Datasets:

timaeus
/

pile-dm_mathematics

Dataset card Data Studio Files Files and versions Community

Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
igit of 2788? 8 What is the thousands digit of 1003? 1 What is the thousands digit of 1948? 1 What is the tens digit of 13584? 8 What is the hundreds digit of 34332? 3 What is the units digit of 76? 6 What is the tens digit of 158? 5 What is the tens digit of 3628? 2 What is the units digit of 2398? 8 What is the units digit of 842? 2 What is the hundreds digit of 16219? 2 What is the units digit of 904? 4 What is the tens digit of 38994? 9 What is the units digit of 27280? 0 What is the thousands digit of 15466? 5 What is the tens digit of 19191? 9 What is the thousands digit of 29876? 9 What is the units digit of 5122? 2 What is the hundreds digit of 2712? 7 What is the hundreds digit of 11461? 4 What is the hundreds digit of 81923? 9 What is the units digit of 14572? 2 What is the units digit of 1400? 0 What is the thousands digit of 3569? 3 What is the units digit of 85? 5 What is the tens digit of 62957? 5 What is the units digit of 4204? 4 What is the units digit of 876? 6 What is the tens digit of 11963? 6 What is the units digit of 238? 8 What is the hundreds digit of 12894? 8 What is the hundreds digit of 29929? 9 What is the thousands digit of 59435? 9 What is the thousands digit of 6035? 6 What is the ten thousands digit of 35301? 3 What is the thousands digit of 58168? 8 What is the hundreds digit of 1292? 2 What is the units digit of 18763? 3 What is the units digit of 687? 7 What is the units digit of 705? 5 What is the hundreds digit of 33186? 1 What is the thousands digit of 22302? 2 What is the tens digit of 6523? 2 What is the units digit of 72? 2 What is the tens digit of 7933? 3 What is the thousands digit of 7091? 7 What is the ten thousands digit of 11450? 1 What is the tens digit of 1092? 9 What is the thousands digit of 1118? 1 What is the thousands digit of 3212? 3 What is the units digit of 2? 2 What is the units digit of 1263? 3 What is the thousands digit of 7778? 7 What is the tens digit of 435? 3 What is the tens digit of 261? 6 What is the units digit of 1018? 8 What is the units digit of 3248? 8 What is the thousands digit of 3110? 3 What is the hundreds digit of 3269? 2 What is the hundreds digit of 397? 3 What is the thousands digit of 17989? 7 What is the thousands digit of 2095? 2 What is the units digit of 19619? 9 What is the thousands digit of 2822? 2 What is the hundreds digit of 7643? 6 What is the tens digit of 708? 0 What is the units digit of 120861? 1 What is the thousands digit of 31115? 1 What is the thousands digit of 6192? 6 What is the thousands digit of 9578? 9 What is the hundreds digit of 1933? 9 What is the tens digit of 1514? 1 What is the units digit of 1010? 0 What is the tens digit of 365? 6 What is the thousands digit of 4871? 4 What is the hundreds digit of 1459? 4 What is the tens digit of 6444? 4 What is the hundreds digit of 986? 9 What is the hundreds digit of 24136? 1 What is the units digit of 448? 8 What is the ten thousands digit of 129670? 2 What is the units digit of 10588? 8 What is the tens digit of 115254? 5 What is the thousands digit of 3100? 3 What is the hundreds digit of 3203? 2 What is the units digit of 3155? 5 What is the tens digit of 17803? 0 What is the thousands digit of 5583? 5 What is the hundreds digit of 6700? 7 What is the units digit of 3484? 4 What is the units digit of 791? 1 What is the units digit of 7169? 9 What is the tens digit of 352? 5 What is the units digit of 54? 4 What is the thousands digit of 3328? 3 What is the thousands digit of 3209? 3 What is the thousands digit of 12828? 2 What is the tens digit of 6979? 7 What is the hundreds digit of 2396? 3 What is the hundreds digit of 7034? 0 What is the units digit of 1366? 6 What is the tens digit of 303? 0 What is the units digit of 24748? 8 What is the units digit of 241? 1 What is the tens digit of 472? 7 What is the thousands digit of 5469? 5 What is the units digit of 21451? 1 What is the units digit of 586? 6 What is the thousands digit of 4450? 4 What is the hundreds digit of 1531? 5 What is the tens digit of 973? 7 What is the thousands digit of 2154? 2 What is the tens digit of 35756? 5 What is the hundreds digit of 1076? 0 What is the ten thousands digit of 18806? 1 What is the hundreds digit of 1152? 1 What is the thousands digit of 5174? 5 What is the thousands digit of 1360? 1 What is the tens digit of 1840? 4 What is the units digit of 1019? 9 What is the tens digit of 930? 3 What is the hundreds digit of 491? 4 What is the ten thousands digit of 112189? 1 What is the units digit of 985? 5 What is the hundreds digit of 1221? 2 What is the ten thousands digit of 147084? 4 What is the hundreds digit of 63440? 4 What is the hundreds digit of 1070? 0 What is the thousands digit of 1230? 1 What is the hundreds digit of 135830? 8 What is the hundreds digit of 6264? 2 What is the thousands digit of 10092? 0 What is the units digit of 1859? 9 What is the tens digit of 3337? 3 What is the thousands digit of 41142? 1 What is the thousands digit of 2200? 2 What is the ten thousands digit of 10226? 1 What is the thousands digit of 1696? 1 What is the ten thousands digit of 26530? 2 What is the tens digit of 629? 2 What is the tens digit of 766? 6 What is the thousands digit of 6585? 6 What is the hundreds digit of 4302? 3 What is the ten thousands digit of 13736? 1 What is the thousands digit of 1111? 1 What is the hundreds digit of 12050? 0 What is the thousands digit of 2744? 2 What is the hundreds digit of 92868? 8 What is the tens digit of 14213? 1 What is the tens digit of 14855? 5 What is the units digit of 1852? 2 What is the thousands digit of 5679? 5 What is the units digit of 804? 4 What is the tens digit of 414? 1 What is the hundreds digit of 382? 3 What is the thousands digit of 150680? 0 What is the tens digit of 57528? 2 What is the thousands digit of 5794? 5 What is the hundred thousands digit of 122031? 1 What is the units digit of 996? 6 What is the thousands digit of 7979? 7 What is the thousands digit of 1791? 1 What is the tens digit of 1353? 5 What is the tens digit of 10514? 1 What is the thousands digit of 2987? 2 What is the hundreds digit of 29077? 0 What is the tens digit of 122562? 6 What is the units digit of 1844? 4 What is the thousands digit of 43273? 3 What is the tens digit of 222? 2 What is the hundred thousands digit of 186134? 1 What is the hundreds digit of 974? 9 What is the units digit of 908? 8 What is the tens digit of 3634? 3 What is the units digit of 613? 3 What is the thousands digit of 160238? 0 What is the units digit of 3313? 3 What is the tens digit of 495? 9 What is the hundreds digit of 38907? 9 What is the tens digit of 80227? 2 What is the tens digit of 34733? 3 What is the ten thousands digit of 37769? 3 What is the tens digit of 1853? 5 What is the hundreds digit of 94825? 8 What is the tens digit of 2560? 6 What is the tens digit of 7151? 5 What is the units digit of 472? 2 What is the hundreds digit of 3444? 4 What is the tens digit of 15123? 2 What is the hundreds digit of 114? 1 What is the units digit of 7510? 0 What is the tens digit of 19311? 1 What is the tens digit of 6046? 4 What is the hundreds digit of 807? 8 What is the units digit of 5632? 2 What is the thousands digit of 4910? 4 What is the hundreds digit of 10819? 8 What is the tens digit of 54318? 1 What is the thousands digit of 8374? 8 What is the thousands digit of 32902? 2 What is the tens digit of 1199? 9 What is the ten thousands digit of 45672? 4 What is the thousands digit of 37482? 7 What is the thousands digit of 5972? 5 What is the units digit of 521? 1 What is the tens digit of 1020? 2 What is the units digit of 1934? 4 What is the hundreds digit of 1392? 3 What is the units digit of 53? 3 What is the units digit of 75? 5 What is the tens digit of 2896? 9 What is the tens digit of 31308? 0 What is the units digit of 1380? 0 What is the hundreds digit of 248? 2 What is the thousands digit of 11404? 1 What is the hundreds digit of 2163? 1 What is the hundreds digit of 122? 1 What is the tens digit of 19311? 1 What is the hundreds digit of 151192? 1 What is the hundreds digit of 15369? 3 What is the thousands digit of 8795? 8 What is the hundreds digit of 4	{ "pile_set_name": "DM Mathematics" }
*3 + 6p*2 - 6p + 6. Let r(i) = -5i2 + 5i - 5. Determine -5d(b) - 6r(b). 5b3 Suppose -2f - 4r = -18 - 2, -27 = -3f - 5r. Suppose 22 = 6g - fg. Let u(d) = -2d*2 + 3d - 4. Let v(b) = 6b2 - 8b + 11. Calculate gu(o) + 4v(o). 2o2 + o Let q(j) = -j3 - j2 - j - 1. Let a(y) = 3 + y3 - 9y*3 + 10y*3 + 3y + 3y3 + 3y*2. Give -a(p) - 3q(p). -2p3 Let c(w) = -3w*2 - 6w - 6. Let v(s) be the second derivative of s*4/6 + 5s*3/6 + 5s*2/2 + 5s. Calculate 5c(l) + 6v(l). -3l2 Let y(f) = 14f + 7. Let j(z) = -1. Determine -6j(o) - y(o). -14o - 1 Let m(h) = -14h3 - 42h + 42. Let l(a) = a - 1. Give 42l(s) + m(s). -14s*3 Let s(h) = -h + 8. Let j(c) = c - 8. Determine 4j(k) + 5s(k). -k + 8 Let v(c) = 2c*3 - 7c*2 + 5c + 6. Let w(d) = 2d3 - 6d*2 + 6d + 5. What is 4v(o) - 5w(o)? -2o3 + 2o*2 - 10o - 1 Let c(i) = -4i3 - 2. Let q(o) = 2 + o3 - 7o*3 + 9o*3. Determine -5c(g) - 6q(g). 2g*3 - 2 Let b(y) = 7y + 6. Let z(p) = p + 2. Let x be z(-3). Let g be (14/6)/((-1)/(-3)). Suppose 3h - g = 8. Let v(d) = d + 1. Determine hv(c) + xb(c). -2c - 1 Let i(g) be the first derivative of 5g2/2 + 5g + 1. Let p(r) = 11r + 11. Suppose 8u + 9u - 119 = 0. Determine ui(f) - 3p(f). 2f + 2 Let g = 0 + 2. Let m(t) = -t + 10. Let o(f) = 2. Let a(n) = -6. Let x(c) = -5a(c) - 14o(c). Determine gm(d) - 10x(d). -2d Let x(t) = 7t*2 - 5t + 6. Let c(m) = 4m2 - 3m + 3. Determine 5c(b) - 3x(b). -b*2 - 3 Let j = -10 - -6. Suppose 0 = 3m - 6, -3k - m + 0m = 1. Let s(d) = -6d - 1. Let n(q) = q. What is jn(z) + ks(z)? 2z + 1 Suppose 2n - 2 = -16. Let c(o) = 3o*2. Let g(d) = 10d*2. What is nc(m) + 2g(m)? -m2 Let j(c) = -2c + 2 - 5c - 5 + 0 - 2c2. Let d(h) = -h2 - 3h - 1. Let m(u) = -u - 2. Let k be m(-5). Suppose -6 = -kn + 9. What is nd(q) - 2j(q)? -q*2 - q + 1 Let m(n) = 7n*3 + 6n*2 + 5n - 6. Let f(i) be the first derivative of -3i4/2 - 5i*3/3 - 2i*2 + 5i - 26. What is 6f(c) + 5m(c)? -c*3 + c Let r(m) = -3m3 - m2 + 4m - 4. Let z(c) = 15c*3 + 6c*2 - 21c + 21. Give 21r(x) + 4z(x). -3x3 + 3x*2 Let n(f) = 3f - 1. Let p = 3 - 6. Let g(i) = -2 + 0 + 1 + 2i. Determine pn(x) + 5g(x). x - 2 Let s(g) = -150g*3 - 14g*2 - 14. Let d(f) = 30f*3 + 3f*2 + 3. Give -14d(x) - 3s(x). 30x*3 Let x(w) = 0 + 3 - 8w + 4w - 6w*2. Let i(t) = -2t + 2 - 4t2 - t2 - t. Let v be -2(-10)/4 - 1. Calculate vi(l) - 3x(l). -2l2 - 1 Let v(x) = -x - 1. Let z(o) = -23o - 6. Determine 6v(m) - z(m). 17m Let y(s) = s*3 - 4s*2 + 4s - 2. Let b be y(4). Let w(m) = -2m + 3. Let c be 2/(-6) + (-16)/(-3). Let k(p) = 1 - 3 - 5 + cp. What is bw(v) + 6k(v)? 2v Let p(x) = 3x*2 - 2x + 5. Let o(a) = -2a2 + 2a - 4. Calculate 4o(d) + 3p(d). d*2 + 2d - 1 Let b(m) = 51m3 + 8m + 8. Let l(c) = -34c3 - 5c - 5. Calculate 5b(g) + 8l(g). -17g3 Let o(d) be the third derivative of d5/20 - d4/6 - 2d*3/3 + 10d*2. Let r(h) = 6h*2 - 7h - 7. Give -7o(l) + 4r(l). 3l2 Let c(l) = -l + 1. Let i be (-35)/(-14) + 2/4. Let w(f) = 2f - 3. Determine ic(y) + w(y). -y Let z(d) = 3d. Suppose -3w = -4w - 14. Let n = w - -10. Let k(j) = j. Let a(g) = -g*2 - 11g - 23. Let b be a(-8). What is bz(o) + nk(o)? -o Suppose 2g = 6g + 24. Let c be (-44)/12(-5 - -2). Let v(y) = 5y*2 + 4y - 9. Let d(s) = 3s2 + 2s - 5. Give cd(z) + gv(z). 3z2 - 2z - 1 Let j(k) = 27k - 2. Let p(g) = -14g + 1. What is -3j(o) - 7p(o)? 17o - 1 Let a be 2/5(7 + -12). Let m(i) = -2i2 - 2i + 1. Let y(d) = 0d - 2d2 + d2 - d. Give am(o) + 6y(o). -2o2 - 2o - 2 Let y(k) = k*2 + 7k + 6. Let c be y(-5). Let x(h) = -15h2 + 9h - 9. Let w(a) = 7a2 - 4a + 4. Calculate cx(d) - 9w(d). -3d2 Let p = -2 - 5. Let w(q) = 6q - 1. Let a(j) = -9j + 1. Give pw(m) - 5a(m). 3m + 2 Let g(c) = -2c + 80. Let a(w) = w - 53. Give -8a(o) - 5g(o). 2o + 24 Let q(u) = -5 + 4 - 5u + 6 + 7u*2. Let a(k) = 6k*2 - 4k + 4. Calculate -5a(l) + 4q(l). -2l2 Let m(l) = -3l*3 - l + 3. Let x(t) = 6 - 5 + t - 2. Determine m(f) + 3x(f). -3f3 + 2f Let c(r) = 2r3 - 8r*2 - 3. Let k(i) = 3i*3 - 12i*2 - 5. Determine -8c(s) + 5k(s). -s3 + 4s*2 - 1 Let b(i) = 17 + 8i*2 + 18i*2 + 17i - 6i2. Let z(r) = -7r*2 - 6r - 6. Suppose 2n + 14 - 2 = 0. Determine nb(q) - 17z(q). -q2 Let y(f) = -f3 - 7f*2 + 4. Let b be y(-7). Let i(d) = bd - 4d + 0d + d. Let h be (-2 - -5)(-10)/3. Let m(n) = -12n. Determine hi(a) - m(a). 2a Let r(x) be the second derivative of -2x3/3 - x2 - 3x. Let z be r(3). Let v(g) = g*2 - 2. Let b(c) = 3c*2 - 7. Give zv(i) + 4b(i). -2i*2 Let g(p) = -3p*3 - 12p*2 + 12. Let a(s) be the first derivative of 0s*2 + 6 - s + 1/3s*3. Determine 12a(n) + g(n). -3n3 Suppose 94f + 6 = 97f. Let q(l) = -7l*2 - 3l - 3. Let x(z) = 7z2 + 2z + 2. What is fq(r) + 3x(r)? 7r2 Let d(q) = q3 + q2 - q + 1. Let m = 0 - -1. Let a = m - 3. Let x be -1(a + 1) + -2. Let p(h) = 2h3 + h2 - 3h + 1. What is xp(k) + d(k)? -k3 + 2k Let l(c) = -9c2 + 5c. Let v(h) = 10h2 - 4h. What is 4l(n) + 5v(n)? 14n2 Let g(o) = 2o*2 - 5. Let s be (28/(-16))/((-1)/(-12)). Let a(b) = -9b*2 + 21. Give sg(i) - 5a(i). 3i*2 Let c(q) = -2q - 3. Let a(u) = u + 1. Give -9a(v) - 4c(v). -v + 3 Let f(r) = -2r + 7. Suppose 23 = -3s + 14. Let i(m) = 3m - 13. Determine si(q) - 5f(q). q + 4 Let x(c) = -7c*2. Let l(z) = 15z*2 + z. Let h(s) = -3l(s) - 7x(s). Let p(t) = -20t*2 + 14t. What is 14h(u) + 3p(u)? -4u2 Let b(a) = -5a + 2 - 8 + 13a. Let i(o) = -2 - 18 + 23o + 3. Calculate 17b(t) - 6i(t). -2t Let b(m) be the third derivative of -m6/60 - m5/30 + 5m*4/24 - 13m*2. Let y(k) = 4k*3 + 5k*2 - 11k. Calculate -5b(s) - 2y(s). 2s3 - 3s Suppose y = -3a - 2y + 33, -3a + 3y = -9. Let b(u) = 1. Let z(p) = p*2 - p + 4. What is ab(l) - 2z(l)? -2l*2 + 2l - 1 Let q(f) = 1. Let t(v) = 4 + 2v + 0v - 8. Calculate -q(k) + t(k). 2k - 5 Let o = -97 - -93. Let y(s) = 3s + 6. Let p(x) = -1. What is op(c) - y(c)? -3c - 2 Let y be 12/5 - 6/15. Suppose t = 3 - y. Let d(q) = q*2 - q - 1. Let a(g) = 4g*2 - 5g - 5. Calculate ta(w) - 5d(w). -w*2 Let q = -11 - -7. Let d be 2/q(-9 - -7). Let t(z) = 0 + 3 - d - 1. Let g(h) = 2h2 + h + 1. What is g(w) - t(w)? 2w*2 + w Suppose 39 = -5w + 4. Let l = -3 - w. Let c(n) = 3n3 - 4n*2 - 6n. Let g(h) = 4h3 - 5h*2 - 7h. Calculate lg(m) - 5c(m). m*3 + 2m Let v(c) = c + 27. Let s(r) = -2r - 54. Determine -4s(i) - 9v(i). -i - 27 Suppose -2d - 4 = 4. Let v(p) = p*3 - 8p*2 - 19p - 5. Let y be v(10). Let k(a) = 2a3 - 4a - 2. Let u(q) = 3q3 - 5q - 2. Give du(m) + yk(m). -2m3 - 2 Suppose 25 - 5 = 4g. Let o be (-26)/(-7) + 8/28. Let a(u) be the first derivative of -2u3 + u2 - 1. Let k(d) = 5d*2 - 2d. Give gk(t) + oa(t). t*2 - 2t Let v(p) = 4p2 - 2p + 3. Let i(o) = 9o2 - 5o + 6. Give -2i(b) + 5v(b). 2b2 + 3 Let l(h) = -h - 10. Let u(m) = -2. Let w(k) = -2l(k) + 11u(k). Suppose t + 0t = -2. Let b(c) = 5 + 1 - 5. Calculate tb(s) - w(s). -2s Let q(b) = 9b3 + 10b*2 - 5b - 5. Let v(k) = 13k3 + 15k*2 - 7k - 7. Calculate 7q(g) - 5v(g). -2g3 - 5g*2 Let f(h) = -14h - 2. Let w(s) = -43s - 7. Determine 7f(q) - 2w(q). -12q Let k(y) = 2y3 + 3y*2 - 5y - 2. Let x(m) = -m3 - m2 + 2m + 1. Calculate -2k(t) - 5x(t). t3 - t2 - 1 Let b(v) = v2 - v + 1. Let r(x) = -2x*3 - 2x*2 + 10x - 2. Let t(u) = 6b(u) + r(u). Let k(q) = -2q*3 + 5q*2 + 5q + 5. What is -4k(o) + 5t(o)? -2o3 Let g(b) = -44b + 11. Let l(t) = 11t - 3. Give -3g(a) - 11l(a). 11a Let c(f) = 3f3 - 3f*2 + 5f - 3. Let m(o) = 3o3 - 4o*2 + 6o - 4. Give -6c(x) + 5m(x). -3x3 - 2x*2 - 2 Let c be (0 + 5/(-2))-2. Let a(p) = -2p + 2. Let t(r) = -7r + 9. Let g(w) = 9a(w) - 2t(w). Let n(m) = -7m. Give cg(x) - 3n(x). x Let m(w) = -4w*2 + 9w + 17. Let y(t) = -2t2 + 4t + 8. Suppose -5n + 10 = 40. Give nm(l) + 13y(l). -2l*2 - 2l + 2 Let g(n) = -6n + 5. Let k be g(-1). Let b(u) = -15u + 4.	{ "pile_set_name": "DM Mathematics" }
culate the highest common factor of l and z. 58 Let n be (-42024)/(-60) - (102/30 + -3). Calculate the greatest common divisor of n and 56. 28 Suppose 0 = 2l + 5k - 41, 74k = 5l + 72k - 30. What is the highest common divisor of l and 19336? 8 Suppose -4g = -3g - 3k - 157, 4k + 796 = 5g. Suppose -o - 4m = -68, -249 = -119o + 116o + 3m. Calculate the highest common factor of g and o. 80 Suppose -5z = -10z + 2240. Suppose 0 = 14r + 3t - 223, -297t - 32 = -r - 299t. What is the greatest common factor of z and r? 14 Let s = -2040 + 2367. What is the highest common factor of s and 3? 3 Suppose 23773 = 552g - 12659. Suppose -123 = -5i - h, -3i - 3h + 5h = -66. What is the highest common divisor of g and i? 6 Let j be (8 - 7) + -2 + 6. Suppose 2f + 24 = jm, 9m + 5f = 7m - 2. What is the highest common factor of m and 4? 4 Suppose -148g + 146g = -4. Suppose -4c = 5l - 58, 0 = -7l + 9l + gc - 24. Suppose 0 + 20 = 5m. What is the highest common factor of m and l? 2 Let v(k) = k*2 - 5k - 27. Let a be (-8 + -1 + 0)/(30 + -31). Let d be v(a). Calculate the highest common divisor of 72 and d. 9 Let u = 21 + -11. Let c be 2/552. Suppose -111 = -ch + 3f, h + 3f - 2 - 37 = 0. What is the greatest common divisor of u and h? 10 Let a = 39829 + -39759. What is the highest common divisor of 11530 and a? 10 Let l(o) = 3o*2 + 16o - 133. Let w be l(-12). Suppose 5j + 5 = -3v + w, -3v + 66 = 3j. What is the highest common factor of 36 and j? 18 Let x be (2 - (-27)/(-15))/((-4)/(-20)). Let v be x/(-2)-10(-294)/(-30). What is the greatest common divisor of v and 35? 7 Suppose 0 = -4684r + 4682r + 170. Let p be -2 + (-4638)/(-27) + (-2)/(-9). What is the highest common factor of p and r? 85 Suppose -102n + 100n + 2682 = 3a, -4n - a + 5374 = 0. Calculate the highest common factor of n and 2184. 168 Let n be 2/2 + (-41 - -2). Let a = n - -62. Suppose 562 = -9u + 2u + 646. Calculate the greatest common divisor of a and u. 12 Suppose 126i - 131i - 70 = 0. Let x(c) = c*3 + 13c*2 - 15c + 12. Let k be x(i). Calculate the highest common factor of k and 26. 26 Let u be 6((-96)/(-432))/(2/12). Suppose z - 27 = 29. What is the highest common divisor of z and u? 8 Suppose 5p - 2438 = 4g, -26p + 25p - 3g = -499. Calculate the highest common divisor of 30 and p. 10 Let t(p) = -p*3 + 7p*2 + 69p - 27. Let d be t(7). Calculate the highest common factor of d and 1938. 114 Suppose 3u + 9384 = 4w, 72u = w + 68u - 2333. What is the highest common factor of 29 and w? 29 Let j = 406 + -237. Let d be j/338-8(-1 + -6). Calculate the highest common divisor of d and 364. 28 Suppose -137m - 265m - 1546467 + 13675209 = 0. What is the greatest common factor of m and 267? 267 Suppose 55j = -80j + 2025. Let l(g) = 33g2 - 1. Let u be l(-1). Suppose -23s + u = -js. Calculate the highest common factor of 4 and s. 4 Let p(r) = -r2 + 10r + 3. Let b be p(9). Suppose -10q = -38 - b. What is the highest common divisor of q and 15? 5 Suppose -25g - 88 = -2238. Calculate the highest common factor of g and 4214. 86 Let l(r) = 12r + 2. Suppose 2a - 2 = -4y, -2y + 7 = -3y + a. Let h be l(y). Let j = 42 + h. Calculate the greatest common factor of 80 and j. 20 Let u(a) = -4a*2 - 117a - 554. Let l be u(-23). Calculate the highest common factor of l and 15897. 21 Let u be (6 + -2)/(2/122). Let f = u + -239. Calculate the highest common factor of f and 25. 5 Let m = -3469 + 3535. What is the highest common factor of 5896 and m? 22 Suppose -1276 = -28h + 96. Suppose 2m + 2v - 43 - h = 0, -3v + 234 = 5m. What is the greatest common factor of 624 and m? 48 Let g be (1 - (-2)/(-6))4320/64. What is the highest common divisor of g and 345? 15 Let k be (-88)/11 - 8/(-2). Let a = k + 132. What is the highest common divisor of a and 4? 4 Suppose 27m + 4m - 786 - 1074 = 0. Let y = 2025 - 1395. What is the highest common factor of m and y? 30 Let f be ((144/14)/1)/((-3)/(-14)). Let g = -44 + f. Suppose -t - 57 = -gt. Calculate the highest common divisor of t and 76. 19 Suppose 0 = -d - 2b + 28 + 7, 3d + 2b = 117. Suppose -44y = -dy - 9. What is the highest common factor of 24 and y? 3 Suppose 0s + s = 2c - 69, -c - 4s = -12. Let k = -12013 + 12057. Calculate the highest common divisor of k and c. 4 Let h(x) = 14x + 9. Let f be h(-8). Let y = 101 + f. Let a be -17y4/8. What is the highest common divisor of 17 and a? 17 Suppose -k + 6k = -3g - 32, -5g - 16 = -k. Let c be g/(-16) + ((-1548)/(-16) - -3). Let l = -82 + c. What is the highest common factor of 54 and l? 18 Suppose 2m + 29 + 53 = 2s, 4s - 2m - 160 = 0. Calculate the highest common divisor of s and 429. 39 Let s(n) = -42n - 16. Let q be s(-3). Let i be ((-28)/(-12))/((-2)/66). Let z = i + q. Calculate the greatest common divisor of 3 and z. 3 Let q be 626 + 30 + (23 - 33). Calculate the greatest common divisor of 952 and q. 34 Let d be (-768)/3(-10)/8. Suppose 19x = 25x - 768. Calculate the highest common divisor of x and d. 64 Suppose 17c - 60203 + 240747 = 108c. Calculate the highest common divisor of 186 and c. 62 Let b = -1624 + 1684. What is the highest common divisor of 735 and b? 15 Let k = 2 + 2. Let c be (-900)/(-63) + k/(-14). Let v(w) = -w2 - 391w - 1923. Let u be v(-5). Calculate the greatest common divisor of u and c. 7 Suppose 4f + 4f = 32. Suppose 2a + 6 + f = 0. Let c be 20 - (20/a + 4). What is the highest common divisor of c and 160? 20 Let r = 5983 + 2137. What is the greatest common divisor of 20 and r? 20 Let d = -150 + 456. Suppose -173s = -182s + d. What is the highest common factor of 578 and s? 34 Let r(i) be the second derivative of 20i + 4i2 + 0 - 1/12i*4 + 8/3i*3. Let o be r(8). What is the highest common factor of o and 180? 36 Let c be (-24)/(-1) - (2 - 1). Let j be 256 - ((-15)/25 - 18/(-5)). What is the highest common divisor of c and j? 23 Suppose a + 58 = 6l - l, 0 = 4a + 12. Suppose -1378 = -lr - 421. What is the greatest common factor of 29 and r? 29 Let t(l) = l*2 + 29l - 18. Let v be t(-30). Let g = 15 - -3. What is the highest common divisor of g and v? 6 Suppose 31720 = -1149i + 1162i. Calculate the greatest common divisor of 20 and i. 20 Let h = 19 - -65. Suppose -5256 = -256d + 37d. Calculate the highest common factor of d and h. 12 Let c = -116 - -328. Let s = 278 - c. What is the highest common divisor of 44 and s? 22 Suppose -105b + 507 - 24 = -98b. What is the highest common divisor of b and 13593? 69 Suppose 3v - 8v + 110 = 0. Suppose 12y - 3m - 883 = 7y, 876 = 5y + 4m. What is the highest common divisor of y and v? 22 Let r = 32845 + -32818. What is the highest common divisor of r and 2979? 9 Suppose 4s - 16 = -2b, 5b - 8 = -s - s. Let z(x) = x + 38. Let r be z(b). Let k be r(0 - (7/(-2))/7). Calculate the highest common divisor of k and 209. 19 Let v(s) = s3 - 8s*2 + 3s - 14. Suppose 44g - 56 = 36g. Let w be v(g). Let m = w + 114. Calculate the greatest common factor of 8 and m. 8 Let j = -13846 - -13946. Calculate the highest common factor of 175 and j. 25 Let m = -137 + -306. Let z = m - -458. What is the greatest common divisor of 15 and z? 15 Let r = 404 + -182. Suppose -472n - 9176 = -596n. Calculate the greatest common divisor of n and r. 74 Let m = 26872 - 21911. Calculate the highest common divisor of m and 82. 41 Suppose -2b = 2 - 0. Let n(m) = 714m*2 - 2m - 2. Let o be n(b). Let u be (o/(-147))/(2/(-14)). Calculate the highest common factor of u and 51. 17 Let r = 16446 + -16366. Calculate the highest common divisor of 3580 and r. 20 Suppose 4h = h + z + 34, -2h + 36 = 2z. Suppose -2n + 21 = h, 3s - 4n - 83 = 0. Calculate the highest common divisor of s and 33. 33 Let c(a) = 1091a + 11. Let t be c(1). Suppose -23n - 90 + t = 0. Let g(o) = -2o. Let j be g(-2). What is the greatest common divisor of n and j? 4 Let c(q) = -q3 + 8q + 7. Let y be c(5). Let g be y((-31)/6 - -5). Calculate the highest common factor of 143 and g. 13 Let g be (16/(-4) - 4) + (-40)/(-2). What is the greatest common divisor of 1668 and g? 12 Let f = -53 - -74. Suppose -3i - f + 15 = 0. Let n(t) = -21*t - 9. Let y be n(i). Calculate the h	{ "pile_set_name": "DM Mathematics" }
t y be k(-4). Let q = 12 - y. Factor 1/2j + j2 + 2j*q - 7/2j*3 + 0. j(j - 1)*2(4j + 1)/2 Let c(f) be the first derivative of -2f*3/27 + 4f*2/9 + 8f/3 - 34. Suppose c(d) = 0. Calculate d. -2, 6 Let i(y) be the first derivative of 3/20y6 + 3 + 3/5y*5 + 3y*2 + 0y*3 + 1/70y7 + y4 + 0y. Let f(o) be the second derivative of i(o). Factor f(w). 3w(w + 2)3 Let m(s) be the third derivative of s3 + 0s - 1/18s4 + 0 - 12s*2 - 1/270s*6 + 1/45s*5. Let u(h) be the first derivative of m(h). Factor u(k). -4(k - 1)*2/3 Let z be (-129)/15 + (0 - 4/10). Let w be (-5 + 5)/(1/(3/z)). Factor w + 1/2y2 + y3 - 1/2y4 - y. -y(y - 2)(y - 1)(y + 1)/2 Factor 0 + 2/15s3 + 128/15s - 32/15s2. 2s(s - 8)2/15 Let z be (-4802)/147 + 2/(-6) + -1. Let a be z/(-6) + (-2 - 3). Solve -a + 4/9x + 2/9x2 = 0 for x. -3, 1 Let c(v) = v2 - v - 12. Let i be c(5). Suppose 2o - i = -2. Factor 0 - 2/11ro + 4/11r - 2/11r2. -2r(r - 1)(r + 2)/11 Let h be 0 + (-3)/(-5 - -2) + 2. Factor 84c5 + 939c*4 - 887c*4 - 6c*3 + 14c*h. 4c*3(3c + 1)(7c + 2) Let n(l) be the first derivative of l4/12 + 8l*3/9 + 8l*2/3 + 182. Solve n(o) = 0. -4, 0 Let y(p) = 7p*2 + 7p + 36. Let a(m) = -30m2 - 30m - 145. Let c(t) = 6a(t) + 25y(t). Factor c(h). -5(h - 2)(h + 3) Suppose 8s - 7s + 2 = 0. Let p be 24/(-15) - (s - 1) - 1. Let -p + y*2 - 3/5y = 0. What is y? -2/5, 1 Let j(c) be the first derivative of 0c + 1/15c*3 - 1/10c*2 - 5. Solve j(f) = 0 for f. 0, 1 Determine l, given that 4l*2 - 10l*3 - 5l*4 + 5l + 9l2 - 15 + 5l + 7l2 = 0. -3, -1, 1 Let d(f) = 120f*2 + 5979f + 5994. Let o(q) = 9q2 + 460q + 461. Let a(t) = -2d(t) + 27o(t). Let a(p) = 0. What is p? -153, -1 Let o be 4/6 + 12/9. Suppose 0 + 162ko - 6k*3 + 6k + 4k4 - 9 - 7k*4 - 150k*2 = 0. What is k? -3, -1, 1 Suppose -2i - l + 6 = 0, -1 = -l - 3. Suppose -it + 3o = -27, -2o + 10 = 4. What is p in -3p - 3p4 - tp + 4p3 + 5p*3 = 0? -1, 0, 2 Let s(g) be the second derivative of 7g*4/48 - 13g3/12 - g2 + g. Factor s(v). (v - 4)(7v + 2)/4 Suppose -35r = -40r. Let b(p) be the first derivative of -1/21p3 + 1 + 1/28p*4 - 1/42p*6 + rp*2 + 0p + 1/35p5. Determine a so that b(a) = 0. -1, 0, 1 Let j = 20/1771 - -3482/5313. Factor 0 - 4h*2 - jh*3 + 0h. -2h2(h + 6)/3 Find f such that -224f2 + 454f*2 - 220f*2 - 185 + 365f = 0. -37, 1/2 Let c(k) = -k + 11. Let v(z) = -3z + 21. Let s(q) = -5c(q) + 2v(q). Let y be s(-13). Find w, given that 0 + 2/7w - 2/7w3 + yw*2 = 0. -1, 0, 1 Suppose -32/7 + 20/7l*3 + 80/7l - 2/7l4 - 66/7l2 = 0. Calculate l. 1, 4 Let v(r) be the first derivative of r6/2880 - r5/240 + r4/64 - 9r3 + 48. Let j(k) be the third derivative of v(k). Factor j(h). (h - 3)(h - 1)/8 Let w be ((-95)/(-76) - 18) + 17. Let wt2 - 3/4t + 0 = 0. What is t? 0, 3 Let v be ((-24)/462)/(124/(-868)). Factor -6/11h - v - 2/11h*2. -2(h + 1)(h + 2)/11 Let n(v) = -v4 - 53v*3 - 89v*2 + 45v + 90. Let m(a) = a*4 + 108a*3 + 179a*2 - 90a - 180. Let j(r) = 4m(r) + 9n(r). Determine f so that j(f) = 0. -6, -3, -1, 1 Let o(g) = -3g5 + 9g*4 + 3g*3 - 21g*2 - 3g + 9. Let h(m) = m3 + m2. Let f(k) = 3h(k) + o(k). Suppose f(z) = 0. Calculate z. -1, 1, 3 Let j(x) be the third derivative of x6/240 + 13x*5/12 + 4225x*4/48 - 228x*2 - 1. Factor j(c). c(c + 65)2/2 Let i(s) = s3 + 4s2 - 7. Let n be i(-3). Let j be n/(-6) - 9/((-81)/6). Suppose -jc*2 - 2/3 - c = 0. What is c? -2, -1 Let a = -23 + 28. Factor -4i*4 + 9i*4 - 10i*2 + 8i - 5i5 - 3i + ai4. -5i(i - 1)3(i + 1) Factor -2/5i4 + 2/5i + 0 + 2/5i2 - 2/5i*3. -2i(i - 1)(i + 1)2/5 Let f(s) be the third derivative of s5/12 + 5s4/2 - 70s3/3 - s2 + 40. Determine n, given that f(n) = 0. -14, 2 Let j be (16/6)/(2/6). Suppose j = 2a + 2a. Solve -49o + o2 + oa + 45o + 0o2 = 0. 0, 2 Let o = -345/8 + 46579/1080. Let y(t) be the third derivative of 14t*2 - 4/27t*3 + 0t - ot5 - 5/108t*4 + 0. Factor y(z). -2(z + 1)(z + 4)/9 Let -22/3m + 1/6m2 - 15/2 = 0. What is m? -1, 45 Suppose 3u + 12 = 5u. Let h be 29/u + 1. Suppose t3 + t5 + 4t3 + 2t*4 - ht*3 = 0. Calculate t. -1, 0 Let a(x) be the third derivative of -2x*2 + 0x*5 - 2/27x*3 + 0 - 1/540x*6 + 1/36x*4 + 0x. Solve a(m) = 0. -2, 1 Let j be (-4 + 0)(-3)/(-40)-4. Let n be (9 - 2) + (-164)/41. Suppose -6/5 - 3/5kn + 3/5k + jk2 = 0. What is k? -1, 1, 2 Let i(j) be the second derivative of -1/3j*3 - 3/4j*2 - 6j - 1/24j4 + 5. Factor i(t). -(t + 1)(t + 3)/2 Solve -209n3 + 13n*2 - 6n + 217n3 - 2n*5 + 4 - 17n2 = 0 for n. -2, -1, 1 Let m(q) be the first derivative of -q6/48 + q4/16 - q2/16 + 42. Factor m(i). -i(i - 1)2(i + 1)*2/8 Determine t so that 3t - 18t + 36t*2 - t = 0. 0, 4/9 Let k(g) be the second derivative of -9g + 1/8g4 + 0 - 1/2g*3 + 0g*2. Determine h so that k(h) = 0. 0, 2 Let m(n) = -8n*4 + 2n*3 - 6n*2 + 6n + 6. Suppose 4o = 8 - 0. Let x(s) = so - 1 + s4 - 4s + 3s + 0s. Let d(l) = m(l) + 6x(l). Factor d(z). -2z*3(z - 1) Let y(a) = 6a2 - 2a. Suppose -4u + 32 = 3p, 0 = 2p - 7p + 3u + 5. Let d(j) = -5j*2 + 2j. Let x(i) = py(i) + 5d(i). Factor x(k). -k(k - 2) Let m(z) be the second derivative of -z6/195 - z5/13 - 6z*4/13 - 56z*3/39 - 32z*2/13 + 61z. Determine f so that m(f) = 0. -4, -2 Let b(q) = -8q + 27. Let f be (-8)/(-40) + 14/5. Let y be b(f). Factor 1/7l*y - 1/7 + 1/7l*2 - 1/7l. (l - 1)(l + 1)2/7 Let i(c) = 0c*2 + 8c*2 - 14c - 2c3 - 4c2. Let q(w) = w2 - w. Let n(j) = i(j) - 10q(j). Factor n(r). -2r(r + 1)(r + 2) Let s(g) be the third derivative of -g8/1344 + g6/120 + g5/120 - g4/32 - g*3/12 + 3g2 + 15. Let s(h) = 0. Calculate h. -1, 1, 2 Let d(k) be the first derivative of k5/60 + k4/72 - k3/9 - 14k2 - 13. Let p(c) be the second derivative of d(c). Factor p(w). (w + 1)(3w - 2)/3 Let i(z) be the third derivative of z6/30 - 7z*5/3 - 76z*4/3 - 104z*3 - 733z*2. Factor i(b). 4(b - 39)(b + 2)2 Factor -27/2 + 1/2l*4 + 18l - 3l2 - 2l3. (l - 3)2(l - 1)(l + 3)/2 Let 25881t3 + 3t*2 + 3t*5 - 21t*2 - 24t*4 - 25842t*3 = 0. Calculate t. 0, 1, 6 Factor -12s*2 + 100s - 4s2 + 20s*2 - 32s + 32s. 4s(s + 25) Suppose 6i = 14 + 28. Factor 9x2 + 3x*4 + ix*3 - 21x3 - x3 + 3x5. 3x*2(x - 1)*2(x + 3) Find x such that 14x - 126x*2 - 3 - 11 + 258x*2 - 2 - 130x2 = 0. -8, 1 Let o(b) be the third derivative of b5/60 - 37b4/12 + 1369b*3/6 + 93b2. Factor o(l). (l - 37)2 Factor -2x + 20x + x*2 - 54 + 0x*2 + 5x*2 - 2x*3. -2(x - 3)*2(x + 3) Let x(p) = -4p3 + 8. Let h(j) = j3 - j2 - j - 1. Let r(v) = 3h(v) + x(v). Let y(u) be the first derivative of r(u). Factor y(b). -3(b + 1)2 Let h(j) = -193j - 1737. Let d be h(-9). Factor -3s2 - 3s*3 - 3/4s*4 + 0s + d. -3s2(s + 2)*2/4 Let 1/5u*4 + 5u + 0 + 7u2 + 11/5u*3 = 0. Calculate u. -5, -1, 0 Factor 75/2x*3 + 0 - 6x + 0x2. 3x(5x - 2)(5x + 2)/2 Determine c so that -4c2 - 144/7 - 120/7c - 2/7c3 = 0. -6, -2 Let j be (-88)/(-24) + (-4)/6. Factor w2 + w4 + w5 + 0wj - w3 - 2w2. w2(w - 1)(w + 1)2 Let c(h) = -6h - 9. Let i be c(-2). Solve w5 - w2 - 2w2 - 3w*i + 2w*5 + 3w*4 = 0 for w. -1, 0, 1 Let 8192/7 + 0r*3 + 0r - 256/7r2 + 2/7r4 = 0. Calculate r. -8, 8 Let k(t) be the third derivative of t7/105 - 2t6/15 + t5/2 + t2 + 6t. Suppose k(h) = 0. Calculate h. 0, 3, 5 Suppose -3g - 27p + 31p - 12 = 0, -9 = g - 3p. Solve 8/7a - 2/7a*5 + 8/7a*2 - 6/7a*3 - 8/7a4 + g = 0. -2, -1, 0, 1 Let f(u) = u3 + 3u2 + 7u - 3. Let w(g) = -3g2 - 6g + 3. Suppose 3j - 4 + 16 = 0. Let y(z) = jw(z) - 3f(z). Let y(i) = 0. Calculate i. -1, 1 Let o(k) be the first derivative of k3/27 - 22k*2/9 + 484k/9 - 187. Solve o(y) = 0 for y. 22 Let c be 32/(-18)279/(-310). Factor 4/5z*2 + 2/5z*3 + c - 14/5z. 2(z - 1)2(z + 4)/5 Let y(b) be the third derivative of -2/15b*3 + 0	{ "pile_set_name": "DM Mathematics" }
7l - 126. Let j be q(6). Let t(k) = -1218 - 1218 + j - k. Let v(g) = -48g*2. Determine t(v(x)). 48x*2 Let r(g) = 2g - 23. Let t(m) = 549778m. Give r(t(x)). 1099556x - 23 Let w(g) = 17g. Let n(q) = 10q*2. Let s(i) = 9i*2. Suppose 0 = 15k + 6k + 63. Let b(z) = kn(z) + 4s(z). Determine w(b(d)). 102d*2 Let u(g) = -18g + 824. Let f(p) = 602p. Calculate u(f(q)). -10836q + 824 Let g(p) be the second derivative of -87p3/2 - 3p*2/2 + 4p - 234. Let m(l) = -4l2. What is m(g(x))? -272484x*2 - 6264x - 36 Let f(c) = 9c. Let k be (4752/(-90))/(3/(-10)). Let w(a) = a2 - a + 85. Let z be w(0). Let y(s) = z + 91 - k + 8s. What is y(f(i))? 72i Let q(c) be the third derivative of 17c*4/24 + 75c*2 + 2c + 100. Let u(l) be the second derivative of l*4/4 - l. Give q(u(y)). 51y*2 Let h(y) = -72512963y. Let i(d) = -d*2. What is i(h(k))? -5258129803039369k*2 Let f(m) = -3m - 5m - 639 - 4m + 641 - m. Let j(a) = -27a2. Determine j(f(g)). -4563g*2 + 1404g - 108 Let v(r) be the second derivative of -r*6/720 - 4r*4/3 + 56r + 1. Let s(y) be the third derivative of v(y). Let b(u) = 6u2 + 17u. Calculate s(b(a)). -6a2 - 17a Let z(u) = 272u. Let w(s) = -425s*2 + 105. What is w(z(k))? -31443200k*2 + 105 Let p(b) = 104b. Let q(w) = 5w2 + 6178w - 1. What is q(p(y))? 54080y2 + 642512y - 1 Let m(h) = -h*2 - h + 1. Let v(t) = 7t - 2 - 8 - 5 - 10 + 18. Let z = 1 - 0. Let j(d) = zv(d) + 7m(d). Let q(u) = 8u. Calculate q(j(n)). -56n*2 Let w(b) = 7b*2. Let c(o) = -287o + 7. Let h(f) = 143f - 3. Let t(k) = 3c(k) + 7h(k). Calculate w(t(p)). 137200p*2 Let j(k) = 12k2. Let c(i) be the second derivative of -i5/60 - 23i2 + 25i. Let o(z) be the first derivative of c(z). Calculate o(j(m)). -144m4 Let f(a) = -a3 - 5a*2 - 20a - 150. Let c be f(-6). Let i(w) = 6440 - 6440 - 27w2 - cw. Let z(p) = -2p2. Determine i(z(r)). -108r*4 + 12r*2 Let g(q) = -41q - 3. Let p(i) be the first derivative of i*3 - 543. Calculate g(p(z)). -123z*2 - 3 Let f(n) = -2n. Let o(p) be the second derivative of 1061p4/6 - 11p + 74. What is o(f(d))? 8488d2 Let z(c) be the second derivative of 0c*3 + 1/4c*4 - 25c + 0 + 0c2. Let p(i) = -2i*2 + 33 - 33. What is z(p(b))? 12b*4 Let q(o) = -12o*2. Let f(y) = 1942 + 2015 - 3957 - 164y*2. Determine q(f(h)). -322752h4 Let h(w) = -w2. Let u(q) = -2q + 5. Let g(a) = 9a - 256. Let b(o) = 2g(o) + 10u(o). Give h(b(s)). -4s2 - 1848s - 213444 Let f(a) = 2a2. Let d(v) = -2166328v. Calculate f(d(z)). 9385954007168z2 Suppose 0 = -106w + 113w - 861. Let z(j) = 248j*2 - 126j*2 - wj2. Let n(l) be the third derivative of l4/2 - l*2. Calculate n(z(x)). -12x*2 Let v(p) = -241p. Let t(h) = -310h2 - 553h. Give v(t(x)). 74710x2 + 133273x Let y(p) = -196p + 272. Let c(x) = -x + 2. Determine c(y(u)). 196u - 270 Let y(h) = -2h2. Suppose -5p + i = -10p + 28995, -2p + 4i + 11620 = 0. Let k(o) = -po + 5800o - 80o*2. Determine y(k(r)). -12800r*4 Let y(j) be the first derivative of 4j*3/3 + 23j*2/2 + 2230. Let c(m) = -9m*2. Calculate y(c(s)). 324s*4 - 207s*2 Let l be (1/12 + 0)/((-1071)/(-4284)). Let p(b) be the second derivative of 0 + 44b + 0b2 + lb*3. Let t(r) = -37r. Determine p(t(i)). -74i Let n(y) be the second derivative of 25y*4/4 - 2768y. Let k(z) = 11z2 - 3. Calculate k(n(f)). 61875f*4 - 3 Let b(u) be the first derivative of 107u*2/2 - 811. Let a(j) = -2j + j + 2j. What is b(a(o))? 107o Let w = 137 - 123. Suppose f - wx + 10x = 79, 0 = 3f + 4x - 317. Let y(m) = fm2 + 132m - 132m. Let h(l) = -2l. Determine y(h(j)). 396j2 Let n(f) = 8f*2. Let z(j) = -46j - 14. Let l(m) = -504m - 160. Let p(k) = 2l(k) - 23z(k). Calculate n(p(r)). 20000r*2 + 1600r + 32 Let j(s) = -104s. Let a(u) = -688u*2 + 7u + 1. Give a(j(b)). -7441408b2 - 728b + 1 Let a(n) = 9n + 5n - 7n. Let o(q) be the first derivative of 31q*2/2 + 68392. Give a(o(r)). 217r Let q(j) = -11j - 1. Suppose -87 + 77 = -5l. Let k(y) = -ly2 - y2 - 5 - 7 + 12. Calculate k(q(d)). -363d*2 - 66d - 3 Let s(r) = 193r. Let c(q) = -3q*3 - 14q*2 - 35q - 3. Let d be c(-7). Let b(v) = d - 585 - v. Calculate s(b(y)). -193y Let m(t) be the first derivative of -25t*3/3 + 2481. Let r(g) = -8g - 9. What is m(r(d))? -1600d2 - 3600d - 2025 Let b(a) = -8a2. Let c(j) = -31 + 443j*2 - 882j*2 + 437j*2. Determine b(c(q)). -32q*4 - 992q2 - 7688 Let f(p) be the first derivative of 9 + p2 + 0p3 + 1/60p*5 + 0p*4 - 2p. Let z(u) be the second derivative of f(u). Let d(q) = -6q. What is d(z(y))? -6y*2 Let l(h) = -36981987h*2. Let x(b) = b. Give l(x(v)). -36981987v*2 Let w(t) be the second derivative of -3t*3 + 13t. Let x(o) be the third derivative of -7o5/60 - 26o*2 - 2o. Calculate w(x(c)). 126c2 Let g(m) = 205m + 369m - 573m. Let r(c) = 6c2 + 291c. What is g(r(t))? 6t2 + 291t Let x(d) = -d. Let l(f) = -299f2 + 918f*2 - 302f*2 + 939f*2 + 130f*2. What is l(x(u))? 1386u*2 Let x(h) = 2h*2. Suppose 4s - 4j - 21 - 19 = 0, 0 = -2s - 2j + 12. Suppose -sk = -17k + 36. Let b(p) = -kp + p - 3p. Give b(x(n)). -12n*2 Let m(f) = -f. Let a(b) = -9b. Let j(x) = -5a(x) + 40m(x). Let c(p) = -12p - 99. Let l(d) = 3d + 22. Let o(s) = 4c(s) + 18l(s). Calculate o(j(v)). 30v Let o(g) = -9g - 1. Let q(b) = 2687b2 + 1. Determine q(o(l)). 217647l*2 + 48366l + 2688 Let v(k) be the second derivative of -2k3 + 0 + 1/2k*2 + 37k. Let r(q) = 3q2. Calculate r(v(b)). 432b*2 - 72b + 3 Let d = -27 + 37. Suppose 0 = 8o - do + 28. Let a(r) = -o - 8 - r*2 + 22. Let p(f) = -8f*2. Give a(p(x)). -64x4 Let a(r) be the first derivative of r5/60 - 19r4/24 - 33r*3 + 59. Let d(g) be the third derivative of a(g). Let m(p) = 2p*2. Determine d(m(u)). 4u*2 - 19 Let l(b) = -507060b. Let h(y) = -2y2. Give h(l(w)). -514219687200w*2 Let y(h) = -1364h. Let k(w) = 230w - 8. Let g(r) = -259r + 9. Let j(z) = -8g(z) - 9k(z). Calculate y(j(b)). -2728b Let y(j) = -19j. Let m(p) = 11675367p. Give y(m(a)). -221831973a Let l(n) = -8n2 - 15n*2 + 34n2. Let d(i) be the second derivative of -i4/6 + 29i. Calculate l(d(c)). 44c*4 Let b(l) = 2l + 5. Let p(g) be the third derivative of g4/24 + g3/2 - 10g2 - 4g. Let d(o) = -6b(o) + 10p(o). Let t(i) = 56i. What is d(t(j))? -112j Let d(o) = 4o - 53. Let m be d(12). Let p(a) = -a - 10. Let r(h) = -h - 14. Let t(x) = mr(x) + 7p(x). Let b(v) = -14v*2. Calculate t(b(z)). 28z*2 Suppose 0 = y - 4y - 3. Let v(c) = -c*2 + 1. Let t(g) = 5g*2 - 3. Let i(f) = yt(f) - 3v(f). Let a(x) = -1 - 3 + 4 + x. What is a(i(z))? -2z*2 Let c(m) = 36m*2. Let d(w) = 632285w*2. Calculate c(d(l)). 14392235564100l*4 Let l(u) = -13u*2 - 8u*2 + 36u*2 + 15u - 6u2 - 6u*2. Let h(x) = 28x. Calculate h(l(i)). 84i2 + 420i Let g(k) = 23k - 45. Let f(h) = 64h - 126. Let b(d) = 5f(d) - 14g(d). Let c(w) = 3w - 1215. Determine b(c(o)). -6o + 2430 Let v(a) = -19a - 42. Let s(w) = -7w - 12. Let y(u) = 7s(u) - 2v(u). Let m(g) = -36g + 56g - 40g. What is m(y(p))? 220p Let c(i) = -i*2. Let b(m) = 102669614m. Give b(c(u)). -102669614u2 Let j(t) = -7t*2. Let d be (0(3 - 60/18))/(-2). Let i(v) be the first derivative of 16 + 1/2v2 + dv. What is j(i(w))? -7w2 Let a(n) = -13n*2 + 0 + 1 + 2. Let r(z) = 7z*2 - z - 2. Let k(b) = 41b*2 - 6b - 12. Let q(m) = k(m) - 6r(m). Give a(q(d)). -13d*4 + 3 Let r(g) = 26g*2. Let o(s) = -573s + 98. Let f(w) = 2673w - 462. Let b(y) = -7f(y) - 33o(y). Give r(b(h)). 1019304h*2 Let r(t) = -5t*2 + 5t + 848. Let a(z) = -7z + 1. Determine r(a(k)). -245k*2 + 35k + 848 Let t(d) = -1675d. Let k(h) = 2h*2 + 4455. Calculate t(k(o)). -3350o2 - 7462125 Let q(s) = s2. Let a(y) = 2y - 10 + 7y - 4y - y. Let l be a(3). Let j(f) = 11f*2 + 3 + 12f*l - 3. Give j(q(i)). 23i*4 Let t(b) = 40b*2. Let s(j) = 3j*2 - 7j - 8. Let k be s(-1). Let z(n) = 47n2 - 1 - 46n*k + 1. Give t(z(q)). 40q*4 Let d(t) = -5t + 22. Let u(n) = -36n + 165. Let z(b) = -30d(b) + 4*u(b). Let	{ "pile_set_name": "DM Mathematics" }
76) + 0) + 1 + (sqrt(76) - ((1sqrt(76) - sqrt(76)) + 3)) + 5)3)*2. 1944sqrt(19) + 25353 Simplify (5(0 + 2((sqrt(1088) - (-1 + sqrt(1088) - sqrt(1088) - sqrt(1088))) + -2 + sqrt(1088) + 0 + sqrt(1088) + -5 + -2)))*2. -51200sqrt(17) + 1747200 Simplify ((12sqrt(95) - (sqrt(95) - -51sqrt(95) - sqrt(95)))/((5sqrt(80)/sqrt(2))/(sqrt(288) - sqrt(288)-1)))*2. 24624/25 Simplify 4 + 2(6(-2 + 2sqrt(1584) + (sqrt(1584) - (sqrt(1584) + 1))-6)2 + 2) + -1. 2304sqrt(11) + 76231 Simplify (((5sqrt(44)2 - sqrt(44)) + sqrt(44))/((sqrt(112)/sqrt(4))/sqrt(7)) + (sqrt(176)2 - 3sqrt(704)) + 2)*2. -24sqrt(11) + 400 Simplify (((sqrt(162)/sqrt(36))/((sqrt(90)/sqrt(3))/sqrt(10)))/(5sqrt(3)-2 - (sqrt(825) + sqrt(33) - sqrt(33) - sqrt(33))/sqrt(11)))*2. 1/392 Simplify (4(-2 + 2sqrt(396) + 1)2 - (5 + (sqrt(396) - 3(sqrt(396) + 1))2 + (sqrt(396) - (3 + 0 + sqrt(396)))2))-4. -18932 + 672sqrt(11) Simplify (5(sqrt(95)-1-4 + ((sqrt(95) + 2sqrt(95))-3 - sqrt(95) - sqrt(95))))/((2sqrt(120)/sqrt(2))/((-2sqrt(36))/sqrt(3))). 35sqrt(19) Simplify (-3sqrt(102)6 - (sqrt(102) - -5(-3sqrt(102) + sqrt(102) + sqrt(102) - sqrt(102))))/(sqrt(24)-3 - (sqrt(726)2 - sqrt(726))). 9sqrt(17)/17 Simplify (-4(sqrt(3744) + 1sqrt(3744))-4-6)/(sqrt(6)/(sqrt(33)/(sqrt(11)2)) - (sqrt(242)1 - sqrt(14)/(sqrt(28)/sqrt(4)))). 288sqrt(13) Simplify 6(1 + (sqrt(65) - (sqrt(65)12 + sqrt(65)))/sqrt(5) - -5sqrt(572)/sqrt(275))*2. 6 Simplify 5(-5 + ((-2sqrt(72))2 + -1 - (2 + sqrt(72)-1)*2) + ((0 + 1sqrt(72) + sqrt(72) - sqrt(72)) + 0 + sqrt(72) + sqrt(72)-1)2). 120sqrt(2) + 1390 Simplify (0 + -1(3 + (sqrt(833) + 0)-2 + 0))-33. -126sqrt(17) + 27 Simplify (-3 + (5(sqrt(432) + sqrt(432)1) - sqrt(432)) + 4)2 + 0 + (sqrt(33) + sqrt(132)/sqrt(36))/(sqrt(77)/(sqrt(7) + sqrt(7) + sqrt(28))). 664sqrt(3)/3 + 34993 Simplify -3((1 + sqrt(200) + 1 + sqrt(200))2 - ((sqrt(200) + 0 + sqrt(200))2 + 5))2. -480sqrt(2) + 6 Simplify ((-1 + -44(-2 + sqrt(108) + 2 + 3))-3)*2. 84672sqrt(3) + 270441 Simplify (sqrt(21)1-6)/(6(sqrt(3)1 + sqrt(3))) - (-2sqrt(7) + -2 + sqrt(343) + 2 + sqrt(343))2. -1008 - sqrt(7)/2 Simplify (0 + 5 + ((sqrt(13) + -1)3 + (1 + sqrt(325))*2 + 4)1)-4. -1328 - 52sqrt(13) Simplify (4 + ((-1sqrt(1188) + sqrt(1188) + sqrt(1188))5)/((sqrt(864) - (sqrt(864) + (sqrt(864) - -1sqrt(864))))/sqrt(2)) + -3)2. -5sqrt(11)/2 + 291/16 Simplify ((2sqrt(280)-2 - sqrt(280) - sqrt(280))/(6sqrt(72)))/(-1(sqrt(180) - (-1(sqrt(180) + sqrt(180)2) + sqrt(180)))). sqrt(7)/54 Simplify (sqrt(198)/sqrt(396))/(2(sqrt(6) + sqrt(24))) - 5((sqrt(120)/sqrt(4)-5)/sqrt(10) + -5)2. -500 - 8999sqrt(3)/36 Simplify (4 + sqrt(176) - sqrt(11)-2-6 - ((-3sqrt(121))/sqrt(11) + sqrt(11) - (2 + sqrt(396))))2. 36 Simplify (((sqrt(252)/(sqrt(4)-2))/(sqrt(12)/(sqrt(4) + 1sqrt(4))))/((sqrt(567) - (sqrt(567) + sqrt(567)-1))/((sqrt(225)/sqrt(5))/sqrt(5))))*2. 1/3 Simplify (-1(0 + (sqrt(1539) + -6sqrt(1539)3 + -3 - (sqrt(1539) + 1 + 4 + -2 + sqrt(1539)2))))2. 2160sqrt(19) + 615636 Simplify (sqrt(209) + 53sqrt(209) - (2sqrt(209) + sqrt(209))-1)/(2-1sqrt(891)-4). 19sqrt(19)/72 Simplify ((-41sqrt(170)15)/((-3-2sqrt(80))/((sqrt(56)1)/sqrt(7)))2)*2. 6800/9 Simplify ((5 + -2 + sqrt(52) + 5 - (sqrt(4212) - (sqrt(4212) + 1)-4)) + -5)*2 + -1. 176sqrt(13) + 100672 Simplify ((sqrt(1800)4-5 + sqrt(1800))1)/(sqrt(110)/(sqrt(77)/sqrt(7) + sqrt(11)) + sqrt(10)3-4). 228sqrt(5)/23 Simplify ((1 + sqrt(13) + -1)1 - (-2 + sqrt(117) + 0) - ((sqrt(52) + 1)6 - ((sqrt(117) - sqrt(117)-2) + 4)))2. 325 Simplify 2((sqrt(80)-1)/sqrt(4) + sqrt(2420)-1 + sqrt(20))/((((-2sqrt(40) - sqrt(40)) + sqrt(40))6)/sqrt(4))3. 11sqrt(2)/2 Simplify ((-3sqrt(54)-2)/(sqrt(243)2 + sqrt(3) + (sqrt(3) - (sqrt(36)/sqrt(3) + sqrt(12))/sqrt(4)))-5)*2. 50 Simplify ((3 + sqrt(108))55)2 + ((sqrt(168) - (sqrt(168) - (sqrt(168) + -1sqrt(168) - sqrt(168))))/sqrt(7))/(sqrt(40)/(sqrt(15)/sqrt(3))). 22499sqrt(3) + 73125 Simplify 1((sqrt(132) - (sqrt(132) + sqrt(132)-2)-5) + sqrt(132)2-5)/((6(sqrt(24) + sqrt(96)/sqrt(4)))/sqrt(2)). -7sqrt(11)/6 Simplify -6(5 + 1 + (5 + 5 + (sqrt(720) - (5 + 2 + sqrt(720) - sqrt(720))) + sqrt(720))2 + 5). -17400 - 864sqrt(5) Simplify (-5sqrt(68)4 + -6(-4sqrt(68) + sqrt(68) - sqrt(68)))/(4(sqrt(196) + sqrt(196)1)1). sqrt(17)/14 Simplify (2(4 + sqrt(242) + 0 + sqrt(242)) + 4 + 5 + -2sqrt(242))2. 748sqrt(2) + 1257 Simplify (-5(2sqrt(99) + sqrt(99) + 4) - (-4 + sqrt(11) - sqrt(11))-3-3-3)2. 11520sqrt(11) + 38659 Simplify (-6sqrt(108)-56 + (sqrt(27)/(sqrt(9) - 4sqrt(9)) - sqrt(3267)/sqrt(9)))-3. -3206sqrt(3) Simplify -2(((sqrt(832) - (sqrt(832) - -5(sqrt(832) - (sqrt(832) + -1)))) + 3)*2 + sqrt(832) + -1 + 2 + -3 + -1 + sqrt(832))6 + -3. -192sqrt(13) - 15 Simplify (-5 + (sqrt(38)/(sqrt(200) + sqrt(200)5) - sqrt(57)/((sqrt(21)-1)/sqrt(7))) + 3)2. -61sqrt(19)/15 + 85099/3600 Simplify ((((3(1sqrt(91) - sqrt(91)) - sqrt(91)) + -4sqrt(91)-1)/(sqrt(35)/((sqrt(5)-3 + sqrt(5))-6 + sqrt(5))))*2 + 3)-3. -59328 Simplify -5(((-2sqrt(540))/sqrt(10))/((sqrt(288)/sqrt(128))/sqrt(12)))*2 + 1. -5759 Simplify -2 + (-3 + (2sqrt(325) + 2 - sqrt(325))6 + (6(sqrt(325) + -1) - (sqrt(325) + 1 + sqrt(325) + -1 + sqrt(325))))*2. 270sqrt(13) + 26332 Simplify -1 + 1 + -2 + sqrt(275) + -2(-2 + sqrt(275) + (-1sqrt(275))*2) + 0. -548 - 5sqrt(11) Simplify (-5 + (sqrt(110)/sqrt(160) + -1 - (sqrt(539) + 1 + sqrt(539) + sqrt(539) - sqrt(539))*2-6) + 5)-6. -77646 - 2019sqrt(11)/2 Simplify ((6sqrt(720)5)/sqrt(12))/(5(sqrt(48)/sqrt(4) + sqrt(12)) - 5((sqrt(12)-2 - sqrt(12)) + sqrt(12))). 3sqrt(5)/2 Simplify ((sqrt(8) + -5 + (2sqrt(2) - sqrt(2)) + 3)4 - (sqrt(2592) + 1 + -1 - sqrt(2592)))*24. -768sqrt(2) + 1408 Simplify (((sqrt(468) + sqrt(468)2-4)/(-2sqrt(192)))/(((sqrt(9) - sqrt(36)/sqrt(4))-2 - sqrt(9))/sqrt(3)6))*2. 637/2304 Simplify ((sqrt(1053) + sqrt(1053) + -5 + sqrt(1053))-3)*2 + -5 + (sqrt(1053) - (5 + sqrt(1053) + -1)) + (-2sqrt(1053))*2 + 1 + sqrt(1053) + -5. -2421sqrt(13) + 89717 Simplify ((sqrt(171)-44 - sqrt(171)) + (sqrt(171) + (sqrt(171) + sqrt(171)1)4 - sqrt(171)))/(-5-2sqrt(225) - -6sqrt(225)-1). -9sqrt(19)/20 Simplify (2(sqrt(2736) - (5 + sqrt(2736) + 1)) - (-1 + (-1sqrt(2736) + sqrt(2736))2)-1)-6 + -4. 74 Simplify (2(sqrt(209) - sqrt(209)4-1)5)/((1sqrt(110)5 - sqrt(110))/(sqrt(10) - (sqrt(10) + 6sqrt(10)1))). -75sqrt(19) Simplify (((2(-2sqrt(13)1 + (sqrt(208) - sqrt(13))5))*2 - (3 + (6(sqrt(52) + 2))*2)) + -1)6. -1728sqrt(13) + 40608 Simplify ((-2sqrt(5100) - sqrt(5100))6 + (sqrt(5100) - -1(sqrt(5100)-1 + sqrt(5100) + sqrt(5100))))/((sqrt(90)/(sqrt(24)/sqrt(4)))/(sqrt(15)/sqrt(48))). -40sqrt(17) Simplify ((-1sqrt(68)-6)*2 - (1 + sqrt(68)2)) + (sqrt(612) + -1 + 1 - (-3(sqrt(612) + 2))2) + -4. -3101 - 214sqrt(17) Simplify 6(4 + sqrt(21)/sqrt(3) + -5)2 - (-5 + (11sqrt(77) - sqrt(77))/sqrt(11)). -12sqrt(7) + 53 Simplify 2(-3-6sqrt(684) + 2 + -5(-5 + 2-3sqrt(19)))*2. 14904sqrt(19) + 725130 Simplify (-4-1sqrt(136) - -5(sqrt(136)-2 + sqrt(136)))/(4(sqrt(968) - sqrt(968)2) + (1sqrt(968)6 - sqrt(968))). -sqrt(17)/11 Simplify 3(-1sqrt(225)-5)/(2sqrt(36)/(sqrt(12)2))-1. -75sqrt(3) Simplify (sqrt(240)/(sqrt(10) + sqrt(30)/sqrt(3)))/(sqrt(12) + 3(sqrt(12) - sqrt(192))) + (1(1 + -5 + sqrt(200)))2. -1281sqrt(2)/16 + 216 Simplify (4-1(2sqrt(1539)1-4 + -6sqrt(1539)-1 + sqrt(1539) + -3 + sqrt(1539)2))*2 + -2. -864sqrt(19) + 24766 Simplify (-5(-4 + (1sqrt(405)2 - 2sqrt(405)-4)))2-6 + -3. -6077403 + 108000sqrt(5) Simplify (((sqrt(10) - sqrt(640)) + sqrt(10))1 + (sqrt(1000) - sqrt(1000)-1) + sqrt(1000))/(sqrt(20)/sqrt(16) - (sqrt(10)/sqrt(2)-5 - sqrt(5))). 48sqrt(2)/13 Simplify ((-3(-1 + sqrt(304))3 - (-4 + (sqrt(190)/sqrt(160) - (sqrt(304) + 0))))2 + 5)5. -8385sqrt(19)/2 + 1594815/16 Simplify (-4 + sqrt(2299) + sqrt(2299)-4 + sqrt(2299) + -2 + -4 + 4 + -1)*2. 308sqrt(19) + 9245 Simplify (-53sqrt(119)-2-3)/(-5sqrt(14)/sqrt(2) - sqrt(35)/sqrt(245)). 35sqrt(17)/2 Simplify ((1sqrt(88)2)/(sqrt(72) - sqrt(72)-1) - (-3sqrt(11) + 4 + -5	{ "pile_set_name": "DM Mathematics" }
-39409304 divided by 38942 -1012 Divide 76700832 by 8528. 8994 What is -8822656 divided by -16? 551416 8431161 divided by 2 8431161/2 Divide -1529371 by -90. 1529371/90 Divide 843 by 3100. 843/3100 What is -3474391 divided by 84? -3474391/84 Calculate -272366691 divided by -272366691. 1 Divide 21 by -43967178. -7/14655726 295 divided by 20443 295/20443 Calculate 748817100 divided by 265068. 2825 Divide -448832580 by 14370. -31234 17191332 divided by -3 -5730444 What is 414887957 divided by -2? -414887957/2 10796370 divided by -3 -3598790 Calculate -296175 divided by 334. -296175/334 What is -9458278 divided by -6? 4729139/3 What is -2464902 divided by 18? -136939 What is -1631 divided by -130697? 233/18671 12 divided by 4053853 12/4053853 Calculate 107318836 divided by -3. -107318836/3 -4420210 divided by 884042 -5 4 divided by -9693875 -4/9693875 Calculate -30735301 divided by 6. -30735301/6 What is -331202030 divided by -659765? 502 What is 1061460078 divided by -11802? -89939 -4102292 divided by 124 -33083 Calculate 23 divided by 1911103. 23/1911103 Calculate 3272 divided by 274. 1636/137 What is 691 divided by -3122? -691/3122 Divide 522 by -52723. -522/52723 Calculate 4822 divided by -15028. -2411/7514 Calculate -8 divided by -2021268. 2/505317 86561332 divided by 52 1664641 175 divided by -6789 -175/6789 What is -5965 divided by 1596? -5965/1596 What is -60361902 divided by -9? 6706878 -2359791466 divided by 2 -1179895733 What is 1690 divided by 11050? 13/85 Divide 5 by -13623744. -5/13623744 What is 222 divided by 7182296? 111/3591148 Divide -2435867 by 2. -2435867/2 What is 3 divided by -40693431? -1/13564477 What is -12035643 divided by 1227? -9809 Calculate 619653452 divided by 8044. 77033 Divide 109245755 by -3767095. -29 Divide 14644744 by -1830593. -8 What is -79 divided by -222421? 79/222421 Calculate -285016340 divided by -4. 71254085 79579712 divided by -19894928 -4 Calculate -25704795 divided by -12085. 2127 Calculate 95131773 divided by 120879. 787 Divide -40180843 by 7123. -5641 Divide -557843735 by 5. -111568747 -5070055 divided by 95 -53369 Calculate 6016 divided by 32463. 6016/32463 -7943096 divided by 1127 -7048 What is 1 divided by -12809478? -1/12809478 Calculate -29 divided by 210879. -29/210879 Divide 111190266 by -37063422. -3 What is -1 divided by -806337? 1/806337 Calculate -35847 divided by 62994. -11949/20998 Divide 166837216 by 64766. 2576 831418 divided by -4 -415709/2 2778 divided by -26258 -1389/13129 43254 divided by -3 -14418 What is 71784580 divided by -14356916? -5 Divide 38463904 by -5. -38463904/5 Divide -154049403 by -3. 51349801 Calculate 12399240 divided by 309981. 40 What is -204014676 divided by 2? -102007338 -61141242 divided by 30570621 -2 What is 68371603 divided by 2? 68371603/2 Divide 152469668 by 884. 172477 Calculate 8515464 divided by -3. -2838488 Calculate -1860490 divided by -372098. 5 -4020314 divided by 2010157 -2 546944 divided by -40 -68368/5 Calculate -3399 divided by 237. -1133/79 12931797 divided by 12931797 1 Calculate -3791975 divided by 758395. -5 What is 3815514 divided by 74? 51561 Calculate -735442732 divided by 5. -735442732/5 3 divided by 2073167 3/2073167 Divide -283253 by 125. -283253/125 Divide 140129028 by 323. 433836 364458698 divided by 2 182229349 What is -735041207 divided by -5? 735041207/5 Divide -38988768 by -2436798. 16 -217166 divided by -8 108583/4 Calculate 2557 divided by 8722. 2557/8722 What is -9283 divided by -715? 9283/715 175424180 divided by 35084836 5 Divide -14058 by -25561. 14058/25561 Divide 5962109 by 5962109. 1 What is -6 divided by -593647? 6/593647 Calculate 19550804 divided by -182. -107422 -48826817 divided by 13 -3755909 -13730400 divided by 6865200 -2 What is -910 divided by -26421? 910/26421 Calculate -1349472 divided by -112456. 12 Calculate -26510 divided by 163. -26510/163 Calculate -10177950 divided by 2035590. -5 10510389 divided by -3 -3503463 What is -383277299 divided by -4? 383277299/4 What is 1269444 divided by 326? 3894 Calculate 140942300 divided by -35235575. -4 Divide 28598306 by -12958. -2207 Divide -1250002 by -26. 48077 432789868 divided by -108197467 -4 2026902 divided by -6 -337817 Calculate 9057224 divided by 8. 1132153 Divide 100 by 619898. 50/309949 What is -3582352 divided by 4? -895588 Calculate -10498336 divided by 557. -18848 Calculate 17743668 divided by 5. 17743668/5 Calculate -5 divided by -172043634. 5/172043634 Calculate -7732895 divided by -2. 7732895/2 Divide -13125224 by -1. 13125224 1195924 divided by 58 597962/29 Divide 668 by 165603. 668/165603 511 divided by -4433 -511/4433 What is 2 divided by 286218242? 1/143109121 Calculate -3069360 divided by 4. -767340 What is 7644 divided by -51? -2548/17 Divide 17984 by -2118. -8992/1059 -144785 divided by 5429 -144785/5429 Calculate 67383828 divided by 71. 949068 What is -8402760 divided by -15? 560184 Calculate 4645 divided by 2449. 4645/2449 Divide -1435106 by -86. 717553/43 Calculate 0 divided by -26974145. 0 Divide -3738440 by -8. 467305 Calculate -14451192 divided by 38952. -371 What is 59816745 divided by 20705? 2889 -504307074 divided by 6 -84051179 Calculate -65 divided by 668217. -65/668217 Divide -3517344 by -531. 6624 623 divided by -2615 -623/2615 Calculate -182013702 divided by -118. 1542489 What is 3741980 divided by -10252? -365 6675764 divided by -646 -10334 24 divided by 5593 24/5593 Divide -11 by 985982. -11/985982 Calculate -51517970 divided by 23741. -2170 What is 159026334 divided by -53008778? -3 Divide 105608 by -3782. -52804/1891 Divide 1597323555 by -5. -319464711 Calculate -1008970 divided by -134. 504485/67 -229585428 divided by -172 1334799 What is 207036 divided by 56? 51759/14 Divide 21642122 by -2. -10821061 -3377580 divided by 3377580 -1 -477146592 divided by 288 -1656759 Divide 15469 by -30337. -15469/30337 -11426844 divided by 11 -1038804 What is -4 divided by -38206897? 4/38206897 Divide -42520066 by 698. -60917 What is -17 divided by -876582? 17/876582 What is 11730846 divided by -6? -1955141 101596803 divided by 1319439 77 Divide 51219 by -29. -51219/29 -79 divided by 25375 -79/25375 Calculate -36393568 divided by 3. -36393568/3 18973289 divided by -2 -18973289/2 What is -99008 divided by -5080? 12376/635 Calculate 286 divided by 518049. 286/518049 -53968544 divided by -13492136 4 Calculate 0 divided by -674310. 0 Divide -229209546 by 38201591. -6 What is -50328264 divided by 42? -1198292 Calculate -192009945 divided by 64003315. -3 What is -49553900 divided by -50? 991078 13559624 divided by -26 -521524 Divide -11320128 by 192. -58959 64893934 divided by -888958 -73 Divide -4 by 31723310. -2/15861655 30 divided by 5298336 5/883056 Divide 294367 by -23. -294367/23 What is 122088 divided by 52? 30522/13 14 divided by -15625660 -7/7812830 What is -25723 divided by 595? -25723/595 -30996214 divided by 2 -15498107 -21993822 divided by 54 -407293 167 divided by -104917 -167/104917 Divide -5 by -47251945. 1/9450389 What is 71245656 divided by -1979046? -36 What is -5080240 divided by -1012? 5020 -1811135 divided by 6 -1811135/6 What is -8111484 divided by 139? -58356 Divide 33832532 by 7223. 4684 What is -2007578304 divided by -4? 501894576 Divide -51668126 by 2. -25834063 What is -24553627 divided by -119? 206333 What is 1127558 divided by 143? 1127558/143 What is 1050145 divided by -13? -1050145/13 What is -10028520 divided by -3342840? 3 Divide -732 by 87307. -732/87307 -1525829 divided by 1525829 -1 Divide 10 by -2763883. -10/2763883 What is -5841375 divided by -13875? 421 -52 divided by 288506 -26/144253 Calculate 39241234 divided by 19. 39241234/19 Calculate -285395733 divided by -1. 285395733 Calculate 3 divided by -26984131. -3/26984131 What is 5 divided by -2885279? -5/2885279 Calculate -34112700 divided by -758060. 45 What is -4 divided by -682448? 1/170612 2190180 divided by 60 36503 What is 31312 divided by 853? 31312/853 Calculate -22 divided by -5980295. 22/5980295 Divide 34478496 by 2652192. 13 638204 divided by 46 13874 Calculate 31 divided by -31327. -31/31327 -46755961 divided by -4 46755961/4 -97110349 divided by 7 -13872907 -11067678 divided by -9 1229742 Divide -2 by -196450303. 2/196450303 Calculate -14	{ "pile_set_name": "DM Mathematics" }
(-2 - 2a + 2 + (1 - 1 - 1)(0 + 0 + 2a)). 4a*2 - 8a Expand (-2a + 0a + 4a)(a + 4a - 3a)(20a - 15a + 33a)(-2a - 4a + 5a). -152a4 Expand (-3 + 3 - 2a)(3 - 3 - 2) + (5 - 3 - 1 - 1 + 2 - 3 + (-3 - 3 + 4)(2 + 0 - 1))(2a + 0a + 0a) + 3a + a - 3a. -a Expand (-3 + 1 + 1)(6j - 3j - 2j - 1 + 1 - j + (5j - 3j + 0j)(0 + 2 + 0) + 0j + 4j - 2j)(-8 + 44 - 21). -90j Expand (g + 4g - 3g)(-26g + 68g - 17g) - 2g + 2g - 2g*2 - 4g*2 + 5g*2 + 2g*2. 51g*2 Expand (2 + 0z + 0 - z)(96z - 79z - 510z - 2). 493z2 - 984z - 4 Expand (-1 + 1 + 2k)(k + 2k - k) + 11 + 25k2 - 11 + 1 - k2 - 3k2 + 0k*2. 25k*2 + 1 Expand -7 + 3j2 + 5 - j - j2 + (j + 2j - j)(0j + 8j - j) + 0j2 - j2 - j2. 14j*2 - j - 2 Expand ((0 - 3 + 1)(-x + x + x) + 37 - 69x - 37)(-5x + 3x + 3x). -71x*2 Expand (-3 + 0 + 4)(-2 + 3 + 2)(-2r + 2r + 6r) + (-2 + 6 - 2)(-2r - 3 + 3) + 4r + 2r - 5r + 1 - r - 1. 14r Expand (1 - 4 + 1)(-84k + 83 - 83)(-1 + 2 - 4)(-2 + 1 + 3). -1008k Expand (2n + 0n + 0n)(6n - 2n - 2n)(-3n*2 + 3n*2 - 2n*2)(2n - 3n - 2n). 24n*5 Expand (-542 + 67 - 26)(b*2 - 4b*2 + 4b*2). -501b*2 Expand (-4a*2 + 5a*2 - 3a*2)(-7 + 0 - 1)(a - 3a + 3a). 16a*3 Expand (0k*2 + 3k*2 + 18k*2)(6 - 5 + 4)(1 - 1 - 2). -210k*2 Expand -7a2 + 75 + 69 - 145 + a2 + 0 + 0 + (-2a + 3a - 4a)(3 + a - 3). -9a2 - 1 Expand 3x - 2x5 - 3x + (6x - x - 3x)(-2x4 + x2 - x*2) + (-10x*4 - 6x*4 + 5x*4)(-8x - 6x + 5x). 93x*5 Expand 0u4 + u4 + 0u4 + (-2u*2 + 5u2 - u2)(3u*2 - 4u*2 + 2u*2) + (3u - 5 + 5)(3u*3 - 5u*3 + 4u*3)(10 - 5 - 4)(-2 - 1 + 0). -15u*4 Expand (-525 - 582 + 67)(2j - j - 3j). 2080j Expand (-3 - 4 - 4)(59j3 + 783j*2 - 783j*2). -649j*3 Expand (-12p - 4p - 24p)(-10 - 1 + 1). 400p Expand (4l + 0l - 2l)(4 - 10 + 7)(1 + 4 - 2)(-6l3 - 5l*3 + 5l*3). -36l*4 Expand (2 + g - 2)(5 - 2g4 - 5) - 76g*5 + 16g*5 - 35g*5. -97g*5 Expand (-270j*2 + 2j + 51j2 - 4j)(10j - 4j2 - 10j). 876j4 + 8j*3 Expand (2r*3 - 1 + 1)(-3 + 0 + 4) + 1 - r*3 - 1 - 30 + 30r*3 + 30. 31r*3 Expand (-16l*2 + 4l*2 - 6l*2)(-4l + 3l + 6l). -90l*3 Expand -9k*2 + 9k*2 + 3k*4 + (-2k*3 + 6k*3 - 2k*3)(-7k - k + 6k - 3) - k*4 + 2k - 2k + (0k + 5k - 4k)(-6k*3 + 4k*3 + 0k*3). -4k*4 - 6k*3 Expand 2b*4 - 4b*4 + 0b4 + (-b2 + b - b)(5b2 - b2 + 3b2)(4 - 6 + 1 - 1 + 0 - 1 + (0 + 0 - 1)(0 - 1 - 1) + 0 - 1 - 2). 26b*4 Expand (-33s*2 + 76s*2 + 145s*2)(s + 2s - 2s). 188s3 Expand 1 - 1 + i3 + (0i - 2i + 4i)(-2i2 - i2 - i*2) + 4i*3 - 3i*3 - 6i*3. -12i*3 Expand (t + 6t*4 + 1 - 3t*4 + t)(6 - 2t - 6 + 2t + 0t + 0t + (0 + 0 - t)(-3 + 1 + 1)). 3t*5 + 2t*2 + t Expand ((2 + 4 - 4)(3j2 - 3j2 - j2) - j2 - j2 + j2 + j2 - 6j2 + 3j*2)(2j - j + j + 2j + 0j + 2j + (-j - 4j + 6j)(-21 - 8 - 12)). 175j*3 Expand (-163w - 7w2 + 163w)(2w*2 - 4w*2 + 6w*2) + 0w*2 + 0w*2 - 2w4 + (-w2 - 5w2 + 5w*2)(2 + 2w2 - 2). -32w4 Expand (b2 - 5b2 + 3b*2)(11 - 18 + 10)(b + 2b - 2b)((6b - b - 2b)(-b + 2 - 2) - 5b*2 + 2b*2 + 2b*2). 12b*5 Expand 1790l*3 - 951l*3 - 906l*3 + 6 + (2l2 + l2 - 4l2)(2l + 4l - 4l). -69l*3 + 6 Expand (-2 + 2 - c)(1325 + 373c2 - 1325) + 4c*3 - 3c*3 - 3c*3. -375c*3 Expand (-1 + 0 + 0)(-2257g2 - 2251g*2 + 3659g*4 + 4508g*2). -3659g*4 Expand (14s + 104 - 104)(0s*2 + 0s*2 + 2s*2)((1 - 2s - 1)(s + 1 - 1) - 3s2 - 3s*2 + 4s*2 - 65 + 23s*2 + 65). 532s*5 Expand 4 - d - 4 + (4 - 2 - 5)(-10 + 10 - 6)((1 - 1 + 1)(3d - 2d - 3d) - 2d - 3d - 4d). -199d Expand (3 - i3 - 3 + (4i*3 - 6i*3 + 4i*3)(-2 + 2 - 1) - i*3 + 0i3 - i3)(i2 - 133i - 4i2 + 128i). 15i5 + 25i*4 Expand (v + 3v*2 - v)(23v2 - 33v*2 - 43v*2) - 6v*4 + 3v*4 + 2v*4. -160v*4 Expand (9 - 20 + i + 7)(-2i - 2i - 3i). -7i*2 + 28i Expand (-33 + 40 + 17)(-3g + 15 + 8g - 6g). -24g + 360 Expand (2l - 4l + 3l)(-3l + 2l - l) + l + l2 - l - 6l*2 + 5l*2 + 4l2 - l2 - l*2 + 3l2 + l2 + 4l2 - 4l*2 + 2l - 23. 4l2 + 2l - 23 Expand 2f4 + 1 - 1 + (4f*4 - 5f*4 + 0f*4)(-1 + 2 + 0) - 5f4 - 4f*4 + 2f*4 + (2f*3 - 3f*3 + 0f*3)(-5 + 11f - f - 8f). -8f4 + 5f*3 Expand (3b*3 - 3b3 + b3)(3b + 4b - 4b + (-5 + 4 - 2)(-7b + 3b + 6b)(-2 + 0 + 4)). -9b*4 Expand (-1381 + 689 + 667 - 2k*2)(0k - 3k - 2k). 10k*3 + 125k Expand (2b - 2b - 2b)(0 - 2b + 0) - 3b2 - b2 + 3b2 - 68 + 68 + 2b + 4b2. 7b*2 + 2b Expand (-o - o - 3o)(-6o - 13o*2 + 6o) - 3o - 3o*3 + 5o + 8o3. 70o*3 + 2o Expand (-3s2 + s2 + 0s*2)(4 + 6 - 4 + (-3 + 2 - 1)(-3 + 0 + 1))(-7 + 0 + 0). 140s2 Expand -111x - 3x4 + 111x + x*2 + (0x + 4x - 2x)(-24x*3 + 35x*2 - 35x*2). -51x4 + x2 Expand (-7 + 6z + 7)(0 + 3 - 2) + (-10 - 3 + 8)(-z - 1 + 1). 11z Expand (2 - 4 + 3)(4s*3 + 0s*2 + 0s*2) - 6s*2 + 126s*3 + 6s*2 + 41s*3. 171s3 Expand (-3 + 3 + c2)(-5c - c*2 + 5c) + (0c + 0c - 3c2)(10c2 + 15c*2 + 14c*2) - 2 + 2 - 2c*4. -120c*4 Expand (0 - 2 + 0)(28t + 89 - 89)(4t - 4t - 4t + (0t + 2t - t)(-1 + 0 + 0) + t + 2t - t). 168t*2 Expand (-55l*3 - 9l*3 + 26l*3)(2 - 4 + 3)(1 + 3 - 5). 38l*3 Expand (3 - 4 - 2 + 3b*2)(8b - b - 6b). 3b3 - 3b Expand (56v + 44 - 53v - 44)(-9 - 4v + 9). -12v2 Expand (-2 + 5 - 6)(2s2 - 64s*3 + 28s*3 + 34s*3). 6s*3 - 6s2 Expand (-p4 - p*4 + 3p*4)(-4p + 4p + p)(-166 + 82 + 75)(-1 + 1 + 3)(5 - 2 - 2). -27p*5 Expand (2u - 6u + 0u)(3 - 3 - u2 + (1 + 2 - 2)(-2u - 2u*2 + 2u) + 0 - 2u2 + 0 + 2u*2 + 3u*2 - 6u*2 - 1)(3u - 4u - 3u). -96u*4 - 16u*2 Expand (2 + 2v + 2 + 1)(-55v*2 + 98v*2 + 238v*2). 562v*3 + 1405v*2 Expand (-i + 3i - i)(2 + 1 - 4) - 127 - i + 127 + 2 + i - 2. -i Expand -4s*2 - 4s*2 - 3s*2 + (-5 + 5 - 2s)(0s + s + s). -15s2 Expand -1000b*2 + 51b*2 - 179b*2 + (2b*2 - 2b + 2b)(1 + 1 - 1) + 2b2 - 2b*2 + 2b*2. -1124b*2 Expand (0n + 0n - n2)(4 + 77n - 2 - 79n)(6n - 4n + 2n). 8n4 - 8n*3 Expand (2 - l - 2)(l*2 + 0l*2 + 0l*2) + 493l - 27l3 + 8l*3 - 489l + (6l - 6l - 3l)(2l2 - l2 - 2l*2). -17l*3 + 4l Expand (571f3 - 2845f + 2845f)(-f*2 + 0f*2 + 0f*2). -571f*5 Expand (2 + 0 - 3)(-2 + 16z + 166z + 38z) + 0 + 2z + 0. -218z + 2 Expand (-16x + 1515 - 1515)(4x*3 - 2x*3 - 4x3) + x4 + x4 - x4 + (-x2 - x2 + 4x2)(-3 - 2x2 + 3) - 6x*4 + 0x*4 - 5x*4. 18x*4 Expand (2o + 1 - 1)((2o*3 - 2o*3 + 2o*3)(-3o + o + 0o) + (2o2 + 0o*2 - 4o*2)(4o2 - 5o*2 + 3o*2)). -16o*5 Expand 0 + 2t2 + 0 - t2 + 2t2 - 2t*2 + (3 - 1 - 4)(t - t - 2t2) + 14t*2 + 2t*2 + 7t*2. 28t*2 Expand -6 - 6h*2 + 6 + (3h - 4h + 2h)(3h - 7h + 2h) - 9h2 + 10h*2 + 4h*2. -3h*2 Expand (-11i*2 - 10i + 10i)(1 - 48i - 5i*2 + 48i). 55i4 - 11i*2 Expand (-29g*2 - 19g*2 - 215g*4 + 49g*2)(5 - 4 + 1)(0g + 0g + g). -430g*5 + 2g*3 Expand (3 - p - 3)(7 - 2 - 4)(-3p - 45719 + 45719)(p3 - 2p*3 + 2p*3). 3p5 Expand (-2 - m5 + 2 + m*4)((7 + 7 - 6)(-2 - 3 + 4) + (0 - 2 + 3)(0 - 2 + 3) - 3 + 2 + 0 - 3 - 1 + 1). 11m5 - 11m*4 Expand (-2 + 6 + 3)(-3 + 0 - 3)(-33v - 5v - 17v + 15v). 1680v Expand (13r3 + 212r - 215r + 18r*3)(2r + 2r - 3r). 31r*4 - 3r*2 Expand ((2 + 0 + 0)(3 + 3 - 5) + 2 + 1 - 1)(-2k*2 + 26k*2 + 44k*2). 272k*2 Expand (-964i*5 - 786 + 786)(-1 + 1 - 2). 1928i5 Expand ((1 + 2z - 1)(-3 + 1 + 1) - 2z - z + z)(5934z - 5934z + 297z*2). -1188z*3 Expand (1 - 3 - 4 - 5c*2 - 2c*2 + 3 - 3 + (-2c + 1 - 1)(-3c - 2c + 6c))(c + 2c + 0c). -27c*3 - 18c Expand (2 + 3 - 3 + (0 + 6 - 5)(4 - 1 - 1) + 6 + 0 - 4 + 4 - 1 - 4 + (-10 - 12 - 2)(-1 - 2 + 5))(-2c*4 + 3c**2 -	{ "pile_set_name": "DM Mathematics" }
7, -b = 2r - 23. What is the units digit of b? 7 Let n(p) be the first derivative of 33p*4/4 - 2p*3/3 + p - 3. What is the units digit of n(1)? 2 Suppose -3c = 3, -413 = -5d + 2c + 314. What is the units digit of d? 5 Suppose 2w + 1 = -7. What is the tens digit of 38 - (-7)/((-7)/w)? 4 Let a be 4/(-3) - (-2466)/27. Suppose 2m = 4f - 158 + 46, 3f - 3m = a. What is the tens digit of f? 2 Let y be (-1 + 3)(1 - 0). Suppose ya + a = 69. What is the units digit of a? 3 Suppose -317 = -5s + 2n, 5s - 82 = -5n + 228. What is the tens digit of s? 6 What is the tens digit of (-200 + -2)6/(-12)? 0 Suppose 5a + 5w - 213 = 3w, -171 = -4a - w. What is the tens digit of a? 4 Let k(w) = 6w2 + 7w - 1. What is the hundreds digit of k(-7)? 2 Let s = -7 - -19. Suppose 3r + s = 2v + r, -3 = 4v + 5r. What is the units digit of v? 3 Let s be (-1 + 4)132/9. Suppose 3p = -p + s. What is the tens digit of p? 1 Suppose -5j = -3j + 5u - 371, 0 = 2u + 10. What is the hundreds digit of j? 1 Let v be (-15)/10(-40)/(-6). What is the tens digit of (5/3)/(v/(-120))? 2 Suppose 5x - 50 = -0. Let j be (-392)/(-63) - (-2)/(-9). Let s = x - j. What is the units digit of s? 4 Suppose -f = -3 + 14. Let x be 0 - f - (-7)/(-7). Suppose 5p - x - 5 = 0. What is the units digit of p? 3 Suppose 2c + 12 = 4n - 6, -n - 3c = -8. Suppose nf - 2 = 3. What is the units digit of f? 1 Let b(a) = a2 - 21a + 31. What is the tens digit of b(23)? 7 Suppose j + 0 - 1 = 0. Suppose y + j = 12. What is the units digit of y? 1 Let p(w) = w*2 - 3w. Let y be p(3). Let r(f) = f + 19. What is the tens digit of r(y)? 1 Suppose 3x + x + 80 = 0. What is the tens digit of x((-11)/(-5) - 3)? 1 What is the tens digit of 456/16 - (-9)/6? 3 Let i(w) = -4w + 1. Let t be i(-1). What is the units digit of 2/t - (-365)/25? 5 Let l(h) = h3 + 7h*2 + 6h + 2. Let z(p) = 6p. Let v be z(-1). Let c be l(v). Suppose 0 = -cd + 4 + 2. What is the units digit of d? 3 Suppose -u - 3u - 20 = 0. Let l(y) = y + 9. Let m be l(u). Suppose -12 + 0 = -mc. What is the units digit of c? 3 What is the units digit of ((-30)/9)/((-6)/45)? 5 Suppose 3j - 2k = -23, 3j + 31 = -k + 5k. Let z(i) = i*2 - 3i - 15. What is the tens digit of z(j)? 2 Let t = 99 - 31. What is the tens digit of t? 6 Let c(i) be the third derivative of -i*5/30 + 7i4/24 + i3/6 - 2i2. What is the units digit of c(3)? 4 Let o be (-2)/11 + (-40)/22. What is the units digit of (o/(-3))/((-2)/(-33))? 1 Let r be -3(-1 + 11/3). Let x = r - -13. Suppose -4y = -5y + 2b + 11, xb = 0. What is the units digit of y? 1 Let f be (1-3)/((-27)/18). Suppose c = -r + 3r - 14, 0 = fr - 2c - 10. What is the units digit of r? 9 Suppose -c + 2 = -4. Let m = c - 0. What is the units digit of m? 6 Suppose 2x = 3 - 5. What is the units digit of 44/24 - x/6? 2 Suppose -5 = o - 4. Let t(x) be the first derivative of -x4 - x3/3 - x2/2 - x - 2. What is the units digit of t(o)? 3 Let c = -11 - -13. What is the units digit of (8/(-10))/(c/(-20))? 8 Suppose 1 = -0i - i - 3n, -4n - 8 = 0. Suppose 4q + 3w - 4 = 5w, -5w = -5q - i. Suppose qv + 2v - 70 = 0. What is the units digit of v? 4 Let j be (-2)/(-3)218. Let g = j + -5. What is the tens digit of g? 1 Suppose 2 - 1 = 2l + z, -4z - 6 = -2l. Let q = 7 + l. What is the units digit of q? 8 Suppose 3q - u - 8 = -0u, u = -4q + 13. Suppose 0 = -3v + 59 + 37. Suppose b + qb = v. What is the units digit of b? 8 Let s(u) = -5u + 3. What is the tens digit of s(-2)? 1 Let s be ((-1)/2)/((-1)/(-12)). Let x(m) = m*2 + 6m + 2. Let o be x(s). Suppose 5l - 27 = ol. What is the units digit of l? 9 Let t = -2 - -2. Suppose a = 2n + 3n + 10, t = a + 2n - 3. Suppose -as + 6s - 8 = 0. What is the units digit of s? 8 Let p = -2 + 6. Suppose pb - 8 = -0b - 4s, -2b = 4s. Suppose -bg + 18 = -2g + 4j, -4g = 2j - 42. What is the tens digit of g? 1 What is the hundreds digit of (-5)/(5 - 0)(-238)/2? 1 Let j(z) be the second derivative of z6/720 + z5/40 - z*4/6 + 3z. Let p(b) be the third derivative of j(b). What is the units digit of p(-2)? 1 Let u(n) = n + 1. Let c(w) = 4w. Let x(b) = c(b) - 3u(b). Let m be x(7). Suppose 2 = -my + 26. What is the units digit of y? 6 Let t(m) = 5m*2 + m - 17. Let p(g) = 2g*2 + g - 8. Let v(z) = -9p(z) + 4t(z). What is the units digit of v(4)? 6 Suppose -2n + 1 = h, 5n - 6 = 4h + 16. Let s(k) = 0kn + 3k*2 - 1 - 2k*2 - 3k. What is the units digit of s(-3)? 7 Let j be (-2 + 0)/(2/(-2)). What is the tens digit of -2j/8-26? 1 Suppose 5u + 371 = 4n, n - 6u = -2u + 101. What is the units digit of n? 9 Suppose 0 = -2b + 12. What is the units digit of 118/6 - 4/b? 9 Let f(c) = -2c - 10. What is the units digit of f(-9)? 8 Suppose 4g + 16 - 404 = 0. What is the units digit of g? 7 Let o(s) = -s + 1. Let b be o(-2). Suppose -99 = -4i - b. What is the units digit of i? 4 Let d(a) = 8a2 - 1. What is the units digit of d(-2)? 1 Let b(f) = -f3 - f2. Let j(o) = -3o*2 - 6o - 4. Let i(s) = b(s) + j(s). What is the units digit of i(-4)? 0 Suppose 4q - 3r = 681, 5r - r = -3q + 492. What is the units digit of q? 8 Let l be 2 + 6 + 2 + 0. Let u(s) = s*3 - 9s*2 - 8s - 11. What is the units digit of u(l)? 9 Let n(q) = 24q + 11. What is the units digit of n(3)? 3 Suppose 0 = 4w + 14 - 230. What is the tens digit of w? 5 Let o = 2 + 1. What is the units digit of o? 3 What is the units digit of -3219/(-6)? 8 Let p(u) = 16u - 1. Let j(n) = 8n. Let q(t) = -7j(t) + 3p(t). What is the units digit of q(-2)? 3 Let g = 9 + -16. Let n = g - -16. What is the units digit of n? 9 Let b(l) = 42l - 4. What is the hundreds digit of b(3)? 1 Let r(m) be the first derivative of 3m + 7/3m3 - 5/2m*2 - 1/4m*4 + 2. What is the units digit of r(6)? 9 Let h(f) = f + 1. Let t be h(4). Suppose 5n + 3u = 37 - 8, -3u + 13 = n. Suppose -t = -y + n. What is the units digit of y? 9 Let u(y) be the first derivative of y*3/3 - 2y*2 + 2y - 2. Let x be u(6). Suppose i + i = x. What is the units digit of i? 7 Suppose 3a - 9a = -348. What is the tens digit of a? 5 Let g(k) = -6k - 2. Suppose v + 2v = -9. What is the units digit of g(v)? 6 Let q(d) = 3d2 - 2d + 2. Let n(r) = -4r2 + 2r - 2. Let c(w) = 2n(w) + 3q(w). What is the tens digit of c(5)? 1 Suppose 221 = 4l - 71. What is the tens digit of l? 7 Suppose -6w + 5w = 0. Suppose 56 = 5m - g, wm - 3g = -4m + 36. What is the units digit of m? 2 Let w = -20 + 67. What is the units digit of w? 7 Suppose 2r - r = 17. Suppose -3b = -p + 2b - r, -3p = -5b + 11. What is the units digit of p? 3 Suppose 4a - 4 = j, -4j + 3a - 2a = -14. Let k(n) = 2n + 2. What is the units digit of k(j)? 0 Let k = -6 + 10. Suppose 4y - 46 = -3o, -24 = -2o - 2o + ky. What is the tens digit of o? 1 Let a(x) = x*2 - 7x + 10. What is the units digit of a(6)? 4 Suppose -5d = -0m + 4m - 20, -2d + 11 = m. What is the units digit of (5/(-10))/((-1)/d)? 4 Let q = 14 - 22. Let n(c) = c + 12. Let w be n(q). Suppose -o - i = -15, 5o - 4o - wi = 0. What is the tens digit of o? 1 Let y be 2 + 0 - 1 - 0. Suppose -a - y = 0, 2a - 37 = -3x + 3a. What is the tens digit of x? 1 Suppose 145 - 470 = -5d. What is the units digit of d? 5 What is the hundreds digit of ((4 - 1) + -4)(-5 + -238)? 2 Suppose 2y = -y - 18. Let r(q) = q3 + 6q*2 + q - 3. Let n be r(-6). Let c = y - n. What is the units digit of c? 3 Let z = 0 - 0. Let v = z + 8. What is the units digit of v? 8 What is the units digit of (-68)/(-1) + (1 - -1)? 0 Let f be 2/8 + (-2)/8. Suppose f = 3n - 2s - 3s + 15, 5s = 15. Suppose -3j = -z - 11, -3z - 18 = -4j - nz. What is the units digit of j? 3 Let h(y) = -23y*3 + 19y*2 + 12y - 5. Let j(o) = 4o3 - 3o*2 - 2o + 1. Let p(f) = 6h(f) + 34j(f). What is the tens digit of p(6)? 2 Suppose j - 2 = 3. Suppose -l + 2m = -2, -j = -l + m - 2. What is the units digit of l? 4 Let x be ((-3)/5)/((-11)/165). Let a = 10 - x. What is the units digit of a? 1 Let r(y) = 2y*2 + y + 1. Let h be r(-3). Let t be (-28)/h - (-2)/(-8). What is the units digit of 6((-1)/t)/1? 3 Let t(s) = 9s2 + 1. Let n be (-4)/(-2)(-1)/(-2). What is t	{ "pile_set_name": "DM Mathematics" }
ommon factor of t and 10. 5 Suppose -8u + 10u = 8. Suppose 4n + 2t = -2t + 60, 0 = -ut + 12. Calculate the greatest common divisor of n and 48. 12 Let s(y) = y2 + y - 6. Let x = -4 - 2. Let f be s(x). Calculate the highest common divisor of f and 12. 12 Let l(b) = -b2 - b + 2. Let n(u) = -u*2 - 2u + 1. Let k(d) = 2l(d) - 3n(d). Let c be k(-5). Calculate the highest common divisor of 2 and c. 2 Suppose 4p = 132 + 188. Calculate the highest common factor of p and 16. 16 Suppose f - 4 = 1. Let q = 3 + -1. Suppose o - 22 = -2h + qo, 3h - fo - 40 = 0. Calculate the greatest common factor of 90 and h. 10 Let u(l) = -l2 - 3l + 3. Let c be u(-3). Calculate the greatest common divisor of 33 and c. 3 Suppose 0 = -m - 3r + 28, 37 + 31 = 3m + 5r. Calculate the highest common factor of 128 and m. 16 Let b be (-1 - (-2)/8)-60. Suppose -2o + 5q = 3o - b, -q - 21 = -2o. Suppose -w + 13 = -5. Calculate the greatest common divisor of w and o. 6 Let m(o) = 5o2 + o. Let y be m(1). Suppose -2s + ys = 844. Let b = s + -75. Calculate the highest common factor of 17 and b. 17 Let j be (-8)/(-3)9/2. Suppose -15 = -p - 2q + j, 51 = 3p - 4q. Suppose -x + 7 = -4y + 24, 3y - 15 = 0. Calculate the greatest common factor of x and p. 3 Let c = -19 - -29. Suppose 3i - 7i = -5k + 67, 23 = k + 4i. Let l be (k/(-10))/(3/(-20)). Calculate the highest common factor of l and c. 10 Let z = 462 - 245. Calculate the highest common divisor of z and 31. 31 Let t(w) = -4w + 3. Let l(k) = -12k + 10. Let b(n) = -4l(n) + 11t(n). Let y be b(5). Let v = -9 + 35. Calculate the greatest common factor of y and v. 13 Let a = -98 - -120. Calculate the highest common divisor of 11 and a. 11 Let z be (-3)/9 + (-2)/3. Let o = z - -2. Calculate the highest common factor of o and 4. 1 Let a(s) = -3s - 1. Let k be a(-9). Suppose -3c = -4c. Suppose -2y = -cy - 78. What is the greatest common factor of k and y? 13 Suppose -128 = -0m - 4m. Suppose 34 = 4k - 30. What is the highest common factor of k and m? 16 Let s = 96 + -16. Let w(i) = i3 + 5i*2 - i - 4. Let j be w(-2). What is the greatest common divisor of s and j? 10 Let g be 132(-2)/(-8)2. What is the greatest common factor of 44 and g? 22 Let m = 20 - 13. Suppose -3w + 3b = -b - 31, -2b + m = 3w. What is the greatest common factor of 40 and w? 5 Suppose 2l + 3 = 3l. Suppose -la + j = -21, -a + 5a - 3j = 33. What is the greatest common divisor of 18 and a? 6 Suppose v = -3s + 4, 3v + 9 = -6. Let q be (-1 - -3) + s + 0. Let r be (q/1)/((-3)/(-6)). Calculate the highest common factor of r and 2. 2 Let w be 4/30 - 8/60. Let p(t) = -t2 - t + 8. Let m be p(w). Calculate the highest common factor of 72 and m. 8 Let d(h) = -h3 + 2h2 + 3h + 3. Let q be d(-3). Calculate the greatest common divisor of 26 and q. 13 Let k(b) = 4b2 - 7b + 3. Let u be k(7). Calculate the highest common divisor of 60 and u. 30 Suppose -3u + 18 = 3s, -2s = 3u - 7u + 54. Let d = -58 - -135. What is the greatest common divisor of u and d? 11 Let u be 41/((-8)/(-10)). Let p = 1 - -7. Suppose -pf + 11f = 105. What is the greatest common factor of f and u? 5 Suppose 0 = p + 1 - 5, -2f = p - 114. Let o be (5/(-2) + 1)-2. Let q be o255/15. What is the greatest common divisor of q and f? 11 Let y = 7 + 18. Suppose 0 = 5n - y, 4b - 3n - 7 = -22. Suppose -2x + 8 = -4a + a, -x - 3a + 4 = b. Calculate the highest common divisor of x and 6. 2 Suppose 5r - 260 = 5m, -4r - 86 = 5m + 156. Let j = 72 + m. Suppose 0 = -i + j + 4. What is the highest common divisor of i and 13? 13 Let d be (-6)/33 - (-158)/22. Suppose 0 = -2h - 5l - d, -h + 16 = -0h - 4l. Let j be 4/1 + -1 + 3. What is the highest common factor of j and h? 2 Let d(t) = t*3 + 4t*2 - 11t - 12. Let l be d(-8). Let g = -36 - l. What is the greatest common factor of 18 and g? 18 Suppose 3q = -3t + 13 + 8, 5t + q = 19. Calculate the highest common factor of 15 and t. 3 Let i(p) = 2p - 1. Let s be i(7). What is the highest common factor of 104 and s? 13 Let c(d) = -d*3 - d + 20. Let m be c(0). Suppose -17o + 15 = -14o. What is the highest common factor of o and m? 5 Suppose -3k + 18 = 3a, -k + 3a = k + 3. Suppose -kx + 30 = -x. Suppose -2f + 13 = -x. Calculate the highest common factor of 98 and f. 14 Suppose -5l + 10 = -65. What is the highest common divisor of l and 15? 15 Suppose 3o = 5b + 17 + 102, 40 = o - 2b. Calculate the greatest common divisor of 95 and o. 19 Let a be 1/((-1 - 0)/6). Let b be a/15 - (-544)/10. What is the highest common divisor of 18 and b? 18 Let a = -1 + 14. Suppose f - 12 - 40 = 0. What is the greatest common factor of a and f? 13 Suppose 2 = -z - 1. Let q be (-26)/1z/6. What is the highest common factor of q and 26? 13 Suppose -k + 27 = 2k. Let w(t) = -t3 - t2 + 10t - 5. Let u be w(-4). Calculate the highest common divisor of u and k. 3 Let m(u) = -u3 + 8u*2 + 9u + 2. Let q be m(9). Suppose 3z - 47 = 2t, -2z + 7z - 105 = -qt. What is the highest common factor of 152 and z? 19 Let h be -2(-1 + 44/(-8)). Suppose 3z - 133 = -h. What is the highest common divisor of 16 and z? 8 Let v = -27 + 14. Let c be 6/(-3)(v - -1). Calculate the greatest common factor of 12 and c. 12 Let l(u) = 7u3 - 2u + 2. Let j be l(1). Calculate the highest common factor of j and 63. 7 Let o(i) = -2i2 + 0i*2 - 8i + 13 + i*2. Let r be o(-9). Let a = r - 2. Calculate the highest common divisor of 2 and a. 2 Let q = -28 - -48. What is the greatest common factor of q and 2? 2 Let w(y) = -2y - 1. Let n(d) = -d - 3. Let z be n(4). Let t be w(z). What is the highest common factor of 52 and t? 13 Suppose -5v = -3v - 42. Suppose -x + v = 5. What is the greatest common factor of x and 48? 16 Let i(x) = 2x + 1. Let h be i(1). Suppose -34 = -4u - k, 0 = 2u - hk + 7k - 10. What is the greatest common divisor of 45 and u? 9 Let n be ((-28)/(-35))/((-1)/20). Let y be (-2)/540/n. Calculate the highest common factor of 1 and y. 1 Suppose -3u - b + 63 - 13 = 0, 36 = 2u + 2b. Let q = -342 + 390. What is the highest common divisor of u and q? 16 Suppose -3m - 3o + 165 = 0, 3o = -3m + 4o + 173. Calculate the highest common divisor of m and 19. 19 Suppose -2o + 20 = 2o. Suppose 3 = oy - 17. Calculate the greatest common factor of 4 and y. 4 Let g = -11 + 12. What is the greatest common factor of g and 8? 1 Let f = 5 - 1. Suppose -17 = -a + 4x, a - 5x - 16 = f. What is the greatest common factor of 20 and a? 5 Suppose -b + 121 - 31 = 0. Suppose 4l + l + 4a + 55 = 0, 40 = -2l + 2a. Let n = 25 + l. What is the highest common factor of n and b? 10 Suppose 0 = -3z + 52 + 179. Calculate the greatest common factor of 55 and z. 11 Let w(x) = -x + 12. Let m be w(7). Let q(f) = -40f3 + f2 - 1. Let z be q(-1). What is the greatest common factor of m and z? 5 Let m(z) = 27z*3 + 2z*2 - z. Let l be m(1). Let q = -14 + l. What is the highest common divisor of 2 and q? 2 Let p = 199 + -187. Let w be (-2)/(-6) + (-179)/(-3). What is the greatest common divisor of p and w? 12 Suppose 1 = -g + 5. Let d be g/6 + 4/3. What is the highest common factor of 18 and d? 2 Let h be (6 + (-165)/10)36/(-7). What is the greatest common factor of 81 and h? 27 Let k = 235 - -17. What is the highest common divisor of 42 and k? 42 Let l(d) = d*2 - 2d + 13. Let q be l(11). What is the greatest common divisor of q and 16? 16 Let r(l) = -40l + 1. Let p be r(-5). Let j = p + -136. Suppose 3o - 26 = 2o. What is the highest common divisor of o and j? 13 Suppose 56 + 24 = 4f. What is the greatest common divisor of 8 and f? 4 Suppose -a + 2 + 0 = 0. Let y(q) = 30q - 10. Let b(t) = -10t + 3. Let f(n) = -10b(n) - 3y(n). Let m be f(a). What is the highest common divisor of 50 and m? 10 Let q be 6(21/9 + -2). Suppose 4u + 3 - 5 = -qb, -34 = -4b + 2u. Calculate the greatest common divisor of 14 and b. 7 Let j(a) = -69a - 10. Let r be j(-4). What is the highest common divisor of r and 19? 19 Let k(r) = -5r - 9. Let u be k(-3). Let y(c) = c - 1. Let v be y(4). Calculate the highest common factor of v and u. 3 Let d(j) = -j + 3. Let v be d(-9). Suppose 0u + 2u + 20 = -5q, 4u + 3q = -v. Let	{ "pile_set_name": "DM Mathematics" }
10? 30 Suppose -7n = 5i - 2n - 25, 3i - n - 27 = 0. Let b(x) = -x*2 - 7x - 5. Calculate the least common multiple of b(-4) and i. 56 Suppose 0 = -i - j - 0j + 9, 31 = 5i - 2j. Suppose 3y + 0 = 12. What is the smallest common multiple of y and i? 28 Let n = -2333 - -23383/10. What is the common denominator of -13/8 and n? 40 Let s(i) = i*2 + 4i - 2. Suppose r + 6q - 3q = -5, -5 = r - 2q. What is the lowest common multiple of s(r) and (-58)/(-6) - 12/18? 9 Suppose 3i - 5i = -170. Suppose i = -g - 4g. Let k = g + 33. What is the lowest common multiple of 4 and k? 16 Suppose 0 = -3x + 5r + 30, 0r + 21 = 2x - 3r. Calculate the least common multiple of x and 6. 30 Let m be (-2)/8 + (-20606)/96. Let a be ((-364)/(-18))/((-92)/84 - -1). Let w = a - m. What is the common denominator of -17/14 and w? 112 Let h be 280(0 - 156/(-10)). Let d = h - 34889/8. Calculate the common denominator of d and -4/9. 72 Let o = -354 + 1783/5. What is the common denominator of 48/11 and o? 55 Suppose 4b = 18 + 14. What is the least common multiple of b and 8? 8 Let x = -17 + 21. Calculate the least common multiple of x and 16. 16 Let z(p) = 2p*2 + 4p. Calculate the least common multiple of 10 and z(2). 80 Suppose 5a - 7a - 26 = 0. Let y = 23 + a. What is the common denominator of 0 - (y + 6/(-2)) and -67/8? 8 Let h(o) be the first derivative of -4o3/3 - 3o*2/2 + 3o + 3. Let g be h(-3). What is the lowest common multiple of 16 and ((-18)/8)/(9/g)? 48 Let n = 12538 - 777393/62. Calculate the common denominator of n and -46/11. 682 Let c be ((-3)/(-6) + 0)6. Suppose -4i - 1 = c. Find the common denominator of 54/5 and i2/10-8. 5 Suppose -3m - 10 = 4k - 25, 2m + 2k - 10 = 0. Suppose -5a = -2n + 5, 4 + 1 = -5a - mn. Let g = 5 - a. What is the smallest common multiple of g and 14? 42 Suppose -2b = r + 563, 470 + 347 = -3b + 4r. Calculate the common denominator of (b/(-4))/((-12)/8) and (-5 + 3)/((-60)/267). 10 Find the common denominator of ((-237)/(-6))/(3 - 2) and ((-148)/66)/((-8)/18). 22 Let v = -4 - -7. Suppose -vb + 20 = 8. What is the smallest common multiple of b and 11? 44 What is the common denominator of -37/28 and (-3)/5 + (-1964)/(-40)? 28 Let q be (-1 - -2)/(1/5). Suppose -h = qu, -3h = -5u + 3u. What is the least common multiple of 9 and h - -1(-1 - -2)? 9 Suppose -4h + 4r = 0, 6h - 4r + 4 = 3h. Suppose 5p + 9 = 34. Let b(y) = -y3 + 5y*2 + y + 7. Calculate the least common multiple of b(p) and h. 12 Let g = 19 - 9. Let c = -10 + 12. Calculate the smallest common multiple of c and g. 10 Suppose -o - 4o = -40. What is the least common multiple of (-1)/(-2)((-3)/1 - -21) and o? 72 Suppose u - 17 - 11 = -3z, 5z - 45 = -2u. Calculate the lowest common multiple of z and 10. 110 Let x = 20 + 135. Let k be 113/1 + -1 + -1. Let s = k - x. Find the common denominator of s and -50/7. 7 Let h = 4 - -20. Calculate the smallest common multiple of 12 and h. 24 Let v(d) = -d*2 - 12d - 1. Calculate the smallest common multiple of v(-11) and 112. 560 Find the common denominator of 31/5 - (-2)/(-5) and (4/15)/(36/(-870)). 45 Let t = -4/271 - 23545/2168. Calculate the common denominator of -71/6 and t. 24 What is the common denominator of (-12)/(-28) + (-683)/(-56) and -97/2? 8 Suppose 0 = -x - 4x - 25, -b + 21 = -4x. Suppose y - 4 = -m - b, -5m = y - 11. What is the smallest common multiple of 12 and m? 12 Let p be -1 + (-1 + 1 - 0). Calculate the least common multiple of -8((1 - 1) + p) and (4/(-3))/2-30. 40 Find the common denominator of 218/12 - (-7 + 18/6) and 37/18. 18 Suppose 4l = 3n + n + 32, -4l - n = -17. Suppose -j = -5i + 15, i - 48 = -lj + 7. Calculate the lowest common multiple of 18 and j. 90 Let y(m) be the third derivative of -m*5/60 + 7m4/24 - m3/3 - 3m2. Calculate the least common multiple of y(5) and 3. 24 Let u be (-525174)/108 - (-3 - -1). Let t = u + 4858. What is the common denominator of 25/8 and t? 72 Find the common denominator of -69/2 and ((-55)/(-44))/(14/12). 14 Let k = -13214/5 + 2652. Find the common denominator of 61/12 and k. 60 Calculate the common denominator of (1/(-3))/(30/(-170)) and -50/39. 117 Suppose 14604 = -2x - 2x. Let o = 73053/20 + x. What is the common denominator of 91/4 and o? 20 Let m(k) = -k2 + 9k - 12. Let i = -12 + 24. Calculate the least common multiple of m(5) and i. 24 Suppose 56 = -3d - 13. Let f = d - -8. Find the common denominator of f3/33 + 0 and -9/7. 77 Let l(w) = -3w - 10. Calculate the lowest common multiple of l(-8) and 22. 154 Suppose 0 = -4s - 1 + 17. Suppose 4c = -3i + 44, -22 = -3i - i + 2c. Calculate the lowest common multiple of s and i. 8 Let q be ((-36)/14)/(3/(-21)). Suppose o + q = 3o. Calculate the smallest common multiple of o and 9. 9 Let a = -52 - -88. What is the common denominator of 122/a - 4/3 and -41/40? 360 Let j = 31 + -15. Let b(d) = d2 + 5d - 4. Let u be b(-5). Let c = u - -6. What is the smallest common multiple of j and c? 16 Let z(c) = -c*2 + 5c + 9. Let n be z(8). Let u(w) = 3w - 6. Let x be u(-5). Let a = n - x. Calculate the least common multiple of 4 and a. 12 Let m be (-2)/(-2) - -2 - 1. Suppose mu - 1 = r + 5, -2u - 2r = 0. Calculate the lowest common multiple of u and 5. 10 Let w = 31 - 13. Let j = -14 + w. Calculate the least common multiple of 20 and j. 20 Let u = -39623/16566 + -13/753. Calculate the common denominator of (-91)/(-616)3 - 4/(-22) and u. 88 Let a = 235/22 - 66887/6270. Let x = -2177/570 - a. Find the common denominator of x and -9/7. 42 Find the common denominator of (1 - 80/(-6))-1 and 47/11. 33 Let g = -17 + 19. Let h(l) = -l - 1 + 4 + 4. Calculate the smallest common multiple of g and h(5). 2 Let t = -1 + -31. Find the common denominator of -9/4 and 24/(-20)(-150)/t. 8 Let x be 20/(-7) + (-2)/14. Let y(w) = -w + 1. Suppose -4b - 8 = 0, -2d - 3b = -5b - 28. Calculate the smallest common multiple of y(x) and d. 12 Let n = -132 - -137. What is the lowest common multiple of n and 4? 20 Suppose -q - 1239 + 353 = 0. Let l = -10679/12 - q. What is the common denominator of 113/20 and l? 60 Suppose -4o = -4g + 4, -30 = -3o - 5g - 1. Calculate the smallest common multiple of 10 and o. 30 Suppose 2p = -0n + 5n - 16, 0 = 5n - p - 18. What is the smallest common multiple of n and 17? 68 Find the common denominator of (4/(-2))/(-18)(-29)/(-4) and 95/2. 36 Suppose -r - 2t + 7 = 3t, 4r - 3t = 5. Calculate the common denominator of (1/r)/(9/75) and 119/6. 6 Suppose w = 2w - 5. Suppose -17 = wg - 2. Calculate the lowest common multiple of (10/g)/(1/(-3)) and 22. 110 Let s = -8 - -16. Suppose i + 2 - 5 = 0. What is the smallest common multiple of i and s? 24 Let p = 0 - -1. Suppose -10v - 16 = -12v. What is the least common multiple of v and p? 8 Let h = 26 - 12. Let b = h + -5. Calculate the smallest common multiple of b and 2/(-12) - -10. 9 Suppose 3i = -2i + 50. What is the lowest common multiple of i and 16? 80 Suppose 3 = 2x - 5. Suppose -j = -xj - 60. What is the common denominator of -109/10 and (-6)/9(-318)/j? 10 Suppose 0 = -3l - l + j + 195, j - 205 = -4l. What is the smallest common multiple of l and 14? 350 Let g = 12758 + -408317/32. Find the common denominator of -35/16 and g. 32 Suppose 0 = -d + 2d - 18. What is the smallest common multiple of 16 and d? 144 Calculate the common denominator of -67/8 and 5 - 0 - 440/(-64). 8 Let f be (-11)/((-5)/70). Find the common denominator of -25/7 and 4/f - (-1967)/147. 21 Suppose -5s - 1129 = -84. Calculate the least common multiple of 1/5 - s/55 and 14. 28 Suppose 0 = 5d - 1227 - 228. Calculate the common denominator of (5/6)/((-1)/17) and ((d/(-6))/(-1))/(-4). 24 Let d be 0 + 1 - (-180)/(-22). Let j = -73/22 + d. Calculate the common denominator of j and (-1)/3438/(-16). 8 Let h = -1/384 + 7361/384. Calculate the common denominator of -13/5 and h. 30 Let y = 7011/40 - 347/2. Find the common denominator of y and 86/45. 360 What is the common denominator of 40/12((-391)/176 + 2) and -69/22? 88 Suppose -5x + 3h - 12 = 0, -4h + 2 - 18 = 4x. Let k = x - -1. What is the smallest common multiple of 10 and (3 + k)116? 80 Let a be 0 - 5 - 0/2. Let l = 8 + a. Suppose 0 =	{ "pile_set_name": "DM Mathematics" }
8y2 - 6y + 8y2 - 3y*3. Suppose 14d - 120 = 6d. What is the tens digit of k(d)? 2 Suppose 2j + 14 = -2h - 6, 0 = 3h + 5j + 38. Let d be 24/9 - 2/h. What is the units digit of 9/12(1 + d)? 3 Suppose 0 = -3q + 14 + 7. Suppose -2w - 13 = -qw + 3u, 3u + 5 = w. Suppose wj - 128 = 26. What is the tens digit of j? 7 Let x(n) be the first derivative of 15n2 + 0n + 10n + n2 - 6. What is the units digit of x(4)? 8 Let o = 148 + -79. Let a = o + 1. Let u = a - 16. What is the units digit of u? 4 Suppose 0 = 95l + 10285 - 126650 - 30410. What is the units digit of l? 5 Let d = 89 + 63. Let m = d - 61. What is the tens digit of m? 9 Suppose 31i = 21i + 61931 + 37309. What is the thousands digit of i? 9 Suppose -7y - 28 = -11y. Let s be (y/5 + -3)/((-6)/150). Suppose -2j + s = 5q, -5q - 46 = -5j - 4q. What is the tens digit of j? 1 Let n(m) = 235m + 38. Let v be ((-8)/(-6))/(30/45). What is the hundreds digit of n(v)? 5 Suppose -5h + 15 = -2h + 2w, -4h = -3w - 20. Suppose -hz = -5a + 505, -a - 388 = -5a - 4z. Suppose g = 4g - a. What is the units digit of g? 3 Let m(z) be the third derivative of -z6/36 + z5/15 - z*4/8 + 17z*2. Let c(y) be the second derivative of m(y). What is the units digit of c(-1)? 8 Suppose -g = -2x + 34, 0g + 52 = 3x - g. Let t(v) = 44v + 49. What is the tens digit of t(x)? 4 Let r = -255 - -1356. Suppose -4l + 5u = -r, -l - u + 3u + 273 = 0. What is the hundreds digit of l? 2 Let q(m) = -m*3 - 3m*2 - 10m + 534. What is the tens digit of q(-37)? 5 Let t = 531 + -524. What is the units digit of (-289685)/(-330) + -1 + t/6? 8 Let d(p) = 218p - 264. Let j(c) = 6c - 1. Let s(l) = d(l) + 5j(l). What is the units digit of s(7)? 7 Suppose 0 = 3t, a + 4t - 286 - 59 = 0. Let g = a - 36. What is the units digit of g? 9 Let f(q) = -146q - 116. Let x = 348 + -354. What is the units digit of f(x)? 0 Let j = 152 - 12. Suppose 2n = -3l + 1321, 2l - j = -5n + 748. What is the tens digit of l? 3 Suppose 18 - 14 = 2w - b, -5b = 20. Suppose 3y - 772 = -x, wx + 1292 = 5y - x. What is the hundreds digit of y? 2 Let k(w) = w2 - 4w - 10. Let z be k(6). Let n be 5 - (4 + z + -3). Suppose -l - 322 = -5o, no + l + 3l = 120. What is the tens digit of o? 6 Suppose 44553 = 19j - 895. Suppose 30438 = 37l + j. What is the hundreds digit of l? 7 Let l be 47/3 + (-20)/30. Let z be ((-70)/l)/((-1)/369). What is the tens digit of z/24 - 1/(-4)? 7 Suppose 3n - 11 = 3v - 116, n + 26 = -2v. Let l = n - -36. Suppose 4g = -3d + 152, ld - 127 = 3g + 59. What is the units digit of d? 8 What is the units digit of (-152)/(-50)179(-17 + 12)-5? 4 What is the thousands digit of (1 + 16/(-6))(-69)/230152554? 6 Suppose 5c - 1674 = 4o - 132, o - 2 = 0. Suppose -3q - 5g + 328 = 0, 0 = 3q - 11g + 7g - c. What is the units digit of q? 6 Let o(m) = 2m + 1. Let h(l) = 22l - 29. Let r(k) = -h(k) - 4o(k). What is the units digit of r(-4)? 5 Let t(w) = w3 + 5w*2 - 7w + 21. Let z(u) = -u*2 - 20u - 56. Let y be z(-17). What is the tens digit of t(y)? 5 Let k be (144/27 + -5)/(2/42). Suppose -3d - 1736 = -kd. What is the units digit of d? 4 Let y(g) = -g*2 + 9g + 140. Let b be y(17). Suppose 2a + 3a = -2z + 1863, -4a + 1468 = -bz. What is the units digit of a? 1 Suppose 50a - 55a + 8530 = -3n, -4n = 5a - 8495. What is the thousands digit of a? 1 Let x(g) = 7g3 + 6g*2 + 18g - 66. Let l be x(7). Let t = -1497 + l. What is the units digit of t? 8 Let y(x) be the second derivative of -893x3/6 + 51x*2/2 + 199x. What is the units digit of y(-2)? 7 Suppose 0 = 46p - 7p - 273. Suppose 0 = 2n + 2d - 1736, -4n - 10d = -pd - 3473. What is the units digit of n? 9 Let w(f) = f3 - 6f*2 - f + 8. Let u be w(6). Suppose -x + 5 = 2m - 6, 4m - ux = 42. Suppose -2s - 66 = -ms. What is the tens digit of s? 1 Let v = -33 + 30. What is the units digit of v1856/(-72) - 2/6? 7 Suppose 0 = -24k - 40044 + 112020. What is the hundreds digit of k? 9 Let p(t) = 4t2 - 12t - 39. Suppose -8d = -4d + 20. What is the units digit of p(d)? 1 Let x(t) = 388t2 - 11t + 42. What is the thousands digit of x(-6)? 4 Let u = -201 - -356. Suppose 4y = -4k + 124, -10k - u = -5y - 6k. What is the tens digit of y? 3 Suppose 3u + 13 = 22. Suppose uz - 374 = -z + 2s, 0 = 3z + 5s - 287. Suppose -2d + z = -90. What is the tens digit of d? 9 Let h(m) = 326m + 170. What is the units digit of h(2)? 2 Suppose -358y = -351y - 21. Suppose 3h - yv = 7h - 726, -5v + 910 = 5h. What is the tens digit of h? 8 Let v be (4/36/4)/(260/520). Suppose -3w + w + 8 = 0. Suppose 5r - 74 = -vl, l + 8 = -wr + 76. What is the tens digit of r? 1 Let t = 8 - 7. Let w be (1 - 0)/(t/(-51)). Let n = w - -133. What is the tens digit of n? 8 Let w(n) = 102n2 - 30n + 29. What is the units digit of w(-12)? 7 Suppose v = 56v - 1237445. What is the thousands digit of v? 2 Suppose 5g + 4b = 2391, -4g - b - 2b = -1912. Let l = -9 + g. What is the hundreds digit of l? 4 Let m = -559 + 818. Let r = m + -103. What is the tens digit of r? 5 Suppose r + 5z + 5 = 0, 26 = 4r - 69z + 66z. Suppose 0g + 5g - 4316 = 4d, -rg + 4288 = 3d. What is the units digit of g? 0 Suppose 107w - 112w = 20. What is the thousands digit of 1551 - (1/w - (-132)/(-48))? 1 Let a(c) = -27c - 43. Let v be a(-6). Let d = 267 - v. What is the tens digit of d? 4 Let c be (171/(-6) - 2)-2. Let l be 9/(6/(-63) - (-80)/336). Let i = l - c. What is the units digit of i? 2 Let b(w) = 45w2 + 154w - 2120. What is the ten thousands digit of b(18)? 1 Suppose -124d + 158859 = -101d - 283546. What is the hundreds digit of d? 2 Let l(j) = j*2 + j - 26. Let o be l(5). Suppose -ot = -v + 790 - 2137, 4v + 348 = t. Suppose -420 - t = -21b. What is the units digit of b? 6 Let q(s) = 98s - 109. Let t = 421 + -412. What is the tens digit of q(t)? 7 Let z(j) = -j2 - 8j + 1. Let o be z(-9). What is the hundreds digit of o/12 + (-2760)/(-9)? 3 Let g(f) = 3458f + 3052. What is the hundreds digit of g(10)? 6 Let g(x) = 15x*2 + 6x - 47. Let i be g(9). Suppose 27q = q + i. What is the tens digit of q? 4 Let r(d) = d3 + 8d*2 - 8d - 31. Let o be r(-6). Let l = 128 - o. What is the tens digit of l? 3 Suppose 3y + 9 = 0, 0 = -c - 7y + 2y + 277. Suppose 22 = -2o + c. What is the hundreds digit of o? 1 Let u(p) = -p*3 + 20p*2 - 75p - 18. Let k be u(15). What is the units digit of (k - -14) + 3 + 894? 3 Let b = 609 + -363. Let p = b + -66. What is the hundreds digit of p? 1 Let o be (-28)/14 + 1 + 16. Suppose -3m = 5c - 92, -4m + 77 + o = -c. What is the tens digit of (-16)/m - 195/(-9)? 2 Suppose 361u - 22975 = -5h + 356u, 3u = 3h - 13797. What is the thousands digit of h? 4 Let j(y) = -495y2 - 25y + 17 - 2y3 + y3 + 486y*2. What is the hundreds digit of j(-12)? 7 Suppose 32 = -7n + 3n. Let o(l) = -16l - 36. What is the units digit of o(n)? 2 Let k(v) = -v*2 + 17v - 28. Let d be k(15). Suppose -57 + 909 = 2o - dy, -1278 = -3o - 3y. What is the hundreds digit of o? 4 Let r(d) = 22d2 - 5d + 43. Let u be r(5). Let n = u + -179. Let y = n - 259. What is the tens digit of y? 3 Suppose 15i - 16 - 59 = 0. Suppose -iw = 4h - h - 1171, -2h + 774 = 5w. What is the hundreds digit of h? 3 Let v(a) = 118 - 363 - 35a + 173. What is the units digit of v(-5)? 3 Let m = 5531 - 5533. Let z be (-208)/(-7) + 2/7. What is the units digit of (25/(-3))/(m/z)? 5 Let r(m) = m*2 - 3m + 19. Let c(s) = s*3 + 13s*2 - 17s - 29. Let g be c(-14). What is the units digit of r(g)? 9 Suppose 7b = 874 - 34. Suppose 0 = -3u + 3x + b, 0 = -2u - 3x + 45 + 15. What is the units digit of u? 6 Let g = 897 - 893. Suppose 0 = -2p - 2, gp - 1335 = -2x + 55. What is the tens digit of x? 9 Let y be (-20)/1(-24)/60. Suppose y = -0x + 4x. Suppose -4t = -xt - 34. What is the tens digit of t? 1 Let m = 14477 - 11855. What is the hundreds digit of m? 6 Let q = 334 + -321. Suppose 0 = -3h - qh + 6464. What is the hundreds digit of h? 4 Let f = -495 - -16987. What is the thousands digit of f? 6 Suppose -688s - 2g = -684s - 154446, -15 = -5g. What is the tens digit of s? 1 Let z(n) = 4n**	{ "pile_set_name": "DM Mathematics" }
