2 + 3m*2 - 3m*2) to lm + j + ym2 and give l. 0 Rearrange -1464x + 749x - 4231x - 1645x - 23x to t + ox and give o. -6614 Express 671q + 48q2 + 665q - 1337q - 5 - q3 + 3q*4 as kq*2 + nq + pq3 + o + rq*4 and give r. 3 Rearrange ((-6 - 3n*3 + 6)(0 + 6 - 4) - n*3 - 2n*3 + 6n*3)(1 + 1 + 0)(-5 - 4 + 6) to fn + xn3 + u + on*2 and give x. 18 Express (7t + 5t - 5t)(1795 + 403 + 311 + 316) as nt + m and give m. 0 Express (120p2 - 592 + 592)(-17p - 12 - 16p + 31p) as cp*2 + y + up + mp3 and give u. 0 Express 87827m*2 + 3 - 86732m*2 - 3 as ym + gm2 + i and give g. 1095 Rearrange 23o + 5 + 254o2 - 1 - 24o - 82o2 to xo + m + vo2 and give x. -1 Express -22d*2 - 58 + 27 + d + 53d*2 + 3d*3 - 3d*2 + 20 as qd + u + zd2 + xd*3 and give x. 3 Rearrange (-3 + n + 3)(7n + n - 2n)(-277 + 623 - 310) to the form sn + y + mn2 and give m. 216 Rearrange (u2 - 2 + 2)(11*	{ "pile_set_name": "DM Mathematics" }
Let h(s) = -s*3 + 6s*2 + 1. Let n be h(6). Let w(o) = 2o*3. Is w(n) a multiple of 2? True Suppose -5i = -5t + 520, -3t + 287 = 5i - 49. Is t a multiple of 30? False Let a(r) = -3r - 1. Let f be a(-5). Suppose 3l - 5 = 2l + 3w, 5w = -5. Suppose -f = -lm + m. Is 7 a factor of m? True Suppose -5g + 4s + 630 = 2s, -3s = -g + 139. Is g a multiple of 14? False Suppose -5p = -10, p = 2l - 2p. Let j(a) = 6a2 + 3a - 3. Is j(l) a multiple of 20? True Is (2 - -2) + 238/1 a multiple of 16? False Does 14 divide 2532/21 + -3 + 72/21? False Suppose 4b = -3l + 6, -2l + b + 4 = 2b. Suppose 0 = -4f + l + 18. Is f a multiple of 2? False Suppose 7l = -5w + 2l + 265, 4w - 217 = l. Does 36 divide w? False Let n = -39 + 22. Let g = 45 + n. Let w = -12 + g. Is w a multiple of 14? False Suppose -5y = l - 177, -101 = -3y - 4l + 6l. Does 5 divide y? True Suppose -3k - p = -16, 2k - 6p = -5p + 4. Suppose -3t + 34 = 3f - 4f, kt - 5f - 38 = 0. Is 4 a factor of t? True Is 6/(-14) + 8088/56 a multiple of 24? True Let v = -7 - -13. Let h(q) = 3q + 6. Let i be h(v). Does 9 divide (6/8 - 0)i? True Suppose 5q + 6 = o - 7, 6 = 4o + 3q. Suppose 3c + 21 = on, -2n - 16 = 2c + 10. Let v(j) = -j3 - 9j*2 + 9j. Is 10 a factor of v(c)? True Suppose 0 = -3d - 3x + 6, -4d - 5x = 2 - 14. Is 3 a factor of d(-12)/31? False Suppose 0 = -3q + q. Suppose qp = p - 34. Does 11 divide p? False Let h(b) = 144b3 + b2 - 2b + 1. Is h(1) a multiple of 22? False Let g(t) = -t*3 - 5t*2 - 4t - 6. Is g(-5) a multiple of 7? True Let l = 3 + 3. Suppose l = -3f - 0n + 3n, 3f + 10 = 4n. Suppose 2p - fj - 23 = -j, -4p + 50 = 2j. Is 6 a factor of p? True Suppose 49 = 2w - 157. Is w a multiple of 30? False Let g be (-2)/6(-680 + -1). Suppose g = 4y - 5f, 0y + 2y + 2f = 100. Is y a multiple of 16? False Suppose -5w + 47 = -g, w = 3w + 3g - 29. Does 5 divide w? True Let w(f) = 4f*2 - 5f + 14. Let p(u) = u*2 + u + 1. Let j(i) = 6p(i) - w(i). Is 11 a factor of j(-8)? False Suppose -8f + 3f = -650. Is 10 a factor of f? True Let u = 75 - 20. Let g = 47 + u. Suppose 2n - g = -n. Does 14 divide n? False Suppose -6 = -7f + 8. Let t = 5 + -14. Is tf/12-2 a multiple of 3? True Suppose -2r + 4o + 12 = 0, o + 1 + 2 = 5r. Let k = r - -29. Is 17 a factor of k? False Suppose o - 9 = -3. Suppose -3q + 2i = -o, -4q + 2q = -2i - 6. Does 6 divide 3/(-1)(-3 + q)? False Suppose -3g + 8n - 3n - 4 = 0, n - 26 = -3g. Is g a multiple of 3? False Let s(h) = -h2 - 8h - 5. Let l be s(-7). Suppose 2p + lp - 2d = 18, -5p + 18 = -d. Is p + (-39 + 1)/(-2) a multiple of 11? True Let x(t) = t*3 + 2t*2 + t + 72. Is x(0) a multiple of 11? False Let r = 8 + 4. Is 6 a factor of r? True Suppose p + 4p = 65. Suppose 0 = -2j - i + 10, -3j = -2i - p - 2. Is 5 a factor of j? True Suppose 4r + 61 = -3i, 2i - 9 = 2r + 25. Suppose n = 3t - 23, 6n - 2t = 2n - 42. Does 10 divide (-316)/r - 2/n? True Let g(z) = z3 - z2 + 3z - 1. Let o = -6 + 8. Let y be g(o). Suppose 5t - 4s + 4 = t, y = 3s. Is t even? True Let r = -3 + 5. Suppose 17 - 3 = ra. Suppose 0 = 3g - a - 113. Is 19 a factor of g? False Let h be 2/8 + 146/(-8). Let a = -9 - h. Let j = a + -6. Is j a multiple of 2? False Let w(y) = 0 - 5y + y - 2 + 3. Is 9 a factor of w(-2)? True Let p = 1 - -1. Suppose 0 = -pk - 0b - 5b + 23, -4k = -5b - 1. Does 4 divide k? True Suppose -4w = 7 + 9, 3v - 15 = -3w. Suppose -4r + 3t + 13 = 0, -5r + 10 = 4t - vt. Let h = r + -3. Does 4 divide h? True Is 7 a factor of 0 - (-14 - (-2 - -2))? True Suppose -5y = -0y. Suppose 2a = k - 0k - 26, -3k - a + 64 = y. Is (-2)/(-11) + 480/k a multiple of 22? True Let k be (-6)/(-9) + 103/3. Let o = k - -14. Is 12 a factor of o? False Let k be 2/3 + 14/6. Suppose km = 8m + 240. Let n = m - -82. Is 11 a factor of n? False Suppose -2a - 2o + 68 = 0, -5o = 2a - 6o - 65. Does 8 divide 517/a + (-1)/(-3)? True Suppose -d - 5f - 8 = -10f, -d - f = -10. Let u(s) = s - 6. Let l be u(d). Suppose 0 = -2g + 8, -4g = t - 6g + l. Does 4 divide t? False Let i(p) be the third derivative of -p*6/120 - 11p5/60 - p4/6 + 7p3/6 - p2. Is 18 a factor of i(-11)? False Is (-3390)/(-25) + (-6)/(-15) a multiple of 31? False Let h(g) be the second derivative of g7/42 + g6/360 - g5/60 + g4/24 + g3/6 - 4g. Let i(z) be the second derivative of h(z). Is 10 a factor of i(1)? True Let k(r) = 22r3 - 4r*2 + 2r - 3. Let s(v) = -44v3 + 9v*2 - 4v + 7. Let c(j) = 5k(j) + 2s(j). Does 21 divide c(1)? True Let h(l) = -4l2 - 5. Let r(y) = 5y*2 + 6. Let p(x) = -4h(x) - 3r(x). Suppose -5o + 5g = 20, -1 - 3 = 4o - g. Is p(o) even? True Suppose -3g = -18 + 3. Let w = 15 + g. Is 10 a factor of w? True Suppose j = -j + 40. Suppose -3g + 19 = -j. Does 13 divide g? True Let g(z) = z*3 - 9z*2 - 2z + 9. Let h be g(9). Let a = 18 + h. Is a a multiple of 4? False Let r(o) = o*2. Let p be (-4)/(-22) + (-42)/(-11). Is 16 a factor of r(p)? True Suppose 0 = -2t + w + w + 6, 0 = -t - 3w - 1. Let j(b) = b + 1. Let c be j(3). Suppose tg - c = 6. Is g even? False Suppose 4y = -13 + 37. Suppose -ym = -m - 5, q + m = 4. Suppose -2w + 14 = -4z, qw + w - 48 = -2z. Is 11 a factor of w? True Let l(p) = -7p + 1 + 0p + 0p - 3. Does 12 divide l(-2)? True Let q(i) be the first derivative of 2i*3/3 - 5i*2 + 6i + 6. Is q(6) a multiple of 3? True Let r = 48 + 2. Is r a multiple of 10? True Suppose 0t + t = 5. Suppose -4d + tm = -29, -2m = 2d + 3m - 7. Suppose -4g + 31 = -0y + 3y, -d = 2y. Is g a multiple of 10? True Let p be 28/20 - (-4)/(-10). Is 3 a factor of -1 + (-21)/(p + -4)? True Let t be (-5 + 15)/(1/5). Let f be t/5 + -3 + 0. Is 20 a factor of 233/f + 2/(-7)? False Suppose 0 = 3q, -2b + 3q = 2b - 24. Suppose 0 = -3m - 2r + 48, -br + 3r = -9. Is 7 a factor of m? True Suppose 2g + 42 = 154. Is 14 a factor of g? True Suppose 23 = 2y - 4b + 11, 5y - 40 = 5b. Suppose -2g + 4n = 3g - 142, -2g + 2n = -56. Suppose 4s - f = g, 3s - 5f = -yf + 34. Is s a multiple of 8? True Let c(q) = 5 + q - q - q*2. Let p be c(0). Suppose 4i - 35 = u, i = -pu + 3u + 2. Is 6 a factor of i? False Suppose 19 + 326 = 5l. Does 17 divide l? False Let f(i) = i3 + 8i*2 + i - 9. Does 9 divide f(-7)? False Suppose 0 = -5h + 2n + 32, 30 = 5h - 4n - 4. Let r(y) = 2y - 6. Let a be r(h). Suppose -3f - 42 = -af. Is f a multiple of 6? False Let g = 24 + 12. Does 6 divide g? True Suppose 0g + 4g - 608 = 0. Suppose -4h = -5t - g, -3h + 2t + 12 = -102. Is h a multiple of 15? False Let p = 53 + -19. Does 34 divide p? True Suppose 3g = -4w + 255, 319 = 8w - 3w + 4g. Does 21 divide w? True Let s(v) = -v2 - 18v - 5. Does 33 divide s(-8)? False Suppose 0 = i - 2f - 18, i - 3f - 28 = f. Let u(o) = 5o2 + 6o - 6. Let n(x) = x*2 - x + 1. Let h(b) = -6n(b) + u(b). Is h(i) a multiple of 20? True Let z be 8/(-52) - 141/13. Suppose 0k = 2j + 2k, 0 = 3j + 4k - 1. Let i = j - z. Is i a multiple of 9? False Suppose -4y = -i - 10, 0y - 2i + 10 = 2y. Let m = y + -15. Is 16 a factor of (m/(-9))/(2/24)? True Let x(q) = 3q - 3. Let z be x(2). Suppose -5i + 209 = 4j, -7j - 3i = -zj - 215. Is 10 a factor of j? False Let g(l) = -10l - 21. Is g(-9) a multiple of 12? False Suppose 2z + z = 24. Is 3 a factor of z? False Suppose 0 = -2h - 3h + 15. Let c = 1 + h. Is c even? True Suppose 0 = -3a + 205 - 67. Does 19 divide (2 - (-1 - 0)) + a? False Suppose -u - 3k + 5 = 0, 5u - 7k - 25 = -3k. Let a(h) = 8h + 2. Let g be a(u). Suppose -2p + g = 4o, 2o + 127 = 5p - 2. Is 10 a factor of p? False Let b = -9 + 6. Is 5 a factor of (-2 - -8) + 1 - b? True Suppose q - 109 = 35. Is q a multiple of 36? True Let f(y) = y3 - 5y*2 - 2y - 3. Let c be 0 + 10 + 4/(-2). Let z be c + (3 + -2 - 3). Is 14 a factor of f(z)? False Suppose -5b + 11 = 3j - 28, 2b - 3j = 3. Does 3 divide (27/b)/((-3)/(-6))? True Suppose 24 = 6s - 0s. Suppose 5m + su = 195, 8u - 55 = -m + 4u. Is 6 a factor of m? False Let v = -33 + 93. Does 10 divide v? True Is 11 a factor of (-144)/(-8) - 2-2? True Let n(b) = b*2 + b - 3. Let g be n(-3). Is 106/g +	{ "pile_set_name": "DM Mathematics" }
Expand (-12b2 + 15b*2 - 8b*2)(-26b2 + 3b*2 + 7b*2). 80b*4 Expand -4s*4 + 4s*4 + 3s*4 + (-2 + 2 + 16s)(11s*2 - 11s*2 - 7s*3). -109s*4 Expand (-44b*3 - 35b*3 + 78b*3)(-b*2 + 3b*2 + 2b*2) + (5b*3 - 7b*3 + 16b*3)(-2b2 + b2 - b2). -32b*5 Expand (-4c*2 + 3c*2 + 3c*2)(3c - c + 0c) + 15 - 15 - 3c3 + (-8c - 5c - 3c)(9c*2 + 2c*2 + 2c*2). -207c*3 Expand (64 - 16 + 84)(-15 - 11b + 15)(3b - 5b + 3b)(0b + 5b - 4b). -1452b*3 Expand (-729q*2 + 218q*2 - 154q*2)(0 - 4q + 8q + 2). -2660q3 - 1330q*2 Expand (3l - 2l + 3l + (-2l + l + 2l)(2 + 0 - 1))(-295l + 178l - 143l)(-3 + 0 - 2 + (2 - 3 + 3)(0 + 0 + 2)). 1300l*2 Expand (820z - 207z + 877z)(0z + 2z + 0z). 2980z2 Expand (109 - 109 + 15a)(10185a - 10185a + 13a3 - a2). 195a4 - 15a*3 Expand 2n*5 - 3n*2 + 3n*2 + (4n3 - n3 - 4n3)(-n2 + n2 - 2n2) + (87n*4 - 16n + 16n)(0 + 0 - n) + 0n5 - 2n5 - n5. -86n5 Expand (-w + w - w2)(-7425 + 11388w - 7430 + 14855). -11388w*3 Expand (-7i + i + 3i)(2 - 34i2 + 64i*2 + 494i - 28i2). -6i*3 - 1482i*2 - 6i Expand (4i + 0i - 5i)(i*4 - 3i*2 + 3i2) - i2 + 3i5 + i2 + (5i - 5i - 4i*2)(-86i3 + 323i*3 + 70i*3). -1226i*5 Expand (0y + 0y + y)((-3 + 2 - 1)(-4y + 4y - y4) - 3y*4 + 0y + 0y) + 298y*3 + 139y*3 + 3y*5 - 251y*3. 2y*5 + 186y*3 Expand (5 - 3 + 0)(-y + 0y + 0y) + y + y - 3y + 2y - 5y + 5y - 4 + 4 + 2y + (0 + 0 - 4)(18 + 8 + 5)(-6y + 4y + 3y). -123y Expand (-62 + 67 + 192)(0o3 - o4 + 0o*3 + (-16o*2 - 17o*2 + 31o*2)(2o2 - o + o)). -985o4 Expand -d2 - 8d2 - 4d*2 + (-9 - 83d + 81d - 11)(-3 + 3 + 2d). -17d*2 - 40d Expand ((-3l - 3l + 4l)(-17 - 214 - 72) - 1 + 2l - 1 + 2l)(0 + 0 - l2). -610l*3 + 2l*2 Expand (6y - 3y + 0y)(-119 + 410 + 5)(0y2 + 0y2 - y2). -888y3 Expand (2 - 4 + 1)(64h - 64h - h*2)((-53 + 28 + 46)(4h - 5h - h) + 4 - 3h - 4). -45h3 Expand (-954 - 36j*2 + 954)(-10 - 3j3 + 10 + 11j*2). 108j*5 - 396j*4 Expand (-5n + 3n + 4n)(-4n + 0n + 6n) + (2n + 3n - 3n)(185n - 7n + 18n) + (3 + 0 + 0)(n*2 - 1 + 1) + (2n - 4n + n)(-n + 0n + 2n). 398n2 Expand (h + 0h - 1 + 0)(3 + 0 + 3)(14h + 144h + 29h). 1122h*2 - 1122h Expand -304z4 + 169z*4 + 163z*4 + (2 + 0 - 4)(2z - z4 - 2z) - 10 + 11 + 3z4 - 2z*4. 31z*4 + 1 Expand (-5u + 3u + u)(-11 - 3 + 1) - 6u + 3 - 3. 7u Expand (1 + 5 + 1)(-5l - 9l - l + (-l - 3l + l)(1 - 2 + 0)). -84l Expand (-15z3 - 16z*3 + 155z*3)(0 + 3 - 1) + (-3z + 3z - 3z)(2z + 2z*2 + 0z - z*2). 245z*3 - 6z*2 Expand (6q*2 + 4q*2 - 4q*2)(2q + 6724 - 7q*2 - 28q - 6727 - 19q). -42q*4 - 270q*3 - 18q*2 Expand (-4 + 0 + 1)(381c2 - 610c*2 + 2300c*2). -6213c*2 Expand (12v - 3v - 6v)((0 - 2 + 8)((3 - 5 + 1)(0 - 1 + 0) + 312 - 119 - 62) + 1 + 4 - 6). 2373v Expand (y - 2y - 3y)(-y3 + y3 + 2y*3) + 2y*3 + 2y*4 - 2y*3 + 57y - 82y - 2y*4 + 0y*4. -8y*4 - 25y Expand (24p - 13p - 8p + 7)((-3 + 1 + 0)(-2p*3 + 0p*3 + 0p*3) + 3p*3 + 1 - 1 + (-3 - 20p + 3)(-p + p - p2) + 0p*3 + 5p*3 - 3p*3). 87p*4 + 203p*3 Expand 10b - 3b + 4b + (-5b + 4b + 3b)(1 + 4 - 3) - 12 - 22 + 69b + 30. 84b - 4 Expand (66 + 11 - 119z + 121z)(-1 - 28 + 1). -56z - 2156 Expand (b*2 + 0b2 + b2)(-1 - 6 + 11 + 2 - 6 + 3 + (-2 + 3 - 3)(0 - 3 + 1) - 3 - 1 + 5 - 3 - 1 + 2 - 1 + 4 + 0 + 62 - 226 - 292 - 141). -1176b2 Expand (-30m - 155 + 77 + 77)(3m + 26 - 53 + 26). -90m2 + 27m + 1 Expand (-i + 4i - i - 3i + 2i + 3i + (4 - 2 + 0)(-i - 2i + 4i) + 0i - 2i + i + 74 - 143 + 58 - 3i)(-4i*2 - 5i + 5i)(-i + 3i + 3i). -40i4 + 220i*3 Expand (0 + 0 + 1)(0g - 28g + 2g) + (0 + g + 0)(-1 + 0 + 2) - 7 + 7 + 8g. -17g Expand (-3 + 3 - 2)(2 - 12 + 34)(-2c + 1 + 7 - 3). 96c - 240 Expand (n*2 + 0n + 0n)(1 + n - 1) - 1136 + 69n3 - 85n*3 + n + 1127. -15n3 + n - 9 Expand (x3 - 2x3 - 7x*3)(x*2 - 211 - 122 + 101 + (2x + 2x2 - 2x)(-1 + 0 - 3)). 56x*5 + 1856x*3 Expand (-20 - 8 - 11)(307s + 56s - 76s)(-3s - s + 5s)(-s + s - s). 11193s*3 Expand (4i - 9i + 19i)(14 + 16 + i - 13). 14i*2 + 238i Expand (114w + 168 - 168 + (w - w - 2w)(-4 + 4 - 3) + 3w + 3w - 3w)(-5w + 2w - 2w). -615w2 Expand ((-1 - 1 + 3)(-1 + 1 - 1) + 4 - 2 - 4 + 2252 - 1179 - 1136)(-5j - 8j2 + 5j). 528j2 Expand (-5n*2 - 5n*2 + 29n*2)(4n3 - 3n*3 + 0n*3) - 3n*5 + 2n*5 + 16n*5. 34n*5 Expand 25i*3 - 94i*3 - 43i*3 + (3i2 - i2 + i*2)(i - i + i). -109i3 Expand (3 - 3 + 2i)(-585i - 578i + 35 + 500i - 168i). -1662i*2 + 70i Expand (4 + 0 + 55)(-2 + 2 + 3v*4) + (2 - 2 + 2v*3 + (0 + 0 - 2v)(-3v*2 - v + v))(4v - 4v - 3v). 153v*4 Expand (-48 + 18 + 2 - 30)(-2y4 - 3y*4 + y - 6y*4). 638y*4 - 58y Expand -3t4 + 4t*4 - 3t*4 + (-15 + 15 - 6t)(-2t*3 + 4t*2 - 4t*2) + (-4t - t*3 + 4t)(3 + t - 3) + 7t*4 + 385t*2 - 385t*2. 16t*4 Expand -1 + i + 1 + (2 + i - 4 + 0)(0 + 3 - 4) + 5661 - 2891i - 5661. -2891i + 2 Expand (28x - 8x + 38x)(2x2 - 2x*2 - 2x*2)(6x - 8x + 6x). -464x*4 Expand (16 - 7r - 16 + (156r - 1 + 0 - 51r)(-4 + 5 - 13))(-4 + 4 - r*2). 1267r*3 - 12r2 Expand (g3 - g*3 + 3g*3)(7710 - 7710 + 8481g). 25443g*4 Expand (2m - 3m - 2m)(-7m - 5m - 10m) - 245m + 2 + 245m + 17m2 - 2m*2 + 2m*2 + 3m*2. 86m*2 + 2 Expand (-1 + 1 + 3y)((-11y + 20y - 11y)(-6 + 2 + 0) + y - y - 10y). -6y2 Expand -7c*5 + 5c*5 - 2c*5 + (7c*2 - 5c2 - c2)(c + 2c*3 - c) + (-16c*3 + 12 - 12)(-5c2 + 0c*2 + 3c*2). 30c*5 Expand (6153446 + 17m*2 - 24m - 6153446)(40m - 5m - m). 578m*3 - 816m*2 Expand (-5 + 0 + 1 + (6 - 5 + 2)(4 - 3 - 2) - 3 + 5 - 3)(-138 - 25 - 266 + t). -8t + 3432 Expand (14y - 3y + 8y - 3y)(13 - 13 - 5y)(201 + 310 + 383). -71520y*2 Expand (-2y*2 - 416236y*3 + 416495y*3 - 6y*2)(-3 - 6y - 2y + 4) - 3y4 + 0y4 + y4 + 4y4 + y4 - 4y*4 + (-4 - 2 + 4)(y*4 + 0y + 0y). -2075y*4 + 323y*3 - 8y*2 Expand 1 - 1 + z + 6z - 4z + 0z + (6z - 2z - 3z)(1 + 2 - 5) - z + 4z + 3z + (2 - 2 - 2z)(3 - 1 - 1) - 2z + 8z - 2z. 9z Expand (3 - 2k3 - 3 + 3 - 3 + k3 + (k - k + k2)(0 + 2k + 0) + (-3k + 0k + k)(-2k2 + k2 - k2))(113k - 69k + 8k). 260k4 Expand v3 - v*3 + 4v*5 + (77v*2 + 194v*2 - 35v*2)(2v2 - 2v*2 + 2v*3) + 18v*2 - 4v5 + v5 + 2v5. 475v*5 + 18v*2 Expand ((0 + u + 0)(1 - u - 1) + (2 - 2 - u)(3 - 2u - 3))((-3 - 4 + 6)(3 - 3 - 2u) + 142u - 910 + 910 + u - 2u + 4u). 147u3 Expand -j5 + 3j*5 - 3j*5 + (-96 - 30 + 19)((-2 - 2 + 3)(-j + j - j5) - 4j*5 + 4j*5 - 2j*5). 106j*5 Expand (-98m - 141m2 + 133m*2 + 32m*2)(-1 - 2 + 1). -48m2 + 196m Expand 11l + l - 2l*2 + 2l + (2l + l - 4l)(l - l + l). -3l*2 + 14l Expand (-3 + 4235o - 3142o + 16100o + 3 + 15358o)(1 - 3 + 4). 65102o Expand 2l5 + 0l5 - l5 + (-3l + l - l)(0l3 + 0l3 - l4) + 32l5 - 42l*5 + 28l*5 + (-4l*2 + 4l*2 - 4l*5)(-2 - 1 + 0). 34l5 Expand -9h + 78h + 31h + (3 - 3 + 1)(-4h + 4h - 2h) - 2h + 4h - 3h + 2 - 2 + 8h. 105h Expand (0z + 0z + z2)(353 + 149 - 2201576z + 2201575z + (2z - 2 + 2)(0 + 1 + 0) + 2z + 0 + 0). 3z*3 + 502z*2 Expand -16m*4 + 6m*4 - 17m*4 + (-41 - 14 - 65)(2m4 - 6m*4 + 2m*4). 213m*4 Expand ((1 - 2 + 3)(-3 + 1 + 0) + (-1 + 4 - 5)(3 + 1 - 6) - 2 - 1 + 4 + 62 + 29 - 8)(-18s + 18s + 2 + 3s3). 252s*3 + 168 Expand ((1 - 2w - 1)(-w + w + w) - 8w*2 + 4w*2 - 12w*2)((-8w - w + 3w)(-3 + 5 - 1) + 19 - 4w - 19). 180w3 Expand (3 + 2 - 3)(8 - 19 + 0)(-10 - 1 - 10)(-5w + 3w + 5w). 1386w Expand (-7p3 + 24p*2 - 24p*2)(-3 - 2 + 3) + (0p + 0p + 2p2)(0p - 4p - p + (p - 3p + 0p)(0 - 3 + 1)) - 38p*3 - 4p*3 + 3p*3. -27p*3 Expand 2 - 36k*3 + 85k**3 -	{ "pile_set_name": "DM Mathematics" }
e -2 - m - (2 + 1). Let y(l) = l*3 + 2l*2 - 4l. What is y(u)? 3 Let w(j) = -j - 7. Let b(g) = g*3 - 5g*2. Let t be b(5). Give w(t). -7 Suppose -3z = -6z - 6. Let u(g) be the third derivative of g6/60 + g5/20 + g4/24 - g2. Give u(z). -6 Let v(x) = x2 - x - 2. Suppose 3y + 2k = -19, -5k - 3 = -3y - 8. Calculate v(y). 28 Let m(h) be the third derivative of -h7/2520 + h6/180 - h4/6 - 4h*2. Let r(j) be the second derivative of m(j). Let p = 12 + -8. Determine r(p). 0 Let q(r) = -6r3 - r2 - r - 4. Let j(k) = k*3 - 5k*2 + 4k - 4. Let w be j(4). Let g(c) = 5c3 + c2 + c + 3. Let p(d) = wg(d) - 3q(d). Give p(-1). 2 Let r be (0 - -1)/1-1. Let u(d) be the third derivative of d4/24 + d3/6 - 7d2. Calculate u(r). 0 Let l(p) = 2p - 5. Let x be l(5). Let v(o) = 0o2 + 4o*2 + 1 - xo*2 + 4o. What is v(5)? -4 Let h = 71 - 70. Let n(k) = -10k2 + k. Determine n(h). -9 Let o(g) = g2 - 8g + 3. Let c be o(7). Let y(l) be the third derivative of 1/4l4 + 1/30l*5 + 0l + 3l2 + 0 + 0l*3. Give y(c). 8 Let k(f) = -13f - 2. Let j(o) = -6o - 1. Let t(a) = -9j(a) + 4k(a). Give t(-2). -3 Let w(y) = 0 + 11 - 2 + y - 7. What is w(-3)? -1 Let v(o) = o. Suppose 0 = 4z + 12 + 20. Let d be (-5)/(140/z)7. Calculate v(d). 2 Let i(g) be the first derivative of -g3/3 + 3g*2/2 - 4g + 24. Calculate i(3). -4 Let y(s) = 5s2 + 7s - 2s - s3 - 3 - 2s*2 - 2s*2. Calculate y(3). -6 Suppose 3i = 6i. Let x be i/(1-21). Let p(k) = k2 + 4. Give p(x). 4 Let d be (-9)/4 + 21/(-28). Suppose 32 = 4a + 8. Let o(n) = a - 1 - 4 + 2n. Give o(d). -5 Let a(p) = p2 - 2p + 3. Let h be 4/14 + (-89)/(-7). Suppose h = 4i + 1. Give a(i). 6 Let i(l) = -l3 - l2 - l + 16. Let b(w) = -w3 - 3w*2 + w + 3. Let f be b(-3). Suppose fc = -4c. Determine i(c). 16 Let o(m) = m + 1. Let t(i) = -6i - 1. Suppose -h + 2 = -u + 3, 0 = 4u - 8. Let q(f) = ht(f) + 3o(f). Suppose 2p = -2, 5d = -2p - 10 - 7. Calculate q(d). 11 Let f(u) = 0 - 1 + 2u - u. Let c(r) = 2r - 31. Let t be c(13). Give f(t). -6 Let w(q) = 0 - 2q2 - 4q + q*3 + 3q - 2q - 4. Suppose 2d = -2t + 12, 3d + 4t = -t + 24. Determine w(d). -4 Let n(j) = 3j*3 + 10j*2 - 2j - 1. Let x(i) = -i3 - i2 - i + 1. Let r(t) = -n(t) - 4x(t). Suppose -4d + 16 = -0. Determine r(d). -11 Let g(y) = -11y2 - 1 + 21y*3 + 19y*3 - 39y*3 - 2 + 10y. Give g(10). -3 Let w(q) = -8 - 4q + q + 2q + 7. Let r = 2 - 2. Suppose r = -g + 3g - 12. Calculate w(g). -7 Let q be ((-16)/6)/(2/(-3)). Let a(k) = 3k + 4. Let w(u) = 2u + 4. Let b(z) = -4a(z) + 5w(z). Calculate b(q). -4 Suppose -45 = 8y - 3y. Let g(b) = b + 6. What is g(y)? -3 Suppose 2z - 14 = b + b, -5z + 2b = -23. Suppose 4k = 3f + 12, 3k - 9 = -zf - 0k. Let n(w) = 3w*2 - 6w*2 + 6 + 2w2. Determine n(f). 6 Let t(u) be the second derivative of u3/3 - 5u2 + 10u. Determine t(7). 4 Suppose m = -5f - 17, 5f + 2m + 6 = 2f. Let i(s) = -s + 5. Calculate i(f). 9 Let f(a) = 414 - 2a + 0a2 - 411 + a2. Suppose 4m = 2v + 3v + 12, m - 5v = 3. What is f(m)? 6 Let s(k) = -5k - 1. Suppose 0 = -2y + 1 - 3. Let w be s(y). Let g(j) = wj + 2 + 4j - 3j. Determine g(-2). -8 Suppose 7v + 5 = -16. Let t(u) = -u*3 - 3u*2 + u + 4. Calculate t(v). 1 Let k = 15 - 13. Let z(l) be the third derivative of -1/8l4 + 0 + l2 + 0l + 1/6l*3. Determine z(k). -5 Let s(x) = -3x + 4. Let w(h) = -7h + 9. Let y(n) = 9s(n) - 4w(n). Let q(j) = -j3 + 5j*2 + 6j + 6. Let r be q(6). Determine y(r). 6 Let t be 3/28/4. Let i(n) = tn - n*2 - 23n*3 - 3 + 22n*3 - 5n*2 + 2n*2. Give i(-5). 7 Let s(t) = 4t - 5t2 + 4t*2 + 7 + 0t. Give s(6). -5 Let v = 11 - 8. Let l(u) = -3 - v + 7 + u. Let f(t) = -t*2 + 7t - 3. Let p be f(6). What is l(p)? 4 Let m(f) be the second derivative of f*5/20 + 5f4/12 + f3/6 + 7f2/2 + f. Let n = -12 - -7. Calculate m(n). 2 Let v(y) be the third derivative of 1/24y*4 - 2y*2 + 1/12y*5 + 0y + 0 - 1/120y6 - 5/6y*3. Determine v(5). 0 Suppose -h = -1 + 5. Let n = h + 9. Suppose -nt - 2 = -27. Let l(r) = r*3 - 6r*2 + 4r + 2. Determine l(t). -3 Let o(l) = -l*2 - 6l + 1. Suppose 0 = 5t - 8 + 33. What is o(t)? 6 Let z(x) = -x3 + x2 - 2x. Let d(g) = g*2 + 4g - 3. Let f be d(-5). What is z(f)? -8 Let l = 3 + -1. Let z(t) = -l + 3t - 4t + 0 + 0t. Let m(v) = 2v*2 - v - 1. Let w be m(-1). Calculate z(w). -4 Let v be 1 + 2/(-8)-4. Let k(z) = 3 - 2z - 2z*2 + 9z3 + z3 - 9z3. What is k(v)? -1 Let k = -2 - -11. Let t(u) = u - 9. Let p be t(k). Let y(s) = 0 + s - 5 + 1 + 0. What is y(p)? -4 Let r(d) = -d3 + 6d2 - 3. Let l(u) = u3 + u. Let t(a) = -2l(a) - r(a). Let b(f) = -f3 - 6f*2 + 9f + 8. Let h be b(-7). Determine t(h). 15 Suppose -2g - p - p + 2 = 0, 5g = -p + 17. Let m(f) = -3f + 1. Give m(g). -11 Let j = 35 + -31. Let i(w) = -2w + 4. Give i(j). -4 Let u(c) = -c3 + c2 - c + 15. Let b(v) = -v*3 + 3v*2 + v - 3. Let o be b(3). Determine u(o). 15 Let k(q) = -8 - 2q + 11q2 - 13q2 - q3 + 8q2. Determine k(6). -20 Suppose -3i - 2i = 0. Let w(a) be the third derivative of ia - 2a2 + 0 + 1/60a*5 - 1/8a*4 - 2/3a*3. Give w(4). 0 Suppose 0 = t + 3t + 8. Let q(b) = -b*3 + 3b + 1. Let v be q(t). Let p(x) = x*3 - 2x*2 + x - 3. What is p(v)? 9 Let h = -13 - -10. Let r(a) = -3a*2 - 4a - 1. Calculate r(h). -16 Let b be (-38)/(-9) + (-2)/9. Let m(w) be the third derivative of w*5/60 - 5w4/24 - w3/6 + 14w2. Determine m(b). -5 Let z(l) be the first derivative of 2l - 6l + 3 + l + l2. Let u(s) = s - 2. Let t(i) = -5u(i) + 3z(i). Give t(-4). -3 Let l(y) = -2y - 16. Let v be l(-11). Let g(m) = -m*3 + 7m*2 - 7m - 2. Calculate g(v). -8 Let d(h) = -h - 1. Let o = 7 + -5. Suppose -2p + 3q - 6 = p, -oq - 8 = p. Calculate d(p). 3 Suppose -20 = -5b, 5g - 24 = 4g - 5b. Let c(s) = -s2 + 7s + 1. Give c(g). 13 Let x = 2 - 0. Suppose -19 - 1 = 5i + t, -19 = 3i + xt. Let c(o) = -o2. Let y(d) = -4d*2 + 2d + 2. Let k(f) = 5c(f) - y(f). Calculate k(i). -5 Let x(s) = 18s + 3. Let n = -1 - -4. Let p(r) = -37r - 6. Let q(l) = np(l) + 5x(l). Let a(k) = -14k - 2. Let z(h) = -8a(h) + 5q(h). What is z(-1)? -6 Let x(p) = -p*2 + 6p + 3. Let m be (-1 - 0) + (-2)/(-2). Suppose 2i - 17 = 5z, mi - 3z + 3 = i. Calculate x(i). 3 Let a(c) = 26c - 42c - c*2 + 7 + 22c. Determine a(6). 7 Let t(h) be the first derivative of h*4/4 + 2h*3 + 5h*2/2 + 7h - 7. Give t(-5). 7 Let y = 2 - -2. Let r = y + -3. Let u(c) = -4c2 + c. Give u(r). -3 Let q(t) = -5t*2 - 13t - 1. Let x(d) = 14d2 + 38d + 4. Let y(p) = -11q(p) - 4x(p). Suppose 0s = -3s + 4o - 2, 2s = 4o + 4. Calculate y(s). 13 Suppose i + 0i = 0. Let u(a) = 3a - 3. Let b(f) = -13f + 11. Let p(s) = -2b(s) - 9u(s). Calculate p(i). 5 Suppose 0 = -5r + 6r - 6. Let d(h) be the second derivative of -h*4/24 + 2h3/3 + h2 + 3h. Let s(b) be the first derivative of d(b). What is s(r)? -2 Let h(l) = 7l*3 + 2l + 1. Let k be 7 + -3 - -2 - -3. Let p = k + -10. Give h(p). -8 Let h(y) be the second derivative of y*3/2 + 3y*2/2 + 2y. Determine h(-3). -6 Suppose -4i + 48 = 4u, -u + 35 = 3i + 9. Let r(w) = -w + 10. Let o be r(i). Let g(p) = -op - p + p - 3 + p2. What is g(3)? -3 Let s(z) be the third derivative of z6/120 - z5/12 - z4/24 + z*3 + 2z*2. Calculate s(5). 1 Let p(x) be the third derivative of 0 - 4x*2 + 0x + 1/24x4 - 1/3x*3. Suppose -5s + 2 = 27. Determine p(s). -7 Suppose 0 = -3c - 9 - 0. Let q(w) = -2w + 3. Calculate q(c). 9 Let r(k) = -7 - 2k3 + 3k*2 + 5 + 5k + k*3. Suppose -4j = -10 - 6. Determine r(j). 2 Let y(a) = 6a3 + 11a*2 - 14a - 15. Let o(x) = x3 + x2 - x - 1. Let r(f) = 5o(f) - y(f). Give r(-7). -4 Let w(x) = -6x*2 + 9x + 2. Let b(m) = 5m2 - 8m - 2. Let j(a) = 5b(a) + 4w(a). Determine j(6). 10 Let o = 0 - -1. Let g(f) = -2f3 - 6f*3 - 2f + f. Determine g(o). -9 Let x(v) be the third derivative of v6/120 + v5/10 + 5v4/24 - v3/3 - 5v*2. Calculate x(-5). -2 Let m be 34/(8/6). Suppose 3i = 3h + 24, m = -5h - 3i - 15. Let s(z) = -2z - 9. Determine s(h). 3 Let o(b) = b2 + 6b +	{ "pile_set_name": "DM Mathematics" }
vative of 6a3k*2 - 3965a*3k - 72a2k + 3a2 - 6685815ak5 wrt k. 12a*3 - 133716300ak3 What is the second derivative of 8406f*2k*2 + 3111f*2k - 2f2 + fk*2 + 574fk - f - 341k*2 + 1 wrt k? 16812f*2 + 2f - 682 What is the third derivative of -2552r3x*3 - 6679r*3 - 299078r2 + x3 - 7x wrt r? -15312x*3 - 40074 Find the second derivative of -11a*2v*2 + 18282a*2 - 199211av2 + 39av + 2v*2 + v wrt v. -22a*2 - 398422a + 4 Find the third derivative of 2519073s3w*2 + 30s*2w*2 + 63870w*2 wrt s. 15114438w*2 Find the third derivative of -1280006119x*3 - 4122758x2 - 65. -7680036714 What is the derivative of -k2r - 3k*2 + 2kr - 5486726k - 3155672r + 6 wrt k? -2kr - 6k + 2r - 5486726 What is the second derivative of s3 - 321124290s*2 - 9203s + 5489? 6s - 642248580 What is the derivative of 5263w*2 + 33w + 106849407? 10526w + 33 Differentiate -1023z*3 + 244z*2 - 5z - 1315044 with respect to z. -3069z2 + 488z - 5 What is the third derivative of 827228431b3 - 140858380b*2? 4963370586 What is the third derivative of -439632810g*5 + 62062g*2 - 14g - 12? -26377968600g2 Find the third derivative of -125874379o*4 + 454o*2 - 3o - 7448. -3020985096o Find the third derivative of -170304z*6 + 430z*3 + 9z*2 + 8827011 wrt z. -20436480z*3 + 2580 Find the third derivative of -918560d*4 - 2d*2 - 1604795d + 2 wrt d. -22045440d Find the second derivative of 1043281ak2 - 200ak - a - k - 606 wrt k. 2086562a Differentiate 3855876x3 - 16421608 wrt x. 11567628x*2 Find the second derivative of 5z*4 - 109204z*2 + 10223312z wrt z. 60z2 - 218408 Find the third derivative of -29i*4s - 7i4 - 11i*3s + 14i3 - 4i*2s - 3098816s wrt i. -696is - 168i - 66s + 84 Find the first derivative of 13999484y*3 + 1003402435. 41998452y*2 What is the first derivative of -18521c*4 + 385c*3 + 6506937? -74084c*3 + 1155c*2 Differentiate 310058333m*3 + 552263420. 930174999m*2 Find the third derivative of -40820779w*3 + 3110w*2 + w + 3142. -244924674 Find the second derivative of 23884440j*4 - 288013598j. 286613280j2 What is the second derivative of 360800sy2 + 1021sy + 2s + 3y2 - 2023y - 4 wrt y? 721600s + 6 What is the third derivative of -26917381y*4 - 16054819y*2 wrt y? -646017144y Find the third derivative of 8351l4m*3 - 86l*4m - 14l2m*3 + 2976lm2 - 9m*3 wrt l. 200424lm3 - 2064lm Find the second derivative of -37702u*4 + 57u*3 + 12094900u. -452424u2 + 342u What is the derivative of -1252y4 + 4y*2 - 69y - 13610878 wrt y? -5008y3 + 8y - 69 What is the derivative of -7889j2 + 1048j + 24099712? -15778j + 1048 Find the first derivative of -2470136a + 4550404 wrt a. -2470136 Differentiate -7sw*3 + 8189783sw2 - 14012w*3 - 2w*2 - 304w + 1 with respect to s. -7w3 + 8189783w*2 What is the second derivative of 57c*3 - 274647c*2 - 8c - 2767610 wrt c? 342c - 549294 Find the second derivative of 2769g*2q*2 - 779g*2 - 3gq2 + q2 - 88828822 wrt g. 5538q*2 - 1558 What is the third derivative of -67468034c*3 + 67546610c*2 + 2 wrt c? -404808204 What is the second derivative of -261648286a*3 - 69740471a? -1569889716a Find the third derivative of -184384416o*4 - 2o*2 + 8544189o wrt o. -4425225984o Find the third derivative of -318c*2j*3 - 3575c*2j*2 - 41085cj3 - 1195j wrt j. -1908c2 - 246510c What is the third derivative of -778l5 - 11767l*3q*2 + 4297l*2q*2 - 1078l*2 wrt l? -46680l*2 - 70602q*2 What is the second derivative of 11535716s*5 + 4s*2 - 3s + 92540342? 230714320s3 + 8 What is the derivative of -3355649kq2 - 441q*2 + 6q - 11 wrt k? -3355649q2 What is the first derivative of -75488785t*3 + 59960699 wrt t? -226466355t*2 Find the first derivative of 13378307i - 11772703. 13378307 Find the second derivative of -124496958r5 + 83065467r. -2489939160r3 What is the second derivative of 15l*2u*3 + 140791l*2 + 13lu3 - lu - 7l + 3u*3 + 4 wrt l? 30u*3 + 281582 Find the second derivative of -10825562k*2 - 2k - 3491200 wrt k. -21651124 Find the first derivative of 1617959l2 + 6203962. 3235918l Find the first derivative of -2pv*3 - 3pv2 - 4162p - 62990v + 256 wrt v. -6pv2 - 6pv - 62990 Find the second derivative of 3029g*3p*5 + 19538g*3p*2 + 18323712g*3p - g*3 - 2g wrt p. 60580g3p*3 + 39076g*3 What is the first derivative of 705645115f*2 + 196655469 wrt f? 1411290230f What is the derivative of 337357134f2m - 2448940m + 2 wrt f? 674714268fm Find the second derivative of 44n*2y*2 + 33n*2y - n*2 + 6123ny2 + 2ny + 2n + 90y2 + 38283y wrt y. 88n2 + 12246n + 180 What is the second derivative of 21874432m2 + 1479209m + 3? 43748864 What is the second derivative of -166z5 + 173977z*4 + 119z - 58740 wrt z? -3320z3 + 2087724z*2 What is the derivative of 170033316b - 14159074 wrt b? 170033316 Differentiate 2t3 + 564t*2 + 52759t + 335935465. 6t2 + 1128t + 52759 Find the third derivative of 2c5g + 69c3g*2 - 18346c*3 - 5351c*2g*2 + 10c*2 + 2cg2 - g2 - 116 wrt c. 120c*2g + 414g2 - 110076 What is the third derivative of -10092105u*5 - 3u*4 - 3u*2 + 86597u + 7 wrt u? -605526300u2 - 72u What is the second derivative of 11r2t*3 + 47r*2t*2 + 305r*2t - 2rt*2 + 194486rt + t3 wrt r? 22t*3 + 94t*2 + 610t What is the second derivative of -7717856n3 + 7820850n wrt n? -46307136n What is the second derivative of 6370466p*5 + 5409709p? 127409320p3 What is the second derivative of -234s*3 - 590s*2 + 22705716s wrt s? -1404s - 1180 Find the first derivative of -1083550co - 10682711c + 2o wrt o. -1083550c + 2 What is the first derivative of 2ru + 199772879r - 113280627u wrt r? 2u + 199772879 Find the third derivative of 3m*2v*3 + 3m*2v*2 - 20m*2 + 268841mv3 + 6353mv2 + mv + 2v3 + v2 wrt v. 18m*2 + 1613046m + 12 What is the derivative of -65280746f3 - 113058353? -195842238f*2 What is the second derivative of -283749276g*5 - 2820740g - 8 wrt g? -5674985520g3 What is the derivative of -70094863z - 50418898? -70094863 Differentiate -3pu*3 + 3856400pu + 48116145p with respect to u. -9pu*2 + 3856400p Find the third derivative of -7009370u6 + 4u*5 - 73150251u*2. -841124400u*3 + 240u*2 What is the derivative of -8573796cv + 56c - 16850 wrt v? -8573796c Differentiate -249226c*4u*2 - 40c*2u*2 + 2434u*2 - 23914u wrt c. -996904c3u*2 - 80cu2 What is the third derivative of 228b*4 - 1237b*3 - 9129733b*2? 5472b - 7422 Find the second derivative of -16115699m2 + 7320094m wrt m. -32231398 What is the first derivative of -9358953c + 18115545? -9358953 What is the third derivative of 47970450h*5 + 2396991h*2 + 53h wrt h? 2878227000h2 Differentiate -2328hs - 17901195h - 1013s wrt s. -2328h - 1013 Find the second derivative of -66053761a2 - 325183327a wrt a. -132107522 Find the second derivative of -2puy2 + pu + py2 + 33000p + 16uy*2 + 5uy + 5509y*2 wrt y. -4pu + 2p + 32u + 11018 What is the third derivative of 259913n*4u - 106n4 - 2n*3 - 3691n*2u + 36148nu wrt n? 6237912nu - 2544n - 12 Differentiate -5310869v*2 - 24973274 with respect to v. -10621738v Find the first derivative of -3533784y3 - 327315 wrt y. -10601352y*2 What is the second derivative of 566k5 - k4 - 15k2 + 2583884k? 11320k3 - 12k*2 - 30 Differentiate -5c*3w - 63755c3 + 341087c*2w + 2c2 + 3c + w + 3 with respect to w. -5c3 + 341087c*2 + 1 Find the third derivative of 6595472o*3r*3 + 647379o*3r - 4r2 wrt r. 39572832o*3 Differentiate 294955p*4 + 814p + 526317444 wrt p. 1179820p3 + 814 What is the second derivative of -10d*4 + 3274198d*2 - 3632d - 7183 wrt d? -120d2 + 6548396 What is the second derivative of 62984796u*2v - 2uv - 14369918v - 2 wrt u? 125969592v What is the third derivative of 81753i3r**3	{ "pile_set_name": "DM Mathematics" }
mplify (t/(t*2t))/t*(1/8)(t(-1/2))(24/7)(t(2/3)tt(2/7))/((t(-7)/t)/(ttt(-4/5))) assuming t is positive. t(6143/840) Simplify (s/(ss*1s))*41((s/(ss(-2)/s))/ss)/(s/(ss(-1/7)s))(s(-1/2))(6/11)/((ss(-2/7))/s)(2/65) assuming s is positive. s*(-392426/5005) Simplify (ss*(-16)ss4s*(-6/11)/(ss12))(2/107) assuming s is positive. s(-518/1177) Simplify r(2/19)/(r/(r*(-3/34)/r))r*14((r/(r*(-3)r))/r)/r assuming r is positive. r(8409/646) Simplify (((j(2/5))*(-6/25)j(-2/7)/j(1/3))(-1/5))(-2/3) assuming j is positive. j(-3754/39375) Simplify (c5c/c(2/7)c(c1c)*9)/((c/(cc*0cc))(-26))(26/3) assuming c is positive. c(-8945/21) Simplify (ppp/(p(1/3)p))*(1/7)(p(-2/3))(-39)(p(-1)/p)4(p*(-2/5)p)1 assuming p is positive. p(1978/105) Simplify (((ii15i)/i)*(7/6)ii(ii(2/45))/ii(-19))44 assuming i is positive. i*(3388/45) Simplify ((uu*4uu(u/u(-1/2))/u)/(u/(u(-2/7)/u))*(-1/9))/(uu*(-2)u*(-1/4)(uu0u)(-30/7)) assuming u is positive. u(4429/252) Simplify ((((a/(a/(a/(a*(-8)a))a))/(a/(a/(a(2/5)a))))/(a*3a)31)(-9/10))(-5/6) assuming a is positive. a(-444/5) Simplify (cc/(cc*(-2/7))(c(-1/3)/c)/c)(15/4)(c(1/6)/cc(-2/9))/(c(1/4)/cc6c) assuming c is positive. c(-2831/252) Simplify ((k(-2)/(k(kk(k(-2/13)/k)/kk)/kk))/(k1)28)/(k(-4)((k*(-1)/kk)/k)/kk(-3/5)/(((k6/kk)/kk)/k)) assuming k is positive. k(-1251/65) Simplify ((y(2/99)y/y(-2/83))0)22 assuming y is positive. 1 Simplify (f(-31)f(-35)/ff)/(f*(-1/11)ff(2/57)) assuming f is positive. f(-41974/627) Simplify ((p/p6)(-2/117)p/p*(-29)pp/((p/(p/((p(1/13)p)/p)))/p))42 assuming p is positive. p(54068/39) Simplify ((aaaa3aa(-9))/(((a/a(4/17)a)/a)/((a/a(-14))/a)))(-38) assuming a is positive. a*(-7258/17) Simplify (((w((ww(-1)/w)/ww)/w)/w)(-18))(2/59)(w/(ww/w(-1)))24/(ww(-2)w/(w/w(-5/4))) assuming w is positive. w(-10509/236) Simplify ((v*(2/9)v/(vv/((((vvv34)/v)/v)/v)))/(v(-4/3)/vv(7/5)))(2/45) assuming v is positive. v*(2984/2025) Simplify (((ii*1i)/i)/(ii/(((i/i(-1)i)/i)/i)))/(ii2/iii/i2i)(ii*3i/i(1/7))(-1/21) assuming i is positive. i*(-328/147) Simplify ((tt/(t/(tt/(t/(tt/(t*2/t)))))t)/((t/(t/(t*(1/6)t)))/t))/(t*(-1/3)t/(t*(2/5)/tt))(t(-6)/t0)(-24/7) assuming t is positive. t(5069/210) Simplify (((n(n/(n/(nn(-2/45))n))/nn)/nn)/((n/n*(-2/25))/nnn)n(-32)/(n/n(1/22)))(-3/10) assuming n is positive. n(168691/16500) Simplify (((r/r(-2/3))/(r3r))/(rrr1rr)(-2/3))/((r/(((r/(rr/r*0))/rr)/r))*(-50)rr(-6)r*(-1)rr) assuming r is positive. r155 Simplify ((ww*(-2/5)w)(-23))36w(ww7w)/ww(-5)(w/((www*(2/3)www)/ww))(1/36) assuming w is positive. w(-356651/270) Simplify ((ww1)(-1/21)(w(-1/3))(-3/2))/((w/(w(ww6)/w))/www(2/19)/w)(-17) assuming w is positive. w(-93211/798) Simplify (q(-20)q*(-2/5)q)/((q*39q)/(qq/((q(1/5)q)/qqq))) assuming q is positive. q(-298/5) Simplify (h(3/8)hh(-4)/h)34((h(2/9))(-8/7))(-3/5) assuming h is positive. h(-51701/420) Simplify ((m3/m)27)(-14)/((m(mm(-2/3))/m)(-4/11)m*(1/8)m(2/7)) assuming m is positive. m(-1397623/1848) Simplify (m*(-2/15)m(m(mm(-1/8)/mm)/m)/m)/(m*4/((m(m/(m*(2/5)m))/m)/m))(mm0)(-24)(m/(m(1/4)m))30 assuming m is positive. m(-4339/120) Simplify ((o(-1/8)/(o/(o/o(-4))))/(o*(1/4)(o*(-6)/o)/o))/((ooo7)/(o(-1)o))(-1/33) assuming o is positive. o(1047/88) Simplify (tt(-2/5))19/(t(1/3))(-6/5)((t/t(-2))/t(1/9))/(t/t*(-8)t7) assuming t is positive. t(-59/45) Simplify o/o*(1/6)o/o*(-5/6)(o*(-4)oo)/oo*(-2/5)/o(o/(o*(-1/4)o))*28o/o*4o/o(-1/6) assuming o is positive. o(103/30) Simplify (k(-16)/k(12/7))*(-1/40)/((kk/(kk1))50(k/k*(-1)k)(-3/11)) assuming k is positive. k(971/770) Simplify bb5b*(2/15)bb(((b*(-3/4)bb)/b)/b)/bb*(2/5)((b*1b)/b(-8))/(b(1/5)/(bb(3/7))) assuming b is positive. b(1513/84) Simplify ((j(2/5))(-4/15))(-46)(j(-1))(-7/5)/((j((j4jj)/jjjj)/j)/(jj(2/13))) assuming j is positive. j(-526/975) Simplify (g(1/13)g(-1))(-50)(((gg(5/4))/g)/g4)(-25) assuming g is positive. g(5975/52) Simplify ((u*12/uuu27)/(u/(uu7))(1/42))30 assuming u is positive. u1175 Simplify (((t0)(-15)tt*7(tt(5/4))/t)(-10/9))44 assuming t is positive. t(-4070/9) Simplify (((u(-1/21)/uu)/u(u/u(-7/3))/u)/(uuu(-1/5)uu(-26)/u))18 assuming u is positive. u(16056/35) Simplify (((j(jjjjj/j*(-2)j)/j)/jj)(6/29))(-38)(j*(1/4)j((j/(j/(jjj(-2))j))/j)/j)2 assuming j is positive. j(-3851/58) Simplify (d(-1/7)/((d(5/4)/d)/dd))/((d5d)/ddd/(d/d*(-2/13)))((d*1d)(-6/7))(-1/8) assuming d is positive. d*(-2193/364) Simplify ((kk/k(1/4))/k(-5)k(-1/5)k*3k)/((k/(k/k*(-4))k)/(k/k(-4)))(-33) assuming k is positive. k*(-5069/20) Simplify ((rrr/(rr*(2/5)r)rrr)/(rr(-3/5)))12(r(-2/11)r(2/7)/r)/(r(-3)/rr(1/4)/r) assuming r is positive. r(65071/1540) Simplify (q(-2/11)/q(8/7)(q/(q/q2))(-41))(-1/63) assuming q is positive. q(6416/4851) Simplify ((s(-1))(3/25))*(2/15)/(((ss*(-3/2))/ss(s(1/2)s)/s)/(s(-3)/(s1/s))) assuming s is positive. s*(-377/125) Simplify (rr*(-2/15)r*(-1/11)r(3/7)/r(-8))/((r(-3/11)/r)/r1)(3/4) assuming r is positive. r(50399/4620) Simplify (z/(zzz*(-15)z))*(-34)(z(-9))(2/95) assuming z is positive. z(-42008/95) Simplify ((g(-9)g(-1/6)ggg*2gg(-4)gg)37)33 assuming g is positive. g(-15059/2) Simplify (((g/g(-6)g)/gg)/ggg(-1/4)g(gg*(-5))/ggg2/g)/((g(2/3)gg)(-3/31))(-21) assuming g is positive. g(41/124) Simplify (cc*15c*(-5)/ccc)(-46)(c*15c(-11))(1/7) assuming c is positive. c(-3860/7) Simplify (g(-13)g/(ggg/g10)g/(gg(7/5))gg/((g/(g/g(12/7)))/g))25 assuming g is positive. g(-895/7) Simplify (v(-39)/((vv26)/v))/((v/(v(10/11)vvv))/v(-3/28)) assuming v is positive. v(-19157/308) Simplify (n(-1)/(n/((n4n)/n))n(-4)n*(1/3)/n)/((nn(1/4))(-1/18)n(-3/7)/n(-2/5)) assuming n is positive. n(-6473/2520) Simplify ((g18/(g/(gg/g*(-25))))/(g(g(g/(g10g))/g)/ggg)11)(1/12) assuming g is positive. g*11 Simplify (yy*(-10)yy(1/11)y*(1/14)y/y13)39 assuming y is positive. y(-119145/154) Simplify (b5b)/(b/b(-8)b)b(2/3)(bbb/b*(-4/9))/b(b*(-3)b)/((b/b*(-4/3))/b)b/((bb(-9)b)/b)bb(2/15) assuming b is positive. b(266/45) Simplify w(-6)/(w(-7)/w)(w(w1/w)/w)2((w/(w/(w(-1/6)w)))/ww(-2/13)ww)(14/5) assuming w is positive. w(1307/195) Simplify ((s0)(-16/5)((s/(s/(s(s(-2/21)/s)/ss)))/ss)/(s5s))/(((ss1/ss)/s(-4/7))/(s(2/7))22) assuming s is positive. s(-50/21) Simplify (z/(z/(zz(-2)))(z/((z2/z)/z))/z)(25/3)/((zz(-2/7)/zz)*0(zz/((z(-8)z)/z)z)/(zz2)) assuming z is positive. z(-49/3) Simplify (v1/v(-2/11))/((v/v*(-2/5)vv)/v3)(v(2/3)/v)/(v(-2/3)/v)v(-2/7)/(vv3) assuming v is positive. v(-2507/1155) Simplify (((bb/(b(-2/7)b))/b)*(35/3)b*(-16)/(bb(-1/3)/b))(-29) assuming b is positive. b(1073/3) Simplify ((y7/(y6/y))/(y(-4/5)y/(y/(y(-5)/yyy))))/(y/(yy/y*4)y0)(-35) assuming y is positive. y(559/5) Simplify (r(2/13)/(r/((r/r*(-3/8))/r)r))0/((r(-2/7))*(12/7)/(rr/r*(-2/11)r7)) assuming r is positive. r(5213/539) Simplify ((k*13(kk(4/3))/k)/(((k/((k(-21)k)/k))/k)/k(-17)))(-41) assuming k is positive. k(2911/3) Simplify (((z(-5)zzzzz(-5/4)z)(-11/4))(-4/5))29 assuming z is positive. z(-319/4) Simplify (((v*(3/7)v)/v)(4/19)/(v2)(-1/39))(-23/5) assuming v is positive. v(-16882/25935) Simplify (x(4/7)/(x*(1/4)/x)x*(-8)x6)/((x(-2/9)xx)(-2/17))(30/13) assuming x is p	{ "pile_set_name": "DM Mathematics" }
= -m - m + jm. Let w(k) = -k + 14 + 0k - 14. Give y(w(v)). 2v Let a(z) = 3z*2. Let q(u) = 12u + 4. Let r(b) = -10b - 3. Let m(k) = -3q(k) - 4r(k). What is m(a(v))? 12v2 Let y(m) = m2 + 91 + 4m2 - 91. Let p(c) = -7c*2. What is p(y(q))? -175q*4 Let o(w) = -4w*2 + 9w - 27. Let j(u) = -u*2 + 2u - 6. Let x(n) = -9j(n) + 2o(n). Let v(z) be the first derivative of z3/3 + 1. Determine x(v(l)). l4 Let s(j) = 0 + 2j + 3j + 6. Let o(d) = d. Let i(t) = 2o(t) + s(t). Let m(p) = -20p - 17. Let z(h) = -17i(h) - 6m(h). Let x(a) = 2a. Give x(z(w)). 2w Let w(b) be the first derivative of -4b2 + 3. Let u(j) = -j. Determine u(w(v)). 8v Let n(s) = 2. Let h be -1 + 1/(-2 + 1). Let p = h + 4. Let q(l) = l + 3. Let b(x) = pq(x) - 3n(x). Let k(f) = -2f. Give k(b(w)). -4w Let x(y) = 2y2. Suppose -t - 3n + 2 + 6 = 0, -2n + 12 = 4t. Let p(i) = 0it + 3i*2 + 0i*2 - 4i*2. Calculate p(x(r)). -4r*4 Let h(g) = -189g. Let d(x) = 5x2. Determine h(d(a)). -945a*2 Let k(n) = -n. Let b(y) = 57y*2. What is b(k(t))? 57t*2 Let o(w) = -95w*2. Let k(r) = -8r*2 + 5r + 5. Let p(x) = -2x2 + x + 1. Let z(t) = -k(t) + 5p(t). Give z(o(m)). -18050m4 Let p(l) be the first derivative of l5/30 - l2/2 - 1. Let w(s) be the second derivative of p(s). Let f(c) = 5c*2 - 8c*2 + 0c*2. What is w(f(o))? 18o*4 Let a(d) = -226d*2. Let c(j) = 2j. Determine c(a(y)). -452y2 Suppose -4r = -2a - 38, -a = 2r - 5r + 31. Let o(v) = r - v2 - 12. Let l(k) = -k. Calculate o(l(q)). -q2 Let w(b) = -b. Let x(u) be the third derivative of 0u*3 - 2u*2 + 0 + 0u + 1/24u4. Give w(x(o)). -o Let o(c) = 5c. Let x(y) = -66y. Let l(t) = -27o(t) - 2x(t). Let h(i) = -25i*2. Calculate h(l(n)). -225n*2 Suppose 2x + 4r - 24 = 0, 2x = 7x - 5r + 15. Let a(g) = -5g2 + gx + 2g*2. Let t(f) be the first derivative of 4f*3/3 - 15. Determine a(t(y)). -32y4 Let g(s) be the third derivative of s5/60 - 2s2. Let r(i) = -7i. Calculate r(g(q)). -7q2 Let n(h) = -28h*2 - 2h. Let q(k) = 3k - 12. Give n(q(o)). -252o*2 + 2010o - 4008 Let p(h) = 2h. Let z(s) be the second derivative of -2s*3 + 5s. Give z(p(n)). -24n Let x(o) = -6o*2. Suppose -5t = -13 - 2. Let c(n) be the first derivative of 0 + 2n2 - tn*2 - 1 - 3. Give x(c(w)). -24w*2 Let o(g) = 76g*2. Let s(f) = -4f*2. What is s(o(j))? -23104j*4 Let l(o) = -2o. Let k(i) be the second derivative of 4i + 0 - 1/6i*3 + 0i*2. What is l(k(s))? 2s Let u(s) = -5s2. Let t(z) = -63z - 24. Let h(x) = 13x + 5. Let v(w) = -24h(w) - 5t(w). Determine u(v(a)). -45a*2 Let j(g) = -552g*2. Let v(t) = -8t. What is v(j(q))? 4416q2 Let k(d) = -540d. Let q(h) = -12h. What is q(k(p))? 6480p Let p(s) = 2 - 2 + 3s. Let g(u) be the second derivative of -u3/3 + 2u. What is g(p(f))? -6f Let i(z) = -3z*2. Let p(m) = -6m - 4. Let s(x) = -13x - 9. Let v be 1/(((-15)/12)/5). Let f(w) = vs(w) + 9p(w). Give i(f(c)). -12c2 Let m(n) be the first derivative of n3/3 - 21. Let i(r) = 2r2 + 2r - 2. Let f(p) = p + 9p - p + 8p*2 - 9. Let w(k) = -4f(k) + 18i(k). Give w(m(v)). 4v*4 Let p(g) = 5g + 8. Let u(c) = -3c - 5. Let y(o) = 5p(o) + 8u(o). Let h(s) = 21s. What is y(h(n))? 21n Let t(v) = 271v*2. Let g(m) = -4m. Determine t(g(a)). 4336a2 Suppose -4l - 2f = -2, 4f + 1 = -3l - 5. Let o(t) = 4t2 + t2 - 4tl. Let h(j) = 2j. What is h(o(q))? 2q2 Suppose -27 - 11 = -4c + 5l, 3l = 6. Suppose -3m + 6 = -c. Let w(v) = 4v - m + 6. Let i(b) = -b*2. Give w(i(o)). -4o*2 Let d(j) = 3j*2 - 4. Let y(i) = 3i*2 - 3. Let u(f) = -3d(f) + 4y(f). Let x(h) = 4h*2. Give x(u(s)). 36s*4 Let g(q) = -4q*2. Let d(x) be the second derivative of 0x*2 - 2x + 1/12x4 + 0 + 0x*3. Give g(d(v)). -4v*4 Let g(f) = 17f*2 + 3f. Let q(d) = -35d2. Give g(q(m)). 20825m*4 - 105m*2 Let b(u) = 6u*2. Let k(m) = -3m - 5m + m + 3m. What is b(k(a))? 96a2 Suppose -3p + 0p = -6. Let m(d) = -8d + 8d - dp + 4d*2. Let z(k) = k + 3 - 3. What is z(m(h))? 3h*2 Let u(c) = -3893c*2. Let h(d) = -d. What is u(h(z))? -3893z*2 Let n(h) = -1022h + 1. Let o(c) = -9c2. Give o(n(j)). -9400356j*2 + 18396j - 9 Let y(z) = -9z2 + 4. Let a(n) = n - 8 + 8 - 3n. Determine y(a(d)). -36d2 + 4 Let p(k) = -k. Let l(z) be the third derivative of -3z*4/4 + 25z*2. Determine p(l(b)). 18b Let r(c) = 4c + 5. Let p(l) = 3l + 4. Let s(w) = 5p(w) - 4r(w). Let m be 2/6 + (-15)/(-9). Let g(k) = -2 + m - 2k. What is g(s(h))? 2h Let c(h) = -h*2. Let w(p) = -4p - 3. Let l(q) = -9q - 10. Let r(n) = -18n - 21. Let z(k) = 7l(k) - 3r(k). Let t(s) = 7w(s) - 3z(s). Give c(t(g)). -g*2 Let r(j) = -10j. Let q be (6(-6)/9)/(-2). Let w(h) = -h + 2h*2 + qh - h. What is r(w(g))? -20g2 Let x(l) = -3l. Let j(s) = 21s2. What is j(x(g))? 189g*2 Let s(w) = 3w*2. Let o(g) be the first derivative of 2g*3/3 + 3. Determine o(s(t)). 18t*4 Let p(i) = 11i. Let o(j) = -j + 6j - 2j. Calculate p(o(x)). 33x Let x(v) be the first derivative of 3v*2/2 + 7. Let n(d) = 9d. What is x(n(j))? 27j Let f(p) = -5p*2. Let c(g) = -137g. Determine f(c(q)). -93845q2 Let z(v) = -2v*2. Let y(f) = f + 2. Let d(m) = 3m + 9. Let g be 2/(3/3) + 0. Let r(l) = gd(l) - 9y(l). Determine r(z(u)). 6u2 Let v(k) = 203k + 34k2 - 203k. Let o(m) = -2m. Calculate v(o(l)). 136l2 Let c(j) = j2 - 12j. Let k(h) = 8h*2. What is c(k(q))? 64q*4 - 96q*2 Let p(l) = 4l*2. Let z(t) = 87t*2. What is p(z(n))? 30276n*4 Let w(n) = -149 - 12n*2 + 149. Let m(t) = 7t*2. Determine w(m(l)). -588l*4 Let l(t) = 3t2. Let r(i) = i2 + 5i - 5. Let d = -12 - -22. Let q(k) = k - 1. Let n(x) = dq(x) - 2r(x). What is n(l(v))? -18v*4 Let k(y) = y. Let p(x) = 3x*2 + x - 2. Let h be p(-2). Let b(s) = 20s - hs + s2 - 12s. What is k(b(w))? w*2 Suppose -5b - 16 = -3w, 2w - 5b - 18 = -2w. Let v(j) = -8 - wj + 8. Let q(u) be the first derivative of u2/2 + 15. What is q(v(x))? -2x Let w(d) = d*2 + 10d. Let y(m) = 5m. What is w(y(b))? 25b*2 + 50b Let c(k) = -4k2. Let j(q) = -8571q. Calculate c(j(y)). -293848164y2 Let i(c) = c2 + 2. Suppose -t = -5t + 4v - 4, -5 = -5v. Let d be i(t). Let g(n) = -n + dn + n. Let x(z) = -z. What is x(g(h))? -2h Let k(q) = -5q + 2q*2 + 5q. Let z(g) = -17g2 + 12g*2 + 4g*2. Calculate k(z(v)). 2v*4 Let l(b) = 166b. Let v(w) = 10w. Calculate l(v(o)). 1660o Let o(m) = -4m2 - 2m. Let l(z) = -4z. Calculate o(l(x)). -64x*2 + 8x Let i(y) = y*2. Let k(r) be the second derivative of -1/4r*4 + 0 + 0r*2 + 0r*3 - 2r. Calculate k(i(v)). -3v4 Let a(n) = 8n*2. Let i(l) = 16l. Give i(a(q)). 128q2 Let g(q) = -q2 + 246. Let l(u) = -13u. Determine g(l(m)). -169m2 + 246 Let n(g) = -g + 1. Let f(s) = s2 - s + 1. Let i(q) = -f(q) + n(q). Let d(c) = 11c*2. Give i(d(x)). -121x4 Let c(t) be the second derivative of -t3/6 + 3t. Let g(n) = -5n - 6. Calculate g(c(k)). 5k - 6 Let m(q) = -8q. Let v(i) = 4i + 2i - 3i - 2i. Calculate v(m(a)). -8a Let g(b) = 4b. Let c(k) = -1. Let o(u) = -4u - 4. Let h(a) = 4c(a) - o(a). Give g(h(z)). 16z Let b(n) = 1 - 1 - n + 0. Suppose -11 - 14 = -3r + 2s, 2s - 15 = -5r. Let c(i) = 0i + 4i - ri + 5i. Determine c(b(d)). -4d Let a(v) = -3v. Let s(o) = -148o. Calculate a(s(y)). 444y Let a(p) = 394p. Let c(x) = x*2. What is a(c(z))? 394z*2 Let o(v) = 4v. Let z(b) be the first derivative of 1/2b2 + 0b + 4. What is o(z(k))? 4k Let i(h) = 15 - 6 + 4h*2 - 9. Let p(f) = 4f. Determine p(i(w)). 16w2 Let f(a) = -3 + 3 + 10a - 4a. Let d(l) = -3l*2. Give d(f(w)). -108w*2 Let q be (-3)/6(-7 - -1). Let u(l) = -ql - 3l + 5l. Let n(r) = -4r*2 - 4r*2 + 6r*2. Calculate n(u(w)). -2w*2 Let f(h) = 19h - 253. Let x(o) = -2o2. Calculate x(f(m)). -722m*2 + 19228m - 128018 Let x(y) = -y. Let z(p) = -2p. Let j be z(-3). Let h(c) = jc + 10c + 0c - 22c. Determine h(x(l)). 6l Let u(g) be the third derivative of g5/30 - g3/2 + 2g2. Let r(n) be the first derivative of u(n). Let s(w) = w2. What is r(s(h))? 4h*2 Let k(c) = 0c +	{ "pile_set_name": "DM Mathematics" }
, 41, 47797 List the prime factors of 5618494. 2, 7, 401321 What are the prime factors of 3396979? 3396979 List the prime factors of 4025693. 7, 29, 2833 What are the prime factors of 50986? 2, 13, 37, 53 List the prime factors of 1550388. 2, 3, 7, 18457 What are the prime factors of 471937? 17, 23, 71 What are the prime factors of 711784? 2, 193, 461 What are the prime factors of 442280? 2, 5, 11057 What are the prime factors of 1053283? 7, 11, 13679 What are the prime factors of 1053649? 37, 28477 What are the prime factors of 4974422? 2, 2487211 List the prime factors of 24781875. 3, 5, 13217 List the prime factors of 5446606. 2, 11, 29, 8537 What are the prime factors of 4662932? 2, 67, 127, 137 List the prime factors of 1435686. 2, 3, 7, 34183 List the prime factors of 8097414. 2, 3, 13, 103813 What are the prime factors of 780058? 2, 263, 1483 List the prime factors of 972211. 19, 51169 What are the prime factors of 1261598? 2, 13, 48523 List the prime factors of 216750. 2, 3, 5, 17 What are the prime factors of 223536? 2, 3, 4657 What are the prime factors of 367919? 127, 2897 List the prime factors of 418938. 2, 3, 13, 41, 131 List the prime factors of 22349437. 11, 2031767 What are the prime factors of 1282738? 2, 673, 953 What are the prime factors of 37943026? 2, 11, 1724683 What are the prime factors of 178767? 3, 2207 List the prime factors of 48280. 2, 5, 17, 71 List the prime factors of 2978262. 2, 3, 7, 7879 List the prime factors of 21238. 2, 7, 37, 41 What are the prime factors of 892972? 2, 223243 List the prime factors of 75383. 7, 11, 89 What are the prime factors of 8656122? 2, 3, 677, 2131 List the prime factors of 4404871. 61, 72211 List the prime factors of 2212266. 2, 3, 7, 52673 List the prime factors of 8401468. 2, 17, 123551 List the prime factors of 118317. 3, 39439 List the prime factors of 2451420. 2, 3, 5, 13619 What are the prime factors of 67086? 2, 3, 3727 List the prime factors of 72026. 2, 36013 List the prime factors of 354337. 354337 List the prime factors of 1758267. 3, 7, 443 List the prime factors of 228206. 2, 11, 23, 41 List the prime factors of 418103. 7, 59729 What are the prime factors of 2246014? 2, 71, 15817 What are the prime factors of 230040? 2, 3, 5, 71 What are the prime factors of 1151060? 2, 5, 67, 859 List the prime factors of 753406. 2, 17, 22159 List the prime factors of 3207820. 2, 5, 7, 11, 2083 List the prime factors of 2058012. 2, 3, 11, 5197 List the prime factors of 8409659. 163, 51593 List the prime factors of 620202. 2, 3, 11, 9397 What are the prime factors of 6687288? 2, 3, 131, 709 List the prime factors of 298426. 2, 149213 List the prime factors of 53283. 3, 17761 What are the prime factors of 255257? 47, 5431 What are the prime factors of 2137594? 2, 919, 1163 List the prime factors of 19159072. 2, 598721 List the prime factors of 30841. 30841 What are the prime factors of 2058000? 2, 3, 5, 7 What are the prime factors of 17544133? 17544133 What are the prime factors of 9250899? 3, 7, 23, 107, 179 List the prime factors of 8599232. 2, 134363 What are the prime factors of 570367? 7, 17, 4793 What are the prime factors of 221928? 2, 3, 7, 1321 What are the prime factors of 5091889? 11, 462899 List the prime factors of 12557749. 12557749 What are the prime factors of 739059? 3, 23, 10711 List the prime factors of 10416726. 2, 3, 53, 61, 179 List the prime factors of 622667. 41, 15187 What are the prime factors of 1782480? 2, 3, 5, 7, 1061 List the prime factors of 97927. 97927 List the prime factors of 22473388. 2, 7, 17, 31, 1523 What are the prime factors of 479656? 2, 59957 What are the prime factors of 14376836? 2, 919, 3911 What are the prime factors of 65136? 2, 3, 23, 59 What are the prime factors of 1346809? 41, 107, 307 List the prime factors of 527824. 2, 11, 2999 What are the prime factors of 19055444? 2, 37, 199, 647 What are the prime factors of 33259193? 11, 3023563 What are the prime factors of 11544? 2, 3, 13, 37 What are the prime factors of 241573? 37, 6529 List the prime factors of 4898475. 3, 5, 41, 59 List the prime factors of 5780336. 2, 361271 What are the prime factors of 37624689? 3, 17, 81971 What are the prime factors of 974894? 2, 487447 List the prime factors of 1231221. 3, 97, 4231 List the prime factors of 159751. 107, 1493 What are the prime factors of 65159? 23, 2833 What are the prime factors of 7756754? 2, 37, 2833 List the prime factors of 1228483. 19, 41, 83 What are the prime factors of 28950490? 2, 5, 17, 19, 8963 List the prime factors of 1473774. 2, 3, 245629 What are the prime factors of 7312421? 37, 257, 769 List the prime factors of 2731181. 23, 118747 List the prime factors of 56321. 17, 3313 What are the prime factors of 20109336? 2, 3, 13, 64453 List the prime factors of 538533. 3, 53, 1129 What are the prime factors of 45366? 2, 3, 7561 What are the prime factors of 1689944? 2, 61, 3463 List the prime factors of 10726960. 2, 5, 134087 List the prime factors of 393182. 2, 29, 6779 What are the prime factors of 7942886? 2, 7, 199, 2851 List the prime factors of 1158695. 5, 29, 61, 131 List the prime factors of 661958. 2, 11, 30089 What are the prime factors of 20141417? 20141417 List the prime factors of 3141345. 3, 5, 17, 97, 127 List the prime factors of 958663. 23, 41681 List the prime factors of 22604. 2, 5651 What are the prime factors of 2903419? 2903419 What are the prime factors of 53461? 193, 277 What are the prime factors of 1209125? 5, 17, 569 List the prime factors of 299053. 299053 List the prime factors of 16484317. 149, 317, 349 What are the prime factors of 181876? 2, 41, 1109 What are the prime factors of 12772852? 2, 3193213 What are the prime factors of 231200? 2, 5, 17 What are the prime factors of 428862? 2, 3, 7, 10211 List the prime factors of 312665. 5, 62533 List the prime factors of 6221665. 5, 1244333 List the prime factors of 3214028. 2, 71, 11317 List the prime factors of 820929. 3, 273643 What are the prime factors of 1371645? 3, 5, 11, 17, 163 List the prime factors of 34451. 47, 733 What are the prime factors of 2920799? 7, 41, 10177 What are the prime factors of 323153? 17, 19009 List the prime factors of 1429362. 2, 3, 11, 7219 What are the prime factors of 5921652? 2, 3, 11, 113, 397 List the prime factors of 184757. 47, 3931 What are the prime factors of 1256630? 2, 5, 53, 2371 List the prime factors of 2246076. 2, 3, 7, 2971 List the prime factors of 13568998. 2, 6784499 List the prime factors of 1062349. 1062349 What are the prime factors of 3484241? 107, 32563 List the prime factors of 89306. 2, 7, 6379 List the prime factors of 547794. 2, 3, 13, 2341 List the prime factors of 505975. 5, 37, 547 What are the prime factors of 61653? 3, 20551 What are the prime factors of 483763? 7, 69109 List the prime factors of 1258245. 3, 5, 27961 List the prime factors of 783805. 5, 11, 14251 List the prime factors of 155799. 3, 7, 2473 What are the prime factors of 400164? 2, 3, 33347 What are the prime factors of 1604849? 61, 26309 What are the prime factors of 603271? 103, 5857 List the prime factors of 75519. 3, 2797 What are the prime factors of 578548? 2, 53, 2729 What are the prime factors of 11308625? 5, 90469 List the prime factors of 12631859. 89, 141931 What are the prime factors of 8327317? 1277, 6521 List the prime factors of 4326352. 2, 59, 4583 List the prime factors of 997254. 2, 3, 17, 3259 What are the prime factors of 997816? 2, 37, 3371 List the prime factors of 1063768. 2, 132971 What are the prime factors of 431033? 41, 10513 What are the prime factors of 12403016? 2, 1550377 List the prime factors of 6341829. 3, 13, 162611 List the prime factors of 7703590. 2, 5, 770359 What are the prime factors of 154820? 2, 5, 7741 What are the prime factors of 1514340? 2, 3, 5, 47, 179 What are the prime factors of 1875304? 2, 17, 13789 What are the prime factors of 117058? 2, 107, 547 List the prime factors of 760201. 13, 58477 List the prime factors of 3261155. 5, 239, 2729 List the prime factors of 1202354. 2, 47, 12791 What are the prime factors of 17042176? 2, 66571 What are the prime factors of 51196? 2, 12799 What are the prime factors of 1331933? 17, 47, 1667 List the prime factors	{ "pile_set_name": "DM Mathematics" }
-2/3, -1/2, q, 0.2 Let s be (3/55/2)/(-3). Sort 1/4, 0.84, s in decreasing order. 0.84, 1/4, s Let f = 0.0462 - 0.0462. Let w = 0.4 - -0.5. Suppose -2v + 4 = -4v. Put v, f, w in descending order. w, f, v Let o = 31 - 30. Let w be o - 2/(-44)-26. Put w, 4, -2 in increasing order. -2, w, 4 Let y(v) = v*3 + 6v*2 + 5v + 2. Let n be y(-5). Let o = 1264 + -1268. Sort n, 5, o in decreasing order. 5, n, o Suppose 0 = -14c + 3209 - 3153. Put -2/5, 6.8, c in descending order. 6.8, c, -2/5 Let z = -0.3 - -0.1. Let m = 18 - 292. Let h = -2195/8 - m. Put h, 0, z in increasing order. h, z, 0 Let p be (4 - 42/12) + 69/2. Suppose -pc + 9 = -38c. Let v be (-2 - -1)(-1 + 0). Sort v, c, -17 in ascending order. -17, c, v Suppose 4t + 5a + 39 - 2 = 0, 5t = -4a - 35. Sort t, 2, -15, 4. -15, t, 2, 4 Suppose d + 5 - 14 = 0. Let m be 6/(2d/6). Let x(k) = k2 - 7k + 1. Let y be x(6). Sort 10, y, m. y, m, 10 Suppose 36 = -3h + 60. Sort h, 2, -4 in descending order. h, 2, -4 Let i(r) = r3 + 6r*2 + 4r - 1. Let n be i(-5). Let h = n + -4. Sort h, 1, -6 in increasing order. -6, h, 1 Let v be (-414)/666/(-18). Put v, -4, 0.4 in increasing order. -4, 0.4, v Let s = 501 + -561. Sort s, -4, -2 in ascending order. s, -4, -2 Suppose -217n = -201n. Let j be (-2)/(-3)(-3)/2. Sort j, 6, n in increasing order. j, n, 6 Suppose -2a - 8 = -3y, -28 + 26 = -y + a. Sort y, 1, -6. -6, 1, y Let u(n) = n + 9. Let v be u(-4). Suppose -12 + 2 = -5s. Suppose -4k = -3d - 15, d = -7k + sk - 5. Sort d, -11, v. -11, d, v Suppose 3t = 5f - 29, -2f = -t - t - 14. Suppose 0 = b - 4z - f, -4b + z - 15 + 1 = 0. Let w be b/18 + 86/(-18). Sort -2, w, 0 in decreasing order. 0, -2, w Let w = 2055 + -18497/9. Suppose -4z - 2m = -5 + 3, -5 = 5z + 5m. Sort 9, w, z, -3. -3, w, z, 9 Let d be (-1)/(1 + (-12)/15). Suppose 0 = -40n + 43n - 3. Put 2, -1, d, n in ascending order. d, -1, n, 2 Suppose 147 = 3f + 171. Let w(h) = -h3 + 9h*2 - 9h + 11. Let m be w(8). Sort -2, m, f in descending order. m, -2, f Let k = 25 - 28. Put -10, k, -2 in decreasing order. -2, k, -10 Suppose 142f + 80 = 158f. Sort f, -4, -95. -95, -4, f Suppose 0 = 5c + 2t + 16, 3c - 3t = -18 - 0. Let p = -56 + 56.46. Let y = p + -0.36. Sort c, -0.4, y in ascending order. c, -0.4, y Let u be (-14(-19)/798)/((-1)/3). Let w(x) = x + 2. Let m be w(-6). Put -7, m, u, 1 in descending order. 1, u, m, -7 Let q = 1792 + -1797. Let p = 4.13 - -0.07. Let z = p + -0.2. Sort z, q, -2 in increasing order. q, -2, z Let m(n) = -4n + n - 35 - 5 + 7. Let f be m(-11). Sort f, -1, -8, -2 in ascending order. -8, -2, -1, f Let s = -0.3 + 1.3. Let f = 484 + -3389/7. Put s, -3/7, f in descending order. s, f, -3/7 Let s = 1188.6 - 1095. Let f = 94 - s. Sort 1/8, f, -0.09, -0.3 in decreasing order. f, 1/8, -0.09, -0.3 Let l = -0.41 + 0.01. Suppose 5t + 588 = 2168. Let y = 2848/9 - t. Put y, 2, l in increasing order. l, y, 2 Suppose -5w - 11 = -3g, -3g = 3w - 0g + 21. Let c = 78 - 66. Suppose -4n + 7b - c = 3b, 11 = 3n + b. Sort w, n, 3. w, n, 3 Let k = -324 - -971/3. Put -1/8, -3/4, k, 22 in descending order. 22, -1/8, k, -3/4 Let q(a) = 0a2 + 4 - 3a*2 - 3a + 7a2. Let j be q(1). Let r be 4/(-6)(-6)/4. Sort j, r, -3 in increasing order. -3, r, j Let x be (-53/(-90))/((-2)/(-8)). Put -2/11, x, 1 in descending order. 1, x, -2/11 Let i = -1118 + 1118. Put -5, 13, -1, i in ascending order. -5, -1, i, 13 Let v be 3/(-12/2). Let l(x) = x*3 + 5x*2 + x - 4. Let a be l(-4). Suppose -u - 3u = -a. Sort v, -1, u in descending order. u, -1, v Suppose 0 = 5a - 43 + 188. Let n = -30 - a. Sort 6, 1, n. n, 1, 6 Suppose -k = -2x + 8, -2x + 30 = x + 3k. Suppose 0 = -2u, 0 = -3q - 2u + 5u - 9. Let j = x + q. Sort j, -2/7, 2 in decreasing order. j, 2, -2/7 Let l be 15/(-21) - (-6)/(-21). Let u be ((-21)/(-14))/((-18)/(-4))3. Suppose -12 = j - 5j. Put j, u, l in decreasing order. j, u, l Let w = 0.2 - 0.1. Let m = w - 0.4. Let x = 173/3 + -1393/24. Sort m, x, 1/4 in ascending order. x, m, 1/4 Let k be (-1)/2 - (-10)/8. Let o = -6 - -4. Let j = -137/54 - -1/27. Put o, k, j in descending order. k, o, j Let n(i) = 125i - 1. Let g be n(2). Let d = -3733/15 + g. Let k = 1.96 - -0.04. Sort k, d, 0.1 in ascending order. 0.1, d, k Let f(i) = -5i - 160. Let d be f(-32). Sort d, -4, 1, 30. -4, d, 1, 30 Let o = -36 + 31. Suppose 5w = 10w - 30. Sort -3, w, o in descending order. w, -3, o Let n(b) = -b*2 - 9b - 15. Let w be n(-4). Suppose 4q - 10 = wl - 0l, 3q + 5l + 10 = 0. Put -2, q, 4, 3 in increasing order. -2, q, 3, 4 Let l = 0.02 - 18.02. Let m be ((-40)/140 - (1 - 3)) + -2. Sort m, -0.4, l in decreasing order. m, -0.4, l Let q = -831.98 + 832. Sort 3/2, -1/3, q. -1/3, q, 3/2 Let t(w) = -w3 + 10w*2 + 2w + 101. Let a be t(11). Put a, -2, 7, -1 in increasing order. -2, -1, a, 7 Suppose -8s - 3s - 165 = 0. Let h be 0/(2(s/2)/5). Sort h, -17, 2. -17, h, 2 Let d = -0.074 + 1.074. Put 0, -0.4, -0.2, d in decreasing order. d, 0, -0.2, -0.4 Let s be (4/6)/(10/(-6)). Let r be 5/(-6)-3-2. Let x be 2/4r/2. Put x, s, 1 in decreasing order. 1, s, x Let p = -6.17 + 0.17. Let n = p + 5.99. Let z = n + -0.09. Put -2/7, z, 1/5 in decreasing order. 1/5, z, -2/7 Let y be ((-4)/(-60)3)/(3/15). Sort 3, 0.061, y. 0.061, y, 3 Suppose -8n + 12 = -12n. Let v = -12 - -14. Sort -5, n, v in increasing order. -5, n, v Let c = 7 - 7. Let u = 7 - c. Let j be -4 + ((-2)/9 - (-585)/81). Sort j, 5, u in increasing order. j, 5, u Let p be 7070/(-21)(-3 + 6). Sort 3, 2, p in decreasing order. 3, 2, p Let d = -107 - -126. Sort 4, d, -4. -4, 4, d Let l = -28 - -27. Let f be l - 2 - 4/4. Sort f, -5, -2 in decreasing order. -2, f, -5 Let u be 31/((-3)/2). Let w = -2069 - -2074. Sort w, -4, u. -4, u, w Let r = 572/17 + -2911/85. Let z = 3 + -6. Put -0.1, -0.3, r, z in decreasing order. -0.1, -0.3, r, z Let k = -1987 + 1991. Put -4, 5, k, 0 in ascending order. -4, 0, k, 5 Let a be (-356)/52 + 2/(-13). Let n(z) = 0 - z2 - 3z*3 + 2z + 2z3 - z2 + 1. Let u be n(-2). Put u, -2, a in descending order. -2, u, a Let p = -0.371 - -0.471. Sort 1, p, 1.1, 5. p, 1, 1.1, 5 Let k(q) = 2q - 9. Let v(w) = -w3 + w2 + 3w + 1. Suppose -3y + p + 3 = 6, 0 = -5y - 2p - 16. Let d be v(y). Let a be k(d). Sort 0, -1, a. -1, 0, a Let m = 0.78 + -44.78. Let u = -46 - m. Put -1, u, 1/5, 1/6 in decreasing order. 1/5, 1/6, -1, u Suppose 0 = -4k - 3 + 23. Let d be (-1 + 1)/(k - 4). Sort d, 4, -3 in decreasing order. 4, d, -3 Let z = -79 - -84. Let m = 1.7 + 0.3. Let v = -1 + m. Sort z, v, 3 in decreasing order. z, 3, v Let t = 9 - 5. Suppose 0 = -269p + 263p + 240. Put t, p, 0 in ascending order. 0, t, p Suppose y - 61 = -5i, -4y - 5i = -8y + 169. Sort y, -3, 5 in descending order. y, 5, -3 Let p = -46 + 51. Sort -3, p, -7, 2. -7, -3, 2, p Suppose 5i + w + w = -149, 0 = i - 2w + 25. Suppose -176 = 7k - 211. Put k, i, 2 in descending order. k, 2, i Let q(l) = 0l - 5 + 0l + l. Let x be q(8). Let h be -1 + ((-18)/21)/(8/(-12)). Sort h, 0.4, x in decreasing order. x, 0.4, h Let u be 48/(-40)(-1)/6. Sort u, -4/17, -4/3, -2/11. -4/3, -4/17, -2/11, u Suppose -4y = -2t - 30, 21t - 15 = 26t. Let j(q) = q2 + 6q + 5. Let i be j(-6). Put i, y, 0.1, 3 in decreasing order. y, i, 3, 0.1 Let d = -0.021 - 25.979. Let o = 25 + d. Sort -2, 3, o. -2, o, 3 Let v = -586 - -585.89. Sort v, 1, -1/15, 3 in decreasing order. 3, 1, -1/15, v Suppose 0 = a - 4. Let t(i) = i*2 - 45i + 492. Let v be t(27). Put 0, 2, v, a in descending order. v, a, 2, 0 Let u = -8.7 - -9. Let q be -1 + 7/(35/3). Put 2, q, u in ascending order. q, u, 2 Suppose 0 = 3o - o - 14. Let x(p) = 22p - 50. Let g(i) = 9i - 20. Let z(n) = -12g(n) + 5x(n). Let t be z(o). Put 2, t, 1 in increasing order. 1, 2, t Suppose -3a - 6 = 0, 3f = 8f + 2a + 4. Sort -4, f, 5, 3 in descending order. 5, 3, f, -4 Let a be 153/(-81) + -3 + (-1)/9. Let o = 0.05 + 0.25. Put a, 0, o in ascending order. a, 0, o Let a = 1004.57 + -17.57. Sort 1, 4/7, a in descending order. a, 1, 4/7 Let f be 4-155/10. Let g = -59/2 - f. Sort -5, g, 3/8 in decreasing order. g, 3/8, -5 Let x = 1.84 - 1.54. Suppose -2g = 2y + 12, 5g = -3*y - 6 - 18. Let l be 1/3 - (-2)/g. Put x, -3, l in decreasi	{ "pile_set_name": "DM Mathematics" }
s - 10. Let z(o) = -o + 1. Let u(f) = -l(f) + 3z(f). Let a be u(-9). Suppose 0 = -3g + a - 1. Solve 4w - g = 15 for w. 4 Let s = 2565 + -2554. Solve 14 = m + s for m. 3 Let h(g) = g*3 + 4g*2 - g - 10. Let p be h(-2). Solve -18i + pi = -18 for i. 1 Let q = -143 + 146. Solve -w + 8 = -qw for w. -4 Suppose -3r - 3b - 6 = 0, 3r + b + 2 = -2r. Solve 16 = 4n - r for n. 4 Let k = -1101 - -1148. Solve 2m + k = 55 for m. 4 Let j(d) = -10d + 80. Let h be j(8). Solve g + h = -5 for g. -5 Let y = -502 - -505. Solve -7 - 2 = -yk for k. 3 Suppose 4p + 1 = 13. Suppose py - 1 = -1. Solve y = -o + 4o - 12 for o. 4 Suppose 247 - 359 = -8h. Solve -30 = -hm + 20m for m. -5 Suppose -2r = -0r. Suppose -2v - 3y = -8y - 1, -3y - 3 = r. Let z be 27/6 - (-1)/v. Solve -6p = -zp for p. 0 Let y(p) = -10p + 2. Let n be y(-4). Let z be n-13/(-9). Let u be ((-15)/(-45))/(1/12). Solve -u = 5v - z for v. 2 Let l(z) = -2z2 + 35z - 33. Let m be l(16). Solve -m = o + 2o for o. -5 Let u(p) = -2p + 32. Let z be ((-8)/2)/((-1)/4). Let h be u(z). Solve hq - 4q = -12 for q. 3 Let w be 8/((-1)/(-5) - 0). Suppose -4b = 2v - w, -v = -2b - 7 + 3. Let t be 6/(-21) - (-8)/(112/102). Solve -ta + 3a = -v for a. 3 Let m(u) = -u3 + 9u*2 + 53u - 5. Let g be m(-4). Let y(f) be the second derivative of f*3/6 + 9f*2/2 + f. Let c be y(g). Solve 5o + 3 + 22 = c for o. -5 Suppose 0 = -2v - 2b + 8, 0 = 39v - 40v + b - 4. Solve v = 5w + 3 - 28 for w. 5 Suppose -156 = 2y + 3c, -2y + y = -3c + 96. Let t = y + 88. Solve -r - 3r + t = 0 for r. 1 Let y(t) = 7 + 14t2 + 5t*2 - 7t2 + t3 + 3. Let p be y(-12). Solve -2a - 3a = p for a. -2 Let f be 10/(-65) + (-558)/(-78). Solve -fw = -8w + 3 for w. 3 Let t be (-7)/(-21) + (-62)/(-3). Let u be t/(-35) + (-312)/(-20). Solve 3r + 0r = -u for r. -5 Let y be 2(-1)/(-2)-2. Let d be (y - (-6)/3)/(-2). Suppose j - 4j = d. Solve -w - 2w + 15 = j for w. 5 Let c = 13 + 72. Suppose 0q + 5q = -25, 5x + 2q = c. Solve -5h + 4 = x for h. -3 Suppose p = 3p - 6. Suppose v = -pg + 6, 0 = v + 4v - 4g - 11. Let i = 3 - -1. Solve -vz + iz = 3 for z. 3 Suppose 0 = -5i + 15, 3d = -3i + 99 - 33. Suppose 0 = 3o + 13 - d. Solve 0 = of + 5 - 13 for f. 4 Suppose -4x - 1 = -h - 11, -4x = -3h - 14. Suppose -4f = -4z + 2z - 2, 3z + xf = 13. Solve -6 = -0n + zn for n. -2 Let m be -4(-1 + 0/2). Suppose -mi + 4 = -4. Let p be i/11 + 152/11. Solve 5c - p = -4 for c. 2 Suppose -t - 36 = -10t. Solve tl = 9l + 5 for l. -1 Let x be 0 - (2 - (-28)/(-7)). Let n(s) = -2s + 7. Let r be n(7). Let b(j) = j + 10. Let l be b(r). Solve xz - l = -z for z. 1 Suppose 10g + 301 = 1051. Suppose 3c - g + 72 = 0. Solve -7 - c = -4l for l. 2 Suppose 5z - 89 = 4q + 158, 4z = -q + 185. Solve -w - 46 = -z for w. 1 Let g = -4 + 76. Suppose t - g = -3t. Solve 4x = -t - 2 for x. -5 Let c(k) = 2k - 5. Suppose 0 = -7j + 4j + 4a - 11, -2j + 21 = 3a. Let g be c(j). Let s be g/(-2)(7 - 7). Solve -4y + 2y - 8 = s for y. -4 Let b(n) = -n3 + 3n - 1. Let z be b(2). Let v(r) = -r*2 - 10r + 27. Let f be v(-12). Let o be (2 - -2) + f + z. Solve -m - om = 0 for m. 0 Let v(k) = 40k*2 - 230k - 7. Let f be v(6). Solve l = -f + 54 for l. 1 Let r be 313/((-78)/(-88)). Solve 24g - 2g = r for g. 2 Let i(u) = -7 + 0 - 1 + 12u - 14u. Let d be i(-5). Let x(h) = -h2 + 7h. Let a be x(5). Solve dp - a = -0p for p. 5 Let t(c) = c*3 + 25c*2 - 27c - 24. Let f be t(-26). Solve 11 = fm + 1 for m. 5 Suppose 3j + 2d - 91 = 6, -3j + 83 = -5d. Suppose 5u - 4 = j. Suppose 4y - 4 = 2y. Solve u = -5s + y for s. -1 Let h be -83/(-24)-4 - -10. Solve 3r + 0 = h for r. 2 Suppose 0 = 13s - 94 - 140. Solve -3v + 6 = s for v. -4 Let i be 8 + 24/(-2). Suppose -2k = -iv - 18, 5k - 78 + 22 = -v. Solve 4 = -3t - k for t. -5 Let u(o) = o3 - 24o*2 + 2o - 48. Let r be u(24). Solve 16d - 17d + 1 = r for d. 1 Let t be (-4)/3 - ((-45)/(-27) + -10). Solve 0 = 10u - tu - 9 for u. 3 Let c be (-16)/(-24)((-3)/(-1) + 0). Solve 0x - cx = 10 for x. -5 Let x be ((-4)/(-2))/((-2)/13). Let y(g) = -g3 + 3g*2 + 7g - 7. Let a be y(5). Let m = x - a. Solve -4u + 1 - m = 0 for u. -2 Let a(h) be the third derivative of h5/30 + 5h*4/24 + 2h*3/3 + 21h*2. Let q be a(-2). Solve -8 = 2s + qs for s. -2 Let x(g) = 17 - 5g*3 + 3 - 13g - 8g2 + 6g*3 + 2g. Let o be x(9). Solve -13 = -5k + o for k. 3 Let t be -1(-5 - -8)-1. Solve 2 - 8 = tc for c. -2 Let m = 107 - 95. Suppose d - 18 = -4l, 7 = 5l + 3d - m. Solve -8 - 17 = -ln for n. 5 Let s be (-8)/(0/(-1) + 1). Let w = 2 + s. Let d be (-2)/3 - 16/w. Solve -2x - 8 = dx for x. -2 Suppose 2w + 2w - 32 = 4h, 4h + 4w = -32. Let c be h/(-14)(-42)/(-12). Let z = 6 - c. Solve zt + 0t = 0 for t. 0 Suppose 3d = 2q - 6, 7q - 3q + 2d = 12. Solve -4t = -5t - q for t. -3 Suppose -2b + 64 = 5h, 44 = 3h + 383b - 379b. Solve -9 - 3 = hq for q. -1 Let n be (-6 - 30)/(-1 + 2). Let r be 8/n + 88/(-9). Let f be (-1)/2 - 35/r. Solve -16 = z + fz for z. -4 Let g = 42 + -50. Let z = g + 11. Solve 8u = zu - 20 for u. -4 Suppose -6 = -0h + 2h, 2q - 13 = 3h. Suppose -3i - qi - 200 = 0. Let k = i + 56. Solve -3s - s = k for s. -4 Suppose -46 + 4 = -7z. Solve -1 = -5n - z for n. -1 Suppose -5f + f = -24. Suppose 2k + 16 = fk. Solve 2 = -2s - k for s. -3 Let n = 41 - 35. Suppose -34 + 124 = ny. Solve -u = 4u + y for u. -3 Let k be 210(6 - 5). Let l = k + -14. Solve 15 = -3b + l for b. -3 Let s(l) = 3l + 2. Let q be 22 - 6(-4)/(-8). Let t be s(q). Solve 0 = ty + 5 + 5 for y. -2 Let d be (-6 - -2 - 0) + 1. Let w = d - 0. Let b be w/(-2) + 1/2. Solve -1 = bn - 3 for n. 1 Suppose -4y - 94 = -2y. Let j = y + 35. Let s(k) = -k - 9. Let b be s(j). Solve g = bg + 8 for g. -4 Let r = 106 + -107. Let w be -2 + 4/2 + r + 6. Solve -wi + 0 = -20 for i. 4 Suppose 3g = -5c - 83, 4g = -5c - 25 - 54. Let h = 12 + 10. Let u = c + h. Solve 4 = -uq - q for q. -1 Suppose -t - 11 = 2b - 43, -5t + 182 = -b. Suppose -4 = -2d - 2k + 20, 3d = 4k + t. Solve 0i + d = -3i for i. -4 Let i(j) be the first derivative of -8j2 - 1. Let c be i(-1). Let k = c - 10. Solve l - k = -3 for l. 3 Let h = 51 - 51. Let d(g) = 3g3 - g2 + 12. Let x(i) = 7i3 - 3i*2 + 25. Let s(c) = 5d(c) - 2x(c). Let t be s(h). Solve 5y - 30 = -t for y. 4 Let z(h) be the second derivative of h4/12 + h3/6 - 15h2 + 16h. Let b be z(5). Solve bl - 5 = -5l for l. 1 Suppose -13b = -16b - 21. Let r(n) = -n*2 - 8n - 4. Let p be r(b). Solve pq = -q + 16 for q. 4 Suppose 874 = 23k + 23k. Solve 0 = -24u + ku + 10 for u. 2 Suppose 4l - 18 = -5l. Suppose 3x - la = -4, 4x - 2a = -0a - 4. Solve xm - 8 = 2m for m. -4 Suppose -h + 8 = -0h. Let u be 9 + -13 + 78. Let p = u + -48. Solve -p = -3t + h for t. 4 Suppose 4z = 5h + 1 + 3, 0 = 4h + 4z - 4. Let b = 388 + -387. Solve h = 5p + 16 - b for p. -3 Let m(c) = c*3 - 12c*2 + 3c - 28. Let v be m(12). Solve 6h - 2 = vh for h. -1 Suppose 5w = -2i + 5, 5 = 5i + w + 4w. Suppose 2n + 2n = i. Solve nt + 2t = -8 for t. -4 Let r be (-108)/(-48) + 3/4. Let d(v) = 0 + v + 0v + 2. Let u be d(0). Solve -ux = -r - 3 for x. 3 Let j(w) = -w*2 + 37w - 232. Let q be j(29). Solve q = i + i + i for i. 0 Let n = -22 - -14. Let h = n + 10. Solve q + hq + 3 = 0 for q. -1 Let r = -2 + 2. Let n = r + 0. Suppose 0 = 26j - 28j + 4. Solve -a + j = -n for a. 2 Suppose 0 = -2w + 8, -5y - 15 = 5w - 45. Solve -3u + y = -u for u. 1 Suppose 3v - l - 25 - 40 = 0, -48 = -2v + 3l. Suppose -4k = -3u + 21, 4u - u - v = -3k. Solve 5c - 32 + u = 0 for c. 5 Let h be (-6)/(-8) - (-1)/4. Let c(j) = -4j - 8. Suppose -1 + 3 = -f. Let i be c(f). Solve v - h + 6 = i for v. -5 Suppose 0m - 6 = -m + h, 9 = -m - 4h. Let a(q) = -q*3 - 6q*2 - 3q + 5. Let d be a(-5). Let i be -4 - (d - 4/4). Solve i + m = -5l for l. -1 Suppose 4p - 4 = -26x + 24x, -3x - 2p = -26. Let y = 3 + -1. Solve l + yl = x for l. 4 Let t(w) = -3w. Let o = -55 - -53. Let v be t(o). Solve 5q = vq + 3 for q. -3 Let r = 421 + -418. Solve -1 = -rs + 2 for s. 1 Suppose 0 = -35y + 34y + 5. Solve -yl = -4 - 1	{ "pile_set_name": "DM Mathematics" }
is the thousands digit of b(23)? 8 Suppose -341a + 10330414 - 1620034 = -31a. What is the units digit of a? 8 What is the units digit of ((-695751)/294)/((-3)/6)? 3 Suppose 0 = 2i - 2d - 54, -4d - 36 = -2i + i. Suppose i + 6 = 5q. Suppose -qb + 259 = -599. What is the units digit of b? 3 Suppose 0 = 379v - 202v - 196v + 190950. What is the units digit of v? 0 Let s = 20 + -26. Let l = s + 4. Let r(q) = -19q*3 + 2q*2 - 1. What is the tens digit of r(l)? 5 Let x = 12 - 6. Suppose -4l = -3c + 10, -5c + 2l = xl - 6. Suppose 2q - 300 = -0q + 2f, -cq + 304 = -f. What is the units digit of q? 4 Let v be 4/(-3)9/(-4). Suppose -1230 = -4l + r, -247 = -vl - 2r + 681. Let x = 566 - l. What is the units digit of x? 8 Suppose -24404 = -7d - 3j, 7d + j = 10d - 10452. What is the units digit of d? 5 Let n(z) = -428z + 340. What is the units digit of n(-5)? 0 Let f(h) = 202h + 137. Let i be f(29). Suppose i = -23r + 28r. What is the tens digit of r? 9 Let l be 4(3 + -5 + 3). Let x(j) = 3 - 4 + 4j + j2 + 6 + l. What is the units digit of x(4)? 1 Let n(i) = i2 + 33i - 66. Let l be n(-35). What is the hundreds digit of (-2208)/l63/(-36)? 1 Suppose -101u + 99u - 71213 = -3y, -4y + 3u + 94951 = 0. What is the thousands digit of y? 3 Let d(g) = -21g2 + 2g*3 + 8 + 4g*2 - 8g - 4 + 1. What is the units digit of d(9)? 4 Let u(y) = -175y - 294. Suppose 4j + 4m + 40 = 0, 10j - 4m = 15j + 51. What is the units digit of u(j)? 1 Let g be 126/8352/12. Suppose -5k + g - 1452 = -5b, k = 4b - 780. Let j = b + -122. What is the units digit of j? 2 Let y be (-4 + 1393)(-4)/(-12). Suppose 0 = -i + 4w + y, w = -3 - 0. Let n = -266 + i. What is the units digit of n? 5 Suppose -w + 6v + 2 = v, -4w = -3v - 8. Let r be 543/((-2)/(-4) + w + -1). Suppose 4n = 6n - r. What is the units digit of n? 1 Suppose -2b + 0y = -2y - 24, 4 = b + 3y. What is the units digit of b/35 + (1 - (-1270)/14)? 2 Suppose -3o + 95 = -g + 252, -2o = -3g + 114. Let d = 58 + o. Suppose 509 = -dt + 2161. What is the hundreds digit of t? 2 Suppose -4y + 4n + 4012 = 0, -2y - 2833n + 2828n + 2020 = 0. What is the tens digit of y? 0 Let h = 171 + -163. Suppose hd - 6d - 1158 = 0. What is the units digit of d? 9 What is the units digit of (-29188)/(-5) - (-856)/(-535) - (-1)/1? 7 Let a(c) be the second derivative of -145c3/6 + 75c*2/2 + 97c. What is the hundreds digit of a(-5)? 8 Let v(a) = -a*2 + 8a + 41. Let p be v(-23). Let w = -555 - p. What is the hundreds digit of w? 1 Suppose 31f - 10f + 12054 = 0. What is the tens digit of 1 + 2 + (-4 - f)? 7 Let n = -35 - -14. Let x be (2/2)/(n/(-105)). Suppose 0 = -xs + 4c + 465, -3s - c + 272 = -2c. What is the tens digit of s? 8 Suppose l - 4l = -3i + 18, 2i + 5l = -9. Suppose -4b = t - 3544, -3b + 2643 = -0t - it. What is the tens digit of b? 8 Suppose -g + 1 - 10 = -h, h = 3g + 19. Suppose -2r + 4 = hb - 6r, -b + 3r + 3 = 0. Suppose -2p + 0p + 342 = b. What is the hundreds digit of p? 1 Suppose -6l = -5l + n - 5, 2n = -l + 8. Suppose -3v = -w - 2w + 114, 205 = 5w - lv. What is the tens digit of w? 4 What is the thousands digit of ((2330-1)/(-5))/(70/8015)? 3 Let q = 1780 - 3717. Let h = 3386 + q. What is the tens digit of h? 4 What is the ten thousands digit of (-846)/(-1410) + (-236287)/(-5)? 4 Suppose -4p = 4, -y + 4 + 0 = 2p. Suppose -77 + 23 = -yo. What is the units digit of 3/o2 - 2/(-6)? 1 Let c(t) = 82t + 219. Let m(z) = -124z - 328. Let k(b) = 7c(b) + 5m(b). What is the tens digit of k(-16)? 2 Let f be ((-12)/5)/(2/(-220)). Let k = 109 - 106. Suppose -kq + 3h + 159 = -f, 5h + 15 = 0. What is the hundreds digit of q? 1 Let l be ((-2)/3)/((-8)/60). Let g = -371 + 374. Suppose -gv - 210 = -lv. What is the hundreds digit of v? 1 Suppose 2g - 4366 = -2h, -5h + g + 5016 = -5905. Suppose h = -27u + 39u. What is the tens digit of u? 8 Let f be -1(-14)/(-21)(-81)/6. Let o = 0 + 1. What is the units digit of o + 115 + (f - 12)? 3 Suppose -7q + 11 = -17. Suppose 4 = qg, g + 389 = -4a + 6g. What is the tens digit of 113/6 + (-16)/a? 1 Let n = 19 + -17. Suppose -326 = -3o + 6o + 2l, -310 = 3o - nl. What is the hundreds digit of -2 - (1 + -1) - o? 1 Let k(j) = 1552j3 - 2j*2 - 10j + 17. What is the units digit of k(2)? 5 Let i(q) = -12. Let r(w) = w - 37. Let c(x) = 7i(x) - 2r(x). Let y be c(-7). Suppose 3l + 138 = 3b, l = -yb - 3l + 192. What is the tens digit of b? 4 Suppose 0 = 66k - 53k - 8658. What is the units digit of k? 6 Suppose -93l = -21l - 339192. What is the hundreds digit of l? 7 Let t(d) = -d*3 - 6d + 15. Suppose 0 = 3u + u + 4, -u = -5q - 34. What is the hundreds digit of t(q)? 4 Let o = 10717 - 1643. What is the thousands digit of o? 9 Suppose -y = -5y + 72. Suppose -13m = -ym + 20. Suppose 15a = ma + 1430. What is the tens digit of a? 3 Let n(k) = 614k*2 - 30k - 108. Let l be n(-6). Suppose 22u - l = 8u. What is the thousands digit of u? 1 Let r(s) be the second derivative of -5s + 1/12s4 + 0 - s2 - 7/6s3. What is the hundreds digit of r(-8)? 1 Suppose 24o - 457474 = -234822 + 252812. What is the tens digit of o? 1 Let a be -502 + 30/(-18)-3. Let b = 728 + a. What is the units digit of b? 1 Suppose -43 = -4h + 461. Suppose -578 = -2c - 4d, 0 = c - 2d - h - 163. What is the units digit of c? 9 Suppose 2x - 160 = 5c, 190 = 5x + c - 264. Suppose 9n = 4n + x. Let k = 55 - n. What is the units digit of k? 7 Let f(c) = -5c3 - 7c*2 - 8c - 13. Let p be f(-6). Let t = p - 176. What is the hundreds digit of t? 6 Let i(d) = 9d - 281. Let m be i(34). What is the units digit of 11/(14 - m) - -2254? 7 Let u be ((-3)/(-9))/(1/6). Suppose 0 = -m + 5q - 16, -3m = -m + uq - 16. What is the tens digit of m/6 + 130/3? 4 Suppose -2j + 18 = 3i - 5j, -i - 2j - 9 = 0. What is the units digit of i/((-2)/(-1)) + (-1191)/(-2)? 6 Let m(l) = -l2 - 15l - 19. Let n be m(-14). Let x(d) = -36d + 0 + 8d*2 - 4d*2 - 1 + 39d. What is the units digit of x(n)? 4 Let u(k) = 2k2 + 13k - 27. Let f(y) = y*2 + 6y - 14. Let z(t) = -5f(t) + 2u(t). Let r be z(-7). What is the hundreds digit of r5/((-50)/(-4)) - -110? 1 Let x(u) = 59u*2 + 498u + 66. What is the hundreds digit of x(22)? 5 Suppose -2b = -5b + 12. Suppose m = 6m - 2y + 52, -by = 4m + 36. Let v = 42 - m. What is the units digit of v? 2 Let b = -26717 - -60240. What is the units digit of b? 3 Let n(l) = 398l2 + 136l - 258. What is the units digit of n(-15)? 2 Let w = 17941 + -75. What is the hundreds digit of w? 8 Let b = -59 + 95. Suppose s = -5g + 39, 0 = s + 4g - 2g - b. What is the units digit of s? 4 Let z = 95420 + -61556. What is the hundreds digit of z? 8 Let u(z) = 2696z*2 + 65z - 144. What is the units digit of u(2)? 0 Let n = -807 - -1085. Suppose 112 + n = 2z. What is the hundreds digit of z? 1 Let m(r) = -160r + 6. Suppose 7y + 9 = -5. What is the units digit of m(y)? 6 Let r be (-1 - 0/(-4)) + -2. What is the tens digit of 77 - r1/(-3)? 7 Let p be (2/4)/((-6)/924). Let y = 414 + p. Suppose 3d + 2h = -0h + y, 3d + 4h - 335 = 0. What is the units digit of d? 3 Suppose 0v = -4v. Let a(r) be the third derivative of r4/8 + 2r*3 - 24r*2 - r. What is the tens digit of a(v)? 1 Let x = -1431 + 2511. Let o = 2035 - x. What is the tens digit of o? 5 Let s = -110 - -112. Suppose 3x = -4k + 1401, 5x - 205 = -sk + 492. What is the units digit of k? 1 Let j(a) = -8 + a + 4 - a2 - 185a*3 + 3 + 2. What is the units digit of j(-1)? 4 Suppose 2o = j + 50101, -322623 - 28099 = -14o + 4j. What is the ten thousands digit of o? 2 Let f = -968 - -1590. Let r = f - 347. What is the units digit of r? 5 Let m be (2/(-14) - (-30)/(-35))3. Let a be m + 452/3 + 4/(-6). Let g = -78 + a. What is the tens digit of g? 6 Let u be 264/56 - (-1)/(28/8). Suppose 3a + 0g = -2g + 646, -ug + 634 = 3a. What is the hundreds digit of a? 2 Suppose v + 2v = 12. What is the tens digit of 43976/72 - (v + 76/(-18))? 1 What is the tens digit of (-894650)/(-638) - 9/33? 0 Suppose 3w - 4z + 3238 = 323, 3w + 2z = -2939. Let n = -276 - w. What is the hundreds digit of n? 7 Suppose -19n +	{ "pile_set_name": "DM Mathematics" }
