Datasets:

timaeus
/

pile-dm_mathematics

Dataset card Data Studio Files Files and versions Community

Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
)z(3/7)zzz/((z/z*0z)/z) assuming z is positive. z(-15/14) Simplify q11/qqq/q*(-2)q assuming q is positive. q15 Simplify (n/(n(-2/11)/n)n(-7/3))(-23) assuming n is positive. n(115/33) Simplify h7/(hhh/(h(1/6)h)) assuming h is positive. h(31/6) Simplify w(-37/2)/(w*(-3/4)ww) assuming w is positive. w(-79/4) Simplify (u0)2(u(uuuu*0u)/u)48 assuming u is positive. u192 Simplify i/(i*(-2/13)/i)ii(11/6)i assuming i is positive. i*(467/78) Simplify (k/(kk*(-2/65)/kk))/k(-17/2) assuming k is positive. k(1109/130) Simplify (j*3j/(jj7j))(-1/21) assuming j is positive. j(5/21) Simplify (y*10/y)/(yy*(-17)/yy) assuming y is positive. y*25 Simplify (((oo(-1))/o)/o(-4))/(o2/o5) assuming o is positive. o*6 Simplify ((qq/q4)/q(-2))/((q/(q/q*3)qq)/qqq(5/4)) assuming q is positive. q(-25/4) Simplify (y1)20(y/y1)(3/44) assuming y is positive. y20 Simplify (m(2/3)m)(3/2)/(m/(m/(mm/(m*3m)))m(-1/4)/m) assuming m is positive. m(23/4) Simplify ((j(3/4)j)/jj)6 assuming j is positive. j(21/2) Simplify (n(5/7))(-1/2) assuming n is positive. n(-5/14) Simplify z(-9)(z/z(2/29))/z assuming z is positive. z(-263/29) Simplify (s/s*(3/7))/sss(-2/25)/s(ss/(s(-5)s)ss)/(s(ss(5/2)/s)/s) assuming s is positive. s(1747/350) Simplify (w/((w/(w/(w/w*6w)w))/w))/(w(-1/32)w) assuming w is positive. w(193/32) Simplify (n(2/5))*(-2/11)nn(-6)n/n(-2/3) assuming n is positive. n(-562/165) Simplify (s/((s*(-10)s)/s)s(-9/2))(-21/4) assuming s is positive. s(-273/8) Simplify (c/(c/(cc/c*4))c(5/3))(22/7) assuming c is positive. c(-22/21) Simplify ((h/((h(-10)/h)/hh))/h)(3/22) assuming h is positive. h(3/2) Simplify (v(2/3)/vvv)40v(-3/4)/v(-1/3) assuming v is positive. v*(265/4) Simplify ss*0s*4(ss/s1)(-27) assuming s is positive. s(-22) Simplify ((j/((jj/(j/((j*(2/3)j)/jjj)))/j))/j)(2/93)/(j0)(2/29) assuming j is positive. j(-16/279) Simplify ((v/(v/v*(-9/2))v)/(vv/(v/v(-3/14))))(-47) assuming v is positive. v(1410/7) Simplify c(1/15)c44 assuming c is positive. c(661/15) Simplify ((g((g(-4)/gg)/g)/g)/gg)/ggg(2/25) assuming g is positive. g(-123/25) Simplify (z(-1/4))13(zz0z)(-7/4) assuming z is positive. z(-27/4) Simplify (((q(2/19)/q)/q)/q(-1))/(q/(q*(-5/6)/qq)q(1/3)) assuming q is positive. q(-349/114) Simplify (aa/a*4)/(a((a/(a*(-3/2)/a))/a)/aa) assuming a is positive. a*(-11/2) Simplify (i/(ii*(2/7)/i)ii/(i(-4)i))(1/30) assuming i is positive. i(4/21) Simplify b*(-1/6)bb2b7/(b6/bb) assuming b is positive. b(23/6) Simplify (f/(f/((f(-1/5)f)/f)))39 assuming f is positive. f(-39/5) Simplify ((ttt1)/t)(-3/44)/(t*(-1/3)/tt)(26/3) assuming t is positive. t(545/198) Simplify (v*(-4/5)(v((v/v(-1/6))/v)/v)/v)/((vv/(vv/(v/(v(-10/7)/v))))/(v(2/7)/v)) assuming v is positive. v(-1213/210) Simplify (n(-3))(-30/13) assuming n is positive. n(90/13) Simplify ((nnnn*(-2)n)(-2/57))44 assuming n is positive. n(-176/57) Simplify (j(1/3))*(-22)/((jj/(j/(jj7)))/(jj*(1/12)jj)) assuming j is positive. j(-53/4) Simplify ffff/(f/(f/(ff/f(2/7)ff)))ffff2 assuming f is positive. f(37/7) Simplify (r12r(-4/13))(-2/45) assuming r is positive. r(-304/585) Simplify (g(1/2)g(-10))(-36/5) assuming g is positive. g(342/5) Simplify ((uu*(-4/7))/((uu/(u*(-2)/u))/u))/((uu/(u/(u((uu*(-2)u)/u)/u))u)/(u/u(-1/3))) assuming u is positive. u(-68/21) Simplify z(-2/15)zzz/(zz(-3/11)z)(zz11/z)/z(2/21) assuming z is positive. z(4637/385) Simplify (j(1/4)j(-6))/(jjj(-3)j(jj0)/j) assuming j is positive. j(-23/4) Simplify (w/(w(w/(w/w(9/7)))/w))/w(10/9) assuming w is positive. w(-88/63) Simplify (x(-3)/x(3/8))(-1/23) assuming x is positive. x(27/184) Simplify ((ss(-1))(-10/17))(4/17) assuming s is positive. 1 Simplify (v2(v/v(-1))/v)(4/7) assuming v is positive. v(12/7) Simplify (z/(z/z0))10(zz0)(-48) assuming z is positive. z(-48) Simplify (p(-1/5)p/(p/(pp(p*(-2/9)p)/p))p)/((p(-3/7)/p)/(p1p)) assuming p is positive. p(1892/315) Simplify (f12)(-42) assuming f is positive. f(-504) Simplify ((q/((qqq(1/25)/q)/q))/q)/q(1/15) assuming q is positive. q*(-8/75) Simplify (yy*(-8)y)/y*(-1/6)(yyy/y*(2/9)y)4 assuming y is positive. y(167/18) Simplify (y*8y)(-1/76) assuming y is positive. y(-9/76) Simplify a*14a14 assuming a is positive. a28 Simplify (o(4/9))(-2/123) assuming o is positive. o(-8/1107) Simplify ((g(2/5))(6/11))(13/6) assuming g is positive. g*(26/55) Simplify ((k/(k/((kk(k/(k(1/4)/k)kk)/kk)/k)))(4/7))(1/57) assuming k is positive. k(1/21) Simplify (((o/(o/(o(-2/9)/ooo)o))/oo)(-31/2))(3/22) assuming o is positive. o*(31/66) Simplify ((yyy(2/3)yy)/y)31((((yy/y(-1/6))/y)/y)/y)/(y/y0) assuming y is positive. y(671/6) Simplify a(-3/29)a*(2/11)aa assuming a is positive. a(663/319) Simplify (u(-2)/u)44((((uu(-1)u)/u)/u)/u)(-26) assuming u is positive. u(-80) Simplify (zz(4/5)zz)/z16 assuming z is positive. z(-61/5) Simplify n/(n(-7)n)n(2/7)(n((n/(n/n0))/n)/nn)/nn(-1) assuming n is positive. n(37/7) Simplify ((z(-1))(-9/8))(3/11) assuming z is positive. z(27/88) Simplify d/(d/d(1/8))d/(d*(-19)/dd) assuming d is positive. d(161/8) Simplify (d(1/4)/(d/d*(-1/6)d))/(d(-1))15 assuming d is positive. d(157/12) Simplify (c(-12))(5/6) assuming c is positive. c(-10) Simplify (z/z*3z)/(zzz*(-3)/z)z(-1/3)/z(-3) assuming z is positive. z*(11/3) Simplify ((tt/((t/(t*6t))/t))/(t/(tt(5/4))))/(t(-2)/((t/((t(-2/9)t)/t))/t)) assuming t is positive. t(449/36) Simplify (z(-1/4)/z3)(-1/58) assuming z is positive. z(13/232) Simplify j/j(2/19)j(4/15) assuming j is positive. j(331/285) Simplify y(-3/13)((y/(yyy/(y*(-1/6)yy)y))/y)/y assuming y is positive. y*(-265/78) Simplify (((pp/p*(-2/11)pp)/p)/p(-2/5))2 assuming p is positive. p(394/55) Simplify (s(-3))16 assuming s is positive. s(-48) Simplify g(-4/7)g*(-4)/gg assuming g is positive. g(-32/7) Simplify (y(-2))*(-10)(y(1/5))(-2/7) assuming y is positive. y(698/35) Simplify ((((m/m(1/5))/m)/m)(-1/16))14 assuming m is positive. m*(21/20) Simplify ((jj/j*(-1/3)j)/jj)/(j/(j(jjj/((j((jj*(2/5)j)/j)/jj)/jj))/j))(jj/(j/j5))/j(2/5) assuming j is positive. j(128/15) Simplify (u(-5/3)uuuu*5)/((u/(uu(2/11)))/(u(-4)u)) assuming u is positive. u(116/33) Simplify w(-4/3)/w(-2/55) assuming w is positive. w(-214/165) Simplify bb/(b*(-12/11)/bb)b/(b/((b(bb(-8)b)/b)/b))b assuming b is positive. b(-32/11) Simplify (pp(-2/5))46/((((p/p*(-5))/p)/pp)/p(2/15)) assuming p is positive. p(341/15) Simplify (g(-3/10)/g1)/(g/g2)(3/14) assuming g is positive. g*(-38/35) Simplify (y(y((yy*4)/y)/yy)/yyy/(y*(-1)/y))/(yy*(-2/7)yy)(3/13) assuming y is positive. y(762/91) Simplify u/(uu/((u/(uu(-42)))/u))u(2/51)/u assuming u is positive. u(1991/51) Simplify ff(-41)f(-2)/f assuming f is positive. f(-43) Simplify v/(v/(vv(v*(2/7)v)/vv)v)vv(2/47)/v assuming v is positive. v(766/329) Simplify ((ggg*(2/25)g)/(g/(ggg(2/5)/g)))/(g(-1/2)/(g/(gg/(g(-5)/g)))) assuming g is positive. g(-151/50) Simplify (tt*(2/13))/tt/(t*(2/7)t)t8t(t/t3)/t assuming t is positive. t(534/91) Simplify (f7f(f/((f/(ff((f/f6)/f)/f))/f))/f)(-13) assuming f is positive. f(-39) Simplify w(-2)/(w(-2/11)/w) assuming w is positive. w(-9/11) Simplify n(-5/3)/nn(n/(n/n(-16))nn)/n assuming n is positive. n(-50/3) Simplify (u7/(uu(-9)/u))(-29/3) assuming u is positive. u(-464/3) Simplify (n/(n2/n))*(-8/15)n*(-6)n(-2/25)/n assuming n is positive. n(-177/25) Simplify (m/m7)(-2/23) assuming m is positive. m**(12/23) Simplif	{ "pile_set_name": "DM Mathematics" }
rom {e: 2, x: 1, w: 5, y: 1}. Give prob of picking 1 w and 1 y. 5/36 What is prob of picking 1 n and 1 g when two letters picked without replacement from {g: 4, t: 8, n: 8}? 16/95 Calculate prob of picking 2 a and 2 z when four letters picked without replacement from qzaaqzaqaa. 1/21 Three letters picked without replacement from {t: 6, o: 1, m: 4, k: 3, y: 2}. Give prob of picking 2 k and 1 t. 9/280 Four letters picked without replacement from {l: 9}. What is prob of picking 4 l? 1 Three letters picked without replacement from hhhhhhhhh. Give prob of picking 3 h. 1 What is prob of picking 3 l and 1 k when four letters picked without replacement from klkkllkk? 1/14 Three letters picked without replacement from {d: 2, c: 3}. Give prob of picking 3 c. 1/10 Calculate prob of picking 2 c when two letters picked without replacement from scsssscsssssssscsc. 2/51 Two letters picked without replacement from {w: 4, e: 2}. Give prob of picking 1 w and 1 e. 8/15 What is prob of picking 3 x when three letters picked without replacement from xxx? 1 What is prob of picking 1 c and 1 i when two letters picked without replacement from {p: 1, i: 5, m: 2, c: 2, b: 4, g: 1}? 2/21 What is prob of picking 1 j and 3 s when four letters picked without replacement from {j: 1, d: 9, s: 9}? 7/323 Two letters picked without replacement from {u: 1, m: 4, h: 2, q: 2, r: 3}. Give prob of picking 1 m and 1 h. 4/33 Two letters picked without replacement from {e: 1, m: 2, d: 1}. What is prob of picking 1 m and 1 d? 1/3 Calculate prob of picking 1 k, 1 r, 1 d, and 1 t when four letters picked without replacement from kkddkrrktdykktyr. 27/455 Two letters picked without replacement from yaa. Give prob of picking 1 a and 1 y. 2/3 Calculate prob of picking 3 f when three letters picked without replacement from lftttftftftftltt. 1/56 Calculate prob of picking 2 c and 1 r when three letters picked without replacement from scryzczcc. 1/14 What is prob of picking 2 y, 1 f, and 1 w when four letters picked without replacement from wywwfufiyiiiuyiwif? 1/85 Two letters picked without replacement from {c: 4, l: 1, n: 2, j: 2}. Give prob of picking 2 j. 1/36 What is prob of picking 2 o and 2 q when four letters picked without replacement from {o: 10, q: 4}? 270/1001 Calculate prob of picking 1 g and 1 f when two letters picked without replacement from {g: 1, z: 1, i: 1, y: 1, f: 1}. 1/10 What is prob of picking 1 n and 2 e when three letters picked without replacement from ddeneqqeddeeeq? 15/364 Three letters picked without replacement from {f: 10, u: 4}. Give prob of picking 2 u and 1 f. 15/91 What is prob of picking 2 a, 1 k, and 1 b when four letters picked without replacement from {t: 1, k: 1, m: 2, b: 1, a: 12}? 33/1190 Two letters picked without replacement from {z: 6, e: 6}. What is prob of picking 1 e and 1 z? 6/11 Two letters picked without replacement from {q: 1, a: 17, e: 1}. What is prob of picking 1 q and 1 e? 1/171 What is prob of picking 1 z and 1 p when two letters picked without replacement from pkfqwqpwzkfpfp? 4/91 Four letters picked without replacement from llevvlxllzlllevzzxx. Give prob of picking 3 z and 1 v. 1/1292 Four letters picked without replacement from {t: 3, j: 3, g: 4, z: 3, w: 3}. Give prob of picking 1 w, 2 z, and 1 j. 27/1820 What is prob of picking 1 z and 2 l when three letters picked without replacement from lzzzqllllzzll? 105/286 Calculate prob of picking 1 x and 1 b when two letters picked without replacement from bxbxxx. 8/15 Calculate prob of picking 1 s and 1 h when two letters picked without replacement from htebs. 1/10 Calculate prob of picking 4 n when four letters picked without replacement from {b: 3, n: 5}. 1/14 Three letters picked without replacement from nyjsnjunnjunsyn. What is prob of picking 1 s and 2 n? 6/91 Four letters picked without replacement from {f: 1, r: 2, b: 2, z: 1, s: 1, l: 2}. Give prob of picking 2 r, 1 f, and 1 z. 1/126 Three letters picked without replacement from ajjjjan. Give prob of picking 1 a and 2 j. 12/35 Three letters picked without replacement from qqeeeeqeqqqq. Give prob of picking 1 q and 2 e. 7/22 Three letters picked without replacement from {u: 4, b: 3}. Give prob of picking 2 b and 1 u. 12/35 Four letters picked without replacement from {c: 9, i: 1, k: 1}. Give prob of picking 1 i and 3 c. 14/55 Two letters picked without replacement from {q: 11, h: 9}. Give prob of picking 2 h. 18/95 Four letters picked without replacement from hpcbpplbhlpbppiihc. What is prob of picking 1 p, 1 b, and 2 l? 1/170 Calculate prob of picking 1 f and 1 z when two letters picked without replacement from {p: 1, f: 2, z: 1}. 1/3 Four letters picked without replacement from {e: 3, n: 3}. Give prob of picking 1 n and 3 e. 1/5 What is prob of picking 1 a, 1 m, and 2 s when four letters picked without replacement from smsssmaaaasmaam? 16/91 Calculate prob of picking 1 h and 1 o when two letters picked without replacement from fffhffhoo. 1/9 What is prob of picking 2 c when two letters picked without replacement from {c: 5}? 1 What is prob of picking 1 d and 2 e when three letters picked without replacement from eeddddd? 1/7 Three letters picked without replacement from lxlllllxxxxxxlxx. What is prob of picking 2 l and 1 x? 27/80 Calculate prob of picking 3 u and 1 k when four letters picked without replacement from pkspkpkksukukkuks. 2/595 Calculate prob of picking 1 l, 1 j, 1 f, and 1 y when four letters picked without replacement from llrbybjf. 1/35 Four letters picked without replacement from {b: 1, u: 1, a: 2, f: 1, r: 3, s: 5}. Give prob of picking 1 f and 3 r. 1/715 Two letters picked without replacement from mftxc. What is prob of picking 1 m and 1 f? 1/10 What is prob of picking 2 h and 1 b when three letters picked without replacement from {b: 2, h: 2, t: 4, r: 1}? 1/42 Two letters picked without replacement from {k: 1, w: 1, e: 4, h: 5, i: 4}. What is prob of picking 1 e and 1 h? 4/21 Three letters picked without replacement from {i: 11, k: 5}. Give prob of picking 1 k and 2 i. 55/112 Two letters picked without replacement from {n: 2, e: 6, y: 1, f: 3}. Give prob of picking 1 f and 1 n. 1/11 Calculate prob of picking 1 u and 3 q when four letters picked without replacement from {u: 1, q: 12}. 4/13 What is prob of picking 2 y when two letters picked without replacement from fyfyyffffyfffy? 10/91 Two letters picked without replacement from wnbsbhn. What is prob of picking 1 h and 1 b? 2/21 Calculate prob of picking 1 g and 1 d when two letters picked without replacement from {v: 2, g: 2, d: 1}. 1/5 Two letters picked without replacement from rktakkaeteeektree. What is prob of picking 1 r and 1 e? 3/34 What is prob of picking 4 a when four letters picked without replacement from {a: 7, p: 7}? 5/143 Four letters picked without replacement from {v: 1, b: 8, j: 10}. Give prob of picking 3 j and 1 v. 10/323 Four letters picked without replacement from uiuvuviiiixxivivxixi. What is prob of picking 1 u and 3 v? 4/1615 What is prob of picking 1 k, 1 j, and 1 n when three letters picked without replacement from nnkjnkjjkkjj? 3/11 Calculate prob of picking 3 o and 1 s when four letters picked without replacement from {b: 1, o: 1, v: 1, s: 10}. 0 Calculate prob of picking 2 j when two letters picked without replacement from kkgjkjajkjkkbkkkjf. 10/153 What is prob of picking 1 g and 1 c when two letters picked without replacement from qgc? 1/3 What is prob of picking 2 u and 2 h when four letters picked without replacement from {u: 7, i: 3, h: 3}? 63/715 Four letters picked without replacement from fllqkklqkllqk. What is prob of picking 4 k? 1/715 Two letters picked without replacement from jwr. What is prob of picking 1 w and 1 j? 1/3 Calculate prob of picking 1 d and 1 e when two letters picked without replacement from {g: 6, j: 1, a: 2, y: 1, d: 3, e: 2}. 2/35 What is prob of picking 2 e and 1 c when three letters picked without replacement from {c: 2, e: 3, h: 6, x: 2, w: 2}? 6/455 Calculate prob of picking 1 p and 1 z when two letters picked without replacement from tttttzzpzzoi. 2/33 What is prob of picking 1 t and 1 r when two letters picked without replacement from {v: 1, t: 1, m: 1, e: 3, r: 1, q: 6}? 1/78 Three letters pi	{ "pile_set_name": "DM Mathematics" }
6). Which is smaller: f or z? z Let a = -0.734 - -30.004. Let z = 29 - a. Are 1 and z unequal? True Suppose 9 + 0 = 3v. Suppose 2j = -5n + 16, 2n - 5 + v = -3j. Which is greater: -1 or j? -1 Let j be 230/8 + (-7)/(-28). Let k = -30 + j. Is k < 1/4? True Suppose 3m - 49 - 44 = -w, 0 = 3w + 5m - 283. Suppose 5v - w = 2n, -2v - v = -5n - 50. Let f be (-28)/v - (0 - 1). Which is smaller: 1 or f? f Let b = -4 + 4. Let c = -17.5 + 16.3. Which is greater: b or c? b Let o(u) = -u*2 - 6u + 3. Let b be o(-6). Suppose 0 = bd - 5d. Is d greater than -2/11? True Let u = -774 + 775. Let x be (-178)/(-92) + (1 - 3). Are x and u non-equal? True Let m(i) = 2i3 + 6i - 11. Let u be m(2). Which is bigger: 0.09 or u? u Suppose 3x + 4q - 28 = 0, x + q = -4x + 24. Suppose xa - 21 = -5p, 0a + 17 = p + 4a. Which is smaller: p or 23/3? p Suppose 2o = 3o - 5. Suppose -9m + 5m + 3b + 2 = 0, -5b = 3m - 16. Suppose o = mq + 9. Is -3 greater than q? False Let a be (-10)/(-6)22/407. Let j = a - -1444/1221. Which is smaller: j or 1? 1 Let d = -243.01 - -243. Is d >= -20/9? True Suppose 1 + 44 = 5g. Suppose -13 = -2u + g. Which is smaller: 1/3 or u? 1/3 Let o = -4 - -4. Suppose o = v + 10 + 2. Let q be v/228/(-12). Which is smaller: -1 or q? -1 Let y = 850 + -879. Is y >= -26? False Suppose 0 = k - 5g + 17, -33k + 12 = -34k + 4g. Which is greater: k or 170/23? k Let r = -1.143 - -0.143. Let b = 11 - 7. Let o = b - r. Which is greater: o or 1? o Let p = -1.42 - -1.52. Is p less than or equal to 8/29? True Let i = 10 - 36. Let q = -25.96 - i. Is q greater than -1? True Let x = -8.99 + 0.89. Let g = -8 - x. Which is smaller: -0.2 or g? -0.2 Let m(t) = 23t + 161. Let p be m(-7). Is p not equal to 1/35? True Let y = 24888/19 + -1310. Which is smaller: 0.1 or y? y Let h be 1322/(-22) + -6 + 8 + -3. Let s = -141770/2321 - h. Which is smaller: -1 or s? -1 Let g = -12.7 - -6.8. Let n = g - -1.9. Is n not equal to 2? True Let f = -3 - -4. Let r be 2/33/f. Do 2 and r have the same value? True Let l be 8349/(-48) - 0/(-2). Let h(w) = w3 + 4w2 - w - 34. Let o be h(-7). Let p = l - o. Which is smaller: 0 or p? 0 Let f(q) = q2 - 6q - 4. Let l be f(6). Let h be (-488)/18 - l/(-18). Let p = h + 245/9. Is 0 greater than or equal to p? True Let l be -4(3 - (-3)/4). Let h = 13 + l. Let c(k) = -k*3 - 2k*2 + k. Let n be c(h). Which is greater: n or 0.01? 0.01 Let u = -2.75 + 2.75. Are -60 and u nonequal? True Let t = -11.866 + -0.234. Let s = t + 0.1. Let a = s - -11. Which is bigger: 10 or a? 10 Suppose 4h + 3u - 13 = 0, 2h + 0u + 3u = 5. Suppose ho = -39 + 7. Let s(b) = b2 + 8b. Let x be s(-7). Which is bigger: o or x? x Let t(s) be the third derivative of -s5/60 + s4/4 + 2s2. Let v be t(6). Suppose v = -19b + 22b - 12. Is 5 >= b? True Let d(z) = z3 + 12z*2 - 11z + 14. Let p be d(-13). Let i be p/16 + (-1)/4. Which is smaller: i or -11/6? -11/6 Let y = -493 - -2025/4. Which is smaller: y or 1? 1 Let c(m) = -m*3 - 24m*2 - 22m + 22. Let q be c(-23). Does q = -2/87? False Let m be 2 - 0(-3)/(-3). Suppose 1 - m = -v. Let s be -2v/30-2. Which is smaller: s or -1? -1 Let x = 219 - 224. Is -5 greater than x? False Let f = -9495 + 3807498/401. Is 0 less than or equal to f? True Let y = -11 + 11.17. Let s = y - 0.11. Let g = s + -4.06. Are g and 0 non-equal? True Let c = 34 + 25. Let p = -473/8 + c. Is -0.1 < p? False Let l(i) = i2 + i - 2. Let g be l(-9). Let r be (-42)/g(-10)/3. Which is greater: 1/2 or r? r Let x = -13 + 10. Let j be (10/x + 3)33. Let b be -1 + (-4)/154/24. Do b and j have different values? True Suppose -2l - 6 + 18 = 0. Suppose 2g - 2 = -0k + k, 0 = -5g + 3k + l. Is 2 smaller than g? False Let f be (-9)/121024/72. Is f greater than or equal to -10? False Let y(i) = 6i - 1. Let h(s) = 11s - 3. Let l(n) = -4h(n) + 7y(n). Let t be l(2). Which is smaller: t or 1/10? 1/10 Let t(o) = 4o3 - o2 + 3o - 2. Let k be t(1). Suppose -kf = 6f - 480. Which is bigger: f or 50? 50 Let l = -932 + 899. Which is smaller: -35 or l? -35 Let t(h) = -h*2 - 8h + 21. Let j be t(-10). Which is smaller: -2/121 or j? -2/121 Let f(l) be the second derivative of -l*3/6 + 15l*2/2 - 7l. Let s be f(12). Let u = -9 + s. Is -6 smaller than u? False Let q = -21 + 26. Let s(b) = -3b + 13. Let c be s(q). Let x = -4 - -4.07. Which is greater: c or x? x Let h = -218 - -220. Is 18/7 greater than or equal to h? True Let z = 28/19 - 93/76. Let m = -1.9 + 2.94. Let g = -0.04 + m. Which is smaller: z or g? z Suppose 10 + 15 = -5m, 0 = 4q - 3m - 511. Suppose 13h = 9h + q. Is h greater than 31? False Let f be -3 + (-67)/(-6) - 4/24. Let u be (-4)/(f/6)6/(-66). Which is greater: -0.3 or u? u Let v(r) = r - 1. Let f be v(5). Which is greater: f or -4? f Let t = 9.19 - 8.19. Which is bigger: t or 1.58? 1.58 Let d be (-7)/15(-9)/(-2). Suppose -17s - 26 = -9. Is s >= d? True Suppose 4v - 3i + 3030 = v, 3v + 5i + 3038 = 0. Is v at most as big as -1010? True Let b(a) = -a3 + 8a*2 - 11a - 6. Let v = 137 + -131. Let o be b(v). Is -7/20 smaller than o? True Let c(g) be the first derivative of -g*3/3 - 4g*2 - 3g - 7. Let p be c(-7). Suppose -5a + 6 + p = 0. Which is smaller: 3/5 or a? 3/5 Let j be (1 - 2) + 2 - 7. Let d = 10 + j. Let q be (-3 - -2) + (d - 3). Which is smaller: -2/5 or q? -2/5 Let k = -446583050/621 + 719135. Let h = -7/27 - k. Is 1 smaller than h? False Let o(c) = 3c - 7 - 2 - 6c - 1. Let q be o(-5). Suppose 0 = qp - 3p + 2. Does p = -1/8? False Let t be (-2)/27 + (-2203)/27. Which is smaller: -83 or t? -83 Let r(g) = g2 - 12g + 4. Let l be r(12). Suppose 2 = -2i + li, -4y = 2i + 70. Are y and -16 non-equal? True Suppose -9s = -6s. Let i = 7 - 4. Let z be 1s/(i + -1). Is 0 > z? False Suppose -o + 5 = 4o. Let u be (-1 + 19)o/3. Let b be 3 - u/52. Which is smaller: 0 or b? 0 Let k(f) = -36f + 386. Let p be k(7). Which is smaller: 135 or p? p Let s be -7 - (-6)/(-4)(-150)/45. Which is smaller: s or -45/31? s Let f = -1.5298 - -0.0298. Let b = -0.2 - -0.2. Which is smaller: b or f? f Let h = 21.16 - 27. Which is smaller: h or 0? h Let g = 2 - 3. Let q be (-1 - 13/(-5))60/80. Which is greater: g or q? q Let s be (-6)/14 - (-6 - (-1349)/(-77)). Let z = s - 6317/275. Is z greater than 2/5? False Let o = -8132/49 - -166. Which is smaller: o or -1? -1 Let x be 54/6 + 2301/(-260). Which is smaller: x or 1? x Suppose -14v + 10v = 0. Suppose 10 = -2i - 5x - 12, -3i - 2x - 22 = v. Which is bigger: i or -5? -5 Let k = 141 - 249. Let s = 100 + k. Suppose 8 = 4d, 2d + 11 + 9 = -3o. Is s bigger than o? False Let y be 33/4280/15. Let i be 16/y + 14/77. Which is smaller: i or -2? -2 Suppose 0 = -0f - 3f + 27. Suppose f = -6i - 69. Which is smaller: i or -14? -14 Let u be 5/2 + (-3)/6. Let p(g) = -g*2 + 4g - 3. Let f be p(u). Let t be (-2)/(3/1 - 1). Which is smaller: f or t? t Suppose -46q - 25q + 3692 = 0. Is 62 bigger than q? True Let p = -27.5696 + -0.0304. Which is bigger: p or 0? 0 Suppose 2486 = 12t + 38. Are t and 208 unequal? True Suppose -4q - q = -15. Suppose qa + 3 - 18 = -s, 0 = -5a + 4s + 42. Let p be (-1)/a + (-78)/36. Are -2 and p unequal? True Let d = -33 - -35. Suppose 12 = -5m + d. Let s be m + (-4)/((-12)/3). Which is smaller: s or -3? -3 Let h = -788.09 - -788. Which is bigger: -0.15 or h? h Let b = 25.55 - 25.5. Which is smaller: -2/13 or b? -2/13 Let n = -2850 + 2848. Let s be 36(-8)/(-9). Which is bigger: n or s? s Let i be 26/(0 + 2 + 0). Let g = i - 8. Suppose 8b = 4b - 2o - 8, -20 = go. Is b >= 1/10? False Let p = -217.31 + 217.3. Which is greater: p or -22? p Let y = 43 - 45. Let c be ((-6)/y - 8)(-20)/25. Which is greater: 14/3 or c? 14/3 Let q = 1.05 + -86.05. Let f = q - -84.8. Is -1.2 at most as big as f? True Let u(f) = -3f*3 - 10f*2 + 8f - 17. Let h be u(-6). Does h = 221? False Let z = -21/17 - -749/510. Which is smaller: 0 or z? 0 Let f = 251 - 239. Let x = 0.01 + -0.11. Which is greater: f or x? f Suppose 56u - 27u - 116 = 0. Let z(c) = c2 - c - 4. Let n be z(3). Which is bigger: n or u? u Let c(b) be the first derivative of -b4/4 - 5b3/3 + 9b*2/2 + 7b + 11. Let r be c(-6). Are r and -11 equal? True Let	{ "pile_set_name": "DM Mathematics" }
-465b Let h(m) = 4m*2 - 2m - 6220. Let v(o) = 20o. Give h(v(r)). 1600r*2 - 40r - 6220 Let g(z) = -z. Let x(b) = b. Let t(j) = -g(j) - 2x(j). Let s(r) be the first derivative of -23r3/3 + r2/2 + 4518. Determine t(s(c)). 23c2 - c Let d(y) = -3940y. Let g(r) = -26r2 + 18r - 30. Let n(v) = 4v2 - 3v + 5. Let z(h) = g(h) + 6n(h). Give z(d(a)). -31047200a*2 Let z(i) = -21i. Let n(a) = -2a2 + 204615. Calculate n(z(t)). -882t*2 + 204615 Let n(d) = 6d - 3112. Let g(x) = -541x2. Determine n(g(f)). -3246f*2 - 3112 Let h(w) = -w. Let o(z) = -3255052z. What is h(o(g))? 3255052g Let y(o) = -217o + 918o + 124o. Let v(x) = -4x. Determine y(v(c)). -3300c Let u(t) = -t*2 - 192638. Let f(y) = 9y*2. Give u(f(n)). -81n*4 - 192638 Let b(w) = w. Let d be 1/6 - 964/24. Let f be -3 + d/15-3. Let x(c) = fc + 2c + 2c. Determine b(x(y)). 9y Let m(x) be the first derivative of -10x3/3 + 2x*2 + 3384. Let h(t) = 4t*2. Calculate h(m(g)). 400g*4 - 320g*3 + 64g*2 Let k(a) = 20173435a. Let h(s) = -2s. What is k(h(d))? -40346870d Let l(p) = 2p2 + 278p. Let x(i) = 12055i - 7. Calculate x(l(a)). 24110a*2 + 3351290a - 7 Let h(x) be the third derivative of -7x4/2 + 76x*2 + 4x. Let n(z) = 27z2. What is n(h(p))? 190512p*2 Let m(r) = -2r*2. Let c(h) = -399h*2 - 48. Let b(v) = -5585v*2 - 660. Let d(z) = 4b(z) - 55c(z). Determine m(d(o)). -312050o*4 Let y(a) = 32a*2. Let k(g) = -70g*2 + 52061. Give k(y(i)). -71680i*4 + 52061 Let t(s) = 1028s - 1. Let h(z) = 3409z. Determine t(h(m)). 3504452m - 1 Let y(p) = 45p - 140p + 83p. Let v(x) be the first derivative of -x3/3 + 11. What is v(y(o))? -144o*2 Let n(v) = 15v. Suppose y - 9 = 228c - 225c, -c - 14 = -4y. Let z(h) be the second derivative of 0h*y + 0 - 4h + 0h2 + 1/6h*4. Give z(n(t)). 450t*2 Let v(y) be the third derivative of 19y*5/10 - 134y*2. Let q(o) = 6o*2. Give q(v(m)). 77976m*4 Let b(a) = -534474a*2. Let x(f) = 21f. Calculate b(x(u)). -235703034u2 Let b(v) = -5v + 22. Let r(k) = -10897k + 1. Calculate b(r(m)). 54485m + 17 Let l(c) = 8c. Suppose -32v = 9v - 82. Let p(g) = -69g*2 - 7 + 123g*2 + 7 - 68g*v. Determine l(p(r)). -112r*2 Let z(p) = 11p*2 + 143p + 8. Let h(f) = 5f2 + 66f + 4. Let l(i) = -13h(i) + 6z(i). Let w(j) = -2j. Determine w(l(a)). -2a*2 + 8 Let o(j) = j - 8. Let l(a) be the first derivative of 36a*2 + 1943. Give o(l(r)). 72r - 8 Let c(s) = -s. Let a(w) = 8408017w. Calculate c(a(d)). -8408017d Let g(o) = -2o2. Let h(y) = -3. Suppose f = 3f - m + 1371, 0 = 2f + 3m + 1367. Let v(x) = 137x - 2055. Let j(d) = fh(d) + v(d). Calculate g(j(t)). -37538t2 Let t(l) = -99 - 2246l*2 + 2248l*2 + 99. Let h(n) = -5n*2 + 18n*2 + 9n*2. Give h(t(g)). 88g*4 Let v(t) = 14018095t*2. Let f(o) = 2o. Give f(v(c)). 28036190c2 Let y(s) = -s2. Let c(n) = 43n + 14. Let h be c(6). Let x be (6/(-4))/(2(-4)/h). Let i(o) = -53o*2 - xo*2 + 105o2. Determine i(y(a)). a4 Let h(n) = n*2. Let b(g) = -9 - 655g + 47 + 659g. Give h(b(u)). 16u*2 + 304u + 1444 Let q(h) = -29h - 21. Let z(t) = -12t - 9. Let g(i) = -3q(i) + 7z(i). Let a(k) = 2k + 5. Let u(b) = 1. Let n(x) = a(x) - 5u(x). What is g(n(o))? 6o Let h(n) = 8n*2 + 8n + 1. Let j(d) = -110d. Give j(h(x)). -880x*2 - 880x - 110 Let o(h) = -2175h. Let u(j) = 5j + 60. Calculate o(u(w)). -10875w - 130500 Let q(f) = -392f*2. Let r(z) = 123303z*2 - 61655z*2 - 61653z*2. What is q(r(c))? -9800c*4 Let c(a) = 2442387a*2. Let n(l) = -13l*2. What is n(c(k))? -77548305350997k*4 Let x(g) = 3g2 + 1118927 - 2237872 + 1118924. Let j(a) be the first derivative of a3/3 - 1. Give x(j(u)). 3u4 - 21 Let t(f) = 2464f + 2452f - 4227f. Let b(v) = 2v. Give t(b(c)). 1378c Let d(m) = 906m. Let j(k) be the third derivative of -5k*4/24 - 9239k*2. What is d(j(t))? -4530t Let c(g) = -7g. Let q(m) = -51890m. Calculate c(q(b)). 363230b Let i(v) = -80162v - 22648. Let x(j) = 1479j + 418. Let r(w) = 11i(w) + 596x(w). Let h(y) = -13y. Calculate h(r(z)). 3874z Let s(j) = -38j. Let w(l) = 1553059l2. What is w(s(q))? 2242617196q*2 Let c(p) = 85p*2. Suppose -25s - 4x = -24s - 58, 3x = -3s + 165. Let q(a) = -sa + 33a + 23a. Determine c(q(n)). 340n*2 Suppose 6m = 7m - 29. Let t(j) = -mj + 68j - 41j. Let g(u) = 7u. What is g(t(c))? -14c Let s(l) = 4l - 3. Let j(h) be the third derivative of 11h*4/12 + 566h*2. What is s(j(a))? 88a - 3 Let x(r) = -2r2 + 24r. Let a(n) = -106n + 2. Let y(g) = -3960g + 75. Let h(j) = -150a(j) + 4y(j). What is x(h(c))? -7200c2 + 1440c Let y(n) = -40n2 + 42. Let a(z) = -6955z. Determine y(a(l)). -1934881000l2 + 42 Let c(o) = 2o. Let b(j) = j - 6. Suppose -6s - 4 = -10s. Let q(p) = 1. Let i(h) = sb(h) - 5q(h). Let l(v) = 2. Let k(n) = -2i(n) - 11l(n). Give c(k(y)). -4y Let v(t) = -28t*2 + 42t*2 + 79t - 79t - 17t2. Let h(j) = j2 - 13j + 15. Let s be h(12). Let r(b) = -s + 30b - 1 + 4. What is v(r(c))? -2700c2 Let m(i) = 6i + 6. Let y(q) = -2q2 + 2q + 23394. What is y(m(t))? -72t2 - 132t + 23334 Let t(s) = -6377s2. Let k(c) = -12c + 12. What is k(t(v))? 76524v2 + 12 Let f(n) = -6n*2. Let x be ((-324)/(-72))/(2/72). Let c(w) = -81w - 81w - 14w*2 + xw. Determine c(f(r)). -504r4 Let t(j) = -j3 - 14j*2 - 11j + 28. Let w be t(-13). Let z(u) = -5uw + 24u*2 - 17u*2. Let n(y) = 2y*2 + 58y. What is n(z(p))? 8p4 + 116p*2 Let f(q) = -9q. Let b(k) = 2 - 2 - 1. Let u be 6/(-12) - (-2)/(-4). Let l(i) = 3i - 1. Let m(y) = ub(y) + l(y). Calculate m(f(r)). -27r Let k(a) = 2a. Let s(z) be the second derivative of 137z3/6 - 34z + 12. Calculate s(k(l)). 274l Let d(x) = -7x - 1. Let j(p) = 6125p + 1375. Let f(v) = -2750d(v) - 2j(v). Let z(u) = u. Give z(f(n)). 7000n Let m(s) = s - s - 2s2. Let l(z) = -3z + 10. Let n(g) = -2. Suppose 9o - 17o - 40 = 0. Let r(v) = on(v) - l(v). Determine m(r(f)). -18f2 Let z(p) = -p2. Suppose -2m - 3 = -7. Let o = -889 + 909. Let i(q) = -2q*2 - oq*m + 3q*2. Calculate z(i(y)). -361y*4 Let t(k) = -2k - 7. Suppose -15 = -5g + v - 0, 4g = 2v + 18. Let j(u) = -1114u + 0ug + 1114u - u*2. What is j(t(w))? -4w*2 - 28w - 49 Let f(z) = 5z. Let i(k) = -65k. Let c(r) = 40f(r) + 3i(r). Let o(j) = 112j - 19. Let h(y) = -68y + 11. Let b(q) = -5h(q) - 3o(q). Determine c(b(w)). 20w + 10 Let g(a) be the first derivative of -19a*4/12 - 19a + 200. Let f(p) be the first derivative of g(p). Let z(h) = -7h. Determine z(f(t)). 133t*2 Let d(a) be the third derivative of -7a*5/10 + 1491a*2 - 1. Let f(q) = 34q + 2. Calculate d(f(g)). -48552g2 - 5712g - 168 Let i(b) = 1416b2. Let s(d) = -148d - 7 + 7 + 292d - 145d. Calculate i(s(f)). 1416f2 Let m(x) = -x2 + 29959596x. Let o(k) = -k. Determine o(m(c)). c*2 - 29959596c Let k(w) = 2w. Let v = -14 + 17. Suppose 3t + v = -5m - 7, 5 = 3t + 2m. Let y(r) = 20r - 20r - 4r*2 - tr*2. Give y(k(a)). -36a*2 Let j(b) be the third derivative of 211b4/24 - b3/3 - 69b2 + 45b. Let f(u) = 2u2. Give f(j(s)). 89042s*2 - 1688s + 8 Let x(k) = 2k - 11. Let q(y) = 153y - 5. Let h(d) = -66d + 2. Let v(n) = 5h(n) + 2q(n). What is v(x(j))? -48j + 264 Let a(c) = 1033c2. Let x(i) = -1241i*2. Give x(a(y)). -1324257449y*4 Let v(x) = -59x*2. Let s(q) = -9q + 178q2 - 198q*2 + 9q. Give v(s(h)). -23600h4 Let s(a) = 2a*2 - 3a. Let m(w) be the third derivative of 1/8w4 + 0w*3 - 2w + 0 + 71w2. Give s(m(b)). 18b*2 - 9b Let x(y) = -60y2. Let r(k) be the first derivative of -6k*3 + 841. What is r(x(p))? -64800p*4 Let d(g) = -155g + 468g - 165g - 165g. Let b(c) = 91c. What is b(d(w))? -1547w Let c(n) = -2n + 888. Let v(p) = -421p2 + 10p - 1. What is c(v(x))? 842x2 - 20x + 890 Let u(y) = -14y + 1 - 2 + 3 - y. Let j = -16 - -22. Let t(n) = 8n - 6. Let x(r) = -17r + 13. Let s(v) = jx(v) + 13t(v). Determine s(u(i)). -30i + 4 Let i(q) be the second derivative of q*3/3 - 24861q. Let f(b) be the second derivative of -23b3/6 - 2b. Determine i(f(g)). -4	{ "pile_set_name": "DM Mathematics" }
-9 16 + 5 + -2 + -9 + -8 2 What is 0 - ((-6 - (-3 + 9 + -6)) + -6)? 12 Evaluate 3 + 3 + 0 + (-15 - -8 - -12). 11 Evaluate -2 + (-29 - -22 - (0 + 0 - -4)). -13 Calculate (0 - -2) + -48 + 34. -12 Calculate 0 + 16 + -8 - (21 + -1). -12 Calculate 88 + -87 + 6 + 1. 8 Calculate 2 - ((-5 - (-9 - -13)) + -10). 21 Evaluate -5 + -12 + 9 - -15. 7 Calculate 0 + 19 - (-8 + 30 + -19) - -3. 19 Calculate 13 + (34 - 46) + 1. 2 What is 17 - 12 - (-18 - -2)? 21 Evaluate 64 + (86 - 125) - (16 - 0). 9 What is (29 - 65) + -36 + 44? -28 Evaluate (-4 - (29 + -23 + 1 + -6)) + 15. 10 Evaluate -8 + (11 - 5 - 6). -8 What is the value of 1 + 3 - (6 - (-3 - -11))? 6 3 + -7 - (-6 - (-10 - -8)) - 6 -6 What is the value of 10 + -1 - (2 - -11) - -12? 8 Calculate (-9 - -11 - 9) + -3 + 5 + -2. -7 Evaluate 20 + -14 + (4 - 1 - -20). 29 Evaluate -4 + (6 - 3) + -8 + 4 + -12. -17 Evaluate (235 - 276) + (-3 - -14). -30 Evaluate 8 + -12 - (-4 + -4). 4 What is 497 - 517 - (-6 + (3 - 2 - 1))? -14 Calculate (-13 - -2) + -19 + -5 + 17 - 10. -28 What is -1 - (8 + (4 - (10 + 1)) + 1)? -3 Evaluate -12 - (-19 + 8 + -5). 4 Evaluate -22 + (17 - (-6 + -18)). 19 Calculate (14 - (-7 + (4 - 16) + 24)) + -22. -13 What is -27 + -21 + (54 - 9)? -3 What is the value of (-5 - -3) + 6 + (-2 - 6) + 9? 5 Calculate (-3 - (0 - 0)) + 15. 12 What is 2 + -1 + 148 + -172 - (6 - -1)? -30 What is 0 + 0 - ((21 - 24) + 4)? -1 -2 - 2 - (7 - (2 + (5 - 13))) -17 What is -7 + 4 + 2 + 1 - (-4 - 7)? 11 Calculate 1 + (-39 - -17) - -10. -11 Calculate (15 - 3 - -3) + -6 + 2 + -2. 9 4 - (30 + (-14 - -9) + 3 + -3) -21 -1 - 2 - (3 + 3 + 13 + -11) -11 Evaluate 8 + -12 + 2 + 8 + 0. 6 Calculate 0 - (-5 + 11) - 1 - -1. -6 What is the value of 1 - (144 + -142 + 1 + 7)? -9 What is the value of (2 - -11 - 12) + 6? 7 Calculate (8 - 15) + -2 + (-4 - -1). -12 Evaluate -13 - (-1 - 3 - (455 - 476)). -30 4 - (-1 - -7) - (-11 - -13) -4 Evaluate (9 - 6 - -5 - 3) + 0. 5 Calculate (31 - (19 - -31)) + 0 + -1 + 7. -13 Evaluate -30 + (-1 + 25 - -2). -4 Evaluate -19 + -10 + 30 + 0 + 1 + -11. -9 What is -23 - 0 - ((27 - (11 - -3)) + -10)? -26 Evaluate -2 + 1 + 0 + 0 - (86 + -78). -9 What is the value of 14 + 1 + (26 - 28)? 13 -10 + 1 - (-16 - -36 - 16) -13 Evaluate -34 + 22 + (-22 - -33). -1 Evaluate -23 + 34 - (1 - -9). 1 What is 23 - 8 - 18 - -4? 1 Calculate (-2 - 3) + -26 + 40. 9 Evaluate 2 - (-6 - ((4 - (-1 - -16)) + 5)). 2 Calculate (-4 - 4) + (14 - 17). -11 Calculate -1 + 1 - ((-17 - 12) + 23). 6 (-4 + (-4 - 1) - (-43 + 28)) + -9 -3 What is (7 - -1) + -6 + 3 + (67 - 60)? 12 What is (1 - -5) + -3 + -16 + 13? 0 What is the value of -9 + (23 + 10 - (-2 + 6))? 20 Calculate -9 - (-34 - 0 - (0 + 5 + -13)). 17 -13 + 33 - (23 - 8) 5 Evaluate -9 - -29 - (-2 - (-12 + 15)). 25 Evaluate (-1 - 5) + 7 - (11 - 15). 5 6 + 0 + -3 + 3 + (4 - 10) 0 Calculate -3 + -3 + (1 - -7). 2 What is -21 - ((5 + -26 - -14) + 7 + 0)? -21 What is the value of (11 - (-3 + 3)) + (-118 - -116)? 9 Evaluate 9 + 3 + -11 + (-1 - -1) - 5. -4 Evaluate -7 + 1 - (-83 + 46 - -31). 0 Calculate 9 + -16 - (-5 + 14 - -17). -33 What is (-66 - -86) + (-21 - -1)? 0 Calculate 0 - (-3 - (-19 + 33)). 17 What is the value of 6 + 18 + -27 + (2 - -2)? 1 -29 - -2 - (162 - 176) -13 What is the value of -5 - (13 - (5 - 5))? -18 What is 112 + -110 - (1 + -2 + (-3 - -1))? 5 Calculate (3 + -7 - 4 - -23) + -1 + 1. 15 Evaluate 4 + (-23 - -22) - (21 - 0). -18 2 + (8 + -9 - -1) - (-3 - 3) 8 What is (3 - -1) + 5 + 7 + -10 + -12? -6 Evaluate 59 - (73 + -27) - 3. 10 What is -6 + -1 - ((22 - 9) + (3 - -2))? -25 -9 + 2 + 10 + -14 -11 What is -17 + 2 + (-14 - (13 - 35))? -7 Evaluate -1 + -6 + -6 + 6 + 5 + 4. 2 What is the value of -16 - (-8 - (-15 + -1 + 55))? 31 Calculate 36 - (17 + 22) - (-3 - 1 - 1). 2 Evaluate 14 - 12 - (15 - 28). 15 What is the value of 11 + (51 - 55) + (-2 + 0 - -9)? 14 Calculate (0 - -3) + (15 - 12) - 22. -16 What is 3 - -1 - (-31 + 21 + 15)? -1 Calculate -18 - 4 - (83 - 104). -1 Calculate -7 + -19 + (72 - 24). 22 What is the value of (16 - 11) + 17 + -11 - (-4 - 1)? 16 Evaluate 16 + (-17 - -17) - 3. 13 What is the value of 124 + -126 + (-14 - 1)? -17 What is 6 - 3 - (-5 + 27) - -11? -8 Evaluate -724 + 732 - (3 - (11 + 0) - 2). 18 Calculate -8 + (152 - 132) + (1 - 0 - 4). 9 What is the value of (2 - (9 - 4)) + 4? 1 What is the value of -1 + 7 + (-143 - -135) - 4? -6 What is the value of (4 - (-14 + 2)) + -4 + -2 + -25? -15 What is -4 - ((7 - 6) + -9) - 8? -4 Evaluate (3 - 2) + (12 - (-10 - (-12 - 6))). 5 What is the value of (12 - 3 - 6) + -9? -6 Calculate -7 + 0 + (-23 - -9 - -17) + -18. -22 What is the value of -8 + 14 + -6 + 0 + -2 + 1? -1 Evaluate 8 + (26 + -39 - (-1 - -1)) + -8. -13 What is the value of 695 - 718 - (-1 + -15)? -7 Evaluate 7 + -2 + (31 + -19 - 18) + 20. 19 Evaluate 2 - 4 - (28 + -26) - -26. 22 -57 + -34 + 66 - 4 -29 Evaluate -17 + 12 - (-4 + 1 + -9) - 2. 5 What is the value of -2 + 25 + (236 - 259)? 0 -3 + -70 + 21 - -28 -24 Evaluate (-10 - (-13 + 8)) + (13 - -5). 13 Evaluate (2 - 0) + 7 + -20 + 18. 7 What is -13 - -1 - (8 + -4 - 18)? 2 What is -1 - 0 - (-5 - (6 - 3) - 0)? 7 What is 0 + 20 + (-18 - (29 + -49))? 22 What is 46 - 57 - (-20 - 0)? 9 What is the value of -19 + 4 + -12 + -6 + 10? -23 What is (18 - 18) + -21 - -15? -6 What is the value of -5 - (1 - 8) - (3 - -4 - -3)? -8 What is the value of (-8 - (-13 + 20 + -9)) + -4? -10 What is (-6 + 10 - 14 - 4) + 8 + -4? -10 1 + 15 + 0 + 32 + -28 + 6 26 Evaluate 7 + (-8 - (35 + -9 - 7)) - 0. -20 Calculate 86 + -83 + (4 + 4 + 1 - -1). 13 What is the value of 5 + -19 + 22 + -25 - -23? 6 What is the value of -1 - (10 + (1 - (9 - 2)) - 2)? -3 Evaluate (4 - -2 - (-1 + (1 - 4))) + 13. 23 Calculate (-5 - (6 + -11)) + (-28 - (15 - 17)). -26 20 + 17 + -27 + 5 15 Evaluate 15 + (4 + -12 + (18 - 6) - 4). 15 What is -1 - (12 + -13 + (-9 - 27))? 36 What is the value of 5 + (30 - 15) + (3 - 3 - 8)? 12 What is -101 + 35 + 52 - (0 - 0)? -14 What is the value of 2 - ((7 - -11 - 18) + 3 + 2)? -3 What is the value of -14 + 2 + -32 + -2 + 46? 0 Calculate -1 - -8 - (0 + -10 + 20). -3 6 + (8 - 4) + 1 - -3 14 What is 0 - -26 - (-478 - -502)? 2 Evaluate (5 - -4 - (3 - -16)) + 2. -8 What is the value of -24 + (-8 - 2) + -9 + 25? -18 -9 + (-9 - (15 + -37)) 4 4 + -22 - -45 - (12 - (8 + -4)) 19 What is 16 + (1 - 8) + -18 + -3? -12 Evaluate (22 - (17 - 0)) + 2 + 5. 12 What is the value of (0 - 10) + -7 + -7? -24 Calculate (-5 - -3) + -2 - (-3 - (11 + -24)). -14 What is the value of 22 + (8 - 9) + -9 + 2? 14 What is the value of 735 + -716 - (36 - -1)? -18 Calculate (3 - 1 - 3 - (2 - 1)) + -4. -6 What is the value of (32 - (8 + 36)) + (1 - 0)? -11 What is the value of 11 - (-3 - -15) - -13 - -3? 15 Calculate 153 + -148 + 1 + -6. 0 What is (150 - 138) + (-3 - 11)? -2 20 + (-15 - 16) - (0 - -5) -16 (-19 + 21 - -1 - -7) + 26 36 -4 - (0 + (6 - 2) + (-10 - -16)) -14 -2 - (-2 - -7) - -8 - (-1 + -6) 8 Evaluate 25 - (10 - (20 - (-3 - (-12 + 1)))). 27 What is 21 + (5 + -11 - -8 - 5)? 18 7 + -85 + 85 + -4 + (-2 - 2) -1 What is -2 + (15 + (-32 - -11) - (2 + -10))? 0 Calculate -60 - (27 - 18 - 45). -24 What is (-5 - 1) + -4 + 4 + 3 + 4? 1 Evaluate -12 - ((10 - 5) + -4). -13 3 + (-7 + 9 - (1 - -6)) -2 Evaluate -12 - (-86 + 44 + 42). -12 Evaluate (26 - -14) + 5 + -34. 11 Evaluate (-19 - (-31 - -15)) + (0 - -4). 1 (-3 - (15 + -7)) + -19 + 8 -22 4 + -10 + -6 + (-6 - -5) + -2 -15 Evaluate (3 - 19) + 37 + -14. 7 Evaluate -18 - 1 - (352 + -342). -29 Calculate (-2 - (-15 - -4)) + 2. 11 Evaluate -2 + 23 + (253 - 254). 20 What is (14 - 3) + -244 + 235? 2 Calculate (19 - 23 - 9) + 22. 9 Calculate -3 - (-43 + -35 + 65). 10 (-4 - (1 - 3)) + 6 + -12 + -2 -10 -13 - -7 - 10 - -30 14 Calculate (156 - 150) + (-17 - -1). -10 What is -4 + -25 - (73 + -96)? -6 Calculate -15 - (-6 - 11 - -10 - 5). -3 What is the value of 10 + (22 - 23) + -4 + 8? 13 Calculate 3 + (13 - (-29 + 51)) + (-1 - -12). 5 (6 - (-11 - (2 - 37)) - 2) + -9 -29 What is the value of -1 + -3 + 2 + -9 - -4 - 5? -12 What is 7 - (-2 - (-1 + (8 - 6))) - -2? 12 Evaluate (-2 - 2) + (-15 + -28 - -31). -16 Evaluate -52 + 58 - ((10 - -3) + (-2 - 0)). -5 What is (-56 - -57) + 3 + 1 + (-12 - 0)? -7 What is -1 - ((-5 - -4) + (0 - -4) + -6)? 2 Evaluate 3 + (-42 - -47) - 21. -13 (3 - -13) + (-38 - -2) -20 What is -42 - -2 - (-860	{ "pile_set_name": "DM Mathematics" }
tive of -s*5/10 + 7s*4/4 - 22s*3/3 - 55s*2/2 + 525s/2 + 1092. Find n such that d(n) = 0. -3, 5, 7 Let -4/7u4 + 32/7u*3 - 200/7u + 0 - 20/7u2 = 0. What is u? -2, 0, 5 Let s(i) be the first derivative of 4i*6/3 - 622i*5/5 - 519i*4 - 2416i*3/3 - 566i*2 - 162i + 570. Find b such that s(b) = 0. -1, -1/4, 81 Suppose 81 = 15i + 12i. Find k such that -91k2 - 8k*i + 24k*2 + 33k*2 + 22k*2 + 4k4 = 0. -1, 0, 3 Let k(i) be the second derivative of i6/6 - 37i5/2 + 365i*4/12 - 1095i. Let k(j) = 0. Calculate j. 0, 1, 73 Suppose -4b + 67 + 13 = 0. Suppose 8z = 13z - b. Solve j4 - 25j*3 - 4j4 + j4 - zj2 + 31j*3 = 0. 0, 1, 2 Suppose -5r - 171 = -4j, 23r - 21r = -j + 33. Suppose u - 39 = -j. Find b such that 9/2b + u + 1/2b2 = 0. -9, 0 Let a(l) be the first derivative of 1/10l*4 - 2/5l*3 - 2/5l - 137 + 3/5l2. Factor a(d). 2(d - 1)*3/5 Let o be (-2)/12 - ((-20)/((-480)/(-924)) - -38). Factor -ow*2 - 8 - 14/3w. -(w + 2)(w + 12)/3 Let -6g*3 + 0g*3 + 7g*3 + 15g*2 - 39g + 23g - 38g = 0. Calculate g. -18, 0, 3 Let z be -1(-1)/((-2)/(-22)). Let p(h) = 5 - 4 - 4h + 14h - zh. Let l(v) = -v*2 - v + 2. Let w(i) = l(i) - 2p(i). Factor w(g). -g(g - 1) Let i be 3/(-3) + (-47 - -3). Let p = -44 - i. Factor -16y + 28y - 5 - 18y*2 - 3y*3 + 3y*4 + 30 - p. 3(y - 2)*2(y + 1)(y + 2) Let u be 3612/54 - 10 - (-84)/33. Factor -u - 2/11g2 + 8/11g. -2(g - 3)(g - 1)/11 Let m = 1331645/6 - 222829. Let x = -888 - m. Factor -13/6a2 - 6 - xa*4 + 5/3a*3 - 10a. -(a - 6)*2(a + 1)*2/6 Factor 28 + 1/2r*4 - 13/2r*3 - 46r + 27r2. (r - 7)(r - 2)*3/2 Let a be 91/21 - 44/33. Let w(i) be the second derivative of 0 - 5/48i*4 + 0i*2 + 1/12i*3 + 1/80i*5 + 1/24i*6 + ai - 1/56i7. Solve w(y) = 0. -1, 0, 2/3, 1 Let 1/10k*4 + 144/5k*2 - 64 - 152/5k - 47/10k3 = 0. What is k? -1, 4, 40 Let b(p) = -2p*2 + 4p + 6. Let d be b(3). Suppose d = 3r - 19 - 5. Factor ru*2 - 6u*2 - u - 5u. 2u(u - 3) Let s(c) be the second derivative of 115c4/12 + 20c*3 + 5c*2/2 - 196c + 4. Factor s(j). 5(j + 1)(23j + 1) Solve -2w*5 + 29w*2 + 56w*3 + 42w - 52w2 - 69w*2 - 4w*4 + 0w*5 = 0 for w. -7, 0, 1, 3 Let r(k) be the first derivative of -44/5k*2 - 484/5k - 4/15k3 - 7. Factor r(u). -4(u + 11)*2/5 Let x(w) be the third derivative of -15w*2 - 9/140w*5 + 0w + 0w6 + 6/7w*3 + 1/490w*7 + 0 + 1/14w*4. Factor x(a). 3(a - 2)*2(a + 1)(a + 3)/7 Let p = 110737/5 + -331931/15. Let 200 - 88s*3 + 140/3s - 4/3s5 - 416/3s*2 - ps*4 = 0. Calculate s. -5, -3, -2, 1 Let k = -5037458/7 + 719650. Solve 16u + 32/7u3 - ku*2 - 48/7 - 4/7u*4 = 0 for u. 1, 2, 3 Let k = -653659/140 + 4669. Let v(a) be the third derivative of -1/280a*6 - 1/168a*4 + 0a*3 - 1/1470a*7 + 0a - ka5 + 0 + 4a*2. Factor v(i). -i(i + 1)*3/7 Let b be 1/3(17 - 17). Let n(r) be the third derivative of 8r2 - 1/60r*6 + 0r*5 + b + 0r*3 - 2/315r*7 + 0r + 1/36r4. Factor n(x). -2x(x + 1)2(2x - 1)/3 Let l(k) be the first derivative of 2k*3/3 + 7k*2 - 36k + 1228. Factor l(u). 2(u - 2)(u + 9) Let v = 9165/12308 + 33/6154. Suppose 33/4n + 0 + vn*2 = 0. Calculate n. -11, 0 Let y be (-4)/(-10) + (-638)/(-55). Suppose yk - 27 = 9. Factor 3f3 + 0f*2 - 4f*2 - 11f - 6fk + 4f*3 - 6. (f - 6)(f + 1)*2 Suppose 218 - 208 = 5w. Let r(z) be the third derivative of 1/42z7 + 2z*5 + 0 + 20/3z*4 + 0z + 6zw + 40/3z*3 + 1/3z*6. Factor r(x). 5(x + 2)4 Let a(j) be the second derivative of -j4/6 - 614j3/3 + 10879j. Suppose a(f) = 0. Calculate f. -614, 0 Suppose 6531 = -16z + 20627. Let w = z - 881. Factor 0 + 0q - 5/2q5 + wq*2 - 5q*4 - 5/2q*3. -5q*3(q + 1)*2/2 Let n = -227499 + 227507. Solve -8/9o*2 + 290/9o - n = 0 for o. 1/4, 36 Let y(h) = -46h2 + 301h - 440. Let r(o) = -174o2 + 1203o - 1758. Let t(g) = 4r(g) - 15y(g). Let t(s) = 0. Calculate s. 3/2, 48 Factor -1189/2m - 1413721/4 - 1/4m2. -(m + 1189)2/4 Let v(x) be the second derivative of -x*4/3 - 232x*3/3 + 1210x*2 + 10587x. Solve v(h) = 0 for h. -121, 5 Suppose 803 = 5c - 1032. Factor 12 - 114p*2 - 118p*2 - 121p*2 + 22p + cp2 + 64p. 2(p + 6)(7p + 1) Let c(g) be the first derivative of g5/35 - g4/28 - 19g*3/7 + 145g*2/14 + 200g/7 - 1992. Factor c(l). (l - 5)*2(l + 1)(l + 8)/7 Let x(v) be the first derivative of v3/3 + 67v*2 - 411v - 525. Determine a so that x(a) = 0. -137, 3 Let u(f) be the third derivative of f*7/105 + 2f*6/15 + 2f*5/3 + 4f*4/3 - 2248f*2. Factor u(d). 2d(d + 2)2(d + 4) Let j = -188943/56 - -3374. Let v(f) be the third derivative of 14f2 + 0f*3 - jf*4 + 1/280f*6 + 0 + 0f + 0f5. Suppose v(o) = 0. Calculate o. -1, 0, 1 Suppose -5o = 148j - 145j - 40, 4o - 32 = -2j. Let m be (-1)/2 - 25/(-10). Factor jp + 2/5p*m - 2/5. 2(p - 1)(p + 1)/5 Let u(p) be the third derivative of p8/20160 - p7/1260 - p6/60 - 13p*5/30 + 2p*2 + 8. Let t(v) be the third derivative of u(v). Factor t(o). (o - 6)(o + 2) Find j such that -7/9j + 0 - 5/9j*3 - 13/9j*2 + 1/9j*4 = 0. -1, 0, 7 Let g(m) be the first derivative of -3m*3 + 33m*2/2 - 24m + 1844. Let g(n) = 0. Calculate n. 1, 8/3 Let v(r) = -r*2 - 75r - 4. Let b(s) = -75s - 3. Suppose -2p - 11h = -14h + 9, -5h + 16 = -3p. Let l(u) = pv(u) - 4b(u). Find o such that l(o) = 0. 0, 25 Let o*2 + 204o - 3o2 - 2o*2 - 86o + 5o2 + 3481 = 0. What is o? -59 Suppose 7 - 47 = -4w. Suppose -21y - 65 = -128. Suppose -10b*2 - 5b + 8b5 - yb*5 + 20b*4 - wb*4 = 0. Calculate b. -1, 0, 1 Suppose -8q + 25 = -3q. Suppose -2c - 9 = -qc. Solve -8s*2 - 58s*3 + 38s*c + 0s*2 = 0. -2/5, 0 Factor 40/3s + 2/3s2 - 14. 2(s - 1)(s + 21)/3 Let t = 527/4 - 2323/20. Let b = 16 - t. Solve 2/5y*2 + 4/5y + b = 0 for y. -1 Factor -26/3d + 5/3d*2 + 5/3. (d - 5)(5d - 1)/3 Let i(y) be the first derivative of -y3/3 - 773y*2 - 597529y - 7739. Factor i(j). -(j + 773)*2 Let v = -3311 - -3326. Let w(k) be the third derivative of 0k + 0k3 + 1/12k*6 - 1/12k*5 + 0 + 1/42k*7 + vk*2 - 5/12k*4. Factor w(j). 5j(j - 1)(j + 1)(j + 2) Let f(a) = -6a*3 + 15a*2 + 22a + 5. Let z be (6 + -4)/(2 + (-8)/5). Let k(j) = -7j3 + 15j*2 + 21j + 4. Let m(q) = zf(q) - 4k(q). Solve m(b) = 0. -1, -1/2, 9 Let f be 1424/216 + 122/1647. Solve 2/9v2 + fv - 62/9 = 0 for v. -31, 1 Suppose 12 = -3w + 21. Suppose 3u + 4o + 2 = 0, wo + o = u - 10. Solve 6mu + 4 - 52m + 87m2 + 40m*2 + 36m*2 = 0 for m. 2/13 Find j such that 322j + 32j3 - 1028j - 4 - 133j3 + 1424j*2 - 613j3 = 0. -2/357, 1 Let v(i) be the second derivative of -i6/180 - 3i5/10 + 13i*4/24 + 37i*3/18 - 387i. Solve v(w) = 0. -37, -1, 0, 2 Let y(g) be the first derivative of -g*5/15 + 5g*4/2 - 28g*3/3 + 41g*2/3 - 9g - 584. Factor y(j). -(j - 27)(j - 1)3/3 Let p(q) be the first derivative of -q3/27 + 257q*2/9 - 66049q/9 - 2346. Factor p(r). -(r - 257)*2/9 Let v = -96787/18 - -48398/9. Find y, given that 0 + 11/4y*2 + vy*3 - 1/4y*4 - 3y = 0. -3, 0, 1, 4 Determine o so that -4/5o2 + 3668/5o + 0 = 0. 0, 917 Let z(n) = -11n - 432. Let t be z(-75). Let u = t + -4319/11. Factor -u + 1/11v*3 + 0v + 3/11v2. (v - 1)(v + 2)*2/11 Let g(d) = 18d*3 + 181d*2 + 962d + 784. Let y(c) = -44c3 - 452c*2 - 2404c - 1960. Let u(j) = 12g(j) + 5y(j). What is n in u(n) = 0? -14, -7, -1 Let p(g) = -g*3 + 486g*2 + 15666g - 33646. Let q(b) = 500b2 + 15665b - 33645. Let d(w) = 5p(w) - 6q(w). Factor d(i). -5(i - 2)(i + 58)*2 Factor -7x*5 - 14x*5 + 19x*5 + 742504x - 1076x4 - 181948x*3 - 11275200x*2 - 10292x*3 + 22585496x. -2x(x - 2)(x + 180)3 Suppose -3h + 2 = -4l, 12h - 1 = 11h + l. Suppose 0 = -5n - 2w + 4, -4n + 2n + hw = -10. Suppose -4/3zn - 2z + 2/3z3 + 0 = 0. What is z? -1, 0, 3 Let v(k) be the first derivative of 50k - 150 + 2k3 - 1/10k*4 - 15k*2. Factor v(m). -2(m - 5)3/5 Let f(b) be the first derivative of -b4/2 + 988b3 - 732108b*2 + 241107568b - 1568. Facto	{ "pile_set_name": "DM Mathematics" }
d to three dps? 0.088 Round -0.0001179041 to six decimal places. -0.000118 Round -308832.8 to the nearest one hundred. -308800 Round 0.0000005208521 to seven decimal places. 0.0000005 What is -21321593 rounded to the nearest one hundred thousand? -21300000 Round 50096 to the nearest one hundred thousand. 100000 What is -11.15445 rounded to 2 decimal places? -11.15 What is 6.94553 rounded to two decimal places? 6.95 What is -293.57 rounded to the nearest integer? -294 Round 12904050 to the nearest one million. 13000000 What is -123.43626 rounded to zero decimal places? -123 What is -56849460 rounded to the nearest one hundred thousand? -56800000 What is 1040.98 rounded to the nearest one hundred? 1000 What is 0.269767 rounded to three decimal places? 0.27 Round -2732.2083 to the nearest ten. -2730 What is 15817.86 rounded to the nearest 100? 15800 What is -0.004605116 rounded to four dps? -0.0046 Round -926813 to the nearest one hundred thousand. -900000 Round 0.000751381 to 6 dps. 0.000751 What is -0.00005532378 rounded to 5 dps? -0.00006 What is -222.514 rounded to the nearest ten? -220 What is -19146.508 rounded to the nearest 10? -19150 Round -134697.4 to the nearest one thousand. -135000 Round 0.000454278 to 4 dps. 0.0005 Round -287.6858 to the nearest one hundred. -300 What is -0.0010850347 rounded to 5 decimal places? -0.00109 What is -8.84808 rounded to 2 dps? -8.85 What is 1263925 rounded to the nearest 10000? 1260000 Round -23334.28 to the nearest 10000. -20000 What is -0.8917948 rounded to one decimal place? -0.9 What is 111.3231 rounded to the nearest ten? 110 What is 193.688 rounded to the nearest ten? 190 What is -628629 rounded to the nearest 100000? -600000 What is 1.595951 rounded to 1 decimal place? 1.6 What is -311389800 rounded to the nearest 1000000? -311000000 What is -4343.276 rounded to the nearest one hundred? -4300 Round 6.198987 to the nearest integer. 6 What is -0.00000409056 rounded to 7 decimal places? -0.0000041 Round 616161 to the nearest 10000. 620000 What is -2.1193248 rounded to 2 dps? -2.12 What is 13.772573 rounded to three decimal places? 13.773 What is -8478910 rounded to the nearest 100000? -8500000 What is -1610977.6 rounded to the nearest one hundred thousand? -1600000 Round 0.000666049 to five dps. 0.00067 What is -341456.3 rounded to the nearest 1000? -341000 What is 1.43354 rounded to one decimal place? 1.4 What is 0.00009819953 rounded to six decimal places? 0.000098 What is 15800848 rounded to the nearest one hundred thousand? 15800000 What is -1.62627 rounded to 1 dp? -1.6 Round 4799.862 to the nearest 100. 4800 What is 1.069185 rounded to 3 dps? 1.069 What is 4466.378 rounded to the nearest one hundred? 4500 What is -0.2054826 rounded to four decimal places? -0.2055 What is 0.0000107715 rounded to six decimal places? 0.000011 Round -0.00000209883 to 7 decimal places. -0.0000021 What is -6.31202 rounded to 2 dps? -6.31 Round -0.00009890811 to seven decimal places. -0.0000989 Round 0.01086437 to 4 decimal places. 0.0109 Round 941582 to the nearest 1000. 942000 Round -876.8318 to the nearest integer. -877 Round 0.000035908407 to five decimal places. 0.00004 What is -21151.6 rounded to the nearest one thousand? -21000 Round -0.000006320088 to seven decimal places. -0.0000063 What is 850244.8 rounded to the nearest 100000? 900000 Round 0.7054706 to 2 dps. 0.71 What is -18.540998 rounded to 0 dps? -19 What is 64422.9 rounded to the nearest 1000? 64000 Round 0.1196017 to three decimal places. 0.12 What is -44.834392 rounded to 1 decimal place? -44.8 Round -0.000478001 to four dps. -0.0005 What is 733796700 rounded to the nearest one hundred thousand? 733800000 Round 3273.7226 to the nearest one thousand. 3000 What is 40.11772 rounded to the nearest integer? 40 What is 39900840 rounded to the nearest 1000000? 40000000 What is -947.729 rounded to the nearest ten? -950 What is 0.00044658106 rounded to five decimal places? 0.00045 Round -4.07025 to 2 dps. -4.07 What is 45588.2 rounded to the nearest 10000? 50000 What is 110430260 rounded to the nearest one million? 110000000 What is -0.00007886429 rounded to 6 decimal places? -0.000079 What is -6280.85 rounded to the nearest one thousand? -6000 What is -2.0317863 rounded to three decimal places? -2.032 Round -31.0661 to the nearest integer. -31 Round 26.81835 to zero dps. 27 What is -22675 rounded to the nearest one hundred? -22700 Round 0.28501 to 4 dps. 0.285 What is 0.03953368 rounded to four decimal places? 0.0395 What is 0.12389035 rounded to four decimal places? 0.1239 What is 36664460 rounded to the nearest 1000000? 37000000 Round 250265.1 to the nearest 100000. 300000 Round -42.459 to the nearest 10. -40 What is -106.2062 rounded to the nearest 10? -110 What is -0.00003246316 rounded to 5 dps? -0.00003 What is -0.00008571886 rounded to five decimal places? -0.00009 What is -387626 rounded to the nearest 100000? -400000 What is 15.15168 rounded to two decimal places? 15.15 Round -1176966 to the nearest 10000. -1180000 What is -50.85827 rounded to the nearest ten? -50 Round -8.9254 to 0 dps. -9 What is -22326.51 rounded to the nearest 100? -22300 What is 477764.5 rounded to the nearest 1000? 478000 Round 336600.43 to the nearest 100. 336600 Round 0.3250311 to four decimal places. 0.325 What is -40.3347 rounded to one decimal place? -40.3 Round 0.1168399 to 4 decimal places. 0.1168 Round 0.68636 to one decimal place. 0.7 Round 1949510 to the nearest ten thousand. 1950000 Round 0.16188658 to 3 decimal places. 0.162 Round -55058400 to the nearest one million. -55000000 Round -0.00000133818 to six dps. -0.000001 Round -0.5265662 to 4 decimal places. -0.5266 Round 0.00000843674 to 7 dps. 0.0000084 What is 0.30937 rounded to two decimal places? 0.31 What is 9.089664 rounded to one decimal place? 9.1 What is 7372.607 rounded to the nearest one thousand? 7000 Round 20237.44 to the nearest 100. 20200 What is 0.004137051 rounded to 6 dps? 0.004137 Round -95027.9 to the nearest 1000. -95000 What is 29.8427 rounded to the nearest ten? 30 Round 0.280005 to three dps. 0.28 Round -0.00001922678 to 7 decimal places. -0.0000192 Round -207.672 to the nearest 10. -210 What is 0.00010355 rounded to 3 dps? 0 What is 0.0664208 rounded to 2 dps? 0.07 What is -0.0260986 rounded to 2 dps? -0.03 Round 106296790 to the nearest 1000000. 106000000 Round 834069.6 to the nearest one hundred thousand. 800000 What is 2.3381907 rounded to 3 decimal places? 2.338 What is -4882300 rounded to the nearest 1000000? -5000000 Round -54.49175 to 1 dp. -54.5 What is -0.000155873 rounded to five decimal places? -0.00016 What is 7.92542 rounded to 2 dps? 7.93 What is 68410610 rounded to the nearest 100000? 68400000 What is 40594.48 rounded to the nearest one thousand? 41000 Round -0.00004462159 to 7 dps. -0.0000446 Round -0.00001199054 to 7 dps. -0.000012 What is 0.000256904 rounded to 6 decimal places? 0.000257 What is -50330.09 rounded to the nearest 10? -50330 What is -8035.423 rounded to the nearest one hundred? -8000 What is -0.012349631 rounded to five dps? -0.01235 Round 379593000 to the nearest one million. 380000000 What is -7233 rounded to the nearest 100000? 0 Round -0.027897 to 4 decimal places. -0.0279 Round 0.0000012047007 to 7 dps. 0.0000012 Round -30458.215 to the nearest one thousand. -30000 What is 0.0021871 rounded to four dps? 0.0022 What is -42.63378 rounded to 2 decimal places? -42.63 Round 23719620 to the nearest 100000. 23700000 What is 0.0008802531 rounded to four dps? 0.0009 What is 12912.71 rounded to the nearest ten? 12910 What is -0.13572136 rounded to two dps? -0.14 What is 1263940 rounded to the nearest 100000? 1300000 Round -80600 to the nearest 100000. -100000 Round -0.000213009 to five dps. -0.00021 What is 0.01303004 rounded to four dps? 0.013 What is 551.26 rounded to the nearest 100? 600 Round 1997.338 to the nearest one hundred. 2000 What is -0.00001648392 rounded to 7 dps? -0.0000165 What is 6114600 rounded to the nearest one hundred thousand? 6100000 What is -0.0006929228 rounded to 6 dps? -0.000693 What is -0.0000410905 rounded to 5 dps? -0.00004 What is -0.000579223 rounded to four dps? -0.0006 Round -29909 to the nearest ten. -29910 What is 8645230	{ "pile_set_name": "DM Mathematics" }
Simplify ((b/(bb(1/5))b)/bb(-10)b)/((b/b*(-7))/bb/b6) assuming b is positive. b(-56/5) Simplify (s/(s/(ss/(ss*2))ss))(-2/31) assuming s is positive. s(6/31) Simplify (aa(2/9)/a)(-1/16) assuming a is positive. a*(-1/72) Simplify (x/(xxx(-7)x))/((((xx(1/5))/xx)/x)/x) assuming x is positive. x*(29/5) Simplify ((q/(qq*(-14)q))/q)(-1/2) assuming q is positive. q(-6) Simplify (u(-15/2)/(u9/u))(-37) assuming u is positive. u(1147/2) Simplify (f/(fff*(2/5)/ff)ff)*(-3/29)ff(2/41)ff(2/17) assuming f is positive. f(212677/101065) Simplify (k(-12)k(-11))(-39) assuming k is positive. k897 Simplify (h0/hhh*(3/10))/(h/(hh/(h/(h/(h*(2/9)h)))h)h)(-18) assuming h is positive. h(43/10) Simplify ((ii4i)/i)/ii(i/(ii/(i(i*(-2/3)/i)/i)))/i(i(-2/7))(-21) assuming i is positive. i(22/3) Simplify (j(-9)/(jj(-4)))/(j/(j/j(-2))(j/((j*(-7)j)/j))/jj) assuming j is positive. j(-12) Simplify (z/(((z/(z/(z/z(1/2)z)))/zz)/z))(2/45)z*(-5)/zz*(2/3)z assuming z is positive. z(-194/45) Simplify h(-7)/(hh(-3)h)(h(-2/5)/h)(3/7) assuming h is positive. h(-33/5) Simplify (n/(nn*(12/11)))/(n/(nn(-12))) assuming n is positive. n(-144/11) Simplify (c(-1)/c)(5/2)c(-3/4)/(c/c(-3/5)c) assuming c is positive. c*(-167/20) Simplify ((t(t/((t/t*(-1/4))/tt))/tt)(-50))12 assuming t is positive. t(-450) Simplify (((yyy17/yyy)/y)/y)/(y/(y/(y(1/10)/yy)yy)) assuming y is positive. y(199/10) Simplify c/(c(3/2)/c)c(-1/3) assuming c is positive. c(1/6) Simplify (v(-1/2)v)(4/7)/(v(-3)/(v/(vv/(vvvv*(4/11)v))v)) assuming v is positive. v(589/77) Simplify (s0/(((s/(s/(s3/s)))/sss)/s))(-26/5) assuming s is positive. s(52/5) Simplify ((g/(gg/g*(-2/9)))/(g(g*(-3/11)g)/g))(-8/15) assuming g is positive. g(1544/1485) Simplify (f0)(-44)(f/(f(-1/6)f))/(ff(-3/5)) assuming f is positive. f(-7/30) Simplify v29v/(v/v(22/5)) assuming v is positive. v(167/5) Simplify (qqqq/((q(2/3)q)/q)q)(-2/11)qq(qqqq(-3)q)/qq2 assuming q is positive. q(106/33) Simplify (q3q)/qq(-18)q assuming q is positive. q(-14) Simplify (c(2/13)ccc(-6)c)/((c/(cc(-4)))/c8) assuming c is positive. c(15/13) Simplify (z(-1/5)z)(8/13) assuming z is positive. z(32/65) Simplify ((tt/(t/(ttt(-4))))/tt(-2))(-7/4) assuming t is positive. t7 Simplify o(-2)o5 assuming o is positive. o3 Simplify (y(-1/7)/(y/(y/y(-9))yy))38 assuming y is positive. y(1824/7) Simplify (q(-10/9))(-24) assuming q is positive. q(80/3) Simplify (i(-1))(-48)(i/(i(i(-5/4)ii)/i))/(ii/(i/(i/i*(-7))i)) assuming i is positive. i(161/4) Simplify ((((p/(p/p(-9)))/p)/p)/p)(-1/3) assuming p is positive. p4 Simplify ((p*(-2)p)(3/2))(-28) assuming p is positive. p*42 Simplify (kk/k(-4/13))(-15) assuming k is positive. k(-450/13) Simplify r3r(-2/11)rr(-1/6)r(1/5) assuming r is positive. r(1271/330) Simplify ((o0)(-35))37 assuming o is positive. 1 Simplify ((t(-17)t)/(tt/(ttt*3/tt)))(1/75) assuming t is positive. t(-13/75) Simplify ((nnn/(n/(n/((n/n*1)/n)n)))(-6))(-3) assuming n is positive. n*90 Simplify (iii/i5ii(2/5))(-22) assuming i is positive. i(66/5) Simplify (y(-11))(-2/45) assuming y is positive. y(22/45) Simplify (l(-1)/(ll*(1/11)l))(-1/23) assuming l is positive. l(34/253) Simplify uu(-15)u*(-1)/uu assuming u is positive. u*(-15) Simplify (aa(1/4)/a)(-5/4)(aa/(a*(-5/3)a))/(a(1/6)/a) assuming a is positive. a(51/16) Simplify (s/(s*3/s)ss/(s/s(-10))ss)(-49) assuming s is positive. s392 Simplify (ccc2)/cc/c*(2/15)c assuming c is positive. c*(73/15) Simplify ((s/(ss(-1)))/s(2/7))(1/48) assuming s is positive. s(5/336) Simplify ((c/((c*9c)/c))/(c/(c/(((c*(5/4)c)/cc)/c))))/(c(-4)cc(-8/7)c) assuming c is positive. c*(-171/28) Simplify (((ddd(-2/7)d)/d)(-41/4))(1/7) assuming d is positive. d(-123/49) Simplify ((d(1/3)/d)/d(6/7))/(d(1/5)dd*6d) assuming d is positive. d(-1021/105) Simplify ((j/((j0/jj)/j))/j)34j*6jj/(j/(j(j/((((j/(j/(j(jj/(jj(1/5)))/j)j))/j)/j)/jj))/j)) assuming j is positive. j(221/5) Simplify (t/t(-3)tt(-3/7)t)(9/4) assuming t is positive. t(351/28) Simplify (r(rr(-6/5))/r)/(r15/r) assuming r is positive. r(-71/5) Simplify (h/(h(-3/7)h)h5/h)(4/29) assuming h is positive. h(124/203) Simplify v/v(-2)vvv(-5)(vv(-1)vv)(12/5) assuming v is positive. v(24/5) Simplify bb*(-6)b(-21) assuming b is positive. b(-26) Simplify (r(1/2)/(r/r4))/(rrr*1rr)(12/13) assuming r is positive. r(-29/26) Simplify (sss6s)(-24/7) assuming s is positive. s(-216/7) Simplify x/(x*(-1/25)/x)x(9/5) assuming x is positive. x(96/25) Simplify (jjj(-47))/j39 assuming j is positive. j(-84) Simplify x2/(x/x*2)x*(-2)/(x/(xxx5)) assuming x is positive. x7 Simplify (t/t(1/4))(-1/60) assuming t is positive. t(-1/80) Simplify (y(y*(-2/11)y)/y)/y*1(y(yy*(1/3)/yy)/yyy)/yy((y/(y*(-2/5)/yy))/y)/y assuming y is positive. y(421/165) Simplify (g14/(((gg/(gg(2/11)/g))/g)/g))(-5) assuming g is positive. g(-780/11) Simplify ((d(-1/6))(-21/4))(-27) assuming d is positive. d*(-189/8) Simplify (y(y*0/y)/yy)22/(y(-7)y(-4/9)y) assuming y is positive. y*(58/9) Simplify (ff*(1/32)/f)/((ff(-2/25))/f) assuming f is positive. f(89/800) Simplify (l/(ll((l(l(6/17)/l)/ll)/l)/ll))/(l/(l(8/13)l)) assuming l is positive. l(58/221) Simplify a(4/23)a/(a/(a(-1/44)/aa))a assuming a is positive. a(1165/1012) Simplify b(2/5)/bb/((b*6b)/b)bbb10/((b/b4)/b) assuming b is positive. b(52/5) Simplify (x(2/3))26 assuming x is positive. x(52/3) Simplify (j(-41)j)/((j/(j(6/7)/j))/j) assuming j is positive. j(-281/7) Simplify ((a(-2/5))(3/7))(-19) assuming a is positive. a(114/35) Simplify (z/(z/z*(-21)z))/z(-20) assuming z is positive. z(-2) Simplify q(-3/2)/q(2/7)(q/q2)(-8/7) assuming q is positive. q(-9/14) Simplify z/z3z(z4/z)/z(zz(-2/5)zz)/(zz*(-1/3)z) assuming z is positive. z(29/15) Simplify (y5y(-2)/y)42 assuming y is positive. y84 Simplify ((w(-5)w)/(ww(1/15)/ww))(-23) assuming w is positive. w(1748/15) Simplify ((y/(y(y/y(2/9))/y))/y(-1/5))/(y/y(-10)yyy/(yy8)) assuming y is positive. y(-206/45) Simplify l/(l/((l/(l/(l(-16)/ll)))/l)l)l/l11 assuming l is positive. l(-28) Simplify l*(-5)l*1l*(-1/4)ll(-6) assuming l is positive. l(-37/4) Simplify (xx*(2/15))/(xxxx*(2/11)xx) assuming x is positive. x(-668/165) Simplify (x(2/9)/xx/x(1/11))17 assuming x is positive. x*(221/99) Simplify (jjj5/j)/j(-4/7)(j/j1)35 assuming j is positive. j(46/7) Simplify ((r/r(2/5)r)/r)(-48)/((r(2/3)r)/r)(-3/4) assuming r is positive. r(-283/10) Simplify (((m1/m)/m)/m7)/(m(2/11))(-4/3) assuming m is positive. m*(-256/33) Simplify ((zz(-4/7)/z)/(z/(z(-8)/z)))/(z*1z/z1) assuming z is positive. z(-81/7) Simplify ((o(-1/4)/o)/o)(-1/8) assuming o is positive. o*(9/32) Simplify ff*(2/7)f*(1/2)f assuming f is positive. f(39/14) Simplify (h(6/19)h)/(h(-3/16)/h) assuming h is positive. h(761/304) Simplify w(1/10)/(w/(w2w)) assuming w is positive. w(21/10) Simplify y(3/10)/yyy*(2/13)(yy(1/14))/(yyy(1/11)) assuming y is positive. y(-2831/5005) Simplify ((pp(15/7))/p)(17/4) assuming p is positive. p(255/28) Simplify ((b32bb)/b)(1/2) assuming b is positive. b(33/2) Simplify (l*4llll5l)/(l(-2/5)/l)(1/8) assuming l is positive. l(527/40) Simplify x3/(x/x*(-7))(x/(x((x(-1)xxx)/x)/x))(-13/6) assuming x is positive. x(-5) Simplify (r(3/2)/((r(-3)r)/r))/(r(-1/4)/(r(-8)r)) assuming r is positive. r(-9/4) Simplify (c4c1cc)/(c4/c3) assuming c is positive. c6 Simplify (t/(t/(t(8/5)/tt)tt)	{ "pile_set_name": "DM Mathematics" }
et n = 4065 + -4012. Are 0 and n non-equal? True Let h(z) = -z*2 - 4z - 4. Suppose v - 4q - 14 = 0, -33 = -3v - 0q + 3q. Suppose -vr - 52 = 8. Let n be h(r). Is n greater than -15? False Let k be (75/(-30))/(3/6). Let l be (-4 + (0 - k))-13. Let b = 19 - 31. Are l and b equal? False Suppose 174u + 168 = 167u. Suppose 21 = -2a + 5a. Suppose -3i + 88 = -ai. Which is greater: i or u? i Let y(f) = 95f3 + f2 - 3f + 2. Let b be y(1). Let q = b - 109. Which is smaller: q or -5? q Let l(b) = -20b2 + 22b + 24. Let t be l(-1). Let p be (-34 + ((-48)/t - 3))/3. Are -12 and p unequal? True Let q = -9 + 1. Let j be 345/(-230)20/3. Which is smaller: j or q? j Let l(s) = -s2 + 2s + 6. Let n be l(4). Let c(i) be the third derivative of -i6/120 - i5/30 + i4/12 + i3/2 + 3i2. Let u be c(n). Is u >= 8? False Let m be 0/7 + (-412)/(-18). Let i(h) = -h3 - 223h*2 - 220h + 466. Let t be i(-222). Is t at least as big as m? False Suppose 2105y = 2110y - 1165. Which is smaller: y or 225? 225 Suppose 0 = -72u + 128u - 3 + 3. Is u not equal to -3/8812? True Suppose -28t - 102 = -45t. Let y be (4(-60)/144)/(8/t). Is 0 bigger than y? True Let a(f) = -38f*3 + 11f*2 - 21f - 6. Let d be a(3). Let c = -997 - d. Let t be (1/29)/(1/(-3)). Is t less than or equal to c? False Let a be (-4 - -3)13/238. Let f = 16 - 12. Suppose 283 = -5l + o + 2o, 0 = -fo + 4. Which is smaller: l or a? a Let n = 0.3 + 0.4. Let r = -107.117 + 107.017. Is r >= n? False Suppose 3j + 6 = 24. Let h = -9398 + 37605/4. Is h not equal to j? True Suppose 0 = 4o - 2b + 13838, 4b + 13844 = -31o + 27o. Which is smaller: o or -3459? o Let g(y) = 2y + 33 - 67 + y3 + 11y*2 + 35. Let o be g(-10). Which is smaller: 82 or o? o Let y = -4230 - -4229. Which is smaller: y or -1/535? y Let l be (-6)/10 - 32/(-10). Suppose 4a = 3p + 5a - 25, 4a - 16 = l. Let t be 2/1081030. Are t and p non-equal? True Let d(x) = -x*3 + 8x*2 - 12x + 2. Let f be d(6). Suppose m - 7 = -4. Suppose 0 = fh + 3v + 160, 131 = -mh - 3v - 109. Is h > -80? False Let u = -68.1 + 0.1. Let j = u + 67.99. Let z = -11 - -12. Is j equal to z? False Suppose -5m = 2w + 96, 3m + 26w - 23w = -45. Let i(u) = -u3 - 4u*2 + 7u - 1. Let b be i(-5). Is m smaller than b? True Let r be 3/(24/(-8)). Let s be 3 + r - 144/(-44). Let g = 1 - -1. Which is bigger: s or g? s Let y = 211 + -190. Suppose 516 = yr - 9r. Is r >= 43? True Suppose -3p - 1371 = -5x, 376p - 538 = -2x + 372p. Which is greater: 265 or x? x Let o = 148 + -146. Suppose 0 = 5c + 3y - 123, -39 = -2c - oy + 11. Do c and 22 have the same value? False Let p be 4 - (3 + (-41 - -2 - 0)). Let v be 13/21 - p/(-60). Which is smaller: v or 1? 1 Let w = 193074 + -83987246/435. Is -1 bigger than w? False Suppose -5i = 3w + 907, 5i - 2i - 321 = w. Let z = 352 + w. Which is bigger: z or 0? z Let c = 0.33 + -0.407. Let h = 0.007 + c. Let o = 8 - 12. Which is smaller: h or o? o Let w = -2409 - -2408.9767. Which is bigger: w or -6? w Let t be (22456/70 - -13)/((-4)/10). Which is greater: -836 or t? t Let h = -1984156/42465 + -25/2831. Which is smaller: h or -48? -48 Let b = 2206/5 - 444. Let d = -169/30 - b. Is d less than -2? True Let p be 4/14(0 - -7). Suppose pz + 19 = 3r, -5r + r = 5z - 10. Let c = 12410 + -86875/7. Which is bigger: z or c? c Let c = 65 + -65. Let j be (-3)/(-7)13/((-25974)/12). Which is smaller: j or c? j Let b = 44.24 + -44. Let r = 9.34 - b. Let l = r + -5.6. Are 0 and l unequal? True Let q be (-27)/(-90) - (7715/50 - 7). Is q at least as big as -1024/7? False Let i(b) = 1106b + 10. Let g be i(13). Let z = g + -791312/55. Which is smaller: 1 or z? z Let k be (0 - 3 - -2)/(4/(-84)). Suppose 2u = -v - k + 3, -4v = -4u + 60. Let b be 4(-4)/(v/10) - 3. Is b < 7? False Let h(s) = 19 - 36 + 11 + 13 - s. Let k be h(3). Suppose 0 = -4p + 4q + 8, -5p - 6 = -6p + 2q. Is k bigger than p? True Let j = 123 - 87. Let m = 13 + -40. Let x = 26 + m. Which is greater: j or x? j Let j be 60/(-50)(3 + 44/(-8)). Suppose -y - 2y + 4t = -26, -y + 3t = -2. Suppose yb = 11b + j. Which is smaller: 5/21 or b? 5/21 Let b = -632 - -578. Is -55 != b? True Let a = 4870 - 4870. Which is bigger: 3070 or a? 3070 Suppose -7o + 5o - 7 = -5z, 0 = o - 3z + 5. Suppose -4j = 2v - 176, -17v = -15v - oj - 200. Which is greater: v or 93? v Let a = -240.2 - -240.1. Is 3799 smaller than a? False Let w(m) = -m3 - 39m*2 - 25m - 20. Let j be w(-38). Let f = j - -566. Which is bigger: 56 or f? 56 Let j = -3670 + 3394. Which is greater: -278 or j? j Let m = -699.1601 + 0.1601. Let v = -702 - m. Which is bigger: v or -4/59? -4/59 Suppose 5 = 5q + n, 3q = -0n - 2n + 10. Let a(s) = 23s3 + 13s*2 - 5s - 8. Let o be a(-4). Let j be o/(-1092)7 + -8. Is j smaller than q? False Let p be (-237)/(-996) + 2/(-8). Let r = 270 - 273. Let t be 4/r - (-16)/24. Which is bigger: t or p? p Let q = -125/363 + 15797/46343. Which is smaller: q or 1? q Suppose 0 = 2k + 5f - 32483, k + 0k - 2f - 16219 = 0. Let n = k - 111352/7. Let c = 321 - n. Which is smaller: c or 3? c Suppose -262g + 2242 = -243g. Are 233/2 and g nonequal? True Let v(j) = j3 - 2j*2 + 4j - 3. Let y be v(2). Suppose -2b = 3x - 0b + y, -b - 4 = 2x. Let g be (4 + 121/(-33))/(-2 - -1). Is x at most g? True Let g = -14 - -12. Suppose 3m = -83 - 88. Let v = -181/3 - m. Which is smaller: g or v? v Let z be 4/5(-30)/(-12). Suppose zl - l = 2l. Suppose l = 4x - 5x - 13. Which is bigger: -25/2 or x? -25/2 Suppose 4 + 1 = 2l + d, -2l + 2d + 2 = 0. Let t be ((99/l)/(-3))/(1/(-2)). Is t > 33? False Let i = 1657 - 1657.1. Which is smaller: 14/3289 or i? i Suppose 0 = -9u + 7u. Let m be 2/1 + (7 - 11). Let o be 1203/280 + m/20. Do u and o have different values? True Suppose 293 = -3n + 4n. Suppose 31 = 6w - n. Let b = 4514 - 4459. Are b and w equal? False Let m = -318.15 - -13801.15. Is m <= -1/3? False Let r be 1/1(-4 - 1 - -1278). Suppose -5y + 25p - 29p = r, 4p = -3y - 767. Are -505/2 and y unequal? True Let a(x) = -7x + 16. Let d(l) = -l - 1. Let f(m) = a(m) - 6d(m). Let v be f(0). Let n(h) = h2 + 9h + 22. Let g be n(-9). Is g greater than v? False Suppose -3y + 12 = 0, 0g = -3g - 2y + 14. Suppose 0 = -5m - 3f + 127, -4f = gm - 3m + 7. Let n = m - 46. Is n >= -24? True Let k = 48 - 44. Suppose 2o + 2 = -k. Is o less than -24/13? True Let j = 0.1329 + -0.2329. Let o = 1011 + -999.89. Let y = o + -0.11. Which is bigger: y or j? y Let s be (-602)/21 - (15/(-9) + 2). Which is bigger: s or -17? -17 Suppose -n - 28x - 16 = -30x, -3n = 5x + 48. Is -177/11 at most as big as n? True Let o = 9410/29 - 266228/377. Is -382 smaller than o? True Suppose 680i - 348i - 350i = 18. Which is smaller: -4/4325 or i? i Let m(k) = 16k*2 + 38k + 32. Let d be m(-16). Let f be 2 + ((-7515)/d - 10/(-55)). Is 0 >= f? False Let p be (-19434)/(-205) + 2/10. Let h = 93 - p. Which is smaller: -20/23 or h? h Let s be (11/6 - (-27)/(-18))0. Which is smaller: 48/223 or s? s Let q = -230 - -228. Let x be 3 - q/(-24)39. Does 84 = x? False Suppose 381t - 344t + 168239 = 0. Do -4547 and t have the same value? True Let g = 25141496/21 + -1196627. Let m = g + -1685/3. Which is smaller: m or 26? m Let v = -37/2522 + 649/1261. Let b = 141 - 64. Are b and v equal? False Suppose 16h = 5221 + 9771. Let o be (2 + h)(-7)/105. Which is smaller: o or -62? o Suppose -83s - 894 = -84s. Which is smaller: 896 or s? s Let a = -5689/9 + 633. Let z = 201 + -200. Is a less than or equal to z? True Let m be 2/(-8) + (-25)/(-148). Let v be 2/((-5)/4(8 + -4)). Which is smaller: v or m? v Let t(h) = h3 - 5h*2 - 34h + 205. Let o be t(13). Let d be (-10)/(-15) - o/(-150). Which is smaller: d or 8? 8 Let n be 2 + 0 + -3 - 4. Let d(q) = 201q + 6425. Let i be d(-32). Is n < i? False Let d(m) = 8m + 4. Let a be d(6). Let y = -4 + a. Suppose -7w + y = -w. Is w greater than 9? False Suppose -3u = 2a - 2280, 51u - 3450 = -3a + 54u. Are 1148 and a nonequal? True Let g(x) = 12x - 34. Let b be g(3). Let t be (4/20)/((-6)/(-15))b. Is -1/56 < t? True Suppose 0 = 2s + 3z - 148 + 537, s + 3z + 196 = 0. Let n(m) = 192m**3 + m + 1. Let r b	{ "pile_set_name": "DM Mathematics" }
hird derivative of -47i6 + 2i*3 - 288i*2 wrt i? -5640i3 + 12 What is the first derivative of -q2u2 - 4qu2 - 2qu + q - 48u*2 - 6u - 2 wrt q? -2qu*2 - 4u*2 - 2u + 1 Differentiate -272n3 + 460. -816n*2 Find the second derivative of -399l*2t + l*2 + 4lt - 12l - 2 wrt l. -798t + 2 Find the third derivative of 2h*4v*2 + 2h*4v - 60h3v*2 - 3h*2v*2 + 7h*2v wrt h. 48hv*2 + 48hv - 360v*2 Find the first derivative of 1357s - 1777. 1357 What is the third derivative of -15523b5 - 147b*2 - 12b + 2 wrt b? -931380b2 What is the second derivative of 746ch3 + 1104ch - 5h3 + h2 + 3h wrt h? 4476ch - 30h + 2 What is the first derivative of -5su*2 - 1663s - 173u wrt u? -10su - 173 Find the third derivative of -o4p + 383o3p + 1405o2p - 2op wrt o. -24op + 2298p What is the second derivative of -3q*3 - 939q*2 - 464q + 2? -18q - 1878 What is the third derivative of -314f*3 + 947f*2 wrt f? -1884 What is the third derivative of -2gv3 - 12gv2 - 7v*3 - 5v*2 wrt v? -12g - 42 Find the second derivative of -1272w5 - w - 134 wrt w. -25440w3 What is the first derivative of j3o + 16j*2o - j*2 + 122o wrt j? 3j2o + 32jo - 2j Find the second derivative of 300f*2 - 2769f. 600 Find the second derivative of 1636v2 + 2101v wrt v. 3272 What is the third derivative of 1475w3 + 1150w*2? 8850 Find the third derivative of 361o*4 + 777o*2 - 2 wrt o. 8664o What is the derivative of -fg2h - 101fgh2 + 54g*2h2 - g2h - h2 wrt f? -g2h - 101gh*2 Find the third derivative of 4h*2k*3 + 32h*2k*2 + 7h*2 - 10k*3 wrt k. 24h*2 - 60 What is the second derivative of -139h*3j2 - h3j - 52h*2jw + hjw - 17j*2w - 4j wrt j? -278h*3 - 34w Differentiate 3d3l*3 - 11d*3 + 2l*3 + 70l wrt d. 9d2l*3 - 33d*2 What is the third derivative of 87w*3y*3 - 2w*3y - 19w2y3 - w2y - y3 wrt w? 522y*3 - 12y What is the third derivative of -7r6 - 4r*4 - 2r*2 - 203? -840r*3 - 96r Find the first derivative of -20265h + 18076 wrt h. -20265 Differentiate cwy2 + 2cwy + 9c + 66wy - 4w + y with respect to y. 2cwy + 2cw + 66w + 1 What is the second derivative of -162qu*5 - qu*3 - 2qu - 24q - 5u wrt u? -3240qu3 - 6qu Find the first derivative of 3969p*3 - 300. 11907p*2 Find the third derivative of -18h*5 + 16h*4 + 1015h*2. -1080h*2 + 384h Differentiate 1689c2i*3 - 4c*2i + c*2 - 4c - 278 wrt i. 5067c2i*2 - 4c*2 What is the first derivative of -58c*2t*3x - 18c2 - ct*3x + 40t3x + 29t3 wrt c? -116ct3x - 36c - t3x What is the second derivative of 2299a2no2 + a2no - 2ano + 2ao*2 - 3no2 + 52no wrt a? 4598no2 + 2no Find the second derivative of l5 + 7l*3x + lx - 87x - 2 wrt l. 20l3 + 42lx Find the second derivative of 83b*3m*5 - 25b*3m - b*2m*5 + bm - m wrt m. 1660b3m*3 - 20b*2m*3 What is the derivative of -2a*4 - 13ai2 + i2 - 2 wrt a? -8a*3 - 13i*2 What is the first derivative of -162a*2 + 677 wrt a? -324a What is the second derivative of -c*4 + 34c*3 - 260c? -12c2 + 204c Find the second derivative of -45v5 - 84v*2 + 7587v wrt v. -900v3 - 168 What is the derivative of 12bl2o*2 + 329bl2 + 12l*2o*2 + 896 wrt b? 12l*2o*2 + 329l*2 What is the second derivative of 2acs*3 + acs2 - 596acs - 2cs - 46s3 wrt s? 12acs + 2ac - 276s What is the third derivative of 2g*2t*6 + 165g*2t*3 - 97g*2t*2 wrt t? 240g*2t*3 + 990g*2 Find the third derivative of 2n*2s*3 - 120n*2s*2y*2 + 36n*2sy3 + 2ns3y - 27s3y3 - s2y2 + 2sy wrt y. 216n*2s - 162s3 Find the second derivative of 50o*3 - 144o*2 + 19428o. 300o - 288 What is the derivative of 831o3 + o2 - 2035 wrt o? 2493o2 + 2o Differentiate -696j2 - j + 2009. -1392j - 1 What is the second derivative of -12b2v*2 + 3b*2v + 14bq*2v*2 + bq*2v + 284v wrt v? -24b*2 + 28bq2 Differentiate -5j*3l + 3j3n - 2jln + 4j + 2ln + l wrt n. 3j3 - 2jl + 2l What is the second derivative of 3s4 + 2s*3y*2 + 176s*3 + 3712sy2 + s + 2y wrt s? 36s2 + 12sy2 + 1056s Find the first derivative of -7fs*3 + 123fs - 9f - 22 wrt s. -21fs*2 + 123f What is the third derivative of -3z5 - 318z*3 - 150z*2? -180z*2 - 1908 Find the third derivative of 5l*4 + 1392l3 - l2 + 2l + 251. 120l + 8352 What is the third derivative of -35d5 - 142d*2? -2100d*2 What is the second derivative of 237j*4 - 476j wrt j? 2844j2 Find the second derivative of 4376s*2w - 161sw - s - w + 2 wrt s. 8752w Differentiate -15203g*4 - 6679. -60812g*3 What is the third derivative of 3451i*3 + 4858i*2? 20706 What is the third derivative of 10s*4 + 138s*3 - 6s*2 + s - 44? 240s + 828 Find the third derivative of -35x5 - 10x*4 + 843x*2 wrt x. -2100x*2 - 240x Find the second derivative of 3i4v*2 + 35i*2mv2 - 3im + mv*2 + 3mv wrt i. 36i*2v*2 + 70mv2 Differentiate m2u3 - m2u2y - m*2u*2 + 19mu2 + 14u*3y wrt y. -m*2u*2 + 14u*3 What is the derivative of 2404h*4 - 1124 wrt h? 9616h*3 What is the derivative of 2d*3i*3k + 260di*3k + d + 95i3k - 4i3 + 2k wrt d? 6d2i*3k + 260i3k + 1 What is the derivative of 16d2y - 34d2 + 2dy - 2d - 6249y wrt d? 32dy - 68d + 2y - 2 Differentiate -d3v + 126dmv - m - 6v - 12 wrt d. -3d2v + 126mv What is the derivative of 1541ox*3 - 265x*3 wrt o? 1541x*3 What is the second derivative of 2t*5u*2 - 108t*4u*2 - 944tu2 wrt t? 40t*3u*2 - 1296t*2u*2 What is the third derivative of -2750j*6q*2 + 12j*2q*2 + 8j*2q - j*2 wrt j? -330000j*3q*2 Find the second derivative of 11f*2v*3 + 8f*2v*2 + 11f*2v + 269fv - 2v2 wrt v. 66f*2v + 16f2 - 4 What is the second derivative of -10h*3q - 54h3 - 2hq + 1287h + q + 3 wrt h? -60hq - 324h Find the first derivative of -48qs2 - 2qv - 83q - s*2v + 3sv wrt s. -96qs - 2sv + 3v What is the second derivative of 7k*2o*3 + 2k*2o + 29ko - 22o3 - o wrt o? 42k*2o - 132o Find the third derivative of -439i*5 - 1181i*2. -26340i*2 What is the first derivative of -3b*2c*3 + 51b*2c*2 - 3b*2c + 6c3 - 38 wrt b? -6bc3 + 102bc2 - 6bc Find the third derivative of -2l*6 - 93l*3 - 502l*2 + 2 wrt l. -240l*3 - 558 Find the first derivative of -cd*3k + 13cdk3 + 591ck3 - 3k wrt d. -3cd*2k + 13ck*3 What is the third derivative of 16l*6 - 5l*5 + 2l*2 + 1? 1920l*3 - 300l*2 Differentiate 2g*2w - gw + 116g - 4w - 501 wrt g. 4gw - w + 116 What is the third derivative of -12dj6 - 56dj3 + dj*2 - 45dj + 5j*2 wrt j? -1440dj3 - 336d What is the second derivative of 6d2s*2 - 2d*2sz3 - 2d*2z*3 - ds*2z*2 + ds - 18dz*3 + sz*2 wrt d? 12s*2 - 4sz3 - 4z*3 Find the second derivative of 121s*4x - 5s3x*2 - 2s*3 - 6sx2 - s + 4x*2 + 4 wrt s. 1452s*2x - 30sx*2 - 12s What is the derivative of -79h4 - 61h*3 + 14873 wrt h? -316h*3 - 183h*2 What is the first derivative of 28983gm3 - 994m3 - m2 + 2m wrt g? 28983m*3 Find the third derivative of -413v*5 - 809v*2 wrt v. -24780v*2 Differentiate 2549p*3 + p + 4790 wrt p. 7647p*2 + 1 Find the first derivative of 14q*4 + 8q*2 + 6q - 4719. 56q3 + 16q + 6 Find the third derivative of -2b2n3 - b2n2 - 47b*2 + 11bn3 - 13bn2 + 17n*3 - 2n*2 wrt n. -12b*2 + 66b + 102 What is the third derivative of 31k3 - 19k2 + 7? 186 Find the third derivative of -o2y4 + 221o*2y*2 - 297oy4 wrt y. -24o*2y - 7128oy Find the second derivative of -1058g3t*3 + 2065g*3t - 2gt*4 wrt t. -6348g*3t - 24gt*2 Find the second derivative of -4454i*4 - 3667i wrt i. -53448i2 Find the second derivative of -89d*3p**2 -	{ "pile_set_name": "DM Mathematics" }
+ 5 - 2)(1 + 8 - 4)(5k2 - k2 - 2k*2). -4530k*3 Expand (0 - 3 + 2)(3p + 0p + 0p)(10 + 6227p + 47 + 6 - 63). -18681p*2 Expand 128u*2 - 268u*2 + 139u*2 - 863u3 + (u2 + u - u)(u - u - 2u). -865u3 - u2 Expand -1 + 4q*5 - 478q*3 + 478q*3 + (0q3 - q3 + 3q3)(-152 + 152 + 13q2). 30q*5 - 1 Expand -3y - 3y - 16y + (-3 + 3 + y)(-2 + 4 - 4) - 35y + 3y + 6y. -50y Expand (0 - 4 - 1)(-73 + 73 + 7z + (0 + 0 + 2)(-4z + 520 - 4z - 524)). 45z + 40 Expand (-1 + 1 - 4)(548 + 959 + 395)((-5 - 1 + 4)(4c - 2c - 3c) + 1 - 1 - c - 3c + c + 5c). -30432c Expand -4c3 + 2c*3 - 2c*3 + (-4 + 1 + 0)(-15c3 + 30c*3 - 30c3) - c2 - 2c3 + c2. 39c*3 Expand (-4v*2 - 2v*2 + 2v*2)(64v2 + 13v*3 - 64v*2) - 6v*5 + 5v*5 - 2v*5. -55v*5 Expand (10 - 65 - 4)(8 - 96 - 1 + 16)(0g*2 - 2g*2 + 5g*2). 12921g*2 Expand (3f*4 - 3 + 3)(5f + 0f - 4f) + 24f*5 + 17f*5 - 7f*5 + (3f - f*3 - 3f)(-7 - 6f*2 + 7). 43f*5 Expand (-4g2 + g2 + 0g2)(566g + 1540g - 240g). -5598g*3 Expand (-3 + 3w + 2 + 2)(-852 + 2175 - 1093). 690w + 230 Expand (-v*3 + v - v)(2v2 - 5v*2 + 7v*2) + (-18v*4 - 8v*4 + 2v*4)(2v - 8v - 3v). 212v*5 Expand (o - 4o + o)(69 + 28 + 12)(5o + o - o) + 50 + 4o*2 - 50 - o. -1086o*2 - o Expand (-1750 + 5680 + 111)(k*3 + 0k*3 - 2k*3). -4041k*3 Expand -1 - 24i*4 + 1 - 2i*4 + 0i4 + i4 + (-3i2 + i2 - i2)(3i2 + 0i + 0i). -34i*4 Expand (-1 - 9 - 4)(2z + z - z)(-6 + 0 + 3)(-2z + 11 - 11)(2820 - 2820 + z3 + 8z). -168z5 - 1344z*3 Expand (17o - 9o - 32o)(4 + 14 + 7)(6o - 3 + 3). -3600o*2 Expand (-26330m + 7622m + 5073m + 4303m)(3 - 3 - 2m). 18664m*2 Expand (2 + 3 - 1)(3u + u + 0u) + (3 - 5 - 1)(1 - u - 1) - 6 + 4u + 6. 23u Expand (2k3 + k3 - 4k3)(12k2 - 17k*2 + 99k*2) + (5k - 5k + 2k*2)(-k3 - 1 + 1) - 5 + 5 + k5 - 4 + 2k5 + 4 + 8k*5 + 35 - 35. -85k*5 Expand (-4652m*4 + 74m*3 - 74m*3 - 827m*4)(-2m - m + m). 10958m5 Expand (22 + 44 - h2 + 0h2)(4h - 4h + 12h). -12h*3 + 792h Expand (1 - 2 + 2)(-23k - 66k + 30k + (3 - 7 + 3)(0k + 2k + 3k)). -64k Expand -199 + 199 - 5r + (1 - 1 + 1)(2r + 13 - 13) + 4r - 6r + r. -4r Expand (-3v3 + v3 + 3v3)(121v - 178v + 4v2 - 58v). 4v5 - 115v*4 Expand -2g + 5g - 4g + (g - 2g + 2g)(83 - 6764 - 59) - g + 0g - g. -6743g Expand 736x*5 + 739x*5 + 1077x*3 - 1477x*5 + (-2x + 2x + 2x*2)(2x3 + x3 - 4x*3). -4x*5 + 1077x*3 Expand (2c - c - 2c)(2c + 2 - 2) + 29c*2 - 26c*2 + 45c*2 - 11c - 4c + 1410c*2 - 1406c*2. 50c*2 - 15c Expand (-4z2 - 5z*2 + 4z*2)(33 - 33 + 16z) + 8z*3 - 2z*3 + 2z*3 + 0z3 - z3 + 2z3 + (-3 + 5 - 3)(2z3 + 0z*3 - 4z*3). -69z*3 Expand (415 - 698 + 357)(-3z4 + 5 - 5 + (3z - 2z2 - 3z)(z2 + 0z*2 - 2z*2)). -74z*4 Expand (-1 - 3 + 0)(0 + 2 - 2w + 4w)(-6w - 5w + w) + (-3w - 3w + 4w)(-w - 2w + w). 84w2 + 80w Expand (-2 + 2 - 3y2)(-y*2 + 10y*2 - 2y*2) + (-127y + 273y - 131y)(-1 - y3 + 1) - y3 + y3 - 2y*4. -38y*4 Expand (-50o*3 - 24o*3 + 19o*3)(21o2 - 44o*2 - 68o*2). 5005o*5 Expand (-2940u + 632u - 401u - 1205u)(-1 - u*2 - 2u + 1). 3914u3 + 7828u*2 Expand ((-3u - 4u + 4u)(0 + 5 - 6) - 4u - 2u + 4u)(1 + 2 - 1)(3u + 20u + 10u)(0 - 4 - 1 - 1 - 1 - 1 + (-3 - 1 + 2)(2 + 1 - 1) + 5 + 0 - 6). -858u*2 Expand -17s*2 + 9s*2 - 30s*2 + (-2s*2 + 4s*2 + 3s*2)(-3 + 0 + 1) + 4s2 + 0s*2 - 3s*2. -47s*2 Expand (-2y + 3y + y)(-73 + 162 - 35)(1 + 1 - 4). -216y Expand -j*2 + 2j*2 - 4j*2 + (0j + j - 6j)(-3j + j - j) - j + j - 4j*2. 8j*2 Expand (-3x + 0x + 2x)((-1 + 4 - 4)(4379 + 756 - 887) - 1 - 3 + 5). 4247x Expand (-4k + 3k - k)(k*2 + 17k*2 + 7k*2) + (5k - 3k - k)(-15k2 - 6k*2 + 85k*2) + 2k*3 - 8k*3 + 2k*3. 10k*3 Expand (-2 - 1 + 2 - 3 + 0 + 1 + (-2 + 1 + 0)(-4 + 3 + 0) + 6 + 102 - 22)(-36d*2 - 2 + 5d + 4d2 - d2). -2772d*2 + 420d - 168 Expand (-10y2 + 1166 - 1067 + 0y*2)(-4y - 2y + 4y). 20y*3 - 198y Expand -5j5 + 3j*5 + 3j*5 + (-5805j*3 + 5805j*3 - 60j*4)(6j - j - 2j + (-1 + 1 - 1)(3j - 2j - 2j) + j - 2j + 0j). -179j5 Expand (16s + 142 - 142)(3s - 3 + 3) + 1775s2 - 1619s*2 + 2s - 2s. 204s2 Expand s4 - 2s + 2s + (-2s3 + 2s*3 + 3s*3)(3 - 3 - s) + 255267s2 + 264s*4 - 255267s*2. 262s*4 Expand (6d*2 + 2d*2 - 84d*2)(-41 + 7 - 23). 4332d2 Expand 4g*4 - 61 - 131 + 88 + (0g - 2g + 0g)(2g*3 - 4g*3 - 7g*3). 22g*4 - 104 Expand (-4 + 3 - 4)(-13u + 3u - 2u) + (0u + 0u + u)(-4 - 2 + 4) + 5u - 11u - 9u. 43u Expand (2q3 - 8q*3 + 3q*3)(3 - 7 - 8) + (-6q2 + 10q2 + q2)(0q + q - 2q). 31q*3 Expand -1 + 3v*3 + 1 + (4 - 3v - 4)(1 + 2v*2 - 1) - 4v*3 - 42v*2 + 39v*2 + 2v*3 + 2v*3 - 2v*2 + 2v*2. -3v*3 - 3v*2 Expand ((4 + 0 - 3)(3g + 0g - 4g) - g + 2 - 2 - 1698g + 32442 - 32442)(4g - 2g - g). -1700g*2 Expand (-3f*3 + 3f3 + f4 + (f4 - f4 + 2f4)(-1 + 1 - 1))((11 - 2 + 1)(-2f + 3f + 4f) - f + 3f - 4f). -48f*5 Expand (-1445h + 591h + 12h)(-7h - 3 + 3). 5894h2 Expand -80p*2 + 59p*4 - 89p*2 + 181p*2 + (-p + p + p)(-p3 - p3 + 4p3). 61p*4 + 12p*2 Expand (2f2 - f2 - 2f2)((6 - 2 - 3)(-6 + 2 + 2) - 126 + 3 + 49). 76f*2 Expand (15x*3 + 485x*3 - 76x*3)(0x2 + x2 - 3x*2) + 4x3 - x5 - 4x3 + 5x*5 + 0x*5 - 4x*5 - 15x*5. -863x*5 Expand (-17556 - 11404 + 998 - 2990)(i*5 - 4i5 + i5). 61904i5 Expand (51 + 26 - 4 + 16 + 24)(1113i2 + 605 - 605). 125769i*2 Expand (51z + 46 - 46)(3351z + z*2 - 3351z - 68). 51z3 - 3468z Expand (-4m + 2m + 0m)(-44 + 19 - 8)(-77m*2 - 149 + 149). -5082m*3 Expand (3q + 0q - q)((-24 + 16 - 9)(20 - 1 + 4) + 1 - 2 + 2 + (2 + 0 - 4)(3 + 2 - 4))(-3 + 5 - 1)(1 - 2 + 9). -6272q Expand (-22 + 15 + 28)(-58o2 + 65o*2 + 2o*3 + 2o*3). 84o*3 + 147o*2 Expand (-125 + 250 - 122 + m)(4 - 2m - 4) + (-7m + 2m - m)(-m - 4m + 0m). 28m2 - 6m Expand (4i - 5i + 3i)(-3 + 1 + 5) + ((-4 + 3 + 3)(-1 + 1 - i) + (-1 + 3 + 0)(-i + 3 - 3) - 44i + 0 + 0)(-6 + 2 + 2). 102i Expand (i3 + 27i*3 + 84i*3 + 4i - 4i - 2i*3 + (0i2 + i2 - 2i2)(-8 + 9i + 8))(i*2 + 0i2 + i2). 202i5 Expand (-1 - 1 + 0)(28k + 184k + 250k) + 2 - 2 + 4k. -920k Expand (y - 5 + y + 7072y*2 - 7074y*2)(-4 + 6 + 6). -16y2 + 16y - 40 Expand (-128 + 14z + 128)(-3z + 4z + 2z)(8 - 13z3 - 8). -546z*5 Expand (-80z*3 - 38z*3 - 8z*3)(-5z2 + 4z*2 + 16z*2 + 2z*2 + 0z + 0z + 4z*2 - 4z2 + z2 + (0z - 4z + 3z)(3z - z - 4z)). -2520z5 Expand (-118y + 20y3 + 118y)(141y + 217y - 104y). 5080y4 Expand (20 + 331 - 203)(-3n + 6n - 2n)(-n3 + n3 - 2n3) - 5n*4 - 7n + 7n + (-2 - n + 2)(0n + 0n - n*3) - 2n*4 + 0n4 - n4. -303n4 Expand (-68 + 8 + 30)(-8a + 19 - 19)(2 + 2 - 2). 480a Expand (44q*2 + 56q*2 + 13q*2)((0 + 4 - 2)(-q - 4q + 4q) - 2q + 5q - 4q). -339q3 Expand (-19 + 32 + 45)(2x + x - x - 5x + 4x + 3x - 3x - 3x + 4x + (4 + 0 - 3)(-4x + x + x) + 1 - 1 + x + x + 2 - 2)(-6 + 0 + 0)(-1 + 2x + 1). -1392x2 Expand (-153 + 43 + 60)(-2z2 - 2z*2 + 2z*2)(-8 + 119 - 10)(0z + 3z - 2z). 10100z3 Expand (-8x + 7x + 11x)(0x + 0x - x) + 3x*2 - 4x*2 + 3x*2 - 3x*2 - 4x*2 + 2x*2. -13x*2 Expand -30 + 15 + 13 - 53l*2 + 2l2 + l2 - l2 + (-l2 + l*2 - 3l*2)(3 - 5 + 0) - 2l2 - 1 + 1. -47l*2 - 2 Expand (0 + 6 - 2f - 1)(-14f + 4f - 11f) - f*2 + 7f*2 + 21 - 20. 48f*2 - 105f + 1 Expand (34l4 - 3 + 9l*4 + 0l*4)(2 - 3 - 4)(2 + 0 + 0)(4 - 4 - l). 430l5 - 30l Expand (y*2 + 3y - 3y)(2y - 4y + 6y) + 1207y*3 + 1433y*3 + 487y*3. 3131y*3 Expand (-2w + 2w2 + 2w)(-2 - 22 - 10) - 8w*2 - 3 + 3 + (0w + 3w - 4w)(2 - 2 + 3w) + w*2 + w - w. -78w**	{ "pile_set_name": "DM Mathematics" }
at is 570 minutes after 11:46 PM? 9:16 AM What is 103 minutes after 5:15 AM? 6:58 AM How many minutes are there between 8:52 PM and 5:19 AM? 507 What is 408 minutes after 11:30 PM? 6:18 AM What is 424 minutes before 9:24 PM? 2:20 PM What is 681 minutes before 2:29 AM? 3:08 PM What is 386 minutes after 8:24 AM? 2:50 PM How many minutes are there between 7:25 PM and 5:14 AM? 589 How many minutes are there between 8:49 AM and 6:34 PM? 585 What is 217 minutes before 12:07 AM? 8:30 PM What is 457 minutes before 5:35 AM? 9:58 PM What is 588 minutes before 1:46 PM? 3:58 AM How many minutes are there between 2:18 PM and 9:14 PM? 416 How many minutes are there between 9:21 AM and 7:55 PM? 634 How many minutes are there between 9:35 PM and 10:35 PM? 60 How many minutes are there between 7:12 PM and 6:57 AM? 705 How many minutes are there between 9:52 PM and 10:45 PM? 53 How many minutes are there between 6:18 AM and 9:55 AM? 217 What is 610 minutes before 7:57 PM? 9:47 AM How many minutes are there between 5:42 AM and 4:57 PM? 675 How many minutes are there between 4:30 PM and 7:59 PM? 209 What is 584 minutes after 9:32 AM? 7:16 PM How many minutes are there between 9:45 PM and 5:57 AM? 492 How many minutes are there between 8:29 AM and 5:27 PM? 538 What is 454 minutes after 3:17 AM? 10:51 AM How many minutes are there between 11:50 AM and 9:23 PM? 573 What is 60 minutes after 8:52 AM? 9:52 AM What is 203 minutes before 11:06 PM? 7:43 PM What is 4 minutes before 6:25 AM? 6:21 AM What is 77 minutes after 12:00 PM? 1:17 PM How many minutes are there between 10:28 AM and 8:01 PM? 573 What is 97 minutes before 8:05 AM? 6:28 AM How many minutes are there between 6:17 AM and 10:17 AM? 240 What is 142 minutes before 9:26 AM? 7:04 AM What is 535 minutes after 11:56 PM? 8:51 AM What is 159 minutes before 7:28 PM? 4:49 PM What is 538 minutes before 1:26 AM? 4:28 PM How many minutes are there between 6:08 PM and 9:23 PM? 195 What is 587 minutes before 12:51 AM? 3:04 PM What is 414 minutes after 1:04 PM? 7:58 PM What is 123 minutes after 7:12 AM? 9:15 AM What is 430 minutes after 3:12 AM? 10:22 AM How many minutes are there between 5:02 AM and 8:06 AM? 184 What is 186 minutes before 1:03 PM? 9:57 AM How many minutes are there between 5:40 AM and 10:29 AM? 289 How many minutes are there between 8:15 PM and 5:14 AM? 539 How many minutes are there between 10:25 AM and 12:46 PM? 141 How many minutes are there between 7:00 AM and 10:04 AM? 184 How many minutes are there between 11:13 PM and 9:43 AM? 630 How many minutes are there between 5:51 PM and 6:16 PM? 25 How many minutes are there between 8:34 AM and 10:34 AM? 120 What is 391 minutes before 6:53 PM? 12:22 PM What is 52 minutes before 7:11 PM? 6:19 PM What is 501 minutes after 6:18 AM? 2:39 PM How many minutes are there between 3:24 AM and 5:27 AM? 123 How many minutes are there between 9:44 AM and 9:54 AM? 10 What is 98 minutes after 2:43 PM? 4:21 PM How many minutes are there between 5:28 AM and 11:44 AM? 376 What is 617 minutes before 11:19 AM? 1:02 AM What is 682 minutes after 2:28 PM? 1:50 AM What is 38 minutes before 1:21 AM? 12:43 AM How many minutes are there between 11:01 AM and 3:47 PM? 286 What is 685 minutes after 5:09 AM? 4:34 PM How many minutes are there between 4:13 PM and 12:01 AM? 468 How many minutes are there between 9:41 AM and 3:47 PM? 366 What is 264 minutes before 7:16 AM? 2:52 AM How many minutes are there between 4:00 PM and 6:47 PM? 167 How many minutes are there between 1:37 PM and 3:07 PM? 90 What is 293 minutes after 1:58 AM? 6:51 AM What is 657 minutes after 10:58 AM? 9:55 PM What is 318 minutes after 8:16 AM? 1:34 PM What is 625 minutes after 8:50 AM? 7:15 PM How many minutes are there between 8:11 AM and 12:54 PM? 283 How many minutes are there between 2:49 AM and 11:12 AM? 503 How many minutes are there between 9:22 PM and 12:53 AM? 211 How many minutes are there between 12:21 AM and 12:01 PM? 700 How many minutes are there between 12:50 PM and 3:35 PM? 165 What is 587 minutes after 11:06 AM? 8:53 PM What is 578 minutes before 8:29 AM? 10:51 PM How many minutes are there between 5:46 AM and 5:13 PM? 687 How many minutes are there between 3:56 AM and 5:18 AM? 82 What is 240 minutes after 6:32 AM? 10:32 AM How many minutes are there between 11:58 AM and 7:02 PM? 424 How many minutes are there between 1:14 PM and 4:28 PM? 194 How many minutes are there between 5:54 PM and 3:27 AM? 573 What is 719 minutes before 7:20 AM? 7:21 PM How many minutes are there between 10:59 AM and 12:56 PM? 117 How many minutes are there between 2:10 PM and 3:57 PM? 107 How many minutes are there between 11:21 AM and 6:22 PM? 421 How many minutes are there between 2:09 AM and 1:41 PM? 692 What is 672 minutes before 8:56 AM? 9:44 PM How many minutes are there between 3:08 PM and 3:10 PM? 2 What is 557 minutes before 7:23 PM? 10:06 AM What is 700 minutes before 12:55 PM? 1:15 AM What is 481 minutes after 3:56 AM? 11:57 AM How many minutes are there between 4:23 PM and 11:02 PM? 399 How many minutes are there between 5:58 AM and 6:08 AM? 10 What is 624 minutes after 6:16 PM? 4:40 AM How many minutes are there between 6:08 AM and 8:59 AM? 171 What is 328 minutes before 10:42 PM? 5:14 PM What is 71 minutes after 4:14 PM? 5:25 PM What is 320 minutes after 12:34 PM? 5:54 PM How many minutes are there between 8:28 PM and 3:28 AM? 420 What is 104 minutes before 12:02 AM? 10:18 PM How many minutes are there between 4:15 AM and 9:11 AM? 296 How many minutes are there between 3:32 AM and 9:43 AM? 371 How many minutes are there between 12:46 PM and 7:42 PM? 416 What is 669 minutes before 8:25 PM? 9:16 AM How many minutes are there between 5:16 PM and 6:08 PM? 52 What is 592 minutes after 11:50 AM? 9:42 PM How many minutes are there between 8:49 AM and 2:48 PM? 359 How many minutes are there between 8:17 AM and 4:05 PM? 468 What is 543 minutes after 6:46 PM? 3:49 AM What is 33 minutes before 12:41 AM? 12:08 AM What is 104 minutes after 3:39 PM? 5:23 PM How many minutes are there between 10:45 AM and 7:06 PM? 501 What is 609 minutes before 11:56 AM? 1:47 AM What is 92 minutes after 4:09 PM? 5:41 PM What is 176 minutes after 8:58 PM? 11:54 PM How many minutes are there between 5:13 PM and 9:11 PM? 238 What is 121 minutes after 5:21 PM? 7:22 PM How many minutes are there between 11:36 AM and 8:35 PM? 539 How many minutes are there between 8:29 AM and 5:41 PM? 552 How many minutes are there between 7:10 PM and 10:15 PM? 185 What is 616 minutes before 7:36 PM? 9:20 AM How many minutes are there between 2:16 PM and 12:25 AM? 609 How many minutes are there between 3:23 PM and 10:35 PM? 432 How many minutes are there between 1:46 AM and 2:11 AM? 25 What is 328 minutes after 11:10 PM? 4:38 AM What is 359 minutes after 1:54 AM? 7:53 AM What is 315 minutes after 7:00 PM? 12:15 AM How many minutes are there between 7:35 AM and 4:15 PM? 520 What is 618 minutes before 6:37 AM? 8:19 PM How many minutes are there between 6:18 PM and 12:29 AM? 371 How many minutes are there between 3:54 AM and 5:23 AM? 89 What is 136 minutes before 2:21 AM? 12:05 AM How many minutes are there between 1:37 AM and 7:02 AM? 325 What is 235 minutes after 4:54 AM? 8:49 AM How many minutes are there between 7:18 AM and 8:20 AM? 62 What is 165 minutes before 2:22 AM? 11:37 PM What is 277 minutes before 12:04 PM? 7:27 AM What is 634 minutes before 4:58 AM? 6:24 PM How many minutes are there between 2:26 PM and 1:31 AM? 665 What is 710 minutes after 10:38 AM? 10:28 PM How many minutes are there between 8:01 AM and 12:12 PM? 251 How many minutes are there between 5:02 PM and 2:34 AM? 572 How many minutes are there between 10:48 AM and 2:02 PM? 194 What is 132 minutes after 9:22 PM? 11:34 PM What is 296 minutes before 9:52 AM? 4:56 AM What is 360 minutes before 9:21 PM? 3:21 PM What is 197 minutes before 5:18 AM? 2:01 AM What is 202 minutes after 9:59 PM? 1:21 AM How many minutes are there between 5:21 PM and 2:05 AM? 524 How many minutes are there between 5:32 PM and 12:31 AM? 419 What is 309 minutes before 5:33 AM? 12:24 AM How many minutes are there between 8:36 PM and 12:47 AM? 251 How many minutes are there between 5:32 PM and 3:39 AM? 607 What is 186 mi	{ "pile_set_name": "DM Mathematics" }
-138222001 -6 Divide 132 by -4964. -33/1241 What is -47 divided by 401115? -47/401115 Divide -705614 by -50401. 14 What is -83408868 divided by -27802956? 3 Divide -96672740 by 955. -101228 259 divided by 7740 259/7740 Calculate -110727225 divided by 24045. -4605 20515 divided by 789 20515/789 What is -1972425 divided by -1785? 1105 Calculate -2877729 divided by -2099. 1371 Calculate 11588934 divided by -48693. -238 2745317 divided by 48 2745317/48 -61668090 divided by 6 -10278015 Divide -897152 by 139. -897152/139 What is 90605937 divided by -30201979? -3 Calculate 109283 divided by -855. -109283/855 What is 377145 divided by 75? 25143/5 Calculate -58492975 divided by 2339719. -25 -53409350 divided by 5 -10681870 What is -5545393 divided by -7? 792199 Divide 3896478770 by -5. -779295754 -255262825 divided by 79 -3231175 -1 divided by 337673059 -1/337673059 Divide -14103132 by 5. -14103132/5 Calculate -439003079 divided by 113. -3884983 8250445 divided by 277 29785 -3687800 divided by 18439 -200 What is 226397458 divided by -113198729? -2 Divide 74270412 by 3. 24756804 Divide 55452732 by 55452732. 1 What is 2955854 divided by -638? -4633 750 divided by 163900 15/3278 -712053 divided by -28 712053/28 Calculate 2623168 divided by 327896. 8 What is -2215663 divided by 31? -71473 Divide -19691298 by -4. 9845649/2 Calculate -69785800 divided by 1246175. -56 What is -11950800 divided by 5? -2390160 Divide -265650 by 1288. -825/4 Calculate -23520 divided by 157. -23520/157 Divide 59987346 by -29993673. -2 -603315362 divided by 635738 -949 What is 85201734 divided by 3? 28400578 Divide 75547602 by 968559. 78 Calculate 3948738 divided by 4. 1974369/2 What is 194306940 divided by 4? 48576735 Divide 57378916 by 2773. 20692 What is 3896084 divided by -1948042? -2 -556191 divided by 261 -2131 What is -1550723 divided by 23? -1550723/23 Calculate -80736116 divided by 58. -1392002 Divide 742092210 by -306270. -2423 What is 6452950 divided by 4475? 1442 Calculate -832226276 divided by 2. -416113138 Divide 3779360 by 208. 18170 -43427508 divided by 4 -10856877 Calculate -1 divided by -5123773. 1/5123773 Calculate 2199568 divided by -164. -13412 What is -19155396 divided by -17? 1126788 Calculate -12732432 divided by -55844. 228 Calculate 25915824 divided by -261776. -99 What is -5400748 divided by 1? -5400748 Divide -15 by -463711. 15/463711 Calculate 247976732 divided by 337. 735836 Divide 1061852 by 42. 530926/21 Divide 775979 by 36. 775979/36 Calculate -1653790446 divided by -2. 826895223 5961 divided by -1179 -1987/393 Calculate -49 divided by 145591. -49/145591 What is 186114824 divided by 6003704? 31 Calculate 15862680 divided by 120. 132189 What is 1 divided by -19578454? -1/19578454 Divide -159 by -30974. 159/30974 Calculate 5 divided by 176805. 1/35361 Calculate 412391 divided by 1. 412391 11 divided by 30745821 11/30745821 Divide -4965792 by -1241448. 4 Calculate -7541840 divided by 1508368. -5 Calculate 573819 divided by -13. -573819/13 What is 370 divided by -32592? -185/16296 Divide 2 by -1138691. -2/1138691 Calculate 3 divided by 113101024. 3/113101024 Calculate -7505116 divided by 1604. -4679 Divide -279814 by 16. -139907/8 What is -3015263290 divided by 5? -603052658 0 divided by -8393154 0 What is -29 divided by -551418? 29/551418 -94536927 divided by 4383 -21569 What is -98 divided by 1084575? -98/1084575 27 divided by 4112519 27/4112519 Calculate 116932046 divided by -22. -5315093 What is 4837060 divided by 1209265? 4 What is 111 divided by -6743664? -37/2247888 Divide 9138913 by 1305559. 7 Divide -108333814 by -54166907. 2 Divide 41704435 by 41704435. 1 What is -16151932 divided by -8075966? 2 What is -81128893 divided by 1? -81128893 Divide -37875320 by -3706. 10220 What is 18214 divided by -156? -9107/78 -955539 divided by 365 -955539/365 -2527 divided by -62222 2527/62222 Divide -17588 by 49. -17588/49 Divide 93217 by -251. -93217/251 Calculate -917196 divided by -84. 10919 Calculate -12078917 divided by -3. 12078917/3 Calculate -26395117 divided by 3770731. -7 What is 7318 divided by 285? 7318/285 Calculate -273378 divided by -55. 273378/55 Calculate 268063906 divided by 1733. 154682 What is -323 divided by -2981822? 17/156938 445952 divided by -1 -445952 Calculate -4 divided by -16067994. 2/8033997 Divide 2309440 by -16496. -140 Divide -51494 by 86. -25747/43 -21324072 divided by -1694 12588 What is 33395391 divided by -258879? -129 Calculate 286316928 divided by -8128. -35226 Divide 71268126 by 38. 1875477 -41425 divided by -279 41425/279 -109843290 divided by 405 -271218 Calculate -2 divided by -4259308. 1/2129654 What is -34 divided by 235937? -34/235937 Calculate 0 divided by -53157811. 0 What is -11901344 divided by -488? 24388 56240932 divided by 18 28120466/9 Calculate 43193508 divided by 14397836. 3 Calculate -140983485 divided by 46994495. -3 100019136 divided by -3 -33339712 Divide -3 by -85087339. 3/85087339 639511 divided by -8 -639511/8 Divide 2004 by 174657. 668/58219 Calculate -28521578 divided by -14260789. 2 What is 10100628 divided by -18? -561146 Calculate -190110024 divided by 15842502. -12 Divide -96958 by -1. 96958 Calculate 448884312 divided by 3. 149628104 Divide -4853911 by 255469. -19 Calculate -93122300 divided by 2060. -45205 25546581 divided by -639 -39979 What is -128393404 divided by -32098351? 4 -920 divided by 27371 -920/27371 Divide -72 by -6245368. 9/780671 What is 20333724 divided by 5757? 3532 Divide 51063 by -276. -17021/92 Calculate -988733852 divided by -2. 494366926 Divide -2328006 by 22. -1164003/11 Calculate 502664165 divided by -3373585. -149 What is 4 divided by 10437418? 2/5218709 Calculate -39959128 divided by -2. 19979564 What is 885990 divided by -14? -63285 Divide -660482 by 249. -660482/249 What is 0 divided by 53795684? 0 Calculate 232184399 divided by -4. -232184399/4 Divide 150 by 93239. 150/93239 Calculate 6078960 divided by -360. -16886 -210340668 divided by -93986 2238 Calculate -205964682 divided by -316382. 651 Calculate 923907 divided by -689. -923907/689 What is 4558 divided by 13831? 4558/13831 Divide 82 by 1447007. 82/1447007 Calculate 56746842 divided by 2. 28373421 Calculate 2 divided by -17800865. -2/17800865 What is -109348 divided by -3880? 27337/970 Divide -1923613464 by 6. -320602244 What is 557 divided by -17801? -557/17801 -20847224 divided by -2 10423612 Calculate -35268174 divided by 6. -5878029 488499984 divided by -2531088 -193 What is -2560902 divided by 2? -1280451 Divide 0 by 3244794. 0 Divide 7031377 by -17. -7031377/17 Divide -2 by -4850930. 1/2425465 Divide 7897240 by -4. -1974310 What is 161734899 divided by -161734899? -1 -556 divided by -110768 139/27692 Calculate 3174 divided by -61. -3174/61 1961394 divided by 233 8418 -496 divided by -45426 248/22713 What is 33744 divided by 7? 33744/7 Calculate 5587 divided by 1728. 5587/1728 Divide 437 by 1196. 19/52 What is -2 divided by -7674369? 2/7674369 Divide 16425105 by -1095007. -15 What is 580 divided by -28361? -580/28361 193096980 divided by 6 32182830 What is 72707724 divided by -9? -8078636 -27 divided by 29937761 -27/29937761 What is 13242495 divided by 4414165? 3 Calculate 26379 divided by -25550. -26379/25550 180865672 divided by 2858 63284 What is -12 divided by 29262? -2/4877 29112211 divided by 21677 1343 What is -143813724 divided by 5? -143813724/5 What is 7628 divided by 176? 1907/44 -20268 divided by 1289 -20268/1289 6119814 divided by 1 6119814 Calculate -2804490 divided by 18. -155805 -6 divided by 57389978 -3/28694989 Calculate 1441083950 divided by 2. 720541975 Calculate -41 divided by 943623. -41/943623 -3 divided by 1266915 -1/422305 Divide -417824595 by -592659. 705 2 divided by -446148268 -1/223074134 Calculate -2322740 divided by 28. -82955 What is 3 divided by 3860912? 3/3860912 -24 divided by 12450005 -24/12450005 -599573 divided by -22 599573/22 What is -1 divided by 1058532? -1/1058532 Calculate -6 divided by 41558738. -3/20779369 Divide 71842508 by -17774. -4042 3267 divided by 2731 3267/2731 -120608 divided by 173 -120608/173 1234580852 divided by 4 308645213 76116516 divided by -28 -2718447 Calculate -161466665 divided by 4. -161466665/4 Calculate -975132 divided by -10	{ "pile_set_name": "DM Mathematics" }