s of 2323952551? 641, 3625511 List the prime factors of 33243654. 2, 3, 19, 331, 881 List the prime factors of 295889319. 3, 11, 23, 199, 653 What are the prime factors of 3722731956? 2, 3, 2437, 42433 List the prime factors of 98335073. 211, 466043 List the prime factors of 1974183565. 5, 17, 61, 22397 List the prime factors of 281650805. 5, 113, 498497 List the prime factors of 369632063. 241, 1533743 List the prime factors of 87872176. 2, 7, 784573 List the prime factors of 2182234868. 2, 11, 49596247 List the prime factors of 105005422. 2, 479, 109609 List the prime factors of 1177938014. 2, 11, 151, 354587 List the prime factors of 4347363674. 2, 251, 8660087 List the prime factors of 17849341. 19, 939439 List the prime factors of 4286188. 2, 23, 46589 List the prime factors of 33063769. 61, 631, 859 What are the prime factors of 14884714? 2, 13, 19, 29, 1039 List the prime factors of 2629647. 3, 292183 List the prime factors of 414586025. 5, 7, 2369063 List the prime factors of 551712859. 31, 191, 93179 What are the prime factors of 89267614? 2, 44633807 List the prime factors of 2260991211. 3, 17, 271, 9623 What are the prime factors of 138517077? 3, 46172359 What are the prime factors of 78459881? 67, 659, 1777 What are the prime factors of 641323806? 2, 3, 29, 337, 10937 What are the prime factors of 22914156? 2, 3, 1909513 List the prime factors of 24260334. 2, 3, 7, 577627 What are the prime factors of 4386576? 2, 3, 91387 What are the prime factors of 1493798295? 3, 5, 11, 9053323 List the prime factors of 404394868. 2, 101098717 What are the prime factors of 98364488? 2, 31, 396631 List the prime factors of 1711085447. 409, 4183583 What are the prime factors of 143880155? 5, 67, 307, 1399 List the prime factors of 11706283. 11706283 What are the prime factors of 176070690? 2, 3, 5, 1956341 List the prime factors of 108986837. 1213, 89849 List the prime factors of 115638739. 43, 53, 50741 What are the prime factors of 91476191? 91476191 What are the prime factors of 44777420? 2, 5, 547, 4093 List the prime factors of 90421425. 3, 5, 79, 5087 What are the prime factors of 143489547? 3, 113, 199, 709 List the prime factors of 67095448. 2, 7, 1198133 List the prime factors of 12043152. 2, 3, 11, 7603 List the prime factors of 274612903. 274612903 List the prime factors of 902983516. 2, 225745879 What are the prime factors of 37563897? 3, 7, 17, 43, 2447 List the prime factors of 873365945. 5, 31, 37, 152287 List the prime factors of 892745356. 2, 53, 4211063 What are the prime factors of 119341250? 2, 5, 7, 23, 593 List the prime factors of 66854614. 2, 33427307 What are the prime factors of 812183519? 7, 19, 6106643 What are the prime factors of 171114836? 2, 19, 2251511 What are the prime factors of 1030331033? 1030331033 What are the prime factors of 173008177? 173008177 What are the prime factors of 1033709356? 2, 258427339 List the prime factors of 325376553. 3, 108458851 What are the prime factors of 458041776? 2, 3, 29, 329053 What are the prime factors of 586919402? 2, 293459701 List the prime factors of 27251694. 2, 3, 504661 List the prime factors of 284975551. 7, 5167, 7879 What are the prime factors of 23173789? 281, 82469 What are the prime factors of 26311679? 61, 431339 List the prime factors of 946658403. 3, 23, 811, 5639 What are the prime factors of 51113294? 2, 25556647 List the prime factors of 312671488. 2, 1221373 List the prime factors of 15899175. 3, 5, 70663 What are the prime factors of 6427052212? 2, 7, 83, 2765513 List the prime factors of 8399934404. 2, 2099983601 What are the prime factors of 782757555? 3, 5, 677, 77081 What are the prime factors of 462998837? 7, 241, 274451 What are the prime factors of 58729752? 2, 3, 271897 What are the prime factors of 129031136? 2, 13, 37, 83, 101 What are the prime factors of 394919194? 2, 181, 1090937 What are the prime factors of 11704319? 11, 1064029 List the prime factors of 24906148. 2, 23, 270719 What are the prime factors of 106721943? 3, 29, 433, 2833 List the prime factors of 3626004375. 3, 5, 7, 17, 5417 What are the prime factors of 42641518? 2, 349, 61091 What are the prime factors of 3149787259? 3149787259 List the prime factors of 213309399. 3, 577, 123229 List the prime factors of 68318555. 5, 97, 140863 What are the prime factors of 335253410? 2, 5, 33525341 What are the prime factors of 4890115160? 2, 5, 7, 17464697 List the prime factors of 426980930. 2, 5, 42698093 What are the prime factors of 214536463? 11273, 19031 What are the prime factors of 27425179? 27425179 What are the prime factors of 32505104? 2, 2031569 List the prime factors of 165611458. 2, 82805729 What are the prime factors of 172568059? 172568059 What are the prime factors of 891664844? 2, 7, 31845173 List the prime factors of 17681001. 3, 13, 19, 107, 223 What are the prime factors of 63042843? 3, 181, 116101 List the prime factors of 3927074967. 3, 233, 251, 829 What are the prime factors of 166649482? 2, 421, 197921 List the prime factors of 1866665580. 2, 3, 5, 13, 2393161 List the prime factors of 476694493. 11, 197, 219979 What are the prime factors of 74925140? 2, 5, 31, 120847 What are the prime factors of 194242315? 5, 38848463 List the prime factors of 39320283. 3, 13106761 What are the prime factors of 135514636? 2, 33878659 What are the prime factors of 581483329? 7, 83069047 What are the prime factors of 318899484? 2, 3, 59, 50047 List the prime factors of 3469226922. 2, 3, 7, 97, 10513 What are the prime factors of 1738114887? 3, 3911, 148139 What are the prime factors of 64900746? 2, 3, 179, 20143 List the prime factors of 184026067. 223, 825229 List the prime factors of 83132819. 7, 11, 1079647 What are the prime factors of 786503665? 5, 101, 1557433 List the prime factors of 188888928. 2, 3, 1967593 What are the prime factors of 284678331? 3, 7, 571, 23741 List the prime factors of 878353234. 2, 11, 599, 66653 What are the prime factors of 205564034? 2, 13, 17, 465077 What are the prime factors of 2203005278? 2, 14197, 77587 List the prime factors of 237897908. 2, 41, 373, 3889 List the prime factors of 152906038. 2, 29, 2636311 List the prime factors of 35109369. 3, 17, 2833 What are the prime factors of 552103886? 2, 229, 1205467 List the prime factors of 57250806. 2, 3, 9541801 List the prime factors of 2366908401. 3, 11, 13, 5517269 What are the prime factors of 630979663? 13477, 46819 List the prime factors of 177968557. 13, 37, 369997 List the prime factors of 1795506493. 11, 17, 29, 53, 6247 What are the prime factors of 52201679? 17, 331, 9277 List the prime factors of 1447547867. 11743, 123269 What are the prime factors of 1354554888? 2, 3, 56439787 List the prime factors of 50864998. 2, 47, 179, 3023 What are the prime factors of 948700566? 2, 3, 11, 1597139 What are the prime factors of 3630909261? 3, 7, 1033, 23911 List the prime factors of 119778853. 577, 207589 What are the prime factors of 15155286? 2, 3, 211, 11971 What are the prime factors of 146172835? 5, 137, 213391 List the prime factors of 105325616. 2, 11, 379, 1579 What are the prime factors of 201543943? 47, 109, 39341 List the prime factors of 28662828. 2, 3, 2388569 List the prime factors of 1178164794. 2, 3, 1823, 107713 What are the prime factors of 7166447? 7166447 List the prime factors of 439084394. 2, 7, 4480453 What are the prime factors of 1112458478? 2, 17, 5309, 6163 List the prime factors of 497771604. 2, 3, 11, 433, 2903 List the prime factors of 985704683. 22409, 43987 What are the prime factors of 640116311? 59, 10849429 What are the prime factors of 8310759? 3, 31, 89363 List the prime factors of 90197041. 11, 107, 197, 389 List the prime factors of 910180871. 37, 43, 271, 2111 What are the prime factors of 243580777? 11, 17, 1302571 List the prime factors of 111682686. 2, 3, 3557, 5233 What are the prime factors of 47066012? 2, 7, 1680929 What are the prime factors of 326870918? 2, 11, 14857769 List the prime factors of 51508220. 2, 5, 2575411 List the prime factors of 5433969734. 2, 6869, 395543 List the prime factors of 269044212. 2, 3, 239, 93809 List the prime factors of 83060132. 2, 229, 90677 What are the prime factors of 13432143? 3, 4477381 List the prime fa	{ "pile_set_name": "DM Mathematics" }
git of b? 3 Let a = 1 - 3. Let b = a - -4. Suppose -q - 4 = -3j + 4q, -bj + 4q = 0. What is the units digit of j? 8 Let g = 13 - 3. Let n(o) = 25o3 + o2 + 2o + 1. Let b be n(-1). What is the units digit of (g/b)/(2/(-60))? 2 Let k = -50 - -71. What is the units digit of k? 1 Suppose 4j = -4m + 84, 2j + 3m = 4m + 54. Suppose j = 3x - 17. What is the units digit of x? 4 What is the units digit of (-2 - -3)/(2/34)? 7 Let l(c) = c*3 - 7c*2 - 9c + 1. What is the tens digit of l(9)? 8 Suppose -5h = 5m - 30, -4h + 37 = -4m - 27. Let f = -25 + 18. Let j = h + f. What is the units digit of j? 4 Let x be (-2)/6 + 73/3. Suppose -18 = -w - 2w. Suppose -wk = -3k - x. What is the units digit of k? 8 Let d(x) = -2x - 15. Let f be d(-10). Suppose fh = -2y + 26, -3y - y = 2h - 68. What is the tens digit of y? 1 Let q be (1 + -2)(-27)/(-3). Let j(s) be the second derivative of s4/12 + 3s*3/2 + 6s2 + s. What is the units digit of j(q)? 2 Let v(t) = t2 + 5t - 4. Let j be v(-5). Let z be (6/(-9))/(j/30). Suppose -o - 2o + 9 = -w, w = zo - 19. What is the units digit of w? 6 Suppose -12 - 40 = -4f. What is the units digit of f? 3 Suppose 2k + 0r = 3r - 3, -4k + 4 = -4r. Suppose -5c = -kc + 36. What is the units digit of c? 6 Suppose 5s - 124 = 71. What is the tens digit of s? 3 Let t be 6(1/(-3) - 0). Let v be 1(t - -17)/3. Suppose 0 = -vd - 2z + 38, -d = -z - 0z - 2. What is the units digit of d? 6 Let j = -72 - -42. Let k = j - -52. Suppose -o - v + 6v = -k, 16 = o - 2v. What is the tens digit of o? 1 Let p be 11/(-2)0. Suppose 5n + a - 154 = p, -30 = n - 2n - a. Suppose 4c = 1 + n. What is the units digit of c? 8 Suppose -3k + 5 + 7 = 0. Suppose 61 = kt - 15. What is the units digit of t? 9 Suppose n - 10 = -68. What is the units digit of n/(-7) - (-4)/(-14)? 8 Let x(u) = -2u3 - u2 + 3u - 1. Let s be x(-3). Suppose -2m = -0m - 2f - 14, 4m - s = -3f. What is the units digit of m? 8 Let g = -4 - -8. Suppose 5p - gp = 22. What is the tens digit of p? 2 What is the units digit of (-25)/(4/(-56)1)? 0 Let x be 41/(-4)-4. What is the units digit of (-1 - x/2) + 8? 5 Suppose l - 10 = -l. What is the units digit of l? 5 What is the units digit of (-223)/(-9) + (-14)/(-63)? 5 Let p(n) = -4n + 3. Let j(r) = -2r + 1. Let w(x) = -5j(x) + 2p(x). Let k be w(1). Suppose 0 = 3a - a, kf + 3a = 15. What is the units digit of f? 5 Let u = -13 + -30. Let c = -22 - u. Let f = -11 + c. What is the tens digit of f? 1 Let i = 10 - 7. Let b be -8-2(-2)/4. Let g = i - b. What is the tens digit of g? 1 Let b(l) = -5l + 4. Let a be b(-4). Suppose -5f = -f + a. What is the units digit of 7/3 - f/(-18)? 2 Suppose -3i + 2i = -4d + 169, 0 = 4d + 4i - 144. What is the tens digit of d? 4 Let l(s) = -s*3 + 8s*2 - 9s + 8. What is the tens digit of l(6)? 2 Suppose 2 = j - k + 2k, -5j + 3k + 26 = 0. Suppose -3h = -j + 1, 5h = 5b - 170. What is the tens digit of b? 3 Suppose 0 = 5a - 248 - 72. Suppose -m - a - 57 = -4v, -5v = -4m - 154. What is the tens digit of v? 3 Suppose 4 = 4n - 4. Suppose -n = m + 23. What is the tens digit of (-5)/m + 128/10? 1 Let d(i) = -i3 + 2i*2 - 2i - 1. Let q be d(2). Let b = q - -8. What is the units digit of b? 3 Let b(h) = 2h2 - 9h - 7. Let y be b(7). Suppose -q + y = 2i, q + 2q = -3i + 42. What is the tens digit of i? 1 Let g = -18 - -21. Suppose 4c = 2v, -5v + 12 = gc - 1. What is the units digit of c? 1 Let f(j) = 2j2 - j + 1. What is the units digit of f(-4)? 7 Let t(p) = -p2 + 10. Suppose -r - 2r = 0. What is the tens digit of t(r)? 1 Suppose 4f - 20 = 8. What is the units digit of f? 7 Let w(x) = -x*2 - 14x + 4. Let t be w(-14). Suppose -4h = -tk - 48 - 136, -k - 148 = -3h. What is the tens digit of h? 5 Let l = 4 - 4. Suppose l = -3j + 6j - 108. What is the units digit of j? 6 Let a(p) = p2 + 0 - p2 + 3 + 2p + p*2. What is the units digit of a(-3)? 6 Suppose -k - 3g = k - 6, k - 3g + 6 = 0. Let a = -73 + 87. Suppose 3c + 2r + 0r - 14 = k, 2c - a = r. What is the units digit of c? 6 What is the tens digit of (-496)/(-10) - (-28)/70? 5 Suppose 3b = 4b - 22. What is the units digit of b? 2 Suppose -4n = 4 - 20. What is the units digit of (n + -3)/((-5)/(-25))? 5 Suppose 2v + 4v - 558 = 0. What is the tens digit of v? 9 Let n = 2 + 0. Suppose 9 = 2b + nb + 3f, b - 26 = 4f. What is the units digit of 4/b - 39/(-9)? 5 Suppose 6v - 2v = 0. What is the units digit of 40/5 + (v - 2)? 6 Let b = 50 - 33. What is the tens digit of b? 1 Suppose -16 = -4n - 4t, n - 5n - 5t + 14 = 0. Suppose 2v + 144 = nv. Suppose 4a + 8 = v. What is the units digit of a? 7 Let w = 574 - 386. What is the hundreds digit of w? 1 Suppose -3o - 2o = -20. Suppose 5q + 3 = -3k, -q + 2k + 2 = -6q. Suppose -2f + qf = -5t + 40, 4f = -ot + 60. What is the units digit of t? 0 Let u = 8 - -36. Suppose 4y + 0y = u. What is the tens digit of y? 1 Let k = -10 - -13. Suppose 0 = -3d + 4v + 32, -kd = d - 4v - 40. What is the units digit of d? 8 Suppose 5w = 6f - f - 40, 3w = 12. What is the units digit of f? 2 Suppose -4l + 27 = 2n - 5, -2l = 2. Suppose -n = -5z + 7. Suppose zu = 41 + 34. What is the tens digit of u? 1 Let i(v) = -2v + 6. Let t = 1 + -8. Let c be i(t). Suppose 2d + 0d - c = 0. What is the tens digit of d? 1 Let n = 128 + -41. What is the tens digit of n? 8 Suppose 34l - 32l - 276 = 0. What is the units digit of l? 8 Suppose -3x = -6x + 3v - 15, x = -2v + 1. What is the tens digit of 13 - (x - (-2 + 2))? 1 Suppose -2k = k + 4c - 44, -c + 45 = 5k. What is the units digit of k? 8 Suppose 1 + 2 = -2m - z, 0 = 3m + 2z + 6. Suppose -c + r + 4 = m, 0 - 4 = -2r. Let x(l) = 2l - 1. What is the tens digit of x(c)? 1 Let v(d) = -2d + 3d + 0d*2 + 4d2 + 3 - d3. What is the units digit of v(4)? 7 Suppose -3y + 114 = -0y. What is the units digit of y? 8 Suppose -2y + 384 = 2b, 5y - 224 = -b - 24. What is the units digit of b? 0 Let s be ((-16)/(-3))/((-8)/(-12)). Suppose -3a - s - 13 = -5v, 4v = -4a + 4. Suppose 0 = -c - 5j + 26, vc + 2c = j + 78. What is the units digit of c? 6 Let r = -194 - -274. Let s = 119 - r. What is the tens digit of s? 3 Let q = -108 + 268. What is the hundreds digit of q? 1 Suppose -4m = -5m + 4f + 50, -2m - 5f + 35 = 0. What is the units digit of m? 0 Suppose j = 4v - 5v, -3v - 2j = 0. Let o be 4/(1(2 + v)). Suppose -20 = -2t - o. What is the units digit of t? 9 Let g(y) = 6y*3 - y + 1. Let c = -8 + 9. What is the units digit of g(c)? 6 Let u(t) = -5t3 + t2 - t - 1. Let y be u(-1). Suppose 0 = -3a + 42 - y. What is the units digit of a? 2 Let o = 3 + -11. Let x be (-27)/(-3) + 20/5. Let p = o + x. What is the units digit of p? 5 Let s(h) = -3h*2 + 2 + 2h - h*2 + 3h*2 + 2h. Let r(t) = t - 2. Let k be r(6). What is the units digit of s(k)? 2 Suppose -4 = 2g - 58. What is the tens digit of g? 2 What is the units digit of 12(-5)/(-2) + -3? 7 Suppose 4r = 3r + 2. Suppose 21 = d + rd. What is the units digit of d? 7 Let q(u) = 2u*2 - 21u + 46. What is the hundreds digit of q(14)? 1 Suppose 3i + 40 = 181. Let p = 73 - i. What is the units digit of p? 6 Let i(u) = u3 - 4u*2 - 3u - 3. Let a be i(5). Let v = 1 + a. What is the units digit of v? 8 Let t = -53 + 36. Suppose -5m = -m + 48. Let f = m - t. What is the units digit of f? 5 Let a = -14 + 21. What is the units digit of a? 7 Suppose 0 = 2p - 4l + 19 + 15, 7 = -p + 4l. Let j = -15 - p. Suppose -4d - f = -18, 0 = 4d + 4f - j - 0. What is the units digit of d? 5 Let w = 6 - -135. What is the units digit of w? 1 Let z be -393/((-27)/6). Suppose 4u = z - 2. Suppose 3j - uj = -39. What is the tens digit of j? 1 Let r be 1/2 + (-57)/(-6). Let g be (r + -9)/((-1)/(-9)). Suppose 0f = -f + g. What is the units digit of f? 9 Suppose -4r + 18 = -r. Let u(z) = z3 - 5z*2 - 5z + 3. What is the units digit of u(r)? 9 Let j(d) = 12d2 + 2d - 1. What is the units digit of j(-2)? 3 Let w = 42 + -8. What is the tens digit of w? 3 Let a = -9 + 6. What is the units digit of a + -1 + 6 - 0? 2 Suppose -10 = 3g - 4g. What is the units digit of 2/g + (-445)/(	{ "pile_set_name": "DM Mathematics" }
of h(w) wrt w? 120w2 Let s(v) = v - 2. Let n be s(6). Let g be 3/(-12) - (-9)/n. Find the second derivative of -2p2 - p + pg + 0p wrt p. -2 Differentiate 16 + 33 + 123j*2 - 2 - 151j*2 wrt j. -56j Find the second derivative of 0s4 - 4s*4 + 8s*4 + s + 3s wrt s. 48s2 Let s(c) be the second derivative of 2c*6/3 + 5c*2/2 + 19c. What is the derivative of s(q) wrt q? 80q3 Let r(q) be the second derivative of 11q*4/12 - 19q*3/6 - 13q. Find the second derivative of r(c) wrt c. 22 Let p(s) = -23s4 + 12s*2 - 6s - 6. Let d(v) = -24v4 + 12v*2 - 7v - 7. Let n(g) = 6d(g) - 7p(g). What is the third derivative of n(l) wrt l? 408l Let n = 9 - 7. What is the third derivative of r2 + 4r*2 - 3r5 - rn wrt r? -180r2 Let x(k) = 2k + 15. Let v(o) = o + 1. Let f(c) = -12c - 24. Let d(w) = f(w) + 10v(w). Let s(i) = -7d(i) - 6x(i). Differentiate s(z) with respect to z. 2 Let w(g) be the second derivative of 5/6g3 + 0 + 1/6g*6 + 0g*5 + 0g*2 + 0g*4 + 5g. What is the second derivative of w(n) wrt n? 60n2 Find the third derivative of c3 - c - 9c*3 + 9c*2 + c wrt c. -48 Let c(l) = l - 1. Let w(f) = -4f + 11. Let p(k) = 3c(k) + w(k). Let h be p(6). What is the third derivative of -2d*3 + 0d*h - 5d*2 + 4d*2 wrt d? -12 Suppose -w - 3 = -3p + 5p, 0 = 3p + 9. What is the second derivative of -wg3 + 0g*3 + 4g - 2g + 0g*3 wrt g? -18g Let r(m) be the third derivative of m*9/756 - 7m5/120 + m3/2 + 6m2. Let s(c) be the first derivative of r(c). Find the second derivative of s(w) wrt w. 80w*3 Let h = -12 - -14. Let k be (-9)/(-2)4/6. Differentiate 0ph + 1 + pk + 0p*2 wrt p. 3p*2 Suppose 0 = 4j - 9j + 10. What is the third derivative of 4i*2 - 3i*2 - ji*4 + 5i*4 wrt i? 72i Let s(a) be the third derivative of 0a - 1/6a*3 - 6a*2 - 1/24a4 + 0. Find the first derivative of s(q) wrt q. -1 Let q(d) be the third derivative of d6/120 - d*3/6 + 15d*2. Differentiate q(p) with respect to p. 3p*2 Let x(g) = -3g3 + g2 - 2g - 10. Let u(h) = -13h*3 + 5h*2 - 9h - 41. Let j(b) = 4u(b) - 18x(b). What is the derivative of j(c) wrt c? 6c2 + 4c Suppose -t - 13 = 4y, 2t + 6 = -4. Let i = y + 5. What is the derivative of -4q2 - i - q2 + 6q*2 wrt q? 2q Let c = 1 + -1. Let n(a) be the first derivative of ca3 - 2 + 0a - 1/2a2 + 1/2a*4. What is the second derivative of n(s) wrt s? 12s What is the second derivative of -288q2 + 290q*2 - 2q + 13q wrt q? 4 Let g(q) be the third derivative of 0q - 7/6q3 - 4q*2 + 0 + 1/8q4. Find the first derivative of g(n) wrt n. 3 Let z(p) be the first derivative of -p6/15 - p*3/6 + 3p - 1. Let h(d) be the first derivative of z(d). What is the second derivative of h(y) wrt y? -24y2 Let a(w) = -15w*3 + 6w*2 + 4. Let n(t) = 45t*3 - 17t*2 - 11. Let j(z) = 11a(z) + 4n(z). What is the third derivative of j(u) wrt u? 90 What is the second derivative of -62u*2 - 28u*3 + 62u*2 - 24u wrt u? -168u Suppose -w + 0 = -2. What is the second derivative of -y4 + 2y - 3y + y4 + wy*4 wrt y? 24y*2 Let c be 13/(-2) + (-9)/6. Let v = -4 - c. Find the second derivative of 7m*3 + vm + 3m2 - 3m*2 - 6m*3 wrt m. 6m Suppose -25 = 5f, f - 3 = -2n - 4. Let d = n + 2. What is the third derivative of 2v4 - 3vd - v2 + 3v2 wrt v? -24v Differentiate -4 + 2 + 7l + 4 with respect to l. 7 Suppose -5d + 164 = 2o, 3d - 78 = -5o + 28. Suppose -4g + 2i + 7 = -17, d = 4g - 4i. What is the derivative of -g + 0 + 4 - y2 - 1 wrt y? -2y Let n = -15 - -8. Let h(l) be the second derivative of 11l4/12 - 3l*2 + 3l. Let s(o) = 6o2 - 3. Let w(v) = ns(v) + 4h(v). Differentiate w(i) wrt i. 4i Let g = -3 + 15. Suppose 2r - b - g = -5b, -5b = -4r + 11. Find the first derivative of -r + 3 - 2k2 - 2 wrt k. -4k Find the third derivative of 159n4 - 9n*6 - 159n*4 + 4n*2 wrt n. -1080n*3 Let q(j) be the first derivative of 3j5/20 + j4/12 + 4j + 4. Let r(i) be the first derivative of q(i). Find the third derivative of r(t) wrt t. 18 Suppose 0d = 3d - 9. What is the second derivative of i5 - 2i*5 + di*5 + 2i + 0i wrt i? 40i3 Let l(a) be the third derivative of a8/56 + a*5/30 - 11a*2. What is the third derivative of l(t) wrt t? 360t2 Let w(f) be the third derivative of -f6/120 + f5/15 - f4/12 - f*3/2 + 2f2. Let p be w(3). What is the derivative of 3 + p - k4 - 4 wrt k? -4k3 Differentiate 72v*4 - 62v*4 + 2 + 7 with respect to v. 40v*3 Let n be 25/10 + (-1)/(-2). What is the second derivative of -4a + 0a - 4a*n + 0a wrt a? -24a Let j(o) be the third derivative of -2o*2 + 0 + 1/21o*7 + 0o*3 + 0o*5 + 1/12o*4 + 0o + 0o6. Find the second derivative of j(n) wrt n. 120n2 Let f(k) be the second derivative of k5/5 + 7k3/6 - 10k. Find the second derivative of f(o) wrt o. 24o Let d(a) be the third derivative of a5/12 - a3/6 + 2a*2. Differentiate d(v) wrt v. 10v What is the second derivative of -11k3 - 5k + 8k - 6k*3 wrt k? -102k Let x(b) be the second derivative of b*6/6 + 3b*2 + 5b. What is the first derivative of x(i) wrt i? 20i3 Let q(f) = -f + 12. Let g be q(10). Suppose -gx + 7 - 1 = 0. What is the first derivative of -1 - 3c + xc + 2c wrt c? 2 Let v(u) be the third derivative of 25u*4/12 - 4u*3 - 4u*2 + 10. Find the first derivative of v(l) wrt l. 50 Let t(x) be the third derivative of 0x + 0x3 - 1/8x*4 + 1/60x*6 - 6x*2 + 0 + 0x*5. Find the second derivative of t(j) wrt j. 12j Let z(j) = -11j5 + 2j*4 + 2j + 2. Let v(c) = 34c5 - 7c4 + c2 - 7c - 7. Let s(l) = -2v(l) - 7z(l). Find the third derivative of s(f) wrt f. 540f2 Let y(u) = -u5 + u4 + u. Let q = 20 - 21. Let c(m) = m5 + 5m4 + 14m. Let h(t) = qc(t) + 5y(t). What is the second derivative of h(s) wrt s? -120s3 Let p(d) be the third derivative of 1/6d*3 + 0d - 5d2 + 0 + 5/24d4. What is the first derivative of p(s) wrt s? 5 Let b(m) be the first derivative of -m5 - 6 - 1/2m2 + 0m*3 + 0m*4 + 0m. What is the second derivative of b(t) wrt t? -60t2 Suppose -18 = m - 4m. Find the third derivative of j*2 - 8j*4 + mj2 - j2 + 12j4 wrt j. 96j Let k(l) be the first derivative of 2/3l3 + 1 + l + 0l*2. Find the first derivative of k(m) wrt m. 4m Let j(k) be the second derivative of 0 + 0k2 + 0k*3 + 3k + 0k5 - 1/4k*4 + 1/30k*6. Find the third derivative of j(g) wrt g. 24g Let i = 3 + -1. Suppose 0 = 5x - 7 - 3. What is the first derivative of 0f + x + f + if wrt f? 3 Let b(i) be the third derivative of -7i*2 + 0i*3 - 1/112i*8 + 1/24i*4 + 0i*7 + 0i*6 + 0i + 0 + 0i5. What is the second derivative of b(x) wrt x? -60x*3 Find the first derivative of -41c + 29c - 4 + 24c wrt c. 12 Let g = 3 + 1. Differentiate -2u3 + 2u3 - ug + 2 - 2u4 with respect to u. -12u3 Let k(y) be the third derivative of y9/15120 + y6/240 + y5/12 + 4y2. Let i(c) be the third derivative of k(c). Find the first derivative of i(f) wrt f. 12f*2 Let p be 1/510/8. Let x(s) be the first derivative of 0s3 + 0s*2 - 3 - ps*4 + 3s. Find the first derivative of x(b) wrt b. -3b2 Let i(y) = -3y - 6. Let m be i(-3). Find the second derivative of mr - 4r*2 + 2r - 6r wrt r. -8 Find the third derivative of -t2 - 12t*5 + 6t*2 + 0t*2 wrt t. -720t*2 Let r be (-9)/6(-4)/3. What is the third derivative of -10lr + 203 - 203 - 6l*5 wrt l? -360l*2 Find the third derivative of -95j + 5j2 + 95j + j*2 + 31j*3 wrt j. 186 What is the third derivative of -3i*3 - 42i*2 + 7i*3 + 7i*6 - 4i*3 wrt i? 840i3 Find the third derivative of 1 - b2 + 5b3 - 1 + 5b*2 wrt b. 30 Let s be (-22)/(-5) + (-27)/(-45). What is the third derivative of 0o*4 - so*4 - 4o2 + o4 - 7o2 wrt o? -96o Let v(m) = 5m3 - 24. Let r(q) = -14q*3 + 72. Let n(s) = 2r(s) + 7v(s). What is the first derivative of n(l) wrt l? 21l*2 Let c(f) = -1 - f + 4f + 6 - 1. Let x(t) = -t*2 + 9t + 11. Let y(a) = -11c(a) + 4x(a). Find the second derivative of y(q) wrt q. -8 L	{ "pile_set_name": "DM Mathematics" }
(o) = 1558o2 - 14o + 14. Let h(u) = -3j(u) - 7m(u). Determine h(v(g)). 12576g4 Let g(s) = -14s*2 - 1866s + 2. Let o(r) = -45r. What is g(o(c))? -28350c*2 + 83970c + 2 Let d(s) = -s. Suppose -4f + 502 = -o, f - 4f + 369 = 3o. Let v(x) = 125 - 712x - f + 47x. Give d(v(c)). 665c Let r(p) = -2p - 19. Let q(m) = 14m + 114. Let s(g) = -q(g) - 6r(g). Let c(y) = 532y. What is c(s(v))? -1064v Suppose -v - 17 = -5i + 8, 13 = -3i - 5v. Let o(f) = -4f + 2f*2 - 14f*2 + if. Let l(w) be the third derivative of w*4/24 - 22w*2. Determine o(l(z)). -12z*2 Let s(h) = -10h*2 - h - 3. Let n be s(-1). Let x be -100(3/n - 0). Let f(z) = 6z + 8z - xz. Let v(j) = 3j*2. Give v(f(r)). 363r*2 Let j(y) = -18 - 15 - 2y - 16 + 47. Let t(o) = 8o. Determine j(t(c)). -16c - 2 Let l(r) = 15r. Let d be (0/2 - 1) + (155 - 13). Let t = d - 84. Let i(w) = -31w + tw - 27w. Determine i(l(b)). -15b Let l(b) = 196090b. Let u(t) = -8t2 - t. Give u(l(r)). -307610304800r*2 - 196090r Let g(n) = -4n. Let b(c) = 473c. Let o(h) = 2b(h) + 110g(h). Let l(p) = 16p2. Calculate l(o(q)). 4096576q*2 Let j(m) = 119m. Let z(f) = 161f. Let l(w) = 3102w. Let u(k) = 4l(k) - 77z(k). What is j(u(a))? 1309a Let c(q) = 57q. Let y(p) = -1831p + 890p + 912p. What is y(c(g))? -1653g Let y(w) = -21w2. Suppose 0 = -39v + 12v + 14v. Let f(n) be the third derivative of -18n2 - 1/30n*5 + 0n*3 + 0 + 0n*4 + vn. Calculate y(f(s)). -84s4 Let d(o) = 65o*2. Let i(t) = -55t - 12t + 1 + 74t - 24t - 14t. What is d(i(h))? 62465h2 - 4030h + 65 Let y(p) = -p - 2. Let q(l) = -128l - 642. Give q(y(k)). 128k - 386 Let o(g) = 487g2. Let w(h) = -2h*2 + 50790. Calculate w(o(t)). -474338t*4 + 50790 Let v(z) = -2z. Let p(w) be the first derivative of -76w2 - 1206. What is p(v(q))? 304q Let p(g) = -g. Let q(u) = -226u2 + 465u - 6. What is q(p(s))? -226s2 - 465s - 6 Let t(v) = 16v - 1. Let y(k) be the first derivative of -57k*2/2 + k + 10902. What is t(y(n))? -912n + 15 Let x(h) = h. Let g(i) be the first derivative of -9/20i5 + 0i*4 - 9i*2 + 0i*3 + 2 + 0i. Let a(q) be the second derivative of g(q). Determine a(x(j)). -27j2 Let q(g) = 3g. Let k(l) = -4l + 30. Let w be k(0). Suppose -3z = -3y - w, -y + 20 = 2z + y. Let f(v) = -5v + 8v - zv2 - 3v. Determine f(q(a)). -90a2 Let y(o) = -4o*2 + 11o*2 + 14 - 14. Let r(m) = -15m*2 - 2m - 2. Let s(q) = 418q2 + 57q + 57. Let b(a) = -57r(a) - 2s(a). What is b(y(w))? 931w4 Let v(b) = -78 + 28 + 53 - 5b. Let o(s) = 6s2. What is v(o(i))? -30i*2 + 3 Let r(g) = 9133g. Let x(t) = t*2 + 79244t. Give r(x(u)). 9133u2 + 723735452u Suppose 3w = 5q - 16, -4w - 5q + 13 = -8w. Let l be 0/(-2) - (-1 - w). Let s(y) = 226y - 226y + ly2. Let p(i) = -i2. Calculate s(p(m)). 4m4 Let l(j) = -47j*2 + 17. Let y(b) = 16b*2 - 6. Let n(i) = -6l(i) - 17y(i). Let k(f) be the second derivative of -f4/6 - 21146f. Give n(k(d)). 40d4 Let c(l) = 3l. Let f(j) = -369029j2 + 197j. Determine f(c(t)). -3321261t2 + 591t Let t(s) = 15811s2. Let u(o) = 61o*2. Determine u(t(y)). 15249250981y*4 Let c(n) = -1769n. Let r(x) = 2731x + 1. Determine r(c(g)). -4831139g + 1 Let j(r) = 144r - 220r + 176r + 79r. Let b(q) = 10q2. Determine b(j(t)). 320410t*2 Let o(y) = 3y - 5087. Let s(m) = -9m - 23. Give o(s(p)). -27p - 5156 Let k(s) = s*2 + 548. Let o(m) = 38m + 6. Let z(d) = -13d - 2. Let b(r) = -o(r) - 3z(r). Give b(k(g)). g*2 + 548 Let g(r) = 4r. Let f(a) = -428a2 + 2a - 162 + 109 + 53. Calculate f(g(m)). -6848m2 + 8m Let w(l) = -l - 6488. Let f(n) = 6n2 - 10n. Calculate w(f(m)). -6m2 + 10m - 6488 Let r(m) = -12394444m. Let d(j) = -4j. Give d(r(n)). 49577776n Let i(v) = 3v*2. Let g(b) = -2. Let t(h) = -2h - 14. Let p(a) = -90g(a) + 5t(a). Give i(p(r)). 300r2 - 6600r + 36300 Let f(a) = 6a2 + 2a + 499. Let i(p) = 128p + 7. Determine f(i(k)). 98304k*2 + 11008k + 807 Let h(m) = 2m. Let r(s) = 11169695s. What is r(h(y))? 22339390y Let x(q) = -7q. Let h(t) = -5t - 3t - 5t. Let i(l) = 6h(l) - 11x(l). Let s(b) = -234b*2. Determine i(s(w)). 234w*2 Let c(l) = 72l*2. Let u = -36 - -45. Let r(v) = -7v - 2v + 2v + uv. Give r(c(f)). 144f*2 Let f(m) = 2711m*2 + 10m - 10. Let n(h) = 11014794h2 + 40635h - 40635. Let k(v) = 16254f(v) - 4n(v). Let y(u) = u*2. What is y(k(o))? 29354724o4 Let j(x) be the first derivative of x5/10 + 3x2 + 5x + 11. Let d(p) be the second derivative of j(p). Let o(n) = -9n. Determine o(d(i)). -54i*2 Let c(s) = 241s*2. Let v(r) = -140r. Let u(x) = -83x. Let k(f) = 5u(f) - 3v(f). Give c(k(l)). 6025l*2 Let n(h) = 3560h + 2. Let o(b) = 14b - 3. What is n(o(r))? 49840r - 10678 Let b(c) = -c*2 + 2c. Let v(o) = 4o2 - 12o. Let j(w) = 6b(w) + v(w). Let u(g) = -5g - 2. Let x(s) = s + 1. Let p(z) = u(z) + x(z). Determine j(p(i)). -32i2 - 16i - 2 Let c(a) = -38a - 25. Let s(v) = 390v*2 - v - 2. Give c(s(p)). -14820p*2 + 38p + 51 Let k(q) = -3q. Suppose -3m = 9a - 11a + 2, 3m + 5 = 5a. Let y(p) be the third derivative of -15p2 + 5/6p*4 + 0p + 0p3 + m. What is y(k(d))? -60d Let f(n) = 68n2 + 2. Let x(l) = -13l + 4. Let b(g) = 43g - 13. Let u(j) = 4b(j) + 13x(j). Give f(u(r)). 612r*2 + 2 Let s(k) = 13923200k. Let n(z) = z*2. Determine s(n(v)). 13923200v*2 Let z(r) = 44945r - 912. Let w(i) = -3i2. Determine z(w(m)). -134835m*2 - 912 Let p(y) = 12y*2. Let r(n) = -1 - 10n - 12 + 22n - 3n - 16n. What is r(p(k))? -84k*2 - 13 Let t(j) = j. Let m(c) = 673294153c*2. Give t(m(k)). 673294153k*2 Let n(w) = -29w*2. Let m(k) be the third derivative of 79k*4/8 + 7848k*2. Give n(m(j)). -1628901j*2 Let l(y) = -3y. Let g(t) = 4t2 - 105t + 3. Let m(b) = 6b2 - 190b + 5. Let a(s) = -5g(s) + 3m(s). Determine a(l(h)). -18h2 + 135h Let s(z) be the second derivative of 0z3 + 21z + 0z2 - 2 - 1/4z*4. Let y(r) = 38r. Determine s(y(v)). -4332v2 Suppose 5h - 4d - 102 = 0, -80h - 2d = -76h - 66. Let v(y) be the first derivative of -h - 4/3y3 + 0y*2 + 0y. Let z(t) = -10t2. What is z(v(l))? -160l*4 Let i(d) = 27d*2. Let j(s) = 6 - 128s + 376s - 123s - 126s. Calculate j(i(h)). -27h*2 + 6 Let w(p) be the first derivative of 0p*3 + 0p*4 + 1/60p*5 + 23 + 0p - 7p2. Let r(g) be the second derivative of w(g). Let d(b) = -23b. Give d(r(t)). -23t2 Let o = -4579 + 4582. Let r(h) be the third derivative of 0 + 1/6h*4 + 5h*2 + 0h + 0ho. Let z(f) = f2. Calculate r(z(q)). 4q*2 Let x(p) = 3p*2 + 2p - 4. Let r(h) = -25h2 - 17h + 34. Let i(q) = -6r(q) - 51x(q). Let c(a) = a - 27. Calculate c(i(f)). -3f2 - 27 Let n(h) = h2. Let i be -6(-7 + 4/1 + 1). Let b(o) = 7o2 - 7o*2 - io*2. What is b(n(m))? -12m*4 Let j be (-6 + 24/4)/(2/(-2)). Suppose 11z - 12 - 21 = j. Let o(x) = 0 + 31x - z + 3. Let t(k) = 2k*2. What is o(t(g))? 62g*2 Let i(f) = 40f*2. Let o(v) = 1951v - 102. What is o(i(l))? 78040l2 - 102 Suppose -10869 = -296q + 1730 - 1647. Let z(h) be the first derivative of 0h2 + q - 5/3h*3 + 0h. Let l(r) = 6r. What is z(l(j))? -180j*2 Let o be ((-20)/14)/(2/(-14)). Let w be (9910/o)/((2/4)/1). Let y(t) = -1982t + 7t2 + wt. Let x(a) = a. Calculate y(x(d)). 7d2 Let y(m) be the first derivative of -m5/3 - m3/3 - 2m*2 + 14m + 110. Let d(a) be the second derivative of y(a). Let p(x) = 2x. Give p(d(n)). -40n*2 - 4 Let g(a) = 3a*2. Let t(r) = 28247406r*2. Give g(t(m)). 2393747837186508m*4 Let m(o) = -10o - 33 + 24 + 9 - 10o. Let v(n) be the third derivative of -n4/3 + 4n*2. Determine v(m(i)). 160i Let y(r) = -450r2. Let o(k) be the first derivative of k2/2 - 808. What is y(o(w))? -450w*2 Let w be (-10 + 7)(-8)/(-36)-3. Let k(n) = 9n*2 - 47n*w + 19n*2. Let u(c) = -11c. Calculate k(u(p)). -2299p2 Let s(j) = -128j*2. Suppose -80x = -94x + 28. Let n(w) = -xw*2 - 18153 + 18153. What is s(n(z))? -512z*4 Let y(a) = 74a + 20. Let c(l) = 222l + 56. Let f(q) = -10c(q) + 28y(q). Let p(n) = 2n**2. Give p(f(i)). 43808	{ "pile_set_name": "DM Mathematics" }
4, p: 1}? 4/15 What is prob of picking 1 a and 1 v when two letters picked without replacement from auvvuuuavuuuuuuuuuuu? 3/95 Three letters picked without replacement from opokookkoooemgoooopo. What is prob of picking 3 k? 1/1140 Four letters picked without replacement from {s: 1, n: 2, f: 6, a: 6, x: 2, z: 3}. What is prob of picking 1 a and 3 f? 8/323 Calculate prob of picking 2 h and 1 z when three letters picked without replacement from zhrhhddzhzhh. 9/44 What is prob of picking 2 g, 1 p, and 1 h when four letters picked without replacement from ppmppgphgmphhkkmha? 2/255 What is prob of picking 2 n and 1 a when three letters picked without replacement from ntkaaktaan? 1/30 Calculate prob of picking 2 a when two letters picked without replacement from {a: 2, d: 5}. 1/21 Calculate prob of picking 2 l when two letters picked without replacement from {g: 5, t: 1, b: 1, l: 2}. 1/36 Calculate prob of picking 2 g when two letters picked without replacement from {c: 6, p: 4, g: 5}. 2/21 Three letters picked without replacement from {w: 1, f: 7}. Give prob of picking 3 f. 5/8 Calculate prob of picking 4 i when four letters picked without replacement from biibdbdiidddf. 1/715 Three letters picked without replacement from {s: 2, a: 2, d: 8, v: 1}. What is prob of picking 1 v and 2 a? 1/286 Four letters picked without replacement from zozozooozzzozozz. What is prob of picking 1 z and 3 o? 9/52 What is prob of picking 1 y, 1 o, and 2 q when four letters picked without replacement from {g: 2, q: 3, y: 4, n: 3, o: 1, s: 3}? 3/455 Calculate prob of picking 2 r when two letters picked without replacement from {h: 1, r: 2}. 1/3 Three letters picked without replacement from ggwgggggggwgggwgwggg. Give prob of picking 2 w and 1 g. 8/95 What is prob of picking 3 o and 1 u when four letters picked without replacement from {e: 2, d: 4, u: 2, q: 2, o: 7}? 1/34 Three letters picked without replacement from {j: 7, k: 4, z: 3, m: 5}. What is prob of picking 1 k and 2 j? 28/323 Three letters picked without replacement from kkvkvgkvkvvvg. Give prob of picking 2 g and 1 k. 5/286 Three letters picked without replacement from auuiu. Give prob of picking 3 u. 1/10 Four letters picked without replacement from {x: 1, l: 7}. Give prob of picking 4 l. 1/2 Three letters picked without replacement from {k: 1, z: 2, f: 2, l: 2, d: 12}. Give prob of picking 2 l and 1 d. 4/323 Four letters picked without replacement from {y: 4, b: 4, x: 9}. What is prob of picking 4 y? 1/2380 Three letters picked without replacement from {h: 3, m: 2, v: 2, r: 2}. What is prob of picking 1 m and 2 v? 1/42 Four letters picked without replacement from hnhnhnhhnnhhn. What is prob of picking 2 h and 2 n? 63/143 Calculate prob of picking 1 g and 2 u when three letters picked without replacement from {g: 6, u: 13}. 156/323 Calculate prob of picking 3 x and 1 j when four letters picked without replacement from {s: 3, x: 7, j: 4}. 20/143 Calculate prob of picking 3 s when three letters picked without replacement from {o: 5, s: 3}. 1/56 Calculate prob of picking 3 v when three letters picked without replacement from uuvvuvvvuu. 1/12 Two letters picked without replacement from ggbpbgbnpgbpgggbbgg. What is prob of picking 1 p and 1 g? 3/19 Four letters picked without replacement from {y: 9, v: 3, r: 4}. What is prob of picking 1 v and 3 y? 9/65 Calculate prob of picking 1 z and 2 e when three letters picked without replacement from {a: 3, q: 3, n: 1, z: 1, k: 2, e: 5}. 2/91 What is prob of picking 2 v and 1 m when three letters picked without replacement from {x: 6, m: 4, v: 9}? 48/323 Three letters picked without replacement from {c: 9, t: 2, s: 6}. Give prob of picking 3 c. 21/170 Three letters picked without replacement from lllllslssl. Give prob of picking 1 s and 2 l. 21/40 Calculate prob of picking 2 m when two letters picked without replacement from {m: 2, z: 5, c: 1, i: 11}. 1/171 Two letters picked without replacement from {d: 10, l: 10}. What is prob of picking 2 l? 9/38 What is prob of picking 1 k and 2 i when three letters picked without replacement from kikkpckkcikv? 3/110 Two letters picked without replacement from {s: 3, x: 4, f: 4}. Give prob of picking 1 f and 1 s. 12/55 Four letters picked without replacement from bbbbbbbbxbbb. Give prob of picking 1 x and 3 b. 1/3 Four letters picked without replacement from {w: 11, l: 1, o: 1, q: 4, h: 2}. Give prob of picking 1 w, 1 h, 1 l, and 1 o. 11/1938 Calculate prob of picking 1 c, 1 v, and 1 k when three letters picked without replacement from {v: 2, c: 3, z: 2, q: 1, k: 4}. 6/55 Four letters picked without replacement from qstsk. Give prob of picking 1 k, 2 s, and 1 t. 1/5 Four letters picked without replacement from shhhhhbffhhhsb. What is prob of picking 2 h and 2 f? 4/143 Calculate prob of picking 1 n and 3 f when four letters picked without replacement from {n: 9, f: 9}. 21/85 What is prob of picking 2 u when two letters picked without replacement from uuwuuuw? 10/21 Calculate prob of picking 1 v and 2 z when three letters picked without replacement from oczrvnz. 1/35 Two letters picked without replacement from {j: 3, b: 3, p: 2, a: 1, w: 2, t: 1}. Give prob of picking 1 p and 1 b. 1/11 Calculate prob of picking 1 e and 1 f when two letters picked without replacement from ffvvseefsyevessemf. 20/153 Two letters picked without replacement from {k: 3, g: 1, d: 3, u: 1, a: 3}. Give prob of picking 1 k and 1 g. 3/55 What is prob of picking 1 o and 1 i when two letters picked without replacement from qmioioqqommmoqmqqqq? 8/171 Calculate prob of picking 2 n and 2 u when four letters picked without replacement from {n: 5, p: 1, u: 4}. 2/7 Calculate prob of picking 2 i when two letters picked without replacement from vjjijjjvivvvjj. 1/91 What is prob of picking 1 q and 1 n when two letters picked without replacement from ncbqkqfbfccfkkkcq? 3/136 Two letters picked without replacement from {p: 1, o: 2, b: 7}. What is prob of picking 1 p and 1 o? 2/45 What is prob of picking 1 x and 2 k when three letters picked without replacement from lpppkppxkpfpxkpkppxk? 1/38 Calculate prob of picking 1 e, 1 a, and 2 s when four letters picked without replacement from {a: 1, o: 1, e: 1, x: 1, p: 1, s: 2}. 1/35 Three letters picked without replacement from {a: 3, g: 13, o: 2}. Give prob of picking 2 g and 1 o. 13/68 Calculate prob of picking 2 y and 1 c when three letters picked without replacement from yccycccc. 3/28 Three letters picked without replacement from hcmcseshhedmmm. Give prob of picking 1 s, 1 e, and 1 m. 4/91 What is prob of picking 1 i, 1 m, and 1 s when three letters picked without replacement from imsep? 1/10 What is prob of picking 1 q and 1 r when two letters picked without replacement from qrrsrrjjrjjssss? 1/21 Four letters picked without replacement from hzqzqhqgzzwzgqwzzq. What is prob of picking 1 g, 1 q, and 2 h? 1/306 What is prob of picking 1 q and 1 u when two letters picked without replacement from {i: 1, q: 3, u: 1, m: 2, t: 1, z: 4}? 1/22 Three letters picked without replacement from geeggegggeg. Give prob of picking 2 e and 1 g. 14/55 Calculate prob of picking 1 x and 1 p when two letters picked without replacement from xxxxpxxxpxxxxxxxxpxx. 51/190 Four letters picked without replacement from {z: 2, o: 4, u: 2, e: 1, d: 5, k: 1}. What is prob of picking 1 e, 2 o, and 1 d? 2/91 Two letters picked without replacement from fsurbeb. What is prob of picking 1 b and 1 u? 2/21 Two letters picked without replacement from yyqyqqqqyqyqqqqyqq. Give prob of picking 1 y and 1 q. 8/17 Calculate prob of picking 2 z when two letters picked without replacement from {s: 3, d: 2, z: 9, h: 1, q: 3}. 4/17 Calculate prob of picking 2 j when two letters picked without replacement from hjjhxnphjhxpxjxjj. 15/136 Four letters picked without replacement from {n: 4, s: 2, w: 7, z: 4, p: 1}. Give prob of picking 2 w and 2 s. 7/1020 Calculate prob of picking 1 m and 1 h when two letters picked without replacement from {h: 6, x: 5, k: 1, z: 1, m: 2}. 4/35 Calculate prob of picking 1 j, 1 c, and 1 r when three letters picked without replacement from {j: 3, t: 1, v: 3, r: 1, z: 11, c: 1}. 1/380 What is prob of picking 1 w and 3 q when four letters picked without re	{ "pile_set_name": "DM Mathematics" }
et w(r) = -r - 7. Give w(h). -7 Let x(k) = -k - 5. Let r(y) = y + 5. Let n(d) = 3r(d) + 2x(d). Suppose -1200a = -1203a - 24. What is n(a)? -3 Let c(t) = -6t - 32. Let b(d) = -5d - 31. Let a(h) = 7b(h) - 6c(h). Give a(0). -25 Let r(b) = b2 - 3. Let d = -27 + 25. Let x be d/(-5) - 12/30. Determine r(x). -3 Let t = 18 + -21. Let m(v) = -237 + 473 - 235 + v. What is m(t)? -2 Suppose -r + 24 - 16 = 0. Let n(q) = q - 14. What is n(r)? -6 Let f(x) be the first derivative of x4/4 - 4x3/3 - x2/2 + 5x + 102. Give f(4). 1 Suppose -q = 5g + q - 56, -16 = -g - 2q. Let c = 7 - g. Let r be ((-32)/(-6))/4c. Let l(p) = -p3 - 3p*2 + 4p + 6. What is l(r)? 6 Let t(v) = -v - 6. Let f = 20 - 23. Let d be t(f). Let s be ((-4)/6)/(d/18). Let u(y) = -y - 4. Calculate u(s). -8 Let h(b) = -3b2 + 4b2 + b2 - b*3 - 1 + 0b*3. Let l = -2 + 1. Let c be ((1 - l) + -4)/(-2). Give h(c). 0 Let r(q) = -3q*3 + 2q + 2. Suppose -4z - 19 = -5l, 0 = -18z + 19z - l + 4. What is r(z)? 3 Let t(s) = -s*2 + 23s + 3. Let i(c) = 3c - 1. Let z(h) = 5i(h) - t(h). Calculate z(8). -8 Let g(a) = 0 + 19 - 2 + a. Calculate g(-11). 6 Let f(r) = r*2 - 4r + 4. Let x(o) = -2o2 - 14o + 3. Let l be x(-7). Determine f(l). 1 Let g be 0/(66/6 - 9). Let n(y) = 3y - 2. Give n(g). -2 Let b(j) = -j2 - 14j - 14. Suppose 0 = -3m + 2f - 20 - 8, 4m + 36 = 3f. Give b(m). 10 Suppose 0 = h - 3o + 4o - 2, -2h - 8 = -o. Let n = 8 - h. Let u(y) = 7 + ny - y*2 - 4y + 2y2. Determine u(-6). 7 Let w(k) = k2 - 5k + 4. Let u(z) = -4z - 70. Let d be u(-19). Give w(d). 10 Let b(p) = p3 - 2p*2 - p - 3. Let t be b(0). Let c(q) = -2q*3 - 7q*2 - 4q - 4. Calculate c(t). -1 Suppose 4i - 3x - 5 + 17 = 0, 0 = 4i - 2x + 12. Let z = i - -9. Let c(g) = 5g2 - zg2 + 2 - 1. Give c(-2). -3 Let f(a) = a2 - 4a - 2. Let v(p) = p3 + 22p*2 + 4p + 94. Let u be v(-22). Give f(u). 10 Let o(g) = -6g3 + 12g*2 - 5g - 20. Let c(w) = 7w3 - 12w*2 + 4w + 21. Let s(v) = 5c(v) + 6o(v). Determine s(11). -4 Let p(b) = b*2 - 7b - 28. Suppose -193 = -46d + 313. What is p(d)? 16 Let u(f) = 3f - 2. Let p(r) = 1. Let i(b) = -b*3 + 3b*2 - b - 2. Let a be i(3). Let n(g) = ap(g) - u(g). What is n(-5)? 12 Let n(i) = -i*3 - 5i*2 - 2i - 10. Let g = 156 - 161. Give n(g). 0 Suppose 5 = 5o + 5w, 17o - 20o - 5w - 5 = 0. Let f(a) be the second derivative of -11a + 0 - 1/20ao + 1/4a4 + a2 + 1/6a3. What is f(3)? 5 Let o = 30 + -31. Let m(p) = -9p - 2. Let v(u) = u. Let r(i) = om(i) - 5v(i). What is r(2)? 10 Let r(d) = -d*2 + 2d + 3 + 2d + d + 1. Let t be -2 - 0/(-3) - -8. What is r(t)? -2 Let b(l) = l3 + 10l*2 - 1. Suppose 4v + 28 = 4t - 32, 5t = 4v + 65. What is b(v)? -1 Let j(l) = 9 + 8 + 14l*3 - 14l - 8l3 - 4l*3 - 3l*3 - 16l*2. Give j(-15). 2 Let w(m) = 15m*2 + 2m + 1. Let b = -47 + 46. Calculate w(b). 14 Suppose 13q = 55 + 36. Let f = 0 - -2. Let k(g) = -3g + 5 + fg + 0 + 5. Calculate k(q). 3 Let v be (12/(-20))/(1/(-5)). Suppose 0 = -2q - q + v. Suppose 0 = -i - 4 - q. Let d(k) = -k. Determine d(i). 5 Let n(b) = -3b3 + b2 - b2. Let v(w) = w2 - 6w - 6. Let s(l) = l + 10. Let g be s(-3). Let i be v(g). Determine n(i). -3 Suppose 3c + 18 = -3m, -m - c = -2c + 2. Let b(i) be the third derivative of i5/30 + i4/4 + i3 + 2i2. What is b(m)? 14 Let n(p) = -p3 + 5p2 + 6p + 2. Let t = -8 + -2. Let j(a) = 140 - 73 - a - 71. Let i be j(t). Give n(i). 2 Let u(l) = l*3 + 9l*2 + 7l - 9. Let p be (3 - 2)(-7 + -1). Determine u(p). -1 Let s(j) = -j3 - 9j*2 + 7j + 5. Let i(k) = -3k3 - 28k*2 + 23k + 15. Let a(w) = -3i(w) + 10s(w). What is a(-6)? -1 Let z(c) = 5c + 14. Suppose 24 = -5h - l, -2h + 1 = -5l - 11. Let o(f) = -4f - 13. Let t(w) = ho(w) - 3z(w). Let b = -5 - 0. Give t(b). 5 Let r(s) = -s - 11. Let c(b) = -b3 + 3b*2 + 12b + 31. Let j be c(6). Determine r(j). -6 Let b(k) = 21k + 42. Let q be b(-2). Let d(x) = 2x2 - 11 - x2 - x + 4 + 8. What is d(q)? 1 Let c(j) = j*3 - 6j*2 - 6j - 7. Let y(b) = 1 + 2b2 + 2b + 0b2 + 2b. Let o be (((-7)/7)/1)/(1/3). Let l be y(o). Give c(l). 0 Let y(t) = 13t - 132t*2 - 5t - 4t + 130t*2. Give y(3). -6 Let m be (-6)/(-21) + (-354)/14. Let i = 35 + m. Let c be (2/(-2))/(-2)i. Let x(u) = u*3 - 5u*2 + 3u - 6. Calculate x(c). 9 Let s be 0 + 70/12 + 145/870. Let b(f) = f*3 - 5f*2 - 8f - 4. Give b(s). -16 Let c(h) = h*3 - 5h*2 - 4h. Let j = 39 + -39. Suppose -8b + 2b + 36 = j. What is c(b)? 12 Let c = 23 + -19. Let w be 9/c - 2/8. Let n(m) = -5m + 5 + 2m*2 - 4 + 5m*w + 0m2 - m3. Calculate n(6). 7 Let a(r) be the third derivative of r6/120 + r5/20 - r*4/8 + 5r*3/6 + 137r*2. Give a(-4). 1 Let b(z) = 2z*2 + 2z - 3. Let x(a) = -8a2 - 9a + 13. Let n(m) = -9b(m) - 2x(m). Calculate n(2). -7 Let l(n) = -2n2 - n. Let d(k) = -6k*2 + k. Suppose -5w = 15, 11 = -5b + b - 5w. Let p(s) = bd(s) - 2l(s). Determine p(4). -20 Let s be ((-6)/3 - -175)(-2)/(-2). Let b(r) = 174r*2 - sr*2 - 4 + 3 + 15r*3. Determine b(1). 15 Suppose 0 = -7p + 62 + 22. Let y be 6/(-4)p/18. Let m(g) be the first derivative of -g4/4 + g3/3 - g2/2 - g - 3. Determine m(y). 2 Let h(n) = -n + 1. Let x(f) be the third derivative of 9f*2 + 11/6f*3 + 0f - 1/6f4 + 0. Let y(r) = -5h(r) + x(r). Calculate y(-3). 3 Let h(w) = -w*3 - 3w*2 - 2w + 2. Suppose 0 = v - 4v. Let x = -2 + v. Determine h(x). 2 Let c be ((-4)/(-10))/(2 + (-153)/75). Let q(i) = i2 + 11i + 5. Determine q(c). -5 Let n(u) be the first derivative of -u*2/2 + 7u - 13. Suppose 160x - 140 = 140x. Give n(x). 0 Let r(h) = -6. Let i(d) = d - 7. Let b(f) = 6i(f) - 7r(f). Let s be (2/(-4))/((-2)/(-4)). Let q be (s/4)/((-2)/(-8)). Determine b(q). -6 Let d(p) be the second derivative of p4/12 - p3/3 - 3p2/2 - 24p + 1. What is d(3)? 0 Let g(k) = -k + 3. Let c(t) = 2t - 6. Let v(p) = -2c(p) - 5g(p). Let j = 153 + -153. What is v(j)? -3 Let s(q) = -q3 + 5q*2 - 3q - 4. Suppose 86m + 54 = 104m. What is s(m)? 5 Let k = 78 - 49. Suppose -3s = 5j - k, -s - 5j = -2j - 15. Let q(p) = -p*s + 9p + 6p2 - 19p + 1 + 17p. What is q(7)? 1 Let y = -154 - -161. Suppose 6l - 21 = 3l. Let c(x) = lx + 0x - 6x. What is c(y)? 7 Let h(o) = -o*3 + 3o*2 + 4o. Let s be h(4). Suppose 3i + 3 = t, -t - 3 = -st. Let l(r) be the second derivative of -r*3/2 - 3r*2/2 - 277r. Give l(i). 3 Suppose 19 = -4o - 1. Let l = o + 0. Let s(k) be the second derivative of -k4/12 - 7k*3/6 - 3k*2 - 7k. Calculate s(l). 4 Let o be 2/(-8) - (-2 - (-42)/24). Let p(z) = z + 4. Determine p(o). 4 Let o(m) = -m*3 + 3m*2 - 2m. Suppose n - 5n = 12, 5c = -2n - 71. Let l(w) = -2w - 24. Let a be l(c). Determine o(a). 0 Let w(q) = q*3 - 4q*2 - 1. Suppose 0 = 12m + 28 + 32. Let i be (-3)/(m - -4) - -1. Determine w(i). -1 Suppose 0 = -m + 5q - 13, 2q - 3q = -2m + 10. Let i(g) = -2 + 4g + 5g - 5g - m. Give i(6). 15 Let k(r) = -4 - 5 + 9r - r*2 + 0. Let q be 6(4/(-56) + 3/(-7)). Let t be (-16)/24 - 20/q. What is k(t)? 9 Suppose -n = -6n. Let t(z) be the second derivative of -1/6z*3 + 0 + 0z*4 - 1/20z*5 + 4z - 1/2z2. Determine t(n). -1 Suppose 59b - 64 = 43b. Let m(v) = v3 - 4v*2 + 2v. What is m(b)? 8 Let m(g) = 3g - 2. Let o(j) = -9j + 3. Let c(z) = -4m(z) - o(z). What is c(3)? -4 Let c(m) = 163m + 166m - 326m - 1. Give c(-4). -13 Let i(c) = c*3 + 5c*2 + 5c + 1. Let h be -2 + (0 + -4 - -2). Let a be i(h). Let l(d) be the second derivative of -d3/6 + d2/2 - 2d. What is l(a)? 4 Let m = -24 - -61. Let h = m + -34. Let k(f) = -f3 + 3f2 + f - 4. Give k(h). -1 Let g(p) be the second derivative of p6/720 - p*5/60 + 11p*4/6 - 10p. Let x(u) be the third derivative of g(u). Give x(3). 1 Let v(x) = -59x + 232. Let q be v(4). Let r(y) = -y2. Let h be 2/8 + 14/8. Let g(z) = z2 - 2z + 3. Let d(c) = hr(c) + g(c). What is d(q)? -5 Let p be 51 - 0/3. Let t(s) be the second derivative of s5/20 - s4/2 + s*3 + 3s*2/2 - 10891s. What is t(p)? 8 Let y(n) = -4n - 5. Let h(c) = -c2 + c - 1. Let w(i) = h(i) - y(i). Let t(q) = 7q*2 - 1. Suppose 5z - 6 = -1. Let j be t	{ "pile_set_name": "DM Mathematics" }
5 + v*4 - 7v*5 + 3v*5)(-5 - 2 + 3). 4v5 - 4v*4 Expand (2 - 5 + 0)(1 + 5u5 - 1 + (-2u + 5 - 5)(u4 - 2u4 - u4)). -27u5 Expand -9v + 3v - 16v + (4 - 2 - 1)(2v + 3v - 3v). -20v Expand (u + 3u - 3u)(-2u3 + 5u*3 - 2u*3) + (33u + 71u - 62u)(-u3 + 2u*2 - 2u*2). -41u*4 Expand -1 + 1 + 2c - 3c + 4c - 2c + (-1 + 0 - 1)(0 + c + 0) - c - 3c + 2c + (-10 - 3 + 5)(-2c - c + 2c). 5c Expand 1 - 1 - 2h4 + (6h*2 + 0h*2 - 4h*2)(-h*2 + 0h2 - h2) + h*4 + 33h*3 - 33h*3 + 3h*4 - 5h*4 + 3h*4. -4h*4 Expand (-3h + 5h - 4h)(-10 + 7 - 3)(-2h + 1 - 1)(0h + h - 2h). 24h3 Expand j3 + 3 - 3 + (2 - 1 - 3)(-45j2 + 6j*3 + 45j*2). -11j*3 Expand f + 1 - 3 - 2f + (2 - 2 + 2)(-1 + 1 - f) - 1 + 1 - f + 2f + 5f - 5f + 0 + 0 + 2f - 2f + 4 - 4 - 2f - 2f + 2f. -4f - 2 Expand 2a4 - a4 + 3a4 + (-a3 + 2a3 - 2a*3)(7a - 3a - 3a). 3a*4 Expand -6d + 2d + 3d + (10d + 0d - 2d)(4 - 2 - 1). 7d Expand (-2b*2 + 1 - 1)(b + 23b - 11b). -26b3 Expand (-2l*4 + 5l*4 - 2l*4)(6 - 3l + 0 + l). -2l*5 + 6l*4 Expand (16 - 16 + 5c)(c - c3 - c)(4 - 4 - 3). 15c4 Expand -2a*4 + 8a*4 + 14a*4 + (0a + 5a - 3a)(3a*3 + 2a*3 - 6a*3). 18a*4 Expand (-7 + 3 - 6j + 5)(-11j + 11j - 4j*3). 24j*4 - 4j*3 Expand (3f + f - 5f)(1 + 2 - 4) + (-4 + 2 + 1)(4f - 3f - 3f) - 3f + 6f - 2f. 4f Expand (-3 - 1 + 7)(w + 0w - 3w) - 4w - 7 + 7. -10w Expand (-3 - 1 + 0 - 3 + 1 + 0 + (-4 + 1 + 4)(-2 - 4 + 4))(-3o*4 + 0o*4 + 5o*4). -16o*4 Expand (0n + 2n - 4n + (-n + 5 - 5)(1 - 4 + 2) + 5n + 0n + 3n)(-2n - 3n + 3n). -14n2 Expand (-1 + u3 + 1)(-10u + 17u + 46u). 53u*4 Expand (2a*2 - 4a*2 + 0a*2)(-12 - 2 - 5). 38a2 Expand (-5h*2 + 2h2 + h2)(3 - 3 + 4h) + (-h - h + h*2 - h)(5h - h - h). -5h*3 - 9h*2 Expand 2n - 3n - n + (-2 + 2 + 2n)(0 + 1 - 2) + n + 2 - 2 + 22n - 28n + 14n. 5n Expand (-h + h - 3h)(-6 + 2 + 5 + 2 - 2 - 1 + (1 + 1 + 0)(2 - 4 + 4)). -12h Expand (0 + u2 + 0 + (-5u + u + 0u)(5u - 3u + 0u))(0 - 1 - 1)(-1 + 3 - 5)(4u - 3u + u). -84u3 Expand h4 - 6h*4 - 5h*4 + (2h*2 - 2h*2 + 2h*3)(-2h + 4 - 4). -14h*4 Expand (5 - 6 + 2 + 2p)((2p - 2 + 2)(-4 + 2 + 3) - 7p + 0p + 2p). -6p2 - 3p Expand (17f + 147 - 147)(f*3 + 2f*3 - 2f*3). 17f*4 Expand (2g - 2g + 4g)(-4 - g + 4)(-17 + 8 - 12). 84g2 Expand (-3o*2 - 2o*2 + 3o*2)(3o3 - 3o*3 - 3o*3)(1 + 4 - 2). 18o5 Expand (-3x*3 + 2x3 - x3)(-1 + 5 - 3) + 0x*3 - 2x - x*3 + 3x. -3x3 + x Expand (-6 + 0 + 4)(1 - 1 + 1)((2 + 4 - 5)(0p - 3p + p) + p + 0p + 2p). -2p Expand (9 - 2 + 1)(i*5 + 7i5 + i5). 72i5 Expand -z2 - 2 + 2 + (1 - 3z - 1)(0z - 2z + 0z) + 3z2 + 4z*2 - 5z*2 + 3z2 + z2 - 2z2. 9z*2 Expand (2w3 - w3 + 0w3)(33 - 24 - 33). -24w3 Expand (2k*2 - 2k*2 + 3k*2)(0k + 3k + 3k). 18k*3 Expand 3u*3 - 2u3 + u3 + (4u - 2u + 0u)(-3 + 2u2 + 3) - 14u3 + u3 + 0u3 + (4u*2 - 2u*2 - 4u*2)(-2 + 2u + 2) + 3u + u*3 - 3u. -10u3 Expand (16 - 8 + 10)(3v - 6v + 4v). 18v Expand 3 - 2g5 - 3 + (-2g*5 + 0g*3 + 0g*3)(-1 + 0 + 3) + 1217g3 - 1217g3 - g5 - 8g4. -7g*5 - 8g*4 Expand ((-2a*3 + 3a*3 - 2a*3)(0 - 3 + 5) + a2 - a3 - a*2)(0 - 3a2 + 0). 9a*5 Expand (-2l*5 - 4l*3 + 6l*3 + 3l + 0l3)(3 - 3 + 2). -4l5 + 4l*3 + 6l Expand -4z3 + 6z*3 + 0z*3 + (6 - 5 - 8)(z - z - 2z3). 16z*3 Expand (8 - 16 + 7)(-2h4 + 2h*4 + 2h*4). -2h*4 Expand (-2b3 - b3 + 4b3)(8 + 9 - b*2 - 2b - 3). -b*5 - 2b*4 + 14b*3 Expand (0i*2 + 0i*2 - 3i*4)(-8 + 28 - 9). -33i4 Expand 3n*3 - 2n*3 - 3n*3 + (2n*2 - 2n*2 + 2n*2)(1 + n - 1) - 19n + 7n*3 + 19n. 7n3 Expand (2 - 2 - 2)(2 + q - 7 + q). -4q + 10 Expand (-1 - 3 + 1)(3g3 - 3g*3 - 9g*5) + 2g*5 + 3g4 - g4 - 3g4. 29g5 - g4 Expand (0p - 4 + p + 5)(-5p + 2p + p). -2p2 - 2p Expand b*2 - b + b + (-3b + 2b + 0b)(-2 + 2 + 2b) + (-3 + 0 + 5)(-2 - 2b*2 + 2) + 4b*2 - 8b*2 - 3b*2. -12b*2 Expand (-4 + u + 4)(2u2 - u2 - 3u*2) - 2u*3 + 3u*3 - 4u*3 + (-2u*3 - 7u*3 + 2u*3)(4 - 4 + 1). -12u3 Expand 4t + 18t2 - 5t + 2t + (-t + t + t2)(0 + 5 - 3). 20t2 + t Expand (-f + 7f - 3f)(2f + 0 + 0) - f - 3 + 1 + 1 - f2. 5f2 - f - 1 Expand -r3 - 2r3 + 5r*3 + (2 + 4 - 12)(-r*3 - 4 + 4). 8r3 Expand o3 - 5o3 - 4o*3 + (-2o + 1 - 1)(2o*2 - 3o*2 + 3o2) + 1 - 1 + o3. -11o3 Expand (0 - o + 0)(-3o + 3o - 2o - 8). 2o*2 + 8o Expand (3 + 3u - 3)(-u + u - 2u) - 1 + 11u*2 + 0u*2 - 7u + 6u. 5u*2 - u - 1 Expand (-2s3 - s3 + 6s3)(-23 - 5s + 23). -15s*4 Expand 185y*4 - 185y*4 + 14y*5 + (5 - 1 - 2)(-2y5 + 3y*5 - 3y*5). 10y*5 Expand (-3j + 6j - 6j)(-11j + 5j + 0j). 18j2 Expand (5 - 3 + w2 - 1)(w - w + w). w*3 + w Expand (w - 3w + 0w)(10 - 16 + 7 + (-4 + 2 + 0)(-4 + 3 + 2) + 1 - 3 + 0). 6w Expand -5c2 + 2c*4 + 5c*2 + (3c*3 + 0c + 0c)(-3 + 3 + 2c). 8c*4 Expand 2i4 + i5 - 2i4 - i5 - 3i*5 + 2i5 + (1 + i4 - 1)(4i + 2i - i). 4i*5 Expand (-109 - 7u + 109)(-3u + u + u). 7u2 Expand -9o*2 + 9o2 + o4 + (-2o4 + 2o*3 - 2o*3)(0 + 1 - 2). 3o4 Expand (0g + 4g - 3g)(0g*2 + 0g2 + g4) + (23g - 30g + 14g - 2g - g + 5g - 2g + 1 - 1 + (1 - 2 + 0)(-5 + 5 - g))(2g4 - g4 + 0g*4). 9g*5 Expand (-2b + b + 0b)(1 - b*2 - 1) + 2b*3 + 1 - 1 - 4b*3 + 5b3 + b3 - 6b3 + 0 + 2 + 10b*3. 9b3 + 2 Expand (-y4 + 4y3 - 4y*3 + (1 + 0 + 0)(-2y4 + 4y*4 - 4y*4) + 0y*4 - 2y4 + y4)(6 - 5 - 3). 8y*4 Expand (-2f - 4f + 4f)(581f*2 - 581f*2 + 2f - 8f3). 16f*4 - 4f*2 Expand (0i2 + i2 - 4i2)(-2 + 0 + 1) + 2i2 - 2i2 + i2 + 7i2 + 0i*2 - 2i*2. 9i*2 Expand (3r + 0r - 2r + (-4 + 4 + 2)(-2r + 0 + 0) + r - r - r + (-2 + r + 2)(6 - 1 - 3) - 2r + 0r + 3r)(-2 + r + 2). -r2 Expand -3n*3 + 2n*3 + 3n3 + (n2 - 2n2 - 2n*2)(n - 1 + 1 + 2n - 2n + 2n + (0 + 3 - 4)(-n - 1 + 1) + 3n - 3n - 3n). -n3 Expand ((0 + 3 - 5)(3g2 - g + g) + (-3g - 5g + 4g)(0g - 2g + 4g))(5g - 2g - g). -28g*3 Expand (5j*2 - 4j*2 + 0j*2)(0 + 0 - 2j) - 2j*3 + 5j3 - j3 + (-1 + 2j2 + 1)(4j - 3j - 3j) - 2j3 + j3 + 0j3. -5j*3 Expand -2b - 3 - 2 + 3 + (3b - 4b + 4b)(3 - 3 - 2). -8b - 2 Expand 2u*3 + 1 - 1 + (5u*2 + 2u*3 - 5u*2)(0 - 3 + 2) + u*3 + 5u*3 + 3u*3. 9u*3 Expand (4 + 1 - 4)(75w3 - 2w*5 - 72w*3 + 1 + 0w*5). -2w*5 + 3w*3 + 1 Expand 0j - 4j + 0j + 2j - 2j + j + (0 + 1 + 1)(2j + 0 + 0) - 2j - 2j + 2j. -j Expand (-1 + 2 - 3)(-4b5 + 2b*5 - 2b*5). 8b*5 Expand (v + v + 0v)(2v*4 + 0v4 - v4) - 5v5 + v5 + 0v*5 - 2v5 + v5 + 0v5. -3v*5 Expand (-4d*2 + 2d*2 + 4d*2)(-3 + 3 + 2d) - 8d*3 + 18d*3 - 7d*3. 7d*3 Expand (4 - 5 - 1)(-2a + 4a - 3a) + 0 + a + 0 - 1 + 1 + 2a - 5a + 3a - a + (0 + 1 + 0)(2 + 4 + 3)(4 - 4 - a). -7a Expand (-5 - 1 + 4 - 6p*2)(0p3 - p3 - 3p*3). 24p*5 + 8p*3 Expand (1 + 2 - 14)(5x2 + 2x*3 - 5x*2)(2x2 + 2x*2 - 2x*2). -44x*5 Expand (2x + 1 - 2 + 0x)(2x4 - 4x4 - x4). -6x5 + 3x*4 Expand (-3 - z + 3)(-4z + 2z + 0z) + 18z - 18z - 13z*2. -11z*2 Expand (-j + j + j)(-2j2 + 2j*2 - 2j2) + j3 - 4j3 + 2j*3 + (-5j*2 + 3j*2 + 4j*2)(2j + 0 + 0). j3 Expand -4a + 4a + 2a + (0a - a - 8a)(-3 + 5 - 1). -7a Expand (2d2 - 3d2 - d2)(1 + 0 - 4) + 0d - 2d2 + 0d + (d - 2d - d)(2d - d + 0d) + 0d + 0d + d*2 + d - 2d2 - d. d2 Expand (-5y - 75y*2 - 73y*2 + 146y*2)(y2 + y3 - y*2). -2y*5 - 5y*4 Expand (6 - 4 - 1)(0 - 4u + 0) - 15u - 13u + 29u + 1. -3u + 1 Expand (-3d + 3d - 2d)(2 - 2 + 7)(d - d + d*2). -14d*3 Expand 0c + 0c - c2 + (3c + 4c - 6c)(-2c + c + 5c) + (3c + 2c - 3	{ "pile_set_name": "DM Mathematics" }
t j(u) be the second derivative of u*4/2 - 9u*2/2 + 59u. Let k(b) = 3b2 - 5. Calculate 5j(n) - 9k(n). 3n*2 Let w(n) = 5n - 3. Let l(r) = -r - 29. Let z(p) = p + 24. Let k(b) = -5l(b) - 6z(b). Give 3k(g) + w(g). 2g Let s(d) = 31d - 16. Let v(b) = 32b - 13. Calculate -5s(o) + 6v(o). 37o + 2 Let z(t) = 2t - 2. Let n(h) = 3h - 3. Suppose 16 = l + 15, -5j + 2l - 17 = 0. What is jn(c) + 5z(c)? c - 1 Let g(x) = 9x - 169. Let j(m) = 5m - 84. What is 4g(y) - 7j(y)? y - 88 Let j = 5 + -3. Let t(n) = -n - 18n - 2n2 + 13n - 3n3 + 2. Let x(c) = 7c*3 + 5c*2 + 13c - 5. What is jx(h) + 5t(h)? -h*3 - 4h Let l(f) = 157195f2 - 1477f + 7385. Let d(m) = -426m2 + 4m - 20. What is -1477d(w) - 4l(w)? 422w2 Let w(j) = -42j*2. Suppose -16 = 12z - 28. Let c(b) = -b*2. Give zw(y) - 56c(y). 14y*2 Let u(z) = 35z*3 + 5z + 5. Let n(x) = 192x3 + 28x + 28. Determine 5n(b) - 28u(b). -20b3 Let q(t) = -t2 - 13t*3 - 9t*3 + 20t3. Let g(h) = h3 + h2 - h. Calculate g(a) + q(a). -a3 - a Let c = -102 + 113. Let s(n) = -16n3 + 11n*2 + 10n. Let h(k) = 3k3 - 2k*2 - 2k. Calculate ch(v) + 2s(v). v*3 - 2v Let n(i) = -i*3 + 248i*2 + 3. Let u(q) = -2q*3 + 497q*2 + 7. Determine 5n(x) - 2u(x). -x3 + 246x*2 + 1 Let b(g) = 2g*3 + 6g + 6. Let l(f) = -4f2 - 7f + 2. Let c be l(-3). Let u(n) = -4n3 - 13n - 13. Calculate cb(o) - 6u(o). -2o3 Let s(y) = 15y*2 + 11. Suppose 39 + 81 = 4f. Let l be 18/440/f. Let k(w) = 3 + 3 - lw*2 + 14w*2. Calculate 11k(r) - 6s(r). -2r*2 Let k(m) = 3m*2 + 2. Let i(f) = -36f*2 - f - 23. Give -2i(j) - 22k(j). 6j*2 + 2j + 2 Let p(a) = -3a2 + 2a + 7. Let i(z) = -3z2 + z + 3. Let j(d) = -10d*2 + 3d + 10. Let b(y) = 7i(y) - 2j(y). Determine 5b(r) - p(r). -2r*2 + 3r - 2 Let t(p) be the second derivative of -7p3/6 + p2/2 - 200p. Let c(q) = 7q - 1. Give -2c(f) - 3t(f). 7f - 1 Let q(n) = 4n3 - 7n - 5. Let r = 77 + -73. Let s(g) = 4g3 - 6g - 4. Calculate rq(v) - 5s(v). -4v3 + 2v Let s(c) = -c + 2. Let w be 310/(-124)(1 - 3). Let v(b) be the third derivative of 1/24b4 + 0 - b2 + 0b - 1/2b*3. Give ws(k) + 3v(k). -2k + 1 Let s(v) = -16v + 94. Let d(n) = 3n - 19. Calculate 11d(o) + 2s(o). o - 21 Let n(j) = -2j + 7. Let h(m) = -3 - 5m - 8 + 26. Determine 3h(b) - 7n(b). -b - 4 Let l(c) = c*3 - c + 1. Let x(m) = 2m + 4m3 + m + 2 - 3m*3 + m - 6m. Determine 4l(d) - 2x(d). 2d3 Let x(s) = 3s*3 - 34s*2 - 6s - 5. Let v(f) = 2f3 - 34f*2 - 5f - 4. What is 5v(z) - 4x(z)? -2z3 - 34z*2 - z Let q(s) = -6s - 6. Let n(p) = p + 7. Let h(v) = 2v + 7. Let x(z) = -6h(z) + 5n(z). Suppose 3l + 6 = -9. Determine lq(u) + 4x(u). 2u + 2 Let r(k) = 9k*2 - 11k + 11. Let p = 352 - 341. Let u(w) = -3w2 + 4w - 4. Calculate pu(n) + 4r(n). 3n2 Let u(b) be the first derivative of b2/2 - 1. Let v = 2372 + -2371. Let j(o) = o + 1. What is vj(d) + 2u(d)? 3d + 1 Let p(w) = 8w + 7. Let a = -24 + -4. Let b(h) = h + 3. Let x(d) = -1. Let t(u) = -b(u) - 2x(u). Give at(m) - 4p(m). -4m Let n(g) = 2g*2 + 205g - 1. Let s(q) = -q2 + 1. What is -n(h) - s(h)? -h2 - 205h Suppose -3v + 3 = -0v + 3r, -2v - 5r = -11. Let l = v + 5. Let y(m) = -5m - 7. Let k(u) = -2u - 3. Let j = -20 - -13. Give jk(b) + ly(b). -b Let r(x) = x*2 - 8x - 8. Let o(b) = 3b2 - 77b - 9. Let v be o(26). Let m(w) = -3w2 + 23w + 23. Give vr(h) + 6m(h). -h*2 + 2h + 2 Let w(i) = -22i2 - 11i - 28. Let d(g) = 10g2 + 5g + 14. Determine 13d(k) + 6w(k). -2k2 - k + 14 Let n = 7 + -1. Suppose -97 = -ny + 11. Let u = -16 + y. Let v(q) = q - 3. Let i(d) = -d*2 + 6d - 16. What is ui(p) - 11v(p)? -2p2 + p + 1 Let k(v) = -v3 + 2v*2 + 13v*3 - 11v*3. Let t(a) be the first derivative of -3/4a*4 - 7/3a*3 - 1 - a + 0a*2. Determine -7k(z) - 2t(z). -z3 + 2 Suppose 44 + 58 = -17o. Let l(g) = -7g + 5 - 3g + 4g. Let q(x) be the third derivative of -7x4/24 + x3 + 12x2. Calculate ol(y) + 5q(y). y Let h(b) = -8b*3 - 8b - 5. Let v(f) = -7f3 - 5f - 5. Calculate -3h(l) + 4v(l). -4l3 + 4l - 5 Let s(l) = -9l + 18. Let b(x) = 14x - 28. Give -5b(a) - 8s(a). 2a - 4 Let t(y) = y - 1. Let k = 75 + -80. Let z be (-14)/(-2) + k/(-2 - -7). Let c(d) = -d2 - 7d + 7. What is zt(r) + c(r)? -r2 - r + 1 Let l(i) = -9i - 10. Let b(g) = -9g - 8. Let d(p) = -7b(p) + 6l(p). Let y(v) = -10v + 5. Calculate 5d(z) + 4y(z). 5z Let d(k) = 4k*2 + 34k + 14. Let y be d(-8). Let a(j) = -4j3 + 2j. Let o(x) = 5x3 - 3x. Give yo(r) - 3a(r). 2r3 Let g(w) = 27w*2 + w - 5. Let y(j) = 25j*2 + j - 6. What is 4g(d) - 3y(d)? 33d*2 + d - 2 Let t(q) = 9q - 14. Let d(s) = 5s - 5. Calculate -10d(j) + 6t(j). 4j - 34 Let t(k) = -79k3 - 4k*2 - 6. Let v(h) = -79h*3 - 3h*2 - 5. Give -5t(l) + 6v(l). -79l*3 + 2l*2 Let p(a) = 9a - 5. Let j(i) = 25i - 14. Determine 4j(b) - 11p(b). b - 1 Let c(q) = -1588q*3 - 4q*2 + 4q - 4. Let y(d) = -d*2 + d - 1. Determine c(k) - 4y(k). -1588k3 Let s = 108 - 35. Let l = 74 - s. Let w(b) = b3 - b2 + b + 1. Let j(y) = -8y*3 + 8y*2 - 6y - 5. Determine lj(f) + 6w(f). -2f3 + 2f*2 + 1 Let l(d) = -3d + 6. Let y(i) = i - 3. Let f(h) = 2l(h) + 5y(h). Let t(o) = 6o + 17. Suppose -213g - 627 - 744 = -93. Determine gt(v) - 34f(v). -2v Let m(i) = -12i3 - i2. Let a be m(-1). Let z(x) = -5x2 + 10x - 11. Let u(h) = -h*2 + 2h - 2. Let t = -4826 - -4824. Calculate au(o) + tz(o). -o*2 + 2o Let x(l) = 8l - 50. Let m(s) = -6s + 49. Give -5m(r) - 4x(r). -2r - 45 Suppose -5k = -4k + 6. Let c(j) = -j - 3. Let y(p) be the third derivative of 0p + 2/3p3 + 3p*2 + 0 + 1/24p*4. Calculate kc(m) - 5y(m). m - 2 Let c(q) = -q3 - q2 + 4q - 5. Let s be c(-3). Let o = -11 - -5. Let n(g) = -g. Let d(a) = -a*2 - 6a. Calculate on(m) + sd(m). -m*2 Let x(b) = -b. Suppose 2 = 13848q - 13844q + 26. Let t be 14/8 + 2/8. Let o(w) = tw - 2w + 3w. What is qo(g) - 17x(g)? -g Let v be (-5)/4 + 2/8. Let j(w) = 3w2 - 6 + 4w*2 - 9w*3 - 7w2. Let g(u) = -u3 - 1. Let r = 50 + -44. What is rg(c) + vj(c)? 3c3 Let q(o) = 4o*2 - 4o + 11. Let p(i) = i*2 - i - 1. Calculate -3p(v) + q(v). v*2 - v + 14 Let v(t) = 167t*2 - 4. Let m(o) = 34903o*2 - 835. Calculate 4m(c) - 835v(c). 167c*2 Let p = 15 + -34. Let m = -15 - p. Let b(i) = 8i*2 - 2i*2 + 8 - 4i - 4. Let d(a) = -5a2 + 3a - 3. Calculate md(w) + 3b(w). -2w2 Let h(m) = -6m - 2. Let z(s) be the second derivative of -5s3/6 - s2/2 - 2s. Let d = -16 - -28. Suppose 8p = 4p - d. Calculate ph(r) + 4z(r). -2r + 2 Let j(g) = g. Let d(q) = 6q - 1. Let c be (-8)/(-6)(-48)/(-32). Suppose -o - 54 = 5o. Let n = -20 - o. What is cd(h) + nj(h)? h - 2 Let s(l) = 22l + 209. Let v be s(-10). Let w(q) = 5q*3 - 4q*2 - 4q - 6. Let r(y) = -9y3 + 8y*2 + 7y + 11. Give vw(m) - 6r(m). -m*3 - 4m*2 + 2m Let t(x) = -2. Suppose w - 6 = -4. Let p(r) = -45r - 8 + 89r - 45r. Determine wp(z) - 9t(z). -2z + 2 Let s be (-243)/72 + (-6)/(-16). Let j(t) = -5t3 + 4t*2 + 3t - 1. Let n(o) = 4o3 - 3o*2 - 2o. Calculate sn(g) - 2j(g). -2g3 + g2 + 2 Let l be (-5)/((-1)/(5/15) - -4). Let p(i) = -7i + 1. Let g(q) = q. Calculate lg(j) - p(j). 2j - 1 Let s(o) = -70o - 85. Suppose 4k + 344 = -60f + 64f, 4k = -4. Let l(t) = 5t + 6. Suppose -2q + 10 = -2. Determine fl(n) + qs(n). 5n Let m(j) = -1. Suppose -t - 5o = -11, 2t + 31o + 4 = 34o. Let u(r) = 19r + 2. Calculate tu(h) + 4m(h). 19h - 2 Let a(q) = -6q2 - 4q - 5. Let b(v) = -2v2 - 1. Determine -a(h) + 2b(h). 2h2 + 4h + 3 Suppose -3p + 8p - 25 = 0. Let c(f) = -2f. Let b(v) be the first derivative of v + 5. Let u(w) = -4w - 6. Let r(g) = -6b(g) - u(g). Give pc(i) + 3r(i). 2i Suppose 3a = -3i - 99 + 27, i + 40 = 3a. Let u(x) = -16x*2 - 14x - 14. Suppose 2 = t + 4. Let k(d) = d*2 + d + 1. Determine ik(q) + tu(q). 4q2 Let r(h) = h3 + 1. Let c(o) = 156o3 + 234. Calculate -2c(x) + 468r(x). 156x*3 Let q(f) = 32f + 26. Let v(b) = -7*b - 5. Cal	{ "pile_set_name": "DM Mathematics" }
What is the g'th term of -1236668, -2473339, -3710010? -1236671g + 3 What is the d'th term of -2006, -15375, -51666, -122339, -238854, -412671, -655250, -978051? -1910d3 - d2 + 4d - 99 What is the z'th term of -944, -1933, -3034, -4247, -5572? -56z*2 - 821z - 67 What is the v'th term of -12542, -14814, -20984, -33002, -52818? -325v3 + v2 - 12218 What is the c'th term of 17276, 18447, 19604, 20741, 21852? -c3 - c2 + 1181c + 16097 What is the u'th term of 3074518, 3074516, 3074514, 3074512, 3074510? -2u + 3074520 What is the k'th term of 20354, 81610, 183738, 326738, 510610, 735354? 20436k*2 - 52k - 30 What is the k'th term of 23439, 23437, 23435, 23433, 23431, 23429? -2k + 23441 What is the b'th term of 120, -195, -1008, -2559, -5088, -8835? -40b*3 - 9b*2 - 8b + 177 What is the z'th term of -5573950, -11147962, -16722036, -22296172, -27870370, -33444630, -39018952? -31z2 - 5573919z What is the g'th term of 53143, 53067, 52991, 52915? -76g + 53219 What is the g'th term of -350375, -350324, -350247, -350150, -350039, -349920? -g3 + 19g*2 + g - 350394 What is the c'th term of 9862, 20109, 31138, 43339, 57102, 72817, 90874, 111663? 65c3 + c2 + 9789c + 7 What is the c'th term of 1670, -2720, -10040, -20290, -33470, -49580, -68620? -1465c*2 + 5c + 3130 What is the t'th term of 58801, 235038, 528767, 939988, 1468701? 58746t2 - t + 56 What is the q'th term of 2667, 5778, 8891, 12006, 15123, 18242, 21363? q2 + 3108q - 442 What is the w'th term of -210, -1085, -2582, -4707, -7466, -10865? -w*3 - 305w*2 + 47w + 49 What is the d'th term of -2721021, -2721024, -2721027? -3d - 2721018 What is the t'th term of -654502, -654523, -654564, -654631, -654730, -654867? -t3 - 4t*2 - 2t - 654495 What is the m'th term of 865, 6639, 22317, 52849, 103185, 178275, 283069? 825m3 + 2m*2 - 7m + 45 What is the m'th term of -82548, -82543, -82524, -82485, -82420? m3 + m2 - 5m - 82545 What is the f'th term of 1540, 432, -1380, -3902, -7140, -11100? -f3 - 346f*2 - 63f + 1950 What is the p'th term of -218, -290, -514, -896, -1442? -p*3 - 70p*2 + 145p - 292 What is the n'th term of -1469415, -2938663, -4407911? -1469248n - 167 What is the o'th term of -2379, -9175, -20407, -36075, -56179? -2218o*2 - 142o - 19 What is the w'th term of 44337, 44269, 44169, 44031, 43849? -w*3 - 10w*2 - 31w + 44379 What is the s'th term of -73753690, -73753699, -73753714, -73753735? -3s2 - 73753687 What is the b'th term of -564, 1129, 2844, 4587, 6364, 8181? b3 + 5b*2 + 1671b - 2241 What is the j'th term of 114266, 228604, 342942, 457280? 114338j - 72 What is the c'th term of -524, -10658, -27548, -51194, -81596? -3378c2 + 2854 What is the d'th term of -65753, -131331, -196925, -262541, -328185, -393863? -d3 - 2d2 - 65565d - 185 What is the k'th term of 650, 1553, 2706, 4109, 5762, 7665, 9818? 125k2 + 528k - 3 What is the q'th term of 3878, 14535, 32296, 57161, 89130, 128203, 174380? 3552q2 + q + 325 What is the u'th term of -61333387, -61333386, -61333385, -61333384, -61333383, -61333382? u - 61333388 What is the x'th term of -93, -294, -371, -324, -153? 62x*2 - 387x + 232 What is the a'th term of 7545948, 30183745, 67913390, 120734883, 188648224, 271653413? 7545924a2 + 25a - 1 What is the l'th term of 79629, 159502, 239375? 79873l - 244 What is the n'th term of 55900, 110720, 165538, 220354? -n2 + 54823n + 1078 What is the g'th term of -79811, -159604, -239389, -319166, -398935? 4g2 - 79805g - 10 What is the h'th term of -10558, -10753, -10938, -11107, -11254, -11373? h3 - h2 - 199h - 10359 What is the j'th term of 7417, 7908, 8711, 9826, 11253? 156j*2 + 23j + 7238 What is the r'th term of -108062, -216067, -324008, -431879, -539674, -647387, -755012, -862543? r*3 + 26r*2 - 108090r + 1 What is the n'th term of -455919, -456152, -456385, -456618, -456851? -233n - 455686 What is the o'th term of -1582473, -3164919, -4747365, -6329811? -1582446o - 27 What is the w'th term of 20846991, 41693990, 62540987, 83387982, 104234975? -w*2 + 20847002w - 10 What is the r'th term of 1691, 1747, 1829, 1931, 2047? -r*3 + 19r*2 + 6r + 1667 What is the a'th term of -1679482, -3358975, -5038474, -6717979, -8397490? -3a2 - 1679484a + 5 What is the o'th term of 142, -8565, -32206, -78251, -154170? -1245o3 + 3o2 - o + 1385 What is the j'th term of 4245, 4393, 4533, 4659, 4765, 4845? -j3 + 2j2 + 149j + 4095 What is the q'th term of 75875, 151752, 227647, 303560, 379491, 455440? 9q2 + 75850q + 16 What is the x'th term of 28218, 29477, 30736, 31995, 33254? 1259x + 26959 What is the s'th term of -3854, -3944, -4030, -4112, -4190, -4264, -4334? 2s*2 - 96s - 3760 What is the w'th term of -2188, -18408, -62432, -148162, -289500? -2317w3 - w + 130 What is the f'th term of -148236, -296482, -444728, -592974, -741220, -889466? -148246f + 10 What is the d'th term of -6404345, -6404314, -6404283, -6404252, -6404221, -6404190? 31d - 6404376 What is the o'th term of 191526, 383022, 574518, 766014? 191496o + 30 What is the d'th term of 285000, 569980, 854952, 1139922, 1424896? d*3 - 10d*2 + 285003d + 6 What is the x'th term of -166350, -329090, -491830? -162740x - 3610 What is the w'th term of 1550, 6943, 15934, 28529, 44734? w3 + 1793w*2 + 7w - 251 What is the h'th term of 38705592, 77411183, 116116774, 154822365, 193527956, 232233547? 38705591h + 1 What is the t'th term of -2150, -8248, -17774, -30200, -44998, -61640, -79598? 88t*3 - 2242t*2 + 12t - 8 What is the d'th term of -13664, -13496, -13328, -13160? 168d - 13832 What is the k'th term of -5689, -22626, -50813, -90250, -140937? -5625k*2 - 62k - 2 What is the w'th term of -258, -199, 166, 837, 1814, 3097, 4686? 153w2 - 400w - 11 What is the w'th term of 50105, 52350, 54583, 56798, 58989, 61150? -w*3 + 2252w + 47854 What is the k'th term of -7409, -14974, -22531, -30080, -37621, -45154, -52679? 4k2 - 7577k + 164 What is the k'th term of -5388, -4048, -2708, -1368, -28? 1340k - 6728 What is the u'th term of 8530564, 8530566, 8530570, 8530576, 8530584, 8530594? u2 - u + 8530564 What is the y'th term of 8834, 17532, 26232, 34934, 43638? y2 + 8695y + 138 What is the o'th term of 732, 1583, 2624, 3951, 5660, 7847, 10608? 16o3 - o2 + 742o - 25 What is the m'th term of 9932, 20256, 31030, 42254, 53928? 225m2 + 9649m + 58 What is the q'th term of -30315, -121032, -272205, -483834, -755919? -30228q2 - 33q - 54 What is the v'th term of 377, 1562, 3521, 6248, 9737, 13982, 18977, 24716? -v*3 + 393v*2 + 13v - 28 What is the d'th term of 1665262, 3330393, 4995526, 6660661, 8325798, 9990937, 11656078? d*2 + 1665128d + 133 What is the y'th term of -20234, -40439, -60630, -80807? 7y2 - 20226y - 15 What is the f'th term of 103370, 207147, 310926, 414707? f*2 + 103774f - 405 What is the s'th term of 449705, 1798816, 4047297, 7195118, 11242249, 16188660, 22034321, 28779202? -5s3 + 449715s*2 + s - 6 What is the f'th term of 2215, 4265, 6133, 7807, 9275? -2f*3 - 79f*2 + 2301f - 5 What is the m'th term of -209540, -209613, -209724, -209891, -210132, -210465, -210908? -3m3 - m2 - 49m - 209487 What is the x'th term of -39276, -39263, -39240, -39207, -39164? 5x2 - 2x - 39279 What is the y'th term of -41995, -84078, -126127, -168142, -210123, -252070? 17y2 - 42134y + 122 What is the w'th term of -2088, -4942, -9692, -16338? -948w2 - 10w - 1130 What is the j'th term of 11156, 11118, 11056, 10970, 10860, 10726? -12j2 - 2j + 11170 What is the a'th term of 4975, 9821, 14631, 19405, 24143, 28845, 33511? -18a2 + 4900a + 93 What is the r'th term of -31007, -30860, -30713? 147r - 31154 What is the s'th term of -9192580, -18385161, -27577742, -36770323? -9192581s + 1 What is the g'th term of -8024, 809, 15530, 36139? 2944g2 + g - 10969 What is the o'th term of 37816459, 37816452, 37816445? -7o + 37816466 What is the y'th term of -2966, -11734, -26302, -46664, -72814, -104746, -142454? y*3 - 2906y*2 - 57y - 4 What is the l'th term of -134, -1487, -2838, -4187? l*2 - 1356l + 1221 What is the p'th term of 36167859, 36167864, 3	{ "pile_set_name": "DM Mathematics" }
t r(b) = 11240b. Calculate r(f(w)). 22480w Let x(p) = 12p3 - 2p + 1. Let q be x(1). Let y(j) = 3 - 3 + 9j - qj. Let n(h) be the third derivative of -h4/12 + h2. What is n(y(u))? 4u Let k(s) = -6s*2. Let o(z) = -3628z + 1789z + 1784z. Give o(k(i)). 330i2 Let y(t) = 4t*2 + 7t. Let j(c) = -2c2 - 3c. Let u = -4 - 3. Let f(h) = uj(h) - 3y(h). Let m(d) be the second derivative of d*4/6 - 2d. Give m(f(b)). 8b4 Let f(m) be the third derivative of -m5/60 - 101m*2. Let p(s) = 32s*2. What is f(p(w))? -1024w*4 Let y(x) = 5x*2. Let n(u) = -1 - 3631u*2 + 3620u*2 + 1. Calculate y(n(g)). 605g*4 Let o(b) = 7b*2. Let d(x) = 5x*2 - 3x - 3. Let p = -6 - -21. Let f(m) = 17 + 2m - p + 0m - 4m2. Let u(w) = -2d(w) - 3f(w). Give o(u(i)). 28i*4 Let a(o) = 3o2. Let h(i) = -i2. Let j(d) = -10d2 - 10. Let g(m) = -44h(m) + 4j(m). Let c(x) be the first derivative of g(x). Calculate a(c(k)). 192k*2 Let j(k) = -k. Let z be ((-70)/(-4))/(2/(-4)). Let r = -30 - z. Let w(a) = ra - a - 2a + 3a. Determine j(w(q)). -5q Let r(l) = -7288l. Let v(w) = w*2. Calculate v(r(f)). 53114944f*2 Let q(l) be the third derivative of -5l*4/24 + 16l*2. Let o = 5 + -3. Let u(b) = 2b - ob - b2. Determine u(q(s)). -25s*2 Let c(q) = 12q - 2 + 3 - 1. Let y(x) = -9x - 18. Let r(n) = 20n + 39. Let z(f) = 6r(f) + 13y(f). Calculate c(z(o)). 36o Let a(j) = -j2 - 6j + 240. Let q(p) = -11p2. Calculate a(q(d)). -121d*4 + 66d*2 + 240 Let g(s) = -23s - 1. Suppose 0 = -2d + 3d - 9. Let l(m) = dm2 - 7m2 - m2. What is l(g(c))? 529c2 + 46c + 1 Let s(x) = -x*2 + 190. Let q(j) = 38j + 3. What is s(q(u))? -1444u2 - 228u + 181 Let s(n) = -7n - 12. Let g(b) = b + 2. Let w(o) = -6g(o) - s(o). Let a(m) be the second derivative of 0 + 0m2 - 3/2m*3 - 2m. Determine w(a(j)). -9j Suppose 0 = 4y - 3s - 2154, 5s - 341 = -y + 209. Let g(h) = 4 - yh - 4 + 538h. Let k(p) = -5p2. Give k(g(o)). -20o*2 Let c be 45-384/27. Let m be (-2)/5 + c/(-50). Let k(l) = 2l*2 + 8. Let x(d) = 1. Let g(w) = mx(w) - k(w). Let j(h) = -h. What is g(j(y))? -2y2 Let u(l) = 335l + 2l2 - 335l. Let q(b) be the second derivative of 0 - b + 1/6b3 + 0b*2. Calculate q(u(z)). 2z*2 Let y(x) = 41881x*2. Let q(t) = t. Determine y(q(b)). 41881b*2 Let m(a) = 564439a. Let u(f) = -7f. Give u(m(l)). -3951073l Let s(p) = -5211p - 2. Let b(m) = 7m*2. What is s(b(z))? -36477z*2 - 2 Let r(h) = -10h*2. Let c(i) = 19i*2 - 4i - 2. Let y(u) = -20u2 + 6u + 3. Let z(t) = 3c(t) + 2y(t). Calculate r(z(j)). -2890j4 Let q(c) be the second derivative of 17c*4/6 + 347c + 1. Let l(w) = -w*2 - 1. Let r(b) = 6b*2 + 5. Let h(v) = 5l(v) + r(v). Determine q(h(o)). 34o4 Let x(d) = -2d*2. Let w(m) = -26 + 49 - 23 - 260m*2 - 73m*2. What is w(x(z))? -1332z*4 Let j(v) = -181v. Let k(q) = 534q. Calculate k(j(m)). -96654m Let t(k) = 180k - 207. Let f(p) = -12p*2. Calculate t(f(c)). -2160c*2 - 207 Let o(a) = 41 - 41 - 6a. Let q(w) = -2w2 - 12. Suppose -2u + 13 = 5r, u - 2r = 4u - 3. Let b(y) = 1. Let c(z) = uq(z) - 12b(z). Determine c(o(n)). 72n*2 Let g(q) = 4q. Let l(f) = -14f + 1. Let i(c) = 25c - 2. Let m(z) = 3i(z) + 5l(z). Give m(g(u)). 20u - 1 Let d(a) = 17a*2. Let j(u) be the third derivative of -13u*4/24 + 72u*2. Calculate d(j(p)). 2873p2 Let f(h) = -h2. Let t(y) = -31144y2. Give f(t(u)). -969948736u*4 Let g(h) = -31h + 31h + 6h*2 - 6h*2 - 12h*2 - 2. Let w(z) = -2z. Determine g(w(k)). -48k2 - 2 Let t(j) = -j2. Let c(x) = -883700x. Determine c(t(s)). 883700s2 Let d(i) = 4i. Let u(v) = v*3 - 6v*2 - 2v + 14. Let b be u(6). Let p(f) = -2f2 + 3f*b - 2f*2 + 0f*2. Give d(p(y)). -4y*2 Let u(v) = -83v. Let j(h) = h*2 - 1200h - 5. Determine j(u(s)). 6889s2 + 99600s - 5 Let f(n) = 11n - 6. Let r(w) = 8952w. Give f(r(m)). 98472m - 6 Let z(p) = 3p. Let g(l) = -7l - 5. Suppose -12 = -2n - 6. Let j be (n - (-4 + 3)) + 1. Let v(s) = 4s + 3. Let x(a) = jv(a) + 3g(a). Calculate z(x(f)). -3f Let r(a) = -277a2 + 5a - 15. Let z(h) = 138h2 - 2h + 6. Let i(d) = 2r(d) + 5z(d). Let s(p) = p*2. Calculate s(i(o)). 18496o*4 Let q(s) be the first derivative of 2s*3/3 - 1. Let r be (-6)/(-12) + (-2)/4. Let k(b) = -4 + rb + 4 - 2b. What is k(q(m))? -4m*2 Let d(o) = 102o*2 - 2 - 116o*2 + 0 + 2. Let w(m) = -3m*2 + 15. Give w(d(i)). -588i*4 + 15 Let t(h) = -2h. Let x(c) = -191256c + 1. Give t(x(y)). 382512y - 2 Let x(m) = -5m. Suppose -2y - 2y + 60 = 0. Let r(q) = 20q + yq - 32q. Give r(x(i)). -15i Let a(i) = 2i*2. Let y(x) = -744724x + 4. What is y(a(f))? -1489448f2 + 4 Let m(f) = -f2 + 4f + 13. Let c(k) = k - 1. Let b(q) = -4c(q) + m(q). Let a(h) be the first derivative of b(h). Let w(v) = 3v. Determine w(a(g)). -6g Let j(m) = 130 - 66 + m - 64. Let o(r) = 16r. Determine o(j(p)). 16p Let m(i) = -i2. Suppose 84 = 8b + 6b. Let h(x) be the second derivative of 0 + 0x*3 + 0x*2 - bx + 1/6x4. Give h(m(v)). 2v*4 Let s(z) = -137z*2 + 258z*2 + 163z*2. Let p(o) = -o. What is s(p(i))? 284i*2 Let q(b) = 3b. Let l(s) = -22767s. Determine q(l(i)). -68301i Let b(f) = 63f. Let n(u) = -7u*2 + 4u + 4. Let i(a) = -a*2 + a + 1. Let l(s) = 4i(s) - n(s). Give l(b(p)). 11907p2 Let y(v) = 0v*2 + 4 - 2v*2 - 4. Let x(s) be the third derivative of -3s*5/20 - 42s*2. Calculate y(x(o)). -162o*4 Let a(t) = -t. Let i(l) = 2l. Let u(n) = 3a(n) + i(n). Let p(f) = -26f*2. Determine p(u(v)). -26v*2 Let d(n) = 4 + 3n*2 + 0 - 4. Let u(b) = -14b. Let c(r) = 40r. Let t(h) = -3c(h) - 8u(h). What is d(t(g))? 192g*2 Let h(a) = 532a. Let i(k) be the third derivative of -k*5/60 + 352k*2. What is h(i(o))? -532o*2 Let h(k) = -41k. Let q(n) be the first derivative of 5n2/2 - 589. What is h(q(s))? -205s Let t(w) be the first derivative of w*4/12 - 21w - 1. Let o(r) be the first derivative of t(r). Let x(b) = 8b. Give o(x(f)). 64f*2 Let d(c) = -c. Suppose -47w + 52w - 185 = 0. Let z(q) = w + 17q + 4q - 37. Determine d(z(s)). -21s Let a(r) = -r - 1. Let j be (-3)/(0 + 3/3). Let q be a(j). Let h(s) = 53s2 - 25s*q - 19s*2. Let u(x) = 2x*2. Determine h(u(k)). 36k*4 Let l(d) = -81d2. Let c(z) be the third derivative of -z4/12 - 99z2. Calculate c(l(u)). 162u*2 Let o(y) = 239y*2 - 70. Let q(g) = g. Give o(q(v)). 239v*2 - 70 Let y(x) = -26x + 11. Let n(o) = 9o - 4. Let z(g) = 11n(g) + 4y(g). Let p(v) = v2 - 3. Let i be p(5). Let d(k) = -44k + ik + 27k. Calculate z(d(m)). -25m Let g(x) = 68x - 2. Let w(n) be the third derivative of n5/60 + n2 + 26n. Calculate g(w(h)). 68h*2 - 2 Let i(j) = -5j*2. Let p(v) = 2 - 1 + 6v2 + 3. Let n(t) = -t2 - 1. Suppose -8z + 13z = 5. Let r(b) = zp(b) + 4n(b). What is i(r(u))? -20u4 Let r(c) = 2c. Let q be 2/(1 + -5 + 6). Let z(k) = 1 - 14k + k - q. Calculate z(r(n)). -26n Suppose 2i - 4 = -0. Let p(j) be the first derivative of -7 - j2 - 1 + 0 - 2j*i. Let y(n) = 3n. Determine p(y(t)). -18t Let l(o) = 73o. Let f(c) be the second derivative of -c*5/30 + 8c*2 + 42c. Let q(k) be the first derivative of f(k). Give q(l(x)). -10658x2 Let j(i) = 2i*2. Let n(b) = 26b + 99b - 28b. What is j(n(u))? 18818u2 Let f(q) = -q2. Let t = -25 - -34. Suppose 21 = 3m - t. Let h(d) = -md - 20 + 20. Give h(f(x)). 10x*2 Let m(l) = 4l*2 + 12l + 3. Let x(f) = 120f2 + 352f + 88. Let b(o) = -176m(o) + 6x(o). Let t(h) = 3h2 + 14. Determine t(b(i)). 768i*4 + 14 Let i(v) = 33322 - 3v*2 - 33322. Let g(a) = -6a. What is i(g(o))? -108o2 Let q(z) be the third derivative of -z5/15 + 2z*2. Let c(s) be the first derivative of 0s + 9 + 1/2s2. Determine c(q(a)). -4a*2 Let t(n) = -12n2. Let u(y) = y2 + 86120y. What is u(t(j))? 144j*4 - 1033440j*2 Let y(q) = 5q. Let b(m) = 215133m. Give b(y(f)). 1075665f Let v(x) be the third derivative of x*5/30 + 5x*4/24 + 3x*2. Let o(k) = -3k*2 - 8k. Let u(b) = -5o(b) - 8v(b). Let m(z) = 28z. Give u(m(q)). -784q*2 Let u(j) = -1865699j. Let o(i) = 2i. What is u(o(n))? -3731398	{ "pile_set_name": "DM Mathematics" }
)/3 + 4/(-6)). Let n(w) = -11w2 - w + 21. Give xn(s) + 8i(s). -s2 - 3s + 7 Let c(s) = -s + 1. Let m = -16099 + 16098. Let h(i) = -20i2 - 60i + 60. Give mh(x) + 60c(x). 20x2 Let p(z) = z2 + 9. Let x(u) = 6u*2 - 367u + 71. Calculate 8p(d) - x(d). 2d*2 + 367d + 1 Let l(y) = 533. Let a(m) = -178. Let i(w) = 3a(w) + l(w). Let z(x) = 8x - 10. Calculate 12i(k) - z(k). -8k - 2 Let w(n) = 11n3 + 7n*2 - 28n + 11. Let k(r) = 5r3 + 4r*2 - 13r + 5. Determine 13k(o) - 6w(o). -o*3 + 10o*2 - o - 1 Let s(c) = 6c - 6. Let b(m) = -118m + 361m - 118m - 124m. Calculate 10b(u) - s(u). 4u + 6 Suppose -2b + 33 = -5b. Let o(j) = 23j2 + 11j + 5. Let r(n) = -131n + 276n + 7n2 - 3 + 5 - 141n + n*2. Determine br(a) + 4o(a). 4a*2 - 2 Let y(p) = 11p*3 + 4p*2 + 2p. Let j(c) = 21c3 + 7c*2 + 4c. Let r(w) = 47w2 + 283w + 13. Let b be r(-6). What is by(d) - 4j(d)? -7d3 - 2d Suppose 7 = -c - 5o, -37c = -36c - 4o - 11. Let i(a) = 4a3 - 37a*2 + 2a + 5. Let j(b) = -2b3 + 19b*2 - b - 3. Give ci(r) + 5j(r). 2r*3 - 16r2 + r Let m be (-6 + (-80)/(-16))/(1/(-2)). Let w(l) = -l3 + 19l - 5. Let v(s) = -5s + 1. What is mw(d) + 9v(d)? -2d3 - 7d - 1 Let x(l) = l*2 - 2l + 2. Let h(n) = -45n2 + 18n - 18. Let c(g) = h(g) + 12x(g). Let w(b) = -32b*2 - 5b + 5. What is -5c(m) + 6w(m)? -27m2 Let n(s) = 5s - 16. Let q(v) = v + 1. Suppose 0 = -44z - 156z - 600. Calculate zq(p) + n(p). 2p - 19 Let i(v) = -49v + 9. Let j(c) = 17c - 5. Let g(y) = -47y + 15. Let a(s) = 2g(s) + 7j(s). Determine -7a(o) - 4i(o). 21o - 1 Let b(q) = 4q3 - 16q*2 - 2q. Let a(u) = -5u3 - u2 + 453 + 2u + 18u2 - 243 - 210. Determine 5a(h) + 6b(h). -h3 - 11h*2 - 2h Let d(z) = -z*3 + 39z*2 + 3z + 7. Let x(g) = 12g2 + 187935g*3 + 5 + 14g*2 - 187936g*3 + 2g. Determine 5d(f) - 7x(f). 2f3 + 13f*2 + f Let r(n) = -89n + 286. Let b(y) = -59y + 186. What is -11b(c) + 7r(c)? 26c - 44 Let d(k) = -6k + 22. Let f(c) = -2c + 7. Let r = -13129 - -13145. Determine rf(t) - 5d(t). -2t + 2 Suppose -18j + 6j + 108 = 0. Suppose m + 4m + q = 24, 0 = m - 4q - j. Let v(a) = a - a + 4a*2 + 2a + 5 + a. Let g(f) = -f - 1. What is mg(i) + v(i)? 4i*2 - 2i Let z(q) = -728q2 + 169q. Suppose 2v + 76 = -3f - 606, -4f = -2v - 668. Let b(h) = 13h2 - 3h. Give vb(k) - 6z(k). -26k2 Let i(n) = -3n*3 - 3n*2 - 12n. Let l(u) = 2u3 - 11u*2 - 108u - 18. Let q be l(-5). Let w(h) = 9h3 + 8h*2 + 35h. Calculate qw(r) - 8i(r). -3r3 - 9r Let u(l) = 5l + 26 - 13 - 9. Let n(t) = 3t + 3. Let q(m) = 8n(m) - 5u(m). Let r(y) = -y + 5. Let s = 8 - 5. Give sq(v) - 2r(v). -v + 2 Let v(x) = -x*2 - 4x + 5. Let w(b) = 2b2 + 13b - 14. Suppose 369t = -1297t - 424t - 6270. Let y be (3 + -1)/2 + -9. What is tw(p) + yv(p)? 2p*2 - 7p + 2 Suppose 0 = -5q + 22 + 3. Let s(d) = 3d - 8. Let k(i) = i*2 - 13i. Let p be k(12). Let f = p - -18. Let g(j) = -2j + 7. Calculate fg(w) + qs(w). 3w + 2 Let y(h) = 3504h2 - 692. Let p(g) = -584g*2 + 120. Give -23p(f) - 4y(f). -584f*2 + 8 Let s(g) = 4g - g - 5g - g - 1. Suppose -679 = 157u - 60u. Let c(v) = 5v + 1 - 2v + v. What is us(h) - 5c(h)? h + 2 Let b(z) = 8295z*2 - 3z - 12. Let d(s) = 8297s2 - 2s - 8. What is 2b(m) - 3d(m)? -8301m2 Let r(i) = -9i*2 - 6i + 4. Let k(x) = -3x3 - 32x*2 - 54x - 347. Let f be k(-10). Let p(j) = -4j2 - 3j + 2. Calculate fp(d) + 3r(d). d*2 + 3d - 2 Let q(c) = -44c + 1. Let x(b) = 737b - 12. Determine -6q(h) - x(h). -473h + 6 Let c(r) = -r + 2. Let p = 12717 - 12715. Let a(k) be the first derivative of 3k - 4k - 6k - 4 + k2. Calculate pa(v) + 7c(v). -3v Let l(x) = 8x3 + 7x*2 - 7x - 7. Let d(w) = -4w3 - 4w*2 + 4w + 4. Suppose -5c = 2h + 45, 3h + 9 = 3c + 15. Calculate cd(v) - 4l(v). -4v3 Suppose -9 = -s - 6. Let i(k) = k2 - k + 1. Let l(b) = 0b + b - 4b - 88b*2 + 44b*2 + 46b*2. What is si(u) - l(u)? u2 + 3 Let u(c) = -c + 4. Let h(m) be the first derivative of -m2 + 13m - 2062. Let k = -9 + 7. What is kh(t) + 7u(t)? -3t + 2 Let i(c) = 989c - 1002c - 146 + 152. Let u(a) = -364a + 169. Determine 169i(y) - 6u(y). -13y Let a(t) = -t*2. Let c(m) = -7m*3 + 3m*2 + 2m. Let w = 4567 + -4570. Let x be (-4 - (1 + -4))/1. What is wa(h) + xc(h)? 7h3 - 2h Let v(w) = 7178782w. Let l(h) = -1766h. Give -12194l(z) - 3v(z). -1742z Let b(o) = o2 - 3o - 113. Let n be b(-9). Let w(t) = 8 - 3 + 0t - 3t - 3 - 6. Let a(g) = -4g - 5. What is nw(u) + 4a(u)? -u Let w(h) = h - 1. Let r(p) = -p3 + 11p*2 + 59p - 445. Let z be r(13). Let f(k) = 6k - 4. Determine zw(m) + 3f(m). 2m + 4 Let p(b) = 4b2 + 1. Let s(u) be the first derivative of u5/60 - 57u*2 - 183. Let h(v) be the second derivative of s(v). Calculate -7h(m) + 2p(m). m2 + 2 Let j(o) = -382o*2 - 76o - 11. Let y(s) = 191s2 + 35s + 5. Calculate -6j(r) - 13y(r). -191r2 + r + 1 Let u(z) be the third derivative of z4/24 + 2z*2 + 285z. Let h(x) = x*2 + 6x - 2. Let a be -1 + (-18)/6 + 3. Give ah(q) + 4u(q). -q*2 - 2q + 2 Let i(p) = -41p2 + 22p + 639. Let w(a) = 7a2 - 4a - 128. What is 2i(r) + 11w(r)? -5r2 - 130 Let f(g) = g2 + 13g. Let l(z) = z*2 + 13z. Let s = 4862 - 4868. What is sl(d) + 5f(d)? -d*2 - 13d Let o(x) = 13x2 - 5x - 2. Let w(i) = 32i2 - 13i - 5. Determine -13o(b) + 5w(b). -9b2 + 1 Let f(p) = -2331p*2 - 5p + 42. Let v(b) = -1166b2 - 3b + 25. Calculate 3f(m) - 5v(m). -1163m2 + 1 Let g(q) = 115q*2 - 5q + 5. Let o(m) = 277m2 + 4 - 450m*2 + 68 - 418m*2 - 72m + 2259m2. Calculate -72g(v) + 5o(v). 60v2 Let h = -557 - -561. Let t(m) be the third derivative of m4/4 + 5m3/6 - 10m*2. Let r(u) = -11u - 9. Give hr(g) + 7t(g). -2g - 1 Let u(b) = -59759221b + 59844. Let c(j) = -19973j + 20. Calculate 14961c(d) - 5u(d). -19948d Let o(v) = -658280205v - 135898. Let h(t) = -19376t - 4. Give 67949h(s) - 2o(s). -19414s Let p(s) = 2s*3 - 5s - 4. Suppose c - 9c = 240. Let b = c + 32. Suppose 4 = -m + 2u, m - bu + 16 = 3m. Let k(y) = -y - 1. What is mk(i) - p(i)? -2i*3 + i Let q(g) be the second derivative of 7g3/6 + g2/2 + 4067g. Let h(l) = -l2 - l. Calculate 2h(t) + q(t). -2t2 + 5t + 1 Let b(s) = 32s2 - 37830s - 16. Let f(y) = -10y2 + 12610y + 5. What is -4b(z) - 13f(z)? 2z2 - 12610z - 1 Let s be 4/2 - (10 + -16 + 12). Let n(t) = 5t2 + 2t - 12. Let l(x) = 11x2 + 4x - 25. What is sl(o) + 9n(o)? o*2 + 2o - 8 Let z(s) = -3s3 - s + 6. Let a(d) be the third derivative of -d6/120 - 6d*2 + 96d - 4. What is 2a(r) - z(r)? r3 + r - 6 Let b(p) = -44p*3 + 16p*2 + 13p - 8. Let q(n) = -31n3 + 11n*2 + 9n - 5. Give 5b(c) - 7q(c). -3c3 + 3c*2 + 2c - 5 Let j(s) = 14s3 - 3s*2 + 1. Let c(y) be the first derivative of 27y*4/4 - 5y*3/3 + 3y - 1387. What is -3c(a) + 5j(a)? -11a3 - 4 Let k be (-6)/(-15) + ((-33)/(-30))/(16/96). Let c(n) = -23n*2 - 7n + 7. Let p(o) = -22o2 - 6o + 6. Determine kp(j) - 6c(j). -16j2 Let b(s) = -5s. Suppose -3f + 55 - 19 = 0. Let z(m) = -fm + 52m - 17m - 7m. What is -8b(i) - 3z(i)? -8i Let o(a) = -5a + 4. Suppose -3i = 4f - 12, -i + 2f = 7f - 4. Let l(v) = -2 - 10v + iv + 10v - 3. Determine -6l(u) - 5o(u). u + 10 Let y(m) = 216m3 + 24m*2 - 21m + 10. Let b(k) = 43k3 + 5k*2 - 4k + 2. Give 11b(n) - 2y(n). 41n3 + 7n*2 - 2n + 2 Let v(g) = -14917g - 8. Let l(u) = 2131u + 1. Calculate -15l(d) - 2v(d). -2131d + 1 Let w(y) = 32y*2 + 3. Suppose 4z - 11 = -5m, 2 = z + 8. Let i(s) = 65s*2 + 7. Give mw(x) - 3i(x). 29x*2 Let p(s) = 80s - 55. Let u(j) = 160j - 147. Calculate 5p(z) - 2u(z). 80z + 19 Let n(c) = -2c - 4. Suppose 5a = 17 + 13. Let q(z) = 11z + 23. Suppose 3p + 3k + 17 = 113, -7p - 5k = -228. What is aq(o) + pn(o)? -2o + 2 Let u(r) = -21r. Let t(o) = 54o + 8. Let l(z) = 106z + 18. Let g(i) = -4l(i) + 9t(i). What is 2g(v) + 7u(v)? -23v Let q(n) = -n2 - n - 1. Let m(k) = k2 - 163*k + 5383. Let j be m(46	{ "pile_set_name": "DM Mathematics" }
8n - 10. Let m = -34 - -39. Suppose -mw + 2 = -8. List the prime factors of j(w). 2, 3 Let c(p) = -11p2 - 4p*3 + 12p*2 - 1 - p - 2p. Suppose -20z - 26 = -7z. What are the prime factors of c(z)? 41 Let a = -3494 - -8124. What are the prime factors of a? 2, 5, 463 List the prime factors of (-2588 - 0)87/(-58). 2, 3, 647 Let x(t) = t2 - 19t + 48. Let g be x(16). Suppose g = -2q - 166 + 498. List the prime factors of q. 2, 83 Let f = 428 - 429. What are the prime factors of f - (97/(-4))/(5/60)? 2, 5, 29 List the prime factors of 23 + -26 + ((-564)/10)/((-2)/50). 3, 7, 67 Let o be (-3 + 6)-163/(-27). What are the prime factors of (-1844)/(-12) - o/(-21)? 2, 7, 11 Suppose -68m - 89697 + 18161 = -70m. List the prime factors of m. 2, 17, 263 Suppose -3v - 317 = 5l - 8322, v = 5l + 2675. Suppose -6f - 4w - 4005 = -9f, -2f - 4w = -v. List the prime factors of f. 3, 5, 89 Suppose 0 = -2u - 0u - 102. Let d(p) = -p3 - 11p - 17. Let b be d(4). Let r = u - b. What are the prime factors of r? 2, 37 Let l be -3 - (-8)/3 - (-1355)/15. Let q = l - 87. What are the prime factors of (18/(-7))/(q/(-238))? 2, 3, 17 Suppose -2g = -0g + 3d - 6215, 2g - 5d - 6239 = 0. What are the prime factors of g? 2, 389 Let d be (-2)/(-2)(20 - 31)-1. Suppose 9o - 40 = -do. List the prime factors of o. 2 Let u = -1764 - -3332. Let t = u - 181. List the prime factors of t. 19, 73 Suppose -136b = -145b + 26145. List the prime factors of b. 5, 7, 83 Suppose 0 = i + 5, -5n - 3i = 2i. Suppose -3x - 4q = -1873, 2x + 3x = -nq + 3130. What are the prime factors of x? 631 Suppose 5x - 23106 = 4u, -228x + 226x + 9264 = 2u. What are the prime factors of x? 2, 3, 257 Suppose 52f = 2075923 + 1845729 - 1013916. What are the prime factors of f? 2, 73, 383 Let o(c) = 5c + c*3 - 5c*2 + 6c*2 - 120 + 117. Suppose 28 - 8 = 5u. List the prime factors of o(u). 97 Suppose 19z - 2604 = -894. Suppose 10230 = zq - 84q. What are the prime factors of q? 5, 11, 31 List the prime factors of (-50743)/(-9) + 1096/1233. 5639 Suppose -3h = -d - 28 - 27, -20 = 5d. Let b(c) = 35c + 160. List the prime factors of b(h). 5, 151 Let m(l) = -2l2 + 39l + 115. Let j be m(22). Suppose -1968 = -3u - jc + 355, 0 = -c - 1. What are the prime factors of u? 2, 97 Let x = 1838 - -2768. Suppose -x = 5p - 12p. List the prime factors of p. 2, 7, 47 Let b = -17191 - -29182. List the prime factors of b. 3, 7, 571 Let z = -86 + 101. What are the prime factors of (-12)/2(10 - z)? 2, 3, 5 Let w(n) = n2 - 5n - 12. Let s be w(7). Suppose 5b - 36 + 9 = 2m, sb - 2m = 12. List the prime factors of (b - 6)/(3/(-48)). 2 Let f(g) = -6g - 12. Let j be f(-3). Suppose -1246 = -20u + ju. What are the prime factors of u? 89 Let j(g) be the second derivative of g4/12 + 7g3/6 - g2/2 - 10g. Let z be j(-7). List the prime factors of z/(-2) + 21/(-24)-4. 2 Let o(m) = 9m2 + 6m + 40. Let s = -478 - -465. List the prime factors of o(s). 1483 Suppose 4v = -p + 18327, -20 = -44p + 48p. What are the prime factors of v? 4583 Let q(i) = -i + 2. Let g be q(-3). Suppose -2c = 5v - 32, 0 = -gv + 10. Let l = c + 33. List the prime factors of l. 2, 11 Suppose 18z - 40501 - 62495 = 0. List the prime factors of z. 2, 2861 Suppose 3794 = 16w - 161907 + 14949. List the prime factors of w. 2, 7, 673 Suppose 3z = -4t + 113981, 3z - 3t - 68110 - 45836 = 0. List the prime factors of z. 37987 Let i = 11 - 8. Suppose -iq + q = -326. Suppose q = 4g - m - 251, -2g = -4m - 214. What are the prime factors of g? 103 Let j be 12/8 + (-22755)/(-10). Suppose -10k = -7k - j. What are the prime factors of k? 3, 11, 23 Let n = 14935 + -6867. What are the prime factors of n? 2, 2017 Let x be 1/((4 + -9)/(-30)). List the prime factors of 8356/28 - x/14. 2, 149 Let u(n) = -2691n - 2072. List the prime factors of u(-6). 2, 31, 227 Suppose 2n + 4v = 7v + 13894, 0 = -3n + v + 20855. List the prime factors of n. 17, 409 Let u be 17/3 + (4 - (-28)/(-6)). Let v = -51 - -42. List the prime factors of 20/(v/u - -2). 2, 5 Suppose h = 11k - 10k + 164, -328 = -2h + k. Suppose 5v = -3g + 671, -5v + h = -5g - 531. What are the prime factors of v? 2, 17 List the prime factors of ((-299186)/30 - 18/135)-3. 3, 9973 Let v(y) = -y3 + 3y*2 + 9y + 3. Let w be v(5). List the prime factors of (-1192)/(-20)(-2 + (-9)/w). 149 Suppose -7x + 16 = -3x. Suppose 0 = -xk + 3v, -6k + 4k + 3v = 0. Suppose 0 = 3p + 2w - 30, 10 = p - kp + 2w. What are the prime factors of p? 2, 5 Let s(o) be the third derivative of -35o4/24 - 11o*3/6 - 36o*2 - 2o. What are the prime factors of s(-8)? 269 Let l(u) = 16u2 + 49u - 50. List the prime factors of l(-34). 2, 5, 839 Let g = 23 - -250. Let o be 375/(-3) - (20/(-30))/((-4)/(-30)). Let d = g + o. List the prime factors of d. 3, 17 Suppose -40366j = -40380j + 376404. What are the prime factors of j? 2, 3, 4481 Suppose 832549 = -101v + 204v. What are the prime factors of v? 59, 137 Let c = -72 - -584. Let y = 912 - c. Suppose -224 - y = -4d. List the prime factors of d. 2, 3, 13 Suppose -16301 - 15835 = -17x - 2505. What are the prime factors of x? 3, 7, 83 Suppose 4l = 2d + 70, 37 = 3l - 3d - 20. Let s be (688/l)/(0 - -1). Let u = s + -24. What are the prime factors of u? 19 Let l(i) = -5i - 23. Let g be l(-6). Suppose 4t - g = 1. Suppose -tw + 5o + 26 = -w, -w = 4o - 53. What are the prime factors of w? 41 Suppose -y - 94 = -4m, 0 = 8m - 13m - 5y + 130. Suppose 5u - 4p - 36 = u, -4p - m = -3u. List the prime factors of u. 2, 3 Suppose 464a = 445a + 345857. What are the prime factors of a? 109, 167 Suppose 1216150 = 64n + 88n - 127n. List the prime factors of n. 2, 13, 1871 List the prime factors of (896/(-5))/((-741)/427310). 2, 89, 173 Suppose -3s + 3j = -2395 - 758, 0 = 4j - 8. List the prime factors of s. 3, 13 Let t(w) = -7w3 - w - 1. Let g be t(-1). Let v(j) = -11j*2 + 31j - 41. Let l(b) = b*2 - 3b. Let r(m) = -7l(m) - v(m). List the prime factors of r(g). 167 Let u be (-2)/(4 - 35/45 - 3). What are the prime factors of (u - (-498)/54) + 1699/9? 3, 7 Let b(p) = 276p + 266. List the prime factors of b(9). 2, 5, 11 Let q(v) = 285v2 + 103v + 1089. List the prime factors of q(-12). 3, 43, 317 Let x(n) = -400n + 1108. List the prime factors of x(-9). 2, 11, 107 Let p be 11197/(-9)(1 - 0). Let a = p - -69. Let s = 301 + a. What are the prime factors of s? 3, 79 Suppose 0 = -g - 2m + 16234, 2g - 33743 = -2m - 1291. List the prime factors of g. 2, 3, 17, 53 Suppose 0 = -7v + 5v + 5l + 275, 4v + 2l - 562 = 0. Suppose -4t + 1855 = 3s, -2t + v = 5s - 791. List the prime factors of t. 463 Suppose -201b = -247b + 94162. List the prime factors of b. 23, 89 Let x(t) = t - 8t - t*2 - 3t - 13t - 20. List the prime factors of x(-13). 2, 5, 11 List the prime factors of (-2 + 48783/2)/((-6 + 10)/8). 48779 Let p(l) = 1095l + 19056. What are the prime factors of p(64)? 2, 3, 619 Let c = -28 + 30. Suppose 7u = 9u - r + 8, cr - 22 = 5u. Let b(a) = 11a2 + 48a + 9. What are the prime factors of b(u)? 3, 13 Suppose -14y + 79255 = -11y + 8g, 0 = -3g - 21. List the prime factors of y. 26437 Let g(b) be the second derivative of 7b4/3 + 13b*3/2 - 27b*2/2 + 57b. What are the prime factors of g(6)? 3, 5 Suppose -2100 - 276 = -8u. Let h be u/(-36)4-3. Suppose 3f - 72 = h. List the prime factors of f. 3, 19 List the prime factors of -46((-324)/243)/(4/4506). 2, 23, 751 Let d(u) = -4u + 45. Let m(j) = -2j3 + 7j*2 - 10j - 4. Let l be m(3). List the prime factors of d(l). 5, 29 Let y(n) be the second derivative of n5/20 - n4/2 - 17n3/6 + 19n*2/2 - 19n. List the prime factors of y(13). 3, 109 Suppose 3q + 72242 + 344219 = 26q. List the prime factors of q. 19, 953 Let u = 41382 - 18664. List the prime factors of u. 2, 37, 307 Let x(w) = -w*3 - 9w*2 - 10w + 30. Let z be x(-7). Suppose -zr + 61 = -419. What are the prime factors of r? 2, 3, 5 Suppose 339 + 267 = 2y. Let j = y - 217. List the prime factors of j. 2, 43 Let a = -5 - -15. Suppose 5w - 2 = -4v + 5v, -4w = 5*v + a. Let k = 78 - v. What are the prime factors of k? 2, 5 Let m =	{ "pile_set_name": "DM Mathematics" }
- 2h3 as jh*3 + ah*2 + y + lh and give l. 1 Express 4q2 - 2q*2 - 4q*2 + (3q*2 + 4q*2 - 5q*2)(-22 + 10 + 15) in the form vq + hq*2 + i and give h. 4 Rearrange 1 + 4f*4 - 4 - 3f*3 + 5f3 - f4 to df + lf*2 + qf*3 + r + cf*4 and give r. -3 Rearrange (-a - a + a)(0a3 + 2a*3 + 0a*3) + 6a*4 - 6a*4 + 7a*4 to ya*2 + wa*4 + d + ka + sa3 and give w. 5 Express -3m*2 + 2m*2 + 0m*2 + (3m - 3m + m2 + (1 - 4 + 5)(m2 + m2 - 3m2))(-94 - 12 + 2) in the form k + nm2 + qm and give n. 103 Rearrange 2w2 - 2 + 21w*3 - 2w*2 - 4w*3 to the form qw*2 + sw + lw3 + a and give a. -2 Express -8g*2 + 8g*2 + g - 2g*2 - 6g*4 as d + qg*3 + xg + ag4 + mg*2 and give m. -2 Rearrange -73c + 3873 - 3873 to the form a + rc and give r. -73 Express (-k + 2k*2 + k)(-91k + 114 - 59 - 55) in the form mk + ck2 + n + ok*3 and give o. -182 Rearrange 42d - 83d + 41d + 39d2 to gd*2 + yd + l and give g. 39 Express -j2 + 24 - j4 - 6j3 - 24 in the form c + hj*3 + bj + qj4 + fj*2 and give b. 0 Rearrange (0d + 2d + 0d)((-2 + 4 - 3)(0 + d*3 + 0) + 10d*3 + 13d*3 - 19d*3) to gd*3 + ld*4 + n + kd + id2 and give l. 6 Rearrange -4x*4 + 3x*4 + 3x*4 + (-2x2 - x2 + 5x2)(-6x - 2x*2 + 6x) to i + dx + wx*2 + nx*3 + ax*4 and give a. -2 Express 4l - 2l - 2l3 - l2 - 4l in the form ol*2 + ml + hl3 + f and give m. -2 Rearrange (-k + 0k + 13k)(-2 + 2 - 4k) to m + dk*2 + tk and give d. -48 Rearrange -8l + 4l - 6l - 9l to the form bl + u and give b. -19 Express (3 - 5 - 1)(a - 2a + 3a)(5a - 6a + 6a) as va2 + x + ga and give v. -30 Express 4r2 - r2 - r2 + 1 + 22r*4 - 4r*4 in the form mr*2 + gr + y + fr4 + hr*3 and give f. 18 Rearrange (-6 + 3 + 1)(3i - 4i + 0i)(24 - 82 - 20) to ni + a and give n. -156 Rearrange -2g - 5g2 - 3g + 0g + 3g*2 to the form p + og + xg2 and give p. 0 Rearrange 3k - 3k + 4k to the form qk + z and give q. 4 Express -3w*2 + 2w*2 + 3w*2 + (1 - 3 + 0)(-2w2 + 0w + 0w) - 119w*2 - 48w*2 + 45w*2 in the form sw*2 + kw + l and give s. -116 Express 54g + 47g - 117g in the form kg + n and give k. -16 Rearrange (-49 + 49 - 55q)(-2q3 - q3 + 5q*3) to jq*4 + yq*3 + mq*2 + lq + t and give j. -110 Express 2 + 4 + 6k2 - 2k3 + k2 - 7 in the form o + pk3 + fk*2 + mk and give f. 7 Rearrange -4 - 28m + 3m + 4 to the form km + p and give k. -25 Rearrange 51b4 - b - b3 - 7b4 - 29b*4 to cb*3 + fb*4 + ab*2 + tb + s and give f. 15 Express 0 + 3j2 + 0 - 163j*3 + 167j*3 in the form vj*2 + ij*3 + bj + p and give i. 4 Rearrange (-8 + 22r2 + 10 - 6r*2)(0 - 1 + 0 + (2 + 0 - 1)(-1 + 2 + 1) + 4 + 5 - 3) to wr*2 + lr + g and give w. 112 Rearrange -1 + 6h4 + 22h*3 + 2h*4 - 2h - 6h4 to qh*3 + zh*2 + ph*4 + gh + o and give g. -2 Express (-l*4 + 0l*4 - 2l*4)(-3 + 0 + 4) + 8l2 - 9l*2 - 12l*4 + 0l*2 in the form sl*2 + wl*3 + m + kl + yl4 and give s. -1 Rearrange (-3p - 3p + 7p)(-2p*2 + 2p*3 + 2p*2) + (0p*4 + 5p*4 - 4p*4)(-3 + 0 + 0) to hp + tp*4 + s + rp*2 + yp*3 and give t. -1 Express (2 - 2 + 2)((-4v + 3v + 2v)(0 + 2 - 3) + 9 - 9 - 7v)(4v + 2v - 4v) in the form x + mv*2 + rv and give m. -32 Rearrange -28x - 46x + x - 19x to a + jx and give j. -92 Rearrange (-q + 0q + 0q)(-10q - 38q + 21q) to the form rq + g + pq*2 and give r. 0 Rearrange 2g*2 + 2 - 3g*3 - 47g*4 + 46g*4 + 6g*3 to s + zg*2 + cg*3 + bg*4 + og and give s. 2 Rearrange -2 - 2o + 2 + 3o - 3o + o + (-1 - 2 + 1)(5o - 3o - 3o) - 6o + 0 + 0 + 2o + 3o - 6o to the form lo + i and give l. -6 Rearrange (-4g + g + 4g)(2g - 5 + 5)(60 - 35 - 35) to fg + v + yg2 and give y. -20 Express (-3 + 3 - f)((-9 - 9 + 0)(-3 + 4 - 3) + (-2 - 3 + 4 + (-2 + 0 + 1)(3 + 2 - 7))(5 - 3 - 1)) in the form cf + b and give c. -37 Express -s - 2 + s*3 + 6 + 2s4 - 2 - s4 as g + os4 + bs + as2 + xs*3 and give o. 1 Rearrange 10s2 - s4 - 11s2 + s + 2 - 4 to ts + h + us2 + gs*4 + cs3 and give g. -1 Rearrange -r3 - 2r3 - 10 + 14 to the form tr*2 + ar*3 + wr + b and give a. -3 Express (-1 - 11 + 4)(4 - 4 - w + (-2 - 1 + 1)(-2w + 1 - 1) + (0 - 3 + 1)(0w - 3w - 2w)) in the form v + tw and give t. -104 Rearrange -5o2 - 14 + 5o*2 - 2o*2 + 3o*2 to the form co*2 + x + bo and give x. -14 Rearrange 21b + 34b - 20b to w + db and give d. 35 Express (2 + a + a - a)(0a*2 + 5a2 + a2) in the form la2 + ba*3 + ua + q and give b. 6 Express (-1 - 1 + 1 - 4 + 2 + 3 + (-3 - 2 + 7)(3 + 1 - 6) + 6 + 2 + 8)(2u + 2u - u) as zu + k and give z. 36 Express 3 - 3o3 + o3 - 2 + 4o + 3o3 - o3 - o3 + (-o3 + 3o3 + 0o*3)(2 - 2 - 1) in the form i + fo3 + no + jo2 and give f. -3 Express (-4p + 4p - 2p)(-4p + 35 - 35)(-1 + 3p + 1) in the form d + np + gp*2 + ip*3 and give i. 24 Express ((-2 + 3 - 3)(-n*3 + 2n*3 - 2n*3) + 0n*3 - 3n*3 + 2n*3)(-26n + 23n - 3 + 11n) in the form zn*3 + pn*4 + tn*2 + dn + r and give r. 0 Rearrange -14b2 + 5b*2 + 7b*2 + b + 2b*4 to sb*3 + ib + wb4 + cb*2 + v and give i. 1 Express -2g*3 + 0g*2 + 0g*2 + (-g - 4g + 3g)(g*2 + 2g - 2g) - 5 + 5 - g3 - 8g*3 + 8g*3 + 10g*3 as d + jg*3 + fg + qg2 and give j. 5 Express (-a2 + 3a2 - a2)(1 + 2a*2 - 1) + 15a*4 + 27a*4 + 37a*4 in the form la*4 + pa + sa3 + r + va*2 and give l. 81 Express (-4 + 5 + 0 + (1 + 4 - 1)(0 + 1 - 3) + 3 - 4 - 2)(-k3 + 2 - 2) as h + yk + bk3 + dk*2 and give b. 10 Express 0p + p + 3 - 8p + 8p as j + wp and give w. 1 Express (5w*3 - 2w*3 - 5w*3)(7w - 12w - 4w) in the form ow + mw2 + jw*3 + p + qw*4 and give q. 18 Rearrange (0k*2 - 3k*2 + 8k*2)(6k + k - 3k)(0 + 0 - 3k) to dk2 + c + yk + ak4 + gk*3 and give a. -60 Express 2s*2 + 11s*2 + 2s*3 - 1998s + 1996s + 1 in the form us*2 + b + rs*3 + ns and give u. 13 Rearrange -5 + 5 - 6c + (-1 - 4 + 3)(4c - 4c - c) + 3 - c - 3 + (-2 - 2 + 3)(-3c + c + 0c) - 2c - 2c + 3c - 3c + 7c - 3c to k + pc and give p. -3 Rearrange (5 + 0 - 4)(-1 + 1 + 2t) - 3t + 2 + 2t - 1 to the form z + kt and give z. 1 Express (9i*2 - 2i*2 + 0i*2 + (i - 1 + 1)(3 + i - 3) - i*2 + 5i*2 - 3i*2)(i + i + 2i) in the form ci + p + hi2 + si*3 and give s. 36 Express (z + 0 + 0)((1 + 1 - 4)(0z - z + 2z) - 11 + 11 - 6z + z + z - 3z) as yz + v + jz2 and give j. -9 Rearrange (-4y*3 + 2y*3 + 3y*3)(-4 + 0 + 3) - y*3 + 2y*3 - 3y*3 + 20y*3 + 46y*3 - 3y*3 to ay + dy2 + ky*3 + c and give k. 60 Rearrange 3 - 3 + 158c - 98c to the form oc + h and give o. 60 Rearrange (-5r + 3r + r)(-3r - 6r - 2r) to i + pr2 + gr and give p. 11 Express (1 + 2o - 1)(4o2 + 2o*2 - 5o*2)(-4o - 2o + 3o) as bo + z + vo2 + yo*3 + jo*4 and give j. -6 Express (-4h + 3h + 2h + (1 - 1 - 2)(-3 + 3 + h) - 5 + 4h + 5 - 3 + h + 3)(2h*3 + 2h - 2h) as ih + fh3 + oh*2 + t + bh*4 and give b. 8 Express (3 + z - 3)(0z - 6z + 3z) + 6 - 6 + 11z*2 as mz*2 + f + lz and give m. 8 Rearrange 121 + 16t - 121 + t to qt + g and give q. 17 Rearrange -k*2 + 0k*2 - 2k*2 + (-13k + 13k + 2 - 8k*2)(-3 + 0 + 5) to bk + g + mk*2 and give g. 4 Rearrange -k - 5k3 - k4 + 3k2 + 309 + 2k*3 - 308 + 5k*2 to the form mk + hk3 + vk*4 + b + ik*2 and give h. -3 Express -3 + 5y - 8y + 3 in the form cy + q and give c. -3 Express (-i - 276 + 130 + 175)(1 + 0 + 0)(2 - 2 + 3i) as z + vi*2 + hi and give v. -3 Rearrange -7 + 0 - 2s + 2 + 6 + 21s*2 to y + os*2 + cs and give c. -2 Express (1865 - 1865 + 64b)(6b3 - 2b*3 - 3b*3) + 3b*4 - 3b*4 + 2b*4 as jb*2 + ob*4 + kb*3 + m + lb and give k. 0 Express (0z2 - 4z*2 + 3z*2)(35z2 + 38z*2 - 18z*2) as gz*4 + p + bz*3 + az + qz2 and give g. -55 Rearrange 332 - 3b*2 + 5b*2 - 347 to the form zb*2 + rb	{ "pile_set_name": "DM Mathematics" }