-5v - 1 - 19 = 0. Let n = 172 - v. List the prime factors of n. 2, 11 Suppose -5z = -2z + 4s + 8, -2z - 17 = 5s. Suppose -zr + 25 = r. Suppose 3p - r = 4. List the prime factors of p. 3 Let k be ((-2)/1)/(2/(-4)). Suppose -kz + 3z - 129 = 0. Let q = z + 181. List the prime factors of q. 2, 13 Suppose -3t + 417 = -5b, -b - 293 = -3t + 136. What are the prime factors of t? 2, 3 Let q be ((-1)/(-3))/((-2)/30). Let h(j) = -j3 - 4j*2 + 4j - 3. Let z be h(q). Suppose zm = m + 10. What are the prime factors of m? 2, 5 Let j = -250 + 447. What are the prime factors of j? 197 Let l(o) = -4 + 2o - 2 - 4o2 + 0. Let k(c) = 5c*2 - c + 7. Let b(z) = -5k(z) - 6l(z). What are the prime factors of b(-6)? 7 Let k = -6 + 6. Suppose 3c - 1 + 13 = k. Let z(m) = -2m2 - 10m - 3. List the prime factors of z(c). 5 Let u = -47 - -134. List the prime factors of u. 3, 29 Let s(f) = -f*3 - 8f*2 + 3f - 22. Suppose 8x - 3x = 0. Suppose 2j - 7j - 45 = x. What are the prime factors of s(j)? 2 Let l be ((-131)/2)/((-3)/6-1). Let c = l - -245. What are the prime factors of c? 2, 3, 19 Let p = 75 + -106. Suppose 10 = 5x - 2t + 80, 3x + t + 31 = 0. Let w = x - p. List the prime factors of w. 19 Let g(k) = 2k - 1. Let p be g(8). Let l be 12 + 179 + 8/2-1. Suppose 0 = -5v + p, f = -3f - 5v + l. List the prime factors of f. 43 List the prime factors of (-8)/(-22) - 337500/(-550). 2, 307 Suppose 0 = -11j - 509 - 250. Let u = j + 177. What are the prime factors of u? 2, 3 Suppose -i = u + 5, -3i = i + 3u + 15. Let y = 2 - -2. Suppose 3x = 2n - 73, i = -n - 4x + 27 + y. What are the prime factors of n? 5, 7 Let f = -1202 - -1758. Suppose 4v + 243 = 6v + 5p, -f = -4v + 4p. What are the prime factors of v? 2, 67 Suppose 5f = c - 877, -5c - 5f + 489 = -3956. List the prime factors of c. 887 Suppose 0 = -92s + 82s + 690. List the prime factors of s. 3, 23 Let h(n) = n3 - 13n*2 - 15n + 14. Let l be h(14). Suppose l = 5w - 3v - 100, w - 21 = v - 3. List the prime factors of w. 23 Let k = 7 - 5. Suppose -3n - 5 = kn. What are the prime factors of (n/3)/(7/(-147))? 7 Let m(j) = 63j + 53. What are the prime factors of m(5)? 2, 23 Let l(c) = -c2 - 5c*2 - 22 - 6c*3 + 2c*2 + 26. What are the prime factors of l(-3)? 2, 5, 13 Suppose 0 = 3b + 8 + 10. Let y(w) = -w*2 - 18w - 21. List the prime factors of y(b). 3, 17 Suppose 0 = 8s - 11s + 1029. Suppose 4m + 3g - 685 = 0, -2m - g = -0g - s. What are the prime factors of m? 2, 43 Let m = 827 - 552. List the prime factors of m. 5, 11 Let r(d) = d2 - d - 3. Let l(u) = -u3 - 3u2 - 2u + 1. Let j(v) = -v*2 + 10v - 3. Let m be j(10). Let w be l(m). What are the prime factors of r(w)? 3, 13 Suppose d - 2f - 1760 = 0, 54d - 57d - f + 5252 = 0. List the prime factors of d. 2, 3, 73 Suppose 0y + 1812 = 4y. Let g = y + -319. List the prime factors of g. 2, 67 Let k(v) = -829v - 797. List the prime factors of k(-5). 2, 3, 31 Suppose 0 = -10a + 5a + 15. Suppose 5h - 188 - 32 = 2f, f = ah - 132. Suppose -5g = h - 189. List the prime factors of g. 29 Let z(m) = 76m - 471. List the prime factors of z(42). 3, 907 Suppose 0 = -p + 5, 10p - 5p + 239 = 3t. Let f = t + -15. What are the prime factors of f? 73 List the prime factors of 30/(-35) + (-19318)/(-14). 7, 197 Let o(h) = 734h2 - 2h - 3. What are the prime factors of o(-1)? 733 Let a = -17 + 24. Suppose -4j + aj = 171. What are the prime factors of j? 3, 19 Suppose 0 = -0p - 2p + 24. Suppose 0 = -f - f + p. Suppose -201 - 39 = -fu. What are the prime factors of u? 2, 5 Let p = -1168 - -2543. What are the prime factors of p? 5, 11 Suppose -9y + 6736 = -1481. What are the prime factors of y? 11, 83 Suppose 7q + 334 = 2980. What are the prime factors of q? 2, 3, 7 Suppose 19 - 11 = -4o. What are the prime factors of (7/3)/(o(-2)/132)? 7, 11 Let i be 3820/16 - 3/(-12)1. Suppose -505 = -4o + i. List the prime factors of o. 2, 3, 31 Let f(x) = -x2 + 11x + 4. Let p be f(11). Suppose 0 = -5z - 3s - 44 + 151, -pz + 68 = -2s. List the prime factors of z. 19 Suppose 30 = 10t - 530. List the prime factors of t. 2, 7 Let p be 2 + 0 - (8 - 8). Suppose -pr - 4 = -84. List the prime factors of r. 2, 5 Let o(y) be the first derivative of 20y2 + y - 5. Let a be o(1). Suppose 5m + 32 = 3s - a, 11 = s + 5m. List the prime factors of s. 3, 7 Let i = -11 - -11. Let b be 19 - i/(-1 - 0). Suppose -5 = -3q + b. List the prime factors of q. 2 Suppose -3c + 2732 = 743. What are the prime factors of c? 3, 13, 17 Suppose -12 = -10i + 13i. What are the prime factors of (-75)/(-4) + (-1)/i? 19 Suppose -356 = -4i - v, 2i + 0i = -2v + 178. Let z be (314)/(51/(-238)). Let l = i + z. List the prime factors of l. 3, 11 Let u(k) = k + 180. What are the prime factors of u(52)? 2, 29 Let w(s) = 3s - 7. Let a be w(3). Suppose 5v = av + 18. Suppose -2x + v = -0x. List the prime factors of x. 3 Let s(w) = -49w + 102. What are the prime factors of s(-14)? 2, 197 Let d = -39 + 49. Let i(z) = z*3 - 9z*2 - 3z - 19. List the prime factors of i(d). 3, 17 Suppose -b = -4m - 4, 3b + 1 = -3m + 2m. Suppose b = -13f + 16f. Let o(g) = -g*3 + 2g*2 + 20. List the prime factors of o(f). 2, 5 Let z = -6 - -40. Suppose -174 = 4d + z. Let i = 73 + d. What are the prime factors of i? 3, 7 Let n = 33 - 33. Suppose -6y + 367 = -2y - 5p, n = y - 2p - 94. List the prime factors of y. 2, 11 Let n(k) = -448k + 17. What are the prime factors of n(-1)? 3, 5, 31 Let i = 5 - 11. Let r = i - -9. Suppose -2x = 2d - 16, 0 = -rd - 4x + 21 - 1. What are the prime factors of d? 2, 3 Let a = 2576 + -1236. List the prime factors of a. 2, 5, 67 Let x = 42 - 40. Suppose xm + m = 423. What are the prime factors of m? 3, 47 Suppose 3b - 7b - 3n = -3, -3b = -2n - 15. List the prime factors of (-63)/((45/(-20))/b). 2, 3, 7 Let g be (-4 + 3)/(3/(-18)). Let q(d) = 2d + 5d2 - 4 - gd*2 - 4d - 5d. What are the prime factors of q(-3)? 2 Suppose 12q - 80 = 8q. Let o be 6/15 - (-1012)/q. Suppose 2b - 60 = 2k, k = 4b - 75 - o. List the prime factors of b. 2 Let a = 7 - 4. List the prime factors of (5/3 - a)-12. 2 List the prime factors of (-3)/60 + 5712/6. 2, 7, 17 Suppose a - 38 = 5h, -3h = -a + h + 36. Suppose -a = 2o - 48. What are the prime factors of o? 2, 5 Let w(r) = -r3 + 4r*3 - 4r*3 + 21r + 14r2 + 0r*3 + 18. List the prime factors of w(15). 2, 3 Suppose i - 159 = 99. Suppose 11j + i - 2480 = 0. List the prime factors of j. 2, 101 Suppose 28749 = 5a - 9g + 8g, -a - 5g + 5729 = 0. List the prime factors of a. 5749 Suppose 5 + 1 = 2h. Suppose -157 = -2j - 0j + 5u, -3u + 267 = hj. What are the prime factors of j? 2, 43 Let h = -97 - -99. Suppose -3z - hp = -418, z + 2p - 138 = -0z. What are the prime factors of z? 2, 5, 7 Suppose 0 = 5h - 3b - 5854, 3b + 705 - 1883 = -h. List the prime factors of h. 2, 293 Suppose -2i - 3p + 2135 = 0, 2451 + 754 = 3i + 5p. What are the prime factors of i? 2, 5, 53 Let r(y) = 11y + 7. Let g be r(9). Suppose -4w = m + g - 313, 3m + 42 = w. Let j = w - 23. List the prime factors of j. 2, 7 Suppose 5s - 29 = 2g, 4s - 28 = 3g + g. Suppose 17 = 3n + 2u, -n - 5u + s + 18 = 0. Suppose -2r + 50 = nr. What are the prime factors of r? 2, 5 What are the prime factors of (41335/(-20))/(2/(-12))? 2, 3, 89 Let l(q) = -162q - 195. What are the prime factors of l(-9)? 3, 421 Let o be (4/(-6))/((-12)/144). Let m be o/(-10)(-30)/12. What are the prime factors of (-6 - -7) + m + 27? 2, 3, 5 Suppose -h - 5i - 23 = 0, 2i - 3i - 11 = -3h. Suppose hc - 3c = -229. What are the prime factors of c? 229 Suppose 13906 - 2566 = 10z. What are the prime factors of z? 2, 3, 7 Let m(k) = 2k*2 - 4k + 2. Let p be m(2). Suppose 0 = pw - w - 3j - 4, -4w = -2j - 16. What are the prime factors of w/(-20) + (-206)/(-5)? 41 Let r be 5/10(3 - -5). Suppose -f - f = rp - 134, 0 = -5p - f + 163. List the prime factors of p. 2 Let r = 2063 - 1401. What are the prime factors of r? 2, 331 Let p = -17 + -5. Let r be (-16310)/(-77) + (-4)/p. Suppose -4d + 8*d - r = 0. What are the prime factors of d? 53 Let h be 681/15 + 12/20. Suppose -74 =	{ "pile_set_name": "DM Mathematics" }
4876, -8345874, -13040014, -18777296, -25557720? -521571s2 - s - 734 What is the r'th term of -2264, -2598, -2932, -3266, -3600? -334r - 1930 What is the f'th term of -79, 632, 2509, 6134, 12089? 97f3 + f2 + 29f - 206 What is the p'th term of 170337496, 170337498, 170337500, 170337502? 2p + 170337494 What is the k'th term of 107791, 107437, 107083, 106729? -354k + 108145 What is the v'th term of -11591073, -23182143, -34773213, -46364283, -57955353? -11591070v - 3 What is the t'th term of -2792516, -5585032, -8377548? -2792516t What is the v'th term of 13110, 25963, 38830, 51717, 64630? v3 + v2 + 12843v + 265 What is the r'th term of 318203, 636398, 954593, 1272788, 1590983? 318195r + 8 What is the c'th term of -308258954, -308258956, -308258958, -308258960? -2c - 308258952 What is the v'th term of -1930, -2845, -3754, -4657? 3v*2 - 924v - 1009 What is the g'th term of 18541484, 18541485, 18541486, 18541487, 18541488? g + 18541483 What is the b'th term of 192, -148, -444, -672, -808, -828, -708, -424? 4b3 - 2b*2 - 362b + 552 What is the u'th term of -1054, -2282, -3694, -5290, -7070, -9034? -92u2 - 952u - 10 What is the j'th term of -15568, -30733, -45898, -61063? -15165j - 403 What is the h'th term of 895842, 1791683, 2687528, 3583377, 4479230? 2h*2 + 895835h + 5 What is the s'th term of 1699398, 1699404, 1699412, 1699422, 1699434, 1699448? s*2 + 3s + 1699394 What is the s'th term of -480, -2365, -5648, -10329, -16408, -23885, -32760? -699s2 + 212s + 7 What is the g'th term of -10471, -13013, -15555, -18097, -20639? -2542g - 7929 What is the r'th term of -2499, -3347, -4195, -5043, -5891? -848r - 1651 What is the i'th term of -226684954, -226684953, -226684952, -226684951, -226684950? i - 226684955 What is the v'th term of -37594248, -37594247, -37594246, -37594245, -37594244, -37594243? v - 37594249 What is the h'th term of -19018, -23274, -27530, -31786, -36042? -4256h - 14762 What is the s'th term of -507724, -1015456, -1523186, -2030914? s2 - 507735s + 10 What is the o'th term of -152290, -609195, -1370702, -2436811, -3807522, -5482835, -7462750? -152301o2 - 2o + 13 What is the g'th term of 117204, 234359, 351508, 468645, 585764, 702859, 819924? -g*3 + 3g*2 + 117153g + 49 What is the q'th term of -13059, -14109, -15177, -16263? -9q2 - 1023q - 12027 What is the p'th term of 335586, 671180, 1006780, 1342386, 1677998, 2013616? 3p2 + 335585p - 2 What is the u'th term of -1957, -9278, -21969, -40036, -63485, -92322, -126553, -166184? -u*3 - 2679u*2 + 723u What is the v'th term of -6607, -13592, -20577, -27562, -34547? -6985v + 378 What is the m'th term of -2395435, -9581749, -21558929, -38326975, -59885887? -2395433m*2 - 15m + 13 What is the g'th term of 26444, 46532, 66620, 86708, 106796, 126884? 20088g + 6356 What is the f'th term of -51050, -102122, -153194, -204266? -51072f + 22 What is the t'th term of -304, -998, -2020, -3370, -5048? -164t2 - 202t + 62 What is the h'th term of -2098, -142, 3084, 7580? 635h2 + 51h - 2784 What is the q'th term of -11745, -19447, -27149, -34851, -42553, -50255? -7702q - 4043 What is the h'th term of 11401, 22408, 32625, 41656, 49105, 54576, 57673, 58000? -66h3 + h2 + 11466h What is the r'th term of -21175, -42039, -62563, -82747, -102591, -122095, -141259? 170r*2 - 21374r + 29 What is the a'th term of 986405, 986401, 986397, 986393, 986389? -4a + 986409 What is the w'th term of -68364, -140790, -213202, -285594, -357960, -430294? w3 + w2 - 72436w + 4070 What is the k'th term of -10408, -21481, -33222, -45631, -58708, -72453, -86866? -334k2 - 10071k - 3 What is the h'th term of 18068, 36758, 55450, 74144, 92840, 111538, 130238? h*2 + 18687h - 620 What is the u'th term of -12322165, -24644255, -36966345, -49288435, -61610525, -73932615? -12322090u - 75 What is the f'th term of 4511, 10371, 16231, 22091, 27951? 5860f - 1349 What is the i'th term of -881277, -881199, -881123, -881049? -i*2 + 81i - 881357 What is the a'th term of 1285, -872, -3029, -5186, -7343? -2157a + 3442 What is the s'th term of -3836566, -3836554, -3836534, -3836506, -3836470? 4s*2 - 3836570 What is the h'th term of -2446362, -2446517, -2446672, -2446827? -155h - 2446207 What is the b'th term of -11602, -92847, -313366, -742795, -1450770? -11606b3 - b2 + 5 What is the p'th term of 1715242, 1715257, 1715292, 1715353, 1715446? p3 + 4p*2 - 4p + 1715241 What is the a'th term of -139, -213, -341, -529, -783? -a*3 - 21a*2 - 4a - 113 What is the x'th term of 5198, 5548, 6136, 6962? 119x2 - 7x + 5086 What is the b'th term of 25123, 25108, 25067, 24988, 24859? -2b3 - b2 + 2b + 25124 What is the q'th term of 42478, 42816, 43394, 44218, 45294? q*3 + 114q*2 - 11q + 42374 What is the t'th term of -322386, -644805, -967264, -1289763? -20t2 - 322359t - 7 What is the s'th term of 273, 825, 1353, 1857, 2337, 2793, 3225? -12s2 + 588s - 303 What is the k'th term of 13791, 27502, 41213? 13711k + 80 What is the a'th term of -1701844, -1701828, -1701812, -1701796, -1701780? 16a - 1701860 What is the h'th term of -19213, -35629, -52045? -16416h - 2797 What is the r'th term of 108151, 108229, 108307, 108385? 78r + 108073 What is the y'th term of 202273, 404225, 606177, 808129, 1010081? 201952y + 321 What is the k'th term of -149415106, -298830211, -448245316, -597660421? -149415105k - 1 What is the t'th term of 3004, 23991, 80952, 191875, 374748, 647559, 1028296, 1534947? 2998t3 - t2 + 4t + 3 What is the p'th term of -64951, -65204, -65461, -65722, -65987? -2p2 - 247p - 64702 What is the q'th term of 27743, 55771, 83799, 111827? 28028q - 285 What is the y'th term of -71, 231, 829, 1729, 2937? y3 + 142y*2 - 131y - 83 What is the b'th term of 3836, 15435, 34764, 61823, 96612? 3865b2 + 4b - 33 What is the j'th term of -619, -2956, -8751, -19732, -37627, -64164, -101071? -288j3 - j2 - 318j - 12 What is the h'th term of 27230, 54412, 81600, 108800, 136018, 163260? h*3 - 3h*2 + 27184h + 48 What is the f'th term of 26993, 27200, 27543, 28022, 28637? 68f2 + 3f + 26922 What is the f'th term of 5241, 5311, 5391, 5481? 5f2 + 55f + 5181 What is the w'th term of -1191381, -1191386, -1191415, -1191480, -1191593, -1191766, -1192011? -2w3 + 9w - 1191388 What is the u'th term of -7163440, -7163422, -7163404, -7163386, -7163368, -7163350? 18u - 7163458 What is the u'th term of -31111, -62465, -93819? -31354u + 243 What is the a'th term of 1303421, 2606870, 3910319? 1303449a - 28 What is the z'th term of -8784503, -8784507, -8784509, -8784509? z2 - 7z - 8784497 What is the z'th term of -262890, -263062, -263236, -263412? -z*2 - 169z - 262720 What is the n'th term of 9177, 18640, 28107, 37578, 47053, 56532, 66015? 2n2 + 9457n - 282 What is the q'th term of 122586110, 122586108, 122586106, 122586104, 122586102? -2q + 122586112 What is the r'th term of 142652, 142700, 142750, 142802? r2 + 45r + 142606 What is the k'th term of 280663, 1122695, 2526093, 4490857, 7016987, 10104483? 280683k2 - 17k - 3 What is the z'th term of 562772, 1125529, 1688294, 2251073, 2813872, 3376697? z*3 - 2z*2 + 562756z + 17 What is the m'th term of -1135181, -1135162, -1135129, -1135082? 7m2 - 2m - 1135186 What is the i'th term of -12910174, -12910177, -12910180, -12910183, -12910186, -12910189? -3i - 12910171 What is the n'th term of 18296, 18225, 18138, 18029, 17892? -n3 - 2n*2 - 58n + 18357 What is the t'th term of -355, -1395, -2435? -1040t + 685 What is the t'th term of 44611, 178485, 401647, 714127, 1115955, 1607161? 5t*3 + 44614t*2 - 3t - 5 What is the l'th term of -7635360, -15270721, -22906082, -30541443, -38176804, -45812165? -7635361l + 1 What is the b'th term of 1889509, 3779072, 5668681, 7558360, 9448133, 11338024, 13228057, 15118256? 4b3 - b2 + 1889538b - 32 What is the z'th term of -93549, -374019, -841411, -1495725, -2336961, -3365119, -4580199? -93461z*2 - 87z - 1 What is the p'th term of -7288, 3283, 13854, 24425, 34996, 45567? 10571p - 17859 What is the w'th term of -7842590, -15685180, -23527770? -7842590w What is the r'th term of -154936,	{ "pile_set_name": "DM Mathematics" }
-2 Rearrange 6h + 8h + 6h + 13h to the form ch + b and give c. 33 Express (0t*2 + 3t*2 - 5t*2)(23 + 154t - 7 - 162t + (1 - 1 - 2t)(2 + 0 + 0)) in the form c + yt3 + bt*2 + rt and give b. -32 Express 0l - l3 + 0l - 5 - 3l3 + 5 + (2 - l2 - 2)(l + l + 0l) + 6l*3 + l - 3l + 10l3 as nl + g + cl2 + jl*3 and give n. -2 Rearrange -68 - 61z - 59 + 127 to x + lz and give l. -61 Express -7m - 3m - m - 6m in the form v + im and give i. -17 Express 2y*2 + 7y*4 + 2 + 5y*4 - 10y*4 + 2y*3 in the form zy*4 + cy*2 + fy*3 + gy + o and give c. 2 Express 2 - 2 - o*2 + (-2o + 7o - o)(3o + 0o - 5o) as qo*2 + p + uo and give q. -9 Rearrange (-1 + 1 - 5g + (-1 + 2g + 1)(-3 + 0 + 1) + 8g - 5g + 3g)(-g - g + 0g) to the form x + og + vg2 and give v. 6 Express -w3 + 24 + 16w - 24 in the form vw + hw2 + xw*3 + k and give v. 16 Express (5s + 7 - 7)(6 - 3 - 1) in the form m + us and give u. 10 Express -20m + 101m - 24m2 + 12m*2 + 11m*2 as g + qm*2 + jm and give q. -1 Express 2 + 0 - 2 - 24g in the form ig + h and give i. -24 Express -j*3 - 3j*3 - 16j + 12j as h + uj + fj3 + wj*2 and give f. -4 Rearrange 4s + 3s2 + 2s - 4s2 - 7s to the form rs2 + w + js and give j. -1 Rearrange -7u2 - 509 + 509 + (0u*2 + 0u*2 + 2u*2)(-2 + 1 + 2) to su + nu*2 + i and give n. -5 Express 2 + 7z*2 - 5 + 2 - 2 as r + hz*2 + mz and give r. -3 Express (-n - 2 + 2)(-338 - 305 + 580) in the form h + gn and give g. 63 Rearrange -80 + k + 3k2 + 80 to the form yk + f + ik2 and give y. 1 Express -166 - 139o*2 + 166 in the form co + do2 + t and give d. -139 Rearrange 2d*2 - d + 3d*2 - 3d*2 + (2d + 3d - 3d)(2d + 0d + 0d) + 7d2 - 4 + 4 to z + ad + sd2 and give z. 0 Rearrange -12d + 12d + 1 + 8d*4 + 2d*4 - 2d4 - d4 + (2d4 + 0d*2 + 0d*2)(0 + 4 - 2) to the form jd3 + r + od + xd2 + pd*4 and give j. 0 Rearrange -5v*3 - 4v*3 + 3v3 + v2 - 2v to wv*3 + zv + l + cv2 and give w. -6 Rearrange -3 - 5j*3 - 2j - 2j3 + 5j*3 to kj + wj2 + p + tj*3 and give w. 0 Rearrange -1 + 3y*2 - 28y + 28y to the form cy*2 + p + hy and give c. 3 Rearrange (-4d + 7d - 5d)(-6d3 + 4d3 - d3) to the form jd + pd*2 + sd*4 + nd*3 + t and give n. 0 Express (0z*3 + 5z3 - z3)(z + 0z + 0z) - 3z*4 - 2z*4 + 6z*4 in the form uz*2 + sz*4 + q + cz + pz3 and give s. 5 Rearrange (-2 + 0 + 0)(2 - 2 + 3p3) - 4p*3 + 3p*3 + 2p*3 + (2 + 1 - 2)(-3p3 + 1 - 1) to the form a + xp + up3 + jp*2 and give u. -8 Express 57i + 47i - 77i + 95i as k + zi and give z. 122 Rearrange -21k3 - 1 - 6k + 3k + 3k to ck + uk*3 + b + wk*2 and give u. -21 Express (4r - 4r + 2r)(1 + 2 - 6) + 4 + 2r + 0 + 5 in the form wr + k and give k. 9 Express (-5t + t + 3t)(478t - 8t2 - t3 - 478t) as gt*2 + rt*4 + ot*3 + j + yt and give r. 1 Express -3 + 3 - 4h + 3h*2 + h as ch + vh2 + f and give c. -3 Express (0x*3 - 2x3 + x3)(2 - 2 - 2)(7 + 3 - 3)(0x + 3x - 5x) in the form ox3 + g + tx*4 + nx*2 + dx and give t. -28 Rearrange 35j - 3 + 7 - 4 to ij + y and give i. 35 Express 11w + 8w + 0w + 8w in the form a + kw and give a. 0 Rearrange -4506j - 2 + 2 + 4871j - j - 1 + 1 + (1 + 2 - 1)(j + 2j - j) to the form fj + v and give f. 368 Rearrange 78 + 2k - 78 to v + mk and give v. 0 Express (2 - 1 + 0)(4v*3 - 4v*3 + 2v*3) + 5v*3 - 4v3 + v3 in the form pv + tv*3 + dv*2 + s and give t. 4 Rearrange (-7 + 3 + 5)(-2 + 2t3 + 2) to the form zt*2 + lt*3 + dt + v and give l. 2 Express (-4 + 2h2 + 5 + 1)(-1331 + 1331 - 125h) in the form ch*2 + wh*3 + s + vh and give w. -250 Express -q + 3 + 2q2 + 2q - 2 + 0q + 0q - 3q2 - q2 - q2 - q2 + (4q + 0q - 2q)(-1 - q + 1) as hq + r + cq2 and give r. 1 Rearrange 10z + 12z - 20z to y + mz and give m. 2 Rearrange (-7i + 2i - 2i)(-3 + 4 + 1) to the form l + pi and give p. -14 Express ((-5 + 1 + 1)(-4u + 3u + 3u) - 3u - u + u)(0 + 3 + 0)(-4 + 4 + 4) as j + qu and give q. -108 Express 4t2 - 5t2 - t2 + (-5t + 5t - 2t2)(3 - 3 + 2) + (2 + 1 - 1)(0t2 - t2 - 2t2) in the form d + bt*2 + it and give i. 0 Express (8 + 5r2 - 8)(r - 2r + 4r) in the form tr + cr*2 + j + ur*3 and give u. 15 Rearrange (-2b*2 + 9b2 + b2)(-4b*2 - 2b + 0b2 + 5b*2) to the form kb*3 + s + yb*4 + wb*2 + rb and give k. -16 Rearrange -4r4 + 3r*4 + 3r*4 + (24 - 24 + 15r)(-r3 + 2r*2 - 2r*2) to nr*4 + or*2 + w + ur*3 + zr and give n. -13 Express -2 + 2 + 180k - 68k in the form r + qk and give r. 0 Rearrange -k3 - 2 + 0 + 0k*3 + 4k*3 to the form wk*2 + bk*3 + s + mk and give m. 0 Express (((0w + 3w - 2w)(-5 + 0 + 3) + w - 4 + 4)(-2 + 3 - 5) + 5w - 4w - 4w)(3w - 3 + 3) as aw + q + zw*2 and give z. 3 Rearrange -22k*3 + 5k - 15k + 6k to the form zk3 + vk*2 + b + rk and give r. -4 Express 25j + 9j + 26j - 23j as qj + z and give q. 37 Rearrange 4c3 + c3 + 2c2 - 3c*3 to uc*2 + vc + l + rc3 and give u. 2 Express 4m + 2m - 13 + 5m - 8m as qm + i and give q. 3 Rearrange (3 - 4 + 0)(-d - 3d + 2d)(-17 + 6d + 2d - 6d) to the form w + kd + td2 and give t. 4 Express 0 + 5m*2 - 6m*3 + 4m*3 + 2 - 4m*2 as fm*3 + q + um + vm2 and give q. 2 Express 54w - 2w3 + 59w - 112w - 2w4 - 3 + w4 - 4w2 as j + gw*4 + bw*2 + iw + rw3 and give g. -1 Express w3 + 7w*4 - 2 + 5 + 3w*4 + 3w*4 as yw + iw3 + ow*4 + jw*2 + u and give i. 1 Rearrange 11o*3 + 35 - 38 - 10o3 + o2 to the form vo + s + jo*2 + do*3 and give s. -3 Express (-3t + t + 4t)(t - 4t + 2t + (-t - 2t + 5t)(-4 - 1 - 1) + t - 2t - t) in the form s + xt2 + ht and give x. -30 Express (-3 - 1 + 6)(2g - 2g + g2) + (4g + 14 - 14)(1 + 11g - 1) in the form bg + p + vg*2 and give v. 46 Rearrange 4j - 4j - 13j*2 + j to the form sj*2 + l + cj and give s. -13 Rearrange -850 + 2a2 + 2a*3 + a + 850 to da*2 + qa*3 + ya + k and give q. 2 Rearrange 26n2 - 3n - 24n2 - 5n*3 + 3n to u + yn + zn*2 + hn*3 and give z. 2 Rearrange (-7 + 10 + 10)(-13 + 13 - 22t) to the form o + zt and give z. -286 Rearrange (-l - 3l + 0l)(-5l*2 + 5l*2 + 2l*3)(1 - 5 + 2) to the form il2 + jl*4 + q + pl + cl3 and give j. 16 Express 0h*3 + 0h*3 - 1 + h + 0h*3 + 3h*3 in the form k + fh*2 + lh*3 + oh and give o. 1 Express 2s + 2 - 2 - 12s*2 as y + ls*2 + zs and give z. 2 Rearrange -13v + 84v + 20v to cv + h and give c. 91 Express (-2z + 5z - 2z)(-30z - 42z - 21z)(-2 - 4 + 5) as cz + tz*2 + o and give t. 93 Express 6z*2 + 5z*2 + 2z*3 + 0z*2 + 2 - 5z*2 in the form w + bz + sz2 + pz*3 and give w. 2 Rearrange -2w*2 - 13w + 13w - 4 - w3 - 1 to the form gw + tw3 + sw*2 + m and give s. -2 Rearrange (0w*3 - 5w*3 + 2w*3 + (-2 + w + 2)(-3w2 + w2 + 3w*2))(5 + 8 - 11) to kw3 + pw*2 + iw + z and give k. -4 Rearrange (5 - 10 - u + 3u)(-2u - u + 1 + u) to i + hu*2 + zu and give z. 12 Express -7b - 8b*2 + 7b - 8b2 in the form ib*2 + pb + v and give i. -16 Rearrange 1 + 1 - 2b4 + 2b2 + b3 - 2b2 to wb*3 + cb + n + sb2 + gb*4 and give n. 2 Rearrange 2z - 24z3 + 6z*3 + 11z*3 to bz + sz2 + g + qz*3 and give q. -7 Express (-5u*3 + 3u*3 + 3u*3)(9u - 149u - 61u) as f + gu*4 + ou + bu2 + wu*3 and give g. -201 Express 31h + 30h + h2 - 69h in the form d + fh + ph*2 and give f. -8 Express (0m + 3m - 5m)(m + 2m - m) - 3m2 + 7m*2 - 3m*2 - 5 + 5 + 4m*2 + 0m*2 + 4m*2 + 0m*2 in the form qm*2 + rm + i and give q. 5 Express 4b2 - 5b2 + b3 - 3b2 - 2b*4 - 2b*3 as cb + tb4 + mb*3 + sb*2 + k and give m. -1 Express 14j - 19j - 36j in the form l + uj and give u. -41 Express 2 - z3 + z4 + 2z2 - 3 + z4 as az2 + lz*3 + oz + kz4 + v and give a. 2 Express z2 - z3 - 5z*2 + 3z*2 + 0z**	{ "pile_set_name": "DM Mathematics" }
-0.2 + 0.1. Put p, -0.2, v in decreasing order. v, p, -0.2 Let q = -18 + 50. Let j = 28 - q. Sort -5, j, 19 in increasing order. -5, j, 19 Let y = -17 + 17.5. Suppose 2f = f. Suppose l - 2x + 7 = 0, l + 3l + 4x - 20 = f. Sort 1/4, y, l in decreasing order. l, y, 1/4 Let w be (4 - 406/105)-5. Sort -2/11, 4, -27, w in decreasing order. 4, -2/11, w, -27 Let i = 0.591 - 1.191. Sort i, -1/10, -3, 2 in ascending order. -3, i, -1/10, 2 Let c = -0.3 + 1.3. Let f = 82 + -83. Suppose 10 = -3j + j. Put c, j, f in ascending order. j, f, c Let u = 0.4 - -1.2. Let x = 3.6 - u. Let j = 0.6 - 0.1. Sort j, -1/5, x in increasing order. -1/5, j, x Let t = 341 + -341.05. Sort -3/5, t, -2 in descending order. t, -3/5, -2 Let q = -1 - -0.5. Suppose -6 = -33j + 36j. Put j, q, 0.5 in decreasing order. 0.5, q, j Let y = 0.19 - 0.39. Put y, 3, 13, -3 in increasing order. -3, y, 3, 13 Let h = -2.49 + 14.39. Let u = h + -7.9. Sort u, -4, -0.6, -2/7. -4, -0.6, -2/7, u Let r = -1 + 3. Let b be (12/r)/1 - 0. Let m = -778 + 777. Sort -4, b, m in increasing order. -4, m, b Suppose 215 = -54k - 1. Sort 2/3, -0.6, k, 1/4 in descending order. 2/3, 1/4, -0.6, k Let r be -512/(-160) - 55/104. Let i be 10(-1 + 9/8). Sort 1, r, i. r, 1, i Let r = -305 + 307. Let h = -2 + -1. Sort h, 3, 0, r. h, 0, r, 3 Let p = -176 + 371. Let j = p + -1367/7. Let m = 3 - 2. Put m, 2/19, j in increasing order. j, 2/19, m Let t = -87 - -63. Let m = t - -41. Sort 4, m, 0.2, 0. 0, 0.2, 4, m Let g(a) = 2a*2 + 47a + 74. Let w be g(-22). Let q be 4 - 1(0 + 0). Sort w, q, 2. 2, q, w Let z be (-2)/(-1) - (6 - 2). Suppose -2r + 10 = 3r. Put z, r, -4, 4 in descending order. 4, r, z, -4 Suppose 78 + 37 = 4b - 3r, -3 = -r. Suppose 5s - 25 = -3d, -3d - 3s = 2d - b. Let v be (-22)/(-20) - (-4)/10. Sort d, -3, v in descending order. d, v, -3 Let t = -3.2 + 2.2. Sort 0.5, t, 0, -3. -3, t, 0, 0.5 Let x(f) = -3f2 - 9f + 4. Let n be x(-3). Let c be 24/11 - 14/77. Put -7, n, c in ascending order. -7, c, n Let m = -0.0262 - -0.0362. Put 4, 9/5, m, 2 in increasing order. m, 9/5, 2, 4 Let y be -7 + (-5 - (-6 - -2)). Let x be (-22)/y - 8/(-32). Sort -3, x, -1, 5 in decreasing order. 5, x, -1, -3 Let y = -525 + 527. Sort -0.2, y, 1 in descending order. y, 1, -0.2 Let k(p) = 5p2 - 10p + 53. Let o be k(8). Sort -3, -1, o in descending order. o, -1, -3 Suppose 0 = -4j - 5i - 4 - 0, 2j - 3i = 20. Suppose 0 = -n + x - 24 - 1, 2n = 5x - 65. Let v = 16 + n. Sort j, 3, v. v, 3, j Suppose 4r = 5o + 31, -3r + 27 = -5o - 0r. Let h be ((-16)/32)/((-1)/10). Suppose -1 + h = 4t - 2p, p + 8 = 4t. Sort 1, t, o in decreasing order. t, 1, o Suppose t - 1 - 1 = 0. Let d = -325 + 342. Sort 1, d, t, -2. -2, 1, t, d Let q = -6 + 15. Let g = -5 - q. Let s = -30 - g. Sort s, 0.5, -3/4 in decreasing order. 0.5, -3/4, s Let c(y) be the third derivative of -y5/20 - y4/12 - y*3/6 - 10y*2. Let j be c(1). Put j, -4, -2 in decreasing order. -2, -4, j Suppose i + 13 = -0i - z, i = -5z + 3. Let m = -14 - i. Let y = -24 + 23. Put 4, y, m in ascending order. y, m, 4 Let w be -20((-9)/4 + 2 + 0). Suppose -2c - 2 = 3n - 2n, 0 = -c + 4n - 1. Sort w, c, 6, -2 in descending order. 6, w, c, -2 Suppose 2 = 4c - 2, 2h - 149 = -3c. Let k = 70 - h. Sort 2, k, 18 in decreasing order. 18, 2, k Suppose -x - 5k = -19, 5 = 3x - 2x - 2k. Let i = x + -8. Let s = -3 + 3.1. Sort 2/3, i, s. s, 2/3, i Let y = -5 - -9. Suppose -33 = -4m + 5r, -r - 5 - y = -2m. Sort -4, -2, m, -1 in decreasing order. m, -1, -2, -4 Let q = -8.48 + -33.52. Sort 0.2, q, 0.5 in descending order. 0.5, 0.2, q Let n(w) = w*2 + 55w + 21. Let r be n(-52). Sort r, -1, -2 in decreasing order. -1, -2, r Let q = -4.9 - -5. Suppose 3z - 15 = -0z. Let c = -23/4 + z. Sort c, -5, q in decreasing order. q, c, -5 Let t = 2.53 - -0.47. Put 9/5, t, -3 in increasing order. -3, 9/5, t Let g(o) = -o - 7. Let b be g(-9). Suppose 3f + 15 = -bf. Suppose 0 = -5q - 2n - 13, 25 = -q - 5n + 4. Sort 4, q, f in decreasing order. 4, q, f Let x be 1/6 + 1/6. Let v = 241.6 - 241.6. Put v, -3/5, 0.03, x in increasing order. -3/5, v, 0.03, x Let u = 838 + -4191/5. Sort 29, -0.1, -1, u in ascending order. -1, u, -0.1, 29 Let a(w) = -2w + 111 - 63 + 0w + 8w. Let v be a(-9). Put v, 0, -4 in decreasing order. 0, -4, v Let c = 15613/15 + -1041. Put c, -1/9, 3/4 in increasing order. c, -1/9, 3/4 Let y be ((-14)/(-5))/((-105)/(-150)). Sort y, -66, -1 in decreasing order. y, -1, -66 Let d = 2325 - 2330. Suppose -16 = 4i - 3i. Sort -3, -4, d, i. i, d, -4, -3 Suppose c + 5 = 5h, 0 = -c + 3c + 3h + 10. Let t = -2 - 0. Sort -4, t, -3, c in decreasing order. t, -3, -4, c Let m = 4 - 9. Let f(t) = 3t*2 + 14t + 14. Let n be f(-3). Put n, -2/3, m in descending order. -2/3, n, m Let l = -8.1 - -1.1. Let r = -3 - l. Let y(q) = -3q - 34. Let d be y(-11). Sort -5, d, r in ascending order. -5, d, r Let q(v) = -v2 - 17v + 21. Let g be q(-18). Suppose -2 = 2n, 3t + gn - 1 = 8. Suppose 0 = -4x - 5u, -3x - 4u = -6x. Put x, t, -4 in ascending order. -4, x, t Let k(g) = g*2 + 7g + 9. Suppose 30 = 4m - 9m. Let a be k(m). Suppose 0 = -c + a, 9t - 4t + 3 = c. Sort 4, t, 11 in ascending order. t, 4, 11 Let v = 3195 + -140585/44. Sort 0, -5, v, -3/7 in decreasing order. 0, v, -3/7, -5 Let q(y) = y*3 + 8y*2 + 2y + 12. Let k be q(-8). Let b = -0.03 + 9.03. Let x = -5 + b. Put x, -4/3, k in ascending order. k, -4/3, x Suppose 3x - x - 4 = 0. Suppose -xr + 14 = 4. Sort r, 2, -1 in descending order. r, 2, -1 Let m = 4.98 + -4.58. Let f = -44/35 + 6/7. Sort f, m, -2 in descending order. m, f, -2 Let n be -1 + -3 - 891/(-33). Put 2, -2, n, -5 in increasing order. -5, -2, 2, n Let d = -1306 - -1300. Sort -4, -30, d in ascending order. -30, d, -4 Let q = 465 - 452. Sort 1/3, q, -2 in decreasing order. q, 1/3, -2 Let x(n) = n*3 + 20n*2 - 23n - 41. Let t be x(-21). Let s be 10(-1 + 1 + t/12). Put 2, s, -6, 0.4 in descending order. 2, s, 0.4, -6 Suppose -5s = 5y + 170, -3s + 3y + 176 = -8s. Sort s, 2, 4 in increasing order. s, 2, 4 Let i = 157/2 + -73. Let p = -25/4 + i. Sort p, 0.2, -0.4, -1/4 in decreasing order. 0.2, -1/4, -0.4, p Let f be (-2)/8 + 10/8. Let x(h) = -h*2 + 3h + 2. Let m be x(3). Suppose -mb + 11 = 1. Put f, -1, b in decreasing order. b, f, -1 Let j = -2460 - -2456. Put j, 2/7, -47 in decreasing order. 2/7, j, -47 Suppose 0 = 7d - 5d - 4, -32 = -4m + 4d. Let f be (-2)/7 - 75/7. Let r = f + m. Sort 1, 5, r in ascending order. r, 1, 5 Let l be -6 - 4/((-12)/15) - 4. Sort -4, 0.2, -6/13, l in decreasing order. 0.2, -6/13, -4, l Let a(y) = y - 14. Let o be a(-7). Put 3/2, o, -0.4 in decreasing order. 3/2, -0.4, o Let t(u) = u2 - 2u - 42. Let o be t(-7). Sort o, -4, 2. -4, 2, o Let g be (20/15 + -1)/((-1)/(-9)). Suppose 6a - w = ga - 7, 3a + 5w = -37. Suppose 5d - 5 = -2s + 4d, -3s + 2d = -18. Put a, 3, s in ascending order. a, 3, s Let o = -11645/8 - -1456. Put -8, 1, o, 23 in ascending order. -8, o, 1, 23 Let l = -1 + 28. Let y be ((-1)/(-9))/(4 - 102/l). Sort -0.2, 8, y, 0.2 in descending order. 8, y, 0.2, -0.2 Let w(m) = 12 + 12 - 23 + 2m + 0m. Let d be w(0). Sort -2, d, -3, 0 in descending order. d, 0, -2, -3 Let c be -10(-1 + (-66)/(-70)). Suppose 3m = 2h - 10 + 2, -20 = -3m - 5h. Suppose -5d - 26 + 6 = m. Sort -3, d, c in increasing order. d, -3, c Let w = 13 + -8. Suppose 11 = -u + 3b - b, 4u = 2b - 26. Sort w, u, 1 in decreasing order. w, 1, u Let o = 2 - 1. Suppose 426 = 61d + 81d. Sort d, 2, o, 8 in increasing order. o, 2, d, 8 Suppose 5p - 26 = 4j, -8j + 9j - 2p + 8 = 0. Put -5, 46, j in descending order. 46, j, -5 Let r = -44 + 43.5. Sort r, -3/7, -0.2. r, -3/7, -0.2 Suppose 0r + 8r - 24 = 0. Suppose -4v + 23 - r = 0. Sort -6, v, 4 in descending order. v, 4, -6 Let h = 1.6 + -2.6. Put 0, 0.1, h, -1/8 in decreasing order. 0.1, 0, -1/8, h Suppose -7 - 68 = 5p. Let g be 12/(-2)(-2)/p. Let a = -1.05 - -0.05. Put 0.2, a, g in decreasing order. 0.2, g, a Let k = 102 + -98. Put k, 5, 3, -3 in decreasing order. 5, k, 3, -3 Suppose 0 = 3u + u, -2v = 5u + 10. Let o = -20 - -23. Suppose 4i - 11 = -oc, 7 = c - i + 3i. Sort v, 3, c in decreasing order. 3, c, v Suppose 44*d - 9 = 35. Sort d, 4	{ "pile_set_name": "DM Mathematics" }
5 Let c = 1110 + -6643/6. Calculate the common denominator of -23/10 and c. 30 Let i(n) = -4n3 - 2n - 1. Calculate the least common multiple of i(-1) and 9. 45 Let s = -6 + 14. Let o be (-4 - 2)12/8. Calculate the lowest common multiple of (-1)/3 + (-39)/o and s. 8 Let p = -9162 - -91537/10. Let u = -1 + -1. What is the common denominator of (u - 0) + (-166)/4 and p? 10 Let p = 2/3219 - 70852/54723. What is the common denominator of p and 155/(-4)(-8)/(-20)? 34 Let h = -121627/35874 - -3/1993. Let p = 106 + -207/2. Calculate the common denominator of p and h. 18 Let t be -2 + 0 + (-345)/(-162). Let y = t + 161/54. Find the common denominator of ((-4)/24)/((-2)/226) and y. 18 Let j(m) be the third derivative of -m*6/120 + 7m*5/60 - 5m4/24 - m3/3 + 3m2. Let h = 35 - 17. Calculate the smallest common multiple of h and j(6). 36 Suppose 0 = -2n - 5h - 5, 2n - n + 15 = -5h. What is the least common multiple of n and 40? 40 Let b be 5 + -2 - (-3)/1. Calculate the common denominator of (1/4)/(b/(-412)) and -32/11. 66 Calculate the common denominator of 33 and -1 + (-3)/(36/(-94)). 6 Suppose 12 = 5z - 13. Let f = -3 + 7. What is the least common multiple of f and z? 20 What is the lowest common multiple of (-10 - -15) + 1/1 and 19? 114 Let k = 281/5 + -3356/55. Find the common denominator of k and 13/14. 154 Let u(g) = g + 12. Calculate the least common multiple of 9 and u(-6). 18 Let f = 11 - 9. Find the common denominator of 1/8 and 1 + 73f/40. 40 Let l(n) = n + 2. Let o = 16 - 11. What is the least common multiple of l(o) and 9? 63 Let j = 999039 - 7977849/8. Let y = 1813 - j. Calculate the common denominator of y and -83/2. 8 Suppose a = -2b + 56, 2a + 2b - 103 = b. Let z = -20 - -28. Calculate the smallest common multiple of 2/(-8) - a/(-8) and z. 24 Let h(b) = -b*2 - 3b + 5. What is the lowest common multiple of 3 and h(-4)? 3 Suppose -2u = -u - 16. Let y be ((-3)/2)/(2/20). Let q = y - -23. What is the least common multiple of u and q? 16 Let h = -3268/35 + 438/7. Let b = h - -661/20. What is the common denominator of -55/2 and b? 4 Suppose -8 + 0 = -k. Let f(q) = -7q - 25. What is the lowest common multiple of k and f(-5)? 40 Let j(x) = -x*3 - 4x*2 - 7x - 10. What is the least common multiple of j(-4) and 8? 72 Let g be (-5)/((-5)/(-8)) - 2. Calculate the lowest common multiple of (0 - (-1 - -2))g and 3. 30 Suppose -5 = -j + 3v, 5j + 5v = 36 - 11. What is the smallest common multiple of 6 and j? 30 Calculate the least common multiple of (14/6)/(2/12) and 7. 14 Let k = 218 - 71. Calculate the common denominator of -139/18 and k/90 + (-4)/(-6). 90 Let o = -34/1485 + 4085303/2970. Let z = o + -1347. What is the common denominator of 93/10 and z? 10 Let y(x) = -x*2 - 8x + 2. Let q(t) = -t - 8. Let o be q(0). Calculate the least common multiple of 7 and y(o). 14 Let b = 21 - 1. Let q(l) = 10l - 5l + 2l. Calculate the lowest common multiple of q(2) and b. 140 Let l(h) = -2h - 18. Calculate the least common multiple of 6 and l(-13). 24 Let v(i) = -i*2 - 6i + 8. Let s be v(-7). What is the common denominator of -5 - -2(-453)/(-132) and 183/66 + s + -1? 22 Calculate the common denominator of -149/48 and 11/(4 - 16)-125. 48 Let c(o) = o3 - 2o*2 - 4o + 3. Let m be c(3). Suppose 3k - 48 = -mk. Suppose -p - k = -5p. Calculate the smallest common multiple of p and 10. 20 Suppose 0x - x = 0, 3o + 3x + 3 = 0. What is the lowest common multiple of o - 63/(-3) - 0 and 22? 220 Let s = -13595/8 - -1687. Find the common denominator of s and ((-68)/(-30))/(8/12 + -2). 40 Let y(a) = 1 + 2 - a - 1. What is the smallest common multiple of 4 and y(-5)? 28 Calculate the smallest common multiple of (-5 + -18 + 5)/(-1) and 8. 72 Let j = 1 + -5. Find the common denominator of (-2270)/105 + j/(-14) and 55/4. 12 Let c = 124 - 97. Calculate the smallest common multiple of c and 6. 54 Let s be (-3)/(2 + (-39)/18). Suppose 5p = 2l - 13, -6l + s = -l + 2p. Calculate the common denominator of -97/4 and (3/l)/(12/(-88)). 4 Let f = 40819/65 - 628. What is the common denominator of f and -49/9? 585 Suppose -3795 + 827 = -4z. Calculate the common denominator of 109/6 and z/80 + 6/(-15). 24 Let r be ((-20)/(-6))/((-5)/(-30)). Let z = 16937/14 - 1209. What is the common denominator of (-66)/r - 2/(-10) and z? 70 Calculate the lowest common multiple of ((-20)/25)/((-1)/10) and 1. 8 Suppose y = -0y + 3b + 15, -5b - 17 = y. What is the least common multiple of 2 and y? 6 Let q = 2333 + -20974/9. Find the common denominator of q and -70/3. 9 Suppose -5o = 3j - 50, 0 = -j - 0o - 5o. Suppose h + 0h = 5, 0 = -4z - h + j. Suppose z = w - 3. Calculate the smallest common multiple of 20 and w. 40 Suppose 2i - 15 = -3i. Let x be 0/2 + 0 - i. Find the common denominator of 51/10 and (-205)/45 - 1/x. 90 Suppose 0x - 5x - 3n = -50, x + 5n - 10 = 0. What is the smallest common multiple of (4 - (-1 - 2)) + -2 and x? 10 Suppose 0 = -0h - h + 71. What is the common denominator of (h/4)/(27/36) and -17/6? 6 Suppose 2y - 4x + 2x = 6, -3y - 5x = -1. Let k = -1781/3 - -1201/2. Find the common denominator of 5/(y3/(-11)) and k. 6 Suppose 0 = 2c + c + 24. Let h = -3929/180 + 187/9. Calculate the common denominator of (138/16)/(2/c) and h. 20 What is the smallest common multiple of 10 and (-28)/(18/(-4) - -4)? 280 Let o = -505/9749 + -8707855/13512114. Let a = o - 22/63. Calculate the common denominator of a and 145/12. 132 Let h be ((-4)/(-6))/(2/15). Let f(z) = 10z - 41. Let y be f(8). Suppose 9 = 4b + 3r - 26, y = hb - r. Calculate the smallest common multiple of 8 and b. 8 Suppose 3q - 15 = 3s, 3s = -5q - 0s + 33. Calculate the least common multiple of 3/(3/(-2)) + 3 and q. 6 Let j = -17 + 27. Calculate the smallest common multiple of 12 and j. 60 Let l(b) = -b3 - 5b*2 + 5b - 4. Let a(n) = n*2 + 6n + 3. Let z be a(-4). Calculate the smallest common multiple of l(-6) and (2/(-4))/(z/20). 2 Let j = 0 - -3. Suppose 2o + 3o - 49 = -jm, m - 2o = -2. Let a = -5 - -16. Calculate the smallest common multiple of m and a. 88 What is the lowest common multiple of (-1 - (-6)/9)-24 and 8? 8 Find the common denominator of 111/21 + (-6)/(-3) and (81/(-1))/(0 + -10). 70 Suppose -2l + 36 = -6. Calculate the smallest common multiple of l and 3. 21 Let z = -3642 - -21805/6. What is the common denominator of -75/22 and z? 66 Suppose 0 = -2n + 1 - 17. Let o be n + 2(-2)/(-4). Let z(u) = -3u - 3. Calculate the least common multiple of 16 and z(o). 144 Let k(t) = -t2 - 4t + 4. Let q be k(-6). Suppose -h + 2h + 539 = -3p, 0 = h - 2p + 564. Calculate the common denominator of 2/q + h/(-24) and -35. 6 Let n(b) = 33b + 2. Let k be n(5). Suppose -2r + k = x, 6 + 4 = -2x. What is the common denominator of r/(-120) - 3/9 and 81/20? 20 Let p(x) = -14x - 7. Let q(l) = -5l - 2. Let r(u) = -6p(u) + 17q(u). Let h be r(6). What is the common denominator of h - (-2)/((-60)/423) and 53/2? 10 Let z(i) = 2i3 + i2 - 1. Let l be z(1). Suppose -lh - 4 = -4h. Calculate the least common multiple of 6 and h. 6 Suppose -h - 4x - 18 = 0, -3h + 2x = -3 - 13. What is the lowest common multiple of 18 and h? 18 Let q(n) = n*3 + 35n*2 - 44n - 286. Suppose -3 = 4p - 19, -60 = -4y + 3p. Calculate the lowest common multiple of q(-36) and y. 18 What is the common denominator of (-191)/(-48) - (-8)/(-48) and 30/11? 176 Let f = -51268949 - -21533010727/420. Let n = -2726/21 + f. Calculate the common denominator of 1/10 and n. 20 Let y be (14/(-3))/(4/(-6)). Let f = y - -5. Let a = 10 + -6. What is the smallest common multiple of f and a? 12 Suppose 0 = 2m + m - 18. What is the common denominator of -27/10 and ((-4)/m)/(20/(-445))? 30 Let a be (-1)/(-3) + (-10)/(-6). Suppose 0 = ax + 3k - 5k - 26, 4k - 38 = -x. What is the lowest common multiple of 4 and x? 36 Let k = -37 + 57. Find the common denominator of 69/(-10) - (-10)/k and -31/9. 45 Let f = 41227/10 - 4127. Find the common denominator of 11/7 and f. 70 What is the lowest common multiple of 2 and 22 + (-3 + 1 - 2)? 18 Let x(w) = -w - 4. Suppose 18 = 3z + 2n, -2n - 2n = -4*z + 4. What is the smallest common multiple of z and x(-6)? 4 Calculate the common	{ "pile_set_name": "DM Mathematics" }
Differentiate -74j2q - 382j2 with respect to q. -74j*2 Find the third derivative of -12841n*3 - 3n*2 - 200 wrt n. -77046 Find the second derivative of 381w*5 + 2776w wrt w. 7620w3 Find the first derivative of 9407fh2 + 20h*2 - h - 10 wrt f. 9407h*2 Find the third derivative of -254p*6 - 12p*2 - 14. -30480p3 Find the first derivative of a3g2 - 2a*3 + 18a*2 + 9479ag2 + 15 wrt g. 2a*3g + 18958ag What is the derivative of 136l4p*2 - 2l*2p*2 - 3lp + 2p*2 + 11p - 3 wrt l? 544l3p*2 - 4lp2 - 3p Find the third derivative of 2c3r*4 + 411c*3r*3 + 10789c*3r - 8r4 + r2 wrt r. 48c*3r + 2466c3 - 192r Find the second derivative of 24a2z + 2a2 - 39az + 2a wrt a. 48z + 4 What is the second derivative of 113j*4 - 9j*3 - 1185j? 1356j2 - 54j Find the second derivative of -2r4x - 10r2x*3 + 379rx2 - 2rx - 2x*3 wrt r. -24r*2x - 20x3 Find the second derivative of -7185x*3 - 9383x. -43110x What is the third derivative of -1495h*4n + 345h2 + hn + 2n wrt h? -35880hn What is the first derivative of 3g*2r - 2g2 - 78gr4 - 2gr - 357g wrt r? 3g2 - 312gr3 - 2g Find the first derivative of 5h3 - 9h*2 - 54. 15h*2 - 18h What is the third derivative of -821q3 - 1752q*2 wrt q? -4926 Find the third derivative of -94d*4 - 15d*3 - 7566d*2. -2256d - 90 What is the second derivative of -36n2 - 312n wrt n? -72 Find the second derivative of -4b5n + 8b2n + 7b2 - 16bn - 3b + n wrt b. -80b3n + 16n + 14 Find the first derivative of 29b*4c + 2bc + 4c + 101 wrt b. 116b*3c + 2c Differentiate 11tv - 5t + 577v with respect to t. 11v - 5 What is the third derivative of -5199d3r*3 - 103d*3r*2 + 15d*2r*2 - 2dr2 wrt r? -31194d*3 What is the second derivative of 14c*5g*2 + 13c*2g*2 + 4c*2r - cr - 6c + g*2 - 60r wrt c? 280c3g*2 + 26g*2 + 8r What is the third derivative of -825h3wx3 - 5h*2wx3 - 10h*2wx - 7hwx*3 wrt h? -4950wx3 Find the third derivative of m3n*3 + 1496m*3n*2 + 196n*6 + 5n*5 + 2n*2 wrt n. 6m*3 + 23520n*3 + 300n*2 Find the third derivative of -7k*5w + 5k3 - 2k*2 - 43kw wrt k. -420k*2w + 30 Find the second derivative of 1789i2 - 34i wrt i. 3578 What is the second derivative of -844y4 + 546y wrt y? -10128y2 What is the third derivative of 2cp4 + 151cp3 - 801cp + p2 wrt p? 48cp + 906c Find the first derivative of 311dj*2 - 487j*2 wrt d. 311j*2 What is the second derivative of 26651i*3 - 19356i wrt i? 159906i What is the second derivative of 172d5 + d3 - 47d - 10? 3440d*3 + 6d What is the first derivative of 57f4p - fp2 - 30p*2 + 8p wrt f? 228f3p - p*2 What is the second derivative of -37k*2n*2 + 2k*2 - 24kn - n2 - 1 wrt k? -74n*2 + 4 Find the second derivative of 2p*5 + 2p*4 - 518p*2 + 1970p wrt p. 40p3 + 24p*2 - 1036 Find the first derivative of -7ciy + 20cy - 2iy + 103i - 5y wrt c. -7iy + 20y What is the second derivative of 570u*2y*4 + 2u*2y + 2u2 - 23y wrt y? 6840u2y*2 Find the first derivative of 183s + 196. 183 Find the first derivative of 2ow*3 + 5ow - 31oz - w3z - 1 wrt w. 6ow*2 + 5o - 3w2z Differentiate -4k4p - 69k2p*2 + 4p*2 - 2p wrt k. -16k3p - 138kp*2 What is the third derivative of -11q*5 + 3q*3 - 91q*2 wrt q? -660q*2 + 18 Find the third derivative of 284l*6 - 22l*2 wrt l. 34080l*3 What is the third derivative of -14f*3n*2 - 9f*3 - 265f*2n*2 wrt f? -84n2 - 54 Find the second derivative of -l3y2 + 375l*2y*2 - 3ly - 84y*2 wrt l. -6ly2 + 750y*2 What is the first derivative of -5698q - 4312 wrt q? -5698 Find the second derivative of -1908q4 + 163q. -22896q2 Find the second derivative of -55p3 + p2x + 32px + p + 2x wrt p. -330p + 2x What is the third derivative of -28c6 + 109c*3g - 5c2 + 124cg wrt c? -3360c*3 + 654g Find the first derivative of -6b3h*3l + 2bh*3 + 58b + 72h3l - 2l wrt b. -18b*2h*3l + 2h3 + 58 What is the second derivative of -8167d*2m*2 - 5d - 20m2 wrt d? -16334m*2 What is the first derivative of -fp*2 - 1716f + 1457p4 wrt p? -2fp + 5828p*3 Find the second derivative of -2d*2j*3 + 384d*2j*2r*2 - 2djr*2 - 2dj + 34dr2 + j3r wrt d. -4j3 + 768j*2r*2 What is the derivative of -2ad2 + 143ads*2 - as*2 + as + 146a - 2d*2s wrt d? -4ad + 143as*2 - 4ds Find the second derivative of -2b*4i*3 + 366b*2i*3 + 22bi2 - 16i*3 wrt b. -24b*2i*3 + 732i*3 Find the second derivative of -4a*3j*2 + 45a*3j + 13a3 + 4j*5 wrt j. -8a*3 + 80j*3 What is the second derivative of 15k*2q*2 + 9k*2 - 16kq2 + kq + 3k + 5q*2 + 28q wrt q? 30k2 - 32k + 10 Find the third derivative of -p*3w3 - p3w2 + p2w*2 + 327w*3 + 724 wrt w. -6p*3 + 1962 What is the second derivative of -7m*2s*3 + 7m*2z*3 - 6m*2z - ms2z*2 - 35ms2 + s3z*3 - 2s*3z wrt m? -14s3 + 14z*3 - 12z What is the third derivative of -30w4 - w3 + 181w*2? -720w - 6 Find the second derivative of 4i2q3 - i2qv*2 - 20i*2qv + 398iq3v + 2iqv2 + q3v wrt i. 8q3 - 2qv2 - 40qv What is the third derivative of 2922l*3 - 300l*2? 17532 What is the third derivative of -143lz3 + 4l - 32z2 wrt z? -858l What is the third derivative of -30r5s + 92r4s2 + r2s2 - 9s*2 - 176s wrt r? -1800r2s + 2208rs*2 What is the second derivative of 1697v*2 - 14060v wrt v? 3394 What is the third derivative of 9a2b*3 - 136a*2b2 - a2 + 8b3 wrt b? 54a*2 + 48 Find the third derivative of -30ct3 + 7ct2 + 16c wrt t. -180c Differentiate -l4 - 679l*3 + 2l*2 - 14908 wrt l. -4l*3 - 2037l*2 + 4l Find the second derivative of -516q4 + 200q. -6192q2 Find the second derivative of -42c*5u*3 - 5c*5 + 134cu3 - 3cu2 wrt c. -840c*3u*3 - 100c*3 What is the third derivative of -1328i*3q*3 + 425i*2 - 7iq3 wrt i? -7968q*3 What is the second derivative of 5qr2y - 2qry - 12qr + q - 6r*4y - 13r2y - 40y wrt r? 10qy - 72r*2y - 26y What is the third derivative of -5851j5 - j2 + 13281j? -351060j*2 Find the second derivative of -109z*3 - 10z*2 - 12z + 50 wrt z. -654z - 20 Find the first derivative of -397m*3q + 217m3 wrt q. -397m*3 Differentiate -2v*4 + 166v*2 + 400 with respect to v. -8v*3 + 332v Differentiate h*3n*2 - 9948h*3 - 3142hn2 with respect to n. 2h*3n - 6284hn What is the derivative of -d*3 + d + 296? -3d*2 + 1 Find the first derivative of 1046lv + v - 149 wrt l. 1046v What is the third derivative of -3792y4 - 16y*2 + 20y wrt y? -91008y What is the second derivative of -2o*3 + 82o*2 + 391o? -12o + 164 What is the second derivative of -978y*4 + 15y - 1? -11736y2 Find the first derivative of 126a*4 - 161 wrt a. 504a*3 What is the second derivative of 18656v*4 - 31176v? 223872v2 Find the third derivative of -13q*4 + 46q*3 - 81q*2 - 5 wrt q. -312q + 276 What is the second derivative of 3x4 - 384x*2 + 19x - 8? 36x2 - 768 What is the third derivative of 160b*4z + 2b3z - 810b2z wrt b? 3840bz + 12z Find the third derivative of -110o4 - o3 + 844o2 wrt o. -2640o - 6 Differentiate q*2 + 64qz3 + 2z*3 + 7z*2 wrt q. 2q + 64z3 What is the derivative of -113r + 239? -113 Differentiate 3573k + 1890. 3573 Find the first derivative of 876l + 1268 wrt l. 876 Find the first derivative of -2l2s - 6lq*2s + 3q2s + 22q2 wrt l. -4ls - 6q*2s What is the third derivative of -745m6 + 5m*5q*2 + 53m*2q*2 - 7mq2 wrt m? -89400m*3 + 300m*2q*2 Differentiate 144l + 328 wrt l. 144 Find the second derivative of 253bc*4 + 2bc3 - b + 8c + 55 wrt c. 3036bc*2 + 12bc Find the third derivative of 3w*6 - 13w*5 + 315w*2 - 2w -	{ "pile_set_name": "DM Mathematics" }
= -0k + k. Suppose -2m + 2s + 0s - 8 = 0, -m - 4s + 21 = k. Solve -m = 3t + 8 for t. -3 Let a be 22 + 12/(-12). Let w(g) = g2 - g - 1. Let x be w(a). Solve y = xy for y. 0 Let o(a) = -a*2 + a. Let y be o(2). Let d be y/(-7) - 594/(-77). Suppose d - 1 = p. Solve 2s + p = 1 for s. -3 Let t be (-30)/3591/(-26). Solve -11f + 3 = t for f. 0 Let u(k) be the second derivative of -k*4/12 - 4k3/3 + k2 + 15k. Let x be u(-8). Solve -3r + 1 = -xr for r. 1 Suppose 0 = 77t - 71t - 54. Solve -8a = -ta + 4 for a. 4 Suppose 0a = 5a - 2d - 28, 4a - 32 = 4d. Suppose -z = 4v + 4, av + 17 + 11 = -3z. Let c be (z/10)/(2/(-15)). Solve 0 + c = 3p for p. 3 Let m be -1(-68)/12 - (-2)/6. Solve -mf = -f + 5 for f. -1 Let f = 21 + -18. Suppose 5 = s + f. Suppose s = 6a - 10. Solve -3z + az - 1 = 0 for z. -1 Let t be ((-2)/8)/(-3 - 44/(-16)). Solve 0 = g - t + 6 for g. -5 Suppose -136b = -138b + 8. Solve 64w = 66w + b for w. -2 Suppose 15 = -c + 37. Suppose -cb = -23b + 10. Solve 3n - n = b for n. 5 Let m(j) = -7 + 2j2 - 3j*2 - 15j - j*3 - 8j*2. Let v be m(-7). Solve b + v = -1 for b. -1 Let z be 10 - 10 - 1-3. Let s be z2 + (-13)/13. Solve -sb + 10b = -10 for b. -2 Let q = -365 - -374. Solve qb = 4b for b. 0 Let s = 660 - 658. Solve sh - 3h = -2h for h. 0 Suppose -13 + 42 = v + 5r, -2v + 23 = 3r. Solve -vb = -b + 6 for b. -2 Let a(q) = q*2 + 4q + 1. Let r be a(-3). Let f = 5 + r. Let x = -57 + 62. Solve fy = xy for y. 0 Suppose 262 = 5r - 2t, 5t - 74 = 228r - 229r. Solve 0 = -7y + r - 61 for y. -1 Suppose -3p - p = -80. Let j = -81 - -84. Solve -b - jb + p = 0 for b. 5 Suppose -8 = -n - 3c, 0 = -3n + 2n + 2c + 3. Suppose na = -3i - 11, -2i = 2a - 1 + 3. Solve -4s = -is - 1 for s. 1 Suppose 5g - 49 = -2s - 63, 5g = -20. Solve -60f = -57f - s for f. 1 Let b = 30 - 20. Suppose -y - 7 = -b. Solve yk = 2k - 5 for k. -5 Let m(h) = 2h*2 - 12h + 8. Let y be m(6). Suppose -2v = 4a + 10, a - y = 5v - 27. Solve -vl = -2l - 3 for l. 3 Let d = -8 - -5. Let x be 58/(-6)d - 4. Let l = x + -25. Solve -1 = -y - ly for y. 1 Let d = 4 + -1. Let z(q) = q2 - 1 - 3 + 8 - 3. Let y be z(0). Solve i + d = y for i. -2 Let n(f) = f2 + 11f - 25. Let p be n(-13). Suppose 3s - 10 + p = 0. Solve -sc - 2 = -5 for c. 1 Let h(j) = 0j2 - 8j - 2 + 0 + 6 - 9j2 - j3. Suppose -3 - 37 = 5s. Let p be h(s). Solve 0 = -2g + p + 4 for g. 4 Suppose 4p - 22 = -3q, -q + 10 = -4p - 8. Suppose 3r - 32 = q. Suppose -4m = -2l - r, -m + 2l = -6m + 4. Solve -mt = -7t for t. 0 Let o(z) be the third derivative of z5/30 + z4/24 - 2z*3/3 - 2z*2. Let u be o(-3). Suppose u = c - 5. Solve 0 - c = -4f for f. 4 Let i = 3 + 15. Suppose -4p + i = -2. Let s be 10/p - 12. Solve -l - l = s for l. 0 Let l be 1 + -1 + 0 - 2. Let j be (-27)/9 - 2l. Let a = -24 - -24. Solve w = j - a for w. 1 Let u = 101 + -88. Solve -19 = 3s - u for s. -2 Let s be (5/2 + 1)-14. Suppose 16a = 10a - 156. Let d = a - s. Solve -d = -5p - 8 for p. 3 Let k(d) = -d + 4. Let r be k(4). Suppose 0z = -6z + 6. Suppose r = -2o + o + z. Solve -a + 2 = -o for a. 3 Let n(i) = -i3 + 6i*2 - 8i + 4. Let d be n(4). Suppose -dz + 0z - 3m = 12, 0 = z + m + 4. Solve w - 5w - 4 = z for w. -1 Let t be 1/(2/(-8))-1. Suppose a - 5 + 3 = 0. Suppose 4 = 142g - 140g. Solve a = gk - t for k. 3 Let n(a) = a*2 - 7a + 5. Let w be n(7). Let u be 1 + 43 - (7 - 4). Suppose -wt - u = -3y, 3t - 9 = y - 4y. Solve -yk = -2k + 10 for k. -2 Suppose 3u - 10 = -0u - 4j, -2u + j + 25 = 0. Solve 0 = v - uv - 36 for v. -4 Let u = -221 + 227. Solve 23 + 1 = ub for b. 4 Suppose -3z + 6 = -0z. Suppose -zb = 5s - 5 + 29, -4s = b + 18. Let m be 30/20s/(-3). Solve -5r = -3 - m for r. 1 Let b(r) = -7r - 1. Let v be b(-1). Let c(a) = a - 4. Let z be c(v). Let j(f) = f*2 + 21f - 349. Let p be j(11). Solve z = -pq - 1 for q. -1 Suppose -v - 6 = -11. Let m be ((-48)/(-10))/(10/25). Solve m = vl - l for l. 3 Suppose 5a - 3n = -177, 20 = 3n + 2n. Let t = -27 - a. Solve -3j + 6j = -t for j. -2 Let o = -55 + 64. Solve oj + 9 = 6j for j. -3 Let y(d) = d*3 - 30d*2 - 3d + 124. Let f be y(30). Solve -37s - 3 = -fs for s. -1 Let r be 17 + (-11 - (-6 - 8)). Solve 0 = -5d - 0d + r for d. 4 Suppose 27d - 11d - 32 = 0. Let v be 0 + 1 - (-1 + 2). Suppose v + 6 = dm. Solve t = mt + 8 for t. -4 Suppose 54 = -472o + 481o. Solve o = -k + 2 for k. -4 Suppose -4l - 5l = 2l. Solve lu - u = -4u for u. 0 Let j be 12(-2)/((-4)/5). Let c = 21 - j. Let y(k) = -k - 7. Let n be y(c). Solve 0 = b - n - 3 for b. 5 Let g(s) = 14s + 13. Let k be g(4). Let p = 74 - k. Solve 4x - px - 4 = 0 for x. -4 Let g be 21/(-4)0. Suppose -2u + 3i + 23 = -gu, 0 = 5u - 3i - 35. Solve -us - 8 = -8s for s. 2 Let l(q) = q*3 - 3q*2 - q - 3. Let i be l(4). Solve 4r = -i + 5 for r. -1 Let j = -9 - -11. Let k = j + 0. Suppose 6w - 64 = kw. Solve 4l = -0l + w for l. 4 Suppose 5b = 3x + 71, -2b + 0b - 60 = 4x. Let i = -17 - x. Suppose 3o - 3q - 3 = i, o + q = 3o - 1. Solve -2d - d + 15 = o for d. 5 Let c = -3 - -7. Suppose -ck - 2q + 20 = -28, -30 = -5k + 5q. Solve 3m - k = -1 for m. 3 Let d(j) = j*3 + 6j*2 - 7j + 9. Let k be d(-7). Let f be ((-12)/2)/(k/(-42)). Suppose -3m - f = -5n, 24 = 4n + 5m - 28. Solve -b - n = b for b. -4 Let x(y) = -19y - 124. Let z(d) = -6d - 41. Let q(i) = 2x(i) - 7z(i). Let j be q(-9). Solve -8 = -t + jt for t. -4 Let c be 3 + ((-61)/(-3) - 3). Solve -c - 3 = -k for k. 5 Let n = 214 + -214. Solve 9a - 12 - 15 = n for a. 3 Suppose 0 = 4k - 3g + 6, -3g + 5g = 2k + 4. Suppose -9t + 112 = -50. Suppose 0v + tv - 36 = 0. Solve k = 3s - v - 1 for s. 1 Suppose -6v = -2 - 22. Let o be (6/(-4))/(3/v-1). Solve -c = oc for c. 0 Let o = -6 - -9. Suppose 16 = -2z + 6z. Suppose 20 = -2a - 5i, zi + 0i + 16 = -5a. Solve a = -w + ow + 8 for w. -4 Suppose 0 = -22h + 14h + 24. Let l be (-25)/(-15) - 2/(-6). Solve 0 = -ld - hd + 5 for d. 1 Let s be ((-3)/2 - 0)-2. Suppose -4x = -13x - 22x + 868. Solve -x = -sg - 13 for g. 5 Let d be 3/(-2)4/(-3). Let u be (-9)/d(-8)/6. Suppose 2k - 3a = -k - u, -5a = -10. Solve kc = c for c. 0 Suppose 0 = 5d + 5, -84 = -5q - 5d + 81. Suppose -8 = 4n, -3h + 4n - 191 + q = 0. Let y be h/(-20) - (-3)/(-4). Solve 8 = -4o + yo for o. -4 Suppose 3f - 5f = -44. Suppose 3r - r - f = 0. Let w(t) = t3 - 11t*2 + t - 5. Let l be w(r). Solve -v = -lv for v. 0 Let i be (0/42)/(12). Solve -14 = -14z - iz for z. 1 Suppose 14 = -9c + 16c. Solve -10 = -4f - c for f. 2 Suppose 2f = -h - 5, 3f - h = f + 5. Solve -5y + fy + 25 = 0 for y. 5 Suppose 0 = 4h + 32 + 4. Let n = h + 12. Suppose n = -p + 5. Solve ps - 2 = 3s for s. -2 Let s be (-9)/12 - 23/(-4). Suppose -2q + sj = 45, 0q + 4j - 30 = q. Let f be 25/q28/(-10). Solve fp - 3p = -12 for p. -3 Let i be 1/7 - (-15664)/308. Solve -il - 21 = -58l for l. 3 Let t(k) = 3k3 - 19k*2 + 8k - 9. Let v be t(6). Solve 7 = -2i - v for i. -5 Let j(x) = 3x*2 + 11x - 5. Let n be j(-4). Let r(w) be the first derivative of -w*2/2 + w + 1. Let y be r(n). Solve 2h = -yh for h. 0 Suppose 27 = q + 3q + u, -u - 1 = 0. Suppose 2c = qc. Solve 4 = -f - cf for f. -4 Let o(a) = a3 - 10a*2 + 2a - 19. Let t be o(10). Let g be t/242/3. Solve -3m - g = -1 for m. -2 Suppose z = 3z - 5w - 13, 5 = z - 4w. Solve -c = 2c + z for c. -3 Let d be (-6)/(-2)(120/36 - 3). Solve 2 = v + d for v. 1 Let z(h) be the second derivative of -h4/12 - 11h*3/6 + h. Let b be z(-14). Let i be ((-56)/b)/(2/3). Solve -3d = -id - 4 for d. 4 Let l = 75 + -60. Solve 85h = 80h + l for h. 3 Suppose 8n = -303 + 1271. Solve -nm + 118m = 12 for m. -4 Let y(i) = 41i - 243. Let q be y(6). Solve -5h = q + 12 for h. -3 Let v = 326 - 324. Suppose 3m - 6m + 6 = 0. Solve mn = -6 + v for n. -2 Let i(n) = n2 + 25n + 128. Let c be i(-18). Solve -2a = -c + 6 for a. -2 Suppose 0 = 4i + 7i. Suppose -3j - 5v - 5 = i, 5j - 4v = -2 + 6. Solve jz - z - 2 = 0 for z. -2 Let t(y) = 3y - 3. Let n be t(3). Suppose -i - 5 - 4 = -h, 3i = n. Let v = 16 - h. Solve 3 + v = -2*f for f. -	{ "pile_set_name": "DM Mathematics" }
+ lc and give i. -18 Express (3 + 2 - 2)(3 - 5 + 1)(-1 + 1 + g + (-g + 2g - 3g)(-3 + 0 + 2) - 2g - 4g + 5g - 4g - g + 2g)(4g - 3g + 7g) as qg*2 + og + k and give q. 24 Express (-3b + 4b - 2b)(b - 20 + 22 + b - 3b3) in the form w + lb*3 + kb + zb2 + ab*4 and give a. 3 Express 2q + 2q - 2q - 2q3 + 8q*4 in the form y + dq + rq4 + oq*2 + pq*3 and give p. -2 Rearrange (-7 + 15k + 7)(-5 + 5 - 1)(2 + 2 - 2 + (0 - 3 + 0)(0 - 3 + 1)) to m + gk and give g. -120 Rearrange -111h2 + 132h*2 - 3h + 3h to d + rh*2 + yh and give r. 21 Rearrange 2784q - 121q*2 - 2784q to nq + yq*2 + z and give y. -121 Rearrange (-49h*2 + 49h2 + h3)(4h - 3h + 0h) + h*4 + 2h*4 - 5h*4 to the form rh*2 + k + nh*3 + vh + zh4 and give z. -1 Rearrange 6s + s*2 - 5s + 2s2 - 4s*2 - 4 to the form is*2 + l + fs and give l. -4 Rearrange (0t + 2t - 3t)(6t + 1 - 1) + (-t2 - 4t*2 + 6t*2)(-1 - 2 + 2) - t*2 - 1 + 1 to ht*2 + zt + g and give g. 0 Rearrange 0d + 2d - 11d - 4d to sd + h and give h. 0 Express (4 + 2 - 4)(-1 + 5 - 3)(-3d*3 + 9d*3 - 5d + 3d) in the form pd*2 + ld*3 + hd + b and give h. -4 Express -424t + 215t - 17 + 210t in the form a + kt and give k. 1 Express (-2u + 2 - 3 - 1)(-1 - 2 + 1 - 2 + 5 - 2 + 5 - 2 - 1 + (1 - 1 - 2)(-3 + 0 + 1) - 2 + 2 + 2 + 2 + 3 - 4) as pu + x and give p. -16 Rearrange -81 - 3y2 + 76 + 5y*2 to the form dy + cy2 + g and give c. 2 Express 0d*2 + 6d3 - d2 + 4 - 4 as yd3 + td*2 + id + j and give y. 6 Express 7w + 4w + 2w in the form rw + q and give r. 13 Express 2o3 + 55o - 4o2 + 3o*4 - 2 - 54o + 4o2 in the form p + mo*4 + do*2 + wo*3 + yo and give m. 3 Express 0n2 + 4n*2 + 2n*2 + (n - n + 2n)(-2n + n - n + 1) as ln + yn*2 + r and give y. 2 Rearrange -33n + 1 + 31n + 2 + (5n - 6n + 2n)(-4 + 2 + 3) - 4n - n + 3n to the form m + pn and give m. 3 Express (-1 + 3 - 3)(2c - 3c + 0c)(-10c - 4c2 + 10c) as hc + u + bc*3 + pc*2 and give b. -4 Express (1 + 1 - 4)(0 + 0 + t) - 4 - 2t + 4 + (-15 - 4t + 15)(-2 + 3 - 4) in the form m + dt and give d. 8 Express 2n2 + 72 - 4n*2 - 71 as fn*2 + h + pn and give f. -2 Express (-1 + 6h + 2h*2 - 6h)(-3 - 2 + 4) in the form oh + fh2 + u and give f. -2 Express 20 + 9z*2 - 8 - 11 in the form bz + kz2 + m and give b. 0 Express 0d*3 - 2d*3 + 5d + d + (-d + d - 2d2)(-2d + d - d) as wd*2 + v + md + pd3 and give m. 6 Express (-2y*2 + 0y + 0y)(-33 + 80 + 5y - 42) in the form xy*2 + qy + vy3 + h and give x. -10 Express 8z*2 + 35z - 35z as fz + b + wz2 and give w. 8 Express -31y + 14y - 5y*2 + 19y in the form j + hy2 + by and give h. -5 Express -5 + 1 - i*2 + 1 + 1 as vi*2 + l + oi and give v. -1 Express (-6 - 1 + 4)(15o*2 + 13 - 13) in the form ao + n + to2 and give t. -45 Rearrange 10288c*2 + 1 - 10283c*2 + c + 1 to the form p + zc + ic2 and give z. 1 Rearrange (3g*3 + 2g*3 - 2g*3)(g - 2 - 2g - 2g) to sg4 + mg*2 + p + zg*3 + ug and give s. -9 Express 791f + 142f*2 - 791f in the form if + hf*2 + x and give h. 142 Express 3v*2 + 2v*3 - 162 + 81 - 3v + 82 as dv3 + qv + jv2 + u and give q. -3 Express (2 - 2 - 1)(4n - 5n + 0n) - 2n + n - n + 3n + 2n + 0n in the form i + un and give u. 4 Express -15p2 + 15p*2 - p - 5p*3 as tp + up3 + sp*2 + b and give t. -1 Express (3q - 2q + q)(2q2 + q + 0q - 3q2) - 7q*3 - 13q*3 - 23q*3 in the form f + nq*3 + tq + yq2 and give n. -45 Express 2w*3 - 4w3 - w3 + 4w - 4w + 2w3 + (-2w - 4w + 4w)(-w2 - 2 + 2) as cw*3 + d + sw*2 + qw and give c. 1 Rearrange -9s3 + 11s*3 + 17s - 19s - 9 to qs*3 + f + cs*2 + gs and give q. 2 Rearrange -2s2 - 3s - 2s + 2 + 0s*2 to l + as + hs2 and give a. -5 Express 3 - 3 + q + (2q - 2q + 2q)(0 - 3 + 6) + 1 - 1 + q + (q - 2q + 2q)(4 + 3 - 5) + 0q + 3q + 2q as p + gq and give g. 15 Rearrange (-2l + 2l - l)(3l + l - 2l) + 3l*2 - 3l*2 - 2l*2 + (8l - 6l + 5l)(-3l - l + 6l) to the form hl*2 + d + ul and give d. 0 Express (2q + 3q - 6q + (1 - 1 - 2q)(-5 + 4 - 2))(0 - 1 + 0) as oq + y and give o. -5 Express (4k + 0k - 2 + 1)(-4k3 + 53k*3 - 10k*3) as uk*4 + dk + r + jk3 + ak*2 and give j. -39 Rearrange -7c + 5c - 6c + 5 - 2c to the form xc + i and give i. 5 Rearrange 63d2 - 236d*2 - 35d + 35d to the form bd*2 + z + td and give b. -173 Express (-6p + p2 - p - 2p*2)(5p2 + 0 + 0) as o + xp*3 + fp*4 + up*2 + np and give f. -5 Express (-10d + 10d - 14d3)(0 - 2 + 3) + (-d*2 + 4d*2 - 2d*2)(0d + 0d + d) as vd3 + gd + pd2 + l and give v. -13 Express -2l*3 - 8 + 2l - 2l + l + 2l*2 - 2l as tl2 + r + al*3 + ol and give a. -2 Express 5j3 + 3j*2 - 6j2 + j4 - 8j + 2j + 2j2 in the form mj*2 + pj*4 + tj*3 + xj + h and give x. -6 Express (0k + k - 2k)(0k3 - k3 - 6k3) in the form ck*4 + f + bk + jk3 + xk*2 and give c. 7 Express (67i + 37i + 179i)(-i - 3i + 6i) in the form s + wi + ri2 and give r. 566 Express (-3 + 3o + 3)(-1 - 4 + 3) + (-2 + 3 + 1)(-3o + 4o - 2o) as m + wo and give w. -8 Express -26z - 8z - 2 + 18z + (-3 + 3 - 1)(-1 + z + 1) as nz + v and give v. -2 Rearrange -9r + 7r - 14r to the form wr + x and give w. -16 Rearrange 16y*2 + 7y*2 - 21y*2 - 26y to xy + r + hy*2 and give h. 2 Express 3x*2 - x + 2x + 2x - 4x*2 as cx*2 + sx + u and give c. -1 Express (-4s + s + s)(6 - 3 - 1 + (-1 - 2 + 1)(-4 + 0 + 3))(-51 + 35 - 35) in the form y + os and give o. 408 Rearrange -4 + 1 - 2j3 - j4 + 0 - 2j2 to the form u + fj*2 + oj + lj4 + yj*3 and give y. -2 Rearrange (-1 + 1 + 4v)(-50 - 10 + 16) to z + qv and give q. -176 Express 1 + 2g2 - 2g*2 - 18g3 + g2 + 0g2 as ng*2 + sg + rg3 + f and give f. 1 Express r3 + 0r*2 + 5r - 2r2 - 3 + 0r*2 - 2r in the form gr3 + or*2 + l + jr and give o. -2 Rearrange 11n + 2n + 39n to f + ln and give l. 52 Rearrange 35w2 + 3 + 0 - 5 - 12w*2 to q + gw*2 + mw and give q. -2 Rearrange (-a - a + a)(-2 + 2 - 1) - 5 - 15a - 11a + 23a to the form w + ja and give j. -2 Express -2a*3 + 13a*2 + 2a + 5a + 1 - 15a*2 as ya*2 + ga*3 + ca + z and give z. 1 Rearrange (2 - 4 + 0 + 4f)(-4 + 5 - 9) to w + nf and give w. 16 Express -9x + x*3 - 2x*2 - 9x + 20x in the form sx + kx3 + d + px*2 and give p. -2 Express (-1 + 2 + 0)(-t + t - 3t3) as p + qt + mt3 + yt*2 and give m. -3 Rearrange -4j + j*3 + 15j - 2 + 9j2 - 10j to w + vj2 + qj*3 + bj and give w. -2 Rearrange (-5b + 3b + 0b + 2b + 2 - 2 + (0 + 0 + 1)(-3b + 2b + 3b))(2 - 2 - 1)(-1 + 3 - 1)(9b - 2b + b) to xb*2 + gb + y and give x. -16 Rearrange u*3 - 5u*3 + 3u*3 + (3u + 3u + 5u)(u2 - 6u*2 + 2u*2) to bu*2 + q + zu*3 + yu and give z. -34 Express (0 - v + 0)(v2 + v2 - 4v*2) + 40v*2 - 40v*2 - 24v*3 in the form rv*3 + bv*2 + i + tv and give r. -22 Express (6 - 3 + 1)(-4 - 5 - 6)(2p4 + p4 - 5p*4) in the form h + op + ap4 + vp*3 + qp*2 and give v. 0 Rearrange (-2i*3 + 3i - 3i)(0 - 5 + 2) - 1 - 2i3 + 1 to c + yi*3 + fi*2 + hi and give y. 4 Rearrange 2 - b*2 - 2 + (-364 + 6b + 364)(-3b + 3b - b) + (3b - b - b)(2b - b + 0b) to kb*2 + a + ib and give k. -6 Rearrange 8 + 10 + 5b - 15 + (2 + 0 + 6)(4b - 5b + 3b) to the form ub + q and give q. 3 Rearrange (-r + 5 - 1 - r*2 + 0r*2)(-3r + 0r + r) to yr2 + nr*3 + pr + d and give n. 2 Rearrange (-m + 2m - 2m)(7 + 1 + 3)(4 - m - 4)(-2 + 1 - 1)(-3 + 0 + 1) to the form um + dm*2 + x and give d. 44 Express -110f + 2 - 9f2 + 110f - f*3 as jf*3 + af + c + pf2 and give c. 2 Rearrange 4l*2 + 2l - l*3 + 5 - 3l*2 - 11 to ol*3 + fl*2 + rl + x and give r. 2 Express 93 - 93 + 2x + 4x in the form cx + h and give c. 6 Express (3d + 0d - d + (4 - 1 - 5)(-6d + 5d + 4d) - 6d + 4d + 4d)(-3 + d*2 + 3) in	{ "pile_set_name": "DM Mathematics" }
5n - 2l - 17 = 6, -25 = -3n + 4l. Let b be x(n). What is the remainder when b + 51 - -3 - -2 is divided by 14? 12 Let c be -8((-10)/8 + 2). Let o(p) = p + 6. Let b be o(c). Suppose -m - 2q + 21 = b, 3q = 4m - 24 - 5. What is the remainder when m is divided by 6? 5 Let h = 1 - 1. Suppose -4v + v + 84 = h. Let r = v + -19. What is the remainder when 26 is divided by r? 8 Suppose -2i = -3s + 3i + 233, 2s = -3i + 130. Suppose n - s = -k, 7n - 25 = 2n. Calculate the remainder when k is divided by 17. 15 Let i(u) = -u - 9. Let d be i(0). Let w be -10(-2 + d/(-6)). Let y = 10 + w. What is the remainder when 28 is divided by y? 13 Suppose 4s = 20 + 28. Suppose -5l + l + s = 0. Suppose -57 = -lh - 0h. Calculate the remainder when 55 is divided by h. 17 Calculate the remainder when 24 is divided by (-1 - (-7 - -2)) + 3. 3 Let a(g) = -2g + 2. Let m be ((-5)/(-2))/((-5)/10). Calculate the remainder when 23 is divided by a(m). 11 Suppose 9b + 56 = l + 5b, 3l - 5b = 147. Calculate the remainder when l is divided by 16. 12 Suppose -14g + 9g + 15 = 0. Calculate the remainder when 0 - (-2 - -4 - 8) is divided by g. 0 Suppose 0 = -u - 2u + 36. Calculate the remainder when u is divided by 4. 0 Suppose -3j - 3 = -3a, -17 = a + j + 4j. Calculate the remainder when a/7 + (-1408)/(-28) is divided by 17. 16 Suppose -2r + 50 = 3l, -2l + 3r = r - 30. Calculate the remainder when 75 is divided by l. 11 Suppose 2o - o + 5c + 3 = 0, 5o + 2c - 8 = 0. Suppose 7z = oz + 170. Calculate the remainder when z is divided by 9. 7 Suppose -20 = -0j - 4j. Calculate the remainder when 18 is divided by j. 3 Suppose 5f - 73 = 197. Calculate the remainder when f is divided by 29. 25 Let p(i) = -2i*3 - 3i*2 - 2i - 4. Calculate the remainder when p(-3) is divided by 10. 9 Suppose a = 2 - 3, k + 2a = -22. Let m be 1-13 + (-1 - -1). Let s = m - k. What is the remainder when s is divided by 3? 1 Suppose 81 = 5q - d, d + 52 = 4q - 3d. Let c = -4 + 100. Suppose j = 2o + 2j - c, -2o - 5j + 88 = 0. Calculate the remainder when o is divided by q. 15 Let n(x) = -x2 - 12x - 15. Calculate the remainder when 16 is divided by n(-9). 4 Suppose -5u + 0 - 45 = 0. What is the remainder when 6/u + 280/6 is divided by 16? 14 Calculate the remainder when 30/((-1)/(-2)4) is divided by 6. 3 Suppose -5g + 47 + 23 = 0. Calculate the remainder when 40 is divided by g. 12 Let l(s) = -s3 - 3s*2 + 4s + 2. Let r be l(-4). Let v = r - -10. Calculate the remainder when 23 is divided by v. 11 Let q(t) = t*2 - 6t + 8. Suppose v - 3v = -14. What is the remainder when v is divided by q(5)? 1 Let n(c) = c2 + 14c + 16. What is the remainder when 5 is divided by n(-13)? 2 Suppose -z = -2 - 14. What is the remainder when z + (2 + 1 - 6) is divided by 4? 1 Let d(h) = h*2 + 12h - 7. Calculate the remainder when d(-13) is divided by 5 - (1 - (2 + -2)). 2 Suppose a = 2a - 1. Suppose -2b + a = -b. Calculate the remainder when 2 is divided by b. 0 Let s = 48 + -3. Suppose 3d + 0l - 2l - 82 = 0, -4d + 81 = 3l. What is the remainder when s is divided by d? 21 Suppose -j - 29 = -5j + 3p, -5p = 5j - 10. Suppose 0 = 2v - v - j. Let m = 7 + -3. What is the remainder when v is divided by m? 1 Let v(y) = -y*3 - 2y*2 + 4y + 2. What is the remainder when 4 is divided by v(0)? 0 Let f(g) = g*2 - 4 + 0g + 3 + 3 - 5g. Let m be f(2). Let b = m - -9. Calculate the remainder when 17 is divided by b. 2 Suppose -5u - w = -55, -3w - 18 - 33 = -3u. Let m = -7 + u. Suppose 2s + 4y - 38 = 0, -2s - s - y = -57. What is the remainder when s is divided by m? 4 Suppose c + 3c - 32 = -4x, x = 5c - 64. Suppose -7v + 20 = -2v. Suppose -37 = -vt + 147. What is the remainder when t is divided by c? 10 Calculate the remainder when 97 is divided by (-6)/21 - (-354)/14. 22 Suppose 2r + 20 = 4r + 4z, 4r - 4 = z. Let g(d) = -1 + d - dr - 2 - 7d. What is the remainder when 8 is divided by g(-4)? 3 Suppose 0 = -5v + v + 40. What is the remainder when v is divided by 2? 0 Let c(g) = -7g - 12. Let w = 2 + 3. Suppose 0 = wl - 11 + 51. Calculate the remainder when c(l) is divided by 15. 14 Suppose -5r + r - 52 = -4t, 0 = -t - 2r + 28. Suppose -t + 120 = 3l. What is the remainder when l is divided by 9? 7 Let k = 142 - 113. Calculate the remainder when 82 is divided by k. 24 Suppose 12p = 11p + 14. What is the remainder when 25 is divided by p? 11 Let a(i) = -i + 18. Let d be (0 + 0)(0 - 1). Let v be -2 - (-1 - 1) - d. Calculate the remainder when 35 is divided by a(v). 17 Suppose 0 = -j + 2r + 6, -2j + r - 2 = -17. Calculate the remainder when 53 is divided by j. 5 Let d(i) = 3i + 5. Let c be (-2 - 1)8/(-6). Suppose -3r + 111 = cy - y, r = y + 41. Calculate the remainder when r is divided by d(5). 19 Suppose 0b - 8b + 536 = 0. What is the remainder when b is divided by 35? 32 Suppose 4u + 19 = 4b - 1, 2b - 10 = -4u. Suppose 0 = 2x + bs - 36, 8 = 3s - s. What is the remainder when 22 is divided by x? 6 Suppose -h - h = -10. Let d(k) = k - 3. What is the remainder when h is divided by d(5)? 1 Suppose -4p + 2 = -26. Let s(v) = 2v3 + 2v. Calculate the remainder when s(2) is divided by p. 6 Suppose -6 = -19k + 17k. Let b = 7 - 5. What is the remainder when k is divided by b? 1 Suppose -2k - 2k - y = -33, 0 = 5k + 3y - 50. Let o(g) = g*3 - 5g*2 + g + 8. What is the remainder when o(5) is divided by k? 6 Suppose b - 4p = -5, -5p + 7 = b - 24. Let q = -8 + b. Calculate the remainder when 5 is divided by q. 2 Suppose -2h + 1 = -3. Let c(j) = -j*3 - 7j*2 - 8j + 3. Let m be c(-6). Suppose 5g - 35 = -v, -hv + 5 = m. What is the remainder when 15 is divided by g? 7 Suppose 6s - 4s = 28. Calculate the remainder when 39 is divided by s. 11 Let k = 138 - 93. What is the remainder when k is divided by 24? 21 Let y(a) = -3 + 5 - 1 - a. Suppose -5k = 33 + 7. Calculate the remainder when 25 is divided by y(k). 7 Let u(b) = 2b - 4b - b + 1 + 2b*2. Let j be u(3). Suppose s + j = 2a, 2a + 3 = -5s + 1. What is the remainder when 7 is divided by a? 3 Suppose 100 = 7u - 75. What is the remainder when 198 is divided by u? 23 Suppose -4i = w - 61, -5i + w = -w - 73. Let m = 0 - -57. What is the remainder when m is divided by i? 12 Let b(q) = q - 1. Let h be b(2). Let d be 0 - 0 - h - -5. What is the remainder when 22 is divided by (d/(-10))/(2/(-60))? 10 Suppose -8i + 9i - 7 = 0. What is the remainder when 39 is divided by i? 4 Let a(p) = -19p + 2. Let w be a(-2). Suppose -3c - 3 = 5m, -4c - 2m + 5 = -5. Calculate the remainder when w/7 + (-4)/(-14) is divided by c. 2 Suppose 3p - 45 = 5k + 36, -66 = 4k - 3p. Let j = 4 - k. Calculate the remainder when (-8)/28 - (-387)/7 is divided by j. 17 Suppose 0 = 7h - 137 + 18. Calculate the remainder when 95 is divided by h. 10 Let t(a) = 4a + a*3 - 3a - 5a2 + 3a*2. Let j be t(2). Suppose -2 + 4 = jm. What is the remainder when 2 is divided by m? 0 Let a = 3 - 3. Suppose 3v - 5 - 13 = a. What is the remainder when v is divided by 4? 2 Let b = -12 - -95. What is the remainder when b is divided by 21? 20 Let k be (-66)/(-10) + 4/10. Let m = k - 6. What is the remainder when m is divided by 1? 0 Suppose 7h - 59 = -3y + 2h, 5y - 61 = h. What is the remainder when 50 is divided by y? 11 Let y = -628 + 928. Suppose -3c = -6c - y. Calculate the remainder when c/(-12) - 2/6 is divided by 3. 2 Let y(q) = q3 + 8q*2 - 11q + 4. What is the remainder when 86 is divided by y(-9)? 20 Let c = -11 + 67. Calculate the remainder when 276 is divided by c. 52 Let z = 3 - -6. Suppose -a - 4a = -70. Calculate the remainder when (-2 - 1)z-1 is divided by a. 13 Let i(s) = -s2 + 8s - 4. Let h be i(7). Suppose -22 = -hy + 2. What is the remainder when y is divided by 3? 2 Suppose 2o - 4o = -4. Suppose -of = -5f. Suppose f = -4q + 66 + 94. Calculate the remainder when q is divided by 14. 12 Let x(s) = s*3 + 13s*2 - 2s + 7. What is the remainder when x(-13) is divided by 12? 9 Suppose 5t - 116 = t. Suppose -g - 54 = -v, 6v - g - 278 = v. What is the remainder when v is divided by t? 27 Suppose -45 = -d + 6d. Let q(h) = -2h*3 - 5h*2 - 3h - 2. Calculate th	{ "pile_set_name": "DM Mathematics" }