rounded to the nearest ten thousand? 21290000 What is -368082.3556 rounded to the nearest ten? -368080 Round -0.000001127519808 to seven dps. -0.0000011 What is -866507.44 rounded to the nearest one million? -1000000 Round 0.150333701 to 5 dps. 0.15033 What is 1703817.124 rounded to the nearest 10000? 1700000 Round -0.03837681349 to five dps. -0.03838 What is -20169.2063 rounded to the nearest one hundred? -20200 What is 0.0000005740126 rounded to 7 dps? 0.0000006 What is 0.368910432 rounded to 2 dps? 0.37 What is 323116.5407 rounded to the nearest 100? 323100 Round 496.131838 to the nearest one hundred. 500 What is -0.00080791227 rounded to seven decimal places? -0.0008079 Round -0.00609585508 to three dps. -0.006 Round 3268694.74 to the nearest 10000. 3270000 Round 0.000000583544964 to six dps. 0.000001 Round 11304.8925 to the nearest 10. 11300 What is 1955946.38 rounded to the nearest one hundred? 1955900 Round 142092730 to the nearest 10000. 142090000 What is 2128728.1 rounded to the nearest one hundred thousand? 2100000 Round 0.000105010877 to 5 decimal places. 0.00011 What is -0.000000177755692 rounded to seven decimal places? -0.0000002 What is -107412308 rounded to the nearest 1000000? -107000000 What is 0.0187467143 rounded to 5 decimal places? 0.01875 Round -606.599868 to two decimal places. -606.6 What is -2413647.95 rounded to the nearest 1000000? -2000000 What is -874308.14 rounded to the nearest 1000? -874000 Round -0.0088329933 to 3 dps. -0.009 What is 0.000239286292 rounded to seven dps? 0.0002393 Round -0.00559819648 to seven dps. -0.0055982 Round -2083702720 to the nearest one hundred thousand. -2083700000 Round -7.72018525 to one dp. -7.7 What is -0.0000227842578 rounded to seven decimal places? -0.0000228 Round -0.000061400483 to seven decimal places. -0.0000614 What is -13.5646943 rounded to one dp? -13.6 What is 39856.178 rounded to the nearest ten? 39860 Round 0.0245052564 to 3 decimal places. 0.025 Round 1231.472606 to the nearest integer. 1231 Round -0.000012664143 to 6 dps. -0.000013 Round 36.4114224 to 3 decimal places. 36.411 Round 0.043919778 to 3 dps. 0.044 What is -1.045365033 rounded to 4 decimal places? -1.0454 What is 1264170.1 rounded to the nearest 1000? 1264000 What is 0.039692134 rounded to three decimal places? 0.04 What is -4.2099198 rounded to one decimal place? -4.2 Round 9458151900 to the nearest one million. 9458000000 Round -13.0579423 to one dp. -13.1 Round -1463361930 to the nearest 1000000. -1463000000 Round -427.900561 to the nearest ten. -430 What is -0.0498376569 rounded to 4 decimal places? -0.0498 Round -11.17088037 to zero dps. -11 Round -2.2852104 to 2 decimal places. -2.29 What is -8206952600 rounded to the nearest one million? -8207000000 What is -1980426876 rounded to the nearest 1000000? -1980000000 Round -3752404640 to the nearest one hundred thousand. -3752400000 What is 395725310 rounded to the nearest one million? 396000000 Round -0.021598548 to 5 decimal places. -0.0216 Round 13750.5008 to the nearest ten. 13750 Round -3.87464722 to 0 decimal places. -4 Round 1.481961072 to four dps. 1.482 Round 0.0108255326 to seven decimal places. 0.0108255 What is -249328.426 rounded to the nearest one hundred? -249300 Round -0.000001064899387 to seven dps. -0.0000011 What is 0.00824829519 rounded to five dps? 0.00825 Round -1229.50775 to the nearest 100. -1200 Round 0.00001920216615 to 7 dps. 0.0000192 What is 0.33343501 rounded to 1 dp? 0.3 Round -23.6821762 to one dp. -23.7 What is -4.04112962 rounded to two dps? -4.04 What is -3320.7981 rounded to the nearest integer? -3321 What is -68.6886065 rounded to 1 decimal place? -68.7 What is 43973.872 rounded to the nearest 1000? 44000 What is 6881.0402 rounded to the nearest 100? 6900 Round 5645.1093 to the nearest one thousand. 6000 Round 0.00320492992 to 7 decimal places. 0.0032049 What is -23.2196407 rounded to one dp? -23.2 Round 20.3771611 to 1 dp. 20.4 Round 5374.338 to the nearest 10. 5370 What is -6118331.8 rounded to the nearest ten thousand? -6120000 What is -3604.38736 rounded to 0 decimal places? -3604 Round 147.816156 to one dp. 147.8 Round -0.036482765 to four decimal places. -0.0365 Round -0.00002408033 to five dps. -0.00002 What is -30.5296836 rounded to the nearest integer? -31 Round 29.655661 to zero decimal places. 30 Round 356373.4408 to the nearest one hundred thousand. 400000 Round -26050495.4 to the nearest 100000. -26100000 Round 0.001122765853 to six decimal places. 0.001123 What is 0.00004124192096 rounded to six decimal places? 0.000041 Round 220.929656 to one decimal place. 220.9 Round 26164113 to the nearest 100000. 26200000 Round 0.0048476749 to 5 dps. 0.00485 Round 0.0063050678 to 3 decimal places. 0.006 Round 0.000148088422 to 5 decimal places. 0.00015 Round 110329.2597 to the nearest 10000. 110000 What is 5702.2965 rounded to the nearest one hundred? 5700 Round 1601.0656134 to the nearest 100. 1600 Round 20.3011051 to zero dps. 20 Round -4831297104 to the nearest 100000. -4831300000 Round 0.90320301 to three decimal places. 0.903 What is 0.0116430459 rounded to five decimal places? 0.01164 What is -242429.619 rounded to the nearest 10? -242430 What is -21062287 rounded to the nearest 100000? -21100000 What is 0.00039103476 rounded to four dps? 0.0004 What is 0.0166802398 rounded to five dps? 0.01668 What is 83.0812309 rounded to the nearest ten? 80 What is 31656491 rounded to the nearest one million? 32000000 What is 646.75235 rounded to the nearest 100? 600 What is -0.00003985256418 rounded to 7 dps? -0.0000399 What is -0.00000170161848 rounded to seven decimal places? -0.0000017 What is -58656.02002 rounded to the nearest 1000? -59000 Round -0.0033765498 to four dps. -0.0034 What is 0.0001570178771 rounded to six decimal places? 0.000157 What is -32.137309772 rounded to the nearest integer? -32 What is -1276530.4539 rounded to the nearest 100? -1276500 What is -0.044636115 rounded to 3 dps? -0.045 Round 70724.16064 to the nearest 10000. 70000 What is -0.184878295 rounded to five decimal places? -0.18488 What is -7.6262156 rounded to two decimal places? -7.63 What is 0.000094757366 rounded to six dps? 0.000095 Round 13.6513639 to 1 dp. 13.7 Round 0.0136309045 to four dps. 0.0136 Round -5227291710 to the nearest 1000000. -5227000000 Round 408.623659 to the nearest one hundred. 400 Round 5.7346216 to two dps. 5.73 Round 0.00000611338 to four decimal places. 0 Round -6.82766478 to zero dps. -7 Round -1.244688397 to 3 dps. -1.245 What is 1171528457.7 rounded to the nearest 10000? 1171530000 What is -0.00000580475545 rounded to six dps? -0.000006 Round 0.39521181 to three dps. 0.395 Round 0.01529005372 to three dps. 0.015 What is 757.8259584 rounded to the nearest one hundred? 800 Round 333631.79 to the nearest one hundred. 333600 What is 1.35950694 rounded to 1 dp? 1.4 What is -598.97274 rounded to 1 dp? -599 What is 0.000067532876 rounded to seven decimal places? 0.0000675 Round 0.000116264448 to seven decimal places. 0.0001163 Round -8.376526 to zero decimal places. -8 What is 0.025210594 rounded to 4 dps? 0.0252 What is -0.017420575 rounded to 3 decimal places? -0.017 Round 0.0000669103757 to 6 dps. 0.000067 What is 0.077290511 rounded to two decimal places? 0.08 What is 1394396.45 rounded to the nearest 100? 1394400 Round -0.0000008814232 to 7 dps. -0.0000009 Round -6.4569327 to 3 dps. -6.457 Round 247.5496977 to 2 dps. 247.55 Round 514567.144 to the nearest 10000. 510000 Round 19289696900 to the nearest one million. 19290000000 Round 0.0021601806 to 4 dps. 0.0022 What is 30141480500 rounded to the nearest 1000000? 30141000000 What is 0.0031310073 rounded to 6 dps? 0.003131 What is -5174580802 rounded to the nearest 1000000? -5175000000 What is -84.59266195 rounded to 2 dps? -84.59 Round -12738218 to the nearest 10000. -12740000 Round -0.00001404619085 to six decimal places. -0.000014 What is -0.0306205 rounded to 2 decimal places? -0.03 Round 62.572097 to the nearest ten. 60 Round -1314.672305 to the nearest integer. -1315 What is -0.05236527634 rounded to 6 decimal places? -0.052365 Round 0.00730553635 to 4 dps. 0.0073 What is -0.001898994151 rounded to 7 decimal places? -0.001899 What is -1.46896248 roun	{ "pile_set_name": "DM Mathematics" }
*6 + 0f*2. Find the second derivative of h(o) wrt o. 24o*2 Let b = 14 - 9. Suppose -3w = -k + 2, -bk + w + 10 = 5w. What is the first derivative of n*4 + 0n*4 - 1 - kn*4 wrt n? -4n*3 Let q be (2/3)/((-6)/(-27)). Let m(d) be the first derivative of -2/3d*q + 0d*2 + 3/4d*4 + 0d + 1. What is the third derivative of m(c) wrt c? 18 Let h be 1 + (-1 - 16/(-4)). Differentiate hy + 1 + 1 + 2 - 10y wrt y. -6 Suppose 2a - 3u = 8, u + 12 + 0 = 3a. Let p(y) be the first derivative of 1 - 1/2y*a - 2/3y*3 + 0y*2 + 0y. Find the third derivative of p(h) wrt h. -12 Let b(o) = -15o3 + 3o*2 + 14o - 3. Let u(l) = -16l3 + 4l*2 + 15l - 4. Let h(x) = -4b(x) + 3u(x). What is the second derivative of h(a) wrt a? 72a Let u(k) be the third derivative of -k5/20 + k4/6 + k2. What is the second derivative of u(g) wrt g? -6 Let y(c) be the third derivative of c6/15 + c4/24 + 3c*2. Find the second derivative of y(h) wrt h. 48h Let y be 1 + (-2)/6-9. What is the second derivative of -6d - 5d2 + 6d*2 + yd*2 wrt d? 10 What is the derivative of -2 + 4 + 0 - 3 + 6k*2 wrt k? 12k Let h(s) be the first derivative of -5s4/4 - 7s - 1. Find the first derivative of h(p) wrt p. -15p2 Let n = 35 - 35. Let q(z) be the third derivative of 0z*3 + 3z*2 + 0z*5 + 0z + 1/12z4 - 1/40z*6 + n. What is the second derivative of q(l) wrt l? -18l Let b(o) be the second derivative of 3o6/10 + 5o*2 - 12o. Find the first derivative of b(v) wrt v. 36v3 What is the third derivative of 9g*2 - 3g4 + g2 - 6g4 + 16g*4 wrt g? 168g Let v(w) = 2w4 - 4w*3 + 11w*2 - 4. Let o(m) = 3m*4 - 3m*3 + 11m*2 - 3. Let r(n) = 4o(n) - 3v(n). Find the third derivative of r(k) wrt k. 144k Let r(f) be the first derivative of 25f4/4 - 23f - 12. Differentiate r(x) with respect to x. 75x2 Let t(f) = -8f2 - 1. Let z be t(1). Let b(p) = p3 + 9p2 + 4. Let d be b(z). Find the third derivative of 3s*4 - 3s*d + 2s5 - s2 wrt s. 120s2 Let y(n) be the third derivative of -5/336n*8 - 2n*2 + 0n*7 + 0n*4 + 0n*3 - 1/15n*5 + 0n*6 + 0n + 0. Find the third derivative of y(z) wrt z. -300z2 Let d(q) = -53q + 22. Let g(r) = 51r - 22. Let v(p) = 5d(p) + 6g(p). Find the first derivative of v(i) wrt i. 41 What is the second derivative of -10 + 3j*4 + 10 - 9j + 3j4 wrt j? 72j*2 Find the second derivative of -3g - 17g2 + 2g*2 - 5g + 13g wrt g. -30 Let x(h) be the third derivative of -2h*6/15 + 13h*3/6 - 9h*2. Differentiate x(v) with respect to v. -48v*2 Let y be (8/(-10))/(3/(-45)). Suppose 0 = -2m - 2m + y. What is the third derivative of 3f*4 - 2f*2 + mf*4 - 5f*4 wrt f? 24f Let n be (1 + 0)(-18)/(-54). Let z(q) be the second derivative of 0 + 1/12q*4 + 0q*2 + nq*3 - q. What is the second derivative of z(j) wrt j? 2 Let z(i) = -7i*4 + 3i. Let f = 8 - 10. Let v(u) = 6u4 - 3u. Let d(b) = fz(b) - 3v(b). What is the second derivative of d(k) wrt k? -48k2 Find the second derivative of 32o - 229o5 + 427o*5 - 216o*5 wrt o. -360o*3 Let c = -2 + 8. Let g(v) = -7v*4 - 6v3 - v. Let h(z) = z4 + z*3. Let i(b) = ch(b) + g(b). What is the second derivative of i(a) wrt a? -12a2 Suppose 5a - 3r - 25 = 0, -4a - 6 = -2a + 2r. What is the second derivative of k - ak4 + k - 2k*3 + 2k*3 wrt k? -24k*2 Suppose 0i = -3i - 3, 8 = q - 3i. Suppose qh = 12 + 3. What is the first derivative of -h + 0a - 7a2 + 10a*2 + 0a wrt a? 6a Let s(n) be the second derivative of 7/6n*3 + 5/12n*4 + 0n*2 + 0 + 5n. What is the second derivative of s(j) wrt j? 10 Let w be -1 + 82/4. What is the derivative of -7u*3 + 2 - 1 + 9u*w wrt u? 6u*2 What is the third derivative of 3b - 79b2 - 23b*6 + 74b*2 - 8b wrt b? -2760b3 Let y(j) = j2 + 2j - 1. Let w be 2/4(-3 - 3). Let v be y(w). Differentiate -8b - vb2 + 8b + 1 wrt b. -4b Let g(w) be the second derivative of 0 + 8w + 0w5 - 1/3w*3 + 0w*2 + 0w*4 - 2/15w*6. What is the second derivative of g(i) wrt i? -48i*2 Let f(s) be the first derivative of -2s7/21 - s3/2 - 3s + 2. Let a(h) be the first derivative of f(h). Find the second derivative of a(z) wrt z. -80z*3 Let n(p) = -6p*3 + 5p*2 + 5p + 6. Let u(j) = -5j3 + 4j*2 + 4j + 5. Let b = -2 - -7. Let v(f) = bu(f) - 4n(f). What is the derivative of v(w) wrt w? -3w2 Let i(n) = 11n*3 + 5n*2 + 9n + 5. Let h(s) = 12s3 + 6s*2 + 8s + 6. Let c(d) = 5h(d) - 6i(d). What is the second derivative of c(o) wrt o? -36o What is the third derivative of -18v*5 - 28v*2 - 13v*5 + 63v*5 wrt v? 1920v*2 Let y(p) = -5p*4 - 4p*3 - 5. Let m(v) = -14v*4 - 11v*3 - 15. Let q(u) = 4m(u) - 11y(u). Differentiate q(x) with respect to x. -4x3 Let x(s) be the third derivative of -s7/1008 - s*6/720 + 2s*5/15 + 5s*2. Let j(q) be the third derivative of x(q). What is the derivative of j(o) wrt o? -5 Let p be 3/(22/16). Suppose -2r - r = -p. What is the derivative of 4o - r - o + 0o wrt o? 3 Let n be (1 - 2)/((-10)/(-4) + -3). Let h(x) = x3 - 6x2 + 2. Let a be h(6). Find the third derivative of tn - 10 - t*3 + 10 - at*2 wrt t. -6 Let h(p) be the first derivative of 3p*5/5 - 3p + 5. Differentiate h(m) with respect to m. 12m3 Find the third derivative of 6d*5 + 13d*6 + 5d*6 - 9d*2 - 6d*5 wrt d. 2160d*3 Let y(x) = -4x - 5. Let k(q) = -q - 1. Let t(j) = -3k(j) - y(j). Find the first derivative of t(c) wrt c. 7 Let r(k) = -2k - 2. Let n(v) = -v - 1. Let m(b) = -8n(b) + 3r(b). Let q(c) = -c*4 - 3c + 7c - 3c. Let u(a) = m(a) - 2q(a). Differentiate u(h) wrt h. 8h*3 Let j = -54 - -58. Let o(r) be the first derivative of 1 + 0r*j + 3r + 2/5r5 + 0r*3 + 0r*2. What is the derivative of o(z) wrt z? 8z*3 Let g = 1 - 7. Let a(u) = 5u*3 - 8u*2 + 6u. Let o(y) = y2 - y3 + 3 - 3 - y. Let d(f) = go(f) - a(f). Find the third derivative of d(s) wrt s. 6 Let i(l) = -l3 + l2 + l + 1. Let t(d) = 9d*3 - 5d - 5. Let h(k) = 5i(k) + t(k). What is the third derivative of h(b) wrt b? 24 Let b(s) be the first derivative of 27s*5/5 + 35s - 24. What is the first derivative of b(y) wrt y? 108y3 What is the second derivative of -44b*3 - 25b + 19b3 + 21b*3 wrt b? -24b Let j(d) be the first derivative of 11d3/3 + 18d + 18. What is the derivative of j(h) wrt h? 22h Let l(w) be the third derivative of -w2 + 0 - 1/120w*6 + 0w*5 - 1/12w*4 + 0w*3 + 0w. What is the second derivative of l(u) wrt u? -6u Let h(y) = y2 + 6y - 4. Let k be (7/4)/((-3)/12). Let t be h(k). What is the second derivative of s + ts2 - 2s - 5s2 wrt s? -4 Let u be (4/1)/(-5 + 7). Let t = 2 + 0. What is the third derivative of -32n + 32n - 2n*3 - tn*u wrt n? -12 Let c = -6 - -10. Differentiate 2 + 0d3 - d3 - cd3 with respect to d. -15d*2 Let n be 1 - (2 + -2)/(-3). Let g(q) = 2q*2 - q + 1. Let a be g(n). Find the second derivative of h - ah + 4h2 - 3h*2 wrt h. 2 Suppose -4y - 5k + 4 = 0, 3y - k - 9 = 13. Suppose -3a + 12 = 3a. Find the second derivative of -o*5 - ao*5 + yo - 2o - o5 wrt o. -80o*3 Let u(b) be the third derivative of 1/3b*3 + 0b + 0 + 1/24b4 - 3b*2. What is the first derivative of u(g) wrt g? 1 Let g(i) = 10i*3 - 5i*2 - 5i - 3. Let p(x) = -10x3 + 4x*2 + 4x + 4. Let j(c) = 4g(c) + 5p(c). What is the first derivative of j(v) wrt v? -30v2 Let d(q) be the first derivative of 0q*2 + 3q + 2 + 1/4q4 + 0q*3. What is the derivative of d(v) wrt v? 3v*2 Let z(h) be the third derivative of 4h5/15 + h4 - 4h2. Find the second derivative of z(o) wrt o. 32 Let m(b) be the second derivative of b7/14 + b3/2 - 10b. Find the second derivative of m(k) wrt k. 60k3 Let u(n) be the third derivative of 0n*4 + 0n*3 + 0n + 0n6 + 0 - 1/60n*5 + 1/210n*7 - 4n*2. What is the third derivative of u(x) wrt x? 24x Suppose 13g = 16g - 15. Let r(o) be the first derivative of -2o + 0o*2 + 0o*3 - 1/5o*g + 0o*4 - 2. Differentiate r(b) with respect to b. -4b*3 Suppose -2s = z - 2z + 6, 5z + 3s - 4 = 0. Suppose 0 = -3f + 6	{ "pile_set_name": "DM Mathematics" }
d derivative of j(i). Differentiate c(l) wrt l. -39l2 Let h(o) be the first derivative of 169o*4/2 - 219o*2 - 2o - 484. Find the second derivative of h(m) wrt m. 2028m Let x(n) be the first derivative of 0n*2 - 3n - 12 - 22/3n3. Differentiate x(y) wrt y. -44y Let d(a) be the second derivative of 21a + 0a*2 + 4a*3 - 11/12a*4 + 0. What is the second derivative of d(t) wrt t? -22 Let z(u) = 4. Let n(y) = 8y + 130. Let f(s) = n(s) + z(s). What is the first derivative of f(i) wrt i? 8 Let g be ((-15)/10)/((-1)/2). Let t = -8 + 8. What is the third derivative of -x*6 + tx*2 + gx*2 - 3x*2 - 2x*2 wrt x? -120x*3 Let q = 139 - 133. Let o(n) = -48n*3 + 6n*2 - 6n + 9. Let f(a) = -a3 + a2 - a. Let w(k) = qf(k) - o(k). Differentiate w(x) with respect to x. 126x*2 Let a = 38 + -26. Suppose 5x = 2x + a. Find the first derivative of 6d*3 - xd*3 + 0d*3 - 6 wrt d. 6d*2 Let z = 2 + -2. Suppose y + z - 5 = 0. Find the third derivative of -2j*3 + 2j*3 - 16j*4 + 18j*4 + yj*2 wrt j. 48j Let c(v) = -161v4 + 2v*2 + 13v - 13. Let l(g) = 81g4 - g2 - 7g + 7. Let i(p) = -3c(p) - 5l(p). What is the second derivative of i(q) wrt q? 936q2 - 2 Let h(j) = -1407j*4 + 7j*2 - 8j - 358. Let y(z) = 937z4 - 5z*2 + 6z + 239. Let x(r) = -5h(r) - 7y(r). What is the second derivative of x(u) wrt u? 5712u2 Let p(l) be the first derivative of l5/12 - 7l*4/24 - 8l*3 - 20. Let i(y) be the third derivative of p(y). What is the derivative of i(j) wrt j? 10 Let u be 2/(-15) - 436/(-120). Let b(x) be the first derivative of -ux*2 - 5x - 8. What is the first derivative of b(o) wrt o? -7 Let b = 141 + -128. What is the third derivative of -br5 - 12r*2 + 84r*2 - 17r*2 wrt r? -780r*2 Find the first derivative of -y + 22y - 30y + 140y - 124 wrt y. 131 Let b(x) = -x*2 + x - 1. Let r = -19 + 20. Let f(j) = 12j*2 - 3j + 4. Let w(s) = rf(s) + 3b(s). Find the first derivative of w(m) wrt m. 18m Suppose 17z = 15z + 18. What is the third derivative of -zc*4 - 9c*4 + 17c*4 + 9c*2 wrt c? -24c Let p(b) = b*3 - 15b*2 - 34b. Let n be p(17). Let h be ((-1)/(-2) + 1)2. Find the third derivative of -4r*h + 0r3 + r2 + nr3 - r3 wrt r. -30 What is the second derivative of 412y + 423y2 - 710y + 193y + 196y + 425y wrt y? 846 Let z(q) be the second derivative of q9/15120 + q5/6 - 5q*4/4 + 18q. Let g(w) be the third derivative of z(w). Differentiate g(p) wrt p. 4p3 Suppose -u = -5q - 15, -5q = -0u + 2u + 30. Let g(j) = j3 + 3j*2 - 6j - 2. Let k be g(q). Differentiate -2i - k + 4i - 3i - 3i with respect to i. -4 Let t(y) = 89y3 - 132y*2 - 5y + 3. Let s(z) = -91z3 + 131z*2 + 7z - 4. Let l(b) = 3s(b) + 4t(b). What is the third derivative of l(x) wrt x? 498 Let m(c) be the third derivative of c*7/210 + 8c*5/3 + 269c*4/24 + 37c*2 + 3c. Find the second derivative of m(p) wrt p. 12p2 + 320 Let m(c) = -54c*3 + 2c + 217. Let n(i) = -2i3 + i2 - i. Let z(b) = m(b) + 2n(b). Differentiate z(j) with respect to j. -174j2 + 4j Let m(b) = -b3 - b2 - b. Let u(o) = -o*2 + 22o*3 + 12o + o*2 + 6o*2 - 33o. Let n(d) = -6m(d) - u(d). What is the second derivative of n(q) wrt q? -96q Suppose -17w + 27 = -24. What is the first derivative of j4 - 14j*4 + 7j*4 + 39 - 2j*w wrt j? -24j*3 - 6j*2 Suppose -8i = -28 - 20. What is the third derivative of -iw2 + 13w*6 + 12w*2 + 4w*3 - 4w*3 wrt w? 1560w*3 What is the third derivative of -13v*2 - 182v*5 - 2 - 24v*2 + 16v2 + v4 - 24v2 wrt v? -10920v*2 + 24v Let i = -6 + 8. Suppose 0 = -7b + 2b + 3a + 35, -ib + 18 = -2a. What is the derivative of 0 + 2l*4 - 2l*4 - 3 - 4l*b wrt l? -16l*3 Let n(t) = 85t*2 - 76t + 10. Let x(s) = -2s2 - s + 2. Let p(i) = n(i) - 5x(i). Find the second derivative of p(q) wrt q. 190 Let q be ((-2)/4)/(2/(-76)). Suppose -3x - 2f + q = 0, 0f - 3f = 5x - 33. What is the second derivative of 202o*5 + xo - 199o5 + 3o wrt o? 60o3 Let k be ((-121)/3)/(14/(-49)). What is the second derivative of -kw - 4w*5 + 54w*3 - 54w*3 wrt w? -80w*3 Let o(n) be the first derivative of 6n*4 + 14n*3/3 - 10. Find the third derivative of o(m) wrt m. 144 Suppose 319 = -32t + 703. Let o(p) be the first derivative of 0p2 + 0p*3 - tp + 1 - 3/4p4. What is the first derivative of o(b) wrt b? -9b*2 Let j(p) = 358p*3 + 332p*2 - 3p. Let d(n) = -358n3 - 332n*2 + 2n. Let r(u) = 3d(u) + 2j(u). What is the third derivative of r(i) wrt i? -2148 Find the third derivative of 82x6 + 24x*2 - 106x*2 - 49x*2 wrt x. 9840x*3 What is the first derivative of 122 - 85r*3 + 82 + 136 - 4 wrt r? -255r*2 What is the second derivative of -153o + 66o4 - 52o*4 + 136o*4 wrt o? 1800o*2 Let r(a) be the second derivative of 17a7/42 + a5/10 + 67a3/6 - 22a. What is the second derivative of r(y) wrt y? 340y3 + 12y Differentiate 4 - 17f2 + 56f*2 + 17f*2 - 123 wrt f. 112f Let g(k) be the first derivative of 0k2 + 0k*5 + 0k*4 + 14/3k*3 + 58 + 49/6k*6 + 0k. What is the third derivative of g(a) wrt a? 2940a2 Let l(h) = -89h + 52. Let s(y) = 87y - 52. Let n(a) = -6l(a) - 5s(a). What is the derivative of n(d) wrt d? 99 Let s(a) be the second derivative of -17a*8/4 + 35a*4/2 + 179a. Find the third derivative of s(r) wrt r. -28560r3 Suppose 0o + 3o = 6. Differentiate -8g - 52 + 5go + 10 + 8g wrt g. 10g Let u(f) be the first derivative of -47f*6/6 + 2f*3/3 - 97f*2/2 + 127. Find the second derivative of u(d) wrt d. -940d*3 + 4 Let y(w) = -9w*4 - 4w*3 + 12w - 1. Let n(t) = -9t4 - 5t*3 + 13t - 2. Let k(g) = -4n(g) + 5y(g). Find the second derivative of k(a) wrt a. -108a2 Let h = -85 + 87. What is the third derivative of 29w*3 - 45w*2 + 15w*2 + 7wh wrt w? 174 Let z(b) be the third derivative of -b7/15 - b*4/12 - 463b*3/6 - 283b*2 - b. Differentiate z(s) wrt s. -56s*3 - 2 Suppose -w = -2g + 8, 0 = -5g - 0w + 4w + 23. Let d(s) = -3s + 11. Let b be d(g). Find the first derivative of -19f3 + 13f*3 + 13f*3 - b wrt f. 21f*2 Let w = 3991/6 + -665. Let o(b) be the second derivative of 9b + wb3 + 9/20b*5 + 0b*4 + 0b*2 + 0. What is the second derivative of o(p) wrt p? 54p Let b be (-158)/(-14) - (24/(-14) - -2). What is the third derivative of 2q6 - bq*6 + 9q*2 - 14q*2 - 12q*6 wrt q? -2520q*3 Let w(g) = 2g*3 - 2g*2 + g - 1. Let b(h) = 8h*3 + 83h*2 - h + 1. Let o(z) = -b(z) - w(z). What is the third derivative of o(d) wrt d? -60 Let x(l) be the second derivative of 43l*5/4 - 20l*2 - l - 166. Differentiate x(a) with respect to a. 645a*2 Find the first derivative of 116 - 233 + 97 + 352k*2 wrt k. 704k Let q = 41 - -6. Differentiate 10 + 23m + 9m - qm wrt m. -15 Let i(y) = -2y*2 + 9y - 7. Let n be i(3). What is the derivative of -41r4 - 28 - 4810r*n + 4810r*2 wrt r? -164r*3 What is the second derivative of 1243i - 32i5 - 83i*5 - 1218i wrt i? -2300i3 Let i(m) be the third derivative of -9m*2 - 1/20m*6 + 0m*3 + 0m + 0m4 + 0 - 11/60m*5. Find the third derivative of i(t) wrt t. -36 Suppose 3w - 15 = -0. Let x be (-22)/(-7) + w/(-35). Find the first derivative of -3c3 + 8c*3 - 4c*3 - 2 + 4c*x wrt c. 15c*2 Let i(v) = 2v + 2. Let s be i(0). Find the third derivative of -17z4 + 16z*6 + 17z*4 + 3z*s wrt z. 1920z*3 Suppose -4n - 3m = -6m - 267, 4n + 5m = 291. What is the second derivative of -12b + 39b - nb2 + 31b*2 wrt b? -76 Let z(l) = -12l*5 - 11l*2 + 0l*4 + 6l*5 - 4l4. Let p(s) = s5 + s*4. Let w(y) = 4p(y) + z(y). Find the third derivative of w(a) wrt a. -120a2 Let w(d) be the second derivative of 17/3d*3 - 9/5d*5 + 0d*2 + 0 - 15d + 0d4. Find the second derivative of w(t) wrt t. -216t Let r(j) be the second derivative of j*6/5 - 5j*4/6 + 6j*2 - 31j + 1. What is the first derivative of r(f) wrt f? 24f3 - 20f Let n(h) be the third derivative of 37h6/120 + 11h4/24 + h2 - 94. Find the second derivative of n(z) wrt z. 222*z Find the thi	{ "pile_set_name": "DM Mathematics" }
picking 2 l, 1 z, and 1 s when four letters picked without replacement from rzrwsll. 1/35 What is prob of picking 1 x and 2 u when three letters picked without replacement from {x: 2, u: 8}? 7/15 Calculate prob of picking 3 u when three letters picked without replacement from {u: 11, f: 3}. 165/364 Calculate prob of picking 2 t and 1 q when three letters picked without replacement from tctqctctctctccqqc. 9/136 Calculate prob of picking 2 o and 1 v when three letters picked without replacement from vvvovvvvoovoov. 45/182 Three letters picked without replacement from {c: 7, d: 5}. Give prob of picking 1 d and 2 c. 21/44 Two letters picked without replacement from ngnenmnln. Give prob of picking 1 n and 1 e. 5/36 Four letters picked without replacement from {c: 3, k: 5, f: 1, p: 3, z: 6}. Give prob of picking 1 p, 1 z, 1 f, and 1 k. 1/34 What is prob of picking 2 h and 2 v when four letters picked without replacement from {h: 4, v: 3}? 18/35 What is prob of picking 1 z and 2 y when three letters picked without replacement from {v: 7, y: 3, z: 8}? 1/34 Calculate prob of picking 1 u and 1 s when two letters picked without replacement from shsshsusshsuhhhh. 7/60 Two letters picked without replacement from {q: 1, h: 2, m: 2, d: 1, p: 1}. What is prob of picking 2 m? 1/21 Calculate prob of picking 2 n and 2 f when four letters picked without replacement from fffffnfffffnfnnfnfn. 195/646 What is prob of picking 1 s and 2 h when three letters picked without replacement from shssshsshsss? 27/220 Three letters picked without replacement from {b: 2, t: 1, y: 1, o: 1}. Give prob of picking 2 b and 1 t. 1/10 What is prob of picking 1 h and 1 e when two letters picked without replacement from aerhy? 1/10 Calculate prob of picking 1 g, 1 t, and 1 j when three letters picked without replacement from {g: 5, t: 3, q: 1, j: 1, x: 4, d: 1}. 3/91 Calculate prob of picking 1 h and 1 y when two letters picked without replacement from qmhmhhmqhhmyy. 5/39 Calculate prob of picking 4 u when four letters picked without replacement from yuyu. 0 Two letters picked without replacement from {o: 3, z: 1, y: 4, b: 4, g: 2}. Give prob of picking 1 g and 1 z. 2/91 Four letters picked without replacement from flxmlscf. Give prob of picking 1 m, 2 f, and 1 s. 1/70 Calculate prob of picking 1 n and 1 k when two letters picked without replacement from {d: 2, x: 2, c: 7, n: 2, g: 4, k: 2}. 4/171 Two letters picked without replacement from fhnhfudqnhuu. Give prob of picking 2 n. 1/66 Two letters picked without replacement from yzymxyzxxx. Give prob of picking 2 y. 1/15 Three letters picked without replacement from {p: 7, d: 5}. What is prob of picking 3 d? 1/22 What is prob of picking 3 v when three letters picked without replacement from vvuvvvuuuuvuvvuvvvv? 220/969 Calculate prob of picking 1 k and 1 d when two letters picked without replacement from {k: 1, t: 1, v: 1, d: 1, g: 1}. 1/10 What is prob of picking 3 f and 1 q when four letters picked without replacement from rqfqrrrfrrqrqrrf? 1/455 Three letters picked without replacement from hbhehxxhhkbbxh. Give prob of picking 1 x, 1 e, and 1 h. 9/182 Two letters picked without replacement from enlneeacenenaeeeen. Give prob of picking 2 a. 1/153 Four letters picked without replacement from nxxxn. What is prob of picking 4 x? 0 Four letters picked without replacement from ozzccccm. Give prob of picking 1 m, 1 o, and 2 c. 3/35 What is prob of picking 1 k, 1 v, and 2 n when four letters picked without replacement from {n: 2, k: 1, v: 3, x: 6}? 1/165 What is prob of picking 4 i when four letters picked without replacement from {i: 6}? 1 Calculate prob of picking 1 b and 1 i when two letters picked without replacement from nbeih. 1/10 Calculate prob of picking 2 f and 1 w when three letters picked without replacement from fkkwmfkfbkksk. 3/286 Four letters picked without replacement from yspppsypsps. What is prob of picking 2 s and 2 p? 2/11 What is prob of picking 2 m and 1 o when three letters picked without replacement from {o: 6, f: 7, e: 2, m: 2, t: 1}? 1/136 Two letters picked without replacement from gboyl. What is prob of picking 1 o and 1 y? 1/10 What is prob of picking 2 a and 1 m when three letters picked without replacement from {e: 3, a: 12, m: 2}? 33/170 Calculate prob of picking 1 j and 1 p when two letters picked without replacement from {j: 1, p: 1, m: 2}. 1/6 Three letters picked without replacement from arhhmha. What is prob of picking 1 m and 2 a? 1/35 Four letters picked without replacement from {d: 17, k: 3}. What is prob of picking 4 d? 28/57 Four letters picked without replacement from {i: 4, v: 6, z: 3}. Give prob of picking 2 i and 2 v. 18/143 What is prob of picking 1 t and 1 j when two letters picked without replacement from {b: 3, t: 1, g: 2, j: 1, w: 2, e: 8}? 1/136 Three letters picked without replacement from {g: 1, m: 6, w: 1, z: 6, f: 5}. Give prob of picking 1 z, 1 f, and 1 g. 10/323 Two letters picked without replacement from {r: 4, v: 6, a: 2}. What is prob of picking 2 a? 1/66 Four letters picked without replacement from {e: 1, t: 1, u: 4, x: 1, c: 6}. Give prob of picking 2 u and 2 e. 0 Two letters picked without replacement from {c: 5, v: 4, a: 1}. Give prob of picking 1 a and 1 c. 1/9 What is prob of picking 2 p when two letters picked without replacement from lilspfpw? 1/28 Four letters picked without replacement from {o: 1, d: 1, f: 1, t: 2, q: 2, k: 2}. What is prob of picking 1 o, 1 f, and 2 t? 1/126 Four letters picked without replacement from chiccciicimcicihiiii. What is prob of picking 1 c, 1 h, and 2 i? 42/323 Two letters picked without replacement from {w: 4, p: 3, d: 2, u: 2, a: 2, g: 1}. Give prob of picking 1 w and 1 d. 8/91 Three letters picked without replacement from hroziow. What is prob of picking 1 z, 1 i, and 1 r? 1/35 Three letters picked without replacement from ggggggrgrr. What is prob of picking 2 g and 1 r? 21/40 What is prob of picking 3 r when three letters picked without replacement from rtrtrrttrrrrtrrr? 33/112 Four letters picked without replacement from {e: 10, j: 2, k: 6}. What is prob of picking 1 j and 3 k? 2/153 Two letters picked without replacement from xxtet. Give prob of picking 1 x and 1 e. 1/5 What is prob of picking 2 l and 1 a when three letters picked without replacement from llalllal? 15/28 Calculate prob of picking 2 u and 1 p when three letters picked without replacement from {j: 3, x: 9, p: 3, u: 5}. 1/38 Four letters picked without replacement from {u: 12, s: 7}. Give prob of picking 1 u and 3 s. 35/323 Four letters picked without replacement from uhsvccvccwvvwvv. What is prob of picking 1 s, 1 h, 1 u, and 1 w? 2/1365 Three letters picked without replacement from {p: 1, a: 1, y: 5, s: 5}. What is prob of picking 3 s? 1/22 What is prob of picking 1 b and 1 c when two letters picked without replacement from {h: 1, k: 5, y: 4, c: 1, b: 1}? 1/66 Four letters picked without replacement from {e: 10, m: 10}. What is prob of picking 3 e and 1 m? 80/323 What is prob of picking 1 v, 1 s, and 1 p when three letters picked without replacement from {p: 2, v: 1, s: 2}? 2/5 Two letters picked without replacement from {s: 4, l: 2}. What is prob of picking 2 s? 2/5 Two letters picked without replacement from nevellbg. What is prob of picking 1 l and 1 n? 1/14 Calculate prob of picking 1 l and 1 w when two letters picked without replacement from lwwguck. 2/21 Two letters picked without replacement from bzejw. What is prob of picking 1 j and 1 e? 1/10 What is prob of picking 1 c, 1 h, and 2 d when four letters picked without replacement from cdhd? 1 What is prob of picking 3 a when three letters picked without replacement from {e: 5, x: 1, a: 3, z: 1}? 1/120 Three letters picked without replacement from {r: 1, i: 1, m: 1, o: 1, n: 1}. What is prob of picking 1 i, 1 o, and 1 r? 1/10 Two letters picked without replacement from {u: 3, n: 1, y: 4, j: 2, e: 1}. What is prob of picking 1 e and 1 j? 2/55 Calculate prob of picking 2 u and 2 f when four letters picked without replacement from eeunuuepuepfupefu. 3/476 Three letters picked without replacement from {l: 1, k: 11, g: 1, v: 4, a: 2}. What is prob of picking 1 a, 1 g, and 1 k? 22/969 Two letters picked without repl	{ "pile_set_name": "DM Mathematics" }
5 + h = -o. Let z(s) = 88s2 + s + 1. What is the tens digit of z(o)? 8 Let x(d) = 6914d - 266. What is the ten thousands digit of x(3)? 2 Suppose -48 = -0l - 12l. What is the tens digit of (2/l)/((-5)/(-2330))? 3 Suppose 17f - 3438 = 3039. Let m = -7 + f. What is the hundreds digit of m? 3 Let q(x) be the first derivative of 29x*2 + 8x + 15. Let w be q(3). Suppose 2o = 4h - 2h + w, 1 = -h. What is the units digit of o? 0 Suppose r - 854 = 2g, -g + 0g - 427 = -4r. Let i = -300 - g. Let t = i - -16. What is the tens digit of t? 4 Suppose -3g - 5 = 4n + 8, 2g - 2n - 10 = 0. Let j(q) = -15q. Let y be j(g). What is the tens digit of ((-50)/y + -4)-24? 1 Suppose 12a - 106168 - 136862 = -89478. What is the hundreds digit of a? 7 Let q(l) = 5l*3 - 4l*2 - 5l + 5. Suppose -5k - 4j - 162 + 39 = 0, 2 = -j. Let o be 0 - 1 - 115/k. What is the hundreds digit of q(o)? 2 Let w(r) = 10r2 - 82r + 14. Let m(h) = 4h2 - 27h + 5. Let d(c) = 11m(c) - 4w(c). What is the units digit of d(-8)? 7 Suppose -n - 417 = -2n - 3m, -3n = -3m - 1251. Suppose -4q + q = -l + 77, 5l - n = -q. Suppose -2w + 13 = -l. What is the units digit of w? 8 Let r(i) = 2i*3 - 5i*2 + 6i + 4. Let k be r(3). Let j = k - -194. Suppose 5g - 4u = j, 0g + 2g - 5u = 107. What is the units digit of g? 1 Let q(t) = -t3 + 16t*2 - 16t + 17. Let w be q(15). Suppose 2n - 4d - 783 = -d, 0 = wd + 6. What is the tens digit of n? 8 Suppose 14v + 16v - 213150 = 0. What is the hundreds digit of v? 1 Let v(r) = r3 - 7r*2 + 5r + 12. Let b be v(6). What is the tens digit of (-330)/(-20)(2 + 448/b)? 6 Suppose 28y - 150253 = 138315. What is the units digit of y? 6 Let n = 12 + -7. Suppose o + 2z - 2 = 0, -5o - 5z + 15 = -0o. Suppose -x - 407 = -nl + x, o = -4x. What is the units digit of l? 1 Suppose 3n + 2p = -0n, p = -2n. Let s(v) = v. Let b(j) = j + 39. Let w(g) = b(g) - 5s(g). What is the units digit of w(n)? 9 Suppose 79m - 80m = 3u - 43675, -3m = 2u - 131011. What is the units digit of m? 9 Let n be 6/(-9)(-5)/((-20)/(-534)). Let q = -34 + n. What is the units digit of q? 5 Let q(j) = -j2 + 52j + 121. Let b(l) = -l*2 + 51l + 120. Let p(w) = -5b(w) + 6q(w). What is the hundreds digit of p(55)? 2 Suppose 14r - 10r - 340 = 0. Let y = 171 + r. What is the hundreds digit of y? 2 Let u = -475 + 792. Suppose 3589 = 9g - u. What is the units digit of g? 4 Let h = -33573 + 38092. What is the tens digit of h? 1 Let v = -4932 + 8431. What is the tens digit of v? 9 Let k = -3982 + 6517. Suppose -5p - 3l = -4l - k, l + 1521 = 3p. What is the units digit of p? 7 Suppose -30 + 61 = -2v - 3w, 2v - 5w - 9 = 0. What is the units digit of ((-2511)/108)/(2/v)? 3 Suppose -3q + q = c - 678, -5q + 4c = -1708. Let z = 446 - q. What is the tens digit of z? 0 Let n(r) = 2r3 - 22r*2 + 34r + 20. Let i be n(9). Let s(v) = v*2 + 3v*2 - 2v*2 + 1 + v. What is the units digit of s(i)? 1 Suppose -2u - 678240 = -29u. Suppose -77840 = -40q - u. What is the units digit of q? 8 Let z = 168 - 166. Suppose -q - 4y = -zq + 757, 2q - 1502 = 2y. What is the tens digit of q? 4 Suppose 6l = 9l - 216. Let f be 2 - -1 - 10/(-5). Suppose 0 = fp - 223 - l. What is the units digit of p? 9 Let g be (-8)/6 - (-2 + 46/(-3)). Let i be 0 + g + (-1 - (8 - 6)). Suppose ir - 212 - 1166 = 0. What is the hundreds digit of r? 1 Suppose 3x + 12 = 6x. Suppose 5a - 765 = 2a - 2b, -4a = -xb - 1000. Suppose 3d + 5j = j + a, 2j - 168 = -2d. What is the tens digit of d? 8 Let r be 11290/6 - ((-16)/3 + 5). Let g = r - 1244. What is the tens digit of g? 3 Suppose g = 3t - 20510, 281t - 282t - g = -6838. What is the hundreds digit of t? 8 Let o = -1221 + 11349. What is the ten thousands digit of o? 1 Suppose -4h - 3z + 22 = 0, 0 = 3h - 0h - 5z - 2. Let m be 2 + (-8)/h + 3 + 0. Suppose 3w + 300 = ma, 5w + 380 + 25 = 4a. What is the tens digit of a? 9 Let g = 9756 + 6630. What is the units digit of g? 6 Suppose 0 = 5q + 3p - 697 - 500, -5q - 2p = -1193. Suppose 5y + q = 4u, 0y = 4y + 4. Let r = u - -18. What is the units digit of r? 6 Suppose -3c - 1971 = -b - 0b, 9875 = 5b - 5c. Suppose -g = 3x - 1189, 3x = -2x - 4g + b. What is the hundreds digit of x? 3 Suppose -50q - 175 = -55q. What is the tens digit of (-30546)/(-42) - (80/q - 2)? 2 Suppose 5s = -5v + 2v + 269, -5s + 4v + 318 = 0. What is the units digit of s? 8 Let x(a) = 71a2 - 21a - 76. Let j be x(-7). Suppose 0 = 34y - j - 20318. What is the hundreds digit of y? 7 Suppose -189z + 3166326 + 2355256 = 1026406. What is the ten thousands digit of z? 2 Let j be 2/4(-1 - -1). Let v be 2/1 + 1572/(2 - j). Suppose v = 6l - 34. What is the units digit of l? 7 What is the units digit of (619605/(-562))/(6/(-80))? 0 Let l = -61293 + 89066. What is the tens digit of l? 7 Let f = 62 - 43. Let z(c) = 2c - 37. Let j be z(f). What is the tens digit of (1 - 130)/(j - 2)? 2 Let l be ((-3 - -4)0)/2. Suppose -5m - 1 = -2j + 5j, l = -3m - 15. Let x(s) = s2 - s + 6. What is the units digit of x(j)? 2 Let q(b) be the second derivative of b4/6 + b*3/6 + 6b*2 + 58b. What is the tens digit of q(4)? 4 Suppose 4s - 18h + 31 = -13h, s - 2h = -10. Let j be 2/6 + 110/3. Let t = j - s. What is the tens digit of t? 4 Suppose 13d = 30d + 51. Let f(j) = -157j - 77. What is the units digit of f(d)? 4 Suppose -2r = -d + 9320, -49d + 44d + 4r + 46618 = 0. What is the hundreds digit of d? 3 Let d(o) = -134o*2 + 4o + 57. Let y(c) = 67c2 - 2c - 28. Let n(g) = 4d(g) + 9y(g). What is the thousands digit of n(-4)? 1 Suppose -7r + 868 = -854. Let g(k) = 37k*2 + 10k - 24. Let j be g(-6). Suppose 5q = m + j, 2m = q - 0m - r. What is the tens digit of q? 5 Let o be (2/4)/(18/900). Suppose -2u = 2g + 22, u + u + o = g. What is the tens digit of (-15)/(-12) + (-657)/u? 5 Let g(c) = 12c*2 - 778c + 89. What is the tens digit of g(76)? 7 Let i(a) = 946a2 - 35a - 75. What is the units digit of i(-3)? 4 What is the thousands digit of ((-68)/102)/((-6)/203265)? 2 Let z = -2574 - -3407. What is the hundreds digit of z? 8 Suppose 0 = -3w + x + 24, -2w + 5w - 36 = -3x. Let o = 3081 - 1974. Suppose wn - o = -171. What is the hundreds digit of n? 1 Let i = 439 - 419. Suppose 2y = 3k + 923, -4k + i + 0 = 0. What is the units digit of y? 9 Suppose -4p + 1289 = 5g, -345 = 5p - g - 1949. Let f(w) = w3 + 6w*2 + 2w - 10. Let r be f(-8). Let x = p + r. What is the units digit of x? 7 Let s be 6/(-10) + 1917/(-5). Suppose 5c = -4v - 872, 60v = -c + 65v - 186. Let l = c - s. What is the tens digit of l? 0 What is the hundreds digit of 7 + -13 + 7926 + 0/2? 4 Let w(j) = -j2 + 9j - 9. Let s be w(7). Suppose y = -g + 1401, -sy + 7005 = 5g - y. What is the tens digit of g? 0 Suppose -5d = -9d - 16, -5y = -2d - 42693. What is the thousands digit of y? 8 Let s(g) = 375g2 - 3g + 3. Let x be s(1). What is the tens digit of 1 + (-34)/30 - (-177050)/x? 7 What is the units digit of (-5)/(-25) - ((-207536)/10)/7? 5 Let d(k) = 1826k + 1271. What is the ten thousands digit of d(13)? 2 Suppose -4c = -w + 13404, 25w - 24w + 3c = 13369. What is the hundreds digit of w? 3 Suppose -2n + 20952 = -9v, -3n + 6v - 7v = -31457. What is the units digit of n? 5 Let f = -64 + 70. Suppose 3d = -f, 3d - 4d + 32 = n. Let r = 76 + n. What is the tens digit of r? 1 Suppose -307t + 318t = 89738. What is the units digit of t? 8 Let n = -215 - -13. Let v = n + 291. What is the units digit of v? 9 Let s be -1 + (-7)/((-42)/8496). Suppose -2y + 7y = 4a + s, -3y = -5a - 836. What is the units digit of y? 7 Suppose -2k - 26k + 1614116 = 0. What is the thousands digit of k? 7 Let b(n) = -n*2 - 3n + 3. Suppose -3 = k + 3m, -k - 3m = -2m + 3. Let w be b(k). What is the units digit of (2 + (-4)/w)/((-18)/(-81))? 3 What is the tens digit of (-28203)/91170/52(-12)/15? 0 Suppose -21718 = -2d - 9m, 59 = -m + 55. What is the units digit of d? 7 Let d be (5 - (-68)/(-12))/(1/(-954)). Let x = d + -431. What is the tens digit of x? 0 Suppose h - 23150 = 4w, 3w = 4h - 27812 - 64853. What is the thousands digit of h? 3 Let z = 25 - 6. Let	{ "pile_set_name": "DM Mathematics" }
s x in -2x2/3 - 606676x/3 - 8290118 = 0? -303297, -41 Find p, given that -2p3/5 - 3681988p*2/5 + 7363984p/5 = 0. -1840996, 0, 2 Suppose -c*2/5 - 26718c - 17483129/5 = 0. Calculate c. -133459, -131 Factor -4x3 + 5144x*2 - 312572x - 317720. -4(x - 1222)(x - 65)(x + 1) Determine h, given that h4/9 - 2408h*3/9 + 14408h*2/9 + 9632h/9 - 19216/3 = 0. -2, 2, 6, 2402 Factor j*2/5 - 14223149j/5 + 28446294/5. (j - 14223147)(j - 2)/5 Factor -2q*2 + 29698q + 5288800. -2(q - 15025)(q + 176) Factor 1849k2/3 - 763766k/3 + 78872161/3. (43k - 8881)2/3 What is a in -2a*4 - 2518a*3 + 2761094a*2 - 5514626a + 2756052 = 0? -1963, 1, 702 Factor 2w2 - 1555158w + 35767576. 2(w - 777556)(w - 23) Factor -2t3 + 146906t*2 - 1468860t. -2t(t - 73443)(t - 10) What is r in -5r*3 + 7725r*2 - 2800170r + 11077400 = 0? 4, 571, 970 Factor 27w4 - 13518882w*3 + 1692219294903w*2 + 1128150702900w + 188025367500. 3(w - 250350)2(3w + 1)2 Factor -3h*4 - 24366h*3 - 69775524h*2 - 79502326050h - 26189924448009. -3(h + 541)(h + 2527)*3 Solve 2s*2 - 224552s - 224554 = 0 for s. -1, 112277 Find k, given that k*5/6 - 113k*4/3 + 1268k*3 - 29815k*2/3 + 135575k/6 = 0. 0, 5, 29, 187 Let 55n4 + 11485n*3 - 622600n*2 + 6396020n - 1142400 = 0. Calculate n. -255, 2/11, 14, 32 Factor 5w2 - 88525w + 82503330. 5(w - 16718)(w - 987) Factor o*3/5 + 161o*2/5 + 576o/5 - 31824/5. (o - 12)(o + 17)(o + 156)/5 Factor l*3/4 + 75l*2/2 + 6743l/4 + 43953/2. (l + 23)(l + 49)(l + 78)/4 Suppose 42r4 + 513r*3 - 5577r*2 - 73872r - 67824 = 0. Calculate r. -12, -157/14, -1, 12 Factor -5q3/4 + 627595q*2/4 - 4927128600q + 231228584640. -5(q - 62736)2(q - 47)/4 Let -1915690s2/11 - 5747054s/11 + 48/11 = 0. What is s? -3, 8/957845 Solve -2k5 - 7244k*4 - 131754k*3 + 44373728k*2 - 88323208k + 44088480 = 0 for k. -3602, -90, 1, 68 Solve 136898y3/11 - 1232072y*2/11 - 3011846y/11 - 20 = 0 for y. -2, -5/68449, 11 Solve -4v3/5 - 10925264v*2/5 - 7460087091856v/5 = 0 for v. -1365658, 0 Factor 4v2 + 224332v - 4039272. 4(v - 18)(v + 56101) Factor 2m3 + 10296818m*2 - 61780962m + 92671470. 2(m - 3)2(m + 5148415) Factor -b*3/9 - 68b*2/3 - 759b - 24124/9. -(b + 4)(b + 37)(b + 163)/9 What is s in 16s4 - 15798620s*3 - 82943080s*2 - 114540580s - 23698056 = 0? -3, -2, -1/4, 987419 Let -4x2 + 3365768x - 708024639364 = 0. What is x? 420721 Factor 2c2/5 - 6916492c/5 - 12449718. 2(c - 3458255)(c + 9)/5 Suppose -4n2/5 - 71856208n/5 + 71856212/5 = 0. What is n? -17964053, 1 Factor -2d2/5 + 8490658d/5 - 16981308/5. -2(d - 4245327)(d - 2)/5 What is k in 22k4 - 320734k*3 + 2505982k*2 + 3351294k + 524556 = 0? -1, -2/11, 9, 14571 Let -t*4/6 - 3871t*3/6 + 7745t*2/6 - 1291t/2 = 0. What is t? -3873, 0, 1 Factor -2a4/5 + 301976a*3/5 - 603944a*2/5. -2a*2(a - 150986)(a - 2)/5 Determine t so that -5t*4 - 2085t*3 + 7152675t*2 - 7146395t - 14301150 = 0. -1423, -1, 2, 1005 Determine i so that -2i4 + 358i*3 + 5362i*2 + 8538i - 83376 = 0. -9, -8, 3, 193 Factor -196520s4 - 34327420s*3 - 255793050s*2 - 647944245s - 549850005. -5(s + 167)(34s + 87)3 Factor -4x*2 - 85219380x - 85219376. -4(x + 1)(x + 21304844) Let 3h5 - 4368h*4 - 215049h*3 - 2293242h*2 - 5062464h = 0. Calculate h. -34, -11, -3, 0, 1504 Let -3r2/5 - 84492r + 1689888/5 = 0. What is r? -140824, 4 Find c such that -7c4 + 22286c*3 + 658411c*2 + 816046c + 179928 = 0. -28, -1, -2/7, 3213 Suppose 2b5/5 - 172b*4 + 35784b*3/5 - 88396b*2 + 2083382b/5 - 633864 = 0. What is b? 3, 7, 28, 385 Solve -4z2 + 33175768z - 33175764 = 0 for z. 1, 8293941 Find r, given that -5r5 - 65280r*4 - 5847180r*3 - 161887360r*2 - 928419840r + 12746096640 = 0. -12966, -32, 6 Suppose q*3 - 3129291q*2 + 12517152q - 12517148 = 0. Calculate q. 2, 3129287 Solve 5450k3/3 - 172052240k*2/3 + 1357890261442k/3 - 24915359716/3 = 0. 2/109, 78923/5 Suppose 5a4 + 3810a*3 - 622415a*2 - 1271400a + 1890000 = 0. What is a? -900, -3, 1, 140 Solve -a*2/4 - 92403a/2 - 1016312 = 0 for a. -184784, -22 Determine x, given that -147x3/2 - 18809229x*2/2 - 601678158177x/2 + 36837508761/2 = 0. -63977, 3/49 Factor -x*2 + 169008190x - 7140942071769025. -(x - 84504095)*2 Solve 10k*3/7 - 4151354k*2/7 + 61548893632k + 258506847744/7 = 0. -3/5, 207568 Let 2331h4 - 149892h*3 + 2348352h*2 - 700272h + 11856 = 0. Calculate h. 2/111, 2/7, 26, 38 Solve -2i4/3 + 5264i*3/3 + 630278i*2/3 + 4206244i/3 + 1977840 = 0. -108, -5, -2, 2747 Factor 2r2 - 1628r - 1288702. 2(r - 1307)(r + 493) Determine w, given that w*4/4 - 48315w*3/2 + 483133w*2/4 - 193251w + 96625 = 0. 1, 2, 96625 Suppose 32w5/9 + 6638000w*4/3 + 23232886w*3/3 + 31115456w*2/9 + 1244618w/3 = 0. Calculate w. -622309, -3, -1/4, 0 Solve -3g3/5 - 239334108g*2/5 + 478668228g/5 = 0 for g. -79778038, 0, 2 What is c in -c*4/10 + 1166c*3/5 - 667968c*2/5 - 2765952c = 0? -20, 0, 1176 Solve 7450z5/11 + 706160z*4/11 + 17009002z*3/11 + 13049252z*2/11 + 2454904z/11 - 35344/11 = 0 for z. -47, -2/5, 2/149 Solve -2n5/3 - 790n*4/3 - 3098n*3 - 39242n*2/3 - 67504n/3 - 12256 = 0 for n. -383, -4, -3, -1 Let 4q5 + 99868q*4 + 621800484q*3 - 19366100588q*2 + 36244200232q = 0. Calculate q. -12499, 0, 2, 29 Factor 2w3 + 14012w*2 + 26822274w + 7792526016. 2(w + 352)(w + 3327)*2 Let -14k*2/9 - 13294k/9 + 67520/3 = 0. Calculate k. -6752/7, 15 Suppose -n*4/9 - 108677n*3/9 + 6524281n*2/9 + 6632957n/9 = 0. What is n? -108737, -1, 0, 61 Factor 8w4 + 4247364w*3 + 751677243792w*2 + 44344196703845056w + 199533664090153728. 4(w + 176972)3(2w + 9) Find h such that 2h*5/5 + 124h*4/5 - 20714h*3/5 - 915052h*2/5 + 8824968h - 8637840 = 0. -90, 1, 31, 86 Factor -3v3/5 + 269250v*2 - 1346247v/5. -3v(v - 448749)(v - 1)/5 Suppose x4 + 795x*3 + 78597x*2 - 493155x + 750546 = 0. Calculate x. -678, -123, 3 Find r, given that 882r4/19 + 3423756r*3/19 - 149511718r*2/19 + 28385256r/19 - 1350200/19 = 0. -3925, 2/21, 43 Determine q, given that 3q2/2 - 51927351q + 898816593959067/2 = 0. 17309117 Factor -1957531536i3 + 2773822363488i*2 - 250774996i + 5668. -4(i - 1417)(22122i - 1)2 What is s in -8s*5/15 + 34286s*4/5 - 147239948s*3/5 + 637426356112s*2/15 - 5473696713212s/5 - 4224852104382/5 = 0? -3/4, 27, 4277 Factor -2r2 + 22231010r. -2r(r - 11115505) Determine j so that -j*2/2 + 214j - 45675/2 = 0. 203, 225 Let -3h5/4 + 309h*4/4 + 52926h*3 + 520785h*2 = 0. What is h? -213, -10, 0, 326 Factor 2w*2 + 167063128w/7 + 95464640/7. 2(w + 11933080)(7w + 4)/7 Find n, given that -n4/3 + 782358n*3 - 1377221949013n*2/3 + 12853611501276n - 269922621379684/3 = 0. 14, 1173523 Find z such that 3z2 + 99729z - 2295354 = 0. -33266, 23 Factor 2s2 + 132986s + 132984. 2(s + 1)(s + 66492) Determine k so that 2k3 - 18687260k*2 + 43651729475704k - 87303384202384 = 0. 2, 4671814 Let -o*2 - 56317027o + 56317028 = 0. Calculate o. -56317028, 1 Solve 23b4 + 668b*3 + 3756b*2 - 16000b + 11264 = 0. -16, 22/23, 2 Find x such that 2x2/7 - 279618x + 9786580/7 = 0. 5, 978658 Factor -3k2 + 1453720542k - 176108617852731147. -3(k - 242286757)2 Factor p2/4 - 489p + 165137. (p - 1522)(p - 434)/4 Find d, given that -8d*5 - 2980d*4 - 150220d*3 + 248560d*2 + 842160d - 464256 = 0. -312, -62, -2, 1/2, 3 What is k in -101k4 - 165k*3/2 + 1281k*2/2 - 95k - 96 = 0? -3, -32/101, 1/2, 2 Find z such that -3z5 + 1434z*4 - 119295z*3 - 13002012z*2 - 74635020z - 110224800 = 0. -56, -3, 270 Solve 4f3 - 630356f*2 + 1891040f - 1260688 = 0 for f. 1, 2, 157586 Determine d so that 2d3/11 + 12615146d*2/11 + 1808431352976d + 19892732267592/11 = 0. -3153786, -1 Suppose 4g5/5 + 8032816g*4/5 - 16065651g*3/5 - 6024613g*2/5 + 10041032g/5 + 4016412/5 = 0. Calculate g. -2008206, -1/2, 1, 2 Find u, given that -2u3/19 - 34u*2 + 2798786u/19 + 2799430/19 = 0. -1355, -1, 1033 Factor -2r2/3 + 1784090r/3 + 178409	{ "pile_set_name": "DM Mathematics" }
ommon factor of x and d? 8 Let v be (32 + -27)/(10/22). Calculate the greatest common factor of 1331 and v. 11 Let b be (-6)/(-4) + 872/16. Let x = b + -34. Calculate the highest common factor of 33 and x. 11 Let d = -88 - -92. Let u(c) = -2c + 19. Let m be u(d). What is the highest common divisor of 121 and m? 11 Suppose -c + 0 = 2. Let b be 1/(-2)40/c. Suppose -30 = -18o + 6. Calculate the greatest common factor of o and b. 2 Let n(g) = -2g*2 + 13g - 2. Let w be n(6). Calculate the highest common factor of 2 and w. 2 Let w(x) = -x*2 - 5x - 3 - 11x + 6. Let n = 11 - 18. Let d be w(n). What is the highest common factor of 6 and d? 6 Suppose 5l = -w - 12, 6 = -2l - 0. Suppose -n - w = -15. Let p be (1 - 1)/(-2) + 3. Calculate the highest common factor of n and p. 3 Let k be (32/(-20))/((-2)/50-1). Let o be (-10)/k - 251/(-4). What is the greatest common factor of o and 7? 7 Let a be (-8)/(-48) - 3026/12. Let x be a/(-15)10/3. What is the greatest common divisor of x and 7? 7 Let n(t) = 6t + 484. Let g be n(-41). What is the highest common factor of 70 and g? 14 Let a(s) = s3 + s2 - 4s + 11. Let p be a(3). Calculate the highest common divisor of 77 and p. 7 Let b = 1345 - 1169. What is the highest common divisor of b and 80? 16 Let k be 292/16 - (-1)/(-4). Let v(b) = -6b + 2. Let g be v(-1). Let t be 72/412/g. What is the greatest common factor of k and t? 9 Suppose 9 = 2q - 3o, 0 = 4q + 27o - 24o - 63. Calculate the highest common divisor of q and 498. 6 Suppose b = 585 - 25. Suppose -4o + b = -4g, 0 = 3g - 6g - 12. Calculate the highest common factor of 17 and o. 17 Suppose -91 + 1 = -5f. Suppose -8d + 461 - 101 = 0. Calculate the greatest common divisor of f and d. 9 Let s be (4 - 104/20)/(12/(-520)). What is the highest common factor of s and 2158? 26 Suppose -a - 2q = -32, 4a - 2a - 19 = 5q. Let o(n) = -n - 12. Let x be o(-11). Let z = x + a. Calculate the highest common factor of 7 and z. 7 Let x be ((-1)/2)/(-1) + (-180)/(-24). What is the highest common divisor of x and 888? 8 Let b = -20 + 20. Suppose b = -12a + 7a + 30. What is the highest common divisor of a and 6? 6 Let b(j) = -7j2 + 31j + 10j2 - j3 + 3j + 9j2. Let y be b(14). Calculate the greatest common divisor of 12 and y. 12 Suppose 18t - 940 + 220 = 0. Calculate the greatest common factor of t and 2440. 40 Let u = -112 - -115. Calculate the greatest common factor of u and 10. 1 Let k be 272 - 0/(5 + -2). Suppose 23p - 34 = 22p. Calculate the greatest common divisor of k and p. 34 Let x = 4 - -43. Let u = -1 + x. Calculate the highest common divisor of 322 and u. 46 Let t = -419 + 457. What is the greatest common factor of t and 4? 2 Suppose 20d - 27d = -91. What is the greatest common divisor of 377 and d? 13 Let z = -9 + 1. Let i(r) = r*3 + 9r*2 + 6r - 11. Let k be i(z). Let h be (0 + (-6)/9)-3. Calculate the highest common divisor of k and h. 1 Let c be ((-2)/(-4))/((-1)/(-18)). Let a be (3 - (-1 - -4))/2. Let h be (9 - a)(-4 + 5). What is the highest common factor of c and h? 9 Suppose 0 = -8i + 4300 + 44. What is the highest common divisor of i and 3? 3 Let z = 13 + -8. Suppose zp + 5 = 6p. Suppose -ph - 38 = -278. Calculate the greatest common divisor of h and 6. 6 Let f = 16 + -12. Suppose 12 = -0i + fi. Let u = 21 - 12. Calculate the highest common factor of i and u. 3 Let w = 1187 + -1176. What is the greatest common factor of 143 and w? 11 Let r(p) = 2p - 12. Let f be r(12). What is the greatest common factor of 12 and f? 12 Suppose 43t - 2133 = 1307. Let s = -10 - -70. What is the greatest common divisor of t and s? 20 Let v = 310 - 286. Calculate the greatest common divisor of 40 and v. 8 Let t be 24 - -4 - (-2 + 7). What is the highest common divisor of t and 207? 23 Suppose 7r - 6r = 5h + 811, 3134 = 4r + 2h. Suppose 13w - 189 = r. Calculate the greatest common divisor of w and 45. 15 Let y = 233 - 203. Let q be 6/((-4)/16-4). What is the highest common factor of y and q? 6 Let w be (-28)/(-6 - -2) + 13. Calculate the greatest common factor of 60 and w. 20 Suppose g + 7 = 2g. Let r = g + -6. Let o = 43 + r. Calculate the highest common factor of o and 110. 22 Suppose -2p + 10 = -0p - 4o, 5o - 26 = -3p. Let d be 310/7 + (-2)/p. Calculate the highest common divisor of 33 and d. 11 Let j = 676 + -595. Calculate the greatest common factor of 108 and j. 27 Suppose 18r - 35846 = 4906. What is the highest common divisor of 8 and r? 8 Let t = 73 - 50. Let b be 10302/39 + 4/(-26). Suppose 4p + 3i - b = 0, -4p + 4i + 0i + 292 = 0. What is the greatest common divisor of p and t? 23 Let j(z) = -z3 + z. Let x = -1 + 1. Let i = -3 + x. Let t be j(i). What is the highest common factor of t and 8? 8 Let m = 66 - -54. Calculate the highest common factor of m and 72. 24 Let z(h) = -h3 - 9h*2 - 3h + 3. Let s be z(-9). Suppose -3i = 3i - s. Calculate the greatest common factor of 40 and i. 5 Suppose 4u - 594 = -426. Suppose 3f + 4g + 3 = 41, 0 = -4f - 4g + 44. Calculate the greatest common factor of f and u. 6 Suppose -2r - 15 = 4h - 3, -4h = 0. Let p be 1/(-2)r/(-3). Let d be (27 - p)(7 + -5). Calculate the highest common divisor of d and 7. 7 Let n(d) = 114d3 + d2 - 2d + 6. Let f be n(2). What is the greatest common divisor of 18 and f? 18 Let z = -258 + 328. Calculate the highest common factor of 98 and z. 14 Suppose -z + 3z + 2g - 10 = 0, -2g = 8. Suppose 10f + z - 79 = 0. Calculate the highest common factor of 21 and f. 7 Let i be (-228)/(-14) - 2/7. Let l(f) = 30f2 + 4f. Let j be l(-2). Calculate the greatest common factor of j and i. 16 Let f = 55 - 43. Suppose -f = -2d + 58. Calculate the greatest common factor of d and 5. 5 Let l = 512 - 500. What is the greatest common factor of l and 924? 12 Suppose -2o + 7o - 2k - 198 = 0, 0 = -5o + 3k + 197. Calculate the greatest common divisor of o and 40. 40 Let o = -14 + 22. Let s = o + 4. What is the greatest common divisor of s and 60? 12 Suppose 4g + 4s - 248 = 28, 4g = 2s + 306. Calculate the highest common factor of 111 and g. 37 Let x(o) = 11o + 4. Let s(y) = -6y - 2. Let p(d) = 5s(d) + 2x(d). Let j be p(-7). What is the highest common divisor of 6 and j? 6 Suppose -4f + 70 = -8v + 5v, -2v - 4 = 0. Calculate the highest common factor of 3 and f. 1 Let d = 99 + 342. What is the greatest common factor of 126 and d? 63 Let s be (-188)/(-4) - 64/6. Suppose 37d - sd + 18 = 0. Calculate the greatest common factor of d and 18. 3 Let d(m) = m2 - 11m + 42. Let i be d(14). What is the highest common divisor of 294 and i? 42 Suppose r + 3r = 0. Let j(p) = 8 - p + 0p2 + 2 + p2 + r. Let a be j(0). What is the greatest common divisor of 20 and a? 10 Let s = 35 + 9. Let v = 278 + -212. What is the highest common factor of s and v? 22 Suppose -4l = -f - 512, 0 = -4f + 2 + 14. Let h = -60 + l. Suppose 0 = -p + 4w - 11, -4p - w = -h + 28. What is the highest common factor of p and 1? 1 Let m = 18 - 11. Let s be (318/(-795))/(2/(-5)). Calculate the greatest common factor of m and s. 1 Suppose -176k + 182k - 126 = 0. Let d(s) = s*3 - 4s*2 - 4. Let n be (-5)/(-1) + (-1 - -1). Let z be d(n). What is the greatest common divisor of z and k? 21 Suppose -12 + 2 = -10s. Let k(c) = 396c2 + 5c - 5. Let j be k(s). What is the greatest common factor of j and 36? 36 Let m be (0 - -2)(-11)/(-2). Let n(u) = 124u*2 + 6u + 3. Let q be n(-1). What is the greatest common divisor of q and m? 11 Suppose -41x + 72 = 4h - 37x, -4x - 96 = -4h. What is the highest common factor of h and 399? 21 Let k(y) = y2 + 4y - 16. Let p be k(-6). Let s be (p/(-8) + -1)-30. What is the highest common divisor of s and 5? 5 Let q(g) = g + 28. Let w be q(0). Let j = -102 + 410. Calculate the greatest common divisor of j and w. 28 Let f = 1087 + -1078. Calculate the highest common divisor of 23 and f. 1 Let q be 2/4138 + (2 - 3). What is the highest common divisor of q and 4? 4 Let f(s) = 4s2 - s - 2. Let w be f(-1). Suppose wi + 108 = 6i. Calculate the greatest common divisor of i and 180. 36 Let r(s) = s2 + 17s + 86. Let n be r(-15). Calculate the greatest common divisor of n and 16. 8 Let c(m) =	{ "pile_set_name": "DM Mathematics" }
e -50u + 286 = -14 for u. 6 Solve n - 2 = -7 for n. -5 Solve -42 = -398r + 384r for r. 3 Solve -3b - 2b = 0 for b. 0 Solve -5z - 37 = -37 for z. 0 Solve -5c = 4c - 27 for c. 3 Solve -3d + 98 = 113 for d. -5 Solve 3p - 23p - 100 = 0 for p. -5 Solve -25j - 44 = 19j for j. -1 Solve 16o + 42 + 6 = 0 for o. -3 Solve 0 = n + 20 - 16 for n. -4 Solve -2n = 7n + 9 for n. -1 Solve -5t + 2t + 6 = 0 for t. 2 Solve -32z = -28z - 4 for z. 1 Solve 47u = 58u + 66 for u. -6 Solve 16 - 16 = 3l for l. 0 Solve -174l = -162l - 72 for l. 6 Solve 63v - 71v + 48 = 0 for v. 6 Solve 3 - 27 = 8f for f. -3 Solve -2a + 12 - 16 = 0 for a. -2 Solve 1 = 9p - 26 for p. 3 Solve -13 = 3x - 25 for x. 4 Solve 8 = -11k - 47 for k. -5 Solve 5r - 13 = 7 for r. 4 Solve 11a = 33 - 44 for a. -1 Solve 19u = 41u - 154 for u. 7 Solve -10j = -26j - 48 for j. -3 Solve 102c = 98c for c. 0 Solve -2w - 2w = -8 for w. 2 Solve -4r + 162 = 182 for r. -5 Solve 54 = -f + 54 for f. 0 Solve 0p = 6p for p. 0 Solve 60 = -36p + 24 for p. -1 Solve -108c + 25 = -113c for c. -5 Solve -2766x = -2769x - 27 for x. -9 Solve -46f = -48f + 12 for f. 6 Solve -6f + 4f - 8 = 0 for f. -4 Solve 0 = 29g - 10 - 77 for g. 3 Solve -34 + 14 = -5t for t. 4 Solve 11p + 4p = 60 for p. 4 Solve -8r = -2r - 6 for r. 1 Solve 2 = 7f + 16 for f. -2 Solve -3c + 10 = -8c for c. -2 Solve 7m = 36m - 58 for m. 2 Solve 12 = 119q - 123q for q. -3 Solve 3 = -12j + 11j for j. -3 Solve 22i - 479 + 545 = 0 for i. -3 Solve 0 = 7l + 48 - 55 for l. 1 Solve s - 13 = -8 for s. 5 Solve -16p + 44 = -52 for p. 6 Solve -11o + 2355 = 2366 for o. -1 Solve 0w + 65 = -13w for w. -5 Solve 9c = -9c + 36 for c. 2 Solve -14g = -11g + 9 for g. -3 Solve -6u = 91 - 43 for u. -8 Solve -3 = 5l + 7 for l. -2 Solve 0 = -2u + 7u - 15 for u. 3 Solve 62l + 33 = -29 for l. -1 Solve -8 - 16 = -12z for z. 2 Solve -3m + 140 - 152 = 0 for m. -4 Solve -x + 5x = -5x for x. 0 Solve -2w = -4w + 8 for w. 4 Solve -20 = 21n - n for n. -1 Solve 0 = -4j - 0 + 4 for j. 1 Solve -20k + 8 = -16k for k. 2 Solve 5d + 332 = 302 for d. -6 Solve 26d + 29d = 52d for d. 0 Solve -42v + 28v = -28 for v. 2 Solve -13z - 107 = -81 for z. -2 Solve 0 = 5y - y + 8 for y. -2 Solve 0 = -27z + 28z - 8 for z. 8 Solve 0 = 183h - 179h - 4 for h. 1 Solve -8 = -4r - 24 for r. -4 Solve -4471 = 3f - 4444 for f. -9 Solve 330z = 329z - 4 for z. -4 Solve 6a + 10 = a for a. -2 Solve -3 - 1 = -m for m. 4 Solve 52 = 15d - 23 for d. 5 Solve 0 = 3h + 3 for h. -1 Solve -17l + 34l + 8l = 0 for l. 0 Solve 0 = -6b + 5b - 2 for b. -2 Solve 18a - 211 = -247 for a. -2 Solve 136l - 33l = 412 for l. 4 Solve -6m = -10m - 20 for m. -5 Solve 0 = 2g + 101 - 95 for g. -3 Solve -35h - 2h = -259 for h. 7 Solve -2z - 14z = 16 for z. -1 Solve 15 = 12u - 33 for u. 4 Solve -513 = -62p + 5p for p. 9 Solve 140y - 6 = 141y for y. -6 Solve 8f + 37 = -3 for f. -5 Solve -15 = -50k + 53k for k. -5 Solve 27 - 27 = -4i for i. 0 Solve 19 = -22j - 47 for j. -3 Solve -13b = -170 + 79 for b. 7 Solve -27m - 137 - 25 = 0 for m. -6 Solve 0 = -3r - 10r + 13 for r. 1 Solve 68a = 86a - 18 for a. 1 Solve -19 = -5j + 6 for j. 5 Solve -5a + 11 = 6a for a. 1 Solve 19t - 168 = 47t for t. -6 Solve -8j - 7 = -j for j. -1 Solve 0 = -62n + 61n - 7 for n. -7 Solve -5q - 15 = -2q for q. -5 Solve -23a = a - 120 for a. 5 Solve 124r = 85r for r. 0 Solve 0 = -13s - 81 + 16 for s. -5 Solve -210z + 205z = 0 for z. 0 Solve 0 = -61a + 42a - 152 for a. -8 Solve 0 = -15u + 50u for u. 0 Solve -16z = -18z + 8 for z. 4 Solve -11g - 12 = 10 for g. -2 Solve -51k + 36 = -47k for k. 9 Solve -47h + 52h + 20 = 0 for h. -4 Solve -38y = -19y + 95 for y. -5 Solve 19z = 49 - 11 for z. 2 Solve 10v - 2 = 8v for v. 1 Solve -182 = 4p - 202 for p. 5 Solve -o - o = -10 for o. 5 Solve 12d + 40 = 28 for d. -1 Solve 0 = -7t + 27 - 62 for t. -5 Solve -28h - 174 = h for h. -6 Solve d + 9d = -30 for d. -3 Solve 0 = 23v - 18v + 10 for v. -2 Solve -54q + 88 = -98q for q. -2 Solve 35v = 11v + 72 for v. 3 Solve -60c + 21c + 195 = 0 for c. 5 Solve -42a = -40a + 10 for a. -5 Solve 24 - 134 = 11g for g. -10 Solve -2c = -c - 3 for c. 3 Solve -64y - 210 = -34y for y. -7 Solve -59u - 26 = -46u for u. -2 Solve 22m = 3m - 57 for m. -3 Solve 515 - 452 = -7q for q. -9 Solve -5j - 17 + 42 = 0 for j. 5 Solve 0 = -7n + 52 - 73 for n. -3 Solve 451a = 450a + 9 for a. 9 Solve -18c = -21c + 3 for c. 1 Solve -23c + 25 = -18c for c. 5 Solve 0 = 32z - 45 - 83 for z. 4 Solve 81 = 2b + 7b for b. 9 Solve 24 = -7d + 52 for d. 4 Solve -31 = -17d - 116 for d. -5 Solve 68t - 26t = -126 for t. -3 Solve -16o = -11o - 25 for o. 5 Solve 2b - 6 = -10 for b. -2 Solve 2p - 16 = -16 for p. 0 Solve 0 = 21l - 12 + 33 for l. -1 Solve b = -4 - 4 for b. -8 Solve 4z = 10 - 6 for z. 1 Solve -2x + 8x = -24 for x. -4 Solve -4s - 118 = -106 for s. -3 Solve -223 - 71 = -42i for i. 7 Solve 5g + 15 - 35 = 0 for g. 4 Solve 10w - 7 - 3 = 0 for w. 1 Solve 8b = 2b - 24 for b. -4 Solve 245t - 255t = 100 for t. -10 Solve 48 = 31k - 15k for k. 3 Solve 0t = 8t + 8 for t. -1 Solve -35 + 51 = -4n for n. -4 Solve 11 = -2r + 5 for r. -3 Solve -401m = -400m - 2 for m. 2 Solve -14y + 188 = 230 for y. -3 Solve 0 + 30 = -6n for n. -5 Solve 54n + 15 = 57n for n. 5 Solve 0 = -3g - 27 for g. -9 Solve 556d - 5 = 561d for d. -1 Solve v = 17v - 64 for v. 4 Solve -11 = -w - 7 for w. 4 Solve 20r - 26r = -12 for r. 2 Solve -17 = -4a - 1 for a. 4 Solve -21 + 27 = 2q for q. 3 Solve -152 = 40o + 88 for o. -6 Solve -2s + 3 = 5 for s. -1 Solve 0 = 7i - 23i + 48 for i. 3 Solve 397 = -50p + 197 for p. -4 Solve 22i = 17 + 5 for i. 1 Solve -33 = -5p - 28 for p. 1 Solve 21y + 118 = -50 for y. -8 Solve 2693 - 2675 = -9d for d. -2 Solve -6s = 2s + 48 for s. -6 Solve 15 + 97 = 16o for o. 7 Solve 0r = -6r + r for r. 0 Solve -8o + 368 = 360 for o. 1 Solve 0 = 10b - 207 + 277 for b. -7 Solve 0 = -2t - 28 + 18 for t. -5 Solve -25o + 28o = -3 for o. -1 Solve -15d - 15 = 45 for d. -4 Solve -19 - 133 = 38h for h. -4 Solve 72 = -23s + 210 for s. 6 Solve -6o + 36 = 30o for o. 1 Solve 2b = -20b + 22 for b. 1 Solve -201 = -69k - 63 for k. 2 Solve 43 = -5s + 18 for s. -5 Solve -6 = -11a + 49 for a. 5 Solve 15r - 16r - 1 = 0 for r. -1 Solve -42f + 21 = -49f for f. -3 Solve 8v + 10 = 10v for v. 5 Solve -36b + 105 = -39 for b. 4 Solve -u + 10 = u for u. 5 Solve 24y - 32 = 8y for y. 2 Solve 0 = -3d + 4d + 4 for d. -4 Solve -901f - 42 = -908f for f. 6 Solve 1 - 55 = -27k for k. 2 Solve 0 = -3c - 4c + 4c for c. 0 Solve 34y - 6y = -0y for y. 0 Solve 4d = 212 - 252 for d. -10 Solve 0y = 5y - 20 for y. 4 Solve 0 = 7j + 19 + 16 for j. -5 Solve 0 = 27h - 76h for h. 0 Solve -9x + 28 = -16x for x. -4 Solve 0 = 352z - 317z - 350 for z. 10 Solve 723 = -58l + 143 for l. -10 Solve -2b - 4b = -18 for b. 3 Solve 14c - 51 = 5 for c. 4 Solve -6m + 4 = -7m for m. -4 Solve -4r + 5 = 1 for r. 1 Solve 160 = 6g - 26g for g. -8 Solve 1570j = 1546j - 48 for j. -2 Solve -25 = -41b + 98 for b. 3 Solve -21 = 19k - 2 for k. -1 Solve 3 = 6j - 3 for j. 1 Solve 5r = 44 - 29 for r. 3 Solve 0w = 40w - 280 for w. 7 Solve 2n - 8n = -24 for n. 4 Solve 6s = 15 + 9 for s. 4 Solve 7 = 7u - 7 for u. 2 Solve 2x = -111 + 125 for x. 7 Solve 0 = -11x + 45 - 12 for x. 3 Solve 23z = 19z - 32z for z. 0 Solve -2185c = -2176c - 72 for c. 8 Solve -13k + 20 = -33k for k. -1 Solve -6x + 7 = x for x. 1 Solve -26 = -5p - 11 for p. 3 Solve 25 = -0p - 5p for p. -5 Solve -25k = -23k + 6 for k. -3 Solve 0 = o + o - 4 for o. 2 Solve -151b + 146b + 50 = 0 for b. 10 Solve 0 = 6q - 0q for q. 0 Solve -5s - 7s - 24 = 0 for s. -2 Solve -13j = 8j - 105 for j. 5 Solve 179p + 56 = 171p for p. -7 Solve 23g = -4 - 19 for g. -1 Solve 8x - 3 = 7x for x. 3 Solve 14z = 19z - 15 for z. 3 Solve -50g + 47g = 9 for g. -3 Solve -2c = 2c - 4 for c. 1 Solve -13n + 120 = 16 for n. 8 Solve 17x + 7 = 10x for x. -1 Solve 15t + 44 - 119 = 0 for t. 5 Solve -2w + 4w = 2 for w. 1 Solve 9y - 601 = -637 for y. -4 Solve 0 = 3	{ "pile_set_name": "DM Mathematics" }
3). -25/4 What is ((-10010)/150150)/((-8)/(-20)(-3)/(-4))? -2/9 What is the value of 16/180(-8)/((-2048)/288)? 1/10 Calculate (-114)/(-11172)-56 + ((-151)/(-7) - 1). 20 (1(-4)/36)/((3420/288)/95) -8/9 What is (8 - 14 - -45) + (-2065)/63? 56/9 Evaluate (-12)/(-24) + (-1320)/1936. -2/11 What is (-73440)/560 + 824/(-309)9/28? -132 What is the value of (1738/5214)/(2/(-618))? -103 Calculate (0 - 5/(-20))(-6 - -7) - (-1357)/92. 15 12/(-27)220/(-88)3/6 5/9 What is 308/(-22) + 54180/3906? -4/31 Evaluate (56/132)/(-1) + (-63)/(-84546)122. -1/3 Calculate 516/(-247981) - (-62)/2263. 2/79 -2 + (-984)/51 - (-63840)/3040 -5/17 (1296/(-2340))/(((-40)/(-440))/(51/11)) -36/13 What is the value of (4 + ((-336)/(-54) + -6)3)/(904/339)? 7/4 What is the value of (794725/10458 - 41) + -35? -1/126 Evaluate 12/(-21)(-53466)/(-4020). -38/5 What is ((-374)/102)/((-385)/(-21)) + (223/90 - 2)? 5/18 What is 12351/20585 + (-518)/21(-2)/((-40)/(-6))? 8 55/1871020/(-425) -12/17 Calculate (78 + 47 + -126)(1 - 812). 95 Evaluate (479560/587461)/(-1 - 5/(-7)). -20/7 Calculate (-56)/1155300/(-240). 2/33 Evaluate ((-28)/(-28455))/((-6)/(-60))((-3375)/(-60))/(-75). -2/271 What is 35 + 10944/(-570) - 4/5? 15 Evaluate (-88 - (7 + -27)) + 120. 52 What is 2493 - 2511 - 1(-6845)/380? 1/76 (-15)/(-70)(175958/(-1164) - -151) -1/28 Calculate (-27 + (-27346)/(-990))50/20. 14/9 Evaluate (6/(-18))/((-10)/60) + ((-1665)/(-54))/(-5). -25/6 What is ((-64032)/(-609))/(-92) + (-423)/(-21)? 19 What is the value of ((-126844)/2185 - -58)(-60)/(-108)? -2/69 -21(-29)/34104(5 + 3) 1/7 Evaluate (399/38 - (-4)/(-32))(20 + -12). 83 (1326/(-168) - -5(-24)/(-160)) + 6 -8/7 Evaluate ((-136)/(-6))/(11312/909 - 12). 51 3504/(-16206)(-10 - 64) 16 What is the value of 5/(-15)(-216)/(-40)90/(-513)? 6/19 (-2 - -24)/(-3(-36)/(-162) - 0) -33 What is the value of (-2)/35-39 - ((-96664)/(-6020))/(-281)? 16/7 Evaluate (-141 - (-1137131)/8051)/(10 - 0). 2/83 What is (0 + (-3)/(-4))2076/17127 - 0? 1/11 What is the value of (-101 - -109) + -4 + (-15)/3 + -6 + 0? -7 What is the value of (-108)/1863-92 - (0/23 - 4/6)? 6 Evaluate ((-2)/532)/((-32362)/111796). 1/77 Evaluate 1310(-30)/(-900) - (2 - 2/6). 42 701645/(-28665) + 24 - (174/(-39) - -4) -1/63 100192/212908 - (-3495)/(-51)-1 69 What is the value of 31977/627 + 20692/(-406)? 1/29 25(-80)/(-19000) - (2 + (-1842)/190) 39/5 (64418/63)/8 23 What is (3984/332051)/((-6)/20)? -20 (8 - 3)/(80/(-672)) -42 What is -38(6/18)/(65/90)? -38 Evaluate (0 - 152/26)(-105612)/5416. 114 Evaluate (-87 - (74 + -142)) + 59/3. 2/3 What is the value of -348(-40 + 2068/132 + 24)? 116 What is -37 + 67/((-4020)/(-720))? -25 What is (525/(-210)2/5)/((-7421)/(-41))? -1/181 What is the value of 259(-9398)/31598 + 77? -2/61 What is the value of (0 + 6/(-5))/(((-754)/(-975))/29)? -45 Calculate 68/(-714)(-29 - (2 - -4)). 10/3 -57(-6 + 5) - 2079/63 24 What is 1 + 20/(-120)24 - (-5)/((-75)/(-9))? -12/5 What is (-371)/((-938630)/345) + 2285/22? 104 What is -8((-12)/(-480))/(1/(-2)) - (-432)/(-105)? -26/7 Evaluate 10(1/(-10) + ((-4)/20)/1). -3 Calculate (424/(-16) + (-1)/(-6))(19229 - 19232). 79 Evaluate (((-2)/24)/(142/1278))/(10/4). -3/10 Evaluate (8/(-14))/((-4)/(-2842)(99 - (137 + -31))). 58 What is 3/2((-6)/1554)/((-141)/(-329))? -1/74 Calculate (1940 + -1944)/(((-476)/(-236) + -2)-2). 118 What is the value of (((-4)/42)/(8/12))/(((-9579)/(-50127))/(-103))? 77 (40/(-14))/(4/(-56))(-308)/(-2464) 5 Calculate ((-16)/(-3536)17)/((-63)/630). -10/13 9/28 - (-10 - (-273)/28) - 5940/9660 -1/23 What is the value of (305/915)/(4 - (-291)/(-72))? -8 What is the value of 6762/(-1176) + (-230)/(-40)? 0 2/((-16)/15) + 434/3472 -7/4 Evaluate 1016(-31)/220720. -2/89 (-4900)/812 - (5 + -19 + 8) -1/29 (2 - (81 + -48)) + (-4515)/(-168) -33/8 Calculate (((-32769)/2772)/331)/((-11)/((-154)/20)). -1/40 Calculate (30/40)/((-3)/1727(-16)/(-5184)). -51 (-15 - 1092/(-70))/((-24)/(-36)(-6)/340) -51 What is the value of 7/14600/(-108) + ((-6)/3 - -7)? 20/9 Calculate (3/((-30)/(-695)))/(7/56-4). -139 Calculate 90/(-135) + (-41)/(-3) + 3-13. -26 (4 + 1)/((-4998)/(-4284)) 30/7 Evaluate (0 + 1 - -2)/((-11)/(-44) + 432/(-1216)). -57/2 (340/20 + -20)/(18/12) - 4/(-3) -2/3 What is (1586/(-260))/((-3)/30) + -15 + -1? 45 What is the value of 22/(-3)(((-2)/10)/1)/((-1832)/27480)? -22 What is the value of ((-5)/(-250))/(293/5860)? 2/5 Calculate ((-51)/12 + 5 + (-3055)/260)10/(-2255). 2/41 Evaluate 1 + -36 - (3344 + -3321). -58 What is ((28 + (-11850)/425)(2 - 3))/2? -1/17 -9(1/((-15)/40))/(6/(-9) + 0) -36 2220 - 2240 - (-996)/50 -2/25 What is the value of 1 - (-2938)/140 - 38346/1743? -1/70 What is the value of 150330/270? 50 Evaluate (-3084)/378 - -6 - (6 + 414/126 + -9). -22/9 Evaluate 1/((-20)/(-924))1 + 1647/940. 47 (-2)/8 - 189/56 - ((-67 - -29) + 34) 3/8 148/35 - (-139)/((-26271)/(-108)) 24/5 Calculate ((-850)/(-210) + -4)/(5/35)-51. -17 -14 + (-273)/(-70) - 7/(-70) -10 What is the value of ((-17316)/(-2664))/((-39)/(-20))? 10/3 Evaluate -117 - 92667/(-790) - 33/10. -3 4/(-54) - (-70)/((336960/(-75))/(-64)) 12/13 24 - (18894/871 + 2) 4/13 Calculate (-16479882)/(-1553670) - (-8)/(-1132). 53/5 Calculate 4461/(-37175)(1 - 5/3) - 3354/50. -67 (-53 + 5)/(-3) - 161785/10127 1/41 What is (280/75)/(912/6840)? 28 9/4(2 - -38 - 11696/129) -114 What is (2/(16/6) + -1)/((-42)/(-336)-63)? 2/63 What is (2/(-3))/((82 + -72)((-27)/(-12) - 2))? -4/15 Calculate ((-15)/(-45))/((-12)/18) - (6 - (-675)/(-126)). -8/7 What is 7018/(-484)(-2)/(-1)? -29 Evaluate 18/(-4773) + 31060/(-740) + 42. 1/43 Calculate -61 - (2329/(-1096))/((-2)/16). -78 356/160734-43 + 1 + 2188/42 53 What is (-18)/3 + (125 + -128)(-2 + 2 + -2)? 0 What is (-6)/(((-1776)/(-390) - 4) + (-10)/25)? -39 Evaluate ((-140)/(-270))/14 + (-485)/2160. -3/16 (168/406)/(1770/5133) 6/5 Calculate ((-44)/(-22) - 3)(-5 - (-138)/10). -44/5 ((-16)/1 + (-17174)/(-1085))10/(-18) 2/21 Evaluate 2 + 6 + -20 + (-25 - (-10 + -16)). -11 What is 2/17 - (7716/9002)/((-1411)/(-154))? 2/83 Evaluate 2/(-5) + 9411/(-135) - (63 - 47712/756). -70 What is (-2636 + 2368)-1(-1)/4? -67 Calculate 14/1053-15 - (-255)/60. -7/4 Calculate ((-1302)/(-8))/((-36876)/(-21072)). 93 What is (39525/(-310))/((-10)/(-4))? -51 130/50 + (192/(-80))/(-3)103 85 Evaluate (8(-42)/1120(-61 + -1))/(9/30). 62 Calculate 274 + -268 - -73. 27 Evaluate (280 - 277)/(6(-8)/1888). -118 What is the value of 628/(-28) - (7 - 1380/46)? 4/7 What is 13 + (-220)/33(-3)/2? 23 ((-11)/(-21))/(25014/6822) 1/7 (-8 - (-5 - 8))259/35 37 What is the value of (-218)/18 - (342 - 353)? -10/9 What is 9450/(-585) - 39 - -55? -2/13 (-109 + -1)/(42/22 + (-16416)/(-528) + -31) -55 Calculate -9(-1)/(-2)(-9 - (-50)/(60/(-6))). 63 Calculate (-16473)/(-255) + 183/135. 65 Calculate -8(277178/(-5544) + 50). -2/63 Evaluate 28/(-35) - 45/(7200/752). -11/2 Calculate -19 + 24 - (-1 + (-6 - -16)). -4 What is the value of 1/(-14)(-10 + -9 + 23)? -2/7 What is the value of ((-510)/(-340))/((-75)/10)? -1/5 What is (-24)/3 + 60 + 0 + -16(-24)/(-32)? 40 What is ((-1860)/7440)/(1/(-212))? 53 (-289)/4 - 24926/9064 -75 What is (62868/6084)/((-124)/12)? -1 Calculate (-6116)/264 + 748/34. -7/6 (-3 + (-674)/(-120) + (-9)/12)10005/2001 28/3 Calculate (2/(-18) - 1)((-10)/9 + 4213503/3864105). 2/87 What is the value of 7(-14 + (-1950)/(-91) - (0 - -7))? 3 (24 + (-1329768)/54395 + 2/43)65 -26 Calculate 88/(-15)(-585)/148219. 44 Evaluate (34 - (-15950)/(-464))/((-10)/(-4) + 4/(-4)). -1/4 What is the value of (-316332)/7272 - (4/(-2) - 2/(-4))? -42 Evaluate 143/5 - (275/375)/((-22)/(-18)). 28 (-14970)/97305 - (-1 - (-1202)/1482) 2/57 Calculate 18/8(1008/(-54) + 20) - 53. -50 Evaluate (-2634)/102 - -26 - 24628/(-799). 31 1776/(-555) - (4851/(-55) + 11) 74 Calculate 6968/119646 - 552/(-9333). 6/61 (((-4)/184)/(18/(-120)-10))/(1/(-6)) 2/23 190(-442)/(-816) - 4/(-48) 103 What is the value of (39/(-4))/(18837/(-25116))? 13 Calculate 248/(-66) + ((-11)/(-3))/((-2004)/(-2004)). -1/11 What is (7/1824 + 25668/468)1? 55 (-10)/(-4)-4 - 767/(-30 + -29) 3 What is the value of 45 - 1575/(-231) - 6/(-33)? 52 What is (-2091078)/(-46728) + 1/(-3)*(-9)/12? 45 What is ((6/14)/(32/(-14)))/(10570 - 10572)? 3	{ "pile_set_name": "DM Mathematics" }
109 for w. 19 Solve 1497 = 152v + 12134 + 1371 for v. -79 Solve 0 = 5329c - 5423c - 4982 for c. -53 Solve 1784 = -96c - 1576 for c. -35 Solve -490r - 396r - 1538 = 176r + 1648 for r. -3 Solve -194o + 49o = -57o - 54o - 204 for o. 6 Solve 164p + 44p + 3691 = 2p + 13991 for p. 50 Solve 700n - 4698n + 17787 + 35873 = 1368n for n. 10 Solve 0 = -513f + 6168 + 501 for f. 13 Solve 2509704c - 2509517c - 20570 = 0 for c. 110 Solve 96w - 27w - 35w - 130 = 312 for w. 13 Solve -681u - 4776 = -3414 for u. -2 Solve -61h + 14 = 26 + 63 + 47 for h. -2 Solve 0 = -1178518s + 1178320s + 9900 for s. 50 Solve 14241 + 14079 + 2051 = -934u - 2319 for u. -35 Solve 74a + 1394 = 147a - 39a for a. 41 Solve -812 - 2354 - 9884 = -209f - 92 for f. 62 Solve 1184 + 6230 - 230 + 796 = -399n for n. -20 Solve 1576v - 2004v = -41088 for v. 96 Solve 0t + 373t + 49690 = -794t - 5159 for t. -47 Solve 3161o + 8480 + 80047 = -60040 for o. -47 Solve -63g + 107g + 17190 = 388g + 38g for g. 45 Solve 255147581 - 255158167 = -79r for r. 134 Solve 47627 + 100876 = 2517p for p. 59 Solve 3890g + 111130 + 79460 = -21445 - 1915 for g. -55 Solve -324 = 4075k - 4093k for k. 18 Solve 235g + 191g = -169g + 12495 for g. 21 Solve 79629 = -11059c + 8663c - 73715 for c. -64 Solve 10962 = 426z + 345z + 898z - 103z for z. 7 Solve 327b - 2778 - 31192 = 516b + 601b for b. -43 Solve -43217 = 152p - 2031p for p. 23 Solve 0 = -36v + 20377311 - 20378247 for v. -26 Solve 2185p + 1315p + 2291p + 503006 = -2322p for p. -62 Solve 56546l - 56871l + 3900 = 0 for l. 12 Solve -127s + 2562 = -6488 + 795 for s. 65 Solve -2385b - 355b - 170039 = -33039 for b. -50 Solve -2477r - 92003 = 78909 + 34679 for r. -83 Solve -171s = 12774 - 12432 for s. -2 Solve -73j + 1 = 85j + 357 + 118 for j. -3 Solve 207684 = 12404p + 62585 + 393134 + 508609 for p. -61 Solve 76m + 487 = 39m + 99m - 1125 for m. 26 Solve 441x - 237x = 1020 for x. 5 Solve 8146y - 418316 + 29123 - 115859 = 0 for y. 62 Solve 184c + 4744 = 355c - 1583 for c. 37 Solve -19o = 11647 - 11533 for o. -6 Solve 1092i - 442i = -10251 + 2390 + 62461 for i. 84 Solve -21j - 15j + 49j = 20j + 42 for j. -6 Solve 212h = 58h - 470h + 15469 - 493 for h. 24 Solve 1308428 = -64l + 1305164 for l. -51 Solve -25609o + 25627o + 373 = -275 for o. -36 Solve -275s - 3066 - 7112 = -553 for s. -35 Solve 0 = -700f + 837f - 2740 for f. 20 Solve -255a + 500a = 273a - 364 for a. 13 Solve -246f = -13040 - 1874 - 6734 for f. 88 Solve 281 - 1378 = 460w + 283 for w. -3 Solve -297n - 6n + 1822 = -147n + 10090 for n. -53 Solve -1047783i - 66 = -1047762i + 648 for i. -34 Solve 119k + 616k = 206k - 28037 for k. -53 Solve 632f - 29102 = 21458 for f. 80 Solve 13454 = -51143452j + 51143018j for j. -31 Solve 1009 + 2217 = 256n - 178n + 886 for n. 30 Solve -1335w - 32752 = -88484 - 60191 - 222 for w. 87 Solve -4331j + 4103j = -10488 for j. 46 Solve -7a - 151810 = -3237a for a. 47 Solve 3304p + 3168 = 3376p for p. 44 Solve 591q = -103q - 30536 for q. -44 Solve -4040d = 18760 - 20283 - 79277 for d. 20 Solve 371h + 603664 = -4091h - 5946h for h. -58 Solve -28797 = -2035z - 8129 + 11892 for z. 16 Solve -548z + 2444 = -595z for z. -52 Solve -3162f - 358935 = 1643f - 70635 for f. -60 Solve -2676j - 95504 - 121252 = 0 for j. -81 Solve 699 + 103 = -66t + 112 - 1752 for t. -37 Solve -23x - 3945 = -4037 for x. 4 Solve 369264 - 85392 = -2957p for p. -96 Solve -18w - 1320 = -31w - 18w - 9w for w. 33 Solve -97p - 6382 + 8389 = -582p + 23832 for p. 45 Solve 279y = -613y - 198y - 49050 for y. -45 Solve 57g + 96g + 100g - 10176 = 61g for g. 53 Solve 16085 + 16082 - 32185 = -9g for g. 2 Solve -5980 - 36618 = -308s - 365s - 2218 for s. 60 Solve -4527p = -888p - 189228 for p. 52 Solve 0 = 17808k - 17723k + 1615 for k. -19 Solve -149z + 8390 + 13762 = 239z + 424 for z. 56 Solve 4247 - 2074 = -57p + 976 for p. -21 Solve -1753y + 5201 + 4546 = 2569 - 6846 for y. 8 Solve 0 = 874m - 103m + 17733 for m. -23 Solve -169068546z + 11016 = -169068342z for z. 54 Solve 93w + 1132w - 40888 = 149w for w. 38 Solve -2038i - 1967i - 1992i + 6071i = -5476 for i. -74 Solve -18925 + 5619 = 85u - 7866 for u. -64 Solve -4535y - 98y + 436y - 20327 = 67810 for y. -21 Solve -100345h + 100515h = 1190 for h. 7 Solve -3133r - 15682r - 12501r = -4745r + 318852 for r. -12 Solve 408q + 5591 + 62811 = -1079q for q. -46 Solve -1452i + 33345 = 1113i for i. 13 Solve -159r - 49r = 115r - 212r + 12099 for r. -109 Solve 173r - 367r = 2612r + 168360 for r. -60 Solve -220q - 2197q + 171700 = 1154q - 137q for q. 50 Solve 1048s = 2401s - 13530 for s. 10 Solve -874l - 1458l + 26191 = -69202 - 23539 for l. 51 Solve -2188p - 1573p = 5479p - 887040 for p. 96 Solve 228s - 10226 - 3256 = -414s for s. 21 Solve -431m - 355m = -96m - 60030 for m. 87 Solve -11424f + 313234 - 121778 = -448288 for f. 56 Solve 580c - 209c = 192c + 504 - 15898 for c. -86 Solve -707b + 11144 - 29526 = 0 for b. -26 Solve 5244 = -3118202b + 3117765b for b. -12 Solve -93w - 106w - 410w + 29232 = 0 for w. 48 Solve -34y - 672y = -53y - 17803 - 57945 for y. 116 Solve -442 = -112s + 103 - 4 + 579 for s. 10 Solve -3283j - 27430 = -652j + 127799 for j. -59 Solve 108z = 22144 - 19984 for z. 20 Solve 1556 = 2059g - 749g + 57886 for g. -43 Solve 1377a - 3964 + 45824 = -2204 for a. -32 Solve 73o + 27 - 165 = 106 + 194 for o. 6 Solve -3w = 87w + 41w - 3144 for w. 24 Solve 1542q - 37095 = 43089 for q. 52 Solve -276z + 50z = 58z + 635 - 3191 for z. 9 Solve -720 = 38u - 89u + 33u for u. 40 Solve -561k + 32667 = 1082k + 15102 - 31725 for k. 30 Solve -5302w + 234w - 75924 = 3368w for w. -9 Solve 0 = 889q + 1304q + 24123 for q. -11 Solve -109q + 1075 = 312 for q. 7 Solve -71y = 5 + 335 + 125 + 742 for y. -17 Solve 0 = -20y + 910072 - 911512 for y. -72 Solve -452h - 486 = -461h for h. 54 Solve 50715 = -940j + 2123j + 4128j + 324j for j. 9 Solve 6004s + 61908 = 3056s for s. -21 Solve -105400331m + 105400022m - 4944 = 0 for m. -16 Solve 74c - 457 = 2 + 207 for c. 9 Solve 115m - 13395m - 2068200 = 5870m for m. -108 Solve 0 = 483o - 421o - 8469 + 5803 for o. 43 Solve -1890j + 1712 + 56441 = -26897 for j. 45 Solve -439o + 318495 = 286009 for o. 74 Solve -56w + 1503 = 2w + 9w - 3589 for w. 76 Solve -783r + 25133 - 50366 = 37407 for r. -80 Solve 105v - 129v = 58v + 132 + 2000 for v. -26 Solve 612q - 325 = 1191q - 604q for q. 13 Solve 0 = 179v - 75v + 221v - 2925 for v. 9 Solve -2062t = 14133 + 41541 for t. -27 Solve -492h = -2303 - 11473 for h. 28 Solve -162936o - 162994o - 20544 = -325716o for o. -96 Solve -2o + 45 - 19 = -2 - 46 for o. 37 Solve 94d - 1229 = -3767 for d. -27 Solve -121095 = 1911089g - 1912142g for g. 115 Solve -114a + 184a - 1092 = 96a for a. -42 Solve -3176g - 3466g = -7030g + 11252 for g. 29 Solve -10f - 23 = 56 - 145 - 324 for f. 39 Solve -2325596 = 79x - 2326860 for x. 16 Solve -260j = -154j + 44j + 450 for j. -3 Solve 88v - 10094 + 1223 = -18727 for v. -112 Solve 1554a = 3438a - 1004a - 132880 for a. 151 Solve -1670l - 409l + 40l + 124928 = -87l for l. 64 Solve 319m - 122153 = -762m for m. 113 Solve 28870385 = 156h + 28887545 for h. -110 Solve -1668p - 2803p - 45262 = 22078 + 236688 for p. -68 Solve -1232m - 44683 = 7061 for m. -42 Solve -38504m + 19305m + 501 = -19327m + 117 for m. -3 Solve 360f - 32224 = -488f for f. 38 Solve -268l - 1233 = 296 + 797 - 450 for l. -7 Solve 453t = -2280 - 6780 for t. -20 Solve -66680 = -650b - 1017b for b. 40 Solve 2219o = 24673 - 184441 for o. -72 Solve -5946r + 837320 = 804r + 862r for r. 110 Solve 93933 = 304z - 63z + 89113 for z. 20 Solve -49315 = -123r - 52636 for r. -27 Solve 149v + 73v = -452v - 339v + 115482 for v. 114 Solve 383q + 366q - 822q + 1460 = 0 for q. 20 Solve -1535a + 2091a = 37808 for a. 68 Solve 24g - 534 - 745 = 65g - 254 for g. -25 Solve 7d + 34d + 19d - 2760 = 0 for d. 46 Solve -23q - 18q - 13q + 10864 = 7948 for q. 54 Solve 165603 = -3064h - 143861 for h. -101 Solve 781u + 335u = 26u - 39240 f	{ "pile_set_name": "DM Mathematics" }
t i = 20 - 23. Let t = 8 + i. Suppose -t = -q - 6. Are q and 0 nonequal? True Let v be (665/10)/(-7)-2. Let f be v4/(-12) - -4 - -1. Let r(y) = y*3 - 5y*2 - 2y + 9. Let p be r(5). Is f not equal to p? True Let q be (-10)/6(-5)/((-25)/(-315)). Let v = q + -106. Let a be (-6)/(-8) + v(1 + 0). Which is greater: a or -1? a Let h(d) = 2d2 + 36d - 487. Let w be h(9). Is -84/733 not equal to w? True Let m(n) = 66n3 - 18n*2 - 32n - 97. Let y be m(-3). Is y > -1939? False Suppose -104 = -4719h + 4721h. Let c(d) = -8d3 + 2d*2 + d. Let t be c(2). Which is smaller: t or h? t Let j = -134 - 88. Let p be 63/22(-740)/j. Which is bigger: 11 or p? 11 Let q = 7.3 - 5.3. Let i = -0.0295 - -3.3295. Which is greater: q or i? i Let p = -433.6 + 433.6. Is p less than 798? True Suppose 4k - 3k - 5f - 8 = 0, 4f = -k - 1. Let a(m) = -m + 21. Let z be a(13). Let b be 43/12 + (-2)/z. Which is bigger: k or b? b Let c = 12967 + -14933. Which is greater: -1968 or c? c Let s be 12/(-36) - 458/(-6). Suppose t - 113 = 2w, 3t - 2w = 263 + s. Which is smaller: t or 1/2? 1/2 Let a = -19608 - -19586. Is -0.4 != a? True Let v = 2.325 + 0.015. Let b = v + -5.34. Which is bigger: b or -0.43? -0.43 Let g = -636 - -817. Suppose -175n = -gn. Is -1/153 at least n? False Suppose -2 = z, -5p = -4p - z + 319. Which is smaller: p or -318? p Suppose 642t = 661t - 19. Which is smaller: -4/3723 or t? -4/3723 Suppose 0 = n + 8 - 5. Let y be (-1738)/2370 + (-4)/15. Is y <= n? False Let v be (4 + (-10)/3)(-4 + -2). Let t = 4525/8 + -566. Which is smaller: v or t? v Let t = -4124 + 3639. Which is greater: t or -3405/7? t Suppose -36426 = -31o - 47o. Is 468 != o? True Suppose -68q + 15652 = 3653 - 46345. Which is smaller: q or 862? q Let o = -220.51 + 222.57. Which is greater: o or -1/3? o Let x(z) = 1 - 12z - 4 + 15. Let c be x(1). Is c smaller than 1? True Suppose -1 - 4 = -5k. Let g be (-43/488)/(14 + -11). Is g bigger than k? False Let v = 0.54 + -0.3. Let z = 0.2 - v. Let f be (-2)/(-5) + (-1)/(-10). Which is greater: f or z? f Let f = -7035 - -597976/85. Is f at least as big as -0.52? True Let w = -15385 + 15462. Which is smaller: w or 20? 20 Let z = 133 + -131. Suppose 0i + 22 = zi. Is 56/5 at most i? False Let y = 278.21 - 292.9. Let i = 14.09 + y. Let r be ((-3)/(-6))/(1/1). Are r and i equal? False Let z be 2220946/185081 - 12/1. Is z <= 0? True Let u be ((-6)/(-4))/(36/3872) + 20/(-60). Which is smaller: u or 158? 158 Let l be -8 + (3 - 2) + -1. Let o(i) = i*3 + 6i*2 - 5i - 3. Let z be o(-6). Suppose -4t = -4p + t - 49, z = -2p + 3t. Is p > l? True Suppose 0 = g - 1, -88g = -4x - 92g + 8. Is x < 3/16760? False Let v = 3226 - 11266. Is -8040 at most v? True Let h be ((-21)/3 + 11)(-1010)/(-4). Is 1009 greater than or equal to h? False Let n be 520487/(-65054) - 40/(-5). Which is smaller: n or -1? -1 Let f = 22 + -109. Suppose 7167 = -100u - 1633. Is f at most u? False Let a be 8/(-276)-38/24. Let q(p) = -p3 - 4p*2 + 5p + 1. Let z be q(-5). Let l = z - 1. Which is bigger: l or a? a Let q = 17441 + -7451. Let t be ((q/63)/5)/(8/42). Which is smaller: t or 168? t Let w = -8026222/1495 + 69890/13. Let n = -37/5 + w. Let c = -51/115 + n. Are c and 1.5 nonequal? True Let t = -49 + 67. Suppose -27j = -33j + t. Let q be (j/10)/((-5)/(-40)-2). Is -2 < q? True Let a be (-6)/4(-8 + 10). Let d be 9a175/15. Let u be (-60)/(-72)(-12)/d. Is u < 1? True Let o = 1320 - 1319. Is -20 greater than or equal to o? False Let i = 1213.15067 - 0.15067. Which is bigger: i or 0? i Let t = -35104573311/2050846 + -12937525/2462. Let r = 22372 + t. Is r at least 0? False Let d be 25/(-10)(-60)/50. Suppose 0 = 5n + 5g - 55, -5n + 9 + 43 = 4g. Is n <= d? False Suppose -x - 3k - 177 + 549 = 0, x - k - 384 = 0. Are x and 3 nonequal? True Let l(y) = 47y - 70. Let o be l(8). Let g be (12/(-5))/(o/45 - 3). Is g > -1? True Let t be ((-2)/(-10))/(28/175)88/275. Which is smaller: t or -2670? -2670 Suppose 4c - 2a + 98 = 0, -a = 4c + 2950 - 2849. Is -1974/79 <= c? False Let t = 47.729 - 4.729. Is -2/5 at least as big as t? False Let p = 251915 + -2769031/11. Is p equal to 184? False Suppose -11s + 16s - 30 = 0. Suppose 2i = 3a + 19, 7 = -5i + 4a + 51. Is s < i? True Let m be (((-6)/(-13))/(4560/3705))/(38/8). Is -0.049 greater than m? False Let k be (-8 - 1748/(-133))/((-4)/(-42)). Is k smaller than 35? False Let l = 131.04 + -139.04. Which is smaller: -316/9 or l? -316/9 Let c be (41/(0 + -1))/((-4)/108). Suppose -2q - 5k = -c, 0 = -4q + 3k + 1860 + 419. Let l = q + -1783/3. Which is smaller: -29 or l? -29 Suppose 7f + 83 = 2i + 8f, 5f = -5. Suppose 4u = -2r + i, -4u + 3r + r = -12. Is 10 smaller than u? False Suppose -17f - 31233 = -3a - 20f, a = -5f + 10395. Which is greater: 31241/3 or a? a Let z be (-784)/(-3024)(-18)/(-21). Is z at most as big as 7/120? False Let k = 6.788 - 19.461. Let h = k - 0.227. Let b = -12 - h. Do b and 2/3 have the same value? False Let g(t) = 46t + 2530. Let v be g(-55). Which is bigger: v or 4906? 4906 Suppose 35067 = -36k - 14685. Which is smaller: -1385 or k? -1385 Suppose 4g = -v + 788, -773 = -v - 2g + 3g. Let y = v - 776. Is y at most 12/91? True Suppose -241 = -15t - 196. Is t bigger than 122/51? True Suppose 0 = 4f + 20v - 25v + 6765, 2v - 3382 = 2f. Let s = -999 - f. Is 690 > s? False Suppose 56a + 6532 = -15a. Suppose -2p + 4p = 902. Suppose i - 2q - 19 = -102, 5i = q - p. Is i at most a? False Let h(r) = 2r + 38. Let k be h(-18). Suppose -x = kd + 45, 3d + 0d + 92 = -2x. Let o = x + 48. Does -6/13 = o? False Let i(z) = 82z + 85. Let s be i(-1). Which is bigger: 47/13 or s? 47/13 Suppose -5d = -20, -t - 5d + 24 = -0t. Suppose -3r = k - 1 - t, 0 = -2r - 3k + 8. Does r = 8/31? False Suppose -6l + 345 + 2775 = 0. Let c be l/(-18) + -57 + 51. Is -34 less than c? False Let v be -5 + 25/(-5 + 10). Suppose v = -6m - 12 - 12. Let r be (m/6)/(-3 + (-16)/(-3)). Is -6 smaller than r? True Let y(k) = k*3 + 12k*2 - 5k - 51. Let j be y(-12). Let h be (-598)/234 + 6/j + -1. Which is smaller: -2 or h? h Let h = -47 - -53. Suppose 3m - h = -0. Suppose -mn + 76 = 80. Is n > -2? False Let g be (5/((-40)/(-12)))/(72/53376). Does 12222/11 = g? False Let u = -186 - -192. Let x be u/10(2/(-3))/1. Which is smaller: 1 or x? x Let w be 2950/(-30)(-9 - 3). Is w less than or equal to 1184? True Let o(d) = 364d2 - 25d - 52. Let g be o(-2). Is 1454 less than or equal to g? True Let a = -73 - -72. Let v be 2/16915/(-10)1. Which is greater: v or a? v Let j = 9049 + -8926. Is 46 greater than j? False Let m(a) = 65 + 49 + 159a - 173a. Let i be m(5). Is 1 smaller than i? True Let o = 3817265/39 + -97891. Are o and -12 unequal? True Let a be 4/14 - 68/14. Suppose -40 = 3p + 23. Let b be (p + 18)/((-1)/8-6). Which is smaller: a or b? a Suppose 0i = -5f + 4i + 178, 0 = -5f - 3i + 164. Suppose fo - 43o = -54. Is o > 11? False Let b = -29163 + 29164. Is 18/517 less than or equal to b? True Suppose 5h = 3o - 55 - 372, 0 = -3h - 6. Suppose 11t + 260 - o = 0. Which is greater: -38 or t? t Let l be 346/28 + (-640)/(-256). Does l = -2/11? False Let q = 52 + -53.6. Let c = -1.35 - q. Suppose 0 = -4v + 16, -j - 9 = -2j - 2v. Is j equal to c? False Let j be 5/10(6 + (-8862)/1505). Do j and 1 have different values? True Suppose -3q + w + 7 = 0, 2q - 4w = -w. Suppose y - 14 + 16 = -k, 2y + 5 = -qk. Which is bigger: 6/17 or k? 6/17 Let q = 0 + -0.1. Let o = 0.9 - q. Suppose -2r + 3z - 39 = -55, 5z + 29 = r. Which is greater: o or r? o Suppose 66m = 27881 + 29341. Is 863 greater than or equal to m? False Let q = 7742 + -7806. Do -1220/19 and q have the same value? False Let s = 61/201 + 2/67. Suppose -69x + 86x - 204 = 0. Let y be 18/22(88/x - 7). Which is smaller: y or s? y Suppose 0 = -46z + 21z - 3475. Is 7/3 equal to z? False Let l = -18 + 27. Let k = -193 - -404. Let r = 211 - k. Which is smaller: l or r? r Let d = 17 + -21. Let l be d/(-150)5/3. Let j(z) = z*3 + 14z*2 - 31z + 17. Let u be j(-16). Is l equal to u? False Let k be (-104/2)/(-16 - 10). Is -21 at least as big as k? False Let v be -3 - 34786(-2)/23192. Let c = v + -1519071/2899	{ "pile_set_name": "DM Mathematics" }
-4p - 3b + 8 = 0 for p. -1 Solve -a - b - 5 = -6a, a - 67 = -13b for a. 2 Solve 5z - 4h = -31, -5h = -z - 11461 + 11396 for z. 5 Solve -5l + 50 - 77 = 3u, -3l + 31 = -10u for l. -3 Solve -6k + 5l = 31, 21 = 111k - 112k + 4l for k. -1 Solve -650a - 25 = -5m - 648a, 2a = -3m + 31 for m. 7 Solve 29 = -3y + 5d, -11y + 33 = 2d - 3 for y. 2 Solve 3a + 20 = -4k, 184a - 5 = k + 183a for k. -5 Solve -160l + 161l - 5r - 9 = 0, r = 2l for l. -1 Solve 0 = 2s - 2k + 8, -3s + 84k + 36 = 89k for s. 2 Solve q - 3i = -4, 5q - 73i + 77i = -1 for q. -1 Solve 0 = 3q - 38b + 37b - 16, -7b = 4q - 13 for q. 5 Solve c = 3d - 2, 0 = 13c + 5c - 6d - 60 for c. 4 Solve 4b = 0, -4782b = 3h - 4777b + 15 for h. -5 Solve 5v + 43 = 8g, 2468g - 2464g = -2v + 26 for v. 1 Solve -3p + 17 = 2h + 2, -2h + 220 = -8p + 238 for h. 3 Solve 20 = -4b + 2k, 0 = 2k + 317 + 316 - 633 for b. -5 Solve 4u - 692x + 695x - 54 = 0, -2u = 3x - 48 for u. 3 Solve 5p + 3 = 3x, -4p - 1782x = -1779x - 3 for p. 0 Solve 4g = -20, -5g + 2488 - 2504 = -w for w. -9 Solve -5b - c = -21, -301b + 4c - 39 = -306b for b. 3 Solve 686h - 681h = 3j + 23, 0 = h - 2j + 5j - 1 for h. 4 Solve -a = -5i + 24, -3a = 298i - 302i + 17 for i. 5 Solve -5w + 2f - 3 = 0, 2w + w - 22f = -19f for w. -1 Solve 43w + 0c = 48w - c - 14, 2w - 5c + 22 = 0 for w. 4 Solve -x = -o - 0o + 4, -5 = 5o + 15 for x. -8 Solve 2w - 2r = 18, -9r + 6r - 51 = -5w for w. 12 Solve 3v - 9 = 273r - 276r, -2r = 4v - 10 for v. 2 Solve -3f = 4k - 834 + 819, 2k = -2f + 8 for f. 1 Solve 2t + 2 = l, -3t - 5l - 363 = -334 for t. -3 Solve 0 = 2t + 3g - 9, -t + 400 - 401 = -4g for t. 3 Solve 2731h - 4q = 2735h, 4q = 5h - 27 for h. 3 Solve 43y - 36 = 47y - 4r, 2y - 6 = -6r for y. -6 Solve -5z - 228j + 85 = -232j, 0 = -4z + 4j + 72 for z. 13 Solve -k - 5841a + 5843a = -9, 0 = -2k + a + 9 for k. 3 Solve 99d - 2 = 98d - 2l, 0 = 8l + 7 - 31 for d. -4 Solve g = 7f - 23, 0 = 2g - 2383f + 2385f - 2 for g. -2 Solve 27 = -285o + 286o - 8d, 0 = 2o + 5d + 30 for o. -5 Solve 2q + 1 = 3w, w - 3 = 2w for q. -5 Solve 15 = 2g + 7, 30 = 5h - 5g for h. 10 Solve -u = 6, 10x + 2u = 6x + 8x for x. -3 Solve 0 = -4g + 2q + 1116 - 1090, 0 = 4g + 3q - 1 for g. 4 Solve 12 = 4l - 2j, 4l - 1980 = -4j - 1968 for l. 3 Solve -44k - 65 = -51k + 5m, -2k + 5m = -15 for k. 10 Solve 4a = -3x + 48, 168x + 32 = 170x + 3a for x. 16 Solve -5j + 4v + 41 = 0, 644j - 649j - v + 21 = 0 for j. 5 Solve -4s + 17 = -3x, 4s = -12x - 71 - 77 for s. -4 Solve i - 5 - 3 = -3k, -4k + 4i = -5i + 13i for k. 4 Solve 43 = -5c - 2a, 18a = 3c + 17a + 17 for c. -7 Solve -3b + 1086j + 51 = 1081j, 2b = -j - 5 for b. 2 Solve 4t - 2f = 18, -24t - 3f - 24 = -29t for t. 3 Solve 9798v + 5w = 9793v - 15, -v + 1 = -w for v. -1 Solve 0 = z + 4, 5s - 53 = -6z - 97 for s. -4 Solve 0 = -3c, -31c + 24 = 4f - 27c for f. 6 Solve 86 - 58 = 3c + 4j, -c + 5j - 16 = 0 for c. 4 Solve -568h + 3 = -571h - 2j, 1 = -h - 5j for h. -1 Solve 30 = 3r - b + 8, r - 4 = b for r. 9 Solve 2c + 2c + 70 = -5b, -b = -3c - 5 for c. -5 Solve 2s - 7 = -9r + 10r, s = 3r + 11 for s. 2 Solve -2z = 3u - 11, -10z + 5u = -z - 68 for z. 7 Solve 3p + 8 = -4n, -3p + 67n + 8 = 63n for p. 0 Solve -8 = -r + b, 516r - 511r - 3b - 30 = 0 for r. 3 Solve -3o = d - 8, -119o + 115o + 15 = -3d for o. 3 Solve 0 = 9j - 23c + 29c + 24, 0 = 5j - 3c + 45 for j. -6 Solve 2p = 5r - 6, -r - 155p + 6 = -157p for r. 0 Solve 129 = -4m - 11a, -407 = 2m + 4a - 359 for m. -2 Solve -5p - 21 = -18k, 2p - 116k = -120k + 14 for p. 3 Solve 3r = -5y + 44, 14y - 25r - 40 = -23r for y. 4 Solve -4n + 4z = -12, 0 = 1526z - 1522z for n. 3 Solve -2p + 1 = y, -40414p + 22 = -40410p - 2y for p. 3 Solve 14c - 37 = -11658g + 11655g, 5c + 5 = 5g for g. 3 Solve -3o - 341 + 335 = 0, 0m + 2m - 10 = 3o for m. 2 Solve 5v + 229f = 232f + 48, -5v + 84 = 6f for v. 12 Solve -9w = -5w - 3n + 13, -16 = w - 5n for w. -1 Solve -g - 2a = -0a + 5, -11 = -734g + 735g + 5a for g. -1 Solve -2i = 4k - 146 + 158, 5i + 18 = -7k for k. -4 Solve -18a = -2y - 17a, -5y + 5a = 0 for y. 0 Solve 4t - 87 = -75w, 0 = -4w - 2t + 23 - 13 for w. 1 Solve 31t - 28t - u = 4, 4t - 16 = 4u for t. 0 Solve 0 = 4s + 86x - 81x + 9, 3x = 5s - 35 for s. 4 Solve -130j + 128j + 20 = -3d, 10j = -3d + 100 for d. 0 Solve -d = 5l - 12, -21 = -3l + 16d - 12d for l. 3 Solve 232t - 228t + 4b - 16 = 0, 2t - 43 = -9b for t. -1 Solve -1 = -5j + q, 7j - 3j + 8 = -8q for j. 0 Solve 1956s = 1951s - 5r + 15, -5r = s + 13 for s. 7 Solve -1 = 6h + 5r, -5h - 87r = -89r + 7 for h. -1 Solve -2 = 2m, -3m + 2 = 69u - 64u for u. 1 Solve -5a + 4c + 48 = 0, -8 = 2a + 3c + 5 for a. 4 Solve -5c = 3u + 10, -1094u + 9 = 4c - 1095u for c. 1 Solve -54s - 18 = 2y - 56s, -3s = 3y - 3 for y. -4 Solve n = 3b - 9, -117n + 115n = 3b - 18 for b. 4 Solve 4g = 2g - 10, -4x + 4g = -56 for x. 9 Solve 5m - 54 = 5s - 59, 3s + 13 = -m for m. -4 Solve 7w - 3330q + 3325q - 45 = 0, -3w + 7 = 4q for w. 5 Solve -5d = -5t - 40, 2d + 53005 = -2t + 53029 for d. 10 Solve 4x = 12, 162z = 159z + x + 3 for z. 2 Solve -61r + 2w = -65r + 20, 6w = 2r + 8w - 8 for r. 6 Solve 619 = -5m + 4f + 639, -3f = -3m + 18 for m. -4 Solve 3a = -2j, -113a + 108a - 4j + 6j = 0 for a. 0 Solve -82k - 571 = v, 2v - 5k = 25 + 16 for v. 3 Solve -3m + 7 + 59 = 0, -53 = -3g - 2m - 9 for g. 0 Solve -h = 6t + 1002 - 985, -5t - 15 = 0 for h. 1 Solve -50j + 52j = -s - 20, -s - 17 = 5j for j. 1 Solve 0 = g - 4u + 37, 3g - 68u = -69u - 59 for g. -21 Solve w + 4m + 1 = 0, 2 = -w - 20613m + 20608m for w. 3 Solve 3p = -y + 18, 40p - 44p + 10y - 10 = 0 for p. 5 Solve 107j - 103j - 3 = -5t, -2t - 10 = -4j for j. 2 Solve -13 = 5i - 4x, -2x = -4i - 126 + 112 for i. -5 Solve 5d - 84 = -3a, -33 = -2d + 2a - 9 for d. 15 Solve -s + 74k - 76k = -1, -4s - 3k = -4 for s. 1 Solve -3 = 5w + n + 2, 3w + 4n - 14 = 0 for w. -2 Solve 0 = j + 5k - 261 + 258, -10 = 4j - 2k for j. -2 Solve 0 = -v - 21g + 26g + 27, 3g - 23 = -5v for v. 7 Solve -138r + v - 8 = -139r, 4v = 8 for r. 6 Solve 3o + 17 + 0 = -2b, 0 = 4o + 4b + 36 for o. 1 Solve 29a - 58 = -2i + 19a, 0 = -4a + 24 for i. -1 Solve u - 20509o + 20507o + 6 = 0, 5o + 199 = -51u for u. -4 Solve t = -3g - 7, -3016g + 3015g - t = 1 for g. -3 Solve -126u + 4 = -125u + 2v, -5u = 5v - 10 for u. 0 Solve b + 235x + 3 = 233x, 3b = x - 16 for b. -5 Solve m - 4 = -4q + 15, 2q + 54m - 27 = 51m for q. 3 Solve -3c - 7 = -2a, -11c + 10c - 91a + 361 = -19a for c. 1 Solve 0 = -3c + 5x - 11, -c - 2637x + 2639x - 4 = 0 for c. -2 Solve 5t - 17 = -3b + 5, 5t - b - 6 = 0 for t. 2 Solve 5b = 4i + 17, 3b + 1602 = 3i + 1614 for i. -3 Solve m + 7u + 23 = 0, 3m = -5u + 7 - 12 for m. 5 Solve 0 = 4i + d - 12, 2d + 13 = -4i + 21 for i. 4 Solve 0 = -2c - 5j - 79, 2j + 26 = -228c + 230c for c. -2 Solve -4a = 34v - 16v + 440, -5v = 3a + 126 for a. -2 Solve 18 = 4i - 2z, 2i - 22z - 6 = -24z for i. 4 Solve 11l = -9g + 16l + 76, 46 = 5g - 3l for g. -1 Solve -39 = -5l - 4t - 11, 2l - 7t = -6 for l. 4 Solve -2z - 12 = 518v - 516v, 9 = -2z + v for z. -5 Solve -3x + 20a + 8 = 15a, -5a = -4x + 4 for x. -4 Solve -8v - 9v = -5t - 16v + 11, 2 = -t - 4v for t. 2 Solve -9439u - 10 = -2h - 9444u, -2h + 4u - 8 = 0 for h. 0 Solve w + 3n - 7n = -9, 0 = -5w + 22n - 47 for w. -5 Solve 2b - 26x - 7 = -31x, 0 = -3x + 3 for b. 1 Solve -741c + 736c = 25, -c - 8 = -3l for l. 1 Solve 5s = 5d + 50, -163d + 5 = s - 159d for s. 9 Solve 2y + 3340h - 3335h = -21, -47 = 4y + 5h for y. -13 Solve -3c + 111z = 106z + 55, -35 = 4c + z for c. -10 Solve 0 = -h + 14, -18o + 23o = 5h - 85 for o. -3 Solve -7i = -2y + 37, 108i - 106i + 6 = -4y for y. 1 Solve -32x - 16 = -54x + 19x - 5w, 3x + 3w - 24 = 0 for x. 12 Solve -7o - p = -2p + 40, 3o + 4p + 4873 = 4878 for o. -5 Solve -j = -3, 43*z -	{ "pile_set_name": "DM Mathematics" }