t. Determine q, given that j(q) = 0. -10, 2/3, 1, 2 Suppose -x - 13 = -16. Suppose 0q + 30 = 5c + q, 0 = xc + 3q - 18. Determine t, given that ct*2 + 6t - t*4 - 22t + 8t + 3 + 0t = 0. -3, 1 Find u such that -2896u - 2u*4 - 380u3 - u4 - 1258u2 - 1440 - u4 - 574u2 = 0. -90, -2, -1 Let m(w) = w2 + 2w. Suppose 0 = -6p - 84 + 90. Let f(v) = 125v2 + 52v + 4. Let s(a) = pf(a) - 4m(a). Determine q so that s(q) = 0. -2/11 Suppose 16 = 4j - 4m, -5j + 3m + 2 = -14. Find p such that -4p5 - 1361p*2 - 12p*3 + 14p*4 - 2p*4 + 1365p*j = 0. 0, 1 Let z(y) be the third derivative of 2y7/105 - y6/3 + 13y5/15 + 4y*4 + 1406y*2. Solve z(s) = 0 for s. -1, 0, 3, 8 Let n be ((-230)/69(-18)/(-112))/((-14)/112). Factor n - 2/7u2 - 4u. -2(u - 1)(u + 15)/7 Let o(s) = -3s2 + 2. Let m(i) be the second derivative of -7i*4/12 + 5i*2/2 + 15i. Let x be -1 + 0 - 0 - -6. Let g(r) = xo(r) - 2m(r). Factor g(p). -p*2 Factor 156i*3 + 51483/5 + 49914/5i*2 - 20436i + 3/5i4. 3(i - 1)*2(i + 131)2/5 Let z(q) = -q2 + 4. Let t = 370 + -368. Let n be z(t). Factor ny2 + 0y + 0 - 2/11y3. -2y3/11 Let b(r) be the third derivative of -r7/105 + 17r6/360 - r5/12 + r4/24 + r3/18 - 45r*2 - 7r. Factor b(h). -(h - 1)*3(6h + 1)/3 Let t(p) be the second derivative of 2p*6/45 - 23p*5/15 + 56p*4/3 - 88p*3 - 198p. What is n in t(n) = 0? 0, 6, 11 Let c be 11/((-275)/(-40))15/2. Suppose -m + 0 = 3b + 4, -b = -3m - c. Factor 3/5s*3 - 3/5s + 0 + bs2. 3s(s - 1)(s + 1)/5 Let s(f) be the third derivative of f*5/120 + 37f*4/24 - 77f*3/4 - 991f*2. Factor s(i). (i - 3)(i + 77)/2 Let j(c) be the third derivative of -c*5/240 - 17c*4/48 - 91c*3/8 + 4c*2 + 64c - 2. Factor j(t). -(t + 13)(t + 21)/4 Let b(i) = -10i*2 + 14i + 5. Let j be b(7). Let u = j - -390. Let 4 - 1/2f4 - 5/2f*3 + 2f - uf2 = 0. Calculate f. -2, 1 Let g(a) be the second derivative of 0a*2 - 2/15a*6 - 9a + 2a3 + 1/3a*4 + 0 - 3/5a*5. Factor g(d). -4d(d - 1)(d + 1)(d + 3) Find f, given that -44/5f*2 + 42/5f*3 + 4/5 - 82/5f = 0. -1, 1/21, 2 Suppose l - 4q - 9 = -25, -l + 2q - 6 = 0. Let t be (-3 + l)(-9 + 10). Solve t + 1/4b*3 + 2b + 5/4b2 = 0 for b. -2, -1 What is n in 4/5n*5 + 0 + 0n - 144/5n3 - 12/5n*4 - 128/5n*2 = 0? -4, -1, 0, 8 Let l = -18218 + 163970/9. Factor -10/9i*2 - li + 0 - 2/9i3. -2i(i + 1)(i + 4)/9 Suppose -532546c + 532548c = 2. Factor -1/3r2 + 2/3r + c. -(r - 3)(r + 1)/3 Let k(x) be the third derivative of x8/112 + 19x*7/35 + 101x*6/8 + 657x*5/5 + 486x*4 + 864x*3 - 118x*2 - 5. Factor k(i). 3(i + 1)*2(i + 12)*3 Let w(p) be the second derivative of 3/110p*5 + 1/231p*7 + 2/33p*4 - 92p - 4/165p6 - 1 - 4/33p*3 + 0p*2. Let w(n) = 0. Calculate n. -1, 0, 1, 2 Suppose -8277 = -21f - 2922. Let p be f/33 + 0 + -7. Determine q so that -pq2 + 8/11q - 2/11q3 + 0 + 2/11q*4 = 0. -2, 0, 1, 2 Solve -1/2k*2 - 131/2k + 270 = 0. -135, 4 Let 0 + 1/9l3 - 29/3l - 26/9l2 = 0. Calculate l. -3, 0, 29 Let d(i) = 5i*3 + 94i*2 + 292i - 1000. Let c be 4/12 - 13/3. Let w(g) = 20g3 + 375g*2 + 1170g - 4000. Let f(b) = cw(b) + 15d(b). Factor f(u). -5(u - 2)(u + 10)*2 Find a such that 354/5a*3 + 0 - 1232/5a*2 + 1568/5a + 2/5a5 - 44/5a4 = 0. 0, 4, 7 Let l(v) be the third derivative of -v7/560 - v6/48 + v5/80 + 5v4/16 - 209v*3/6 + 30v*2 - 4. Let x(g) be the first derivative of l(g). Factor x(b). -3(b - 1)(b + 1)(b + 5)/2 Let g = -425 - -425. Suppose 4a = -4s + a - 1, g = -5s + a + 13. Factor 12/7 - sb*2 - 38/7b. -2(b + 3)(7b - 2)/7 Let a(b) be the third derivative of b6/40 - 2139b*5/20 + 6559b*2. Factor a(t). 3t*2(t - 2139) Let g(j) = j - 6. Let x be g(7). Let k(n) = -7 - n + 4 - 3n2 - n - x. Let r(z) = 4z*2 + z + 4. Let t(q) = 3k(q) + 2r(q). Determine p so that t(p) = 0. -2 Suppose -2p - 21 = 2t - 15, t + 4p = 0. Let f be t + ((-52)/20 - -7). Factor -fz4 - 2/15z*2 + 0 + 0z - 2/15z5 - 2/5z*3. -2z*2(z + 1)*3/15 Suppose -11x = 4x - 270. Determine m so that -2m + 2m2 - x + 15 - 9 = 0. -2, 3 Let i = 7487 + -15925/2. Let m = -468 - i. Determine f, given that -mf*3 - 21/2f*2 - 9/2f - 3/2f4 + 0 = 0. -3, -1, 0 Let o(a) be the second derivative of -5a*7/42 - 34a*6/3 - 133a*5/4 - 55a*4/2 - 3a - 11. Determine j so that o(j) = 0. -66, -1, 0 Let c(w) be the second derivative of 7w5/40 + 339w*4/8 + 145w*3/6 - 682w - 2. Factor c(j). j(j + 145)(7j + 2)/2 Let j(n) be the second derivative of n6/10 + 129n*5/20 - 49n*4/4 - 223n*3/2 - 198n*2 + 4877n. Factor j(k). 3(k - 3)(k + 1)*2(k + 44) Let y(w) be the first derivative of 1/21w6 + 71 + 0w - 1088/21w3 + 64/35w*5 + 289/7w*2 + 111/7w*4. Solve y(n) = 0. -17, 0, 1 Let k = -159 + 162. Let g = -5549 + 5549. Determine s so that -2/11s*2 + 2/11s*5 - 6/11s*4 + gs + 0 + 6/11sk = 0. 0, 1 Factor 451k + 12284k2 - 9394k*2 - 123k + 953k + 975k*3 + 5k*4 + 639k. 5k(k + 1)(k + 2)(k + 192) Suppose 3w = -68 + 26. Let m be ((-24)/28w/(-10))/(-3). Let -8/5 - 6/5r + mr*2 = 0. Calculate r. -1, 4 Factor -24/7 - 8/7i + 2/7i2. 2(i - 6)(i + 2)/7 Let w(s) be the second derivative of -23s + 4 + 9/80s5 + 1/40s*6 - 3/4s*2 - 3/8s*3 + 1/16s*4. Factor w(u). 3(u - 1)(u + 1)2(u + 2)/4 Factor 0j + 45j*2 + 0 + 3/2j*3. 3j*2(j + 30)/2 Let y be -1 + -17 + (-19397)/(-1071). Let m(s) be the first derivative of 1/3s2 - 11 + ys*3 - s. Determine l, given that m(l) = 0. -3, 1 Let m(f) be the first derivative of -2f*3/3 + 149f*2 - 1716f - 1708. Find j such that m(j) = 0. 6, 143 Let o = 354 + -351. Let j be -1o - (-138)/23. Solve gj + 1 - 1/4g*4 - 3/4g*2 - g = 0. -1, 1, 2 Let d(p) = -9p*2 - 329p - 487. Let i(j) = -2j2 + j + 37. Let r(q) = 4d(q) - 20i(q). Factor r(m). 4(m - 336)(m + 2) Let k = 1055 + -1736. Let x = k + 683. What is z in 4/9z*4 + 0 + 0z - 4/3z3 + 0z*x = 0? 0, 3 Let z(b) = -4b*3 - 7b*2 - 7b - 3. Let m(j) = -29j2 - 4j*3 + 3 - 29j - 14j3 - 16 + j3. Let f(u) = 6m(u) - 26z(u). Factor f(o). 2o(o + 2)2 Let s(t) be the first derivative of 2t*3/9 + 15t*2 - 456t - 10596. Solve s(l) = 0. -57, 12 Let y be 2/544878 + 106 + -109. Let j = 6/17 - y. Find n, given that jn*3 + 0 + 0n + 3/8n2 = 0. -3, 0 Let c(l) be the first derivative of -36l2 - 22 - l3 + 9/2l4 - 3/5l*5 - 48l. Factor c(k). -3(k - 4)2(k + 1)*2 Let x = 18395/798 + -220/399. Find y such that 0 - 30y + xy3 - 3/2y*5 - 3y*4 - 6y*2 = 0. -5, -1, 0, 2 Let h be (-43 - -13)(-6)/4. Let g = h - 35. Let -20 + 8q + 6q2 - q2 - 3q + gq = 0. Calculate q. -4, 1 Let i(f) = -f*3 + 19f*2 + 5f + 35. Let v be i(19). Factor -18d4 + 132 - 3d*3 + 18d*2 - 262 + v + 3d*5. 3d*2(d - 6)(d - 1)(d + 1) Let a be (-9)/((-99)/(-2))(-66)/244. Factor 2/5 - 2/15qa - 4/15q. -2(q - 1)(q + 3)/15 Let d(v) be the third derivative of -v*5/12 + 5v*4/24 + 75v*3 + 961v*2. Factor d(x). -5(x - 10)(x + 9) Let l(m) be the second derivative of -1/150m*6 + 0m*2 - 4/15m*4 - 2/5m*3 - 7/100m*5 - 2m - 4. Factor l(d). -d(d + 2)2(d + 3)/5 Let b be (-1232)/(-10)(-5200)/(-17160). Factor 146/3z*2 + 32/3 + 86/3z*3 + bz + 2/3z5 + 22/3z*4. 2(z + 1)*3(z + 4)*2/3 Let u be (-2 - (-10)/6)-91. Suppose uj - 4 = 2. Determine y, given that -4y2 - 243y*3 + jy*5 + 8y*4 + 2y + 12y2 + 255y*3 = 0. -1, 0 Let p = -41639/21 - -416453/210. Factor -pq - 1/10q4 + 0 + 1/10q*2 + 3/10q*3. -q(q - 3)(q - 1)(q + 1)/10 Let o be 17 - 17 - (73 + 3). Let b be 57/o + 46/8 - 3. Solve -272/7pb - 32/7 - 208/7p*3 - 10/7p*5 - 160/7p - 74/7p4 = 0 for p. -2, -1, -2/5 Let f be 4(3/(-24)18 + 4). Factor -8p*3 - 24 + 90p*2 - 88p2 - p3 + 16p + fp*3. -2(p - 2)*2(p + 3) Factor -176q - 2q*2 + 139 - 51 + 90. -2(q - 1)(q + 89) Let n(j) be the second derivative of j4/102 - 251j*3/51 + 498j*2/17 - 2138j. Factor n(r). 2(r - 249)(r - 2)/17 Let l be (54/(-21))/128/(-3). Let h be (54/(-72))/((-10)/l). Factor 6/5q + 1/5q*	{ "pile_set_name": "DM Mathematics" }
next in -207, -279, -351, -423, -495, -567? -639 What is the next term in 288, 1418, 3296, 5922, 9296? 13418 What is the next term in 198, 643, 1338, 2277, 3454? 4863 What is the next term in -71125, -71126, -71121, -71104, -71069, -71010, -70921? -70796 What is next in 3357, 13436, 30237, 53760? 84005 What is the next term in -10, -11, 112, 461, 1138, 2245, 3884? 6157 What comes next: -105, -149, -209, -291, -401, -545, -729, -959? -1241 What comes next: -3810, -3828, -3846, -3864, -3882, -3900? -3918 What is the next term in -56, -118, -236, -410, -640, -926? -1268 What is the next term in -8324, -16657, -24988, -33317? -41644 What is the next term in 138, 540, 942, 1344? 1746 What is next in 167683, 167659, 167635, 167611, 167587? 167563 What comes next: 2914, 2923, 2932, 2941? 2950 What comes next: 230, 359, 232, -277, -1294, -2945, -5356, -8653? -12962 What comes next: 92, 510, 1208, 2186, 3444, 4982, 6800? 8898 What comes next: 2789, 5577, 8353, 11111, 13845, 16549? 19217 What is next in 103479, 103478, 103477, 103476, 103475? 103474 What is next in -495, -756, -991, -1188, -1335, -1420, -1431? -1356 What is next in -113, -155, -99, 55, 307? 657 What comes next: -361, -1214, -2559, -4396, -6725, -9546? -12859 What is next in 158, 97, 4, -139, -350, -647, -1048, -1571? -2234 What is the next term in -1697, -1699, -1693, -1673, -1633? -1567 What comes next: -7194, -28721, -64600, -114831, -179414? -258349 What comes next: 670, 1157, 1650, 2155, 2678? 3225 What is the next term in 1078, 1100, 1130, 1168? 1214 What is the next term in 211, 252, 309, 382, 471, 576? 697 What is next in 1052, 2064, 3084, 4112? 5148 What is the next term in -1186, -1247, -1308, -1369, -1430, -1491? -1552 What is next in 173, 186, 217, 266, 333, 418? 521 What comes next: 3463, 6774, 10085, 13396, 16707? 20018 What is next in -129526, -259061, -388598, -518137? -647678 What is the next term in -7547, -15098, -22649, -30200, -37751, -45302? -52853 What is the next term in 1646, 1581, 1502, 1403, 1278, 1121, 926, 687? 398 What is the next term in -88, -71, 2, 167, 460, 917, 1574? 2467 What comes next: -890, -1295, -1700, -2105, -2510, -2915? -3320 What comes next: 3739, 14861, 33367, 59257, 92531, 133189, 181231? 236657 What comes next: 174, 387, 604, 825, 1050? 1279 What comes next: 490943, 981889, 1472833, 1963775, 2454715, 2945653, 3436589? 3927523 What comes next: 1629, 1670, 1739, 1836, 1961, 2114? 2295 What is the next term in 28631, 28628, 28625, 28622, 28619? 28616 What is the next term in 74651, 149243, 223835? 298427 What is the next term in -52592, -52590, -52588? -52586 What is the next term in 601858, 601863, 601870, 601879, 601890, 601903, 601918? 601935 What is next in -4560, -18258, -41090, -73056, -114156, -164390, -223758? -292260 What is the next term in -17393, -69572, -156537, -278288, -434825? -626148 What comes next: -40901, -40903, -40895, -40871, -40825, -40751? -40643 What comes next: -78205, -312827, -703863, -1251313, -1955177? -2815455 What comes next: -2924, -2929, -2934, -2939, -2944? -2949 What is the next term in 28, 34, 34, 28? 16 What comes next: 672, 712, 756, 804? 856 What comes next: 590, -1186, -6008, -15400, -30886, -53990, -86236? -129148 What is the next term in -346, -533, -668, -733, -710, -581, -328, 67? 622 What comes next: -2143480, -2143476, -2143470, -2143462? -2143452 What is the next term in 901, 3731, 8439, 15019, 23465, 33771, 45931, 59939? 75789 What comes next: -176, -1675, -5764, -13739, -26896, -46531, -73940? -110419 What comes next: 105559, 211118, 316677, 422236, 527795? 633354 What is the next term in -2182, -4390, -6608, -8842, -11098, -13382, -15700, -18058? -20462 What is the next term in 975, 1899, 2729, 3417, 3915? 4175 What is the next term in 1903, 3867, 5827, 7783? 9735 What is next in 1104, 2108, 3040, 3900, 4688? 5404 What is the next term in -60946, -121891, -182836, -243781? -304726 What comes next: -12487, -24926, -37361, -49792, -62219, -74642, -87061? -99476 What is the next term in 626, 1711, 2780, 3827, 4846, 5831, 6776, 7675? 8522 What comes next: 521, 456, 379, 284, 165, 16, -169? -396 What is next in 571, 1194, 1817, 2440, 3063, 3686? 4309 What is next in 234, 416, 596, 774, 950, 1124? 1296 What comes next: -40078, -40071, -40054, -40021, -39966, -39883, -39766? -39609 What is next in -12746, -12742, -12738, -12734, -12730? -12726 What is next in -38888, -77802, -116716, -155630, -194544? -233458 What comes next: -409, -1695, -3839, -6841, -10701, -15419? -20995 What is next in 1309, 2676, 4043, 5410, 6777? 8144 What is next in -234491, -234492, -234495, -234500? -234507 What is next in -488481, -488480, -488479, -488478, -488477? -488476 What is next in -214, -394, -566, -730, -886, -1034? -1174 What is next in -826, -3334, -7526, -13414, -21010, -30326, -41374? -54166 What is the next term in -137347, -137348, -137349, -137350? -137351 What comes next: -101, -104, -81, -32? 43 What is next in 632, 25, -1616, -4807, -10064? -17903 What is the next term in -3694587, -3694586, -3694585, -3694584, -3694583? -3694582 What is the next term in 2228, 4476, 6726, 8978? 11232 What is the next term in -3225, -3226, -3221, -3210, -3193, -3170? -3141 What comes next: -24884, -49765, -74640, -99509, -124372? -149229 What is next in 16, 51, 184, 463, 936, 1651, 2656? 3999 What is the next term in 634, 2560, 5770, 10264, 16042, 23104, 31450? 41080 What is the next term in 228, 644, 1338, 2310, 3560, 5088? 6894 What is next in 14728, 14778, 14828? 14878 What is next in 521, 553, 585, 617, 649, 681? 713 What comes next: 209183, 209186, 209189, 209192, 209195, 209198? 209201 What comes next: -167909, -671623, -1511145, -2686475, -4197613? -6044559 What is the next term in 18281, 18279, 18279, 18281, 18285, 18291, 18299? 18309 What is the next term in 128, 105, 82, 59, 36? 13 What is the next term in 5142, 10246, 15312, 20340, 25330? 30282 What is next in 109, 114, 109, 82, 21, -86? -251 What is the next term in 1772, 1837, 1902? 1967 What is the next term in -3707, -7407, -11105, -14801, -18495, -22187? -25877 What comes next: -164522, -329043, -493564? -658085 What is the next term in -531, -1032, -1519, -1986, -2427? -2836 What is next in 1942, 2012, 2082? 2152 What comes next: -6939, -6920, -6875, -6792, -6659, -6464? -6195 What comes next: -1301, -2579, -3857, -5135, -6413? -7691 What comes next: 1, 17, 105, 301, 641, 1161, 1897? 2885 What is next in 510, 1059, 1610, 2163, 2718? 3275 What is next in 6101, 12570, 19039? 25508 What is next in -485, -813, -1139, -1469, -1809, -2165, -2543, -2949? -3389 What is next in 633, 1307, 1981, 2655, 3329? 4003 What is next in -6212, -6209, -6204, -6197? -6188 What is the next term in 7027, 7023, 7019, 7015, 7011? 7007 What is next in -3518, -4386, -5254, -6122, -6990? -7858 What comes next: -1633, -1328, -1023, -718, -413? -108 What is the next term in -24176, -48349, -72522, -96695? -120868 What comes next: 15764, 15772, 15778, 15782, 15784? 15784 What comes next: 755233, 755232, 755231, 755230, 755229, 755228? 755227 What is the next term in -4567, -4592, -4643, -4726, -4847, -5012? -5227 What is next in -4968, -19893, -44768, -79593, -124368? -179093 What is the next term in 6828, 27377, 61624, 109569, 171212, 246553, 335592? 438329 What is next in -68, -61, -52, -41, -28, -13, 4? 23 What comes next: 480, 953, 1742, 2847? 4268 What is the next term in -55124, -55120, -55116, -55112? -55108 What comes next: -17854, -35707, -53560, -71413, -89266, -107119? -124972 What is the next term in -31519, -63024, -94517, -125998, -157467, -188924? -220369 What is next in -522, -502, -482, -462, -442, -422? -402 What comes next: 1614, 1622, 1628, 1632? 1634 What comes next: -61, -99, -135, -163, -177? -171 What is the next term in -491, -530, -569, -608, -647, -686? -725 What comes next: -1785, -2050, -2327, -2622, -2941, -3290? -3675 What is next in -94187, -94190, -94193, -94196? -94199 What is the next term in 917, 3650, 8203, 14570, 22745? 32722 What is next in -31936, -63858, -95780? -127702 What is the next term in 36049, 36037, 36025, 36013? 36001 What comes next: 8078229, 8078230, 8078231? 8078232 What is next in 344, 628, 816, 860, 712, 324, -352, -1364? -	{ "pile_set_name": "DM Mathematics" }
f*3 - 6f + 18f - 5f - 7f + (5f - f - 2f)(0 + f*2 + 0) to the form gf*3 + zf + r + pf2 and give g. -346 Express -5 + 1 + 116p*3 - 182p*3 + 112p*3 + 3 + 2p*2 as up*2 + jp + xp3 + h and give j. 0 Rearrange (54q - 21q - 8q + (-3 + 1 + 1)(q - 2q + 0q))(5 - 3 - 1) to a + pq and give p. 26 Rearrange (2 - 6 + 3 + 4x - 3x + 25 - 25 + (2x - x + 0x)(-1 + 2 + 0) + 3x - 3x - x - 9x - x - 3x)(0 - 1 - 1) to the form b + ix and give i. 24 Express 0m + 25m - 15m + 20m in the form q + jm and give j. 30 Express (-5 + 5 - 1)(-6u + 16u + 4u)(-7 - 4 + 0) in the form a + pu and give p. 154 Express (-c3 + c3 - 5c*3)(203 - 644 + 100) in the form uc3 + qc + xc2 + v and give q. 0 Express 60x*2 - 124x*2 + 19x + 53x2 in the form o + fx*2 + wx and give f. -11 Express -107x3 - 64x*2 - 72x*2 + 135x*2 in the form ox*3 + vx*2 + k + jx and give k. 0 Rearrange -g + 8g3 + 3g - 73g2 + 75g*2 - 3g to the form o + ig2 + hg*3 + zg and give i. 2 Express 3w3 - 3 - 3w - 15w + 20w in the form aw2 + sw*3 + r + cw and give r. -3 Rearrange 13330u - u2 - 13419u + 2u2 to cu*2 + gu + x and give g. -89 Rearrange -2h + h2 - 19h*2 - 6h - 68h2 + 6h to ah2 + ih + t and give t. 0 Rearrange (-48u + 15u*3 + 48u)((4 - 1 + 0)(-4 + 3 - 1) + 0 - 2 + 0) to fu2 + d + cu*3 + tu and give c. -120 Rearrange (153 - 2p - 172 + 120)(-32 + 17 - 12) to the form v + mp and give v. -2727 Express 4 - 8k*4 - 2k*2 - 3k + 5k + 8 - 14 as yk*3 + g + ik + uk2 + lk*4 and give u. -2 Express -6v - 3v - 50v*2 + 10v + 0v in the form l + hv + sv2 and give h. 1 Express 5a*2 - 4a*2 + 2a*2 + (3 + 3 - 2)(2 - 3a - 2)(6a - 13a + 34a) in the form fa*2 + y + da and give f. -321 Express 3u2 + 0u2 - u2 + (3u - 4u + 28u)(u + 0u + u) as qu + iu2 + z and give i. 56 Rearrange (0 + 5 + 1)(d - d + d*4) + 185d*4 - 11 - 98d*4 - 88d*4 + 3d*3 to the form ud*3 + ld*2 + yd + pd4 + s and give s. -11 Rearrange (4 - 2 + 0)(1 + 6 - 3)(-16z*4 + 18z*4 - 9z*4) to qz*3 + kz + az2 + c + mz*4 and give m. -56 Rearrange (3 + 0 - 4)(-1994n2 + 1994n*2 + 67n*3)(-5n - 1 + 1) to an + tn2 + i + zn*4 + jn*3 and give z. 335 Express ((2 - 2 + h)(-1 - 1 + 0) + 3h - 5h + h + 2 - 4h - 2)((-2h + 6h - 2h)(4 + 2 + 3) + h + 2h + 2h) as wh + kh*2 + n and give k. -161 Rearrange 106f - 3f + 134f + f*2 - 6f + f*2 to wf + i + lf2 and give l. 2 Express -13k*2 - 3k*2 + 3k*2 + 2k*3 + 12k*2 + 5 - 6k as t + bk2 + rk + jk3 and give j. 2 Express (4a2 + a2 - 2a2)(-3a2 - 12a*2 - 2a*2) + 6a*4 - 7a*2 + 7a2 + a4 - a + a as m + ra2 + na*3 + ia + za4 and give z. -44 Rearrange (-20 + 20 - 9i)(-4 - 3i + 4) + 5i2 + i2 - 3i*2 to the form a + ui*2 + yi and give u. 30 Rearrange 20 + 3q4 - 7q*3 - 36 + 0q*4 + 14 to bq*4 + hq*2 + xq*3 + f + vq and give x. -7 Express -1 - 23t2 + 53 - 59 in the form ct + ft2 + i and give i. -7 Express 76c - 23c - 2c*4 - 12c - c*3 + 3c*2 - 13c - 22c as lc*4 + zc*3 + mc*2 + fc + q and give f. 6 Express (4744z - 6538z + 5883z)(3 + 2 - 3) as p + tz and give t. 8178 Rearrange 181u*3 - 7 + 9 + 55u*3 + 0 to the form iu + l + bu2 + au*3 and give a. 236 Express 3 - 3j - 3 + (-2 + 2 + 3)(0j - j + 2j) + (-2j - 2j + j)(-9 + 3 - 1) in the form s + uj and give s. 0 Express m + 12m*2 + 10m*3 - 7m*3 + 1 - 4m*2 - 9m*2 as r + hm + gm3 + xm*2 and give h. 1 Express -2a*4 + 49 - 24a - 16a + 39a - 3a3 in the form ua*3 + va*4 + sa*2 + na + k and give n. -1 Express -33n + 356n*2 + 357n*2 - 712n*2 - 225n as in2 + a + fn and give i. 1 Express 8 - 30 - 21 - 3v + 2 + v as ov + z and give z. -41 Express 14q - 3 + 0 + 4 + 3 in the form lq + o and give o. 4 Express -y*2 + 24y + 645y - 132y + 2y2 in the form ly + dy2 + q and give q. 0 Express 1 + 156u3 - u4 - 2u2 + 4u2 - u2 - 2 + u*2 as t + su*4 + du*3 + qu + vu2 and give v. 2 Express (0 + 3 - 6)(-2 + 2 - h) + 15607h - 1 - 1 - 15631h in the form rh + u and give u. -2 Express 487h*2 - 13h*3 - 487h*2 + 795h*3 - 1 + 1 - 2h*3 + (1 + 1 - 3)(h - h + h*3) in the form ah*3 + ih*2 + b + rh and give a. 779 Express -14f + 3f + 2f4 - f2 + 10f + 4f as tf*3 + r + if*4 + cf + hf2 and give h. -1 Rearrange 4 - 5 - 191a - 1 - 260a to the form u + ka and give k. -451 Express 30g - 126g - 64 + 38g + 29g + 33g in the form n + yg and give y. 4 Express 13 - 5a2 + 5a2 + a - a2 + 15a - 15a + 10a2 + (0a + 2a - a)(2 - 2 + a) + 2a2 - a2 + 0a*2 in the form ua + c + da2 and give d. 11 Rearrange -500 + 500 - 192q to t + oq and give o. -192 Rearrange -419m + 88m - 773m to b + um and give u. -1104 Express 0l*2 - 3l*2 - 21l*3 + 2l + 18l3 - 1 + 7l*2 in the form dl + cl2 + p + fl*3 and give p. -1 Rearrange 95 - 17d - 20d - 16d - 23d + 75d to the form n + wd and give n. 95 Express 33j - 51 + 18j + 2j*2 - 47j in the form uj2 + wj + t and give u. 2 Rearrange 10a - 1265a*3 - 2 + 1266a*3 - 3a*4 + 5a*4 to the form ia + ja4 + y + za*2 + ka*3 and give k. 1 Express -6v + 3v - 2v + 3v + 4v*3 - 9 as hv + xv3 + jv*2 + k and give k. -9 Express -2o*2 - 3 + 8 - 8 - 2o - 7o2 as uo*2 + n + mo and give n. -3 Express (-6 + 4 + 3)(1 - 176v + 5 + 172v - 2v + 3v + v + (4 - 3 + 1)(-4 + 2v + 4)) in the form p + iv and give p. 6 Rearrange (245 - 1601 - 1639)(1 + 4 - 3)(0 - 2a + 0) to ma + w and give m. 11980 Rearrange 3q + 20 - 20 - 2q + 27q2 to m + vq + oq2 and give o. 27 Express -5 + 65z - 8 + 7 + 60z + 2 in the form hz + r and give r. -4 Express -9i2 + 20 - 5i - 2i4 + 3i*3 + 19 - 39 as c + bi*2 + gi*4 + zi*3 + ti and give b. -9 Express -3v4 - 302 + 9v2 + 155 + v4 + 151 + 2v3 as lv*2 + r + zv*4 + pv*3 + mv and give l. 9 Rearrange (-5g - 10g - 9g)(-5 - 10g + 5) to the form mg + k + pg2 and give p. 240 Rearrange (14 - 14 + 3h)(-13h*2 - 41h*3 - 13h*2 + 24h*2) to the form ih*4 + nh*3 + jh*2 + q + th and give i. -123 Rearrange 0u4 + u2 - 47u - 2u4 - 2 + 9u*3 + 48u - 2u2 to fu*3 + qu + gu2 + x + cu4 and give f. 9 Rearrange -w3 - w + 2w2 + 259 - 257 + 2w + 0w2 to the form kw*3 + dw*2 + gw + v and give d. 2 Express (15j - 1006 + 1006)(-j*2 + 0 + 0j*2 - 1) in the form dj + hj2 + lj*3 + p and give d. -15 Express -459t*2 + t + 548t*2 - 4t + t in the form kt + zt*2 + s and give z. 89 Rearrange -126a + 98 + 124a + 104 + 47 to sa + u and give s. -2 Rearrange 3i - 2229 + 3i*4 + 2i - 6i + 2194 to the form yi*3 + r + ui + bi4 + gi*2 and give r. -35 Rearrange -72b + 236b + 57b to y + hb and give h. 221 Express -17n*3 + 3n*3 - 42n + 12n3 + 0n*3 in the form d + pn*3 + kn + bn2 and give p. -2 Rearrange -1 - 1295z*2 - 2z*4 - z - 124z*3 + 1295z*2 to the form qz + oz3 + lz*2 + pz*4 + k and give p. -2 Express -2i*2 + 382i + 638i + 2 - i3 - i3 - 823i as oi3 + ci + t + fi2 and give t. 2 Express -3h*4 - 26h*2 + 8h*3 + 2h*4 + 27h*2 in the form fh*2 + sh*4 + gh*3 + ph + n and give s. -1 Express -22i - 76i - i in the form ci + o and give c. -99 Rearrange (3g - 5g + 0g)(11g + 14g + 23g) to d + pg2 + ug and give d. 0 Express 4 + o - 4 + (0 + 0 - o)(-3 - 2 + 4) + 4o + 4o - 7o + (1 + 2 - 5)(17o + 17o - 12o) + 0 + 2o + 0 as io + k and give i. -39 Rearrange 2m2 + 31m*3 + 547 - 31m*3 - m + m + 2m*3 to the form zm*2 + sm + g + um3 and give s. 0 Express -28j + 26j - 5j + (2 - 1 - 2)(j - 4j + 4j) as z + dj and give d. -8 Express 2 + 73j - 2 + (-1 + 1 - 2j)(2 - 1 + 1) + (-3j + 4j - 2j)(1 + 4 - 3) in the form oj + p and give o. 67 Express -39o4 + 22o*3 - 37o*4 + 78o4 + o2 - 6 as no3 + g + mo + vo4 + so*2 and give g. -6 Express ((-2f + 3f + 0f)(2 + 0 - 3) - f + 0 + 0)(-5f3 - 4f*3 - 4f*3) in the form t + j	{ "pile_set_name": "DM Mathematics" }
seconds. 16674178752000000000 What is 1/10 of a gram in micrograms? 100000 What is one twentieth of a kilogram in grams? 50 Convert 21.270531 milliseconds to minutes. 0.00035450885 What is 3/28 of a week in minutes? 1080 How many hours are there in 51/4 of a day? 306 How many millilitres are there in fourty-five quarters of a litre? 11250 What is eleven quarters of a meter in centimeters? 275 Convert 9.20135 nanograms to tonnes. 0.00000000000000920135 How many millimeters are there in three fifths of a centimeter? 6 How many minutes are there in 4/3 of a week? 13440 How many milligrams are there in one quarter of a gram? 250 What is 3/25 of a meter in centimeters? 12 What is 2/15 of a minute in milliseconds? 8000 Convert 429.6013 millilitres to litres. 0.4296013 How many centimeters are there in 59674.34 kilometers? 5967434000 What is 3154.99 micrograms in kilograms? 0.00000315499 Convert 23.825142 months to centuries. 0.019854285 What is 51/2 of a year in months? 306 Convert 0.920335 weeks to minutes. 9276.9768 What is one twentieth of a meter in millimeters? 50 How many millilitres are there in 426775.9 litres? 426775900 What is three fifths of a millisecond in microseconds? 600 How many millilitres are there in 24.18786 litres? 24187.86 Convert 5.304841 millilitres to litres. 0.005304841 What is 3/5 of a minute in milliseconds? 36000 What is eleven halves of a kilometer in meters? 5500 How many milliseconds are there in 4.755254 microseconds? 0.004755254 What is 24569.58 nanograms in kilograms? 0.00000002456958 Convert 602.1021 nanograms to milligrams. 0.0006021021 How many centimeters are there in 1/5 of a meter? 20 Convert 0.2388585l to millilitres. 238.8585 What is 31/5 of a microgram in nanograms? 6200 How many nanometers are there in eleven halves of a micrometer? 5500 How many grams are there in 3/8 of a kilogram? 375 What is seventeen tenths of a millennium in months? 20400 How many hours are there in 71.862588ns? 0.00000000001996183 How many months are there in 52/3 of a decade? 2080 How many months are there in eleven quarters of a century? 3300 How many millilitres are there in 356.3914 litres? 356391.4 What is 87/4 of a microgram in nanograms? 21750 Convert 29625.39 decades to millennia. 296.2539 How many months are there in 29/2 of a decade? 1740 What is 21/8 of a hour in seconds? 9450 How many years are there in 6/25 of a millennium? 240 How many centuries are there in three tenths of a millennium? 3 What is fifty-three quarters of a litre in millilitres? 13250 What is 518985.9g in micrograms? 518985900000 What is thirty-one halves of a kilogram in grams? 15500 What is 11/4 of a kilometer in meters? 2750 What is 2/125 of a millennium in years? 16 What is 52/5 of a litre in millilitres? 10400 How many millilitres are there in five quarters of a litre? 1250 Convert 0.320862ms to seconds. 0.000320862 Convert 35.79998l to millilitres. 35799.98 What is 12397.7532 hours in weeks? 73.79615 Convert 4.19763cm to millimeters. 41.9763 Convert 6.074783 tonnes to micrograms. 6074783000000 What is 2/125 of a millimeter in micrometers? 16 What is one tenth of a litre in millilitres? 100 What is 17/2 of a litre in millilitres? 8500 How many years are there in three eighths of a millennium? 375 What is 982.5102km in millimeters? 982510200 What is thirty-one fifths of a week in minutes? 62496 How many micrometers are there in 1/10 of a centimeter? 1000 How many micrograms are there in 11.90738mg? 11907.38 Convert 577464.1 micrometers to centimeters. 57.74641 How many millilitres are there in one quarter of a litre? 250 What is 19.07745 years in decades? 1.907745 Convert 50.87209 nanograms to kilograms. 0.00000000005087209 How many months are there in thirty-seven fifths of a century? 8880 How many nanometers are there in thirty-one halves of a micrometer? 15500 Convert 4226.13ns to milliseconds. 0.00422613 What is 90011.5 kilograms in milligrams? 90011500000 What is 7.9517151 minutes in days? 0.005522024375 How many millimeters are there in 11/10 of a centimeter? 11 What is 17/4 of a litre in millilitres? 4250 How many centuries are there in twenty-nine fifths of a millennium? 58 What is 431.9192 grams in nanograms? 431919200000 How many micrometers are there in 1/5 of a millimeter? 200 How many centimeters are there in 3.64393mm? 0.364393 Convert 42.635 millennia to years. 42635 Convert 762725.5kg to grams. 762725500 How many centuries are there in 75.74263 millennia? 757.4263 How many millimeters are there in 21/4 of a meter? 5250 Convert 99.37675 millennia to centuries. 993.7675 How many litres are there in 7.486961ml? 0.007486961 How many days are there in 1455802.74 nanoseconds? 0.00000001684956875 How many kilometers are there in 794.8584mm? 0.0007948584 What is nineteen quarters of a tonne in kilograms? 4750 How many nanograms are there in 1963.685 micrograms? 1963685 What is 3/5 of a minute in milliseconds? 36000 How many months are there in 1/60 of a century? 20 What is 3/10 of a week in minutes? 3024 What is 817109.6 nanograms in grams? 0.0008171096 How many years are there in 7/8 of a millennium? 875 Convert 586341.9mg to tonnes. 0.0005863419 Convert 159297837.3ms to weeks. 0.26338928125 How many weeks are there in 92.0388 hours? 0.54785 What is twenty-one halves of a kilogram in grams? 10500 How many micrograms are there in 30.10102 milligrams? 30101.02 How many micrometers are there in 6/25 of a millimeter? 240 What is one twentieth of a litre in millilitres? 50 What is 11/14 of a week in hours? 132 What is fourty-four fifths of a litre in millilitres? 8800 What is three fifths of a millisecond in microseconds? 600 What is thirteen fifths of a litre in millilitres? 2600 What is thirty-three fifths of a litre in millilitres? 6600 What is one tenth of a century in decades? 1 How many millilitres are there in 76/5 of a litre? 15200 What is 1/100 of a gram in micrograms? 10000 What is 715.218 centuries in years? 71521.8 How many meters are there in 3/50 of a kilometer? 60 What is 45.15703km in micrometers? 45157030000 How many minutes are there in 3/5 of a week? 6048 How many millilitres are there in 37/5 of a litre? 7400 What is 93.98247mm in micrometers? 93982.47 What is 0.9441726 decades in centuries? 0.09441726 How many litres are there in 981.8807ml? 0.9818807 What is thirteen sevenths of a week in hours? 312 What is 0.275708cm in millimeters? 2.75708 How many milligrams are there in 104896.9 grams? 104896900 How many meters are there in 33/5 of a kilometer? 6600 How many kilograms are there in 2252.29mg? 0.00225229 Convert 48090.52 centimeters to meters. 480.9052 How many micrometers are there in 7410.221mm? 7410221 Convert 47102.32 millilitres to litres. 47.10232 How many minutes are there in five quarters of a week? 12600 How many nanograms are there in 3/40 of a microgram? 75 How many nanograms are there in 3/8 of a microgram? 375 How many minutes are there in 1/15 of a day? 96 What is 7182.197 millennia in centuries? 71821.97 How many millilitres are there in five eighths of a litre? 625 What is nine tenths of a meter in millimeters? 900 What is 17/2 of a week in hours? 1428 How many millilitres are there in 4.580872 litres? 4580.872 What is 3/5 of a litre in millilitres? 600 What is twenty-one halves of a millennium in decades? 1050 What is 2865.318 years in centuries? 28.65318 What is 5/24 of a week in hours? 35 What is 3/50 of a millennium in months? 720 What is 815300.9 millennia in centuries? 8153009 What is 14008.25 weeks in seconds? 8472189600 What is 0.301278ns in microseconds? 0.000301278 What is thirty-three fifths of a minute in seconds? 396 How many years are there in 217.65378 months? 18.137815 What is one sixteenth of a gram in micrograms? 62500 Convert 2899.355 centuries to decades. 28993.55 Convert 9099.243m to micrometers. 9099243000 How many milligrams are there in fourty-five eighths of a gram? 5625 How many minutes are there in 1/18 of a day? 80 How many seconds are there in 6.370462 weeks? 3852855.4176 What is 135117.54 months in years? 11259.795 What is 3/40 of a milligram in nanograms? 75000 What is six fifths of a century in months? 1440 What is seven quarters of a millennium in decades? 175 How ma	{ "pile_set_name": "DM Mathematics" }
t replacement from iwhhhwvwhwhewgwwv. 1/340 Calculate prob of picking 2 u when two letters picked without replacement from {u: 3, r: 1, j: 3, x: 6}. 1/26 What is prob of picking 1 f and 1 m when two letters picked without replacement from xxfxwxxmx? 1/36 What is prob of picking 2 d and 1 l when three letters picked without replacement from {d: 2, l: 4}? 1/5 Calculate prob of picking 1 p and 1 i when two letters picked without replacement from iytzptzy. 1/28 Two letters picked without replacement from mucccncccmcmanm. Give prob of picking 2 n. 1/105 Three letters picked without replacement from hhhhhhhsedhlhhh. Give prob of picking 1 h, 1 s, and 1 l. 11/455 Calculate prob of picking 1 r and 1 y when two letters picked without replacement from fbyjjir. 1/21 Four letters picked without replacement from {p: 4, r: 10, g: 1, c: 3}. What is prob of picking 1 c and 3 p? 1/255 Four letters picked without replacement from hhhththqhtbhhhbbhht. What is prob of picking 3 b and 1 q? 1/3876 Two letters picked without replacement from {s: 4, b: 1, w: 1, l: 5}. What is prob of picking 1 l and 1 b? 1/11 Four letters picked without replacement from maamaa. What is prob of picking 4 a? 1/15 Two letters picked without replacement from {r: 1, g: 7}. What is prob of picking 1 r and 1 g? 1/4 Calculate prob of picking 2 a when two letters picked without replacement from {a: 3, r: 12}. 1/35 Calculate prob of picking 4 a when four letters picked without replacement from aooyoooyyoyoyyoyoooo. 0 Two letters picked without replacement from {q: 1, i: 4, w: 2, g: 3, j: 1, e: 1}. What is prob of picking 1 w and 1 j? 1/33 Two letters picked without replacement from {i: 4, t: 4, f: 1, j: 3, s: 2}. Give prob of picking 1 i and 1 f. 4/91 Calculate prob of picking 1 h and 2 a when three letters picked without replacement from {z: 1, p: 1, a: 2, x: 2, o: 2, h: 1}. 1/84 What is prob of picking 2 r when two letters picked without replacement from {r: 4, e: 14}? 2/51 Two letters picked without replacement from {z: 3, n: 4, a: 6, g: 1}. Give prob of picking 1 g and 1 n. 4/91 Calculate prob of picking 1 x, 1 z, and 1 w when three letters picked without replacement from zwmwwwxzzwwzzwzw. 3/35 Two letters picked without replacement from {a: 4, w: 2, u: 1}. What is prob of picking 1 u and 1 w? 2/21 Calculate prob of picking 1 j and 1 d when two letters picked without replacement from {d: 3, j: 3, z: 7, h: 1}. 9/91 Two letters picked without replacement from {o: 7, j: 1, h: 2, s: 1, t: 4, f: 3}. Give prob of picking 1 o and 1 s. 7/153 Calculate prob of picking 2 m, 1 u, and 1 w when four letters picked without replacement from {m: 2, w: 2, u: 1, i: 9}. 2/1001 What is prob of picking 2 e when two letters picked without replacement from eeseeeseeeseeeesee? 91/153 Two letters picked without replacement from eeezzzezzzzez. What is prob of picking 2 z? 14/39 Calculate prob of picking 1 i and 1 j when two letters picked without replacement from {j: 5, i: 2, g: 9, p: 2}. 10/153 Two letters picked without replacement from caucnocncc. What is prob of picking 1 c and 1 o? 1/9 Calculate prob of picking 2 h when two letters picked without replacement from {f: 3, w: 4, h: 4, k: 4, o: 2, m: 3}. 3/95 Three letters picked without replacement from prproorprooprprr. Give prob of picking 1 o and 2 r. 3/20 Calculate prob of picking 3 u when three letters picked without replacement from {u: 7, i: 4, n: 2}. 35/286 Two letters picked without replacement from {n: 1, d: 5, f: 8, i: 2, z: 1}. What is prob of picking 1 n and 1 i? 1/68 Two letters picked without replacement from {j: 4, m: 3}. Give prob of picking 2 j. 2/7 Three letters picked without replacement from {d: 2, n: 2, x: 1}. What is prob of picking 1 x and 2 d? 1/10 Calculate prob of picking 1 m, 1 f, and 1 v when three letters picked without replacement from ffmfmmmvmmmfmfmmmm. 5/68 What is prob of picking 2 x and 2 a when four letters picked without replacement from {x: 7, a: 2}? 1/6 What is prob of picking 2 n when two letters picked without replacement from {m: 2, n: 2, j: 5, w: 3}? 1/66 Calculate prob of picking 1 w and 1 s when two letters picked without replacement from {w: 2, s: 4}. 8/15 Two letters picked without replacement from {w: 2, a: 1, r: 1}. What is prob of picking 2 a? 0 What is prob of picking 2 t and 1 z when three letters picked without replacement from kkzzzdztlktzklkzkzk? 7/969 Calculate prob of picking 1 w and 1 g when two letters picked without replacement from ggggggggghggggggwg. 16/153 Two letters picked without replacement from {y: 4, g: 1, x: 2, l: 3}. Give prob of picking 1 l and 1 y. 4/15 Calculate prob of picking 2 k when two letters picked without replacement from oyoygrykgorkrkyggyy. 1/57 Calculate prob of picking 3 f and 1 y when four letters picked without replacement from qffffyyyyffffqfq. 12/65 Two letters picked without replacement from hkanhannnnnaoh. What is prob of picking 1 k and 1 a? 3/91 Four letters picked without replacement from qaxxqxixqq. Give prob of picking 1 a and 3 x. 2/105 Calculate prob of picking 1 o, 1 l, and 1 f when three letters picked without replacement from {p: 4, f: 2, o: 2, g: 8, l: 3}. 4/323 What is prob of picking 2 r when two letters picked without replacement from {p: 1, n: 6, r: 11}? 55/153 Four letters picked without replacement from jjjjjjjjjjjajjaajj. What is prob of picking 1 j and 3 a? 1/204 What is prob of picking 3 w when three letters picked without replacement from {w: 5, k: 5}? 1/12 Calculate prob of picking 1 f, 1 z, 1 g, and 1 o when four letters picked without replacement from ozgggoovggofog. 30/1001 Calculate prob of picking 1 a and 1 m when two letters picked without replacement from {k: 1, t: 1, j: 1, a: 1, e: 2, m: 1}. 1/21 Two letters picked without replacement from {u: 7, j: 7}. Give prob of picking 2 u. 3/13 What is prob of picking 2 u when two letters picked without replacement from {v: 3, e: 5, s: 4, m: 4, u: 3}? 1/57 Two letters picked without replacement from {s: 2, j: 7, w: 3, q: 5}. Give prob of picking 2 s. 1/136 What is prob of picking 1 j and 1 n when two letters picked without replacement from {j: 1, n: 2, a: 14}? 1/68 Two letters picked without replacement from {t: 2, q: 1, l: 1, y: 1}. Give prob of picking 1 l and 1 q. 1/10 Three letters picked without replacement from dbdbwuxwi. Give prob of picking 1 u and 2 w. 1/84 Two letters picked without replacement from {o: 2, e: 4, m: 2, f: 5, s: 1}. Give prob of picking 1 f and 1 m. 10/91 What is prob of picking 1 h, 1 n, and 1 i when three letters picked without replacement from {n: 1, i: 4, h: 1, w: 6, j: 4}? 1/140 Calculate prob of picking 1 w, 1 f, and 1 u when three letters picked without replacement from {w: 1, f: 3, u: 1}. 3/10 Three letters picked without replacement from {k: 2, c: 2, e: 5, s: 9, t: 2}. What is prob of picking 3 e? 1/114 Four letters picked without replacement from {c: 2, o: 10, y: 4}. Give prob of picking 4 y. 1/1820 What is prob of picking 1 a and 1 z when two letters picked without replacement from nnazuu? 1/15 Three letters picked without replacement from mhnnmz. What is prob of picking 2 n and 1 m? 1/10 Calculate prob of picking 1 y and 3 p when four letters picked without replacement from {y: 1, l: 1, w: 5, j: 3, p: 4}. 4/1001 Three letters picked without replacement from {w: 3, j: 9}. What is prob of picking 1 w and 2 j? 27/55 Calculate prob of picking 2 n when two letters picked without replacement from novvnvnnvo. 2/15 What is prob of picking 2 p, 1 m, and 1 i when four letters picked without replacement from wwiiiwwwwipimwwwwiip? 7/4845 What is prob of picking 1 f, 1 q, and 1 p when three letters picked without replacement from {q: 1, v: 1, p: 1, f: 1, z: 2, t: 1}? 1/35 What is prob of picking 1 h and 1 b when two letters picked without replacement from hbbbbhbbbbhbbbbbhb? 56/153 Two letters picked without replacement from lcshs. Give prob of picking 1 c and 1 l. 1/10 Calculate prob of picking 1 p and 1 b when two letters picked without replacement from {p: 2, b: 2}. 2/3 What is prob of picking 1 j and 1 e when two letters picked without replacement from {e: 14, j: 5}? 70/171 What is prob of picking 1 t and 3 l when four letters picked without replacement from tlltltyt? 2/	{ "pile_set_name": "DM Mathematics" }
increasing order. p, 1/2, 6 Let l be 14/(-18) - (-6 + 5). Let u = -25.3 - -26.3. Put l, 0.3, u in increasing order. l, 0.3, u Let h = -2/189 - 179/945. Put 2/5, h, 3 in descending order. 3, 2/5, h Let k = -3/22 - -65/154. Let p be (-240)/25 + (-2)/5. Let g be (-5)/(-4)(-4)/p. Sort k, 0.6, g in decreasing order. 0.6, g, k Let s = 71 + -71.3. Put 0, 1/8, s, 3 in increasing order. s, 0, 1/8, 3 Let r = -142 - -138. Let h be 2/3 + (-344)/12. Put r, 3, h in decreasing order. 3, r, h Suppose 3o - 2 = f + 2o, -5o - 25 = 0. Let y be (1/f-1)/(-10 - -9). Let z = -13 + 8. Put 4/3, z, y in increasing order. z, y, 4/3 Let x = -41 + 35. Let b be (-38)/57 + -1 + 8/x. Let j be (2/6)/(4/60). Sort b, j, -6 in ascending order. -6, b, j Let n be (10140/(-21))/4 + -5. Let m = n + 126. Sort -1/5, 2/5, m in decreasing order. 2/5, m, -1/5 Let j(w) = -w3 - 6w*2 - 15w - 32. Let r be j(-4). Suppose -5k - 28 = 3u - 0k, -2u + k + 3 = 0. Sort 2, 0, r, u. r, u, 0, 2 Let u be (-7)/(-1) + (-7 - 1). Put 47, -4, 5, u in ascending order. -4, u, 5, 47 Suppose 0 = -9g + 4g - 15. Let a be g/(-1 - 28/(-16)) + 3. Sort a, 0, 5, -5 in decreasing order. 5, 0, a, -5 Let z(d) be the second derivative of -d*3/3 + 5d*2 + 19d. Let a be z(6). Put 1, -16, a in increasing order. -16, a, 1 Suppose -2s - 4y + 44 = 0, 12s - 2y = 10s + 14. Let h be 2/s - 3/(-6). Let u = -6 + 9. Put 4, h, u in descending order. 4, u, h Let k(q) = q3 - 2q + 1. Let x = -7 + 1. Let n = x - -4. Let i be k(n). Sort 2, 5, i in decreasing order. 5, 2, i Let m = 277.8 + -323. Let c = m + 45. Sort 3, -2, c, 1/7 in descending order. 3, 1/7, c, -2 Suppose 0 = 4m - m. Suppose m = 2s - 2p - 12, -3s = -5p - 30 + 8. Suppose 0 = -0g - 2g - 4. Put g, s, -3 in descending order. s, g, -3 Let s be (-3 - -13) + (-212)/20. Sort -17, -3/2, s, -3. -17, -3, -3/2, s Let z(l) = -l3 - 2l*2 + 1. Let b be z(-1). Let g be 0 + b + 8/(-2). Let o be (1032/(-126) + 8)-3. Sort o, -2, g in descending order. o, -2, g Let k(t) = -3t + 7t + 4 - 13 + 4. Let x be k(2). Let s be -4 + x - (-4)/(-2). Sort s, -5, -8 in increasing order. -8, -5, s Let v = 3.44 - 10.51. Let m = 0.07 + v. Sort -1/2, 2/9, m. m, -1/2, 2/9 Let n = -0.05 - 0.1. Let b = n + 0.45. Sort 14, -3, b. -3, b, 14 Let c = -0.23 + 0.03. Suppose 21 = 2b - 3b. Let x = b - -23. Put x, -0.1, c in increasing order. c, -0.1, x Let u be (-264)/42 + 4/14. Let s = -141 + 145. Sort u, -5, 3, s in descending order. s, 3, -5, u Let l be ((-22)/(-77) - 26/(-7)) + -1. Suppose 5v = -2a - 24, 0 = -0a + 4a + 4v + 24. Sort -3, a, l in decreasing order. l, a, -3 Suppose 0 = -4l + 5h + 4 + 12, 0 = 3h. Sort 9, -5, l, -2. -5, -2, l, 9 Let f = -82 - -86. Let k = -77 + 77. Sort k, -1, f in increasing order. -1, k, f Let t be 2/(-4)(12 + -6) - -1. Let o = 1 + 3. Let l = o + t. Sort -3, -2, l in decreasing order. l, -2, -3 Let t(c) = 9c*2 - c + 7. Let y(b) = -1. Let d(x) = -t(x) - 6y(x). Let n be d(1). Let i be (-3)/(n/6) - -3. Sort -1/2, 1/3, i. -1/2, 1/3, i Suppose t = -1, -q = -4q - 2t - 47. Let u(a) = -a + 6. Let z be u(6). Sort z, -4, q in decreasing order. z, -4, q Let y = -1 + 2. Let q = y + -0.5. Let j = 88 - 86. Sort q, -5, j in increasing order. -5, q, j Let g = 136 + -141. Sort g, -11, 2, 3 in decreasing order. 3, 2, g, -11 Suppose -5h = -7 - 3. Let s be (-6)/5 + (-9804)/(-570). Sort -4, h, s, 0 in decreasing order. s, h, 0, -4 Suppose 93u - 3 = 94u. Sort 5, u, -19, 1. -19, u, 1, 5 Let b(j) = -4j*2 + 2j - 17. Let c be b(2). Sort 0, c, 9. c, 0, 9 Let y = 6.067 + -2.067. Sort 4/7, y, -0.131, 0.1. -0.131, 0.1, 4/7, y Let k(o) = -o*3 - 7o*2 + 8o + 2. Let s be k(-8). Let m be (-10)/8(7 - -5). Let d be (-11)/4 + m/(-20). Sort s, d, 3 in ascending order. d, s, 3 Suppose -3h + 11 + 22 = 0. Let b = h - 7. Let w = -0.07832 + 0.07832. Sort 2/5, w, b in decreasing order. b, 2/5, w Suppose 2q - 2f - f = -11, -3q = -4f + 15. Suppose -3t - 4c + 0 = -11, -4c = -2t + 14. Sort t, q, -4, -3 in descending order. t, q, -3, -4 Let i = -1125 + 1125. Sort i, -160, 2, -1 in descending order. 2, i, -1, -160 Let l = 162 + -201. Sort l, 5, -3, 4/3. l, -3, 4/3, 5 Let q(n) = -n + 6. Let i(t) = -t*3 - 12t*2 - t - 5. Let c be i(-12). Let h be q(c). Let p(r) = r + 6. Let b be p(-4). Put b, 4, h in ascending order. h, b, 4 Let l = -0.4 + 0.7. Let w = l + -0.8. Let g = -103 + 103. Put -2/15, g, w in descending order. g, -2/15, w Let b be -5 - -10 - (-12)/(-3). Let m be 11 + -7 + (b - 2). Sort 4, 7, -4, m in decreasing order. 7, 4, m, -4 Let a = 53 + -53.23. Let h = a + -2.77. Put 4, h, 0.1 in decreasing order. 4, 0.1, h Let n(z) = -27z - 1104. Let b be n(-41). Sort 1, b, 4, 15. 1, b, 4, 15 Suppose 9 = w - 6b + b, 0 = -w - 2b + 9. Let l = -8 + 12. Suppose la = a + w. Put a, 4, -2 in ascending order. -2, a, 4 Suppose 4c = 5r + 11, -3r - 2r = -3c + 7. Suppose -b + r - 10 = 0. Suppose -2t = -3t - 4. Put 0, b, t in increasing order. b, t, 0 Let i be (-2)/9(1 - 0). Let a = -142 + 161.2. Let f = a - 21.2. Sort f, i, 0.3 in decreasing order. 0.3, i, f Let z be (102/(-153))/(3/(-18) + 13/6). Let c = 0 + -0.1. Let l = c - 0.1. Sort 5, z, l. z, l, 5 Suppose o - 4 = 1. Suppose 5f - 60 = -5p, -4p = f + 4f - 50. Put 3, o, p in decreasing order. p, o, 3 Suppose -5l + 2y - 23 = 0, 0l + 19 = -l + 4y. Let j(i) = 8i*2 + 4 + 29i + i*3 - 25i*2 + 4i*2 + 8. Let r be j(10). Put 1, l, r in ascending order. l, 1, r Let h = -0.9 + 0.4. Suppose -98 = 4p - 11p. Let k be (-4)/(-2) + p + -14. Put -0.02, k, h in descending order. k, -0.02, h Let t be (-1)/4 + 100/16. Suppose 0 = b + 3i + t + 4, -b - 2i - 8 = 0. Put 2, 1, b, -5 in ascending order. -5, b, 1, 2 Suppose 24g = 27g - 9. Suppose 3w = 3q + 1 + 2, gq = 5w - 11. Sort 2, -1, -10, q in decreasing order. q, 2, -1, -10 Let d be (0 - 1571)6/20. Let h = 470 + d. Let c = h - -4/5. Sort 5, c, 0.4 in descending order. 5, 0.4, c Let n = 1947 + -1942. Let c = 9 - 4. Let i(f) = f - 4. Let m be i(c). Sort -1, m, n in increasing order. -1, m, n Suppose -3f - 11 - 1 = 0. Suppose 4c = -c - 40. Let j be 2/c + (-19)/4. Sort f, j, 2 in ascending order. j, f, 2 Let n = 2 + -3. Suppose -5f + 76 = 4x - 64, 0 = 4x + 2f - 128. Let d be (-33)/(-126) + (-5)/x. Sort -2/11, d, n in increasing order. n, -2/11, d Let n be (-2 + (-40)/(-12))(-7)/28. Let t be (-6)/21 - (-11)/14. Sort n, 3, t in descending order. 3, t, n Let l = -0.22 + -2.38. Let o = l - -1.6. Let b = o + -2. Sort b, 5, 1/4 in decreasing order. 5, 1/4, b Suppose -9p = -6p. Suppose -2w - 5w + 126 = p. Let r be (-5)/3 + w/27. Sort 3, 1, r in increasing order. r, 1, 3 Let o = -77.51 - -77. Let y = o + 0.01. Suppose -3 = -3b - 4k, 5b - 5 = -4k - k. Sort y, -2/3, b. -2/3, y, b Suppose 12i - 33 - 3 = 0. Suppose ig = 10g + 28. Let o(c) = -c - 3. Let r be o(-5). Put -2, r, g in decreasing order. r, -2, g Let h be 154/(-12)(18/(-12) + 3). Let r = h + 18. Put -0.4, r, 1/2, -2/23 in descending order. 1/2, -2/23, -0.4, r Suppose 0q = q - 2. Let w = -290 - -293. Sort q, 5, 0, w. 0, q, w, 5 Let c = -2 - 10. Let s = 15 + c. Let n = -53.5 - -53. Sort n, 0, s in descending order. s, 0, n Let n = 37.627 + 0.373. Sort 0.4, n, -3 in descending order. n, 0.4, -3 Let u = 99/28 + -13/4. Sort u, -0.3, 6/7, -4 in decreasing order. 6/7, u, -0.3, -4 Let d be 2/(-5) - (-161)/2802. Suppose 2w + 15 = 4f + 5, 0 = -3w - 9. Put -5, f, 2, d in ascending order. -5, d, f, 2 Suppose -3c = -5 + 2. Let y(k) = -7k - 22. Let h be y(-5). Suppose 5l - 3t = 10, 4t - h = -2l + 17. Sort l, c, -3 in increasing order. -3, c, l Let p = -0.0978 - -0.3978. Put -19/3, 0.01, -0.5, p in decreasing order. p, 0.01, -0.5, -19/3 Suppose -39 = 6m - 117. Put -3, m, 0.4, -1 in descending order. m, 0.4, -1, -3 Suppose -5f + 2f + 6 = 0. Suppose -o + 4 = 4q + f, -8 = -4o - q. Suppose -og - 13 + 5 = -2m, 2g + 2*m = 0. Sort 3, -5, g in decreasing order. 3, g, -5 Let u be 52/(-8) - -9 - 1/2. Sort -2, 1, u, -5 in increasing order. -5, -2, 1, u Let j = 83.7 - 3.7. Let w = j - 83. Put -0.2, 2, 1, w in decreasing order. 2, 1, -0.2, w Let i = -23 - -9. Let o = 9 + i. Let t = 23 - 23.1. Put o, 0.1, t in ascending order. o, t, 0.1 Let r = -2.48 + 2.08. Sort 0, 1/5, r, 2 in ascending order. r, 0, 1	{ "pile_set_name": "DM Mathematics" }
of ((-10)/((-30)/3))/((-55)/(-11))? 1/5 Calculate 8/(10/((-80)/(-8))). 8 What is the value of ((-10)/20)/((-4)/8)17? 17 -1(-23)/6909 3/10 Evaluate (24/60-3)/(20/(-150)). 9 What is the value of (-9(-1)/(-3))/((-2)/(-4))? -6 What is (3/18)/((-23)/(-3312))? 24 What is the value of (1(-51)/34)/(60/16)? -2/5 (66/110)/(33/55) 1 Calculate ((-7)/10)/((-1533)/5475). 5/2 Calculate 6/1830(72/150)/6. 4/5 Evaluate (4/9)/(8/(-72)6). -2/3 What is the value of (36/60)/((3/30)/((-15)/(-6)))? 15 Evaluate -2((-42)/(-35))/(256/40). -3/8 Evaluate (15/(-8))/(87/(-232)). 5 (8/(-18))/(8/36) -2 Calculate (-207)/1288-142/24. 9 Calculate (-16(-10)/630)/(30/140). 4/9 (9/(-27)595/(-7))/5 17/3 60/(-45)1710/120 -19 (((-12)/(-1))/528)/(2/24) 3/11 Evaluate (-6)/(-1)2238/(-627). -8 What is the value of 500/(-1400)(-8)/10? 2/7 What is the value of -607/(-245)7? 12 Evaluate 4/(-24)9/(162/12). -1/9 (11/(594/(-36)))/(-2) 1/3 Calculate (-74)/481-65(-12)/(-15). 8 What is (-712/294)/((-87)/21)? 2/29 What is the value of ((-8)/(-60)-6)/((-43)/(-215))? -4 What is 80/10(10/(-16))/(-5)? 1 What is the value of -15(-8)/(-144)(-36)/(-18)? -5/3 897/(-138)308/(-143) 14 Calculate (6/(-36))/((-1372)/294). 1/28 Calculate ((-9)/108)/(50/540-6). 3/20 Calculate 1380/(-805)28/(-8). 6 What is 39-2(-1341)/5811? 18 Evaluate 17/(19/19)-1. -17 Calculate 37/((-7)/4)2/4. -6 Evaluate (3/9155/(-31))/((-3)/9). 5 What is (-721)/(-206)4/14? 1 (1/(-35)2-10)/(8/(-28)) -2 2(-42)/(112/16) -12 (1/(-11))/((-140)/(-560)) -4/11 Evaluate (31/(6944/(-84)))/6. -1/16 What is the value of (((-28)/(-2))/7)/(30/345)? 23 Calculate ((-1850)/(-740))/((-5)/(-14)). 7 Calculate (2/(-76))/(-46(-42)/7728). -2/19 ((-7)/(-10))/(70/20) 1/5 Calculate 1/(-3)-2(-20298)/796. -17 What is (135/180(-16)/(-42))/((-2)/(-91))? 13 What is 419(311/(-66))/2? -19 What is (3/(-3))/((-17)/(-153))? -9 ((10/(-30))/(5/18))/((-345)/1150) 4 Evaluate (3/(-3))/((8/48)/(6/18)). -2 Evaluate (-61/1)/(144081/(-54888)). 16/7 Evaluate (-13)/24/6(-177)/59. 13 What is -10((-1656)/1890)/92? 2/21 Calculate (((-288)/(-42))/2)/((-4)/14). -12 (1/(-3))/(((-1537)/29)/1590) 10 (-11(-78)/429)/(2(-2)/66) -33 What is the value of 55/((-40)/8)9/(-9)? 11 2(-18)/(198/77) -14 6/(-14)1077/16170 -1/49 What is the value of 128/70460/45? 2/11 (290/(-2900)(-8)/(-2))/(1/(-40)) 16 Evaluate (122/(-1464))/(3/(-45)(-5)/(-4)). 1 What is the value of ((-35)/(-20))/(-7)37/(259/42)? -3/2 Calculate 1435/(-8)184/(-690). 7 What is the value of -99/135-10? 6 Calculate (1/(-1))/((-426)/(-568)). -4/3 What is the value of ((-2)/(-3))/(-21(-82)/(-46494))? -18 (-847)/(-77)(-20)/255/2 -22 Evaluate (271/(-4878))/(1/(-2)). 1/9 (-4)/(-9)(-26)/(1976/(-285)) 5/3 -86/30((-75)/40)/5 3/5 What is (34/(680/15))/((-5)/(-20))? 3 What is the value of (6/18)/(2970/(-324))? -2/55 What is (232/(-29))/((-8)/(-6))? -6 Calculate (230/(-345))/(3/(9/(-7))). 2/7 6/126-7-69/(-6) -3 ((-63)/294)/(((-663)/42)/17) 3/13 What is the value of 52/(-8)13224/(-936)? 22 What is (-43)/((-2064)/(-3))(-44)/1? 11/4 What is (-175)/35216/(-40)? 27 What is (6/(230))/(51/136-4)? -1/15 What is the value of ((-14)/(-12))/(1/324/48)? 7 Calculate ((-5)/(-15))/((-35)/385). -11/3 Evaluate 2/((-5)/240-6(-4)/(-2)). 8 What is the value of ((-5)/(-20)4)/(1/(-1))? -1 (-217)/4(-2740)/(-4795) -31 Evaluate (3/17)/(63411/31246). 2/23 Evaluate 6/(2/2)684/(-2736). -3/2 What is the value of (10/4(-1)/15)/((-15)/2070)? 23 Evaluate (151/30)/((-18)/(-228)). 19/3 What is the value of 4-1(-81)/270-10? -12 -3(1320/90)/2 -22 What is (26/260)/((-189)/180)? -2/21 Calculate (-2110/(-35))/34/(-40). -1/5 What is the value of (6(-3)/30)/(11/(-6160)16)? 21 What is (55/(3080/(-16)))/((-3)/(-105))? -10 Calculate (42/8)/((21/12)/7). 21 Calculate 28/(-4)87/(-21). 29 What is the value of ((-15)/(-20))/(285/20)? 1/19 Evaluate ((-7)/(-28))/((-5)/(-8)(-22)/(-55)). 1 20/(-6)((-12)/70)/(105/735) 4 Evaluate (-36)/92/8. -1 Evaluate (10/(-21))/((-634)/2853). 15/7 Calculate 4240/(-79500)(-3)/4. 1/25 Evaluate ((-1)/(-2))/((-18)/(-12))37. 7 Evaluate (384/(-608)19/(-14))/(135/42). 4/15 Evaluate (-4)/((-5)/(20/6)432/3402). 21 Calculate ((1/1)/(-5))/(2/((-60)/18)). 1/3 What is the value of ((-7668)/2106)/(-71)(-6)/(-4)? 1/13 What is the value of (2/(-8))/((-380)/(-1824)99/15)? -2/11 What is the value of ((-4)/(-288)-4)/(-4(-1)/12)? -1/6 What is the value of ((-30)/(-4))/(800/320)2/(-9)? -2/3 What is the value of 12/14636/54? 1 Calculate ((-759)/99)/((-15)/45). 23 What is 4/(-24)(-15)/(-5)? -1/2 What is the value of (-28)/12(-10)/(-28)? -5/6 (-64)/12165/44 -20 What is 6/8-2(-80)/(-720)? -1/6 Calculate ((-36)/14)/((-14)/1968/2). 9 -3(-6)/(11/((-132)/(-90))) 12/5 Calculate (-36)/(-18)26((-10)/5)/8. -13 ((-440)/660)/((-40)/(-24)) -2/5 What is 6(-16)/183? -16 What is (-200)/175(-420)/(-80)? -6 30/5-11(-8)/1320 2/5 What is the value of 2(-9)/(954/(-2))? 2/53 What is ((-3)/(2-6))/(13/1560-5)? -6 What is the value of (-7)/(-6)(-10)/((-100)/(-15))? -7/4 What is (-14800)/555(-6)/20? 8 (-6)/(-30)58 8 Evaluate (((-1)/(-3))/1)/((-45)/(-4995)). 37 What is (-162)/432(-4)/(-2)? -3/4 60/(-8)((-1)/6)/(3/6) 5/2 Calculate 1(10/(-5))/2(-6)/6. 1 Calculate (((-870)/(-10))/783)/((3/2)/3). 2/9 What is ((14/36)/(-1))/(1778/(-508))? 1/9 What is (-7)/(-2)496/434? 4 What is the value of (251800/88130)/(12/7)? 10 What is (-48)/5928-382/4-3? -6/13 What is (13/(-2))/(((-17)/(-2))/17)? -13 Evaluate ((-132)/88)/((-3)/(-8)). -4 ((-40)/5320-28)/((-4)/(-38)) 2 (133/(-57))/(56/(-120)) 5 What is (-1)/((-2)/(-2)(-55)/(-165))? -3 (((-3)/10)/(420/160))/((-6)/(-7)) -2/15 (((-1984)/31)/(-16))/13 4/13 Evaluate 494/(-247)(-7)/2. 7 Evaluate (4590/68)/(-27)-10. 25 1/5615256/(-288) -16 What is the value of (-84)/(-8)6080/1824? 35 What is (-4595)/1838((-14)/(-10))/1? -7/2 7/1426/364 1/28 What is (-26)/(8658/(-15))(-30)/75? -2/111 What is (-2)/8-14? 1 What is (-10)/110(-286)/2? 13 Evaluate 61/(-5)(-10)/(-4230)-15. 2/47 What is ((-999)/1110)/((-12)/102)? 3/8 -14(-14)/8(-6)/21 -2 What is the value of ((-58)/464)/(3/(-4))? 1/6 468/1755(-25)/(-40) 1/6 What is the value of (306/1071)/(2/5)? 5/7 Evaluate (6/(-2))/(21206/(-1236)). 9 Evaluate ((8/12)/(3/6))/((-2)/15). -10 What is the value of ((-80)/3)/(-5)-52/(-120)? 4/9 Evaluate 285/(-57)(-3)/2251. 1/15 (-1)/(-150)-10(-2)/((-36)/15) -1/18 Evaluate 3393/(-5655)(-25)/(-7). -15/7 What is the value of (33750/(-13125))/(4/14)? -9 What is the value of ((-8)/6)/((-55)/(40755/456))? 13/6 (7/140)/((10/(-16))/1) -2/25 Calculate (-76)/(-209)33/54. 2/9 Evaluate ((-40)/12)/(185/(-37)). 2/3 Calculate (-220)/(-12)918/765. 22 Calculate 42/(5(-4)/(-100)15). 14 What is the value of (990/550)/((-6)/10)? -3 Evaluate (4/(-3))/(406/87). -2/7 What is the value of 1/(-2)(69/437)/((-3)/(-2))? -1/19 Calculate 2/((-2)/(-2))4/(-30)15. -4 Evaluate 8(-3)/36((-6)/(-7))/(-2). 2/7 (10/(-420)7)/(2/(24/38)) -1/19 Calculate (40144/4800)/(1/(-20)). -24 What is (2/16)/(3465/1980)? 1/14 Calculate (((-1)/(-1))/((-1253)/2864))/(2/7). -8 Evaluate ((-42)/45306/(-119))/((-3)/10). -8 Evaluate ((-82)/82)/((-63)/(-7)). -1/9 (0(-5)/10)/(20/(-10)) 0 Evaluate (27/(-2))/((-8)/(-16)9/6). -18 Calculate (-39)/(1053/(-1305))6/(-10). -29 Evaluate (3068/585)/59(-15)/6. -2/9 What is 2/(1/90-2(-174)/29)? 15 What is the value of -3((-11)/(-6))/(-2(-3)/12)? -11 Evaluate (9/10)/(384/(-80))(-20)/(-6). -5/8 Calculate ((988/16)/19)/(-14/16). -13 Calculate 3/(27/42)((-66)/4)/(-33). 7/3 40/15(-1)/(300/5) -2/45 What is the value of ((-17)/(-1581))/((285/(-38))/15)? -2/93 What is the value of (46/(-4))/((-57)/646-17)? -4 Evaluate ((1330/20)/19)/((-84)/(-144)). 6 Evaluate (2/(-114))/((-850)/(-15300)). -6/19 What is the value of (-12)/(-21)(-225)/(-180)(-1)/10? -1/14 Evaluate ((-24)/(-1560))/((4/4)/(5/2)). 1/26 (1780/(-623))/(35/294) -24 (184/161)/((-528)/(-84)) 2/11 (14/1)/(30/(-210)7) -14 ((-289)/(-7803))/(1/(-1)) -1/27 Evaluate (-184)/((-1104)/24)(77/24)/(-7). -11/6 ((-4290)/(-3300))/((-1)/(-10)) 13 (52/(1456/(-21)))/(3/(-8)) 2 What is the value of 2/(-26)((-3)/10)/(57/(-95))? -1/26 Calculate 5/25((-8)/8)/((-8)/(-5)). -1/8 Calculate (-40)/(-15)1/((-8)/6).	{ "pile_set_name": "DM Mathematics" }
: d or v? v Suppose p = -4p + 4q + 17, 0 = -4p + 5q + 10. Suppose -pl + 5 + 0 = 0. Are l and 3/4 unequal? True Let l = 151/2289 - 2/109. Let p be ((-60)/(-4))/(-5) + 3. Is l < p? False Let q(k) be the third derivative of -k6/120 + 3k5/20 - k4/3 - 19k3/3 + 52k*2. Let i be q(8). Is -39 at least i? False Let d = 8 - 13. Let k be (-6)/9 - (-22)/(-6). Is k > d? True Let j = 0.44 + -0.55. Let w = 0.18 + -0.07. Let g = j + w. Is 2 <= g? False Let v = 11018/15 - 734. Which is bigger: v or 2? 2 Let b = -1056119 - -7368425/7. Let p = 3555 + b. Let y = -68 + p. Which is smaller: y or 0.3? y Let k be 2/(-3) - 590/(-120). Which is smaller: k or 5? k Suppose -3k + 8 = -k. Let j(q) = 1 + 0q + 2q - 4 - 4. Let y be j(5). Which is smaller: k or y? y Let d = 199 + -641. Let k be ((-4)/22)/(2/(-4859)). Let l = d + k. Are -1 and l non-equal? True Let d be (-8 + 4 - -2)-14. Let f be 1 + 2/((-64)/d). Which is greater: -1 or f? f Let p = 37.6 - 37.5. Which is smaller: p or -660? -660 Suppose -3w + 46 = 1. Suppose j - 7 = 8. Is j not equal to w? False Suppose -8r + 13r - 145 = 0. Let h = 30 - r. Which is greater: 3/25 or h? h Suppose 0 = 6j - 9j + 285. Let r = 1333/14 - j. Is 0 less than r? True Let k be (7 - 25)/2 + 10. Is 16/73 greater than k? False Suppose 180 = 2y - 6y. Let n be (-6)/1228/y. Let r = n - 149/5. Which is greater: r or -1? r Let d(l) be the second derivative of l5/20 - 11l4/12 + l3/3 - 4l2 - 3l. Let h be d(10). Let t be (-16)/h + (-94)/154. Is t >= 0.1? False Let a be 1-2 + 30580/(-22). Let h be a/330 + (-2)/(-5). Are h and -3 non-equal? True Let m = -19985/1135342 + -1/6718. Let r = m - -1252/3887. Is r greater than or equal to 0? True Let k = 52.3 + -54. Let f = 1.9 + k. Which is greater: 1 or f? 1 Let b(s) = -18s - 4s2 + 16s + 6s2. Let n be b(0). Is n at least -3/10? True Let k = 12 - 13. Let a = 0.1 + k. Let h = -1.1 - a. Which is smaller: h or 0? h Let t = 0.0782 - 1.2782. Is t at most as big as -15? False Let c = 3/25 + 101/200. Let b(q) = -q - 5. Let j be b(-5). Which is smaller: j or c? j Let v = -6708 - -6706. Let z = 0.4 + -0.36. Let u = z - 0.44. Is u at least v? True Let u(y) = y3 + 7y*2 - 14y - 11. Let k be u(-9). Let b = -43 - k. Which is smaller: 9 or b? b Let q = 236 + -234. Let k(a) = a*3 - 7a*2 + 8. Let l be k(7). Let n = -5 + l. Is n smaller than q? False Suppose -5f + 1812 = 3x, -f = 3f. Let c = 22350/37 - x. Let h = 5 - 4. Is h less than or equal to c? False Let v = -2056 + 2060. Is 111/22 bigger than v? True Let t = -0.802 + 0.502. Is t not equal to 39? True Suppose 0 = 3p - 12. Suppose 15v - p = 19v. Does -0.2 = v? False Let y = 5.57 - 5.4. Let t = y + -0.38. Is t < 2? True Suppose -235 - 145 = -5k. Let t = 77 - k. Which is smaller: 3 or t? t Let k = -1.56 + 7.93. Let v = 0.17 - k. Let u = v - -6. Are 2 and u equal? False Suppose -5c + k + 245 = -0k, -2k + 38 = c. Suppose -152x + 1925 = -1830 - 3541. Is c at least as big as x? True Let j = 2.8 - 7.8. Suppose 5i = -4l + 69, 5l - 24 - 11 = 4i. Is l equal to j? False Suppose -5j + 2 = 42. Let m(g) = -g - 10. Let d be m(j). Is -1/2 smaller than d? False Let c be 18/4 + (-111340)/152. Are -728 and c equal? True Let l = 30 + -16. Let v be 7/6(-9)/l. Let t be ((-6)/4)/(78/(-12) - -4). Are v and t nonequal? True Let w = -227.61 + 227.7. Let x = -2 - -5. Is w equal to x? False Let k be (3/(-132))/(735/(-369) - -2). Let g = 28/11 + k. Which is smaller: g or 9? g Let w be (0 - -2)/(4/6). Suppose -wx - 5x - 16 = 0. Is x smaller than -4? False Let c = 0.12 + -4.12. Let s = 3 + c. Let b = 9 - s. Do b and 1/2 have the same value? False Let d(u) = u*3 - 7u*2 - u + 6. Suppose 0 = 4m + m - 10. Suppose 4f + 5q - 28 = 0, 0 = -mq + 3q. Let r be d(f). Is -6/13 smaller than r? False Let n be (3 + -6 - 3)1. Let b = -3 - n. Suppose 0x - 4 = -x - 2f, -bf = -5x + 20. Which is bigger: x or 1? x Let a be -5 + 2 - 35/(-11). Let i = 60 - 59.4. Is a <= i? True Let y = -2257 - -2330.2. Is y at most as big as -2/7? False Let x(j) = -j3 - 15j*2 - 12j + 8. Let v(y) = -y*2 + 7y - 6. Let q be v(8). Let r be x(q). Is -21 >= r? False Let i = 6 + -8. Which is bigger: -258 or i? i Suppose -8a + 128 = -4a. Let m be 426/a + -3. Do m and 9/11 have the same value? False Suppose 0 = -4w + 23 + 1. Suppose 0 = -3b - 3t + 6 + 6, 3b + 2t = 12. Which is smaller: w or b? b Let p = -0.3 + -6.2. Let v = -769 + 768. Is p at most as big as v? True Let g be (4/38 - (-12)/(-114)) + 0. Which is greater: 24/131 or g? 24/131 Let l be (2/74)/((-35)/(-140)). Is l bigger than 0? True Let l be 9/(-6)6/(-9). Let z = l - 4. Let i = 200 + -206. Which is bigger: z or i? z Let h be 2/((-78)/1473)-10. Let x = -378 + h. Suppose -4l + 71 - 71 = 0. Which is bigger: x or l? l Let o = -0.3627 + 0.1627. Which is bigger: -496 or o? o Let c = 437 + -438. Let u(b) = -b - 2. Let w be u(-3). Let p = -5 + w. Which is smaller: p or c? p Let x = -21.55 + 24. Let t = -0.56 + x. Let c = t - -0.11. Is -0.02 equal to c? False Let c = 314.9 + -297. Let k = 18 - c. Which is smaller: k or 0.4? k Let b be 52/6-24 + 5. Is b smaller than -203? False Let l(k) = -k*2 + 15k - 50. Let m be l(11). Let n = -12 + 13. Which is greater: m or n? n Let n = 110.7 + -110.645. Is -0.4 at most n? True Let p = -152/7 - -22. Suppose -5i + g + 449 = 0, i + 5g - 77 = 18. Is p at most as big as i? True Let c be 1320/80 - (-5)/(-2). Is c bigger than 19? False Suppose 10 = -2s, -35 = -2r + 7r + 5s. Suppose 0 = 11b - 9b. Suppose b = 8n - 13n + 25. Is n greater than r? True Let n be 4 + ((-16764)/(-204))/(-11). Which is greater: -3 or n? -3 Suppose g + 3n + 6 = 0, -3g - 4n = -g + 6. Suppose -gy = -3j + y + 17, 4y = -4j - 24. Is j greater than 8? False Let s(k) = k3 + 2k*2 - 3k. Let c be s(-3). Suppose 3a + 12 = c, 4 = 4d - 3a + 5a. Suppose 16 = dx + x, 4m = -4x. Is -4 greater than m? False Suppose 4a + 7c = 2c - 102, 38 = -2a + 4c. Let o be (-504)/(-6) - 2/1. Suppose -z + 2p - 17 - 1 = 0, -4z + 3p = o. Which is smaller: z or a? a Suppose 5b = -2q + 2184, 0 = 4q + 98b - 96b - 4400. Are 1101 and q unequal? True Let j = 29/132 - 1/4. Is j at least 0? False Let j be 4927/28-4. Is j greater than -495? True Let n = 64261/135 + -476. Which is greater: 1 or n? 1 Let a(s) be the second derivative of s4/12 + s3/3 + 7s. Let c be a(0). Is -1/22 at most c? True Let y = -3.0513 - -0.0513. Are -9 and y equal? False Suppose 0 = -j - j. Suppose -7a + 477 = 1. Suppose -67 = -d - a. Is j at most d? False Let d(h) = -2h3 + 2h*2 + 6h + 1. Let a be d(5). Is -169 less than a? False Let p = -0.36 - 42.64. Let i = p - -31. Let z = i - -11. Which is smaller: -0.16 or z? z Let r = 316/3 - 12938/123. Are 0 and r unequal? True Let p be (10/(-35) - (-3246)/(-546)) + (8 - 2). Let d(r) = -2r - 1. Let n(l) = l. Let s(h) = -4d(h) - 9n(h). Let x be s(4). Which is bigger: x or p? x Let k = -15/16 + 77/48. Let t be (10/15)/((-4)/6). Is k less than t? False Let p = -3411 - -3411. Let l = -8 + 4. Let x = l - -7. Is x >= p? True Let h be 248/(-66) - -25/110. Suppose 14j = 9j - 15. Are h and j unequal? True Suppose 0 = -3p - 12, -x = -49p + 54p + 7. Are 86/7 and x non-equal? True Let m be -2 - ((-270)/64 + 2). Let u be (-65)/32 + (1 - -1). Let k = m - u. Which is greater: k or 1? 1 Let g be (-24)/(-8) + 16. Let x(h) = h*2 - 10h + 6. Let t be x(g). Let b be 1 + t(-22)/(-54). Which is bigger: b or -1? b Let z(f) = -f2 - 10f + 6. Let u be z(-10). Suppose -uk = -2k - 12. Let a = k + -4. Which is smaller: a or 1/4? a Let g = 1494 - 1493.9. Which is greater: 12.8 or g? 12.8 Let l(i) = 2i2 + 2i - 4. Let k be l(4). Let r be k/306 + (-563)/17. Let g = r - -25. Which is smaller: g or -9? -9 Let k = -547 + 549. Let a = -15355/11 - -1397. Is k greater than a? True Let l = -667 + 758. Which is greater: l or -0.6? l Let a(y) = -y*3 - 8y*2 - 9y - 10. Let i be a(-7). Suppose 2 = 2g - g, im - 4g + 32 = 0. Let q be ((-12)/(-3))/((-4)/m). Which is smaller: 5 or q? 5 Let l be (-5(-18)/(-3660))/((-3)/(-4)). Is l at least -1? True Let s(r) = 5r2 - 2r + 1. Suppose -6a = 2m - 2a + 2, -1 = -5m - 4*a. Let b be s(m). Let f = 143 - 143.3. Which is smaller: f	{ "pile_set_name": "DM Mathematics" }
+ a - 5. Let w be x(-4). Give v(w). -5 Let x(k) = -1. Let t(r) = r3 - r2 - 2r + 2. Let p = 612 - 614. Let i(f) = px(f) + t(f). What is i(3)? 16 Let b = 134180 - 134174. Let t(s) be the third derivative of -s*5/60 - 7s4/24 - s3/3 - 2s2. Let a(j) be the first derivative of t(j). Give a(b). -19 Let r(l) = -l. Let x(h) = -h3 - 13h*2 - 9h + 48. Let d be x(-12). Suppose -o - 4j = -d + 13, -o - 4 = j. Give r(o). 5 Let h be (9 + -1)/((-16)/8). Let i(x) = 7x*3 - 5 - 16x*3 + 8x*3 + 1 + 4x - 3x2. What is i(h)? -4 Let r(x) be the first derivative of 2x*2 - 19x + 1824. Give r(8). 13 Suppose -39z - 3 = -2h - 36z, 2h - 5z + 3 = 0. Let y(j) = j3 - 7j*2 + 12j - 25. Give y(h). 11 Suppose -8u + 13 = -3. Suppose 4t - 5l = -24, ul - 4l = 5t - 3. Let r be (t - -3) + -2 + (11 - 4). Let h(c) = c - 12. Calculate h(r). -5 Let j(v) = -v*3 + 4v*2 + 4v + 7. Suppose 0 = -5y + 10, -x + 12y - 7y = 0. Suppose -3i + x + 5 = 0. What is j(i)? 2 Let u be (0/2 - 2) + -1. Let w(g) be the second derivative of 2g3/3 + g2 + 2822g + 1. Calculate w(u). -10 Let g(p) = -61 - 56 + 114 + 3p2. Calculate g(2). 9 Let k(r) = 3r3 + r - 1. Let z(u) = -u2 - u + 1. Let d(o) = -o*3 + 2o*2 + o - 1. Let f(y) = d(y) + z(y). Let x(j) = -4f(j) - k(j). Determine x(5). 21 Let w be (-6 - -9) + (37 - -1). Let j(s) = 43s - 1. Let g be j(-1). Let k = w + g. Let a(f) = -f3 - f2 - f - 4. Calculate a(k). 17 Let f(c) = 3c - 18c2 - 11 - 3654c*3 + 13c*2 + 3653c*3. What is f(-6)? 7 Let g = 914 + -649. Suppose -35z + g - 90 = 0. Let m(i) = -i + 7. What is m(z)? 2 Let x(r) = 8r2 - 4r - 37. Let o(g) = 18g2 - 7g - 79. Let k(c) = -6o(c) + 13x(c). Calculate k(-4). -31 Suppose -4d = -3p - 11, -4d + 177p = 182p - 3. Let w(h) be the first derivative of -1/3h3 + hd + 24 + h. What is w(-1)? -2 Let v(z) = z*3 + 28z*2 - 54z + 187. Suppose m - 5h + 10 = 0, -18m = -13m + 2h + 158. Give v(m). 7 Let n(z) = 12z - 161. Let m be (1513/119 - 4/(-14))/1. Let y be n(m). Let s(h) = h2 + 7h + 6. Calculate s(y). -4 Let g = 51 + -31. Suppose -3a = i + 2a + 16, 2a + g = 3i. Let m(t) = -t*2 - 2t + 7 - i + 9t. Determine m(7). 3 Let s be (1/(2/(-8)))/(-2). Let u(d) = -21d - 34. Let a(q) = -14q - 25. Let z(l) = -7a(l) + 5u(l). Calculate z(s). -9 Let o = -3 + 6. Let x(l) = -11l - 99 - 13 + 100 + 16. What is x(o)? -29 Let f(v) = -3v + 365 - 221 - 140. Suppose y + 15 = 4y - 3x, -2y + 5x + 16 = 0. Suppose 0 = 4u - 4g - 44, 0 = u + 3u + yg - 23. Calculate f(u). -20 Let x(v) be the third derivative of -v5/60 + v4/2 - 7v*3/3 - 56v*2 + 62v. Determine x(8). 18 Let m(s) be the first derivative of -17 - 15/2s2 + 0s + s*3 + 1/24s*4. Let c(g) be the second derivative of m(g). What is c(0)? 6 Let x(m) = 15m + 3 + 33m + 14 - 37m - 13m2. Let t(n) = 3n*2 - 3n - 4. Let v be 9 + (-3 + 0 - -3). Let u(d) = vt(d) + 2x(d). Give u(4). -6 Suppose a = b + 1, 4b - a = a + 2. Let v(o) = -ob + 5 + 3o + 1 + 0o. Let n = -50919 + 50924. Determine v(n). -4 Let h(b) = -7b*2 + 88b + 259. Let g be h(15). Let d(v) = -49v + 191. Determine d(g). -5 Let r(g) = 2g + 3. Let l be -8(-3)/30 - ((-520)/100 - -11). Determine r(l). -7 Let q(j) = -j2 + 13j - 8. Let v(t) be the first derivative of -23/2t2 + 5t - 16 + t*3. Let g be v(8). Give q(g). -8 Let c(k) = 2k*2 + 55k - 55. Let i(f) = -148f - 176. Let n be i(-1). Calculate c(n). -27 Let r(o) = 3o + 2. Let d be r(1). Suppose 0 = -q + 3 + d. Suppose 9x - 5x = q. Let z(c) = -c3 - c2 + 2c + 1. What is z(x)? -7 Let c(h) be the third derivative of 1/6h*3 - 7/60h*5 - 64h*2 + 0h + 7/24h4 + 0 + 1/120h*6. What is c(6)? 7 Let i = -8433 + 8427. Let g(z) = 2z*2 - 12z - 11. What is g(i)? 133 Suppose -5m + n = 93, -1183m - 3n = -1188m - 99. Let b(i) = 3i2 + 58i + 53. Give b(m). -19 Let k(w) be the second derivative of -w*3/6 - 2w. Suppose 17u - 18u + p = 89, -3u = -p + 257. Let g be (86 + u)/((-2)/3). Give k(g). 3 Let m = -41 - -43. Let v(l) be the first derivative of l - lm - 16 + 6l + l + 0l. Give v(6). -4 Let t(b) = -4b*3 + 22b*2 - 4b - 9. Let a be t(5). Suppose -53h + 3j = -55h - 9, j - a = 2h. Let v(p) = -p*3 - 10p*2 - 8p + 12. What is v(h)? 3 Let x(c) = 8c2 - 37c + 82c - c3 - 53c + 3. Suppose 0 = 2d - 3k - 20, -4d + 2k + 10 = -22. Determine x(d). -4 Let g(y) = -156y + 97y + 9 + 57y. Let j = -27 - -19. What is g(j)? 25 Let p(v) be the first derivative of -v4/4 + v3 + 4v*2 + 3v - 39. Determine p(-3). 33 Let a = -1834 - -1837. Let p(i) = -i*3 + 5i*2 - 6i - 7. Calculate p(a). -7 Suppose -3v - 15 = -183. Suppose 3k = 4t + 147, -4t + 153 = 3k - 6t. Let x = v - k. Let j(f) = -f + 1. What is j(x)? -2 Suppose 0 = 5o + 15 - 0. Let v(t) = t - 9. Let z(d) = -d + 8. Let a(y) = 3y - 26. Let b(i) = 2a(i) + 7z(i). Let k(u) = ov(u) - 5b(u). Give k(6). 19 Let b(n) = 17n2 + 9n - 9. Let t(u) = -94u2 - 46u + 46. Let i(q) = -11b(q) - 2t(q). What is i(3)? -5 Suppose -5l - 48 = -l. Let w(d) be the first derivative of -d4/4 - 11d*3/3 + 6d*2 - 8866. Give w(l). 0 Let m(q) = 4q*3 + 21q*2 - 5q + 3. Let v(k) be the first derivative of -k*4/4 - 7k3/3 + k2 - k + 156. Let a(c) = 2m(c) + 7v(c). Determine a(6). -13 Let s = 7249 - 7241. Let w(v) = -7v + 58. What is w(s)? 2 Let r(f) be the first derivative of f4/4 + f2/2 - 29f + 3. Let u be (-625)/(-25) - (0 - -4). Suppose -21 = 11k - u. Determine r(k). -29 Suppose 3j + 163 = 82. Let k = j + 29. Let y(a) = 3a - ak - 9 - 12a + 3a. Determine y(-6). -9 Let a(x) = -3x3 + x2 + 3x + 6. Let p(r) = 4r*3 - 2r - 6. Let f(g) = 5a(g) + 4p(g). Let j = 117085 + -117089. Determine f(j). -6 Let z(a) = -a*2 + 3a + 10. Let x be z(6). Let j(v) = -7v - 19. Let s(q) = -11q - 29. Let f(r) = xj(r) + 5s(r). Give f(-7). 0 Let g(l) be the second derivative of l*5/20 - 2l4/3 - l3/2 + 3l2 - l - 2184. Calculate g(9). 60 Let j(y) = 1542244y*2 - 1542257y*2 - 39y - 21 - y*3 + 0y*3. Give j(-9). 6 Let t(s) = -3s*2 + 22s + 13. Let x = 3033 + -3025. Determine t(x). -3 Let t(r) be the third derivative of r5/60 + r4/24 - r3/3 + r2. Let j be (-6 - -2 - (-65)/10)30/(-25). Calculate t(j). 4 Let s(h) = h. Let n = -154 - -162. Suppose -32 = 4a - n. Calculate s(a). -6 Let d(v) be the first derivative of -v*3/3 - 10v*2 - 54v + 8449. Give d(-17). -3 Let m(s) = s*3 + 36s - 230s + 30 + 14s*2 + 49 + 184s. Give m(-15). 4 Let g(q) = 2q3 + 25q*2 - 2q - 26. Let w(s) = s*3 + 12s*2 - s - 13. Let c(h) = 2g(h) - 5w(h). Let t = -492 - -482. Determine c(t). 3 Let j(v) = v3 - 17v*2 - 17v - 27. Let z be j(18). Let s(f) = -3f + 12. Determine s(z). 39 Let o = -4 - 9. Let h(c) = -4c*2 - 3c + 8. Let x(d) = 9d2 + 6d - 17. Let b(p) = oh(p) - 6x(p). Determine b(-3). -29 Let b(j) = -3j3 - 4j*2 - 2j. Let h(g) = 4g3 + 4g*2 + 2g. Let n(c) = 5b(c) + 4h(c). Suppose 2x - 8 = 2. Calculate n(x). 15 Let c(w) be the second derivative of w5/20 - 7w*4/6 - 17w*3/6 + 2w*2 - 1342w. Give c(15). -26 Let r be -3((-9)/(-15) + 32/(-20)). Let m(f) = -8f - 7. What is m(r)? -31 Let i(k) = k*3 + 11k*2 + 5k + 5. Let d be i(-6). Suppose 4x = d + 41. Let s(h) = h3 - h2 - 95 + h + x + 48. Determine s(0). 2 Let j(l) = -8l*3 + 40l*2 - 55l - 23. Let i(m) = -3m3 + 14m*2 - 19m - 9. Let w(f) = -11i(f) + 4j(f). Calculate w(-7). 35 Let j(s) = -3s2 + 23s + 222. Let q be j(12). Let p(f) = 3f2 - 196f - 131. Calculate p(q). 1 Let y(v) = 43v2 + 38v + 9. Let a(b) = -47b2 - 39b - 10. Let s(c) = 9a(c) + 10y(c). What is s(-4)? -4 Let u(m) = m*3 + 5m*2 - 9m - 17. Let s(d) = -d*3 - 55d*2 + 182d + 3871. Let g be s(-57). Calculate u(g). 28 Let z(y) = 83y2 - 81y*2 + 3 - 1 + y - 3. Let w(k) = -3k*2 + 6k + 4. Let u(p) = w(p) + 2z(p). Give u(-7). -5 Suppose -24c = -871 + 79. Let o(j) = 6j + 14 + j3 + 15 - 3j - c + 5j2. Give o(-3). 5 Let m(d) = -d + 1. Let o(i) = -i2 - 2i. Let y(n) = 5m(n) + o(n). Let x = 539 + -522. Suppose xt = -18t - 245. Give y(t). 5 Let h be (4 + -5 + 2)1-23. Let l = h - -27. Let k be (-3)/(l - 33/6). Let p(q) = 2q**2 + 1. Determi	{ "pile_set_name": "DM Mathematics" }
et a(z) = z*3 - 8z*2 - 8z - 5. Let l be a(9). Suppose -o + l = -i + 4i, 5o = -4i - 2. Let k be ((-2)/16)/((-3)/52). Which is smaller: i or k? i Let v = 23/11 - -31/143. Let s = v - 304/143. Is 5 smaller than s? False Let v be 14/(-63) + (1037/9 - 1). Let z = 56 - v. Let p = 58 + z. Is p smaller than 5/6? True Let f = 33/31 - 621/496. Suppose -4z - 85 = 5g - 0g, 2g - 4z = -62. Let n be 0(3/30 + g/(-90)). Do n and f have the same value? False Let c(h) = h2 - 14h - 74. Let x be c(18). Let u = 0.5 + -1. Let r = -1.3 - u. Is x < r? True Let z be 3/(-96)(-2)/(-10). Suppose -4u + 5f = -34, f = -u - 4f - 29. Which is greater: u or z? u Let f = 292 - 175. Suppose 6i + 3i + f = 0. Let c(n) = -2n - 14. Let x be c(0). Do i and x have the same value? False Let t be (80/(-210))/((224/(-12))/4). Let h = -19 - -19. Suppose w + 3 = 3f + 2f, 4f - 5w + 6 = h. Which is smaller: t or f? t Let u = 2795 + -2824. Which is greater: u or 89? 89 Let l = -5/773 + 32023/51018. Is l > 1? False Let b(i) be the first derivative of 5i*2/2 - 22i + 33. Let g be b(9). Let p = -56 + 80. Is p equal to g? False Let u = -223164 - -14952872/67. Which is greater: 14 or u? 14 Let i(g) = g2 - g - 8. Let t be i(4). Let n be 175/637 - ((-36)/(-21))/t. Let z(p) = -p2 + p + 1. Let u be z(2). Is n at most as big as u? False Let g(p) = p*3 - 51p*2 + 108p + 329. Let b be g(46). Is b > -5283? False Let h = 3 - 6.2. Let k = -6 + 12. Let z be 3/k + (-2)/4. Which is bigger: z or h? z Let v(w) = w*3 + 5w*2 - w - 3. Suppose 3z - 2 + 17 = 0. Let m be v(z). Let r be 43/570(-12 + m). Which is smaller: r or 1? r Let v be ((-4)/(-14))/((-260)/28). Let x = v + -76/1755. Is x equal to 0? False Let p = 3.006 + -3.23. Let f = p + 0.414. Is -2 bigger than f? False Let r be 2((1 - 4) + -1)/(-1). Suppose -9a = -ra + 3. Let j be (-6)/(-126)3a. Is j at least 0.3? False Let h = -35 + 40. Let v = 52 + -58. Let n = v + h. Which is smaller: n or 2? n Suppose 5r + 28f = 25f + 1032, -3f = 4r - 822. Is r smaller than 1056/5? True Let a = 10933 - 10940. Is 3/10 smaller than a? False Let i = -17150/25908303 + 4/4091. Is i at least -2/3? True Let h(o) = -5o2 - 142o - 528. Let q be h(-24). Let d = 392 - 19991/51. Is q >= d? False Let h = 35 - 68. Let v = h + 31.5. Let d = -2.5 - v. Is -8/5 bigger than d? False Suppose l = -4q + 58, -2q - 4l + 52 = 2q. Let y = 3852 + -3841. Is y smaller than q? True Suppose 3j + 2j + 65 = -4n, 3j + 55 = -4n. Let w be n/(-12) - (-1 - (-132)/72). Is -2/593 smaller than w? True Let k(d) = d2 - 7d + 6. Let x be k(6). Let j be (-15 - (-8 + -6))(168/4572)/7. Which is smaller: j or x? j Let h = 7261/17 + -427. Suppose 5g - 4m + 7 = -0m, 3g - 3m + 6 = 0. Is g greater than h? True Let d be (5/(-2) + 0)/(1420/(-4544)). Suppose 4t - 1056 = -4o, 5o = do - t - 796. Is 266 less than or equal to o? False Let g(i) = 10i3 + 5i*2 - 5i + 9. Let v be g(2). Is v at most 99? True Suppose -193a = -181a - 228. Suppose ad = 25d + 216. Which is smaller: d or 2? d Let f = 6.906 - 5.91. Let p = 0.096 - f. Which is bigger: -0.4 or p? -0.4 Let z = -89.21 - -87. Let x = z - -3.2. Is x >= -2/3? True Let c = -4581 - -4609. Is -1.6 at most as big as c? True Let j = 0.0229 + 147.9771. Let x = j - 148.12. Are 5 and x non-equal? True Suppose 3z = -3g - z + 28, 5g - 2z = 38. Suppose 7t - gt = -28. Let f be (-45)/(-231) - (36/t - 1). Which is smaller: f or 1? f Let v(i) = 3i2 - 14i + 7. Let y be v(6). Let r = y + -19. Let k(q) = -2q3 + 28q*2 - 25q + 1. Let g be k(13). Which is smaller: r or g? r Suppose 0 = 5z - 4z + 3m - 10, 2m = -5z + 89. Suppose -3y + zy - 608 = 0. Which is greater: 40 or y? 40 Let l = 625/144 - 1/144. Suppose 2b + 10 = 0, 0 = -3d + 2b + 3b - 200. Let t be 6/d + (-612)/(-150). Is t greater than l? False Suppose 5y - 8y = 5i - 292, 0 = 4i + 2y - 234. Let v(p) = -9p - 16. Let u(j) = 9j + 17. Let q(b) = -6u(b) - 5v(b). Let a be q(-9). Is a smaller than i? False Let s = 207.1505 + 18.8235. Let j = s - -0.026. Is j >= 2? True Let l = 22 + -17. Suppose -23 = -j + o, 0j - lj - o = -91. Let d(a) = -13a - 7. Let h be d(-2). Is j equal to h? True Let j = -1088968 - -9813748/9. Is 1447 bigger than j? False Let i(q) = 17q - 817. Let f be i(70). Which is bigger: f or 370? f Let c = -12565 - -12616. Which is bigger: -0.07 or c? c Let l be 2 - (28 + -16)(-135)/168. Are 11 and l equal? False Let k be 0(1/6)/(119/(-357)). Is -12530 less than k? True Let y be 6 - -2-64/(-16). Let h be (-12)/y(-18)/8. Is 14 greater than or equal to h? True Let z = 11 - 8. Suppose -4y + 5c = 53, zc = -2y - 7 - 14. Let n = 149 + -162. Is n > y? False Suppose 6z - 25 = z, 0 = j - z + 10. Let n(x) = x3 + x2 - 7x - 23. Let s be n(j). Is s at least as big as -87? False Let w = -23313 + 46629/2. Is w > 767? False Let x = -37/105 - -52/105. Is x != 326? True Let b be (-1 + -1 + (-621375)/(-310725))/((-2)/12). Which is bigger: -23 or b? b Suppose -3p = z - 13, -2z + 5 + 3 = 0. Suppose -i - 3 = 2o + 1, -po - 6 = -3i. Let l = 16/27 + -161/135. Is l at least i? False Let i be (-24)/2042991 - 1(-6 + 0). Is i smaller than -347? False Suppose 2c - 5p - 640 = -613, -2p - 10 = 0. Is -2/22479 > c? False Let o = 140 + -134. Suppose -2q + o + 39 = -5n, 4q - 41 = 3n. Let d be -1 - (6 + n)/(2/2). Which is smaller: -1/6 or d? -1/6 Let t(j) = -j3 - 10j*2 - 12j - 11. Suppose 4i + 47 = -3s, 0i + 5s = 4i + 7. Let z be t(i). Let r = z + 51. Does r = 64/7? False Suppose 291 = 2n + 1411. Let k = -577 - n. Is k less than -14? True Suppose -21o = -19o + 11k + 2083, 0 = -o - 2k - 1059. Which is smaller: o or -1070? -1070 Let f = 129 - 131. Let y(h) = h*2 - h - 3. Let g be y(f). Which is bigger: g or 11/5? g Let l = -353 + 352. Let u be 5/l - (-3)/(120/206). Which is bigger: 0 or u? u Let v be (98/(-21) + 5)/((-1)/795). Let k = v + 262. Which is greater: 1/3 or k? 1/3 Let i be (-15)/4(-32)/(-48)22/5. Suppose -q = 5j + 3, 4j - 3 = j. Do i and q have the same value? False Let c = -243 + 231. Let k be 3c/18 - -296. Which is bigger: 295 or k? 295 Let q = 0.142 - -87.858. Let t = -72 + q. Let n = 23 - 23. Which is bigger: t or n? t Let g be 12/(-18)6/(-142). Let s(o) = -25 - 2 + 4o + 3 + 0o. Let b be s(6). Which is bigger: g or b? g Let k = 4474 - 22367/5. Suppose -3q + 5q = 0. Suppose qh - 4h = 2x, 4x + 11 = 3h. Is k at least as big as h? False Let d be 1110/(-75) + 14 - -16603/35. Which is smaller: d or 188? d Let n(t) = t2 - 7t - 26. Let h be n(10). Suppose -z + 5 = hz. Let k = 25759/31 - 831. Which is greater: z or k? z Suppose 128u - 1869 = 139u - 4t, 4u = 3t - 675. Is -24 at least as big as u? True Let d be 126/14 + -281 - -15. Which is smaller: -4 or d? d Let f = -3 + 1. Let t = -35 + 37.1. Let m = t + f. Which is bigger: m or -6/23? m Suppose -z - p = -100, 2z + 2p + p = 200. Let s = z - 120. Is s less than -2? True Suppose -n + 4 = o - 0n, 0 = 5o + 4n - 15. Is -4/959 at least as big as o? True Let b(l) = -l3 - 3l*2 - 24l - 167. Let d be b(-5). Which is smaller: 286 or d? d Let f be (-4)/603 - (-7 + 204/30). Is f >= 2/2395? False Let p = 6840 + -6843. Which is greater: p or 1.161? 1.161 Let t(i) = -2057i*3 - 13i*2 + 16i - 2. Let r be t(1). Is r not equal to -2057? True Let m = 15168 + -14539.3. Let u = m - 629. Is u > 13? False Let m = -47 + 613/13. Let g(v) = -9v - 25. Let u(y) = -17y - 51. Let o(c) = -7g(c) + 4u(c). Let r be o(-6). Is r equal to m? False Suppose 5s - 20 + 25 = -p, 4p + 20 = 5s. Suppose sk = -k. Do k and 73 have the same value? False Let z be 2 + 3/(-6)-2. Suppose 10q + 567 = 31q. Which is bigger: z or q? q Let b be (-44)/(-40) - (-6)/15. Let g be (2 - (-7)/(-2))(-12)/(-18). Let j be 84/208 + g/41. Which is smaller: j or b? j Let b be 92/(4/(-1)) + (-9)/(-3). Let j = 21 + b. Let i be (-2 + (-30)/(-4))/(j/(-6)). Which is greater: i or -31? -31 Suppose -3z = -2x + z - 36, 2z + 78 = -3x. Let k be (33/6 - 1)(-16)/x. Do -0.131 and k have different values? True Let v be (-180)/(-25)10/(-21). Suppose -4l - 43 = 5w - 11, -w = -3l - 5. Are v and l equal? False Let g be (12/(-9))/((-2)/3). Suppose 3w = -gi + 3, 0 = -3w - 0w +	{ "pile_set_name": "DM Mathematics" }
- 5 + 4g4)(-342 - 255 - 6) to the form rg + b + sg*2 + zg*4 + ng*3 and give z. -2411 Rearrange -9 + 24b*2 - 653b*3 + 362b*3 + 290b*3 to the form zb + i + kb2 + yb*3 and give k. 24 Express 23o*3 + 73o*2 - 45 + 43 - 75o*2 - 4o + o in the form k + ho + xo*3 + jo*2 and give j. -2 Rearrange -17614 + 35222 - 17610 + 2g - 65g3 + 484g*3 to qg*3 + t + wg + pg2 and give w. 2 Rearrange (s + s + 0s)(-4 + 3 - 1)(-12s + 6s - 7s + (-s + s - s)(0 + 2 - 3) + 3s - 5s + 0s - 45s + 192s + 29s) to xs + gs*2 + t and give g. -648 Express -17q3 - q4 - 257 + 259 + 20q3 in the form hq*4 + gq + pq2 + w + jq*3 and give j. 3 Rearrange -1 + 158y - 2881y + 1 - 1027y to ry + n and give r. -3750 Rearrange 6 + 253h + 227h + h3 - 462h - 2h2 to the form i + mh*3 + bh*2 + kh and give m. 1 Rearrange -l*2 - 3l - 18 - 2l4 + 4l + l + 4l4 - 8l*2 to the form vl*2 + al + yl4 + dl*3 + p and give y. 2 Express (g - g - g)(-19 + 36 + 7 + (-3 + 2 + 2)(-6 + 5 + 11))(0 + 0 - 14) in the form p + zg and give z. 476 Rearrange 3074w - 52w3 - 3090w + 4 - 3 - w*4 to the form cw + aw3 + j + lw*4 + zw*2 and give j. 1 Rearrange 21w - 11w3 + 2w + 2 - 11w2 - 18w to the form iw + bw*3 + z + uw*2 and give i. 5 Express (-10 + 6 + 3 - 6026y - 2485y + 1)(0 + 2 + 4) as ky + b and give k. -51066 Rearrange 305k - 836k - 681k - 628k - 109k to mk + z and give m. -1949 Express (5 - 2 + 0)(4n + 9n - 2n)(-112 - 51 - 7 - 7 - 118) as yn + o and give y. -9735 Rearrange (2 + 0 - 7)(-2 + 3 + 0)((h - 3h + 3h)(-6 + 2 + 2) + (0 + h + 0)(1 + 35 + 28)(3 - 1 + 0)) to the form mh + u and give m. -630 Express 1936k - 4616k - 2916k - 4504k as ik + l and give i. -10100 Express 360g2 + 1196433 + 1285g*2 - 1196433 as mg + q + pg2 and give p. 1645 Rearrange 0 - 2 + 3x*2 + 0x*2 + (1 + 1 + 0)(72x2 + 60x*2 - 44x*2) + 5x - 5x - 44x*2 to the form tx*2 + gx + p and give p. -2 Rearrange -17l + 22l*4 + 10 + 53l*3 - 125l*3 + 5l + 70l3 + 11l to the form kl3 + a + dl + ml4 + yl*2 and give m. 22 Express (0 + 3 - 2 + (-2 + 2 - 2)(-6 + 3 + 4) - 5 + 0 - 12)(4943 - 139b - 4943) in the form ub + n and give u. 2502 Rearrange -50806a*2 + 50803a*2 + 7 - 47a*3 + 131a*3 to the form ia + p + za3 + va*2 and give v. -3 Rearrange (-8x + 198 + 9x + 69)(0x - 7x + x) to the form rx + z + lx*2 and give l. -6 Rearrange 8p*3 + 109 - 39 - 39 - 33 - 23p*2 to wp + s + yp2 + cp*3 and give s. -2 Rearrange (3 - 1 - 3)(-2 + 2 + 2)(-16 + 7 - 3)(124m - 1047 + 1047) to b + cm and give c. 2976 Rearrange 2263h - 1725h + 3722h to b + jh and give j. 4260 Express 2 + 214m2 + 86m*2 + 147m*2 + m + 57m*2 + 8m*2 in the form jm + bm2 + c and give c. 2 Rearrange (-3g*3 + 3g3 - g3)(22 + 7 + 33 + (3 - 6 - 15)(6 - 3 - 4)) to the form h + xg + kg*3 + ag*2 and give k. -80 Express -6s + 9s2 + 113 - 226 + 115 - 13s*3 as ws*2 + o + ls + ts3 and give o. 2 Rearrange -3w*2 - 124w + 72w - 13w*2 + 7 + 54w to the form t + ow2 + fw and give t. 7 Rearrange 256 + 324 - 584 + 2d3 + 3d*4 - 2d*2 + 51d to the form rd + p + qd*4 + od*2 + hd*3 and give r. 51 Express -19270 + 2439z*3 - 6479z*3 + 19271 in the form a + cz + yz3 + fz*2 and give a. 1 Rearrange -5p*3 + 7p*3 - 304p*2 + 615p*2 - 5 - 314p*2 to tp + gp3 + up*2 + c and give g. 2 Rearrange (0 + 2 - 4)(-11f + 16f + 10f)(-6 + 0 + 3)(2f - 3f + 0f) to df2 + z + wf and give z. 0 Rearrange 1 - 199j - 220j - 11j2 + 420j - 9j4 to wj*2 + vj + yj4 + l + dj*3 and give w. -11 Rearrange (-2m*2 + 0m*2 + 4m*2)(-202m2 - 217 + 217) - 98m*4 - 73m*4 + 147m*4 to im + gm3 + jm*2 + bm*4 + q and give b. -428 Rearrange 85x*2 - 125 - 83x*2 + 2x - 2x3 + 45 + 2x*3 + 4x*3 to the form yx*3 + px + vx2 + i and give i. -80 Rearrange (2 - 1 + 1)(-i*2 - 3i*2 + 5i*2)(-1927 + 8528 + 334) to ai + ri*2 + h and give h. 0 Rearrange (-12 + 12 - 4h)(1 - 5 + 2)(4h + 0h - 2h)(-40h - 13h - 12h) to gh + k + rh2 + th*3 and give t. -1040 Rearrange 67 - 22 - 22 - 19 - 433n*2 - 22 to the form o + sn*2 + fn and give s. -433 Express -4y + 7y*3 - 9y*3 + 7y2 - y3 + 9y3 - 2y*3 - 5 as z + qy*2 + vy + by3 and give q. 7 Rearrange 2v*2 + 36 - 41 - 521v*4 - 2v + 452v4 to the form iv + jv3 + zv*2 + fv*4 + a and give z. 2 Rearrange (3o - 4o - o)(-1 + o + 1) - 1968o2 + 796o*2 - 1397o*2 to a + vo*2 + zo and give v. -2571 Rearrange (t + 0t + t)(3 - 2 + 1) + (-2902t - 1703t - 629t)(3 - 3 + 1) to i + nt and give n. -5230 Express -13l + 27l + 26l + 0l in the form t + yl and give y. 40 Express 16284150y - 1 + 1 - 16272171y in the form ky + o and give k. 11979 Rearrange 47 - 26r + r*3 + 129r*4 + 135r*4 - 309r*4 + 26r - r*2 to the form ar*2 + y + gr*4 + nr*3 + vr and give g. -45 Rearrange (-2t + 6t - 3t)(t2 - t2 + 2t2) - 405t*2 + 203t*2 + 2112 + 2t*3 + 200t*2 to the form wt + xt2 + n + gt*3 and give x. -2 Express (3 - 1 - 1)(3 - 3 + 18h)(44 - 11 - 5)(0 - 4 + 5)(-h*2 + 5h3 + h2) as yh4 + j + nh + zh3 + ih*2 and give y. 2520 Rearrange 87d*4 - 97d4 - 1385 - d3 + 1383 - 5d to id + l + ad2 + ud*3 + bd*4 and give l. -2 Rearrange 719 - 145 - 6q - 180 - 3q2 + 1 + 380 to cq*2 + g + dq and give g. 775 Express 3v - 12v - 27v + (-2v - v + 5v)(-1 - 2 + 6) - v + 4v - 4v + (-4v + 0v + 2v)(-1 - 4 + 4) in the form qv + c and give q. -29 Rearrange (-2 + 3 - 3)(-2r + 5r + 4r - 2r + 3r - 4r + (-1 + 3 + 1)(12r + 5r - 2r)) to the form ar + z and give a. -98 Express 2 - 3 + 23281l + 1 - 22919l as s + tl and give t. 362 Express (3 - l - 3)(3l - l + l) + 18l2 - 10l*2 + 3l*2 + 2l2 + l2 + 0l2 as ml*2 + al + s and give m. 11 Express 6 + 2q4 + 2q + 0 - 93q2 + 5q*3 + 94q*2 + 25q*2 as pq + uq3 + aq*4 + dq*2 + g and give g. 6 Rearrange -451h*2 - 5 + 4h + 25h - 25h - 5h to v + nh + yh2 and give n. -1 Express (f + 2f - f)(235f + 394f - 1058f) + (-3 + f + 3)(5f - 3f - 3f) in the form o + af + rf*2 and give a. 0 Express -19k + 2k + 3k - k + 0k + 0k + (-1 + 0 + 3)(-3 + k + 3) + k + 0k - 3k + 941k - 289k - 500k as fk + c and give f. 137 Express 5 - 6635i + 6638i + 2632i*2 - 5 in the form ri + f + yi2 and give y. 2632 Rearrange (0w - 4w2 + 0w)(-3 + 1 + 3)(1196 + 1147 - 2449 + 2w) to k + nw*2 + jw + iw3 and give n. 424 Express -9y + 2y3 + 9y + (2 - 2 + 3y2)(2y - 3y + 0y + (-y + 4y - y)(-3 + 5 + 1)) as ly*3 + qy + f + uy2 and give l. 17 Express (-1100 + 1100 + 2x)(2x - 4x - x)(-2x + 4x - x) in the form cx2 + ix*3 + t + hx and give i. -6 Rearrange -26826l + 57297l - 28449l to the form i + fl and give f. 2022 Express (-12r + 9r + 1 + 21)(-3 + 5 + 2r2 + r2) in the form dr3 + xr*2 + k + jr and give j. -6 Rearrange (-297 + 12r + 297)(0 + 6 - 4) - 8 + 164r - 13 + 20 to j + nr and give j. -1 Rearrange (1272 - 312p - 1272)(-4p3 - 8p3 - p3) - 2p3 - p4 + 2p*3 to the form ap*4 + fp + s + vp3 + np*2 and give a. 4055 Rearrange -259f*2 - 305f*3 + 437f*3 - 4 - 133f*3 to the form qf + af2 + tf*3 + b and give b. -4 Express 2670 + 6i*3 - 17i*3 - 2666 + 6i*4 + (3i*2 + 2 - 2)(-4i2 + 7i2 + i2) as l + ci2 + si*4 + oi + qi3 and give s. 18 Rearrange (-3x + 6x - x)(-5 + 532 - 317 + 492) to yx + j and give y. 1404 Rearrange -6 + 32121f + 32162f + f2 - 64374f to the form df + kf*2 + y and give d. -91 Rearrange (-26 + 41 - 31)((-2 + 0 + 4)(6 - 2 - 1) + 4 - 3 + 4)(-2 + 2 + 2g) to the form x + sg and give s. -352 Express -22k2 + k - 21k*2 + 6 - 15k*2 - 9 + 11 in the form lk + v + hk2 and give h. -58 Rearrange -2 - 3638a*2 + 292a*3 - 4a - 3652a2 + 13a + 7288a2 to the form oa + qa2 + ka*3 + n and give k. 292 Express (-24 + 41 + 11)(-51k + 30k + 309k) as b + uk and give u. 8064 Rearrange -3448*	{ "pile_set_name": "DM Mathematics" }
5474. Is c prime? False Suppose 5j + 3c = 21373, -5c - 706 - 12145 = -3j. Suppose 5r + 952 - j = 0. Let o = -474 + r. Is o prime? True Is (-40)/120(-1 + 632/(-1)) composite? False Let z(v) = 4v2 - 2v - 3. Let d be z(-1). Is 526/d(-6)/(-4) a prime number? True Suppose 0 = -5d - q + 14, 3d + 4q - 16 = 6. Suppose -2l = -3l + d. Suppose 5x - 32 = -3u + 245, -5u - lx = -449. Is u a composite number? False Suppose -4m + 3091 = -2505. Is m a composite number? False Suppose -30208 = -2s - 2x, 0 = 7s - 5s - 3x - 30193. Is s a composite number? False Let d be 3 + 21 + -3 - -3. Suppose -10l + d = -6l. Is (-8)/l + (-121)/(-3) composite? True Let c be 1 + (-9)/(-3) + 2237. Suppose -3y - 4b = -c, -5y + 2095 + 1654 = 2b. Is y a prime number? True Suppose -4 = q + 3. Let k(i) = -i*3 - 7i*2 - 2i + 4. Let a be k(q). Let y = 40 + a. Is y composite? True Let s(h) = -h*3 + 6h*2 - 5h + 6. Let n be s(4). Suppose -r - 64 = n. Let i = r - -317. Is i a composite number? True Is ((-3)/(18/2253))/((-33)/66) a prime number? True Suppose -62w = -63w + 1481. Is w prime? True Let g = -278 - -531. Let b = g + -138. Is b a prime number? False Suppose -5l + s + 35 = 10, 15 = 3l + 3s. Let q be (4/(-2))/((-4)/362). Suppose -lj + 174 = -q. Is j a composite number? False Suppose -8n + 341515 = 19227. Is n a prime number? False Is (1 + (0 - 143))/((-76)/266) a prime number? False Is 1703 + (0 + -1)/(4/(-24)) a composite number? False Let f be (-1)/((-6)/16082) + 4/6. Let m = f + -1884. Is m prime? True Suppose 4g = 15 + 1. Suppose -gw + 105 = -9w. Is 7/w - 308/(-6) prime? False Let f(a) = 6a2 - 4a - 3. Let r be (-3)/4 + (-14)/(-8). Let p be 3r + -16 + 8. Is f(p) prime? True Let p = -263 - -2236. Suppose 0z = 4b - 5z - p, z = 5b - 2440. Is b a prime number? True Let a = 66 - 69. Is 0 - a/((-15)/(-670)) a composite number? True Is (14/56-4)/(2/(-103102)) a composite number? False Let g(h) be the second derivative of -h5/20 - h4 - 4h3/3 - 17h*2/2 + 2h. Is g(-12) prime? True Let i be (-2)/(-9) - 3164/(-18). Suppose -5f - 4s = -92, 4f - 20s - 52 = -16s. Suppose 57 = 2h + 5b, -5h + i - f = -5b. Is h prime? True Let c be 10/2 + (-2)/(-6)-3. Suppose -4r = -cs + 127 + 549, -5s + 845 = -4r. Is s prime? False Let l be 1/((-12)/(-8))6. Suppose lo - 19 + 3 = 0. Suppose 4u = 0, -4t + 3t = -ou - 161. Is t prime? False Let h(c) = 3c3 + 5c*2 + 5c - 41. Let b(m) = m*3 + 2m*2 + 2m - 21. Suppose 0 = 3r - r - 4. Let q(a) = rh(a) - 5b(a). Is q(0) a prime number? True Suppose -3i + 2961 = i + b, 4i = -3b + 2963. Let n(t) = -418t3 + t2. Let w be n(1). Let g = i + w. Is g a prime number? False Let b(z) = -32z - 17. Let d be b(-8). Let t = d - 54. Is t composite? True Suppose -4m + 159118 = 3w, 5w + 278855 - 79940 = 5m. Is m prime? False Is (8/(-12))/((-2)/9258) prime? False Suppose 38340 = -2g + 7g + 2m, m + 7661 = g. Is g a composite number? True Suppose 16i + 8899 = 5i. Is (-2)/(((-1)/i)/((-49)/14)) a prime number? False Let p(y) = -y2 + 7y - 8. Let z be p(4). Suppose -zr = -4100 - 2472. Suppose 619 = 2w + 5h, 5w + 3h - r = -67. Is w a prime number? True Let c be (13)/(12/20). Suppose -cv + 1 = -5f - v, 3 = -3f + 3v. Suppose -fw - w + x + 2958 = 0, 4w - 2x = 2960. Is w a composite number? False Let f(j) = j3 + 3j*2 + 2j - 1. Let p be (-12 - -5)1-1. Is f(p) a prime number? True Is 211/2 - -6120 composite? False Let o = -22 + 26. Suppose -5y + 6645 = of, -2341 = -2f - y + 974. Is f composite? True Let o be 7473/(-6) + (-6)/(-12). Let j = -488 - o. Is j prime? True Suppose -o = 4w - 42141 - 83092, 0 = 2w - 5o - 62589. Is w a composite number? False Let u(a) = 29a3 - 5a*2 + 7a - 11. Let q = 83 - 79. Is u(q) a prime number? False Let y(p) = 10p2. Let i = -5 + 3. Let z be 2 - (5 + (i - 0)). Is y(z) a prime number? False Suppose 2u + 336 = -5u. Let m = 15 + -8. Let b = m - u. Is b composite? True Let t = -7 + -2. Let w = t + 9. Suppose -n + 3n - 62 = w. Is n prime? True Let r(u) = -u*3 - 25u*2 + 73u + 26. Is r(-37) a composite number? True Let o = -9736 + 19814. Is o a prime number? False Let l = -540 - -225. Let r = 1592 + l. Is r prime? True Let t be 1/(3/121). Is (t(-2)/(-12))/(18/32211) prime? True Let h be ((-15)/(-12))/((-6)/(-864)). Let x be h/81 - 2/9. Is (5 - x)55/3 a composite number? True Let r(b) = -8b*2 + 14b + 31. Let d(s) = -7s2 + 15s + 30. Let v(u) = -6d(u) + 5r(u). Is v(-11) composite? True Suppose 0 = -11k - 20 - 2. Is (27/(-6))/9 + (-2795)/k a prime number? False Let o(t) = t2 - 16t + 6. Let w be o(16). Suppose 3f = -b + wf + 164, 0 = 2b - 5f - 327. Is b composite? True Let t(u) = -8515u - 57. Is t(-2) composite? True Suppose 16824 = -2l + 10l. Is l a composite number? True Let z(n) = 2n - 11. Let w be z(4). Let r be -1 + w + -1 + 35. Let l = r - -161. Is l a composite number? False Let r(n) = -1488n - 346. Is r(-19) a prime number? False Let q = 193758 - 134095. Is q composite? False Let z(p) = 4p*2 - 16p - 67. Is z(-29) a composite number? False Let x(z) = 2867z2 + 6z - 9. Let i be x(-7). Is i/48 - 4/(-3) composite? False Suppose t + 4g = -t - 36, -5g + 72 = -2t. Let j = 30 + t. Suppose -2d = 3l - jl + 993, -4l - 5d = -3972. Is l composite? True Suppose -4d - q + 167060 = 0, -41765 = 37d - 38d - 5q. Is d prime? False Let x(f) = 2f3 - 4f*2 + 3f - 2. Let y be x(2). Is 2-449y/(-8) a prime number? True Let k(z) = -160z3 + 2z + 1. Suppose 3b = 2y - 2 - 6, -3y + b = -12. Suppose -2 + 6 = -yn. Is k(n) a prime number? False Let r(h) = 714h3 - 5h*2 + 14h + 3. Is r(2) prime? False Suppose -587509 = -29z - 14z. Is z a prime number? False Let y be 3/9 + (-2)/6. Suppose -g + 381 = 4u - 5u, -5g - 2u + 1905 = y. Is g a prime number? False Let j = -69432 - -111311. Is j prime? True Let q(g) = -51g + 140. Is q(-15) prime? False Let u(m) = 3m*2 + 4m - 8. Let o be u(-5). Suppose -46d - 2 = -od. Suppose 1802 = dr - 716. Is r a composite number? False Let g(v) = 10061v - 74. Is g(3) prime? True Let g = -30 - -32. Suppose 0 = n + 4h - 2h - 369, 5n - 1861 = -gh. Is n a composite number? False Let w be (5/20-6)/((-1)/1082). Suppose 13y = 10y + w. Is y a composite number? False Suppose -4u + 30738 = 2w, -5u = -4w - u + 61416. Is w composite? False Let z(t) = -t3 + 38t*2 + 30t - 63. Is z(20) prime? False Let f be (-5 - -1)(-15)/20. Suppose 2p + 1 = fp. Let w(i) = 22i3 + i2. Is w(p) composite? False Let z(h) = 191h - 5. Suppose -6c = -11c + 50. Let j be z(c). Suppose -4r + r = -j. Is r prime? False Is 15/(1785/402628) + (-6)/14 a prime number? False Suppose -d + 804 + 731 = 0. Is d a prime number? False Suppose 0 = -5w - 5l + 9320, 5608 = 3w + l - 2l. Suppose -7y + 5y - w = 0. Is (-3)/(-15) - y/5 a prime number? False Let l be ((-2)/(-8))/((-1)/(-116)). Let d(f) = 30f2 + 2 + 4f - 5 + 4 - lf2. Is d(-7) a composite number? True Let x = 1952 - 455. Is x a composite number? True Let s = 10 + -5. Let i(a) = -2 + 10a + sa + a - 1. Is i(5) a composite number? True Let a = 1124 - 639. Is a a prime number? False Is (-61 - (-1 - (3 - 2)))-1 a composite number? False Let n(m) be the second derivative of m*5/20 - 3m*4/4 + 11m*3/6 + 4m*2 + m. Let r be n(9). Let b = -72 + r. Is b a composite number? True Suppose -1417 = 4d + 755. Let y be d(-4)/121. Suppose 5v = 2s - 25 - 21, -5s - 4v + y = 0. Is s a prime number? False Let o = 4702 - 1748. Suppose 0 = -3c + o + 1729. Is c composite? True Suppose 60 = -0w - 5w. Let c(r) = -6 - 7 - 14r + 3. Is c(w) a prime number? False Let w = 8092 - 2993. Is w composite? False Let g(y) = -62y - 37. Suppose 2i = -0p - 4p - 2, 4 = -i + p. Is g(i) prime? True Let p = -4 - -9. Let z(u) = 29u - 2. Let y be z(p). Let j = 286 - y. Is j a composite number? True Let i = -24173 + 49558. Is i a prime number? False Is 1(342 - (1 - -6)) composite? True Let v = -34 - -38. Suppose vm - 228 = 352. Is m a composite number? True Suppose -4i + f = -141712, -5f + 0f - 141696 = -4i. Is i a composite number? True Suppose j + 5 = w, 2w + j - 7 = -0. Suppose 2q - 2741 = -3c, 3q - 4567 = -c - wc.	{ "pile_set_name": "DM Mathematics" }