234 What is the derivative of -31n - 25 - 148 + 11140n*2 - 11154n*2 + 8 + 12 wrt n? -28n - 31 Let r(t) = -2t2 + t + 1. Let g(v) = -2057v*3 - 6v*2 - 271v + 9. Let l(o) = -g(o) + 3r(o). What is the second derivative of l(d) wrt d? 12342d Let v(x) = 91. Let g(i) = 5198i + 2454. Let z(a) = -g(a) - v(a). What is the first derivative of z(p) wrt p? -5198 Let o = 179 - 93. What is the third derivative of -42q*2 + oq*2 - 12q*2 - 5q*3 wrt q? -30 Let y(r) be the third derivative of 0 - 1/6r*3 + 1/8r*4 - 4r*2 + 53/120r*6 + r + 0r*5. What is the second derivative of y(m) wrt m? 318m Let b(f) = -2f + 12. Let s be b(1). What is the second derivative of su*3 - 185u + 133u3 + 35u wrt u? 858u Suppose 3l = 4l - 9. Suppose -lm = -6m - 39. What is the second derivative of 14i - i + mi + i5 - 17i*5 wrt i? -320i*3 What is the second derivative of -1316f*3 - 4008f*3 + f - 4925 + 694f*3 wrt f? -27780f Let d(i) = 30i3 - 200i*2 - 3128i - 7. Let t(c) = -15c3 + 101c*2 + 1564c + 4. Let u(l) = -4d(l) - 7t(l). Find the second derivative of u(h) wrt h. -90h + 186 Let o(j) = 123j3 - j2 + 3j - 1704. Let z(b) = -8b*3 - b - 1. Let c(f) = o(f) + 4z(f). Differentiate c(i) wrt i. 273i2 - 2i - 1 What is the derivative of 981c3 + 50c - 50c + 434c*3 + 695 wrt c? 4245c*2 Let d be (0 + 1)/(2/(-4)) + -444. Let q = d - -983. Find the third derivative of qs*3 + 17s*4 - 20s*2 - 537s*3 wrt s. 408s Let p(a) be the third derivative of 283a8/336 - 4a7/105 - a5/60 - 5a4/12 - 91a*3/3 - 1774a*2. What is the third derivative of p(c) wrt c? 16980c*2 - 192c Let d be 1/(-16)-8 - 228/(-8). Find the second derivative of -9 + 26n*2 - 24n*2 + dn*3 + 3 - 81n + 91n wrt n. 174n + 4 Suppose 0d - 2z = 4d - 622, 0 = -z + 5. Differentiate d + 20 - 2 - 2h + 8h + h wrt h. 7 Suppose 0 = 376j - 372j. Let z(s) be the third derivative of 5s*2 + 0s + 0 - 1/3s5 + 7/3s*3 + js*4. Find the first derivative of z(v) wrt v. -40v Let g = -3934 - -6183. What is the derivative of -2249w2 + 206w*3 + 81 + gw*2 + 106 wrt w? 618w*2 Let c(m) be the third derivative of -1027m*7/210 - 11m5/12 + m4/12 - 44m2. Find the third derivative of c(r) wrt r. -24648r Let r(i) = 12i - 41. Let j(n) = -12n + 98. Let d be j(8). Let h(p) = 59p - 205. Let o(a) = dh(a) - 11r(a). Find the first derivative of o(t) wrt t. -14 What is the second derivative of -32r*3 + 58704r*4 - 4098r - 2r5 - 3359r - 58731r4 - 3877r wrt r? -40r3 - 324r*2 - 192r Let z be (-2)/11 - 8/(-44). Let l be (z + -2)/40. What is the third derivative of lg*3 + 9g - 9g - 9g*3 - 13g*2 wrt g? -54 Differentiate -3438d*3 - 23d*4 + 3438d*3 + 12d*2 - 1185 with respect to d. -92d*3 + 24d Let b(o) = o*2 + o - 2. Let a(w) = -1144w*2 - 8w - 491. Let q(c) = -a(c) - 5b(c). What is the second derivative of q(j) wrt j? 2278 Let j be (-5)/2(-2 - (-20)/25). What is the third derivative of -d*4 - 14d*3 + 8d*3 + 11d*j + 50d*2 wrt d? -24d + 30 Let t(m) be the third derivative of 1/20m5 + 0m - 1/6m3 + 1/10m*6 - 1/4m*4 - 71m*2 + 0. What is the second derivative of t(r) wrt r? 72r + 6 Find the third derivative of -59u + 59u + 4u2 - 6175u*3 + 958 - 1013u3 + 92 wrt u. -43128 Let w(d) be the third derivative of d7/210 + 319d6/60 - 327d*5/20 + 15d*2 - 52. What is the third derivative of w(c) wrt c? 24c + 3828 Let c(b) = -4461b2 + 339b - 2. Let d(l) = 44613l2 - 3384l + 21. Let r(x) = 21c(x) + 2d(x). What is the second derivative of r(a) wrt a? -8910 Let a(b) = b3 + b2 + b + 10. Let t be a(0). Differentiate 2n + 8n - 146n4 - tn - 114 wrt n. -584n3 Let k = 42 - 93. Let h = k + 53. What is the derivative of 4b + 516bh - 4b - 14 - 539b2 wrt b? -46b Let s(q) be the first derivative of -111 - 39/2q2 - 72q. Differentiate s(h) with respect to h. -39 Let f = -158 - -158. What is the second derivative of 79o3 + f + 10o*3 - 8 - 7o wrt o? 534o Let t = -458 - -463. Find the second derivative of -66b - 57b + 19b*t + 52b - 26b wrt b. 380b*3 Let t = 45 - 46. Let y = 14 - t. Find the second derivative of 6f*5 + yf - f - 6f + 6f wrt f. 120f3 Let w(y) = 5y + 89. Let x be w(-13). Find the second derivative of -c*2 + 35c*4 - 5c*3 + xc - 4c3 - 1 - c2 + 9c*3 wrt c. 420c2 - 4 Let u = -541 + 550. What is the derivative of -32 - q - q2 + 0q + uq*2 - 4q + 264 wrt q? 16q - 5 Suppose w + 5t = 78, -t = 4w - 252 + 16. Find the first derivative of 112 + 159p - wp - 65p wrt p. 36 Let p(a) be the second derivative of 136a6/15 - a4/6 - a3 + 161a*2/2 + 4945a. Find the second derivative of p(x) wrt x. 3264x2 - 4 Let w(q) be the second derivative of -286q*7/21 + 1046q*4/3 + 27q - 17. What is the third derivative of w(v) wrt v? -34320v2 Let m(b) be the first derivative of -2415b*6/2 - 27b*2 - 4b - 3842. Find the second derivative of m(t) wrt t. -144900t3 Let p(z) be the first derivative of -89z*6/3 - 5z*4/4 - 458z*3 - 650. What is the third derivative of p(f) wrt f? -10680f*2 - 30 Let j = -323 - -321. Let l(k) = -161k*2 - 8k + 159. Let v(z) = 805z2 + 44z - 795. Let n(h) = jv(h) - 11l(h). Find the first derivative of n(m) wrt m. 322m Let b be (9 + -10)/(1/(-3)). Suppose -br - 72 = -7r. Differentiate -r - 3c*3 + 1 - 2c*3 - 2c*3 with respect to c. -21c*2 Let j(m) = m - 6. Let s be j(9). Let a be -2 + 1 + s + 2. Differentiate -17u*4 + 36 - 45 + 3u*a wrt u. -56u*3 Suppose -37 = -r - 2. Find the third derivative of rh*5 + 16h*2 - 16h*2 + 60h*2 wrt h. 2100h*2 Let c(k) be the second derivative of -697k*6/5 - 1241k*4/4 - 2032k. What is the third derivative of c(s) wrt s? -100368s What is the third derivative of 93l*5 + 980l*2 - 134l*5 + 64l*4 + 42l*5 wrt l? 60l*2 + 1536l Suppose -40 = -c - 2n - 4, 0 = 4n. What is the derivative of 70a2 - c - 2a - 26 - 114a2 - 97a*2 wrt a? -282a - 2 Let a(s) be the first derivative of 486s2 + 267s - 1181. What is the first derivative of a(g) wrt g? 972 Let h(a) = a*2 - 10a - 5. Let c be h(11). Suppose -cl = -21 + 9. Find the third derivative of 5s*2 - 3s*l + 9s*6 + 0s*2 - 23s*6 wrt s. -1680s*3 Find the first derivative of 230p*2 - 1001 - 17p*2 + 5p*2 - 961 - 4p wrt p. 436p - 4 Let v = 19 + -15. Let m be -2 - (-3)/(3/v). Find the second derivative of 6a - 619am + 619a*2 + 10a*5 wrt a. 200a3 Let c(w) be the first derivative of w6/30 - 24w5/5 - 160w*2 + 4w + 173. Let a(i) be the first derivative of c(i). Differentiate a(r) with respect to r. 4r3 - 288r*2 Suppose 0 = -461z + 451z + 40. Find the second derivative of 24t - 77tz - 4t*4 + 108t - 6t wrt t. -972t*2 Let c = 1022 + -328. What is the second derivative of -2h*2 + 49h + 190h + 678h4 - h2 - ch4 wrt h? -192h*2 - 6 Let x(g) be the second derivative of 5g*6/6 - 29g*5/20 - 991g*4/4 + 3912g. What is the third derivative of x(h) wrt h? 600h - 174 Let o(u) be the second derivative of u4/6 + 1247u*3/3 - 2115u*2 - 477u. What is the first derivative of o(h) wrt h? 4h + 2494 What is the second derivative of -391s*3 + 529s*3 + 1239s*3 - 17s + 99s3 + 5 - 20s wrt s? 8856s Let n(d) be the first derivative of -34d5/5 + d3 - 109d + 89. What is the third derivative of n(j) wrt j? -816j Let d(q) be the first derivative of 3q5/20 - 20q*3/3 + 83q + 88. Let t(x) be the first derivative of d(x). What is the second derivative of t(c) wrt c? 18c Let q(b) be the second derivative of -115/12b*4 + 0 + 0b*2 + 20/21b*7 + 0b*5 + 0b*3 - 107b + 0b6. Find the third derivative of q(r) wrt r. 2400r*2 Let y = 14 - 4. Let r be ((-22)/(-55))/(2/y). What is the third derivative of 5o*5 - 4o*2 + 6o*2 + 11o*r wrt o? 300o*2 Let p = -82 - -82. Let t be p - (10/(-4) - -3)0. What is the first derivative of -15 + t - 18 - 12z wrt z? -12 Suppose -25r + 22r + 96 = 0. Suppose -3h = -5i - 20, 0i + i - r = -3h. Find the second derivative of -251z*2 + 239z*2 - hz + 0*z wrt z. -24 Let y = 278 + -239. Differentiate y	{ "pile_set_name": "DM Mathematics" }
+ -162. What is the remainder when n is divided by 7? 4 Let t(l) = -l*2 + 13l + 7. Let d(w) = -4w - 19. Let a be d(-7). Suppose -27 = -k - 2k. Calculate the remainder when t(a) is divided by k. 7 Suppose -4x + 7 = 5z, z = 2z + 1. What is the remainder when (-3 + 3)/4 + 12/((-228)/(-589)) is divided by x? 1 Let k(f) = 6f*2 - 4f2 - 99 + f2 + 5f2 - 6f*2 - 11f. What is the remainder when k(16) is divided by 41? 32 Let b be (217/21)/(6/36). Suppose -5x + 172 = b. Let l(w) = w + 76. What is the remainder when l(0) is divided by x? 10 Calculate the remainder when 285 is divided by (-110)/100 + 4/(-10) - 597/(-6). 89 Let m(y) = -y3 + 12y*2 + 17y + 13. Suppose i + 39 = 4i. Let a be m(i). Let n = 144 - a. What is the remainder when n is divided by 9? 7 Let z(d) = 241d + 1744. Calculate the remainder when 314 is divided by z(-7). 29 Suppose p = -5m - 43 - 62, p - 5m + 85 = 0. Let r = p + 88. Let j(y) = -10y - 26. Calculate the remainder when j(r) is divided by 6. 2 Let y(p) = 5p + 9. Let l = -40 - -45. Let r be y(l). Suppose 0 = -4x + r + 42. What is the remainder when 75 is divided by x? 18 Calculate the remainder when (-1)/(-3) + -11 + (10 - 752/(-12)) is divided by 24. 14 Let p(t) = 37t + 5252. Calculate the remainder when 977 is divided by p(-116). 17 Let d = 137 + -98. Let j = 102 - d. Calculate the remainder when 187 is divided by j. 61 Let f be ((2 - -214) + -1)1. Suppose 43 + f = 6q. Suppose -k - 27 = -q. What is the remainder when 56 is divided by k? 8 Suppose 6b + 187 = 247. Suppose 870 = bg - 4g. What is the remainder when g is divided by 49? 47 Let m = -172 + 339. Let j = 310 - m. What is the remainder when j is divided by 21? 17 Suppose 34w + 45 = 31w. Let a(n) = n2 + 7n - 3. Let z be a(w). Suppose -319 = -2q - z. Calculate the remainder when q is divided by 27. 20 Let w(y) = 6y*2 - 4y + 9. Let c be w(-3). Suppose -j - 61 = -c. What is the remainder when 109 is divided by j? 11 Suppose 0o + 11 = o + 4j, -63 = -4o + 3j. Suppose 55p - 59p + 400 = 0. Suppose -6m + p = -134. Calculate the remainder when m is divided by o. 9 Let n be ((-8)/12)/((-4)/804). Suppose 0 = -7h + 20 + n. Suppose 2c - 161 - 9 = 2p, -3c + 239 = 5p. What is the remainder when c is divided by h? 17 Let b(f) = -f*2 + 7f + 41. Let j be b(-4). What is the remainder when (1/j)/((-7)/1512) is divided by 16? 8 Let u be (-1 - -5)/((-4)/(-8)). Let x(l) = -l*2 + 8l - 3. Let m be x(u). Calculate the remainder when 37 is divided by (-16)/(-24) - 37/m. 11 Suppose -3n - 5z + 9828 = 0, n = -51z + 53z + 3254. What is the remainder when n is divided by 43? 41 Let r = -33 + 91. Suppose 0 = -15u + 487 - 1297. Let c = r + u. Calculate the remainder when 16 is divided by c. 0 Let f = 8420 + -6568. What is the remainder when f is divided by 265? 262 Let i = -2743 + 4129. Suppose 9o - i - 279 = 0. Calculate the remainder when o is divided by 35. 10 Let z = 637 - 594. Let v(y) = -2y3 + 20y*2 + y - 7. Let u be v(10). What is the remainder when z is divided by (23)/u - (-2 - 7)? 10 Suppose -27w + 9w = -108. What is the remainder when 50 is divided by w? 2 Suppose -2v + 4r = 810, -409 = 11v - 10v + 2r. Let h = -402 - v. Suppose 0b = 3b - 129. What is the remainder when b is divided by h? 3 Suppose 4h + 12 = 8h, 4r + 16 = -4h. Calculate the remainder when (3 + r)(-7)/2 is divided by 9. 5 Let b = -6392 + 6650. What is the remainder when 521 is divided by b? 5 Let o = 10 + -8. Suppose 2c = -o + 8. Suppose -3y + 90 = 4p - 6y, cp + 4y = 80. Calculate the remainder when 69 is divided by p. 21 Let r(f) = 1029f - 4078. What is the remainder when 783 is divided by r(4)? 23 Calculate the remainder when (-8)/12(-688 - 9/((-117)/(-26))) is divided by 94. 84 Let m = 177 - 177. What is the remainder when (m + -8 - -16) + 19 is divided by 0 + (-1)/((-2)/20)? 7 Let u = -36 - -1072. Suppose -13q + 27q = -u. Let s = q - -95. What is the remainder when 39 is divided by s? 18 Let m(y) = 2y2 - 21y + 28. Let q be m(10). Suppose -qr + 0r = -1062. What is the remainder when 199 is divided by r? 22 Let i(x) = -42x - 64. Calculate the remainder when 212 is divided by i(-5). 66 Let b = 9386 + -9135. What is the remainder when b is divided by 87? 77 Let t(y) = 6y*2 - y. Let r be t(1). Suppose rc - 133 = -3p, 2c + 2p = -0p + 50. Let a = -19904 + 19956. What is the remainder when a is divided by c? 23 Let h(q) = 163q2 + 29q - 1. Calculate the remainder when h(-2) is divided by 104. 73 Suppose -2f + 2 = 0, 0 = 5d + 447f - 445f - 107. Calculate the remainder when 11190 is divided by d. 18 Let m(x) = x*3 + 13x*2 + 6x + 9. Calculate the remainder when m(-10) is divided by 56. 25 Let j = -16 - -18. What is the remainder when (-153)/(-11) - (-66)/726 is divided by j? 0 Suppose 6 = -4p - 2u, 4u - 8 = -p - 2p. What is the remainder when 149 is divided by ((-4)/6)/((-940)/234 - p)? 32 Let j be -33/((-36)/20). Suppose js - 637 = -4v, v - 597 = -3v + 3s. What is the remainder when v is divided by 31? 29 Let f = 10217 + -10160. What is the remainder when f is divided by -1(18 + -1)-1? 6 Let s = 4 - 1. Let z(a) = -a3 - 5a*2 - 6a + 10. Calculate the remainder when z(-4) is divided by (-72)/(-27) + 1/s. 0 Let u(i) = i*3 + 14i*2 + 15i + 26. Let x be u(-13). Suppose -2v + 161 + 443 = x. What is the remainder when v is divided by 19? 17 Let b(a) = -a3 + 10a*2 - 14a + 15. Suppose -60 = 226l - 238l. Calculate the remainder when 627 is divided by b(l). 67 Let o = -23 - -15. Let w(h) = -11h - 15. Let f(s) = -s2 + 14s - 8. Calculate the remainder when w(o) is divided by f(9). 36 Suppose -3r - 15r = -10r - 880. Calculate the remainder when 431 is divided by r. 101 Suppose -45q = -206 - 1819. Calculate the remainder when 265 is divided by q. 40 Let i(k) = 2k3 - k2 - 4. Suppose 0 = -23j + 85j + 30j - 1564. What is the remainder when i(3) is divided by j? 7 Let x(l) = 2l + 156. What is the remainder when x(7) is divided by 2332/52 + 4/26? 35 Let y(b) = -60b2 - 1. Let u be y(-1). Let j(f) = f3 + 6f2 + 13f + 32. Let o be j(-6). Let s = o - u. Calculate the remainder when 52 is divided by s. 7 Let s(a) = a*2 - a + 7. Let m be (-88)/(-12) + (12/(-9) - -2). Let g be s(m). Let v = 106 - g. What is the remainder when v is divided by 8? 3 Let d be ((-42)/(-4))/(2/4 + 0). Suppose 10o = 7o - d. Let g(l) = -l3 - 7l*2 - 2l - 3. What is the remainder when 30 is divided by g(o)? 8 Let a = 233 + -221. Suppose 10k + 42 = ak. Calculate the remainder when 4/(-12)249/(-1) is divided by k. 20 Suppose -2g = -3r + 78, -5r + 8g - 9g = -104. Let c be (33/6 - 2)8. Suppose -2o = 2o - c. What is the remainder when r is divided by o? 1 Let t be 20/90 + (-232)/(-9). Suppose 22j - 20j = t. Suppose 0 = 6f - 9f + 147. Calculate the remainder when f is divided by j. 10 Let i(w) = 81w*3 - 2w*2 + 34w - 30. Calculate the remainder when 578 is divided by i(1). 80 Let u = -11212 + 11676. What is the remainder when u is divided by 66? 2 What is the remainder when (-12)/42 - (-2412)/63 is divided by 30? 8 Let x = 64 + -59. Suppose 0 = -7o + 118 + 8. Suppose 8w - 2 = 13w - 3p, w + 4p = o. Calculate the remainder when x is divided by w. 1 Suppose 110166 = -61678p + 61699p. Calculate the remainder when p is divided by 32. 30 Let v = 21 - 3. Suppose 5o = 17 + v. Suppose 0 = -3w + 5s + 37, w = 5s - 1. Calculate the remainder when w is divided by o. 5 Let w(z) = z2 - 4z - 17. Let o(m) = 3m + 7. Let g(x) = 10x + 21. Let i(p) = 2g(p) - 7o(p). Calculate the remainder when i(-22) is divided by w(7). 3 Suppose -4f = f - 50. Suppose fy = 5y + 70. Calculate the remainder when y is divided by 1 - ((-40)/25 + 4/(-10)). 2 Suppose 425h - 426h + 883 = 0. Suppose -4m + 10s = 8s - 706, -3s = -5m + h. What is the remainder when m is divided by 48? 32 Let p(j) = -j*3 - 9j*2 - 12j - 20. What is the remainder when 2020/40(-4)/(-1) is divided by p(-8)? 10 Let d = 6037 + -6007. Calculate the remainder when 4524 is divided by d. 24 Suppose -n + 2w + 7 = 3w, -5n = 3w - 39. Suppose 6c + n*c = 825. Calculate the remainder when 383 is divided by c. 53 Let b be 72/(-7) + (-18)/(	{ "pile_set_name": "DM Mathematics" }
prime factors of 57803383? 11, 17, 309109 What are the prime factors of 222513073? 222513073 What are the prime factors of 165072986? 2, 13, 101, 62861 What are the prime factors of 648275158? 2, 8747, 37057 List the prime factors of 242301139. 461, 525599 List the prime factors of 599213. 599213 What are the prime factors of 24633597? 3, 101, 81299 What are the prime factors of 316686802? 2, 8209, 19289 List the prime factors of 935524707. 3, 13, 47, 510379 List the prime factors of 52960681. 47, 1126823 List the prime factors of 4136682579. 3, 1021, 1350533 List the prime factors of 974349839. 89, 10947751 What are the prime factors of 60153681? 3, 7, 79, 101, 359 List the prime factors of 46230765. 3, 5, 7, 31, 2029 What are the prime factors of 241174133? 241174133 List the prime factors of 90576522. 2, 3, 1677343 What are the prime factors of 1045587128? 2, 1319, 99089 What are the prime factors of 728836410? 2, 3, 5, 17, 29, 49279 What are the prime factors of 29146009? 167, 174527 What are the prime factors of 1373856290? 2, 5, 41, 277, 12097 List the prime factors of 83194675. 5, 3327787 What are the prime factors of 38938253? 223, 283, 617 What are the prime factors of 998809708? 2, 13, 19, 31, 32611 List the prime factors of 1580613962. 2, 790306981 List the prime factors of 86214734. 2, 281, 153407 What are the prime factors of 1009579046? 2, 7, 31, 332317 List the prime factors of 1374648405. 3, 5, 13, 7049479 What are the prime factors of 1749891396? 2, 3, 11, 17, 79, 9871 What are the prime factors of 2242826070? 2, 3, 5, 29, 733, 3517 List the prime factors of 66466176. 2, 3, 7, 79, 313 What are the prime factors of 50906917? 859, 59263 List the prime factors of 333317142. 2, 3, 281, 65899 What are the prime factors of 71461093? 11, 431, 15073 What are the prime factors of 4036400333? 7, 349, 4817 List the prime factors of 8886098. 2, 13, 341773 List the prime factors of 767695475. 5, 19, 1616201 What are the prime factors of 54601909? 17, 409, 7853 List the prime factors of 779878473. 3, 11, 47, 61, 8243 What are the prime factors of 5238823875? 3, 5, 59, 236783 List the prime factors of 45020146. 2, 271, 83063 What are the prime factors of 453014891? 7, 19, 367, 9281 What are the prime factors of 111070828? 2, 11, 53, 47629 What are the prime factors of 573590776? 2, 11, 6518077 List the prime factors of 1271827859. 1271827859 What are the prime factors of 89204677? 19, 4694983 List the prime factors of 167369815. 5, 33473963 List the prime factors of 86727461. 86727461 What are the prime factors of 146658378? 2, 3, 19, 373, 3449 List the prime factors of 637421544. 2, 3, 137, 64621 What are the prime factors of 119931197? 1493, 80329 List the prime factors of 93389659. 11, 8489969 What are the prime factors of 246139488? 2, 3, 7, 83, 1471 List the prime factors of 317424215. 5, 3907, 16249 What are the prime factors of 41694002? 2, 7, 59, 7211 List the prime factors of 199040018. 2, 47, 2117447 List the prime factors of 12626378. 2, 6313189 What are the prime factors of 514262222? 2, 173, 233, 6379 List the prime factors of 82603679. 107, 771997 List the prime factors of 107296627. 107296627 What are the prime factors of 2151145176? 2, 3, 43, 2084443 What are the prime factors of 6250589? 1213, 5153 What are the prime factors of 96780350? 2, 5, 127, 15241 What are the prime factors of 339845610? 2, 3, 5, 13, 89, 9791 List the prime factors of 491928334. 2, 29, 647, 13109 List the prime factors of 69590388. 2, 3, 7, 19, 6229 What are the prime factors of 3752941? 199, 18859 List the prime factors of 137861518. 2, 131, 526189 List the prime factors of 809900510. 2, 5, 80990051 List the prime factors of 428362276. 2, 107090569 List the prime factors of 196494275. 5, 31, 71, 3571 What are the prime factors of 1386161283? 3, 13, 17, 19, 110039 List the prime factors of 82247620. 2, 5, 7, 13, 45191 List the prime factors of 63778076. 2, 29, 18959 List the prime factors of 4104411337. 13, 17, 83, 223759 List the prime factors of 92729145. 3, 5, 6181943 What are the prime factors of 581565163? 193, 211, 14281 List the prime factors of 151833708. 2, 3, 13, 324431 List the prime factors of 1152441022. 2, 43, 179, 1741 List the prime factors of 85671102. 2, 3, 11, 1298047 List the prime factors of 3078280726. 2, 353, 4360171 What are the prime factors of 139460996? 2, 17, 120641 List the prime factors of 524718342. 2, 3, 167, 173, 1009 List the prime factors of 35924061. 3, 1787, 6701 What are the prime factors of 29321189? 1231, 23819 List the prime factors of 41118147. 3, 7, 19, 34351 List the prime factors of 3636316500. 2, 3, 5, 43, 56377 What are the prime factors of 3869568969? 3, 7, 127, 1450907 List the prime factors of 1162740400. 2, 5, 2906851 List the prime factors of 200759951. 7, 181, 193, 821 List the prime factors of 333092343. 3, 111030781 List the prime factors of 3257174572. 2, 53, 223, 68897 What are the prime factors of 497651389? 497651389 What are the prime factors of 162106296? 2, 3, 11, 677, 907 List the prime factors of 402192516. 2, 3, 11, 37, 82349 What are the prime factors of 247304134? 2, 7, 11, 17, 94463 What are the prime factors of 28191742? 2, 14095871 List the prime factors of 7000802379. 3, 86429659 What are the prime factors of 11926117? 7, 1703731 What are the prime factors of 163480995? 3, 5, 619, 5869 What are the prime factors of 38768625? 3, 5, 7, 547 What are the prime factors of 37579210? 2, 5, 1103, 3407 List the prime factors of 2450592953. 239, 701, 14627 List the prime factors of 3208601738. 2, 1604300869 List the prime factors of 1735736478. 2, 3, 7, 29, 1425071 List the prime factors of 741063389. 11, 67369399 What are the prime factors of 26727582? 2, 3, 7, 53, 12007 List the prime factors of 257563576. 2, 71, 467, 971 List the prime factors of 819815378. 2, 17, 109, 157, 1409 List the prime factors of 505005313. 19, 73, 89, 4091 What are the prime factors of 113559159? 3, 7, 2011, 2689 List the prime factors of 597439298. 2, 71, 4207319 What are the prime factors of 89135395? 5, 17827079 What are the prime factors of 1611299198? 2, 5573, 144563 What are the prime factors of 456508248? 2, 3, 7, 113, 139, 173 List the prime factors of 810259909. 810259909 List the prime factors of 12264138. 2, 3, 681341 What are the prime factors of 9744521? 89, 103, 1063 List the prime factors of 62876530. 2, 5, 229, 27457 List the prime factors of 79717182. 2, 3, 17, 31, 1483 What are the prime factors of 449635620? 2, 3, 5, 7, 1070561 What are the prime factors of 1243754776? 2, 11, 199, 71023 What are the prime factors of 90868748? 2, 139, 163433 What are the prime factors of 25743172? 2, 7, 13, 197, 359 What are the prime factors of 572637193? 572637193 List the prime factors of 42173038. 2, 677, 31147 List the prime factors of 823597363. 23, 257, 139333 What are the prime factors of 2192329585? 5, 438465917 What are the prime factors of 3188390042? 2, 23, 47, 71, 20771 List the prime factors of 30683829. 3, 11, 929813 What are the prime factors of 84602473? 84602473 List the prime factors of 480103683. 3, 463, 345647 List the prime factors of 339839284. 2, 29, 743, 3943 List the prime factors of 86663350. 2, 5, 1733267 What are the prime factors of 200171819? 97, 2063627 What are the prime factors of 57974441? 7, 8282063 What are the prime factors of 321337207? 307, 1046701 List the prime factors of 466793183. 1117, 417899 List the prime factors of 5928825553. 7, 1559, 543281 List the prime factors of 388169193. 3, 47, 1223, 2251 List the prime factors of 30642093. 3, 499, 6823 List the prime factors of 214565973. 3, 31, 2307161 List the prime factors of 22713947. 22713947 List the prime factors of 3379570651. 29, 67, 1739357 List the prime factors of 89948686. 2, 59, 762277 What are the prime factors of 2529644506? 2, 17, 43, 1730263 List the prime factors of 192200593. 13, 2113, 6997 What are the prime factors of 89233252? 2, 31, 59, 12197 List the prime factors of 87776130. 2, 3, 5, 13, 225067 What are the prime factors of 26543734? 2, 7, 1895981 List the prime factors of 792042959. 173, 179, 25577 What are the prime factors of 96755497? 3041, 31817 List the prime factors of 1598045872. 2,	{ "pile_set_name": "DM Mathematics" }
are there in seventy-seven fifths of a milligram? 15400 How many seconds are there in 1/4 of a day? 21600 What is 35.06134 kilometers in nanometers? 35061340000000 How many kilograms are there in 51316.25 micrograms? 0.00005131625 What is 54/5 of a meter in millimeters? 10800 How many decades are there in 40924.79 millennia? 4092479 What is 42/5 of a millimeter in micrometers? 8400 Convert 1877159.1 minutes to hours. 31285.985 How many seconds are there in one eighteenth of a week? 33600 How many millilitres are there in 0.8400297l? 840.0297 How many minutes are there in 18/5 of a day? 5184 Convert 445.7009 litres to millilitres. 445700.9 What is 42/5 of a litre in millilitres? 8400 What is 16.240779 months in decades? 0.135339825 How many millilitres are there in fourty-eight fifths of a litre? 9600 What is 0.93989 micrograms in nanograms? 939.89 How many milligrams are there in 13/4 of a gram? 3250 How many centimeters are there in 971.3647km? 97136470 What is 4/15 of a hour in minutes? 16 How many millilitres are there in three tenths of a litre? 300 What is 738.2265 hours in milliseconds? 2657615400 How many micrometers are there in 636039.5mm? 636039500 Convert 3484.148 centuries to millennia. 348.4148 What is seven halves of a litre in millilitres? 3500 What is 89.4414 years in millennia? 0.0894414 What is 852.9031mm in kilometers? 0.0008529031 Convert 174707.22 seconds to minutes. 2911.787 Convert 491429.9 meters to millimeters. 491429900 What is eleven quarters of a day in hours? 66 What is one quarter of a day in seconds? 21600 How many centimeters are there in fourty-four fifths of a meter? 880 Convert 718.539 millilitres to litres. 0.718539 What is fifty-five quarters of a tonne in kilograms? 13750 How many millilitres are there in 34/5 of a litre? 6800 Convert 1113.776 tonnes to grams. 1113776000 How many grams are there in 1/4 of a kilogram? 250 What is 0.523718 grams in nanograms? 523718000 What is 80.4738 litres in millilitres? 80473.8 How many centimeters are there in 3/10 of a kilometer? 30000 How many millimeters are there in 7/4 of a meter? 1750 How many hours are there in 761512.6 weeks? 127934116.8 How many millilitres are there in 47/4 of a litre? 11750 What is 647734.1 minutes in microseconds? 38864046000000 What is 19539.32 kilograms in nanograms? 19539320000000000 How many months are there in 1/4 of a decade? 30 How many decades are there in thirty-three fifths of a century? 66 How many millimeters are there in five eighths of a meter? 625 How many centimeters are there in seventeen quarters of a meter? 425 How many litres are there in 21.95005 millilitres? 0.02195005 Convert 8452.321 meters to nanometers. 8452321000000 Convert 68846.84 kilograms to micrograms. 68846840000000 How many microseconds are there in 8.73631ns? 0.00873631 What is 67918.38 years in millennia? 67.91838 Convert 4780.87km to centimeters. 478087000 How many minutes are there in five quarters of a day? 1800 What is 41/2 of a centimeter in millimeters? 205 Convert 98329.58um to centimeters. 9.832958 Convert 1865.113 litres to millilitres. 1865113 Convert 0.5946191 days to microseconds. 51375090240 How many nanoseconds are there in 510.3592 days? 44095034880000000 What is 1.292013l in millilitres? 1292.013 What is 25/2 of a millimeter in micrometers? 12500 How many grams are there in 3.582508 kilograms? 3582.508 What is 787.34l in millilitres? 787340 How many millilitres are there in 5/4 of a litre? 1250 Convert 30476.8 litres to millilitres. 30476800 What is 3487.26 grams in milligrams? 3487260 What is 53752.67l in millilitres? 53752670 How many millennia are there in 727.6736 centuries? 72.76736 How many nanoseconds are there in 7.990502 minutes? 479430120000 Convert 71604.5ms to nanoseconds. 71604500000 What is 3/28 of a week in seconds? 64800 How many millilitres are there in 0.1539215l? 153.9215 How many millilitres are there in nineteen quarters of a litre? 4750 Convert 9086.647ug to nanograms. 9086647 What is 82676.12nm in micrometers? 82.67612 How many micrograms are there in nineteen quarters of a milligram? 4750 How many millilitres are there in 3/25 of a litre? 120 How many milliseconds are there in 60113.49 weeks? 36356638752000 How many millennia are there in 926.9726 decades? 9.269726 What is 19/4 of a litre in millilitres? 4750 How many years are there in 33/5 of a millennium? 6600 What is 33.35448 milliseconds in seconds? 0.03335448 What is 9/10 of a century in months? 1080 What is 3/25 of a kilometer in meters? 120 What is 0.000095g in nanograms? 95000 How many millimeters are there in thirteen fifths of a centimeter? 26 How many seconds are there in 1/4 of a minute? 15 How many millilitres are there in 4.956764 litres? 4956.764 How many centimeters are there in 7/4 of a meter? 175 What is twenty-seven halves of a kilogram in grams? 13500 How many minutes are there in 275.111 days? 396159.84 What is seven eighteenths of a week in minutes? 3920 How many micrometers are there in six fifths of a millimeter? 1200 What is 656.2828 hours in microseconds? 2362618080000 What is twenty-five eighths of a gram in milligrams? 3125 Convert 3841.264 days to seconds. 331885209.6 Convert 782.8749 centuries to millennia. 78.28749 How many millimeters are there in 77579.87km? 77579870000 How many meters are there in 13/4 of a kilometer? 3250 What is thirty-three fifths of a litre in millilitres? 6600 How many years are there in 1/5 of a millennium? 200 What is 1777.31 centuries in months? 2132772 Convert 880.9295 weeks to days. 6166.5065 What is 0.0459317m in millimeters? 45.9317 How many kilograms are there in 663.3973 grams? 0.6633973 What is 51/5 of a millennium in years? 10200 How many months are there in fourty-three quarters of a year? 129 What is 93/4 of a gram in milligrams? 23250 Convert 27.19294ml to litres. 0.02719294 What is 561820.7t in grams? 561820700000 What is one fifth of a litre in millilitres? 200 How many nanograms are there in 1479.356mg? 1479356000 What is 1/20 of a minute in seconds? 3 What is 312.7226ml in litres? 0.3127226 What is 3/10 of a centimeter in micrometers? 3000 How many millilitres are there in 1/4 of a litre? 250 What is 18/5 of a litre in millilitres? 3600 What is one fifteenth of a minute in milliseconds? 4000 What is thirty-four fifths of a minute in seconds? 408 What is 1/10 of a millimeter in micrometers? 100 How many millennia are there in 2275.006 centuries? 227.5006 What is 15.88545 months in millennia? 0.0013237875 What is 6/5 of a kilogram in grams? 1200 What is 18/5 of a minute in seconds? 216 How many millilitres are there in 21/8 of a litre? 2625 How many nanometers are there in seven quarters of a micrometer? 1750 What is 6354.995 millennia in years? 6354995 How many decades are there in 1.069428 centuries? 10.69428 What is 4/3 of a decade in months? 160 What is 69/2 of a meter in centimeters? 3450 What is three fifths of a meter in millimeters? 600 Convert 60.7877 millennia to years. 60787.7 What is seven halves of a litre in millilitres? 3500 How many years are there in 11/4 of a century? 275 What is 3/50 of a milligram in nanograms? 60000 What is thirteen fifths of a microgram in nanograms? 2600 What is 21/5 of a decade in years? 42 What is 152.5333 litres in millilitres? 152533.3 How many decades are there in 8692.065 years? 869.2065 How many nanograms are there in 31/2 of a microgram? 15500 What is 15/4 of a hour in minutes? 225 What is thirteen eighths of a millennium in years? 1625 How many kilograms are there in twenty-one quarters of a tonne? 5250 What is 68071.65 tonnes in milligrams? 68071650000000 What is 3/16 of a millennium in months? 2250 Convert 3337.684t to nanograms. 3337684000000000000 How many weeks are there in 1307148.381ms? 0.0021612903125 What is 0.8436093 milligrams in tonnes? 0.0000000008436093 How many milliseconds are there in 7179.15 nanoseconds? 0.00717915 How many micrometers are there in 33/5 of a centimeter? 66000 How many centimeters are there in 3/5 of a meter? 60 How many milligrams are there in eleven halves of a gram? 5500 How many kilograms are there in 193.3079 milligrams? 0.0001933079 How many millilitres are there in five quarters of a litre? 1250 How m	{ "pile_set_name": "DM Mathematics" }
j? False Let s = 14 + -8. Suppose 0 = l - 0 - s. Suppose ld - 18 = 3d. Is 5 at most d? True Let a be 1/(1 + 2/(-1)). Let m be 32/(-16) - (a + 91 + 0). Is m at most -92? True Let c = -28 - -13. Let w be (6/(-2835))/((-12)/c). Let k = w + 221/189. Is 2 at most as big as k? False Let l(h) = -3h + h2 + 98h*3 - 99h*3 - 12 + 4. Let r be l(-3). Which is smaller: 38 or r? r Suppose -f - 16f = -187. Is f less than 75/7? False Suppose -3c + 2b - 6b = -235, b + 76 = c. Let y be -3 - 0 - c/(-21). Is y bigger than -6? True Let h = 0.675 + -2.575. Is h < -0.1? True Let n be -2 + 9/7 + 1. Let g(x) = x3 - 15x*2 - 56x + 37. Let c be g(18). Which is bigger: c or n? c Let z = -269 + 270. Which is greater: 5/19 or z? z Let z be 178/26 - (3 - (-123)/(-39)). Suppose 5k + zm = 5m + 21, -m - 7 = -k. Which is smaller: 7 or k? k Let t(i) = -i3 + 6i*2 + 4i - 9. Let x be t(6). Let w be (2/x)/(7/((-35)/(-4))). Is 0.4 equal to w? False Let a = 425547691/3869319 - -30/75869. Let o = a + -110. Which is smaller: o or -1? -1 Let o = -0.0335 - 72.9665. Is o at least -3? False Let a(c) = -c*3 - 2c*2 + 1. Let b be a(1). Let n = -4276/5 - -833. Let m = n - -757/35. Is m smaller than b? False Let s = -124 - -125. Which is smaller: s or -19/6? -19/6 Let y = 557 - 556.8. Do -111 and y have different values? True Let y(f) = 31f + 43. Let h be y(-7). Let w = h + 160. Let m = 2 - 3. Is w less than m? True Let x be (-6)/93(-1)/(-2). Do x and -4.6 have the same value? False Let x be (-2)/(-3)(-54)/(-4). Suppose 0 = k - 5, 2k - x - 49 = -4f. Suppose -19h + 157 = -33. Which is greater: h or f? f Let a = 393/799 + -8/17. Let l = a + 40/329. Which is bigger: l or 1? 1 Suppose -2r + 204 = -36. Suppose -2s + 30 = -2c, r = 5s - 3c + 39. Let v = s + -20. Which is smaller: v or 4? v Suppose -4r - 5x = -158, 2r - 6 = 5x + 88. Suppose 6g = r + 60. Which is greater: g or -0.1? g Let r = 15838/17 + -932. Let y = r + 154/51. Let b = -110/39 + y. Does 1 = b? False Let u(q) = q*3 + 8q*2 - 11. Let o be u(-8). Let d = -5 - o. Suppose b = db. Is 1/2 at least as big as b? True Let o(a) = -a*2 - 6a + 19. Let u = 56 - 64. Let d be o(u). Is d not equal to 7/4? True Let y = 0.9 - 1. Let s = -121.3 + 123. Let i = s + -1. Is i at least y? True Let g = -668494 + 11359890/17. Let y = -265 - g. Let w = 1 + -2. Which is smaller: y or w? w Let q = -26.7 + 26.72. Let x = 0.04 + 0.26. Is x at least as big as q? True Let x = -23 - -27. Suppose 16 = 4d - 4t, -2d - 6 = -xt - 22. Let w = -89/14 - -13/2. Is w at most as big as d? False Let v be (-46)/(-11) - (-10)/(-55). Suppose -va + 4w = -76, -a - 3w - 23 = -2a. Which is smaller: a or 1? 1 Let c = -52275/23 + 2272. Which is smaller: -1 or c? -1 Let x(p) = p + 4. Let a be x(7). Suppose 5d = a + 4. Suppose -5h = -10, 2h = -di - i + 4. Which is greater: -2/15 or i? i Let m be 1/1-11. Suppose 30k - 6k = 720. Let a be (16/k)/4 - (-960)/(-10575). Which is smaller: a or m? m Suppose 0y = 6y - 330. Let c = -50 + y. Is c equal to 6? False Let d = 83/18 - -8/9. Is 2 greater than or equal to d? False Let r(a) = a*3 - 12a*2 + 5a - 13. Let n be r(12). Suppose -3p - n = 139. Is p at most -63? False Let o = -34 - -64. Let k = o - 40. Let t be (1 - -1) + (-6 - k). Is t less than 7? True Suppose 48 = 51v - 55v. Is v greater than -22? True Let p be ((-430)/(-3) + 0)/((-2)/3). Which is smaller: -216 or p? -216 Let j be -9 + 423/45 - (-194)/(-10). Is j not equal to -19? False Let t = -38182/196103 + -2/4783. Let y = -59/328 + t. Is -1 at most as big as y? True Suppose -2a + 2 = 10. Suppose 5i + 4x - x - 155 = 0, 0 = i - 4x - 8. Suppose -30p - i = -16p. Which is smaller: p or a? a Let y(z) = z3 - 11z*2 - 4z - 4. Let t(j) = -j*2 - j. Let p(i) = -6t(i) + y(i). Let g be p(5). Suppose -6 = -4c + g. Which is greater: 2 or c? c Let h = 37471 + -337597/9. Is -41 < h? True Suppose 3p = -58 + 55. Which is greater: -1/391 or p? -1/391 Let o(w) = 4w2 - 2w - 2. Let t be o(-1). Suppose 0 = tp - 6p + 2. Let i be (p/2)/((-25)/(-30)). Is 1 equal to i? False Let j be (4/(-6))/(2-1). Suppose 558 = 159f - 221f. Is j > f? True Let q = 0.057 - 0.006. Let m = q - -0.009. Let y(s) = -s3 - 3s*2 - 1. Let g be y(-3). Is g >= m? False Let t = -166 - -1161/7. Let q = -25.2 + 20. Let b = q + 5. Which is greater: t or b? t Let v = -84 - -89. Suppose 6p - vp - 2f = 6, 4f + 12 = 5p. Which is greater: 0.6 or p? 0.6 Let z(l) = -l*2 - l + 4. Let w be z(3). Suppose 4n - 5g = 8, n + 4g + g = -23. Which is smaller: n or w? w Let l(m) = m*3 + 52m*2 + 26. Let r be l(-52). Let n = -3.1 + 3. Is r at least n? True Let q = 1281 - 1163. Are 118 and q non-equal? False Let m = 529 + -529. Which is greater: m or 345? 345 Let l = 208 + -207. Which is bigger: 7/19 or l? l Let j be (2 - 7/3)/(2/6). Let w be (-2)/(j/((-705)/474)) - -3. Which is smaller: 0 or w? 0 Suppose 18u - 30u + 780 = 0. Is 65 greater than u? False Let u(s) = s2 - s. Let m(f) be the third derivative of f5/12 - f4/3 + 6f*2. Let n(x) = -m(x) + 6u(x). Let z be n(-3). Is -2 at most as big as z? True Let t be (-2)/6(-1378)/(-154) - -3. Which is smaller: 1 or t? t Suppose 0 = -15t - t + 17520. Let b = -1419412723/1297584 + 1/432528. Let i = t + b. Is i less than 2? True Suppose -140h = -2h + 100188. Which is smaller: h or -724? h Let r = 150 - 151. Let t = 2034/19 + -107. Which is bigger: t or r? t Let l = 652 + -774. Which is greater: -123 or l? l Let i be 2/10 + (-39)/45. Let k = 154.2 + -138. Let w = 16 - k. Which is greater: w or i? w Suppose -2q = 177 + 247. Let i(p) = p + 5. Let w be i(-5). Let t be w + (-4 - q/54). Which is smaller: t or 1? t Let o = 77 - 56. Is o less than 182/9? False Suppose 4o + a = 19, 5o - 5a = 3o - 7. Suppose -4t + t + 5p = -32, -op = 3t - 23. Are 7 and t unequal? True Let b = 8.548 + -8.5. Let p = 9.952 + b. Which is smaller: p or -0.2? -0.2 Let i = 85.2 + -85. Let b = -1264 + 192129/152. Let z = 451/760 + b. Which is smaller: i or z? i Suppose 158 = y + 2f, 2f - 315 = -2y - f. Which is bigger: 155 or y? y Let x = 39 - 49. Let n = 9 - x. Is 20 equal to n? False Let o(r) = -7r3 - r + 1. Let b(z) = 6z*3 + z - 1. Let y(x) = 6b(x) + 5o(x). Let h be y(0). Let w = -415/6 + 69. Which is greater: h or w? w Let o = -25.9 - -26. Is 11 at most o? False Let d(k) = -2k*3 + 14k*2 - 3k + 9. Let w be d(6). Which is greater: w or 62? w Let i be (-1)/(-3)5-3. Let n = i + 4. Let m be ((-2)/42)/((-10)/30). Is m < n? False Let n be (-8443)/65 + (-2)/(-10). Let h = n + 130. Are h and 0 non-equal? True Let s = -18 + 17. Let i = s - -1.2. Is 3/2 less than or equal to i? False Suppose -3g = 4k - 12, -6k + 5k + 3 = 4g. Is -1/1271 > g? False Let a = 101 + 43. Is a at least as big as 0? True Let a be 3/(((-18)/(-4))/1). Let w = 45 - 33.8. Let p = w + -11. Is p >= a? False Suppose -22y + 26y + 688 = 0. Let n = y - -95. Is n not equal to -77? False Suppose -3s + 5b + 177 = 2b, 0 = 2b. Suppose 0 = -3q + 5u + s, 2u + 112 - 38 = 4q. Is 17 bigger than q? False Suppose 0h + 2h = 3h. Suppose 3 = 3r + 3z - 4z, h = 2z. Which is bigger: -37 or r? r Let s be 8/((-48)/42) - -7. Is 2/397 at most as big as s? False Let a = -5135/516 + 125/12. Is 0 equal to a? False Let g = 1.3 + 12.7. Let c = -8.74 - -8. Let r = c - -0.64. Which is smaller: r or g? r Suppose 0 = -7c + 6 + 8. Let y be (((-42)/(-119))/((-3)/c))/30. Which is bigger: y or -1? y Let p = -85 + 88. Suppose 0 = -5c + pc - 3d + 1, 4c = -5d + 1. Which is smaller: c or 1? c Let q be (578/(-255))/((-32)/(-3)). Let i = -3/16 + q. Let j = -1.6 + 2. Is i equal to j? False Let z be (4/10)/((-6)/(-10)7). Let i be (-1)/(-2)-2 - 2. Let w = 3 + i. Is w >= z? False Let d(s) = -21s + 2 + 1 + 27s + s*2. Let t be d(-2). Suppose 31 = -4c + 11. Is t <= c? True Let r(t) = 12 - 25t + 54t - 18t - t2. Let y = 10 - -3. Let u be r(y). Is u smaller than -13? True Suppose 2346 = -5i + 2351. Are i and -8 unequal? True Let w = -54/25 + 19/25. Is w at most 2/23? True Let h be -1(1 - 0)2. Let i = 15/149 + -507/596. Is h bigger than i? False Let m be ((-143)/39)/(8 - 7). Which is smaller: m or 1/5? m Suppose 0 = 5z - 2y + 4, -4z + 3y = -9*z + 6. Let c(r) = -	{ "pile_set_name": "DM Mathematics" }
3 to lw3 + u + gw + fw2 and give l. 55 Express -20t*3 + 8t*3 + 10t*3 + 2t3 - t3 + 0t3 + (3t - 5t + 0t)(-2t*2 + 0t + 0t) in the form gt + nt3 + vt*2 + a and give n. 3 Express (52b*2 + 173b*2 + 53b*2)(5b - 5b + 2b) + (b2 + 2b*2 + 0b*2)(b - 3 + 3)(1 + 2 - 2) as tb + fb3 + kb*2 + g and give f. 559 Rearrange 19368y + 1 - 18771y - 1 to ry + g and give r. 597 Express 33p2 + 24p*2 - 29p*2 + 104p*2 as ip + rp2 + u and give r. 132 Express (31t - 7t - 13t + 480 - 12t)(-t + 3t - 5t) in the form r + wt + yt*2 and give w. -1440 Rearrange (0 + 0 + 2)(-4t2 - 3t*2 + 5t*2)(-25 + 0 - 7) to the form ht + s + it*2 and give i. 128 Express 3y*2 + 3y*4 - 7y*3 - 8y*3 - 74y - 3y2 + 18y*3 in the form ky*2 + uy*3 + i + py + hy4 and give p. -74 Express 0m*3 - 2m*4 + 260m*2 - 10 - 2m*3 - 255m*2 in the form ym*2 + um + lm3 + h + pm4 and give l. -2 Rearrange -c4 - c*3 + c - 491c*2 + 1007c*2 - 506c*2 to rc*4 + uc*3 + p + xc + qc2 and give q. 10 Express (-11 + 11 - 9y)(-12 + 1 - 8) as f + vy and give v. 171 Express 2a4 - a + 18a*2 - 45 - 2a*3 + 41 - 17a*2 as da*4 + xa*3 + na*2 + ca + j and give d. 2 Express -2v + 6v - 6v + 23v*2 + 4v as uv + gv*2 + c and give u. 2 Rearrange 29o*2 + 0o + 69 - o - 34 - 33 to ko + lo*2 + m and give k. -1 Express 147g*3 - 291g*3 + 13 + 145g3 - g - g4 in the form cg3 + tg*2 + yg*4 + vg + s and give t. 0 Express 149y - 7363y*2 + 0 + 7361y*2 + 0 as ty*2 + qy + l and give t. -2 Rearrange -7 - 4 - 31o + 10o*2 - 14 + 25 to io*2 + po + c and give i. 10 Express (2u + u + u)(-65u2 - 168u*2 + 55u*2) in the form s + nu*2 + gu + du3 and give s. 0 Express 2 - 17x + 2x2 - 19x + 58x in the form fx + a + dx2 and give a. 2 Rearrange 0a*2 + 3a2 - 1 + a2 + 2a2 to the form ca + j + fa2 and give f. 6 Express 9262a*2 + 0 - 1 - 8862a*2 as qa*2 + sa + t and give q. 400 Rearrange (158 - 5b - 154 - 6b)(-3b*2 + 0b*2 - 2b*2)(5b + 0b - 4b) to the form n + sb*3 + gb*4 + hb + qb2 and give s. -20 Express 6h*2 + 5499 - 4h*2 - 5414 in the form zh*2 + o + gh and give o. 85 Express -4 - 6f - 19f + 34f - 17f - 3f3 as uf + zf2 + bf*3 + y and give b. -3 Rearrange -39y*2 - 35y*2 - 1 + 19y + 8y3 + 109y*2 - 35y*2 to the form r + ay*2 + gy + jy3 and give r. -1 Rearrange 11m*3 - 8 + 1 - 5 - 3m*3 + 29 to g + rm*2 + jm*3 + cm and give j. 8 Rearrange (-4k2 + 4k*2 + 7k*2)(160k - 10k*2 - 160k) to rk3 + gk*4 + b + dk + fk2 and give g. -70 Rearrange p2 + p + 155p*3 + 3 - 3p*2 - 125p*3 to h + bp*2 + cp*3 + gp and give b. -2 Rearrange -1841 + 25f + 3678 + 2f*2 + 2f3 - f4 - 2f2 - 1838 to m + cf*3 + sf + xf2 + jf*4 and give s. 25 Express 0 - 4x + 1 + 2x + 4x + 2x - 4x + (-2x - x + 2x)(1 + 1 - 4) + 37x + 0x - 13x as f + ox and give o. 26 Express -7 - 2 + 9 + 6 - 2v in the form dv + p and give p. 6 Rearrange -x + 3x - 3x + (-4x - x + 4x)(-4 + 2 + 3) + 417 - 201 + 149x - 218 to the form b + yx and give y. 147 Rearrange -9x + 5x + 4x + 300x*2 + 525x*2 to qx + f + ix2 and give i. 825 Rearrange 41q*2 + 10q*2 + 4q*2 + (-7 + 7 + 10q)(-1 - 2q + 1) to the form zq2 + k + tq and give z. 35 Express -10k2 - k + 8k*2 + 6k*4 + 1615 + 4k*4 - 1612 + 2k*3 in the form t + hk*3 + zk*4 + gk*2 + uk and give h. 2 Express 30d + 2d*2 + 0d*2 - 6d*2 + 68d as r + td2 + sd and give t. -4 Rearrange -2 + 19m + 1 - 14m + (-2m + 0m + 0m)(-17 - 18 + 39)(3 + 1 - 3) to j + km and give j. -1 Express (3 - 5 - 1)(-176x + 221x + 152x) as k + jx and give j. -591 Rearrange 233y - 79y - 78y - 76y - 1724y*2 to iy + xy2 + c and give x. -1724 Rearrange 273194 + 17m*3 + 5m - 3m2 - 273194 to the form xm*2 + c + zm + tm3 and give x. -3 Rearrange 78m + 92m - 168m + 75 to v + lm and give l. 2 Rearrange -1411 - 97x + 1412 - 32x - 145x to the form i + nx and give n. -274 Express (7p - p + 4p)(340p2 + 104p*3 - 340p*2) in the form np*4 + ap*3 + ip + m + dp2 and give n. 1040 Express 345 + 0x - 9x + 5x + 6x in the form mx + r and give r. 345 Rearrange 4m3 - m - 8 - 1 + 0 - 12m*4 + 2m*2 + 4 + 6 to the form ym*3 + vm*4 + z + um*2 + am and give v. -12 Express 0b2 - b2 + 0b*2 - 19b - 5b2 + 19b + (-13 + 13 + b)(-2 + 2 - 8b) in the form pb + q + nb*2 and give n. -14 Express (-3n*4 + 2n*4 + 2n*4)(-2 + 2 - 1) - 31n4 + 47n*4 - 18n*4 + 2n*3 - 5n*2 - 1 as in*4 + b + tn + on3 + pn*2 and give p. -5 Rearrange 247 - 257 + j - j - 2j*2 to the form o + tj + lj2 and give o. -10 Express j3 + 6j*4 + 0j4 - 3 - j4 - 6j4 - 84j + 4 in the form x + wj2 + sj + zj3 + gj*4 and give s. -84 Rearrange -15f*4 - 11f*4 - 15f*4 + (-6f*3 - 9f*2 + 9f*2)(1 + 4f - 1) + 3f4 - f4 - f*4 to l + rf + mf4 + pf*3 + if*2 and give m. -64 Express -2s*3 - 2s - 160 + 178 - 341s2 - 18 as js*3 + hs + qs2 + f and give j. -2 Rearrange (113q*2 + 275q*2 - 61q*2)(-q + 2q + q) to vq*3 + l + xq + nq2 and give v. 654 Express (-2n2 - n3 + 2n2)((8n - 5n - 4n + 2)(2 + 1 + 1) + 7n + 22 - 22) as dn*3 + k + pn*4 + bn + tn2 and give p. -3 Rearrange (-7s + 12s - 2 + 0s)(29 + 23 - 53) to vs + d and give d. 2 Rearrange (5h - 4h - 3h)(219h + 60h*2 - 219h) + (3 - 3 - 2h2)(2h + 3h - 3h) to zh + ih3 + lh*2 + q and give z. 0 Express 211 + 49v*2 - 1011v*2 - 209 in the form uv*2 + z + kv and give u. -962 Rearrange ((-4 + 3 - 1)(2 + 2q*3 - 2) - 33q*3 - 1470q*3 - 1509q*3)(1 - q - 1) to the form fq + cq*2 + pq*4 + h + yq*3 and give p. 3016 Rearrange -4 - 3y + 2663y4 + y - 2684y*4 to the form sy*2 + m + oy*3 + py + ry4 and give m. -4 Rearrange -4x*4 + 1375 - x - 8x*4 - 1377 - 6x*3 - 4x4 + x4 to kx4 + fx + ox3 + bx2 + q and give f. -1 Express i4 - 3i4 + 3i*4 + (-319i + 210i + 425i)(1 - 2i*3 - 1) in the form ni*2 + ri*4 + z + qi + li3 and give r. -631 Rearrange -y3 + 7y*3 - 4y*3 + (0y*2 + 0y*2 + 6y*2)(2y + 0y + y) to the form ry + o + by*2 + dy*3 and give d. 20 Rearrange -2z + 7z2 + 0z*2 + 18z*2 to q + mz*2 + pz and give p. -2 Rearrange -23 - 36c - 403c + 23 to n + qc and give n. 0 Rearrange (2035s*3 - 283s*3 + 1384s*3)(-2 + 2 + 2) to the form js + ws*3 + qs*2 + d and give w. 6272 Express (-3d - 2 + 2d - 1)(-4d - 352d - 9d) as hd*2 + kd + v and give k. 1095 Rearrange 5a2 + 2 + 12a*3 - 5a*2 - 46a*3 + 2a to ca + h + na*2 + ya*3 and give h. 2 Express 10t*2 - 6t + 19t - 13t - 16t as dt*2 + b + lt and give l. -16 Rearrange (-v2 - v2 + v*2)(-3 + 0 + 1) - 2979v2 - 4263v*2 + 5212v*2 + 0v2 + v2 - 2v2 to the form hv*2 + dv + j and give h. -2029 Express (28d - 17d + 11d)(2d2 + 75 - 40 - 40) in the form fd*3 + ld*2 + k + qd and give l. 0 Rearrange -12951 - 1261v2 + 12951 to the form lv + x + cv2 and give c. -1261 Express -433r - 435r + 870r - 25 - 14 as l + zr and give z. 2 Express -b - 813 + 1626 - 811 + 32b*3 in the form hb + u + db2 + yb*3 and give h. -1 Rearrange 1710z + 33z4 + 1713z + 1 - z*2 - 3422z to rz + yz*3 + sz*2 + kz4 + x and give r. 1 Express 259 - t2 - 129 - 2t - 131 - 4t*3 as m + nt*2 + ut*3 + gt and give g. -2 Express (-2d + 3 - 3)(1 - 5 + 1) + (-2d + 3d - 2d)(-2 - 5 + 4) as l + fd and give l. 0 Rearrange (-6 - 77 - 3)(21 - 10 - 6)(4z + 0z - 2z) to the form sz + d and give s. -860 Express -250 + 38p - 88p + 49p in the form g + jp and give j. -1 Rearrange (72076 - 72076 + 222s)(-2s*3 - 2s*2 + 2s*2) + 5s*4 - 3s*4 + 0s*4 to the form gs*4 + ws + js3 + l + ks*2 and give g. -442 Express (2k - k - 2k)(k + 0k - 4k)(846 - 846 + 21k) as ok2 + ik + xk3 + y and give o. 0 Express (811 - 811 + 180p)(0p - 2p2 + 0p) - 4p3 + 5p3 + p3 in the form	{ "pile_set_name": "DM Mathematics" }
erms in -161m2 - 1826 + 41m - 41m - 48m*2 + 1825. -209m*2 - 1 Collect the terms in -949 - 2h*3 - 66 + h + 1015 + 0h*3 - 2h*3 - 3h. -4h3 - 2h Collect the terms in 488x2 - 36 - 181 - 50 + 312 - 45. 488x*2 Collect the terms in 6408f*3 - 3709f*3 - 2758f*3. -59f*3 Collect the terms in 17 - 8 - 9 - 2217504s*2. -2217504s*2 Collect the terms in 32d*2 + 88d*2 + 6d*2 - 127d2. -d2 Collect the terms in 0l3 + 3l*3 + 4l*3 + 6l*3 - 43l*3 + 3l*3 + 31l*3. 4l*3 Collect the terms in 1364 + 1381 + 45b + 1375 - 4118. 45b + 2 Collect the terms in 3 - 137q + 3 - 64q - 8 + 412q. 211q - 2 Collect the terms in 10 - 1140w + 71 + 61 - 35. -1140w + 107 Collect the terms in -1 - 486096y + 2 - 1. -486096y Collect the terms in -236661n*3 - 87917n*3 - 48897n*3 + 72743n*3. -300732n*3 Collect the terms in 134534h*2 + 3181h - 3181h. 134534h*2 Collect the terms in -444d - 534d - 486d + 1382d. -82d Collect the terms in -1504145 + 1504145 + 3d. 3d Collect the terms in 11 + 256j3 - 252j*3 - 218j*3 - 265j*3. -479j*3 + 11 Collect the terms in 36464h + 15h2 - 17h2 - h3 + 0h3. -h3 - 2h*2 + 36464h Collect the terms in -1683 + 3554 - 1864 - 103i. -103i + 7 Collect the terms in -15654 + 12h2 + 15654 - 6938h. 12h2 - 6938h Collect the terms in -a + 3a + 328a*2 + 470a*2 + 4a - 910a2. -112a*2 + 6a Collect the terms in -2w - 4w + 990w3 + 3255w*3. 4245w*3 - 6w Collect the terms in -279h - 336 - 64h - 18h. -361h - 336 Collect the terms in -54 - 3n + n - 64 + 89 + 29. -2n Collect the terms in 0k2 + 15826k*3 + 11143k*3 + 0k*2. 26969k*3 Collect the terms in -4 - 4826m - 16354m - 885m. -22065m - 4 Collect the terms in 414j*2 - 120656413j*3 - 414j*2 + 120656411j*3 + 130j. -2j3 + 130j Collect the terms in 2 + 3 + 5a - 9a - 7a + 2 - 11. -11a - 4 Collect the terms in -14g2 - 14g*2 - 16g*2 - 20g*2 + 293643g - 293643g + 70g*2 - 7g2. -g2 Collect the terms in -59491y2 - 575 - y + 575. -59491y*2 - y Collect the terms in 3495a*2 + 246a - 3493a2 + 0 + 0 - 262a. 2a2 - 16a Collect the terms in -36400 - 36402 + 18959q + 72802 + q2 - 18959q. q*2 Collect the terms in 3097s*2 - 3097s*2 + 39282s*3. 39282s*3 Collect the terms in -17096624z + 8548337z + 8548312z. 25z Collect the terms in -1505m*2 - 1580m*2 + 5175m*2 - 1574m*2. 516m*2 Collect the terms in -22j*3 - 1062396 + 531536 + 530860. -22j*3 Collect the terms in -186b + 209b2 + 211b*2 - 596b*2 + 186b + 194b2. 18b*2 Collect the terms in 435977 + 3019y*2 - 435977. 3019y*2 Collect the terms in -21 + 1145m - 347m + 14 - 12 + 19. 798m Collect the terms in 793r2 + 269r*2 + 971r*2. 2033r*2 Collect the terms in 41 + 2138q - 773q - 687q - 680q + 74. -2q + 115 Collect the terms in 1866r2 - 69 - 3746r*2 - 4r + 1868r2. -12r*2 - 4r - 69 Collect the terms in 863x3 - 427x*3 - 1 + 0 - 434x*3. 2x*3 - 1 Collect the terms in 14352704 + 1353y*3 - 1397y*3 - 14352704. -44y*3 Collect the terms in 689200j*2 - 9 - 690050j*2 + 8. -850j*2 - 1 Collect the terms in -492758z*2 + 245878z*2 + 246878z*2. -2z*2 Collect the terms in -1367728 - 2h - 1367725 + 2735453. -2h Collect the terms in 1108f + 104 - 26 - 24 - 22 - 32. 1108f Collect the terms in -219v*3 + 525v*3 - 704v*3. -398v*3 Collect the terms in -104 - 181 + 23791g + 285. 23791g Collect the terms in -51j - 137j - 58j - 50j - 20j - 50j + 365j. -j Collect the terms in -2936o2 + 1501o*2 + 3 - 3 + 1474o*2 - 2o. 39o2 - 2o Collect the terms in -10z3 - 6z*3 + 12z*3 + 14z*3 - 15z*3 + 2z*3 + 2z3. -z3 Collect the terms in 94844 - 569u - 94844 + 562u. -7u Collect the terms in 0 + 13059879n*2 + 0 - 26119772n*2 + 13059877n*2. -16n*2 Collect the terms in -5r + 0 - 1 - 26r + 67r*2 + 8r. 67r2 - 23r - 1 Collect the terms in -566 - 12h + 179 + 218 + 10h + 178. -2h + 9 Collect the terms in -6k + 2 - 33459k2 + 33452k*2 + 2 + 6k - 5. -7k2 - 1 Collect the terms in -12194c - 4 - 222c + 9 - 4397c. -16813c + 5 Collect the terms in 5d - 170 - 7d2 + 131 + 99 + 5d*2. -2d*2 + 5d + 60 Collect the terms in 17706 + 17829 - 36003 + 2x. 2x - 468 Collect the terms in -418246n + 10n*3 + 68n*3 - 418228n + 836474n. 78n*3 Collect the terms in 4g + 4g2 + 2g*2 - 4585 + 27g*2 - 36g*2. -3g*2 + 4g - 4585 Collect the terms in -161z3 + 168z*3 + 500z*3. 507z*3 Collect the terms in -25x*2 - 32x + 28x - 15x*3 + 8x. -15x3 - 25x*2 + 4x Collect the terms in 5 + 83335v - 3 - 222397v - 2. -139062v Collect the terms in 61206 + 61172 - 244736 + 9k + 61183 + 61175. 9k Collect the terms in 436u + 3u3 + 65u - 4u3 + 75u*2 + 477u. -u*3 + 75u*2 + 978u Collect the terms in 5960611f - 5960611f - 2 + 9f2. 9f*2 - 2 Collect the terms in 477f*3 + 362f*3 + 28f - 19f - 9f. 839f3 Collect the terms in 328 + 6i - 165 - 67 - 96. 6i Collect the terms in -7 + 20 + 11 - 90u - 25. -90u - 1 Collect the terms in -13h*3 + 26h*3 - 7h - 11h3 - 5h*3. -3h*3 - 7h Collect the terms in -2660m + 1169m + 756m + 735m - 60m2. -60m*2 Collect the terms in 15590r + 124 - 171377r - 124. -155787r Collect the terms in 30w - 85w - 160 + 62w. 7w - 160 Collect the terms in -71q + 46q - 131q2 + 10q + 16q + 10q*2. -121q*2 + q Collect the terms in -581202u + 195032u + 195034u + 191133u. -3u Collect the terms in 11581x3 + 3 - 3 - 2705x*3 + 2640x*3. 11516x*3 Collect the terms in -823n*2 - 27 + 98 + 90 + 2738n*2. 1915n*2 + 161 Collect the terms in 7l*3 - 4470729l*2 + 2235327l*2 + 2235402l*2. 7l*3 Collect the terms in 7220b*2 - 12385b*2 - 7488b*2 + 2b*3. 2b*3 - 12653b*2 Collect the terms in -11511w + 46052w - 11507w - 11510w - 11523w. w Collect the terms in -2426821 + 89h3 + 4853639 - 2426818. 89h*3 Collect the terms in 983q*3 + 8048586 - 8048586 - 482q*3. 501q*3 Collect the terms in -32867g - 45337g + 777680g. 699476g Collect the terms in -8838b - 16147b - 1122b. -26107b Collect the terms in 46957877x - 93915757x + 46957873x. -7x Collect the terms in 542379838b*3 - 542380185b*3 + 2 - 2. -347b*3 Collect the terms in 246 + 67048s - 568s - 246 + 34726s. 101206s Collect the terms in -5w*3 - 4w*3 + 16w*3 + 6w*3 + 13w*3 + 24w*3. 50w*3 Collect the terms in 254970m*3 - 510612m*3 + 255644m*3. 2m*3 Collect the terms in 404u*3 - 882 - 666 + 1550. 404u*3 + 2 Collect the terms in -456s - 442s - 566s + 1447s. -17s Collect the terms in -14l2 + 12l*2 + 3l*2 - 18l*2 + 4 - 11l*2 + 0l*2. -28l*2 + 4 Collect the terms in -16057f*3 - 16052f*3 - 16050f*3 + 48133f*3. -26f*3 Collect the terms in -6c*2 + 822 - c - 493 + 321. -6c*2 - c + 650 Collect the terms in 720l + 3053 - 5991 - 609l + 2938. 111l Collect the terms in -1092044839n + 23n*2 + 1092044839n. 23n2 Collect the terms in 20h*2 + 211h*3 - 12h*2 - 2h*2 + 0h*2 - 6h*2. 211h*3 Collect the terms in 140 - b - 151 - 161. -b - 172 Collect the terms in 65o + 7o2 + 4 - 64o - 2o2 - 13o*2 - 11o*2. -19o*2 + o + 4 Collect the terms in 4106z - 1372z + 4705z - 1448z + 2216z. 8207z Collect the terms in 10i - 10i - 207047477i*2. -207047477i*2 Collect the terms in -1288037g*2 - 4757049g*2 + g + 1052786g*2. -4992300g*2 + g Collect the terms in 196c*3 + 5 + 166c*2 + 47c - 42c - 3. 196c*3 + 166c*2 + 5c + 2 Collect the terms in 73t - 189t + 67t + 52t + 33t. 36t Collect the terms in 49 + 48 - 146 - 17o - 36 + 44 + 41. -17o Collect the terms in -374g2 - g3 - 369g*2 - 16 + 1 + 743g2 - 24. -g3 - 39 Collect the terms in -261892 + 261892 + 27231j2. 27231j*2 Collect the terms in 0 - 130230p + 0 + 414821p. 284591p Collect the terms in -35q + 92q - 4024 - 36q + 1396 - 23q. -2q - 2628 Collect the terms in -2w*3 - 86608076w*2 - 18 + 86608076w*2. -2w*3 - 18 Collect the terms in 6a*2 - 18590 - 6a*2 + 9295 + 39a*3 + 9289. 39a**3 - 6 Collect	{ "pile_set_name": "DM Mathematics" }
) = -212u + 20. Let y(k) = -13k + 1. Let h(l) = -i(l) + 16y(l). Calculate -3h(q) - 2j(q). -6q + 6 Let m(p) = -12p + 2. Let g(s) = -7s + 11. Let f(d) = -g(d) + 2m(d). Let t(a) = 8a + 3. Calculate 4f(l) + 9t(l). 4l - 1 Let p(c) = -126c - 8. Let g(y) = 111y + 7. Calculate -6g(j) - 5p(j). -36j - 2 Let g(c) be the first derivative of 2c2 - 5c + 50. Let l(i) = -4i - 1. Let r(z) = -42z - 20. Let b(u) = 12l(u) - r(u). Calculate -5b(m) - 8g(m). -2m Let r(p) = -8p3 + 15p*2 - 45p - 5. Let o(h) = -17h3 + 32h*2 - 87h - 11. Determine -6o(i) + 13r(i). -2i3 + 3i*2 - 63i + 1 Let d(i) = -235016i2 - 696i + 696. Let x(p) = 2362p2 + 7p - 7. Give 7d(u) + 696x(u). -1160u2 Let g(x) = 9x*3 + 32x*2 + 18x - 57. Let r(t) = -7t3 - 24t*2 - 18t + 58. What is 3g(s) + 4r(s)? -s*3 - 18s + 61 Let i(f) be the third derivative of f*4/6 + 7f*3/6 + 30f*2 - 72f. Let w(r) = 1. Give i(h) - 2w(h). 4h + 5 Let s = 20066 - 20060. Let u(m) = 5m + 5. Let j(k) = -3k + 1. Let d(t) = -4t + 2. Let q(g) = 2d(g) - 3j(g). Determine sq(o) - u(o). o + 1 Let i(v) = -707v + 144. Let h(d) = 706d - 157. Calculate 11h(y) + 12i(y). -718y + 1 Let t(p) = -2p*3 - 6p*2 + p - 1. Let j(o) = 19o*3 + 16o*2 + 36o + 7. Give j(y) + 3t(y). 13y*3 - 2y*2 + 39y + 4 Let z(o) = 7o3 + o2 + o + 5. Let l = 45 - 46. Let g(q) = -q3 - q2 - 1. Give lz(d) - 5g(d). -2d*3 + 4d*2 - d Let t(z) = 11z3 - z2 + 10z + 7. Let p(u) = -u3 - u2 + 2u. Determine 4p(i) - t(i). -15i*3 - 3i*2 - 2i - 7 Let j(x) = 2x2 + 7x. Let w(m) = -5m2 - 153m + 2. Give 2j(v) + w(v). -v2 - 139v + 2 Let h(o) = 7007o - 47. Let v(d) = -21020d + 164. What is 7h(q) + 2v(q)? 7009q - 1 Let w(q) = 43q + 977. Let r(m) = 15m + 325. Calculate 17r(u) - 6w(u). -3u - 337 Let z(r) = 24r2 - 5r - 5. Let j(u) = 13 + 36u - 168u*2 - 70u + 70u + 9 + 14. Determine 5j(v) + 36z(v). 24v2 Let l(a) = -a3 - 11a + 4. Let g(x) = x3 - x + 1. Let y be -27/18 - (-49)/(8379/(-38)). Calculate yl(b) + 2g(b). 3b3 + 9b - 2 Let a(f) = -644f2 - 54f + 4. Let b(x) = 32x - 2. Calculate -a(j) - 2b(j). 644j2 - 10j Let i = 293 + -287. Let c(j) = 4j - 5. Let z(m) = -2m + 2. Let f = 40 - 27. Give fz(t) + ic(t). -2t - 4 Let r(h) = h3 - h - 1. Let b(n) = 4n + 6. Suppose l + 5 = -2w, 3l + 51 = -2w + 32. What is wb(d) + 6r(d)? 6d*3 - 2d Let a(s) = -1390s2 + 9s - 16. Let x(q) = -1390q2 + 10q - 18. Determine 9a(m) - 8x(m). -1390m2 + m Let k(v) = -17v*2 - 131v + 12007. Let d(q) = -4q2 - 29q + 3001. Give -9d(n) + 2k(n). 2n2 - n - 2995 Let l(g) = 3g*3 + 206g*2 - 5g + 15. Let m(h) = 28h3 + 1858h*2 - 47h + 134. Calculate -19l(o) + 2m(o). -o*3 - 198o*2 + o - 17 Let w(d) = -14d*2 - 4d + 22. Let k(v) = 14v2 + 4v - 18. Let z(l) = 4k(l) + 3w(l). Let i(m) = 9m2 + 3m - 4. What is 8i(y) - 5z(y)? 2y2 + 4y - 2 Suppose 2w = -521 - 541. Let f = -532 - w. Let g(n) = -n - 1. Let u(d) = 3d*2 + 7d + 4. Determine fu(k) - 6g(k). -3k2 - k + 2 Let p(h) = -6h*3 + 3h2 + 2. Let w(j) be the third derivative of j6/24 - j5/20 - j3/3 - 8j2 - 26j. Give -6p(m) - 7w(m). m*3 + 3m2 + 2 Let p(z) = z3 + z*2. Let k(o) = -6o + 30. Let f be (-289)/(-68) - 1/4. Let i be k(f). Let a(w) = -w*3 - 2w*2. Give ip(j) + 3a(j). 3j*3 Let q(h) = -12h*3 - 5h*2 + 1075h + 5. Let f(r) = 5r3 + 2r*2 - 539r - 2. Give 5f(v) + 2q(v). v*3 - 545v Let s(n) = -8n3 + 96n*2 - 461. Let x(c) = 5c*3 - 64c*2 + 307. Calculate -7s(y) - 11x(y). y3 + 32y*2 - 150 Let s(k) = -733k*3 + 4k*2 - 4k. Let t(d) = 736d3 - 3d*2 + 3d. Calculate 3s(x) + 4t(x). 745x3 Let r(j) = -397j*3 + 17j*2 + 6j + 5. Let v(w) = -3w2 - w. Give r(k) + 6v(k). -397k3 - k2 + 5 Let z(a) = -a + 1. Let p(o) = o2 - 4o + 4. Let d(l) = l*3 + 18l*2 + 48l + 44. Let f = -146 + 131. Let v be d(f). Give vp(j) + 3z(j). -j*2 + j - 1 Let i(f) = 2382f - 3f2 + f3 + 2352f - 5 - 2f2 - 4713f. Let m(z) = z*3 - 7z*2 + 31z - 7. Determine 7i(v) - 5m(v). 2v3 - 8v Let a(b) = 10b3 + 60b*2 + 11b - 6. Let n(r) be the second derivative of r5/10 + r4 + r3/3 - r2/2 - 12584r. Calculate -2a(p) + 11n(p). 2p*3 + 12p*2 + 1 Let f(t) be the first derivative of -2t3/3 - t2/2 - 4t - 3802. Let d(j) = -6j*2 - 3j - 11. Determine -6d(y) + 17f(y). 2y2 + y - 2 Let t(o) = -5 - 223o*2 + 106o*2 + 106o*2. Let k(d) = 4d*2 + 2. Let b = -17 - -24. Let p be (-57)/(-21) + 2/b. Calculate pt(y) + 8k(y). -y2 + 1 Let p(v) = -v2 - 6v + 1. Let x(k) = -146k - 30. Let d(a) = 53a + 11. Let j(f) = 11d(f) + 4x(f). What is 2j(i) - 2p(i)? 2i2 + 10i Let j(a) = -12a2 - 3a + 1. Let z(y) = -71y2 - 497y - 5. Determine 6j(d) - z(d). -d2 + 479d + 11 Let l(q) = q. Let b(v) = 149v - 2. Let g(t) = -258t + 3. Let x(k) = 7b(k) + 4g(k). Calculate -2l(o) + x(o). 9o - 2 Let u(h) = 3h - 14h + 2h + 4h*2 + 1478 - 1479 + 0h. Let m(t) = 2t2 - 5t. Give -5m(g) + 2u(g). -2g2 + 7g - 2 Let q(x) = -160x2 - 76x - 10. Let l(z) = -160z2 - 54z - 8. What is -5l(a) + 4q(a)? 160a2 - 34a Let w(p) = -33330p2 - 605p - 121. Let x(z) = 1111z2 + 20z + 4. Determine 4w(d) + 121x(d). 1111d2 Let l(b) = -3b - 4. Let z(n) = -n3 + n2 + n + 6. Let a be z(2). Let y(q) = q - 2q - 5 - aq + 3q - q. Let r = -5 - -9. Calculate ry(i) - 5l(i). 3i Let o(d) = 674d3 - 6d*2 + 11d + 18. Let u(m) = 674m3 - 5m*2 + 9m + 15. Determine -5o(f) + 6u(f). 674f3 - f Let o(c) = 326c*2 + 80c. Let s(w) = 163w2 + 48w. Calculate -6o(h) + 10s(h). -326h2 Let h(j) = -6j - 2. Let l(g) = g. Give 2h(u) + 6l(u). -6u - 4 Let n(w) = 54w - 49. Let l(y) = -55y + 35. Calculate -3l(s) - 2n(s). 57s - 7 Let k(i) = 14i3 - 8i - 8. Suppose -451 = -34t + 195. Suppose -3f - b = 14, -4b = 6f - 9f - t. Let w(s) = 9s*3 - 5s - 5. Calculate fk(g) + 8w(g). 2g3 Let w(s) = -2953s*2 - 18s. Let m(d) = 1160530d2 + 7080d. Determine -9m(v) - 3540w(v). 8850v2 Let a be (-36)/1060/(-54). Let x(i) = -28i2 - 2. Let k(r) = 27r*2 + 2. Determine ak(v) + 5x(v). -32v*2 - 2 Let z(u) = 6u*2 + 4u + 1. Let g = 3167 - 3162. Let l(n) = -5n2 - 3n - 1. Give gl(s) + 4z(s). -s*2 + s - 1 Let y(q) = -18023q + 2. Let x(w) = -36082w + 5. Determine -2x(s) + 5y(s). -17951s Let p(k) be the first derivative of 15k2/2 + 33k + 24738. Let m(b) = 0b - 2 - b + 0. Calculate -99m(t) - 6p(t). 9t Let j(h) = h*2 + 3h - 24. Suppose 6a = -4a - 60. Let k be j(a). Let w(q) = -8q - 6. Let x(y) = -7y - 5. Calculate kx(v) + 5w(v). 2v Let t(k) = -7k*3 + 8k*2 - 3k. Suppose -40v = -46v - 18. Let r(s) = -s2 + s2 + s*3 + s - 3s2 + s3. Determine vt(h) - 8r(h). 5h3 + h Let c(l) = l3 - 6l*2 + 9l - 7. Let i = -78 - -81. Let a be c(i). Let j(n) = 3n - 1. Let v(g) = -9g + 4. What is aj(m) - 2v(m)? -3m - 1 Let y = -12 + 25. Let j(n) = 15n*2 - 15n. Let m(c) be the first derivative of 7/2c2 - 7/3c*3 + 0c + 4. Give ym(f) + 6j(f). -f*2 + f Let v(n) = 147n - 1319. Let q be v(9). Let k(b) = -b3 - b2 - 1. Let f(h) = -3h3 - 23h*2 - 4. What is qk(m) - f(m)? -m*3 + 19m*2 Let g(j) = -9j*3 - 4j*2 + 4j - 4. Let z(r) = -143r3 - 65r*2 + 65r - 65. Let o be ((-18)/(-24))/((-96)/(-512)). What is oz(m) - 65g(m)? 13m3 Let c(j) = -36j*2 + 1122j - 59. Let n(o) = 5o2 - 160o + 8. Determine 2c(p) + 15n(p). 3p2 - 156p + 2 Let l(v) = 5v - 5. Let a(y) = -9y + 9. Suppose -3g + 373 = -173. Let b = -175 + g. Give bl(r) + 4a(r). -r + 1 Let x(j) = -j2 + j + 1. Let z(p) = 6p*2 - 5p - 5. Let c(y) = y*3 + 8y*2 - 5y - 1. Let w be c(-7). Let v = w - 81. Give vz(i) + 10x(i). 2i2 Let b(f) = -31f*2 - 78f + 41. Let d(r) = -17r2 - 39r + 23. Give 6b(n) - 11d(n). n*2 - 39n - 7 Let a = -5 + 54. Suppose -5x + 34 = a. Let o(t) = 6t*2 + 2t + 3. Let n(f) = 7f2 + 3f + 4. Give xo(l) + 2n(l). -4l2 - 1 Let d(y) = 6y + 1. Let o(r) = -9r - 4. Let w(g) = 19g + 9. Let b(n) = 7o(n) + 3w(n). Let c be 78/1131 - (-1 + (-354)/(-87)). Calcul	{ "pile_set_name": "DM Mathematics" }
illilitres are there in 440.22l? 440220 Convert 9.957416kg to micrograms. 9957416000 What is 25588.41kg in tonnes? 25.58841 What is 0.2036911 millilitres in litres? 0.0002036911 How many milligrams are there in 1/10 of a kilogram? 100000 How many micrometers are there in 21/8 of a millimeter? 2625 How many millilitres are there in 11/4 of a litre? 2750 How many centimeters are there in 256.4794m? 25647.94 How many hours are there in two sevenths of a week? 48 What is 0.7166815 micrometers in nanometers? 716.6815 How many millilitres are there in six fifths of a litre? 1200 How many millilitres are there in fifteen quarters of a litre? 3750 How many centuries are there in 2470.131 decades? 247.0131 How many weeks are there in 46462.871 days? 6637.553 How many months are there in 7/4 of a year? 21 How many kilometers are there in 0.585518 centimeters? 0.00000585518 How many micrometers are there in eleven halves of a centimeter? 55000 Convert 7.433415 nanograms to kilograms. 0.000000000007433415 How many millilitres are there in 393.5707 litres? 393570.7 How many nanograms are there in fifty-two fifths of a microgram? 10400 How many months are there in 13/5 of a century? 3120 How many micrograms are there in 18/5 of a milligram? 3600 Convert 0.409273 litres to millilitres. 409.273 How many hours are there in three sevenths of a week? 72 How many nanoseconds are there in 3/8 of a microsecond? 375 How many millilitres are there in 0.8121657 litres? 812.1657 What is 7/4 of a litre in millilitres? 1750 How many kilograms are there in three tenths of a tonne? 300 What is 1703404.8 microseconds in minutes? 0.02839008 What is seventeen halves of a kilometer in meters? 8500 What is fourty-three halves of a decade in months? 2580 How many meters are there in 3/40 of a kilometer? 75 What is twenty-five quarters of a century in years? 625 What is 1/10 of a kilogram in grams? 100 What is 42/5 of a millennium in decades? 840 How many millilitres are there in one fifth of a litre? 200 What is 3/25 of a microgram in nanograms? 120 What is fourty-nine fifths of a millennium in decades? 980 Convert 388457.1 microseconds to hours. 0.00010790475 How many seconds are there in 4/3 of a minute? 80 How many millilitres are there in seventeen halves of a litre? 8500 What is one tenth of a centimeter in micrometers? 1000 What is 13/5 of a millennium in centuries? 26 What is 3/5 of a litre in millilitres? 600 How many nanometers are there in 536.3359mm? 536335900 How many micrometers are there in 266.416 centimeters? 2664160 How many kilometers are there in 4438.113nm? 0.000000004438113 What is 15/4 of a kilogram in grams? 3750 How many millilitres are there in eleven quarters of a litre? 2750 How many nanometers are there in 3/8 of a micrometer? 375 How many litres are there in 58610.3 millilitres? 58.6103 What is 3/8 of a microsecond in nanoseconds? 375 What is twenty-seven fifths of a meter in centimeters? 540 How many millilitres are there in three tenths of a litre? 300 What is 105.67932 months in years? 8.80661 What is 3/5 of a centimeter in millimeters? 6 What is 7/6 of a minute in seconds? 70 How many centuries are there in 39480.16 millennia? 394801.6 What is 23599.4um in centimeters? 2.35994 How many micrometers are there in 868.746 centimeters? 8687460 What is 17/2 of a week in minutes? 85680 What is 459.1676 millilitres in litres? 0.4591676 How many seconds are there in 1/45 of a hour? 80 What is 13/5 of a centimeter in micrometers? 26000 What is sixty-one quarters of a kilometer in meters? 15250 What is thirteen eighths of a microgram in nanograms? 1625 How many milligrams are there in 1.589282 grams? 1589.282 What is 2/7 of a week in hours? 48 How many micrometers are there in 201.72 millimeters? 201720 How many micrometers are there in three fifths of a centimeter? 6000 How many kilometers are there in 8955.53 nanometers? 0.00000000895553 What is 17/2 of a litre in millilitres? 8500 How many millilitres are there in 3/5 of a litre? 600 What is six fifths of a microsecond in nanoseconds? 1200 What is twenty-seven fifths of a litre in millilitres? 5400 How many centimeters are there in 6/25 of a meter? 24 Convert 0.40675 millennia to decades. 40.675 What is twenty-one halves of a kilogram in grams? 10500 How many millilitres are there in 11/8 of a litre? 1375 What is 45/8 of a kilometer in meters? 5625 What is 809.9655ms in nanoseconds? 809965500 Convert 0.8361072 grams to milligrams. 836.1072 How many centimeters are there in 193.1983 millimeters? 19.31983 Convert 130.2699ns to minutes. 0.000000002171165 How many grams are there in 3/10 of a kilogram? 300 How many nanograms are there in twenty-seven fifths of a microgram? 5400 How many months are there in 7/2 of a year? 42 What is 654.229g in tonnes? 0.000654229 Convert 54027.04l to millilitres. 54027040 How many years are there in seventy-three quarters of a century? 1825 Convert 681.4221 millennia to years. 681422.1 Convert 5.903204um to millimeters. 0.005903204 What is seven quarters of a microsecond in nanoseconds? 1750 Convert 13688.991ns to minutes. 0.00000022814985 What is 5/4 of a litre in millilitres? 1250 How many micrograms are there in eleven halves of a milligram? 5500 How many months are there in 37/5 of a millennium? 88800 What is 3/50 of a meter in micrometers? 60000 What is three fifths of a milligram in micrograms? 600 Convert 591657.1 centimeters to meters. 5916.571 How many seconds are there in 21/4 of a hour? 18900 How many decades are there in 55.17576 years? 5.517576 How many meters are there in 0.5123125nm? 0.0000000005123125 What is 13/5 of a milligram in micrograms? 2600 What is 5.406518g in milligrams? 5406.518 How many nanometers are there in one quarter of a micrometer? 250 What is 12.00055us in milliseconds? 0.01200055 Convert 1917.94 decades to years. 19179.4 How many micrometers are there in 74.20919mm? 74209.19 What is 2/15 of a millennium in months? 1600 What is 51.67311l in millilitres? 51673.11 How many millimeters are there in 25/8 of a meter? 3125 How many minutes are there in 13/4 of a week? 32760 What is 14.780313 months in millennia? 0.00123169275 How many millilitres are there in 0.2711397l? 271.1397 What is 1/16 of a kilometer in centimeters? 6250 How many millilitres are there in 1/4 of a litre? 250 What is six fifths of a micrometer in nanometers? 1200 How many kilograms are there in five quarters of a tonne? 1250 What is 3/50 of a litre in millilitres? 60 What is 148.34547 months in years? 12.3621225 How many millilitres are there in 1.938464l? 1938.464 How many grams are there in one tenth of a tonne? 100000 What is 6/25 of a litre in millilitres? 240 What is 1/64 of a millisecond in nanoseconds? 15625 How many months are there in 401733.2 years? 4820798.4 How many months are there in 21/4 of a century? 6300 How many decades are there in 19.457868 months? 0.1621489 How many centimeters are there in 61491.52mm? 6149.152 What is 746800.8ug in nanograms? 746800800 How many grams are there in ninety-one quarters of a kilogram? 22750 Convert 552.1249ml to litres. 0.5521249 How many millennia are there in 280.40571 months? 0.0233671425 What is 17/2 of a decade in months? 1020 What is 5/4 of a week in hours? 210 How many litres are there in 4832.746ml? 4.832746 Convert 5955.084 days to milliseconds. 514519257600 What is 587.1944 microseconds in seconds? 0.0005871944 What is one fifth of a century in months? 240 What is 1/5 of a microgram in nanograms? 200 How many litres are there in 81.8309ml? 0.0818309 What is 55/2 of a year in months? 330 What is 3/10 of a litre in millilitres? 300 What is eleven quarters of a kilometer in meters? 2750 How many weeks are there in 1591825.095ms? 0.0026319859375 How many days are there in 14664015.9 nanoseconds? 0.00000016972240625 Convert 8.806593 micrograms to grams. 0.000008806593 Convert 773.3191 nanometers to micrometers. 0.7733191 What is 3/25 of a litre in millilitres? 120 Convert 1.852706 kilometers to nanometers. 1852706000000 What is 1/20 of a decade in months? 6 What is 3/40 of a microgram in nanograms? 75 How many weeks are there in 1730474.928 seconds? 2.861235 What is 72.48813 meters in millimeters? 72488.13 What i	{ "pile_set_name": "DM Mathematics" }
36. -2(g - 603)2(g + 2) Determine h so that 4h2/7 + 68h/7 - 72/7 = 0. -18, 1 What is q in 4q5 + 292q*4 + 568q*3 - 8q*2 - 572q - 284 = 0? -71, -1, 1 Factor -11i4/2 + 13i*3/2 + 9i2. -i2(i - 2)(11i + 9)/2 Factor 2q*2 - 24q - 26. 2(q - 13)(q + 1) Solve u*2 - 11784u + 34715664 = 0. 5892 Solve 4f2 + 1512f + 3008 = 0 for f. -376, -2 Factor -11u4/3 + 35u*3/3 - 2u2. -u2(u - 3)(11u - 2)/3 Determine c, given that -6c*5 - 2558c*4 - 366324c*3 - 18014724c*2 - 56422278c - 16819326 = 0. -141, -3, -1/3 Determine y so that 4y2/3 - 68y/3 + 88 = 0. 6, 11 Factor -20f3 + 2955f*2 - 5100f - 1460. -5(f - 146)(f - 2)(4f + 1) Let l*4/7 + 10l*3/7 + 4l*2/7 - 6l + 27/7 = 0. Calculate l. -9, -3, 1 Let -2n5 + 30n*4 - 130n*3 + 130n*2 + 132n - 160 = 0. What is n? -1, 1, 2, 5, 8 Determine v so that 3v2/7 - 3v + 18/7 = 0. 1, 6 Factor -2j2/5 - 5968j/5 - 5966/5. -2(j + 1)(j + 2983)/5 Solve -4u3/5 + 184u*2/5 = 0. 0, 46 Factor -27q*2 + 53q - 26. -(q - 1)(27q - 26) Factor -4h5 + 28h*4 - 12h*3 - 92h*2 + 128h - 48. -4(h - 6)(h - 1)*3(h + 2) Factor -10s3 + 19s*2 - 8s - 1. -(s - 1)*2(10s + 1) Factor -2f*2/5 + 16f/5 + 66/5. -2(f - 11)(f + 3)/5 Find b, given that b3/5 + b2/5 - 2b + 8/5 = 0. -4, 1, 2 Find w, given that -175w*5 - 995w*4 - 1215w*3 - 25w*2 + 490w + 120 = 0. -4, -1, -2/7, 3/5 Find i such that -2i3 - 26i*2 - 46i - 22 = 0. -11, -1 What is c in -2c2 + 160c - 3200 = 0? 40 Determine p so that 3p3/7 + 33p*2/7 + 120p/7 + 144/7 = 0. -4, -3 Determine y, given that -y*2/5 + 74y/5 + 152/5 = 0. -2, 76 Suppose 5j4 + 335j*3/3 + 1085j*2/3 - 9815j/3 - 3380/3 = 0. What is j? -13, -1/3, 4 What is u in 2u2/9 - 3662u/9 + 1220/3 = 0? 1, 1830 Solve r*4 - 11r*3 + 18r2 = 0. 0, 2, 9 Suppose b2 + 30b = 0. What is b? -30, 0 Factor -j2/2 + 3j - 4. -(j - 4)(j - 2)/2 Determine k, given that -3k*2/4 - 3k + 9 = 0. -6, 2 Suppose -4r5 - 72r*4 + 348r*3 + 5296r*2 - 35520r + 57600 = 0. What is r? -15, 4 Factor 3c3/2 - 321c*2/2 + 8745c/2 - 8427/2. 3(c - 53)2(c - 1)/2 Find w, given that w*5/2 - 25w*4/2 + 102w*3 - 344w*2 + 416w = 0. 0, 4, 13 Find g such that g*3 - 5g*2 - 2g + 24 = 0. -2, 3, 4 Let 8f3/9 - 82f*2/9 + 220f/9 - 50/9 = 0. What is f? 1/4, 5 Factor -z*2/7 - 31z/7 + 410/7. -(z - 10)(z + 41)/7 Solve u5 - 13u*4 - 2u*3 + 26u2 + u - 13 = 0 for u. -1, 1, 13 Determine d so that d2 + 15d - 34 = 0. -17, 2 Let -4v*4/5 + 148v*3/5 + 184v*2/5 - 1168v/5 - 1824/5 = 0. Calculate v. -2, 3, 38 Find j, given that 4j2 - 12j + 8 = 0. 1, 2 Find g such that 25g4 + 1615g*3 + 30150g*2 + 168980g - 72520 = 0. -37, -14, 2/5 Factor 2x5 + 7444x*4/3 + 3464560x*3/3 + 239096800x*2 + 55887916000x/3 + 36940840000/3. 2(x + 310)4(3x + 2)/3 Solve -4y*4/5 - 64y*3/5 - 164y*2/5 - 104y/5 = 0 for y. -13, -2, -1, 0 Factor 4r3/5 - 104r*2/5 + 101r/5 - 5. (r - 25)(2r - 1)*2/5 Solve -6x*2 + 69x/4 + 9/4 = 0 for x. -1/8, 3 Factor 3l2 - 7l/4. l(12l - 7)/4 Let -2y3/21 + 106y*2/21 - 194y/3 + 418/7 = 0. Calculate y. 1, 19, 33 Determine k so that -21k5/4 + 39k*4/2 - 39k*3/4 - 51k*2/2 + 15k + 6 = 0. -1, -2/7, 1, 2 Suppose 3u3 + 42u*2 + 105u + 66 = 0. Calculate u. -11, -2, -1 Factor -5w3 - 55w*2 - 40w + 100. -5(w - 1)(w + 2)(w + 10) Factor -2z*2/5 + 329z/5 + 33. -(z - 165)(2z + 1)/5 Find h, given that h*4 + 4h*3 - 27h*2 + 38h - 16 = 0. -8, 1, 2 Factor 8u3/5 - 108u*2/5 + 8u + 156/5. 4(u - 13)(u + 1)(2u - 3)/5 Find z, given that -z*3/7 + 8z*2/7 + 33z/7 = 0. -3, 0, 11 Solve 4t5/3 - 8t*4/3 - 8t*3/3 + 16t*2/3 + 4t/3 - 8/3 = 0. -1, 1, 2 Factor -4q3 + 40q*2 - 36q. -4q(q - 9)(q - 1) What is z in -3z*4/7 + 81z*3/7 - 129z*2/7 - 6885z/7 + 6936/7 = 0? -8, 1, 17 Let -o5/4 - o4/2 - o*3/4 = 0. What is o? -1, 0 Factor -20t*5 - 48t*4 - 16t*3. -4t*3(t + 2)(5t + 2) Determine u so that 5u4 + 120u*3 - 125u*2 = 0. -25, 0, 1 Factor 2d*3 + 4450d*2 + 2477536d + 2473088. 2(d + 1)(d + 1112)2 Factor -v5/5 + 3v4/5 + 4v*3/5 - 16v2/5 + 16/5. -(v - 2)3(v + 1)(v + 2)/5 Let -w*3/7 + 9w*2 + 634w/7 + 144 = 0. What is w? -7, -2, 72 Find r, given that 2r2/13 - 102r/13 - 212/13 = 0. -2, 53 Factor 6z2 + 382z - 128. 2(z + 64)(3z - 1) Factor f3/3 - 5f*2/3 + 8f/3 - 4/3. (f - 2)*2(f - 1)/3 Factor -432i3 - 603720i*2 - 281232900i - 43669219750. -2(6i + 2795)3 Determine q, given that q2/5 - 17q/5 - 18/5 = 0. -1, 18 Factor 2s*4/5 - 42s*3/5 - 192s*2/5 - 40s. 2s(s - 25)(s + 2)2/5 Let 4s*2 + 192s + 540 = 0. What is s? -45, -3 Determine j so that -7j5 - 12j*4 + 60j*3 + 110j*2 + 27j - 18 = 0. -3, -1, 2/7, 3 Factor h*3/5 - 3h*2 - 81h/5 + 19. (h - 19)(h - 1)(h + 5)/5 Determine r, given that -20r3 - 88r*2 - 124r - 56 = 0. -2, -7/5, -1 Determine j so that -2j4/13 - 2j*3/13 + 2j*2/13 + 2j/13 = 0. -1, 0, 1 Factor -2o4 - 102o*3 - 1248o*2 + 1352o. -2o(o - 1)(o + 26)2 What is d in -3d*4 - 6d*3 + 27d*2 + 6d - 24 = 0? -4, -1, 1, 2 Factor q*3/4 - 5q*2 - 119q/4 - 75/2. (q - 25)(q + 2)(q + 3)/4 Factor 2x3/3 - 4x*2 - 2x/3 + 20. 2(x - 5)(x - 3)(x + 2)/3 Factor 3n*3/2 + 69n*2/2 - 117n. 3n(n - 3)(n + 26)/2 Determine r so that -14r*4/9 - 4112r*3/9 - 1680r*2 - 11584r/9 + 4640/9 = 0. -290, -2, 2/7 Factor -2h2/9 + 26h/3 - 340/9. -2(h - 34)(h - 5)/9 Determine k so that -4k2 + 40k - 84 = 0. 3, 7 Suppose g*4 + 13g*3 + 59g*2 + 107g + 60 = 0. What is g? -5, -4, -3, -1 Factor -3f4 + 69f*3/7 - 18f*2/7. -3f*2(f - 3)(7f - 2)/7 Factor -5b3 - 70b*2 + 345b - 270. -5(b - 3)(b - 1)(b + 18) Determine h, given that -2h*4/11 + 48h*3/11 - 4h*2 - 48h/11 + 46/11 = 0. -1, 1, 23 Factor f*3 - 2f*2 - f + 2. (f - 2)(f - 1)(f + 1) Factor g2/8 - 7g/4. g(g - 14)/8 Let 2g*3/5 + 2g*2/5 - 8g/5 - 8/5 = 0. What is g? -2, -1, 2 Factor 3t4/8 + 3t*3/4 - 21t*2/8 + 3t/2. 3t(t - 1)*2(t + 4)/8 Determine h so that -14h4 - 1012h*3 - 12342h*2 - 43232h - 11368 = 0. -58, -7, -2/7 Factor -2z3/13 - 30z*2/13 - 144z/13 - 216/13. -2(z + 3)(z + 6)2/13 Let -f5/2 - 7f4/2 - 13f*3/2 + 3f*2/2 + 9f = 0. Calculate f. -3, -2, 0, 1 Solve k*3 + 26k*2/3 + 5k - 8/3 = 0 for k. -8, -1, 1/3 Factor 2t4/9 - 4t*2/9 + 2/9. 2(t - 1)*2(t + 1)*2/9 Let 5t*4 + 3155t*3 + 496120t*2 - 499280t = 0. What is t? -316, 0, 1 Factor b*2/2 - 941b + 885481/2. (b - 941)*2/2 Factor -6r*3/13 - 28r*2/13 - 16r/13. -2r(r + 4)(3r + 2)/13 Factor j*2/4 - 21j/4. j(j - 21)/4 Find k, given that 5k*4 + 120k*3 - 3030k*2 + 17920k - 30135 = 0. -41, 3, 7 Find f such that 5f2 - 20f = 0. 0, 4 Factor 2645u2/6 + 115u + 15/2. 5(23u + 3)2/6 Factor s2/3 - 83s/3 + 1720/3. (s - 43)(s - 40)/3 Factor -s*3 - 8s*2 - 13s - 6. -(s + 1)*2(s + 6) Determine u so that -6u4 - 124u*3/5 - 18u*2 + 52u/5 + 48/5 = 0. -3, -1, -4/5, 2/3 Determine j, given that 2j4/3 - 40j*3/3 + 200j2/3 = 0. 0, 10 Factor -a3/5 + a*2 - 7a/5 + 3/5. -(a - 3)(a - 1)2/5 Determine g so that 3g*5/5 - 93g*3/5 + 318g*2/5 - 396g/5 + 168/5 = 0. -7, 1, 2 Factor 3b3 + 114b*2 - 1617b. 3b(b - 11)(b + 49) Factor -4l*3 - 36l*2 + 84l - 44. -4(l - 1)2(l + 11) Determine r, given that r*5 - 7r*3 - 2r*2 + 12r + 8 = 0. -2, -1, 2 Let 3i5 + 9i*4 - 27i*3 - 69i*2 + 72i + 108 = 0. What is i? -3, -1, 2 Factor 3g4 - 42g*3 + 180g*2 - 246g + 105. 3(g - 7)(g - 5)(g - 1)2 Determine p, given that p3 + 18p*2 + 96p + 128 = 0. -8, -2 Let 8h2/11 + 18h/11 - 18/11 = 0. What is h? -3, 3/4 Solve -4s3 - 56s*2 + 1356s - 1296 = 0 for s. -27, 1, 12 Determine d, given that -3d4/7 - 30d*3/7 - 69d*2/7 + 30d/7 + 72/7 = 0. -6, -4, -1, 1 Let -4j4 - 48j*3 - 140j*2 + 48j + 144 = 0. What is j? -6, -1, 1 Solve 3l5/4 - 4233l*4/2 - 33897l*3/4 - 10596l*2 - 4239l = 0. -2, -1, 0, 2826 Factor -5k2 - 35k + 150. -5(k - 3)(k + 10) Factor -3f4 + 12f*3 + 63f*2. -3f*2(f - 7)(f + 3) Factor 2l**	{ "pile_set_name": "DM Mathematics" }