-6261i2 + i - 151 What is the u'th term of -3609, -10751, -22659, -39333, -60773, -86979, -117951? -2383u*2 + 7u - 1233 What is the a'th term of 29131, 34196, 39261, 44326, 49391, 54456? 5065a + 24066 What is the o'th term of 222, -4849, -13300, -25131, -40342, -58933, -80904? -1690o*2 - o + 1913 What is the p'th term of 108159888, 216319775, 324479662, 432639549, 540799436, 648959323? 108159887p + 1 What is the v'th term of 241, 736, 1569, 2746, 4273, 6156? v*3 + 163v2 - v + 78 What is the f'th term of -5157, 2408, 15005, 32628, 55271? -f3 + 2522f2 + 6f - 7684 What is the w'th term of -20261401, -40522797, -60784193, -81045589, -101306985? -20261396w - 5 What is the o'th term of 19179, 32225, 45271, 58317, 71363, 84409? 13046o + 6133 What is the z'th term of 77433, 309712, 696835, 1238796, 1935589, 2787208, 3793647? -z*3 + 77428z*2 + 2z + 4 What is the s'th term of 2692, 5350, 7936, 10414, 12748, 14902, 16840? -6s3 + 2700s - 2 What is the h'th term of -23679, -49382, -75085? -25703h + 2024 What is the g'th term of -10910, -10839, -10754, -10649, -10518, -10355, -10154, -9909? g3 + g2 + 61g - 10973 What is the v'th term of -45672774, -45672784, -45672794, -45672804? -10v - 45672764 What is the g'th term of 11600, 46396, 104382, 185558, 289924? 11595g*2 + 11g - 6 What is the t'th term of -625, -2380, -5231, -9166, -14173, -20240, -27355? 2t3 - 560t*2 - 89t + 22 What is the x'th term of 21497, 42990, 64545, 86192, 107961? 5x3 + x2 + 21455x + 36 What is the b'th term of 37, 398, 1135, 2362, 4193, 6742? 19b3 + 74b*2 + 6b - 62 What is the q'th term of -6487, -6161, -5835, -5509, -5183, -4857? 326q - 6813 What is the d'th term of 362290207, 362290204, 362290199, 362290192? -d2 + 362290208 What is the a'th term of 49183, 49323, 49463, 49603, 49743? 140a + 49043 What is the n'th term of 1251768, 2503548, 3755330, 5007114, 6258900, 7510688? n*2 + 1251777n - 10 What is the r'th term of -5825831, -5825829, -5825825, -5825819? r*2 - r - 5825831 What is the d'th term of -3040, -6484, -10646, -15526? -359d*2 - 2367d - 314 What is the y'th term of -109255, -204932, -300609, -396286? -95677y - 13578 What is the x'th term of 161715, 646874, 1455473, 2587512, 4042991? 161720x2 - x - 4 What is the n'th term of -39848, -79421, -118996, -158573? -n2 - 39570n - 277 What is the t'th term of -68548, -137102, -205652, -274198? 2t*2 - 68560t + 10 What is the o'th term of 3216210, 3216028, 3215846, 3215664? -182o + 3216392 What is the o'th term of -1936, -1866, -1616, -1096, -216, 1114, 2984? 15o*3 - 35o - 1916 What is the n'th term of 4873951, 4873965, 4873979? 14n + 4873937 What is the u'th term of -9268, -10920, -13672, -17524, -22476? -550u*2 - 2u - 8716 What is the v'th term of -5666, -14377, -26134, -40937, -58786, -79681, -103622? -1523v2 - 4142v - 1 What is the w'th term of 147658, 295320, 442956, 590554, 738102, 885588? -2w3 - w2 + 147679w - 18 What is the g'th term of -18897, -20658, -22419, -24180, -25941? -1761g - 17136 What is the x'th term of -2018318, -4036649, -6054992, -8073347, -10091714, -12110093? -6x*2 - 2018313x + 1 What is the o'th term of -78980081, -78980084, -78980087? -3o - 78980078 What is the r'th term of -5032, -10136, -15318, -20578, -25916? -39r*2 - 4987r - 6 What is the x'th term of -12913, -13440, -13983, -14542, -15117? -8x2 - 503x - 12402 What is the r'th term of 587, 732, 987, 1370, 1899? 3r3 + 37r*2 + 13r + 534 What is the m'th term of 2659, 10889, 24729, 44173, 69215, 99849? -m*3 + 2811m*2 - 196m + 45 What is the m'th term of 2465, 5675, 10395, 17381, 27389, 41175? 126m3 - m2 + 2331m + 9 What is the q'th term of -138875, -279587, -420299, -561011, -701723? -140712q + 1837 What is the t'th term of 3411, 4292, 7021, 12522, 21719, 35536, 54897, 80726? 154t*3 - 197t + 3454 What is the i'th term of 31250, 31044, 30838, 30632, 30426? -206i + 31456 What is the n'th term of -39596, -74389, -109182? -34793n - 4803 What is the o'th term of -197997, -396276, -594555? -198279o + 282 What is the q'th term of 76744, 75893, 75042, 74191, 73340, 72489? -851q + 77595 What is the k'th term of -2166497, -4332987, -6499481, -8665979, -10832481, -12998987? -2k2 - 2166484k - 11 What is the h'th term of -17630055, -17630057, -17630059, -17630061, -17630063? -2h - 17630053 What is the f'th term of -6826, -13663, -20488, -27301? 6f*2 - 6855f + 23 What is the y'th term of -312504, -312500, -312496? 4y - 312508 What is the o'th term of 1994, 3050, 4270, 5660, 7226, 8974, 10910? o3 + 76o*2 + 821o + 1096 What is the x'th term of 33738, 33910, 34082, 34254, 34426, 34598? 172x + 33566 What is the g'th term of -8794953, -8794963, -8794973, -8794983, -8794993? -10g - 8794943 What is the w'th term of -45923513, -91847029, -137770545, -183694061, -229617577? -45923516w + 3 What is the f'th term of -1332, -2656, -3978, -5298? f2 - 1327f - 6 What is the v'th term of 86365, 86319, 86271, 86221, 86169, 86115, 86059? -v*2 - 43v + 86409 What is the y'th term of 8029, 32053, 72085, 128137, 200221, 288349, 392533? 2y3 + 7992y*2 + 34y + 1 What is the j'th term of -106, -2098, -5496, -10300, -16510, -24126, -33148? -703j2 + 117j + 480 What is the j'th term of -8230, -8290, -8350, -8410, -8470? -60j - 8170 What is the n'th term of 1921136, 3842264, 5763392, 7684520, 9605648? 1921128n + 8 What is the z'th term of -13388, -27991, -42582, -57155, -71704? z*3 - 14610z + 1221 What is the d'th term of -1777, -1915, -2149, -2485, -2929? -d*3 - 42d*2 - 5d - 1729 What is the s'th term of 14966, 59907, 134820, 239705, 374562, 539391, 734192? 14986s2 - 17s - 3 What is the n'th term of -35, 394, 1885, 5038, 10453? 100n3 - 69n*2 - 64n - 2 What is the t'th term of -2005, -7647, -17053, -30223? -1882t2 + 4t - 127 What is the t'th term of -135, -598, -1275, -2166, -3271, -4590? -107t2 - 142t + 114 What is the g'th term of -7164159, -14328342, -21492525? -7164183g + 24 What is the v'th term of 112719, 100208, 87685, 75144, 62579, 49984, 37353, 24680? -v3 - 12504v + 125224 What is the n'th term of -81997, -81924, -81851? 73n - 82070 What is the i'th term of -38292, -149182, -333998, -592740, -925408, -1332002, -1812522? -36963i*2 - i - 1328 What is the w'th term of 3714, 14765, 33092, 58695? 3638w*2 + 137w - 61 What is the m'th term of -19652, -78412, -176348, -313460, -489748, -705212? -19588m2 + 4m - 68 What is the n'th term of -13433, -24983, -36533, -48083, -59633, -71183? -11550n - 1883 What is the w'th term of 2091119, 2091143, 2091185, 2091245, 2091323, 2091419, 2091533? 9w*2 - 3w + 2091113 What is the i'th term of -584627, -1169753, -1754889, -2340041, -2925215, -3510417, -4095653? -i3 + i2 - 585122i + 495 What is the t'th term of 6940206, 6940244, 6940280, 6940314, 6940346? -t2 + 41t + 6940166 What is the z'th term of -97, -437, -1025, -1879, -3017, -4457, -6217, -8315? -3z3 - 106z2 - z + 13 What is the i'th term of 450799, 901570, 1352305, 1802998, 2253643, 2704234? -i3 - 12i2 + 450814i - 2 What is the k'th term of 50156245, 100312491, 150468737? 50156246k - 1 What is the r'th term of 196, 497, 898, 1387, 1952, 2581? -2r*3 + 62r*2 + 129r + 7 What is the k'th term of 61867752, 61867754, 61867756, 61867758? 2k + 61867750 What is the v'th term of 338274, 676458, 1014632, 1352796, 1690950, 2029094? -5v*2 + 338199v + 80 What is the o'th term of 20946, 83884, 188776, 335616, 524398, 755116, 1027764, 1342336? -o*3 + 20983o*2 - 4o - 32 What is the w'th term of 69, 97, 109, 105, 85? -8w2 + 52w + 25 What is the z'th term of -170512, -170514, -170516, -170518, -170520, -170522? -2z - 170510 What is the c'th term of -811375, -811820, -812555, -813574, -814871, -816440, -818275, -820370? c3 - 151c*2 + c - 811226 What is the y'th term of 549305, 549582, 549859, 550136, 550413? 277y + 549028 What is the m'th term of 70764988, 141529962, 212294936, 283059910, 353824884? 70764974m + 14 What is the a'th term of -31765, -63665, -95623, -127669, -159833, -192145, -224635, -257333? -5a3 + a2 - 31868*a + 107 What is the a'th term of -9301, -37166,	{ "pile_set_name": "DM Mathematics" }
vbb. Give prob of sequence fbb. 1/12 Calculate prob of sequence ltii when four letters picked without replacement from litfiim. 1/140 Four letters picked without replacement from {f: 1, g: 7, x: 5, j: 1, z: 5}. Give prob of sequence xfzz. 25/23256 Three letters picked without replacement from qqygkyq. Give prob of sequence qkq. 1/35 Two letters picked without replacement from izy. Give prob of sequence yi. 1/6 Calculate prob of sequence efff when four letters picked without replacement from ehcfhfefahtfeh. 3/1001 What is prob of sequence kfk when three letters picked without replacement from kkkqqfkq? 1/28 What is prob of sequence st when two letters picked without replacement from {r: 4, s: 1, t: 1, l: 1, v: 2}? 1/72 Calculate prob of sequence qbbx when four letters picked without replacement from {b: 10, o: 1, x: 2, q: 1, u: 3}. 3/952 Two letters picked without replacement from {o: 1, d: 2, n: 1, f: 1, h: 2}. What is prob of sequence hd? 2/21 Four letters picked without replacement from {s: 11, d: 1}. Give prob of sequence sdss. 1/12 Two letters picked without replacement from bllhslgllllgggl. Give prob of sequence hg. 2/105 What is prob of sequence ibbh when four letters picked without replacement from hhiihhbbbhbbhbh? 1/78 Three letters picked without replacement from nnwannwnnww. Give prob of sequence aww. 2/165 Calculate prob of sequence zfer when four letters picked without replacement from rezezbeeefzrerfr. 3/910 Three letters picked without replacement from ffsfzefzsssffezfze. Give prob of sequence zff. 7/204 Four letters picked without replacement from {b: 1, n: 18}. Give prob of sequence bnnn. 1/19 What is prob of sequence yd when two letters picked without replacement from ddyddyddtdt? 7/55 Calculate prob of sequence hum when three letters picked without replacement from uqphm. 1/60 What is prob of sequence oddo when four letters picked without replacement from qodotoodoqooooveveee? 2/1615 Three letters picked without replacement from {n: 1, a: 1, z: 2, d: 1}. What is prob of sequence adz? 1/30 Calculate prob of sequence ypty when four letters picked without replacement from {y: 5, g: 5, p: 4, t: 6}. 4/969 What is prob of sequence dll when three letters picked without replacement from bmbdsldlbsblssbdsd? 1/204 What is prob of sequence iqa when three letters picked without replacement from iwqqviiwibwia? 5/858 What is prob of sequence pa when two letters picked without replacement from {a: 2, j: 2, t: 7, p: 1, i: 7}? 1/171 Calculate prob of sequence uuc when three letters picked without replacement from {u: 2, c: 2}. 1/6 Three letters picked without replacement from emiiameiaaiiaiiam. What is prob of sequence aia? 7/204 What is prob of sequence sivv when four letters picked without replacement from wwdwwwwiiwsibvvwd? 1/9520 What is prob of sequence wus when three letters picked without replacement from {s: 3, w: 1, g: 1, p: 1, u: 5, m: 1}? 1/88 What is prob of sequence qpt when three letters picked without replacement from tthttpptqhtt? 7/660 Two letters picked without replacement from {w: 2, j: 1, o: 7, q: 8}. What is prob of sequence qw? 8/153 Four letters picked without replacement from {f: 8, j: 3, d: 7, q: 2}. What is prob of sequence qjdf? 14/4845 Three letters picked without replacement from nenpeeeen. What is prob of sequence nne? 5/84 Calculate prob of sequence dsmd when four letters picked without replacement from {s: 1, m: 1, d: 3}. 1/20 What is prob of sequence xx when two letters picked without replacement from {y: 9, x: 9}? 4/17 What is prob of sequence oyyo when four letters picked without replacement from {o: 3, y: 9}? 2/55 What is prob of sequence ylss when four letters picked without replacement from {y: 3, l: 2, d: 10, s: 3}? 1/2040 Three letters picked without replacement from {v: 3, w: 13, a: 3}. What is prob of sequence vav? 1/323 What is prob of sequence ty when two letters picked without replacement from {v: 1, t: 2, l: 3, w: 4, y: 4}? 4/91 Three letters picked without replacement from {j: 12, h: 3}. What is prob of sequence jhj? 66/455 Three letters picked without replacement from izzfqrf. What is prob of sequence ffr? 1/105 Two letters picked without replacement from sppsppppspppps. Give prob of sequence ss. 6/91 Three letters picked without replacement from vvovokkrvvov. Give prob of sequence kkv. 1/110 Four letters picked without replacement from hbehuhbhhhhuhbhhuu. Give prob of sequence ubeh. 1/612 Three letters picked without replacement from aqxrrqagrquq. What is prob of sequence arx? 1/220 Calculate prob of sequence qcix when four letters picked without replacement from {x: 3, q: 6, i: 2, c: 4}. 2/455 Four letters picked without replacement from ppmjvjvgxpj. Give prob of sequence vvgj. 1/1320 Two letters picked without replacement from xhxoxxxxx. Give prob of sequence oh. 1/72 What is prob of sequence bab when three letters picked without replacement from aaahbaabbaaaaaaabaab? 7/171 Three letters picked without replacement from {c: 11, b: 5}. Give prob of sequence cbb. 11/168 Two letters picked without replacement from iaiaiiarracipaeeer. What is prob of sequence ac? 5/306 Calculate prob of sequence ytzz when four letters picked without replacement from {t: 4, y: 1, l: 2, z: 2}. 1/378 Calculate prob of sequence ybyb when four letters picked without replacement from {y: 11, b: 7, d: 1}. 385/7752 What is prob of sequence cpc when three letters picked without replacement from cccppcpc? 5/28 Two letters picked without replacement from qooorqooqr. Give prob of sequence or. 1/9 What is prob of sequence hhhc when four letters picked without replacement from {c: 5, h: 14}? 455/3876 Three letters picked without replacement from yttjtyttttjttttttytt. What is prob of sequence yyt? 1/76 Calculate prob of sequence buuq when four letters picked without replacement from qffiffuqiqiiub. 1/4004 Two letters picked without replacement from nuogkron. What is prob of sequence rk? 1/56 Three letters picked without replacement from {k: 15, w: 3}. What is prob of sequence kkw? 35/272 Three letters picked without replacement from {m: 1, t: 3, v: 5}. What is prob of sequence mvt? 5/168 Three letters picked without replacement from pwsspss. What is prob of sequence psw? 4/105 Calculate prob of sequence oq when two letters picked without replacement from {y: 2, o: 1, s: 1, c: 4, q: 1}. 1/72 Two letters picked without replacement from aahaaahhaahiq. What is prob of sequence ah? 7/39 Four letters picked without replacement from eeyykkkfehyiykiff. What is prob of sequence eefy? 3/2380 Two letters picked without replacement from huuuduuduwhfuhhhhud. What is prob of sequence wh? 1/57 Two letters picked without replacement from xbqeqih. What is prob of sequence xh? 1/42 Four letters picked without replacement from yyyyykyyyyyyyyyykkyy. What is prob of sequence kkky? 1/1140 Four letters picked without replacement from {d: 2, l: 1, u: 4}. Give prob of sequence udlu. 1/35 Three letters picked without replacement from llllll. What is prob of sequence lll? 1 Two letters picked without replacement from {e: 1, w: 1, c: 3, l: 3, a: 1, p: 2}. What is prob of sequence pc? 3/55 Calculate prob of sequence uro when three letters picked without replacement from oortwouottrorwo. 3/455 Calculate prob of sequence iwt when three letters picked without replacement from {y: 2, q: 2, w: 3, t: 4, i: 1}. 1/110 Two letters picked without replacement from ihihagdasaii. Give prob of sequence id. 1/33 Three letters picked without replacement from ezezrzrzenzssrznzzz. Give prob of sequence ezn. 3/323 Two letters picked without replacement from {a: 3, c: 2}. Give prob of sequence cc. 1/10 Two letters picked without replacement from {e: 1, q: 1, n: 1}. What is prob of sequence nn? 0 Four letters picked without replacement from {z: 2, u: 3, i: 2, t: 1, o: 4, y: 2}. Give prob of sequence ztzu. 1/4004 Three letters picked without replacement from fddffdkdfffff. What is prob of sequence kdf? 8/429 What is prob of sequence ivv when three letters picked without replacement from vkikvkv? 1/35 Calculate prob of sequence xp when two letters picked without replacement from dpngnpnndx. 1/45 What is prob of sequence naa when three letters picked without replacement from	{ "pile_set_name": "DM Mathematics" }
ositive. w(-1703/1155) Simplify (p18p)(-2/35)p(-2/41)/p(-19) assuming p is positive. p(25637/1435) Simplify (t14tt14)/((t/t(1/4))/(tt/(t1tt)t)) assuming t is positive. t*(113/4) Simplify (mm/m*(-1/8)m/m(2/37))/(m(2/9))(-1/26) assuming m is positive. m(106649/34632) Simplify ((rr9)/(rr/r*0))/(rr(r/((r/(rr/r*(-19)r))/r))/rrrr(2/33)) assuming r is positive. r(-596/33) Simplify (g(2/65)g*(-11/6)/gg)/(g2)47 assuming g is positive. g(-37363/390) Simplify (r(-11/5)/rr(rrr/r*(-15/8)r)/rr)/((rr*(-25))/(((rr(1/2))/r)/r)) assuming r is positive. r(1087/40) Simplify (m/m*(-23/5)(mm/m(-2/93))/m)3 assuming m is positive. m(3079/155) Simplify (v/(v/(v13v))v26)/(v14vv(-1/5)) assuming v is positive. v(126/5) Simplify cc*9(c*(-1/5)/c)/cc(-1)/c0 assuming c is positive. c(34/5) Simplify ((j(1/4))(-20)/((j(-7)/j)/j11))(7/5) assuming j is positive. j*(98/5) Simplify (j/(jj/(j(-5/6)/j)))32/(j(-1/11)/j)(-2/65) assuming j is positive. j*(-194552/2145) Simplify ((zz*(-3/4)z/(zz(-1/3)))39)(1/4) assuming z is positive. z(91/16) Simplify ((i(-1/2))(-16)i(iii6/i)/iii/(i/((i(i/i1)/i)/i)))(4/3) assuming i is positive. i*20 Simplify (fffff(-37)fffff)/ffff(-19)(f/f(-2/37))8 assuming f is positive. f(-1390/37) Simplify (w/w(-1)w)(-2/45)/(w(-5/2))(1/4) assuming w is positive. w(59/120) Simplify ((z/(zz*13)zz(-1/2))(-17))(-10/9) assuming z is positive. z(-2125/9) Simplify ((vv*(-2))/vv)*(-38)(v/(vv(-2/21)))/(v5v) assuming v is positive. v(674/21) Simplify ((l(1/8)l)(-16))(-21/8) assuming l is positive. l(189/4) Simplify ((w/(ww3))(-33))21 assuming w is positive. w2079 Simplify (c/(c*1c)cc*(-1/10)(c(cc(c/(c/c(-2/7)))/c)/c)/c(-5))32 assuming c is positive. c(6288/35) Simplify ((bb/b*(7/3))/(bb*(-2/5)))/((bb*(11/2)b)/b(bb*(2/11)b)/b) assuming b is positive. b(-2843/330) Simplify (i(-1)ii(-3))/(i12/(i*(-4/3)i)) assuming i is positive. i(-46/3) Simplify ((t9t3)/((t/(t3t))/(t/(ttt*(-4)tt)t)))(1/3) assuming t is positive. t(17/3) Simplify ((d*(4/9)dd(-3))/((d1d)/d)(-17))(-13) assuming d is positive. d*(-1807/9) Simplify (aa/(a*(3/5)a)a(-1/32))/(a/a10)(1/4) assuming a is positive. a(419/160) Simplify m22/m(-11/2)m*(2/17)mm/(m/((m/m(4/7))/m))m assuming m is positive. m(6913/238) Simplify (j/j15j(1/11))/(j20)5 assuming j is positive. j(-1253/11) Simplify (b(b*39b)/bb(-42)/bb)*(-1/4) assuming b is positive. sqrt(b) Simplify ((l/((l(l*(1/17)/l)/l)/l))/ll(ll(2/5)/l)/l)/(l/l(-2/3))(2/15) assuming l is positive. l(1621/765) Simplify (i*(3/7)iiii/(i(i/(ii/i(-10)))/i)i)/(i/i*2i)29 assuming i is positive. i(115/7) Simplify ((c/((c(-2/7)/c)/c))(-9/4))(3/13) assuming c is positive. c(-621/364) Simplify ((w/w*(4/5))/(ww*(-2/41)w))/((w*(2/27)w)/w)(-3/37) assuming w is positive. w(-119137/68265) Simplify (u/(uuu/u*(-2)))/uuu(-14)((u/(uu(-2/25)/u))/u)/(uu*(-4/7)u) assuming u is positive. u*(-3386/175) Simplify (mm/(m*(-1/14)/mm))/mm/m(12/7)(m*(-2/13)m)(5/8) assuming m is positive. m(645/728) Simplify (a*23/aa)/(a/a*(-11))(a(9/7)/a)(-1/20) assuming a is positive. a(769/70) Simplify (b(-2/27)/b(8/3))/(b(-14)bb)3 assuming b is positive. b(898/27) Simplify (b(-5/8)/((b5b)/b))/(b/b(-5/2))28 assuming b is positive. b(-829/8) Simplify ((x8/x)/x(-8))/(x(-4)xx(-11)) assuming x is positive. x29 Simplify (mm(-2))(3/13)/(m/((mm(3/2))/m)mm((mm/(m/m7)m)/m)/m) assuming m is positive. m*(-227/26) Simplify (jjj4/jj)(1/26)/(j/j(-3))(-19) assuming j is positive. j(991/13) Simplify ((f(f/(f/(f/(((ff/f*(-3/8)ff)/f)/f))))/ff)/(f/((ff14f)/f)))/(f*(-1/3)/f(f/f14)/f) assuming f is positive. f(695/24) Simplify l(-7)/(l(5/6)l)(l1)31 assuming l is positive. l(133/6) Simplify (t/((t/t(-15)t)/t)ttt(2/13))/(((t27t)/t)/(t/((t/(t(tttt(2/13)tt)/t))/t))) assuming t is positive. t(-438/13) Simplify ((pp*(-1/3))/pp*(2/5)/p)/((pp(5/3))/p(-11)) assuming p is positive. p(-73/5) Simplify (r(-6)r(-27)rr)(-30) assuming r is positive. r930 Simplify (i/(ii*0i))(-37)/(i1)(-34) assuming i is positive. i71 Simplify cc4c*(-14)/c(c*20ccc)/c6 assuming c is positive. c7 Simplify (v/((vv(-1/7))/vv))/((vv(-1/24))/v)(v/((vv(3/5))/v))(2/77) assuming v is positive. v(1801/9240) Simplify (a(-5)aaaaa)*(-6)(a/(a/((a/(aa(4/3)))/a)))(-25) assuming a is positive. a(175/3) Simplify (f(1/12))(-42)(f/((fff/f(-9))/f))/f(-10) assuming f is positive. f(-7/2) Simplify o(-1/5)oo*(-6/7)/o(o(oo*(-4)/oo)/oo)/oo(-14) assuming o is positive. o(-632/35) Simplify ((p(-1/4))(-43)(p(pp(-6)ppp)/p)/(p/(p(-1)/p)))3 assuming p is positive. p(69/4) Simplify (s(-7)ss*2(s(-1/4))28)(-2/11) assuming s is positive. s2 Simplify ((z/z*(-1/6)z(-2/9))(-7))(37/5) assuming z is positive. z(-4403/90) Simplify ((p(-18))(-34))3 assuming p is positive. p1836 Simplify (p(3/2)/p)(-34)(p(-2/11)/p)(-31) assuming p is positive. p(216/11) Simplify v(-1/3)vv15v*(-10)v/(v/v*(3/11)v) assuming v is positive. v*(163/33) Simplify (yy*(-12)/yy(-7/2))/(y(7/5)y(y/(y/(yyy/y*(-8)y)))/y) assuming y is positive. y*(-289/10) Simplify ((bb*(-9))/b)/bb/(b/b*(-2/7))(b*(-4/5)b)/(bb2) assuming b is positive. b(-458/35) Simplify (k4)(2/79)/(kk(4/9))(-48) assuming k is positive. k(16456/237) Simplify (v12)(-2/25)/(v16v(-6)) assuming v is positive. v(-274/25) Simplify q(-1/6)qq(-5)q11/(q(-2/63)q) assuming q is positive. q(739/126) Simplify (w((w/(ww(-13)w))/w)/w)/(((ww/(((w/(w(-1/2)/w))/w)/w))/w)/w)(w(1/2))(22/3) assuming w is positive. w*(91/6) Simplify ((a/(aa*(7/5)aa)aaaa)/aa)(-1/48)/(a18/a(-3)) assuming a is positive. a(-1681/80) Simplify ((z(1/4))(-1/30)(z/(zz*(3/4)))/(z/(z(z/(z*(-2/9)z))/zz)))(-7/5) assuming z is positive. z(1351/1800) Simplify (((ww*(-9))/(w/(ww(w/(w/w4))/ww)))(2/41))(-15/2) assuming w is positive. w(45/41) Simplify (a/(a(-7)a))(-16)/(a3)37 assuming a is positive. a(-223) Simplify ((aa*(-1)/aaa)/a(-22))/(a(-22/5)a(2/27)) assuming a is positive. a(3689/135) Simplify (p*18p/(p14/p))/((p18p)/p(-2/3)) assuming p is positive. p(-41/3) Simplify (u/u(-2/5))17(u3)24 assuming u is positive. u*(479/5) Simplify (((yy*(-11))/yy*(-10))/(y/(yy*(1/4)y))(-8/5))(-28) assuming y is positive. y644 Simplify (l(-18)/l(-5/2))/((l(3/10)/l)/(ll/l3l)) assuming l is positive. l*(-74/5) Simplify ((ss*(4/5)/s)/s)/(ss/s*(-7/3))(s(-1/2))27 assuming s is positive. s*(-541/30) Simplify ((ss/s0)(2/11)(ss(1/3)/s)(-6/13))(22/7) assuming s is positive. s(60/91) Simplify ((y/(y23/y))/(y/(y/(y25/y))))/(y*(-10)y*1yy) assuming y is positive. y(-38) Simplify ((p(-12/11)p/(p*(-2/29)p))35)(3/2) assuming p is positive. p*(-17115/319) Simplify (((vvv/(vvv(-17)))/(v20v))(11/5))(2/21) assuming v is positive. v*(-22/35) Simplify (i(ii/i(-3/2))/i)38(ii(-4)i)/(ii(-12)) assuming i is positive. i142 Simplify ((d5/d3)(-3/7))27 assuming d is positive. d(-162/7) Simplify f(-10)/(f/(f/(f/((f/f(-20)f)/f))))f/f(-3/11)f(1/13)/f assuming f is positive. f(1480/143) Simplify (y(-10/3))(-11)y(2/23)y/y(-21/5) assuming y is positive. y(14474/345) Simplify (((ss/(s/s(-5)))/((ss(-3/5))/s))(-4/27))27 assuming s is positive. s(68/5) Simplify (r*(-1/11)r/(rr/(rr*11)r)rr)/(r/r*36r*30/rr) assuming r is positive. r(186/11) Simplify ((z/z(4/5))/(z*(-8)z)(z/((z/z(-7))/z))/zzzzzz(-4))(7/5) assuming z is positive. z*(7/25) Simplify ((g/(gggg/((gg(4/3))/g)g)(g/g5)/g)(-2/49))*(15/4) assuming g is posi	{ "pile_set_name": "DM Mathematics" }
20 for f. -4 Solve -15z + 20z - 35 = 5k, -4z + 49 = 3k for k. 3 Solve 16d - 104b + 73 = -99b, 2d + 31 = 5b for d. -3 Solve -5l = 5o - 10, -486o + 527o - 166 = l for l. -2 Solve -2u + 3w + 15 = 0, -20 = -38u + 36u + 4w for u. 0 Solve 24a = u + 20a + 9, -30 = -12u + 2a for u. 3 Solve -4m + 40 = 3o, 969m + o - 20 = 966m for m. 4 Solve 4x + 5r + 248 = 184, -85 = 7x + 2r for x. -11 Solve -2 = -3z - 8f, 12 = -2z - 5f + 3f for z. -10 Solve -o + 8 = 5h, -55o + 47o + 3h + 21 = 0 for o. 3 Solve 3b + 12 = -6x, -5b - 67x + 71x = -36 for b. 4 Solve -10k - 16k = -5l - 25k, 0 = 4k + 20 for l. -1 Solve u = -4o + 37, -5u - 149392o + 65 = -149387o for u. 5 Solve 0 = -p + 5d + 29, 2p - d + 920 = 933 for p. 4 Solve -3o + 143 = 155, -2o - 28 = -0w + 5w for w. -4 Solve -5j - 5x + 10 = 0, -15j + 13j + 14 = -3x for j. 4 Solve -5t + 15 = 0, -j + 892t - 897t + 11 = -1 for j. -3 Solve 0 = 2q - 3b - 11, -13 = -2q - b - 22 for q. -2 Solve d - 1 = -z, 40z - 31z + 5d + 11 = 0 for z. -4 Solve -34 + 22 = 3d, 6 = 5b - 4d for b. -2 Solve v - 3v - 8 = 0, 3u - 286 + 289 = 4u - 2v for u. -5 Solve 2b + 5t - 54 = -34, 0 = 6b - 3t - 24 for b. 5 Solve -3r - 9 = -s, -4r + 24s + 106 = 118 for r. -3 Solve -2j = 4p - 10, -5p + 630 = 3j + 615 for p. 0 Solve 4q = 2f + 2, -3q + 15 = 30f - 45f for f. -1 Solve 2c + 2n + 4 = 0, 232n = 227n + 15 for c. -5 Solve -3n + 18 = -19i + 22i, 3i = -2n - 3n + 26 for i. 2 Solve -v - 7184 = 2d - 7196, 0 = 3d - 12v + 63 for d. 3 Solve 30 = 4k + 3w, 44k - 82 = 48k - 5w for k. -3 Solve 3o - 5z + 29 = 0, 37z = 36z + 4 for o. -3 Solve -3y - 25m = -16m + 6, y = -2m - 3 for y. -5 Solve -17 = 2y + 3z, -3y - 22 - 1 = 4z for y. -1 Solve -4p = 3t + 29, -19665p = -19662p - 2t + 9 for p. -5 Solve 117w - 115w = 3a + 29, 4a - 108 = -4w for a. 5 Solve -5 = 11a - 12a + 5z, 5 = -3a + 5z for a. -5 Solve 3b = -3p - 84, -2p - 221b = -224b - 69 for p. -3 Solve -2 = -4t + 5n + 5, 0 = 4t + 37n - 49 for t. 3 Solve -2h = q - 11, 13 = 4q - 2h + 49 for q. -5 Solve 28 = -l - 2i + 27, 5l + 6i - 3 = 0 for l. 3 Solve 5i - 4m + 68 + 9 = 0, 94m + 9 = 97m for i. -13 Solve -25s + 30s - 8 = 13p - 12p, -3p - 9 = 0 for s. 1 Solve 0 = -3f - 4s + 5, -f + 4s = -10185 + 10210 for f. -5 Solve -3y = 21v - 24v, -9y = 4v - 13 for v. 1 Solve -16v - 15v - 3r = -36v + 28, -4r - 8 = -3v for v. 8 Solve 5r = 3t - 2, -4r = -t + 338 - 335 for t. -1 Solve 3b - 3x + 27 = 0, -452b = -449b + 4x - 1 for b. -5 Solve -45k + 42k + 4j + 15 = 0, -5k - 9j - 22 = 0 for k. 1 Solve 5b = 2m + 27, -1296m - b = -1299m - 8 for m. -1 Solve h = k - 6, -5h - 209 + 200 = 2k for k. 3 Solve 4w + x + 15 = 0, -61w = -60w - 5x - 33 for w. -2 Solve -2i - 29 = 3n, -3n + 3i + 20 = -2i for n. -5 Solve -146g - 10 = -151g + 5c, 4g + 5c = 8 for g. 2 Solve -5i - 10 = -2q, 17i - 4q - 2 = 18i for i. -2 Solve -104x = -103x - 5m - 27, -2m = 5x for x. 2 Solve y - 7 = -29b + 30b, 23 = 2y - 5b for y. 4 Solve -12 = -4t, 84f - 86f = -4t + 18 for f. -3 Solve 2a + 763 = 2f + 755, -10 = -3f + 5a for f. 5 Solve 7o - 34h + 39h - 83 = 0, -4h + 28 = -4o for o. 4 Solve 848m = 843m + 60, -3k = -4m + 42 for k. 2 Solve 0 = -17f - 3i - 32, -1697f = -1695f + i + 3i + 22 for f. -1 Solve -516 + 515 = -2w + 3a, 2w - 4a = 4 for w. -4 Solve 0 = 5t + 5d - 30, 130d - 40 = 5t + 128d for t. -4 Solve 4n - 60 = -969y + 973y, 8n = 2y + 120 for y. 0 Solve -8t = -3t + 5j, -t = -0t + 11j + 50 for t. 5 Solve 4n = -3s + 169 - 209, -4n = 5s + 48 for n. -7 Solve -2b = 5u - 10, -6 = -800u + 797u - 4b for u. 2 Solve 19r = -6v + 22r + 24, 5v = 3r + 24 for v. 0 Solve 0 = -2q + 4n - 14, -5q - 50 = 5n - 30 for q. -5 Solve -l + 15 = 5i, 11 = -3i + l + 36 for i. 5 Solve 4q + 14f + 38 = 0, -2q + 4f - 3990 + 4004 = 0 for q. 1 Solve 3m + 4q = -12, 17580m + 6 = 17578m - 2q for m. 0 Solve g - 8 = -n - 7, 5g = 5n + 25 for n. -2 Solve 5k = -78h + 83h + 20, 3k = -4h - 16 for h. -4 Solve 5f - 58c + 56c - 12 = 0, 0 = -3c + 12 for f. 4 Solve 71q = 76q - 7g + 5, -5q + 6g = 5 for q. -1 Solve 3z - 22 = 2g, 4g + 676 - 682 = z for g. 4 Solve 0 = -l - u, -41u - 24 = 2l - 45u for l. -4 Solve -12 = 4x - 4k, -76x + 27 = -80x + k for x. -8 Solve 67w - 62w + 5d = 20, 2w - 2d - 12 = 0 for w. 5 Solve -120v + 54v - 10 = -61v, 16 = j - 5v for j. 6 Solve 0 = 4t - 8, 871t + 1 = f + 872t for f. -1 Solve -4y + 5 = n, y - n + 460 - 460 = 0 for y. 1 Solve -3q + 6 = 2h, -h + 56q - 59q = -6 for h. 0 Solve -5p + 78 + 132 = -3y + 149, -3y = 2p + 26 for y. -12 Solve 4z = -k + 5, -k + 32 = -z + 37 for k. -3 Solve 3l = -4b + 9, -3b + l + 0l = -23 for b. 6 Solve 2g + 3g + 5w - 10 = 0, -602 + 588 = -g - 4w for g. -2 Solve 762x - 758x + 5d = 98, 0 = 4x + 4d - 76 for x. -3 Solve -t = -163u + 162u + 7, -5u = -t - 15 for t. -5 Solve -4m + 30w = -26w + 52w + 8, 5w = -2m - 4 for m. -2 Solve -5j + 171k = 169k + 62, -2j - 50 = -2k for j. -4 Solve 5l = -5o + 60, 16o - 2l - 81 = 11o for o. 15 Solve -619u = -620u - 3z + 8, 2u - 5 = 5z for u. 5 Solve 5v + 18o - 102 = 0, -87o + 32 = 2v - 82o for v. 6 Solve 0 = -3i, 3b + 17i - 19i - 18 = -0b for b. 6 Solve 0 = -3b - 3g - 15, -106 = 17b - 4g - 63 for b. -3 Solve -34d - 4 = -6c - 36d, 0 = 2c + 2d for c. 1 Solve -4m - 195 = -8r - 239, -3r = 2m - 1 for r. -3 Solve 7t = u - 30, 3u - 49t = -50t - 20 for u. -5 Solve 0 = -2m + 2k - 2, 0 = m + 535k - 526k - 9 for m. 0 Solve -4w - 12 = -4x, -20 = -137x + 142x for w. -7 Solve 244t - 13 = -5y + 241t, 0 = -y - 2t + 4 for y. 2 Solve -3i - 21 = -4k, 5k = 3i - 1018 + 1042 for k. 3 Solve 4a + 29g + 522 = 0, 0 = -a + 3g - 3158 + 3212 for a. 0 Solve 5s - 218q = -219q + 81, -67 = -3s + 4q for s. 17 Solve 0 = 2f + 5p - 7, -19f - 4p + 8 = -18f for f. -4 Solve 3h - 3q + 5 = -2h, q = -13h - 57 for h. -4 Solve 175z - 174z + 4p + 17 = 0, 3z = -3p - 6 for z. 3 Solve 5t + 3w = 0, 0 = 5w - 0w - 25 for t. -3 Solve 5j = -4l - 6, -4j - 3 = -l + 6l for l. 1 Solve 2f - 8 = 2t, 109160f + 2t = 109156f + 16 for f. 4 Solve 3b + 669 = 3r + 627, 67 = 2r - 5b for r. 1 Solve -10o - u + 325 - 333 = 0, 5o - 5u - 40 = 0 for o. 0 Solve 0 = 2a - 2f + 26, -4a + 1868f = 1873f - 101 for a. 4 Solve 5i = 9f + 172 - 213, 24 = 5f - 4i for f. 4 Solve 8h + 1 = 3v, -164v - 11 = -5h - 166v for h. 1 Solve 4k - 5785w + 5787w + 6 = 0, -4k + w = 21 for k. -4 Solve -5v = -5x + 15, -1393v + 1387v = -x + 13 for x. 1 Solve 0 = -3c + 5s + 80, 3c = -2982s + 2986s + 67 for c. 5 Solve -3h + 33b - 34b = 0, 2h + 5b = 0 for h. 0 Solve -5f = -3w - 30, -3f + 4w - 74 = -103 for f. 3 Solve 3t + p + 19 = -0p, 4t = -42p + 28p for t. -7 Solve 1221j - 8 = 1225j + 3o, -5j + 5o + 25 = 0 for j. 1 Solve -2c = 5g - 212 + 211, -c = -8 for g. -3 Solve -2o - 8 = -6r + 12, -5752r + 5748r + 3o = -10 for r. 4 Solve 2s - 16 = 2d, 21s + 4d + 5688 = 5706 for s. 2 Solve -2r + 109 - 79 = -4u, 0 = -2r - 3u + 16 for r. 11 Solve -4f = 2c + 2, 58 = 2c + 60 for f. 0 Solve -829k = 5g - 828k + 12, 0 = 4k - 12 for g. -3 Solve 22 = -4r + 2a, 2a + 221 = -2r + 219 for r. -4 Solve 0 = -15z + 11z + 5k + 27, -3z + 6 = 183k - 182k for z. 3 Solve 0 = -2d - 3048u + 3045u - 34, 5u + 51 = -9d for d. 1 Solve 5 = -9g + 8g - 2h, 12 = -4h + h for g. 3 Solve 4r - 18 = -5y, 5r + 1163 = -5y + 1178 for y. 6 Solve 2i - 10 = -3d, -18 = -5i - d + 7 for i. 5 Solve z + 3w + 8 = 0, 5z + w + 105 - 107 = 0 for z. 1 Solve 123j - 120j = 5n - 45, 3j + 27 = 3n for n. 9 Solve -10h + 5o = 30, -20o + 18o = 0 for h. -3 Solve 33 = -5k + 2h, 2k - 5h + 50 - 20 = 0 for k. -5 Solve -4d + 2q = -0d, 0 = 2d + 4q for d. 0 Solve 4v + 2j = -4, -5v + 19 = 5j + 34 for v. 1 Solve 2l = m, -106l + 102l = -5m - 6 for l. -1 Solve -y + 3o - 12 = 0, -18 = 266y - 262y - 2o for y. -3 Solve -5k + 10 = -a, -2a - 18k + 6 = -58 for a. 5 Solve -f = -5j + 9, j + 3f + 9232 - 9253 = 0 for j. 3 Solve -5751i + 5754i - 14 =	{ "pile_set_name": "DM Mathematics" }
/3 Factor -523q3/5 + 74786q*2/5 + 429q/5. -q(q - 143)(523q + 3)/5 Factor -x3/4 - 431x*2/4 - 20159x/2 - 38610. -(x + 4)(x + 130)(x + 297)/4 Suppose 3w4 - 285w*3 + 8613w*2 - 92907w + 208656 = 0. Calculate w. 3, 21, 23, 48 Solve -2w5/5 - 308w*4/5 - 3174w*3/5 + 69788w*2/5 + 51296w/5 - 207552 = 0. -141, -23, -4, 4, 10 Suppose u*3/5 - 847678u*2 + 4490970494417u/5 + 35928035212808/5 = 0. Calculate u. -8, 2119199 Suppose -d*5/3 - 5103d*4 - 48110563d*3/3 + 27841078711d*2 - 166902079336d/3 + 27808989692 = 0. Calculate d. -8266, 1, 1221 Solve -k*4 + 13k*3 + 678k*2 - 5040k = 0. -24, 0, 7, 30 Suppose -5a5/4 + 1575a*4/4 - 90485a*3/2 + 4487715a*2/2 - 171120465a/4 + 816422355/4 = 0. Calculate a. 7, 29, 93 Let 4p4/11 + 2942p*3/11 - 773660p*2/11 + 4172934p/11 - 1893420/11 = 0. Calculate p. -942, 1/2, 5, 201 Determine r, given that -2r2/11 + 393258r/11 = 0. 0, 196629 Factor -2y2 + 9086y - 9412220. -2(y - 2945)(y - 1598) Solve -i*4 - 46i*3 - 143i*2 + 10726i + 42504 = 0. -33, -23, -4, 14 Factor -y*3/6 + 4667243y*2/3 - 10891527270670y/3 - 239615858905676/3. -(y - 4667254)*2(y + 22)/6 Solve i*2 + 110016i + 3025880064 = 0 for i. -55008 Find z, given that z*2/5 + 28123502z/5 - 28123503/5 = 0. -28123503, 1 What is x in 49x4/3 - 2673818x*3/3 + 12158550731x*2 + 10421778616x/3 + 744416656/3 = 0? -1/7, 27284 Factor g*2/4 - 6843519g + 46833752303361. (g - 13687038)*2/4 What is d in -3d*2 + 47992551d + 335948004 = 0? -7, 15997524 Factor -5a5 - 12219855a*4 - 7466224481250a*3 + 22398746762930a*2 - 22398771202665a + 7466261140845. -5(a - 1)3(a + 1221987)*2 Factor -2n*2 - 1218934n. -2n(n + 609467) Solve -4p5 + 54896p*4 - 3606476p*3 + 10435216p*2 - 6883632p = 0 for p. 0, 1, 2, 63, 13658 What is n in 5n2 + 6032850n + 18098505 = 0? -1206567, -3 Factor 4n2 - 87106032n - 87106036. 4(n - 21776509)(n + 1) Find n, given that -2n2 - 1996n + 684720 = 0. -1268, 270 Suppose -11x3 - 759229x*2 - 59772556x + 10892836 = 0. What is x? -68942, -79, 2/11 Determine h, given that -3h4 + 3558789h*3 + 17794038h*2 - 21352824h = 0. -6, 0, 1, 1186268 Find p, given that p*2/2 - 364218p = 0. 0, 728436 Suppose -4n2 - 1074328n + 49427552 = 0. Calculate n. -268628, 46 Suppose 26679813d2/5 + 26679814d/5 + 1/5 = 0. Calculate d. -1, -1/26679813 Determine y so that -28y3/5 - 9515516y*2/5 + 20390512y/5 - 2718736/5 = 0. -339842, 1/7, 2 Solve 4m2 - 144932m + 5357008 = 0. 37, 36196 Find s, given that -4s3/3 - 252144s*2 + 252145s - 189109/3 = 0. -189109, 1/2 Solve -5a3 - 4201315a*2 - 8402615a - 4201305 = 0 for a. -840261, -1 Suppose 2s5 - 142388s*4 - 1566476s*3 - 2420992s*2 + 1566474s + 2563380 = 0. Calculate s. -9, -2, -1, 1, 71205 What is w in 2w4/3 - 4137422w*3/3 - 5516570w*2 - 20687146w/3 - 8274860/3 = 0? -2, -1, 2068715 Suppose 2t5/13 - 1850t*4/13 + 465524t*3/13 - 13318644t*2/13 - 1624847670t/13 - 1611061650/13 = 0. Calculate t. -43, -1, 99, 435 Find i such that 94i3/3 - 16846i*2/3 + 20312i/3 - 3560/3 = 0. 10/47, 1, 178 Factor d*5/9 + 1762d*4/9 + 779677d*3/9 + 1032532d*2/3 + 343396d. d(d + 2)2(d + 879)2/9 Factor -b3 - 226253b2 + 2036428b + 15838340. -(b - 14)(b + 5)(b + 226262) What is x in 2x3 + 980502x*2 + 2941492x + 1960992 = 0? -490248, -2, -1 Determine c so that 21c3 - 7449537c*2 + 660653941071c + 1415721223845 = 0. -15/7, 177371 Solve -t*3/3 + 6394t*2 + 1367035t/3 - 462072 = 0 for t. -72, 1, 19253 Suppose g*5 - 828g*4 - 73127g*3 + 103530186g*2 + 14007123676g - 285160499208 = 0. Calculate g. -206, 18, 611 Factor -2y2/13 - 1342106y/13 + 2684220/13. -2(y - 2)(y + 671055)/13 Factor -68d2 - 36420d + 236312. -4(d + 542)(17d - 109) Determine x, given that 2x*3 + 8522359x*2/3 - 2367327x - 15624334/3 = 0. -1420394, -1, 11/6 Let -3y5/4 + 1671y*4/4 + 163245y*3/4 - 144562803y*2/4 + 713831265y/2 = 0. Calculate y. -279, 0, 10, 413 Factor -2n2/3 + 13218n + 3291972. -2(n - 20073)(n + 246)/3 What is z in 5z2 - 26628845z - 106515460 = 0? -4, 5325773 Suppose 143g4 - 411604g*3/7 - 1582331g*2/7 + 317914g/7 - 9960/7 = 0. What is g? -4, 3/77, 2/13, 415 Solve 2n3 - 1392n*2 + 3982n + 121968 = 0 for n. -8, 11, 693 Find o, given that 2o5/5 + 712o*4/5 + 11472o*3/5 - 19332o*2/5 - 69930o - 622404/5 = 0. -339, -17, -3, 6 Find v such that -v*2 + 544682v + 37587819 = 0. -69, 544751 Let r*2 + 123489r - 1111482 = 0. Calculate r. -123498, 9 Suppose 2u3 + 31368u*2 - 125496u + 125504 = 0. What is u? -15688, 2 Factor 3r2 + 113916r - 4903935. 3(r - 43)(r + 38015) Suppose 2k3/7 - 10756980k*2/7 + 2066295226152k + 4132596599152 = 0. Calculate k. -2, 2689246 Solve t*3/2 - 2677t*2/2 + 38291t + 278040 = 0 for t. -6, 35, 2648 Factor x*3/2 - 1414265x*2/2 - 2828536x - 2828538. (x - 1414269)(x + 2)2/2 Factor -4m*2 - 103854072m - 674104266936324. -4(m + 12981759)2 Determine q so that -5q*4 + 830000q*3 + 1660055q*2 - 5810090q + 3320040 = 0. -4, 1, 166002 Let -5l4 - 3720l*3 + 145410l*2 + 718120l - 3362205 = 0. Calculate l. -781, -7, 3, 41 Factor -v*2/4 + 127429v/2 - 3439854. -(v - 254804)(v - 54)/4 Find f, given that -f5/3 - 3319f*4/3 - 92360f*3/3 - 697532f*2/3 + 177120f + 5265600 = 0. -3291, -12, -10, 4 What is o in -5o2 - 58086500o - 168702074112500 = 0? -5808650 Determine f so that 18f3/5 - 379f*2 + 39333f/5 - 2156 = 0. 5/18, 28, 77 Find i such that 16i4 - 79252i*3 - 932956i*2 - 2303888i + 635520 = 0. -8, -4, 1/4, 4965 Factor -2g2/13 + 1492282g/13 - 7461360/13. -2(g - 746136)(g - 5)/13 Solve 17298w4 + 144508236w*3 + 301810112426w*2 + 12980879608w + 139578632 = 0. -4177, -2/93 Determine r so that 6r3/5 - 537783r*2/5 + 12050036448r/5 + 18076264704/5 = 0. -3/2, 44816 Factor 25834d3 + 25843d*2 - 51659d - 18. (d - 1)(d + 2)(25834d + 9) Factor 2w*2/7 - 150678w/7 + 11891080/7. 2(w - 75260)(w - 79)/7 Suppose -3w5/5 + 243w*4/5 - 6498w*3/5 + 61986w*2/5 - 58779w/5 - 930069/5 = 0. Calculate w. -3, 7, 19, 21, 37 Let -5k2 + 247895k + 46780980 = 0. What is k? -188, 49767 Determine w so that w*3 + 3030w*2 + 90144w + 432000 = 0. -3000, -24, -6 Let 2y3/3 + 9047914y*2/3 - 180958880y/3 + 904795400/3 = 0. What is y? -4523977, 10 Find h, given that 578h5 - 8757754h*4/3 + 33234424478h*3/9 - 152531271130h*2/9 - 21216748000h/3 - 707281000 = 0. -10/51, 5, 2523 Factor 6099r4/7 + 24387r*3/7 - 36r*2/7. 3r*2(r + 4)(2033r - 3)/7 What is t in 91t3/5 - 241448t*2/5 + 548829t/5 - 190872/5 = 0? 3/7, 24/13, 2651 Solve -23t4/10 + 27771t*3/5 + 44544t*2 + 445808t/5 = 0. -4, 0, 55726/23 What is d in -14d5 - 4474d*4/3 + 20822d*3/3 - 5254d*2/3 - 5460d + 1776 = 0? -111, -6/7, 1/3, 1, 4 Solve u*4 + 1101u*3 - 174169u*2 - 532389u = 0. -1241, -3, 0, 143 Suppose -4i5/3 + 4276i*4 + 701792i*3 + 118386400i*2/3 + 862440000i + 5049000000 = 0. What is i? -50, -9, 3366 Let -4i5 - 8836i*4 - 304476i*3 - 251516i*2 + 1451824i - 886992 = 0. What is i? -2174, -34, -3, 1 Let -185j5 - 4985j*4 - 6575j*3 + 58645j*2 - 49400j + 2500 = 0. What is j? -25, -5, 2/37, 1, 2 Factor -3y2/4 - 5379447y/4 + 2689725/2. -3(y - 1)(y + 1793150)/4 What is x in x*3/3 - 11248x*2/3 + 22493x/3 - 11246/3 = 0? 1, 11246 Let 5v3 - 103745v*2 + 10542975v - 268514235 = 0. What is v? 51, 20647 Solve -3m3/4 - 52641m*2/4 - 54520920m + 28542424512 = 0. -9008, 469 Factor -k*2/3 + 22995377k/3 + 7665126. -(k - 22995378)(k + 1)/3 Factor -3b*2 - 97372536b - 790117563922608. -3(b + 16228756)2 Suppose -2c*4 + 1534c*3 + 130292c*2 - 266704c = 0. What is c? -79, 0, 2, 844 What is q in -2q4/15 + 12768q*3/5 + 76632q*2/5 + 64q/15 - 408704/5 = 0? -4, 2, 19158 Suppose -s*2 - 189540984s = 0. Calculate s. -189540984, 0 Find a such that 4a3/3 - 4365836a*2/3 + 69852208a/3 + 52389264 = 0. -2, 18, 1091443 Determine f so that -2f2/7 + 3361994f/7 - 13447944/7 = 0. 4, 1680993 Let -1300j4 - 446035j*3 + 849050j*2 - 474165j + 72450 = 0. What is j? -345, 1	{ "pile_set_name": "DM Mathematics" }
32, 274, 480? 2i3 + 2i*2 + 2i - 36 What is the s'th term of 64, 65, 66, 67, 68, 69? s + 63 What is the d'th term of 37, 270, 889, 2086, 4053, 6982, 11065, 16494? 32d3 + d2 + 6d - 2 What is the x'th term of -24, -62, -124, -216, -344, -514, -732? -x*3 - 6x*2 - 13x - 4 What is the o'th term of 69, 229, 497, 873, 1357, 1949? 54o2 - 2o + 17 What is the f'th term of 1, 16, 55, 130, 253, 436, 691? 2f3 + f - 2 What is the h'th term of 105, 118, 131, 144? 13h + 92 What is the t'th term of 13612, 27222, 40832? 13610t + 2 What is the d'th term of 31, 100, 169, 238, 307, 376? 69d - 38 What is the s'th term of 33, 25, 19, 21, 37, 73, 135, 229? s*3 - 5s2 + 37 What is the q'th term of 133, 126, 107, 70, 9, -82? -q3 + 134 What is the j'th term of 130, 138, 146, 154, 162? 8j + 122 What is the w'th term of -17, -202, -711, -1706, -3349? -27w*3 + 4w + 6 What is the b'th term of -272, 2, 266, 514, 740, 938, 1102? -b3 + b2 + 278b - 550 What is the v'th term of 939, 1878, 2817? 939v What is the h'th term of 71, 73, 75, 77, 79? 2h + 69 What is the v'th term of -15, -5, 3, 9, 13? -v2 + 13v - 27 What is the h'th term of 841, 814, 765, 688, 577, 426, 229, -20? -h*3 - 5h*2 - 5h + 852 What is the j'th term of 251, 500, 749? 249j + 2 What is the y'th term of 34, 9, -44, -131, -258? -y3 - 8y*2 + 6y + 37 What is the m'th term of 3, 0, -3, 0, 15, 48, 105? m*3 - 6m*2 + 8m What is the m'th term of 169, 168, 167, 166, 165, 164? -m + 170 What is the p'th term of -40, -66, -108, -172, -264, -390, -556? -p*3 - 2p*2 - 13p - 24 What is the z'th term of 18, 15, 10, 3, -6, -17? -z2 + 19 What is the c'th term of 4, -2, -6, -8, -8, -6? c2 - 9c + 12 What is the k'th term of 520, 1041, 1562, 2083? 521k - 1 What is the r'th term of -8, -28, -90, -218, -436, -768, -1238? -4r3 + 3r2 - r - 6 What is the a'th term of -150, -142, -146, -168, -214, -290, -402? -a3 + 15a - 164 What is the w'th term of -66, -46, -10, 48, 134, 254, 414, 620? w3 + 2w*2 + 7w - 76 What is the v'th term of -20, -82, -192, -374, -652, -1050, -1592? -4v3 - 34v + 18 What is the d'th term of 8, -7, -38, -91, -172, -287? -d*3 - 2d*2 - 2d + 13 What is the r'th term of 20, 19, 16, 11, 4? -r*2 + 2r + 19 What is the w'th term of 3783, 7567, 11351, 15135, 18919? 3784w - 1 What is the l'th term of 6, 63, 158, 291, 462, 671, 918? 19l*2 - 13 What is the r'th term of 15, -7, -23, -33, -37, -35? 3r*2 - 31r + 43 What is the c'th term of -26, -114, -270, -500, -810? -c*3 - 28c*2 + 3c What is the u'th term of 294, 302, 310, 318? 8u + 286 What is the i'th term of -49, -47, -45, -43, -41? 2i - 51 What is the c'th term of 21, 177, 431, 777, 1209? -c*3 + 55c*2 - 2c - 31 What is the j'th term of -400, -401, -402? -j - 399 What is the a'th term of 247, 251, 257, 265, 275, 287, 301? a2 + a + 245 What is the b'th term of 1282, 1268, 1256, 1246, 1238, 1232, 1228? b2 - 17b + 1298 What is the q'th term of 110, 109, 108, 107, 106? -q + 111 What is the h'th term of -1338, -1339, -1342, -1347, -1354? -h2 + 2h - 1339 What is the f'th term of -279, -264, -241, -210, -171, -124, -69? 4f2 + 3f - 286 What is the h'th term of 74, 151, 228, 305, 382? 77h - 3 What is the j'th term of -157, -318, -479, -640, -801, -962? -161j + 4 What is the r'th term of -8, -12, -28, -62, -120, -208? -r*3 + 3r - 10 What is the j'th term of -55, -70, -79, -82, -79, -70, -55? 3j2 - 24j - 34 What is the o'th term of -26, -14, 4, 28, 58? 3o2 + 3o - 32 What is the g'th term of -19, 19, 57, 95, 133? 38g - 57 What is the r'th term of 249, 501, 755, 1011, 1269, 1529? r2 + 249r - 1 What is the j'th term of -26, -12, 24, 94, 210, 384, 628, 954? 2j3 - j2 + 3j - 30 What is the s'th term of 32, 61, 90? 29s + 3 What is the i'th term of 11738, 23473, 35210, 46949, 58690, 70433, 82178? i2 + 11732i + 5 What is the h'th term of -1170, -2332, -3494, -4656, -5818? -1162h - 8 What is the d'th term of 251, 509, 769, 1031, 1295, 1561? d2 + 255d - 5 What is the o'th term of 44, 55, 74, 101, 136, 179, 230? 4o2 - o + 41 What is the l'th term of 37, 89, 153, 235, 341? l3 + 45l - 9 What is the x'th term of 110, 245, 382, 521? x*2 + 132x - 23 What is the q'th term of 18, 31, 42, 51, 58, 63? -q*2 + 16q + 3 What is the r'th term of -369, -637, -915, -1209, -1525, -1869, -2247? -r3 + r2 - 264r - 105 What is the j'th term of -75, -101, -141, -195? -7j*2 - 5j - 63 What is the m'th term of -109, -122, -143, -172, -209? -4m2 - m - 104 What is the i'th term of -4, -16, -34, -58? -3i*2 - 3i + 2 What is the m'th term of 120, 240, 360, 480, 600, 720? 120m What is the y'th term of 104, 125, 174, 263, 404, 609, 890? 2y*3 + 2y*2 + y + 99 What is the g'th term of 3220, 6438, 9656? 3218g + 2 What is the f'th term of -4, -57, -146, -289, -504, -809? -3f3 - 32f + 31 What is the i'th term of -18, -63, -156, -321, -582, -963, -1488, -2181? -4i3 - 17i + 3 What is the v'th term of -218, -439, -660? -221v + 3 What is the z'th term of -88, -55, -8, 59, 152, 277, 440, 647? z3 + z2 + 23z - 113 What is the c'th term of 12385, 12386, 12387, 12388, 12389? c + 12384 What is the g'th term of 1, -2, 3, 22, 61, 126, 223, 358? g*3 - 2g*2 - 4g + 6 What is the j'th term of -291, -298, -303, -306, -307, -306? j*2 - 10j - 282 What is the g'th term of 218, 221, 224, 227? 3g + 215 What is the g'th term of -2, 14, 16, -2, -46, -122? -g3 - g2 + 26g - 26 What is the j'th term of -1, -21, -45, -67, -81, -81? j*3 - 8j*2 - 3j + 9 What is the w'th term of 21, 49, 101, 183, 301? w*3 + 6w*2 + 3w + 11 What is the g'th term of -6, 4, 14, 24? 10g - 16 What is the u'th term of -201, -217, -243, -279, -325? -5u*2 - u - 195 What is the x'th term of 501, 502, 503, 504, 505, 506? x + 500 What is the g'th term of -1522, -1518, -1514, -1510, -1506? 4g - 1526 What is the h'th term of 10, 18, 16, -2, -42, -110? -h3 + h2 + 12h - 2 What is the m'th term of -161, -269, -385, -515, -665, -841, -1049? -m3 + 2m*2 - 107m - 55 What is the r'th term of 89, 41, -9, -61, -115? -r*2 - 45r + 135 What is the j'th term of -201, -400, -599, -798, -997, -1196? -199j - 2 What is the m'th term of -43, -160, -355, -628, -979, -1408, -1915? -39m*2 - 4 What is the o'th term of 1256, 1222, 1138, 980, 724, 346, -178, -872? -4o3 - o2 - 3o + 1264 What is the c'th term of -39, -69, -93, -111, -123? 3c*2 - 39c - 3 What is the n'th term of 248, 491, 734, 977? 243n + 5 What is the j'th term of 130, 137, 148, 163, 182? 2j2 + j + 127 What is the m'th term of -15, -41, -61, -69, -59, -25, 39, 139? m3 - 3m2 - 24m + 11 What is the j'th term of -9, -2, 25, 84, 187, 346? 2j3 - 2j*2 - j - 8 What is the a'th term of 348, 696, 1044, 1392? 348a What is the n'th term of -11, 6, 37, 82, 141, 214? 7n2 - 4n - 14 What is the x'th term of -16, -58, -116, -184, -256, -326? x*3 - 14x*2 - 7x + 4 What is the o'th term of -13, -6, 1? 7o - 20 What is the u'th term of -3087, -3091, -3089, -3075, -3043, -2987, -2901? u3 - 3u*2 - 2u - 3083 What is the s'th term of 2700, 2695, 2690, 2685, 2680? -5s + 2705 What is the k'th term of -67, -56, -31, 14, 85, 188, 329, 514? k3 + k2 + k - 70 What is the i'th term of 15283, 15281, 15279, 15277, 15275, 15273? -2i + 15285 What is the i'th term of 361, 724, 1087, 1450, 1813, 2176? 363i - 2 What is the t'th term of -103, -131, -175, -235, -311? -8t*2 - 4t - 91 What is the v'th term of -213, -1646, -5539, -13122, -25625, -44278? -205v3 + 2v - 10 What is the i'th term of -6174, -12346, -18518, -24690, -30862, -37034? -6172i - 2 What is the p'th term of 5, 24, 57, 104, 165, 240, 329? 7p*2 - 2p What is the y'th term of -39, -201, -471, -849, -1335, -1929? -54y2 + 15 What is the q'th term of -750, -1500, -2250, -3000, -3750, -4500? -750q What is the c'th term of -61, -113, -163, -211, -257, -301? c*2 - 55c - 7 What is the k'th term of -74, -73, -72, -71? k - 75 What is the n'th term of -23523, -23524, -23525? -n - 23522 What is the l'th term of 2571, 5137, 7703, 10269, 12835? 2566l + 5 What is the v'th term of 10888, 21777, 32666, 43555, 54444, 65333? 10889v - 1 What is the l'th term of	{ "pile_set_name": "DM Mathematics" }
aad. What is prob of picking 4 a? 6/13 Two letters picked without replacement from {s: 1, w: 1, j: 2, y: 5, o: 1}. Give prob of picking 1 o and 1 s. 1/45 What is prob of picking 2 m when two letters picked without replacement from {y: 4, m: 2, b: 2}? 1/28 Calculate prob of picking 4 x when four letters picked without replacement from {b: 6, x: 4}. 1/210 Two letters picked without replacement from {i: 10, c: 2, u: 2, q: 5, m: 1}. Give prob of picking 1 u and 1 c. 2/95 What is prob of picking 1 e and 1 p when two letters picked without replacement from pse? 1/3 What is prob of picking 2 s when two letters picked without replacement from {i: 5, j: 3, s: 3}? 3/55 Three letters picked without replacement from vvccgvsvfvvcgcfgc. What is prob of picking 1 s, 1 v, and 1 c? 3/68 Calculate prob of picking 2 c when two letters picked without replacement from {c: 7, n: 3, l: 4, d: 1, k: 1}. 7/40 Three letters picked without replacement from {v: 12, e: 7}. Give prob of picking 2 v and 1 e. 154/323 Calculate prob of picking 1 t, 1 b, and 1 u when three letters picked without replacement from {a: 1, u: 8, b: 4, t: 7}. 56/285 Calculate prob of picking 2 h when two letters picked without replacement from hhhhh. 1 Two letters picked without replacement from {w: 7, a: 5}. Give prob of picking 2 w. 7/22 Two letters picked without replacement from {i: 7, o: 2, t: 3, m: 6, v: 1}. What is prob of picking 1 i and 1 t? 7/57 Three letters picked without replacement from {f: 5, c: 1, r: 1, e: 2}. What is prob of picking 3 f? 5/42 Two letters picked without replacement from {f: 3, y: 7, q: 2, p: 5, b: 1, k: 2}. Give prob of picking 1 y and 1 k. 7/95 Calculate prob of picking 2 d when two letters picked without replacement from {d: 7, k: 9}. 7/40 Two letters picked without replacement from {y: 7, v: 4, r: 2, j: 5}. Give prob of picking 1 j and 1 y. 35/153 Three letters picked without replacement from {a: 12, t: 1}. What is prob of picking 3 a? 10/13 Three letters picked without replacement from {f: 2, t: 11, b: 3, s: 3}. What is prob of picking 1 f, 1 s, and 1 b? 6/323 Four letters picked without replacement from {y: 4}. Give prob of picking 4 y. 1 Four letters picked without replacement from {u: 3, p: 2, i: 2, z: 5}. What is prob of picking 1 u, 1 z, and 2 i? 1/33 Two letters picked without replacement from yyyyybubyy. What is prob of picking 2 y? 7/15 Three letters picked without replacement from {f: 1, i: 4, c: 1, o: 8, q: 2, w: 4}. What is prob of picking 2 w and 1 f? 1/190 Calculate prob of picking 1 h and 1 j when two letters picked without replacement from hhmjhhhhhhhhhhjhham. 28/171 What is prob of picking 4 r when four letters picked without replacement from {r: 5, g: 7, b: 4}? 1/364 Four letters picked without replacement from fnfnnfffffffff. What is prob of picking 4 f? 30/91 Two letters picked without replacement from {v: 2, k: 3, i: 1, c: 3, u: 4, y: 3}. Give prob of picking 1 u and 1 i. 1/30 Two letters picked without replacement from {r: 4, y: 3, f: 3, w: 4}. What is prob of picking 1 f and 1 w? 12/91 Two letters picked without replacement from {n: 7, l: 1, m: 7, e: 2}. What is prob of picking 1 n and 1 l? 7/136 What is prob of picking 2 z when two letters picked without replacement from llllllzllz? 1/45 Three letters picked without replacement from ejtteyyyyetetyeyyy. What is prob of picking 3 y? 7/102 Four letters picked without replacement from tittittiizt. Give prob of picking 1 t, 1 z, and 2 i. 6/55 Three letters picked without replacement from dodmmdmodmmddmdod. What is prob of picking 2 o and 1 m? 9/340 What is prob of picking 2 r when two letters picked without replacement from jrarrjrarjrajar? 1/5 Calculate prob of picking 2 h, 1 l, and 1 w when four letters picked without replacement from lffwlnhwlannw. 0 Three letters picked without replacement from {g: 3, v: 7}. What is prob of picking 3 v? 7/24 Two letters picked without replacement from kkponpknmmonkkm. Give prob of picking 2 k. 2/21 Four letters picked without replacement from pcpmrcogm. What is prob of picking 1 m, 1 p, 1 o, and 1 c? 4/63 Calculate prob of picking 2 w when two letters picked without replacement from zzwkckwqzzzkbkqwbkzq. 3/190 What is prob of picking 2 x and 1 h when three letters picked without replacement from {p: 3, u: 3, h: 4, w: 3, x: 2, c: 1}? 1/140 Calculate prob of picking 2 p and 2 d when four letters picked without replacement from pwzppwddwwwdpppp. 9/260 Two letters picked without replacement from qmqccrrcxgrc. What is prob of picking 1 m and 1 x? 1/66 Calculate prob of picking 1 f and 1 i when two letters picked without replacement from {f: 2, i: 9}. 18/55 Three letters picked without replacement from lllltlltttltl. What is prob of picking 1 l and 2 t? 40/143 Four letters picked without replacement from wuywgykewegegkyueek. What is prob of picking 1 y, 1 g, and 2 k? 9/1292 Three letters picked without replacement from lunuuluul. Give prob of picking 1 u and 2 l. 5/28 Two letters picked without replacement from {r: 2, f: 1, l: 1, h: 3, o: 6}. Give prob of picking 1 o and 1 h. 3/13 Three letters picked without replacement from ikkyykykvyvkv. What is prob of picking 1 i and 2 k? 5/143 What is prob of picking 2 t and 1 o when three letters picked without replacement from fiitbtobbtbiftitif? 5/408 Calculate prob of picking 4 c when four letters picked without replacement from kkckkckkkckckckkck. 1/204 Two letters picked without replacement from {x: 6, k: 5, p: 1, f: 7}. What is prob of picking 1 f and 1 x? 14/57 Four letters picked without replacement from uuuukukuuuuu. What is prob of picking 2 k and 2 u? 1/11 What is prob of picking 1 y and 1 p when two letters picked without replacement from plffyp? 2/15 What is prob of picking 1 j and 1 f when two letters picked without replacement from jfyyjffgf? 2/9 Calculate prob of picking 2 f when two letters picked without replacement from fffffffhfffhffh. 22/35 Four letters picked without replacement from zykfkfyyzyffy. Give prob of picking 4 y. 1/143 Four letters picked without replacement from {q: 1, z: 8, u: 2, v: 7, w: 1}. What is prob of picking 1 w, 1 u, 1 q, and 1 v? 7/1938 Four letters picked without replacement from {s: 15, q: 3}. What is prob of picking 2 q and 2 s? 7/68 Calculate prob of picking 1 g and 1 q when two letters picked without replacement from ittuitgqttin. 1/66 Two letters picked without replacement from pmmpmfjpuww. Give prob of picking 1 f and 1 p. 3/55 Calculate prob of picking 2 i when two letters picked without replacement from {i: 2, h: 2, q: 10}. 1/91 What is prob of picking 1 v and 3 c when four letters picked without replacement from ccjnxnnnjncnjvcvn? 2/595 Four letters picked without replacement from kkkkokkkkoooo. What is prob of picking 3 k and 1 o? 56/143 What is prob of picking 2 d when two letters picked without replacement from dzhzzdpdpdithzz? 2/35 Calculate prob of picking 3 x and 1 g when four letters picked without replacement from xgxxgxgxxxxxxxxx. 33/70 What is prob of picking 1 v, 1 b, and 1 a when three letters picked without replacement from {v: 1, r: 2, q: 1, a: 1, b: 2}? 2/35 Two letters picked without replacement from fffffwffffww. What is prob of picking 2 f? 6/11 Calculate prob of picking 2 n when two letters picked without replacement from {f: 3, o: 4, k: 1, n: 2}. 1/45 Three letters picked without replacement from kzzmzzkzkmm. What is prob of picking 1 m, 1 z, and 1 k? 3/11 Calculate prob of picking 3 z when three letters picked without replacement from gzzzggzggggggg. 1/91 Four letters picked without replacement from ttbttgtssbtuttbtbtth. What is prob of picking 3 t and 1 s? 22/323 What is prob of picking 1 h, 1 i, and 1 a when three letters picked without replacement from ijaaooojjajaaha? 6/455 What is prob of picking 2 t and 1 u when three letters picked without replacement from {v: 2, u: 7, t: 4}? 21/143 What is prob of picking 2 v and 1 a when three letters picked without replacement from {c: 2, v: 2, a: 1, k: 1, g: 2, n: 1}? 1/84 Four letters picked without replacement from {l: 6, r: 3, g: 8, q: 2}. What is prob of picking 2 g, 1 r, and 1 l? 42/323 Four letters picked without replacement from wlawukwwkkwwkwlw. Give prob of picking 2 w, 1 a, and 1 u. 1/65 Tw	{ "pile_set_name": "DM Mathematics" }
of -255, -533, -811? -278k + 23 What is the t'th term of -65, -76, -109, -176, -289, -460, -701, -1024? -2t3 + t2 - 64 What is the b'th term of 18, 30, 42, 54, 66? 12b + 6 What is the r'th term of 29, 56, 83? 27r + 2 What is the u'th term of -2400, -4803, -7206, -9609, -12012? -2403u + 3 What is the m'th term of -788, -792, -796, -800, -804, -808? -4m - 784 What is the r'th term of -57, -23, 41, 141, 283, 473, 717? r*3 + 9r2 - 67 What is the n'th term of 35, 64, 81, 80, 55? -n3 + 36n What is the f'th term of -132, -249, -392, -573, -804, -1097, -1464? -2f3 - f2 - 100f - 29 What is the y'th term of -62, -125, -188, -251, -314? -63y + 1 What is the o'th term of 105, 414, 921, 1620, 2505, 3570, 4809, 6216? -o*3 + 105o*2 + o What is the w'th term of 95, 90, 85, 80, 75, 70? -5w + 100 What is the o'th term of -183, -194, -219, -264, -335? -o3 - o2 - o - 180 What is the a'th term of -556, -555, -554, -553? a - 557 What is the v'th term of 136, 271, 402, 529, 652, 771, 886? -2v2 + 141v - 3 What is the h'th term of -16, 19, 84, 185, 328, 519, 764, 1069? h*3 + 9h*2 + h - 27 What is the h'th term of -12, -63, -150, -273? -18h*2 + 3h + 3 What is the v'th term of -27, -37, -61, -105, -175? -v3 - v2 - 25 What is the o'th term of -13, -14, -15, -16? -o - 12 What is the s'th term of 2, -4, -24, -64, -130, -228? -s3 - s2 + 4s What is the x'th term of 101, 98, 95? -3x + 104 What is the a'th term of 561, 1128, 1697, 2268, 2841, 3416? a*2 + 564a - 4 What is the d'th term of 406, 435, 492, 583, 714? d*3 + 8d*2 - 2d + 399 What is the n'th term of -180, -178, -166, -138, -88, -10? n3 - n2 - 2n - 178 What is the s'th term of -46, -179, -398, -703, -1094, -1571, -2134? -43s*2 - 4s + 1 What is the o'th term of -2, -15, -32, -53, -78, -107? -2o2 - 7o + 7 What is the t'th term of -49, -42, -31, -16, 3, 26? 2t2 + t - 52 What is the n'th term of -73, -89, -117, -163, -233, -333, -469? -n3 - 9n - 63 What is the j'th term of -19, -24, -15, 14, 69, 156, 281, 450? j3 + j2 - 15j - 6 What is the d'th term of -16, -35, -58, -85, -116, -151? -2d*2 - 13d - 1 What is the f'th term of 143, 259, 363, 449, 511? -f*3 + 123f + 21 What is the f'th term of -17, -90, -215, -392, -621? -26f2 + 5f + 4 What is the c'th term of -62, -65, -68? -3c - 59 What is the t'th term of 93, 91, 89, 87? -2t + 95 What is the c'th term of -489, -486, -473, -444, -393? c3 - c2 - c - 488 What is the p'th term of -2552, -2574, -2604, -2648, -2712, -2802, -2924, -3084? -p*3 + 2p*2 - 21p - 2532 What is the j'th term of 11, 42, 75, 110, 147, 186, 227? j*2 + 28j - 18 What is the d'th term of -901, -886, -873, -862, -853, -846? -d*2 + 18d - 918 What is the d'th term of 43, 124, 337, 748, 1423, 2428? 11d3 + 4d + 28 What is the t'th term of 14, 53, 120, 215, 338, 489, 668? 14t2 - 3t + 3 What is the c'th term of 2002, 2004, 2008, 2014? c2 - c + 2002 What is the s'th term of 125, 119, 103, 71, 17, -65, -181, -337? -s3 + s*2 - 2s + 127 What is the s'th term of -79, -80, -81, -82, -83, -84? -s - 78 What is the p'th term of -15, -8, -1, 6? 7p - 22 What is the o'th term of 27, 127, 297, 537? 35o*2 - 5o - 3 What is the i'th term of 93, 167, 283, 435, 617, 823, 1047? -i*3 + 27i*2 + 67 What is the r'th term of -39575, -79150, -118725, -158300, -197875? -39575r What is the d'th term of -304, -1411, -3264, -5869, -9232, -13359, -18256, -23929? -d*3 - 367d*2 + d + 63 What is the x'th term of 782, 785, 788, 791, 794? 3x + 779 What is the f'th term of -12, -12, -10, -6, 0, 8? f*2 - 3f - 10 What is the u'th term of 1410, 1419, 1442, 1485, 1554, 1655? u3 + u2 - u + 1409 What is the f'th term of -122, -246, -370, -494? -124f + 2 What is the o'th term of 22, 47, 72, 97? 25o - 3 What is the g'th term of -5, -8, -13, -20, -29? -g*2 - 4 What is the b'th term of 207, 432, 807, 1332, 2007, 2832, 3807? 75b*2 + 132 What is the d'th term of 139, 281, 417, 547, 671, 789, 901? -3d*2 + 151d - 9 What is the z'th term of -279, -560, -847, -1146, -1463? -z*3 + 3z*2 - 283z + 2 What is the x'th term of 33, 18, -19, -90, -207, -382, -627? -2x3 + x2 - 4x + 38 What is the n'th term of -24, -43, -82, -147, -244, -379, -558, -787? -n*3 - 4n2 - 19 What is the k'th term of 103, 110, 129, 166, 227? k3 + 102 What is the j'th term of -13, -14, -15, -16, -17? -j - 12 What is the s'th term of -25, -29, -33, -37, -41? -4s - 21 What is the k'th term of -778, -1549, -2320, -3091? -771k - 7 What is the m'th term of -212, -252, -318, -410, -528, -672, -842? -13m2 - m - 198 What is the w'th term of 171, 176, 191, 222, 275, 356, 471, 626? w3 - w2 + w + 170 What is the c'th term of 54, 112, 170? 58c - 4 What is the h'th term of 25, 2, -21, -32, -19, 30, 127? 2h3 - 12h*2 - h + 36 What is the q'th term of -94, -127, -180, -253, -346? -10q*2 - 3q - 81 What is the x'th term of -4145, -4142, -4137, -4130, -4121, -4110? x2 - 4146 What is the r'th term of -16, -33, -64, -115, -192, -301, -448, -639? -r3 - r*2 - 7r - 7 What is the l'th term of -152, -151, -142, -119, -76, -7, 94? l*3 - 2l2 - 151 What is the h'th term of 16, 17, 18, 19, 20? h + 15 What is the u'th term of 46, 13, -50, -149, -290? -u3 - 9u2 + u + 55 What is the p'th term of -47, -44, -37, -26, -11? 2p*2 - 3p - 46 What is the q'th term of -23, -32, -41? -9q - 14 What is the f'th term of 0, 87, 254, 507, 852? f3 + 34f*2 - 22f - 13 What is the k'th term of -232, -935, -2106, -3745, -5852? -234k2 - k + 3 What is the h'th term of 21, 44, 65, 84, 101, 116, 129? -h2 + 26h - 4 What is the n'th term of -56, -80, -120, -176, -248? -8n2 - 48 What is the b'th term of 9, 16, 21, 24? -b2 + 10b What is the h'th term of -770, -735, -714, -713, -738, -795, -890, -1029? -h3 - h2 + 45h - 813 What is the x'th term of 2434, 2411, 2352, 2239, 2054, 1779, 1396? -3x*3 - 2x + 2439 What is the k'th term of -63, -134, -201, -258, -299? k*3 - 4k*2 - 66k + 6 What is the n'th term of -492, -1984, -4476, -7968, -12460? -500n2 + 8n What is the i'th term of -51, -70, -89, -108, -127? -19i - 32 What is the x'th term of 91, 240, 389, 538, 687? 149x - 58 What is the p'th term of -41, -35, -27, -17, -5? p*2 + 3p - 45 What is the y'th term of 18, 61, 166, 363, 682, 1153, 1806? 5y3 + y2 + 5y + 7 What is the l'th term of 795, 1587, 2379? 792l + 3 What is the g'th term of 5677, 5675, 5671, 5665, 5657, 5647? -g2 + g + 5677 What is the s'th term of -541, -1083, -1611, -2119, -2601? s3 + s2 - 552s + 9 What is the t'th term of -17, -18, -19? -t - 16 What is the m'th term of -1404, -2810, -4224, -5652, -7100, -8574, -10080, -11624? -m*3 + 2m*2 - 1405m What is the f'th term of -1906, -1925, -1942, -1957, -1970? f*2 - 22f - 1885 What is the k'th term of 104, 114, 140, 188, 264, 374? k*3 + 2k*2 - 3k + 104 What is the l'th term of 92, 72, 52, 32, 12, -8? -20l + 112 What is the y'th term of 9606, 9605, 9604, 9603? -y + 9607 What is the q'th term of -65, -87, -123, -173, -237? -7q*2 - q - 57 What is the x'th term of -29, -90, -169, -266? -9x*2 - 34x + 14 What is the w'th term of 3, -11, -25, -39, -53, -67? -14w + 17 What is the b'th term of 6306, 12615, 18924, 25233? 6309b - 3 What is the w'th term of 2058, 4118, 6178, 8238? 2060w - 2 What is the x'th term of 307, 320, 367, 466, 635, 892? 3x3 - x2 - 5x + 310 What is the s'th term of 3, 4, 3, 0? -s2 + 4s What is the r'th term of -105, -126, -165, -222, -297, -390, -501? -9r2 + 6r - 102 What is the l'th term of 728, 1458, 2186, 2912, 3636, 4358, 5078? -l*2 + 733l - 4 What is the m'th term of -115, -125, -125, -109, -71? m3 - m2 - 14m - 101 What is the i'th term of 76, 78, 80? 2i + 74 What is the a'th term of -417, -416, -415, -414, -413, -412? a - 418 What is the p'th term of 775, 776, 777, 778, 779, 780? p + 774 What is the r'th term of 134, 136, 138, 140, 142? 2r + 132 What is the b'th term of -7, 4, 15, 26? 11b - 18 What is the r'th term of 1887, 1895, 1915, 1953, 2015, 2107, 2235, 2405? r3 + r + 1885 What is the l'th term of -5, -2, 9, 34, 79, 150, 253? l3 - 2l2 + 2l - 6 What is the y'th term of 17, 82, 189, 338, 5	{ "pile_set_name": "DM Mathematics" }
term of 12, -6, -40, -84, -132? n*3 - 14n*2 + 17n + 8 What is the j'th term of 5, 17, 39, 77, 137, 225? j3 - j2 + 8j - 3 What is the y'th term of -12, -9, -4, 3, 12, 23, 36? y2 - 13 What is the k'th term of 44, 40, 38, 38? k2 - 7k + 50 What is the q'th term of 703, 697, 687, 673, 655, 633? -2q2 + 705 What is the c'th term of 58, 58, 52, 34, -2, -62, -152, -278? -c3 + 3c*2 - 2c + 58 What is the p'th term of -200, -789, -1762, -3113, -4836, -6925? p*3 - 198p*2 - 2p - 1 What is the x'th term of -1166, -1160, -1144, -1112, -1058? x3 - x2 + 2x - 1168 What is the t'th term of 45, 164, 283? 119t - 74 What is the b'th term of 108, 106, 104, 102? -2b + 110 What is the d'th term of -706, -1418, -2132, -2848, -3566, -4286? -d2 - 709d + 4 What is the o'th term of 32, 113, 242, 419, 644? 24o2 + 9o - 1 What is the j'th term of 600, 599, 598, 597, 596? -j + 601 What is the x'th term of 3, -2, -7, -12? -5x + 8 What is the v'th term of 3, 1, 5, 21, 55, 113, 201? v3 - 3v2 + 5 What is the c'th term of -16, 11, 62, 143, 260, 419, 626, 887? c3 + 6c2 + 2c - 25 What is the v'th term of 174, 700, 1574, 2796, 4366, 6284, 8550? 174v2 + 4v - 4 What is the d'th term of 4185, 8364, 12533, 16686, 20817, 24920, 28989? -d3 + d2 + 4183d + 2 What is the k'th term of 119, 124, 133, 146, 163, 184? 2k2 - k + 118 What is the x'th term of 906, 898, 900, 918, 958? x3 - x*2 - 12x + 918 What is the h'th term of 59025, 59019, 59003, 58971, 58917, 58835? -h3 + h2 - 2h + 59027 What is the i'th term of -884, -877, -870? 7i - 891 What is the d'th term of -36, -136, -320, -600, -988, -1496, -2136, -2920? -2d3 - 30d*2 + 4d - 8 What is the o'th term of -247, -241, -245, -265, -307, -377, -481? -o3 + o2 + 10o - 257 What is the r'th term of 1674, 1673, 1670, 1665, 1658, 1649, 1638? -r2 + 2r + 1673 What is the c'th term of 223, 450, 677? 227c - 4 What is the v'th term of 251, 514, 791, 1088, 1411, 1766, 2159, 2596? v3 + v2 + 253v - 4 What is the f'th term of -1815, -3628, -5441, -7254, -9067, -10880? -1813f - 2 What is the v'th term of 11, 30, 51, 74, 99, 126? v2 + 16v - 6 What is the t'th term of 266, 265, 264? -t + 267 What is the t'th term of 48, 170, 362, 618, 932, 1298, 1710? -t*3 + 41t*2 + 6t + 2 What is the i'th term of -176, -187, -198, -203, -196, -171? i*3 - 6i2 - 171 What is the z'th term of 32, 39, 36, 17, -24, -93, -196? -z3 + z*2 + 11z + 21 What is the r'th term of -2, -16, -34, -50, -58, -52? r*3 - 8r*2 + 3r + 2 What is the k'th term of 6, -7, -28, -57? -4k2 - k + 11 What is the r'th term of 1119, 2239, 3359, 4479, 5599? 1120r - 1 What is the n'th term of -1028, -1027, -1026? n - 1029 What is the v'th term of 2819, 5638, 8457, 11276? 2819v What is the u'th term of 76, 70, 50, 10, -56, -154, -290, -470? -u3 - u2 + 4u + 74 What is the y'th term of 483, 959, 1435, 1911, 2387, 2863? 476y + 7 What is the a'th term of -12, -19, -24, -27? a2 - 10a - 3 What is the t'th term of -753, -751, -749, -747, -745, -743? 2t - 755 What is the i'th term of -405, -396, -373, -330, -261? i3 + i2 - i - 406 What is the t'th term of -279, -559, -839, -1119, -1399? -280t + 1 What is the p'th term of 370, 738, 1106? 368p + 2 What is the q'th term of 2334, 2329, 2322, 2313, 2302, 2289? -q2 - 2q + 2337 What is the y'th term of 1, -16, -53, -116, -211, -344, -521, -748? -y*3 - 4y*2 + 2y + 4 What is the h'th term of -2969, -2970, -2971, -2972? -h - 2968 What is the o'th term of 1220, 1221, 1222, 1223, 1224? o + 1219 What is the g'th term of 395, 849, 1299, 1745, 2187? -2g2 + 460g - 63 What is the k'th term of 108, 219, 326, 429, 528, 623, 714? -2k2 + 117k - 7 What is the x'th term of 5395, 5394, 5393, 5392? -x + 5396 What is the p'th term of -6, -10, -26, -60, -118, -206? -p*3 + 3p - 8 What is the s'th term of 50, 102, 154, 206? 52s - 2 What is the z'th term of 104, 123, 164, 233, 336? z3 + 5z*2 - 3z + 101 What is the f'th term of -32, -113, -248, -437, -680? -27f2 - 5 What is the n'th term of 30, 13, -22, -81, -170, -295? -n3 - 3n*2 - n + 35 What is the v'th term of 7, -11, -29, -47, -65, -83? -18v + 25 What is the r'th term of 212, 219, 226, 233, 240? 7r + 205 What is the q'th term of 823, 3286, 7391, 13138, 20527, 29558, 40231? 821q2 + 2 What is the w'th term of -24, -34, -60, -108, -184, -294? -w3 - 2w2 + 3w - 24 What is the s'th term of -292, -293, -296, -301, -308, -317? -s*2 + 2s - 293 What is the o'th term of 188, 181, 162, 125, 64, -27? -o*3 + 189 What is the i'th term of -3143, -3152, -3161, -3170? -9i - 3134 What is the s'th term of -12, -17, -32, -63, -116, -197? -s3 + s2 - s - 11 What is the h'th term of 64, 284, 650, 1162, 1820? 73h2 + h - 10 What is the a'th term of -40, -46, -56, -70? -2a*2 - 38 What is the n'th term of -10, -41, -112, -241, -446? -3n*3 - 2n*2 - 4n - 1 What is the a'th term of 31, 28, 21, 10? -2a2 + 3a + 30 What is the v'th term of -15, -48, -109, -204, -339, -520, -753, -1044? -v*3 - 8v*2 - 2v - 4 What is the n'th term of -66, -61, -56, -51, -46, -41? 5n - 71 What is the t'th term of 290, 288, 286? -2t + 292 What is the p'th term of 1294, 2580, 3844, 5074, 6258, 7384? -2p3 + p2 + 1297p - 2 What is the f'th term of -13, 14, 31, 32, 11, -38, -121, -244? -f3 + f2 + 31f - 44 What is the x'th term of 115, 194, 273? 79x + 36 What is the w'th term of -42, -82, -122, -162, -202, -242? -40w - 2 What is the q'th term of 286, 281, 276, 271? -5q + 291 What is the q'th term of 936, 952, 970, 984, 988, 976, 942? -q*3 + 7q*2 + 2q + 928 What is the o'th term of -6, -7, 2, 27, 74, 149? o3 - o2 - 5o - 1 What is the z'th term of -1073, -2151, -3231, -4313, -5397, -6483? -z2 - 1075z + 3 What is the a'th term of 23, 30, 39, 50? a*2 + 4a + 18 What is the l'th term of -5377, -5379, -5383, -5389, -5397, -5407, -5419? -l*2 + l - 5377 What is the s'th term of -9, -37, -65? -28s + 19 What is the i'th term of -13, -1, 31, 83, 155? 10i2 - 18i - 5 What is the g'th term of 355, 352, 347, 340, 331? -g2 + 356 What is the b'th term of 90, 177, 262, 345, 426? -b2 + 90b + 1 What is the u'th term of 21, 70, 151, 264? 16u*2 + u + 4 What is the b'th term of 217, 212, 207, 202, 197? -5b + 222 What is the q'th term of -1237, -1236, -1235? q - 1238 What is the i'th term of 7568, 7570, 7572, 7574? 2i + 7566 What is the y'th term of -19, -43, -57, -55, -31, 21, 107, 233? y3 - y2 - 28y + 9 What is the v'th term of 468, 924, 1380, 1836, 2292, 2748? 456v + 12 What is the o'th term of 530, 556, 582, 608? 26o + 504 What is the i'th term of 19, 45, 71, 97, 123, 149? 26i - 7 What is the k'th term of 4487, 4486, 4485, 4484, 4483, 4482? -k + 4488 What is the x'th term of 670, 672, 674? 2x + 668 What is the l'th term of -86, -100, -138, -212, -334, -516, -770, -1108? -2l3 - 84 What is the q'th term of 24, 43, 64, 81, 88? -q3 + 7q*2 + 5q + 13 What is the t'th term of 35633, 35634, 35635? t + 35632 What is the b'th term of -47, -99, -151, -203, -255? -52b + 5 What is the x'th term of -232, -233, -234, -235? -x - 231 What is the j'th term of -63, -132, -203, -276? -j2 - 66j + 4 What is the s'th term of -1244, -1242, -1238, -1232, -1224? s2 - s - 1244 What is the s'th term of -2, -18, -40, -62, -78, -82, -68? s3 - 9s2 + 4s + 2 What is the m'th term of -69, -117, -163, -207? m*2 - 51m - 19 What is the l'th term of -521, -520, -511, -488, -445, -376, -275? l*3 - 2l*2 - 520 What is the l'th term of -2104, -2102, -2100, -2098, -2096? 2l - 2106 What is the o'th term of 1486, 5912, 13288, 23614, 36890, 53116, 72292? 1475o2 + o + 10 What is the v'th term of 199, 205, 221, 253, 307, 389, 505, 661? v3 - v2 + 2v + 197 What is the c'th term of -1841, -3683, -5525, -7367, -9209, -11051? -1842c + 1 What is the q'th term of -14, -12, -8, -2, 6, 16, 28? q2 - q - 14 What is the h'th term of 198, 212, 226, 240, 254, 268? 14h + 184 What is the i'th term of 26, 124, 386, 896, 1738, 2996? 14i3 - 2i*2 + 6i + 8 What is the b'th term of 17, 12, 19, 44, 93, 172, 287? b*3 - 12b + 28 What is the p'th term of 9, 6, 3, 0, -3? -3*p + 12 What is the h'th term of	{ "pile_set_name": "DM Mathematics" }
88510 is divided by 1772. 1682 What is the remainder when 2008 is divided by 339? 313 Calculate the remainder when 72094 is divided by 346. 126 What is the remainder when 6409 is divided by 278? 15 Calculate the remainder when 540267 is divided by 405. 402 What is the remainder when 3903 is divided by 292? 107 What is the remainder when 28772997 is divided by 1000? 997 Calculate the remainder when 13867 is divided by 7. 0 What is the remainder when 159063 is divided by 3180? 63 What is the remainder when 359 is divided by 66? 29 What is the remainder when 44381 is divided by 78? 77 Calculate the remainder when 22410 is divided by 265. 150 What is the remainder when 4956 is divided by 513? 339 Calculate the remainder when 315432 is divided by 751. 12 What is the remainder when 92159 is divided by 120? 119 What is the remainder when 247942 is divided by 95? 87 Calculate the remainder when 10179 is divided by 767. 208 Calculate the remainder when 3003 is divided by 1495. 13 Calculate the remainder when 5679 is divided by 194. 53 What is the remainder when 1111 is divided by 93? 88 What is the remainder when 2279 is divided by 568? 7 Calculate the remainder when 202854 is divided by 10. 4 What is the remainder when 376194 is divided by 79? 75 Calculate the remainder when 72614 is divided by 1770. 44 What is the remainder when 1209455 is divided by 888? 887 Calculate the remainder when 40059 is divided by 413. 411 Calculate the remainder when 28971 is divided by 964. 51 What is the remainder when 3461 is divided by 68? 61 What is the remainder when 96040 is divided by 15? 10 What is the remainder when 5058 is divided by 52? 14 What is the remainder when 3400 is divided by 84? 40 Calculate the remainder when 7969 is divided by 129. 100 Calculate the remainder when 3503 is divided by 318. 5 Calculate the remainder when 992156 is divided by 32. 28 What is the remainder when 1733 is divided by 552? 77 What is the remainder when 1280 is divided by 408? 56 Calculate the remainder when 338 is divided by 103. 29 Calculate the remainder when 352406 is divided by 248. 246 Calculate the remainder when 1595 is divided by 618. 359 What is the remainder when 1662 is divided by 1565? 97 Calculate the remainder when 13471 is divided by 7. 3 Calculate the remainder when 4210 is divided by 105. 10 What is the remainder when 5237 is divided by 220? 177 Calculate the remainder when 224587 is divided by 31. 23 What is the remainder when 4009 is divided by 335? 324 Calculate the remainder when 1240 is divided by 79. 55 What is the remainder when 12479 is divided by 1039? 11 What is the remainder when 180477 is divided by 376? 373 What is the remainder when 2729 is divided by 97? 13 What is the remainder when 3699 is divided by 3585? 114 Calculate the remainder when 17559 is divided by 501. 24 What is the remainder when 19533 is divided by 9687? 159 Calculate the remainder when 5062458 is divided by 20. 18 Calculate the remainder when 2055 is divided by 21. 18 What is the remainder when 160170 is divided by 119? 115 Calculate the remainder when 80710 is divided by 40. 30 Calculate the remainder when 27256 is divided by 58. 54 Calculate the remainder when 1273 is divided by 232. 113 Calculate the remainder when 60580 is divided by 166. 156 What is the remainder when 116574 is divided by 348? 342 Calculate the remainder when 676234 is divided by 338113. 8 Calculate the remainder when 2196975 is divided by 61. 60 What is the remainder when 253386 is divided by 84459? 9 Calculate the remainder when 5702 is divided by 1799. 305 What is the remainder when 4958528 is divided by 1652842? 2 What is the remainder when 5689 is divided by 70? 19 Calculate the remainder when 68151 is divided by 68088. 63 Calculate the remainder when 10289 is divided by 5. 4 Calculate the remainder when 9195 is divided by 4. 3 Calculate the remainder when 1905 is divided by 1293. 612 Calculate the remainder when 2432 is divided by 600. 32 What is the remainder when 133461 is divided by 161? 153 What is the remainder when 4944 is divided by 99? 93 What is the remainder when 1389 is divided by 6? 3 Calculate the remainder when 738 is divided by 382. 356 Calculate the remainder when 5226 is divided by 146. 116 What is the remainder when 1936 is divided by 490? 466 What is the remainder when 12939 is divided by 121? 113 What is the remainder when 169376 is divided by 60? 56 Calculate the remainder when 220338 is divided by 1191. 3 Calculate the remainder when 203791 is divided by 589. 586 Calculate the remainder when 161226 is divided by 241. 238 Calculate the remainder when 635 is divided by 252. 131 Calculate the remainder when 2118 is divided by 704. 6 What is the remainder when 3774 is divided by 1836? 102 Calculate the remainder when 122267 is divided by 24447. 32 Calculate the remainder when 38718 is divided by 9669. 42 What is the remainder when 68249 is divided by 72? 65 Calculate the remainder when 7397 is divided by 68. 53 Calculate the remainder when 337259 is divided by 2248. 59 Calculate the remainder when 87891 is divided by 53. 17 Calculate the remainder when 7152 is divided by 56. 40 What is the remainder when 6011 is divided by 352? 27 What is the remainder when 131160 is divided by 3974? 18 What is the remainder when 318658 is divided by 45? 13 What is the remainder when 654 is divided by 214? 12 What is the remainder when 22201 is divided by 493? 16 What is the remainder when 24846 is divided by 828? 6 Calculate the remainder when 16800 is divided by 290. 270 What is the remainder when 4355 is divided by 522? 179 Calculate the remainder when 6524 is divided by 6386. 138 Calculate the remainder when 78789 is divided by 588. 585 Calculate the remainder when 960782 is divided by 22. 20 Calculate the remainder when 56639 is divided by 180. 119 What is the remainder when 23981 is divided by 11980? 21 Calculate the remainder when 5309 is divided by 331. 13 Calculate the remainder when 1869762 is divided by 41. 39 What is the remainder when 1062601 is divided by 4765? 6 Calculate the remainder when 804 is divided by 137. 119 What is the remainder when 29622 is divided by 29590? 32 Calculate the remainder when 9035 is divided by 705. 575 Calculate the remainder when 1408 is divided by 19. 2 Calculate the remainder when 146895 is divided by 9. 6 Calculate the remainder when 487 is divided by 215. 57 What is the remainder when 17748 is divided by 40? 28 What is the remainder when 47761 is divided by 11937? 13 What is the remainder when 148353 is divided by 1279? 1268 What is the remainder when 7521 is divided by 175? 171 Calculate the remainder when 6557 is divided by 2173. 38 Calculate the remainder when 40297 is divided by 1087. 78 What is the remainder when 73510 is divided by 327? 262 Calculate the remainder when 69412 is divided by 12. 4 What is the remainder when 1993 is divided by 637? 82 What is the remainder when 14087 is divided by 6? 5 Calculate the remainder when 5241 is divided by 1026. 111 Calculate the remainder when 9445 is divided by 103. 72 Calculate the remainder when 30494 is divided by 2063. 1612 Calculate the remainder when 181897 is divided by 761. 18 What is the remainder when 99552 is divided by 26? 24 What is the remainder when 524139 is divided by 5? 4 Calculate the remainder when 14929 is divided by 648. 25 Calculate the remainder when 100051 is divided by 488. 11 Calculate the remainder when 341208 is divided by 17. 1 What is the remainder when 35045 is divided by 366? 275 Calculate the remainder when 81380 is divided by 5. 0 What is the remainder when 142789 is divided by 438? 1 What is the remainder when 6318 is divided by 3154? 10 What is the remainder when 123531 is divided by 355? 346 Calculate the remainder when 9389 is divided by 4568. 253 What is the remainder when 27042 is divided by 15? 12 Calculate the remainder when 9778 is divided by 813. 22 Calculate the remainder when 30879 is divided by 10291. 6 What is the remainder when 5691 is divided by 234? 75 Calculate the remainder when 2213 is divided by 170. 3 Calculate the remainder when 52751 is divided by 42. 41 What is the remainder when 113821 is divided by 346? 333 Calculate the remainder when 8004	{ "pile_set_name": "DM Mathematics" }
00040124752 rounded to seven decimal places? 0.0000401 What is 0.0000009762807 rounded to seven decimal places? 0.000001 Round -4.450351 to the nearest integer. -4 Round 0.0639708 to 4 dps. 0.064 Round -0.022312 to three dps. -0.022 Round 62026683 to the nearest one million. 62000000 What is 181872.99 rounded to the nearest ten thousand? 180000 Round 174299.7 to the nearest 10000. 170000 What is -7894.2 rounded to the nearest 10? -7890 What is -186.975 rounded to zero dps? -187 Round -1587110 to the nearest 10000. -1590000 What is 43626.26 rounded to the nearest one thousand? 44000 What is -0.0024614783 rounded to six decimal places? -0.002461 Round -6.94586 to the nearest integer. -7 What is -0.00020503593 rounded to seven decimal places? -0.000205 What is -82.4482 rounded to the nearest ten? -80 What is -0.00635331 rounded to five decimal places? -0.00635 What is -0.0000019253619 rounded to seven decimal places? -0.0000019 Round 8568.32 to the nearest 100. 8600 What is 0.000005319419 rounded to 7 dps? 0.0000053 What is 0.00021178612 rounded to 6 dps? 0.000212 What is 4.82703 rounded to one decimal place? 4.8 Round -0.0000020376449 to six decimal places. -0.000002 What is 0.4132743 rounded to 2 decimal places? 0.41 Round -1177308.2 to the nearest one hundred thousand. -1200000 Round 958.91 to the nearest 10. 960 Round 0.004826644 to 3 decimal places. 0.005 Round 53230789 to the nearest ten thousand. 53230000 Round 0.00049905 to seven decimal places. 0.0004991 What is -31.42619 rounded to the nearest integer? -31 Round 0.451955 to 3 dps. 0.452 Round 89415.4 to the nearest ten thousand. 90000 What is -142.7636 rounded to 1 dp? -142.8 Round 0.015486905 to 4 decimal places. 0.0155 What is 0.00738609 rounded to four dps? 0.0074 What is 0.000122306 rounded to 7 dps? 0.0001223 What is -287.085 rounded to the nearest integer? -287 Round -44.81789 to the nearest 10. -40 What is -27.655 rounded to one decimal place? -27.7 What is -54.4439 rounded to zero dps? -54 What is 0.78904377 rounded to two dps? 0.79 What is 0.0147599 rounded to 5 decimal places? 0.01476 What is 65418270 rounded to the nearest one million? 65000000 What is 24.9905 rounded to the nearest ten? 20 Round -0.00000263359 to 6 decimal places. -0.000003 Round 0.00000018329079 to 7 decimal places. 0.0000002 What is 3302.99 rounded to the nearest 10? 3300 Round -0.0000072442686 to seven dps. -0.0000072 What is 183609800 rounded to the nearest one hundred thousand? 183600000 What is 40866.2 rounded to the nearest one hundred? 40900 What is -19093.7 rounded to the nearest one thousand? -19000 Round -0.0341552 to 3 dps. -0.034 Round 39164400 to the nearest 100000. 39200000 Round -48.97535 to one dp. -49 What is -0.0244039 rounded to 3 decimal places? -0.024 What is -115520200 rounded to the nearest one million? -116000000 What is -194982.9 rounded to the nearest 1000? -195000 What is -16.259518 rounded to 1 dp? -16.3 What is -8214620 rounded to the nearest 100000? -8200000 What is 0.003208127 rounded to five dps? 0.00321 Round -49.778338 to 2 dps. -49.78 What is -232183 rounded to the nearest 100000? -200000 Round -0.0013526925 to five decimal places. -0.00135 What is 1868.851 rounded to the nearest 100? 1900 Round 1.927666 to two dps. 1.93 Round -0.000047093577 to 5 dps. -0.00005 Round 55019900 to the nearest 1000000. 55000000 What is 0.00832945 rounded to five dps? 0.00833 What is -0.001008541 rounded to four dps? -0.001 What is -0.0000698618 rounded to six decimal places? -0.00007 What is -10784427 rounded to the nearest 100000? -10800000 Round -0.000015481873 to 7 decimal places. -0.0000155 Round -6451.578 to the nearest ten. -6450 Round -1070281.2 to the nearest one thousand. -1070000 What is 0.06865895 rounded to 2 decimal places? 0.07 Round 0.00012597881 to 6 decimal places. 0.000126 What is -0.11345784 rounded to four dps? -0.1135 Round 0.0702909 to four dps. 0.0703 Round 34658 to the nearest 10000. 30000 What is -0.0008798651 rounded to 4 dps? -0.0009 What is -0.0002013537 rounded to 7 dps? -0.0002014 What is -550755600 rounded to the nearest 100000? -550800000 What is 0.00000950329 rounded to six dps? 0.00001 Round -85470 to the nearest ten thousand. -90000 Round -0.2734749 to three decimal places. -0.273 What is 9665.761 rounded to the nearest 1000? 10000 Round 0.000781609 to 5 decimal places. 0.00078 Round -0.000328314 to four decimal places. -0.0003 What is 0.00011963058 rounded to 5 dps? 0.00012 Round 862.76 to the nearest ten. 860 What is 4.79458 rounded to 2 decimal places? 4.79 What is -202910 rounded to the nearest 100000? -200000 What is -0.0155133 rounded to 4 decimal places? -0.0155 What is -0.0006343894 rounded to five dps? -0.00063 What is 39104450 rounded to the nearest 1000000? 39000000 Round -0.000000904853 to 7 decimal places. -0.0000009 Round -4062.581 to the nearest 10. -4060 What is -1790380 rounded to the nearest ten thousand? -1790000 What is 31492.54 rounded to the nearest one thousand? 31000 What is -3619.48 rounded to the nearest 1000? -4000 What is -0.646479 rounded to three dps? -0.646 What is -1493.39 rounded to the nearest 100? -1500 What is -0.0979892 rounded to two decimal places? -0.1 What is 0.0351077 rounded to two decimal places? 0.04 Round 0.000000386586 to seven dps. 0.0000004 Round 0.0596767 to two decimal places. 0.06 What is -215.7373 rounded to the nearest 100? -200 Round 1784.247 to the nearest 100. 1800 What is 0.08001419 rounded to five decimal places? 0.08001 Round 36.4974 to 1 dp. 36.5 Round -10647628000 to the nearest one million. -10648000000 Round -9692.5 to the nearest 100. -9700 Round -0.012673423 to six dps. -0.012673 What is -22007.095 rounded to the nearest one hundred? -22000 What is -2922.901 rounded to the nearest ten? -2920 Round -0.00006300341 to six dps. -0.000063 Round 0.447759 to 1 dp. 0.4 Round 0.00010521191 to 6 decimal places. 0.000105 Round -0.0017049682 to 6 decimal places. -0.001705 What is 15800.5 rounded to the nearest 1000? 16000 Round -0.0036881 to 3 dps. -0.004 What is -4.893448 rounded to the nearest integer? -5 What is -0.46677 rounded to two dps? -0.47 Round 36.1559 to the nearest 10. 40 Round 0.0000041604911 to 7 decimal places. 0.0000042 What is 597394.5 rounded to the nearest one hundred thousand? 600000 What is 0.5036001 rounded to four decimal places? 0.5036 What is -0.000052305 rounded to five dps? -0.00005 What is -0.00000058533 rounded to seven dps? -0.0000006 Round -22.8264 to 0 dps. -23 Round -0.0341936 to four dps. -0.0342 Round 59107.21 to the nearest ten. 59110 What is -0.00159725 rounded to 5 decimal places? -0.0016 What is -0.00009354731 rounded to 5 decimal places? -0.00009 Round 142613.94 to the nearest one hundred. 142600 Round -17.81503 to 1 decimal place. -17.8 Round 7.409972 to 3 decimal places. 7.41 Round 0.00190549 to 5 decimal places. 0.00191 Round -0.00000178711 to 7 decimal places. -0.0000018 What is 0.0007555493 rounded to 4 dps? 0.0008 Round -11614.7999 to the nearest integer. -11615 Round 0.90918 to 3 dps. 0.909 What is -11.965117 rounded to one dp? -12 Round -0.09305932 to four dps. -0.0931 What is -0.3576693 rounded to four dps? -0.3577 What is 50672 rounded to the nearest one hundred thousand? 100000 Round -333089 to the nearest one thousand. -333000 Round -22.3727 to two dps. -22.37 Round -25149720 to the nearest 1000000. -25000000 Round 89.0679 to one dp. 89.1 What is 0.047083 rounded to three dps? 0.047 What is -0.953304 rounded to three dps? -0.953 What is -436131 rounded to the nearest one thousand? -436000 Round -4.5764 to 0 dps. -5 What is 0.0255129 rounded to 3 dps? 0.026 Round -20.31796 to one dp. -20.3 What is -841.62 rounded to the nearest one hundred? -800 What is 0.00670081 rounded to 4 decimal places? 0.0067 What is -0.7238793 rounded to three decimal places? -0.724 What is -0.01052381 rounded to 5 decimal places? -0.01052 What is 0.0000271396 rounded to 6 decimal places? 0.000027 What is 0.249691 rounded to two decimal places? 0.25 What is 0.004282941 rounded to three decimal places? 0.004 What is 0.00005488809 rounded to 7 decimal places? 0.0000549 What is -99886.5 rounded to the nearest ten thousand? -100000 What is 0.00008908254 rounded to seven decimal	{ "pile_set_name": "DM Mathematics" }
, 3, m Let m(q) = 5q3 - q2. Let r be m(1). Put r, -2, 5 in decreasing order. 5, r, -2 Let m = 26 - 183/7. Put -3, 4, m in descending order. 4, m, -3 Let j = 0.2 - 0.3. Sort j, -3/5, -0.3 in descending order. j, -0.3, -3/5 Let f be 10(-2)/(-10)2. Let t = 3 + -5. Put t, f, 3 in decreasing order. f, 3, t Let f = 20.5 + 4.5. Let s = -21 + f. Let o be (-2)/(-24) + (-4)/(-6). Put o, s, 1/4 in ascending order. 1/4, o, s Let h = -5 + 5.3. Let t be 1/3 + 33/9. Put t, 3/2, h in ascending order. h, 3/2, t Let r be 2/2424/27. Let q = 0.17 + 0.83. Sort r, -5, q in decreasing order. q, r, -5 Let a be (-9)/(-6)32/12. Suppose -af + 19 = 15. Put f, 8, 0 in increasing order. 0, f, 8 Let s = 171/55 - 21/11. Sort -0.5, s, -1/3 in ascending order. -0.5, -1/3, s Let o be 27/((-5)/(-3) + (-3)/18). Put -0.4, o, -1 in increasing order. -1, -0.4, o Let r(h) = -2h2 - 2h + 12. Let z be r(-4). Sort 5, -5, -2, z. z, -5, -2, 5 Let y = -19.7 - -20. Put -5, y, -6, -0.1 in decreasing order. y, -0.1, -5, -6 Let f = -26 + 30. Sort f, 3, -8 in descending order. f, 3, -8 Let b(t) = t*3 + 4t*2 + 4t + 4. Let x be b(-3). Suppose -4k + 7 = 23. Let a = k + 7. Sort x, a, -2 in increasing order. -2, x, a Let b(i) = i - 5. Let w be b(7). Put w, 3, -5, -1 in increasing order. -5, -1, w, 3 Let m(q) = q3 - 8q*2 + 6q + 14. Let j be m(7). Sort -3/5, j, 4. -3/5, 4, j Let j = -1 + 1. Let g = -465/4 - -117. Let o = 0.5 + -0.3. Sort j, o, g. j, o, g Suppose 4s + 3z + 15 = 3s, 2z = -2. Let y be (-8)/(-3)(-18)/s. Suppose 2 - y = 2p. Sort p, 1, 4. p, 1, 4 Suppose 0 = -p + y - 2, -11 = 2p + p - 4y. Let g(w) = -2w - 1. Let u be g(p). Let l = u + 22/3. Put l, 2/3, 3 in increasing order. l, 2/3, 3 Suppose -5t = h - 3h + 8, 3t = -h + 4. Let b = -12.1 - -12. Put b, t, -1 in increasing order. -1, b, t Let x = -89/6 - -1145/78. Suppose 0 = b - 2b + 5. Suppose -2u = -2z + 6, -bu - 5z = -z + 24. Sort u, 3/8, x. u, x, 3/8 Let r be ((-24)/20)/3 - 0. Sort 3, 6, r, -2/3 in descending order. 6, 3, r, -2/3 Let h = -41 - -21. Let w = h - -20.5. Let k = 4 + -2. Sort -0.4, w, k. -0.4, w, k Suppose -26 = -a - 21. Sort -0.5, a, -4 in increasing order. -4, -0.5, a Let c = -0.1 - -0.04. Let a = c - 0.24. Sort 4, a, 2. a, 2, 4 Let u(d) = -d - 11. Let p be u(-11). Suppose -2 = -po - 2o. Sort -1, -5, o in descending order. o, -1, -5 Let u = 2.4 - 1.4. Let g = -1.1 + u. Put g, -0.2, 6 in descending order. 6, g, -0.2 Let p(l) = l3 + 8l*2 - 8l + 13. Let a be p(-9). Sort 0.5, -1/5, a in decreasing order. a, 0.5, -1/5 Let s(m) = m + 5. Let y be s(-8). Suppose 2n = -n + 24. Suppose n = -5x - 2. Sort x, y, 2. y, x, 2 Suppose -2h + 7 + 21 = 0. Sort -1, 2, h. -1, 2, h Let n be (-104)/(-16) + 6/(-4). Put -1, n, 0 in decreasing order. n, 0, -1 Let m = -0.15 - -0.25. Sort m, 0, -1/3 in decreasing order. m, 0, -1/3 Let t = 42.9 + -43. Sort 4/3, 0.4, t in descending order. 4/3, 0.4, t Suppose -4y = 11 + 45. Let r be (-2)/(-7) - 24/y. Let t(z) = -z*3 + 6z*2. Let g be t(6). Put 1, g, r in decreasing order. r, 1, g Suppose -3n + 15 - 6 = 0. Suppose -nx + 0 - 3 = 0. Sort -0.2, x, 2/7 in decreasing order. 2/7, -0.2, x Let i = 0.35 + -0.05. Let m = 3 + -3.6. Let u = -1 - m. Sort u, i, -2 in descending order. i, u, -2 Let k = -2 + 2.1. Let w = 6 - 9. Put w, 4, k in decreasing order. 4, k, w Let j = -1 - 2.8. Let p = j - -4. Let q = -0.2 - p. Sort 2/13, q, -5 in increasing order. -5, q, 2/13 Let x(f) = f3 + 7f*2 + 7f + 4. Let r be x(-6). Let i be (r - -1) + 18/(-6). Let a = -1 - -4. Sort i, -5, a in decreasing order. a, i, -5 Let v = 193 - 194. Suppose -2o = s + 4 + 7, 4o + 16 = 0. Sort 1, s, v in decreasing order. 1, v, s Suppose s - 3z = 8, -6 = s + 4z - 0. Let k(y) = y*3 - 7y*2 + 3y - 23. Let x be k(7). Put s, x, 5 in decreasing order. 5, s, x Let r be (9/18)/(2/(-6)). Put 11, 1, r in ascending order. r, 1, 11 Let m = -61 + 56. Sort 0.4, m, 1/5, 5 in descending order. 5, 0.4, 1/5, m Let d = -6 + 4. Suppose 3t - 5q = -37, -3t + 2q - 27 = -q. Put t, -1, d in ascending order. t, d, -1 Suppose -5d - 2m = -13, d + 2 = -m - 4m. Let a(s) = s3 + 4s*2 + 4s + 2. Let q be a(-2). Sort d, q, -4 in descending order. d, q, -4 Let w = -1 - -1.1. Sort 0.2, -5, w in ascending order. -5, w, 0.2 Let w = -2 + 1.6. Let d = w - -4.4. Let l = 5 + -5.1. Sort d, 0.4, l in descending order. d, 0.4, l Let y be (-22)/(-35) + (-8)/40. Let z(x) = 2x + 3. Let t be z(-3). Sort 1, t, y. t, y, 1 Let a = -0.5 - 1.5. Let w be (-48)/70 + (-2)/(-7). Sort w, a, 2 in increasing order. a, w, 2 Let c(q) = -q2 - 7q + 10. Let w be c(-8). Sort 4, -3, w in ascending order. -3, w, 4 Let p = 2 + -8. Let x = p - -4. Let t be -1 + 8 - (0 - x). Put -1, t, 1 in ascending order. -1, 1, t Let g = -1.4 - -2.5. Let i = g + 1.9. Sort i, 1/9, -0.3. -0.3, 1/9, i Suppose 0 = w + 2 - 3. Let x(d) = -2d2 + d. Suppose 5r - 2l = -0r - 9, 0 = 3r - 5l + 13. Let y be x(r). Sort w, y, -1 in descending order. w, -1, y Let d = -139/12 - -45/4. Sort 0.1, d, -3, -4. -4, -3, d, 0.1 Let c(y) = 2y - 6. Let w be c(4). Suppose 3p = -q - q + 9, 4q = -p + 13. Suppose s = -6 + q. Sort s, -4, w in descending order. w, s, -4 Suppose -2m - 16 = -26. Sort m, -4, -6. -6, -4, m Let n = 30.041 + -0.041. Let f = n - 27.2. Let y = 0.8 - f. Put y, 2, 1/2 in descending order. 2, 1/2, y Let g = 0.07 - 0.37. Let l = 0.06 - -1.94. Put -1/2, l, g in descending order. l, g, -1/2 Let x = -9 + 15. Let m = -7 + x. Let h = -3 - 0. Put -5, m, h in ascending order. -5, h, m Let h = 0.06 - -0.02. Let q = -0.38 + h. Sort q, 4, 3/5 in increasing order. q, 3/5, 4 Let s be (3 + 18)(-2)/6. Let u be (2 - s)/(-3) + 7. Sort u, 1, -2 in descending order. u, 1, -2 Let h(l) = 3l + 4. Let q be h(-3). Let k(t) = t*2 + 4t - 5. Let p be k(-5). Put q, 3, p in decreasing order. 3, p, q Suppose 15i = 7i - 64. Put -2, -5, i in ascending order. i, -5, -2 Let v = 0.3 - 0.39. Let u = v + 0.09. Sort 4, 0.1, u in ascending order. u, 0.1, 4 Suppose -5k + 22 = -2y, 3y - 17 = -4k - 4. Sort -1, 10, k. -1, k, 10 Suppose -5t - 2i - 14 - 7 = 0, -5t = i + 23. Sort t, 0, 5 in decreasing order. 5, 0, t Let k = -29.44 + 29. Let u = k - -0.04. Let q be (1 + 1)(-3)/8. Put 2/9, q, u in increasing order. q, u, 2/9 Let q(s) = 5s + 6. Let k be q(-3). Let y be 4(k/(-4) - 1). Put 2, 1, y in descending order. y, 2, 1 Let n be 3/(-2)6 - 2. Let m = n + 6. Sort -2, m, 17. m, -2, 17 Let c be (34/(-85))/((-2)/20). Put c, 12, 0.4 in ascending order. 0.4, c, 12 Suppose -9 = b + 11. Let h = -8 - b. Let i be h/(-42) + 102/14. Sort 0, 3, i in decreasing order. i, 3, 0 Let i(s) = 2s*2 + 7s. Let q be i(-5). Let r = -10 + q. Let u(k) = k*3 + 4. Let b be u(0). Sort -3, r, b in increasing order. -3, b, r Let s = 0.28 + -0.08. Let h = 1 + -1. Let u = s + h. Put u, -0.5, 1 in ascending order. -0.5, u, 1 Suppose 25p = 20p - 20. Suppose u + 2 + 3 = 0. Put p, u, -2 in descending order. -2, p, u Let l be 6 + -6 - (-2)/(-8). Put -0.4, l, 4 in ascending order. -0.4, l, 4 Let t = -194 + 2912/15. Sort t, 0.1, -0.2. -0.2, 0.1, t Suppose -8 = 4u - 4. Put 5, u, 4 in decreasing order. 5, 4, u Let y be (0 - (-4)/2) + -1. Suppose n + 2n = c + 6, 0 = -5c. Suppose -3p + 20 = np. Sort -1, p, y. -1, y, p Let w be (212/40)/((-1)/(-1)). Let j = -0.086 - -2.136. Let a = -0.05 + j. Sort -1/2, a, w in descending order. a, w, -1/2 Let d = -1.01 - -1. Let j = d + -4.99. Let w be 14/(-6) + (-2)/(-6). Put 0, w, j in descending order. 0, w, j Let q be 6/(-2 - 12/(-4)). Suppose 0 = -5u + qu. Sort -0.2, u, 3 in decreasing order. 3, u, -0.2 Let d = -0.501 - 21.399. Let u = d - -22. Put -3/5, -5, u in decreasing order. u, -3/5, -5 Let z(m) = m3 - 6m*2 + 7m - 5. Let f be z(5). Suppose -l - 26 + 2 = 5b, -20 = l + 4b. Put l, 3, f in ascending order. l, 3, f Let w be -1 - (72/42)/(4/14). Let p = 0.11 + -4.11. Sort w, -1/5, p. w, p, -1/5 Let f = -0.5 + 1. Suppose 2b - 4b + 6 = -4n, -12 = -4b - 4n. Let r = b + -8. Sort -3, f, r. r, -3, f Let x(o) = o2 + 2o + 3. Let h be x(-2). Sort 0, -4/5, h in decreasing order. h, 0, -4/5 Let l = -0.4 + 0.4. Let n = -5 + l. Sort -3/2, n, 1/6 in decreasing order. 1/6, -3/2, n Let c = 119/18 + -85/9. Let u = c + 4/3. Let g = 0.01 + 0.09. Sort g, 1, u. u, g, 1 Suppo	{ "pile_set_name": "DM Mathematics" }