in descending order. 582, 5, -0.4, -1, -2.2 Put -20, -8, -231 in descending order. -8, -20, -231 Sort 1, -2, -1/2, -7/1128 in descending order. 1, -7/1128, -1/2, -2 Sort 320, 109, -10 in ascending order. -10, 109, 320 Put -3, -4, 5, 8, 2, -65 in increasing order. -65, -4, -3, 2, 5, 8 Sort -2/9, -0.3, 3, -0.659, -2/25 in increasing order. -0.659, -0.3, -2/9, -2/25, 3 Sort 3, 1, -0.1, 189, -4, -0.02. -4, -0.1, -0.02, 1, 3, 189 Sort 71, 2/11, 14, -4. -4, 2/11, 14, 71 Put -16, -707, -19, -2 in descending order. -2, -16, -19, -707 Sort 0.001, 3, 1148 in descending order. 1148, 3, 0.001 Sort 2, -5, -55, 1 in increasing order. -55, -5, 1, 2 Put 1/2, -1606, -0.4, -2/3 in decreasing order. 1/2, -0.4, -2/3, -1606 Sort -63, 2, -23, 0. -63, -23, 0, 2 Put -1.26, 4, 15/38 in ascending order. -1.26, 15/38, 4 Put -2, 2/7, 387, 1/5 in descending order. 387, 2/7, 1/5, -2 Put -0.7, 1/20, -31/2, 0 in increasing order. -31/2, -0.7, 0, 1/20 Sort -91, 911, -5 in descending order. 911, -5, -91 Sort 22, -30, 31 in ascending order. -30, 22, 31 Sort 5, -3, -88/9, 20, -2/13. -88/9, -3, -2/13, 5, 20 Put 0.02, -111/5, 55 in increasing order. -111/5, 0.02, 55 Put 4, -4, 20.14, 2/9, 1/2, -1/2 in decreasing order. 20.14, 4, 1/2, 2/9, -1/2, -4 Put 0, -4, 134, 2 in decreasing order. 134, 2, 0, -4 Put 0, 2, 75, 4, -66 in ascending order. -66, 0, 2, 4, 75 Sort 2, -27, 62, -5. -27, -5, 2, 62 Sort -1/7, -1/2, 3/10, 17, 3, -70.3. -70.3, -1/2, -1/7, 3/10, 3, 17 Put -51, 2/21, 3/20 in increasing order. -51, 2/21, 3/20 Sort 27, -5, 206, -1, -2. -5, -2, -1, 27, 206 Put -5, 27, 1, -323 in increasing order. -323, -5, 1, 27 Put -513, 16, 5, -5, 0 in decreasing order. 16, 5, 0, -5, -513 Sort 138, -2, 4, 5, -5 in increasing order. -5, -2, 4, 5, 138 Put 0.2, 63, -0.11, -2/13, -0.7 in decreasing order. 63, 0.2, -0.11, -2/13, -0.7 Sort -57, -12, -1368 in decreasing order. -12, -57, -1368 Sort 0.13, 5, 6603 in decreasing order. 6603, 5, 0.13 Put 10, -7, 3, 4, -1 in ascending order. -7, -1, 3, 4, 10 Put 2/9, -5893, -5/4 in decreasing order. 2/9, -5/4, -5893 Put 366, 2, -21 in ascending order. -21, 2, 366 Sort 8, 32, 385, 0.3 in decreasing order. 385, 32, 8, 0.3 Put 10, 5, 11, 2, -4 in descending order. 11, 10, 5, 2, -4 Sort -2/3, 12, 667/3, 1 in ascending order. -2/3, 1, 12, 667/3 Sort -18, 0.1, -2/19, 28, 2/9 in ascending order. -18, -2/19, 0.1, 2/9, 28 Put 0, -101, -1, -59 in ascending order. -101, -59, -1, 0 Put 7, -0.13, -103, 2, -0.4 in decreasing order. 7, 2, -0.13, -0.4, -103 Put 6075, -0.5, 0.4, -2/27 in descending order. 6075, 0.4, -2/27, -0.5 Sort 5, 2, -5, 70, 0, 147 in decreasing order. 147, 70, 5, 2, 0, -5 Sort 7, 2/5, -280/839 in increasing order. -280/839, 2/5, 7 Sort 0.2, 0, -1, -251, -1/2, 0.3. -251, -1, -1/2, 0, 0.2, 0.3 Put 3, 1, 4, -2706, 2 in decreasing order. 4, 3, 2, 1, -2706 Sort 15, 1, -18, -1, 16, -5. -18, -5, -1, 1, 15, 16 Sort 1, 5, -1, 3130, -3 in decreasing order. 3130, 5, 1, -1, -3 Put -1, -2, -0.2, -6/13 in increasing order. -2, -1, -6/13, -0.2 Put 5, -1, 0, -2, 198, -6 in descending order. 198, 5, 0, -1, -2, -6 Sort -5, 4, 0.00535. -5, 0.00535, 4 Sort -7, -2/15, -0.34, -5 in descending order. -2/15, -0.34, -5, -7 Put 5, -4, 3, 13, -7 in ascending order. -7, -4, 3, 5, 13 Sort -565, -3, -2/17, -7 in descending order. -2/17, -3, -7, -565 Put -563, -13, 21 in descending order. 21, -13, -563 Sort -541, 1, 3, 0, -1 in decreasing order. 3, 1, 0, -1, -541 Sort -4, 1, -8/187 in ascending order. -4, -8/187, 1 Sort 9, -3, -15, -42. -42, -15, -3, 9 Put 4, 2/7, -32, -1.9, 2/9 in descending order. 4, 2/7, 2/9, -1.9, -32 Put -4, -3/20, 0, 53 in increasing order. -4, -3/20, 0, 53 Put 4, 2, 4862, -1, 1, 0 in ascending order. -1, 0, 1, 2, 4, 4862 Sort -216, 13, -1 in ascending order. -216, -1, 13 Sort 21257, 1, -11, 2 in decreasing order. 21257, 2, 1, -11 Sort -5, 2, -4290 in ascending order. -4290, -5, 2 Sort 164/45, 3/2, -1, -0.1. -1, -0.1, 3/2, 164/45 Put -0.03, -5293, -1, -2/7 in descending order. -0.03, -2/7, -1, -5293 Put -1, 3, 890, -10 in increasing order. -10, -1, 3, 890 Put 801, 184, -1/3 in ascending order. -1/3, 184, 801 Sort 838, -135, 1 in ascending order. -135, 1, 838 Sort -1, 0, 43, -83, -2 in descending order. 43, 0, -1, -2, -83 Put 13, -5, 171 in descending order. 171, 13, -5 Sort 0, -52622, -10 in ascending order. -52622, -10, 0 Sort -45574, 0, -4 in ascending order. -45574, -4, 0 Put -4.3, 0, -5, -2 in descending order. 0, -2, -4.3, -5 Put -2/461, -1/2, -15 in increasing order. -15, -1/2, -2/461 Sort 0, -0.1, 2155.3, 5, 3/4 in increasing order. -0.1, 0, 3/4, 5, 2155.3 Sort 30, 585, 1/3 in descending order. 585, 30, 1/3 Sort -189, -9, -53. -189, -53, -9 Sort 4, -3/2, -5875, -4 in descending order. 4, -3/2, -4, -5875 Sort 11/50, 1/2, 1/7, 30, 5 in increasing order. 1/7, 11/50, 1/2, 5, 30 Sort -137, 1, 22, 34 in descending order. 34, 22, 1, -137 Sort 90, -5, 335 in descending order. 335, 90, -5 Sort -447, -0.6, -5, 0.3 in descending order. 0.3, -0.6, -5, -447 Sort 2/19, 0.2, -1/188, 1/2. -1/188, 2/19, 0.2, 1/2 Sort -5, 3, 157. -5, 3, 157 Sort 388, 0, 3, -3, -7. -7, -3, 0, 3, 388 Put 17, -7, 5, -3 in increasing order. -7, -3, 5, 17 Put -529, -4, 197 in decreasing order. 197, -4, -529 Sort 2, 5, -4, -78, -1484, 3. -1484, -78, -4, 2, 3, 5 Put -5, -132, -30, -6 in increasing order. -132, -30, -6, -5 Sort -4, 11, 0, 14, -15. -15, -4, 0, 11, 14 Sort 4, -28, -2, -27, -112 in decreasing order. 4, -2, -27, -28, -112 Sort -23, 1, 39, 2, 18 in decreasing order. 39, 18, 2, 1, -23 Put 62, 16, 1 in decreasing order. 62, 16, 1 Sort 0.6, -87, -110. -110, -87, 0.6 Sort 2/7, 0.0083, -11/26 in decreasing order. 2/7, 0.0083, -11/26 Put -18, -7, -13 in descending order. -7, -13, -18 Sort 0.1, 4/21, 1/4, 4, 0, 1/3 in descending order. 4, 1/3, 1/4, 4/21, 0.1, 0 Put -1428, 0.1, -3, 0.2, 0 in ascending order. -1428, -3, 0, 0.1, 0.2 Sort 4092, 38, 5 in ascending order. 5, 38, 4092 Sort -0.3, -2/15, -38/73, -7/12 in decreasing order. -2/15, -0.3, -38/73, -7/12 Sort 5/7, -0.3, 1/2108, -2 in ascending order. -2, -0.3, 1/2108, 5/7 Sort -4/5, 4, 1709, -1/4, 0.5, -3 in increasing order. -3, -4/5, -1/4, 0.5, 4, 1709 Sort 18687, -2, 1/4, 3/2 in descending order. 18687, 3/2, 1/4, -2 Sort 21, -1, 11, 2/27, 3. -1, 2/27, 3, 11, 21 Put 3, -2.85, 0.1, -0.11, -2 in decreasing order. 3, 0.1, -0.11, -2, -2.85 Put -45.5, 1, -3/2, -2, 2 in descending order. 2, 1, -3/2, -2, -45.5 Put 1.16, 1/2, -3/4, 3, -180 in descending order. 3, 1.16, 1/2, -3/4, -180 Sort -29, -14/93, -4, -3/4 in ascending order. -29, -4, -3/4, -14/93 Sort 0, 1, 15, 2, -1, -41 in decreasing order. 15, 2, 1, 0, -1, -41 Sort -0.32, 2, 2/7, 263 in decreasing order. 263, 2, 2/7, -0.32 Sort -2, 0, 2/107, -67, -6/7, -0.1. -67, -2, -6/7, -0.1, 0, 2/107 Sort -575, 5201, 2 in decreasing order. 5201, 2, -575 Put -106, 0, -2, -1 in decreasing order. 0, -1, -2, -106 Sort -4, 6, 111, 0. -4, 0, 6, 111 Sort -3, 7, 2291, -2 in descending order. 2291, 7, -2, -3 Put 0.03, -21, 2/21, 2, -0.5, 0 in ascending order. -21, -0.5, 0, 0.03, 2/21, 2 Sort 1, -18, 3, 397, 4 in decreasing order. 397, 4, 3, 1, -18 Sort 0.06, 1/2, 0.4, -2, 1, -308 in increasing order. -308, -2, 0.06, 0.4, 1/2, 1 Put 4618, 15, 2/11 in descending order. 4618, 15, 2/11 Sort -179, -9, 4, -4 in ascending order. -179, -9, -4, 4 Put -469, -2/5, -2/7, -0.5, -3/2 in descending order. -2/7, -2/5, -0.5, -3/2, -469 Put 17, 5/108, 2/3 in decreasing order. 17, 2/3, 5/108 Sort -5, 3, -7881, -2. -7881, -5, -2, 3 Put 1.7, 1, 3031 in descending order. 3031, 1.7, 1 Put -8/181, -0.13, -1, -7/6 in descending order. -8/181, -0.13, -1, -7/6 Put -778, -3.5, 5 in decreasing order. 5, -3.5, -778 Sort 5, 5.1, 0.4, 0.02, -2 in increasing order. -2, 0.02, 0.4, 5, 5.1 Sort 2, -3/7, -3, -8, -4.5 in descending order. 2, -3/7, -3, -4.5, -8 Sort -25, -8, 8, -5 in decreasing order. 8, -5, -8, -25 Put 242, -1/3, 1/3, 16 in descending order. 242, 16, 1/3, -1/3 Sort -51/5, 0.1, 12, -0.5, 2, 5 in increasing order. -51/5, -0.5, 0.1, 2, 5, 12 Sort 2/3, 264, 4/7, 0.0249 in descending order. 264, 2/3, 4/7, 0.0249 Put 1/4, -3, -2/9, 350 in increasing order. -3, -2/9, 1/4, 350 Sort 0, -0.03, -0.61, 29 in decreasing order. 29, 0, -0.03, -0.61 Put -228, 2, -571 in ascending order. -571, -228, 2 Sort 2, -2288/7, -3/14, -0.4. -228	{ "pile_set_name": "DM Mathematics" }
ivative of s(v). What is m in o(m) = 0? -27, 0 Suppose -2h + 12 = -0h + 2c, -3c = -3h - 6. Factor 2f*2 - 11f*h + 3f*3 - 139f + 133f + 0f*5 + 3f*5 + 9f*4. 3f(f - 1)(f + 1)*2(f + 2) Let u = 115320/17 + -576532/85. Factor 0r + 0 - 16/5r*3 + 0r*2 - ur*4. -4r*3(r + 4)/5 Let r(h) be the first derivative of h*4/10 - 4h*3/15 - 697. Find w such that r(w) = 0. 0, 2 Let s(n) be the first derivative of 5n*3/3 - 2155n*2 + 928805n + 477. Factor s(u). 5(u - 431)2 Let r = 279720 - 279720. What is y in -4/5y*2 + r - 4y = 0? -5, 0 Let i(r) be the third derivative of 1/180r5 + 0r + 0r3 + 0 - 11/24r*4 - 140r*2. Factor i(c). c(c - 33)/3 Find m such that -4m3 - 450 - 198 - 36m + 432m - 48m2 = 0. -18, 3 Let w(l) = l2 - 5346l - 1732. Let v(b) = 1337b + 432. Let g(x) = 33v(x) + 9w(x). Factor g(k). 3(k - 444)(3k + 1) Let h(c) be the first derivative of 1/12c*3 - 31 - 7/8c*2 + 3/2c. Factor h(z). (z - 6)(z - 1)/4 Let n(w) be the second derivative of 0w*2 + 0w*4 + 0w*3 - 1/63w*7 - 16/15w*5 + 0 - 4/15w*6 + 60w. Suppose n(a) = 0. Calculate a. -8, -4, 0 Suppose -5l - 85 = -0l. Let o be (-11)/(-66) - l/6. What is g in 10g4 - 124g - 14g2 + 4 + 2g*3 + 3g*3 + 118g + go = 0? -1, 2/5, 1 Let y(s) = -s3 + 5s2 + 4s - 4. Let o be y(5). Suppose 5w + 3w = o. Factor -15t4 - 3t*5 - 18t*3 + 44 + 24t + 12tw - 44. -3t(t - 1)(t + 2)*3 Let t be (-208)/(-40) + (12/15 - 1). Solve 0z*2 - 38z - t + 2z3 - 1 + z2 - 14 - 17z*2 = 0. -1, 10 Let l(k) be the first derivative of -17/7k*2 - 60 - 1/21k*3 - 289/7k. Factor l(g). -(g + 17)*2/7 Let x(c) = -2c*2 + 8c - 2. Let b be x(3). Factor bv5 + 14029 - 4v*3 - 14029. 4v*3(v - 1)(v + 1) Suppose 0 = 59z - 65z + 24. Suppose 5o - 11k - 8 = -13k, -3o + k = z. Factor o + 1/4j*4 + 1/4j*3 - 1/4j - 1/4j2. j(j - 1)(j + 1)2/4 Let u = 2651/4 - 659. Let g(w) = 4w*2 - 760w - 7998. Let b be g(200). Factor u + 25/4a + 5/2a*b. 5(a + 1)(2a + 3)/4 Let f(b) be the first derivative of 2b5/35 - 75b*4/14 + 144b*3/7 - 1193. Solve f(v) = 0. 0, 3, 72 What is a in 1/3a*2 - 25/3 + 1/3a*3 - 25/3a = 0? -5, -1, 5 Let l(f) = -4f + 32. Let m(y) = 7y*2 - 98y + 8. Let s be m(14). Let z be l(s). Suppose 0g2 + 2/11g*4 - 2/11g*3 + 0g + z = 0. What is g? 0, 1 Let i(s) = s4 + s. Let y be (-615)/195 + 4/26. Let m(z) = z5 + 2z4 - 4z*3 + 4z*2 + 3z. Let u(q) = yi(q) + m(q). Find w such that u(w) = 0. -2, 0, 1, 2 Find p such that -104p + 24 + 452p2 + 46p*4 + 8p*4 - 278p*2 - 8p*5 - 140p*3 = 0. 3/4, 1, 2 Let a = -3188770/7 + 457294. Factor -384/7u - a - 3/7u2. -3(u + 64)*2/7 Let w = 264738 + -1323678/5. Suppose wk*2 + 8/5k + 0 + 1/5k4 + 6/5k*3 = 0. Calculate k. -2, 0 Let g be 30330/(-3033) - 58/(-1)(570/35 + 6). Factor -268/7n - 2/7n*2 - g. -2(n + 67)2/7 Let h(m) be the first derivative of -m4/12 - 8m3/3 - 30m*2 - 144m + 1601. Solve h(l) = 0. -12, -6 Let j(t) = t*3 - 46t*2 + 87t + 47. Let b be j(44). Factor -381n4 + 156 + 3n*5 + 2119n - 885 + n*5 + 268n*4 + 1769n + 1108nb - 4158n2. (n - 9)3(n - 1)(4n - 1) Let a be (-5)/6 + 1 + (-371)/(-42). Let n be 29/a - 70/315. Find j such that -2/9j + 2/9jn - 4/9 - 2/9j*4 + 2/3j*2 = 0. -1, 1, 2 Let -1240/3c*3 + 116/3c*4 + 656/3c + 80/3 + 1028/3c2 + 80/3c*5 = 0. Calculate c. -5, -1/4, -1/5, 2 Let m = -1639 - -1642. Let v = 5 - 1. Let 32f*v + 2f*m - 18f*3 + 8f*5 + 12f*5 = 0. What is f? -2, 0, 2/5 Suppose 4t = -8t + 6132. Suppose tw - 40 = 503w. Factor 3/4f*2 - 1/2f + 1/4f3 - 3/4f*4 + 0 + 1/4f*w. f(f - 2)(f - 1)2(f + 1)/4 Suppose 13 = -19j - 2j + 13. Let k(n) be the second derivative of 0 + 1/100n5 + jn*2 + 21n + 1/60n4 + 0n*3. Let k(i) = 0. What is i? -1, 0 Let v = -141 - -226. Let f = v - 77. Let -128g*2 - 6g*3 + 116g*2 + 6g*3 + 4g*4 - fg = 0. What is g? -1, 0, 2 Let v = 274 + -314. Let n be v/(-18) - (-36)/(-162). Find m, given that 46/15m - 14/15m*n - 4/5 = 0. 2/7, 3 Let r = 4 - 330. Let k = r - -1634/5. Factor 6/5q*2 + 8q*3 + 0 - kq. 2q(4q - 1)(5q + 2)/5 Let t be 5 + -6 + (1 - 32). Let i = 36 + t. What is u in 20u*5 - 2u*i + 10u*2 - 36u*5 + 0u*4 + 18u*5 - 6u*3 - 4u = 0? -2, 0, 1 Let l(f) = 3f + 17. Let r be l(-5). Let b be r/(-8)(14 - 222/15). Factor 0g - 1/5 + bg*2. (g - 1)(g + 1)/5 Let h(l) be the third derivative of l*7/70 + 9l*6/5 - 73l*5/20 - 1119l*2. What is a in h(a) = 0? -73, 0, 1 Let g = 639216 + -639216. Factor -28/9m + g - 2/9m2. -2m(m + 14)/9 Find p, given that 169/8p + 83/8p2 - 1/8p*3 + 85/8 = 0. -1, 85 Determine h so that -53h*2 - 13h*3 - 1200h + 477h2 + h3 - 624 - 592 + 504h2 = 0. -2/3, 2, 76 Let s(j) be the third derivative of -j6/1620 - 2j5/135 - 5j*4/36 - 5j*3/2 + 5j*2 - 1. Let v(b) be the first derivative of s(b). Factor v(l). -2(l + 3)(l + 5)/9 Suppose -5y - h + 9 = -7, -16 = 4h. Determine m so that 9m*2 + 20m*3 + 5m*3 + 16m*4 + ym5 - m2 - 5m3 = 0. -2, -1, 0 Suppose -2l - 21948c - 24 = -21944c, 3l = 3c + 63. Suppose ly + 4/9y*2 - 46/9 = 0. Calculate y. -23, 1/2 Let c = 2 + 2. Let r be (-2529)/843 + (100/(-36))/(-1) + 2. Let 32/9 - rb*2 + 32/9b - 32/9b3 - 14/9b*c - 2/9b*5 = 0. What is b? -2, 1 Let y be (-22)/(-9 - 2)1. Let r(s) be the first derivative of -y + 9/10s2 + 1/5s*3 - 12/5s. Let r(z) = 0. Calculate z. -4, 1 Let x be (-1591)/22200-30 + 2/(-5). Factor 0 + xh - 1/8h3 + 13/8h*2. -h(h - 14)(h + 1)/8 Let t(p) be the second derivative of p6/105 - 39p*5/70 - 41p*4/42 + 13p*3/7 + 40p*2/7 + 3197p. Let t(s) = 0. Calculate s. -1, 1, 40 Factor 3/4f3 + 0 + 15f - 63/4f2. 3f(f - 20)(f - 1)/4 Let d(a) = a - 4a + 3 + 0a. Let i be d(0). Factor -t4 - t5 + 2t4 + 2t*i - 2 - 2t2 + 3 - t. -(t - 1)3(t + 1)2 Let o(x) = 8x*4 - 3979x*3 + 7979x*2 - 3972x - 9. Let y(w) = 5w4 - 1990w*3 + 3990w*2 - 1985w - 5. Let g(u) = 5o(u) - 9y(u). Factor g(c). -5c(c - 1)*2(c + 399) Suppose 4w + 130 - 3 = b, 4b - 440 = -w. Let 16o3 - 159o*2 + bo*2 + 392 - 12o*3 - 84o - 8o3 = 0. Calculate o. -7, 2 Let y(q) be the first derivative of 45 + 7/45q*5 + 13/18q4 + q3 - 4/9q + 2/9q*2. Let y(p) = 0. Calculate p. -2, -1, 2/7 What is v in 0 + 6v*3 + 0v - 2/3v5 - 6v*2 + 2/3v*4 = 0? -3, 0, 1, 3 Determine a so that 62/9 + 47/9a*2 + 1459/9a = 0. -31, -2/47 Let n be (-17)/(-5) - (-387)/(-430). Factor 5/2 - 35/4p - np*4 + 10p*2 + 5/4p*5 - 5/2p*3. 5(p - 1)*4(p + 2)/4 Let u be -13 - -14 - (0 - 2). Let s(q) be the first derivative of 2/3qu + 0q + 2/15q5 + 1/2q*4 + 1/3q*2 - 12. Factor s(g). 2g(g + 1)3/3 Let o(h) = 7h*2 + 67h*3 - 66h*3 - 8h - 9 - 2h. Let v be o(-8). Determine k, given that -4k - 9k2 + 2k - 3k + 3k*3 - vk = 0. -1, 0, 4 Let g be (-2)/10 + 1700/13500 - (-1738)/135. Solve 0 + 86/5l2 + 6/5l*4 + gl*3 - 36/5l = 0 for l. -9, -2, 0, 1/3 Suppose 88 = -19g + 2197. Let 31w*2 - 80w + 9w4 - gw*2 + 11w*4 + 5w*5 = 0. Calculate w. -2, 0, 2 Let v(t) be the second derivative of -4t*6/27 + 3287t*5/90 - 379t*4/18 - 1802t*3/27 - 328t*2/9 - 2t - 85. Suppose v(x) = 0. Calculate x. -2/5, -1/4, 1, 164 Let t(z) be the third derivative of -5z8/336 - 13z*7/21 - 5z*6 + 263z*5/6 - 2915z*4/24 + 170z*3 - 523z*2 + 4z + 3. Determine m so that t(m) = 0. -17, -12, 1 Let p be (0/1)/(-27 + (35 - 7)). Let b(h) be the first derivative of 2/15h5 + 0h - 1/18h6 - 15 + 0h*3 + 0h*4 + ph2. Factor b(q). -q4(q - 2)/3 Factor -512/9s - 56 - 2/9s3 - 134/9s*2. -2(s + 2)*2(s + 63)/9 Let u(x) be the third derivative of -x*7/630 + 7x*6/72 + 68x*5/15 - 9406x2. Factor u(n). -n2(n - 51)(n + 16)/3 Let g(v) be the first derivative of 0v - 17 + 1/2v*6 + 0v*2 + 0v*3 + 3/4v*4 - 6/5v*5. Determine p so that g(p) = 0. 0, 1 Let h(a) = -5a*2 + 1757a - 1741. Let x(i) = -2i2 + 586i - 580. Let g(c) = -4h(c) + 11x(c). Factor g(d). -2(d - 1)(d + 292) Suppose -32p = -36p - 8. Let n be p/2 - 64/(-48). Factor 0 - 4/3a*4 +	{ "pile_set_name": "DM Mathematics" }
3 c Let b be (8/(-12))/((-2 - 3)/(-15)). What is the second biggest value in 8, b, 0.03? 0.03 Let f be 2 + -1 + 0 + 1. Let v be (-3)/f - 6/(-4). Let g = 0.0093 + -0.0193. What is the second biggest value in v, -2/5, g? g Suppose 3q = -2q - 10. Which is the smallest value? (a) q (b) -0.067 (c) -0.1 a Let v be 1(-4)/1616/5. Let g = 0.033 - -0.267. What is the smallest value in v, 2, g? v Let x = 4 + -6. Let g = -224 - -226. Which is the third smallest value? (a) -2/9 (b) x (c) g c Let q = 166 + -312. Let j = -142 - q. Which is the smallest value? (a) -6 (b) -5 (c) j a Let r be (210/(-135))/(-2 - 7/(-3)). What is the biggest value in 4, r, -2? 4 Let y = -14 + 27. Let d = -12.7 + y. Let a = d - 0.4. What is the third smallest value in -4, 2, a? 2 Let q = -250 - -253. What is the fourth smallest value in q, 0.2, -1, -1/11? q Let q = -6 + 3. Let s = 3 + q. Let h = 4.29 + -14.29. Which is the second smallest value? (a) -1 (b) s (c) h a Let d(h) = 18h + 4. Let m be d(-2). Let z = 47 + m. Suppose 3t = -z + 6. Which is the second smallest value? (a) 3/7 (b) t (c) -1/3 c Let s be -1 - (4 + (-10 - -2)). What is the smallest value in -1.1, 1, s? -1.1 Let q = 19 + -17. Let y be (14/(-112))/(q/(-4)). Which is the smallest value? (a) y (b) 5/2 (c) 0.6 a Suppose 1 = d + 4. Let i = -1170 + 1169.9. What is the third smallest value in i, -1/4, d, 0.2? i Let f be ((-38)/12)/(-1) - (-18)/(-9). Let w = -23/30 + f. Let r be (18/(-12))/(21). Which is the smallest value? (a) w (b) r (c) -1/3 b Let i(j) = 13j3 + j2 - 20j - 21. Let h be i(-1). Which is the second biggest value? (a) h (b) -2 (c) 3 b Suppose -2m = 3v - 6, -5v + 12 = -4v + 4m. Let o = 0.3 + -2.3. Which is the fourth biggest value? (a) 11 (b) v (c) 4 (d) o d Let y = -1386.014 - -1390. Let g = -0.014 - y. What is the third biggest value in -2, 0.07, g? g Let l = 0.39 - 0.33. Let w = 0.46 - l. Which is the biggest value? (a) -3 (b) -5 (c) -4 (d) w d Let t = -6 + 5.6. Suppose -5r = -7r. Let m be (-2)/2410 - r. What is the third biggest value in t, m, 0.4? m Let o = -80573/6 + 13396. Suppose 2k + 2j = 72, 57 = 6k - 4k - 3j. Let i = k + o. What is the smallest value in 0.4, i, 2? i Let a = -56 - -57. Let d = a - 3. Let h(v) = v - 4. Let y be h(4). What is the smallest value in d, y, -13? -13 Let t = 1669 + -1494. What is the third biggest value in -0.4, -1, t? -1 Let p = 19.5 - 1.5. Let r = -10 - p. Let v = r - -33. What is the biggest value in -2, -0.4, v? v Let h = 2 - 0.1. Let n = h + -18.9. Let s = n - -21. What is the second smallest value in 0.5, s, -1? 0.5 Let r be 2/(-3) - (6 - 6220/960). What is the third biggest value in 1/7, -0.1, r, 0.2? -0.1 Let q = -0.1 - 0.02. Let c = -2.03 - q. Let k = 0.09 - c. What is the smallest value in k, -0.1, 0? -0.1 Let v = 1.99 + -3.5. Let q = v + 1.31. What is the biggest value in 2, q, 37? 37 Suppose 0r - 3r = 5h - 61, -4r + 58 = 2h. Let y = -35 - -75. Let g be (12/(-50))/(r/y). Which is the third biggest value? (a) 1 (b) -0.2 (c) g c Suppose -7 = 5r + 8. Let h be (r/15)/((-1)/25). What is the second smallest value in h, -5/2, 1? 1 Let w be ((-9)/7 - -1)217/(-62). What is the second biggest value in 0, 0.1, w, 0.8? 0.8 Let o be ((-13)/(390/(-20)))/((-2)/15). Suppose -5j + 8 = 4k - 1, 2 = -3k + 5j. What is the second smallest value in 12, o, k? k Let a = 247.5 + -248. Let z be 2 - (-2 + (-11)/(-3)). What is the third biggest value in a, 4/3, z, -2/13? -2/13 Let o = -2.24 - -2.33. Which is the biggest value? (a) -1/5 (b) -4 (c) o c Let z = -1.161 - -0.161. What is the third biggest value in 0.1, z, 2/5, 5/7? 0.1 Let a = 134 + -138. Let n(x) = 2x. Let z be n(2). What is the second biggest value in 1/9, a, z? 1/9 Let r = -107 + 110. What is the smallest value in -14, r, -7? -14 Let q = -9 - -15. Let s = q + -3. Let x = 0.32 + -2.32. Which is the smallest value? (a) x (b) 5 (c) s a Let s = -21 + 20.1. Let q = -11351/12 + 3785/4. Let d = 2.4 - 2. Which is the second smallest value? (a) s (b) q (c) d b Suppose -6t = -4a - t + 35, 15 = -5t. What is the second biggest value in 0.3, -2.1, 0.08, a? 0.3 Let y = 138 + -136. Which is the smallest value? (a) -1 (b) y (c) -4 (d) 1 c Let f = -0.089 + 3.089. What is the fourth biggest value in 1, f, 2/11, -1/4? -1/4 Let c = 0.105 - -111.895. Let n = -115 + c. What is the smallest value in n, -5, -0.01? -5 Let z = -488/5 + 97. Let f be -31 - (-1)/(-3)3. Let w = 37 + f. Which is the second biggest value? (a) 2/9 (b) w (c) z a Let f = -2.2 - -2.5. Let c = 0.35 + 0.05. Let q = -88 + 87.7. What is the biggest value in f, c, q? c Let w = 0.5 - 0. Let q = 0.104 - 0.104. Which is the third biggest value? (a) q (b) -1/8 (c) w b Let u = -169 - -178. Which is the third smallest value? (a) 5 (b) u (c) 1/3 b Let l = -1.5 - 1. Let z = -3 - l. Suppose -40 = 4y - 2j - 14, -3y + 5j = 37. Which is the biggest value? (a) y (b) z (c) -5 b Let y = 1457 + -1456. What is the second biggest value in -7/6, 5, y? y Let l be ((-1)/(-3))/((504/54)/(-28)). Which is the second biggest value? (a) -0.4 (b) 9 (c) l (d) 0.2 d Let k = 0.16 + -17.16. Let t = k - -17.2. What is the second biggest value in -5, t, 0.3? t Let g = -11.02 - -0.02. Let l = 11.5 + g. Let j = 0.3 - l. Which is the third biggest value? (a) 3 (b) j (c) 4 b Let p = -547 + 546.6. Which is the biggest value? (a) p (b) 5 (c) -1 (d) 3 b Let m = 216/11 + -1307/66. Which is the third smallest value? (a) m (b) -1 (c) 33 c Let k = -2/103 - 293/824. Which is the third biggest value? (a) 0.5 (b) -2 (c) k b Let n(q) = -q + 34. Let j be n(38). Which is the smallest value? (a) j (b) -1/9 (c) -0.3 a Let m = 181 + -180.8. Let d = -0.2 - -5.2. What is the third smallest value in m, d, 0? d Let u = -66 + 525/8. Which is the fourth biggest value? (a) 4/7 (b) 0.5 (c) 1/3 (d) u d Let l be 8 - (-2 - (1 - 14)). What is the third smallest value in -3/5, 30/7, l? 30/7 Let w = -0.1 - 0.4. Let x = 570 - 1711/3. Which is the fourth biggest value? (a) -2/5 (b) x (c) 3 (d) w d Let f be (6/(-10) - (-26)/10)/(-7). What is the second biggest value in 3/10, f, 16? 3/10 Let j = 1045 - 1045.3. What is the third smallest value in -3, -7/2, j? j Let h be 4/(-10) - (-308)/420. Let n be (-3)/(1 + 7/(-4)). Suppose 4f + 16 = -n. Which is the second smallest value? (a) f (b) h (c) -0.5 c Let x = 20 + -30. Let p = 9 - x. What is the second biggest value in p, -0.5, -1? -0.5 Let p = -28 + -51. Let w = 85 + p. Let x(m) = m2 - 3m - 2. Let l be x(3). Which is the second smallest value? (a) -1 (b) l (c) w a Suppose -2q + 42y - 2 = 46y, 0 = -q - 5y - 10. What is the smallest value in q, 21, 1? 1 Let f = -237.31 - -236. Let d = 15.91 + f. Let l = d + -15. Which is the second smallest value? (a) 2/3 (b) l (c) -2 b Let y(o) = -o*3 + 8o*2 - 20o + 5. Let s be y(4). Which is the fourth smallest value? (a) -3 (b) -0.2 (c) s (d) -0.6 b Let q = -632 + 674. What is the second biggest value in q, -2/7, 0.3? 0.3 Let i = 32/11 - 310/99. Let h = -34.043 - -0.043. Let l = -34 - h. Which is the third smallest value? (a) i (b) l (c) -3 b Let k = -15.78 + 10.78. Which is the biggest value? (a) k (b) -4 (c) -28 (d) 0.1 d Let u(l) = 2l + 2. Let d be u(2). Suppose -3y + 11 = -4z, 0z + 20 = -4z. Let t = y + d. What is the smallest value in -2/11, t, -3? -3 Let t be 25/((-625)/30) - (4 + -5). Let r = 11 - 19. Which is the third smallest value? (a) r (b) -1/4 (c) -2 (d) t b Let t = 639/10 + -63. Let o = t + -2/5. Let m = -6/7 + 4/21. Which is the second smallest value? (a) o (b) 1 (c) m a Let d = 3.5 + -3.6. Let r = 23.2 + -23. Which is the third biggest value? (a) 6/11 (b) d (c) r b Let z be (-18)/(-27) + (-12 - -2). Let o = 198.2 + -198. What is the smallest value in o, z, -10? -10 Let f = -562 + 16296/29. Which is the biggest value? (a) f (b) -0.3 (c) 3/5 c Let w = 2 - -1. Let i = w + 2. Which is the fourth smallest value? (a) -0.4 (b) i (c) -4 (d) -2 b Let f = 0.5 - 1. Let a = f + 0.7. What is the biggest value in 2/7, a, -2? 2/7 Let h = -0.14 - -0.3. Let d = h - 0.36. Let s = 0.01 - -2.99. Which is the third biggest value? (a) d (b) -3/7 (c) s b Let l = 4298/5 + -860. Let q	{ "pile_set_name": "DM Mathematics" }
7/4, -4, 3790 in ascending order. -177/4, -4, 3790 Put -193/5, 2/7, 1.811 in descending order. 1.811, 2/7, -193/5 Put -3, -143, 2, -38, 4 in decreasing order. 4, 2, -3, -38, -143 Sort -1/1596, -5, 15. -5, -1/1596, 15 Sort 22, 35, -5, -3. -5, -3, 22, 35 Sort 0.4, -1, 228102. -1, 0.4, 228102 Sort 17, -0.4, 2/7, 0.018, -1/2 in increasing order. -1/2, -0.4, 0.018, 2/7, 17 Sort 183, 1/5, 66, 4 in descending order. 183, 66, 4, 1/5 Put -6, -688, 0, -23, -4, 3 in ascending order. -688, -23, -6, -4, 0, 3 Sort 77, -514, 5 in descending order. 77, 5, -514 Sort -2/3, 0.49, -0.158, 8 in increasing order. -2/3, -0.158, 0.49, 8 Sort 1, -5, 14513. -5, 1, 14513 Sort 3, -7069, -4 in descending order. 3, -4, -7069 Sort 11371, 5/3, 0.1, 5, 1/6 in descending order. 11371, 5, 5/3, 1/6, 0.1 Put -4, 0, -66, 0.28, -0.5 in descending order. 0.28, 0, -0.5, -4, -66 Put -576, -4, 1, 0, 110 in increasing order. -576, -4, 0, 1, 110 Sort -16, 4, -4725 in ascending order. -4725, -16, 4 Put -2, 8, 4, 0.3, 2/9, 15.9 in decreasing order. 15.9, 8, 4, 0.3, 2/9, -2 Sort -190, 3, 4, -15, 1 in ascending order. -190, -15, 1, 3, 4 Sort -2, -3/7, 1/3, 21195 in decreasing order. 21195, 1/3, -3/7, -2 Sort 413, -76, 11 in descending order. 413, 11, -76 Put 1, -0.6, -5, -3/3953 in decreasing order. 1, -3/3953, -0.6, -5 Put 3/206, -2/13, -13, -5 in ascending order. -13, -5, -2/13, 3/206 Put -32719, -3/2, -5, -2/5 in decreasing order. -2/5, -3/2, -5, -32719 Sort 0.1, 0.0174, 1, 6/17, 5 in increasing order. 0.0174, 0.1, 6/17, 1, 5 Sort -2/75, -0.27, 0.8 in descending order. 0.8, -2/75, -0.27 Sort -0.2, -2/3, -32.738 in decreasing order. -0.2, -2/3, -32.738 Sort -5, 6, 71, 1 in ascending order. -5, 1, 6, 71 Put -0.09, -4/7, 20, 1, -2/3, -3 in ascending order. -3, -2/3, -4/7, -0.09, 1, 20 Sort 1, 3, 4, -153, -53, 0 in decreasing order. 4, 3, 1, 0, -53, -153 Put 11, -3/8, 5/4, 2, 187/9 in descending order. 187/9, 11, 2, 5/4, -3/8 Sort -0.2, -8, 2, -5, -2/2773 in ascending order. -8, -5, -0.2, -2/2773, 2 Put -91, -5, 3, 1 in decreasing order. 3, 1, -5, -91 Put -8, 5, -1, -3778, 2 in ascending order. -3778, -8, -1, 2, 5 Sort 2, 709/6, 5, -5. -5, 2, 5, 709/6 Sort -14, 38, 3, 22, 0 in decreasing order. 38, 22, 3, 0, -14 Put -178837, 12, -5 in increasing order. -178837, -5, 12 Sort -59, 3, -423, 0 in increasing order. -423, -59, 0, 3 Sort 301, 2.3, -11 in increasing order. -11, 2.3, 301 Put 15550, -7, -3 in descending order. 15550, -3, -7 Sort -3, 2, -5, 5, -479, 4 in decreasing order. 5, 4, 2, -3, -5, -479 Sort -5, 5, 15, -9210. -9210, -5, 5, 15 Sort 1, 12, 2, -2, -1. -2, -1, 1, 2, 12 Put -6, -25, -2, -1, -339 in descending order. -1, -2, -6, -25, -339 Sort 1, 96, -2, -7, 5 in decreasing order. 96, 5, 1, -2, -7 Put 0, 0.01, 43166 in ascending order. 0, 0.01, 43166 Sort -1, 4, -15, 0, 6, -2 in decreasing order. 6, 4, 0, -1, -2, -15 Put 2/5, 1160, 3/4, 2 in increasing order. 2/5, 3/4, 2, 1160 Sort 3/10, 0, 38/9, -0.1, -1/8, 5 in decreasing order. 5, 38/9, 3/10, 0, -0.1, -1/8 Sort -3, -1680, -9, 4 in descending order. 4, -3, -9, -1680 Put 61, -5, 89 in descending order. 89, 61, -5 Sort -1/10, 19316, 1, -5, 2. -5, -1/10, 1, 2, 19316 Sort -0.5, -3520, 1, 3, -1/6 in ascending order. -3520, -0.5, -1/6, 1, 3 Sort -2, -1, 189974. -2, -1, 189974 Sort -2, -9, 2, 4, 114. -9, -2, 2, 4, 114 Put 19791, 0, -1, -2 in increasing order. -2, -1, 0, 19791 Put 1, 4, -2, 20, -322 in descending order. 20, 4, 1, -2, -322 Put -7, 1, -22, -2, -5 in descending order. 1, -2, -5, -7, -22 Sort -17, 11, 2, -1. -17, -1, 2, 11 Put 1, 255, 2, 0, 8, -5 in decreasing order. 255, 8, 2, 1, 0, -5 Sort -3, -1/7, -75, -4/5, -2/15, 3 in descending order. 3, -2/15, -1/7, -4/5, -3, -75 Sort 357.6, -0.5, -0.08, 2/5, 2 in decreasing order. 357.6, 2, 2/5, -0.08, -0.5 Sort -1, 0, 14527, 2 in descending order. 14527, 2, 0, -1 Put -1, 0, 3, -12, 1, -67 in increasing order. -67, -12, -1, 0, 1, 3 Sort 2/9, -4, -3, 29240, 3/5, -2/13 in descending order. 29240, 3/5, 2/9, -2/13, -3, -4 Put -2.3, 2/25, 1, -0.3, -3/5 in descending order. 1, 2/25, -0.3, -3/5, -2.3 Put -0.2, 0.5, -0.06, 20, 12 in decreasing order. 20, 12, 0.5, -0.06, -0.2 Put -106961, 0, 1/5 in increasing order. -106961, 0, 1/5 Sort -7, -6/11, -0.1, 13, -3 in decreasing order. 13, -0.1, -6/11, -3, -7 Sort -52, -104/457, 5 in decreasing order. 5, -104/457, -52 Put -5, 2/19, 0.3, 2/3, 0.49, 5 in descending order. 5, 2/3, 0.49, 0.3, 2/19, -5 Sort 3, 1, 19, 98, -12, -2 in decreasing order. 98, 19, 3, 1, -2, -12 Sort 6, 13, 1, -5, -8 in ascending order. -8, -5, 1, 6, 13 Sort -45, 0.5, 11, -0.5, -58 in descending order. 11, 0.5, -0.5, -45, -58 Put -1113, 2371, 5 in ascending order. -1113, 5, 2371 Sort -98, -54/13, 4 in decreasing order. 4, -54/13, -98 Sort 4746, 3, 4, 12, -4 in descending order. 4746, 12, 4, 3, -4 Put -5, 242127, 4/3 in increasing order. -5, 4/3, 242127 Sort 5, 4, 2, -1, -78552, -2 in decreasing order. 5, 4, 2, -1, -2, -78552 Sort -2, 69, -7, -34. -34, -7, -2, 69 Sort 1646, 110, -2, -3, -5 in ascending order. -5, -3, -2, 110, 1646 Sort -1, 5, -4, 3885. -4, -1, 5, 3885 Put 3, 3095, 2, -3 in descending order. 3095, 3, 2, -3 Put 50551, 4, 2 in increasing order. 2, 4, 50551 Put -3, -4, 2, -195, -2 in decreasing order. 2, -2, -3, -4, -195 Put -6, 13, 2/11, -0.26, 2/5 in increasing order. -6, -0.26, 2/11, 2/5, 13 Put -5, 3, -2, 7, 16, 4 in increasing order. -5, -2, 3, 4, 7, 16 Put -255, 5, -6, -2 in descending order. 5, -2, -6, -255 Put 4, -5, -4, 79, -1 in increasing order. -5, -4, -1, 4, 79 Put 0.9, 5, 26, 2, 4/5, 11 in decreasing order. 26, 11, 5, 2, 0.9, 4/5 Sort 0, 4, 2, 3, -65, 29 in decreasing order. 29, 4, 3, 2, 0, -65 Put 1/5, 0.12, -3, -38/9, -4 in decreasing order. 1/5, 0.12, -3, -4, -38/9 Sort -4/11, 8, -3, -27 in decreasing order. 8, -4/11, -3, -27 Sort -1628, -1291, 0.5. -1628, -1291, 0.5 Sort 5, 60, -4, 18, 37 in decreasing order. 60, 37, 18, 5, -4 Sort 0.068, 0.09, -66. -66, 0.068, 0.09 Put 0, -5, -3, 127, -171 in decreasing order. 127, 0, -3, -5, -171 Sort 4, 1420, 1/4, 2/21 in increasing order. 2/21, 1/4, 4, 1420 Sort 3, 0, -0.4, 1/3, -1/6, 10/61 in descending order. 3, 1/3, 10/61, 0, -1/6, -0.4 Put -5, -1, 392, -33, 0 in descending order. 392, 0, -1, -5, -33 Sort 6.6, -4, -538, -0.11. -538, -4, -0.11, 6.6 Sort 4, 1, 72, -523, 5, 3 in ascending order. -523, 1, 3, 4, 5, 72 Sort 8, 3/62, 2, 1/4, 0.4 in decreasing order. 8, 2, 0.4, 1/4, 3/62 Sort 5, 43, -0.009, 1.6 in increasing order. -0.009, 1.6, 5, 43 Sort -4, -53212, 4 in decreasing order. 4, -4, -53212 Sort 4, -52, -11, 30, 10 in ascending order. -52, -11, 4, 10, 30 Put 1, -108, 939 in ascending order. -108, 1, 939 Sort 6, 22, -3, -153, 3, -4. -153, -4, -3, 3, 6, 22 Sort -4917, 2, -7 in decreasing order. 2, -7, -4917 Sort -15, -1, 13, -7 in decreasing order. 13, -1, -7, -15 Sort -6, 5, -7/101, 3, -2, -1. -6, -2, -1, -7/101, 3, 5 Sort -96, -19/166, -3 in ascending order. -96, -3, -19/166 Put -6, -5, 3/169, -1 in increasing order. -6, -5, -1, 3/169 Sort -2, -5, -22305. -22305, -5, -2 Put -184, -50, -5 in descending order. -5, -50, -184 Sort 3, 122483, 1 in descending order. 122483, 3, 1 Sort -30/17, 5, -0.4, 0.031, 0.5, 1 in ascending order. -30/17, -0.4, 0.031, 0.5, 1, 5 Sort -2, 2/7, -0.4, 0.1, -3, -4. -4, -3, -2, -0.4, 0.1, 2/7 Put -57, -40, 14 in ascending order. -57, -40, 14 Sort 14, 21, -2, -5, 0 in increasing order. -5, -2, 0, 14, 21 Put 6, -4, -815, 4 in increasing order. -815, -4, 4, 6 Sort -6, 2/59, 42, 0, 1. -6, 0, 2/59, 1, 42 Sort 1041, -10, 4 in increasing order. -10, 4, 1041 Sort 14/5, -4, -1, -3, 2. -4, -3, -1, 2, 14/5 Put 2566, 5, 19, 4 in increasing order. 4, 5, 19, 2566 Put -1/3, -2, -7/3, -31, -4, 21 in descending order. 21, -1/3, -2, -7/3, -4, -31 Sort 1, 530, -9, 2, -12 in increasing order. -12, -9, 1, 2, 530 Sort -1, 1541, 0, 3. -1, 0, 3, 1541 Sort 199, -1, 5, -13 in increasing order. -13, -1, 5, 199 Sort 4, 199, 276, -6 in ascending order. -6, 4, 199, 276 Put -12, -5, -9096 in increasing order. -9096, -12, -5 Put -12, 1748, 3, -2/13, 4/9 in descending order. 1748, 3, 4/9, -2/13, -12 Sort 336, -2, 6. -2, 6, 336 Put -224, -5, 2, 0 in increasing order. -224, -5, 0, 2 Sort -2, 3, -1/178263 in decreasing order. 3, -1/178263, -2 Put 5, -182, -92, -4 in decreasing order. 5, -4, -92, -182 Put 67, 6,	{ "pile_set_name": "DM Mathematics" }
b be (-11)/66 - (-34)/(-48). What is the smallest value in -0.2, b, z? b Suppose -4d = -3x + 50, -5x = -4d + d - 43. Let u(p) = -p*2 + 4p - 7. Let i = 41 - 38. Let m be u(i). Which is the biggest value? (a) m (b) 1/3 (c) d b Let n(r) = -30r - 243. Let f be n(-8). Let g = 36 - 16. Let s = g - 24. What is the third smallest value in f, -1, s? -1 Let n = -2110 + 14774/7. Let q = -0.6 + 0.59. Let v = q + -20.99. What is the second smallest value in -0.3, -4, n, v? -4 Let f(o) = -9o - 181. Let m be f(6). Let i be 6/((-1020)/m) + 12/(-8). What is the second biggest value in i, 0.01, -2? i Let b = 27907.94 + -27908. Let z = 4 - 6. What is the second biggest value in z, 3/8, b? b Let y = 0 + -0.1. Let w(o) = -15o2 - 5o + 20. Let g be w(-8). Let m be (-83)/100 - 72/g. Which is the biggest value? (a) 5/2 (b) -4 (c) y (d) m a Suppose 5 + 95 = -4p. Let b = p - -46. Suppose 2i + 0i = -n - 9, 5i + b = -n. What is the smallest value in n, -0.3, -2/15? n Let z = 10333.6 - 10334. Let l = 94.175 - 0.175. What is the second biggest value in l, 5, z, -1? 5 Let q = 7689 - 7691. What is the fourth smallest value in -20.3, q, 12, 4, 0.5? 4 Let u = 24151.005 - 24151. Which is the third smallest value? (a) u (b) 5 (c) -3 (d) 8 b Let x(d) = -d*3 - 133d*2 - 1128d - 1441. Let m be x(-124). Let g = -2/113 + 236/565. What is the fourth biggest value in g, 5, m, 0.2? 0.2 Let u = -3491 - -3488. Which is the smallest value? (a) 3378 (b) u (c) -1/2 b Let j be (8/(-80))/((-141)/(-12)). Let f = j + 49/235. Let v = -26 + 51/2. Which is the third smallest value? (a) -0.3 (b) v (c) 0.6 (d) f d Let k = -8 + 5. Let m = -262.2 + 45.2. Let x = 219 + m. Which is the smallest value? (a) x (b) 0.8 (c) k (d) 0 c Let h = 1.7167 - 1.2167. Let f = 3 - 4. Which is the biggest value? (a) f (b) h (c) 22 c Let o = 1343/468 - 248/117. Let m = 1 - -1. Which is the second biggest value? (a) m (b) 13 (c) o a Let p = -6.7 + 7. Let z = 11 - 4. Let d = 16945 + -16950. What is the third biggest value in z, p, d? d Let q = -1826/3085 + -5/617. What is the second smallest value in 2, -32/5, -0.4, -1, q? -1 Let s = -193.05853 - -0.05853. Which is the biggest value? (a) -4 (b) s (c) -0.4 c Let i = -20 - 68. Let l = 179/2 + i. Suppose -159x - 85 = -142x. What is the fourth smallest value in l, x, -3, -4? l Let t = 0.0734 - -0.4266. What is the fourth biggest value in -4/5, t, -0.4, 29? -4/5 Let t be (-44)/(-23) + 1 + -3. Let i(y) = y*3 + 4y + 38. Let q be i(-3). Which is the second smallest value? (a) -2/9 (b) t (c) -1/8 (d) q a Let n = 2808 + -2808. Which is the smallest value? (a) -0.219 (b) 4 (c) n (d) -1 d Let k = 1438 - 1437.94. Which is the biggest value? (a) k (b) 37/3 (c) 1/3 b Suppose -88v = -51v - 111. Which is the third biggest value? (a) -0.3 (b) v (c) 0.05 a Let d be ((-48)/1440)/((-2)/(-3)) + 1/(-5). What is the third smallest value in d, -52, 1/17, -2/9? -2/9 Let m = -13.926 - 0.974. Let y = -16.9 - m. What is the second biggest value in 3, y, 11/7? 11/7 Let i = 1.026 + 0.324. What is the fourth biggest value in i, -0.1, -4/9, -3? -3 Let p = 31 + -25.1. Let j = p - -0.1. Let y be (8 - 56/21) + -6 + 1. What is the third biggest value in y, j, 0? 0 Let g = 1078 - 33. What is the biggest value in 1/5, -2/5, g? g Suppose -9v + 168 = -3v. Let u be v/70(-10)/(-18). Let l = -2/27 + 31/54. Which is the biggest value? (a) l (b) u (c) -1/4 a Let q = 6406 - 6410. What is the fourth smallest value in -2, q, -89/2, 0.3? 0.3 Suppose 2t + 0t + 3s - 17 = 0, 2t - 7 = -s. Let u = 242677.1 + -242677. Which is the smallest value? (a) -45 (b) t (c) u a Suppose 705 = -4j + 717. Which is the biggest value? (a) 61 (b) 3/7 (c) j a Let j = -1071 - -1076. Let k = 0.6 - 1.54. Let p = -0.9 - k. What is the smallest value in p, j, -0.3? -0.3 Suppose u = 4u + 3. Let i = -6156 + 73873/12. Which is the biggest value? (a) i (b) -8 (c) u a Let n = -4034/133 - -560/19. What is the third smallest value in 484, n, -0.3? 484 Let d = -0.8 - -0.4. Let v = -15179/12 - -1265. What is the biggest value in -0.5, d, v? v Let d be (-17)/102 + (-76)/(-168). Let l = -12 + 9. Which is the biggest value? (a) d (b) l (c) -0.4 a Let x = -1.2 - -0.2. Let v = x - -0.96. Let i = 59570 - 416994/7. What is the second biggest value in v, 0.4, -2, i? v Let u(s) = 2s*3 + 11s*2 - 4s + 9. Let f be u(-6). Let i be ((-588)/(-119) + -5)/(1/f). Which is the third smallest value? (a) 4/3 (b) -3/5 (c) i a Let n = -380.2 + 416. Let y = n + -31.8. Let w = -0.9 + 1. Which is the smallest value? (a) w (b) 2/11 (c) y (d) 2/9 a Let q = -54799 + 493189/9. Let s = -5.07 + 5. Let k = 0.9 + 0.1. What is the second smallest value in s, -5, q, k? q Let s = -71.4 + 1.4. Let w = -71 - s. Which is the fourth biggest value? (a) w (b) 4 (c) 5 (d) -0.4 a Let w = 128 - 116. Let i be ((-14)/w - -1) + (-646)/228. What is the fourth smallest value in 4, -5, -0.2, i? 4 Let c = -181.72 - 3.28. Let l = c - -185.4. Let t = 21 - 20.9. What is the third smallest value in t, l, -5, -1? t Let x = -61/171 + 11/19. Which is the fourth biggest value? (a) -0.134 (b) -1 (c) 1/6 (d) x b Let g = 12815 + -12812. What is the smallest value in -6, g, 4, -7, 0.14? -7 Let k = 947 + -398. Let l = k + -541. Let q be (2/2)/((-6)/2). What is the biggest value in q, 5, -2/9, l? l Let r = 0.3 - 0.8. Suppose 4c = 7c. Let j be 201/39 - 190/1235. What is the second biggest value in r, j, -0.1, c? c Let y = -71/5 + 492/35. Let m = -497.5 + 498. Let z be (-7)/226/(-91). Which is the second smallest value? (a) y (b) 0 (c) z (d) m b Let o be (-5)/(-2) - ((-110)/(-20))/(-11). Which is the smallest value? (a) -7 (b) o (c) 48 a Let s(x) = 2x*3 + 125x*2 + 727x - 59. Let g be s(-56). Which is the biggest value? (a) -1/19 (b) g (c) 22 c Let z = 0.00965 - -0.07035. Which is the fourth smallest value? (a) 35 (b) z (c) 2 (d) -1/7 a Let l = 239.102 + -239.1. Let t = 0.02403 + -5.02603. Let m = l + t. Which is the second biggest value? (a) 1 (b) m (c) -0.2 c Let g = -1 + 1. Suppose 143 = -214u + 344 + 441. Which is the third biggest value? (a) u (b) g (c) -2/5 c Let k = 138.061 + -138. Let r = k - 0.094. Let v = r - -0.433. Which is the fourth biggest value? (a) v (b) -4 (c) 0.1 (d) -1 b Let k = -3.853 + 3.953. Let l = -36.11 - -36. Which is the second smallest value? (a) l (b) k (c) 2 b Let v = 1256/11 + -114. Let j = -230 - -30. Let n = j - -199. Which is the smallest value? (a) v (b) n (c) 0 (d) 0.5 b Let o be (-744)/(-234) + (-124)/(-806). What is the biggest value in -2/11, -1/9, o, -0.4? o Let v be ((-36)/945)/(8/20). Let y = -2.07 + 0.07. Let i = y - -2.5. Which is the second biggest value? (a) v (b) 1 (c) 6/7 (d) i c Let g = -11059.6 + 11060. Which is the third biggest value? (a) -29 (b) 0.2 (c) -1 (d) g (e) -3 c Let f = 510.6 - 511. Let t = 1/3 + -14/15. Which is the biggest value? (a) -3 (b) 4 (c) t (d) f b Let s(x) = x3 - 2x*2 + 4x - 10. Let k be s(-3). Let q = k + 69. Let n = 10 - 15. Which is the third smallest value? (a) n (b) q (c) 1/6 (d) -2/5 c Let f(v) = 3v + 13 - 36 - 5v. Let u be f(-9). Which is the fourth smallest value? (a) 0.1 (b) u (c) -15 (d) 0.4 d Let s = 0 + 0. Let b = -267928 + 267934. What is the second smallest value in b, -0.4, s? s Let k = 53 + -85. What is the fourth smallest value in k, -0.14, 0, -6? 0 Let c = -2.322 + 2.022. What is the smallest value in -2/445, 1/6, c? c Let j = 37.934 + -38. Let t = 1.716 - 1.35. Let p = t + j. What is the second biggest value in 3/4, 2/45, p? p Let v(c) = c*3 + 80c*2 - 244c + 417. Let y be v(-83). Let o = -9 - -13. What is the fourth smallest value in -2, y, -24, o? o Suppose 20 = -200m + 205m. Let p = -2.63 + 0.03. Let r = -5.6 - p. Which is the second smallest value? (a) r (b) -2/5 (c) -1 (d) m c Suppose -4g + 1 = -2z - 15, -3g + 26 = -5z. Suppose -9l = -4l + 10. Let q be l - (3 - (-2 + 2)). What is the third smallest value in z, q, -6/13? -6/13 Let s = 9.7 - -1.1. Let z = s + -10.85. What is the third smallest value in z, -1/4, 1? 1 Let g = -0.443 - 84.457. Let d = g + 85. Let j = 6 - 5.5. What is the third biggest value in j, d, 3/5? d Let z = 2264/7 -	{ "pile_set_name": "DM Mathematics" }
jj)))/j))24)39 assuming j is positive. j(-2392/11) Simplify (b(-2/3)bb)*(4/17)(b6/b)25 assuming b is positive. b(6391/51) Simplify (b(-1/2)/((bb/((b/(b/(b(7/3)/b)))/bb))/b))/(b2)(2/53) assuming b is positive. b(-77/318) Simplify (q(-17/6)/q(1/10))/(q6)15 assuming q is positive. q(-1394/15) Simplify (t*(-4)/(t(tt(2/13))/tt)t(2/3)tt11/t)(-28) assuming t is positive. t(-6020/39) Simplify (q29/(q/(q/q(-2)q)))/(q/(qq(-2/35))qq23) assuming q is positive. q(278/35) Simplify (n(1/4))(7/2)/(n(-2/9)/n)(-2/31) assuming n is positive. n(1777/2232) Simplify kk*7kk1((k/k*8)/kk)/k(-1) assuming k is positive. k4 Simplify a/(a*(-8)/a)a*(1/12)(a(-2/3)/a)18 assuming a is positive. a(-239/12) Simplify (((b(1/11))(-5/17))(7/11))(-3/2) assuming b is positive. b(105/4114) Simplify ((dd(-4/9)d)/(d/(ddd*6d)))/(d/(ddd*6)d(2/3)) assuming d is positive. d(143/9) Simplify (w/(((w/w(-2))/w)/w))(4/5)/(w*(-16)/ww/(w*9ww)) assuming w is positive. w27 Simplify (((((q/q14)/qq)/q)/q(3/8))(-25))(3/2) assuming q is positive. q(8625/16) Simplify y(y/(y/y(9/2))y)/yy(-1/3)(y/y2)(-31) assuming y is positive. y*(217/6) Simplify (i/(ii*(-1))i)*44/(ii(-5))(1/6) assuming i is positive. i(266/3) Simplify ((c(-20)/ccc7)(10/11))(-2/39) assuming c is positive. c(20/33) Simplify (((r/(r(2/5)/r))/r)/(r/((r(11/4)r)/r)))/(r(-1/5))(-1/46) assuming r is positive. r(1079/460) Simplify (((zz/(zz/(z(-2/5)/z))zz)(-3/26))(-14/9))13 assuming z is positive. z(7/5) Simplify ((n7n)/(n(n/n16)/nnn))/((n(4/7)/nn)/(n*(-2/17)n)) assuming n is positive. n(2536/119) Simplify u(-8)/(u/(uu(-20)))uuu*(3/8)uu(-33) assuming u is positive. u(-461/8) Simplify r/r(-1)r*(-1/16)(r4)(4/15) assuming r is positive. r(721/240) Simplify ((v(5/3)v)/v)/((v/((v/(vv*0v))/v)v)/v)(v/(v/v(-2/31)))/v15 assuming v is positive. v*(-1525/93) Simplify ((nn/(nn(-35)nn))/n)/n(-28)n/(nnn*(2/99)n)n/((nn*2)/nnn) assuming n is positive. n(5542/99) Simplify (x(2/9)/xx*(-9))/(((x/(xx(-24)))/x)/((x/x23)/x)) assuming x is positive. x(-502/9) Simplify (o(-1)o)(-10)/(o(-2)o(-13)) assuming o is positive. o15 Simplify (o/o(-1/10))/(o/(o/(o/((o(-33)/o)/oo)))o)(o(-1/16)/o)/(oo/(o/o(-28))) assuming o is positive. o(-717/80) Simplify (u(-3)/u(-1/5))/(u((uu/u*(-8))/u)/uu)29 assuming u is positive. u(-1464/5) Simplify (j*8j/(jj(-8))j)/((j*(-1/2)j)/(j/(jj(-2/9)))) assuming j is positive. j(301/18) Simplify ((oo*1o)(-5)/(o2/o(-2/13)))(3/2) assuming o is positive. o(-669/26) Simplify (h(-2))*(-2/67)h*12/((hhh(-2/15))/h) assuming h is positive. h(11249/1005) Simplify ((ll/(l/l*35l)l)/(l(22/3)/l))/((l/(((l(-1)l)/l)/l)l)/(l(-42)l)) assuming l is positive. l(-46/3) Simplify (v(1/2))*(-40)v*(-1/2)v5 assuming v is positive. v(-31/2) Simplify ((n0)(-21)/(n*(3/7)nn/(nnn(1/3)n)))(-9/4) assuming n is positive. n(-57/28) Simplify (k(-2/41)/k)/k15(k/(k/(k(-5)/k)k))/(((kk/(k/(k/((k(k/k*21)/kkk)/k))))/k)/k) assuming k is positive. k(-1724/41) Simplify ((g((gg28gg)/g)/g)/g)/g(-25)g*(2/3)gg/(g/g(-11)) assuming g is positive. g(134/3) Simplify u(-3/10)uu/(u(-1/2)u)(u/u(-1/3))/(u13u) assuming u is positive. u*(-172/15) Simplify ((kk/(k/(kk(-2/9)))k)(-5/18)/(k(-2)k)(-45))(1/20) assuming k is positive. k(-1483/648) Simplify (b/(((bb*(-10))/b)/b)b)*(2/17)/(b(b/(b*24/bb))/bbb(-14)) assuming b is positive. b(638/17) Simplify (((b(-1)/b)(-31))(3/16))(-25/4) assuming b is positive. b*(-2325/32) Simplify ((yyy(-18))/y)/y(-13)(y*(-2/3)y)/y(14/5) assuming y is positive. y(-97/15) Simplify ((d(-2/7))(2/129)/(d*(1/4)d(2/5)/d))(-1/44) assuming d is positive. d*(-6241/794640) Simplify (ww*38)/(((w/((ww*(-2))/ww))/w)/w)(w(14/5)/w)/(w((w/w*30)/w)/ww) assuming w is positive. w(349/5) Simplify ((d0/d)(-3/11)/(d(-3))29)49 assuming d is positive. d(47040/11) Simplify (f28ff(-3/8)/f)19 assuming f is positive. f*(4199/8) Simplify (dd/(dd(d(dd*(-2/3))/d)/dd)ddd(d/(d/(d(dd*(8/7)/dd)/dd)))/d)/(d10dd(1/2)) assuming d is positive. d(-281/42) Simplify (((w(-2))(-5/19))(-12))(-29) assuming w is positive. w(3480/19) Simplify ((bbb(-4/13))25)(-26) assuming b is positive. b(-1100) Simplify (a(1/16)aa(2/27))/((a/a(-2/9))/aa(-20)) assuming a is positive. a(9035/432) Simplify (a*(5/7)/aa)*36(a(a/(a2/a))/a)23 assuming a is positive. a(180/7) Simplify (z(-2/51)zz(zzz*23zz)/zzz)/(zzz/z(-11))(3/11) assuming z is positive. z(14666/561) Simplify (v(3/4))(-30)/((v(1/5)v)/v(-3/19)) assuming v is positive. v(-4533/190) Simplify ((ii(-2/3))/(((i(-4/5)i)/iii)/ii)(((iii/(i/((ii0/ii)/i))iii)/i)/i)(-29))(-1/19) assuming i is positive. i(1318/285) Simplify ((((p(p*8p)/p)/p)/(p/p(-1/12)))/(p(5/4)/(p(p(1/5)/p)/p)))(-38) assuming p is positive. p(-2774/15) Simplify ((o(o/(oo(1/7))o)/ooo/o*8o)(-43))(7/2) assuming o is positive. o*(1247/2) Simplify ((dd*3/dd/(d*(-1)dd))/(d/d(-2/5))(-29))(-8) assuming d is positive. d(-1744/5) Simplify (c(-3/8)cc5)/(c(1/4))(-25) assuming c is positive. c(95/8) Simplify (x(-1/2))(2/119)/(x/(xx(-4)))49 assuming x is positive. x*(-23325/119) Simplify ((z/(zz/z*(-6))zz/(z/(z/((zzz/(z/z9)z)/z))z)z)/(z(1/3))(3/40))15 assuming z is positive. z(-1923/8) Simplify (uu25)/(u/(u(-1/28)uu))u/u*(-25)uu((uu/(u(3/7)/uu))/u)/u assuming u is positive. u*(1527/28) Simplify ((tt*(1/2)tt)23/(t1)31)(-2/73) assuming t is positive. t(-99/73) Simplify ((y(-2/17)/((y/y(10/11))/y))27)(-17/3) assuming y is positive. y(-1332/11) Simplify ((s31s)/s)/s*(3/8)(sss(-4)/s)(2/49) assuming s is positive. s(11957/392) Simplify ((q/(q(1/15)/q))/q(-4/5))/((q/q8)/qqq)(-10/3) assuming q is positive. q(-259/15) Simplify p/(p/(pp(1/2)p))p/p(-30)p(p0p)/(p/(p/p(-2/3))) assuming p is positive. p(217/6) Simplify (v*(-3)/vv)*23/(vv/v*(-1/3)vv)21 assuming v is positive. v(-160) Simplify m(-20)m(mm*10m)/mmm(m/((m(m/m*(1/21))/m)/m))/((mmm14m)/m) assuming m is positive. m*(-440/21) Simplify ((z(z*(-7)z)/z)/z(-3/4))/(z/z15zzz/z(-4/3)) assuming z is positive. z(53/12) Simplify ((t(-1/5)t)/tt(-32))(1/2) assuming t is positive. t(-161/10) Simplify (((q/q(-1/3))/q)/q19)/(q/(qq/(qqq*(-10)qq))q/(q((((q/(q10/q)q)/q)/q)/q)/q)) assuming q is positive. q(-68/3) Simplify s/s11sss/s(-1)ss(s*9s)/s(2/9) assuming s is positive. s(52/9) Simplify (m/(m*(-6/7)/m)m/m(-10/3))/(m(-2/3)/((m/m(1/3))/m)) assuming m is positive. m(158/21) Simplify (k/(k/(k/k*37))k(-24))/(k(-5)/(k/(k*(1/37)/k)k)) assuming k is positive. k(-1925/37) Simplify ((q(-5)/q5)(-2/25))(-18) assuming q is positive. q(-72/5) Simplify (((k*(2/11)k)/k)/k)/kkk*3/kk(k/((kk(1/3))/k))(-20) assuming k is positive. k(-368/33) Simplify w/w8ww*12ww(ww(1/10))/wwww(1/5) assuming w is positive. w(103/10) Simplify (h(((h4/hh)/h)/h)/hh)(-6)/(h(-2)/hh(-10/11)) assuming h is positive. h(-155/11) Simplify r*(-4)(r*(3/2)/rrr)/r(rr(-14))/r(-5) assuming r is positive. r(-21/2) Simplify i/i(-2/17)ii(-2/7)(iii/i(-16/5))/i(-1/6) assuming i is positive. i*(29269/3570) Simplify ((oo(3/5))/((o/(o/o(-1/8)))/oo)oo(-1)o(oo6)/o)(-7/6) assuming o is positive. o(-2443/240) Simplify ((y(-2)y/((yy/y*(2/13)yyy)/y))/(y(2/9)/((((y/((y/(y/y1))/y))/yyy)/y)/y)))(29/5) assuming y is positive. y(-17197/585) Simplify (((zz(1/6)z)(-6/37))(-5/8))(-21) assuming z is positive. z(-1365/296) Simplify (uuu/u*(4/9)u/(u*(-33)u))/(u/(u/u*(-6/5))(u**(12/11)/u)/u) assuming u is positive.	{ "pile_set_name": "DM Mathematics" }
io - 1331. Suppose -2y - 5a + w = 0, -1 = a - 6. Is 17 a factor of y? False Let o(z) = 15z*3 - 2z + 7. Let t(y) = 14y3 - y + 6. Let d(b) = -4o(b) + 5t(b). Let s be d(-1). Let c = 33 + s. Does 4 divide c? False Let x(r) = r3 + 11r*2 + 3r + 15. Let m be x(-11). Let n = 23 + m. Suppose -s + 0s + 5g + 205 = 0, s + ng = 165. Does 18 divide s? False Suppose -5b + 1206 = -4z, -3z - 918 = -0b + 3b. Let u = -266 - z. Does 12 divide u? False Suppose -10976 = -2m + 1824. Suppose -4j = -4s - m, 0 = 3j - 8j + 4s + 8001. Is 16 a factor of j? False Suppose 13t + 1133 = 111789. Does 19 divide t? True Let x be 2 + 9/(-4) - 781/(-4). Suppose -3t - 575 = -1736. Let u = t - x. Does 48 divide u? True Does 36 divide 81/(-2)(54 + -92)? False Let d(v) be the second derivative of 22v*3/3 + 12v*2 - 2v + 11. Let l be d(4). Suppose 3w - 7w + l = 0. Is 7 a factor of w? False Suppose 2q = -2s - 2, 5q = -4s + 8q + 3. Suppose s = -6n + 2322 + 5094. Is n a multiple of 70? False Let c(x) = 15x2 - 192x + 81. Is c(18) a multiple of 13? False Suppose -4u - 5y - 16 = 0, -4u + 3y - 15 - 1 = 0. Does 10 divide (-241)/u + (-6)/(-8)? False Let a(m) = 10m2 - 174m + 4044. Does 2 divide a(23)? True Let x(z) be the third derivative of 1/120z6 + 13/24z*4 + 1/5z*5 + 0 + 0z + 8z2 + 0z*3. Is x(-10) a multiple of 15? False Let b(a) = 33a + 613. Is b(-4) a multiple of 2? False Let w(m) = -m*2 - m - 1. Let j be w(-2). Let o = 2 + j. Does 18 divide (o + 118/10)/(5/25)? True Let o(k) be the first derivative of 42k + 6 + 1/2k2. Does 14 divide o(0)? True Let s(y) = -408y - 864. Is s(-4) a multiple of 24? True Let s = -7331 - -15809. Is s a multiple of 9? True Let n(y) = -20y3 - 11y*2 + 42y + 370. Does 17 divide n(-13)? True Does 11 divide ((-12181)/39)/((20/5)/(-192))? False Let h(y) = 29470y - 814. Does 36 divide h(1)? True Let d(c) be the first derivative of -c4/4 + c2 - 26c + 24. Let q be d(0). Does 13 divide (q/(-3))/(-52/(-105))? True Let a(k) = -54k*3 - 2k*2 + 13k + 8. Is a(-4) a multiple of 20? True Suppose 15t - 19t + 4402 = 3j, 2j + 4 = 0. Does 29 divide t? True Suppose -10v + 4v + 570 = 0. Suppose -vh + 97h = 228. Does 19 divide h? True Let s = 10134 + 2758. Is 19 a factor of s? False Suppose -19t + 113 = -20. Let w(k) = 4k - 9. Let v be w(6). Let d = t + v. Is d a multiple of 22? True Let p(b) = b*2 - 15b + 3126. Is p(115) a multiple of 71? True Suppose 4n = -4a + 34590 + 50262, 5a - 106089 = 3n. Suppose -a = -15z + 3z. Is 23 a factor of z? False Suppose 5z - 18609 = -4m, z = -11m + 15m + 3741. Is 32 a factor of z? False Let p(b) = 42b2 - 976b + 31. Does 243 divide p(43)? True Suppose 0 = 4n - 3n - 60. Suppose 417 = 63x - nx. Does 5 divide x? False Let t = 33562 - 17354. Is 16 a factor of t? True Let c = -10649 + 17769. Suppose -24l + c = -16l. Is 18 a factor of l? False Let v(r) = -2r2 + 10r - 20. Let h be v(6). Let f = -33 - h. Is (f/21)/(64/(-30336)) a multiple of 58? False Suppose -301 - 29 = -10d. Suppose 35x - 136 = dx. Let h = x + -14. Does 27 divide h? True Let f = 1601 - -4924. Does 45 divide f? True Let n be 3/(((-20)/(-12))/(5/3)). Suppose -np = -4p + 135. Is 15 a factor of p? True Suppose 5c = -5o - 10, 3o + 3c + 9 = o. Suppose om = 151 - 118. Is 8 a factor of m? False Let d(i) = -893i - 587. Is 7 a factor of d(-5)? True Let b = 185 + 7. Suppose 2d - 3z - b = -0d, -5z + 10 = 0. Does 43 divide d? False Let y(s) = -s*3 + 45s*2 + 965s - 21. Does 2 divide y(-16)? False Let p = 34 + -7. Let c = p + -38. Let a = c + 101. Is a a multiple of 13? False Let u = 320 + -521. Let p = u - -353. Suppose 12 - p = -h. Is 38 a factor of h? False Let d(b) = -2b2 - 270b + 822. Does 6 divide d(-75)? True Let r(b) = -4b - 124. Let m be r(-32). Let o(j) = j2 + 16. Is o(m) a multiple of 29? False Let c(a) = 5a*2 - 89a + 1453. Does 45 divide c(22)? False Let o(f) = -f*2 + f + 1. Let k(p) = -4p*2 - 4p - 7. Let q(u) = k(u) - 3o(u). Let s be q(-5). Suppose sx + 123 = x. Is 22 a factor of x? False Suppose -3c + 8 = -j, c - 4 = 4c + 5j. Let p(z) = -c - 5z + 8 + 3. Is 8 a factor of p(-3)? True Let x = -9 + 306. Suppose 3t = -5c + 880, t = 3c - c + x. Is t a multiple of 41? False Is 24 a factor of (-134405)/(-70) + 11/(-154)? True Let z(g) = -g2 - 2g + 3. Let n be z(0). Let p(a) = 7 + na + 26a - 133a2 + 139a*2. Is p(-6) a multiple of 8? False Is 70 a factor of 2/(-8) - -161(-4059)/(-44) - -7? False Is (2 - (-72)/24) + 4/(4/261) a multiple of 5? False Suppose 0 = 4a + 26 - 2. Let u be a/(-27) + (-1720)/45. Let g = u + 52. Does 7 divide g? True Let b = 67 - 64. Let v(i) = -6i - 4i2 + b - 3 - 1 + i3. Is v(6) a multiple of 5? True Let t(q) = 266q*2 - 183q + 6. Does 34 divide t(4)? False Suppose -7c - 4137 = 14c. Let s = c + 485. Is 36 a factor of s? True Let f(s) = -48s3 + 1067s*2 + 14s - 4 - 1065s2 - 16s. Is 49 a factor of f(-2)? True Suppose y + x = 319, 11 = -3x - 4. Suppose 2g - 908 = y. Is 14 a factor of g? True Let g be (-12)/(-18)(-3)/1-30. Suppose -2t + 7t - g = 0. Is (-4)/(-6) - (-604)/t a multiple of 26? False Suppose 14j - 74 = 262. Let m = -27 + j. Is 4 a factor of (-5 - (19 + 1))m? False Let k(a) = a*3 + 48a*2 - 55a - 525. Is 45 a factor of k(-48)? True Let r(q) = 4q + q3 + 1321q*2 - 1326q*2 + 9 - 6q. Suppose -k = -3u + 9 - 0, -3 = 2k - 3u. Is r(k) a multiple of 6? False Let b be (3384/180)/(4/710). Suppose b = 9c + 124. Is 77 a factor of c? False Suppose -3b - 42 = -90. Suppose -29j - b + 1437 = 0. Does 7 divide j? True Let d = -52327 - -81052. Does 25 divide d? True Does 10 divide 7/1 - (-5)/((-25)/(-43665))? True Let j(i) be the third derivative of 0 + 0i + 2/3i*3 + 1/12i*5 - 12i*2 + 1/6i*4. Does 3 divide j(-2)? False Let c(a) = -539a + 44. Suppose 0 = -18w - 20w - 38. Does 11 divide c(w)? True Does 44 divide 1/3 - ((-589008)/432 + (-2)/9)? True Let p = -126 + 141. Suppose -p = -3g, -h = -4g - 301 - 37. Is 36 a factor of h? False Suppose 13p + 1523 - 6463 = 0. Suppose -60 = 2u - p. Is 10 a factor of u? True Suppose -1807c = -1789c - 77112. Does 68 divide c? True Let l(b) = b*2 - 18b + 32. Let k be l(12). Let w(u) = 16u - 4. Let o be w(5). Let f = k + o. Is 9 a factor of f? True Let u be (498/5)/(44/(-110)). Let d = 298 + u. Is 15 a factor of d? False Let i(v) = -1622v + 16. Let j be i(-1). Suppose 8n - j = 3882. Is 40 a factor of n? False Let p = -72 - -77. Suppose -2h - 4n = -11 - 17, 0 = -5h + pn + 145. Is 6 a factor of h? True Suppose 3l + 174 + 171 = 0. Let g = 175 + l. Suppose g = 2r + 3r. Does 12 divide r? True Let z = -2285 - -2582. Is 27 a factor of z? True Suppose -13b = 8 + 148. Is 23 a factor of (80/b)/((-316)/(-159) - 2)? False Suppose 2o = -3p + 776, -1289 = -3p - 2p + o. Let y be (37/(-13) - -3) + p/13. Is (15/y)/3 - 503/(-4) a multiple of 34? False Suppose 200k - 516k + 9106488 = 0. Is 18 a factor of k? True Let h(m) = -m3 - 29m*2 + 4m + 98. Let r be h(-29). Is 8 a factor of (-5607)/r - 3/(-6)? True Suppose 0 = 2693t - 2667t - 34944. Is t a multiple of 2? True Suppose 5w = k + 168794, 0 = 111w - 118w - 5k + 236350. Is w a multiple of 10? True Let j(h) be the first derivative of h*3 + 9h*2/2 + 9h - 60. Does 18 divide j(5)? False Let a(x) = 4x + 38. Let l be a(5). Suppose 8v - l + 2242 = 0. Is v2/(-2) - 3 a multiple of 15? True Let o = 524 + -738. Let j = o + 144. Let f = j + 143. Does 10 divide f? False Suppose x - 4o - 12907 + 541 = 0, 0 = 4x + 3o - 49616. Does 3 divide x? False Suppose 0 = -b + f + 15, -5f + 2 = -b - 3. Suppose 4g = -v - b, -3g - 38 = -4v - v. Is (g/4)/((-51)/(-60) + -1) a multiple of 7? False Let c be (-35626)/(-16) + ((-525)/(-56))/25. Suppose 2z + 15z = c. Is z a multiple of 39? False Let y(v) = -2. Let p(w) = -w*2 - 55w + 142. Let i(d) = p(d) + 4y(d). Is 14 a factor of i(-25)? False Let r = 46 + -41. Suppose 0 = 3z + rx + 19 - 84, 3z + x = 49. Suppose zy - 168 = 8y. Is 12 a factor of y? True Let s(w) = -w*3 + 9w*2 + 12w - 23. Let r be s(10). Let v be 1(r - (-54)/(-3)). Is 19 a factor of (19/3)/(4 - (-77)/v)? True Suppose 11j - 45 = 20*j. Let k(a) =	{ "pile_set_name": "DM Mathematics" }
- s for a. 4 Solve h = -1, y - 5h - 4 + 3 = 0 for y. -4 Solve -4r = -4s - 28, -568s + 570s - 49 = -5r for s. 2 Solve 5v - 5d = 13 + 12, -4 = 4d for v. 4 Solve -3n - w + 160 = 162, 2w + 14 = 4n for n. 1 Solve -o = 3r + 1, -4o - 12r = -7r - 3 for o. 2 Solve 239x + 18 = 241x - 4a, -2x = 5a + 9 for x. 3 Solve 0 = -l + 112 - 108, 35 = 3g + 5l for g. 5 Solve 3h - 6q - 6 = -5q, -2h - 2q = -12 for h. 3 Solve -2s - 4w = s + 13, 5s = -5w - 15 for s. 1 Solve 3m + 5u = u + 2, 4 = -5m - 3u for m. -2 Solve 17 = 5h + 5q + 22, 0 = 5q - 20 for h. -5 Solve 2m = 5 + 5, 2m - 2 = -4y for y. -2 Solve 4j + 18 = -5d, -9d + 13d + 2j = -12 for d. -2 Solve 0 = 5r + 5l - 20, -r = 2l - 9 + 4 for r. 3 Solve -19 = -2d + 3h + 2h, -5h = 15 for d. 2 Solve -3c + 2a = 6a + 9, 5c + 4 = -3a for c. 1 Solve -13v + 10v = -4r - 5, 3v + 3r = 12 for v. 3 Solve -5b - 25 - 25 = 5p, -45 = 5b + 4p for b. -5 Solve 0k - 2q = -3k - 2, -2q - 2 = -5k for k. 2 Solve 4w = 4n + 4, -5w - 8 - 27 = 5n for n. -4 Solve 3m + 2w - 1 = 0, -w + 41 = -5m + 60 for m. 3 Solve 11b - 10b + 4x + 10 = 0, 4 = 2b - 4x for b. -2 Solve 8t - 3t = -5s - 5, 5s = -3t - 3 for t. -1 Solve -1 = i - 3y - 3, 3y = 4i - 17 for i. 5 Solve l - 5 = 389i - 385i, 8 = 3l - 5i for l. 1 Solve -4z - 5 + 16 = i, -i - 16 = -5z for z. 3 Solve 2r = -3g + 3, -6r = -2g - r + 21 for g. 3 Solve 3d - 25 = 4f, -13 + 10 = -3f - 5d for f. -4 Solve 3k - 12 = -3u, 0 = -3u - k - 62 + 66 for u. 0 Solve 0 = 3h + 4y - 31, -3h + 18 + 9 = 3y for h. 5 Solve -7t + 2t = 3r - 20, -5r = 3t - 12 for t. 4 Solve 18o - 16o - 3 = -t, 3o = -3t + 12 for o. -1 Solve -4w = 2g - 10, 4w - 2w - 6 = 0 for g. -1 Solve 36d - 39d - 9 = -3v, 2v = -4d for v. 2 Solve -5v = -10, 0y + 5y - 16 = 2v for y. 4 Solve 0 = -56n + 52n + 5f + 16, -2f - 10 = 2n for n. -1 Solve 2r - 8 = 5f, -4r - r - 5 = 0 for f. -2 Solve 5d = 5u, 0d - 3u - 32 = 5d for d. -4 Solve -c = 4w - 13, -4w - w = -15 for c. 1 Solve -4h = 4t + 4, 4t + 103h + 16 = 102h for t. -5 Solve w - 8 = 2i, -3w + 4i = -17 - 3 for w. 4 Solve v = 4p - 16, -3p + 15 = -4v - 10 for v. -4 Solve 4q = 5q - 3, 0 = 2h - 5q + 9 for h. 3 Solve -5i - 12 = -3i + r, 4i + 28 = -3r for i. -4 Solve -3n - i + 6 = 0, -2i + 4 = -5n + i for n. 1 Solve -4z + 5u + 22 = -15, z - u - 8 = 0 for z. 3 Solve 5d + 20 = 5g + 6d, 4d = 0 for g. 4 Solve 53d + 4y + 14 = 52d, y - 6 = -5d for d. 2 Solve 0 = -31v + 34v - 2h - 3, -12 = -4h for v. 3 Solve -25 = -0l - 5l - 2c, -4l - 2c = -22 for l. 3 Solve 2t + 12p - 15p - 6 = 0, 3t - p - 2 = 0 for t. 0 Solve -h + 4j - 23 = 0, -18j + 15j + 9 = 2h for h. -3 Solve -4t - 4p - 16 = 0, 63p = -2t + 58p - 20 for t. 0 Solve -5r = z + 3, 0 = 2r - 0r + z + 3 for r. 0 Solve 5h = 3g - 14, g + 2h + 4 - 5 = 0 for g. 3 Solve -2k = 3h - 14, 4 = 3k - 5h + 2 for k. 4 Solve f - d = 0, -2f + 7 + 5 = 4d for f. 2 Solve -2m - 3m + 16 = -4o, m - 20 = 5o for m. 0 Solve -2w - 13 + 35 = -5t, -14 = 4t + 2w for t. -4 Solve 5g = -12u + 13u - 12, 0 = 4u + 4g for u. 2 Solve -7 = -3m + 4x, 2m = 4x - 1 + 3 for m. 5 Solve 2r + 0w = 2w - 10, -3w = r - 3 for r. -3 Solve 0 = -y - 38i + 35i + 11, 3y + 2 = -2i for y. -4 Solve 8k - 6 = 6k + 2w, 0 = -k - 3w - 9 for k. 0 Solve 4g + 8 = 0, 4i + 150g = 147g + 10 for i. 4 Solve 0 = s - 5, 2 = -2u + s - 3 for u. 0 Solve 17 = m + 5u, 5u = 2m - 7m + 5 for m. -3 Solve 0 = 2q - z + 6, -15q + 5z = -20q for q. -2 Solve 4m - 20 = 0, 3o + m - 2m + 2 = 0 for o. 1 Solve 2 = -2n + 4l, 2n - 10 = -3n - 5l for n. 1 Solve 22x - 5n = 20x + 33, 3x = -5n - 13 for x. 4 Solve -3o + 0p - 3p = 0, -2o = -3p + 10 for o. -2 Solve -4b - 5x + 10 = 0, x + x = -4 for b. 5 Solve 2q = x + 4, 3x + 3q = -x + 17 for x. 2 Solve 0 = 5i + j - 17, -17i + 22i - 5 = 5j for i. 3 Solve 5u = 3l + 31, 4l + u = 7l + 11 for l. -2 Solve -20 = 5y + 3x + 4, 0 = -5x - 15 for y. -3 Solve 0 = 5q + 33 - 23, -5x + 31 = -3q for x. 5 Solve 5c = 5, -c + 16 = -v + 4v for v. 5 Solve 5k - 25 = -0i - 4i, 2k - 3i + 13 = 0 for k. 1 Solve -q - 12a + 7a = -6, -5a + 2 = -3q for q. 1 Solve 0 = -3l - k - 2, -3l - 11k = -7k + 8 for l. 0 Solve 0 = -5b + 2s - 19, -6b = -2b - 2s + 14 for b. -5 Solve 4v - 260 + 270 = 2c, 2c + 2v = -2 for c. 1 Solve 0 = 4l + 4i - 3i + 13, -22 = 4l - 2i for l. -4 Solve 4d = 5s - 27 + 45, 5s + 5d = 0 for s. -2 Solve -5d + 3d + 11 = -3j, 3d + 3j - 9 = 0 for d. 4 Solve -4b + 13 = -7t + 2t, -4t = 3b - 2 for b. 2 Solve 0 = -l + 5b - 13, -3l - 4b = -2b + 5 for l. -3 Solve -6u + n + 17 = -u, 31 = 4u + 5n for u. 4 Solve -b - 3o = 11, -3o = 4b - 21 + 20 for b. 4 Solve 4v - 4l = 6v - 10, 2l - 23 = 5v for v. -3 Solve -4y = 12, 2y - 3 = 4t + 3 for t. -3 Solve 0 = y - 2v + 6, 2v + 6 = -5y - 0v for y. -2 Solve -s - 7 = 4j, 3s + 7 = -5j - 0j for s. 1 Solve 4v + 41 = 4r - 9r, 3r + 15 = 0 for v. -4 Solve x - 20 = 4h, x - 3x = 3h + 15 for h. -5 Solve 0 = 3n + 5h + 6, -2h + 2 = -n for n. -2 Solve 0 = -b + 2l - 11, 0l - 11 = 5b + l for b. -3 Solve -5c = k + 23, 0 = 23c - 21c - 2k + 2 for c. -4 Solve -4i - 2k + 3 = -9, -k = -3i + 9 for i. 3 Solve 2v - 8 - 2 = -5n, 5v = -3n + 6 for v. 0 Solve 3x + 17 = -0x - 5d, -13 = 4x - 3d for x. -4 Solve z - 4 = 2o, -z + 8o + 8 = 5o for z. -4 Solve -3i - 7 = -5y, 0 = i + 9y - 11y + 3 for i. 1 Solve 4n - 2l + 6 = 0, 2n + 5l = -0 - 33 for n. -4 Solve -4v - 1236x + 1234x - 18 = 0, 3v + x + 12 = 0 for v. -3 Solve -5w + 16d = 21d + 50, -22 = 3w + d for w. -6 Solve -5 = 5t + 3c + c, -3c - 4 = 4t for t. -1 Solve -3s - 4l = -15, -16s + 5 = -15s + 4l for s. 5 Solve -28o + 2 = -2q - 30o, 2q + 11 = -5o for q. 2 Solve -9 = -3v, -v = -2l - l for l. 1 Solve -4y = -4, 13u + 3y - 2 = 66 for u. 5 Solve -5d + 3d = -4l - 8, -5l - 21 = 3d for d. -2 Solve 0 = 3a - 4h - 25, 46a - 51a + 5h + 35 = 0 for a. 3 Solve -g + 5d = 7d + 9, 8 = -2g + d for g. -5 Solve 0 = 3g - 12, 0 = -5m - 3g + 7 - 5 for m. -2 Solve 2m + 10 = -5h, 5h = -5m + 4h + 21 for m. 5 Solve 5 = 3o - 4z, -3o - 30z + 11 = -28z for o. 3 Solve -4 + 5 = t + 5n, 0 = -4n for t. 1 Solve -o + 4l = -29 + 9, -4l = 3o + 4 for o. 4 Solve -v - 4v = -f + 16, 2v + 24 = -4f for f. -4 Solve -2q = 4a + 14, 0 = q - a - 0 - 8 for q. 3 Solve 0 = -2p + h - 1, -p - 2h = 2h - 13 for p. 1 Solve 0 = s + k + 6, 0 = 2s - 5k + 104 - 127 for s. -1 Solve p = b + 3, 4b - 8 = 7b - 2p for b. -2 Solve -74z - 10 = 5g - 79z, g = 5z - 18 for g. 2 Solve 14 = 3z + 4w, 0z - 14 = -4z - 3w for z. 2 Solve -18 = h - 4t - 43, -t = 5 for h. 5 Solve 2p + 5h = -15, -2p - h - 3h = 12 for p. 0 Solve -4z = 3n - 27, n - 40 = -35 for z. 3 Solve 2x = -4i + 20, 4i + 5x - 2 = 6x for i. 2 Solve -2m - 12 = 2m, -5m = 2i + 21 for i. -3 Solve -f - 19 = -4s, 10f - 6f + 12 = 0 for s. 4 Solve z = -3, z - 7 = -5x + 5 for x. 3 Solve 3j = 4k - 3, -j = -11k + 13k + 1 for k. 0 Solve 5b - 30 = 5t, -2 = 5b + 5t - 22 for b. 5 Solve -16c = a - 18c - 7, 0 = 4a - c for a. -1 Solve 5a - 11 = 2q, -9a + 10a + 7 = 5q for a. 3 Solve 4p + 2d + 2 = 0, 2p + 3d + 0 - 1 = 0 for p. -1 Solve 3a + 3l - 6 = 0, 3a + 4l - 2l = 6 for a. 2 Solve -2f - 6 = -2x - 10, -3x = 2f - 14 for x. 2 Solve -1 = -2r + i + 7, 2r + 3i = -8 for r. 2 Solve j = 3o - 16 - 4, 5o + 5j = 0 for o. 5 Solve -5a - 4b - 12 = 0, 0 = a + 2a - 3b + 18 for a. -4 Solve 3j - 2 = -4a - 17, 2j - a - 1 = 0 for j. -1 Solve 4s - 3p + 12 = -p, -5p = -3s + 5 for s. -5 Solve 6p + 4 = -4t + p, 0 = 5t + 5p for t. 4 Solve 2m + f + 11 = 0, -5m - 4f - 25 = 10 for m. -3 Solve 9 = -3b - 3f, -4b - 12 = 6f - f for b. -3 Solve -5n + 2n = 2z - 16, 3z - n = 2 for z. 2 Solve -3l + m + 20 = 0, 2l - m = 5 + 10 for l. 5 Solve -25 = 5c - 16l + 11l, 20 = 5l for c. -1 Solve -1 = -o - 5m, -o + 1 = -m + 2m for o. 1 Solve 2w + 2c = -12, 8c = -3w + 6c - 15 for w. -3 Solve -4h + 2p = 6, 0 = -2h - h + 2p - 2 for h. -4 Solve 10 = 4z + 2r, 2r = -0z + z for z. 2 Solve -2y - 2 = -2*	{ "pile_set_name": "DM Mathematics" }
e. q*(96/7) Simplify (uu*(-3))/(uuuuu1u)(uu/((uuu0)/u))(-3/32) assuming u is positive. u(-259/32) Simplify (z(-6)/(zz16))(-30) assuming z is positive. z690 Simplify (l37l)/l(7/3) assuming l is positive. l(107/3) Simplify u(1/8)/(u/u0)((((uu*(1/4))/u)/u)/u)/uu(3/4) assuming u is positive. u(-23/8) Simplify ((n(((n/(((n(nn(-3)n)/nn)/n)/nn))/n)/n)/n)(2/51))(-3/47) assuming n is positive. 1 Simplify (t/(t/t2))45tt/(t/(tt(-5)t))t(-2/9)t assuming t is positive. t*(799/9) Simplify ((w((w(w0/w)/ww)/w)/ww)18)(-1/9) assuming w is positive. 1 Simplify mm*(-5/6)/mmm(3/4) assuming m is positive. m(11/12) Simplify (b(-2/5))(-16)b*(1/3)bbb*(3/7)/bb assuming b is positive. b*(962/105) Simplify z/(zz/(zz(-20/3)/zz))z(1/23) assuming z is positive. z(-457/69) Simplify (l/l(-1/15))(-12/17) assuming l is positive. l(-64/85) Simplify (((y/(yy*(-1)y)y)/y)/y)(-3/7)/(y(2/7))3 assuming y is positive. y(-3/7) Simplify (ss(-15))11 assuming s is positive. s(-154) Simplify (v(-2/11)v10)(2/13) assuming v is positive. v(216/143) Simplify f(-13)f29 assuming f is positive. f16 Simplify v*45v(-16/5) assuming v is positive. v(209/5) Simplify (t*0t)(3/2) assuming t is positive. t(3/2) Simplify ((n((n(n/(n/(n/(nnn(n7/n)/nn)n)))/n)/n)/n)/n)/((n/(nn*(-3/8)/n)n)/n)(n(-2/5)n)(2/15) assuming n is positive. n(-2059/200) Simplify (yy(1/6)/y)(-42) assuming y is positive. y(-7) Simplify ((kkk/k(-3/5))/k(-10))/(kkkk*(-2)/kkk2k) assuming k is positive. k(48/5) Simplify ((b/b(-2/7))/(b(-1/4)/b))22 assuming b is positive. b*(781/14) Simplify (cc/((c/c*(3/8)cc)/c))(-4/23) assuming c is positive. c(-3/46) Simplify (f(-1/25)f)/(f/f(-9)) assuming f is positive. f(-226/25) Simplify v/v*(-17/5)v(-22) assuming v is positive. v(-88/5) Simplify (o(-2)/o(-5/9))27 assuming o is positive. o(-39) Simplify d*13/dddd/(ddd*(-2/15)/ddd) assuming d is positive. d(182/15) Simplify mm/m*1mmm7 assuming m is positive. m10 Simplify (((k1/k)/k)/k)(-1/25)k/(k/(k/(kk*(-2/3))))k*(2/3)k assuming k is positive. k(181/75) Simplify ((z/(z/(((z(-2)/z)/z)/zzz)))(-48))(-1/33) assuming z is positive. z(-48/11) Simplify y2yyy(-2)((y((y(-1)y)/y)/y)/y)40 assuming y is positive. y(-78) Simplify (h(-1)/h)43((((h/(h/(h(-1)/hh)))/hh)/h)/h)/h3 assuming h is positive. h(-92) Simplify (c(-1)cc)(-4)/(c0c)(-12/7) assuming c is positive. c(-16/7) Simplify (c*(2/9)(c/(cc/(cc*(-2/5))c)c)/c)/(cc*(-1/3)c(-3/5)) assuming c is positive. c(-56/45) Simplify (pp(-3/16))/(pp((p/(p/(((p2pp)/p)/p)))/p)/pp) assuming p is positive. p(-35/16) Simplify (i(2/17)ii(-1/6))45 assuming i is positive. i(1455/34) Simplify (h6h/(h(hh(-1/3))/h))/(h(-2/21)/(h/(hh(3/2)))) assuming h is positive. h(69/14) Simplify (u(2/9)/u)(-1/25) assuming u is positive. u*(7/225) Simplify bb*(-18)/bbbb(2/21) assuming b is positive. b(-334/21) Simplify nn(1/8)nnnn/(nn(n(5/2)/n)/nnn)n assuming n is positive. n(13/8) Simplify (p(-2/7))*(23/2)(p/p*(-2/7)p)(-5/6) assuming p is positive. p(-109/21) Simplify (g(-2/3))(-25)/((g*(-4/5)/g)/(g/(gg*(-3/4)gggg))) assuming g is positive. g(913/60) Simplify (c(-1/5)c)(33/5)/(c9/(c/(cc/(cc7)))) assuming c is positive. c(82/25) Simplify (v1/v)33(v(2/9)/v)/v(-3) assuming v is positive. v(20/9) Simplify (g(-1/6)gg(1/8))/(g/(g/(g/g3))ggg*(-7)g) assuming g is positive. g(167/24) Simplify (a(-1)a)(-25)(aa(-2/9))46 assuming a is positive. a(322/9) Simplify ((v/(v/((vv/(((((v/(vv(-1/2)vv))/vv)/v)/v)/v)v)/v)))/(v/v(3/10)))/(v(-6/11)/(v/v(3/2))) assuming v is positive. v(643/110) Simplify ((a/a(1/6))/a2)(2/35) assuming a is positive. a(-1/15) Simplify i16i11 assuming i is positive. i27 Simplify (ll(1/11)/l)/((ll(-18))/l) assuming l is positive. l(199/11) Simplify ((rr/((r/(rr*(-5)))/r)r)/((r/(r(-3/8)/r))/r))/(r4/r(-3)) assuming r is positive. r(-75/8) Simplify (g3)38 assuming g is positive. g114 Simplify w/(w/((w21w)/w))w/((w/w*10w)/w) assuming w is positive. w*31 Simplify (bb*(-5))/bb(-2/27) assuming b is positive. b(-137/27) Simplify (o/((oo/o(-36))/o))/o18 assuming o is positive. o(-54) Simplify (q(-1/4)/qq)(-2)/(q(-6)q(q/q(3/4))/q) assuming q is positive. q(25/4) Simplify (s*(-9)s/((s/(ss(6/13)))/s)s)/(ss(-7)((s/s*(2/15)s)/s)/s) assuming s is positive. s(116/195) Simplify a(-11)(aa*(-15)a)/a assuming a is positive. a(-25) Simplify (d(-1)/((d/d*(5/2))/dd))(4/15) assuming d is positive. d(2/15) Simplify ((d/(dd(-13)))/d)/dd/(d/((d/(dd(1/28)))/dd))d assuming d is positive. d(335/28) Simplify ((t/((tt/((((t(t/(t/t(-19)))/tt)/t)/t)/t))/t))/(t/t10))(1/5) assuming t is positive. t(-12/5) Simplify g(25/4)/(g/((g*20g)/g)) assuming g is positive. g(101/4) Simplify g/g24g(gg25)/g assuming g is positive. g3 Simplify (q(-12))(-4) assuming q is positive. q48 Simplify ((q(1/2)q)/q2)/(q1)(-49) assuming q is positive. q(97/2) Simplify kk(-37)k(7/5) assuming k is positive. k(-173/5) Simplify s(-46)/(s(-2/57)s) assuming s is positive. s(-2677/57) Simplify (w5/www(ww/(ww(-2/25)))/w)(-12) assuming w is positive. w(-1824/25) Simplify (p(-1/2)p4)/(((pp/p6)/p)/p1) assuming p is positive. p(19/2) Simplify (g25g)/(gggg(7/3)) assuming g is positive. g(62/3) Simplify ((i/(ii(-2/3)/i)i)/i)*26i*(-5)/(i/((i/((ii/((i/(i(ii*(-6/7)ii)/i))/i)ii)/i))/i)) assuming i is positive. i(676/21) Simplify (((d/d(1/2))/dd)/((d/(d/d*(-1/6))d)/dd))/((dd/d*(-7)d)/(d(d/d0)/d)) assuming d is positive. d(-28/3) Simplify ((d/(d4/d))/dd(d/((d/(d/(d(2/29)/d)))/dd))/dd)17 assuming d is positive. d(-34/29) Simplify (w/w(-6))/w(2/7)w*(-7)/(ww(3/7)/w) assuming w is positive. w(-5/7) Simplify (((x/(x/(x*2x))x)/x)(-17))17 assuming x is positive. x(-867) Simplify ((i/((ii(-2/3)/i)/i))/i(-1))/(i/(i/(i/i*(-1/3)))(i/(i(i/(i2/i)i)/i))/ii) assuming i is positive. i(7/3) Simplify ((u(2/9))(1/2))20 assuming u is positive. u(20/9) Simplify ((i/(i/i(-4/5)))/i)(-2/19) assuming i is positive. i(18/95) Simplify aa*1/aaaa26 assuming a is positive. a29 Simplify (pp(-1))(-35) assuming p is positive. 1 Simplify u(-4)uu(-1/16)uuu assuming u is positive. u*(-1/16) Simplify z/((zz*2)/z)zzz*(8/3)zz(-4/7)z*4z assuming z is positive. z(191/21) Simplify (((c(-8)/cc)/c)/c)/(cc(cc(-6))/c) assuming c is positive. c(-6) Simplify (d*(-6/17)/d)/dddddd(-4) assuming d is positive. d(-40/17) Simplify x/x*(-1/4)x(3/7) assuming x is positive. x(47/28) Simplify b*(1/11)/(bb(1/34)) assuming b is positive. b(-351/374) Simplify (k/((k/(k*(1/4)k))/k))*37/(k/(k/(((kk*(3/5))/k)/k))k)24 assuming k is positive. k(1377/20) Simplify (mm(-2/29)/m)/((m42m)/mm) assuming m is positive. m(-1249/29) Simplify ((pp*(1/4)p)/p)*16/(pp*6pp/((p9/p)/pp)) assuming p is positive. p19 Simplify ((h0h)(1/36))(8/5) assuming h is positive. h(2/45) Simplify ((g/(g(-1/10)g))/g)/g(1/10) assuming g is positive. 1/g Simplify (v/(v(-3/11)/v))(2/7) assuming v is positive. v(50/77) Simplify x/(x*(8/9)/x)xxx*(-41)/xx assuming x is positive. x(-341/9) Simplify (f(2/9))(-47)/(f(-2/5))(-34) assuming f is positive. f(-1082/45) Simplify (ssss(2/3)s(-21))(23/3) assuming s is positive. s*(-1196/9) Simplify (bb*(6/5)b(7/3)/b)(-16) assuming b is positive. b*(-848/15) Simplify (ddd0/d)(-15)/((ddd(8/5)ddd)/d(-2/5)) assuming d is positive. d(-22) Simplify q/(q/q*(-4/9)q)q3(q(1/2)/q)/(q6q) assuming q is positive. q(-107/18) Simplify ((mmm(-1/8)mmm)/mmm(-2/27))45 assuming m is positive. m**(5185/24) Simplify (	{ "pile_set_name": "DM Mathematics" }
years. 714087.9 How many nanometers are there in 0.5718607 micrometers? 571.8607 How many days are there in 85.590891us? 0.0000000009906353125 How many minutes are there in 1.5767595us? 0.000000026279325 How many decades are there in 50543.71 years? 5054.371 How many centuries are there in 0.038035 decades? 0.0038035 Convert 31.05087 decades to years. 310.5087 Convert 22.533492 milliseconds to minutes. 0.0003755582 Convert 341956.1 millilitres to litres. 341.9561 What is 1/100 of a litre in millilitres? 10 What is 62905.57nm in millimeters? 0.06290557 Convert 0.6016116 millennia to months. 7219.3392 What is 43/2 of a litre in millilitres? 21500 How many years are there in 13/5 of a decade? 26 How many millilitres are there in 11/4 of a litre? 2750 How many centimeters are there in 84.77121mm? 8.477121 Convert 8.075125 millennia to centuries. 80.75125 What is eleven quarters of a year in months? 33 What is 461.49138 minutes in days? 0.320480125 What is 3/10 of a day in minutes? 432 What is 332.76744ns in days? 0.000000000003851475 How many kilometers are there in 2.759594 centimeters? 0.00002759594 How many centimeters are there in 6/25 of a meter? 24 What is 9565.807 kilograms in tonnes? 9.565807 How many months are there in 3/25 of a century? 144 How many kilograms are there in 74.66329 milligrams? 0.00007466329 What is 7.622312l in millilitres? 7622.312 What is 3/40 of a meter in millimeters? 75 How many millimeters are there in 965406.4 meters? 965406400 What is 9967.528 centimeters in nanometers? 99675280000 How many millilitres are there in fourty-five halves of a litre? 22500 What is 0.8915727 tonnes in kilograms? 891.5727 How many months are there in fifty-five sixths of a century? 11000 Convert 63.02674 millimeters to kilometers. 0.00006302674 What is 3.75138nm in meters? 0.00000000375138 What is eleven tenths of a litre in millilitres? 1100 What is 9973.637ug in kilograms? 0.000009973637 What is 3/8 of a meter in millimeters? 375 What is 8/25 of a litre in millilitres? 320 What is nineteen quarters of a millennium in years? 4750 Convert 0.0198277um to nanometers. 19.8277 How many millimeters are there in three tenths of a centimeter? 3 Convert 154.8999 millennia to years. 154899.9 What is 451.181682 minutes in weeks? 0.0447600875 Convert 6998.768 years to months. 83985.216 Convert 133.58 millilitres to litres. 0.13358 How many decades are there in 15.7008 centuries? 157.008 What is nineteen quarters of a hour in minutes? 285 How many minutes are there in 42.25153 days? 60842.2032 What is 940036.5mm in centimeters? 94003.65 What is 2.261252 weeks in minutes? 22793.42016 Convert 4.9157748 milliseconds to hours. 0.000001365493 What is 11/2 of a gram in milligrams? 5500 Convert 170849.8 millilitres to litres. 170.8498 What is 13/5 of a meter in centimeters? 260 Convert 518149.6m to millimeters. 518149600 How many grams are there in 0.6267115mg? 0.0006267115 Convert 75514.2318 seconds to weeks. 0.1248581875 How many nanometers are there in 1/10 of a millimeter? 100000 How many kilometers are there in 3392.32mm? 0.00339232 How many millilitres are there in 21/4 of a litre? 5250 What is 45.2511 grams in micrograms? 45251100 How many seconds are there in four thirds of a minute? 80 Convert 198455.04 minutes to hours. 3307.584 What is 445.5561 hours in microseconds? 1604001960000 How many minutes are there in 15123.62 hours? 907417.2 How many centimeters are there in 1/5 of a meter? 20 How many minutes are there in seven fifteenths of a hour? 28 How many decades are there in three fifths of a millennium? 60 What is 3/40 of a millimeter in nanometers? 75000 How many nanometers are there in 11/2 of a micrometer? 5500 How many decades are there in 867708.5 years? 86770.85 Convert 4.194321 millimeters to meters. 0.004194321 How many microseconds are there in 492539.2 days? 42555386880000000 Convert 29.29284t to kilograms. 29292.84 What is two ninths of a week in minutes? 2240 What is 977.5376 millennia in decades? 97753.76 What is 9.990527 centuries in years? 999.0527 How many milliseconds are there in four fifteenths of a minute? 16000 Convert 45307.95 tonnes to grams. 45307950000 How many nanoseconds are there in 13/4 of a microsecond? 3250 Convert 241814.5 milligrams to grams. 241.8145 What is 75/2 of a gram in milligrams? 37500 How many nanometers are there in five eighths of a micrometer? 625 How many millennia are there in 97728.7 decades? 977.287 How many kilometers are there in 0.6452345nm? 0.0000000000006452345 How many micrograms are there in 27/2 of a milligram? 13500 What is nineteen quarters of a gram in milligrams? 4750 How many decades are there in six fifths of a millennium? 120 How many micrograms are there in sixty-three eighths of a milligram? 7875 How many micrograms are there in 18/5 of a milligram? 3600 What is 9/10 of a day in seconds? 77760 How many centimeters are there in 0.6493781km? 64937.81 Convert 48.20017 grams to tonnes. 0.00004820017 What is 6475.452 decades in millennia? 64.75452 How many grams are there in 11/10 of a kilogram? 1100 What is 1078.101 milligrams in nanograms? 1078101000 What is 8/3 of a day in hours? 64 What is three eighths of a kilometer in meters? 375 What is ten thirds of a century in months? 4000 What is 26948.616 months in decades? 224.5718 What is 47/4 of a micrometer in nanometers? 11750 What is 82.93697 kilometers in centimeters? 8293697 What is 3/8 of a kilometer in meters? 375 How many hours are there in fifteen quarters of a week? 630 How many millilitres are there in 45/4 of a litre? 11250 How many micrograms are there in thirty-two fifths of a milligram? 6400 How many hours are there in 314989.2 minutes? 5249.82 What is fourty-nine quarters of a micrometer in nanometers? 12250 What is 3/32 of a kilogram in milligrams? 93750 How many tonnes are there in 80.7998mg? 0.0000000807998 How many nanograms are there in 81064.83kg? 81064830000000000 What is four fifteenths of a decade in months? 32 What is 91.49806 tonnes in grams? 91498060 What is 2/75 of a millennium in months? 320 How many nanograms are there in 19/4 of a microgram? 4750 Convert 1255.512 tonnes to nanograms. 1255512000000000000 Convert 22.71018 milligrams to tonnes. 0.00000002271018 What is 414.5011 kilometers in meters? 414501.1 What is 8.026028us in nanoseconds? 8026.028 How many minutes are there in 1/45 of a week? 224 Convert 6.146304 millilitres to litres. 0.006146304 How many millilitres are there in one tenth of a litre? 100 What is 1/6 of a minute in seconds? 10 Convert 24.19198kg to micrograms. 24191980000 What is 8.383594cm in kilometers? 0.00008383594 How many months are there in eight thirds of a year? 32 Convert 7813.65cm to nanometers. 78136500000 How many months are there in 0.0477693 millennia? 573.2316 What is 171995.2 litres in millilitres? 171995200 How many millilitres are there in twenty-one fifths of a litre? 4200 What is twenty-seven halves of a micrometer in nanometers? 13500 What is one quarter of a litre in millilitres? 250 What is 0.4187728l in millilitres? 418.7728 What is 881.42mg in grams? 0.88142 How many seconds are there in 51/5 of a minute? 612 How many kilograms are there in 21/8 of a tonne? 2625 What is 3/5 of a litre in millilitres? 600 How many days are there in 261.2164 weeks? 1828.5148 What is one quarter of a kilometer in centimeters? 25000 How many kilograms are there in eleven halves of a tonne? 5500 What is one quarter of a kilogram in grams? 250 What is thirty-one fifths of a decade in months? 744 What is nine tenths of a litre in millilitres? 900 What is 3/40 of a litre in millilitres? 75 What is 37/2 of a gram in milligrams? 18500 What is 11/8 of a litre in millilitres? 1375 How many grams are there in 283.3658 tonnes? 283365800 How many nanograms are there in one tenth of a milligram? 100000 Convert 7.552013cm to micrometers. 75520.13 Convert 363.77523 minutes to weeks. 0.0360888125 How many litres are there in 3187.928ml? 3.187928 Convert 592099.8l to millilitres. 592099800 What is fifty-seven fifths of a meter in millimeters? 11400 What is 9.425853km in meters? 9425.853 Convert 29944.88 years to decades. 2994.488 What is 1916875.8ns in hours? 0.0000005324655 Convert 57.90	{ "pile_set_name": "DM Mathematics" }
12 + (-4 + 0 + 2)(-u - u + 3u) + 4u + 12u + 10u + u + 2u - u in the form s + fu and give f. 95 Rearrange 5008 + 420r - 2514 - 2499 to the form y + sr and give y. -5 Rearrange 4270 - t + 7229 - 2857 + (3 - 2 + 1)(-2t + 5t - 5t) to x + at and give a. -5 Express (-4 - 6 + 5)(2149g + 626 - 626 + 1229g) as kg + c and give k. -16890 Rearrange 208c + 5092c*2 - 227c + 19c to x + nc + rc2 and give r. 5092 Rearrange -19168i + 93174477 - 93174477 to the form h + di and give d. -19168 Express 26q3 + q2 - 128q3 - 148q*3 + 5 - 331q*3 in the form dq*2 + l + xq + mq3 and give l. 5 Express -8 + 8 + 55l*2 + (-4l + l + 2l)(0l + 4l + 2l) + (-4 + 4l + 4)(-3l + 1 + l - 2) as bl + xl*2 + w and give x. 41 Express (0 - 8 - 4)(34 + 14z - 32 - 18) in the form w + dz and give w. 192 Express 4q2 - 108q - 2q2 - 51q*4 + 5q*4 - 108q + 214q in the form vq + iq2 + p + uq*4 + yq*3 and give u. -46 Rearrange (-1 - 2 + 4)(3d - 3d - d) + (-1 - 1 - 2)(-712d - 85d - 1204d) to cd + a and give c. 8003 Express -122y - 104y + 7 + 2y*3 + 7 + 225y + 72y4 as i + zy*3 + sy*2 + by + xy4 and give b. -1 Express (-3d3 - 811 + d3 + 1007)(-20d + 14d + 19d) as o + fd3 + sd + td4 + pd*2 and give s. 2548 Rearrange 642y*2 - 306y*2 + 4 - 342y2 - y4 + 5y - 2y*3 to vy*3 + j + py*2 + gy*4 + xy and give j. 4 Rearrange -4t2 + t2 + 206 - 10t*2 + 3t - 209 + t*2 to ct*2 + xt + b and give c. -12 Rearrange (-5p3 + 18p*2 - 18p*2)(397p + 316p - 83p) to up*2 + gp + k + lp4 + xp*3 and give u. 0 Express 27974152k + 13 - 3 - 27974063k as jk + t and give t. 10 Express (-729s + 220s - 2031s)(s + 0 + s - 2) as ds2 + a + cs and give d. -5080 Express 7c - 823c*2 + 0c + c*4 + 822c*2 + 93c*3 - 5c as qc3 + i + hc + wc2 + sc*4 and give h. 2 Express -47337p + 95481p - 47758p as bp + t and give b. 386 Rearrange (-3d + 38d2 + 3d - 809d2)(6d + 3d + d + (-d - 2 + 2)(0 + 2 - 3)) to td*2 + sd + bd3 + y and give b. -8481 Express -96 + 3f - 2f3 - 126f*2 + 116f*2 - 2f3 - f4 + 3f4 + 97 as bf*4 + pf + kf2 + g + rf*3 and give b. 2 Rearrange -5b*2 + 2 + 3b*2 + 91b + 39745b4 + 39742b*4 - 79491b*4 to the form db*3 + i + ab*4 + wb + pb2 and give a. -4 Rearrange 203n + 2882n - 173n + (4 - 4 - 2)(3 - 3 - 6n) + n - 2n - n to ln + b and give l. 2922 Rearrange -2159x + 6373x - 1127x to tx + m and give t. 3087 Rearrange 70r2 + 6 - 482r - 4 + 123r2 + 481r to mr2 + a + gr and give m. 193 Express (0 + 0 - 1)(-1 + 1 + 2w) + 212w - 619w - 842w + 3w + 41 - 41 in the form bw + o and give b. -1248 Rearrange 234q*3 + 7q*4 - 229q*3 - 3q*2 - 43 + 44 to the form gq*4 + wq*2 + h + zq*3 + xq and give g. 7 Rearrange (-5i + 5i - 7i)(-3i + i2 + 3i)(-2 + 1 + 3 + (2 - 5 + 1)(-3 - 1 + 5) - 77 - 37 - 55) to zi + y + mi*3 + ki*2 and give m. 1183 Express 4000v*2 + 4050v + 4050v - 8100v as c + wv2 + mv and give w. 4000 Rearrange -460r - r2 + 449r*3 - 54r*3 + 462r to the form yr2 + o + ur + kr3 and give u. 2 Express (-3j - 4j + j)(-553j + 335j - 1 + 381j)((0 + 0 - 2)(1 + 2 - 2) + 1 - 4 - 2 - 2 + 0 + 1) in the form lj*2 + z + dj and give l. 7824 Rearrange (2229u + 1578u - 3282u)(1 - 4 - 9) + (-2u + 0u + 4u)(1 - 1 - 1) to the form f + zu and give z. -6302 Express (-2f + f*2 + 2f)(527f - 14462 + 14462)((-f + 0 + 0)(-2 + 0 - 1) - 2f + 4f - 3f) as uf*4 + af*2 + jf*3 + d + if and give u. 1054 Rearrange 5 + 0u + 4u - 3 - 920u3 + 1503u*3 to the form du*2 + wu*3 + j + ku and give w. 583 Rearrange (3n3 + 3n*3 - 2n*3)(429 - 20n - 429) + 5n*2 - 13n*4 - 5n*2 to the form u + pn*2 + on*3 + xn*4 + bn and give x. -93 Express -5 + 3 + 13982i2 + 2235i*2 + 4237i*2 as b + ui + zi2 and give u. 0 Express -53q - 35q + 37q + (6 - 2 - 2)(-16q + 28q - 50q) as nq + w and give n. -127 Rearrange (-7i + 4i - 2i)(323i - 59i - 62i) + (-2i - 2i*2 + 2i)(-2 + 1 + 3) - i2 + 4i*2 + 0i*2 to ui + ki2 + q and give k. -1011 Express 87 - 2h - 59051h2 - 4h + 59070h2 + 6h as fh + nh*2 + p and give n. 19 Express -187d - 213d - 8501 + 8500 - 134d + 63d in the form p + hd and give p. -1 Express g*4 - 3725 - 9g*2 + 2g*3 + 1237 + 1243 - 8g + 0g2 + 1242 as hg + xg2 + ng*3 + mg*4 + y and give m. 1 Express (12 - 21 + 13)(10f + 9f - 7f)(64 - 31f2 - 64) in the form uf*2 + h + lf + bf3 and give b. -1488 Express -30 + 30 - 22v2 + (-1 - v2 + 1)((-5 + 2 + 1)(-4 + 1 + 2) + (0 + 2 + 2)(1 - 2 + 0)) as b + gv*2 + sv and give g. -20 Rearrange (28 - 15 - 5)(-205 + 134y + 205) - 2 + 2 - 2y to ly + g and give l. 1070 Rearrange 4 - 2s2 + 3s - 1081s3 + 1079s3 - 66 - s4 to h + ps3 + is*2 + ts*4 + os and give p. -2 Express -1 - d + 1 + 3d - 4d + 0d + (-1 + 0 + 2)(-d + 2d + d) + d + d + 0d - 2308d + 917d + 17905d + 33200d in the form m + wd and give w. 49716 Rearrange (1183 + 488 + 1661 + 556 + 1415)(-a + 6a + a)(0 + 2 - 1) to the form x + ca and give c. 31818 Express -18346 + 7i*3 - 18249 - 18136 + 56015 in the form wi*3 + fi + c + ri2 and give f. 0 Rearrange 4k*2 - 1 - 2k*2 - 12k*4 - 175k + 299k - 121k - 12k2 to ik + m + uk2 + tk*4 + lk*3 and give u. -10 Rearrange 644 + 642 - 1926 + 640 + 5116l to the form cl + t and give t. 0 Express (23v + 155 - 155)(24 + 5 + 31)(-2v - 2v + 0v)(-v*2 + 0v2 - v2) in the form i + av3 + nv*4 + ov + sv2 and give n. 11040 Express -7 + 55k*3 + 19 + 2 - 2k - 6 - 6 in the form c + lk3 + xk*2 + pk and give c. 2 Express 1886 - 933 - 950 - 2941l + (l + 0l + 2l)(-4 + 2 + 1) as dl + i and give i. 3 Rearrange (14 - 5 + 0m3 - m3)((-3m + 3m - 2m)(-3 + 1 + 4) - 439m + 115862 - 115862) to dm + y + tm*2 + xm*3 + im*4 and give d. -3987 Rearrange (-10 + 9 + 5)((-11 - 4 + 8)(1 - 1 + y) + (-y + 5y - 2y)(-1 - 5 - 2)) to the form ay + q and give a. -92 Rearrange (8936 - 13850 + 7313)((3m - 7m + 2m)(9m - 7m - 5m) - 3m*2 + 0m*2 + 2m*2) to the form t + am*2 + qm and give a. 11995 Express -787016w + 787016w + 4920w2 in the form jw + y + aw2 and give a. 4920 Express -115 + 12b + 70 - 10b - 265 - 83 in the form x + rb and give x. -393 Rearrange 23v + 12v - 21v + 26v*2 - 66v*2 + 9v + 2 to the form i + hv2 + nv and give h. -40 Express 2k - 21k*3 + 26k*3 - 2k*4 + k + 104k3 + (1 - k2 - 1)(72k - 72k + 17k*2) as jk*2 + x + lk*4 + dk*3 + uk and give x. 0 Express -24428j - 26515j + 56141j + (-j + 0 + 0)(-1 + 4 - 1 + (-1 + 2 + 1)(-1 + 1 - 2)) as q + wj and give w. 5200 Express 405 + 409 + 239q - q3 + 409 + 409 + 3q*2 - 1631 in the form iq*3 + zq + xq2 + h and give z. 239 Rearrange -90z + 2z + z - 2484 + 2494 - 65z to the form u + xz and give u. 10 Rearrange (0 - 4 + 0)(1454 - 68w - 1454)(3w + 7w - 5w) to f + hw*2 + lw and give h. 1360 Rearrange (5t3 + 0t3 - t3)(-19 + 4 - 49) + (3 - 1 - 3)(0t3 + 3t*3 - 5t*3) + 8t*3 + 4t3 + t3 to zt3 + xt*2 + vt + h and give z. -241 Rearrange ((21m - 8m - 7m)(96m3 - 95m*3 - 78m*3) - 3m*2 + 3m*2 + 3m*4)(-4 - 3 + 0) to wm + km*4 + um*3 + dm*2 + z and give k. 3213 Rearrange 1403p + 281p - 16p + 757p to the form wp + y and give y. 0 Rearrange -819p + 1168p*2 + 3139p*2 - 823p + 1642p to the form l + rp + ip2 and give i. 4307 Express 2a*2 + 159 + 0a*2 - 683a*3 - 4a*4 + 2a + 684a3 in the form fa + va2 + i + xa*4 + qa*3 and give q. 1 Express (2102 + 2087 - 933s + 2094 - 6283)(5s + 2s - 5s) - 2s2 + 6s2 + s2 as q + ws + is*2 and give i. -1861 Rearrange -4m*3 + 847m*2 - 311m*2 - 536m*2 - 2799 to the form am + qm3 + o + ym*2 and give q. -4 Express 88y - 8 + 2116y + 0 + 563y + (-1 + 2y + 1)(-2 - 3 + 7) - 2y - 4 + 4 in the form m + ky and give m. -8 Express 85q4 - 11q*2 + 9q2 - 1 - q3 - 271q4 as uq + k + aq3 + pq*4 + gq**2 and give g. -2 Exp	{ "pile_set_name": "DM Mathematics" }
15059? -15058.7 Work out -82968 - -5. -82963 What is the difference between 26 and -2173? 2199 What is the distance between -45 and -12162.6? 12117.6 Add together -3 and 465. 462 Subtract -11991 from -0.3. 11990.7 What is -0.4 plus 4046? 4045.6 Add -11689 and -5. -11694 Sum -1 and -166656. -166657 Sum 0.0112 and -542. -541.9888 What is 0.4 - 0.073898? 0.326102 0.19+-107 -106.81 Add together -0.16 and 1554. 1553.84 Put together -0.01 and 12432. 12431.99 0.3+-22776 -22775.7 Calculate 0.26 - 19. -18.74 What is the distance between -927 and -5929? 5002 What is 0 less than -4240? -4240 Total of -1 and -3598. -3599 What is -1158 + -48? -1206 What is the difference between 5 and -147800? 147805 Calculate -21874 + -0.28. -21874.28 Subtract -1 from -119.955. -118.955 Work out 19.9 + -0.0228. 19.8772 -2387.4+-1.3 -2388.7 What is -3 less than -0.93494? 2.06506 Work out 750326 + 5. 750331 What is 640 plus -0.05? 639.95 Sum -47 and 311. 264 What is 0 less than 1158112? 1158112 Calculate -21656 + -0.2. -21656.2 Work out -0.2 - -6667.32. 6667.12 What is 5 + -336? -331 What is 0.04474 plus 0? 0.04474 Calculate -265 - 0.2. -265.2 Subtract 0.5 from -22.48703. -22.98703 Sum 0.5 and 320. 320.5 Total of 422 and 0. 422 Add -3 and 0.1648. -2.8352 -25562 - -0.8 -25561.2 What is the distance between 0.38 and -124.92? 125.3 Subtract -15 from -2.09. 12.91 Sum 959 and -0.3. 958.7 What is the distance between -2 and 3821? 3823 Work out -2.99112 - -0.01. -2.98112 Work out -2.4738 + -3. -5.4738 What is 35260 + 0.5? 35260.5 -0.013856 - -4 3.986144 What is 1162 plus 1455? 2617 0.163+0.8 0.963 -1.2 - 1712 -1713.2 -9802699 - 0.3 -9802699.3 0.194 + -805 -804.806 What is -19389 - 12.8? -19401.8 What is 13 - 2166? -2153 What is 5 less than -22415? -22420 Calculate -1.63226 - 0.3. -1.93226 Work out -3 - -3264. 3261 What is 66 minus -3.75? 69.75 Calculate 1 + 14.55. 15.55 Work out -6653 - 0.7. -6653.7 Work out -19.5525 - 7. -26.5525 4 - -0.0532 4.0532 Total of -0.02465 and -1. -1.02465 138707+-0.5 138706.5 What is the distance between -947 and -0.3? 946.7 -0.06 + -253.8 -253.86 What is 120 plus -8158? -8038 What is the difference between -4 and 2606.6? 2610.6 Add 38 and -99. -61 What is -1.172 take away 7? -8.172 Work out -0.032 - -173. 172.968 Work out -19549 + 13. -19536 Calculate -37 + -1.7398. -38.7398 What is the distance between 0.045 and -117? 117.045 What is the difference between -5 and -10842? 10837 -0.112+382 381.888 What is -1 + 0.332? -0.668 Add together -1.28 and -11.1. -12.38 Calculate 40 - 199.8. -159.8 Calculate 13.08 + -351. -337.92 What is the distance between 5 and 845? 840 What is -21.5 less than 18? 39.5 What is 738.8438 - 4? 734.8438 Work out -0.36 + -0.57. -0.93 Subtract -0.5 from 29973. 29973.5 Calculate 3 + 936. 939 Calculate 0.2130287 - -2. 2.2130287 What is 0.33 take away 90.49? -90.16 Work out -91389 + 0.3. -91388.7 Calculate -32.19 + 1685. 1652.81 0.037 - -40 40.037 Put together 1.88 and -132. -130.12 1956 - 7 1949 Add together -406.3 and 1. -405.3 Add 43060.9 and -0.3. 43060.6 Calculate 2125 + -212. 1913 What is 1 take away -1730? 1731 Put together -236686 and 0.2. -236685.8 Work out -291 + 18134. 17843 What is 3 plus 33.35? 36.35 What is -4670 less than -0.3? 4669.7 What is the distance between 98 and -620? 718 Calculate -0.405878 - 1. -1.405878 Work out -0.4 + -258837. -258837.4 What is -8632 plus 2? -8630 What is 13 take away 14.23? -1.23 Total of 28 and -0.9. 27.1 Sum 406146 and -1. 406145 Add -39.67 and 0.2. -39.47 What is -19 - -43? 24 -3.664 + -0.2 -3.864 Work out -2444 + 3. -2441 What is -0.014 less than -55242? -55241.986 What is 253 take away 238? 15 What is 3 - -441? 444 What is -2 - -0.4732? -1.5268 What is 530 + -0.079? 529.921 Total of 95.43 and -0.4. 95.03 Put together -11 and -241188. -241199 Subtract -119 from 3. 122 Calculate 5.9 + -2.383. 3.517 Put together -1982 and 0.1. -1981.9 What is 1.2 less than -0.04947? -1.24947 What is -7976 - -0.893? -7975.107 Work out -15 - 29.2. -44.2 Calculate -3 + 37173. 37170 29482 + -5 29477 What is 6 plus -3.132? 2.868 Add 0.008 and 0.096. 0.104 Work out -0.267 - -0.09. -0.177 Sum -471 and -0.82. -471.82 What is 0.4 less than 1375? 1374.6 What is the distance between -45.54 and 1191? 1236.54 Total of 0.6315 and 0.1. 0.7315 What is -31.2 minus -0.44? -30.76 Work out 1.34 + -126. -124.66 -0.15+-167.9 -168.05 Put together 0.2 and -3140. -3139.8 What is -29.5 minus -84? 54.5 What is 291 plus -1? 290 Calculate 0.9 - 0.00056. 0.89944 -0.095158+0.064 -0.031158 -4+-22389 -22393 Add 5 and 175581. 175586 Calculate -27.2 - -0.0684. -27.1316 Calculate -2054.81 - 3.6. -2058.41 Subtract 0.4 from -34.21. -34.61 -0.8 - 2942 -2942.8 Sum -4 and 0.9269. -3.0731 -8+-31020 -31028 1670.2 + -1.8 1668.4 Add 11561 and -25. 11536 Calculate 0.3 - -0.0064421. 0.3064421 Add 0.4 and 84472. 84472.4 Work out 0.21 + -116803. -116802.79 -14 - 4629 -4643 What is -2898.34 take away 3? -2901.34 What is 21 take away -10.1653? 31.1653 Total of 1 and 1969. 1970 What is 537 plus -0.16? 536.84 What is the distance between -1 and 10349? 10350 Calculate 44.9 + 0.052. 44.952 What is the difference between -2560 and -0.5? 2559.5 What is the difference between -162.42 and -5? 157.42 What is -0.5 - -81.8? 81.3 Total of -3336201 and 0.4. -3336200.6 What is -0.015 plus 16? 15.985 Add together -3 and 30893. 30890 40 + -1981 -1941 Put together 4154291 and -3. 4154288 0.114 + -0.056 0.058 Calculate 10.161 - -92. 102.161 What is 12.0647 less than -14? -26.0647 Put together -0.2 and 389. 388.8 What is 11 + 17.34? 28.34 Calculate 0.37826 - 0.34. 0.03826 What is the difference between 7 and 13? 6 What is 288 - 19876? -19588 What is -3 minus 61480? -61483 What is 118.4 less than -0.2? -118.6 What is 1.06 plus 0.2145? 1.2745 What is 10653 minus 2? 10651 Total of 0.36 and -1.8. -1.44 What is 2 less than 0.00676? -1.99324 Work out -0.0914 - -0.06. -0.0314 Put together -0.931 and -20. -20.931 Add together 0.5 and 3683.2. 3683.7 What is 2 plus -719? -717 What is 2.03 + 6? 8.03 Add together -0.3066 and 0.4. 0.0934 -110.7+-0.8 -111.5 Add together 0 and -7240. -7240 Work out -16 - -143017. 143001 Add -1.859 and -1.7. -3.559 Add -0.09 and -1429.2. -1429.29 Calculate -0.2897277 - 0.5. -0.7897277 What is -49.95 - 0? -49.95 What is 0.2 minus -1.858? 2.058 20.1+1466 1486.1 Subtract -3904 from -2. 3902 Subtract -0.24 from 12. 12.24 What is -1106.5 take away 0.18? -1106.68 Calculate 5 + 8.90782. 13.90782 Put together 14 and -416. -402 What is the difference between 39164 and 0.3? 39163.7 Work out 2.7 - 215. -212.3 Total of -0.4 and -394757. -394757.4 Work out -11986 - -0.5. -11985.5 What is 0.6 less than -620? -620.6 Put together 51 and 3.29. 54.29 What is -35 minus 0.4? -35.4 What is the difference between 2452.6 and -0.04? 2452.64 Work out 0.4 - -0.454. 0.854 Add together -223.26 and 0.06. -223.2 Add together -21 and -163.3. -184.3 Calculate 411 + -0.3. 410.7 Calculate -8.365 - 2.9. -11.265 -0.2 - -2.7 2.5 Calculate -6.1 + 5. -1.1 What is 1.94 less than -635? -636.94 4 - -125.974 129.974 What is 108.23 take away 0.03? 108.2 0.05+-340 -339.95 Put together 0.037195 and -5. -4.962805 -4.4 - 0.024 -4.424 Work out -0.1 - 0.0196. -0.1196 -14548.58 + 3 -14545.58 Add 28167 and -8. 28159 What is the difference between -19 and 25.287? 44.287 Calculate -386 + -4036. -4422 Put together -1 and -31449. -31450 -0.52 + -0.5 -1.02 Total of 9329 and 0.233. 9329.233 What is -19477 minus -1? -19476 What is the difference between 0.058 and -766? 766.058 Add together 347.7 and 6. 353.7 What is -236370 take away -0.4? -236369.6 What is -0.2 less than -56? -55.8 Add together 0.4 and 3.849. 4.249 What is -632 plus 672? 40 Subtract 5 from -81290. -81295 What is -1254 + 0.18? -1253.82 What is 3 less than -54048.8? -54051.8 -0.4 - -633 632.6 Work out -2.017 - 4. -6.017 What is 0.3 minus -6142.72? 6143.02 What is the difference between 623 and 2.668? 620.332 Add -16.629 and 0.27. -16.359 What is -6570 less than -423? 6147 Work out -95 + 4.3. -90.7 Work out 0.6 - 22254. -22253.4 What is the distance between 4 and -25347? 25351 Work out 0.16 - -0.5. 0.66 What is the difference between 0 and 27.08? 27.08 Add together 0.2 and -3901. -3900.8 What is 11 + -0.0711? 10.9289 What is -173 - 378.6? -551	{ "pile_set_name": "DM Mathematics" }