+ 718 What is the second derivative of 11p5 - 112p*3 - 13p*2 - 365p + 505? 220p3 - 672p - 26 What is the third derivative of -79m3z*4 + 91549m*3z + 1241mz*5 + mz*2 wrt z? -1896m*3z + 74460mz*2 What is the first derivative of 842053fj - 850997f wrt j? 842053f What is the third derivative of -28470t*3z - t*2 + 14637t + z wrt t? -170820z Differentiate -5b*3 + 53b*2cv + 16bc - 1926cv + 15c with respect to b. -15b2 + 106bcv + 16c Differentiate 107b*4 - 6b*3 - 7b - 29456 with respect to b. 428b3 - 18b*2 - 7 Find the second derivative of -847627r*3 - 31421r. -5085762r Find the second derivative of -4416823j*5 - 2489192j wrt j. -88336460j3 Find the second derivative of -2501bl3y*2 - bl*3 - 42bl2y*2 - 24bly + 6bl - 3l3y - 27l wrt y. -5002bl3 - 84bl2 What is the second derivative of -3a*2b*3 + 176a*2b*2 - 2a*2b + 32a2 - 4a + 27332b3 wrt a? -6b*3 + 352b*2 - 4b + 64 Find the second derivative of 105956b2 - 389711b wrt b. 211912 Find the first derivative of -290538u + 87768. -290538 Find the second derivative of 137j*4 + 3j*3 - 24j*2 + 2869j + 217 wrt j. 1644j2 + 18j - 48 What is the first derivative of -3f3 - 43493f - 118000? -9f2 - 43493 What is the derivative of 22792nv - 4n - 191461v wrt n? 22792v - 4 What is the derivative of -2087q2 + 6q + 9798 wrt q? -4174q + 6 What is the third derivative of 15740n*4 + 2069n*2 - 8? 377760n Find the third derivative of 318741u4 + 14069u*2. 7649784u Find the third derivative of -2kt*4 - 540k - 1199t4 + 13t*2 wrt t. -48kt - 28776t Find the second derivative of -5b4f - 40b3l - b*2fl + 7bf + 2b + 11f + 15l - 1 wrt b. -60b2f - 240bl - 2fl Find the second derivative of -54g3 + 325g*2 + 38351g + 1. -324g + 650 Differentiate i4 - 2i*3y - 4062i + 4385y + 2 wrt i. 4i3 - 6i*2y - 4062 What is the second derivative of -55b4 - 136b*3 - 3b*2 + 7b - 25846? -660b2 - 816b - 6 What is the second derivative of -38gm*2p*2 - 69gm2 + 2gmp - g - 2m2p*3 + 7m*2p - 2p2 wrt p? -76gm2 - 12m*2p - 4 Find the first derivative of -6135125fs - 5779769s wrt f. -6135125s Find the second derivative of -159pu*2 + 117pu + 5p - 22u2 + 13u wrt u. -318p - 44 What is the second derivative of 2c*2i*2 - 10c*2i - 307c + 4189i*5 wrt i? 4c*2 + 83780i*3 Find the third derivative of 100hnu*5 - 2hu + 1070nu3 - 75725nu2 + 2n wrt u. 6000hnu2 + 6420n What is the first derivative of 15133f4 + 20f3 + f2 + 4153388 wrt f? 60532f3 + 60f*2 + 2f Differentiate -50846cl*2 + 46998l*2 with respect to c. -50846l*2 Find the first derivative of -27agi + 4ag - 40518ai*2 - 2ai + gi*2 + 2045gi wrt g. -27ai + 4a + i*2 + 2045i What is the first derivative of 159h3 - 1646h*2 + 575185? 477h*2 - 3292h Find the second derivative of -16p5u - 39p3 + 12p*2u + 2pu + 3p - 244u - 10 wrt p. -320p3u - 234p + 24u Differentiate 65037ac*3s*2 - 2acs*3 + 3c*3s*3 - 4c*3s*2 - 25cs3 - 54cs wrt a. 65037c*3s*2 - 2cs3 What is the second derivative of -1410551i*2l - i*2 + 857il + 46l + 2 wrt i? -2821102l - 2 Find the second derivative of -294479u*5 - 19u - 8369 wrt u. -5889580u3 Find the second derivative of -120876j*4 - 2j*3x - 11263jx + x wrt j. -1450512j2 - 12jx Find the second derivative of -57260g*3 + 2604g + 3. -343560g What is the first derivative of -1962q - 9346? -1962 Find the second derivative of -4m3q*5 - 7724m*3q*2 - 5m*3q + 4756m3 wrt q. -80m*3q*3 - 15448m*3 What is the derivative of -2bv3w + 2bv*3 - 50634b - 102v3w + 99w wrt w? -2bv3 - 102v*3 + 99 Find the third derivative of 13s*3vw3 + 2013s*3vw2 + 2s*2w*3 + 2s*2w + 680svw3 + vw*3 wrt s. 78vw3 + 12078vw2 Find the second derivative of 691x*4 - 3x*3 + 2940x - 2. 8292x2 - 18x Find the second derivative of 76071m2o*3 + 2mo3 - 2mo2 + m - 190o*3 - 1 wrt m. 152142o*3 Find the first derivative of 624h*4 - 2h*3 + 7h*2 - 43h + 1927866. 2496h3 - 6h*2 + 14h - 43 Find the third derivative of -22nq*6 + 4354nq3 + 268405nq2 wrt q. -2640nq3 + 26124n Find the third derivative of 19788o3q*2 + 5o*2q*2 + 79oq2 + 2oq + 3q*2 wrt o. 118728q*2 Differentiate -146880nr - 4138n - 7 with respect to r. -146880n What is the third derivative of -r6 - 1700818r*3 + 2r*2 + 2r + 1913205 wrt r? -120r3 - 10204908 Find the first derivative of -31444gl - gz - 16lz*2 - 114734z*2 wrt l. -31444g - 16z2 Find the third derivative of 61098w*3 - 3w*2 + 13w + 110 wrt w. 366588 Differentiate -6a3 + 59a*2 + 11a - 232619 wrt a. -18a2 + 118a + 11 Find the third derivative of -3055g3z*2 - 17g*3 + 5g*2z2 + g2z + 1789z wrt g. -18330z2 - 102 What is the first derivative of 18339ir - 13468i + r*2 + 2r wrt r? 18339i + 2r + 2 Differentiate -8003t3u*3 - 7t*3u - 2u3 - 39u + 62 with respect to t. -24009t2u*3 - 21t*2u What is the second derivative of 31lv*4 - 163lv3 + 4l - 2v2 + 4633v wrt v? 372lv*2 - 978lv - 4 What is the derivative of 114x*4 + 2x*3 + 51x*2 + 1800804? 456x*3 + 6x*2 + 102x Find the second derivative of 3264876z5 - 12z - 52169 wrt z. 65297520z3 Find the third derivative of 2d*4 - 25249d*3 - 94004d*2. 48d - 151494 Find the second derivative of 76q3y*3 + 146q3 - q2y2 - 9qy3 + 144y*3 + 9 wrt q. 456qy3 + 876q - 2y2 What is the second derivative of 325825x*2 + 19x + 539? 651650 What is the second derivative of -2l2n*2 + 26502l*2 - 2ln2 + 109n*2 + 18n + 1 wrt l? -4n2 + 53004 What is the third derivative of 3022k*2tx3 - 2k*2tx2 + 2k*2x*2 + 9ktx*3 - 2ktx + 29792x wrt x? 18132k*2t + 54kt Find the second derivative of -117965s2 - 232299s. -235930 Find the second derivative of 3966684w2 + 2290231w wrt w. 7933368 What is the first derivative of -1038c2 + 10c + 19863 wrt c? -2076c + 10 Find the first derivative of -11m*3s + 3417m2s + 601875s wrt m. -33m*2s + 6834ms Find the third derivative of -48s6 + 5s*3 + 26939s*2 wrt s. -5760s*3 + 30 Differentiate -2iv3 + 46308i + 1768429v3 - 1 with respect to v. -6iv2 + 5305287v*2 What is the second derivative of -22164y*3 + 47009y? -132984y What is the third derivative of 40535d*3h*2 + 8d*3 + 47d*2h*2 - 3d*2h + 6h2 wrt d? 243210h*2 + 48 Find the third derivative of -423711g*3 - 2g*2 - 22g + 3155. -2542266 Find the second derivative of -179264h3 - 32h + 3344. -1075584h Differentiate 14o*2 + 419o + 2193 wrt o. 28o + 419 Find the second derivative of 30005a*2 - 35741a - 1 wrt a. 60010 Find the third derivative of -k*5 - 53493k*4 + 2k*3 - 244471k*2 wrt k. -60k*2 - 1283832k + 12 Differentiate 34p2z + 4p2 + 3p + 17z + 716 wrt z. 34p*2 + 17 Differentiate 734036m*2 - 186313. 1468072m Find the second derivative of 7l3 - 76208l*2 + 2287385l. 42l - 152416 Find the first derivative of -1192091b - 762982. -1192091 Find the second derivative of 3552604z4 + 257z + 4154. 42631248z2 Find the first derivative of 215356m + 16443. 215356 Find the third derivative of -73616n3 - 13n*2 - 2085n + 2 wrt n. -441696 Differentiate -2fk - 2159117f + 4340719k with respect to f. -2k - 2159117 Differentiate -8my2 + 36my + 3274m - 1348y - 649 wrt y. -16my + 36m - 1348 Find the first derivative of -35750g - 561 wrt g. -35750 What is the third derivative of 484910v*3 - 916v*2 + v - 139 wrt v? 2909460 What is the second derivative of 99885y*2 + 3139577y - 2? 199770 What is the third derivative of -4cd*3k - 2cd*2k + 18ck + 498d3k - dk wrt d? -24ck + 2988k What is the first derivative of 2x4 - 14x*2 + 216x - 61048? 8x3 - 28x + 216 What is the derivative of -4365064s4 + 3429148 wrt s? -17460256s**3 What is the second	{ "pile_set_name": "DM Mathematics" }
minator of l and -44/9. 9 Let j be (2 - -18)(-24)/10. Let o be j/(-27) - (-6)/27. Let w = 10 - o. Calculate the least common multiple of w and 8. 8 Let y be 7/(-1)(-1 + 2). Calculate the common denominator of 2/56461 + 44/154 and (-2)/y - 24. 28 Suppose 4i - 135 = -i. What is the least common multiple of i and 63? 189 Let s = 135/4 - 1049/28. What is the common denominator of s and -3/19? 133 Suppose 5b = b + 68. Let j be -1 + 4 - (1 + 0). Suppose jr + 1 - b = -3d, 3d = 3r - 9. Calculate the least common multiple of 8 and d. 8 Let c(d) = d*3 - 12d*2 + 11d + 4. Let v be c(11). Suppose 0 = vt - 4w - 80, 2t + t = -5w + 28. What is the least common multiple of t and 20? 80 Let r = -112/11 - -973/88. Let i(n) = -1462n2 - n + 1. Let o be i(-2). Let v = 52678/9 + o. Calculate the common denominator of v and r. 72 Let z = 560 + -4547/8. What is the common denominator of 27/16 and z? 16 Let r(f) = 15f3 - f2. Let h be r(1). Calculate the common denominator of (-65)/(-40)(-14)/(-4) and 61/h - 1 - -1. 112 Let m = -40 - 30. Calculate the smallest common multiple of ((-96)/(-60))/((-4)/m) and 12. 84 What is the common denominator of -5/8 and 8/12 - (-145)/10? 24 Let a = -9 + 14. Let y = a - 4. Calculate the least common multiple of y and 9. 9 Let p be (-7371318)/660 - 1/5. Suppose n + 0t + 11181 = -5t, 33492 = -3n + 2t. Let q = n - p. Calculate the common denominator of 139/6 and q. 66 Let q = 130765/14 + -9336. What is the common denominator of q and 61/8? 56 Let u be ((-3068)/(-10))/(6/20). Let h = u - 67223/66. Calculate the common denominator of h and 101/2. 22 What is the common denominator of (-3 + 24/16)/(72/122) and -31/28? 168 Suppose 13 - 2 = f. What is the least common multiple of f and 27? 297 Suppose 0 = -z - 2s + 22, z + 5s = 2s + 25. What is the least common multiple of z and 8? 16 Let t(s) = -3s - 2. Let v be t(-2). Calculate the common denominator of -77/18 and ((-8)/v)/(8/30). 18 Suppose -3p = 15 - 39. Calculate the lowest common multiple of 2 and p. 8 Let q = -7370 - -58881/8. Let i = 43 + -177. Calculate the common denominator of q and i/(-110) + (-4)/10. 88 Let b = -1/2081 - 20801/18729. Let a = 132 - 605. Let i = 1444/3 + a. Calculate the common denominator of b and i. 9 What is the common denominator of -25/3 and 1-1 - (-1003)/(-34)? 6 Let s = 51 - 21. Calculate the least common multiple of s and 2. 30 Let l(z) = z3 + 2. Let p be l(0). Suppose pr + 0r = -4. Find the common denominator of ((-63)/33)/((-3)/r) and -38/9. 99 What is the common denominator of -3 + (3 - (-51)/66) and 145/12? 132 Let x(z) be the third derivative of -z4/8 - z3/3 + 2z2. What is the smallest common multiple of 4 and x(-4)? 20 What is the common denominator of (-1)/(-4) + (-142)/(-56) and (978/(-72) - -6) + 2? 84 Let x = 8862 - 177337/20. What is the common denominator of x and 8/5? 20 Find the common denominator of 269/(-24) - (-2)/6 and -119/6. 24 Let a(g) = g2 - 6 - 2g2 - 6g + 0g. Let o be 6 + 15/(-5) - 7. Calculate the least common multiple of a(o) and 2. 2 Let v = -910859/180380 - 3/9019. What is the common denominator of v and -85/2? 20 Let d(c) = 4c - 1. Let y be d(2). Let q(u) = 2u + 1. Let o be q(y). Suppose -3a = -42 + o. What is the lowest common multiple of a and 8? 72 Let u(q) = 3q. Calculate the lowest common multiple of u(2) and 10. 30 What is the common denominator of 31/(-48)3 and ((-101)/4)/(-1 + 3)? 16 Let b(u) = -u2 - 7u - 6. Let i be b(-4). Let z = 8 - i. Calculate the smallest common multiple of 10 and z. 10 Suppose -5f = -2f - 48. Calculate the lowest common multiple of f and 52. 208 Let r = 424288490/58497 + 1/116994. Let w = r - 7237. Calculate the common denominator of w and 35/6. 6 Let l = 49/40 + -2549/840. What is the common denominator of l and -16/9? 63 Find the common denominator of (2/(-18))/((-34)/(-5559)) and -36/19. 114 Suppose 0 = -4b + 5g + 35, -21 = -2b - 4g + 3g. Calculate the lowest common multiple of 38 and b. 190 Let b = 809/5 - 163. Let w = -11676/5 - -2344. Find the common denominator of b and w. 5 Let p(z) = -3z*2 + 4. Let r be p(7). Suppose j = 4j - 12. Calculate the smallest common multiple of j and r/(-55) - (-6)/(-10). 4 Let f(b) = -b + 5. Calculate the smallest common multiple of 2/(-7) - (-88)/14 and f(3). 6 Let l(o) = 6o2 - 3o - 3. Let f be l(5). Suppose g = 5g - f. Find the common denominator of g and 69/8. 8 Let b(y) = 2y - 8y + 1 + 3 + y2. Let g be b(4). Find the common denominator of (-6)/40(-130)/g and -131/6. 24 Suppose -2f - 4w = w - 3, -f - 2w = -1. Let n = 1809/110 + -102/5. Calculate the common denominator of n and (f/(-2))/(12/76). 66 Suppose -2k = -k - 2. Let s = 11 - k. What is the smallest common multiple of 4 and s? 36 Suppose 3o + 2 = 14. Let m = -113357/22 - -5154. Find the common denominator of m and 1445/(-50) - o/(-10). 22 Let o be (1/1)/((-1)/(-5)). Let v(f) = f3 - 4f*2 - 2f - 5. Suppose 2k + 4 = 4k + z, -4z = 0. What is the smallest common multiple of v(o) and k? 10 Let j = -1756 + 10451/6. Let z = -516351 - -21685583/42. Let r = z + 77/3. Calculate the common denominator of r and j. 42 Let n = -2/3631 - 236011/7262. Find the common denominator of n and -89/16. 16 Let v(h) = -6h*2 + h. Let q be v(3). What is the common denominator of q/(-21)(-1 - -3) and 71/10? 70 Calculate the least common multiple of (-2)/(-14) + 110/14 and 20. 40 Suppose 0 = 4h - 2h - 12. Suppose -2q = -hq + 28. Let a = q + -2. What is the least common multiple of 2 and a? 10 Let w = -50679/8 + 6346. Find the common denominator of w and -89/16. 16 Let w = -93479/10 - -9359. Let g(z) = -721z2 - 2z - 2. Let p be g(-2). Let m = p - -25978/9. Calculate the common denominator of w and m. 90 Find the common denominator of 2 + -1 - 51/(-30) and 8/(-12)-3 + 114/4. 10 Suppose 0 = d - 5w + 5, -w + 1 = -2. Suppose -f = 5t - 103, 4t - 85 = -t + 5f. What is the least common multiple of d and (56/t)/((-2)/(-10))? 70 Suppose -4v - 5 = -13. What is the common denominator of 67/4 and (-11)/(-4) + v/4? 4 Let w = 11 + 0. Let u be 0 - 2 - 12/(-3). Suppose -m + u = m. Calculate the smallest common multiple of m and w. 11 Suppose -390 = 5p - 3g, 2p + g = 5p + 238. What is the common denominator of ((-10)/210)/((-2)/p) and -37/4? 28 Let u = 2 - 0. Calculate the least common multiple of u and 16. 16 Let i = -10086 + 272354/27. Calculate the common denominator of 47/3 and i. 27 Let r(c) = -c*3 - 6c*2 + 1. Let j be r(-5). What is the common denominator of (2/j)/(5/790) and -149/6? 6 Let s = -548039/120571 - 1/10961. Let q = -44346361/63940 + 63483/92. Let y = -18/139 - q. What is the common denominator of s and y? 55 Suppose -3s = 3i - 30, 3s - 8 = i + 18. Calculate the lowest common multiple of s and 9. 9 Let s = 57193376600775740309459/18165 - 3148548122638666799. Let c = -2584951389 - s. Let z = c - -5/2422. Calculate the common denominator of z and -95/18. 90 Let x = 9 - 6. Suppose xj = -62 + 197. Find the common denominator of -79/18 and j/(-24) - (-1)/(-2). 72 Find the common denominator of 2/12 + (-1685)/300 and 99/8. 40 Let j be (2 - (-96)/(-9))3. Let c = 36 + j. Suppose 0 = -4r - 0v + 3v + 27, -v - 1 = 0. What is the lowest common multiple of c and r? 30 Let x(d) = 4d*3 - 3d*2 - 3d. Let n be x(-3). Find the common denominator of 15/12n/20 and -53/22. 88 Let b(v) = -2 - 3v*2 - 2v + 4v3 - 4v*3 - 3v*3 + 1. What is the least common multiple of 7 and b(-2)? 105 Suppose -3g + 5 = -4. Suppose 3m + 35 + 34 = -go, -4m = -8. Let n = 41 + o. Calculate the smallest common multiple of n and 22. 176 Suppose 5g + 24 = 74. Suppose -2k = 6, o - 5k = -4k + 12. What is the smallest common multiple of g and o? 90 Calculate the common denominator of -89/8 and (-43)/((-605)/(-35) - (-2)/(-7)). 136 Let c = -133 + 148. Calculate the smallest common multiple of c and 27. 135 Suppose -13 = 4v - 53. Let a be (1 - 1)1 - 0. Let g = 6 + a. Calculate the smallest common multiple of g and v. 30 Let c(y) = -y3 + 6y*2 + 7y + 2. Let w be c(7). What is the lowest common multiple of 14 and w/(-1 - (-12)/11)? 154 Let v = 9 - 1. Calculate the smallest common multiple of 8 and v. 8 Suppose -55381 = -5*m - 9986. S	{ "pile_set_name": "DM Mathematics" }
arest to g? (a) h (b) 2/13 (c) -2/5 a Let r(f) = f*2 - 18f + 37. Let q be r(16). Which is the closest to 0.2? (a) 1/6 (b) -2 (c) q a Let g(v) = v*3 + 4v*2 - 5v + 5. Let q be g(-5). What is the closest to -1/4 in 2, q, -4? 2 Let d be 1(-10)/(-8)16/(-12). Which is the nearest to 2.3? (a) d (b) -3/5 (c) -0.2 c Let s = 7 - 11. What is the nearest to -1/4 in -0.3, -0.04, s? -0.3 Let v be (-4)/124/6. What is the nearest to -7 in 1/6, v, -0.5? -0.5 Let k = -4.2 + 2.9. Let h = k + 1. What is the closest to -1/2 in 0, h, -0.1? h Suppose -3u - 2p + 10 = 0, -u - p = -6p + 25. Suppose 3c + y - 1 = -uy, 5c - 3y = 25. Let i = 13 - 18. What is the nearest to -0.2 in 3, i, c? c Suppose u + u = 2m + 4, 5m - 2 = -u. Which is the closest to 11? (a) -2 (b) u (c) -0.2 b Let x = 1.79 + 0.21. Which is the closest to x? (a) -3 (b) -0.4 (c) -2/11 c Let f = 33 + -32. Which is the nearest to 2/3? (a) -0.2 (b) f (c) -5 b Let p(z) = 4z2 + 10z + 8. Let x be p(-6). Suppose 4o - x = -0o. Let u be (-2)/3 + o/12. What is the closest to 2/5 in 1, u, 5? 1 Suppose 0 = 2s + 10, 2z = -4s - 8 - 6. Let k = 7.3 - 7. Which is the closest to 0.1? (a) -5 (b) k (c) z b Let s = -63.9 + 58. Let d = s + 0.9. Let z = d + 2. Which is the nearest to -1? (a) -2/9 (b) 1/4 (c) z a Let q = 3 - 4. Let n = 2.7 + -3. Let v = 0.3 + n. Which is the closest to v? (a) q (b) -0.4 (c) 0.5 b Let o = 0.2 + -13.2. Let k = -19 - o. Let y = k - -3. Which is the nearest to -1? (a) y (b) -2/5 (c) 3 b Let n be (-4)/((-24)/(-10)) - (-2 + 1). Let h be 31/9 - (3 - 2). Let o = h - 35/18. Which is the closest to 0.1? (a) n (b) -2 (c) o c Let d = 6 - 10. Let o = -3 - d. Let t = -95/4 - -657/28. Which is the closest to o? (a) 3 (b) t (c) -4 b Let v = 27 + -25. Let j(u) = -u + 1. Let z be j(1). What is the nearest to 0 in z, v, -3? z Let v = 2.06 - 0.06. Let m = -10 - -32. Let l = 111/5 - m. Which is the nearest to v? (a) 1 (b) l (c) 0.3 a Let n(g) = -5g - 7. Let z be n(-2). Which is the closest to 0? (a) 0 (b) 1/4 (c) z a Let m be ((-1)/(-7))/((-12)/14). Let d be (-7)/(-9) - (-3)/(-3). Which is the nearest to -1? (a) m (b) d (c) 1 b Suppose 5f = -11 + 1, 2f = -5t + 16. Let l = 0.6 + 0.4. Let n = -4 + -1. What is the closest to l in n, -1, t? -1 Let i = -8/141 + 934/1551. Let k = 3.1 - -0.9. What is the closest to i in 2/13, -0.1, k? 2/13 Let d = 956.3 - 956. Let y = 0 + 0.2. What is the closest to y in -1/11, d, -2? d Let s = 3.8 + 1.2. Let z be (3 - (1 + -2)) + 0. Suppose -12 = zr - r. Which is the nearest to -2? (a) s (b) 1/4 (c) r c Let t = -2 - -8. Let w = 10 - t. Let m = 4 - w. What is the nearest to -1/4 in -4, 5, m? m Let n be (-36)/(-8) - 3/6. Which is the closest to -2/5? (a) n (b) 8 (c) 5/3 c Let m be -1 - -1 - (-3)/(-3). Let p be (m + 1)/(5 - 7). Which is the closest to -0.2? (a) -1/7 (b) 2/19 (c) p a Let l = 0.3 - -0.7. Suppose 4g = -3y + 31, 4y + 3g - 9 - 23 = 0. Suppose 5s - 5z = -25, ys + 4z + 0z = 20. What is the nearest to l in 1/4, 0.1, s? 1/4 Suppose -58h + 66 = -80h. Let m = 0.1 + -0.3. What is the closest to m in h, -2, 1/6? 1/6 Let q = -0.13 + -4.87. Let s = 140 + -557/4. Let x = 4 + -4.1. Which is the closest to x? (a) 2/11 (b) s (c) q a Let u = -23.2 - -23. What is the nearest to 7 in 3, 2/9, u? 3 Let a = -11.6 - -10. Let p = a + 3.6. What is the nearest to p in -0.1, -3, 1/6? 1/6 Let m be 4/12084/1. Let k = -761/453 + m. Which is the nearest to 2/3? (a) 1 (b) k (c) 4 a Let w = 5.4 + -5.1. Which is the closest to 5? (a) -2 (b) -1/6 (c) w c Let q be (-21)/4 + 1/4. Suppose 2s - 7s + 1 = -4x, -s = 4x + 19. Let v be 2 + s + 2 + 0. What is the closest to 1 in q, v, 1/4? v Let o = -39/187 - -2/17. Let q = -162 + 161.5. What is the closest to -2/7 in 1, q, o? o Let d = 6 + -11. Let i = 11 + -6. Let p = d + i. Which is the nearest to 0? (a) 2/11 (b) p (c) 5 b Let s = -18640/39 + 478. Let z = s + -32/117. Let v = 4.258 + -0.258. What is the closest to -2/9 in z, -1, v? z Let g = 2.5 + -2. Let n = g - 0.4. Let j = -1.2 - -0.2. Which is the closest to n? (a) 4 (b) j (c) 2 b Let h = -2.94 + -0.06. Let y = 3.1 + h. Let o be 2/7(-6)/(-4). Which is the nearest to -1? (a) y (b) o (c) 2/11 a Let g(q) = 3q. Let p be g(1). Suppose -4l + pi + 17 = 0, -2l + i - 5 = 4i. What is the nearest to l in -0.4, 2/7, 2/5? 2/5 Let a = 1/78 + -23/273. What is the nearest to 0.1 in a, 1, 0? 0 Let n = -11 + 19. Let w = n + -13. Let o = 1 - 1. What is the closest to o in -4, w, 4/9? 4/9 Let k = -50.8 + 46.79. Let t = 0.01 + k. Which is the nearest to 1/3? (a) -1/4 (b) -3 (c) t a Let m = -10 + 9. Let r = -8.4 - -8. Which is the closest to r? (a) 0 (b) -0.3 (c) m b Let z = 18.9 - 22.9. Which is the closest to -0.1? (a) -2/3 (b) 11/5 (c) z a Let w be (-3)/(-1)1/6. Let i = -52 + 51.7. Let m = 1 + -2/3. What is the closest to m in 2, w, i? w Let f = -2 - -6. What is the closest to 0.3 in 0.4, 0.1, f? 0.4 Let i = -24.1 + 24. What is the closest to -0.1 in i, 0.1, -3? i Let w = -482/5 + 96. Which is the closest to -1? (a) -5 (b) w (c) 0.5 b Let l be (-3)/2(-8)/6. Let v be (l + -1)/((-3)/6). Let a = 134/3 - 44. What is the closest to -1 in 1, a, v? v Let g = -7.06 + 7. Let p = g + -2.94. Let d be (1 - (-2 - -1))/13. What is the nearest to 0.1 in p, d, 4/7? d Let f = -28.1 - -28. What is the nearest to 1 in -0.4, f, -1/5? f Let z = 17 - 18. Let d = -0.7 - z. Which is the closest to -1? (a) 0.08 (b) d (c) -5 a Let p = -0.64 + 0.54. Which is the closest to p? (a) 1/8 (b) -0.2 (c) 4 b Let i = -1057/1958 + -1/178. Which is the closest to 1/3? (a) -2/19 (b) 22 (c) i a Let q(j) be the first derivative of j*2/2 + 2j - 1. Let n be q(-3). Let i = 186 - 3908/21. What is the closest to n in -1/3, -0.1, i? -1/3 Let m be 14/(-8)-4. What is the nearest to -1/7 in -1/4, -1/5, m? -1/5 Suppose -6f = -5v - 2f - 9, 0 = 2v + f + 1. Let t be (-2 + 0)/410. Let x be (2/12)/((-1)/(-2)). Which is the closest to v? (a) t (b) x (c) -4 b Let y = 8.3 + -8. Let z = y - -2.7. Let p = -0.1 + -0.9. What is the nearest to -0.1 in p, -3, z? p Let y = 3 + -5. Let w be y/8 - (-13)/20. Let q = -12/11 + 25/33. Which is the closest to w? (a) q (b) -1 (c) 0 c Let y = 44 - 41. Which is the closest to -1? (a) y (b) -1 (c) 0.1 b Let q be 1/(-9)1(1 + 1). What is the nearest to -2/7 in -3/8, q, -0.3? -0.3 Suppose 0m - 4m = -4. Let z(q) = q2 - 6q + 4. Let f be z(10). Let y be (9/f)/((-12)/(-32)). Which is the nearest to m? (a) 4 (b) -0.1 (c) y c Let l be -5 + 1 + 13/4. Which is the closest to l? (a) -5 (b) -4 (c) -0.5 c Let n = 0.04 + -0.15. Let p = -2.89 + n. What is the closest to 2/3 in 3/4, p, 5? 3/4 Let o = -10 + 15. Let j = 3 - 2.1. Let z = -2.1 - j. Which is the nearest to -1/4? (a) z (b) o (c) 0.5 c Let t = -0.4 - -0.9. Let s = 2 - 1.3. Let v = -0.6 + s. Which is the nearest to 0.1? (a) t (b) 5 (c) v c Suppose -5q = -5i + 7 - 32, 5q = -4i + 25. Let k = 0.02 - 3.02. Which is the closest to -1? (a) i (b) -4 (c) k a Let n be (-374)/110 - -41. What is the nearest to 19 in 3, n, 1? 3 Let d = 1.8 + -2. Let h = 3.6 - 5. Let p = 0.6 - h. Which is the closest to p? (a) -0.5 (b) d (c) 5/3 c Suppose 0 = 4z - 4w + 10 - 2, -4w = 3z - 29. Suppose -4f = -3i, zf + 0i = 5i. Let p = 3.5 - 4. Which is the closest to f? (a) 1/4 (b) 1/7 (c) p b Let o = -0.22 - -0.22. Which is the closest to -0.1? (a) o (b) 2/19 (c) -1 a Let n = -3 - -4. Let r = -6.3 + 2.3. Let d = n + r. What is the closest to -1 in -0.4, d, -2? -0.4 Let t(i) = -i*2 - 3i. Let q be t(-4). Let h = 38.24 + -43.3. Let g = h + 0.06. Which is the closest to -1/2? (a) q (b) g (c) 2/7 c Let q = 26 + -25. What is the nearest to 2/3 in -0.1, -3, q? q Let j be 9/(-30) + 32/40. What is the closest to 16 in -3, -4, j? j Suppose -2n + 4p + 15 = -n, 0 = p + 5. Let t = 4 + -3.7. Let y = t + 0.7. Which is the nearest to 1/3? (a) y (b) -2/19 (c) n b Let m = 3.07 + -0.07. Let w = 3.1 - m. Let q = -84 + 86. Which is the nearest to w? (a) q (b) -2 (c) -5 a Suppose -2b = -4b + 4. Let z be (-4)/(-3) - 4/b. Let u = 4.3 - -0.7. What is the closest to z in 1, u, -3? 1 Let u(w) = -w + 2. Let m be u(4). Let z = 43.2 + -43. Suppose 0*y	{ "pile_set_name": "DM Mathematics" }
3y - 74259y*4 + 4y*2 + 74261y*4 to fy*4 + dy + n + cy3 + wy*2 and give d. -3 Rearrange -63l*3 + 6l*3 + 46l*3 - 340l + 9l3 to al*3 + s + hl*2 + il and give s. 0 Rearrange (608t + 6523 - 3263 - 3260 - 11124t)(-t - t2 + t) to the form xt + zt2 + jt*3 + f and give j. 10516 Express (389 - 972 + 439)(-2 + 1 + 0)(0 - 1 + 0)(3g + g + 0g) in the form l + mg and give m. -576 Express 13z2 - z2 - 6z2 - 9z*2 + 0z*2 + 173 as uz*2 + rz + n and give u. -3 Rearrange -45l + 78l - 115l + 2 - 158l - 15l to the form j + rl and give r. -255 Express 0d2 - 141d - 10d2 + 6d*2 + 2d*2 - 2d*3 as ad*3 + cd + w + sd2 and give s. -2 Express -1550v*2 - 1 + 773v*2 + 778v*2 + 2v*3 - 60v*4 in the form xv*4 + kv*3 + r + av + lv2 and give l. 1 Rearrange -1126 + 378 + 377 + 371 + 257m to km + d and give k. 257 Express (-121 - 419p*2 + 121)(2p - 2p - 4p2) as tp*4 + y + gp*3 + kp*2 + ip and give t. 1676 Rearrange 13w + 56w + 8w + 1 - 21w to aw + f and give f. 1 Rearrange 99n - 9n2 + 2 - 18 - 98n + 20n2 to the form y + pn*2 + tn and give t. 1 Rearrange 5y2 - y2 - 7y*2 - 2y + 8y2 + 2y + (-2 + y + 2)(4y + 2y - 4y) to the form fy + b + cy*2 and give f. 0 Express -2n - 44 - 2 + 5 + 0n + 2n - n + (0 + 0 + 2n)(0 - 1 - 1) - 2n + 0n + 4n + (3 - 2 - 3)(0n + 0n + n) in the form f + in and give i. -5 Rearrange (4h - 38h + 0h)((-h + 2h + 0h)(0 + 5 + 2) + 5h - h - 2h) to the form mh2 + l + rh and give m. -306 Express 2c - 14c + 4c2 + c as q + wc + mc2 and give m. 4 Rearrange 4s - 1 + 3s2 + 13s*4 - 10s + 4s - 4 + 4 to the form us + f + rs4 + hs*2 + ls*3 and give h. 3 Express 25 + 870h*2 + 5h*3 - 37 - 870h*2 + 16 as th*2 + b + fh*3 + jh and give b. 4 Express -53w + 80w - 22w - 32 in the form k + lw and give l. 5 Rearrange (0 + 0 + 1 - k)((-2 - 22 - 10)(-2k + k - k) + (3k - k - 3k)(-1 + 5 - 3) - 5k + 2k + k) to ik + r + uk2 and give u. -65 Express -l2 + l*2 - 2l*2 + (-l + 5l - l)(33 - 28 + 12)(l - 3l + 4l) in the form xl + g + il*2 and give i. 100 Express 4f*3 + 2 - 1566f*4 - 5f + 3133f4 + f - 1564f*4 as of*3 + hf*2 + sf*4 + a + uf and give a. 2 Rearrange 1 - 1160r + 53r*4 + 2r*2 - 2r*3 + 576r + 583r to yr + ur4 + f + gr*3 + kr2 and give u. 53 Express (-v3 + 0v3 - 2v*3)(v - 4v - 5v)(-1 + 5 + 3) in the form fv + mv2 + nv*4 + p + yv*3 and give n. 168 Rearrange 15319 + 3y - 2y - 15319 - 2y*2 + 59y*4 to the form m + iy*4 + ry*3 + py*2 + by and give b. 1 Express (4n2 + 2n*3 - 4n*2)(-1475 - 1480 - 70 - 667 + 843) in the form rn3 + yn + on2 + m and give y. 0 Rearrange 8 - 5v + 140v2 + 0v*4 - 142v*2 - 2v4 - v3 to the form iv3 + ov*2 + cv*4 + zv + k and give c. -2 Express 217l2 - 31l*2 + 120l*2 - 37l*2 + 31l*2 as fl + hl2 + u and give h. 300 Rearrange -3u + 3u3 + 50 - 5u - 2u3 - 56 + 5u to the form du + n + su*3 + zu*2 and give d. -3 Express 11a - 15a + a - 12a*3 as ma*2 + v + ba + na3 and give b. -3 Express (241 - 479 + 476c + 238)(4c2 - c2 + 2c2 + (6c*2 - 3c2 - c2)(3 + 1 - 5)) in the form nc*3 + u + hc*2 + vc and give n. 1428 Express -13n + 77n + 40n in the form pn + w and give p. 104 Express 3 - 6 + 2 + 0 + 3 + 32f as mf + l and give l. 2 Rearrange -180k + 3 - 3 - 144k to v + jk and give j. -324 Express (-3 + 2h + 3)(4h - 4h + 5h) + (h + 4h - 2h)(h - h + h) as z + wh + xh2 and give x. 13 Express (29 + 21 + 21w + 1 + 7)(-6 + 1 + 3) as t + pw and give p. -42 Rearrange -15 - 3s4 + 2s - 28 + 17s3 + 43 + 4s*4 to w + zs*3 + ps*4 + ys*2 + vs and give z. 17 Rearrange 3a2 + 4 - 3 + 1 - a3 + 5a*2 - 2a*4 to ua*4 + k + za*3 + ca*2 + ba and give k. 2 Rearrange -1 + 2v3 + 0v*3 + 6 + (-2v + 3 - 3)(169v - 169v - 14v2) + v3 + 0v3 + 2v*3 to the form i + bv*2 + kv*3 + uv and give k. 33 Rearrange -19o3 + 4 + 0 + 42o*3 + 5o*2 - 2o*4 - 12o*3 - 12o*3 to the form ko*2 + u + do + ho4 + xo*3 and give x. -1 Express -10g - 196g2 + 194g*2 + 149g in the form t + bg2 + cg and give c. 139 Express -199w2 + 2w*4 + 99w*2 - 20w*3 + 2w + 0w4 + 98w*2 as cw*4 + n + iw*2 + fw + zw3 and give i. -2 Express -28w*4 + 1 - 6w*2 - 5w*4 - 7w + 32w4 as dw*2 + o + sw*4 + lw*3 + xw and give x. -7 Express -88v3 + 50v*3 + 49v*3 + v in the form yv + x + ov2 + lv*3 and give y. 1 Express 3843p - 3843p - 124p*2 in the form hp + qp2 + s and give q. -124 Rearrange 387938 - 3p - 387875 - p to kp + m and give m. 63 Express -3x*4 + 1220 - 2x*2 - 1222 - 2x - 2x2 in the form jx*2 + ax + sx4 + px3 + c and give j. -4 Express g2 + 16g + 5g*4 - 4 - 32g*3 - 4g*4 + 32g*3 as ug*3 + pg*2 + w + zg + lg4 and give p. 1 Rearrange -s3 + s2 - 2 - 5s - 2 + 6 + 3s to i + ts*3 + ns + fs2 and give t. -1 Rearrange 1 - 251c + 2 - 67c to the form qc + i and give i. 3 Rearrange (-162u + 200u - 98u + 3u*3)(3 - 4 + 3) to nu3 + lu*2 + p + tu and give t. -120 Express (5r3 - 3r - 7r + 16r)((-4r + 0 + 0)(6 - 3 - 4) - r + 5r - 6r) in the form nr*2 + hr*3 + fr + tr4 + u and give n. 12 Express (-2c4 - c4 + 4c4)(0 + 2 + 0 + (1 - 3 + 0)(-6 + 4 + 0) + 0 + 4 + 4) in the form kc + tc3 + hc*4 + fc*2 + j and give h. 14 Express -8p*3 - 15p*3 + 4 - 3p*4 + 10p*3 as mp*3 + ap*4 + s + yp*2 + op and give m. -13 Rearrange (-26a - 1 + 13a - 29a)(-a + 18a - 2a) to oa + c + xa*2 and give o. -15 Express 278 + 2n*2 - 62n*2 + 3n*3 - 276 + 2n*2 as sn*3 + un + wn2 + t and give s. 3 Rearrange -11z + 34 + 39 + 18 - 67 - 3z to the form lz + p and give l. -14 Express 67v + 187v + 172v - 103v as sv + h and give s. 323 Express 9 + 10l*2 - 9 - 62l*2 in the form v + yl + hl2 and give h. -52 Express (3 - 4p + 2p - p)(-48 - 43 - 78 - 20) as lp + j and give j. -567 Rearrange x4 + x2 - 4 - 13 - 2x*4 + x + 3x to gx + tx*3 + wx*2 + s + px*4 and give w. 1 Express 19 - 12 - 71x - 7 - 676x in the form zx + q and give z. -747 Rearrange -434740j2 + 241j*3 + 2j + 510j3 + 434740j*2 to the form nj*2 + uj*3 + wj + r and give w. 2 Express -19l - 17l + 44l + l2 - 22 - 9l as x + rl + hl*2 and give r. -1 Express (-31l3 + 1 + 1 - 3 + (-l2 + 0l2 - l2)(-2 + 2 - 2l))(27 - 59 + 29) in the form xl + rl*3 + gl*2 + o and give o. 3 Express 4 + v - 2 + 2v*2 - 5 - 7v*3 - 2v*4 + 2v*3 as tv*2 + lv*4 + yv + sv3 + k and give s. -5 Rearrange -96f - 90f - 64 - 2f*3 + 182f to tf3 + a + pf*2 + if and give t. -2 Express -19m3 + 66 + 62m*3 - 82 in the form gm + xm2 + i + wm*3 and give i. -16 Rearrange (-856t + 1759t - 176t)(-3t*2 - 4t*3 - 2 + 2t*2 + 2t*3) to ft*4 + yt*3 + zt + k + nt2 and give z. -1454 Express -596n + 24 + 25 + 574n as wn + s and give w. -22 Rearrange -4v - 3 - 24 - 564v*2 + 565v*2 to p + fv + zv2 and give p. -27 Rearrange 2d*4 + 0d - 10d3 + 11d*3 - 7d to rd4 + n + md*2 + yd*3 + ad and give r. 2 Rearrange m*2 + 20m*3 - 3m - 55m3 + 34m*3 to the form lm*2 + fm*3 + um + b and give f. -1 Express 7 - 33 + 19 + 7 + 556m2 as v + am + fm2 and give f. 556 Express 18653 - 18653 + 48k*2 + k in the form g + ck*2 + jk and give c. 48 Express -13x - 2 + 10x + 13x + x in the form hx + a and give a. -2 Express (3 + 7 - 4)(-2q + q + 8 - 7)(1 - 5 + 2)(3 - 3 + 2) as zq + a and give z. 24 Rearrange -19 - 101j - 10 + 106j to k + lj and give k. -29 Rearrange 0h4 + 0h - 124h2 + 130h2 - h4 + 2h3 - 3h + 4 to nh + ih*2 + b + gh*4 + sh*3 and give g. -1 Rearrange 9 + 2b + 0 + 11 + 4 - 6b to the form g + kb and give k. -4 Rearrange 15x - 2x*2 + 24x - 76x to the form yx*2 + v + zx and give v. 0 Express 3o2 - 12o*2 + 74o + 10o2 as v + po*2 + io and give i. 74 Express 42n3 - n4 - 2n*2 + 2n - 65n3 + 29n**3 as	{ "pile_set_name": "DM Mathematics" }
2 Divide -1694772 by 47077. -36 What is -492975 divided by -23475? 21 Calculate 439 divided by 4. 439/4 Divide -9107706 by 6. -1517951 -182045 divided by -36409 5 Calculate -58353678 divided by -6. 9725613 Divide -640334 by 2. -320167 Calculate 32996 divided by 2. 16498 What is -71036 divided by 17759? -4 What is 69 divided by -13332? -23/4444 -35 divided by 37 -35/37 -32655 divided by 10885 -3 Divide -246948 by 156. -1583 What is -113 divided by 250? -113/250 Divide 376174 by 254. 1481 What is -82250 divided by 3290? -25 Calculate 59 divided by 2254. 59/2254 What is 181012 divided by 4? 45253 Calculate 60609 divided by -267. -227 Divide 32310 by -1795. -18 Calculate 2913822 divided by -3. -971274 Divide -23 by -480. 23/480 Calculate 14079 divided by -77. -14079/77 Calculate 212868 divided by 9. 23652 -7 divided by -32579 7/32579 What is -130219 divided by -5? 130219/5 Divide 159620 by 3. 159620/3 Calculate -4 divided by -723. 4/723 222631 divided by 1 222631 Calculate -867240 divided by 4818. -180 Calculate 396657 divided by -4. -396657/4 -1113 divided by -19 1113/19 Divide 43686 by -6. -7281 What is 1133030 divided by -29? -39070 What is -10323540 divided by -6? 1720590 What is -7424 divided by -7? 7424/7 What is -68850 divided by -6? 11475 What is -557504 divided by 557504? -1 5013 divided by 18 557/2 95 divided by 1009 95/1009 Calculate 1 divided by 194909. 1/194909 11718 divided by -8 -5859/4 What is -1313174 divided by 4? -656587/2 Divide 4 by 117308. 1/29327 Divide 191184 by -2. -95592 Calculate -267630 divided by -2433. 110 Calculate 1 divided by -16679. -1/16679 Calculate 0 divided by -9193. 0 What is 4188 divided by 6? 698 What is 0 divided by -103287? 0 Calculate -30864 divided by 6. -5144 -35805 divided by -231 155 Divide -2182110 by 6. -363685 What is 3541 divided by 3541? 1 Calculate 175875 divided by 7. 25125 What is 6440 divided by -9? -6440/9 5 divided by -36095 -1/7219 What is 592330 divided by -2? -296165 What is -44 divided by -22? 2 Calculate 4752 divided by -5. -4752/5 1179923 divided by 19343 61 Divide -11335 by 6. -11335/6 What is -5475 divided by 19? -5475/19 Divide 99512 by -7. -14216 What is 16948 divided by 76? 223 -8 divided by 42389 -8/42389 Divide -1132 by -193. 1132/193 What is 53669 divided by 1309? 41 55972 divided by -14 -3998 Calculate -580 divided by 99. -580/99 Calculate -625516 divided by 156379. -4 -939 divided by 167 -939/167 21280 divided by 560 38 Divide -425 by -9364. 425/9364 -61 divided by 23038 -61/23038 Calculate -23711 divided by 19. -23711/19 -2721390 divided by -5 544278 Calculate 496 divided by 40. 62/5 Calculate 132760 divided by -26552. -5 Divide 746692 by -186673. -4 What is -2 divided by 65543? -2/65543 Calculate 2 divided by -67047. -2/67047 Divide 3 by 42283. 3/42283 Divide 342000 by -285. -1200 What is 6071004 divided by 3? 2023668 What is 18 divided by -13377? -6/4459 What is -763692 divided by 138? -5534 What is -891 divided by 891? -1 Calculate -1 divided by -356912. 1/356912 Calculate -19 divided by 12484. -19/12484 Calculate -217936 divided by 27242. -8 Calculate 623853 divided by -3. -207951 -36014 divided by 2 -18007 Divide 5 by -20989. -5/20989 What is 486420 divided by -24321? -20 22464 divided by 2808 8 19044 divided by 207 92 Divide 48546 by 5. 48546/5 Divide 28103 by -28103. -1 Divide -536760 by 210. -2556 Divide -1 by 84800. -1/84800 What is 379796 divided by -2? -189898 Calculate 67 divided by 9846. 67/9846 Calculate -16137 divided by -9. 1793 Calculate -1143 divided by 92. -1143/92 Calculate 404723 divided by -1. -404723 Divide 296394 by -6. -49399 455760 divided by -5697 -80 2270829 divided by 3 756943 -184096 divided by -4 46024 What is 48 divided by -12349? -48/12349 -843709 divided by 23 -36683 Calculate 115 divided by 44627. 115/44627 Calculate 1086915 divided by 217383. 5 -79596 divided by -1206 66 Divide 8108 by 14. 4054/7 What is -220194 divided by -2823? 78 What is -3162068 divided by -13? 243236 Calculate -5914 divided by 2957. -2 What is 9648 divided by 1206? 8 -116610 divided by -69 1690 What is -544 divided by -121? 544/121 Divide -38120 by -2. 19060 -396000 divided by -15840 25 Calculate 23184 divided by 11592. 2 Divide -17 by 2729. -17/2729 What is -5 divided by 4287? -5/4287 -5566248 divided by 695781 -8 What is 0 divided by -14700? 0 Divide 0 by -200054. 0 Divide 250 by -1681. -250/1681 31 divided by 17511 31/17511 What is -269 divided by 131? -269/131 -2612385 divided by -58053 45 70 divided by 1543 70/1543 Divide 91936 by 416. 221 1025946 divided by -341982 -3 Calculate 5946690 divided by 5. 1189338 What is 20970 divided by 6990? 3 Divide 29988 by -6. -4998 What is 17238 divided by 6? 2873 Divide -5133 by -87. 59 What is 3 divided by -82052? -3/82052 Divide 45684 by 1. 45684 Calculate -48458756 divided by 4. -12114689 What is 3358 divided by 24? 1679/12 Calculate 49328 divided by 12332. 4 25179 divided by 33 763 Divide -4371 by 1. -4371 Divide -35 by -1857. 35/1857 What is -5123 divided by -48? 5123/48 -85097 divided by -15 85097/15 Divide 83844 by 4658. 18 714278 divided by -4 -357139/2 Divide 370425 by 3. 123475 Calculate 119730 divided by 15. 7982 What is 54796 divided by -35? -7828/5 Divide 428420 by 124. 3455 What is 178881 divided by -3? -59627 What is 510498 divided by -474? -1077 What is -21 divided by -1114? 21/1114 What is -232024 divided by 13? -17848 -179940 divided by 5 -35988 Divide 69432 by -17. -69432/17 3 divided by -24034 -3/24034 What is -45 divided by 1467? -5/163 What is -768235 divided by 65? -11819 Divide -3828480 by -11964. 320 Divide 192375 by 5. 38475 What is 527620 divided by 22940? 23 What is -318712 divided by 4? -79678 What is -4 divided by 295249? -4/295249 Calculate 2 divided by 17981. 2/17981 Divide 64746 by 6. 10791 Calculate -2 divided by 149232. -1/74616 What is 7805 divided by -168? -1115/24 What is -12 divided by -37353? 4/12451 What is 0 divided by 74275? 0 What is 399441 divided by -3? -133147 What is 1722494 divided by 86? 20029 142 divided by 2623 142/2623 What is 33990 divided by -9? -11330/3 Calculate -3531 divided by -20. 3531/20 What is 413 divided by 44? 413/44 Calculate -1058265 divided by 5427. -195 What is 205120 divided by 3205? 64 Calculate -414 divided by 104. -207/52 -17087 divided by 17 -17087/17 What is -190494 divided by 6? -31749 Calculate -111424 divided by -2. 55712 What is 145994 divided by 72997? 2 What is -79842 divided by 6? -13307 Calculate -1502 divided by -15. 1502/15 What is -3 divided by -37633? 3/37633 What is 1799413 divided by 163583? 11 Calculate 20105 divided by 3. 20105/3 0 divided by 18866 0 Calculate -13810 divided by -6. 6905/3 What is -401108 divided by 100277? -4 2 divided by 27394 1/13697 Calculate 4067186 divided by 6. 2033593/3 Divide 79112 by -116. -682 743310 divided by -13765 -54 Divide 227 by -206. -227/206 Calculate -33400 divided by 334. -100 Divide -108 by -28208. 27/7052 Calculate -485 divided by 2573. -485/2573 160780 divided by -32156 -5 105788 divided by 26447 4 Divide 3683271 by -72221. -51 Calculate 5204 divided by -4. -1301 What is -515768 divided by -257884? 2 Calculate 60 divided by -36784. -15/9196 Calculate -9925 divided by 1985. -5 Divide -11850 by 3. -3950 17 divided by -175 -17/175 -332 divided by 218 -166/109 Divide -17035 by -17035. 1 Calculate 21288 divided by 1774. 12 What is 5 divided by -1500059? -5/1500059 Calculate -1230 divided by 109. -1230/109 Calculate -18 divided by -89462. 9/44731 Divide 2684 by 244. 11 Divide 108018 by -2. -54009 What is -6041 divided by -6041? 1 Divide -16 by -39300. 4/9825 What is 4 divided by -17541? -4/17541 What is 739044 divided by 3? 246348 11 divided by 68 11/68 Calculate 279943 divided by 1. 279943 30 divided by 690 1/23 Divide -539 by 20. -539/20 Divide -54846 by 18282. -3 Divide -1758 by -82. 879/41 41824 divided by -8 -5228 Calculate -700 divided by 11. -700/11 -1 divided by 62852 -1/62852 What is -29 divided by -129? 29/129 Divide 2 by -76626. -1/38313 Divide 560540 by -4. -140135 Calculate 2633 divided by 8. 2633/8 What is 108358 divided by 3187? 34 -1510208 divided by 53936 -28 Calculate -3 divided by -11074. 3/11074 -15991 divided by 15991 -1 Calculate -9 divided by -1258. 9/1258 Calculate 21 divid	{ "pile_set_name": "DM Mathematics" }
s be k(-11). Let o be x(s). What is the units digit of (-4 + 2)2o? 4 Suppose -8x - 1332 = -4p - 4x, p - 309 = -5x. What is the hundreds digit of p? 3 Suppose -42 = -8n + 6. Suppose 5f - nf + 5 = 0. What is the units digit of f? 5 Let x be 0 + 2182/(-7) + 2/(-7). Let s = x + 501. What is the hundreds digit of s? 1 Let u = 19 - 35. Let z = 57 + u. What is the units digit of z? 1 Let m be 30/(-20)8/(-3). Let f be 6/m(-4)/3. Let b(p) = 14p*2 + 2p + 3. What is the tens digit of b(f)? 5 Let x(h) = h*3 + 6h*2 + 6h + 1. Let y be x(-4). Suppose -4g + 44 = 2w + 2, -g - w + 13 = 0. Let m = g + y. What is the units digit of m? 7 Suppose -4k + 15 = -1. Suppose -4i = 5s - 414, 5i - 562 = ks - 24. What is the hundreds digit of i? 1 Let k = 173 - 132. What is the tens digit of k? 4 Let c(w) be the first derivative of w4/4 - 3w*3 - 9w*2/2 - 9w - 11. What is the units digit of c(10)? 1 Let w(g) = 15g2 + 7g*2 - g + 11g*2 - g. Let f be w(2). Suppose -3t - r + 97 = 0, -3t + r = -7t + f. What is the tens digit of t? 3 Suppose 0 = -5r - 56 + 176. Let f = r + -6. Let x = f - 15. What is the units digit of x? 3 Let q = -4 + 84. Let r = q - 24. What is the tens digit of r? 5 Suppose 5v + 3196 = 4b + 9v, b - 3v - 803 = 0. Suppose -13t + b = -3t. What is the units digit of t? 0 Suppose 0w + 7 = -5w - 3a, 3w + 3a + 3 = 0. Let s be w/(-15) + (-6942)/90. Let q = -22 - s. What is the units digit of q? 5 Let r = -12 + 127. Suppose -2l + 267 = 3b, r = 4b - 5l - 241. What is the tens digit of b? 8 Suppose -11 = 2r - 3. What is the tens digit of (r/(-26) - 9/(-26))204? 0 Suppose v - 5 - 10 = -2h, 2v + 15 = 5h. Suppose -22 = -q + 6x - 2x, 2x = -vq + 132. Suppose qd - 192 = 22d. What is the tens digit of d? 4 Suppose -4x = 0, -2s + 7 - 3 = -x. Suppose 0 = -5o + 2o - 3c, -6 = so - 4c. What is the units digit of 4 + o - (3 + -38)? 8 Suppose 2i + 32 = -5x + 12, i = -2x - 8. Let t be 140/(-105)(0 - (-3)/(-2)). Suppose -tw + 0w + 30 = i. What is the units digit of w? 5 Let a = 36 - 14. Suppose -2y + 3y = a. Suppose 4f = 5v - 99, f + 4 = -v + y. What is the tens digit of v? 1 Suppose 2b = 5d - 19392, 14d + 15515 = 18d - 3b. What is the thousands digit of d? 3 Let b = 1135 + -557. What is the tens digit of b? 7 Suppose -1716 = 5f - 6886. What is the tens digit of f? 3 Let r = -33 - -35. Suppose ri - 136 = -2. What is the units digit of i? 7 Suppose 0 = -11p - 11p + 22770. What is the tens digit of p? 3 Let d = 134 + -120. Let r(n) = -n3 + 6n*2 - 3n + 3. Let x be r(3). Let a = x - d. What is the units digit of a? 7 Let r be ((-16)/6)/(-2)57/38. Suppose -5i + 48 = -s + rs, 3s = 2i + 178. What is the units digit of s? 8 Let f(j) = -1248j + 39. What is the units digit of f(-1)? 7 Let r(i) = i*3 + 15i*2 + 11i - 15. Let q be r(-14). Suppose 2j - 373 = q. What is the hundreds digit of j? 2 Suppose 4m = 5x + 516, 3m - 463 = -2x - 53. What is the units digit of m? 4 Let p = 6034 + -3212. What is the hundreds digit of p? 8 Suppose -5u - 4l = -374, -3u - 3l = 2u - 378. Suppose 4w - 186 = -2z, 9w - 4w = -z + u. What is the units digit of z? 3 Let l(u) be the third derivative of -23u6/360 - u5/60 - u4/3 - 3u*2. Let n(v) be the second derivative of l(v). What is the units digit of n(-1)? 4 Suppose s = k - 3k - 6, 0 = -2k - 10. What is the units digit of 1152/52 - s/26? 2 Let p(k) = k3 + 23k*2 + 24k + 27. What is the units digit of p(-11)? 5 Suppose 0 = 4i - 5f - 13, f = -4i + 25 + 6. Suppose -q - i + 16 = 0. What is the units digit of 129/q - (-6)/(-18)? 4 Let a(i) = 9i*3 + 4i*2 + 2i - 5. What is the tens digit of a(4)? 4 Suppose -2f = -5a - 3331, -f + 11a + 1667 = 8a. What is the hundreds digit of f? 6 Suppose 2s - 286 = 5t, 2 = 3s - 7. Let n = t + 38. Let x = -8 - n. What is the units digit of x? 0 Suppose 2o - 15 = -o. Suppose s + o = 3. Let w(v) = v*2 - v - 1. What is the units digit of w(s)? 5 Suppose -3p = -2d + 4d + 125, d + p + 62 = 0. What is the units digit of 1 - (-2)/1 - 0 - d? 4 Let a = 11 + 26. Let h = 62 + -44. Suppose -h = -5j + a. What is the tens digit of j? 1 Let f be -21 - (-3 + 1 + -1). Let a be (-1)/2(18 - f). What is the units digit of (0 - a)(-4)/(-1)? 2 Suppose 130 = -b - b. Let c be b(36/(-10) + 4). What is the units digit of (-4)/(-30) + c/(-30)? 1 Suppose -c + 1943 = 4c + 3o, 5c - 1942 = -2o. What is the tens digit of c? 8 Let j(n) = 22n2 - 39n - 20. What is the hundreds digit of j(-7)? 3 Suppose 0 = -6r + 2835 - 507. Suppose 4l - r = -4t, 3t = 5t - 5l - 208. What is the units digit of t? 9 Let w be ((-2)/(-3) - 0)27. Let y = 288 + w. What is the units digit of y? 6 Let q = 394 - 184. Suppose -5l = q - 1325. What is the tens digit of l? 2 Let l(f) = -f*2 + 45. Let q be l(0). Let k(d) = d - 23. Let z be k(9). Let u = z + q. What is the tens digit of u? 3 Let w = 4494 - 1889. What is the tens digit of w? 0 Suppose -2l = 24 - 8. Let r = -4 - l. What is the units digit of r? 4 Let n(k) = 2k - 5. Let t be n(1). Let m(g) = -5g - 4g2 - g3 + 2g2 + g2 - 2. What is the tens digit of m(t)? 3 Suppose 3t - 2n = 1747, 2n = 2t - 106 - 1056. What is the units digit of t? 5 Suppose 28o - 2o - 36816 = 0. What is the thousands digit of o? 1 Let p = -109 - -115. What is the hundreds digit of -4 + 10/p69? 1 Suppose t - 23 = -3j, 2t = 4j - 2t - 52. Let z(g) = 9g + 14. What is the units digit of z(j)? 5 Let c(u) = 2u2 - 57u + 404. What is the thousands digit of c(37)? 1 Suppose -1 = -2z - 2t + 13, 0 = -z + 5t - 23. Let h(x) = x2 - 4x + 4. Let v be h(z). Suppose vq + 28 = q. What is the units digit of q? 8 Let p = 1209 - 847. What is the units digit of p? 2 Let u be 2 - 11/6 - 85/(-30). What is the hundreds digit of (0 + -1)/(u/912-2)? 1 Let x(p) = p*2 - 16p + 304. What is the thousands digit of x(42)? 1 Let r be -6 + (-1)/14. Let w be (-736)/(-9) + r/(-45). Let g = -49 + w. What is the units digit of g? 3 Let f = -2 - -2. Suppose -2u + 98 + 4 = f. What is the tens digit of u? 5 What is the hundreds digit of (-7 - (-55)/10)/((-3)/776)? 3 Let c(x) = -x*3 + 21x*2 + 3x - 30. Suppose 0 = 19i - 13 - 386. What is the units digit of c(i)? 3 Suppose 0 = 166d - 161d - 6220. What is the hundreds digit of d? 2 Let q be 1016/10 - 8/(-20). Let z = q + -54. What is the units digit of z? 8 Suppose 2k - 7k + 10 = 0. Suppose kt - 4t + 18 = 3q, 3t = 9. What is the units digit of q/(-6)174/(-4)? 9 Suppose 3v - 2v - 1867 = b, -5b = 15. What is the thousands digit of v? 1 Let p be (36/(-16))/((-1)/4). Suppose -4n + pn = 675. Suppose -2b - 3r - 13 = -67, -5b = 4r - n. What is the units digit of b? 7 Let q = 11 - 6. Suppose 17l = 5t + 22l - 10, 4t + 3l = 13. Suppose t + 58 = qx. What is the units digit of x? 3 Let r(z) = -61z - 50. What is the units digit of r(-9)? 9 Let a(o) = -o3 + o2 + 1. Let f(t) = -5t3 + 16t*2 - 3t + 16. Let d(m) = 6a(m) - f(m). What is the units digit of d(-11)? 8 Suppose -5m - 652 + 3442 = -3z, -z = -m + 556. What is the hundreds digit of m? 5 Let s(y) = -123y + 33. What is the units digit of s(-2)? 9 What is the thousands digit of 8226 - (69 - 74)? 2 Let t be -25(-4)/30102. Suppose 0 = -2j - 2j + t. Suppose -3s - 2y = -48, s - 5y = 6s - j. What is the units digit of s? 4 Let a be (-2 - -1)/3-111. Let x = 371 - 370. Let f = x + a. What is the tens digit of f? 3 What is the tens digit of (-4 - -5)/((-2)/(-262))? 3 Let l = 48 - 46. Suppose -3c - h = -6h - 46, lh = c - 17. What is the units digit of c? 7 What is the tens digit of 18981/9 + -2 + 6? 1 Let g = 100 - -715. What is the tens digit of g? 1 Let b(n) = -3n - 6. Let w be b(-3). Suppose -4u = -wd - 36, 0 = 4u + 5d - 23 - 45. What is the units digit of u? 2 What is the units digit of 256/19210866/164? 2 Let i = 163 + -262. Let j = 184 + i. Suppose b = -4b + j. What is the tens digit of b? 1 Let y = -34 - -39. What is the tens digit of 12/y(-190)/(-4)? 1 Suppose 3m + m = -16. Let a(b) = b2 + 1. Let v be a(m). Suppose 24 = r - v. What is the tens digit of r? 4 Let a(b) = 10b*2 + 11b + 9. What is the tens digit of a(10)? 1 Suppose 190 = -6l + 11l. Sup	{ "pile_set_name": "DM Mathematics" }
m {z: 6, x: 4, i: 5, b: 1, v: 1, g: 3}. 1/456 Two letters picked without replacement from {p: 10, t: 2}. What is prob of sequence pt? 5/33 Two letters picked without replacement from {z: 2, l: 16}. What is prob of sequence zz? 1/153 What is prob of sequence ay when two letters picked without replacement from {x: 2, s: 1, a: 1, y: 1, v: 1, p: 1}? 1/42 Calculate prob of sequence bzcb when four letters picked without replacement from zmcccbbcs. 1/378 Four letters picked without replacement from {r: 3, i: 2, e: 5}. What is prob of sequence irri? 1/420 Calculate prob of sequence kvkj when four letters picked without replacement from jkkkkkkkkkkkkkvkkk. 1/306 Calculate prob of sequence omk when three letters picked without replacement from kykeeeekmeyokkkkyoee. 7/3420 Four letters picked without replacement from {p: 5, k: 11}. What is prob of sequence pppk? 11/728 Three letters picked without replacement from {t: 3, d: 1, y: 3, j: 2, k: 1, f: 5}. What is prob of sequence kjf? 1/273 What is prob of sequence uuc when three letters picked without replacement from jfeumjcu? 1/168 What is prob of sequence gmm when three letters picked without replacement from ggjmmlmnnlmmjgjnmnl? 5/323 Calculate prob of sequence oop when three letters picked without replacement from owwoowooooppoowpoqoo. 11/190 Four letters picked without replacement from {f: 15, x: 3}. Give prob of sequence ffff. 91/204 Three letters picked without replacement from rrgrbbbrrarbssabar. Give prob of sequence brs. 35/2448 What is prob of sequence gyq when three letters picked without replacement from {n: 3, y: 3, d: 7, l: 3, g: 1, q: 2}? 1/969 Three letters picked without replacement from ubbbbbunhahhbuhbu. What is prob of sequence uha? 1/255 Four letters picked without replacement from yaayimaayhmmamy. Give prob of sequence imhm. 1/2730 Calculate prob of sequence lul when three letters picked without replacement from luuluuuu. 1/28 What is prob of sequence yqyw when four letters picked without replacement from qwqqqyyqyyq? 1/110 What is prob of sequence pfe when three letters picked without replacement from {p: 4, b: 2, e: 9, d: 1, f: 4}? 2/95 Two letters picked without replacement from {p: 2, o: 3}. Give prob of sequence po. 3/10 Calculate prob of sequence lciw when four letters picked without replacement from ciipliwi. 1/420 Two letters picked without replacement from {w: 5, t: 1, v: 2, b: 3, f: 6, h: 2}. What is prob of sequence fw? 5/57 What is prob of sequence ffzf when four letters picked without replacement from ufzzuucfubufzu? 3/4004 What is prob of sequence nsnr when four letters picked without replacement from {r: 2, n: 7, s: 5}? 5/286 Calculate prob of sequence ww when two letters picked without replacement from {w: 2, v: 3}. 1/10 Three letters picked without replacement from {m: 2, i: 17}. Give prob of sequence iii. 40/57 Calculate prob of sequence mllh when four letters picked without replacement from {m: 1, h: 1, z: 2, l: 5, f: 2, s: 2}. 1/858 Calculate prob of sequence gs when two letters picked without replacement from {j: 5, s: 2, n: 3, g: 1, v: 1}. 1/66 What is prob of sequence mjmt when four letters picked without replacement from {t: 7, j: 2, m: 3}? 7/990 Two letters picked without replacement from sywossosossy. What is prob of sequence sw? 1/22 Four letters picked without replacement from trjlrjj. Give prob of sequence jrjj. 1/70 Four letters picked without replacement from xffxxfxfkxxxxtxxtkfx. What is prob of sequence tfkf? 2/2907 Two letters picked without replacement from rrqqrrq. What is prob of sequence rq? 2/7 Four letters picked without replacement from {q: 4, d: 10, l: 5}. Give prob of sequence lldd. 25/1292 Four letters picked without replacement from {r: 8, w: 1, u: 6, c: 1, m: 1}. Give prob of sequence ucru. 1/238 Three letters picked without replacement from {w: 1, x: 2, f: 2, q: 4, j: 1}. What is prob of sequence wfj? 1/360 Calculate prob of sequence kusu when four letters picked without replacement from kbebeosssooukuoo. 1/3640 Two letters picked without replacement from {j: 2, l: 2, q: 1, u: 4, f: 2, a: 1}. What is prob of sequence jj? 1/66 Four letters picked without replacement from njngjjjgjjgnngj. What is prob of sequence jnng? 2/195 Two letters picked without replacement from {h: 2, k: 1, i: 5, o: 1, f: 1}. What is prob of sequence hk? 1/45 Calculate prob of sequence zgug when four letters picked without replacement from gzgujggjuuhjj. 3/1430 Four letters picked without replacement from {q: 6, g: 4, l: 7}. What is prob of sequence qglg? 3/340 Two letters picked without replacement from dkddwwkrwkpkwwk. Give prob of sequence wp. 1/42 Two letters picked without replacement from {g: 18, b: 2}. What is prob of sequence bb? 1/190 Three letters picked without replacement from {c: 5}. Give prob of sequence ccc. 1 Three letters picked without replacement from wwgwggwwwgggwgggww. Give prob of sequence wgw. 9/68 Four letters picked without replacement from kkrkkrkkrk. What is prob of sequence krrk? 1/20 What is prob of sequence cc when two letters picked without replacement from czmmaczmczcccmm? 1/7 Calculate prob of sequence ff when two letters picked without replacement from wfffwwfffwfwff. 36/91 Three letters picked without replacement from {h: 4, d: 10}. Give prob of sequence hdd. 15/91 Four letters picked without replacement from xxxxddxxxdx. What is prob of sequence dxdd? 1/165 Four letters picked without replacement from nffnnnnnnfff. Give prob of sequence ffff. 1/99 Three letters picked without replacement from {m: 5, k: 2}. Give prob of sequence kmk. 1/21 Three letters picked without replacement from roibq. What is prob of sequence rib? 1/60 Four letters picked without replacement from wrmrlllrmllwl. Give prob of sequence wwll. 1/286 Calculate prob of sequence miki when four letters picked without replacement from {z: 3, d: 1, i: 4, m: 1, k: 5}. 5/2002 What is prob of sequence ll when two letters picked without replacement from {l: 2, j: 3, d: 1, u: 1}? 1/21 Three letters picked without replacement from gggggpwjggggggwppwgw. What is prob of sequence ppg? 1/95 Two letters picked without replacement from ddddduujzzzdczjucd. What is prob of sequence uj? 1/51 What is prob of sequence fx when two letters picked without replacement from ifxkxoxxifxf? 5/44 Two letters picked without replacement from mfmfmmmmmfm. Give prob of sequence ff. 3/55 What is prob of sequence ree when three letters picked without replacement from {e: 6, r: 13}? 65/969 Calculate prob of sequence ffye when four letters picked without replacement from mffeymfyyv. 1/280 Four letters picked without replacement from {l: 14, q: 5}. Give prob of sequence lqll. 455/3876 What is prob of sequence ozn when three letters picked without replacement from {n: 3, o: 2, q: 1, b: 3, e: 1, z: 2}? 1/110 Three letters picked without replacement from kuguuuhksg. Give prob of sequence ugs. 1/90 Three letters picked without replacement from {e: 3, h: 3, j: 3, a: 3}. What is prob of sequence ahe? 9/440 What is prob of sequence guju when four letters picked without replacement from {g: 1, u: 2, j: 1}? 1/12 Two letters picked without replacement from aataajfkf. What is prob of sequence af? 1/9 Calculate prob of sequence hbh when three letters picked without replacement from {l: 2, b: 5, h: 3}. 1/24 Three letters picked without replacement from vlllnrnrnnyyrnnynl. Give prob of sequence yly. 1/204 Two letters picked without replacement from {r: 1, a: 3, n: 1, w: 5, j: 2, d: 1}. What is prob of sequence rj? 1/78 What is prob of sequence ndd when three letters picked without replacement from {n: 13, d: 3}? 13/560 What is prob of sequence ccw when three letters picked without replacement from ggggwcwcccgifgw? 6/455 Two letters picked without replacement from pppdc. What is prob of sequence pp? 3/10 What is prob of sequence vdd when three letters picked without replacement from {v: 2, d: 4, e: 6}? 1/55 Two letters picked without replacement from {l: 3, t: 7, j: 8, a: 2}. What is prob of sequence lj? 6/95 What is prob of sequence uhr when three letters picked without replacement from hrrmuu? 1/30 What is prob of sequence cw when two letters picked without replacement from wweccwbeecevbeveceec? 3/76 What is pro	{ "pile_set_name": "DM Mathematics" }
False Let l be 4(-4)/8 + 26. Let q = 41 - l. Is 4 a factor of q? False Suppose -21x + 27608 = 13x. Does 16 divide x? False Suppose 592 = f - 5f + 5r, -4f - 628 = 4r. Let u = -109 - f. Let b = 80 - u. Does 18 divide b? True Let z(l) = 4l*2 + 19l - 15. Let y be z(-11). Let d = y - 46. Is d a multiple of 13? False Suppose 4x - 23 = 53. Suppose 2c - x = 33. Is c a multiple of 12? False Let f(h) = h*3 + 33. Let m be f(0). Let w be 12/9 - m/(-9). Suppose -wz + 2u + 302 = 86, 2z = -5u + 69. Does 7 divide z? True Suppose -4f = -12, -4i + 5f = -i + 24. Let t be 7i6/21. Let p(v) = v*3 + 7v*2 - 10v - 15. Is 27 a factor of p(t)? True Let g be (0 - 1)1-2. Suppose gn + 42 = -0n. Let d = 26 + n. Does 2 divide d? False Let r = 153 + 207. Is r a multiple of 12? True Let l = -785 + 374. Let k = 593 + l. Is k a multiple of 28? False Is ((-4)/(-8))/(7/10052) a multiple of 7? False Let l be (-2)/(-3) + 20/6. Suppose -l = -2j + 2. Suppose -jo = -15 - 66. Is o a multiple of 9? True Let r = 202 - 73. Suppose -x - 4u + 70 = 0, -2x + 3u + r = -0u. Is 11 a factor of x? True Let s = 26 + -16. Suppose -3v + 38 = -8h + 3h, 5h - s = -5v. Suppose 0 = -a + va - 4u - 23, -47 = -5a - 4u. Is a a multiple of 2? False Let a(h) = h2 + 3h + 110. Is a(-9) a multiple of 4? True Let i(m) = -10m + 2. Let j be i(-1). Suppose 0 = o + 2b - j, -4o + 5b - 15 = o. Suppose 2n + on = 256. Does 20 divide n? False Let f(l) = -9l - 9 - 2l2 + l3 + 9l2 - 2l*2. Is f(-5) a multiple of 9? True Let u(i) = 6i*2 + 91i - 21. Is u(-19) a multiple of 16? True Let y be (-4)/(-10) + (-5736)/40. Let m = -93 - y. Let o = -1 + m. Is 20 a factor of o? False Suppose 3n - 127 = -4f, -10 - 26 = -2f + 4n. Suppose f = -5y + 128. Suppose j - 6j = -y. Is j a multiple of 3? False Let u = 11 - 4. Let f be (-1)/u - (-282)/14. Let k = -8 + f. Does 6 divide k? True Suppose 3w = -3h + 34 - 7, 16 = -w + 4h. Let d(y) = 11y - 1 + y - 8. Is 13 a factor of d(w)? True Suppose -12p + 33 = -3. Suppose 276 = 3v - v. Suppose pl = v + 66. Is l a multiple of 15? False Let d(a) = 7a. Let i be 8/(-6)-2 - 12/(-36). Is 3 a factor of d(i)? True Let p be ((-84)/(-16))/(3/4). Suppose -a = -pa + 24. Suppose af - i - 37 = 0, -4f + 23 = -3i - 24. Does 8 divide f? True Suppose 5t = 3k - 4615, 299k + 5t = 296k + 4655. Is k a multiple of 14? False Let s be (0 + 1 + -1)/(-2) - 4. Does 5 divide (25 + -4)/(0/s + 1)? False Is 18 a factor of 180044/115 - (-2)/5? True Let d = 144 + -264. Is 11 a factor of 70/(-4)(4 - d/(-21))? False Let r be (4/(-12))/((-3)/54). Is r - 2 - (1 + -69) a multiple of 8? True Suppose -p - 8 = -5b, p = 2p + 5b - 22. Suppose -o = -pz + 4z - 23, 2o - 4z - 36 = 0. Is o a multiple of 4? True Suppose -4o = -7o + 3. Let m(f) = 64f3 + 3f*2 - 1. Does 11 divide m(o)? True Suppose -2k - 20d = -24d - 264, k = 5d + 120. Is k a multiple of 10? True Suppose 2z - 40 = 5s, -s + 58 = 5z - 42. Suppose 4v + 4d = z, -4v - 4d + 8d + 44 = 0. Is 2 a factor of v? True Suppose d = 2y - 7y - 34, -4d = 5y + 46. Let t(q) = q3 + 7q*2 + 6q + 8. Let h be t(y). Is (189/12)/(2/h) a multiple of 24? False Let x = -775 + 877. Does 17 divide x? True Let g(l) = 39l - 213. Does 44 divide g(19)? True Let c be (-3168)/63 - (-4)/14. Let f = 95 + c. Does 9 divide f? True Let v(m) = m3 + 10m*2 - 12m + 5. Let p be -2((-9)/6)/3. Let j be (-32 - p)2/6. Is v(j) a multiple of 5? False Suppose -5h - 3a - 182 = 0, -5h - 4a - a - 190 = 0. Let q(w) = 13w + 26. Let r be q(-7). Let o = h - r. Does 20 divide o? False Suppose 4u = -0u + 16. Let c be 2 + u/4 + 1. Suppose -135 = -ck + k. Is 9 a factor of k? True Suppose -5l - 3858 = -2n, -2n - 306l + 309l + 3858 = 0. Does 62 divide n? False Suppose 3t - 5t = -396. Suppose -6l + 4l + t = 0. Suppose -14v + 17v = l. Is 11 a factor of v? True Suppose -c + 24 = 3c. Let p be 758/12 + (-1)/c. Suppose -p = -3q + 6r - 3r, 3r - 33 = -3q. Does 4 divide q? True Let i be (-1)/(2(-1)/4). Suppose -ib - b + 9 = 0. Let v = 24 - b. Is 9 a factor of v? False Is (-965831)/(-2575) - 2/25 a multiple of 6? False Suppose m = -2m + 4y + 165, -3m + 165 = -3y. Suppose -265 - m = -5v. Suppose -4t + 95 = -5x + 31, -v = -4t + x. Is t a multiple of 6? False Suppose -103k - 1212 = -109k. Is 4 a factor of k? False Suppose -4x = -8, -2k - 31 = -5k - 5x. Suppose -q - 4 = -s, -s + kq = 2q - 12. Suppose -sj = -6j, u - 29 = -3j. Is 18 a factor of u? False Let v(x) = -x*3 - 41x*2 - 5x + 109. Does 24 divide v(-41)? False Let g(m) be the first derivative of 11/2m2 + 12m - 1/3m3 - 1. Is 12 a factor of g(11)? True Suppose -5n + 2l - 140 + 470 = 0, 15 = 3l. Suppose -f + 2w + 31 = 0, -n + 210 = 4f + w. Let k = f - 25. Is 5 a factor of k? True Suppose -21g = -32g + 1980. Is g a multiple of 6? True Suppose 5l = 6l - 3. Suppose 2p + 48 = 2q, -lp + 2 = -10. Does 7 divide q? True Let m be 4/(-3) - 2/(-6). Let u = m + 0. Is 9 a factor of u/(-7) - 522/(-21)? False Let n(s) = s3 - 5s*2 - 6s - 8. Let y be n(6). Let v be y/16 - 5/(-2). Suppose -2p = 2l - 124, 2p - vl - 85 = 39. Does 9 divide p? False Let z be (-6)/(-33) + 525/77. Suppose 0 = -5c - 5r + 175, -c + r + 18 = -z. Is 6 a factor of c? True Is 10 a factor of 1310/35 + (-21)/49? False Let j = -59 - -63. Suppose 4f + 2a = ja + 418, 4a = 20. Is f a multiple of 30? False Let t = 286 + -222. Does 11 divide t? False Let u = 1374 + 333. Does 35 divide u? False Let z(f) = -f*3 - 5f*2 - 5f + 4. Let n be z(-3). Suppose -3g = 0, 3g = 4p - 13 + n. Is 3 a factor of p? True Does 60 divide (-2)/(4/(-1398)) - -10? False Let w = 223 + -149. Let t be (-20)/50 - w/(-10). Is 9 a factor of ((-36)/t)/((-1)/7)? True Let i(h) = h3 + h2 - h + 12. Let s be i(0). Let o = s + 28. Is 20 a factor of o? True Suppose 2t + 774 = 11t. Suppose 0 = w - 4n - 14, -w - 3w = -n - t. Is w a multiple of 11? True Suppose 1 = -5r + 16. Let p(z) = -1 + 3z - 2z3 - z2 + 0z + 9z*r - 2z. Is p(1) even? True Suppose 0 = c - 7 - 231. Does 5 divide c? False Suppose -598 = -2t + 3b + 671, -t + 662 = 4b. Is t a multiple of 55? False Let w = -4 - -5. Let z be (-1 + w)/(-4 - -3). Suppose -4l + 89 - 13 = z. Is l a multiple of 19? True Let o be 2/(-6) + (-805)/(-3). Suppose -4h + 283 - 20 = 5y, o = 4h + 4y. Does 9 divide h? True Suppose -60n = -26n - 2346. Is n a multiple of 23? True Let i be 0/(((-1)/(-1))/1). Let k = i - -41. Suppose 4n = w + k - 8, -n + 3w = 0. Is 9 a factor of n? True Let t be 20/(-6)(-39)/26. Suppose 0 = -p + t, -5p + 8 + 7 = -5x. Suppose -3r - 497 = -4z, 0z = -4z + xr + 502. Does 28 divide z? False Let l(t) = -t*3 - 4t*2 + 21t. Let d be l(-7). Suppose -244 = -2x + 4b, x + 4b = 6x - 616. Suppose -i - i + x = d. Is i a multiple of 16? False Let x be (-1 + 1 - -5) + -3. Suppose -4k - 32 = -3q - xk, 4k - 68 = -5q. Is (-220)/(-6) - 8/q a multiple of 12? True Suppose 5p = 12 + 3. Suppose 7o - 400 = -po. Is o a multiple of 7? False Suppose 64 = -7z + 505. Is z a multiple of 21? True Let l(d) be the third derivative of d5/4 - d4/12 - d3/6 - 9d*2. Let t be l(-1). Let n = 61 - t. Does 15 divide n? True Let x(q) = -26q*2 + 9q*2 - 2q*3 - 3q + 7 + 11q2. Does 23 divide x(-6)? False Let k = -3141 - -5281. Is 107 a factor of k? True Suppose 8p = 5v + 6p - 556, -101 = -v - 3p. Is v a multiple of 6? False Suppose -301 = -0o - 3o - 5y, 4o + y = 390. Does 4 divide o? False Suppose -3 = 3u - 0. Is 31 a factor of (-1(0 - u))/((-2)/326)? False Let p = 10 + -52. Let w = -20 - p. Does 11 divide w? True Let a(o) = 100o*2 - 6o - 10. Is a(-2) a multiple of 21? False Suppose -5i + 0i + 2h = -29, -2i + 4h = -18. Suppose -v - v + 129 = 3a, 0 = 5a + iv - 210. Is a a multiple of 5? True Let m(c) = c + 3. Let v be m(-3). Let n(q) = -6q - 3q*2 - 2 + vq + 5q2 + 1. Is n(4) even? False Let l = 27 + -45. Is (-45)/6l/15 even? False Suppose -6x = 26x - 18496. Does 21 divide x? False Let b be (-5 + 4 + 3)1. Suppose -c + bc - 5d = 671, 0 = -5c - 5d + 3235. Suppose -5k + c = 146. Is 17 a factor of k? False Let q be (-11 + (-187)/(-22))/((-1)/2). Let t(x) = 3x*2 - x. Let h	{ "pile_set_name": "DM Mathematics" }
et i(s) = 11s3 - 36s*2 + 77s - 43. Let k(j) = -18i(j) + 5l(j). Factor k(w). -3(w - 2)3 Let f = 145 + -144. What is h in -3/2h + f + 1/2h3 + 0h*2 = 0? -2, 1 Suppose -8 - 1 = x - 2g, 5g = -3x + 17. Let a = 3/2 + x. Solve -ab + 0b*2 - 1/2b5 + b3 + 0b4 + 0 = 0 for b. -1, 0, 1 Let k(f) = f4 - f3 - 2f2 + f. Let t(y) = y4 + y*3 - y. Let g(j) = k(j) + t(j). Factor g(c). 2c*2(c - 1)(c + 1) Let x(a) = a2 + 4a - 3. Let d be x(-5). Factor 0u + 3u + u2 - u2 - 3ud. -3u(u - 1) Let z(w) = -w - 2. Let d be z(-6). Factor -dg*2 - g + 5g - 1 + 3g2 - 3. -(g - 2)2 Let t(w) = 4w*2 + 9w - 9. Let u(m) = -5m2 - 10m + 10. Let i = -3 + 6. Let s be (-1)/((i/18)/(-1)). Let a(x) = st(x) + 5u(x). Factor a(d). -(d - 2)*2 Let a(o) = 3o - 30. Let l be a(11). Let q(z) be the third derivative of 0z + 0 - 4/15zl + z2 - 1/300z6 + 1/50z*5 + 0z*4. Factor q(s). -2(s - 2)*2(s + 1)/5 Let w = 3 - 4. Let d be (-4 + (1 - -1))w. Factor 2b + 2 - 2b - 2b*d. -2(b - 1)(b + 1) Let c(q) be the second derivative of 1/36q*4 - 3q + 1/9q3 + 1/6q*2 + 0. Determine l so that c(l) = 0. -1 Let x be (-4)/10 - (-66)/15. Factor 8q*3 + 0q3 - q3 + xq4 - q + 2q*2. q(q + 1)*2(4q - 1) Let w(z) be the second derivative of 1/9z*4 + z + 0 + 4/9z*3 + 8/9z*2 + 1/90z*5. Let w(k) = 0. Calculate k. -2 Let c(d) = -d - 11. Suppose w = g - 2w - 2, 6 = -2g + 4w. Let z be c(g). Determine k so that 1/3k3 + 0 + 0k*z + 0k + 0k4 - 1/3k5 = 0. -1, 0, 1 Let o(u) be the first derivative of u7/210 - u6/40 + u5/20 - u4/24 + u2 + 8. Let p(n) be the second derivative of o(n). Let p(r) = 0. What is r? 0, 1 Let b(x) be the first derivative of 4x3/3 + 2x*2 - 8x - 5. Find t such that b(t) = 0. -2, 1 Let b(p) be the third derivative of 8p7/21 + 5p*6/3 - 29p*5/4 + 175p*4/24 - 10p*3/3 + 31p*2. Determine t so that b(t) = 0. -4, 1/4, 1 Let f = 9 - 3. Let q(x) be the second derivative of 1/135x*f + 0x*2 + 1/54x*4 + 1/45x*5 + 0x*3 + 0 - 2x. Let q(g) = 0. What is g? -1, 0 Let m(u) be the first derivative of 5u3/4 - 55u*2/8 - 5u + 14. Factor m(n). 5(n - 4)(3n + 1)/4 Let u(n) be the first derivative of -2n*6/3 - 8n5/5 - n4 - 6. Factor u(l). -4l3(l + 1)*2 Let k be 0 + -3 - (1 + -4). Let p(q) be the third derivative of kq*3 + 0q*5 + 2q*2 + 1/180q*6 + 0q + 0 + 0q4. Suppose p(m) = 0. What is m? 0 Let p be -2 + (-32)/(-18) + 8/36. Factor 0 + 2/5a*5 + 0a + pa4 - 2/5a*3 + 0a*2. 2a*3(a - 1)(a + 1)/5 Suppose 32 = 8m + 8m. Let h(v) be the second derivative of 2v + 1/20v4 + 0 - 3/10v*m + 0v*3. Factor h(u). 3(u - 1)(u + 1)/5 Let r(c) = -4c2 - 8. Let j(g) = g2 - g. Let n(z) = -6j(z) - r(z). Solve n(l) = 0. -1, 4 Suppose o + 7c - 4c + 21 = 0, 0 = -3c. Let m = -19 - o. Let 0 + 1/5zm + 1/5z = 0. Calculate z. -1, 0 Let l(j) be the third derivative of j8/16800 + j7/12600 - j6/900 + j5/20 - j2. Let p(r) be the third derivative of l(r). Let p(g) = 0. What is g? -1, 2/3 Let u(r) be the third derivative of r7/11340 + r6/810 + r5/135 + r*4/3 - 4r*2. Let d(i) be the second derivative of u(i). Solve d(h) = 0. -2 Suppose -5a - 2q - 6 = -6a, -3a - 2q = -2. Factor -o - 1/3o3 - oa - 1/3. -(o + 1)3/3 Let j(w) be the third derivative of 0w - 5w2 - 1/180w*5 - 1/18w*3 + 1/36w*4 + 0. Suppose j(m) = 0. What is m? 1 Let p(v) be the first derivative of 1/360v*6 + 1/24v*4 + 1/60v*5 + 0v*2 - 1/3v*3 + 2 + 0v. Let s(y) be the third derivative of p(y). Factor s(l). (l + 1)*2 Suppose -4j = -2u - 78, -8 = 5u - 3. Factor -2h3 - 24h + h*2 + 16 + jh*2 - 8h*2. -2(h - 2)*3 Factor 1 + x - 3/4x*2. -(x - 2)(3x + 2)/4 Let r(z) = -36z*3 - 39z*2 + 12z - 15. Let f(m) = 9m3 + 10m*2 - 3m + 4. Let h(v) = 15f(v) + 4r(v). Factor h(s). -3s(s + 1)(3s - 1) Let t(u) be the second derivative of -u*6/10 + 9u5/20 + u4/4 - 3u3/2 + 6u. Factor t(i). -3i(i - 3)(i - 1)(i + 1) Suppose -24 = -b - b. Find h such that -5h2 + 13h + 2h3 - bh*3 - 2h4 - h2 + 5h = 0. -3, 0, 1 Let i be 1 - 0 - (-2 - 0). Suppose -iv + t = -3t + 8, -8 = v - 4t. Factor v + 4/9j2 - 2/9j - 2/9j3. -2j(j - 1)2/9 Let t(h) be the third derivative of 2/1155h*7 + 0h*6 + 0h - 1/165h5 - 1/132h*4 + 0 + 1/1848h*8 + 0h*3 + 5h*2. Suppose t(s) = 0. What is s? -1, 0, 1 Let t = -61 - -17. Let p be 3/(-12) + (-11)/t. Determine b, given that 9/4b*3 + 5/4b*5 - 1/2b*2 - 3b*4 + p + 0b = 0. 0, 2/5, 1 Let x = -20 - -26. Let u = x + -4. Factor 4/7y3 + 0y - 2/7y4 - 2/7y*u + 0. -2y*2(y - 1)*2/7 Suppose -f - 4f + c = -2, -2c = 4. Factor -1/4g + f - 1/4g2. -g(g + 1)/4 Let y = -69 - -211/3. Factor 0 - yj - 4/3j*2. -4j(j + 1)/3 Let 3/2q*2 + 0q + 0 + 1/2q3 = 0. What is q? -3, 0 Let x(f) be the first derivative of -3f*5/20 + 3f4/16 + f3/8 - f + 4. Let u(m) be the first derivative of x(m). Solve u(w) = 0. -1/4, 0, 1 Let x(d) be the third derivative of d7/70 + d6/10 + d*5/5 + 5d*2. Factor x(v). 3v*2(v + 2)*2 Let o = -1 - -7. Suppose 3b - 2k - o = 0, -2b + 3b + 6 = -2k. Factor 2/3t2 + 1/3t*3 + 1/3t + b. t(t + 1)2/3 Let f = 2/131 - -248/917. Factor -fy*2 + 1/7y + 0. -y(2y - 1)/7 Let q = 29/8 - 601/168. Let k(t) be the first derivative of 16/7t + qt*6 + 4t*2 + 25/14t*4 + 16/35t*5 + 2 + 76/21t3. Find n such that k(n) = 0. -2, -1 Let k(x) be the third derivative of x7/735 - x6/420 - x5/210 + x*4/84 - 12x*2. Find w such that k(w) = 0. -1, 0, 1 Let p(c) be the first derivative of -2/21c*3 - 2/7c - 2/7c2 - 1. Suppose p(f) = 0. What is f? -1 Suppose -2y - 40 = 3y. Let l be y/20(-30)/3. Solve -5/3k3 + 3k*2 + 2/3 - 7/3k + 1/3kl = 0. 1, 2 Let 15/4 + 3/4j*2 - 9/2j = 0. Calculate j. 1, 5 Let z(t) be the third derivative of t*6/300 + 2t5/75 + t4/20 - 11t2. Factor z(m). 2m(m + 1)(m + 3)/5 Suppose 4m = m + 9. Suppose mv = 2v. Solve 1/2z - 1/2z2 + v = 0. 0, 1 Let -19o*2 + 2 + 5o*3 - 11o*2 - 2 + 25o = 0. Calculate o. 0, 1, 5 Let w = -5256/17 + 1261559/4080. Let c(t) be the third derivative of 0t3 + 0 - wt*5 - 1/48t4 + t2 + 0t. Find g such that c(g) = 0. -2/7, 0 Let m(o) = -3o - 5 + 1 + 2o - 2. Let j be m(-8). Suppose 2p - 4p2 + 3p*2 + 1 - jp = 0. What is p? -1, 1 Suppose -2s - k = -6, 4s - 3k - 2k = 12. Factor -4n3 - ns + 0n*3 + 3n*3 + 2n*2 + 4n. -2n(n - 2)(n + 1) What is d in -1/4d*3 + 0d + 1 - 3/4d2 = 0? -2, 1 Factor 1/6t + 0 + 8/3t4 + 4/3t*3 - 7/6t*2. t(t + 1)(4t - 1)*2/6 Suppose 4k - 34 = -3y + 41, 0 = 3k - 5y - 49. Suppose 4p - 3q - 13 - k = 0, 3p - 2q - 23 = 0. Solve -7n + 2n4 + pn - 2n3 = 0. 0, 1 Let q be 122/240 + ((-9)/(-6))/(-3). Let j(t) be the third derivative of 0t + 0 - qt5 + 3t*2 + 1/12t*3 + 1/240t*6 - 1/48t4. Factor j(p). (p - 1)2(p + 1)/2 Let n(s) be the second derivative of s5/20 + s4/6 - s3/6 - s2 - 7s. Factor n(y). (y - 1)(y + 1)(y + 2) Let h(u) be the first derivative of -2u3/15 + 5u*2/3 - 16u/15 + 66. Solve h(d) = 0. 1/3, 8 Let u(t) be the third derivative of -5t8/336 + 5t7/42 - t6/3 + t*5/3 - 11t*2. Factor u(m). -5m*2(m - 2)*2(m - 1) Factor 10w4 - 15w*4 - 29w + 5w3 + 20w*2 + 9w. -5w(w - 2)(w - 1)(w + 2) Let 0 + 2/7d2 - 2/7d = 0. What is d? 0, 1 Let m be 10/15 + 4/(-6). Suppose -r + 4 + 0 = m. Suppose -2/7j3 + 0 - 2/7j*r + 0j + 0j2 = 0. Calculate j. -1, 0 Let k(x) = 2x. Let r be k(1). Let i(g) be the first derivative of -2 - 4/7g - 2/21g*3 + 3/7gr. Determine q so that i(q) = 0. 1, 2 Let f(s) be the second derivative of -s5/170 + 2s4/51 - 5s*3/51 + 2s*2/17 + 8s. Determine b so that f(b) = 0. 1, 2 Let w(p) be the first derivative of -4p5/5 - 2p*4 - 4p*3/3 - 10. Factor w(j). -4j*2(j + 1)*2 Suppose 2v + 7v = 198. Let w = v + -22. Factor 0 - 2/9d*4 + wd*3 + 2/9d*2 + 0d. -2d2(d - 1)(d + 1)/9 Suppose -6 = -4o + 2. Let i = -18 + 22. Factor -9zi - 3z*2 + oz5 + z5 + 0z5 + 9z*3. 3z*2(z - 1)*3 Let k(j) be the second derivative of 0 + 1/35j	{ "pile_set_name": "DM Mathematics" }
61 Put -0.2, 3, -0.18, 67 in decreasing order. 67, 3, -0.18, -0.2 Put -3, 1/9, 1/3, -38, -10/7 in descending order. 1/3, 1/9, -10/7, -3, -38 Put 5, -185720, 3 in decreasing order. 5, 3, -185720 Sort -17, -243, 11 in decreasing order. 11, -17, -243 Put -11, 7, -600 in descending order. 7, -11, -600 Sort -3, -11161, 26, -5 in ascending order. -11161, -5, -3, 26 Put -1466, 0.2, 3, 1 in decreasing order. 3, 1, 0.2, -1466 Sort -2, -5, 21, 1 in increasing order. -5, -2, 1, 21 Put -36034, -4, -2 in descending order. -2, -4, -36034 Sort 0.4, 3042.6, 0.1. 0.1, 0.4, 3042.6 Sort 1, -3, -2, 3, 23 in descending order. 23, 3, 1, -2, -3 Put -3, -4, -20, -10/3, -33 in decreasing order. -3, -10/3, -4, -20, -33 Sort -0.017, -0.2, 15, 5, -5 in decreasing order. 15, 5, -0.017, -0.2, -5 Sort 16, -84, 15 in ascending order. -84, 15, 16 Put -499, -2/9, -3/14, -0.1 in descending order. -0.1, -3/14, -2/9, -499 Put 4, -36, 26, 12 in increasing order. -36, 4, 12, 26 Sort -1, 3/6524, 3, 0 in decreasing order. 3, 3/6524, 0, -1 Sort 33, 5, -2, 2, 9, 147 in descending order. 147, 33, 9, 5, 2, -2 Sort -0.5, -27, -2/9, -17281 in decreasing order. -2/9, -0.5, -27, -17281 Sort 78.1, -0.5, -2/831, -5 in decreasing order. 78.1, -2/831, -0.5, -5 Put 56, -24, 5, 0 in decreasing order. 56, 5, 0, -24 Sort 0.9, -245, -2 in descending order. 0.9, -2, -245 Put -0.1, -21, 5/6, 1, -10 in descending order. 1, 5/6, -0.1, -10, -21 Sort 4, 32, 17, 2, 5 in decreasing order. 32, 17, 5, 4, 2 Put 0, 11, -14, 10 in descending order. 11, 10, 0, -14 Put -2, -4, -1085, 6 in increasing order. -1085, -4, -2, 6 Put 92/7, 0.42, 5 in descending order. 92/7, 5, 0.42 Sort -2/39, -2/3, 0.1377. -2/3, -2/39, 0.1377 Put 4, -1/6, 13, 5, -31 in increasing order. -31, -1/6, 4, 5, 13 Sort 2/3, -0.12, 3/2, 2.86. -0.12, 2/3, 3/2, 2.86 Put 1, -15.4, -3, 4/5, 17/3 in decreasing order. 17/3, 1, 4/5, -3, -15.4 Sort 4, -4, -3574, 7, 3, -3 in decreasing order. 7, 4, 3, -3, -4, -3574 Put -10, -1/7, 2/3, -1.6, -8 in increasing order. -10, -8, -1.6, -1/7, 2/3 Sort -12, -81, -134, 4 in increasing order. -134, -81, -12, 4 Sort 11851, -2, -4, -1, -7, 3 in ascending order. -7, -4, -2, -1, 3, 11851 Sort -21, 24, 3, 159 in increasing order. -21, 3, 24, 159 Sort -2/5, -3/5, 70, 0.05, -3/16 in increasing order. -3/5, -2/5, -3/16, 0.05, 70 Put 2, 1, -2, 4, 56, 27 in descending order. 56, 27, 4, 2, 1, -2 Sort -64, 7, -3, -51 in ascending order. -64, -51, -3, 7 Put 3, 4, -3, 391, -5 in increasing order. -5, -3, 3, 4, 391 Sort 3, 4, -146949 in decreasing order. 4, 3, -146949 Sort 1, 10026, -4, 0.4, -0.1. -4, -0.1, 0.4, 1, 10026 Put -1/4, 9.6, -2/7, -2 in descending order. 9.6, -1/4, -2/7, -2 Put 0.1, 1/5, -8, -11.8, 6 in decreasing order. 6, 1/5, 0.1, -8, -11.8 Put -98, -7/2, -18 in decreasing order. -7/2, -18, -98 Sort -2, -16, 4, -4, 25. -16, -4, -2, 4, 25 Sort -38, -5, -121 in ascending order. -121, -38, -5 Put -0.01, -195, 20, -0.5, 1/6 in descending order. 20, 1/6, -0.01, -0.5, -195 Put -6, 4, 5, -2, -51 in increasing order. -51, -6, -2, 4, 5 Sort 29, -27/13, 0.1 in decreasing order. 29, 0.1, -27/13 Put 5, -3, -130, -2 in descending order. 5, -2, -3, -130 Put 0.2, 5, 1, 3863.9 in decreasing order. 3863.9, 5, 1, 0.2 Sort -2, -4, 0, 8041 in decreasing order. 8041, 0, -2, -4 Sort 1303, 2, 1, 4 in descending order. 1303, 4, 2, 1 Sort -9, 463, -3, 2 in descending order. 463, 2, -3, -9 Sort -862, 0, 0.4. -862, 0, 0.4 Sort -2, -14, 1, -21, -1. -21, -14, -2, -1, 1 Put -1, -7, 1 in ascending order. -7, -1, 1 Put -69, -3, 874, 3, -5 in descending order. 874, 3, -3, -5, -69 Put 0, -115, -5, -1/3, 1222 in descending order. 1222, 0, -1/3, -5, -115 Sort 6/19, 2640, -0.2, 3 in ascending order. -0.2, 6/19, 3, 2640 Put -41, -8, -2, -5, 5, -3 in descending order. 5, -2, -3, -5, -8, -41 Sort -0.2, -0.91, 1147, -2/5. -0.91, -2/5, -0.2, 1147 Sort -4, 52, 0, 22, -1 in descending order. 52, 22, 0, -1, -4 Put 2, 4/11, -2, 0.0273, -2/9 in increasing order. -2, -2/9, 0.0273, 4/11, 2 Sort -388, -0.1, 0.4. -388, -0.1, 0.4 Sort -189, 2, -3, 11. -189, -3, 2, 11 Sort -2, 0.13, -682. -682, -2, 0.13 Put -56, -55/8, -5 in descending order. -5, -55/8, -56 Sort 4.3, 0, 0.23, 2/5, -0.4 in descending order. 4.3, 2/5, 0.23, 0, -0.4 Put 2, 7/69, -32 in descending order. 2, 7/69, -32 Sort 24, 1, -1, -5, 5. -5, -1, 1, 5, 24 Sort -4, -3184, 4, 2/3 in increasing order. -3184, -4, 2/3, 4 Sort -7, 2, -3, -28, 21 in ascending order. -28, -7, -3, 2, 21 Put 24, 0.2, -84, -0.04 in decreasing order. 24, 0.2, -0.04, -84 Sort -304, 4, 1, -0.06, 5, 3/2 in descending order. 5, 4, 3/2, 1, -0.06, -304 Put -3, 3, -34, -5, -8 in descending order. 3, -3, -5, -8, -34 Sort 9, -15, 0, 1, 422 in descending order. 422, 9, 1, 0, -15 Sort 0, 8.948, 0.1, 1. 0, 0.1, 1, 8.948 Sort -357, 0, -1, 3, -2, -4 in decreasing order. 3, 0, -1, -2, -4, -357 Put -26, 8, -7, -15 in ascending order. -26, -15, -7, 8 Sort 7, -3545, 0.02. -3545, 0.02, 7 Put 4, -656, -42, -5 in decreasing order. 4, -5, -42, -656 Sort -0.02, 0.068, -4, 0.3, 5, -0.2. -4, -0.2, -0.02, 0.068, 0.3, 5 Put -2/9, -7, 2140, 0.2 in decreasing order. 2140, 0.2, -2/9, -7 Sort -3, 4, 2, -30627. -30627, -3, 2, 4 Sort 73, -3265, 2. -3265, 2, 73 Sort 4, 96, -479, 1 in decreasing order. 96, 4, 1, -479 Put 0.01, -1, -3/2, -4433, -1/4 in increasing order. -4433, -3/2, -1, -1/4, 0.01 Put 2/13, 7/9, -3, -3.9, 12, -2 in decreasing order. 12, 7/9, 2/13, -2, -3, -3.9 Sort 4.82, -2/651, 16 in ascending order. -2/651, 4.82, 16 Put -64139, -0.2, 3, 4 in decreasing order. 4, 3, -0.2, -64139 Sort 2/3, 2, 0.3, -9, 0.1 in decreasing order. 2, 2/3, 0.3, 0.1, -9 Sort -4, 7146, 3 in decreasing order. 7146, 3, -4 Put 0.7, 5, 0.3, 3, 215, -0.01 in descending order. 215, 5, 3, 0.7, 0.3, -0.01 Sort -1, -233, 4, 1, 0 in descending order. 4, 1, 0, -1, -233 Put -1/3, -49, 5 in decreasing order. 5, -1/3, -49 Sort 0.4, 0.3, 1, 17, -14/31 in descending order. 17, 1, 0.4, 0.3, -14/31 Sort -1/5, -4, 13.48, 0.2 in increasing order. -4, -1/5, 0.2, 13.48 Sort 1/5, -458, -0.8, 0.1, -3, -0.5. -458, -3, -0.8, -0.5, 0.1, 1/5 Put 0, 126, -21, -105, 1 in decreasing order. 126, 1, 0, -21, -105 Sort -2/21, -102, -0.5, -2/5 in ascending order. -102, -0.5, -2/5, -2/21 Sort -2/7, 4/7, -3, 3/8, 6 in descending order. 6, 4/7, 3/8, -2/7, -3 Put 2/1089, -2/15, 1, 2/7, 5 in increasing order. -2/15, 2/1089, 2/7, 1, 5 Put -5, 3/13, 3, -21 in decreasing order. 3, 3/13, -5, -21 Sort -49, -3, 34, 19 in ascending order. -49, -3, 19, 34 Sort -5, 11, 199, 4, 51. -5, 4, 11, 51, 199 Put -1/6, -3.3, -1, -0.3, 1, 126 in descending order. 126, 1, -1/6, -0.3, -1, -3.3 Put -2, 1/6, -8, -40083, 2/5 in ascending order. -40083, -8, -2, 1/6, 2/5 Put -5, -32, -2047, 1 in increasing order. -2047, -32, -5, 1 Put -983, 2, -5, -33 in ascending order. -983, -33, -5, 2 Sort 5, -1, 2, 324 in ascending order. -1, 2, 5, 324 Sort 1, 0, -18, 11, 3. -18, 0, 1, 3, 11 Sort 12/11, -0.6, 1/43, -0.2. -0.6, -0.2, 1/43, 12/11 Put 36, -1, -563 in ascending order. -563, -1, 36 Sort -1/7, 5, -3/2, -3, 54/101, 0.5 in increasing order. -3, -3/2, -1/7, 0.5, 54/101, 5 Put -56, 0, 17, 5, -15 in decreasing order. 17, 5, 0, -15, -56 Sort 0.1116, 0.7, 0 in ascending order. 0, 0.1116, 0.7 Sort -1/3, -3, -0.06, -1.58, 0.06 in descending order. 0.06, -0.06, -1/3, -1.58, -3 Put 6, 61, 0, 148, -4 in descending order. 148, 61, 6, 0, -4 Put -454, -1, -420, -2 in decreasing order. -1, -2, -420, -454 Put 3, 6, -5, 4, -81 in increasing order. -81, -5, 3, 4, 6 Put -1, -10/21, 1, -4/7, 9, 4 in descending order. 9, 4, 1, -10/21, -4/7, -1 Put -0.06, -114, -0.42 in descending order. -0.06, -0.42, -114 Sort 6, 4, 2, -46, -11 in decreasing order. 6, 4, 2, -11, -46 Sort 2, 3, -10, 7, -5. -10, -5, 2, 3, 7 Put -2/43, -2634/7, 2, 5 in decreasing order. 5, 2, -2/43, -2634/7 Sort -20, -272, 0, 3 in increasing order. -272, -20, 0, 3 Put 2140, 2, -2 in decreasing order. 2140, 2, -2 Put 1, 0, 6452 in increasing order. 0, 1, 6452 Put 1542, 4, 15 in ascending order. 4, 15, 1542 Sort 33, 4, -887, -4, -1 in descending order. 33, 4, -1, -4, -887 Put 2, 1541, 3, -5 in increasing order. -5, 2, 3, 1541 Put 5, -36, 4, 16, -120, 3 in decreasing order. 16, 5, 4, 3, -36, -120 Put -0.23, 4/25, -2/8033 in decreasing order. 4/25, -2/8033, -0.23 Put -5, 0.2, -2, 10, -37/33 in ascendin	{ "pile_set_name": "DM Mathematics" }