8u2 + 9u + 2. Let v be -3(4 + 4) - 0. What is the remainder when (-4)/v + 138/36 is divided by l(9)? 0 Let w be (-24)/7112/(-24). Calculate the remainder when 25 is divided by (42/12 + -3)w. 1 Let m(g) = -2g*2 - 23g - 3. Let s be m(-11). Calculate the remainder when (0 + 4)(s + -2) is divided by 14. 10 Let f = 780 - 639. What is the remainder when f is divided by 15? 6 Let i(p) = 24p*2 + 4p + 4. Calculate the remainder when 104 is divided by i(-1). 8 Let r = -85 + 357. What is the remainder when r is divided by 39? 38 Suppose 4l - 996 = -44. Suppose 0 = -2z, -2i - z + l = -0z. Calculate the remainder when i is divided by 24. 23 Suppose 2h - 1 = 3h - 2f, 4f = -3h + 47. Let x(g) = -g + 33. Calculate the remainder when x(11) is divided by h. 4 Let u be 124/(0 + -3). Let d = u + 32. Let m = -13 + 26. Calculate the remainder when d is divided by m. 11 Let i = -13 + 30. Let c(y) = y*2 - y - 55. Let n be c(0). Let x = n - -88. What is the remainder when x is divided by i? 16 Suppose -84 = 58k - 61k. What is the remainder when 110 is divided by k? 26 Let u be -104 + -14 + 6 + 6. Let x(w) = -69w3 + w2 - w. Let f be x(1). Let m = f - u. What is the remainder when m is divided by 13? 11 Let i = 27 - 27. Suppose 12s - 13s + 10 = i. What is the remainder when 59 is divided by s? 9 Let r(x) = 2x - 1. Suppose -z - 1 = -b + 3, 4z + 3b + 9 = 0. Let c be r(z). Let g = 16 + c. Calculate the remainder when 25 is divided by g. 7 Let g(z) = z2 - z. Let a be g(-1). Suppose ah - 116 = -0h. Suppose -2u + 3u - h = 0. What is the remainder when u is divided by 15? 13 Suppose -22a + 90 + 372 = 0. Calculate the remainder when 117 is divided by a. 12 Suppose -3p + 81 = 5a + 17, 5a = -4p + 82. Suppose -3o = -p + 3. Let j(u) = -2u*2 - 27u + 63. Calculate the remainder when j(-15) is divided by o. 3 Let g(l) = 13l2 + 15l + 1. Let r(y) = -y*3 - 1. Let s(q) = g(q) + r(q). Calculate the remainder when 27 is divided by s(14). 13 Suppose 4j - j = -5a + 29, 2a - j - 16 = 0. Suppose 2 = u - a. Calculate the remainder when (-4)/(-18) - 232/(-9) is divided by u. 8 Calculate the remainder when (-32)/3(-57)/2 is divided by 48. 16 Let n = -524 + 568. Calculate the remainder when 303 is divided by n. 39 Suppose 0 = z + 433 - 1295. Calculate the remainder when z is divided by 36. 34 Let t(r) = -r2 + 0r*2 + 2r*2 - 2r*2 + 36. Suppose 5k + 15 = -q - 0, 2q = -5k - 15. Calculate the remainder when t(q) is divided by 13. 10 Let c(u) = -2u + 11. Let y be c(-4). Let t = y - 13. Suppose -4o = 5g - 104, -g = -o - 22 - t. Calculate the remainder when 45 is divided by g. 21 Let d(i) = -i3 + 6i*2 - 4i - 4. What is the remainder when d(-6) is divided by 13? 10 Suppose z = 2z + j - 29, 0 = 5z + j - 137. Let b = 62 - z. Calculate the remainder when b is divided by 6. 5 Let h = -8 + 13. Suppose 26 = 3c - 0x - hx, -x - 4 = 0. What is the remainder when 9 is divided by c? 1 What is the remainder when -11 + -5 + -3 + 85 is divided by 17? 15 Let k(g) = 3g*3 + 71g*2 + 32g + 18. What is the remainder when k(-23) is divided by 86? 82 Let d = 27 + -25. Calculate the remainder when 10/35 + 12/7 is divided by d. 0 Calculate the remainder when 65 is divided by (77 + -2)/3 + -2. 19 Calculate the remainder when 79 is divided by (-14208)/(-336) - 4/14. 37 Suppose -14s = -9s - 40. Suppose -42 = sv - 194. Calculate the remainder when v is divided by 3. 1 Let j = -53 - -108. Calculate the remainder when (j/(-44))/(2/(-8)) is divided by 2. 1 Let x = 7 - -3. Suppose l + a - 19 = 0, -a = -2l - 2a + 41. Calculate the remainder when l is divided by x. 2 Let o = 34 + 0. Let t be (0 + 2)264/16. Let z = t + -14. What is the remainder when o is divided by z? 15 Suppose -2s = 2s + 4. Calculate the remainder when (-89)/(4 + (s - 4)) is divided by 15. 14 Let j = 417 + -783. What is the remainder when j/(-10) - 16/(-40) is divided by 19? 18 Let g(v) = 2v - 34. Let k be g(14). Calculate the remainder when 132 - (2 - 3) is divided by ((-75)/20)/(2k/32). 7 Suppose 0 = -6n + 9 + 45. Let x = n + 37. Suppose i + 5u + 3 = 0, -3i - 6u = -3u - 27. What is the remainder when x is divided by i? 10 Suppose 3l = -2l. Let j = l - -11. Calculate the remainder when (42/5)/(1/5) is divided by j. 9 Suppose -2b = 3b - 65. Let i = 2957 - 2910. What is the remainder when i is divided by b? 8 Suppose -6z + z = -2m - 796, -3z - 2m + 468 = 0. What is the remainder when z is divided by 84? 74 Suppose 3n - 85 = 2. What is the remainder when n is divided by (0 - -8 - 14) + 14? 5 Let z = -767 + 784. What is the remainder when 56 is divided by z? 5 Suppose 0 = -2s + 4, -x + 9s - 13s = -172. What is the remainder when x is divided by 57? 50 Suppose -3l - 35 = -7u + 2u, 4u = -l + 11. What is the remainder when 82 is divided by u? 2 Let l be 18/(-22) + 4/(-22). Let r = 5 - l. Let u = 107 - 86. Calculate the remainder when u is divided by r. 3 Suppose -2j = 4h - 526, 0 = 5h + j + 3j - 656. Calculate the remainder when h is divided by 37. 21 Let u(a) = 10a - 48. Let y be u(14). Suppose 0 = yo - 94o + 32. What is the remainder when 43 is divided by o? 11 Let k(c) = 47c - 808. Suppose v + 5 = 3r, r = -5v + 2r + 45. What is the remainder when k(18) is divided by v? 8 Let c(l) = -l3 - 5l*2 - 4l + 1. Let d be c(-4). Calculate the remainder when (-44 - 10)/(-2 - (-3)/6) is divided by d/2(39 + -1). 17 Let h(r) = -25r - 36. Calculate the remainder when h(-4) is divided by 31. 2 Suppose -4u + 460 = -5m, 244 = -4u + 6u + m. What is the remainder when u is divided by 63? 57 Let b(w) = w*3 - 8w*2 + 4w - 16. What is the remainder when 190 is divided by b(8)? 14 Let n(d) = d*3 - 34d*2 + 70d - 94. Suppose 5q - 6 = -56. What is the remainder when n(32) is divided by q/((-1 + -1)/4)? 18 Let i(v) = -3v + 5. Let p be i(1). Suppose -5b + 24 = -b - 5j, -2b - 14 = 4j. Calculate the remainder when (-15)/20p/1-2 is divided by b. 0 Suppose -7l + 9l = 26. Let x(c) = c*3 - 12c*2 - 10c - 15. Calculate the remainder when x(l) is divided by 5. 4 Suppose b - 2 = -4g + 8, 3g - 9 = -b. Suppose 0 = bi - 184 - 830. Calculate the remainder when i is divided by 58. 53 Suppose -2m = 2c - 18, 32 = 4c + 12. Let w be (6 - m)/(4/16). Calculate the remainder when 5 is divided by ((-6)/w)/((-3)/12). 2 Let b(n) = -4n + 2. Let v(m) = -m + 1. Let c(x) = -3b(x) + 3v(x). Suppose -28t = -2t - 130. What is the remainder when c(t) is divided by 22? 20 Let x = -633 - -650. What is the remainder when 66 is divided by x? 15 Let c(g) = 10g*2 + 2g + 9. Let l be (-2)/(-9) - ((-80)/9)/(-4). What is the remainder when c(l) is divided by 12? 9 What is the remainder when 173 is divided by -12(5 - 84/18)-2? 5 Let n = -1200 - -1595. Calculate the remainder when n is divided by 80. 75 Let z = 226 + -211. Calculate the remainder when 47 is divided by z. 2 Let a = 539 - 529. What is the remainder when 47 is divided by a? 7 Let z = -1762 + 2518. What is the remainder when z is divided by 11? 8 Let c(h) = 4h - 17. Let o be c(-7). What is the remainder when 71 is divided by o/60 + ((-594)/(-8))/3? 23 Suppose 506 = 5n + 4s, -3n + 13s + 282 = 10s. Let j = -52 + 90. Suppose -4m + n = -j. What is the remainder when m is divided by 7? 6 Suppose 32v - k + 46 = 33v, -v + 41 = -4k. Suppose 2q - m - 26 = 0, -3q = -q - 5m - 34. Calculate the remainder when v is divided by q. 9 Let y = -8 - -23. Suppose -3l + y + 0 = 0. Calculate the remainder when l is divided by 3. 2 Suppose 2s + 4u + 24 = 232, -5u + 545 = 5s. Calculate the remainder when s is divided by 39. 36 Let b(c) = c*2 + c - 4. What is the remainder when 50 is divided by b(3)? 2 Let n be 333/117 - (-2)/13. Suppose ns - 6 = 0, -2l - 2l + s = -522. Calculate the remainder when l is divided by 44. 43 Let w = 15 + -14. Let b = -16 - -30. What is the remainder when b is divided by 16/(w + (-2)/(-2))? 6 Suppose -7b + 40 = -303. Calculate the remainder when b is divided by (-2 + (-9)/2)-2. 10 Let t(c) = c*3 + 16c*2 + 14c - 16. Let y be t(-15). Let o = 120 + y. Calculate the remainder when o is divided by 30. 29 Let d(c) = -c*3 + 3c*2 - 2c + 2. Let r(l) = -5*l - 1. Let q be r(-1).	{ "pile_set_name": "DM Mathematics" }
4))) + -5? 1 Calculate 3 - (5 + -5) - (3 - (1 + 19)). 20 What is 14 - (7 + 13) - (3 + -5 + 6)? -10 What is the value of (25 - 18) + 9 + 2? 18 What is 1 + -6 - (-1 - 0 - (17 - 21))? -8 Calculate 5 + 0 + -4 - (13 - (10 + -2)). -4 What is 0 + 2 + 7 + -6 - (48 - 56)? 11 What is the value of 5 - (10 + -5) - (-7 + 3)? 4 16 - 24 - (-13 - -2) 3 (-886 - -860) + (17 - 1) -10 What is the value of -1 + 1 + -5 + -3 + 7 - 7? -8 Calculate (-13 - -25) + 2 + -14 + 6 + -3. 3 Evaluate -15 - (0 + -14) - 19 - -40. 20 What is -43 + 59 + -3 + -22? -9 Calculate ((1 - -3) + -12 - -2) + -27 + 45. 12 Calculate 2 + -1 + 0 + 2 + 3 + 2. 8 Evaluate 6 - (-8 - (-35 + 9 + -3)) - 5. -20 What is -24 + 14 + -20 + (0 - 3) + 8? -25 Evaluate 25 + -19 + (-1 - 3) - (-71 + 52). 21 What is the value of -24 + 3 + 9 + -2 + 2? -12 What is the value of (-7 + -1 - -12) + 2 + 5? 11 Calculate -2 + -2 + 1 - (-93 - (118 + -202)). 6 Evaluate -2 + -9 - (5 + (-10 - -9) + -10). -5 What is the value of (-20 - (0 + -17)) + (2 - -25)? 24 Evaluate 4 - (-6 - -10) - (-9 - -2) - 8. -1 Calculate 7 + -11 - (-6 + 31). -29 What is -57 - (3 - (76 + -42))? -26 What is the value of (2 - (8 + 2 + -1)) + -1132 + 1146? 7 What is 19 - ((6 - -6) + 14)? -7 What is 25 + 6 + -44 + 33? 20 Evaluate -2 + 8 - (5 + -29 + 30). 0 What is (4 - 2) + 0 - (8 - (10 + 4))? 8 -18 - (-24 + 21 - 6) -9 Calculate (8 - (-11 + 1)) + -4 + -4. 10 What is the value of -7 + 5 + 9 - 4 - (11 + -1)? -7 What is -10 + 19 + (7 - 8)? 8 19 + 0 - (447 + -464) - -2 38 4 + 3 + -4 + -2 + -7 - 2 -8 Evaluate -7 + 9 + 3 + (-5 - (-16 + 3)). 13 Calculate 22 + -4 + -5 + -4 - 14. -5 Evaluate -2 + (5 - 2) + (-6 - -17). 12 Calculate -1 + -10 + 7 + 5 + -7. -6 What is the value of 63 + -83 - (-11 - (7 + -1))? -3 Calculate -11 + -6 + -56 + 98. 25 What is the value of -30 - -34 - -6 - 1? 9 Calculate 3 + (4 - 3) - (-237 - -225). 16 7 + (1 - (11 + (3 - 9))) 3 Calculate 2 - -6 - (2 - 11 - -6 - 2). 13 Calculate (7 - (-7 + 16)) + (-2 - -17). 13 What is the value of (-1 - 10) + 0 + 0 - (-63 + 62)? -10 4 + (0 - 8) + (13 + -19 - -6) -4 Evaluate 63 + -50 - 25 - (1 + -5). -8 Evaluate -3 - -6 - 10 - (-4 - (2 - 4)). -5 What is the value of -10 + -5 + 25 + 3? 13 What is the value of (29 - 35 - (-1 - 2)) + 15? 12 1 + -1 - (52 - 46) - (0 + -1) -5 What is the value of -7 + -30 + -32 + 54? -15 What is -1 + (-10 - (-15 + 20)) - -25? 9 Calculate -2 + 13 + (-6 - -1) - 9. -3 What is 19 + -24 + 14 + -1? 8 What is the value of -11 + -23 + -2 + (101 - 88)? -23 Evaluate 17 - (-25 + 28) - 11. 3 4 + (-4 - (4 + (-10 - -4))) 2 Calculate (-3 - -6) + (-4 - (0 - 2)). 1 What is the value of (-15 + 17 - (0 - 5)) + (40 - 67)? -20 Calculate (21 - (-16 - -39)) + 15. 13 Evaluate (10 - 27) + 13 - -1 - (-15 - -1). 11 What is (-15 + 7 - -19) + -9 - (5 - 1)? -2 Evaluate -26 + (0 - -3 - -20). -3 Calculate 89 + -82 + (-12 - 1) + -7. -13 Calculate (15 - -10) + (3 + 2 - 20). 10 What is -4 + -1 - (-20 + -10 + 28)? -3 What is the value of -6 + (28 - 8 - 17)? -3 Calculate 0 + -1 + 3 + -39 + 29. -8 Calculate (3 - (-1 - -2)) + (-738 - -727). -9 What is (10 - 13) + (11 - (8 + -14 + 13))? 1 Calculate (-9 - -2 - -5) + (-13 - 0) - -5. -10 Calculate 43 + -87 - -41 - (18 + -1). -20 Calculate 81 + -54 - 23 - (-27 + 0). 31 Calculate -7 + -1 + -2 + 15 + (-6 - 19). -20 Calculate 803 - 826 - (1 + (-15 - 3)). -6 Evaluate -38 + 21 + 70 + -80. -27 What is 1 - 11 - (-221 + 200 + -1 + 15)? -3 Evaluate 492 - 519 - (-47 - 0). 20 -30 + -5 + 70 + -29 6 What is the value of (-5 - -14 - 21) + 27 - 43? -28 Calculate 14 + (-16 - -4 - 5) + 3. 0 23 - 0 - (-15 - 20 - -43) 15 Calculate 2 - ((22 - 34) + (1 - (1 + 0))). 14 Evaluate -10 + (1 - (7 - 18)). 2 What is the value of -53 + 33 + (-7 - -26)? -1 0 + 1 - ((-11 - 11) + 9 + 9) 5 Evaluate (-4 - 13 - (-31 - -26)) + 14. 2 (7 - -1) + -12 + -4 + (-1 - -3) -6 Calculate -84 + 82 + (-3 - -14 - 3). 6 Evaluate -3 + (-1 + -9 - -35) + -10. 12 What is the value of 0 + 3 + 33 - 20? 16 What is 8 + -1 + (-3 - (18 - 20)) + 21? 27 What is the value of -5 + -5 + -2 + 0 - -6 - 5? -11 Calculate 0 + 6 - -3 - (-28 - -48). -11 What is the value of -18 + (3 + -1 - (38 - 29 - 6))? -19 21 + -9 + -13 + -9 -10 What is -10 + (13 + -1 + 0 - (-54 - -15))? 41 What is the value of -5 + -23 + -4 + (2 - (4 - 11))? -23 Calculate -15 + (-2 - 1 - (-2 + (1 - 4))). -13 32 + 15 - (-7 + -5 + 21) 38 What is the value of (-183 + 181 - (-6 - (1 + -1))) + -5? -1 What is 3 + 0 + -3 + -2 + (-42 - -47)? 3 What is the value of -34 - -1 - (67 - 118)? 18 3 + (51 - 71 - (-6 + 1)) + 3 -9 What is the value of 0 - 7 - (2 + (19 - (-19 - -38)))? -9 Evaluate -1 + -5 + -360 + 363. -3 What is -4 + (11 - (40 - 18)) + 1 + 5? -9 Evaluate -237 + 256 - (48 - 2). -27 Calculate -13 + (-20 - (-3 - 21)). -9 What is -13 + 39 - 22 - (1 - 1)? 4 What is the value of -9 - ((16 - 5) + -31)? 11 What is (-3 + 24 - (34 + -24)) + -8? 3 -3 + (-5 - -5 - 5 - -17 - 5) 4 What is -4 + -5 + -2 + -1 + (-20 - -19)? -13 8 + (-8 - (-3 - -6)) -3 Evaluate -5 + 5 + -2 + 7 - (7 - 0). -2 4 + 6 + -9 - (-1 - -8) -6 What is -16 - -5 - (-1 + -4 + -2)? -4 -10 - (-20 - (22 - 22)) - (-4 + 1) 13 Evaluate -16 + (1 - (-22 + 9) - 7) + 25. 16 (5 - -2) + 14 + -43 - (-2 + 11) -31 Calculate 5 + -35 + 16 + 15 - 14. -13 What is 32 + 4 + 0 + -2 + -4 + -4? 26 Evaluate (-4 - 0) + (-18 - (0 - 21)) - 18. -19 What is the value of (20 - 37 - -21) + (22 - 6)? 20 -9 - -1 - ((1 - 0 - 13) + -6) 10 Evaluate 9 + (-22 + 24 - 20). -9 (1 + 5 - 0) + (-18 - -9) - 6 -9 Evaluate 19 - 8 - -3 - 9 - (-1 + 2). 4 What is the value of (1 - -12) + -31 + 18 - 12? -12 -1 + 1 + 5 - (1941 - 1914) -22 What is -2 + (-2 + -8 - (-2 + 0)) - -3? -7 Calculate 22 + -10 + -8 + (-8 - -3) + 6. 5 0 - (6 + -2 + 0 + -1 + 4) -7 What is (176 - 179) + -1 + -1? -5 19 + -12 + (-13 - (-13 + 8)) -1 What is the value of (-6 + 9 - (-6 - 5)) + -9? 5 What is -8 + 12 + -9 - (0 - 15)? 10 Calculate (5 - (25 - -8)) + 13. -15 Calculate (53 - 25) + (-2 - 10) - 1. 15 What is the value of (-8 - -2) + -6 + 20 + -7 + 6? 7 Evaluate 19 + -13 + 20 + -12. 14 -10 + 13 + 1 + (10 - -1) 15 What is -9 + -33 + 52 + (-3 - 24)? -17 What is (32 - 40) + (-1 - -19) + 2? 12 Evaluate (3 - 2) + -7 - (2 + (2 - 20)). 10 What is -7 + 25 + -21 + 1? -2 Evaluate (-3 - 8) + (28 - 18 - (9 - 2)). -8 Calculate 193 + -179 - (1 + -2). 15 What is 2 - (7 + -15 - (-9 + 2))? 3 -1 + -2 - (-28 + 56) -31 Calculate 6 - (7 + -12 + (-5 - -5)). 11 Evaluate (-13 - 2) + (1 - (2 + -2 + -3)). -11 Calculate 4 + (-3 - -7 - 5 - -6) - 5. 4 Evaluate (13 - 15) + -6 + -20 + (-8 - -9). -27 Evaluate 6 + 14 + -1 + (-13 - -4) + -36. -26 What is the value of -12 + 22 + (1 - 0)? 11 Calculate (0 - -4) + -3 + -1 + -5. -5 (13 - (-5 - -14)) + 0 + -2 2 What is -230 - -249 - (17 + -2)? 4 What is the value of 5 - (-12 + 11 + 11 + -22 + 11)? 6 Calculate 62 - 50 - (2 - -33) - (-12 - -4). -15 What is -41 + 24 + 25 + -36? -28 6 + -26 + 48 + -10 18 What is (-1 - 8 - -18) + -15 + (0 - 1)? -7 25 + 0 + -15 + 0 10 What is the value of 9 + (-71 - 11) + 38? -35 Calculate 0 + (-163 - -159) + -7 + 0. -11 What is the value of -17 + 0 + 14 + 5 + 2? 4 Evaluate 10 - (8 + -9 + 4). 7 (-7 - -4) + -23 - -28 2 (10 - 0 - (30 + -2 + -26)) + -30 -22 -1 + -2 - (3 + 11 + -22) - 44 -39 What is the value of 0 + -18 - (-11 - 0 - (-178 + 172))? -13 Calculate 2 - 32 - (200 + -212). -18 What is (-13 - -17 - 3) + -3? -2 What is the value of 2 + -24 - (-1 + 5 + -18 + 4)? -12 (9 - 3) + 7 + (6 - 0) 19 Calculate (93 - 93) + (-3 - -1). -2 What is the value of -32 + ((18 - 10) + -8 - -10)? -22 What is the value of 8 + 2 - (19 + (-19 - (-22 + 10)))? -2 Calculate -119 + 97 + (-1 - -19). -4 Calculate (-5 - -5 - (5 + 1 + 7)) + -4. -17 Calculate -12 + (24 - (20 - 26)). 18 What is -8 - -6 - (10 - -8 - 10)? -10 Evaluate (-25 - -11) + 26 + (3 + 0 - 11). 4 What is -6 - (10 + 23 + -26)? -13 Evaluate 2 - 3 - (-5 + -17). 21 118 - 71 - 68 - (-9 + 1) -13 Evaluate 18 + 13 + -41 + (0 - (1 - -12)). -23 What is the value of -15 - 0 - ((-35 - -76) + -37)? -19 Evaluate 1 + 0 - -5 - (4 - 1 - 4). 7 Calculate 14 - (35 + (2 - 8) + -15). 0 Calculate -23 - (-19 - (-29 + 20)). -13 Evaluate 2 + -9 - (0 + -2 - 6) - -4. 5 (-1 - (11 - 16)) + 9 + -1 12 (6 + -3 + -1 - 4) + 10 + 1 9 Calculate -30 - -14 - (-11 + 3). -8 Calculate (5 - (9 - (-8 - -12))) + -7. -7 Evaluate (9 - 10) + 8 - 16 - 4. -13 What is	{ "pile_set_name": "DM Mathematics" }
2 + 77o*2 + 5o + 47o2. Calculate l(a(r)). 164r*4 - 5r*2 Let x(f) = -478f*2 + 973f*2 - 480f*2. Let y(q) = 40q*2. Determine x(y(g)). 24000g*4 Let k(v) = 2v*2. Suppose 12m - 892 = 2804. Let d(u) = -m + 155 + 7u + 153. What is k(d(w))? 98w*2 Let z(n) = -335n - 70. Let j(b) = 24b + 5. Let u(l) = 55j(l) + 4z(l). Let x be u(-1). Let a(o) = -29o + xo + 16o + 8. Let p(q) = -2q. Give a(p(i)). -4i + 8 Let y(k) = 21k2. Let r(o) = o2 + 2o. Let n(q) = -q*2 - 5 + 5 - q. Let f = 925 + -924. Let t(p) = fr(p) + 2n(p). What is y(t(a))? 21a*4 Let s(w) = 13838w + 3. Let b(c) = 4c2. Determine s(b(p)). 55352p*2 + 3 Let x(f) = 79f + 3. Let u be x(1). Let g(p) = -7 + up + 7 - 78p. Let n(r) = r + 4. Determine g(n(y)). 4y + 16 Let z(m) = m2. Suppose 6k - 2p = 2k + 54, 0 = 5p + 15. Let g(b) = 2b - 13b + 2 + kb - 12b. Calculate g(z(y)). -11y*2 + 2 Let u(x) = 1363x + 4176. Let w(k) = 39k + 120. Let p(c) = 5u(c) - 174w(c). Let m(n) = 9n + 2n + 0n + 0n. Determine m(p(l)). 319l Let b(y) = -2y2. Let k be (22/110)/(2/20). Let z(t) = 177t*k - 108t*2 - 97t*2. Give z(b(a)). -112a*4 Let d(s) = 59197s*2. Let o(t) = -884t. Determine d(o(b)). 46259850832b2 Let u(p) = p2 + 23p - 46. Let t be u(2). Let x(c) = 15016 - 15016 - tc. Let j(d) = 24d. Calculate x(j(a)). -96a Let c(f) = -7f*2 + 3f - 3341. Let b(v) = -3v2 - 31. Determine c(b(x)). -63x*4 - 1311x*2 - 10161 Let u(m) = -12m. Let p(z) = -z + 3. Let c(q) = -4q + 16. Let v(h) = -4h - 4. Let w be v(-6). Let l = w - 23. Let x(i) = lc(i) + 16p(i). Calculate u(x(j)). 48j Let o(w) = -w2. Let v(b) = 25b*2 + 3b + 3. Let d = -186 + 189. Let k(z) = -51z2 - 7z - 7. Let l(h) = dk(h) + 7v(h). Give o(l(y)). -484y4 Let b(r) = -3991r2. Let c(h) be the first derivative of -h3/3 + 5038. Calculate c(b(u)). -15928081u4 Let g(s) = 2769s*2 - 10s - 33. Let j(i) = -3i. Calculate g(j(k)). 24921k*2 + 30k - 33 Let k(h) = 5h2 - 7h + 9. Let j(f) = f*2 + 7f - 9. Let o(b) = -4j(b) - 4k(b). Let p(t) = 48t. Calculate p(o(r)). -1152r2 Let p(i) be the first derivative of i2/2 + 1. Let z(k) = 35k + 386. Let n(b) = -40b - 464. Let s(g) = 5n(g) + 6z(g). Calculate s(p(v)). 10v - 4 Let j(p) = -2p. Let k = -4001 + 4001. Let v(t) be the third derivative of kt + 1/6t*4 + 0t*3 - 14t*2 + 0. Calculate j(v(z)). -8z Let t(h) = 10h. Let y(r) = r2 - 1258901. What is y(t(p))? 100p*2 - 1258901 Let l(h) = 4h. Let a(q) be the third derivative of 533q5/15 - 2q*2 - 324q. Give l(a(o)). 8528o2 Let j(v) = -198 - 2v + 46 + 151. Let y(u) = -7u. Give j(y(f)). 14f - 1 Let i(q) = 24q. Let z be (-858404)/(-28) + 18/(-63). Let c(y) = -30657 + y + z. Calculate c(i(j)). 24j Let u(q) = 4575939q2. Let w(k) = 10k. Determine w(u(c)). 45759390c2 Let y(x) = -3x*2. Let d(l) be the first derivative of -4537l*3/3 - 5052. Calculate y(d(b)). -61753107b*4 Let a(n) = -789 + 1578 - 127n - 787. Let s(i) = -3i2. What is s(a(p))? -48387p*2 + 1524p - 12 Let a(f) be the first derivative of 17f2/2 - 317. Let r(s) = s - 1. Let u(t) = -25t + 20. Let b(j) = -20r(j) - u(j). Calculate a(b(d)). 85d Let l(z) = z - 5. Let h be l(6). Let v(q) = 156q - 1 - 154q + h. Let x(s) = 13s2. Give x(v(f)). 52f2 Let w(u) = -u2. Let q(o) = -2078321o. What is w(q(k))? -4319418179041k*2 Let u(c) be the first derivative of 49c3/3 + c2 + 1. Let p(r) = 12r + 12r - 50r - 4r + 11r + 21r. Give p(u(d)). 98d2 + 4d Let r(q) = -12055q2 - 25. Let d(j) = -4j. What is r(d(h))? -192880h2 - 25 Let g(n) = -6n*2. Let u be (15/3)/(2 + -1). Suppose 6 + 9 = uh. Let m(r) = -3r + 0r + 3r + hr. Give g(m(j)). -54j2 Let j(l) = l2 - 103l - 3. Let r(h) = -18838h2 + 37667h*2 - 18827h*2. Give j(r(s)). 4s*4 - 206s2 - 3 Let p(t) = t2 - 11869176. Let a(b) = 2b. Give p(a(y)). 4y*2 - 11869176 Let q(c) = -2126867c. Let f(r) = 2r. Determine f(q(i)). -4253734i Let t(d) be the first derivative of d*3/3 + 279. Let m(c) = -2c + 1287. Calculate m(t(n)). -2n2 + 1287 Suppose 116 + 84 = 40j. Let m(s) = -35 + 19 + 4s + 16 + js. Let x(v) = -v - 18. Determine x(m(l)). -9l - 18 Let t(g) = -2g*2. Suppose 0 = 13a + 8a - 315. Let u(s) = -4s + 22 + 9 + 3 - a. Give t(u(f)). -32f2 + 304f - 722 Let r = -48 + 62. Suppose 10 = -9u + ru. Let k(v) = -13v2 + 9v*u - 4v*2. Let f(l) = -9l*2. Give f(k(c)). -576c*4 Let s(j) = -102j*2. Let m(i) = 93i*2 - 2. Let w(p) = 61004p*2 - 1313. Let g(t) = -1313m(t) + 2w(t). Determine s(g(x)). -1040502x*4 Let w(j) = 11j - 1. Let f(n) = n*2 - n - 19. Let g(m) = 21m*2 - 15m - 285. Let x(a) = 15f(a) - g(a). Determine x(w(b)). -726b*2 + 132b - 6 Let z(r) = -3r2 + 4r. Let v(o) = 15o2. Let k(b) = -b2. Let w(l) = -40k(l) - v(l). Give z(w(n)). -1875n4 + 100n*2 Let t(m) = 7 - 4 - 1 - 26m. Let r(w) = 34w2 + 3w + 1. Let p be r(2). Let x(y) = -py - 134y + 279y. Calculate x(t(q)). -52q + 4 Let f(q) be the third derivative of -q*7/2520 - 5q*4/12 + 26q*2. Let b(w) be the second derivative of f(w). Let v(k) = 3 - 3 + 2k*2. Give v(b(s)). 2s*4 Let s(j) = 11j + 17. Let n(f) = 4f + 6. Let o(d) = 17n(d) - 6s(d). Suppose 8t = 417 - 401. Let g(v) = -100v2 - 83v*2 + 215v*t. Calculate g(o(q)). 128q*2 Let k = 127 + -125. Let f(i) = -3 + 7 - 4 + ki. Let o(b) = -3b + 33b - b. What is o(f(r))? 58r Let j(c) = -c2 - 16c - 2742. Let q(z) = 39z. What is q(j(f))? -39f*2 - 624f - 106938 Let s(o) = -9o + 15o - 78o + 187o. Let v(m) = -m. Calculate v(s(g)). -115g Let k(z) = 7z2 + z2 + z*2. Let h(q) = 5q*2 - 4q. Let y(t) = 70t2 - 55t. Suppose -12w + 1 = -47. Let l(n) = wy(n) - 55h(n). Determine k(l(x)). 225x*4 Let k(d) = -109670d*2. Let p(f) = -16f. Give k(p(a)). -28075520a2 Let t(c) be the third derivative of 37c*5/60 - 136c*2 - 4c + 3. Let v(s) = 485s. Determine v(t(n)). 17945n*2 Let c(p) = -4974p + 700. Let x(h) = -5h. Calculate c(x(d)). 24870d + 700 Let o(l) be the first derivative of l*4/12 + 88l - 26. Let v(a) be the first derivative of o(a). Let w(c) = -85c. Determine v(w(f)). 7225f*2 Let q(t) = 25t*2. Let u(s) be the second derivative of -109s*4/12 + 3324s. Calculate u(q(r)). -68125r4 Let r(w) = 14w*2. Let p(d) be the first derivative of 17d*2 + 2d + 1504. Calculate p(r(c)). 476c2 + 2 Let l(r) = -56554 - 11r + 56554. Let x(t) = 5t. Determine x(l(a)). -55a Let t = -7783 + 7786. Let h(x) be the first derivative of 0x + 0x*2 + 13 - 2/3x*t. Let n(i) = 14i*2. Calculate h(n(y)). -392y*4 Let h = -71 + 83. Suppose h = 3g, 24 = -0j + 4j - g. Let x(c) = jc + 82 - 82. Let s(r) = -3r*2. Calculate s(x(v)). -147v*2 Let c(a) be the first derivative of -4a*3 - 3297. Let l(r) = r - 51. Determine c(l(s)). -12s*2 + 1224s - 31212 Let w(g) = -g*2. Suppose 3q - 1 + 7 = -4i, q + 2 = -5i. Let a(y) = iy - 85y*2 + 52y*2 + 0y. Determine w(a(k)). -1089k4 Let f(c) = -3c + 1. Suppose 8k + 15 = 7k + 4d, 0 = -3k + 4d - 5. Let x(p) = -22p + 7. Let m(n) = kx(n) - 35f(n). Let j(g) = 26g2. What is j(m(u))? 650u*2 Let d = 342 - 334. Suppose -1 = -2u + 3. Let p(x) = 12x - d - ux - 6x. Let k(w) = w2. Calculate p(k(i)). 4i*2 - 8 Let z(s) = -83s*2 - 74s*2 + 55s + 8s - 63s. Let x(f) = -4f2. Determine x(z(d)). -98596d*4 Let m(y) = -6y*2 + 2y. Let f(r) be the first derivative of 17r3/3 + 1293. Determine f(m(d)). 612d*4 - 408d*3 + 68d*2 Let q(a) = 4 + 5 - 9 - 17a. Let g(u) be the second derivative of 7u3/3 - 4177u. Give q(g(l)). -238l Let g(f) be the first derivative of -2f*2 + 9766. Let t(y) be the second derivative of 3y*3/2 - 2y. Calculate t(g(q)). -36q Let b(m) = 935m - 198. Let i(a) = -19a + 4. Let g(x) = 4b(x) + 198i(x). Let t(z) = -191z. What is t(g(c))? 4202c Let d = -150 - -145. Let r be (0/((-3)/(-1)))/(d - -1). Let j(y) = 23y*2 + r + 0 - 25y*2. Let m(o) = -2o. Give m(j(s)). 4s2 Let z(k) = -2714k - 582. Let u(c) = 6c. What is u(z(d))? -16284d - 3492 Let v(p) be the first derivative of 2p2 - 2595. Let z(j) = 104j*2 + j. Give v(z(k)). 416k*2 + 4k Let t(j) = -143803	{ "pile_set_name": "DM Mathematics" }
10572, -18856, -29512, -42534, -57916? j*3 - 1198j*2 + 65j - 12 What is the p'th term of -45719, -182867, -411453, -731483, -1142963, -1645899, -2240297, -2926163? -p*3 - 45713p*2 - 2p - 3 What is the h'th term of -489, -991, -1493, -1995? -502h + 13 What is the a'th term of -9006, -35891, -80700, -143433, -224090, -322671, -439176? -8962a*2 + a - 45 What is the y'th term of 2158, 4291, 6424, 8557? 2133y + 25 What is the q'th term of -399, 9, 1115, 3267, 6813? 58q3 + q2 - q - 457 What is the y'th term of 6020, 6018, 6016, 6014, 6012, 6010? -2y + 6022 What is the y'th term of 1089782, 2179560, 3269338, 4359116, 5448894, 6538672? 1089778y + 4 What is the a'th term of -9745, -9740, -9733, -9724? a2 + 2a - 9748 What is the q'th term of 4, 6, 6, 4, 0, -6, -14? -q*2 + 5q What is the h'th term of -1969587, -3939174, -5908761? -1969587h What is the t'th term of 67221, 134446, 201675, 268908, 336145? 2t*2 + 67219t What is the b'th term of 15421, 61577, 138493, 246163, 384581? -b*3 + 15386b*2 + 5b + 31 What is the q'th term of 7233, 7241, 7255, 7275, 7301, 7333? 3q2 - q + 7231 What is the y'th term of 345, 682, 1005, 1308, 1585, 1830, 2037? -y3 - y2 + 347y What is the q'th term of 39, 423, 809, 1197, 1587, 1979? q*2 + 381q - 343 What is the v'th term of -11435, -22902, -34333, -45710, -57015, -68230, -79337, -90318? 3v3 - 11488v + 50 What is the o'th term of -195, -283, -145, 333, 1265? 19o3 - o2 - 218o + 5 What is the m'th term of 16533, 16530, 16527, 16524? -3m + 16536 What is the w'th term of 46574, 93145, 139716? 46571w + 3 What is the o'th term of -7665, -30739, -69217, -123099, -192385, -277075, -377169? -7702o2 + 32o + 5 What is the g'th term of 3685, 7376, 11075, 14782, 18497, 22220? 4g2 + 3679g + 2 What is the y'th term of -33474, -66950, -100428, -133908, -167390? -y*2 - 33473y What is the v'th term of -131508, -263015, -394526, -526041? -2v2 - 131501v - 5 What is the c'th term of -1413, -2828, -4241, -5652, -7061, -8468, -9873? c*2 - 1418c + 4 What is the c'th term of -32127, -32121, -32115, -32109, -32103? 6c - 32133 What is the t'th term of -1634328, -3268655, -4902982? -1634327t - 1 What is the d'th term of 320, 705, 1090? 385d - 65 What is the d'th term of -215, -330, -513, -764, -1083? -34d*2 - 13d - 168 What is the k'th term of 589, 892, 1205, 1534, 1885, 2264, 2677? k3 - k2 + 299k + 290 What is the a'th term of -4335, -4143, -3951, -3759? 192a - 4527 What is the g'th term of 4705, 9408, 14109, 18808, 23505, 28200? -g*2 + 4706g What is the k'th term of -126194, -126198, -126202, -126206, -126210, -126214? -4k - 126190 What is the x'th term of -35397, -35398, -35399? -x - 35396 What is the y'th term of -40835, -40843, -40865, -40907, -40975, -41075, -41213, -41395? -y3 - y2 + 2y - 40835 What is the q'th term of 24370, 48740, 73110, 97480, 121850? 24370q What is the c'th term of -721628, -721629, -721630, -721631, -721632, -721633? -c - 721627 What is the j'th term of 2976, 6187, 9648, 13365, 17344, 21591, 26112? j3 + 119j*2 + 2847j + 9 What is the x'th term of -478526, -957043, -1435562, -1914083? -x*2 - 478514x - 11 What is the w'th term of -383, -296, -211, -128, -47, 32? -w*2 + 90w - 472 What is the l'th term of 1812, 7327, 16508, 29349, 45844, 65987? -l*3 + 1839l*2 + 5l - 31 What is the d'th term of -21, -126, -401, -930, -1797, -3086? -14d3 - d2 - 4d - 2 What is the w'th term of -5, -44, -153, -368, -725, -1260, -2009, -3008? -6w3 + w2 What is the l'th term of -3612, -3599, -3578, -3549, -3512, -3467? 4l2 + l - 3617 What is the a'th term of -492, -1112, -1760, -2442, -3164, -3932? -a3 - 8a2 - 589a + 106 What is the s'th term of 1218, 1175, 1060, 837, 470, -77, -840, -1855? -6s3 - s + 1225 What is the j'th term of -1275, -5315, -12055, -21501, -33659, -48535? -j3 - 1344j*2 - j + 71 What is the u'th term of 564, 456, 288, 60? -30u*2 - 18u + 612 What is the b'th term of -109523, -109503, -109469, -109421? 7b2 - b - 109529 What is the h'th term of -157, -248, -345, -454, -581, -732? -h3 + 3h*2 - 93h - 66 What is the s'th term of 304, 1163, 2600, 4615, 7208, 10379, 14128? 289s2 - 8s + 23 What is the n'th term of 413058, 413052, 413046, 413040, 413034, 413028? -6n + 413064 What is the p'th term of -151, -130, -55, 110, 401, 854, 1505, 2390? 6p*3 - 9p*2 + 6p - 154 What is the u'th term of -1, -19, -61, -139, -265, -451? -2u3 - 4u + 5 What is the f'th term of 223, 291, 329, 325, 267, 143, -59, -351? -2f3 - 3f*2 + 91f + 137 What is the o'th term of 2531, 2308, 1937, 1418, 751? -74o2 - o + 2606 What is the g'th term of 2348, 2166, 1662, 674, -960, -3402, -6814? -27g3 + g2 + 4g + 2370 What is the f'th term of -2697886, -5395772, -8093658, -10791544, -13489430, -16187316? -2697886f What is the w'th term of -1359, -484, 981, 3042, 5705, 8976, 12861? w*3 + 289w2 + w - 1650 What is the k'th term of 1492230, 2984458, 4476684, 5968908, 7461130, 8953350? -k2 + 1492231k What is the j'th term of -175404, -350807, -526210, -701613? -175403j - 1 What is the i'th term of 1167, 808, 447, 84, -281? -i*2 - 356i + 1524 What is the y'th term of -27827, -27823, -27819, -27815, -27811? 4y - 27831 What is the r'th term of 970, 2154, 3338, 4522, 5706, 6890? 1184r - 214 What is the y'th term of -9305, -9305, -9307, -9311, -9317, -9325, -9335? -y*2 + 3y - 9307 What is the t'th term of 122980, 122963, 122930, 122875, 122792, 122675, 122518, 122315? -t*3 - 2t*2 - 4t + 122987 What is the c'th term of 1536, 3038, 4540, 6042, 7544? 1502c + 34 What is the f'th term of -6730, -11916, -17104, -22294, -27486, -32680, -37876? -f2 - 5183f - 1546 What is the y'th term of -16737, -33504, -50271, -67038? -16767y + 30 What is the c'th term of 77, 657, 2215, 5231, 10185, 17557? 80c*3 + 9c*2 - 7c - 5 What is the u'th term of 1156, 1149, 1142, 1141, 1152, 1181? u*3 - 6u*2 + 4u + 1157 What is the g'th term of -727, -3221, -7377, -13195? -831g2 - g + 105 What is the b'th term of -376, -1490, -3350, -5956, -9308, -13406, -18250? -373b*2 + 5b - 8 What is the t'th term of -8, 2, 36, 94, 176, 282? 12t2 - 26t + 6 What is the k'th term of 195, 364, 521, 666, 799, 920? -6k2 + 187k + 14 What is the u'th term of 1729, 7042, 15897, 28294, 44233, 63714? 1771u2 - 42 What is the s'th term of -132, -224, -294, -342, -368, -372? 11s*2 - 125s - 18 What is the s'th term of -2552, -10211, -22984, -40877, -63896? -s*3 - 2551s2 + s - 1 What is the w'th term of -630, -1685, -2686, -3627, -4502, -5305? w3 + 21w2 - 1125w + 473 What is the c'th term of -257670, -515350, -773030, -1030710, -1288390, -1546070? -257680c + 10 What is the m'th term of -124, -665, -2094, -4855, -9392, -16149? -74m*3 - 23m - 27 What is the c'th term of 685, 2246, 4849, 8494, 13181? 521c2 - 2c + 166 What is the l'th term of -112117, -112118, -112119, -112120? -l - 112116 What is the h'th term of 552, 1128, 1726, 2346, 2988, 3652, 4338? 11h2 + 543h - 2 What is the m'th term of 10117, 10052, 9987? -65m + 10182 What is the w'th term of -470, -814, -1148, -1466, -1762, -2030? w3 - w2 - 348w - 122 What is the y'th term of -724, -1485, -2294, -3169, -4128, -5189? -3y3 - 6y*2 - 722y + 7 What is the c'th term of 1433, 2675, 3917, 5159, 6401? 1242c + 191 What is the r'th term of 2043, 4124, 6201, 8274, 10343? -2r*2 + 2087r - 42 What is the w'th term of -2687, -2659, -2631, -2603? 28w - 2715 What is the i'th term of -197458, -197457, -197454, -197449, -197442, -197433? i2 - 2i - 197457 What is the v'th term of 3046, 3016, 2984, 2950, 2914, 2876, 2836? -v*2 - 27v + 3074 What is the v'th term of 1080, 3921, 8520, 14877, 22992, 32865, 44496? 879v2 + 204v - 3 What is the y'th term of 1589, 1584, 1569, 1538, 1485? -y3 + y2 - y + 1590 What is the f'th term of -535, -774, -1013, -1252, -1491, -1730? -239f - 296 What is the p'th term of -142, -507, -1086, -1879, -2886? -107p*2 - 44p + 9 What is the f'th term of 873, 7020, 23691, 56148, 109653, 189468, 300855, 449076? 877f3 + 8f - 12 What is the n'th term of -6484, -12966, -19444, -25918, -32388, -38854, -45316? 2n*2	{ "pile_set_name": "DM Mathematics" }
f) = -f*3 - 3f*2 - 3f. Let s = -88 - -102. Let g(n) = -15 + s - n + 1 - n*2. Give 3g(v) - i(v). v*3 Let a(r) = 4r - 1. Let u(s) = s*2 + s + 1. Let k(b) = -10b + 45. Let i be k(3). Let h(d) = -d*3 + 15d*2 - 1. Let m be h(i). What is mu(g) - a(g)? -g*2 - 5g Let s(a) = 9a + 723. Let o(g) = -10g - 721. Calculate 8o(j) + 9s(j). j + 739 Let s be 1-2 - 1-1. Let z(n) = n - 3. Suppose 4v = 14 + 10. Let p(m) = 4 - vm - 3 + 3m + 3m + m. Give sz(h) - p(h). -2h + 2 Let t(a) = 22a2 + 1460a. Let b(z) = -8z2 - 487z. Calculate 17b(d) + 6t(d). -4d2 + 481d Let v(c) = -579c + 287c - 5 + 287c. Let y be (2/3)/(16/24). Let h(p) = p + 1. Determine yv(i) + 3h(i). -2i - 2 Let z(o) = 4o + 91. Let v(q) = 11q + 251. Calculate 3v(y) - 8z(y). y + 25 Let u = -14 - -19. Let l(p) = -3p3 + 4p*2 - 4p. Let q(z) = -5z - 2z*3 + 5z*2 + 1566258 - 1566258. What is ul(i) - 4q(i)? -7i*3 Let b(y) = -19y*3 + 17y2 + 13. Let t(x) = -x2 + 29x + 552. Let m be t(-13). Let f(q) = -8q*2 - 10 + 87q*3 + 4 - 78q*3. Determine mb(d) + 13f(d). 3d*3 - 2d*2 Let a(s) = 6s*2 - 131s + 12. Let y(q) = -11q2 + 228q - 22. Let u(l) = -7a(l) - 4y(l). Let x(k) = 7k2 + 21k + 17. What is 9u(h) - 2x(h)? 4h2 + 3h + 2 Let j(h) = -64h - 27. Let m(i) = i - 15. Let f(t) = j(t) - 2m(t). Let d(b) = 133b - 5. Determine -3d(k) - 5f(k). -69k Let f(j) = 2j3 + 7j*2 + 8j. Suppose -2d + 15 = s + 8, 0 = s + 4d - 21. Let i(v) = 3v3 + 10v*2 + 12v. Give sf(b) + 5i(b). b3 + b2 + 4b Let i(y) = -7y + 16y - 6y. Let a(r) = -9r - 8r + 21r - 5r. Calculate 2a(f) + i(f). f Let o(t) = 9t*2 - 3t. Let l be (-6)/(-15)(19 - -1)/4. Let u(x) = -5x*2 + 25x*2 - 10x*l + x - 13x*2. What is 3o(b) + 8u(b)? 3b*2 - b Let t(v) = -41v*2. Let m be (-640)/112 + (270/(-63) - -4). Let c(a) = 2625a*2. What is mc(l) - 385t(l)? 35l*2 Let x(p) = -5p + 50. Let f(l) be the third derivative of l*4/12 - 25l*3/6 - 165l*2 + 8l. Determine -9f(w) - 4x(w). 2w + 25 Let c(n) be the first derivative of 7n*3 - 3n*2/2 + 3n + 1454. Let h(i) = -i + 1. Determine c(z) - 3h(z). 21z*2 Let q(m) = 153118 + 0m*3 + 19m*3 - 153120. Let o(c) = -18c*3 + 3. Give -4o(g) - 6q(g). -42g3 Let h(q) = -q3 - 11q2 + 123q + 5. Let l(g) = -3g3 - 36g*2 + 363g + 16. What is -13h(x) + 4l(x)? x3 - x2 - 147x - 1 Let m(o) = -10o - 1. Let v(w) = 29w - 1689. What is -3m(i) - v(i)? i + 1692 Let w(t) = 17. Let v(o) = 1203o - 306765. Calculate 2v(j) + 36090w(j). 2406j Let a(w) = -91w2 - 5w. Let k(x) = -43x - 774x*2 - 11 - 8 - 37 + 56. Calculate -43a(g) + 5k(g). 43g*2 Let m(b) = -11b - 14b - b3 - 3b + 5b2 + 3 + 29b. Let s be m(5). Let n(z) = z*2 + z + 1. Let y(d) = 6d*2 + 10d + 8. Determine sn(c) - y(c). 2c*2 - 2c Let l(o) = -o3 - o2 - o + 1. Let p(t) = 24t2 + 132t - 60. Let n(q) = 7q2 + 37q - 17. Let j(h) = -18n(h) + 5p(h). Give j(s) - 6l(s). 6s*3 Let f(c) = 2c + 11. Let y(j) be the third derivative of -j4/24 - j3 + 6j2 + 251j. Determine 6f(u) + 10y(u). 2u + 6 Let w(q) = 498q*3 + 4q*2 + 4q - 246q3 + 0q*2 - 255q3. Let o(g) be the second derivative of -g4/12 - g*3/6 - g. Determine -2o(m) - w(m). 3m3 - 2m*2 - 2m Let l(k) = -1491k. Let j(c) = 5976c + 1. Determine 2j(p) + 9l(p). -1467p + 2 Let c(x) = 70x - 26x - 70x + 6 - 2. Let y(z) = 26z - 3. Give -3c(g) - 4y(g). -26g Let m(t) = -2407t + 7. Let l(j) = -2409j + 11. Determine -2l(w) + 3m(w). -2403w - 1 Let i(t) = -10t. Let g(b) = -56b - 21. Give g(l) - 6i(l). 4l - 21 Let o(l) = 9 - 5l*2 - 2l + 8l - l2 + 4l*3. Let t be 1/(1/(-6))(11 + 5265/(-486)). Let x(g) = -g3 + g2 - g - 1. Calculate to(a) - 6x(a). 2a3 - 3 Let b(p) = -17p - 5. Let j(c) be the first derivative of -2c2 - c - 1080. Let y be 83/9 - (-6)/(-27). Give yj(f) - 2b(f). -2f + 1 Let o(r) = 17r3 - 5r*2 - 5r. Let t(d) = -8d3 + 3d*2 + 3d. Let g be (11 + (-459)/34)/((3/(-4))/3). Calculate gt(u) + 6o(u). 22u3 Let r(t) = 3t*2 + 7t + 17. Let o(w) = -12w2 - 37w - 64. Determine -2o(z) - 9r(z). -3z2 + 11z - 25 Let n(q) = 70q3 - 17q*2 - 5q - 2. Let a(p) = -71p3 + 20p*2 + 5p + 2. Give 5a(i) + 6n(i). 65i3 - 2i*2 - 5i - 2 Suppose 8z - 291 - 133 = 0. Suppose -zh = -63h - 30. Let l(w) = 3w + 1. Let q(p) = -4 + 5p + 5 - 2p. Determine hl(j) + 2q(j). -3j - 1 Let m(t) = -3t3 - t2 - 2t + 1. Let h(l) = 10l*3 + 2l*2 - 23l - 3. Determine -h(k) - 3m(k). -k3 + k2 + 29k Suppose -r + 25 = 4r. Let p(m) = m - 6 + r + 0m. Let s(n) be the first derivative of -n*4/4 - 3n*2/2 + 7n + 337. Give 5p(y) + s(y). -y3 + 2y + 2 Let j(g) = 451g - 36. Let a(u) = 4u - 19. Calculate -2a(r) + j(r). 443r + 2 Let d(u) = 429u3 + 20u*2 + 4u - 4. Let g(k) = -22306k3 - 1045k*2 - 209k + 209. Determine 209d(n) + 4g(n). 437n3 Let j(u) be the first derivative of -14u*3 - 3u*2/2 - 3u + 919. Let q(s) = 43s2 + 2s + 2. Calculate 2j(z) + 3q(z). 45z2 Let d(q) = -q2 - 14q - 52. Let k = -225 - -217. Let c be d(k). Let f(x) = -6x + 6. Let t(w) = -13w + 13. Give ct(b) + 9f(b). -2b + 2 Let q(i) = -188i*2 + 18i - 1. Let c(b) = -126b2 + 13b. Give -7c(v) + 5q(v). -58v2 - v - 5 Let t be (1/(-2))/(25/300). Let c(x) = -4x*2 - 6x - 6. Let r(q) = 2q - 7. Let j(f) = f - 3. Let h(u) = 9j(u) - 4r(u). Calculate th(i) - c(i). 4i2 Let t(j) = -55j - 4. Let a(z) = 67z + 9. Calculate 2a(o) + 5t(o). -141o - 2 Suppose 21 = -4y - 3. Let n(z) = -1. Let k = 154 + -151. Let s(l) = 3l - 5. Let w(q) = kn(q) - s(q). Let m(a) = 9a - 6. Determine ym(o) - 17w(o). -3o + 2 Let d(g) = -25710508g*3 + 48072g*2 - 32048g + 16024. Let t(m) = -8022m3 + 15m*2 - 10m + 5. Determine 5d(l) - 16024t(l). -8012l3 Suppose 24 = -3o - n - 18, -3o - 24 = -5n. Let h(f) = -22f - 5 + 2 + 9 + 1 + 37f. Let v(i) = -7i - 3. Determine ov(m) - 6h(m). m - 3 Suppose -155 = 6m + 205. Let g = m - -64. Suppose 5p - 3n - 16 = 0, -3n + 19 = -3p + 5p. Let q(w) = 2w - 3. Let y(u) = -2u + 4. Give gy(l) + pq(l). 2l + 1 Let b(c) = -5c + 11. Let m(k) = 2k - 5. Let o(z) = 23z3 + 11z*2 + 15z + 14. Let s be o(-1). Give sm(l) - 6b(l). 4l - 1 Let p(u) be the third derivative of -5u*4/12 - 2u*3 - 8025u*2. Let j(g) = -13g - 8. Let s(t) = t. Let x(w) = j(w) + 6s(w). Determine -5p(i) + 7x(i). i + 4 Let g(t) = 167t + 22. Let z(m) = 177m + 23. Determine 3g(f) - 4z(f). -207f - 26 Let k(y) = 7y + 6. Let l(g) be the first derivative of -7g*2/2 - 5g + 2719. Give -2k(z) - 3l(z). 7z + 3 Let r(u) be the first derivative of 2u + 206 + 1/2u2. Let i(z) = 1 - 4 + 0. Calculate -2i(l) - 3r(l). -3l Let f = 456 + -320. Let w(n) = 7n3 - 142n - fn - 4 + 274n - 4n2. Let j(u) = -u3 + u2 + u + 1. Determine 4j(z) + w(z). 3z3 Let n(h) = -8h*2 + 87h + 16. Let v(y) = -y*2 + y + 2. Give -n(x) + 6v(x). 2x2 - 81x - 4 Let r(j) = j*2 - 2j - 3. Let l(p) = -281p. Let i(b) = 282b + 1. Let s(w) = -i(w) - l(w). Let t(g) = g + 1. Let f be t(-7). Calculate fs(d) + 2r(d). 2d2 + 2d Let r(m) = m*3 - 13m*2 + 21m + 13. Let y be r(11). Let x(h) = 29h2 - 76h*2 + 3h*3 + 45h*y. Let n(s) = -65s*3 + 45s*2. What is 2n(w) + 45x(w)? 5w3 Let z(t) = -t2 - t + 1. Let m(s) = -9s2 - 5s + 5. Let v = -37 + 56. Suppose -8q + 5 + v = 0. Suppose qu + 13 = 10. Calculate um(a) + 5z(a). 4a2 Let s(c) = 5c*3 - 13c*2 - 7c + 14. Let f(a) = 5a3 - 12a*2 - 8a + 17. What is -4f(t) + 5s(t)? 5t3 - 17t*2 - 3t + 2 Let s(w) be the third derivative of -w*4/12 + 25w*3/3 + 4w*2 - 165. Let n(g) = 2g - 51. Determine 5n(x) + 6s(x). -2x + 45 Let w be (-355)/(-35) + 6/(-42). Let a be (w/25 - (-2)/(-5)) + 5. Let v(s) = 4s*2 + 3s + 2. Let b(z) = -z*2 - z. Calculate ab(c) + v(c). -c*2 - 2c + 2 Let v(t) = -4t3 - 3t*2 - 3t - 3. Suppose 3r + 68 = -2g + 74, -r - 11 = 5g. Let q(z) = 4z*3 + 2z*2 + 2z + 2. What is gq(a) - 2v(a)? -4a3 Let j(v) = -15v*2 - 45v + 54. Let r(g) = 26g2 + 75g - 90. What is -12j(y) - 7r(y)? -2y2 + 15y - 18 Let o(d) =	{ "pile_set_name": "DM Mathematics" }
plify 4(((-3(-1 + sqrt(108)))2 - sqrt(108) - sqrt(108)) + (-1 + sqrt(108) + sqrt(108) + -4)2) + 4. -960sqrt(3) + 5756 Simplify (-1sqrt(18) + -5 + sqrt(18) - (0 + sqrt(2178)) - ((sqrt(108)-3)/sqrt(6) + -1))2. 192sqrt(2) + 1168 Simplify -2(((-1 + sqrt(125))1)*2 + (sqrt(125) + -1sqrt(125) - sqrt(125))*2-5 + -4). 20sqrt(5) + 1006 Simplify (4 + sqrt(272) + -2sqrt(272) + (-3sqrt(170))/sqrt(10))-2. -8 + 14sqrt(17) Simplify ((sqrt(91) - sqrt(91)-1)1)/(sqrt(14)/(sqrt(14)/sqrt(7))). 2sqrt(13) Simplify 2 + ((4(1sqrt(25) - sqrt(25)) + sqrt(25))/(-5sqrt(40)/sqrt(8)))2. 11/5 Simplify (sqrt(175) - (-3 + 1sqrt(175)))2 - ((sqrt(175) - (sqrt(175) + 3)) + 4)2. 8 Simplify ((sqrt(1700) - 2(sqrt(1700) + 1) - (0 + sqrt(1700))-6) + (sqrt(1700) - (-4 + sqrt(1700) + 1sqrt(1700))) + 1)2. 240sqrt(17) + 27209 Simplify -4 + (-1 + sqrt(833) + -1)*2 + 5 + (0 + sqrt(833)-2 - -3(-2sqrt(833))*2). -42sqrt(17) + 10834 Simplify (-1(sqrt(304) - (sqrt(304) + sqrt(304) + (1sqrt(304) - sqrt(304)))6 - sqrt(304))-5)*2 + -3. 1094397 Simplify 1 + (((sqrt(22) + (-1sqrt(22) - sqrt(22)))-4)/(sqrt(539) - (-1sqrt(539) - sqrt(539))))*2 + 5 + 2. 3560/441 Simplify ((5sqrt(429)/sqrt(539))/(-2sqrt(36)/(sqrt(12) + sqrt(60)/sqrt(5))))2. 325/49 Simplify -3(sqrt(9)/(-1sqrt(3)) - sqrt(21)/(-1sqrt(7)) - (sqrt(75)2 + sqrt(3) + -5)). -15 + 33sqrt(3) Simplify (-5(2(sqrt(272) - (sqrt(272) + (sqrt(272) - sqrt(272)-3))1 - sqrt(272)) + -5) + -4)*2. 8400sqrt(17) + 680441 Simplify (-3 + (sqrt(99)-1-5 - -3(sqrt(99) - (sqrt(99) - -2sqrt(99) - sqrt(99))))*2)-5 + 5. -1960 Simplify 3 + (2sqrt(672) + sqrt(168)1)/(-2sqrt(54) - sqrt(48)/(sqrt(16)/sqrt(2))). -10sqrt(7)/7 + 3 Simplify (sqrt(70)/sqrt(360) - (3 + sqrt(700)) - (sqrt(448) + -1 + sqrt(7) - sqrt(7) - sqrt(14)/(sqrt(8) + sqrt(2))))*2. 70sqrt(7) + 8591/4 Simplify 4(3 + (sqrt(1088) + 2)2-4). -17460 - 512sqrt(17) Simplify -2(sqrt(605)-3-4 + 2)*2. -174248 - 1056sqrt(5) Simplify sqrt(539) + (sqrt(539) - (sqrt(539) + (-3 + sqrt(539)-4 - sqrt(539)) + sqrt(539)) - sqrt(539))2 + 2(-3 + sqrt(539))*2 + 0. 49sqrt(11) + 5956 Simplify -3((-2 + -1 + sqrt(1377) - 1(sqrt(1377) + (sqrt(1377) - (sqrt(1377) - (sqrt(1377)4 - sqrt(1377)))))) + 3)2. -37179 Simplify -4-6(sqrt(34)/sqrt(2) + 4)2 - ((-2sqrt(119) + sqrt(119) + sqrt(119) + sqrt(119) - sqrt(119))/sqrt(7) - ((-1sqrt(170))/sqrt(10))2). 192sqrt(17) + 809 Simplify (sqrt(48)/sqrt(12)5)/(-6sqrt(32)). -5sqrt(2)/24 Simplify (-3 + sqrt(1584))3 - ((4 + sqrt(1584))-3 - sqrt(1584))2. -25497 - 1116sqrt(11) Simplify (sqrt(2904)-2 - sqrt(2904) - sqrt(48)/sqrt(8))/(-3(sqrt(972) + -2sqrt(972)) - sqrt(972) - sqrt(972)). -67sqrt(2)/18 Simplify (sqrt(39)-1-1 + (2sqrt(312))/sqrt(8))/(sqrt(6)/(sqrt(6)/sqrt(3))1)4. 12sqrt(13) Simplify (1sqrt(190)4-1)/(5sqrt(490)-2). 2sqrt(19)/35 Simplify -52sqrt(19)1 + 6(sqrt(19) + -1 + 1). -4sqrt(19) Simplify (-5(sqrt(68) - -1sqrt(68)))/((sqrt(12) + sqrt(24)/sqrt(2))/sqrt(3)) + -4sqrt(187)/(sqrt(176) - (sqrt(176) + sqrt(176) + sqrt(176)2 + sqrt(176))). -19sqrt(17)/4 Simplify ((sqrt(132) + 3(sqrt(132) - 2sqrt(132)))2)/(-6(-1sqrt(768) - sqrt(768)) + sqrt(768)). -sqrt(11)/26 Simplify -2sqrt(30)/sqrt(250) + 3sqrt(432)-1. -182sqrt(3)/5 Simplify -6(6(sqrt(2268) + (1sqrt(2268) - sqrt(2268))))/(6(sqrt(324) - -1sqrt(324))). -3sqrt(7) Simplify (4 + ((-2 + 4 + sqrt(19))2 - sqrt(19)) + 3sqrt(19)3)1. 27 + 12sqrt(19) Simplify -4(-3 + sqrt(512) + (sqrt(56) - (sqrt(1400) + sqrt(56)))/sqrt(7)). -24sqrt(2) + 12 Simplify (sqrt(88)-22 + sqrt(88))/sqrt(8) - sqrt(77)/((sqrt(42) + sqrt(672) - sqrt(42))/sqrt(6)). -13sqrt(11)/4 Simplify -1 + sqrt(26)/sqrt(200) - (2 + -1sqrt(832)). -3 + 81sqrt(13)/10 Simplify ((sqrt(170)-1)/sqrt(10) + sqrt(17) - sqrt(17) - (sqrt(1377) + sqrt(1377)2) - (3 + sqrt(17)22))*2. 192sqrt(17) + 17417 Simplify (-3 + 4((sqrt(304) - (3sqrt(304) + sqrt(304) + -1)) + 1 + sqrt(304)2))2. -160sqrt(19) + 4889 Simplify ((sqrt(198) - (sqrt(198)-3 + sqrt(198)))/sqrt(9)-5)/(6sqrt(8)/sqrt(4)5). -sqrt(11)/2 Simplify 4 + ((sqrt(114) + -2sqrt(114) + sqrt(114))-1)/(sqrt(54)-1)6 + -4. 0 Simplify 5(sqrt(7)-1)2 + -4 + (sqrt(567) + (sqrt(567) - (sqrt(567) + 1) - sqrt(567))2 + sqrt(567) + -1 + sqrt(567) - sqrt(567)). 36sqrt(7) + 598 Simplify (sqrt(66)/sqrt(147))/(sqrt(99)/sqrt(225)). 5sqrt(2)/7 Simplify ((5(sqrt(132) + -2-1sqrt(132)))/(-32sqrt(1728)))2. 275/576 Simplify (1sqrt(121)-3)/((-3sqrt(121))/sqrt(11)) + -3. -3 + sqrt(11) Simplify 6(32(sqrt(832) + (sqrt(832) - (sqrt(832) + 0 + sqrt(832))) + sqrt(832)))26. 1078272 Simplify (sqrt(2058)2)/(sqrt(864) + (sqrt(864) + sqrt(864) + -1sqrt(864) - sqrt(864)) + sqrt(864))2. 7sqrt(7)/6 Simplify (-2 + -5 + -4sqrt(200))2. 560sqrt(2) + 3249 Simplify -4((sqrt(2299) + 2sqrt(2299)-1)2 + 1)1. -9200 Simplify (-5(1 + sqrt(171)))2 - ((sqrt(19) + -2)-3 - (sqrt(19) - (-1 + sqrt(19) + 0))). 153sqrt(19) + 4295 Simplify 3((sqrt(13) - sqrt(13)2-1)*21 + (sqrt(117) + 5)2 + (sqrt(832) + 0)2)-4. -13092 - 360sqrt(13) Simplify ((sqrt(234)/sqrt(6))/sqrt(3) - sqrt(104)/(sqrt(24)/sqrt(3)))-6. 0 Simplify (sqrt(320) - (sqrt(320) - (sqrt(320) + 2sqrt(320) + -1)) - sqrt(320) - ((sqrt(320) + -1)-3 - sqrt(320)))2 - (-1sqrt(90))/(sqrt(2)-2-2). -1533sqrt(5)/4 + 11536 Simplify ((sqrt(3) - 1sqrt(147)) + -4)*2 + (-2sqrt(243))*2-5. -4736 + 48sqrt(3) Simplify (-3 + (sqrt(49) + (sqrt(49) - -34sqrt(49)))/sqrt(7) + -1)2-6. -8328 + 672sqrt(7) Simplify (-5 + ((sqrt(208) + -3)-4 + sqrt(208) - sqrt(208)))*2 - 6(sqrt(208) + 1 + -3sqrt(208)). -176sqrt(13) + 3371 Simplify (2sqrt(7)1 + (0 + sqrt(175) - sqrt(7)) - (-4 + sqrt(7)-2 + (sqrt(28) - sqrt(7)) + -2)2)64. -1032 - 144sqrt(7) Simplify 4 + 6(sqrt(60)/(sqrt(8)/sqrt(4)))/(sqrt(490) - -3sqrt(490)). 3sqrt(3)/14 + 4 Simplify (-3(2 + 5(sqrt(5) + sqrt(5) + 1) + sqrt(5) + sqrt(5) + 4 + 2))2. 2808sqrt(5) + 8001 Simplify -4(2 + sqrt(13) + 1) - 4(1 + sqrt(13) + -1). -8sqrt(13) - 12 Simplify ((6-5sqrt(45))2 + -4sqrt(245)-1)1. 28sqrt(5) + 40500 Simplify (sqrt(133) - 1sqrt(133)6 - sqrt(133))/(sqrt(21)/(sqrt(3)6)). -36sqrt(19) Simplify 4 + (6sqrt(136)-2 - sqrt(136))/sqrt(8) + (6(0 + sqrt(1700)) + -4)*2. -493sqrt(17) + 61220 Simplify ((5 + 1 + sqrt(99))*2 + sqrt(99) - ((-2sqrt(44))*2 + -3))2. -76 + 78sqrt(11) Simplify ((sqrt(480) + (1sqrt(480) + sqrt(480))1)/sqrt(12))/(((sqrt(64)2 + sqrt(64))1 - sqrt(64))/sqrt(8)). 3sqrt(5)/2 Simplify -4 + 0 + -3 + 3 + sqrt(720) + 1. -3 + 12sqrt(5) Simplify 1(((0 + sqrt(1216))2)2 - sqrt(1216) - (-4 + 0 + sqrt(1216))2 - (-6(sqrt(1216) + 3sqrt(1216)2))*2). -2141392 + 56sqrt(19) Simplify 3 + ((sqrt(22) - sqrt(220)/(sqrt(20)/sqrt(2)))/(sqrt(539) - sqrt(539)2))2. 3 Simplify (-3 + (sqrt(700) + 1 + -3 - -1sqrt(28)4))2. -180sqrt(7) + 2293 Simplify -1(3 + (sqrt(2448) - 3(1sqrt(2448))2 - (3 + sqrt(2448) + 1)2)) + -4. 84sqrt(17) + 9801 Simplify ((sqrt(2106) - (sqrt(2106) - 1sqrt(2106))-5)/((1sqrt(14))/sqrt(7) - (sqrt(2)-2 + sqrt(2) + sqrt(2))-6))2. 1053 Simplify (-6sqrt(99)-45)/(sqrt(18)/(sqrt(18)4)). 1440sqrt(11) Simplify 2 + -6((sqrt(77)/((sqrt(44)/sqrt(4) + sqrt(11))-3))*2 + (-1-1sqrt(28))/sqrt(4)). -6sqrt(7) + 5/6 Simplify (-5 + ((sqrt(300)-2 + sqrt(300))-4 - sqrt(300))1 + -5)2. -600sqrt(3) + 2800 Simplify ((-1sqrt(65) + sqrt(65))-1 - (4(sqrt(65)1 - sqrt(65)) + sqrt(65)))/(sqrt(720) - (sqrt(720) - 61sqrt(720))). -sqrt(13)/72 Simplify -1(((sqrt(27) - sqrt(243)-5) + sqrt(54)/(sqrt(2) + sqrt(6)/sqrt(3)))/((1sqrt(108))/sqrt(12) + (sqrt(126)/sqrt(2))/sqrt(7)))2. -3267/16 Simplify 2-1((sqrt(325) + 0 + sqrt(325) + sqrt(325) + sqrt(325))2)*2-3. 124800 Simplify sqrt(80)/sqrt(4)4 + 2 - -1(sqrt(80))*2-5. -398 + 8sqrt(5) Simplify (-1 + -1 + sqrt(19)4 + 6(sqrt(19)1 - sqrt(19)) + sqrt(19))44. -32 + 80sqrt(19) Simplify sqrt(288) + 0 + (sqrt(2)2)*2 + 3 + (2sqrt(2)1 - (sqrt(10)/(sqrt(5)2) + sqrt(2))). 11 + 25sqrt(2)/2 Simplify ((-2(sqrt(2662) - (sqrt(2662) + (sqrt(2662)-1 - sqrt(2662)))) + sqrt(2662))/((sqrt(99)2 + sqrt(99))-6))2. 121/162 Simplify 3 + ((2 + sqrt(11)-2)*26 - ((sqrt	{ "pile_set_name": "DM Mathematics" }
- 1. What is b(-9)? -46 Let t(b) = b*3 - 5b*2 + 4b + 3. What is t(4)? 3 Let f(m) = -m*2 + 8m + 1. Determine f(7). 8 Let k(h) = 35h - 141. Give k(4). -1 Let f(v) = -v3 + 9v*2 - 7v - 9. Determine f(7). 40 Let r(t) = -10t + 62. What is r(6)? 2 Let x(h) = -h3 - 19h*2 + 2h + 45. Calculate x(-19). 7 Let n(a) = 5a2 + 15. Determine n(-5). 140 Let s(g) = 2g*2 - 7g + 8. Calculate s(4). 12 Let n(q) = -q*3 + 3q*2 + 8q - 3. Give n(5). -13 Let z(j) = j*3 - 7j*2 + 3. What is z(7)? 3 Let v(m) = 3m*2 + 82m + 17. What is v(-27)? -10 Let v(l) = -2l3 - 19l*2 - 5l + 31. Give v(-9). -5 Let j(z) = z - 2. Determine j(-6). -8 Let z(d) = 5d3 + 2d2 + d. Determine z(-1). -4 Let t(w) = w3 - 2w + 1. What is t(-2)? -3 Let j(p) = -4p*2 + 15p - 1. What is j(4)? -5 Let s(b) = -b + 5. Calculate s(8). -3 Let j(i) = -i*3 + 9i*2 - 3i - 20. Determine j(6). 70 Let i(j) = -3j2 + 18j - 39. Calculate i(4). -15 Let d(q) = -33q - 198. Calculate d(-6). 0 Let c(v) = 2v*2 + 46v + 39. Calculate c(-22). -5 Let h(r) = -r*2 + 10r - 7. Determine h(8). 9 Let k(j) = -40j2 + 84j - 7. Give k(2). 1 Let c(g) = -g*2 - 13g - 16. Give c(-11). 6 Let i(c) = -4c2 - 7c - 8. Calculate i(-2). -10 Let v(r) = -5r + 218. Give v(39). 23 Let w(q) = -15q3 - q2 - 1. Calculate w(-1). 13 Let d(b) = -b*2 - 7b - 10. What is d(-6)? -4 Let g(k) = k*2 - 6k - 3. What is g(7)? 4 Let q(n) = 16n2 + 2n. Determine q(-1). 14 Let u(p) = p*2 - 9p - 18. Give u(11). 4 Let f(q) = 14q + 96. Give f(-8). -16 Let b(w) = w3 - 3w*2 - 11w - 6. Give b(-4). -74 Let c(q) = 2q - 37. Determine c(18). -1 Let f(y) = -y2 + 22y - 21. Determine f(21). 0 Let o(n) = -6n - 22. Give o(14). -106 Let v(t) = -t3 - 11t*2 + t - 5. Calculate v(-11). -16 Let u(h) = 2h + 29. What is u(-15)? -1 Let m(b) = -b*2 + 10b - 9. What is m(6)? 15 Let t(q) = 3q2 - q + 6. Calculate t(3). 30 Let w(f) = f2 + 2f - 3. Determine w(3). 12 Let n(j) = 4j - 5. What is n(2)? 3 Let w(n) = -n3 + 38n2 + n - 4. Determine w(0). -4 Let y(d) = d - 55. What is y(13)? -42 Let b(c) = c3 + 6c2 - 3c + 2. Determine b(-6). 20 Let s(o) = -o*2 + 20o - 79. Give s(14). 5 Let j(u) = -u*3 + 9u*2 + 9u. What is j(10)? -10 Let j(y) = 2y + 27. Give j(-10). 7 Let p(a) = a2 - 14a + 1. Determine p(10). -39 Let a(f) = -14f + 76. What is a(4)? 20 Let h(o) = o2 + 8o + 12. Calculate h(-6). 0 Let g(q) = q*3 - 4q*2 + 2q - 21. Calculate g(4). -13 Let m(y) = -4y - 8. Determine m(-6). 16 Let v(t) = -11t*3 + 2t*2 - 4t + 3. Determine v(2). -85 Let d(s) = s + 17. Determine d(-4). 13 Let j(u) = 16u - 200. Give j(13). 8 Let w(f) = -f2 - 17f + 14. What is w(-14)? 56 Let b(n) = -n - 27. Determine b(-5). -22 Let x(l) = -l + 13. What is x(-3)? 16 Let c(d) = d*3 + 6d*2 - 11d + 1. Give c(-8). -39 Let x(j) = -j*2 + 3j + 8. Give x(4). 4 Let f(w) = 2w3 - 19w*2 + 10w - 4. Determine f(9). 5 Let l(i) = -i*3 + 11i*2 - 2i - 11. Determine l(5). 129 Let z(k) = 2k2 - 3k. What is z(0)? 0 Let t(y) = -y - 3. Calculate t(-9). 6 Let x(w) = 2w3 + 2w*2 + 2w. Calculate x(-2). -12 Let b(r) = -110r + 325. Determine b(3). -5 Let q(p) = 3p - 12. What is q(-7)? -33 Let w(s) = -s*2 + 5s + 18. Determine w(8). -6 Let q(o) = 3o2 + 4o + 9. What is q(-3)? 24 Let w(k) = -26k - 22. Give w(-1). 4 Let m(k) = -k2 - k + 1. Give m(-3). -5 Let m(c) = 99c - 1196. Calculate m(12). -8 Let z(h) = -6h - 60. Give z(-6). -24 Let v(x) = x3 + 3x*2 - 5x. Determine v(-5). -25 Let k(u) = 10u - 9. Determine k(3). 21 Let z(k) = k2 + 52k + 134. What is z(-49)? -13 Let v(z) = 2z2 + 27z + 78. Calculate v(-8). -10 Let x(d) = -9d3 - 2d*2 + 2d - 2. Give x(2). -78 Let p(c) = -c*2 + 19c + 48. Give p(22). -18 Let x(h) = 57h + 162. Calculate x(-4). -66 Let x(n) = 52n + 58. What is x(-1)? 6 Let k(h) = h*2 - 11h + 2. Determine k(13). 28 Let i(r) = -2r2 + 61r - 394. Give i(21). 5 Let h(f) = -35f - 24. Give h(-1). 11 Let u(d) = -d2 + 22d + 22. Give u(9). 139 Let c(x) = -x*3 - 4x*2 + 14x + 10. Calculate c(-6). -2 Let c(g) = -5g + 1. Calculate c(-5). 26 Let p(h) = h2 + 8h - 28. Determine p(-9). -19 Let a(m) = -m*2 + 11m - 8. Calculate a(9). 10 Let n(j) = -25j - 25. Determine n(-4). 75 Let n(h) = -24h + 186. Determine n(8). -6 Let y(x) = x*3 - 16x*2 + 25x + 32. Determine y(14). -10 Let m(i) = -i*3 + 10i*2 + i - 18. Determine m(10). -8 Let m(d) = 3d + 47. Determine m(-20). -13 Let r(t) = -t*3 - 8t*2 + 10t + 13. What is r(-9)? 4 Let y(l) = l*2 + 4l + 3. What is y(-4)? 3 Let f(x) = -2x + 12. Give f(6). 0 Let r(t) = 3t*3 + 6t*2 + 2. Determine r(-2). 2 Let z(t) = -2t*3 + 25t*2 + 13t + 10. Give z(13). 10 Let t(x) = 2x2 - 43x + 38. Give t(22). 60 Let f(z) = z*2 - 12z + 4. Calculate f(14). 32 Let q(d) = 11d2 - d - 3. What is q(2)? 39 Let z(s) = s3 + 19s*2 - 24s - 75. Determine z(-20). 5 Let g(i) = 2i2 - 8i - 2. Give g(6). 22 Let x(b) = -b*2 - 2b - 7. Give x(-3). -10 Let z(m) = -25m + 44. Give z(2). -6 Let f(q) = q2 - 8q + 22. Calculate f(3). 7 Let y(u) = u*3 + 4u2 + u - 17. Calculate y(-4). -21 Let h(o) = o3 + 13o2 - 31o - 15. Calculate h(-15). 0 Let h(d) = d*2 - 7d - 2. Calculate h(8). 6 Let c(f) = f*2 + 2f - 35. Calculate c(-8). 13 Let s(o) = -o*2 + 2o - 2. Determine s(0). -2 Let b(d) = d*3 - 11d*2 - 6d + 2. Determine b(11). -64 Let t(q) = -q*3 - 2q*2 + 2q - 5. Calculate t(-4). 19 Let c(h) = -2h - 14. Give c(-7). 0 Let y(i) = i3 - 3i*2 - 4i - 1. Determine y(-3). -43 Let u(m) = m*3 - 3m*2 - 5m + 1. What is u(4)? -3 Let p(b) = b*2 + 12b - 5. Give p(-11). -16 Let j(o) = -o*3 - 40o*2 + 45o + 171. Give j(-41). 7 Let r(b) = 9b2 + b. Determine r(1). 10 Let q(x) = -3x + 5. What is q(4)? -7 Let b(i) = -5i + 1. Give b(-1). 6 Let r(i) = -4i*2 + 136i + 4. Calculate r(34). 4 Let f(g) = 3g2 + 6g - 62. What is f(4)? 10 Let a(f) = -5f2 - 95f. Determine a(-19). 0 Let u(m) = m - 23. Give u(9). -14 Let v(j) = j3 - j2 - 3j + 3. What is v(2)? 1 Let z(n) = 133n + 671. Calculate z(-5). 6 Let n(f) = f*3 + 8f*2 - 18f + 14. What is n(-10)? -6 Let o(m) = 2m2 + 84m + 90. What is o(-41)? 8 Let t(n) = -2n2 - 11n. What is t(-8)? -40 Let m(f) = f2 + 3. Give m(3). 12 Let d(n) = -n - 12. Determine d(-4). -8 Let j(y) = -y2 + y + 54. Give j(8). -2 Let s(v) = 20v + 133. What is s(-7)? -7 Let r(a) = -2a + 32. Give r(-8). 48 Let a(m) = -18m - 2. Determine a(-4). 70 Let i(o) = o2 + o - 8. Calculate i(4). 12 Let q(x) = x + 3. Calculate q(7). 10 Let s(t) = 2t*2 + 10t + 9. Give s(-6). 21 Let q(p) = -p*3 - 13p*2 - 24p - 16. Give q(-11). 6 Let c(o) = o*2 + 17o + 43. Determine c(-15). 13 Let m(o) = -5o + 81. Calculate m(15). 6 Let j(y) = -3y + 3. Determine j(2). -3 Let r(t) = -t*3 - 9t*2 + 10t + 2. Determine r(-10). 2 Let n(g) = -3g. What is n(-6)? 18 Let x(l) = l2 + 69l + 731. Determine x(-56). 3 Let l(r) = r*3 - 7r*2 + 5r - 4. Determine l(6). -10 Let f(b) = 2b + 1. Determine f(-3). -5 Let x(y) = -y2 + 5y - 7. What is x(4)? -3 Let c(w) = -2w2 - 13w + 14. What is c(-7)? 7 Let w(k) = k3 + k2 + 8k + 23. What is w(-2)? 3 Let o(v) = -64v + 410. Determine o(6). 26 Let z(y) = -y*3 - 2y*2 + 24y - 6. Determine z(4). -6 Let c(n) = -5n2. What is c(2)? -20 Let t(g) = -g3 - 6g*2 - 11g - 10. Determine t(-4). 2 Let g(b) = -b*3 + 15b*2 - 7b - 45. Calculate g(14). 53 Let d(i) = -i*2 - 6i. Calculate d(-3). 9 Let b(d) = -3d - 102. Give b(-39). 15 Let k(f) = f3 - 5f*2 - 14f + 33. Determine k(6). -15 Let t(i) = -i*3 - 7i*2 - 5i - 7. Determine t(-5). -32 Let p(s) = -5s - 43. What is p(-8)? -3 Let j(f) = f2 - 7f - 3. Determine j(5). -13 Let b(m) = m3 - m2 - 5. Calculate b(0). -5 Let l(v) = -3v2 + v + 6. Give l(3). -18 Let j(b) = -2b*2 + 63b - 30. Give j(31). 1 Let f(h) = h*2 - 18h + 5. What is f(17)? -12 Let g(m) = 9m + 36. Give g(-4). 0 Let g(d) = -2d*2 - 6d - 6. What is g(-3)? -6 Let s(o) = -3o2 - 32o + 3. Determine s(-10). 23 Let u(t) = -43t2 - 15t - 2. Determine u(-1). -30 Let b(g) = -8g - 191. What is b(-27)? 25 Let f(y) = -3y2. Determine f(-1). -3 Let c(g) = -g2 - 6*g + 20. What is c(-9)? -7 Let u(g)	{ "pile_set_name": "DM Mathematics" }
base 8, what is -11 - 52400261? -52400272 In base 13, what is -5305b - c4? -53152 In base 14, what is -200d - -4? -2009 In base 2, what is 11 + 1001001011011100010010? 1001001011011100010101 In base 7, what is 303 - 130101506? -130101203 In base 5, what is -4 + -2424133140? -2424133144 In base 6, what is -31213 - -24115? -3054 In base 12, what is -1 - 71498b7? -71498b8 In base 8, what is 1 - -63327244? 63327245 In base 9, what is 4206 + 11805? 16112 In base 3, what is 20000112 - 122011202? -102011020 In base 16, what is -521 + 52b8? 4d97 In base 4, what is 100100333 - -20123? 100121122 In base 2, what is 1000 + -100111100000100001110101? -100111100000100001101101 In base 15, what is -2957a - 1b6? -29741 In base 9, what is -125 + -55530? -55655 In base 4, what is -13332 - 100021001? -100100333 In base 11, what is -1a81 + 837? -1245 In base 12, what is -5 - -1670412? 1670409 In base 11, what is 2 - -67536294? 67536296 In base 10, what is 159967 - 1? 159966 In base 9, what is 1634171 + 40? 1634221 In base 6, what is -14225424002 + 4? -14225423554 In base 9, what is -36 + 287324? 287277 In base 15, what is -77d64 - 18b? -78000 In base 16, what is -436f6 - 0? -436f6 In base 11, what is 11a36337 - -15? 11a36351 In base 16, what is c2e1b + -12? c2e09 In base 3, what is -22 + 2002101221210101? 2002101221210002 In base 7, what is 2236312154 - 3? 2236312151 In base 12, what is -78954 + -21? -78975 In base 14, what is 110c898 + -32? 110c866 In base 12, what is 5 + 3750640? 3750645 In base 15, what is d7283 + 3c8? d765b In base 4, what is 200110 - 1210202? -1010032 In base 4, what is -11 - -12301022121? 12301022110 In base 14, what is 2d5214 + -1a? 2d51d8 In base 13, what is -9aaa8c93 + 5? -9aaa8c8b In base 5, what is 4110 - -2342? 12002 In base 2, what is 101100000100000100100011 - -111101? 101100000100000101100000 In base 14, what is 16b9 - 944d? -7b74 In base 13, what is -184711 + -30? -184741 In base 12, what is 385b7 - 6355? 32262 In base 9, what is -72534 - -118? -72415 In base 16, what is 2111 - -12b? 223c In base 6, what is 2455 + -311434? -304535 In base 16, what is b27 + 4c8c? 57b3 In base 7, what is 131552 - 321? 131231 In base 15, what is -e3 + -6440? -6533 In base 16, what is 38c502 - -3f? 38c541 In base 12, what is 630ab9 - 13? 630aa6 In base 15, what is -3652 - -a1? -35a1 In base 8, what is 220 + 46336? 46556 In base 13, what is -2cb72 + 12c? -2ca43 In base 3, what is -2202122 + -10202202120? -10212112012 In base 2, what is -101 - 10110010010000110010010? -10110010010000110010111 In base 15, what is 4d + 1aa90? 1aadd In base 3, what is 10000210102020211 - 0? 10000210102020211 In base 14, what is -3 + 31b5b87? 31b5b84 In base 4, what is 1131 - 22330322002? -22330320211 In base 5, what is -13421401 - 114134? -14041040 In base 8, what is 3475 + 2110? 5605 In base 16, what is -267398 + 0? -267398 In base 15, what is -6 + -166b68? -166b6e In base 9, what is -40854811 + -4? -40854815 In base 11, what is -40a505 + -a? -40a514 In base 16, what is -17 + 15113? 150fc In base 13, what is -4c5b35c - -1? -4c5b35b In base 9, what is -3 - -125120270? 125120266 In base 9, what is -10218447 + 6? -10218441 In base 8, what is 316260 - 711? 315347 In base 8, what is -5300615 + -573? -5301410 In base 16, what is 150c - 1c0? 134c In base 7, what is 212653 + -243? 212410 In base 7, what is 5006 - -565? 5604 In base 9, what is -10248 + -423? -10672 In base 14, what is b582 + 75? b617 In base 9, what is -7658 + 5057? -2601 In base 3, what is -10 + -110102122010? -110102122020 In base 16, what is 13 - 5e88f? -5e87c In base 11, what is -5 - -2459a67? 2459a62 In base 11, what is -138 - 35419? -35556 In base 4, what is 23303301011303 - -11? 23303301011320 In base 9, what is -835718 + -4? -835723 In base 15, what is -4a - -9075? 902a In base 13, what is 1 + -26b9678? -26b9677 In base 2, what is 101100011 + 101101010110? 110010111001 In base 10, what is 259 + -12541? -12282 In base 13, what is 11a81434 - 0? 11a81434 In base 6, what is -2012322230 - 3? -2012322233 In base 2, what is 10111100000 - -10000111100111000? 10001010100011000 In base 3, what is 201210 + -101101222? -100200012 In base 13, what is -113104c + c3? -1130c59 In base 3, what is -11020021112200112 + 100? -11020021112200012 In base 13, what is 8772a5 + 4? 8772a9 In base 9, what is -455082 + 11? -455071 In base 13, what is 221 + -22074? -21b53 In base 7, what is 5 + 21265252? 21265260 In base 2, what is 1001 + 11000010100000101? 11000010100001110 In base 6, what is 2443554052 - -10? 2443554102 In base 12, what is -5612a6183 - -3? -5612a6180 In base 2, what is 110010000111011010 - 1100101? 110010000101110101 In base 10, what is 51177 + 83? 51260 In base 16, what is 41443f2 - -12? 4144404 In base 15, what is 8c4d - 8? 8c45 In base 11, what is -6 + -367182? -367188 In base 10, what is 13 + 472724? 472737 In base 5, what is 1333443 + 302020? 2141013 In base 16, what is -47fb82c - -5? -47fb827 In base 13, what is 12930a7 - -3? 12930aa In base 12, what is 48270139 + 5? 48270142 In base 14, what is -30d4547 + 1? -30d4546 In base 10, what is 2985 - 15643? -12658 In base 8, what is 1 + -543655614? -543655613 In base 8, what is 72 + 10342? 10434 In base 7, what is 204 - 1423663? -1423456 In base 9, what is 17 + -3712856? -3712838 In base 6, what is 3150431121 + -2? 3150431115 In base 8, what is -6270231 + 434? -6267575 In base 14, what is -17 + 5723a9? 572392 In base 4, what is -130220202100 + 3? -130220202031 In base 9, what is 2551 + -30505? -26844 In base 2, what is 101100011 - -100110111110100? 100111101010111 In base 10, what is -5 - 23711320? -23711325 In base 7, what is -5 - 431155232? -431155240 In base 6, what is -2 - 1021503113? -1021503115 In base 11, what is -503 + 12310a? 122707 In base 4, what is 1302 + 1012310? 1020212 In base 13, what is 4 + -2099bc? -2099b8 In base 15, what is -50173 + -245? -503b8 In base 7, what is 51321321 + 0? 51321321 In base 8, what is 17257 + 2314? 21573 In base 16, what is -a1 - -755a? 74b9 In base 11, what is -20 - 1166468? -1166488 In base 11, what is 8 - -1a177803? 1a177810 In base 14, what is 369 + 798b? 7d16 In base 12, what is 3 - 43b76992? -43b7698b In base 6, what is -200413503 + 112? -200413351 In base 4, what is -103321 - -2020230? 1310303 In base 6, what is -10211025514 - -1? -10211025513 In base 7, what is -115166 + 156515? 41316 In base 8, what is -265166306 + -4? -265166312 In base 7, what is -4444 + 1643024? 1635250 In base 16, what is 1d8 + 9bfd3? 9c1ab In base 13, what is 7047 - -1b63? 8baa In base 4, what is -233113 - 330222? -1230001 In base 4, what is 212222021332 - 0? 212222021332 In base 5, what is -1112412144 - 121? -1112412320 In base 6, what is 332 + -431555? -431223 In base 2, what is -100011110111011 + 101111011101110? 1011100110011 In base 11, what is -55 + 390844? 39079a In base 9, what is 32785630 + -4? 32785625 In base 15, what is -54ce + 9b4? -4a1a In base 16, what is ba51c6 + 1? ba51c7 In base 6, what is 11542032 + -4051? 11533541 In base 14, what is -9 + 1b50485? 1b5047a In base 13, what is 1 + -130b69b7? -130b69b6 In base 4, what is 10300102003 - -10? 10300102013 In base 7, what is -454 + -61520? -62304 In base 3, what is -12211022 + 2021012? -10120010 In base 7, what is 4 - 164665414? -164665410 In base 2, what is -1100 - 1010110001100000001? -1010110001100001101 In base 11, what is 1 + 1800267? 1800268 In base 3, what is 120111221 - 102210020? 10201201 In base 3, what is 111012012 - -210201? 111222220 In base 14, what is 16583 + 33b9? 1995c In base 6, what is -2321 + 503104? 500343 In base 8, what is -70637 - -770? -67647 In base 7, what is 1006033464 + 1? 1006033465 In base 16, what is -674 - 1ac? -820 In base 8, what is -1126 - -772? -134 In base 7, what is 3 + -101445643? -101445640 In base 3, what is 120110211122001 - 0? 120110211122001 In base 15, what is -799 + -1060? -1809 In base 15, what is -257c - -1e8? -2384 In base 8, what is -205674 + 3536? -202136 In base 3, what is -1021 + -101202221202? -101210000000 In base 14, what is -32a0b92 - -2? -32a0b90 In base 14, what is -13 + -54b902? -54b915 In base 14, what is -28 - 8ba49? -8ba73 In base 3, what is 11012000212220020 - 12? 11012000212220001 In base 7, what is 4244055 + -10?	{ "pile_set_name": "DM Mathematics" }
for f. 4 Let d be ((-7)/2)/(3/(-6)). Let p be 26/d + 16/56. Solve -pw = -4n + 4, -4 = -5n + 16 for w. 3 Let b = 1 - -11. Let p(q) = -q3 + 3q*2 + 5q - 1. Let m be p(4). Solve -mc = -3g + b, 0 = -g + 2c + 8 - 2 for g. 2 Suppose 0 = -3x + 22 + 29. Solve 7 = 4l + 4h - x, 0 = 2l - 3h + 8 for l. 2 Let g(o) = -6o2 - 2o + 1. Let b be g(1). Let u = b + 10. Solve 4n = 2j, 3j = un - 2n + 5 for n. 1 Suppose 0 = 2l - 4l + 8. Suppose 5j - 8 = -t, 7j + 4 = 4j - 5t. Suppose -5u = d + 23 + 2, 4d = -ju - 10. Solve 2o + 5c - 16 = d, lo + 3c = c for o. -2 Let j(s) = -s3 + s2 + 3. Let m = 5 + -5. Let v be j(m). Solve -vr = 5h + 30 + 7, 0 = 4r - 2h + 6 for r. -4 Suppose p - 5p = 2t - 66, -3t + 67 = 4p. Solve 3o + 2k + 9 = 0, 4o + k = -3k - p for o. -1 Suppose 3o = 4q + 5, -4o - 3q + 8q + 7 = 0. Suppose ob = b - 2. Let u(v) = -11v + 1. Let j be u(b). Solve -19 + 4 = 5f - n, 0 = -4f - 3n - j for f. -3 Let d = -38 - -41. Solve a - d = -3a - 5g, 4a + 2g - 6 = 0 for a. 2 Let u(m) = -3m2 + m + 1. Let o be u(-2). Let l = -8 - o. Solve p - 3k = -4k, -3p - l = 4k for p. 5 Suppose -5c + 0c - 4y = -18, 4 = -2c + 4y. Solve 8 = -4d - 2f - 6, cd + 3f + 5 = 0 for d. -4 Suppose -d = -0d - 2. Suppose -2x - 8 = 3r - 7r, -dr = -5x - 12. Let q be 1 - (2/(-2) - r). Solve -3i - 2a - 9 = -0i, -i - q = 2a for i. -3 Let f be (-6)/8(6 + -10). Suppose -fq - 4 = -19. Solve 3r + qa - 7 - 5 = 0, r = -2a + 5 for r. -1 Let k = 9 - 4. Suppose -kn + 2 = -18. Suppose -5z + 0p + 3p + 37 = 0, nz - p = 24. Solve -4b + 4 = -l + 1, -2l + 20 = zb for b. 2 Suppose u - 7 = -j - j, j + 3u - 11 = 0. Solve g + q - j = 0, 0g = -2g + 5q - 31 for g. -3 Suppose 25 = 9u - 4u. Solve 0 = 5k + 5, -10 = uv + 4k + 4 for v. -2 Let u(m) = -5m - 1. Let o be u(-1). Suppose -15 = -3r - 3h, -5r - 2h - 3 + 28 = 0. Solve oj - 3y = -16, -ry + 14 = -2j - 2y for j. -1 Suppose 0 = u - 4c - 10, -5u = -2c + 3c - 8. Suppose 0 = -2y - u + 8. Suppose yq = -15 + 54. Solve 3x = j - q, x + 0x = -5j + 1 for x. -4 Suppose 2t = 3q + 20, -t - 2q + 5 = 2. Let m = 3 - -21. Suppose -4y = 5v - m, -4v - 3y + 19 = -0y. Solve -d = 3d + vj + 12, -t = -3d + j for d. 1 Suppose 0 = -4l + 22 - 6. Let s(f) = -lf + 1 + 2f - 5. Let u be s(-3). Solve -4v - 4 + 0 = b, 0 = -3b + uv - 12 for b. -4 Let v(a) = -3a - 4. Let o be v(-3). Suppose -ow + 0w = -2g - 70, 4w = -2g + 38. Solve 4i - w = 0, 3t - 5i = -6 - 0 for t. 3 Let r = 11 + -3. Suppose 27 + r = -5l. Let g = -5 - l. Solve 0 = -2h - 5p + 19, 3p - 11 = gh - 2p for h. 2 Let h = 6 - 4. Suppose 8d - 5 = 3d, 19 = 5i - d. Solve if - 4u = 24, -h - 2 = 2u for f. 4 Let t be (1 - -89)/6 + (-1 - -1). Solve -2d + 9 = -2w + 5w, 5d = -5w + t for d. 0 Let s(f) = -f + 18. Let m be s(12). Suppose j = mj. Solve j = -2q - o + 5, q - 4o + 2o - 5 = 0 for q. 3 Let t = -38 - -58. Suppose -5u = -t, -f = -2f - 5u + 25. Suppose 2y + 4i + 8 = 4y, 8 = y - 4i. Solve -x - 20 = 5j - 1, y = -fx + j - 17 for x. -4 Suppose 5c = c. Solve c = 4m + 16, -3s + s + 4m + 10 = 0 for s. -3 Let u = 6 - 1. Let l = u - 3. Solve -6 = -2d - 0d + 3c, 0 = -d + lc + 3 for d. 3 Suppose -l = -2h - 8, -12 = l - h - 20. Solve -2w = 2t + l, w = 4t + 6w + 16 for t. -4 Let h be (-10)/(-4)8/10. Suppose -3b + 0b = 2o + 1, hb + 6 = 0. Solve 3t - 23 = os, -2s = t + 12 - 3 for t. 1 Let o = -16 + 18. Solve 4v - 7 - 16 = 3d, 0 = v - o for d. -5 Let b(v) = -6v - 6 + 3 + 2 + 3v + v*2. Let c be b(4). Solve -cy - d + 15 = 0, 3d - 7d = 5y - 32 for y. 4 Suppose 0 = -5o, 51 = 5l + 3o + 11. Suppose -4n + 24 - l = 0. Let f be (2/n0)/2. Solve -3x = 0, -8z + 4z - x - 20 = f for z. -5 Suppose p + 4 = 3, -4w + 24 = 4p. Solve k + 2 = -4z, 10 = 2z - wz - 5k for z. 0 Let u be 4/(1(-1 - -2)). Suppose -k = 3k + 36. Let s = k - -14. Solve -sc + 9 = -2v, -uc = -3c + 4v + 7 for c. 1 Let d(a) = -a*3 + 4a*2 - 2a + 5. Let i be d(4). Let j be 3i8/(-12). Solve -2n = 2x + j, 0n + 2n - 9 = x for n. 2 Let d = 9 + -5. Suppose 0w - 2s + 97 = 5w, 0 = -2s + 2. Let b = -14 + w. Solve -bg - 3y = -1, -2g + dy - 2 + 18 = 0 for g. 2 Let y(q) = q*2 - 11q + 17. Let s be y(10). Let k = 4 + -1. Solve kd = 4l - 13 - s, -4l = -5d - 20 for d. 0 Let m(a) = -2a3 - 2a*2 + 2a - 1. Let v be m(-2). Suppose -2y = -10 + 4. Let u = 1 + y. Solve -vt = -2r - 2, -ur + 0r + 2t = -12 for r. 5 Suppose 10 = -n + 3n. Let i(s) = s - 5. Let b be i(9). Suppose -bm - 27 = -nm. Solve -4u - 5 - 3 = 0, 5c - u = m for c. 5 Let y = 8 - 4. Suppose yu + j = -27, -4u + 3j + j - 32 = 0. Let q = u - -8. Solve -3s + q = -2a + 2, -4s + 5a + 1 = 0 for s. -1 Let a(x) = -7x + 2. Let o be a(-2). Let f = o - 14. Solve l + 2r - 2 = -3, fl - r = -12 for l. -5 Let n = -4 + 7. Suppose -4r = k + nk + 4, -k + 1 = 3r. Let a be 81r/2. Solve 2 = c - aq - 1, 0 = -5c + q - 23 for c. -5 Let z be 2 - -9(3 + -2). Suppose -12p = -zp - 3. Solve 0 = -5r + 3q + 40, pr = -2r - 5q for r. 5 Let i be (-4)/(-7) + (-376)/(-28). Let v = 4 + 2. Let f = v + i. Solve 3o + o + 15 = -3u, 3o = -4u - f for o. 0 Let n(b) = -b*2 + 5b + 10. Let d be n(6). Solve -2s + 4 + 8 = 5v, -3s = 2v + d for v. 4 Suppose -5n = -2n - 6. Suppose 0 = -nk - 2k + 4. Solve -2q + k = -4s - 3q, 3s = q + 8 for s. 1 Let o be ((-28)/7)/(2/(-8)). Suppose -o = -3f - f. Solve fs = 4c - 4, 3c + s - 5 = c for c. 2 Suppose 4i - 46 - 14 = 0. Let f = i + -13. Let j(x) = -2x - 3. Let c be j(-3). Solve -fo + cu + 13 = 0, -2u - 14 = -2o + 2u for o. 5 Let i = -3 + 5. Let g be -1 - (i + 1 + 1). Let w be (-2)/((-6)/g)-3. Solve 35 = 2v + 5k - 0k, wk - 25 = 0 for v. 5 Suppose 2 = y - 0. Solve yc - x = -2, -x - 3 = 3c - 5 for c. 0 Let t(x) = x + 1. Let d = 0 + 4. Let n = d + -5. Let i be t(n). Solve -3u - 4w + 1 = i, -2u - 2w = -0w + 2 for u. -5 Suppose 0 = -3n + n. Let r(i) = -7i + 1. Let c be r(-1). Suppose nu - c = -2u. Solve us = 16, -3s = 5h - s - 33 for h. 5 Suppose d - 2l - 28 + 6 = 0, 3l = 5d - 75. Let k = 11 + -8. Let h(p) = p2 - 15p. Let u be h(15). Solve -4s = -5w - 3 + d, s - kw + 11 = u for s. 4 Let m(w) = w2 + 5w + 8. Let t be m(-3). Solve 20 = -ta + 4b, 9a + 23 = 4a + b for a. -4 Suppose 3m = 3k - k - 3, 3k - 4m = 4. Solve -2v = 2b - 10, 0 = -3b - kb + v + 11 for b. 4 Let r be 1 + 2/((-2)/(-13)). Let n = -10 + r. Let t be (-2)/(-2) + (-2 - -1). Solve 3y = -5v + 20, -y = -v - ty + n for v. 4 Let k be (1/3)/(3/36). Let j be 6/(-21) + k/14. Solve -5v + 19 = 2z - 4, 2v + 5z - 5 = j for v. 5 Suppose -10 = -4m + 2. Suppose -mn + 2n = -6. Let r be (4/n)/(2/12). Solve y - rx = 3 - 2, 2y - 5 = 5x for y. 5 Let y(s) = -s + 4. Let j be y(4). Let r(v) = -v + 12. Let x be r(10). Let f be 22 + (2 - 2 - x). Solve j = 5u - f, -3u + 10 = 3n - 5 for n. 1 Suppose 3r - 5h + 14 = 0, -r + 3r = -4h + 20. Solve g + p + 7 = 0, -5g + r - 1 = -4p for g. -3 Let z(a) = a*3 - 11a*2 + 4. Let v be z(11). Solve 0 = 5y + 5l - 25, -1 = -5l + v for y. 4 Let a be (13 + -8)/((-5)/(-2)). Let d = -35 + 58. Solve -4m - 16 = ar, 4r + 0m - 3m = d for r. 2 Let d = 6 - 9. Let r = d - -7. Solve -2y + 0k - rk + 6 = 0, 2y - 5k = 6 for y. 3 Let t be (3/2)/((-7)/(-14)). Let q be (1 - 1)(0 + -1). Solve 5u - 4b - 15 = -qb, -u = 2b - t for u. 3 Suppose -4i = 2k - 48, 2i + i - 29 = -k. Solve 5c - k = p, -c - p - 2 = -0p for c. 2 Let a(u) be the third derivative of -u4/12 - u3 - u*2. Let x be a(-7). Let k(p) = p + 3. Let g be k(0). Solve gn - x = -4j, -j - 5 = 2j + 5n for j. 5 Let z(b) = 5b. Suppose -4t = -2t - 14. Let k = 8 - t. Let c be z(k). Solve -4p - 2d = -10, 9p + 4d = 4p + c for p. 5 Suppose 4k - 5b = 13, -4k + b = -0b - 9. Solve d + 2p = -1, -kd + 3 = -d + 4p for d. -5 Let d(a) = 3a + 0a + 2 - a - 3a. Let h be d(-5). Solve -5g - 5n - 7 = -8g, 5g + h = -n for g. -1 Let r = 6 - -9. Solve 4s = b - 0b + 6, -5s = -5b - r for s. 1 Suppose 5k - 16 = -f, 4k + 32 = 8k - 4f. Let x = 8 - k. Solve 5y - 2h + 3 = 0, xy + 0h + 2 = 2h for y. -1 Let k(h) = -4h*3. Let z be k(-1). Let c = z - 10. Let n(j)	{ "pile_set_name": "DM Mathematics" }
sqrt(3025))/(sqrt(50)/sqrt(250)). 110sqrt(5) Simplify sqrt(45) + -3 + sqrt(5) - (sqrt(80) + sqrt(5) + 2)2. -132 - 16sqrt(5) Simplify (-3 + (1 + sqrt(171) + -2 - sqrt(171)))*2. 16 Simplify sqrt(9)/(sqrt(3) - sqrt(96)/sqrt(2)) + 4. -sqrt(3)/3 + 4 Simplify ((-2sqrt(15) - sqrt(15))/sqrt(5))*2 + sqrt(75)-2. -10sqrt(3) + 27 Simplify 4(sqrt(153))*2 - (2sqrt(612) + sqrt(17) + sqrt(17)). -14sqrt(17) + 612 Simplify (-3 + sqrt(18) + sqrt(32)4)*2. -114sqrt(2) + 731 Simplify sqrt(704) + 1 - sqrt(704) - 1-1sqrt(11). 1 + sqrt(11) Simplify (sqrt(825)-1)/(sqrt(147) + 2sqrt(147) + sqrt(147)). -5sqrt(11)/28 Simplify (sqrt(784)2)/sqrt(128). 7sqrt(2)/2 Simplify ((2sqrt(441) - sqrt(441))/sqrt(7))/(sqrt(108)/(-1sqrt(12))). -sqrt(7) Simplify (sqrt(96)/sqrt(8)3)/sqrt(6). 3sqrt(2) Simplify (sqrt(1539) + 4 + sqrt(1539))2 + 3 + -4. 144sqrt(19) + 6171 Simplify (sqrt(153)/sqrt(225) + (sqrt(17) - (sqrt(17) + 2 + -5)) + -4)*2. -2sqrt(17)/5 + 42/25 Simplify (sqrt(200)6 + sqrt(50))/(-2sqrt(90)). -13sqrt(5)/6 Simplify -1-1sqrt(5)-2. -2sqrt(5) Simplify 4(sqrt(147) - (sqrt(147) + -2)). 8 Simplify ((2sqrt(143) + sqrt(143))/sqrt(11) - ((sqrt(65) + (sqrt(65)-2 - sqrt(65)))/sqrt(5) - sqrt(13)))*2-4. -1872 Simplify (52sqrt(3) - (0 + sqrt(75)))*2. 75 Simplify ((sqrt(171) - (sqrt(171) + 2 + sqrt(171)))-6 - (2 + sqrt(171))6)2. 0 Simplify sqrt(7) + sqrt(28)/sqrt(4)5 - (-5 + 2 + sqrt(7)). 3 + 5sqrt(7) Simplify sqrt(228)/sqrt(48) - (sqrt(1216) + sqrt(1216)-1) - (1sqrt(76)/sqrt(4) + 2). -sqrt(19)/2 - 2 Simplify -4(5 + sqrt(320)/sqrt(10))-5. 100 + 80sqrt(2) Simplify -5 + (-4(sqrt(76) + sqrt(19)))24-4. -43781 Simplify 4sqrt(14)/sqrt(7)-2. -8sqrt(2) Simplify ((-5(sqrt(77) + (sqrt(77) - 1sqrt(77) - sqrt(77) - sqrt(77) - sqrt(77)) + sqrt(77) + sqrt(77)))/sqrt(7))*2. 0 Simplify (sqrt(143) - (sqrt(143) - sqrt(143)-6) - sqrt(143))/sqrt(11) - -4(sqrt(13) + -3). -12 - 3sqrt(13) Simplify ((sqrt(475) + -1)5 - (2 + sqrt(475) + sqrt(475)1))-4. -60sqrt(19) + 28 Simplify ((5(sqrt(13) - sqrt(39)/sqrt(3) - sqrt(13)))2 - (sqrt(91) - sqrt(91)-2)/sqrt(7)) + 2. -3sqrt(13) + 327 Simplify sqrt(34)/(1-3sqrt(2)). -sqrt(17)/3 Simplify -1(0 + sqrt(19))*2-3-1. -57 Simplify (-2sqrt(72)3 - (-5 + sqrt(72) + 1))2 + -2. -336sqrt(2) + 3542 Simplify ((sqrt(216)5)/sqrt(8))2. 675 Simplify 0 + ((sqrt(77)2 - sqrt(77)) + sqrt(77))/sqrt(7)-1. -2sqrt(11) Simplify (sqrt(7920)-2)/sqrt(5) + (sqrt(396) + sqrt(396) + -1 - 6(sqrt(44))*2). -265 - 12sqrt(11) Simplify sqrt(22)/((sqrt(539) - sqrt(539)1 - sqrt(539) - sqrt(11)) + sqrt(11)) + 3(sqrt(72) + (sqrt(72) + 0)*2). 125sqrt(2)/7 + 216 Simplify (sqrt(320) + 2sqrt(320) + -4)2 - (-4 + (sqrt(320)-2 - sqrt(320))). -168sqrt(5) + 2900 Simplify (sqrt(99) - (2sqrt(99) + sqrt(99) - sqrt(99))-4 - sqrt(99))/sqrt(9) + (0 + sqrt(1100)2)*2. 8sqrt(11) + 4400 Simplify (-6(-2sqrt(88) + sqrt(88) + sqrt(88)) - sqrt(88))/sqrt(8). -sqrt(11) Simplify (-1sqrt(7) + -5)2 + -4. 10sqrt(7) + 28 Simplify (sqrt(99) - (sqrt(99) + -5))*2 + (6sqrt(77))/sqrt(7). 6sqrt(11) + 25 Simplify -3(sqrt(256)-2)/sqrt(8) + -4. -4 + 24sqrt(2) Simplify ((1sqrt(35))/sqrt(5) - sqrt(7))3 - (sqrt(112) - ((sqrt(112) - -2sqrt(112))-6 + sqrt(112) + sqrt(112))*2). -4sqrt(7) + 28672 Simplify ((sqrt(132) - (sqrt(132) + sqrt(132)2 - sqrt(132)))4)/(-1sqrt(588)) + 3. 4sqrt(11)/7 + 3 Simplify (4 + sqrt(28)/sqrt(4) - (2 + 2sqrt(7)))2. -4sqrt(7) + 11 Simplify (-1sqrt(272)-1)*2. 272 Simplify 3(sqrt(162) + -2)*2 - (sqrt(162) - (sqrt(162) + sqrt(162)25))2. -15702 - 108sqrt(2) Simplify -2(sqrt(833)25)2. -166600 Simplify ((sqrt(156) - 1sqrt(156))/sqrt(6))/(-2sqrt(6)/sqrt(3)). 0 Simplify (sqrt(204)-1)/sqrt(12) - (1 + sqrt(153)). -4sqrt(17) - 1 Simplify (sqrt(5) - sqrt(10)/(sqrt(2) + sqrt(72)))5. 30sqrt(5)/7 Simplify -3 + (-2 + sqrt(175))-1. -5sqrt(7) - 1 Simplify -6(sqrt(117) + -5)*2. -852 + 180sqrt(13) Simplify -4 + 5sqrt(6)/sqrt(3). -4 + 5sqrt(2) Simplify ((sqrt(99) + -1sqrt(99) + sqrt(99))-2 - sqrt(99))/sqrt(9). -3sqrt(11) Simplify 2 + (sqrt(3) + 1)2 - (4 + sqrt(27)). -sqrt(3) + 2 Simplify (1(sqrt(7) + sqrt(21)/(sqrt(6)/sqrt(2)) + sqrt(35)/sqrt(5) + -3))*2. -18sqrt(7) + 72 Simplify (sqrt(288) - (sqrt(288) - -5(-1sqrt(288))*2)) + -2. -1442 Simplify sqrt(171)4 - (sqrt(19) - ((-1 + sqrt(19))-3)2). -7sqrt(19) + 180 Simplify 2 + 6sqrt(65)/(-2sqrt(5)). -3sqrt(13) + 2 Simplify ((sqrt(27) + sqrt(54)/(sqrt(50) + sqrt(2)) + sqrt(27))/(sqrt(225) - (sqrt(225)1 + sqrt(225))))*2. 169/300 Simplify 4 + (sqrt(25)/sqrt(5)5 - ((sqrt(40)/sqrt(72) - sqrt(5)) + sqrt(5))). 4 + 14sqrt(5)/3 Simplify (-4 + sqrt(128))2 + -3. -64sqrt(2) + 141 Simplify (-3sqrt(144))/sqrt(8). -9sqrt(2) Simplify (-3 + sqrt(75)-1 + -5)2. 80sqrt(3) + 139 Simplify sqrt(209)/((sqrt(891) - (sqrt(891)3 + sqrt(891))) + sqrt(891)). -sqrt(19)/18 Simplify -4sqrt(11)-2 + -2. -2 + 8sqrt(11) Simplify ((sqrt(3) - (sqrt(3) + sqrt(12)/sqrt(4))) + 3)-4 + 0. -12 + 4sqrt(3) Simplify (2sqrt(931)1 - sqrt(931))*2. 931 Simplify sqrt(3) + (-5sqrt(3)1)2 + sqrt(30)/(sqrt(40) + sqrt(10)). 4sqrt(3)/3 + 75 Simplify -11sqrt(363) + sqrt(363) - sqrt(363). -11sqrt(3) Simplify sqrt(28)/((sqrt(112)/sqrt(4))/sqrt(7)). sqrt(7) Simplify (5sqrt(19) + 2 - (sqrt(19) - (sqrt(684) + 0) - sqrt(19)))*2. 44sqrt(19) + 2303 Simplify -1sqrt(76) + sqrt(171)-6. -20sqrt(19) Simplify 0 + sqrt(180) + 1 + sqrt(180) + 2. 3 + 12sqrt(5) Simplify (sqrt(20) + (sqrt(200)/(sqrt(10) + sqrt(80)/sqrt(8)) - sqrt(20)))*2. 5 Simplify (sqrt(272) + (sqrt(272) + (sqrt(272) - (sqrt(272) - sqrt(272)-3)) + 1 - sqrt(272) - sqrt(272)) + sqrt(272))*2. -16sqrt(17) + 1089 Simplify (-2sqrt(1539))2-1. -6156 Simplify 5 + (0 + sqrt(11))2 + (sqrt(99) + -1)2. -6sqrt(11) + 116 Simplify (5(-3 + sqrt(48))-4)2. -9600sqrt(3) + 22800 Simplify -22sqrt(19) + (sqrt(19) - (0 + sqrt(171))). -6sqrt(19) Simplify (sqrt(91)/sqrt(252) - 6sqrt(52)) + 1. -71sqrt(13)/6 + 1 Simplify 3 + sqrt(11) + -1 - -3(-1sqrt(11))2. sqrt(11) + 35 Simplify sqrt(14)/(sqrt(7) + (-3sqrt(700) - sqrt(7))). -sqrt(2)/30 Simplify (sqrt(10) + sqrt(30)/sqrt(48))/sqrt(2). 5sqrt(5)/4 Simplify (-62sqrt(117))2. 16848 Simplify ((-3sqrt(72))/((sqrt(4) - sqrt(8)/sqrt(32)) + sqrt(4)))*21. 2592/49 Simplify 5(sqrt(1500) - 2sqrt(1500))/sqrt(12). -25sqrt(5) Simplify sqrt(30)/sqrt(160) + (-5(2 + sqrt(3)))*2. 401sqrt(3)/4 + 175 Simplify sqrt(363) + -2 + sqrt(363) - ((3sqrt(9))/sqrt(3))2. -29 + 22sqrt(3) Simplify (1sqrt(110)1)/sqrt(640). sqrt(11)/8 Simplify 0 + (sqrt(65)1 - sqrt(65))/sqrt(5). 0 Simplify 5sqrt(15)/sqrt(3)4 - (-1 + sqrt(5))6-4. -24 + 44sqrt(5) Simplify (2sqrt(117)1)/sqrt(324). sqrt(13)/3 Simplify ((sqrt(130)3 + sqrt(130))/sqrt(10) - (2 + sqrt(52)/sqrt(4)))2. -12sqrt(13) + 121 Simplify (sqrt(300) + sqrt(300)36)*2. 108300 Simplify 5 + sqrt(396) + 5. 10 + 6sqrt(11) Simplify -2 + (sqrt(343)-2 + sqrt(343) + 5 - sqrt(343) - (sqrt(343) + -5 + (sqrt(343) - (sqrt(343) - 1sqrt(343)))))*2. -560sqrt(7) + 5586 Simplify sqrt(196)/sqrt(847). 2sqrt(7)/11 Simplify 1 + (6sqrt(15)/sqrt(3) - sqrt(5)3-6). 1 + 24sqrt(5) Simplify (sqrt(1088) + -1 + sqrt(1088) + sqrt(1088)-2)*2. 1 Simplify -2 + (-1sqrt(272))*2. 270 Simplify -2(-2 + 4sqrt(1900)). -80sqrt(19) + 4 Simplify (sqrt(187)/(sqrt(55)/sqrt(5)) - ((sqrt(136)1)/sqrt(8))2)2. -34 + 2sqrt(17) Simplify -4 + (sqrt(5) + 1sqrt(25)/sqrt(5) + (-5 + (sqrt(245) - sqrt(5)) - sqrt(5)))*2. -70sqrt(5) + 266 Simplify (sqrt(68) + (sqrt(68) - (-2sqrt(68) - sqrt(68)))-4 - (sqrt(68) - (-5 + sqrt(68) + -1 + sqrt(68))))*2. 336sqrt(17) + 13364 Simplify 4(sqrt(17) + sqrt(17)4) - sqrt(136)/sqrt(800). 199sqrt(17)/10 Simplify (sqrt(304)2 - sqrt(304))*2 + -1 + sqrt(304) + 2. 4sqrt(19) + 305 Simplify -5 + sqrt(76)-5. -10sqrt(19) - 5 Simplify sqrt(6)/(sqrt(96)/sqrt(3) - sqrt(2)). sqrt(3)/3 Simplify (-2sqrt(1377) - sqrt(1377)) + -3 + -4. -27sqrt(17) - 7 Simplify 4 + -4(1 + sqrt(13)). -4sqrt(13) Simplify (sqrt(21) + sqrt(21) + (sqrt(231)/sqrt(275) - sqrt(21)))/sqrt(3). 6sqrt(7)/5 Simplify 1 + sqrt(1008) + (sqrt(1008) + 1)2 + sqrt(1008) + sqrt(1008) - (1(0 + sqrt(7))*2 + (sqrt(7) - 2sqrt(112))**2	{ "pile_set_name": "DM Mathematics" }
+ 16m - 5. Calculate n(8). -5 Let d(v) = 4v - 3. Give d(-6). -27 Let o(m) = m*3 + 10m*2 - 39m - 313. Determine o(-11). -5 Let d(g) = 3g3 + 4g*2 + g - 4. Give d(-2). -14 Let q(r) = 8r*3 - 4r*2 - 2r + 3. Calculate q(2). 47 Let r(d) = -10d3 - 4d*2 - 2d - 8. What is r(-2)? 60 Let n(k) = -k*2 - 14k + 1. Give n(-9). 46 Let o(a) = 11a. Determine o(4). 44 Let a(w) = 25w + 128. Determine a(-5). 3 Let k(t) = -t*3 - 8t*2 + 9t + 6. What is k(-9)? 6 Let p(b) = -2b + 9. Calculate p(5). -1 Let r(i) = i3 + 3i*2 - 2i + 1. What is r(-3)? 7 Let a(s) = s*2 + 11s + 11. Give a(-5). -19 Let a(h) = h*2 - 10h + 7. Calculate a(10). 7 Let f(s) = -24s - 146. Determine f(-8). 46 Let y(a) = -8a3 - a2 - a + 1. What is y(1)? -9 Let t(b) = -b*2 - 10b - 2. What is t(-10)? -2 Let g(b) = -b*3 + 26b*2 - 72b + 18. Give g(23). -51 Let a(r) = -r*3 + 3r*2 + 4r + 1. Calculate a(3). 13 Let d(t) = t*3 + 6t*2 - 35t - 177. Give d(-8). -25 Let f(k) = k*2 - 3k - 112. What is f(-9)? -4 Let o(x) = 8x + 10. Determine o(-6). -38 Let n(u) = u3 - 8u*2 + 6u - 8. Determine n(6). -44 Let o(j) = j*2 - 12j + 2. Give o(10). -18 Let u(y) = -7y + 6. Calculate u(2). -8 Let j(l) = 79l + 1. Determine j(1). 80 Let n(p) = -p*3 - 14p*2 - 24p - 3. Calculate n(-12). -3 Let g(p) = p*3 - 7p*2 + 2p - 5. Determine g(7). 9 Let x(n) = -n*3 - 19n*2 + 16n - 67. What is x(-20)? 13 Let b(i) = -i*3 + 2i*2 + i + 3. What is b(3)? -3 Let l(m) = 3m + 24. Calculate l(-8). 0 Let g(v) = -v*2 - 18v - 9. Calculate g(-16). 23 Let x(k) = k - 9. What is x(10)? 1 Let b(f) = 2f - 23. Give b(3). -17 Let x(f) = f3 - f2 + 10. Give x(0). 10 Let i(l) = -l2 - 10l - 3. Give i(-8). 13 Let l(p) = -p*2 + 4p + 26. What is l(10)? -34 Let k(y) = y3 + y2 - y - 20. Calculate k(0). -20 Let h(m) = -m*3 + 35m*2 - 33m - 37. What is h(34)? -3 Let m(u) = -u*3 + 3u - 1. What is m(-5)? 109 Let r(t) = -t*2 - 7t - 17. Give r(-7). -17 Let s(c) = 6c + 4. What is s(2)? 16 Let l(m) = -m3 - 8m*2 - 19m - 15. Calculate l(-5). 5 Let d(s) = s + 36. Calculate d(-17). 19 Let u(c) = -13c3 - 2c + 2. Calculate u(2). -106 Let v(i) = -2i + 12. Give v(10). -8 Let s(g) = -8g - 51. Calculate s(5). -91 Let y(c) = 3c - 2. What is y(-6)? -20 Let r(m) = -m2 - 15m - 14. Determine r(-7). 42 Let b(z) = -z - 7. Calculate b(-9). 2 Let c(z) = -z*2 + 12z + 32. Give c(14). 4 Let u(d) = 13d2 + 5d - 2. Give u(2). 60 Let x(h) = -5h2 + h + 2. Give x(-1). -4 Let q(f) = -f3 + 12f*2 - 2f + 18. Calculate q(12). -6 Let j(b) = -b*3 - 10b*2 - 17b + 2. What is j(-8)? 10 Let s(x) = x*3 + 9x*2 - 8. Calculate s(-8). 56 Let m(n) = -4n*3 + 28n*2 + 4n + 1. Calculate m(7). 29 Let n(d) = -d*3 + 9d*2 - 14d + 16. Give n(7). 16 Let t(w) = w*3 + 2w*2 - 2w + 7. Give t(-4). -17 Let v(a) = -2a2 + 8a + 71. What is v(-5)? -19 Let p(l) = l*2 - 3l - 14. What is p(6)? 4 Let m(l) = -2l2 + 4. Calculate m(-4). -28 Let z(f) = 2f*2 + 83f + 46. Give z(-41). 5 Let t(w) = w*2 - 10w - 9. Calculate t(11). 2 Let d(p) = -5p - 6. Calculate d(-5). 19 Let y(b) = b3 - 7b*2 + 7b - 1. Give y(6). 5 Let i(g) = -g*3 + 19g*2 - 20g + 42. What is i(18)? 6 Let h(j) = -17j + 34. What is h(3)? -17 Let p(o) = o2 + 10o - 12. Determine p(-10). -12 Let t(m) = 2m2 - 8m + 11. What is t(3)? 5 Let y(q) = q*3 - 6q*2 - 9q + 22. What is y(7)? 8 Let w(f) = 3f2 - f. Determine w(-1). 4 Let v(o) = o + 3. Give v(3). 6 Let c(b) = b2 - 18b - 12. Give c(17). -29 Let p(g) = -2g2 - 8g + 36. Determine p(-9). -54 Let t(f) = -5f + 20. Determine t(6). -10 Let t(m) = -13m + 3. Calculate t(-2). 29 Let k(m) = m*2 + 11m + 15. Calculate k(-8). -9 Let u(d) = d*2 - d - 5. Determine u(-3). 7 Let i(w) = 11w - 35. Determine i(5). 20 Let h(a) = a*2 - 2a - 3. Give h(2). -3 Let p(i) = -i*2 - 5i + 15. Determine p(-7). 1 Let b(n) = -n*3 - 17n*2 - 15n + 17. Calculate b(-16). 1 Let j(s) = -s*3 - 6s*2 - 6s. Calculate j(-6). 36 Let y(s) = -s*3 - 4s*2 + s + 2. Calculate y(-4). -2 Let r(q) = -2q*2 - 10q + 14. Determine r(-6). 2 Let g(x) = -2x + 1. Calculate g(5). -9 Let c(n) = n2 - 7n - 7. Calculate c(8). 1 Let u(c) = 5c2 - 7c - 17. Give u(-2). 17 Let n(p) = p - 23. Give n(16). -7 Let q(h) = 76h - 2. Calculate q(0). -2 Let l(h) = -h2 - 32h - 202. What is l(-24)? -10 Let f(h) = h*2 - h. What is f(4)? 12 Let h(t) = -12t + 3. Calculate h(5). -57 Let j(p) = -p*3 - 15p*2 + 17p + 11. What is j(-16)? -5 Let y(a) = -4a3 + a2 + a + 1. Calculate y(-1). 5 Let u(k) = -k2 - 12k - 9. Give u(-9). 18 Let y(m) = -m3 - m2 + 3m - 3. Determine y(-3). 6 Let l(p) = -2p*2 + 2p - 3. Determine l(-4). -43 Let d(y) = -y*2 + 13y - 1. Determine d(6). 41 Let b(x) = -4x3 + x2 + 4x + 3. Calculate b(-2). 31 Let h(m) = -8m - 157. Determine h(-22). 19 Let v(r) = 3r*3 + 4r2 + r - 6. What is v(-3)? -54 Let c(g) = -g2 - 2g. What is c(-1)? 1 Let w(f) = -9f + 7. Give w(3). -20 Let m(u) = u*3 + 9u*2 + 9u - 13. Calculate m(-7). 22 Let f(y) = -5y3 + y2 + 3y - 2. Calculate f(2). -32 Let b(x) = -x*3 + 8x*2 + 8x - 4. Give b(9). -13 Let h(z) = 2z3 - 26z2 + z + 7. Calculate h(13). 20 Let p(k) = k3 + 3k2 - 3k - 10. What is p(-3)? -1 Let t(a) = -a*3 - 10a*2 - 22a - 51. Give t(-8). -3 Let l(j) = 4j3 - j2 - 6. Give l(2). 22 Let y(c) = -3c*2 + 6c - 6. Give y(1). -3 Let p(c) = c*3 - 11c*2 + 31c - 14. What is p(5)? -9 Let o(s) = -s*3 - 3s*2 + 6s + 1. What is o(-2)? -15 Let j(d) = -18d - 56. What is j(-4)? 16 Let t(d) = d3 - 5d*2 + 9d - 13. Give t(6). 77 Let z(i) = i*3 + 6i*2 - 7i + 1. Give z(-7). 1 Let b(n) = -2n3 - 2n*2 - n - 2. Determine b(-3). 37 Let y(d) = 29d + 2. Determine y(-1). -27 Let z(b) = 12b + 20. Determine z(-2). -4 Let o(p) = 5p + 76. Determine o(-16). -4 Let h(o) = o3 - o2 + 6. Determine h(3). 24 Let b(v) = v3 + v - 10. Determine b(0). -10 Let o(i) = -i + 5. What is o(9)? -4 Let m(n) = -n + 16. Determine m(12). 4 Let h(v) = v3 + 8v2 + 14v + 6. Give h(-6). -6 Let b(q) = -9q - 8. Give b(-2). 10 Let y(c) = -10c + 80. Give y(8). 0 Let c(y) = 7y + 19. Determine c(-4). -9 Let l(y) = -y3 + 2y2 + y. Calculate l(3). -6 Let c(g) = g2 + 7g - 48. Calculate c(-11). -4 Let r(y) = -y3 + 10y2 + 1. Give r(10). 1 Let v(t) = t2 + 9t + 6. Calculate v(-9). 6 Let o(w) = -w2 - 29w - 165. Give o(-20). 15 Let n(q) = -14q2 - 105q - 48. What is n(-7)? 1 Let i(b) = 10b + 15. What is i(-2)? -5 Let i(a) = -3a + 14. Determine i(-10). 44 Let w(u) = 3u + 18. What is w(-7)? -3 Let g(q) = 5q*3 - 2q*2 - 2q + 3. Calculate g(2). 31 Let w(k) = k*3 + 4k*2 + 8k + 7. Give w(-2). -1 Let j(w) = -w*2 + 5w - 9. Calculate j(3). -3 Let n(s) = -s*2 + 7s + 18. Calculate n(8). 10 Let s(n) = 6n + 4. Calculate s(3). 22 Let f(y) = 21y*3 - 3y*2 + 4y - 2. Determine f(1). 20 Let x(k) = 41k + 131. Calculate x(-3). 8 Let c(y) = -y2 + 11y + 8. Determine c(10). 18 Let x(q) = -q*2 - 10q - 9. Give x(-4). 15 Let g(z) = -21z + 9. Give g(0). 9 Let r(n) = 27n - 408. Calculate r(15). -3 Let q(t) = -12t - 11. Determine q(0). -11 Let w(m) = m - 42. Give w(7). -35 Let b(h) = 11h + 423. Calculate b(-38). 5 Let v(u) = 12u - 44. Give v(6). 28 Let m(r) = r2 + 12r - 27. Give m(-14). 1 Let q(n) = n*2 + 12n + 6. Give q(-12). 6 Let s(d) = -d*3 - 3d*2 + 3d + 5. What is s(-5)? 40 Let z(h) = 10h + 45. Determine z(-10). -55 Let m(o) = o2 - 2o + 10. What is m(6)? 34 Let v(a) = -a - 27. Determine v(-17). -10 Let q(t) = -2t2 - 70t - 195. Determine q(-32). -3 Let q(t) = 3t2 - 7t - 1. Determine q(5). 39 Let x(r) = 7r + 18. Calculate x(-5). -17 Let j(i) = -i3 - 7i2 - i + 10. Give j(-7). 17 Let w(t) = t2 + 12t + 14. Determine w(-4). -18 Let a(w) = 2w + 33. Give a(-18). -3 Let f(p) = -p*3 - 12p*2 - 10p + 44. Give f(-10). -56 Let h(g) = g*3 - 18g*2 - 18g + 21. What is h(19)? 40 Let t(a) = 2a - 1. Give t(0). -1 Let y(w) = -w3 + 4w*2 + 8w - 8. Give y(6). -32 Let u(v) = v + 5. Determine u(1). 6 Let r(l) = -3l2 + 38l + 31. What is r(13)? 18 Let v(c) = c*3 + 8c*2 - 5c + 34. Give v(-9). -2 Let g(p) = -p*3 - 4p*2 - 16. Give g(-6). 56 Let m(a) = 2a*3 - 4a*	{ "pile_set_name": "DM Mathematics" }
digit of 55401471? 4 What is the billions digit of 1739640798? 1 What is the millions digit of 40878636? 0 What is the hundred millions digit of 1643035223? 6 What is the units digit of 76766472? 2 What is the millions digit of 122386719? 2 What is the hundred millions digit of 396125426? 3 What is the billions digit of 3883459919? 3 What is the thousands digit of 1860476531? 6 What is the tens digit of 470795971? 7 What is the thousands digit of 4958726586? 6 What is the thousands digit of 311162219? 2 What is the hundred thousands digit of 87418389? 4 What is the hundred millions digit of 1995833939? 9 What is the thousands digit of 5352846475? 6 What is the millions digit of 7609198? 7 What is the ten thousands digit of 155735438? 3 What is the hundred thousands digit of 338544115? 5 What is the units digit of 966994392? 2 What is the hundreds digit of 15285101? 1 What is the tens digit of 1176837829? 2 What is the hundreds digit of 861344049? 0 What is the millions digit of 47870542? 7 What is the hundreds digit of 82868356? 3 What is the hundred thousands digit of 380306493? 3 What is the tens digit of 15470373? 7 What is the units digit of 125625029? 9 What is the millions digit of 38102900? 8 What is the billions digit of 1160289218? 1 What is the units digit of 4635139775? 5 What is the hundred millions digit of 118503903? 1 What is the ten millions digit of 47146417? 4 What is the units digit of 4705071237? 7 What is the billions digit of 5371584639? 5 What is the hundred thousands digit of 471605159? 6 What is the tens digit of 1304617683? 8 What is the ten millions digit of 168653324? 6 What is the tens digit of 93005462? 6 What is the tens digit of 11117541? 4 What is the millions digit of 23859516? 3 What is the hundred millions digit of 5683421776? 6 What is the hundreds digit of 916294459? 4 What is the hundred millions digit of 2216749187? 2 What is the tens digit of 881031571? 7 What is the hundred thousands digit of 2789184? 7 What is the hundred thousands digit of 363115672? 1 What is the hundred thousands digit of 861111953? 1 What is the hundreds digit of 1858446397? 3 What is the ten thousands digit of 93388995? 8 What is the thousands digit of 545623534? 3 What is the millions digit of 376256383? 6 What is the thousands digit of 163836303? 6 What is the ten millions digit of 91646494? 9 What is the units digit of 27899493? 3 What is the tens digit of 1647015003? 0 What is the hundreds digit of 97737477? 4 What is the tens digit of 2348264001? 0 What is the ten millions digit of 690587851? 9 What is the tens digit of 580666176? 7 What is the units digit of 2897212651? 1 What is the thousands digit of 389309381? 9 What is the ten thousands digit of 318806363? 0 What is the ten millions digit of 159831127? 5 What is the tens digit of 1237874698? 9 What is the hundred thousands digit of 360979333? 9 What is the hundreds digit of 1051485150? 1 What is the thousands digit of 25822111? 2 What is the millions digit of 4748253802? 8 What is the ten thousands digit of 373972226? 7 What is the ten thousands digit of 474643130? 4 What is the ten thousands digit of 99114123? 1 What is the hundred thousands digit of 46462590? 4 What is the ten millions digit of 1439245182? 3 What is the ten millions digit of 11771953? 1 What is the ten thousands digit of 1290549918? 4 What is the ten thousands digit of 785342461? 4 What is the millions digit of 33124107? 3 What is the hundred millions digit of 280386731? 2 What is the tens digit of 89368880? 8 What is the ten millions digit of 2332235152? 3 What is the hundreds digit of 142360847? 8 What is the hundreds digit of 226754081? 0 What is the tens digit of 134722425? 2 What is the thousands digit of 167516151? 6 What is the hundreds digit of 574019041? 0 What is the thousands digit of 29754182? 4 What is the tens digit of 879652527? 2 What is the hundred thousands digit of 629134019? 1 What is the millions digit of 1503927108? 3 What is the ten thousands digit of 545004099? 0 What is the hundred thousands digit of 9954674? 9 What is the hundreds digit of 1038779244? 2 What is the hundreds digit of 12654525? 5 What is the ten thousands digit of 199728281? 2 What is the hundred thousands digit of 1452694180? 6 What is the ten thousands digit of 502778352? 7 What is the millions digit of 1084102725? 4 What is the hundred thousands digit of 162758504? 7 What is the ten millions digit of 1250607265? 5 What is the tens digit of 35594877? 7 What is the hundred thousands digit of 17684033? 6 What is the hundred millions digit of 1137561546? 1 What is the hundreds digit of 4658353701? 7 What is the hundreds digit of 765688295? 2 What is the thousands digit of 117760436? 0 What is the hundreds digit of 965737337? 3 What is the ten thousands digit of 3771078075? 7 What is the hundreds digit of 65455807? 8 What is the ten millions digit of 5200875357? 0 What is the units digit of 132044679? 9 What is the millions digit of 44927321? 4 What is the units digit of 182262441? 1 What is the hundred thousands digit of 49289723? 2 What is the ten millions digit of 323530187? 2 What is the units digit of 752568296? 6 What is the tens digit of 1972436? 3 What is the millions digit of 296963553? 6 What is the hundreds digit of 84287798? 7 What is the thousands digit of 194819344? 9 What is the millions digit of 2543637725? 3 What is the thousands digit of 93596801? 6 What is the ten millions digit of 49012439? 4 What is the hundreds digit of 193901667? 6 What is the hundreds digit of 296848057? 0 What is the thousands digit of 955852? 5 What is the ten millions digit of 61032310? 6 What is the hundreds digit of 951025155? 1 What is the ten millions digit of 2054719871? 5 What is the ten thousands digit of 7479131266? 3 What is the hundred millions digit of 2858820488? 8 What is the tens digit of 814330828? 2 What is the millions digit of 2337490786? 7 What is the thousands digit of 198760075? 0 What is the hundred thousands digit of 4761979453? 9 What is the thousands digit of 44506313? 6 What is the millions digit of 50925232? 0 What is the ten millions digit of 33216619? 3 What is the tens digit of 20501326? 2 What is the tens digit of 930027423? 2 What is the hundred thousands digit of 99222295? 2 What is the ten thousands digit of 54962662? 6 What is the units digit of 167308246? 6 What is the millions digit of 513637751? 3 What is the ten thousands digit of 40873878? 7 What is the ten thousands digit of 1333059714? 5 What is the thousands digit of 26304484? 4 What is the hundred millions digit of 2921311179? 9 What is the hundreds digit of 10759777? 7 What is the thousands digit of 22869382? 9 What is the units digit of 61451225? 5 What is the thousands digit of 920038986? 8 What is the units digit of 1085867945? 5 What is the hundreds digit of 197834683? 6 What is the hundreds digit of 78400865? 8 What is the thousands digit of 161049973? 9 What is the tens digit of 941041129? 2 What is the millions digit of 291186575? 1 What is the hundred millions digit of 2169496404? 1 What is the tens digit of 1227244986? 8 What is the units digit of 5195533? 3 What is the ten millions digit of 1202887778? 0 What is the units digit of 4863945? 5 What is the units digit of 265553584? 4 What is the hundreds digit of 2486986588? 5 What is the units digit of 287603424? 4 What is the hundred thousands digit of 365439765? 4 What is the thousands digit of 4863967755? 7 What is the millions digit of 5093142555? 3 What is the tens digit of 197792588? 8 What is the millions digit of 1619735930? 9 What is the ten millions digit of 446353356? 4 What is the thousands digit of 1509032343? 2 What is the tens digit of 42494523? 2 What is the units digit of 71974965? 5 What is the ten thousands digit of 2352320251? 2 What is the thousands digit of 450362320? 2 What is the units digit of 32932254? 4 What is the ten millions digit of 1279735780? 7 What is the ten millions digit of 292697611? 9 What is the tens digit of 76594959? 5 What is the units digit of 153879570? 0 What is the ten millions digit of 685174500? 8 What is the units digit of 120739944? 4 What is the ten millions digit of 307875764? 0 What is the hundred thousands d	{ "pile_set_name": "DM Mathematics" }
.2 Add together -33554.22 and -5041. -38595.22 2747 - -24799 27546 What is 591 minus 6976807? -6976216 Work out -2.13 - 1618.76. -1620.89 Work out 16290.1 + -22445. -6154.9 -0.1 + 16961906012 16961906011.9 Add together 3380 and -0.1798. 3379.8202 10 - 10408099 -10408089 What is -43253998 - -0.087? -43253997.913 -4009.3518+0.21 -4009.1418 What is -56 plus 65.471? 9.471 What is 627 minus -68345343? 68345970 Add together 2999 and -82242. -79243 Calculate 2449 + 14712. 17161 Add together -8461 and 3715. -4746 Subtract 2 from -28.068786. -30.068786 What is the distance between -38740.5 and -3? 38737.5 Put together 107.4 and -0.070265. 107.329735 Subtract -46 from -33773392. -33773346 What is -491 - -6.159128? -484.840872 What is -3065 take away -118.3914? -2946.6086 What is -6651.12 minus -5145? -1506.12 Calculate 0.11 + 771532337. 771532337.11 What is the difference between 70012 and -100? 70112 Subtract 60155 from -45. -60200 Sum -6888.82 and 178. -6710.82 Calculate 461623483 + -0.5. 461623482.5 Put together -11.963 and -25739. -25750.963 What is -571.76 minus 0.0211? -571.7811 What is the distance between 9624.376 and -0.02? 9624.396 Subtract 2845.1609 from -4. -2849.1609 What is -7465684 plus 85.1? -7465598.9 What is -25893 less than -6.5? 25886.5 -1630+4907387 4905757 What is -459.5 + 0.667603? -458.832397 Work out 21249.7 - -1.2. 21250.9 4477.16+-0.1 4477.06 Work out -16893 - 364663. -381556 Work out 63654.799 + 0. 63654.799 Calculate -102.3 - 0.14015227. -102.44015227 What is 3092 + -77804? -74712 What is -22192 minus 53393? -75585 What is -140191013 plus 3? -140191010 Calculate -3565352 + -152.5. -3565504.5 Put together -48206734 and 263. -48206471 What is -14395 minus 241345? -255740 Total of 488.37402 and 0.1. 488.47402 Calculate -5 - 21129326120. -21129326125 Work out 0.014 + 2.00573087. 2.01973087 Work out -1857839 - 1649. -1859488 0.088562 + 245.9 245.988562 What is the difference between -33.6951192 and 0? 33.6951192 Add 303 and 2804741. 2805044 Work out 44.76 + 0.690063. 45.450063 Work out -432.6 - 28. -460.6 Work out -221261414 - -0.1. -221261413.9 Calculate 11 - 17659653.23. -17659642.23 Calculate 37608.63 - 94. 37514.63 Work out 0.0598 + -825949. -825948.9402 Sum 0.13734 and -799. -798.86266 Put together 2.09 and -187008. -187005.91 38084247 + -4 38084243 Total of 257348 and 0.345. 257348.345 Subtract -33.2 from -11.4672. 21.7328 Total of -8686.8 and 0.06666. -8686.73334 Sum 0 and 2.59174. 2.59174 What is the distance between 1602 and -31296.1? 32898.1 Calculate -44530 - 27091. -71621 What is the difference between 72.816 and -9381.8? 9454.616 What is the distance between -0.2 and 0.045380417? 0.245380417 Work out -3061423 + -0.005. -3061423.005 What is 15 less than -2258184? -2258199 Put together -81.64 and -334671. -334752.64 What is 1378 less than 1988? 610 Sum -236991335 and 1. -236991334 0.3+21184 21184.3 Sum -211 and -148673.479. -148884.479 1066+12757 13823 Calculate -1395131919 - -2. -1395131917 Work out -53129830 - -0.3. -53129829.7 Add 0.1 and -25637112. -25637111.9 -26483.86724 - -7 -26476.86724 Subtract -0.12 from 18094.91499. 18095.03499 -12 - 2322408 -2322420 What is the difference between 2899.382 and -0.03? 2899.412 Work out 0.5 - -10392639991. 10392639991.5 What is 73379813834 plus -0.3? 73379813833.7 Work out 1.2 + -288436. -288434.8 Total of 4231 and 16473.2. 20704.2 Add 0.2 and -408770379. -408770378.8 -0.4 - 10020424 -10020424.4 Put together 0.004 and 1052160539. 1052160539.004 -1 - -162380.98 162379.98 Calculate 102.1 + -104466. -104363.9 What is the distance between -0.085539 and -85.2? 85.114461 Add together 1999 and -232058. -230059 What is -2822 plus -0.40593? -2822.40593 Sum -5028 and -27621. -32649 What is -281.527 - -20.2? -261.327 What is -567977 + 0.212? -567976.788 Calculate -3111294404 + 0. -3111294404 Subtract 320779 from -1381. -322160 -50.079737+26 -24.079737 Work out -0.033953 + -6293.5. -6293.533953 What is the distance between 3858 and 2510? 1348 What is 3 - -11616.18? 11619.18 Calculate 1740828.98 + -0.3. 1740828.68 What is -33.266 plus 694439? 694405.734 What is 134 - 24027105? -24026971 Calculate 119.612 + 133673. 133792.612 Calculate -3932.99 - -1.22. -3931.77 3938 - 13054.35 -9116.35 What is 42260723 take away -0.91? 42260723.91 What is the difference between 9944940 and 5? 9944935 Subtract -98251256 from -0.3. 98251255.7 What is 38985437 take away 0.548? 38985436.452 Calculate 13 - 701708. -701695 What is -0.13 plus -5097281.331? -5097281.461 Put together -246966 and -464693. -711659 Add together -119.843 and 3837. 3717.157 Calculate -11108.548 - -31. -11077.548 Sum 3520 and 1893244. 1896764 Subtract -91165261 from 1.7. 91165262.7 40+171115297.2 171115337.2 6+897998043 897998049 What is -25 + -480509? -480534 Work out 477924 + -326.7. 477597.3 Sum -12.2 and 298611. 298598.8 What is -24.1771 + -0.307? -24.4841 Total of -1.27 and 37.5. 36.23 Work out 0.03 + 14269.27709. 14269.30709 What is 19681160.88 - 19? 19681141.88 What is the difference between -87085.55 and -914? 86171.55 Add together -4 and 313795909. 313795905 Calculate 0.074 - -0.6736. 0.7476 Total of 1.8 and 6198450. 6198451.8 Sum -0.4 and 1.24451036. 0.84451036 Calculate 1510634.93 - 324. 1510310.93 Add together 0.11445 and 821.5. 821.61445 What is the difference between 457893 and -130? 458023 Total of -28.3 and 4.79172. -23.50828 1294 - 9481066 -9479772 Work out -5590.8 + 0.1785. -5590.6215 What is the distance between -89392 and -237.621? 89154.379 What is -245.3504 take away 6.413? -251.7634 What is 49472 plus -22883.5? 26588.5 Add together -839.68 and -0.4. -840.08 Calculate 1804653236 - 2. 1804653234 Calculate 1 - 694408387. -694408386 Add together -1546828687 and 0.4. -1546828686.6 What is 1108695 minus -0.028268? 1108695.028268 Put together -48897683 and 0.78. -48897682.22 0.1 - 6055.52568 -6055.42568 What is 240979149 minus 0.074? 240979148.926 Calculate 0.49064 - -3139. 3139.49064 Calculate -1 + 616.1296. 615.1296 Calculate 2822 - 4577. -1755 Subtract -2845 from 0.140521. 2845.140521 Calculate 5205.2913 - -21. 5226.2913 What is -63.62097 take away 1? -64.62097 Add -15048 and -534487. -549535 What is 12402818458 less than -0.2? -12402818458.2 Add -1678 and -1503330. -1505008 What is 571.7 plus 1466151? 1466722.7 Work out -2175085.3 + 5. -2175080.3 Work out 2901 + 0.86593. 2901.86593 What is 0.04483 take away -13.05? 13.09483 Subtract 1.57 from -1191819. -1191820.57 Subtract 0.3544828 from -0.3. -0.6544828 Sum 32594589002 and -5. 32594588997 -76208795+-37 -76208832 -1841.2649+-5.5 -1846.7649 What is -75993346 - -2? -75993344 Put together -5 and 828457468. 828457463 Work out 32.168509 - 22. 10.168509 Work out 22025 - -12306.9. 34331.9 46 + 0.2485007 46.2485007 -184 - 773805 -773989 Work out -20219581 - 3. -20219584 Sum -864302.181 and -4. -864306.181 What is -426932958 take away -0.4? -426932957.6 What is 1.78 plus -897520? -897518.22 What is the distance between -27.64138876 and -0.2? 27.44138876 What is -1967484 minus -0.029? -1967483.971 5.010064 - -675 680.010064 -231940611+29 -231940582 -0.5+16890836.99 16890836.49 What is -291 + 12661? 12370 -8 + -3250013089 -3250013097 What is 3469 less than -9797? -13266 What is 416.1 + -61290? -60873.9 Calculate -1413 + -3077148. -3078561 Subtract 988822440 from -3. -988822443 What is 2678 take away 13075.5? -10397.5 Put together 2405 and 11997. 14402 What is -0.8 plus 1.1143831? 0.3143831 What is the difference between -1.2 and -138651345? 138651343.8 Subtract 262 from 299.3719. 37.3719 What is 16510347 plus 70.8? 16510417.8 What is 155194 take away 0.273281? 155193.726719 What is the difference between -248 and 2887.4? 3135.4 Total of 0 and 22719942344. 22719942344 What is -18 - 3173008? -3173026 What is -448218 - 68023? -516241 What is -1.3 - -0.04510484? -1.25489516 Calculate 12458963.8 + 28.2. 12458992 What is 0.03586355 plus -4? -3.96413645 -647 + -30.21355 -677.21355 Sum -10291.8 and 7495. -2796.8 Add 387253 and 0.79095. 387253.79095 -63201 - -0.3344 -63200.6656 Subtract 5 from 4.4416149. -0.5583851 What is the distance between 1.11769149 and -0.054? 1.17169149 What is 1020.3 plus -2354.55? -1334.25 -0.0143538 - -137 136.9856462 What is 825 + -0.09692? 824.90308 What	{ "pile_set_name": "DM Mathematics" }