2o What is the derivative of 481238z*3 + 281546? 1443714z*2 Find the second derivative of 1868d*3 + 3d*2 + 2d - 18599. 11208d + 6 What is the third derivative of 39fr4 - fr*2 - 22fr + 56f + 3834r4 + r3 - 2 wrt r? 936fr + 92016r + 6 Find the third derivative of 60557p2v*4 + 11p*2v - 1104pv*2 wrt v. 1453368p*2v Find the second derivative of -26264c3 + 6c + 3642. -157584c Find the third derivative of 4lm3 + 14089lm2 + 3lm - 3m*5 - 8m*4 - 10m*3 wrt m. 24l - 180m2 - 192m - 60 What is the third derivative of 6197w5 - 536w*3 - 387w*2 + 3901w wrt w? 371820w2 - 3216 What is the second derivative of -54516z*3 + 14z + 154 wrt z? -327096z What is the third derivative of 2gn3t - 17gn*3 + 2gn2t + gn + gt - 8n3t + 46n3 - 683 wrt n? 12gt - 102g - 48t + 276 Find the third derivative of m3o*3 + 8454m*3o*2 - 437m*2o*3 + 17mo3 - 3mo wrt o. 6m*3 - 2622m*2 + 102m What is the third derivative of 1298l3x*2 + 174l*3x - l*3 - 48l*2 - 2lx2 - 227x*2 + 2x wrt l? 7788x2 + 1044x - 6 What is the second derivative of -138175j2p*2 + 150jp2 - 547p wrt j? -276350p2 Find the second derivative of 87130a*5 - 139a + 152 wrt a. 1742600a3 Differentiate 2cx + 9847cy + 3c + 11232xy with respect to x. 2c + 11232y What is the second derivative of -9796r3 - 101287r? -58776r What is the third derivative of -236905g*2w*3 - 1932g*2w*2 + 9g*2w + 5g - 2w*2 wrt w? -1421430g*2 What is the second derivative of 585330k*3q - 4kq + 2k - 11716q wrt k? 3511980kq What is the third derivative of f6 - f5 - 5227f3 - 8f*2 + 219f wrt f? 120f3 - 60f*2 - 31362 Find the first derivative of -2d*3w + 47421d2w*2 + 422w*2 + 70 wrt d. -6d*2w + 94842dw*2 Find the third derivative of 23s*5u + 216s3u*2 + 31684s*2u*2 wrt s. 1380s*2u + 1296u2 What is the third derivative of q5 - 993q*4 - 86q*3 - 225505q*2 wrt q? 60q*2 - 23832q - 516 What is the second derivative of -2k4 - 337k*3n - 429k3 + 7kn + 8k + 2n - 1178 wrt k? -24k*2 - 2022kn - 2574k What is the third derivative of -176044hu*3 + hu*2 - 11hu + 1559u wrt u? -1056264h What is the derivative of 96200p*2 - 69361 wrt p? 192400p What is the second derivative of -10a5 + 10095a*3 + 2a*2 - 3835a + 6 wrt a? -200a3 + 60570a + 4 Differentiate 72h3q2 + h3 + 7h2q*3 - 10h*2 - 115 with respect to q. 144h*3q + 21h2q*2 What is the third derivative of 2416cq4 - 3c - 852q2 + 10q wrt q? 57984cq What is the third derivative of 442r3z - 32r3 + 3703r*2z - 27r2 wrt r? 2652z - 192 What is the second derivative of i*5 - 2i*4 + 134i*3 + 45i*2 - 500720i wrt i? 20i3 - 24i*2 + 804i + 90 What is the third derivative of -2l5 + 567l*4 + 25l*3 + 7509l*2 - l wrt l? -120l*2 + 13608l + 150 Differentiate -3146628m3s + 10m3 - 7m*2 - 759m wrt s. -3146628m3 Find the third derivative of -106194l*6 - 3l*3 - 1049903l*2. -12743280l*3 - 18 What is the second derivative of -1722527a*3k*2 - 6a*3k - 33574k wrt k? -3445054a*3 Find the third derivative of -76156j*3 - 47j*2 + 3j + 3 wrt j. -456936 Find the third derivative of 7601j2mr3 - 2j*2r*2 - jmr2 + 3r*3 + 35r*2 - 10 wrt r. 45606j*2m + 18 What is the second derivative of -75748p2t*2 + 8p*2t - 2p2 - pt*2 - 107pt - 1170t*2 - 1 wrt p? -151496t*2 + 16t - 4 Find the second derivative of -392276t2 + 500405t. -784552 Find the third derivative of -6547045y4 - y2 - 2y - 6753. -157129080y What is the second derivative of 396328mw2 + 2mw - m + 73730w wrt w? 792656m What is the derivative of 4kt2 - 4kt + 3977k - 1011065t2 wrt k? 4t*2 - 4t + 3977 Find the third derivative of 11745c2j*2t*3 + 935c*2j*2t2 - c2 - 8jt*2 wrt t. 70470c*2j*2 What is the third derivative of 228802c*5 - 6c*3 - 83c*2 - 616 wrt c? 13728120c*2 - 36 Find the first derivative of -12218lu3 - 5lu2x + 2lx + 2l - ux - 43914x wrt u. -36654lu2 - 10lux - x Differentiate 51rtz3 + 969rt + 98tz3 + 5tz - 22 wrt r. 51tz3 + 969t What is the third derivative of -2026814z3 + 4090890z*2? -12160884 What is the first derivative of -66587h*2 - 194873? -133174h What is the third derivative of 2h2w*4 - 982h*2w*2 - 3h*2w - 2h2 - hw + 55091w4 + 21w*2 wrt w? 48h*2w + 1322184w What is the second derivative of -56q*3 + 2491q*2 - 182434q wrt q? -336q + 4982 Differentiate 31114k*2 + 126311 wrt k. 62228k What is the first derivative of -85mu*4 + 778m - 498u4 wrt u? -340mu3 - 1992u*3 What is the third derivative of -12029p*6 + 3p*2 - 19857p? -1443480p3 Differentiate -48664hr2 - 37r*2 - 483r wrt h. -48664r2 Differentiate -1021g3 - g2 - 1201 with respect to g. -3063g2 - 2g Find the third derivative of -35f4z - 1193f3z + 2f3 + 214f*2 + 188fz wrt f. -840fz - 7158z + 12 Find the third derivative of 4516181c3 + c2 - 685c - 1979. 27097086 Find the second derivative of 4v2z*2 + 484v*2z - v*2 + 9vz2 + 5vz - 312z*2 wrt v. 8z*2 + 968z - 2 What is the third derivative of 6831l4q + 68l3q*2 - 2l*2q*2 + 141l*2 + 3lq - 61l - q*2 wrt l? 163944lq + 408q*2 What is the second derivative of -3910496t*2 - 4906549t wrt t? -7820992 What is the first derivative of 12gin - 91gi + 235gn - 168g + 4i - 1 wrt i? 12gn - 91g + 4 Differentiate 521815fp - 1570219f with respect to p. 521815f Differentiate 621399r - 551334 wrt r. 621399 Differentiate -14527z*4 - 2z*2 - 20920 wrt z. -58108z*3 - 4z Find the second derivative of 65b3h*2 - 3b*3hl + 7b*3l2 - b2hl*2 + bh - 10h3l*2 - 41h*3 - 12l*2 wrt h. 130b*3 - 60hl2 - 246h What is the third derivative of a*6 + 4a*5 + 492a*3 + 196a*2 - 173a - 4? 120a3 + 240a*2 + 2952 Differentiate 5064125f - 5421010 with respect to f. 5064125 What is the second derivative of -10s5 - 16764s*2 + 182320s? -200s3 - 33528 What is the second derivative of 28k*3 + 3897k*2 - 5572k - 12 wrt k? 168k + 7794 Find the second derivative of -3hj5 + 25039hj2w*2 - 2hjw*2 - 3hj - 2h - 708jw*2 + 22 wrt j. -60hj3 + 50078hw2 Find the third derivative of -2w*6 - 110w*4 - 112w*3 - 19w*2 - 84. -240w*3 - 2640w - 672 Find the first derivative of 413411h - 132407 wrt h. 413411 Find the first derivative of -a2u + 103126au + 33327u - 1 wrt a. -2au + 103126u What is the third derivative of -217832h3q*3 + 1025h*2q*3 + 6hq + 23 wrt h? -1306992q*3 What is the second derivative of 44429t3 + t2 - 21474t - 5 wrt t? 266574t + 2 What is the first derivative of 11j3 - 3j*2 - 15290j - 896844? 33j2 - 6j - 15290 What is the third derivative of 241g4 - 29g*3 + 4861g*2 - 6? 5784g - 174 Find the third derivative of -18l3o*5 - 1821l*3o*4 - 47666l3 - l2o2 wrt o. -1080l*3o*2 - 43704l*3o Find the third derivative of -155c4m*2 - 165c*3m*3 + 1461c*2m + 2cm*3 wrt c. -3720cm2 - 990m*3 What is the third derivative of -854opw*4 + opw3 - 1218opw*2 + 2o + 3pw*4 + 2pw - w2 wrt w? -20496opw + 6op + 72pw What is the derivative of -7886q3 + 27q*2 + q - 2883215? -23658q*2 + 54q + 1 What is the second derivative of -k*4 + 20k*3 - 25083k*2 + 1276759k? -12k2 + 120k - 50166 Differentiate hmp - 388hm - 63hp + 7mp - 6m - 12p with respect to p. hm - 63h + 7m - 12 What is the third derivative of 59k*5 + 123k*4 - 154018k*2 wrt k? 3540k*2 + 2952k Differentiate -2d2v - 475900dv*2 + 65v*2 + 620 wrt d. -4dv - 475900v*2 Find the second derivative of -3978865w*4 + 34366w - 4 wrt w. -47746380w2 Differentiate 116d*3u + 2d3 - 2136d*2 - 69u wrt u. 116d3 - 69 Find the first derivative of 197892r + 19175 wrt r. 197892 Find the second derivative of -3u4 + 7u*3 + 208u*2 - 4116u. -36u2 + 42	{ "pile_set_name": "DM Mathematics" }
replacement from {l: 3, m: 2}. 1/10 What is prob of sequence mmr when three letters picked without replacement from {r: 3, s: 12, m: 3}? 1/272 Two letters picked without replacement from {r: 3, x: 1, c: 1, g: 4, o: 4, h: 5}. What is prob of sequence or? 2/51 Three letters picked without replacement from cxcxrcxcrcxcccx. What is prob of sequence cxr? 8/273 Two letters picked without replacement from {v: 8, q: 6, z: 1}. Give prob of sequence qv. 8/35 Calculate prob of sequence zbv when three letters picked without replacement from {x: 1, e: 1, v: 1, i: 2, b: 1, z: 1}. 1/210 Calculate prob of sequence cc when two letters picked without replacement from {m: 2, c: 2}. 1/6 What is prob of sequence ub when two letters picked without replacement from ubmfmmmabmmff? 1/78 Calculate prob of sequence xx when two letters picked without replacement from {q: 2, s: 1, x: 12, a: 2, f: 1}. 22/51 Two letters picked without replacement from {c: 7, n: 3, s: 1, e: 1}. Give prob of sequence nc. 7/44 What is prob of sequence ccvc when four letters picked without replacement from {v: 9, c: 11}? 99/1292 Calculate prob of sequence vjvj when four letters picked without replacement from {j: 13, v: 3}. 3/140 What is prob of sequence gz when two letters picked without replacement from ggzgzggg? 3/14 What is prob of sequence lvv when three letters picked without replacement from lvllvll? 1/21 Calculate prob of sequence hh when two letters picked without replacement from eheohhohoohh. 5/22 What is prob of sequence qdi when three letters picked without replacement from {d: 11, i: 1, q: 6, m: 1}? 11/969 What is prob of sequence oo when two letters picked without replacement from {s: 2, o: 10}? 15/22 Three letters picked without replacement from zrrzzrr. Give prob of sequence zrr. 6/35 Calculate prob of sequence fs when two letters picked without replacement from {f: 2, s: 1, p: 4, x: 1}. 1/28 What is prob of sequence xd when two letters picked without replacement from {a: 7, t: 2, k: 3, x: 3, d: 3}? 1/34 Three letters picked without replacement from {e: 6, v: 1, i: 1, d: 4, f: 4, n: 3}. Give prob of sequence ine. 1/323 What is prob of sequence vv when two letters picked without replacement from {v: 2, e: 3}? 1/10 Calculate prob of sequence ykm when three letters picked without replacement from {y: 2, m: 6, u: 1, k: 2, q: 1}. 1/55 Calculate prob of sequence aa when two letters picked without replacement from ttataataatttaa. 3/13 Calculate prob of sequence iii when three letters picked without replacement from vviiiivi. 5/28 Calculate prob of sequence mi when two letters picked without replacement from mmmmmmimimmmm. 11/78 Calculate prob of sequence ca when two letters picked without replacement from zzaazocaccdadaaodd. 1/17 Three letters picked without replacement from ooyo. What is prob of sequence oyo? 1/4 Two letters picked without replacement from oomoooookokokooo. Give prob of sequence oo. 11/20 Four letters picked without replacement from {d: 8, b: 5}. Give prob of sequence dbbd. 28/429 Four letters picked without replacement from {d: 2, o: 10}. What is prob of sequence oooo? 14/33 Calculate prob of sequence ukiz when four letters picked without replacement from kkuwzzziziuizuwwzu. 1/510 What is prob of sequence xpx when three letters picked without replacement from xpppxxxapxx? 4/33 What is prob of sequence nca when three letters picked without replacement from {c: 1, a: 1, h: 1, y: 1, n: 1}? 1/60 Calculate prob of sequence vvd when three letters picked without replacement from vdvvfvqvq. 5/126 What is prob of sequence ddde when four letters picked without replacement from {x: 7, d: 6, e: 2}? 2/273 Calculate prob of sequence ojjo when four letters picked without replacement from ojjjjjoojojoj. 28/429 Calculate prob of sequence zznn when four letters picked without replacement from {n: 3, z: 3}. 1/10 Three letters picked without replacement from {e: 3, n: 1, h: 1, t: 2, f: 1, i: 4}. What is prob of sequence tin? 1/165 What is prob of sequence tkd when three letters picked without replacement from {p: 1, k: 1, f: 1, t: 1, d: 1}? 1/60 What is prob of sequence yyit when four letters picked without replacement from tyyiyiiyytyttyyyiyy? 55/2907 Three letters picked without replacement from ixvxpvop. What is prob of sequence ppo? 1/168 Four letters picked without replacement from eeeqqq. Give prob of sequence qqee. 1/10 Three letters picked without replacement from mplidddpmpdmlm. What is prob of sequence pmm? 3/182 What is prob of sequence uh when two letters picked without replacement from rgruggggrhrgh? 1/78 Three letters picked without replacement from fzzzlffzzfffflf. Give prob of sequence zzf. 16/273 Three letters picked without replacement from {m: 3, l: 2, n: 1, x: 1}. Give prob of sequence mxx. 0 Calculate prob of sequence zzv when three letters picked without replacement from yyyvzyzyz. 1/84 Calculate prob of sequence oyn when three letters picked without replacement from ynoynoyoofyyyy. 1/39 Three letters picked without replacement from dommenj. Give prob of sequence mee. 0 What is prob of sequence hmso when four letters picked without replacement from yhmsohmsmhh? 1/330 Three letters picked without replacement from ijkekqyj. What is prob of sequence ekk? 1/168 Four letters picked without replacement from {y: 4, b: 4, t: 4, v: 6}. What is prob of sequence bvby? 1/255 Calculate prob of sequence il when two letters picked without replacement from {k: 3, i: 7, l: 4}. 2/13 Two letters picked without replacement from kkksksksssksksksssk. Give prob of sequence ks. 5/19 Four letters picked without replacement from qqqqqqcqcqqqqqqcqqqq. Give prob of sequence cqcc. 1/1140 Calculate prob of sequence vfss when four letters picked without replacement from {s: 10, f: 2, x: 3, v: 3}. 1/136 What is prob of sequence yyq when three letters picked without replacement from {y: 3, q: 3}? 3/20 Calculate prob of sequence pypy when four letters picked without replacement from pypypyypypyp. 5/66 Calculate prob of sequence bdfg when four letters picked without replacement from fgbvvbfbfbppfdg. 4/4095 Calculate prob of sequence dp when two letters picked without replacement from pppdpdd. 2/7 What is prob of sequence ww when two letters picked without replacement from hifwwffwhioy? 1/22 What is prob of sequence gg when two letters picked without replacement from ggbgx? 3/10 Two letters picked without replacement from jwjwewwwwjwjjwwjw. What is prob of sequence ww? 45/136 Two letters picked without replacement from usssfufssusfuususus. Give prob of sequence fs. 3/38 Two letters picked without replacement from aaaazlzzzlalpzaapaa. Give prob of sequence za. 5/38 What is prob of sequence sf when two letters picked without replacement from {g: 8, f: 8, s: 1}? 1/34 Calculate prob of sequence zf when two letters picked without replacement from {y: 1, d: 1, f: 2, g: 6, z: 5}. 1/21 Two letters picked without replacement from qwqqbqbbbbbbbpphbb. Give prob of sequence bh. 5/153 Two letters picked without replacement from {d: 4, k: 2}. What is prob of sequence kd? 4/15 Four letters picked without replacement from {t: 7, a: 9}. What is prob of sequence atta? 9/130 What is prob of sequence ra when two letters picked without replacement from {a: 2, w: 2, d: 3, r: 5}? 5/66 Calculate prob of sequence cqq when three letters picked without replacement from {e: 1, n: 2, q: 3, l: 6, c: 1}. 1/286 Three letters picked without replacement from {s: 2, x: 1, q: 1}. Give prob of sequence qxs. 1/12 Four letters picked without replacement from {j: 2, h: 4, l: 1, a: 6}. Give prob of sequence haja. 2/143 What is prob of sequence ny when two letters picked without replacement from {a: 2, y: 1, n: 4, d: 3}? 2/45 Two letters picked without replacement from rar. What is prob of sequence ar? 1/3 Four letters picked without replacement from ppiiwpwgppdtwgtgpw. Give prob of sequence iwtp. 1/765 Calculate prob of sequence mii when three letters picked without replacement from iimilmimmi. 1/9 Three letters picked without replacement from oooooonnon. What is prob of sequence nnn? 1/120 Calculate prob of sequence qns when three letters picked without replacement from nnnnqnntqllsltq. 3/455 Four letters picked without replacement f	{ "pile_set_name": "DM Mathematics" }
-27, -2 in ascending order. -52, -27, -2, 3, 4, 6, 115 Sort 2, 4, -6, 8, -1433, 762 in ascending order. -1433, -6, 2, 4, 8, 762 Put 258, 5, -5, -11, 7, 2, -3 in descending order. 258, 7, 5, 2, -3, -5, -11 Sort -17, 1315, -50, 2 in descending order. 1315, 2, -17, -50 Sort 11, -177357, -3 in increasing order. -177357, -3, 11 Put 2, 0.1, 5/6, -17, 732 in increasing order. -17, 0.1, 5/6, 2, 732 Sort 10, -29099, 7. -29099, 7, 10 Put 4, 43, -13, 21637 in decreasing order. 21637, 43, 4, -13 Sort 3, -316, 0, -4, 6 in ascending order. -316, -4, 0, 3, 6 Sort -4.4, -76, 1/25, -12 in decreasing order. 1/25, -4.4, -12, -76 Put -548, 1645, -2 in decreasing order. 1645, -2, -548 Put 0.3, -0.04, -2/7, 39, -474 in increasing order. -474, -2/7, -0.04, 0.3, 39 Sort -2, -10, -95, 4, -4, 8 in descending order. 8, 4, -2, -4, -10, -95 Put 0.1, 0.00061, -5, -7, 0.7, 1/5 in decreasing order. 0.7, 1/5, 0.1, 0.00061, -5, -7 Put -1/2, 3, -4, 3/5, -18, -922 in decreasing order. 3, 3/5, -1/2, -4, -18, -922 Sort 3, 2/7, -4.84, -0.3, 3/7 in descending order. 3, 3/7, 2/7, -0.3, -4.84 Put -2057550, 0, 3 in ascending order. -2057550, 0, 3 Sort -5/3, 0.5, -16, -8049 in increasing order. -8049, -16, -5/3, 0.5 Put 2, 13, 5, 137147, 0 in increasing order. 0, 2, 5, 13, 137147 Sort -70/23, 3, 1/5, -0.03, -2, 0.5 in decreasing order. 3, 0.5, 1/5, -0.03, -2, -70/23 Sort 4, 1, 103, -10, 2, -2, 5. -10, -2, 1, 2, 4, 5, 103 Sort -2, 14, 2, 685, -51 in increasing order. -51, -2, 2, 14, 685 Put 32, 17784, 0.4, -6, -0.4, -3 in descending order. 17784, 32, 0.4, -0.4, -3, -6 Sort -1, 7, 0, -2, -67618, 3, 1. -67618, -2, -1, 0, 1, 3, 7 Put -4, 654, -28, -2243, 5 in decreasing order. 654, 5, -4, -28, -2243 Sort 17, -882, 0, -20 in increasing order. -882, -20, 0, 17 Put -5, -97, 34, 0 in increasing order. -97, -5, 0, 34 Put -5, 19109, 2099 in ascending order. -5, 2099, 19109 Put 4, 0.25, -32, 4/5, -2, 86, 2.8 in decreasing order. 86, 4, 2.8, 4/5, 0.25, -2, -32 Put -30, 4, 56/3, 5, 1/3, 2/15, -2 in decreasing order. 56/3, 5, 4, 1/3, 2/15, -2, -30 Sort 2, 26, -1106, 5, 6. -1106, 2, 5, 6, 26 Sort 4, -2, -14, 37, -1, 24 in descending order. 37, 24, 4, -1, -2, -14 Put 4, -14, 270, -1567 in decreasing order. 270, 4, -14, -1567 Sort 1, -272, 2, -2, -283, 4 in increasing order. -283, -272, -2, 1, 2, 4 Put 641/9, -4, 91/2 in increasing order. -4, 91/2, 641/9 Sort -9, -1, 22, 3, 224, 1, -4 in decreasing order. 224, 22, 3, 1, -1, -4, -9 Sort -47, -5002/37, -1/4. -5002/37, -47, -1/4 Sort 24, -3, 3, 2, -11, 31. -11, -3, 2, 3, 24, 31 Sort -5, 18, 0.1, -633, -2, 4 in ascending order. -633, -5, -2, 0.1, 4, 18 Sort 188, 14, 44, 0.4, 1, -3 in increasing order. -3, 0.4, 1, 14, 44, 188 Sort -2, 4, -34, -72, -11 in ascending order. -72, -34, -11, -2, 4 Sort 5268445, 2, 3 in ascending order. 2, 3, 5268445 Put -69, -870, -4, 0 in increasing order. -870, -69, -4, 0 Sort -5, 15, 18, -60, 102. -60, -5, 15, 18, 102 Put 4, 1.23, 33, 0.4, 8/25, 1/6 in ascending order. 1/6, 8/25, 0.4, 1.23, 4, 33 Sort 4/7, 19, -9/83, 0, 33/28 in increasing order. -9/83, 0, 4/7, 33/28, 19 Sort 104/3, 2, 0.0002, 5, 3/17. 0.0002, 3/17, 2, 5, 104/3 Put 0.0388, 7770, 5, -2/3, -4 in increasing order. -4, -2/3, 0.0388, 5, 7770 Put 2, 0, 4, 1, 358, -10, -9 in increasing order. -10, -9, 0, 1, 2, 4, 358 Put 5, 3892, 32, 7, -3, -5, -7 in ascending order. -7, -5, -3, 5, 7, 32, 3892 Put 2, -2/3, -8, 68, 2/7, 0.9, 1 in decreasing order. 68, 2, 1, 0.9, 2/7, -2/3, -8 Sort 6, 3, -10, -23, 8 in ascending order. -23, -10, 3, 6, 8 Put -1150, -3206, 3, -1 in increasing order. -3206, -1150, -1, 3 Put -1123, 68, 0, -14, 1 in increasing order. -1123, -14, 0, 1, 68 Sort -4, 17, 10, 5, -2. -4, -2, 5, 10, 17 Put 4, 1200, -2/7, 3.22 in decreasing order. 1200, 4, 3.22, -2/7 Sort 3, 54, 41092. 3, 54, 41092 Sort 31, -195, -1, -0.4, -2/81 in ascending order. -195, -1, -0.4, -2/81, 31 Put 5, 4, -7, -5, 3470, 7, -1 in decreasing order. 3470, 7, 5, 4, -1, -5, -7 Sort -4, -1, -147, -107, 0, 2 in increasing order. -147, -107, -4, -1, 0, 2 Sort -205, 2/9, -40, -31/7, -0.2 in ascending order. -205, -40, -31/7, -0.2, 2/9 Sort 2, 27, 1, -4, 40517 in descending order. 40517, 27, 2, 1, -4 Put 2, -157, -64977 in decreasing order. 2, -157, -64977 Put 2683, 4, 3, -8 in descending order. 2683, 4, 3, -8 Sort -4, -45, 6, -128, 2, -38. -128, -45, -38, -4, 2, 6 Put -0.8, -46, -77/131 in decreasing order. -77/131, -0.8, -46 Put 117.8, 0.2, -273.58 in increasing order. -273.58, 0.2, 117.8 Put 0, 95, 5, -126, -3, 6 in ascending order. -126, -3, 0, 5, 6, 95 Put -429, 4, -1/5, 1, 2, 41/12 in ascending order. -429, -1/5, 1, 2, 41/12, 4 Put -5, -0.5, -0.055, 282, -2/21 in increasing order. -5, -0.5, -2/21, -0.055, 282 Put 4/15, 0.4, -1/7, -16, 0.9 in ascending order. -16, -1/7, 4/15, 0.4, 0.9 Sort 1/2, 0.2, 69, -0.13, 2, 2/11 in increasing order. -0.13, 2/11, 0.2, 1/2, 2, 69 Sort -2/771, -5, -44.25. -44.25, -5, -2/771 Sort 21, 35, 2, -1020, 1 in increasing order. -1020, 1, 2, 21, 35 Put 2, -4, -35731, -1, 4, 5 in decreasing order. 5, 4, 2, -1, -4, -35731 Sort -4, -587010, 0.4 in descending order. 0.4, -4, -587010 Sort 9, -397, 2, -2, 12. -397, -2, 2, 9, 12 Sort -57, 0, 8, 12992 in ascending order. -57, 0, 8, 12992 Sort 985, 25/36, -0.53. -0.53, 25/36, 985 Put -2/7, 3/7, 6/41, 0.037, 0.29 in decreasing order. 3/7, 0.29, 6/41, 0.037, -2/7 Sort -3, 1, -47, 11, 160 in decreasing order. 160, 11, 1, -3, -47 Put -5202, -5, 33, 0 in ascending order. -5202, -5, 0, 33 Sort -1, 2, -8593524 in decreasing order. 2, -1, -8593524 Sort 1, -7, -73, 176, -3 in increasing order. -73, -7, -3, 1, 176 Sort -3, 5, 484, -477, 4. -477, -3, 4, 5, 484 Sort -106, 10, -244, -3 in decreasing order. 10, -3, -106, -244 Sort 4/39, 0.3, 2503, -0.14. -0.14, 4/39, 0.3, 2503 Put 2, 2.657, -8, -2, -3 in decreasing order. 2.657, 2, -2, -3, -8 Sort 342, 4, 7, 16327. 4, 7, 342, 16327 Sort 7833, -3, -4, -14, 22. -14, -4, -3, 22, 7833 Sort 41/2, -3, 1, -23, 0.029 in descending order. 41/2, 1, 0.029, -3, -23 Put -1, 7, -5, 511, -2, 4 in descending order. 511, 7, 4, -1, -2, -5 Put -4.4471, -1, -0.27, 27 in ascending order. -4.4471, -1, -0.27, 27 Sort -0.4, -100, -27858 in increasing order. -27858, -100, -0.4 Sort -49, 4/5, 2/67, 16.1. -49, 2/67, 4/5, 16.1 Sort -0.019, -5, -4/51, -2, -2.99 in ascending order. -5, -2.99, -2, -4/51, -0.019 Put 786, 0, 76, -0.48 in decreasing order. 786, 76, 0, -0.48 Sort -3, -2, 4, 50, 29, 9. -3, -2, 4, 9, 29, 50 Sort -5, 21, 510, -6, -1, -3, 4 in descending order. 510, 21, 4, -1, -3, -5, -6 Put 40, -5, 1165552 in decreasing order. 1165552, 40, -5 Sort 3, 2533, 0, -299, -5. -299, -5, 0, 3, 2533 Put 5, 32, 2, -4, -174, -9, 9 in decreasing order. 32, 9, 5, 2, -4, -9, -174 Sort 1, 4, -1, -3, -5, 2922, -46 in ascending order. -46, -5, -3, -1, 1, 4, 2922 Sort -1/4, -0.1, 1/3, -1, -10014/11 in descending order. 1/3, -0.1, -1/4, -1, -10014/11 Put 5, 65245072, -1 in decreasing order. 65245072, 5, -1 Sort -40, -4, -29, 0, 4, 79 in increasing order. -40, -29, -4, 0, 4, 79 Put 2, -156, -5, -2, 6, -9 in decreasing order. 6, 2, -2, -5, -9, -156 Put 3693, -815, 0, -5 in descending order. 3693, 0, -5, -815 Sort 40, -4/5, -0.5, 19384 in decreasing order. 19384, 40, -0.5, -4/5 Sort 2602, -1, 1, -2, 548 in increasing order. -2, -1, 1, 548, 2602 Put -36/25, -1/3, 0.14, 1.1, 1 in increasing order. -36/25, -1/3, 0.14, 1, 1.1 Put -814984/11, -1, 3 in increasing order. -814984/11, -1, 3 Sort -28587, -299, 84. -28587, -299, 84 Sort 39, -3, 5, -22, -32 in ascending order. -32, -22, -3, 5, 39 Sort -627294, -1, -2, 92, 3 in descending order. 92, 3, -1, -2, -627294 Put -1, -1218472, 3, -5, 9 in increasing order. -1218472, -5, -1, 3, 9 Put -5, -3, 1213580, 5 in descending order. 1213580, 5, -3, -5 Sort 1, 2, 6, 5, 7, 125, -5 in ascending order. -5, 1, 2, 5, 6, 7, 125 Sort 1/145, -15/2, -145/27. -15/2, -145/27, 1/145 Sort -215, -91051, 4. -91051, -215, 4 Put 0.2, 3, -0.13, 7, 30, 218 in decreasing order. 218, 30, 7, 3, 0.2, -0.13 Sort -4, 5, 8, 764, 1, -351 in decreasing order. 764, 8, 5, 1, -4, -351 Put 2, -10, -0.8, -4, -5, 258 in decreasing order. 258, 2, -0.8, -4, -5, -10 Put -7, -1306, 4, -4, -5, -2 in increasing order. -1306, -7, -5, -4, -2, 4 Sort 5, 4, -31, -23, 0, -21 in descending order. 5, 4, 0, -21, -23, -31 Put 0, -6, 5, 2, -3	{ "pile_set_name": "DM Mathematics" }
d (-6 - 9 + 3)(0i + 0i + 3i). -36i Expand (-3h + 0h - 3h)(12 - 5 - 3). -24h Expand (-2 + 4 + 0)(-a2 - 4a + 4a) + (a + 0a + 0a)(-a + a - 4a). -6a*2 Expand (2k*2 + 0k2 - k2)(10k + 7 - 7)(-5k + 2k + 2k). -10k4 Expand (93 - 93 - 4i)(2 - 2 + i) - 1 - i2 + 1 + 2i*2 - 2i*2 + 2i*2. -3i*2 Expand 0k*2 - 2k*3 + 0k*2 + (0 - 2k + 0)(-2 + 2 + k2) + 10k*3 + 3k*3 + 14k*3 - 2k3 + k3 + 0k3. 22k*3 Expand 2h4 - 2 + 2 + (h3 + h*3 + 0h*3)(h + 0h - 3h) + (3 - 4 + 0)(2h + 5 - 5)(0h3 + h3 + 11h3). -26h*4 Expand (-2 + 3 + 0)(0f + 11f + 3f). 14f Expand (0v4 + 2v*4 + 0v*4)(-1 + 5 - 2)(22 + 5 - 6)(3v - 6v + 2v). -84v5 Expand r2 - 4r2 - r2 + r2 + 3r*2 - 2r*2 + 5r2 + r2 - 4r2 + (6r - 2r - 2r)(r - r + r) + 2r*2 - 2 + 2 + 3r2 + r2 - 2r2. 6r*2 Expand (5l + l - 5l)(2l - 5l + 0l) + (2l - l + 0l)(-3l - 4l + 5l) + l2 + 2l*2 - 4l*2. -6l2 Expand s2 + 4s3 - 1557s + 1557s + (s - 3s + 0s)(3s2 - 2s*2 + 0s*2). 2s3 + s2 Expand (-1 + 1 + 2v)(v - v + 2v)(-128 + 128 + 12v). 48v*3 Expand (-2i*2 + 2i2 + i2)(2i + i - 2i) - 2i3 + i3 + 4i3 + (-1 + 5i*3 + 1)(-1 + 2 + 2). 19i3 Expand (0g - 3g - 5g)(-2g + 6g - 2g) - g + 2g2 + g + 3 - g2 - 3. -15g*2 Expand (5y + 0y - 3y + 14)(-5y*2 - 2y*2 + 5y*2). -4y*3 - 28y*2 Expand (4g - 2g - g - 2g - 3g + 3g + (-g + 0g + 2g)(-4 + 5 - 2) + 4g - g - 2g - 2 + 3g + 2)(3g + 2g - 3g) - 2 + g*2 + 2. 5g*2 Expand (r - r - r)(-2r4 + r3 - r3) + (0r*2 + 0r*2 - 2r*4)(2 - 9r - 2) + r5 - 4r5 + r5. 18r5 Expand (3 - 2c - 3)(5c + 7c + 2c). -28c2 Expand 83 + 10u - 83 + (0 + 0 - u)(2 - 5 + 2). 11u Expand (5y2 + 0y*2 - 3y*2)(-3y - y + 0y) + 2y - 7y - y*3 + 3y. -9y3 - 2y Expand (-3m + 0m - 2m)(m - 5m + 3m - m + 0m + 2m + (-1 + m + 1)(-3 + 2 + 3) + m + 0m - 2m). -5m*2 Expand (2v*3 - 3v*3 + 0v*3)(6v - v - 3v) + (0v2 + 0v*2 - 5v*2)(0v2 + v2 - 2v*2). 3v*4 Expand (11d*3 - 2d*3 + 2d*3)(-2d + 4d + 0d) + d4 - d2 + d2 + (1 + d3 - 1)(-4d + 5d - 3d). 21d4 Expand b4 - 2b4 - 2b*4 + (3b2 + b2 - 7b2)(0b2 + b2 + 2b*2). -12b*4 Expand 5b*4 - 8b*4 + 7b*4 + (-3b + 3b - 3b*3)(b + 2b - 5b). 10b4 Expand (-l - l + 0l)(l - 2 + 2) + 13l*2 + 49l - 49l - 6l*2 + 5l*2 + 2l*2. 12l*2 Expand (13y + 9y - 7y)(y4 - 8y + 8y). 15y*5 Expand -5p*4 + 3p*4 + 0p*4 + (4 - 3 - 3)(3p2 - 3p*2 - 2p*4) + 2p*4 + 0p*2 + 0p*2 - 2p*4 + 28 - 28 - 3p. 2p4 - 3p Expand (-3s + 4 + 1 - 4)((5s + 0s - 3s)(3 + 0 - 1) + (3 - 3 - 1)(-2 + 2 - 3s)). -21s2 + 7s Expand ((2u - u + u)(3u + 0u - u) + u*2 - 2u*2 + 2u*2 - 2u + 9u2 + 2u)(-2u + 2u + 3u)(6u - 2u - 3u). 42u4 Expand -2s + 0 + 0 + (-2 + 2 + 1)(-3s - 2s + 3s) + (-4 + 0 + 2)(2 - 2 + 2s) - s + 5s - 2s + 0s + s - 4s. -9s Expand ((3 - 3 + z)(8 - 2 - 1) + 3z + z - 2z)(-3z - z + 3z)(-1 + 4 - 1). -14z2 Expand (1 - 2s*2 - 1)(1 - 2 + 3) + 2s2 - 4 + 4 - s2 + 4s*2 - 2s*2 + (-4s*2 - 4s*2 + 6s*2)(4 - 1 - 1) - 2s2 + 0s + 0s. -7s*2 Expand (4k*3 - 7k3 + k3)(1 - 2 - 2)(-2k - 6k + k). -42k4 Expand (12g*2 + 23g - 23g - 2)(0 + 0 - 2g2). -24g*4 + 4g*2 Expand (2a*2 - 4a2 + a2)(2 - 2 + 1 + (-2 + 1 + 0)(0 + 0 + 1) + 2 - 2 + 2 + (2 + 0 + 0)(0 + 0 - 2)). 2a*2 Expand ((-3 + 2z + 3)(3 - 2 + 1) + 0z + 2z + 0z + z - 4z + z)(7 + 6z4 - 8 - 7z*4). -4z*5 - 4z Expand (-c + c + 2c3)(642c - 642c + 10c2). 20c*5 Expand (-n - 23 + 44 - 23)(1 - 6 + 3). 2n + 4 Expand (7 - 7 + 2a*2)(-1 - 2 + 4 + (-3 + 0 + 5)(4 - 2 - 1)). 6a2 Expand (0 + 0 + d3)(3 - 2 + 0) + (-2 + d + 2)(d*2 - 4d*2 + 4d*2) - 4d + 4d + 2d*3 + 2d*3 + 3d*2 - 3d*2 - 3d*3 + 0d3 - d3. 2d3 Expand (7g - 6g - 4 + 0)(-5 - 4 + 4). -5g + 20 Expand (-2a - 1 + 1)(4a*3 - 4a3 - a3) + (-2a - a - a)(0a2 - a3 + 0a*2). 6a*4 Expand (2h*2 - 1 + 1)(0h - 3h + 2h)(3h - 5h + 3h). -2h4 Expand y5 - 2y5 - y5 + (2y + 0y - y)(0y2 - 2y*4 + 0y2) + y5 + 2y5 + 0y*5 + 3y*5 - 4y*5 + 0y*5. -2y*5 Expand (3 + 1 - 1)(d3 - d3 - 2d3) + (4d - 4d + 2d*2)(-d - 4 + 4) - 2 - 2d3 + 2. -10d*3 Expand (-210 - 103u + 210)(0 + 3 - 2). -103u Expand (-4d3 + 0d*3 + 2d*3)(-3d + 4d - 2d) - 4d*4 + 0d4 + d4 - d + 0d4 + d4 + 2d*4. 2d*4 - d Expand (-5 + 1 + 5)(4b + 2b - 4b)(1 + 0 + 1) - 3b + 1 - 1. b Expand ((-2i2 + i2 - i*2)(-1 + 1 + i) - 3 - 2i3 + 3 - 2i*3 + 2i3 + i3 + (-2i - 3 + 3)(2 - 2 - 2i2))(i*2 - 5i*2 - 6i*2). -10i*5 Expand (-20h - 3 + 11h + 17h)(-h - 3h - 2 + 0h). -32h*2 - 4h + 6 Expand (3r2 + 2r*2 - 4r*2)(-1 + 3 + 3)(-1 + 5 - 3)(-2r + 2r - 2r). -10r*3 Expand (-70r*3 + 142r*3 - 74r*3)(-3 + 5 - 1). -2r3 Expand (-12x - 6 + 6)(-2x*2 - 2 + 2). 24x*3 Expand (-o - 4 + 4)(-3o + 0o + o) - 7 + 7 - 5o2 + (3 + o - 3)(3o + 4o - 3o). o2 Expand 4m*4 - 4m*4 + 3m*4 - 1 + 1 - 4m4 + (-m2 + 2m2 - 3m*2)(4m + 2m*2 - 4m) + 1 - 3m4 - 1 - 5m*4 + 0m*4 + 3m*4. -10m4 Expand -1 + 1 + l2 + (6l + 0l - 4l)(-l + 5 - 5) + (1 + 8 + 1)(-4l2 + l2 + 2l2). -11l*2 Expand (-4 - 4 - 1)(2m + 2m - 6m + (-m + 6m - 3m)(2 - 2 - 1) + 1 - 1 + m). 27m Expand ((-4 + 3 + 0)(2s - 4s + 3s) + 2 - 2 - s)(2s3 - 4s*3 + 3s*3). -2s*4 Expand (s - 2s + 6s)(3s3 + 3s - 3s) + (-3s - 2s + 3s)(-2s3 + s3 - s*3). 19s*4 Expand (-1 + 0 + 2)(2 - 1 - 2)(-2z + 3z - 3z)(3z*2 - 33 + 33). 6z*3 Expand (3y - 2y + 0y)(3y*2 + y - y)(5y2 - y2 - 3y*2). 3y5 Expand (d3 - d4 - d3)(0 + 0 - 2d) + 2d5 - 3d*2 + 3d*2 + 2d*5 + 2 - 2 + (2d - 2d - d2)(2d3 - d3 - 2d*3) + 2d5 + d5 - 2d5. 8d*5 Expand (0h - 2h - h)(-9 + 1 + 1). 21h Expand (5 + 2 - 5)(0o + 4o - 3o) + 3 - 2o - 3 + 2o + 0o - o + (0 - 3 + 2)(o + 0o - 2o) + 1 + 2o - 1. 4o Expand (a + a - a)(-8 + 6 - 6) - 2 - a + 0 + 1. -9a - 1 Expand 7x*5 + 0x*5 - 3x*5 + 4x*5 - 3x + 3x + (x + 5x - 4x)(x*4 + 3x*3 - 3x*3). 10x5 Expand 1 - 1 + o3 + (-o + 0o + 3o)(-3o*2 + 13 - 13) - 2o*3 - 1 + 1. -7o3 Expand -f2 + 2f4 + f2 + (1009 - 7f - 1009)(0f - 2f3 + 0f). 16f4 Expand 2r*5 + 0r*5 - 6r - 2r + (-r4 - 4 + 4)(-r + 4r - 4r). 3r5 - 8r Expand (k - 2 + 2)(30k*3 - 17k*3 - 7k*3). 6k*4 Expand (-13 + 13 + 4x)(5x - 2x - 2x + (2x + 0x - 4x)(-2 - 4 + 4) - 1 + 2x + 1 + 18x + x - 2x). 96x*2 Expand 16g - 11g - 6g - 12g2 + (g2 - 2g*2 + 3g*2)(-4 + 2 + 3). -10g2 - g Expand (-2k*3 - 2k*3 + 6k*3)(1 + 0 + 0)(0k + 0k - k) - k4 + 0k*4 + 0k*4 + (3 + 2k*4 - 3)(1 - 1 + 1). -k*4 Expand (-8f + 6f + 4f + (1 - 1 - 2)(f - 5f + 3f))(5 - 4 - 4) + 3f - 1 + 1. -9f Expand -z*2 + 3z*2 + 11z2 + z3 - z*3 - 4z*3 + 6z*3 + (-2z*3 + 5z*3 - 2z*3)(1 + 1 + 0). 4z3 + 13z*2 Expand (-3h + 4h - 4h)(-3 + 3h + 3 + h + 3h - 6h + (0h + 3h - 2h)(1 - 2 + 0) - 2h - 2 + 2 + 2 - 2h - 2 + 4h - 5h - h). 18h2 Expand (60s*2 - 109s*2 + 61s*2)(-s + 0 + 0). -12s3 Expand (2 - 6 + 3)(4a4 - 4a*4 - 11a*4). 11a*4 Expand (2c - 1346 + 0c + 1382)(c + c + 0c). 4c*2 + 72c Expand -18 + 42c + 6 - 40c + 3 - 3 + c + (-2 - 1 + 2)(1 + 2c - 1) + 4 - 4 - c + 0 + 0 - 2c. -2c - 12 Expand (-q - 3 + 3 + (-5q + 2q + 4q)(4 + 2 - 2))(-2q*2 + 0q + 0q). -6q*3 Expand ((2 - 4 + 0)(-s - 3s + 2s) - s - 3s + 3s + 2s + 3s - 6s + (-3 + 4 + 0)(-3s + s + s))(-3s + 2s + 0s). -s2 Expand (-46i - 4i + 6i)(-2i*3 + 2i3 - i3). 44i4 Expand -3w*4 + 8w*4 + 0w*4 + (-4 - 2w + 4)(2w*2 - 2w2 - w3) + 3w4 + w4 - 3w*4. 8w*4 Expand (-2a*4 - 4a + 4a)(2 - 6 - 1)(2 - 2 - 1). -10a4 Expand (-p + p + p2)(-3 + 4 + 0) + (2p + 4 - 4)(2 + 2p - 2) - 8p2 + 0p2 - p2. -4p*2 Ex	{ "pile_set_name": "DM Mathematics" }
+ 31. What is the highest common factor of l and 11? 11 Let v be (-83)/(-9) - (-4)/(-18). Let r = -6 + v. Suppose 2c - 6c - 2g = -54, 4g + 36 = 4c. What is the highest common divisor of c and r? 3 Suppose -4d = 3 + 1. Let n = 82 + d. Calculate the highest common divisor of 27 and n. 27 Let n be (-3)/6 + 8430/12. What is the greatest common divisor of 156 and n? 78 Suppose 0n + 2n = 12. Let p = -246 + 270. Calculate the highest common divisor of p and n. 6 Suppose 4p - s - 67 = -p, p = -4s + 26. Let l(i) = 3i3 + 4i*2 - 4i + 3. Let m be l(2). Calculate the highest common divisor of m and p. 7 Let m(a) = 55a3 - a2 - a + 1. Suppose -3c = 2c - 5. Let b be m(c). Let z be ((-66)/9)/((-4)/b). Calculate the highest common factor of z and 11. 11 Let x be (-3)/(6 - (-4543)/(-504) - -3). What is the greatest common factor of 27 and x? 27 Let s = -731 + 747. Calculate the highest common divisor of 104 and s. 8 Suppose -17 = -2v - 9. Let u = -18 - -34. What is the highest common factor of u and v? 4 Let l(x) = x*3 - 2x*2 + 2x + 17. Let o be l(4). Calculate the highest common factor of o and 3. 3 Suppose -10f - 84 = -12f. Suppose 0 = 5t + 142 - f. Let r = t + 31. What is the greatest common factor of 1 and r? 1 Suppose -3i + 135 = -3o, 73 + 112 = 4i - 5o. Calculate the greatest common factor of 140 and i. 20 Suppose 0m = -5m + 25. Suppose -5g + 3z + 7 = -5, -3g + 2z + 7 = 0. Let n be (-1 - -2) + g + 11. What is the greatest common divisor of m and n? 5 Suppose 0 = 2p - 3w - 75, -5p + 168 = 5w - 57. Calculate the highest common divisor of p and 987. 21 Let a be -3 + 9 - (-1)/(-1). Let v(p) = -6 + 28 + 2p - 12 - 6. Let o be v(a). What is the highest common divisor of 98 and o? 14 Let n = -99 - -129. Calculate the greatest common divisor of n and 570. 30 Suppose -3g - 9 = 0, -3a - 6 = -3g - 0g. Let v be -1 + -3 + 15 + a. Calculate the highest common divisor of v and 66. 6 Let g = 103 + -101. Suppose -p + gp = 84. Calculate the greatest common divisor of 12 and p. 12 Let z be (8/6)/(-4)-39. Suppose 12 = -9k + zk. Suppose kp - 88 = -p. Calculate the greatest common factor of p and 44. 22 Let p = -356 + 388. Calculate the greatest common factor of p and 6. 2 Let f = 28 - 26. Suppose 2k = 2b, fb - 3k + 3 = -0b. Suppose -365 = -5i + w - 38, 0 = i - bw - 57. What is the highest common divisor of i and 6? 6 Let n be 8/28 + 556/14. Suppose -5h + 115 = -n. Suppose -i - 3w + 57 = 2i, -5w - h = -2i. Calculate the greatest common divisor of 12 and i. 6 Suppose 208 = 2n - 0n. Suppose 3u + 9 = -4o, 2o - 5u + 0u = 15. Suppose o = 5z - z - n. What is the highest common divisor of 234 and z? 26 Let d be 95/(1/1(1 - 0)). What is the highest common divisor of 15 and d? 5 Let s be (-16)/(-3) + (-1)/3. Suppose -5m + 2b + 26 = 0, -5b - 2 = -4m + 12. Suppose -35 = -o - mo. What is the highest common factor of o and s? 5 Let h(g) = 22g*3 - 4g - 4. Let c be h(2). Calculate the greatest common divisor of 123 and c. 41 Let n be (-10)/472/(-10). Let m(p) = -9p + 9. Let b(g) = -8g3 + g. Let v be b(1). Let w be m(v). What is the greatest common divisor of n and w? 18 Let l = 26 - 3. Let j = 27 - l. Suppose 4 = 3g - 4g, 4c - 136 = -jg. Calculate the greatest common divisor of 95 and c. 19 Let c = 255 + -180. Calculate the greatest common factor of c and 30. 15 Let o(x) = -3x + 13. Let m be o(3). Suppose -4 = 4v, 5g = -mv + 45 + 41. Calculate the greatest common divisor of 126 and g. 18 Let z(r) = 8r - 4. Let w be z(6). Suppose 0 = 3n - 6n - 9. Let f be (-9)/(-3) + (n - -4). What is the highest common factor of f and w? 4 Let t(r) = r*3 - 13r*2 - 14r + 9. Let d = 10 + 4. Let u be t(d). What is the greatest common factor of u and 63? 9 Suppose -9 = -3h, -129 = 2q - 7q - 3h. What is the greatest common factor of 120 and q? 24 Let r = -139 + 136. Let z be (r(-80)/18)/((-26)/(-117)). Calculate the greatest common factor of 45 and z. 15 Suppose -4d + 53 + 7 = 0. What is the highest common factor of 15 and d? 15 Suppose 0q - 5q - 3l = 2, 0 = 4q - 2l - 16. Suppose -234 = -5g + 5s + 181, -qg + 5s + 163 = 0. Calculate the highest common divisor of g and 28. 28 Let c(x) = 2x - 7. Let z be c(7). Let m = -180 - -300. Let k = -71 + m. What is the greatest common divisor of z and k? 7 Let k = 9 - -2. Suppose 31 = 5g + 4x, -4g - x = -k - 5. Let j = 14 + -8. Calculate the highest common factor of j and g. 3 Let n(k) = -6 + 1 + 2 + 2k + 2. Let x be (-4 - -18) + 1/(-1). Let c be n(x). What is the highest common divisor of c and 175? 25 Suppose -5i + 50 = 5l, -l = -i + 1 + 1. Let s(t) = -t*2 + 16t - 14. Let k be s(i). What is the greatest common factor of k and 23? 23 Let n(u) = u*3 - 51u*2 - 54u + 256. Let w be n(52). What is the greatest common factor of w and 133? 19 Let w be (12/(-20))/(3/(-195)). What is the greatest common divisor of w and 104? 13 Let t = 52 - 37. Suppose -33w + 37w - 420 = 0. Calculate the greatest common divisor of w and t. 15 Let h be 2 + -7 + (-20)/5. Let b = -7 - h. Suppose -588 = -5w + 5n + 287, -bw + 358 = -4n. What is the highest common factor of 19 and w? 19 Suppose -2z = k - 6, 5k = -10z + 9z + 39. Let m = 3 - 5. Let b be 42 - 1/m-4. Calculate the greatest common factor of k and b. 8 Let t be -3((-4)/(-3))/1. Let s be ((-124)/2 + t)/(-2). Let x = s + -24. Calculate the greatest common factor of x and 36. 9 Suppose 34 = 2p + i, 3p + 8i - 25 = 13i. What is the greatest common factor of 1515 and p? 15 Suppose 225 = 26k - 87. Calculate the greatest common factor of 66 and k. 6 Let f = -103 + 166. What is the greatest common factor of 42 and f? 21 Let x(w) = -9w*3 + 51w*2 - 12w + 2. Let o be x(5). What is the greatest common factor of o and 1472? 92 Let h(y) = -y*2 - 25y + 44. Let d be h(-20). Calculate the greatest common divisor of 60 and d. 12 Let b(t) = t*3 - 8t*2 + 5t + 15. Let h be b(8). Let f be 3 - 1 - (28 + -37). What is the greatest common divisor of f and h? 11 Let v(n) = 73n + 300. Let r be v(0). What is the greatest common divisor of r and 75? 75 Let k(u) = u2 - 14u - 9. Suppose -2i = v - 50 + 15, 0 = 2i - 5v - 17. Let y be k(i). Calculate the greatest common divisor of y and 207. 23 Suppose 555 = 11q - 28. What is the highest common factor of 212 and q? 53 Let k(a) = a*2 + 2a - 11. Let z be k(5). Suppose 0o = o - 120. Suppose 2f - o = f. What is the greatest common divisor of z and f? 24 Suppose -39w = -1135 - 1829. Calculate the greatest common divisor of 1216 and w. 76 Let c be (22 - 1) + -144 + 141. Let q(o) be the second derivative of 5o*3/6 + 3o*2 + o. Let m be q(6). What is the highest common divisor of c and m? 18 Let x = 17 + -8. Suppose -388 - 1097 = -15v. Calculate the highest common factor of x and v. 9 Let m be ((-294)/(-30) + -8)40/6. Let t(f) = 3f - 25. Let y be t(m). What is the highest common factor of y and 44? 11 Suppose -f - 3u = 5, 2f = -f - 2u - 1. Let b be f2/(-2) - 11. Let n be b5/((-30)/16). Calculate the greatest common factor of 8 and n. 8 Let j = 31 + -22. What is the greatest common factor of 1422 and j? 9 Let o be (-1 - 1)/((-11)/77). Let m(i) = -i3 + 11i*2 - 3i - 9. Let p be m(9). What is the highest common divisor of o and p? 14 Suppose -o + r + 73 = 27, -5o = -3r - 236. Let v = 786 - 779. Calculate the greatest common divisor of v and o. 7 Suppose -59 = -9m + 31. Let y(x) = x2 - 6x. Let k be y(m). What is the greatest common divisor of k and 20? 20 Suppose 5x = 0, -2h + 696 = 2h + 3x. Let r be h/15 + 1 + (-2)/(-5). Calculate the greatest common divisor of r and 143. 13 Suppose x - 4 - 32 = -4i, 5i = -5x + 45. Calculate the highest common divisor of 117 and i. 9 Suppose 6 = 3d - 3. Suppose 5m - 55 - 125 = -4l, dl = 0. Suppose -2f = -m - 2. What is the greatest common divisor of f and 133? 19 Let p be 6/(-4) + (-39)/(-2). Suppose 4o - 93 = 3c, 4o - 63 = 2c + 35. What is the highest common factor of o and p? 9 Let w(a) = -24a - 32a*2 + 57a*2 - 23a*2 - 4. Let h be w(14). What is the highest common factor of h and 13? 13 Let z = 13 - 10. Suppose zm - 38 = 4s, 5m - 2s - 102 = -5s. Suppose -2q + 412 = -4k, 376 = 2*q -	{ "pile_set_name": "DM Mathematics" }
43. Let k(r) = -7r3 + 4r*2 - 281. Calculate 4a(w) + 11k(w). -w3 + 281 Let w(f) = 8f + 5. Let j be (-60)/(-8) - (3 + 10/(-4)). Let q(u) = -9u - 6. Determine jw(l) + 6q(l). 2l - 1 Let o(r) = 4r - 1. Let h(x) = 482x + 4. Determine h(n) + 6o(n). 506n - 2 Let o(x) = x*2 - x + 1. Suppose -5y + 5p = -20, 5y + 7p = 3p + 20. Let v(q) = 5q2 - 4q + 2. Determine yo(g) - v(g). -g2 + 2 Let y(d) = -6d*2. Let r(k) = 3k2. Let s(u) = u2 - 54u + 320. Let x be s(7). Give xr(p) - 4y(p). -3p*2 Let b(u) = 5u - 18. Suppose -v + 2v - 9 = -d, -v - 57 = -5d. Let t(g) = dg - 10g + g - 6. What is -3b(c) + 8t(c)? c + 6 Let n = 74 - 73. Let k(w) = -n - 3w - w + 0w + 6w2 + 2. Let q be -4 + 2 + (-9)/(-1). Let u(b) = -11b*2 + 7b - 2. Give qk(j) + 4u(j). -2j2 - 1 Let p(u) = -u2 + 2u. Let w(q) be the second derivative of -5q4/12 + 11q*3/6 - 206q. Give 11p(k) - 2w(k). -k*2 Let y(i) = -3i*2 - 271. Let o(r) = 2r*2 + 273. What is 5o(m) + 4y(m)? -2m*2 + 281 Let h(y) = -1. Let z(g) = -g + 2. Let o(a) = -2h(a) - z(a). Let q(w) = -8w. Give 51o(u) + 6q(u). 3u Let l(p) = 20p3 - p2 - 12p - 14. Let w(f) = 3f + 1. Calculate -l(s) - 4w(s). -20s3 + s2 + 10 Let y(f) = 17f*2 - 8f + 8. Let g(v) = 11v2 - 5v + 5. Let o(j) = -2j - 9. Let r be o(-4). Let x be (-93)/(-12) + r/(-4). Give xg(l) - 5y(l). 3l*2 Let g(f) = -688f. Let a(w) = 154w - 80w - 101w. Determine -128a(b) + 5g(b). 16b Let m(r) = r3 - r2 + r. Let q(f) = -3f3 + f2 - 3f + 2. Suppose 0 = 5d - 5g + g + 178, 4d - 2g + 140 = 0. Let p = d + 33. What is pm(i) - q(i)? 2i*3 + 2i - 2 Let v(r) = 2r2 - 2r + 127. Let a(q) = q*2 - 2q - 4. Give -a(f) + v(f). f*2 + 131 Let g(v) = -3v*2 + 5v - 3. Let a(s) = 6s2 - 9s + 5. Suppose 2y - 3z + 1 - 7 = 0, y - 5z = -11. Suppose -3l + yl = 18. Give la(f) + 5g(f). 3f*2 - 2f Let s(q) = q*2 + 58q + 3. Let f(h) = -h*2 - 59h - 2. What is -4f(l) - 3s(l)? l*2 + 62l - 1 Let o(s) be the second derivative of -s3/3 + s2 - 8s. Let n = 21 - 22. Let u be n/(-24/16). Let p(k) = 1. Calculate up(l) - o(l). 2l Let z(v) = -8v - 11. Let x(h) be the second derivative of 0 - 7/6h*3 - 5h*2 + 8h. Give -7x(q) + 6z(q). q + 4 Let q(a) = 2a2 + 55a - 1 - 54a - a2. Let o(d) = -d + 2. Let n(j) = -j2 - 8j + 1. Let u be n(-8). Calculate uq(x) + o(x). x2 + 1 Let c(u) = 35u*2 + 4u + 3. Let k(a) = 245a2 + 30a + 20. Determine 15c(b) - 2k(b). 35b2 + 5 Let l be 1 + ((-7)/((-14)/10))/1. Let b(z) = 7z + 49. Let c(h) = h + 6. Give lb(j) - 49c(j). -7j Let l(c) = 950c - 9. Let k(h) = 477h - 4. Calculate 5k(f) - 2l(f). 485f - 2 Let m(i) = 1 - 98i2 + 49i*2 + 56i*2 - 6 + 4i. Let q(p) = -p + 1. Determine m(z) + 5q(z). 7z*2 - z Let s(n) = -2n + 7. Suppose -5p = -1 + 26. Let c(k) = 10k - 19. Let z(b) = 7b - 13. Let j(h) = 5c(h) - 7z(h). Let g be 1(1-3)/1. Give gs(u) + pj(u). u - 1 Let x(f) = 14f + 2. Suppose 3c + 6 = 2d + d, -3d + 12 = -5c. Let z(q) be the third derivative of q*4/24 - 11q*2 - 2. Give dx(i) + 12z(i). -2i - 2 Let t(u) = u - 209. Let i(v) = -5v + 839. Determine -2i(r) - 9t(r). r + 203 Let h = 1 + -8. Let w(a) = -13a*3 + 6a*2 - 10a. Let j be 10/(-30) + 20/(-12). Let b(u) = 4u3 - 2u*2 + 3u. Give hb(g) + jw(g). -2g3 + 2g2 - g Let u(p) = p3 - p*2 - 1. Suppose 1 = -4k - 7. Let l = 4 - 6. Let f(t) = 11t - 21595t*2 + 21596t*2 - 10t. What is kf(i) + lu(i)? -2i3 - 2i + 2 Let k(x) = x + 1. Let z = 11290 - 11286. Let u(f) = 7f + 2. Suppose -5a = -5j - 7 + 27, -2j + 2 = 4a. Calculate au(y) + zk(y). -3y + 2 Let k = 198 + -196. Let j(f) = -4f3 + 2f2 + f. Let w(h) = -h3 + h*2 - h. Determine kw(s) - j(s). 2s3 - 3s Let z(g) = -78g - 9. Let s(o) = -77o - 11. Give -4s(d) + 5z(d). -82d - 1 Let x(b) = 3b2 + b - 6. Let n(v) = -v2 - 1. Give 5n(o) - x(o). -8o*2 - o + 1 Let c(f) = 0 + 2 + 2 + 10f + 1. Let p(g) = g + 1. Determine c(m) - 3p(m). 7m + 2 Let j(t) = t*2 - 13t - 8. Let d be j(13). Let f(g) = 3g3 + 4g*2 + 4g. Let m(u) = 5u3 + 6u*2 + 6u. Let h be 6/3 + -3 + 6. What is df(z) + hm(z)? z*3 - 2z*2 - 2z Let v(j) = -9312j + 64. Let k(s) = 716s - 5. Give 64k(b) + 5v(b). -736b Let h(p) = p + 2. Let x(g) = -g2 - 6g - 31. Give -5h(l) - x(l). l2 + l + 21 Let q(k) = -49k*2 + 13k - 9. Let m(x) = -16x2 + 4x - 3. What is -7m(u) + 2q(u)? 14u2 - 2u + 3 Let i(b) = 3b - 2. Let z(f) = -2f + 1. Suppose r + 11 = 4p + 4, 0 = 5r + 4p - 61. Suppose -rj - 148 = -58. Calculate jz(w) - 6i(w). 2w + 2 Let x(j) = -20j + 2. Let c(f) = 2f. Calculate -6c(g) - x(g). 8g - 2 Let i(l) = 2l - 250. Let r(h) = h - 84. Give -3i(s) + 8r(s). 2s + 78 Let y = -3 - -4. Let n(o) = -19o + 11. Let r(l) = 16l - 10. Let j(x) = 4n(x) + 5r(x). Let q(f) = -f + 1. Determine yj(k) + 5q(k). -k - 1 Let t(l) = l. Let b(r) = 4r*2 + 61r + 16. Let o be b(-15). Let j(q) = -2q - 2. Give oj(s) + 3t(s). s - 2 Let f(o) = 13o + 5. Let g(w) be the first derivative of -3w2/2 - w + 17. Calculate 2f(c) + 9g(c). -c + 1 Let j(k) = 1. Let z be 8/52 - (-284)/13. Let g = z - 13. Let s(v) = -v + 11. Let y(o) = 3. Let i(n) = gy(n) - 2s(n). What is -i(w) + 5j(w)? -2w Let y(c) = 4c. Let x(q) = 2q. Let n = 223 + -219. Determine ny(g) - 9x(g). -2g Let b(i) = 11i2 + 7i - 2. Let u be (90/(-150))/((-2)/202). Let l(x) = 5x*2 + 3x - 1. Give ub(c) - 7l(c). -2c2 + 1 Let s(z) = 14 - 9 - 4z2 - 16. Let i(d) be the third derivative of -d5/10 - 17d3/6 - 4d*2 - 1. Determine -5i(q) + 8s(q). -2q2 - 3 Let o(y) = y3 - y*2 - y. Let c be (-5)/1530/(-2). Let n(j) = -cj2 + j2 + 3j*3 + 13j + 9j - 26j. Determine n(l) - 5o(l). -2l3 + l2 + l Let s(y) = -91y2 - 77. Let k(m) = -13m*2 - 12m. Let w(o) = 14o2 + 14o - 1. Let q(j) = 7k(j) + 6w(j). Determine 77q(f) - 6s(f). 7f2 Let k(b) = b. Let c(j) = 16j + 1. What is -c(i) + 2k(i)? -14i - 1 Let d(i) be the third derivative of 7i5/60 + i3 + 38i*2. Let a(p) = 7p*2 + 7. Determine 6a(q) - 7d(q). -7q*2 Let r(c) = 12c - 381. Let n(m) = -5m + 190. Calculate 7n(b) + 3r(b). b + 187 Let m(u) = 185u*2 - 5u + 5. Let g(l) = -186l2 + 4l - 4. Calculate -5g(z) - 4m(z). 190z2 Let y(m) = m3 + 1. Let w(v) = 30v*3 + 21. Let u be -6 + 8(-9 - -10). Give uw(n) - 42y(n). 18n3 Let a(g) = -25g*2 - 24g. Let o(h) = h*3 - h. What is a(i) + 2o(i)? 2i3 - 25i*2 - 26i Let y(g) = 2g3 + 143. Let u(z) = -3z*3 - 144. Determine 3u(f) + 4y(f). -f3 + 140 Let c(t) = t3 - 2t2 + 3. Let u(f) = f2 + 6f - 19. Let o be u(-8). Let a(n) be the first derivative of n4/2 - n3 + 5n - 6. Give oa(s) + 5c(s). -s3 - s2 Let p(v) = 4v3 + 5v*2 - 5v - 3. Let m(h) be the second derivative of -3h5/20 - h4/3 + 2h3/3 + h2 - 56h. Determine 3m(c) + 2p(c). -c3 - 2c*2 + 2c Let b(c) = -36c3 + 69c*2 - 68c*2 - 7 - 6c + 44c3. Let u(o) = -o3 + o + 1. Give b(l) + 6u(l). 2l3 + l2 - 1 Let d(j) = -5j*2 - 3j + 1. Let s(b) = 3b2 + 2b + 1. Calculate -4d(n) - 7s(n). -n*2 - 2n - 11 Let c be (36/16)/((-60)/160). Let s(i) = i3 - i2 - 6i. Let y(a) = -a3 + 2a*2 + 11a. Give cy(b) - 11s(b). -5b3 - b2 Let f(r) = 133r + 6. Let n(i) = 14097i + 635. Calculate -635f(z) + 6n(z). 127z Let t(h) = h*2 - 4h + 1. Let d(u) = 897u2 + 16u - 4. Give -d(s) - 4t(s). -901s2 Let f(w) = -w3 + 5w3 - 9w + 7w2 - w + 2 + 4. Let b(c) = -3c*3 - 6c*2 + 9c - 5. Give 6b(i) + 5f(i). 2i3 - i2 + 4i Let k(v) = -3v2 + 2v + 11. Let o(d) = 8d2 - 6d - 31. Calculate -17k(c) - 6o(c). 3c2 + 2c - 1 Let b(l) = 29l - 118. Let p(x) = -18x + 79. What is 5b(i) + 8p(i)? i + 42 Let n(w) = 2 + 8 - 1 - 8. Let z(i) = i + 4. Let k be 16/(-6)(-78)/52. What is kn(x) - z(x)? -x Let p(d) = -39d2 + 5. Let a(j) = -527j*2 + 68. Let m be (-4)/(-6) - (-117)/27. Calculate ma(f) - 68p(f). 17f*2 Let k(a) = 5a. Let r(x) = -149x. Calculate -6k(s) + r(s). -179s Suppose 0j + 4 = 4j. Let x(r) = 21r + 1 + j - 19r. Let n(d) = -3 + 5 - 5 + 4. Determine -3n(s) + x(s). 2*s - 1 Let c(g)	{ "pile_set_name": "DM Mathematics" }
se 4, what is -12301233 + 1? -12301232 In base 6, what is -1322 + -5500? -11222 In base 9, what is 1868 + -215? 1653 In base 5, what is 413 + 2? 420 In base 7, what is -254 - -1056? 502 In base 14, what is 195b + -8? 1953 In base 14, what is 412db - 3? 412d8 In base 5, what is 234 - -201? 440 In base 2, what is -10001101001101101 - -1? -10001101001101100 In base 2, what is 1110010011111 - -11? 1110010100010 In base 3, what is 1221102221120 - 2? 1221102221111 In base 9, what is -1075564 + 1? -1075563 In base 8, what is 471071 + 5? 471076 In base 7, what is 353 + -14401? -14015 In base 9, what is -2815 + -10? -2825 In base 15, what is 1a1 - -2? 1a3 In base 2, what is -1010100010111010100 - -10? -1010100010111010010 In base 11, what is -30a6 - -364? -2842 In base 6, what is 30 + -1415? -1345 In base 2, what is -1111 + 11011100101? 11011010110 In base 2, what is 1001101101 + 1100000? 1011001101 In base 7, what is 141040 - -2? 141042 In base 9, what is -1213 + 200? -1013 In base 8, what is -117 + -3674? -4013 In base 2, what is 1010000111111111101 - -10? 1010000111111111111 In base 15, what is cc50b - -3? cc50e In base 8, what is -203 + 1114? 711 In base 2, what is 101 - -10001001100101010? 10001001100101111 In base 9, what is -48158 - 217? -48376 In base 10, what is -679 - 67? -746 In base 12, what is -2 - 14a28? -14a2a In base 4, what is 22 - 133032000? -133031312 In base 6, what is 340532 - -3? 340535 In base 12, what is -13 + 107a3a? 107a27 In base 6, what is 545 + 30? 1015 In base 2, what is -10100110110101110 + -11? -10100110110110001 In base 12, what is 0 - 97737? -97737 In base 9, what is -110 + -135? -245 In base 3, what is 1220012 - 10112? 1202200 In base 14, what is -4 - -40762? 4075c In base 13, what is -23468 + -2? -2346a In base 2, what is 101011 - 10000010011? -1111101000 In base 5, what is 110 + 12130? 12240 In base 8, what is 43 - -11023? 11066 In base 9, what is 5433 + 147? 5581 In base 4, what is 1032 - -30131? 31223 In base 6, what is -1231 - -21111? 15440 In base 4, what is 1000023 + 3? 1000032 In base 7, what is 5250 + -26? 5221 In base 7, what is -12551 - 154? -13035 In base 8, what is -1 - 177102? -177103 In base 12, what is -5026 + -34? -505a In base 12, what is -2 - -128979? 128977 In base 11, what is 341 - 89? 263 In base 9, what is 1371 - -13? 1384 In base 3, what is -111022111012 - 2? -111022111021 In base 13, what is -3 - -414? 411 In base 4, what is -3 - -331020? 331011 In base 14, what is 4 + 30917? 3091b In base 13, what is 29352 + -13? 2933c In base 3, what is 20201222011100 + -2? 20201222011021 In base 14, what is -3 + aa4? aa1 In base 7, what is -311644 - -6? -311635 In base 2, what is -1 + 111001011000101010? 111001011000101001 In base 5, what is -120 - 131? -301 In base 11, what is 0 + 73330? 73330 In base 6, what is 223 + 230500? 231123 In base 7, what is 10 - 2166214? -2166204 In base 16, what is -2 - -2b87? 2b85 In base 11, what is -43 + 41? -2 In base 5, what is -3 + 24342110? 24342102 In base 13, what is -bc5 + 227? -99b In base 6, what is -31 - 135? -210 In base 13, what is 2a36a8 - 1? 2a36a7 In base 7, what is -1 + -241511? -241512 In base 11, what is -211524 + -5? -211529 In base 11, what is 458 + -4a0? -43 In base 15, what is 7 + -cee0? -ced8 In base 4, what is 1010101 - 10? 1010031 In base 7, what is 1 + -110230? -110226 In base 13, what is 91165 - -1? 91166 In base 8, what is 4 + -213463? -213457 In base 7, what is 12143 - -16? 12162 In base 14, what is -45 - 43? -88 In base 3, what is 20 - 12121200? -12121110 In base 9, what is -2 - 11754? -11756 In base 12, what is -4a520 + 0? -4a520 In base 9, what is 125 + -1251? -1125 In base 10, what is 15030 - 42? 14988 In base 4, what is -20322302 + -223? -20323131 In base 15, what is 6 - -14eb? 1502 In base 14, what is 799 - -a8? 863 In base 2, what is 101 - 100111010111011101001? -100111010111011100100 In base 9, what is -4412 + 5? -4406 In base 12, what is -1489 - 356? -1823 In base 5, what is 131332 + -3? 131324 In base 7, what is -11305424 - 3? -11305430 In base 3, what is 2121122112 + 101? 2121122220 In base 11, what is 7 - -21521? 21528 In base 11, what is -1547 + 678? -97a In base 5, what is 3 - -11440010? 11440013 In base 2, what is -101011 - 11001111? -11111010 In base 13, what is -144 - -69b? 557 In base 12, what is -10 - -352? 342 In base 12, what is -3758b - -49? -37542 In base 9, what is -260 - 1641? -2011 In base 12, what is -191 + -789? -95a In base 16, what is eeb17 + -2? eeb15 In base 5, what is 30010 + -201? 24304 In base 14, what is 49 - 179cc? -17983 In base 11, what is -847 - 19? -865 In base 15, what is e13b - 0? e13b In base 4, what is 111211031 - 10? 111211021 In base 13, what is -4 + 2b82c? 2b828 In base 11, what is 8619 + -a? 860a In base 10, what is 41 - 24686? -24645 In base 8, what is 22 - -150432? 150454 In base 13, what is 325 + 12? 337 In base 3, what is -1021211110122 + 21? -1021211110101 In base 7, what is -63 + -200231? -200324 In base 14, what is -3828 - -2b? -37db In base 8, what is 10402 - -32? 10434 In base 3, what is 2100 - 10000022? -2220222 In base 5, what is 12 - -443200? 443212 In base 3, what is 201 - -1020112021? 1020112222 In base 12, what is 1 + 9297a? 9297b In base 2, what is 1111 + -11100? -1101 In base 12, what is 1 + b4693? b4694 In base 5, what is 13 + -2041242? -2041224 In base 7, what is -3 + -5332? -5335 In base 15, what is -5d41 - -3? -5d3d In base 8, what is 1470074 + 3? 1470077 In base 5, what is 1140223 + 41? 1140314 In base 14, what is -2 + 64c1? 64bd In base 7, what is 5 + 3326600? 3326605 In base 7, what is -5 - 4353633? -4353641 In base 7, what is -13526 - 350? -14206 In base 12, what is 20809 + -a1? 20728 In base 11, what is 0 + -53081a? -53081a In base 13, what is -887 + -153a? -20c4 In base 8, what is 21553 + 6? 21561 In base 2, what is -1100111 + -10101110? -100010101 In base 14, what is 5db - 4c3? 118 In base 12, what is -2 - -3166a7? 3166a5 In base 11, what is 37 - 295? -259 In base 16, what is -12dc + 13? -12c9 In base 3, what is 112200122 + 11? 112200210 In base 8, what is -603 - -14033? 13230 In base 11, what is 734 + 6? 73a In base 7, what is 5 + 24052? 24060 In base 15, what is 1 + 27ba7? 27ba8 In base 2, what is -11 + -10010010111100011? -10010010111100110 In base 7, what is 5046 + -226? 4520 In base 12, what is 4285a + 4? 42862 In base 8, what is -133 + -13045? -13200 In base 2, what is -100011001110100001 - -100? -100011001110011101 In base 16, what is 2aa - -43c? 6e6 In base 11, what is -57 - 2156? -2202 In base 9, what is 15620 + -44? 15565 In base 5, what is -10113 - 24404? -40022 In base 11, what is 3 + 89a65? 89a68 In base 10, what is 2 - 115126? -115124 In base 5, what is -131423 + 1420? -130003 In base 7, what is -466460 + 3? -466454 In base 5, what is 112434 + -2432? 110002 In base 8, what is 14600 + -26? 14552 In base 11, what is -8 + -63538? -63545 In base 12, what is -12 + -1912? -1924 In base 7, what is -12 + -23316? -23331 In base 15, what is 0 - -10771? 10771 In base 14, what is -2 + 29608? 29606 In base 13, what is -4 - 15100? -15104 In base 16, what is cd1a - 3? cd17 In base 6, what is -20423 - -3? -20420 In base 3, what is 21012100 + 20110? 21102210 In base 2, what is -1100100011001 - 1001111001? -1101110010010 In base 13, what is -6678 - 0? -6678 In base 6, what is -13140451 - 5? -13140500 In base 9, what is 5 + 24474? 24480 In base 9, what is 3 - -16602? 16605 In base 2, what is 101000000010011101110 - 11? 101000000010011101011 In base 3, what is 112211 + -1011020? -121102 In base 8, what is -2603 + 145? -2436 In base 4, what is -223 + -2112231? -2113120 In base 8, what is -775445 - 5? -775452 In base 8, what is -3 + 1212673? 1212670 In base 7, what is 50 + -14463? -14413 In base 11, what is 309a + -2? 3098 In base 2, what is 10011100 - 11011111101? -11001100001 In base 14, what is 506 - d? 4d7 In base 13, what is -2 + -4cbc1? -4cbc3 In base 2, what is -10111 + 1010000000100110? 1010000000001111 In base 5, what is -23001020 - -1? -23001014 In base 13, what is -88 - 1aa? -265 In base 9, what is 0 - 21750? -21750 In base 7, what is 4 + 1022333? 1022340 In base 8, what is 22 - 1164? -1142 In base 9, what is 71 + 330? 411 In base 9, what is -2 - 1620628? -162063	{ "pile_set_name": "DM Mathematics" }
3q = -944q - 19 for y. 5 Solve -6o - 370 = -16o, -p + 730 = -3o + 841 for p. 0 Solve j + 5d + 16 + 0 + 24 = 0, 0 = 3j + 3d + 24 for j. 0 Solve -2l + 58 = 6j, 20j + 54j = -2l - 12j + 538 for l. 11 Solve 105 = -6w - 0w + 7q, -3w = 5q - 46 - 29 for w. 0 Solve k + 4y - 102 + 135 = 0, -5y - 1020 = 23k for k. -45 Solve -z + 12 = -z - 6g, -5z - 4g + 14g - 8g = 6 for z. -2 Solve -5q = -5t + 15, t + 105 = 33200q - 33163q for t. 6 Solve -654n + 11 = 2o - 24 - 23, 2n - 87 = -0n - 0n - 3o for n. 0 Solve 12p - 27 = -3b, 4b - 3p + 32 = -27 for b. -11 Solve -16p + 8p + 12 - 35 = 8p - 3j, p = -5j - 100 for p. -5 Solve 13t + 37 + 15 = -28539m + 28543m, 0 = -158t - 5m + 65 for t. 0 Solve 17u + 208u + 3615 = 3z, 2z + 14 - 85 = 7u + 49 + 2 for z. 5 Solve -60 = 3m + 2m + 2t - 38, -2m - 37t - 407 = 0 for m. 0 Solve -3z - 8317l - 33 = -8316l, -5z + 3l + 2l + 65 = 0 for z. -5 Solve -8t - 4g - 72 = 4t, -109g + 47g + 19 = -4t - 65g for t. -7 Solve 3380k - 3377k + c = -107, -357 = 3c for k. 4 Solve 38x + 53 = 5v - 13, -x + 0v = v + 4 for x. -2 Solve -4h = -5w - 9, -53488w + 53487w - 17 = 3h for w. -5 Solve -3t + 2q = 10, 882t = 883t - 10q + 50 for t. 0 Solve -6g - 217f - 38 = -213f, 0 = -5g + 4f + 27 for g. -1 Solve z - 2b = 3z - 16, -3z + 0z = 2z - b - 52 for z. 10 Solve 20t = -t + 11q + 1491, 3t + 8q = 11q + 213 for t. 71 Solve 248k + 915z = 253k - 4610, -2z - 38 = -4k for k. 7 Solve -3h + 3v + 0 = -33, 5h + 30967970 = 4v + 30968016 for h. 2 Solve 65f - 5a + 3a = -a + 393, 3f + 103 - 127 = 2a for f. 6 Solve 29967q - 98 = -2p + 29981q, 2p - 4q - 48 = 0 for p. 14 Solve 5y = 105o - 145o - 1740, o + 23 = 5y for y. -4 Solve 6w - v + 54 = -0v + v + 96, w + 5v = -25 for w. 5 Solve 2s - 2g + 0 - 8 = 0, 5s - 124g = -123g - 9 + 33 for s. 5 Solve 0 = 2950c - 2955c + 15 + 95, 2c - 36 = -4n for n. -2 Solve 5m = 198g - 394g + 200g - 141, -g + m = -36 for g. 39 Solve -3t = x + 2t + 17, 3x = -21t - 27t - 51 for x. -17 Solve d = 5d - r + 29 + 12, 0 = 4r - 20 for d. -9 Solve -9d + 1121 - 1393 = 4y, -8y - 4y - 256 = -8y + 5d for y. -59 Solve 4g - 87 = -3d, -143g - 395 = 4d - 162g for d. 1 Solve 3p = -130877q + 130875q - 16, 5p = 23q + 105 for q. -5 Solve 28a - 20a - 29 = -4x + 13a, -82 = -62x + 4a for x. 1 Solve -407 = -6q - k, 186 = 3q - 19233k + 19230k for q. 67 Solve -4h - 45 + 66 = q, q - 3 = 2h for h. 3 Solve 2z - 4y - 119 = 3z, 63 = -2y + 5 for z. -3 Solve -2i + 352 = 5c + 307, -2c - 3i = -29 for c. 7 Solve -8d - 1 = -9d + a + 13, 5d = -4a - 101 for d. -5 Solve 302 = 11v + r, 4v - 97 = -9r - 12r + 16r + 36 for v. 27 Solve -3f + 28d = f + 16d - 92, -f = 3d + 19 for f. 2 Solve -z - 4k = 30, -1235z + 791z + 2k + 6 = -440z for z. -2 Solve q + 5s - 162 = -3q, -89s + 45 = -5q - 87s for q. 3 Solve -5r + 319p - 324p = 70, 5p = 3r - 110 for r. 5 Solve 4 = -j + 10a - 25 - 78, -3j - 3a = -42 for j. 3 Solve -4 = -a, -r - 6068a + 6 = -6067a for r. 2 Solve 3b - 3 = -1543r + 1538r, -10b - 31 = 3r for r. 3 Solve -21 - 2153 + 576 = 123j - w, 2w - 63 = 5j for j. -13 Solve -3 = 5p - 21s + 22s, -4s - 90 = 98p for p. -1 Solve -35752y + 35755y + 8q - 19 = 0, 2y + 3q - 1 = 0 for y. -7 Solve 2w + 14x = 18x + 8x + 68, -11w - x + 48 = -192 for w. 22 Solve -22j = 4c + 16, 76c = 153c - 75c - 3j + 64 for c. -26 Solve -4u - 12081 = -2p - 12073, 197 = -52p + 23u for p. -6 Solve 0 = 6m + 5i - 2 + 11 - 2, 252 = 51m - 47m - 48i for m. 3 Solve v = 2j - 7, 6 = 541v - 559v - 4j for v. -1 Solve -81f = -85f + 5x + 15, -3f - 4x = 12 for f. 0 Solve -5h = -2s + 175, 3s + 125 = 206h - 418h + 209h - 1 for h. -37 Solve 10h + 1437625z + 325 = 1437630z, -4h + 5z = 139 for h. -31 Solve -2x + 0x - 4h = 0, 11x - 3h = -168 + 43 for x. -10 Solve 4t - 18 = -2u, -54453 = -5t + u - 54448 for t. 2 Solve 5j = -20318t + 20313t + 15, 167 = 29t + 9j for t. 7 Solve 0 = -13c - 2i - 3, 281c - 276c = 7i - 40 for c. -1 Solve 30 = -2c - 584q + 586q, -2c - 7q + 3q = 42 for c. -17 Solve -2r + 2h = -4r, 14h - 49h - 14h = -4r - 17h - 51 - 129 for r. -5 Solve 0 = 3t - 2100u + 2102u - 58, 5u + 39 = 4t for t. 16 Solve 505651u - 505656u - 177 = -6x, 0 = 4x + 3u - 99 for x. 27 Solve -2g + g - 2 = -1249l + 1244l, -5g - 19 + 34 + 41 = 41l for g. 3 Solve -5c - 51 = 4x - 7 + 11, 22 = -c - 3x - 11 for c. -3 Solve p - 1548334h + 1548333h = -4p + 13, -6h - 52 = -12p - h for p. 1 Solve -121u + 117u = 2b - 244, -2u = -10b - 144 for u. 62 Solve 22 = -k - 3h, -5h + 26134 = 3k + 26196 for k. -19 Solve 0 = 26501j - 26505j - 2y - 3y + 255, -3y = -3j - 180 for j. -5 Solve -l = -4z + 1, -2 = -0l - 3l + l - 209355z + 209359z for l. 3 Solve 3k + 2f - 635 + 326 + 346 = 0, 0 = -k + 5f + 101 for k. 1 Solve -94i - 5v = -89i + 40, 0 = 11i - 2v - 16 for i. 0 Solve -5t = -6g + 2291 - 2240, -2t - 3 = 15g for t. -9 Solve 3k - 3o + 84 = 0, -40k - 3759o + 50 = -3760o for k. 2 Solve -10y + 3a = -0y + 96, y - 212 = a - 123 - 114 for y. -3 Solve -27y + 5t + 3159 = 3058, 8t = y - 35 for y. 3 Solve -28g + 2g + 609 = -5i, -536g + 5 = -539g + 5i + 62 for g. 24 Solve -40821k + 69 = -40829k + 5f, 5f - 30 = -5k for k. -3 Solve g + 2g + 4b = -26, -4g + g + 113 - 389 = 54b for g. -2 Solve p - 5t - 65 + 125 = 0, 5p + 157 = 10t + 2t for p. -5 Solve -33 = -2a - 2905u + 2909u - 13, 2a + 7a - 2u - 42 = 0 for a. 4 Solve 449 = -a + 5q + 377, -7a - 3q = -66 for a. 3 Solve 20z = -4y + 176, -11z + 22z + 3y - 28 = 9z for z. 8 Solve -u = -3s - 13, -3s - 31u - 14 = -33u + 3 for s. -3 Solve -4u - 13 = -1480a + 1478a + 23, 3a - 54 = -280u for a. 18 Solve h - 3x + 356035 - 356040 = 0, 4 = 2x for h. 11 Solve 205p = 419p - 214p + 4d - 148, 116 = 5p + 3d for p. 1 Solve 0 = -2h + 4p - 4, -5h - 1809904p - 26 = -1809906p for h. -6 Solve -4r - 1735336 = -1735348, -s = 4r - 8 for s. -4 Solve -33 = 2a + w - 28, 5a + 3w = -12 for a. -3 Solve 311j - 126 = 22t + 313j, -5t - 5j = 15 for t. -6 Solve -3i + 7c = 47, 3c - 1967 + 1964 = -3i for i. -4 Solve -1 = q - 2t - 0 - 9 + 16, -301t = q + 917 for q. -14 Solve 4o - 9 = -3c, 7276 = -3o - c + 7289 for o. 6 Solve 11d - 18 = -2y - 0y, 0 = -5d - 6y + y for d. 2 Solve 1085523q - 1085510q + 197 = g, -4q - 62 = -g for g. 2 Solve -159k + 318k - 6u + 8u = 162k + 23, -5k = -21u + 3 for k. -9 Solve -5k + 42 = -i, 4k + 1628i = 813i + 810i + 22 for k. 8 Solve 3b + 5c = -29, -c + 3 = -1079b + 1084b for b. 2 Solve 3o - 23 = -4i, 590405i = 4o + 590401i - 12 for o. 5 Solve -n + 2q + q = 7, 1566498 = 4n + 4q + 1566542 for n. -10 Solve 0 = 6n - 2n + 2n + 42h - 46h - 90, 5h = -105 for n. 1 Solve 214h + 39 = 211h + 2b, 2h + 3b + 15 = -11 for h. -13 Solve z - 31 + 63 = -2i, i - 39 = 2z for z. -22 Solve -4l - 25 = 2l + c, -65 = -3l + 5c - 3c - 126 + 66 for l. -3 Solve -3k = q - 25, -3k + 0k + 79q - 68q = 419 for k. -4 Solve -4m = -28n - 25n - 34n + 86n - 0m + 5, -9m - 21 = -3n for n. 13 Solve 8s - 9270 = -4r - 265s, -2r + 633s = 631s + 74 for r. -3 Solve -2o - 30 = 10t, 21 = -3t - 673o + 670o for t. -2 Solve 12 = -v + w, 3v + 4655 - 4459 = 19w for v. -2 Solve -30h + 28h + y + 18 = 5 - 51, 0 = 5h - y - 160 for h. 32 Solve -2k = -4y + 24, -1277 = -19k - 5y - 1419 for k. -8 Solve 2m - 2o = -134, 5m - 2532o = -2515o - 1127 for m. -1 Solve -9106v = -u - 9111v - 33, 42 = -u - 3u - 2v for u. -8 Solve -21f + 39f + 2s + 6 = 20f - 0s, 3s = 0 for f. 3 Solve -31o + 34o + 51 - 3 = -3w, 0 = -11w - 6o - 196 for w. -20 Solve -3p + 4p = -5s - 21, -4s - 6p + 2p - 20 = 0 for s. -4 Solve -138 = -2w - d - 23 - 26, -d = w - 46 for w. 43 Solve -5u - 5 = 3m + 2m, -27271m + 27267m + 5u + 41 = 0 for m. 4 Solve -33c + 8c - 5o = -0c + o - o + 325, 3o + 51 = -3c for c. -12 Solve 4k + a + 14 = 0, -58a + 36a + 24a + 53 = -3k for k. 5 Solve l + 4h - 17 = 3l + 17, 323 = -4l + 93h for l. -11 Solve -46z = 3n + 2n + 56, 2 = -5z + 9n + 15 for z. -1 Solve	{ "pile_set_name": "DM Mathematics" }
s (-32 - -33)p/1 composite? False Let a(s) be the second derivative of 373s5/10 - s3/6 + s*2/2 + 14s. Let z be a(1). Suppose z = 2n - 0n. Is n composite? False Let u = -37 - -55. Suppose 2m - 11m - u = 0. Is (-18692)/(-10) + -2 + m/10 composite? False Let c(s) be the second derivative of 0 + 11/12s4 + 7/6s*3 + 20s - 1/2s2. Is c(-6) composite? False Let t be (-36)/27123/(-2). Let i = 187 - t. Let h = i - -326. Is h a composite number? False Let c be 2 + 0/1 + 1. Let a(q) = q*2 - 16q + 41. Let y be a(13). Suppose yd - 5v - 3923 = 0, 6d + v = cd + 5842. Is d a composite number? False Let m = 272 + 66. Let x = m - 87. Is x composite? False Suppose 0 = 2p + 10, 540r - 782970 = 535r + 5p. Is r a prime number? True Suppose -29443 = -4w + 21905. Suppose 2742 = -3d + w. Is d prime? False Suppose 4w = -11f + 8094465, -4f = 9w - 5w - 2943424. Is f prime? False Let b(s) = 41s + 4. Suppose 0 = 2a + v - 5, a = -4v - 6 - 2. Let z be b(a). Suppose -u = 23 - z. Is u composite? True Let c = 1951 + -1952. Let r(g) = -365g + 14g + 1 - 181g. Is r(c) a composite number? True Let s = 683 - 200. Let b = 862 - s. Is b a composite number? False Let a be (12/(-21))/(1/(-7)). Let y be 20 + (0/a - 5). Suppose 7u = yu - 6824. Is u a prime number? True Suppose -18s + 22s - 3o = 40714, 3s - 2o - 30537 = 0. Is s a prime number? False Let f(t) = 8t + 5. Let i be f(2). Let k be -10i/6 - 0. Let m = 1542 - k. Is m composite? True Let w(i) = -5i2 - 2i + 1. Let x be w(-1). Let l be (1 + x)/(7/(-9989)). Let f = l - 178. Is f prime? True Let g be ((-14)/35)/(8/110)-2. Suppose -3w + g = z, 1 + 2 = -3z + 3w. Is 849 + (-4)/(z + -3) composite? False Is (-1075064)/(-5) + (-162)/(-135) a prime number? False Let u(f) = -5f3 + 66f*2 - 12f - 8. Let q be u(13). Suppose 8159 = i - 3w, -qw - 804 = i - 8931. Is i prime? True Let n(d) = -7d2 - 233d + d2 - 21 - d3 - d*2 + 243d. Is n(-9) a prime number? False Let x(i) = i*3 - 19i*2 + 35i - 17. Let g be x(17). Suppose -2n + n + 178 = g. Is n a prime number? False Is -301(0 - 775) + 3(-12)/(-9) prime? True Suppose -q = -3c + 114615, 5c + 17q = 12q + 191005. Suppose -3f - 38204 = -4n - 2f, 0 = 4n + 2f - c. Is n a prime number? True Suppose 0 = 7c - 3c - 64. Suppose a = -3a + c. Is (3 + a - 4) + 388 a composite number? True Let k = -161 - -57. Let w be (-2091)/(-13) + (-16)/k. Suppose -w = -2r + 963. Is r composite? True Suppose -x + 5t + 11733 = -144394, 3x + 5t - 468541 = 0. Is x prime? False Suppose 110n - 105n = 1615. Let s = 472 - n. Is s prime? True Let z(j) = -2j - 70. Let l be z(0). Let h = l + 86. Let y = 23 - h. Is y a composite number? False Let n(y) = -125658y + 7611. Is n(-4) a prime number? False Let l(q) = 4q*2 + 21q - 213. Is l(8) prime? True Suppose 3r = -2u - 1, 3u = -5r - 0r. Let g(q) = -8q*2 + 2q*3 - 7 - 14q + 4qr + 3q*2. Is g(8) composite? False Let h be (((-48)/9)/8)/((-4)/18). Let c(n) be the first derivative of 46n*2 - 9n + 3. Is c(h) a prime number? False Let q(f) = f*3 - 10f*2 + 4. Let i be q(10). Let y = -203 - -279. Suppose 0 = 2t - 2, -y = -ic + 2t + 14. Is c composite? False Let n(h) = h*2 - 14. Let m be n(4). Suppose p + 3p + 2358 = mq, -5q + 5p = -5885. Suppose 2k + 3k - q = 0. Is k a prime number? False Let k(c) = 65c*3 - 12c*2 + 22c - 8. Let t be k(9). Suppose 24b - 389635 = -t. Is b a prime number? True Suppose -w + 226294 = -3g, 436008 + 695255 = 5w + 8g. Is w prime? True Let b = -254122 + 455093. Is b a prime number? True Let n(w) = 112w2 - 46w - 107. Is n(-17) a composite number? True Let b be ((-171)/(-18))/(3/(-282)). Let g(x) = 25x3 + 6x*2 + 2x - 3. Let f be g(-4). Let n = b - f. Is n a composite number? True Suppose 2k + 4y = 380254 - 34916, 4k - 5y - 690637 = 0. Is k a prime number? True Let p be 2/(-1)(882030/(-20) - -9). Suppose -4l + 60238 = 3u - 27975, -3l - p = -3u. Is u prime? True Suppose 0 = -21g + 24g - 12. Suppose 0 = 5a + 2j - 7 - 3, 3a - gj + 20 = 0. Is (4 - -297 - 0) + a a prime number? False Suppose 3v - 5 - 31 = 0. Is -1087(8/v + (-10)/6) a prime number? True Let b(l) = 3l*2 + 5l + 26. Let d be b(-14). Let t = d - -1197. Is t composite? False Let p(y) = -y*2 + 4y + 10973. Let l be p(0). Let c = -5260 + l. Is c prime? False Let j(h) = 62h - 285. Let p be j(5). Suppose -pf + 32f = 70546. Is f prime? False Let d = 59234 + -24762. Suppose -t = 7t - d. Is t prime? False Suppose -3d - d = -p - 17, -5p = -3d. Suppose -db + 4 - 32 = -2t, 3b = 0. Is (1 - 5) + 1330/t a prime number? False Suppose 0 = -2902r + 2891r + 35761. Is r composite? False Let k = -294 - -336. Let z = k - -91. Is z prime? False Let n = 3 - -37. Suppose -2c - y - 3y = -n, 82 = 5c + 4y. Suppose cj - 11655 = -3857. Is j prime? True Let y be (-1)/((-6)/36-6). Is (-1)/y + -3 + (4047 - 6) composite? True Let z(f) = -f*2 + 10f - 20. Let t be z(4). Suppose -m - 4m - 3g + 3350 = 0, tm + 3g - 2683 = 0. Is m a prime number? False Is (19 - (-159970)/(-20))/((-2)/4) a prime number? True Suppose j - 6035 - 3254 = 4u, -18563 = -2j + 3u. Is j composite? False Suppose 52o - 39o - 490589 - 271120 = 0. Is o a composite number? True Is (18841/454)/((-2)/(-5692)) composite? True Let s(k) = -k2 - 10k + 9. Let v be 3-1(-2 + 26/6). Let i be s(v). Suppose 970 = 4b + i. Is b a composite number? True Is 64/(-192)(-3826506)/42 a prime number? True Suppose 0 = 5z + 16 - 86. Suppose -4 = -9v + z. Suppose vu - 2h - 2178 = -h, 2u - 4h - 2190 = 0. Is u prime? True Let r(b) be the third derivative of 5b*4/24 - 35b*3/6 + 16b*2. Let p be r(7). Suppose 6u - 59 - 55 = p. Is u a composite number? False Let h = 4485 - 272. Suppose -a - h = -0a - 5t, 2a = -2t - 8390. Is a(-1)/22 + (-4)/(-22) prime? True Let m = 679487 - 310548. Is m a composite number? False Let o(r) = -r2 - 55r + 13. Let x = -236 + 436. Suppose 7q + 3q + x = 0. Is o(q) a composite number? True Let i(x) = -x*2 + x - 1. Let j(q) = 10q*3 - 3q*2 - 6q - 8. Let t(l) = -i(l) + j(l). Suppose -5g = 5f - 10, -4f - 3g + 3 = -7. Is t(f) prime? False Let o(t) = 3t2 - 7t - 7. Let s(q) = -q*2 - q - 1. Let j(r) = o(r) - 4s(r). Let u = -9 + 6. Is j(u) a prime number? False Let j(p) = 7p - 18. Let w be j(2). Let h be 3/18w + 24/9. Suppose -5t = -5q + 22755, 4t + 3997 - 13075 = -hq. Is q prime? True Let j be (0 + -1 - 104568)-1. Suppose 19u - 52846 = j. Is u composite? True Is 15/240 + 47850138/96 prime? True Let b be 76/(-570) + 206/(-30). Is 2/(-4) + 874/(-4)b prime? False Suppose -4l + 75413 = f, 8f = 5l + 12f - 94269. Let v = -10790 + l. Is v a composite number? True Suppose -15a + 23a = 104. Suppose 5n + 14w - aw = 12546, 1 = w. Is n prime? False Let o = -801 + 3651. Suppose -5h - o = -10h. Suppose -114 + h = 8f. Is f prime? False Let k be 27 + -29 - (-5 + 0). Suppose -a + 1403 + 5339 = ki, -20216 = -3a + i. Is a composite? True Let r(i) = i2 + 15i + 19. Let z be r(-14). Suppose -2s = b - 4, -b = 5s - 8 - z. Is (1 - b/(-2)) + (-2 - -547) a prime number? False Let l(c) = -c*3 + 27c*2 - 10c + 15. Suppose 1 = -b + 15. Let t = b + 9. Is l(t) a composite number? False Let y = -23124 + 33007. Suppose 11k = 10335 + y. Is k a prime number? False Let g(j) = 3623j*2 - 35j - 47. Is g(6) prime? True Let d(j) = -j + 339. Let v = -213 + 213. Is d(v) composite? True Let k be 0/(2(-3)/3). Suppose 28j - 32j + 496 = k. Let y = 737 - j. Is y a composite number? False Let r(y) = -y2 + 2. Let q(s) = 147s*2 + 40. Let a(x) = q(x) - 2r(x). Is a(5) composite? False Let i = 8 - 4. Suppose -5g = it - 32, -2t - 9 = -t - 3g. Suppose f - 2k - 6469 = -2f, tk - 8597 = -4f. Is f composite? False Let o(y) = 3482y - 1843. Is o(40) a prime number? True Let u = 30784 - 9793. Suppose 3b - u = -o + 4o, 5b + o - 34967 = 0. Is 5/((-20)/(-12)) + b prime? True Let c(k) = 6k2 - 2k + 1. Let d be c(-4). Let h be (-1)/(d/(-20) - -5). Suppose 0 = ho - 4, 4o = 3t - 3753 - 2402. Is t composite? False Let k = 202 + -234. Is -1402(-2 + 4/(k/(-12))) a prime number? True Let s = -30 + 111. Suppose 77h = sh - 28124. Is h composite? True Let n(z) = -8*	{ "pile_set_name": "DM Mathematics" }
+ sqrt(605) + -4 - (sqrt(605) - (sqrt(605) + (sqrt(605) - sqrt(605)36) + sqrt(605)) - 23sqrt(605)))*2. 1320sqrt(5) + 87148 Simplify ((2sqrt(91)64)/(sqrt(56)/(sqrt(648)2 - sqrt(648))) + -2)*2. -1728sqrt(13) + 2426116 Simplify 5 + -2(4 + (sqrt(80) + (-2 + sqrt(80) + 3)2 + sqrt(80) - (4(sqrt(80) - (sqrt(80) - (2sqrt(80) - sqrt(80)))))2)). -32sqrt(5) + 2395 Simplify ((4(1 + -1sqrt(425) + sqrt(425) + sqrt(425) + 3 + -3 + sqrt(425)) + -3)-2)2. 320sqrt(17) + 108804 Simplify ((((sqrt(133) - sqrt(133)1)2)/(-1sqrt(112)))2 + 6((sqrt(1900) - (2sqrt(1900) - sqrt(1900)))2 + 6(sqrt(19) + -1)*2))2. -144sqrt(19) + 1440 Simplify -6(-1 + (4sqrt(21)2 + sqrt(21))/sqrt(3) + ((-6-2sqrt(77))/(sqrt(11) + -5sqrt(33)/sqrt(3)))2). -372 - 54sqrt(7) Simplify 3 + (3((sqrt(180)-2)*2 - sqrt(180)) + (0 + sqrt(180) + sqrt(180)2)*2 - (-1 + -3 + 0 + sqrt(3645))). -45sqrt(5) + 3787 Simplify 4((42sqrt(3630) - sqrt(3630))2)/(sqrt(10) + (sqrt(10) - (sqrt(110)-1 + sqrt(110))/sqrt(11)) + (sqrt(10) - -22sqrt(10))). 88sqrt(3) Simplify 4 + -1-6-1sqrt(2880)45. -2880sqrt(5) + 4 Simplify 1(sqrt(704) + sqrt(704) + 1) + (sqrt(704) - (sqrt(704) + 2)24) + 1sqrt(704) + -4 + sqrt(704) + (-2 + -1 + sqrt(704))2 + 0. -2122 - 136sqrt(11) Simplify -1(0 + -2 + (sqrt(117) - (sqrt(117) + 1)) + 5 + ((-2 + sqrt(117))-4 - (sqrt(117) - (1 + sqrt(117) + 4))*2)). 15 + 12sqrt(13) Simplify -1(3-2sqrt(121)2)/((sqrt(220)/(sqrt(5)-2) - sqrt(44)) + sqrt(44)). -12sqrt(11) Simplify ((sqrt(5760) + 1sqrt(5760) - sqrt(5760)) + sqrt(1000) + sqrt(1000)2 + sqrt(1000))/((sqrt(64)2)/sqrt(8)-5). -16sqrt(5)/5 Simplify ((((sqrt(243) + 1)14)2 - (1(sqrt(243)-1)2 + -2)) + 1)-5. -18320 - 1440sqrt(3) Simplify sqrt(209)/(sqrt(22)/(sqrt(6)/sqrt(3)))-1 + 4(sqrt(2299) + (4(-3sqrt(2299) - sqrt(2299) - sqrt(2299)))2). 43sqrt(19) + 3678400 Simplify 66((sqrt(648)-4 + -3 - sqrt(648))2 - (sqrt(648) + (sqrt(648) - (-2 + sqrt(648) + -2)))2). 14256sqrt(2) + 559620 Simplify (sqrt(88)/sqrt(275) + sqrt(8) + (sqrt(8) - sqrt(128))-5)/(sqrt(576)-2 - sqrt(108)/sqrt(3)). -3sqrt(2)/5 Simplify (-3(-3 + sqrt(75) + (2sqrt(75) - sqrt(75)) - (-3 + 0 + sqrt(75))) + (sqrt(75) + 1 + -1sqrt(75))-3-4)*22. -720sqrt(3) + 1638 Simplify -2(-3 + (-5 + 52sqrt(252))3)2. -454248 + 12960sqrt(7) Simplify (1(-2sqrt(153) - sqrt(153))5)/((sqrt(81) - 4(sqrt(81) - (sqrt(81) - (sqrt(81)3 - sqrt(81) - sqrt(81)))))/sqrt(9))-5 + -1. -25sqrt(17) - 1 Simplify 2 + sqrt(1728) + 1 - (-1 + (sqrt(3) + (sqrt(3) - -2sqrt(75)))-6)2. -15550 - 120sqrt(3) Simplify 2 + ((1 + ((-5(1 + sqrt(180)))2 - sqrt(180)))-5 - (-4(sqrt(180) + (sqrt(180) - (sqrt(180) + -2))) - (sqrt(180) + -1 + sqrt(180)-3))). -22621 - 1458sqrt(5) Simplify 3(sqrt(270)/(2sqrt(96)))/(6(sqrt(441) + sqrt(441)2) + sqrt(441))-5. -15sqrt(5)/1064 Simplify 5 + (0 + (-3sqrt(121)1)/(sqrt(33)/sqrt(3)2) + -5)*2. 15sqrt(11) + 219/4 Simplify -4 + -1((-4(-2 + (sqrt(162)2 - sqrt(162))))2 - (-5sqrt(162)-1 - (-3 + (sqrt(162)2 + sqrt(162))*2 + sqrt(162)))) + 4. -4111 + 612sqrt(2) Simplify (-3 + (1sqrt(1100) + 0 - sqrt(1100) - sqrt(1100)) + sqrt(1100) + 0 + 0 + sqrt(1100) + -2 + -1)2 + -2. -120sqrt(11) + 1134 Simplify (((sqrt(144)/(sqrt(12)-1))/sqrt(3))/(sqrt(18)/sqrt(9)26))2. 1/72 Simplify ((1(sqrt(10) - sqrt(90)/sqrt(9)))/sqrt(5) - (sqrt(1800) - sqrt(1800)-3))2-3 + 1. -86399 Simplify (-2sqrt(686) - sqrt(126)3)/((sqrt(7) - sqrt(77)/(sqrt(44)/sqrt(4))) + -4sqrt(7)-1). -23sqrt(2)/4 Simplify ((sqrt(105) - (sqrt(105) - (sqrt(105) + 4sqrt(105)6)))/sqrt(7))/(sqrt(180) + -4(sqrt(180) - sqrt(180)-2) + sqrt(180)). -5sqrt(3)/12 Simplify -5-4(((sqrt(108) - -1sqrt(108)1) + sqrt(108))/(sqrt(144)5)-2)*2. 108/5 Simplify -2(-1 + (sqrt(153)-2 + 0 - ((-2sqrt(153)4)2 + sqrt(153)) - (sqrt(153) + -1 + sqrt(153) + -5)2)). 42sqrt(17) + 19562 Simplify ((-2-1sqrt(132))/(-2sqrt(300)) - (-1 + ((((-1 + sqrt(1584) - sqrt(1584)) + sqrt(1584))-3)2 - sqrt(1584))))-4. -4556sqrt(11)/5 + 57056 Simplify ((3(-4(2 + sqrt(500) + sqrt(500) + sqrt(500) + sqrt(500)) + sqrt(500)) - -4(sqrt(500) + -3 + 5))2)2. 52480sqrt(5) + 3363024 Simplify -1 + (-5 + sqrt(133)/(sqrt(35)/sqrt(5))-6 - (sqrt(171)/((sqrt(9) + sqrt(18)/sqrt(2))4) + -1)). -49sqrt(19)/8 - 5 Simplify 3 + -2((4(sqrt(180)-1 + sqrt(180) - sqrt(180)) + (sqrt(180)2 - sqrt(180))6)/(2(sqrt(10) + (sqrt(70)2 - sqrt(70))/sqrt(7))))*2. -6 Simplify (sqrt(44) - ((3sqrt(704) - sqrt(704)) + sqrt(704)) - sqrt(44))/(-1sqrt(64) - sqrt(64)) - ((5sqrt(99)3)/(2sqrt(36)/sqrt(4)))*2. -2475/4 + 3sqrt(11)/2 Simplify -1-4(sqrt(140) - (-5(sqrt(140)-1 + sqrt(140)) + sqrt(140)))/(sqrt(343) + sqrt(343)1) + 1. 1 Simplify ((2 + sqrt(2048) + 2)2 + ((-2sqrt(2048) + sqrt(2048) + sqrt(2048))-1)2)2 + 1. 512sqrt(2) + 4129 Simplify ((sqrt(882)-26)/(6(sqrt(81)3 + sqrt(81) + sqrt(9))) + 2)2. -56sqrt(2)/13 + 1068/169 Simplify (3 + (sqrt(204)25)/(sqrt(60)/(sqrt(10)/sqrt(2))) + 4)-1-1. 7 + 10sqrt(17) Simplify 4(24sqrt(72))/((sqrt(44)-2)/sqrt(11) + sqrt(4)2-1). -24sqrt(2) Simplify (1-42(sqrt(128) + (sqrt(128) - (1(-3 + sqrt(128)) - sqrt(128))) + -5sqrt(128)5))*2. -70656sqrt(2) + 4334144 Simplify (-2 + 3 + (sqrt(110) - (sqrt(110) + 4sqrt(110))2)/(6(sqrt(10) + sqrt(10)-4 + sqrt(10))))*2 + -3. 67/16 + 3sqrt(11)/2 Simplify ((sqrt(450)24)/((sqrt(10) - sqrt(10)1)4 + sqrt(40)/(sqrt(4) - (2sqrt(4) + sqrt(4)) - sqrt(4) - sqrt(4))) + 5 + -4)2. -192sqrt(5) + 46081 Simplify ((0 + sqrt(833) + -2 - 2sqrt(833)-1)*2 + (((sqrt(119)-6)/sqrt(7))*2 - (5(-5 + sqrt(17)) + sqrt(17))))6. -540sqrt(17) + 48828 Simplify (0 + (sqrt(684) + sqrt(684) + -3sqrt(684) - sqrt(684) - sqrt(19)) + -1 - (sqrt(228) + sqrt(228)-2)/(sqrt(108)-2))2. 79sqrt(19)/3 + 118615/36 Simplify (sqrt(192)/sqrt(8)-4 + (sqrt(24) - (sqrt(216)4 - sqrt(216))))/(-4sqrt(1452) - (sqrt(12) + (sqrt(108)-5)/sqrt(9))). 3sqrt(2)/10 Simplify ((sqrt(2) + sqrt(24)/(sqrt(12)2) - (sqrt(24)-2)/sqrt(12))2 - sqrt(8)/(sqrt(36)2))65. -5sqrt(2) + 735 Simplify (((0 + (sqrt(5) - 3sqrt(5)) - (sqrt(10)-2)/sqrt(2)) + (-1-1sqrt(30) - sqrt(30))/(sqrt(960)/sqrt(10)))-5)*2. 0 Simplify -3 + (sqrt(1216) + sqrt(1216)1 + 3 - (sqrt(1216) - (sqrt(1216) + sqrt(1216)2)-4))*2 + 4 + ((-1sqrt(1216))*25 - ((-1sqrt(1216))2 + 1)). -528sqrt(19) + 152009 Simplify (-31sqrt(130)21)/(-1sqrt(810) + (sqrt(90)-2)/sqrt(9)). 6sqrt(13)/11 Simplify (6(-1(sqrt(77)2 - sqrt(77)) + sqrt(77))-3)/((3(sqrt(528) - sqrt(528)3))/sqrt(12)). 0 Simplify 5 + -2 + ((sqrt(126)/((sqrt(81)/sqrt(9) - sqrt(9)) + sqrt(9)))/(sqrt(128)2))2. 775/256 Simplify (sqrt(175) + sqrt(175) + -2 + 1)2 - (-5 + (1sqrt(175) + sqrt(175) - sqrt(175))) - (3(sqrt(175) + 2 + sqrt(175))*2 + 2sqrt(175)-4). -1406 - 105sqrt(7) Simplify ((1(sqrt(77) + sqrt(77)1))/(1sqrt(7)-1))*2 - (-6(-2 + sqrt(1584) + sqrt(1584)) + sqrt(1584))5. -16 + 660sqrt(11) Simplify (-6sqrt(1872)2 + -5(sqrt(1872) - sqrt(1872)-1 - sqrt(1872)) - (sqrt(1872) + 4 + sqrt(1872) + -1 + (sqrt(1872) - -1sqrt(1872)1)))*2. 1512sqrt(13) + 825561 Simplify ((2(sqrt(264)2 + sqrt(264)))/(4(sqrt(6) - sqrt(18)/sqrt(3) - sqrt(6)) - sqrt(6)))/(-54(-1sqrt(324) + sqrt(324) - sqrt(324) - sqrt(324))). -sqrt(11)/300 Simplify (-2((((sqrt(833) - (1 + sqrt(833))) + sqrt(833))-5 - sqrt(833)21) + (0 + sqrt(833) + 2)4)-1)*2. -2184sqrt(17) + 30664 Simplify (-3 + -2 + sqrt(2057) + 1 + -62(sqrt(2057) + 3))*2-1. -250497 - 9680sqrt(17) Simplify 2 + (sqrt(525) - (sqrt(525)2 - sqrt(525))-4)/(sqrt(56)/(-5sqrt(128))) + -4. -500sqrt(3) - 2 Simplify -1 + 2((-3 + (-2sqrt(176) - sqrt(176)))1)*2 + 3 + 1 + 0 + 0. 144sqrt(11) + 3189 Simplify (2((sqrt(1512) - 2sqrt(1512)) + sqrt(1512))-1)/(1(sqrt(6) - (sqrt(6) - sqrt(60)/(sqrt(40)/sqrt(4))))-4) + 5. 5 Simplify ((sqrt(77) + -4(sqrt(77) + sqrt(77)1))/((sqrt(11) + (sqrt(11) - sqrt(55)/sqrt(5)))6) + 2 + sqrt(63)/sqrt(9) + sqrt(21)/(sqrt(3)2))2. 4sqrt(7)/3 + 43/9 Simplify ((-2 + sqrt(325) + -2)-6)2 + (sqrt(52) + 1sqrt(1872))/sqrt(4)4. -1412sqrt(13) + 12276 Simplify (-1 + (-4(sqrt(48) + (sqrt(48) - (-3 + -4 + sqrt(48)))*2) - sqrt(48	{ "pile_set_name": "DM Mathematics" }
han 2? -3.931 Subtract 88 from -0.016. -88.016 What is 0.2 take away 147250? -147249.8 4767 - 0.4 4766.6 What is 8.5 - 8? 0.5 Calculate 2 + 381. 383 Sum -2.7 and -226. -228.7 What is 627 plus 0.045? 627.045 Calculate -386 - 12.126. -398.126 Add together 6 and -25.638. -19.638 What is -1.5 minus -0.363? -1.137 Calculate 21.419 + -4. 17.419 Subtract 0.102 from -1162. -1162.102 What is 517.3 + -0.031? 517.269 What is -997 minus 0? -997 Add together -19 and -0.354. -19.354 What is -1.05 - 19283? -19284.05 -1.4+-6915 -6916.4 What is -0.16 minus 241.8? -241.96 What is -5 take away 677? -682 What is the difference between -4 and 0.11735? 4.11735 Calculate -2.4 - -0.53758. -1.86242 What is -4435 - -0.0794? -4434.9206 Total of -5181 and 0.5. -5180.5 Add together 5 and 0.877. 5.877 Add -7 and 164. 157 -299+-4.22 -303.22 What is 0.1083 minus 9.5? -9.3917 Sum -10185 and -0.18. -10185.18 Add together -397 and 13.27. -383.73 0.2 - 0.1547 0.0453 Work out -1 - 7.9186. -8.9186 What is -0.003 - -141? 140.997 What is 13 plus 31015.5? 31028.5 What is 2 take away -1121? 1123 What is 377.97 + 6? 383.97 What is 36.6 plus 10996? 11032.6 Put together 813 and 27.4. 840.4 Work out 0.19169 + 2. 2.19169 Sum 0.0815081 and -5. -4.9184919 -679+-0.034 -679.034 Put together -11607 and 237. -11370 -0.765 - -1704 1703.235 What is -0.2076 take away 0.23? -0.4376 -56.9 - 4 -60.9 Calculate 0.05162 - -0.06. 0.11162 Calculate -38 + -28. -66 Sum -1521 and 8. -1513 2273.92 - 3 2270.92 Sum -0.2 and -961012. -961012.2 -17 + -0.9224 -17.9224 0.3 - 2243 -2242.7 3.739 - 63 -59.261 Add together -4363 and -0.5. -4363.5 Sum -0.1 and -64. -64.1 1 + -14.5 -13.5 Add 98 and -0.223. 97.777 Add -0.49 and 2.22. 1.73 What is 4 + -1566? -1562 What is 4 + -41? -37 What is -3658 plus 5? -3653 Add together -9369 and -0.019. -9369.019 Add together -374 and -14.7. -388.7 3378 - 166 3212 What is the distance between 11 and 25018? 25007 What is the distance between 23169 and -19? 23188 Calculate -66 - -1.4. -64.6 Calculate 25690 - -2.52. 25692.52 Add together -708 and -1. -709 What is -2181 take away 0.18? -2181.18 Calculate 5 + -0.218. 4.782 Subtract 0 from 296960. 296960 Sum 0.4075 and -0.4. 0.0075 What is -1.2309 less than 1? 2.2309 Work out 1735.5 + 8. 1743.5 -0.2+-2.842 -3.042 What is 969 less than -3.23? -972.23 Work out 96 - -8.1. 104.1 Total of 8.15 and 0.03111. 8.18111 Work out -1357.3 + -0.3. -1357.6 What is -45 less than -2336.3? -2291.3 What is 526 minus -13? 539 Sum 0.3 and 646390. 646390.3 -0.08 + -0.428046 -0.508046 What is 1.008 less than 0.1? -0.908 Subtract 116737 from 0.5. -116736.5 0.0871 - 7 -6.9129 What is -39 take away -17? -22 What is the distance between 58 and -35.6? 93.6 -17899 + 0.4 -17898.6 What is -0.037 take away 0.01191? -0.04891 Subtract -0.05 from 55.65. 55.7 What is the distance between 0.00865 and 0.17? 0.16135 What is -3191 take away -0.2? -3190.8 Put together 0.02 and 3069. 3069.02 What is the distance between -0.4 and -691.3? 690.9 Calculate -0.07 - 2875. -2875.07 67492.7 - 0.2 67492.5 What is 129344 + 0.5? 129344.5 Calculate -8.925 - 0.04. -8.965 Calculate 14.6251 + -38. -23.3749 What is -0.03 plus 25? 24.97 What is -0.0276 take away 0? -0.0276 What is -13 less than 135? 148 0.09 + -318 -317.91 What is the difference between -3 and -428261? 428258 What is -727 minus -0.00616? -726.99384 Calculate -1.901 - -0.6. -1.301 Work out 5 + 411.239. 416.239 What is the difference between 0.19 and -6977? 6977.19 What is 14.786 plus -1? 13.786 Work out 0.4 + 128.5. 128.9 Total of -0.18 and -1408. -1408.18 What is -7 less than 92147? 92154 Calculate -1.68 + 2.2. 0.52 -4308 - 0.3 -4308.3 Subtract -2200 from -12. 2188 What is 21 less than 4387? 4366 Total of -2.7 and -14.2. -16.9 What is 5 take away -2675? 2680 Add together -0.0661 and 77. 76.9339 What is 6 - 1109.39? -1103.39 What is -186.359 minus 1.1? -187.459 Sum -2 and -0.04548. -2.04548 Add together -262 and -12379. -12641 Add 2 and -419. -417 Work out -24.83 - 376. -400.83 Add 2277 and 0.1. 2277.1 Subtract 0.38 from -0.46. -0.84 What is the distance between 9144 and 0.044? 9143.956 Put together 1.7 and 77. 78.7 Add 0.02742 and 336. 336.02742 Put together -2.409 and 2. -0.409 -0.415 - -0.015 -0.4 What is 2 take away 392770? -392768 0.032 + 95 95.032 What is 0.09 minus 33.9? -33.81 Work out 235327 + 0.2. 235327.2 Total of 43912 and -0.237. 43911.763 Add 4 and 1935.28. 1939.28 Total of 13264169 and -5. 13264164 What is -3 minus -0.0691343? -2.9308657 What is -6.9571 take away -0.4? -6.5571 355921+-6 355915 -0.0269 + 37.281 37.2541 What is the distance between 2167 and -2.36? 2169.36 4264 + 7 4271 930 - -0.5 930.5 What is 2415.6 plus -0.03? 2415.57 What is -5482 - 3? -5485 What is the distance between 312282 and 0.4? 312281.6 What is the distance between 1731 and -0.06? 1731.06 Work out -0.2645 - -0.5. 0.2355 -5894+2 -5892 Add 479 and -2482. -2003 Subtract 0.164 from -0.1103. -0.2743 What is the distance between -9.04 and 0.03? 9.07 Total of 4 and -11779.38. -11775.38 Work out 0.1195 + -351.4. -351.2805 Total of 14 and -0.151. 13.849 What is -0.5 take away 146.3? -146.8 What is 0.02765045 - 0.1? -0.07234955 Put together -0.042139 and -17. -17.042139 What is 0.1278 + -0.2? -0.0722 -62603 + -0.2 -62603.2 1114 - 1.45 1112.55 What is 1.3515 minus -0.1? 1.4515 -0.668 + 8 7.332 What is the distance between -0.024 and 13418? 13418.024 Subtract 0.12 from -14.1. -14.22 Calculate 16 + 1132.98. 1148.98 What is -1 - 10258? -10259 Work out 5346 + -0.3. 5345.7 What is -0.15382 take away 0.13? -0.28382 0.014 + -9 -8.986 Calculate -9984 + -5. -9989 Work out 1.12 - -0.0389. 1.1589 Sum -0.5 and 1.39. 0.89 What is -1994789 less than 0.4? 1994789.4 What is the distance between 8.218 and -0.1? 8.318 What is the difference between 2.35123 and -0.1? 2.45123 -58.5 - 1 -59.5 -2.6 + 64 61.4 0.1 - -377 377.1 Calculate -78 - -64. -14 What is 12 take away -4869? 4881 What is -0.2 - 1470? -1470.2 0.0077 - 0.3 -0.2923 Sum -48.77 and -13.4. -62.17 Calculate -2 - -5541.88. 5539.88 What is 14194 minus 0.09? 14193.91 What is 330 + 2? 332 Add -228 and -0.0746. -228.0746 What is 0.3 less than -66675? -66675.3 What is -0.5 plus 3.591? 3.091 Add together 69622 and 0.4. 69622.4 What is the distance between 1.4 and 15742? 15740.6 What is 9569 - -5? 9574 What is 1 less than 343076? 343075 Subtract -0.04 from 30669. 30669.04 Work out -17259 - -0.33. -17258.67 -0.2 + -25.484 -25.684 Sum -8 and -0.026504. -8.026504 Total of 23763 and -17. 23746 -329+-5 -334 What is -7 take away -0.0284? -6.9716 Add together -5531 and 0.3. -5530.7 Total of 171.3 and 2. 173.3 What is 417 take away 0.25? 416.75 Add 285.09 and 42. 327.09 What is 0.95 minus -12? 12.95 Put together -0.05136 and -4. -4.05136 What is -5.133 + 7? 1.867 Add -22.94 and 0.27. -22.67 0 + -60 -60 What is -6 - -65.2391? 59.2391 What is the distance between 5 and 0.0126? 4.9874 What is 1760 less than 0.081? -1759.919 What is the difference between -185955 and -0.1? 185954.9 What is the difference between 61803 and 0.05? 61802.95 -7544 - 3 -7547 Add together -4.5 and 11411. 11406.5 Subtract 0.09 from -15118.3. -15118.39 What is 2 less than 3.4817? 1.4817 What is 150.35 plus 52? 202.35 Work out 66 + 0.0994. 66.0994 0.052 - 617 -616.948 Sum 0.29 and 18.1. 18.39 What is -106104 - -0.4? -106103.6 -124+256 132 What is -0.381 take away 0.5? -0.881 1086531 - -5 1086536 0 + -0.0028781 -0.0028781 Put together -0.01 and 0.1735. 0.1635 What is the difference between 0.522 and 4? 3.478 What is -0.2 + 5.21? 5.01 Calculate -334 + -1.394. -335.394 Add -24 and 88. 64 Work out -0.2 + 27.15. 26.95 What is -0.098 take away 0? -0.098 What is the difference between 18 and 0.39? 17.61 What is 2.876 minus -0.4? 3.276 What is -32098 minus -0.1? -32097.9 73 + -0.023 72.977 Add 1 and -242.58. -241.58 Work out 40 + 25. 65 Sum -0.3 and -586. -586.3 Put together -174 and -0.83. -174.83 0.3 - -320089 320089.3 What is 0.1351 minus 951? -950.8649 What is 31234.75 take away -3? 31237.75 What is -36956 minus -5? -36951 Put together -0.0201913 and 0. -0.0201913 Add together -1.25 and -69. -70.25 Work out -0.252 - 0.4. -0.652 -5 - -222.196 217.196 Subtract 0.2 from 12.2. 12 What is -25.6 - 3606? -3631.6 Calculate 3 - 245. -242 What is -0.17 - 81.75? -81.92	{ "pile_set_name": "DM Mathematics" }
Calculate 260/767/35. 6/19 What is the value of (22320/630)/(14/2)623/178? 62 Evaluate (216/27)/((-112)/12010)1/(-3). 2/7 What is the value of 85/255(528/88)/((-16)/10)? -5/4 Calculate (-10(-24)/(-600)350)/(-5). 28 Evaluate (33060/(-783))/(-95)(-612)/4. -68 Evaluate ((-1380)/1518)/(225/6930). -28 What is the value of 3((-9)/(-6))/(18/(-51))180/45? -51 What is the value of 42/16(-589)/(8246000/(-14400))? 27/10 What is (5/(15/(-27)))/(11417/1631)? -9/7 What is the value of (((-8)/4)/(4/9))/((-3197)/(-3892)-7)? 18/23 What is (85/969)/((26130/117)/67)? 1/38 What is 1(-13)/(-6)24877/(-24877)? -13/6 Calculate 315/2520((-32)/6)/(-8)-3. -1/4 (-11653)/(-271)((-55)/5)/(-11) 43 What is the value of (216/(-14))/((-74016)/21588)? 9/2 Calculate 2/((-10)/5)2120/(-33920). 1/16 What is the value of 412/(-206)(6/(-8))/((-3)/4)? -2 What is ((400/(-3400))/((-6)/61))/4? 1/34 Evaluate ((-2808)/(-585))/((9(-2)/82)/15). -16 Evaluate 150/((-144)/234-13)16/(-12). -25 Evaluate ((-11)/11)/((3888/(-36))/(-27)). -1/4 ((3366/12)/(-11))/(1815/(-360)) 34 What is (-16/270-75)/((-5)/(-42))? 14 Evaluate (-12)/((-516)/(-1247))(-4)/(-64)4. -29/4 Evaluate ((1-730)/(-5))/(1172/(-586)). -73 What is the value of ((-423)/(-2303))/((-36)/42)? -3/14 Evaluate (7725/(-40425)-77)/(1/(-7)). -103 What is 31/((-15965)/1133)(-20)/36? 11/9 Calculate -6(-1)/(-7)31/(-3410)-55. -3/7 What is 12(48/48)/(56/(-8))? -12/7 ((-39100)/(-345)(-36)/150)/(8/(-10)) 34 Evaluate 16/66(318/(-371))/(11/((-385)/(-10))). -8/11 Evaluate 43092/(-2052)236/84. -59 Calculate ((-46656)/264)/(-54)(-143)/(-182). 18/7 ((-6)/(-4))/((-140)/((-47600)/30)) 17 Calculate 12/(-9)(36/12)/(((-40)/(-42))/(-5)). 21 Calculate (-6612)/11671/7. -57 ((-6)/(246/205))/(63/211/6) -10 Calculate 3213/1872(-312)/16. -13/3 Calculate (1/(-4)9)/(105/(-70))466206/(-48789). -43/3 Evaluate (132/(-308)10/6)/((-995)/(-2388)). -12/7 Calculate 9492/13051523/(-36). -2/165 What is 36/35/105(-41)/(42312/84)? -2/43 What is the value of (16/(-4))/((-18)/8(-47)/((-12267)/(-58)))? -8 Calculate ((-100)/175)/((-66)/11). 2/21 Calculate (2/52)/(256/140395008267). 79 What is the value of ((-3)/(-135)-27)/(-57/(-1050))? -18 (-3672)/85(-5)/(-6)-2(-4)/(-6) 48 Evaluate 56/(9240/27)(-35)/21. -3/11 72210/2075(-15)/6 -87 What is 30160/1160(-9)/(-3042)? 1/13 Calculate ((-67)/((-8710)/(-468)))/((-8)/520-8). -117/4 10264/(-19360)(-11)/36 1/24 (-2)/((-36)/(-9)(2/5)/((-376)/(-10))) -47 Calculate -33(-423)/(-3619)(-98)/(-21). -18 Evaluate (-23)/((-13)/31224). 23 Evaluate 240/88060/180. 1/11 Calculate ((-1632)/1377)/16-302/(-8). -5/9 Calculate ((-75)/(-105000)-126)/(9/12). -3/25 What is (-1)/2(-39)/(-377)(-1)/3? 1/58 What is the value of (7/35)/(24/(-5400))? -45 What is ((-5)/(-275)15)/((-456)/(-76))? 1/22 Evaluate ((-12)/(-280))/(27/(-36)). -2/35 -68/240030(60/(-14))/1 18/7 (37219/17178)/(26/150)28/5 70 Calculate 6450/2476802/5. 1/96 Evaluate (10094/2163)/(4/(-6)). -7 Evaluate -126(-581)/(-14940)(-8)/14. 14/5 What is (3/(-143)(-16)/24)/(210/770)? 2/39 (14500/1000)/(2/8) 58 What is (65/(-13)(-396)/300)/(((-8)/(-10))/(-4))? -33 What is the value of (-123)/(6/((-38)/(-209)11))? -41 Evaluate (-32740)/(-39288)(-1)/(10/56). -14/3 (9(-6)/(-10))/(858/(-1430)) -9 Calculate 18((-4)/72)/(45/18)(-50)/4. 5 Calculate 4(-2)/(-32)1/256/406. 1/58 Evaluate 2748/(-110607)-17/(-2). -2/23 (48/(-192))/(171/1197) -7/4 (105/140-2)/(((-10)/5)/(-26)) -9 Evaluate 282/(-14993)2240/(-48). 10/29 What is the value of 132/(-1200)50/(-330)? 1/60 What is the value of (5264/(-1155))/4-721? 42 What is ((-125)/(-250)-4)/((8/82)/2)? -41 What is 399/(-1862)5/((-45)/(-6))? -1/7 What is (546/84)/((-1)/(-1))(-30)/3? -65 ((-12)/108(-36)/(-42))/(9/405-1) 30/7 Evaluate (1/(20/72))/(((-8778)/(-350))/19). 30/11 Evaluate 237/316((-16)/84)/(72/420). -5/6 What is ((-138)/27)/((17864/203)/(-88))? 46/9 9/1621/((-441)/14) -3/8 ((-5(-72)/765)/(126/(-9)))/((-136)/3332) 14/17 (((-6)/(-7))/((-510)/476))/((2-2)/(-80)) -16 What is (((-1748)/(-855))/23)/((-4)/(-6))? 2/15 What is the value of ((-11)/(220/(-68)))/((24/(-140))/((-21)/147))? 17/6 (-25)/(17120/680) -25/3 What is (24/832)/(14/(-56))? -3/26 What is the value of (-5)/(50/10)15-154/81? 10 What is the value of ((-19096)/55242)/((-3)/27)? 28/9 What is the value of (6/(-5))/((7804/(-27314))/(460/21))? 92 What is the value of (1674/1953(-7)/16)/(2/(-336))? 63 ((-12252)/27567)/((-7)/18) 8/7 Calculate (-684)/(-18)((-80)/720)/((-10)/(-45)). -19 What is ((-25)/11259)/((-10)/600)? 12 Calculate (((-891)/(-1386))/((-18)/(-7)))/((-7)/(-60)). 15/7 What is (45/15)/((((-800)/(-40))/60)/((-67)/(-9)))? 67 What is ((32913/(-27))/23-23/(-6))/(-1)? 53 Calculate (((-6860)/14)/(-10))/(-2426/156). -49/4 Evaluate 322/((-75670)/17625)(-2)/(-14). -75/7 What is (-4)/(-5)337270/(-4652)? -58 Evaluate ((-6)/(-10))/(((-428)/(-642))/((-1420)/(-18)))1. 71 Calculate -363/2457(-30)/(-5). -6/13 What is the value of (-2)/(4/14)151/(101472/(-4224))? 44 (10/258)/((-450)/82620-51) 6/43 What is the value of (1-51)/(-1)(-531)/48321131? -51/7 What is the value of ((-8)/6)/(169/(6929/574))? -2/21 ((-2)/(-1))/19(-18)/90728 -2/7 What is (2/7)/((1674/3906)/(5/(-165)))? -2/99 What is the value of (((-5180)/210)/(-74))/((-1)/502)? -25/3 What is ((-60)/(-150))/(((-25284)/3920)/((-3)/(-4)))? -2/43 What is the value of -3((-77)/((-7392)/(-128)))/(-301)? -2/15 Evaluate (3/5)/((-41)/524816). -24/5 What is the value of ((6/(1-2))/((-36)/((-5112)/142)))/1? -3 What is the value of 28/(784/126)19/((-114)/8)? -6 (-4)/(((-1)/50-2)/((-7)/((-2030)/29))) -10 What is the value of ((36/27)/(72/324))/(12/(-3))? -3/2 (((-280)/(-560))/(3(-2)/(-12)))/(12/(-4)) -1/3 What is the value of ((-60)/189805/(-1725))/(6/162)? 4 (((-137708)/1791)/173)/((-1)/18) 8 Calculate ((-285)/45)/(-19)(-30)/20-86. 43 (-5)/((((-3)/2)/(-3))/(188/(-8272)-308)) -70 (-7)/3-17((-5815)/24423)/((-5)/(-3)) -17/3 Evaluate (-9827/504)/(21/(-216)). 54 Evaluate ((-270)/1110)/((4/(-16))/((-7)/42)). -6/37 What is ((-32)/288)/(23/10143)? -49 What is the value of 76/((-608)/56)2/(-14)? 1 What is (8/(-40))/(((-322)/(-14))/10925)? -95 (43/22532)/((-43/(-120))/(8/10)) 2/131 What is (-4)/(-4)((-133)/28)/19(-416)/39? 8/3 Evaluate 18((-2784)/9048)/((-36)/338). 52 ((-8)/(-6))/((-1)/1)(-2172)/5792-4 -2 What is the value of (((-130)/10)/1)/((-31)/93)? 39 What is the value of (41)/(1336/13694)? 41 What is (1620/243)/(704/(-33))? -5/16 49/(-63)66/(-77)210/4 35 What is 969/76(-4)/912? -68 (-8)/9(60/432)/(10/6) -2/27 What is the value of -15(31970/623415)/(((-8)/18)/(-2)3)? -15/13 What is the value of ((-468)/(-156))/(13/13)? 13 What is (5/(560/108))/((-1)/136/(-384))? 72/7 What is ((228/(-30))/(22/660))/(18/91)? -114 (-9)/(-15)((-550)/84)/((-1350)/945) 11/4 Evaluate (189/((-94122)/(-1328)))/(((-2)/9)/(3/(-423))). 4/47 What is ((22/231)/(-2(-3)/36))/(6/(-2))? -4/21 (1/(-2))/(-15419/(-1862))(-4)/21 2/33 What is ((-4)/(-3))/(-1)(-462)/(-11396)? -2/37 What is 1008/1764(-42)/64? -3/8 Calculate (39/(-6))/((-312)/1056). 22 What is (-2)/(((-10)/15122/244)/(2/1014))? 2/169 Evaluate ((-384)/160)/((-6102)/(-4520)). -16/9 Evaluate 98/(-4)2076/1038. -49 What is ((-66)/(28512/(-54)))/((-38)/(-16))? 1/19 Evaluate 544/1263(-7)/21. -12/7 Evaluate (-1((-4)/(-10))/((-321)/1070))/(4/(-10)). -10/3 Evaluate 39/35178-332. -3/41 What is (112/3920)/((((-16)/(-48))/((-1)/(-3)))/(-2))? -2/35 ((-5274)/586)/((-621)/(-9)) -3/23 ((-48)/108)/(6/9) -2/3 Evaluate (14/84)/(520/(-208)). -1/15 What is 42/(-12)3/911/((-484)/(-24))? -7/11 ((113/11526)/(11/(-132)))/(24/(-17)) 1/12 What is the value of 656/(-20746)23/(-12)? 2/33 Calculate (52/((-32)/8))/(481/(-481)). 13 Calculate -3(-4)/6(-5147)/(-499259). 2/97 -8(509/5090)/((-1)/(-15)) -12 (-9909)/3676/181 -9 Evaluate (-1781)/(-17810)(-24/46)/(-1). 2/115 (931/(-8778)(-2)/28)/(3/(-6)) -1/66 (-56)/2772(342/16)/(-19)-61 -3/22 What is (127/14859-26)/((-84)/27)? 1/14 What is the value of ((-5)/110)/((-5775)/6050)? 1/21 Calculate ((-4)/(-120))/(((-84)/14)/(-6)(-22)/44). -1/15 Calculate (-290)/5(-37170)/36540. 59 What is (-71)/((-2059)/174)(56/(-3))/(-8)? 14 What is (-284)/((-143)/(2288/64	{ "pile_set_name": "DM Mathematics" }
t*(2731/990) Simplify (((yy*12y)/(yy/y11))/(y/(y(y1/y)/y))(-1/26))34 assuming y is positive. y(10183/13) Simplify n*(-2/7)(n/n*(-5)n)/n(((nn/(n*0n)nn)/n)/n)/n*2((n/(n/n*(-1)n))/((nn/((((n/n(3/7)n)/n)/n)/n)n)/n))30 assuming n is positive. n(-1107/7) Simplify (((s(-1/3)/(ss*(-1/6)s))(-13/2))40)40 assuming s is positive. s(67600/3) Simplify ((f/f*(1/2)f*(-9/7)/ff)/(f*(-2/13)f12))(5/2) assuming f is positive. f(-11495/364) Simplify (z(1/4)z)(-19)z(3/8)/z(2/19)((z(-2/7))19)(3/17) assuming z is positive. z(-442039/18088) Simplify ((c/(c/(c42/c)c))/(c/c(-6)))/((c(-47)/c)/c(1/9)) assuming c is positive. c(730/9) Simplify (((t/t*11)/t)/(tt/t*6)(t/t(3/4))/(t(-31)t))28 assuming t is positive. t651 Simplify ((s(2/21))8/(s(1/4)s/(s(s/s(1/14))/s)))35 assuming s is positive. s(185/12) Simplify ((g/((gg*(2/29)g)/g)g/(g(-5)/ggg))/(g(-2/7)g)*(-4/11))/((g/(g(gg1)/gg))*(-2/3)g/g*(2/3)g*(-3/4)g) assuming g is positive. g(87733/26796) Simplify ((((l/(l/(l(-11)/ll)))/l(2/35))/((l/l8)/l4))(-40))(-7/3) assuming l is positive. l(-16/3) Simplify ((pp(4/3))/(p0/pp))44(pp1)29p*(-7/4)/(pp0) assuming p is positive. p(1895/12) Simplify ((u*(1/18)uu)/(uu*(-5/9)))/(u/(u/(u/(uu*(-17))))u(4/15)) assuming u is positive. u(-1409/90) Simplify (w*(-15/4)ww(-5/14)/ww)/(w/(w/w*(7/9)w))(-8) assuming w is positive. w(-1231/252) Simplify (g*(-5)(gg/(gg/g*(-3)g)g)/g)17/((g(-1)/g)/ggg/(g(2/11)g)((g(g/(g(g/(gg*(-1))g)/gg))/gg)/g)(-2)) assuming g is positive. g(-1703/11) Simplify ((i(i(-9)i)/i)/i4)(-10/3)(i2)4i*9ii0 assuming i is positive. i58 Simplify ((w(2/3)/w(-5))/(w1)(-13))/((((w(1/4)/w)/w)/w)(1/31))14 assuming w is positive. w(3703/186) Simplify ((w(-1))(-42)(ww1)(11/4))/((w/((ww(www(-4)w)/ww)/ww))/w(w/(w/w5))/ww)(-18) assuming w is positive. w(239/2) Simplify (g(2/7))(30/11)/(gg(g*(-3/7)g)/ggggg/g*(1/4))(g*2/(gg(-5/2)/g))(-3/34) assuming g is positive. g(-12931/2618) Simplify (((i(4/3)/i)/(i*(-2/13)/i))/(ii/((i/i*0)/i)ii/i(-5)))/(i(-7)/i(3/4))(-44) assuming i is positive. i(-13592/39) Simplify ((l(-1))(-45)(l(1/3))(4/9))/((l/l(-1/3))48)37 assuming l is positive. l(-62717/27) Simplify (m/(m/(m/m1)))(-34)mmm(2/23)m*(-7)m(m6mmm(-3/8))/(m(-3)/(m/m(2/5))) assuming m is positive. m(6727/920) Simplify ((p/p*(-5))/((((pp/(p*(3/4)p)pp)/p)/p)/p))*(-23)(p*(-1/5)/(p/((ppp(-2/27)p)/p)))/(p/(pp1p))(2/5) assuming p is positive. p(-83011/540) Simplify (((l(8/5)/l(-12/5))/((llll(-5/6)l)/(l/(ll(1/15)))))23)(23/2) assuming l is positive. l(12167/60) Simplify ((w/(w/w13))(3/17)w*28(ww(3/2)/w)/w)(-18/7) assuming w is positive. w(-9423/119) Simplify ((n/n11)(3/5)(nn26n)/(n/(n25/n)))(34/3) assuming n is positive. n*510 Simplify (vv/(v*(-2/9)vv))(-1/28)/(v0/(vv(vv*(2/3)v)/v))(v(-2/21)v4)(24/7) assuming v is positive. v(15035/882) Simplify (c/(c/(((c(-1/3)/c)/c)/cc)))21c/(c/(c*2/c))cc(-8/5)(cc(-1)/ccc1/c)/((c/(c(-3/2)/c)c)/(cc/(c(-6)/c))) assuming c is positive. c(-441/10) Simplify ((r/(r/((rr/r0)/r)))/r5)*(-1/2)(rr(-1/4)/rr)*(-17)/((r/(rrr(-2/3)))/(r/(r/(rr*(-5)/rr)))) assuming r is positive. r*(-173/12) Simplify ((h/(hh*(1/2)hh))(-25)/(h/(h(h/(h/(h/h*(-2)h)))/hh))(4/33))/(h(6/5)h(-6))(-1) assuming h is positive. h(19201/330) Simplify ((y(-3/8)/(yy(2/5)))/(y1)14)/((y(1/4))(28/9)/((y(-4/5)y)/(yy/(yy/(y*4y))y))) assuming y is positive. y(-8047/360) Simplify ((n(-3)n)43)38/(((n/n*(5/2))/(n/(n/(nn(-7)))))/(n(-1/6)n/((nn9/n)/n))) assuming n is positive. n(-9839/3) Simplify ((mm/m(-12)m*(-12)m*0(m(m(-4)m)/m)/mm)14)(-20) assuming m is positive. m280 Simplify ((i(-2/25)i/i18)/(i(-8)/(i*(2/19)/ii)))(-12/7) assuming i is positive. i(7308/475) Simplify (q/(qq/(q/(qq/(qq/(q/q(3/5))q)q)qqq))q/(q(-3)/q)q/(q/(qq10))q(-6))46 assuming q is positive. q*(2898/5) Simplify ((h/((hh*(-8)hh)/h)(h/h8)/h)/(h(-2))23)42 assuming h is positive. h*1890 Simplify ((nnn/n(1/17)nn(3/10))/(n(2/17))42)(-10) assuming n is positive. n7 Simplify (((w(-6/7)/ww)/www)/(ww(-2)w))*(-1/39)((w(-3))(-18/7))(-25) assuming w is positive. w(-52651/273) Simplify (r(-2/5))(2/35)/(r/(r*(-1/2)r))*(-4/5)(r(r2r)/rr)19((r/(r/(r/(r/r2))))/r)(-24) assuming r is positive. r*(9166/175) Simplify (kk(1/5))(6/7)(kk*(-1/9)k)/(k*(-3/10)k)(k/k(1/4))/((k(-2/3)/k)/kk)(kk*(-8)k)/((k*(-5)k)/k) assuming k is positive. k*(4579/1260) Simplify zz*13z*(-22)z2/z41 assuming z is positive. z(-47) Simplify ((((n(-2/7)/n)/n)/n)(-2/5)/(n1)42)(-1) assuming n is positive. n(1424/35) Simplify (j5jj1/j)/(j(1/5)/(j*(-1/2)j))jj/j*0jj/j(-6)(j/(j/(j/(j(jj*4)/j))))/(jj(2/5)) assuming j is positive. j(109/10) Simplify (((k(kk7)/k)/k)26((k/(k/(kk/(k/k*(-10))k)))/k)/(k(-1/5)/k))(2/37) assuming k is positive. k(1742/185) Simplify ((l/l(8/3)ll(5/4))/(l(2/19)/(l*0/ll)))(-29) assuming l is positive. l(-3161/228) Simplify (n/n(-1/5))(-1/63)/(n*10nn(2/65)) assuming n is positive. n(-15083/1365) Simplify (p(-2/3))(-32)/(pp(-2/7))15(p(2/7)/pp)/(pp1)p*6/(pp(-2/19)) assuming p is positive. p(5590/399) Simplify ((oo(1/6))22/(oo*(3/2)o/(o(2/15)/o)))(4/7) assuming o is positive. o(426/35) Simplify ((((d(-7)/d)/d)/(d/(d/(d/(d*(-1/4)d))))(d/(d/(d(d*1ddd)/d)d))48)38)47 assuming d is positive. d(481327/2) Simplify (l(-1/4)l(-9/5))(-7/3)/((lll/l*5l)/((l(-11)/l)/l))22 assuming l is positive. l(-15553/60) Simplify ((l(28/3))*(2/5)/((ll(-34))/l6))(-13/3) assuming l is positive. l(-8333/45) Simplify (u*6u)/u*(4/7)u*(-2/3)uu(4/3)u(uuu/(uu*(-3/2))u/(u*(-2/3)u)u)25 assuming u is positive. u(5807/42) Simplify ((z(-11)z(-10))/(((z(6/5)z)/z)/(z/(z/(z(-8)/zz)z))))(34/5) assuming z is positive. z(-5304/25) Simplify (kkk18/kk(k/(k/((kk*(-11))/k)k))/k((k/(kk*(-16)))/k)/((kk25)/k))(-25/2) assuming k is positive. k*(75/2) Simplify (v(v(-1)/v)/v)(-38)(vv1)(-20)(v(-2/5)/v)(-2/129)/(v4vvv5) assuming v is positive. v(16139/645) Simplify (b/b*(-1/2))/bb*(-1/8)((b*1b)/b)*(-2/3)(b(b(-2/5)/b)/bb*(-2)/bb)/(b(bbb/(bb*2))/bb/(b(2/9)/b)) assuming b is positive. b(-1969/360) Simplify ((n*(-3)/nn)/n(4/7))(-5)/((n/(n*(2/7)n))/n*(-4)(n2)(4/17)) assuming n is positive. n*(1627/119) Simplify (xx*(3/7)/x)/(x/(xx*(3/5)))x4/x(-4)(x(-1))(2/49)x*(-2/21)x(-2) assuming x is positive. x(5066/735) Simplify ((d*3/dd/((d*(1/4)dd)/d))/(d(-5)d(-1/2)))/(d/(d/((d/d4ddd)/d))dd/((d/(d(d*(-4)/dd)/d)d)/dd))(34/7) assuming d is positive. d(883/28) Simplify ((l(4/3))(28/3)l(-8)(l/(llll(-17)/ll)l)/ll)(1/4) assuming l is positive. l(46/9) Simplify (r*(-9)/(rr/(r/(rr9rr))))(-31)/((r3/r)/rr*(-2/11)r*(2/7)/r(r*(-3)rr)/r) assuming r is positive. r(52660/77) Simplify ((uuu(2/5)/u)(-37)(uu3)/uuu(2/5))/((u0)(-45))24 assuming u is positive. u(-237/5) Simplify ((((nn(2/17)/n)(-8/7))(-8/17))19)(1/62) assuming n is positive. n(1216/62713) Simplify (((nn23)/(n/(n(n*14n)/n)n))/(n(-9/2)/n)(-11))(4/5) assuming n is positive. n(-94/5) Simplify ((ggg(g/(gg(2/7)/g)g)/ggg)(10/9)/(g5/g*(-5)))/((g(g/(g/(g/(gg(2/3)g)g)))/g)/((gg/g*(-5)g)/g))(2/25) assuming g is positive. g(-4784/1575) Simplify h*(-1/3)h*(4/7)hh(-4)h(hh*(-5))/h(h*(-2/7)/h(hh(-7))/h)/((h6h)/((h/h*(6/7))/hh)) assuming h is positive. h*(-460/21) Simplify ((a/(aa*(-1/7)a)a/a(3/4)a)/((a(a/a2)/a)/a(3/5)))/((a/(a/(aa**(1/3))))	{ "pile_set_name": "DM Mathematics" }