+ 38, -4d = 2t + 30 for t. -5 Let t be (0/1)/(1/1). Let p(o) = -5o - 6. Let s be p(-5). Suppose sx = 29x - 90. Solve -2r + b = t, xr - 3 = 4r + 4b for r. -1 Let x(p) = -p3 - 9p*2 - 51p - 238. Let w be x(-7). Solve -5b + 14f - 24 = 17f, -3b - 4f - w = 0 for b. -3 Let t(z) = 5z*2 - 5z - 4. Let k be t(-1). Suppose 4j - i + ki = 12, -5i = 0. Solve -jw - d = -7, -d - 40 = -5w + 3d for w. 4 Let k = 8 - 7. Suppose 2m - 3q = 7, -m = -3m - 2q + 2. Solve 2c - w = w - m, c = -w - k for c. -1 Suppose -5a = -5y - 55, -2 = 2y + 2. Suppose 0 = -7b - ab + 6b. Let m(h) = h2 + 6h. Let i be m(b). Solve i = 2p - v - 8, 3p - 19 - 3 = 4v for p. 2 Suppose k + 1 = -d + 2k, -3k + 5 = -2d. Let m(w) = 22 + dw + 0w - w. Let l be m(-13). Solve 2h + h - l = s, 4s = 12 for h. 4 Suppose 16t + 24 = 22t. Suppose -tl - 25 = -9l. Solve 4q + 40 = -ld, 0d - 2q = -2d + 2 for d. -4 Suppose -5u = 5l + 15, -23 = -5l + l + 3u. Solve -lx - q = -5x - 1, -x + 4q - 4 = 0 for x. 0 Let d be 12 + -7 + (1 - 0)/1. Let m(t) = -2t2 - 18t - 4. Let a be m(-8). Suppose 3j - a = -j. Solve -dg + g - r = -10, -4g + 27 = -jr for g. 3 Let b = -8829 + 8831. Suppose 2z - 12 = -2. Suppose zd - 5 - 5 = 0. Solve dw = -p - b, 3w = 5p + w + 10 for p. -2 Let l = 50 + -49. Let n(b) = 3b3 - b2 + 1. Let r be n(l). Suppose 9k - rp - 44 = 4k, -4 = -2p. Solve 0 = 3h + 4g + k, -3h - h - 3 = -5g for h. -2 Suppose -3s - 224 = 11s. Let o be (s/(-3))/(-8)3 - -6. Solve k + o = 3b - 0b, -4k = 5b + 16 for k. -4 Suppose -20y = -17y - 60. Suppose -18t = -yt - 122. Let z = -42 - t. Solve -4h = -5k - 2 - z, 4h = 4k + 16 for h. -1 Let q = -371 - -373. Let m = -311 + 315. Solve -2d + 4j + 26 = -md, qj = 3d - 1 for d. -3 Suppose 0 = 6u - 66u + 180. Solve 0 = f - 3a + u, -4f + f - 3a = -3 for f. 0 Suppose 148 = 49y - 97. Solve -yh + 3k - 2 = 0, 4h - 7h + 4k - 10 = 0 for h. 2 Suppose -4i + 12 = 2h - 6, -6 = -2h. Suppose -ik + 7k = -2r + 18, -13 = -5r - 2k. Solve q = -3u - 5, r + 1 = -2u for q. -2 Let s be (112/48)/(0 + (-3)/(-9)). Suppose 0 = -5l - 4 + 9, -s = -2w - l. Solve 5u - 10 = -i, -2i - 4 = -wi + u for i. 5 Suppose -55 + 951 = 4u. Suppose -4o = -8o + u. Let m = o + -40. Solve -m = 3s - 5z, 3s - 2z = 4s - 13 for s. 3 Let t(g) = -g*3 + 18g*2 + 51g - 217. Let n be t(20). Solve -m - 15 = 4i, m - 10 = -nm - 2i for m. 5 Let q be (((-40)/48)/(12/(-18)))/((-10)/(-120)). Solve 6 = 2o + 4h, 0 = 3o + 2h + 2 - q for o. 5 Let r(j) = -312j - 9977. Let k be r(-32). Solve -m - k = -2a + 4a, -a = 3m - 4 for m. 3 Let j = 4 - -1. Suppose -jz = 3l - 96, -6z + z - 2l + 94 = 0. Suppose 4y = -2y + z. Solve -4d = -yv + 32, 5d + 7v = 3v - 9 for d. -5 Suppose 0u + 5x - 85 = -5u, -x = -5u + 79. Let v be (u/(-64) - (-81)/4)/1. Solve 5g + v = 0, 3n = 5g + 7 + 22 for n. 3 Let b be (-5)/(-10)(1 + (-5)/(-5)). Let i(s) = 6s + 9. Let q be i(b). Solve 31 = 2v - 4k + 1, -q = -4v - k for v. 5 Let m be (2/(-4))/(6/168). Let j be (-126)/3(-3)/((-147)/m). Solve 0 = 2g - 4w - 18, -3w + j = 2g - 5w for g. 3 Let r be -6(-2 - 0)/4. Let s be -32/(-12)(-2)/1. Let i be 141/94 + s/(-2). Solve 0 = -5h + 4l + 7, -ih - rl = -4h for h. 3 Let c be -23/(-39) - (-840)/(-52). Let j(v) = v2 + 10v - 93. Let w be j(c). Solve 2t + 4 = -5x, -8 = wx + x for t. 3 Suppose 0 = -12f + 1108 - 1048. Solve -fb + i + 15 = 0, -2i - 2i - 28 = -4b for b. 2 Suppose -s + 3 = 0, -8a - 3s - 31 = -3a. Let w be 52/a12/(-2). Let p = 47 - w. Solve 0y - 2g + 3 = y, -3g = 5y - p for y. 1 Let f be 4/(8/(-6)) - (-100)/756. Solve -5d = u + 10, 180 - 165 = -fd - 2u for d. -1 Let h(o) = 3o + 35. Let b be -1 + (2 + -1 - (-72)/9). Let m be (-86)/b + 8/(-32). Let u be h(m). Solve -1 - 2 = -a - 2q, -ua = 2q + 2 for a. -5 Suppose 0 = -4h + 3h + 2. Suppose -b + 13 = 20o - 17o, 3o + 3b - 15 = 0. Suppose 0 = 6g + og. Solve 3z - 6 = g, -p - 2z + 9 = hz for p. 1 Let g be (-492)/(-820) + 97/5. Solve 0 = 4x + 27w - 31w - g, -3w = 2x for x. 3 Let n(x) be the second derivative of 0 + 1/12x4 - 11/6x*3 + 3x*2 - 21x. Let r be n(12). Solve -3w = -2b + 3b - r, 0 = -3w + 2b + 9 for w. 5 Suppose 4a = -4x + 68, -45 = -4x + a + 33. Suppose 0 = -3h - x + 85. Solve n = 6n - 3v + 30, 5v = -n + h for n. -3 Let i(u) = -2u3 - u2 + 2u + 2. Let s be i(-1). Let x be 1(-2 - -6) - s. Solve -5q - xo + 1 = -4, -10 = -5q - 2o for q. 4 Let a(s) = -4s3 - s2 + s. Let x = -35 + 34. Let c be a(x). Suppose 5w + 5 = -4q, cw - 1 = -4q + 3w. Solve q = 4o - 2f - 30, 2f + 5 = -o for o. 5 Suppose 0 = 6r + 55 - 127. Suppose -rv + v - 5v = 0. Solve 4k + 9 - 3 = -2n, v = 5k - 2n + 30 for k. -4 Let u be -5 + (-13)/((-91)/21). Let g be ((-2 + -4)/u)/((-23)/(-69)). Solve -16 = z - 2y - 3, g = -z + y for z. -5 Suppose 8417b = 8402b + 75. Solve 5d = -bg - 4 - 6, 2g - 24 = 5d for g. 2 Let i(z) = -200z + 223. Let j be i(1). Solve -jn + 19n - 16 = -2a, -n = 4 for a. 0 Suppose -2x = -14 + 2. Suppose 2i + x - 26 = 0. Suppose -7d = -i - 11. Solve -1 + 9 = db + 5a, 2b = -2a for b. -4 Let y be (-3)/((-6)/52) - (878 + -881). Solve -ym + 34m - k + 1 = 0, -16 = 4m + 3k for m. -1 Suppose -4n = 5r + 60 - 114, -5n = -5r. Solve 0 = -5q + ra - 5, 0 = -4q + a - 4 for q. -1 Suppose 3m - 3p = 202 - 88, p = -2m + 64. Solve 4z + 9 = 5o, -5z - 1 = -30o + mo for z. -1 Let y be (12/(-21))/((-437)/133 + 3). Solve 0 = -4b - yv + 12, -b - v - 14 = -17 for b. 3 Suppose -16 = -z - 3z, -z = -5q - 14. Let g be (-1 + 3)/(q/(-1)). Let u = g - -3. Solve h - ub = -21, 0 = 3b + 2b - 20 for h. -5 Let p(n) = 12n + 4. Let l be p(2). Let z = -25 + l. Let c = 30 - 20. Solve -b + 2m = -10, zm = -b - 0m - c for b. 2 Let t be ((-3)/6)/(4/(-40)). Suppose 0 = -2p - 3p + 10. Suppose 4x + ts = -0x + 17, 5s = -px + 11. Solve 14 = -xd - w, 3d + 4w + 4 = -7 for d. -5 Let n(o) = -15o - 5 + 43 - 24o + 23o - o*2. Let r be n(-18). Solve 2p = 2g - 21 + 5, 0 = 5p - rg + 28 for p. -4 Suppose 156 - 55 = 101y. Solve -o + 4 = 2m + 1, 0 = 3m - 2o - y for m. 1 Suppose 9p - 20 + 38 = 0. Let x be (p + 1 - 4)/((-7)/21). Solve d - 2b - 10 = 4d, -d + 3b = -x for d. 0 Suppose 3p - 2h - 34 = -22, -2h = 2p + 2. Solve 5v + 13 = -3x, 3v - 2 + 10 = -px for x. -1 Let u be (60/132)/((-18)/(-198)). Solve -uc = 3i - 34, -254c + 5 = 5i - 256c for i. 3 Suppose 0 = -2o + 17 - 13. Let b = -70 - -73. Solve -q = -0q + oi + 1, -i = -bq + 18 for q. 5 Let t be (3/(-2))/(3/(-6)). Let l be ((-301)/(-70)-2 + 9)/((-28)/(-210)). Solve 0 = -tm + 3g - 3, -m - 4g - 9 = -lg for m. -5 Let v = -2844 + 2853. Solve 2s = -3z + 6, -v = -z - 7 for s. 0 Let s(m) = -64m - 61. Let v be s(-1). Suppose -5f + 47 = vo, 5o + f - 42 - 73 = 0. Solve 5c = b, -7c + 3c + o = 4b for b. 5 Suppose -5n = -129 + 99. Suppose 4 = -4w - 2k, k = -nw + 10w - 8. Solve -3t + 4z = 0, -2t = -t - z - w for t. 4 Let p = -24 + 28. Suppose 18 = 5y - 3k - 25, 4k = 5y - 49. Solve 2j + pu - 6 = 4, yu = -4j + 14 for j. 1 Let i(u) = -3u*2 - 35u - 17. Let t be i(-12). Let g(l) = -l*3 - 28l*2 + 28l - 26. Let w be g(t). Solve -3r = -wp + 12, -3p + 20 = -4r - r for p. 0 Let w = 511 + -515. Let t be (-3)/w - 215/(-172). Solve 5b = -10, 0c + 4b = -5c + t for c. 2 Suppose -21s - 27 = -26s - 2x, -3s = 2x - 17. Solve 15 = -4k - 5m, m - 12 = k + sm for k. 0 Suppose 136 = 2i + 122. Suppose -iu = 61 - 89. Solve us - 2f = -12, -4f + 5 = s - 1 for s. -2 Let u(n) = -1159n - 4627. Let f be u(-4). Solve c + j = 2, -4j - 2 = 3c - f for c. 1 Let h be 2 - (5 + (-6)/2). Suppose 212q - 211q - 5 = h. Solve -2l - 20 = 4b, l + q = -b - l for b. -5 Let a = -154 - -164. Suppose -4d + 66 = -a. Solve -4z - o + d = 3, 0 = -3z + o + 12 for z. 4 Let g be (45/105)/(2/14). Suppose 0 = gp + n - 31, 6 = 4p - 3n - 18. Let o be (-10)/(-3)p/5. Solve -5u - 2 = 3d - 28, -2u + d + o = 0 for u. 4 Suppose -5p + 3x = -36, -x - 26 = p - 5p. Let c be (3 - 6) + -1 + p. Solve 3g + z - 3 = cz, -18 = -3g - 4z for g. 2 Suppose -12r = -43r + 186. Suppose r = 3u + 5h, -2u + 10 = 4*h + 8.	{ "pile_set_name": "DM Mathematics" }
ssuming l is positive. l(-18/47) Simplify j(2/49)/j(-13/2) assuming j is positive. j(641/98) Simplify ((k/(k/k*0))/(kk(2/5)))(2/7) assuming k is positive. k(-2/5) Simplify (b(-6)bb(-1)/b)(-35) assuming b is positive. b*245 Simplify bb*3b*4b*5b/b(3/2) assuming b is positive. b(25/2) Simplify ((m((mmm(-1)m)/m)/m)5)(-5/9) assuming m is positive. m(-25/9) Simplify f(-1)/((ff(-7)f)/f)(ff2)/(((f/(f(-2/25)f))/f)/f) assuming f is positive. f(248/25) Simplify (j/(j/(jj/j30)))(1/15) assuming j is positive. j(-28/15) Simplify (s2s(6/5))(2/107) assuming s is positive. s(32/535) Simplify (z6z(z/((zz*(-7))/z))/zz)/(z(1/4))(1/82) assuming z is positive. z(4919/328) Simplify (h7)(22/5) assuming h is positive. h(154/5) Simplify (p/(p(p/p(1/4))/p))(-29/3)/(p(-1))(2/61) assuming p is positive. p(-1745/732) Simplify o3oo(-26) assuming o is positive. o(-22) Simplify (b/(bb*(2/37)bb))/bb(b/(bb*(-6)/bbbb))/b assuming b is positive. b(35/37) Simplify ((m(-2/3)/mm)(-4))26 assuming m is positive. m(208/3) Simplify (tt(tt*(-21)t)/t)/(t*(2/45)t) assuming t is positive. t*(-857/45) Simplify (o/((o/(oo*(-5)))/o))/(oo/o31) assuming o is positive. o26 Simplify ((((xx(2/41)x)/x)/x)/(x(x(x/(x*17x))/xxxx)/xx))(8/5) assuming x is positive. x(856/41) Simplify v*(1/46)vv/(vv*(3/11)vv)v assuming v is positive. v(-127/506) Simplify s/(s2s)s*(-3/7)s assuming s is positive. s(-10/7) Simplify (y(2/9)/yy(-2/5)y)/((yyy/((yy3)/y))/(y/((((y(-4)/yy)/y)/y)/yy))) assuming y is positive. y(307/45) Simplify ((t(-1/3)t)/(tt/t10tt))(-9/10) assuming t is positive. t(-6) Simplify l(1/5)/lll/(l/(ll*0/ll))(l1)(-20/9) assuming l is positive. l(-46/45) Simplify (g(-1/10))(-17) assuming g is positive. g(17/10) Simplify p(6/5)/(ppp(-5)/p) assuming p is positive. p(26/5) Simplify t(-2/21)t/(t((t(4/7)t)/t)/tt) assuming t is positive. t(-2/3) Simplify ((ppp(2/5))/p)(-46)p/(p(pp*(-2/7)p)/pp)p(-10) assuming p is positive. p(-2664/35) Simplify y*9/yy*(-1/5)(y/y(-6))/(y(-1/12)y) assuming y is positive. y(833/60) Simplify ((i/(ii*(1/3))ii)(-40))(-2/27) assuming i is positive. i(400/81) Simplify ((a/(aa*2/a))/aaa3)/(a(-1/3)/(a(3/7)/a)) assuming a is positive. a(37/21) Simplify (jjj(j*(-15)/j)/j)/jjj(-3) assuming j is positive. j(-17) Simplify ll*(-6)(l/((l/l*(-7/3))/l)l)/ll assuming l is positive. l(-16/3) Simplify (u/(((u/(u/u(3/7)u)u)/u)/u)u(-2/5))/(u(2/3)/uu)(-7) assuming u is positive. u(718/105) Simplify dd(dd*(4/19)d)/dd/((d(1/20)/d)/d) assuming d is positive. d(2341/380) Simplify ((llll(-1/4))43)(-1/3) assuming l is positive. l(-473/12) Simplify ((((a/(a*(-8)aa))/a)/aa)/a)(-3) assuming a is positive. a(-15) Simplify (aa2a8)(-3/20) assuming a is positive. a(-33/20) Simplify v(2/9)v(v/(vv/((vv10/v)/v)))/v assuming v is positive. v(74/9) Simplify ((j/(jjj6))/j(-2/13))(-25) assuming j is positive. j(2225/13) Simplify (k/(kk1))(-19)/(k/(k(-3)k)(k(1/5)/k)/k) assuming k is positive. k(89/5) Simplify x(2/61)x(-2/39) assuming x is positive. x(-44/2379) Simplify ((z*3z)/(zz/(zzz0z)))/(z/z*3z*(-9)zz) assuming z is positive. z14 Simplify qq*(-3/5)(qq/q(6/11)q)/qq assuming q is positive. q(157/55) Simplify (u(2/15)/u)/(u(-18/5)uu) assuming u is positive. u(11/15) Simplify (h/(h/(h/(hh(h(-1/3)h)/h))h)h)*42(h/(hh/h(1/2)))15 assuming h is positive. h(-71/2) Simplify (r(24/5)r)/r31 assuming r is positive. r(-126/5) Simplify (cc(c*(-6/7)c)/c)/(cc(8/7)c) assuming c is positive. c(-2) Simplify n14n(-7/2)/n assuming n is positive. n(19/2) Simplify mm*15(m*6mm)/m assuming m is positive. m23 Simplify s(-8)/s(-23) assuming s is positive. s15 Simplify (l/(l/l(-1/3)))(-16) assuming l is positive. l(16/3) Simplify ((i(4/7))(-15/4))16 assuming i is positive. i(-240/7) Simplify (aa*(2/15)aa/(a/((a(6/13)/a)/a)))(-1) assuming a is positive. a(-116/195) Simplify (a1)(-1/14) assuming a is positive. a(-1/14) Simplify q5/qqq3(qq2)/(q/(q(-1)/q)) assuming q is positive. q8 Simplify ((z(2/3))34)20 assuming z is positive. z(1360/3) Simplify (m16(m/m(-10/9))/m)(-11) assuming m is positive. m(-1694/9) Simplify ((y3/yy)(-5/4))(-2/17) assuming y is positive. y(15/34) Simplify (kk/k*(-13)k)(-1/15) assuming k is positive. k(-16/15) Simplify (((kk(5/2))/kkkk)/k)13 assuming k is positive. k(117/2) Simplify (yy/(y/y(3/8)y)yy(yy*1y)/y)/(y5/(y/(y/y(-2)y))) assuming y is positive. y(-29/8) Simplify (uu*(-3/5)u)(13/4) assuming u is positive. u(91/20) Simplify uu(-15)uuuu20u assuming u is positive. u10 Simplify i(-14/11)/iiii(2/3) assuming i is positive. i(13/33) Simplify ((r/(rrr(-16)rr))/r)/((r3/r)/r) assuming r is positive. r11 Simplify ((s(-2)s)/s)/s(-12/11) assuming s is positive. s(-10/11) Simplify ((q(q/(q(-1)q))/q)/q)*(-2)q(3/5)/q(-1/7) assuming q is positive. q(26/35) Simplify ((y(-5)yyy)/(y(-2/25)/y))/(y(-1))(1/5) assuming y is positive. y(-18/25) Simplify d2/dd/(d/((d(d(d*(-2/3)dd)/d)/dd)/d))dd(2/3)/(d(-10)/dd) assuming d is positive. d14 Simplify (b(-3)bbb/(b(-2)/b))/(b(-2/9)b(1/11)) assuming b is positive. b(310/99) Simplify (z(-1/2))11(zz(-1)zz)(-10/3) assuming z is positive. z(-73/6) Simplify ((p(-3/7)p)/(pp/(p(3/11)/pp)p))/(p/(p/(pp1)))(-26) assuming p is positive. p(3838/77) Simplify h20h(3/2) assuming h is positive. h(43/2) Simplify ((uuuu*(-1/7)u)/u(-2/11))/(u(-2/3)uu(5/2)) assuming u is positive. u(557/462) Simplify (n/n(-4))/(n/(n/n9))(nn(-1))(-8) assuming n is positive. n(-4) Simplify ((x(-2/7)x)/x)(-24)/(xx/(x(-1/2)/x))(-50) assuming x is positive. x(1273/7) Simplify (g/(g/(g(-7)/g)))/ggg*(3/5)(g/g*3)/(gg/(ggg/g*(4/5)g)) assuming g is positive. g(-41/5) Simplify f(-2/9)/f*(-1)f(f/f(-1/2))/ffff/(f/f3) assuming f is positive. f(131/18) Simplify (q(-1/17))(-5/6) assuming q is positive. q(5/102) Simplify y21y31 assuming y is positive. y52 Simplify (ss(s(1/3)/ss)/ss)(-43)(s/s(2/17))/(s(-7)s) assuming s is positive. s(-4766/51) Simplify (c(c*(6/5)c)/cc)(15/11) assuming c is positive. c(48/11) Simplify (u0)(3/37)/((u/u5)/(u(-6)/u)) assuming u is positive. u(-3) Simplify (r(-7)r(1/4))(6/7) assuming r is positive. r(-81/14) Simplify (m(-1/3))7/(m/(m/((m(-1)/m)/m)m))3 assuming m is positive. m(29/3) Simplify (bb*11b/(b/b(-3/4)))11 assuming b is positive. b*(495/4) Simplify s/(sss(-3/5)ss)ss/s(1/2)(s(-1/4)/s)(-1/57) assuming s is positive. s(-1001/1140) Simplify (b(2/5))(-42) assuming b is positive. b(-84/5) Simplify ddd/(ddd*(-1)/ddd)dd(-1/6)/ddd8/((d/d(-2/7))/d) assuming d is positive. d(401/42) Simplify (x(2/47)/(x/(x(-3)/x)))(-9) assuming x is positive. x(2097/47) Simplify ((pp*4)/pp(-2))/(p(-3/4)p4) assuming p is positive. p(-5/4) Simplify g(1/12)/(gg/g(3/22)) assuming g is positive. g(-235/132) Simplify (t/(ttt/(t*(-2/7)/t)t))/(tt(-15/2)t) assuming t is positive. t(17/14) Simplify (j/((j(-1)/jj)/j))(-2/89)j*(-2/5)j(-2) assuming j is positive. j(-1098/445) Simplify (i(-1))(1/7) assuming i is positive. i*(-1/7) Simplify (yy(y0/y)/yy)*(-34)(y(-2/5))(5/9) assuming y is positive. y(-308/9) Simplify g5/(g*4g)(g(2/9)/g)(-1/4) assuming g is positive. g(7/36) Simplify (v(-2/3)/v)16 assuming v is positive. v(-80/3) Simplify (pp*40pp)(-2/53) assuming p is positive. p(-86/53) Simplify (((yy/(y/(y/(y*4y))))/y)/y*(-3))/((yy(-5))/(((y0/y)/y)/y)) assuming y is positive. 1 Simplify ((t(tt/t*(2/7))/t)/((tt/t(6/5))/t))/(t1t)*50 assumi	{ "pile_set_name": "DM Mathematics" }
- 6l5 - 6l5 + l5. -455l5 Expand -3v*3 - 2v*2 + 2v*2 + (0v + 0v - v2)(-v + 0v + 2v) + 1169v - 1169v - 106v3. -110v*3 Expand -2a*2 - 9a*2 + 2a + 12a2 + (7a - 2a - 25a)(-3 + 2a + 3). -39a2 + 2a Expand (-88x + 93x - 4055x)(x - 2x + 2x). -4050x2 Expand (-4 + 4 + 2)(2i - i + 0i) + (-18i + 80i - 8i)(-1 - 1 + 5). 164i Expand 314s - 276s + 15s*2 - 39s + 31 + (-2s2 + 0s*2 + 0s*2)(3 - 2 - 3) - 2s2 - 1 + 1. 17s*2 - s + 31 Expand (54t*3 + 108t - 108t)(-3t - 3t + 2t)(0 + 1 - 3)(1 - 3 + 0). -864t*4 Expand 0m - m - m + (4m + m - 2m)(-6 + 3 + 1)(41 + 53 - 65). -176m Expand (2x - 2x - 3x)(-401 - 262 - 239)(0 + 3 + 0) + 3 + 2x - 3. 8120x Expand (-99w + 99w - 18w2)(-w + w - 4w3) + 16w*5 + 13w*5 + 7w*5 + 15w5 - w5. 122w5 Expand (73823 + 63t*3 - 73839 + 16t*3)(t - 2t2 - t). -158t*5 + 32t*2 Expand (4t + 4t - t)(90t4 + 253t*4 - 76t*4). 1869t*5 Expand 20435i*2 - 20435i*2 + 3183i3 + (-i2 + 4i2 - i2)(2i - 3 + 3). 3187i*3 Expand (-2w*2 + 2 - 2)(-2w + 2w + w) + (3w - 3w + 10w)(78 - 78 + w*2 - 4w) - 3 + 3 + 3w3. 11w*3 - 40w*2 Expand (6 - 3 + 0 + (-4 + 6 - 1)(3 - 4 - 1) + 0 + 1 + 0 + 4 - 6 - 5)(6p*2 + 12 - 12). -30p*2 Expand (a + 5a - 2a)(-293a + 295a + 192a). 776a*2 Expand (2 - 2520j - 919j + 517j - 88j)(2 + 0 + 0). -6020j + 4 Expand (28 + 0 - 5)((-2 + 1 + 2)(-u + 6u - 4u) - u + 0u + 2u + u - 2u + 2u + (2u + 0u - u)(3 + 3 - 4) + 1 - 1 - 2u). 69u Expand (-r*2 + 0r*2 + 3r*2)(-6r + 0r + 4r) - 20603r*3 + 1935r*3 - 15669r*3 - 5987r*3 - 13760r*3 + 5539r*3. -48549r3 Expand s5 + s*5 - 3s*5 + (2 - 6 + 2)(s2 - s5 - s*2) + (-1 - 2 - 874s*2 + 2 + 1)(4s3 - 2s*2 + 2s*2). -3495s*5 Expand (-7l - 6l + 4l)(-3280l + 3280l + 37l2) + l3 - l*3 - 5l*3. -338l*3 Expand (2483m*2 + 3 - 94m - 4967m2 + 2487m*2)(2m3 + 4m*3 - 4m*3). 6m*5 - 188m*4 + 6m*3 Expand (-3d - 7d + 5d)(-d - 2 + 2)(-4d2 - 2d*2 - 4d*2). -50d4 Expand -t4 + 0t4 - 2t*4 + (-14 + 23 + 25)(-2t4 + 7t4 + t4) - 43t3 + 43t*3 + 12t*4. 213t*4 Expand (0d2 + d2 + 0d2)(671 + 1696 + 1256)(-3d*3 + 3d*3 + 2d*3). 7246d*5 Expand (a - 3a - 2a)((a - a + a)(0a*2 - 3a*2 + 0a*2) + 4a*3 - 3a*3 + 0a3 + (-a - 13 + 17 + a2 - 6)(-2 + 1 + 0)(-7a + 3a - 3a)). -20a*4 + 28a*3 + 56a*2 Expand 31k - 114k + 49k - 105k + (87k - 39k + 115k)(1 - 3 + 0). -465k Expand (4 - 4 - 2)(2z - 3z + 0z) - 2z + 6z - 2z - 2z + 4z - z - 2z + z + 2z + (1 - 6 + 1)(3z - z - z) - 171z + 341z + 1586z. 1758z Expand (-2 + 3b + 2)(-52 - 88b + 115b - 33b). -18b2 - 156b Expand 13n3 - 15n*3 - 28n*3 - 5n*3 + 4n*3 + 3n*3 - 99n*3 + 33n*3 - 46n*3 + (1 - 1 + 2)(2n3 - 2n3 + n3) - 4 - n*3 + 4. -139n*3 Expand (-18 - 4r + 18)(2 - 2 + 2r) + 20r2 + 31r*2 + 6r*2 - 5r*2 + 2r*2 + 0r*2 + (-1 + 1 - 2)(2r2 - 7r2 + r2). 54r2 Expand (4s - 4s + 18s)(3 - 2 - 3 + (-3 - 4 + 1)(1 - 2 - 1)). 180s Expand (4 + 6f*2 - 6 + 2 + 19)(58 - 120 + 77). 90f2 + 285 Expand (-819f + 819f + 46f*2)(-1 + 3 + 0) + (-5f + 5f - 2f)(-3f + 6f - f). 88f2 Expand (31g - 6g + 15g)(-69 + 27 + 35) + (-4 + 4 - 2g)(3 + 1 - 3). -282g Expand (14a - 14a - 68a)(11a - 156a - 95a + 17a). 15164a2 Expand (-53r*2 + 4r + 5r + 54r*2)(-2r - r + 32r). 29r3 + 261r*2 Expand ((1 + 2f - 1)(-6f + 7f - 6f) + (5 - 2 - 1)(-10 + 10 - 7f*2) - 5f2 + f2 + 3f2)(-2f - 2f + 0f). 100f*3 Expand 10 + 5 - 15 - 47n + (-69 - 70 + 55)(-2n - 4n + 5n) + n - 5n + 2n. 35n Expand (-x4 + x4 + 2x*4)(-x - 3 + 3) + 2378x5 - 8x + 6x - 1852x*5. 524x*5 - 2x Expand (-14w + 21w - 51w)(15 - 28 - 23 - 21 + 10). 2068w Expand -z + 5z - 2z - 2z - 12z + 4z - 3z + 0z + z + (-1 - 3 + 3)(-7 + 2z + 7) - 5 - z + 5 - 2z + 3z - 2z + 4 - 2z - 4. -16z Expand (2a - 2a - 2a)(4 + 0 - 2) + 1 - a - 1 - 20088 + 20088 - 264a + (2 - 2 - 1)(-2a - 2 + 2a - 2a). -267a + 2 Expand -4d*3 + 22 - 294d*2 + 294d*2 + (-22 + 22 + 12d*2)(-3d + 5d - 14d). -148d3 + 22 Expand q3 - 4q3 + 4q*3 + (-3 + 3 - 2q*2)(2q + 0q + 0q) + 2336 + 2q*2 + 2343 + 1229q*3 - 4680. 1226q*3 + 2q*2 - 1 Expand (238f - 266f + 165f + 2)(0 + 1 + 1)(-2f3 - f3 + 0f*3). -822f*4 - 12f*3 Expand -9l*3 + 395l*3 - 132 + 133 + (0 + 0 + l)(-3 + 4l2 + 3). 390l*3 + 1 Expand (-266 - 292 + 558 - 3748v)(-v + v2 + v + (v - v - v)(-6v + 3v + 2v)). -7496v*3 Expand (-2251u + 10741u + 1 - u2 - 1058u)(u3 + u3 + 0u*3). -2u*5 + 14864u*4 + 2u*3 Expand (4x - 3x - 3x)(46 + 15 - 24)(2x - 5x + 2x) + (-2 + 2 + 3)(14x2 + 9x*2 - 4x*2). 131x*2 Expand (26 - 26 + 5a)(-6a + 4a - 3a)(4 - 3 + 1)((-1 + 1 + 1)(2 - 2 + 1) + 2 + 1 - 4 + 0 + 2 - 3). 50a*2 Expand (-k - 3k + 6k)(6 + 0 - 1) + (0 - 1 + 2)(-2 - 2 + 2)(818 - 818 - 17k). 44k Expand (4 + 0 + 0)(1827g - 68261 + 78g + 68263). 7620g + 8 Expand (-k*2 - 4 + 7k*2 + 1)(-5 - 1 + 4)(-31 - 30 + 60)(k - 3k + k). -12k*3 + 6k Expand (2296c - 4148c - 4836c + 2 - 2 + 869c)(11c - 13c - 14c). 93104c2 Expand -z + z - 3z*4 + (-2z*3 + 4z*3 - 4z*3)(3z + 9z - 10z). -7z*4 Expand (8 - 2v - 4 - 5)(584 - 101 + 955)(-2 + 2 - 1)(3 - 4 - 2v + 2). -5752v2 + 1438 Expand 2m - 3m + 0m + (m - 5m + m)(13 + 35 - 3) + (3m + 3m - 4m)(4 - 1 - 4) - 2m + m - m. -140m Expand (-308a - 59a*3 + 308a)(60 - 60 + 15a*2). -885a*5 Expand (-1448 + 16783c + 4112c + 1448)(3c - 6c + c + (-1 - 2 + 2)(2c + 2c - 2c) + 2c + 0c - 4c). -125370c*2 Expand (b - b - 2b + (-2 - b + 2)(-2 + 0 + 4) + b + b - 4b)(6b*3 + 31b - 58088 + 58088). -36b4 - 186b*2 Expand (-3 + 2 + 2)(12k4 + 17k*4 - 14k*4)(-445 + 200 + 216). -435k4 Expand ((-128i + 43i + 37i)(1 - 3 - 2) - 5i + i + 3i)(-5 + 0 + 4). -191i Expand -5m*5 - 5m*5 + 0m*5 + (2m*4 - 6m*4 + 3m*4)(2m - 2m + m) - 124m5 + 116m*5 - 211m*5. -230m5 Expand (-d3 + 2d - 2d)(-2 + d + 2)(-2d + 6d - 3d)(-2 + 5 - 2) + 2178d3 - 710d*5 - 2178d*3 + (0d4 - d4 - d*4)(d + 0 + 0). -713d5 Expand -2m3 + m3 + 2m3 + (m - m + m)(3m + 2 - 2)(-25 + 25 - 38m + (4 - 4 - 2)(-m - 2m + m)). -101m*3 Expand (-2 + 2v + 2)(4 - 4 - 1) - 34v + 114v + 233v + (-2 + 4 - 4)(5 - 5 - v). 313v Expand -6m2 - 6m*2 + 7m*2 + (4 - 2 - 3)(5 + 0 - 3)(4723m - 31m2 - 4723m - 3). 57m2 + 6 Expand (-1 + 2 + 1 + 0 - 2 + 0 + (1 - 4 + 1)(3 + 1 - 5) - 4 + 0 + 2 - 4 + 5 - 4)(14o + 2o + 2o)(-8o + 8o - 2o*2)(0 + 0 + 3). 324o3 Expand -564s - 1579s - 1796s - 2020s + 159s + 1170s + (-2s + 1 - 1)(-2 + 15 + 7). -4670s Expand (9s3 - 219s*4 + 8s*4 - 7s*3)(-16s + 3s - 17s). 6330s*5 - 60s*4 Expand (-36n + 70n + 190n)(4 - 4n - 4)(0n + 8n - 2n). -5376n3 Expand (3s - 6s + 2s)(1 + 1 - 1)(3 - 1 + 3)(1 - 3 + 1)(5s - 3s + 0s)(2 - 2 + s*2). 10s*4 Expand (3n*2 + 3n*2 - 8n*2)(3n2 + n3 + n2 - 2n*2 + (1 - 1 + 2n)(-388n*2 - 452n*2 + 250n*2)). 2358n*5 - 4n*4 Expand (494d - 494d + 174d*4)(6 + 1 - 3)(3 + 1 - 2). 1392d*4 Expand (-33h*2 + 45h*2 + 560h*2)(0h2 - 9h*2 + 2h*2). -4004h*4 Expand (87d*2 + 442d*2 - 41d*2)(1 + 2 + 0)(-1 + 0 + 2). 1464d*2 Expand (325210 - 325210 + 560a)(-5 + 2a - 3 + 7)(-a2 + a - a). -1120a*4 + 560a*3 Expand 1 - 1 - 2a + (3 - 6 + 4)(-a + 3 - 3) - a + 3a - a - 21a - 20 + 20 - 1 - 3a + 1 + (-4a + 0a + 5a)(-1 - 2 + 1) + (0 + 3 - 1)(2a - 1 + 1). -24a Expand (6v*4 + 275v4 + v4)(2 - 2 + 1)(-3 - 2 - 3). -2256v4 Expand (1 + 4 - 2 + (-1 - 5 + 5)(-2 - 2 + 3) - 3 + 4 - 2)(66b + 124 - 124). 198b Expand (22j*2 + 96j - 96j)(-7j - 4j + 2j)(-2 - 2 + 1). 594j3 Expand -3j*3 - 3j*3 - j + 5j*3 + j - j + 2j3 + (-j3 + 4j2 - j3 + 5j*2)(0 + 4 + 6). -19j3 + 90j*2 - j Expand (2 - 4 + 0 + (1 - 2 + 2)(-1 + 1 - 1) + 3	{ "pile_set_name": "DM Mathematics" }
late the highest common factor of m and 120. 24 Let b be (2340/(-135))/(4/(-18)). What is the greatest common divisor of b and 13? 13 Let w(i) = -40i + 104. Let b be w(0). What is the greatest common factor of b and 169? 13 Suppose -81 - 147 = -2p + 3m, 3m = 4p - 450. Calculate the greatest common factor of 37 and p. 37 Let r(l) = 4l*2 + 26l - 25. Let x be r(-8). Calculate the highest common factor of 4 and x. 1 Let c(x) = x*2 - 10x + 18. Let t be c(9). Let h be (-40)/45t/(-2). What is the greatest common divisor of h and 14? 2 Let i(w) = -3w*3 + 10w*2 + 14w + 23. Let l be i(-3). What is the greatest common divisor of 8 and l? 8 Suppose 497 - 1667 = -5i. What is the highest common factor of i and 18? 18 Let w = 915 - 864. What is the highest common divisor of 187 and w? 17 Let h = 6 + -26. Let f be (h/(-6) - (-3)/(-9)) + 27. Calculate the highest common factor of f and 15. 15 Let h(t) = t + 31. Let g be h(49). Calculate the greatest common divisor of g and 304. 16 Let m = -902 - -937. Suppose 2c + 3d - 23 - 13 = 0, -3c = -d - 43. What is the highest common factor of c and m? 5 Let x be ((-528)/20)/((-3)/10). Suppose 2v + 2o - 24 = 0, -2v = -0v + 4o - 16. Suppose -v = -c - c. Calculate the greatest common divisor of c and x. 8 Let i = 103 + -20. Calculate the greatest common factor of 913 and i. 83 Let q be 3/24 - -54(-5)/(-16). What is the highest common factor of 697 and q? 17 Suppose -5y + 3k + 111 = 0, k + 2k = -2y + 57. Suppose -y = -3v - 3v. Suppose vr = 9r - 390. What is the greatest common divisor of 52 and r? 26 Suppose -5i + 5 = -4i. Suppose -4q = 3r - 1276, -ir - 5q + 2140 = -q. Calculate the greatest common factor of r and 16. 16 Suppose -5o - 2r - 621 = 282, 3r - 908 = 5o. Let s = 280 + o. Calculate the greatest common factor of s and 9. 9 Let r(t) = 25t3 - 3t*2 + 2. Let k be r(-2). Let x be (-6)/4 + k/(-12). Let n be 8 - -1 - 2/2. Calculate the greatest common factor of n and x. 8 Let w(j) = 2j2 + j - 6. Let i be w(-3). Suppose -y + 29 = i. What is the greatest common factor of y and 30? 10 Let a(k) = k2 - 3k - 7. Let p be a(3). Let d be (p + 2)3/(-15). What is the highest common factor of 11 and d? 1 Let h(c) = 3c + 111. Let p be h(47). What is the greatest common divisor of p and 54? 18 Suppose -4 = -6y + 14. Suppose -i + 537 = -3k, -557 = yi - 4i - k. Let n be 2/7 - i/(-28). What is the highest common factor of n and 30? 10 Suppose 4u - 216 = 40. Suppose 2l - u = -0l + 2o, 0 = 3o + 15. What is the greatest common divisor of l and 27? 27 Suppose 5h + 137 - 2605 = -c, 1963 = 4h - 3c. What is the greatest common divisor of 17 and h? 17 Suppose -33q = -2444 - 658. Calculate the greatest common divisor of q and 470. 94 Suppose 0 = -3i - h + 575, 383 = 2i - 0h + h. What is the highest common factor of 12 and i? 12 Let d be 3 - (3/(-2) + 1671/(-2)). Calculate the greatest common divisor of d and 20. 20 Let h = -12 - -13. Let c(r) = -72 + 37 + 105r*2 + 34. Let y be c(h). Calculate the greatest common factor of y and 13. 13 Let i(q) = 6q*2 - 24q + 7. Let b be i(4). Calculate the highest common divisor of 4 and b. 1 Let h(c) = 4c - 3. Let s be h(2). Let n(k) = 1 - 3 + 0 - 4 + k. Let m be n(7). Calculate the highest common divisor of m and s. 1 Let w = 3 - -114. Calculate the highest common factor of 36 and w. 9 Let x = -734 + 844. What is the greatest common divisor of x and 165? 55 Let z be 4/(-22) + 114/22. Suppose zs = 8s - 45. Calculate the greatest common divisor of s and 165. 15 Let j(u) = u3 + 8u*2 - 13u - 16. Let p be j(-9). Suppose -3n - 2f = -p, 0 = -3n + 9f - 4f + 13. What is the highest common divisor of 24 and n? 6 Let c(i) = -10i*3 + 21i*3 - 10i*3 + 5i*2 - i. Let l be c(-5). Suppose 1121 = lw + 406. Calculate the highest common divisor of 13 and w. 13 Let k = -118 - -190. Suppose y - 13 = s, 3y - s + 0 = 49. Calculate the greatest common factor of y and k. 18 Suppose -3t + 5 = -4t. Let u(h) = h3 + 7h*2 - h - 16. Let l be u(t). Calculate the highest common factor of 13 and l. 13 Suppose -c + 1429 = -w, 4w - 8w + 8 = 0. Calculate the highest common factor of 53 and c. 53 Suppose -2u + 0u = -140. Let i be (-6 + 9 + 6/(-2))/(-1). Suppose i = -5t + 5, 2b - 5t - 1 - 22 = 0. What is the greatest common factor of b and u? 14 Let b be (-14)/(-4) - (-4)/(-8). Suppose bh + 460 = 7h. Let c(x) = 2x + 58. Let y be c(-6). What is the highest common factor of h and y? 23 Let i(j) = 14j*3 + 2j*2 - j + 2. Let v be i(3). Calculate the greatest common factor of v and 79. 79 Let d be ((-450)/(-54))/(1/3). Suppose 20l - dl = -95. Suppose i + 62 = u, 0 = 5u + i - 281 + 1. What is the highest common divisor of u and l? 19 Suppose -290u - 1632 = -294u. Calculate the greatest common factor of u and 8. 8 Let v(n) be the second derivative of -n*3/2 - 13n*2/2 + 2n. Let l be v(-6). Suppose lu - 65 = 160. What is the greatest common factor of 5 and u? 5 Suppose -11 = 7t - 669. Suppose t = 4k - 1226. Calculate the highest common divisor of k and 30. 30 Let w be (17 + -34)/((-4)/3 + 1). Let p = 73 - w. What is the greatest common divisor of 154 and p? 22 Let o be (((-10)/(-4))/1)/(43/688). Let s(q) = 6q + 46. Let m be s(9). What is the greatest common divisor of o and m? 20 Suppose -w + 2340 = -2z, 7020 = 3w - 0w + 4z. Calculate the highest common factor of w and 18. 18 Suppose r - 1 + 5 = 0. Let l be 60/(-9) - r/6. Let c(o) = -o*2 - 8o - 9. Let t be c(l). Calculate the greatest common factor of t and 27. 3 Let k be ((-15)/(-10))/((-2)/128). Let x = k - -160. What is the highest common divisor of 8 and x? 8 Let v be (11/(-3) - 0)/((-4)/852). What is the greatest common factor of v and 33? 11 Suppose -2d + 5d = 5c + 230, -d + 88 = 4c. What is the greatest common divisor of 460 and d? 20 Let i(c) = 2c3 - 3c*2 - 7c - 1. Let x be i(4). Let r = 56 - x. What is the greatest common divisor of r and 1? 1 Let b(m) be the third derivative of m6/120 - m5/6 + 13m4/24 - 11m3/3 + m2. Let k be b(9). What is the highest common divisor of k and 70? 14 Let w = -92 - -176. What is the highest common factor of 12 and w? 12 Suppose 88 + 53 = 47h. What is the greatest common divisor of 4 and h? 1 Let v = -234 - -255. What is the greatest common factor of 15 and v? 3 Let j = 31 - 7. Let b be ((-16)/(-2))/(6/j). Suppose -m = m - b. What is the greatest common divisor of 80 and m? 16 Let j(a) = 9a*2 - 2a + 1. Suppose -3d = -2 - 13. Suppose 0 = -6u + u + d. Let z be j(u). Calculate the highest common factor of z and 32. 8 Let p be 24/28(-4 - (-33)/3). Calculate the greatest common divisor of p and 105. 3 Suppose -4x = -2x - 40. Suppose 0o + 420 = 4c - 5o, 284 = 3c + 4o. Calculate the highest common factor of c and x. 20 Suppose 4a + 4y + 6 = -10, 4a - 3y + 51 = 0. Let u be (a/(-4))/(15/2360). Suppose -5f = -u - 21. What is the highest common divisor of 30 and f? 15 Let b = 1989 + -1946. What is the highest common divisor of 2021 and b? 43 Suppose 31 + 7 = 2l. Suppose 10 = -0u + 2u. Suppose 0 = g + 4x + 8, 2x = -5g - u + l. Calculate the highest common factor of 20 and g. 4 Let g = 155 + 54. Suppose -131 = -4i - 5c + g, 4c + 16 = 0. Calculate the highest common divisor of 10 and i. 10 Let t = 334 + -477. Let i = -73 - t. What is the greatest common divisor of i and 14? 14 Let h = 169 - 152. Calculate the greatest common factor of 119 and h. 17 Let f(c) = c*3 - 6c*2 - 34c - 11. Let u be f(11). Let j = 104 - 16. What is the greatest common factor of j and u? 44 Suppose -14 = -5i + 2n, 3i = i - 3n - 2. Suppose -28f + 383 = -9f + 117. What is the greatest common factor of i and f? 2 Suppose -5c = -12c + 28. Suppose 22 = 5s + 2m, 2s - 2m + 4m = c. Calculate the highest common factor of s and 48. 6 Let g = -25 - -35. Suppose 5j - g = 2n, -5j + 4n - 11 = -31. Suppose -4h + 880 = -jh. What is the greatest common divisor of h and 20? 20 Let u be -1 - (3 + (5 - -3)). Let f be ((-1)/(-3))/((-2)/u). Suppose -4y = -fz - 44, -2z = y - 0 - 11. What is the greatest common factor of y and 77? 11 Suppose 3*x = -416 + 701. Calculate the highest common factor of 171 and x. 19 Suppose 0	{ "pile_set_name": "DM Mathematics" }
respect to b. 47655554b Find the first derivative of 6424k*2 - 943k + 14337836. 12848k - 943 Find the third derivative of -5671876fu3 - 51484fu - 123u*2 wrt u. -34031256f Find the third derivative of -348916011o6 - 493890o*2 + 12. -41869921320o*3 Find the third derivative of -183529157y*4 + 73257882y*2 wrt y. -4404699768y Find the second derivative of 18kr*3 + 10kr2 - 3kr + 2752k - 28r3 - 9r*2 - 6 wrt r. 108kr + 20k - 168r - 18 What is the third derivative of 1905i*6 - 8385i4 - i3 + i*2 - 2424519i + 2? 228600i3 - 201240i - 6 Differentiate 525j2q - 102j2 + 13jq + 6423044q with respect to j. 1050jq - 204j + 13q Find the third derivative of -5145899k4 - 34k*3 - 144709251k*2 + 3. -123501576k - 204 What is the second derivative of -9003326i3 - 83329164i wrt i? -54019956i Find the second derivative of -1153f*2t*2 - 748884f*2t + 3065ft*2 + 11ft + 4t*2 wrt t. -2306f*2 + 6130f + 8 What is the derivative of 686018913bc + 52b - 1036776 wrt c? 686018913b Find the first derivative of 2h2r + 8385h2 - 6hr + 11372h + 9485017r - 1 wrt r. 2h*2 - 6h + 9485017 What is the derivative of -406296455k2 - 111035790 wrt k? -812592910k Find the second derivative of -143906p4 + 6p*3 - 2p*2 + 5813008p + 23. -1726872p2 + 36p - 4 What is the second derivative of 45937633c2 + 9989093c wrt c? 91875266 What is the second derivative of -1388b5 - 25783b*2 - 278394092b wrt b? -27760b3 - 51566 Find the second derivative of 9175156u*4 - 5152u + 24. 110101872u2 What is the third derivative of -326s*3u + 1439s3 - 611s*2u + 107s2 wrt s? -1956u + 8634 What is the second derivative of 217585477w3 - 89240938w? 1305512862w What is the second derivative of 311jw5 - 4jw - 40138j - 14w5 + 3w*2 - 10w wrt w? 6220jw*3 - 280w*3 + 6 What is the second derivative of 15g*3xy + 8g3 - g2xy + 7g2x - 40gxy - gx + 179gy + 17xy + y wrt g? 90gxy + 48g - 2xy + 14x What is the third derivative of 15883772t*3z - 170t2z + 2tz + 2385z wrt t? 95302632z Find the third derivative of 1428925ko*3 + 47ko2 - ko - 81k - 2o*2 - 35o wrt o. 8573550k What is the second derivative of 67k*3z + 4193k2xz - 5k*2 - 2kxz - 2kz + 4644864x wrt k? 402kz + 8386xz - 10 Find the second derivative of -1124155691o*3 - 3629274o - 2 wrt o. -6744934146o What is the first derivative of -q4 + 127q*3 + 517442q - 460786276? -4q3 + 381q*2 + 517442 What is the third derivative of 18179451d*5 + 1614254d*2 + d wrt d? 1090767060d*2 Find the second derivative of 776434c*5o + 2c4o*3 - 142555co - c - 3o*3 - 3 wrt c. 15528680c*3o + 24c2o*3 What is the third derivative of -46991p*4 + 27p*3 - 30p*2 + 6096p - 5? -1127784p + 162 Differentiate -105716561l*4v - 97826372v with respect to l. -422866244l*3v Find the third derivative of -62979153d3 + 9d*2 + 2d - 48290. -377874918 Find the second derivative of 136242044h2 + 89h - 208640 wrt h. 272484088 Find the second derivative of -2589mxy2 - 144mxy - 13mx - 5896my*2 + 4my - 2m - 27xy + 2x + 19 wrt y. -5178mx - 11792m What is the derivative of 22712124o4 - 4o*3 - 478548060? 90848496o*3 - 12o*2 Find the third derivative of -41464v*5 - 51v*4 - 17228v*2 + v + 490 wrt v. -2487840v*2 - 1224v Differentiate -4ht*2 - 804125h + 624277t2 - t wrt h. -4t*2 - 804125 What is the second derivative of 241777580b*2v*3 - 2bv3 - 113bv2 + 62bv - 20b + 3v3 - 4 wrt b? 483555160v*3 What is the third derivative of -9y*4 - 4614707y*3 - 28y*2 - 200y + 2998 wrt y? -216y - 27688242 What is the first derivative of -97jkt - 9234jk - 32jt - k - 2530t + 5 wrt k? -97jt - 9234j - 1 Find the third derivative of -1327870o3w*2 + 2o*3 - 55o*2w*2 - 782w*2 + 23 wrt o. -7967220w*2 + 12 What is the third derivative of 15169m*3p*2 - 5591m*3 + 128450m*2p*2 - 2m*2 + 21mp2 wrt m? 91014p*2 - 33546 What is the derivative of -466d*2z*3 - 3d*2z - 146z3 - 79z*2 - 34z wrt d? -932dz*3 - 6dz Find the second derivative of 97780465p*4 + 2p*3 + 28948p + 5566. 1173365580p2 + 12p Find the second derivative of -2a2u*2x + 77a2ux + 61629au2x + 6259aux wrt u. -4a*2x + 123258ax What is the third derivative of 196550617k3 + 2k*2 - 5052k - 2863? 1179303702 Find the second derivative of 7nrx2 + 4nrx - 1275nx*2 - 2nx + 80rx2 + rx - 7165r + 3x*2 + 30x - 2 wrt x. 14nr - 2550n + 160r + 6 What is the derivative of -3717951t2 - 24265220 wrt t? -7435902t What is the second derivative of 265l3 + 131623l*2 + 143640670l wrt l? 1590l + 263246 What is the second derivative of -406521781b*3 + 419324604b wrt b? -2439130686b Find the third derivative of 40b*5 + 20b*4 - 1489b*3 - 160b*2 + 5687b. 2400b2 + 480b - 8934 Differentiate s*2w + 7s2 - 382sw - 8s + 3839468w wrt s. 2sw + 14s - 382w - 8 What is the first derivative of -dj*2r - 4djr - 63000dj + j2r + 3446091jr wrt d? -j*2r - 4jr - 63000j Find the third derivative of -3i*4 + 1153079i*3 + 2446894i*2. -72i + 6918474 What is the third derivative of 62318221f4 + 27550520f*2 wrt f? 1495637304f What is the derivative of -2437057i4 - 498072? -9748228i*3 Find the third derivative of -2u*5 - 2u*4 - 147828u3 + u2 - 518u - 5. -120u*2 - 48u - 886968 Find the first derivative of -69984740h - 121388398 wrt h. -69984740 What is the derivative of 776900hm2 - 13h + 7m2 + 2865323 wrt h? 776900m*2 - 13 What is the second derivative of -2768349g*2r - 67g - 441r + 24 wrt g? -5536698r Differentiate -94604381p + 119163269 with respect to p. -94604381 Differentiate sv4 + 1572560sv3 - s - 27157584 with respect to v. 4sv3 + 4717680sv2 Find the first derivative of -3t*4 - 674960t*3 + 14t - 372135374. -12t3 - 2024880t*2 + 14 Differentiate -1905j*4 - 17j*3 - 3j*2 - 4j + 6187794 with respect to j. -7620j3 - 51j*2 - 6j - 4 Find the second derivative of 3c5 + 19c*4 - 147c*3 - 2c*2 + 54c - 136407 wrt c. 60c3 + 228c*2 - 882c - 4 Differentiate 5157951b + 7473283 with respect to b. 5157951 Find the third derivative of -3944d*4h*2 + 123d*3 + 185d*2h*2 + 752d*2 - d + 3h*2 wrt d. -94656dh2 + 738 What is the third derivative of -2123370c*4 + 4901c*2 - 91c? -50960880c Differentiate 318093d*2x - 2d2 - 35dix - 24198i - 2x*2 + 801 with respect to x. 318093d*2 - 35di - 4x Find the second derivative of 75219467a2 + 712531743a. 150438934 What is the first derivative of -19k2 + 19668143k + 77674989? -38k + 19668143 Find the second derivative of -320892926j*2 + 1088620300j. -641785852 Find the first derivative of 566712047t - 33814160 wrt t. 566712047 Find the second derivative of 105nr + 43712ny2 + n - 108r*2y*2 - 38r*2y + 109y wrt y. 87424n - 216r2 What is the second derivative of 778430p*2 + 11166963p? 1556860 What is the first derivative of 440art + 220atu + 61rtu + 19tu + 10u wrt a? 440rt + 220tu Find the third derivative of 13f5 - 369662f*3 + 10411485f*2. 780f*2 - 2217972 What is the derivative of 323249x*2 + 37x + 140797978? 646498x + 37 What is the first derivative of 17n*2p*2 + 3264np2 + 2152p*2 + 653 wrt n? 34np2 + 3264p*2 What is the second derivative of -213955916i*3 - 116874361i? -1283735496i What is the derivative of 18q*3u + 767879267q3 - 2q*2u + 245930u2 wrt u? 18q*3 - 2q*2 + 491860u Find the third derivative of -32144r3t - 264r3 - 62r*2t - 2r2 + 2rt - 599r + 92t wrt r. -192864t - 1584 Find the third derivative of 836bm*4 - 52bm3 + 76b - 28m4 + m3 + 197121m*2 wrt m. 20064bm - 312b - 672m + 6 What is the third derivative of 109268846v*3 + 3627962v*2 wrt v? 655613076 Find the first derivative of 6q4 - q3 - 182114q2 - 12210087. 24q*3 - 3q*2 - 364228q What is the second derivative of -95a3v*	{ "pile_set_name": "DM Mathematics" }
b Which is the closest to 6? (a) 44 (b) 0.3 (c) -11 b Which is the closest to 0? (a) 19 (b) -2 (c) -3 (d) 0.1 (e) 36 d Which is the nearest to 4? (a) 3 (b) -10/11 (c) 37 (d) -3/7 a What is the nearest to -0.2 in -2, -1/177, 0.2, -2/7? -2/7 Which is the closest to 0.1? (a) 1 (b) 2445 (c) -2/11 c What is the nearest to 2/3 in -8, 3, 0.04, -0.0351, -1/9? 0.04 Which is the closest to 3.43? (a) 2 (b) -2/11 (c) 2391 a What is the closest to 1/5 in -0.3, -5, 62/9? -0.3 Which is the closest to 0.4? (a) -5 (b) -76 (c) -0.4 c What is the closest to -3/8215 in 2, 5, -0.5, -0.2? -0.2 Which is the nearest to -2/39? (a) -1/16 (b) 1 (c) -148 a What is the closest to -21 in 0.5, -0.8, -24, 2? -24 What is the closest to -1 in -2, 5/3, -797? -2 What is the closest to 0 in 0.25, 2, -5, -0.4, 573? 0.25 What is the nearest to 2 in -145, 364, -0.09? -0.09 Which is the nearest to -0.2? (a) 3/5 (b) -2576 (c) 0.06 (d) 3/8 (e) 1/2 c Which is the closest to 5? (a) 0.5 (b) 5 (c) 12.02 (d) 2 b Which is the closest to -1/4? (a) -202 (b) 0.2 (c) 3 (d) 2/11 d Which is the nearest to 1369? (a) 1/4 (b) 2/7 (c) -5 b Which is the nearest to -35.6? (a) 4 (b) 1 (c) 2 b What is the closest to -0.26 in 0.4, -12/781, 1/3, -1/4, 0.3? -1/4 What is the closest to -1 in 4, -0.7, -0.4, -0.2? -0.7 What is the closest to -10 in 408, -6, -5? -6 Which is the closest to 1/4? (a) 3/8 (b) 0.006 (c) 6 (d) -1/24 a What is the closest to -4 in 0.1, 2/11, -0.11, -2/5? -2/5 What is the closest to -0.3 in -2, -3/4, -0.4888, -3? -0.4888 Which is the closest to -14? (a) 0.079 (b) -3 (c) -2/5 (d) 0.3 b What is the closest to 0 in 16081, 2, -4? 2 What is the closest to -1 in -3, 5, -0.298, -0.29? -0.298 Which is the nearest to 7? (a) -4/3 (b) 0.4 (c) -4 (d) -7905 (e) -2 b Which is the nearest to -426? (a) -0.2 (b) -123 (c) 0.5 (d) 0.9 (e) 0.4 b What is the nearest to 7 in 1, -0.5, -0.4, 1.23? 1.23 Which is the nearest to -5? (a) -4 (b) 7/30 (c) -3/5 (d) 9 a Which is the nearest to -0.1? (a) 11/2 (b) 0.3 (c) -3 (d) 179/7 b What is the nearest to 1/3 in -2/15, -3/5, 17, -17, -4/5? -2/15 Which is the closest to 2? (a) 4/9 (b) 1 (c) -2 (d) 42 (e) 0.1 b Which is the closest to -0.1? (a) -0.8 (b) 0.3 (c) -4 (d) -101 (e) -1 b What is the nearest to -5 in 6/13, -4, -2, 13, 1/4? -4 Which is the nearest to -1/13? (a) 0.037 (b) 2/7 (c) 3 (d) -2 (e) -1 a What is the closest to 0 in -265, -1/2, -2, -1? -1/2 Which is the nearest to 0.1? (a) -7 (b) -1/204 (c) -1/12 b Which is the nearest to 3? (a) 2 (b) -4 (c) 27 (d) -155 (e) 0.4 a What is the closest to -3 in 4, 1401, -3, 4/3, 1/9? -3 Which is the nearest to -0.2? (a) -1/8 (b) 2.1 (c) -66 (d) 1 (e) -2 a Which is the nearest to 2/19? (a) -0.01 (b) 0 (c) 2/15 (d) -1.8 (e) 3/5 c Which is the nearest to 0.2? (a) 5 (b) -0.4 (c) 4/155 (d) -4 (e) 0.1 e What is the closest to -0.08 in 0.12, 9, 1? 0.12 What is the nearest to 0.9 in 4, 3.1, -1/5? -1/5 Which is the closest to -32? (a) 0.2697 (b) 0 (c) 4 b What is the nearest to 0 in 0.06, 1.7, 6? 0.06 What is the nearest to 12 in 1, 144.5, -1/6? 1 What is the closest to 129 in 13, -0.1, -1.1, -1, 0.2? 13 Which is the nearest to 1/3? (a) 0.1 (b) 1.3 (c) 23009 a What is the closest to 0.6 in 0.3, -41038, 3, 0? 0.3 Which is the nearest to -4? (a) -2/3 (b) -2 (c) 8.9 (d) 3 b What is the nearest to -0.1 in 0.4, 8, -0.077, 2/11? -0.077 What is the closest to 0 in 20, -5, 0, 2, -9? 0 Which is the nearest to 0.19? (a) 5 (b) -1/10 (c) 0.4 (d) -0.2 (e) 3/31 e Which is the closest to -0.12? (a) -5 (b) -3 (c) 0.2 (d) 17 (e) -0.8 c Which is the closest to 10? (a) 1 (b) -3 (c) 12.66 c Which is the closest to -2? (a) -0.1 (b) -0.06729 (c) -0.2 c What is the closest to 0.2 in 0.1579, -1/6, -3? 0.1579 What is the closest to -1/3 in -17, -2/5, 19, -5, 1/25? -2/5 What is the closest to 44 in 1.4, 2/7, 1, -2/7? 1.4 Which is the closest to -0.104? (a) -4 (b) 1/8 (c) 25/3 (d) 6 b What is the closest to -30 in -2, 0.5, -1, -5? -5 What is the closest to -2 in 1455/32, 5, -1/6? -1/6 What is the nearest to -1/4 in -52, -1/5, 2/43, 1? -1/5 What is the nearest to 1 in -1, -2, 0.2, -0.3919? 0.2 Which is the nearest to 0.1? (a) 23/2 (b) 25/3 (c) -2/7 (d) 4 (e) -0.4 c Which is the closest to -15? (a) -4 (b) 5 (c) -4/261 a Which is the closest to -166? (a) 4 (b) 0.4 (c) -4/5 c Which is the nearest to -1? (a) 0.4 (b) 2.9 (c) 0.5 (d) -9 a What is the nearest to 0 in 3/2, 10.1, 24, -1? -1 What is the closest to 1/6 in -0.01, 0.5, -4/67? -0.01 Which is the nearest to 0.1? (a) -4 (b) 4 (c) -0.2 (d) 2/275 (e) 4/9 d Which is the nearest to 2? (a) -0.5 (b) 5 (c) -1/5 (d) 34/69 d Which is the nearest to -4? (a) 8 (b) 2 (c) -1 c What is the nearest to -0.2 in 7, -2/101, -9? -2/101 Which is the closest to 2? (a) -0.3 (b) -45 (c) 7 a Which is the closest to -2/13? (a) -3 (b) 4/9 (c) -2 (d) 3 b What is the nearest to 0.2 in 55471, -2/7, -3? -2/7 What is the nearest to -1 in 26, -0.3, -2/3, 1, 120.9? -2/3 Which is the nearest to 4? (a) -1 (b) 71.2 (c) -0.1 (d) -2/5 c Which is the nearest to -3/4? (a) -0.2 (b) -1 (c) 0.02 (d) 15 b Which is the closest to 0.1? (a) 2 (b) -36 (c) 0.111 c Which is the closest to 7? (a) -3/17 (b) 28 (c) 4 c What is the nearest to 45 in 2/47, 2/5, -0.041? 2/5 What is the nearest to 23 in -2, 4/15, -4, 2? 2 Which is the nearest to -0.4? (a) 0.2 (b) -2 (c) 50453 a Which is the closest to 237? (a) 4 (b) 5/3 (c) -0.1 (d) 8 d What is the closest to -0.1 in 3, -469/6, -5, 0? 0 What is the nearest to 2 in -25.51, 196, 1? 1 Which is the closest to 6258? (a) -95 (b) -0.1 (c) -0.3 b Which is the nearest to 1? (a) -14 (b) -0.016 (c) -3/8 b What is the closest to 5 in -1/2, -132, 2/5? 2/5 What is the nearest to 0.1 in 1, 2, -1/52, -0.173, 3/7? -1/52 Which is the closest to -1? (a) 2 (b) 234.07 (c) 0.2 c Which is the nearest to -148? (a) -5 (b) 0.5 (c) -1/8 (d) 3 (e) 2 a Which is the closest to 2/5? (a) -0.3 (b) 74 (c) -0.006 c What is the nearest to -11 in 127, -0.3, 0.91? -0.3 What is the closest to -0.1 in -3, 0.5, -823? 0.5 What is the nearest to 348 in 2/13, -8, 1/7? 2/13 Which is the nearest to -49? (a) 7 (b) -1/11 (c) 5 (d) -1/4 d Which is the closest to -1/2? (a) 1 (b) -15 (c) 2 (d) -45 a What is the nearest to -0.09 in -0.06, 0.1095, -3, 7? -0.06 Which is the nearest to 0? (a) -20 (b) -2 (c) -1/7 (d) -14.62 c Which is the nearest to -2/9? (a) -0.03 (b) -0.4 (c) -670 b What is the nearest to -1/2 in 2, 3, -7.2, -2/5, 2/17? -2/5 Which is the closest to 2? (a) -3/2168 (b) 4 (c) 0.2 c Which is the nearest to 2? (a) -2/3 (b) 54 (c) -2/4755 (d) -4/7 c What is the nearest to -0.1 in 66.5, 0.23, -2? 0.23 What is the nearest to -2/7 in 6, 20.4, 3/2, -5, -0.3? -0.3 Which is the nearest to 91? (a) 19 (b) 0.5 (c) 11 a What is the nearest to 0.2 in -5, 4, -2.0479? -2.0479 What is the closest to 73 in 0.3, -4/13, -3/254? 0.3 Which is the closest to 2/17? (a) -34 (b) -3/2 (c) 3 (d) 0.05 (e) -0.031 d Which is the nearest to 3? (a) 8 (b) -2/3 (c) 3 (d) 23 (e) 2/9 c What is the nearest to 0.01635 in 2, -0.5, 3? -0.5 Which is the nearest to -1/301? (a) -2 (b) -14 (c) -2/9 (d) -0.2 d What is the nearest to 1 in 36, -41, 4, 0.1? 0.1 Which is the nearest to 94/9? (a) 0.5 (b) -4 (c) 4/3 c What is the closest to 0.045 in -1/7, -6/5, 15.1? -1/7 What is the nearest to 63 in -2, -2/5, 0.4, 1/4, -0.02? 0.4 Which is the closest to 9? (a) 1 (b) -4 (c) -2.4 (d) -3 (e) 3 e Which is the nearest to 0? (a) 0.045 (b) -0.3 (c) -0.0561 a What is the nearest to 0 in -1/2, -1/6, -0.3, -442/7? -1/6 Which is the closest to 0.2? (a) -54643 (b) -1/12 (c) -0.4 b What is the nearest to 0 in 845, -6/11, 2, -0.4? -0.4 What is the nearest to 1/7 in -2/9, 4, 11, -0.3? -2/9 Which is the closest to 0.3? (a) -0.5 (b) 393 (c) 0.1 (d) -1/6 (e) -5 c Which is the closest to 0.2? (a) -1/7 (b) -199/15 (c) 3 a What is the closest to -0.2 in 245, -6, 1? 1 Which is the nearest to 55? (a) 4 (b) -6.6 (c) -0.4 a What is the closest to -1234 in 5, -4/11, -4, 3? -4 Which is the closest to 1/3? (a) -0.1 (b) 4 (c) 7 (d) -179 (e) -3/8 a What i	{ "pile_set_name": "DM Mathematics" }
of s(m) wrt m. -8m Suppose 3m = 7 + 11. Suppose -3p + m = -p. Find the second derivative of pc + 0c3 - 3c - 2c + 2c*3 wrt c. 12c Let k(b) = b*2 - 6b. Let y be k(6). Suppose 3s - 3t = y, 4t = -s - s + 12. Find the second derivative of -3o + 2os - 2o*2 + 2o*3 wrt o. 12o Find the second derivative of -3o3 - 7o*3 - 2o - 4o + 2o wrt o. -60o Let k = -3/31 + 37/62. Let j(a) be the second derivative of -a + 0a*4 + 0 + ka*2 + 1/10a*5 + 0a*3. What is the first derivative of j(l) wrt l? 6l2 Let y(a) be the third derivative of a5/20 + a*4/4 + 5a*2. What is the second derivative of y(r) wrt r? 6 Let f(q) be the second derivative of 9q*5/10 + 2q*2 - 4q. Differentiate f(t) wrt t. 54t2 Let g = 2 + 0. Suppose 6 + 2 = 5k - gd, 5d - 3 = k. Find the second derivative of -ky - 2y*5 + y - y wrt y. -40y*3 Let x(b) = -10b + 42. Let u(r) = 11r - 43. Let c(k) = 3u(k) + 4x(k). What is the derivative of c(j) wrt j? -7 Let t = 6 - 5. Suppose -t = -3u + 11. What is the second derivative of -3i4 + 0i*4 + 2i*u + 2i wrt i? -12i2 Let l(k) be the first derivative of 0k*3 - 2k + 0k2 - 2 - 1/2k*4. What is the first derivative of l(h) wrt h? -6h*2 Find the second derivative of 101t*3 - 42t*3 + 56t - 29t3 wrt t. 180t Suppose -2k - 14 = -5a, k + 4a - 25 = -2k. Suppose -5z - kn + 5 = -2, -8 = -5z - 2n. Find the second derivative of p*2 - 5p*2 + zp2 - p wrt p. -4 Let b(m) = m4 + m*2 + m. Let x(l) = 9l*4 + 4l*2 + 4l - 8. Let n(h) = 4b(h) - x(h). Differentiate n(q) with respect to q. -20q*3 What is the third derivative of 15z*2 + 10 - 18z*3 - 10 wrt z? -108 Let u be (24/((-3)/(-1)))/2. What is the third derivative of -2 - 2d*5 + ud5 + 2 - d2 wrt d? 120d2 Let z = -24 - -29. What is the third derivative of d5 - 4d*z - 4d5 + d2 + 2d5 wrt d? -300d*2 Let g(b) be the third derivative of 0b - 1/60b5 + 0 - 8b*2 + 0b*3 + 5/24b*4. Find the second derivative of g(w) wrt w. -2 Let f(w) = w + 5. Let x be f(0). Find the first derivative of 1 + x - 3 - 3q + 8q wrt q. 5 Let y(o) = 3o*2 - 2o. Let f(u) = 7u2 - 5u. Let a(g) = -6f(g) + 13y(g). Find the second derivative of a(k) wrt k. -6 Suppose -20 + 5 = -3h. Suppose 20 = -0q + hq. What is the third derivative of 2b + qb + 3b*3 + 2b*2 - 6b wrt b? 18 Let l be (-1)/4 - 336/(-64). Let k(r) = -5r2 + 4r. Let m(w) = 5w2 - 3w. Let f(h) = lk(h) + 6m(h). What is the second derivative of f(x) wrt x? 10 Let i(s) = -s*3 + 0 + 5s*2 - 3s - 6 + 4. Let z be i(4). Find the second derivative of 2jz + j - 2j*2 - 2j*3 wrt j. -12j Let n be ((-54)/144)/((-6)/4). Let c(k) be the second derivative of 3k + 0k*2 + 0 + 1/6k*3 + nk*4. What is the second derivative of c(q) wrt q? 6 Let u = 17 - 12. Let c(s) = us - 2 - 2 + 2. Let l(i) = -6i + 3. Let z(o) = -4c(o) - 3l(o). What is the first derivative of z(w) wrt w? -2 Let t(q) be the third derivative of -2q*9/63 - 2q*5/15 - 23q*2. Find the third derivative of t(i) wrt i. -1920i*3 Let m = -5 - -8. Suppose 4y - 9 = mp + y, 0 = -y + 5. What is the second derivative of 0v*p - 4v*2 - 3v*4 + 4v*2 - v wrt v? -36v*2 Find the third derivative of 6m*2 - 80m*6 + 17m*6 + 20m*6 + 5m*2 wrt m. -5160m*3 Let o(d) = -8d*4 - 2d*2 - 2d + 9. Let h(x) = -7x4 - 3x*2 - 3x + 10. Let p(g) = 2h(g) - 3o(g). Find the first derivative of p(r) wrt r. 40r3 Let h(x) = -7x*3 - 14x. Let y(g) = g*3 + g. Let z(k) = -h(k) - 6y(k). Find the second derivative of z(v) wrt v. 6v Let z(w) be the third derivative of -w5/12 - w4/3 + 5w*2. What is the second derivative of z(t) wrt t? -10 Let t(i) = 5i*4 - 35i2 + i - 1. Let b(g) = -g4 - g*2 - g + 1. Let r(d) = b(d) + t(d). What is the third derivative of r(x) wrt x? 96x Let w(a) be the third derivative of 3a7/70 - 7a*4/6 - 3a*2. Find the second derivative of w(t) wrt t. 108t2 Let r(d) be the third derivative of -d6/60 + d*5/20 - 5d*2. What is the third derivative of r(c) wrt c? -12 Let w(o) be the first derivative of 3o*5 + 11o*2/2 - 3. Find the second derivative of w(q) wrt q. 180q*2 Let k = 2 - 0. Find the second derivative of kv*2 + 0v + v + v*2 wrt v. 6 Find the second derivative of -5b*3 + 4b - 17b3 - b3 + 3b*3 wrt b. -120b Find the third derivative of 6x2 - 3x*2 + 8x*6 + 9x*2 wrt x. 960x3 Let g(d) be the second derivative of d7/360 - d6/720 - d4/6 + 2d. Let i(t) be the third derivative of g(t). Find the second derivative of i(o) wrt o. 14 Let d(v) be the first derivative of -v6/2 - 21v*2/2 + 20. What is the second derivative of d(f) wrt f? -60f*3 Let s(m) = -2m - 2. Let f(l) = 2l + 2. Suppose -2 = -b + 2. Let i(y) = bs(y) + 3f(y). Find the first derivative of i(w) wrt w. -2 Let k(w) be the second derivative of w9/3024 - w6/120 + w3/3 - 3w. Let d(x) be the second derivative of k(x). Find the third derivative of d(j) wrt j. 60j2 Let k(t) = 15t*3 - 3t*2 - 14t. Let d(j) = -30j3 + 7j*2 + 28j. Let s(g) = 3d(g) + 7k(g). Find the second derivative of s(a) wrt a. 90a Let c(i) be the third derivative of -2i*7/35 - 3i*3 - 13i*2. What is the derivative of c(v) wrt v? -48v3 Let l(g) be the second derivative of g4/2 + g*3/3 - 5g*2/2 - g - 7. Find the second derivative of l(h) wrt h. 12 Differentiate f - 3f + 2 - 2f + 4 wrt f. -4 Let k(t) = -10t*2 - 8t. Let x(j) = -j + 1. Suppose y - 32 = 5y. Let h(l) = yx(l) + k(l). Differentiate h(o) wrt o. -20o Let b(z) be the first derivative of 0z + 1 - 1/2z2 + 1/12z*4 - 1/3z*3. Let k(i) be the second derivative of b(i). Differentiate k(t) wrt t. 2 Differentiate -45j - 41j + 86j + 10j3 - 7 wrt j. 30j*2 What is the third derivative of 922y*4 + 0 - 915y*4 + 0 + 17y*2 wrt y? 168y Let b(f) be the second derivative of 5f7/21 + f4/3 - f3/2 - 4f - 3. Find the third derivative of b(w) wrt w. 600w2 Let i(o) = -31o - 5. Let x(a) = -47a - 7. Let m(k) = -8i(k) + 5x(k). Differentiate m(h) with respect to h. 13 Find the second derivative of 45c*5 + 1 - 31c + 7491c2 - 7491c*2 wrt c. 900c*3 Let k(n) = -4n*3 + 12n*2 + 2n. Let f(h) = -h*2 - h. Let d(p) = -2f(p) - k(p). Find the third derivative of d(c) wrt c. 24 Find the third derivative of 423 - 423 + 11x2 - 10x*3 wrt x. -60 Suppose w = -3f - 3, 4w + 3f - 18 = 6f. What is the first derivative of 0 - 4 - ws*4 + 1 wrt s? -12s*3 Let q(w) = 3w*2 - 4w*2 + 0w + w + 3 - 2. Let x(c) = -3c4 + 3c*2 - 3c - 2. Let r(z) = 3q(z) + x(z). What is the first derivative of r(b) wrt b? -12b*3 Find the second derivative of -3l2 - l2 - 6l + l2 + 0l2 wrt l. -6 Let c(x) be the third derivative of -x7/105 + x*4/4 - 2x*2. What is the second derivative of c(f) wrt f? -24f*2 What is the first derivative of 3 - 66v*3 + 4 + 39v*3 wrt v? -81v*2 Let l(s) = 5s + 7. Suppose -2 = -3o - 11. Let v = -1 + o. Let f(u) = -11u - 15. Let r(h) = vf(h) - 9l(h). What is the derivative of r(x) wrt x? -1 Let b(x) be the second derivative of -3x5/10 + 7x*3/6 - 5x. What is the second derivative of b(s) wrt s? -36s Suppose -t + 5f - 8 = 0, -1 = 4t - 2f - 5. Find the third derivative of -x*5 + 2x*5 - 2x*2 + 0x*t wrt x. 60x*2 Let l(o) = 1. Let r(y) = 4y - 8. Let j(n) = -10l(n) - r(n). Find the first derivative of j(p) wrt p. -4 Let g(o) be the first derivative of -7o*4/4 + 4o*3/3 - 1. What is the third derivative of g(m) wrt m? -42 Suppose -3k = 3d - 87, d - k - 91 = -2d. Find the first derivative of 1 - z*3 - 30z*2 + dz*2 wrt z. -3z*2 Suppose -2n = -z - 7, -2n + 0n = -5z - 19. Let k be (-1)/(-1 - 1)n. Differentiate -3 - 3l4 + 1 + k with respect to l. -12l3 Let q = 5 + -3. Find the third derivative of v4 - 36 + 2vq + 36 wrt v. 24v What is the derivative of 2y4 - 4y*4 + 3 - 5 wrt y? -8y3 Let p(y) = -y2 - y. Let u = -1 + 4. Let z(w) = -4w3 - 3w*2. Let f(d) = up(d) - z(d). What is the second derivative of f(b) wrt b? 24b Let i = 2 + 2. What is the third derivative of 0r*2 + 5r*4 - 5r2 + r2 - 6ri wrt r? -24r Find the second derivative of	{ "pile_set_name": "DM Mathematics" }
h*(2/65)h)/(hh(-3/14)/hh) assuming h is positive. h(21391/26390) Simplify (d(2/11)/dd(-1/4)/ddd)(-4)(d(-4)/(d/(d(2/23)/dd)))/((d/d6)/dddd*(-1)dd) assuming d is positive. d(-415/253) Simplify v(-1/2)vv(v/v*(-6))/vvv(-6)/v(-2/3)(v(2/15)/(v(1/7)/v))/(v0)31 assuming v is positive. v(291/70) Simplify ((((n/(n(5/4)n))/n)/n3)/((nn/(nn/n(1/4)))/(nn(nnn2n)/n)))/(nn(-2)nnn/(n/(n(2/7)/n)))(-22) assuming n is positive. n(95/14) Simplify (((l1)*(-16)/(((l/(ll2))/l)/l)(1/7))42)(-20/7) assuming l is positive. l(12960/7) Simplify p/(p(-1/6)/p)p(-4)/pp(-1/6)/p(-2/3)(ppp(2/11)p(-5))0 assuming p is positive. p(-7/3) Simplify (((b(5/8)bb(bb*30b)/b)(12/5))27)(-4/25) assuming b is positive. b(-43578/125) Simplify ((n(2/47)/n(-18))/(n/((n/(n/(n*(4/9)/n)))/n)n(-6/19)))29 assuming n is positive. n(3683203/8037) Simplify (j(2/25)/((j/((j/(jjj/j*(2/5))j)/j))/j))30/(j(2/13)/(jj/(jj*(-2/19)))(j*(-3/7)j)/jj(-4)) assuming j is positive. j(-347702/8645) Simplify ((n25)(-5/6)/((n36/n)/((nn23)/n)))(-3/23) assuming n is positive. n(197/46) Simplify ((x(-2)x3)/((x(2/5)x)/x)(3/19))/((x0)*(11/2)x/(x/(x*(-8)/xx))(x/x4)/x) assuming x is positive. x(1229/95) Simplify (o/o2o*0o)/(oo/(oo*(-1)o)o/o(2/23))((o*(-1)oo)11)(-6/29) assuming o is positive. o(-2794/667) Simplify (((((m(1/10)m)/m)/m)/(m/(m/(mm(10/3)))m))/(m*(-3/4)m)47)(2/31) assuming m is positive. m(-1079/930) Simplify (a1/a5)(3/38)(a1)13a/a*(2/9)aa/(a/(a0a)) assuming a is positive. a(2644/171) Simplify (((f13f11)(-4/17))(-3/10))(-15) assuming f is positive. f(-432/17) Simplify ((q(-3/4))(-4/7)((((q(q/(q(qq/(q/q(6/11)q))/q))/q)/q)/q)/q)/(q(4/3)/q))(-42) assuming q is positive. q(1132/11) Simplify ((b(-7)bb/b10)/(b(3/4))(-8/13))(-5) assuming b is positive. b*(945/13) Simplify (xx(-14/9))(24/5)(x(-20)/x)(-49) assuming x is positive. x(3079/3) Simplify (d(1/4)/((dd/(d*(-1/5)d))/d))/(d*(1/6)/dd*7)((d/d(-3/4))/(d/d(-1/8)))/(d(-2))(-40) assuming d is positive. d*(-10259/120) Simplify ((aa/((a/a(-19))/a))/a6a(-7/5)(a/(a*(-16)a))/a)50 assuming a is positive. a(-470) Simplify (q/(q*31q)qq*(-2/65)(q(-8/9)/q)(3/11))39 assuming q is positive. q(-65521/55) Simplify ((z*(-5)z/(z/(((z*(-1)zz)/z)/z)))/(zz*(-5)z)(2/27))(2/35) assuming z is positive. z(-104/315) Simplify ((g1/g)*(-1/34)/(gg(g/g(-1))/g)(16/5))/((g/(g(-1/4)g))*(2/127)(g(-1/4))(-6/11)) assuming g is positive. g*(-68036/6985) Simplify ((v(v/v0)/v)7/(v1/(v/(v/v2))))/(((v/((v/(v/(v/(vv(-1)v)))v)/v))/v)(-39)(vv1)(-4/15)) assuming v is positive. v(128/15) Simplify ((r(1/4)/r)(-22)r*5/((rrr(-2/17)/rrr)/rr))/((r(-1/2))(1/10))4 assuming r is positive. r(3199/170) Simplify ((tt(-2/9))/(ttt(-1/7)/t))(-46)((t1)(-1/47))29 assuming t is positive. t(8983/2961) Simplify (i(2/7)/(i/(i6/i)))(-7/2)/((i0ii/(i*(-2)i))/((ii2i)/(ii(-5)))) assuming i is positive. i(-10) Simplify (c(2/3)/(c/c4)(cc/(c/c(1/4)))(-3/13))/(c/(cc*1/c)(c*(2/3)/c)/cc)27 assuming c is positive. c(1931/156) Simplify ((d/d*3)/(d/(dd*(-3/19)))(dd/((dd/(d*0d)d)/d)d)10)10 assuming d is positive. d*(3390/19) Simplify (((hh(-1/2))/h)(-2))*(7/12)h(-2/15)/h(-2/7)hh*(-1/3)((h/h*(2/9))/h)/hh assuming h is positive. h(1487/1260) Simplify (f(-32))(-16/7)/(f(1/2))(1/24) assuming f is positive. f(24569/336) Simplify (h/(h/(hh0)h))*50/(hh/h*(-2/7)h)*(-29)(h/((h/(hh(-1/4)h))/h))*(11/9)(h/((hhhh(1/2)h)/h))/hh/h(-1/10)h assuming h is positive. h(122531/1260) Simplify v3v(-1/4)vv4v*(1/6)((v/v0)(3/32))(-31) assuming v is positive. v(481/96) Simplify (fff/((f*(1/3)/f)/f)ff)(5/7)(f*(-2/11)ff)/(f/f(-6))(ff(1/3))(-25)(f/(f/f*(-1/6))ff)/f(-1/4) assuming f is positive. f(-29263/924) Simplify ((((q1)19)21)(-28))17 assuming q is positive. q(-189924) Simplify ((rr(-12)/r)/r(-3/2))*2(r*(-2/5)r/(rr/((r/(r(r/(r*(-4)r))/r))/rr)r))2 assuming r is positive. r(-159/5) Simplify ((a(-2/3)/a)(-34)a4a*(1/3)a)/((a*(-1)a*(5/4)/aa)/(a*3aaaa(1/4))) assuming a is positive. a68 Simplify ((rr*(-2/3))/rr*(-23))/(rr/(r/((r*(-42)/r)/r))rr(-3/4)rr) assuming r is positive. r(205/12) Simplify (m(-2/49)/(m(mm(9/4))/m)(mm/m27)(2/59))32 assuming m is positive. m(-382840/2891) Simplify (((aa1)/a)(1/25)((a(-2/9)aa)/a)/aa*(-1/6))/(((aaa0)/a)23)(-4/33) assuming a is positive. a(12073/4950) Simplify ((tt(t/t(-25))/tt)/t(t/(ttt2))/t(t/(t/((tt2)/t)))/t(tt(1/3)t)/t)(17/5) assuming t is positive. t(1292/15) Simplify ((b/b(-10/7))/b)47/(bbb(-23/2))(-1/53) assuming b is positive. b(49687/742) Simplify (o0/(((o/(o*(-1/6)o))/o)/o))(3/5)/((o2)(-2/19)/(o7oo/o*(-3/8)o)) assuming o is positive. o(8881/760) Simplify (f/(f/f(1/10))f)/(ff*(-6)f)((f(-1/4)/f)/f)/f0(f/f2)/(f(-7)/f)fff2ff3 assuming f is positive. f(357/20) Simplify ((v/(v/v2))/(((vv*(-5)/vv)/v)/v))*(-6/31)(v*(-2/5)v)*(-4/15)v*(-4)/vv(6/7)/v assuming v is positive. v(-37168/5425) Simplify (c8/((((c/c(-1/14)c)/c)/c)/c))(-43)/((ccc/(cc(1/6)/c))(-2/5))(5/2) assuming c is positive. c(-8003/21) Simplify (vv(-4/17)vv)10(v/v(-2/21))(-14) assuming v is positive. v(628/51) Simplify (q/q(1/46))/q*19(q(-24)/q)(6/19) assuming q is positive. q(-22651/874) Simplify (u(2/17)/(u/u(2/27)))(-43)(u(-2/5)/uu/(u/(u/u(-3))))/((u/(u/u(-5)))/uu(-3/4)u) assuming u is positive. u*(395713/9180) Simplify ((bb(-2/11))/b(3/10))*(-2/83)/(((b(b(b/(b(1/9)/bb))/bb)/b)/((b/(b(2/11)b))/bb))/(b(-1/8)bb/b(-2/11))) assuming b is positive. b(-8669/328680) Simplify (((q4/(qq*(-7)))/(qq/q*(-5)q5))(2/45))(-12) assuming q is positive. q(16/15) Simplify ((m/(m*(-2/21)/m))/(mmmm*6m)(m/(m(2/3)m))(-37))/((m(4/11)m(-4))/(mmm/(m2m))(-2/41)) assuming m is positive. m(4712/231) Simplify (((h/(hh(-2)/hh)h/((h/(h8h))/h))/(h/h*(-3)h(-5)))(-41))16 assuming h is positive. h(-8528) Simplify ((q/(q/(qq1q)))(-47)/(q20q/(q(-20)q)))(12/11) assuming q is positive. q(-2172/11) Simplify ((b*(-3/4)/b)/bbb7b(bbbbb(-1/3)bbbb)(-1/15))/(b(-1/3)/((b/(b((bb(-5))/b)/bbb))/b))(-2/105) assuming b is positive. b(7151/1260) Simplify (c(-6)(c(c/(c/c(2/9))c)/c)/c)/(((c*(-1/5)/c)/c)/cc*0)cc6c*(2/7)(c0)42 assuming c is positive. c(1483/315) Simplify v/(v(-1)v)v*(5/4)v*(-2/13)vv(6/11)/vv((v/v(-5))/v(3/2))9 assuming v is positive. v(25249/572) Simplify ((v(6/5)vv(-17)/v)/(v((vv/(v/v(-5)))/v)/v)(-19))(-38) assuming v is positive. v(21052/5) Simplify ((dd11)/(d/d(3/4)))(-1/29)/((d(1/4))31/(d1/dd)(-4/5)) assuming d is positive. d(-2597/290) Simplify (ff/f*(-2)(ff(2/17))/fff3/(ff(-2/7)))/((f(1/11)f/f(-2/13))/(f3/(ff*(-5)fff))) assuming f is positive. f*(172869/17017) Simplify ((zz/z(-3))/((z/(z/z(-2/7)))/z)(z(1/2))(-1/4))/((z(-2/3))(-1)(z(2/5))(5/16)) assuming z is positive. z(451/84) Simplify (((s/((s(1/3)ss)/s)s)/s(-2/5))/(s(-1/4)/s(-3)))/((ss/((sss/s*(1/3)s)/s))(-13/5))(-5/2) assuming s is positive. s(53/20) Simplify (f/f20)*(-1/9)((ff(8/7)f)/ff)/ff/((f*(-4)f)/ff) assuming f is positive. f(520/63) Simplify (q(-2/11)/((q(-1/3)/q)/q))33(q/((q(qq/(q*(-1)q))/q)/q))(4/11)/(q(-2/7))(9/8) assuming q is positive. q(1997/28) Simplify (q*(6/7)/qq(-1))(-9)(q/(qq*(-1/3)qq))(5/3)((q/q*6)/qq)/q5 assuming q is positive. q(-157/63) Simplify (((n/(n*(2/63)/n))/nnn/((nn*(-2/63)/nn)/n))/(n*30(n(n/(n/n(-28))n)/n)/n))**(-31) assuming n is pos	{ "pile_set_name": "DM Mathematics" }
2. Suppose -2v = -hv + 35. Suppose 4a - 37 = v. List the prime factors of a. 2, 3 Let j(p) = -p3 + 5p*2 + 4p - 4. Let b be j(5). Suppose -260 = -bq + 11q. List the prime factors of q. 2, 13 Suppose 4 = 4d - j, 5j + 4 = -5d - 16. Suppose 5o - 2o = d. Suppose ot - 4t = -36. List the prime factors of t. 3 Let b = -46 + 180. Suppose -74 = -3c - 4l, 2c + 3c - b = -4l. List the prime factors of c. 2, 3, 5 Suppose -6176 = -28n - 4n. List the prime factors of n. 193 List the prime factors of (2 - (-12)/(-8))(517 + 13). 5, 53 Suppose 0 = -p - 4p + 2m + 204, 5p - 3m - 206 = 0. What are the prime factors of p? 2, 5 Suppose -24w = -20w - 104. Let r = w + -17. Suppose -rp + 6p = -99. List the prime factors of p. 3, 11 Let i = -18 + 16. Let k be (i/3)/(2/(-9)). Suppose 0 = -o + ko - 4. What are the prime factors of o? 2 Let x be 3/(3 + 13/(-4)). Let n(p) = -5p - 8. What are the prime factors of n(x)? 2, 13 Let u(n) = n2 + 9n + 7. Let j be u(-10). Let b = 19 - j. Suppose -3a = 2a - 2x - 164, -x = ba - 62. List the prime factors of a. 2 Let x = -501 + 1236. Suppose 2a = 9a - x. List the prime factors of a. 3, 5, 7 Suppose -4h = 5y - 1484, -7h + 9h - 1192 = -4y. List the prime factors of y. 2, 3, 5 Suppose 15t - 4633 = 15557. List the prime factors of t. 2, 673 Let y = 21 - 16. Suppose 0 = 5o + yo - 60. List the prime factors of o. 2, 3 Let a(s) = -s*2 - 2s + 4. Let g be a(-6). Let n be 59/(-5) - (-4)/g. Let q = 24 + n. What are the prime factors of q? 2, 3 Let r(b) = 22b + 16b - 9b + 1 - 8b. Let g be r(1). List the prime factors of (-11)/(-1) - g/(-11). 13 Let b(c) = 6c3 - 5c*2 - c - 5. Let m(z) = 5z*3 - 4z*2 - z - 5. Let y(v) = 4b(v) - 5m(v). Suppose 0 = -0j - 2j. List the prime factors of y(j). 5 Suppose n + 2c = 4023, -4n - 25c + 16067 = -22c. What are the prime factors of n? 4013 Let j = 35 - 19. Let s = j - -67. What are the prime factors of s? 83 Suppose 8o - 511 = 129. What are the prime factors of o? 2, 5 Let n(o) = 5o2 - 9o - 3. Let d be n(7). Let g = d + -108. What are the prime factors of g? 71 Suppose 56l - 232760 + 83072 = 0. List the prime factors of l. 3, 11 Suppose -2a + 2m + 1 - 5 = 0, -m + 2 = 2a. Suppose a = 25t - 20t - 30. List the prime factors of t. 2, 3 Suppose -14y = -15y - 25. Let k(u) = -8u + 10. Let v be k(7). Let s = y - v. What are the prime factors of s? 3, 7 Let h(y) = 7y - 2. Let d be h(1). Suppose 0 = ds - 68 - 162. What are the prime factors of s? 2, 23 Suppose 0 = -3k + 2u + 605, 2k - 4u - 636 = -230. List the prime factors of k. 3, 67 List the prime factors of ((-48)/(-14))/((4 - 6)/(-112)). 2, 3 Suppose -3c = -4m - 3, 3m - 2c + 14 = 12. Let h(a) = -a + 40. Let r be h(0). Suppose 4l = -ml + r. What are the prime factors of l? 2, 5 Suppose -66u + 4v + 2365 = -61u, 0 = u + 3v - 473. What are the prime factors of u? 11, 43 Let s(g) = g2 - 4g - 4. Let l(y) = -y*2 + 3y + 3. Let r(u) = -6l(u) - 5s(u). Let p be r(-5). Let o = -10 + p. What are the prime factors of o? 7 Suppose 0 = 7p - 8 - 20. Suppose pf = 2d - 114, -3d + 228 = d + 3f. What are the prime factors of d? 3, 19 Suppose -4y + 3y = -5. Suppose -20 = yj, j + 4j = -5t + 370. List the prime factors of t. 2, 3, 13 Let b(i) = i*2 - 9i + 4. Let f be b(5). Let x = 20 + f. Suppose -d - xd + 25 = 0. What are the prime factors of d? 5 Let o(t) be the first derivative of -2t*3/3 - 3t*2/2 + 3t - 6. Let m be o(-4). List the prime factors of m/(3/(-4 - -1)). 17 Let o be 4/6 - (-42)/(-9). Let u(z) = 6. Let a(v) = -v + 1. Let i(t) = oa(t) - u(t). What are the prime factors of i(6)? 2, 7 Let q = -54 + 1051. What are the prime factors of q? 997 Suppose -1782 = -2t + b + 5704, 2t + 2b - 7480 = 0. List the prime factors of t. 2, 1871 Let k = -664 - -701. What are the prime factors of k? 37 Let z(i) = -i*2 + 6i - 2. Let v be z(5). Let a(b) = -1 - 22 - 15b + v + 4b. What are the prime factors of a(-6)? 2, 23 Let h(s) = -33s + 69. List the prime factors of h(-19). 2, 3, 29 Let n(p) be the first derivative of 30p*2 - 37p + 37. What are the prime factors of n(3)? 11, 13 Let m(s) = s - 1. Suppose -19 = 3h - 1. Let d be -1 - (3 - 1) - h. What are the prime factors of m(d)? 2 Let j(m) = -5 - 2m + 2 + 13 + 6. What are the prime factors of j(7)? 2 Suppose -3p - 15 = -5o, 0o + o + 5p = -25. Suppose 4a + 416 = 5f, 5f - 2a + 7a - 380 = o. Suppose 4w - f = -0w. What are the prime factors of w? 2, 5 Suppose -6p + 1630 = -422. List the prime factors of p. 2, 3, 19 Let z(o) = -3o3 - 10o*2 + 7o - 11. What are the prime factors of z(-9)? 1303 Let l be 4/4 + 2 - -10. Suppose -v - 5h = -23, 5v + h - 6 = l. List the prime factors of (-1 + -28 + v)-1. 2, 13 Let z be (-18)/(-4) - 12/24. Suppose -k - 471 = -zf, -2f + k + 237 = -0f. List the prime factors of f. 3, 13 Let j(a) = 1927a3 + 3a*2 - 2a + 1. List the prime factors of j(1). 3, 643 Let m = 90 + 1047. What are the prime factors of m? 3, 379 Let c(p) = 5p2 + 8p - 6. Let b(i) = 11i2 + 17i - 12. Let m be 12/(-5) - (-16)/40. Let z(g) = mb(g) + 5c(g). List the prime factors of z(4). 2, 3, 11 Suppose -5q = 5, 0a + 2a = 5q - 367. Let y = a + 261. What are the prime factors of y? 3, 5 Let x(y) = y*2 + 2y - 10. Let q be x(-5). Let h(v) = 22v + 8. What are the prime factors of h(q)? 2, 59 Let v be 5 + (-1)/((-1)/(-1)). Suppose -2l - vb + 32 = l, l - b = 20. Let p = l - 1. What are the prime factors of p? 3, 5 Let s(c) = c3 + 20c*2 - 2c - 17. List the prime factors of s(-20). 23 Let z be 4/8 - (-162)/12. Let n(s) = -6 + 9s - s2 - 9 + 7s. What are the prime factors of n(z)? 13 Let t(b) = b*3 + 7b*2 + 3b - 2. Let x be t(-6). Let h = x - -44. What are the prime factors of h? 2, 3, 5 Let n(r) = r + 26. Let s(k) = 2k + 51. Let q(w) = -7n(w) + 4s(w). What are the prime factors of q(-18)? 2 Let h(s) = -30s + 6. Let p(n) = -n. Let o(x) = h(x) + 2p(x). What are the prime factors of o(-5)? 2, 83 Let p = -4 - -6. Suppose -752 = -5h - 3f, 0h - pf = h - 156. Suppose 7w + h = 477. List the prime factors of w. 47 Suppose -g - 60 + 2901 = 4s, 4g - 2856 = -4s. What are the prime factors of s? 709 Let w(v) = 2v*2 - 6v - 7. Let c(d) = -d*3 - 5d*2 + 3d - 9. Let l be c(-6). What are the prime factors of w(l)? 101 Suppose -4z - 1 + 9 = 0. Let o be 4 - ((2 - 2) + z). Suppose of - 18 = 20. What are the prime factors of f? 19 What are the prime factors of 11 + 808 + 3 + -9? 3, 271 Let n = -94 - -96. Suppose -4w = -4q - 328, 2w + 0w = -nq + 164. List the prime factors of w. 2, 41 Suppose u + 10 - 14 = 0. Suppose 64 = 2l + 2i - u, -l + 3i + 14 = 0. Suppose 3o + 39 = 2k, -6k + 5o = -4k - l. List the prime factors of k. 3 Let n(u) = -3u - 5. Let q be n(-5). Let g(j) = qj - 10j - 12j + 2 - 15j. List the prime factors of g(-1). 29 Suppose -43r = -830 - 15854. List the prime factors of r. 2, 97 Let r = -51 - -51. Suppose r = -5q - 6 + 441. What are the prime factors of q? 3, 29 List the prime factors of (-1 + 200)/(17/119) - -5. 2, 3, 233 Let s be (-1)/((-18)/4) + (-6468)/(-54). Suppose 10w = 140 + s. List the prime factors of w. 2, 13 Suppose -y - 3h = -16, 48 - 30 = y + 5h. What are the prime factors of y? 13 Let k(n) = 7n*2 - n + 2. Let i be k(2). Let m = i - -8. Suppose 0y = -4y + 4c + m, -2c - 30 = -4y. What are the prime factors of y? 2, 3 Let q(v) = v*3 + 7v*2 + v + 5. Let t be q(-7). Let o be (-1368)/(-99) - t/11. Suppose -4 + o = z. List the prime factors of z. 2, 5 Suppose d - 3236 = -2h, 2h - h - 12944 = -4d. List the prime factors of d. 2, 809 Suppose i + 2u = -i + 4, 0 = -4u + 8. Suppose -5l + 1251 - 351 = i. What are the prime factors of l? 2, 3, 5 Let c = 17 + -2. Let j = 19 - c. Suppose -2f + y - 4 = -86, 4f - 164 = -jy. List the prime factors of f. 41 Let s(k) = -k*3 + 14k*2 + k - 14. Let j be s(13). Let c = j - 33. Suppose -3u + 0u = 3f - c, 111 = 2u - 5f. List the prime factors of u. 2, 3 Let h(l) = -l*3 - 22l*2 - 12l + 21. What are the prime factors of h(-22)? 3, 5, 19 Let b be (-6 + 1)18/(-10). List the prime factors of (b/(-8))/3 - (-3046)/16. 2, 5, 19 Suppose 5 = 5f, c + 3f - 498 = 6c. Let y	{ "pile_set_name": "DM Mathematics" }