0879016? 7 What is the tens digit of 119540? 4 What is the tens digit of 153666? 6 What is the hundred thousands digit of 906354? 9 What is the hundreds digit of 423286? 2 What is the units digit of 21968? 8 What is the hundreds digit of 9429164? 1 What is the ten thousands digit of 32148? 3 What is the units digit of 11113383? 3 What is the ten thousands digit of 465517? 6 What is the hundred thousands digit of 503308? 5 What is the units digit of 2602215? 5 What is the hundreds digit of 4267122? 1 What is the ten thousands digit of 490733? 9 What is the units digit of 3966350? 0 What is the hundred thousands digit of 237782? 2 What is the millions digit of 4164590? 4 What is the millions digit of 19931417? 9 What is the thousands digit of 1713667? 3 What is the tens digit of 2570290? 9 What is the tens digit of 1980477? 7 What is the ten thousands digit of 2016042? 1 What is the ten millions digit of 10271222? 1 What is the tens digit of 203107? 0 What is the ten thousands digit of 705901? 0 What is the thousands digit of 658136? 8 What is the hundreds digit of 9662170? 1 What is the ten thousands digit of 2175231? 7 What is the hundred thousands digit of 263591? 2 What is the thousands digit of 13440476? 0 What is the units digit of 7435087? 7 What is the millions digit of 13614543? 3 What is the hundred thousands digit of 369566? 3 What is the hundred thousands digit of 1391625? 3 What is the hundred thousands digit of 3467355? 4 What is the thousands digit of 374254? 4 What is the ten thousands digit of 3338751? 3 What is the tens digit of 1664064? 6 What is the hundred thousands digit of 24825245? 8 What is the units digit of 138148? 8 What is the thousands digit of 33578392? 8 What is the ten thousands digit of 162294? 6 What is the hundred thousands digit of 214011? 2 What is the hundreds digit of 449582? 5 What is the thousands digit of 32156552? 6 What is the hundreds digit of 1870299? 2 What is the units digit of 79225? 5 What is the thousands digit of 313558? 3 What is the thousands digit of 486738? 6 What is the tens digit of 29240482? 8 What is the ten thousands digit of 537875? 3 What is the thousands digit of 274144? 4 What is the hundreds digit of 63123? 1 What is the units digit of 35704? 4 What is the thousands digit of 1735530? 5 What is the units digit of 91953? 3 What is the units digit of 8701116? 6 What is the units digit of 652941? 1 What is the thousands digit of 107247? 7 What is the millions digit of 2205005? 2 What is the ten thousands digit of 91021? 9 What is the hundred thousands digit of 2263433? 2 What is the millions digit of 4924680? 4 What is the hundreds digit of 3929042? 0 What is the units digit of 21956716? 6 What is the units digit of 1484808? 8 What is the tens digit of 6851844? 4 What is the ten thousands digit of 9716840? 1 What is the thousands digit of 304538? 4 What is the hundreds digit of 224718? 7 What is the tens digit of 7463056? 5 What is the millions digit of 6848125? 6 What is the tens digit of 208619? 1 What is the ten thousands digit of 6636975? 3 What is the units digit of 342760? 0 What is the tens digit of 6244661? 6 What is the ten thousands digit of 440539? 4 What is the hundreds digit of 6692551? 5 What is the ten thousands digit of 567964? 6 What is the tens digit of 11734102? 0 What is the ten thousands digit of 10928314? 2 What is the millions digit of 1045169? 1 What is the hundred thousands digit of 5844498? 8 What is the tens digit of 96133? 3 What is the hundred thousands digit of 9575657? 5 What is the ten thousands digit of 8215077? 1 What is the thousands digit of 19394288? 4 What is the ten thousands digit of 17504712? 0 What is the millions digit of 2082927? 2 What is the tens digit of 388083? 8 What is the hundreds digit of 13601109? 1 What is the hundred thousands digit of 6958523? 9 What is the tens digit of 465591? 9 What is the ten millions digit of 31221898? 3 What is the thousands digit of 203827? 3 What is the millions digit of 2322741? 2 What is the thousands digit of 1002995? 2 What is the units digit of 613995? 5 What is the hundreds digit of 19137673? 6 What is the ten thousands digit of 19833370? 3 What is the ten thousands digit of 69414? 6 What is the tens digit of 962596? 9 What is the ten thousands digit of 1336761? 3 What is the hundreds digit of 4036776? 7 What is the thousands digit of 5208698? 8 What is the ten thousands digit of 6375151? 7 What is the units digit of 9925598? 8 What is the thousands digit of 4598257? 8 What is the tens digit of 2262509? 0 What is the hundred thousands digit of 390828? 3 What is the tens digit of 94414? 1 What is the ten thousands digit of 1929872? 2 What is the tens digit of 74655? 5 What is the ten thousands digit of 227494? 2 What is the tens digit of 11728005? 0 What is the hundreds digit of 1082509? 5 What is the ten thousands digit of 5101605? 0 What is the ten thousands digit of 32557796? 5 What is the tens digit of 107502? 0 What is the tens digit of 15835431? 3 What is the thousands digit of 20530025? 0 What is the ten thousands digit of 8532595? 3 What is the ten thousands digit of 22964? 2 What is the hundred thousands digit of 205031? 2 What is the thousands digit of 9526? 9 What is the hundreds digit of 9839884? 8 What is the hundred thousands digit of 395127? 3 What is the units digit of 72475? 5 What is the hundreds digit of 2759194? 1 What is the hundreds digit of 3122505? 5 What is the hundred thousands digit of 988391? 9 What is the hundreds digit of 1456366? 3 What is the ten thousands digit of 2222552? 2 What is the ten thousands digit of 1415870? 1 What is the tens digit of 457125? 2 What is the hundred thousands digit of 682015? 6 What is the thousands digit of 169938? 9 What is the ten thousands digit of 20577235? 7 What is the tens digit of 2576638? 3 What is the units digit of 5160825? 5 What is the hundreds digit of 62175? 1 What is the ten thousands digit of 1439913? 3 What is the units digit of 567159? 9 What is the thousands digit of 9021751? 1 What is the units digit of 1168215? 5 What is the hundred thousands digit of 253771? 2 What is the ten thousands digit of 4925565? 2 What is the hundreds digit of 1271383? 3 What is the millions digit of 7735312? 7 What is the thousands digit of 7879825? 9 What is the tens digit of 1770054? 5 What is the tens digit of 364972? 7 What is the thousands digit of 11570721? 0 What is the ten thousands digit of 162532? 6 What is the hundred thousands digit of 816529? 8 What is the hundreds digit of 107621? 6 What is the ten thousands digit of 10057012? 5 What is the hundreds digit of 2169546? 5 What is the hundred thousands digit of 4166280? 1 What is the hundred thousands digit of 16102534? 1 What is the units digit of 586243? 3 What is the units digit of 1074150? 0 What is the thousands digit of 4370837? 0 What is the millions digit of 2047097? 2 What is the hundred thousands digit of 248850? 2 What is the millions digit of 3626145? 3 What is the units digit of 2300313? 3 What is the hundreds digit of 356938? 9 What is the hundreds digit of 1902862? 8 What is the units digit of 88377? 7 What is the ten thousands digit of 397196? 9 What is the millions digit of 11192382? 1 What is the millions digit of 5665488? 5 What is the hundreds digit of 1007790? 7 What is the ten thousands digit of 34816? 3 What is the hundreds digit of 284442? 4 What is the hundred thousands digit of 3954164? 9 What is the tens digit of 150352? 5 What is the hundred thousands digit of 464901? 4 What is the tens digit of 688346? 4 What is the tens digit of 591775? 7 What is the hundred thousands digit of 5476486? 4 What is the thousands digit of 1489504? 9 What is the tens digit of 438503? 0 What is the ten millions digit of 12701116? 1 What is the hundreds digit of 1219437? 4 What is the tens digit of 322718? 1 What is the hundreds digit of 950506? 5 What is the ten thousands digit of 8728763? 2 What is the tens digit of 213487? 8 What is the millions digit of 1097463? 1 What is the hundreds digit of 2915288? 2 What is the ten thousands digit of 605446? 0 What is the tens digit of 340522? 2 What is the tens digit of 774771? 7 What is the thousands digit of 1328946? 8 What is	{ "pile_set_name": "DM Mathematics" }
digit of p? 7 Let n(u) = u + 7. What is the units digit of n(8)? 5 Let z(o) = 4o2 - o. Let m be z(1). Suppose 5q = 15, -q = -2a + mq - 2. What is the units digit of a? 5 Suppose 6y - 651 = -y. What is the tens digit of y? 9 Suppose 5r - 12 - 193 = 0. What is the units digit of r? 1 Suppose 3w = 3n - 113 - 187, 0 = 5n + 3w - 500. What is the tens digit of n? 0 Let q(a) = a*3 + 2a. Let z = -2 - -4. Let v be q(z). Suppose 3i - v = -0i. What is the units digit of i? 4 Suppose -2h - 5k = -215, -k = -2h - 11 + 208. What is the hundreds digit of h? 1 Suppose 3x + 165 = 3r, 219 = 4r - 2x + 5. What is the units digit of r? 2 Suppose -2i = i - 180. What is the tens digit of i? 6 Suppose -3t = 2a - 30, -3a - t + 27 + 11 = 0. Suppose -n + 3s = -a, 4s + 4 = -5n + 3s. What is the units digit of (n + 4 - 2) + 1? 3 Let m(a) = -a3 + 7a*2 - a + 7. Let u be m(7). Suppose 3q + 6 = 2f + 5q, -3f - q + 13 = u. Let w = -2 + f. What is the units digit of w? 3 Let z(a) be the third derivative of -a6/120 - 3a*5/20 + 3a*4/8 - 2a*3/3 - 2a*2. Suppose 2x + 40 = -2x. What is the units digit of z(x)? 6 Suppose -5c - 39 = -129. Suppose -3d = -3j + c, 4d - 5d = -5j + 22. What is the units digit of j? 4 Suppose -263 - 77 = -5l. What is the tens digit of l? 6 Suppose 3 = -2q - 3w, 2w = 5w + 9. Suppose -q = -3a + 6. Suppose 0 = ac + 3n + 3, 4c - 3n = 18 - 1. What is the units digit of c? 2 Let y(t) = -t - 1. Let r be y(0). Let u(f) = -22f3 - f2 + f + 1. Let n be u(r). Suppose 14 + 10 = 4c - 4o, -5c = 4o - n. What is the units digit of c? 5 Let y(g) = -g*3 + 9g*2 - g + 10. Let b be y(9). Suppose -2d = -d - b. What is the units digit of -2 - d - (-12 + -1)? 0 Suppose i = 5i + 3k, 0 = 5i + 2k. Suppose i = r - 0r. Suppose r = -4p - 2 + 6. What is the units digit of p? 1 Let u(l) = -2l + 6. Let b be u(4). Let i be 68/(-8) - (-1)/b. Let y = 3 - i. What is the units digit of y? 2 Let l = 7 - 0. Let g = l - 1. What is the units digit of g? 6 Let m(u) = -32u*3. Suppose 3w + 2 + 1 = 0. What is the units digit of m(w)? 2 Let c be (-6)/44/(-3). Let i be ((-1 - -1) + c)3. Let q(t) = -t*2 + 8t - 5. What is the units digit of q(i)? 7 Let w(p) = 0 + 4p - 2 - 3p. Suppose d = -3 + 6. What is the units digit of w(d)? 1 Suppose 1 = u, 0 = 2n - 3n + 2u. Suppose -3q - nq = -60. What is the units digit of q? 2 Let z(x) = -2x + x + 1 + 0x2 + x2 - 5x. Let h be z(6). Let r = 8 - h. What is the units digit of r? 7 Let c = 7 + -4. Let r = c - 0. What is the units digit of r? 3 Suppose -5t + 58 = a, -t + a = -15 + 1. Suppose t = -4p + 7p. Suppose -py + 35 = 3. What is the units digit of y? 8 Suppose 5c + 2k - 6k = 155, -3c + 91 = -2k. What is the tens digit of c? 2 Suppose -3c + 3 = 9. Let h = 3 + c. What is the units digit of h? 1 Suppose 2n = 5n + 2g - 20, 0 = 5n - 2g - 44. Suppose 5s - s = -n, 3f + 6 = -3s. Let u(c) = -c2 + c + 5. What is the units digit of u(f)? 5 Let d(k) = k3 + 21k2 - 5k + 5. What is the units digit of d(-21)? 0 Let c be 2/7 + (-12)/(-7). Suppose -3z = -2w - 0w - 43, -4w = -cz + 18. What is the tens digit of z? 1 What is the units digit of 504/9 + (-3)/(-3)? 7 Let a(x) = x. Let m(s) be the second derivative of -s3/6 + 2s. Let v(w) = -2a(w) - m(w). What is the units digit of v(-8)? 8 Let h(t) = t + 7. Let o be h(-5). Let v(b) = -b2 - 7 + 11b*o - 9b + 17 - b*3. What is the units digit of v(9)? 0 Let a = 108 + -49. What is the units digit of a? 9 Let d(g) = 0 + 1 - 5 - g + 2g + g*2. What is the units digit of d(-4)? 8 Let r(c) = -c - 4. Let x(p) = 1. Let f(m) = -r(m) - x(m). Let v be -2 + 0 - 8/(-4). What is the units digit of f(v)? 3 Let y = -4 + -8. What is the units digit of (2/4)/((-1)/y)? 6 Suppose 2d - 6d = -44. Let c be -1 + 0 + d + 2. What is the units digit of c(16/6 + -2)? 8 Let m(d) be the third derivative of d*6/120 - 7d*5/30 + 7d*4/12 + 3d*3 + 8d*2. What is the units digit of m(13)? 1 Suppose 2 = -5d + 32. Suppose 24 = -5c - d. Let l(s) = s3 + 7s*2 + 5s - 2. What is the units digit of l(c)? 4 What is the hundreds digit of 14/(-6)(-1386)/14? 2 Suppose 18 = -4d - 14. Let n be (-76)/(-6) - d/(-12). Let i = n + -3. What is the units digit of i? 9 Let c = 64 + -29. What is the units digit of 2/4 + c/10? 4 Suppose 0b = -b + 1. What is the units digit of -1((-1 - b) + -1)? 3 Let p(d) = -d + 5. Let x be p(5). Suppose 0 = t - xt - 13. What is the tens digit of t? 1 Let s(h) be the third derivative of 0 - 5/6h*3 + 0h - h*2 + 1/24h*4. What is the units digit of s(8)? 3 Let u(i) be the third derivative of 1/30i*5 - 1/24i*4 + 1/3i*3 + 0 + 2i*2 + 0i. What is the units digit of u(2)? 8 Let f be (13/(-3))/(((-6)/(-18))/(-1)). Let x(v) be the second derivative of v*3/3 - 5v*2 - v. What is the tens digit of x(f)? 1 Let i be 1/2(0 - -10). Let s = -7 + i. What is the tens digit of 1/(s + 29/14)? 1 Suppose 0i - 1313 = -4f + 5i, 5f - 1645 = 5i. What is the units digit of f? 2 Let s(b) = 4b + 3. Let j be s(-2). Let i(o) = o*3 + 5o*2 - 4o + 5. What is the units digit of i(j)? 5 Let z be (42/(-8))/(3/(-16)). Suppose 0 = -3p + 3 + 33. Let x = z - p. What is the tens digit of x? 1 Suppose 0 = -r - 2c + 74, -5r + 2c + 370 = -0c. Suppose -6 = -4w + r. What is the units digit of w? 0 Let u(b) = -3b2 - 1 + 18b*2 + 7b*2. What is the units digit of u(-1)? 1 Suppose 4y - 2y + 12 = 0. What is the tens digit of 0 + 27 + y/6? 2 Let b = 37 + -27. Let f = b + 19. What is the units digit of f? 9 Suppose -4p = -9p - 4w + 12, 6 = -p + 2w. Suppose 3u = q + q - 38, 4u + 16 = p. What is the tens digit of q? 1 Suppose -3x + 4n + 16 = 0, 2n + 0n = 3x - 8. Let g = x + -1. Let b = g + 2. What is the units digit of b? 1 Let q be 78/4(-4)/(-6). What is the units digit of q/2(-4)/(-2)? 3 Suppose 4n = n. Suppose n = -h - 5m - 14, -6m = -5h - 2m + 46. What is the units digit of h? 6 Let k(b) = -b + 1. Let r(v) = 2v - 8. Let q(d) = 5k(d) + r(d). Let t be q(-6). Suppose -3y + 4y = 4i - t, -2y = -2. What is the units digit of i? 4 What is the tens digit of ((-21)/(-84))/(1302/(-1304) - -1)? 6 Suppose 0 = -3t + 4g + 580, 3t - 2g + 118 - 690 = 0. What is the tens digit of t? 8 Let i(y) = y2 + y - 4. Let w be i(5). Let x = w - 13. What is the units digit of x? 3 Let u = 315 + -73. What is the tens digit of u? 4 Suppose 0 = -2z + 77 - 7. Suppose -z = -5d + 3m + m, 4m - 35 = -5d. Let q = d + 0. What is the units digit of q? 7 Let x(d) be the first derivative of 3d2/2 + 9d - 9. What is the units digit of x(9)? 6 Suppose -2w - 2j = -112, 2w - 114 = -0j - 3j. What is the tens digit of w? 5 Let j be (5 + -3)/(1/2). Suppose jf = 2f. Let x = 4 - f. What is the units digit of x? 4 Let i = -107 - -218. What is the tens digit of i? 1 Suppose -9 = 3q - 3l, 0 = -0q + q - 4l + 18. Let u = 42 - 39. Suppose -qs = -3r - 21, 23 = -4r + u. What is the units digit of s? 3 Let v(g) = g*3 - g + 5. Suppose -3j + 9 = 5q, -4q - 5j + 4 = -11. Let f be v(q). Suppose fi = 3i + 8. What is the units digit of i? 4 Let q(l) be the first derivative of l3/3 + l2 - l + 1. Let o be q(-3). Suppose -2g + 3v + 1 = 0, -5v - 5 = -og - 3g. What is the units digit of g? 2 Let a = -52 - -90. What is the tens digit of a? 3 Let i(v) = v*3 - 2v*2 - 2v + 1. Let r be i(2). Let a = -7 - r. What is the units digit of (-10)/a + 1/(-2)? 2 Let o = -2 + 11. Suppose 6m = 3m + 3q - o, 5m = -4q + 12. Suppose 0 = 5d - 5, mw + d = -w + 4. What is the units digit of w? 3 Let b be (220/15)/((-4)/(-6)). Suppose -2d = -4d + b. What is the units digit of d? 1 Let a = 16 + 6. What is the units digit of a? 2 Let a(q) = 4q*2 + 10q - q*3 + 0q*2 - 5 - 4. Let c be a(6). What is the tens digit of (c/1)/((-9)/6)? 1 Suppose -3r - 13 = v + r, -5v = -r + 2. Let h be v/3 - 4/6. What is the units digit of (4 - h) + 10/5? 7 What is the units digit of 98/4 - 1/2? 4 Suppose -5o + 39 = -2x, 0 = -5o + 2x - x + 37. Let i = o - 2. Let y = i - 3. What is the units digit of y? 2 Let v = 6 + -6. Suppose -4a - 13 = -3o + 8, v = 2a - 6. What is the units digit of o? 1 Suppose 2*f = 138 + 8. What is the tens d	{ "pile_set_name": "DM Mathematics" }
000829 Round 9031.13 to the nearest one thousand. 9000 Round 1205435.3 to the nearest one hundred thousand. 1200000 Round -8270060 to the nearest one million. -8000000 What is -66751.5 rounded to the nearest 10? -66750 Round 21.72387 to 1 decimal place. 21.7 Round -8.206356 to three dps. -8.206 What is 3.4309715 rounded to 3 dps? 3.431 Round 32534.06 to the nearest ten. 32530 What is -131349000 rounded to the nearest 1000000? -131000000 What is 24376.6 rounded to the nearest 1000? 24000 Round 0.03137797 to five decimal places. 0.03138 What is 7.339826 rounded to 3 dps? 7.34 What is -0.0000502115 rounded to 6 decimal places? -0.00005 What is -0.00007994182 rounded to six decimal places? -0.00008 What is 0.0006992745 rounded to four decimal places? 0.0007 What is -926490 rounded to the nearest ten thousand? -930000 Round -213635.6 to the nearest ten thousand. -210000 What is 503850 rounded to the nearest 1000000? 1000000 Round 0.000003489176 to seven dps. 0.0000035 Round 2602139.1 to the nearest one thousand. 2602000 What is -747330 rounded to the nearest one hundred thousand? -700000 What is -4324.74 rounded to the nearest one hundred? -4300 What is -291258 rounded to the nearest 1000? -291000 What is 1.405509 rounded to three decimal places? 1.406 Round -0.0003220393 to 6 decimal places. -0.000322 What is 149978.8 rounded to the nearest 1000? 150000 What is 1.112535 rounded to three decimal places? 1.113 Round 2411328.4 to the nearest one thousand. 2411000 What is 0.000007058491 rounded to seven decimal places? 0.0000071 Round 622.723 to the nearest 100. 600 Round -351.71569 to 1 decimal place. -351.7 What is 0.076046 rounded to 1 dp? 0.1 Round 0.01004355 to five dps. 0.01004 Round 1952035.2 to the nearest one hundred thousand. 2000000 Round -0.0002017756 to 4 dps. -0.0002 What is -11991.74 rounded to the nearest 1000? -12000 What is 46575750 rounded to the nearest 1000000? 47000000 What is 0.000688033 rounded to 5 decimal places? 0.00069 What is -0.0032708927 rounded to 4 decimal places? -0.0033 Round -518.2255 to the nearest one hundred. -500 Round 0.0000130587 to six decimal places. 0.000013 What is -0.00000074411857 rounded to seven decimal places? -0.0000007 Round 0.000576439 to 6 dps. 0.000576 What is 0.0002686102 rounded to seven dps? 0.0002686 What is -0.01434968 rounded to four dps? -0.0143 What is 1846934600 rounded to the nearest 100000? 1846900000 What is 1182153 rounded to the nearest ten thousand? 1180000 What is -7.06238 rounded to zero decimal places? -7 What is 8772.3 rounded to the nearest 10000? 10000 What is -1358.669 rounded to the nearest one hundred? -1400 Round 5105709 to the nearest one million. 5000000 Round 43306070 to the nearest 100000. 43300000 What is 0.0001620874 rounded to six dps? 0.000162 What is -0.000029768 rounded to 6 decimal places? -0.00003 What is 0.03998089 rounded to 2 decimal places? 0.04 What is -0.014025293 rounded to 4 dps? -0.014 Round 0.0005806736 to 5 decimal places. 0.00058 Round -6129.9 to the nearest 100. -6100 Round -99.5377 to 0 decimal places. -100 What is -324.014 rounded to zero dps? -324 What is 0.01484956 rounded to five dps? 0.01485 What is 0.000011679995 rounded to 6 dps? 0.000012 Round -0.03715367 to three dps. -0.037 What is 0.000040265 rounded to 5 dps? 0.00004 What is 0.0009486751 rounded to 4 decimal places? 0.0009 Round -21726360 to the nearest ten thousand. -21730000 What is 111.7275 rounded to the nearest one hundred? 100 Round 955843780 to the nearest 100000. 955800000 Round -0.002160559 to two decimal places. 0 Round -0.8917374 to three decimal places. -0.892 What is -0.00018278698 rounded to five dps? -0.00018 Round 301.56 to the nearest one hundred. 300 What is -145181200 rounded to the nearest one hundred thousand? -145200000 Round 5.08731 to zero dps. 5 Round 0.0000282 to 5 dps. 0.00003 What is -3120111400 rounded to the nearest one million? -3120000000 Round 970.9156 to the nearest one hundred. 1000 What is 487.3731 rounded to the nearest 10? 490 What is -0.1581874 rounded to four dps? -0.1582 What is 0.412217 rounded to 3 decimal places? 0.412 Round -3100390 to the nearest 1000000. -3000000 Round 213305300 to the nearest 100000. 213300000 Round -2.67626 to one dp. -2.7 What is 0.0000888219 rounded to five dps? 0.00009 What is -717321000 rounded to the nearest 100000? -717300000 Round 211275000 to the nearest one hundred thousand. 211300000 What is -0.00000292777 rounded to six decimal places? -0.000003 Round 1485881 to the nearest one hundred thousand. 1500000 What is 202.13587 rounded to 2 decimal places? 202.14 What is -10.8325 rounded to the nearest 10? -10 Round -720.6051 to the nearest 10. -720 Round 637.18566 to the nearest 100. 600 What is -0.0001985253 rounded to 5 decimal places? -0.0002 Round -0.000051067951 to seven decimal places. -0.0000511 Round 0.0000026738 to 7 decimal places. 0.0000027 Round 3583.3 to the nearest one thousand. 4000 What is 0.0000229468 rounded to 7 dps? 0.0000229 What is -53583 rounded to the nearest one thousand? -54000 What is -613.578 rounded to the nearest ten? -610 What is 5412004 rounded to the nearest 1000000? 5000000 What is 278208.4 rounded to the nearest 1000? 278000 Round 0.0000395 to six dps. 0.00004 Round 0.09182878 to 3 decimal places. 0.092 Round -0.574773 to three decimal places. -0.575 What is -702.8535 rounded to 1 dp? -702.9 What is 0.02262433 rounded to two dps? 0.02 What is -24.41293 rounded to one dp? -24.4 What is -0.1006535 rounded to two decimal places? -0.1 Round 0.06503002 to 4 dps. 0.065 Round -945304 to the nearest one hundred thousand. -900000 What is -0.00237629 rounded to four dps? -0.0024 What is 31943296 rounded to the nearest 1000000? 32000000 What is -2359.927 rounded to the nearest 100? -2400 Round -0.46709 to 2 dps. -0.47 Round -1812100 to the nearest one million. -2000000 Round 504560 to the nearest one million. 1000000 What is -0.000000685 rounded to 6 decimal places? -0.000001 What is 0.00005690748 rounded to five dps? 0.00006 Round -0.029514665 to 3 decimal places. -0.03 What is -0.00011751439 rounded to five decimal places? -0.00012 Round 624.5691 to 1 decimal place. 624.6 Round 2078.198 to the nearest 100. 2100 Round -0.0000302843 to seven decimal places. -0.0000303 What is 0.09764694 rounded to 3 decimal places? 0.098 Round -1.796732 to one dp. -1.8 What is -0.015892735 rounded to 5 decimal places? -0.01589 Round 0.0004885707 to six dps. 0.000489 Round -1.4350855 to 2 dps. -1.44 Round 962533 to the nearest one thousand. 963000 Round 0.0001206273 to five dps. 0.00012 What is 10.8176 rounded to 0 decimal places? 11 What is 24222.81 rounded to the nearest 10000? 20000 What is -0.0565028 rounded to 2 dps? -0.06 Round 0.000000697795 to seven decimal places. 0.0000007 What is -98.4785 rounded to one decimal place? -98.5 Round 0.000017197 to 6 decimal places. 0.000017 What is 660.14 rounded to the nearest 100? 700 What is -0.0004905847 rounded to five decimal places? -0.00049 What is -207308.73 rounded to the nearest ten thousand? -210000 What is -0.0000960065 rounded to 5 dps? -0.0001 What is 562363000 rounded to the nearest one million? 562000000 Round -3.85276 to 1 dp. -3.9 Round -23337.464 to the nearest 10. -23340 What is 3999474 rounded to the nearest one million? 4000000 What is 833.9919 rounded to the nearest integer? 834 What is 45111600 rounded to the nearest one hundred thousand? 45100000 What is -0.00238281 rounded to four decimal places? -0.0024 Round -71885 to the nearest ten thousand. -70000 Round -4.377988 to one decimal place. -4.4 Round 11957290 to the nearest one million. 12000000 Round -976472.1 to the nearest 1000. -976000 Round 0.000338573 to 4 decimal places. 0.0003 What is 0.00365045 rounded to five dps? 0.00365 Round 939190.2 to the nearest one thousand. 939000 Round -44.689966 to 1 decimal place. -44.7 What is -335.8372 rounded to 0 decimal places? -336 What is 0.000002856993 rounded to 7 decimal places? 0.0000029 What is 0.00001327254 rounded to six decimal places? 0.000013 Round 50393.81 to the nearest ten thousand. 50000 Round 309132000 to the nearest one million. 309000000 Round 0.0027447817 to 4 decimal places. 0.0027 Round -1222450 to the nearest one hundred	{ "pile_set_name": "DM Mathematics" }
9 + 9. Let x = s + 11. Put -3, x, 3 in increasing order. -3, x, 3 Suppose 3 - 1 = 2i. Let p be i + (1 - (-3)/1). Suppose -ps = 4t - 9 + 1, 5s = -t + 17. Put -5, s, 6 in descending order. 6, s, -5 Let u(x) = -6x2 + 22x - 9. Let t be u(3). Let r = 6 - 1. Suppose -v + 0p - 9 = -p, p - 29 = rv. Put v, t, -2 in decreasing order. t, -2, v Let v be (-1)/(1/(-6) - 21/(-18)). Suppose 0g = 2g - 6. Put v, 4, g, -4 in increasing order. -4, v, g, 4 Suppose -3 = -r, -b = -0b + 2r - 6. Let f(n) = -21n + 213. Let m be f(10). Sort 5/2, b, m, -3/7 in ascending order. -3/7, b, 5/2, m Let f be 9/(-4)(88/(-12) + 6). Suppose -u + 0u + 1 = 0. Let c be (0u/2)/(-1). Sort c, f, -3 in decreasing order. f, c, -3 Let s = -42 + 44. Suppose -5t - s = -7. Sort t, 2, -5 in ascending order. -5, t, 2 Let n(w) = 3w + 32. Suppose -16u + 48 = -20u. Let c be n(u). Sort c, -3, -2 in descending order. -2, -3, c Let l = 18 + -13. Let z = 94 + -96. Sort l, z, 0.5. z, 0.5, l Let v = -0.06 + 1.66. Let p = 1.68 - v. Let a = p + -4.08. Sort -2, a, -2/7 in increasing order. a, -2, -2/7 Let p = 1.73 + -1.43. Let t = -104 - -94.7. Let g = t - -9. Put p, g, 8 in decreasing order. 8, p, g Let m = 0.61 + -8.41. Let u = m - -4.8. Put 2, u, -5/6, -1/7 in increasing order. u, -5/6, -1/7, 2 Let a be ((-12)/54 - (-2)/9)-1. Sort 1, a, -6, -1 in increasing order. -6, -1, a, 1 Let g = 185.4 + -50.9. Let y = g + -135. Sort y, 0, -0.24, -2 in ascending order. -2, y, -0.24, 0 Suppose -2j + 10 = -4b, 3j - 8j + 4b + 19 = 0. Let s = 46 + -31. Suppose -2i = -5i - s. Sort j, i, 1 in increasing order. i, 1, j Suppose 3k + k - 21 = -5j, -k + 4j = 0. Suppose -3y - d + 13 = 0, -ky = -y + 4d - 25. Let n be (-7 - -8)/(y1). Sort 2, n, 0 in increasing order. 0, n, 2 Let j(p) = -p2 + 14p - 43. Let x be j(6). Let z be (-2)/8 + (-9)/(-36). Sort z, -5, 4, x in decreasing order. x, 4, z, -5 Let z = -0.3 + 7.3. Let n = z - 6.6. Let k = 6 - 10. Put n, k, -5 in increasing order. -5, k, n Let j = 250/461 + -416861/2766. Let b = j + 150. Sort -0.2, b, 12 in ascending order. -0.2, b, 12 Let l = 2/75 - -16/25. Let a = -8 - -8.3. Let t = -3 - -4. Put a, l, t in increasing order. a, l, t Let j = 400 - 404. Let x = 0 + -2. Sort -5, j, x in decreasing order. x, j, -5 Let m be 6 - (81/(-9))/(-9). Sort -2/25, m, -5, 1/3 in decreasing order. m, 1/3, -2/25, -5 Let c = -141 - -226. Sort -3/4, 1, -1/3, c. -3/4, -1/3, 1, c Suppose 3u - 5t + 10 = 0, 0 = 2u - 0t - t + 2. Sort 2, -1, u, -23 in descending order. 2, u, -1, -23 Let c = 19 - 19. Suppose x - 3x = 0. Suppose m + d + 1 = -x, 3 = -3m + 5d. Sort m, 1, c in ascending order. m, c, 1 Let w be ((-2)/10)/(9/(-135)). Sort 0, -3, -1, w in descending order. w, 0, -1, -3 Suppose 2f - 5f = -3k + 9, 4f - 2k + 2 = 0. Sort -17, f, -1, -3 in increasing order. -17, -3, -1, f Let k(i) = -16i + 102. Let p be k(8). Put -2, 4, p, 2 in ascending order. p, -2, 2, 4 Let x = 816 - 821. Sort x, -1, 2, 1 in increasing order. x, -1, 1, 2 Let p = 464 - 459. Sort p, 58, 2, 3 in descending order. 58, p, 3, 2 Suppose -12b - 15 = -10b + 5w, -w = -b + 10. Put b, 3, -111, -5 in increasing order. -111, -5, 3, b Let h = 2.3 + -1.9. Let u be 1/(-2) + (-143)/(-130). Sort 0, h, u. 0, h, u Let s = 4.557 + -0.557. Sort -3, s, -3/8 in decreasing order. s, -3/8, -3 Let w = -0.5 - -0.48. Let y = 0.08 - w. Put -5, -0.4, y in increasing order. -5, -0.4, y Let c(s) = -3s2 + s + 42. Let p be c(4). Let g = 5 + -9. Sort g, -3, p, 2 in increasing order. g, -3, p, 2 Let p = 1.123 - 1.223. Sort 2/11, 0.17, p. p, 0.17, 2/11 Suppose 7 = 2l - q, -15 = -4l + 2q + q. Let n = 2127 - 2130. Put l, -4, 3/2, n in increasing order. -4, n, 3/2, l Let g be ((-2)/2 - -2)-9. Let h = 13 + g. Let a be (6/8)/(2/8). Put h, a, -1 in decreasing order. h, a, -1 Let o(n) = -n3 + 8n*2 + 4n + 42. Let f be o(9). Put 7, f, 0, -10 in decreasing order. 7, 0, f, -10 Let s = -36194 + 36197. Let o = 1 - -1. Sort o, 5, -2, s in descending order. 5, s, o, -2 Suppose 0h + 180 = 5h. Suppose -4k + 5t + h = t, -3k - 5t + 43 = 0. Let x = 20 - k. Put x, -3, -4 in ascending order. -4, -3, x Let j(s) = -s*3 - 14s*2 + 40s + 130. Let q be j(-16). Put 5, q, -23, -5 in descending order. 5, q, -5, -23 Let j = -17/6 + 2. Let f = -62 + 57. Let p = 3 - 2.9. Sort p, j, f in increasing order. f, j, p Let w = -185 + 187. Let j be (-18)/(-8) - 2/8. Let b be j/1 - (-3)/3. Sort b, -1/5, w in descending order. b, w, -1/5 Suppose -14u = -139 + 13. Put -2, u, -4, -3 in increasing order. -4, -3, -2, u Suppose -2 = -2m, 4u - 11m + 14 = -13m. Sort -3, 1, u, 70 in increasing order. u, -3, 1, 70 Let j be (-4)/((-16)/(-12)) + (1 - 4). Let q be (-7)/(-21) + -3 - 4/j. Let t be ((-1)/2)/(2/(-48)). Sort q, t, -4 in descending order. t, q, -4 Suppose 4t + 14 = n, -4t + 0n - 16 = -2n. Suppose -8o + 6o = -6. Suppose 0k - 22 = -2q - 3k, ok - 17 = -q. Put q, t, 1 in decreasing order. q, 1, t Let t = 1623 + -1620. Let z = -4.94 - 0.06. Sort z, -1, 2, t. z, -1, 2, t Let l(m) = -3m + 12. Let r be l(3). Sort -0.8, -1/8, r, -5 in ascending order. -5, -0.8, -1/8, r Suppose -2h - 3k + 28 = 0, h + 108 = 6h - 2k. Suppose 16f - 20 = hf. Put f, 4, 0 in descending order. 4, 0, f Let c = -108 + 107.992. Sort -3, c, 2, -4 in decreasing order. 2, c, -3, -4 Let a = -0.4 + -0.1. Let w = 85.7 - 133.8. Let f = w - -48. Put a, -5, f in ascending order. -5, a, f Let y = 186 - 181. Put 2/15, 0.09, y in ascending order. 0.09, 2/15, y Suppose 156m - 3p = 155m - 8, 0 = -2p - 4. Let d = -4/21 - -86/231. Sort d, 2, m in ascending order. m, d, 2 Let m = -0.1 + 0.3. Let l = 2608 + -2607.6. Put m, l, 0, -1 in descending order. l, m, 0, -1 Let g be 18/((-6)/(-2)) - -1. Let b = 14 + -14. Sort -4, b, g in decreasing order. g, b, -4 Suppose -2 - 2 = -4z. Let n(b) = 2b*2 - 14b + 4. Let d be n(7). Sort -1, z, d. -1, z, d Suppose 176 = -16o + 128. Suppose 0 = u - 3u. Put u, o, -1, 2 in descending order. 2, u, -1, o Let a = -200/1253 - -3/179. Put 190, 1, a in decreasing order. 190, 1, a Let g be 7042/105 + 2/(-5). Let c = -68 + g. Let p = -0.184 - -0.084. Sort p, c, 0.2. c, p, 0.2 Let z(u) = -u*2 + 6u + 5. Let f be z(6). Let p = -66 + 64. Let x = p - -3. Sort f, -8, x in decreasing order. f, x, -8 Suppose -6i - 49 = -229. Sort 4, -2, -5, i in decreasing order. i, 4, -2, -5 Let z(c) be the first derivative of c2/2 + 3c + 5. Let k be z(-5). Put k, 3, 1/5 in ascending order. k, 1/5, 3 Let s be (10/8)/((-4)/((-112)/(-7))). Sort 5, s, -1, 0 in descending order. 5, 0, -1, s Let i = -338 + 340.01. Let d = i + -0.01. Let c = -896 + 895.9. Sort c, d, -0.5 in ascending order. -0.5, c, d Let t(l) = -l*3 - 7l*2 - 9l - 3. Let g be t(-6). Suppose y = 4y - 9. Put y, g, -1 in ascending order. -1, y, g Let u be -1 - ((-21)/(-18) - 2). Let s = 3.4 + -3.4. Put 0.1, u, s in decreasing order. 0.1, s, u Let x be (13/(91/(-4)))/((-45)/21 + 2). Let n(p) = p - 1. Let c be n(3). Put c, x, -4, -3 in decreasing order. x, c, -3, -4 Let m(j) = -j2 - 4j + 16. Let f = -25 - -19. Let x be m(f). Sort -3, x, -6. -6, -3, x Let d = 40.5 + -39. Let h = d + -1. Sort 1, 0.01, h in ascending order. 0.01, h, 1 Let u = 8 - 5. Suppose 5t = -y + 21, -2y + 9 = 2t - y. Suppose 36 = -tw + 4l + 12, 4 = l. Put u, -3/2, w in ascending order. w, -3/2, u Suppose 199y - 104 = 195y. Put -3, 0, -5, y in descending order. y, 0, -3, -5 Suppose 0 = -3v + 3c - 3, -5v + c - 5 = 4. Suppose 127 = 5t + d, 121 = 5t + d - 3d. Let y = 22 - t. Put -4, v, y in ascending order. -4, y, v Suppose 5h - 3h - 132 = 0. Let w be (h/(-9))/(2/3). Let l be -2 + 53/15. Put w, l, -5 in ascending order. w, -5, l Suppose -6 = 3p + 3, 4p = w - 17. Suppose w = -4n - n. Sort 3, -5, n. -5, n, 3 Let f = 0.279 - -4.721. Sort f, -3, -0.2, 2 in descending order. f, 2, -0.2, -3 Let z = 11 - 13. Let p(r) = r2 - 5r. Suppose 0q + 20 = 5q. Let v be p(q). Sort 0, z, v. v, z, 0 Let a = 514 - 366. Sort 3, 1, a in increasing order. 1, 3, a Let z(f) = 13f - 1. Let w be z(1). Suppose -w = 3l, 2b + 4l = -0 - 24. Put 1, b, 4, -1 in descending order. 4, 1, -1, b Let i be (-14)/180 - (110/90 - 1). Sort -4/5, 4, 0.4, i. -4/5, i, 0.4, 4 Suppose g = s + 2, -g = -0*g - 1. Sort 1, 0, s, 2 in descending	{ "pile_set_name": "DM Mathematics" }
ivisor of g and 11? 11 Suppose -3p - 52 = r, -3p + r = -4r + 64. Let d = p - -21. Calculate the greatest common factor of d and 1. 1 Let b(u) = 7u*2 + u. Let m be b(1). Let i = m + -3. Calculate the highest common factor of 5 and i. 5 Suppose t + u = -3u - 5, 3t = 2u - 29. Let m = -7 - t. Let k be (-1)/m - 57/(-6). Calculate the highest common factor of 6 and k. 3 Let u(j) = j - 2. Suppose -5z + 30 = -5q, -2q - 2q = 2z - 24. Let w be u(z). Calculate the greatest common divisor of w and 30. 6 Let h = 44 - 14. Calculate the highest common divisor of h and 270. 30 Suppose -4b + 40 = 4p, -7b + 10 = -3b - 2p. Suppose i - 60 = -3q + 6q, i - 5q - 70 = 0. Calculate the highest common factor of i and b. 5 Suppose 3s + 4 = 4s. Let j be (-2)/(-6) - 258/(-9). Suppose 35 = 4a - j. What is the greatest common factor of a and s? 4 Let k(h) = -2h - 15. Let v be k(-12). Calculate the greatest common factor of 3 and v. 3 Suppose s - u - 2u - 14 = 0, 2s = u + 18. Calculate the greatest common divisor of s and 88. 8 Suppose 102 + 74 = 4r. What is the highest common divisor of 4 and r? 4 Let k = 16 + -13. Suppose -5h + kg = -0g - 60, -2g = 0. Calculate the highest common factor of h and 2. 2 Let v = -6 + 21. Let b(y) = 3y2 + 3y. Let l be b(-2). Suppose -2n = -ln + 240. Calculate the greatest common divisor of v and n. 15 Let p = -21 + 12. Let l(j) = -2j - 11. Let c be l(p). Calculate the highest common factor of c and 49. 7 Suppose -4h + 5h - 4 = 0. Suppose hs - 20 - 4 = 0. Calculate the highest common divisor of s and 42. 6 Suppose 0 = 4j, d + 3j = 2d - 8. What is the greatest common divisor of 64 and d? 8 Let t = -54 - -59. Calculate the greatest common factor of 15 and t. 5 Let v be (-18)/4((-27 - 2) + 3). Suppose -3g + 0i = 3i - 36, 2g - 27 = i. What is the highest common factor of v and g? 13 Let c be 26/(-39)57/(-2). Calculate the highest common divisor of 38 and c. 19 Let w = 3 + 1. Suppose -n = t - 6, 3n - w = n + 2t. Suppose 3 = -nf + 219. What is the highest common factor of f and 6? 6 Suppose -61 - 563 = -3w. Let f be (w/(-6))/((-2)/15). Suppose -292 = -5i - 3v, -5i - 2v + 7v = -f. What is the highest common divisor of i and 7? 7 Suppose 0s + 200 = 10s. What is the greatest common divisor of 4 and s? 4 Suppose -12i + 548 = 68. Calculate the highest common factor of 5 and i. 5 Let q be (-1)/4 + (-2)/(-8). Suppose 2u - 140 = -qu. Suppose 4d + 3y = -d + 41, 0 = d - 4y - 22. What is the highest common divisor of d and u? 10 Let g be 10/35 + (-54)/(-7). Calculate the greatest common factor of 72 and g. 8 Let l be (-2)/(-6) + (-16)/(-6). Suppose -5w = -m - 416, -lm + 32 = -3w + 284. Suppose w = 4v + 23. What is the greatest common divisor of v and 10? 5 Let a(p) = 8p2 - 3p - 4. Let b be a(4). Let q = -33 - -47. Calculate the highest common factor of q and b. 14 Suppose 3o - 4d + 4 = 2o, 5d - 14 = -o. What is the greatest common divisor of 12 and o? 4 Let c = -116 - -193. Suppose o - 2o + c = 0. What is the greatest common divisor of 11 and o? 11 Let m = 12 - 10. Suppose -b = 3b + mv - 18, 0 = 4b - v - 21. Calculate the highest common factor of 35 and b. 5 Suppose -2b = -4d + 132, b - 125 = -3d - 16. Let f = 7 + 0. Calculate the highest common factor of d and f. 7 Suppose -21c + 2c = -798. What is the greatest common factor of 56 and c? 14 Suppose 3x + 122 = 2k - 195, -k - 3x + 145 = 0. What is the greatest common divisor of 14 and k? 14 Suppose 0 = -3v - 20 - 10. Let z = v - -19. What is the highest common factor of 72 and z? 9 Let h = -9 - -1. Let a = h + 17. Let c = 1 - -44. Calculate the greatest common divisor of c and a. 9 Let w be 2 + -1 + 25 + -1. Suppose 6f - 22 = -y + 2f, y + 5f - w = 0. Let h = 31 - y. Calculate the greatest common factor of 14 and h. 7 Let b(v) = v*2 - 15v + 18. Let j be b(14). What is the highest common divisor of 6 and j? 2 Suppose 3x - x = -o + 144, -2x - 156 = -o. What is the highest common divisor of o and 30? 30 Suppose 0 = -2x - 3j + 3 + 11, 0 = -3x - 5j + 20. Let u(h) = 3h2 + 2h + 2. Let l = -2 - 0. Let m be u(l). What is the highest common divisor of x and m? 10 Let d be (-72)/(-2)(-60)/(-18). Suppose -2w + 4p = -22, 5p = 3p + 4. Calculate the greatest common factor of w and d. 15 Suppose -167 = -5n + 3i, 2n - 3i - 64 = i. Calculate the greatest common divisor of n and 17. 17 Suppose -2s + 0g + 3g + 237 = 0, 485 = 4s + 5g. Calculate the highest common factor of 15 and s. 15 Suppose 3j + 46 = 5l + 6j, -4l + 2j + 28 = 0. Suppose -1 = -f + l. Calculate the highest common factor of 1 and f. 1 Let g(c) = 6c*2 + c + 1. Let x be g(2). Let v(j) = -9j - 5 + 5. Let s be v(-1). What is the highest common factor of s and x? 9 Let k be 1/(-3) + (-32)/(-6). Let u = 8 - k. Let v(t) = -t + 4. Let a be v(-5). Calculate the greatest common factor of u and a. 3 Suppose 10 = 2o, 3b - 2o - 57 = 11. Let u = -36 + 49. What is the greatest common factor of b and u? 13 Suppose -25 = -2x - 1. Calculate the highest common divisor of x and 36. 12 Let c(y) = y*3 - 2y*2 - 16y - 8. Let s be c(6). Calculate the highest common factor of 10 and s. 10 Let s be (1 - 8)(-4 + 3). Let d = s - -1. Calculate the greatest common divisor of d and 8. 8 Let z be (5 - 1)/(3/15). Calculate the greatest common factor of z and 140. 20 Let g(t) = -t2 - 10t - 7. Let v be g(-4). Let p(h) = -h + 17. Let z be p(0). Calculate the highest common divisor of z and v. 17 Let a = 5 - -9. Suppose 13 - 5 = -2b. Let x(j) = -j3 - 2j*2 - j - 1. Let t be x(b). What is the highest common factor of t and a? 7 Suppose 4u - 151 = -3w, -33 = -4u - 2w + 121. What is the highest common divisor of 10 and u? 10 Suppose 8u - 45 = 3u. What is the greatest common factor of 9 and u? 9 Let z be 1(31 - 1 - 3). Suppose 2j + 6 - 24 = 0. Calculate the greatest common divisor of j and z. 9 Let s = -90 + 110. Calculate the greatest common factor of s and 80. 20 Suppose 4 = r - 132. Let c be 12((-15)/(-6) - 2). Suppose -h = -2q + 41 - c, 22 = q - 5h. What is the greatest common factor of r and q? 17 Let r(c) = -24c + 2. Let k be (5 + -3 - 6)/1. Let w be r(k). What is the highest common factor of 14 and w? 14 Let g(j) = -j3 - 8j*2 + 2j + 17. Let b be g(-8). What is the highest common divisor of b and 13? 1 Let u = -29 + 49. Calculate the greatest common divisor of u and 5. 5 Suppose -5j - 9 = -2c, -3c = -0c - 6. Let s be -1 + (44 - (j - 1)). What is the greatest common divisor of 30 and s? 15 Suppose 0d - 4 = 4d, -d = 4a - 987. What is the greatest common divisor of 19 and a? 19 Let d(i) = i2 - 7i + 6. Let w(a) = -a*3 + 7a*2 - a + 1. Let q be w(7). Let c be d(q). What is the greatest common divisor of c and 56? 28 Let t be (5/10)/(2/8). Let z = t + 0. Let k be (-117)/18z-1. What is the greatest common divisor of 91 and k? 13 Let z(i) = i2 - 3i - 2. Let a be z(4). Suppose 2g - 4l - 36 = 0, ag = 2l + 16 + 12. Calculate the greatest common factor of g and 30. 10 Let x be (-40)/(-6)(-3)/2. Let s be (9/3)/((-6)/x). What is the greatest common factor of 10 and s? 5 Suppose 0h = 4l - 3h - 108, 0 = -3l + 5h + 70. Calculate the greatest common factor of 45 and l. 15 Let b(f) = -2 + 6 + 2f - 4f. Let y be b(-7). Let k(n) = -n*3 + 6n*2 + 4n - 3. Let s be k(3). Calculate the greatest common factor of s and y. 18 Let h be (0 + 1)/(4/116). Let k = h + -16. Let q = 27 - k. Calculate the highest common factor of 35 and q. 7 Suppose -48 = 8j - 192. Suppose -5y + o + 130 = 0, -21 - 1 = -y + o. Calculate the greatest common factor of j and y. 9 Suppose 33 = 4y - 5r, -y + r = -0 - 8. What is the highest common factor of 3 and y? 1 Let a = -3 + 3. Let f = 3 + a. Suppose 0 = -g - f + 36. What is the highest common factor of 22 and g? 11 Suppose 3q - 1 - 8 = 0. Let v = -3 + 4. Suppose 3d = -4w + 2d + 10, -v = 3w + 5d. Calculate the highest common factor of w and q. 3 Let v(o) = 16o - 5. Let h be v(10). What is the highest common factor of h and 31? 31 Let t(m) = -m - 2m + 4m + 2. Let o = 34 - 25. Let z be t(o). What is the greatest common divisor of z and 11? 11 Let d be 2/(-3)(-6 - 0). Let n be d/(-14) - (-107)/7. What	{ "pile_set_name": "DM Mathematics" }
+ sqrt(2448))2)). -12244 + 252sqrt(17) Simplify -4 + -6(-1 + sqrt(1700) + 0)2 - ((5 + sqrt(68) + (3(sqrt(68) - -2sqrt(68)) - sqrt(68)))-5)*2. -148535 - 4380sqrt(17) Simplify (sqrt(32)/sqrt(2)-3)/(sqrt(24)/(sqrt(15)/sqrt(5))) + (sqrt(2) + sqrt(2) + 3 + -3 - sqrt(2)) + sqrt(18)-1. -5sqrt(2) Simplify 1(5 + -5 + (-2-3sqrt(119) + sqrt(119))/(sqrt(343)4)). sqrt(17)/4 Simplify (sqrt(65)/(sqrt(180)-4 + sqrt(5)))2 + 0 + (3 + (sqrt(52) - sqrt(156)/sqrt(3)) + -5)2. 2129/529 Simplify (((-5 + 2 + sqrt(12))-6 - (2 + ((sqrt(147) - sqrt(147)2) + sqrt(147))-1)) + 1)2. -408sqrt(3) + 721 Simplify 3 + (-4 + (sqrt(112) + (-4 + sqrt(112))4)-4 + -4)*2. -8960sqrt(7) + 47939 Simplify (1sqrt(1573) + -5 + -2 + (-2(sqrt(1573) - -1sqrt(1573)) + sqrt(1573) - (-1 + sqrt(1573))-2)*2)-5. -7850 - 275sqrt(13) Simplify -1 + -4(5 + -4 + -3 + ((0 + sqrt(325))*2-3 - (sqrt(325) - -6-2sqrt(325))*2)). 161207 Simplify 6(0 + ((-4 + (sqrt(128)13 + sqrt(128) + (sqrt(128) - sqrt(128)-2) + -1)5 + 0)2)2). -120960sqrt(2) + 3765144 Simplify (sqrt(1152) + 2sqrt(1152))/(sqrt(99)/sqrt(176) + sqrt(9)) - (((sqrt(18) + -5)2 - (-2sqrt(16))/sqrt(8)) + -4). -39 + 236sqrt(2)/5 Simplify (((-5 + (sqrt(117) - (sqrt(117) + -2)))-1)2 + (5 + sqrt(117) + 0)2 + -3 + 1sqrt(117))-3. -444 - 99sqrt(13) Simplify ((sqrt(75)1 + sqrt(75) + -1)5 + 2 + (sqrt(75) - (2 + sqrt(75) + -2)) + -1)2. -400sqrt(3) + 7516 Simplify (3 + -5 + ((sqrt(180) + 1)*2 + -5)-1-2 + 4)-4. -1416 - 96sqrt(5) Simplify 4(2 + (3(sqrt(88) - sqrt(88)-2) + (sqrt(88) - (-4-2sqrt(88) + sqrt(88) + sqrt(88))))/(sqrt(128)3-4)). 8 Simplify (1(sqrt(2057) + -4sqrt(2057)) + -4 + (sqrt(85) + (sqrt(85) - sqrt(85)-2)4)/(sqrt(5)-2-4))*2. 251sqrt(17) + 1072041/64 Simplify ((-3 + (sqrt(700) - -2sqrt(700)2 - sqrt(700)) + sqrt(700))-6)2 + (sqrt(700)-2-5 - (sqrt(700)1 + -3))-3. -11070sqrt(7) + 630315 Simplify (-4(sqrt(300) + 41sqrt(300) + 5 + 5 + 0 + sqrt(300) + 0))2 + 3. 19200sqrt(3) + 174403 Simplify (((sqrt(119) - (sqrt(119) - sqrt(119)2)6) + (sqrt(119)-5-1 - sqrt(119)) + sqrt(119))/(sqrt(7)34 - -1sqrt(448)))2. 153/25 Simplify (sqrt(468)/(sqrt(18)/sqrt(32)))2 + (1sqrt(52) + 3 - (1 + sqrt(1300))). -8sqrt(13) + 834 Simplify (sqrt(108) + (0 + sqrt(108) + -5)2 + -1 - 2(3 + -2sqrt(108))) + 5. -30sqrt(3) + 131 Simplify 0 + ((sqrt(275) - (sqrt(275) + (sqrt(275)4 - sqrt(275)) + sqrt(275) + sqrt(275))2)/sqrt(5))/(sqrt(55)/(sqrt(55)/sqrt(5)-5)). 55sqrt(11) Simplify ((sqrt(1782) - sqrt(1782)-2)/((sqrt(12)-1)/sqrt(6)) - 3(((2sqrt(132) - sqrt(132))-3)/sqrt(12))2)-6. 162sqrt(11) + 1782 Simplify sqrt(171)-2461 + (-3(-4 + (sqrt(171) - (sqrt(171) + 1)) + sqrt(171) - ((-2sqrt(171) + 0 - sqrt(171)) + sqrt(171))))2. -954sqrt(19) + 14076 Simplify ((-12sqrt(117) - -4(sqrt(117) + sqrt(117)-1))4)/((2sqrt(36)/sqrt(2))/(sqrt(22)/(sqrt(11) - sqrt(176)))). 4sqrt(13)/3 Simplify (6(sqrt(85) - -5sqrt(85)-2 - (sqrt(85) + (1sqrt(85) - sqrt(85))-1)))/(5(sqrt(50) - (sqrt(450) + sqrt(450)4))/sqrt(10)). 6sqrt(17)/7 Simplify -6((-2 + sqrt(75) + 0)*2 - (sqrt(75) - 5sqrt(75)1) - (-4 + (sqrt(189)/sqrt(7) - (sqrt(6)/sqrt(2) + 2)))). -510 + 12sqrt(3) Simplify (-2(sqrt(3840) + (5(1sqrt(3840) + sqrt(3840)) - sqrt(3840))))/((((sqrt(108)1 - sqrt(108) - sqrt(108)) + sqrt(108) + sqrt(108))-5)/(-5sqrt(9)2)). -320sqrt(5) Simplify (1sqrt(200)-1 + -4 - (sqrt(200)2 + 0 + sqrt(200) - (3 + -1 + sqrt(200) + sqrt(200) + sqrt(200))))2 + 3. 40sqrt(2) + 207 Simplify ((-2sqrt(784)-2-2)/(-3sqrt(28) - -4(sqrt(7) + sqrt(35)/sqrt(5))))2. 1792 Simplify 263(4 + (2sqrt(143)3 + sqrt(143))/(-3sqrt(11)-1))*2. 672sqrt(13) + 3124 Simplify (-1sqrt(2058) - sqrt(42))/(sqrt(36)/sqrt(96)) - ((sqrt(7)-2-3)2 - -6(0 + sqrt(7))*2). -294 - 32sqrt(7) Simplify 5 + (((sqrt(800) + 1sqrt(800) + sqrt(800))3)/((4sqrt(500))/sqrt(5)))2 + 1. 93/2 Simplify (sqrt(77) + sqrt(77)-14 + -1(sqrt(77) - (sqrt(77) - -2sqrt(77))) + sqrt(77))/((2sqrt(77)1)/(sqrt(11) + sqrt(396)/sqrt(4))). 0 Simplify (3 + (3(sqrt(1053) - (2sqrt(1053) + -2)) - 4(sqrt(1053)-1-6 - sqrt(1053))) + -1)*2. -3312sqrt(13) + 557101 Simplify ((-3(sqrt(720) + 1) + 5 + 1sqrt(720))-4 - -3(-4 + -1 + sqrt(720) + 5))*2 + 1. -2112sqrt(5) + 87185 Simplify (-3 + -1 + -3 + 2 + -3 + sqrt(80)-2 + 1 + sqrt(80) + 1)2. 48sqrt(5) + 116 Simplify 0 + 3 + (sqrt(931) - (5 + sqrt(931)-1)) + -3 + (sqrt(1216) + -1 + sqrt(1216))2 + sqrt(209)/sqrt(176) + 3. -71sqrt(19)/4 + 4863 Simplify (sqrt(1260) + 2sqrt(1260) + sqrt(35) + sqrt(35) - sqrt(315)-2)/((sqrt(180)/(sqrt(12)5 + sqrt(12)))/sqrt(3)). 156sqrt(7) Simplify ((-2 + (3sqrt(12))/sqrt(6))1 + (sqrt(162)-3 + -4 + 3)2)-1. -1457 - 57sqrt(2) Simplify -5(-6((-1sqrt(432) - sqrt(432) - sqrt(432) - sqrt(432)) + sqrt(432)))/(sqrt(486)/sqrt(9) - sqrt(54)/(sqrt(9) + sqrt(81))). -2160sqrt(2)/11 Simplify 4 + (((sqrt(33) + -3sqrt(33)-3)-4)/(2-3sqrt(18)/sqrt(6)))*2. 4436/9 Simplify 0 + 1((-4 + sqrt(1539) + -2)*2 - (-3(sqrt(228) - -2sqrt(228)))/sqrt(12)) + 5. -99sqrt(19) + 1580 Simplify -1 + -2 + (2sqrt(2299)-6 + (sqrt(2299) - (-3(sqrt(2299) - (sqrt(2299) + 0 + sqrt(2299))))2) + 2)5-2 + -5. 1210sqrt(19) + 206882 Simplify 3 + (-1 + 6(0 + (sqrt(245) - (sqrt(245) - (sqrt(245)5 + sqrt(245)))) + ((-3 + sqrt(245) - sqrt(245) - sqrt(245)) + sqrt(245) + 4 - sqrt(245))))*2. 2100sqrt(5) + 220528 Simplify -5 + (sqrt(153) + 4sqrt(153))/sqrt(9)-6 + sqrt(51)/(3sqrt(3)2). -179sqrt(17)/6 - 5 Simplify ((4(sqrt(84) + (sqrt(84) - -2sqrt(84) - sqrt(84))) - ((sqrt(84) - (-1sqrt(84)5 - sqrt(84))) + sqrt(84)))1)/(4sqrt(108)43). sqrt(7)/36 Simplify (3(sqrt(114) + (sqrt(114) - -5(-1sqrt(114) - sqrt(114))) + sqrt(114))2)/(sqrt(294)13 - (sqrt(294) + 2sqrt(294)4)) + 4. 4 + sqrt(19) Simplify ((sqrt(119) - sqrt(119)-2 - sqrt(119))-3 + sqrt(119))/sqrt(7)-32 + -2((sqrt(1088) + 2sqrt(1088))2 + 3) + 5. -19585 + 30sqrt(17) Simplify ((1 + -1(sqrt(1300) - sqrt(1300)1))5 - (3 + (sqrt(468) + (sqrt(468) + 0)1 - (-1 + sqrt(468) + -3 + sqrt(468)))))*2. 4 Simplify -4 + 1(sqrt(704) + -1)*2-2 + (-2 + (sqrt(1100) - 3sqrt(1100) - sqrt(1100)))2 + (0 + sqrt(1100))4. 192sqrt(11) + 8490 Simplify (sqrt(99)-2 - (sqrt(22)/sqrt(2)-6 - sqrt(11))) + -2(sqrt(11) + 2 + sqrt(44)/sqrt(4))2. -7sqrt(11) - 8 Simplify 1((4 + sqrt(325) + -1)2 + (-1 + sqrt(325) - sqrt(325))22)-335-6 + -5. 8100sqrt(13) + 90715 Simplify (1(sqrt(5) + -1) - (1sqrt(720))2) + sqrt(15)/sqrt(3)6 + ((sqrt(35)2)/sqrt(7))2. -701 + 7sqrt(5) Simplify (-2 + (sqrt(1216) - sqrt(1216)-2) + -4 + 0 + -1sqrt(304) + 3)*2-1. -7609 + 120sqrt(19) Simplify -3(0 + 0 + (sqrt(3) + 3 - sqrt(3))6 - ((0 + sqrt(108))6 - (sqrt(108) - (sqrt(108)2 + 2))2)). -390 + 36sqrt(3) Simplify 2 + ((-4sqrt(17)-3)*2 + -3 + sqrt(2448) - (5(sqrt(68)-2 - sqrt(68)))/(-2sqrt(16))). 33sqrt(17)/4 + 2447 Simplify (-1 + sqrt(432) + -4 + sqrt(432) + 4 + -2 + sqrt(432))2 - (-3(sqrt(432) - ((-1sqrt(432) - sqrt(432)) + 2)))21. -31131 + 1080sqrt(3) Simplify (-3(sqrt(108))*2 - (sqrt(12) + -3 - sqrt(3)) - ((-2 + sqrt(432))4 + -2)) + -3. -314 - 49sqrt(3) Simplify (sqrt(384) + -5-2sqrt(384) - (sqrt(384) + 2sqrt(384) + sqrt(384))-3)/(sqrt(24)/sqrt(18) + -2sqrt(12)1) + -5. -276sqrt(2)/5 - 5 Simplify (1 + 2sqrt(1377))2 - (sqrt(1088) - (sqrt(1088) - (1 + -2sqrt(1088))*2)) - (sqrt(204)/sqrt(144))/(sqrt(3) - sqrt(6)/sqrt(72)). 339sqrt(17)/5 + 1156 Simplify ((sqrt(130)/(sqrt(10) - (sqrt(10) + sqrt(80)/sqrt(2) - sqrt(10))) + -5-2sqrt(13) + sqrt(91)/sqrt(28))5)2 + -4. 117309/4 Simplify 2 + (-2 + sqrt(243))-5 - (6(sqrt(192) + 1) + 0)2. -6936 - 621sqrt(3) Simplify (3(sqrt(1408) + ((-2sqrt(1408) - sqrt(1408)) + sqrt(1408))-6))/((-2sqrt(512))/(sqrt(48)/sqrt(3))) + -1. -39sqrt(11) - 1 Simplify (sqrt(252)/(sqrt(192)1)4)/(sqrt(288)/sqrt(6) + sqrt(108)/sqrt(9)). sqrt(7)/6 Simplify ((6(1 + sqrt(272) + 0) + sqrt(272) + 1sqrt(272)-1 + 1 + 3)-1)2 + 3. 480sqrt(17) + 9895 Simplify (1 + (-5 + sqrt(147) + (sqrt(147) + -4)*2 + -4 + (-1 + sqrt(147))1)-6)6. -5502 + 1512sqrt(3) Simplify (((sqrt(95) - 4(sqrt(95)3 + sqrt(95))) + sqrt(95)2*1)/(sqrt	{ "pile_set_name": "DM Mathematics" }
z is divided by 8. 6 What is the remainder when 97/(-1)(3 + -4) is divided by 25? 22 Let b(y) = 13y - 4. Suppose -8 = -4f, -2f = -2x - f - 2. Suppose -r + 18 = -x. What is the remainder when b(3) is divided by r? 17 Suppose 11 = 3x - 2g - 0, x = 2g + 1. Let p = x - -6. Let i(l) = -32l3 - l2 - l - 1. What is the remainder when i(-1) is divided by p? 9 Let i(y) = y3 + 3y - 3. Calculate the remainder when -42(-2)/(-9 + -1)-5 is divided by i(2). 9 Let p = -64 - -41. Let g = 6 - p. Calculate the remainder when g is divided by 8. 5 Let l = -20 - -33. Let w = 202 + -133. Let o = w - 31. What is the remainder when o is divided by l? 12 Let k = -40 + 61. Let w = -10 - -21. Calculate the remainder when k is divided by w. 10 Let z = -28 - -47. Calculate the remainder when z is divided by 7. 5 Suppose 0 = -5a + 6a - 5. What is the remainder when 13 is divided by 2/a - (-66)/10? 6 Let o = -51 - -112. Calculate the remainder when o is divided by (3 - (-15)/(-10))14. 19 Calculate the remainder when 47 is divided by (2/(-1 - 0))/(-2) + 15. 15 Suppose -3p + 125 = -223. What is the remainder when p is divided by 40? 36 Suppose 3x + 97 + 69 = 5y, 0 = -3y + 4x + 93. What is the remainder when y is divided by 13? 9 Let s(g) = -g*3 - 8g*2 - 8g + 1. Let o be s(-7). Calculate the remainder when (-12)/(-9)348/o is divided by 15. 13 Suppose 3c + 1 + 6 = 2s, 3c - 1 = s. Let r = s + -2. Calculate the remainder when (-57)/(-5) - (-2)/(-5) is divided by r. 5 Suppose 29 = -3i + 4i - 4x, 5x + 25 = 0. Calculate the remainder when 3/(1/(2 + i)) is divided by 9. 6 Let l = 74 + -29. Suppose 3n + t = -2t - l, 99 = -5n + 3t. Let r = 11 - n. What is the remainder when r is divided by 10? 9 Let v be (-3)/(2/(8/(-6))). Calculate the remainder when 29 is divided by -4 - (4-4 + v). 9 What is the remainder when 19 is divided by 203/21 - 2/(-6)? 9 Suppose 4y - 65 - 87 = 0. Suppose -5b + 55 = -5o, -2b + o + y = 2b. Let l(q) = -q*3 + 6q*2 - 1. What is the remainder when l(5) is divided by b? 6 Let x = 52 + -1. What is the remainder when x is divided by 13? 12 Let k = -10 + 18. Suppose 4g + 5v = v - 4, -5v = -4g + 32. Suppose -3u = -5d + 3d + 1, -4d = -gu - 11. Calculate the remainder when k is divided by d. 3 Let b be (-2 - -21) + 4. Let v = -3 + b. What is the remainder when 15 is divided by 12/((-3)/v)-2? 7 Let b be (-156)/(-5) + (-6)/30. Let l = -15 + b. Calculate the remainder when 62 is divided by l. 14 What is the remainder when 18/8(-336)/(-18) is divided by 11? 9 Let a(g) be the first derivative of -g2/2 + 3g + 3. Let j be a(-4). Suppose jt - 2t = 45. What is the remainder when 16 is divided by t? 7 Suppose -3f = -4z - 6f + 25, -2f = 2. What is the remainder when z is divided by 5? 2 Let g(f) = -f*2 + 13f - 2. Calculate the remainder when 133 is divided by g(4). 31 Suppose 2j + 3t = 6t + 28, -4j + 4t + 60 = 0. Suppose -32 = -f - 5u + 25, 0 = f + 2u - 42. What is the remainder when f is divided by j? 15 Calculate the remainder when (2 - 5)/((-3)/22) is divided by 1 - 1(0 - 4). 2 Let n(u) = u*2 + 6u + 7. Let h = -10 - -5. Calculate the remainder when 5 is divided by n(h). 1 Suppose 2s + 34 - 102 = 0. What is the remainder when s is divided by 12? 10 Let z(a) = 6a*2 - 9a + 14. What is the remainder when z(3) is divided by 9? 5 Let s = 18 - 12. What is the remainder when 7 is divided by s? 1 Let d(n) = -4n2 - 2n - n*3 + 0n - 10 - 8n2 + n. Let u be d(-12). Suppose m = u + 28. What is the remainder when m is divided by 8? 6 Let a(j) = -2j - 7. Let k be a(-6). Let m(u) = 9u + 1. Calculate the remainder when m(k) is divided by 12. 10 Let b(v) = -v3 - 9v*2 - 18v - 14. What is the remainder when b(-7) is divided by 6? 2 Let h = 6 + 3. Suppose 0 = ho - 5o - 84. What is the remainder when o is divided by 11? 10 Suppose -5a = 4x - 6x, 5x - 62 = -3a. What is the remainder when 38 is divided by x? 8 Let w(d) = -2d + 58. Calculate the remainder when 174 is divided by w(7). 42 Let c be (8/5)/((-6)/(-15)). Suppose -2g - 3m = -35, -g - cm - 6 = -31. Calculate the remainder when g is divided by 4. 1 Let s = 107 - 94. What is the remainder when 35 - 0/(0 + 2) is divided by s? 9 Let p(c) = -c - 1. What is the remainder when 64/(-24)33/(-4) is divided by p(-7)? 4 Let q = -17 + 30. What is the remainder when 50 is divided by q? 11 Let z be (2 - 4)(-50)/4. Suppose -4l + 100 = 2g, 0g = -l - g + z. What is the remainder when l is divided by 14? 11 Suppose 0d + 2d + 4 = -3q, 0 = 4d - 3q + 26. Let v = 6 + d. What is the remainder when v is divided by 1? 0 Suppose -3 = -o + 33. Let k(x) = 2x - 2. Let u be k(3). Suppose -4i - u = -o. Calculate the remainder when 22 is divided by i. 6 Let h = -214 - -318. Calculate the remainder when h/6 - 6/(-9) is divided by 10. 8 Suppose -2k = -6k + 24. Calculate the remainder when 10 is divided by k. 4 Suppose -10 = 5a, -4a - 41 = -s - 0a. Calculate the remainder when s is divided by 7. 5 Suppose h = -g + 17, -g + 42 = g + 4h. What is the remainder when 40 + (4/8)/((-1)/8) is divided by g? 10 Suppose a - 1 = 1. Let h = 4 - a. Let x = 6 + -4. What is the remainder when x is divided by h? 0 Let t(c) = -4c*2 + 2c - 3. Let g(w) = -13w2 + 5w - 10. Let b(y) = 2g(y) - 7t(y). Calculate the remainder when b(3) is divided by (-65)/(-15) - 1/3. 3 Calculate the remainder when 43 is divided by (4/(-6))/(-2)27. 7 Suppose -5j = 2n + 7 + 4, 0 = 2j + 10. What is the remainder when 3 - n(2 - 3) is divided by 4? 2 Let s = -3 - -23. Calculate the remainder when s is divided by 6. 2 Let o(v) = v3 + 4v*2 - 4v + 7. Let w be o(-5). Suppose wz - 12 = -3l, 0z + 3z + 2l = 18. Calculate the remainder when 17 is divided by z. 5 Let u = 6 + -11. Let x(p) = p + 7. Let d(a) = a3 - a2 - a - 1. Calculate the remainder when x(u) is divided by d(2). 0 What is the remainder when (-12)/48 + (-473)/(-4) is divided by 20? 18 What is the remainder when 98 is divided by (0 + (-5)/2)-10? 23 Let m(x) = 10x - 1. What is the remainder when m(3) is divided by 11? 7 Suppose 5j + 0n = -2n - 2, 4n = -2j + 12. Suppose -r + 5 = 3g - 3, g = -3r + 24. Calculate the remainder when r is divided by 9 + -2 + j + 0. 3 Suppose 5 - 10 = l. Let p = l + 52. Calculate the remainder when p is divided by 12. 11 Let q(t) = 6 + 3t - 3 - 1. Let b = -40 - -44. What is the remainder when q(4) is divided by b? 2 Let y = 7 + 5. Calculate the remainder when 23 is divided by y. 11 Suppose o = 5o - 20. Suppose 2u - 48 = k, u - ok = -4 + 37. What is the remainder when u is divided by 13? 10 Suppose 376 = 3x - 2v + 132, 4x - 2v - 326 = 0. Suppose -x + 10 = -4r. Calculate the remainder when 52 is divided by r. 16 Suppose -2f + 78 = 24. Suppose -2s = 2w - 220, -2w = -6w - 3s + 437. Calculate the remainder when w is divided by f. 26 Suppose 44 = 4r - 4q, -2r - r + 36 = -2q. What is the remainder when ((-123)/2)/3-2 is divided by r? 13 Let r(t) = -2t2 + 5t*2 - 2t*2 + 8t + 3. Let c be r(-8). Suppose -g = -5u - 31 + c, 5g = -3u + 56. What is the remainder when g is divided by 5? 3 Suppose -19 = -4n + 9. Let b be 167/5 + (-2)/5. Suppose 4o - b - 19 = 0. Calculate the remainder when o is divided by n. 6 Suppose 5x - 6 = 2x. What is the remainder when ((-36)/(-14))/(-3)-7 is divided by x? 0 Let z(y) = -4y - 5. What is the remainder when 29 is divided by z(-5)? 14 Let l = 45 + -14. Let r = l + 16. Suppose -3n - 19 = -67. Calculate the remainder when r is divided by n. 15 Let y(b) = -b*3 - 11b*2 - 24b + 4. What is the remainder when 26 is divided by y(-8)? 2 What is the remainder when 53 is divided by (-3 - (-2 + -1)) + 14? 11 Let t be (-2)/9 + (-330)/(-27). Suppose -15 = -4z + 41. Calculate the remainder when z is divided by 62/8 + 3/t. 6 Let k(z) = -z3 - 2z*2 + 2z. Let i(f) = 4f3 + 6f*2 - 6f. Let v(b) = 2i(b) + 7k(b). What is the remainder when v(3) is divided by 6? 3 Suppose -4l = 12, -2u - 8 = -l + 3l. Calculate the remainder when (7/(-2) - 0)-4 is divided by 1 - u - -16. 6 Let n(c) = -9c*3 + 2c*2 - 4c + 2. Let w be n(2). Let a = w + 121. Let p = 23 - 10. Calculate the remainder when a is divided by p. 12 Let h(r) = -6*r	{ "pile_set_name": "DM Mathematics" }
ssuming u is positive. u*(-1218) Simplify (y/(yy*(-3/38)y))(-2/195) assuming y is positive. y(7/741) Simplify (((p/p(-3/4))/p)/p)/(p/(p(-4)/p))p/(pp/(pp0))p6/p assuming p is positive. p(-5/4) Simplify ((jjj*(2/5))/j(jj(2/9))/j)/(j(-1/3))48 assuming j is positive. j(793/45) Simplify (ff(-3))(-1/21) assuming f is positive. f(2/21) Simplify o(-17)o6/oo assuming o is positive. o(-11) Simplify (y(3/2)yy)/(yy(2/17)yyy) assuming y is positive. y(-21/34) Simplify (((m(-1/41)/m)/mm)/m)/(m(-1/5)/m) assuming m is positive. m(-169/205) Simplify ((bb*(-2/3))/(bb6))/(b(-3)bbb(2/13)b) assuming b is positive. b(-266/39) Simplify j(-16/5)j(-2/15) assuming j is positive. j(-10/3) Simplify ((t(-4/7)/t)/(t/t(-2/15)))41 assuming t is positive. t(-11644/105) Simplify (((h2/h)/h)/h)19h*(3/4)/(hh(-3)) assuming h is positive. h(-65/4) Simplify (j/(j*(2/17)/jj)jjj/((jj(j/(jjj(-2/7)jj)j)/jj)/j))(15/4) assuming j is positive. j(8205/476) Simplify x6/x19 assuming x is positive. x(-13) Simplify (oo/o(1/12))/(((o(-8/9)/o)/o)/oo) assuming o is positive. o(173/36) Simplify ((j(jjj(j/j(-3/7))/j)/jj)/(j/j*9j))(2/13) assuming j is positive. j(160/91) Simplify (d(-2/5))(-41)d(2/3)/dd5 assuming d is positive. d(316/15) Simplify (u(-2))(1/30)u8u*(1/2)uu assuming u is positive. u(313/30) Simplify (l(-9/5))(-32/5) assuming l is positive. l(288/25) Simplify (t/(t/(t/t33)))/(t/t26) assuming t is positive. t(-7) Simplify (ff/((f*(-1)f)/f)f)/f(-2/11)(f/(f(ff*(-1))/ff))(-2/105) assuming f is positive. f(46/11) Simplify s*(-2/17)(ss(2/15))/ss*(-6)(s/(s*(4/3)s))/s assuming s is positive. s*(-707/85) Simplify (gg5/g)(-47) assuming g is positive. g*(-235) Simplify vvvv/(v*(-1/3)v)vvv(5/7) assuming v is positive. v(127/21) Simplify ((q(-3/2)q)46)2 assuming q is positive. q(-46) Simplify ((k/k(-29))/k)(-9/2) assuming k is positive. k(-261/2) Simplify (y*(1/4)/(yy(2/9)/y))(1/2) assuming y is positive. y(1/72) Simplify (t/((t9/t)/t)(t/(t(t/(t/(t/(t*5t)t))ttt)/t))/t)/(t(1/6))(-17) assuming t is positive. t(-13/6) Simplify ((p(-1/13)p)/p)/pp*0(ppp/p(-1/2))(7/8) assuming p is positive. p*(413/208) Simplify (p/(pp4))(4/29) assuming p is positive. p*(-16/29) Simplify vv*12/vv(-2) assuming v is positive. v10 Simplify (r(2/15)/r(-6/7))/(r(1/2))28 assuming r is positive. r*(-1366/105) Simplify (aa25)/(a(-2/11)a) assuming a is positive. a(277/11) Simplify (yy/(yy/y5)y)/y(-10) assuming y is positive. y16 Simplify (l(-5)/l(4/3))(2/27) assuming l is positive. l(-38/81) Simplify (t/(t/t*(-1))t/t5)/(t(-6)/(t/(((tt0)/t)/t)t)) assuming t is positive. t*4 Simplify (p(p/(pp(-16)p))/pp)(-14/13) assuming p is positive. p(-224/13) Simplify (r/(rr*(-1)))/rrr/(rrr(4/3))r/(r*(-2/5)/r)r(2/11) assuming r is positive. r(206/165) Simplify ((ss/s(-4/5))/(s(1/3)/ss))/(ss(1/3)sss)(-4/11) assuming s is positive. s(667/165) Simplify x*3x/x*6(x/(xx/(x/x(-1)x))x)/(x/(xx6)) assuming x is positive. x7 Simplify h/(h*20h)((h(h*(-3/11)hh)/hh)/h)/h assuming h is positive. h*(-212/11) Simplify (aa/(a*2a))/(a/a*(2/21))(a1)1 assuming a is positive. a(-19/21) Simplify (d/d(2/43))/(dddd(-1/2)) assuming d is positive. d(-133/86) Simplify b(2/9)/bb/(b/b*(-2)b)(b(2/7)/b)21 assuming b is positive. b(-169/9) Simplify m(1/9)/(mm(1/51)/m) assuming m is positive. m(14/153) Simplify ((hh/h(-3))/h)/h(10/7) assuming h is positive. h(18/7) Simplify (c11/c)/ccc(-38)c assuming c is positive. c*(-27) Simplify (ff*(-2)f)*31f/((f/((f/f*9)/f)f)/f)f/f9 assuming f is positive. f(-17) Simplify r(-3)rrr/(r/r*(-3))r(-7)/r9 assuming r is positive. r(-20) Simplify ((g/g(1/11))/g)(-20) assuming g is positive. g(20/11) Simplify (qq(3/7))(-31/5) assuming q is positive. q(-62/7) Simplify v/(v(2/3)/vv)v(1/8)(v0)(-30) assuming v is positive. v(11/24) Simplify (z/z(-1))*(2/9)z(-3)/z(-3) assuming z is positive. z*(4/9) Simplify (rr*(-4)/rr*(-1)r)(-22) assuming r is positive. r88 Simplify (f*(-2/5)/ff)*23((ff0)/ff)(-12/11) assuming f is positive. f(-566/55) Simplify (u/(uu(-3/4)))/u(-9) assuming u is positive. u(39/4) Simplify v(7/6)/(v/(v/((vvv9)/v))) assuming v is positive. v(-53/6) Simplify (p(ppp/((p*1/p)/pp)p)/p)(-9/4)p*(3/5)pp/(p(-1/3)/pp) assuming p is positive. p*(-91/15) Simplify ((d/(d/(((dd/(ddd/d*(-1/2)d))/d)/d)))(-2/3))32 assuming d is positive. d96 Simplify (((v(-2)v)/v)/(v/(v/(vvvvv/(vv*(-2/5)))v)))/((v/v*(-3/10)v)/v(-4/7)) assuming v is positive. v(-579/70) Simplify (r(-2/5)/((r(-2/3)/r)/r))/(r(rr/(rr1r))/rr)34 assuming r is positive. r(34/15) Simplify (oo*(-14/3))/oo(-1/6) assuming o is positive. o(-29/6) Simplify s*(5/4)/sss21 assuming s is positive. s(89/4) Simplify ((j((j/(((j*(-1/61)/j)/j)/j))/j)/jj)/j)/(j*(-1/19)j) assuming j is positive. j*(2398/1159) Simplify ((gg8)/g)/((g8g)/g)g*(-4)/gg(-2/13) assuming g is positive. g(-67/13) Simplify ((pp(-2/3))23)(2/29) assuming p is positive. p(46/87) Simplify l(7/6)/l(-3/13) assuming l is positive. l(109/78) Simplify p/((p/p(2/19))/p)p(-9) assuming p is positive. p(-150/19) Simplify (d(-2/23))(1/43) assuming d is positive. d*(-2/989) Simplify (aa*(3/5)aa/(a/(aa*2)))/(a/(aa*(1/4)/a)a(2/5)) assuming a is positive. a(89/20) Simplify (sss/((s(ss/((ss(1/4)s)/s))/sss)/s)ss)*22(s/s(-1/5))/(s(-2/13)/ss) assuming s is positive. s(9471/130) Simplify (y/y4)(-14) assuming y is positive. y42 Simplify q(7/3)/q(-14/9) assuming q is positive. q(35/9) Simplify t(-1/2)/ttttt/t(-1/9)tt assuming t is positive. t(83/18) Simplify (t(-4)tt)(-10/3) assuming t is positive. t(20/3) Simplify j(3/10)/j25 assuming j is positive. j(-247/10) Simplify (w(-9)/(w/((ww4)/w)))/((w(-2/11)/w)/(w*0w)) assuming w is positive. w*(-42/11) Simplify qq*6q((qq/(q/(q*4q)q))/qqq)/qq*(-5)qq(5/3) assuming q is positive. q(32/3) Simplify (cccc*(1/2)ccc)/((c/(c/((c/(cc12/cc)c)/c)cc))/c) assuming c is positive. c(43/2) Simplify (p(-1/5)/p)/p(-1/4)(p(2/3))36 assuming p is positive. p*(461/20) Simplify (pppp(-13))/(p(-13)/pp) assuming p is positive. p3 Simplify (n10nn8)/(n(-10)n(n((n2/n)/n)/n)/n) assuming n is positive. n29 Simplify g/((g/(((g/(g/g*26))/gg)/g)gg)/g)g13 assuming g is positive. g37 Simplify g(-2/11)gg(-3/5) assuming g is positive. g(12/55) Simplify a(10/3)a/(a/a(-2/7)) assuming a is positive. a(64/21) Simplify (qqq/(q/((q/(qqq*8/qq))/q)q)qq/(q/(q(-1)/qq)))(-31) assuming q is positive. q279 Simplify (((oo5)/oo)47)(14/3) assuming o is positive. o1316 Simplify ((l(-7)l)/l)/(l(l*4l)/l)l(1/5)/l(-1/6) assuming l is positive. l(-349/30) Simplify (xx39)/(x/(x(-1)/x)x) assuming x is positive. x36 Simplify (gg*(-5)gg(-3/7))(-4/5) assuming g is positive. g(96/35) Simplify ((y(1/3)yy)/y(-3))(-1) assuming y is positive. y(-16/3) Simplify ((j(-1/4)j)(3/2))(2/5) assuming j is positive. j*(9/20) Simplify ii*(-33)i/i(-16) assuming i is positive. i(-15) Simplify (d(18/13))25 assuming d is positive. d(450/13) Simplify (g(-1/2)/g(-7))(15/7) assuming g is positive. g(195/14) Simplify p(-4/5)pp(2/25) assuming p is positive. p(7/25) Simplify (hh/h14)(-12) assuming h is positive. h144 Simplify (v(-1/12)vv0)/(v(1/2)/v(-1/2)) assuming v is positive. v(-1/12) Simplify (d(-1))(2/47)(d*(1/3)d)(-39) assuming d is positive. d(-2446/47) Simplify ((kkk0)(-18/13))(-2/35) assuming k is positive. k(72/455) Simplify (m(-6/7)/m)(3/34) assuming m is positive. m(-39/238) Simplify r(-13)r*5 assumi	{ "pile_set_name": "DM Mathematics" }
-2f = -3l - 6, df - l - l = 26. Solve -fc = -c for c. 0 Suppose 4013 = 92b + 1989. Solve -b = s - 20 for s. -2 Suppose 2l - 502 = 4j, 0 = 2l - 3j - 307 - 192. Let i = l + -240. Solve ir = -4 - 6 for r. -2 Let w(q) = -3q + 3. Let x be w(0). Suppose -4c + 24 = 7k - 9k, -4c + 32 = 2k. Solve xu = cu for u. 0 Let f be (4/5)/((-2)/(-15)). Suppose 472369c = 472391c. Solve c = -h + fh for h. 0 Let t be 17 - (-1305)/(-75) - 4/(-10). Solve 51m - 48m = t for m. 0 Suppose -g - 87 = 8a - 13a, -g = 2. Suppose 3h = -9, -x = -3x + 5h + a. Solve 7w - 6w = x for w. 1 Let h be (-1071)/102(1 + 0 - (-3)/(-1)). Solve 45 - h = 4y for y. 6 Let c(k) = 21k2 + 12k + 10. Let u be c(-1). Suppose 30j = uj. Solve j = 4a - 4 for a. 1 Suppose -4m = 15m - 1330. Suppose 3t - m = -37. Solve 20 = -6y + ty for y. 4 Suppose -4j = 3n - 60, n - 7 + 101 = 5j. Let v = j + -15. Suppose -2f = vb - 12, 0 = 5b + 6f - 4f - 20. Solve -3g - b = -g for g. -2 Let z = -3121 + 3215. Solve zd = 86d - 56 for d. -7 Let z(h) = -71h*3 + 3h*2 - h - 3. Let r be z(-1). Let l be (-6 - -2)(-54)/r. Let f be 4/(-16) + 37/4. Solve 0 = -ly + 12 - f for y. 1 Suppose 3v - 2 = t, 3 = 4t - t. Suppose v = p - 2y - 1, -3y = -4p + 13. Suppose 0 = pm - 2m - 24. Solve -4 = 2c - m for c. 4 Suppose -2s - s - 8 = -5f, 0 = -4s + 16. Let o be (-1)/10 - (-505)/50. Suppose -5d + 5p = -od + 10, 0 = -d + 2p - 4. Solve 0l + 2l + f = d for l. -2 Let n = -78 + 74. Let m be (4/5)/n - (-360)/50. Suppose 3p - 8 = m. Solve 5y + 0 - p = 0 for y. 1 Let c be 9(6/2)/9. Let t be (2/(1 + 0))/((-4)/110). Let h = 56 + t. Solve h - 7 = cl for l. -2 Let u be (-672)/19220/(-7). Solve uv = 9v + 7 for v. 7 Let l(q) = 1341q - 5360. Let x be l(4). Solve -2c - x = -8 for c. 2 Suppose 0 = 3v - 19v + 64. Suppose -vu = -52 + 32. Solve 1 = 4b + u for b. -1 Let z = -1 - -1. Let y(f) = -f2 + 0f - 15f - 119 + 74. Let a be y(-10). Solve z = x - ax for x. 0 Suppose -642i + 378 = -600i. Let p = 8 - -35. Solve -16 = io - p for o. 3 Let p be (-88)/(-12) - (-1)/(-3). Suppose 5l - pl = 28. Let h(b) = b3 + 14b*2 + 2b + 33. Let r be h(l). Solve 0 = rm - 2 - 8 for m. 2 Let m(s) = 4s + 53. Let a be 7/(14/6) + (-13 - 2). Let k be m(a). Solve -kg + 4 = -7g for g. -2 Suppose 3k - 240 = -2w + 7k, -5k = -13w + 1686. Solve -8x = 108 - w for x. 3 Let c be (-17)/(-4) + (-11 - 517/(-44)). Let t(u) = u*3 + 10u*2 - 10u + 14. Let m be t(-11). Solve cd = md for d. 0 Let g = -8080 - -8093. Solve -2r = -gr + 66 for r. 6 Suppose -3b - 6 = 0, -182g + 178g + 2b + 112 = 0. Solve -11v - g - 6 = 0 for v. -3 Let w(g) be the second derivative of -5g*3/6 - 6g*2 + 19g. Let h be w(-5). Suppose -hr = -11r - 14. Solve 2s = 3 - r for s. -2 Let l(n) = -13n3 + n2. Let w be l(-2). Let t = 112 - w. Solve h + t = 8 for h. 4 Suppose -12j = -35j + 115. Let w(k) = -k*3 + 5k*2 + 3k - 5. Let r be w(j). Solve 0i = 2i + r for i. -5 Let h = 1015133 - 1015130. Let w be 4/(-6) - (-35)/3. Solve -ho - w = 4 for o. -5 Let f = 488 + -461. Let a = f - 10. Solve 13q = aq - 12 for q. 3 Let f(g) = g3 + 16g*2 - 17g + 2. Let x = 2 + -19. Let o be f(x). Let b(v) = 3v2 - 7v + 5. Let l be b(o). Solve -lz = 2z for z. 0 Suppose -25n + 6318 = -51n. Let h = n - -247. Solve g + 3 = hg for g. 1 Suppose -23 = -4q + z - 0, -z - 8 = -q. Let n be q/(100/(-15))(-16)/12. Solve 29 - n = 7d for d. 4 Suppose 0 = 3c - 11 + 2. Suppose 1 = -2o - 5y - 3, co - 8 = -4y. Let m be (-57)/(-12) - (-5 - 114/(-24)). Solve -ms + 12 = -o for s. 4 Let r be ((-15)/9)/(105/126). Suppose -d + 10 + 17 = -5v, -4d - v = -3. Let c be 10 + (-5 - r) + d. Solve -c - 7 = 4l for l. -4 Suppose -f + 3214 = -10p + 14p, -3p - f + 2412 = 0. Solve 17d = -p + 666 for d. -8 Suppose -3n - 3i + 83 = 38, -15 = 5i. Solve -o - n = -17 for o. -1 Let l(b) = 6b2 + 16b - 10. Let q be l(1). Solve -d - q = -18 for d. 6 Let h(d) = -3d2 - 10d + 1. Let u be h(-3). Suppose 0 = -4s + uj + 4, 0 = 5s - 2j - 10 - 1. Solve sr = -r + 16 for r. 4 Let j = 13 - 40. Let v be (4/(-10))/(j/(-15) + -2). Solve vk = 6 - 14 for k. -4 Let i(n) = -52n - 1142. Let l be i(-22). Solve -4 - l = -3k for k. 2 Let j be (4/(-1))/(97/(-194)). Solve j = -5r - 17 for r. -5 Let v be 660/(-36)(-30)/50. Solve 0 = vq + 8 - 19 for q. 1 Let z = 894 - 837. Solve z = -j + 51 for j. -6 Let q = -1 - -9. Suppose 4d - 16 = 0, -3d + 135 = 5f - qd. Let z = f + -27. Solve 7 = i + z for i. 3 Let l be ((-3)/(-2))/(36/264). Let c(a) = -a2 + 14a - 22. Let k be c(l). Solve 4y = ky for y. 0 Suppose -k = -3q, q + 10 - 6 = k. Suppose 0 = 38u - 40u + k. Solve ul - 25 = 8l for l. -5 Let i = 1 + 1. Let x(a) = a2 + 7a + 6. Let j = -215 + 215. Let h be x(j). Solve h = z + i for z. 4 Suppose 0 = 5s + c - 21, -s - 3c = -5s + 32. Solve -sh + 75 = 10h for h. 5 Let h = 449 + -299. Let z be h/90 + (-10)/6. Solve z = 4l - l + 3 for l. -1 Suppose 146h + 65 = 151h. Suppose -u - 36 = -hu. Solve 0t = -3t - u for t. -1 Suppose 204 = -7m + 13m. Let n = -102 - m. Let v = 139 + n. Solve 0 = vi - 9 - 6 for i. 5 Let x be -2 + -1 + (9 - 2). Let r = 3 - 2. Let d = 269 + -266. Solve dq = r - x for q. -1 Suppose 0 = 22k - 434 - 556. Suppose -5s + 125 = 5v, 3s + v - k = s. Solve sb = 17b for b. 0 Let p be (1 + 0 + -2)-3. Let l be (-1888)/(-20) + (-12)/(-20). Suppose -l = -b - 89. Solve -b = 3u - p for u. -1 Let p(r) = 6r + 1. Let j(g) = -g - 1. Let x(v) = 4j(v) + p(v). Let o be x(9). Suppose 0 = 5l - 2l - o. Solve lu + 4 = -6 for u. -2 Let j be (-1581)/(-221) - (-16)/(-104) - (1 - 8). Solve 384i - 386i = -j for i. 7 Let x = -7242 + 7266. Solve xg + 52 = 37g for g. 4 Suppose -25t + 1632 = 357. Solve -57 = ta - 6 for a. -1 Let y(p) = -p*3 - 35p*2 - 187p - 2. Let b be y(-5). Solve 27 = -35l - b for l. -6 Let x = -9121 + 9135. Solve -x = -13r + 64 for r. 6 Let n = 26 + -23. Let u be (n + -3)(3 + -4). Suppose u = -2k + 3y + 1, 4y = -5k + 6y + 8. Solve j + k = -j for j. -1 Suppose 2r + 56 = 9r. Let s = 5094 - 5091. Solve -f = -sf - r for f. -4 Let o(z) = z3 - 6z*2 + 19z - 18. Let q be o(3). Solve qr = -80 + 188 for r. 9 Let o = 31 + -20. Let b(g) = -g3 - 9g*2 - 15g + 1. Let w be b(-3). Let m = w + o. Solve 16 = -h - mh for h. -4 Let z be 5/10 + 5341/(-14). Let y = z - -386. Solve -6l = -7l - y for l. -5 Let c(n) be the third derivative of -5/24n*4 + 21n*2 - 1/120n*6 + 2/15n*5 + 0n + 0 + 1/3n3. Let t be c(7). Solve 3h - t = -h for h. 4 Let j(v) = -v*2 + 11v - 5. Let u be j(10). Suppose 100 = -0k + 4k + ua, -3a = -12. Solve -25y + ky - 10 = 0 for y. -2 Let j be (-154)/165-560/8. Solve 0 = -12d + 107 - j for d. 6 Let a(s) = -4s*2 + 9s + 11. Let k be a(3). Let f be (k/15-3)/((-5)/50). Solve 0 = fx + 4 - 16 for x. 3 Let i = 1301 + -808. Let d = -481 + i. Solve 0 = -6l + dl + 6 for l. -1 Let t be 0/22/(1 - 5). Let a be (-76)/190 - 12/(-5). Solve t = ag - 2 + 6 for g. -2 Suppose 18l + 31l = 343. Suppose 2c = -0c + 12. Suppose 15 + c = ld. Solve -dq - 12 = -6q for q. 4 Let g(z) = -11z - 51. Let q(p) = -5p - 25. Let i(s) = 2g(s) - 5q(s). Let w be i(-6). Suppose -10 = wt + 5k, 3t + 3k = 8k + 18. Solve 0 = -a + t for a. 1 Let a = -193 + 202. Let k be (6/(-10))/(a/(-90)). Solve kw - 10 = 2 for w. 2 Let l be (-1)/(-2 - (-164)/80). Let p be (((-36)/30)/(-1))/((-6)/l). Suppose 3k + 3b - 1 - 2 = 0, 2k - p = -b. Solve -ks = s + 16 for s. -4 Let h be 80/8 - -1464 - 15. Solve 9 = -hi + 1456i for i. -3 Suppose 11 = 4p + 3y, -4p - p - 3y + 13 = 0. Let w be (-153)/(-18)(-84)/(-357). Solve p = wa + 4 for a. -1 Let n = 161 + -78. Suppose 5r = 4w + 56 + n, r - 29 = 2w. Solve 0 = 5f + r - 12 for f. -3 Suppose -78f + 1007 - 851 = 0. Solve 24 = fr + 18 for r. 3 Let h(u) = -31u*3 - 4u*2 + 81u + 81. Let o be h(-1). Solve -o - 30 = 19q for q. -3 Let v be 2/(-1) + 9 + -7. Let u = 128 + -98. Suppose vq + u = 6q. Solve w = qw for w. 0 Let h be (418 - -22)/((1/1)/1). Suppose 8y - 488 = -h. Solve j + 3 - y = 0 for j. 3 Let x be (362/10)/1 + (-74)/370. Suppose -xn = -4n. Solve n = 3l - 9 + 12 for l. -1 Suppose 0 = -5b + 3o + 28, 4*b - 17 = 4	{ "pile_set_name": "DM Mathematics" }
(3/5)p(1/4)))/((pp*(-2))/pp/((ppp*10/pppp)/p))(-4/27) assuming p is positive. p(581/540) Simplify (b*(3/5)/(b/(b(b/(bbb5))/b)))(2/33)(((b(-3/2)/b)/b)/bbb(-1/4))/(b1b/(b*(-3)b)) assuming b is positive. b(-5371/660) Simplify (i(-3/31)i)(-49)(i(-11))(-9) assuming i is positive. i(1697/31) Simplify ((w/(w/w0))(-1/20))37/(w(1/10)/w(2/31)www/w(-2)((w/(w*(3/8)w))/w)/w) assuming w is positive. w*(-3299/1240) Simplify ((nn2)/n(2/5)n/(n/(n(-2)n)n)n(4/5))/(n(-2/25)/nn/n7(n(2/5))(-2/9)) assuming n is positive. n(1928/225) Simplify (((k1k)/kkkk23)(2/117))6 assuming k is positive. k(8/3) Simplify (((w/(w(-7)/w))/(w(-4/3)w))/(w1)37)/((w(w/w(-1/2))/w)(-15/7)((w4/w)/w)/(ww(-3))) assuming w is positive. w(-1195/42) Simplify (a/(aa3)a*6)/((a/(aa*0)a)/a*4)(a*(1/4)/(((a/((aa*(2/3))/a)a)/aa)/a))(21/5) assuming a is positive. a(113/20) Simplify (g16/(ggg/((g/g(-23)g)/g)g)g/(gg(5/7))gg(-7/8))37 assuming g is positive. g(73371/56) Simplify ((ff(-3/16))27f(-11)f/(f(f(-5)f)/ff))(7/2) assuming f is positive. f(1673/32) Simplify n(3/2)n*3(nn(4/9))/n(-2/5)(n/(n*(2/17)/n))/nnn/(n(-2/7)n)n(n*2nn)/nnn/n(2/5) assuming n is positive. n(30229/2142) Simplify (d1)(-4/5)d/(d/(d*(-2/13)/d))d*8(d0/d)(1/11)/(d/d1)(1/49) assuming d is positive. d(4258/715) Simplify (((q/q(-1/12)q)/(q/(q/q0)))/(q(-2/9)q)(5/8))/((q0)(5/3))(2/29) assuming q is positive. q(115/72) Simplify ((g(-1))(-20/9)/(g7/gg(-2)))/((gg*(-2/7)g)*35(g*3g)/g6) assuming g is positive. g(-538/9) Simplify ((c(c/(c/(c1/c))c)/cc)/(c((c/c*1)/cc)/c))/((c/c(1/7))/c(3/7))((c/(cc(c(4/11)/c)/cc))/(c*0c))34 assuming c is positive. c(-3449/77) Simplify ((((z(1/3))(-2/103))(-1/8))20)(-3/35) assuming z is positive. z(-1/721) Simplify aa0(aa/(a/((aaa/a(-1)aa)/a))a)/a(a(1/3))(-3)(a*(1/3)a6)/(a/a5aa(2/17)) assuming a is positive. a(776/51) Simplify ((x/(xx/x(1/3))x)/(xx(-1/8)))/(((xxx(1/5)x)/x)/x*(-3/7))(x*(6/11)((x*(4/3)x)/x)/xx)(2/67) assuming x is positive. x(-642637/206360) Simplify (n(-19)/(n/(nn/n*5))(n(1/2))(-2/57))20 assuming n is positive. n(-26240/57) Simplify ((p*(2/7)pp)(-24)(p1)22)/(p(3/7)/(p/(p/(p(-1/7)/p))pp))(3/26) assuming p is positive. p(-853/26) Simplify ((m/(m*37/m)m(mm(-11))/m)/((m/(m(-2/75)m))/(m33m)))(-22) assuming m is positive. m(18194/75) Simplify ((xx(2/19)x/((xx19)/x))/(x8xx(xx/(xx/(x/x(3/4))))/x))(-30) assuming x is positive. x(29805/38) Simplify ((i(5/3)ii)/(iiii(-5)))29/((i(ii(i/(i/((i*(-2/7)/i)/i)i))/ii)/i)(-41))(-5/18) assuming i is positive. i(7517/42) Simplify (b/b(-2/3))(-37)/(b0)(-2/31)(b(-2/3)/b(2/13))(7/3) assuming b is positive. b(-7439/117) Simplify ((t/t*(-17))/tt*(-20)/tt(tt*(-2/25))/tt(-9))(-4) assuming t is positive. t(1208/25) Simplify (u1)*(8/17)/(uu*(1/4)u)*(-3/5)(u*(-1)/(u(u*(3/5)/u)/uuu))/(u1)21 assuming u is positive. u(-1481/68) Simplify ((((www(-3/7)w)/w)/(w/(w/w*(-2/9))w))/((w/(ww6w))/((ww(1/5))/w)))/((w/w(1/3))33/(w(-1))44) assuming w is positive. w(-18272/315) Simplify ((i(5/3)/i(-1/2))/(i(5/7)/iiiii(-10)))27 assuming i is positive. i(3573/14) Simplify ((((x0)(-26))42)(-9))(-19) assuming x is positive. 1 Simplify ((u(1/6)u4/u)/(u/u(-1))*46)/(((uu/(u/(u/(u0/u))))/u)(2/5)u(-1)/(u/(u2u))) assuming u is positive. u*(-2719/30) Simplify (((mm*(-2/15)m)/m)/mm(-3/8)(m*(4/11)m)/(m/(m/m(-20))))(29/5) assuming m is positive. m(798341/6600) Simplify ((n1)(3/14)/((((n13/n)/n)/n)/(n(5/3)/n)))(-16) assuming n is positive. n(3064/21) Simplify (g1g)(-1/24)/(gg(gg*(2/3)g)/g)*32(ggg*(1/5)/gg((g5g)/gg)/g)(-9) assuming g is positive. g(-10933/60) Simplify (jj/(j/(((j*(2/3)/jj)/j)/j)))*(-1/25)/(jj*(2/5)jj(-2))((j6/j)/j(1/7))/(jj1jj(1/3)) assuming j is positive. j(199/175) Simplify (((g/((gg/(g/g4))/g))/g)(7/10)/((g*(1/12)g)/gg14))21 assuming g is positive. g(-7091/20) Simplify ((((d(-3)dd)/d)/(d/(dd(-6)/d)))/(d(-2/9)/(dd/(d/d(-8)))))/((d4)(16/7))(1/35) assuming d is positive. d(-35366/2205) Simplify ((f(-2/5)/f6)/(f/f(-6/5)f/(f/f*(-2))))/(((f/((ff/(ff(-5/4)/f))/ff))/f6)/(f(-1))50) assuming f is positive. f(-967/20) Simplify (((g(-7)/g(-2))10)(-50))(1/6) assuming g is positive. g(1250/3) Simplify ((f*(-2/15)ff(ff/(f/(f/(f38/f))))/f)/(f/f(-1/3)ff42f))(-5/11) assuming f is positive. f(1192/33) Simplify (r/r*4)/(rr*(-8))r(-2/3)/(r/r(3/4))((r/(((rr6)/r)/r))/((r/((r(1/11)/r)/rrr))/r))(-47) assuming r is positive. r(24659/132) Simplify ((((z(-2/7))47)(3/26))(-22))31 assuming z is positive. z(96162/91) Simplify (q(-16))27/(qqq*(-42)qq)28 assuming q is positive. q632 Simplify (((i(-2/5))(2/47)/((i/(ii(4/5)))/(i/i3i)))19)(-1/4) assuming i is positive. i(969/940) Simplify ((y(-2))(1/2))18((yy/(yy/y(-6/5)))/y(-2/11))/(y*(-1)yyy*(-4/3)/yy) assuming y is positive. y(-3083/165) Simplify (((i8i/(i/i(-3))i)/(i*(-1)/((ii8)/i)))(1/5))(-41) assuming i is positive. i(-123) Simplify ((zz7)/z(4/9))43(z5/z(-7))32 assuming z is positive. z(6380/9) Simplify (((t*(-1/8)t(-2)/t)16)9)16 assuming t is positive. t(-7200) Simplify (z(-4)zz(-4))/(z(-2)/(zzz/(z/(zzzz8z))))(((zzz/(zz/(z/z*(3/4))z))/zz)/z(-5/3))(2/27) assuming z is positive. z(1481/162) Simplify (n/n(-6/7)nnn(-5))(-34)(n2/n(1/2))/(n(-4/7)/nn/(((n*2n)/n)/nn)) assuming n is positive. n(601/14) Simplify (((s(1/25)(((s/(ss(-1/15)))/s)/s)/s)/(s(-11)/((sss(-6))/s)))35)(-7/5) assuming s is positive. s(-11417/75) Simplify (((n(-4)/n(-3/2))/((n(4/5)/nn)/nn(-1/2)))(-35))(-4/15) assuming n is positive. n(-84/5) Simplify (z(-10)/(z/(z/z(1/3))z))*15((z/z*0)/zz)*21/((zz(4/9))/(z/(z/z(3/4)zz)z)) assuming z is positive. z(-5425/36) Simplify (c(-4)cc)/(c(2/13)c)(c/(c6c))/c*(2/17)((c/c*(4/5))/(cccc(-3/5)))(1/3) assuming c is positive. c*(-33166/3315) Simplify ((cc2/c)(2/17))(1/22)/((c/(c/c(2/9)))30)(3/10) assuming c is positive. c*(-372/187) Simplify ((mm(-8))/(m(-7)mm)m(-1/4)m(1/5))/((m(2/7))(-23))16 assuming m is positive. m*(14433/140) Simplify (((ttt/(tt/(t*(2/9)t)))(-8/13)/(t(-1/3))(-27))(-3/14))(1/36) assuming t is positive. t(1213/19656) Simplify (((q*(-2/31)q)/qq)/(q/(qq*9q))(qq*(1/5)q)4)43 assuming q is positive. q(131537/155) Simplify (((r(-2/9)/r)/r)35)(2/31)/(((((((r*(-8)/r)/rr)/r)/r)/r)/r)/(r/(r/r*6))rrr/r*8r(-4)) assuming r is positive. r(6412/279) Simplify ((x(xx/(x/(x/x(-1))))/x)(-2/7))(-2/97)/((x0x)/(x(x*(-4/7)x)/xx)x/x*(-1/11)x(x(-5)x)/x) assuming x is positive. x(25061/7469) Simplify (((t/t(-3)tt)/t)*(-25)t*1/(t/(tt/(tt(-2/13)))))(10/7) assuming t is positive. t(-2300/13) Simplify ((s(-1)/s)/s)(2/39)/(s(-4)/(s(1/3)/ss))(s(-3/5)/(s/(ss*(-5))))/(ss(1/3))(-18) assuming s is positive. s*(4403/195) Simplify ((i/((ii*(-1/11)ii)/ii))*(-11)/(i(i/i*(10/9))/iiiiiiii*(-2)ii))(-2/5) assuming i is positive. i(-272/45) Simplify (((f/(ff(-1/2)))/f5)/((f/(ff(-4/9))ff)/fff(-1/10)/fff))/(((ff0)/f)(-6/7))(-27) assuming f is positive. f(-353/45) Simplify (((h*(2/11)/h)/(hh(hh*13h)/hhh))/(hh(-2))12)37 assuming h is positive. h(-2775/11) Simplify ((d/(d/(d/d(1/5))))/(d/d(1/6)))/((dd0)/d(-1/2))((d/(d/(d4/ddd)d))(-8))41 assuming d is positive. d(-19703/15) Simplify ((a(8/9))*(-31)(a/a*(1/59))/(aa*(9/5)/aaa))12 assuming a is positive. a(-322556/885) Simplify (((q(-1)/q)19q*(2/11)q	{ "pile_set_name": "DM Mathematics" }
))). -sqrt(2)/12 Simplify -2 + (((sqrt(88) - -2sqrt(88)) + sqrt(88))5)/sqrt(8). -2 + 20sqrt(11) Simplify (-4-1sqrt(15))/sqrt(5)4. 16sqrt(3) Simplify (sqrt(360)/sqrt(250))/(sqrt(432)2). sqrt(3)/60 Simplify (sqrt(1539) + (sqrt(1539) - (sqrt(1539) + 2 + -2)))*2. 1539 Simplify 5sqrt(52) - (sqrt(13) + 0 + -5). 5 + 9sqrt(13) Simplify 3 + ((-2sqrt(459))/sqrt(9))/((sqrt(3) + sqrt(3) + sqrt(12))6). -sqrt(17)/12 + 3 Simplify ((3(sqrt(49) + sqrt(441)) - sqrt(49))/sqrt(7))*2. 847 Simplify (1 + sqrt(3) + (-4 + sqrt(3))3 + sqrt(3))*2. -110sqrt(3) + 196 Simplify (5(4 + (sqrt(7) - 1sqrt(7))) + 1)*2. 441 Simplify (-1(sqrt(52) + -1sqrt(52)))/((sqrt(64) - (1sqrt(64) - sqrt(64) - sqrt(64))) + sqrt(64) + sqrt(64)). 0 Simplify -2(sqrt(68) + -1sqrt(68))*2 - -3(sqrt(17) + (sqrt(17) + 0)*2 + 0). 3sqrt(17) + 51 Simplify -3 + (3sqrt(624))/sqrt(12). -3 + 6sqrt(13) Simplify (sqrt(75) - (sqrt(75) + 0))-5. 0 Simplify (sqrt(72) + 1sqrt(72) - sqrt(18))/((sqrt(60)/sqrt(2))/sqrt(5)). 3sqrt(3) Simplify (sqrt(81)/sqrt(3) - sqrt(27))2 + sqrt(18)/sqrt(96) + 2. sqrt(3)/4 + 2 Simplify -5 + (sqrt(55)/(sqrt(5) + sqrt(45)) - sqrt(11) - sqrt(11)). -7sqrt(11)/4 - 5 Simplify ((sqrt(1100) + 4sqrt(1100))1)*2. 27500 Simplify sqrt(100)/sqrt(5)-1. -2sqrt(5) Simplify (sqrt(70) + 5(sqrt(70) + sqrt(70)2 - sqrt(70)))/(sqrt(20)/sqrt(2)1). 11sqrt(7) Simplify sqrt(24)/sqrt(128) - ((-2sqrt(300))*2 - sqrt(300)). -1200 + 41sqrt(3)/4 Simplify ((sqrt(95) - sqrt(95)1)-5)/sqrt(5). 0 Simplify 5 + ((sqrt(34) + sqrt(136))/sqrt(2))*24. 617 Simplify 4 + (sqrt(343) - ((3sqrt(343)1)*2 + sqrt(343))) + sqrt(343). -3083 + 7sqrt(7) Simplify -4(1 + sqrt(405))25. -8120 - 360sqrt(5) Simplify (3-2sqrt(539) - (1 + sqrt(539) + -2))2. -98sqrt(11) + 26412 Simplify -1(1 + sqrt(363)) + sqrt(363) + (sqrt(363) + 0 + -2)2 + sqrt(363). -33sqrt(3) + 366 Simplify (sqrt(200)2 + sqrt(200))2-1 + sqrt(16)/(sqrt(80)/(sqrt(30)/sqrt(3))). -1800 + sqrt(2) Simplify (sqrt(110)/(2sqrt(160)))2. 11/64 Simplify (sqrt(102)/sqrt(6)-2 + 5)*2-6. -558 + 120sqrt(17) Simplify (1sqrt(1872)-6)2 + -3sqrt(832)2. -48sqrt(13) + 67392 Simplify 5-1sqrt(98) - -5(3sqrt(98))*2. -35sqrt(2) + 4410 Simplify (sqrt(315) - sqrt(315)1)/(sqrt(112)-4 - sqrt(7)). 0 Simplify -4(-5(0 + sqrt(833)) - sqrt(833)). 168sqrt(17) Simplify (sqrt(364)/sqrt(7) - (sqrt(117) + -1 - sqrt(13)))2. 1 Simplify (1 + sqrt(272) + -2)2 - sqrt(272)23. -32sqrt(17) + 273 Simplify 2sqrt(2) + 0 + -2. -2 + 2sqrt(2) Simplify (sqrt(132) + sqrt(132) + -5sqrt(132)1 + sqrt(132))/(1sqrt(768)). -sqrt(11)/4 Simplify (-2sqrt(117)-2 - sqrt(117))/(sqrt(54)/(sqrt(6)-1)). -3sqrt(13) Simplify -43(sqrt(1300)-2 + sqrt(1300) - sqrt(156)/(sqrt(36)/sqrt(3))). 132sqrt(13) Simplify sqrt(18)/(-4(sqrt(6) - sqrt(96))). sqrt(3)/12 Simplify sqrt(121)/sqrt(176) + ((sqrt(44) + (sqrt(88)/sqrt(2) - sqrt(44)))/sqrt(4) - sqrt(88)/(sqrt(24)/sqrt(3))). sqrt(11)/4 Simplify -2(sqrt(1377) - (sqrt(1377)1 - sqrt(1377)))6. -108sqrt(17) Simplify (sqrt(165)/(sqrt(5)-3))/sqrt(3) + 2. -sqrt(11)/3 + 2 Simplify (sqrt(35)-11)/(sqrt(14)/sqrt(32)). -4sqrt(5) Simplify sqrt(44)/(sqrt(28)/(sqrt(35)/sqrt(5))). sqrt(11) Simplify (sqrt(34)/sqrt(2) + -1 - sqrt(119)/sqrt(175))*2. -8sqrt(17)/5 + 297/25 Simplify (sqrt(187) + sqrt(187)2-4)/(-6((sqrt(11) - sqrt(33)/sqrt(3)) + sqrt(11))). 7sqrt(17)/6 Simplify -3(sqrt(1216) + 0 + -3)2. -3675 + 144sqrt(19) Simplify sqrt(176) - (sqrt(176)1 + -4 - sqrt(176)). 4 + 4sqrt(11) Simplify -2sqrt(3)-6 + (-1 + sqrt(48))*2. 4sqrt(3) + 49 Simplify (3sqrt(95)3)/(sqrt(5) + sqrt(125) + -1sqrt(125)). 9sqrt(19) Simplify sqrt(720) + -2sqrt(720) + -3 + -1. -12sqrt(5) - 4 Simplify sqrt(204)/(1sqrt(1200)) - -4(sqrt(1700) + sqrt(1700)-1). sqrt(17)/10 Simplify (sqrt(190)/(sqrt(10) + sqrt(10)1))*2 + (-3-2sqrt(19))2. 2755/4 Simplify (-3sqrt(931) + sqrt(19))*2-4. -30400 Simplify -5(4 + -1sqrt(68)/sqrt(4)). -20 + 5sqrt(17) Simplify ((-1sqrt(34)/sqrt(2))2 - sqrt(68)/sqrt(64)) + -4. -sqrt(17)/4 + 13 Simplify (sqrt(14)/((sqrt(32)/sqrt(8))/sqrt(2)))2. 7 Simplify -4(sqrt(567) - sqrt(567)-1)-4. 288sqrt(7) Simplify (sqrt(6897)2)/(sqrt(48)4). 11sqrt(19)/8 Simplify -2 + ((-2sqrt(204))/sqrt(12))2. 66 Simplify (-5 + 3 + 0 + sqrt(2299))2. -44sqrt(19) + 2303 Simplify (4(sqrt(1053) + (sqrt(1053) + 1)3))2. 3456sqrt(13) + 269712 Simplify (4(0 + sqrt(2448) + 0))2. 39168 Simplify (-2 + sqrt(108) + sqrt(3) - 3sqrt(12)/sqrt(4))*2. -16sqrt(3) + 52 Simplify ((sqrt(171) + -1sqrt(171)-6 + sqrt(171) + sqrt(171)-2 + sqrt(171) + sqrt(171) + 5)-3)*2. 2160sqrt(19) + 98721 Simplify (sqrt(300)26 + sqrt(300))*2. 50700 Simplify -6(-2sqrt(672))/(sqrt(6) - (sqrt(72) - (sqrt(72) - 2sqrt(72)))/sqrt(12)). -48sqrt(7) Simplify ((sqrt(68) + sqrt(68) + (-2sqrt(68) + sqrt(68) - sqrt(68)) - sqrt(68))-5)/(sqrt(4) - (sqrt(4) + (-3sqrt(16) - sqrt(16))/sqrt(4)) - sqrt(4)). 5sqrt(17)/3 Simplify (sqrt(704) + 1(sqrt(704) + -2) + -4 + (-2sqrt(704) - sqrt(704)) + sqrt(704))2. 36 Simplify -6(sqrt(4)/sqrt(18))*26. -8 Simplify (((4(sqrt(136) - sqrt(136)-2) - sqrt(136)) + sqrt(136) - sqrt(136))/sqrt(8))*2. 2057 Simplify -1(3(1 + sqrt(13)) - sqrt(13) - sqrt(13)) - ((sqrt(52)/sqrt(4))2 + -2 + sqrt(13) + -1). -13 - 2sqrt(13) Simplify sqrt(15)/sqrt(3) + -5 + -2(sqrt(5) + 0). -5 - sqrt(5) Simplify -5 + (sqrt(6) + sqrt(30)/(sqrt(20)/sqrt(4)))/sqrt(3). -5 + 2sqrt(2) Simplify (sqrt(432) + 0)*2 + -4. 428 Simplify 1(-1sqrt(1100)-2)*2. 4400 Simplify sqrt(228)/(-1sqrt(768)). -sqrt(19)/8 Simplify (sqrt(12)-2-4)/(-1sqrt(216)). -4sqrt(2)/3 Simplify (31sqrt(171) - sqrt(171))/(sqrt(9) + sqrt(972)/sqrt(3)). 2sqrt(19)/7 Simplify -2(sqrt(152)/(1sqrt(8)) + sqrt(19)). -4sqrt(19) Simplify (sqrt(20) + -1 + sqrt(1280))*2 + -5. -36sqrt(5) + 1616 Simplify ((2sqrt(80))/sqrt(4))/sqrt(4). 2sqrt(5) Simplify (sqrt(77) - (sqrt(77) + sqrt(77) + sqrt(77)-1 + sqrt(77))6)/sqrt(11). -11sqrt(7) Simplify (sqrt(88)/sqrt(11))2 + sqrt(6)/(sqrt(9)/sqrt(3) + sqrt(3)) + -4(sqrt(4)/sqrt(2)-6)2. -280 + sqrt(2)/2 Simplify ((sqrt(121)/(sqrt(33)/sqrt(3)) + 4)-1)*2. 8sqrt(11) + 27 Simplify sqrt(1800) + -2 + 3. 1 + 30sqrt(2) Simplify sqrt(2205) + 2 + sqrt(2205) + sqrt(2205) + -2. 63sqrt(5) Simplify (sqrt(1331) + 3)5 + -4. 11 + 55sqrt(11) Simplify 4 + (sqrt(300) + 1sqrt(300))-5 + (0 + sqrt(300) + 0)*2. -100sqrt(3) + 304 Simplify (-2 + sqrt(320) + -4)*2. -96sqrt(5) + 356 Simplify -3sqrt(15)/(2sqrt(5)). -3sqrt(3)/2 Simplify (1(3 + sqrt(10)/sqrt(2) - (-3 + -1sqrt(5))))2. 24sqrt(5) + 56 Simplify sqrt(3) - sqrt(432) - (3(-1 + sqrt(3)) - sqrt(3))2. -21 + sqrt(3) Simplify (3 + sqrt(13)-3 + 4)*2. -42sqrt(13) + 166 Simplify (sqrt(99) - (sqrt(99) + -1(sqrt(99) - -2sqrt(99))))/sqrt(9). 3sqrt(11) Simplify (-6((2 + sqrt(1872))5 + sqrt(1872) - sqrt(1872)))2-6. -10130400 - 259200sqrt(13) Simplify (5(sqrt(114) - -2sqrt(114)))/sqrt(6). 15sqrt(19) Simplify -2(-1 + sqrt(7))-5. -10 + 10sqrt(7) Simplify (sqrt(128) - ((sqrt(128) - (sqrt(128) + -2))2 + sqrt(128))) + sqrt(128) - -3sqrt(32). -4 + 20sqrt(2) Simplify -4 + (sqrt(605) + 3 + sqrt(605) + sqrt(5))2. 138sqrt(5) + 2650 Simplify (sqrt(4900) - (sqrt(4900) + sqrt(4900) + 1sqrt(4900)))/(sqrt(35)/sqrt(5)5). -4sqrt(7) Simplify sqrt(3) - (1sqrt(27))/sqrt(9) - (1 + sqrt(108)). -6sqrt(3) - 1 Simplify (sqrt(63)/(sqrt(9) + sqrt(18)/sqrt(2)) - sqrt(49)/(-2sqrt(7))) + (sqrt(56)/(-6(sqrt(8) + (sqrt(24)/sqrt(3) - sqrt(8)))))2. 7/36 + sqrt(7) Simplify -1(sqrt(304) + -2 - sqrt(19)). -3sqrt(19) + 2 Simplify (sqrt(136)-4)/sqrt(8) - sqrt(34)/(sqrt(72) - sqrt(2)). -21sqrt(17)/5 Simplify -6(sqrt(12) + -3 + -2 + 3). -12sqrt(3) + 12 Simplify ((2 + sqrt(275))-6 + sqrt(275) - (-1sqrt(275) + sqrt(275) + 4))2. 800sqrt(11) + 7131 Simplify ((sqrt(143)/(sqrt(33)/sqrt(3)) - (sqrt(13) + -1 + -2 - sqrt(13)))5 + 3)2. 180sqrt(13) + 649 Simplify ((sqrt(256) + sqrt(256)-1)-6)/sqrt(8). 0 Simplify ((sqrt(280)/(-5sqrt(8)))/sqrt(7))2. 1/5 Simplify sqrt(125)2 + 2. 2 + 10sqrt(5) Simplify (sqrt(308)/sqrt(44))/sqrt(4). sqrt(7)/2 Simplify ((3 + sqrt(125) - sqrt(125))2 - sqrt(125) - sqrt(125)) + -4. -10sqrt(5) + 5 Simplify 1*sq	{ "pile_set_name": "DM Mathematics" }
- 5x + 5x. Let f be w(2). Let m(s) = 8s - fs + 4s. Let n(j) = 13j*2. Give m(n(i)). 13i*2 Let z(r) = -3515r*2. Let f(h) = 231h - 22. Calculate f(z(o)). -811965o2 - 22 Let f be 233 + (8/(-10))/((-17)/(-85)). Let w(s) = -f - 237 + 466 - s. Let p(m) = 28m. What is p(w(a))? -28a Let l(y) = -42 - 2y - 99y2 + 5y + 45. Let n(o) = 2080o2 - 64o - 64. Let w(q) = -64l(q) - 3n(q). Let f(v) = v. Calculate w(f(c)). 96c2 Let w(f) = -31f*2 - 5f + 3f + 2f. Let p(d) = 9d + 8542 - 8542. Calculate p(w(l)). -279l*2 Let b(g) = -4g + 36. Let z(s) be the second derivative of 1/3s3 + 0s*2 + 0 - 215s. What is z(b(d))? -8d + 72 Let u be ((-75)/(-10))/((-132)/(-88)). Let b(h) be the third derivative of 1/30h*u + 0 + 0h + 0h3 + 0h*4 + 5h*2. Let j(n) = 9n. What is b(j(x))? 162x2 Let s(f) be the third derivative of f5/60 - 7990f*2. Let o(y) = 57y*2 - 9y*2 - 5y*2. Determine s(o(p)). 1849p*4 Let m(t) = -3t + 1. Let p(c) be the third derivative of c*5/20 + 1542c*2. Determine p(m(s)). 27s*2 - 18s + 3 Let l(d) = -187d2. Suppose w - 23 = 2g - 30, 2w - 3g + 11 = 0. Let c(x) = 2x + 1. Let y(s) = -8s - 3. Let v(k) = wy(k) - 3c(k). Calculate v(l(z)). -374z2 Let y(h) = 15h*2 - 5h - 5. Let i(r) = 46r2 - 16r - 16. Let d(w) = 5i(w) - 16y(w). Let z(b) be the first derivative of -b*2/2 + 757. What is d(z(s))? -10s*2 Let o(l) = -4l + 78692. Let w(b) = 4b + 27. Calculate o(w(i)). -16i + 78584 Let x(v) = 3v + 1. Let l(z) = -4347z*2 - 1. Calculate x(l(u)). -13041u*2 - 2 Let o(j) = 1460j + 3. Let l(w) = 1695w. Give o(l(s)). 2474700s + 3 Let p(x) = -x*2. Let w(y) = -1386y*2 - 3864y. Let r(n) = 2n2 - 23n. Let t(v) = -168r(v) + w(v). What is p(t(u))? -2965284u*4 Let i(a) = -28a + 65. Let t be i(2). Let d(b) = tb + 4b + 5b - 21b. Let j(m) = 24m. Determine j(d(w)). -72w Let f(h) = h*2 - 5h. Let r be f(6). Let n(w) = -w - w - 2w + rw. Let b(u) = -4606 + 9218 - 4612 - 28u2. Calculate b(n(i)). -112i2 Let j(b) = -b2 + 25b2 - 25b*2. Let c(x) = -7x + 2. Let v(k) = -6k + 1. Suppose 5i - 9 = 8i. Let m(p) = ic(p) + 4v(p). Determine j(m(f)). -9f*2 - 12f - 4 Let u(z) = -2746z. Let p(k) = -2k*2 - 8k + 2. Let v(d) = 4d2 + 20d - 5. Let s(i) = -5p(i) - 2v(i). Determine s(u(c)). 15081032c2 Let j(q) = -2q. Let p(h) = 7309h + 6888h + 2317h. Determine j(p(a)). -33028a Let z(k) be the second derivative of 5k3/2 + 40k - 4. Let p(r) = r*2 - 2r*2 + 4r*2. What is p(z(c))? 675c*2 Let g(h) = -14h*2 - 3. Let o(u) = -15542u. Give o(g(k)). 217588k2 + 46626 Suppose -w + 4c = -200, 5w + 14c = 15c + 1095. Let f(q) = -wq + 4q2 + q2 + 220q. Let n(p) = p. Give f(n(r)). 5r2 Let d(i) = 3i*2 + 2i - 399. Let l(j) = 208j + 23. Let a(p) = -36p - 4. Let f(t) = -23a(t) - 4l(t). Give d(f(b)). 48b2 - 8b - 399 Suppose -3a + 12 = 6. Let i(w) = 73w*a - 20w*2 - 25w*2 - 21w*2. Let g(n) = 0n + 3n - 3n - n*2. Calculate g(i(l)). -49l4 Let b(k) be the first derivative of -k2/2 - 8k - 218. Let y(g) = 112g - 33. Let i(z) = 4b(z) - y(z). Let f(j) = -2j. Determine i(f(n)). 232n + 1 Let w(i) = -24i*2 - 34i*2 - 28i*2 + 84i*2. Let g(k) = -2k + 269. What is g(w(o))? 4o2 + 269 Let v(c) = -c. Let d(i) = -i - 1350231. What is v(d(t))? t + 1350231 Let j(u) be the third derivative of -u5/60 + 1450u*2. Let q(y) = 26y + 24. Give j(q(h)). -676h2 - 1248h - 576 Let o(l) = -4l2 + 6l + 6. Let a(n) = n*2 - n - 1. Let h(t) = 6a(t) + o(t). Let i(j) = 714j - 2. Calculate i(h(g)). 1428g*2 - 2 Let p(m) = -16m. Let g(h) = -32h2 - 12. Let u(a) be the third derivative of -13a*5/60 - 5a*3/6 + 3a*2. Let o(i) = 5g(i) - 12u(i). Calculate o(p(r)). -1024r*2 Let r(t) = -2t*2. Let h(w) = -1379w - 55. Calculate h(r(u)). 2758u2 - 55 Let y(l) = -20l. Let b(q) = -4q. Let u(j) = 28b(j) - 6y(j). Let p(s) = -8s*2. Calculate p(u(v)). -512v*2 Let b(z) = 88z + 121. Let v(a) be the second derivative of a*3/2 + 2a*2 + 8a + 3. Let k(m) = 4b(m) - 121v(m). Let d(r) = 3r. Calculate k(d(j)). -33j Let w(x) = 21984x - 43994x + 21997x. Let f(k) = -11k - 45. Give f(w(h)). 143h - 45 Let f(y) = -18y*2. Let u(j) = -127j + 70. Let q(r) = 1820r - 1001. Let d(m) = 10q(m) + 143u(m). What is f(d(k))? -27378k*2 Let c(b) be the second derivative of -33b + 0b2 + 0 - 1/3b*3. Let s(z) = -13z*2 + 1. What is s(c(a))? -52a*2 + 1 Let y(n) = -2n. Let d(j) = 409 - 810 + 1352j + 401. What is d(y(t))? -2704t Let h(i) = 20i2 - 695. Let t(x) = -4x + 120. Calculate h(t(j)). 320j2 - 19200j + 287305 Let o(q) = 16q + 4. Let v(d) = 89777d - 1. Give o(v(m)). 1436432m - 12 Let j(m) = 555m. Let r(w) = -178w2. Determine r(j(i)). -54828450i*2 Let m(h) = 7h + 1. Let g(p) = -32041p. Determine m(g(v)). -224287v + 1 Let q(f) = -211025f + 4. Let y(o) = -o. Determine y(q(d)). 211025d - 4 Let w(d) = 2d. Let q(s) be the second derivative of -31s + 4s2 + 13/6s*3 + 1. What is q(w(t))? 26t + 8 Let u(v) = 7v. Suppose -3l = -f + 2f - 26, -4l + f = -23. Suppose -l + 5 = -t. Let n(s) = 2s + ts - 2s - 4s. Give n(u(o)). -14o Let m(h) be the second derivative of 7h*4/6 + 1145h. Let r(k) = -3k + 4. Let z(s) = -5s + 7. Let a(y) = 7r(y) - 4z(y). Give m(a(j)). 14j2 Let m(y) = -3y*2 - y. Let u(s) = -91s*2 - 28s. Let l(p) = 28m(p) - u(p). Let t(a) = 9a + 14a - a + 5a. Determine l(t(d)). 5103d2 Let q(u) = -2 - 2u + 2. Let z(d) be the second derivative of -d*3 + 6d*3 - 3d*3 - 10 + d + 5d + 3d3. Determine z(q(x)). -60x Suppose 101 + 29 = v. Let y = v - 57. Let s(x) = -y + 2x + 73. Let p(k) = -10k*2. Give p(s(b)). -40b*2 Let c(n) = -423n - 2. Let z(d) = 2554d + 13. Let j(w) = -13c(w) - 2z(w). Let x(p) = -p2. Give j(x(b)). -391b*2 Let z(x) be the first derivative of -926x*2 + 6502. Let k(s) = -4s. Determine z(k(a)). 7408a Let n(d) = -374d2. Let j(i) be the first derivative of -i3 + 2132. What is n(j(g))? -3366g4 Let b(z) = 230z. Let j(h) = -199h - 203h - 206h + 612h. What is j(b(i))? 920i Let a(t) = -3t*2. Let p(c) = -2c*3 - 12c*2 - 2c - 1. Let o be p(-6). Let m(l) = 10l + 11l - 7l - ol. Calculate m(a(s)). -9s2 Let o(k) = 15k*2 - 88k. Let q(h) = -h - 989. Determine o(q(w)). 15w2 + 29758w + 14758847 Let r(l) = -l + 1. Let j(k) = 10k - 7. Suppose -19 = 2n - 5f, -7n + 4n + 4 = -f. Let t(v) = nj(v) + 21r(v). Let q(d) = 10d. Calculate t(q(o)). 90o Let x(v) be the first derivative of -v2 + 1. Let y be (4/(-10))/((-27)/(-15) + -2). Let q(z) = 990z*2 + 983z*y - 1967z*2. Determine q(x(u)). 24u*2 Let b(o) = 7838o*2. Let v(a) = -10a*2 + 28a - 7. Let r(l) = -3l2 + 8l - 2. Let z(u) = -7r(u) + 2v(u). What is b(z(y))? 7838y4 Let n(b) = 18b*2. Let p = -91 + 93. Let a(x) be the first derivative of 3x*2 + 42 - 4x*p - 76. Determine a(n(f)). -36f*2 Let k(j) = 315j. Let c(f) = 247416f2 - 123706f*2 - 123707f*2. Give k(c(h)). 945h2 Let x(l) = l2. Let p(w) = -4w - 5. Let j(n) = -2n. Let k(z) = 3j(z) - p(z). Let h(m) = -m + 3. Let f(a) = 5h(a) - 2k(a). What is x(f(i))? i2 - 10i + 25 Let n(f) = -6f + 9f + 9f. Let c(z) = -13z. Let i(w) be the first derivative of 3w2 + 17. Let y(t) = -4c(t) - 9i(t). Calculate n(y(r)). -24r Let o(w) = 2w2. Suppose -30 = 20p - 21p - a, 0 = -p + 4a + 45. Let z(h) = -117h + ph + 114h + 130h. What is o(z(f))? 51200f2 Let m(d) = -4d*2. Let k(o) = -124274920o. Determine k(m(f)). 497099680f2 Let c(r) = 3r. Let s(x) be the second derivative of -x5/10 + x4/24 - x*3/2 + 11x*2/2 - 7x. Let b(k) be the second derivative of s(k). What is c(b(z))? -36z + 3 Let s(t) = -7t*2. Let a(k) = -47553800k. Calculate a(s(r)). 332876600r2 Let s(o) be the first derivative of o2/2 + 8105. Let d(y) = -391y*2. Calculate s(d(g)). -391g*2 Let s(v) = 78v*2 - 4v + 105v2 + 4v - 123v2. Let n(z) = -5z - 3. Determine s(n(j)). 1500j2 + 1800j + 540 Let y(l) = -5924l2. Let z(b) = 858b. Calculate z(y(s)). -5082792s2 Let j(n) = -229n + 3555. Let r(q) = -q. What is r(j(v))? 229v - 3555 Let m(c) = 2c**2. Let t(d) = 4 +	{ "pile_set_name": "DM Mathematics" }