o base 16. 0 Convert -33 (base 9) to base 15. -20 Convert 53 (base 10) to base 15. 38 Convert 11 (base 11) to base 4. 30 -7 (base 15) to base 2 -111 -27 (base 14) to base 4 -203 What is 242 (base 5) in base 11? 66 cc (base 13) to base 3 20020 97 (base 11) to base 5 411 What is -4 (base 11) in base 8? -4 What is 2 (base 15) in base 10? 2 What is -210 (base 5) in base 6? -131 -1 (base 3) to base 15 -1 -27 (base 10) to base 12 -23 -1011 (base 2) to base 12 -b Convert -2 (base 15) to base 7. -2 -1 (base 15) to base 4 -1 What is -302 (base 8) in base 6? -522 What is -4 (base 16) in base 11? -4 Convert -24 (base 6) to base 16. -10 -323 (base 6) to base 2 -1111011 What is 12 (base 8) in base 5? 20 -213 (base 11) to base 14 -144 What is 11 (base 16) in base 8? 21 Convert -101110 (base 2) to base 11. -42 Convert -2 (base 15) to base 10. -2 3 (base 8) to base 2 11 6 (base 14) to base 15 6 3 (base 9) to base 13 3 2 (base 11) to base 4 2 What is 33 (base 8) in base 2? 11011 What is -31 (base 4) in base 13? -10 -100010 (base 2) to base 13 -28 What is -25 (base 11) in base 5? -102 Convert -1 (base 13) to base 8. -1 What is -3123 (base 4) in base 6? -1003 -8 (base 11) to base 16 -8 Convert 123 (base 4) to base 6. 43 Convert -ee (base 15) to base 9. -268 What is 3333 (base 4) in base 12? 193 Convert 40 (base 14) to base 3. 2002 Convert 89 (base 13) to base 8. 161 Convert -185 (base 12) to base 16. -f5 -1 (base 4) to base 10 -1 Convert 42 (base 12) to base 8. 62 -b (base 13) to base 5 -21 Convert -13 (base 5) to base 12. -8 What is 331 (base 7) in base 3? 20021 What is 31 (base 4) in base 9? 14 Convert -2 (base 7) to base 15. -2 What is 6 (base 16) in base 15? 6 Convert 11100101 (base 2) to base 5. 1404 -133 (base 8) to base 3 -10101 11 (base 2) to base 14 3 100101 (base 2) to base 11 34 What is 1103 (base 4) in base 13? 65 Convert -120 (base 5) to base 13. -29 Convert -11 (base 11) to base 5. -22 Convert -25 (base 12) to base 10. -29 Convert 21 (base 3) to base 11. 7 What is -25 (base 14) in base 9? -36 What is 1010 (base 3) in base 5? 110 122 (base 4) to base 8 32 -10a (base 11) to base 16 -83 Convert 14 (base 14) to base 4. 102 Convert -2 (base 14) to base 13. -2 -1 (base 11) to base 10 -1 What is 1011 (base 3) in base 7? 43 What is 9 (base 15) in base 5? 14 Convert 10b (base 13) to base 16. b4 Convert 1100 (base 2) to base 14. c -41 (base 12) to base 11 -45 What is -3 (base 16) in base 6? -3 cb (base 14) to base 7 344 -24 (base 6) to base 13 -13 What is 2 (base 10) in base 12? 2 Convert -22 (base 9) to base 2. -10100 Convert -1314 (base 6) to base 10. -334 What is 86 (base 10) in base 6? 222 What is -9 (base 11) in base 5? -14 Convert -105 (base 7) to base 2. -110110 What is -22 (base 8) in base 9? -20 -1 (base 13) to base 16 -1 10 (base 12) to base 16 c 74 (base 9) to base 14 4b What is -21102 (base 3) in base 4? -3020 What is 2 (base 7) in base 4? 2 -3 (base 7) to base 2 -11 What is 0 (base 10) in base 7? 0 -6 (base 7) to base 13 -6 What is 1100000 (base 2) in base 6? 240 What is 2 (base 12) in base 5? 2 13 (base 6) to base 12 9 Convert 2 (base 15) to base 16. 2 Convert -13 (base 6) to base 3. -100 What is -2 (base 14) in base 7? -2 What is 5 (base 12) in base 4? 11 What is 2 (base 12) in base 9? 2 -34 (base 7) to base 4 -121 What is -1 (base 16) in base 8? -1 -152 (base 6) to base 12 -58 Convert -79 (base 11) to base 16. -56 What is -62 (base 10) in base 3? -2022 What is 15 (base 7) in base 8? 14 Convert 7f (base 16) to base 6. 331 What is -2 (base 9) in base 12? -2 What is 1000 (base 3) in base 11? 25 -2 (base 5) to base 15 -2 -2 (base 8) to base 15 -2 Convert -32 (base 15) to base 12. -3b -2 (base 7) to base 12 -2 What is 101 (base 7) in base 4? 302 What is 29 (base 15) in base 12? 33 -20 (base 13) to base 16 -1a 432 (base 5) to base 2 1110101 What is 334 (base 8) in base 16? dc -10 (base 2) to base 4 -2 What is -21 (base 15) in base 7? -43 -7 (base 14) to base 7 -10 What is -14 (base 9) in base 2? -1101 Convert 0 (base 14) to base 11. 0 What is 0 (base 13) in base 11? 0 What is -2 (base 16) in base 12? -2 Convert 153 (base 10) to base 4. 2121 Convert 2 (base 3) to base 8. 2 Convert 28 (base 11) to base 5. 110 What is -124 (base 7) in base 6? -151 What is -a3 (base 14) in base 11? -120 14 (base 8) to base 6 20 Convert -3 (base 8) to base 7. -3 Convert -221 (base 5) to base 9. -67 What is 2 (base 3) in base 5? 2 What is 1 (base 12) in base 4? 1 Convert 1 (base 11) to base 5. 1 18 (base 9) to base 10 17 Convert -32 (base 4) to base 12. -12 What is 41 (base 8) in base 6? 53 Convert 3d (base 16) to base 8. 75 What is 111 (base 2) in base 11? 7 Convert -202 (base 6) to base 2. -1001010 -10332 (base 4) to base 15 -163 What is 1001 (base 3) in base 5? 103 Convert 4 (base 5) to base 10. 4 Convert -155 (base 7) to base 4. -1121 Convert -10 (base 3) to base 8. -3 -6 (base 8) to base 15 -6 Convert -1 (base 3) to base 13. -1 2021 (base 4) to base 6 345 What is -57 (base 11) in base 13? -4a -8 (base 11) to base 5 -13 -3 (base 11) to base 16 -3 Convert -12 (base 6) to base 11. -8 2 (base 12) to base 11 2 -13 (base 4) to base 3 -21 What is 11102 (base 3) in base 7? 230 What is 1 (base 3) in base 8? 1 Convert -1 (base 11) to base 5. -1 Convert -1a (base 16) to base 13. -20 3 (base 11) to base 12 3 Convert 4 (base 9) to base 10. 4 Convert -19 (base 15) to base 7. -33 What is -117 (base 11) in base 2? -10001011 What is 27 (base 9) in base 15? 1a What is -3 (base 15) in base 5? -3 -22 (base 6) to base 4 -32 What is 11 (base 4) in base 15? 5 What is -11 (base 12) in base 14? -d 41 (base 6) to base 14 1b What is 0 (base 11) in base 4? 0 What is -101 (base 2) in base 7? -5 10332 (base 4) to base 3 102210 Convert -5 (base 8) to base 12. -5 -6 (base 11) to base 15 -6 274 (base 8) to base 2 10111100 What is -2 (base 14) in base 2? -10 56 (base 12) to base 5 231 -2002 (base 3) to base 6 -132 10 (base 4) to base 12 4 Convert -5 (base 6) to base 8. -5 Convert 110 (base 5) to base 6. 50 -37 (base 11) to base 6 -104 Convert -2 (base 11) to base 6. -2 What is 2 (base 16) in base 4? 2 What is -b8 (base 16) in base 8? -270 What is 100000000 (base 2) in base 11? 213 What is 4 (base 11) in base 15? 4 -35 (base 8) to base 14 -21 1 (base 7) to base 2 1 Convert 5 (base 16) to base 8. 5 What is 1 (base 6) in base 15? 1 What is -a3 (base 16) in base 5? -1123 What is -1 (base 5) in base 8? -1 What is -10 (base 4) in base 6? -4 -2 (base 12) to base 3 -2 -3 (base 9) to base 16 -3 10 (base 6) to base 8 6 27 (base 15) to base 7 52 What is -4 (base 7) in base 3? -11 What is 88 (base 10) in base 16? 58 What is -2 (base 14) in base 11? -2 Convert -6 (base 7) to base 5. -11 Convert -20 (base 5) to base 6. -14 -98 (base 14) to base 5 -1014 1010110 (base 2) to base 9 105 Convert 30 (base 5) to base 4. 33 -3 (base 13) to base 10 -3 -d (base 16) to base 9 -14 Convert -7 (base 9) to base 15. -7 Convert 2 (base 15) to base 2. 10 13 (base 5) to base 11 8 Convert 2 (base 7) to base 13. 2 Convert 18 (base 12) to base 2. 10100 Convert -17 (base 10) to base 15. -12 What is -16 (base 7) in base 15? -d What is -27 (base 11) in base 16? -1d 1a (base 13) to base 7 32 Convert -12 (base 4) to base 12. -6 What is -11100 (base 2) in base 12? -24 -43 (base 14) to base 10 -59 Convert 5 (base 6) to base 7. 5 -2 (base 3) to base 5 -2 Convert -4 (base 15) to base 16. -4 Convert -60 (base 7) to base 12. -36 What is 11 (base 2) in base 13? 3 What is 11 (base 10) in base 13? b 3 (base 15) to base 3 10 0 (base 8) to base 16 0 -3 (base 8) to base 10 -3 Convert -102 (base 4) to base 9. -20 Convert 323 (base 4) to base 5. 214 What is 2 (base 14) in base 6? 2 44 (base 9) to base 16 28 -17 (base 15) to base 10 -22 Convert -14 (base 7) to base 6. -15 -66 (base 7) to base 3 -1210 205 (base 6) to base 4 1031 Convert 2440 (base 5) to base 11. 307 What is 6 (base 12) in base 4? 12 -10 (base 16) to base 6 -24 -234 (base 5) to base 6 -153 What is -18 (base 10) in base 2? -10010 254 (base 8) to base 4 2230 Convert 1 (base 3) to base 10. 1 Convert 1 (base 12) to base 14. 1 What is -1 (base 7) in base 10? -1 -89 (base 16) to base 9 -162 What is -45 (base 6) in base 8? -35 Convert -19 (base 12) to base 8. -25 What is -1 (base 7) in base	{ "pile_set_name": "DM Mathematics" }
- 2812945t + 5625972t. t Collect the terms in -5h3 + 351644h + 13h3 - 11h*3. -3h*3 + 351644h Collect the terms in -5y2 - 10y*2 - 4y*2 + 7y*2 + 3y + 2y2 + 12y*2. 2y*2 + 3y Collect the terms in 389352s - 895845s + 506495s. 2s Collect the terms in 4312g3 + 3037g*3 + 2685g*3 - 1399114g + 1399112g. 10034g*3 - 2g Collect the terms in -260d2 - 58d*2 + 1090d*2 + 5 - 6 + 895d*2. 1667d*2 - 1 Collect the terms in 5501787f*2 - 2074323f*2 + 9060950f*2. 12488414f*2 Collect the terms in -80528z - 80548z - 80553z + 322131z - 80613z. -111z Collect the terms in -2h*3 + 54 + 59 + 57 + 10h*3 + 53 - 228. 8h*3 - 5 Collect the terms in 219m2 - m3 + 74m - m3 + m3 - 31m. -m*3 + 219m*2 + 43m Collect the terms in 6640 - 35b - 78b - 13261 + 6625. -113b + 4 Collect the terms in -2498873h - 143h2 - 2499034h + 4997907h. -143h*2 Collect the terms in 0 + 0 - 554o + 560o - 598o*3 + 0 + 0. -598o*3 + 6o Collect the terms in 1069u3 - 551u3 - u2 + 9u3 - 529u3 + u2. -2u3 Collect the terms in 1749d*2 - 6934d*2 + 1690d*2 + 1747d*2 + 1748d*2 + 31d*3. 31d*3 Collect the terms in 7p - 729p3 + 8p - 485p3 + 1217p*3 - 15p. 3p3 Collect the terms in -90o + 46o - 1 - 128o - 7 + 13o. -159o - 8 Collect the terms in -5596p + 1 - 3 - 74p*2 - 70p*2 + 36p*2 + 15967p. -108p2 + 10371p - 2 Collect the terms in -16249 + 3q3 + 7046 + 9203. 3q*3 Collect the terms in 21172x*3 + 6006x*3 + 539x*3. 27717x*3 Collect the terms in 22115 - 692x + 690x - 4131. -2x + 17984 Collect the terms in -3016a - 11804112878 + 11804112878. -3016a Collect the terms in l - 144404432 + 72202215 + 72202215. l - 2 Collect the terms in b*2 - 162b + 162b - 7791b*3 - 6b*2 + 4b*2. -7791b3 - b2 Collect the terms in -3416a3 - 327a*3 - 2a - 2315a3 - 1018a*3. -7076a*3 - 2a Collect the terms in 338p - 399900 + 399900. 338p Collect the terms in 654d + 187 + 159 - 346. 654d Collect the terms in 4s3 - 2s*2 + 546 - 7s*3 - 16s*3. -19s*3 - 2s*2 + 546 Collect the terms in 107j*2 - 114j + 114j2 - 448j*2 + 115j*2 + 109j*2. -3j*2 - 114j Collect the terms in 213500a2 + 213477a*2 - 640393a*2 + 213434a*2. 18a*2 Collect the terms in -7422s*3 - 17s*2 - 15s*2 + 48 + 32s*2 - 52. -7422s*3 - 4 Collect the terms in 12283 - 23r*3 + 12293 + 12291 - 36867. -23r*3 Collect the terms in -6764692q - 45 + 26q2 + 6764692q + 46. 26q2 + 1 Collect the terms in 710j - 2389j + 878j + 858j. 57j Collect the terms in 135x + 2x*3 + 151 - 307 + 156 - 94x. 2x3 + 41x Collect the terms in -6 - 22799z + 5 + 22793z - 4 + 5. -6z Collect the terms in 262u*3 + 450 - 27u*3 + 23u*3 - 819 + 419. 258u*3 + 50 Collect the terms in -126672p*2 - 299378p*2 + 17052p*2 - 347427p*2 - 368p*2. -756793p*2 Collect the terms in 1077l - 3474l + 4292l + 5309l. 7204l Collect the terms in -1669151x - 1669074x + 3338301x. 76x Collect the terms in -1187v3 + 526v*3 + 2541v*3 + 4110v*3. 5990v*3 Collect the terms in 31f*2 - 70f2 + f2 - 103f2. -141f*2 Collect the terms in -20l - 1027l3 - 1122l*3 - 1 + 39l. -2149l3 + 19l - 1 Collect the terms in 444 - 2031m - 221 - 223 + 331m. -1700m Collect the terms in 2677261 - 1338617 - 1338644 - 3g*3. -3g*3 Collect the terms in -380g2 - g3 - 75g2 + 13g*3 - g - 5g*3 - 8g3. -g3 - 455g2 - g Collect the terms in 25931b*3 + 25931b*3 - 103738b*3 + 22 + 25937b*3 + 25940b3 - 12. b3 + 10 Collect the terms in -4h - 168109452 + 168109450 + h. -3h - 2 Collect the terms in 345 - r*2 + 3r*2 - 253 - 138. 2r*2 - 46 Collect the terms in 0i*2 + 15787 - 31094 + 15307 - 5i*2 + 6i2. i2 Collect the terms in 33905w3 + 35573w*3 - 69481w*3. -3w*3 Collect the terms in -8r + 3r + 0r - 651 - 63r2. -63r*2 - 5r - 651 Collect the terms in -435d2 - 5 - 827d*2 + 2078d*2 - 825d*2. -9d*2 - 5 Collect the terms in 387d - 740d + 372d + 325 + 13. 19d + 338 Collect the terms in -1053t - 917t + 148t. -1822t Collect the terms in -19i - 4i - 480 + 22i - 2i - 5i. -8i - 480 Collect the terms in -1072p*2 + 1072p*2 - 35867p*3 - 31656p*3 - 38523p*3. -106046p*3 Collect the terms in -2 + 7932814j*2 + 2. 7932814j*2 Collect the terms in 6d*3 - 30d*2 - 12d*2 + 28d*2 - 7d*2 + 21d*2. 6d*3 Collect the terms in 0y - 34y3 + 0y*2 + 6y*2 + 4y + 0y - y2. -34y*3 + 5y*2 + 4y Collect the terms in 316 + 92 - w*3 - 67 - 362w + 730w - 368w. -w*3 + 341 Collect the terms in -15o*2 - 608749 + 608749. -15o*2 Collect the terms in 2y*2 - 85y + 31y + 2y*2 + 36y - 3y2 + 29y. y*2 + 11y Collect the terms in -193 + 73 - 28 + 76 + 72 + 41w3 + 34w*3. 75w*3 Collect the terms in -11l*2 + 815587607496834 - 815587607496834. -11l*2 Collect the terms in -270457q*3 + 135241q*3 + 7q*2 + 135217q*3 + 5q2. q3 + 12q2 Collect the terms in 2767 + 695u*3 - 5539 + 2772. 695u*3 Collect the terms in 71d - 71d + 3475d*3 - 20d*2 + 20d*2. 3475d*3 Collect the terms in 404z - 802z + 393z + 10356. -5z + 10356 Collect the terms in 9244y + 4y2 - 5y*2 - 9186y - 56. -y*2 + 58y - 56 Collect the terms in 161140j - 321830j + 161098j. 408j Collect the terms in -14s - 61 + 21s + 112 + 3s - 56 - s. 9s - 5 Collect the terms in -520944 + 94m2 - 522311 - 93m2 + 1043255. m2 Collect the terms in 5m2 - 4m*2 - 2m*2 - 13m*2 + 24m*2 - 2m*2. 8m*2 Collect the terms in -1690p + 5356p - 1841p - 1820p. 5p Collect the terms in 1881541b2 - 3763069b*2 + 1881529b2. b2 Collect the terms in -36 + 301 + 363 + 152 + 54 + 12h3. 12h*3 + 834 Collect the terms in 79a - 6 + 47 + 18 + 47 - 2. 79a + 104 Collect the terms in 63923n + 54783n - 111777n. 6929n Collect the terms in -83l*2 + 11l*2 + 17l*2 + 18l*2 - 99l*2. -136l*2 Collect the terms in 250755j + 3 - 2 - 250808j. -53j + 1 Collect the terms in p2 - p2 - 21589p3 + 20738p*3. -851p*3 Collect the terms in -30747011333s + 30747011333s + 8s*2. 8s*2 Collect the terms in 179470587 - 179470587 + 2h*3. 2h*3 Collect the terms in -45 + 32 + 40k - 3k + 12 + k + 18k. 56k - 1 Collect the terms in -51 - 45 + 279719b - 279758b + 96. -39b Collect the terms in -7k2 - 6k*2 + 51k*2 - 11k*2 - 38k*2 - 43k*2. -54k*2 Collect the terms in 23t*2 + 22701 + 24t*2 + 33t*2 - 22701. 80t*2 Collect the terms in -199172r*2 + 1138r - 1138r. -199172r*2 Collect the terms in -3349y - 3266y + 6546y + y2 + 62. y2 - 69y + 62 Collect the terms in 227x + 21 - 4 + 21 - 5 + 181x. 408x + 33 Collect the terms in 1 + 7476g - 1 + 10386g. 17862g Collect the terms in -1853v*2 - 1830v*2 + 7406v*2 - 1855v*2 + 71v - 1865v2. 3v*2 + 71v Collect the terms in 394r3 + 1355r*3 + 987r*3 + 3552r*3. 6288r*3 Collect the terms in -243p - 148p + 831p - 158p - 153p - 203p. -74p Collect the terms in -7 - 2 + 29j + 8 - 13. 29j - 14 Collect the terms in -134w2 + 126w - 7 + 246w2 - 63w - 63w - 156w*2. -44w*2 - 7 Collect the terms in 17811 - 9m*3 - 17811 + 38m. -9m3 + 38m Collect the terms in 183 + 155q2 - 60q*2 - 44q*2 - 60q*2. -9q*2 + 183 Collect the terms in 24048183 - 24048210 + 33w - 9w. 24w - 27 Collect the terms in 92902q + 92676q - 185570q. 8q Collect the terms in 10f3 - 6845f + 13717f - 6882f. 10f3 - 10f Collect the terms in -6167f2 + 6167f*2 + 21929f*3. 21929f*3 Collect the terms in 36 + 53i*2 + 39 - 220 + 108 + 37. 53i*2 Collect the terms in -9424w*2 + 0 + 8655w*2 + 4w + 2. -769w2 + 4w + 2 Collect the terms in -104g2 + 132g - 41g - 71g + 89g2 - 20g. -15g2 Collect the terms in 30i*3 - 29i*3 + 5i*3 - 56i*3 - 117i*3 + 2276852i*2 - 2276852i*2. -167i*3 Collect the terms in 3341666k*2 - 6678785k*2 + 3337129k*2. 10k*2 Collect the terms in 8y*3 + 8y*3 + 144248y*2 - 72028y*2 - 72220y*2. 16y*3 Collect the terms in -18c*3 + 9c + 4c + 4 - 17c + 3*c. -1	{ "pile_set_name": "DM Mathematics" }
or t. -5 Let d be 10/(-25) - (-18)/(-5) - -8. Solve -5r + 4x - 13 = 0, -3r + dx - 11 = -0x for r. -1 Let b = 0 - -3. Suppose -3s + 5v = 2, 3s + 2v + v - 6 = 0. Suppose -s - 23 = -6y. Solve -bq + 4q - ya = -25, -3q + 4a = 35 for q. -5 Let r = 8 - 4. Solve -m - r = -2b + b, -b - 2m + 7 = 0 for b. 5 Let i = 10 - 6. Let g be 2/(-8) - (-95)/76. Suppose -h + i = -g. Solve t + 5j = -4t + h, 0 = -3t - 4j + 6 for t. -2 Let f be ((21 - 11) + -10)/(-3 - 0). Solve 4n = 3j - 18, fj + 2j = -3n - 5 for j. 2 Let l = 23 + -10. Let o(w) = 4w3 + w2. Let y be o(1). Solve j = -yd + 5j + l, 4d = j + 17 for d. 5 Suppose 4i + 7 = -1. Let x = i - -7. Suppose 0 = xj - 4j. Solve 4r - 19 = d - 4d, 2r - 4d + 18 = j for r. 1 Suppose 0 = 5a - 44 + 34. Solve -2f - m = -8, 4f - af + 2m = 6 for f. 5 Let f(h) be the first derivative of h*4/4 + 8h*3/3 + 4h*2 - 10. Let s be f(-6). Let v = 30 - s. Solve -u + 4g = g - 14, v = -2g for u. 5 Let i(m) = -3m*2 + 22m - 24. Let u be i(6). Solve 5y + uq = 4q + 29, 0 = y + 5q for y. 5 Suppose -4a = 4f + 336, -3a - 86 - 6 = f. Let h be (f1)/(-4)1. Solve p + 5q = h, -4p - 4 = -9p - q for p. 0 Suppose -3r - 12 = -l - 1, -17 = -3l + r. Suppose 5 = -lz, 3b + b + z = -1. Suppose 0 = -bm + 2m. Solve ma + 16 = 5a - 3d, 3d - 4 = -5a for a. 2 Let m be (-3 + 9 - 8)/(4/(-8)). Solve 5x = -5j + 20, -4j + 5x = mx - 21 for j. 5 Let g be (-6 + -1)/(2/(-4)). Suppose o - 2o - 13 = -t, 2o + 4t + 8 = 0. Let s = o + g. Solve -27 = -5u + 4y, -2y = su + 2y for u. 3 Let f be -2 + 1(-1 + 3 + 2). Suppose -4l + r + 0r = -10, fr - 1 = l. Solve 0 = 2p + 3j + 7, lj - 2j = -p - 3 for p. -2 Let u(m) = -m*3 + 18m*2 - 16m - 12. Let s be u(17). Solve 4i - sh + 11 = -5, 3i - 3h = -12 for i. -4 Suppose -11 - 1 = -6z. Solve 2m = 3b - z, 4m + 12 = 2b + 8m for b. 2 Let g = 5 + 15. Suppose -5t + 24 = -t. Suppose -r = -tr + g. Solve i - q = q + 14, -4i - 4q = r for i. 4 Suppose -2w + 13 = -1. Let i(k) = k - 13. Let b be i(w). Let r(s) = s2 + 4s - 5. Let n be r(b). Solve -2z = -v - 1, 0v + n = 5z + 2v for z. 1 Let a = 12 + -10. Let w be a/(-6) - (-32)/6. Solve 5r + 10 = 5f - f, -2r - 4 = wf for r. -2 Suppose -3u = 5k - 0k - 35, 0 = -5k - 4u + 40. Let b be 2 - -2 - k/2. Solve 3f + 3 = -d - b, 0 = -f for d. -5 Suppose -7u - 27 + 6 = 0. Let q be u/((-18)/20) - (-16)/(-12). Solve -5m + 10m = -qj + 3, 2j + 1 = -m for j. -1 Let x(w) = -w2 - 9w - 27. Let g be x(-8). Let n(y) = y*2 + 19y + 2. Let p be n(g). Solve b = -4b - 3h - 37, -pb = 4h + 26 for b. -5 Let x(g) = g*3 - 53g*2 + 197g - 45. Let m be x(49). Solve 3w = 6w - 2c + 8, 16 = -mw + 4c for w. 0 Let d be -112(-45)/(-12). Let r be ((-4)/(-8))/((-3)/(-1 - -7)). Let a be r/(33/d). Solve -4l + 2l - ap = 4, -3p = 0 for l. -2 Suppose -4c - 5x = -16, -2c + 20 = 3c - 3x. Suppose cw = 5 + 7. Solve -wi + 0v + 3 = -3v, -4i - 3v = 17 for i. -2 Let j be (12/(-16))/((-1)/12). Let k be 25/9 + 2/j. Suppose ky = -w + 5, 0y - 2y = w - 3. Solve 3c + 2 = -5l + c, 2l = -2c - y for l. 0 Let p = -53 - -55. Suppose -3s - q = ps - 15, -s - q = -7. Solve -4g = sc - 20, -2c - 15 = -5c - 3g for c. 0 Suppose -8 = -4m - 0m. Suppose 7b = 94 - 31. Solve -2u - 5v - 22 = 0, 2u + mv = u - b for u. -1 Suppose 0 = 4a - u + 6u, -5u = -4a. Let l be (4/3)/(656/48 + -13). Solve -5o - t - 6 = a, 3t - l = 4o - 1 for o. -1 Let p(f) = -f2 + 3f - 90. Let h be p(0). Let j be 18/h + 2/10. Solve -4b - w + 2 = 0, b = -4w - jw + 8 for b. 0 Suppose -10 = -3f - 2r, -9f + 4f + 25 = -5r. Suppose 5x + 50 = -5d, 5x = x - d - 25. Let v = f - x. Solve 0 = q - 3o - v, -2q - 5o = -3o - 2 for q. 3 Let q be (52/2 - -2)56/28. Suppose -2o = q - 64. Solve 4h - o = 0, -2s + 2h = s + 5 for s. -1 Let h(w) = 5w + 0w + 3 - 2w - 24. Let a(v) = -v3 - 2v*2 + 2v + 6. Let g be a(-3). Let x be h(g). Solve 4z + xu + 16 = 2u, 4z + 10 = 2u for z. -3 Let h be (-8)/44 - 167/(-11). Let a be (50/h)/(6/9). Solve a + 1 = -4q + 5v, -q + 9 = 4v for q. 1 Let b(d) = d - 12. Let l be b(15). Suppose 3z = lo + z - 11, -5z - 2 = o. Solve -5q = -3r + 15, -or - q - 3q + 15 = 0 for r. 5 Let i(u) = 2u - 9. Let r be i(6). Suppose -z + 3d = -15, -9 + 29 = rz - 4d. Solve -b = -a + b, -a + b = z for a. 0 Let h = 5 + -2. Suppose k = hk - 4. Solve -12 = -4c - 2y, 0 = -kc - 3y - 0y + 14 for c. 1 Let j be (-9)/(-2) + (-7)/(-14) + -1. Solve -2h = -2m, jh - 30 = -2m - 0m for h. 5 Let u = 244 - 244. Solve 2 = 4m + 3t - ut, -8 = -2m - 5t for m. -1 Suppose -4p + 6p = -3w + 21, 0 = 4p + 3w - 39. Let l = -9 + p. Solve x - 4a - 3 = l, 0 = -4x - a - 0a - 5 for x. -1 Let f = 9 + -7. Solve -fz + 2v = -2, 2z + 10 = -5v - 16 for z. -3 Suppose -3r - 9f + 5f = -25, 2f = -2r + 16. Solve p + r = i - 1, -3i = -p - 14 for i. 3 Suppose -2w + 44 = -12. Let p = 23 - 19. Solve l - a - 16 = 3a, 0 = -2l - pa - w for l. -4 Let k be (18/15)/((-3)/(-10)). Suppose -kr + 6r - 8 = 0. Solve rd + 12 = -t, 3t + 0d = -2d + 4 for t. 4 Suppose 2h - 4a = 0, 3h - 2a = 3 + 1. Suppose -6l + l = n - 33, hn - 66 = l. Solve -5o - n = -4z, -2o - 16 = -5z + 2z for o. -5 Suppose 0 = -6m - 7 + 7. Let i(b) = -b2 + 2b + 2. Let a be i(m). Solve -2c - av - 6 = 0, -c + 4c = 2v + 1 for c. -1 Let f = -176 - -179. Solve -fc + 5c = 5n + 6, 2n = c - 2 for c. -2 Let y be 2(3 + -2 + 34/(-4)). Let w be (9/y)/((-4)/20). Solve 2z - 4p - 14 = 0, -2p = 8z - wz + 25 for z. -3 Suppose 11 = 3l - 1. Let b be (-6)/l + 205/10. Let q(m) = m2 + m - 4. Let z be q(-3). Solve -11 = -zv + 3v + 4a, 0 = -3v + a + b for v. 5 Let s be 69(-5)/9(-21)/35. Solve 7 = -2c - i, 4c = c - 4i - s for c. -1 Let o(h) = 3h - 14. Let j be o(5). Suppose 0 = -4r + 5n + 17, -4 = 5n + j. Solve -rb = -5v + 21, 0v - 5 = -2b - 3v for b. -2 Let z(g) = -g3 - 41g*2 + 44g + 111. Let l be z(-42). Solve 3y = 2u + 3u + l, -y = 3u + 5 for u. -3 Let s(k) = 6k + 125. Let f be s(-20). Solve -o = -3c + 2o, -3o = -fc + 6 for c. 3 Suppose -2z + 65 = -155. Let o = z + -108. Solve -3x = -5g, -og = -5x - 4 - 15 for g. -3 Let v = 0 + 0. Let w = 24 - 17. Solve 3z = v, -2g + w = -2z - 1 for g. 4 Let a(x) be the third derivative of x4/24 + 17x*3/6 - 7x*2. Let c be a(0). Solve -c = 4t - 7t + u, -5u = 2t for t. 5 Let p(a) = 14a + 156. Let b be p(-11). Solve -4k + 5 + 9 = 3l, 4l - bk + 18 = 0 for l. -2 Suppose -s + y - 5 = 0, -4s + 5s + 3 = 3y. Let q be (-4)/(-14) - s/(-21). Suppose 36r - 15 = 33r. Solve -rh + 3g + 37 = q, 0h + 3h + 1 = -4g for h. 5 Suppose -22d + 102 = -5d. Solve 3w = -2h + 4h - d, -4w + h = 3 for w. 0 Suppose -4h - 2v = -h - 45, 5v + 15 = 0. Solve 4m + 4o = 6 + 14, 3o + h = 5m for m. 4 Suppose -5x + 1 = -14. Let f(z) = -xz - 6 + z2 + 5 - 4. Let c be f(5). Solve -p + 15 = -cw, w - 3p = 4w + 9 for w. -3 Let k(p) = 32p + 165. Let c be k(-5). Solve -m - 3m + ca = 0, -35 = -3m - 5a for m. 5 Let l be (2/1)/(3/30). Suppose 61 + l = 3b. Let o = 38 - b. Solve 2z + 2c - o = -z, -2c = -z + 1 for z. 3 Suppose -89 = 3h + l, -2h - 4l - l = 81. Let n = -17 - h. Suppose 0 = -2g + 3 + n. Solve -g = -4p - 3w, 0 = 4p - 3w + 12 + 11 for p. -2 Let t be 441/98 - (-2)/(-4). Solve -2y - 18 = y + 3f, -3f + 3 = -ty for y. -3 Let u = 543 + -538. Solve -4w = 0, -4q + 3w - 17 = -u for q. -3 Let d(q) = q*3 - 2q*2 - 3q + 3. Let i be d(3). Let u = i + -1. Suppose uz = 6z. Solve -4b = -5f - 24, z = -f - f - 8 for b. 1 Let h = 291 - 289. Solve -4l - hj - 22 = 0, -3j - 5 = 2l - 8j for l. -5 Let b(p) = p - 16. Let m(f) = 3f - 33. Let s(k) = -5b(k) + 2m(k). Let n be s(10). Let w be 34/(n/10). Solve -3r + 0r - 3q = -18, -wq = 2r - 21 for r. 3 Suppose -v = -7 + 1. Solve -d - 27 = -vd - 3o, -22 = -2d - 4o for d. 3 Let a(b) = -b*2 - 9b - 14. Let o be a(-6). Suppose 0 = -ot + s + 17, t - 2t + 11 = 2s. Let u = -5 - -10. Solve u = th, -3x = x - 4h for x. 1 Let h(l) = -14l - 68. Let v be h(-6). Solve 4m = -v, -2r - 3m + 8m + 10 = 0 for r. -5 Let c = -3105 + 3109. Solve -3w = -12, s - w + 16 = c*w for s. 4 Suppos	{ "pile_set_name": "DM Mathematics" }
What are the prime factors of 1151? 1151 List the prime factors of 1568. 2, 7 What are the prime factors of 3144? 2, 3, 131 List the prime factors of 7477. 7477 What are the prime factors of 113069? 11, 19, 541 List the prime factors of 8271. 3, 919 List the prime factors of 687. 3, 229 What are the prime factors of 23225? 5, 929 What are the prime factors of 1280? 2, 5 What are the prime factors of 4307? 59, 73 List the prime factors of 12370. 2, 5, 1237 What are the prime factors of 104197? 29, 3593 List the prime factors of 10854. 2, 3, 67 List the prime factors of 253. 11, 23 List the prime factors of 14724. 2, 3, 409 What are the prime factors of 1682? 2, 29 What are the prime factors of 702? 2, 3, 13 What are the prime factors of 548? 2, 137 List the prime factors of 118851. 3, 173, 229 List the prime factors of 1875. 3, 5 What are the prime factors of 103044? 2, 3, 31, 277 List the prime factors of 52694. 2, 26347 List the prime factors of 41805. 3, 5, 929 What are the prime factors of 2106? 2, 3, 13 List the prime factors of 8707. 8707 List the prime factors of 43398. 2, 3, 2411 List the prime factors of 139909. 7, 11, 23, 79 What are the prime factors of 900? 2, 3, 5 What are the prime factors of 92? 2, 23 List the prime factors of 172810. 2, 5, 11, 1571 List the prime factors of 104. 2, 13 List the prime factors of 136423. 7, 19489 List the prime factors of 1152. 2, 3 List the prime factors of 15051. 3, 29, 173 What are the prime factors of 3656? 2, 457 What are the prime factors of 71961? 3, 17, 83 List the prime factors of 25488. 2, 3, 59 List the prime factors of 767. 13, 59 What are the prime factors of 691? 691 What are the prime factors of 3599? 59, 61 What are the prime factors of 39374? 2, 19687 List the prime factors of 406. 2, 7, 29 List the prime factors of 24465. 3, 5, 7, 233 List the prime factors of 13524. 2, 3, 7, 23 List the prime factors of 58787. 58787 List the prime factors of 534. 2, 3, 89 What are the prime factors of 784? 2, 7 What are the prime factors of 7922? 2, 17, 233 What are the prime factors of 12229? 7, 1747 What are the prime factors of 79389? 3, 8821 What are the prime factors of 1020? 2, 3, 5, 17 List the prime factors of 2091. 3, 17, 41 List the prime factors of 7146. 2, 3, 397 List the prime factors of 1134. 2, 3, 7 What are the prime factors of 3205? 5, 641 What are the prime factors of 495? 3, 5, 11 What are the prime factors of 1128? 2, 3, 47 What are the prime factors of 83138? 2, 11, 3779 What are the prime factors of 8345? 5, 1669 What are the prime factors of 2675? 5, 107 List the prime factors of 522. 2, 3, 29 List the prime factors of 59513. 59513 What are the prime factors of 18610? 2, 5, 1861 List the prime factors of 3739. 3739 List the prime factors of 1654. 2, 827 What are the prime factors of 23400? 2, 3, 5, 13 List the prime factors of 7163. 13, 19, 29 What are the prime factors of 1821? 3, 607 List the prime factors of 4410. 2, 3, 5, 7 List the prime factors of 4694. 2, 2347 List the prime factors of 8513. 8513 List the prime factors of 1337. 7, 191 List the prime factors of 8309. 7, 1187 List the prime factors of 2300. 2, 5, 23 List the prime factors of 5022. 2, 3, 31 List the prime factors of 3701. 3701 What are the prime factors of 1030? 2, 5, 103 What are the prime factors of 760? 2, 5, 19 What are the prime factors of 65553? 3, 21851 What are the prime factors of 51? 3, 17 List the prime factors of 17840. 2, 5, 223 What are the prime factors of 50834? 2, 7, 3631 List the prime factors of 3974. 2, 1987 List the prime factors of 53000. 2, 5, 53 What are the prime factors of 80788? 2, 19, 1063 List the prime factors of 32077. 32077 List the prime factors of 1965. 3, 5, 131 What are the prime factors of 5556? 2, 3, 463 What are the prime factors of 90375? 3, 5, 241 List the prime factors of 1223. 1223 List the prime factors of 450. 2, 3, 5 List the prime factors of 5863. 11, 13, 41 What are the prime factors of 4407? 3, 13, 113 List the prime factors of 32592. 2, 3, 7, 97 What are the prime factors of 74695? 5, 14939 List the prime factors of 512. 2 List the prime factors of 23330. 2, 5, 2333 What are the prime factors of 15048? 2, 3, 11, 19 List the prime factors of 5918. 2, 11, 269 List the prime factors of 11757. 3, 3919 List the prime factors of 6346. 2, 19, 167 List the prime factors of 34. 2, 17 List the prime factors of 2781. 3, 103 List the prime factors of 1178. 2, 19, 31 List the prime factors of 73610. 2, 5, 17, 433 What are the prime factors of 1174? 2, 587 List the prime factors of 26355. 3, 5, 7, 251 List the prime factors of 17040. 2, 3, 5, 71 List the prime factors of 53730. 2, 3, 5, 199 List the prime factors of 513. 3, 19 What are the prime factors of 6506? 2, 3253 List the prime factors of 3179. 11, 17 What are the prime factors of 15919? 15919 What are the prime factors of 1452? 2, 3, 11 List the prime factors of 5927. 5927 List the prime factors of 1727. 11, 157 List the prime factors of 17295. 3, 5, 1153 What are the prime factors of 18891? 3, 2099 List the prime factors of 49340. 2, 5, 2467 What are the prime factors of 76377? 3, 7, 3637 List the prime factors of 33255. 3, 5, 739 What are the prime factors of 3700? 2, 5, 37 List the prime factors of 3449. 3449 List the prime factors of 848. 2, 53 What are the prime factors of 15378? 2, 3, 11, 233 List the prime factors of 2189. 11, 199 What are the prime factors of 4857? 3, 1619 What are the prime factors of 757? 757 List the prime factors of 1784. 2, 223 What are the prime factors of 3245? 5, 11, 59 List the prime factors of 20302. 2, 10151 What are the prime factors of 5049? 3, 11, 17 List the prime factors of 12802. 2, 37, 173 What are the prime factors of 9070? 2, 5, 907 List the prime factors of 10773. 3, 7, 19 List the prime factors of 18064. 2, 1129 What are the prime factors of 27008? 2, 211 List the prime factors of 23664. 2, 3, 17, 29 List the prime factors of 40036. 2, 10009 List the prime factors of 4369. 17, 257 List the prime factors of 1881. 3, 11, 19 What are the prime factors of 27632? 2, 11, 157 What are the prime factors of 7946? 2, 29, 137 List the prime factors of 61492. 2, 15373 List the prime factors of 328. 2, 41 List the prime factors of 2334. 2, 3, 389 What are the prime factors of 2215? 5, 443 List the prime factors of 1328. 2, 83 What are the prime factors of 6248? 2, 11, 71 What are the prime factors of 2162? 2, 23, 47 What are the prime factors of 7840? 2, 5, 7 List the prime factors of 565. 5, 113 What are the prime factors of 589? 19, 31 What are the prime factors of 746? 2, 373 List the prime factors of 89857. 59, 1523 List the prime factors of 194. 2, 97 List the prime factors of 1648. 2, 103 List the prime factors of 48891. 3, 43, 379 List the prime factors of 27684. 2, 3, 769 List the prime factors of 1881. 3, 11, 19 List the prime factors of 97372. 2, 11, 2213 What are the prime factors of 1771? 7, 11, 23 List the prime factors of 1403. 23, 61 List the prime factors of 6131. 6131 What are the prime factors of 17063? 113, 151 List the prime factors of 5117. 7, 17, 43 List the prime factors of 28377. 3, 1051 List the prime factors of 2330. 2, 5, 233 What are the prime factors of 15598? 2, 11, 709 List the prime factors of 36872. 2, 11, 419 What are the prime factors of 6905? 5, 1381 List the prime factors of 6356. 2, 7, 227 List the prime factors of 64230. 2, 3, 5, 2141 List the prime factors of 1123. 1123 What are the prime factors of 9134? 2, 4567 What are the prime factors of 4765? 5, 953 What are the prime factors of 2781? 3, 103 What are the prime factors of 1811? 1811 What are the prime factors of 8526? 2, 3, 7, 29 List the prime factors of 19175. 5, 13, 59 What are the prime factors of 468? 2, 3, 13 What are the prime factors of 1100? 2, 5, 11 List the prime factors of 7210. 2, 5, 7, 103 What are the prime factors of 1351? 7, 193 List the prime factors of 637. 7, 13 What are the prime factors of 1665? 3, 5, 37 What are the prime factors of 5534? 2, 2767 List the prime factors of 984. 2, 3, 41 What are the prime factors of 4076? 2, 1019 List the prime factors of 6086. 2, 17, 179 List the prime factors of 22060. 2, 5, 1103 List the prime factors of 1365. 3, 5, 7,	{ "pile_set_name": "DM Mathematics" }
-14 - (1 - (-1 + -4)) 2 What is (-5 - -2 - 0) + 3? 0 Evaluate 0 + (-3 - (2 + -1)). -4 What is the value of (8 - 5) + -3 + -2? -2 What is the value of 6 + (-12 - -5) + 3? 2 Calculate 0 - (-2 + -2 + -3 + 7). 0 What is the value of -16 + 21 - (0 + (-1 - -5))? 1 -2 + 5 + -4 + 1 0 -4 + -4 + 0 + -5 + 10 -3 Evaluate -8 + (-5 - (-22 + 2 - -8)). -1 Evaluate (-6 + 14 - 14) + -4 + 4. -6 What is the value of (-3 - -1) + 4 - 3? -1 3 - (0 + -2) - 1 - 0 4 Evaluate (-11 - -19 - 14) + 7 + 1. 2 Evaluate (-9 - (0 - (0 - -2))) + 2. -5 What is the value of 0 - (6 + -19) - 3? 10 4 + 0 + (-5 - 0) -1 Calculate 8 + 4 + -8 - (0 + -1). 5 10 + 7 + 3 + -22 -2 What is the value of -8 + 2 - -15 - 2? 7 What is the value of -5 - -3 - (3 + -5 + 5)? -5 Calculate -2 + -9 + 4 - -1. -6 -2 + (3 - -1) + -1 - -4 5 What is -5 + (-1 - -5) + (14 - 19)? -6 Calculate 1 + -3 + -2 - -5. 1 What is the value of 28 + -39 + (5 - -1)? -5 (3 - 3) + -6 - (-1 + 0) -5 Evaluate 4 - (10 - 2) - (-1 - 2). -1 What is the value of (1 - -3) + (-1 + 2 - 6)? -1 What is -2 + 2 + 6 + -2? 4 What is 6 - (0 - 2 - (-2 + -3))? 3 What is (-7 - (-2 - -4)) + (3 - -2)? -4 What is 5 + -1 - ((-2 - -1) + 4)? 1 Calculate -8 + (-16 - -10) - -8. -6 What is 6 - (-3 + 2 - -2)? 5 Calculate -7 - (13 + -9 - 9 - -1). -3 Calculate (5 - 13) + -1 + 5 + 0. -4 1 + 6 + 0 - 3 4 (-9 - (-6 - -5)) + 3 -5 What is the value of (1 - (1 - 0)) + 81 + -81? 0 What is 5 + -9 + -2 + -1 + 0? -7 -9 + (10 - (14 - 8)) -5 What is 7 - -1 - (35 - 21)? -6 Calculate -3 + (-1 - (1 - (1 + 2))). -2 Evaluate 6 + -2 + 0 + -34 + 32. 2 Calculate -5 + (4 + 5 + -10 - 0). -6 Evaluate -13 + (11 - (3 - -5)). -10 Evaluate 3 + -2 - (7 + 2 - 8). 0 Calculate 5 - (8 + -15 + 11). 1 Calculate 11 + -10 + -1 + 0. 0 Evaluate (-1 - 5) + (0 - (-3 + 1)). -4 Evaluate 10 + (-12 - -8) + -4 + -11. -9 What is 14 - (7 + -2) - 3? 6 What is the value of (-5 - (-2 - -1)) + 1? -3 What is the value of (7 - (17 + (-4 - 4))) + 1? -1 Evaluate -12 + 13 - ((0 - -2) + 3). -4 8 + (4 - 6 - 3) 3 What is 11 + (-6 + 6 - 2)? 9 What is the value of -2 + 2 + (-11 - -2)? -9 Evaluate 1 - 1 - (3 - 5 - 1). 3 Evaluate -4 + 1 + 2 + (18 - 15). 2 Calculate -2 - 1 - (-1 + 14 + -8). -8 Calculate 4 + (-9 - -8) + 2. 5 (9 - 5) + (-7 - -4) 1 What is (-3 - -4) + -4 + (-1 - -1)? -3 Calculate (2 - (-2 + 3)) + (-2 - 4). -5 What is the value of 5 + (-1 - 0 - (-2 - -1))? 5 Calculate (0 - 5) + 20 + -6 + -7. 2 What is the value of 3 - (-5 - (5 + -12) - -3)? -2 -6 + (-9 + 4 - -9) -2 Evaluate 16 + 0 + (-5 - 21) + 20. 10 What is the value of 1 + (2 - (4 - (-4 - -8)))? 3 Calculate 12 + 2 + -94 + 91. 11 Calculate 4 - 0 - (10 - 4). -2 What is 1 - (3 + -2) - 5? -5 Calculate -40 + 50 + -13 + -1. -4 -2 - (2 - (3 - -2)) 1 What is (6 + 0 - -1) + -1? 6 Calculate -2 + (3 + -1 - (-16 + 16)). 0 What is 6 + (15 + -24 - (1 - 3))? -1 What is the value of -3 + 3 + (-3 - -1) + -1? -3 What is -2 - (-4 + 2 - -7)? -7 What is the value of 14 + 1 + -73 + 66? 8 Evaluate -6 + (12 - 7) + -1 + 0. -2 Evaluate -1 - 4 - ((6 - -2) + -10). -3 Calculate ((-2 - -7) + -2 - 4) + -4. -5 What is the value of 1 + 1 + -4 + (10 - 7)? 1 What is -4 + -1 - -9 - (1 - -5)? -2 Calculate 2 + -1 - 4 - -1. -2 Calculate (-60 - -69) + (1 - 9). 1 What is the value of -8 - (8 + -14 - 6)? 4 What is -1 + 4 - -3 - (-1 - -4)? 3 Evaluate 2 + -1 + (172 - 176). -3 9 + (-1 + 1 - 5) 4 What is 1 + (-3 - (6 - 5 - 0))? -3 What is 0 + -1 - -3 - (-1 + -2)? 5 (-35 - -47) + -3 + 0 9 Calculate 1 + 6 + -3 + -4 + -7. -7 What is (1 - (2 + -1)) + 3 + 2? 5 What is -3 - (-4 + 7 - 0)? -6 Evaluate (1 - 7) + 45 + -25 + -4. 10 Calculate 1 + -1 + 6 + (164 - 161). 9 1 - (6 + 2 + -6) -1 What is (-13 - -15) + (-9 - 0)? -7 Calculate 1 - (8 + -10) - 4. -1 What is the value of -2 + (-5 - -8) - 2? -1 Calculate -1 - -1 - (-2 + 3). -1 Calculate 0 - (-2 + (3 - -3)). -4 What is the value of -1 + (9 - (4 - 5) - 5)? 4 Calculate -9 - (8 + (1 - 27)). 9 1 - (-2 + 3 - 0 - 3) 3 Evaluate 1 + 0 - (-6 + 11). -4 6 + -16 + 6 + 6 2 2 - -2 - (0 + 0) 4 What is the value of (-3 - -8) + -10 + 0? -5 What is 5 + (-2 - 0) + (-14 - -16)? 5 What is the value of 13 + -9 + -10 + (4 - 0)? -2 What is -12 + 7 + -1 + 9 + 1? 4 What is the value of -5 + 9 - ((16 - 11) + -8)? 7 What is the value of -1 + (-3 - (-3 - 3))? 2 10 + (-5 - -2) + -2 5 Calculate 13 + -9 + (-5 - 1) + 0. -2 What is the value of -2 - -3 - (4 + -1)? -2 Evaluate 6 + -8 + 12 - 4. 6 What is the value of 6 - (-4 + 8 + 1)? 1 6 + (-1 - -5 - 5 - 0) 5 Calculate -3 + (5 + 1 - 7). -4 Calculate 1 - (-3 + 2) - 6. -4 Evaluate 8 + -6 + 3 + 0. 5 Calculate 6 - 4 - -3 - (3 + 2). 0 -4 + 5 + 0 + -3 -2 Evaluate 3 + (2 - (-6 - -3)). 8 Calculate (-1 - (-3 + -1)) + -1. 2 (2 - 4) + 16 + -9 5 What is -5 - (1 + (3 - 8))? -1 What is 8 + (-11 - (0 - (1 + -4)))? -6 Calculate -5 - (-10 + -2) - (5 - 1). 3 What is the value of (-12 - -4) + 1 - (13 + -12)? -8 Evaluate (-7 - -12) + 2 + 2 + 0. 9 -1 - 4 - (-13 - (0 - 2)) 6 Evaluate 6 - (-5 - (-8 - 7)). -4 13 + -20 - (1 + -4) -4 What is 0 + 1 + -6 + 0? -5 What is the value of -9 - -12 - (-2 - (-14 + 2))? -7 Evaluate (-8 - -9) + -4 + 3. 0 Calculate 7 + -4 + -11 + 8. 0 What is the value of 6 - (7 + (0 - -4) + -5)? 0 Evaluate 2 - (-5 + (11 - 4)) - -8. 8 Evaluate (52 - 57) + (-2 - 0 - -2). -5 Evaluate (-9 + 10 + -5 - -12) + -2. 6 Calculate (-6 - 2) + 6 + -2. -4 What is -2 + 5 + (-2 - 1)? 0 Calculate (5 - 9) + -2 + 1 + 9. 4 What is the value of -5 - (0 + -4 - (9 - 7))? 1 What is 1 + (7 + -11 - (-1 - -1))? -3 What is -10 - (-32 + 26 + (4 - 0))? -8 What is (-3 - -12) + (2 - 5)? 6 Calculate 6 - (1 + -3 + 3 - -1). 4 What is the value of -8 - (7 + 5 + -12)? -8 Evaluate 3 + (6 + -6 - 1) + -6. -4 Calculate (-3 - -2 - 0) + 8. 7 -8 + (5 - (-7 + 2 - -4)) -2 What is the value of 1 + -13 + 7 + 8? 3 Calculate -1 + 11 - (16 - 4). -2 What is the value of -1 - (-1 + (-7 + 0 - -2))? 5 What is the value of (8 - -3) + 3 + -7? 7 Calculate (0 - (0 - 2)) + (4 - 11). -5 What is the value of -2 - 0 - (-5 - 1)? 4 What is the value of -3 + 5 - 6 - -4 - -1? 1 What is 2 - (12 - 10) - -9? 9 What is the value of -7 - (7 - 26) - 10? 2 What is the value of -1 - ((-3 - 0) + 0 - 0)? 2 What is the value of 1 - (-3 + 5) - (-3 + 1)? 1 What is the value of 1 - 1 - ((-11 - -11) + 1)? -1 -4 - -3 - 1 - -1 -1 Calculate 13 + -12 - (0 - -6). -5 Evaluate 5 + (-4 + 4 + -5 - 1). -1 What is the value of 3 - (-1 + (2 - 3)) - 2? 3 What is the value of 16 - (7 - (-4 + 3))? 8 Calculate (-4 - -14) + (1 - 8). 3 -1 + (4 - -6) + -7 + 1 3 11 - (16 + -10 - -13) -8 Calculate -2 + (-13 - -24) + -7. 2 4 - (8 - -2) - -4 -2 What is the value of -4 + 5 - -5 - 10? -4 (0 - 1) + -12 + -13 + 22 -4 Evaluate 6 + 2 + -4 + -1. 3 Evaluate 6 + -9 + (7 - (1 + -1)). 4 What is the value of -2 + 17 + (-3 - 5)? 7 Calculate -4 + 0 + (3 - 2). -3 What is the value of -10 - (2 - 11) - 1? -2 What is (9 - 1 - 3) + 19 + -25? -1 Evaluate 1 + -1 + -13 + 10. -3 What is the value of -9 + (3 - -2 - (6 + -4))? -6 What is 4 + 1 + (-23 - -6) + 11? -1 41 + -43 + (-3 - -2) + -3 -6 What is -4 - (3 + (4 + -5 - 6))? 0 9 + -7 + (5 - 2) - 4 1 Evaluate -9 - (14 - 13 - (-1 + 6)). -5 -8 + 0 + -8 + 11 -5 Calculate -3 - (-20 + 7 - -3) - 17. -10 What is 0 - -1 - (-2 - -1) - 0? 2 What is the value of (1 - -1) + (-21 - -24)? 5 Calculate -4 + (12 - (3 + -4)). 9 Evaluate (-3 - -5) + -19 + 6 - -6. -5 -10 + (-1 - -5 - -2) -4 Calculate -9 - (-3 - (6 + -4)) - -5. 1 What is the value of 6 + -3 - (1 + -3 + 0)? 5 What is (3 - -1) + (-8 - -5)? 1 Calculate (-3 + 1 - 2) + -2 + 2. -4 What is 9 + -4 - ((4 - 8) + 4)? 5 7 - 3 - (0 - -3) 1 Evaluate 0 + 7 + 0 + -6. 1 3 + (1 - (6 + -4)) - 3 -1 4 - (8 - 3) - -4 3 Evaluate 1 - 0 - (3 - -2) - 1. -5 What is 2 + 1 + -8 + 4? -1 Evaluate 31 - 35 - (-1 - -1). -4 What is 5 + -5 - (7 - (2 + 4))? -1 Evaluate (0 - (1 - 16)) + -22. -7 What is the value of -2 + 4 - (-1 + -1 + 5)? -1 Evaluate 10 + -12 + -9 + 14. 3 Evaluate 16 + -14 + (4 - 1). 5 Evaluate -2 - -2 - 0 - (-38 - -43). -5 What is 4 + -8 + 1 + 1? -2 Evaluate (17 - -2 - 9) + -8. 2 What is the value of 4 + 1 - (-2 + -2 + 7)? 2 What is 1 + (-6 - -1) + 0 + -1? -5 -4 + (0 + 2 - -2) - 1 -1 Calculate -6 + -12 + 11 - (2 + -10). 1 What is the value of -12 - (-25 + 9 - -13)? -9 -3 + 6 + 0 + 2 5 (-13 - -7 - 0 - -5) + -7 -8 4 - ((0 - (-6 + 4)) + 3) -1 Calculate -2 - (0 - (-2 - -5) - -3). -2 What is the value o	{ "pile_set_name": "DM Mathematics" }
106 0.046148 * 5 0.23074 4.15194 805.1 1.61121 194.81 What is 8111 times -28? -227108 151 times 54 8154 What is the product of 4 and 0.0479? 0.1916 What is -4.5409 times -4? 18.1636 115670 times 0.13 15037.1 Product of 15 and 1.5576. 23.364 -0.01 * 2.04607 -0.0204607 Product of -525.6 and 19. -9986.4 Calculate 109.76. 97.6 What is 0.61 times -3144? -1917.84 Work out -165200 -0.3. 49560 Calculate 18375.1-2. -36750.2 Product of 4 and 148812. 595248 Product of -82 and 478. -39196 Product of 59 and 62.5. 3687.5 What is 0.04 times 57.022? 2.28088 Product of -2.3 and 1.811. -4.1653 Work out -18 -7710. 138780 Calculate -1-112197. 112197 0.11 41993 4619.23 Work out -14732 * 0.03. -441.96 -0.42499014 -1.6999604 6.5 times 5.53 35.945 Work out 1.0729 1. 1.0729 0.19 * 3647 692.93 Work out 82523 * 0.37. 30533.51 Work out 19 * 29.625. 562.875 Work out 19.088 * -110. -2099.68 What is -12 times 2404? -28848 Calculate -2-51343. 102686 -0.5 times 372997 -186498.5 0.01472184 32.1048 Calculate 9654274. 4124410 What is -12 times 212937? -2555244 Work out -47965 2. -95930 Product of -1137 and 0.178. -202.386 Multiply -5058 and -0.11. 556.38 Multiply 3 and -0.441036. -1.323108 0.29 * -0.05253 -0.0152337 Work out 0.4 * 36.341. 14.5364 Product of 1.488 and 3.4. 5.0592 0.89 * -1377 -1225.53 -0.4 times 0.82271 -0.329084 0.3-9361.98 -2808.594 41.0968 4.3872 Calculate 0.3-42109. -12632.7 -1.2839 0.0245 -0.03145555 What is -39.89 times -0.09? 3.5901 Work out 3 * -31.49. -94.47 Multiply 0.04 and -4449. -177.96 0.5-39854 -19927 0.4294 -0.02 -0.008588 -5 times -4372 21860 What is the product of -28.3 and 0.04? -1.132 10447384 4178952 Calculate -0.154-6492. 999.768 -0.1-4990 499 -1.3920.01 -0.01392 -11.5431 -1.5431 Multiply 33884 and 11. 372724 3.1 times -69 -213.9 Work out 68.8 -323. -22222.4 Work out 57177 * -2. -114354 Multiply 18277 and 1.8. 32898.6 1314 * 473 621522 Product of -25 and 55. -1375 Calculate 63.1-35. -2208.5 Product of -0.7 and 0.014025. -0.0098175 Multiply -6 and 30938. -185628 Work out -1420788 0. 0 1.084 times 12.9 13.9836 What is -3342 times 380? -1269960 What is the product of -0.07 and 78785? -5514.95 Calculate -0.3-0.3333. 0.09999 Product of -19 and -4315. 81985 176948 -4 -707792 What is 3 times 8356? 25068 What is 2.4256 times 1.6? 3.88096 Product of -0.27 and 1160. -313.2 -597 times 39 -23283 What is the product of 0.3 and -51323? -15396.9 411.5617 64.0297 446269 times 5 2231345 Product of 0.3 and -6556.65. -1966.995 Work out 3540 301. 1065540 Work out -99.63 * -0.023. 2.29149 -62155 -12930 Product of 6 and -0.166. -0.996 Product of 0.3 and -22528.5. -6758.55 Work out -0.04576 11.8. -0.539968 -7205319 * 0.1 -720531.9 What is -1622.6 times 8? -12980.8 196.9 times 2399 472363.1 Calculate -54797-28. 1534316 Calculate 683.1-7. -4781.7 What is 1.5809 times -0.76? -1.201484 Product of 2915.4 and -0.1. -291.54 -5-8114 40570 44888 times 22 987536 88 -47.7 -4197.6 Work out 2541.22 * 5. 12706.1 What is 0.6 times 143.753? 86.2518 Work out -3517 * -2.1. 7385.7 43.51 times -3 -130.53 -0.2-2.1602 0.43204 Multiply -4 and 5012. -20048 Calculate -862951. -253786 0.1 * 0.81862 0.081862 -2 times -9056 18112 1.6 times -10.149 -16.2384 -13812 times 0.5 -6906 Calculate 2.2899-0.1. -0.22899 -0.5840978 -420489 What is the product of 0.14 and 120200? 16828 Calculate -1167629. -167629 What is the product of -4353.51 and -0.4? 1741.404 0.2016 times -97 -19.5552 Multiply 0.0606 and -8. -0.4848 Work out -1 -6081. 6081 Product of -0.5 and -86558. 43279 Product of -1.7 and -0.2307. 0.39219 Calculate -3.37912.6. -42.5754 10-25.2778 -252.778 What is -0.235 times -16.7? 3.9245 What is -3 times 347.4? -1042.2 0.03-476334 -14290.02 Multiply -2384.47 and 0.2. -476.894 -3090.99 -2729.7 -2 * 8.83 -17.66 What is 1745 times 3? 5235 Product of 8 and -1.98027. -15.84216 Work out -5 * -43388. 216940 Product of -440203 and 0.4. -176081.2 Work out -33 * -0.149. 4.917 Multiply 0.2 and 9447. 1889.4 -18.371-3 55.113 -4 14.022 -56.088 -2562150.1 -25621.5 -0.3 times 18647 -5594.1 What is the product of 1.97 and 3? 5.91 Multiply -0.02653 and -22. 0.58366 Calculate 1156981. 156981 -2.35141-8 18.81128 Product of -320687 and 3. -962061 Calculate -57.84-0.09. 5.2056 What is the product of -3.79442 and -0.6? 2.276652 0.6 times -22.614 -13.5684 -587335 * -0.2 117467 0.106-2.1 -0.2226 Work out -0.008 20.96. -0.16768 Product of 0.0298 and 0.2381. 0.00709538 Product of -0.0205 and -18. 0.369 0.97-91 -88.27 Product of -0.9 and -0.028711. 0.0258399 21.592 3.184 -8 times 13770 -110160 Calculate -252511. -27775 Calculate -134315. -42210 Product of -6600 and 7. -46200 2473 * -0.415 -1026.295 -0.5 times -8854 4427 What is the product of 0.32 and -69? -22.08 Product of 0.001 and 11.3. 0.0113 688528 times -0.2 -137705.6 16200 times -162 -2624400 Product of -4 and -1.55755. 6.2302 Product of 0.21 and -0.082208. -0.01726368 What is the product of -36689 and 0.3? -11006.7 -881 times 3 -2643 What is the product of 4.9 and -0.37035? -1.814715 -2.88721 -60.627 Multiply -1876 and 1.71. -3207.96 Work out 3 123.36. 370.08 Calculate -110.08407. -0.92477 -31.92 times 27 -861.84 Multiply 22.3 and -0.7794. -17.38062 What is the product of -1945026 and 1? -1945026 Multiply 0.3 and 17.0222. 5.10666 0.9518-1 -0.9518 Product of -6.9613 and -0.4. 2.78452 Work out 1 * -566303. -566303 -0.045 * 16128 -725.76 What is the product of 27259 and -2.3? -62695.7 What is -53866 times -0.01? 538.66 -5.4 times 3.44 -18.576 Multiply -823521 and -1. 823521 Multiply 315 and -176.3. -55534.5 Calculate 6494. 2964 Calculate 0.1-17.53. -1.753 Product of -0.2 and -12795. 2559 Multiply -1.104 and 12. -13.248 -182.8 * -0.05 9.14 What is 0.1 times 182.775? 18.2775 Product of -0.22276 and -7.5. 1.6707 -0.55848 -26.784 Multiply 3 and -49813. -149439 Product of -7 and -44832. 313824 1.27946 -0.4 -0.511784 What is the product of 0.31722 and -0.4? -0.126888 Calculate -6-3.9277. 23.5662 Product of -4 and 1.6366. -6.5464 Multiply 3 and 0.0107067. 0.0321201 What is the product of 35393 and 1? 35393 2803264 times 5 14016320 95179 -0.6 -57107.4 -9656 * -0.01 96.56 What is -158 times -155? 24490 Multiply -795 and 2379. -1891305 Calculate -0.2-44656. 8931.2 0.1691 37 6.2567 -4 * -755 3020 81 * 197 15957 Calculate -960.1636. -15.7056 Work out -981.7 -120. 117804 Multiply -0.1786 and -79. 14.1094 Product of 276 and -60. -16560 Work out 11.02 * 0.128. 1.41056 What is the product of 71.42 and -1.4? -99.988 286.1144 41198.4 Product of 1284.1 and 4.4. 5650.04 10-195.846 -1958.46 What is 18 times -69? -1242 Product of 3.065 and -4. -12.26 What is 4 times -35258? -141032 Calculate 754.69-0.1. -75.469 1488 times 834 1240992 What is the product of -0.014 and -1182? 16.548 What is 23 times 7542? 173466 Work out -3536 -21. 74256 What is the product of -220 and -9.7? 2134 Multiply -51.6 and -3.197. 164.9652 Multiply 204 and 629. 128316 What is -0.6 times -30369? 18221.4 Calculate 62-38713. -2400206 Multiply -0.023 and 3.673. -0.084479 What is -1671.59 times -0.4? 668.636 4.51-0.008 -0.03608 Work out -235871 * -1. 235871 13 times -5561 -72293 Multiply -0.1 and -40.54. 4.054 What is 51.2 times 30? 1536 What is -0.0097 times -2.828? 0.0274316 Work out 2276 * -0.14. -318.64 0.42 * 2.2827 0.958734 Product of 44.098 and 5. 220.49 Work out 5 * -0.080735. -0.403675 Product of -7.51357 and -5. 37.56785 Work out 0.12 * 584. 70.08 -1-221475 221475 Work out 5 10153.2. 50766 -246.9-2.7 666.63 Work out 0.032 -354. -11.328 Product of -1025 and -1618. 1658450 Calculate 0.46-0.3717. -0.170982 What is the product of 6436 and -0.05? -321.8 4.08-4 -16.32 1388316 222128 35.234862 70.46972 Work out -1.18931 * 11. -13.08241 0.7 times -37812 -26468.4 Product of -101525 and -3. 304575 Multiply 2944 and -497. -1463168 Calculate -5910.0824. -48.6984 -15898 times 2 -31796 Calculate -1439200.8. -288951.2 Multiply -5.00868 and 0. 0 Work out -2 * 6.8334. -13.6668 -342 * 1071 -366282 Calculate 281-0.152. -42.712 Product of -0.2 and 103838. -20767.6 2.9831 0 0 Multiply -6 and 139258. -835548 What is the product of 0.09 and 2305? 207.45 -0.3 times 21740 -6522 Multiply -127 and 2874. -364998 What	{ "pile_set_name": "DM Mathematics" }
1, y in decreasing order. y, i, -0.1, -2/7 Let f(a) = 88a2 + 1849a + 16. Let c be f(-21). Put -7, -1, c, 3, 4 in ascending order. -7, c, -1, 3, 4 Let a = 599 + -602. Sort a, -1/3, 0.2, 0.1 in increasing order. a, -1/3, 0.1, 0.2 Let u = 1637 + -1636.84. Suppose 8h = 3h - 25. Put 5, -0.1, h, u in ascending order. h, -0.1, u, 5 Let x = 47 + -29. Suppose 5d = x + 12. Suppose 76h - 63h + 39 = 0. Sort d, 2, h in decreasing order. d, 2, h Let n = 86 - 81. Suppose 0 = nr - 4 + 264. Let c = -55 - r. Sort -1, 48, c, -5 in increasing order. -5, c, -1, 48 Let s = -292917/11 - -26629. Put -33, -34, s in increasing order. -34, -33, s Let w = -3 - -8. Let k(o) = o*3 + 7o*2 - 40o - 236. Let v be k(-8). Suppose 0 = -2p - 4n + 8, n - 1 = -p - 0. Put p, w, v in ascending order. p, w, v Let h(p) = -p*2 - p - 7. Let y be h(0). Suppose 0 = 56b - 61b + 25. Put b, -5, y in decreasing order. b, -5, y Suppose -64v + 9v + 440 = 0. Sort -2, v, 1, -4 in ascending order. -4, -2, 1, v Suppose 28 = -52j + 48j. Sort j, -48, -2 in ascending order. -48, j, -2 Suppose 136 = 10q - 504. Suppose 68j - qj - 40 = 0. Sort j, 2, -13. -13, 2, j Let r = 943.89 - 948. Let o = r + 1.11. Let m = 0.3 + -0.5. Sort o, m, 4/3 in ascending order. o, m, 4/3 Let p(z) = -337z + 1027. Let c be p(3). Put c, 0, -3 in ascending order. -3, 0, c Let r be 4/62 + (-96234)/3999. Sort -1/4, 2, -1/3, r in decreasing order. 2, -1/4, -1/3, r Let l = 8 - 13. Let p be 7/((-4)/20 - (-20)/(-25)). Sort l, 5, p in decreasing order. 5, l, p Let h = 53 - 52.5. Let z = 283.4 - 283.9. Sort -2/9, h, z, 6 in increasing order. z, -2/9, h, 6 Let k(f) = f2 - 8f + 3. Let a be k(7). Suppose -61o = -82o - 105. Put o, a, -7, 3 in descending order. 3, a, o, -7 Let k = 8.7 + -9. Let b = k - -0.6. Let g = 727 + -726. Sort g, -0.1, b in descending order. g, b, -0.1 Let z = -1/557 + 2231/1671. Put -5, 2/7, 3/7, z, -2/3 in decreasing order. z, 3/7, 2/7, -2/3, -5 Let b = -9.8 + 3.8. Let d = -5538.2 + 5538. Put -0.5, d, b, -3 in descending order. d, -0.5, -3, b Let z = 217.3 - 215.3. Put z, -1656, -2/15 in decreasing order. z, -2/15, -1656 Let m be (-51)/(-85) - (-82)/(-170). Let u = -43.5 + 43. Sort -2/7, m, -2/15, u in descending order. m, -2/15, -2/7, u Let k = -369.4 - -368.4. Put k, 7, 0.3, -0.4 in increasing order. k, -0.4, 0.3, 7 Let u = 4 - 0. Suppose -um = -3z - 1 + 24, 1 = -z - 3m. Suppose 4q + 1 = 5o - z, -12 = 3q. Sort 3, -5, o. -5, o, 3 Let m = -236.49 + 238.49. Put 1/7, 134, m in ascending order. 1/7, m, 134 Let z = 0 - -4. Let f = 0.375 + -0.675. Put -2/7, f, -0.2, z in descending order. z, -0.2, -2/7, f Let r = -2124 + 2214. Suppose 2p + 5 - 1 = -h, 0 = -4h - 5p - 16. Sort h, r, 4 in increasing order. h, 4, r Let u = -36.05 + 32. Let z = u + 4. Let k = 3266 + -3265. Put k, 0.1, z in increasing order. z, 0.1, k Let p = -0.068 - 0.014. Let k = p + 0.04. Let q = k - -2.042. Put -0.5, -1, q, 0.1 in ascending order. -1, -0.5, 0.1, q Let m(x) = -x3 + 2x*2 + 8x + 4. Let b be m(4). Let t be b - 30/((-20)/(-4)). Sort t, 31, 4, -1/4 in decreasing order. 31, 4, -1/4, t Let w be 10((-18)/(-5) + -4) + 6. Let g = 47.67 - 47.7. Sort -1, g, w, -0.5 in increasing order. -1, -0.5, g, w Suppose 32h + 22h + 915 = -129h. Sort h, -49, 7 in decreasing order. 7, h, -49 Let u = 307 - -132. Let w = u + -1319/3. Let d be (10/(-8))/((-14)/8). Put d, w, 0 in descending order. d, 0, w Let n(b) = -b*3 - 10b*2 - 14b - 16. Let g be n(-9). Let u = g - -2. Let j = u - 29. Put -12, 5, j, -2 in descending order. 5, j, -2, -12 Suppose -o - 5j = -0o - 53, 5o - 145 = 5j. Let i be (20/(-9) - -2) + 68/(-18). Suppose -2574z = -2565z + 9. Put 1, z, o, i in decreasing order. o, 1, z, i Suppose -27 = -3b + 5a - a, 0 = 2b - 2a - 14. Sort -5, -7, b, 2 in descending order. 2, b, -5, -7 Suppose 0 = -10k + 1001 - 1031. Let a = -21766/35 + 627. Let r = -27/5 + a. Sort r, k, -4, -5 in decreasing order. r, k, -4, -5 Let o(p) = p2 - 7p - 5. Let b be o(7). Suppose -54j + 20j + 9690 = 0. Let u = -280 + j. Sort 4, 2, u, b. b, 2, 4, u Let n be 5/(60/(-26))(-1 - 5). Suppose -16 = -np + 23. Sort p, 2, 0, 5 in decreasing order. 5, p, 2, 0 Let t be (-3 - -4)/((-1)/(-1)). Let p = 2 - 0. Let j be ((-2)/34 + (-2160)/272)(-3)/132. Sort p, j, t in increasing order. j, t, p Let i = 9920 + -9921. Put i, -2, 132, -5, -3 in increasing order. -5, -3, -2, i, 132 Let u be (2/40)/(((-5)/(-24))/(260/(-468))). Put 2, -7/9, u, 0.3, 0.5 in increasing order. -7/9, u, 0.3, 0.5, 2 Let f = 2024 + -2023. Sort -4, -9, f in ascending order. -9, -4, f Let q = -5/2 - -17/6. Let z = -5.4 + 7. Let b = 1.3 - z. Put b, q, -1 in decreasing order. q, b, -1 Let r be ((-3)/(-261))/((-10)/20). Let y = -362/609 - r. Let k = -5 - -6. Put 0.4, k, y in decreasing order. k, 0.4, y Let f = 4 + -2. Let d be (-3)/6f - 4. Let j = -13147 + 13146. Put j, d, -4, -3 in increasing order. d, -4, -3, j Let b = -0.01 + 0.05. Let x = 142 - 129. Suppose xs + 7 = 3g + 11s, 0 = 3g + 5s - 35. Sort b, -5, g in ascending order. -5, b, g Let g = 3779 + -3778. Put g, 2/5, 4, 24, -0.4 in descending order. 24, 4, g, 2/5, -0.4 Let l = 143 + -139. Suppose 5n - 4 = -o, -ln - 88o + 20 = -83o. Put -185, 4, n in ascending order. -185, n, 4 Let q = 16 + -17. Suppose 2x - 18 = -2a, -37a + 2x + 24 = -33a. Sort -3, a, q, 4 in descending order. a, 4, q, -3 Let f = 218/5 + -43. Let y = 34/13 - 271/39. Let p = 29/6 + y. Put 23, f, p in decreasing order. 23, f, p Suppose 6a - 2r + 14 = 11a, -2r + 14 = a. Let d = 13 + -16. Sort d, a, 1/12, 1 in ascending order. d, a, 1/12, 1 Suppose -5v + 3i = 21, v - 4i = -7i + 3. Suppose 4 = l + 2b - 24, -20 = -5b. Let z be ((-25)/l)/((-6)/24). Put z, 4, v in ascending order. v, 4, z Suppose 147j - 151j = -20, -5j + 40 = -3u. Suppose -3w - 4m - 23 = -4w, 0 = -4w - 2m + 128. Suppose 4v + 5 = -w. Sort 5, v, u in ascending order. v, u, 5 Let q be 20/((-9)/21 - (-92)/84). Suppose 5i - q = -g, -4g - 4i = g - 45. Suppose -ga + 5 = -5. Sort a, -3, 0, 1 in ascending order. -3, 0, 1, a Let k = -3.6 + -11. Let s = k - -6.8. Let w = s - -7.7. Put -1/3, -3, 2, w in descending order. 2, w, -1/3, -3 Let b = 5.95 - -0.05. Let u = 3290.111 - 3292. Let d = -0.111 + u. Sort d, b, 5/3, -1/4 in increasing order. d, -1/4, 5/3, b Let x = 32 + -29. Let i(p) = 3p2 - 8p + 10. Let m(c) = -c*2 - 1. Let u(g) = i(g) + 4m(g). Let d be u(-9). Sort 6/7, x, d in ascending order. d, 6/7, x Suppose 10y - 1388 = -1298. Put y, 1/2, 0.05 in decreasing order. y, 1/2, 0.05 Suppose -212i - 48i = 23i - 2264. Sort -1, -2, -4, 2/5, i in descending order. i, 2/5, -1, -2, -4 Let b be (12/9)/((-1)/(-3)). Let h = -19677 + 19673. Sort -10, -1, b, h. -10, h, -1, b Let y be (-18)/(-4)4/6. Suppose -10 = 5v + 5w, yw = 4w. Suppose -801r = -13041 - 6697 + 2116. Sort v, -1/2, 1/10, r in increasing order. v, -1/2, 1/10, r Let g be (-2)/5-20(-8)/(-16). Suppose 3s - gf = -7f, 0 = -f + 2. Sort -5, s, 1, 2. -5, s, 1, 2 Let u(g) = g3 - 9g*2 - 2g + 28. Let c be u(9). Suppose 33y - 35y + c = 0. Put -14, y, -2 in ascending order. -14, -2, y Let k = -18438 - -18433. Put k, 1, 155 in decreasing order. 155, 1, k Suppose 5p = -2r + 3r - 392, -4p - r = 310. Put -9, 1, p in descending order. 1, -9, p Let k be (-2 + (-9)/(-6))6. Suppose -5o = -0o - 825. Let c be -5(121/o + (-2)/6). Sort -1, c, k, 0 in decreasing order. 0, -1, c, k Suppose 19m = 338 - 15. Suppose 5r + mr - r = 0. Sort r, 6, -1, 3. -1, r, 3, 6 Suppose -2t = -5i - 9, 0 = 2i + 4t + 26 - 8. Let m be ((-4)/12)/((-1)/i). Sort m, 28, 4 in descending order. 28, 4, m Let c = -4617 - -4617. Sort 1/11, 24, -0.1, c in decreasing order. 24, 1/11, c, -0.1 Let i be (23 - 7)/((-4)/10). Let q = -734 - -733.5. Sort 2, q, 1/3, i in descending order. 2, 1/3, q, i Let z = 302 - 297. Let h = -37 + 39. Sort h, -0.5, z in decreasing order. z, h, -0.5 Suppose 5j + 5r - 10 = 0, 222j - 224j + 4r - 2 = 0. Put 2, j, 124, -4 in increasing order. -4, j, 2, 124 Suppose -17z + 14z = 0. Suppose -g - 4g - 3d + 149 = 0, z = 5g - 4d - 163. Let y = -26 + g. Put y, -1, 16 in ascending order. -1, y, 16 Let f be 1/3 - 4/3. Let l = -371 + 366.53. Let c = 0.47 + l. Put f, c, -1/6, -1/5 in decreasing orde	{ "pile_set_name": "DM Mathematics" }
/25 Is -719/4 at most -1/3? True Is -126 at least -126? True Which is smaller: -0.4 or 0.0594? -0.4 Which is smaller: 0 or 2/15? 0 Which is greater: 1 or -20/117? 1 Which is greater: -1 or -2/10471? -2/10471 Which is bigger: -1/23 or 1? 1 Which is smaller: 0 or 80? 0 Is -909 at least as big as -911? True Which is smaller: -9/4 or -3? -3 Which is smaller: 3/5 or -25/3? -25/3 Which is bigger: -1 or -35/61? -35/61 Which is smaller: 0 or 16/15? 0 Is -915 not equal to -913? True Is 0.5125 greater than or equal to 2/7? True Is 2916 at most 2913? False Which is smaller: -496 or 11? -496 Which is smaller: -100 or 10? -100 Which is smaller: 1/41961 or 0? 0 Does -1 = 16/6897? False Which is smaller: 0.2035 or 2? 0.2035 Is -201 > -200? False Is -303 equal to -29/2? False Which is bigger: 0.8 or -240? 0.8 Is 143 less than 136? False Are -24 and -0.1 unequal? True Is 1 greater than or equal to -1/361? True Which is bigger: -6 or -10? -6 Which is greater: -41 or -39? -39 Are 19 and 88/5 nonequal? True Which is smaller: 1864/11 or 170? 1864/11 Is 7 smaller than -169? False Is -5/1367 equal to 0? False Is -100/23 at most as big as -5? False Is -1 < 2/32683? True Which is smaller: 25/53 or 0? 0 Does 19/2 = 9? False Which is smaller: -7 or -12.6? -12.6 Do -2751/5 and -550 have the same value? False Which is bigger: -145 or -581/4? -145 Which is bigger: 1/2 or -0.08? 1/2 Which is bigger: -14502 or 0? 0 Which is greater: 86 or 693/8? 693/8 Which is bigger: 0 or 13/68? 13/68 Is -2 at least 2.782? False Which is greater: -20 or -0.14? -0.14 Which is smaller: -1 or -39/527? -1 Is -11 < -3? True Is 1 <= 11/48? False Which is greater: -1.039 or 0.1? 0.1 Is -1/3 greater than -882? True Which is bigger: 1/21 or -22.3? 1/21 Which is smaller: -4938 or -4939? -4939 Which is bigger: 317 or -2/3? 317 Which is smaller: 0.124 or 1? 0.124 Which is smaller: 3/314 or 0? 0 Is 3370 bigger than 3367? True Which is smaller: 4736 or -3? -3 Is 288 smaller than 289? True Are 1535 and 7671/5 unequal? True Is -0.1108 less than or equal to -0.1? True Which is bigger: -62 or -2/3? -2/3 Which is smaller: 3.4 or -0.03? -0.03 Is 2327 not equal to -2/11? True Is -104 >= -89? False Is -85 smaller than -83? True Which is bigger: 0 or 38/51? 38/51 Is -7135 at most as big as -7135? True Is -11/195 at least as big as 1? False Which is bigger: 2 or -0.113? 2 Which is greater: 309 or 308? 309 Is 1 >= -9/449? True Does 5 = 43? False Is 5/19 at most as big as 6? True Is 0 equal to -1/11011? False Which is smaller: 1 or -1/96? -1/96 Which is greater: 94/3 or 31? 94/3 Which is bigger: -4 or -28? -4 Is 18 < 2? False Which is smaller: -33 or 0.01? -33 Which is smaller: -106 or -107? -107 Do -8477 and -8475 have the same value? False Which is bigger: -11 or 0.96? 0.96 Is 3.6 > -2/7? True Which is smaller: 1/1828 or 0? 0 Which is smaller: -243 or -242? -243 Is 19/24 >= 2? False Is -1.2 at least as big as 2/105? False Which is greater: -6 or 537? 537 Which is smaller: -2/3 or 15.372? -2/3 Which is smaller: -14208 or 0.1? -14208 Does -25 = 34? False Which is greater: -9/22 or -1? -9/22 Which is greater: -89/10 or -8? -8 Which is bigger: 572 or 573? 573 Which is smaller: -0.7 or -1057? -1057 Which is smaller: 24 or 35? 24 Is -36 less than 0.3? True Which is bigger: 964 or 16? 964 Which is bigger: -471 or -472? -471 Is -680 equal to -681? False Is -1 less than -5.42? False Which is smaller: -1/81 or 1? -1/81 Is -0.1 not equal to 2/2775? True Is 468 < 1/3? False Do 0 and 920/3 have different values? True Is -13 at least -179? True Is -853 greater than -849? False Which is smaller: 2/6275 or 1? 2/6275 Which is greater: 789/62 or 14? 14 Which is bigger: -4583/3 or -1528? -4583/3 Which is bigger: -556 or -555? -555 Which is smaller: 0 or -1/471? -1/471 Which is bigger: -14 or -12? -12 Is 0.4115 at least 0.4? True Which is greater: 0 or 1/447? 1/447 Is -186 greater than -369/2? False Is 2/5 equal to -6462? False Is 1.2 >= 2.14? False Which is smaller: -1/4 or 101.57? -1/4 Is -42.5 bigger than -0.1? False Are 0 and 1074/13 equal? False Which is bigger: -0.0297 or 2? 2 Is 42/11 at least as big as 0.4? True Which is smaller: -0.08 or -28? -28 Is 2/3 > 88? False Is 152 equal to 51? False Which is greater: 3 or 26/9? 3 Which is greater: 80 or 2/9? 80 Is -1 < -1/151? True Is -386 <= -403? False Is 7 equal to 603? False Which is bigger: -24 or -0.23? -0.23 Is -5/32 not equal to 0? True Which is greater: 84/1249 or 1? 1 Which is bigger: -4/7 or 48? 48 Which is smaller: -5 or 44/3? -5 Is 325 greater than or equal to 325? True Is -6759/8 smaller than -846? False Is 0.4 greater than 8/9? False Is 79 bigger than 77? True Is -26/219 greater than -1? True Which is bigger: 1 or 18/3055? 1 Which is smaller: -5/4 or -60? -60 Is 1 greater than or equal to 182/15? False Which is smaller: -1/36 or 2/5? -1/36 Is 25294 less than or equal to 25294? True Which is smaller: 5 or -17/3? -17/3 Which is bigger: 1 or -147? 1 Is 8/11 at most -78? False Which is bigger: -497 or -496? -496 Which is smaller: -0.4 or -37? -37 Which is bigger: 80/27 or -1/3? 80/27 Is 3 < 472.9? True Which is greater: -0.1 or -37/14? -0.1 Does 0 = 9/6208? False Which is smaller: -1 or 26/3? -1 Does -1 = -0.1599? False Which is smaller: 1728 or -1? -1 Is 1/7 < -1? False Is 8256 less than 33021/4? False Is 497/3 >= 166? False Is -1 equal to 7/27? False Is -7.66 greater than or equal to 18? False Do 794 and 3175/4 have the same value? False Is -39 <= -40? False Which is greater: -2/6673 or -1? -2/6673 Is 116 at least 103? True Which is greater: -1 or 3/9689? 3/9689 Is -1146 at least as big as -1147? True Which is smaller: -0.0539 or 55? -0.0539 Is 0.0141 less than or equal to -0.6? False Which is smaller: -1885 or -1884? -1885 Which is greater: 165 or 659/4? 165 Is -314 not equal to -310? True Which is bigger: 29 or 58? 58 Is -174 less than 2? True Which is smaller: -16 or -56? -56 Which is greater: -3/73 or 1? 1 Which is bigger: 1/4 or -16967? 1/4 Which is bigger: -3 or -6? -3 Are 1 and 3/1390 nonequal? True Which is smaller: 1 or -1/917? -1/917 Which is bigger: -0.09 or -3.5? -0.09 Is 71 equal to 75? False Which is smaller: 1 or 0.0283? 0.0283 Which is smaller: 61/17 or 4? 61/17 Is 18.9 >= -2/3? True Is -5 at most as big as -22.5? False Is -5 <= -21? False Is 5/61 at most 1? True Is 41/6 < -1? False Which is greater: -40 or -436/11? -436/11 Is -11/14 equal to 0? False Is 8/23 != 1? True Which is greater: -4 or -661? -4 Is 2/5747 <= 0? False Are -119 and 1/3 equal? False Which is smaller: -452 or -458? -458 Which is smaller: -126 or -499/4? -126 Which is greater: -29430 or 1/4? 1/4 Is -1286 greater than or equal to -3857/3? False Which is bigger: -9/13 or -140? -9/13 Which is smaller: 207 or 205? 205 Which is bigger: -2/5 or 0? 0 Which is smaller: -79 or 0.17? -79 Is -1/3 at most 3221? True Do -1269 and -1 have different values? True Which is smaller: 64 or 72? 64 Which is smaller: -1 or -11/53? -1 Which is greater: 12006 or 12010? 12010 Which is greater: -1896 or -1890? -1890 Is -505 bigger than -504? False Is 5574 at least 5574? True Which is bigger: -17.3 or 0? 0 Which is bigger: 416 or 0.1? 416 Which is smaller: 2/523 or 1? 2/523 Is 2382 at most as big as 2379? False Which is bigger: 71 or 2/13? 71 Which is greater: -617 or 26? 26 Is 143/3 equal to 48? False Which is smaller: 47/3 or 15? 15 Is -0.1 smaller than -12/4979? True Which is greater: 358 or 363? 363 Which is bigger: -1128 or -1127? -1127 Is 1/4 greater than 10.4? False Which is smaller: 1 or 786? 1 Which is bigger: -574 or 4? 4 Which is greater: 350 or 1/4? 350 Is -1 not equal to -223? True Which is greater: -2 or -43/17? -2 Is -4953 greater than or equal to -4954? True Is -1302 >= -1302? True Which is smaller: -5 or 812? -5 Is 4118/7 not equal to 0.1? True Which is smaller: -7 or 1? -7 Which is bigger: 89 or 88? 89 Which is smaller: -1 or 1/244? -1 Is 5/2 < 43/13? True Is -4087 less than or equal to -4087? True Is -7/611 less than or equal to -1? False Which is smaller: 19553 or 19552? 19552 Which is bigger: -2/7 or 0.193? 0.193 Which is smaller: 36 or 30? 30 Which is smaller: 6/7 or 2? 6/7 Is 7 equal to 43? False Which is smaller: -2681 or 0? -2681 Which is smaller: -400 or 8? -400 Which is greater: 0.	{ "pile_set_name": "DM Mathematics" }
What are the prime factors of w? 3 Let l be 1/((-13)/7 - -2). Suppose -a + lo - 18 = 3o, 3a - 4o = -30. List the prime factors of (a/15)/(2/(-30)). 2, 3 Let y(x) = 3x. Let v be y(1). Suppose 13 = -vs - 2, -5t + s = -120. Suppose 5z = t + 7. What are the prime factors of z? 2, 3 Let v(b) = b*3 + 6b*2 - 8 - 5b + 3b + 0b*3. Let a be v(-6). Suppose -6 = -f + u, 0u - au = -3f + 13. List the prime factors of f. 11 Let o = 476 + -261. What are the prime factors of o? 5, 43 Suppose 0q = -4q. Suppose k - 13 + 6 = q. List the prime factors of k. 7 Suppose p - 3p = 0. Suppose 4o = 3d - 55, -d - 2d + 2o + 53 = p. What are the prime factors of d? 17 Suppose 15j + 138 = 16j. What are the prime factors of j? 2, 3, 23 Suppose -225 - 63 = -3c. Suppose 5j - c = 59. What are the prime factors of j? 31 Let i(z) = 10z. What are the prime factors of i(7)? 2, 5, 7 Let c be 1/(-2) - 11/(-2). Let u(g) = -g*2 - 7g - 6. Let q be u(-5). Suppose qn - 2n - 3 = -cj, 2n - 11 = 3j. What are the prime factors of n? 2 Let b = 10 + -5. Suppose 4x - 2p = 32, bp + 16 + 16 = 4x. Suppose 5z - x - 9 = -2d, 5d - z - 83 = 0. What are the prime factors of d? 2 List the prime factors of (-25 + 5)/(3/(30/(-4))). 2, 5 Suppose 4x - 10 = -x. Suppose -4c + b = c - 66, -3b - 29 = -xc. What are the prime factors of c? 13 Let v(j) = -j*3 - 5j*2 - j - 4. Let g be v(-5). Suppose -24 = -5y + g. List the prime factors of y. 5 Suppose -11m + 6 = -8m. List the prime factors of m-1(-76)/8. 19 List the prime factors of (-2 + 51 - -1)2. 2, 5 Let n(i) = -3i*2 - 9i + 2. Let b(r) = -17r - 3 - 5r*2 + 3 + 3. Let j(c) = -4b(c) + 7n(c). List the prime factors of j(5). 2 Suppose 9x - 8x - 3 = 0. What are the prime factors of (2/x)/((-1)/(-6))? 2 Suppose 4w + 68 = 4p, -6 = -3p - 3w + 21. List the prime factors of p. 13 What are the prime factors of (-32)/(-6) + (-12)/(-18)? 2, 3 Let i(u) = 3u*3 - u + 1. Let r be i(1). Suppose rv - v = 4. Suppose -vm + 5m = 54. What are the prime factors of m? 2, 3 What are the prime factors of 30/(-105) - (-443)/142? 3, 7 Let i = -10 - -6. List the prime factors of (0 - -1)/(i/(-32)). 2 What are the prime factors of -3 + (6/(-4))/(3/(-176))? 5, 17 Let w(r) = 19r. Let p be w(2). Let l(h) = h*2 + 21h - 8. Let o be l(-22). Suppose 4f = -o + p. List the prime factors of f. 2, 3 Let j(i) = -4i - 2. Let b(h) = -h*3 - 3h*2 + 2h + 4. Let u be b(-3). What are the prime factors of j(u)? 2, 3 Let y(m) = m*2 - 3m + 1. Let g(c) = 4c2 - 9c + 3. Let d(x) = 2g(x) - 7y(x). Let p be d(-3). Let q = 10 - p. List the prime factors of q. 11 Suppose -12y + 1610 = -874. List the prime factors of y. 3, 23 Suppose d + 505 = 3y - 3d, 0 = -4d - 4. What are the prime factors of y? 167 Let y = 804 - 463. List the prime factors of y. 11, 31 Suppose -3c + 19 = -k - k, 15 = 5c + 5k. Suppose 0i = -ci. Suppose -h + 5p = -2, -4h + 8 = -ip - 4p. List the prime factors of h. 2 Let w(y) = 9y*2. Suppose 6 - 2 = 2q. Suppose t + 2o = 5, 5t + qo - 2 = t. List the prime factors of w(t). 3 Suppose 3n - 110 - 7 = 0. Suppose -n = -8s + 5s. List the prime factors of s. 13 Let w(r) = r*2 - 11r. Let l be w(11). Suppose 0c + 5c - 80 = l. List the prime factors of c. 2 Suppose -i + 1 = -2. Suppose -iy + t = -42, y + 56 = 5y - 2t. What are the prime factors of y? 2, 7 Let g(f) = f2 + 18f - 3. What are the prime factors of g(-19)? 2 Suppose -5w - 3g + 116 = 9, -4g = -5w + 79. What are the prime factors of w? 19 Suppose 2g - 127 = -3t, 0 = -0t + 3t + 3. Suppose -4d + g = -9d. Let h = d + 22. List the prime factors of h. 3 Suppose 1 = -2g - 1, -g = 3z + 142. Let r = 17 + z. List the prime factors of 1/2 + r/(-4). 2 Suppose 4h = 3d + 2d + 784, 5h + 3d - 943 = 0. What are the prime factors of h? 191 Let y(v) be the third derivative of v5/60 + v4/4 + v2. Let t be y(-6). Suppose t = -4g + 15 + 9. What are the prime factors of g? 2, 3 Suppose 5y = -3w, 3w + 5 = 2w. What are the prime factors of 5 + 2/(-3)y? 3 Let h(r) = r3 - 4r*2 + 5r - 3. Let p be h(3). Suppose -t = -3t - f + 4, 4t = -4f. Suppose tl - 21 = p. List the prime factors of l. 2, 3 Let f(k) = -k*2 - 7k - 6. Let q be f(-6). Let r = q + 2. Suppose l = r + 2. What are the prime factors of l? 2 Suppose 0 = -0b + 3b + 6. Let j(i) = 3i2 + 2i - 2. List the prime factors of j(b). 2, 3 Let f be (-2)/3(8 + 1). What are the prime factors of 4/f180/(-8)? 3, 5 Let j be 21/48/2. Let n = j - 12. Suppose -r + a = -n, 0 = a + 4 - 5. List the prime factors of r. 2, 5 Suppose g = -4g + 30. Let r = g + 2. What are the prime factors of r? 2 Let q(l) = l*2 - 3l - 1. Let p(o) = -2o2 + 7o + 3. Let m(s) = 6p(s) + 13q(s). List the prime factors of m(-5). 3, 5 Suppose 4j - 4r = -r - 72, -r + 49 = -3j. Let c = 26 + j. What are the prime factors of c? 11 Let h(k) = -k + 13. List the prime factors of h(5). 2 Let s(p) = -p3 - 3p*2 - 2. Suppose 3q = q - 8. What are the prime factors of s(q)? 2, 7 Suppose -t + 500 = 4t. What are the prime factors of t? 2, 5 Suppose -3b - 51 = -0b - 3w, b = -3w - 21. Let q be (-4)/18 - (-68)/b. What are the prime factors of (-2 + q)/((-1)/2)? 2, 3 Let j(s) = -s + 2 - 3 + 7. What are the prime factors of j(4)? 2 Let s = 58 + -33. What are the prime factors of s? 5 Suppose 0 = -5z - 0z + 25. Suppose z + 6 = -b. Let y = -5 - b. What are the prime factors of y? 2, 3 Let o = -101 + 173. List the prime factors of o. 2, 3 Suppose 0 = 7t - 10t + 60. What are the prime factors of t? 2, 5 Suppose 0 = 3q - 12, 20 = 5p + 4q - 16. Let a = -11 + 18. Suppose 5h + 1 = 3z + a, 27 = 5h + pz. What are the prime factors of h? 3 Let m(u) = -u + 10. Let b be m(7). Suppose 4n + 3 = 11, -5f - bn - 24 = 0. What are the prime factors of ((-2)/f)/(3/99)? 11 Let l(d) = -4d - 2. Suppose -4s = -4b - 5s - 14, -5b + 2s - 24 = 0. What are the prime factors of l(b)? 2, 7 Suppose -2t - 2t - 4v + 516 = 0, -t + 4v + 139 = 0. What are the prime factors of t? 131 Let d = 8 - -1. List the prime factors of (-6 - 9/(-3)) + d. 2, 3 Let k(i) be the second derivative of i5/20 + 3i4/4 - i3/3 - 7i2/2 - 2i. What are the prime factors of k(-9)? 11 Suppose -164 = 5a - 14. Let b = 42 + a. What are the prime factors of b? 2, 3 Let v(k) = -7k + 33. What are the prime factors of v(-11)? 2, 5, 11 Let t(s) = -5s3 - 2s*2 + 2s + 7. What are the prime factors of t(-3)? 2, 59 Let h be ((52 + 2)/3)/1. What are the prime factors of 194/h - 8/(-36)? 11 Suppose 6q - 2q = 16. What are the prime factors of 10/q(-6)/(-5)? 3 Suppose 4r = 2c - 408, -5r - 287 = -5c + 708. List the prime factors of c. 2, 97 Let i(u) = 2 - 3 - 2u - 3 + 2. What are the prime factors of i(-2)? 2 Suppose 0z = -5z - p - 79, -p - 64 = 4z. Let u = z - -27. What are the prime factors of u? 2, 3 Suppose -w + 3t = -13, -w - 4t - 8 = -0t. Let p(b) = 0b - wb + 2b - 4b - 1. What are the prime factors of p(-1)? 5 Let a be 26/10 + 2/5. Suppose 4n - 81 = -3c, -4n + 85 - 22 = -ac. List the prime factors of n. 2, 3 Let x(z) = 2z2 - 6z + 4. Let i(b) = -b*2 + b - 1. Let w(f) = -5i(f) - x(f). What are the prime factors of w(-1)? 3 Let b(t) = -4t. Let u be b(-1). Suppose -3i - 35 = -i - d, ui = -4d - 40. Let r = -7 - i. List the prime factors of r. 2 Let i(l) = l*3 + 3l*2 + 3l + 3. Let h(r) = 2r3 + 7r*2 + 6r + 6. Let a(c) = -3h(c) + 5i(c). List the prime factors of a(-6). 3, 5 Let l be 0 - (4 + -1 - 8). Let p(m) = m - 2. Let q be p(2). Suppose -20 = -ln - qn. What are the prime factors of n? 2 Let g(m) = -m*2 - 14m - 15. What are the prime factors of g(-10)? 5 Let t be -2(-1)/(-2) - -44. Suppose -a = 4a - 5f - 75, 0 = 3a - f - t. List the prime factors of a. 2, 7 Let x(c) = c*3 - 3c*2 - 13c - 4. Let w be x(6). Suppose 3d - w + 2 = 0. List the prime factors of d. 2 Suppose -4q = -3x - 8, -2x - 6 = -3q + 3x. Let o(n) be the second derivative of n5/20 - n4/12 + n*3/2 - 3n2/2 - n. List the prime factors of o(q). 7 Let q(a) be the first derivative of a4/2 + 4a3/3 - 2a*2 + 2a + 4. What are the prime factors of q(2)? 2, 13 Let t = -15 + 43. Let n = -9 + 13. Suppose n*d - t =	{ "pile_set_name": "DM Mathematics" }
11) to base 8. 13 Convert 257 (base 8) to base 6. 451 Convert 2 (base 9) to base 14. 2 What is -7 (base 12) in base 16? -7 Convert 1 (base 8) to base 16. 1 Convert -20 (base 16) to base 14. -24 330 (base 6) to base 10 126 What is 3101 (base 4) in base 2? 11010001 77 (base 16) to base 15 7e Convert -2 (base 13) to base 8. -2 Convert 9 (base 14) to base 3. 100 What is -1 (base 14) in base 2? -1 What is 10 (base 8) in base 2? 1000 Convert 3 (base 14) to base 10. 3 a3 (base 14) to base 11 120 What is 2 (base 9) in base 10? 2 32 (base 11) to base 2 100011 1 (base 14) to base 9 1 Convert 217 (base 10) to base 12. 161 0 (base 3) to base 10 0 Convert -56 (base 9) to base 7. -102 Convert 10 (base 10) to base 12. a What is -32 (base 11) in base 10? -35 -13 (base 5) to base 13 -8 Convert -2 (base 7) to base 12. -2 4f (base 16) to base 3 2221 What is 24 (base 5) in base 4? 32 Convert -128 (base 10) to base 13. -9b Convert 5 (base 13) to base 14. 5 -3 (base 11) to base 15 -3 What is -4 (base 12) in base 9? -4 What is -10010 (base 2) in base 12? -16 42 (base 6) to base 10 26 -50 (base 9) to base 3 -1200 Convert -110 (base 2) to base 3. -20 Convert -410 (base 6) to base 8. -226 What is 20 (base 4) in base 9? 8 2 (base 10) to base 3 2 -4 (base 12) to base 16 -4 What is 0 (base 16) in base 6? 0 1 (base 8) to base 4 1 11 (base 6) to base 15 7 What is -11 (base 3) in base 8? -4 Convert -240 (base 8) to base 2. -10100000 -70 (base 12) to base 14 -60 1 (base 13) to base 2 1 What is 52 (base 9) in base 13? 38 What is -11 (base 12) in base 11? -12 -11 (base 11) to base 16 -c -3 (base 10) to base 11 -3 What is 178 (base 9) in base 6? 412 Convert 2 (base 11) to base 15. 2 -10101000 (base 2) to base 5 -1133 1 (base 15) to base 4 1 -9 (base 12) to base 14 -9 1000 (base 2) to base 12 8 What is 0 (base 11) in base 3? 0 Convert -37 (base 14) to base 11. -45 Convert 3 (base 9) to base 7. 3 Convert -c4 (base 15) to base 12. -134 What is 9 (base 10) in base 5? 14 -83 (base 9) to base 4 -1023 What is 14 (base 14) in base 11? 17 Convert 25 (base 9) to base 8. 27 -412 (base 6) to base 7 -305 Convert 221 (base 5) to base 15. 41 Convert -101110001 (base 2) to base 5. -2434 54 (base 8) to base 7 62 -2 (base 8) to base 11 -2 What is 9 (base 12) in base 10? 9 What is 1 (base 16) in base 2? 1 2 (base 13) to base 10 2 Convert 1 (base 12) to base 16. 1 What is 38 (base 15) in base 9? 58 What is 6 (base 8) in base 16? 6 Convert 9 (base 16) to base 4. 21 Convert 4 (base 6) to base 2. 100 66 (base 8) to base 12 46 What is 44 (base 7) in base 3? 1012 Convert 12 (base 10) to base 2. 1100 What is -14 (base 8) in base 3? -110 What is -5 (base 8) in base 7? -5 Convert -10 (base 2) to base 11. -2 Convert -300 (base 5) to base 16. -4b What is 76 (base 8) in base 15? 42 Convert -16 (base 9) to base 13. -12 What is 10 (base 8) in base 12? 8 112 (base 3) to base 10 14 What is 5a (base 15) in base 11? 78 What is 3001 (base 4) in base 14? db Convert 49 (base 15) to base 5. 234 10 (base 4) to base 3 11 -10101 (base 2) to base 4 -111 Convert 4 (base 7) to base 10. 4 What is 77 (base 11) in base 4? 1110 Convert 1d (base 14) to base 8. 33 What is -6 (base 16) in base 5? -11 414 (base 5) to base 15 74 151 (base 6) to base 15 47 What is -15 (base 13) in base 11? -17 22 (base 16) to base 12 2a What is 1000 (base 5) in base 13? 98 What is -61 (base 9) in base 8? -67 What is -4 (base 7) in base 9? -4 Convert -2 (base 5) to base 13. -2 What is 2 (base 4) in base 14? 2 Convert 2 (base 6) to base 12. 2 What is 3 (base 11) in base 10? 3 What is -6 (base 7) in base 12? -6 Convert 7 (base 8) to base 14. 7 What is 15 (base 7) in base 4? 30 -3 (base 8) to base 7 -3 What is 101 (base 2) in base 4? 11 -10 (base 5) to base 3 -12 -110 (base 2) to base 12 -6 Convert -5 (base 6) to base 7. -5 -4 (base 14) to base 7 -4 What is e (base 15) in base 5? 24 What is 1022 (base 3) in base 16? 23 Convert 27 (base 11) to base 13. 23 52 (base 7) to base 16 25 What is 1 (base 4) in base 7? 1 What is 9 (base 11) in base 6? 13 What is -2130 (base 4) in base 11? -132 What is 5 (base 8) in base 2? 101 What is -43 (base 13) in base 16? -37 -5 (base 14) to base 8 -5 10000110 (base 2) to base 7 251 Convert -1001 (base 2) to base 5. -14 What is -9 (base 10) in base 9? -10 -4 (base 15) to base 4 -10 Convert 76 (base 11) to base 16. 53 -4a (base 14) to base 7 -123 What is 30 (base 6) in base 15? 13 Convert 135 (base 10) to base 14. 99 Convert 18 (base 16) to base 2. 11000 Convert -452 (base 6) to base 3. -20112 Convert -2 (base 6) to base 15. -2 What is 1000 (base 2) in base 4? 20 -1 (base 13) to base 9 -1 Convert -16 (base 8) to base 10. -14 Convert 5 (base 9) to base 14. 5 -5 (base 12) to base 5 -10 What is -20 (base 6) in base 7? -15 Convert -8 (base 10) to base 3. -22 What is -6 (base 9) in base 8? -6 22 (base 6) to base 14 10 Convert 2 (base 7) to base 10. 2 Convert 21 (base 14) to base 16. 1d 8 (base 10) to base 5 13 Convert a (base 16) to base 9. 11 What is 0 (base 4) in base 6? 0 What is -3 (base 12) in base 15? -3 What is -322 (base 6) in base 2? -1111010 What is 306 (base 10) in base 11? 259 Convert 321 (base 4) to base 9. 63 What is -139 (base 16) in base 2? -100111001 What is -3 (base 15) in base 2? -11 Convert -5 (base 10) to base 14. -5 1103 (base 6) to base 9 313 What is -22 (base 12) in base 3? -222 -c (base 15) to base 14 -c -170 (base 11) to base 10 -198 -3043 (base 5) to base 2 -110001110 Convert 33 (base 8) to base 10. 27 What is -310 (base 4) in base 3? -1221 Convert -3 (base 4) to base 11. -3 Convert -110100 (base 2) to base 10. -52 1 (base 10) to base 9 1 Convert -32 (base 10) to base 6. -52 What is 1b (base 15) in base 11? 24 What is 0 (base 4) in base 10? 0 What is -3 (base 16) in base 13? -3 What is 32 (base 6) in base 11? 19 What is -1 (base 4) in base 9? -1 What is 34 (base 8) in base 5? 103 12 (base 12) to base 5 24 Convert -26 (base 7) to base 13. -17 11 (base 16) to base 13 14 What is -2 (base 14) in base 3? -2 -20 (base 3) to base 8 -6 Convert -11 (base 14) to base 10. -15 Convert -18 (base 12) to base 16. -14 What is -137 (base 8) in base 4? -1133 Convert -154 (base 7) to base 14. -64 What is -6 (base 7) in base 16? -6 11 (base 14) to base 11 14 Convert -2304 (base 5) to base 3. -110012 What is 101010100 (base 2) in base 15? 17a -1 (base 16) to base 11 -1 Convert -2341 (base 5) to base 9. -424 What is 99 (base 16) in base 8? 231 -1120 (base 3) to base 15 -2c What is 1 (base 5) in base 13? 1 Convert 25 (base 11) to base 5. 102 What is 2 (base 16) in base 4? 2 Convert 9 (base 11) to base 2. 1001 What is -311 (base 9) in base 11? -210 What is -3 (base 11) in base 2? -11 Convert -32 (base 7) to base 6. -35 Convert -4 (base 16) to base 7. -4 230 (base 4) to base 8 54 Convert -1010111 (base 2) to base 9. -106 3 (base 9) to base 13 3 -2 (base 14) to base 2 -10 Convert -2 (base 8) to base 10. -2 What is 0 (base 3) in base 5? 0 -71 (base 11) to base 10 -78 What is 31 (base 13) in base 6? 104 -59 (base 11) to base 12 -54 -122 (base 3) to base 4 -101 What is ab (base 13) in base 6? 353 9 (base 10) to base 14 9 Convert a (base 14) to base 13. a What is -21121 (base 3) in base 12? -151 What is 0 (base 5) in base 15? 0 Convert -12 (base 4) to base 9. -6 -3 (base 6) to base 5 -3 What is -16 (base 15) in base 16? -15 -14 (base 5) to base 11 -9 What is d1 (base 15) in base 12? 144 Convert -4 (base 6) to base 4. -10 Convert -11 (base 11) to base 9. -13 -21 (base 8) to base 16 -11 Convert -2 (base 7) to base 6. -2 Convert 1 (base 3) to base 11. 1 Convert 233 (base 5) to base 3. 2112 Convert -17 (base 12) to base 4. -103 What is -2333 (base 4) in base 6? -515 What is -15 (base 15) in base 10? -20 Convert -5 (base 8) to base 4. -11 What is -1110 (base 4) in base 16? -54 52 (base 16) to base 15 57 Convert -27 (base 14) to base 12. -2b What is 3 (base 15) in base 16? 3 What is -111 (base 2) in base 11? -7 72 (base 13) to base 16 5d What is c (base 14) in base 15? c What is 3 (base 13) in base 15? 3 Convert 22 (base 5) to base 7. 15 -2b (base 14) to base 4 -213 0 (base 4) to base 3 0 Convert -5 (base 13) to base 3. -12 -2 (base 4) to base 14 -2 Convert -4 (base 5) to base 13. -4 What is -2 (base 11) in base 14? -2 Convert 3 (base 8	{ "pile_set_name": "DM Mathematics" }
se 0 = 8k - 11k + 27. Let y = k - 7. Suppose w - 2j = -j + 3, 0 = -yw - j. Put -1, 0, w in decreasing order. w, 0, -1 Suppose -z - 87 = -3q - 4z, 5q - 115 = 5z. Let c = q - 16. Suppose 0 = -2o + 4y - 2y - c, -2o - 10 = y. Put o, 4, 2 in decreasing order. 4, 2, o Let j = 95 + -28. Let c = j + -77. Sort 5, c, -5, -4 in decreasing order. 5, -4, -5, c Let f = 0.42 + -0.42. Let x = -0.37 + 0.27. Suppose -j = -4 - 1. Put x, j, f in ascending order. x, f, j Let z = 6 + -5. Suppose 0 = -4m + 2t + 8, 5m - 15 + 3 = 3t. Sort z, m, 20 in ascending order. m, z, 20 Suppose -2y - 4s - 12 = 28, y + 30 = 3s. Let b = 121/5 + y. Suppose 12u + 24 = 4u. Sort b, u, 1/6 in ascending order. u, 1/6, b Let b(p) = p2 + 7p - 9. Let l be b(-4). Let g be 32/l(-6)/8. Sort -3/5, g, -1 in increasing order. -1, -3/5, g Let a = -0.78 + -1.22. Sort -4, -1, 3/8, a in decreasing order. 3/8, -1, a, -4 Suppose 0 = 4f - 5o - 25, 4f + 34 - 49 = -5o. Put -3, f, 28, 0 in ascending order. -3, 0, f, 28 Let c be (-40)/2(1 - 3). Let p be c/12 + (-3)/9. Let a = 3/7 + -36/35. Sort a, -2/13, p in descending order. p, -2/13, a Let r be -5 + 4/2 + -1. Let n be (4 - 3)2/(-12). Let a = -14 - -21. Put n, r, a in decreasing order. a, n, r Let k = -978 - -1955/2. Put 5, 2/19, 1/4, k in increasing order. k, 2/19, 1/4, 5 Let c(j) = j2 - 3j + 3. Let z be c(3). Let h = -4 - 1. Let r = 496 - 496.2. Sort h, r, z in ascending order. h, r, z Let o(a) = -a*2 - 10a + 6. Let s be o(-9). Suppose -2 = t - 4, 3i - s = -3t. Put -4, i, 2, -2 in increasing order. -4, -2, 2, i Suppose 4r + 40 = -8z + 7z, -2z = -r - 10. Put r, -5, -39 in descending order. -5, r, -39 Let r = 0.29 - -0.01. Let a = 0.08 + 12.92. Let q = a - 18. Sort -1/3, r, q in increasing order. q, -1/3, r Let p(r) = 6r + 18. Let l(f) = -7f - 18. Let c(a) = 5l(a) + 6p(a). Let m be c(-21). Sort m, 4, 8 in descending order. 8, 4, m Let b be (-50)/(-60)(-3)/(-40). Put b, -0.3, 0.8 in descending order. 0.8, b, -0.3 Let c(d) = -d3 - 2d*2 + 14d - 5. Let u be c(-5). Sort 8, 4, u, -4 in descending order. 8, 4, u, -4 Let i = -5.04007 - -0.04007. Suppose 9 + 6 = 3c. Put 0.3, i, c, -1 in descending order. c, 0.3, -1, i Let p = -442 + 452. Put p, 5, 2, -2 in decreasing order. p, 5, 2, -2 Let r = 8 - 7.5. Let n be (-105)/(-56) + (0 - 2). Sort n, 1/3, r, 3/4 in descending order. 3/4, r, 1/3, n Let c be (10/8)/((-2)/8). Let p(n) = 3n - 109. Let v be p(37). Put -3, v, c in decreasing order. v, -3, c Let b be (-4)/(-14) - (-32)/(-14). Put 40, 3, b in increasing order. b, 3, 40 Let t(j) = 15j + 12j - 11 - 29j. Let x be t(-8). Suppose 0 = -6o + xo. Sort -1, 3/2, o in increasing order. -1, o, 3/2 Let t be (3 - 0) + (-24)/(11 - 5). Let y = -2 + -1. Sort t, 3, y, -4 in ascending order. -4, y, t, 3 Suppose -8s - 4v = -6s + 128, 5v - 137 = 3s. Sort s, -2, 0 in ascending order. s, -2, 0 Let t be 4 + (-7 - (-5 + 2)). Let q = 14 + t. Let x = 14 - q. Sort x, -13, -0.1 in increasing order. -13, -0.1, x Let t(s) = 2s + 6. Let g be t(5). Suppose g = -a - 4h, 5h + 9 = -16. Sort a, 0.4, -5, -5/6 in decreasing order. a, 0.4, -5/6, -5 Let u = 5.56 + -5.86. Sort u, -0.52, 2/13, 1/8 in descending order. 2/13, 1/8, u, -0.52 Let a = -634 - -629. Put -0.1, a, 23, 7 in ascending order. a, -0.1, 7, 23 Let c(q) = -q2 + 7q + 3. Let z = 11 - 4. Let d be c(z). Suppose dw - 4w - 1 = 0. Sort -3, 0, w in increasing order. -3, w, 0 Let b = 316.98 + -312. Let k = b + 0.02. Let w be -2 - 100/(-42) - (-10)/(-15). Sort w, -5, k in increasing order. -5, w, k Let x = -7 + 15. Suppose 0 = -4z + d + 30 + 10, -x = 2d. Let f be -1(-4)/(12/z). Sort f, -2, -3 in descending order. f, -2, -3 Let p(c) = -c3 - 14c*2 + 14c - 10. Let h be p(-15). Suppose d - 20 = 5n - h, -2n = 4. Sort 3, -1, 0, d in increasing order. -1, 0, 3, d Let l = -1060 + 1062. Put 51, 4, l in decreasing order. 51, 4, l Let p = 466 + -506. Sort p, 5, 2/3 in ascending order. p, 2/3, 5 Let d = -1 + 0. Let c = 3035 + -3033. Sort d, -2, c, 5 in decreasing order. 5, c, d, -2 Let j = 18 - 30. Let f = j - -12.43. Let z = -0.13 + f. Sort 3/2, z, -5 in decreasing order. 3/2, z, -5 Let x = -2/301 - 12/43. Let m = -1299 + 1294. Sort m, -9, 1, x. -9, m, x, 1 Let f = -14.633 - -14.233. Suppose -4d = -5h - 7, 1 = -5d - 4h + 20. Sort d, 4, f, -5. -5, f, d, 4 Suppose 0 = 5q + 37 + 8. Let p(f) = -f3 - 10f*2 - 8f + 8. Let n be p(q). Suppose 5s + 2b + 0 = 17, 2b + 18 = 2s. Sort -4, s, n in descending order. s, n, -4 Let b = -35 + 37. Suppose 10o = 12o - b. Suppose 0 = -4c - 0c - 4. Put -2, o, c in descending order. o, c, -2 Let n = -8.2 + 8. Let v = -2.33 + 2.2. Let k = -0.87 + v. Put n, k, 5 in descending order. 5, n, k Let x(s) = s*3 + 10s*2 - 9s + 17. Let v be x(-11). Put 0, 9, v, 5 in ascending order. v, 0, 5, 9 Let s = -2/205 - -223/1845. Put 3, 1.5, 1, s in decreasing order. 3, 1.5, 1, s Let l(f) = f - 4. Let x be l(7). Let j = -216 - -212. Put -2, x, j, 1 in descending order. x, 1, -2, j Suppose -78 = -4m + 10. Suppose -3j = 3l - 9 - 0, 3l - 2j - 9 = 0. Suppose 3x - b = -x + 11, -lx - 2b = -m. Sort x, -2, -5. -5, -2, x Let q be 3/(-15)2/12. Let c = 3477/10 - 348. Let j = c + q. Put -2, j, 3 in decreasing order. 3, j, -2 Suppose -2l + 4l = 40. Let s = l - 17. Suppose 4d - 8d = 0. Sort d, s, 1 in descending order. s, 1, d Let v = -1/345 - 68/345. Sort 2, -3, v in increasing order. -3, v, 2 Let k = 5 - 5.2. Let r = 0.3 - k. Let z = -924.1 + 924. Sort r, z, 0 in descending order. r, 0, z Let x be (3 + 20/(-7))(-4 + 7). Sort -3, 0.1, x, 3 in increasing order. -3, 0.1, x, 3 Let l be (-5)/(-1) + -2 - 45-1. Let b be (-5)/6 + 4/l-2. Let k = -1 - -1. Sort b, -3, k in increasing order. -3, b, k Let g be (-12)/14 + -19 + 20. Let d be 42/10 - (-5)/(-25). Suppose -di - 3c - 21 = -2i, i = 2c + 7. Put g, 4/5, i in decreasing order. 4/5, g, i Let g(h) = h + 63. Let a be g(-59). Put 0.5, a, -156, -0.3 in descending order. a, 0.5, -0.3, -156 Let t = -1142.96 + 1143. Sort 0, 3, 5, t in decreasing order. 5, 3, t, 0 Suppose 2a - a = 17. Suppose 5x - a = -k, 1 - 17 = -5k - 2x. Suppose 2 = -kt - 4. Put t, -4, -5 in descending order. t, -4, -5 Let t = 240 + -241. Put 10, 5, t in increasing order. t, 5, 10 Let p(b) = -b3 - b + 4. Let v be p(0). Suppose a - 9 = -0a. Let h = -4 + a. Sort 1, v, h in increasing order. 1, v, h Let h(d) = d*2 + 3d - 12. Let g be h(-6). Suppose -gn - z - 21 = -2n, 2z = -5n - 30. Sort n, 5, -1. n, -1, 5 Let k = 1647 - 1646.8. Let f be (-4)/10 + 192/430. Sort f, k, 3. f, k, 3 Let m = -70 - -70.8. Let r = m + -0.5. Put 19, 5, r in increasing order. r, 5, 19 Let k be 12/(-180) - 222/45. Sort 6, 4, k, 2 in descending order. 6, 4, 2, k Let t be 81/(-12) - 3/12. Let q(u) = -u*2 - 2u + 31. Let j be q(t). Sort 1, 4, j. j, 1, 4 Let p be (-1)/(-3) + (-2)/(-3). Let b be 26/117 + (-2)/9. Suppose b = 14m - 3m - 33. Put p, 6, m in decreasing order. 6, m, p Let x = 1741.1 - 1741. Put -160, -1/5, x in descending order. x, -1/5, -160 Let k = 440 - 444. Let a(h) = -h - 3. Let g be a(-3). Let w be -6 - (g - -3 - 1). Put -2, k, w in descending order. -2, k, w Let v = 202 - 187. Sort 0, 2/9, -0.4, v in ascending order. -0.4, 0, 2/9, v Let i be ((-9)/1965)/(24/4356099690). Let j = 831317 + i. Let q = -2/131 + j. Put q, 1/2, 0.02 in decreasing order. 1/2, q, 0.02 Suppose 13 - 15 = l. Let d be 803/1881 - l/(-18). Sort 0.4, 1/4, d in increasing order. 1/4, d, 0.4 Suppose 0 = -5j + 5, -2m + 2j = -0m - 2. Let v(g) = 23g2 - 344g - 20. Let y be v(15). Put 10, m, 4, y in increasing order. y, m, 4, 10 Suppose 0 = 32t - 136 - 88. Sort t, 1, 3. 1, 3, t Let c = 29 + -15. Suppose c = 4b - 6. Let a = 0.09 - 0.1. Sort a, b, 3 in ascending order. a, 3, b Suppose 11q - 4 = 7q. Sort 5, q, -24, -4 in descending order. 5, q, -4, -24 Let b = -466.1 + 466. Sort b, -144, -3 in decreasing order. b, -3, -144 Let f(q) = q*2. Let c(x) = x + 7. Let k be c(-8). Let j be f(k). Suppose -4h - j = -u - 0u, -h - 5u + 5 = 0. Put 3, h, 2 in descending order. 3, 2, h Let y = -219 - -219. Put -1/2, y, -4/7 in ascending order. -4/7, -1/2, y Suppose -3s - 12 = -2q, -1 = q - 4. Put s, -10, -1, 4 in descending order. 4, -1, s, -10 Let t(b) = b*3 - 4b*2 + 5	{ "pile_set_name": "DM Mathematics" }
)/(-50)) + (-51265)/(-15) a multiple of 5? True Is (1248/1324846)/(0 - (-1)/5904) a multiple of 11? False Let j(n) = 37n + 8. Let o be (-90)/(-126) + (-2)/(-7). Is 29 a factor of j(o)? False Let z = -9289 - -15681. Is z a multiple of 16? False Let t be -4(-25)/40508/10. Let b = t + -65. Let d = b + -42. Is d a multiple of 2? True Let c(n) = 5n3 + 20n*2 + 30n - 10. Let u(x) = -2x3 + x + 1. Let r(z) = c(z) + 2u(z). Is 42 a factor of r(-16)? True Let h = -39 - -42. Suppose -k - 162 = 3r + hk, r = -4k - 46. Let t = -36 - r. Is 11 a factor of t? True Let r(b) = -b3 + 23 - b2 + 7 - 8 + 18b. Is r(-6) a multiple of 6? False Suppose 0 = -9u + 456 + 381. Suppose -828 + u = -3d. Let q = d + -164. Is q a multiple of 27? True Let g(r) = 17r2 - 5r - 2r + 6r*2 + 17 - 22r*2. Is g(-5) a multiple of 22? False Let c = -2430 + 3772. Suppose -2222 = -9h + c. Does 22 divide h? True Is 190 a factor of (-338400)/(-30) + 21 - (1 - 9)? False Suppose 0 = 72c + 235783 - 803863. Is c a multiple of 263? True Suppose -2n + 5308 = 5m, -m + 1400 - 356 = -4n. Suppose 9y - 4y - m = 0. Let j = y - 96. Does 29 divide j? True Let x be (2-258)/(-6)(-3)/2. Let c = 218 + x. Does 12 divide c? False Let v(j) = j + 28. Let i be v(-21). Suppose -c - 5o = -219, ic + o - 895 = 3c. Does 16 divide c? True Suppose -5i - 4s = -12945, 5i + 2s + 4240 = 17195. Is 54 a factor of i? False Suppose -3a + 237 = 5b - 61, -2a = -5b + 318. Let r = -58 + b. Is 34 a factor of 4/r - -3 - 1 - -167? True Let a(l) = -152l3 + l2 - 12l - 13. Let u be a(-1). Does 28 divide u/16 + -8 + 370/4? False Let y = 234 - 240. Is 45 a factor of ((-22)/33 - 4/y) + 450? True Is 3 + 50/(-14) - (-2250818)/287 a multiple of 81? False Suppose 27 = 3l + 4o, 3l - l + 3o = 19. Suppose -254 = 3f - lf. Suppose -f = -2b - 39. Is b a multiple of 11? True Suppose 62w - 59w + 405 = 0. Let a = -123 - w. Suppose -3s - 2f = -123, -s = 14f - af - 41. Is s a multiple of 9? False Suppose 3s - 16955 = -5b, 1360s - 11306 = 1358s - 4b. Does 17 divide s? False Let b be ((-180)/(-72))/(1/8). Is -85(-28)/b6 a multiple of 26? False Let y(c) = -3c - 31. Let r be y(-15). Suppose -rm - 66 = -8m. Let u(x) = 2x2 + 17x - 18. Is u(m) a multiple of 4? False Let a = 136 - -417. Suppose -42 = b - 2d - 169, 0 = -4b - d + a. Does 61 divide b? False Let d(u) = u2 - 1. Let t(z) = z2 - 17z + 32. Let c(a) = 2d(a) - t(a). Let r be c(-19). Suppose -rh - 3 + 15 = 0. Is 2 a factor of h? False Let b = -845 + 2041. Is b a multiple of 28? False Let u = 52 - 73. Is ((-340)/6)/(-6 - 112/u) a multiple of 5? True Suppose 3t + b = 24494, 3t - b + 11917 = 36419. Does 4 divide t? False Let b be 18/(1(-1)/1). Let v be (-2)/9 - 166/b. Let m(l) = l - 1. Does 4 divide m(v)? True Let t(f) = f - 14. Let k be t(14). Let d(r) be the second derivative of 5r3/6 + 16r*2 + r. Is d(k) a multiple of 10? False Let i = 87 - -1. Suppose -11g = -9g - i. Does 2 divide g? True Suppose -a = 9, -12x + 17x + a = 347491. Does 20 divide x? True Suppose 0 = p - 4b + 48, 3b + 1 = 10. Let o be 1/(((-15)/132)/(-5)). Let j = p + o. Does 8 divide j? True Let z = 151 + -232. Let j(p) = -p2 + 17p + 79. Let q be j(-8). Let g = z - q. Is g a multiple of 40? True Suppose t = -p + 25 + 13, 3t = 4p + 86. Suppose -7l + tl - 25029 = 0. Is 75 a factor of l? False Suppose -7q + 2d - 3120 = -9q, 0 = -3q + 2d + 4655. Is 112 a factor of q? False Let r = 8566 - 7407. Is 30 a factor of r? False Let h = 15205 + -6593. Is h a multiple of 31? False Let z = 14691 + -9129. Is 27 a factor of z? True Let w(a) = 1635a + 1252. Is w(10) a multiple of 30? False Suppose -a + 13 = -2m - 50, -3a = -5m - 188. Suppose 54c + 462 = ac. Is c a multiple of 23? False Suppose 15k = 11560 + 5525. Is 8 a factor of k? False Let p(g) = 56g + 11 - 2g*2 - 69g + 6g2. Let v be p(5). Let b = v + -35. Is 2 a factor of b? False Suppose 5s - 79 = 2d, s - 4d - 17 = -3d. Let o(f) = 32 + 3f2 - 21 - s + f3 - 7f. Does 10 divide o(4)? True Let c(q) = -370q + 18653. Let i be c(51). Suppose w + 22 + 9 = 0. Is (20/7)/(w/i) a multiple of 20? True Suppose 10s + 1 = 41. Let d be (21/s)/((-36)/(-336)). Suppose -24 = -t + d. Does 10 divide t? False Let u = -67 + 75. Suppose -99 = 7d - ud. Suppose -3t + 4v + d + 215 = 0, 334 = 3t + v. Is t a multiple of 10? True Let q be 476/8-1(-4)/1. Suppose 4n + 393 = 3o - q, -210 = -o + n. Is 19 a factor of o? True Suppose -4t - h = 313 - 10650, -3t + 4h + 7767 = 0. Does 11 divide t? True Suppose 6l = 4d + 3l + 189, 31 = -d + 4l. Let x = d - -378. Does 7 divide x? False Let d = -5654 - -7254. Does 16 divide d? True Suppose -j - 16 = -4z - 4j, -8 = -2z - 2j. Suppose zx - 46 = -c, -3c + x - 43 = -207. Is c a multiple of 35? False Let x(o) = -o2 + 23o + 8. Suppose 0 = 2m + 2w, 12 = 5m - 0w - w. Let t be (8/m)/(23/92). Is 20 a factor of x(t)? True Suppose 7 = 5i - 8. Suppose b + 3u = 760, -iu = -5b - 7u + 3800. Does 95 divide b? True Suppose -p + 6 + 6 = 0. Suppose -3i + pi = 0. Suppose iu = u - 74. Is u a multiple of 37? True Let k be 352(6/(-4) + 1). Let j = -936 - -1294. Let w = k + j. Does 14 divide w? True Suppose -4j + 2m + 1098 = 0, -146j + 141j - 3m + 1367 = 0. Is j a multiple of 2? True Suppose -4y + 69a = 70a - 193537, -4 = -4a. Is 32 a factor of y? True Suppose n = 2u - 492, 2n - 12u + 9u = -985. Let m = 611 + n. Does 16 divide m? False Suppose -l - 3z - z = -8358, 0 = -7l + 5z + 58407. Is 13 a factor of l? True Let t(v) = 13v + 156. Suppose y + 4b + 22 = 0, 38 = 2y - 7y - 2b. Is 5 a factor of t(y)? False Let f(m) = -10m - 2. Let k(v) = v2 + 7. Let j be k(3). Suppose -4p - j - 4 = 0. Is 22 a factor of f(p)? False Suppose 24d - 81600 - 3048 = 0. Is d a multiple of 5? False Let d(u) = -5u + 345. Let v be d(0). Let j = 396 - v. Does 24 divide j? False Let n(g) be the second derivative of -g*3/3 + 11g*2 - 4g. Let d be n(7). Let o(r) = 2r3 - 16r*2 + r + 6. Is 14 a factor of o(d)? True Let n be (-476)/(-85)5/2. Let w be (n - 11)/((-1)/(-19)). Suppose 21 = 3g - w. Does 26 divide g? True Suppose 0 = 4l + 5d + 173, 4l - 6l = 5d + 79. Let g = -35 - l. Suppose 0 = -gc + 11c + 96. Is 50 a factor of c? False Let z = 45 - 47. Let k be (3 + -3)(0 + 1)/z. Suppose -3o - 5r + 75 = -ko, 2r - 114 = -4o. Is o a multiple of 10? True Let u = 10006 + -2002. Is 23 a factor of u? True Let h be ((1 - 4) + (-88)/(-33))30. Is ((-396)/48 - h)(75 - -1) a multiple of 3? False Let i(y) = y*3 + 382. Suppose s - 3s = c - 6, 5c - 5s = -15. Does 8 divide i(c)? False Let q(s) = -7s2 - 5s + 8. Let k(r) = -15r2 - 11r + 16. Let d(u) = 6k(u) - 13q(u). Let z be d(6). Suppose 24 = 4h - 2l, l = -4h + 8 + z. Is h even? False Let p be ((-14)/(-35))/(1/(-35)). Let t = p - -18. Suppose 154 = 3h - 2g, -3g + 192 = th - 36. Does 9 divide h? True Let q(r) be the first derivative of -3r*4/4 - 2r*3/3 + 3r*2/2 + 2r + 4. Let p = -43 + 41. Is q(p) a multiple of 11? False Let s(m) be the first derivative of -m*4/4 - 5m3/3 + m2 + 9m - 16. Let u(n) = n3 - 4n*2 + n - 1. Let h be u(3). Does 8 divide s(h)? False Suppose 66j - 2688 = 62j. Is 112 a factor of j? True Suppose -4j + q = 25, 0 = 2q + q - 3. Let u be 1042 - j(-2)/(-3). Suppose 3f - 5t = -t + 626, 5f - 4t - u = 0. Does 21 divide f? True Let j(n) = n*2 + 15n - 16. Let s be j(-13). Let q = 132 - s. Is q a multiple of 29? True Let x(q) = 232q2 + 537q + 27. Does 8 divide x(11)? False Let n = 2556 + -1066. Suppose -3p + n + 757 = 4v, 0 = v + p - 563. Is v a multiple of 18? True Suppose 65w - 1261919 + 317909 = 20w. Is 15 a factor of w? False Let d = 9172 + -7724. Is 4 a factor of d? True Let n(f) = -4552f + 1658. Does 62 divide n(-3)? True Suppose 5i - 4784 = -2l + 20836, l + 4i = 12801. Is l a multiple of 285? True Is (-11315)/(-9) - ((-282)/(-54) + -5) a multiple of 120? False Let k = -51 - -51. Suppose k = 5s + b - 92, -68 = -4s + 2b - 0. Is s a multiple of 2? True Let n = 7988 - 6833. Does 41 divide n? False Let p = -219 + 226. Suppose 0 = 5j - 20, 0 = -2q - 3j + pj + 1744. Is q a multiple of 80? True Suppose -4a + 0*d + 208 = 4	{ "pile_set_name": "DM Mathematics" }