- 52437020 = 0. What is o? -89, 2/7, 1655 What is p in 4p2/3 - 3365592p + 2123851783212 = 0? 1262097 Determine w, given that -4w5 + 306812w*4 - 2454312w*3 + 5522104w*2 - 4908500w + 1533900 = 0. 1, 5, 76695 Determine t, given that 4t4 - 19596t*3 + 26959764t*2 - 14647622756t + 2797407742584 = 0. 611, 3066 Factor 4j2 + 298256j + 13413420. 4(j + 45)(j + 74519) Solve -2q2/7 + 53300q/7 + 11172928/7 = 0. -208, 26858 Solve -5c3 - 314884695c2 = 0. -62976939, 0 Find h such that -h4 + 1718h3 - 729600h2 = 0. 0, 768, 950 Find w such that w5/9 + 139w4/9 + 367w*3/9 - 30433w*2/3 - 30392w = 0. -131, -29, -3, 0, 24 Suppose -l*4 + 260l*3 + 156288l*2 - 35842832l - 2746285040 = 0. Calculate l. -370, -62, 346 Factor 3a2/2 - 323757834a + 17469855846061926. 3(a - 107919278)2/2 Suppose -44n*3/3 + 10537n*2/9 + 613n/3 + 80/9 = 0. Calculate n. -1/11, -1/12, 80 Solve -d*4/2 - 2735d*3/2 - 1809867d*2/2 + 82960803d/2 = 0 for d. -1389, 0, 43 Determine u, given that u*5/5 + 571u*4/5 + 43018u*3/5 + 636742u*2/5 + 1146709u/5 + 110483 = 0. -485, -67, -17, -1 Factor 2t3 - 63376t*2 + 1076778t + 1140156. 2(t - 31671)(t - 18)(t + 1) Let -2t*3/9 + 1522106t*2/9 + 2t/9 - 1522106/9 = 0. Calculate t. -1, 1, 761053 Let 2u5/3 - 148u*4 + 16546u*3/3 - 52008u*2 - 57672u = 0. What is u? -1, 0, 18, 27, 178 Factor 5s3 + 7888555s*2 + 141992775s + 638965665. 5(s + 9)2(s + 1577693) Determine z, given that z*3 + 3493z*2 + 364172z + 6331820 = 0. -3386, -85, -22 Factor -5c3/4 + 252855c*2/4 - 2653875c/2. -5c(c - 50550)(c - 21)/4 Find f such that -f4 + 17884f*3 - 64969218f*2 - 139847460444f + 139912411779 = 0. -1491, 1, 9687 Find c, given that 2c2/5 - 16599718c/5 + 49799136/5 = 0. 3, 8299856 Find o such that 5o5 - 5260o*4 - 271375o*3 - 4520750o*2 - 27500000o - 55100000 = 0. -20, -5, 1102 Determine w so that w*2/5 + 143013w/5 + 143012/5 = 0. -143012, -1 Find i, given that -i*2/9 + 16739i/3 - 50216/9 = 0. 1, 50216 Factor 4l2/7 - 3434288l/7 - 3434292/7. 4(l - 858573)(l + 1)/7 Find x, given that 4x4 + 1122x*3 + 7164x*2 + 10960x = 0. -274, -4, -5/2, 0 Solve -3c2 + 21705c - 21185208 = 0 for c. 1163, 6072 Determine k, given that -k*3/3 - 630163k*2 + 4k/3 + 2520652 = 0. -1890489, -2, 2 Let -2f5/15 + 2f*4/5 + 562f*3/15 - 58f*2/5 - 4144f/3 - 6664/5 = 0. Calculate f. -14, -6, -1, 7, 17 Suppose 3d4/4 + 850731d*3/4 - 6806025d*2/4 + 4253925d/4 + 21268875/2 = 0. Calculate d. -283585, -2, 5 Factor 10124929602g2 + 455366400g + 5120000. 2(71151g + 1600)*2 Determine u, given that -5u*3 - 1071170u*2 - 11782265u = 0. -214223, -11, 0 Find p, given that 3p2/5 - 1180830p + 112177767/5 = 0. 19, 1968031 Find g such that -35g2 + 34410960g - 9831700 = 0. 2/7, 983170 Solve -2g2/9 - 17762g/9 - 3370556/9 = 0. -8687, -194 Find x such that 1033396722x2/5 - 6910224x/5 + 11552/5 = 0. 76/22731 Let -10v5 - 26v*4 + 3126v*3 + 26v*2 - 3116v = 0. What is v? -19, -1, 0, 1, 82/5 Determine t so that -t*3/5 - 8887t*2/5 + 964808t - 127182640 = 0. -9407, 260 Determine r, given that -r*4 - 19437r*3 - 92625835r*2 + 17803697937r - 17711052664 = 0. -9811, 1, 184 Suppose -u*3/3 - 12768u*2 - 968924u - 55201232/3 = 0. Calculate u. -38228, -38 Factor 5s3 - 7429885s*2 + 29719480s - 29719460. 5(s - 1485973)(s - 2)2 Factor x4/4 - 4553x3 + 9105x2. x2(x - 18210)(x - 2)/4 Find m such that 20m2 + 5383732332m - 2153492936 = 0. -269186617, 2/5 What is c in -4c3/3 + 985c*2 - 35271c - 26638/3 = 0? -1/4, 38, 701 Factor n*3 - 371486n*2 - 104818695n - 7391119608. (n - 371768)(n + 141)2 Factor -2t*3 + 9946t*2 - 549822t - 4336794. -2(t - 4917)(t - 63)(t + 7) Determine d so that 2d*4/3 + 2836d*3/3 + 482320d*2/3 - 976000d/3 = 0. -1220, -200, 0, 2 Let 4k2 + 2670472k + 2670468 = 0. What is k? -667617, -1 Factor 51a2 + 385032a - 135900. 3(a + 7550)(17a - 6) Solve z5/8 - 33z*4/8 - 30851z*3/8 + 61857z*2/8 + 15425z/4 - 7728 = 0 for z. -161, -1, 1, 2, 192 Factor -2s2/7 + 229640s + 1607482/7. -2(s - 803741)(s + 1)/7 Let -54o3 - 8252o*2 + 80262o - 14580 = 0. What is o? -162, 5/27, 9 What is h in 2h4/9 + 22126136h*3/9 + 61195714660172h*2/9 - 13599055077640h + 6799528768050 = 0? -5531535, 1 Solve 12a4 + 2180a*3 + 67060a*2 - 245940a + 74448 = 0. -141, -44, 1/3, 3 Find m, given that 5m2 - 6875m + 2251530 = 0. 538, 837 Let 2b4 + 303431b*3/6 + 957997157b*2/3 - 13521724150b/3 + 1120157500/3 = 0. Calculate b. -12650, 1/12, 14 Factor 4a2 + 32296056a + 64592096. 4(a + 2)(a + 8074012) Factor -3h2 + 809211h - 5664330. -3(h - 269730)(h - 7) Suppose 5043t3/7 + 224130477t*2/7 + 355742118240t - 355774137600 = 0. Calculate t. -911120/41, 1 Factor -c*3 + 37505c*2 - 171230367c + 209344968063. -(c - 32423)(c - 2541)2 Determine s so that -4s*2 - 101628s - 101624 = 0. -25406, -1 Solve 63t5 - 4792782t*4 + 42673482t*3 + 7987476t*2 - 33545385t - 12322854 = 0 for t. -2/3, -3/7, 1, 9, 76067 What is w in -3w5 + 7542w*4 - 848427w*3 + 16768404w*2 + 485256420w - 501183936 = 0? -16, 1, 66, 2397 Determine x, given that -x*3 + 308362x*2 - 87514316x + 6212084792 = 0. 142, 308078 Solve -14j2 - 531830j/9 + 7504 = 0. -4221, 8/63 Find v, given that -2v5/19 - 3868v*4/19 + 730518v*3/19 + 12742648v*2/19 - 14914840v/19 - 26923104/19 = 0. -2106, -17, -1, 2, 188 Factor -j*2 - 655951j. -j(j + 655951) Let 4b*3/5 + 1077808b*2/5 - 45274992b/5 = 0. Calculate b. -269494, 0, 42 Factor 11i3 + 26383i*2 - 52799i + 26405. (i - 1)*2(11i + 26405) Solve r4/3 - 2185r*3/3 + 380214r*2 + 19445184r + 37363680 = 0. -45, -2, 1116 Let -2g5/15 + 416g*4/3 - 228782g*3/5 + 13628900g*2/3 + 578635648g/15 + 78651328 = 0. Calculate g. -4, 210, 419 Factor -3k2/2 + 144777006k. -3k(k - 96518004)/2 Determine p, given that -p*3/8 + 4309p*2/8 + 9184p + 75705/2 = 0. -10, -7, 4326 Factor 3g3 - 66294g*2 - 3056013g + 3122304. 3(g - 22144)(g - 1)(g + 47) Solve 2l*3/17 - 236216l*2/17 + 5432030l/17 - 14170200/17 = 0. 3, 20, 118085 Suppose -2y4/5 - 244872y*3/5 - 7516316456y*2/5 - 1287378298944y/5 - 55279500103808/5 = 0. What is y? -61132, -86 Let -1365w4/4 - 4391w*3 - 14025w*2/4 + 1099w/2 + 6 = 0. Calculate w. -12, -1, -2/195, 1/7 Suppose -16n3/3 + 441200n*2 - 1323564n + 992664 = 0. Calculate n. 3/2, 82722 Determine t so that 4t4 - 72820t*3 + 4499460t*2 + 72820t - 4499464 = 0. -1, 1, 62, 18143 Factor -672z2 - 9052z + 62060. -4(z - 5)(168z + 3103) Factor 4o*3 + 27892o*2 + 63788364o + 47602577340. 4(o + 1735)(o + 2619)*2 Factor 3a*2/7 - 147243324a/7 + 1806716371880748/7. 3(a - 24540554)2/7 Find z such that -3z*3 - 5445z*2 + 98886z - 175968 = 0. -1833, 2, 16 Factor -x*2/3 - 1554x - 3878552/3. -(x + 1084)(x + 3578)/3 Find q, given that 5q*3/3 - 112840q*2/3 + 628785905q/3 + 29644840070 = 0. -138, 11353 Factor g*2/3 - 39565906g/3 - 26377272. (g - 39565908)(g + 2)/3 Suppose -u2 - 43379u + 1606392 = 0. What is u? -43416, 37 Find q, given that -650q4 + 1438455q*3 - 4321865q*2 + 2906160q - 22100 = 0. 1/130, 1, 2, 2210 Suppose 2r3 + 2353594r*2 = 0. What is r? -1176797, 0 Determine q so that -79q*3/2 + 170567q*2/2 - 176880q + 12942 = 0. 6/79, 2, 2157 Let 39j5 + 17951j*4 - 31099j*3 - 66923j*2 + 31060j + 48972 = 0. What is j? -462, -1, 1, 106/39 Determine v so that -2v2/3 + 2753678v/3 - 22029040 = 0. 24, 1376815 What is d in -4d2 - 102493572d = 0? -25623393, 0 Let -2b3/19 - 12550b*2/19 - 34728b - 1866600/19 = 0. Calculate b. -6222, -50, -3 Let -3q5/2 - 28569q*4/2 + 3675525q*3/2 - 10855131q*2/2 + 5398989q - 1794900 = 0. What is q? -9650, 1, 124 Factor -5j2 + 309358j + 123744. -(j - 61872)(5j + 2) Determine j, given that 5j4/3 + 10500j*3 + 1158065j*2/3 - 1231590j + 2505200/3 = 0. -6263, -40, 1, 2 Suppose 4p5/9 - 57008p*4/9 - 88756p*3 - 1312528p*2/9 + 798800p/9 + 456512/3 = 0. What is p? -12, -2, -1, 1, 14266 What is a in -2a2/5 - 44882a/5 + 3422400 = 0? -	{ "pile_set_name": "DM Mathematics" }
1173 + 18d2. 18d*2 Collect the terms in -109367 + 109367 - 2u. -2u Collect the terms in -10j + 16j - 29j. -23j Collect the terms in 10j - 2j - j + 25j. 32j Collect the terms in 36d*3 + 32d*3 - 39d*3. 29d*3 Collect the terms in 0 + 0 - 20x*3 + 8x*3. -12x*3 Collect the terms in 46 - 3w - 46. -3w Collect the terms in -41x*2 + 46x*2 - 4x + 4x. 5x*2 Collect the terms in -636m*2 - 625m*2 + 1268m*2. 7m*2 Collect the terms in -115q*3 + 97q*3 + 55q*3. 37q*3 Collect the terms in 5s + 0s + 1500 - 2s - 1500. 3s Collect the terms in -13s*2 + 5s*2 + 11s*2 + 3 - 3. 3s*2 Collect the terms in 46j*3 - 32j*3 + 193j*3. 207j*3 Collect the terms in -11z*3 - 18z*3 - 9z*3. -38z*3 Collect the terms in 15 + 26 + 11n*3 - 41 + 4n*3. 15n*3 Collect the terms in 9 - 32 + 3q + 3q + 10. 6q - 13 Collect the terms in -28z3 - 4z*2 - 33z*3 + 4z*2. -61z*3 Collect the terms in 21y - 13y + 4y*2 - 8y. 4y2 Collect the terms in -5x - 10x + 25x - 9x. x Collect the terms in -4d*3 - 2d + 3d3 + 0d3. -d3 - 2d Collect the terms in -5 + 2 + 1 - 266o. -266o - 2 Collect the terms in 13v - 24v + 10v. -v Collect the terms in -2q - 6q + 5 - 1 - 3. -8q + 1 Collect the terms in 8h - 6h + 9h + 14h. 25h Collect the terms in 9y2 - 2y*2 - 2y*2 + 4y*2. 9y*2 Collect the terms in -8 + 20 + 12h*2 - 12. 12h*2 Collect the terms in 20j + 3j2 + 91j - j*2. 2j*2 + 111j Collect the terms in -9 - 5o2 + 18 - 9 + 0. -5o*2 Collect the terms in 3s*2 - 307 + 307. 3s*2 Collect the terms in -29m*3 + 21m*3 + 7m3. -m3 Collect the terms in -9c - 2c + 7c + 6c. 2c Collect the terms in 127 - 3v*2 - 22 + 7v*2. 4v*2 + 105 Collect the terms in -19a - 10a - 11a + 7a. -33a Collect the terms in -4o - 27o + o - 18o. -48o Collect the terms in 113m2 - 240m*2 + 117m*2. -10m*2 Collect the terms in 65v - 21v - 18v - 11v - 16v. -v Collect the terms in -66 + 23d + 66. 23d Collect the terms in -4t2 - 8t*3 - 8t*2 + 12t*2. -8t*3 Collect the terms in 0 + 1 - 191n*2 - 1 + 199n*2. 8n*2 Collect the terms in 5c*2 + 2c*2 + 6c*2. 13c*2 Collect the terms in -2m + 11m + 22 + 19m. 28m + 22 Collect the terms in 3j*3 - 4j*3 - 1331j*2 + 1331j2. -j3 Collect the terms in 3i - 12i + i. -8i Collect the terms in -40h*2 - 36h*2 + 13h*2 - 135h*2. -198h*2 Collect the terms in -28 + 28 - 5n*3 + 7n*3. 2n*3 Collect the terms in -5o*3 - 5o*3 - 4o*3 + 12o*3. -2o*3 Collect the terms in -8d*2 + 2 - 2 + 0d*2. -8d*2 Collect the terms in 20w2 - w3 - 20w2 - 10w*3 + 10w3. -w3 Collect the terms in -151 + 151 + 8v3. 8v*3 Collect the terms in -2 - 12i - 23i + 2 + 48i. 13i Collect the terms in -82d - 50d + 86d. -46d Collect the terms in -111l*2 - 24l*2 + 138l*2 - 11l + 11l. 3l*2 Collect the terms in -2c - 17455 + 17455. -2c Collect the terms in -j2 + j2 - 95j*3. -95j*3 Collect the terms in 10k + 12k - 15k. 7k Collect the terms in -k3 - 326k*2 + 326k2. -k3 Collect the terms in 13m2 + 2m - 2m2 - m + 5m. 11m2 + 6m Collect the terms in -89c3 - 83c*3 + 176c*3. 4c*3 Collect the terms in -15p*3 - 17p*3 + 33p3. p3 Collect the terms in -2p + 7p + p - 11p + 4p. -p Collect the terms in -3m + m + 0m + 0m. -2m Collect the terms in 13d3 + 5d*3 - 3d + 3d - 4d. 18d3 - 4d Collect the terms in 19s - 44s - 161s - 1. -186s - 1 Collect the terms in 8r - 8r - 775r3. -775r*3 Collect the terms in m + 64m*2 + 46m*3 - 44m*3 - m. 2m*3 + 64m*2 Collect the terms in 14s*3 + 10s*3 + 33s3 + s2. 57s3 + s2 Collect the terms in 4123 + 4u*3 - 3u + 3u - 4123. 4u*3 Collect the terms in -309 + 105 + 101 - 35g*2 + 103. -35g*2 Collect the terms in 938q*2 - 938q*2 + 2q*3. 2q*3 Collect the terms in 6q*2 - 6q*2 + 0q*2 + 3q*2 - 9q*2. -6q*2 Collect the terms in -2w*3 - 9w3 - w3 + 15w3. 3w*3 Collect the terms in 1924 - 1924 - 6w. -6w Collect the terms in 10m*2 - 11m*2 + 6m*2. 5m*2 Collect the terms in -57l*3 - 142l*3 + 32l*3. -167l*3 Collect the terms in 7u - 7u - 26u*2 - 6u*2. -32u*2 Collect the terms in -57907m - 4 + m*2 + 57907m + 4. m*2 Collect the terms in 21p*2 + 23p*2 + 17p*2 - 41p*2. 20p2 Collect the terms in s3 + 0s3 + 12s3 + s3. 14s3 Collect the terms in -5m*2 + 5m*2 + 17m - 2m2. -2m*2 + 17m Collect the terms in 1 - 84k3 + 80k*3 + 18. -4k*3 + 19 Collect the terms in -6q*2 + 170 - 170. -6q*2 Collect the terms in 235i*3 + 2 - 2. 235i*3 Collect the terms in -32z - 39z + 144z - 35z - 36z. 2z Collect the terms in 59600v + 1 - 1 - 59615v. -15v Collect the terms in -5752 - 3l2 + 5752. -3l*2 Collect the terms in 0w*3 + 5w*3 + 0w*3. 5w*3 Collect the terms in -2 - 308p*2 + 2 - 203p*2. -511p2 Collect the terms in w2 - 1316w + 1316w. w*2 Collect the terms in -101p + 4p3 - 2 + 101p + 5. 4p3 + 3 Collect the terms in 19i*2 - 14i*2 + 2i*2. 7i*2 Collect the terms in -3t*2 + 11t*2 - 9t2. -t2 Collect the terms in -9q2 + 9q*2 + 58q*3 - 3q*3. 55q*3 Collect the terms in -1 + 10r*3 + 4 - 6 + 3. 10r*3 Collect the terms in 33r*2 + 18r2 + r3 - 75r2 + 24r2. r3 Collect the terms in -36w3 + 34w*3 + 19w + 27w - 46w. -2w3 Collect the terms in g2 - 447g + 447g - 3g*2. -2g*2 Collect the terms in 1 - 1 + 9t - 8t. t Collect the terms in -g2 + 6g*2 + 10g*2. 15g*2 Collect the terms in -3a - 11a + a + 4a. -9a Collect the terms in -9g - 8g + 18g. g Collect the terms in 411n - 411n - 4n3. -4n*3 Collect the terms in -1 - 8f*3 - 69f*3 + 2. -77f*3 + 1 Collect the terms in 46 - 2f*2 + 7f - 46. -2f2 + 7f Collect the terms in -10q - 64 + 64. -10q Collect the terms in 429l2 - 866l*2 + 435l*2. -2l*2 Collect the terms in 24 - 24 + 77f - 79f. -2f Collect the terms in -5c - 3c + 236c. 228c Collect the terms in -1980 - 4l2 + 1980. -4l*2 Collect the terms in 8o - 4 - 3o + 7o. 12o - 4 Collect the terms in 535f - 266f - 268f. f Collect the terms in 23d2 - 1143 + 1143. 23d*2 Collect the terms in 0j*2 + 133j + 0j2 + 2j*3 - 87j. 2j3 + 46j Collect the terms in 290a3 - 144a*3 - 136a*3. 10a*3 Collect the terms in 7q - 3q - 7q. -3q Collect the terms in i2 + 5i*2 - 300i*3 - 5i*2. -300i3 + i2 Collect the terms in 2u3 + 20u*2 - 12u*2 - 8u*2. 2u*3 Collect the terms in 56w*3 + 60w*3 - 87w*3. 29w*3 Collect the terms in 6 - 21 - 11o + 15. -11o Collect the terms in 2z*2 - 4z*2 - 4z*2 + 10z*2. 4z*2 Collect the terms in 114g*3 - 88g*3 - 88g*3. -62g*3 Collect the terms in -8x - 6x + 12x. -2x Collect the terms in -202q + 108q + 95q. q Collect the terms in -5w + w + 8w. 4w Collect the terms in 26p*2 - 9p*2 - 15p*2 + 0p*2. 2p*2 Collect the terms in 3 + 2 - 5 - 86z. -86z Collect the terms in -34z*2 + 14z*2 + 24z*2. 4z*2 Collect the terms in -240k*2 + 238k*2 - k + 43 + k. -2k*2 + 43 Collect the terms in 0m2 + m2 - 12 + 0m2 + 12. m2 Collect the terms in 3x*2 - 5x*2 - 333 + 164 + 169. -2x2 Collect the terms in b2 + 3b2 - 13b*2. -9b*2 Collect the terms in -21144z + 21144z - 23z*2. -23z*2 Collect the terms in 2d + 15 + 4d3 - 2d - 3d3. d3 + 15 Collect the terms in -8 + 7 + 32n*2 + 1. 32n*2 Collect the terms in 9l - 4l - 3l*2 - 5l. -3l2 Collect the terms in -4 + k + 2 + 4k + k. 6k - 2 Collect the terms in -44 - 3u + 121 - 37 - 40. -3u Collect the terms in 35 - 6z - 17 - 18. -6z Collect the terms in -19 + 10 - 5k + 9. -5k Collect the terms in 2 - 473z - 7 + 5. -473z Collect the terms in 121w*2 - 253w*2 + 130w*2. -2w*2 Collect the terms in 34 - 71 + 37 + 2k. 2k Collect the terms in -5n + 12n - 4n. 3n Collect the terms in 3 - 19t*2 - 1 + 18t2. -t2 + 2 Collect the terms in -63618y2 + 63618y*2 + 3 - 12y*3 - 3. -12y*3 Collect the terms in 2l - 4l - 24l. -26*l Collect	{ "pile_set_name": "DM Mathematics" }
)/3)/(2/6). Let n be 5412/d - (-24)/(-56). Let g = -272 - n. List the prime factors of g. 5, 23 Let o = -1 + 3. Suppose ok - 164 = 420. What are the prime factors of k? 2, 73 Let x(y) = 5y*3 + 21y*2 - 13. Let p(t) = 6t*3 + 23t*2 + t - 13. Let q(a) = -6p(a) + 7x(a). List the prime factors of q(6). 59 Suppose 5 = -d + 16. Suppose -7y + 40 = -dy. Let q(i) = -i3 - 11i*2 - 12i + 10. What are the prime factors of q(y)? 2, 3, 5 Let d = 3 - -1. Let v(b) = 6b + 25b + 2b + 22b + 12. List the prime factors of v(d). 2, 29 Let r be (-3)/(6/4)15171/(-6). Suppose 0 = -16t + 3t + r. List the prime factors of t. 389 Let r(q) = -q3 + 29q*2 + 8q - 39. Let h be r(27). Let z = h - 1104. What are the prime factors of z? 3, 59 Suppose -179l + 21l = -2004862. List the prime factors of l. 12689 Let x(i) = -5i2 - i. Let n be x(-2). What are the prime factors of -15(n - -1) - (22 + -22)? 3, 5, 17 Let f(r) = r*2 - 24r - 65. Let d be 6/(-15) - (-5 + 456/(-15)). List the prime factors of f(d). 2, 5 What are the prime factors of (-90)/420 + (-363603)/(-42)? 11, 787 Suppose 4s = -5w + 136980, -2w - 3s + 4611 = -50181. List the prime factors of w. 2, 3, 761 Let n(r) = -r*3 + 15r*2 + 21r - 9. Let j(d) = -6d - 28. Let f be j(-7). List the prime factors of n(f). 13, 37 Let a be 130/18 - (-16)/(-72). Suppose -1111 + 110 = -al. List the prime factors of l. 11, 13 Let p(t) = t + 12. Let v be p(-8). Suppose vn = -4, -4n - 94 = 2j - 4j. List the prime factors of 0 + j/(9/(-3))-5. 3, 5 List the prime factors of (-1 - 8) + 3 + 104/(-8) + 4842. 7, 13, 53 Let k(l) = -2l*2 - 7l + 175. Let y be k(16). Let a = -320 - y. List the prime factors of a. 3, 43 Let k(p) be the second derivative of 5p4/4 + 10p*3/3 + 2p*2 - 3p - 3. List the prime factors of k(-12). 2, 13, 37 Suppose 4i + 2d = 414 + 438, 0 = -2i + 3d + 434. Suppose 0 = -4k + 20, -5m + 280 = -5k. Let u = i - m. What are the prime factors of u? 3, 17 Let u(x) = 268x + 85 + 81 - 173. What are the prime factors of u(3)? 797 Let h(m) = m*2 - 35m - 71. Let u be h(-21). Let w = -629 + u. List the prime factors of w. 2, 7, 17 Let h(j) = 1413j2 + 22j + 5. List the prime factors of h(2). 5701 Suppose a = 84 - 50. Let s = -32 + a. Suppose -sz + 4k = -136, 3z = -z - k + 308. What are the prime factors of z? 2, 19 Let b(c) = c3 - 6c*2 - c - 83. Let h be b(0). Let f = 103 + h. List the prime factors of f. 2, 5 Suppose -272 - 1010 = -k. Suppose -2t + k = i, -2t - 1277 = -i - 3t. Suppose -3b - 375 = -i. List the prime factors of b. 13, 23 Suppose q - 6 = 4q + 5x, 3x = 4q - 21. Suppose -20 = 5y, -qy + 706 + 124 = 2f. List the prime factors of f. 421 Suppose 0 = -w + 2f + 12587, 4w - 53f - 50383 = -50f. What are the prime factors of w? 12601 Let l = 62 + -56. Suppose c - 196 = -5z, 0 = 2c + lz - z - 392. What are the prime factors of c? 2, 7 What are the prime factors of ((-592)/32 + -16)3334/(-3)? 23, 1667 Let t = -192 + 440. Let b be 10/(-4)(-6)/5. Suppose bq = 10 + t. What are the prime factors of q? 2, 43 Let f(v) = 185v + 5528. What are the prime factors of f(73)? 7, 2719 Let s = -87 + 105. Suppose -sq = -5766 - 3360. What are the prime factors of q? 3, 13 Let c = -16649 - -36911. List the prime factors of c. 2, 3, 11, 307 Let t(a) = -17a3 - 18a*2 - 18a - 44. What are the prime factors of t(-8)? 2, 1913 Let x be (-2)/3 + 8604/27. Suppose 5w - 4w = x. List the prime factors of w. 2, 3, 53 Let y(o) = -2o2 + 32o + 2. Let a be y(16). Suppose -2d + 718 = ag, -4 = -4d + 8. What are the prime factors of g? 2, 89 Suppose 0 = -3f - 5 - 22. Let o(k) = -k*3 - 10k*2 - 10k - 4. Let t be o(f). Suppose c - 4j = 127, -3c + tc = -j + 236. What are the prime factors of c? 7, 17 Let l be (-9324)/(-60) + (-6)/(-10). Suppose -f + l = 3q, -4f + 0f + 588 = 3q. What are the prime factors of f? 2, 3 Let t be 44/(-2)-4(-9)/12. List the prime factors of ((-24244)/t)/(4/6). 19, 29 Suppose 3w + 1375 = 4r, -426 + 92 = -r + 4w. List the prime factors of r. 2, 173 Suppose -5d + 15 = 8c - 11c, 4d + 5c + 25 = 0. Suppose -1636 = -4v - dv - 4u, -2v = -3u - 823. List the prime factors of v. 2, 5, 41 Suppose 6m + 2 = 26. Suppose -4d - 2l = -2790, md = -5l + l + 2796. List the prime factors of d. 2, 3, 29 Let n(p) = 3p*3 - 56p*2 + 41p - 15. List the prime factors of n(19). 3, 5 Suppose n = -0n + 4u + 33, -2n + 4u + 58 = 0. Suppose 4i = h - n, 5i - 8 + 33 = 0. Suppose ht - 200 = -3t. List the prime factors of t. 5 Suppose -74r = 5c - 75r - 97277, -4c + 77795 = 3r. What are the prime factors of c? 2, 71, 137 Let i(g) = -4g - 27. Let c be i(-14). Suppose -b + 5l = -5, 0b - 3l = 2b + c. Let m(o) = o*3 + 11o*2 + 2o - 18. List the prime factors of m(b). 2, 31 Let f(n) = -7n + 13 - 51n*2 + 2 + 69n*2 + 86n*2. What are the prime factors of f(3)? 2, 3, 5, 31 Let b(z) = -4z + 5. Let o be b(1). What are the prime factors of 54/((o - 36/(-15)) + -3)? 3, 5 Suppose -53w = -22991 - 629651. What are the prime factors of w? 2, 47, 131 Let i(r) = r3 - 16r*2 + 104r + 6. What are the prime factors of i(26)? 2, 5, 947 Let a(y) be the first derivative of -3y2 + 15y + 4y2 + 0y*2 + 28. What are the prime factors of a(9)? 3, 11 Suppose 0 = -3i + 4q + 24, 5q - 5 + 28 = 2i. Suppose 0 = 2r - 2p + 3p + i, -r = 5p + 11. What are the prime factors of (44/6 - r)/(6/18)? 5 Suppose 5h + 7 = -3s, -1 + 7 = 2h - s. Suppose c + h = 2c + 5y, 3y + 3 = 0. Suppose -u + cu = 340. List the prime factors of u. 2, 17 Let n be 420/75-1(-10)/4. Suppose -2l + n = 176. Let v = 125 + l. What are the prime factors of v? 2, 11 Suppose -84j - 60640 = -86j - g, 5g - 151590 = -5j. List the prime factors of j. 2, 15161 Let l be 2/(-10)0 - 45. Let q = l - -62. Suppose -q = -2b + 131. List the prime factors of b. 2, 37 Suppose 5y - 103 + 78 = 0. Suppose y = 5f - 25. What are the prime factors of -3 + f + 3 - (-6 + 3)? 3 Let s(i) = -16i*2 + 2i - 2. Let t be s(1). Let k be (-2 - 0) + (0 - t/(-2)). Let l = k + 47. List the prime factors of l. 37 Let u = 12415 + -6134. List the prime factors of u. 11, 571 Suppose 10f + 236 - 226 = 0. What are the prime factors of 4 + f + -3 - (3 - 663)? 2, 3, 5, 11 Let k(c) = 2c*2 + 33c - 17193. What are the prime factors of k(129)? 2, 3, 3391 Suppose -46946 - 171529 = -45x. List the prime factors of x. 5, 971 What are the prime factors of ((-19)/98816367)/((-2)/(-424)-1)? 53, 1259 Let z = 111785 + -77182. What are the prime factors of z? 34603 Let h = 48811 + -25588. List the prime factors of h. 3, 7741 Suppose -a + 4p = -13190, 5p - 39519 = 403a - 406a. What are the prime factors of a? 2, 11, 599 Suppose 0 = 12x - 89852 + 25124. List the prime factors of x. 2, 3, 29, 31 Let h(v) = -26v + 1083. List the prime factors of h(17). 641 Suppose 707 = 3p - 5g - 360, 4p - 5g - 1416 = 0. Let q = p - -662. What are the prime factors of q? 3, 337 Suppose 35t + 10878 = 38t + 3f, -2t + 7224 = -5f. List the prime factors of t. 2, 1811 Let t = -615 - 264. Let v = 1460 + t. What are the prime factors of v? 7, 83 Let d = 145 - 143. Suppose dr - 48 = q, -q + 4q = 5r - 141. What are the prime factors of (-7)/2312/q? 2, 13 Suppose -p = -4y, -5p - 4y = -5y + 19. What are the prime factors of -5 + p/((-927)/921 - -1)? 3, 7, 29 Let o = -30 - -33. Let p be 36 + (-5)/1 + 1 + o. Let x = p + 12. What are the prime factors of x? 47 List the prime factors of (24 - 3658/155)/(1/(6070/4)). 607 Let j = -32686 + 56591. List the prime factors of j. 5, 7, 683 Suppose 3u - 6 = -u + 2q, 5u + 12 = -4q. Suppose ux + 816 = -12x. Let b = x + 154. List the prime factors of b. 2, 43 Suppose 3i = -0i. Let u(c) = 23c - 76c + 12 + 24c + 28c. What are the prime factors of u(i)? 2, 3 Let n(d) = 229d2 + 37d - 574. List the prime factors of n(13). 2, 19, 127 Let a = 23 - 19. Let i be (-2)/(-3) - (30/(-9) + a). Suppose -246 = -4d + l, i = -4d - 2l + 4l + 248. List the prime factors of d. 61 List the prime factors of (86647/(-77)-7)/1. 7877 Suppose -2q = -v + 6, 5v - q - 1 + 16 = 0. Let h(a) = -16a - 4. Let j(b) = 17b + 4. Let z(w) = vh(w) - 3*j(w). List the prime factors of	{ "pile_set_name": "DM Mathematics" }
+ -7. Let j = z - -13. List the prime factors of j. 11 Let l(r) = r - 7. Let p be l(9). Let q(k) = -2 - 3k + 6k + 2k2 + 0k*2. List the prime factors of q(p). 2, 3 Suppose 2y - 5y + 7 = 2i, y + 3 = 0. Suppose m = 3m - i. What are the prime factors of 10/(42/m)? 5 Suppose -q + 18 = -0q. Let v = q - 12. Let y(u) = u3 - 6u*2 + 3u - 5. What are the prime factors of y(v)? 13 Let c(y) be the first derivative of -y*4/4 + 11y*3/3 - 4y*2 + 4y - 1. Let u(k) = -k + 1. Let b(q) = -c(q) - 3u(q). List the prime factors of b(10). 3 Suppose 71 + 9 = 5i. What are the prime factors of -1 - 1/((-2)/i)? 7 Suppose 4g - 451 = -3w, -5g = 3w + 229 - 795. List the prime factors of g. 5, 23 Let v(p) = -9p2 - 9 - p3 - p2 + 17 + 0p*3. List the prime factors of v(-10). 2 Let r(m) = 5m*2 + 12m - 12. What are the prime factors of r(6)? 2, 3, 5 Let c(x) = x3 + x2 + 17. Let r be c(0). Let m = r + 4. Suppose -m = -l + 2n, l - 4l + 3n = -57. List the prime factors of l. 17 Let h(r) = r + 11. Let l = -12 + 3. Let t be h(l). Suppose 2x - j - tj - 9 = 0, -4j + 30 = 2x. What are the prime factors of x? 3 Suppose -2j - 2 = -3j. Suppose j = -t - 1, -4l + 2t = -186. List the prime factors of l. 3, 5 What are the prime factors of (775/5)/(5 - 4)? 5, 31 Suppose 3j - 143 + 47 = 0. What are the prime factors of j? 2 Suppose 0h + 33 = a - 3h, -5a + 3h + 165 = 0. Let n = a - -15. List the prime factors of n. 2, 3 Let i = 7 + 11. Suppose im = 16m + 6. List the prime factors of m. 3 Let r = -6 + 14. Suppose 10 = 2c + 3c. Let d = r + c. List the prime factors of d. 2, 5 Suppose 6 = 2q + q. Let a = q - 0. Suppose au = 5 - 1. List the prime factors of u. 2 Let f(u) = u*2 + u - 4. Let s be f(3). Suppose 4p - s = -x, -3p - 5x - 16 = -5. List the prime factors of ((-2)/6)/(p/(-153)). 17 Let f(t) = -t*2 - 6t + 4. Let i be f(-6). Let l(m) = -m*3 + 4m*2 + 4. List the prime factors of l(i). 2 Let i be (-2(-3)/(-2))/(-1). Let p(q) be the second derivative of -q*4/12 + 4q*3/3 - 3q*2/2 - 2q. List the prime factors of p(i). 2, 3 Suppose 4v = -0v - 3y + 19, -5v + 5y + 15 = 0. List the prime factors of v/120 - -21. 3, 7 Let b(k) = k*2 - 3k - 8. Let y be b(6). Let d = -73 + 105. List the prime factors of ((-15)/y)/((-2)/d). 2, 3 Let q(v) = 6v3 + 2v - 2. List the prime factors of q(2). 2, 5 Suppose -2f + 3f - i - 26 = 0, -3f - i = -78. What are the prime factors of f? 2, 13 Let z = 16 + -11. Suppose n - 30 = u, 0 = 4n + n + zu - 100. Suppose 0 = -3j + 4v + 3 + n, -22 = -j - 5v. List the prime factors of j. 2, 3 Suppose 2w + o = 7, w - 6 = -0o + 2o. Let g be -5 + (w - (-2 - -3)). Let u = g - -14. List the prime factors of u. 2, 3 Let f(k) = -k3 - 7k*2 + 4k - 5. Suppose a - d = -5, -3a + 2a = 5d + 23. What are the prime factors of f(a)? 3 Let b = -4 + 6. Suppose 5 = bm + 1. What are the prime factors of 8 - (-1m - -1)? 3 Suppose -74 = 4r - 98. List the prime factors of r. 2, 3 Let j(u) = -u + 8. Let k be j(7). Let i(z) = 4z + 1. Let r be i(k). Suppose r + 4 = 3f. What are the prime factors of f? 3 Suppose 2o + w = -2w + 97, -5o + 4w = -185. Suppose -43 = -5u - g, 5u + 5g - 3g = o. Let z = 2 + u. What are the prime factors of z? 11 Let b be 8/(-6)(-6)/4. Suppose 2l + 3o = 28, -3l - 4o + 42 = -b. What are the prime factors of l? 2, 5 Suppose 5c - 167 = b, 4c + 3b - 180 = -54. What are the prime factors of c? 3, 11 Suppose -4h + 38 = -34. Suppose h + 3 = u. What are the prime factors of 2/(0 - (-6)/u)? 7 List the prime factors of (-14)/(-4)112/49. 2 Let i(f) be the first derivative of 29f3/3 - f2/2 - f + 7. List the prime factors of i(-1). 29 What are the prime factors of 32/18 - (-26)/117? 2 Let r = 218 - 105. List the prime factors of r. 113 Suppose -2q = -6, -2d + 195 - 60 = 3q. What are the prime factors of d? 3, 7 Let i = 8 - 6. Let w(a) = -a + 0a2 + 4a*i + 11 - 5a*2 + 0a*2. List the prime factors of w(0). 11 Let q = 154 + -109. List the prime factors of q. 3, 5 Suppose 2 = 4f - 22. Suppose -fy + 31 = -2y + 3m, y + m = 9. List the prime factors of y. 2 Let v = -2 - -7. Let d = -4 - -7. Let q = v - d. List the prime factors of q. 2 Let z(b) = -17b + 4. List the prime factors of z(-2). 2, 19 Suppose 4 = -3w + 25. Suppose 2 = 5x + w. What are the prime factors of 6x(-4)/3? 2 Let j(u) = -2u + 9. Let b be j(7). Let z = b - -25. Let p = z - 9. What are the prime factors of p? 11 Let v be (-39)/18 - (-4)/24. Let c be (-151)/v - (-1)/2. What are the prime factors of 1/(-2) - c/(-8)? 3 Let n be ((-9)/(-6))/((-3)/(-16)). Let k(o) = 3 + o - o3 - 8o2 - o3 + 3o3. List the prime factors of k(n). 11 Let o(j) = -5j + j + 10j + 13j2 + j3 - 16 + 4j. What are the prime factors of o(-12)? 2 Let u(p) = -p3 + 9p2 + 8. What are the prime factors of u(9)? 2 Let p(f) = f2 + 37. List the prime factors of p(0). 37 Let w(j) be the third derivative of j5/60 + j4/8 + 2j3/3 + 3j*2. What are the prime factors of w(-3)? 2 Suppose 0 = -2r + 5t + 241, 5r - 6t - 610 = -t. List the prime factors of r. 3, 41 Let i(z) = 4z*2 + 2z - 3. Let f(b) = -b*2. Let o(m) = 3f(m) + i(m). What are the prime factors of o(2)? 5 Let o = 24 - 18. Suppose 2n + 104 = on. What are the prime factors of n? 2, 13 Suppose 0 = -s - 4s + 130. Let i = s + -16. Let j = i - 2. What are the prime factors of j? 2 Let n(v) = v3 - v2 - v + 26. What are the prime factors of n(0)? 2, 13 Let h(w) = -3w*3 - 2w*2 - 2. Let i be h(-2). Let x be (-4)/i + (-422)/(-7). Suppose -x = -3y - y. What are the prime factors of y? 3, 5 List the prime factors of 7 - 3437/(-28) - (-2)/8. 2, 5, 13 Let f = -2 + 0. Let c = 6 - f. What are the prime factors of c? 2 Let c = 37 + -13. Let b(w) = w3 + w2 - w. Let u be b(0). Suppose -q - q + c = u. What are the prime factors of q? 2, 3 Suppose v - 5g = 4, 0 = 5v + g - 0 + 6. Let j(n) = 27n2 - n. Let r be j(v). Suppose 0 = 2o - 4c - r, 0o + 4c = -5o + 28. List the prime factors of o. 2 Let o(i) = -5i3 - 2i*2 - 4i - 3. List the prime factors of o(-2). 37 Suppose 52 = 2j + 2h, h + 61 = -j + 3j. Suppose 7 = 3x - j. List the prime factors of x. 2, 3 Let u = 11 - 8. Suppose -2h + h = 2o - 15, -uo + 3h + 45 = 0. What are the prime factors of o? 2, 5 Let f = 11 - 12. What are the prime factors of (f - 11)(-1 - 0)? 2, 3 Let g(d) = 6d*2 - 4d + 8. List the prime factors of g(3). 2, 5 Suppose 0 = -3q + 5q - 40. Suppose -q = -8o + 4o. Suppose 4l - 6 = -oi, l + 16 = 5i + 5. What are the prime factors of i? 2 Let j = -1 - -2. Let w(u) = 9u + 1. What are the prime factors of w(j)? 2, 5 Suppose -8 = -4b + 2b. Suppose 0 = -5w + 1 + b. Suppose j - 5 = -w. What are the prime factors of j? 2 Let w be 2/(-4) + 1/2. Suppose k + l = 14, 3k + wl - 37 = -2l. List the prime factors of k. 3 Let k be 3 - 2/(8/12). Suppose -33 + 8 = -5t, -4l + t + 15 = k. What are the prime factors of l? 5 Let u be (8/5)/((-12)/(-30)). Suppose 5q = 5x - 8 - 12, uq - 5x = -14. What are the prime factors of (q + (-4 - -1))-1? 3 Let n = -13 - -5. Let g(c) = c2 + 7c + 7. What are the prime factors of g(n)? 3, 5 Let t(a) = a*2 - 2a + 1. Let u be t(1). Let b = 11 - 5. Let c = b - u. What are the prime factors of c? 2, 3 Let z = -31 + 59. List the prime factors of z. 2, 7 Suppose 17 = 4c - 91. What are the prime factors of c? 3 Suppose -d + 12 = 3d, -d = 5q + 2. Let o be 0/(2 + q) - -2. Suppose -5 + o = -y. What are the prime factors of y? 3 Let u(x) = x2 - 4. Let j be u(-2). Let r(z) = -z3 - z2 - z + 3. What are the prime factors of r(j)? 3 Suppose 7 = 5a - 8. Suppose 10 = 2i - 4. Suppose 48 = -ag + ig. List the prime factors of g. 2, 3 Let b = 149 + -27. What are the prime factors of b? 2, 61 Let p(d) = 86d*2 - 2. What are the prime factors of p(1)? 2, 3, 7 Let c = -271 - -402. What are the prime factors of c? 131 Suppose -15 = 4g - 3, -5k + 546 = 3g. What are the prime factors of k? 3, 37 Let k be -5-1(7 - 1). Suppose -4m - f = -0f - k, 2m - f = 18. List the prime factors of m. 2 Let h = -7 + 10. Let x = 5 - 3. Suppose 35 = hs - 5o, 3s + 3o - 1 - x = 0. What are the prime factors of s? 5 Let t(z) = -4z +	{ "pile_set_name": "DM Mathematics" }
arest integer? 1265 What is the sixth root of 1162758151 to the nearest integer? 32 What is 1168815397 to the power of 1/2, to the nearest integer? 34188 What is 1670637607 to the power of 1/2, to the nearest integer? 40873 What is the fifth root of 1807110850 to the nearest integer? 71 What is the square root of 180927039 to the nearest integer? 13451 What is 89077744 to the power of 1/3, to the nearest integer? 447 What is the eighth root of 584229439 to the nearest integer? 12 What is the cube root of 1068395242 to the nearest integer? 1022 What is the third root of 169325867 to the nearest integer? 553 What is the fifth root of 707567799 to the nearest integer? 59 What is the square root of 35977665 to the nearest integer? 5998 What is the square root of 2122148886 to the nearest integer? 46067 What is the cube root of 91004573 to the nearest integer? 450 What is the eighth root of 90143558 to the nearest integer? 10 What is 9306028 to the power of 1/7, to the nearest integer? 10 What is 4695234203 to the power of 1/7, to the nearest integer? 24 What is 49976404 to the power of 1/2, to the nearest integer? 7069 What is the third root of 138315243 to the nearest integer? 517 What is the square root of 2829729 to the nearest integer? 1682 What is the third root of 110872880 to the nearest integer? 480 What is 121313053 to the power of 1/2, to the nearest integer? 11014 What is 935764250 to the power of 1/6, to the nearest integer? 31 What is the square root of 2265464112 to the nearest integer? 47597 What is the seventh root of 6550037449 to the nearest integer? 25 What is 5512308031 to the power of 1/6, to the nearest integer? 42 What is 403677816 to the power of 1/6, to the nearest integer? 27 What is 35560517 to the power of 1/3, to the nearest integer? 329 What is 90914298 to the power of 1/9, to the nearest integer? 8 What is the cube root of 116932202 to the nearest integer? 489 What is the third root of 1228711218 to the nearest integer? 1071 What is 680432326 to the power of 1/3, to the nearest integer? 880 What is the third root of 54950696 to the nearest integer? 380 What is 394748340 to the power of 1/3, to the nearest integer? 734 What is the cube root of 902995951 to the nearest integer? 967 What is 929907827 to the power of 1/2, to the nearest integer? 30494 What is the seventh root of 2835870208 to the nearest integer? 22 What is the sixth root of 1529609213 to the nearest integer? 34 What is the cube root of 364776282 to the nearest integer? 715 What is 266476549 to the power of 1/2, to the nearest integer? 16324 What is 2578553067 to the power of 1/9, to the nearest integer? 11 What is 6966772 to the power of 1/4, to the nearest integer? 51 What is the third root of 182000811 to the nearest integer? 567 What is the cube root of 356798850 to the nearest integer? 709 What is the tenth root of 742188050 to the nearest integer? 8 What is the third root of 66648289 to the nearest integer? 405 What is the square root of 1465514886 to the nearest integer? 38282 What is 690238208 to the power of 1/7, to the nearest integer? 18 What is 478101721 to the power of 1/2, to the nearest integer? 21866 What is the ninth root of 21828933 to the nearest integer? 7 What is the third root of 50906044 to the nearest integer? 371 What is the square root of 2892993372 to the nearest integer? 53787 What is the third root of 274505047 to the nearest integer? 650 What is the square root of 405279517 to the nearest integer? 20132 What is the square root of 1357307524 to the nearest integer? 36842 What is 54895188 to the power of 1/2, to the nearest integer? 7409 What is 207112681 to the power of 1/10, to the nearest integer? 7 What is the sixth root of 2178943023 to the nearest integer? 36 What is the third root of 242402252 to the nearest integer? 624 What is the seventh root of 5181180087 to the nearest integer? 24 What is 605404727 to the power of 1/5, to the nearest integer? 57 What is 90980541 to the power of 1/7, to the nearest integer? 14 What is 94032490 to the power of 1/7, to the nearest integer? 14 What is the cube root of 3045711055 to the nearest integer? 1450 What is the seventh root of 117675810 to the nearest integer? 14 What is 229747943 to the power of 1/3, to the nearest integer? 612 What is the third root of 36673092 to the nearest integer? 332 What is 264570623 to the power of 1/3, to the nearest integer? 642 What is the tenth root of 324168788 to the nearest integer? 7 What is the third root of 49824700 to the nearest integer? 368 What is 53973485 to the power of 1/2, to the nearest integer? 7347 What is 45143852 to the power of 1/2, to the nearest integer? 6719 What is the sixth root of 12453395 to the nearest integer? 15 What is the square root of 6101019 to the nearest integer? 2470 What is the third root of 41467107 to the nearest integer? 346 What is 51857327 to the power of 1/3, to the nearest integer? 373 What is 4553348581 to the power of 1/6, to the nearest integer? 41 What is 84639209 to the power of 1/4, to the nearest integer? 96 What is the third root of 128139735 to the nearest integer? 504 What is the square root of 99242360 to the nearest integer? 9962 What is 56029680 to the power of 1/9, to the nearest integer? 7 What is the cube root of 14394989 to the nearest integer? 243 What is 15227589 to the power of 1/2, to the nearest integer? 3902 What is the third root of 433854753 to the nearest integer? 757 What is the cube root of 2154491844 to the nearest integer? 1292 What is 54963544 to the power of 1/2, to the nearest integer? 7414 What is 246249465 to the power of 1/7, to the nearest integer? 16 What is the third root of 319609065 to the nearest integer? 684 What is the square root of 145899505 to the nearest integer? 12079 What is 6672921880 to the power of 1/3, to the nearest integer? 1883 What is the square root of 121298674 to the nearest integer? 11014 What is the third root of 47686522 to the nearest integer? 363 What is 52100608 to the power of 1/2, to the nearest integer? 7218 What is the square root of 458581695 to the nearest integer? 21415 What is 11791177 to the power of 1/2, to the nearest integer? 3434 What is 630201591 to the power of 1/3, to the nearest integer? 857 What is 5835448 to the power of 1/5, to the nearest integer? 23 What is 1076826564 to the power of 1/9, to the nearest integer? 10 What is 1188748418 to the power of 1/3, to the nearest integer? 1059 What is the fourth root of 47673009 to the nearest integer? 83 What is 4504213308 to the power of 1/4, to the nearest integer? 259 What is the eighth root of 3044952080 to the nearest integer? 15 What is 80097756 to the power of 1/8, to the nearest integer? 10 What is the sixth root of 36506707 to the nearest integer? 18 What is 4692519791 to the power of 1/3, to the nearest integer? 1674 What is the fourth root of 51925483 to the nearest integer? 85 What is 122918297 to the power of 1/7, to the nearest integer? 14 What is 364084730 to the power of 1/2, to the nearest integer? 19081 What is 246536304 to the power of 1/2, to the nearest integer? 15701 What is the tenth root of 119962300 to the nearest integer? 6 What is the seventh root of 73834576 to the nearest integer? 13 What is the square root of 1190544727 to the nearest integer? 34504 What is the cube root of 4211709589 to the nearest integer? 1615 What is 18227014 to the power of 1/6, to the nearest integer? 16 What is 24096613 to the power of 1/2, to the nearest integer? 4909 What is the third root of 536165926 to the nearest integer? 812 What is 145493927 to the power of 1/3, to the nearest integer? 526 What is 298596576 to the power of 1/3, to the nearest integer? 668 What is the sixth root of 31568658 to the nearest integer? 18 What is the fifth root of 12202613 to the nearest integer? 26 What is the square root of 188362941 to the nearest integer? 13725 What is the square root of 78554440 to the nearest integer? 8863 What is the cube root of 1156230444 to the nearest integer? 1050 What is the square root of 207069155 to the nearest integer? 14390 What is 356171634 to the power of 1/7, to the nearest integer? 17 What is the square root of 143860507 to the nearest integer?	{ "pile_set_name": "DM Mathematics" }
st value in -0.5, -2/13, 174? 174 What is the biggest value in 4, 0.3, -80/9? 4 Which is the smallest value? (a) 1/2 (b) -4 (c) -0.66 (d) 0.037 b What is the smallest value in 0.5, 1.3, -1/9? -1/9 Which is the fourth smallest value? (a) 0.02 (b) 0.07 (c) -1 (d) -3/2 b Which is the biggest value? (a) 0.4 (b) -3/4 (c) -2/63 a Which is the second biggest value? (a) 4/9 (b) 3682 (c) 1 c What is the second biggest value in -0.1, 0.01, 7/2? 0.01 What is the smallest value in 2/11, -78, 0, 3? -78 What is the second biggest value in 58, -3, -0.1, -0.4? -0.1 What is the fifth biggest value in 4, 9, 0.3, 2/3, -3? -3 Which is the fourth smallest value? (a) 9 (b) -5 (c) 2/7 (d) 2 (e) -7/9 d Which is the fourth biggest value? (a) -5 (b) -1 (c) 2 (d) -18 d Which is the third biggest value? (a) 69 (b) 0.5 (c) -3 c What is the smallest value in 20, 86, 0.4? 0.4 Which is the biggest value? (a) -1 (b) 0 (c) 1/5 (d) 2/7 d Which is the fourth smallest value? (a) 17 (b) -0.4 (c) -6/5 (d) -0.03 a Which is the second smallest value? (a) 16/17 (b) 4/5 (c) -2/13 (d) 4 b What is the second smallest value in 3, 1.2, 2, -1/3? 1.2 What is the smallest value in 8.4, -12, -2/13? -12 Which is the third biggest value? (a) -0.2 (b) 0 (c) 0.009 (d) 0.5 (e) 3 c What is the third biggest value in -5, 2, 8, 4/13? 4/13 What is the third smallest value in -8.86, -2, -5? -2 Which is the fourth biggest value? (a) 3/5 (b) 4/5 (c) 3 (d) -10 (e) -5 e Which is the biggest value? (a) -3 (b) 0.3 (c) -2/7 b Which is the second biggest value? (a) -19/4 (b) -10 (c) -1/4 a What is the smallest value in -5, -2, -4? -5 Which is the fourth smallest value? (a) -9 (b) -3 (c) -1 (d) -2 c What is the second biggest value in -2, 0.5, 4? 0.5 What is the third biggest value in 0.1, 566, -0.1, 2/13, 1/6? 2/13 Which is the third smallest value? (a) -1 (b) -2/3 (c) 2468 c Which is the third biggest value? (a) 4195 (b) 0 (c) 3 b What is the second biggest value in -1/3, -0.5, -1? -0.5 What is the third biggest value in -0.12, 2.8, -4/3, 2? -0.12 Which is the second smallest value? (a) 0.4 (b) 0.2 (c) -8 (d) 38 b What is the smallest value in 4, 0.2, 2/5, -8/3? -8/3 What is the fourth smallest value in -3/2, 1, -1/5, 3/5? 1 What is the second smallest value in -1/5, 1/7, 0, 105, -1? -1/5 Which is the fourth biggest value? (a) 0.2 (b) -0.5 (c) -13 (d) 4 c What is the smallest value in -0.02, 3/2, 0.1, -1/5? -1/5 Which is the fifth smallest value? (a) -4 (b) 0.5 (c) 2/5 (d) -1 (e) 1.13 e What is the second biggest value in -8/5, 6, -0.1, 5? 5 Which is the fourth smallest value? (a) 2/19 (b) -3/7 (c) -1/10 (d) 33 d What is the smallest value in 1.5, 5, -9/2? -9/2 What is the smallest value in 4.12, 3, -0.4? -0.4 What is the smallest value in -0.3, 0.398, 2? -0.3 Which is the second biggest value? (a) -2/97 (b) -3 (c) 3 a Which is the third smallest value? (a) -2 (b) -75/11 (c) -2/5 c What is the biggest value in -18.6, 1, 4? 4 What is the fourth biggest value in -5/11, -1.4, -0.7, -1? -1.4 What is the third smallest value in -3, 0.3, 6? 6 What is the biggest value in 0.04, 232, -0.4? 232 What is the second smallest value in -0.24, 5, -0.5, 6/7? -0.24 What is the biggest value in -0.7, -11.5, -1? -0.7 Which is the second biggest value? (a) -0.5 (b) -3 (c) 4/99 a Which is the fourth biggest value? (a) -3 (b) 0 (c) 2 (d) -2 a Which is the smallest value? (a) -0.5 (b) -5 (c) -2 (d) 2/21 b Which is the second biggest value? (a) 1 (b) 9 (c) 38/5 c What is the smallest value in 1, 0.83, -5? -5 Which is the biggest value? (a) -3 (b) 2 (c) 0.29 b What is the fifth biggest value in 10, 5, -2/7, -7, 1/4? -7 What is the smallest value in 17, -2/11, -0.3, -4? -4 What is the biggest value in 44.3, -0.5, 3/4, 4? 44.3 Which is the third smallest value? (a) 3 (b) 4/5 (c) -40 (d) 1 (e) 2/5 b What is the fourth smallest value in 3, -0.2, -5, 2/5, 5? 3 Which is the third biggest value? (a) 3 (b) -0.1 (c) -1/2 (d) 3/2 b What is the fourth smallest value in -0.026, 0.4, -0.1, 1/8? 0.4 Which is the smallest value? (a) -5 (b) 3 (c) 0 (d) -6 (e) -2/17 d What is the second smallest value in -0.1, 24, -1, 2/11? -0.1 What is the smallest value in 1/29, -26, 5? -26 What is the second smallest value in 3/5, 2/3, 1/4, 81? 3/5 What is the second smallest value in 5, -2/7, 4, -3/22, -3? -2/7 Which is the third biggest value? (a) -0.5 (b) 0.4 (c) -160.2 c What is the third biggest value in 25, -0.4, -9? -9 What is the second smallest value in 1/6, 4, 2/3? 2/3 What is the third biggest value in 2, 13, 3? 2 What is the second biggest value in -7, 0.162, 3? 0.162 What is the third biggest value in 21, 39, -0.4? -0.4 Which is the fourth biggest value? (a) -0.05 (b) -3 (c) 2/11 (d) -12 d What is the second biggest value in -4/3, 0.5, 324? 0.5 Which is the biggest value? (a) -21 (b) -4/15 (c) -2/3 b Which is the fourth biggest value? (a) -146 (b) -1/7 (c) 3/7 (d) 0 a Which is the third biggest value? (a) -1 (b) -2.7 (c) 5 b What is the biggest value in 17, 3, -0.2, -0.3, -6.8? 17 What is the smallest value in 0, 3, -462? -462 Which is the fourth smallest value? (a) -2/9 (b) -1 (c) 3/2 (d) -0.2 c What is the fourth smallest value in -0.3, 2, 4, 0.4? 4 What is the second biggest value in 0.02, -15.6, -3? -3 Which is the second smallest value? (a) 4 (b) -12 (c) -0.7 (d) -5 (e) 0 d Which is the second biggest value? (a) 0 (b) -1/2 (c) -3 (d) -12 b What is the second biggest value in 0.249, 0, -4, 3? 0.249 What is the third biggest value in -2, -2/45, 0, 1? -2/45 What is the third biggest value in -3/8, -3, -10, -1/6? -3 What is the second smallest value in 1/5, -6, -0.42? -0.42 Which is the third smallest value? (a) -0.03 (b) -15 (c) -0.2 a Which is the third smallest value? (a) 1/2 (b) 1 (c) 1.3 c Which is the second smallest value? (a) 0.3 (b) 0.5 (c) 3/4 (d) -170 (e) 2 a Which is the third smallest value? (a) -0.2 (b) -2/5329 (c) 0 c Which is the third biggest value? (a) -1/2 (b) 0.15 (c) 0.1 (d) -3 a What is the fourth smallest value in -4, 0.2, -0.5, -16? 0.2 What is the second biggest value in -0.3, -8, -10, 5, 1/6? 1/6 What is the second smallest value in -1/8, 2/21, 1? 2/21 What is the second biggest value in -4, -0.1, 0.07, 26? 0.07 Which is the third biggest value? (a) 0.52 (b) 0.4 (c) -1 (d) -3 c What is the third smallest value in -3, 4/13, -2/3, 4? 4/13 What is the second biggest value in -0.04, 0, -0.02? -0.02 Which is the biggest value? (a) -0.74 (b) 0.1 (c) 2 (d) -2 c Which is the second smallest value? (a) 2 (b) 6/11 (c) 1/2 b What is the second smallest value in -5, 1, 0? 0 Which is the third biggest value? (a) -1/6 (b) 0.3 (c) 5 (d) 12/5 b What is the third smallest value in 3/4, -2/7, 3, -0.4, -2/3? -2/7 Which is the fourth biggest value? (a) 5/19 (b) 5 (c) -1/3 (d) 5/4 c What is the fourth biggest value in 2, -2/5, 19, -0.1? -2/5 Which is the second smallest value? (a) 4 (b) 0 (c) 5 (d) 2 d Which is the biggest value? (a) 4 (b) -1 (c) 57 c Which is the third biggest value? (a) -0.4 (b) 3 (c) -2 (d) 1 a What is the fourth biggest value in 4, -8, 4/13, 0? -8 What is the fourth biggest value in -2/13, -0.4, -22, 2/3? -22 What is the third smallest value in -0.2, -2, -3/89, 0.4? -3/89 Which is the biggest value? (a) -0.1 (b) -3/8 (c) 1/2 (d) -8 c What is the second smallest value in 3, -3, 2/3, 0? 0 Which is the second biggest value? (a) -2/7 (b) 26 (c) 0 c Which is the smallest value? (a) 0.23 (b) 1/4 (c) -2/7 c Which is the third smallest value? (a) 0.5 (b) 4 (c) -18 b Which is the biggest value? (a) 0.6 (b) -0.03 (c) -38 (d) 0.4 (e) 0.2 a Which is the second biggest value? (a) -0.0388 (b) 3/7 (c) -9 a Which is the third smallest value? (a) -3 (b) 1.93 (c) 0.3 b Which is the biggest value? (a) 2/5 (b) -0.3 (c) 2 (d) -4/81 c Which is the second biggest value? (a) -4 (b) -2/3 (c) -2/9 (d) -0.4 d What is the second biggest value in -12, -2/43, 7? -2/43 What is the fourth biggest value in 5, -1.8, -5, 0.2? -5 What is the biggest value in -2/103, 0, 1, -2/7? 1 What is the fourth biggest value in -0.7, 0.05, 0, -3	{ "pile_set_name": "DM Mathematics" }
ment from {w: 3, n: 6, y: 2, k: 1}. 9/55 Calculate prob of picking 2 f when two letters picked without replacement from sssfsffusmps. 1/22 Three letters picked without replacement from rrrrdkqkrrqrcr. Give prob of picking 1 c, 1 q, and 1 k. 1/91 Four letters picked without replacement from {z: 2, c: 1, d: 1, n: 2}. What is prob of picking 1 c, 1 d, and 2 z? 1/15 What is prob of picking 4 h when four letters picked without replacement from nhssnsssnshv? 0 Three letters picked without replacement from {h: 3, z: 1, c: 3, x: 2, k: 2, y: 1}. What is prob of picking 1 h, 1 z, and 1 c? 9/220 What is prob of picking 2 w and 2 t when four letters picked without replacement from wtsw? 0 What is prob of picking 1 n, 1 a, and 1 l when three letters picked without replacement from {a: 1, d: 1, n: 2, f: 1, l: 2}? 4/35 Two letters picked without replacement from {d: 3, j: 3, p: 1, g: 1, x: 1, l: 2}. Give prob of picking 1 l and 1 d. 6/55 Three letters picked without replacement from {r: 8, h: 5, f: 5, b: 1}. Give prob of picking 2 r and 1 h. 140/969 Three letters picked without replacement from {w: 3, r: 4, k: 1, o: 10}. Give prob of picking 2 o and 1 r. 15/68 Calculate prob of picking 2 x when two letters picked without replacement from {o: 8, q: 4, c: 2, f: 3, x: 2}. 1/171 What is prob of picking 2 d, 1 x, and 1 p when four letters picked without replacement from {x: 3, d: 3, p: 4, a: 3}? 36/715 Three letters picked without replacement from {m: 11, b: 5, x: 2, p: 2}. What is prob of picking 1 x, 1 m, and 1 p? 11/285 Calculate prob of picking 2 u and 1 y when three letters picked without replacement from yumyuymuymuymu. 25/182 What is prob of picking 3 x and 1 p when four letters picked without replacement from {z: 3, p: 2, x: 5}? 2/21 Two letters picked without replacement from {t: 1, x: 2, h: 3, b: 3, o: 2, m: 3}. What is prob of picking 1 m and 1 b? 9/91 What is prob of picking 2 r when two letters picked without replacement from {r: 6, w: 3, a: 1, u: 1, g: 3}? 15/91 What is prob of picking 1 u and 2 a when three letters picked without replacement from {v: 6, e: 3, a: 2, o: 1, u: 2, y: 1}? 2/455 Three letters picked without replacement from mtmtmmmmmmmttttmmm. What is prob of picking 3 t? 5/204 What is prob of picking 1 t and 1 q when two letters picked without replacement from {g: 1, d: 1, q: 1, v: 1, t: 3}? 1/7 Four letters picked without replacement from osssoooooossoosooo. What is prob of picking 4 o? 11/68 What is prob of picking 2 i and 2 l when four letters picked without replacement from iibwbblblbwibbl? 3/455 What is prob of picking 1 r and 1 q when two letters picked without replacement from rqrrqqrrrrrrrrrrqrrr? 32/95 Calculate prob of picking 2 z when two letters picked without replacement from lzlzzzzzlzzlzzzzzz. 91/153 Two letters picked without replacement from swswwswkwwwwws. What is prob of picking 2 w? 36/91 What is prob of picking 2 u and 1 p when three letters picked without replacement from pppuuppuppuppp? 15/91 Two letters picked without replacement from xrzbzxbzqb. What is prob of picking 1 x and 1 z? 2/15 Four letters picked without replacement from gumnzmmngmmugumu. What is prob of picking 1 n and 3 g? 1/910 What is prob of picking 1 h and 2 a when three letters picked without replacement from iasismaaihiimssia? 3/340 Calculate prob of picking 2 p and 2 g when four letters picked without replacement from ppgppggpggppg. 63/143 Two letters picked without replacement from {b: 8, s: 3}. Give prob of picking 2 b. 28/55 Calculate prob of picking 2 x and 1 q when three letters picked without replacement from xwnqdwxgwqqwqqqqwwww. 7/1140 Calculate prob of picking 1 t and 1 b when two letters picked without replacement from twobo. 1/10 Calculate prob of picking 1 v and 1 m when two letters picked without replacement from mmcvvmmcpmvvpvccncc. 25/171 Four letters picked without replacement from {k: 5, a: 5, n: 1}. What is prob of picking 3 a and 1 k? 5/33 Four letters picked without replacement from {t: 1, v: 2, l: 7}. What is prob of picking 1 t and 3 l? 1/6 What is prob of picking 2 f when two letters picked without replacement from jffjfjffffjjfffjffj? 22/57 What is prob of picking 2 l when two letters picked without replacement from tbllpelptbbb? 1/22 Two letters picked without replacement from {j: 1, g: 5, i: 1, e: 3}. Give prob of picking 2 e. 1/15 Three letters picked without replacement from nnnn. Give prob of picking 3 n. 1 Calculate prob of picking 2 u when two letters picked without replacement from ozoouuoszlsoou. 3/91 What is prob of picking 1 d and 3 l when four letters picked without replacement from {d: 6, l: 12}? 22/51 What is prob of picking 4 x when four letters picked without replacement from {i: 6, w: 2, x: 1, v: 3}? 0 Calculate prob of picking 3 n and 1 v when four letters picked without replacement from {n: 19, v: 1}. 1/5 Two letters picked without replacement from ahhabaa. What is prob of picking 1 a and 1 b? 4/21 Two letters picked without replacement from {t: 8, e: 2, z: 5, l: 1}. Give prob of picking 1 t and 1 z. 1/3 What is prob of picking 1 t and 3 c when four letters picked without replacement from {t: 4, c: 15}? 455/969 Two letters picked without replacement from {o: 2, r: 1, k: 4, y: 4, u: 1, p: 6}. Give prob of picking 1 y and 1 r. 4/153 Two letters picked without replacement from {j: 1, i: 2, y: 2, a: 1, x: 1, o: 1}. What is prob of picking 1 o and 1 j? 1/28 Calculate prob of picking 1 v and 1 s when two letters picked without replacement from {v: 4, l: 11, s: 4}. 16/171 Four letters picked without replacement from trssssasstgtsg. What is prob of picking 1 t, 1 r, and 2 s? 9/143 Two letters picked without replacement from {h: 2, j: 2, l: 3, z: 8, c: 4}. What is prob of picking 2 l? 1/57 What is prob of picking 1 s, 1 x, and 1 j when three letters picked without replacement from jxxxojjjjxsxxjjjjjtx? 7/114 Calculate prob of picking 1 q, 2 t, and 1 b when four letters picked without replacement from {z: 2, m: 1, n: 1, b: 2, t: 2, q: 4}. 8/495 Calculate prob of picking 3 v when three letters picked without replacement from vvwvwwwvvvvvvv. 30/91 What is prob of picking 1 b and 1 f when two letters picked without replacement from {m: 9, b: 5, t: 2, f: 3}? 5/57 Four letters picked without replacement from {f: 9, k: 3, y: 6, l: 1}. What is prob of picking 1 k and 3 y? 5/323 Calculate prob of picking 2 p and 1 x when three letters picked without replacement from rxjnpjrpdjnd. 1/220 What is prob of picking 1 r and 1 i when two letters picked without replacement from iabiaiir? 1/7 Two letters picked without replacement from dnaxxxkxwxxxakxdwxwd. What is prob of picking 1 x and 1 w? 27/190 Calculate prob of picking 2 w, 1 q, and 1 b when four letters picked without replacement from teqewzbtwbeb. 1/165 What is prob of picking 2 k when two letters picked without replacement from kkkk? 1 Calculate prob of picking 1 c and 2 r when three letters picked without replacement from {z: 3, g: 1, c: 1, r: 2}. 1/35 Calculate prob of picking 1 c and 3 v when four letters picked without replacement from {n: 5, c: 3, v: 4}. 4/165 Two letters picked without replacement from {t: 5, v: 1, o: 6, z: 7}. What is prob of picking 2 o? 5/57 Four letters picked without replacement from {r: 1, w: 1, c: 2, g: 1, p: 1, n: 1}. What is prob of picking 1 w, 1 n, 1 p, and 1 c? 2/35 Two letters picked without replacement from gmmg. What is prob of picking 1 g and 1 m? 2/3 Four letters picked without replacement from vqqqwvvqvvvvvwqvq. What is prob of picking 3 v and 1 w? 6/85 Calculate prob of picking 1 t, 2 o, and 1 w when four letters picked without replacement from {r: 1, o: 3, w: 10, t: 1}. 2/91 Calculate prob of picking 1 a and 2 w when three letters picked without replacement from {q: 1, w: 2, a: 1, m: 2, b: 1, x: 1}. 1/56 Calculate prob of picking 1 w and 1 e when two letters picked without replacement from {w: 2, j: 11, e: 2}. 4/105 Calculate prob of picking 2 a when two letters picked without replacement from {r: 1, s: 4, u: 6, a: 3, q: 3, j: 1}. 1/51 Two letters picked without replacement from kkkkkkkjkkkkjkkkkkkk. Give prob of picking 2 j. 1/190 Three letters picked without replacement from {f: 4, n: 2, a: 4}. What is prob of picking 1	{ "pile_set_name": "DM Mathematics" }
west common multiple of 336 and 1188. 33264 What is the common denominator of 139/216 and -13/48? 432 Calculate the lowest common multiple of 40 and 392. 1960 Calculate the common denominator of -1/5 and 8/9. 45 What is the common denominator of -95/10956 and 7/3? 10956 What is the common denominator of -47/1976 and -89/56? 13832 What is the smallest common multiple of 165 and 15? 165 What is the common denominator of 75/572 and 47/22? 572 What is the smallest common multiple of 26 and 52? 52 Calculate the smallest common multiple of 64 and 32. 64 Find the common denominator of -49/1207 and -1/497. 8449 What is the least common multiple of 1 and 1598? 1598 Calculate the lowest common multiple of 3140 and 40. 6280 Calculate the least common multiple of 4425 and 590. 8850 Calculate the common denominator of -33/1633 and -125/138. 9798 What is the smallest common multiple of 10 and 4462? 22310 Calculate the lowest common multiple of 33 and 99. 99 Find the common denominator of 133/666 and 133/444. 1332 Calculate the common denominator of 1/70 and -93/110. 770 Calculate the common denominator of 139/54 and -61/1044. 3132 What is the common denominator of -31/349 and 26/7? 2443 Find the common denominator of 71/90 and 1/300. 900 Calculate the lowest common multiple of 790 and 5530. 5530 What is the lowest common multiple of 770 and 10010? 10010 What is the common denominator of -71/20 and 37/20? 20 What is the smallest common multiple of 3798 and 33? 41778 Calculate the common denominator of -37/2583 and -37/273. 33579 What is the common denominator of -101/12 and 119/580? 1740 Calculate the lowest common multiple of 16 and 2764. 11056 Calculate the common denominator of -75/8 and 19/2554. 10216 What is the common denominator of 67/21 and 23/1452? 10164 Calculate the smallest common multiple of 6 and 60. 60 What is the common denominator of -61/6378 and -57/14? 44646 What is the lowest common multiple of 1 and 26774? 26774 What is the least common multiple of 28 and 8? 56 Find the common denominator of 29/280 and 73/45. 2520 What is the lowest common multiple of 2298 and 24? 9192 Find the common denominator of -79/64 and 149/48. 192 Calculate the common denominator of -15/286 and -145/624. 6864 What is the lowest common multiple of 1544 and 24? 4632 What is the least common multiple of 3852 and 1605? 19260 Find the common denominator of -121/40 and -37/88. 440 What is the lowest common multiple of 1026 and 380? 10260 Calculate the common denominator of 19/8 and 31/14798. 59192 Find the common denominator of -51/1280 and -37/5120. 5120 Calculate the lowest common multiple of 24 and 1671. 13368 Find the common denominator of 65/88 and 37/8998. 35992 Calculate the lowest common multiple of 166 and 18. 1494 Calculate the least common multiple of 4 and 160. 160 What is the least common multiple of 24790 and 4? 49580 Calculate the lowest common multiple of 4155 and 25. 20775 Calculate the smallest common multiple of 82 and 902. 902 What is the common denominator of -125/24 and 53/204? 408 What is the smallest common multiple of 1305 and 125? 32625 What is the common denominator of 73/6 and -70/249? 498 What is the least common multiple of 3 and 6021? 6021 Find the common denominator of 75/76 and -25/1653. 6612 Calculate the lowest common multiple of 300 and 1350. 2700 What is the common denominator of -7/66 and -97/66? 66 What is the lowest common multiple of 960 and 64? 960 Calculate the lowest common multiple of 648 and 360. 3240 Find the common denominator of 25/7 and -87/302. 2114 Calculate the lowest common multiple of 10 and 25. 50 Calculate the common denominator of -79/544 and 9/11. 5984 Calculate the smallest common multiple of 79 and 632. 632 Calculate the smallest common multiple of 18 and 2340. 2340 Calculate the common denominator of -94/2715 and 119/30. 5430 Find the common denominator of 1/103 and 57/7. 721 Calculate the smallest common multiple of 2234 and 11. 24574 What is the common denominator of 127/120 and -93/188? 5640 Calculate the lowest common multiple of 109 and 8. 872 What is the common denominator of 41/9 and -107/72? 72 Calculate the common denominator of 93/578 and -61/170. 2890 Calculate the common denominator of 91/30 and -35/426. 2130 Calculate the common denominator of -109/30 and 65/16. 240 Calculate the lowest common multiple of 6 and 85. 510 Calculate the common denominator of 5/64 and 31/24. 192 What is the common denominator of 44/1127 and 59/7? 1127 Find the common denominator of -59/10 and 45/5426. 27130 What is the least common multiple of 14 and 6916? 6916 Calculate the lowest common multiple of 360 and 33. 3960 Calculate the lowest common multiple of 16 and 706. 5648 What is the least common multiple of 447 and 12? 1788 Calculate the common denominator of 32/1189 and -1/410. 11890 Calculate the least common multiple of 30 and 1160. 3480 Calculate the smallest common multiple of 62 and 2. 62 What is the smallest common multiple of 64 and 144? 576 Calculate the least common multiple of 88 and 11. 88 Calculate the smallest common multiple of 150 and 810. 4050 Calculate the least common multiple of 67 and 9. 603 Calculate the least common multiple of 35 and 905. 6335 Find the common denominator of 59/285 and -77/24. 2280 Calculate the least common multiple of 11 and 3. 33 What is the lowest common multiple of 826 and 472? 3304 What is the common denominator of -53/65 and -94/195? 195 What is the least common multiple of 26 and 6? 78 Calculate the common denominator of 61/39 and 143/522. 6786 Find the common denominator of -13/2 and -95/5214. 5214 What is the least common multiple of 15998 and 3? 47994 Find the common denominator of 115/1364 and 69/3472. 38192 What is the least common multiple of 822 and 1096? 3288 Calculate the lowest common multiple of 70 and 210. 210 Calculate the lowest common multiple of 608 and 24. 1824 Calculate the common denominator of 1/10 and -69/1570. 1570 What is the common denominator of -7/2 and -41/213? 426 Calculate the common denominator of -83/126 and -67/756. 756 Find the common denominator of 39/25 and 32/605. 3025 Calculate the smallest common multiple of 22 and 229. 5038 What is the lowest common multiple of 15 and 81? 405 Find the common denominator of -16/215 and -33/344. 1720 Find the common denominator of 17/623 and -35/3382. 23674 Calculate the common denominator of -43/21 and 103/30. 210 What is the common denominator of 93/10 and -53/24864? 124320 What is the common denominator of 11/195 and 161/30? 390 Find the common denominator of 13/213 and 8/399. 28329 What is the common denominator of -73/1632 and -23/136? 1632 What is the common denominator of -87/50 and 11/5? 50 Find the common denominator of 65/42 and -125/168. 168 Calculate the lowest common multiple of 85 and 105. 1785 Calculate the common denominator of 29/510 and -13/1190. 3570 What is the common denominator of 25/222 and 61/22? 2442 What is the lowest common multiple of 534 and 2492? 7476 Calculate the common denominator of 21/1156 and 83/680. 11560 Calculate the common denominator of -45/64 and 143/96. 192 What is the smallest common multiple of 18 and 722? 6498 Calculate the lowest common multiple of 2872 and 1795. 14360 Find the common denominator of -179/930 and -51/1240. 3720 What is the common denominator of -83/40 and 97/8? 40 Find the common denominator of -40/61 and 59/5. 305 What is the common denominator of 25/567 and -65/441? 3969 Calculate the common denominator of 133/282 and -57/5. 1410 Calculate the smallest common multiple of 1105 and 845. 14365 Find the common denominator of -127/2088 and -18/319. 22968 What is the lowest common multiple of 60 and 348? 1740 Calculate the common denominator of -43/35 and -52/15. 105 What is the least common multiple of 12 and 19? 228 Calculate the least common multiple of 7542 and 14. 52794 Find the common denominator of -38/15 and -143/144. 720 Calculate the common denominator of -95/112 and -109/392. 784 Find the common denominator of -43/8 and 26/79. 632 What is the lowest common multiple of 810 and 2025? 4050 Calculate the least common multiple of 4170 and 3475. 20850 Find the common denominator of 69/440 and 101/28. 3080 Calculate the smallest co	{ "pile_set_name": "DM Mathematics" }
4v, 3g - 20 = -v. Let f(d) = -3d + 1. Let u be f(-1). Suppose 27 = gz - 2z + 5l, -4l = -uz + 36. Does 4 divide z? True Let w(m) = -42m + 1. Let k be w(-2). Let s be 38 + (-16)/(-3). Suppose -5g = -s - k. Does 14 divide g? False Let v be 22/(-4) + 2/4. Let z = -7 - v. Let r = 4 - z. Is 2 a factor of r? True Does 9 divide ((-27)/(-6))/((-2)/(-20))? True Suppose -1 - 9 = 5m. Is (-9 - 3)/(m/3) a multiple of 9? True Suppose 16 = u - 48. Does 32 divide u? True Let b = -3 + 5. Let k be b/6 - 60/(-9). Suppose 0v - v = -k. Is v a multiple of 7? True Suppose 455 - 131 = 3h + 3p, -6 = -2p. Is h a multiple of 35? True Suppose 0 = -6s - 4s + 240. Does 13 divide s? False Suppose g - 4g + 30 = 0. Does 10 divide g? True Let g(u) = -12u. Let l be g(2). Let h = l + 40. Does 8 divide h? True Let p(q) = q + 1. Let c be p(-1). Suppose -2n + 3b + 32 = -b, -5n + 4b + 110 = c. Is n a multiple of 13? True Suppose 0p + 583 = 4p + o, 2p - 296 = -2o. Suppose j = 4m + 19, 6j = j - 5m + p. Is j a multiple of 9? True Suppose 10o - 1540 = -0o. Does 22 divide o? True Let r(g) = -g3 + 3g*2 + 6g - 6. Let t be r(4). Let n be (-2)/t + 43 - 1. Suppose -4h + n = -2u - 77, 74 = 2h + 2u. Is 16 a factor of h? True Let o(y) = 8y3 + y2 + 4y - 1. Let t(a) = -17a3 - 2a*2 - 9a + 2. Let p(j) = -13o(j) - 6t(j). Is 4 a factor of p(-2)? False Let u(z) = -2z2 - 3z + 2. Let i be u(-4). Let w be (-6)/(-27) + (-1238)/i. Suppose 23 + w = 4n. Is 22 a factor of n? False Let y(f) = -f3 - 3f*2 + 3f - 2. Let t be y(-4). Suppose -6r + 25 = -r. Suppose -i + ru - 4 = -4i, ti = -4u + 2. Does 2 divide i? False Suppose -2i = 2g + 2g - 86, 0 = 3g - 3i - 60. Does 11 divide g? False Let o(z) = -z*3 - 3z*2 + 2z - 1. Let j(g) be the third derivative of -g*4/24 - 11g3/6 + g2. Let s be j(-7). Is 3 a factor of o(s)? False Suppose -37 = -3w + 56. Suppose 141 - w = 2q. Let s = -30 + q. Is s a multiple of 14? False Suppose -3u + 16 = u. Suppose h + 4q = -3h + 4, 4h = uq + 36. Suppose -45 = -hv + 15. Is v a multiple of 12? True Let y(k) = -6k3 + k2. Is 3 a factor of y(-1)? False Suppose -2q + q - 6 = 0. Let s = 24 + -19. Is 12 a factor of 43 + q/(2 - s)? False Let i be (0 + 1 - 1)/2. Suppose 3a + 12 = -ia. Let r = a + 23. Does 9 divide r? False Does 25 divide (-140)/(-3)3/2? False Suppose 3g + 0j = 3j - 384, -3g - 384 = j. Let s = -76 - g. Is 13 a factor of s? True Let i be (-19 - -1)/(2/4). Let w = -12 - i. Is w a multiple of 24? True Let b(r) = r3 + r - 1. Let c be b(2). Let z = c - -18. Suppose 0 = -5d + z + 43. Does 7 divide d? True Suppose 0 = -b - 2y + 22, 3b + 4y = -b + 68. Is b a multiple of 12? True Suppose -5s + 31 = j, -2j + 2s + 36 = -s. Let x be (15/(-6) - -2)18. Let h = j + x. Is 6 a factor of h? True Let y = 45 - 15. Let b be (-1 + 1)/(2 + -4). Let x = b + y. Is 13 a factor of x? False Let g = 7 + -5. Suppose -3w + 0w = 5d - 248, -gd + w = -108. Does 14 divide d? False Suppose g = 4r + 108, g = -0g + r + 108. Let a = g - 64. Is a a multiple of 22? True Let h = 242 + -162. Is h a multiple of 20? True Suppose 5k - 356 = -106. Let o = k - 30. Is o a multiple of 5? True Does 8 divide 0 - (-14 + 0 + 3)? False Suppose -177 = -3k + 3u, 5k - 286 = 5u - 3u. Does 28 divide k? True Let a = -80 - -140. Is a a multiple of 23? False Suppose -4q + 3 = -5. Let c(f) = 25f - 2. Does 24 divide c(q)? True Suppose -4k = -2k. Suppose -r + kr = 16. Let p = r + 28. Does 12 divide p? True Suppose -j = 5a - 4j - 208, -2j - 80 = -2a. Suppose 0 = -2s - 2s + 3i + 53, -3s - 2i + a = 0. Is s a multiple of 11? False Let k = 41 + -124. Let i be 0 - k - (-1)/1. Suppose 2m + 3o = o + 60, 3m - 3o = i. Is 10 a factor of m? False Suppose 698 = -0l - l. Does 13 divide l/(-18) + 4/18? True Let r(n) = 1 + n*3 + 9 + 9 - 13n*2 + 2n. Let a be r(13). Suppose 4i - 5 = f, 5f + 2i - 40 = a. Is f a multiple of 10? False Suppose -5o + 442 = -2u - 326, -2o + 4u + 304 = 0. Is o a multiple of 12? False Let v(g) = 3g*3 + 3g*2 - 3g + 5. Is v(2) a multiple of 14? False Let b(s) = -2s + 6. Let h be b(4). Let r be -5 + 1 + (-5 - h). Let d = 16 - r. Is 10 a factor of d? False Let c = 18 - 4. Does 14 divide c? True Let v(z) be the third derivative of z4/24 - 5z3/6 - z2. Let d be v(8). Let t(c) = c*2 - 2c + 2. Is t(d) a multiple of 3? False Suppose 0 = -2t - 2t + 12. Let y be (-98)/(-6) - 1/t. Suppose -4k + y + 4 = 0. Is k a multiple of 2? False Let j(y) = 4y + 9. Let z(i) = -i + 1. Let u(a) = j(a) - 3z(a). Let h be u(-5). Let n = h + 59. Is 15 a factor of n? True Is (-124)/(-6)54/4 a multiple of 16? False Let n be 7/28/14. Suppose 2 = -w - 4v + 46, -w - nv + 36 = 0. Is w a multiple of 7? True Is 7 a factor of (16/(-12))/(1/(-21))? True Let j be (1 + 0 - 2)4. Let y(z) = -z*3 - 3z*2 + 2z + 5. Is y(j) a multiple of 10? False Let h(s) = -s*3 - 8s*2 + s + 10. Suppose 0n - i = -3n - 20, 4n + 44 = -3i. Let l be h(n). Suppose -10 = lz - 68. Does 13 divide z? False Let f = 198 - 80. Does 14 divide f? False Suppose 5w + 2x = 23, 4w - 24 = 3x - 6x. Suppose 5j + 55 = 3q, 4q - 9 = wj + 68. Is q a multiple of 10? True Suppose -3w + 4w - 2 = 0. Suppose 413 = 5a + 5h - 292, -276 = -wa + 4h. Is 8 a factor of (3/2)/(15/a)? False Let m(b) = 40b*2 + 3b + 2. Let t be m(-2). Suppose 7i = 3i + t. Suppose -4j = 3f - 29, 3f - i = 5j + 26. Does 15 divide f? True Let l(y) = 7y3 - 3y + 2. Let b be l(2). Let v = 84 - b. Suppose -2a = 4q - 7a - v, -8 = -q - 5a. Is 8 a factor of q? True Let w = 1 - -3. Suppose wf = -0f - 1104. Is 23 a factor of (2/(-3))/(4/f)? True Suppose 12 = 5a - 2a, -2d - 4a + 16 = 0. Suppose 3k - 4v + 25 = 0, 3v + 2 = -5k - 1. Is 22 a factor of k + 5 - (-42 - d)? True Suppose 0 = -f - 2m + 3, 5f - 26 = -5m - 6. Let y = f + -3. Is 6 a factor of 11 - (-2 + y + 2)? False Suppose -q + 3i - 115 = -2q, 5q = -4i + 575. Does 5 divide q? True Let h be (-1956)/(-9) - 6/(-9). Is 7 a factor of 4/22 - h/(-11)? False Is 238 + -1(-1 - -4) a multiple of 47? True Suppose 86 = -5f + 551. Does 19 divide f? False Let g(z) = -z3 + z2 - 1. Let q(a) = 3a*3 - 11a*2 + 13. Let u(d) = 4g(d) + q(d). Is 5 a factor of u(-7)? False Let p = -158 + 272. Is 19 a factor of p? True Let x(s) = 3s3 - 2s*2 + 1. Let c be x(1). Suppose c = y + 4v - 11, 5y - 2v = 21. Suppose -ya = -88 - 77. Is a a multiple of 11? True Let z(k) be the first derivative of -k4/4 - 4k3/3 + k2 - 3k - 1. Suppose 2 = -3p - 13. Is z(p) a multiple of 6? True Is 15 a factor of 1 + 2 + 1 - -86? True Suppose 0 = -2p + p + 2n + 11, -5p + 10 = 5n. Is p even? False Let x = 523 + -285. Is 7 a factor of x? True Let n(x) = 4x3 + 2x*2 - 5x + 4. Is n(2) a multiple of 17? True Let s be (-1 - 1) + 2 + 2. Suppose 55 + 9 = so. Is 14 a factor of o? False Let r = -247 - -638. Is 16 a factor of r? False Let a(f) = 36f*2 - 1. Let g be a(-1). Suppose 3p + t = -g, -4t + 5t + 46 = -4p. Let l = -1 - p. Is l a multiple of 4? False Let b(t) = 24t - 13. Is b(2) a multiple of 20? False Let h = 21 + -129. Let j = 192 + h. Suppose 0 = -d - d + j. Does 18 divide d? False Let c = 188 + -107. Let t = c + -56. Suppose 5i + t = 0, 3i - 46 = -5r - 11. Does 6 divide r? False Let s = -12 + 21. Suppose -2h + s = h. Is 2 a factor of h? False Let p(r) = 6r2. Let w be p(2). Is 15 a factor of (34/2)/(8/w)? False Let j(y) = -y3 - 6y2 + y + 6. Let d(a) = -a3 + 1. Let i be d(2). Is 12 a factor of j(i)? True Let i(x) = -15x + 69. Does 8 divide i(-7)? False Is 6 a factor of 2/(5/((-710)/(-4)))? False Let h(t) = t3 - 5t*2 - 4t - 8. Let k be h(6). Suppose -5u = -ku - 5. Is 5 a factor of u? True Suppose -193 = -h - 3z, 0z = -z. Is h a multiple of 13? False Suppose 10 = -2w - c - 37, -5w = 3c + 116. Let n = 1 - w. Does 26 divide n? True Let c(p) = -2p*2 + 4p + 13. Let f(b) = 5b2 - 9b - 26. Let q(g) = 7c(g) + 3f(g). Let n be -5 + 5 + 3 + -13. Is 6 a factor of q(n)? False Let p = 407 - 237. Is p a multiple of 34? True Let n be (-15)/(2 - 9/3). Suppose -n = 5u - 0, -4*w + 85 = u. Does 22 divide w? True Let n be (-2)/(-17) - (-8)/(-68). Let w = n - -36. Does 18 div	{ "pile_set_name": "DM Mathematics" }
st 10000? -90000 Round -0.0000803386 to five dps. -0.00008 Round 1751.54 to the nearest one hundred. 1800 Round 14941900 to the nearest 100000. 14900000 Round -1089156.25 to the nearest ten thousand. -1090000 What is 1274.6184 rounded to the nearest 100? 1300 Round 1143188000 to the nearest one million. 1143000000 Round -138922 to the nearest 10000. -140000 Round 0.11204 to 4 decimal places. 0.112 What is -55465510 rounded to the nearest one million? -55000000 Round 0.0003968651 to six decimal places. 0.000397 Round 0.108102 to 1 decimal place. 0.1 What is -0.022361632 rounded to three dps? -0.022 Round -8549.87 to the nearest 1000. -9000 What is 22238.26 rounded to the nearest ten? 22240 What is -0.000454189 rounded to five dps? -0.00045 What is -0.4400444 rounded to one dp? -0.4 What is 0.0003239715 rounded to 6 decimal places? 0.000324 What is -0.000078327 rounded to 5 decimal places? -0.00008 Round 4159690 to the nearest one hundred thousand. 4200000 What is -191821030 rounded to the nearest one million? -192000000 Round 1125.922 to the nearest integer. 1126 What is -0.001876141 rounded to four dps? -0.0019 Round -16103994 to the nearest one hundred thousand. -16100000 What is -164723100 rounded to the nearest 1000000? -165000000 What is -106800 rounded to the nearest one hundred thousand? -100000 What is -0.5694101 rounded to 1 dp? -0.6 Round 1.6511 to the nearest integer. 2 What is -0.000016285195 rounded to 6 dps? -0.000016 What is -0.000469014 rounded to four decimal places? -0.0005 What is 14239 rounded to the nearest 1000? 14000 Round 270945.77 to the nearest 100000. 300000 What is -0.0004524084 rounded to six dps? -0.000452 What is 171403.75 rounded to the nearest one thousand? 171000 Round -0.4472008 to 4 decimal places. -0.4472 What is -0.70413 rounded to two decimal places? -0.7 Round -1887634 to the nearest ten thousand. -1890000 Round -1237.41 to the nearest 10. -1240 Round -1833.1434 to the nearest 10. -1830 What is 104.412 rounded to the nearest ten? 100 What is -252365.5 rounded to the nearest 100? -252400 What is 0.00000050745 rounded to seven decimal places? 0.0000005 Round -0.001734965 to 5 dps. -0.00173 What is -0.0121568 rounded to 3 decimal places? -0.012 Round 0.00018200105 to 7 decimal places. 0.000182 What is 0.0000399947 rounded to five decimal places? 0.00004 Round 84565.3 to the nearest one thousand. 85000 What is -0.04023252 rounded to 3 dps? -0.04 Round -1577685000 to the nearest 1000000. -1578000000 Round 0.001989945 to 4 decimal places. 0.002 Round -1.0600157 to 4 decimal places. -1.06 What is -2926680 rounded to the nearest 1000? -2927000 Round -1503.6077 to the nearest 100. -1500 What is -20570400 rounded to the nearest one million? -21000000 Round -1.065271 to 1 dp. -1.1 Round 43386500 to the nearest one million. 43000000 Round -2057539 to the nearest 1000. -2058000 What is -19911930 rounded to the nearest one million? -20000000 What is -0.0004560916 rounded to 7 dps? -0.0004561 What is 0.0000275159 rounded to seven dps? 0.0000275 What is -0.799625 rounded to 1 decimal place? -0.8 Round 0.020294364 to 5 dps. 0.02029 Round -0.66356009 to three decimal places. -0.664 What is 4.1789 rounded to 1 decimal place? 4.2 What is -2.27 rounded to the nearest 1000? 0 Round 3942 to the nearest 100. 3900 What is -2046.139 rounded to the nearest 100? -2000 What is 0.32690874 rounded to 2 decimal places? 0.33 Round -14993.17 to the nearest 10. -14990 What is 4.255956 rounded to 0 decimal places? 4 Round 207138 to the nearest one thousand. 207000 What is 0.00035591504 rounded to seven decimal places? 0.0003559 Round -297.3948 to the nearest one hundred. -300 Round 0.000227886 to six dps. 0.000228 Round 0.00202438 to 3 dps. 0.002 Round 218753 to the nearest ten thousand. 220000 What is -609711.61 rounded to the nearest one thousand? -610000 What is -565046.3 rounded to the nearest 1000? -565000 Round 0.013275868 to 2 dps. 0.01 What is -295.94911 rounded to the nearest 10? -300 What is 10388.8 rounded to the nearest ten thousand? 10000 What is 2818.15 rounded to the nearest one thousand? 3000 What is 58843580 rounded to the nearest 10000? 58840000 What is 1132396 rounded to the nearest 100000? 1100000 What is 0.000000357699 rounded to 7 dps? 0.0000004 Round -506.0831 to 1 decimal place. -506.1 What is -0.4490071 rounded to one dp? -0.4 Round -0.00003909745 to 5 decimal places. -0.00004 Round 17.2834 to one dp. 17.3 What is -166.1555 rounded to 0 dps? -166 Round 1708242000 to the nearest one million. 1708000000 What is 486664 rounded to the nearest ten thousand? 490000 Round 0.0001689554 to five decimal places. 0.00017 What is 0.00001446003 rounded to six dps? 0.000014 What is 6.09384 rounded to one decimal place? 6.1 What is -0.047815058 rounded to 4 decimal places? -0.0478 What is -63982932 rounded to the nearest 10000? -63980000 Round 10993 to the nearest 1000. 11000 What is -5.1497 rounded to one decimal place? -5.1 Round -0.825977 to 1 dp. -0.8 Round 0.00000838057 to 6 dps. 0.000008 Round -329860780 to the nearest one million. -330000000 What is -1584380 rounded to the nearest ten thousand? -1580000 What is -0.0000912947 rounded to 7 decimal places? -0.0000913 What is 7416.56 rounded to the nearest 10? 7420 What is -8152.9 rounded to the nearest ten? -8150 What is 12.34604 rounded to two dps? 12.35 Round -6281266 to the nearest 1000. -6281000 Round 0.00000966477 to 5 decimal places. 0.00001 What is -34199 rounded to the nearest 10000? -30000 Round -7441.787 to the nearest 10. -7440 Round 3080.031 to 0 decimal places. 3080 What is -790.0738 rounded to the nearest one hundred? -800 What is 570.2751 rounded to the nearest integer? 570 Round -1.052458 to one dp. -1.1 Round -0.0002491111 to 7 dps. -0.0002491 What is 0.1076371 rounded to one dp? 0.1 What is -876290 rounded to the nearest 100000? -900000 Round -18.97852 to one decimal place. -19 What is -0.159475738 rounded to 5 decimal places? -0.15948 Round -12.62735 to two decimal places. -12.63 Round -1504854 to the nearest 100000. -1500000 What is -0.000014693519 rounded to seven dps? -0.0000147 Round 202316 to the nearest one thousand. 202000 Round 0.0001156733 to seven decimal places. 0.0001157 Round -0.00009515622 to 6 decimal places. -0.000095 What is 1681.365 rounded to the nearest ten? 1680 Round -0.0005125602 to 5 dps. -0.00051 What is -95694.53 rounded to the nearest 10? -95690 Round -5.00931 to 0 decimal places. -5 What is 34099330 rounded to the nearest one hundred thousand? 34100000 What is -0.0000090939 rounded to 7 decimal places? -0.0000091 Round -3.63253 to 3 decimal places. -3.633 Round 715.216 to 0 dps. 715 Round 0.01391771 to four decimal places. 0.0139 Round -23532400 to the nearest one hundred thousand. -23500000 Round -1790177 to the nearest 1000000. -2000000 What is -0.00245186 rounded to 5 dps? -0.00245 Round -0.0418157 to 3 decimal places. -0.042 Round 0.006862713 to 5 dps. 0.00686 Round -5.037066 to one dp. -5 What is 421186.7 rounded to the nearest 1000? 421000 What is -44.4278 rounded to the nearest one hundred? 0 Round 181425.56 to the nearest 10. 181430 What is -268.80783 rounded to the nearest integer? -269 Round -0.156621 to 3 decimal places. -0.157 Round -13.691856 to 0 decimal places. -14 What is 0.0000151294 rounded to 6 decimal places? 0.000015 Round 0.0000480189 to 5 decimal places. 0.00005 Round 83952500 to the nearest 1000000. 84000000 What is -0.534989 rounded to 1 decimal place? -0.5 What is -0.00005828589 rounded to 5 dps? -0.00006 What is -0.00366985 rounded to five decimal places? -0.00367 Round 54.474581 to the nearest 10. 50 Round 734863.1 to the nearest 100000. 700000 What is -2051.903 rounded to the nearest ten? -2050 What is 320072400 rounded to the nearest one hundred thousand? 320100000 What is -0.00474364 rounded to five dps? -0.00474 What is 0.000386506 rounded to five decimal places? 0.00039 What is 42728.75 rounded to the nearest 10000? 40000 Round 0.0004541919 to five decimal places. 0.00045 Round 38.383967 to one dp. 38.4 Round -0.0569796 to four dps. -0.057 Round -6879392 to the nearest one million. -7000000 Round -0.1899566 to 4 decimal places. -0.19 What is 315874.2 rounded to the nearest 1000? 316000 Round 0.	{ "pile_set_name": "DM Mathematics" }