2. Let o(a) = 11a - 6. Let l(g) = -6b(g) - 65o(g). What is l(t(w))? -5w Let p(q) = 2q*2. Let a(t) = -20209t*2. Determine a(p(g)). -80836g*4 Suppose 0p - 5 = -p. Let n(z) = -2 + pz2 + 2. Let w(t) = -2t + 8360 - 8360. Determine w(n(l)). -10l2 Let m(i) = 30i. Let c(d) = -21 - 8d + 64 - 20 - 23. What is m(c(s))? -240s Let h(u) = -6u2. Let j(r) be the second derivative of 7r*4/6 + 88r. Give j(h(l)). 504l4 Let g be -2 - 23/(207/(-36)). Let y(n) be the first derivative of 0n + 13 + 1/2ng. Let r(z) = 7z*2. Calculate r(y(h)). 7h*2 Let u(j) = -2018j + 31. Let d(o) = 21o. Give d(u(x)). -42378x + 651 Let b(x) = 2x2. Let q(n) = -n - 20054. Calculate q(b(u)). -2u*2 - 20054 Let a(l) = 416411l. Let k(h) = -9h. Determine a(k(f)). -3747699f Let j(s) = 2s2. Let x(t) = t2 - 11260t - 15. Determine x(j(c)). 4c4 - 22520c*2 - 15 Let z(d) = 118d - 86. Let a(m) = -2m. Determine a(z(k)). -236k + 172 Let m(x) = -6x2. Let j(r) = 2r*2 + 10r. Let w(f) = 3f. Let y(a) = 2a. Let h(o) = -5w(o) + 7y(o). Let u(s) = 10h(s) + j(s). Give u(m(p)). 72p*4 Let a(k) = 9k*2. Let q(n) be the first derivative of -7n*2/2 + 167. Give q(a(i)). -63i*2 Suppose p = -p + 4. Let h(k) = 148k*2 - 311k*p + 147k2. Let j(f) = f2. Give j(h(b)). 256b4 Let j(z) = 26z*2. Suppose -96m + 111m - 30 = 0. Let d(y) be the first derivative of -7 + 0y - 1/2ym. Give j(d(u)). 26u*2 Let w(z) be the first derivative of -3z*2 - 224. Let g(x) = -4x + 5x + 3x. Calculate g(w(o)). -24o Let r(s) = 2496171s*2. Let u(y) = -2y*2. Determine r(u(q)). 9984684q*4 Let g(l) = -2l. Let m be (3 + -15)2/(-8). Let u(j) = 5j - mj - j. Let c(w) = -3w. Let a(n) = 4c(n) + 9u(n). Calculate g(a(v)). 6v Let t(q) = 522004q*2. Let n(u) = -2u. Determine n(t(c)). -1044008c2 Let v(i) = i. Let q(j) = -123j*2 - j - 3j + 4j. What is q(v(f))? -123f*2 Suppose -4g = 5u - 3, 4u + 9 = 4g + 3u. Let d(v) = v + v - gv - 7v. Let q(t) = -3t2. What is q(d(i))? -147i*2 Let h be (-2)/(-6) + 118/6. Let k = h + -11. Let f(v) = v - 3 + k - 6. Let m(t) = -6t*2. Give m(f(z)). -6z*2 Let i(o) = -19o. Let m(n) = 24n. Let r(b) = -5i(b) - 4m(b). Let k(z) = -351z. Calculate r(k(a)). 351a Let o(f) = f. Let t(a) = -9a. Let y(m) = -m - 3m - 2m + 4m. Let h(x) = 4t(x) - 22y(x). Give o(h(b)). 8b Let v(r) be the second derivative of 0r3 - 5/12r*4 - 27r + 0r2 + 0. Let g(k) be the second derivative of k4/4 - k. Give v(g(o)). -45o*4 Let z(i) be the third derivative of -5i*4/6 + 255i*2. Let f(d) = -10d*2. What is f(z(r))? -4000r*2 Let u(v) = 3088v*2. Let s(k) = 8k*2. Determine s(u(b)). 76285952b*4 Let u(s) = -26s. Let c(v) be the first derivative of v*5/120 + 5v*3/3 + 9. Let m(n) be the third derivative of c(n). Calculate m(u(j)). -26j Let m(i) = -2i2 - 1 + 1. Suppose -5l = -2n, 8 = l + n + 1. Let c(w) = -lw*2 - 78w - w*2 + 78w. Determine c(m(s)). -12s4 Let c be (0 - 1)/(4/(4 + -8)). Let k(x) = -17 + x + 4 - c. Let r(h) = -2h. Give r(k(t)). -2t + 28 Let j(t) = -t - 1. Let a(b) = -4 + 0 + 5b + 7 - b. Let c(h) = a(h) + 3j(h). Let v(w) = 10w. Calculate c(v(i)). 10i Let f(s) = s. Let m be (-8 - 4) + 4 - -8. Let q(t) be the third derivative of 0t + 0 + 0t4 + 1/30t*5 - 3t*2 + mt*3. Determine q(f(k)). 2k*2 Let i(d) = 24d - 12. Let a(m) = m. Let w(b) = -54a(b) + 2i(b). Let s(v) = -2v. What is w(s(c))? 12c - 24 Let q(w) = -126w2. Let d(g) = 24g - 1. Give q(d(j)). -72576j2 + 6048j - 126 Let t(a) = -21a - 19a + 9 - 9. Let c(g) = 9g. Calculate c(t(x)). -360x Let p(b) = 1566b2 + 1. Let d(w) = 10w. What is p(d(n))? 156600n2 + 1 Let s(q) = 54q. Let o(k) = -k*2 + 4k + 23. Let b be o(7). Let h(r) = -21r + 2r*b + 21r. Give h(s(x)). 5832x2 Let n(v) = 3v + 18. Let x(l) = 3l + 15. Let z(q) = 5n(q) - 6x(q). Let o(a) = -45a. Calculate o(z(y)). 135y Let k(j) be the third derivative of j4/24 + 69j*2. Let m(w) = -2w + 2. Calculate k(m(t)). -2t + 2 Let z(f) = 12134 + 12139 - 24273 + 3f. Let d(c) = -18c. Let t(a) = -a. Let k(o) = 2d(o) - 30t(o). Determine k(z(m)). -18m Let v(u) = -333u. Let s(o) = -o - 5. Let y(t) = -t2 + t + 5. Let m(a) = -2s(a) - 2y(a). Calculate v(m(d)). -666d*2 Let w(b) = 2b. Let f(n) = n - 2. Let z = -13 + 16. Let q be f(z). Let u(g) = -5g + 0 - q + 1. What is u(w(k))? -10k Let i(o) = 525o. Let u(b) be the third derivative of b5/60 + 420b*2. Determine i(u(y)). 525y2 Let z(o) = -o2 + 3 + 2 - 5. Let s(g) = g*2. Let i(y) = 5y + 6y - 11y - 8y2. Let f(k) = 3i(k) + 21s(k). Calculate f(z(p)). -3p*4 Let r(k) = 95942k*2. Let j(t) = -10t. Give r(j(o)). 9594200o2 Let g(s) be the third derivative of s4/8 - 44s*2. Let i(w) = 0w + 0w + 2w*2 - 10w*2. Calculate g(i(p)). -24p*2 Let n(y) be the second derivative of -7y*3/6 + 185y + 1. Let c(s) = 94s. Calculate c(n(z)). -658z Let z(q) = 416q2. Let p(h) = -3h*2 + 0h*2 + 2h*2. Calculate z(p(o)). 416o*4 Let k(r) = 10r - 325. Let n(s) = -s*2. Give n(k(q)). -100q*2 + 6500q - 105625 Let x(l) = -29l. Let n(r) = 17r*2 - 24. Let d(m) = 392m*2 - 560. Let f(v) = 3d(v) - 70n(v). Determine f(x(b)). -11774b*2 Let n(u) = 2u + 7. Let k(o) = o + 3. Let f(z) = -7k(z) + 3n(z). Let d(s) = -18s - 120. Let p(r) = r + 5. Let x(j) = -3d(j) - 72p(j). Determine x(f(a)). 18a Let l(b) be the second derivative of 29b4/12 + 3b. Let c(z) be the third derivative of -z*4/24 + 29z*2. What is l(c(p))? 29p2 Let t(j) be the first derivative of -j2 + 233. Let y(a) = -5a - 6. Determine y(t(q)). 10q - 6 Let a(o) = 112 - 5o + 3o + 2. Let q(k) = 2k2. What is q(a(l))? 8l*2 - 912l + 25992 Let g(k) = 5970k2. Let a(l) = -2l*2. Calculate a(g(c)). -71281800c4 Let v(l) = l2 - 28. Let o(z) = 1001z + z2 + 3z*2 - 2z*2 - 1001z. Determine o(v(p)). 2p4 - 112p*2 + 1568 Let r(l) = -2163l*2. Let d(k) = -87k. Give d(r(t)). 188181t2 Let t(y) = -670y. Let n(p) = -p - 25152 + 25152. What is n(t(f))? 670f Let r(k) = k2 + 0k2 + k2 - 4k2. Let y(h) be the first derivative of h4/12 + h2 - 1. Let p(a) be the second derivative of y(a). Determine r(p(s)). -8s*2 Let l(w) = -w - 14. Let j(y) = -85y*2 - 2y. Calculate l(j(d)). 85d2 + 2d - 14 Let d = -123 - -121. Let p(z) = z*2 - z + 1. Let n(r) = 30r*2 - 35r + 35. Let v(q) = dn(q) + 70p(q). Let y(m) = 2m - 4m + 3m. Determine v(y(i)). 10i*2 Let l(y) = 10y. Let f(u) = -333u + 3. Give l(f(g)). -3330g + 30 Let o(p) = -9p2. Let j = 568 + -566. Let u(m) be the first derivative of 0m + 1/2mj + 3. Determine u(o(n)). -9n*2 Let n(f) be the first derivative of 6f*3 + 238. Let b(l) be the first derivative of -3l*2/2 + 3. Calculate n(b(y)). 162y2 Let g(d) be the first derivative of d4/2 + 12d - 7. Let w(f) be the first derivative of g(f). Let k(p) = 6p*2. What is k(w(z))? 216z*4 Let m(s) be the second derivative of 0s*3 + 0 + 4s - 13/2s2 - 5/24s*4. Let z(w) be the first derivative of m(w). Let y(p) = 2p*2. What is y(z(j))? 50j*2 Let s(q) = 6q*2. Let z(r) be the first derivative of 15r*2/2 + 231. Calculate z(s(w)). 90w*2 Let o(u) = -2u. Let z(m) = 22m - 17. Let y(q) = 3q + 1. Let k(x) = 6y(x) - z(x). Determine k(o(a)). 8a + 23 Let j(m) = 121m2 - 15m. Let z(i) = 119i2 - 12i. Let a(q) = -4j(q) + 5z(q). Let r(w) = w*2. What is r(a(y))? 12321y*4 Let l(y) = -3y + 2. Let f(m) = 27m2 - 3m. Calculate l(f(b)). -81b2 + 9b + 2 Let d(x) = -10x2 + 24x - 8. Let v(m) = m*2 - 3m + 1. Let s(h) = 3d(h) + 24v(h). Let u(n) = -4n2. What is s(u(y))? -96y4 Let f(r) = r2. Suppose 0v + 372 = 4v. Suppose 15 - 84 = -3m. Let l(j) = -93 + mj + 6j + v. Determine f(l(a)). 841a*2 Let u(r) = 4r. Let x(g) = -5g. Let n(m) = -6u(m) - 5x(m). Let s(b) = 14b + 7b2 - 14b. Calculate s(n(o)). 7o2 Let m(k) = 3k. Let b(d) = -35658d2. Give m(b(o)). -106974o*2 Let j(b) = -9b. Let m(a) = 8299a2. Determine j(m(t)). -74691t*2 Suppose 0 = 2l + l - 12. Let f(p) = -4p + p + lp. Let s(x) = -46x. Let w(h) = -4h. Let d(o) = 4s(o) - 44w(o). Determine d(f(u)). -8u Let x(m) = 338m	{ "pile_set_name": "DM Mathematics" }
Let o be d(0). Suppose -5w - 4v + 2083 = 423, o = 5w + v - 1660. What is the hundreds digit of w? 3 What is the hundreds digit of 1916 - 22/(-4)(100 + -95)? 9 Let z(o) = 91o*3 - 19o*2 + 141o + 16. What is the units digit of z(8)? 0 Let n = 15898 + -2462. What is the thousands digit of n? 3 Let l be 0/((-3)/64)1. Let f(t) = -13t + 226. What is the hundreds digit of f(l)? 2 Suppose -3p - 2r + 4r + 21 = 0, 2p - 4r - 22 = 0. Suppose 3x + 1964 = pk, -725 = 5k - 2x - 2691. What is the units digit of k? 4 Let i(m) = 240m + 2000. What is the tens digit of i(72)? 8 Let k(a) = a3 + 9a*2 - 9a - 8. Let q(h) = -h*2 - 5h - 9. Let j be q(-4). Let o be (-9)/(j/(-4 + -1)). What is the tens digit of k(o)? 7 Let q be (-460)/(-15) + 4/12. Let l = q + -3. Let n = l - -36. What is the units digit of n? 4 What is the ten thousands digit of 3649228/55 + 2 + (0 - 8/5)? 6 Let g(z) = 6984z2 - 4z + 11. What is the hundreds digit of g(1)? 9 Let s be (-26)/(-22) + (-4)/22. Let g be 1 - 4191/(-9) - s/(-3). Suppose 126 = f + 4i, -4f + g = 5i - 26. What is the tens digit of f? 2 Suppose 58k = -26764 + 213872. What is the tens digit of k? 2 What is the hundreds digit of 26/442 - (-240548)/34? 0 Suppose 0 = -4c + 5o + 1040 - 159, -o + 218 = c. Suppose 2h - 5h + c = 0. Suppose 0 = -s - 2s + m + 195, 3m = s - h. What is the units digit of s? 4 Suppose -58o = -65o + 21. Suppose 3t + 72 - 2708 = a, -7914 = -9t - oa. What is the units digit of t? 9 Suppose -4437 = -3s + 5604. Suppose -c + 5a + 824 = 0, -16c + 12c + s = -3a. What is the units digit of c? 9 Let p be (-2)/15 + 7024/30. Let x = p - 147. What is the tens digit of x? 8 What is the hundreds digit of 140/60 + 160216/24? 6 Let w(a) = 17a - 7. Let x be (-61/1)/(4 - 6). Suppose -13 = -xy - 2y + 3m, -3m + 12 = 0. What is the tens digit of w(y)? 7 Let o(t) = -50t + 197. Let u(l) = 52l - 198. Let q(g) = 4o(g) + 5u(g). What is the units digit of q(18)? 8 What is the tens digit of (48/(-14))/((2/9968)/(11/(-22)))? 4 Let o(w) = -10w - 179. Let d be o(-35). Let c = 261 + d. What is the hundreds digit of c? 4 Suppose -n + 5 = 0, 2b - 3n = -0b - 13. Suppose -3r - b + 13 = 0, -r = -5z + 1631. What is the hundreds digit of z? 3 Let k = 37210 - 18492. What is the tens digit of k/13 + (-7)/((-1456)/32)? 4 Let l(i) = 78i2 - i + 302. What is the units digit of l(-15)? 7 Suppose 4a = -14 + 46. Let w be (-3 + 4)/(4/a) + 86. Let x = 194 - w. What is the hundreds digit of x? 1 Suppose 4n = -2b + 218268, -28972 = n - 3b - 83560. What is the hundreds digit of n? 5 Let m(x) be the second derivative of -x5/20 + 5x*4/12 + 5x*3/3 - 11x*2/2 - 2x + 11. What is the units digit of m(6)? 3 Let f(j) = 32j - 1. Let t be f(-1). Let v = 40 + t. Suppose -vr + 705 = -2r. What is the units digit of r? 1 Let r(j) = 72j*2 - 15j - 32. Let g = -405 + 402. What is the hundreds digit of r(g)? 6 What is the units digit of -5 + 1644/324 + 6466380/162 + -6? 0 Let v be (-3)/((-1)/4-6). Let k(r) = 32r - 7. Let b(s) = s. Let q(i) = b(i) - k(i). What is the tens digit of q(v)? 6 Let a be 0/((30/20)/(6/(-8))). Suppose -j - 71 = -76. Suppose a = -jp + p + 668. What is the tens digit of p? 6 Suppose -2t - 71979 = -4x + 36495, -5t = -x + 27105. What is the units digit of x? 0 Let d(p) = -3p2 - 6p + 4. Let u be d(-5). Suppose 4r + 447 = 8r - 5q, -5r + 4q + 570 = 0. Let s = u + r. What is the tens digit of s? 7 Suppose 4l + 5b + 8 = 0, -2l - l + b = 6. Let p be 1l/((-2)/(-3)). Let h = 93 - p. What is the tens digit of h? 9 Let d(y) = -11y*3 + 2y*2 - 14y + 12. What is the hundreds digit of d(-8)? 8 Let p = 1273 + -478. What is the units digit of ((-3)/((-30)/8))/(6/p)? 6 Suppose 4y - 145 = 3n, -3n - 111 = -3y - 0n. Let x(p) = 0p*2 + 21 + yp + 5p2 - 43p. What is the tens digit of x(5)? 0 Let c = 151 - 151. What is the thousands digit of c + 2 + (6 - -1600)? 1 Let r = 12 + 12. Let b = 2431 + -2440. Let k = b + r. What is the units digit of k? 5 Suppose 20p = 21p + 15. Let s(y) = y*2 + 12y - 34. Let w be s(p). Suppose -wh = -h - 50. What is the units digit of h? 5 Let z(l) = 8l*3 + 4l - 2 + l*2 + 28l*2 - 6l*3 - 17. What is the tens digit of z(-14)? 2 Let c = -1015 - -1478. Suppose z + 4u - 219 = 0, -4z - c + 1313 = 3u. What is the tens digit of z? 1 What is the tens digit of (-1130)/6-15 - -2 - 3? 2 Let o(u) = u - 20. Let r be o(15). Let l(d) = -63d - 13. What is the units digit of l(r)? 2 Suppose -2t + 2h = -h - 36, -3t - 2h + 67 = 0. Suppose -1880 = 11a - ta. What is the hundreds digit of a? 1 What is the hundreds digit of ((-18877940)/161)/20(-14)/2? 0 Suppose -5a + 5j - 81 = -16, -4a + j - 52 = 0. Let x(d) = -7d3 - 14d*2 - 10d + 1. Let w be x(-2). Let t = w - a. What is the units digit of t? 4 Let s be (-6)/6 + 1 - -13. Suppose -12z = -sz + 143. What is the hundreds digit of z? 1 Suppose -213 = -b + 4u, -23 = b + 5u - 191. Let t = b + 98. What is the units digit of t? 1 Suppose 2q + 40571 = 5r - 22305, 12583 = r - 3q. What is the units digit of r? 4 Let b(t) = -7532t - 12653. What is the units digit of b(-10)? 7 Let z(w) = 2w2 + 4w - 39. Let t be z(-9). Let m = 449 - t. What is the tens digit of m? 6 What is the hundreds digit of 1 - (-12692 + (-4)/((-2)/124))? 6 Let j be 6/15 + 5/((-50)/5144). Let d = j - -288. What is the hundreds digit of (-4)/8d - 0? 1 Let l be (319/33)/(3/342). Suppose -5n + 1473 = -3d - 1298, -2n - 2d = -l. What is the tens digit of n? 5 Suppose 0 = 7d + d - 1200. Suppose -z + 150 + d = 0. Suppose 4t + 2t = z. What is the units digit of t? 0 Let d(o) = o2 + 13o + 14. Let y be d(-12). Suppose -yl + 6l - 52 = 0. What is the units digit of l/(-3)(3 + -12)? 9 Let o(j) = -j3 + 5j*2 - 2j - 4. Let g be o(4). Suppose 6s - 1920 = gs - 5b, 2s - 1928 = -3b. What is the tens digit of s? 7 Let n(d) = -112d - 110. Let t = 315 + -321. What is the units digit of n(t)? 2 Let q(w) = 9w - 102. Let a = 79 - 63. What is the units digit of q(a)? 2 Let z = -811 - -14861. What is the ten thousands digit of z? 1 Suppose -4r + 5i - 31145 = -9r, 2i + 2 = 0. What is the thousands digit of r? 6 Let f = 281 - 278. Suppose q - 3w - 455 = -6w, 0 = fq + w - 1405. What is the tens digit of q? 7 Suppose -22d - 3 - 151 = 0. What is the units digit of 6/(-42)6d? 6 Suppose 11t = 35 - 2. Suppose 2u - 908 = -19j + 21j, j = tu - 1354. What is the hundreds digit of u? 4 Let k = -10 + 62. Let p = 59 - k. Let u = p - -14. What is the tens digit of u? 2 Let r be ((-2)/8)/(6/(-48)). Let u = 332 - 298. Suppose 0 = -5n + 2j + 424, -rn + 126 = -4j - u. What is the units digit of n? 6 What is the ten thousands digit of 399222/20 + (-15)/75(-8)/(-16)? 1 Suppose 2j + 0j - 4 = 0. Let o(s) = 16s*2 - 20s - 4s2 + s3 - 5 - js*3. What is the units digit of o(9)? 8 Suppose -5d - 136648 = -5d - 19d. What is the units digit of d? 2 Let x(d) = -10 - 3d2 + 9 + 2d*2 + 75 - 4d. What is the tens digit of x(6)? 1 Suppose -3x + 4m = -3773, 2m + 1965 + 1816 = 3x. What is the thousands digit of x? 1 Let x(p) = 2p3 - 47p*2 - 26p + 67. Let z be x(24). Suppose zi = 1208 + 3162. What is the units digit of i? 0 Suppose 1587w - 1580w = 55895. Suppose -2z = 2x - 3182, x = -5z + 2x + w. What is the hundreds digit of z? 5 Suppose 245 = 14a - 119. Let q(x) = -5x + x3 - 31 - 41x*2 + ax*2 + 10x. What is the tens digit of q(15)? 4 Suppose t = -s + 517, 3s + t - 1602 = -47. Suppose 7p - s - 881 = 0. What is the units digit of p? 0 Let v = 1440 + -355. What is the tens digit of 20/(-7)v/(-10)? 1 Let z(a) = 2a*3 + 9a*2 + 9a + 3. Let u be z(-5). Let y = -65 - u. What is the tens digit of (-319/12)/(y/(-8))? 9 Let h be ((-28)/((-6)/(-3)-1))/1. Let r(f) = 2f3 - 26f*2 - 28f + 8. Let c be r(h). Suppose -13t = -ct - 350. What is the units digit of t? 0 What is the hundreds digit of -4 + 1 - 222924/(-52)? 2 Let h(b) = b - 2. Let t(f) = -f + 1. Let x(v) = -5h(v) - 4t(v). Let s be x(4). Suppose l - 6 = -l, sy = l + 217. What is the hundreds digit of y? 1 Let y = 44 + -42. Let h be 0(-3)/6y/(-2). Let p(c) = -c*3 + c + 74. What is the tens digit of p(h)? 7 Suppo	{ "pile_set_name": "DM Mathematics" }
11)/((-44)/(-40)). List the prime factors of (95/(-3))/(-5)b. 3, 19 Suppose -d = -u - 602, 5d + 15u - 17u = 3010. What are the prime factors of d? 2, 7, 43 Let m = 173 + -90. Let s = 154 - m. List the prime factors of s. 71 Let o be (3 - 13)/(4/(-2)). Suppose -o = 2a - 29. What are the prime factors of (a/(-8))/((-6)/88)? 2, 11 Let y be 0/((-2)/((-3)/(-3))). Suppose -4p + 6p - 4 = y. Suppose 6s + 72 = pl + 2s, 34 = l - s. What are the prime factors of l? 2 Let c(t) = -t + 31. Let u be c(21). Suppose -554 - 796 = -uf. List the prime factors of f. 3, 5 Let r = -171 + 310. What are the prime factors of r? 139 Let l = -466 + 1253. Suppose -3f = -5i + l, 11i + 5f - 795 = 6i. What are the prime factors of i? 2, 79 Let t = 86 - -616. Suppose -14g + t = -5g. What are the prime factors of g? 2, 3, 13 Let q = -62 - -69. Suppose 10 = 4o - 2a + qa, 0 = o - 2a - 9. What are the prime factors of o? 5 Suppose -2k - 1 + 3 = 2n, -3k + 3 = -4n. Suppose 0t - 4t + 136 = -2m, -t - 4m + 43 = n. List the prime factors of t. 5, 7 Suppose 3o = -o + 92. Suppose -4 = 21y - oy. Suppose 0 = -2r + y, w + 65 = 3w + 3r. What are the prime factors of w? 31 Let b = 9 + -7. Suppose 0 = bs - 7s. Suppose 3p = 3g - 57, 4g - p - 73 = -sp. List the prime factors of g. 2, 3 Let p(n) = n*3 - 36n*2 + 70n + 45. List the prime factors of p(34). 113 Let g(x) = 35x + 78. List the prime factors of g(7). 17, 19 Let t be (4/(-16))/(-22/32). Let r(k) = 63k - 11. List the prime factors of r(t). 5, 23 Let p(r) = -r2 - 11r + 15. Let h(y) = -y + 11. Let t be h(20). List the prime factors of p(t). 3, 11 Suppose 4r + m + 1176 = 6r, -3r + 1763 = -m. What are the prime factors of r? 587 Suppose 28 = 8a + 4. Suppose 163 = aq + 40. What are the prime factors of q? 41 Let n(f) = -f2 + 19f + 20. Let q be n(12). Let h = q + -47. List the prime factors of h. 3, 19 Suppose 0 = k - 5b + 23, 4k - k + 4b - 26 = 0. Suppose 0 = o - k - 56. What are the prime factors of o? 2, 29 Let v be -2((-12)/(-8) - 2). Let o = 76 + v. List the prime factors of o. 7, 11 Let k(b) = -82b - 25. List the prime factors of k(-6). 467 Let l be ((-1)/2)/(2/(-32)). Suppose 0 = -lb + 3b + 40. What are the prime factors of b? 2 Let l(f) = 4f*2 + 107f - 17. What are the prime factors of l(-33)? 2, 101 Let n(p) = 6p + 9. Let v be n(7). Suppose 0 = -7l + 376 + v. Suppose 5d - 451 = -l. List the prime factors of d. 2, 3, 13 Suppose 5m + 31 = 4g + 1, 3g = 5m + 25. Suppose 14 = 2s - gv + v, 0 = -s + 4v + 5. What are the prime factors of s? 3 Suppose 0 = 3q + 5m + 5, q + 4m + 4 = -0q. Suppose 3v - 180 = 4j, q = -4v + 3j - 5j + 240. List the prime factors of v. 2, 3, 5 Suppose -4p + 4c + 2143 = -8397, 4 = -2c. What are the prime factors of p? 2633 Let j(h) = 6h2 - 7h - 8. Let g be j(6). Suppose 0 = 5l - g - 164. What are the prime factors of l? 2, 3, 11 Let r(y) be the second derivative of y4/12 - y3/2 - 11y*2/2 + 2y. What are the prime factors of r(6)? 7 Let s(a) = 33a - 114. List the prime factors of s(18). 2, 3, 5 Let p be (-3)/(-9)(1 - 1). Suppose 966 = -pu + 4u - j, 0 = -u - j + 239. List the prime factors of u. 241 Let m(q) = 16q2 - 3q - 204. What are the prime factors of m(-12)? 2, 3, 89 Suppose -16905 = -6f - 2811. What are the prime factors of f? 3, 29 Suppose 4n + 938 - 4622 = -5s, 5s - 3679 = n. What are the prime factors of s? 2, 23 Suppose -1006 = -10f + 934. What are the prime factors of f? 2, 97 Let o be (44/(-10))/((-4)/(-20)). Let m be (-5)/25 + o/(-10). List the prime factors of m + 0 + 2 - -3. 7 Let g be 50/13 - 14/(-91). Suppose 478 = 4z - 5x, -476 = -5z + z + gx. List the prime factors of 1(z/3 + 0). 3, 13 Suppose -q + 156 = -3s, 8q = 4q - 2s + 666. What are the prime factors of q? 3, 5, 11 Suppose 45582 = 26a + 4632. What are the prime factors of a? 3, 5, 7 Suppose 2c - 3c = 2. Let o be c/(-7) + (-45)/35. What are the prime factors of (-3)/o(-1 - -9)? 2, 3 Suppose 5c - 2443 = 392. Suppose 24a = 17a + c. What are the prime factors of a? 3 Let o = 0 - -4. Let p(z) = z3 + z - 3. Let t be p(4). Suppose -oi + t = i. What are the prime factors of i? 13 Let c = 453 + -316. List the prime factors of c. 137 What are the prime factors of 783(6 + -7)-1? 3, 29 Suppose 5 = d + 4. Suppose -d - 1 = f. List the prime factors of 156/9 + f/(-3). 2, 3 Let w(o) = o*2 + 4o - 6. Let d be w(-7). Let v be 4/10 + (-6)/d. Suppose vp - 3p + 57 = 0. What are the prime factors of p? 19 Suppose -2x - 33 + 667 = -4s, s + 625 = 2x. List the prime factors of x. 311 Suppose -3j + 836 = 3w - 8j, -w + 292 = j. Suppose 0 = 6n - 115 - w. What are the prime factors of n? 67 Suppose 3l - 15351 = 3u, 3818 = 3l + 3u - 11533. List the prime factors of l. 7, 17, 43 Let j = 9947 - 5620. List the prime factors of j. 4327 Suppose -3a + 1987 - 165 = -2n, 0 = a + 3n - 622. List the prime factors of a. 2, 5, 61 Suppose 2 - 8 = 6g. What are the prime factors of (g + 2)(-6 + 90)? 2, 3, 7 Let h(y) = 5y2 - 7y + 4. Let n(f) = -7f - 9. Let w be n(-2). What are the prime factors of h(w)? 2, 47 Let r = 592 - 398. What are the prime factors of r? 2, 97 Suppose 5q - 3q - 4 = 0. Suppose 0 = 3z + q - 17. Suppose zj + 2s = 245, 2s + 147 = 3j + 3s. List the prime factors of j. 7 Let k be (-435)/39 + 4/26. Let b = k + 10. What are the prime factors of b155/(-10)2? 31 Let c(z) = -8 - 3z + 13 + 0 + 10. What are the prime factors of c(-2)? 3, 7 Suppose -9456 = -5i - 3u + 1492, -4i = 4u - 8760. What are the prime factors of i? 11, 199 Let k = 43 - 40. Suppose -3l + 42 = kl. List the prime factors of l. 7 Suppose 3k + 5z = 34 + 129, 0 = k + 5z - 41. Suppose -59r - k = -60r. List the prime factors of r. 61 Suppose 6 = -4n + 7n. Let q(b) = -6b*3 + 2b*2 - b - 1. Let a be q(-2). Suppose a = 4i + 5j, -5i - nj = -i - 54. What are the prime factors of i? 13 Suppose k + 6 = 4k. Suppose -g + 258 = kg. List the prime factors of g. 2, 43 Let i be 3952/64 + 6/(-8). Let c = 105 - i. What are the prime factors of c? 2, 11 Let z = -3 + -3. Let l(b) = -2b - 6. Let u be l(z). Suppose -3c - u = -18. What are the prime factors of c? 2 Suppose -4 = -6r + 8. Let w(p) = 8p3 + p2 + 2p - 1. What are the prime factors of w(r)? 71 Suppose 0 = -0p - 2p + 24. Suppose -8r = -pr. Suppose -5t - h + 211 = r, -2t + 2h = 2t - 166. List the prime factors of t. 2, 3, 7 Suppose 0 = 3j - 6j. Suppose -3s + 2h + 330 = j, -6s = -s - h - 543. Suppose 0 = v + 2v - s. List the prime factors of v. 2, 3 Let t = 1124 + -452. What are the prime factors of t? 2, 3, 7 Suppose 0 = 5r + r - 24. Suppose -rg = -l + 70, -2g = -4 + 6. What are the prime factors of l? 2, 3, 11 Suppose 0 = 56u - 58u + 20. What are the prime factors of (-15)/u + (-585)/(-2)? 3, 97 Suppose 8285 = 2p - 5s, 5p - 2304 = 2s + 18356. List the prime factors of p. 2, 5, 7, 59 Let g be (3/(-9))/(3/(-18)). Let h be (16/(-2))/g + 46. Suppose -3z = 4c - 131, -4c = -z + 23 + h. List the prime factors of z. 7 Let v(h) = -h*3 - 5h*2 + 6h - 7. Let i be v(-8). Let g = i + -62. What are the prime factors of 140/g + 2/15? 2 Let b be 9/(-27)(-45 - 0). Let c be (-1632)/(-10) - (-12)/b. Suppose c + 44 = 4p. List the prime factors of p. 2, 13 Suppose -13o + 3a = -15o + 2714, -a + 2710 = 2o. What are the prime factors of o? 2, 677 What are the prime factors of (-7082920)/(-1352) + (-2)/(-13)? 13, 31 Let a = -15 + 22. Let n(t) = -t*3 + 7t*2 + t. What are the prime factors of n(a)? 7 Let t = -21 - -23. Suppose -2l + 153 = r, -7l + tl - 638 = -4r. Let w = r + -106. List the prime factors of w. 3, 17 List the prime factors of 2 + (18/8)/((-66)/(-26048)). 2, 5, 89 Suppose 9 = -8p - 7. Let x(d) = -30d - 3. List the prime factors of x(p). 3, 19 Let s(t) = t3 - 7t*2 - 45t + 19. List the prime factors of s(13). 2, 7 Suppose -28655 = -355o + 344o. What are the prime factors of o? 5, 521 Let q be (-4 + 11)/((-4)/248). Let z be q/(-4) + 8/(-16). What are the prime factors of -39/(z/(-80))? 2, 5 Suppose 2h + 145 = 3*q, -q + 21 + 29 = h. List the prime factors of q. 7 Let l = 9 - 10. Let m be (10/15)/(l/(-51)). Let b = 48 - m. What are the prim	{ "pile_set_name": "DM Mathematics" }
001 Let b = -974 + 973.999999834. Round b to seven dps. -0.0000002 Let g = -3 - 1. Let p be g-2(-3)/(-6). Let m be (p - 2 - 6800003) + 1. Round m to the nearest 1000000. -7000000 Let v = -4.3909 - -0.0109. Round v to the nearest integer. -4 Suppose -17850 = -2h + 5i, 0 = -9h + 4h + 4i + 44608. Suppose -g + 5g = -h. What is g rounded to the nearest 100? -2200 Let h = -25.62 - -49.43. Round h to zero decimal places. 24 Let d be (13 - 13)(0 - -1). Suppose d = -c - 2y, -7y = c - 3y. Suppose -5t + 1650000 = -ct. What is t rounded to the nearest 100000? 300000 Suppose 41a - 15a - 3101800 = 0. Round a to the nearest 10000. 120000 Let l = -16.968 - -17. Let u = 30.968 + l. Let f = -24.9 + u. Round f to the nearest integer. 6 Let q = 5.07 + 127.93. Let k = 6650.037 + -6783.1. Let h = q + k. Round h to 2 dps. -0.06 Let q be (12/4)/(9/(-6)). Let i = q + -10. Let w be i/(3/64503). Round w to the nearest one thousand. -9000 Let q be (-17520)/(-4) + (1 - 1). Let u = q - -48620. What is u rounded to the nearest ten thousand? 50000 Let c(n) = 14220n*2 - 11n + 8. Suppose 40 = 2u + 3u. Let h be c(u). Round h to the nearest one hundred thousand. 900000 Suppose -2d = 5z - 15 - 20, -2d + 26 = 2z. Let x be (74955/225 + 2/d)1119. What is x rounded to the nearest 10000? 370000 Let a = 6.405 - 4.404. Let m = -2 + a. Round m to three decimal places. 0.001 Let c = 438 + -437.41. What is c rounded to 1 decimal place? 0.6 Let q = -374120 - -232120. Round q to the nearest one hundred thousand. -100000 Let h = -35.3 + -1.7. Let i = -855221 + 855183.9993. Let c = h - i. What is c rounded to three decimal places? 0.001 Let a = 0.366447 - 0.3646. Round a to four dps. 0.0018 Let x be -2 + (-12894020)/(-15) - 6/(-9). Round x to the nearest ten thousand. 860000 Let l = -0.07378725 + 0.0738. Round l to seven decimal places. 0.0000128 Let t = 41 - 14. Let u = t - 27.000031. Round u to 5 dps. -0.00003 Let f = 114.01 - -15.79. Let p = f - 130.499. Let b = 0.61 + p. What is b rounded to two decimal places? -0.09 Let r(y) = 258y*2 - 22y - 60. Let w be r(14). What is w rounded to the nearest 10000? 50000 Let u = -200545.274 + 200563.2739994. Let w = u - 18. What is w rounded to seven dps? -0.0000006 Let q = 0.06784 + -0.071. Round q to four dps. -0.0032 Let k = 24 - 7. Let x = k - 16.78. Let q = 0.22000022 - x. What is q rounded to seven decimal places? 0.0000002 Suppose -2s = 3 - 13. Suppose -sr + 37035 = -1965. Round r to the nearest one thousand. 8000 Let u = -856.71 + 848. Round u to 1 decimal place. -8.7 Let f = 533560824782.9629979 + -533560796120. Let j = f - 28663. Let n = j - -0.037. Round n to 6 dps. -0.000002 Let w = 0.5 - 0.3. Let g = 22.5 - 13.8. Let j = w + g. Round j to 0 decimal places. 9 Let q be (23890/3)/(-5)(-3090)/4. Suppose 6s - q = -3570335. What is s rounded to the nearest 100000? -400000 Let w = 6.86 - 5.1. Let p = -3.18 + w. Let l = p + 1.420138. Round l to 5 dps. 0.00014 Let o = 54.072 + -45.79. Let k = o - 0.082. What is k rounded to the nearest integer? 8 Let n = -835409 - 2592591. What is n rounded to the nearest one million? -3000000 Let z = -1.32896 - -1.338. What is z rounded to 4 decimal places? 0.009 Suppose -84812 = -915c + 901c. What is c rounded to the nearest 100? 6100 Let c be (-6)/(-12)0/(-2) - -8742. Suppose -2758 - c = -w. Round w to the nearest 1000. 12000 Let g = 119 + -119.1115. Let c = g + 0.1768. Let a = c + -0.062. Round a to three decimal places. 0.003 Let h = 254 + -254.026. Round h to 3 decimal places. -0.026 Let x = -0.006 - 0.00423. Round x to 4 dps. -0.0102 Let w = 590.212 - 6.112. Round w to the nearest 10. 580 Let w = -68 + 69.8. Let a = 1.79999965 - w. Round a to 7 dps. -0.0000004 Let o = -15.060005922 + 15.06. What is o rounded to 7 dps? -0.0000059 Suppose -36b = -39b + 855. Suppose s = -n + b, s + 3n = 127 + 152. Round s to the nearest 100. 300 Let c = -5008352.2399833 + 5008353. Let a = c + -0.76. Round a to 6 decimal places. 0.000017 Let s = 52 + -116. Let m = -64.084 - s. Round m to two dps. -0.08 Let c = -0.59 - -0.01. Let z = -0.57999982 - c. What is z rounded to seven decimal places? 0.0000002 Let r = 22 + -21.33. Let h = -3.57 + r. Let c = 2.805 + h. Round c to 2 dps. -0.1 Let g = -27.9999743 + 28. What is g rounded to six decimal places? 0.000026 Let t = -15 - 80. Let c = t + 64. Let p = c - -66. Round p to the nearest 10. 40 Let j be (-4368838)/(-5) + (-3)/5. Let h = -2473767 + j. Round h to the nearest one million. -2000000 Let w = -56311 + 80786. Let k = w + -24491.969. Let o = 17 + k. What is o rounded to two dps? 0.03 Let h(s) = -2s - 3. Let f be h(-3). Suppose -4y - 14 = -2r, fr + 2y - 4y - 13 = 0. Let i be (-1)/(r/576012) + 4. What is i rounded to the nearest 10000? -190000 Let u = -612.998 + 625.78293. Let p = u - 12.885. Let c = p + 0.1. Round c to 5 dps. -0.00007 Suppose 352000 = -97p + 92p. What is p rounded to the nearest ten thousand? -70000 Let u(q) be the first derivative of 67348q3/3 + 3q*2 - 10q + 4. Let k be u(-7). Round k to the nearest 1000000. 3000000 Let m be (1/(-2))/(4/(-8)). Suppose 3x - 24571059 = -2g, 2g - m = 5. Suppose 3b = 11609649 + x. What is b rounded to the nearest one million? 7000000 Let d = 26360 - 38076. Let h = d + 11716.9634. Let t = -0.98 + h. Round t to three dps. -0.017 Let m = 1.26609 + -1.302. What is m rounded to 3 dps? -0.036 Let y = 4.986 - -0.014. Let t = -12.6 + y. What is t rounded to zero dps? -8 Let i = -2.6399539 + 2.64. What is i rounded to 6 decimal places? 0.000046 Let g = -176404.387 + 176674. Let c = g + -0.613. Let y = -256.7 + c. Round y to zero decimal places. 12 Let f be (-4)/6 - (-84)/18. Suppose -fd - 15 = -9d. Let z be 2/(1 - d) - 6099. Round z to the nearest 1000. -6000 Let r = -0.0422 - -13.2022. Let f = -13 + r. Let m = f - 0.15999958. What is m rounded to seven decimal places? 0.0000004 Let v = -51.02 - -47. What is v rounded to zero decimal places? -4 Let k = 5127.5947 - -420.3033. Let l = k + -5540. Let n = -8 + l. What is n rounded to two decimal places? -0.1 Let t = 72165318266 + -72165752554.810003. Let s = 434289 + t. Let c = s - 0.19. Round c to six decimal places. -0.000003 Let f = 6.6 - 3.2. Let i = f + 11.6. Let l = i + -14.99975. Round l to 4 decimal places. 0.0003 Let f = 944.00000183 + -944. What is f rounded to 7 decimal places? 0.0000018 Let w = 1.071 - 1.07102438. What is w rounded to six dps? -0.000024 Let g = 0.042 + 0.758. Let j = g + -0.65. What is j rounded to one decimal place? 0.2 Let t = 2384 + -2383.97662. Round t to 3 dps. 0.023 Suppose 5q + 4941010 = -3p, 3p - 2q + 6963611 = 2022615. What is p rounded to the nearest 100000? -1600000 Let h = -4412.23 + 4433. Let b = -21 + h. Round b to one dp. -0.2 Suppose t = -3l + 18606, 4l - 10554 = -t + 8054. Round t to the nearest one thousand. 19000 Let q = -85.79 - -86.3417. What is q rounded to 2 dps? 0.55 Let f = -2.53 - -2.3. Let w = -0.2278 - f. Let n = w - 0. What is n rounded to three dps? 0.002 Suppose -281990 = -2p - 5n, 18n = 20n + 4. Round p to the nearest 10000. 140000 Let s(r) = 35r + 41410. Let o be s(0). Round o to the nearest 10000. 40000 Suppose 3u + u - 1280 = -n, -n - u = -1295. Let i be (29992 + 8)1/(3/n). What is i rounded to the nearest 1000000? 13000000 Let q = -0.25060804 + 152.24989804. Let z = 62 + -214. Let o = z + q. What is o rounded to four decimal places? -0.0007 Let p = 1567 + -1566.999994765. Round p to 6 decimal places. 0.000005 Suppose 304 = 5l + 284, 4r - 2l - 8 = 0. Let k(a) = -435373a - 1 + 5 + 75372a. Let i be k(r). What is i rounded to the nearest 100000? -1400000 Suppose 0i + 10 = 5i. Let w be (1432/(-16))/(i/12). Let n = w - -1537. Round n to the nearest 100. 1000 Let t = -0.05 + 0.02. Let r = t - 0.17. Let l = -0.20012 - r. What is l rounded to four decimal places? -0.0001 Let x = 1906.0873 - 1906. Let w = -0.081 + x. Round w to two dps. 0.01 Let f = -17371.3489 + 2.3489. Let i = -17371.9972 - f. Let b = i - -3. What is b rounded to 3 decimal places? 0.003 Let m = 0.423994658 + -5.523994188. Let t = -9.9 + 15. Let r = t + m. What is r rounded to 7 decimal places? 0.0000005 Let d = -840 - -600. Let r be (8/2 - d)*10/(-4). What is r rounded to the nearest 1000? -	{ "pile_set_name": "DM Mathematics" }
101s + 252. Suppose -60c + 138 = -sc. Sort -5, c, -3, -26 in descending order. c, -3, -5, -26 Let w be (0 + -42 - 4) + 4. Let d be 1-4w/(-56). Let a be (-1824)/(-608) - 5(1 + 0). Sort -4, 6, a, d. -4, d, a, 6 Let t be (2/21)/((-30)/135). Let m = -44 + 40.04. Let c = m + -0.04. Sort c, 1/2, t, -3 in decreasing order. 1/2, t, -3, c Let q = 147 - 65. Suppose -8a = q + 14. Sort 1, a, -5. a, -5, 1 Suppose -4914 = d - 14d. Let l = -342 + d. Put -4, -2, l in ascending order. -4, -2, l Suppose -3p + k = -6, 50k - 129 = 171. Sort -2, -1, p, -202, 0 in descending order. p, 0, -1, -2, -202 Suppose -3y - 281 = 4j + 2, 0 = 3j - y + 222. Put 5, 0, 4, j, 1 in decreasing order. 5, 4, 1, 0, j Let p(t) = -5t - 4. Let a be p(-2). Let c be (2 + a)/(2/1). Suppose -3x - 2j = 16, 4x - 2j = -cj - 20. Put -2, x, -1, 5 in descending order. 5, -1, -2, x Let z be 1 - (-21 + (19 - 10)). Sort -1, -49, -2, z. -49, -2, -1, z Suppose -8v = 794 - 74. Let m = 88 + v. Let k(l) = -l*3 - 3l*2 - 2l - 3. Let y be k(-3). Sort y, -3, m. -3, m, y Suppose -15p = 13273 - 2668. Let g = p + 709. Sort -1/2, g, 1 in ascending order. -1/2, 1, g Let n = -150 - -146. Let b be 0 - 1(n + -1). Put -4, b, -10 in increasing order. -10, -4, b Let o(t) = t*3 + 11t*2 + 23t. Let d be o(-8). Let g = -0.75 - -0.55. Sort d, -5, g, 2/11 in descending order. d, 2/11, g, -5 Let y = 5.6 + -2. Let m = 0.6 - y. Let x be 4 - (0 + 256/56). Sort x, m, -2, 0. m, -2, x, 0 Let o = -7886 + 7885. Sort 24, 3, -3, -5, o in ascending order. -5, -3, o, 3, 24 Let w be -2 - (1 + -5) - 12. Suppose -666i + 65 = -669i + 5b, 4i - b = -30. Sort w, i, 0. w, i, 0 Let m = 34/3 - 11. Let v be 2/8(-88)/77. Put v, -1, m in decreasing order. m, v, -1 Let c = 1115/7 - 159. Let w = -0.117 + 3.047. Let a = w - 2.9. Sort a, c, 0 in descending order. c, a, 0 Let l = -372 - -4824/13. Put -3, 3, l, 0 in descending order. 3, 0, l, -3 Let p = -2 - -6. Suppose -352q + 2140q + 12366 - 1638 = 0. Sort -2, -1, p, q. q, -2, -1, p Let w = -0.3 + 0.4. Let p = -163.89 + 156.89. Put -2, w, p in decreasing order. w, -2, p Let q = 35765/71538 + 2/35769. Put 64, q, -15 in ascending order. -15, q, 64 Let v = 427 + -297. Let w = v + -129.6. Suppose -4 = a - 8. Sort 0.1, a, w, 1.2 in ascending order. 0.1, w, 1.2, a Let o be (-38 - (-1554)/42)-2(-10)/(-4). Sort -17, -200, o in decreasing order. o, -17, -200 Let f = -9875 + 9874. Let s = 0.01 - -0.25. Put f, 0, s in decreasing order. s, 0, f Suppose 403d = 398d + 120. Suppose -228n = -236n - d. Sort -2, n, 15, 1 in descending order. 15, 1, -2, n Suppose -5t = c - 15, -t - 6 - 7 = -3c. Suppose 10r - 8r - 6 = -2q, -2q + 12 = cr. Sort 43, 1, r in increasing order. 1, r, 43 Suppose 687 + 106 = -61j. Put 5, -4, j, 0 in decreasing order. 5, 0, -4, j Suppose 95r = -112r + 743 + 85. Put 1, -6, r, -125 in decreasing order. r, 1, -6, -125 Suppose -4z - v - 22 = -5z, -2z = 5v - 23. Sort z, 0, 20 in descending order. 20, z, 0 Suppose 2c = y - 6 + 10, y + 7 = 3c. Suppose 0 = 4x + 5p + 20, 6p - 3p = -5x - 25. Sort -2, 8, x, c in decreasing order. 8, c, -2, x Let y(m) = -12m - 2. Let p be y(-2). Suppose -d + 11 = 4j, d = 3j - d - p. Sort 64, j, 2 in ascending order. 2, j, 64 Let z = -3979 + 3981. Sort -2, -4, 0, 3, z in descending order. 3, z, 0, -2, -4 Suppose 0 = -147k - 149k - 2054 - 1318402. Sort 5, k, 0. k, 0, 5 Suppose 7r - 2r = 5. Let i(l) = 153 - 2l*2 + 153 - 9l - 312. Let c be i(-3). Put r, c, 2 in decreasing order. c, 2, r Let b(s) = s*2 + 11s - 1. Let z be b(-7). Let d = -71 - z. Let u be (-6 + 4)(d/(-45) + -1). Sort 2, 4, u, -2 in increasing order. -2, u, 2, 4 Let v be (4 + (-110)/4)(26 - 28). Sort -7, -4, v. -7, -4, v Suppose 4j + 5m = 15, 0 = -4m + 37 - 9. Suppose 1 - 21 = -4z. Sort z, 1, -2, j. j, -2, 1, z Let z = 1/51146 - 36722837/460314. Let h = 80 + z. Let p = -3/88 - 29/440. Sort -5, h, p. -5, p, h Let j = 187.75 + -1.75. Let s = -185 + j. Sort -2/7, s, 0.6. -2/7, 0.6, s Let g = -7629 + 7624. Put 5, 57, g, 2, 3 in ascending order. g, 2, 3, 5, 57 Let f = 162 - -281. Let s = 442 - f. Let q(n) = n*2 + 10n + 11. Let m be q(-8). Put s, -3, m, 2 in descending order. 2, s, -3, m Let w(s) = 3s2 - 46s + 161. Let l be w(5). Put -0.3, -3, 0.108, l in decreasing order. l, 0.108, -0.3, -3 Let g = -5816 - -5814. Put -3, g, 0.41 in increasing order. -3, g, 0.41 Let o = -8 + 10. Suppose 0v - ou = -4v + 10, -v - 2u = 0. Suppose 0 = x - 1, -va - x + 13 = 2x. Put -4, a, -1 in descending order. a, -1, -4 Let z = 0.4 - -4.6. Let h be 22/6 + 8/(-12). Let x = 13/535 + -1109/1605. Sort x, z, h in ascending order. x, h, z Let b be 5/((-7)/2 - -6). Let u(i) = -3i + 3. Let n be u(-4). Let q be b/40 + -5 + 78/n. Put q, 4/5, 1/2 in ascending order. q, 1/2, 4/5 Suppose 5w - 368 = -4k + 28, 0 = -w + 4k + 60. Put 5, w, -4 in decreasing order. w, 5, -4 Let q = 2 - 4. Let f be (-112)/(-308) - (1/4 - (-1350)/264). Sort q, f, 7. f, q, 7 Let p be (3/(-21))/(12/(-14)). Let b = 411 + -586. Let v = b - -172. Put p, v, 4/9 in increasing order. v, p, 4/9 Let c = -3644.8 - -3645. Put c, -1, -5/2, -2/3 in decreasing order. c, -2/3, -1, -5/2 Suppose 21x + 75x - 288 = 0. Put 0.03, 1/7, x in decreasing order. x, 1/7, 0.03 Let q = -188 + -20. Let y = q - -208.5. Let j = -37/4 - -9. Put j, y, 3/2 in increasing order. j, y, 3/2 Suppose 0 = -4s - 3b - 23, -2s + b + 5 = 14. Put -9, s, 296 in increasing order. -9, s, 296 Suppose -14z - 5320 = -0z. Let k = -374 - z. Put 1, -9, k in descending order. k, 1, -9 Let f = 2 - -3. Let m = -0.01 + -0.3. Let l = m + 2.31. Sort -4/5, f, l in increasing order. -4/5, l, f Let o(u) = 6u*2 - 831u + 409. Let r be o(138). Suppose 5h + 3d + 22 = -0d, 2h + 8 = -d. Let l = -9 + 5. Put l, r, h in decreasing order. h, l, r Let p be 612/60 - 11 - ((-12)/10 + 0). Put p, -0.4, 0.334, 3 in increasing order. -0.4, 0.334, p, 3 Let k(b) = -b*3 + 4b*2 - 6b. Let y be k(4). Suppose 770a - 833a = -189. Sort 5, y, a, -3. y, -3, a, 5 Let j = 89 - 89.039. Let h = 0.291 - j. Let r = h + 4.67. Sort r, 2/5, -3/5 in descending order. r, 2/5, -3/5 Let l be -36(1 - 6)/10. Suppose 5m - 25 = -3x, 2x + 5m - l = m. Put -16, x, 4 in increasing order. -16, 4, x Let i = -5744 + 5745. Put 0, -2, i, -2/17, 0.11 in increasing order. -2, -2/17, 0, 0.11, i Let p = -9248 - -9258. Sort 7, p, -12 in decreasing order. p, 7, -12 Let m = -0.4336 - -0.6336. Put -1.8, 0.1, 5, m in descending order. 5, m, 0.1, -1.8 Let s be (4/78)/((-14)/(-9 + -33)). Put s, 2/11, 1, -2/11, -3 in increasing order. -3, -2/11, s, 2/11, 1 Suppose 177c - 179c + 9 = -3p, -2p + 4c - 22 = 0. Put 21, -1, p, 20 in ascending order. -1, p, 20, 21 Let b(r) = 3r2 + 119r + 25. Let v be b(-44). Let y = v - 594. Put y, -20, 5 in increasing order. -20, y, 5 Suppose -37 = 4r - 17, 46 = 2i - 2r. Suppose ix + 209 = 3035. Put x, 4, 0.3 in increasing order. 0.3, 4, x Let h(t) = 3t3 + 38t*2 + 18t - 59. Let g be h(-12). Suppose 4m - 12 = 8. Sort m, g, -2, 0 in descending order. g, m, 0, -2 Let g = -40717 + 40721. Let p = 8 + -7.7. Sort p, 62, 0.2, g in ascending order. 0.2, p, g, 62 Suppose 15h - 220 = 9h - 38h. Let q = -5 + 2. Sort 0, h, 3, q in decreasing order. h, 3, 0, q Let z be (138/230)/(2/(3 + -1)). Let q(c) = -c*3 - 9c*2 + 1. Let u be q(-9). Put z, 0.2, 0.04, u in ascending order. 0.04, 0.2, z, u Let y(r) = r + 27. Let d be y(-10). Let p = 22 - d. Suppose 0 = -pw + 1 + 9. Put w, -1, 1 in increasing order. -1, 1, w Let m be (24/(-70))/((-8)/20). Let c = 3449/230 - 699/46. Sort -1, c, 9, m in descending order. 9, m, c, -1 Let f(c) = -c*2 - 3c + 6. Let n be f(-5). Suppose 55w = 59w + 3p + 5, -3w - 110 = -19p. Put n, w, 0 in increasing order. w, n, 0 Let c = -11174 - -11176. Sort -3, -33, 3, c. -33, -3, c, 3 Let x(o) = o2 + 19o + 50. Suppose 12l = -12l - 384. Let w be x(l). Sort w, -2, -3, -1 in increasing order. -3, -2, -1, w Let c(h) = -h*2 + 61h - 824. Let v be c(38). Sort v, 4, 0, 1 in decreasing order. v, 4, 1, 0 Let h(c) = -51*c + 712. Let z be h(14). Sort 25, -1, 1, -3, z in descending order. 25, 1, -1, z, -3 Let t = -5.3 - 0.7. Let j = t + 1. Let r = -544.7 + 510.7. Put r, j, 0.4 in descending order. 0.4, j, r Let o = 61.4 - 61. Let y	{ "pile_set_name": "DM Mathematics" }
(q(-5/2))(-39)qqq(7/11)qq29 assuming q is positive. q(2863/22) Simplify ((((z(-1/2))14)(-28))(4/33))37 assuming z is positive. z(29008/33) Simplify (y(y/((y*6/y)/y))/yyy(2/13)(y*(2/5)y)/yy(3/7))/((y/y0)6)(-4) assuming y is positive. y(10457/455) Simplify (k/k0((kk(k(k/k(2/19)k)/k)/kk)/kk)/kk)(-6/23)/((k6k/k*0)/(kk/(k1/k))(-1/7)) assuming k is positive. k(-26193/3059) Simplify s(-2/9)ss/s*2(s/(s/s1))(1/8)(((s/(s(-3/7)/ss)s)/ss)/(s/(s/(s/s*4)s)ss))/(s*(-7)(s(-7)/s)/s) assuming s is positive. s(10247/504) Simplify (u3/(u/(u/(u/u(1/5)))u)(uu(-2))(-25))/(u0u/u*(-7)(u(-1/2))(-37)) assuming u is positive. u(-3/10) Simplify ((r0)(1/4))(-3/17)/(((r(-1/2)/r)/r)32)0 assuming r is positive. 1 Simplify ((b(2/9)/b)/b(2/9))/(b(4/9)/(bb1b))((b(-2)b)/bb/(b(-3)b))/(b(-2/7)/b6) assuming b is positive. b(557/63) Simplify (k(-2/9)/kk(5/2)/kk*(1/14)kk(k/((k/k*(1/8)k)/k)k)/k)/(k6k*4k(k2)17) assuming k is positive. k(-21433/504) Simplify ((qq*6q*(-2/7))/(qqq(-3)qq5))(-40) assuming q is positive. q(-480/7) Simplify (p(-1/7)pp/(p/p(-1))((p((p(p*1p)/p)/p)/p)/p)(-8))/(p(-1/4)/p*(-1/2)(p(2/3))(-2/37)) assuming p is positive. p(-1109/3108) Simplify (g(-1/13)g(2/33)/g)1/((gg*1ggg)*(2/81)g(-2/13)/g(-8)) assuming g is positive. g(-104084/11583) Simplify ((y(2/21)/y)/(((y/y6)/y)/y))(2/89)y(y*1y)/yyy*(3/7)y/y*(2/3)y(-2/3) assuming y is positive. y(863/267) Simplify ((a/((aaa*(-2/3))/a))/((aa/((a*(-2/5)/a)/a))/a))/((a(aaa(-1))/a)/a3)((a2a)(8/7))28 assuming a is positive. a(1429/15) Simplify (m(-1/9)/(mmm*3/m)(m/(m/m*(2/9)))/(m/(mm*3)mm))/((m(-6)m*(-2))/(mm*(1/3)mm/m2)) assuming m is positive. m(58/9) Simplify v(-3)v/v*3v((v/((((v/v8)/vv)/v)/v))/v)/(vv8)(v*(1/8)vv(2/13))(12/7) assuming v is positive. v(-47/26) Simplify z(zz(3/20)z)/zz(-1/53)z(zzz(-48))(-5/12) assuming z is positive. z(70907/3180) Simplify ((s(-4/3)s*(-3/10)/ss*(-1)s/(ss7s))(26/5))(-10) assuming s is positive. s(9074/15) Simplify (k(1/4)/(k/(((k*(4/5)k)/k)/k)))/(k*(4/3)k(k/k(-1))/k)(kk(2/17)(k*(-2/9)/kk)/k)/(k*(-1)kk(-3)k) assuming k is positive. k(-7307/3060) Simplify ((s(2/3)s)/s)(-20)s*3/(ssss*(-1/2)ss)ss3s/s*(4/3)(s*5/s)/ss(-4) assuming s is positive. s(-73/6) Simplify ((((j(-2/7)/j)/j)/j)/j7j(-6/7)/(j(4/9)j))/((j*(-2)/j)/jjj/(j/j(-2)j)jjjj*4jjj/j(-3)) assuming j is positive. j(-1234/63) Simplify ((((ff(-1)/ff)16)(2/5))(-21))(-18) assuming f is positive. 1 Simplify ((((a(2/25))(1/2))8)(11/6))(2/3) assuming a is positive. a(88/225) Simplify (l*(3/10)/ll/(l/(l*(3/4)/l))ll(l/l*(-8)ll)/(l/(l/(ll/l(3/4)))))(-1/3) assuming l is positive. l(-18/5) Simplify (x/x(3/8)(x/x(2/7)xx)/x)/(x(-1)xx(x*(-6/11)x)/xx)(((xxx/(xx(2/5)))/x)(-10))(2/9) assuming x is positive. x(-829/1848) Simplify (((r14(r/r10)/r)/(r8r(-6/5)))39)(2/35) assuming r is positive. r(-156/25) Simplify (s1s/s5)(-1)(ss*(-4)ss9)(-4) assuming s is positive. s(-25) Simplify (ff4)/((f/(f(5/6)/f))/f)f(2/3)f*(1/6)(ff/((f/(ff(-2/7)))/f))(1/66)/(f/(fff*(1/2))f)(-1/37) assuming f is positive. f(16223/2849) Simplify ((m*3m)(-40))24(m(8/9)m(mm/(mmm*9))/mm)(-1/4) assuming m is positive. m(-34544/9) Simplify ((o(1/2)/o)(4/23))*(-13)/(((ooo(-2/3)/o)/o)46)(-30) assuming o is positive. o(-21134/23) Simplify (((x/(xxx/x(-1))x)/x)(-2/73))10/(((xx(1/4)/x)/x(-2))/(x0xxx/x(-1))) assuming x is positive. x(751/292) Simplify (y*(-1)y/y*(1/27)(y(-4)/y)/(y7y))33 assuming y is positive. y(-3872/9) Simplify ((ww/(w/(w(-2/3)/w)))24(w/w(-2))/www(-1/5)w)(-12) assuming w is positive. w(732/5) Simplify ((sss*(-1/3)s)(-48)/(s1)*(-1/3))/((ss(s/s(-5))/s)/sss(-4)/ss)(-13/2) assuming s is positive. s(-649/6) Simplify ((ggg*(1/3)g)/gg)(1/3)(g*(-2/3)g)*(-15/8)((gg(-1/8))(2/3))31 assuming g is positive. g(1337/72) Simplify ((((n3/n)/nn)/(n/(n/(nn/n25))))/(nn(-9/7))17)(-5/9) assuming n is positive. n(-1045/63) Simplify ((h(-1/2)/h1)/((h/(h/(h*(2/5)h)))/h(-4/3)))/(h5/hhh*(-2)(h/(h/(h*(-7)h)))/hh(-5/3)) assuming h is positive. h(43/30) Simplify ((j2(jj7)/jjj)/(j(2/9)j/j*(1/3)))/((j(j/j(2/9))/j)/(j(-2/11)j))(-1/28) assuming j is positive. j(7006/693) Simplify ((t/(tt*0t))/(((t*(6/7)t)/t)/t))/(((ttt(-17))/t)/(t0/t)) assuming t is positive. t*(99/7) Simplify nn*(-1)n*5((nn1)/n)(-1)(n/(n(-1/3)/n))(-5/7)/(n(2/11))(-22/9) assuming n is positive. n*(25/9) Simplify ((g/(g(g*(1/4)g)/gg))(-44))(-48)(g(2/3))(-48)/(g(gg/(g/g*(-1/3)))/gg(2/15)/g) assuming g is positive. g(-13359/5) Simplify (v*(-23)vvv/v*(5/9)v*(1/11)/(v((v*(-4/13)/vv)/v)/v))(-37) assuming v is positive. v(912235/1287) Simplify ((v/(v(v/v(1/4)v)/v))(-30/11)/(v1)(4/11))/(((v(-2/5)v)/vv)*26(((vv(2/3)v)/v)/v)(2/65)) assuming v is positive. v(-59797/4290) Simplify (w22/w)/w36(w(-13/4)w)/w41 assuming w is positive. w(-233/4) Simplify (i*1ii(-26)ii(i(-6/29))(-34/5))(1/33) assuming i is positive. i(-2986/4785) Simplify (d4/(d/d(-16))(d9)(-15/7))(2/5) assuming d is positive. d(-452/35) Simplify (((((h0h)/h)/h)*(-8)(h(-3))49)(-24/11))(-6/5) assuming h is positive. h(-20016/55) Simplify (c13)*(-18/5)c*(5/14)/cc/c(-8/3) assuming c is positive. c(-9193/210) Simplify (l/(l/(l/l0)))39(ll/(l/(l(l/((l0ll)/ll))/l)))/ll/l(-1)(l*(-1)l)*(16/7)(l0/l)(-2/17) assuming l is positive. l(682/17) Simplify ((f(-1/2)fff(-2/3)fff)/((ff/f(2/7))/f)(-12/7))/((f(2/7))(1/29)/(ff(2/3))46) assuming f is positive. f(232233/2842) Simplify ((h(-2/63))*(-5/6)/((hhh(1/2))/(((hh/(h/(hh19)h))/h)/h)))(-2/99) assuming h is positive. h(-5869/18711) Simplify (l*(10/7)l(l/(l/l(17/6)))/ll((ll(l/l18l)/l)/l)(5/2))34 assuming l is positive. l(-24803/21) Simplify f3/(((f*7f)/f)/f)(f/f5)/(ff*(-3/2))((ff0f)/((f*(7/5)f)/f))45 assuming f is positive. f(41/2) Simplify ((uu(-1/4)u)(-8))35/(u*8u(-6/11))2 assuming u is positive. u(-5554/11) Simplify (f(3/32)/(f(f/(f(-33)f))/f))/(f*(2/73)f/(f/(fff/(f(-15/7)/f)))) assuming f is positive. f(-638979/16352) Simplify x*(1/4)/((x/(x(xx(-4))/x))/x)x*1xx(-2)(x(-1/4))27x(-3)(x*(2/23)/x)/xx assuming x is positive. x*(-617/46) Simplify ((dd(-4)/d)/((d(8/5)d)/d))(-4/15)/((d(d/((d*1d)/d))/d)*(-34)d*(-6)/dd/(dd(1/4)d)) assuming d is positive. d*(2923/300) Simplify (jjj(-23)(j*(-1/5)j)/jj(4/15)/j(17/3))(-49) assuming j is positive. j(6517/5) Simplify (((ooo(-2/23)o)/oo)/((o(-2/5)/oo)/o))*(-7/6)(o/(o*(2/7)ooo))*(2/7)(oo(-1/2)/o)/o3 assuming o is positive. o(-310543/33810) Simplify (d(-1/6)/(d/((((dd/d4)/d)/d)/d)))(-1/12)/(d*(2/17)/dd(d/d(2/7))/dd)(-2/9) assuming d is positive. d(5987/8568) Simplify ((d(-2/3)/d)(13/4)/(dd(-4)dd/(d(-4)/d)))/((dd/d*(1/11))/(dd(2/5)))(-16) assuming d is positive. d(-839/660) Simplify (((b(-17)/b)/b*35)/(((b/(bb/(b*9/bbb)))/b)/((b(b*(-24)b)/bb)/bb)))(2/41) assuming b is positive. b(-166/41) Simplify (w*7ww/(ww*(4/11))w*(-1/6)/ww(-2/5)/w)/(w(7/3)w(-2)w)(-39) assuming w is positive. w(18833/330) Simplify ((a/a4)/(a(-26/3)a))/(a(-25)/(aa/a40)) assuming a is positive. a(-25/3) Simplify (((p19)(-2/25))(-7))(-45) assuming p is positive. p(-2394/5) Simplify (m(-9)/m(-1/4))(-27)/((m/(((m*(2/7)/mmm)/m)/m)m)*(2/167)/((mm*4mm)/m(2/17))) assuming m is positive. m(19324493/79492) Simplify ((u6/((uu*(-2/3))/uu)uu/u*(-2)u**(2	{ "pile_set_name": "DM Mathematics" }
9787844 and 20? 1798939220 What is the smallest common multiple of 176904 and 165? 9729720 What is the smallest common multiple of 203259320 and 26840? 203259320 Calculate the common denominator of -163/42 and 85/1859706. 13017942 Find the common denominator of -53/27125064 and -151/16932. 27125064 Calculate the common denominator of 77/1178 and 58/333265. 392586170 What is the lowest common multiple of 25 and 379155940? 1895779700 What is the lowest common multiple of 21588 and 173732? 3648372 What is the lowest common multiple of 5338596 and 2669298? 5338596 Calculate the smallest common multiple of 4312392 and 49794. 185432856 Find the common denominator of 23/6024 and -73/2673150. 10692600 What is the common denominator of -30/303239081 and 23/5? 1516195405 Calculate the least common multiple of 11813895 and 765. 11813895 Find the common denominator of -20/7599097 and 141/4070. 75990970 What is the common denominator of -21/4075910 and 55/6? 12227730 What is the smallest common multiple of 16248672 and 31878? 113740704 Find the common denominator of 23/1160 and -163/2662200. 2662200 Calculate the smallest common multiple of 2133810 and 10364220. 72549540 What is the lowest common multiple of 72648 and 157324? 2857318488 What is the lowest common multiple of 7560 and 57060? 2396520 Find the common denominator of -107/31410 and -49/81912045. 491472270 Calculate the common denominator of 121/7020 and 55/13806. 414180 Calculate the lowest common multiple of 78966784 and 66560. 394833920 What is the common denominator of 32/7541947 and -14/261813303? 1832693121 Calculate the smallest common multiple of 4208007 and 3016359. 340848567 What is the common denominator of 59/1770972 and -41/145? 8854860 Find the common denominator of 83/413868 and -20/2451. 338130156 What is the common denominator of 25/5236 and 137/1619590? 35630980 Calculate the least common multiple of 1536 and 96612. 12366336 Find the common denominator of -1/2010 and 91/2540. 510540 Calculate the least common multiple of 158 and 10534729. 21069458 Calculate the least common multiple of 534 and 3628174. 10884522 What is the least common multiple of 386916 and 39108? 1260959244 What is the lowest common multiple of 1005 and 1026225? 68757075 Calculate the lowest common multiple of 718725 and 128205. 23717925 Calculate the least common multiple of 2181870 and 450. 10909350 What is the common denominator of -75/269348 and 41/5291896? 89962232 What is the lowest common multiple of 715 and 176894575? 176894575 What is the common denominator of 21/5282176 and 103/13865712? 110925696 What is the smallest common multiple of 18418 and 2836372? 2836372 What is the common denominator of -41/9030 and 151/21672? 108360 Calculate the least common multiple of 20 and 205487178. 2054871780 What is the least common multiple of 420 and 170358? 11925060 What is the common denominator of 26/111252981 and 37/333758943? 333758943 Calculate the smallest common multiple of 30230420 and 42322588. 211612940 What is the common denominator of -127/2160 and -101/486144? 7292160 What is the common denominator of 151/30 and 113/1726248? 8631240 Calculate the lowest common multiple of 19617200 and 550. 215789200 Calculate the lowest common multiple of 9504256 and 38017024. 38017024 Find the common denominator of 73/557102 and 8/2041. 87465014 What is the common denominator of -149/253260 and 59/366? 15448860 Find the common denominator of -8/147 and -71/1996353. 97821297 Calculate the common denominator of -9/188 and 29/1393940. 65515180 Calculate the common denominator of 119/412308 and -125/3848208. 11544624 Find the common denominator of 7/1116 and -131/1010898. 62675676 What is the smallest common multiple of 25868268 and 432? 103473072 What is the lowest common multiple of 77 and 9751? 107261 What is the common denominator of -85/32952 and 21/35698? 428376 What is the lowest common multiple of 2837 and 1577? 4473949 What is the lowest common multiple of 11061558 and 270? 165923370 Find the common denominator of -107/43776 and 7/417148800. 2502892800 Find the common denominator of 101/1194480 and 173/10800. 5972400 Calculate the smallest common multiple of 4031352 and 296088. 52407576 Calculate the common denominator of -87/172208 and -37/19712. 212160256 Find the common denominator of -55/46644 and -5/130806. 6017076 What is the smallest common multiple of 712602 and 2? 712602 What is the lowest common multiple of 345345156 and 20? 1726725780 What is the smallest common multiple of 89241 and 570315? 86117565 Calculate the common denominator of -115/11530596 and 38/262059. 11530596 Calculate the lowest common multiple of 3815 and 49050. 343350 Find the common denominator of 103/414 and -67/154400. 31960800 Calculate the common denominator of 99/32 and 77/15780066. 252481056 What is the smallest common multiple of 734318 and 3332674? 43324762 What is the lowest common multiple of 2333580 and 1760420? 100343940 What is the smallest common multiple of 16706928 and 2660? 83534640 What is the least common multiple of 801150 and 2478? 47267850 Find the common denominator of -55/78306116 and 47/12856228. 861367276 What is the least common multiple of 436137 and 11473758? 149158854 What is the common denominator of 33/14 and -95/52430642? 367014494 What is the smallest common multiple of 33072784 and 212906047? 3406496752 What is the smallest common multiple of 110 and 16489165? 32978330 What is the common denominator of -19/955296 and -5/803356? 1793090592 Calculate the least common multiple of 490014 and 882. 3430098 Calculate the smallest common multiple of 21535855 and 11401335. 193822695 What is the common denominator of -8/9782363 and -139/12? 117388356 Calculate the lowest common multiple of 1366181 and 91690. 13661810 Find the common denominator of -23/7767968 and -93/1613768. 458310112 What is the common denominator of -211/210 and -89/437970? 3065790 What is the least common multiple of 971012 and 2427530? 4855060 Calculate the lowest common multiple of 27 and 6595212. 59356908 What is the common denominator of 7/9 and 52/113799? 341397 Calculate the lowest common multiple of 4755 and 523050. 523050 Calculate the common denominator of -19/26863044 and 79/390. 134315220 Calculate the common denominator of -23/177765960 and -113/32280. 177765960 Find the common denominator of 61/170010 and -97/11562. 327609270 Calculate the smallest common multiple of 4 and 1640948. 1640948 What is the lowest common multiple of 640 and 8543760? 68350080 What is the lowest common multiple of 32197 and 7524? 22022748 Find the common denominator of -17/18264 and 73/644805. 3925572840 What is the least common multiple of 39987136 and 328? 39987136 Calculate the common denominator of -33/379642 and -133/658656. 54668448 What is the common denominator of 175/269620032 and 61/429? 3505060416 Calculate the smallest common multiple of 835329 and 792. 20047896 What is the least common multiple of 26274 and 17652? 77298108 Calculate the smallest common multiple of 300216 and 9757020. 19514040 What is the smallest common multiple of 7935368 and 3128? 134901256 What is the lowest common multiple of 88942 and 28266? 179573898 What is the lowest common multiple of 5055530 and 121820? 10111060 What is the least common multiple of 787660 and 610? 48047260 Find the common denominator of -55/165340353 and -29. 165340353 Calculate the smallest common multiple of 8672 and 97984. 26553664 What is the least common multiple of 98196 and 19873? 1669332 Find the common denominator of -181/618030 and -86/20601. 618030 Calculate the common denominator of 113/2710860 and -123/9036200. 27108600 What is the lowest common multiple of 16602978 and 45065226? 315456582 Calculate the common denominator of -27/4702000 and 109/1750. 32914000 What is the smallest common multiple of 556416 and 1536? 2225664 What is the smallest common multiple of 56 and 71898544? 503289808 What is the common denominator of -34/2095347 and -42/434171? 48192981 What is the least common multiple of 97794 and 472671? 2836026 What is the common denominator of 29/9916 and -109/297480? 297480 Calculate the least common multiple of 1195053 and 5137. 13145583 Calculate the common deno	{ "pile_set_name": "DM Mathematics" }
z(f). Give k(2). -1 Let a = 7 + -1. Let s(g) = 2g - 9. Calculate s(a). 3 Let g(p) be the first derivative of p3/3 - 3p*2/2 - 3p - 10. Let u be g(-2). Let o(w) = -w*3 + 6w*2 + 6w + 5. Calculate o(u). -2 Let j(g) be the second derivative of 5/6g3 - 1/24g*4 - 1/120g6 - g2 + 1/12g5 + 0 - 2g. Let w(v) be the first derivative of j(v). Calculate w(5). 0 Let h(b) = b*2 - 4b - 4. Let p(o) = o + 1. Let n(m) = h(m) - 3p(m). Determine n(8). 1 Let f(v) = -v3 - 3v*2 - 2v + 2. Let x be f(-2). Suppose 0 = 5q - w - 18, -6q + xw + 21 = -q. Let c(n) = n2 - 3n - 3. Determine c(q). -3 Suppose -2 = p - 4. Let v(l) = -5l + 0l*2 + 5l*p - 6l*2 + 0l*2 - 4. Suppose 0n = -4n - 20. Give v(n). -4 Let o(m) = 20m*2 - 11m + 11. Suppose 6q = q + 30. Let t(v) = 7v*2 - 4v + 4. Let n(k) = qo(k) - 17t(k). Determine n(-4). 6 Let l(z) = -5z + 4. Let x(p) = p3 - 4p*2 + 3p + 3. Let o be x(3). Determine l(o). -11 Let r = -1 + 4. Let f(j) = 2j + 4j + r - j. Let p = -5 - -3. Give f(p). -7 Let d(b) = b*2 + 3b - 37. Let h be d(-8). Let l(f) = 2f3 - 2f*2 - 3f + 3. Give l(h). 30 Let l(i) = -3i + 2i + 6i2 + 6i*2 + 2 - 11i2. Give l(0). 2 Let g(y) be the first derivative of y4/4 + 5y3/3 + 5y*2/2 + y + 15. Let d(b) = -3 - 5b + 2b - 1 + b2. Let q be d(3). Determine g(q). -3 Let s(m) = m2 + m - 5. Let n be s(0). Let z(c) be the second derivative of -c + 1/2c*4 + 1/20c*5 + 0 - 5/2c*2 + 1/2c*3. Give z(n). 5 Let o be (2/8)/(14/84). Let q(l) be the second derivative of 1/20l*5 + 2l + 0 - ol2 + l3 - 5/12l*4. What is q(4)? 5 Suppose -t + 7 = -5y, -4y - 1 - 1 = t. Suppose 0 = tg + 5q, q = -g - 3q. Let w(f) = f3 - f2 + f - 7. Determine w(g). -7 Let v be 4/(-30) - (-4)/30. Let u(b) = b*3. Give u(v). 0 Let f(p) = -2p*2 - 3p - 1. Suppose -5r - q = -10, -2r + 4q = 10 - 36. Suppose rv - 2 = -4w, 2v - v - 2w + 6 = 0. What is f(v)? -3 Let k(g) = -g2 - 7g - 6. Let t be k(-6). Suppose t = -2r + 6 + 6. Let h(s) = 0s + 6s + r - 8 - s2. Determine h(4). 6 Let r(x) = 6 + 2x - 2x - x2 - x + 6x. What is r(7)? -8 Let h(v) = -v + 4. Let o be h(6). Let x(w) = 23336 + 2w2 - 23334 - w2 + 2w*3 - w. What is x(o)? -8 Let l be (4/10)/(3/(-15)). Let n be 3/(21/l). Let v = 2 - n. Let j(z) = z*2 - 4z - 7. What is j(v)? -2 Let n be (-18)/(-8)(-80)/(-30). Let f(h) = 2h - 5. Give f(n). 7 Suppose 2a + 15 - 3 = 0. Let g = -3 - -7. Let q = a + g. Let b(w) = w3 + w2 + w. Give b(q). -6 Let c(b) = -25b - 5. Let j(p) = -6p - 1. Let m(r) = 2c(r) - 9j(r). Let x(k) be the third derivative of -k4/24 - k3/3 + 4k*2. Let q be x(0). Give m(q). -9 Let o = -3 + 30. Suppose 0 = -3f + y - 11, o = -5y + 7. Let i(j) = j2 + 3j - 3. Give i(f). 7 Let x be 46/(1/(-21)). Suppose -2j + 4j = 40. Let v be x/j - (-2)/(-5). Let h(s) = -s2 - 5s - 1. Determine h(v). -1 Let j(t) = -4t3 - t2 + t - 1. Let a(w) = -w2 + 6w - 4. Let y be a(2). Suppose 8u = yu + 4. Calculate j(u). -5 Let o = 0 + -5. Let i(t) = t + 7. Determine i(o). 2 Let q(b) be the first derivative of -b4/2 - b2 - b - 16. Determine q(-1). 3 Let v(o) be the second derivative of -o*6/120 - 7o*5/60 - 5o4/24 - o3/2 - o*2 - 5o. Let q(m) be the first derivative of v(m). What is q(-6)? -9 Let d(l) = -l - 5 + 0 + 6. Calculate d(-5). 6 Suppose 4l - u + 2u = 14, l + 5u = 13. Let a(j) = j3 - 4j*2 - 2j + 4. What is a(l)? -11 Let z(p) = -2 - 3p - 2p2 - 4 + 4. Let y(n) = -n2 + 1. Let k(t) = -3y(t) + z(t). Let v(o) = -5o. Let i be v(-1). Determine k(i). 5 Suppose -5g + 2u - 5 - 1 = 0, 0 = 3u + 6. Let s(a) = a2 - a - 1. Calculate s(g). 5 Let i(t) be the first derivative of -t3/6 + t2 + t - 1. Let z(l) be the first derivative of i(l). Let g(n) = n2 - 8n - 9. Let b be g(9). Determine z(b). 2 Let t be (8 - (-16)/(-4)) + 1. Let z = 4 - 4. Suppose z = j + 2s - 15, -tj + s + 16 = -4. Let y(m) = m - 1. What is y(j)? 4 Let h = -3 - -7. Suppose 2a + 2x = -0x + 14, x - h = 0. Let m(t) = -t. Give m(a). -3 Suppose -4 = -0q + 4q, 5 = -5l + 5q. Let s(z) = -3 + 3 - 1 + 0 - 4z*2 - 2z. What is s(l)? -13 Let t(f) be the third derivative of -f5/60 + f4/4 + f*3/6 - 6f*2. What is t(6)? 1 Let u(n) = -3n + 4. Let f(b) = b + 1. Let d(z) = -2f(z) + u(z). Suppose 12 = -6m + 2m. Let x be 10/8 + m/(-4). Give d(x). -8 Let j(h) = h + 1. Suppose -x + 300 = 3x. Suppose -3n = 2n + x. Let s be (-2 - n/6)-4. Determine j(s). -1 Suppose 0 = 10n - 5n + 20. Let v(w) = w3 + 4w*2 - 3w - 4. Give v(n). 8 Suppose -4o = 2 + 2. Let j = 9 + -6. Let u(r) = -jr - 3 + 6r + 2. Give u(o). -4 Let y(i) be the second derivative of 0 + 0i*2 + 1/6i*3 + i. Let h be 21/(-9)3 - -3. What is y(h)? -4 Let p(f) be the second derivative of -f*4/12 - 5f*3/3 + 15f*2/2 - f. Let o be p(-11). Let s(h) be the first derivative of -2h*2 + 3h - 3. Give s(o). -13 Suppose -2d = -4n - 22, -d - 5n = 11 + 6. Let r be (0 - 3)/((-3)/d). Suppose -3 = -3v, -5 - 6 = -rj + v. Let f(t) = t2 - 5t - 2. Calculate f(j). -6 Let d(x) = -25x2 - 100x + 3x2 + 99x. What is d(-1)? -21 Let h(t) = 3t3 + 15t*2 + 9t - 7. Let s(j) = 4j3 + 22j*2 + 14j - 10. Let i(c) = -7h(c) + 5s(c). What is i(6)? 5 Let m be ((-48)/(-4))/(-4) - 1. Let r(j) = -j*2 - 3j + 4. Determine r(m). 0 Let x be (-1)/(-3) - (-16)/(-3). Let l = 13 + -7. Let g(m) = 1 - lm2 - 1 - 6m - m*3. Calculate g(x). 5 Let j(m) = -2m - 8. Let n be j(-6). Suppose 36 = -nd - 5l, -2d + 7d = -5l - 40. Let a(h) = h2 + h - 5. Calculate a(d). 7 Let g be 4 - (0 - -1)-1. Suppose -2r = r + 2o + 14, -5r + 4o = -6. Let s = g + r. Let w(b) = 2b - 3. Determine w(s). 3 Let g(t) = t3 + 3t*2 + 2t - 2. Let c(p) = -3p2 - 2p - 1. Let y be c(-1). Calculate g(y). -2 Suppose 0 = -2x + 2 + 2. Suppose -3h + 2w = -4h + 2, 0 = -5w. Let q(j) = -1 - 3j*3 + h + j + 2j3. Calculate q(x). -5 Let w(a) = a2 + a + 1. Let m(v) = -v*3 + 5v*2 + 2v - 7. Let g be m(5). Suppose -c = 4y - 7, gc - 49 = 3y - y. Suppose -2z = 3z + c. Give w(z). 7 Let t(d) = -6d*2 - 4d + 5. Let j(x) = -x + 1. Let h(p) = 4j(p) - t(p). Give h(1). 5 Let d(y) = 8y - 5y + 0y + 3. What is d(-5)? -12 Suppose 3j + 2 + 5 = i, 5j = 4i. Let a(b) = b3 + 3b*2 - 3b. Give a(j). -4 Suppose -l + 5l = 8. Let i = l - 1. Let q(v) = -3v + 2v - i - 4. Calculate q(4). -9 Suppose 4w + 7 = 3h + 5w, -5w = -2h + 16. Let m(z) = -h - 2z + 0 + 4. Let f be -32(-1)/3. Calculate m(f). -3 Let y(u) = 3u*2. Suppose 2s + 6 = -4k, 0s - 27 = -4s + 5k. Suppose -sc - 6 = -6c. What is y(c)? 12 Let b(z) be the first derivative of -z*4/4 - 4z*3/3 + 7z*2/2 + 4z + 1. Let d be -5 - ((-4)/(-2) - 2). Determine b(d). -6 Let v(u) = 3 - 4u2 - 6 - 5u + 2. Let c(m) = 177m - 178m + 3m2 - 4m*2. Let o(l) = -9c(l) + 2v(l). Calculate o(2). 0 Let c = 18 + -16. Let s(p) = cp*2 - 4p*2 + 3p*2. Calculate s(1). 1 Let l(s) = -s - 4. Suppose -3h + 3p + 45 = 0, 29 = -h + 3h - p. Let i be (21/h)/((-6)/20). Calculate l(i). 1 Let l = -7 - -12. Suppose -2x + lz - 23 = 0, -3x - 4z = -31 + 8. Let w(u) = 12u3. What is w(x)? 12 Let a(b) be the second derivative of b5/20 - b4/3 - 5b*3/6 - 7b. What is a(5)? 0 Let j(m) = -2m2 + 2m - 4m + m2. Suppose 0 = -v - 4i + 11, -8v + 14 = -4v + i. Suppose 0 = -2o - 5 + v. Calculate j(o). 1 Let b(r) = r + 7. Let g be b(-4). Let s(y) = 5y + 1. Give s(g). 16 Let p(u) = -u + 4. Let f be p(6). Let w = 1 + -4. Let b be (f/w)/((-2)/6). Let m(v) = 2v - 1. Calculate m(b). -5 Suppose 4m + a - 24 = 5a, 3a = 2m - 15. Let n(o) = -2o + 4. Calculate n(m). -2 Let h be (-7)/(7/3) + -1. Let z(a) = a*2 + 5a + 2. Determine z(h). -2 Suppose -2p - 15 = -7p. Suppose -pj = -6j + 6. Let t(r) = 8 + 2rj - 2r2 + 4 + r2 - r*3. Give t(0). 12 Let g(s) = 12 - 10s - 2 - 6 + 7s. Give g(5). -11 Let h(n) = -3n*2 - 3n + 0n + 2n*2. Let u(z) = z. Let m(p) = 7p + 1. Let y(d) = m(d) - 6u(d). Let w be y(-4). What is h(w)? 0 Let c(y) = -3y*2 - 4y - 4. Let w(h) = -2h2 - 3h - 4. Let i(x) = 3c(x) - 4w(x). Suppose -8 = -4q - 4n, 7q - 3q = 5n - 10. What is i(q)? 4 Let o(j) = j3 + 7j*2 - 8j - 11. Let a be (-52)/6	{ "pile_set_name": "DM Mathematics" }
v*d + 1 + 3 wrt v? -3v*2 Let q(s) be the first derivative of 7s*5/60 + 15s*3/2 - 31s*2/2 + 8. Let y(w) be the second derivative of q(w). What is the derivative of y(t) wrt t? 14t Differentiate 2u2 + 291 - 87 - 29u*2 - 4u*2 + 484u - 486u with respect to u. -62u - 2 Let p(s) be the first derivative of 7/2s6 + 0s*4 + 0s + 43 + 3s2 + 0s*5 + 0s*3. What is the second derivative of p(n) wrt n? 420n*3 Let n(y) = 268y + 279. Let u(c) = -178c - 186. Let f(p) = 5n(p) + 7u(p). What is the derivative of f(q) wrt q? 94 Suppose 3k + 24 = 2s, 4k - 4 + 32 = 2s. Let a be (-5)/(10/5 - 3). What is the second derivative of 24n*3 - 24n*3 - sn + an4 wrt n? 60n*2 Let j(n) be the second derivative of -7n*4/12 + 55n*3/6 - 3n*2/2 + 6n - 1. What is the second derivative of j(g) wrt g? -14 What is the second derivative of 2k2 + 356k + 639k3 - 54k - 70k - 26k wrt k? 3834k + 4 Let h(g) = 15g*2 - 6g + 36. Let j(z) = -2z2 + 0z*2 + z - 1 + 3z*2. Let w(d) = h(d) + 6j(d). What is the derivative of w(i) wrt i? 42i Let f(j) = -j2 + 4j. Let y be f(4). Let n be 18/3 - (0 - y). What is the third derivative of -5d6 + 7d*6 - 2d*2 + 6d*n wrt d? 960d*3 Suppose 5a - 21 - 4 = 0. Find the second derivative of -12ma + 397m*4 - 28m - 397m4 wrt m. -240m*3 Let s(z) be the third derivative of 95z*8/336 - 27z*5/5 + 161z*2. What is the third derivative of s(q) wrt q? 5700q*2 Let m(u) = -274u*3 - 13u*2 + 477u + 26. Let q(p) = -137p3 - 6p*2 + 238p + 12. Let f(z) = 6m(z) - 13q(z). Find the second derivative of f(l) wrt l. 822l Let k(n) = 189n*2 - 133n. Let w(c) = 570c2 - 401c. Let t(j) = -17k(j) + 6w(j). What is the second derivative of t(y) wrt y? 414 Suppose t + 3t - 12 = 0. What is the second derivative of -5g - 13gt + g - 2g wrt g? -78g Let p(q) = 35q*3 - 2q*2 - 6q + 12. Let n(j) = -69j3 + 3j*2 + 11j - 22. Let x(v) = 6n(v) + 11p(v). What is the third derivative of x(l) wrt l? -174 Suppose l - 28 = 65. What is the third derivative of -lz2 - 5z3 - z3 + 91z2 wrt z? -36 Let h(p) be the first derivative of 6 - p + 0p*2 - 1/3p*3. Let a(f) = 2f*2 + 6. Let b(z) = 2a(z) + 10h(z). What is the derivative of b(l) wrt l? -12l Let h = -3 - 3. Let k(z) = 5z2 - 5z*2 - 3 - 3 - 5z*3. Let x(y) = -4y*3 - 7. Let q(s) = hk(s) + 5x(s). Find the first derivative of q(j) wrt j. 30j*2 What is the third derivative of -3p*4 + 21592p*5 + 24p*2 - 21551p*5 + 3p*4 wrt p? 2460p2 Let l(w) = w2 + 5w + 9. Let t be l(-6). Let c be (t/12)/((-2)/(-16)). Find the second derivative of 6b - cb + 4b*4 + 2 - 2 wrt b. 48b2 Let p(v) = -v3 + 6v2 - 2v - 1. Let s be p(4). Let c = s - 20. What is the first derivative of -8h + c - 1 - 3 + 0 wrt h? -8 Let h(p) = -35p - 18. Let y(f) be the third derivative of 53f4/12 + 53f*3/6 + 35f*2. Let l(k) = 7h(k) + 2y(k). Differentiate l(a) wrt a. -33 Suppose 5p = -3x + 12, 2x + 4 + 7 = 3p. Suppose -7y - 4 = 4o - py, -3o = -4y - 32. What is the second derivative of -m*5 + om - m*5 + 9m*5 wrt m? 140m*3 Let s(n) be the first derivative of 0n*4 + 0n + 2/5n5 - 13/3n*3 - 4 + 0n*2. Find the third derivative of s(j) wrt j. 48j Let r be (2/(-6))/((-16)/192). Let z(j) be the first derivative of -6 + 0j + 0j*3 - 3j*2 + 5/4j*r. What is the second derivative of z(l) wrt l? 30l Let z(x) be the second derivative of 159x5/20 - 13x*4/12 - x - 24. What is the third derivative of z(h) wrt h? 954 Let d(p) = -46p*2 + 2p - 82. Let b(u) = -1. Let m(l) = 3b(l) + d(l). Find the first derivative of m(c) wrt c. -92c + 2 Suppose -3j = 3h - 6, 0h = -h - 2j + 1. Suppose -g - 4g = hw - 6, -2w - g = -11. Find the third derivative of -2z*6 - wz2 + z2 + 4z2 wrt z. -240z*3 What is the second derivative of -2a*2 - 2a*2 - 184a + 30a + 11a*3 + 3a*2 - 96a*3 wrt a? -510a - 2 Suppose 48 = 3h - 3c, h - 75 = -4h + 4c. Suppose -2j = m - h, 2m - m + 1 = 2j. What is the first derivative of -8 - r4 - 102r*3 + 102r*j wrt r? -4r*3 Let t(k) be the second derivative of -221k5/20 - k4/6 + 4k3/3 - 91k. Find the third derivative of t(a) wrt a. -1326 Let h(a) be the first derivative of 19a3/3 + a2 - 116a - 52. What is the second derivative of h(z) wrt z? 38 Let d(l) = 442l2 - 11l + 150. Let j(g) = -221g2 + 6g - 76. Let r(t) = -6d(t) - 11j(t). What is the first derivative of r(v) wrt v? -442v Let z(c) = -c3 + 17c*2 - c + 21. Let v be z(17). Differentiate v - 3o + 5 + 1 with respect to o. -3 Let m = -76 + 97. What is the derivative of -34o3 + 5 - 1 + 2 + m wrt o? -102o2 Let t(j) be the second derivative of -j5/20 + 19j4/12 + 11j*3/2 + 3j*2/2 - 54j - 1. What is the second derivative of t(w) wrt w? -6w + 38 Let b(a) be the second derivative of -4/21a*7 + 0a*5 - 16a + 0 + 0a6 + 0a*4 + 0a*2 - 5/3a*3. What is the second derivative of b(o) wrt o? -160o*3 Let f(u) be the third derivative of -41u7/210 + u5/6 + 13u2 - u. What is the third derivative of f(l) wrt l? -984l Let p = -60 + 62. What is the second derivative of -9b - 16b*2 + pb - 21b - 2b2 wrt b? -36 Let n(d) be the first derivative of d6/10 + 13d5/60 - 2d*2 + 11. Let j(u) be the second derivative of n(u). What is the third derivative of j(x) wrt x? 72 Suppose 2w - 4w = 10, -l = -w - 8. Suppose 0 = b - 2b + 3. Differentiate -2m + 2m - 1 + 4mb - 10m*l wrt m. -18m*2 What is the derivative of 113 + 83 - 362z*2 - 19 + z - 5z*2 wrt z? -734z + 1 What is the second derivative of -38452 - 262a + 59a*2 + 67a*2 + 38452 wrt a? 252 Let i(m) be the first derivative of -57m5/5 - m4/4 + 111m2 + 143. What is the second derivative of i(v) wrt v? -684v*2 - 6v Let b(x) = x + 4. Let v be b(0). Suppose 0 = -vf - 0f. Find the first derivative of -u*4 - 1 + 2u*4 + 2u*4 + fu*4 wrt u. 12u*3 Let i be (-1 - -3) + (-2)/1 + 3. Find the first derivative of -193j*2 - 13j*i + 193j*2 + 14 wrt j. -39j*2 Let l(k) be the first derivative of 0k + 11 + 0k4 - 13/6k*6 + 0k*5 + 2k*2 + 0k*3. Find the second derivative of l(p) wrt p. -260p*3 Let y = -139 + 143. What is the second derivative of 18h*4 + 31h*y - 23h - 66h2 + 66h*2 wrt h? 588h*2 Let k be 112/40 + (-2 - (-11)/5). Find the second derivative of -16a*2 - 201 + 201 + ka wrt a. -32 Let g(y) be the first derivative of -241y6/6 + 64y*3/3 + 5. Find the third derivative of g(n) wrt n. -14460n*2 Let b(y) be the third derivative of -371y5/60 - y4/12 + 13y3 - 75y*2 - 2y. What is the second derivative of b(i) wrt i? -742 Suppose 0o - 15 = -3o, 14 = -v + 3o. Find the second derivative of v - 113f*3 + 107f*3 + 8f - 1 wrt f. -36f Let l(y) = -48 + y2 + 28 + 30 - 8y. Let s be l(7). What is the second derivative of 3f3 - fs - 4f - 15f3 - 4f wrt f? -78f Find the second derivative of 41a*2 - 153a*2 - 1 + 42a - 166a2 + 35a*2 wrt a. -486 Let a(g) = -31g*2 + 3g + 169. Let l(b) = 59b2 - 7b - 336. Let c(h) = -7a(h) - 4l(h). Find the first derivative of c(f) wrt f. -38f + 7 Let b(d) = 127d*4 + 13d*3 - 198d. Let w(l) = -63l4 - 6l*3 + 98l. Let s(z) = 6b(z) + 13w(z). What is the second derivative of s(j) wrt j? -684j2 Let c(d) = d2 - 2d + 1. Let x(o) = 2o3 - 49o*2 + 5o - 3. Let a(j) = -2c(j) - x(j). What is the second derivative of a(s) wrt s? -12s + 94 Let r(f) be the first derivative of -f*3 + 0f*6 + 0f*2 + 0f*5 + 8/7f*7 - 27 + 0f + 0f4. What is the third derivative of r(h) wrt h? 960h*3 Let k(q) = 2q*2 + 3q. Let h(x) = -153x2 + 9x. Let p(s) = h(s) - k(s). What is the second derivative of p(f) wrt f? -310 Let b(s) be the third derivative of 3s8/1120 - s5/15 + 3s*4/8 + 10s*2. Let j(l) be the second derivative of b(l). Differentiate j(q) with respect to q. 54q*2 Suppose 5w - 15 = m + 4, 0 = -2m - 8. Let k be (-22)/(-10) - w/15. What is the third derivative of -3q*k + 2q*2 - 4q*3 - 2q*2 + 3q*3 wrt q? -6 Let v(u) = -34u*2 + 5u + 101. Let q(a) = 76 - 18a2 + 0a + 0a + 3a - 25. Let l(i) = 5q(i) - 3	{ "pile_set_name": "DM Mathematics" }
6 and 2700? 108 What is the greatest common factor of 16896 and 1221? 33 Calculate the greatest common divisor of 3281 and 2123. 193 What is the greatest common divisor of 639729 and 36? 9 Calculate the highest common divisor of 4992 and 50752. 832 Calculate the highest common factor of 847 and 4278197. 847 What is the highest common divisor of 4551 and 8856? 123 What is the greatest common factor of 2089036 and 4? 4 What is the highest common divisor of 3515616 and 39? 39 Calculate the greatest common factor of 8 and 18488. 8 What is the highest common divisor of 30564 and 3186? 54 Calculate the highest common divisor of 810 and 2132730. 810 Calculate the highest common factor of 44 and 115126. 22 Calculate the highest common factor of 1807 and 21047. 13 Calculate the greatest common divisor of 959010 and 3510. 390 What is the greatest common factor of 6 and 1382817? 3 Calculate the highest common factor of 11115 and 78. 39 Calculate the highest common factor of 1116 and 2916. 36 What is the highest common divisor of 981390 and 30? 30 Calculate the highest common divisor of 627 and 31559. 209 Calculate the highest common divisor of 1440 and 155. 5 Calculate the greatest common divisor of 144 and 124808. 8 What is the highest common factor of 3540168 and 216? 72 What is the highest common factor of 882 and 1422? 18 Calculate the highest common divisor of 456 and 366776. 152 Calculate the greatest common divisor of 239 and 9355177. 239 Calculate the highest common factor of 12 and 44706. 6 Calculate the highest common factor of 186 and 129022. 62 What is the greatest common divisor of 261 and 3075972? 87 Calculate the highest common divisor of 1560 and 17496. 24 What is the highest common divisor of 1442 and 97335? 721 What is the highest common factor of 31856 and 136836? 724 Calculate the highest common divisor of 3160 and 200. 40 Calculate the highest common divisor of 36 and 6282. 18 What is the highest common divisor of 95 and 154318? 19 What is the highest common divisor of 5207 and 19024? 41 What is the highest common divisor of 1724 and 2312? 4 What is the highest common divisor of 7809 and 3553? 19 Calculate the highest common divisor of 6794 and 89569. 43 Calculate the highest common factor of 64 and 17. 1 What is the highest common divisor of 21 and 3647? 7 What is the highest common factor of 40518 and 24? 6 Calculate the greatest common divisor of 982748 and 624. 52 Calculate the highest common factor of 340 and 4680. 20 Calculate the greatest common divisor of 303345 and 229635. 2835 Calculate the greatest common divisor of 46 and 15594. 46 What is the greatest common divisor of 118260 and 108? 108 What is the highest common divisor of 2673 and 6732? 99 What is the highest common factor of 9105 and 135? 15 Calculate the greatest common divisor of 11 and 109. 1 Calculate the greatest common factor of 532203 and 168. 21 What is the greatest common divisor of 2280 and 513285? 285 What is the highest common divisor of 1410 and 510? 30 What is the greatest common divisor of 172998 and 126? 126 What is the greatest common factor of 776010 and 60? 30 What is the highest common divisor of 119803 and 188? 47 Calculate the highest common factor of 167895 and 910. 455 Calculate the greatest common factor of 54 and 75246. 6 What is the greatest common factor of 99780 and 120? 60 What is the highest common divisor of 1592450 and 60? 10 What is the greatest common divisor of 8330 and 2450? 490 What is the greatest common factor of 227710 and 70? 70 What is the greatest common factor of 363 and 568821? 363 Calculate the greatest common divisor of 4 and 172022. 2 What is the greatest common divisor of 429 and 91962? 39 Calculate the greatest common divisor of 6760 and 906685. 845 What is the highest common divisor of 74 and 50098? 74 Calculate the greatest common divisor of 6488291 and 2337. 779 Calculate the greatest common factor of 46843 and 278. 139 Calculate the greatest common factor of 220 and 1295635. 55 What is the highest common factor of 6924 and 4? 4 What is the greatest common factor of 267 and 299841? 267 What is the highest common divisor of 1230861 and 615? 123 What is the highest common divisor of 20 and 9782080? 20 Calculate the highest common factor of 81442 and 86. 86 What is the highest common factor of 58 and 18721? 1 Calculate the greatest common divisor of 150 and 52710. 30 Calculate the highest common factor of 564 and 116748. 564 What is the greatest common factor of 402 and 38458? 134 Calculate the greatest common factor of 11058 and 17328. 114 What is the highest common divisor of 32805 and 63? 9 Calculate the highest common factor of 433654 and 3380. 338 What is the highest common factor of 71838 and 338? 26 Calculate the highest common factor of 574938 and 52. 26 Calculate the greatest common divisor of 68280 and 9600. 120 What is the highest common divisor of 11118 and 9078? 102 Calculate the greatest common divisor of 104 and 299624. 104 What is the greatest common factor of 484 and 4334? 22 What is the greatest common factor of 666 and 192807? 333 What is the greatest common divisor of 7327960 and 1097? 1097 Calculate the greatest common divisor of 51939 and 116. 29 What is the greatest common divisor of 7104 and 4144? 592 What is the greatest common factor of 252 and 1236186? 126 Calculate the highest common factor of 279 and 30101. 31 What is the greatest common divisor of 853 and 21? 1 What is the highest common divisor of 13764 and 45198? 186 Calculate the greatest common divisor of 184 and 608. 8 Calculate the highest common factor of 148 and 30266. 74 What is the greatest common divisor of 3 and 16917? 3 Calculate the greatest common divisor of 2012586 and 2636. 1318 What is the greatest common divisor of 290 and 258854? 58 Calculate the highest common divisor of 555 and 335035. 185 What is the greatest common factor of 1026 and 12825? 513 Calculate the greatest common divisor of 318 and 2317478. 106 Calculate the greatest common factor of 9427152 and 28. 28 What is the greatest common divisor of 5 and 1329805? 5 Calculate the greatest common divisor of 1313 and 221. 13 What is the greatest common factor of 248 and 64? 8 Calculate the highest common divisor of 257129 and 3890. 389 What is the greatest common factor of 9345 and 3210? 15 Calculate the highest common factor of 11 and 1052535. 11 Calculate the greatest common factor of 12772 and 372. 124 Calculate the greatest common factor of 116 and 22069. 29 What is the highest common divisor of 2225 and 1225? 25 What is the greatest common factor of 324 and 1092366? 162 Calculate the greatest common divisor of 619960 and 220. 220 What is the greatest common divisor of 1846 and 840853? 923 What is the highest common factor of 8132 and 5853007? 2033 Calculate the greatest common factor of 989 and 1118. 43 Calculate the greatest common divisor of 115121 and 49932. 1387 What is the highest common factor of 273669 and 209? 11 What is the highest common factor of 216528 and 120? 24 Calculate the greatest common factor of 26 and 126386. 26 Calculate the highest common divisor of 187880 and 528. 88 What is the greatest common factor of 2596 and 327391? 59 Calculate the greatest common factor of 8988 and 23540. 428 What is the highest common factor of 267109 and 655? 131 What is the highest common factor of 7657 and 6851? 403 Calculate the highest common factor of 215 and 158885. 215 What is the highest common factor of 4947 and 61983? 291 Calculate the greatest common factor of 2394912 and 104. 104 What is the highest common divisor of 26 and 7396? 2 What is the highest common factor of 99 and 204567? 33 Calculate the greatest common divisor of 135 and 219645. 135 What is the greatest common divisor of 24563 and 164318? 847 Calculate the greatest common divisor of 39517 and 1032. 43 Calculate the greatest common divisor of 3419334 and 162. 162 Calculate the greatest common factor of 496 and 1190896. 496 Calculate the greatest common divisor of 50721 and 29. 29 Calculate the highest common divisor of 1780 and 35244. 356 What is the greatest common factor of 593780 and 100? 20 What is the highest common divisor of 3777 and 96? 3 What is the highest common divisor	{ "pile_set_name": "DM Mathematics" }
irst derivative of d(z). What is x(j(h))? -2h Let v(a) be the second derivative of -1/3a*4 + 0a*2 + 0 + 0a3 - a. Let r(p) be the first derivative of p3/3 - 3. Give v(r(h)). -4h4 Let c(f) be the third derivative of f5/40 + f3/3 - 3f*2. Let q(l) be the first derivative of c(l). Let a(n) = 5n - n - 2n. What is a(q(s))? 6s Let x(w) = 15w2. Let k(a) = -a + 25. What is k(x(d))? -15d*2 + 25 Let l(c) = 3c. Let k(o) be the second derivative of 0o2 + 1/6o*3 + 0 + 2o. What is l(k(f))? 3f Let n(q) = 3q2. Let b(z) be the third derivative of z6/144 - z*4/8 - 2z*2. Let w(d) be the second derivative of b(d). Calculate n(w(f)). 75f*2 Let q(y) = 24y*2 + 11. Let t(l) = 8l*2 + 4. Let i(j) = -4q(j) + 11t(j). Let z(n) = 8n. Give i(z(h)). -512h2 Let h(a) = 5a*2 + 4a + 4. Let k be (4/1)/(1 + -2). Let y(l) = 6l2 + 5l + 5. Let n(f) = ky(f) + 5h(f). Let j(b) = -2b. Determine n(j(r)). 4r*2 Let d(c) = -2c*2. Let w(q) = 0q + 2q - 2q + 6q2. What is d(w(x))? -72x*4 Let p(c) = 4c*2. Let j(l) = -99l*2. Determine j(p(d)). -1584d*4 Let b(l) = l - 3. Let h be b(3). Let i(m) = hm - 6m + m. Let d(o) = -8o + 6. Let p(v) = -17v + 13. Let z(t) = 13d(t) - 6p(t). Determine z(i(x)). 10x Let w(y) = -21y2. Let t(i) be the second derivative of i4/6 - 2i. Give w(t(u)). -84u4 Let g(m) = 13m*2 + 4m. Let t(x) = -4x2. Give g(t(w)). 208w*4 - 16w*2 Let p(n) = -113n2. Let b(l) = l2. What is b(p(u))? 12769u4 Let o(i) = 11i - 532 + 532. Let d(t) = -t*2. Calculate d(o(b)). -121b*2 Let g(s) = 10s + 4. Let w(f) = 60f + 25. Let r(c) = -25g(c) + 4w(c). Let k(z) = -z. Calculate k(r(h)). 10h Let v(c) = -2c2 + 13. Let t(x) = -2x. Give t(v(b)). 4b2 - 26 Let k(t) = -4t*2. Let w(j) = j - 1021. Calculate w(k(m)). -4m*2 - 1021 Let i(k) = -43k. Let r(u) = 57u2 + 33u. Let m(c) = -7c2 - 4c. Let w(v) = -33m(v) - 4r(v). What is w(i(s))? 5547s2 Let c(g) be the first derivative of g2/2 + 2. Let f(x) be the second derivative of -x3/3 - x + 25. Give c(f(z)). -2z Let a(c) = 2c. Let d(w) = -328w2 + 369. Let s(o) = o2 - 1. Let t(b) = -2d(b) - 738s(b). What is a(t(q))? -164q2 Let t(x) = -7x. Let d be (-16)/(-5) - (-4)/(-20). Let o(r) = -2r2 + dr*2 + 3r*2 - 5r*2. What is t(o(n))? 7n2 Let a = 14 + -5. Let p(g) = -g3 + 5g2 + 2g - 4. Let h be p(5). Let c(z) = hz2 + 9 - a. Let i(j) = j. Determine c(i(r)). 6r*2 Let p be (-4)/(-6)(-6)/(-2). Let c(n) = -3np - n + n. Let m(q) be the second derivative of q4/6 - q. Give c(m(k)). -12k*4 Let y(a) = -2a*2. Let g(z) = 4z + 9. What is g(y(h))? -8h2 + 9 Let m(j) = j2. Let y(t) = 193t*2. Calculate y(m(w)). 193w*4 Let m(u) = 3u*2. Suppose 3t - 7 = -s - 17, s - t - 6 = 0. Let g(c) = -c*2 + 3c + 1. Let w be g(3). Let j(l) = -1 + l*s + w. Determine j(m(f)). 9f*4 Let y(s) = -3s. Let r(q) = q. Let z(c) = -9c. Let k(d) = 51r(d) + 6z(d). Determine y(k(p)). 9p Let k(h) = -2h2. Suppose o = 6o - 20. Let q(p) = p - op + 5p. Give k(q(x)). -8x2 Let j(o) = 5o*2. Let y(t) = 11t*2. What is y(j(z))? 275z*4 Let i(s) = 3s. Let m(f) = -2f2 - 2f - 2. Let a(c) = -2c2 - 3c - 3. Let u(h) = 2a(h) - 3m(h). Give i(u(o)). 6o2 Let o(j) = 2j. Let w(h) = 1912h2. Calculate w(o(t)). 7648t*2 Let h(q) = 11q. Let u(z) = 100z. Let n(d) = -28h(d) + 3u(d). Let t(o) = 3o*2. What is n(t(m))? -24m2 Let z(s) be the second derivative of -s4/4 - s. Suppose -5k = -2a - 9, 2k + 4a + 3 = 21. Let i(g) = -kg2 + 0g2 + g2. Determine i(z(n)). -18n4 Let f(v) = v + 5. Let l(x) = 2x + 6. Let q(d) = -6f(d) + 5l(d). Let u(h) be the second derivative of h*4/4 - 21h. Calculate u(q(y)). 48y2 Let p(o) = 292o. Let l(m) = -2m. Determine l(p(i)). -584i Let j(n) = -n*2. Let i(k) = 2k*2 + 34k + 8. What is i(j(t))? 2t4 - 34t*2 + 8 Let m(i) = 104i*2. Let h(d) = 4d. Determine m(h(c)). 1664c2 Let s(n) = -8n + 1. Let d(c) = 28c + 2. Determine d(s(a)). -224a + 30 Let d(o) = -17o + 2 + 32o - 13. Let g(n) = -2n - 1 + 7 - 6n. Let s(r) = -6d(r) - 11g(r). Let a(k) = -k*2. Determine a(s(y)). -4y*2 Let a(z) = -4z*2 + 58z. Let w(h) = 4h2. Calculate a(w(o)). -64o*4 + 232o*2 Let n(l) = 5l. Suppose 0 = 7u - 3u - 20. Let j(d) = -15d2 + 9d*2 + ud*2. What is j(n(h))? -25h*2 Let c(o) = 3o*2. Suppose -x = x - 22. Let q(j) = -3j + 0j - 4j + xj. Give c(q(h)). 48h*2 Let d(f) = 0f*2 + 0f2 - f2. Let s(o) = -10o. Give s(d(t)). 10t2 Let m(t) be the first derivative of t4/12 + 5t2/2 + 2. Let k(c) be the second derivative of m(c). Let l(b) = -2b*2 + 0b*2 - 3b*2. Calculate k(l(o)). -10o*2 Let o(j) = -7j - 25j + 2j + 13j. Let u(t) = -t2 + t2 + t2. Determine u(o(n)). 289n*2 Let q(v) = 2v*2. Let p be (-2 - 2)(-4)/8. Let t(s) = -192 + 192 - 21sp. What is q(t(o))? 882o*4 Let v(a) = 2a*2 + 15a. Let j(h) = -4h. Determine j(v(b)). -8b*2 - 60b Let b(t) = 3t. Let z(m) = -8m - 14. Determine b(z(w)). -24w - 42 Let k(c) = 2c*2. Let h = -7 + 10. Suppose 0 = 4t - 2r - 30, 3t - 27 = -0r + hr. Let d(n) = 3n2 + 6 - t. Calculate k(d(a)). 18a*4 Let g(a) = -17a*2. Let z(m) = -7m*2. Give z(g(x)). -2023x*4 Let h(l) = -2l. Let y be ((-6)/(-2) - -1) + 1. Suppose yf - 11 - 4 = 0. Let v(m) = -4m + fm + 3m. Determine h(v(a)). -4a Let n = -18 + 20. Let v(z) be the second derivative of 1/6z*4 + 0z*n + 0z*3 + 0 - 4z. Let g(m) = -m*2. What is v(g(t))? 2t*4 Let u(f) be the first derivative of 7f*4/12 + 3f - 2. Let j(n) be the first derivative of u(n). Let b(k) = -1 + 1 + 10k2 - 8k*2. Determine b(j(m)). 98m4 Let u(b) = b. Let w(n) be the second derivative of n3/6 - 3n. Let g(y) = -2u(y) + 4w(y). Let s(a) = 4a*2. Calculate g(s(x)). 8x*2 Let b(l) = -21l + 15. Let g(o) = 3o - 2. Let z(n) = 2b(n) + 15g(n). Let d(h) be the first derivative of -h2/2 - 1. What is z(d(m))? -3m Let u(v) = 2v - 8. Let m(y) = 7y. What is m(u(q))? 14q - 56 Let i(s) = -411s. Let a(p) = -2p2. What is i(a(n))? 822n*2 Suppose 1 = 5g - 9. Let k(o) = go - 2o + 2o. Let l(s) = 7 - 2s*2 - 4 - 3. Give l(k(b)). -8b*2 Let d(u) = 2u*2. Let k(m) = -2345 + 3m - 32m + 2345. Calculate d(k(z)). 1682z*2 Let j(l) = 2l*2. Let i = 2 + 3. Let b(a) = 4a - ia - 6a. Calculate b(j(u)). -14u2 Let s(n) = -n2 + 3n*2 + 0n*2. Suppose g - 5c - 6 = -3c, 5c = -10. Let v(h) = -2hg + 0h - 4h + 4h. Give s(v(k)). 8k4 Let b(x) = -x. Let l(v) = v3 + 5v*2 + 2. Let t be l(-5). Let m(g) = 5g + 0g - tg. Calculate m(b(q)). -3q Let x(l) = -6l. Let m(s) = -48s + 2. Determine x(m(z)). 288z - 12 Let x(f) = -2f2. Suppose 0 = 2g - 26 - 22. Let n(v) = -3. Let k(s) = s + 24. Let o(p) = gn(p) + 3k(p). Determine x(o(r)). -18r2 Let c(k) = -65k2. Let b(f) = -f2. Determine c(b(y)). -65y4 Let d(z) = 1 - 3 - 3 + 4. Let w(a) = a - 3. Let t(q) = 3d(q) - w(q). Let p(l) = -3l. What is p(t(n))? 3n Let o(a) be the third derivative of 13a5/60 - 15a*2. Let n(f) = 6f - f - 3f. Calculate n(o(u)). 26u2 Let v(s) = s2. Let i(z) be the first derivative of 53z2/2 - 21. Give i(v(r)). 53r*2 Let g(x) = -2x. Let l(w) = 2w - 6. Let b be l(4). Let m(y) = -y + 4y*b + y. Calculate m(g(u)). 16u*2 Let i(c) be the second derivative of 4c*4/3 + 28c. Let t(y) = 4y. Give i(t(d)). 256d*2 Let w(g) = -42g*2 + 12g - 12. Let l(a) = -17a2 + 5a - 5. Let z(x) = 12l(x) - 5w(x). Let m(o) = -6o. Calculate m(z(b)). -36b*2 Let r(y) = -3y*2 - 2y. Let f(t) = -16t + 28 - 25t*2 - 28 - t. Let j(c) = 6f(c) - 51r(c). Let q(g) = 2g. Give q(j(n)). 6n2 Let v(k) = 118k2. Let f(r) be the third derivative of -r4/24 + r*2 + 52r. Calculate v(f(g)). 118g2 Let u(f) = -f. Let d(c) = -2c - 203. Give u(d(w)). 2w + 203 Let w(r) = -2r. Suppose 5p - 5l - 5 = 0, -4p + 0l + 2l = -6. Let a(v) = 3v*p + 0v*2 + 0v*2. Determine a(w(u)). 12u*2 Let s(x) = -47 + 4x*2 + 47. Let h(c) = 4c - 2. Let i(k) = -21k + 11. Let n(j) = 11h(j) + 2i(j). Determine s(n(g)). 16g2 Let s(q) be the third derivative of q5/30 - 5q2. Let z(c) = -6c2 + 16. Let l(i) = i2 -	{ "pile_set_name": "DM Mathematics" }
a - 6a + a*2. Calculate w(-9). -2 Let b = 61 - 59. Let u(t) = -2t*2 + 2t - 2. Determine u(b). -6 Suppose x = 1 + 2. Let y(h) = -5h3 - 2h*2 - 7h - 1. Suppose 3w - 22 + 1 = 0. Let l(z) = 2z3 + z2 + 3z. Let m(a) = wl(a) + xy(a). Calculate m(0). -3 Let m(a) = -4a2 + a + 1. Let n(x) = -x3 - 2x2 + 2x - 1. Let w be n(1). Let z be 2w(-3)/(-12). Calculate m(z). -4 Let p(k) = 4k2 - 4k + 3. Let o(v) = v*2 - 7v + 8. Let d be o(6). Let w be p(d). Suppose 1 - w = 2f. Let j(i) = -i2 - 4i + 4. Calculate j(f). -1 Let d(r) = -6 - 3r - r2 + 0r*2 + 8r*3 - 4r. Let x(i) = -7i3 + i2 + 6i + 5. Let p(s) = 4d(s) + 5x(s). Determine p(-1). 3 Suppose 18 = j + 5q, 11j + 4 = 15j + 3q. Let r(x) = 5x2 + 3x + 3. Determine r(j). 17 Let b(d) = -9d2 + 4d - 1. Let l(z) = 18z2 - 9z + 3. Let g(v) = 5b(v) + 2l(v). What is g(-1)? -10 Let i = -6 + 10. Let c(g) be the second derivative of -1/4g4 - 2/3g*3 + 1/20g*5 + 0 + 3g*2 + 4g. What is c(i)? 6 Let y(q) = q - 2. Suppose 5h + d - 37 = 18, 0 = -4d. Suppose 5g = 4 + h. Let p be y(g). Let a(k) = -6k3 + k2 + k - 1. Determine a(p). -5 Let a(i) = 8i3 - i + 1. Let x be ((-9)/(-6))/((-3)/(-2)). Determine a(x). 8 Let s(m) = -4m*3 - 10m*2 - 4m + 2. Let c(z) = z3 + z2 + z. Let i(l) = 5c(l) + s(l). What is i(2)? -8 Let q(x) = 5x + 4. Suppose -8v - 22 = 10. Give q(v). -16 Let l = 0 - -1. Let a be (-2)/(0 - (l - -1)). Let o(p) = 3p*3 + p. Let n be o(a). Let j(y) = 3y - 5. Determine j(n). 7 Let o(b) be the first derivative of b5/12 - b3/6 - b2/2 - 1. Let p(u) be the second derivative of o(u). Let t = 3 + -2. Give p(t). 4 Let w(p) = p3 + 6p2 - 4. Let o = -27 - -16. Let g = o + 5. Determine w(g). -4 Let y(m) be the first derivative of 1/4m*4 - 7m - 2m3 + 8 + 1/2m*2. Give y(6). -1 Let m(z) = -7z*2 + 20z*2 + 7 + z - 12z*2. Determine m(0). 7 Let o(a) = 2a*2 + 2a + 1. Suppose -i + 10 = 4x + i, 0 = 5x - i + 5. Suppose -3v - 2v - 10 = x. What is o(v)? 5 Suppose -2x + 5x = 12. Let m(v) = 6v2 + v - 9. Let r(g) = 7g*2 + 2g - 10. Let y(z) = 6m(z) - 5r(z). Calculate y(x). -4 Let y(u) = -u. Let z = 7 + -7. Let w = z + -3. Give y(w). 3 Suppose 2u = 10 + 212. Let k be 4/14 - u/21. Let o(a) = -a2 - 7a - 6. What is o(k)? 4 Let f(r) = -r*3 - 8r*2 + 9r - 4. Let d(s) = 2s3 + 15s*2 - 17s + 8. Let m(x) = 4d(x) + 7f(x). Give m(-5). 4 Let r be 8/3(-66)/44. Let p(s) = -4s + 1. Let h(a) be the second derivative of 5a3/6 - a2/2 + a. Let w(i) = -5h(i) - 6p(i). Calculate w(r). 3 Let t(j) = -1 + 3 + 3j - 3 + j*2. Let q be t(-4). Let x be (2 - q)(-5)/1. Let i(d) = -d - 2. Calculate i(x). -7 Let s(z) be the first derivative of -z6/360 - z4/8 - z3 - 5. Let j(t) be the third derivative of s(t). Give j(0). -3 Let b(n) = n2 + 6n + 1. Suppose 4t - 2t + 22 = 0. Let k = t - -5. Let a = k - -3. Calculate b(a). -8 Let j be (-2 - -4) + (-4)/2. Let o(m) = 5 - m + 1 + 0. Calculate o(j). 6 Let p(j) = 1 + 3j - 4j + 23j*2 - 14j2 - 2. What is p(-1)? 9 Let h(m) = -m + 13. Let r be 1 - 4 - 1 - -1. Let f be (9/(-6))/(r/14). Calculate h(f). 6 Let l = -6 + 11. Let g = l + -5. Suppose -u - 1 + 0 = f, u - 5 = g. Let o(i) = i3 + 6i2 - i - 4. Determine o(f). 2 Let z be -22((-5)/(-2) + -3) + -3. Let d(g) = g*2 - 7g. What is d(z)? 8 Suppose 5z = -23 - 2. Let j(k) = -k2 - 6k + 1. Calculate j(z). 6 Let w be -1(-1)/(-3)-3. Let n(x) = -7x2 - 4x + 3. Let u(a) = a*2 - a + 1. Let t(o) = -n(o) + 2u(o). Give t(w). 10 Let r(t) = -t*3 + 6t2 - 2. Let w be r(6). Let a(j) = -j3 - 4j2 + 3j + 3. What is a(w)? -11 Let j(f) = -11f2 - 7f + 6. Let c(h) = -5h2 - 3h + 3. Let p(i) = -9c(i) + 4j(i). Determine p(3). 3 Let k(v) = v*3 - 3v*2 + 5v - 3. Let a(l) = -14l - 14. Let y(w) = 5w + 5. Let h(o) = 6a(o) + 17y(o). Let q be h(2). What is k(q)? 12 Let m(w) = w*2 - 7w + 6. Let y be 2 - ((-6)/(-4)4)/(-1). Give m(y). 14 Suppose k - 3 = 4k. Let q(j) = -7j. What is q(k)? 7 Let k(g) be the second derivative of g4/4 - g3/3 - g2/2 - 6g. Calculate k(-1). 4 Let m be -1 - -1 - 0/(-1). Let r(o) = 7o + 17. Let b(l) = -20l - 50. Let i(p) = p*2 + 7p - 5. Let n be i(-4). Let s(k) = nr(k) - 6b(k). Give s(m). 11 Let y = -115 - -119. Let c(b) = b*2 - 6b. Give c(y). -8 Let q(m) be the second derivative of m*3/6 - 2m*2 - 5m. Let r(x) = -x - 2. Let c be r(-8). Calculate q(c). 2 Let v(i) = -4i3 - 4i2 + 5. Let w(l) be the third derivative of -l6/120 - l*5/60 + 4l*2. Let t(f) = -v(f) + 3w(f). Let u = 2 + -2. Determine t(u). -5 Let t(i) = -i - 4. Let s = -19 + 29. Suppose -3o = -o + s. What is t(o)? 1 Let r be (2 - 0)/((-3)/96). Suppose -6g + 3g + 3 = 0. Let p be g/(-3) + r/(-12). Let x(t) = t3 - 4t*2 - 5t - 7. Determine x(p). -7 Let i(b) = 2 - b*2 + 2b*2 + 0. Suppose -w = -w - 3w. What is i(w)? 2 Let s(b) = b*2 + 2b + 2. Let p(n) = n*3 + 10n*2 + 8n - 11. Let h be p(-9). Let i be s(h). Let j(x) = 4x + i + 1 + x2 + x. Give j(-3). -3 Let k = -10 + 13. Let r(o) = 2o - o + 8o + 2 - k. What is r(1)? 8 Let a be (1/4)/(2/8). Let r = a + 2. Let s(y) = 2y*3 - 3y + 2yr + 5y*2 - 5y*3. Calculate s(4). 4 Let b be 12(10/4 + -2). Let z(f) be the first derivative of f*3/3 - 2f*2 - 2f + 7. Determine z(b). 10 Let a(j) = 7j2 + 5j + 1. Let d(w) = 6w2 + 5w. Let x(n) = 5a(n) - 6d(n). Suppose c + 3c = -24. Determine x(c). -1 Let o = -4 + -2. Let x(p) = -p3 - 7p*2 - 7p - 5. Calculate x(o). 1 Let v(g) = -g*3 + 6g*2 - 6g + 2. Let j be ((-18)/(-24))/(6/40). Determine v(j). -3 Let x(t) = -21t - 25t + 49t + 3. Suppose -q + 5 - 1 = 0. Suppose -5m - qs = 16, 10 + 11 = -4m + 5s. Calculate x(m). -9 Let g = 139/3 - 46. Let f(l) be the first derivative of 4l - 1 - gl3 - 2l2. Give f(-5). -1 Let w(c) = 0 - c2 + 6c - 8 + 1 + 2. Give w(4). 3 Let h(m) = 5m*2 - 5. Let x(g) = -6g*2 - g + 6. Let n(k) = 5h(k) + 4x(k). Calculate n(5). 4 Suppose -j - 4 + 19 = 0. Let i(c) = jc + 5 - 2c2 + 3c*2 - 8c. Calculate i(-5). -5 Let t(h) = -h. Let z(o) = -o*3 + 5o2 + 3. Let r be z(5). Let w = 4 - r. Let j(c) = -c2 - 3c + 3. Let q(x) = wj(x) + t(x). What is q(2)? -9 Let b(n) = n*3 + 6n*2 + 6n. Let a be b(-5). Let h(x) = -3x3 - 5x*2 + 2. Let t(c) = -4c*3 - 5c*2 + 3. Let l(k) = ah(k) + 4t(k). Determine l(5). 2 Let c be 0 - 2 - 12. Let s(d) = 2d2 + 11d - 5. Let z(w) = -2w2 - 12w + 6. Let v(r) = 6s(r) + 5z(r). Calculate v(c). 8 Let z(i) = -i3 + i2 - i + 6. Let o be (1 - (2 - 1)) + -2. Let f be o + (18/3)/3. Give z(f). 6 Suppose -t = -2 - 4. Let f(r) = -9r - 13. Let h(b) = -5b - 6. Let g(d) = tf(d) - 11h(d). Suppose 0a = -3a. What is g(a)? -12 Let d(v) = -v*2 + v + 5. Let f = 5 - 2. Suppose j = -fj. Give d(j). 5 Suppose -48 = -5b - 13. Suppose 0 = -3l - 5q + q + b, -5q = 2l - 14. Let u(t) = t - 2. Determine u(l). -5 Let y(r) be the first derivative of r4/4 + 4r*3/3 - 3r*2/2 + 5r - 1. Let o(w) = 13 + 3w2 + 33w - 22w - 2w*2. Let j be o(-9). Give y(j). -5 Let m(q) = -q + 1. Suppose 2n - 6 = -0. Calculate m(n). -2 Let s(m) = m*3 - 2m*2 - m - 2. Suppose -12 = -3i, 5o = -4i + 5 + 36. Suppose 0 = -4r - r + o. Let a be -1 + 5 + (r - 2). Determine s(a). 4 Let k(m) = 4m*2 - 2m - 5 + 10 - 8m2 + m3 + m. Determine k(4). 1 Let r(n) = 6n*3 + n - 1. Suppose 0 = -6u + 3u + 15. Suppose -3 = 2q - u. Let l be r(q). Let o(f) = f - 3. What is o(l)? 3 Suppose 0 = 4d - 2 + 14. Suppose -3j = 2j - 35. Let q(x) = 2x - 9. Let s(w) = -5w + 19. Let t(c) = jq(c) + 3s(c). Determine t(d). -3 Let n = -3 - 4. Let h(z) = -5 - z + 2z + z*2 + 4z - 1. Let p(s) = -s*2 - 5s + 7. Let d(i) = nh(i) - 6p(i). Determine d(-5). 0 Let r be 3/(-6) + (-2)/4. Let b(y) = -y*2 - y. Let i(q) = 3q*2 + 11q. Let m(u) = ri(u) - 4b(u). Give m(4). -12 Let p = -29 + 30. Let m(x) = -x - 7 + 4 - p. Suppose -5i - 4s = 1 - 28, -3s + 18 = 3i. Give m(i). -7 Suppose 2w - 4w = -d - 5, -10 = w - 3d. Let m(y) = -y3 + 6y*2 - 5y + 1. Give m(w). 1 Let g(u) = -u*2 + 11u + 12. Let m be g(9). Suppose -5t + 10t - m = 0. Let k(h) = 0h3 - th2 - h3 + h - 2 + 3h*2. Calculate k(-3). -5 Let o(t) be the th	{ "pile_set_name": "DM Mathematics" }
(-6)/(-7)(28/6 + -5). What is the second smallest value in w, c, y? y Let j = -156 - -156. Which is the smallest value? (a) 3 (b) 4 (c) j c Let s = 15.3 - 16. Let a = s - -0.4. Let h = 1/320 + 63/320. What is the second smallest value in 1, a, h? h Let g(i) = -i3 - 3i*2 + 3i - 4. Let r be g(-4). Let s = -589/70 - -41/5. Which is the second smallest value? (a) 0.4 (b) s (c) r c Let l be ((-4 + 4)/2)/(-4). Let h be l/3 + -4 + 9. Let g be h + (3 - 12/3). Which is the biggest value? (a) g (b) 0.5 (c) -4 a Let q be (-1)/30 - 36/18. What is the biggest value in 13/6, 5, q? 5 Let o be -2(-8)/(-18)(-6)/(-8). What is the smallest value in 4/5, 5, -40, o? -40 Let o be 1 + 0 + (2 - 59). Let p be 1/3 + o/24. Let n be (7/21)/(2/p). Which is the third smallest value? (a) n (b) -1/10 (c) -2 b Let v be 3(-3 + (264/(-9))/(-8)). Let n = 7 - 6. Which is the biggest value? (a) v (b) -0.2 (c) n a Let j = -249 - -239.4. What is the third biggest value in -0.5, j, -4? j Suppose u + 607 = -2j, -2990 = 5u - 3j - 2j. Which is the biggest value? (a) u (b) -1 (c) 0.2 c Let i be (-80)/(-140)(-21)/(-6). Which is the second biggest value? (a) i (b) -22 (c) -3 c Let w = -112/3 + 37. Let q = 0.801 + -0.301. What is the third smallest value in q, 1/6, w? q Let z be (738/1312)/(-1 + (-2)/4). Which is the third biggest value? (a) -0.4 (b) z (c) 19 a Let v = -0.7 - -1. Let d = 0.4 - 6. Let j = d + 0.6. Which is the biggest value? (a) j (b) 0.5 (c) v b Let l = 0.243 - -0.157. What is the smallest value in -1, l, -8? -8 Let p(j) = -j3 - 12j*2 + 80j - 88. Let w be p(-17). Let k = 0.2 - 0. Which is the second smallest value? (a) k (b) w (c) -5/7 c Let o = 2358 + -2353. What is the second biggest value in -3, 1/15, o, 4? 4 Let p = 1156 + -1158. Let w = -0.36 + 0.06. Let o = w - -0.1. Which is the third smallest value? (a) o (b) 3/5 (c) p b Let d = -2 + 34. Let o = 36 - d. What is the fourth smallest value in -3/4, 1/2, -4, o? o Let o = -20.4 + 19. Let a = -0.4 - o. What is the smallest value in -2, a, -2/15? -2 Let b be ((-16)/30)/(76/(-190)). What is the third smallest value in -60, b, -1/6? b Let t = -44 + 44.148. Let a = -5.068 + t. Let z = a + -0.08. What is the biggest value in 0.4, z, 0.2? 0.4 Let o = -39 - -38.66. Let l = -0.04 - o. Let q = -1.8 + -0.2. What is the third smallest value in l, q, -5? l Let g = 1.3 - 0.8. Let k = g + -0.1. Let d = -0.03 - 0.37. Which is the third biggest value? (a) d (b) k (c) 2 a Let m = 0.73 - -80.27. Let f = m + -80.5. Which is the third smallest value? (a) -2 (b) f (c) 0.08 (d) 2/9 d Let d = -93 + 92.9. Suppose 15 + 39 = -3w. What is the third biggest value in d, w, 2? w Let l = 2 + -2.5. Let y = 30 + -16. Let n = 10 - y. Which is the biggest value? (a) n (b) 1/3 (c) l b Let x = -89.5 - -89. Let z = -0.01 - -0.01. Which is the smallest value? (a) z (b) -3 (c) x b Let q be (-320)/(-25)(-5)/(-2). Let t = q - 35. What is the second smallest value in t, -4, -1/8? t Let x = -1.9 + 0.6. Let s = 0 + 0. What is the third smallest value in -1, x, s? s Let s = 0.27 + -2.87. Let c = s + 3. Let u = 1160.4 - 1161. What is the biggest value in c, u, -4? c Let u be 1/(2 - 10/4). What is the smallest value in -5/2, u, -1/6? -5/2 Suppose 0 = 4g + 4p - 12, -5g + 3p + 5 = -g. Let j be 0 + g - (-11)/(-6). Let f = 448 - 454. What is the second biggest value in 3, f, j? j Let l = -1195 + 1192. Which is the fourth biggest value? (a) -1/6 (b) -77 (c) l (d) -5 b Let i be 14 + (-9 + 10)/(1 - 0). Suppose 9q = -i - 12. Which is the third biggest value? (a) 0.4 (b) q (c) -2 (d) -0.03 c Let g be (7 + (-75)/10)0. What is the biggest value in 7, g, 0.4, -3/2? 7 Let k = 301 - 278. Which is the second smallest value? (a) k (b) 2/19 (c) -5/3 b Let y = -59 - -1241/21. What is the fourth smallest value in y, -2/17, -2/9, 0.4? 0.4 Let h = 174.2 - 174. Which is the third smallest value? (a) 19 (b) -5 (c) h a Let g = -0.0085 - -0.0085. Which is the biggest value? (a) 3 (b) g (c) -9 (d) 2 a Let m = -44 - -41.7. Let s = 2.1 + m. Let q = -27/2 + 13. Which is the smallest value? (a) q (b) s (c) -2 c Let l = -348.9 + 349. Which is the second biggest value? (a) 0.2 (b) -0.005 (c) l (d) 0 c Let r be -4(-2)/(-2) + 110/45. What is the second biggest value in r, -0.04, 2/9? -0.04 Let s = -246 - -246.1. Which is the third biggest value? (a) s (b) 4 (c) -1.8 c Let q(n) = -n2 - 4. Let f be q(0). Let s be (-11)/(-2) - 4/8. Which is the third smallest value? (a) f (b) s (c) 0 b Let y = 0.5 + -0.1. Let s be (-7)/(-14) + (-23)/2 + 3. Let v be (2/s)/(385/120 + -3). Which is the third smallest value? (a) y (b) v (c) -2 a Let o = -6 - -6.1. Let i = -1.1 + o. Let x = 2 - i. Which is the second smallest value? (a) 1 (b) x (c) -1/8 a Suppose -5z = 2n - 7n - 30, -n = 5z - 6. Let c = -105 - -106. What is the second smallest value in 2/9, z, c? c Let u = -11/3 - -10/3. Let v = 93 - 51. Let p be 14/24 - 14/v. Which is the second smallest value? (a) u (b) p (c) -0.5 a Let r = 2591/346 + 2/173. What is the second smallest value in 0.5, r, 0.1, -3/7? 0.1 Let b = -0.02 - -1.02. Let i = -74/5 + 15. Let n = 7/15 + i. What is the biggest value in b, n, -0.4? b Let g = 0.2 + -0.5. Let x be -4-12/4. Let k be (1/5)/(1/x). Which is the biggest value? (a) g (b) k (c) 5 c Suppose -53x = -86x + 33. What is the second smallest value in 0.1, -0.2, x, -2/11? -2/11 Let u = 0.399 - -1.831. Let h = u + -0.23. Let i = -0.1 - 3.9. What is the smallest value in 1/12, h, i? i Let w = 4.5 - 7.2. Let h = -5.7 - w. Let v = 5.6 - 6. What is the third smallest value in v, -6, h? v Let f = 20 + -21. Let g be 1 + f + (22/4 - 4). Which is the second smallest value? (a) g (b) 6 (c) -0.5 a Let r = -103/69 + 42/23. Let j = 0.36 + -0.46. What is the biggest value in r, -8, j? r Let o = -0.09 + -0.01. Let n = o + -0.7. Suppose 0 = -7c + 3c. What is the second biggest value in c, n, -2/5? -2/5 Let x = -1.072 - -0.072. Let j be (52/78)/((-14)/(-6)). Which is the third smallest value? (a) j (b) -6/5 (c) x a Let w be ((-8)/(-6))/(((-8)/(-1668))/1). Let l be 6/4 - (w/52 - 4). Which is the biggest value? (a) 0.2 (b) -13 (c) l a Let y = -3.97 + -0.03. Suppose 244 = 4s - 232. Let t be -14 + 442/s. What is the second smallest value in 0.4, y, t? t Let u = 0.06 + -2.06. Which is the smallest value? (a) u (b) 1/3 (c) 46 (d) -1 a Suppose -26t + 152 = -22t - 5r, -r = -3t + 103. Which is the third biggest value? (a) t (b) 0.4 (c) 0.3 c Let t = -6.7 - -7. Let j = 5561 - 5559. Which is the fourth biggest value? (a) t (b) 0.4 (c) j (d) -5 d Let o = -0.023 + 33.023. Let x = -32.6 + o. Which is the biggest value? (a) -0.4 (b) 4 (c) x b Let t be 2/(-8) - 1/2. Let l be 0 - (1 - 0 - -51). Let j be 7/35 - l/(-10). Which is the biggest value? (a) j (b) -1 (c) t c Let d = -45.1 + 47.1. What is the third biggest value in -10/3, d, 2/5, 0? 0 Let c = 6.9 - 7. Suppose -q + 5 = -6q. Let y = -74 - -78. What is the smallest value in c, y, q? q Suppose 0 = -3f - u + 7, -3u + 7 = 2f - 7. What is the third smallest value in 2/53, f, -5? f Let m be (-1)/680/120. Which is the fourth smallest value? (a) 2/7 (b) m (c) 1 (d) -0.5 c Let k(m) = -m*2 + 17m - 1. Let l be k(0). Which is the smallest value? (a) -0.053 (b) 1 (c) l (d) 0.1 c Let q = -39.06 - 0.94. Let w = q - -42. What is the third biggest value in w, -6, -4? -6 Let b(j) = j*3 - 3j*2 + 4j - 3. Let t be b(2). Let u = 2.0689 - 1.9689. What is the fourth biggest value in 1/3, u, t, 0.18? u Let v = -43/150 + 3/25. Which is the third smallest value? (a) 3 (b) -5 (c) v a Suppose -10 = -5k - 0. Suppose 33 - 9 = kl. Suppose 10 = -5f - 3y, 4f + 3y - 1 = -l. What is the second smallest value in -2/19, f, -4? -2/19 Let j = 425 + -429. What is the third smallest value in -2/7, j, 0.005? 0.005 Let t = 63 - 62.92. Let u = t - 0.48. What is the fourth biggest value in 2, u, 0.1, 1/5? u Let r = -21.9 - 2.5. Let x = -24 - r. Which is the third biggest value? (a) -0.02 (b) x (c) 4 a Let v be 1/(10/(-4) + -2). Suppose 0 = -3w + 2d + 583, 0 = -3w - 0d + d + 578. Let o = w - 2100/11. Which is the third biggest value? (a) 0 (b) o (c) v c Let i =	{ "pile_set_name": "DM Mathematics" }