digit of 209136? 0 What is the units digit of 10598888? 8 What is the millions digit of 3681620? 3 What is the hundred thousands digit of 23771867? 7 What is the ten thousands digit of 857578? 5 What is the hundred thousands digit of 2208130? 2 What is the thousands digit of 7444811? 4 What is the hundreds digit of 431268? 2 What is the thousands digit of 826702? 6 What is the hundreds digit of 24008946? 9 What is the hundreds digit of 40481? 4 What is the hundreds digit of 10133707? 7 What is the ten thousands digit of 944393? 4 What is the hundreds digit of 1692043? 0 What is the tens digit of 3756393? 9 What is the ten thousands digit of 160633? 6 What is the thousands digit of 2059724? 9 What is the hundreds digit of 587095? 0 What is the hundred thousands digit of 820247? 8 What is the tens digit of 509218? 1 What is the ten thousands digit of 1098602? 9 What is the millions digit of 2372208? 2 What is the thousands digit of 4120569? 0 What is the units digit of 99410? 0 What is the hundred thousands digit of 534934? 5 What is the hundreds digit of 11804845? 8 What is the units digit of 2039257? 7 What is the millions digit of 16599253? 6 What is the millions digit of 1431054? 1 What is the hundred thousands digit of 342301? 3 What is the hundred thousands digit of 767741? 7 What is the units digit of 371429? 9 What is the thousands digit of 453170? 3 What is the tens digit of 25078657? 5 What is the hundred thousands digit of 6929219? 9 What is the millions digit of 30620959? 0 What is the hundred thousands digit of 408289? 4 What is the thousands digit of 13160727? 0 What is the ten thousands digit of 1642158? 4 What is the ten thousands digit of 266689? 6 What is the ten thousands digit of 585227? 8 What is the thousands digit of 329786? 9 What is the ten thousands digit of 697060? 9 What is the tens digit of 933114? 1 What is the hundreds digit of 146986? 9 What is the hundred thousands digit of 5597520? 5 What is the millions digit of 2257311? 2 What is the thousands digit of 1504409? 4 What is the millions digit of 16978487? 6 What is the hundred thousands digit of 2185393? 1 What is the units digit of 2944288? 8 What is the tens digit of 141920? 2 What is the millions digit of 4127322? 4 What is the hundred thousands digit of 17132581? 1 What is the hundreds digit of 109226? 2 What is the tens digit of 5557? 5 What is the tens digit of 35496? 9 What is the millions digit of 8763224? 8 What is the units digit of 12616699? 9 What is the hundred thousands digit of 434712? 4 What is the tens digit of 1787338? 3 What is the hundreds digit of 9960489? 4 What is the hundreds digit of 3795849? 8 What is the ten millions digit of 23330840? 2 What is the thousands digit of 665878? 5 What is the millions digit of 3520998? 3 What is the thousands digit of 776387? 6 What is the hundreds digit of 110964? 9 What is the ten thousands digit of 577684? 7 What is the hundred thousands digit of 2935721? 9 What is the thousands digit of 9097828? 7 What is the hundred thousands digit of 780674? 7 What is the ten thousands digit of 320633? 2 What is the hundred thousands digit of 545326? 5 What is the tens digit of 802084? 8 What is the tens digit of 229881? 8 What is the thousands digit of 392970? 2 What is the tens digit of 631429? 2 What is the units digit of 935431? 1 What is the hundred thousands digit of 2792793? 7 What is the thousands digit of 16914517? 4 What is the tens digit of 18854? 5 What is the hundreds digit of 1992583? 5 What is the hundred thousands digit of 2480066? 4 What is the units digit of 5980045? 5 What is the units digit of 6611819? 9 What is the hundreds digit of 7226625? 6 What is the units digit of 20506? 6 What is the tens digit of 986305? 0 What is the tens digit of 184341? 4 What is the thousands digit of 1708489? 8 What is the units digit of 255034? 4 What is the hundreds digit of 3120073? 0 What is the hundreds digit of 264771? 7 What is the hundred thousands digit of 5455320? 4 What is the units digit of 3047862? 2 What is the hundreds digit of 742045? 0 What is the thousands digit of 11304539? 4 What is the millions digit of 6534142? 6 What is the ten thousands digit of 9696392? 9 What is the units digit of 12237? 7 What is the ten thousands digit of 389154? 8 What is the ten thousands digit of 66568? 6 What is the tens digit of 673224? 2 What is the units digit of 143130? 0 What is the units digit of 6239304? 4 What is the millions digit of 5399706? 5 What is the hundreds digit of 421392? 3 What is the ten thousands digit of 20845385? 4 What is the ten thousands digit of 181542? 8 What is the hundred thousands digit of 568679? 5 What is the tens digit of 1465888? 8 What is the thousands digit of 22278? 2 What is the millions digit of 20497207? 0 What is the thousands digit of 667706? 7 What is the units digit of 239043? 3 What is the hundreds digit of 12917455? 4 What is the units digit of 249258? 8 What is the hundreds digit of 518065? 0 What is the millions digit of 29916351? 9 What is the hundreds digit of 652239? 2 What is the ten thousands digit of 10580523? 8 What is the hundred thousands digit of 5920616? 9 What is the ten thousands digit of 3030829? 3 What is the thousands digit of 59628? 9 What is the ten thousands digit of 1567969? 6 What is the tens digit of 227880? 8 What is the ten thousands digit of 16262? 1 What is the units digit of 2867897? 7 What is the units digit of 128825? 5 What is the units digit of 3085140? 0 What is the hundred thousands digit of 101205? 1 What is the tens digit of 1998? 9 What is the ten thousands digit of 4657812? 5 What is the tens digit of 1229777? 7 What is the units digit of 1407157? 7 What is the hundred thousands digit of 16926138? 9 What is the hundreds digit of 2325043? 0 What is the units digit of 16725383? 3 What is the thousands digit of 4431218? 1 What is the ten thousands digit of 308300? 0 What is the thousands digit of 128303? 8 What is the units digit of 809674? 4 What is the hundreds digit of 9287158? 1 What is the hundreds digit of 261948? 9 What is the units digit of 14880061? 1 What is the ten thousands digit of 558897? 5 What is the ten thousands digit of 1701957? 0 What is the tens digit of 3406324? 2 What is the hundreds digit of 402117? 1 What is the hundreds digit of 15117277? 2 What is the units digit of 2858107? 7 What is the ten thousands digit of 18469? 1 What is the tens digit of 18277999? 9 What is the thousands digit of 1428029? 8 What is the tens digit of 1838675? 7 What is the thousands digit of 14245? 4 What is the units digit of 12782367? 7 What is the millions digit of 6104457? 6 What is the tens digit of 31067645? 4 What is the ten thousands digit of 2709513? 0 What is the thousands digit of 1276270? 6 What is the tens digit of 27063? 6 What is the units digit of 19814890? 0 What is the hundreds digit of 5087730? 7 What is the thousands digit of 641474? 1 What is the units digit of 9715917? 7 What is the hundreds digit of 6027265? 2 What is the thousands digit of 2759239? 9 What is the ten thousands digit of 121914? 2 What is the ten thousands digit of 310304? 1 What is the hundred thousands digit of 150222? 1 What is the ten thousands digit of 2983708? 8 What is the units digit of 525247? 7 What is the ten thousands digit of 437006? 3 What is the thousands digit of 570822? 0 What is the hundreds digit of 2159533? 5 What is the units digit of 7402130? 0 What is the ten thousands digit of 158227? 5 What is the tens digit of 192393? 9 What is the hundred thousands digit of 1977261? 9 What is the thousands digit of 1205464? 5 What is the units digit of 4031606? 6 What is the ten thousands digit of 343097? 4 What is the hundreds digit of 307046? 0 What is the ten millions digit of 20243594? 2 What is the thousands digit of 63534? 3 What is the hundreds digit of 657603? 6 What is the hundred thousands digit of 749986? 7 What is the tens digit of 267650? 5 What is the hundreds digit of 6697746? 7 What is the hundreds digit of 817389? 3 What is the hundred thousands digit of 1285936? 2 What is the thousands digit of 464432? 4 What is the units digit of 239914? 4 What is the hundreds digit of 70633? 6 What is the units digit of 13632005?	{ "pile_set_name": "DM Mathematics" }
visor of 42 and 84. 42 What is the highest common factor of 2 and 366? 2 Calculate the greatest common divisor of 108 and 3204. 36 What is the greatest common factor of 400 and 112? 16 What is the greatest common factor of 7249 and 11? 11 Calculate the greatest common factor of 50 and 10. 10 Calculate the highest common factor of 34 and 459. 17 Calculate the greatest common divisor of 30 and 1280. 10 Calculate the highest common factor of 99 and 36. 9 What is the highest common factor of 57 and 133? 19 What is the highest common factor of 3 and 741? 3 Calculate the highest common divisor of 450 and 350. 50 What is the greatest common divisor of 377 and 26? 13 Calculate the highest common factor of 3268 and 1204. 172 Calculate the greatest common factor of 45 and 10. 5 Calculate the greatest common factor of 44 and 1364. 44 Calculate the highest common divisor of 24 and 948. 12 What is the highest common divisor of 132 and 946? 22 What is the highest common factor of 58 and 27579? 29 What is the greatest common factor of 6194 and 38? 38 Calculate the greatest common factor of 1458 and 594. 54 What is the greatest common divisor of 1070 and 10? 10 Calculate the greatest common factor of 5487 and 31. 31 What is the highest common divisor of 1216 and 1024? 64 What is the highest common divisor of 2043 and 81? 9 Calculate the highest common factor of 18800 and 300. 100 What is the highest common factor of 266 and 38? 38 What is the greatest common factor of 150 and 5825? 25 What is the greatest common divisor of 1630 and 90? 10 Calculate the highest common divisor of 246 and 164. 82 Calculate the greatest common divisor of 57 and 57. 57 What is the highest common divisor of 33 and 473? 11 What is the highest common divisor of 24604 and 4? 4 What is the greatest common divisor of 765 and 36? 9 Calculate the highest common factor of 476 and 28. 28 Calculate the highest common factor of 6 and 1968. 6 Calculate the highest common divisor of 4615 and 104. 13 What is the highest common factor of 48 and 120? 24 What is the greatest common factor of 405 and 180? 45 Calculate the greatest common divisor of 2480 and 868. 124 Calculate the highest common divisor of 440 and 198. 22 Calculate the highest common factor of 12 and 1338. 6 What is the greatest common divisor of 22 and 231? 11 Calculate the highest common divisor of 7 and 5257. 7 What is the greatest common divisor of 25448 and 8? 8 Calculate the greatest common divisor of 49 and 497. 7 Calculate the highest common factor of 140 and 100. 20 Calculate the highest common divisor of 48 and 444. 12 Calculate the greatest common factor of 2648 and 8. 8 What is the highest common divisor of 23684 and 124? 124 Calculate the highest common factor of 1177 and 4922. 107 Calculate the highest common divisor of 160 and 26720. 160 Calculate the highest common divisor of 68 and 52. 4 What is the greatest common factor of 99 and 1683? 99 What is the greatest common divisor of 98 and 13181? 49 Calculate the greatest common factor of 630 and 2961. 63 What is the highest common factor of 105 and 7? 7 What is the greatest common divisor of 38 and 158? 2 Calculate the highest common divisor of 57 and 76. 19 Calculate the greatest common factor of 935 and 170. 85 Calculate the highest common factor of 4773 and 387. 129 What is the greatest common divisor of 32 and 12? 4 Calculate the greatest common divisor of 2697 and 93. 93 Calculate the highest common divisor of 48 and 20592. 48 What is the highest common divisor of 88 and 308? 44 What is the highest common divisor of 1105 and 34? 17 Calculate the highest common factor of 16 and 536. 8 What is the greatest common divisor of 5828 and 248? 124 What is the highest common divisor of 46 and 102? 2 Calculate the highest common divisor of 574 and 112. 14 What is the highest common factor of 71 and 2911? 71 Calculate the greatest common divisor of 133 and 7. 7 Calculate the highest common factor of 33 and 836. 11 What is the greatest common factor of 2 and 11? 1 Calculate the greatest common factor of 1846 and 284. 142 Calculate the highest common factor of 495 and 11715. 165 Calculate the greatest common factor of 30 and 75. 15 What is the greatest common divisor of 1152 and 216? 72 What is the greatest common factor of 39 and 69? 3 Calculate the highest common divisor of 217 and 62. 31 Calculate the greatest common divisor of 10933 and 3393. 377 Calculate the greatest common divisor of 24 and 176. 8 What is the greatest common divisor of 30 and 555? 15 What is the greatest common factor of 45 and 1125? 45 Calculate the highest common factor of 11 and 52. 1 Calculate the highest common factor of 15 and 69. 3 Calculate the greatest common factor of 728 and 287. 7 What is the greatest common factor of 196 and 56? 28 What is the greatest common factor of 69 and 92? 23 What is the highest common divisor of 155 and 496? 31 What is the greatest common divisor of 2108 and 136? 68 What is the greatest common factor of 147 and 336? 21 Calculate the greatest common divisor of 19 and 113. 1 What is the highest common factor of 3472 and 372? 124 What is the greatest common divisor of 54 and 42? 6 Calculate the greatest common factor of 32 and 956. 4 Calculate the greatest common factor of 29 and 58. 29 Calculate the greatest common factor of 152 and 171. 19 What is the greatest common factor of 2537 and 129? 43 What is the highest common factor of 71 and 142? 71 What is the highest common factor of 60 and 555? 15 What is the greatest common divisor of 54 and 135? 27 Calculate the highest common factor of 11530 and 10. 10 Calculate the highest common divisor of 245 and 70. 35 What is the highest common factor of 524 and 10611? 131 What is the highest common divisor of 2 and 1478? 2 What is the highest common divisor of 170 and 290? 10 Calculate the greatest common divisor of 60 and 45. 15 Calculate the greatest common divisor of 24 and 768. 24 What is the highest common factor of 435 and 10? 5 What is the greatest common divisor of 1066 and 26? 26 Calculate the highest common factor of 219 and 5694. 219 What is the highest common divisor of 8 and 18728? 8 Calculate the greatest common factor of 462 and 88. 22 Calculate the highest common divisor of 21907 and 19. 19 Calculate the highest common divisor of 8 and 7688. 8 What is the greatest common factor of 28 and 189? 7 What is the greatest common divisor of 14 and 142? 2 Calculate the highest common divisor of 91 and 572. 13 Calculate the greatest common divisor of 1008 and 63. 63 Calculate the highest common factor of 360 and 14520. 120 What is the greatest common divisor of 7725 and 412? 103 Calculate the highest common divisor of 91 and 104. 13 Calculate the highest common factor of 310 and 30. 10 Calculate the greatest common divisor of 12260 and 60. 20 Calculate the highest common divisor of 64 and 5184. 64 Calculate the greatest common factor of 567 and 42. 21 Calculate the highest common factor of 44 and 418. 22 What is the greatest common divisor of 475 and 190? 95 Calculate the greatest common divisor of 8 and 416. 8 What is the highest common factor of 169 and 1222? 13 Calculate the greatest common factor of 75 and 5575. 25 Calculate the greatest common factor of 5 and 280. 5 Calculate the highest common factor of 2 and 26. 2 Calculate the greatest common factor of 1678 and 2. 2 Calculate the greatest common divisor of 470 and 30. 10 Calculate the greatest common divisor of 10 and 310. 10 What is the greatest common divisor of 1226 and 2? 2 Calculate the highest common divisor of 68 and 51. 17 Calculate the highest common divisor of 468 and 225. 9 Calculate the greatest common factor of 560 and 32. 16 Calculate the greatest common divisor of 2 and 13. 1 What is the greatest common factor of 8374 and 474? 158 Calculate the highest common factor of 117 and 312. 39 What is the greatest common divisor of 40 and 260? 20 What is the greatest common factor of 118 and 826? 118 What is the greatest common divisor of 124 and 496? 124 What is the highest common factor of 940 and 80? 20 What is the greatest common divisor of 715 and 275? 55 What is the greatest common factor of 12056 and 44? 44 What is the highest common factor of 18	{ "pile_set_name": "DM Mathematics" }
ng order. 0.5, 0.2, 0.11, 0.1, -5 Sort -1, 1/3, -2/7, 27, 3 in decreasing order. 27, 3, 1/3, -2/7, -1 Put 3, -42, 0, 2 in ascending order. -42, 0, 2, 3 Sort -1, -71, 2 in increasing order. -71, -1, 2 Sort 155, -5, -2/7, 0.5 in ascending order. -5, -2/7, 0.5, 155 Sort -5, -0.1, -0.02, 133, -4 in ascending order. -5, -4, -0.1, -0.02, 133 Put -1, 4, -222 in decreasing order. 4, -1, -222 Put 3, 7, -19 in increasing order. -19, 3, 7 Sort 0, 2/5, -3, -0.3, -311 in decreasing order. 2/5, 0, -0.3, -3, -311 Sort -2, 2, 3, -6 in ascending order. -6, -2, 2, 3 Put 3, -135, 37 in ascending order. -135, 3, 37 Put 56, 3, 5 in descending order. 56, 5, 3 Sort 3, -9, 0, -3 in ascending order. -9, -3, 0, 3 Sort -17, -2, 4, 190. -17, -2, 4, 190 Sort 1/4, 4, 1, -5. -5, 1/4, 1, 4 Put 3/8, 14, 5, 2/19 in decreasing order. 14, 5, 3/8, 2/19 Put 0.6, 4, -0.4, -0.2 in decreasing order. 4, 0.6, -0.2, -0.4 Put -4, -127, 5 in descending order. 5, -4, -127 Put 2, -4, 99 in increasing order. -4, 2, 99 Sort 39/4, -2/3, -0.01. -2/3, -0.01, 39/4 Sort -3, 1, 46. -3, 1, 46 Put 3, 1, 0.5, -3.9, 2 in decreasing order. 3, 2, 1, 0.5, -3.9 Sort -8, -1, -2.3, -2/3, 0.5 in increasing order. -8, -2.3, -1, -2/3, 0.5 Sort 10, -0.1, -7, -4, 2/9. -7, -4, -0.1, 2/9, 10 Put 0, -10, 2, 28 in ascending order. -10, 0, 2, 28 Sort -56, -2, 3 in descending order. 3, -2, -56 Put -4, -12, 44, -0.5 in decreasing order. 44, -0.5, -4, -12 Sort 4, 3, 1/11, -34, 1 in increasing order. -34, 1/11, 1, 3, 4 Sort 2/11, -37.6, 1/2 in descending order. 1/2, 2/11, -37.6 Sort 5, -2, -13, 18 in decreasing order. 18, 5, -2, -13 Sort -15/8, -4, -1. -4, -15/8, -1 Put 20, -8/7, 5 in descending order. 20, 5, -8/7 Sort 18, -2, 5 in descending order. 18, 5, -2 Sort 1910, 5, -2/21 in decreasing order. 1910, 5, -2/21 Sort 10/11, 8, -0.04 in increasing order. -0.04, 10/11, 8 Put 1, -431, -5 in decreasing order. 1, -5, -431 Sort -8, 5, -1 in descending order. 5, -1, -8 Sort 0, -4, -3, 3 in increasing order. -4, -3, 0, 3 Sort 2176, -3, 2/5 in decreasing order. 2176, 2/5, -3 Put 188, 3, -3/4, -1, -0.2 in decreasing order. 188, 3, -0.2, -3/4, -1 Put -22, 4, 26 in decreasing order. 26, 4, -22 Put -2, 2, -4, -3, 10 in decreasing order. 10, 2, -2, -3, -4 Put -0.4, -2/17, -1.6 in increasing order. -1.6, -0.4, -2/17 Sort 1/31, -10/3, 1/5 in ascending order. -10/3, 1/31, 1/5 Sort 1.2, 0.2, 2/5, -141 in descending order. 1.2, 2/5, 0.2, -141 Put -11, -2, -3, -0.11 in descending order. -0.11, -2, -3, -11 Sort 4, 5, -3, -20 in decreasing order. 5, 4, -3, -20 Sort -4, 1, 7, -6 in ascending order. -6, -4, 1, 7 Sort -2, 44, 4. -2, 4, 44 Sort 3, -4, -27, 5 in increasing order. -27, -4, 3, 5 Put 1, 2, -2, 85, -1 in decreasing order. 85, 2, 1, -1, -2 Sort 2, -2, 4, 1 in decreasing order. 4, 2, 1, -2 Put -4, 2, 4/59, 0.1 in decreasing order. 2, 0.1, 4/59, -4 Put 4, 1, -4, -2 in ascending order. -4, -2, 1, 4 Sort 1/8, -0.05, -0.02, -1/2 in decreasing order. 1/8, -0.02, -0.05, -1/2 Sort 5, -0.04, 4, -2/9 in decreasing order. 5, 4, -0.04, -2/9 Sort 22, 3, 4 in ascending order. 3, 4, 22 Sort -0.4, 1, -88 in ascending order. -88, -0.4, 1 Sort -2, 0, 2, 8 in increasing order. -2, 0, 2, 8 Sort -3/7, -0.4, 4, 0.05 in descending order. 4, 0.05, -0.4, -3/7 Put 5, 2/9, 2, 2375 in decreasing order. 2375, 5, 2, 2/9 Sort -0.3, 0.8, 3, 5 in descending order. 5, 3, 0.8, -0.3 Put 1, -27, 0, 1/2 in descending order. 1, 1/2, 0, -27 Put 6, -5, 24 in increasing order. -5, 6, 24 Put 3, -5, -4, 5, 11 in decreasing order. 11, 5, 3, -4, -5 Sort 17, 1, -4, -5 in decreasing order. 17, 1, -4, -5 Put 1, 4, -10, 0, 5 in increasing order. -10, 0, 1, 4, 5 Put -2/3, 14/3, -10 in increasing order. -10, -2/3, 14/3 Sort -6, -5, 12, -1 in decreasing order. 12, -1, -5, -6 Sort 3, -1, 48, -5 in decreasing order. 48, 3, -1, -5 Put -2/7, -5, 0.06, -7 in decreasing order. 0.06, -2/7, -5, -7 Sort 1, -4, 0, -3, -246 in increasing order. -246, -4, -3, 0, 1 Sort -1, -3, 3, -50, 0 in descending order. 3, 0, -1, -3, -50 Sort 2, 79, 5 in decreasing order. 79, 5, 2 Sort 100, 1, 14 in descending order. 100, 14, 1 Sort 5, -233, 1, 4, 2. -233, 1, 2, 4, 5 Sort -1/6, -0.05, -0.02, -3 in decreasing order. -0.02, -0.05, -1/6, -3 Put -23, 2, 0 in decreasing order. 2, 0, -23 Sort 0, 2, 12 in increasing order. 0, 2, 12 Put -4, -1, 4, 1, 45 in ascending order. -4, -1, 1, 4, 45 Sort -1/9, -3/2, 1/4, -1 in ascending order. -3/2, -1, -1/9, 1/4 Sort 114, 1, 5 in ascending order. 1, 5, 114 Put -111/5, -1, 3/4 in decreasing order. 3/4, -1, -111/5 Put -0.123, -2/9, 3/4, -2/7 in descending order. 3/4, -0.123, -2/9, -2/7 Sort 0.4, -0.09, 3. -0.09, 0.4, 3 Sort 4, -1/117, -3, 3/11 in increasing order. -3, -1/117, 3/11, 4 Put -2, 0.1, 1/2, -2/11 in descending order. 1/2, 0.1, -2/11, -2 Sort -0.3, 0.1, 1, 2/31. -0.3, 2/31, 0.1, 1 Sort 8, 7, 48 in decreasing order. 48, 8, 7 Sort 2, -32, 5, 43, 3. -32, 2, 3, 5, 43 Sort 7, 0.5, -39. -39, 0.5, 7 Put 2, -28, 3 in ascending order. -28, 2, 3 Sort -4, 4, 7 in increasing order. -4, 4, 7 Put -0.4, 0, -0.06, -1/11, 3 in increasing order. -0.4, -1/11, -0.06, 0, 3 Sort -266, -4, 19 in ascending order. -266, -4, 19 Sort 337, -1, -4, 4 in increasing order. -4, -1, 4, 337 Sort 0, -13.3, 4 in ascending order. -13.3, 0, 4 Sort 1, -1, 20. -1, 1, 20 Sort -3, 0, 0.13 in decreasing order. 0.13, 0, -3 Put -15, 4, 1, -2, -1 in decreasing order. 4, 1, -1, -2, -15 Put 1, 238, 5 in descending order. 238, 5, 1 Put 1, -3, -6, 5 in decreasing order. 5, 1, -3, -6 Put -2/13, -5, -4, 0.9 in descending order. 0.9, -2/13, -4, -5 Sort -2, 1, -333 in ascending order. -333, -2, 1 Sort 26, -4, -2, -3. -4, -3, -2, 26 Sort -43, -1, 1 in decreasing order. 1, -1, -43 Sort -5, 106, -4, 5. -5, -4, 5, 106 Sort 1.3, 6, -0.3. -0.3, 1.3, 6 Sort 0.1, 2, 133, 2/7. 0.1, 2/7, 2, 133 Put -0.1, 135/7, 3/4 in descending order. 135/7, 3/4, -0.1 Sort 1/8, 2/13, 18. 1/8, 2/13, 18 Put 6, 14, 1, 4, -0.4 in decreasing order. 14, 6, 4, 1, -0.4 Put -466, -2/13, -0.18, 4 in descending order. 4, -2/13, -0.18, -466 Sort -4, -26, 0 in increasing order. -26, -4, 0 Sort -11, 7, -1, 0.3 in increasing order. -11, -1, 0.3, 7 Sort 1, 0, 33, -0.6. -0.6, 0, 1, 33 Put -4, 3, 120, 5 in descending order. 120, 5, 3, -4 Put 1170, -2, 1, 4, -5 in descending order. 1170, 4, 1, -2, -5 Sort -4, 1960, 5, 3 in decreasing order. 1960, 5, 3, -4 Sort -971, 2/7, -4 in ascending order. -971, -4, 2/7 Sort 5, -149/2, 0, -0.1 in decreasing order. 5, 0, -0.1, -149/2 Sort 1, 2/3, 4, -3.532 in decreasing order. 4, 1, 2/3, -3.532 Put 86, 2, -10 in decreasing order. 86, 2, -10 Sort -61, -5, 5, -2. -61, -5, -2, 5 Sort 5/2, -6, -11.5 in increasing order. -11.5, -6, 5/2 Put -3/2, 13, -2, -0.3 in increasing order. -2, -3/2, -0.3, 13 Sort 1, -1, 29, 0, -4 in decreasing order. 29, 1, 0, -1, -4 Sort -0.5, 1/6, 1, 4, -3/4 in descending order. 4, 1, 1/6, -0.5, -3/4 Sort 2, -1, -5, -28 in decreasing order. 2, -1, -5, -28 Put 3, -56, -2, -4 in increasing order. -56, -4, -2, 3 Put 8, -6, -2, 4 in increasing order. -6, -2, 4, 8 Put -7, 2, -2 in increasing order. -7, -2, 2 Sort 30, -3, 4 in descending order. 30, 4, -3 Sort 25, -5, 3, 32, 2 in increasing order. -5, 2, 3, 25, 32 Put -10, -3, 2/11 in descending order. 2/11, -3, -10 Sort 15, -1, -4, -5 in ascending order. -5, -4, -1, 15 Sort -0.2, 0, 2/17, 18 in ascending order. -0.2, 0, 2/17, 18 Put -0.1, 3093, 1, -0.3 in descending order. 3093, 1, -0.1, -0.3 Sort -33, -4, -1, -0.4, 1 in descending order. 1, -0.4, -1, -4, -33 Sort 13, -13, 0, -3. -13, -3, 0, 13 Put 0.4, 572, -4 in increasing order. -4, 0.4, 572 Sort 38, 4, 5 in increasing order. 4, 5, 38 Put -4, -1, 0, 138 in decreasing order. 138, 0, -1, -4 Sort -1, 11, -0.82, -0.08. -1, -0.82, -0.08, 11 Sort -1, 20, 3 in decreasing order. 20, 3, -1 Sort -0.3, 3, 18/11. -0.3, 18/11, 3 Sort 0, -1, 2, 4 in descending order. 4, 2, 0, -1 Sort 2, -3, 31, 10 in descending order. 31, 10, 2, -3 Sort -2, -21, -1 in decreasing order. -1, -2, -21 Put 1, 4, 2, 0.3, -128 in descending order. 4, 2, 1, 0.3, -128 Put 4, 3, 45, -1 in ascending order. -1, 3, 4, 45 Put 200, 4, 3 in increasing order. 3, 4, 200 Put 4752, -2, 0.1 in ascending order. -2, 0.1, 4752 Put -2, 5, -5, 4, 73 in decreasing order. 73, 5, 4, -2, -5 Sort -0.09, -2, 218 in ascending order. -2, -0.09, 218 Sort -1, 930, -4, -5, 5	{ "pile_set_name": "DM Mathematics" }
ommon factor of 1364 and 868. 124 Calculate the highest common factor of 3 and 1. 1 What is the highest common factor of 40 and 1960? 40 What is the greatest common factor of 5888 and 1656? 184 Calculate the greatest common factor of 26 and 3133. 13 Calculate the greatest common divisor of 385 and 5313. 77 Calculate the highest common factor of 37914 and 213. 213 What is the highest common factor of 2 and 6671? 1 Calculate the greatest common divisor of 1781 and 208. 13 Calculate the highest common divisor of 253 and 99. 11 Calculate the greatest common factor of 130 and 65. 65 What is the greatest common factor of 21877 and 131? 131 Calculate the greatest common divisor of 165 and 75. 15 What is the highest common divisor of 15 and 3495? 15 Calculate the greatest common divisor of 584 and 24. 8 What is the greatest common factor of 45 and 465? 15 What is the highest common divisor of 6 and 738? 6 What is the highest common factor of 2541 and 105? 21 What is the highest common factor of 25 and 13225? 25 What is the highest common divisor of 6 and 12048? 6 Calculate the highest common divisor of 512 and 272. 16 What is the highest common divisor of 261 and 58? 29 Calculate the highest common divisor of 29516 and 188. 188 Calculate the highest common divisor of 5 and 25. 5 What is the greatest common divisor of 3 and 6? 3 What is the highest common factor of 76 and 190? 38 What is the highest common divisor of 19234 and 354? 118 Calculate the highest common divisor of 3832 and 24. 8 What is the highest common divisor of 6970 and 170? 170 Calculate the greatest common factor of 11800 and 400. 200 What is the highest common factor of 418 and 88? 22 What is the greatest common divisor of 270 and 450? 90 What is the highest common divisor of 969 and 114? 57 What is the greatest common factor of 88 and 64? 8 What is the highest common factor of 24 and 696? 24 Calculate the greatest common factor of 400 and 160. 80 What is the highest common factor of 1391 and 13? 13 Calculate the highest common factor of 8282 and 246. 82 What is the highest common factor of 103 and 23999? 103 What is the greatest common factor of 2047 and 115? 23 What is the greatest common divisor of 186 and 2511? 93 Calculate the highest common divisor of 976 and 16. 16 What is the highest common factor of 19 and 19? 19 Calculate the highest common divisor of 438 and 12. 6 What is the greatest common factor of 7055 and 83? 83 Calculate the greatest common factor of 198 and 264. 66 What is the highest common divisor of 3162 and 204? 102 Calculate the greatest common divisor of 3741 and 87. 87 Calculate the greatest common factor of 2 and 16. 2 Calculate the greatest common divisor of 5 and 65. 5 What is the greatest common divisor of 1020 and 60? 60 Calculate the highest common factor of 5 and 1445. 5 What is the highest common divisor of 35 and 1475? 5 What is the highest common factor of 2665 and 20? 5 Calculate the greatest common factor of 672 and 1596. 84 Calculate the highest common factor of 120 and 870. 30 Calculate the highest common divisor of 272 and 108. 4 What is the greatest common divisor of 33 and 11? 11 What is the greatest common divisor of 464 and 319? 29 What is the greatest common factor of 621 and 54? 27 Calculate the greatest common divisor of 5129 and 2899. 223 Calculate the highest common factor of 10 and 94. 2 Calculate the highest common factor of 7833 and 63. 21 Calculate the highest common divisor of 161 and 42. 7 What is the highest common factor of 32 and 544? 32 What is the highest common divisor of 1770 and 75? 15 Calculate the highest common divisor of 8 and 200. 8 What is the highest common divisor of 459 and 18? 9 Calculate the greatest common factor of 880 and 10. 10 Calculate the highest common factor of 779 and 41. 41 Calculate the greatest common factor of 90 and 1080. 90 What is the highest common factor of 78 and 702? 78 Calculate the highest common divisor of 267 and 356. 89 Calculate the highest common divisor of 153 and 187. 17 What is the highest common divisor of 2599 and 46? 23 Calculate the highest common factor of 56 and 40. 8 What is the highest common divisor of 84 and 1988? 28 What is the greatest common factor of 72 and 126? 18 Calculate the highest common factor of 10813 and 11. 11 What is the greatest common divisor of 72 and 72? 72 Calculate the greatest common factor of 185 and 2035. 185 Calculate the greatest common factor of 6437 and 82. 41 Calculate the highest common divisor of 12 and 852. 12 Calculate the greatest common divisor of 119 and 3689. 119 Calculate the greatest common factor of 156 and 572. 52 What is the highest common factor of 29 and 232? 29 Calculate the highest common factor of 1732 and 4. 4 Calculate the greatest common divisor of 2440 and 40. 40 Calculate the greatest common factor of 11 and 396. 11 What is the greatest common factor of 1813 and 49? 49 What is the highest common divisor of 10 and 4835? 5 What is the highest common divisor of 35 and 10? 5 What is the highest common divisor of 65 and 195? 65 Calculate the highest common divisor of 16 and 504. 8 What is the highest common factor of 1 and 19? 1 Calculate the highest common factor of 80 and 48. 16 Calculate the highest common factor of 21 and 231. 21 Calculate the highest common divisor of 497 and 7. 7 What is the highest common factor of 819 and 63? 63 Calculate the highest common divisor of 51200 and 100. 100 What is the greatest common factor of 17 and 1921? 17 What is the greatest common divisor of 623 and 356? 89 What is the highest common factor of 44 and 3366? 22 Calculate the highest common factor of 1008 and 938. 14 Calculate the highest common divisor of 3 and 129. 3 What is the greatest common divisor of 16 and 12? 4 Calculate the greatest common divisor of 510 and 102. 102 What is the greatest common divisor of 130 and 975? 65 What is the highest common divisor of 488 and 671? 61 Calculate the highest common divisor of 2735 and 40. 5 What is the highest common factor of 6 and 174? 6 Calculate the highest common factor of 22971 and 247. 247 What is the highest common factor of 68 and 17204? 68 Calculate the highest common factor of 528 and 99. 33 What is the greatest common divisor of 2135 and 70? 35 What is the highest common divisor of 37 and 296? 37 What is the greatest common divisor of 3 and 81? 3 What is the greatest common divisor of 123 and 120171? 123 What is the highest common divisor of 14118 and 312? 78 What is the greatest common factor of 14 and 76? 2 Calculate the highest common divisor of 24 and 252. 12 Calculate the highest common divisor of 1530 and 50. 10 Calculate the highest common divisor of 68 and 884. 68 Calculate the highest common factor of 4032 and 2772. 252 Calculate the highest common factor of 245 and 392. 49 Calculate the highest common divisor of 8 and 13. 1 Calculate the greatest common divisor of 65 and 5. 5 Calculate the highest common divisor of 150 and 225. 75 Calculate the highest common divisor of 630 and 27. 9 What is the greatest common factor of 22596 and 84? 84 What is the highest common divisor of 195 and 52? 13 What is the highest common factor of 36585 and 27? 27 What is the greatest common factor of 64 and 88? 8 Calculate the highest common factor of 80 and 12. 4 Calculate the highest common factor of 69324 and 872. 436 Calculate the greatest common factor of 320 and 440. 40 What is the highest common divisor of 315 and 225? 45 Calculate the greatest common divisor of 400 and 28. 4 What is the highest common divisor of 7280 and 48? 16 What is the highest common divisor of 6 and 24? 6 Calculate the highest common factor of 282 and 13959. 141 Calculate the greatest common factor of 174 and 1334. 58 Calculate the highest common divisor of 1328 and 688. 16 Calculate the highest common divisor of 860 and 60. 20 Calculate the greatest common divisor of 5746 and 52. 26 What is the greatest common factor of 871 and 143? 13 Calculate the highest common divisor of 16 and 1384. 8 Calculate the highest common divisor of 96 and 15. 3 Calculate the greatest common divisor of 30 and 90. 30 Calculate the highest common factor of 53 and 5671. 53 Calculate the greatest common factor of 195 and 156	{ "pile_set_name": "DM Mathematics" }
s prob of sequence pbft? 1/455 Four letters picked without replacement from zoovzaooiozaa. What is prob of sequence zvoz? 1/572 Four letters picked without replacement from bbbbbbbbbbbbkbbkbkbb. What is prob of sequence bkbk? 4/285 What is prob of sequence cc when two letters picked without replacement from {c: 16, p: 4}? 12/19 Two letters picked without replacement from {m: 1, p: 1, h: 6, y: 11}. What is prob of sequence py? 11/342 Calculate prob of sequence yy when two letters picked without replacement from {y: 6, g: 4}. 1/3 What is prob of sequence ivv when three letters picked without replacement from iiivivivvvvv? 7/44 Four letters picked without replacement from {d: 4, j: 2, x: 2}. What is prob of sequence jxjx? 1/420 Four letters picked without replacement from {g: 2, v: 5, x: 3, c: 3, h: 5}. Give prob of sequence hvgv. 5/1836 What is prob of sequence qlbb when four letters picked without replacement from qbllqlbl? 1/105 Two letters picked without replacement from woowssqwwl. What is prob of sequence qw? 2/45 Two letters picked without replacement from {e: 2, x: 2, b: 5, t: 3}. What is prob of sequence ex? 1/33 What is prob of sequence bb when two letters picked without replacement from {g: 1, c: 6, o: 8, n: 1, b: 4}? 3/95 Calculate prob of sequence nnnf when four letters picked without replacement from nnnnnnfnnnnnfnnnnn. 14/153 Two letters picked without replacement from kkwkkwkkkkkk. Give prob of sequence kw. 5/33 Two letters picked without replacement from {s: 2, j: 3, x: 3}. Give prob of sequence jj. 3/28 Calculate prob of sequence oq when two letters picked without replacement from fffflqoaafowl. 1/78 Calculate prob of sequence vtt when three letters picked without replacement from vvttfc. 1/30 Three letters picked without replacement from bzzjjjkttffjbj. What is prob of sequence kbt? 1/546 Calculate prob of sequence kzzz when four letters picked without replacement from {z: 4, k: 10}. 10/1001 What is prob of sequence eee when three letters picked without replacement from {e: 6}? 1 Four letters picked without replacement from nznnnnzznnnsznznnnnn. What is prob of sequence znsz? 7/2907 What is prob of sequence kggk when four letters picked without replacement from {g: 5, k: 7}? 7/99 Calculate prob of sequence oxo when three letters picked without replacement from oxoxooooooooooooox. 35/272 Two letters picked without replacement from {b: 2, s: 1, r: 1, c: 1, g: 2}. What is prob of sequence sb? 1/21 Four letters picked without replacement from pppzpzpzpzzpp. Give prob of sequence zppz. 28/429 Two letters picked without replacement from {p: 1, b: 1, e: 1}. What is prob of sequence pe? 1/6 What is prob of sequence nw when two letters picked without replacement from {n: 1, y: 2, b: 3, w: 1, j: 3}? 1/90 What is prob of sequence nw when two letters picked without replacement from wnwwnwwwwwww? 5/33 Four letters picked without replacement from nznnnznznnznnn. What is prob of sequence nnnn? 30/143 Four letters picked without replacement from rrrrrfrrf. What is prob of sequence frrr? 5/36 Three letters picked without replacement from mfmcmmkkkmcemm. What is prob of sequence cem? 1/156 What is prob of sequence vvv when three letters picked without replacement from vvxxvvx? 4/35 What is prob of sequence zy when two letters picked without replacement from zyyzzzzzyzz? 12/55 Two letters picked without replacement from iinieipj. What is prob of sequence ii? 3/14 Calculate prob of sequence cysh when four letters picked without replacement from {s: 1, c: 1, y: 1, h: 1, z: 1}. 1/120 What is prob of sequence ii when two letters picked without replacement from {d: 4, u: 3, n: 1, i: 2, z: 4}? 1/91 Calculate prob of sequence ttkt when four letters picked without replacement from kvkttkvvktvvkkvvvtv. 1/646 Two letters picked without replacement from {r: 2, i: 8, j: 5}. Give prob of sequence ji. 4/21 Two letters picked without replacement from {r: 1, h: 8, j: 2, w: 3, a: 1, v: 1}. What is prob of sequence jj? 1/120 What is prob of sequence hk when two letters picked without replacement from hujkjupkkhcu? 1/22 Two letters picked without replacement from jjjpplppl. Give prob of sequence jl. 1/12 Four letters picked without replacement from {u: 6, k: 3, r: 1, q: 2, w: 2, b: 6}. What is prob of sequence bqrq? 1/9690 Three letters picked without replacement from hhcccchhhhh. What is prob of sequence hch? 28/165 Three letters picked without replacement from {e: 4, n: 2, l: 5, j: 4, d: 1}. What is prob of sequence jnj? 1/140 Four letters picked without replacement from {c: 6, p: 7, w: 4}. Give prob of sequence cppc. 3/136 What is prob of sequence tsuu when four letters picked without replacement from {k: 2, u: 2, s: 1, t: 1, j: 1}? 1/420 Two letters picked without replacement from vqvafvvffv. What is prob of sequence fa? 1/30 What is prob of sequence iob when three letters picked without replacement from iibo? 1/12 Calculate prob of sequence veo when three letters picked without replacement from {v: 3, y: 1, e: 3, w: 5, o: 1, l: 1}. 3/728 Calculate prob of sequence zmmn when four letters picked without replacement from mmpmpzpznm. 1/210 Four letters picked without replacement from jcbkkctckcgt. What is prob of sequence kbtj? 1/1980 Three letters picked without replacement from {r: 2, t: 2}. What is prob of sequence rtr? 1/6 Two letters picked without replacement from {s: 2, b: 2, y: 1, q: 1, m: 4, f: 4}. Give prob of sequence qy. 1/182 Three letters picked without replacement from keeeemkeemeekuke. Give prob of sequence kuk. 1/280 Calculate prob of sequence dd when two letters picked without replacement from {n: 2, d: 4, y: 3, b: 1}. 2/15 Three letters picked without replacement from nenvpnnpvennennnaevv. Give prob of sequence vpe. 4/855 Four letters picked without replacement from {i: 2, t: 5, e: 4, h: 2}. Give prob of sequence htit. 2/429 What is prob of sequence wvf when three letters picked without replacement from {j: 4, f: 5, c: 1, v: 1, w: 4}? 2/273 Four letters picked without replacement from fffttefptcftfefpevtv. Give prob of sequence pvct. 1/5814 Three letters picked without replacement from nnnzzznnxzzzz. Give prob of sequence nxn. 5/429 What is prob of sequence ss when two letters picked without replacement from wxwwsssqeexxwwq? 1/35 Calculate prob of sequence qotu when four letters picked without replacement from {z: 1, q: 1, o: 2, b: 1, u: 1, t: 2}. 1/420 Four letters picked without replacement from zhhhhzz. Give prob of sequence zhzh. 3/35 Calculate prob of sequence wt when two letters picked without replacement from ttttttttttwwt. 11/78 Four letters picked without replacement from {d: 7, w: 1, g: 1, t: 2, m: 4}. Give prob of sequence tdtg. 1/2340 Calculate prob of sequence oxy when three letters picked without replacement from ooyxyyo. 3/70 Three letters picked without replacement from {w: 2, r: 4, q: 2, m: 2}. What is prob of sequence qqr? 1/90 What is prob of sequence ibhb when four letters picked without replacement from hbdibhdbdd? 1/420 Calculate prob of sequence et when two letters picked without replacement from {e: 2, t: 6, c: 7}. 2/35 Two letters picked without replacement from {g: 1, n: 1, d: 4, y: 1, r: 4}. Give prob of sequence gd. 2/55 Calculate prob of sequence rz when two letters picked without replacement from rtetcvtvtttvzvtt. 1/240 What is prob of sequence ict when three letters picked without replacement from {i: 2, t: 6, w: 2, j: 3, c: 5}? 5/408 Two letters picked without replacement from {o: 2, v: 1, p: 1, j: 2}. Give prob of sequence ov. 1/15 Calculate prob of sequence bo when two letters picked without replacement from bdewubuwuobeded. 1/70 Two letters picked without replacement from kpakpazppppappaa. Give prob of sequence pz. 1/30 What is prob of sequence kkkk when four letters picked without replacement from kkkkkkkkk? 1 Calculate prob of sequence wx when two letters picked without replacement from xwgwlrlk. 1/28 What is prob of sequence okl when three letters picked without replacement from kolyaylo? 1/84 Two letters picked without replacement from {e: 8, d: 3}. What is prob of sequence dd? 3/55 Calculate prob of sequence wmwi when four letters picked without replacement from mimwywwiii. 1/105 What is prob of seque	{ "pile_set_name": "DM Mathematics" }
9, -3/10, h? -3/10 Let q = 17.9 + -10.8. Let h = q - 7.6. What is the closest to 0 in h, 0, -4? 0 Let s = -4 - -2. Let y = -2.0035 - -0.0035. Which is the nearest to s? (a) -1 (b) -5 (c) y c Let o = 90 - 168. Let l be (33 - 27)(-2)/o. Which is the closest to 1? (a) 3 (b) l (c) -0.1 b Let k = 505 + -504.9. Which is the nearest to 1.8? (a) 1/3 (b) k (c) -0.2 a Let y = 216.2 + -216. Let s = 22.997 - -0.003. What is the closest to y in -5, s, -3? -3 Let p = 7 - 7. Let q(d) = -d3 + 10d*2 + 7. Let x be q(10). Let m be (1 + x/(-3))/((-240)/(-144)). Which is the closest to p? (a) -0.3 (b) -1 (c) m a Let c = -0.01 + -13.99. Let t = 9 + c. Let j be (-6)/(-18) - (-2)/(-6). What is the closest to 1 in -1/4, t, j? j Let y be 299/26-1 - -11. What is the closest to y in 0.3, 18/11, 1? 0.3 Let f be 1680/3325 + 2/(-5). Which is the nearest to -7? (a) f (b) -4 (c) 11 b Let y = 1449 - 1448. Which is the nearest to 0? (a) 3/100 (b) 5 (c) y a Let q(f) = 8f + 192. Let p be q(-24). Let m = 6.8 + -7. Let r = 0.2 - m. What is the nearest to 0 in p, 4, r? p Suppose -2x + 5f = 3f - 2, 2x - 8 = 5f. Let s = -85 - -158. Let j = s + -66. Which is the nearest to x? (a) -0.1 (b) j (c) 0.3 a Let t = 0 + -0.2. Let z = 0.07 + -0.19. Let j = 0.08 - z. Which is the closest to j? (a) 0.4 (b) 5 (c) t a Let k = -27 - -28. Suppose 3x - 10 = -k. Which is the nearest to 1? (a) -0.3 (b) -0.5 (c) x a Let o be ((-6)/(-21))/(15/(-7)). Let i = 45 + -46. Let q = -5.1 + 1.1. Which is the nearest to i? (a) -5 (b) q (c) o c Let t be (6/20)/((-15)/20). Which is the closest to -8? (a) 0.08 (b) -4 (c) t (d) 0.3 b Suppose 3m - 6 = 0, -2m = -139b + 143b - 12. What is the closest to 3/7 in 8, b, 1, -1/2? 1 Let g = -362 - -4704/13. Which is the nearest to 1/2? (a) -3/4 (b) -4 (c) 1/3 (d) g c Let a(w) = w - 1. Let u be a(1). Suppose u = -5d - d. What is the closest to 2/5 in 2, d, -2? d Let h(i) = -10i2 - 82i - 20. Let u be h(-8). Suppose 2 = -3z - 4. Which is the nearest to z? (a) u (b) -2/3 (c) 3 b Let m be ((-3)/2)/(-1(-12)/(-560)). Let h = m - 75. Which is the nearest to 1/2? (a) -1/9 (b) 5 (c) h a Suppose j + 6 = 2. Let h = -160 + 160.2. Let x be (-28)/(-20) + (-2)/5. Which is the nearest to x? (a) h (b) j (c) 1 c Let k = -1.81 + 1.95. Which is the nearest to 1/4? (a) -1/2 (b) -2/3 (c) k c Let v be 78/27 + (-3 - 0). Let h = v - 1/9. What is the closest to 1 in -0.5, -0.1, h? -0.1 Let g = 1925 + -1925. What is the closest to g in -1/6, 3.5, 0.3? -1/6 Let t = 2.273 - 1.873. What is the nearest to -2/7 in -0.4, t, -17/5, -1/3? -1/3 Let x be 1/2 - (-5)/(-8). Let q = -8.417 - -8.717. What is the nearest to -2/3 in q, 2, x? x Let m = 370.6 + -371. What is the nearest to 0 in m, -6, 5, -4? m Let f = 67/3 - 24. Which is the closest to -4/5? (a) -0.1 (b) 3/5 (c) 3 (d) f a Let v = 3 - 3.1. Let j = 9/14 - 1/2. Which is the nearest to v? (a) j (b) 0.5 (c) 5 a Let q be -5 + (-255)/(-50) - (-9)/(-18). Which is the nearest to -12? (a) q (b) 1/2 (c) -3 (d) -3/4 c Let p = -6 + 7. Let f(u) = -u*3 - 42u*2 + 42u - 39. Let h be f(-43). What is the closest to -0.1 in p, 0.1, h? 0.1 Let y = 0 + -1. Let h be 27/1264/24. Let i be y(-1 + 4/h). Which is the closest to -1? (a) 1/5 (b) -1/4 (c) i b Let y be -1 + -1 - (-1 - 2). Let v be 28/(-13) + y + 1. Let s = 4.271 - -1.729. What is the nearest to -0.1 in v, -0.1, s? -0.1 Let v(u) = 16u3 + 2u*2 + 4u + 4. Let i be v(-1). Which is the closest to i? (a) 3 (b) -5 (c) 1 (d) -0.2 b Let x = -2.79 + 4.16. Let f = x - 1.57. Let d = 1 + -0.9. Which is the closest to 1? (a) f (b) 4 (c) d c Let n = 11 - 10.6. Let f = -0.2 + 2.2. Let v = f + -1.7. Which is the closest to -1? (a) -1/7 (b) n (c) v a Let n = 64725070/2107 - 246664261069/7943390. Let r = n + 9621/29. Let k = 24/13 + r. What is the nearest to 1 in 0.5, 0.3, k? 0.5 Let u be 13/65 + 744/(-70). Let h = u - -10. Which is the nearest to -1? (a) 2/3 (b) h (c) 5 b Let a(z) = -2z3 + 6z*2 - 2z + 5. Let w be a(-4). Let u = w - 2131/9. What is the closest to -2 in -0.4, u, 2/13? -0.4 Let v = -1298/9 - -144. What is the closest to -1/7 in -3, v, -1/8? -1/8 Let l = 0.8 - 0.3. Let y = -14 - 55. Let h = -71 - y. Which is the nearest to -0.1? (a) h (b) l (c) 2/3 b Let d = -0.04 - 0.1. Let o = d + 0.24. What is the nearest to o in 0.3, 5, -2/13? 0.3 Let r be 8/(-20) - (-10388)/120. Let q = r + -86. Let j = -0.09 - -4.09. What is the nearest to -0.4 in -2, j, q? q Let s = -592 + 593. Which is the closest to 24/5? (a) 2/11 (b) -2 (c) 2 (d) s c Let o = -14.14 - -13.8. Which is the nearest to 0? (a) -3 (b) 1 (c) o (d) 2/15 d Let w = 74 - 79. What is the closest to 1 in 3, -22, w? 3 Let q = 0.3 - 1.3. Let j be 6-1 + ((-71)/3 - -30). Which is the nearest to q? (a) j (b) -7/5 (c) -5 b Let w = 108.2 - 108. Let n = -4 + 9. What is the closest to 2/3 in -1.4, n, w? w Let y = 59/60 - 11/15. Which is the nearest to y? (a) 3/4 (b) -3/2 (c) -15 (d) 0.1 d Let u = -248 - -248.03. What is the closest to -2 in 5, -1, u? -1 Suppose 5z + 4r - 66 = 0, 3z - 3r = 2z + 17. Let i = z + -10. Let u = -41/48 - -3/16. Which is the closest to -1? (a) i (b) -3 (c) u c Suppose 4 = -3j + 16. Which is the closest to -1/4? (a) -1 (b) j (c) -48 a Let r(x) = -x2 + 12x - 8. Let v be r(11). Let q = 420 + -420.3. Which is the closest to -2/13? (a) q (b) v (c) -1 a Let v = 948 + -947.8. Let z = 6.4 + -1.4. What is the nearest to z in 1/7, 0, v? v Suppose 148 = 6b + 172. What is the nearest to -4.5 in b, 0.2, 3? b Let z = -2 + 2.5. Let p = -155 + 148.7. Let g = p - -1.3. What is the nearest to -1/3 in g, z, 0.3? 0.3 Let i = -35.1 - -35. Let y be (-2)/(-10) - 6/(-120). Which is the closest to i? (a) y (b) 1 (c) -2/9 c Suppose -3s - 12 = 0, s = 2v - 3s - 26. Let j = -69 - -69. Let m = v + j. Which is the nearest to 0? (a) -1/2 (b) m (c) -4 a Let l = 92 - 64. Let x = l - 28. What is the closest to x in 0, -3, -5? 0 Let g(h) = -h*2 + 6h + 4. Let x be g(6). Let y = -1.22 - -1.22. Let t = 49/2 - 24. Which is the closest to t? (a) y (b) -2 (c) x a Suppose 0 = 4s + 2 - 22, 115 = 3y + 2s. Suppose yj + 3 = 32j. What is the closest to j in 0.3, 1/2, -5? 0.3 Let b(w) = -w2 - w2 - w + 4w*2 + 1 - 2. Let a be b(2). Let t = 115 - 802/7. What is the closest to 2/9 in t, -3, a? t Let r = 547/3 - 184. Let w = 793 + -792. Which is the nearest to w? (a) r (b) 0.4 (c) 1 c Let t = 52 + -48. Let l be -1 + (1 - (-3)/2). Let j = 22 + -22. What is the nearest to l in 2, t, j? 2 Let h = -0.2 + 4.2. Let v = -2.312 + 3.312. Which is the closest to v? (a) -0.1 (b) -0.5 (c) h a Let j be 106/(-22) - (-15 - -21 - 11). Which is the nearest to 31? (a) 2/7 (b) -0.2 (c) j a Let u = -594.9 - -651. Let g = u - 53.07. Let f = g + -0.03. Which is the closest to 0? (a) -5 (b) -0.1 (c) f b Suppose -5p + 25 = 5v, -4p + 4v + 20 = -v. Which is the nearest to 5? (a) 2/3 (b) p (c) 4 b Let m = -1070 + 1067. What is the nearest to 0.1 in 1, -2, 1/2, m? 1/2 Suppose 6205n - 6188n = -85. Which is the closest to 0? (a) -13 (b) 3/5 (c) n (d) -1 b Let f = -5.3 + 5. Suppose 0y = -y - 35. Let h be y/(-10) + 3/2. Which is the nearest to 2/5? (a) h (b) -1 (c) f c Suppose 3m = u - 24, 5u - m + 0m - 64 = 0. Let k be (3/u)/((-49)/(-112)). What is the closest to 3/5 in 2, 1, k? k Let x(l) = -l3 + 5l*2 + 5. Let f be x(5). Suppose 8k = fk + 15. Let d = 141 - 142. Which is the nearest to -0.1? (a) k (b) d (c) 3 b Let u be 4/(8/6) + (-17)/6. Which is the closest to 0? (a) -0.11 (b) u (c) 0.3 a Let a = 2.9 + -2.5. Suppose -7 - 3 = -5x. What is the nearest to -1 in x, a, -1/2? -1/2 Let u = 3.52 + -4.52. Let k = -8 - -9. What is the nearest to k in 2, u, -2? 2 Let r = 1380 - 1379.9. Let d = 0.1 - 0.1. Which is the closest to 2/3? (a) r (b) 2 (c) d a Let f be 190/14 - 12/(-28). Suppose -2r + d - f = -d, -4r + 3*d - 23 = 0. What is the nearest to 2 in 3, -0.1, r? 3 Let y = 769 - 770. Which is the nearest to 0.34? (a) y (b) -0.2 (c) 0 c Let o = 0.149 + -18.149. Let t = 51 - 34. Let v = t + o. Which is the nearest to v? (a) -1 (b) -0.3 (c) 0 a Let h = 360.5 - 363. What is the closest to h in 5, -3, -0.3? -3 Let g = 3 +	{ "pile_set_name": "DM Mathematics" }
7 -12546 divided by 18 -697 Divide -52458 by 44. -26229/22 Calculate -1134216 divided by 356. -3186 Divide 3 by 678929. 3/678929 Calculate -885317 divided by 5. -885317/5 -3 divided by -149819 3/149819 Calculate 110 divided by -1062. -55/531 Calculate -47499 divided by -47499. 1 4 divided by -79285 -4/79285 -4043472 divided by -4 1010868 Divide -878886 by -2826. 311 14697 divided by -69 -213 Calculate 1 divided by -587. -1/587 53 divided by -61076 -53/61076 -22 divided by -347 22/347 -3530956 divided by -11 320996 Calculate 1376178 divided by -37. -37194 What is 117695 divided by -5? -23539 Calculate 4704 divided by -7. -672 1 divided by -6504 -1/6504 Divide -29 by 6012. -29/6012 Divide 2 by -185023. -2/185023 Calculate -20125 divided by 35. -575 Calculate 1 divided by 4763. 1/4763 What is -11 divided by 242387? -11/242387 5130450 divided by -325 -15786 Calculate -4 divided by 261251. -4/261251 Divide -153 by -1492. 153/1492 What is 96292 divided by -6? -48146/3 Divide -6083 by -7. 869 Divide -4 by 13140. -1/3285 -1 divided by -168083 1/168083 Divide 188905 by -188905. -1 Divide 1700 by -7. -1700/7 Calculate -4907 divided by 1. -4907 0 divided by -58734 0 What is -4432814 divided by -31? 142994 941201 divided by -2 -941201/2 -1002924 divided by 4286 -234 Divide -108299 by 1. -108299 Calculate -32984 divided by 14. -2356 Divide -95 by -109. 95/109 1 divided by 10437 1/10437 Calculate 2095 divided by 8. 2095/8 What is -20 divided by 12014? -10/6007 Calculate 126 divided by -737. -126/737 What is 63504 divided by 31752? 2 -1424375 divided by -284875 5 Divide 0 by -182757. 0 Divide -703875 by 25. -28155 Calculate 174177 divided by 9. 19353 Calculate -66 divided by 12. -11/2 Divide -5024 by 11. -5024/11 Calculate 11475 divided by 2295. 5 Divide -15696 by -7848. 2 Divide 75355 by -2153. -35 What is 1453628 divided by 363407? 4 Calculate 20916 divided by 581. 36 What is -17442 divided by 3? -5814 7255761 divided by 3 2418587 Calculate 29699 divided by 29699. 1 Divide -109384 by 452. -242 Divide 21 by 45. 7/15 Divide 0 by -19443. 0 What is 1323653 divided by -18643? -71 Calculate 1327 divided by 6. 1327/6 Divide -19278 by -6. 3213 What is -23212 divided by 107? -23212/107 330050 divided by 230 1435 Calculate 10993 divided by -1. -10993 Divide -254560 by 10. -25456 Calculate 9118890 divided by -1823778. -5 What is 0 divided by -157066? 0 Divide -313187 by 7. -44741 Divide 0 by 168460. 0 Divide -3 by 4199. -3/4199 -8781 divided by -47 8781/47 115245 divided by -23049 -5 What is 4 divided by -16368? -1/4092 Calculate 1645526 divided by 2. 822763 57 divided by 1762 57/1762 What is -4 divided by -11915? 4/11915 Calculate -400244 divided by 26. -15394 Calculate -79 divided by -3751. 79/3751 -18 divided by -12281 18/12281 Calculate -830574 divided by -54. 15381 What is 860 divided by -602? -10/7 -2299741 divided by 121039 -19 Calculate -279456 divided by 32. -8733 Calculate -11 divided by 9208. -11/9208 70 divided by 191 70/191 -626575 divided by 5 -125315 What is 115903 divided by 5? 115903/5 What is 132194 divided by -314? -421 What is 444620 divided by -188? -2365 What is -2 divided by 165531? -2/165531 What is -919 divided by 1? -919 Divide 2 by -3651. -2/3651 Divide -483208 by 10982. -44 Calculate 240374 divided by -2. -120187 Calculate 152192 divided by -164. -928 Calculate 129884 divided by 64942. 2 What is -1683576 divided by -1396? 1206 What is -382430 divided by -4? 191215/2 -3271352 divided by -2 1635676 -71195 divided by 5 -14239 -4405726 divided by 2 -2202863 35691 divided by -1 -35691 2283 divided by -22 -2283/22 Calculate 1839950 divided by 14. 131425 What is 239 divided by 1238? 239/1238 Calculate 1814 divided by 82. 907/41 What is 66624 divided by -22208? -3 Calculate -36197 divided by -2. 36197/2 Divide 75542 by 214. 353 Calculate -902 divided by 175. -902/175 Divide 6077 by -351. -6077/351 Divide 13138 by -29. -13138/29 -228615 divided by 2 -228615/2 Divide -22650 by 2. -11325 Calculate -27340 divided by -5. 5468 313606 divided by 2 156803 Calculate 12634 divided by 59. 12634/59 Divide 804699 by 1687. 477 Calculate -1 divided by -6029. 1/6029 Calculate 43959 divided by 2. 43959/2 Divide 3 by 66087. 1/22029 What is 217124 divided by 14? 108562/7 What is -2 divided by -1545065? 2/1545065 20031 divided by -6677 -3 What is -68622 divided by 6? -11437 What is -324498 divided by 3? -108166 Calculate 6350 divided by -4. -3175/2 Divide -1 by -523479. 1/523479 -16 divided by -290921 16/290921 Divide 754896 by -4. -188724 1 divided by 667346 1/667346 Divide -81535 by 16307. -5 Calculate -915 divided by -5. 183 What is 64 divided by 64199? 64/64199 -22704 divided by 172 -132 Calculate 6 divided by 370. 3/185 -18156 divided by -3 6052 What is 1045 divided by 3? 1045/3 Divide -1267 by -39. 1267/39 What is 406 divided by 40? 203/20 What is -122 divided by -7247? 122/7247 -7091 divided by -1 7091 Divide 130768 by 743. 176 -24719 divided by -7 24719/7 What is 162 divided by 10966? 81/5483 What is 252 divided by -3? -84 What is -761765 divided by 152353? -5 What is -3673360 divided by 734672? -5 Divide -451703 by 4. -451703/4 Divide -1628346 by 1338. -1217 Divide 19760 by 380. 52 What is -2433 divided by 47? -2433/47 Calculate 105 divided by 652. 105/652 What is 13 divided by 26948? 13/26948 -486154 divided by 1 -486154 -4 divided by -41849 4/41849 15 divided by -45463 -15/45463 Divide 1384167 by -461389. -3 -653520 divided by 21784 -30 What is 639 divided by -2078? -639/2078 Calculate 6493 divided by 12. 6493/12 What is 54395 divided by -2? -54395/2 -13 divided by 17355 -1/1335 0 divided by 8468 0 11 divided by 229 11/229 What is 197456 divided by 14104? 14 Divide -6013 by 89. -6013/89 805239 divided by 4709 171 Calculate -162336 divided by 40584. -4 What is -591360 divided by 112? -5280 What is 0 divided by 10820? 0 What is 2703890 divided by 1351945? 2 Divide -28035 by -1869. 15 What is 6708 divided by -3354? -2 Calculate 151 divided by 80. 151/80 What is 500045 divided by 245? 2041 What is 316 divided by -3126? -158/1563 25986 divided by 4 12993/2 96140 divided by 55 1748 Calculate -2 divided by 756482. -1/378241 Divide -4 by 22218. -2/11109 Divide 126846 by 12. 21141/2 Divide -65562 by 98. -669 Calculate 12964 divided by -463. -28 Calculate -90315 divided by 3. -30105 -235180 divided by 47036 -5 -1788750 divided by -10 178875 -11 divided by -56287 1/5117 Calculate -520 divided by -137. 520/137 -2422 divided by -389 2422/389 What is 4918338 divided by 153? 32146 Calculate -1 divided by 329874. -1/329874 What is 168 divided by 490? 12/35 Calculate 2481 divided by 8. 2481/8 What is -1391 divided by 15? -1391/15 -4632480 divided by -5 926496 What is 14 divided by -15749? -14/15749 -2636760 divided by 36120 -73 0 divided by 55 0 Calculate 3 divided by 176305. 3/176305 -8 divided by 227052 -2/56763 Divide -152048 by 344. -442 Divide -1665129 by 555043. -3 What is -3120 divided by -521? 3120/521 -413015 divided by 82603 -5 Divide -2602168 by -650542. 4 What is -575610 divided by -3? 191870 What is -41790 divided by 35? -1194 Divide 133740 by 90. 1486 Calculate 507130 divided by -5. -101426 Calculate 8366 divided by -178. -47 What is -198488 divided by -24811? 8 What is 53655 divided by -511? -105 Calculate 2739200 divided by 80. 34240 What is -19746 divided by 72? -1097/4 What is 700300 divided by 140060? 5 What is -11 divided by -127349? 11/127349 204112 divided by -2 -102056 What is 220072 divided by -4? -55018 Divide 118 by 14390. 59/7195 Divide -800354 by 400177. -2 -3232490 divided by -323249 10 Divide -5 by 34951. -5/34951 Divide 3 by -204680. -3/204680 Calculate 75359 divided by -4. -75359/4 Divide -63755 by -3. 63755/3 What is -4 divided by -228467? 4/228467 Divide 98841 by -3. -32947 Divide -5 by -18902. 5/18902 -7781298 divided by 6 -1296883 341160 divided by 12 28430 What is -436140 divided by -87228? 5 Calculate 34216 divided by 28. 1222 What is -27 divided by -10734? 9/3578 What is 33 divided by -600? -11/200 Calculate 254796 divided by -1249. -204 Divide 69930 by 222. 315 -432 divided by -25 432/25 -31116 divided by 4 -7779 Calculate -8738 divided by -174. 4369/87 -3 divided by 13455 -1/4485 Calculate 752915 divided by 2. 752915/2 What is	{ "pile_set_name": "DM Mathematics" }
b4 - -10? 3b30c4 In base 5, what is 10 + -113020434? -113020424 In base 5, what is 40401 + 2422204? 3013110 In base 11, what is 391 + 236858? 237139 In base 6, what is 31402004415 - -3? 31402004422 In base 13, what is 2 - 44bb23c? -44bb23a In base 9, what is 4057 - -1453? 5521 In base 11, what is 5806 + 395? 60a0 In base 9, what is -816663 + -86? -816760 In base 13, what is 23 + -3254238? -3254215 In base 14, what is 52 + -13658cc? -136587a In base 14, what is -7a57ca6 + -3? -7a57ca9 In base 13, what is 929173a + 8? 9291745 In base 8, what is 5 - 216553365? -216553360 In base 6, what is 14120512 - -112? 14121024 In base 14, what is 97bd2 - -10? 97c02 In base 15, what is -b + -1be7e? -1be8a In base 13, what is 3c5c8969 - -5? 3c5c8971 In base 3, what is -1201002 + -1001222111210? -1002001012212 In base 2, what is -100000100 - -11010101001011? 11010001000111 In base 7, what is -13553 - 51624? -65510 In base 16, what is 504c70 - -e? 504c7e In base 9, what is -4 - -166541240? 166541235 In base 9, what is -16436 - -25325? 7778 In base 14, what is -463564 - 56? -4635ba In base 11, what is -8108 + -1789? -9896 In base 3, what is -20022112 - 1121100? -21220212 In base 6, what is 11230 + 1030325? 1041555 In base 9, what is -231453 + -153? -231616 In base 14, what is 4042 + 61c? 4660 In base 2, what is 11000 - 1001001010001010010? -1001001010000111010 In base 6, what is 13050 - 51253? -34203 In base 11, what is 65840a - 29? 658391 In base 3, what is -12110012021 - 120012? -12110202110 In base 9, what is -60 + 1081165? 1081105 In base 8, what is -114 + -120762? -121076 In base 9, what is -2777673 + -14? -2777687 In base 8, what is -200 + 40417? 40217 In base 11, what is -70874 + 652? -70222 In base 9, what is -66146 + 62? -66074 In base 9, what is -5 + -10288871? -10288876 In base 16, what is -162a9 + -2? -162ab In base 14, what is 5 - -b7676b? b76772 In base 5, what is -222 + -4442244121? -4442244343 In base 10, what is -2578 + -1446? -4024 In base 9, what is 18518083 - 1? 18518082 In base 4, what is -223332 + 30133? -133133 In base 15, what is 6ba1 - -7160? dd11 In base 9, what is 547 - -16110? 16657 In base 16, what is -30720 - -4b? -306d5 In base 12, what is 724909 + 26? 724933 In base 15, what is 117 - 48d4? -47bc In base 5, what is 1341140 - 10322? 1330313 In base 13, what is -8955 - -79a? -8188 In base 11, what is -325 - -6992a? 69605 In base 16, what is -1ee + -2b75e? -2b94c In base 3, what is -11111001 - 1222102200? -2010220201 In base 14, what is -14 - 6799ca? -679a00 In base 6, what is -130435224 + 115? -130435105 In base 11, what is -3 + a578432? a57842a In base 8, what is 255565212 + -3? 255565207 In base 10, what is 541 + -329013? -328472 In base 8, what is 372 - -221772? 222364 In base 16, what is 3a5 + -1a06? -1661 In base 15, what is 9 - 137b0c1? -137b0b7 In base 14, what is -b - 88b441? -88b44c In base 9, what is -163550 - 74? -163634 In base 12, what is -3659 + 132a? -232b In base 2, what is 1010011100 + 101111001001010100010? 101111001010100111110 In base 13, what is 35273839 + 1? 3527383a In base 9, what is 57251776 - -1? 57251777 In base 16, what is 1 + ea23af? ea23b0 In base 11, what is -200 - -28705a? 28695a In base 4, what is 122211312 + -220110? 121331202 In base 14, what is -115b22 + 70? -115a92 In base 6, what is 31451 + 12231? 44122 In base 9, what is -122307461 - -10? -122307451 In base 12, what is 672359 - 21? 672338 In base 6, what is 102 - 1124114? -1124012 In base 13, what is -174c1b9 - -a8? -174c111 In base 13, what is -509a5c1c - 1? -509a5c20 In base 3, what is 12202220 + -11200010? 1002210 In base 9, what is 3635 + -4347? -612 In base 5, what is 1044 - -1142133? 1143232 In base 16, what is -e - 12f578? -12f586 In base 10, what is 13470 + -431? 13039 In base 3, what is -20220222200011000 - -10? -20220222200010220 In base 4, what is 122233002100 - -3? 122233002103 In base 10, what is -57503215 - -11? -57503204 In base 5, what is 1343303244 + -11? 1343303233 In base 10, what is -2707442 - -7? -2707435 In base 13, what is 1650a2 - -103? 1651a5 In base 10, what is 20386439 - 4? 20386435 In base 13, what is 571c98 + -5c? 571c39 In base 16, what is -4bc93e + ea? -4bc854 In base 5, what is -2410 - 44103422? -44111332 In base 16, what is 1 + -1830? -182f In base 3, what is 11020012 - 12001100100? -11220010011 In base 9, what is -4 - -75282031? 75282026 In base 16, what is -b - -107bd9? 107bce In base 6, what is 3020433131 + -2? 3020433125 In base 8, what is -175043 - -101? -174742 In base 10, what is 55 - 7894? -7839 In base 10, what is -13894 - 1590? -15484 In base 16, what is -1b367 - -a1? -1b2c6 In base 10, what is 879053 - 78? 878975 In base 12, what is 258258 - 21? 258237 In base 10, what is 16 - 555784? -555768 In base 16, what is 2f2bf - -1e5? 2f4a4 In base 11, what is 34a1 - 25501? -22010 In base 8, what is 1 + 75115434? 75115435 In base 8, what is 12430 + 112? 12542 In base 4, what is 2223 - 333303031? -333300202 In base 13, what is -147 - 12bb3? -1302a In base 16, what is -3 + -1ed3a31? -1ed3a34 In base 14, what is -7 + 4b719? 4b712 In base 10, what is -14636296 - 21? -14636317 In base 13, what is -192 - -1c210? 1c04b In base 7, what is -6122 + -122? -6244 In base 14, what is 25009b - 10? 25008b In base 5, what is 411003332332 + 2? 411003332334 In base 10, what is 1693570903 - -1? 1693570904 In base 3, what is 0 - -20122122012220? 20122122012220 In base 9, what is 120 + 42666? 42786 In base 3, what is -12 - -1020111221102211? 1020111221102122 In base 12, what is 1 + 9503848? 9503849 In base 3, what is -11010010112112010 + 2? -11010010112112001 In base 7, what is -5 + -35360036? -35360044 In base 15, what is -6 - a94b? -a952 In base 10, what is 570807212 + -1? 570807211 In base 7, what is -50 + -4025256? -4025336 In base 16, what is -37bc63c + c? -37bc630 In base 15, what is -10e6d778 - -4? -10e6d774 In base 15, what is -d8eb - 0? -d8eb In base 4, what is 11 - -1320230213? 1320230230 In base 15, what is 3 - 38b971? -38b96d In base 9, what is 3 - 1520150? -1520146 In base 6, what is 344453013 + -101? 344452512 In base 6, what is 22352 - -124152? 150544 In base 3, what is 11000221102210010 + -12? 11000221102202221 In base 13, what is 2069b4 - -8? 2069bc In base 13, what is b368 + -13943? -55a8 In base 7, what is -15246 + 21016? 2440 In base 5, what is -20 - 123014124034? -123014124104 In base 10, what is -5 + 2370373? 2370368 In base 7, what is 14 - 1012636142? -1012636125 In base 12, what is 3 - -2b8495? 2b8498 In base 15, what is 0 + 7467dbb? 7467dbb In base 12, what is -2 + bb5bb86? bb5bb84 In base 2, what is 101 - 1100111001111100101101100100? -1100111001111100101101011111 In base 4, what is -11 - 311130101? -311130112 In base 7, what is -414613 + 23531? -361052 In base 12, what is -538a5b + -38? -538a97 In base 13, what is -1774 + -438? -1bac In base 12, what is 2 + -845840? -84583a In base 7, what is 502551604 - -12? 502551616 In base 7, what is 426301254 + 4? 426301261 In base 5, what is -230204210340 + -1? -230204210341 In base 7, what is -2 + 3140626? 3140624 In base 16, what is 1174 + 123dc? 13550 In base 6, what is 515 + 1120? 2035 In base 7, what is 136 - -14130331? 14130500 In base 7, what is -10 + 246536133? 246536123 In base 15, what is 45d + 193de? 1984c In base 8, what is -5317357125 - -1? -5317357124 In base 12, what is -36 + 2358325? 23582ab In base 14, what is 1861 - -8898? a319 In base 5, what is -13411013 - -2104? -13403404 In base 10, what is -97 - -1447915? 1447818 In base 2, what is 11110011101 - -100010100011111010? 100011000010010111 In base 11, what is 702 + -63a1? -579a In base 16, what is -45d0aa - 5? -45d0af In base 2, what is -1000 + -1010010000001100111011? -1010010000001101000011 In base 12, what is b9 - 3546? -3449 In base 5, what is 10202220 - -1441? 10204211 In base 13, what is -12a + 11640? 11513 In base 8, what is 102266 - -7373? 111661 In base 5, what is -2 - 410312302? -410312304 In base 12, what is 1 - -7622a3? 7622a4 In base 5, what is -2 + -123024422? -123024424 In base 12, what is -1 + -9aa95ba? -9aa95bb In base 15, what is -3 + 57873d? 57873a In base 14, what is d72 + 10228? 1119a In base 10, what is 169 - 418220? -418051 In base 15, what is 2 + -3831? -382e In base 4, w	{ "pile_set_name": "DM Mathematics" }
2645r3 + 2970r*2 = 0. What is r? -54, -11, 0, 1 Factor 3h*2 - 117h - 120. 3(h - 40)(h + 1) Factor s*3/4 - 15s*2/4 + 75s/4 - 125/4. (s - 5)*3/4 What is g in 5g*3 + 50g*2 + 145g + 100 = 0? -5, -4, -1 Factor -2i2 + 2630i - 2628. -2(i - 1314)(i - 1) Factor -9b5 - 12b*4. -3b*4(3b + 4) Let 3n*3/4 + 729n*2/2 + 45360n + 259200 = 0. Calculate n. -240, -6 Factor -3q2 + 147q - 144. -3(q - 48)(q - 1) Factor 198y3/5 - 62y*2/5 + 4y/5. 2y(9y - 2)(11y - 1)/5 Factor 2o*2/11 + 2o/11. 2o(o + 1)/11 Suppose -4j3/5 + 8j*2 = 0. Calculate j. 0, 10 Factor 9b*4 + 2b*3 - 36b*2 - 8b. b(b - 2)(b + 2)(9b + 2) Factor 5h4 - 20h*3 - 10h*2 + 60h + 45. 5(h - 3)2(h + 1)2 Determine i, given that -i3/5 + 162i2/5 - 6561i/5 = 0. 0, 81 Find s such that 7986s5 + 22506s*4 + 11704s*3 - 23776s*2/9 + 512s/3 - 32/9 = 0. -2, -1, 2/33 Find m, given that m*2 - 98m + 1377 = 0. 17, 81 Factor -f*5/10 + 27f*4/10 - 219f*3/10 + 101f*2/2 - 228f/5 + 72/5. -(f - 12)*2(f - 1)*3/10 Factor -2c*5/9 - 50c*4/9 - 176c*3/9 - 56c*2/3. -2c*2(c + 2)*2(c + 21)/9 Factor -10l3 + 4l*2 + 10l - 4. -2(l - 1)(l + 1)(5l - 2) Factor -5h5/2 + 40h*4 + 175h*3/2 + 45h*2. -5h*2(h - 18)(h + 1)2/2 Factor -4w*2/9 + 940w/9. -4w(w - 235)/9 What is c in -2c2 + 28c - 48 = 0? 2, 12 Factor 4q2 + 1548q. 4q(q + 387) Factor 2n4/17 - 416n*3/17 + 22044n*2/17 - 42848n/17 + 21218/17. 2(n - 103)2(n - 1)*2/17 Factor -2h*3/3 - 6h*2 + 8h + 40/3. -2(h - 2)(h + 1)(h + 10)/3 Factor 3v*5 - 9v*4 + 6v*3. 3v*3(v - 2)(v - 1) Factor -2i*2/7 + 286i/7 + 288/7. -2(i - 144)(i + 1)/7 Factor 3x5 + 3x*4 - 3x*3 - 3x*2. 3x*2(x - 1)(x + 1)2 Suppose -n4/2 - 17n*3/2 - 25n*2/2 + 81n/2 + 45 = 0. What is n? -15, -3, -1, 2 Determine d, given that d*5 + 3d*4 - 15d*3 + 17d*2 - 6d = 0. -6, 0, 1 Suppose 3n2 - 1506n + 189003 = 0. Calculate n. 251 Factor -120x3 + 415x*2 - 220x - 260. -5(x - 2)2(24x + 13) Solve -x4/4 + 4x*3 + 993x*2/4 + 1855x - 2107 = 0. -14, 1, 43 Factor 2g2/7 - 6248g/7 + 4879688/7. 2(g - 1562)2/7 Determine l, given that -3l*4 - 111l*3 - 585l*2 - 837l = 0. -31, -3, 0 Factor 2i5 - 13i*4 - 61i*3 - 85i*2 - 49i - 10. (i - 10)(i + 1)3(2i + 1) Determine w, given that 7w*5 + 5w*4 - 9w*3 - 5w*2 + 2w = 0. -1, 0, 2/7, 1 Suppose 3z5/4 - 873z*4/4 + 84681z*3/4 - 2738019z*2/4 = 0. What is z? 0, 97 Factor -3p*2/2 + 555p/2. -3p(p - 185)/2 Factor -2d3/9 - 28d*2 - 982d/9 - 244/3. -2(d + 1)(d + 3)(d + 122)/9 What is j in -j3/2 + 15j*2/2 - 27j/2 + 13/2 = 0? 1, 13 Find z such that -17z5/3 + 56z*4 - 133z*3/3 - 6z*2 = 0. -2/17, 0, 1, 9 Factor -2c*2/5 + 6c/5. -2c(c - 3)/5 Factor -2w2/19 + 3412w/19 - 1455218/19. -2(w - 853)2/19 Factor -4c*3 + 32c*2 + 4c - 32. -4(c - 8)(c - 1)(c + 1) Solve 4p*3/7 + 18p*2/7 = 0. -9/2, 0 Factor 5s*4 - 60s*2 + 80s. 5s(s - 2)*2(s + 4) Factor -4a2 - 84a + 288. -4(a - 3)(a + 24) What is j in 2j4/15 - 1346j*3/15 + 448j2/5 = 0? 0, 1, 672 Find v such that -v5 + 6v4 - 6v*3 - 16v*2 + 15v + 18 = 0. -1, 2, 3 Factor -2k5/11 + 14k*4/11 - 20k*3/11. -2k*3(k - 5)(k - 2)/11 Suppose -k5/2 + 5k*4 + 83k*3/2 + 98k*2 + 94k + 32 = 0. Calculate k. -2, -1, 16 Let 4j2/7 - 63480j/7 + 251856900/7 = 0. What is j? 7935 Determine s so that 7s4 - 108s*3 + 570s*2 - 1100s + 375 = 0. 3/7, 5 Solve s*3/9 - 7s*2/9 + 2s/3 = 0. 0, 1, 6 Factor -2g4/7 - 4g*3/7 + 26g*2/7 - 20g/7. -2g(g - 2)(g - 1)(g + 5)/7 Solve w*2/3 - 4w/3 - 4 = 0. -2, 6 Factor 4d5 + 16d*4 - 56d*2 - 68d - 24. 4(d - 2)(d + 1)*3(d + 3) Factor 5h2 + 75h - 170. 5(h - 2)(h + 17) Let 7q3/6 - q2/3 = 0. What is q? 0, 2/7 Determine g so that 2g*3 + 3196g*2/5 + 1646g - 3804/5 = 0. -317, -3, 2/5 Let 4r3/9 - 52r*2/9 + 208r/9 - 80/3 = 0. Calculate r. 2, 5, 6 What is d in 3d5 - 1308d*4 + 189219d*3 - 8954034d*2 - 18480972d - 9336408 = 0? -1, 146 Determine h, given that 2h5 + 8h*4 - 40h*3 - 132h*2 + 198h + 540 = 0. -5, -3, -2, 3 Suppose 2j4/13 - 12j*3/13 - 22j*2/13 + 48j/13 + 56/13 = 0. What is j? -2, -1, 2, 7 Solve 2o2 - 6472o - 12952 = 0 for o. -2, 3238 Factor 2z5 + 476z*4 + 28322z*3. 2z*3(z + 119)*2 Suppose -5r*4 + 90r*3 + 95r*2 = 0. What is r? -1, 0, 19 Solve 2u*4/19 - 20u*3/19 + 54u*2/19 - 36u/19 = 0 for u. 0, 1, 3, 6 Suppose 950o3/3 - 964o*2/3 + 14o/3 = 0. What is o? 0, 7/475, 1 Let 3q2/2 + 42q - 87/2 = 0. Calculate q. -29, 1 Determine z, given that -3z5/7 + 33z*4/7 + 2091z*3/7 + 15087z*2/7 - 2088z/7 - 2160 = 0. -12, -1, 1, 35 Determine y so that y*2 + 154y + 5929 = 0. -77 Suppose 2w2/9 - 454w/9 - 152/3 = 0. What is w? -1, 228 Solve -9x3 + 921x*2 - 23715x + 7803 = 0. 1/3, 51 Determine a, given that -a*3 + 121a*2 - 3339a - 19845 = 0. -5, 63 Factor -15v3 - 234v*2 - 567v. -3v(v + 3)(5v + 63) Let 2u3 - 42u*2 - 140u - 96 = 0. Calculate u. -2, -1, 24 Factor h*2/3 - 4h/3 - 7. (h - 7)(h + 3)/3 Find s such that 2s*5/15 + 8s*4/5 - 8s*3/5 - 1408s*2/15 - 2176s/5 - 3072/5 = 0. -6, -4, 8 Solve -3p4/4 - 5p3/4 - p2/2 = 0 for p. -1, -2/3, 0 Solve -d*5/3 - 2d*4 + 49d*3/3 - 70d*2/3 - 12d + 88/3 = 0. -11, -1, 2 Factor 2b2 - 350b + 692. 2(b - 173)(b - 2) Solve -3o4 + 3o*3 + 3o*2 - 3o = 0. -1, 0, 1 Factor -3s2/7 + 2274s/7 - 430923/7. -3(s - 379)2/7 Factor 10u*4 + 475u*3 + 230u*2 - 235u. 5u(u + 1)(u + 47)(2u - 1) Solve -t4/4 + 19t*3/2 + 463t*2/4 + 202t + 96 = 0. -8, -1, 48 Find n such that -4n4/3 + 8n*3 + 20n*2 + 32n/3 = 0. -1, 0, 8 Find x such that -3x2 - 552x - 25392 = 0. -92 Factor p*2 + 330p + 27225. (p + 165)*2 Factor 3t*2 - 207t + 402. 3(t - 67)(t - 2) Determine a, given that -4a3/3 - 60a*2 - 512a/3 - 112 = 0. -42, -2, -1 Solve h*5/3 + 7h*4/3 + 7h*3/3 - 23h*2/3 - 8h/3 + 16/3 = 0. -4, -1, 1 Solve 2l5/5 + 66l*4/5 + 46l*3/5 - 2282l*2/5 + 4152l/5 - 1984/5 = 0. -31, -8, 1, 4 Determine g so that 4g5 + 12g*4 - 20g*3 - 60g*2 + 16g + 48 = 0. -3, -2, -1, 1, 2 Suppose -k*3/5 - 183k*2/5 + 186k/5 + 368/5 = 0. Calculate k. -184, -1, 2 Factor -4u4 - 24u*3 + 484u*2 + 504u. -4u(u - 9)(u + 1)(u + 14) Determine a so that -33a3 + 885a*2 + 2076a + 348 = 0. -2, -2/11, 29 Suppose -2o4/15 - 8o*3/3 - 106o*2/15 + 628o/15 - 32 = 0. What is o? -15, -8, 1, 2 Find f such that -f*5/7 - 9f*4/7 - 23f*3/7 - 15f*2/7 = 0. -5, -3, -1, 0 What is q in 12q*3 + 291q*2 + 348q + 69 = 0? -23, -1, -1/4 Solve -q*4 - 12q*3 - 51q*2 - 92q - 60 = 0 for q. -5, -3, -2 Determine m so that 15m5 + 20m*4 - 165m*3 - 490m*2 - 480m - 160 = 0. -2, -4/3, -1, 4 Find a such that -a4/6 - a3/6 + a2/6 + a/6 = 0. -1, 0, 1 Suppose i3 + 4i2 - 45i = 0. Calculate i. -9, 0, 5 Find q, given that 14q2 + 934q - 268 = 0. -67, 2/7 Factor c*3/9 + 7c*2/3 - 22c/9. c(c - 1)(c + 22)/9 Suppose -v*5/2 - 67v*4/2 + 71v*3 + 134v*2 - 276v = 0. Calculate v. -69, -2, 0, 2 Let 565x2/7 - 242x - 3/7 = 0. Calculate x. -1/565, 3 Determine t so that 4t3 + 904t*2 - 5548t + 4640 = 0. -232, 1, 5 Determine a, given that -2a4/3 + 32a*3/3 + 76a*2/3 - 208a - 510 = 0. -3, 5, 17 Let 8h4/3 + 10h*3 - 14h*2/3 - 8h = 0. Calculate h. -4, -3/4, 0, 1 Factor -4y2 + 492y + 1512. -4(y - 126)(y + 3) Let w*2/3 - 23w + 134/3 = 0. Calculate w. 2, 67 Determine i so that 5i5 - 15i*4 - 50i*3 = 0. -2, 0, 5 Suppose -2t*3/3 + 44t*2/3 = 0. Calculate t. 0, 22 Let -2f*2/5 + 32f/5 - 126/5 = 0. What is f? 7, 9 Factor -j*4/3 + 3j*3 - 8j*2 + 16j/3. -j(j - 4)2(j - 1)/3 Find t such that 2t4/3 + 8t*3 = 0. -12, 0 Determine p, given that -20p*5 - 1715p*4 + 490p*3 + 5185p*2 + 2140p - 860 = 0. -86, -1, 1/4, 2 Solve -2q3/7 - 2q*2/7 + 10q/7 - 6/7 = 0 for q. -3, 1 Let -3y2/7 - 393y/7 - 372 = 0. What is y? -124, -7 Solve 8s5/5 - 76s*4/5 - 228s*3/5 - 144s*2/5 = 0. -3/2, -1, 0, 12 Factor 4j*2 + 156j. 4j(j + 39) Dete	{ "pile_set_name": "DM Mathematics" }
g*2 + 7g - 1. Let l be f(7). Let v(r) = 9r + 1. Let y be v(l). Let k be (-3 - 46/y) + -2. Which is the closest to 0? (a) k (b) 0.4 (c) 5 b Let t(h) = 2h*3 - 9h*2 + 2h + 6. Let l be t(6). Let k = l + -1132/9. What is the nearest to 2/5 in -0.03, k, -0.4? k Let r be (23/4)/1 - 6. Which is the closest to r? (a) 3 (b) 0.5 (c) 4 b Let v be -10(4 + (51/(-15) - 1)). Which is the nearest to -0.1? (a) -2/7 (b) 0.7 (c) v a Let p = 0.02 + 0.28. Let g = -5 - -4.95. What is the nearest to -2/5 in p, g, 3/8? g Let h be -1 - ((-4)/(-10) - 1). Let a(k) = k3 - 110k*2 + 2k - 216. Let r be a(110). What is the nearest to -1 in 3/5, r, h? h Suppose -s - 36 = 4m, -5s - 10m + 15m - 55 = 0. What is the nearest to 1 in -10, 0, s? 0 Let m be (3/(-81))/((-15)/(-9) - 2). Let g(u) = -u3 - u + 1. Let i be g(0). Which is the closest to i? (a) 0 (b) m (c) 3 b Let h = -425 + 424.6. Which is the closest to -1/4? (a) 0.4 (b) 4/7 (c) -4/3 (d) h d Let u = -116 - -77. Let m = -38 - u. Let z = -2 - -1. Which is the nearest to m? (a) z (b) -5 (c) 1/4 c Let q = 16 - 16.19. Let x = 0.13 - 0.04. Let z = q + x. Which is the closest to z? (a) 0.1 (b) 4 (c) -1/6 c Let f = 3937 + -3936.8. Let y(o) = -o + 2. Let t be y(-3). Which is the closest to -1/4? (a) t (b) f (c) 0 c Let x = -17 - -11. Let l = x + 11. Let j = 2.09 - 3.09. What is the nearest to j in l, -2/11, -5? -2/11 Let r = 175 - 179. Let t = 2.8 + -3. Which is the nearest to 0.6? (a) t (b) r (c) 5 a Let g = 28042/5 + -5627. Let z = -37/2 - g. Which is the nearest to 0.1? (a) 5 (b) z (c) 0.4 b Let i = 1351 - 1359. Which is the nearest to 4? (a) 0.5 (b) i (c) 2 c Let t be 4/16 - (-23)/(-12). Let f = -839 - -839.3. What is the nearest to -6/7 in -4, t, f? t Let y = 4.11 - 4.21. Which is the closest to y? (a) -4 (b) -3 (c) 1 c Let d = -233.7 - -234.1. What is the nearest to 0.05 in 1, d, -2/7? -2/7 Let j(x) = x3 - 9x2 + x - 8. Let v(f) = -f3 - 4f*2 - f + 5. Let o be v(-4). Let q be j(o). What is the nearest to q in 1, -4/9, 0.04? 1 Let s be (-3 + 392/(-4))(5 + -4). Let y = s + 106. What is the nearest to -2 in y, -1/7, 9? -1/7 Let v = 0.67 + -0.67. Which is the closest to -1? (a) -0.1 (b) v (c) -7/11 c Let h be -24/(56/21). Let t = -18 + 16. Let y = -7/25 + 12/25. What is the closest to t in h, -0.1, y? h Let t = 5/12 + 5/12. Let k = 0.237 + 0.063. Suppose 4j + j + 5 = 0. What is the nearest to j in t, k, 1/2? k Let j = -36 + 39. Let g = -6 + 7. Which is the closest to g? (a) j (b) -4 (c) -3 a Let v = -3/31994 + 3255412/239955. Let o = -67/5 + v. Which is the nearest to o? (a) 8 (b) 2/17 (c) 0.2 c Let r = 694/7 + -99. Let k be 9/4 + 3 + -6 + 1. What is the closest to -0.1 in k, 2, r? r Let m = -89 - -88. Let z be 2/8 - 17/(-12). Suppose 2 = -2i + 6. Which is the closest to -0.3? (a) m (b) i (c) z a Let t = 200 - 209. Let y = 2 + -2.2. Which is the closest to -2/5? (a) y (b) t (c) -2/9 c Let y be 0/(18/2) - 1. What is the closest to y in 4, -1, 2.3, 3/5? -1 Let z be 84/(-210) + 24/110. Which is the nearest to 0.1? (a) z (b) -0.3 (c) -38 a Let z = -1837/12 + 153. Let w = -2/203 - -60/203. Which is the closest to z? (a) -1 (b) 4 (c) w c Let q be (-12)/6 + 3 - -1. Which is the nearest to 0.1? (a) 3 (b) 1/2 (c) q b Let g = -194.7 + 193.7. Which is the closest to g? (a) 1/10 (b) -14 (c) -4 (d) -0.04 d Suppose 0 = -3v + 4v - 5. Let i be (-3 - -4) + 1 - v/3. Let d = -117 + 583/5. What is the nearest to i in 3, 5, d? d Let s(o) = -o3 - 34o*2 + 31o - 141. Let i be s(-35). What is the nearest to 1/3 in 3, -2/125, i? -2/125 Let s = -1.4 - -0.4. Let y be 1/(-4) - 60/(-232). Let d = y + -235/348. What is the closest to s in -1, -5, d? -1 Let k(y) = 5y - 261. Let n be k(51). What is the nearest to n in -26, -4, -1/6? -4 Let d = 0.07 - 0.03. Let x = d + 0.36. Let q = -9.2 + 9.5. Which is the nearest to 0? (a) 0.1 (b) q (c) x a Let z = -1565.9 - -1566. Let p(g) = g - 7. Let f be p(5). Let s be (6/16)/((-3)/f). Which is the nearest to s? (a) z (b) 3 (c) 0 a Suppose 0 = 4m - 5l + 180, -2l + 42 = 3m - 4m. Let k be 20/m(-5)/(-21). Which is the nearest to 0? (a) 1 (b) k (c) -9 b Suppose 5i - 16 = 2k - 0, 3i = -3k - 3. Let c = -5 + 54. Let h = c + -49. What is the closest to h in k, 0, 1? 0 Let z be ((-2)/(-35)-10)/(4/14). Let t = -43/42 - -6/7. What is the closest to 0.02 in z, 4, t? t Let s = 9 - 14. Let l be s/4 - 15/(-10). Which is the nearest to -1/4? (a) -3 (b) l (c) 5 b Let o(u) = -u - 6 + 5u - 3u. Let p be o(5). Let m = -0.1 - -0.2. What is the closest to m in -5, 0, p? 0 Let y = -220 - -211. What is the closest to 1/4 in -0.5, 1/9, y? 1/9 Let w = 2.04 - 0.04. Let y = -3 + w. Let k = 6/19 - 43/76. What is the nearest to k in -5/4, y, 5? y Suppose 29m - 30m - 1 = 0. Which is the nearest to m? (a) -4/5 (b) 1/3 (c) 5 a Let c = -15225 + 15224.7. Let n = -2 - -2.1. What is the closest to c in 1/2, -0.5, n? -0.5 Let y be (-5)/15 - 25/(-3). Suppose y = 5n - n. Let w = 25/92 + -12/23. Which is the nearest to w? (a) 5 (b) n (c) 8 b Let n(l) = l3 - 6l*2 + 7l + 7. Let w be n(6). Let q be -1 - (14/w - (-5)/7). Which is the closest to 1/2? (a) q (b) -5 (c) -1/6 c Suppose -h - 3l = -6h + 99, -24 = -2h - 4l. Suppose 10y - 4y = h. Which is the nearest to y? (a) 0.1 (b) -1/8 (c) 0.2 c Let p be (3 - 2) + 3 + -5. Let l be 2/(-28)10/153. What is the nearest to -2 in l, 2, p? p Let k be (-2 - -1) + 1706/(-18). Let d = k - -96. Suppose -724q - 7 = -726q - f, 6q = -5f + 31. What is the nearest to 0.1 in -4, q, d? d Let j be 3 + 6/(-2) + (0 - 0). Suppose 3m + 5p + 1 = j, -15 + 1 = 5m - 4p. What is the nearest to m in 1, -3/2, -3? -3/2 Let l = -2.88 + -0.42. Let t = 1.3 + l. Let g = 4/33 - -6/11. What is the nearest to g in 0.2, -4, t? 0.2 Let w be (4 - 15) + (1 - -1). Let x(g) = -g - 10. Let t be x(0). Let v = t - w. What is the nearest to v in 1/2, 5, -0.2? -0.2 Let o = 290 + -289.9. What is the closest to o in 0.4, 2/13, -2/9? 2/13 Let m = -14 - -12.4. Let q = m + 2. Let p be 3 - 4 - (0 - 1). Which is the closest to -0.1? (a) 5 (b) p (c) q b Let m = -49 - -51. Let x = -47 + 50. Let j = -0.03 + -2.97. What is the closest to 1 in j, m, x? m Let v = 55.03 - 56. Let h = v + 3.97. What is the closest to 0.1 in -4, 3/2, h? 3/2 Let d = -112 + 112.1. Let t = -47.8 - -48. Which is the nearest to d? (a) t (b) -4 (c) -5/6 a Let f = -2.18 - -0.28. Let p = f + 1.5. Let s = -8 + 11. What is the closest to 0 in p, s, 5? p Let u(i) = 3i - 407163. Let f be u(0). Let a = f + 291122097/715. Let p = a - -4/143. What is the nearest to 2 in -1, p, -2? p Let i = -202.7 + 203. Let f = 6.4 - 6. Let w = i - f. Which is the closest to w? (a) 1/4 (b) -1 (c) -0.3 c Let k = 0.165 - 0.065. What is the closest to k in -1, -0.2, -4? -0.2 Let g = 6 + -6.3. Let w = 0.2 - g. Let t = -0.85 + 0.35. What is the closest to -2/9 in t, -3, w? t Let x = 71.04 + -71. Suppose -5r + 10r + 14 = -2f, 4r + 13 = -f. Let h be 1/6(2 + 1). Which is the nearest to h? (a) f (b) x (c) 0.3 c Suppose 4s + 12 = -3p, -3s = 2s - 2p - 8. Let u = -29 - -88/3. Which is the nearest to u? (a) -5 (b) 2/9 (c) s b Let v be 1/(7/(-35)-5)(7 + -12). Let u = -13/253 + -3/23. Which is the nearest to -0.2? (a) v (b) u (c) 1/2 b Let b = -33 - -7. Let x = b - -31. Let u = -2 - 0. What is the nearest to -0.1 in x, 0.3, u? 0.3 Let c be 12/7651/930. What is the closest to 0 in -3, c, 0.02, -8? 0.02 Let i = -0.27 - -0.21. Let h be 230/70 + 6/(-21). What is the nearest to i in 5, h, 3/5? 3/5 Let m be -6 - 3/(-12)23. What is the closest to m in -0.1, 5, 0.2? -0.1 Let g be 14/281/2. Let m = -22 + 284/13. What is the closest to g in -4, 0.2, m? 0.2 Let t = 4 + -14. Let u = -0.39 - 9.71. Let q = t - u. Which is the closest to 1? (a) 2/5 (b) q (c) -1 a Let p = 146 - 146. Let s be 2/11 + (-24)/495. Which is the nearest to p? (a) 2 (b) 4/3 (c) s c Let g = 8 + -4. Let s = -237.7 + 242. Let t = g - s. Which is the nearest to 0? (a) t (b) 0.4 (c) -0.2 c Let h = 7.2 - 8. Let f = -1576.6 - -1577. Suppose 4*a = 33 - 17. What is the nearest to -1 in h, a, f? h Let t = 1 + -1. Let x = 0 - t. Let m = 3176/105 - 458/15. What is the closest to m in 5, x, 0.5	{ "pile_set_name": "DM Mathematics" }
st common multiple of f and l(45)? 36 Suppose 5t - 7669 = -4y, -t - 3y = -1135 - 401. What is the smallest common multiple of 39 and t? 19929 Let d = 43 + -22. Find the common denominator of ((-33)/d)/((-20)/42) and (-55862)/(-7812) - (2/(-56))/((-24)/64). 90 Let l = 1033 + -988. Let v = -18 + 24. What is the lowest common multiple of l and v? 90 Suppose 0 = i - 2y - 3y - 22, -4y + 136 = 4i. Let x be (-66318)/i(-6 + 2338/390). Let s = 378/65 - x. Calculate the common denominator of 57/8 and s. 16 Find the common denominator of -7/432 and ((-2856)/280)/(48/15). 432 Suppose 0 = -56o + 62o + 1224. Let d = o + 213. Let x(s) = s + 10. Calculate the lowest common multiple of d and x(-6). 36 Let l(m) be the third derivative of m5/60 - m4/4 + 4m3/3 - 14m*2 + 3m. What is the lowest common multiple of l(6) and 8? 8 Suppose 0 = -2q - u + 681, -2u - 2u + 1024 = 3q. Calculate the smallest common multiple of (-24)/(-16) + q/8 and 4. 44 Let c = 3/214915 - -3213813/710079160. What is the common denominator of -115/24 and c? 9912 Let g = 3 - 0. Let t(o) = -o*3 + 10o*2 + 28o - 27. Let d be t(12). What is the smallest common multiple of 4/6(d + 18) and g? 78 Let z = -2483 - -15035/6. Let h = -248585/42296 - -12/5287. Find the common denominator of z and h. 24 Let n(x) = -10 - 3 - 14 + 15 - 26x. Calculate the lowest common multiple of 42 and n(-3). 462 Let u(w) = 11w3 + 3w*2 + 11w + 11. Let j be u(-8). Let y = 55237/10 + j. Let n = 56542/9 - 6289. Calculate the common denominator of n and y. 90 Suppose 2l + 0u - 76 = 4u, 4u - 4 = 0. Let h = -9 + 14. Suppose -hc + 115 = r, -2c - 3 = 3r - 36. What is the lowest common multiple of l and c? 120 Find the common denominator of -71/80 and (10 - (-880)/(-48))27/(-1248). 2080 Suppose 15 = 13j - 89. Suppose 14 = -2q + j. Find the common denominator of -63/10 and -338q/540 - (-6)/27. 10 Calculate the least common multiple of 10 and (-321)/6(-5 - (1 - 4)). 1070 Suppose -4m = 4k - 1236, 23k = 21k + 2. Calculate the least common multiple of m and 7. 308 Calculate the lowest common multiple of 80 and (0 + (-125)/(-25))/(1/748). 14960 Let t(x) = 14x + 308. What is the lowest common multiple of t(-16) and 114? 1596 Let y = 30939506111/50 - 618856546. Let i = -66426 - y. Find the common denominator of i and 75/8. 200 Find the common denominator of (255/50 + 3)/((-5)/(-1)) and 61/110 + 11/330-6. 550 Let w(j) = -3j + 3 + 5j + 4j - 5j. Let i be w(-1). What is the common denominator of ((-1)/i)/((-117)/598) and 70/3? 9 Let f(x) = -x*3 - 17x*2 - 19x - 26. What is the least common multiple of f(-16) and (-2 - 95)/(1 + (-6)/4)? 2134 Suppose 2n - 3p - 129 = 0, n + 27 - 95 = -2p. Suppose 0 = 25a - 36a + n. What is the lowest common multiple of a and 110? 330 Let n(h) = -392h - 1512. Calculate the smallest common multiple of 1232 and n(-7). 1232 Let l be ((-113233)/(-3))/((-46)/(-48)-5). Let s = l - -7877. Let h = -3779/1265 - s. Calculate the common denominator of -57/8 and h. 88 Let c = -58 - -68. Suppose 0 = -ci + 79 + 101. What is the lowest common multiple of 1362 and i? 4086 Let z = -10448 - -94010/9. Calculate the common denominator of -53/1197 and z. 1197 Suppose -3c = 4t - 8 - 21, -5c = -3t. Suppose -6u + 238 = -20. Let w = u - 30. What is the smallest common multiple of c and w? 39 Suppose -8y + 106 = -14. Suppose 2636 = yk - 2044. Calculate the lowest common multiple of 20 and k. 1560 Let z = 9973/438 + 14/219. Calculate the common denominator of -25/661 and z. 3966 Find the common denominator of (-286)/(-56) - (-156)/(-312)(-4)/14 and 55/1816. 1816 Let i = 2005 + -27973/14. What is the common denominator of i and -23/46352? 324464 Find the common denominator of -109/42 and 4469/(-2952) + (-7)/56. 252 Calculate the common denominator of 64/77 and 3/(-210)(-2010)/(-156). 4004 Let g be (3443/(-22))/(-4 + -29). Let v = g - 87/11. Calculate the common denominator of -2710/122 and v. 6 Let j(x) = 185x + 7221. What is the smallest common multiple of j(-39) and 13492? 40476 Suppose 6r + 35407 = 12691. Let m = 34133/9 + r. Calculate the common denominator of -61/159 and m. 477 Let p(t) = -3t + 3. Let s(x) = -8x3 + 14x*2 + 6x - 4. Let g be s(2). Suppose 90j - 77j - 156 = g. What is the smallest common multiple of j and p(-5)? 36 Let x = -585 - -315. Find the common denominator of (16/80)/((-2898)/(-3010) - 1) and 2/9 + 1059/x. 40 Let z = -4/21283 - 2575099/766188. What is the common denominator of ((138/504)/(-23) - 8/(-84)) + -5 and z? 36 Suppose 16g - 573 = -509. What is the smallest common multiple of g and 61? 244 Let y = 66/16062975019 - -29950878632950141/5038441248259692. Let x = y - 1/34852. Calculate the common denominator of 2/8 + (-3618)/(-360) + -7 and x. 90 Suppose w + 21 = 25. Suppose -wo - 1342 = -0o + 2s, -3o - s = 1007. What is the common denominator of -23/44 and (-98)/o(3 + 0)? 88 Let k = 5017 + -4945. What is the smallest common multiple of k and 24? 72 Suppose 1047 = 5b - 4l, 5l = 3b - 642 + 6. Let r = b + -183. What is the lowest common multiple of r and 21? 168 Let a = -13/1225 - 2503/1033900. What is the common denominator of 11/1688 and a? 1688 Let o = -353198501/31497456 - 2073/103952. Let x = o + -5/303. Find the common denominator of x and (-161489)/21274 + ((-4)/(-10) - 318/(-30)). 44 Let n(a) = a*2 + 53a - 164. What is the smallest common multiple of 434 and n(3)? 868 Let r = 51458 - 44364. What is the smallest common multiple of r and 16? 56752 Suppose 3n = p - 43, 94 = 3p + n - 65. Let t be 0 + (-6)/(-14) - (-20960)/28. Let x = -729 + t. What is the smallest common multiple of x and p? 260 Suppose 0b = 2b - 16. What is the lowest common multiple of b and (-1 - (-290)/29)/(3/14)? 168 What is the common denominator of 5 + 110/(-11) - 895/(-187) and 42/425? 4675 Let a(o) = 30o3 + 7o*2 - 17o + 4. What is the smallest common multiple of a(2) and 2? 238 Let z = -105 - -84. Let n = z - 2. Let k = 671 + -5413/8. Find the common denominator of n and k. 8 Let p(o) = 9302o2 + 3o - 3. Let c be p(1). Let r be 1 - (c/6981 - (-5)/(-15)). Let b = -172180/20943 - r. Find the common denominator of 19/27 and b. 27 Suppose -4g - 2n = 94, 2g + 30 = 2n - 14. Let w be g/(161/(-30)) + 2/(-7). What is the common denominator of -41/2 and (3/60)/(w/(-10))? 8 What is the common denominator of 190/26 + -14 + 10 and ((-4600)/(-240))/(90/24)? 117 Calculate the least common multiple of 117 and ((3 - -1) + 450/(-72))/(27/(-396)). 1287 Let p = -12258577/378 - -32430. Find the common denominator of 25/21 and p. 378 Suppose -4m - 26 = -3f, -5f - 5m = -2m + 5. What is the least common multiple of 8 and f(-1)/5(-245 + 30)? 344 Let d = -1/54 + -1/2. Calculate the common denominator of d and ((-151)/135)/(10/25)3. 54 Find the common denominator of (-160)/88 + 2 + (-1757)/6336 and -133/360. 2880 Suppose 12 = -2v + v + x, 4v + 4x + 48 = 0. What is the common denominator of 38/15 and 2/v348/(-480)6? 120 Let p(k) = k3 - 4k*2 - 7k + 9. Let b be p(5). Let f be -4 - b/((-1)/(-13)). Suppose 8x + 15 = fx. What is the lowest common multiple of x and 30? 30 Let o = 5363 - 5351. What is the smallest common multiple of o and 591? 2364 Let a be -6 - (-4 + 3 + -3). Calculate the smallest common multiple of 21 and (-25)/5-1 - 2/a. 42 Calculate the common denominator of 3/9 - (-119)/(-28) and -61/204. 204 Suppose 0 = 3h + 5g - 25, 5h - g + 0g + 5 = 0. Let p = h - -2. Suppose -51q + 82 + 326 = 0. Calculate the least common multiple of q and p. 8 Let x = -335 + 341. Calculate the least common multiple of 6/(x/9 + 0) and 31. 279 Suppose -3f = -4f + 30. Let g = -237900 - -237903. What is the least common multiple of g and f? 30 Let g(f) = -3f2 + 153f + 30. Suppose -4r + 43 = -53. Calculate the lowest common multiple of g(51) and r. 120 Let v = -28585321/306 + 93416. Suppose 0 = -5u - 3a + 345, 5a - a - 345 = -5u. Calculate the common denominator of 3(1 - u/(-54)) and v. 306 Suppose 7c = -10c + 13c + 13520. What is the lowest common multiple of 2028 and c? 10140 Let x(q) = 79q - 3944. What is the least common multiple of 6 and x(68)? 1428 Let g = 9637 + -9599. What is the lowest common multiple of g an	{ "pile_set_name": "DM Mathematics" }
Simplify ((s/(s*(1/2)/s)s)*(-26/7)((sss(-3/7))/s)/(s/s1))39 assuming s is positive. s(-2379/7) Simplify (m*8((m(-7)/m)/m)/m)/(m/m(-35)(m/(m(-3/14)/m))/mm) assuming m is positive. m(-563/14) Simplify ((s/(s/s26))/s)/s*(20/3)s(-3/20)/(s(-34/5)s) assuming s is positive. s(1439/60) Simplify (tt(-2))(-11)t/(t/t(-2/9))t/t7 assuming t is positive. t(43/9) Simplify ((x(x/(xx/(x*(2/25)/xx)))/x)/(xx(2/11)))/(x/(xx*(1/4))xx(-15)) assuming x is positive. x(13363/1100) Simplify (pppp4)/(p34p)((p*(-1)/p)/p)/ppp22p assuming p is positive. p*(-8) Simplify ((u/(u/((u/(u/((u/(uu*(5/4)))/u)))/uu)))/uu/(u/(u19/u)))/((uu/(uu25uu))/u(6/7)) assuming u is positive. u(1165/28) Simplify ((m/(m/(m(2/49)/m)))/(mmm(-1/3)))8 assuming m is positive. m(-3088/147) Simplify d6/((dd*(-1/15))/d)d(-1)/(d(2/21)d) assuming d is positive. d(139/35) Simplify (((t(1/3))(-3/20))(-1/35))(-31) assuming t is positive. t(-31/700) Simplify (((gggg*1g)/((g/(g/(g*(1/2)/g)))/gg))/(g*(1/3)g)(1/11))(4/7) assuming g is positive. g*(710/231) Simplify (aaa(-13)a)/((a(aa/(a/(a*6/aa)))/a)/a)(a(3/4))(-1) assuming a is positive. a(-67/4) Simplify (((cc*(2/7)c)/ccc*7c)/(c4)(5/2))(-3/7) assuming c is positive. c(-6/49) Simplify (y(y/(yy/((((y/(y/y*(-4/29)))/y)/y)/y)))/yy/(yy/(y/(yy(-5)))))/((y(2/17)/y)/y)(3/22) assuming y is positive. y(644/5423) Simplify ((a/a*(-11/4))/aa/(a/(a*(-10)/a)))/(a/(a/(a/((aa/(a*(2/37)/a)a)/aa))a)a(-6)) assuming a is positive. a(251/148) Simplify ((g(-2/7))(33/7)(g(-2/5))(-2/107))(-22) assuming g is positive. g(772508/26215) Simplify (n/((n/(nnnn(-3/2)))/n))(-4/29)/(nn*(1/4)/nn)(-7) assuming n is positive. n(975/116) Simplify (hh(2/23))46(hhhh(2/23))/(h/(hh(1/12))) assuming h is positive. h(14675/276) Simplify (mm/(((m(-19)/m)/m)/m))/((mm*(-3/4))/m)(m2)19 assuming m is positive. m*(251/4) Simplify (m/(mmm(1/4)m)m(mm(28/3)/m)/m)/(((m/(m/m(5/11))m)/m)/mm(1/20)/m) assuming m is positive. m(2831/330) Simplify ((w4w)/(ww(4/7)))/(w10/ww)(2/183) assuming w is positive. w(4252/1281) Simplify (m*(-1/16)mm(-2/7))/(m(-12)/mm)36 assuming m is positive. m(48457/112) Simplify w/w*(2/7)w*5/ww*(-7)w*(-1/4)ww assuming w is positive. w(-15/28) Simplify (g(7/2)gg/(g/(gg*(2/3)/gg))g)(-2/63) assuming g is positive. g(-43/189) Simplify ((k22/((k/(k(-1/3)k))/k))(-11/2))(-3/2) assuming k is positive. k187 Simplify (i/(i(2/3)/i)i(-10))/(i(2/11))(-1/11) assuming i is positive. i(-3140/363) Simplify dd*(-4/3)dd(-7)/ddddd(-4/5)(d/(dd/d(-1/6)))/d assuming d is positive. d(-73/10) Simplify (v/(v(-15/7)v)v(5/8))/(v(-3))(-1/3) assuming v is positive. v(99/56) Simplify o(-18)o*(19/4)(oo(-4/7)/o)/o(-15) assuming o is positive. o(33/28) Simplify (z/(z(zz(4/7)z)/zzzz))/(z/z(-12))(z/(((zz(-3/4)z)/z)/z))/(z/(z13/z)) assuming z is positive. z(-135/28) Simplify (((h/(hh(-5/4)))(-8/5))(5/9))(-6/7) assuming h is positive. h(20/21) Simplify (((c/(c/(c/c(5/7))c))/((c/(c(c/(c(-8)c))/c))/c))(-24))(-1/5) assuming c is positive. c*(1224/35) Simplify (kk*(19/3))/(kk/((kkk*(3/5))/k))(k(2/49))14 assuming k is positive. k(788/105) Simplify (k(-2)/(kkk/(k/k*(-1)))k(1/4)/(k/k(-3/4)))37 assuming k is positive. k(-333/2) Simplify (t(1/6))(-4/13)(t/(t/(tt(-1/15))))/(t/t4) assuming t is positive. t(757/195) Simplify ((w/(w/(w/w(3/2))))/w)*(-2/27)w*9((w/(w/((ww(1/6)/ww)/w)ww)ww)/w)/w assuming w is positive. w(131/18) Simplify (u(4/7))(-30)/(u/u(1/3))(-9) assuming u is positive. u(-78/7) Simplify (xx8x)*(-7/3)/(xx(-2/19))38 assuming x is positive. x(-172/3) Simplify (t(-13)/(t6/t))/((t/(t/t(-5)))/(t/t4)) assuming t is positive. t(-16) Simplify (dd/d(-7)d)/dd(-2)d/(d/d*(-17))d(1/27) assuming d is positive. d(-269/27) Simplify (cc(1/22))/(c(8/5)c)c(-13/5)/(cc(cc*(3/2)/c)/cc) assuming c is positive. c(-421/55) Simplify (n(-3))*(-1/6)(n(2/9))(-38) assuming n is positive. n(-143/18) Simplify c/c(-1/9)c(-1/10)/c(c*(-9/2)c)(4/9) assuming c is positive. c(-139/90) Simplify ((ff0)(2/91)/(f/(ff/((ff5)/ff)f)f(-4)))18 assuming f is positive. f(36/91) Simplify (v0)*(3/13)vvvv(-13)vvv/(v3/v) assuming v is positive. v(-9) Simplify ((bb(-14))/b)/b(-2/15)(b/(bb/b(3/11)b))/(bb(-4/7)) assuming b is positive. b(-18506/1155) Simplify ((h(-1))(-7/4)(h/(h/(h*(1/2)h)))(12/5))(-39) assuming h is positive. h(-4173/20) Simplify (j(2/15)j)(-47)j(-1/10)/(j(1/4)j) assuming j is positive. j(-3277/60) Simplify (r12/r(2/3))/(((r(r/r*27)/r)/rr)/r(-1/2)) assuming r is positive. r(221/6) Simplify (n*(-4/9)n*(-4/11))/(nn*(8/7)nnn)5 assuming n is positive. n(-18380/693) Simplify (q(-1/7))(-1/12)/((((q*1q)/q)/qq)/q)(-49) assuming q is positive. q(1/84) Simplify (((lll(-2/25))/l)/l)(1/49)/(llll*(-18)ll/(l/(l/l(10/13))l)l) assuming l is positive. l(219249/15925) Simplify b(-7)b*13bbb(b(-7))(2/71) assuming b is positive. b(625/71) Simplify (((oo2)/o)(-37)o(-2)/o(-3/4))(-20/3) assuming o is positive. o(1505/3) Simplify (z(-13))(-3/2)(zz9zz)(2/11) assuming z is positive. z(477/22) Simplify (j/j(-2))31((j(4/3)/j)/j)/j(3/5) assuming j is positive. j(1376/15) Simplify (((j/(j/(j/j19)))/j(-16))(-2/39))(4/7) assuming j is positive. j(16/273) Simplify (c(-5/9)/(c4/c))(2/19) assuming c is positive. c(-64/171) Simplify (i/((i*(-2/17)iii)/i)ii*(-1/5)i(ii(2/11))(2/9))(-2/117) assuming i is positive. i(-1528/75735) Simplify ((q*(9/4)/qq)/(q/q*(-13)))/((qq/q*(-9))/qqq(q*(-4/11)q)/qq) assuming q is positive. q(-1073/44) Simplify ((m/((m0m)/m))(23/3)/((m/m6)/(m/(m/((m*(2/5)/m)/m))mm)))(8/7) assuming m is positive. m(224/15) Simplify hh/((((hh/h4)/h)/h)/h)h/((hh(-13)h)/hh)h(h(-8))(-18/7) assuming h is positive. h(284/7) Simplify ((a(-2/37)a)/(aa(-6))a(a/(aa/a*5))/a(((a/a*(-1))/a)/a)/aa)(-4) assuming a is positive. a(-1472/37) Simplify (ii(-21)(((i/i(-4/11))/i)/i)/i)(9/11) assuming i is positive. i*(-2142/121) Simplify (cc/(c/((c*(1/8)c)/c))c(-4))/(c(1/6)c(-12)) assuming c is positive. c(215/24) Simplify (k/(k/k*22)kk(-27)/k)/(k13/(kk(-30))) assuming k is positive. k(-47) Simplify t*(-2/11)(t/((t/(tt(-9/5)))/t))/t(t(-2))(-36) assuming t is positive. t(3906/55) Simplify b(-14)b/b(-16)bb(1/9)/(b(-3/16)/b) assuming b is positive. b(763/144) Simplify (t(-2/11)/t(-1/18))/(t/t(-2))19 assuming t is positive. t(-11311/198) Simplify (((k/k(-8)k)/(k/k*13))/((kkk4/kkk)/((k/(k/k(-4)k))/k)))(-2/35) assuming k is positive. k(-18/35) Simplify (k*(-9)k*(2/7)(k(-1/4))35)(2/3) assuming k is positive. k(-163/14) Simplify ((i*(2/11)i5)(6/11))(-29/4) assuming i is positive. i(-4959/242) Simplify (o/(oo0ooo))*(-5/3)(oo/(o/o2)oo)(6/23) assuming o is positive. o(145/23) Simplify ((l/((ll*1)/l)l)/l)*(4/35)l*(-11)l/l(-8) assuming l is positive. l(-2) Simplify ((u*(-1/12)u(u12u)/uu)/(u(-4)u)(-6/25))(-2/43) assuming u is positive. u(-3959/6450) Simplify a(4/11)a(-3/4)(a7)(-12) assuming a is positive. a*(-3713/44) Simplify (b/((bb*(-17))/bb))/(b*8b)((b/b8)/b)/(b(-16)b) assuming b is positive. b15 Simplify (l8/(l*(-7)/ll)(l(-1)l)(7/8))(17/2) assuming l is positive. l(255/2) Simplify x(-1/7)/x(x/(x(1/11)/x))/xx(x/(xx/x(-6)))46 assuming x is positive. x*(-24735/77) Simplify (gg*(1/8)gg)(-15)(gg/(g/g(1/4)g)g)(-1/14) assuming g is positive. g(-1315/28) Simplify rr*(-24)rr16r/(r/r*0)r/r(2/41) assuming r is positive. r(-207/41) Simplify (((q/q(2/5))18)(-3/7))(-2	{ "pile_set_name": "DM Mathematics" }