0147? -538339i2 + 10i - 3 What is the f'th term of -38191, -76388, -114571, -152722, -190823, -228856, -266803? 3f3 - 11f*2 - 38185f + 2 What is the l'th term of 7235, 28784, 64667, 114884, 179435, 258320? 7167l2 + 48l + 20 What is the d'th term of 7100, 56814, 191712, 454382, 887412, 1533390? 7098d3 + 4d*2 + 16d - 18 What is the a'th term of -802043, -1604392, -2406741, -3209090? -802349a + 306 What is the s'th term of -299136, -299149, -299162, -299175? -13s - 299123 What is the z'th term of -256645, -2053167, -6929429, -16425301, -32080653, -55435355, -88029277, -131402289? -256645z3 - 7z + 7 What is the x'th term of -25364, -101490, -228366, -405992, -634368, -913494, -1243370? -25375x2 - x + 12 What is the n'th term of -944206, -944201, -944196, -944191? 5n - 944211 What is the c'th term of -24631182, -49262376, -73893570? -24631194c + 12 What is the r'th term of 23342, 46972, 70892, 95102, 119602, 144392? 145r*2 + 23195r + 2 What is the c'th term of -8544, -16994, -25444? -8450c - 94 What is the b'th term of 485, 1984, 4489, 8000, 12517? 503b*2 - 10b - 8 What is the i'th term of -26051, -52090, -78155, -104252, -130387, -156566? -i*3 - 7i*2 - 26011i - 32 What is the a'th term of -10441, -18557, -26675, -34795, -42917? -a*2 - 8113a - 2327 What is the q'th term of 7635, 3493, -635, -4743, -8825? q3 + q2 - 4152q + 11785 What is the t'th term of -721359, -1442756, -2164239, -2885850, -3607631, -4329624, -5051871, -5774414? -7t3 - t2 - 721345t - 6 What is the o'th term of -498044, -1992185, -4482378, -7968587, -12450776, -17928909, -24402950? 6o*3 - 498062o*2 + 3o + 9 What is the i'th term of -489657, -489645, -489633? 12i - 489669 What is the x'th term of 2444, 9610, 21548, 38264, 59764, 86054, 117140? x3 + 2380x*2 + 19x + 44 What is the m'th term of 516, 967, 1462, 2013, 2632, 3331? 2m3 + 10m*2 + 407m + 97 What is the x'th term of 451, -4280, -17111, -42092, -83273, -144704, -230435? -675x3 - 6x + 1132 What is the v'th term of -6462, -25476, -57284, -101886? -6397v2 + 177v - 242 What is the j'th term of 12037, 47918, 107683, 191302, 298745, 429982, 584983? -5j3 + 11972j*2 + 70 What is the x'th term of 533734, 533729, 533724, 533719? -5x + 533739 What is the h'th term of 2706596, 2706611, 2706626, 2706641? 15h + 2706581 What is the c'th term of -127297413, -254594824, -381892233, -509189640, -636487045, -763784448, -891081849? c2 - 127297414c What is the b'th term of -23350, -47451, -71552, -95653? -24101b + 751 What is the w'th term of 8732713, 17465446, 26198179, 34930912? 8732733w - 20 What is the l'th term of 264795, 529514, 794207, 1058862, 1323467, 1588010? -2l3 - l2 + 264736l + 62 What is the h'th term of -7309, -12371, -17433, -22495? -5062h - 2247 What is the m'th term of -119723, -239430, -359137, -478844, -598551? -119707m - 16 What is the o'th term of 23233, 23269, 23353, 23491, 23689, 23953, 24289, 24703? o*3 + 18o*2 - 25o + 23239 What is the m'th term of -3208, -8334, -16878, -28840, -44220? -1709m2 + m - 1500 What is the v'th term of -201, -384, -1029, -2412, -4809, -8496, -13749? -46v*3 + 45v*2 + 4v - 204 What is the x'th term of 240510973, 240510971, 240510969, 240510967, 240510965? -2x + 240510975 What is the k'th term of -19006, -15425, -5722, 13163, 44290, 90719? 510k3 + k2 + 8k - 19525 What is the q'th term of 26578037, 53156073, 79734109, 106312145, 132890181, 159468217? 26578036q + 1 What is the o'th term of 38568, 76856, 115144, 153432, 191720, 230008? 38288o + 280 What is the k'th term of 11870, 23399, 34918, 46421, 57902, 69355, 80774? -k3 + k2 + 11533k + 337 What is the r'th term of 872, 2140, 4260, 7232, 11056? 426r2 - 10r + 456 What is the b'th term of 454, 1260, 2576, 4378, 6642, 9344? -4b3 + 279b*2 - 3b + 182 What is the g'th term of -56250393, -56250392, -56250391, -56250390, -56250389? g - 56250394 What is the g'th term of -114568, -916509, -3093204, -7332031, -14320368, -24745593, -39295084? -114563g3 + g2 - 3g - 3 What is the s'th term of -51754, -123576, -195398, -267220, -339042, -410864? -71822s + 20068 What is the h'th term of 4853, 18876, 42247, 74966, 117033, 168448, 229211? 4674h*2 + h + 178 What is the b'th term of -4061, -5135, -6927, -9437, -12665, -16611? -359b*2 + 3b - 3705 What is the q'th term of 5930418, 5930417, 5930416? -q + 5930419 What is the t'th term of -4768, -19184, -43192, -76786, -119960? t*3 - 4802t*2 - 17t + 50 What is the f'th term of -2761414, -11045647, -24852702, -44182579, -69035278? -2761411f2 - 3 What is the h'th term of 4101109, 8202233, 12303373, 16404529? 8h*2 + 4101100h + 1 What is the p'th term of -8586, -33465, -74922, -132951, -207546, -298701, -406410? p*3 - 8295p*2 - p - 291 What is the y'th term of 1845199704, 1845199703, 1845199702, 1845199701, 1845199700? -y + 1845199705 What is the h'th term of 2074, 3927, 5742, 7501, 9186? -3h3 - h2 + 1877h + 201 What is the c'th term of -260, -2310, -7872, -18704, -36564, -63210, -100400? -293c*3 + 2c*2 - 5c + 36 What is the p'th term of -7653, -7831, -8009, -8187, -8365? -178p - 7475 What is the p'th term of 3924032, 7848085, 11772138, 15696191, 19620244, 23544297? 3924053p - 21 What is the x'th term of 1686, 2788, 3876, 4944, 5986? -x3 - x2 + 1112x + 576 What is the c'th term of 128, 1199, 4084, 9689, 18920, 32683? 151c3 + c2 + 11c - 35 What is the p'th term of -3294842, -6589490, -9884138, -13178786? -3294648p - 194 What is the k'th term of 24619477, 49238960, 73858443, 98477926, 123097409, 147716892? 24619483k - 6 What is the j'th term of 184, 1770, 6054, 14386, 28116, 48594? 225j3 - j2 + 14j - 54 What is the g'th term of -27163430, -27163425, -27163408, -27163373, -27163314? g3 - 2g - 27163429 What is the r'th term of -3367, -10212, -20533, -34336, -51627, -72412? -r*3 - 1732r*2 - 1642r + 8 What is the k'th term of 7425661, 14851293, 22276925, 29702557, 37128189, 44553821? 7425632k + 29 What is the o'th term of 112291703, 224583402, 336875099, 449166794, 561458487? -o2 + 112291702o + 2 What is the y'th term of -4537, -10430, -20255, -34012, -51701, -73322? -1966y2 + 5y - 2576 What is the c'th term of 16364822, 16364824, 16364826, 16364828? 2c + 16364820 What is the o'th term of 2567498, 2567502, 2567506, 2567510? 4o + 2567494 What is the g'th term of -27472, -24171, -20872, -17575, -14280, -10987? -g*2 + 3304g - 30775 What is the s'th term of 1370197, 2740357, 4110519, 5480683, 6850849? s*2 + 1370157s + 39 What is the r'th term of 588315, 588840, 589365, 589890, 590415? 525r + 587790 What is the r'th term of 10781, 10459, 10135, 9809, 9481, 9151, 8819? -r2 - 319r + 11101 What is the i'th term of 31456, 125982, 283560, 504190? 31526i2 - 52i - 18 What is the g'th term of -576242, -1152477, -1728710, -2304941, -2881170, -3457397, -4033622? g*2 - 576238g - 5 What is the l'th term of 14974, 30934, 46894, 62854? 15960l - 986 What is the l'th term of 518, 1056, 1928, 3134? 167l*2 + 37l + 314 What is the v'th term of -36, 330, 1306, 3192, 6288, 10894, 17310, 25836? 50v3 + 5v*2 + v - 92 What is the x'th term of -1382, -4471, -9622, -16835? -1031x*2 + 4x - 355 What is the s'th term of -27914, -27935, -27990, -28097, -28274, -28539? -3s3 + s2 - 3s - 27909 What is the k'th term of 200510, 401265, 602020, 802775, 1003530? 200755k - 245 What is the f'th term of -992291, -1984411, -2976531, -3968651, -4960771, -5952891? -992120f - 171 What is the q'th term of 4781113, 4781093, 4781045, 4780957, 4780817? -2q3 - 2q2 + 4781117 What is the r'th term of 5547568, 5547574, 5547572, 5547556, 5547520? -r3 + 2r2 + 7r + 5547560 What is the n'th term of -24387, -195058, -658311, -1560438, -3047731, -5266482, -8362983? -24382n3 + n2 - 6 What is the c'th term of -72279, -144593, -216903, -289209, -361511, -433809? 2c*2 - 72320c + 39 What is the o'th term of 10198589, 10198588, 10198587, 10198586, 10198585? -o + 10198590 What is the m'th term of 21435, 32137, 42839? 10702m + 10733 What is the y'th term of 571037, 1141891, 1712745, 2283599? 570854y + 183 What is the n'th term of 3098,	{ "pile_set_name": "DM Mathematics" }
5, 2k - y + 7 = 4. Which is smaller: k or 9/16? 9/16 Suppose 29y = 102y + 91177. Is -1249 at least as big as y? True Let d = -1537996 + 701326699/456. Let p = d - 25/24. Let g be (01/(-4))/((16 - 33) + 16). Is p at least g? True Let f = -1491/11 + 91160/671. Do -1 and f have the same value? False Let c = 38169.9 + -38169.9. Let j = -97 + 74.4. Which is greater: j or c? c Let t = 128.89 + -137.89. Let l = 1.58 + 6.32. Let y = 8 - l. Is t at least y? False Suppose -4x - 4z + 19 = 3, 2z + 4 = x. Suppose -4b - 4 = q + 46, -4b - 52 = 2q. Let w be 7/b - (-1)/x. Do -0.28 and w have different values? True Suppose 0 = 20h + h - 72471. Let s be h/(-63) - (-5)/(180/(-8)). Is s at most as big as -56? False Suppose 290z = 289z + 2y + 8, 0 = -3z - y - 4. Are z and -38 unequal? True Let x(l) = -38l*2 - 1. Let r be x(-1). Let s be (-4)/(-7)966/(-12) + 5. Which is smaller: s or r? s Suppose 0 = -14p + 38p - 1176. Suppose 0 = -2q + p + 63. Is q less than or equal to 56? True Let o = 30003 + -30157. Is 2/9 > o? True Let o be (128/(-112) - 12/(-7))(-1883)/2. Which is bigger: -2691/5 or o? o Suppose -5d - 9 = 11, -5d - 65 = -3j. Suppose -26y + 486 - 148 = 0. Which is smaller: y or j? y Let w be (-56449)/209 - 3/(-33). Let a = 268 + w. Is -8 at least as big as a? False Suppose -4f + 1 = h, 3h - 3f + 4f = 3. Let q be 104/24 + 2/3. Let z be (-5)/(q/(-3)) - (h + 1). Which is bigger: z or 2? 2 Suppose 3s = -5l + 5107, 2l - 376 - 1670 = 2s. Is l smaller than 1020? False Suppose -2o + 7 + 17 = 0. Suppose -3u + o = 15. Is 3/47 equal to u? False Let s = -2358.115 + 2365. Let m = s - 13.892. Let g = m - -0.007. Does 0 = g? False Suppose 345 = -4s - i + 2198, -1409 = -3s + 2i. Is s >= 464? True Let c = -205 + 202. Let a be 1/2c(-384)/(-9). Is -64 smaller than a? False Let r = -3.4 - -4.1. Let a = 3.082 - 1.082. Which is smaller: a or r? r Let b = 4.905 + 2.885. Which is smaller: 0 or b? 0 Suppose 50 = i + 4u, -30i - 3u + 216 = -25i. Does 20 = i? False Let f = -745.5 + 609.5. Which is smaller: f or 6? f Let g(f) = 14f*2 + 7f - 3. Let s be g(1). Let o(r) = r - 20. Let w be o(-10). Let i = s + w. Which is smaller: -10 or i? i Let b = 0.28 - 0.3. Let r = -69.3 - -69.12. Let v = b + r. Is v < -3/2? False Let p = 3092.0359 - 3092. Is -6 smaller than p? True Let w = 0.36628 + -346.36628. Is w at least as big as 5/3? False Let v = -1 - 5. Let a be (-1 + v/(-9))/((-9)/729). Is 24 greater than or equal to a? False Let p(d) = -24d + 134. Let q be p(5). Suppose -2z + 3g + g = -16, 5z = 5g + 15. Let u be (-5)/(-20) + (z - q/(-8)). Which is smaller: u or -1/145? -1/145 Let c(n) = -n3 - 7n*2 + 91n + 106. Let x be c(-13). Let w be (10/(-20))/(1/122). Which is smaller: x or w? x Let x(l) = 0l2 - 17l - 4l2 + 3l*2. Let i = 1194 + -1211. Let z be x(i). Which is bigger: z or -1? z Let f = 141 + -66. Let i = -98 + 698. Let r = 675 - i. Is r >= f? True Suppose 10436f = 10458f + 19096. Is -867 at most as big as f? False Let m be 110/((-121)/11) + 10. Which is smaller: -1031 or m? -1031 Let p(q) be the third derivative of -q5/20 + q4/12 - q3 + 21q*2. Let b be p(4). Let w be 23/b(0 - (-1)/1). Which is smaller: w or 26/5? w Let d = -1175 + 1830. Let c be (-8)/((-240)/d) - (-7 + 2). Which is greater: 26 or c? c Let n = -2170 - -2067. Let m(i) = -i*2 - 2i - 5. Let k be m(9). Is n at least k? True Let y = -93999/86 - -1093. Suppose -6131 = -5z - 36. Let w = -1220 + z. Do w and y have the same value? False Let b = -149 - -148.741. Let n = 1.659 + b. Is n less than 5? True Let p(s) be the second derivative of -s3/6 - 3s*2/2 + 2s - 10. Let z be p(-3). Which is bigger: 1 or z? 1 Let s(x) = -x*2 - 44x - 436. Let c be s(-24). Which is smaller: 38 or c? 38 Let q = -2682 - -2681. Is q at least 1/697? False Let x(y) = 7y2 - 4y - 2. Let n be x(-1). Suppose 0 = ns + 9s - 720. Is 40 at least s? True Suppose 5w + 12 = v, v - 3v + 2w + 16 = 0. Let y(g) = -2g*2 + 6g - 10. Let l be y(v). Let i be (-56)/l + (27/33 - 1). Is i <= 2.1? True Let q(y) be the second derivative of y*3/6 - 11y*2/2 + 8y. Suppose -44 = -3g - 11. Let x be q(g). Are -1/2 and x nonequal? True Let a be (-6)/51 - -8979(-8)/(-204). Let q be 250/875 + a/(-1134). Is 1 not equal to q? True Let u = 2621/20 + -131. Let n be -2 + 4863/15 - (-4)/5. Let w = 323 - n. Which is smaller: u or w? w Suppose -d + 2d - 4w + 4 = 0, 4w = 4d + 16. Let c be 20872/2984 + -3 + d. Is -1 bigger than c? False Let r(w) = 3w - 32. Let i = 89 + -84. Suppose 4g = -ig + 99. Let f be r(g). Is 1/21 at least f? False Let p = -1.143 + 0.143. Let y = 60 - 75.5. Let o = y - -20. Which is greater: o or p? o Let q = -25 - 90. Let s = q + 113. Let f be 1/((-116)/(-76) + -2). Are s and f unequal? True Let o(b) = -b3 - 6b*2 + b + 2. Let t be o(-5). Let j be (-4)/(-14) - 10/t. Let i be 0((-50)/(-250) + (-6)/(-20)). Which is smaller: i or j? i Let c be 18 + (-7 - 3) + 10/2. Let r be 39/c - (6 + 0 + -2). Which is smaller: r or 8? r Let w be -5 + 15 + -6 + 17. Let g(n) = n*2 - 16n + 81. Let h be g(w). Which is greater: h or 187? 187 Suppose -20j - 908 = 452. Let s be 5(-116)/8 + 6. Which is greater: s or j? s Suppose 0 = 2c + 5k - 229, 8315c - k = 8314c + 76. Let i(r) = -r3 - r2 + 89. Let l be i(0). Is c less than l? True Let m be (118/6)/((-14)/(-420)). Let r be 5 + (-9)/((-63)/4102). Which is bigger: m or r? r Let t = 14.92 - -0.08. Let j = t - 15.45. Let n = -0.45 - j. Are n and -64 non-equal? True Let d(w) = 22w2 + 20w - 1. Let i be d(-1). Is i less than 340? True Let x be 1(102/(-17))/12. Is x at least 1.1597? False Suppose z + 0 = 2, -3k - 4z + 8 = 0. Suppose k = g + 15 - 22. Let b be 55/(-10) + 5 - g/(-18). Is 0.2 less than b? False Let c(l) = -l3 - 16l*2 + 3l - 36. Let t be c(-16). Let i be (8/6)/(t/234). Which is greater: i or -1/2? -1/2 Suppose 10r - 202 = 728 + 140. Which is smaller: -11 or r? -11 Let m be (30/7670)/(-13 + 9). Which is greater: m or 0? 0 Let d = 28266 - 28265.9. Is d less than -2986? False Let c = 2 + -1.9. Suppose -6g + 81 = -4g + 3m, g = 3m + 27. Suppose 20v - g = 24. Does v = c? False Suppose -2n = 10n. Suppose n = 159r - 167r. Is r <= -247? False Let s = 0.203 + 29.797. Let m = s - 124. Do 0.1 and m have different values? True Suppose -2o = -4945 - 8315. Let h = o - 13759/2. Let k = -244 - h. Is k at most 5? False Let t = 2.99 + -2.7. Let a = t - 0.49. Let w = 15.981 - -2.019. Which is greater: w or a? w Let p = -39 + 43. Suppose g - pg = 312. Let j be (2/4)/(2/g). Which is smaller: j or -1? j Let z(w) = 6w2 - 9w - 4. Let t = -257 - -253. Let b be z(t). Is 128 <= b? True Let c = 29 + -30. Let h = -847097108604/222545 + 19032041/5. Let n = -2/947 - h. Is n at least c? True Let g(r) = r*3 + 9r*2 + 16r + 66. Suppose 0 = 2q + 10v - 6v + 12, 5q = 3v - 43. Let h be g(q). Which is smaller: -0.2 or h? -0.2 Let o be (3/(-75))/(2/(-6)). Let b(i) = -8i*3 - 11i*3 + 65i - 5i2 - 10 - 8i*3 + 26i*3. Let y be b(-11). Which is bigger: o or y? y Let j be (-224)/84 + (-62024)/(-23268). Are 1 and j non-equal? True Suppose 5x + 3h = 120 + 42, 0 = -2x + 5h + 102. Let a(t) = t2 + 2t - 3. Let u be a(-3). Suppose -4z + 13z - x = u. Is z > 2? True Suppose 27 = 5f + 52. Let g be (-4 - f)/(1/(-5)) - 153. Which is smaller: -156 or g? g Let i = 6363 - 6363. Let v be 2990/940 + 5/(-2). Which is bigger: i or v? v Let x be (48/(-56)-7)/(1-5). Let d be 0/((-2)/6(-11 + 14)2). Is d equal to x? False Let w be (-40)/(-35) - 2863397/623. Is w greater than -18377/4? False Let y = -1357/116730 - -2/3891. Let q = 5756 - 5757. Do q and y have different values? True Let c be 2 + 8462/(-16) - (-8)/(-64). Is c <= -2637/5? False Let n = 1875 + -1874. Which is smaller: n or 2/1471? 2/1471 Suppose 4l - 1206 = 5o, -4o + 1188 = -16l + 20l. Let d = l - 301. Is d greater than or equal to -10? True Suppose -5g = 0, 0 = -3a - 5g - 22 - 14. Let p be (a - -13)/((-1)/(-34)). Let s = -18 + p. Is s less than -1/3? False Suppose -9x + 69 = -111. Let i(u) = 17 + 16 + xu2 - u - u3 - 13. Let c be i(20). Do c and -1/4 have the same value? False Suppose 3s = -3h - 201, 8s - 13s = -11h - 641. Which is bigger: h or -56?	{ "pile_set_name": "DM Mathematics" }
- 10f2 + (-f - 2f + 5f)(f - 4f + 6f) - 2f2 + 0f*2 - 11 + 5 to t + pf*2 + yf and give t. -6 Rearrange 299n + 579n + 388n + 1784n + 4059n to pn + u and give p. 7109 Rearrange (4x2 - 4x*2 - 4x*2)(8632x2 - 125x + 7x + 2 - 2 + 118x) to the form qx + vx*4 + cx*3 + u + ax*2 and give v. -34528 Rearrange 18 - 17 - 5y*2 + 334y + y*4 + 3y*2 - 6y*3 - 2y*3 + 6y*3 to the form oy*4 + cy*3 + z + ay + iy2 and give z. 1 Rearrange -b2 - 2055b - 1294655 + 1294655 + (-4 + 1 + 4)(0b*2 + 0b2 - b2) + 3 - b*2 - 3 to y + vb + fb2 and give f. -3 Rearrange 1714j - 5061j - 3976j to aj + u and give a. -7323 Rearrange (h - h - h)(-606 + 2066 + 2804 + 713 + 471) to yh + v and give v. 0 Rearrange (-3z + 3z + 2z)(-5848z - 33928z - 6719 - 2234z + 3360 + 3359) to i + cz + xz*2 and give i. 0 Express -330m4 + m3 - 61m2 - m - 34m*4 - 2 - 58m*2 + 119m*2 in the form tm*4 + v + wm*2 + om*3 + hm and give t. -364 Rearrange (4 - 4 - 1 - 21 + 1 - 15 + (3 - 4 + 0)(2 - 2 + 1) - 1 + 5 - 3 - 4 + 0 + 8)(-b - 7b + 3b + 3) to kb + h and give h. -96 Rearrange 10831 - 10936 + 14j*3 + j - 7j*3 + 12j*3 - 6j*3 to i + tj + yj2 + qj*3 and give y. 0 Express 4 - 3p + 10650p3 + 5p - p*4 - 10651p*3 - 96p*2 in the form tp + bp3 + x + qp*4 + np*2 and give n. -96 Rearrange (6y*4 - 5 + 5)(466 + 552 + 437 + 508 + 968) to the form h + oy + by*3 + wy*4 + cy*2 and give w. 17586 Rearrange (0 + 0 + n)(0 + 5 - 1)(-5 + 0 + 1) - 2n + 4n + 0n + (3 + 1 - 1)(2n + 0n - 5n) to the form dn + w and give d. -23 Express (44v + 96v - 11v)((11v + 5v - 7v)(1 - v - 1) + 1 - v2 - 1) in the form g + kv*2 + wv + tv3 and give k. 0 Rearrange -f4 - f2 - 570 - f2 - 5f*2 - 528 + 4f*2 to gf + o + tf4 + vf*2 + af*3 and give o. -1098 Express -7d*3 - 1691 - 150d*2 + 35d - 37d + 1691 in the form id + ld3 + u + nd*2 and give n. -150 Rearrange (4 - 2 + 0)(2m - 5m + m)(2098 + 667 + 290) to the form am + u and give a. -12220 Rearrange -2g + 1008 + 3g*2 - 40 - 67 + 221 to the form ng + bg2 + i and give b. 3 Express -38u*2 - 3u + 3u + (255u - 48u + 140u)(u + 5u - 4u) in the form vu*2 + iu + g and give v. 656 Express -148k4 + 3 - 1014k*2 + 551k*2 + 459k*2 as y + mk*2 + rk + vk3 + xk*4 and give y. 3 Express (4h*2 + 2h*2 + 0h*2)(44 - 64 + 27)(-4 + 3 + 6)(-2 - 2 + 6) in the form vh2 + fh + k and give v. 420 Express -2 + 84j2 + 58j*2 - 179j*2 - 11j + 74j2 in the form r + sj*2 + nj and give s. 37 Express -72877d2 - 12d*4 - 17d*3 - 9d*3 + 72874d*2 - 1 in the form fd*4 + g + jd*2 + md + xd3 and give x. -26 Express 4 - 29 + 918m - 899m in the form j + pm and give p. 19 Rearrange (103 - 5n - 69 + 20n)(-1 + 1 + 5) to u + hn and give h. 75 Express 127v - 17v - 611v - 844v - 1400v as f + lv and give l. -2745 Rearrange 3q2 + 3 + q2 - 1739q + 1771q - 6q*2 to jq*2 + bq + s and give j. -2 Express (-7a2 - 10 + 10)(-10a2 + 24a*2 - 13a*2) - 3a*4 - 2a4 + a4 in the form ha3 + na + i + ga4 + ta*2 and give g. -11 Express 299 - 621 + 320 + 2h*2 + 26h*3 in the form oh*3 + ih*2 + xh + y and give x. 0 Express 32w2 - 14w2 + w3 + 12w2 + 8w*2 + 15w*2 in the form hw*2 + lw + gw3 + r and give g. 1 Rearrange (0 + 3 + 0)(-4 + 0 + 0)(-63 - 293 + 39 + (4 - 4 - 2)(-2 + 2 - 2) - 1 + 3 - 3)(3 + 2 - 6)(-3s + 0s + 5s) to the form fs + z and give f. -7536 Express 2 + 5 + 107r2 - 4 + 654r*2 - 4 as n + jr + gr2 and give g. 761 Express 190k + k*4 - 800k - 5 + k*3 + 4k*4 + 658k in the form xk2 + lk*3 + pk + ak4 + w and give a. 5 Rearrange (15f*2 + 8f*2 - 8f*2)(f2 + f2 + 9f2 + (5f - 7 + 7)(6f + 3 - 2f - 1)) to mf*3 + w + vf*4 + xf + of2 and give v. 465 Rearrange (12 + 12 - 5)(-18g3 - 19g - 15g3 + 21g*3) to rg*3 + z + yg*2 + lg and give r. -228 Rearrange (12934 + 48d - 12934)(-6 + 5 - 3 + (-2 + 5 + 2)(3 - 6 + 1) - 5 + 2 + 4) to f + od and give o. -624 Express 66l3 + l + 11 - 138l*3 + 0 - 8 in the form o + bl*3 + jl + cl2 and give b. -72 Rearrange -1273 - 1270 + 295n - 1276 + 3819 to the form gn + k and give g. 295 Express -2u*4 - u + u + (-2u*3 + 2u3 - u3)(4635u - 1996u - 2222u) as yu2 + vu*3 + cu + wu4 + k and give w. -419 Express 146 - 524 + 192 + 186 + 11501s as y + us and give u. 11501 Express (782 - 782 + 16t)(6t*3 + 22t3 + t3) - t2 + t2 + t*4 as vt*2 + ot + lt4 + s + ht*3 and give l. 465 Express 7012k*2 + 2036k*3 + 10694k*3 - 7014k*2 in the form bk*3 + fk*2 + pk + h and give f. -2 Express -q*3 + 285935 - 4q*4 + 2q3 + q3 - 285937 + 55q2 as wq + xq4 + rq*2 + h + fq*3 and give r. 55 Rearrange -n - 9n*2 + 48n*3 - 2n*4 - 2 - 27n*3 + 3n*4 to jn + d + un3 + wn*4 + qn*2 and give w. 1 Express 559f + 51 - 479f - 49 in the form p + sf and give s. 80 Express (-2i + 4i + 0i)(10i2 + 8i - 8i)(20i + 45i + 112i) in the form f + zi*3 + yi*4 + qi*2 + pi and give y. 3540 Express (-2 - 3 + 1)(438v*2 - 237v*2 - 346v*2)(0v + 4v - 2v + (-5 + 4 + 3)(-25 - 11v + 42 - 19)) as jv*3 + zv*2 + fv + y and give j. -11600 Rearrange -561g2 + 18g + 262 + 560g2 + 2g*4 - 19g to the form hg3 + ig*4 + c + vg*2 + yg and give c. 262 Rearrange -14f + 5f*3 - 155f - 32f + (-3f*2 + 3f*2 + 3f*2)(2f + 0f - 4f) + 21f*2 + 3f*3 - 21f*2 to sf*3 + hf*2 + i + nf and give s. 2 Rearrange 3 + 891q + 472q - 4 + 2 to the form i + rq and give i. 1 Rearrange -2k + 0 + 0 + (2k - k + k)(-2 + 6 + 0) - 3k - 7k + 9k - 3 + 4k + 3 - 1 + 1 - k + (-3 - 4 + 4)(3k - 3k + 6k) to r + gk and give g. -10 Express (-3 + 3 + n)(-3n2 + n2 + n2) + 1067218n*2 - 1607n*3 - 1067218n*2 in the form zn*3 + an + yn2 + t and give z. -1608 Express 4n*2 - 7n*2 + 9n*4 + 2n*4 + 1 - n - 73n*2 - 12n*4 in the form hn*4 + a + on*3 + mn + in2 and give i. -76 Rearrange 6212a - 3115a - 2a*4 - 10a*2 - 3097a + 2 - 7a2 - 54a*3 to ra*3 + za*4 + c + da*2 + ya and give z. -2 Express -6446g2 + 6332g*2 + 0g - 10 + 0g as hg + x + kg2 and give x. -10 Rearrange (1 - 1 + 2n)(-4 + 1 + 1) - 5n + 3n + n - 7750n - 35163 + 35163 to yn + m and give m. 0 Rearrange (2 + 0 - 3)(2 - 2y2 - 2) - 18y - 585y2 + 522y*2 + 18y to the form r + xy + hy*2 and give h. -61 Rearrange (155 - 97 + 321)((-2x - x + 2x)(-1 + 2 + 0) - 10x + 4x - 29x) to bx + l and give b. -13644 Rearrange -6543562h*4 + 5 + 6371471h*4 - 5 + 0 + (1 - 5 + 6)(2h3 - 2h*3 + 2h*4) to the form jh + oh2 + i + kh*4 + nh*3 and give i. 0 Rearrange -338i - i*2 - 26i*3 + 345i + 25i3 to the form hi*2 + ci*3 + ui + f and give u. 7 Express (-5n + 2n + n)(1 + 0 - 2) - 2143n + 7409n + 2174n - 4 + 7516n + 4 as an + l and give a. 14958 Rearrange (3 - 3 + 1 + (-2 + 0 + 4)(1 - 4 + 2) + (-1 + 3 + 0)(-2 - 3 + 2))(-4d*2 - 13d*2 + 0d*2) to the form ld*2 + xd + a and give l. 119 Express 3280s - 1203198 + 1203198 in the form y + bs and give b. 3280 Rearrange -22 + 50 - 16 - 10 - 395i - 2i2 - i2 to si2 + q + pi and give p. -395 Express (-164a - 70a - 86a)(0a - a2 + 0a)(2a + 0a - a) as ma*2 + pa*3 + za + ja4 + b and give j. 320 Express (-3x*2 + 6x*2 - 4x*2)(-254x + 184x + 1439x)(4 - 2 - 3) as a + fx + vx*3 + wx*2 and give v. 1369 Rearrange (41g + 42g + 60g)(-29 + 1 - 5) to f + kg and give k. -4719 Express (-3r2 + 5r*2 - 4r*2)(-82r + 188r - 1913r) in the form tr*3 + kr*2 + wr + o and give k. 0 Rearrange 6970q3 + 22q*2 - q + 5 + 6970q*3 - 13938q*3 to iq + c + tq2 + bq*3 and give i. -1 Express -2c*2 - 975 + 955 - 11c - 11c as yc + kc2 + j and give j. -20 Express -36m4 - m2 + 1 + 55m4 + 3m - 75m3 - 21m*4 as tm + dm3 + pm*2 + z + cm*4 and give p. -1 Rearrange (-7u + u + 3u)(-5283 + 1154 - 3866)(1 + 2 - 1) to the form ou + t and give o. 47970 Express -	{ "pile_set_name": "DM Mathematics" }
r + 2 Let g(o) be the second derivative of -11o4/12 - 4o*3/3 - 7o*2 + 3o + 15. Let y(d) = 4d2 + 3d + 5. Give 3g(f) + 8y(f). -f*2 - 2 Let k(g) = -5g*2. Let m = -8 - -5. Suppose 6l - 10l = -4n + 32, -n = -1. Let x(b) = 11b2. What is lk(y) + mx(y)? 2y*2 Let p(n) = -8n*2 - 5n - 4. Let m(h) = h*2 + 3h + 2. Give -2m(r) - p(r). 6r2 - r Let d(s) = -s2 - 4s + 2. Let b be d(-3). Suppose 0 = -2n - 2q, -5q = -bn + 2n - 16. Let g(c) = 3c2 - c - 1. Let u(t) = t2. What is nu(m) + g(m)? m2 - m - 1 Let n(j) be the third derivative of j6/24 + 7j5/60 - j4/8 - 2j*3/3 - 164j*2. Let r(t) = -2t*3 - 3t*2 + t + 2. What is -3n(s) - 7r(s)? -s3 + 2s - 2 Let g(d) = 1331d + 5. Let u(z) = -51912z - 196. Calculate -196g(r) - 5u(r). -1316r Let y(p) = p2 - p - 2. Let s(u) = -10u*2 + 9u + 10. What is 4s(k) + 20y(k)? -20k2 + 16k Suppose -22s - 52 = 36. Let t(b) = -b - 2. Let h(i) = i2 + i. Let a(m) = -2h(m) - t(m). Let z(n) = 2n2 + n - 2. Give sz(k) - 5a(k). 2k*2 + k - 2 Let v(s) be the first derivative of -9s*4/4 - 5s*3/3 - 7s*2/2 - 5s + 215. Let f(m) = 13m3 + 7m*2 + 10m + 7. What is 5f(y) + 7v(y)? 2y3 + y Let a(z) = -105z*3 + 90. Let b(i) = -1 + 15655i - 15655i + i3. What is a(d) + 90b(d)? -15d3 Let v(j) = -4j*3 + 7j*2 - 5j + 7. Suppose 2t - 65 = 23. Let n = t + -47. Let q(a) = 2a*3 - 3a*2 + 2a - 3. What is nv(y) - 7q(y)? -2y3 + y Let r(j) = 4j + 2j + 1 - 3j - 2j. Let o = 103 - 104. Let k(x) = -x2 + 6x + 5 + x - x*2. Calculate ok(n) + 6r(n). 2n2 - n + 1 Let o(z) = -z - 1. Let g(q) = q2 - 3q - 3. Let a be g(-3). Let d(c) = -ac + 5c + 12c - 2. What is d(u) - 2o(u)? 4u Let r(g) = 1387g - 2774g + 2 + 1386g. Let o(u) = -3u + 6. Give 4o(j) - 11r(j). -j + 2 Let u(b) = 2b3 - 5b*2 + 142. Let g(s) = -3s*3 + 7s*2 - 213. Determine -5g(a) - 7u(a). a3 + 71 Let d(a) = 2a*2 + a. Let k be (140/(-840))/((-2)/4). Let c(r) be the first derivative of -1/2r*2 + 0r + 7 - kr3. Calculate -5c(f) - 3d(f). -f2 + 2f Let t(d) = 5d3 + 4d*2 + 4d. Let z(f) = f2 - 7612 + 7612 + f + f3. Let i(b) = -b*3 + 2b*2 + 2b + 1. Let a be i(3). Give at(o) + 9z(o). -o3 + o2 + o Let w(s) = 17s2 + 7s + 11. Let i(d) = -18d2 - 8d - 11. Determine 5i(y) + 6w(y). 12y2 + 2y + 11 Let a(s) = -6s - 3. Let d(f) = f. Let m(c) = -1. Let t(z) = 2d(z) - m(z). Let u = -178 - -293. Let o = u + -108. What is ot(g) + 2a(g)? 2g + 1 Let y = 149 - 127. Let h(n) = -2n - 1. Let j(t) = 8t + 4. Determine yh(p) + 6j(p). 4p + 2 Let f be 7 + (-2 - (-1 - 3)). Let x(n) be the first derivative of -n*2 + n + 35. Let r(g) = 8g - 4. Give fx(q) + 2r(q). -2q + 1 Let p(x) = -6x + 6. Let u(j) = -10j + 17. Let a(m) = -5m + 8. Let r(y) = -7a(y) + 3u(y). Suppose 0 = g + 7 - 2. Calculate gr(b) - 4p(b). -b + 1 Let m(x) = 14x3 + 7x. Let l(q) = q*3 + q. Give -14l(z) + 2m(z). 14z*3 Let b(y) be the second derivative of -5y3/2 - y2 - 471y. Let o(v) = -15v - 3. Calculate -3b(p) + 2o(p). 15p Let m(i) = -2i. Let g = -46 + 46. Let d(b) = -4b + 3b + gb + 2b. Suppose -5t = -5r + 5, 5r = -2t - 0r - 23. Give td(y) - m(y). -2y Let m(r) = 137r*3 + 822r. Let i(c) = c. Determine 822i(t) - m(t). -137t*3 Let y(h) = -4h*3 - 14h*2 + 14h - 14. Let z(w) = w*3 + 3w*2 - 3w + 3. Suppose -u + 41 + 39 = -3r, 0 = -3r - 4u - 100. Determine rz(g) - 6y(g). -4g*3 Let t(i) = 41i*2 + 2i - 13. Let y(p) = -21p2 - p + 6. Calculate -4t(g) - 9y(g). 25g*2 + g - 2 Let o(u) = 4u3 + u2 + 5u - 3. Let n(q) = 45q*2 - 8q*3 - 6q + 3q3 + 46q*2 - 137q*2 + 45q*2 + 4. Determine 3n(l) + 4o(l). l3 + l2 + 2l Suppose 10r - 21 = 39. Let s(a) = 4a*2 + 2a + 3a2 + 7a*3 + 6 - 11a*2. Let p(i) = -13i*3 + 7i*2 - 4i - 11. What is rp(t) + 11s(t)? -t*3 - 2t*2 - 2t Let y(p) = 657p - 2. Let v(r) = 657r - 2. Calculate 4v(w) - 5y(w). -657w + 2 Let h(d) = d2 + 4d + 4. Let g(p) = p*3 - 17p*2 - 18p + 9. Let z be g(18). Let s(f) = -23 + f + 4 + z + 11. Give h(u) - 2s(u). u2 + 2u + 2 Let m(o) = -2o + 1. Let a(s) = -441s + 4. Calculate -a(y) + 4m(y). 433y Let b(l) = -73l3 - 12l. Let a(k) = 948k3 + 158k. What is -6a(y) - 79b(y)? 79y3 Let d(m) = -m3 + m2 - 5m - 1. Let l(s) = -3s3 + s2 - 12s - 3. Give -7d(x) + 3l(x). -2x3 - 4x*2 - x - 2 Let r(d) = 307d - 12. Let g(k) = -69690k + 2727. Determine 4g(j) + 909r(j). 303j Let f(c) = 1. Suppose -23 + 49 = 4t - 2h, -2t - 2h = 2. Let l(k) = 2k - 7. Let m(r) = r - 3. Let n(w) = -4l(w) + 9m(w). What is tf(o) - 4n(o)? -4o Let v(w) = -13w2 + 5w. Let k(n) = -7n2. Let z(i) = 180i*2 - 4i. Let t(s) = 24k(s) + z(s). Give 5t(d) + 4v(d). 8d*2 Let u(f) = -19. Let a(c) = 10. Let l(h) = -2a(h) - u(h). Let k(x) = -x. Let r be 2/(-9) - (-60)/27. What is rk(y) - 3l(y)? -2y + 3 Let w(z) = z3 - z + 3. Suppose 5r - 4p - 553 = 0, 0p + 4p - 12 = 0. Let v = 116 - r. Let u(s) = 2s3 - s2 - s + 4. Calculate vu(a) - 4w(a). 2a3 - 3a2 + a Let p(f) = -f2 - 1. Let u(x) = 25. Let t(y) = 9. Let c(n) = 11t(n) - 4u(n). Calculate c(a) - p(a). a*2 Let s(l) = -l. Let u(m) = -4m - 8. Let b(c) = 2c2 + 3c + 2. Let p be b(-1). Calculate pu(y) - 5s(y). y - 8 Let b(h) = -3h3 - h2 + 2h. Let d = 30 - 30. Let c = -2 - d. Let l(i) = i*2 - i. Determine cl(n) - b(n). 3n3 - n2 Let s(p) = p2 - p - 1. Suppose 0 = q + 18 - 21. Suppose 3u - 3 + 6 = 0, -qr - 2u = -22. Let z(a) = -12a2 + 8a + 8. Determine rs(t) + z(t). -4t2 Let m(x) = x2 - x. Let v(q) = 3q2 - 6q + 4. Let r(f) = 4m(f) - v(f). Let j(h) = h - 4h*2 - 24 - 26 + 3h*2 + 49. Calculate -2j(i) + r(i). 3i2 - 2 Let x(f) = f - 1. Let c(d) = -12d + 12. Let g(k) = 8k - 8. Let l(a) = 5c(a) + 8g(a). Let b = -1971 - -1969. What is bl(q) + 7x(q)? -q + 1 Let h(i) = 19i*2 + 8i + 11. Let v(w) = -6w2 - 3w - 4. Give 4h(b) + 11v(b). 10b2 - b Let g(y) = -5y - 6. Suppose -3h - 4b + 36 = -8h, 28 = -3h + 4b. Let a(v) = 11v + 13. Give ha(l) - 9g(l). l + 2 Let v(k) be the third derivative of -1/12k5 + 0k + 0 + 1/6k3 - 29k*2 - 1/6k4. Let b(t) = t2 + t. Give 2b(m) + v(m). -3m*2 - 2m + 1 Let p(w) = -w + 1. Let j(z) = 17z - 8. Let h(b) = -20b + 9. Let l(g) = 5h(g) + 6j(g). What is l(f) + 4p(f)? -2f + 1 Let k(p) = 11p2 - 3p. Let s(t) = -34t2 + 8t. Let c be -117 - (133 + -142). Calculate ck(y) - 3s(y). 14y*2 Let h(i) = 2i*2 - i - 2. Let o = -63 - -61. Let n(j) = -2j - 6 - 4j - 3j*2 + 13j*2 - 5. Calculate on(a) + 11h(a). 2a2 + a Let z(n) = -n3 + n*2 - n - 1. Let d(p) = -5p*3 - 55p*2 - 2p - 4. Determine -d(o) + 2z(o). 3o*3 + 57o*2 + 2 Let j(x) = 8x. Let p(q) = 5q. Let b(r) = -r2 + 36r - 64. Let m be b(34). Give mj(h) - 8p(h). -8h Let p(l) = -3l - 3. Let g(q) = -5q - 6. Let k = -1120 + 1127. Give kp(c) - 4g(c). -c + 3 Let u(n) = -193n*2 - 3n + 7. Let l(d) = -193d2 - 4d + 8. Determine -3l(c) + 4u(c). -193c2 + 4 Let l(p) = -p - 1. Let x(k) = 31k - 244. Let z be x(10). Let v(d) = -11d2 + 66d + 66. Determine zl(y) + v(y). -11y*2 Let u(f) = 10f*2 - 40f. Let r(b) = -7b2 + 25b. Determine 7r(g) + 5u(g). g*2 - 25g Let o(z) = -z*2 - z - 1. Let h(a) = -2a*3 + 6a*2 + 7a - 110. Determine h(d) + 6o(d). -2d*3 + d - 116 Let r(d) = 6d*2 + 6. Suppose 0 = -3w - 2w - 5. Let l(q) = 4 + q2 - 1 - 2. Determine wr(u) + 4l(u). -2u2 - 2 Let s(n) = n2 - 4. Let o(l) = 2l2 - 1. Let i(g) = 3o(g) - 2s(g). Let d(h) = 4h*2 + 4. Determine 3d(f) - 2i(f). 4f*2 + 2 Suppose 2 = p + 5. Let w(f) be the first derivative of f + 210. Let g(u) = u + 5. Determine pw(l) + g(l). l + 2 Let v(i) = -255i - 11. Let j(g) = -254g - 14. Give 4j(x) - 5v(x). 259x - 1 Let m(k) be the third derivative of k3/2 - 7k2. Let z(b) = -b3 - 4. Let r(q) = -q*3 - 5q*2 - 7q - 6. Let f be r(-3). What is fz(y) - 4m(y)? 3y3 Let g(i) = -2i*2 + 6i - 1. Let m(b) = b*3 - 7b*2 + 19b - 3. Calculate -7g(f) + 2m(f). 2f3 - 4f + 1 Let k(q) = q*3 + 4q*2 - 2q - 6. Let g be k(-4). Let t(r) = 3r*2 -	{ "pile_set_name": "DM Mathematics" }
be 4/(-10) - 8/5. Let w be (4 - 1)s/(-6). Which is the closest to 2? (a) -0.2 (b) w (c) 1/4 b Let t = -4.5 - -4.7. What is the nearest to -4 in t, 5, 0.5? t Let d(n) = -n3 - n - 1. Let k(z) = 3z*3 - 5z*2 - 3z - 4. Let x(l) = -2d(l) - k(l). Let r be x(6). Which is the closest to -2/3? (a) -5 (b) r (c) -4 b Suppose -5i = 4k + 396, -4k + 4i = 2i + 424. Let r = k + 517/5. Let h = -0.2 - -0.2. Which is the closest to -1? (a) h (b) r (c) -1/3 b Let i = -527/5 - -105. Let p be 2/6(1 - 2). Which is the nearest to 0.1? (a) p (b) -6/11 (c) i a Let w be (3/6)/(10/5). What is the nearest to -1 in w, -5, 13? w Let n be 2 - (-39)/(-9) - 3/(-9). What is the closest to -0.06 in 1, n, 3? 1 Suppose -x + 2q = 0, 2x = 7x - 3q. Suppose -2b - 2b + 4 = x. What is the nearest to 0 in 2/5, -2/7, b? -2/7 Let w = -13.5 + -3.5. Let k = -19 - w. Let s = -3/23 - -84/115. Which is the nearest to 0.1? (a) 1/5 (b) s (c) k a Let g = -1203 - -1207.83. Let u = g + 0.17. What is the closest to 0.05 in 0.5, u, 2? 0.5 Let l = 153 + -153.2. Which is the nearest to -0.1? (a) l (b) -0.5 (c) 7 a Let f = 26/3 + -344/39. Let v = 5 + -9. Which is the closest to 4? (a) 2/11 (b) f (c) v a Suppose 4 + 1 = -5t. Let p be (6 - 2)/(9 + -2). Let w = -4.1 + 4. Which is the nearest to w? (a) -0.4 (b) p (c) t a Let u = 0.073 + 0.027. What is the nearest to u in -9, -0.2, -1/3? -0.2 Let f be 4/(-6) - 1/(-6). Which is the nearest to f? (a) -2 (b) 5 (c) -0.5 c Let t = 23 - 32. Let h = t - -5. Let q = -12/5 - -56/15. Which is the closest to 1? (a) q (b) h (c) 5 a Let u = -0.3 + 3.3. Let p(w) = -w*2 - 6w - 5. Let r be p(-5). Let l be 8/16 + (-10)/(-12). Which is the closest to r? (a) l (b) u (c) -1/3 c Suppose 4v + 8v = 3v. Let j be 3/(-10) - (-2)/5. What is the nearest to v in j, 3, 1? j Let f = -44 + 309/7. What is the closest to 3 in 3, -1/3, f? 3 Let d = -19 + 19.1. Suppose 3t - 163 = 2s, 0 = -2t + 4s - 33 + 155. Let l be (-2)/(-1) - t/21. Which is the closest to d? (a) l (b) 3 (c) 0 c Let m be 2/4 - 40/(-16). Let d be (1/22)/m. Let z = -2.6 - 0.4. Which is the closest to -1? (a) z (b) -0.2 (c) d b Let h = 15.65 + -0.65. Which is the closest to 0? (a) 0 (b) -2/7 (c) h a Let f = 5 + -5. Suppose 4w + r - 6 = 2w, -2w - 2r + 10 = f. Which is the nearest to w? (a) 0.5 (b) 5/3 (c) -0.3 a Let y = 0.037 - -0.063. What is the closest to 1 in 5, y, 1/4? 1/4 Let t(j) = -j3 - j2. Let z be t(1). What is the closest to -2 in 0.2, -1/6, z? z Let q = 8 - 17/2. Which is the closest to 3? (a) q (b) -2 (c) 3 c Let i be (-2)/3(20 + -18). Suppose 5u - 2u = 3x + 15, 5u = 4x + 20. Which is the closest to 0.1? (a) 1 (b) x (c) i a Let u = -4.2 - -4. Let b = 10 + -7. What is the closest to 1 in b, u, -0.5? u Let i = 0.82 - 0.02. Let x = i + -0.9. Which is the closest to x? (a) -1 (b) 2/13 (c) -0.1 c Let j = -197 - -205. What is the nearest to 0.3 in j, 1/8, -0.5? 1/8 Let l be (-4)/(-14) - 2/56. Let n = -0.16 + 0.4. Let g = 0.06 + n. Which is the closest to l? (a) -0.5 (b) 1/9 (c) g c Let a = 2/91 + 81/455. What is the nearest to 3/2 in -0.5, a, 0.1? a Let a = 0.2 - 0.6. Let v = 0.84 + 3.16. What is the closest to 1/2 in -1, a, v? a Let t = 0.31 - 0.01. Which is the closest to -1? (a) t (b) -0.2 (c) 0.4 b Let v be -2 - 264/(-45) - (-2 - -6). Let s be ((-24)/(-18))/(1-2). Let q = 0.3 - -1.7. Which is the nearest to s? (a) v (b) 0.2 (c) q a Suppose z + 0 + 2 = g, 3z - 2 = -g. Let i be (-3)/(-6)8/7. Let y be (-2)/(-7) + (-78)/(-21). What is the closest to z in y, 0, i? 0 Let q = 6.9 + -7. Let g = 0 + -2. Which is the closest to -2/7? (a) g (b) -2/7 (c) q b Let u = -6.4 - -6. Which is the closest to -1/3? (a) 0 (b) 2 (c) u c Let l = 0.12 - 0.02. Suppose -g - 3g = 16. Which is the nearest to l? (a) -3 (b) g (c) -1 c Let h be (-5)/30 + (-34)/12. Let s = -2.3 - -2.2. Which is the nearest to s? (a) -5 (b) h (c) 2 c Let w = -0.38 - 0.12. Which is the closest to 2? (a) w (b) 0.2 (c) 5 b Let i = 1 + -6. Let g be (4 - 6) + 14/8. What is the nearest to g in 3, 0.4, i? 0.4 Let g = 1.5 + 0.5. Let r be 36/(-16)(6 - 2). Let z = r + 19/2. What is the closest to g in 0, z, -0.4? z Let d be (10/6)/(-1) + (-38 - -40). Which is the nearest to -0.1? (a) -0.5 (b) d (c) 0 c Let l be -2 + (-9)/(-4) + (-15)/(-30). What is the nearest to -0.1 in 4, -18, l? l Let d = -83 - -85. Which is the closest to 2/5? (a) d (b) 2/7 (c) 4 b Let i = -9 + 26/3. Let p = 1.2 + -6.2. What is the closest to 0 in i, -1/8, p? -1/8 Suppose -3z - 2f = f + 6, -f + 13 = -2z. What is the closest to 0 in 1, -1.2, z? 1 Let g = -23 - -22. Let p = g - -1.4. What is the nearest to -1 in p, -1, -5? -1 Let s = -5 - -5.2. Let z = 1.4 - -2.6. Which is the nearest to 3? (a) z (b) 0.1 (c) s a Suppose 0 = -4u - 4t + 4, 5u + 0t = 4t + 5. Which is the nearest to -0.1? (a) u (b) 0.5 (c) -5/7 b Let m = 4 - 0. Let l = 0.2 - 0.3. Let c = 0.1 + l. What is the closest to 0 in m, c, 2? c Let f = -0.2 + 0.3. Let p = -23/6 + 11/3. Let u = -41/69 - -6/23. Which is the nearest to f? (a) u (b) -0.1 (c) p b Let s = 68 - 342/5. Which is the nearest to s? (a) -2 (b) 3/4 (c) -3/7 c Suppose 3f - 7 = 5v + 2, 5f - v - 15 = 0. Let q = 8.9 + -9. What is the closest to q in f, 5/2, -2/7? -2/7 Let x = -0.2 - -0.3. Let s be (474/(-32))/(3/12). Let w = 59 + s. Which is the nearest to x? (a) w (b) 2 (c) 0.5 a Let d = 0.02 - 0.02. Let r = d - 0. Let j be -2 - (-1)/2-4. What is the nearest to r in j, 2/7, -3? 2/7 Suppose 4y = -17 - 3. Let d = 1 + y. Suppose -5 + 0 = 5f. What is the closest to f in -1, -0.4, d? -1 Let c(i) = -71i*3 + 5i*2 - 6i - 3. Let r be c(-5). Let t = -180043/20 + r. Let q = t + -97/4. What is the nearest to 1/2 in -0.1, -4, q? q Let j = -2.4 - -2.4. What is the nearest to 0 in j, 1, 1/2? j Let a = 17 + -15. What is the nearest to -0.1 in 1/2, a, -4? 1/2 Let b = 0.15 - 0.1. Let g = -0.05 + b. Let x = 0.6 + 1.4. What is the nearest to 2/5 in g, x, 1/6? 1/6 Let z = 46 + -48. Which is the nearest to z? (a) 0.3 (b) -7 (c) 2 a Let o be (-15)/(-1490)2/3. Let y = o - 305/1043. Let p = -6 - -10. Which is the closest to -1? (a) 1/5 (b) y (c) p b Let n be ((-1330)/45)/7 - 2/(-9). Which is the closest to -2? (a) 0.3 (b) n (c) -0.02 c Let z = -3 - 4. Let l = 0.97 + 0.03. Which is the closest to l? (a) z (b) -5 (c) -4 c Let x = -34 + 30. What is the nearest to 0.1 in x, 0.1, 0.4? 0.1 Let w = -0.6 + 0.7. Let n = 5 + -4. What is the closest to -2/9 in n, 4, w? w Let q be ((-4)/10)/((-56)/35). Which is the nearest to q? (a) -2 (b) -1/7 (c) -4 b Let x = -19 + 20. Let j = -1.8 + 2. Let y = j - 0.1. Which is the closest to 0.1? (a) x (b) y (c) 0.3 b Let n = 41/196 - -2/49. What is the closest to 1/2 in -2/5, 3, n? n Let m = -52 - -56. Which is the closest to 0? (a) m (b) -2/3 (c) 5 b Let p(d) = -d3 + 9d*2 + 12d + 2. Let i be p(11). Let t = 758/7 + i. Which is the closest to t? (a) -1/2 (b) 2/3 (c) 5 b Let f = -0.4 + -0.1. Let x = -319/5 + 64. Which is the closest to 0.1? (a) 0.1 (b) f (c) x a Let a = 0.8 + -3.8. Let j = -1.042 - -0.042. What is the nearest to j in a, -2, 2/15? -2 Let r = 0.7 + -0.5. What is the nearest to 1/4 in r, -1/7, -5? r Let q = -77 - -80. What is the nearest to 0 in q, 0.1, 2? 0.1 Let h = -25/92 + 12/23. Suppose 1 + 4 = -w. Let i be w/(-5) - (0 - 1). Which is the closest to 1? (a) h (b) 1 (c) i b Let d be (315/126)/(5/8). Let p = 2 - 2. Let h = 0.1 - p. What is the closest to 0.2 in h, d, 2? h Let r = 11 - 15. Let v = 17 - 14. Suppose 5w - vc = -5 - 11, 3w = 4c - 14. What is the closest to 0 in r, 0.3, w? 0.3 Suppose -5 + 0 = k. What is the nearest to 2/5 in 0.1, 5, k? 0.1 Let d = -1.08 + -0.32. Let t = -1.6 + d. Let j = -25 - -45/2. What is the closest to -0.1 in t, 3/8, j? 3/8 Let y = -4.4 + 4.2. What is the nearest to 0 in y, 0.5, 4? y Let x = -0.3 + 0.1. Which is the nearest to -0.05? (a) x (b) 2/5 (c) 5 a Let q(w) = -w*3 - w - 7. Let u be q(0). Let k be 10/202/u. What is the nearest to -1 in 2/5, k, 3? k Let o = -2 + 12. Let j = o + -9.9. Which is the closest to 0? (a) 3/5 (b) j (c) 4 b Suppose -3*f = f. Which is the nearest to 3? (a) -0.5 (b) f (c) 0.2 c Let m = 138 - 1	{ "pile_set_name": "DM Mathematics" }
035436 Convert 100011010022 (base 3) to base 6. 3510012 Convert 120332331311 (base 4) to base 14. c26b1b 51321 (base 6) to base 5 204232 What is 3404501 (base 6) in base 7? 1314541 2310313011 (base 5) to base 7 61626031 Convert 331334 (base 11) to base 10. 528807 -1000001101110010 (base 2) to base 4 -20031302 Convert 25b4a (base 12) to base 15. 10504 156134 (base 11) to base 12 b8340 What is -71d56 (base 15) in base 14? -95684 -35342256 (base 7) to base 3 -12212111110100 a1159 (base 12) to base 10 209301 What is b4d60 (base 14) in base 8? 1523730 Convert -230404 (base 7) to base 10. -41017 Convert 61052 (base 11) to base 5. 10323414 What is -55201145 (base 7) in base 2? -10010000101001110011111 Convert -45b98 (base 13) to base 10. -127213 Convert -111330120 (base 4) to base 12. -44020 What is -1224320 (base 6) in base 9? -110213 What is -1244133 (base 6) in base 13? -2512b -224240212 (base 5) to base 15 -14dd8c Convert 21513550 (base 7) to base 14. 363160 Convert 41c25 (base 13) to base 5. 12243000 Convert -7133a5 (base 11) to base 14. -21bb49 Convert 1112442 (base 6) to base 16. dc0a -145fb (base 16) to base 5 -10132301 -1330303213 (base 5) to base 6 -200114023 -51a998 (base 13) to base 14 -3797d8 What is 12300554 (base 8) in base 7? 32056226 Convert -201 (base 4) to base 11. -30 What is -30444004 (base 7) in base 2? -1001101110010001100101 What is 10010001011100010101 (base 2) in base 6? 20434005 What is -21111115 (base 6) in base 5? -124201423 -5bb67a (base 12) to base 10 -1492222 Convert 220323004 (base 5) to base 16. e7918 Convert -4540590 (base 11) to base 3. -112221221101212 What is -10220200100111 (base 3) in base 11? -11a0894 Convert 16051514 (base 7) to base 6. 53015025 What is -249083 (base 10) in base 2? -111100110011111011 Convert 320420041 (base 5) to base 11. 837206 -4696b (base 12) to base 6 -2010215 Convert -37a657 (base 16) to base 3. -20212021211102 Convert 1207db (base 14) to base 10. 616221 What is 34dce4 (base 15) in base 16? 2690b6 What is -684132 (base 11) in base 14? -204b98 What is -15297a (base 13) in base 11? -325851 Convert 3d9301 (base 15) to base 5. 1224423201 What is -c4b6 (base 14) in base 11? -234a3 Convert 250712 (base 9) to base 12. 737b5 What is 100012231221 (base 4) in base 15? 585d86 What is -b0a43a (base 14) in base 4? -112223100110 Convert 1b3119 (base 13) to base 15. da19b 111121000 (base 3) to base 9 14530 1111010110111100001110 (base 2) to base 11 22aa985 100011111111110111100100 (base 2) to base 14 1379020 1011000100010101110 (base 2) to base 16 588ae What is 9e32b (base 15) in base 2? 1111010111100100111 Convert 242473 (base 15) to base 11. a81036 What is -111452 (base 6) in base 5? -300324 What is 100110011010000101100 (base 2) in base 4? 10303100230 What is -3592827 (base 11) in base 3? -102202210202020 -1646573 (base 8) to base 4 -1310311323 What is 11404241 (base 6) in base 10? 358657 What is 311311302 (base 4) in base 10? 220530 What is 1101517 (base 9) in base 2? 10010000011100011000 -aa82 (base 13) to base 16 -5cd6 665078 (base 9) to base 8 1410100 11021020222 (base 3) to base 2 10100100000110111 Convert 431479 (base 16) to base 15. 5bc86d -135552544 (base 6) to base 10 -2798704 120010221030 (base 4) to base 14 ba3a44 What is -211221111110000 (base 3) in base 10? -12193578 Convert 104b7ac (base 14) to base 6. 433205100 What is -1527014 (base 8) in base 12? -191410 Convert 3145243 (base 13) to base 6. 1253003314 -1231120300 (base 4) to base 9 -752541 What is -33552153 (base 9) in base 2? -111110000100110111100011 What is 80b61 (base 13) in base 3? 102201002022 Convert 232683 (base 16) to base 8. 10623203 What is -46643 (base 7) in base 16? -2ed3 Convert -267736 (base 9) to base 2. -100111110101011111 -31205611 (base 7) to base 2 -1010000000100110100101 8c404 (base 13) to base 16 3e62c What is 211102002022 (base 3) in base 6? 13242055 What is -323758 (base 10) in base 16? -4f0ae What is -85014 (base 13) in base 10? -239490 Convert -101031 (base 6) to base 14. -2cc3 Convert -101000001111010010000001 (base 2) to base 10. -10548353 What is -1031443 (base 5) in base 2? -100010101010100 What is -101100011100100100 (base 2) in base 9? -306650 106313106 (base 7) to base 5 3132241401 What is 255887 (base 13) in base 16? db32f What is -2775227 (base 9) in base 8? -5644340 -2222111120111 (base 3) to base 14 -2d3651 Convert -21313300011 (base 4) to base 16. -277c05 200210101111 (base 3) to base 6 11532234 Convert -42315132 (base 6) to base 5. -304120231 What is -11110011110001011110 (base 2) in base 5? -223422434 What is -173a790 (base 14) in base 8? -53504632 -50401023 (base 6) to base 5 -331243030 What is -25a145 (base 14) in base 5? -312423200 Convert -1180394 (base 10) to base 13. -324377 -1021213430 (base 5) to base 15 -2c1c2a Convert 23033115 (base 6) to base 15. ddab8 What is -1454514 (base 6) in base 16? -14d2e What is -224030 (base 5) in base 6? -101035 What is -521134 (base 7) in base 4? -111302212 Convert -107a82 (base 11) to base 8. -517224 What is -c37980 (base 13) in base 5? -2131330303 -637100 (base 10) to base 3 -1012100221022 What is 11055722 (base 8) in base 3? 11111001120221 What is 3692a3 (base 15) in base 14? 4c02c5 101512 (base 7) to base 5 1024104 What is -80d980 (base 14) in base 16? -4239ac 339737 (base 10) to base 14 8bb4d 80eb5 (base 16) to base 11 330809 Convert 203322012 (base 4) to base 8. 437206 What is 988498 (base 12) in base 15? 32c012 -2c63a (base 13) to base 10 -84549 Convert 34210411 (base 5) to base 11. 198323 2555110 (base 6) to base 2 100010001000010010 Convert -ab7065 (base 13) to base 2. -1111011010111101000011 2519a (base 11) to base 9 54545 2192c (base 14) to base 12 3b118 2bb5a (base 14) to base 16 1aac4 267b (base 12) to base 2 1000100111111 What is -14132341 (base 7) in base 11? -820aa1 What is 223100213 (base 5) in base 3? 1212011200020 1490c (base 16) to base 6 1445552 551200 (base 8) to base 3 100101201101 -220121003 (base 4) to base 3 -22101221112 1369c0 (base 13) to base 2 1110011001100011011 24b8801 (base 13) to base 16 af0c12 What is 119465 (base 14) in base 13? 180c00 What is 22303121 (base 4) in base 7? 243002 What is 222a34a (base 12) in base 5? 3132410444 -23034 (base 10) to base 3 -1011121010 Convert -372c6f (base 16) to base 10. -3615855 Convert -2a123 (base 11) to base 4. -22123302 101200220101 (base 3) to base 14 56a78 256203 (base 8) to base 14 2472b What is 6a78a (base 11) in base 10? 102101 What is 13102223032 (base 4) in base 15? 27b587 Convert f22e (base 16) to base 6. 1155010 -117497 (base 15) to base 14 -17a271 What is 17b41 (base 15) in base 2? 10010101111110010 Convert 1c2b (base 14) to base 15. 17c5 Convert 21112021111 (base 3) to base 8. 441335 What is -3729a78 (base 11) in base 14? -c0b296 Convert 22120122110222 (base 3) to base 16. 45929c Convert 10101001110001111010 (base 2) to base 12. 296536 -11010342 (base 6) to base 12 -1399b2 What is -10010111110010001 (base 2) in base 9? -127537 What is -640fb (base 16) in base 8? -1440373 What is 140433052 (base 6) in base 15? 3b0022 db36 (base 15) to base 9 70576 What is -193085 (base 12) in base 4? -1223212211 What is -416704 (base 8) in base 14? -38788 -256637 (base 9) to base 5 -14441142 2211111022022 (base 3) to base 7 15540350 76041 (base 9) to base 16 c4a2 -5313114 (base 7) to base 14 -12a044 What is 44077 (base 13) in base 16? 1e0fa What is -35452342 (base 7) in base 14? -5b9d22 What is -223223000 (base 4) in base 16? -2bac0 -3203012213 (base 4) to base 7 -10622666 What is -387522 (base 9) in base 4? -321122123 -1100100010100011010100 (base 2) to base 16 -3228d4 2057622 (base 11) to base 15 4b9749 What is -4124336 (base 7) in base 10? -493751 What is 90e27 (base 15) in base 8? 1600074 What is 13103320 (base 4) in base 5? 1424234 What is -6824a9 (base 12) in base 15? -22cb46 Convert -d862a (base 14) to base 9. -875747 Convert -11321351 (base 8) to base 15. -33ac5c 11011011110010111100 (base 2) to base 9 1621855 -10011101111001110 (base 2) to base 8 -235716 What is -69434 (base 12) in base 9? -233754 Convert -21012020020 (base 3) to base 9. -235206 -262370 (base 12) to base 16 -98d84 Convert -110102222211020 (base 3) to base 13. -14a723c Convert 11314575 (base 9) to base 10. 550	{ "pile_set_name": "DM Mathematics" }
+ 4 = 4f. Suppose 2j = 4j + 6. Let k be 45/(-15) - 1j. Solve tb + 0 - 20 = k for b. 5 Suppose 5d - 19 = 2c + 11, 2d - 2c - 12 = 0. Let h(j) = 2j - 6. Let b be h(5). Solve do - 2o = -b for o. -1 Suppose 3a - 4v - 32 = 0, 2a + 3v + 0v + 7 = 0. Solve 3o = 4o + a for o. -4 Let t be (-1)/6 + (-1772)/24. Let f = 86 + t. Solve 0x - f = 3x for x. -4 Suppose 0 = -4d + 3z + 37, -5d + z + z = -41. Let f(a) = -2a3 + 14a*2 + 10. Let k be f(d). Solve 2 - k = 2h for h. -4 Let q be -2 + (-3)/((-6)/8). Let v be ((-6)/q)/(-1) + 0. Solve -vp - 1 = 2 for p. -1 Let g = 302 - 293. Solve -gr - 41 = -14 for r. -3 Suppose x - 4u = 8, 15 = 3x - 3u - 9. Suppose 0 = -5v + 17 + x. Solve -a = -va + 20 for a. 5 Let y(s) = 5s*2 - 77s + 2. Let l(n) = 2n2 - 26n + 1. Let v(j) = 11l(j) - 4y(j). Let r be v(-11). Let d = 4 + 0. Solve -rb - 10 = -d for b. -2 Let c = 67 + -63. Solve 0u + cu = 8 for u. 2 Let s = -206 - -210. Solve -9j + sj = 15 for j. -3 Let n(j) = j3 - 9j*2 - 7j - 8. Let u be n(10). Let t = u + -20. Solve 5w = tw for w. 0 Suppose -2f + 2g = 8, 4f - f + 8 = -g. Let n be (f/(-21) + 1)(-7)/(-2). Solve s + 3 = ns for s. 1 Let t(z) = -2z + 3z - 2z + 33 + 2. Let a be t(14). Suppose 0 = -2o - 2o - p + a, 0 = 5o - 4p - 42. Solve 4n = -6 - o for n. -3 Let g(v) be the third derivative of v5/60 - v4/6 - 3v*3/2 + 22v*2. Let n be g(-2). Solve 0 = -nw - 2w + 15 for w. 3 Suppose 3w + 79d - 74d = 1, 0 = -3d - 3. Suppose -4l = -2s - 2 + 30, -5s = -4l - 16. Let i be l/6w/(-3). Solve 2h = -5 - i for h. -3 Let s = -264 - -264. Let c(t) = t2 + 8t - 7. Let h be c(-8). Let d be 2/(-7) - 37/h. Solve sv - d = v for v. -5 Let t(n) = -n - 1. Let l be t(-4). Let a(b) = bl - 4 - 1 + 4 - 2b. Let u be a(-1). Solve ux + x = 5 for x. 5 Let q be (-1)/(33/243). Let n = q - -39. Let f be (-2)/n + (-628)/(-24). Solve 5v - 6 = -f for v. -4 Suppose -5h = 5, 2s = -h + 4h + 7. Suppose -so = o - 6. Solve -o = 4t - 14 for t. 3 Let b(v) = v*2 - 2v - 2. Let t be b(3). Let r be (-1 + t)/(13 + -10). Solve r = -f + 4f - 3 for f. 1 Let f(s) = -s + 8. Let q(k) = 2k*2 - 14k + 8. Let l be q(6). Let r be f(l). Solve 2 = 5x + r for x. -2 Let a(i) = 3i - 8. Let g be a(6). Let b(w) = -2w3 - w2 + w + 3. Let s be b(0). Suppose -sk - g + 13 = 0. Solve 5c + 4 = -k for c. -1 Let d(o) = -2o*3 + 52o*2 + o - 20. Let l be d(26). Let v be 15/3 + (-6)/l. Solve 20 = -vk + 4 for k. -4 Let t = -31 - -34. Suppose 0 = tz + 6 - 15. Solve -zv + 1 = -11 for v. 4 Let o be (-4094)/(-69) + (-6)/(-9). Solve 5d - o = -7d for d. 5 Let j(a) = a*2 + a. Let g be j(-2). Suppose 7s - 10 = gs. Let p be 66/24 - 2/(-8). Solve -1 = -sq + p for q. 2 Suppose -26q - 16 = -22q. Let s be (-10)/40 + (-9)/q. Solve -sc - 12 = -6c for c. 3 Let q = -287 + 291. Solve 4a - 20 + q = 0 for a. 4 Let j(o) = o3 - 2o*2 - 2o - 2. Let c = -12 - -15. Let k be j(c). Suppose 5z - 2z - h = 1, -k = -z + h. Solve zd = d for d. 0 Let o = 17 - 20. Let y = 5 + o. Suppose 5 - 3 = yh. Solve 3s = -5 - h for s. -2 Let w = 441 + -439. Let b(i) = -9 - 8i + 3i2 - i2 - 3i*2 + 0i*2. Let y be b(-6). Solve -y = r + w for r. -5 Let z = -233 + 237. Solve 0 = -0b + zb - 4 for b. 1 Suppose -4q + 3w = -61, -2q + q + 1 = 4w. Solve qo - 10o = 3 for o. 1 Let g(h) = -9h - 92. Let x be g(-12). Solve 0 = -5z + x + 4 for z. 4 Let a(w) = w3 + 8w*2 - 11w - 15. Let x(z) = z + 4. Let j be x(-13). Let r be a(j). Solve rh = h for h. 0 Let w = 89 + -51. Let c = -33 + w. Let n be c((-6)/(-3) + 1). Solve 3i = -0i + n for i. 5 Suppose -408r + 7 = -407r. Solve 0 = -3b + 1 - r for b. -2 Let r(w) = -9w + 237. Let p be r(25). Solve -2 = -2l - p for l. -5 Let l(y) = 8y*2 + 26 - 2y - 13y2 + 4y*2. Let o be l(-6). Solve -3j = oj + 10 for j. -2 Let z = 2534 + -2426. Solve -5q - z = 22q for q. -4 Suppose 2r = 5r + 15. Let h(y) = y3 + 5y*2 - 4y - 12. Let z be h(r). Solve z = -0x + 4x for x. 2 Let n be ((0 + -4)/(-8))/(14/84). Solve nq = 7q for q. 0 Let c be -2 + 3 + -1 - -1. Let r be 3((-2)/(-3))/c. Solve -4 = rh - 2 for h. -1 Let o(i) = -16 + 19 + 30 + 7 + i. Let u(k) = 13. Let p(t) = -4o(t) + 11u(t). Let x be p(-6). Solve xg - 3g = 0 for g. 0 Suppose -140 = 5h - 19h. Suppose 4 + h = 4n + 2z, 0 = n + 2z - 8. Solve -n = a - 7 for a. 5 Suppose -6i = 4i - 30. Let x(o) = -o2 - 22o - 57. Let n be x(-19). Solve ib - 15 = -nb for b. 5 Suppose 0 = 3j + 62 - 89. Solve 5m - 11 = j for m. 4 Let y be 1(2 + -1)/1 - -4. Let o be (22/(-4) + y)-12. Solve 5n + o = -4 for n. -2 Let d = 50 - 36. Let n = -10 + d. Solve -v + 0 = -n for v. 4 Let m(s) = s2 - 10s + 11. Let p be m(9). Let z(v) = v*2 + 10v + 13. Let d be z(-9). Suppose dr + 20 = 4c, 3r + 17 = -2c + p. Solve cq = q + 3 for q. -3 Let d(w) = -w2 + 6w - 3. Let a be d(6). Let j be (-3)/(a + 1 + 1). Let q be ((-2 + -4)/j)/(-2). Solve 0 = 3v - q - 2 for v. 1 Let a = -1142 - -1148. Solve -af = 21 - 51 for f. 5 Suppose -4 = h - 6. Suppose hc - c - 5 = 0. Solve cm - 8m + 9 = 0 for m. 3 Let t = 38 + -35. Suppose -td + 1 = -11. Let s = -5 - -7. Solve 0 = dm - s + 6 for m. -1 Let d(v) = 6v*3 - 4v2 - v - 4. Let w(p) = p3 + p*2 - 1. Let u(b) = d(b) - 5w(b). Let y be u(9). Let g be 2(-1 + (-12)/y). Solve -5z - g = 19 for z. -4 Suppose -2i - 3u + 391 = 0, 0 = 5i - u + 615 - 1601. Solve 197 = 7k + i for k. 0 Let z(r) = 24r3 + r - 1. Let g be z(1). Suppose -a + g = 3a. Let y = a + -6. Solve y = -0t - 2t - 10 for t. -5 Let v(f) = -f*3 - 27f*2 + 34f + 173. Let k be v(-28). Let m be ((-9)/(-12))/((-2)/(-8)). Solve 0 = -mz + k - 2 for z. 1 Let f(n) be the second derivative of -n3/6 - n2/2 + 14n. Let s be f(-6). Solve 0 = -6g + sg - 2 for g. -2 Suppose 0 = -2a - 3a + 95. Let f = a - 17. Solve -2h - fh = 4 for h. -1 Suppose -2g + 36 = 2g. Let m(c) = 2c2 + 3c - 5. Let x be m(-5). Suppose x = 2b - 5s, 3s - 9 - 4 = -5b. Solve bi + g = -6 for i. -3 Let v be (-8)/(-2 - (-2 - -2)). Let l be 0/((-7)/(-7 + 14)). Solve l = vg - g - 3 for g. 1 Let k = -116 + 123. Solve 6x = 25 - k for x. 3 Let a = 396 - 361. Let s be (-4)/(-1)30/8. Let l = a - s. Solve -l = 5f - f for f. -5 Let q(v) = -v2 - 9v - 7. Let l be q(-10). Let s = l - -22. Solve 0 = -su + 3u + 10 for u. 5 Suppose 19 = g + 5. Let s(w) = -w*2 + 13w + 17. Let m be s(g). Solve mf + 13 = 1 for f. -4 Suppose -2m + 0m - 18 = -4h, 4m + 24 = 5h. Suppose hl = -6z + z + 35, -2l = -2z - 40. Solve -w - l = -6w for w. 3 Suppose -5q = -4l - 278, 5l - 2q + 356 = -0q. Let p = -58 - l. Solve -1 = 3k + p for k. -5 Suppose 3s = -4m + 6, -2 = -3s + 5m + 4. Suppose 0 = -3f + 39 - 36. Solve -3c + f = -sc for c. 1 Let j = 36 - 34. Let v be j + -2 + (-4)/(-2). Solve vk = 5k - 12 for k. 4 Let o(a) = -7a - 130. Let h be o(-19). Solve 0 = -hq + q for q. 0 Suppose 5 = -o + 1, 2o = -3n - 2. Suppose 0 = 2x + nx - 8, x = 4f - 6. Solve -18 = -4g - f for g. 4 Let a(k) = k*3 + 9k*2 + 19k + 9. Let z be a(-6). Suppose 0 = zw + 4w - 28. Solve wi = 5 - 1 for i. 1 Suppose 0 = 6r - 8r - 12. Let k be ((-9)/3)/(r/8). Solve -s = s + k for s. -2 Suppose 13i + 26 = 17i + 5z, 2z + 4 = 2i. Solve -19r + 15r - i = 0 for r. -1 Suppose -6762 = -39z + 18z. Solve -i = 318 - z for i. 4 Let m be 35/15(-32 - 4). Let b = m + 86. Solve -bd - 12 = -5d for d. 4 Suppose 4c = -z - z + 26, 3z = 4c - 51. Solve c = 6g + 3 for g. 1 Let b(g) = -10g - 153. Let o be b(-17). Solve -4j + 1 - o = 0 for j. -4 Let h(f) = -f2 + 5f. Let o be h(3). Suppose -r - 3 = -5v, 0 = v - 5r + 3 + o. Solve -l + 0l = v for l. -1 Suppose -7p = -3p + 4. Let d be (-4)/((-10)/6 - p). Solve 2u + d = -0u for u. -3 Let d be (-6 - -5)24/(-2). Suppose dq + 3 = 13q. Suppose 4j - 7u + qu - 8 = 0, -4j + 3u + 6 = 0. Solve jx + 2x + 6 = 0 for x. -3 Let s(l) = l3 + 3l*2 - 1. Let c be s(-1). Suppose 0 = 2j + 2x - 10, -3j + 0j - x = -7. Solve c = -v - j for v. -2 Let b = 8 + 7. Suppose -36k + 39k = b. Solve -8h + 9 = -kh for h. 3 Suppose -2i = -4x - 22, -5i = -4x - 25 - 6. Let d(z) = -z3 - 3z*2 + 4z. Let o be d(x). Solve 0a - a = o for a. 0 Let f(k) = -k	{ "pile_set_name": "DM Mathematics" }
than 144021277? 144020225.256 2 - 8.2676306066 -6.2676306066 What is 4 less than -0.261002070240684? -4.261002070240684 What is 5.18517 take away -44.10731? 49.29248 What is -1911647 take away -348395? -1563252 Work out -3636.5 + 1.32035127. -3635.17964873 Add together 129118007 and 10.4806. 129118017.4806 What is -707723 plus -0.1059237? -707723.1059237 Total of -128332.8 and -7.01153. -128339.81153 What is -690 take away -166438069? 166437379 Put together 0.067 and 157210443120. 157210443120.067 What is -84463697 less than 280? 84463977 -525628855392+0.082 -525628855391.918 What is -3.40659 take away 7127.7? -7131.10659 Add together 0.009244589286 and 0.1. 0.109244589286 What is -56716.84440972 plus 0.1? -56716.74440972 -17.51 + 0.000923440935 -17.509076559065 What is 69502 take away 1333353? -1263851 What is 0.7 plus -86955540039013? -86955540039012.3 -159646399 - 0.0636 -159646399.0636 What is 6 + 13860313606? 13860313612 What is -1198142.27 plus 15582? -1182560.27 Add together -180 and -1691.591654. -1871.591654 28430208854.961 - 3 28430208851.961 Put together -6831855 and 185676. -6646179 What is -80266.17047 minus 1708? -81974.17047 What is 252090905481 plus 1? 252090905482 What is 2711174770.55 + -0.1? 2711174770.45 Add together 21213.7 and -201120890. -201099676.3 22 - 557847945286 -557847945264 Add 7090244.0219968 and -4. 7090240.0219968 Add together 66960716.54739 and 6. 66960722.54739 Work out -77587166.19323 + -3. -77587169.19323 Total of 2573.7755 and -106.8603. 2466.9152 0.19179719+9473 9473.19179719 Sum -5745257771862 and 18. -5745257771844 Work out 0.02 - 536.58060826061. -536.56060826061 What is 107634606175212 take away -2? 107634606175214 Calculate -0.01 - 13544063.1409. -13544063.1509 What is 15.95647 less than 10764255? 10764239.04353 What is -135240 take away -96119155? 95983915 Total of 167610555 and 43.8. 167610598.8 Work out -88911 - 484999083. -485087994 Calculate 1 + -2452.5344288393. -2451.5344288393 What is -1515942262.26 minus -0.01? -1515942262.25 -16369689839 + 1.2 -16369689837.8 What is the difference between 4.445 and 103741826783? 103741826778.555 What is 230640 minus 482.706231? 230157.293769 7.5 - 5767253309207 -5767253309199.5 Work out 848368 + -20357255. -19508887 Add together 1095856553 and 10.76. 1095856563.76 What is the distance between -12.56009 and 2474? 2486.56009 What is 79354318.61 less than 2.8? -79354315.81 Sum 151 and 3.41214368. 154.41214368 What is 0.4415946166 + 5166? 5166.4415946166 What is 182563244504 take away -0.85? 182563244504.85 Add together -102038948613 and -1457. -102038950070 -0.132102+1458499 1458498.867898 43678.9+1.216742 43680.116742 What is -444422174.05 minus -0.27? -444422173.78 What is -2143 + 2.9773512696? -2140.0226487304 1.6112 + 9.6602447 11.2714447 What is the difference between -509 and 0.0389002909? 509.0389002909 What is 110.5 + -54.906935? 55.593065 Calculate -0.30240759658 + 0.24. -0.06240759658 What is -3608559.3007 minus -1.122? -3608558.1787 Subtract -315595238.64 from -2.473. 315595236.167 Calculate 3.416 + -63555635. -63555631.584 Add 45387.4 and 429234. 474621.4 Calculate -6954381794 - 60. -6954381854 Subtract -1.69 from -203692388. -203692386.31 -9343 + 318837469 318828126 Work out 1232.512 + -384854. -383621.488 What is 165 minus -87762697? 87762862 Put together 0.0317603009 and 74308. 74308.0317603009 What is the distance between 0.0418 and 299838964902? 299838964901.9582 Put together -1136 and 119087092. 119085956 What is the distance between 140815380.13862 and -9? 140815389.13862 17.4377 + 4618.2843 4635.722 What is the difference between 0.01 and 0.155322275161? 0.145322275161 Subtract -4674577 from -24467634. -19793057 Work out -38.3074618 - -492165. 492126.6925382 What is the difference between 450561964 and 0.90857? 450561963.09143 Calculate -435872 - 841.3. -436713.3 -309865406562 + 0.04 -309865406561.96 -463873593.84 - -10 -463873583.84 Subtract -19753.37 from -0.0061295. 19753.3638705 What is 29019041977.2 minus 0.5? 29019041976.7 Total of -125404496595 and -4. -125404496599 -2247 - -327511519 327509272 What is 69990 less than 13699.1? -56290.9 Add 4.5747 and 2632016. 2632020.5747 What is -2072247419.85 minus -3? -2072247416.85 What is 166.032 plus -0.232293? 165.799707 Work out -78.4112969886 - 2. -80.4112969886 What is the difference between 28672.226857 and 1337? 27335.226857 Calculate 335 + -74896690836. -74896690501 Calculate 7580954 + 37151922. 44732876 What is 16290967 less than 40.9454? -16290926.0546 Total of -57.3976105621 and 199. 141.6023894379 Add together 48427 and -0.7223812. 48426.2776188 What is 0.06608 less than 3903336843? 3903336842.93392 Calculate 719914989 + 41.37. 719915030.37 Sum 78271021323 and 0.428. 78271021323.428 What is -121.865989534 less than -1.175? 120.690989534 What is -170649910731 plus 3633? -170649907098 -79881.5431 - 10.85 -79892.3931 Subtract -2048 from -92286187. -92284139 What is 0.0781359640639 plus 0.02? 0.0981359640639 What is 388634936 minus -33992? 388668928 Subtract 118 from 35462353943. 35462353825 What is 13.2987 minus -1482995? 1483008.2987 -150 - 544913675187 -544913675337 What is -5163 minus -705.727441? -4457.272559 What is 0.5 plus 84569301954.17? 84569301954.67 9722 - 1335496993 -1335487271 What is -1.96 less than -461217708298? -461217708296.04 -2919105846+-0.587 -2919105846.587 Calculate 89.134 - -1651.55861. 1740.69261 What is 1219.52195 plus 0.043643? 1219.565593 -0.067189985095 + 1 0.932810014905 What is the difference between -607437856705 and 4? 607437856709 What is 1 take away 13.1233185748139? -12.1233185748139 Work out -2496404071990 - 1.3. -2496404071991.3 What is the difference between 1.3 and 170476.334813? 170475.034813 What is -31089821019253 take away -0.9? -31089821019252.1 Add -9343605300 and 0.00281. -9343605299.99719 2.4 - 9402889.421842 -9402887.021842 What is the distance between -0.2189 and -82084211940? 82084211939.7811 Subtract 11415.47917 from -0.1. -11415.57917 Put together 0.108 and 1.566708393389. 1.674708393389 Total of -5064.69908137 and -186. -5250.69908137 What is -1.4182 + 328304529? 328304527.5818 Work out 8750715 + 174.7. 8750889.7 Subtract -93700805993 from -0.663. 93700805992.337 Sum 12294.7 and 1.590429. 12296.290429 -218732.777 - -506 -218226.777 What is 803362677 + -5361? 803357316 Total of -11716199.63202 and -16.9. -11716216.53202 Total of -19.38192 and -1467361. -1467380.38192 Subtract -212 from -44273.581791. -44061.581791 Put together 77270 and 0.02735613. 77270.02735613 What is -158720.657 - -211005? 52284.343 -7.3221 + -18691068 -18691075.3221 Put together 132.5275768 and -326.1. -193.5724232 What is the difference between -9166422680 and 0.08? 9166422680.08 Work out -974082.9775 + -2393. -976475.9775 What is -235451 minus 5.111567? -235456.111567 What is the distance between 113 and -1005453466? 1005453579 Calculate -1724680441 - -14563. -1724665878 Subtract -13977 from 29083.3032. 43060.3032 Add together 1348910 and -0.021728. 1348909.978272 Add -33.266 and 10734.66. 10701.394 1765 + 53185454 53187219 What is -0.3047311 + 429849? 429848.6952689 -53.4594692 - 75.97 -129.4294692 What is 518 - 128390336? -128389818 452027083116962+1 452027083116963 -2506.79 - 775276529 -775279035.79 Add together 2903823987383 and -333. 2903823987050 Work out -9233776085 + -1713. -9233777798 Work out -3 - 41421995671. -41421995674 4+7979098973.689 7979098977.689 Subtract -9839.243 from -220.413. 9618.83 Calculate -2458808 - 5778350. -8237158 553397327460 - 0.1283 553397327459.8717 Calculate -9 - 34553759459198. -34553759459207 Work out -0.3710260682 - -0.006. -0.3650260682 Work out -84 + 600.6013159872. 516.6013159872 What is -81 minus 534.19135592? -615.19135592 Work out -23987760 + -7050. -23994810 Put together 0.46 and 140371228.85. 140371229.31 Subtract -2.1754009466 from -0.36. 1.8154009466 What is the difference between 46302792.6 and 1936? 46300856.6 Sum -6952859 and 0.3685. -6952858.6315 Total of -350.20348 and 2115239. 2114888.79652 Calculate 0.2 - 137728661969. -137728661968.8 What is -2048329086 minus -106? -2048328980 What is 30.32 minus 27666470766? -27666470735.68 Calculate 49.2507389 - -9.9. 59.1507389 What is -65.697 - 0.07128208? -65.76	{ "pile_set_name": "DM Mathematics" }
1 = -8828 for i. -4 Solve 4g + 70 = 18l, 4452l + 4g = 4447l + 45 for l. 5 Solve -36z = 19z - 3x + 222, 3x + 39 - 81 = -5z for z. -3 Solve -3b = -3q - 168, 2b - 55 = -89q - 85q + 175q for q. -57 Solve -g = -2s - 29176 + 29202, -2g + 5s + 18 = 6s for g. 2 Solve 0 = -59d + 61d - 2 - 2, 3h + d - 102 = 26 for h. 42 Solve 4y = 3w - 3 - 3 + 1, 23w - 26 = 43 for y. 1 Solve 4d + 8318 - 8508 = -6t, -2d = -44t + 1362 for t. 31 Solve i + 15754d - 15753d - 1 = -0i, 4d + 14 = 2i for i. 3 Solve 5l - 5 = 2p + 1, 30p - 51p + 22p = -140l + 567 for p. 7 Solve 0 = -5b - 15, -128 = 9j - 4j + 2b - 132 for j. 2 Solve 5i = 4s + 61, 1043s - 4i = 1039s - 56 for s. -9 Solve 3d - 46 = -4j, 6813399d - 3j = 6813397d + 25 for d. 14 Solve 0 = k + 31t + 76, -k + t + 14 = -2t - 36 - 10 for k. 48 Solve h + 5 = 2v, -8 = -3h + h + 68v - 69v - 3 for h. 1 Solve 0 = -2x + 5o + 18, 0 = x + 3478o - 3474o - 35 for x. 19 Solve -30a - 4p = -64a - 298, -2a = -a - 4p + 133 for a. -5 Solve -4c + j + 3 = 2j, -7c + 18j - 5j - 11j = -69 for c. 5 Solve 1 = -q + 2, 352g = 356g + 4q for g. -1 Solve h + q = 27, h + 322q + 332q - 651q - 47 - 40 = 0 for h. -3 Solve -4j + 67 = 3i, -10j + 110 = -7i + 10i - 35 for i. 5 Solve -99545s - 5m = -99544s + 49, 9s = 5m - 191 for s. -24 Solve 5l - 59 = 4h + 75, -1072 = 30h - 4l - 0l for h. -36 Solve -26 = -4o - 2l, 0l + 41 = 14o + 3l - 62 for o. 8 Solve -100p + 549p + 26142 - 15027 = -s - 19862, -5p + 5s = 365 for p. -69 Solve -13q + b = -22q + 41, 4q - 10b = 60 for q. 5 Solve 2562n + 67 = -v - 2563n + 5128n, -n + 19 = 3v for v. -1 Solve 0 = -9b + 14b - 3w - 7, -50w = 5b + 201 - 261 for b. 2 Solve 0 = -5m - 20, -19868d + 19865d + 40 = -4m for d. 8 Solve 0 - 10 = -5y + 2u + 29, 81y - 571 = 2u for y. 7 Solve -6s - s - 4o = -s - 4, 4o = -2s - 12 for s. 4 Solve 3c + 0c = -4n - 38, -1500n - 6733c - 11998 = -6734c for n. -8 Solve 5n - 2p = 10, 5306 - 5281 = -43n - 5p for n. 0 Solve 11u + 25 - 67 = 3w, -140w + 138w = -5u + 21 for w. -3 Solve 2o - 5h = -2, -3o + 35 = -60833h + 60835h for o. 9 Solve 13o - 24372r + 12186r + 12181r = 423, 0 = -r + 2r + 82 for o. 1 Solve -a + 5i - 33 = 0, a - i - 442 + 455 = 0 for a. -8 Solve 2z + 33f - 49f = -13f - 14, 5z - 2f = 9 for z. 5 Solve 2y - 1 = -67q + 68q, -6q + 6y - 8 - 4 = 0 for q. -3 Solve w = -376i + 371i - 51, -3539 = -3i + 77w for i. -1 Solve k = 6k - 10a, 11k + 45 = 2a - 2 + 7 for k. -4 Solve 0 = 6m + 4g + 379 - 613, -m + 25 - 95 = -3g + 122 for m. -3 Solve 37 + 2 = -2h - 2o + 5, 0 = 2h + 77o + 1084 for h. -3 Solve t + 6t - 18t - 5i + 40 = 7t, -23i = 2t - 184 for t. 0 Solve -4792d - 4792d - 4796d + 2z + 6 = -14384d, -5d = 14z + 88 for d. 2 Solve 10s - 2t - 750 = -4s, 20s + 5t = 18s + 7t + 114 for s. 53 Solve 120s + 33 = -g + 110s, -9 = 2g + s for g. -3 Solve -20v + 2j + 31 = -25v, -v = 5j + 20 for v. -5 Solve 4s + 54r = 262, -3r = -s - 8901 + 8884 for s. -2 Solve 972j - 4p = 975j - 194, -5j + 2p + 280 = 0 for j. 58 Solve 5s = 15y + 120, 3s + 297 = -5559y + 5527y for s. -3 Solve 123 = 2b - 58v + 73v, -b - 34v + 5 = -35v - 14 for b. 24 Solve -45q - 3x = 174, 393q + 3x + 27 = 780q - 383q for q. -3 Solve 7827y - 7824y + 105 = -4h, 118 = -4y + 2h for y. -31 Solve -68t + 247t + 5w = -890, t = -5w for t. -5 Solve 2t - 5l - 61 = 0, 37031l - 37035l + 164 = 6t for t. 28 Solve -5v = 5s - 30, -v - 10594s - 7 + 97 = -10581s for v. -1 Solve -134141a + 1232 = -134141a + 2m - 46m, a - 137 = 5m for a. -3 Solve -5674224h = -5674221h + 2b - 11, 3h = 5b - 17 for h. 1 Solve 0 = -2v + 5s - 142, 79v - 5s = 75v - 134 for v. 4 Solve -3w + 24 = 0, 503745v - 503751v - w = -32 for v. 4 Solve -2f = -92r + 179r - 88r + 10, 5f - 3r + 26 = 0 for f. -4 Solve -2y + 97 = -2d + y - 4y, -82d + 71 = -83d - 5y for d. -46 Solve t + 14 = r, 17123r - 2t - 10 = 17122r for r. 18 Solve u + 39d - 38d = 2u + 9, -10u - 2d = -30 for u. 1 Solve 29 = 4j + 5x - 10x, -132x - 26 = 11j - 134x for j. -4 Solve 5c + 2y - 19901 = -19914, 0 = c - 6y - 23 for c. -1 Solve -177 + 493 = -26w + 5t - 412, 28 = -w - 2t for w. -28 Solve 7g - 2g = -2b + 3b + 4b + 15, -5g + 15 = 4b for g. 3 Solve 14 = -7p, -6196 + 5950 = 22m + 2p for m. -11 Solve 4a - 973c = -490c - 484c + 16, -3a - 3c + 3 = 0 for a. 5 Solve 59k - g = 42k + 20k + 11, 6k = 4g + 26 for k. -1 Solve 0 = 3p + 35y - 228, 16p - 13p + 22 = 6y + 4 for p. 6 Solve 0 = 3a + r - 6, -5a + 3r = 71056 - 71066 for a. 2 Solve -5b + 3w - 6308 + 6334 = 0, -8 = 5b - w for b. -5 Solve 3j - 162 = -9k, -k + 9792j - 190 = 9787j for k. 5 Solve -50t + 130 = -3l - 48t, t = -44l + 45l - 4t + 52 for l. -42 Solve 5i - 275 = 10102y - 10097y, 5i + 30y - 205 = 0 for i. 53 Solve -27 + 70 = -21c + 5q, 0 = -37c - q - 115 for c. -3 Solve 22z - 5 = 3m + 83, 2m + 0z - 4 = -m - z for m. 0 Solve -322v = -337v + 4p - 175, v = 7p - 180 for v. -5 Solve 4u + 43 = -g, 738g - 372g + 3u - 100 = 371g for g. -23 Solve c + 44 - 41 = 6g - 192, 6 = 2c for g. 33 Solve -5m = -112l - 6587 - 1905, -l - 4l + 5l - 3m - 12 = 0 for l. -76 Solve n + 6l + 180 = 10l, -12n - l + 24 = -7n for n. -4 Solve -5d - 6342q + 6331q = 9, 2d + 13 = 5q for d. -4 Solve -3j - 1073 + 1048 = x, 0 = 6x + 4j + 206 for x. -37 Solve -12s - 31131 = 3z - 30990, 2s - 4z = -46 for s. -13 Solve -16 = 5q + 4x, -q - 9x + 2869 = 2946 for q. 4 Solve 4z - 96 = 8g, 5g + 11g + 2z = 14g - 18 for g. -11 Solve 4n - 68081z + 55 = -n - 68080z, -n - 5z = -15 for n. -10 Solve -y + d = -3d + 12, d + 10 = -8y + 5y for y. -4 Solve -2y + 5p = -92, -p - 1000052 = 12y - 1000666 for y. 51 Solve 5y + 30 = 5y + 15m, -y - 2m = -4m - 5 + 7 for y. 2 Solve -3w = -2i + 17, 5w - 4137 = -4i - 4180 for w. -7 Solve -2d = 4t - 21977 + 21987, 4t - 16d - 80 = 0 for t. 0 Solve 41599i - 41598i + 5l = -8, -24i = 3l - 159 for i. 7 Solve -4h + 116 = 133j - 113j, h - 5 = 3j for j. 3 Solve 81i - 65 = -2h + 79i - 61, 5i - 18 = -3h for h. -4 Solve 156 = -38v - 2p + 16, 0 = -5v + 16p - 18p - 8 for v. -4 Solve -2q + 4v = -5q - q - 8, -72474q + 72471q - 14 = -v for q. -4 Solve 21l - 23l + 2m - 6 = 5m, 6l + 182 = 3m + 164 for l. -3 Solve -141b + k - 30 = -282b + 140b, -42 = -2b + 4k for b. 27 Solve -10o + 2o + 11o = 6o - 17k - 195, 0 = 3o + k + 21 for o. -3 Solve -4r + 3l - 138 + 117 = -0r, 31r - 47r + l = -8 + 15 for r. 0 Solve -12x - 9530y + 4767y + 6 = -4764y, -y = 7x + 6 for x. 0 Solve 6d + 4321h = 4319h + 262, -3d + 2h = -134 for d. 44 Solve -15a + 11a - 6 = -18r, -383a - 6 = 3r - 386a for r. 1 Solve 5c = 7g - 71, -42c = 127g - 68g - 61g - 134 + 560 for g. 3 Solve -2u - 872 = -31k, 0 = -7u - 148k + 152k - 126 for u. -2 Solve -5x = -t + 99, 0 = 4x + 13015t - 13010t + 85 for x. -20 Solve -7p - 3r = -11 - 3 - 11, -5p + 4r - 19 = 0 for p. 1 Solve 3x - 53 = -5k, -18x + 8k + 5k = 8k - 178 for x. 11 Solve 6q - 67r = 4q - 12r + 597, -7q - 39 = r for q. -4 Solve -4t = -56, -13940g + 13936g - 34 = -3t for g. 2 Solve -3q + 25 = -37i, 5i + 182 = -q + 173 for i. -1 Solve -1077y + 1074y = -2k - 37, 61y - 59y - 16 = -3k for k. -2 Solve 0 = -w - c - 211 + 185, 2w - 7c - 227 = 0 for w. 5 Solve -4l + 7g - 3g = 56, 7l + 5g = -12l - 266 for l. -14 Solve -132t - 992 = 185q - 189q - 188, -t + q - 33 = 4t for t. -6 Solve -25k + 19k = -2a - 1 - 15, 4a = 5k - 25 for k. 1 Solve 112n = 115n - o - 5 - 21, n = 160o - 630 for n. 10 Solve 5g - 69 = 4l, -90g + 294g - 90g - 66 = l + 103g for l. -11 Solve 2u + n + 2492 = 2438, -u - 3u + 0u + 5n + 256 = 0 for u. -1 Solve 76s - 80s + w = 0, 10s = -17w + 14w - 110 for s. -5 Solve -22t - 33 = 12l + 23t - 48t, -5t = -2l - 55 for l. 0 Solve 164n - 29 = -3v + 160n + 10, 5v - 33 = 4n for v. 9 Solve -68397b + 68402b - 4u = -28, -5u = -10 for b. -4 Solve 4x + 3y + 101 = 0, 31x - 30x + 426 = 11y + 812 for x. 1 Solve 3p - 3b + 42 = 0, 1672p - 1667p + 25 = -4*b for p. -9 So	{ "pile_set_name": "DM Mathematics" }