ors of b(-3)? 2 List the prime factors of (1/(-4))/((-6)/552). 23 Let p = -26 + 37. List the prime factors of p. 11 Let b be 150/35 - (-2)/(-7). Let q be (1 + -2)/(b/(-12)). Suppose qp + 2 - 29 = 0. What are the prime factors of p? 3 Suppose 0 = -2k + k + 4. Suppose 0 = -5w - kh + 102, -10 = -3w - 3h + 53. What are the prime factors of ((-4)/(-12))/(2/w)? 3 Let t be 3/(-4) - 95/(-20). Suppose tn - 2n + 650 = 0. What are the prime factors of n/(-35) + (-4)/14? 3 Suppose -6o = 4o - 1610. What are the prime factors of o? 7, 23 Let g(i) = -i*3 + 2i*2 - i - 1. Let z be g(2). Let x be 0/(z/1)1. List the prime factors of (-9 + 0)/(-1 + x). 3 Suppose -2w - 2l = 3w - 293, 3l = 5w - 273. What are the prime factors of 6/(-15) + w/5? 11 Let d = 6 + -12. Let t(f) = -f3 - 2 + 6f + f - 5f2 - 2f. What are the prime factors of t(d)? 2 Suppose -4f - o + 40 = 0, 2o - 7 = -f + o. Suppose -5g - f = -3x - x, g - 50 = -5x. Let v = -6 + x. What are the prime factors of v? 3 Suppose -11x - 294 = -13x. What are the prime factors of x? 3, 7 Let h(c) = -29c - 5. Suppose -4i + 0 = 8. List the prime factors of h(i). 53 Let p(h) = h3 + 7h*2 + 2h + 2. Let v be p(-7). What are the prime factors of (-159)/(-12) - (-3)/v? 13 Suppose 5s + 16 - 1 = -g, 5g + 75 = s. What are the prime factors of (-1)/((g/(-24))/(-5))? 2 What are the prime factors of 2/3(-477)/(-6)? 53 Let q(f) = f3 - 15f*2 - 12f - 4. List the prime factors of q(16). 2, 3, 5 Suppose -4t + 1316 = 3o, 0t + 2o = 3t - 1004. Let r be ((-2)/4)/((-2)/t). Suppose 5w = r - 3. List the prime factors of w. 2 Let o = -11 + 13. Suppose -ov = 4q - v - 105, v = 2q - 51. What are the prime factors of q? 2, 13 Suppose 0 = b - 165 + 53. What are the prime factors of b? 2, 7 Suppose -4n - 80 = n. Let b = 33 + n. List the prime factors of b. 17 Let v(n) = 25n - 4. Let p(m) = -25m + 5. Let t(w) = -3p(w) - 4v(w). What are the prime factors of t(-1)? 2, 13 Suppose 9 = -2m + 3m. Suppose -y + 6 = 5j, -2y + 3 = 2j - m. What are the prime factors of (-3)/y + (-46)/(-4)? 11 Let y = -9 - -13. Suppose 0 = 3k + 5 + y. List the prime factors of (0/(-1) - k)2. 2, 3 Let b(t) = t2 - 12. Let z(q) = 2q*2 - 24. Let g(v) = -13b(v) + 6z(v). What are the prime factors of g(0)? 2, 3 What are the prime factors of 1 - (-1 + (0 - 21))? 23 Let g(n) = -n2 + 5n + 7. Let q be g(6). Let s = q + 3. Suppose -4v - s = -48. What are the prime factors of v? 11 Let b = 132 - -21. What are the prime factors of b? 3, 17 Let n(i) = i2 + 5. Suppose g = -p - 1, -2 = 3g - p + 1. Let w = 1 + g. What are the prime factors of n(w)? 5 Suppose -2a + 2i = 0, -5a - 2i + 6i - 1 = 0. Let n(g) = -14g + 1. What are the prime factors of n(a)? 3, 5 Let w(r) = r + 9. Let u be w(-7). Let c(a) = 3a - ua - 6 + 4a. List the prime factors of c(4). 2, 7 Let l(w) = -w2 + 7w + 21. Let y be l(7). Let j = y - 0. What are the prime factors of j? 3, 7 Suppose 0 = v + 3p + 9, 4v + 8p - 3p + 57 = 0. Let u = -13 - v. List the prime factors of u. 5 Let g(l) = 2l3 - 7l*2 - 2l + 18. List the prime factors of g(6). 2, 3, 31 Suppose -8r = -3r - 40. Suppose 3h + r = 7h. Suppose -3a = 2b - 25, -5b = -5a + ha + 32. What are the prime factors of a? 3 Let r = -6 + 8. Let p = 1 + r. List the prime factors of p. 3 Suppose 2r - 118 = 2n, -n = -5r + 322 - 27. What are the prime factors of r? 59 Suppose o = 2u + 62, o - 2u - 224 = -3o. List the prime factors of o. 2, 3 Let p be 0(-3)/(-9) + 6. Suppose 3x - 45 = -p. List the prime factors of x. 13 Let b be 6/15 - (-96)/10. Let q = b + -5. Suppose -53 = -qy + y - 5u, 4y + 2u = 38. What are the prime factors of y? 7 Suppose -9o = -0o - 54. What are the prime factors of o? 2, 3 Let k be 12/(-15)10/(-4). Suppose 2r + k = 3r. Suppose -h + 36 = 4g, rh + 2g = 6g + 24. What are the prime factors of h? 2, 5 Let y be (-1 - 11)(-2)/4. What are the prime factors of 12 - ((y - 3) + -2)? 11 Let m(k) = -5k + 4. List the prime factors of m(-6). 2, 17 Let f be (12/8)/(2/12). Let x = 17 - f. What are the prime factors of x? 2 Let h = -9 - -44. List the prime factors of h. 5, 7 Suppose -2q - 50 = -4q. Suppose -4k = 4i - q - 35, -3 = -k - 4i. What are the prime factors of k? 19 Suppose 5k = 2k + 180. Suppose -3t + 3x = -k, t + x + 0x - 26 = 0. What are the prime factors of t? 23 Suppose 25 = -0i - 5i. Let b be ((-2)/i)/(3/15). List the prime factors of b + -2(-22)/4. 13 Let m be (02/6)/(-2). Suppose m = -4g + 3s - 4 + 64, 0 = -4g + s + 52. What are the prime factors of g? 2, 3 Let k(u) = -u - 1. List the prime factors of k(-3). 2 Let h = 304 + -761. What are the prime factors of h/(-8) - (-1)/(-8)? 3, 19 Let f(c) = -c3 + 6c*2 + 13c - 6. Let x be f(9). What are the prime factors of x/1510/(-4)? 2, 11 Let w(u) = 11u*2 - u - 4. Let o be w(2). Let x = o - 16. List the prime factors of x. 2, 11 Suppose 4p + 2r = 82, 3p = 3r + 42 + 15. Let a = 42 - p. What are the prime factors of a? 2, 11 Suppose 3m - 6m + 5i + 177 = 0, -335 = -5m - 5i. What are the prime factors of m? 2 Let y(h) = -h*2 - 4h + 4. Let o be y(-4). Suppose -2d - d + 221 = 5b, -ob = -d - 170. What are the prime factors of b? 43 Suppose -2j + 50 = 3j. What are the prime factors of j? 2, 5 Let t(b) = -b2 + 12b + 14. List the prime factors of t(10). 2, 17 Suppose -7 = 5v + 4z - 2, 4v + 3z = -5. Let m be (v/(-2))/(2/4). Suppose -5u + m = -15. List the prime factors of u. 2 Let o = -11 - -20. Suppose 5g = 4g + 2. Suppose -q - gh + 17 = 0, oh = -q + 4h + 29. List the prime factors of q. 3 Let z(p) be the first derivative of p3/3 + p2 - 4p + 1. Let c be z(6). Suppose 0 = -3s - 5 + c. List the prime factors of s. 13 Let x(k) = -6k - 1. Let l be 311/(-3). Let p be x(l). Suppose -1 = -g - 5b, 0g + pg = -5b + 85. List the prime factors of g. 3, 7 Let c = 9 + 25. What are the prime factors of c? 2, 17 Let l = -221 + 434. What are the prime factors of l? 3, 71 Suppose g = 9 + 67. What are the prime factors of g? 2, 19 Let s be 6/1(3 + -1). Let p = -4 + s. List the prime factors of p. 2 Suppose -3k = n - 4k - 58, 5k + 184 = 3n. What are the prime factors of n? 53 Suppose -3v = 3i - 189, -317 = -5v - 6i + 3i. Let f = 93 - v. What are the prime factors of f? 29 Let f(j) = -j3 - 7j*2 + 5j - 1. Let b = -11 - -4. Let q be f(b). Let w = 55 + q. List the prime factors of w. 19 Let j = -37 - -21. Let f = 22 + j. What are the prime factors of f? 2, 3 Suppose -6m + 125 = -m. What are the prime factors of m? 5 Let g(j) = -j2 + 6j - 3. Let i be g(5). Suppose 0 = iy - y. Suppose yw + 7 = w. List the prime factors of w. 7 Let n = 0 - -3. Let p be ((-4)/5)/(n/(-30)). What are the prime factors of (-16)/p5/(-1)? 2, 5 Suppose 4j + 0a - 5a - 33 = 0, 0 = 5j + a - 5. Suppose -28 = -jf - 0f. What are the prime factors of f? 2, 7 Let k(q) = -2q - 12. Suppose 2b + 14 = -2. Let s be k(b). List the prime factors of s5/((-10)/(-3)). 2, 3 Suppose y - 58 = b, 0 = -3y - 4b - b + 134. List the prime factors of y. 53 Suppose -2 = -3q + 1, 25 = 4s + 5q. Let i = s + -4. Let c(g) = 7g*2 - g. What are the prime factors of c(i)? 2, 3 Let c be (1 + 2)/3-7. Let w = -2 - c. What are the prime factors of w? 5 Suppose 0c - a - 16 = 3c, -7 = 2c - 3a. Let v be (0 + -1 - -1) + c. Let b(h) = -h*3 - 5h*2 + 5. What are the prime factors of b(v)? 5 Suppose -3q + 2q = -2. Let w(o) = -2o*q - 4o*2 - 9 - 2o - 3o + 7o*2. List the prime factors of w(8). 3, 5 Let l be (-4)/(-2) + (-90)/(-1). List the prime factors of 12/28 - l/(-14). 7 Let j be (1 - -13) + 21. Suppose -2u = 2v - j, 0u + v = 5u - 64. List the prime factors of u. 2, 3 Suppose -5i - 2s + 6s + 73 = 0, 4i + 5s = 83. List the prime factors of i. 17 Let n be 1 - 11(-2 + 1). Suppose 2u = 3u - n. List the prime factors of (-3)/u - 34/(-8). 2 Suppose 4s = 2q - 52, 5s - 8 - 17 = 0. List the prime factors of q. 2, 3 Let x be -1 + 58 + 1 + 2. What are the prime factors of ((-16)/(-5))/(8/x)? 2, 3 Let k(j) = j3 + 13j*2 + 10. List the prime factors of k(-13). 2, 5 What are the prime factors of ((-17)/(-2)12)/1? 2, 3, 17 Let p be 1 - (1*75 - -2). Let y = 1 + 8. List th	{ "pile_set_name": "DM Mathematics" }
m - u + 389. List the prime factors of m. 3, 5, 13 Suppose -5a - 51992 = -g, -48g - 103984 = -50g + a. What are the prime factors of g? 2, 67, 97 Let u = 22381 + 9510. List the prime factors of u. 31891 Suppose 3q + 0r = 2r + 3065, 0 = 2q - 2r - 2042. Suppose -q = -3b - 0b. What are the prime factors of b? 11, 31 Let p be 176/33 + 4/(-3). Suppose -12b - 533 = -14b - 3f, pf - 274 = -b. What are the prime factors of b? 2, 131 Let w(s) = -19s + 63. Let h be w(6). Let l = h + 92. Let g = 238 - l. List the prime factors of g. 197 Let l = -391 - -799. Let h(a) = -a3 - 3a*2 + 2a - 3. Let n be h(-4). Suppose -nb - l = -4p, -5p + 408 = -p + 2b. What are the prime factors of p? 2, 3, 17 List the prime factors of (149535/(-6))/((-171)/114). 5, 3323 Suppose -4r = 91o - 96o - 3356, 2o = 5r - 4212. What are the prime factors of r? 2, 211 Let n(a) = 78a - 80a + 7 - 3a*2 + 0a*2 + 4a*2. What are the prime factors of n(6)? 31 Let q = 11299 + 3349. List the prime factors of q. 2, 1831 Let l = 3976 + 223. Suppose -9v + l = 10v. What are the prime factors of v? 13, 17 Let a(h) = 11h - 1 + 2h2 - 3h*2 - 23h - 39h3 + 9h. What are the prime factors of a(-2)? 313 Let m(g) = -g*2 + 2g + 31. Let s be m(7). Let t be 2/((s/(-61))/2). Suppose b - t = -0b. What are the prime factors of b? 61 Let o = 30 - 15. Suppose 38 = -15s + 158. Let r = o - s. List the prime factors of r. 7 List the prime factors of (-122)/2196 - 2128540/(-72). 17, 37, 47 Suppose 3g + 5l + 344 = 0, 0l = -3g + 4l - 335. Let p = -90 - g. List the prime factors of p. 23 Let y = 82 + -94. Let n be (-24)/202910/y. Suppose -6x = -3x - n. What are the prime factors of x? 97 Let i be -88(2 - (1 - -2)). Let n = 55 - i. Let g = 208 + n. List the prime factors of g. 5, 7 Let g(u) = -1172u - 181. List the prime factors of g(-5). 3, 631 Suppose -6w + 2w - 124 = 0. Let m be (-11)/(1 - (-40)/(-36)). Let h = w + m. What are the prime factors of h? 2, 17 Let c(y) = -y*2 + 9y + 3. Let h be c(9). Let t(z) = 49z3 + z2 + 5z - 1. Let p be t(2). Suppose -hl + 183 = -p. List the prime factors of l. 2, 7 Let h(t) = -11t*3 + 3t*2 + 23t + 19. List the prime factors of h(-8). 5659 Suppose 53t + 20t = -30t + 5763365. What are the prime factors of t? 5, 19, 31 Let g = 12851 + -6055. List the prime factors of g. 2, 1699 Let i = 4065 + -966. What are the prime factors of i? 3, 1033 Let f(u) = -10u + 7. Suppose -3s = 3s - 348. Suppose 14 = -4p - s. What are the prime factors of f(p)? 11, 17 Let r(l) = -9l - 157. Let v be r(-18). Suppose m - h = 63, -4h - 54 - 261 = -vm. List the prime factors of m. 3, 7 Suppose 13o - 19o - 2022 = 0. List the prime factors of -4(-6)/(-24)o. 337 Let a(u) = -12u3 - 70u*2 + 19u + 90. What are the prime factors of a(-19)? 56767 Suppose 42w = 41w + 99. Let q = 168 - w. List the prime factors of q. 3, 23 Let y = 68209 + -43092. List the prime factors of y. 25117 Let n(a) = 124a2 - 11a + 35. List the prime factors of n(-7). 2, 7, 13, 17 Let l = -357 + 254. Let h = 105 + l. Suppose 2i - 59 = -f, -i = -hi + 4f + 25. List the prime factors of i. 29 Let v(o) = -1669o*3 + 2o*2 + 3o - 3. List the prime factors of v(-2). 13, 79 Let h(l) = -22l + 2. Let o be h(3). Let f = -1134 + 1233. Let z = f + o. List the prime factors of z. 5, 7 What are the prime factors of (-5 + 10 - 2) + (4300 - 4)? 3, 1433 Let t = -1402 + 926. List the prime factors of ((-4)/(-5))/(48/120) - t. 2, 239 Let j(f) = -f + 12. Let r be j(-17). Suppose -ry + 9218 = -7y. List the prime factors of y. 419 Let x = -555 + 318. Let a = x + 454. What are the prime factors of a? 7, 31 Let v be (35 - 15)(-330)/(-8). Suppose 0 = 26f - 2671 + v. What are the prime factors of f? 71 Suppose 2p = -3b + b + 20, -3b = 2p - 24. Let v(c) be the third derivative of 11c*4/24 + 14c*3/3 - 2c*2. What are the prime factors of v(p)? 2, 47 Let m(s) = 28s*3 - 3s - 13. Let w be m(4). Suppose w = 4l + 5a, 2a - 206 = -l + 238. List the prime factors of l. 2, 3, 73 Let t(b) = -49b - 9. Let v(o) = -o*3 + 15o*2 - 14o - 2. Suppose -2j + 25 = 3x, -5j - 4x + 38 = -2j. Let g be v(j). What are the prime factors of t(g)? 89 Let a(z) = 2z*2 - 5z - 8. Let b(u) = 3u2 - 3u - 8. Let h(y) = -4a(y) + 3b(y). What are the prime factors of h(-18)? 2, 67 Let i(a) = 2a3 + 35a*2 + 20a - 15. Let z be i(-16). Let c = -228 + z. What are the prime factors of c? 5, 41 Suppose 4i = 40u - 38u - 2122, -4i + 20 = 0. Suppose -4a - 5w = -a - 3281, u = a - 4w. List the prime factors of a. 1087 Let u = 45 + 11. Let s = u - 54. Suppose 68 = sj + 26. List the prime factors of j. 3, 7 Suppose 0 = 3s + 6, -r + 58502 = -267s + 269s. List the prime factors of r. 2, 3, 7, 199 Let m = 11285 - 5080. What are the prime factors of m? 5, 17, 73 Let q(n) = -18 - 2n + 22 + 27. Let w be q(14). List the prime factors of (-98)/(-6) - (-2)/w. 17 Suppose 21f - 99103 = 63626. List the prime factors of f. 3, 7, 41 Let y = -339 - -45. Suppose 113 = f - 436. Let d = y + f. List the prime factors of d. 3, 5, 17 Let k(l) = -l2 + 16l + 2. Let r be -3 - (-22)/6 - (-26)/6. Let n(i) = -i + 12. Let a be n(r). List the prime factors of k(a). 5, 13 List the prime factors of (-5466)/((-16)/(-128)-12). 2, 911 Let x be (56/(-12) - -4) + 772/(-3). Let r = x - -843. What are the prime factors of r? 3, 5, 13 Let t = -236 + 240. Let r(a) = 40a + 73. List the prime factors of r(t). 233 Let b(p) = -p*3 + 9p*2 - 6p - 16. Let r be b(8). Suppose -7i + 6i + 25 = r. What are the prime factors of i - 0 - -4 - -1? 2, 3, 5 Suppose 19999 = v + 5t, t = 1120v - 1117v - 59869. List the prime factors of v. 3, 6653 Let z be 1 + 2 - -1 - 2. Let u be z4/(-40) + (-3873)/(-15). Let h = u - 28. What are the prime factors of h? 2, 5, 23 Let u = 60 - 60. Suppose 5o - 3v - 14 = 0, -5o + uv = -v - 18. Suppose -11p = -op - 1099. List the prime factors of p. 157 Suppose 0 = -5u + 4f - 3, 3u + 4f + 2 = -19. Let v(c) = 89c2 + c + 14. Let w be v(u). Suppose w = 11t + 97. What are the prime factors of t? 5, 13 Suppose -5u + 308 = -3u. Suppose -14r + 1364 = 384. Let s = u - r. List the prime factors of s. 2, 3, 7 Suppose 1280 + 90 = b. Let g = b - 953. What are the prime factors of g? 3, 139 What are the prime factors of 2751(-25)/40(-96)/36? 5, 7, 131 List the prime factors of 67874/4 + 2 - (-1374)/916. 2, 4243 Let k(q) = -7 - 2q + 2q + 8q*2. Let l = 727 + -730. What are the prime factors of k(l)? 5, 13 Let f(r) = 4r - 27. Let d be f(8). Suppose 9y - dy = 1192. Suppose -32 = -15q + y. List the prime factors of q. 2, 11 Suppose -46780 = 13h - 160h + 1001771. List the prime factors of h. 7, 1019 Suppose 26k + 4290 = -13k. List the prime factors of (k + -1)120/(-18). 2, 5, 37 Let i(t) = t*3 - 7t*2 - 20t + 6. Let u be i(9). What are the prime factors of 532/5 - u/(-30)? 2, 53 Let p = -38906 + 60325. List the prime factors of p. 21419 Let k = 6690 + -3953. List the prime factors of k. 7, 17, 23 Let b = -15698 + 22953. List the prime factors of b. 5, 1451 Let r(y) = y*2 + 10y + 7. Let l be r(-6). Let g = l + 24. List the prime factors of (-2)/4g-20. 2, 5, 7 Suppose 0 = 56o + 6o + 45o - 824863. List the prime factors of o. 13, 593 Let p = -259 - -261. Suppose -4k - 78 + 510 = ps, 0 = s + 4k - 212. List the prime factors of s. 2, 5, 11 Suppose 48c = -135c + 2122434. What are the prime factors of c? 2, 3, 1933 Suppose 241p + 315p = 25553760. What are the prime factors of p? 2, 3, 5, 383 List the prime factors of ((-822564)/52)/(-3) + (-4)/52-2. 5273 Let l(g) = g. Let p(y) = 25y + 21. Let z(x) = 5l(x) - p(x). What are the prime factors of z(-5)? 79 List the prime factors of (70182/(-567))/(1/612/(-18)). 2, 557 Let k = -891 - -1399. Suppose 0 = p + p - k. What are the prime factors of p? 2, 127 Suppose 5v = 6018q - 6021q + 191459, 0 = -5q - 10. What are the prime factors of v? 149, 257 Let g(d) = 174*d + 21. Let c = -41 + 51. Let s be g(c). What are the prime factors of 1 + s/27 + 14/(-63)? 2, 3, 11 Let c = 9387 - 5969. What are the prime factors of c? 2, 1709 Let f = 97476 - 68888. List the prime factors of f. 2, 7, 1021 What are the prime factor	{ "pile_set_name": "DM Mathematics" }
5, 5643, 5679, 5739, 5829? 5955 What is next in 142, 1062, 3552, 8392, 16362? 28242 What comes next: -70904, -141767, -212630, -283493? -354356 What is the next term in -1042, -1212, -1406, -1624? -1866 What comes next: 141, 1438, 4919, 11676, 22801, 39386, 62523, 93304? 132821 What comes next: 2937, 11850, 26739, 47604? 74445 What is next in -30643, -61284, -91925? -122566 What is the next term in -48728, -97456, -146184? -194912 What comes next: -6, 105, 302, 591, 978, 1469, 2070, 2787? 3626 What comes next: 19639, 39280, 58921, 78562? 98203 What comes next: -20106, -40213, -60318, -80421? -100522 What is next in 24045, 24040, 24035, 24030? 24025 What is next in 16745, 16743, 16739, 16733, 16725, 16715? 16703 What comes next: -288, -2154, -7216, -17070, -33312, -57538, -91344, -136326? -194080 What is the next term in -43, -778, -2069, -3922, -6343, -9338, -12913, -17074? -21827 What comes next: -76, -178, -366, -682, -1168, -1866, -2818, -4066? -5652 What is the next term in -182, -270, -488, -902, -1578, -2582? -3980 What is the next term in -5815, -6450, -7099, -7768, -8463, -9190, -9955? -10764 What is next in -40774, -81548, -122322, -163096, -203870? -244644 What is next in 1798, 1843, 1888, 1933, 1978, 2023? 2068 What comes next: 45501, 45481, 45461, 45441, 45421? 45401 What comes next: 134, 297, 480, 695, 954, 1269? 1652 What comes next: -533, -1796, -3059, -4322? -5585 What is the next term in -260, -518, -758, -968, -1136, -1250, -1298? -1268 What is the next term in 1701, 1555, 1311, 969? 529 What is the next term in 718, 737, 782, 865, 998, 1193, 1462, 1817? 2270 What is the next term in 77, 325, 771, 1439, 2353? 3537 What comes next: 3177, 6351, 9523, 12693, 15861, 19027, 22191? 25353 What is the next term in -600, -4797, -16184, -38355, -74904, -129425, -205512? -306759 What is next in 373803, 373811, 373825, 373845, 373871? 373903 What comes next: 13958, 13845, 13732, 13619? 13506 What is next in -214, -1759, -5946, -14095, -27526, -47559? -75514 What is next in 7433, 14848, 22275, 29720, 37189, 44688, 52223? 59800 What is the next term in 2049, 2031, 2013, 1995, 1977, 1959? 1941 What is next in 1411, 2860, 4309, 5758, 7207, 8656? 10105 What comes next: 243, 406, 485, 480, 391, 218? -39 What is next in -131, -137, -165, -215? -287 What is next in 177, 357, 563, 807, 1101, 1457? 1887 What is next in -340504, -681014, -1021524, -1362034? -1702544 What is next in 7, 50, 141, 292, 515, 822, 1225? 1736 What is the next term in 1881, 1846, 1803, 1752, 1693? 1626 What comes next: -1199, -977, -607, -89? 577 What is the next term in -63, -122, -177, -228, -275? -318 What comes next: -2060, -2051, -2036, -2015, -1988? -1955 What comes next: 155948, 155954, 155970, 156002, 156056? 156138 What is the next term in -6499, -6406, -6313, -6220, -6127, -6034? -5941 What comes next: -2283, -2232, -2181, -2130, -2079? -2028 What is next in 45815, 45819, 45825, 45833, 45843, 45855, 45869? 45885 What is next in -92719, -185444, -278169, -370894? -463619 What comes next: -186, -394, -660, -984, -1366, -1806? -2304 What comes next: 23058, 92234, 207528, 368940, 576470, 830118? 1129884 What comes next: -1275, -2679, -4083, -5487, -6891, -8295? -9699 What comes next: 802, 1019, 1238, 1459, 1682, 1907, 2134? 2363 What comes next: -750, -735, -714, -687, -654, -615, -570? -519 What is the next term in 15, 136, 377, 750, 1267, 1940, 2781? 3802 What comes next: 1365, 2738, 4111? 5484 What is the next term in -166504, -166505, -166506, -166507, -166508, -166509? -166510 What is the next term in 113082, 113081, 113080, 113079? 113078 What is next in 439, 3498, 11791, 27934, 54543? 94234 What comes next: -1217877, -1217879, -1217881, -1217883? -1217885 What comes next: 43, 105, 179, 259, 339? 413 What is next in 10193, 10200, 10211, 10226, 10245? 10268 What is the next term in -632, -2443, -5476, -9743, -15256? -22027 What comes next: 1084993, 1084992, 1084981, 1084954, 1084905, 1084828? 1084717 What is the next term in 8136, 8071, 8006? 7941 What is the next term in -389, -856, -1391, -1988, -2641, -3344, -4091, -4876? -5693 What comes next: 360, 913, 1466, 2019? 2572 What is the next term in 5861, 11713, 17563, 23411, 29257, 35101? 40943 What is next in -292335, -292334, -292333, -292332, -292331? -292330 What is the next term in -305138, -305143, -305148, -305153, -305158? -305163 What is next in 486, 487, 496, 513, 538, 571, 612? 661 What is next in -62828, -125692, -188558, -251426? -314296 What is the next term in -64, -177, -380, -679, -1080, -1589, -2212, -2955? -3824 What comes next: -64154, -64173, -64204, -64253, -64326, -64429? -64568 What is next in -207, -1021, -2381, -4281, -6715, -9677, -13161, -17161? -21671 What is the next term in -256, -2012, -6802, -16144, -31556, -54556? -86662 What is next in 17291, 17291, 17289, 17285, 17279? 17271 What is next in -192, -434, -874, -1542, -2468? -3682 What is the next term in 13, -70, -245, -506, -847, -1262, -1745, -2290? -2891 What comes next: 178, 302, 420, 538, 662, 798? 952 What is next in -88314, -88314, -88306, -88284, -88242, -88174, -88074? -87936 What comes next: -7, 104, 215, 332, 461, 608, 779, 980? 1217 What is next in -123163, -246325, -369487, -492649, -615811? -738973 What is the next term in -6, 33, 98, 189? 306 What comes next: 171287, 342572, 513857, 685142, 856427, 1027712? 1198997 What comes next: 797, 3321, 7535, 13445, 21057? 30377 What is next in 656002, 656003, 656004, 656005? 656006 What is the next term in -94, -291, -604, -1033, -1578, -2239? -3016 What is next in 254767, 254760, 254753, 254746, 254739, 254732? 254725 What comes next: 238, 2222, 7578, 17992, 35150, 60738? 96442 What comes next: -14647, -29283, -43905, -58507, -73083, -87627? -102133 What comes next: 158454, 316905, 475356, 633807, 792258, 950709? 1109160 What is next in 227490, 454978, 682464, 909948, 1137430, 1364910? 1592388 What comes next: 86, 51, -20, -145, -342, -629? -1024 What is next in -360, -174, 12, 198, 384? 570 What is the next term in -1027, -1016, -989, -940, -863? -752 What comes next: 779, 1554, 2331, 3110, 3891? 4674 What comes next: 4323, 8651, 12979, 17307? 21635 What is the next term in -40142, -40138, -40134? -40130 What comes next: 244429, 244432, 244435, 244438, 244441? 244444 What is next in 46, 376, 1266, 2998, 5854, 10116? 16066 What is next in 5823782, 5823784, 5823786? 5823788 What is the next term in -376719, -753447, -1130175, -1506903, -1883631, -2260359? -2637087 What is the next term in -26266, -52533, -78802, -105073, -131346, -157621? -183898 What comes next: 3762, 15086, 33954, 60354, 94274? 135702 What is next in 6, 117, 404, 951, 1842, 3161? 4992 What comes next: 4894152, 4894153, 4894154, 4894155, 4894156, 4894157? 4894158 What comes next: 92, 552, 1316, 2384, 3756, 5432? 7412 What comes next: -5761, -5751, -5719, -5659, -5565, -5431, -5251? -5019 What is next in 13146, 52557, 118242, 210201, 328434? 472941 What is next in -1980, -7880, -17708, -31458, -49124, -70700, -96180? -125558 What is next in -5327, -21257, -47793, -84935, -132683, -191037? -259997 What is the next term in 397, 691, 997, 1321, 1669, 2047, 2461, 2917? 3421 What is next in -15394, -30786, -46178, -61570, -76962, -92354? -107746 What comes next: 42706, 85413, 128124, 170839, 213558, 256281, 299008? 341739 What is the next term in 3981, 3279, 2575, 1869, 1161? 451 What is the next term in 42986, 42976, 42952, 42908, 42838, 42736? 42596 What comes next: 402, 671, 796, 771, 590, 247, -264, -949? -1814 What is the next term in -309, -328, -357, -402, -469, -564? -693 What is the next term in 197787, 197785, 197783, 197781? 197779 What is the next term in -3828731, -3828734, -3828737, -3828740, -3828743, -3828746? -3828749 What comes next: -6640, -6610, -6580, -6550, -6520? -6490 What comes next: 11728, 11752, 11788, 11830, 11872? 11908 What is the next term in 68, 149, 188, 173, 92, -67, -316? -667 What is the next term in -802, -3358, -7618, -13582, -21250, -30622, -41698? -54478 What is the next term in 49, 201, 481, 907, 1497, 2269, 3241? 4431 What is the next term in 71, 869, 2207, 4091, 6527? 9521 What is next in 15512, 31081, 46656, 62237, 77824, 93417, 109016? 124621 What is next in -544	{ "pile_set_name": "DM Mathematics" }
(d) 2 d Let y = -2913614/7 + 417314. Let u = y + -1083. Let o = 0 + 2. Which is the closest to o? (a) 15/2 (b) u (c) 0 b Let f(u) = 6u + 4. Let n be f(-1). Let x = 0.03891 + 0.06109. Which is the closest to x? (a) -5 (b) -6 (c) n (d) 1 d Let j = 19/70 - -1/70. Let g be (-3)/(-2)((-303)/99 + 3). What is the nearest to j in -0.1, -0.2, g, -4/9? g Let o(w) = 1349w - 4042. Let p be o(3). Which is the closest to 96? (a) p (b) -2/17 (c) 0 a Let c = 5.3 - 6.3. Let o = -696 + 712. What is the closest to 0.1 in 3, -3, c, o? c Let f = 19.0514 - 0.0514. Let l = f + -33. What is the nearest to l in 1/2, 0.2, -0.1, 3? -0.1 Let s = -0.3476 + -7.6524. What is the closest to -2 in 0.1, s, 0.2? 0.1 Let h = 7.56 - 997.56. What is the closest to 2/3 in 5, -0.1, h? -0.1 Let n = 151 + -150.4. Which is the closest to -1? (a) 3 (b) 82 (c) n c Let g = 2364 + -2363.9. What is the nearest to -2/3 in 0.2, g, -8, -11? g Let q be 7 + -10 - 11/(-4). Let z(v) = v3 + 11v*2 - v - 4. Let o be z(-11). Suppose p - op = -p. What is the closest to q in 0.4, p, -3/8? -3/8 Let d = -57.5 - -57.49. Which is the nearest to 0? (a) -5.1 (b) d (c) -0.3 b Let l = -44.56 + 41.46. Which is the nearest to -1? (a) 1/3 (b) l (c) 0.1 c Let j be 2/(-5) - 17610/225. Let u = 79 + j. Suppose 2q - 3y + 5 = 0, 0q - 3y = -3q - 6. What is the nearest to u in 4, q, 0.4? 0.4 Suppose 24z + 335 = 29z. Let h = -537/8 + z. Which is the closest to 1? (a) 0.4 (b) 0.1 (c) h a Let f be (32/(-192))/((-6)/4). Let w = -0.18 - -0.18. Let s be 24/(-60) + 24/110. What is the closest to f in w, s, -3? w Suppose -5d + d = 20. Let q be (-2)/(-10) + (d - (-186)/(-5)). Let p = q - -48. Which is the nearest to -0.1? (a) p (b) -0.4 (c) -2/7 c Let x = -4391 - -4392.1. What is the nearest to 0 in x, -0.3, 4, 11? -0.3 Let s be (2/(-9) + (-32)/(-63))/((-842)/5894). What is the nearest to 33 in 0.4, s, 0.6? 0.6 Let j(q) be the first derivative of 8q2 - 101q + 15. Let h be j(6). Which is the nearest to 1/2? (a) -4 (b) 3 (c) h b Suppose 6d + 3 = 3d. Let f = -2.2 + 1.5. Let t = -0.7 - f. Which is the nearest to 2? (a) 3 (b) t (c) d a Let w be -255(-6 + 6 + (1 - 0)). Let k = 769/3 + w. Which is the nearest to -5? (a) 1/3 (b) -0.3 (c) k b Let f be 12/(-9) + -31 + 11900/375. Let p = 0.31 + -0.3. Which is the closest to 0? (a) 0.3 (b) f (c) p c Let r = 7606 + -7653. What is the nearest to -0.1 in 10/9, r, 3, -0.2? -0.2 Let x be -2 - (0/3)/((-174)/(-29)). What is the closest to -0.1 in -1/8, x, -100, 0? -1/8 Let o = 29/33 + -211/165. What is the nearest to 1 in o, -5, 0.15, -2.4? 0.15 Let y = -12453 - -12454. Let s = 15 - 11. Let z = 1 - s. Which is the closest to -0.1? (a) y (b) z (c) 2/3 c Let s = 0.24574 + -2.24574. Let u be 12/16 - 2/8. Which is the nearest to u? (a) s (b) -0.5 (c) 0.3 (d) 20 c Let j = -352/9 + 116/3. Let p be (0/((-44)/4))/3. Which is the nearest to 3/26? (a) p (b) 1/4 (c) j a Let h = 1 - 1. Let u = -377649/10 - -37765. Which is the nearest to h? (a) -4 (b) u (c) -0.4 b Let f = 1650 - 1651. Let v = -311 + 3418/11. Which is the closest to f? (a) 1/4 (b) -2 (c) v c Let p = 338 - 339. Let z = -93 - -95. Which is the closest to p? (a) z (b) 8/7 (c) -9 b Suppose 6h - 13 = -5a + 5, -a = 0. What is the closest to h in -2, 1.3, 2/15, -2/7? 1.3 Let s be (-90)/(-133) + (-8)/76. Suppose -2a - 3a + t = 93, 3a = t - 55. Let h be (-33)/44 - a/20. What is the closest to -2 in s, h, 3? h Let r be -1 - (-6 + 0)/6. Let x be (-29)/(-58)((-2)/4 - r). Which is the closest to -2/7? (a) 48 (b) x (c) -0.5 b Let z = -18720.3 + 18720. Let q = 5.8 + -0.8. Which is the closest to -1? (a) z (b) q (c) 0 (d) 3 a Let q = 6079/7728 + -1/1104. Let y = -9/7 + q. Let k be 1/(-5)(12 + (-119)/17). Which is the closest to y? (a) 1 (b) k (c) -5 b Suppose -5z + 5j = 15, 5j - j = 20. Let f = 338 + -335. Which is the nearest to z? (a) f (b) -19 (c) -5 a Let j be 164547/23547(0 - -1) + -7. Which is the nearest to 0.1? (a) j (b) 0.1 (c) -0.3 b Let i be (-8)/90 - (665/(-75) - (-54)/6). Which is the nearest to i? (a) 3 (b) -7/206 (c) 0 b Let m(x) be the first derivative of -x*3 - 9x*2/2 + 2x + 65. Let g be m(-3). Which is the closest to g? (a) 5/2 (b) -0.07 (c) 1 a Let l = 304/115 + -24/23. Let w be ((-1)/1)/((-118)/590). What is the nearest to l in -5/2, 0.1, w? 0.1 Let s = 4 - 2. Let v = 1 - s. Let a(f) = f*2 - 197f - 3179. Let h be a(-15). What is the nearest to h in 2/5, 1, v? 1 Let g = 82.8 - 84.8. Which is the nearest to 1/3? (a) 3 (b) g (c) -5/7 (d) 1 d Let p be ((-1)/3)/(20/12 + -2). Let o be -1 - -1 - 11/(-11 + 66). Which is the closest to 0.1? (a) -0.43 (b) o (c) p (d) -2/7 b Let z = -403451/36 + 11207. What is the closest to 1 in z, -6/7, -0.1? z Suppose -4 = q - 0q - x, -11 = 5q + 4x. Let o = 41 - 42.65. Let j = o + -0.35. Which is the closest to -4? (a) 4 (b) q (c) j b Let w = 1639 - 1638. What is the nearest to w in -5, -2, -32/3, -4? -2 Let k = -4/3 - -1. Let n be (-5)/15453/1. Let z = 452/3 + n. Which is the nearest to k? (a) -0.2 (b) z (c) 7 b Let q = 48 + -15. Suppose 2y + 9y = -q. Let v = -1/20 - 11/180. What is the closest to -1/3 in v, y, -2? v Let h be (-32 - (-35 + 1))/(-2). Let l = 0.9 - 1. Suppose -1 = -2m - 13. What is the closest to h in l, 2/3, m? l Let z = 3534 + -3530. Which is the closest to 1? (a) z (b) -0.01 (c) -0.1 (d) 0.4 d Let d be 1/(10/(-16)) + 0. Let u be (-1 - 46/(-10)) + -31. Let w = -1.4 - -1.4. What is the closest to w in u, 0, d? 0 Let o = -142 - -142.38. Let y = o - -0.62. Which is the closest to y? (a) -0.4 (b) -3 (c) -0.2 c Let d = -18/211 - 34195/2321. Let i = d + 15. Let g = -7/37 + -173/259. Which is the closest to 2/5? (a) 0 (b) g (c) i c Let z be (-9)/54 - 17/(-17). Let v be (18/(-12) + 1)/(1/(-6)). What is the closest to 0.11 in 0, 2/9, z, v? 0 Let v = 0.005 - 0.055. Let m = 1.27 + v. Let j = m - 2.22. What is the nearest to 0.1 in j, 0.4, -16? 0.4 Let u be (-36)/(-19872)46 + (-10)/56. What is the nearest to 237 in -3, 1, u, 18/7? 18/7 Let l = 10.9 - 10.5. Let q = 39 + -59. Let t = -39/2 - q. What is the nearest to t in 3, l, 0? l Let f = 42 + -37. Let s = 198 + -196. What is the nearest to f in 2/5, -0.1, s? s Let d be ((-50)/3)/((-429)/54 - -8). Let s be (24/d)/((-8)/(-10)). Which is the closest to 1? (a) 1/4 (b) s (c) 1/5 a Let d = -1.94 + -0.06. Let f = 1 + d. Let o be (60400/(-180))/(-20) - 17. Which is the nearest to f? (a) 1 (b) o (c) 2/5 b Let k = -10.17 - -10.2. Let v = 0.02 - -0.48. Let c = -22 - -24. What is the nearest to c in -0.2, v, k? v Let n = -0.24 + -0.26. Let t = -4937.17 - -4937. Which is the closest to 0.1? (a) n (b) -0.4 (c) t c Suppose 12 = 3g + 3m, -6m = 3g - 5m - 8. Suppose 4 = -l - g. Which is the closest to 0.1? (a) -4 (b) l (c) 0.5 c Suppose -12m + 79 = -5. Let u be (-1)/m551/152. Let z = -3/8 - u. Which is the nearest to 17? (a) 0.5 (b) -2/3 (c) z a Let b = -22 + 25. Let y = -249.9 + 231. Let g = -18.9 - y. What is the nearest to 1 in b, 4, g? g Let j = 3555 - 3559. Which is the closest to -1? (a) j (b) 1 (c) 6/7 (d) 4 c Suppose 3i - 8 = -v, 5i - 9 = 2v + 8. Let c = 4204 + -67265/16. What is the closest to -2/11 in 0.2, v, c? c Let u be (-45)/(-60) - (1 + 21/(-4)). Let q = -46.86 - -47. Suppose -3 = -4o - 4k + 13, -2o + 4k = 16. Which is the closest to o? (a) 0.4 (b) q (c) u b Let k = -470 - -469.94. What is the nearest to -0.1 in -1, -0.4, 5, k? k Let h be 108520/(-76000) - (1 - 7/4). Let q = -13/25 - h. Let c = -28/57 + q. What is the nearest to -1/3 in c, 4, 0.1? c Let o(w) = -941w - 5633. Let y be o(-6). Let p = -0.2 - 2.8. Which is the nearest to -2? (a) p (b) -0.1 (c) y a Let v = -74.006 + 0.006. Let j = 73.695 + v. Let f = j - 0.095. Which is the nearest to 1? (a) f (b) -5 (c) 0 c Let s = -157 - -157.968. Let z = 0.99 - s. Let k = z + 0.088. Which is the nearest to k? (a) 5/4 (b) 0 (c) 0.5 b Suppose -4w = -105z + 109*z - 32, w = z - 10. What is the closest to w in -49, -0.5, -3/8? -0.5 Let m = -102.77 - -102.85. Which is the closest to m? (a) -2.4 (b) 0 (c) 0.1 (d) -1/7 c Let f = 86.07 + -86. Let n = f + 28.93. Let k = -29.1 + n. Which is the closest to 1? (a) 1/3 (b	{ "pile_set_name": "DM Mathematics" }
2u, 5u - h = -5k. Is k a composite number? False Let s be ((-9462)/(-15))/(4/20). Suppose 0 = -9c + s + 2957. Is c prime? False Let k(b) = 71b + 158. Is k(13) a composite number? True Let u = -3 + 8. Suppose -uj = -i + 171, -i - 828 = -6i - 2j. Suppose f - i = 205. Is f composite? True Suppose -3j - 4q + 36550 = -j, -3q = 4j - 73085. Is j composite? False Let y = 7465 + -2815. Suppose 4p + t = 3717, -2t + y = 5p + 3t. Is p prime? True Let g(p) be the third derivative of p5/60 - p4/24 + 2p3/3 - 5p*2. Let v be g(0). Suppose 2555 = h + vh. Is h a prime number? False Let y(c) = 21c + 88. Let h be y(-10). Let k be 59 + 2 + -3 - 1. Let r = k - h. Is r prime? True Let m be -2 + -3 - 2-1. Suppose -3x = -5t + 3t - 69, 4x - 92 = 3t. Is x/(-5 - -3 - m) a prime number? True Let a(r) = r2 - 3r. Let z be (3/(-5))/((-9)/45). Let f be a(z). Suppose f = 4o - 435 - 49. Is o a prime number? False Is 252/140 - (-399772)/10 a prime number? True Suppose -8p = -13p + 97655. Is p prime? True Let p be (-4)/(-10) - (-92)/20. Suppose 2w = pw - 561. Is w a composite number? True Let u(w) = -w3 + 10w*2 - 6w + 5. Let b be u(6). Let j = 276 - b. Is j a composite number? False Let a(s) = s*3 - 20s*2 - 6s - 38. Let c be a(18). Suppose -5i - 3w = 5970, -5i + 2w = 2005 + 3940. Let j = c - i. Is j a composite number? False Let l be (-4)/(12/(-2)). Suppose -c - 5r = -28, 5 = lc + 2r - 17. Is 0/c - (-2 - 140) prime? False Let o = 2487 - -1412. Suppose -r = 6r - o. Is r a composite number? False Let v = -124 + 82. Let l be (-3)/15 + v/(-10). Suppose 2q = ly - 130, 3y = -y + 3q + 125. Is y a composite number? True Suppose c + 2 = -0, -3f - 1424 = -2c. Let j = -339 - f. Suppose j + 67 = 4n. Is n composite? True Suppose -12 = u + 5g, -2g + 3 = -3u - 6g. Suppose 4w = 2w - o + 133, uw - 206 = 5o. Is w composite? False Let s(p) = -p*3 + 7p*2 - 4p - 5. Let l be s(6). Let x be -2 + 1 - (-28)/l. Suppose 0 = -6o + xo + 2m + 931, 1557 = 5o + 2m. Is o a composite number? False Let h(s) = s2 + 14s - 17. Let p be h(-13). Let v = 65 + p. Is 15/v + 726/21 a composite number? True Let k(i) = -8i + 3. Let g = 66 + -70. Is k(g) a prime number? False Let n = -500 + 1135. Suppose -5p = -4p - 4s - n, -4p + s = -2495. Is p a composite number? True Let x(r) = 31r*2 + 14r - 151. Is x(12) prime? True Suppose -5h = 2v - 2841 - 604, 3h + 5v = 2086. Is h a prime number? False Suppose -5d - 78 = -3y, -2d - 58 = -4y + 46. Let t = y + 25. Suppose -284 = -3o + 2u + t, -3u = -2o + 220. Is o composite? False Let z(q) = -112q2 + 5q + 6. Let u = 14 - 17. Let g be z(u). Let j = -524 - g. Is j a composite number? True Let j be 64/(-24)(-3)/2. Suppose -4a - 4u - 172 = 0, -4u = -ja - 117 - 95. Let h = a - -85. Is h a prime number? True Let w(q) = 18q*2 - 26q + 195. Is w(-29) a composite number? False Suppose -16w + 0w = -474992. Is w composite? True Let p = 189 - 58. Is p a prime number? True Let o be ((-6)/5)/((-7)/70). Suppose -2z = -3c + 515, -3z - o = -0z. Is c a prime number? False Suppose 16u + 7u = 50002. Is u a prime number? False Let a(b) = -b*2 + 2b2 + 4 + b - 2 - b3. Let f be a(2). Suppose 4p - 4v - 828 = f, 3p + 3v + 1039 = 8p. Is p a composite number? True Let u(x) = 42x*3 + 4x*2 - 2x - 1. Is u(3) a composite number? False Let q(k) = 102k - 41. Let p(f) = 1. Let l(i) = 2p(i) - q(i). Is l(-14) a prime number? True Let y(s) = -s + 8. Let x be y(-14). Suppose 2 + x = 4t. Is 3 + (t-21)/(-1) prime? False Let d be 94874 + 11 - (3 - 0). Suppose -4g = 5r - d, -2r + 2g + 19862 + 18098 = 0. Is r/90 + (-4)/(-30) prime? True Let z(c) be the second derivative of 20c3 - 5c*2/2 + 9c. Is z(11) a composite number? True Suppose 14v - 28v + 10066 = 0. Is v a prime number? True Let h(b) = -1. Let m(f) = 2f - 21. Suppose 2z = v - 4v + 4, -2v = -z - 12. Let i(q) = vh(q) - m(q). Is i(-15) composite? False Let r = 304 + 103. Is r prime? False Let m(o) be the second derivative of -4o*5/5 + 5o*4/12 + 4o3/3 + o2/2 + 5o. Is m(-4) prime? False Let j be (3/(-2))/((-21)/28). Suppose -5s + 42 = -2u, 0s + js = -4u + 12. Is 210/4 - s/(-16) a prime number? True Let b = 13 - 11. Suppose 0p - bp - 16 = -5o, -3p = -3o + 15. Suppose ow + 14 = 3w. Is w composite? True Let k = -2099 + 3878. Is k a prime number? False Suppose 3a = 514 + 3125. Suppose 3y - a = -244. Is y a prime number? False Let b = -20 + 24. Suppose -bw + 0 = 3k + 4, 0 = 2w + 5k + 16. Suppose -2f = -o + 34, -f = -wo - 3f + 68. Is o prime? False Let m = 21 + -10. Suppose -2w - 19 - m = 0. Is (-20)/(-8)(-1818)/w composite? True Suppose 4x + 7612 = 4a, -5a - 4x = 1028 - 10525. Is a a composite number? False Is -293(-3)/(6 - 3) prime? True Suppose -6w = -3879 - 58263. Is w a composite number? False Let f(s) = 3s - 8. Let p be f(4). Let x = p + -1. Suppose -v - 2i + 173 = 0, 0 = -xv - 0i + i + 533. Is v composite? True Suppose 5u = -4a + u + 8, -2a = -u - 13. Suppose aj = 9j - 1440. Suppose 0d + 5d = -2w + j, -d = 2. Is w prime? False Is (-108)/36 + (-224)/(-1) composite? True Suppose 22l - 75772 = -6758. Is l composite? False Suppose -19o = -21o + 894. Is o prime? False Suppose 7g - 40 = 2g. Suppose -gd + 4723 + 2389 = 0. Is d a prime number? False Suppose -10 = s - 0s. Is 2/s - (-2 - (-2212)/(-10)) a composite number? False Let r = 16 + -6. Suppose -ri + 378 = -11i. Let b = i + 563. Is b composite? True Let s(y) = y3 + 8y*2 + 9y - 5. Let v be s(-7). Let u(d) = 2d2 + 18d + 2. Is u(v) prime? False Let d = -24 + 28. Suppose dl = -l + 11585. Is l a composite number? True Let t = -10064 + 23707. Is t a prime number? False Let h = -130296 + 206525. Is h a composite number? True Let x(z) = -93381z - 74. Is x(-1) a composite number? False Let c(t) be the first derivative of 1/3t3 - 5/2t*2 - 1/4t*4 + 4t + 1. Is c(-5) a composite number? False Is 18152 + (114/(-6) - -10) prime? True Suppose t + 29 = -4p - 0p, -3t + 49 = -5p. Let d be 17811 - (p + 9). Suppose -2j - 1616 = -5b + 609, 5j = -4b + d. Is b composite? True Suppose -4y + 2523 = w, -6w - 3y + 2525 = -5w. Is w a prime number? True Let x(w) = 2w*2 + 6w. Let d be x(6). Let a = 4 - d. Let p = a - -267. Is p a composite number? False Let c(o) = 15 + 5o - 5o - o. Let u be c(8). Let j = u - -304. Is j prime? True Let t(d) = -7d - 11. Let x be t(-11). Let l be x/16 - (-3)/(-24). Suppose 0 = 4n + 4s - 748, -ln + 662 = -4s - 118. Is n prime? True Suppose 0 = c + c + 230. Let o = 200 + -281. Let w = o - c. Is w prime? False Let h = 23 + -18. Suppose 3b + 15 = -0b, -2g + hb = -919. Suppose 4u - g = u. Is u a composite number? False Let v = -3387 + 9686. Is v composite? False Let z = 4713 + 3536. Let q = z + -5674. Suppose -q = -3c - 4u, -u + 3u = 3c - 2605. Is c composite? True Let n(u) be the second derivative of 11u3/6 + 3u*2/2 + 104u. Suppose 3w - 5 = 4w, -g + w + 11 = 0. Is n(g) composite? True Suppose 3k - 944 = 7501. Suppose -5l + 0l + 3s = -k, 0 = -3l + s + 1689. Is l a composite number? False Let o(g) = 1123g*2 - 63g - 347. Is o(-5) composite? True Let m(p) = -p*2 + 7p - 2. Suppose -5 = -5y + 25. Let c be m(y). Suppose 2q = 3g + 7, -4q + 7 + 17 = -cg. Is q composite? False Let b(d) = 200d*2 + 7d - 9. Let l be b(2). Let x = 2986 - l. Is x a prime number? False Suppose -4y - 2v = -40, 32 = 5y - 0v - 2v. Let b(u) = 15u*2 + 7. Is b(y) a prime number? True Suppose -2c = -2x - 18, 0 = -4c + c - x + 15. Is (8984/c)/((-4)/(-6)) a composite number? True Is 0 + 1/6 + 9747455/258 composite? False Let u(p) = -806p - 13. Let c(k) = -1. Let j(r) = 4c(r) - u(r). Is j(5) prime? False Let p(o) be the second derivative of 0 + 4o + 61/6o*3 - 3/2o*2. Is p(2) prime? False Suppose -5p + 13p - 43768 = 0. Is p composite? False Let f = -11 + 11. Let b(m) = -m - 3m*2 + 5m + 4 - 6m3 + f. Is b(-3) composite? False Let f = -31 - -27. Let q(t) = 12t*2 - 5t - 13. Is q(f) a prime number? True Suppose 4m + 2u = -m, -3u = -2m. Suppose m = 4j - 31 - 5. Is 2261/j - (-2)/(-9) prime? True Let n be (160/100)/(2/220). Suppose -3t + n = -61. Is t p	{ "pile_set_name": "DM Mathematics" }
2 + 634y - 46. Let c be u(-8). Which is greater: c or -103? c Let y be (-114)/(-4)14276/498. Are y and 815 equal? False Let s(z) = -2z*2 + z + 31. Let l(t) = 26t*2 - 49t*2 + 22t*2. Let y(c) = l(c) - s(c). Let g be y(6). Which is smaller: 1/4 or g? g Let c = -39991499/522 + 76612. Are c and -1 non-equal? True Suppose -2i = -10, -6m + 90i - 1594 = 88i. Which is bigger: m or -249? -249 Let v be 1((-1)/2 - (-114)/12). Let f be 3 - (2/(-1) - -5) - -8. Suppose 5m = -5n + 40, n + 2 = m + f. Does n = v? False Let l = -201 - -243. Let r = 3989/92 + -37/23. Is r <= l? True Let u = -13165 + 12085. Is u at least as big as -1079? False Suppose -3b = -9, 2s + 4b = 3s + 9. Suppose -sg = -2m - 169, -134 = -2g - 5m + m. Suppose -3r + 13 = -g. Is r greater than 24? False Let t(x) = 13 - 17 - 6x + 4x. Let v be t(-4). Suppose 3h = -3d - d + 85, vh + 70 = 2d. Which is smaller: d or -0.1? -0.1 Let m = 12095711/539 - 22441. Which is bigger: -1 or m? m Suppose -9 = -5o - 3h + 2h, -4o = h - 7. Let d be (15/(-20))/(o/(-18)). Let j = -201/28 + d. Is 2/3 less than j? False Let c = 53804911/131 - 410727. Which is greater: c or -3? c Let p be 85608/106128 + ((-96)/(-44))/(-4). Is p less than -1? False Let f be 386210/340 + (-3)/1. Let v = f + -1133. Is 1 >= v? True Let n be ((-12)/(-4) - 17) + 7. Let d(c) be the first derivative of c3/3 + 11c*2/2 + 23c + 13. Let t be d(n). Which is smaller: t or -6? -6 Let x(j) = 2j + 4. Let n be x(0). Let f = -485.24 + 485. Which is smaller: f or n? f Suppose -2h = -3v - 6h - 9, -4v + 19 = -5h. Is -7/185 less than v? True Let b be 11704/(-66)(-1425)/(-38). Which is greater: b or -6648? -6648 Let f(h) = -h3 + 38h*2 - 35h + 65. Let l be f(37). Let p = 201 - l. Is 62 > p? False Suppose 2883k - 2858k = 38850. Which is greater: k or 1556? 1556 Suppose 0 = -10z + 12z - 4y + 84, 2z + 2y + 114 = 0. Let n be (210/11)/(117/z + 3). Which is bigger: n or 24? n Let r(t) = -t - 6. Let q be r(-5). Let v(y) = 61y*2 - 3y - 2. Let o be v(q). Which is greater: 63 or o? 63 Let g = -290/3751 - -14172/86273. Let d = 1.91 - 2. Is g != d? True Suppose -4y + 10 = -3y + 3z, -3z + 5 = -4y. Let i be (3/(-14))/(-1)484/66. Do i and y have different values? True Let y be (3/8 + 0)/(-3). Let m(s) = -7s - 66. Let k be m(-10). Suppose 3p + kp = 7. Do y and p have the same value? False Suppose -4c + 158 = 5z, 70 = -2z + 4z + 5c. Let b = 70 + -70. Suppose -3a + ba + 90 = 0. Is a at most as big as z? True Suppose 2t - 574 = 152. Let s = t - 361. Is 0 greater than s? False Let c = -0.8636 - -1.1636. Which is smaller: c or -17? -17 Suppose -7a = -1 + 1. Suppose 2i + 12 = -3f, a = -8i + 3i + 2f - 11. Let u be i/(-12)-2 + 1/8. Which is smaller: u or -1? -1 Let h be 434/196-7(-6 + 0). Which is bigger: 375/4 or h? 375/4 Let w(b) = 8b - 13. Let o be (-8)/20(-32 + -3). Suppose 0 = -oh + 12h - 10. Let d be w(h). Is d at most -53? True Let u(g) = -135g - 1590. Let v be u(-12). Which is bigger: 372/13 or v? v Let c be (-13)/(-7) + -2 + -5(-90)/(-525). Which is smaller: c or -9/1552? c Let d = 11.589 + -11.489. Which is bigger: 10528 or d? 10528 Let w = 1/14724 - 29453/73620. Which is smaller: 5305 or w? w Suppose -9h - 10 = 4k - 4h, 5k = 5h + 10. Are 2/267 and k nonequal? True Let j be 210/213 - 2/2. Let t be (-2)/41 + 3/6. Suppose -c - c - 3c = t. Is j at most as big as c? True Let b = 913 - 913. Let n = -1114/5 + 217. Which is greater: n or b? b Suppose 0 = -b + 2v - 405, -45v = -3b - 41v - 1215. Let i be (-90)/b + 2 + (-1722)/783. Is 1 >= i? True Let p = 243487/233 - 1045. Suppose 4s = 6 - 2. Which is greater: s or p? s Let j = -2/10159 + -10153/30477. Do -854/11 and j have different values? True Suppose 352 = 3m - 8. Let i = 264 - m. Let h be (i/(-15))/(-4) + (-2)/5. Which is smaller: 1 or h? 1 Let l be ((-1081)/(-94) - 12)(-4)/67. Suppose m + 3n + 6 = 21, 2m - 3n + 15 = 0. Which is greater: m or l? l Let f = -17 - -10. Let y = -2842 + 2842. Which is bigger: f or y? y Let l be (-1)/6 + (-85)/30. Let c = 256 + -264. Let a be c/(-16) + l/(-2). Is 2 > a? False Suppose b = -3o + 6364, 4b - 12766 = -3o + 12753. Which is smaller: b or 6386? b Let j be 18345/281945 + (-4)/62. Which is bigger: 0 or j? j Suppose -5k - 4905 = 4q, -278q + 280q + 2491 = 3k. Which is bigger: q or -1231? -1231 Let n(h) = -4h*2 + 23h + 6. Let z be n(6). Suppose -3j + 2b + 386 = z, 0 = -b - 4 + 3. Suppose -57 = -5t + j. Which is smaller: t or 36? 36 Suppose 5d = 10d + 15. Let y(l) = -2l*2 - 6l + 1. Let u be y(d). Let o(b) = 3b - 2. Let t be o(u). Is t >= 1/18? True Suppose 0 = k - 5j + 11, -7 = -2k - 2j + 7. Suppose 4h + 4c = -0c + 180, 0 = -h + kc + 65. Which is smaller: 191/4 or h? 191/4 Let l = -756 + 756.0121. Which is smaller: l or 8? l Let r be ((-24)/20)/2 + 54125/(-1250). Do -44 and r have different values? True Let z = 26 + -27.1. Let t = -1 - z. Let o = 3138 + -3160. Is t equal to o? False Let p be (2740/15)/(-6 + 3070/510). Which is smaller: p or 1? 1 Let p = -17.072 + 17. Let m = 418276 - 418274. Which is smaller: p or m? p Let d = -3465473/129 - -26864. Are 1 and d equal? False Suppose -747 + 797 = 2d. Let u be (-5)/d - (-1)/5. Which is smaller: u or 8/13? u Suppose -10 = -2p, 0 = 3l - 4p - 8 - 2. Let i(r) = -r*3 + 7r*2 + 16r + 24. Let g be i(l). Which is smaller: -115 or g? g Let v be (-3100)/(-248)9304/10. Which is smaller: v or 11629? 11629 Let p = 11179 + -12973. Is 1/2 <= p? False Let x be (5/(90/(-16)))/(12/(-8)). Let g = x - 235/351. Let d = -33/91 - g. Which is bigger: -12/17 or d? d Let z = 459 - -66. Let n = -452 + z. Is 76 at least as big as n? True Let p be 156/((-243)/36 + 6). Let w be (288/p)/62/6. Which is smaller: -1.5 or w? -1.5 Let y be (3 + -8)(2 + 64/(-20)). Let b be (-5)/63-2. Suppose 0 = t + 2u - u + 1, bu + 29 = t. Which is greater: t or y? y Let j = -19606/387 + 457/9. Which is bigger: j or -0.41? j Let a = 4401.07 - 4401. Is a less than or equal to 2/281? False Let j = -10.834 + 9.914. Which is greater: j or 28? 28 Let r = 1651 + -1649. Let f be (-5254)/(-14)(-1)/1. Let s = 376 + f. Which is bigger: s or r? r Let t(c) = 49c + 365. Let w be t(-7). Let s(i) = -i + 12. Let a be s(10). Suppose -2d + 4l = w, -4d - 8 = -al + 6. Is d >= -5/13? False Let m = 24 + -86. Let n = m + 71. Let x = n + -9. Is 11 greater than or equal to x? True Let p be (-3)/((-3)/13) - 1. Let i(r) = -r3 + 2r*2 + 9r + 1. Let c be i(5). Let t be -6 - c/5 - 66/(-5). Is p > t? False Let u(i) = -5i2 - 28i + 55. Let q be u(-7). Is 73/15 at most as big as q? True Let t = 63.23381 + -0.19781. Let j = t + -63. Let a = -5.964 - j. Which is smaller: 0.3 or a? a Let r(h) = 119h - 1734. Let s be r(14). Which is bigger: -53 or s? -53 Let l = 14706 - 14706. Which is smaller: 2/18565 or l? l Let f be 15 + -118(-90)/(-705). Is -2/31 at least f? False Let i(s) = s3 + s2 - 71s - 71. Let q be i(-1). Which is bigger: q or -43/358? q Suppose 3s = 6s + 39. Let c(l) = -l2 + 89l + 665. Let o be c(-7). Are s and o non-equal? True Suppose -4d = -28 + 4. Suppose -g + dg = 2g. Let b be ((-165)/(-6) + g)-2. Is b bigger than -55? False Let p = -23341 + 163385/7. Is p smaller than 15576? True Let o(z) = -852z - 322. Let q be o(5). Which is greater: q or -4583? q Suppose -2z + 4 = -4v, -4z - 23 = 5v - 5. Let r be v/(-6) - (1 + 0). Let u = 4.3387 - 4.9387. Which is smaller: r or u? r Let t = 0.29 + 12.51. Let p = -0.0578 + -12.5422. Let b = p + t. Which is smaller: 25 or b? b Let k(t) = 3t*2 + 29t - 10. Let s be k(-10). Is s >= -3/1036? True Suppose 22c = 26c + b + 801, 995 = -5c + 5b. Suppose 121 - 724 = 3t. Does t = c? False Let f = 30 - 49. Let r = -14.5 + f. Let x = -4.5 - r. Which is greater: 0.1 or x? x Let f = 3316 - 3313.3. Which is smaller: 27 or f? f Suppose -h + 2 = -5i - 13, 5i + 10 = 0. Suppose 5j = -2k - 89, hk + 41j + 238 = 44j. Which is bigger: k or -43? -43 Let x = -4437 + 1637255/369. Which is bigger: x or 1? 1 Let m = -3232 + 12927/4. Which is greater: m or 615? 615 Let g = 63564 + -63562.9. Let f = -1460/9 + 162. Are g and f unequal? True Suppose -3p + 11 = -4k, 0 = -3p - 4k - 4 - 1. Let g be (-1 + 8/12)/(p/(-	{ "pile_set_name": "DM Mathematics" }
5706 wrt c. 1004300c3 + 24c*2 + 20 Find the second derivative of -4q*3t2 - q3t + 15q*3 - 4q*2t*2 - 2q*2 + 11qt2 + 249t*2 - 3t - 168 wrt t. -8q3 - 8q*2 + 22q + 498 Find the second derivative of 60o3 - 8255o*2 - 607o + 1012 wrt o. 360o - 16510 Differentiate 2dt2 - 2504dt - 2d - 4801t2 wrt d. 2t*2 - 2504t - 2 Find the third derivative of -78j3x - 398j3 - 245j*2 - 2jx + 103 wrt j. -468x - 2388 Find the third derivative of d*5 - 768971d*4 + 4d*2 - 215898. 60d*2 - 18455304d Find the third derivative of -10adp2 - 1892ap3 - a + 684d*2p3 + d2p2 - 16d*2p + 86p2 wrt p. -11352a + 4104d2 Find the third derivative of -23210o*2v*4 - 64o*2v*2 + 8ov4 - 22 wrt v. -557040o*2v + 192ov What is the second derivative of 965387u4 - 144453u - 4? 11584644u2 What is the third derivative of 950854i*5m - 680i2m - 78i2 wrt i? 57051240i*2m Find the second derivative of 49y5 + 200y*2 - 44929y + 2. 980y3 + 400 Find the second derivative of -6j*3y + 655j3 + 4jy - 2247j - 2y wrt j. -36jy + 3930j What is the second derivative of -2195463r2 + 931953r wrt r? -4390926 Find the third derivative of -1635b4 + 2b*3k*2 + 12b*3 + 2b*2k - 5408bk*2 wrt b. -39240b + 12k2 + 72 Find the first derivative of 950581q*2 + 216990. 1901162q Differentiate 14in*2 - 2in + 57977i + 3622080n2 with respect to i. 14n*2 - 2n + 57977 What is the first derivative of 14390d2q + 2d2 - 46933d wrt q? 14390d2 Find the first derivative of -4o*2 + 181144o - 2068634. -8o + 181144 What is the first derivative of -4194u*4 - 262u*3 + 244505 wrt u? -16776u*3 - 786u*2 Find the second derivative of -159s*3 - 23s*2 + 2090s - 4 wrt s. -954s - 46 What is the second derivative of 2sw3 + 1663sw + 113658w3 + w2 - 268w wrt w? 12sw + 681948w + 2 What is the third derivative of -30453y3 + 6014y*2? -182718 What is the third derivative of 2557080m*4 - 2425722m*2? 61369920m What is the derivative of o*3 + 6814o*2 + ox + 395x + 11 wrt o? 3o*2 + 13628o + x Find the first derivative of 3859593m2 - 3330333 wrt m. 7719186m What is the third derivative of 768728j3 + 2153887j*2 wrt j? 4612368 What is the derivative of -363499d3 - d2 - 2d + 856006? -1090497d*2 - 2d - 2 What is the first derivative of 15j4 + 17j*2 - 111j - 102934? 60j3 + 34j - 111 Find the first derivative of -55019m4 + 190955 wrt m. -220076m*3 Find the second derivative of -1257450i*4 + 66183i wrt i. -15089400i2 What is the third derivative of -25157h*6s + 10h4sw - h2sw + 50h*2s - 243h2w + hs + 2sw wrt h? -3018840h*3s + 240hsw What is the derivative of 86462i*2 - 31787 wrt i? 172924i Find the third derivative of -32f5 + 2f*4 - 487f*3 + 315f*2 - 3f - 129. -1920f2 + 48f - 2922 What is the third derivative of 865bx*4y - 16bx*4 - 7bx2y + 2bxy - 9bx - 59b - 4x4 - x2y + 2x2 wrt x? 20760bxy - 384bx - 96x What is the third derivative of -58880l*5 - 41193l*2? -3532800l*2 Differentiate 23836f*3 - 19f*2 + 2312850 wrt f. 71508f*2 - 38f Find the second derivative of 3c2y*3 - 4925c*2y*2 - 5332c*2y + 8cy*2 wrt y. 18c*2y - 9850c2 + 16c Differentiate -14268g + 11027 with respect to g. -14268 Find the third derivative of -156235j*3o*2 + 2j*2o*2 - 3j*2 - 187o*2 + 2 wrt j. -937410o*2 Find the second derivative of 119o*3v - 21o3 - 2180ov - 3o + 7v wrt o. 714ov - 126o What is the third derivative of 60177z4 - 110z*2 - 89z - 3 wrt z? 1444248z What is the derivative of -106w3 + w2 + 70w + 91237? -318w*2 + 2w + 70 Find the second derivative of 282592v3 - 2v*2 + 527v - 185. 1695552v - 4 Find the third derivative of -202882h*5 - 13h*2 - 3h - 5437 wrt h. -12172920h2 What is the first derivative of 2y*2 - 4585y - 159817 wrt y? 4y - 4585 Find the second derivative of 467409o*2 - o - 74032. 934818 Find the third derivative of -7a*4 - 41286a*3m*3 - 1626a*2m*3 - 149m*3 wrt a. -168a - 247716m3 What is the first derivative of -6k*2t - 376k2 - 8kt - 1058024t wrt k? -12kt - 752k - 8t What is the second derivative of -2497287a4 + 13a - 77734 wrt a? -29967444a2 Differentiate 94623q - 2799656 wrt q. 94623 What is the third derivative of 311712m3 - 2m*2 + 168440? 1870272 What is the second derivative of -4072b*2g*4 - 3b*2g*3 + 2b*2g + 5576b2 wrt g? -48864b*2g*2 - 18b*2g Differentiate 38h2p*2 - 3h*2r - 683h2 + 6hp2 + 38600p*2r + p - r wrt r. -3h2 + 38600p*2 - 1 Find the second derivative of -3250w4 - w3 - 100630w. -39000w*2 - 6w What is the first derivative of 4n3 + 6763n*2 - 122487 wrt n? 12n*2 + 13526n What is the second derivative of 6413706s3 + 22057s + 47? 38482236s Differentiate -8dlm*3u + 10dl + 53dm*3u + dm2u - 16dmu - 88lm2u with respect to l. -8dm*3u + 10d - 88m*2u What is the derivative of -127363g - 49822? -127363 What is the third derivative of -1101y*4 - 741y3 + y2 + 75207y wrt y? -26424y - 4446 What is the second derivative of 62u5 + 217u*2v*2 - 31uv2 + 12uv + 2v wrt u? 1240u3 + 434v*2 What is the first derivative of -918v*4 - 12v*3 - 41744 wrt v? -3672v*3 - 36v*2 What is the derivative of 14866r + 65867? 14866 What is the second derivative of 819c2r*2 + 2c*2r + 22c2 + 9cr2 + 1422c - 24r wrt c? 1638r*2 + 4r + 44 Find the third derivative of -7281c3y + 30c3 - 193c*2y + 1639c2 - 2y wrt c. -43686y + 180 Find the second derivative of l3w + 161l2w - 11lw - l + 3w - 14 wrt l. 6lw + 322w Find the third derivative of 2021i4 + 2i*3 - 8795i*2 wrt i. 48504i + 12 What is the third derivative of 146484f3 + 127283f*2 wrt f? 878904 Find the second derivative of 705591iu5 + 629313iu + i wrt u. 14111820iu3 What is the third derivative of 2f*2m*5 + 21972f*2m*4 - 4f*2m*2 + 154m*2 wrt m? 120f*2m*2 + 527328f*2m Find the third derivative of -12242q6 - 2q*5 + 2q*3 - 245q*2 + 3q - 46. -1469040q3 - 120q*2 + 12 Find the first derivative of -116512g - 168420. -116512 Find the second derivative of -15a5 - 5741a*3 - 12412a + 22. -300a3 - 34446a What is the third derivative of -2839j2t*3 - 6j*2t*2 + 6j*2t + jt3 + j + 34t*4 + 985t wrt t? -17034j2 + 6j + 816t Find the second derivative of 2ux2 + 19ux + 2311u + 56687x2 wrt x. 4u + 113374 What is the third derivative of 43fl*5 - 2fl + 1016l*6 + 7l*2 + 2797l wrt l? 2580fl*2 + 121920l*3 What is the third derivative of 4608r*3t*4 + 8092r*3t*2 + 2rt3 + 27rt - 2t*4 + 1 wrt t? 110592r*3t + 12r - 48t What is the derivative of 141228p3 - 1513890? 423684p2 Find the first derivative of -z4 + 7z3 - 3z*2 - 79z + 2125224 wrt z. -4z3 + 21z*2 - 6z - 79 What is the third derivative of -77846w6 - w4 + 29w*2 + 562w + 1 wrt w? -9341520w3 - 24w Find the second derivative of -72a2hx3 + 164a*2hx2 + 122ahx - 4ax*3 + 6ax2 + 5h + 1 wrt a. -144hx*3 + 328hx2 What is the derivative of -2a*3 - 1046751a*2 + a - 1647930? -6a*2 - 2093502a + 1 Find the first derivative of -h*3n*3v - 34h3 - 115h*2n*3 + 46775hn3v wrt v. -h*3n*3 + 46775hn3 Differentiate -1631cw2 + 688cw + 567108w*2 wrt c. -1631w*2 + 688w What is the derivative of 152080b - 1678194 wrt b? 152080 Differentiate 2194ns3 - 15ns2 - 2ns - 7n + 1536s3 - 817 with respect to n. 2194s*3 - 15s*2 - 2s - 7 Find the second derivative of 26138r4 + 449r + 8. 313656r2 What is the derivative of -293863p*4 - 2p + 5853318 wrt p? -1175452p3 - 2 Differentiate 479hp3 - 12627h + 37p3 with respect to p. 1437hp2 + 111p*2 Find the first derivative of -2b*4 - 81b*3 - 95b + 102987 wrt b. -8b3 - 243b*2 - 95 Find the third derivative of -2bs4 - 38bs3 + 10bs2 - 5s*4 + 45s**3 - 117	{ "pile_set_name": "DM Mathematics" }
76/39 and -77/2829. 36777 Calculate the common denominator of -73/157390 and -71/10. 157390 Calculate the smallest common multiple of 202316 and 16. 809264 Calculate the smallest common multiple of 6 and 350626. 1051878 What is the least common multiple of 7884 and 657? 7884 Calculate the lowest common multiple of 49 and 686. 686 Find the common denominator of -18/2483 and -83/6448. 1231568 What is the lowest common multiple of 5 and 33480? 33480 Find the common denominator of -29/8592 and 109/2148. 8592 Find the common denominator of 61/6 and 32/388633. 2331798 What is the common denominator of -34/1754739 and 60/2144681? 19302129 Calculate the common denominator of -54/50141 and -77/1482. 300846 Calculate the common denominator of -79/5770 and -167/17310. 17310 Calculate the common denominator of 113/10 and -77/8782. 43910 Find the common denominator of -5/77694 and 35/3. 77694 Find the common denominator of 17/3630 and -16/9075. 18150 Calculate the common denominator of -107/258 and 44/10019. 60114 Calculate the common denominator of 101/1764 and -69/2092. 922572 Calculate the common denominator of 127/2380 and 127/5880. 99960 Find the common denominator of -52/30345 and -157/43350. 303450 What is the smallest common multiple of 1793 and 539? 87857 Find the common denominator of -68/46179 and -73/205240. 1847160 What is the lowest common multiple of 42 and 66906? 66906 Calculate the lowest common multiple of 1314400 and 5200. 17087200 Calculate the smallest common multiple of 341285 and 9751. 341285 What is the smallest common multiple of 63140 and 98? 441980 Find the common denominator of 37/158096 and 113/492. 474288 Calculate the common denominator of 117/220 and -89/410. 9020 Calculate the lowest common multiple of 510 and 25194. 125970 Calculate the smallest common multiple of 96726 and 7896. 386904 What is the common denominator of 23/36358 and 107/2058? 109074 Find the common denominator of 46/139881 and 87/26644. 559524 Calculate the common denominator of -77/16146 and -25/12. 32292 Find the common denominator of -7/17390 and -62/8319. 3078030 Calculate the common denominator of 17/3195 and 19/10. 6390 Calculate the common denominator of 71/8 and 15/8626. 34504 Calculate the smallest common multiple of 4818 and 3066. 33726 What is the lowest common multiple of 14 and 13580? 13580 What is the smallest common multiple of 40 and 855700? 1711400 Calculate the least common multiple of 172470 and 38. 3276930 What is the common denominator of 117/1630280 and 61/67672? 17933080 Find the common denominator of 53/87024 and -53/480. 870240 Calculate the common denominator of 87/102316 and 79/12. 306948 Find the common denominator of -107/2922 and -83/953546. 2860638 Find the common denominator of 14/82875 and 153/9100. 2320500 What is the common denominator of -101/9288 and -113/648? 27864 Calculate the smallest common multiple of 280 and 1232. 6160 Calculate the common denominator of 43/363975 and -39/10. 727950 What is the smallest common multiple of 37364 and 74728? 74728 Calculate the common denominator of -43/41584 and -105/4048. 457424 Find the common denominator of -43/988 and -10/1121. 58292 What is the smallest common multiple of 118440 and 1260? 118440 Calculate the common denominator of 15/163112 and 137/122334. 489336 Calculate the common denominator of 8/387 and 105/946. 8514 Calculate the smallest common multiple of 44 and 261. 11484 What is the smallest common multiple of 1757 and 179465? 1256255 Find the common denominator of -19/143994 and 29/294. 7055706 What is the least common multiple of 356 and 19224? 19224 Calculate the smallest common multiple of 3088 and 81832. 163664 Find the common denominator of -21/188848 and 97/348. 566544 What is the common denominator of 117/29060 and -137/156? 1133340 What is the lowest common multiple of 327933 and 83? 327933 Find the common denominator of 107/120 and -131/1236. 12360 What is the least common multiple of 46844 and 42? 140532 What is the smallest common multiple of 34 and 30922? 525674 What is the common denominator of -13/99894 and 7/6? 99894 Calculate the lowest common multiple of 13468 and 26. 13468 What is the common denominator of -139/1086 and -9/1546? 839478 Calculate the smallest common multiple of 96 and 1089. 34848 What is the smallest common multiple of 6 and 8097? 16194 Calculate the common denominator of 3/220 and 111/34760. 34760 What is the least common multiple of 175 and 1135? 39725 Calculate the common denominator of -6/11063 and -29/148. 44252 Calculate the smallest common multiple of 12042 and 72252. 72252 What is the least common multiple of 7889 and 588? 94668 Calculate the common denominator of 8/5231 and 7/824. 4310344 Calculate the common denominator of 97/216 and -49/12216. 109944 Calculate the least common multiple of 570 and 18. 1710 What is the smallest common multiple of 2584 and 10778? 819128 Calculate the common denominator of 67/734 and 107/114. 41838 What is the least common multiple of 855 and 2736? 13680 Calculate the common denominator of 91/6 and 17/431219. 2587314 What is the lowest common multiple of 27082 and 220? 270820 What is the least common multiple of 317960 and 160? 1271840 Calculate the least common multiple of 3996 and 740. 19980 Find the common denominator of -173/546 and 73/378. 4914 Calculate the lowest common multiple of 77 and 74987. 524909 What is the least common multiple of 15180 and 191130? 4204860 What is the least common multiple of 248 and 11222? 44888 Calculate the least common multiple of 30846 and 11. 339306 Find the common denominator of 83/49532 and 73/580. 247660 Calculate the smallest common multiple of 1309 and 34111. 579887 What is the lowest common multiple of 20 and 427946? 4279460 Calculate the common denominator of 97/1098 and -93/107482. 967338 What is the common denominator of 37/21133 and 26/35? 105665 What is the common denominator of 61/20408 and -45/88? 224488 What is the lowest common multiple of 124 and 51056? 1582736 Calculate the smallest common multiple of 46024 and 598312. 598312 What is the common denominator of 139/22350 and -157/232440? 1162200 Find the common denominator of 73/490 and -71/375683. 3756830 What is the smallest common multiple of 733850 and 146770? 733850 Calculate the common denominator of -30/8303 and -41/7942. 182666 What is the lowest common multiple of 44452 and 5? 222260 Find the common denominator of 21/5738 and -33/5738. 5738 What is the common denominator of 5/11 and 17/4224? 4224 What is the least common multiple of 9470 and 9470? 9470 Find the common denominator of -61/43340 and 69/19700. 216700 Find the common denominator of -61/21805 and -11/4984. 174440 Calculate the common denominator of -59/117 and 73/201. 7839 What is the common denominator of 37/1300 and 61/460? 29900 Calculate the common denominator of 95/2862 and 53/45. 14310 Calculate the lowest common multiple of 114465 and 153. 5837715 Calculate the lowest common multiple of 156 and 1248. 1248 What is the least common multiple of 9936 and 30544? 824688 Calculate the common denominator of -151/8364 and -83/7872. 133824 Calculate the common denominator of -69/1295 and 86/3885. 3885 Find the common denominator of 8/13079 and 43/91553. 91553 Calculate the smallest common multiple of 282 and 221934. 221934 What is the smallest common multiple of 362366 and 7? 2536562 What is the lowest common multiple of 9480 and 1580? 9480 Calculate the common denominator of -43/75 and -61/34225. 102675 Find the common denominator of -38/2433 and 125/18. 14598 Calculate the smallest common multiple of 8303 and 456. 199272 Calculate the least common multiple of 51048 and 264. 561528 What is the common denominator of 16/12735 and 49/14150? 127350 What is the least common multiple of 117382 and 19? 117382 What is the common denominator of -39/561454 and -91/2672? 4491632 What is the least common multiple of 8190 and 198? 90090 Calculate the lowest common multiple of 1830 and 165. 20130 Calculate the common denominator of -97/29414 and 53/432806. 3029642 Find the common denominator of 101/403378 and 103/18. 3630402 What is the smallest common multiple of 46124 and 7096? 92248 Calculate the common denominator of -173/300	{ "pile_set_name": "DM Mathematics" }
plify (t*(-3)/tt*4t)/((t/t*(-2))/ttt(ttt/t(-3))/t) assuming t is positive. t(-8) Simplify i/(i*(1/19)/iii)i18 assuming i is positive. i(341/19) Simplify (ii(-2/67))/i(-11/3) assuming i is positive. i(932/201) Simplify d/d13dd(4/3) assuming d is positive. d(-29/3) Simplify (zz/(z*22z))/zz(2/49) assuming z is positive. z(-1076/49) Simplify g(-9/2)/gg(g/g(-6)g)/g assuming g is positive. g(5/2) Simplify (y(2/11)y)(-2/163) assuming y is positive. y(-26/1793) Simplify (gg/(g/g(-2/9)))(-4/9)g(-1/5)g/(g/(gg/(g1/g)g)) assuming g is positive. g*(994/405) Simplify ((((l(l/(lll*(3/14)l))/l)/l)/ll)/ll*(-2/9)l)(2/21) assuming l is positive. l(-433/1323) Simplify (g/g(1/12))(-11/8) assuming g is positive. g(-121/96) Simplify (q(1/2))(5/2)/((q/(q/(q(1/10)/q)))/q7) assuming q is positive. q(183/20) Simplify (k*(-1)/(kk*0k))/(k0)(-13) assuming k is positive. k*(-3) Simplify (ii(-4))/i(-9)i/((i/(ii*(-1/2)))/i)i/(ii(-7)) assuming i is positive. i(29/2) Simplify (((h/h(-5/6))/h)/((hh/h*(-7)h)/h))/(h/((h/((hh(1/2)/h)/h))/h))(-5/3) assuming h is positive. h(-22/3) Simplify (mm/(mm(3/13)))(-3) assuming m is positive. m(-30/13) Simplify (a(24/5))(-36) assuming a is positive. a(-864/5) Simplify (a(-1/2))(-49)/(a4/a(-4)) assuming a is positive. a(33/2) Simplify (tt*(3/20)t)12 assuming t is positive. t(129/5) Simplify j*(-25)/(j((jj(2/19)/jj)/j)/j) assuming j is positive. j*(-477/19) Simplify ((x(x/x*(2/17))/x)/(xx6))/(x(-2/7)/(xxx/(x/x(1/2)))) assuming x is positive. x(-793/238) Simplify ((x*(4/7)/x)/xx(xx*0x)/xxxx)39 assuming x is positive. x(975/7) Simplify (k1)(-22)(k(1/3))45 assuming k is positive. k(-7) Simplify (f(-37))(-2/101) assuming f is positive. f(74/101) Simplify j*37/(jj*26j) assuming j is positive. j*9 Simplify ((o/(ooo(oo(2/9))/o))/(o(1/6)oo))/(o(-2/3)o4) assuming o is positive. o(-139/18) Simplify ((aa(-1))/a(7/5))0 assuming a is positive. 1 Simplify (z(-1/11)z)2 assuming z is positive. z(20/11) Simplify m*8/((mm*(-11)m)/m) assuming m is positive. m18 Simplify c(2/69)ccc0c assuming c is positive. c(209/69) Simplify (t(-7)/ttt(-2/5))(1/26) assuming t is positive. t*(-37/130) Simplify u/(u(uuu*(-24)uu)/u)uu(1/15) assuming u is positive. u(331/15) Simplify ((n(6/11)n)/(n(-4)/n))(-1/22) assuming n is positive. n*(-36/121) Simplify cc/c*(10/7)c(c/((c(-13)c)/c))/c assuming c is positive. c(102/7) Simplify (k(-3/2)/kk/k(-4/3))/(k(-1/4)kk)(-2/25) assuming k is positive. k(-2/75) Simplify (r((r*(-1/4)r)/r)/rrr)*7(rr(-1/2)/rr)/r(3/10) assuming r is positive. r(249/20) Simplify (j/j(-1/2))(9/4)(jjj(-2/3)j)/(j*(-2/13)/jj) assuming j is positive. j*(1829/312) Simplify pp*7p/(pp(-1/3))p(1/7)/(p/(p(-2/7)pp)) assuming p is positive. p(193/21) Simplify (a(4/5))(-9/2) assuming a is positive. a(-18/5) Simplify (p/(p/p0))45 assuming p is positive. 1 Simplify (z*(3/22)zz)/(z/(z/z(-30))) assuming z is positive. z(707/22) Simplify ((s(-2/9))(-8))(-19/5) assuming s is positive. s(-304/45) Simplify (o(-6))(-2/11) assuming o is positive. o(12/11) Simplify ss/(s/s*26)s(-28) assuming s is positive. 1/s Simplify o(-5)/ooo*(2/21)(o/(ooo(o/(o/(oo/((o/o*3)/o))))/oo)o)/oo/((oo(-3))/o) assuming o is positive. o(-166/21) Simplify (r/(((rr*32/rr)/r)/r)r)/(r/(r/r(-26))) assuming r is positive. r(-3) Simplify (z/(zz/(z/(((zz(2/13))/zz)/z)z)))/(z/(z(-2/13)/z))z5/z3 assuming z is positive. z(9/13) Simplify (o(2/9)/o)/(o*(-1/9)/o)(o*(-5)o)/(o*(6/7)o) assuming o is positive. o*(-116/21) Simplify ((ss/((s/(s*(-8)/s))/s)s)/(s(-2/3)/s))(-32/7) assuming s is positive. s(416/21) Simplify (u/((u(3/20)/u)/uu)u)/(uu((u/u*21)/u)/uu) assuming u is positive. u(437/20) Simplify (c/(c/c(11/4)))/c(c(-14)c)/c assuming c is positive. c*(-49/4) Simplify ppp/p(-22)(p(-2/5)/p)/p assuming p is positive. p(113/5) Simplify n/(nn(-1)nnn)(nn21)/n assuming n is positive. n19 Simplify (v/v1)(-1/12)/(v*(-5)/vv(2/7)/v) assuming v is positive. v(47/7) Simplify ((m(2/5)/m)44)(-2/67) assuming m is positive. m(264/335) Simplify z*(-2/3)z(zz/z*0z)/zzz*(-1/3)(z4/z)/z assuming z is positive. z5 Simplify i*21i/(i/(i/i*25)i) assuming i is positive. i(-4) Simplify (x6)(-4/5) assuming x is positive. x(-24/5) Simplify (o*(-1/3)/oo)37/((o/o(-1/5)o)/((o/(oo(-1/9)))/o)) assuming o is positive. o(-694/45) Simplify (www*(9/4)ww/(w/(((w(-1/2)/w)/w)/w)))(-27) assuming w is positive. w(-189/4) Simplify v(2/51)v(14/9) assuming v is positive. v(244/153) Simplify ((ii(1/17)/ii)/i)/(i/(i*(-29)/ii)) assuming i is positive. i(-509/17) Simplify z(-26)/z(-2/13) assuming z is positive. z(-336/13) Simplify (pppp(-5)p/(ppp((p/p4)/pp)/pp)p)(-30) assuming p is positive. 1 Simplify b(1/17)/((b15/b)/b) assuming b is positive. b(-220/17) Simplify (vv11)(-1/8) assuming v is positive. v(-3/2) Simplify (n/n(1/3))2(n/(nn(2/5)))19 assuming n is positive. n(-94/15) Simplify (jj*(-10)jj/(jj(-3)))45 assuming j is positive. j*(-225) Simplify (gg(g/(g/(gg/(g/g*0g))g))/g)(-2/49)g/(((gg/g(5/3))/gg)/g)g(-2/9) assuming g is positive. g(13/9) Simplify (a(-2))(1/34)(a1)(7/3) assuming a is positive. a(116/51) Simplify ((u(-2/17)/uu)/u(1/4))(-14) assuming u is positive. u(175/34) Simplify ((pp/p*(3/14)pp)/p(-2))10 assuming p is positive. p(405/7) Simplify g/(g/g15)gggg(-36) assuming g is positive. g(-18) Simplify g(8/3)/ggg22 assuming g is positive. g(74/3) Simplify ((rr/((r/r*(-4/5))/r)r)/rr(-3)/r)/(r(r/(r/(rr(2/7))))/rrr)46 assuming r is positive. r(-5388/35) Simplify v(1/7)/(vv*(4/7)v)v(1/11)/vv/(vvv8) assuming v is positive. v(-950/77) Simplify (q/(q(-4/5)/q))(3/7) assuming q is positive. q(6/5) Simplify f(2/3)f((f(f/(f/((f/(f/(f/f(1/6)ff)))/ff))f)/ff)/f)/fff/(f/(f*(3/10)/f))f(-3/4) assuming f is positive. f(81/20) Simplify (b*6(b/b*(2/27)b)/b)/(b(-1/2)/(b7b)) assuming b is positive. b(833/54) Simplify (t(-3)tt/(t/(t/(ttt5))))/(tt*0t*(-2/5)t) assuming t is positive. t*(-48/5) Simplify (ff(2/3)/f)12 assuming f is positive. f8 Simplify (k(-2))*(4/5)/(k(kk/(k/(kk/(kkk*(-4)k)))kkkk)/kk(k/(k/(k(k6k)/k))k)/k) assuming k is positive. k(-88/5) Simplify (ww*(-2)/ww(-2))26 assuming w is positive. w(-104) Simplify (y(1/2))*0(((y/(y/((y*6/y)/y)y))/y)/y)/y5 assuming y is positive. y(-4) Simplify ttt/(t*(-23)/t)tt(-16)/t assuming t is positive. t11 Simplify (v/((v3/vv)/v))(4/5) assuming v is positive. v(-4/5) Simplify (y(-1/5))(-1) assuming y is positive. y(1/5) Simplify i(-15)(ii*(1/9))/ii assuming i is positive. i(-125/9) Simplify d/d25dd(-8) assuming d is positive. d(-31) Simplify (t*(-3)t/t*(2/5)t)/(t(-5)/t0) assuming t is positive. t(18/5) Simplify (x(4/11)/xx(2/7))/(x(-3/2)x(-5)) assuming x is positive. x(947/154) Simplify ((w/(w/(ww/(www(-3/7)))))/((w/((ww*(-5))/w)w)/w))(-2/3) assuming w is positive. w(26/7) Simplify (k*(-2/17)k)/kkk/(kk2k) assuming k is positive. k(-36/17) Simplify ((p(4/5)/p)(-30))(-1/27) assuming p is positive. p(-2/9) Simplify (s/s(-3/4)s)/(s/(s/(ss*16s))s) assuming s is positive. s(-65/4) Simplify (jj/(j/(j/(j2/j))))(-1/16)/((j(jjj/((j/(j(-2)/j)jj)/j))/j)/(j/(((jjj(-4))/j)/j)j)) assuming j is positive. j(127/16) Simplify (((v/(v/((v/v8)/v)))/v)/(v(-1/4)/v))/((v(-4)/vv)/v(-2/7)) assuming v is positive. v(-113/28) Simplify (l(-10))29 assuming l is positive. l(-290) Simplify (f(-6))(1/31) assuming f is positive. f(-6/31) Simplify (aa/(a*0/a)a*(-8))/(((aa*(-5)a)/aa)/a*(1/2)) assuming a is	{ "pile_set_name": "DM Mathematics" }
e 2i - 2k = 6i - 12, di + 5k - 9 = 0 for i. 3 Let h = -95 - -95. Solve 0j - 17 = -j - 3v, -4j + v + 3 = h for j. 2 Let i(m) = 3m3 + m2 - m + 1. Let q be (7/(-28))/((-2)/8). Let f be i(q). Solve fh = -0j + 3j - 1, 2h + 13 = -j for h. -4 Let y be (-790)/25 - (-4)/(-10). Let g be 4/(-12) - y/6. Solve 2w + 5c + g = 7w, 0 = w + 4c + 24 for w. -4 Let y = -23 + 28. Solve -yo - 3 = 12, -3f - 4o = 24 for f. -4 Suppose 14 = 3c + 5. Solve 9 + 6 = -cm - 3d, -d = 0 for m. -5 Let b(n) = -n3 - 3n*2 - 3n - 2. Let x be b(-2). Suppose -r + 4 = -x. Solve -3a + 13 = -4k, -7k = -2k - ra + 16 for k. -4 Let r(z) = z2 - 7z + 11. Let s be r(8). Solve -5f - 2x = -s, 2f + 2x + 2 = 6 for f. 5 Suppose 0q = 3q. Suppose 2a - a - 4 = q. Suppose -4w + 1 = 3k, -3k - aw - 1 = w. Solve t + r + 5 = 0, 0 = 5t + kr - 4r - 5 for t. 0 Suppose 22r - 50 = 12r. Solve rj = 20, -2w - 3j - 18 = -6j for w. -3 Let a = -13 + 15. Solve 2m + a = 2o - 12, o - 2m - 12 = 0 for o. 2 Suppose -1 = 4r - 9. Suppose 3g + 24 = 3i, 5i + rg = -0i + 19. Let s(u) = u2 - 7u - 4. Let x be s(8). Solve -xa + 2m + 8 = -2m, im - 2 = 2a for a. 4 Let o(p) = -p3 - 14p*2 - 14p - 8. Let h be o(-13). Solve -4 = hd - 2v + 5v, 3v - 6 = 0 for d. -2 Suppose -3i - 3 = 2u, -3u - 2u = -3i - 24. Solve -up - 14 = -p + 2a, 0 = p - 3a - 9 for p. -3 Let d = 18 + -14. Let l = -4 + d. Solve l = o - 4c - 1, o - 2c = -4o - 13 for o. -3 Let i be ((-18)/(-15))/((-6)/(-20)). Solve 3d = -4t - 6, -d = -2t + id - 16 for t. -3 Let d = 11 - 5. Solve 5f + d + 7 = -3s, -3s + f = 1 for s. -1 Let b = 96 - 93. Solve 3w = 4o + 23, bo + 4w + 4 = -7 for o. -5 Suppose r - 4 = -3r. Let j be (2/6)/(r/3). Solve -4i = 5a - j + 9, 3 = i for a. -4 Let p be (-18)/(-8)(0 + 4). Let f be p/6(-1 - -3). Suppose 4w - 11 = -u, 9 = w - 3u + 3. Solve 3n - 5 = 5d, 0 = 4n - wd + 6d + f for n. 0 Suppose -12q + 29 - 5 = 0. Solve -2y - 8 = -2j, qy + 5 = j + 4j for y. -5 Suppose 0 = -5p - 5, -4z + p + 14 + 3 = 0. Solve 3v + k - 12 = 0, zk = 2v - 5v + 3 for v. 5 Let r(l) = l2 + l - 1. Let y be r(0). Let i = 3 - y. Solve 4z + 30 = 2z + 5f, iz - 4f = -36 for z. -5 Let a(z) = -z + 0 + 3 - 2 + 1. Let t be a(-10). Solve -4g + 11 = -3l, 2g + 3g - t = 2l for g. 2 Let n = -34 - -36. Solve 3s - 12 = nx + 2s, -4s = -3x - 23 for x. -5 Suppose -5f - 5 = -5n - 145, -5n = 4f - 67. Suppose k + 5d + f - 3 = 0, 2d + 10 = 0. Suppose -40 = -i - 3i. Solve -i = -kv, -3b - 14 = -b - 3v for b. -4 Let m be 15/((-15)/(-6)). Let o = m - -1. Let c(y) = -y3 - 3y*2 - 4y - 2. Let h be c(-2). Solve -os - 19 = 2z, -s + 2s - z = h for s. -3 Suppose -4b - 5 + 29 = -2t, -5t - 10 = 0. Solve 0 = 3c + bj + 28, -3c + j + 4 = 2 for c. -1 Suppose -3j + 12 = 0, -5c - 2j = -7j + 50. Suppose 0 = u + 4s - 22, 5u - 35 = 3s + 2s. Let w = u + c. Solve -4a - l - 1 = 15, -2l + w = -a for a. -4 Let a(t) = -3 - 5 + 6 - t. Let s be a(-12). Solve -p = -4m - 10, 0 = 4m + 4p + 10 + s for m. -3 Let j be (1 + (-1)/3)6. Let d(x) = -38x - 33. Let w be d(-1). Solve 0 = -b + u - wu - 18, -13 = -jb + u for b. 2 Let u(d) = -d*2 - 9d + 2. Let k be u(-8). Let c = 17 + 3. Let g be (-1)/(56/c - 3). Solve s + 3m = -10 - k, 0 = s - gm - 20 for s. -5 Let r be (-3)/2 - (-15)/2. Let l be ((-4)/r)/((-6)/18). Solve -4p - 5 = 5d + 7, 6 = -lp - 5d for p. -3 Suppose 0q - 3q = -21. Solve -4y - a - q = 0, 7 = -5y - a - 2a for y. -2 Let y = 21 - 17. Solve -5a + 11 = -2w, 0w - yw = 2a + 10 for a. 1 Let p(l) = l*2 - 5l. Suppose -4i = -3z - 3 - 20, -2i + z = -11. Let m be p(i). Suppose mg = g. Solve -3o = -go + 3y - 24, -3y = -5o for o. 3 Suppose -4f + f = -15. Suppose 3n - fr - 22 = 0, -4r = 2n - 3r + 7. Let o = 3 + n. Solve 2t - oh = -2t - 14, -4t - 20 = -4h for t. -2 Suppose -5h + 2h - 3 = 0. Let l be 2/(-3)3h. Let w = 10 - 6. Solve f - l = 5v, -2f = -5f - wv + 6 for f. 2 Let b be (0/(-1))/(-49/36). Solve 16 = 5o - 0a + 4a, b = 3o + 4a - 16 for o. 0 Let z(d) = d*2 - 6d - 11. Let p = 15 - 7. Let c be z(p). Suppose -81 = -cl - 2r, -3 = -4r + 9. Solve -4q = -0t + 2t + 18, 5t = 2q + l for q. -5 Suppose -5i + 4 = -4c - 4, i - 1 = c. Solve 5o + 27 = -y, -30 + 5 = 5y + co for y. -2 Suppose 3w = 2z + 2w + 47, -5w = -25. Let l be (-12)/(-7) - 6/z. Solve 5i - g - 4g = -25, 10 = -3i - lg for i. -4 Let q = 39 - 37. Let g = 5 + -3. Let x(a) = -a3 - 5a*2 - 2a - 7. Let y be x(-5). Solve -yk + 3l + 22 = qk, -l = gk for k. 2 Let l(b) = -b*3 - 18b*2 - 31b + 16. Let z be l(-16). Solve -3r = -5t + 19, -2t + 12 = r - z for t. 5 Let k(r) = -r2 - 9r - 5. Let p be k(-7). Solve 3g - 5q = 23, -3q - p = -2g + 5g for g. 1 Suppose 0v = 4v. Suppose v = -4n - 2y - 2, -n + 5 = 4n + y. Solve 10 = 5r - nr + 2s, -25 = 4r - 5s for r. 0 Let r(c) = 4 - 5 - c - 2. Suppose 4y = -12y - 80. Let f be r(y). Solve n + 7 = -0n + 2m, 0 = -fn + 2m - 12 for n. -5 Let i(n) = -n2 + 12n + 3. Let s(l) = l*2 - 11l - 4. Let p(t) = 6i(t) + 7s(t). Let a be p(7). Solve -1 = ao + 3u + 2u, 0 = -2o - 4u - 2 for o. 1 Let v be -2 - (-3 + 2 + -11). Let l be v3(-2)/4. Let x = l + 52. Solve -16 = -5t + 3r, 5t + r - x = -3r for t. 5 Let a(g) = -19g3 - g2. Let w be a(-1). Suppose w = 2n - 4b, -2n - b - 3 = -1. Solve p + j = -0p - n, -j - 21 = 5p for p. -5 Let d be (-2)/7 + (-4)/(-14) + 1. Solve -3m + 2 = -4m, 3i + 4m = d for i. 3 Let t be (24 + 0)/((-6)/4). Let d = -10 - t. Solve b + 19 = -2r + 4b, 2b - d = 0 for r. -5 Let l be (12/4)/(1/(-6)). Let q be -1 - 1l/3. Solve 0 = -5o + qz - 2 - 8, 2z - 8 = 3o for o. -4 Let f = -11 + 11. Solve -3z + 3y + 14 = -13, f = -z - 3y - 7 for z. 5 Suppose -3a = 2a. Solve 5c = -4g + 1, ag - 2c = 2g for g. -1 Let a be (-12)/(-15)15/2. Suppose ao = 8o - 50. Suppose 6u + 12 = 2u, 2r - 15 = 3u. Solve -5d = 2s - o, d + 0s - 5 = rs for d. 5 Let c(s) = s*2 + 5s - 5. Let n be c(-6). Suppose 1 = d - n. Suppose x - 6 = 2z + z, 5z = -2x + 1. Solve 0 = xf + 3, du - 4f + 8 = -u for u. -4 Let n be (-2)/5(-16 - -1). Let a be (-2 - n/2)-1. Solve -l = -am + 14, 0l - 2l - 2 = 3m for m. 2 Let m = -73 + 76. Solve 2h + 3z + 15 = 0, -5z - 25 = mh - h for h. 0 Let q be 30/45 - 7/(-3). Solve 2r + 4d = 10, 2r = -d - 5 + q for r. -3 Let k(m) be the second derivative of 1/2m*2 - 7/20m*5 + 0 + 0m*4 + 2m + 0m3. Let v be k(-1). Solve vl = 4l - z - 2, -4l - 10 = -3z for l. -1 Suppose 25 = -j + 6j. Suppose 3o - 5 + 15 = 4s, jo = 5s - 10. Solve w + ox = 5, -4w - 2x = -x - 20 for w. 5 Suppose -2p = -3i - 22, -9 - 13 = -3p - i. Suppose 0r - 4r = -p. Solve rl - 4 - 2 = 2o, 1 = -5l - 3o for l. 1 Let m(b) = b*3 - 5b*2 + 6b. Suppose 3o - 3 - 9 = 0. Let q be m(o). Let g be 1/3(2 + 13). Solve q = -k - gc, -4c = 5k + 11 + 8 for k. -3 Let t(d) = -2d + 14. Let n be t(6). Solve 5l - 5h - 40 = 0, -h - 5 = -nl + 8 for l. 5 Let t be (-7)/(-1) + 0 + -4. Solve 2q - t = a, -2q - 5 = a + 2 for q. -1 Let b be 32 - (-16)/(-8). Suppose 2 = bn - 10. Solve -ni - p + 15 = 0, -2 + 15 = 4i - p for i. 4 Let o be (-9)/(-21) - (-32)/7. Solve 4p - 7 - 1 = -v, -v - op = -9 for v. 4 Let j(a) = -a + 1. Let g be j(-2). Solve f = -3q - 3f - 23, -gf - 26 = 4q for q. -5 Let b(t) = -t3 - 8t*2 - 6t + 9. Let k be b(-7). Let u be (-10)/4(-10)/5. Solve -n + 20 = -uh, -3h = -h + kn + 20 for h. -5 Let h = 3 - -9. Let v be 3/416/4. Solve g = 4g - h, -5g = -vt - 17 for t. 1 Let o(i) = -13i2 + 13i - 2i + 55i*3 - 54i*3 + 12. Let d be o(12). Solve 5n - 2r + 12 = d, 5n - 3n + 2r = -2 for n. -2 Suppose -3t + 0 = -6. Suppose 3r = -5j - 2 - 6, -r = tj + 4. Solve -ra - f - 7 = -5a, 5f = -3a - 3 for a. 4 Suppose 4f = 5x + 9 - 33, -4f - 24 = -2x. Let u be 2 - (f - (-3)/1). Solve -v - 17 = 4w, 0v + 4v + u = 5w for v. -5 Suppose 0 = -2t + 2 + 4. Let w(l) = 3l + 10 + l - tl. Let x be w(-7). Solve 4c = -3r - c - 18, -c - x = 0 for r. -1 Suppose -q - 2q = 0. Suppose 0 = y - 0y - 2h, q = 2h. Solve -5n = y, 0d + 4n = 2d - 2 for d. 1 Suppose -3m - 4w = -13, -3m + 2*w - 4 = -11. Let i(	{ "pile_set_name": "DM Mathematics" }
. 158 Calculate the remainder when 175837 is divided by 56. 53 Calculate the remainder when 1112 is divided by 581. 531 What is the remainder when 394180 is divided by 8? 4 What is the remainder when 1490 is divided by 467? 89 What is the remainder when 36109 is divided by 122? 119 What is the remainder when 33702 is divided by 16724? 254 Calculate the remainder when 1109019 is divided by 675. 669 What is the remainder when 115856 is divided by 332? 320 Calculate the remainder when 9259 is divided by 1321. 12 Calculate the remainder when 52428 is divided by 364. 12 What is the remainder when 214 is divided by 208? 6 What is the remainder when 1105957 is divided by 10? 7 What is the remainder when 17373 is divided by 90? 3 Calculate the remainder when 36958 is divided by 36. 22 What is the remainder when 28838 is divided by 40? 38 Calculate the remainder when 80638 is divided by 252. 250 Calculate the remainder when 45786 is divided by 654. 6 Calculate the remainder when 26575 is divided by 97. 94 What is the remainder when 7990 is divided by 127? 116 What is the remainder when 498100 is divided by 81? 31 Calculate the remainder when 17846 is divided by 33. 26 What is the remainder when 46241 is divided by 340? 1 Calculate the remainder when 216153 is divided by 108. 45 What is the remainder when 12221 is divided by 126? 125 Calculate the remainder when 601109 is divided by 45. 44 Calculate the remainder when 2374 is divided by 2365. 9 Calculate the remainder when 8459 is divided by 4196. 67 Calculate the remainder when 2778 is divided by 100. 78 Calculate the remainder when 12109 is divided by 1859. 955 What is the remainder when 63873 is divided by 159? 114 Calculate the remainder when 309 is divided by 309. 0 What is the remainder when 5470 is divided by 1087? 35 What is the remainder when 2904 is divided by 1448? 8 What is the remainder when 2822 is divided by 91? 1 Calculate the remainder when 842351 is divided by 336. 335 What is the remainder when 19025 is divided by 110? 105 What is the remainder when 66540 is divided by 2377? 2361 What is the remainder when 105435 is divided by 13178? 11 What is the remainder when 70746 is divided by 64? 26 Calculate the remainder when 2100754 is divided by 34. 30 What is the remainder when 2975 is divided by 732? 47 Calculate the remainder when 6934 is divided by 126. 4 What is the remainder when 86794 is divided by 62? 56 Calculate the remainder when 4141161 is divided by 62. 57 What is the remainder when 76997 is divided by 64? 5 Calculate the remainder when 6535 is divided by 486. 217 Calculate the remainder when 25905 is divided by 53. 41 What is the remainder when 4897 is divided by 42? 25 Calculate the remainder when 5023367 is divided by 252. 251 Calculate the remainder when 7711 is divided by 9. 7 What is the remainder when 4035 is divided by 805? 10 Calculate the remainder when 62451 is divided by 1301. 3 Calculate the remainder when 6286 is divided by 630. 616 What is the remainder when 454378 is divided by 14? 8 Calculate the remainder when 4973 is divided by 1285. 1118 Calculate the remainder when 12575 is divided by 16. 15 What is the remainder when 2568 is divided by 828? 84 Calculate the remainder when 3007 is divided by 162. 91 What is the remainder when 58251 is divided by 8316? 39 What is the remainder when 300508 is divided by 53? 51 What is the remainder when 86968 is divided by 85? 13 Calculate the remainder when 317199 is divided by 1220. 1219 Calculate the remainder when 6475 is divided by 190. 15 What is the remainder when 379704 is divided by 41? 3 Calculate the remainder when 226828 is divided by 226819. 9 What is the remainder when 31244 is divided by 93? 89 Calculate the remainder when 1566 is divided by 897. 669 Calculate the remainder when 45236 is divided by 119. 16 Calculate the remainder when 1280997 is divided by 71. 15 Calculate the remainder when 744903 is divided by 109. 106 Calculate the remainder when 615 is divided by 25. 15 Calculate the remainder when 23903 is divided by 649. 539 Calculate the remainder when 21479 is divided by 40. 39 What is the remainder when 56238 is divided by 1105? 988 Calculate the remainder when 338137 is divided by 220. 217 What is the remainder when 10173 is divided by 1402? 359 What is the remainder when 326152 is divided by 32? 8 What is the remainder when 108024 is divided by 2348? 16 Calculate the remainder when 16111 is divided by 129. 115 Calculate the remainder when 3262 is divided by 204. 202 What is the remainder when 8217 is divided by 685? 682 Calculate the remainder when 574 is divided by 271. 32 Calculate the remainder when 885181 is divided by 49. 45 Calculate the remainder when 29258 is divided by 27. 17 Calculate the remainder when 4826 is divided by 245. 171 Calculate the remainder when 21305 is divided by 2367. 2 What is the remainder when 6353 is divided by 120? 113 Calculate the remainder when 205815 is divided by 27. 21 What is the remainder when 19749 is divided by 267? 258 What is the remainder when 4175 is divided by 823? 60 What is the remainder when 27198 is divided by 33? 6 Calculate the remainder when 812561 is divided by 74. 41 Calculate the remainder when 34609 is divided by 3460. 9 Calculate the remainder when 2135 is divided by 711. 2 Calculate the remainder when 125425 is divided by 3. 1 Calculate the remainder when 25277 is divided by 43. 36 What is the remainder when 71255 is divided by 11811? 389 What is the remainder when 9060 is divided by 88? 84 Calculate the remainder when 3992 is divided by 3839. 153 Calculate the remainder when 24267 is divided by 18. 3 Calculate the remainder when 36651 is divided by 12216. 3 What is the remainder when 15290 is divided by 566? 8 What is the remainder when 8199 is divided by 1267? 597 Calculate the remainder when 15441 is divided by 642. 33 What is the remainder when 13160 is divided by 528? 488 What is the remainder when 183965 is divided by 61318? 11 What is the remainder when 291936 is divided by 441? 435 Calculate the remainder when 529613 is divided by 17. 12 Calculate the remainder when 63217 is divided by 614. 589 What is the remainder when 81063 is divided by 27012? 27 Calculate the remainder when 1479 is divided by 308. 247 Calculate the remainder when 168835 is divided by 1897. 2 Calculate the remainder when 22076 is divided by 166. 164 What is the remainder when 170765 is divided by 821? 818 What is the remainder when 21988 is divided by 204? 160 Calculate the remainder when 133936 is divided by 151. 150 Calculate the remainder when 142 is divided by 32. 14 Calculate the remainder when 78314 is divided by 2060. 34 Calculate the remainder when 2681 is divided by 62. 15 Calculate the remainder when 31229 is divided by 64. 61 What is the remainder when 1134 is divided by 144? 126 Calculate the remainder when 15843 is divided by 117. 48 Calculate the remainder when 4817 is divided by 140. 57 What is the remainder when 68635 is divided by 110? 105 Calculate the remainder when 2126 is divided by 425. 1 What is the remainder when 15918 is divided by 20? 18 What is the remainder when 1509 is divided by 1285? 224 Calculate the remainder when 8256 is divided by 1576. 376 Calculate the remainder when 39721 is divided by 4964. 9 What is the remainder when 40687 is divided by 1564? 23 What is the remainder when 5101 is divided by 2545? 11 What is the remainder when 89172 is divided by 2785? 52 Calculate the remainder when 855 is divided by 344. 167 What is the remainder when 135273 is divided by 239? 238 What is the remainder when 1144 is divided by 84? 52 What is the remainder when 999993 is divided by 125? 118 Calculate the remainder when 872 is divided by 272. 56 Calculate the remainder when 246005 is divided by 28. 25 What is the remainder when 186 is divided by 47? 45 What is the remainder when 126486 is divided by 17? 6 What is the remainder when 97090 is divided by 151? 148 What is the remainder when 144645 is divided by 246? 243 Calculate the remainder when 2419 is divided by 271. 251 What is the remainder when 18059 is divided by 10? 9 Calculate the remainder when 2445743 is divided by 157. 154 What is the remainder when 4786 is divided by 339? 40	{ "pile_set_name": "DM Mathematics" }
+ 2p - 1 + (2p - p + p)(1 - 2 - 1))(-3 + 1 + 1)) to the form op + fp*3 + y + rp2 and give f. 2 Rearrange (-2 - h2 + 2)(h - 4h + 4h) + (4h*2 - 3h*2 - 3h*2)(-5h + 4h + 3h) to sh*2 + b + nh*3 + ih and give n. -5 Rearrange 5f2 - 9f*2 - 46f*2 to the form mf*2 + lf + h and give m. -50 Rearrange (1 - 1 - 1)(o - 5o + 5o - 3o - 2o + 7o + (1 + 0 + 1)(-o - 2o - 3o)) to the form ko + a and give a. 0 Rearrange -14t2 - 12 + 6 + 6 to the form i + at + qt2 and give q. -14 Rearrange -6o + o - 12o to d + ao and give a. -17 Express 8k + 23k - 20k + 3k*2 in the form q + lk*2 + ak and give q. 0 Express (-1 + 1 + 3)(-3a + a + a)(a + 2 + 0a + a) in the form wa2 + ca + y and give c. -6 Rearrange 576h + 3 - 608h - 3 to the form th + p and give t. -32 Rearrange -5c*4 + 49c*2 + 56c*2 - 2 - 106c*2 - 3c*3 to oc + jc3 + rc*2 + v + lc*4 and give l. -5 Express -11b - 429 + 429 as rb + l and give r. -11 Express 5 - 12 + 7 - 5y + 4y2 in the form my*2 + l + ty and give m. 4 Rearrange (-5 - 1 + 5)(26f - 62f - 29f) to the form w + lf and give l. 65 Rearrange 15l - 22 + 22 + (0 - 4 + 3)(3 - 5 + 0)(2 - l - 2) to the form ol + d and give o. 13 Express h3 + 9641h*2 - 9641h*2 + 19 + 2h in the form sh3 + ph + m + xh2 and give m. 19 Rearrange (-3 + 3 + k3)(k - 4k + 5k) - 11k4 + k4 - 2k*4 to the form j + ok + yk2 + bk*3 + mk*4 and give m. -10 Express -18m*3 + 2m + 123 - 2m - 121 as wm*2 + om*3 + u + fm and give u. 2 Rearrange (10a + 2a*2 - 6a + a*2)(-2 + 3 + 1)(-4a*2 - 2 + 2) to ca + va2 + o + ga*3 + ma*4 and give m. -24 Rearrange (0 + 2 + 0)(-4k4 - k4 + 7k*4) + 10k*3 - 10k*3 - 56k*4 to dk + ck4 + s + gk*3 + fk2 and give c. -52 Express -k2 + 2k3 + k2 + k4 - 5k + 2k in the form ak*4 + j + ik*2 + pk + qk3 and give q. 2 Express (19q + 348 - 348)(-4q + 0 + 2q + 3) as cq*2 + t + kq and give k. 57 Express (2t3 + 0t3 + t3)((2 - 1 + 1)(3t - 4t + 0t) - t + 5t - t) as at2 + yt*3 + qt + v + nt4 and give n. 3 Express -301x + 149x + 153x - 2 + 5 in the form a + lx and give a. 3 Rearrange (-36q - 7q + 7q)((1 - 2 - 1)(-q - 2q + 5q) + 2q + 1 - 1) to the form t + hq + mq2 and give m. 72 Express 41l + 2 + 1 - 3 as k + ql and give q. 41 Rearrange ((-b + 0b + 3b)(-1 + 3 - 4) + 2b - 2b - b)(-1 - 3 + 6) to lb + f and give l. -10 Rearrange 55 - 55 - 176c to the form a + oc and give o. -176 Rearrange -6o - 6o + 5o to ao + v and give a. -7 Express (-6h3 + 3h*3 + 0h*3)(7h + 0h - 5h) as xh*4 + nh*2 + b + yh + uh3 and give x. -6 Rearrange (3 - 1 + 0)(-l*2 - 3l*2 + 3l2) + l2 - 2 + 2 + 1593l - 1593l + 49l2 to the form w + ul*2 + ql and give u. 48 Rearrange 62g + 14g + 8g - 29g to ug + q and give u. 55 Rearrange -8b*3 - 4b*2 + 1 + 3b*2 - b + 2b*4 + 9b*3 + 0b to lb2 + xb + z + cb4 + ub*3 and give z. 1 Express (3i + 3 + 4i - 6i)(-3i + 5i - 4i)(0 - 2 + 5) as hi*2 + ki + o and give k. -18 Express 22u + 0u + 35u + 3u in the form fu + o and give f. 60 Rearrange (-b + 3b + 2b + (4 - 4 + 2b)(-4 + 4 + 1))(-3 + 4 - 10) to the form c + ob and give o. -54 Express -2w*3 + 4w*3 - 5w*2 + 3w*2 + 3 in the form zw*2 + jw + hw3 + l and give z. -2 Rearrange (-2v + v + 2v)((-v + 4v - v)(-5 + 5v2 + 5) + 3v*3 + 0v*3 - 2v*2 + 0v*2) to the form jv + qv4 + av*3 + kv*2 + w and give k. 0 Rearrange -2k*2 - 2k + 0 - 7 + 4 to fk2 + z + vk and give v. -2 Express -6d + 7d*2 + 2d + 6d as pd + td2 + a and give a. 0 Rearrange (-2p + 2p - 2p)(-21 + 10 - 11)((-1 - 2 + 4)(0 + 0 - 2p) + p - 3p + 0p + p + 3p - 2p) to lp + c + gp*2 and give g. -88 Rearrange (5o - 2o - o)(-279o + 74o*3 + 279o) to the form co4 + io*2 + g + xo + wo3 and give c. 148 Express 2z*2 + 23 + 4z - 51 + 30 as uz2 + b + tz and give b. 2 Express 28t + 2t + 4t2 - 7t2 + t2 as j + mt2 + ft and give f. 30 Express -19 + m*2 + 19 + 7m*3 as hm*3 + cm*2 + o + qm and give h. 7 Express 13h + 7h + 4 - 4 as bh + z and give b. 20 Rearrange -2w*4 - 3w*4 + 3w*4 + (12w*4 - 14w*4 + 25w*4)(-1 - 1 + 3) to the form dw3 + cw*4 + u + vw + gw2 and give g. 0 Express (7 + 8n*3 - 7)(-2 + 1 + 2n - 8n) as j + rn2 + bn*3 + on + yn4 and give y. -48 Express 2j + 15j + 17j + 0j in the form d + cj and give d. 0 Express (7d - 7d - 4d2)(-1 - 2 + 1)(-1 + 1 - 7d) as qd3 + w + kd*2 + od and give q. -56 Express 1658 + 12j - 1658 as tj + w and give t. 12 Rearrange ((4 - 3 - 3)(4 - 3 - 3) + 1 + 2 - 5)(-27f + 71f - 29f)(-f + f - 2f3) to af*2 + sf + qf4 + b + vf*3 and give q. -60 Rearrange (0 - 2 + 0)(20o3 - 18o*3 - 10o*3) + (o + 0o - 6o)(-1 + 1 - 3o2) to mo*2 + zo + x + po3 and give p. 31 Rearrange -3 - 2u*2 - 2 + 7 to the form ku + su2 + b and give b. 2 Rearrange (6t*2 - 4t*2 + 0t*2)(4t - 5t + 2t)(1 + 3 - 6) to the form qt2 + lt + mt3 + h and give m. -4 Express (-l4 + l + 6 - 4 + l)(10 + 2 + 1) in the form nl3 + tl*4 + xl*2 + kl + b and give b. 26 Rearrange -58 - 15q4 + 58 + q - 3q*3 to the form wq*4 + bq + fq3 + gq*2 + k and give w. -15 Rearrange 18g*2 - 7g - 1 + 1 + 4g to the form u + bg + rg2 and give r. 18 Express (x3 + 4x*3 - 2x*3)(-3 + 3 + 2x) + 5x*4 + 9x*4 + 2x - 11x4 as vx*4 + zx*3 + tx + i + wx2 and give v. 9 Express 6 + 3 + x2 - 8 - x as ox + d + px2 and give o. -1 Rearrange -1 + 5t2 + t3 + 2t4 - 6t*2 - 4t*4 to xt*3 + dt*2 + lt*4 + r + at and give r. -1 Express -4 + 22t2 + 5 - 1 in the form dt*2 + c + ot and give d. 22 Express -2y2 + 0y + 0y + (4 + 2y*2 - 4)(-4 + 3 + 3) + 41y2 + 165 - 165 in the form ly*2 + by + h and give l. 43 Rearrange -2408 + 3t2 - 4t3 + 2408 + t3 - 5t3 + 3t*3 + (0 + t + 0)(-2t2 + 0t*2 + 0t*2) to ft*3 + z + ot*2 + it and give f. -7 Rearrange (7b - 7b + 2b)(-b*3 + 5b*3 - 2b*3) - 4b*4 + 2b*4 + 3b*4 to the form a + rb + xb2 + sb*4 + ib*3 and give s. 5 Express -3j*2 + 4j + 3j - 4j in the form vj2 + n + bj and give v. -3 Express 0c2 - 6c2 - 4 + c2 + 4c2 - 5c2 - c2 + (c - 1 + 1)(0c - c - c) in the form jc2 + tc + x and give j. -9 Express -3n2 + 4n*2 - 4 + 0n*2 + 0n*4 + n - 2n*4 as cn + h + zn2 + kn*4 + yn*3 and give c. 1 Rearrange (1 - y - 1)(-4y3 + y3 + 0y*3) to the form vy*2 + ay*4 + wy + t + ky3 and give a. 3 Express (4g + 3g2 - 4g)(1 - 5g + 3g + 17g) in the form o + jg + mg*2 + ug*3 and give u. 45 Rearrange (-3h + 4h + 2h)(-2h2 + h2 + 30h2) to ih + r + dh3 + sh*2 and give d. 87 Rearrange -9i*2 + 11i*2 + 19i + 105i to the form wi*2 + ri + s and give w. 2 Rearrange 0l2 - l4 + l3 + 0l*4 - 4l + 2l2 to the form il*3 + yl*2 + ol + j + ml4 and give o. -4 Rearrange 33d*2 + 26d*2 - 60d*2 to the form ad*2 + s + zd and give a. -1 Rearrange o*3 + 2o*3 + o - 2o3 + o4 - 3o2 to l + fo*2 + wo*3 + vo*4 + yo and give v. 1 Express (-3 + 3 - 2o)(2 - 4 + 4)(4 - 1 - 4) in the form b + qo and give b. 0 Express 1 + 5277w2 - 2w*3 - 5277w*2 - 31w in the form cw3 + uw*2 + vw + f and give f. 1 Rearrange -4 + 2z + 0z*3 - 2z*2 - 4z2 + z3 + 5z2 to the form jz*2 + gz*3 + d + cz and give j. -1 Rearrange (1 + 2 - 4 + (3 - 3 + 2)(-3 - 2 + 3) + 2 - 3 + 3)(57f + 28f + f*2 - 6f) to the form m + sf + cf*2 and give m. 0 Express 5v + 2v3 - 2v - 11 + v*3 - v in the form u + fv*3 + yv + dv2 and give f. 3 Express 7i + 7i - 5i + ((-2 + 2i + 2)(-2 + 4 - 4) - i - i + 4i - 2i + 0i + 0i)(1 + 3 - 5) as s + ji and give j. 13 Rearrange -18 - 2c + 12 + 4c*2 - 3c2 + c4 to vc3 + x + pc + hc4 + ic*2 and give p. -2 Rearrange 6 + 2y3 - y3 - 3 + 0y3 + y3 - 2y*3 + (-y + y + 2y*2)(0y + 4y - 6y) to the form my*3 + hy*2 + by + r and give b. 0 Rearrange 15t - 53t - 14*	{ "pile_set_name": "DM Mathematics" }
-22 = -5z + 3. Suppose -z = v - 0. Let c(l) = l3 + 6l*2 + 5l + 6. Determine c(v). 6 Let x = -1 - 0. Let n(s) = 4s + 7. Let r(c) = 4c + 6. Let z(o) = 6n(o) - 7r(o). Calculate z(x). 4 Let l be (-3)/(-2) + 28/(-8). Let k(n) = -4n - 3. Give k(l). 5 Let w(p) = p - 4. Suppose 8d = 4d. What is w(d)? -4 Let o(h) = -4h - 3. Let j = -4 - -6. Suppose 0 = m - 0m - 4z + 6, 2z - 6 = jm. What is o(m)? 5 Let i(y) = 4y + 71. Let p be i(-19). Let r(w) = -5 - w + 2 - 1. Determine r(p). 1 Let x(k) = 4k + 7. Let z(t) = -7t - 13. Let r(c) = 11x(c) + 6z(c). Suppose 4p - 5v = 18 - 7, -2p + 2v + 4 = 0. Give r(p). -3 Let j(s) be the second derivative of -s4/6 + s3/2 + s. Suppose 6c + 5z = c, 3z + 10 = -c. Suppose ci = -5l - 5, -i + 3 = 3l - 0. Calculate j(l). -2 Let c be (-21)/(-3) + -2 + -1. Let p = -9 + c. Let h(f) = -f + 3 - 3. What is h(p)? 5 Let m(k) = -7k - 2. Let b(x) = -16x - 5. Let v(t) = 4b(t) - 9m(t). Suppose 4q - 3p - 18 = 0, -2p = 5q + p - 36. Give v(q). -8 Let u(d) = 2d*3 - 3d*2 - 3d*3 - 1 + 0d*3 + 4d. Suppose 5j - 4g = -5g - 23, 3g = 2j - 1. Let w be u(j). Let p(h) = h - 1. What is p(w)? -2 Let s(m) = 8m - 3. Let j(k) = 24k - 8. Suppose -5w + 8 = -3w. Let x(r) = wj(r) - 11s(r). Suppose -4d - 2z - 4 = 0, -2d - 3d = -3z + 5. What is x(d)? -7 Let g(z) = z*2 - 6z + 5. Suppose 0 = -3m - 4 - 5. Let p = 0 - m. Suppose -2a + 2v - 18 = -7a, 9 = pa + 3v. Calculate g(a). -3 Suppose -33 = -0j - 3j. Let y = 17 - j. Let x(t) = t*2 - 7t + 5. Give x(y). -1 Let k(p) = p*2 - 2p - 1. Let t(y) = 3y2 - 3y - 3. Let w(h) = 5k(h) - 2t(h). Let f(l) = l*3 - 3. Let c be f(0). Calculate w(c). 4 Let p(q) = q. Let m be (10/3)/((-16)/(-24)). What is p(m)? 5 Let a(q) = 5q - 3. Let v(l) = -6l + 3. Let g(k) = -7a(k) - 6v(k). Let s(n) = n3 - 10n*2 + 8n + 5. Let f be s(9). What is g(f)? -1 Let g(l) be the second derivative of l3/6 + l2/2 + 7l. Let v be g(3). Let k(r) = r2 - 2r. Give k(v). 8 Let k(w) be the third derivative of -5w4/12 - w3/6 + 4w*2. Calculate k(-1). 9 Suppose -5n + 3 = -3c + 2c, 0 = -3c - 3n - 9. Suppose 3s - 5l + 2l = 6, -2l = -3s + 4. Let i(b) = -3b + s + 7b + 0 + 3. Determine i(c). -9 Let a(n) = -n3 - n2 + 2. Let o be a(0). Suppose -ou = 2u. Let d(z) = -z2 - 9. What is d(u)? -9 Let v(l) be the second derivative of l5/20 + 7l*4/12 + 4l*3/3 + 3l*2/2 + 3l. What is v(-6)? -9 Suppose 3p = 13 + 11. Let a(v) = -v2 + 10v - 11. Let t be a(p). Let f(x) = -x + 2. Give f(t). -3 Let p(g) be the third derivative of -g5/120 + g4/12 + 5g3/6 + 5g*2. Let a(w) be the first derivative of p(w). Determine a(-5). 7 Let i(m) = m + 8. Suppose 7 - 37 = 5z. Calculate i(z). 2 Suppose 12 = -2r + 2d, 5r = d - 0d - 50. Let t = r + 7. Let c(k) be the first derivative of k*4/4 + 5k*3/3 + 3k*2 + 5k - 1. Calculate c(t). -3 Let h = 18 - 13. Let g(r) = r*3 - 6r*2 + 5r - 6. Give g(h). -6 Let a(k) be the first derivative of -k*2/2 + k + 90. Suppose -7b + 4b = 0. Let i be 0 + (-2 + 3)b. Give a(i). 1 Let c(t) = t*2 + 5t - 7. Suppose 5x = x + 3p - 30, -5x = -5p + 40. What is c(x)? -1 Let b(t) = -t*2 + t - 1. Let f(q) = 3 + 4q*2 + 0q + 0q3 - 3q + q*3. Let m(n) = 5b(n) + f(n). What is m(2)? 6 Let g = 9 + -11. Let u = -1 - g. Let v be 3u(-4)/(-4). Let w(d) = -2d + 2. Calculate w(v). -4 Let m(h) = -h2 - 5h - 3. Let b = 11 - 9. Suppose 3q + 5 = bq. What is m(q)? -3 Let f(q) = q*2 + 5q - 2. Let v(z) = z - 1. Let n(g) = g - 11. Let m(u) = -n(u) + 2v(u). Let y be m(-7). Suppose 8 + 0 = -yt. Determine f(t). -6 Suppose -3m - 5 = 1, 0 = 2z + 4m - 2. Let o(i) be the second derivative of i4/12 - 5i*3/6 + 3i2/2 - i. Calculate o(z). 3 Let b = 2 - 0. Let h(s) = -3 - 2 - s + b. Let f(j) = -j + 4. Let y be f(4). Calculate h(y). -3 Let a = -17 + 23. Let z(w) = w2 - 7w + 4. Determine z(a). -2 Let d(l) = l3 + 4l*2 + 3l + 1. Suppose -2u - 2 = 4m - 4, 0 = -5u + 5m - 25. What is d(u)? 1 Let u(g) be the third derivative of g4/12 + g3/6 - g*2. Suppose c - 12 = 2s, 0 = s - 5c + 15 + 9. Give u(s). -7 Let y(q) be the first derivative of -q6/360 + q5/30 - 5q4/24 - q3/3 + 3. Let l(t) be the third derivative of y(t). Calculate l(5). -10 Let m = 11 - 5. Let u(g) = 2g + m - g - 4g + 4g. Determine u(-3). 3 Let i(b) = 2b*3 + 4b*2 - b + 1. Suppose 0 = -2r + r - 3. Calculate i(r). -14 Let l(b) = -9b + 1. Let a = -9 - -11. Calculate l(a). -17 Let p(i) be the second derivative of -i4/12 - i3 - i2/2 - 10i. Give p(-6). -1 Let o(x) = -10x - 13. Let y(b) = 7b + 9. Let v(u) = -5o(u) - 7y(u). Give v(-2). 0 Let m(c) = -c*2 + 1. Let j(x) = 3x - 19. Let l be j(7). Determine m(l). -3 Let r(q) = -7q2 - 2q - 1. Let v(a) = a. Let x be v(3). Suppose 6 = 3j + xb, 2j + 11 = 3j + 4b. Calculate r(j). -6 Let y(r) = 13r*2 + 2 - 3 - 16r*2 - 5r*2. Calculate y(-1). -9 Let i(g) be the first derivative of 5g*2/2 - 2g - 3. Calculate i(2). 8 Let p(k) = -2k2 + 5k + 8. Let r(d) = -3d2 + 10d + 15. Let v(j) = -5p(j) + 3r(j). Let w(i) = -2i. Let a be w(2). Determine v(a). 1 Let j(y) = 2y - 2y2 - y2 + 0y. Let g(m) = m*2 + 3m + 2. Let f be g(-3). What is j(f)? -8 Suppose 0w - 2w = 12. Let m(x) = 3x3 - 23x*2 - 8x - 9. Let u(q) = q*3 - 8q*2 - 3q - 3. Let h(i) = wm(i) + 17u(i). What is h(2)? -3 Suppose 0 = z - 6z + 5. Let y(u) = 31u - 11u - 14u. Give y(z). 6 Let g(s) be the second derivative of -s4/12 - s3 - 2s2 + 4s. Determine g(-3). 5 Let u(f) = -f - 5. Suppose -2c = 3b + 4, -3b - c = -0c + 2. Suppose 0 = -bx + 5x. What is u(x)? -5 Let k(m) = m - 3. Suppose v = 4f + f, 4v = -2f. What is k(f)? -3 Let k(l) = -3l2. Let v(x) be the third derivative of x4/24 + 5x3/6 - 2x*2. Let o be v(-6). Give k(o). -3 Suppose 11h - 15h = 4. Let i(b) = -5b + 0b + 5 - 4. Determine i(h). 6 Let z(g) = 15 - 26 + g + 14. Determine z(-5). -2 Let s(w) = -w + 3. Let y be s(-3). Let q(i) = -i2 + 5i + 3. Calculate q(y). -3 Let a = 1 - -2. Suppose -20 = -5i, -2i + 10 = ar + 2i. Let u(c) = 2c - 2 - c + 0c. Give u(r). -4 Suppose -22t = -27t - 20. Let o(i) = -i*3 - 5i*2 - 4i - 6. What is o(t)? -6 Let c(v) = -6v + 2. Let t(x) be the third derivative of 7x4/24 - x3/2 + x*2. Let n(s) = 6c(s) + 5t(s). Suppose 5i - 14 - 11 = 0. Give n(i). -8 Suppose -5p - 33 = 4t, -t + 3 = -p - 0. Let s(a) = -4 + 3a - 3a + 3a - 5a. Let r(n) = 3n + 5. Let w(u) = -3r(u) - 4s(u). Determine w(p). 6 Suppose -3o + 5v = -17, o + 2v - 2 + 0 = 0. Let h(d) = d - 6. Calculate h(o). -2 Suppose -4i + 20 = -4f + f, -3f = 2i - 10. Suppose fx + x - 2 = 0. Let u(g) = -g3 - 2g*2 + 2g + 2. What is u(x)? -10 Let p(h) = 2h + 5. Let z(k) = 4k + 9. Let f(i) = 7p(i) - 4z(i). What is f(4)? -9 Let t(r) = -4r - r + 1 + 0 - 2r - r2. What is t(-6)? 7 Let g(s) be the second derivative of -s3/6 - s*2/2 + 2s. Suppose 0 = -2c - 8. Calculate g(c). 3 Let x be (1 + -1)/((-2)/2). Let r(k) = k + x - 5 + 3 - 2k. Give r(-1). -1 Let x(u) = -u*2 - 8u - 6. Let o be x(-6). Let i(b) = -b*3 + 6b*2 + 2b - 6. Determine i(o). 6 Let t(d) = -6d3 - 30d2 + 15. Let g(y) = -y3 - 6y2 + 3. Let r(z) = 11g(z) - 2t(z). Give r(6). 3 Let r(o) = -5o - 4. Let l(n) = -4n - 5. Let z(s) = -4l(s) + 3r(s). Let t(a) = -a2 - 7a + 3. Let x be t(-7). Suppose 0 = -v + x - 9. Calculate z(v). 2 Let u(o) be the second derivative of 7o5/20 + o4/6 - o3/3 + o2/2 - 6o. What is u(1)? 8 Let p(k) be the second derivative of -k6/20 - k5/60 + k4/24 + k3/6 + 2k2 + 2k. Let x(z) be the first derivative of p(z). Give x(-1). 5 Suppose -4n - 12 = -4z, -3n + 7n + 44 = -4z. Let x = -2 - n. Let f(m) = m2 - 3m - 1. Give f(x). 9 Let h(o) = -3o + 2. Let u(b) = -b2 + 5b - 2. Let s be u(4). Determine h(s). -4 Let p be (0 - -2) + 6 + -1. Let s(n) = -n*3 + 6n*2 + 6n + 2. Determine s(p). -5 Let a(r) be the third derivative of r5/60 - r4/24 + 7r3/2 - r2 - 26. What is a(0)? 21 Let z(x) = -3 - 2x - 3 + 3. Let k = -1 + 5. Let o = 0 - k. Give z(o). 5 Let r(l) = l*2 - 2. Suppose 3x + 10 = 8x. Suppose 0 = -3h + 4h - x. Suppose -w + 1 = 2o - 3, -w = -h*o. Calcula	{ "pile_set_name": "DM Mathematics" }
+ z*2 - tz*c - 7 wrt z? -6 Let y(n) be the first derivative of 3n*4 + 10n - 96. Let j(k) = k*2 + 24k3 - k2 + 19. Let g(f) = 3j(f) - 5y(f). Differentiate g(u) wrt u. 36u2 Let c(u) be the second derivative of 8u6/15 - u5/4 - 313u4/12 + 3u - 87. Find the third derivative of c(w) wrt w. 384w - 30 Let p = 0 + 8. Let j = 11 - p. Differentiate -3t + 4t + t - 2 - jt with respect to t. -1 Let y = -32 + 47. Find the first derivative of 16i - i + 2 - y - 2 wrt i. 15 Find the third derivative of 179m - 179m - 1078m*3 + 137m*2 wrt m. -6468 Let c(y) be the first derivative of 0y*2 + 0y*4 + 0y*3 + 3 + 3/5y*5 - 11y. Differentiate c(m) with respect to m. 12m3 Let b = -24 - -29. What is the third derivative of 22y + 20yb + 17y*2 - 22y wrt y? 1200y2 Let g(u) = u2 + 17u. Let l(h) = -2h2 - h2 + 4h*2 - 3h*2 - 18h. Let d(o) = 7g(o) + 6l(o). What is the second derivative of d(r) wrt r? -10 Suppose -12 = -8c + 5c. What is the second derivative of 2f + 7f*c + 34f*4 - 42f wrt f? 492f2 Let s(b) = -b2 - b + 1. Let l(y) = -16y*2 - 9y - 8. Let m = 52 + -51. Let f(d) = ml(d) + 5s(d). Find the second derivative of f(j) wrt j. -42 Let w(m) be the third derivative of -m8/42 + m5/20 - 59m4/24 + 13m*2 + 9m. What is the second derivative of w(k) wrt k? -160k3 + 6 Let m(z) be the third derivative of -31z*4/24 + 47z*3/3 - 85z2. What is the derivative of m(w) wrt w? -31 Let u(j) = -j2 + 14j + 11. Let r be u(14). Differentiate -rh - 36 + 29h - 15h - 9 wrt h. 3 Let c(m) = -87m4 - 2m*2 + 7m + 4. Let a(n) = 173n4 + 3n*2 - 15n - 9. Let s(r) = -4a(r) - 9c(r). What is the third derivative of s(o) wrt o? 2184o Suppose -3f + i = -0f + 4, f = i. Let t be (-1)/(-2 + 3)f. What is the third derivative of 4 - 4 + 6o5 + 0ot - o2 wrt o? 360o2 Let k = 32 + -33. Let j(g) = -g4 - g3 - 8g2. Let v(n) = n6 + n4 + n3. Let y(o) = kv(o) - j(o). What is the third derivative of y(x) wrt x? -120x*3 Let u be 3(-1 + 40/15). What is the third derivative of 0z2 + 5z*6 + uz*2 + 4z*6 wrt z? 1080z*3 Let y(p) = 63p - 70. Let k(d) = 3d + 1. Let g(c) = 4k(c) + y(c). Differentiate g(u) with respect to u. 75 Suppose 0 = j - 14 - 8. Find the third derivative of -21l2 + 37l*3 - 42l*2 + jl2 wrt l. 222 Let s(k) = k3 - k*2 + k. Let t(y) = -38y*3 + 3y*2 - 3y + 9. Let b(r) = 3s(r) + t(r). Find the first derivative of b(q) wrt q. -105q*2 Let y(h) be the third derivative of -97h*7/210 + 27h*3/2 + 25h*2. Differentiate y(v) with respect to v. -388v*3 What is the first derivative of 505g*2 - 505g*2 - 3g - 5g3 - 61 wrt g? -15g2 - 3 Let g(y) be the first derivative of y3 + 12y2 - 72y + 21. Differentiate g(d) wrt d. 6d + 24 Let u(v) be the first derivative of -65v6/6 + v2/2 + 7v - 26. What is the second derivative of u(k) wrt k? -1300k*3 Let b = -76 - -78. Find the second derivative of s + 14s*b + 4s*2 - 16s wrt s. 36 Let i(n) be the second derivative of 3n5/20 + n4/6 - 30n*2 - 9n - 9. What is the derivative of i(u) wrt u? 9u2 + 4u What is the second derivative of -733y3 - 56 + 600y + 28 + 28 wrt y? -4398y Let l(b) be the third derivative of 23b*6/24 + 151b4/24 + b2 - 13b. Find the second derivative of l(u) wrt u. 690u Let d(n) be the third derivative of 17n7/105 + n6/40 + n5/30 + 13n*4/3 - 100n*2 - 1. What is the third derivative of d(f) wrt f? 816f + 18 What is the second derivative of 3 - 324x3 - 2 + 181x*2 - 395x + 322x3 wrt x? -12x + 362 Let i = -16 - -56. Suppose y - i = -y. What is the first derivative of 9 - 20w + yw - w*4 + 0w*4 wrt w? -4w*3 Let i(f) = -9f*4 - 47f*3 + 71f*2 + 1. Let h(u) = 5u*4 + 23u*3 - 35u*2 - 1. Let n(d) = 7h(d) + 4i(d). What is the third derivative of n(l) wrt l? -24l - 162 Suppose -22u + 39 = -71. Let y(t) be the second derivative of 1/6t*3 - 1/20t*5 + 0 + 0t*2 - ut + 0t4. Find the second derivative of y(r) wrt r. -6r Let z(r) = -r + 3. Let p(m) = -31m - 34. Let o(g) = -p(g) - 2z(g). Find the first derivative of o(v) wrt v. 33 What is the second derivative of -18r2 + 8r + 29r - 17r*2 - 16r*2 + 3 - 5r*2 wrt r? -112 Let m = -48 + 74. Suppose -2 + 0 = h + n, 5h - 4n - m = 0. What is the derivative of -hb*4 + 3b*4 + 7 - 4 wrt b? 4b*3 Suppose -3w + 8 + 4 = 0. What is the second derivative of -24r5 + 7r*5 - 3r - wr wrt r? -340r*3 What is the first derivative of 21 + 0 - 7 + 160o + 18 + 56o wrt o? 216 Let i(b) be the first derivative of -249b*2/2 + 629b - 249. Differentiate i(g) with respect to g. -249 Find the second derivative of -28y + 6421 - 6421 + 266y*4 wrt y. 3192y*2 Let g(a) = a - 3. Let n be 144/14 - 6/21. Let c be g(n). Differentiate 2h*4 - ch*4 + 4h*4 - 1 + 3 wrt h. -4h*3 Let j(m) be the third derivative of -11m9/168 - m5/15 - 95m2. Find the third derivative of j(z) wrt z. -3960z*3 Let a = 20 - 4. Find the first derivative of -30 - at + 0t + 40 + 0t wrt t. -16 Let f(t) = 181t3 - 270t*2 + 7. Let a(r) = 60r*3 - 90r*2 + 2. Let c(s) = 7a(s) - 2f(s). Find the third derivative of c(x) wrt x. 348 Let s(l) be the third derivative of -l7/210 - l6/20 - l5/6 + 62l*2. Find the third derivative of s(y) wrt y. -24y - 36 What is the third derivative of -13g5 + 128g*2 - 7g*4 + 183g*2 + 4g*4 - 123g2 + g4 wrt g? -780g2 - 48g Let t(c) be the third derivative of c5/60 + c4/2 + 5c2. Let v be t(-12). What is the third derivative of vl*2 + 2l6 + l2 + 6l6 - 2l*6 wrt l? 720l*3 Let f(p) be the first derivative of -283p*2 + 340p + 221. Differentiate f(g) wrt g. -566 Let l(u) be the second derivative of -1/3u3 - 4u*2 + 0 - 12u. What is the derivative of l(g) wrt g? -2 Differentiate 699 + 3616a2 + 6a - 1811a2 - 1803a*2 with respect to a. 4a + 6 What is the derivative of -311 + 38g3 + 493g*2 + 85g*4 - 86g*4 - 493g*2 wrt g? -4g*3 + 114g*2 Let x(w) be the second derivative of -17w*4/4 - 49w*3 + 380w. What is the second derivative of x(k) wrt k? -102 Find the first derivative of 8z + 83 + z - 276 - 4z*4 wrt z. -16z*3 + 9 Find the third derivative of -2j*6 + 19j*4 + 22j*2 + 141j*4 - 3j*4 wrt j. -240j*3 + 3768j Let h(g) be the second derivative of 14g6/15 + 5g*3 - 3g*2 + 406g. What is the second derivative of h(w) wrt w? 336w2 Suppose 5 = 5t - 4v - 1, -2v = -t. Suppose tu - 3u = -3. Differentiate -20z3 + 7z*4 + 20z*u + 7 with respect to z. 28z*3 Let n(d) be the second derivative of -149d4/12 + d3/2 + 39d2/2 + 82d + 3. Find the second derivative of n(k) wrt k. -298 Suppose 10g - 42 + 2 = 0. Differentiate 282y*3 - 8 + 31y*g - 282y*3 with respect to y. 124y*3 Let p be 4(-22)/(-28) + 19/(-133). What is the third derivative of 2b3 - 11b*p - 10b*2 + 6b3 + b3 wrt b? -12 Let f be 1 - (1 - (3 + 0)). What is the third derivative of -h2 - h2 - 3hf + 5h*2 + 6h*2 wrt h? -18 Let l(h) = 2h*3 + 51h*2. Let n(a) = -2a*3 - 51a*2. Let w(q) = -5l(q) - 6n(q). Find the third derivative of w(b) wrt b. 12 Suppose 2f = f + 65. Suppose 3b - f = -2b. What is the derivative of 0 + b + 8u4 - 5 wrt u? 32u*3 Suppose -5v + 7v + 4 = 0. Let r = -2 - v. What is the second derivative of 2p*3 + 4p + rp + 2p3 - p3 wrt p? 18p Let g(p) be the second derivative of 39p*7/7 - 65p*4/3 - 122p - 1. Find the third derivative of g(k) wrt k. 14040k2 Let u(v) be the third derivative of v8/112 - 43v*5/60 + 17v4/8 + v3/6 + 18v2 - 7. What is the second derivative of u(b) wrt b? 60b*3 - 86 Let l(y) = 13y*4 - 115y*3 + 5y*2 - 14y. Let m(s) = 2s4 - s3 + s2. Let c(g) = -l(g) + 5m(g). What is the second derivative of c(u) wrt u? -36u2 + 660u Let p be (-9)/11 + 1 - 2/11. Let k(s) be the third derivative of 0 + ps + 0s*4 + 1/60s5 + s2 - 2/3s3. Differentiate k(z) with respect to z. 2z Suppose 13 + 53 = 2d. Let o = 37 - d. Find the second derivative of 5f*4 + of + 3f5 - 5f*4 + 5f*5 wrt f. 160f*3 Let t(w) = 90w - 1. Let j be t(3). Suppose 9*m =	{ "pile_set_name": "DM Mathematics" }
42. 9009i3 Collect the terms in 125j*3 + 104j*3 + 7451j*2 - 7451j*2. 229j*3 Collect the terms in -53279j + 1894j3 + 53279j. 1894j3 Collect the terms in 201427w*2 - 100711w*2 - 100710w*2. 6w*2 Collect the terms in 108g*3 + 46g*3 - 1 + 1. 154g*3 Collect the terms in 1770f*3 + 0 + 3 + 2f - 1 + 1. 1770f3 + 2f + 3 Collect the terms in 2l - 84l*2 + 5l + 98l2 - 7l. 14l2 Collect the terms in 0l + 644l2 - 317l*2 - 322l*2 - 4l + 4l. 5l*2 Collect the terms in -44689k*2 - 85 + 85. -44689k*2 Collect the terms in -84474 + 84474 - 3i. -3i Collect the terms in -149 - 860 - 79c + 3c3 - 5c*3 + 79c. -2c3 - 1009 Collect the terms in 5775t - 21t2 - 41t*2 + 5782t - 11557t. -62t*2 Collect the terms in 2s + 50954 - 50954. 2s Collect the terms in -1035 + 6d - 1299 + 2334. 6d Collect the terms in 996 - 996 + 63w + 22w. 85w Collect the terms in 10m3 + 72417m - 72425m - 3m*3. 7m*3 - 8m Collect the terms in -3446 - 157o + 3446 + 794o. 637o Collect the terms in -5187 + 6g*2 + 1726 + 1731 + 1730. 6g*2 Collect the terms in -13021a - 1 + 16847a + 1. 3826a Collect the terms in 5h - 44 - 3h + 71 - 207. 2h - 180 Collect the terms in -22v - 22 + 22 + 12v - 12v. -22v Collect the terms in 2i*2 - 117i - 115i - 4i*2 - 135i + 329i. -2i*2 - 38i Collect the terms in -143g + 210g - 129g + 4g*2 - 5g2. -g2 - 62g Collect the terms in 57f + 175f + 28f. 260f Collect the terms in 40p - 151p + 33p + 34p + 30p. -14p Collect the terms in -1 + 15s*3 - 723s*2 - 712s*2 + 1435s*2 - 2. 15s*3 - 3 Collect the terms in 0r*3 + 4 + 28 - 8r*3 + 9r*3 - 8r*3 + 8r3. r3 + 32 Collect the terms in 11241 + 11240 - 169f - 22481 - 273f. -442f Collect the terms in -415 - 641 + 1056 + 3s*3. 3s*3 Collect the terms in -76r*2 - 83r*2 + 162r*2. 3r*2 Collect the terms in -2044687533 + 2044687533 - 5b. -5b Collect the terms in 21t*2 - 27t2 - t2. -7t2 Collect the terms in -9x*2 - 232 + 655 - 423. -9x*2 Collect the terms in 1055 - 16s - 1056 + 6s. -10s - 1 Collect the terms in -107a2 - 109a*2 + 219a*2. 3a*2 Collect the terms in -7693q*3 - 3799q*3 - 611q*3 + 26 - 25. -12103q*3 + 1 Collect the terms in 108r - 18r2 + 101r - 208r. -18r*2 + r Collect the terms in -15 - 813s + 401s + 409s + 26. -3s + 11 Collect the terms in -14121m*2 + 4935m*2 - 18914m*2. -28100m*2 Collect the terms in -p - 3 + 261p*2 + 355p*3 + 3 - 260p*2. 355p3 + p2 - p Collect the terms in -10b - 36 + 8b - 89 - 5b. -7b - 125 Collect the terms in 3k - 4k - 479k3 - 34 - 28 + 0k. -479k3 - k - 62 Collect the terms in 1468 - 2945 + 26y*3 - 11y*3 + 1477. 15y*3 Collect the terms in u - 2015476 + 2015476. u Collect the terms in 225g - 608g + 212g + 217g. 46g Collect the terms in 11218h2 + 11226h2 + h3 - 22444h2. h3 Collect the terms in -162113p - 3p2 + 324228p - 162115p. -3p*2 Collect the terms in 2r*2 - 25r + 106r3 + 9r + 3r + 13r. 106r3 + 2r*2 Collect the terms in 3x + 135x + x - 2. 139x - 2 Collect the terms in 15u2 - 35u*2 + 0u*3 - 15u*3. -15u*3 - 20u*2 Collect the terms in -7960t - 3 + 7959t + 3 + 0. -t Collect the terms in -54l + 13l - 39l - 61l - 1. -141l - 1 Collect the terms in -2961j - 17j*2 - 2869j + 5830j. -17j2 Collect the terms in -g2 - 222g + 4g*2 + 222g. 3g2 Collect the terms in 8h + 6h + 4h + 19h - 27h. 10h Collect the terms in -38y + 16y + 19y - 870y3. -870y*3 - 3y Collect the terms in 12833y - 2678 + 2678. 12833y Collect the terms in 250r3 + 182r*3 + 148r*3. 580r*3 Collect the terms in 11z*3 - 43z*3 + 10z*3 + 18z*3. -4z*3 Collect the terms in -1 + 246n3 + n2 - 81n3 + 2n*2 - 4n*2 - 7n*2. 165n*3 - 8n*2 - 1 Collect the terms in 893r - 2242r + 717r. -632r Collect the terms in -3w*3 - 2w*3 - 811w - 2 + 17w3. 12w*3 - 811w - 2 Collect the terms in 39v - 50v + 7v. -4v Collect the terms in 311x + 2732x + 2152x + x3 + 2228x. x*3 + 7423x Collect the terms in -n + 5n3 + 4032662n*2 + n - 4032662n*2. 5n*3 Collect the terms in -4596s + 0 + 1651s + 1. -2945s + 1 Collect the terms in -9i3 - 12i*3 - 8i*3 + 35i*3 - 4i*3 - 11i*3. -9i*3 Collect the terms in -2840202i - 3i3 + 2840202i. -3i3 Collect the terms in -566063 + 8d + 566063 - 12d. -4d Collect the terms in -7 + 3 + 0 + 8 + 6u - 10. 6u - 6 Collect the terms in -134 - 8c3 + 130 - 12c*3. -20c*3 - 4 Collect the terms in 1578s + 1730s - 3294s. 14s Collect the terms in -546849o*3 + 273424o*3 + 273426o*3 + 6o2. o3 + 6o2 Collect the terms in 47q*2 - 301q + 2q3 - 1088q - 47q2. 2q*3 - 1389q Collect the terms in -2w2 + 43780957804w - 43780957804w. -2w*2 Collect the terms in 5i*2 + 8i*2 - 10i*2 - 27i*2 - 12i*2. -36i*2 Collect the terms in -339f - 2 - 1744f + 2. -2083f Collect the terms in 4723g2 - 2370g*2 - 2417g*2. -64g*2 Collect the terms in 18x*3 - 11x*3 + 61x*3 + 63x*3. 131x*3 Collect the terms in -390c*2 + 496c*2 - 807c*2. -701c*2 Collect the terms in -1889r + 7658r + 1988r + 3677r. 11434r Collect the terms in 179i3 + 177i*3 - 534i*3 + 176i*3. -2i*3 Collect the terms in 1133q*2 + 15q + 2q + 2q. 1133q2 + 19q Collect the terms in -5473v2 + 2769v*2 + 2701v*2. -3v*2 Collect the terms in -77x*3 + 147x*2 - 35x*2 - 112x*2. -77x*3 Collect the terms in -4 - 166x + 700x + 4 + 978x. 1512x Collect the terms in 3 - 1 + 2167b - 2167b - 11b*2 - 2. -11b*2 Collect the terms in 2752u - 2u3 + 3318u - 6070u. -2u*3 Collect the terms in 41g3 - g2 - 94g3 - 2g*2 + 3g*2. -53g*3 Collect the terms in 67p + 0 + 2 - 2. 67p Collect the terms in j3 - 261114j*2 + 261114j2. j3 Collect the terms in 2f3 + 10f*3 - 14f*3 - 19f*3 - 8f*3 + 2f*3. -27f*3 Collect the terms in 11 + 2g*2 - 6021g + 6021g. 2g*2 + 11 Collect the terms in 641r*2 - 641r*2 - 742r*3 + 770r*3. 28r*3 Collect the terms in 8w*3 + 27 - 753w*2 - 27 + 750w*2 + 5w*3 + 20w*3. 33w*3 - 3w*2 Collect the terms in 216w + 29047 - 29047. 216w Collect the terms in -201 + 32m + 201. 32m Collect the terms in -63 - 11q*3 + 111 - 57. -11q*3 - 9 Collect the terms in -1 - 38b*2 - 492b*2 + 1. -530b*2 Collect the terms in 264 + 308 - 840 + 270 + 29j. 29j + 2 Collect the terms in 2 - 7f + f - 1 + 104f3. 104f*3 - 6f + 1 Collect the terms in -3i3 + 7i*3 + 0i*3 - 9i*3 - 17i*3. -22i*3 Collect the terms in 1006v*2 - 5321v*2 + 859v*2. -3456v*2 Collect the terms in -f - 54f - 1979f. -2034f Collect the terms in u + 334447 - 334447. u Collect the terms in 69m2 - m + 29 + m + 70m*2 - 142m*2. -3m*2 + 29 Collect the terms in -331y + 11y + 338y. 18y Collect the terms in -2 + 2 + 1 - 1 + 1509s*3. 1509s*3 Collect the terms in 791p*3 + 799p*3 - 1564p*3. 26p*3 Collect the terms in -964x - 260 - 967x + 260 + 1927x. -4x Collect the terms in 2p*3 + 3319 - 1657 + 3p*3 - 1665. 5p*3 - 3 Collect the terms in -148x*3 - 3155x*2 + 9x*3 + 3155x*2. -139x*3 Collect the terms in 7k - 3k - 14k - 857286 + 857283. -10k - 3 Collect the terms in 10j + 51j - 12j - 3j + 4j*2. 4j*2 + 46j Collect the terms in -30f3 - 19677f*2 - 19689f*2 + 39366f*2. -30f*3 Collect the terms in -15i + 22723 - 22721 + 31i + 14i + 7i. 37i + 2 Collect the terms in -272 + 2280 + 0x + x3 - 7x. x*3 - 7x + 2008 Collect the terms in -348r + 0r*2 + 0r*2 + 128r*3 - 121r*3 + 348r. 7r3 Collect the terms in 469t + 315t - 76t + 472t + 239t. 1419t Collect the terms in 1 + 1 - 389597m*3 + 389659m*3. 62m*3 + 2 Collect the terms in 12654 + 12660 - 25313 + 49p*2. 49p*2 + 1 Collect the terms in 8a + 15a - 37360a*3 - 23a + 37365a3. 5a*3 Collect the terms in -3y*2 + y + 4918 - y. -3y*2 + 4918 Collect the terms in 18692 + 13d - 3d - 18692 + 31d. 41d Collect the terms in 314b*2 - 549b*2 + 235b*2 - 66b*3. -66b**3 Collect th	{ "pile_set_name": "DM Mathematics" }
207/68 - r/(-4) a multiple of 6? True Suppose g + v - 265 = 0, -v - 9 + 8 = 0. Is g a multiple of 19? True Suppose -2t + 3l + 143 = 0, -3t - t = -2l - 290. Is t a multiple of 24? False Let n(x) = 27x2 - 2x - 3. Is 13 a factor of n(3)? True Suppose m - 9 = 39. Does 24 divide m? True Let a(j) = -j*3 + 9j*2 + 3j + 12. Does 20 divide a(9)? False Let p = 2 - 1. Let g = -4 - -6. Is 4 a factor of g/(-4)(p + -15)? False Suppose -7j + 3j - 36 = 0. Let r be 6/27 + (-754)/j. Suppose 0o = 3o - r. Is 14 a factor of o? True Let l(k) = k2 + 7. Suppose -y = -3y. Let q be l(y). Is 3 a factor of (0 - 0) + q + -1? True Let u be 44/(-77) + 22/14. Does 10 divide (1 + u)245/14? False Suppose -4p + 15 = 5m, -4p - 4m + m + 9 = 0. Suppose -2j - 4 = 0, p = 4h + 3j - 128 - 2. Is 34 a factor of h? True Let u(a) = a*3 - 11a*2 + 11a. Let m be u(10). Let y be ((-4)/(-10))/(2/m). Is (-14)/(0 - y) - -2 a multiple of 4? False Suppose -2c + 7 = -1. Let v = c - -1. Suppose -2g + v = -g. Does 4 divide g? False Does 12 divide -124/28-42? True Let b(a) = -a3 - a2 + 2a - 7. Let i be b(-3). Suppose 382 + 23 = in. Is n a multiple of 15? False Let u be (-5)/(-10) + 5/2. Let i = u + 0. Suppose 0n - 156 = -in. Is 14 a factor of n? False Let t(u) be the first derivative of u*4/4 - 4u*3 + 3u*2/2 - 18u + 9. Does 18 divide t(12)? True Let h(n) = n*3 + n + 5. Let c(r) = 0r + r + 0r - r2. Let i be c(1). Is h(i) a multiple of 3? False Let w(v) = 2v - 6. Let t be w(4). Suppose 3j + 18 = 5s - 167, -ts + 3j + 74 = 0. Is s a multiple of 10? False Let l(i) = i*2. Let v(x) = 6x*2 + 13x + 9. Let o(m) = 5l(m) - v(m). Is o(-8) a multiple of 12? False Suppose 2y = 4 + 4. Suppose 3u = 2n + 52, -n = -4u - yn + 41. Suppose 70 + u = 4m. Does 16 divide m? False Let n(z) = 3z - 1. Let p be n(2). Let a be 0 + 3/(-6)-78. Suppose a - p = f. Does 17 divide f? True Suppose 4f - 2f + 2 = 0. Let g = f - -3. Is g/(-8) - 207/(-12) a multiple of 16? False Let a(c) = -c2 - 5c - 3. Let s be a(-3). Suppose sn = n + 4p + 130, -3n = -5p - 194. Does 21 divide n? True Suppose v + 26 = n, n - 2v = -4v + 20. Suppose -3b + 4x + 12 = -5b, 3x - n = 4b. Let f(z) = 2z*2 + 8z + 4. Is 14 a factor of f(b)? True Let y(r) = 2r3 + 5r*2 - 12r + 2. Let z(q) = -q3 + q2 + q + 1. Let a(f) = y(f) + 3z(f). Is a(6) a multiple of 10? False Let m(s) = -s + 9. Let h be m(7). Suppose 2 = -hz - 0. Is (7 - z) + (3 - 1) a multiple of 5? True Let h = 9 + 64. Is h a multiple of 16? False Let h = -5 + 7. Is 11 a factor of (76/2 - h) + 2? False Does 13 divide (5 - -21)/((-10)/(-130))? True Let j = -4 + 3. Let f be (j/(-2))/(5/(-30)). Is (-3)/f + (1 - -28) a multiple of 15? True Let o(g) = -8g*2 - 3g - 2. Let f(a) = -15a2 - 6a - 4. Let u(s) = 6f(s) - 11o(s). Let y be u(-2). Does 7 divide 128/9 - y/(-18)? True Suppose -4n + 20 = 0, -2v + n + 163 - 10 = 0. Suppose -m + v = 8. Is m a multiple of 27? False Let y = -1 + -1. Let l = 22 - 11. Let z = y + l. Is z a multiple of 8? False Let a = 8 + 3. Let l be (-3 - 0 - 3) + -1. Let k = l + a. Is k a multiple of 3? False Let d be 0 + (-2)/((-6)/(-159)). Let a = -38 - d. Is a a multiple of 11? False Is 5 a factor of (-978)/(-66) + (-2)/(-11)? True Let s be 2/2 + (4 - 3). Suppose 0 = o - so. Suppose -122 = -3z - j, oj - 102 = -3z + 3j. Is z a multiple of 10? False Suppose j = -3j. Suppose -4o - 2i - 98 = 0, 3o - 5i + 106 = -jo. Let y = 45 + o. Is 9 a factor of y? True Suppose 5 = -q + 46. Let f = q - 15. Is f a multiple of 12? False Suppose 2u = -0u - 8. Does 5 divide (10/15)/(u/(-42))? False Let o(r) = -r3 - 2r*2 + r - 4. Let i = -2 - 1. Let f be o(i). Does 2 divide (f/(-6))/(2/(-24))? True Let y(a) = 7a*2 + a + 1. Does 9 divide y(1)? True Let d = 3 + 0. Suppose 0 = -5l - dm + 5 + 3, 5m = -4l - 4. Is 3 a factor of l? False Let h(r) = 2r*2 + 3r - 3. Let a be h(-3). Suppose 3w + 2w + 5t = -20, -3w - 5t = 20. Let d = a - w. Is 6 a factor of d? True Is 25 a factor of (27 + -2)/(5/5)? True Let s(v) = v3 + 12v*2 + v + 12. Let x be s(-12). Does 13 divide (-4 - -30) + x + -3? False Suppose -3f = -f. Suppose -l + 10 + 1 = f. Let y(w) = w*2 - 11w + 11. Does 5 divide y(l)? False Let d be 6/(-10) + (-9)/(-15). Suppose 85 = 5u - du. Is 14 a factor of u? False Let d = -1 - -3. Suppose -262 = -2s + 4u, ds = 2u - 6 + 276. Suppose -117 = -3n - j, s - 10 = 3n - 3j. Is 15 a factor of n? False Let p = -23 + 83. Is 15 a factor of p? True Is (-15)/((-27)/(-10) + -3) a multiple of 31? False Suppose -6p + 137 = -667. Does 24 divide p? False Let x(r) = -r*3 - 10r*2 - 11r - 13. Let h be x(-9). Suppose 3w - 5m + 90 = hw, 0 = -2w - m + 82. Is 11 a factor of w? False Let q(f) = -f*2 + 6 + 19f + 11f - 28f. Is q(0) a multiple of 3? True Suppose -21 - 23 = 4m. Let n = 32 + m. Is 10 a factor of n? False Let s = 15 - 42. Suppose -5t + 39 = -4t. Let w = t + s. Is 6 a factor of w? True Suppose -4b - 3 + 15 = 0. Suppose -5j + 2z + 160 = -3z, -4j = bz - 100. Is j a multiple of 14? True Let x = 0 + -20. Let d be (5 - 1)/((-8)/x). Is 12 a factor of (-20)/(-6)36/d? True Does 7 divide 224/3 + 1(-2)/(-6)? False Suppose -3a + 498 = -111. Is 15 a factor of a? False Suppose -4p - 5z + 6 = -56, 28 = 2p + 4z. Does 6 divide p? True Let n = 35 - 97. Let a = -30 - n. Is 16 a factor of a? True Let x = -133 - -253. Is 30 a factor of x? True Let z(a) = 11a. Is 11 a factor of z(1)? True Suppose 4a = -z + 9, 4a - 3z - 1 = 4. Suppose a + 11 = c. Suppose 0 = -3s - 4q + 55, -s + 2q = -2q - c. Does 11 divide s? False Suppose 2 = 2p - 0. Let v = -1 - p. Is 4 a factor of (-7)/(-2) + (-1)/v? True Suppose 0r - 4z = -4r + 36, -4r + 21 = -z. Let j = 3 + r. Is j a multiple of 3? False Is 190/5 - (2 + (5 - 3)) a multiple of 7? False Let h(d) = -61d - 10. Let v be h(-4). Let w = 332 - v. Does 15 divide w? False Let d(i) = -i + 21. Suppose x = 3x - 18. Is d(x) a multiple of 12? True Let j(n) = -n2 - 27n - 48. Does 13 divide j(-21)? True Let q = 32 + -56. Let k = -9 - q. Is k a multiple of 8? False Let t(n) = 31n2 - n + 1. Let d be t(1). Suppose 2h = v - 10 - 7, h + d = 5v. Is 14 a factor of h/2 - (9 - 26)? True Let a be 1/(-1(-1)/(-1)). Is a/(-4) + (-111)/(-4) a multiple of 14? True Suppose 0 = d, j = -j - 5d. Suppose -x + 12 = -24. Does 13 divide -1 + 1x + j? False Let w(m) = m - 1. Let y(b) = b*2 + 5b + 13. Let v(h) = -5w(h) + y(h). Is v(0) a multiple of 9? True Suppose 17 + 8 = 5u, 3u = -2x + 3. Let c be (-4)/x - 65/(-15). Suppose -7d = -3d + 3s - 56, -cd + 5s + 35 = 0. Does 11 divide d? True Is (0 - (1 - 1)) + 3 a multiple of 2? False Let p(d) = 12d*2 + 2d + 2. Does 12 divide p(-1)? True Let r = -128 + 191. Does 12 divide r? False Let k(u) = u*3 + 6u*2 + 3u - 3. Let m be k(-3). Suppose 3a = -m, r - 60 = 2a + 10. Does 11 divide r? False Let v(x) = -x*2 - 5x - 4. Let c be v(-4). Suppose m - 3n = 30, -76 = -2m - cm - 2n. Is m a multiple of 18? True Suppose -2l - 132 = -4l. Suppose l = n + n. Suppose -n = -3m - 3y, 3y = -m - 0m + 19. Is m a multiple of 3? False Suppose 0 = 2u + u + 2p - 14, -5u + p = -19. Does 20 divide u/18 - (-349)/9? False Does 27 divide (3/9)/(2/174)? False Suppose -2t - 1 + 13 = 0. Let i = 9 + t. Suppose -15 = -3y + i. Is y a multiple of 5? True Let i(q) = -4q*2 + 2q - 2 + q3 + 0 - 2. Let d be i(4). Let j(w) = -w2 + 6w - 3. Is 5 a factor of j(d)? True Let h = 3 - -25. Is 7 a factor of h? True Let u(z) = 35z - 1. Let i = -5 - -5. Suppose i = -5x + 5. Is u(x) a multiple of 12? False Let a(c) = c2 - 6c + 3. Is 25 a factor of a(-6)? True Let m(b) = b*3 - 3b*2 - 4b + 4. Let h be m(4). Suppose hi = -0i + 180. Suppose 4j + 5 = i. Does 5 divide j? True Suppose 4k + 2z - 230 = 0, 2z = k - 6k + 290. Let n = k + -6. Does 18 divide n? True Suppose 0 = -u + 4v + 8, 4u - v - 4 = v. Suppose 0 = -3k - 4w + 138, 3k + 2w - 210 + 72 = u. Is k a multiple of 16? False Suppose 4b - 120 = -32. Is 11 a factor of b? True Let k(g) be the third derivative of g4/24 + g3/3 - 4g2. Suppose -3z + 6 = 0, 2m - 5z + 15 = 3m. Is k(m) a multiple of 4? False Let k(z) = -z2 + 12z. Let r be k(10). Let b be	{ "pile_set_name": "DM Mathematics" }
ulate the remainder when z(-12) is divided by r. 3 Let x(c) = -c*2 - 7c - 14. Let y be x(-4). Calculate the remainder when y/((-3)/(-810)-4) is divided by 46. 43 Suppose -1 = 2v - 39. Let k(z) = 3z - 30. Let d be k(10). Suppose 5w = -dw + 180. Calculate the remainder when w is divided by v. 17 What is the remainder when 4/((-12)/(-9)) - -84 is divided by 28? 3 Let h = -163 - -473. Suppose -4d = -n - h - 252, 4d + 2714 = -5n. Calculate the remainder when n/(-22) - (-4)/22 is divided by 13. 12 Let a(i) = 2i2 + 24i - 4. Calculate the remainder when 113 is divided by a(-13). 3 Let m = 2250 - 2005. Calculate the remainder when m is divided by 41. 40 Suppose 2a - 622 = -4t, 0 = -28a + 23a - t + 1564. Calculate the remainder when a is divided by 16. 9 Let s(i) = -2i2 + 8i + 13. Let q be s(6). Let z = 0 - q. Calculate the remainder when 19 is divided by z. 8 Let d(w) = 14w3 - w2 - w + 1. Let f be d(1). Suppose fy - 6y = 49. What is the remainder when y is divided by 5? 2 Let i = -21 - -25. Suppose -2k + 10 = v - 4, -ik = -5v - 42. What is the remainder when 15 is divided by k? 7 Suppose 5s = -19 + 69. Suppose 0 = -r - 4, 3j - s = 2r + 34. Suppose 3b + 3o - 96 = 0, 5b + 3o = o + 169. Calculate the remainder when b is divided by j. 11 Calculate the remainder when 218 is divided by -4 - -21(-4 - -5). 14 Let g(c) = -c*3 - 3c*2 - 3c. Let l be g(-2). Suppose f - 3w = -lf + 45, 2f + w - 36 = 0. Calculate the remainder when f is divided by 7. 3 Suppose 5c - 5q = -0q + 65, 2q - 76 = -4c. Let n = -8 + 38. What is the remainder when n is divided by c? 13 Let m = 990 - 671. Calculate the remainder when m is divided by 32. 31 Suppose 0 = -z + 8z - 1169. Let h = -135 + z. What is the remainder when h is divided by 11? 10 Let o = 10 - 1. Calculate the remainder when 136 is divided by 255/o - 1/3. 24 Suppose -18 = k + 2k. Calculate the remainder when (153/k)/(1/(-2)) is divided by (-124 - -142) + -31 + -2. 12 Let h be (-186)/(-12)(-4)/63. Let s = h - -92. What is the remainder when s is divided by 13? 9 Suppose 0 = 2b - 4c + 9c - 33, -3b + 27 = 3c. Suppose 3s + 84 = 7s + bd, 3s - 63 = -2d. What is the remainder when 57 is divided by s? 15 Suppose -4x + 5n - 4n = -721, 915 = 5x - 4n. Calculate the remainder when x is divided by 51. 26 Let a = 22 - 15. Suppose 0 = 9x - 14x + 100. Let s = x - -5. What is the remainder when s is divided by a? 4 Let q = -1710 - -1864. Calculate the remainder when q is divided by 78. 76 Let z(k) = -k3 + k2 - 1. Let n be z(1). Let w be -3 + 8 - 1 - -6. Let f = w + n. Calculate the remainder when f is divided by 4. 1 Let y(f) = 3f3 - 3f*2 + 3f - 3. Suppose 5w + 52 = 37. What is the remainder when y(2) is divided by ((-36 - (w + -1))/(-2))/2? 7 Suppose 0 = 4m - x - 152 + 993, 0 = 2m - 4x + 424. Calculate the remainder when 117 is divided by 60/m + (-424)/(-14). 27 Suppose -t = 2t - 54. Calculate the remainder when 276/t + 4/6 is divided by 6. 4 Suppose 0 = 2p - 4. Suppose -pj - 3j = -350. What is the remainder when j is divided by 18? 16 Let n = 392 - 378. What is the remainder when 62 is divided by n? 6 Let h be -4(65/20 - 4). What is the remainder when 73 is divided by (16 + h)/(-4 - -5)? 16 Let x(p) = -2p*3 - 7p*2 + 6p - 11. What is the remainder when x(-6) is divided by 14? 7 Suppose -4a - 4h = -56, 0 = 3a - a + h - 31. Let n = 1815 - 1807. What is the remainder when a is divided by n? 1 Suppose 0 = 3n - n + 6. What is the remainder when (-1 + 3)1 + 29 is divided by (-1)/n - (-161)/21? 7 Suppose 3d - 3b = 183, 0 = -5d - 7b + 323 + 42. What is the remainder when 153 is divided by d? 21 Calculate the remainder when 6 + -7 + 194 + -8 is divided by 10. 5 Suppose 66 = 4f + 3p, 2f - p = -3p + 34. Suppose 4y - 12 = 2y. Suppose -2 - y = -o. What is the remainder when f is divided by o? 7 Let c = -450 - -473. Calculate the remainder when 214 is divided by c. 7 Suppose 16 = n - 28. Let k be (-3 + 17/5)5. Suppose kl - 9 = -s + 6, 0 = 4s + l - 60. Calculate the remainder when n is divided by s. 14 Let r = -1 - -28. Let n = 6 - -9. What is the remainder when r is divided by (-10)/(-4)42/n? 6 Let t = -1 - -13. Let p(y) = 3y + 9. Suppose -15 = -5r, z + 21 = 4z - r. What is the remainder when p(z) is divided by t? 9 Let n = 821 - 817. Let u(o) = o - 1. Calculate the remainder when u(8) is divided by n. 3 Let y(c) be the first derivative of -c + 2. Let p(a) = a + 7. Let r(h) = p(h) + 2y(h). What is the remainder when 23 is divided by r(7)? 11 Let a be (-1 + (-36)/(-20))/(4/(-40)). Calculate the remainder when 158 is divided by (-540)/8a/10. 50 Let m(d) be the second derivative of -d*4/12 - 2d*3 + 3d*2/2 - 8d. Let t be m(-12). What is the remainder when -4 - (-4 - 260)/t is divided by 17? 16 Let g = 11 - -12. Suppose 5 = -5u + 155. Calculate the remainder when g is divided by 176/u - 10/(-75). 5 Let s(p) = -3p + 25. Let l = -27 - -41. Calculate the remainder when s(0) is divided by l. 11 Suppose -3v - 38 = -3f + 25, -5f - 4v + 78 = 0. What is the remainder when 195 is divided by f? 15 Suppose 461 = 17y - 253. Let p = 1 + 8. Calculate the remainder when y is divided by p. 6 Let x = -104 + 149. Calculate the remainder when 8/(-10) - (-100128)/560 is divided by x. 43 Suppose u = 2k - 3u - 360, -5k + u + 900 = 0. Calculate the remainder when k is divided by 62. 56 Let d = 1733 - 666. Calculate the remainder when d is divided by 21. 17 Let t(n) = n*2 - n + 5n - 2n. Let s(k) = -k2 - 2k - 5. Let f be s(0). Calculate the remainder when t(f) is divided by 9. 6 Suppose 7g + k = 4g + 12, -2g - 3k = -15. Let u(p) = -20p2 + 8p - 6. Let r be u(2). Let c = 74 + r. Calculate the remainder when c is divided by g. 1 Let h = 12 - -34. Let d(x) = -x*3 - 9x*2 - 9x - 5. Let t be d(-8). Suppose -tj - h = -193. Calculate the remainder when j is divided by 25. 24 Suppose 0n + 2n = -5r + 8, -3r - 16 = -4n. Suppose r = 8s + 217 - 777. What is the remainder when s is divided by 18? 16 Let q = -26 + 57. Let f = q + -16. Calculate the remainder when f is divided by 3. 0 Suppose 2g - 115 = 2h + 79, 2g - h = 199. What is the remainder when g is divided by 38? 26 Suppose 0 = 4i + 3j - 239, -j + 179 = 3i + j. What is the remainder when 211 is divided by i? 34 Let w = 107 - 51. Suppose -3v + 31 = -29. Calculate the remainder when w is divided by (-1(-1 + v))/(-1). 18 Suppose -2p + 134 = 2w, -5w + 0w = p - 343. Let h(o) = o2 + 10o + 25. Calculate the remainder when w is divided by h(-11). 33 Let w = 217 + -174. Calculate the remainder when 128 is divided by w. 42 Let l(c) = -2c2 + 3c + 3. Let h be l(6). Let s = h - -59. What is the remainder when 37 is divided by s? 5 Let g = 77 - 72. Suppose 28 = gm - 2. What is the remainder when 15 is divided by m? 3 Let j = -883 - -917. Calculate the remainder when 231 is divided by j. 27 Suppose 319 = 4w + 199. Let k(i) = -30i - 1. Let c be (7/5 + -1)-5. Calculate the remainder when k(c) is divided by w. 29 Let i be (19/(-7) - -3)14. Suppose 0g - 24 = -ig. Suppose 47 = 3p - 4x, -5p + 40 = -3x - 42. What is the remainder when p is divided by g? 5 Let d be 4 + -1 - 7 - -9. What is the remainder when (-5)/(-25) - (-2 + (-284)/d) is divided by 4? 3 Let o be (-1 + -1 + 2)1. Suppose o = -t + 2 + 14. Calculate the remainder when 29 is divided by t. 13 Let z(b) = 34b - 361. What is the remainder when z(15) is divided by 22? 17 Let n be (2 + 26)/4 + -4 - -213. Suppose -n = -9h + 5h. What is the remainder when 161 is divided by h? 53 Let h(m) = -2m*2 - 28m - 35. Calculate the remainder when h(-11) is divided by 26. 5 Let k = 17 + -13. Let m be 1(52/k + 3). Suppose 3i - m = 20. What is the remainder when 33 is divided by i? 9 Suppose 3f = 3x - 114, -2x - 4f + 23 = -x. Suppose -14 = 62k - 63k. What is the remainder when x is divided by k? 7 Let d = 908 + -596. What is the remainder when 2/(-4)-5d/20 is divided by (-2)/(-3)21/2? 4 Let a be ((-4)/(-16))/(3/(-12)). Let h(m) = 7m*2 - m - 2. Let j be h(a). Suppose -q - 185 = -jq. Calculate the remainder when q is divided by 10. 7 Suppose 3a + 4s + 11 = 76, 5s = -2a + 55. What is the remainder when 162	{ "pile_set_name": "DM Mathematics" }
. Let l = w + h. What is l rounded to the nearest integer? -5 Let q = 528.00485032 - -0.09844968. Let g = q - 528. What is g rounded to two dps? 0.1 Suppose 4l = 4g - 217084, 2g - 6l = 112136 - 3582. What is g rounded to the nearest ten thousand? 50000 Let q = -3929.08 + 3897. What is q rounded to 0 dps? -32 Let d = -0.095 - -0.1529. Let t = -244.9421 - d. Let w = t + 245.0000418. Round w to six decimal places. 0.000042 Let k be 7/(-21)8-321. Suppose 2l + 1048 = r, 4l + 1240 = -5r - k. What is l rounded to the nearest one hundred? -500 Let u be (-2)/(-4)60/(1 - -5). Suppose -25i + 22i = -5j + 221700010, 295600010 = -4i + uj. Round i to the nearest one million. -74000000 Let o = 9138 + -9138.7694. Let j = o + 0.823621. Let t = j + -0.054. What is t rounded to five decimal places? 0.00022 Let d = -67 + 67. Suppose 0 = 5s + 25, 3u + s - 3383 + 553 = d. Let n = u + 655. Round n to the nearest one thousand. 2000 Let g = -1673 - -1066. Let k = g + 606.999999317. Round k to seven decimal places. -0.0000007 Suppose 0 = 5j - 249 + 264, -4w + 4j = -429256012. Round w to the nearest one million. 107000000 Let g(t) = 2951t + 745. Let s be g(11). Let v(f) = 7708f*2 + 7f + 6. Let j be v(-4). Let d = j - s. What is d rounded to the nearest ten thousand? 90000 Suppose -2d + 4z = 0, 1 + 7 = d + 2z. Suppose 7v - 720010 = dv + 5f, -2v - 2f = -479996. Round v to the nearest one hundred thousand. 200000 Suppose 3g = g - 4r - 40, 5g - 4r = -72. Let z be (-4295990)/40 + 4/g. Round z to the nearest ten thousand. -110000 Let i = 11676.23 - 11669.98993. Let t = -6.185 + i. Round t to 2 dps. 0.06 Suppose 217412 = -4v - 340600. Suppose -38r = -31r - 521521. Let y = v + r. What is y rounded to the nearest 10000? -70000 Let m = -8810 + 8808.8122. What is m rounded to 1 dp? -1.2 Let l = -0.0225501736 - -0.02255. Round l to 7 dps. -0.0000002 Let b = 3644295687.0000914 + -3644295299. Let h = -388 + b. What is h rounded to 5 decimal places? 0.00009 Let p = 0.81302 - 0.812980299. Round p to seven dps. 0.0000397 Let d = -27.621 - -27.3. Let m = d - -0.035. Let k = -0.285881 - m. Round k to four dps. 0.0001 Let a = -3.1406 + 3.1443741. Round a to 3 decimal places. 0.004 Let z = 625 + -290. Let d = z + -334.9878. Round d to two decimal places. 0.01 Let n = -2698 + 2686.328. Let w = -0.072 - n. Let f = w + -11.6000047. Round f to 6 dps. -0.000005 Let b = 215 + -104. Let r = -109.6 + b. Let v = 1.399562 - r. What is v rounded to 5 decimal places? -0.00044 Let a = 0.39 - 0.15. Let p = a + -0.286. Round p to 2 dps. -0.05 Let y = -2.66176869 + 2.6616. What is y rounded to 5 decimal places? -0.00017 Let q be 81/8-1. Let r be (-1250000)/10240/q. What is r rounded to the nearest one million? 30000000 Let f(i) = -1871i + 13. Let r be f(3). Let h be (-27452 + 2)/(4/(r/6)). Suppose 7z = 22z - h. What is z rounded to the nearest 100000? 400000 Let y = -59634.7 + 82992. What is y rounded to the nearest 100? 23400 Suppose -5u + 7725 = -2s, 3u - 4u + 2s = -1537. Suppose i - 12b + 10b + 390 = 0, 0 = -4i - 5b - u. What is i rounded to the nearest one hundred? -400 Suppose 2w + 1277692 = 2g, 0 = 2w - 87g + 86g + 1277686. Round w to the nearest one hundred thousand. -600000 Let d = 6994467 + 325558. Suppose -4k + d = 5r, k = -5r + 1506168 + 323857. Round k to the nearest one hundred thousand. 1800000 Let t(d) = d*3 + 6d*2 - 17d - 4. Let m be t(-8). Suppose -1120000 = -mc - c. What is c rounded to the nearest 10000? 220000 Let f = -132 + 132.071. What is f rounded to zero dps? 0 Let k = 227.9433 + 0.0567. Let v = k + -228.001288. What is v rounded to 4 dps? -0.0013 Let b = -28743470 + 45550470. What is b rounded to the nearest one million? 17000000 Let d = 413655 + -413653.25623. Let w = 1.3 - -0.44. Let s = w - d. What is s rounded to 4 dps? -0.0038 Let x = 31202.648851 - -0.471149. Let u = x + -31420.1289. Let r = -217 - u. Round r to three decimal places. 0.009 Let u = -15426.0023618 + 15426. Round u to four dps. -0.0024 Let o = 4.71 + -5. Let y = -27.33113 - -27.04113075. Let t = y - o. Round t to seven decimal places. 0.0000008 Let w = -4774 + 4774.0003569. Round w to five dps. 0.00036 Suppose 22u = -32u - 368658000. What is u rounded to the nearest one hundred thousand? -6800000 Let f = -1265.00219 + 1265. Round f to three dps. -0.002 Let x be 4415((-28)/(-20))/7-1713. Let q = x + 3019579. What is q rounded to the nearest one hundred thousand? 1500000 Suppose 0 = -4y - 4u + 36, -4y = 5u - 3u - 30. Suppose x + yr - r = 5399995, -4r - 4 = 0. What is x rounded to the nearest one million? 5000000 Let k = 10189.47 + -10127.4709. Let o = k - 62. What is o rounded to three dps? -0.001 Let z = -33337.420344 + 33335.5. Let p = 1.92 + z. Round p to five dps. -0.00034 Let x = -12133.9 - -12023.226. Let d = 112 + x. What is d rounded to the nearest integer? 1 Let t = 178.17 + -177.81444. What is t rounded to three decimal places? 0.356 Let n = -253 - -680. Let b = n + -426.9999883. What is b rounded to five decimal places? 0.00001 Suppose 0 = -r - g + 35249 - 4870, -60743 = -2r - 5g. Let i = -19944 + r. What is i rounded to the nearest 1000? 10000 Let o = 84.06 + -84.4323. Let m = -0.042 - -0.398. Let q = m + o. What is q rounded to three dps? -0.016 Let f = -1875 + 1097. Let y = 778.0727 + f. Round y to 2 dps. 0.07 Let a = 27201220 - 27201269.999991. Let g = a - -50. Round g to six dps. 0.000009 Let m = 3465 - 3491.57. Let r = m - -26.570001703. What is r rounded to seven dps? 0.0000017 Let u = -92.058125 + 92. Let b = u + 0.058. Round b to five dps. -0.00013 Let t = 10740263 + -6157016. Let o be 383247 - 0/(-7 + 3). Let c = t - o. Round c to the nearest one million. 4000000 Let s = 0.1485872 - 0.14139. Round s to 4 decimal places. 0.0072 Let j = -34.93174 - 6.1841. Let h = j - 0.02416. Round h to the nearest 10. -40 Let j = 4480.4952 - 4480. What is j rounded to 2 dps? 0.5 Let g = 2.09 + -1.8325. Let q = -0.236 + g. Round q to 3 dps. 0.022 Let d = 492 - 699. Let b = 561 + d. Let g = 414.8 - b. Round g to the nearest 10. 60 Let k = -3.35 + -307.65. Let d = k - -310.9979. Round d to four dps. -0.0021 Let l(j) be the second derivative of j*4/12 + 7j*3/6 - 14j*2 + 16j. Let i be l(-14). Suppose -x + 32 = -i. What is x rounded to the nearest ten? 100 Suppose 120209 - 3621009 = 8q. What is q rounded to the nearest 100000? -400000 Let w = 0.4266927448 - 0.4267. Round w to 7 dps. -0.0000073 Suppose 3z - 77001 = 6z. Let n be (z/2)/(12/(-144)). Let y be (4 + 4)/4 - n. Round y to the nearest ten thousand. -150000 Let f = -6498750 - -4374050. Round f to the nearest 10000. -2120000 Let i = 1526 - 1669.1. What is i rounded to the nearest one hundred? -100 Let k be (180/50)/((-9)/(-2469030)). Suppose 0 = b - 5b + 3d + k, 740708 = 3b - 2d. Round b to the nearest one hundred thousand. 200000 Let y = 7362950.8599692 - 7362955. Let z = 4.14 + y. Round z to 5 decimal places. -0.00003 Let i = -200125.21881 - -509956.21788. Let u = -309835 + i. Let t = u - -4. Round t to 4 decimal places. -0.0009 Let w = 23.721 + -23.721014447. Round w to six decimal places. -0.000014 Suppose 312 = 8i - 104. Suppose -152 + i = -10v. Suppose -1206412 + 5836412 = -vs. What is s rounded to the nearest 10000? -460000 Let t = 1199.25 + -1378. Let u = -0.25 + t. Let z = 178.99671 + u. Round z to 4 dps. -0.0033 Let s = -3533 - -3532.638. What is s rounded to one decimal place? -0.4 Let k(u) be the third derivative of 0u - 9u*2 - 1/3u*4 - 1/10u*5 + 0 + 1/30u*6 - 5/3u*3. Let d be k(11). Round d to the nearest one thousand. 5000 Let o = -4976 + 4975.7202. What is o rounded to one dp? -0.3 Let m = -13968 - -13967.9999990549. Round m to 6 dps. -0.000001 Let p = -1406908070 - -1406907392.9999876. Let d = 677 + p. Round d to five dps. -0.00001 Let r = 776 + -776.701. Let n = r + 1.004. Let s = n - 0.604. Round s to two decimal places. -0.3 Let n = 0.047843 - 0.04828249. What is n rounded to 5 decimal places? -0.00044 Let c = 7396 - 7276.46. Let z = 12.66 + c. Let x = z - 151. What is x rounded to 0 dps? -19 Let u = 236158013 - 19501013. Suppose 110h - u = 91*h. What is h rounded to the nearest 1000000? 11000000 Let w = 302.34 + -0.34. Let d = -30	{ "pile_set_name": "DM Mathematics" }
9586217v2. -34v*3 Collect the terms in -1524b*3 - 9b - 718b3 + 9b. -2242b3 Collect the terms in 18v - 6 - 7 - 6 + 7v + 28 - 26v. -v + 9 Collect the terms in -2d2 + 3d - 224d - d + 6d + 213d + 3d. -2d2 Collect the terms in 560529 + 0t - t + 167423 + 657833. -t + 1385785 Collect the terms in -8k3 + 21k + 17k - 68k + 20k3 + 12k + 15k. 12k*3 - 3k Collect the terms in 38 + 42 + 2z - 49 - 45. 2z - 14 Collect the terms in -7r2 - 2 + 10r*2 + 7r*2 + 333r + 4r2. 14r*2 + 333r - 2 Collect the terms in 13634g - 13634g - 25933g2. -25933g*2 Collect the terms in -53k*2 + 208k*2 - 37k*2 - 29 - 44k*2 + 29 - 73k2. k2 Collect the terms in 697873y - 348934y - 3 + 3 - 153y2 - 348939y. -153y2 Collect the terms in 13 - 13 - 55q*2 - 2190777q + 2190777q. -55q*2 Collect the terms in 4 - 82057g - 35518g - 4. -117575g Collect the terms in -88r3 - 953r*3 + 1453r*3 - 146r*3. 266r*3 Collect the terms in -46v*2 + v + 20v*2 - 5v*2 + 25v + 25v2. -6v*2 + 26v Collect the terms in -424594a - 634196a + 329665a - 640494a. -1369619a Collect the terms in 103b + 7b2 + 34b - 15b2 + 279b + 6b2. -2b*2 + 416b Collect the terms in -2843f3 - 1763f*3 - 3128f*3 - 2851f*3. -10585f*3 Collect the terms in -207g + 41g2 - 204 + 107 + 97 - 24g*2 + 207g. 17g2 Collect the terms in 4n + 12n3 - 221 - 4n*3 + 307 - 86. 8n*3 + 4n Collect the terms in -369q2 - 41q*3 - 104 + 162q*2 + 104 + 207q*2. -41q*3 Collect the terms in 15u + 21 + 121 - 6u - 35u - 17. -26u + 125 Collect the terms in -6146934x - 6146650x + 2x*3 + 12293584x. 2x3 Collect the terms in -757j*3 + 0j*2 + 743j*3 - 8j*2 - 9738 + 9738 + 8j*2. -14j*3 Collect the terms in 241j - 217j + 7j*3 + 6 - 24j. 7j3 + 6 Collect the terms in -2n*3 + 20 - 9n*3 - 2n*2 + 6n - 4n3 + 4n*3. -11n*3 - 2n*2 + 6n + 20 Collect the terms in -166u + 7u*2 + 80u - u + 45u2 + 85u. 52u2 - 2u Collect the terms in 678 - 4317r2 - 680 + 4311r*2. -6r*2 - 2 Collect the terms in -27k + 6 - 16k - 3 - 17k + 49k. -11k + 3 Collect the terms in 44x + 49x + 41x + 32x + 40x + 18x - 228x. -4x Collect the terms in -1214w3 + 589w*3 + 912w + 918w + 610w*3 - 1830w. -15w3 Collect the terms in -2i*2 - 15i*3 - 29i*3 - 1669 - 1773 + 3442. -44i*3 - 2i*2 Collect the terms in 48o + 1312 - 1312 + 52o - 96o. 4o Collect the terms in -65668t*2 + 330660t*2 + 2259865t*2. 2524857t*2 Collect the terms in -2066f + 1095f + 1416f. 445f Collect the terms in 161v*2 + 380v*2 - 15v*2 + 476v*2 - 91v*2. 911v*2 Collect the terms in -43j - 107j - 2j*2 - 49j + 345j - 3j. -2j2 + 143j Collect the terms in -24r - 31r + 5r2 + 106r + 5r - 56r. 5r2 Collect the terms in -528r - 841461 + 841461. -528r Collect the terms in 1 - 2641v*2 + 5321v*2 - 2680v*2 + 115v*3. 115v*3 + 1 Collect the terms in 486 - 2a2 + a2 - 464 + a*2 - 30a*2 + 2a*2 + 30a*2. 2a2 + 22 Collect the terms in -c2 + 759 - 1242 + 0c2 + 483 + 3c*2. 2c*2 Collect the terms in 22w*2 - 3w + 10 - 9w - 7w + 32w - 9w. 22w2 + 4w + 10 Collect the terms in -2r3 + 81r*2 - 458 + 81r*2 - 245r*2 + 83r*2 + 25r. -2r3 + 25r - 458 Collect the terms in 100 + 3623l3 - 3618l*3 + 137 - 237. 5l3 Collect the terms in -230005666 - 230005668 + 460011334 + g3. g*3 Collect the terms in 266 + 480 + 2m + 1068 - 88. 2m + 1726 Collect the terms in -475g - 692447g2 - 3250114g*2 + 475g. -3942561g2 Collect the terms in 390 - 129 + 2234m - 126 - 135. 2234m Collect the terms in 431 + 224 - 1083 + 434 + 42y. 42y + 6 Collect the terms in 2 - 17284n*3 + 51807n*3 - 2 - 17240n*3 - 17284n3. -n3 Collect the terms in 12842j - 12842j - 611j2 + 20 - 22. -611j*2 - 2 Collect the terms in -64597y + 14574y - 10313y - 40411y - 1087y. -101834y Collect the terms in -228y - 123y - 540y + 336y. -555y Collect the terms in -605728512 - 3919m + 605728512. -3919m Collect the terms in 34 + 5t + 11 - 112 + 40 - 13 + 40. 5t Collect the terms in -1406 - 4481h + 8965h - 4485h. -h - 1406 Collect the terms in -191b*2 + 90b*2 + 36b*2 + 6b*3 - 2b + 65b2. 6b*3 - 2b Collect the terms in -5 - 153178j2 + 176j - 176j + 2. -153178j*2 - 3 Collect the terms in 67132s*2 - 22353s*2 - 22457s*2 - 22357s*2. -35s*2 Collect the terms in 7851f*3 + 6732f*3 + 1358f - 1356f. 14583f*3 + 2f Collect the terms in r2 + 118406792134 - 118406792134. r2 Collect the terms in -614549c + 0c*2 + 2c*2 + 2612578c + 1754277c. 2c*2 + 3752306c Collect the terms in -143948s3 - 197 + 143517s*3 + 197. -431s*3 Collect the terms in 20220h + 18242h - 38463h. -h Collect the terms in 9 - 37353a2 - 4211a + 4211a - 9. -37353a*2 Collect the terms in 32 - 58 + 30 + 8523n*3. 8523n*3 + 4 Collect the terms in -115435k*3 + 58432k*3 + 57004k3. k3 Collect the terms in -25756a3 + 10665a*3 + 13058a*3 - 2. -2033a*3 - 2 Collect the terms in -194j*2 + 4957079j - 4957079j. -194j*2 Collect the terms in 4w*3 + 76213642354w*2 + 28w*3 - 76213642354w*2. 32w*3 Collect the terms in -2398h - 198h2 - 4978h + 7376h. -198h*2 Collect the terms in 8219p*2 + 53091p*2 + 76784p*2. 138094p*2 Collect the terms in 9449374 - 9449374 + 2w*2. 2w*2 Collect the terms in 2m + 13m - 241 - 23m + 62m - 2m. 52m - 241 Collect the terms in 56w*2 - 413w*2 + 57w*2 - 23w*2 - 32w*2 + 51w*2. -304w*2 Collect the terms in -824038107 + 824038107 - 1250b. -1250b Collect the terms in 968b - 968b - 43585b*3. -43585b*3 Collect the terms in -2231w*3 - 7536w*3 - 7992w*3. -17759w*3 Collect the terms in 302j + 8j3 - 1306j - 776j + 2j*2. 8j*3 + 2j*2 - 1780j Collect the terms in -24762g + 19321g - 7852g - 62119g. -75412g Collect the terms in 785 + 43o + 11o2 - 464 - 324. 11o*2 + 43o - 3 Collect the terms in -46560169498191 + 3m + 46560169498191. 3m Collect the terms in -103 + 36 + 29 + 27c2 + 27c*2 + 37 + 29c*2. 83c*2 - 1 Collect the terms in -268 + 49 - 115q + 106q - 257. -9q - 476 Collect the terms in 47840u3 + 3852u*3 - 11u + 11u. 51692u*3 Collect the terms in 511676f*2 + 18988f*2 - 58242f*2. 472422f*2 Collect the terms in -4u - 15781 + 16373 + 4u + 6u*2. 6u*2 + 592 Collect the terms in -423o*2 + 4300o*2 - 3498o*2. 379o*2 Collect the terms in -2 - 4 + 32 - 11 + 3 - 38o - 5. -38o + 13 Collect the terms in 83g*3 - 40904 + 11g*3 + 40903. 94g*3 - 1 Collect the terms in -q - 404 - 87 + 3564. -q + 3073 Collect the terms in 35443 - 4f*3 + f - 5f*3 + 8f3 + 3053. -f3 + f + 38496 Collect the terms in 19 - 2662110b + 2662153b - 19. 43b Collect the terms in -38g - 63g - 53g + 66g - 65g. -153g Collect the terms in 0x - 18x - 7x - 7896167 + 7896167. -25x Collect the terms in -13983w + 7356w2 - 7369w*2 + 13964w. -13w2 - 19w Collect the terms in 8360 - 4632 - 15h - 3730. -15h - 2 Collect the terms in 1257s + 2984s - 35 - 794s + 1430s. 4877s - 35 Collect the terms in 22y + 282y2 + 8y + 471y2. 753y*2 + 30y Collect the terms in 1241c + 993c + 93c. 2327c Collect the terms in 18k2 + 635k - 635k - 15k*2 - 35 + 35. 3k*2 Collect the terms in 62 - 173 + 310r + 55 + 56. 310r Collect the terms in 132224c*2 - 6c*3 - 264433c*2 + 132209c*2 + 7c*3 + 9c*3 - 2c*3. 8c*3 Collect the terms in -382m + 55m + 65m + 61m + 57m + 61m + 78m. -5m Collect the terms in 181074b*2 + 7067b - 7067b. 181074b*2 Collect the terms in -318127q*3 + 636345q3 - q2 - 318080q3. 138q3 - q2 Collect the terms in -14455b + 25378b - 5516b - 5406b. b Collect the terms in 116s2 + 323s*2 + 5s + 8 - 3s. 439s*2 + 2s + 8 Collect the terms in 981 - 2j + 1120 - 272 + 860 + 46. -2j + 2735 Collect the terms in -55617q2 - 8q + 56555q2 - 2 + q. 938q*2 - 7q - 2 Collect the terms in -106b - 171b - 180b + 608b - 158b. -7b Collect the terms in -1663f3 + 11f + 5753f*3 + 17 +	{ "pile_set_name": "DM Mathematics" }
rt(475) + 1)*2 + (-4 + sqrt(19)-15)2. 20sqrt(19) + 2392 Simplify (sqrt(39)/(sqrt(108)-1 + sqrt(108) + sqrt(108)))2 + (3 + 1 + sqrt(39)/sqrt(3))2. 8sqrt(13) + 1057/36 Simplify 6(-3-2sqrt(720))/(5sqrt(360)/sqrt(4)). 72sqrt(2)/5 Simplify ((-2sqrt(14)1 - (1sqrt(168))/sqrt(12))/(sqrt(16)/sqrt(8)))*2. 63 Simplify 1 + (sqrt(32) - (sqrt(192)/sqrt(6) + 2)) - (-5sqrt(384)2)/sqrt(12). -1 + 40sqrt(2) Simplify (sqrt(49)/sqrt(112))*2 + -5 - (sqrt(14)/sqrt(2)-1 + -2). -41/16 + sqrt(7) Simplify 4(sqrt(19) + (2sqrt(19))*2 + 4) - (-2 + sqrt(19) + 1 + (-1sqrt(304))*2). 3sqrt(19) + 17 Simplify (2 + (sqrt(704) + (sqrt(704) - 1sqrt(704)) + sqrt(704) - sqrt(704) - sqrt(704)) + 5 + -2 + -3)2. 4 Simplify 5(sqrt(11) - sqrt(99)) + -4 + sqrt(11)-2 + (sqrt(198) - (sqrt(198) + 1sqrt(198)) - sqrt(22))/sqrt(2). -16sqrt(11) - 4 Simplify (sqrt(12) + -2 + (sqrt(72)/sqrt(3))/sqrt(8))2 - ((2sqrt(33))/sqrt(11) + sqrt(6)/sqrt(2) + -1)*2. -6sqrt(3) + 3 Simplify ((sqrt(11)-2)2 + 2)3 - (((-2sqrt(121))/sqrt(11))2 + (sqrt(11) + -1)-4). 4sqrt(11) + 90 Simplify ((2(2sqrt(156) + sqrt(156)))/(sqrt(12) - (sqrt(12) - 2sqrt(60)/sqrt(5))))*2. 117 Simplify -2((sqrt(1331) + 3 + sqrt(1331) + -1 - (-2 + (sqrt(1331) - (1 + sqrt(1331)) - sqrt(1331))))-3)2. -216072 - 5940sqrt(11) Simplify (2sqrt(77)43)/(11sqrt(7)1). 24sqrt(11) Simplify 5 + (0 + -3 + sqrt(425) + sqrt(425) - sqrt(34)/((sqrt(128)4 - sqrt(128)) + sqrt(2))). 2 + 249sqrt(17)/25 Simplify -2 + sqrt(1053) + 0 - sqrt(78)/((2sqrt(66))/sqrt(11)). -2 + 17sqrt(13)/2 Simplify -4(2-3sqrt(225))/((sqrt(147) - (sqrt(147) - sqrt(147)-2))3). -20sqrt(3)/7 Simplify (-1(1sqrt(288)1-3 + 0))2-2. -5184 Simplify 2 + sqrt(143)/(sqrt(11) - (sqrt(11) - sqrt(11)-3)) - (2sqrt(208)3)2. -7486 - sqrt(13)/3 Simplify (sqrt(48)/(3sqrt(2)))/(6sqrt(300))1. sqrt(2)/90 Simplify ((sqrt(243)2 + -3 - (sqrt(243) + -2sqrt(243))4 - -6((sqrt(243) + -1 - sqrt(243)) + 2))2)2. 1296sqrt(3) + 35028 Simplify -3 + 3 + (5 + -4(0 + sqrt(1300)))2. -400sqrt(13) + 20825 Simplify -1(-2 + (3sqrt(7) + -3 + -2)*2). -86 + 30sqrt(7) Simplify -5 + (6-5sqrt(500)1)2-1-5. 2249995 Simplify 3(-3 + sqrt(2))*2-5 + 1 + (sqrt(20)/sqrt(10) + 2)*2. -158 + 94sqrt(2) Simplify sqrt(117) + (sqrt(117) + -2)*2 + -1(-1 + sqrt(13)) + (sqrt(78)/(sqrt(12)/sqrt(2)) - sqrt(13))*2 + (1sqrt(52) + sqrt(52))*2. -10sqrt(13) + 330 Simplify 3(2 + (-4(-3 + sqrt(1700)) + sqrt(1700) + sqrt(1700))*2 + sqrt(1700)). -1410sqrt(17) + 20838 Simplify (-1(0 + sqrt(1200)))2 + (-2 + 0 + sqrt(75))3. 15sqrt(3) + 1194 Simplify (5 + (-1sqrt(39)-54)/(sqrt(12)/sqrt(16) + (sqrt(3) - ((sqrt(243) + 2sqrt(243) + sqrt(243) - sqrt(243)) + sqrt(3)))))2. -400sqrt(13)/53 + 91025/2809 Simplify (sqrt(1872)1 + 1 + 1 + (sqrt(1872) - -1(sqrt(1872) + 0))5)2. 528sqrt(13) + 226516 Simplify 5 + 2sqrt(15)/(sqrt(3)-3)-1. 2sqrt(5)/3 + 5 Simplify (1 + (sqrt(117) - (sqrt(117)2 - sqrt(117))3)/(sqrt(81)5 - sqrt(9)))2-5. -310/49 + 10sqrt(13)/7 Simplify (3(-2sqrt(117)-4 - sqrt(117)))/(sqrt(63)/(sqrt(7) + (sqrt(7) - (sqrt(7) + 4sqrt(21)/sqrt(3))) - sqrt(7))). -84sqrt(13) Simplify ((sqrt(240)/sqrt(3) + sqrt(20))/sqrt(10) + (sqrt(200) + (sqrt(200) + sqrt(200) + 2)*2 + sqrt(200) - (-4 + -1sqrt(2))))2. 208sqrt(2) + 1616 Simplify (2 + sqrt(1300) + sqrt(1300)2 + (sqrt(1300) + 0)-2 - (((sqrt(1300) + 0)-5 - sqrt(1300)) + sqrt(1300) - (sqrt(1300) + 0 + sqrt(1300) + -1)))2. 160sqrt(13) + 83201 Simplify -1 + (sqrt(98) + -1)*2 - -5(-2 + 2sqrt(2))2. -54sqrt(2) + 158 Simplify ((sqrt(65) + sqrt(65) + sqrt(65) + sqrt(65) + (sqrt(65) - sqrt(65)1))3)/((sqrt(5)2 - sqrt(5))-3)1. -4sqrt(13) Simplify (sqrt(1088) - (sqrt(1088) + 2(0 + sqrt(1088))2)) + (sqrt(17) + 0 + sqrt(272) + sqrt(17))3. -2176 + 18sqrt(17) Simplify (-1(1sqrt(77) + sqrt(77) + sqrt(77)) - sqrt(77) - sqrt(77) - (sqrt(77) + -2sqrt(77))3)/(5sqrt(275) - sqrt(11) - 1sqrt(11)2). -sqrt(7)/11 Simplify ((sqrt(45) + -4sqrt(4500) - sqrt(45))-5)/(sqrt(45)/(sqrt(80)4)). 3200sqrt(5) Simplify (-2 + 0 + (5 + -3 + sqrt(128) + -2)6)2. -192sqrt(2) + 4612 Simplify (sqrt(112) + -2)-5 + -5. -20sqrt(7) + 5 Simplify (-2sqrt(104)3)/(-5sqrt(56)/sqrt(7)). 6sqrt(13)/5 Simplify 4 + (sqrt(162) - 3(sqrt(162) + -3))2 + 4. -324sqrt(2) + 737 Simplify 62(2 + sqrt(1331)) + 1. 25 + 132sqrt(11) Simplify (4sqrt(180)-165 + 1)2 + -2. -1440sqrt(5) + 2591999 Simplify sqrt(204)/(sqrt(12)3) + (-2sqrt(1088))2 - ((sqrt(153) + 0 + 4 + sqrt(153) - sqrt(153))2 - sqrt(153) - sqrt(153))-4. 217sqrt(17)/3 + 5028 Simplify 2 + -4((sqrt(243) + 3 + sqrt(243) + sqrt(243))-3 + sqrt(243)). 38 + 288sqrt(3) Simplify -3(sqrt(20) - (sqrt(20) + (sqrt(200) + sqrt(200)-1 + sqrt(200))/sqrt(10)))/(sqrt(4) + (sqrt(4) - sqrt(8)/sqrt(18)))6. 54sqrt(5)/5 Simplify (sqrt(32)4-4 + sqrt(32) + sqrt(64)/(sqrt(2)4) + -1)*2. 118sqrt(2) + 6963 Simplify (sqrt(42)/(sqrt(600)-1 - sqrt(6))-4 + (sqrt(7) - (sqrt(28)/(sqrt(4)-3) - sqrt(7)) - (sqrt(21)/sqrt(3) + -5)))2. 560sqrt(7)/33 + 49177/1089 Simplify ((sqrt(156) + 4sqrt(156))2)/(sqrt(216)/sqrt(2)). 10sqrt(13)/3 Simplify -5 + (sqrt(20)5 - sqrt(20))/sqrt(10) - (sqrt(8)/sqrt(324) + 1)*2. -488/81 + 34sqrt(2)/9 Simplify (0 + (sqrt(88)/sqrt(2))/sqrt(4))*2 + ((3 + sqrt(1584))-6)*2. 2592sqrt(11) + 57359 Simplify -5sqrt(35)/(sqrt(120)/sqrt(6))4. -10sqrt(7) Simplify (sqrt(156) - 4((sqrt(156) - (sqrt(156) - sqrt(156)1)) + sqrt(156)))/(sqrt(192)-3). 7sqrt(13)/12 Simplify (((sqrt(180) - sqrt(180)-2 - sqrt(180) - sqrt(180))3)/sqrt(4))/(sqrt(27)/((-1sqrt(18))/sqrt(6))). -3sqrt(5) Simplify 0 + 1(3 + sqrt(891)) + 4. 7 + 9sqrt(11) Simplify 6sqrt(25)/(sqrt(5)3) + 3 + -1. 2 + 2sqrt(5) Simplify -1(1 + sqrt(1152) + -1 + 0 + sqrt(2178) + sqrt(2178) + -4)2. -16216 + 720sqrt(2) Simplify (5sqrt(84)-1 + 2sqrt(84)-2)/((sqrt(12) + sqrt(108)-1)6). 3sqrt(7)/4 Simplify (-1(sqrt(45) + 0))*2 + ((-2sqrt(315) - sqrt(315))/sqrt(7) + sqrt(45))*2 + (-2sqrt(120)/sqrt(2))/(sqrt(972)2). -sqrt(5)/9 + 225 Simplify -2 + 5 + (51sqrt(1573))2-2 + 3. -78644 Simplify (sqrt(75)3 + -1 + sqrt(75))2 + 1 + -3 + -2sqrt(75) + 0 + (sqrt(75) - -2sqrt(75)). -35sqrt(3) + 1199 Simplify 2(-4 + sqrt(432) + sqrt(432))2 + 5(sqrt(210)/sqrt(7))/sqrt(10). -379sqrt(3) + 3488 Simplify (-4(sqrt(140) + sqrt(35)))/((sqrt(405) - sqrt(45))/sqrt(9)) - ((-1 + sqrt(252) + -4 + sqrt(252) - sqrt(252)) + 3). -12sqrt(7) + 2 Simplify 4sqrt(104)/sqrt(2) - 4(sqrt(208) + (sqrt(208) - (sqrt(208) - (sqrt(208) + sqrt(208) + 1))))2. -7492 - 88sqrt(13) Simplify (sqrt(117) - (sqrt(117) - 2sqrt(117))-2)/sqrt(9)3 - (2 + (2sqrt(13) + sqrt(13))-4)-3. -39sqrt(13) + 6 Simplify sqrt(176)15 + sqrt(275)2 + (sqrt(539)2)2 + -5. 30sqrt(11) + 2151 Simplify (-3(sqrt(567) + (3sqrt(567)-1 - sqrt(567)) - (0 + sqrt(567))4) + 2)*2. 756sqrt(7) + 250051 Simplify (sqrt(264)/((-2sqrt(11) - sqrt(11)) + sqrt(11)))/(sqrt(48)6) - ((sqrt(128)-4 - sqrt(8)) + sqrt(8))/(sqrt(8)/(sqrt(6)/sqrt(3))). 383sqrt(2)/24 Simplify 33((3 + 2sqrt(2057))-4)*2. 19008sqrt(17) + 1186128 Simplify (sqrt(133) - 3(2sqrt(133) + sqrt(133)))/(sqrt(56)/sqrt(800)). -80sqrt(19) Simplify (-1sqrt(243))*2-1 - ((sqrt(24) + sqrt(72)/sqrt(3))/sqrt(8) + (0 + sqrt(3) + -3)*2). -255 + 4sqrt(3) Simplify (1sqrt(192)2)/(sqrt(120)/(1sqrt(5))). 4sqrt(2) Simplify 2(-1 + sqrt(99)2)-56. -360sqrt(11) + 60 Simplify (5 + -3sqrt(9)/sqrt(3) + 2sqrt(3)-2 - (3 + -2sqrt(432)6))*2. 548sqrt(3) + 56311 Simplify sqrt(35)/(sqrt(7)-1) + -1 - (2 + sqrt(125)2)*2. -505 - 41sqrt(5) Simplify ((sqrt(1200)-2 - sqrt(1200) - sqrt(1200))/sqrt(4) + 5 + sqrt(243) + -1 + sqrt(243) + 3)2. -308sqrt(3) + 1501 Simplify (sqrt(2100) + -21sqrt(2100) - sqrt(2100))/(sqrt(300) + -5-2sqrt(300)). -2sqrt(7)/11 Simplify ((sqrt(55) + sqrt(6655)3 + sqrt(6655) + sqrt(6655))/sqrt(5) - ((sqrt(44)/(sqrt(20)/sqrt(5) + sqrt(4)) - sqrt(11)) + -1sqrt(891)))2. 188771/4 Simplify (-31sqrt(30)/sqrt(3))/(-16(sqrt(180) - sqrt(5))). sqrt(2)/10 Simplify -5 + ((sqrt(500) + sqrt(500) + 1 + 3)2 + -2)5. 800sqrt(5) + 10065 Simplify (-6(sqrt(1700) + 6-2sqrt(1700) - (-4 + (sqrt(1700) - (sqrt(1700)	{ "pile_set_name": "DM Mathematics" }
0 + 1) + 5z + 0z - 3z) + (1 - 1 - z)(-3 - 2z + 3) + z - z + 2z*2 - 4z + 4z + z2. 71z*2 Expand (3l + 17 + 30 + 6)(-1 + 1 + 1). 3l + 53 Expand 3a2 - 5a + 5a + a2 + 3a*2 + 4a*2 + (3a - 3a - 2a)(5a + 0a - 3a). 7a2 Expand (0a*2 + 3a*2 - 2a - 5a2)(-65a2 - 70a*2 + 141a*2). -12a*4 - 12a*3 Expand -h - 1 + h + h + 1 - h - 1 + 6h + 0 + 0 + (3h + h - 5h)(0 - 4 + 2). 8h - 1 Expand (2 - u*3 - 2)(1 - 1 - 3)(3 - 4 + 2)(0 + 0 + 1)(4 + 0 + 11). 45u*3 Expand (-2 + 38y + 3 - 39y)(y - 7y + 4y). 2y2 - 2y Expand (l*2 - 1048l - 2 + 0l2 + 1053l)(-3l + 2l - l). -2l*3 - 10l*2 + 4l Expand -u*5 + 3u*5 + 0u*5 + (5u4 + u4 - 2u4)(4u + 0u - 2u) + 2u*5 - 2u*5 - 2u5 + u5 + 0u + 0u. 9u5 Expand (2 - 1 - 3)(2k + k - 5k) + 2k - k + 0k + 2k + 0 + 0 + (4k - 5k - k)(-1 + 3 + 0) + k + k - k + 2k - 2 + 2 + (-1 + 0 - 2)(4k - 6k - 15k). 57k Expand (-7 + 5 - 2)(-2t*3 + 2t*3 - 2t*4). 8t4 Expand (-l2 - 3l + 2l*2 + 0l*2)(l - 4l + 7l). 4l3 - 12l*2 Expand (1 + 4 - 6)(-4 + 4 + i) + (3 + 1 - 3)(-2i + 4i - 4i) + 0i - i + 2i + i + 2i - i + (-2i + 5i + 3i)(-3 + 3 + 1). 6i Expand (4 - 4 - 1)(-8g + 2g - 8g). 14g Expand 2q*2 - q + q + 57q - 57q - 9q*2 + 2q*2 - 3q2 - q2 + (-4 + 1 + 2)(-1 + 1 + 2q*2). -11q*2 Expand (-5 + 4 + 2)(0f - 3f + 4f) + 1 - 1 - 2f + (f - f - f)(-3 + 5 + 1) - 3f - 3 + 3. -7f Expand (-2 - 1 - 1)(g + g - 3g)(-1 + 0 + 5). 16g Expand ((2w + 4w - 5w)(2w - 1 + 1) + 3w2 - 2w2 + w2 - 9w2 + 5w*2 - 36w*2)(3 + 0 - 1). -72w2 Expand (-2 - 2 + 3)(-1 + 3 - 1)(2t - 4t - 2t). 4t Expand (-4g*2 + 6g*2 - 3g*2)(2g2 - 5g2 + g2) + 7g4 + 3g*4 + 5g*4. 17g*4 Expand (2c + 3c - 4c)(2 - 2 + 1)(1 - 1 - 2)(c - c - 2c). 4c2 Expand (a + 3 - 3)(2a2 + a2 + 0a*2) + 3 - 3 + 2a3 + (a3 - 5a3 + 3a*3)(2 - 6 + 2) + a*3 - 3a + 3a. 8a*3 Expand (-107 + 107 - 10g)(2g2 - g2 + 0g2). -10g*3 Expand (1 + 3u - 1)(3u*2 + 4u*2 - 5u*2)(-3u + 4u + 2u). 18u*4 Expand (-3w*3 - 2w + 2w)(3 - 6 + 1 + (-3 + 1 + 3)(-3 + 6 - 2) - 2 + 1 + 2 + 1 - 1 + 2). -6w3 Expand (r2 + 3r2 - 3r*2)(2r - 398 + 407 - r). r3 + 9r*2 Expand (2n*3 + 0n3 + n3)(-2 + 3n - 3n + 6n). 18n4 - 6n*3 Expand (-2z + 4 - 5 + 10)(2z - 1 + 1). -4z2 + 18z Expand 4j3 + 5 - 5 + (0j - j + 4j)(1 - 1 - 2j2)(-3 + 4 + 3). -20j3 Expand -7s*2 + 7s*2 - 9s*4 + (0s - s*2 + 0s)(-s2 + 2s*2 - 3s2) - s4 - 3s4 + 5s*4. -6s*4 Expand (36 - 35 + 24)(-4p + 4p + p). 25p Expand (6u*3 + 6u3 - u3)(u2 + 0u*2 - 4u*2) + 2u*5 - 3u*5 + 2u*5. -32u*5 Expand (w + 2w - 2w)(2w3 + 9w - 3 - 9w). 2w*4 - 3w Expand (3z3 - z3 - z3)(158 - 20z - 158). -20z*4 Expand (n - 5n - n)(-4n*2 + 0n*2 + 5n*2). -5n*3 Expand (-5h + h + 2h)(0 + 2 + 0) + 4h + 0h - 3h + 1 - 1 - 2h - 2h - 4h + 5h + (3 + 2h - 3)(-5 - 12 + 21). 2h Expand (-3t + 5t - t - 2t + 3t - 3t + 2 + 2t - 2 + (3t + 4t - 6t)(-2 + 2 - 1) + 3t - 5t - 4t)(6 - 3 - 4). 6t Expand -24r*3 + 5r*3 + 0r3 + (-r - r2 + r)(0 + 0 - r). -18r*3 Expand (-3 - 2n*2 + 3)(2n2 + n2 + 0n*2 + 2). -6n*4 - 4n*2 Expand (0 - 1 - 1)(-1 - 3 + 6)(17v*5 - 21v + 21v). -68v*5 Expand (11 - 11 + 3y)(-2y - 3y + 6y). 3y2 Expand (-5 - 3g + 5)(-7 + 3 - 4). 24g Expand 4i4 - 4i*4 - 2i5 + (i3 + 37i5 - i3)(0 + 1 + 1). 72i5 Expand (-2 - 2 + 0)(-1 - 2 + 1)(-2 + 2h*3 + 2). 16h*3 Expand (2f - f + 0f)(13f2 + 15f*2 - 25f*2). 3f*3 Expand (-15h + 39 - 39 + (-4 + 3 + 2)(-h - 2 + 2))(-1 - 3 + 3). 16h Expand (4x*4 - 4x*4 + 3x*5)(3 - 1 + 0 + (-3 + 2 + 2)(3 - 1 - 3)). 3x*5 Expand 3g*4 + 0g4 - g4 - 3g4 + g4 + 3g4 + (-g3 - 2g3 + 4g*3)(-1 + 1 + 3g) + 0g*4 - 3g4 - g4. 2g4 Expand (1 + 3 - 6)(j - 4j + 2j)(-j2 - j2 + 0j*2)(-4j + j + 4j). -4j4 Expand (2m - m - 2m)(-3 + 1 + 1) + 3m + 2m - 2m + 3m - 4m + 4m. 7m Expand 3m*4 - 2m + 2m + (-5m*3 + 4m*3 - 4m*3)(2m - m + 0m). -2m4 Expand (-2x + 2x + x)(x - 5x + 3x) - 6x2 + 5x - 5x. -7x*2 Expand (4a2 - a2 - a*2)(17 - 1 + 2)(a + 5a - 4a). 72a*3 Expand (4f + 5 + 2 - 5f)(-2 + 2 + 2f). -2f*2 + 14f Expand (19 - 48 + 22)(0c - 3c + 2c). 7c Expand (-g - g + g)(0g4 + 0g*4 - 2g*4 - 2g*4 + 6g*4 - 2g*4 + (-3 + g + 3)(4g2 - 4g2 - g3)) + (-3g + g + g)(-4g4 + 5g*4 + 2g*4). -2g*5 Expand (y - 3y + 0y)(0y2 + 0y2 + y2 + (0 + 1 + 0)(4y2 + y2 - 2y2)). -8y*3 Expand (7n + 8 - 8)(-3 + 0 + 1). -14n Expand 4n2 - 3n*2 - 3n*2 + (-2n + 0n + 0n)(-5n - 5n + 3n). 12n2 Expand (0 + 3 - 5)(0g + 0g + 2g4) + 4g*4 - 6g*4 + 3g*4 + (g - 2 + 2)(3g3 - 2g*3 + 0g*3). -2g*4 Expand (-3 + 0 + 5)(2r + 3r - 16 - 3r). 4r - 32 Expand (-4q2 + q2 + 2q*2)(-q + q - 5q + (-3 + 0 + 5)(-q + 0q + 0q)). 7q3 Expand (3t2 - t2 - 3t2)(-8t + 13t*3 + 8t). -13t5 Expand -16w + 4 - 4 + 2w + 2w - 2w + (0 - 1 - 1)(5w - 4w + w) + w - 3w + w. -19w Expand 6 - 2x4 - 6 + (7x - 5x + 2 - 4x)(-2x + 2x + 3x*3). -8x*4 + 6x*3 Expand (-5q*2 + 0q*2 + 4q*2 + (-5q2 - q2 + q*2)(-3 + 5 - 3))(0q - 3q + q). -8q*3 Expand 1 - 1 - 2i*2 + (3i - i - i)(0 + 0 - 2i) + (3i - 3i + i)(2i - 2i - 5i). -9i2 Expand (5t + 10t - 7t)((-2 + 2 - 2t)(-3 + 1 - 1) + 0t - 4t + 2t). 32t2 Expand 3z*3 + 2z3 + z3 + (4z + 3z - 5z)(-z2 + z2 - z2) + (-z3 + 2z3 + z3)(-2 + 0 + 1). 2z3 Expand ((2y + 5 - 5)(4 - 1 - 5) + 0y + 4y - 3y)(4y2 - y2 - y*2). -6y*3 Expand (3z4 - z4 - z*4)(-4 - 3 + 2). -5z4 Expand s5 + 2s*2 - 2s*2 + (-2s*2 + 0s + 0s)(3s3 - 2s3 + s3) - 3s5 - 6s*4 + 0s*4 + 4s*4. -6s*5 - 2s*4 Expand (-55t*3 - 18 + 15 + 4)(5t - 2t - t). -110t4 + 2t Expand (-3f + 5f - f)(-7 + 1 + 2). -4f Expand -2d4 + 0d*4 + 0d*4 + (-d - 2d + 0d)(2d - 2d*3 - 2d) + (2d3 - 3d*3 - 2d*3)(-4d + 2d + 3d). d4 Expand (0w*3 + 4w*3 - 5w*3)(-w - w + 0w) + 0 + 4w*4 + 5 - 3w*4. 3w*4 + 5 Expand (1 + 2 - 1)(-4d + 3d - d)(5d + 0d - 4d)(-d2 - 2d*2 + 5d*2). -8d*4 Expand (2n + 0n - 4n)(-4 - 2 + 5) + 0n + n + 0n. 3n Expand 44 + 16q4 - 44 + (-q + 4q - q)(-5q*3 + 3q3 - q3) + q*4 + 0q4 + q4. 12q4 Expand (-y + 2y + 7y)(-3y2 + 3y2 + y2)(1 + 0 - 2y + 3). -16y4 + 32y*3 Expand (f - f - f)(f + 2f - 8f) + 0f2 + 2f2 - f2 + 3f2 - 3f2 - f2 + (0f + f - 3f)(4f - 6f + 0f) - f*2 + 2f*2 + 0f*2. 10f*2 Expand (2w + 3 - 3)(-5w*4 + 3w*4 + 3w4) - w5 + 0w4 + 0w*4 + (3w - w + 0w)(13w4 - 104 + 104). 27w*5 Expand (-13z2 + z3 + 13z2)(0z + 2z - 3z)(2 + 1 - 2). -z4 Expand (b2 + b3 - b2)(-4b - 3b + 6b) - 6b4 + 3 - 3. -7b*4 Expand (2u + u + 0u)((4 + 2u - 4)(u3 + u3 - 4u3) - 2u4 + u4 - u*4). -18u*5 Expand (2 + 0 - 3)(-2h2 + 2h*2 + 2h*2) + 3h*2 + 3h*2 - 2h*2. 2h*2 Expand (1 - 1 + 2f)(-2f*3 + 4f*3 - 4f*3) + (5f*3 + 4f*3 + 4f*3)(3 - 3 - 2f). -30f*4 Expand 0 + 2b5 + 0 + (-b4 + 3b - 3b)(12b - 4b + 4b). -10b5 Expand (-3t*2 + 0t*2 + 2t + 2t2)(-2 + 0 + 0). 2t2 - 4t Expand (2 + 16 + 5)(-2w + 2w - w2) + w2 + w - w. -22w2 Expand (r2 - r2 + r2)(7 - 2 + 1)(0r + 0r + 4r) + (-5r2 + r2 + 2r2)(-2 + 2 - 2r). 28r3 Expand (-i2 + 0i2 + 0i*2)(4i + 0i - 5i) + (1 + 3 - 5)(2i2 - 2i*2 + 2i*3) + 14i*3 + 10i*3 - 10i*3. 13i*3 Expand (1 - 1 + m)(-m*3 - 3m*3 + 7m*3). 3m*4 Expand (4a*3 + 3a*4 - 4a*3)(-1 + 1 - 1)(3a + 0 + 0 + (2 - 3 - 1)(0a - 3a + a)). -21a*5 Expand (4 - 3 + 3)(-4 + 0 + 2w + 3). 8w - 4 Expand (-o*5 - 2o*3 + 2o*3)(119 - 61 - 61). 3o5 Expand (1807r*3 + r - 15r - 1810r3)(-3r2 + 0r2 + r2). 6r5 + 28r*3 Expand (0i - 3i + i)(9i3 + 7i**3	{ "pile_set_name": "DM Mathematics" }
tors of n. 11 Suppose -2w = -33 + 1. Let q be w(-1 - (-3)/2). Let x(t) = 6t + 5. List the prime factors of x(q). 53 Let n(v) = v3 - 16v*2 + 5v + 30. Suppose 162 = 12u - 30. List the prime factors of n(u). 2, 5, 11 Suppose 0 = -3c + 5u + 27 - 9, 0 = -2u. Suppose ck = 8k - 178. List the prime factors of k. 89 Suppose -5v + 2374 + 851 = 0. What are the prime factors of v? 3, 5, 43 Let u(y) be the third derivative of -y6/120 - 2y*5/15 - 5y4/12 - y3/6 - 45y2. List the prime factors of u(-7). 2, 5 Let w(u) = 7u - 6. Let f be w(13). Suppose -3z + 109 - f = 0. List the prime factors of z. 2 Suppose 153f - 134f - 27037 = 0. List the prime factors of f. 1423 Suppose -3l + 394 = -5t, 37 = l + 2t - 98. Suppose 26 = -2n - 3i - 150, 2n - 4i + 176 = 0. Let h = n + l. List the prime factors of h. 3, 5 Suppose 24j = 34338 + 28614. List the prime factors of j. 43, 61 Suppose a = 1180 + 1875. List the prime factors of a. 5, 13, 47 Let r = 4274 - 1382. What are the prime factors of r? 2, 3, 241 Suppose -159l + 11010 = -153l. Suppose l - 358 = 7b. What are the prime factors of b? 211 Let f(g) = 80g - 8. Let y be f(-5). List the prime factors of ((-3)/6)/(3/y). 2, 17 Let p(y) = 5y*2 + 2y + 2. Let i(f) = -f + 12. Let s be i(0). Let b = s + -15. What are the prime factors of p(b)? 41 Let c(t) = -3t3 - 3t*2 + 2. Let s be c(-1). Let i be (-81)/15 - 3/5. List the prime factors of s + i + (40 - 0). 2, 3 Suppose -8 = 2h - 6. Let p be (-4)/(-4) - (h + 2). What are the prime factors of -44(p - (-1)/(-2))? 2, 11 Let d(v) = 3v + 4. Let t be (-4)/6(-9 + 0). Let p be d(t). Suppose f + 3f = -2l + 14, -l + 3f + p = 0. List the prime factors of l. 13 Let b = 226 + -10. List the prime factors of (-6)/33 + b/99. 2 Let z(f) = -f*2 + 10f + 5. Let o(i) = i*3 + 14i*2 - 2i - 18. Let a be o(-14). Let t be z(a). List the prime factors of ((-108)/12)/((-1)/t). 3, 5 Suppose t = -4o - 241, 3t - t + 2 = 0. Let i be 89 - (14)/2. Let g = o + i. List the prime factors of g. 3 Let n = 28 - 24. Suppose -5r + 200 = 2i, 3r + 3i = nr - 40. What are the prime factors of r? 2, 5 Let n be 63/(-18)8/14. What are the prime factors of 2 - n/234? 2, 3 Let r be (4 - 1)/1 - -1. Let v(x) = -rx + 16 - 7x + 12x. What are the prime factors of v(-11)? 5 List the prime factors of (118/(-236))/((14/17616)/(-7)). 2, 3, 367 Let t(p) be the second derivative of p3/3 + 11p*2/2 - p. Let z be 34/(-68)(-10)/33. What are the prime factors of t(z)? 3, 7 Suppose 3x = -5h + 279 + 2485, 0 = -4x - 2h + 3690. What are the prime factors of x? 13, 71 Suppose 4r - 34 = 2. Let p = -9 + r. Suppose po = 2o - 26. List the prime factors of o. 13 Let h(n) = 5n2 + 8n + 10. Let m be h(-5). Suppose -k = 2l - 4k - m, -k = -4l + 175. List the prime factors of l. 43 Let m = 3920 - 1475. List the prime factors of m. 3, 5, 163 Suppose -1885 + 10045 = 3d. What are the prime factors of d? 2, 5, 17 Suppose -3i - 54 = 5t - 218, 3i - t = 158. Suppose 50m + 921 = im. List the prime factors of m. 307 Let n = -5850 + 8597. What are the prime factors of n? 41, 67 Let s = 3 + 2. Suppose 0 = -sj + 2j + 48. Let d = 30 - j. What are the prime factors of d? 2, 7 Let q = 860 + -418. List the prime factors of q. 2, 13, 17 Let l(w) = w3 - w2 + w - 3. Let x be l(0). Suppose 237 = -2h + 33. List the prime factors of 1/(x/h) - -4. 2, 19 Suppose -3h + 50 + 51 = 2x, 4x - 3h = 211. List the prime factors of (1 + -2)/((-4)/x). 13 Suppose -4l - 3h + 18 = -79, -2h = -5l + 127. What are the prime factors of l? 5 Suppose -4t = 0, b + 4t + 65 = -121. What are the prime factors of 21/(-6) + 4 + b/(-4)? 47 Let f(t) = t*3 - 4t*2 + 3t. Let d be f(3). List the prime factors of 0 - (d - (-1 + 279)). 2, 139 Suppose 2905 = i + 2542. List the prime factors of i. 3, 11 Let h(v) = v*3 + 13v*2 + v - 10. Let d be h(-10). Suppose 2g = -2g + d. Suppose 170 = 5w - g. What are the prime factors of w? 2, 3 Let a(d) = -d*3 + 3d*2 + 3d + 2. Let c be a(4). Let n be (c - -3)(2 - -3). Suppose 3v - 5f = 65, 2f = 5v + nf - 131. List the prime factors of v. 5 Suppose 95p - 86p - 12960 = 0. What are the prime factors of p? 2, 3, 5 Let s = -150 - -34. Let d = 59 - s. List the prime factors of d. 5, 7 Let x(n) = -49 - 4n + 30 - 5 - 2n. What are the prime factors of x(-6)? 2, 3 Suppose -9 + 54 = 3v. Let a = v + -13. Suppose 135 = 3o - 3p, ap = 4p - 10. What are the prime factors of o? 2, 5 Let i = 2 - -60. List the prime factors of i/4 + (-3)/2. 2, 7 Let k = -132 + 36. Let c = k - -161. List the prime factors of c. 5, 13 Suppose 11f = 15885 - 4643. List the prime factors of f. 2, 7, 73 Suppose -3t + 0 = -6. Suppose 4s - 5w = 4, -2s + tw + 2 = w. List the prime factors of (0 - s)/(4/(-68)). 17 Suppose -4h = -4u + 264, -5h - 146 = 4u - 428. List the prime factors of (u/3)/((-1)/(-6)). 2, 17 Suppose 0 = 49k - 53k + 20, -2k = 4m - 2726. What are the prime factors of m? 7, 97 Suppose 0u + 143 = 3u + m, 0 = -4u - 3m + 189. Suppose i + o - 10 = u, 0 = -4i + 5o + 223. What are the prime factors of i? 3, 19 Let q = -12 + 14. Let o be (1 + (q - -1))1. Suppose od - 2c = 24, -1 + 7 = d + c. List the prime factors of d. 2, 3 Let y be (-4)/((-25)/5 - -4). Suppose h = -yh - 3u + 89, -2h + 4u + 46 = 0. List the prime factors of h. 19 Let q(l) = -l*3 + 18l*2 + 9l - 7. Let u be q(6). Suppose 4s + 5t = -0s + u, 5s - 604 = -t. What are the prime factors of s? 11 Let s = 132 + -60. Suppose -s = -z - 5j, -230 = -3z - j + 42. Suppose -q + 5v + z = 0, -3q - q - 4v = -248. What are the prime factors of q? 67 Let b = 8 + -11. Let n be (-16)/b-2-6. Suppose m - n = -m. List the prime factors of m. 2 Suppose 0 = 3s + 9 + 9. Let t = 60 - s. List the prime factors of t. 2, 3, 11 Suppose 0r + 9r - 45 = 0. Suppose -3v = -0v - 2c - 67, -rv + 3c + 113 = 0. What are the prime factors of v? 5 Let n(w) = 13w - 8 + 4 - 1. What are the prime factors of n(5)? 2, 3, 5 Let m(a) = -59a3 + a + 1. Let v be m(-1). Suppose -2w - 159 + v = 0. Let k = w - -71. What are the prime factors of k? 3, 7 Let z = -399 - -601. What are the prime factors of z? 2, 101 Suppose 3407 = 2f - 5v, 21f = 20f - v + 1714. List the prime factors of f. 29, 59 Let d = -18 - -18. Suppose 2y - 27 - 25 = d. What are the prime factors of y? 2, 13 Let z(p) = -2p*3 + 42p*2 + 36p + 93. List the prime factors of z(19). 2221 Suppose -48a = -51a. Suppose a = 9q + 90 + 9. What are the prime factors of -4 - (q - 2) - 2? 7 Let i = -57 - -498. What are the prime factors of i? 3, 7 Suppose -4v - 15 = -9v - j, 0 = 4j + 20. Let p be 18/24 - 123/v. List the prime factors of (-9)/15 + (-978)/p. 2 Suppose 0 = 5y - 2y - 3z + 99, 4y - 5z + 133 = 0. Let x = 54 + y. Suppose -j = -t + x, 9t - 106 = 4t + 4j. List the prime factors of t. 2, 3 Let g be -1(-1)/36. Suppose 0 = i - 4c - 15, gi - 6 = -c - 3. Suppose -4b - 110 = -6b + 4w, -4w + 125 = ib. What are the prime factors of b? 47 Let w(r) = -31r*2 - 8 + 5r + 13r2 + 11r2 + r3. What are the prime factors of w(7)? 3 Let m(q) = -q*2 - 29q + 3042. What are the prime factors of m(0)? 2, 3, 13 Let l be (-883)/(-2) + (-6)/4. Suppose -4n + 88 + 66 = 2o, 0 = 5o - n - l. Suppose -5a = -g - 4g - 125, 3g - o = -3a. What are the prime factors of a? 3 Suppose d - 5 = 6d. List the prime factors of 1485/33 - 0/(0 + d). 3, 5 Let r = -1928 + 2731. List the prime factors of r. 11, 73 Suppose -230 = -3x + x - 4s, s = -3. Suppose -5i + x = 2m - m, -3i - 3m = -75. What are the prime factors of i? 2, 3 Let x = -8 + 13. Suppose -xw + 259 = -131. What are the prime factors of w? 2, 3, 13 Let m = 11 - 13. Let q(i) = 4i*2 - i. Let z be q(m). Let x = 9 + z. List the prime factors of x. 3 Suppose 3l - 6 = 9. Suppose -2s + lx = s + 17, -s = -2x + 7. What are the prime factors of 45 - 8 - (-2)/s? 3, 13 Let q(c) be the second derivative of -11/6c*3 + 0 + 2c + 1/2c2 - 1/12c*4. List the prime factors of q(-9). 19 Suppose 3b - 5l = 4, 2l = 2b - 4b + 24. Suppose 0 = -13o + bo + 10. List the prime factors of o. 2 Let s(w) = w3 + w2 + 14w - 30. Let r(o) = o3 - 2o*2 + 4o - 2. Let z be r(2). Wh	{ "pile_set_name": "DM Mathematics" }
4/15)/((-6)/(-45)). Let f = 22 - c. List the prime factors of f - 31/1. 7 Suppose 0 = -4c, 5c = 5w - 10 - 10. Suppose wk + 32 = 2u, -1 + 16 = -3k. Suppose -3g = -4i - 21, ui - 4i - 14 = -2g. What are the prime factors of g? 7 Suppose i - 3u = -2i + 12, 2 = u. Let y = 21 - i. What are the prime factors of y? 3, 5 Let u(k) = -4 + 40k - 34k + 11k2 - 5k*2 + 5k2. List the prime factors of u(-3). 7, 11 Let t(p) = p3 - 4p2 - 2p - 4. Let r be t(5). Let w = r - -222. List the prime factors of w. 233 Let c = -315 + 489. What are the prime factors of c? 2, 3, 29 Suppose t = -2v + 5, 7t - 4t = -3v + 9. Let f(k) = -2k2 + 1. Let w be f(t). List the prime factors of (w - -5)(6 - 2). 2 Suppose 14 = -2q + m, 4q + 22 + 12 = 5m. Let x(a) = -21a - 14. What are the prime factors of x(q)? 2, 7 What are the prime factors of (-552)/(-18)65? 2, 5, 23 Let a(f) = -f*2 + 22f + 4. Let v be a(27). What are the prime factors of (12 - 5)(v/(-7) + 1)? 2, 3, 23 Let l be (-2)/6 - 10/(-3). Suppose b + 15 = 5j - 3b, -4b - 9 = -3j. Suppose -jd - lp + 18 = 0, 4d - 13 - 2 = 5p. List the prime factors of d. 5 Let g(t) = t - 5. Let h be g(-10). Let u be 2/(-10) - 3/h. Suppose 62 = 5x - 3n, ux - 22 = -2x + 4n. List the prime factors of x. 13 Suppose 0 = -3u - 5j + 7726, 2u + 0j + j = 5146. What are the prime factors of u? 2, 643 Suppose 4h + 1603 = 3r, 6r = 2r + 4h + 2140. What are the prime factors of r? 3, 179 Suppose 5v = v. Suppose v = 3x + m - 0m - 70, -25 = 5m. Suppose 2k - x = k. List the prime factors of k. 5 Let y(t) = 61t3 - 1 - 12t*2 + t + 12t*2. Let g be y(1). Let f = 99 - g. List the prime factors of f. 2, 19 List the prime factors of (-237732)/(-484) - 2/11. 491 Suppose 4j - 17 - 3 = 0. Suppose -o - t = -57, jt - 119 = -2o + 2t. What are the prime factors of o? 2, 13 Suppose -5 = t + 2v, -3v + 7v + 4 = 0. Let a be (-10)/15 - 14/t. Suppose 5f = al - 94, 3l - 4f + 6f - 59 = 0. What are the prime factors of l? 3, 7 Let k = 17 - 14. Let r be -17 + 1 - 6/6. List the prime factors of -3 + k - (r + -4). 3, 7 Let d = 1497 + -846. List the prime factors of d. 3, 7, 31 Suppose 135 = 3u - 297. What are the prime factors of u? 2, 3 Suppose 8t - 3156 = -228. What are the prime factors of t? 2, 3, 61 Suppose -11o = -15037 - 8294. List the prime factors of o. 3, 7, 101 Suppose 2n - 2r + r + 20 = 0, -64 = 4n + 4r. List the prime factors of n/(((-108)/(-208))/(-9)). 2, 13 Let g(r) = 150r - 168. List the prime factors of g(8). 2, 3, 43 Suppose -7j + 4j + 231 = 0. Let v = j + -43. What are the prime factors of v? 2, 17 Suppose -925 = -14x + 1175. What are the prime factors of x? 2, 3, 5 Suppose -5v + 4x = -825, 4x = -v - v + 302. Let f = 228 - v. What are the prime factors of f? 67 Let x(m) = -m2 + m + 1. Suppose -g + 3 = -0, 2u + 15 = 5g. Let y be x(u). Suppose 3w - 10 = -y. What are the prime factors of w? 3 Let m(b) = b*3 - 3b*2 - b + 3. Let c be m(3). Suppose 4k - 650 + 126 = c. List the prime factors of k. 131 Let s = 322 - 88. Let c = s + -96. List the prime factors of c. 2, 3, 23 Let g(s) = -27s - 96. Let b(u) = -7u - 24. Let c(n) = 21b(n) - 5g(n). List the prime factors of c(-18). 2, 3 Suppose 2k + 9515 = 5j + 3k, 5709 = 3j - 3k. List the prime factors of j. 11, 173 Suppose -p + 345 - 10 = 4n, 0 = 4n - 2p - 326. Suppose -n - 66 = -c. What are the prime factors of c? 149 Let t(u) = 6 - 5 + 2u + 3 + 5. Let i be t(5). Let v = 29 - i. What are the prime factors of v? 2, 5 Let u be 0/2 + 1 - -6. Suppose -uv + 4v + 378 = 0. List the prime factors of (-1)/4 + v/24. 5 Suppose -3r + 8 = -4. Suppose 20 + 0 = ro. Suppose 5t + 36 = -0d + d, 0 = -ot - 15. List the prime factors of d. 3, 7 Suppose -2k + d - 1091 = -3k, 4k = 2d + 4376. What are the prime factors of k? 1093 Let n be 2 + 42/8. Suppose -3f = -4l + 121, nl - 5f + 24 = 123. Suppose l = 4s + r - 0r, 3s = 2r + 32. List the prime factors of s. 2 Suppose -10u = -7u - 228. List the prime factors of u. 2, 19 Let n = -1383 + 3172. List the prime factors of n. 1789 Suppose 6v - v = -185. Suppose -2r - 3 - 3 = 3a, r - 3a - 15 = 0. List the prime factors of r/6 - v/2. 19 Let k(a) = 587a + 113. List the prime factors of k(3). 2, 937 Let z = -17 - -19. Suppose -6a = zl - a - 206, -a = -4l + 434. What are the prime factors of (l/(-126))/(2/(-70))? 2, 3, 5 Let m = -91 - -55. Let q = m - -36. Let i(f) = 2f + 62. List the prime factors of i(q). 2, 31 Suppose b - 12 = 6. Let o = b + 43. What are the prime factors of o? 61 Let r(k) = 104k + 28. Let a be r(5). Suppose -387 - a = -5l. What are the prime factors of l? 11, 17 Let y(x) = -x*3 - 69x*2 - 240x - 96. What are the prime factors of y(-66)? 2, 3, 223 Suppose -2n + 7k - 2k = -120, -20 = 5k. Let p = 191 - n. List the prime factors of p. 3, 47 Let j = -7 + 15. Suppose 5d = -j + 78. Suppose 10a + 100 = da. List the prime factors of a. 5 Let m(c) be the second derivative of 5c*3/2 - 2c*2 + 2c. What are the prime factors of m(10)? 2, 73 Suppose -5j + 164 = -4q - 606, -5j = 2q - 770. What are the prime factors of j? 2, 7, 11 Suppose -7x + 3x = -3b - 19, 4b + 4x - 12 = 0. List the prime factors of b/1(-17)/(34/48). 2, 3 Let t = 142 + -134. Let q(m) = m*3 - 2m*2 - 14m + 20. List the prime factors of q(t). 2, 73 Suppose -2q = 8d - 5d - 4429, q = -5d + 2197. List the prime factors of q. 2, 11, 101 Let q(n) = -n3 + n2 + n + 1. Let c(t) = -2t3 + 15t*2 + 6t + 4. Let a(s) = c(s) - 3q(s). List the prime factors of a(-10). 3, 19 Let s(p) = 5p - 7. Let t be -16 + 21 - (-1 - -4). Suppose t + 3 = h. List the prime factors of s(h). 2, 3 Suppose 6i + 962 = 3110. Let v = -81 + i. List the prime factors of v. 277 Let l(d) = -d + 7. Let j be l(4). Suppose jq - 5i = 89, -4i - 32 = -3q + 56. Suppose w - 46 = -2x + 5w, -x - 3w = -q. List the prime factors of x. 5 Let c be 130/6 - 2/3. Let m(q) = q - 6. Let u be m(-7). Let d = c + u. What are the prime factors of d? 2 List the prime factors of 40 + 1536 + 3/(-1). 11, 13 Let m(l) = -2 + 8l3 - 3l*3 - 2l - 2l2 + 6l. Let r be m(4). What are the prime factors of (-14)/(-119) - r/(-34)? 3 Let f be 6 + (-3)/(-2 + 5). Suppose -5r - 35 = j, -2j = r - fr + 112. What are the prime factors of (-1 - (j - -4)) + 0? 3, 5 Let m(z) = 9z + 35. What are the prime factors of m(-2)? 17 Suppose 64a = 67a - 18. List the prime factors of a - -2 - 0/(-2 + 3). 2 Let x(k) = 184k2 + 3k - 2. List the prime factors of x(1). 5, 37 Suppose -15v + 16v - 4 = 0. Suppose -4 = -vc + 136. What are the prime factors of c? 5, 7 Suppose 0 = c + 3m + 23 - 4, 5c + 95 = -2m. Let v = 18 + c. Let n = 7 - v. What are the prime factors of n? 2 Suppose -3x + 3r = r - 27, 67 = 5x + 4r. Let p(c) = -2c - 1. Let a be p(-4). Suppose -a - x = -i. List the prime factors of i. 2, 3 Let u(y) = y + 1. Let g be u(-1). Suppose -4t - 5 + 9 = g. What are the prime factors of (t - -1)/((-2)/(-38))? 2, 19 Suppose -10f = 42 - 102. List the prime factors of f. 2, 3 Suppose 9g - 4g - 3q - 985 = 0, 4g - q - 795 = 0. What are the prime factors of g? 2, 5 Let r be (-5 - (-12 + -4))55. Suppose -3z + 0c + 380 = -c, 0 = 5z + 4c - r. What are the prime factors of z? 5 Let d = -43 + 47. Suppose -dv - 174 = 5k - 617, -2k - v + 176 = 0. List the prime factors of k. 3, 29 Let p(b) = -b - 2. Let u be p(-7). Suppose 5n - 25 - 20 = -ua, -4n + 6 = -2a. Suppose 46 = 3r - j, -4r + 52 = -3j + nj. What are the prime factors of r? 2, 7 Let t be 445/3 - (-2)/(-6). Suppose t = v + 3g, v + 32 - 187 = 4g. List the prime factors of v. 151 Let s = 25 + -29. List the prime factors of (-126)/s + (-15)/10. 2, 3, 5 Let u(n) = 16n + 5. Let q(l) = -1. Let o(t) = 2q(t) - u(t). Let j(p) = -47p - 20. Let h(r) = -6j(r) + 17o(r). What are the prime factors of h(2)? 3, 7 Let r = 1043 - -1397. What are the prime factors of r? 2, 5, 61 Let n = -7 + 13. Let o be -1 - (-12)/3 - n. What are the prime factors of (-104)/(-6)o/(-2)? 2, 13 Let x = 319 - 174. What are the prime factors of (-2)/(-2)3/(15/x)? 29 Suppose 0 = 36j - 23j - 6123. What are the prime factors of j? 3, 157 Let l(v) = -8v3 + 5v*2 + 4	{ "pile_set_name": "DM Mathematics" }
. What is the closest to 0 in g, v, -5? v Let s = -0.69 - -1.09. Let z = 0.4 - 0.2. Let d be (1/(-3))/(2/(-6)). What is the nearest to d in z, -5, s? s Let k = 3049 + -3049.4. Let g be 16/(-10)1/2. What is the closest to g in k, 4/7, 0.3? k Let z = -74 - -73.33. Let c = z + 1.07. What is the closest to -0.1 in -4, c, 0.8? c Let k = 0.26217 - -0.03783. Let l = -0.5 - -1. Let i = 0 - l. Which is the closest to 1? (a) -1 (b) i (c) k c Let z = -149 - -153. What is the closest to 10 in 3, 0.5, z? z Let x = 0 - 0.2. Let d be ((-15)/(-6) + -2)/(34/68). Which is the closest to d? (a) -0.8 (b) -1/7 (c) x b Let o = 1.28 + -1.08. Which is the nearest to o? (a) -4 (b) 5 (c) -3 (d) -0.4 d Let p = 17 + 11. Let y = p - 28. What is the closest to 2 in 2, y, -1/2? 2 Let k = 119 + -117. What is the nearest to k in -20, -3, -0.1? -0.1 Let u = 6 + 11. Let l = u + -16.9. What is the closest to l in -4, 0, -0.3? 0 Let n = 99 - 91. Suppose 16 = nr - 24. What is the closest to 1/2 in -3, -4/5, r? -4/5 Let n = 797.2 + -930. Let z = -133 - n. Let d = 0.2 + -0.3. What is the closest to 1 in 3, z, d? d Suppose 46j - 20 = 36j. Which is the nearest to 0? (a) -4 (b) 11 (c) j c Let g = -32 - -32.23. Let z = g + -0.13. Let r = -0.6 + 1. What is the nearest to 1 in r, -5/3, z? r Let k = 89 - 85. Which is the closest to -0.1? (a) k (b) 1/4 (c) -5 b Let o = 10.5 + -10.7. What is the closest to o in 0, 0.6, -1/5? -1/5 Let f = 110147/7 + -15735. Suppose 3w - 4g = -19, -3w + 21 = -8w - 4g. What is the nearest to 2/3 in 0.2, w, f? f Let j(k) = -k + 5. Let m be j(4). Let s be 3 - (-2 - (-76)/16). Which is the closest to -1/3? (a) s (b) m (c) 2 a Let z = 45 + -50.4. Let n = -5.9 - z. What is the nearest to 0 in -2/21, -2, n? -2/21 Let c = -1289.5 - -1290. What is the nearest to -32 in 1/5, c, -0.5? -0.5 Let q = 39/86 + 2/43. What is the nearest to 0 in q, 6, -11? q Let c be ((-4)/(-42))/((-15)/35). Let m be -8 + (-1 - -16 - 8). What is the nearest to m in -2, 2, c? c Let l(g) = -189g - 1. Let u be l(-1). Suppose 4o - 12 = -u. Let z be (-2)/(-3 - o/8). What is the nearest to -1 in z, -2/3, 2? z Let b = 0.4 - -1.6. Let n(v) = -7 - 7v - 16 + 3v - v. Let g be n(-5). What is the nearest to g in -0.5, 2/3, b? b Let n = -9.5 + 14. Let x = -12660 - -12659. What is the nearest to x in -0.4, n, 5/4? -0.4 Let t = 36.216 + 0.184. Let n = -35 + t. Which is the closest to 0.1? (a) 0 (b) n (c) -3 a Let r = -80 - -84. Which is the closest to 1? (a) -19 (b) r (c) -1/3 c Let l = -20 - -18. Let w be (3/(-9))/(l/6). Let z be (-3)/2 - (-1 - 1). What is the nearest to -0.1 in z, w, -4? z Let t = 6.22 + -7.22. What is the nearest to -0.2 in t, -5, -17? t Let s = -6.75 - -6.65. What is the closest to s in -5, -4, 14? -4 Let u be 1/(-3 - (-4)/2). Let p = 20 + -24. What is the closest to p in u, 3/8, -1/6? u Let v be -5 + (-65)/30-2. What is the closest to 0.2 in 3, -2/9, v? -2/9 Let w = -130 + 128. What is the nearest to -0.5 in -2/7, w, -4? -2/7 Let z = 24 + -49/2. Let w = 1789/7 - 256. Let q be (-2)/2 + (-105)/(-140). Which is the closest to q? (a) -2 (b) z (c) w c Let i = -30.1 + 30. Let h = 0.05 - 9.05. Let d = 8 + h. What is the closest to d in -0.4, i, -1/3? -0.4 Let h = 1816 + -1816.1. What is the closest to -1/20 in -2/3, h, 3? h Let a = 120 + -119. Let h = 9.7 - -3.3. Let y = h - 8. What is the nearest to 0 in a, y, 0? 0 Suppose -33 = 6m - m - 3t, 0 = 5m - t + 31. Which is the nearest to -0.2? (a) m (b) 0.3 (c) 1 b Suppose 75 = 10c + 175. What is the nearest to 1 in -1/4, c, 0.4? 0.4 Let z = 7937/22 + -721/2. Which is the closest to z? (a) 0 (b) -4 (c) 1/3 (d) 1/7 c Let a = 17.82 + -10.82. What is the closest to a in 0.1, -3, 0.9? 0.9 Suppose 2z - 32 = 2j + 32, 0 = -2j + z - 61. Let f = j - -29. What is the nearest to -2 in 2, -3, f? -3 Let u = -162.3 - -184. Let o = u + -3.7. Let i = o - 20. Which is the closest to i? (a) -5 (b) 5 (c) -2 c Let l(a) = 8a - 6. Let k be l(0). Let i(w) = 2w2 + 2w + 1. Let b be i(-1). Let r be 4/((-4 + b)1). What is the closest to -0.2 in r, k, -2/9? -2/9 Let t = -8 + 8. Let x = t - 0.07. Let n = x + 5.07. What is the closest to 4 in -0.1, 2/7, n? n Let d = 1927.7 - 1925. What is the nearest to d in 1/4, 0.1, 0.2? 1/4 Let l(h) = -h3 - 10h2 + h + 1. Let c be l(-10). Let x = 124.1 + -124. What is the closest to -1/3 in x, c, -1? x Let s = 0.97 + 0.03. Let f(v) = -v3 + 9v2 - 2v + 18. Let z be f(9). Let o = 3/46 + -199/230. Which is the closest to -0.3? (a) o (b) s (c) z c Let i = -8 - -7.9. Let h be 4/(-18) + (-35)/(-90). What is the nearest to 0.1 in h, i, 2? h Let q = 55/188 + -2/47. Let o = 67 - 66. Which is the closest to q? (a) o (b) 2/7 (c) -2/9 b Let p = 7.7 + 24.3. Let r = 34 - p. Which is the nearest to r? (a) -0.5 (b) 4 (c) 0.2 c Let i = -75.5 + 75.6. Which is the nearest to i? (a) 10 (b) -2/3 (c) -4 (d) 2 b Let p be (-4)/313/(-52)-2. Which is the nearest to 5? (a) 2/15 (b) p (c) 5 c Let o = 4.1 + -3.1. Let d = 0.58 - 0.08. Which is the nearest to 1? (a) -1/2 (b) o (c) d b Let d = -0.0336 - -5.0336. What is the nearest to 0 in 2, 12, d? 2 Let w be 9(-1 + -1 - 56/(-24)). Let k be (1 - 3)1 + w. Let t = 0.1 + 0. Which is the nearest to k? (a) 2 (b) t (c) -0.8 b Let k = 14.55 + -15.55. Which is the nearest to k? (a) 0.39 (b) 2 (c) -5 a Let r be (-2)/(-3) - (-7)/3. Let o be -1 + (r - (4 - 0)). Which is the nearest to -1? (a) 2/7 (b) 2/5 (c) o c Let p = 46 - 90. Let z = p - -134/3. Let q = -17 - -20. Which is the nearest to z? (a) q (b) 2/3 (c) -2/7 b Let r = 13 + -48. Let u = 37 + r. What is the nearest to 0.1 in -1, u, 0.1? 0.1 Let a = -0.46 - -2.46. What is the nearest to -1 in 11, 3/8, a? 3/8 Let b = -3.561 + -0.039. Let k = b - -4.6. What is the closest to k in -3/2, 3/5, -9/5? 3/5 Let t = -5 + 6. Let x = -132 - -128. Which is the closest to x? (a) -2 (b) 0.4 (c) t a Let d = -3.1 + 3. Let m be (7/((-189)/(-18)))/((12/9)/1). Which is the closest to 0? (a) -1/7 (b) m (c) d c Let j = -23.9 + 26. Let c = j + -4.1. Let x = 4 + -7. What is the nearest to 0.4 in 1, c, x? 1 Let t = -254 - -256.11. Let n = t - 2. Let w = -0.19 - n. What is the nearest to -1 in 0.5, -1, w? -1 Let t = 4 - 7. Let u = t + 3.5. Suppose -290 + 280 = -5y. Which is the closest to 1? (a) y (b) u (c) 5 b Let l = 187 + -187.2. What is the nearest to 2/17 in 5, l, 3? l Let k = -137/2 - -70. Let u(p) = 2p3 + p2 - p. Suppose -17 = 3r - 5n, 0n + 15 = 3r + 3n. Let v be u(r). What is the nearest to v in 1, k, 1/3? k Let x = 159/4 - 40. Let c be (-1 - -2) + 1 - 2. Let p be (-2)/(-2)(3 + c). What is the nearest to x in p, 5, 0.3? 0.3 Suppose 3u = -4v - 35, 9u = 4u + 3v - 10. Which is the nearest to 5? (a) u (b) 1/8 (c) -1 b Let m = 180.8 - 181. Which is the closest to 0? (a) 3 (b) m (c) 12 b Let j = -71 - -67. Let g = -23.5 + 23. Which is the closest to -1? (a) j (b) g (c) -2 b Let q = 122.2 + -122.3. Which is the nearest to q? (a) 12 (b) -0.5 (c) -4 b Let a = 169.8 + -169.7. Let o = 0.5 - 2.5. Let n = o + 2.2. What is the nearest to a in 2/11, 0.1, n? 0.1 Let p = 2 - 12. Let f = p + 29. Let g = f + -24. What is the closest to 0 in -4, -2/13, g? -2/13 Let y = -5/43 + -33/86. Let m be (-2)/7 - (-18)/14. Let k = 5 + -10. Which is the nearest to m? (a) y (b) -2 (c) k a Let i(l) = -l3 + 5l*2 - 18l + 36. Let r be i(3). Which is the closest to 0.1? (a) 9/7 (b) r (c) 0.03 (d) -1/5 c Let v be (0 - -2) + (-48)/(-4). Let q = -1 - -12. Let m be v - q - 23/7. What is the nearest to 1 in m, -4, 4? m Let d = 0.2 + 0. Let k = -1135 - -1136. What is the nearest to k in -5, d, -2/5? d Suppose -3r - 4p + 13 = 0, 16 = -4r + 5p - 2p. Let z be r/(6/(-8) + 1). Let k = -111.9 - -112.3. What is the closest to -1 in z, k, -0.2? -0.2 Let b = 0.013 - 3.013. Let q be (-5)/((-100)/(-28)) - -1. What is the closest to 0 in q, b, -1? q Let d = -179/682 - -5/62. Let v = -211 - -1901/9. Let l = -7.6 - -8. Which is the closest to v? (a) d (b) l (c) 4 b Suppose p - 4l = -18 - 15, 0 = -2p - 5l - 79. Let g = -37 - p. Let m = 1 + -1. What is the closest to m in g, -0.2, 1? g Let z = 5.128 - 0.128. Which is the closest to 0.1? (a) 19 (b) 4 (c) z b Let q = -167 - -167.08.	{ "pile_set_name": "DM Mathematics" }
149j2 + 278 What is the y'th term of -34276, -68554, -102832, -137110? -34278y + 2 What is the b'th term of 518, 1732, 3762, 6614, 10294? b*3 + 402b*2 + b + 114 What is the n'th term of -24056, -48110, -72164? -24054n - 2 What is the x'th term of -14324, -28634, -42962, -57314, -71696, -86114, -100574, -115082? -x*3 - 3x*2 - 14294x - 26 What is the d'th term of 4813, 4836, 4875, 4930? 8d2 - d + 4806 What is the r'th term of 30237, 30218, 30193, 30162, 30125? -3r*2 - 10r + 30250 What is the v'th term of -738, -1423, -2106, -2787, -3466? v*2 - 688v - 51 What is the q'th term of 86, -15, -274, -691, -1266, -1999, -2890? -79q2 + 136q + 29 What is the g'th term of 1852487, 1852485, 1852483, 1852481, 1852479? -2g + 1852489 What is the n'th term of -345150, -690297, -1035444, -1380591, -1725738, -2070885? -345147n - 3 What is the r'th term of -1807, -3631, -5475, -7351, -9271? -2r3 + 2r*2 - 1816r + 9 What is the l'th term of -2753, -5555, -8363, -11177? -3l2 - 2793l + 43 What is the o'th term of -670, -1245, -1816, -2383? 2o2 - 581o - 91 What is the o'th term of 532, 1140, 1748, 2356, 2964? 608o - 76 What is the q'th term of -1443, -2906, -4369, -5832? -1463q + 20 What is the h'th term of 1233, 4915, 11047, 19629? 1225h2 + 7h + 1 What is the y'th term of 2795, 5530, 8265? 2735y + 60 What is the a'th term of 1271, 1276, 1281, 1286? 5a + 1266 What is the a'th term of -16618, -33279, -50022, -66889, -83922? -7a3 + a2 - 16615a + 3 What is the b'th term of -2915, -11714, -26405, -46988, -73463, -105830? -2946b2 + 39b - 8 What is the g'th term of -1913, -3830, -5749, -7670, -9593? -g*2 - 1914g + 2 What is the r'th term of 4728, 4731, 4734, 4737? 3r + 4725 What is the u'th term of -8473, -34016, -76587, -136186, -212813? -8514u*2 - u + 42 What is the a'th term of 88, 329, 708, 1207, 1808, 2493, 3244, 4043? -3a*3 + 87a*2 + a + 3 What is the h'th term of 5, -93, -293, -595, -999, -1505, -2113? -51h*2 + 55h + 1 What is the c'th term of 2378164, 2378166, 2378168, 2378170, 2378172? 2c + 2378162 What is the a'th term of -296, -323, -350, -377? -27a - 269 What is the v'th term of 21796, 43559, 65322, 87085? 21763v + 33 What is the l'th term of 2923, 2926, 2929, 2932, 2935? 3l + 2920 What is the l'th term of -312, -626, -944, -1278, -1640, -2042? -2l3 + 10l*2 - 330l + 10 What is the z'th term of -14700, -14774, -14848, -14922? -74z - 14626 What is the m'th term of -1131626, -2263256, -3394884, -4526510? m2 - 1131633m + 6 What is the s'th term of 144, 224, 360, 552, 800? 28s2 - 4s + 120 What is the u'th term of 1624, 1763, 1980, 2263, 2600, 2979, 3388? -2u3 + 51u*2 + 1575 What is the p'th term of 584, 1097, 1610? 513p + 71 What is the h'th term of -498888, -498892, -498896, -498900? -4h - 498884 What is the z'th term of -12909973, -12909976, -12909981, -12909988, -12909997, -12910008? -z2 - 12909972 What is the f'th term of 65077, 65085, 65099, 65119, 65145? 3f*2 - f + 65075 What is the m'th term of -309, -522, -657, -714, -693? 39m*2 - 330m - 18 What is the x'th term of 396, 387, 378? -9x + 405 What is the p'th term of -7592, -60735, -204992, -485921, -949080, -1640027? -7593p3 + p2 + 5p - 5 What is the p'th term of -18817, -18819, -18809, -18781, -18729, -18647, -18529, -18369? p3 - 9p - 18809 What is the x'th term of -5033, -5000, -4967, -4934, -4901, -4868? 33x - 5066 What is the p'th term of -23142, -23144, -23148, -23154, -23162, -23172? -p2 + p - 23142 What is the f'th term of -126680, -126684, -126688, -126692, -126696? -4f - 126676 What is the b'th term of 7, 6, 11, 28, 63, 122, 211? b*3 - 3b*2 + b + 8 What is the a'th term of 100993, 100995, 100997, 100999, 101001? 2a + 100991 What is the w'th term of -14, -35, -62, -95, -134, -179? -3w2 - 12w + 1 What is the j'th term of 2064731, 2064730, 2064729, 2064728, 2064727, 2064726? -j + 2064732 What is the s'th term of -98, -432, -994, -1784, -2802, -4048, -5522? -114s2 + 8s + 8 What is the n'th term of -116, -94, -72, -50? 22n - 138 What is the a'th term of -19008, -38020, -57032, -76044? -19012a + 4 What is the b'th term of 2158, 8669, 19516, 34693, 54194, 78013? -b*3 + 2174b*2 - 4b - 11 What is the q'th term of -7, -68, -179, -340? -25q2 + 14q + 4 What is the n'th term of -472, -972, -1472, -1972, -2472? -500n + 28 What is the i'th term of -49609, -49606, -49601, -49594? i2 - 49610 What is the s'th term of -217, -706, -1457, -2476, -3769, -5342? -s3 - 125s*2 - 107s + 16 What is the l'th term of -146369, -146365, -146361? 4l - 146373 What is the d'th term of -2530, -5065, -7600? -2535d + 5 What is the k'th term of -49142, -98266, -147390? -49124k - 18 What is the l'th term of -6937, -6854, -6771? 83l - 7020 What is the d'th term of -1510454, -1510458, -1510462, -1510466, -1510470? -4d - 1510450 What is the o'th term of -6155, -12341, -18527, -24713? -6186o + 31 What is the w'th term of 141454, 141436, 141406, 141358, 141286, 141184, 141046, 140866? -w*3 - 11w + 141466 What is the z'th term of 40802, 40756, 40708, 40658? -z*2 - 43z + 40846 What is the h'th term of -172, -609, -1336, -2353, -3660, -5257? -145h2 - 2h - 25 What is the d'th term of 841, 1008, 1279, 1654, 2133, 2716? 52d2 + 11d + 778 What is the g'th term of 2233, 4472, 6713, 8956? g*2 + 2236g - 4 What is the f'th term of 1362, 1369, 1376, 1383, 1390? 7f + 1355 What is the x'th term of -10, -1, 26, 83, 182, 335, 554? 2x*3 - 3x*2 + 4x - 13 What is the w'th term of -11, 29, 171, 463, 953, 1689, 2719, 4091? 8w3 + 3w*2 - 25w + 3 What is the t'th term of 93, 107, 143, 213, 329, 503, 747? 2t3 - t2 + 3t + 89 What is the z'th term of 16931, 33856, 50777, 67694, 84607, 101516? -2z2 + 16931z + 2 What is the d'th term of -149040, -149071, -149102, -149133, -149164? -31d - 149009 What is the r'th term of 9324, 18658, 27992, 37326, 46660, 55994? 9334r - 10 What is the t'th term of -552, -1117, -1692, -2277, -2872? -5t2 - 550t + 3 What is the s'th term of -2677, -10722, -24137, -42922, -67077, -96602, -131497? -2685s2 + 10s - 2 What is the x'th term of -6671, -6663, -6655? 8x - 6679 What is the d'th term of -1560, -1506, -1434, -1344, -1236, -1110, -966? 9d*2 + 27d - 1596 What is the d'th term of -2326, -2187, -2048, -1909? 139d - 2465 What is the q'th term of -8525, -17039, -25569, -34115? -8q*2 - 8490q - 27 What is the a'th term of -55, -109, -167, -229, -295, -365, -439? -2a2 - 48a - 5 What is the i'th term of 254, 230, 182, 104, -10, -166, -370, -628? -i*3 - 6i*2 + i + 260 What is the g'th term of -630, -4947, -16640, -39393, -76890? -614g*3 - 4g*2 - 7g - 5 What is the j'th term of 7510188, 7510187, 7510186? -j + 7510189 What is the d'th term of 401298, 802591, 1203886, 1605183, 2006482, 2407783, 2809086? d*2 + 401290d + 7 What is the a'th term of 63477, 507756, 1713651, 4061970, 7933521, 13709112? 63468a3 + 3a + 6 What is the i'th term of 519, 1908, 4169, 7302, 11307? 436i2 + 81i + 2 What is the j'th term of -72171, -72173, -72175, -72177, -72179, -72181? -2j - 72169 What is the z'th term of -66033, -132065, -198097, -264129, -330161? -66032z - 1 What is the k'th term of -23, 6, 79, 196? 22k2 - 37k - 8 What is the n'th term of 787564, 787565, 787552, 787519, 787460? -n3 - n2 + 11n + 787555 What is the v'th term of -574, -664, -766, -886, -1030? -v3 - 83v - 490 What is the x'th term of 361, 2586, 8609, 20326, 39633, 68426, 108601, 162054? 316x3 + 3x*2 + 4x + 38 What is the j'th term of 39, 78, 167, 324, 567, 914, 1383, 1992? 3j3 + 7j*2 - 3j + 32 What is the o'th term of 42, -322, -930, -1782, -2878, -4218? -122o2 + 2o + 162 What is the w'th term of 2900, 3165, 3598, 4193, 4944, 5845? -w*3 + 90w*2 + 2w + 2809 What is the o'th term of -32256, -32241, -32224, -32205, -32184, -32161, -32136? o*2 + 12o - 32269 What is the o'th term of 303, 2287, 7629, 18009, 35107? 280o3 - o2 + 27o - 3 What is the o'th term of 10614, 21224, 31834? 10610o + 4 What is the w'th term of -469, -921, -1353, -1765? 10w*2 - 482w + 3 What is the a'th term of 15427, 15440, 15455, 15472, 15491, 15512, 15535? a*2 + 10	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.