= 447p for u. -2 Solve 5r = -2x + 12, 27x - 30x - 16 = -r for r. 4 Solve -2f = -5y - 0f - 8, 3y + f = 4 for y. 0 Solve -57c + 4s = -61c + 4, -3c = 4s - 6 for c. -2 Solve -5y + u = -3, 5y + u - 15 = 6u for y. 0 Solve 0h + h + 3v - 11 = 0, -3h - v = -17 for h. 5 Solve -5y + 38 = -3w + 8, -w + 1 = 2y for w. -5 Solve 32 = -9s + 14s - 4r, 5s - 3r - 29 = 0 for s. 4 Solve 3c = 3u + 2c + 4, 0 = u - c for u. -2 Solve 3m + 2n = -116 + 112, 24 = -5m + n for m. -4 Solve 3b - 10 = b - 2s, 5 = b + 2s for b. 5 Solve -2b - 7 = -3l, 0l + l - 24 = 5b for b. -5 Solve 0 = -n + 4j + 9, -3n + 2j - 3 = -0 for n. -3 Solve -v + r = 5, -16 = 5v - 2r - 3 for v. -1 Solve -74r = 3l - 71r + 6, -6 = -2r for l. -5 Solve -a - 3g + 14 = 10, a = -5g + 8 for a. -2 Solve 4j + 3g - 5g + 28 = 0, 5j = -2g - 17 for j. -5 Solve -v - 2m - 1 = 0, 24v - 3m - 29 = 20v for v. 5 Solve -4s - 2r + 0r - 10 = 0, -4s - 7 = -r for s. -2 Solve -2p = -2q + 4, p + 2q - 2 - 2 = 0 for p. 0 Solve 4i = -3h + 15 + 14, -4h - 13 = -5i for h. 3 Solve 69w + 3 = 68w + a, 2a = -3w - 9 for w. -3 Solve 2a - 2x + 4 = 0, -9x - 10 = -14x for a. 0 Solve 4b = 10y - 15y + 11, -2b = 2 for y. 3 Solve -x + 6 = 29t - 34t, -2t = -5x + 30 for t. 0 Solve 0 = 2n + 2d - 14, 3 = 4n - d - 15 for n. 5 Solve -2s - 2u + 6 = 0, 67s + 2u + 3 = 68s for s. 3 Solve 5i - 15 = 0, 2f + 2 = -0i + 2i for f. 2 Solve 4u - 3f - 6 = -14, -2u - 4 = -5f for u. -2 Solve -h = -3l + 9, 8 + 8 = 4l for h. 3 Solve 0 = 2y + 2 - 6, -2y + 12 = -2a for a. -4 Solve 0 = 3u + 2j + 7, -u + 2 = -j - 4 for u. 1 Solve -5f + 14 = -n, -8 = -6f + 8f + 3n for f. 2 Solve 4o - 5 = -5x, 15o = -3x + 18o - 24 for x. -3 Solve 16s - 11 = 19s - 5u, -4u + 12 = -4s for s. -2 Solve -l - 98 + 102 = c, 0 = 5c - 5l + 10 for c. 1 Solve 5u - 7 = -3b, 3u - 71 + 38 = 3b for u. 5 Solve -4x - 8 = 0, 4k - 4x = 5 + 11 for k. 2 Solve -h + 18 = -4g, 1 = -5g - 24 for h. -2 Solve y + 25 = -4m, 5y + 0y + 10 = 3m for y. -5 Solve 0 = 3r - 4s - 9, 5r - 10 = -2s - 21 for r. -1 Solve -5y + u = 11, 1 = -y - u - 0 for y. -2 Solve 0x = -5x - 4a - 22, -4a - 8 = -2x for x. -2 Solve 3r - 10 = 5m - 0, -3m - 5r = 6 for m. -2 Solve 2h = 5h - 3d + 15, -5d + 34 = 4h for h. 1 Solve 5n = -p - 17, 2n + 6 = -0 for p. -2 Solve 0x + x + 3f - 10 = 0, 4 = 2x + 2f for x. -2 Solve 3v = v + 2, 4y - v + 9 = 0 for y. -2 Solve 2j = -8, 0 = -0u - 3u + 2j - 4 for u. -4 Solve -4q = -4o, -56q + 59q = 2o + 4 for o. 4 Solve 5q = 25, 5a + 14q = 16q + 15 for a. 5 Solve -39n - 4 = 2h - 37n, 0 = -3n + 3 for h. -3 Solve -q + 6c + 17 = c, 4 = -c for q. -3 Solve 5s - 1 = 4c + 19, -2c + 20 = 5s for c. 0 Solve -p - 29 = 5g, -19 = -4p + 3p + 3g for p. 1 Solve -8 = -5b + 2b + k, 5k + 21 = -4b for b. 1 Solve 0 = 3i - t - 0t - 14, i + 3t = -2 for i. 4 Solve -8 = -5b - 2d, 2b = 4d + 19 - 11 for b. 2 Solve -2n + r = -r + 10, -13 = 5n - 2r for n. -1 Solve -4k + 0 - 23 = -3x, -11 = 3k - x for k. -2 Solve -4m - 16 = -4t, -m = 3t - 7 - 5 for m. 0 Solve -4l + 2 - 14 = 0, 2l = -3s + 6 for s. 4 Solve 0 = 2q - p + 9, 59 = 4q + 3p + 52 for q. -2 Solve -2s = -5g + 27, -g + 6g + s - 24 = 0 for g. 5 Solve 2a - 30 + 38 = 0, 4h - 4a - 36 = 0 for h. 5 Solve u + 7 = -2m - 2, u + 3 = m for u. -5 Solve 0 = -3u + 4a - 12, 2u + 4a + 0a - 12 = 0 for u. 0 Solve 3c = 2r - 1, 12 = -2c - 3r - 6 for c. -3 Solve 3m + 0 = -2r + 19, r - m - 2 = 0 for r. 5 Solve -2i - 2r = 2i + 2, -5i + 3r + 3 = 0 for i. 0 Solve -5f = k - 30, 21 = 4f + 1 for k. 5 Solve -4g + 6 = -v, -v - 14 = -2g - 12 for g. 2 Solve -3y = -5a - 34, -2y - y - a + 4 = 0 for y. 3 Solve 2y = d + 8 - 0, 0 = -y - 4d + 13 for y. 5 Solve s + 8 = l, 5l + s - 20 = 2l for l. 7 Solve 3j = g - 3g - 2, -3j - g = -2 for j. 2 Solve 5y = -c + 29 - 2, 0 = -5c + y + 5 for c. 2 Solve 2s - 3 = 3m + s, 3m + 18 = -4s for m. -2 Solve 0 = -4r - 3t - 15, 4 = -4r + 2t - 6 for r. -3 Solve -2b + 0k - 14 = -2k, -5k + 5 = b for b. -5 Solve -3m - q - 1 = 0, 9m - 11 = 14m - 3q for m. -1 Solve 2g = 2z + 16, 3g + 8z - 6z - 9 = 0 for g. 5 Solve d + 4 = j + 13, 0 = j + 4 for d. 5 Solve 4j + 4v + 8 = 2j, 10 = 4j - 5v for j. 0 Solve -i + 2 = 0, -i - i + 9 = -s for s. -5 Solve 0 = -3d + 7b - 8b + 14, -19 = 2d - 5b for d. 3 Solve -2h = 4n + 8, 3n + 17 = 2h - 3 for n. -4 Solve -5 = -r + q - 2, -5q - 16 = -4r for r. -1 Solve b + 2a + 6 = 3b, -2b = a - 12 for b. 5 Solve -v - 5u + 9 = 0, 367 - 392 = -5v - 5u for v. 4 Solve 2u + 2 = 0, -m = 3m - 5u - 17 for m. 3 Solve 4 - 5 = b + w, -3b = -2w - 17 for b. 3 Solve x + 4 = -2i, -12 + 8 = 2x + 3i for x. 4 Solve -4o = -2x - 16, 0o - 3x + 26 = 4o for o. 5 Solve 5d + 6 = 2d + 3p, 5d - 26 = -4p for d. 2 Solve -5v + 7v + 5d = -8, -4v + 4d = 16 for v. -4 Solve -4b - 2 - 8 = 2m, -3b + 3m - 21 = 0 for b. -4 Solve 4o + p = 5, -4o - 6 = -2p + 4 for o. 0 Solve -3f - 3 = 0, u + 8 = -2u - 5f for u. -1 Solve 4z + z = -4x + 6, 5x - 22 = z for x. 4 Solve -3r + 1 = -2i, -r - 5i + 2i = 18 for r. -3 Solve -5w - 20 = 5u, -2u + w + 0w + 7 = 0 for u. 1 Solve 15a - 12a - 4 = -5s, 3s = -a for s. -1 Solve -4g - 9 = 5l, -g + 2g = -3l - 4 for g. -1 Solve 2a - 4n = 6, -5n = -0n + 10 for a. -1 Solve -5g - v + 18 = -2v, 0 = -3g + v + 10 for g. 4 Solve 4d + 2t + 10 = 0, t + 3t - 8 = -d for d. -4 Solve 3s - 213y + 209y + 4 = 0, 2s + 4 = 4y for s. 0 Solve 3o - 6 = 24t - 25t, -4o = -4 for t. 3 Solve 0 = m - 3c + 4c, 0 = -3m - c for m. 0 Solve -5t - 11m + 28 = -8m, 3t - 19 = -4m for t. 5 Solve -t + 4m - 9 = 0, 15t + m + 1 = 12t for t. -1 Solve 5x + 4a = -9, -4x = a - 0 + 16 for x. -5 Solve a + 14h - 9h - 19 = 0, 3h = -2a + 3 for a. -6 Solve 0 = -g + 2v + 5 + 1, -2 = -g - 2v for g. 4 Solve 22 = -m + 5n, 2n = 4m - 8m for m. -2 Solve -5b - 3 + 28 = 5t, 0 = -3t - 4b + 15 for t. 5 Solve -m = 5o - 10, 4m - 87o = -88o + 2 for m. 0 Solve 2x + 2v = -2, 0 = -0x + 2x - v - 4 for x. 1 Solve 4c - 8l + 9l + 11 = 0, 0 = -3c - 3l + 3 for c. -4 Solve -3r - 15 = 0, -6q - 2r = -13q + 38 for q. 4 Solve 5s + 20 = 4x, 2x = -119s + 114s - 20 for x. 0 Solve 0 = -4x - 5n - 4 - 13, 3x + 13 = -4n for x. -3 Solve 0 = 4q, q = -7l + 2l + 5q for l. 0 Solve 29h - 2 = 3j + 31h, 0 = -3j - h - 4 for j. -2 Solve 0 = -4b + 8, 3s - 3b = b + 7 for s. 5 Solve -y + 15 = 6f - 4y, -3f + 15 = -4y for f. 1 Solve 0 = -2d - 5h + 11 + 4, d - 6 = -2h for d. 0 Solve t = -3w - 8, 2t = 5w - 5 - 0 for t. -5 Solve 3x - 2m = -2, -3m - 14 = 5x + 21 for x. -4 Solve 16t + 3r + 23 = 18t, 5t + 3r = -16 for t. 1 Solve -52o = -50o + 3q - 9, 24 = -3o + 3q for o. -3 Solve 3s + 3m = 7s - 27, -3m = -3s + 24 for s. 3 Solve -11 = -z - 5c - 1, -2c = -2z - 16 for z. -5 Solve -3a = k + 16, -5a - 4k - 32 = -a for a. -4 Solve -c = -m - m + 3, -2c - 2m + 6 = 0 for c. 1 Solve -5 = -2x + 2r + 3, -2x - 7 = r for x. -1 Solve 4b - 6u + 3u + 13 = 0, 2u = -2 for b. -4 Solve 3r = -3q - 24, 5r - 4q + 9 = -4 for r. -5 Solve 5o - a = 21, 2o - 4a - 4 = -2o for o. 5 Solve -d - 4 = -5q + 1, 3q = -d - 5 for q. 0 Solve -2x = 5t + 10, 5t - x - 2x = 15 for t. 0 Solve -v = -5w - 25, 0 = 2w + 36v - 31v + 10 for w. -5 Solve -4p + 31 = o + 10, -4o - 4p = -36 for o. 5 Solve -14 = -3d + 4p - 26, 0 = 5d + 3p + 20 for d. -4 Solve 13 = -5i - 4j, -6i + j - 28 = -i for i. -5 Solve -3z = 3q, -1 = -q + 1 for z. -2 Solve -4p - 20 = 3i + 11, 5i + 5p + 45 = 0 for i. -5 Solve -g - 23 = -4a - 26, -2a + 4g - 12 = 0 for a. 0 Solve 0 = -o + 35p - 39p + 18, 4p - 24 = 2o for o. -2 Solve 4l + 29 = 5n, -8n + 2l = -7n - 7 for n. 5 Solve 0 = -3p - 15, -2p - 13 = -g - 0p for g. 3 Solve 3w + 5o - 35 = 0, -w - 5o + 21 = -o for w. 5 Solve 5 = 3i - 2r, 47 - 17 = 3i + 3r for i. 5 Solve -3f = 12, x + f + 2 = -2 for x. 0 Solve 4y - 15 = -3n + 2y, 4y - 15 = -3n for n. 5 Solve 6 = -a + t + 3t, 4t = -2a for a. -2 Solve -5h = 2r - 10, 14h - 13h = 5r + 2 for r. 0 Solve -v = 5x - 24, -5v + 8v = 2*x - 13 for v. -1 Solve -v	{ "pile_set_name": "DM Mathematics" }
eplacement from {c: 6, w: 2, k: 4, z: 3}. Give prob of picking 3 c and 1 z. 4/91 Calculate prob of picking 3 t when three letters picked without replacement from tdidttitdt. 1/12 Two letters picked without replacement from hmfmo. What is prob of picking 1 h and 1 m? 1/5 What is prob of picking 1 s and 1 r when two letters picked without replacement from {h: 4, s: 1, x: 3, r: 5}? 5/78 What is prob of picking 2 z when two letters picked without replacement from {b: 2, z: 6}? 15/28 What is prob of picking 1 m and 1 a when two letters picked without replacement from jmummmamlmmmmjumamm? 8/57 Two letters picked without replacement from ssqssqqsqqqq. Give prob of picking 1 s and 1 q. 35/66 Four letters picked without replacement from {s: 1, o: 5, q: 3}. Give prob of picking 1 q and 3 o. 5/21 Four letters picked without replacement from {e: 5, z: 4, q: 1}. What is prob of picking 2 e and 2 z? 2/7 Three letters picked without replacement from uzuuuzuzuuuuzuuuuuzu. Give prob of picking 1 z and 2 u. 35/76 Four letters picked without replacement from jjjjbjjjjjb. Give prob of picking 4 j. 21/55 Four letters picked without replacement from vvmmjmjjjjvmjjvmjjpj. Give prob of picking 3 j and 1 v. 32/323 Three letters picked without replacement from {b: 2, u: 9}. What is prob of picking 1 u and 2 b? 3/55 Two letters picked without replacement from xyvus. What is prob of picking 1 s and 1 v? 1/10 Two letters picked without replacement from jja. Give prob of picking 2 j. 1/3 What is prob of picking 2 d and 2 j when four letters picked without replacement from {j: 5, d: 14}? 455/1938 Calculate prob of picking 2 o, 1 j, and 1 n when four letters picked without replacement from {j: 1, n: 2, o: 3, v: 1}. 6/35 Two letters picked without replacement from {c: 2, v: 6, g: 4}. Give prob of picking 2 c. 1/66 Three letters picked without replacement from {l: 4, z: 16}. What is prob of picking 3 l? 1/285 Calculate prob of picking 2 k when two letters picked without replacement from kwwkuyqwwquqweq. 1/105 Four letters picked without replacement from {y: 2, x: 11}. What is prob of picking 1 y and 3 x? 6/13 Three letters picked without replacement from miigigimigmggqigi. What is prob of picking 1 q and 2 i? 21/680 Calculate prob of picking 1 c, 1 k, and 2 h when four letters picked without replacement from yhccfcyccfchckkhkfk. 7/323 Calculate prob of picking 1 m, 2 g, and 1 f when four letters picked without replacement from ggfggmzjg. 5/63 What is prob of picking 1 k, 1 h, and 2 n when four letters picked without replacement from {q: 2, h: 1, k: 4, f: 1, n: 3}? 2/55 Two letters picked without replacement from {s: 1, y: 6, r: 10}. Give prob of picking 2 y. 15/136 Two letters picked without replacement from ssnic. Give prob of picking 1 n and 1 i. 1/10 Two letters picked without replacement from qccqqqqqq. What is prob of picking 2 q? 7/12 Calculate prob of picking 4 a when four letters picked without replacement from oxapppxaaxppxpoaopi. 1/3876 Two letters picked without replacement from zvz. Give prob of picking 2 z. 1/3 Three letters picked without replacement from wwwweeweweew. Give prob of picking 2 e and 1 w. 7/22 What is prob of picking 3 q when three letters picked without replacement from qqqqqqiqqqiqq? 15/26 Four letters picked without replacement from zzzs. What is prob of picking 2 s and 2 z? 0 Two letters picked without replacement from ommoomoomm. Give prob of picking 2 m. 2/9 Calculate prob of picking 1 p and 2 v when three letters picked without replacement from {v: 3, p: 3, i: 2}. 9/56 Calculate prob of picking 1 f, 1 l, 1 y, and 1 n when four letters picked without replacement from {f: 1, y: 1, r: 1, n: 1, l: 3}. 3/35 Two letters picked without replacement from zppizznxzznxinzxrx. Give prob of picking 1 r and 1 i. 2/153 Calculate prob of picking 1 d, 2 y, and 1 m when four letters picked without replacement from ddayaddmmdyy. 2/33 What is prob of picking 1 i and 1 m when two letters picked without replacement from {m: 3, i: 7}? 7/15 Three letters picked without replacement from yooyyoooyoooooyooo. What is prob of picking 2 y and 1 o? 65/408 Calculate prob of picking 1 q, 1 v, and 2 s when four letters picked without replacement from {b: 1, v: 2, q: 3, s: 4, o: 1}. 6/55 Three letters picked without replacement from {i: 2, h: 1, v: 1, p: 4, n: 3, a: 1}. What is prob of picking 1 h, 1 a, and 1 n? 3/220 Three letters picked without replacement from yyyyyllylyy. Give prob of picking 2 l and 1 y. 8/55 Calculate prob of picking 1 g and 2 l when three letters picked without replacement from {g: 16, l: 4}. 8/95 Three letters picked without replacement from qrqcrrrqqrcrcrqcrqqq. Give prob of picking 1 q and 2 c. 4/95 What is prob of picking 2 u and 1 l when three letters picked without replacement from {l: 5, u: 7}? 21/44 Four letters picked without replacement from xxvvcxxxxxxxcxx. What is prob of picking 3 x and 1 v? 22/91 Two letters picked without replacement from {e: 6, v: 6}. Give prob of picking 1 e and 1 v. 6/11 Four letters picked without replacement from ddrnnrddd. What is prob of picking 2 d and 2 n? 5/63 What is prob of picking 1 w and 2 z when three letters picked without replacement from gygzwizhy? 1/84 What is prob of picking 3 c when three letters picked without replacement from {z: 1, c: 2}? 0 Two letters picked without replacement from jrjj. What is prob of picking 1 r and 1 j? 1/2 Three letters picked without replacement from umuxmxxm. Give prob of picking 1 u and 2 m. 3/28 Calculate prob of picking 1 v and 3 j when four letters picked without replacement from ejjqevvevqvjvvvejj. 7/306 Two letters picked without replacement from kvxgkgvkkxgkggvgg. What is prob of picking 1 g and 1 x? 7/68 Four letters picked without replacement from {j: 4, r: 6}. What is prob of picking 3 j and 1 r? 4/35 Two letters picked without replacement from eeief. What is prob of picking 1 f and 1 i? 1/10 Two letters picked without replacement from {d: 5, j: 5}. What is prob of picking 2 j? 2/9 Four letters picked without replacement from nnrdcnr. What is prob of picking 1 n, 1 r, 1 d, and 1 c? 6/35 Calculate prob of picking 2 c and 1 l when three letters picked without replacement from {l: 2, q: 1, o: 3, c: 4, n: 1}. 4/55 Three letters picked without replacement from sssssss. What is prob of picking 3 s? 1 Three letters picked without replacement from qlqlllwlqllllwqwlplq. Give prob of picking 1 l and 2 q. 11/114 Two letters picked without replacement from {l: 1, r: 1, n: 2, i: 1, f: 2, s: 1}. What is prob of picking 1 l and 1 i? 1/28 Three letters picked without replacement from heababhoakha. Give prob of picking 1 e and 2 a. 3/110 What is prob of picking 1 f, 2 b, and 1 u when four letters picked without replacement from {j: 1, s: 3, a: 1, b: 6, u: 3, f: 4}? 1/17 What is prob of picking 1 p and 2 u when three letters picked without replacement from ppuppoouuopuupoupu? 49/272 What is prob of picking 1 m and 2 p when three letters picked without replacement from mmpmppppmrmmmmmmm? 11/68 Two letters picked without replacement from {k: 1, p: 4, t: 2, l: 2, r: 10}. What is prob of picking 1 l and 1 r? 20/171 Four letters picked without replacement from {v: 10, g: 4}. What is prob of picking 1 g and 3 v? 480/1001 Four letters picked without replacement from ttzztztztztwkzkzkz. Give prob of picking 4 z. 7/306 Two letters picked without replacement from dddodddxddxdoood. Give prob of picking 1 d and 1 x. 1/6 Three letters picked without replacement from {v: 1, m: 1, e: 1, u: 6, i: 3}. Give prob of picking 2 i and 1 m. 3/220 Two letters picked without replacement from {p: 1, n: 7, s: 1}. Give prob of picking 2 p. 0 Three letters picked without replacement from ncrrmec. What is prob of picking 1 e and 2 c? 1/35 Calculate prob of picking 1 y, 1 r, 1 m, and 1 v when four letters picked without replacement from {y: 1, v: 3, m: 3, p: 1, r: 3, j: 2}. 27/715 What is prob of picking 1 o and 1 x when two letters picked without replacement from mmmxmxsmmsmmmo? 2/91 Three letters picked without replacement from {b: 3, v: 5}. Give prob of picking 3 b. 1/56 Two letters picked without replacement from xteem. Give prob of picking 1 m and 1 x. 1/10 Three letters picked without replacement fro	{ "pile_set_name": "DM Mathematics" }
l4 + 0l + q - rl2 - 8l*3. -2l*2(3l + 2)2/3 Let j(b) be the first derivative of b6/27 + 2b5/45 - b4/9 - 1. Let j(x) = 0. What is x? -2, 0, 1 Let h(t) = -20t - 74. Let w be h(-4). Let j(p) be the second derivative of -1/135p*w - 1/45p*5 + 0p*2 - 1/54p*4 + 0 - p + 0p*3. Factor j(n). -2n*2(n + 1)*2/9 Let u be 1/2(-1 - 3). Let o = 6 + u. Factor -10w3 + 3w*2 + 21w*2 + o - 26w + 8w. -2(w - 1)*2(5w - 2) Let f be (-24)/(-35) - 60/210. Factor 0 - 2/5j + fj2. 2j(j - 1)/5 Suppose -m - 9 = 4t + 8, 37 = 4m - 5t. Factor 2o5 + mo*3 + 3 + 4o*2 - o - 5o*4 - 3o*2 - 3. o(o - 1)*3(2o + 1) Let b be ((-12)/(-75))/((-4)/(-20)). Find i, given that -bi*2 + 4/5 + 0i = 0. -1, 1 Let v(g) be the first derivative of g4/12 + g3 + 9g2/2 - 2g - 2. Let s(h) be the first derivative of v(h). Solve s(i) = 0 for i. -3 Let u(i) = -i*2 + 11i - 7. Let n be u(10). Suppose 5j + 3b = b - 2, -4 = nj + 4b. Let ja + 0a*2 + 0 + 1/3a*3 = 0. Calculate a. 0 Let n = 6 + -4. Let r(b) be the first derivative of 1/3b*3 + 3 + 1/2b*n + 0b - 1/4b4 - 1/5b*5. Factor r(l). -l(l - 1)(l + 1)2 Let i(b) = -b - 3. Let n be i(-6). Determine k so that 2k*n - 10k + 10k + 2k2 = 0. -1, 0 Let u(c) = c2 + 1. Let x(a) = 20a2 + 27a - 1. Let j(o) = -5u(o) + x(o). Factor j(s). 3(s + 2)(5s - 1) Let z(p) = 5p4 - 24p*2 + 28p - 3. Let x(s) = -s3 + s2 + s + 1. Let h(c) = 3x(c) - z(c). Factor h(w). -(w - 1)2(w + 3)(5w - 2) Let r = 3/130 + 59/260. Factor 1/4w4 - 1/4w*3 - rw*2 + 1/4w + 0. w(w - 1)2(w + 1)/4 Let v(c) = 4c3 - 12c*2 + 7c - 9. Let h(w) = -6w3 + 18w*2 - 11w + 13. Let b(q) = -5h(q) - 7v(q). Factor b(o). 2(o - 1)3 Let n be 3 + 3/((-300)/436) + 2. Let p(g) be the first derivative of 12/5g*3 + 2/5g + 1 + 2g4 + 7/5g*2 + ng5. What is c in p(c) = 0? -1, -1/2 Let k = 2 - -4. Let l(a) = a3 - 5a2 - 6a + 2. Let u be l(k). Let -1/4w3 - 1/4w*u + 1/2w*4 + 0 + 0w = 0. Calculate w. -1/2, 0, 1 Suppose 0 + 10/3b + 2/3b*2 = 0. Calculate b. -5, 0 Suppose 4r = 5r - 10. Let k = 10 + -7. Factor 0y*3 - 2y*k - ry*4 - 2y*3. -2y*3(5y + 2) Find v, given that 0v - 4v - 4v*2 + 7v*3 + 20v*3 - 7v*3 - 12v*4 = 0. -1/3, 0, 1 Factor -7i*2 - i + 5i3 - 12 + 11 + 4. (i - 1)2(5i + 3) Let n be (3 + -3)/(2 - 3). Let w be n + (3 - (-1 + 1)). Factor -6m4 - 2 + 21m*w + 12m + 0m4 - 24m2 - m3. -2(m - 1)3(3m - 1) Let h(j) be the second derivative of -j4/3 - 8j*3/3 - 6j*2 - 7j. Factor h(n). -4(n + 1)(n + 3) Let b(x) be the first derivative of x6/300 - x4/20 - 2x3/15 - 5x*2/2 + 4. Let c(g) be the second derivative of b(g). Let c(y) = 0. Calculate y. -1, 2 Factor 2y - 33y2 - 31y*2 + 73y*2. y(9y + 2) Let a(w) = 3w*4 - 12w*3 + 6w*2 + 6w + 3. Let c(r) = 2r4 - 11r*3 + 5r*2 + 6r + 3. Let t(y) = 5a(y) - 6c(y). Solve t(k) = 0. -1, 1 Let c = 12 + -8. Suppose -c + 19 = 3f. Determine a so that 10a*3 - 28a*4 + 16a*2 - 30a*f - 8a - 5a3 + 21a3 = 0. -1, 0, 2/5, 2/3 Let q(d) be the third derivative of d7/1680 + d*6/1080 - 7d5/720 + d4/72 - 2d3/3 + 2d*2. Let a(c) be the first derivative of q(c). Factor a(o). (o - 1)(o + 2)(3o - 1)/6 Let z(g) = g*3 + 5g*2 - 2g - 7. Let u be 101/4-2. Let l be z(u). Suppose 3dl - 2d*4 + 1/2d - 2d2 + 0 + 1/2d*5 = 0. Calculate d. 0, 1 Factor 4/3n*4 + 0n*3 - 2/3n + 2/3n5 + 0 - 4/3n*2. 2n(n - 1)(n + 1)*3/3 Let o(q) be the third derivative of -5q8/336 + q7/42 + q6/24 - q5/12 + 27q2. Factor o(g). -5g*2(g - 1)*2(g + 1) Let s(q) be the third derivative of q10/30240 - q9/7560 + q7/1260 - q6/720 - q*4/8 - 4q*2. Let w(k) be the second derivative of s(k). Factor w(o). o(o - 1)*3(o + 1) Let b(k) be the first derivative of k - 1/6k3 + 4 + 1/4k*2. Determine h so that b(h) = 0. -1, 2 Let v be ((-3)/1 - (-4 - -1))/2. Factor 2/3k*5 + vk*2 - 4/3k*3 + 2/3k + 0k4 + 0. 2k(k - 1)2(k + 1)2/3 Let a(q) be the second derivative of -q9/12096 + q8/3360 - q7/3360 + q*3/6 - 5q. Let b(c) be the second derivative of a(c). Suppose b(g) = 0. What is g? 0, 1 Let u(f) be the first derivative of f6/135 + f5/54 + f*4/108 + 2f*2 - 3. Let c(v) be the second derivative of u(v). Let c(s) = 0. Calculate s. -1, -1/4, 0 Suppose -12 = -3s + 6. Suppose sp3 + 9p*2 - 9p4 + p3 - 4p3 - 3p = 0. What is p? -1, 0, 1/3, 1 Let r be 180/210 - 54/14 - -3. Find c, given that -1/6c3 + rc*2 + 0 + 0c = 0. 0 Factor -15/7b + 12/7b*2 - 3/7b*3 + 6/7. -3(b - 2)(b - 1)2/7 Let f(o) be the third derivative of o8/2240 + o7/840 + o4/4 + 4o*2. Let y(b) be the second derivative of f(b). Find k such that y(k) = 0. -1, 0 Let r be 5/(-14)((-52)/8 + 3). Suppose 1/4d4 + 9/4d*2 + 1/2 - 7/4d - rd3 = 0. Calculate d. 1, 2 Let b(s) be the second derivative of -s6/60 + s5/20 - 6s. Factor b(z). -z*3(z - 2)/2 Suppose -5r - 15 - 5 = 0. Let m be r/14 - 10/(-35). Factor 0p + 1/4p4 - 1/2p*3 + 1/4p2 + m. p2(p - 1)2/4 Let q(h) = -h3 - 12h*2. Let x be q(-12). Let m(p) be the third derivative of -4p*2 - 1/44p*4 + 0p*5 + 2/33p*3 + xp + 0 + 1/660p6. Factor m(y). 2(y - 1)*2(y + 2)/11 Let z = 19 + -19. Suppose -3d + q = -8d + 6, z = 2d + 2q + 4. Determine c so that 2/9c + 0 + 2/9c*3 - 4/9c*d = 0. 0, 1 Factor 3/4m*2 - 1/2m*3 + 0 - 1/4m. -m(m - 1)(2m - 1)/4 Suppose -91l - 15 = -94l. Let j(a) be the second derivative of 1/9a*3 + 0 - 1/30a*l + 0a*2 - 3a + 0a4. Solve j(p) = 0 for p. -1, 0, 1 Let a(h) = -4h*3 + h. Let x be a(2). Let s be (2/(-8))/(6/x). Determine k so that sk - 1/4 - k2 = 0. 1/4, 1 Let b(q) be the third derivative of q7/280 - q*6/32 + 3q*5/80 + 5q4/32 - q3/2 + 29q2. Factor b(r). 3(r - 4)(r - 1)2(r + 1)/4 Suppose 4t - 4m = -4 + 20, 3m + 8 = -t. Let o(s) = s2 - 1. Let d(a) = 20a*2 + 18a - 2. Let g(q) = td(q) - 5o(q). Factor g(w). 3(w + 1)(5w + 1) Suppose -2v - 3o + 6 = v, 3o - 12 = 0. Let u(n) = -3n3 + 5n*2. Let l(j) = -9j*3 + 16j*2. Let k(g) = vl(g) + 7u(g). Solve k(c) = 0 for c. 0, 1 Let j(i) = -2i - 2. Let w be j(-4). Factor -17u2 + 4u*2 + 21u + wu2 + u2 - 9. -3(u - 3)(2u - 1) Let g(p) be the third derivative of -p8/112 + p7/70 + 3p6/40 - p5/20 - p4/4 + 12p*2. Let g(m) = 0. What is m? -1, 0, 1, 2 Let y = -2 - -8. Let d(u) = -9u*4 + 6u*3 + 3u*2 + 12u. Let q(m) = 8m4 - 5m*3 - 4m*2 - 11m. Let x(t) = yq(t) + 5d(t). Factor x(s). 3s(s - 2)(s + 1)2 Let x be (-2)/(-4) - (-20)/(-8). Let j be -2 + x + (-28)/(-6). Factor -2/3r + 2/3r2 - j + 2/3r*3. 2(r - 1)(r + 1)2/3 Let b be 5/(450/42) - 1/(-5). Let r(l) be the second derivative of 0 + 2l - bl2 - 1/36l*4 - 2/9l3. What is c in r(c) = 0? -2 Let u(p) be the third derivative of -p8/1680 + p7/1260 - p4/8 + p*2. Let s(h) be the second derivative of u(h). Factor s(l). -2l*2(2l - 1) Factor 1/4 - 1/8k*2 - 1/8k. -(k - 1)(k + 2)/8 Let p(y) be the first derivative of 4 + 0y*3 - 1/6y*6 + 0y*2 - 1/4y*4 - 2/5y*5 + 0y. Factor p(k). -k*3(k + 1)*2 Let l(v) = -20v*5 + 80v*3 - 40v*2 - 60v + 40. Let r(s) = -5s5 + 20s*3 - 10s*2 - 15s + 10. Let n(b) = -2l(b) + 9r(b). Factor n(j). -5(j - 1)3(j + 1)(j + 2) Determine k, given that 0 - 1/3k4 + k2 + 0k + 2/3k*3 = 0. -1, 0, 3 Suppose 0 = 4g + 16, 2g = -f - 0g. Suppose -3u + f = -7. Find w, given that -5/3w - 10/3w2 - 5/3w*4 - 10/3w*3 - 1/3 - 1/3wu = 0. -1 Let d(y) be the second derivative of -y5/5 + y*4/3 + 2y*3/3 - 4y*2 - 2y. Let p(b) be the first derivative of d(b). Let p(j) = 0. What is j? -1/3, 1 Let l(t) = 8t3 + 5t*2 - t + 9. Let d(j) = -2 - j + 5j*2 + 1 + 7j3 + 9 - j2. Let c(b) = 7d(b) - 6l(b). Find x, given that c(x) = 0. -1, 1, 2 Let p(f) = 3f - 10. Let h be p(5). Suppose -4d - hs = -s, -2d - s + 2 = 0. Let 0ud - 3/5u*3 - 1/5u*4 + 0 + 4/5u = 0. Calculate u. -2, 0, 1 Let q be ((-4)/(-3))/(-3 + 22/6). Determine u, given that 2/5u3 + 0 + 2/5u*4 - 2/5u - 2/5uq = 0. -1, 0, 1 Suppose -30 = -17x + 4	{ "pile_set_name": "DM Mathematics" }
0.00166047339 to 3 decimal places. -0.002 Round 0.00361383184 to 5 dps. 0.00361 Round -36692506.4 to the nearest one million. -37000000 What is 1.64684201 rounded to four decimal places? 1.6468 What is -6.18815006 rounded to one dp? -6.2 Round -26421264000 to the nearest one million. -26421000000 What is 11.940945 rounded to the nearest integer? 12 What is -574927.761 rounded to the nearest 100000? -600000 Round -497442.919 to the nearest 100000. -500000 Round -19933796.795 to the nearest ten thousand. -19930000 Round 89342296 to the nearest 100000. 89300000 What is -58242008.5 rounded to the nearest one hundred thousand? -58200000 What is 0.0000190055423 rounded to five dps? 0.00002 What is -0.1039353 rounded to 1 dp? -0.1 Round -7173465.62 to the nearest one hundred. -7173500 Round 3.7397657 to 2 dps. 3.74 What is -1647.18073 rounded to the nearest integer? -1647 Round 174629.716 to the nearest one thousand. 175000 Round 2.59867293 to 3 dps. 2.599 What is -0.829761748 rounded to 4 dps? -0.8298 What is -1054286.13 rounded to the nearest one hundred thousand? -1100000 Round -134821.5739 to the nearest one thousand. -135000 Round -0.0451934379 to six decimal places. -0.045193 What is -22911200 rounded to the nearest one hundred thousand? -22900000 What is -1434.17922 rounded to the nearest one hundred? -1400 What is 13.132277 rounded to one dp? 13.1 What is -9550.81026 rounded to the nearest 1000? -10000 What is -98508852.3 rounded to the nearest 1000000? -99000000 What is 0.0001952110325 rounded to seven decimal places? 0.0001952 What is -65.0296819 rounded to the nearest integer? -65 Round -14910959.6 to the nearest one thousand. -14911000 Round 2.490167381 to 1 dp. 2.5 Round -0.0000012703832803 to seven dps. -0.0000013 What is -0.436892505 rounded to three decimal places? -0.437 Round 71035.217 to the nearest one hundred thousand. 100000 What is 87774.306 rounded to the nearest one thousand? 88000 Round 458.468982 to the nearest ten. 460 Round 604103.659 to the nearest 1000. 604000 Round -6052.74124 to the nearest one thousand. -6000 What is -418.413467 rounded to 1 decimal place? -418.4 What is -600402120 rounded to the nearest ten thousand? -600400000 What is 4455381.57 rounded to the nearest 10000? 4460000 What is -351.55698 rounded to the nearest 100? -400 Round -1277.5837 to 1 dp. -1277.6 Round 38543.908591 to the nearest 10. 38540 Round 5824.73553 to the nearest one thousand. 6000 What is -44931560 rounded to the nearest 1000000? -45000000 What is 0.0000007019413 rounded to 7 dps? 0.0000007 What is 102571350580 rounded to the nearest one million? 102571000000 What is 2.2615484 rounded to 3 dps? 2.262 Round -257.1230984 to 2 decimal places. -257.12 Round -9204292.73 to the nearest 100000. -9200000 Round -0.00000134811693 to 7 decimal places. -0.0000013 Round 14.8341436 to the nearest integer. 15 What is 157624217910 rounded to the nearest 1000000? 157624000000 What is 2709118250 rounded to the nearest 1000000? 2709000000 What is 9.106998 rounded to the nearest ten? 10 What is -1570.6381369 rounded to zero decimal places? -1571 What is 1352.25619 rounded to the nearest 10? 1350 Round 0.0750132966 to five decimal places. 0.07501 Round 28.576442 to 1 decimal place. 28.6 Round 1.88754505 to three dps. 1.888 What is 293.234983 rounded to the nearest integer? 293 What is -0.00215767409 rounded to six decimal places? -0.002158 What is -41.394991 rounded to one decimal place? -41.4 What is -3.11368044 rounded to 3 dps? -3.114 Round 265001.4749 to the nearest one hundred. 265000 What is 85726696 rounded to the nearest one hundred thousand? 85700000 Round 0.089423686 to 6 dps. 0.089424 Round -2003372.6829 to the nearest 10000. -2000000 Round 0.0103608812 to six decimal places. 0.010361 Round -16160.77499 to the nearest integer. -16161 What is -13215426.59 rounded to the nearest 10000? -13220000 What is -0.3558783643 rounded to three decimal places? -0.356 What is 0.3641602753 rounded to three decimal places? 0.364 Round -687015.449 to the nearest 100000. -700000 What is 293242156 rounded to the nearest one million? 293000000 What is -564629.265 rounded to the nearest one thousand? -565000 What is -112.1436879 rounded to the nearest 10? -110 Round -0.00304910325 to three decimal places. -0.003 Round -1444383.1524 to the nearest 100. -1444400 Round 0.002706248268 to seven dps. 0.0027062 Round -285424176 to the nearest ten thousand. -285420000 Round -358.76572471 to 3 decimal places. -358.766 What is -7250990.12 rounded to the nearest one thousand? -7251000 What is 14.11529039 rounded to 0 dps? 14 What is 3584578.39 rounded to the nearest 10000? 3580000 What is 1346025368 rounded to the nearest 100000? 1346000000 Round 0.0000002420653761 to 7 decimal places. 0.0000002 Round 19433.24333 to the nearest one thousand. 19000 What is -0.00001961104442 rounded to seven decimal places? -0.0000196 What is -0.3623768712 rounded to four decimal places? -0.3624 Round -0.00001877745219 to 7 decimal places. -0.0000188 Round -41255983.5 to the nearest one hundred thousand. -41300000 What is 0.0000008923154738 rounded to 7 decimal places? 0.0000009 Round 0.0000081237613 to 7 dps. 0.0000081 What is -46662272.2 rounded to the nearest one million? -47000000 What is 0.010344355 rounded to five dps? 0.01034 Round -0.01096164562 to 6 decimal places. -0.010962 Round 2.150002488 to 4 decimal places. 2.15 What is -2799413.153 rounded to the nearest one hundred thousand? -2800000 What is 85814.90847 rounded to the nearest ten? 85810 Round -35894.593 to the nearest 10. -35890 Round -126.45570073 to the nearest 10. -130 What is -790580.4 rounded to the nearest 1000? -791000 Round -8946.51388 to the nearest 10. -8950 Round 0.000602975604 to 5 dps. 0.0006 What is -20.24393747 rounded to three decimal places? -20.244 What is -5937.05449 rounded to the nearest 1000? -6000 Round 1.060536432 to one decimal place. 1.1 Round -0.0900289659 to four decimal places. -0.09 What is -0.002921480997 rounded to 6 dps? -0.002921 Round -419800075 to the nearest ten thousand. -419800000 Round 0.02116789837 to 6 decimal places. 0.021168 Round 0.0000689785691 to 7 decimal places. 0.000069 What is -0.00213842863 rounded to 4 decimal places? -0.0021 Round 14289.6111 to the nearest 10000. 10000 Round -0.1166723312 to five dps. -0.11667 Round 0.020227148 to four decimal places. 0.0202 What is -24.79231768 rounded to two dps? -24.79 Round 0.31347007 to two dps. 0.31 What is 0.018433847 rounded to 6 dps? 0.018434 Round 0.08110856353 to four decimal places. 0.0811 Round 1.466728938 to four dps. 1.4667 What is -0.0001283928799 rounded to 5 dps? -0.00013 What is 4740.31 rounded to the nearest 10000? 0 What is 989377.675 rounded to the nearest ten thousand? 990000 Round 0.0001040440256 to 7 decimal places. 0.000104 Round 385659.369 to the nearest one hundred thousand. 400000 What is -2406.25668 rounded to 1 decimal place? -2406.3 Round -0.00000234407776 to six dps. -0.000002 Round 6348762.86 to the nearest ten thousand. 6350000 What is 9.9064919 rounded to 1 dp? 9.9 What is 0.00440813292 rounded to 7 dps? 0.0044081 What is -35.68265335 rounded to 2 dps? -35.68 What is 0.166865636 rounded to 2 dps? 0.17 Round 1.139510745 to two dps. 1.14 What is -0.254982369 rounded to 5 dps? -0.25498 What is -60140.5659 rounded to the nearest one thousand? -60000 What is -0.7627055533 rounded to four dps? -0.7627 What is 0.05765418 rounded to three dps? 0.058 What is -0.75973838 rounded to 3 decimal places? -0.76 Round -2.410597711 to 0 dps. -2 Round -19.696550304 to 4 decimal places. -19.6966 Round -0.0000771115111 to 7 decimal places. -0.0000771 What is -51468971.3 rounded to the nearest one thousand? -51469000 What is 15970282.03 rounded to the nearest 1000000? 16000000 Round 22.82018 to the nearest ten. 20 What is -1434186.79 rounded to the nearest one hundred thousand? -1400000 What is 300442.383 rounded to the nearest ten? 300440 What is -12818102.8 rounded to the nearest 1000000? -13000000 What is 710756887 rounded to the nearest one hundred thousand? 710800000 Round 1108672.916 to the nearest ten thousand. 1110000 Round -5421.74824 to the nearest integer. -5422 What is 0.026893108 rounded to four dps? 0.0269 Wha	{ "pile_set_name": "DM Mathematics" }
ue? (a) d (b) 4 (c) f a Let t = 55 + -273/5. What is the third biggest value in t, 0.6, 5? t Let a = 1.8 + -5.8. What is the third smallest value in -5, a, 2? 2 Let w = -877 + 41221/47. Let v = -145/94 + w. What is the third biggest value in v, -2, -1? -2 Let s = 6 - 10. Let n = s + 3. Suppose 3k - 15 = 2q - 9, k + 5q = 2. What is the third smallest value in n, k, 0.5? k Suppose -2 = -z - 4. Which is the second smallest value? (a) 3 (b) 33 (c) z a Let y = 40 + -321/8. Let g be 3 + (-18)/14 - 2. What is the biggest value in 0.3, g, y? 0.3 Suppose 6o + 2 = 4o. Let d be (1/(-14))/((-3)/(-18)). What is the third smallest value in d, -3/2, o? d Let u = 79 - 78.7. What is the third smallest value in u, 0.2, 3? 3 Let q be -2 + (-28)/(-9) - 1. Which is the third smallest value? (a) 3 (b) q (c) -0.5 a Let i = 6.02 + -0.02. Which is the second biggest value? (a) i (b) 1/4 (c) -0.1 b Let k be (-6)/15 + 26/(-10). Let s be k/1010/12. Let z = -6 - -5.7. Which is the second smallest value? (a) s (b) z (c) -0.4 b Let p = 4.2 - 4. Let v = 6 - 5.6. What is the smallest value in v, -5, p? -5 Let m = -951/8 - -119. What is the second smallest value in -3/8, -3, m? -3/8 Let f = 3 + -3.01. Which is the second biggest value? (a) -1 (b) -5 (c) f a Let w = -5 + -1. Suppose -p + 37 = 2. Let s be (w/p)/(15/50). Which is the smallest value? (a) s (b) 3/8 (c) 1 a Let h = -125/6 + 21. Suppose d - m = 3d + 2, 3d + 8 = -4m. Which is the biggest value? (a) d (b) h (c) 4 c Suppose 4 = 3y + 2d + 15, 4d + 4 = 0. Let i = 0.1 - 0. Let k = -0.1 + i. Which is the biggest value? (a) -0.5 (b) y (c) k c Let m = -33 + 36. Which is the second biggest value? (a) 3/2 (b) 6/7 (c) m a Suppose 2n = -n - 9. Let j be ((-2)/222)/(-1). What is the second smallest value in n, j, 4? j Let f(y) = 6y - 10. Let z be f(5). Suppose -4t - 12 = -0x - x, 4t - 3x = -z. Which is the second biggest value? (a) 2 (b) t (c) 3 a Let y(t) = -4t. Let m be y(1). Suppose 5u + 18 = g, 3g - 72 = -g - 3u. Suppose -2 = 4f + g. Which is the third biggest value? (a) m (b) 5 (c) f c Let d be (-7 - -5)/((-2)/4). Let l = 4 + -4. Let u = l - -0.4. What is the biggest value in 1, u, d? d Let x = -23 + 23.12. Let p = x - 0.52. Which is the biggest value? (a) 0.4 (b) -1/4 (c) p a Let c = 13 + -15. What is the biggest value in c, 3, 2? 3 Let g be 0 + -2 + (-336)/(-54) + -4. Which is the third biggest value? (a) -19 (b) -4 (c) g a Let m = -1.6 + -0.4. Let k = m - -2.2. Let o = k - 5.2. What is the second smallest value in o, 2/11, -3/5? -3/5 Let v = -7.3 - -7. Let o be 1/(-4)(-2 - 1). What is the smallest value in o, v, -1? -1 Suppose 5k - 7 - 8 = 0. Let u = -391771/2910 + 17/582. Let g = 135 + u. What is the third biggest value in g, 1/2, k? g Let y = 10 - 7. Let g = -6 + 6.06. Let t = g - 0.36. Which is the second smallest value? (a) -2 (b) t (c) y b Let x = -0.024 + 0.224. Which is the fourth biggest value? (a) -2/7 (b) -2/17 (c) -0.3 (d) x c Suppose -2v - 25 = -7v. Suppose 2n - vw + 3 = -1, -4n = -w + 8. Let q be 1/(n/(-10))-1. Which is the smallest value? (a) 2 (b) q (c) -1 b Let u = -4.4 + 0.4. Let t = 0.038 - -6.962. Which is the second biggest value? (a) u (b) t (c) 2 c Suppose -5y + 13 - 43 = 0. Let a = -2 - y. What is the third smallest value in 0.07, 5, a? 5 Let n be (-26)/(-13)(2/8)/(-1). What is the third smallest value in 1, -3, n, 0? 0 Let j = 1.3 + -1.5. Which is the smallest value? (a) j (b) -0.1 (c) 0.5 a Let n = 0 + -0.03. Let h = n + -2.97. Let o = 7 + -2. Which is the biggest value? (a) 0 (b) o (c) h b Let r = 0 - -0.1. Let j = 6 - 5.9. Let f = j - r. What is the biggest value in -0.3, 4, f? 4 Let o = -0.01 - 0.99. Let s = 1.9 + 1.1. Which is the third biggest value? (a) o (b) -0.3 (c) s a Let y = -0.1 + 0.1. Let z = y + 1. Let o = -4 - -1. Which is the second biggest value? (a) 0.2 (b) z (c) o a Let g = -0.01 + 0.41. Let c = g - 0.3. Let m be ((-6)/675-10)/(4/(-20)). What is the biggest value in 2/17, m, c? 2/17 Let l = 54 + -54.31. Let r = 0.09 - l. What is the third smallest value in r, -0.3, -1.1? r Let y be (4/6)/(0 + -2). Suppose 0 = -5b - 0f - 4f + 205, 4b = -3f + 165. Let l be b/(-50) + (-4)/(-10). What is the second biggest value in y, 2/3, l? y Let u = 0.02 - 5.02. Let l = 0 - u. Let s = 0 - l. Which is the second biggest value? (a) 2 (b) s (c) -2 c Let g be -1 + 3 + -2 + 3. Let l = 52.47 + -52. Let h = l - -0.03. Which is the third biggest value? (a) h (b) g (c) 2 a Let p(t) = t*2 - 4t - 8. Let g be p(6). Let w be (-25)/40 + 1/g. What is the smallest value in -5, w, 3? -5 Let r be 1/2 - (-19)/(-2). Let v = -86 + 86.5. Which is the third biggest value? (a) v (b) r (c) 4 b Let t = -1.5 + 1.1. Which is the second smallest value? (a) t (b) -2/11 (c) 5 b Let k = 7 + -6.6. Suppose 0p + 6 = 2p. Which is the biggest value? (a) k (b) 6/11 (c) p c Let y = -0.027 + -0.473. Which is the biggest value? (a) y (b) -0.06 (c) -3 b Let z = -0.15 - -9.15. Let t = z - 14. Let o = 0.06 - -1.94. What is the second smallest value in -3, o, t? -3 Let t = -9 + 9.4. Which is the second smallest value? (a) t (b) -3 (c) 1 (d) -0.5 d Let v be ((-45)/20 - -3)/(9/(-16)). Suppose -6j - 8 = -2j. Let h = 0 - -0.4. What is the smallest value in j, v, h? j Let y = 2 + -1.5. Let i = 0.4535 - 0.0535. What is the third biggest value in y, 0, i? 0 Let p = 0.5 - 1. Let n be (-8)/(-7)(-2)/4. Let a = -0.27 + -0.73. What is the third biggest value in n, a, p? a Let p = -15 + 10. Let k = 0.8 - -0.2. Let r = 4 - k. What is the third smallest value in r, p, -0.1? r Let b = -0.13 - 0.17. Suppose -3w - 3 = 3. Let m be w/(-4)(-2)/(-1). What is the third biggest value in m, -0.5, b? -0.5 Let f(v) = v - 1. Let w be f(-2). Let h be (-2)/11 + 420/132. Let j be 0/2 + h/(-5). What is the smallest value in 0.5, j, w? w Let c = 0.1 - -0.1. Let z = 11 - 15. What is the smallest value in z, 1, c? z Let l = 15 - 15.86. Let n = 0.14 - l. What is the biggest value in 0, -5, n? n Let u be (2/(-183))/((-1)/3). Let z = 108/427 + u. Let v = 10 - 7. What is the third smallest value in -1, v, z? v Let o = 7 + -7.3. Let g be (-36)/(-65) - (-6)/(-15). What is the second biggest value in o, g, 2? g Let g = 3.5 + 0.5. Which is the fourth biggest value? (a) 2/7 (b) -1 (c) -0.5 (d) g b Suppose 4s - 10s - 12 = 0. Which is the third smallest value? (a) -5 (b) s (c) -1/4 c Let o = 5.5 + -9.5. What is the third biggest value in -3/8, o, 0.4? o Let s = -0.3 + 0.8. Let g = 0.05 + -0.45. Let b = -0.29 + 0.39. What is the third smallest value in g, b, s? s Let y(i) = i - 9. Let u be y(5). Let p be -1(24/(-14))/u. Which is the second smallest value? (a) p (b) 0.4 (c) 0.5 b Let u be 2 + 3 + 1 + -1. Which is the second biggest value? (a) -9/4 (b) -4 (c) -1/8 (d) u c Let k = -2.92 + 3. Let x = k + 0.32. Which is the third biggest value? (a) -0.4 (b) x (c) -4 c Suppose -16 = 5m + o, 4m + 4 = 4o - 4. Let g = -4/79 - 217/395. Which is the smallest value? (a) m (b) 1 (c) g a Let m = 0.6 - 0.1. Let j = -1.7 + 1.59. Let k = j + -3.89. Which is the third biggest value? (a) 1/4 (b) m (c) k c Let m = -19 + 15. Which is the smallest value? (a) 3/11 (b) 2/3 (c) m c Let u = 0.18 + 0.02. Which is the third smallest value? (a) u (b) 3 (c) 0 b Let z = -3.82 + -0.18. What is the fourth biggest value in z, 0, -0.1, 8? z Suppose -4t = 4, 4y + t - 9 = 2t. Let r be (-10)/5 + 1y. Suppose 0w - 2w = 10. Which is the smallest value? (a) w (b) r (c) 5/2 a Let n(x) be the first derivative of -2x*3/3 - 3x*2/2 + 4x - 1. Let m be n(-3). Let h = -4.36 - -4.16. What is the third smallest value in -3, h, m? h Let n(m) = m*2 + 4m. Let w(o) = -2*o + 4. Let f be w(4). Let s be n(f). Let k = 46 - 51. What is the second biggest value in 0.2, s, k? s Let z = -1 - -1. What is the biggest value in -4, 0.5, z? 0.5 Let s = -13 - -23. Let n = s + -5. Which is the second smallest value? (a) -0.1 (b) -0.3 (c) n a Let w = -3.61 - 0.09. Let f = -0.3 + w. What is the third smallest value in f, -2, -5? -2 Let y = 409/2 - 207. Let o = 0.5 - 0.1. Which is the second biggest value? (a) 3 (b) y (c) o c Let i = -0.1 + -0.4. Suppose -g = -t +	{ "pile_set_name": "DM Mathematics" }
z)(2z*2 - 2z*2 - 9z*2). -27z*3 + 9z*2 Expand 6g*3 - 27g + g*2 + 27g + (2g - 4g + 3g)(-63g + 4g*2 + 63g). 10g3 + g2 Expand 29j + 4j + 4j + 2j + 3 - 3 + 5j - 3j - j + (2j - 5j + 4j)(1 + 5 - 4). 42j Expand (4t3 - 2t*3 - 3t*3)(-4t2 - t2 + 3t*2) + (3 - 3 + t)(t*4 + 2t*2 - 2t*2). 3t*5 Expand 3p*2 - 4p*2 - 2p*2 + 3p2 + p2 - 3p2 + (3p - 7p + 2p)(-1 + 1 + 2p) - 753 + 753 - 54p2 + p2 - 3 + 3. -59p*2 Expand (-3j + 4j + 5j)(-28j*3 + 30j*3 + 40j3) + 4 - 4 + j4. 253j4 Expand -1 + u3 + 1 + (u2 + 5 - 2u*2 - 3)((4u - 2u + 7u)(-1 + 1 - 1) + 0u + 5u - 2u + 7u - 3u - 7u). 10u3 - 18u Expand (1 + 4 - 3)(p + 4 + 5 - 6) + (2 - 2 - 1)(-p - p + 3p) + 10p - 4p - 7p + (-2 - p + 2)(4 - 5 + 2). -p + 6 Expand (-40 + 20 - 191)(-d + 3d + 0d). -422d Expand (2w3 + w3 + w*3)(2 - 2 + 2) + (-69 - 2w2 + 33 + 10w + 38)(-3w + 0w + 4w). 6w3 + 10w*2 + 2w Expand (-2x3 - x3 + 0x*3)(-6x2 - 2x2 - x2) - x*3 - 6x5 + x3 + (-3x4 + 3x4 + x4)(-2x - 1 + 1). 19x5 Expand (0p3 - p4 + 0p3)(-p - 1 + 1 + (1 + 1 - 4)(0p - 2p + p) + p - 2 + 2 - 4p + 0p + 2p + 3p - 2p + 0p - 429p + 171p - 506p). 763p5 Expand (0q*4 - 6q*4 + 3q*4)(1 - 5 - 18q + 16q). 6q5 + 12q*4 Expand -2f - 5f3 + 4f3 + f4 - 3f4 + (-6 - 3 - 11)(-2f3 + f4 + 2f*3). -22f4 - f3 - 2f Expand (l + 5l - 2l + (-1 - 2 + 1)(l + l - 3l) - 3l - 2l + 0l)(2 - 2 + 6). 6l Expand (4 + 2 - 5)(74 + 2 - 1)(7y4 + 2y*4 - 4y*4). 375y*4 Expand (-49w*2 - 120w + 119w - 18w*2)(-2w3 + 0w*3 + 0w*3). 134w*5 + 2w*4 Expand (0p*3 - 2p*3 + 0p*3)(-2p - 17 - 1 - 15)(0p + 0p - 2p). -8p*5 - 132p4 Expand -3 + j3 + 3 + 4j3 + 3j*3 - 5j*3 + (0j - 3j + j)(j*2 - 6j*2 + 3j*2) - 3j*3 + 3j*3 + 2j3 + j3 + 0j + 0j + 168 - 252j3 - 168. -242j*3 Expand -192l*2 + 114l*2 - 269l*2 + (2l - l + l)(-1 + 1 - 2l). -351l2 Expand 7633t + 949 - 317 - 317 - 315 + (3 + 1 - 5)(2t - 1 + 1). 7631t Expand (5l5 + l5 - 9l5)(0 + 5 - 10). 15l5 Expand -2 + 2 + c - c + 2c + c + (3 + 2 - 3)(29c - 80 + 80) + 2c + 2c - 5c. 60c Expand (122 + 137 - 56)(-2k - k + k)(-3k + 3k + k4). -406k*5 Expand (374r - 374r + 64r3 - r2)(0r*2 - 3r*2 - 2r*2). -320r*5 + 5r*4 Expand (-2c - 5c + 5c)((6 - 2 - 3)(-c + c - 2c2) - 136187 + 136187 - 461c*2). 926c*3 Expand (9 + 99u - 9)(0 + 6 - 4). 198u Expand (-n + 2n - 3n)(0 - 3 + 4)(0 - 4 + 1)(-2 + 3 - 2). -6n Expand (1 + 0 + 2)(-3h*3 - 10h*3 + 18h3) + h3 + 2h3 - h3. 17h*3 Expand 9l*5 + 2l*3 + 156l - 156l + (-3 + 3 + l2)(5l3 - 3l3 - l3). 10l5 + 2l*3 Expand (-2l + 2l3 + 2l)(2l - 19l + 7l) - 4l - 3l*4 + 4l + (2l2 - 2l*2 - 3l*2)(-l*2 + 0l*2 - 2l*2). -14l*4 Expand (b + b + 0b)(-2 + 2b + 2)(-1 + 1 - 2b - 11b + 16b - 49b + 0b + b - 2b + (-1 + 0 + 3)(-4b + 5b + b)). -172b3 Expand (3 - 6 - 2)(t3 - t3 - 6t3). 30t*3 Expand (0 + 1 + 1)(5b - 4b + b) + 2b - 3b - b + 13 - 18 - 14b + 16b. 4b - 5 Expand (d3 - 2d3 - d3)(2d - 3d + 4d + (2d + 2 - 2)(-2 - 5 + 4)) - 421d3 + 21d*4 + 421d*3. 27d*4 Expand (-4v + 3v + 0v - 3)(62 - 62 - 46v*2 + (2v + 4v - 5v)(v - 3v + 4v)). 44v*3 + 132v*2 Expand (-1 + 4 - 5)(4 - 3 + 1)(-10 - 4 - 6)(7m + 5m - 8m). 320m Expand (c*2 + 3 - 3)(-c - 4c - 5c) + 2c3 - 6c*3 - 7c*3 + (4c*2 - 4c*2 + 2c*2)(-2 + 2 - c). -23c3 Expand (-2d - 2 + 2)(33 + 8 + 0)(2 + 3 - 6)(-3 - 2 + 3)(2 - 2 + 2d3). -328d*4 Expand -2h2 - h2 + 4h2 + (13h*2 - 2h2 + h2)(4 + 2 - 7) + (-h - 4 + 4)(0 - h + 0) + 0h2 + 4h*2 - 2h*2 + 0h*2 + 0h2 + h2. -7h2 Expand (81b + 37b - 223b)((2b*2 - b + b)(-5b2 + 3b2 + b2) + 0b4 + 2b*4 - 3b*4 + 0b*2 - 2b*4 + 0b*2). 525b5 Expand a5 + 3a5 - 3a*5 + 5a*5 - 3a5 - a5 + (a*3 - 2a4 - a3)(-6a + 3a + a) + (0a*2 + 0a*2 + 2a*2)(175a + 21a*3 - 175a). 48a5 Expand 0s*5 - 3s5 + s5 + (0 - 1 + 3)(3s5 + s5 - s5) + 1 - 1 - s5 + (0s4 + 0s*4 - 2s*4)(-2 + 2 + 12s). -21s*5 Expand 0p2 + p5 + 0p2 + (p3 + 0p + 0p)(-2p2 + 2p - 2p) - 169p*5 + 7380p*2 - 7380p*2. -170p*5 Expand 0p5 + p5 - 2p5 + (-5p*2 - 6p*3 + 5p*2)(25p2 - 21p*2 + 11p*2). -91p*5 Expand 78v*4 + 66v*4 + 127v*4 + (0 + 0 + 2v)(4v3 - v3 + v*3). 279v*4 Expand 358w - 356w + 0w*4 + 4w4 + w4 + 0w3 + 0w*3 + (-3 + 0 + 1)(-6w4 + 3w*4 + 2w*4). 7w*4 + 2w Expand -460q - 75q*3 + 460q + (-q*3 + 0q*3 + 3q*3)(6 + 0 + 2). -59q3 Expand (-3v*3 + 0v3 - v3)(-2 - v2 + 2) + (-1 - 2v*2 + 1)(4v3 - v3 - 5v*3 + (2v - 10v + v)(v*2 - 2v2 - v2)). -20v5 Expand (-4l3 + l3 + l*3)(3 - 2 + 82l2 - 70l*2). -24l*5 - 2l*3 Expand (21k*4 + 4k*4 + 0k*4)(-6 + 2 - 2). -150k4 Expand (-3t + 6t - 2t)(-3 + t + 3) + (2t*2 - 1 + 1)(-2 - 1 + 5) + 92936 - 92936 - 216t2. -211t*2 Expand 0u - u + 3u + (-3 + 2 - 1)(-10u - 13u + 2u) + 3 - 3 + u + (u - 4u + 4u)(1 + 2 - 1) + u - u + u + u + 1 - 1. 49u Expand (6 - 11 - 10 + (0 + 6 - 4)(3 - 1 - 4))((2 - 2 + 1)(-u - u + 4u) + u + 4 - 4). -57u Expand (s + 2s - 2s)(-2s*3 + 2s - 2s) + (-4s3 + s3 + 7s3)(-3s - 3s - 1 + 5s). -6s*4 - 4s*3 Expand -y + 3y + 0y + 4y + y - 4y - 3y - y + 3y + (4y - y - 2y)(7 - 2 - 3) + y + y - y - 6y - 18y + 7y - y - 1 + 1 + (2 - 1 - 3)(-2y + 1 - 1). -9y Expand (5n + 0n - 3n)(510 - 7 + 825 + 117 + 125). 3140n Expand -3z + 4z + 0z + (-12z - 28z + 20z)(-2 + 1 - 1) - 4z + 4z - z - 2z + 3 - 6 + 7z. 45z - 3 Expand (-9o + 9o - 29o*3)(0o2 + 2o*2 + 0o*2) + 3o5 - o5 + 0o5. -56o5 Expand (-a2 - a*2 + 6a*2)(-137 + 6a2 + 137 - a). 24a*4 - 4a*3 Expand (0v*3 + 0v*3 - 3v*3)(-145 + 12v2 + 145 - v). -36v*5 + 3v*4 Expand (3r*2 - 2r*2 + 0r*2)(-17254r + 8178r + 7773r). -1303r*3 Expand (-10 + 12 + 1248d - 1209d)(2d3 - d3 + d3). 78d*4 + 4d*3 Expand ((0l - l*3 + 0l)(-2l - 2l + 2l) - l*4 + 2l*4 + 2l*4 - 3l*4 + 0l*3 + 0l3 + 1 - 1 - l4)(-7 - 6 - 6). -19l4 Expand 178 - b4 - 178 - 61b + b4 - b4 - 2b*4 + (5 - 5 - 2)(2b4 - 2b4 + b4) + 2b4 - 4b*4 + 3b*4 - 2b*4 - 2b*4 + 3b*4. -5b*4 - 61b Expand 3a + 2a - 2a + (0 + 0 - 2a)(4 - 4 + 1) - 4a + 0a + 2a - a + 4a - 4a - 32 + 32 + 104a. 102a Expand 8k4 - k4 + 0k*2 - 2k*2 + (-1 - k + 1)(-2k2 + 2k2 - k3) + (2k3 - 2k*3 + 2k*4)(-3 + 1 - 2) + 18k4 - 5k*4 - 6k*4. 7k*4 - 2k2 Expand (-w5 - w*5 + 3w*5)(-408 - 401 - 65). -874w5 Expand (5k - 3k - 3k)(0 - 8 + 3) - 4 + 4 - 2k + (-3k + 6k - 4k)(3 + 2 - 3). k Expand -z3 + z3 - z*4 + (6 - 1 - 4)(-2 + 2 - 2z4) + (z + 2z - 4z - 7 + (33 - 33 + 9z)(3 - 2 + 1))(z*3 + 3 - 3). 14z*4 - 7z*3 Expand (0x*2 - 2x*2 + 0x*2)(x - 1 + x - x)(0 - 5 + 0) + (-5x*2 + 3x2 - x2)(0x + 2x - 3x). 13x3 - 10x*2 Expand (-2f*3 + 3f*2 - 3f*2)(-18f + 41 - 41)(-5 - 7 - 7). -684f4 Expand (w3 - 2w*3 - 2w*3)(22w - 16w + 9w) + ((2 - 1 + 1)(-3 + 2w + 3) + w + 1 - 1)(w*3 + 3w*3 - 3w*3). -40w*4 Expand (0 + 3 - 1)(7w - 4w + 4w)(-4 + 0 - 4)(1 - 2 + 2). -112w Expand (2d2 + 2 - 2)((-2 + 0 + 3)(-3 - 1 + 3) - 5 - 10 + 4). -24d*2 Expand 192r*2 - 192r*2 + 22r*5 + (-2r*2 + 2r*2 + 3r*3)(-4r - 2r*2 + 4r). 16r5 Expand (-4o - 2o + 5o)(322 + 598 + 96 - 178). -838o Expand 3 - 5 + 1 - 3g + (-9 + 14 + 7)(21g - 636 + 636). 249g - 1 Expand (y*2 - 3y*2 + 5y*2)(-204 + 357 - 205). -156y2 Expand 2z*2 - 4z*2 + 3z*2 + 5z*2 + 0z*2 - 3z*2 + (7 - 2 + 5)(-z*2 + 0z*2 + 0z*2). -7z*2 Expand (-3 + 0 - 2)(77g - 350g + 7 - 6). 1365g - 5 Expand (-3y3 - y3 + 5y3)(8y2 + 0y*2 - 303y + 259y). 8y*5 - 44y*4 Expand (0 + 0 - n)(-1 + 1 + 2n) + 2n**2	{ "pile_set_name": "DM Mathematics" }
x(-63) composite? False Suppose 0 = 27q + 4302096 + 777144. Is (-3)/(5/(q/24)) composite? False Let y(i) = 8374i*2 - 50i + 65. Is y(-9) a composite number? False Is (170/(-150) - (-14)/105) + 59498 a composite number? False Is (2 + -95616)(102/(-12) - -8) prime? True Let t(z) = 77z - 118. Let k be t(-36). Let u = 6483 + k. Is u composite? False Let f = 3303 - -3104. Let l = -1236 + f. Is l prime? True Let y = 6894 + 18668. Is y composite? True Let t(g) = 7g - 54. Let j be t(22). Let n be (-5)/((-20)/8)j. Let m = n + -55. Is m a composite number? True Suppose 79z - 47z = 2793632. Is z composite? True Suppose 0 = 5n - 5, m + n = 3n + 1. Suppose -9s + 24 = ms. Is -64594/(-6)1/s a prime number? True Suppose b = -b - 4o, 5b + 18 = -4o. Suppose -5j + 5640 = j. Is 4/3 - (3 + j/b) prime? False Let g = -68 - -281. Let r = g + 1588. Is r prime? True Let j(n) = 11n3 + 75n*2 + 41n - 116. Is j(19) composite? True Let s = -31 - -54. Let d = 19 - s. Let f(r) = -3r3 - 2r*2 - r + 5. Is f(d) prime? False Let w = 1880 + -6149. Is (4/4)/((-1)/w) prime? False Let o(z) = -7z*2 - 3z - 5. Let w be o(-2). Let q be (-38855)/(-9) - (2 - (-48)/w). Is (4/4)/(-1 - (-4320)/q) a composite number? False Suppose -4s + 1 = 5. Let b be (1 - (-49 - 0))s. Let j = b + 309. Is j a prime number? False Let h = 10861 + -6284. Is h prime? False Suppose -5 = 5p - 30. Suppose -pm + 4042 = -3s, 4m = -s + 1820 + 1417. Is m a prime number? True Let y be (243/(-54))/(3/(-6)). Suppose yj - 68032 = -23j. Is j a composite number? True Suppose -82 = -5o - 4g, 6o - 5o = -3g + 12. Is (-3)/((-36)/86840) + 6/o composite? False Suppose -2o + 3t + 1154617 = 0, 10t = 3o + 12t - 1731919. Is o prime? True Suppose -19w - 492762 = -25w. Is w composite? True Let b(z) be the second derivative of -4357z3/6 - 149z*2/2 - 6z + 2. Is b(-4) prime? False Suppose -c = -2u + 82713, 24u - 29u + 206784 = -c. Is u a prime number? True Let f be (104/(-120))/(1/(-18))5. Let a = 69 - f. Let l(c) = -5c3 + 6c*2 + 14c + 34. Is l(a) prime? False Let m be (-10694)/14 - (-6)/(-42). Let n = 1083 + m. Is n prime? False Suppose -23z + 3z - 102700 = 0. Let a = z - -12496. Is a prime? False Let v = 487856 + -157735. Is v a composite number? True Let q be (-4944)/(-45) - 16/(-120). Suppose q = 4f + f. Suppose 104 - f = m. Is m a prime number? False Let y be (154/42 - 4)-33. Suppose -45353 = -2q + 5p, 3q + q - p - 90751 = 0. Suppose -q = 2h - yh. Is h a prime number? True Suppose u - 5 = -q, 5q - 17 = u + 2u. Let b be 322 - q - (-3 + 0). Suppose 464 = 3i + 4p - 2p, p + b = 2i. Is i composite? True Is (-62526765)/(-105) - (-1 + 13) prime? True Let p be (1/(-3))/((-6)/170928). Let u = -5447 + p. Is u composite? False Let w(d) = -17d*3 - 40d*2 + 29d + 85. Is w(-24) composite? True Suppose 0 = -4d + v + 22150 + 11848, 5d = v + 42499. Is d composite? False Let f(j) = 158492j - 1851. Is f(7) prime? True Is ((-1083)/(3 - 60))/(16708/16706 - 1) prime? False Let s = -1178 - -2618. Let x be ((-21)/14)/(6/(-8)). Suppose 5q - 2249 = -xc + s, -q = -2c + 3695. Is c a composite number? False Is (4/3)/((-1120)/(-615801480)) prime? True Let f be 45/12(-840)/(-18). Let y = -62 + f. Is y a composite number? False Is (-2 + 5 - (-90584)/5)/(21/105) prime? True Let y(x) = -2x*3 + 68x*2 - 103x + 12. Is y(19) prime? False Is 590/(-120) + 5 + (-643170)/(-72) a prime number? True Suppose -4l - 5d + 81 = 9, 2d - 54 = -3l. Let z(j) = -j*3 + 21j*2 + 33j - 1. Is z(l) a composite number? True Let c(u) = -u*3 - 6u*2 + 16u - 5. Let f be c(-9). Suppose 4i + i = 0, 2p - f = 5i. Is p composite? False Let o = -52791 + 89977. Is o a composite number? True Suppose -3b + 0v + 44383 = -4v, 3v = -5b + 73933. Is b a composite number? True Suppose 151c = 169c - 892548. Is c prime? False Let w(i) = 49i2 - 76i - 119. Is w(-20) a prime number? True Suppose -14r + 18r - 24 = -4g, g - r - 16 = 0. Suppose 10067 = 3a - 9m + gm, 0 = -a + 2m + 3345. Is a a prime number? False Let s = 1127736 - 643429. Is s a prime number? False Let l = -9798 + 18258. Suppose o - 5u = 2124, 0o - 2u = -4o + l. Suppose 4y = 6y - o. Is y composite? True Let h(p) be the third derivative of -p6/6 - 11p*5/60 - 7p*4/12 - 20p*3/3 - 38p*2. Let y be h(-7). Let u = y + -3800. Is u composite? False Let g = 366 - 364. Suppose z - i - 626 = 0, -4i + i - 1247 = -gz. Is z a composite number? False Suppose -5g = 5w + 60, 3g = 4g + 5. Let l = 7 + w. Suppose l = y - 0y + 4i - 461, i = -5. Is y a composite number? True Suppose -5f - 21 = -41. Suppose -fi - 24 = -10i. Suppose 236 = z + o, -5z - 5o + io + 1184 = 0. Is z a prime number? False Let g(f) = -23558f*3 - 30f*2 - 69f - 11. Is g(-4) composite? True Let u = 282351 - 153802. Is u prime? True Let j = -86183 + 277182. Is j composite? True Is 136/476 - (-199398)/14 prime? True Suppose -o - 5a = -2 + 5, 5o + a = 81. Let m be (-1 - 102)13/(52/(-8)). Let f = m + o. Is f a prime number? True Suppose 901 + 1163 = 4m + 4x, -3m - 2x + 1546 = 0. Suppose 2a - o - m = 0, 5a + 17o - 22o - 1285 = 0. Is a composite? False Let i(r) be the second derivative of -3r*5/20 - 21r*4/4 - 7r*3/2 + 77r*2/2 + 29r - 3. Is i(-32) a composite number? True Let d(j) = 277j - 199. Let p(r) = -139r + 101. Let g(t) = -4d(t) - 7p(t). Is g(-20) a composite number? False Let v = 18 + -30. Let p(a) = -3a3 + 4a - 3. Let y be p(1). Is (-1815)/y - v/(-24) a prime number? True Let p(u) = -u3 + u2 + u + 6. Suppose -9m + 4m = 0. Let g be p(m). Is 4/(-6) - (-8278)/g a composite number? True Let d(c) = -68c + 9155. Is d(-16) a composite number? False Suppose -2267894 = -18q - 604352 + 1056636. Is q a prime number? True Let z = 164 + -169. Let m(w) = -116w3 + 3w*2 - 13w - 7. Is m(z) prime? True Suppose 0 = -5q, 5a + 4q + 20 = 6q. Let t(y) = -79y3 + 9y*2 + 44y + 9. Is t(a) prime? False Suppose 8k + 0 - 24 = 0. Suppose 2w + kp = 4043, -5p = w - 0p - 2032. Is w prime? True Let u(h) = 104h*2 + 7h - 8. Suppose -2d = n + d, 2d + 34 = 5n. Is u(n) a prime number? False Is -20 + (17791 - (-6 + -6)) a composite number? False Let o(a) = -a3 + 155a + 1 - 2a2 + 150a - 302a. Is o(-9) a composite number? False Let d(c) = -4c + 19. Let n be d(19). Let s = n + 1625. Suppose 3g = -p + 1170, -4g + 2p = 6p - s. Is g prime? True Let c = -517333 - -751374. Is c a prime number? False Suppose -y = -5n - 27, -5y + y = 5n - 33. Let i(a) = -4 - 11 + 163a - y. Is i(8) a prime number? True Is 43 + -33 - (-44345 - -4) a composite number? False Let n(d) = 133d2 - 35d + 8715. Is n(-119) composite? True Suppose -29z + 42 = -26z. Suppose zx - 2x - 71052 = 0. Is x prime? False Let s be (3/(-5))/(3/(-15)). Suppose a - 2668 = -sa. Let r = -290 + a. Is r composite? True Is (2 - (-3 + (-137572)/8))/(2/4) composite? False Suppose 11508 = 6t - 11574. Is t prime? True Suppose 0a = 2a + a. Suppose 5 = -aq + q. Suppose -1426 = -i + 3m, -4383 = -qi + 3m + 2735. Is i a prime number? True Let y = 673 - 638. Is (-1)/7 - (-412690)/y prime? False Suppose v + 24371 = -116. Is v/(-4) + (-7)/(-28) prime? False Let y = -14480 + 25817. Suppose 7l - 1844 = y. Is l a prime number? False Let q(l) = 2l*2 + 13l + 13. Let b be q(-6). Let d(o) = 8o3 - 8o*2 + 22o - 9. Is d(b) composite? True Let y = 71 - 67. Suppose -3f + 8f + 5025 = yl, -4l = -4f - 5024. Is l composite? True Let k be 6/(-15) + 924/(-15). Let s = 71 + k. Is ((-6414)/s + 3)6/(-2) composite? False Suppose 4o - 7o - 2w + 739 = 0, 2w = 3o - 731. Let a(i) = 4i - 88. Let s be a(0). Let l = s + o. Is l prime? True Let o(j) be the third derivative of 7j5/3 + 19j*4/24 - 13j*3/3 - 86j*2. Is o(-9) composite? True Suppose -7q = 11q - 607517 - 10355257. Is q a prime number? True Let n(k) = k3 + 2k + 413. Suppose 5u - 4 = 7u. Let y(x) = 5x3 + 11x + 2064. Let p(q) = uy(q) + 11n(q). Is p(0) composite? True Suppose -7n + 9n = 2. Let z be 382/n - 24/(-12). Let k = z - 197. Is k a prime number? False Let b = -66688 + 158525. Is b a prime number? True Let g = -1361229 - -2089598. Is g a prime number? True Let k(i) be the se	{ "pile_set_name": "DM Mathematics" }
t is the value of -20 - ((95 - 102) + (1 - -9))? -23 Evaluate (-1 - (-3 + -16 + 4)) + -7 + -19. -12 (-1109 - -1094) + (-8 - -1) -22 Calculate -3 + (-17 - -4) + 6. -10 Calculate (-13 - (43 - 83)) + (-11 - (-2 - -1)). 17 (1 - -41) + (-301 - -279) 20 Calculate (-12 - -12) + -10 + 6 - (-5 - -2). -1 Calculate (63 - 87) + (21 - -8). 5 Calculate (-8 - -11) + -17 + 3. -11 -1 - (-4 + -12 - (-11 - -12)) 16 What is the value of 3 + (-9 - ((-5 - -2) + (-7 - -16)))? -12 What is -23 + (51 - 32) - 5? -9 What is 1 - 4 - -3 - (6 - 5)? -1 What is the value of (-19 - (22 - 59)) + 8 + -1? 25 What is the value of 3 + -5 + (9 - (-12 - -27))? -8 Calculate (56 - 32) + (-10 - -2) + -1 + 0. 15 What is the value of -3 - (1 + -7) - 1 - 1 - -4? 5 What is 4 - (-14 - -2 - -12)? 4 (-77 - -69) + 18 + -1 + 2 11 What is the value of 2 + 29 + -15 + -41? -25 What is 2 + -29 - (-7 - 7)? -13 What is 11 + -4 + 4 + -1 + -7? 3 Calculate (13 - 4) + -3 + 11. 17 Evaluate 18 + -8 + 25 + -50. -15 What is the value of 1 + -1 + (1 - 1) + -109 + 75? -34 What is -2 + 16 + 1 + (-6 - -2)? 11 What is 12 - (41 - ((2 - (3 - 10)) + -9))? -29 What is 0 + 10 - ((17 - 6) + -17 + 4)? 12 What is 12 + (-30 - (-9 - 4) - -8)? 3 7 - (-11 + 8 + 23) -13 Evaluate 72 + -52 - (5 + -10). 25 What is 2 - (-9 + -6 - (-6 - 0)) - 7? 4 Calculate (-48 + 16 - -22) + 33. 23 Evaluate 29 + (-25 - -32) + -11. 25 What is the value of (6 - 15) + (30 - 6) - (-14 - -2)? 27 What is 13 - 0 - (-3 - (5 + -8))? 13 What is (-15 - -4) + 6 + (-4 - (-20 - -10))? 1 What is the value of 760 + -748 - (3 - (2 - (3 + 1)))? 7 Evaluate 20 + -8 + -5 + 7 + (-2 - 1). 11 4 + -1 - (26 + -11) -12 What is the value of 9 - (9 - 42) - 35? 7 Calculate ((2 - 10) + 6 - -9 - 4) + -8. -5 20 + -9 + (-2 - (-5 + 2)) 12 Calculate 62 + -48 + (0 - -14). 28 What is the value of 3 - ((-4 + 5 - 18) + 10)? 10 What is the value of 0 - (-4 + 7 + -1) - 3? -5 What is 17 - (12 + (-9 - -7)) - 11? -4 What is the value of 13 - (28 + (-31 - -3))? 13 4 - (1 + (0 - (-7 + (4 - 1)))) -1 Evaluate ((13 - 4) + 0 + -1 - 33) + 6. -19 What is (3 - (17 - 18)) + (-17 - -1)? -12 What is the value of 166 - 137 - (21 + -2)? 10 What is the value of (0 - -3) + -3 - -11 - (-293 - -286)? 18 Calculate -30 + 29 + 15 - 4. 10 What is -14 - 3 - (-238 - -224)? -3 Calculate 215 - 200 - (17 + 2). -4 Evaluate -42 - (-40 - -16) - -34. 16 What is the value of 27 + -30 + 5 + (0 - -8)? 10 What is the value of -18 + -3 + 34 + -4? 9 What is (-2 - (-7 + 4 + 2)) + 3 + 4? 6 Calculate (0 + -9 - (-5 + -2)) + 16. 14 What is the value of 2 - (-3 - (-8 + (11 - -2)))? 10 Calculate (2 - (-4 - 1)) + -1 - (-2 + 4). 4 Calculate 7 + -1 + 13 + -31. -12 Calculate 28 + (13 + (-6 - -2 - 8) - 4). 25 (17 - (22 + -21)) + (1 - (-1 - -8)) 10 Calculate -39 - (-13 - -10) - (-4 + 3 + -2). -33 What is the value of -37 - (-19 - (19 - 21 - (9 - 2)))? -27 Calculate -11 + -1 - ((-1 - 3) + (3 - 5)). -6 Evaluate -242 + 237 - (14 + -2). -17 -8 - ((-20 - -11) + -5) - 1 - -19 24 What is the value of (-3 + 2 - -17) + -2? 14 What is the value of 5 + -2 + 3 + (5 - 4)? 7 What is -16 + 13 - (-12 - (8 - 15))? 2 What is 23 + -30 + -2 + -3 + -5 + 10? -7 Calculate 25 + -2 + -35 + 24. 12 What is 16 + -10 - ((44 - 26) + (-6 - 1))? -5 What is (0 - -1) + (5 + (-11 - -11) - 7)? -1 What is 8 + (-7 - (-4 + 14))? -9 0 + 2 + 23 + -18 - (-1 - 0) 8 -29 + 2 - (-8 - (-2 - 5)) -26 What is 3 - (9 - (2 - -8) - (-1 - -1))? 4 Calculate 0 + 9 + -2 + 5 + -1. 11 Evaluate (-12 - -11) + 0 + -1 + 4. 2 What is 11 - (-14 + 5 - -13)? 7 What is -9 + (-7 + -8 - -3)? -21 What is the value of -12 + (19 - (-10 + 11)) - 26? -20 What is 8 + (1 - 0 - 7) + -12 + 7? -3 Evaluate 3 + (8 + -14 + 1 - (-2 - 1)). 1 Evaluate 34 + (22 - 76) + 23. 3 4 + -5 + 2 - 3 - (100 - 108) 6 Calculate 2 - (-9 - (12 - 20)) - (9 + -1). -5 What is the value of -28 + (-13 - (-13 + -11 + 5))? -22 Evaluate (0 - 10) + 41 + -28. 3 Evaluate (13 - (-42 - -15)) + -30. 10 Calculate -3 + (-32 + 39 - (0 + 0)). 4 Evaluate -5 - (0 + 1 + (-20 - (-22 + -1))). -9 Evaluate -14 + 1 + 20 + -9. -2 Calculate 10 + (12 - (-12 - (12 - 21))). 25 What is -5 - (-3 + (-1 - -2) - 4)? 1 What is the value of 21 - (1 + (8 + 2 - 10))? 20 What is (34 - (-26 - -52)) + 1 + 9? 18 Evaluate 0 + (8 - 1) + (-1 - 14). -8 What is the value of 8 - -27 - -32 - 30? 37 Evaluate (-10 - (-11 - (14 + -17))) + (-2 - -16). 12 What is (2 - 7 - -3) + 9 + (11 - 8)? 10 Evaluate ((23 - 6) + 0 - 16) + -17. -16 What is the value of 8 - (-7 + (10 + -7 - (-4 - 20)))? -12 What is (8 - (17 + 3 + 2 + -7)) + -3? -10 Calculate -2 + 11 + (5 + -6 + 4 - -2). 14 Evaluate -3 + -8 - ((-14 - -11) + 14). -22 (7 - 41) + (-4 - -65) 27 What is the value of (-14 - 7) + (-37 - -47)? -11 What is -54 + 30 - (-22 - -4)? -6 What is the value of -14 + (21 - (7 - 1))? 1 29 + -48 + 16 + (0 - 8) -11 Evaluate -3 + 10 + 0 + -1 + -2 + -1. 3 What is -18 + 12 - (25 + -19)? -12 What is (5 - -12) + -28 + 7? -4 What is the value of -73 - -54 - (-1 + -11)? -7 Calculate 562 + -569 + 0 + 1 + -2. -8 Evaluate 13 + -1 - (448 - 436). 0 Evaluate 6 + (17 - 10) - (0 - (-1 - -4)). 16 Evaluate -5 + (133 - 136) + (-2 - (-2 - -1)). -9 What is the value of 5 + -1 + -11 + -7 + 9? -5 What is the value of 5 + -10 - (3 - 0) - (8 - 23)? 7 Evaluate -24 - -22 - 12 - (2 - 1). -15 7 - (11 - (10 + 1)) 7 What is the value of 5 + (-23 - -15) - -4? 1 What is (5 - -2) + (-33 - (17 - 34)) + 11? 2 Evaluate 0 - (-25 - (6 - 26)). 5 Evaluate 1 + (-9 + 18 - (-1 - 3 - -8)). 6 Evaluate 26 + -1 + (0 - 4) + 3 + -2. 22 -1 + -1 + -1 - 2 - (-8 - -2) 1 (13 + (8 - 10) - 28) + 7 -10 10 - (2 - -6) - -16 18 Calculate (1 - 9) + (2 - 2) + (4 - -42). 38 What is (-4 - 4 - (-3 + 6)) + 8? -3 Evaluate 28 - (-15 - (-43 + 5)). 5 Calculate 21 - (-23 + 36) - (-2 + 3 - -15). -8 Calculate 9 + -9 + -2 - (-6 - -3 - 28). 29 Evaluate (-6 - 3 - 2) + 11. 0 Calculate -2 - -3 - (-23 - -25). -1 What is (2 + -6 - -2) + (-8 + 9 - -17)? 16 1 + -1 + (7 - -10) + -7 10 ((15 + -6 - -6) + -5 - -2) + -7 5 Calculate 3 + -1 + (-21 - -22) - (-2 + -2). 7 What is 24 + 4 - (-50 - -35 - (-21 + 1))? 23 What is the value of -7 + 7 + 1 + (31 - 42)? -10 173 + -162 + 2 + 3 16 Calculate 9 + -33 + 16 - 11. -19 What is (355 - 365 - (0 - 21)) + -38? -27 Calculate (69 - 69) + 5 + (8 - 2). 11 (6 - 1) + (-8 - (-19 + 10)) - 3 3 -7 - (33 + -10 - 0 - 4 - 9) -17 What is the value of (-35 + -2 - -59) + (-5 - -1)? 18 Calculate (-11 - -1) + -17 - -7 - (1 + -12). -9 Evaluate -10 - (-25 - 10) - 19. 6 (0 - 2) + 13 + -10 + (-3 - -8) 6 What is 3 + -37 - (4 - 16)? -22 What is the value of -10 - (-14 + -14 + 5)? 13 -11 - (-17 - (-4 - -2)) 4 Evaluate (8 - (4 - 6 - 1)) + (221 - 251). -19 Evaluate (-14 - (-3 + -3)) + 8. 0 Evaluate -19 - (-20 - (-22 + 7)) - (0 + 2). -16 13 - (-2 + (-22 - -31)) 6 What is (-2 - -7) + (9 - -3)? 17 0 + 12 + -2 + -10 + (0 - 2) -2 What is the value of 11 + (1 - (-4 - -2 - -4)) - 2? 8 What is the value of -183 + 184 - ((-3 - -3) + -5 + 2)? 4 -5 + -14 + 2 + -5 + 11 -11 What is (-4 - 4 - ((1 - 8) + 6)) + -15? -22 (2 - -1) + (-2 - -5) - 17 -11 Evaluate 4 + (-1 + -1 - (-2 - -3)) + 2. 3 6 - ((-2 - -6 - -1) + 9 + 5) -13 Evaluate 10 - (3 - (7 + 4 + 2 + -12)). 8 Calculate (-3 - 16) + (6 + -3 + 6 - 6). -16 What is 19 + (-17 - -13) + -14? 1 Evaluate 2 + -19 + (9 - -8). 0 Evaluate 11 - (33 + -2 + (-2 - -4)). -22 What is the value of 20 + 6 + -15 + -11 - -24? 24 What is -8 - (9 + (-18 - -4))? -3 Evaluate 8 + (22 - (18 + -4)). 16 -83 - -79 - (3 - (4 - -8)) 5 What is the value of (281 - 260) + -15 + -1? 5 -12 - -42 - 12 - (9 + -8) 17 What is (4 - 8 - (8 - (11 - 4))) + 42? 37 Calculate 0 - (3 + -2 - -6) - -1 - 0. -6 What is 1 - (-9 + -15 + 21)? 4 What is the value of 1 - (-10 - (3 - (-5 + 7 - 1)))? 13 What is the value of (18 - -12) + -21 - 27? -18 What is -3 + (122 - 141) + (1 - 0) + 3? -18 What is -8 + (-1 - 0 - (-31 - -26 - -3))? -7 Calculate (-28 - -14 - -10) + (-1 - (-20 + -2)). 17 3 + (0 - 14) - (-63 + 59) - 8 -15 What is (0 + 1 - (-6 - -10)) + -8? -11 Calculate 3 - 8 - -19 - 6 - 13. -5 What is (0 - -17 - 3) + -10? 4 2 + -14 + (58 - 42) 4 What is 23 + (-15 + 26 + -20 - (-7 - -4))? 17 Evaluate 10 - ((-3 - 6) + 7). 12 (0 - -1 - (6 + -1)) + (105 - 96) 5 Calculate -11 + ((-1 - (-9 + 1)) + -1 - 3). -8 Evaluate (-15 - (-14 + 7)) + (-11 - 1). -20 What is 114 - 104 - (1 + (8 - 4))? 5 -1 - (-4 - (9 + 2 - 2	{ "pile_set_name": "DM Mathematics" }
a litre in millilitres? 11800 What is 79/2 of a day in minutes? 56880 What is 1/4 of a century in years? 25 What is 2.7709 decades in centuries? 0.27709 How many micrometers are there in fifteen quarters of a millimeter? 3750 How many milligrams are there in twenty-one fifths of a gram? 4200 How many micrograms are there in 1.105781 kilograms? 1105781000 What is 2617063.8 months in millennia? 218.08865 What is 1/10 of a centimeter in millimeters? 1 What is five eighths of a kilometer in centimeters? 62500 What is 23382.6 centimeters in nanometers? 233826000000 How many millilitres are there in three fifths of a litre? 600 Convert 7.437039 meters to centimeters. 743.7039 How many millilitres are there in 3/5 of a litre? 600 What is fifteen quarters of a millisecond in microseconds? 3750 How many months are there in 13/5 of a millennium? 31200 What is thirty-one halves of a century in decades? 155 What is 131.61489 months in centuries? 0.109679075 What is 15.788619 microseconds in minutes? 0.00000026314365 What is one fifteenth of a hour in minutes? 4 What is 3.283749cm in millimeters? 32.83749 What is 25/2 of a minute in seconds? 750 How many millimeters are there in 469.878m? 469878 What is 13499.57 millennia in decades? 1349957 What is eight fifteenths of a century in months? 640 What is seventeen halves of a kilogram in grams? 8500 What is 3/25 of a microgram in nanograms? 120 What is 1/10 of a millennium in decades? 10 What is 10/7 of a week in hours? 240 What is 37.64722 millilitres in litres? 0.03764722 How many months are there in eight thirds of a decade? 320 What is eleven quarters of a century in months? 3300 Convert 7.922146m to millimeters. 7922.146 What is seventeen sixths of a century in months? 3400 How many seconds are there in 1/27 of a day? 3200 What is 29/5 of a millimeter in micrometers? 5800 What is 3/5 of a gram in milligrams? 600 What is 7/8 of a week in hours? 147 How many millennia are there in 0.0811629 decades? 0.000811629 How many millilitres are there in 8/25 of a litre? 320 How many microseconds are there in 19/4 of a millisecond? 4750 What is 64966.85t in micrograms? 64966850000000000 How many millilitres are there in 3/5 of a litre? 600 What is 5/4 of a day in minutes? 1800 How many millilitres are there in eighty-seven halves of a litre? 43500 What is nine tenths of a century in decades? 9 Convert 68025.44ml to litres. 68.02544 How many months are there in 52/5 of a decade? 1248 How many millilitres are there in 25/4 of a litre? 6250 What is 5/6 of a year in months? 10 How many nanometers are there in 77.85903m? 77859030000 Convert 533260.71ms to hours. 0.148127975 Convert 654883.3km to centimeters. 65488330000 What is 1669.637 kilograms in milligrams? 1669637000 What is 517482.5t in kilograms? 517482500 What is nineteen quarters of a litre in millilitres? 4750 What is 1/5 of a kilometer in centimeters? 20000 What is 46955.41 centuries in millennia? 4695.541 Convert 530140.7l to millilitres. 530140700 Convert 2887.4124 months to years. 240.6177 How many meters are there in 521600.4nm? 0.0005216004 How many kilograms are there in nineteen quarters of a tonne? 4750 What is 6116.317 millilitres in litres? 6.116317 How many milligrams are there in 0.02827kg? 28270 How many centimeters are there in 3/25 of a kilometer? 12000 Convert 96533.85l to millilitres. 96533850 Convert 8.648462 centimeters to millimeters. 86.48462 What is fourty-four fifths of a meter in millimeters? 8800 How many millilitres are there in nine tenths of a litre? 900 Convert 0.0569175 years to months. 0.68301 What is 18/5 of a litre in millilitres? 3600 What is one tenth of a millennium in decades? 10 How many nanograms are there in five quarters of a microgram? 1250 What is 1/20 of a tonne in grams? 50000 How many years are there in seventeen quarters of a millennium? 4250 Convert 17218.17 litres to millilitres. 17218170 How many months are there in twenty-one fifths of a decade? 504 What is seven halves of a millennium in years? 3500 Convert 17404.66 millennia to centuries. 174046.6 How many millilitres are there in 7/8 of a litre? 875 How many seconds are there in seventy-one quarters of a hour? 63900 What is twenty-five halves of a centimeter in millimeters? 125 Convert 792173.3mg to kilograms. 0.7921733 How many days are there in 148316.13 nanoseconds? 0.000000001716621875 What is 43/2 of a decade in years? 215 What is three fifths of a week in minutes? 6048 How many grams are there in thirty-one fifths of a kilogram? 6200 What is 169.164g in milligrams? 169164 What is twenty-nine halves of a litre in millilitres? 14500 What is 8389.414 centuries in months? 10067296.8 What is one tenth of a milligram in nanograms? 100000 What is 239.3475 nanograms in tonnes? 0.0000000000002393475 What is fifty-four fifths of a meter in millimeters? 10800 How many grams are there in three fifths of a kilogram? 600 How many microseconds are there in 31/2 of a millisecond? 15500 What is 85.39075 decades in years? 853.9075 How many millennia are there in 886158.4 years? 886.1584 How many meters are there in 34/5 of a kilometer? 6800 What is 0.3725674 millilitres in litres? 0.0003725674 How many milligrams are there in 323487.3ng? 0.3234873 Convert 69841.17ml to litres. 69.84117 Convert 189.7204 millilitres to litres. 0.1897204 How many nanograms are there in 517136.9kg? 517136900000000000 Convert 95688.65 days to nanoseconds. 8267499360000000000 How many micrograms are there in three fifths of a milligram? 600 What is 0.209567 days in milliseconds? 18106588.8 What is 457.507764 nanoseconds in weeks? 0.00000000000075646125 Convert 5.017333mm to centimeters. 0.5017333 How many decades are there in fourty-two fifths of a millennium? 840 How many micrometers are there in 3/5 of a centimeter? 6000 How many millimeters are there in 361.4504 micrometers? 0.3614504 Convert 56533.48 millimeters to centimeters. 5653.348 What is fourty-seven quarters of a tonne in kilograms? 11750 How many milliseconds are there in 610.0972 days? 52712398080 What is thirteen fifths of a decade in months? 312 Convert 0.9094594 litres to millilitres. 909.4594 How many years are there in one quarter of a century? 25 What is 725.4349ml in litres? 0.7254349 How many micrometers are there in 21433.41km? 21433410000000 How many grams are there in 152.1714ng? 0.0000001521714 What is 12625.911 months in centuries? 10.5215925 How many hours are there in 415891.3 days? 9981391.2 How many millilitres are there in fourty-three halves of a litre? 21500 Convert 1532.66883 hours to weeks. 9.12302875 How many micrometers are there in 0.7905565 millimeters? 790.5565 How many micrometers are there in seven eighths of a millimeter? 875 How many micrometers are there in nine tenths of a centimeter? 9000 What is 5.221111 litres in millilitres? 5221.111 How many meters are there in 686.2885um? 0.0006862885 How many years are there in 6.746336 centuries? 674.6336 What is 76/5 of a litre in millilitres? 15200 What is twenty-five quarters of a hour in seconds? 22500 What is one quarter of a microgram in nanograms? 250 How many micrometers are there in 93075.04m? 93075040000 What is 3/5 of a second in milliseconds? 600 How many millimeters are there in 3/8 of a meter? 375 How many hours are there in 3/8 of a week? 63 What is 37.48548ml in litres? 0.03748548 How many kilograms are there in 375299.2ng? 0.0000003752992 What is one fifth of a centimeter in millimeters? 2 How many meters are there in thirty-three fifths of a kilometer? 6600 How many hours are there in 3/28 of a week? 18 What is 81.5156 milligrams in grams? 0.0815156 How many hours are there in 61/2 of a week? 5124 What is 3.936177cm in millimeters? 39.36177 How many hours are there in eighty-one quarters of a day? 486 How many months are there in fifteen quarters of a century? 4500 How many decades are there in eleven quarters of a millennium? 275 What is fifty-seven fifths of a gram in milligrams? 11400 Convert 817.7383 decades to millennia. 8.177383 What is 0.014932 tonnes in micrograms? 14932000000 How many tonnes are there in 75.84975mg? 0.00000007584975 How many months are there in 26/5 of a millennium? 62400 Convert 40.44628 weeks to nanosec	{ "pile_set_name": "DM Mathematics" }
*3 + 83o*2 - 113o*2. -2(o + 1)*3(o + 4) Let u(k) be the third derivative of -k*6/180 - 11k*5/18 - 52k*4/9 - 68k*3/3 - 64k*2 + 4. Suppose u(f) = 0. Calculate f. -51, -2 Let i(y) = -52y*3 - 3y*2 - 4y - 1. Let k be i(-1). Factor 235a2 - 1800a - 651 - 14a4 + ka*3 + 9a*4 - 2a*3 - 5829. -5(a - 9)*2(a + 4)*2 Let w(t) = 58695t*2 - 2t - 1. Let r be w(-1). Suppose -4d + r = 22268. Determine j, given that 2j*4 + 2j*3 - 4j*2 - 9107j + dj = 0. -2, 0, 1 Let h(y) be the second derivative of y6/900 - y5/30 - 11y*4/60 + 14y*3 - 10y - 2. Let b(z) be the second derivative of h(z). Factor b(c). 2(c - 11)(c + 1)/5 Let c be (12/8)/(153/1088) - 8. Let y(q) be the second derivative of -q*5 + cq*4 + 12q*2 - 14q + 38/3q3 + 0. Factor y(v). -4(v - 3)(v + 1)(5v + 2) Let w(g) = -g2 + 79g. Suppose 11c - 58 + 3 = 0. Let p(j) = -42j. Let v(d) = cp(d) + 3w(d). Determine l, given that v(l) = 0. 0, 9 Let q be (-11)/(583/(-530)) - (-78)/(-8). Factor 3/8j2 + 5/8j + q. (j + 1)(3j + 2)/8 Suppose 33 = 238h + 33. Let k(r) be the second derivative of 0r*5 - 7r - 1/70r7 + 0 + hr*2 + 1/50r*6 + 0r*3 + 0r4. Find a, given that k(a) = 0. 0, 1 Let w(n) be the third derivative of n6/480 + n*5/60 - 7n*4/24 + 4n*3/3 - 622n2. Factor w(j). (j - 2)2(j + 8)/4 Let g(f) be the third derivative of 1/20f*5 - 199f*2 + 8f*3 + 0 + 0f + f*4. Factor g(m). 3(m + 4)*2 Let f = -12037187/7 - -1719601. Factor 2/7u*3 + f + 4/7u*2 - 26/7u. 2(u - 2)(u - 1)(u + 5)/7 Let l(p) = -p3 - 2p*2 + 25p - 2. Let y be l(4). Factor -18 + 6 + 15 + 13 - d - 2dy + 5d. -2(d - 4)(d + 2) Let p be 5/(-3) - ((-24750)/1080 - (-4 - 17)). Find d, given that -5/4d2 + pd*3 - 3/2d + 0 = 0. -1, 0, 6 Let k(p) = 9p2 - 4p + 2. Let g be 1/((-1)/((-8)/(-4) + -4)). Let m be k(g). Factor -3h - 29h*2 + mh*2 - h + 2 + h. (h - 2)(h - 1) Let y(f) be the third derivative of -8/9f3 + 0 + 210f*2 - 1/45f*5 + 0f + 5/18f4. Determine u, given that y(u) = 0. 1, 4 Let f(o) = -7o*3 + 111o*2 + 254o + 4. Let l(p) = -15p3 + 220p*2 + 510p + 10. Let c(m) = 5f(m) - 2l(m). Factor c(u). -5u(u - 25)(u + 2) Let x be -8 - (-748)/51 - (-65)/78. Let k = 0 + 0. Factor kw - xw2 - 6w*3 + 3/2w*4 + 0. 3w*2(w - 5)(w + 1)/2 Factor -1595/2q + 2544025/4 + 1/4q2. (q - 1595)2/4 Let n(m) be the first derivative of -11/20m*5 + 3/20m*6 - 1/2m*2 + 3/4m*4 - 1/2m*3 + 18 + 0m. Let k(c) be the second derivative of n(c). Factor k(d). 3(d - 1)(2d - 1)(3d - 1) Let i(v) be the second derivative of v4/78 + 341v*3/39 - 1389v. Factor i(d). 2d(d + 341)/13 Suppose -5c = -5y - 1397 - 823, 0 = y - 5c + 456. Let q = -4409/10 - y. Determine r so that -1/10r*2 + 2/5 - 2/5r + qr3 = 0. -2, 1, 2 Let b(h) be the third derivative of 2/95h*5 - 1/1995h*7 + 7/114h*4 + 0h + 1/570h6 - 171h*2 + 5/57h*3 + 0. Determine l so that b(l) = 0. -1, 5 Let r = 2167 + -2162. Let j(s) be the second derivative of -1/48s*4 + 0s*3 + 0 + 1/2s*2 + rs. Find d such that j(d) = 0. -2, 2 Let i(t) be the first derivative of -t*5/120 + 11t*4/24 - 12t*2 + t + 12. Let a(l) be the second derivative of i(l). Factor a(g). -g(g - 22)/2 Let x(p) be the third derivative of -p*5/180 + 11p*4/72 + 7p*3 + 914p*2. Factor x(y). -(y - 18)(y + 7)/3 Factor -8 - 36/5t + 28/5t*2. 4(t - 2)(7t + 5)/5 Let t(h) = 4h4 - 24h*3 - 14h*2 + 29h - 20. Let y(i) = 12i4 - 72i*3 - 44i*2 + 88i - 64. Let r(n) = -16t(n) + 5y(n). Factor r(g). -4g(g - 6)(g - 1)(g + 1) Let k(z) be the first derivative of 0z - 27/14z*2 + 6/7z*4 + 27 + 1/14z*6 - 18/35z*5 + 6/7z*3. Solve k(g) = 0. -1, 0, 1, 3 Let q(w) be the first derivative of 405w*4/4 - 1560w*3 - 1070w*2 - 240w + 2218. Suppose q(f) = 0. What is f? -2/9, 12 Let f = -444926/5 + 88986. Suppose fn2 + 4n + 16/5 = 0. What is n? -4, -1 Let j(s) = -4s2 - 50s + 46. Let l(i) = -13i2 - 106i - 79i - 32i + 138 + 64i. Let f(x) = -7j(x) + 2l(x). Factor f(g). 2(g - 1)(g + 23) Let w(n) be the first derivative of -2/3n*3 + 62 + 12n*2 + 26n. Factor w(x). -2(x - 13)(x + 1) Let c be ((-432)/(-288) - 0/(-1)) + 6/4. Let f(s) be the first derivative of 19 - 1/7s2 + 0s - 2/21sc. Determine l so that f(l) = 0. -1, 0 Let o(c) = 30c*4 + 326c*3 + 185c*2 - 632c + 79. Let y(q) = -11q2 - 1. Let i(n) = 2o(n) - 2y(n). Solve i(a) = 0. -10, -2, 2/15, 1 Let u be (-33074)/29479(-41 - 0). Factor 1/2n4 - 45n*2 + 14n*3 + un - 31/2. (n - 1)*3(n + 31)/2 Let l(y) = -y*2 - 3y + 1. Let s be l(-2). Suppose -2x = -6, 0 = -4o - 0x - sx + 25. Factor -c*3 - 2c2 - c5 + c*2 + 2c*3 + 16c*o - 15c4. -c2(c - 1)2(c + 1) Let d(n) be the second derivative of 3n5/140 - 13n*4/28 + 6n*3/7 - 8n - 76. Factor d(x). 3x(x - 12)(x - 1)/7 Let f be (-15)/108/(-6). Suppose ft - 10 = -0t - 2k, 2k + 5 = 3t. Find h such that 24h2 + h3 - 4h4 - 12h*t + 16h + 7h3 - 32 = 0. -2, 1, 2 Let v = -972489 + 972492. Factor -8/9b*2 + 2/9b*4 - 4/9b*v + 2/3 + 4/9b. 2(b - 3)(b - 1)(b + 1)2/9 Let w = 1304691/124256 + -3/124256. Factor 27/2u*2 + 3/2u*4 + wu + 3 + 15/2u3. 3(u + 1)*3(u + 2)/2 Let m(b) = -b*3 + 30b*2 + 31b + 4. Let a be m(31). Factor 3ua + 181u - 7u + 66u - 576 + 36u2 - 27u*3. 3(u - 4)*3(u + 3) Let l be (-2)/(55/(-77) + 351/(-126)). Suppose -12/7j2 + 12/7j - l + 4/7j3 = 0. Calculate j. 1 Let z = 380 + -376. Suppose 3b + l + 24 = 20, zl = -5b - 16. Determine g, given that 2/11g2 + b - 4/11g = 0. 0, 2 Let w(v) be the first derivative of 16v - 7/10v*4 + 23/5v*3 - 59 + 1/25v*5 - 68/5v*2. Factor w(c). (c - 5)(c - 4)*2(c - 1)/5 Let b(f) be the first derivative of -44 - 13f3 + 0f + 9f2 + 15/4f*4. Factor b(h). 3h(h - 2)(5h - 3) Suppose 8l + 17 = -23. Let i(h) = 3h2 - 8. Let k(a) = 4a*2 + a - 9. Let m(g) = li(g) + 4k(g). Factor m(d). (d + 2)2 Let v(s) be the first derivative of -7s*3/3 + 15s*2 + 72s - 1137. Find y such that v(y) = 0. -12/7, 6 Let x(j) = 9j4 - 25j*3 - 109j*2 - 167j - 77. Let f(w) = 2w4 - w3 - w - 1. Let d(q) = -5f(q) + x(q). Determine y so that d(y) = 0. -12, -6, -1 Suppose -5 = 5c - 5j, 3c + 86j = 82j + 4. Let 0h - 1/5h2 + c = 0. What is h? 0 Let i(v) = -2v*4 + 36v*3 + 40v*2 - 42v - 32. Let n(b) be the first derivative of -b*2/2 + b + 88. Let k(l) = i(l) - 6n(l). What is o in k(o) = 0? -1, 1, 19 Determine j, given that -76800/7 + 960/7j - 3/7j*2 = 0. 160 Let z be (2(-2)/12)/((-11)/(-55)-5). Find d such that d + 8/3d*2 + 2d*3 + 0 + 0d*4 - zd*5 = 0. -1, 0, 3 Let q(v) be the first derivative of 3v*5 + 47v*4/4 + 12v*3 + 2v2 + 2445. Find o, given that q(o) = 0. -2, -1, -2/15, 0 Let m(p) = -p3 + 28p2 - 23p - 107. Let s be m(27). Let j be 56/(-56) - (s - 2). Factor j - 11/2o2 - 1/2o*4 - 7/2o*3 - 5/2o. -o(o + 1)2(o + 5)/2 Let y = 707410 - 707407. Factor 10i - 6i*2 + 2/3i*y + 50/3. 2(i - 5)*2(i + 1)/3 Factor -2w2 - 70880 + w2 - 56699 - 68670 + 886w. -(w - 443)*2 Let q = 813225 - 813223. Solve -24/5k - 2/5kq + 26/5 = 0. -13, 1 Let k(v) = 67v*2 + 2v. Let d be k(-1). Let r = 68 - d. Suppose 8/9j2 - 8/9j*r + 0 + 0j + 2/9j4 = 0. What is j? 0, 2 Let a be -2 + 132/(-242)(-13 + 2). Let f(h) be the third derivative of -1/150h6 - 1/25h*5 - 1/15h*a + 0 - 6h*2 + 0h + 0h3. Factor f(x). -4x(x + 1)(x + 2)/5 Let p(k) be the first derivative of k*4 + 300k*3 + 25086k*2 - 51076k + 2283. Let p(m) = 0. What is m? -113, 1 Let u(n) be the second derivative of n*4/48 + 557n*3/12 - 1115n*2/8 - 48n + 20. Determine w, given that u(w) = 0. -1115, 1 Let r(h) be the second derivative of -h*6/120 + 3h*5/20 - 19h4/24 + h3/2 + 63h2/8 + 2211h. Factor r(a). -(a - 7)(a - 3)2(a + 1)/4 Let y(c) = 31c3 - 227c*2 + 246c + 50. Let g(a) = 5a3 - 38a*2 + 41a + 8. Let j(h) = -25g(h) + 4y(h). Find w, given that j(w) = 0. 0, 1, 41 Factor 0b + 6480b*3 + 0b*2 + 180b*4 + 0 + 5/4b*5. 5b*3(b + 72)*2/4 Let f = 377905 + -377901. Determine y, given that -2/5y*2 - fy + 0	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.