t(b) = 2408b + 83. Let o(x) = 3612x + 125. Let i(j) = -5o(j) + 8t(j). Is i(11) a prime number? False Suppose 0 = 4l - 3u - 17, -2l + 17 = 4u + 3. Let s be -3 - -2l/10. Is (-2688)/(-18) + s/6 composite? False Let r = 28329 + 56458. Is r a composite number? False Let t(o) = -7o*2 + 19o + 33. Let v be t(-17). Is v/(-5) - (-16)/40 a prime number? True Let p(x) = x - 20. Let k be p(20). Suppose kn = -3n + 42. Suppose -nb + 673 = -13b. Is b composite? False Let x = 13456 + 41373. Is x a composite number? False Let n(d) = -2d3 - 10d*2 - 2d + 4. Let s be n(-4). Is 5((-10)/(-8) + (-15915)/s) composite? True Suppose -47c + 4r = -42c - 739366, -3r = -3c + 443616. Is c a prime number? False Let h(l) = -4 - 2l - 6l + 5 + 13l + 19l*2. Let i(n) = 2n*2 - 9n - 14. Let a be i(-2). Is h(a) composite? False Suppose -2o + 37u = 34u - 205715, 10o - 3u - 1028587 = 0. Is o composite? False Suppose 16613990 - 1590820 = 118i. Is i composite? True Suppose 0 = 7a - 2a. Suppose 14b - 12b - 3828 = a. Let y = b - 553. Is y a composite number? False Let a(n) = n*3 + 14n*2 + 25n + 24. Let i be a(-12). Suppose -i = -7r + 16. Let o(j) = 441j - 25. Is o(r) a prime number? False Let j(s) = 442s3 - 2s*2 + 18s - 2. Let l be j(4). Suppose 3q - 34297 - l = -2b, 0 = 3b - 5q - 93982. Is b composite? False Let v(b) = 4b2 - 14b - 21. Let t(z) = 9z2 - 29z - 42. Let r(o) = -3t(o) + 7v(o). Let p be r(-11). Suppose -574 = -3n + p. Is n a composite number? True Suppose -265a + 174730219 = -194a. Is a composite? False Let r(u) = -20u + 417. Let h be r(0). Let o = h + -218. Is o composite? False Let l(t) = 801t + 1430. Is l(23) a composite number? False Let u be ((-1)/2)/(7/(-6) - -1). Let l be (-8491 - (u - 0)) + 3 - -1. Is ((-3)/6)/(l/4244 - -2) prime? True Suppose 0 = -4o - 16, 46091 = 2h - 5o + 4885. Is h a composite number? False Is 4(645240/32 - (-16 - -9)) a prime number? True Let w(m) = -76m*3 + 2m*2 + 24m - 149. Is w(-15) a prime number? True Let z(y) = -4 + 348y2 - 17 + 16 - y. Is z(6) a prime number? True Suppose 16k = 25k - 189. Is k/(-12)(2 - (-5052)/(-2)) prime? False Suppose -2t + 4b + 27206 = 0, 47t + 5b = 50t - 40806. Is t a composite number? False Suppose 0 = 26i - 22i - 164. Let v = 413 + i. Is v a composite number? True Suppose -n + 364119 = -12n + 32n. Is n prime? False Suppose 115t - 85710 - 917663 = 66t. Is t prime? True Suppose 15q + 102413 - 502166 = 6q. Is q a composite number? False Let f = -3456 + -13630. Let y = 25899 + f. Is y prime? False Let q = -41 + 43. Suppose -23 = -r - 5b, -b + qb = r + 1. Suppose -rm + 7m = 1956. Is m composite? True Let r be -5(12/24)/(2/(-4)). Suppose 0 = -ri - 4q + 26675 - 7354, -i + 3866 = -q. Is i composite? True Let r(k) = 449k2 - 177k + 77. Is r(-9) a composite number? False Let f(y) be the first derivative of 593y3/3 - y + 109. Is f(2) composite? False Let u(k) = -54k*2 - 3k + 3. Let f be u(5). Let m = 2153 + f. Is m composite? True Suppose -9121 = -4k + f + 188, -4k + 9311 = -3f. Is k composite? True Let z(y) = -1383y*3 - 2y*2 - 17y - 53. Is z(-3) composite? False Is (26/78)/((-6)/(-2647926)) a prime number? True Suppose -2v + 17480 = 29948 - 152450. Is v a prime number? True Let t(u) = u2 - 12u + 32. Let n be t(4). Suppose n = -4q + 16q - 45348. Is q prime? True Suppose -3c - 1263 = -3u, 6u - 9u + 5c + 1273 = 0. Let k = 3553 - u. Is k a composite number? False Suppose -32d + 27d + 60 = 0. Suppose -17b + 15b + d = 0. Suppose bt = 7t - 293. Is t a prime number? True Let u be 2140 - ((-4)/26 - 28/(-13)). Suppose 0o - u = 2a + 2o, 8 = 2o. Is 1(-4)/(1 - -3)a composite? True Let d(k) be the third derivative of -13k*4/4 + 2k*3/3 + 5k*2. Let i be d(-5). Suppose 2l = i - 116. Is l prime? True Let d(f) = 7f3 - f2 + 2f. Let y be d(1). Is (-17)/(y/(-14) - 30681/(-53949)) a prime number? False Suppose 26686659 = -200z + 219z. Is z prime? False Suppose 3q - r - 15 + 0 = 0, q - r - 5 = 0. Let b be (4 - 1)(5 - -142). Suppose qk + 5t - 1630 = 0, 5k - 1224 = 2t + b. Is k a prime number? True Let s = 281180 + -121107. Is s composite? False Let r = 477169 - 335870. Is r a composite number? True Let s(c) = -c*2 + 10c + 3. Let i be s(10). Suppose 0 = iu + 48 - 33. Is (-1)/u - 8068/(-10) composite? True Let h be -4 - (8/(-2) + -9). Let y(c) = 4c + 11 - 5 + hc2 - 3 - 3c*2. Is y(4) prime? False Is -4 + (7 - 1484624/(-8)) a prime number? False Suppose 3c = -h + 132, h = -4c + 2h + 176. Suppose 0 = -48x + cx + 2072. Suppose j + 5f - x = 0, -2f - 3f = -5j + 2620. Is j a prime number? True Let g(u) = -u*3 - 17u*2 + 3u - 3. Let y be g(-17). Let f = -50 - y. Suppose -3p - fp = -805. Is p a prime number? False Let r be (-294)/(-30) + -10 + (-101926)/(-5). Suppose -k + 4a + r = 4k, -2k + a + 8151 = 0. Is k composite? False Suppose -78 = -9n + 6n. Is ((-4)/(-1) - 2)52403/n prime? False Let w = 23 + -14. Suppose -u - r + 8182 = 3u, -u - 3r = -2051. Suppose -wl + 8l = -u. Is l prime? False Let q be (-5)/30 - (-17)/(-6). Let u(s) = -4 - 1 - 23s2 + 47s*2. Is u(q) a prime number? True Suppose 2c - 6c + 5o + 52 = 0, 2o - 26 = -c. Suppose 3z = z - 2s + c, z - 14 = 4s. Is (-16)/40 - (-11394)/z prime? False Is (-38)/(-437) - (-149165456)/368 a composite number? False Suppose 0 = -7231v + 7229v + 1835426. Is v a prime number? True Suppose 45566220 = 36m - 8m. Is (2/(-3))/((-23)/(m/10)) composite? True Suppose 35u - 5149625 = -612190. Is u a prime number? True Let m = -66019 - 60718. Is -4 - (0 - 1)/((-13)/m) a composite number? True Suppose 7y - 15579 = -5u + 7759, -2y - 5u + 6693 = 0. Is y a prime number? True Let b be ((153/6)/17)/(3/40). Suppose 3212 + 14328 = bw. Is w prime? True Suppose 0 = -2b - 4x - 26 + 66, 35 = 5b - 3x. Let a(d) = 122d2 + 4d - 55. Is a(b) composite? True Let t(a) = -20166a + 7. Is t(-1) composite? False Suppose 3468 = -4r + 4n, -5r = -n - 0n + 4315. Let j = r - -13467. Is j a prime number? False Let o(j) = -4378j + 33. Let w be o(-3). Suppose 12h - 2253 = w. Is h prime? False Let o = -547358 + 826359. Is o a prime number? True Let i be (-1 + -1)(45/9 + -7). Suppose 26k = ik + 216766. Is k a prime number? False Suppose -392295 = -5g + 130w - 127w, -4g - 4w + 313836 = 0. Is g a composite number? True Suppose -3a = 2d + 3801, -3d = -5d. Let z = a + 4470. Is z a prime number? True Let b(t) = -t3 + 10t*2 + 41t - 201. Let n be b(12). Let l(o) = -5o - 5. Let m be l(-5). Suppose -n = -x + m. Is x prime? True Let d(x) = 6588x + 1055. Is d(8) a composite number? False Let d = 963634 + -363751. Is d a composite number? True Suppose -c = -9c + 136. Suppose 19l = cl - 4. Is (-10890)/(-27) + l/6 prime? False Suppose 4p - 4o - 4216 = -3o, 5p + 4o - 5291 = 0. Suppose -13j = -p - 8604. Is j a prime number? True Let y(m) = -1. Let u(v) = v2 + 10v + 3. Let z(b) = u(b) + 3y(b). Let l be z(-10). Suppose l = 9n - 33 - 1065. Is n a composite number? True Let z = 232 + -228. Is (-202)/((-1)/(65/40z)) prime? False Let t = -9 + 10. Let d be (220/t)/5 - -3. Suppose d = -l + 516. Is l a composite number? True Suppose 4v + 2l - 80194 = 0, 54l - 58l - 40122 = -2v. Is v composite? False Suppose 1500 = l - 216 + 217. Is l prime? True Suppose l - m - 1809 = -3l, l = 2m + 461. Let n(b) = b*3 - 28b*2 - 4b + 2. Let c be n(28). Let j = c + l. Is j a composite number? True Let d be -9759(203/(-21) - -9). Suppose 8665 = -107m + 111m - 3x, -5x + d = 3m. Is m a prime number? False Let k be ((-48)/(-60))/((-1)/(-60)). Suppose 0 = -kq + 47q + 101. Suppose -3c + 373 = x + 80, -c - 2x = -q. Is c prime? True Let h = 19842 + -8729. Is h prime? True Let u(k) = -4k3 + k2. Let n be u(-1). Suppose nb - 35 = -2b. Suppose -2g - 2g - o = -1343, -5o - 1710 = -bg. Is g composite? False Let l(u) = 6801u + 9727. Is l(16) prime? True Let g(f) = 48728f + 5927. Is g(6) prime? False Let j = -49983 - -144541. Is j a prime number? False Suppose 3l + 4n = 17717, -62l + 58l - 3n + 23632 = 0. Is l a composite number? True Let g be 444/(-36) + 15/(-9). Is (-9 - (-195)/21) + (-16278)/g prime? True S	{ "pile_set_name": "DM Mathematics" }
is -1002011011 - -1? -1002011010 In base 9, what is -2865 - 1? -2866 In base 7, what is 145 + -1? 144 In base 3, what is 100200121 + 11? 100200202 In base 4, what is 13 - -23? 102 In base 5, what is 10042 - 11? 10031 In base 6, what is 34333 - 1? 34332 In base 16, what is -14 + 1b2? 19e In base 14, what is 1 + -18d? -18c In base 5, what is 143 + 10200? 10343 In base 9, what is 32 - 24? 7 In base 6, what is 5 - -144? 153 In base 6, what is -4 - 232? -240 In base 2, what is 101 - -110100? 111001 In base 2, what is -1010 + 111? -11 In base 7, what is -30 - -113? 53 In base 14, what is 2 + -1b67? -1b65 In base 9, what is -672 + -14? -686 In base 13, what is 240 - 3? 23a In base 11, what is -423 + -1? -424 In base 15, what is 8 + -b0? -a7 In base 13, what is 1 + 77? 78 In base 16, what is 0 + -3a0? -3a0 In base 10, what is 1 - -350? 351 In base 15, what is -1 - 7? -8 In base 7, what is 106215 + 3? 106221 In base 3, what is 120 - -1211? 2101 In base 14, what is -33c - 0? -33c In base 6, what is -10 + -11122? -11132 In base 7, what is -1 - -342? 341 In base 13, what is b48 + -2? b46 In base 9, what is 2230 + 4? 2234 In base 5, what is -10231 + -2? -10233 In base 8, what is -5 + 41? 34 In base 13, what is -10b - 1? -10c In base 14, what is -229 - -2? -227 In base 2, what is -1000001000 - 10? -1000001010 In base 6, what is 54 + 0? 54 In base 14, what is -6 + 325? 31d In base 9, what is -13 - 280? -303 In base 5, what is -1344 + 2? -1342 In base 7, what is -223 - 0? -223 In base 5, what is 0 - -120? 120 In base 9, what is 17 - 100? -72 In base 5, what is -43 - 4? -102 In base 2, what is 1100000100 - 1011? 1011111001 In base 14, what is -2 + b? 9 In base 8, what is 0 + -152? -152 In base 12, what is 27aa + -4? 27a6 In base 12, what is 9 - -165? 172 In base 10, what is -2 + -1141? -1143 In base 6, what is 1 - 11240? -11235 In base 4, what is -33203 - 0? -33203 In base 7, what is -1566 - 11? -1610 In base 6, what is 43444 - 2? 43442 In base 12, what is 7 + -102? -b7 In base 2, what is -111 - 11101001? -11110000 In base 16, what is 3e + 3a? 78 In base 11, what is 90 + -2? 89 In base 5, what is 10 - -34? 44 In base 13, what is b9 - 75? 44 In base 9, what is -677 + 3? -674 In base 6, what is -53 + 151? 54 In base 4, what is 1101133 - 10? 1101123 In base 15, what is 4 + 115? 119 In base 12, what is 2813 - -4? 2817 In base 16, what is -e + -190? -19e In base 12, what is -46 - 19? -63 In base 15, what is 427 - 7? 420 In base 16, what is -3 + 32? 2f In base 10, what is -5 - 438? -443 In base 11, what is 106 - 0? 106 In base 8, what is -1120 + -1? -1121 In base 16, what is 24 + -9? 1b In base 13, what is -61 - -9? -55 In base 7, what is -21 - -10? -11 In base 14, what is -40 - 2? -42 In base 14, what is -36 + -6? -3c In base 14, what is 3496 - 3? 3493 In base 15, what is 2 - -351? 353 In base 2, what is -100000 - 1010? -101010 In base 9, what is -17 + -3? -21 In base 11, what is -5 + -12? -17 In base 3, what is -20 + 2102101? 2102011 In base 15, what is 2 - -47? 49 In base 15, what is -8 - -cdc? cd4 In base 16, what is 5c + -1? 5b In base 10, what is -2 - 20? -22 In base 9, what is 21 + -1171? -1150 In base 4, what is -2 - -12? 10 In base 11, what is -4 - -40? 37 In base 13, what is 1 + -1006? -1005 In base 2, what is 10110 + 100000? 110110 In base 12, what is 7 + 8? 13 In base 4, what is -110010 - 10? -110020 In base 2, what is 10100111100111 - 100? 10100111100011 In base 4, what is 22 - 202? -120 In base 3, what is 1201 - -100? 2001 In base 14, what is 3469 - -3? 346c In base 14, what is 189 + 5? 190 In base 7, what is 0 + -34? -34 In base 3, what is 1100 - -201022? 202122 In base 16, what is -6 + d? 7 In base 12, what is 1b02 + -5? 1ab9 In base 13, what is -104 - -a? -c7 In base 12, what is -173 - 5? -178 In base 13, what is -3 + 54? 51 In base 9, what is -3 - 475? -478 In base 14, what is 1a28 + -3? 1a25 In base 13, what is -2 + -1c4? -1c6 In base 13, what is 220 + -18? 205 In base 2, what is 100 + -1000101? -1000001 In base 9, what is -148 + -7? -156 In base 5, what is -1 + 14334? 14333 In base 14, what is -240 + 3? -23b In base 7, what is -5 + 116? 111 In base 11, what is -3 - -31? 29 In base 6, what is 10 - -115? 125 In base 10, what is 1322 + 4? 1326 In base 10, what is 769 - 0? 769 In base 11, what is 6 - -2511? 2517 In base 14, what is 30 - -2? 32 In base 7, what is 42 + -64? -22 In base 13, what is -5b - 19? -77 In base 12, what is -1129a - -5? -11295 In base 5, what is 101 - -1? 102 In base 11, what is 465 + -4? 461 In base 8, what is 223 + 5? 230 In base 13, what is -181c - 1? -1820 In base 9, what is 4 - 144? -140 In base 6, what is -5 + 515? 510 In base 13, what is -144 - -7? -13a In base 11, what is 6 + -23? -18 In base 8, what is -23176 + -2? -23200 In base 5, what is -2 - -2024? 2022 In base 10, what is 147 - -29? 176 In base 16, what is -57c + -2? -57e In base 8, what is -5 + -63? -70 In base 3, what is -222 - -102021? 101022 In base 9, what is -23 + 118? 85 In base 2, what is -11 + -110111? -111010 In base 6, what is 130232 + 2? 130234 In base 5, what is -1120 - -23? -1042 In base 8, what is 120 + -4? 114 In base 15, what is -273 - 3? -276 In base 9, what is -1313 - -1? -1312 In base 7, what is -4 + -1? -5 In base 16, what is -160 + 1? -15f In base 16, what is -30b2 - 5? -30b7 In base 5, what is -10 - -122? 112 In base 5, what is -12301 - 200? -13001 In base 6, what is 5 - 1034? -1025 In base 5, what is 0 + 23433? 23433 In base 11, what is 285 + 5? 28a In base 6, what is -110 - -1? -105 In base 7, what is 4 + -665? -661 In base 5, what is 4 - 1441? -1432 In base 6, what is -2 + -103? -105 In base 15, what is -6 + 121? 11a In base 16, what is b9 - 1? b8 In base 16, what is -289 + -1d? -2a6 In base 12, what is -2 + 358? 356 In base 9, what is -1 - 741? -742 In base 16, what is -189 + -d? -196 In base 6, what is 310 - -121? 431 In base 5, what is -124 - -10244? 10120 In base 12, what is 471 + 14? 485 In base 13, what is 2 + -3b0? -3ab In base 6, what is -235 + -3? -242 In base 2, what is -1011 + -11101110? -11111001 In base 3, what is 1122021012 - -1? 1122021020 In base 15, what is 1c - -a6? c3 In base 13, what is -72 - -76? 4 In base 10, what is -3 + 1537? 1534 In base 4, what is 22 + 23000? 23022 In base 12, what is 0 - 248? -248 In base 8, what is 3 - 104? -101 In base 14, what is 9 + 1305? 1310 In base 15, what is 2 - -2d? 30 In base 3, what is 1002 - -12? 1021 In base 15, what is 11 + -b0? -9e In base 8, what is 43 - -10? 53 In base 5, what is 204 + -1? 203 In base 3, what is 111 - 11102? -10221 In base 7, what is 212 + 256? 501 In base 6, what is -523 - 5? -532 In base 16, what is -3 - -23e? 23b In base 6, what is -30 - -141? 111 In base 11, what is -3 + -43? -46 In base 2, what is 110110001 + -11? 110101110 In base 6, what is 133 - -150? 323 In base 4, what is -32 - 3130? -3222 In base 3, what is 101202 + -11? 101121 In base 12, what is 10 + 5b0? 600 In base 7, what is 440 - -40? 510 In base 14, what is 1a44 + -7? 1a3b In base 4, what is -21011 - 112? -21123 In base 16, what is 4 + 7? b In base 5, what is -44 - -2? -42 In base 3, what is -211011 - 1? -211012 In base 6, what is 1122 + -10? 1112 In base 13, what is 39a3 - -2? 39a5 In base 11, what is 506 - 5? 501 In base 10, what is -3 - -69? 66 In base 16, what is 3 + 20? 23 In base 11, what is 4 - 448? -444 In base 10, what is 247 + 2? 249 In base 8, what is 76 + -4? 72 In base 16, what is -4 + 5d? 59 In base 2, what is -11111101 - 1000010? -100111111 In base 2, what is -1000001000 - 0? -1000001000 In base 10, what is 5 + -426? -421 In base 16, what is -22 + -2? -24 In base 7, what is -416 - -5? -411 In base 13, what is 216 - -3? 219 In base 7, what is -2 + -511? -513 In base 16, what is -2b - -5? -26 In base 5, what is -4 + 203? 144 In base 2, what is -1001000101 - 110? -1001001011 In base 11, what is -4 + 63a? 636 In base 15, what is 5eab + 2? 5ead In base 9, what is -2157 - 4? -2162 In base 13, what is -9 - -1a4? 198 In base 4, what is -3 + -12130? -12133 In base 16, what is -16 - 9? -1f In base 14, what is -3ca7 - -4? -3ca3 In base 10, what is 39 - 51? -12 In base 2, what is -1000101 + -10? -1000111 In base 4, what is 100 - -102? 202 In base 7, what is -2143 - 5? -2151 In base 4,	{ "pile_set_name": "DM Mathematics" }
*2 - 4n + 3. Let r(t) = 13t2 - 11t + 8. Let i(k) = -11h(k) + 4r(k). Is i(-2) a multiple of 31? True Let b be 5(1 + (-153)/(-15)). Let z = b - 35. Does 21 divide z? True Let t be 7/(-1(-1)/(-4)). Let w = 111 + -173. Let r = t - w. Does 19 divide r? False Let z = -10 - -44. Does 18 divide z? False Let m(u) = u*2 + 6u + 1. Let w be m(-8). Let y = w - -1. Suppose 3g - 5 = 2j, -5g + y + 3 = 3j. Is j even? True Let t be (-1)/(-1 - (-2)/3). Is 6 a factor of 1(t + -1) + 4? True Suppose 2y - 290 = -2z, -4y = -0z - 5z + 707. Is z a multiple of 13? True Let j(t) = t*3 - 2t*2 + 6t - 18. Does 69 divide j(8)? True Suppose -3n = -0n - 18. Does 6 divide n? True Let b = 74 - 45. Suppose 59 = 4c - b. Is 6 a factor of c? False Let u(b) = -b3 + 10b*2 - 17b + 12. Does 3 divide u(8)? False Let r(b) = -49b3 + b2 + b + 1. Is 34 a factor of r(-1)? False Let o be (-2788)/(-119) + (-8)/(-14). Let d = 82 - o. Does 20 divide d? False Suppose -a + 4a - 9 = 0. Is ((-6)/a)/((-2)/5) a multiple of 2? False Let t(a) = -a - 8. Let h be t(-8). Suppose 3m = -5p + 112, hm = -m - 2p + 38. Is m a multiple of 19? False Suppose -r - r + 14 = 0. Suppose 2y - 1 = -r. Is ((-15)/(-9))/((-1)/y) a multiple of 5? True Let o(m) = 5m - 5. Is 4 a factor of o(4)? False Suppose -4l + l - n = -193, 5l = -4n + 324. Is l a multiple of 8? True Let s be (2/(0 + 1))/1. Suppose 4f - w - 152 = sw, f - 38 = w. Is 19 a factor of f? True Let u = -23 + 32. Is u a multiple of 2? False Suppose 11l - 5199 = -656. Is l a multiple of 12? False Let v = 51 + -35. Is 8 a factor of v? True Let h(m) = -3m + 4. Let t be h(-7). Suppose 2a - t - 39 = -w, w = 0. Does 14 divide a? False Suppose -4j + 235 = j. Suppose -3a - j = -11. Let y = a - -21. Does 9 divide y? True Suppose z + 2o - 20 = 0, -19 = -2z + 2o + 21. Suppose 0 = 3j - 4i - 18, 5j - 13 = 4i + 9. Suppose z + 24 = jv. Is 9 a factor of v? False Let a(r) = -r*2 + 5r - 2. Let t be a(4). Suppose ts + s - u = 0, -14 = -5s - 3u. Does 5 divide (-3)/((-3)/13) - s? False Let r = 367 + -252. Let w = -78 + r. Is 11 a factor of w? False Suppose 0 = -3z + 4z. Suppose -5g + zg = -205. Does 12 divide g? False Let p(z) = -z2 + 25z - 1. Is 11 a factor of p(5)? True Suppose -3a = t - a - 4, t - a = 10. Let i = 0 + t. Does 4 divide i? True Let j(u) = -u + 1. Let v(h) = -h3 - 5h*2 + h + 8. Let d(b) = 2j(b) - v(b). Let n = 2 - 6. Is 11 a factor of d(n)? True Suppose 0 = 2b + 6. Is 11 a factor of (-5)/(b + (-51)/(-18))? False Let x(r) = -r2 + 9r - 7. Let d be x(8). Let h be (-151 - 0)/(d/(-1)). Suppose 0 = -5l + h + 49. Is 17 a factor of l? False Let m = -334 + 516. Is m a multiple of 32? False Let c be (0 + 237/(-9))3. Let k = c + 19. Is 5 a factor of (6/(-10))/(4/k)? False Suppose -10i + 441 = -i. Is 16 a factor of i? False Suppose 2 = -r - 0r. Let i = r + 7. Suppose 5g - b = 8, 2g - ib - 2 = -4b. Is 2 a factor of g? True Let z = -28 - -20. Is z/12 + 64/6 a multiple of 5? True Suppose 23 = 3k - 52. Suppose -2f = j - 34, -k + 0 = -5f. Does 9 divide j? False Let r = 205 + -129. Suppose -5v + r = -14. Is v a multiple of 15? False Let k = 1 + -5. Let s(v) be the first derivative of -v*4/4 - 2v*3/3 + 2v*2 + 2v - 2. Is s(k) a multiple of 9? True Let m(u) = -u*3 + 5u*2 - 5u + 8. Let s be m(4). Suppose -2l + 137 = sh + 3l, -167 = -4h + 5l. Is h a multiple of 19? True Let f = -10 + 30. Suppose -f = -5o - 0. Is 2 a factor of o? True Suppose -2t = -5t + 5i + 210, 3t + 4i = 183. Is 20 a factor of t? False Suppose 4n + 5v = 13, -4n + n = -4v - 2. Let j = n + -2. Suppose -38 = -2m - jm. Is 12 a factor of m? False Let j be 0(-2 - -1)/1. Suppose 540 = 4z - jz. Suppose 3k + 53 = 2s, 4s + 24 = 5k + z. Is 13 a factor of s? False Suppose 2s + 3o - 178 = 0, o = s - 62 - 32. Suppose 0 = -3k - k + s. Is k a multiple of 6? False Let s = -51 + 86. Is 5 a factor of s? True Suppose -17 = -k - 2. Suppose k = -5m, 4y - 3m = 22 + 11. Is 6 a factor of y? True Suppose -i + 4h + 26 = -60, -165 = -2i + h. Is 30 a factor of i? False Let x(d) = -d*3 + 7d*2 - 3d - 2. Suppose -2b - 16 = -2i, 5i - b + 9 - 33 = 0. Suppose 24 = ip - 0p. Is x(p) a multiple of 8? True Suppose y = -2y - 12, -562 = -5x + 3y. Suppose 0t = -2t + x. Does 10 divide t? False Let w(z) = 8z + 14. Does 14 divide w(6)? False Let g(w) = w3 - 5w*2 + 6w - 6. Let k be g(4). Suppose kc - 1 - 3 = 0. Does 20 divide 582/10 + c/(-10)? False Is (-2 - 1) + -2 + 20 a multiple of 15? True Suppose -r - 2r - 3d = -171, 2d = -3r + 171. Does 11 divide r? False Suppose -4m - 4z = -m + 34, 5z + 20 = 0. Let i = -4 - m. Is 6 a factor of i - 1 - -4 - -1? True Let q(b) = 5b2 - b - 1. Let h be q(-1). Suppose -5z + 5 + h = 0. Suppose zw = -0w + 36. Does 9 divide w? True Let l(v) = -v*3 - 6v*2 - 5v + 2. Suppose 3 = -0m - 3m - 5h, 0 = -3h + 9. Is l(m) a multiple of 17? False Let o be -4(21/(-2))/7. Let j(t) = -5t - 7. Let h be j(o). Let l = h - -88. Does 13 divide l? False Suppose 3a = -3q + 135, -4a - 2q + 157 = -23. Does 14 divide a? False Let i = 14 + -9. Suppose i = -b - 0. Let v = b + 7. Is 2 a factor of v? True Let w(c) be the second derivative of -c5/10 - c2 - c. Does 14 divide w(-2)? True Let z(b) = b*2 - b + 3. Suppose -j = 3j - 16. Does 15 divide z(j)? True Let x(j) = j*2 + j. Let c be x(-2). Suppose -ck = 2l + 4, 4l + k + 4k = -10. Suppose -5d + 71 - 6 = l. Is d a multiple of 6? False Suppose -2s - 154 = -3l, -s = -l - 6s + 23. Suppose -v + l = v. Does 8 divide v? True Suppose 0 = 4k + 43 + 53. Let p = 44 + k. Does 10 divide p? True Let r be 1(-2 + 1) + -3. Let y = -2 - r. Suppose 20 = yp - 48. Is p a multiple of 17? True Let o = -14 - -13. Let u(y) = 9y2 + y. Does 8 divide u(o)? True Suppose -2b - 2r + 3 - 9 = 0, -r = 3b - 1. Suppose 2s + 5 - 1 = bj, 0 = -2j + 3s + 1. Is j a multiple of 4? False Suppose -7p + 89 = -464. Is p a multiple of 6? False Suppose 4b = b, -b - 40 = -4n. Suppose 5g + 0g + 55 = 2a, 0 = a + g - n. Is 15 a factor of a? True Let k = 136 + -53. Let y(t) = 2t - 1. Let z be y(2). Suppose zl - k - 4 = 0. Is l a multiple of 14? False Let t be (16/(-12))/((-4)/(-6)). Is t/6 + (-314)/(-6) a multiple of 24? False Let a = -5 + 36. Let j = 20 + a. Is 21 a factor of j? False Let g(t) = -t*2 - t. Let z be g(-1). Let d be z/1 + (-21)/(-7). Suppose f = -df + 32. Does 8 divide f? True Is -49 + 51 - (1 + -1 - 62) a multiple of 16? True Let j(k) = k*2 + k - 1. Let z be j(0). Let r be z/((0 - -1)/(-14)). Is (-7)/r1-14 even? False Suppose -j + 121 = t + 3j, 0 = -5t + 2j + 671. Does 21 divide t? False Is (0 + 6/(-2))(0 + -1) even? False Suppose 0 = -6g + 60 - 18. Is g even? False Let c(i) = -43i - 7. Is c(-1) a multiple of 4? True Let o = 182 - 143. Does 5 divide o? False Suppose -5i + f = -0f - 5, 20 = 2i - 4f. Is 15 a factor of (25 - i)/((-1)/(-1))? False Let x = 4 + 1. Suppose -4f - 1 + 3 = -2u, 5u + xf = 25. Does 3 divide u? True Let h = -17 + 50. Is h a multiple of 11? True Let f = -5 - -5. Suppose fn + 2n - 64 = 0. Does 16 divide n? True Suppose -2z - 2p - 30 = 0, 5z = -5p + 2p - 83. Let g = -14 - z. Does 4 divide g? False Let p(z) = -z*3 - 3z*2 + 4z - 5. Let o be p(-4). Let i(r) = r*2 + r + 6. Is 17 a factor of i(o)? False Is 169 + (-16)/(-4) + 4/(-1) a multiple of 23? False Let h(s) = 47s - 6. Is h(6) a multiple of 12? True Suppose -5z = a + 2a - 126, 42 = a - 4z. Is a a multiple of 7? True Suppose 3v - 8v = 30. Let l = v + 3. Is 11 a factor of (-88)/6l/2? True Let k be -14-26/8. Let p(q) = 2q*2 - 4q - 5. Let z(d) = -3d2 + 6d + 7. Let g(t) = -7p(t) - 5z(t). Is 12 a factor of g(k)? True Suppose 4v - 340 = 2m, 0m = -5v - m + 439. Suppose -3n + v = -0n. Is 10 a factor of n? False Let l be (-22)/(-8) + 4/16. Let x be l2/6 + 7. Suppose -4 = -p + x. Is p a multiple of 9? False Suppose -2y + 2 + 2 = -5k, -2k - 16 = 4y. Let h = 0 - y. Is h even? False Let u be (-6)/(8/6 + -2). Suppose 2n - 3n = -u. Is 9 a factor of n? True Suppose 4u = -16, 2u + 44 = 4h - 2u. Is 7 a factor of h? True Suppose -5t + 15 = 0, 4t = -v - t + 83. Is v a multiple of 17? True Let z(o) = -5o - 1. Let	{ "pile_set_name": "DM Mathematics" }
remainder when k(-4) is divided by 4. 3 Suppose -4s = 2b - 82, -13s + 18s = 3b + 119. Calculate the remainder when 49 is divided by s. 5 Let c(m) = -5m + 1. Let d be c(6). Let f(p) = 2p3 - 3p2 - 1. Let j be f(4). Let q = j + d. What is the remainder when q is divided by 13? 11 Let u(d) = d3 + 17d2 + 28d - 23. What is the remainder when 109 is divided by u(-15)? 4 Let c = 1274 - 1268. What is the remainder when 237 is divided by c? 3 Let z(o) = -6o - 17. Let l be z(-19). Let t = -76 + l. Calculate the remainder when 187 is divided by t. 19 Suppose -3r - 4 + 19 = 0. Let w = r + 0. Let t = 474 + -466. Calculate the remainder when t is divided by w. 3 Let b(w) = 4w3 + 2w*2 - 1. Let t be b(1). Suppose 0 = -th - x + 94, x = 2h - 20 - 12. Calculate the remainder when 16/(-72) + 1318/h is divided by 25. 23 What is the remainder when 1(72 + -4 - 2 - -2) is divided by 26? 16 Let w(k) = -52k - 107. Calculate the remainder when 244 is divided by w(-3). 48 Let a(u) = 3u + 6u + 19 - 5u. Calculate the remainder when a(11) is divided by 13. 11 Suppose -2x + 75 = 3l - 196, 5x = -3l + 277. Suppose 0 = 5g - 5i - 140, -5g - 2i + l + 51 = 0. Calculate the remainder when 82 is divided by g. 26 Let f(d) = -24d - 1. Let s = 1 + -2. Let m(n) = -443n + 39959. Calculate the remainder when m(90) is divided by f(s). 20 Let l(k) be the first derivative of k*3/3 + 3k*2/2 - 3k - 7. Let a be l(-3). Let x = 8 + a. Calculate the remainder when 17 is divided by x. 2 Calculate the remainder when 49 is divided by -12 + 10 - -1 - (-14)/1. 10 Let b be 6/((-2)/(134/(-3))). Let j = -108 + b. What is the remainder when 49 is divided by j? 23 Let p be ((-57)/(-9) - 1)6. Let r = 61 - p. Let u = -44 - -129. Calculate the remainder when u is divided by r. 27 What is the remainder when (1/((-2)/4))/(3/(-108)) is divided by 11? 6 Let l = -7 - -33. Suppose -5p = 0, -4p + 2 = m - 9. What is the remainder when l is divided by m? 4 Suppose a = -3, -3k + 4a - 109 = -256. What is the remainder when 307 is divided by k? 37 Suppose 0 = -0u + u - 7. Suppose 3k - 48 = uk. Calculate the remainder when 59 is divided by (5/(-2))/(2/k). 14 Let p = 162 - 111. Suppose -6q + p = 3. What is the remainder when 9 is divided by q? 1 Let n(w) = 6w - 1. Let v be n(1). Let s be 24/(-10)25/v. What is the remainder when (180/s)/((-1)/3) is divided by 16? 13 Suppose 20 = 11d - 7d. Suppose -da + 7 = -18. What is the remainder when (-3)/(-5)(47 + -12) is divided by a? 1 Suppose -4p = -4, 11g - 3p = 12g - 112. What is the remainder when g is divided by 45? 19 Let f(c) = -27c - 98. Let w = -48 - -105. Calculate the remainder when w is divided by f(-4). 7 Suppose 3y - 38 = 5i, -3y = -2y - 2i - 13. Let z = 369 - 223. Suppose 8d - z = 14. Calculate the remainder when d is divided by y. 9 What is the remainder when 3/((0 - 6/(-165))/(26/39)) is divided by (1 - 1) + 3 + 12? 10 Suppose 5q - 966 = 4g, 579 = -12q + 15q - 3g. Calculate the remainder when q is divided by 49. 47 Suppose 5q + 85 = f, f + 5q = 172 - 127. Calculate the remainder when f is divided by 48. 17 Suppose -6 = -3g, 8c - 4c - 8 = 4g. Suppose -2i = -2p + 4, 5i = -2p - 1 + 19. What is the remainder when c is divided by i? 0 Let t be (3/6)/(1/(-2)). What is the remainder when (-8 + 4 - -5)/(t/(-24)) is divided by (-1)/3 + 86/6? 10 Suppose z + 184 = 4v, 2v - 118 + 40 = -3z. What is the remainder when 222 is divided by v? 42 Suppose 28p + 164 = 32p. Calculate the remainder when 157 is divided by p. 34 Let z(v) = 32v + 3. Let r be z(6). What is the remainder when 167 is divided by (r/(-12) - -2)/(3/(-12))? 53 Suppose r - 3h = 323, 4r + 4h = 523 + 769. Calculate the remainder when r is divided by 36. 35 Let k(o) = -o*3 + 9o*2 + 11o - 3. Suppose -3a + 59 = 5y, 3y + 0 = 5a + 15. Calculate the remainder when y is divided by k(10). 3 Suppose 4c = 28 + 20. Let g(r) = 4r - cr + 9r. Calculate the remainder when 24 is divided by g(9). 6 Let y be 6/4(-20)/(-3). Calculate the remainder when -12((-65)/y + 2) is divided by 14. 12 Let t = 547 + -483. Calculate the remainder when 68 is divided by t. 4 Suppose 120 = -78d + 4176. What is the remainder when 204 is divided by d? 48 Suppose 2b - 5j = -b - 229, 0 = 4j - 8. Let k = b - -94. Calculate the remainder when k is divided by 6. 3 Suppose -2p + 32 + 12 = 0. Let r = 274 - 243. Let m = r - p. What is the remainder when 34 is divided by m? 7 Let s(r) = 184r - 2. Let j be s(-1). Let u = -62 - j. What is the remainder when u is divided by 25? 24 Let j(w) = -w - 21. Let q(d) = 4d + 83. Let f(u) = -9j(u) - 2q(u). Let h be f(-12). Let t = 23 - h. What is the remainder when t is divided by 7? 5 Let i(a) = 11a - 6a + 5a + 4. Calculate the remainder when i(4) is divided by 24. 20 Let c be (25/10)/((-10)/(-8)). Suppose -2t + 24 = ct. Suppose -n + t = -j - 0j, 0 = 2n + j - 9. Calculate the remainder when 19 is divided by n. 4 Suppose 4b + 3k = 82, 0 = -3b + 5k - 10k + 56. What is the remainder when 85 is divided by b? 19 Let v be (-26)/4 + 21/14. Let x be (v/(-1))/((-85)/(-34)). Suppose -1 - 2 = 3h, -14 = -r + xh. Calculate the remainder when r is divided by 4. 0 Suppose -3z = -3b + 4b - 7, -2b - 4z = -10. Suppose 0 = c - 7m + 3m + b, 3c = -m + 49. What is the remainder when c is divided by (-2)/(-1) + 6 + 0? 7 Let c = 2 + -1. Suppose -b + 127 = 4t, 0 = b + c. What is the remainder when t is divided by 3 - 42/(-3)1? 15 Let f(b) = -b3 - b2 - b + 6. Suppose -4m = m + 2g - 6, 0 = 4m + 3g - 9. What is the remainder when 9 is divided by f(m)? 3 Let t be (-20)/(-90) + 14222/36. Calculate the remainder when -1(-5 - -2)t/9 is divided by 8. 5 Let a = 671 + -953. Let r = -200 - a. What is the remainder when r is divided by 21? 19 Suppose 5i - 22c = -26c + 122, -5i = -3c - 136. What is the remainder when 672 is divided by i? 22 Let v(m) = -6m + 5. Let s be v(-5). Suppose 4o = -s - 13. Let j = 20 + o. Calculate the remainder when 29 is divided by j. 5 Let q(v) = 13v - 281. What is the remainder when q(22) is divided by 3? 2 Suppose 0 = -0l - 10l + 50. What is the remainder when 6 is divided by l? 1 Suppose 2k = -8, 0 = 4t + 4k + 117 - 905. Calculate the remainder when t is divided by 51. 48 Suppose 5a - 356 = -x, 281 = 4a - x - 2x. Let v = -59 + a. What is the remainder when 22 is divided by v? 10 Calculate the remainder when 186 is divided by 19/(-2)(-4)/63. 15 Let a = -16 + 19. Suppose -88 = -5f + ac, -4f = c - 82 - 2. What is the remainder when 58 is divided by f? 18 Let g(j) = j2 - 2j - 1. Let o be (-3 - (1 - 5))0. Suppose -u = -4 - o. Calculate the remainder when g(4) is divided by u. 3 Let w(m) be the second derivative of m4/12 + m3 + 29m*2/2 + 23m. What is the remainder when 178 is divided by w(-8)? 43 Suppose -10o + 9o = 0. Suppose -3q + q + 27 = -3z, o = -5z - 15. Calculate the remainder when -60(q/(-2) + 3) is divided by 31. 28 Suppose 6y + 30 = 330. Suppose -3o = -o - y. What is the remainder when 98 is divided by o? 23 Let g = -285 + 750. What is the remainder when g is divided by 26? 23 Let m(x) = -45x - 5. Let o be m(9). Let p be 2/7 + o/(-35). Let q = 10 + p. Calculate the remainder when q is divided by 6. 4 Let x(m) = -9m - 3. Suppose 2s + 6 = -s. What is the remainder when x(-3) is divided by (s/1)/((-12)/54)? 6 Suppose -5 = -5n, 0 = -m - n + 2n + 21. What is the remainder when (((-9)/3 + 1)-43)/2 is divided by m? 21 Suppose -10l + 12l + 3g = 146, 5g - 146 = -2l. Calculate the remainder when l is divided by 12. 1 Let k be (-2)/8 - (-46)/(-8). Let q = -18 - k. What is the remainder when (-2)/q - 917/(-42) is divided by 8? 6 Let d = 9 - 6. Let k be (-3 - -3) + d - 1. Suppose -m + o + 2o = -24, km - 2o = 40. What is the remainder when 33 is divided by m? 15 Let r(g) = g*2 - 2g. Let f = -8 - -3. Let d = 3 + f. What is the remainder when r(d) is divided by 3? 2 Let v = -26 - -45. Let f = 142 + -139. Let s = v - f. Calculate the remainder when 46 is divided by s. 14 What is the remainder when 2/10 + (-4 - (-1408)/10) is divided by 28? 25 Suppose 395 = -6s + 437. Let b(y) = 14y**2 - 1. What is the remainder when b(-2) is divided by	{ "pile_set_name": "DM Mathematics" }
37t + 22t + 38 + 2t + 0 + 0 + (t - t + 2t)(0 - 2 + 0). -3t + 38 Expand (-1893h2 + 1818h*3 - 185h*3 + 1893h*2 + 504h*3)(-3h - 3 + 3)(2h - h + 2h). -19233h5 Expand (-1 + q + 1)(-4q - q + 3q) + (-12q - 5q + 2q)(-7q + 11q + 29q). -497q*2 Expand (1236u - 20852 + 20852)(-4 + 0 + 3) + (-4 + 4 + 1)(-2 - 2u + 2). -1238u Expand -918116q + 9 + 918088q + 8 - 2q - 4 + 4 + (3q - 3q - 2q)(1 - 2 + 2). -32q + 17 Expand -13o5 - 148o*5 - 25o*5 + (-1 - 2 + 1)(-2o + 2o - 19o5). -148o*5 Expand (-11 - 1 + 2)(18y2 + 4y*5 - 18y*2) + 12 - 12 + 2y*5. -38y*5 Expand (-5g + 3g + 4g)(2 - 2 + 2g + g + 1 - 1 + (0 + 2g + 0)(-1 + 2 + 0) + g - 2g + 2g - 3g + 4g + 3g)(-8 - 10g3 + 13g*3 + 0g*3). 60g*5 - 160g2 Expand -h3 + h3 - h4 + (h*3 + 3h*3 - 2h*3)(h - 28h - 4h) - 53 + 38h4 + 53 + 4h*4 - 2h4 - h4. -24h4 Expand (-1485 - 1970 + 4352)(-1 + m*2 + 1 + (-1 + 0 + 0)(3m2 + 2m2 - m2)). -2691m2 Expand (-2h - 4h + 5h)(-2 - 5 + 3)(143h4 + 34h*4 + 0h*4). 708h*5 Expand (7 - 34 - 27)(3o + 348 - 435 - 2o)(-1 + 3 + 1). -162o + 14094 Expand (-1 - 3 + 2)(-3 + 12 + 18)(3m - 2m + 2m) + (-m + 3m - 3m)(1 + 2 - 5) + 2m + 0 + 0. -158m Expand (3 + 0 - 2)(-s3 - 2s + 2s) + (-15s*2 + 33s2 - s2)(2s - 3s - s) + 3s*3 + 0s*3 - 2s*3 + (-1 + 1 + 3s)(-1 + 1 - s2). -37s*3 Expand ((-3 - 3 + 4)(-2 + 1 + 2) - 6 - 18 + 100)(-1 + 0 - 10)(1 - 4 + 2)(-5l + 5l - 3l). -2442l Expand (-11x - 19x - 17x)(205x2 + 172 - 172) + x2 - x2 - x3. -9636x3 Expand -v4 - 3v*4 + 5v*4 + (-v - 2v + 2v)(748v3 + 646v*3 - 3556v*3). 2163v*4 Expand (6m + 7m - 3m)(5 - 14 + 5)(4 - 1 - 1). -80m Expand (-2 + 4 + 1)(-3j + 5j - j) + 0j - 3j + 2j + 3585j - 294j + 2591j. 5884j Expand -2i*5 + 3i5 + i5 + (2i2 + 49 + 87 + 69)(0 + 6i3 + 0) - 2i*3 + 2i*5 + 2i3 + (-i4 + 2i4 + 0i*4)(2i - i + 0i). 17i5 + 1230i*3 Expand (51 + 82 + l - 240)(-l*4 - 2l4 + l4). -2l5 + 214l*4 Expand (-815 - 288 + 1889)(5i2 - i2 - 2i2) - i2 - 3i2 + 5i*2 + (-3i + 0i + 2i)(0i + i - 3i). 1575i2 Expand (b2 + b*2 + 0b*2)(287b2 + 1304093b - 1304093b + (4b + 2b + 0b)(-b - 3b + 6b)). 598b*4 Expand (-1 + 1 + f)(1 - 1 - 2)(-3f + 17f - 7f)(-282f*2 + 1 + 1 + 283f*2). -14f*4 - 28f*2 Expand ((-10547 + 10547 - 249j)(-2j + j + 3j) + j - j2 - j)(3j - j - 4j)(3j - 3j - 3j*2). -2994j*5 Expand (2f + 1 - 1)(-f3 - 1 + 1) + (-2f*3 - 24f*3 - 28f*3)(2f + 0 + 0). -110f*4 Expand (-5k*4 + 3k*4 + 5k*4)(-4 + k - 3 + 21 - 13k + 10 - 10 + (3k + k - 2k)(2 - 3 + 0) - k - 2k + k). -48k*5 + 42k*4 Expand (2r - 2 + 2)(-3r + 3r + r) + (2r - 2r - 2r)(10r + 249r + 443r). -1402r2 Expand (-1 + 1 + 1)(-1 - 3306x - 8327x + 1905x + 3). -9728x + 2 Expand (-17571 + 17571 + 396u2)(3 - 3 + 2)(-8 - 5u + 8). -3960u3 Expand -k5 + 0 + 0 - 2k3 - k5 + 2k3 - 3k*5 + 6k5 - k5 + (3k3 - 4k*3 + 3k*3)(-k + 2k2 + k) + 15k*5 + 9k*5 + 2k*5. 30k*5 Expand (-137d - 120d + 57d - 73d)(4 - 5 + 6). -1365d Expand 2z + 1 - 1 + (31 - 14z - 31)((-2 + 6 - 3)(0 - 1 + 0) + 3 - 7 - 2). 100z Expand (-167563 + 167563 + 1113j)(4 + j - 2 + 3). 1113j2 + 5565j Expand (60 + 2983s + 55 - 171 + 56)(-s*4 + 5s4 - s4). 8949s5 Expand ((-6s + 3s + 2s)(18 + 17 + 21) - 19 + 19 + s)(-2s2 + 2s*2 - 2s*4). 110s*5 Expand (-279 + 158 + 124y + 125)(0 - 2 + 0). -248y - 8 Expand (-a*2 + 20a - 77a2 - 11a)(3a - 3a - a2 - 4a2 + 0 + 0 + a - a - a2 + (0 + 0 - 2a)(0a + 3a - 2a)). 624a*4 - 72a*3 Expand (-2104 - 10099 - 14668 - 517)((3 + 1 - 5)(4q - q - 5q) - 2q - 4q + 5q). -27388q Expand (-1261 + 1381 + 1305 + 2706)((-3i3 - 3i*3 + 4i*3)(-4i2 + 0i*2 + 3i2) - i2 + i5 + i2 - 2 + 2 - 2i5). 4131i*5 Expand (-4v + 3v + 0v)(-3v + 3v + v) + (2v + 7 - 3 + 9)(-239v - 220v - 161v). -1241v2 - 8060v Expand -25 + 25 + 3q4 + (2q - 11q - 24q)(-4q + 4q + 4q*2)(q - 5q + 0q). 531q4 Expand (4 - 2 - 4)(641d3 + 1664d*3 - 555d*3). -3500d*3 Expand (6062n - 4294n - 6350n)(3n - 3n - n)(-2 + 1 + 0)(3 - 2 - 2). 4582n*2 Expand (-271 + 376v + 271)(-4 - 9 + 3). -3760v Expand (-200416 + 101123 + 103699)(5u - 2u5 - 5u). -8812u5 Expand -4f*2 - 3f*2 + 5f*2 + (-23 + 23 + 24f)(2f + 8f + 3f). 310f2 Expand (-37m*5 + 4m*5 - 12m*5)(38 - 13 - 76). 2295m5 Expand -3j*2 + 1 - 1 - 762j + 762j + 20 - 2j*2 + (-4j - 2j + 3j)(-25j - 18j + 60j). -56j2 + 20 Expand (-145422 - 916h + 145422 + 2852h)(-5 + 2 - 3)(2 + 2 - 2)(5h - 5h - h). 23232h2 Expand -h2 + h - 2h + 86 - 85 + h*2 - 2h2 - h2 + (-5h + 3 - 3)(-5h + 2h - 2h). 22h*2 - h + 1 Expand (4q*2 - 6q*2 + 4q*2)(-2q + 221 + q2 - 365 - 91). 2q*4 - 4q*3 - 470q*2 Expand -4d*3 + 2d*3 + 20d*3 + (2 + 3 - 7)(5d3 + 0d*3 - 4d*3) + 4d*3 + 3d*3 - 3d3 + (4 - 4 + d2)(0d + 2d - 3d). 19d3 Expand 7w*2 + 4w*2 - 9w*2 - 7 + 3w2 + w2 + 3w2 + (-2w + 3w + 0w)(-2 + 5w + 2). 14w2 - 7 Expand (-333 + 333 - 197x + (-3x + 2x + 0x)(-3 + 1 + 1))(3 - 3 - 2). 392x Expand (-4 + 0 + 2)(r - 2r + 3r) + 10r + 4r - 19r + 37 + 149r - 37. 140r Expand (-2 - 2 + 6)(2 - 1 - 2)(6q4 + 8q*4 - 4q*4) + (-2q2 + q2 + 0q2)(0 + q + 0)(-3q + 0q + 4q) + 2q4 - q4 + q4. -19q4 Expand (-y5 + 0y2 + 0y*2)(3564 + 5863 - 11707 + 8286). -6006y5 Expand -134h*2 + 0h*2 - 161h*2 + (h + h + 4h)(h - 7h + 0h). -331h*2 Expand (2 - 2 + 6t*2)(1835003t2 - 188 - 1835004t*2 - 38). -6t*4 - 1356t*2 Expand (-1307 + 379 - 6316)(0h + 2h*4 + 0h). -14488h4 Expand (4 + 2 - 3)(1458q - 49q + 89q + 1216q). 8142q Expand (-9u - u + 2u)(7 + 11 - 5 + (1 - 4 + 2)(-3 + 1 - 2)) + 4u - 11u - 2u. -145u Expand (-2110 + 2110 + 217b)(-1 + 29 - 1)(0b2 + 2b*2 + 0b*2). 11718b*3 Expand -45t - 320t + 72t - 5t + 3t + 5t + (-3t - 2t + 4t)(4 - 1 - 1) + (t + 0t - 2t)(0 - 6 + 10). -296t Expand (4a*2 + 12a*2 - 23a*2)(-14 - 17 + 31 - 160a). 1120a*3 Expand (-2f*4 + 169f*2 - 167f*2 + 5f*4)(2 + 10 - 4)(-6f - 2f + 2f). -144f5 - 96f*3 Expand (0v*2 - 2v*2 + 4v*2)(-3v2 - 4v*2 + 3v*2) + (-1 + 1 - 2v*3)(5v + 2v - 5v) + 10 - 10 + 6v*4. -6v*4 Expand (4f*4 - 4f4 - f5)(-1 - 1 + 1) + 5f*5 + 0f*5 - 2f*5 + (6 - 6 - 8f)(-2f*4 + 3f*4 + 2f*4) + (-2f*5 - 2f5 + f5)(-3 + 1 + 1). -17f*5 Expand (-2s + 0s + 0s)(-2 - 2 + 3) - 3391s + 10165s - 3391s + 1652 - 3382s. 3s + 1652 Expand -11f2 - 6f*2 - 45f*2 + 2f*2 - 3f*2 + 4f*2 + 5f*2 - 2f + 2f + f2 + f2 - f2 + (-f + f + 2f*2)(-1 + 3 - 1). -51f2 Expand (0u + 0u - u)(-2u4 - u4 + 5u*4) + (-3u - 5u3 + 1255510u*2 - 14 - 1255510u*2)(-u*2 + 2u*2 + 0u*2). -7u*5 - 3u*3 - 14u*2 Expand 0s3 + s4 - s*3 - 3s*3 + (-4 + 2 - 6)(-5s4 - 14s*3 + 14s*3) + s - 2s*4 - s. 39s*4 - 4s*3 Expand (44910m - 6871m - 3435 + 17666m + 3435)(-m + 5m - 2m). 111410m*2 Expand (4x*2 - 3x2 + x2)(-99x*3 - 82x + 82x + 81x - 9x3 - 81x + (-4x2 + 0x*2 + 5x*2)(-4 + 4 - x)). -218x5 Expand (1157m + 810m + 2775m - 226m)(-6m2 + 0m*2 + 4m*2). -9032m*3 Expand 4i - 5i + 0i + (52 + 152 + 110)(-i - 5i + 4i). -629i Expand (3 - 3 - 1 + (4 - 2 - 4)(0 - 2 + 0) - 11 - 9 - 4 - 3 - 3 + 4)(-56b + 126 - 126). 1288b Expand (-5 + 3 + 1)((3l - 2l - 3l)(1 - 1 - l2) + 0l*3 + 3l*3 - 4l*3 + (-l + 0l + 0l)(-13l + 2l + l)(-15l + 53 - 53)(-2 + 3 - 2)). -151l*3 Expand (14x*4 - 16x*4 + 112x*4)(-1 + 5 + 7 + 5x). 550x*5 + 1210x*4 Expand (2g - 2g3 - 2g)(-136g - 12 - 111 + 119). 272g4 + 8g*3 Expand (-4x*2 - 4 + 4)(126 - 154 - 111 + (3 - 1 - 1)(-1 + 0 + 2)). 552x*2 Expand ((2r - 3r - r)(r + 3r + 5r) - 27r2 + 22r*2 + 8r*2)(-10 + 10 - 2r2). 30r*4 Expand (378p*3 + 15p**3 +	{ "pile_set_name": "DM Mathematics" }
+ 4c + 2. Calculate pd(x) + ub(x). 2x*2 + x - 1 Suppose -2j + 0j = -10. Suppose -5q + q = -5g + 21, 0 = -5g + jq + 25. Let s(m) = -1. Let o(t) = -t - 4. Calculate go(d) - 6s(d). -d + 2 Suppose 2l + s = 9, 3l + 0l = 4s - 3. Let j(q) = -11q*3 + 2q*2 + 7q - 5. Let n(u) = 2u3 - 3u + 6u + u2 - 7u*3 - 2. What is lj(v) - 7n(v)? 2v3 - v2 - 1 Let y(f) = -f + 13. Let k = -8 + 12. Suppose m + r - k = 0, 4m - 4r = -r + 2. Let v(b) = -3. What is my(o) + 9v(o)? -2o - 1 Let q(j) = j2 - 1 + j + 2 + 0j*2. Let x(t) be the first derivative of -4t3/3 - t2 - 3t + 4. Calculate -6q(h) - 2x(h). 2h*2 - 2h Let j(k) = -1 - k - 6k + k. Let w(i) be the third derivative of -i5/60 + i4/3 + 2i*3/3 - 3i*2. Let q be w(8). Let o(f) = -f. Give qo(r) - j(r). 2r + 1 Let j(g) = -2g - 2 + 0 + 3g + 0g. Suppose -3u - 1 = -13. Suppose 42 = uh + 130. Let k(x) = 6x - 11. Calculate hj(y) + 4k(y). 2y Let q(i) = -7i. Suppose 0 = -x - 4x - 25. Let a = x - -3. Let h(u) = -3u. Give aq(r) + 5h(r). -r Let b(g) = -6g - 57. Let z(t) = 5t + 56. Calculate -4b(r) - 5z(r). -r - 52 Let j(r) be the first derivative of -3r4/4 - r3/3 + 2r2 + 4r + 1. Let v(s) = -3s3 - s2 + 3s + 3. Determine 3j(p) - 4v(p). 3p3 + p2 Let z(q) = 9q + 1. Let r(k) = -k. Suppose b + 2 + 12 = 0. Give br(h) - 2z(h). -4h - 2 Let x(z) = 4 - 5z - 4. Let m(q) be the second derivative of 3q3/2 - 6q + 3. Give 3m(w) + 5x(w). 2w Let h = 6 - 7. Let w = 8 - 6. Let s(z) = 1. Let x(c) = -c + 1. Determine hx(k) + ws(k). k + 1 Let b(p) = -2p*2 - p. Let w be b(-1). Let a(k) = -2k - 1. Let l(q) be the third derivative of 1/24q4 + 0q + 0 + 0q3 - 2q*2. What is wa(t) - 4l(t)? -2t + 1 Let q(a) = -4a + 4. Let d be 1/5 + (-78)/15. Let j(f) = 5f - 5. Calculate dj(k) - 6q(k). -k + 1 Let a be (-1)/(-4) - 54/(-8). Suppose c = -3c + 20. Let z(i) = 9 + i2 + 4i + 8i - ci - 3i2. Let v(g) = -3g*2 + 10g + 13. Give az(n) - 5v(n). n*2 - n - 2 Let v(s) = 5s*2 + 9s + 4. Let q(a) be the second derivative of 1/6a4 + 3a + 2/3a3 + a2 + 0. Calculate 9q(k) - 4v(k). -2k*2 + 2 Let p(i) = 3i*3 - 6i*2 + 1. Let s = 3 - 8. Let u(q) = 4q*3 - 7q*2 + 1. Let g be 18/24 - 9/12. Suppose g = 5l - 3l - 12. Give lp(n) + su(n). -2n3 - n2 + 1 Let b(f) = -4f3 - 17f*2. Let j(u) = -17u*3 - 67u*2. What is 9b(z) - 2j(z)? -2z*3 - 19z2 Let s(l) = -l2 - 3l - 2. Let d(g) = 4g*2 + 8g + 6. Give -3d(b) - 8s(b). -4b2 - 2 Let i(q) = 21q*3 - 3q - 1. Let o(d) = -d*3 - 1. Determine i(j) - o(j). 22j*3 - 3j Let t(q) = 3q3 + 4q*2 + 4q + 4. Let k = 11 + -44. Let h(m) = 24m3 + 33m*2 + 33m + 33. Give kt(p) + 4h(p). -3p3 Suppose 0 = 2g + g + 15. Let t = g + 10. Let o(k) = -k. Let y(n) = 8 - 3 - 3 + 7n + 0n. What is to(u) + y(u)? 2u + 2 Let n be ((-2)/3)/((-32)/144). Let q = -9 + 4. Let i(u) = -4u2. Let f(g) = -2g*2. Calculate ni(c) + qf(c). -2c*2 Let j(k) = 134k + 3k2 - 7 + 127k - 268k. Let f(z) be the third derivative of -z5/60 + z4/12 + z3/3 + z2. Calculate -14f(p) - 4j(p). 2p*2 Let k(s) = 2s + 4. Let d = 8 - 5. Let t(f) = f + 3. Suppose 3j = -0j + 135. Suppose j = -5z - 5g, 0 = 3z - 0g + g + 17. Calculate dk(w) + zt(w). 2w Let r(x) = -18x*2 - 4. Let z(n) = -91n*2 - 21. Determine -21r(l) + 4z(l). 14l*2 Let w(h) = -5h*2 - 3h + 3. Let o(f) = -11f - f - 2f + 14 - 24f2 + 0f. Give -3o(v) + 14w(v). 2v2 Suppose 3 = -2n - 7. Let a(p) = p*3 + 4p*2 + 2p + 3. Let v(w) = -7w2 + 18 - 4w*3 - 3w + 2w3 - 23. Determine na(r) - 3v(r). r3 + r2 - r Let z be (-8)/3 + (-5)/15. Let x(u) = 2u*2 - 3u - 3. Let k(v) = -v*2 + v + 1. Calculate zk(n) - x(n). n*2 Let b = -1 - -7. Suppose 3m + 0z - 3z + b = 0, -10 = 3m + z. Let g(p) = 2p + 3p - 4p - 4p - 8. Let a(k) = -k - 3. Give mg(s) + 8a(s). s Let u(c) = 2c + 4. Let k(s) = 5s + 11. Suppose -x = -3z + 60, -2x = 5z - 160 + 60. Let b be (1 - 0)/((-5)/z). Determine bk(w) + 11u(w). 2w Let a be (1 - 0)/((-2)/(-12)). Let u(y) = 40y - 12y - 17y - 1 - 12y. Let c(k) = -7k - 4. What is au(p) - c(p)? p - 2 Suppose 3 - 11 = 8g. Let j(w) = -3w3 + 4w - 2. Let s(c) = c*3 - c + 1. Calculate gj(q) - 4s(q). -q3 - 2 Let w = 21 + -27. Let k(b) = -4b*3 + 2b*2 - 6b - 11. Let i(x) = 2x3 - x2 + 3x + 6. What is wk(s) - 11i(s)? 2s3 - s2 + 3s Suppose -4u + d = -3d + 8, u + 8 = -5d. Let v be -1(-1 - (13 - u)). Let y(f) = -20f2 - 23f + 6. Let t(j) = -7j2 - 8j + 2. Calculate vt(z) - 6y(z). z*2 + 2z - 2 Suppose z + 2z = -33. Let l(h) = -8h*2 + 5h - 11. Let r = 12 - 8. Let s(o) = -3o2 + 2o - 4. Calculate rl(c) + zs(c). c*2 - 2c Let m(k) = -3k - 72 + 13k*3 + 72. Let z(c) = -9c*3 + 2c. Determine -5m(n) - 7z(n). -2n3 + n Let v(y) = -17y*3 + 11y*2 + 9y. Let k be ((-3)/6)/(3/36). Let m(w) = -9w3 + 6w*2 + 5w. Determine kv(g) + 11m(g). 3g3 + g Let l = 12 + -7. Let w(s) = -s3 + 5s*2 - 1. Let b be w(l). Let y(o) = o - 4. Let t(k) = -1. What is by(u) + 5t(u)? -u - 1 Let x(g) = -5g + 3. Let q(b) = b + 1. Let y(p) = 17p - 1. Let j(m) = 6q(m) - y(m). Let d = -17 - -13. Determine dj(h) + 9x(h). -h - 1 Let c(a) = 3a2 - 2a. Let l = -33 - -38. Let d(s) = -4s2 + 2s. What is ld(i) + 6c(i)? -2i2 - 2i Let o(h) = 12h - 12. Let i(j) = -11j + 13. Let a(p) = -3i(p) - 2o(p). Let w(g) = 5g - 8. Determine 6a(k) - 11w(k). -k - 2 Let d be -6 - ((-1 - 1) + 1). Let p(f) = 2f*3 + 2f*2 + 4f + 2. Let a(n) = -3n3 - 2n*2 - 5n - 2. Determine dp(v) - 4a(v). 2v3 - 2v*2 - 2 Let h(g) = -3g - 3. Let a(c) = c + 1. Suppose 5r = 21 - 16. What is rh(k) + 2a(k)? -k - 1 Let o(u) = -6150u*2 + 165u - 165. Let l(h) = 75h2 - 2h + 2. Calculate 165l(x) + 2o(x). 75x2 Suppose 2w = w + 3d - 10, w = d - 8. Let l(g) = 3g - 4. Let h(j) = 4j - 5. What is wl(u) + 6h(u)? 3u - 2 Let b(y) = -y3 + y2 - y + 1. Let o(x) = x*3 - 5x*2 + 3x - 3. Suppose 68l - 72l = -4. What is lo(v) + 3b(v)? -2v3 - 2v*2 Suppose -133 = -3g + 22g. Let a(d) = -10d + 9. Let u(i) = 50i - 46. Let x(y) = -11a(y) - 2u(y). Let r(l) = -1 - 3 + 6 - 3l. Determine gr(m) - 2x(m). m Let j(o) = 7o3 - 5o. Let p(n) = -6n3 + 5n. What is -4j(q) - 5p(q)? 2q3 - 5q Let o(j) be the first derivative of -20j3/3 - 7j*2 - 3j + 4. Let g(k) = 7k2 + 5k + 1. Calculate 17g(n) + 6o(n). -n*2 + n - 1 Let t(u) = u + 1. Suppose k = -0k - 16. Let s be (-142)/8 - (-4)/k. Let m(h) = 10h + 9. Give st(q) + 2m(q). 2q Let w be 18/45 + (-99)/(-15). Let h(b) be the third derivative of -5b4/12 - 7b3/6 + b2. Let y(i) = 3i + 2. What is wy(n) + 2h(n)? n Suppose 7 = 5z - 0z - 2s, 10 = -2z + 4s. Let h(a) = 4 + a*z + 12a - 2 - 3a. Let q(d) = d3 + 1 + 0d*3 + 5d + 0d3. Determine -3h(m) + 5q(m). 2m*3 - 2m - 1 Let a(y) = -3y2 + 27y. Let w(b) = -b*2. What is a(f) - 2w(f)? -f*2 + 27f Let r(m) = 15m - m2 - 4 - 15m. Let l(u) = 4. Suppose -n = -2g + 16, g + 14 = -6n + n. Let h(q) = -1. Let b(x) = gh(x) + l(x). Calculate 5b(z) - 2r(z). 2z*2 - 2 Suppose 21 = 4l + 5. Let r(z) = -7z - 1. Let f(h) = -14h - 2. Let p(m) = lf(m) - 9r(m). Let a(u) = -u. Calculate -5a(g) - p(g). -2g - 1 Let s(w) = -2w - 2. Let g(m) = m + 2 - 3m - m + 5m. Give 6g(x) + 5s(x). 2x + 2 Let m(q) = -q3 - q2 + q - 1. Let y(l) = l*2 + 3 - 2 - 13045l + 13044l. Suppose -2 = -x + 2x. What is xy(c) - 2m(c)? 2c3 Let b(k) = -7k - 7. Suppose 5s - 38 - 17 = 0. Let z(i) = -1 + 9 + si + 3. What is -8b(c) - 5z(c)? c + 1 Suppose 0 = 5t + 5m + 55, 4 = -0m - m. Let z(v) = 6 - 1 + 0v*3 + 4v + 6v2 - 2v*3. Let n(u) = 3u*3 - 11u*2 - 7u - 9. Determine tz(f) - 4n(f). 2f3 + 2f*2 + 1 Let o(p) = 18p*2 - 15p - 15. Let s(x) = -x*3 - 3x*2 - 4x - 3. Let r be s(-2). Let m(f) = -f*2 + f + 1. Calculate ro(q) + 15m(q). 3q*2 Let q(t) = -3 - 4t*3 + 1 + 5 + 2. Let y(r) = -3r*3 + 4. Let l be (32)/(3/(-2)). Let a be 0 + 2/2 + 4. What is ay(f) + lq(f)? f3 Let m(s) = s2 - 3s - 3. Let d(a) = -a - 1. Calculate 6d(v) - 2m(v). -2v*2 Let h(d) = -2d. L	{ "pile_set_name": "DM Mathematics" }
-2 Rearrange -841r - 73 + 24 + 23 + 27 to t + jr and give t. 1 Express -2 - 2g3 + 9g*4 + 19g - 2 - 1 - 14g + 7 - 3g*2 as pg*3 + ag*2 + y + lg*4 + xg and give x. 5 Express (-2i + 3i - 7i)(-692 - 280 - 436) in the form w + gi and give g. 8448 Rearrange -916t - 2 + 3 - 2013t - 556t to the form bt + y and give y. 1 Rearrange -10041p + 3351p + 3334p - 16 + 3336p to y + fp and give y. -16 Rearrange 1019832f2 + 3f + 187f3 + 25f*4 - 1019832f*2 - 2f to the form of + if*4 + hf*2 + p + xf*3 and give o. 1 Express -7698j*2 + 7736j*2 - 21j*3 + j - j + 9j*3 in the form k + xj + uj3 + yj*2 and give u. -12 Rearrange (34 - 281 + 7)(17t - 119 + 119) + 3 - 2t + t - 1 to w + lt and give l. -4081 Rearrange -15p*2 + 489p*3 + 9683369 - 9683369 + 221p*3 to op + wp2 + s + tp*3 and give t. 710 Express 3a*3 - 97 - 3a*4 - 2a*2 + 14 + 81 - 174a in the form da + na*4 + ma*2 + l + ta*3 and give t. 3 Rearrange 2l*3 + 2 + 2183l + 3l4 + 3 - 2252l to the form m + pl2 + jl + zl4 + bl*3 and give z. 3 Express -1 + 19k*3 - k - 8k*3 + 2 - 37k*2 + 46k*2 - 5 as i + wk*3 + hk + yk2 and give y. 9 Express -5i + i + 3i + (-2i + 2i - 2i)(4 - 1 - 5) - 4 + 4 - 2i + 1491 - 747 - 737 + 4i in the form ni + l and give l. 7 Rearrange (-1 + 0 + 3 - 2 - 2 + 2 + (0 + 0 + 1)(-2 + 0 + 4) + 4 + 1 - 3 - 140 + 95 - 135)(x + 4x - 2x) to kx + c and give k. -528 Express -a2 + 0a*2 + 0a*2 + (a - 7a + 0a)(-750354 + 750354 + 2069a) as wa*2 + k + ma and give k. 0 Express -3t2 + 172t + 174t - 337t - 5 as st2 + wt + j and give w. 9 Rearrange (0 + 0 - i)(89 - 89 + 814i)(-4 - 1 + 4) to the form yi*2 + ci + h and give c. 0 Rearrange -116 - 12 - 40k - 99 + 33k to the form rk + t and give t. -227 Express (-1104256f*4 + 1221 + 1103 + 1104255f*4)(-1 + 1 - 1) as rf + sf*2 + o + uf*4 + nf*3 and give u. 1 Rearrange (-4 + 4 + 2v*2)(-2v - 4v + 5v) - 83v*2 + 13v*2 - 189v*3 - 93v*2 - 29v*2 - 18v*2 to the form cv*3 + mv*2 + qv + n and give m. -210 Rearrange 46b2 - 17b*2 - 74 - 9b*2 + 4b - 14b2 - 5b*2 to the form w + zb*2 + cb and give w. -74 Express (-4040s - 2528s + 1646s - 5865s - 2702s)(-3 - s + 3) in the form o + ws + is*2 and give i. 13489 Rearrange -52p*3 + 46p - 45p + 2 + 516p*3 to the form jp*3 + wp + u + bp2 and give w. 1 Rearrange -2363 + 159a - 2367 - 2371 + 7099 to the form n + ka and give k. 159 Express -667f*2 - 236f - 106f + 669f*2 in the form xf + bf2 + w and give b. 2 Rearrange 202s + 18s - 33s + (0 + 1 + 0)(2s - 5s + 5s) - 24s + 23 - 23 - 4s + 4s - s to bs + n and give b. 164 Express (3 - 5 + 11)(-1 + 0 - 4 - d)(-8d - d + 3d) as md + b + td*2 and give m. 270 Express (12905w*3 + 3w - 18w - 6650w*3 - 6820w*3)(3w + w - 7w) in the form vw + zw*2 + hw*3 + o + fw*4 and give f. 1695 Express (-409b + 1203b - 400b + 12 - 401b)(3b - b - b)(83b + 93b - 46b) in the form wb + f + ob3 + qb*2 and give q. 1560 Express 91l + 176l + 112l - 119l + (4 - 3 + 1)(-186 + 186 + 10l) in the form q + ol and give o. 280 Rearrange (-2190 + 2190 - 724b - 133b)(-1317 - 23b + 1317) to ib2 + g + wb and give i. 19711 Express 11444b - 9639b + 14539b in the form q + zb and give q. 0 Express (-3923 - 4615 - 4194 + 2456)(2h - 2h + 5h) in the form m + kh and give k. -51380 Rearrange 0a3 - a4 + 0a3 + (1362 - 3531a - 2859 + 1498)(4a*3 - 2a*3 + 3a*3) to the form n + ja*3 + fa*2 + ca + ia4 and give j. 5 Express (-1014 + 1014 - 95k)(4k + 3k2 - 4k)((-2k + 2k + 2k)(-6 + 9 + 1) + 4k + 0k - 6k) as f + ck + uk*3 + pk*4 + sk*2 and give p. -1710 Rearrange ((3 + 4 - 6)(3 - 3 - c) - 494 + 494 - 20c)(-9c + 0c + 8c) to the form dc + w + lc2 and give w. 0 Express 3 + 2n - 3 + (1 + 1 - 1)(-106 + 6430n - 20552n + 101) as cn + b and give c. -14120 Rearrange -12t3 + 28t3 - t2 - t*2 - 8t*3 + 2t*4 + 38t - 13t3 to the form zt*3 + qt + wt2 + mt*4 + a and give w. -2 Rearrange -9862b + 4019b + 3122b + 4204b to y + ub and give u. 1483 Express -m - m*2 + 16088 - 7414 - 7767 - 2m*2 as y + im + tm2 and give i. -1 Express -91z*3 - 34z*2 + 14z*3 + 43z*3 + 2 + 43z*3 as kz*2 + cz + uz3 + y and give c. 0 Rearrange 39t - 20t + 1 - 2t*2 - 20t + (-2 - 2 + 0)(120t*2 + 213t*2 - 239t*2) to the form k + gt*2 + ht and give g. -378 Rearrange 2j - 18j*4 + 1141j*3 - 1139j*3 - 581j*4 to lj*2 + kj + q + oj4 + dj*3 and give o. -599 Express 7522y*3 - 3y*2 + 14 - 7520y*3 - 4y + 2y4 - 2 as ay*3 + hy*4 + zy + i + my2 and give m. -3 Rearrange (-1 - 1 + 2240y*3 - 2294y*3)(1 + 0 - 2 + (-2 + 4 + 0)(2 - 2 + 1)) - 97 - 43y*3 + 97 to the form zy*2 + qy + a + cy3 and give a. -2 Express -24 + 16f + 24 + (4 + 3 - 5)(-3f + 0f + 2f) - 2f + 4 - 4 - 16f + 8f - 5f in the form cf + b and give c. -1 Express (-20 + 12 - 1)((-3n + 0n + n)(-161n - 14n + 16n) + 2n2 + 0n2 - n2 - 1)(0 + 3 - 5) in the form cn*2 + p + tn and give t. 0 Rearrange (-3 - 4s2 + 6s*2 + 2)(-77623 + 77623 + 365s + (-1 + 1 - 2)(4s + 2s - 4s) - 1 + 1 - 2s) to qs3 + cs*2 + os + a and give q. 718 Rearrange -75q3 + 8q - 56q3 + 3 + 158q*3 + 1 to the form n + tq*3 + kq + uq2 and give n. 4 Rearrange (4f*2 - 72 + 72)(-2f2 + 2f*2 + 5f*2 + (-4f - f + 2f)(10 - 10 + 7f)) to the form of*2 + b + hf*3 + yf*4 + xf and give y. -64 Express -49 - 2014i2 - 1193i*2 + 509i*2 + 49 as a + ki*2 + mi and give m. 0 Express (-1 + 2 + 1)(11 - 11 + 15t)(-629 - 405 + 213 - 1348 - 563) in the form c + at and give a. -81960 Rearrange (51 + 71 - 42)(-4002s*3 + 8392s*3 + 3s*4 - 4222s*3) to the form ws*4 + as*2 + qs*3 + us + k and give a. 0 Rearrange -g*4 - 8 + 9 + 3g3 - g2 + 1 + 21 to the form jg4 + og*2 + z + wg*3 + rg and give j. -1 Rearrange -696d - 688d + 2078d - 9396d*2 - 694d to td + g + id*2 and give i. -9396 Express -8 + 3a - 21329a3 + 10662a*3 + 10665a*3 in the form ma*2 + ia*3 + r + ga and give i. -2 Express (-23 - 44 - 12)(-14 - 10 - 8)(-3v + 3v - 2v3) in the form lv*2 + w + kv*3 + qv and give k. -5056 Express 21n2 - 52n*2 + 32n*3 + 21n*2 + 3n + 15n2 in the form rn*2 + dn + gn3 + x and give r. 5 Rearrange 2q - 4q + 0q + (4 - 2q - 4 + (7 - 7 - 3q)(0 + 0 - 2))(174 + 121 - 34) to the form z + lq and give z. 0 Rearrange -46214k*2 - 2k + 15398k2 + 15405k*2 + 928k*3 - 179k*3 + 15407k*2 to zk*3 + j + ck*2 + xk and give x. -2 Rearrange 947u3 - 10 - 16 + u2 - 1 + 88u - 948u3 + 3 to the form zu + su3 + ru*2 + p and give r. 1 Express 244o - 711o + 234o - 417 - 1321 + 234o as bo + a and give a. -1738 Rearrange (77n - 5n + 173n)(11 + 26 + 12)(-n + 3n + n) to the form m + rn2 + vn and give r. 36015 Rearrange -33k2 - 174k + 2 + 31k2 + 11k - 255k to the form nk*2 + o + bk and give n. -2 Rearrange 6o4 - 6o4 + o4 + (2o - 2o*2 - 2o)(-4 - o2 + 4) - 118o*4 + 29o*4 - 264o*4 to co*2 + qo*4 + po*3 + bo + n and give q. -350 Express -42d3 + 4d - 21d3 + 5d + 19d3 - d4 + 3d as l + ud + md*3 + sd*4 + qd*2 and give m. -44 Rearrange 1 + 0 + 2z*3 + 1 + 22z*2 + 302z - 4 - 304z to g + az*3 + tz + iz2 and give a. 2 Rearrange (-10m*2 - 1 + 1)(1 - 3 + 1) + 18m2 + 226 - 226 + (-4m + 5m + 5m)(0m + 3m - 4m) to the form gm + xm2 + l and give x. 22 Rearrange -1 + l2 + 1 + (-1 + 4 + 2)((2 + 1 - 1)(2l + l - 6l) + 4l + 5 - 5)(10l + l + l) to the form hl*2 + dl + s and give h. -119 Rearrange -3r - 155889r*3 + 8 + 155885r*3 + 4 to vr*2 + cr + i + dr3 and give d. -4 Express 4 + 11l + 8l + 44l*3 - 23l + 2l2 + 4l as zl + wl*2 + nl*3 + s and give s. 4 Rearrange (-3l*2 - 2l*2 + 6l*2)(4 - 3 - 2) + 740l2 - 501l*2 - 407l*2 to the form cl + b + wl2 and give w. -169 Rearrange 2 + 4v*3 - 120735v*2 - 12v*3 - 8v + 120732v2 to the form dv**3 + z	{ "pile_set_name": "DM Mathematics" }
et s(h) = -31h3 - h2 - 11h - 11. Let u(x) = -6x3 - 2x - 2. Let j be 277/(-1108) - (0 - 45/4). Calculate ju(k) - 2s(k). -4k3 + 2k*2 Let u(t) = -14t*3 + 15t*2 - 62t - 2. Let m(y) = 26y3 - 28y*2 + 123y + 4. Determine 8m(b) + 15u(b). -2b3 + b2 + 54b + 2 Let j be (1 + 25)/((-1342)/671). Let k(i) = 17i - 19. Let x(a) = 0a - 3 - 6 + 8a. Give jx(u) + 6k(u). -2u + 3 Let l(k) = -4k2 - 531k + 3178. Let x be l(6). Let n(c) = -1007c + 152. Let z(m) = 33m - 5. Determine xz(j) - 5n(j). 19j Let j(t) = -56. Let o(p) = -p - 1895. Calculate -j(m) + o(m). -m - 1839 Let d(q) = -3q2 + 21. Let v be 9 - ((-50)/(-5) - 0). Let l(z) = z2 + 1. What is vd(k) - 4l(k)? -k2 - 25 Let t(q) = -q2 - 7q - 1. Let a(m) = 8m*2 + 25m - 3. Determine -a(n) - 4t(n). -4n*2 + 3n + 7 Suppose -9898 + 648 = 937n - 817. Suppose -6h + 7h = 2. Let p(o) = 21o*2 + 9. Let i(s) = 5s*2 + 2. Determine hp(d) + ni(d). -3d2 Let t(z) = -z2 - z - 8. Let o(n) = 3n + 196. What is o(c) + t(c)? -c2 + 2c + 188 Suppose -2o = 6v - 7v + 9, 8v + 5o = 9. Let i(q) = -48q2. Let u(f) = -f2. What is vi(s) - 126u(s)? -18s2 Let k be 24/(-12)5/5. Let o be ((0 - 0) + 1)1. Let d(p) = -p2 + p - 1. Let h(j) = -3j*2 + 3j. Give kd(u) + oh(u). -u2 + u + 2 Let r(a) = a2 - 4a - 19. Let f be r(7). Let g(s) = 17 + 14 - 71 + 3s + 25 + 14. Let u(w) = -2w. Give fu(l) + 2g(l). 2l - 2 Let i(q) = 3q - 7. Let z be -3(-3 - 40/(-12)). Suppose -o - s = 7, 3o - 2s - 12 = 4o. Let a(j) = -j + 1. What is oa(k) + zi(k)? -k + 5 Let k(u) = -9391u + 1. Let i(r) = 28105r - 3. Give -4i(t) - 11k(t). -9119t + 1 Let a(g) = 28g + 22. Let y(c) = -3c - 4. Let l(o) = a(o) + 5y(o). Let t(u) = 7u + 1. Determine 2l(w) - 5t(w). -9w - 1 Let t(v) be the first derivative of v4/4 - v3/3 + v2/2 - 1776. Let y(k) = -6k*3 + 4k*2 - 4k + 1. Give -4t(b) - y(b). 2b*3 - 1 Let g(j) = -907j*2 - 29j + 15. Let p(s) = -912s2 - 25s + 13. Calculate -6g(q) + 7p(q). -942q2 - q + 1 Let d(v) = v2 - 52v + 30. Let y(f) = -2f2 - 2f - 5. Give d(p) + 6y(p). -11p*2 - 64p Let j(q) = -532q2 + 8q - 12. Let f(d) = -800d2 + 12d - 19. Calculate 5f(b) - 8j(b). 256b2 - 4b + 1 Suppose -3s + s - 222 = 0. Let b = s + 108. Let u(j) = -6j + 2. Let a(g) = -5g + 2. Give ba(y) + 2u(y). 3y - 2 Let k(z) = -2z3 - 8z*2 + z - 2. Let q(r) = -12r*3 - 16r*2 + 59r - 3. What is 2k(c) - q(c)? 8c*3 - 57c - 1 Let w(c) = 423c3 - 58c*2 + 10c - 20. Let z(i) = -141i3 + 19i*2 - 3i + 6. What is 3w(s) + 10z(s)? -141s3 + 16s*2 Let i(w) = -1325. Let u(v) = 757. Let h(a) = -4i(a) - 7u(a). Let r(l) = -l + 1. Calculate -6h(s) - r(s). s - 7 Let k(d) = 969d + 133. Let q(p) = 25p - 27. Let f(x) = 74x - 71. Let l(w) = 3f(w) - 8q(w). Determine 3k(a) - 133l(a). -19a Let o(x) = 4x. Let v(j) = 12j + 1. Suppose -2898 = -635l + 221l. Determine lo(r) - 2v(r). 4r - 2 Let v(l) = -2698614l*2 - 2448l - 2448. Let n(q) = -5513q2 - 5q - 5. Determine 2448n(a) - 5v(a). -2754a2 Let t(d) = -9d*3 + 7d*2 - 15d + 7. Let v(a) = 5a3 - 4a*2 + 8a - 4. Suppose 4g = 5g + 3l - 7, -g + 3l + 7 = 0. What is gv(x) + 4t(x)? -x*3 - 4x Let l = -6646 - -6645. Let x(w) = -2w - 1. Let d be x(2). Let o(t) = 4t2 - t. Let g(u) = -u2. Calculate dg(n) + lo(n). n*2 + n Suppose 0 = 673v - 663v + 70 - 60. Let c(m) = -4m*3 - 5m*2 - 5m + 5. Let u(k) = 1 - 5k - 2k*3 + 4k - k2 + k3. Determine vc(b) + 5u(b). -b3 Let g(i) be the first derivative of i4/4 - i*3/3 - 858. Let h(j) = 4j*3 + 2j + 3. What is -g(x) - h(x)? -5x3 + x2 - 2x - 3 Let v(i) = 43i - 21. Let f(d) = -d + 2. What is 22f(o) + 2v(o)? 64o + 2 Let y(d) = 28d - 51392. Let l(v) = -10v + 17115. Calculate 11l(j) + 4y(j). 2j - 17303 Let c(d) = -141d*2 + 56d - 23. Let f(g) = -118g2 + 58g - 21. What is 5c(n) - 6f(n)? 3n2 - 68n + 11 Let b(p) = -3p2 - 7p + 4. Let n be 6/(-8 + 2)0. Suppose 3q - 6q = 2w - 29, -5w + 2q + 25 = n. Let f(j) = 4j2 + 10j - 6. Calculate wb(k) + 5f(k). -k*2 + k - 2 Let g(n) = -4n - 4. Let w(r) be the third derivative of -6r + 0 - 5r*2 - 5/3r*3 - 5/12r*4. What is -12g(j) + 5w(j)? -2j - 2 Let n(s) = 76398s - 29853. Let v(x) = -317x + 124. Determine -4n(p) - 963v(p). -321p Let p(l) = -6l*2 + l - 2. Let a(u) = 89u*2 - 9u + 15. Let i(w) = 38w2 - 4w + 7. Let n(v) = 2a(v) - 5i(v). Give 2n(f) - 5p(f). 6f2 - f Let s(v) = 278v - 3. Let y(z) = 1393z - 17. Determine -11s(p) + 2y(p). -272p - 1 Let n(u) = 83u + 12. Let v(h) = 369h + 47. Calculate 18n(k) - 4v(k). 18k + 28 Let a(t) = -3t*3 + 6t*2 + 310t + 4. Let s(j) = 7j3 - 14j*2 - 621j - 10. Give -5a(l) - 2s(l). l*3 - 2l*2 - 308l Let g(s) = -833s2 + 8s - 2. Let r(j) = 69138j2 - 668j + 167. Determine -334g(b) - 4r(b). 1670b2 Let c(n) = -4127n + 34. Let h(i) = -4i - 7. Give -c(m) - 5h(m). 4147m + 1 Let p(y) = -3y*3 + 2y*2 + 4y - 4. Suppose 74122i = 73979i + 286. Suppose 5 = -o + 2o. Let s(l) = 7l*3 - 5l*2 - 9l + 9. Calculate is(h) + op(h). -h*3 + 2h - 2 Let u(j) = 61j - 5. Let c(a) = 4 - 1 + 0 + 504a - 1051a + 514a. Let x(i) = 11c(i) + 6u(i). Let z(o) = -16o - 15. Calculate 11x(n) + 2z(n). n + 3 Let v(y) = 6y + 6. Let j(l) = 171648l + 177012. Determine -2j(h) + 59004v(h). 10728h Let y(q) = -q3 - q2 + q - 1. Let m = -3678 + 3679. Let n(x) = -3x3 + 2x*2 - 3x + 2. Calculate mn(d) + 2y(d). -5d3 - d Let m(n) be the first derivative of -n2 - 4n - 206. Let k(t) = 1. Determine -3k(h) + m(h). -2h - 7 Let v(q) = -1. Let l = 56 + -54. Let w be -6(l - 8)4/(-16). Let a be (-24)/w + 4/(-6). Let z(u) = -u + 3. Calculate av(t) + z(t). -t + 1 Let l(j) = -3j*2 - 138j - 499. Let n be l(-42). Let a(f) = -100f2. Let s(t) = -250t*2. Give ns(b) - 12a(b). -50b*2 Let f(a) = 3a2 - 4 - a2 - a2. Let y be (5/15)/(332/168 - 2). Let i = -16 - y. Let r(d) = d2 - 2. What is if(j) + 5r(j)? 3j2 - 2 Let t(s) = 10s*3 - 5s*2 - 5s + 5. Let n = 2196 + -2200. Let i(w) = 10w3 - 4w*2 - 4w + 4. Calculate nt(u) + 5i(u). 10u3 Let v be (5 - (-322)/(-35))(-120)/72. Let d(z) = -4z3 - 37z*2 - 5z + 5. Let j(s) = 6s3 + 55s*2 + 7s - 7. Calculate vd(y) + 5j(y). 2y3 + 16y*2 Suppose -3d + 8 = -2l - 23, 0 = -5d - l + 43. Let s = -8 + 18. Let w(m) = -d - m + s + 2m. Let h(r) = 2r*3 - 10r - 10. Determine -2h(g) - 20w(g). -4g3 Suppose -2r + 31 = -31. Let d(x) = 12 - 2x - r + 16. Let g be 1 - 4 - (1 - (2 - 3)). Let j(q) = q + 1. What is gj(w) - 3d(w)? w + 4 Let g(u) = 28u*2. Let x be g(3). Suppose -58p + 70p + 7 = 67. Let z(b) = -pb2 + x + 264 - 527. Let j(f) = f2 + 2. Calculate -33j(a) - 6z(a). -3a2 Let z(w) = -35w*2 - 174w + 13. Let k(c) = -c*3 + 11c*2 + 58c - 4. Give -13k(j) - 4z(j). 13j3 - 3j*2 - 58j Let p(k) = -40k + 3. Let t(a) = 306a - 335. Let c(u) = -77u + 75. Let b(s) = -9c(s) - 2t(s). Give 4b(o) + 7p(o). 44o + 1 Suppose -52t - 290 = -110t. Let u(j) = 3j + 11. Let s(o) = 3o + 10. What is tu(m) - 6s(m)? -3m - 5 Let q be 6/(-4)(-44)/(-11). Let l(d) = -10d + 16d - 26d3 + 21d*3. Let k(i) = 20i*3 - 25i. Determine qk(a) - 25l(a). 5a3 Let y(l) = l - 1. Let a be ((-4)/10)/(-8 - (-39)/5). Let g(o) = -3o*a - 2o + 5o2 - 3o*2 + 0o*2 + 3. Give g(t) + 2y(t). -t*2 + 1 Let k(x) = 2x - 11884. Let f(z) = 12z - 71306. Calculate -2f(q) + 13k(q). 2q - 11880 Suppose -19 = -4r - d - 36, r + 3d = -7. Suppose -243 = 6m - 3m. Let p = -48 - m. Let x(u) = -u - 4. Let v(f) = -9f - 33. Calculate px(z) + rv(z). 3z Let d(k) = k*2 + k - 1. Let v be ((-155)/(-50) - 3) + (-102)/20. Let o(f) = -4f*3 + 7f*2 + 5f - 4. Give vd(x) + o(x). -4x*3 + 2x*2 + 1 Let z(m) = 54m - 17. Let h(g) = 61g - 18. Calculate -6h(b) + 7z(b). 12b - 11 Let o(d) = -4d2 + 162d + 14. Let i(f) = f*2 - 8. Give -2i(r) - o(r). 2r2 - 162r + 2 Let u be (-2)/(-4) - 10/(-4). Let w(y) = 170y2 + 40. Let o(h) = 18523452h*2 + 1 - 4 - 18523465h*2. Give uw(n) + 40o(n). -10n*2 Let s(n) = 30 - 186 + 4n + 150. Let i(z) = z - 1	{ "pile_set_name": "DM Mathematics" }
k - -33. Which is the third biggest value? (a) l (b) 0 (c) 2/31 b Let h = -65 - -63. What is the biggest value in -3, h, -2/9? -2/9 Let u = -1.0182 + 0.9182. Let f be (1 + -2 - 1)2. What is the second smallest value in u, -0.5, f, -0.2? -0.5 Let i be (-42)/(-8)43/(-129). Let l = 16 - 16.29. Let d = -0.01 + l. Which is the biggest value? (a) i (b) -3/7 (c) d c Let d = 8 + -11. Let k be 21/14(-23 + d). Let m be (-10)/(-15) + 20/k. What is the second smallest value in -8, m, -2? -2 Let d = -230 + 225. What is the third smallest value in 15, d, 2, 1? 2 Suppose 6 = 2k + 4n + 8, -3k = -n - 18. Let o = 136/3 + -45. What is the second biggest value in k, o, 0.5, -5? 0.5 Let b = -102.3 + 97.3. What is the biggest value in -0.2, -0.5, 1/5, b? 1/5 Let h be (-1)/(-21)(18 + -20). Which is the second biggest value? (a) -1 (b) -5 (c) 2 (d) h d Let f = -82 - -30. Let u = 55 + f. What is the smallest value in -1/5, 1, u, 0.2? -1/5 Let m(z) = 9z*2 + 107z - 17. Let r be m(-12). Which is the second biggest value? (a) -0.5 (b) r (c) -68 b Let w = -0.2883 - 0.1117. What is the biggest value in -29/8, -0.5, w? w Let y = 0.177 - -0.653. Let k = 0.27 + y. Let u = -88/145 + 6/29. Which is the biggest value? (a) u (b) 3/2 (c) k b Let i be (-10)/612/15. Let f = 4.014 - -0.086. Let t = f - 4. What is the second biggest value in i, t, -0.4? -0.4 Let i be (544/(-88) - 3) + 9. What is the biggest value in 1/8, -108/7, i? 1/8 Suppose -w + 18 = 6. Let k = w - -28. Let i be ((-8)/(-110))/((-16)/k). Which is the second smallest value? (a) -2 (b) 0.03 (c) i c Let i = 0.09 + -3.09. What is the biggest value in i, 6, -4? 6 Let i = 0.01 - 2.01. Let w = i - -2. Let f = -1.39 + 1.89. What is the biggest value in -4/5, w, f? f Let s = -3.8 + 3.7. Let a = -9 - -18. Let v = 13 - a. What is the smallest value in v, -4, s? -4 Let q = 7.86 + -10.86. What is the second biggest value in 0.97, q, -4? q Let s = -9350/19 - -492. What is the biggest value in -3/2, -0.2, 3/7, s? 3/7 Let z be (-1)/(-5)(-105)/28. Let h = z - -5/4. Let r = 5 - 10. What is the second biggest value in r, 2/3, h? h Let a = 5 - 1.6. Let d = -2.9 + a. Let v = 5 + -3. What is the biggest value in -5, v, d? v Let z = -2.6 - 7.4. Let x = z + 5. Let g = -50.1 + 50. Which is the smallest value? (a) g (b) x (c) 2 b Let h = 4 - 4.4. Let z = 0.002 - 4.002. Let s = -8.5 - -8. Which is the second biggest value? (a) z (b) s (c) h b Let m = -34.5 - -35. Suppose 9q - 7q + 18 = -3v, 2q + 4v = -22. Which is the second biggest value? (a) q (b) m (c) 2 b Suppose 7i = i + 12. Suppose 8 = il + 16. What is the third smallest value in -2/3, -0.02, l? -0.02 Let x = 236 - 237. Which is the second smallest value? (a) x (b) -1/22 (c) -4 a Suppose -3 + 2 = 3u - 2y, -3y = 5u + 8. Which is the smallest value? (a) -3 (b) -6 (c) 5 (d) u b Let u = 0.1129 - -3.8871. What is the smallest value in u, 0.5, -9? -9 Let k = 39 + -39. Suppose 4g = 4s - 32, k = -3g + 4g + 5s - 22. What is the third smallest value in g, -2, 1/5? 1/5 Let o be -6 + 634/30. Let h = 1.5 - 2. What is the third biggest value in 0.5, h, o? h Let g = 2.5 + -2. Let v = -332 - -329. Which is the third biggest value? (a) v (b) g (c) -0.2 a Let x = 0.44 + -0.396. Let v = -0.956 - x. Which is the biggest value? (a) v (b) -4 (c) 3 (d) -0.3 c Let y = 1.5 + 4.9. Let t = y - 5.9. What is the smallest value in 0.1, 3, t? 0.1 Let g(f) be the third derivative of -7f*4/24 + 5f*3/3 + 18f*2. Let s be g(2). Which is the third biggest value? (a) 0.01 (b) -1 (c) s c Let j be (-19)/(-4) + 18/(-24). Suppose -16 = jd, -4d + d - 88 = 2i. Let p = -191/5 - i. What is the biggest value in 4, p, 5? 5 Let h = -1.7 - -0.5. Let l = -1.34 - h. Let g = 0.13 + l. What is the third smallest value in -0.4, g, -3/7? g Let r = 196.4 + -196. Which is the second biggest value? (a) 2 (b) -82 (c) r c Let k = 18/13 + -38/65. What is the third biggest value in k, 1, 2, -5? k Let d be (48/(-28))/((-10)/35). Let u be d/((-24)/(-28)) + -2. What is the second smallest value in -3, 1, u? 1 Let i(t) = -3t2 + t + 1. Let h be i(-1). Let d be ((-2(-2)/(-14))/(-2))/((-88)/(-308)). Which is the second biggest value? (a) h (b) d (c) 1 b Let w be 1 + 2 + (-90)/26. Let p = -1442 + 1441.5. Which is the fourth biggest value? (a) 0.4 (b) w (c) p (d) -0.2 c Let p = 1.17 - -7.83. Let v = p - 8.8. Which is the biggest value? (a) v (b) 0.16 (c) 1 c Let h(c) = -c*3 - 50c*2 + 49c - 105. Let f be h(-51). What is the smallest value in -3/2, f, 5, 0.2? f Let k(d) = -3d - 8. Let g be k(-7). Let q = 29 - 27. Let l be (q(-2)/10)/((-18)/180). Which is the smallest value? (a) 3 (b) l (c) g a Let q = -185.6 + 186.1. Suppose -p + 0p = -2. Which is the biggest value? (a) q (b) -1/2 (c) p (d) 4 d Let o = 94.3 - 111.3. Which is the third biggest value? (a) 0.2 (b) o (c) 2/3 b Let l = 16 - 12. Let x(j) = j2 + 4j - 1. Let f be x(-4). Let z(u) = 5u + 3. Let m be z(f). Which is the smallest value? (a) m (b) 3 (c) l a Let l = 16 - 26. Let k = 17 + l. Let m = 5 - k. Which is the third biggest value? (a) -1 (b) m (c) -4 c Let r(o) = o3 - 3o*2 - 2o - 5. Let w be r(4). Let i = -0.537 + 0.637. Which is the third biggest value? (a) w (b) 2 (c) i c Let u = -44 - -44.4. Let l = -3 + 4. Which is the smallest value? (a) u (b) 2/17 (c) l b Suppose q - 3q - 3g + 8 = 0, -3q + 4g - 22 = 0. Let f be q/10 + (-1345)/150. Let w = f + 17/2. Which is the third smallest value? (a) -1/8 (b) 0 (c) w b Let o be (0/(-8 - -5))/(1 + 1). Suppose 3c + oc + 3 = 0. Let n = -1 + -4. What is the biggest value in c, n, 2/3? 2/3 Let p = -337 + 341. Which is the second smallest value? (a) -0.4 (b) 5 (c) p c Let t = 29 - 21. Suppose -7j = -3j - 112. Let s be (152/j)/2 - 3. Which is the third biggest value? (a) 3/8 (b) t (c) s c Let w(f) = -2f. Let g be w(5). Let y be (-36)/(-15)g/2. Let x be (-45)/y - (-4)/16. Which is the third biggest value? (a) x (b) -2/13 (c) -0.4 c Let d = -277/1824 - 9/608. Let v = 1 - 1.05. Which is the biggest value? (a) d (b) v (c) -1 b Let v = -91 - -93. What is the second smallest value in v, 2/5, 0.04, -1? 0.04 Let x = 6 + -1. Let v be 3/4 - 42/(-56)(5 + -4). Suppose -15 = -8y + 3y. Which is the second smallest value? (a) y (b) x (c) v a Let s = -42.51 - 2.19. Let u = 44 + s. What is the biggest value in -5, 1, u? 1 Let m = 1.69 + -1.39. Let x = -20 - -20.4. What is the biggest value in 0.5, x, m, 1/11? 0.5 Suppose -w - 35 = -6w. Let j = w - 7. Which is the third smallest value? (a) 5 (b) j (c) 3 a Let j be (3 - 10/2)168/(-7). What is the biggest value in 2, j, -5? j Let d = 0.4383 + -0.0383. Suppose -2n = -n - 2. Which is the second biggest value? (a) 1/7 (b) d (c) n b Suppose 2z = 3z + 3q - 33, z - 38 = -4q. Which is the smallest value? (a) -3 (b) -2 (c) z a Let n = 5 + -9. Let l = n - -3.87. Let p = 0.13 + l. Which is the third smallest value? (a) -3/5 (b) p (c) 1/4 c Let l be (2/(-2))/(2/42). Let k be (l/12 - -2)4. Suppose -j = -2u + k, j + 3 = -0j. Which is the smallest value? (a) u (b) -2/5 (c) 5 a Let k = -236 + 236.13. Let g = 13 + -8. Which is the fourth smallest value? (a) -1/2 (b) g (c) k (d) 2 b Let a = 361/20 + -94/5. What is the smallest value in a, 4, -0.01, -5? -5 Let f = -4.7 - -4.4. Suppose -5c + 10c + 2a - 5 = 0, -a = -c + 1. What is the second biggest value in 2/5, c, f, 0.3? 2/5 Let z = -23/63 - -1/7. Suppose -15 = -5q, -2c = -3c + 4q - 15. Let w = 28 + -28. What is the second smallest value in z, c, w? z Let i = 159.1 + -159. Let g = -21.64 + 22. Let z = -0.06 + g. Which is the third biggest value? (a) -4 (b) i (c) z a Let m = -253 + 257. What is the third smallest value in 48, m, -1/2? 48 Let s = 0.29 + 0.01. Which is the third smallest value? (a) s (b) 2/13 (c) 9 c Let g = 51 - 49. What is the biggest value in 1, g, -15/2, -1/2? g Let g(a) = -2a - 9. Let o(y) = -4y - 18. Let v(u) = 10g(u) - 4o(u). Let d be v(-9). Let t = -16 + d. What is the biggest value in t, -0.2, 7? 7 Let f = -16.6 + 17. Let k = 0.8 - 1. Let m = 1315/4676 + 3/668. Which is the third smallest value? (a) f (b) k (c) m a Suppose 41*a = -81 - 288. What is the third s	{ "pile_set_name": "DM Mathematics" }
+ 3z. What is y(b(c))? 7c*2 Let z(q) = -2q*2 - 79q. Let r(x) = -3x. Calculate z(r(o)). -18o*2 + 237o Let o(d) = 10d - 5. Let k(b) = -5b + 2. Let w(r) = -5k(r) - 2o(r). Let t(n) = n*2 - 6n + 3. Let a be t(6). Let l(u) = 3 - u - a. Determine w(l(v)). -5v Let b(h) = -2h*2. Let p(j) = 11j - 4. Suppose -6 - 29 = -5d. Let t(a) = 21a - 7. Let x(r) = dp(r) - 4t(r). Determine b(x(y)). -98y2 Let f(p) = p2. Let k(v) be the first derivative of 1/2v*2 - 1 + 0v. Give k(f(c)). c2 Let y(t) = -t2 - 16 + 16 - 11 + 0t2. Let f(a) = -2a. What is y(f(z))? -4z2 - 11 Let n(b) = -26b. Let j(w) be the second derivative of -w*4/6 - 11w. Determine n(j(y)). 52y2 Let x(a) = 36a*2 - 1 + 1 - 40a*2. Let l(d) = d. Give l(x(s)). -4s2 Let o(w) = -w2. Let b(z) = z*2 - 4z + 4. Let q be b(4). Let n(p) = 16p - qp - 9p. Determine n(o(v)). -3v*2 Suppose m + 3 = 7. Let q(p) = -4 + 6p + 4 - mp. Let v(g) = 6g. What is q(v(y))? 12y Let c(g) = 2g - 1 + 1. Let d(h) be the first derivative of 2h3/3 - 22. Give c(d(k)). 4k*2 Let l(g) = 15g + 1. Let i(m) = -4m. What is l(i(w))? -60w + 1 Let m(t) = t. Let c(q) be the second derivative of -q7/1260 - q4/4 - 4q. Let p(o) be the third derivative of c(o). Calculate p(m(w)). -2w2 Let m(w) = -w3 + w*2 + w + 4. Let q be m(0). Let f(b) = 2b. Let z be f(q). Let u(s) = -zs + 0s + 2s. Let g(h) = 2h. What is u(g(o))? -12o Let j(p) = -p2 - 8p + 13. Let f be j(-9). Let x(o) = -4o - o + fo. Let a(z) = 0z - 2z + 0z. Calculate a(x(h)). 2h Let g(j) be the third derivative of -7j4/12 + 33j*2. Let q(h) = -h. Determine q(g(i)). 14i Let q = 17 - 11. Let t(k) = -2 + qk2 + 1 + 6 + 5k. Let m(r) = 7r2 + 6r + 6. Let l(x) = 5m(x) - 6t(x). Let w(j) = 2j. Determine w(l(i)). -2i*2 Let g(w) be the second derivative of -7w6/720 - w4/6 + 2w. Let y(u) be the third derivative of g(u). Let m(r) = r2. Determine m(y(f)). 49f*2 Let j(b) = -74b. Let z(r) = -79r2. Calculate j(z(d)). 5846d*2 Let r be 0 - 1 - (-4 + 3). Let c(a) be the third derivative of ra*3 + 1/12a*4 + 0 + 0a + 2a2. Let l(v) = 5v. Calculate l(c(j)). 10j Let m(f) = 936f*2. Let q(i) = 28i*2. What is q(m(a))? 24530688a*4 Let r(m) = 9m. Let g(f) = 17f. Give g(r(u)). 153u Let n(o) = o2. Let s(v) = v2 - 7v + 5. Let i be s(4). Let f(j) = 16j*2 + 7j. Let h(t) = 11t2 + 5t. Let x(d) = ih(d) + 5f(d). Calculate n(x(m)). 9m4 Let q(j) = 6j2. Let a(u) be the second derivative of -u4/6 - 3u. Give a(q(s)). -72s*4 Let r(u) = -1109u + 6. Let k(z) = 2z. What is r(k(o))? -2218o + 6 Let h(p) = -p. Let b = -4 - -10. Let k = b - 2. Let t(m) = k - 4 + 3m2. Calculate h(t(r)). -3r2 Let c(f) be the first derivative of -f4/8 - f*2/2 - 2. Let s(j) be the second derivative of c(j). Let m(d) = -2d - 255 + 255. Calculate s(m(i)). 6i Let x(z) = -2z. Let m(w) = -2w2 - 4w - 4. Let s(l) = l + 1. Suppose v - 1 + 0 = 0. Let a(f) = vm(f) + 4s(f). Determine x(a(t)). 4t2 Let o(n) = -18n + 6. Let t(z) = z - 1. Let g(q) = -o(q) - 6t(q). Let m(b) = 3b. Calculate g(m(c)). 36c Let m(y) be the first derivative of -y2/2 - 6. Let k(u) = -2u. What is m(k(p))? 2p Let f(m) = -2m. Let z(o) = o - 27. Give f(z(w)). -2w + 54 Let j(b) = -b3 - 2b*2 + b + 2. Let a be j(-2). Let m(z) = 3z*2 + az2 + z2. Let k(p) be the third derivative of p*4/12 + 4p*2. What is k(m(c))? 8c*2 Let g(n) = 6n. Let q = -1 - -5. Let c(x) = -3x + qx - x + x. Calculate g(c(o)). 6o Let q(f) = -3f*2. Let b(v) = 0 + 6 + 2v - v - 7 - v*2. Let h(o) = -2o + 2. Let m(w) = 2b(w) + h(w). Give m(q(x)). -18x*4 Let f(h) = -37 + 37 + 2h*2. Let m(k) = -14k*2. What is m(f(q))? -56q*4 Let r(u) = 2u. Suppose 0 = -l - 2 - 0. Let a = l + 4. Let b(t) = -at2 + 0t*2 + 4t2 - t2. Calculate r(b(z)). 2z2 Let l(d) = -2d2. Let k(i) be the second derivative of -i7/1260 + i*4/4 - 2i. Let t(j) be the third derivative of k(j). What is t(l(m))? -8m4 Let z(u) = 3u - 3u - 3u. Let k(m) be the first derivative of -m5/60 - m2/2 - 1. Let w(a) be the second derivative of k(a). Give z(w(r)). 3r2 Let v(u) = u2. Let d(x) be the second derivative of -x4/2 - 5x. Calculate d(v(w)). -6w4 Let g(y) = 2y. Suppose -h = 2t - 0t - 8, -t = 4h - 11. Let u(a) be the first derivative of 1/2a*2 + 0a - h. Calculate u(g(s)). 2s Let r(m) = -3m*2. Let y(x) = 26x - 3. Give r(y(i)). -2028i2 + 468i - 27 Let v(o) = -15 + 15 - 3o + 0o. Let d(r) = 17r2. What is d(v(s))? 153s2 Let r(m) be the first derivative of m2 - 23. Let b(l) = -2l - 2. Calculate r(b(o)). -4o - 4 Let m(n) = n*2. Let f be (25/(-50))/((-2)/8). Let r(t) be the third derivative of 0 + 0t + 0t3 + 0t*4 - 2t*f + 1/60t5. Calculate r(m(a)). a4 Let o(g) = -g*2. Let v = 7 + -5. Let l(f) = 0 + 0 + 0 - vf. What is o(l(w))? -4w2 Let c(a) = -a2. Let k(b) = 4b + 434 - 434. What is k(c(s))? -4s2 Let l(x) = 968x*2. Let w(s) = 2s. Give w(l(d)). 1936d2 Let g(v) = -5v*2. Let i(m) = -3m + 9. What is g(i(o))? -45o2 + 270o - 405 Let m(y) = 6 - 6 + 2y2. Let k(z) = z + 8. Let f be k(-6). Let i(u) = -17 + 17 + uf. What is i(m(p))? 4p*4 Let n(a) = -10a. Let s(m) be the third derivative of -m*6/180 - 4m*3/3 + 4m*2. Let j(l) be the first derivative of s(l). Determine j(n(g)). -200g2 Let u(g) be the first derivative of g3/3 - 1. Let s(h) = h*2 + 3h. Let p = -15 - -12. Let j(x) = x*2 + x. Let c(t) = pj(t) + s(t). What is c(u(i))? -2i4 Let f(m) = -9m*2 + 3m. Let v(q) = -18q2 + 5q. Let b(s) = 5f(s) - 3v(s). Let d(j) = j. Calculate d(b(o)). 9o2 Let q(x) = -16371x2. Let j(t) = t2. Determine j(q(v)). 268009641v4 Let f(i) = 3i*2. Let g(n) = -1413n. Determine g(f(j)). -4239j2 Let b(r) be the second derivative of -r4/3 - 16r + 2. Let d(j) = j. Give d(b(l)). -4l2 Let q = -1 + 6. Let a(p) be the first derivative of -2 + 1 + q + p2. Let t(i) = i2. Calculate a(t(o)). 2o2 Let r(f) be the third derivative of -f5/120 + f*3/2 - 3f*2. Let i(m) be the first derivative of r(m). Let y(c) = -2c*2. What is y(i(p))? -2p*2 Let u(b) = -11b*2 + 11. Let f(c) = 2c. Calculate u(f(p)). -44p2 + 11 Let x(a) = -2a. Let j(b) = -334b2. What is j(x(l))? -1336l*2 Let k(x) = 4x - 48x2 - 4x + 61x2. Let h(l) = -l2. Calculate k(h(d)). 13d*4 Let t(k) = -9k + 24. Let z(c) = 2c - 5. Let u(s) = -5t(s) - 24z(s). Let w(b) = 2b*2. What is w(u(y))? 18y*2 Let p(j) = -39j*2. Let o(a) = 59a - 1. Give p(o(f)). -135759f2 + 4602f - 39 Let h be (6 - (0 - -2)) + -2. Let n(l) be the first derivative of -1/2lh + 2 + 0l. Let b(c) = -2c2. What is n(b(k))? 2k*2 Let h(r) = 7r*2 - 6. Let t(j) = -15j*2 + 13. Let i(x) = 13h(x) + 6t(x). Let p(l) = -1081l - 8l2 + 543l + 538l. Calculate p(i(q)). -8q*4 Let w(q) = 1190q + 21q2 + 18q*2 - 1192q. Let i(y) = -y*2. Calculate w(i(z)). 39z*4 + 2z*2 Let z(w) = -12w*2. Let f(s) = 60s - 25. Let l(o) = -5o + 2. Let c(i) = 2f(i) + 25l(i). Determine z(c(v)). -300v*2 Let k(f) = 120f. Let m(j) be the second derivative of -j*4/12 - 24j. What is m(k(d))? -14400d2 Let y be (-2)/4 - 5/(-2). Let f(s) = -2s + 2s + 2s2 - sy. Let b(p) = 2p2. Determine b(f(o)). 2o*4 Let j(r) be the first derivative of -2 - 1 + 2r2 + 0. Let c(m) = m2. Determine j(c(y)). 4y2 Let k be -4-3(-2)/(-12). Let v(h) = -1 + 1 - 2h*k. Let g(s) = 4s*2 - 4s*2 + 4s*2. What is g(v(f))? 16f*4 Let x(t) = -10t*2. Let c(g) = 5g. Let k(i) be the second derivative of i*3/6 + 2i. Let r(z) = -2c(z) + 11k(z). Calculate r(x(d)). -10d2 Let j(h) = -h - 4. Let u(f) = -8f*2. Calculate j(u(a)). 8a*2 - 4 Let p(i) = -2i. Let m(a) = 2. Let b(h) = -h + 5. Let z(t) = 2b(t) - 5m(t). Determine p(z(w)). 4w Let t(x) = x2. Let h(f) be the third derivative of -f8/10080 + f5/30 - 3f*2. Let q(u) be the third derivative of h(u). What is t(q(d))? 4d*4 Let v(o) be the first derivative of 7o*3/3 - 3. Let a(x) = -2x*2. Calculate v(a(r)). 28r*4 Let j(d) = 14d. Let k(n) = 5n. Suppose -p = p - 6. Let z(g) = pj(g) - 8k(g). Let u(o) = 5o - 3o - 3o. Determine u(	{ "pile_set_name": "DM Mathematics" }
0.1 b What is the smallest value in -2/5, 2/5, 1, -5515? -5515 Which is the smallest value? (a) -1 (b) -11 (c) 7/199 b What is the second smallest value in 6, 738, 525? 525 Which is the smallest value? (a) 2/13 (b) 0.0383 (c) -0.1 (d) -10 (e) -0.4 (f) -8 d What is the smallest value in -0.01, 0.2, -2.2, 9? -2.2 What is the sixth smallest value in -0.4, 1, 3/5, 1/4, -0.117, -3/13? 1 What is the fourth biggest value in -4.983, -2, -0.4, 4? -4.983 What is the third biggest value in -1/7, -4, 32703? -4 What is the second smallest value in -3/5, 0.8, 5, -0.14, -0.4011, -1/4? -0.4011 What is the biggest value in -0.5, 5, 2, -6/5, -84.27? 5 Which is the third smallest value? (a) 3/2 (b) -2/7 (c) 2/11 (d) 2 (e) -0.0219 (f) 1/11 f Which is the third smallest value? (a) -1 (b) 3 (c) 0 (d) 97/3 (e) -4 c What is the fourth smallest value in -2631, -6/7, -3, 0.2? 0.2 Which is the biggest value? (a) 5/4 (b) -0.2 (c) -3 (d) -731 (e) -2/7 a Which is the third biggest value? (a) -1 (b) 5 (c) -0.3 (d) 28 (e) 0 (f) -1/58 e Which is the fifth biggest value? (a) -5 (b) -1 (c) -29/24 (d) 0.3 (e) -70 e What is the biggest value in -1/5, 7/3, -0.5, -58, 0.09? 7/3 What is the second smallest value in 9132/5, 0.1, 2/7? 2/7 Which is the third biggest value? (a) -0.1 (b) 30 (c) 9 (d) 50 (e) 1 (f) 3/5 c Which is the second biggest value? (a) -1/7 (b) 4 (c) -2 (d) -10.5 (e) -13/7 a Which is the fifth biggest value? (a) -0.03 (b) -5 (c) 5 (d) -65/8 (e) 0 (f) -4 b Which is the third biggest value? (a) 3379 (b) -4/7 (c) 26 b Which is the biggest value? (a) 1/10 (b) -1.3 (c) 4 (d) -154 (e) -0.3 c What is the second smallest value in 40, -25.3, -0.5? -0.5 What is the fifth smallest value in 4, 2, 2/13, 0, 5? 5 What is the third smallest value in 0.5, 4, -0.4, 9319, 4/3? 4/3 What is the fourth biggest value in -1/3, 20.5, -5, 24, 4/7, 0.2? 0.2 What is the third biggest value in 0.03, 5, 2, 0, -10? 0.03 Which is the third biggest value? (a) 0 (b) -1 (c) -86 (d) 0.2 (e) 2/1449 a What is the fifth biggest value in -2/17, 625, -5, -1/16, 0? -5 Which is the third smallest value? (a) -1/9 (b) -5025 (c) 3/4 c What is the second biggest value in 2, 3, -2/3, 68, -2/13, 481? 68 Which is the third biggest value? (a) -106 (b) -2/9 (c) 6087 a What is the second biggest value in 1/4, -3/2, -2/11, 5, -2/7, 143? 5 Which is the fourth biggest value? (a) -5 (b) -1 (c) -31/366 (d) -0.02 (e) -0.1 b What is the smallest value in -6, -8/1961, -0.3, -1? -6 Which is the second smallest value? (a) -2/15 (b) 223 (c) 0.04 (d) 1/4 c What is the fourth smallest value in -784, 0, -5, 3/4, -0.5? 0 Which is the third smallest value? (a) 6 (b) 1/71 (c) 0.6 (d) -1.5 c What is the third smallest value in 2/33, 2/11, -0.2, 23, 1/2? 2/11 Which is the second smallest value? (a) -4 (b) 10 (c) 17 (d) 0.23 d What is the smallest value in -0.3, 32/7, 0.59, -4? -4 Which is the smallest value? (a) 15 (b) 5 (c) 785 b What is the fourth biggest value in -3.45, 2/3, 13, 3/5? -3.45 Which is the second biggest value? (a) 2/11 (b) 3 (c) -0.012 (d) 8 (e) -1/5 (f) 2/15 b Which is the second biggest value? (a) -0.62 (b) 5 (c) -76 a Which is the biggest value? (a) 2 (b) 18 (c) -0.5 (d) 0.1 (e) 12 (f) 1/9 b Which is the biggest value? (a) 2/11 (b) 125 (c) -3/4 (d) 1/5 (e) 4 b Which is the biggest value? (a) 4 (b) 10881 (c) -3/8 b What is the second biggest value in -62, 0.3, -92? -62 Which is the fifth smallest value? (a) -0.2 (b) 6/5 (c) -5 (d) -4 (e) 2/3 (f) 1.14 f Which is the third biggest value? (a) 34 (b) 2 (c) -0.32 (d) 0 (e) 0.3 e What is the second biggest value in 3.88, 3/2, -1, -2/9, -3? 3/2 What is the second biggest value in 1/72, 0.1, -2, -1/326? 1/72 What is the smallest value in 6, 3/44, 0.1, -11? -11 Which is the biggest value? (a) -3/59 (b) -0.5 (c) 0.3 (d) -47 (e) 2 e What is the fourth biggest value in -28, -1, 3, -87? -87 What is the fifth smallest value in 8, 10, 4/7, -2, 19? 19 What is the second smallest value in -193, 2/7, -79? -79 Which is the biggest value? (a) 0 (b) 4 (c) -0.4 (d) 16/5 (e) -2/61 b Which is the fourth smallest value? (a) -0.2 (b) 2/9 (c) 6 (d) 3 (e) 2/67 (f) -0.5 b What is the third biggest value in -1/4, -2/3, -3.74, 0.2, -0.4? -0.4 What is the third biggest value in 397, -5, -0.1, 0.07, 0.4? 0.07 Which is the third biggest value? (a) -11.1486 (b) -0.1 (c) 0.4 a What is the third biggest value in -2, -0.2, -89, -28, 0, -0.5? -0.5 What is the biggest value in -3/16, -2, -3/299, 0.5? 0.5 Which is the fourth biggest value? (a) -0.3 (b) 7/2 (c) -1/6 (d) -0.4 (e) 0 (f) -175/9 a What is the third biggest value in -0.12, 2, -0.5, -2/3, 2195? -0.12 What is the second biggest value in -5, 1.6, 25, -3, -2? 1.6 What is the second biggest value in 1/4489, -3, -0.1, -1/6? -0.1 Which is the third biggest value? (a) 2 (b) 58291 (c) 0.5 c What is the biggest value in -0.2, 0.018827, 5/2? 5/2 Which is the fourth biggest value? (a) -2 (b) -0.2 (c) 3 (d) -2/3 (e) 7342/3 d What is the third smallest value in -23, 12, 34, 3? 12 Which is the fifth biggest value? (a) 0.5 (b) -2/5 (c) 2 (d) -4 (e) -0.2 (f) -0.97 f Which is the smallest value? (a) -2 (b) 1/3 (c) 46 (d) -13 d Which is the fourth smallest value? (a) -0.51 (b) -1/6 (c) -4 (d) 0.11 (e) 5 (f) -2/13 f Which is the fifth smallest value? (a) -1747 (b) 0.1 (c) 1/4 (d) 2 (e) 3 e Which is the biggest value? (a) 0.01 (b) 5 (c) -0.5 (d) -5 (e) -1.2 (f) 0.014 b Which is the smallest value? (a) 5 (b) 3/8 (c) -3/7 (d) -0.25 (e) 6/5 (f) 3 c Which is the fifth biggest value? (a) 3/5 (b) 6 (c) 41 (d) -0.57 (e) 0 d Which is the third biggest value? (a) -0.1 (b) 2 (c) 129.72 a Which is the third smallest value? (a) -1/5 (b) -1 (c) 0 (d) 0.027 (e) 0.01 (f) -5 a What is the third biggest value in -6, -3, 1/8, -2/15, 24.7, 1? 1/8 Which is the third smallest value? (a) 0.09 (b) -5 (c) 0.7 (d) 11809 c Which is the smallest value? (a) -1/17 (b) 1.98 (c) 4 a Which is the third smallest value? (a) -0.3 (b) 3/2 (c) 2/9 (d) -1 c Which is the second smallest value? (a) -4 (b) -11 (c) -5 (d) 5 (e) -2/19 (f) 17 c What is the smallest value in -21, 2, 1.18? -21 What is the third smallest value in -1/2, 1/2, -0.2, -1/6, -7? -0.2 What is the second biggest value in 1/5, 2, 118, -15, 5/8? 2 What is the second smallest value in 0.5, 2, 5644? 2 What is the third biggest value in 5, 2.2509, 4? 2.2509 What is the second biggest value in 4, 2, -1, 20472? 4 Which is the smallest value? (a) -4 (b) 386.9 (c) 0.4 (d) 0.5 (e) -1/2 a Which is the third biggest value? (a) 4 (b) -0.6329 (c) -116 c Which is the fifth smallest value? (a) 24 (b) 12/13 (c) 2/21 (d) 0.2 (e) 57 e What is the third biggest value in -0.7, 28, 1/23, -1/3? -1/3 What is the smallest value in 1/4, 0.1, -1, 19, 10, 0.2? -1 Which is the fifth smallest value? (a) 3/2 (b) 17 (c) 3 (d) 22 (e) -2 d Which is the second smallest value? (a) 0.5 (b) -0.6 (c) -5 (d) 3 (e) -20069 c Which is the second biggest value? (a) -14 (b) -29 (c) -16/9 a Which is the second smallest value? (a) -0.2094 (b) 5 (c) 33 b Which is the second biggest value? (a) 1/4 (b) -0.3 (c) 0.228 (d) -0.4 (e) 3 a What is the biggest value in 4, 2, -0.096079, 1/8? 4 Which is the second smallest value? (a) 0 (b) 245/6 (c) -2 (d) 2/5 (e) -34 c Which is the second biggest value? (a) -3115 (b) 0.4 (c) -5 (d) -2 d What is the smallest value in -0.13, -5, 12, 1/19, 5? -5 Which is the fourth smallest value? (a) -6 (b) -3 (c) 40184 (d) -0.4 c What is the second smallest value in -2, -1/2, -5, 5, 0.8526, -1? -2 What is the fifth biggest value in 3/7, -0.09, -0.2, 3/5, 20, 1? -0.09 What is the third biggest value in 1/6, -0.0277, -4/5? -4/5 What is the fourth biggest value in -0.3, 32, 0.22, 2, -2? -0.3 Which is the smallest value? (a) 23 (b) 4125 (c) 5 c What is the fifth smallest value in 1.42, 0, -3/7, -1, 2? 2 What is the third biggest value in -0.02, -4/51, -43, -1/6? -1/6 What is the second smallest value in -1/5, -3, 1.6, -5, -3/2? -3 Which is the fourth biggest value? (a) -4.1 (b) -2/13 (c) 3/7	{ "pile_set_name": "DM Mathematics" }
? 3/10 Calculate prob of picking 1 o and 2 i when three letters picked without replacement from {o: 2, t: 6, e: 3, i: 4}. 12/455 Four letters picked without replacement from {m: 2, i: 3, g: 3, d: 2, c: 3}. Give prob of picking 1 c, 1 m, 1 i, and 1 d. 36/715 What is prob of picking 1 y and 2 r when three letters picked without replacement from grygrgqyg? 1/42 Calculate prob of picking 1 r and 1 a when two letters picked without replacement from {a: 2, x: 6, j: 2, r: 9}. 2/19 What is prob of picking 1 z and 1 c when two letters picked without replacement from {z: 1, c: 5, l: 5}? 1/11 What is prob of picking 2 b and 1 k when three letters picked without replacement from {b: 2, g: 3, i: 5, s: 8, k: 2}? 1/570 Calculate prob of picking 2 a when two letters picked without replacement from {b: 5, a: 5, r: 1, f: 1, q: 1, u: 1}. 10/91 Two letters picked without replacement from ffffffooff. What is prob of picking 1 o and 1 f? 16/45 Two letters picked without replacement from bikbkbb. What is prob of picking 1 i and 1 k? 2/21 What is prob of picking 1 d, 1 e, and 2 k when four letters picked without replacement from kzkeezedzeeedezdezd? 8/969 Calculate prob of picking 2 j when two letters picked without replacement from qlqjcji. 1/21 Four letters picked without replacement from fffiiffififfifffiif. What is prob of picking 4 f? 165/1292 Two letters picked without replacement from {y: 2, l: 1, b: 3, x: 2, o: 1, p: 3}. What is prob of picking 1 y and 1 o? 1/33 Two letters picked without replacement from sstmt. What is prob of picking 1 m and 1 t? 1/5 What is prob of picking 3 l and 1 d when four letters picked without replacement from qqbdddqllggqqlqql? 3/595 Two letters picked without replacement from bbbehbeeb. Give prob of picking 2 b. 5/18 Two letters picked without replacement from fayffyaafqaaayaaaa. What is prob of picking 2 f? 2/51 Four letters picked without replacement from snsssssssssnssssns. Give prob of picking 1 s and 3 n. 1/204 Calculate prob of picking 2 h and 1 g when three letters picked without replacement from {p: 3, h: 2, r: 2, u: 4, x: 1, g: 3}. 3/455 What is prob of picking 1 x and 2 c when three letters picked without replacement from {s: 3, x: 7, c: 9}? 84/323 Calculate prob of picking 2 f when two letters picked without replacement from fpkffflkfk. 2/9 Two letters picked without replacement from {u: 1, v: 2}. Give prob of picking 2 v. 1/3 What is prob of picking 2 f when two letters picked without replacement from kkkfkkkffkfkf? 5/39 What is prob of picking 1 b and 2 y when three letters picked without replacement from {s: 2, b: 1, u: 2, y: 2, n: 1}? 1/56 What is prob of picking 2 t, 1 g, and 1 k when four letters picked without replacement from {t: 4, g: 3, k: 7}? 18/143 Calculate prob of picking 1 z and 1 b when two letters picked without replacement from {z: 7, b: 5, t: 8}. 7/38 Three letters picked without replacement from {x: 9, r: 4, l: 3}. Give prob of picking 2 x and 1 r. 9/35 Three letters picked without replacement from {g: 2, d: 1, s: 7}. What is prob of picking 1 d and 2 s? 7/40 Four letters picked without replacement from {w: 2, h: 4, t: 7}. Give prob of picking 4 h. 1/715 Three letters picked without replacement from {m: 7, u: 5, n: 1, s: 3}. What is prob of picking 1 m, 1 u, and 1 n? 1/16 What is prob of picking 2 h, 1 x, and 1 t when four letters picked without replacement from aaxatxhhthhhhtottt? 1/17 Two letters picked without replacement from tmtttlttmt. What is prob of picking 2 m? 1/45 Three letters picked without replacement from drdlrllrlzlldrd. Give prob of picking 1 r and 2 d. 24/455 Four letters picked without replacement from {x: 2, i: 5, u: 3, a: 3, r: 5}. What is prob of picking 1 i and 3 a? 1/612 What is prob of picking 1 q and 2 g when three letters picked without replacement from {q: 2, g: 8}? 7/15 What is prob of picking 1 r, 2 u, and 1 b when four letters picked without replacement from rsreeusuueuesbruuae? 15/1292 Calculate prob of picking 2 l and 2 r when four letters picked without replacement from {l: 2, r: 6}. 3/14 What is prob of picking 1 n, 1 y, and 1 x when three letters picked without replacement from {w: 3, x: 1, l: 1, y: 6, n: 2}? 6/143 Four letters picked without replacement from {t: 4, d: 7}. What is prob of picking 4 t? 1/330 Three letters picked without replacement from awwwaawnnw. What is prob of picking 3 w? 1/12 Four letters picked without replacement from {o: 4}. What is prob of picking 4 o? 1 Two letters picked without replacement from {y: 1, x: 1, f: 3, r: 1, a: 1}. Give prob of picking 1 a and 1 x. 1/21 Calculate prob of picking 4 i when four letters picked without replacement from iiibibniiienbneie. 1/34 Three letters picked without replacement from {p: 1, n: 2, u: 4, t: 1}. What is prob of picking 2 n and 1 u? 1/14 Three letters picked without replacement from hmhhhmhhhhhmhh. Give prob of picking 2 h and 1 m. 165/364 Three letters picked without replacement from {a: 3, n: 2, m: 7, l: 4, z: 2}. What is prob of picking 1 m and 2 n? 7/816 What is prob of picking 1 o and 1 l when two letters picked without replacement from {l: 6, d: 2, o: 7}? 2/5 What is prob of picking 1 v and 2 c when three letters picked without replacement from {v: 1, b: 2, c: 1}? 0 Calculate prob of picking 1 o and 1 t when two letters picked without replacement from ogoztz. 2/15 Calculate prob of picking 2 f and 1 m when three letters picked without replacement from mmdfmmdf. 1/14 Calculate prob of picking 1 b, 1 x, and 1 h when three letters picked without replacement from {x: 1, h: 2, m: 1, b: 1, e: 1, i: 1}. 2/35 What is prob of picking 1 k, 1 l, and 1 z when three letters picked without replacement from {z: 1, l: 1, i: 1, u: 1, k: 1}? 1/10 What is prob of picking 1 r, 2 l, and 1 w when four letters picked without replacement from yylcrlclwrfr? 1/55 Four letters picked without replacement from hyhnnnhnhnhnhnnhnnn. Give prob of picking 2 n and 2 h. 385/1292 What is prob of picking 4 r when four letters picked without replacement from {r: 10}? 1 Four letters picked without replacement from {a: 1, t: 1, g: 5, j: 3}. Give prob of picking 1 j, 1 a, 1 t, and 1 g. 1/14 Three letters picked without replacement from obbbbbbvbobrr. Give prob of picking 1 b, 1 r, and 1 o. 16/143 What is prob of picking 1 h and 1 d when two letters picked without replacement from {d: 1, h: 2, n: 4}? 2/21 What is prob of picking 2 q and 1 e when three letters picked without replacement from eeyqyofyeqjyjjo? 3/455 Four letters picked without replacement from gjgkjuurrujgjujuuj. Give prob of picking 2 r and 2 u. 1/204 Two letters picked without replacement from tttaxtpumumummpttmuu. Give prob of picking 2 u. 1/19 Calculate prob of picking 1 r and 1 z when two letters picked without replacement from zgozgggmzqro. 1/22 Four letters picked without replacement from {k: 3, q: 1, t: 2, r: 1, n: 3, w: 1}. What is prob of picking 1 t, 1 n, 1 r, and 1 k? 3/55 Calculate prob of picking 3 t when three letters picked without replacement from xxxtxttxttxx. 1/22 Four letters picked without replacement from jorulqojrlrjljl. Give prob of picking 1 j, 2 r, and 1 q. 4/455 Calculate prob of picking 1 n and 3 w when four letters picked without replacement from {n: 6, w: 12}. 22/51 Three letters picked without replacement from ssssskssrrksksrk. Give prob of picking 1 s, 1 k, and 1 r. 27/140 What is prob of picking 2 w when two letters picked without replacement from wttwwghhwxzh? 1/11 What is prob of picking 1 i, 1 m, 1 k, and 1 q when four letters picked without replacement from mirrmbrbkbrmkqkkr? 3/595 Two letters picked without replacement from {r: 18, n: 1}. Give prob of picking 2 r. 17/19 Three letters picked without replacement from hddzljo. Give prob of picking 1 d, 1 z, and 1 o. 2/35 Three letters picked without replacement from wweeeewwewww. What is prob of picking 1 e and 2 w? 21/44 Two letters picked without replacement from {v: 2, c: 4, r: 1, x: 5, u: 2, a: 1}. Give prob of picking 1 c and 1 v. 8/105 Four letters picked without replacement from aawwaawaacaaaapaxaaa. What is prob of picking 1 c, 2 p, and 1 x? 0 Calculate prob of picking 1 k, 2 r, and 1 t when four letters picked without replacement from dgqqgqqrrgqqkktdqdqq. 2/4845 Three	{ "pile_set_name": "DM Mathematics" }
, -1, -2, -22, -28 Sort 0.7, -45, -1/2 in descending order. 0.7, -1/2, -45 Put 0, 0.2, 42/5 in increasing order. 0, 0.2, 42/5 Put 0.12, 1.21, -2, 1 in decreasing order. 1.21, 1, 0.12, -2 Put 5.9, 2/5, 4 in ascending order. 2/5, 4, 5.9 Sort -1, 9, 11, 2 in increasing order. -1, 2, 9, 11 Sort -0.5, 1/49, 0.4, -2/17 in increasing order. -0.5, -2/17, 1/49, 0.4 Sort -0.803, -2/5, -3 in increasing order. -3, -0.803, -2/5 Sort 12, 5, -5. -5, 5, 12 Sort -1/4, -4, -6.3, 0.9, -1 in ascending order. -6.3, -4, -1, -1/4, 0.9 Put 3, 51, 12 in increasing order. 3, 12, 51 Put -47, 1/5, -5, -2/9 in ascending order. -47, -5, -2/9, 1/5 Sort -5, -2, 4, 1625 in descending order. 1625, 4, -2, -5 Sort -4, -1, 111, 3. -4, -1, 3, 111 Put -5, 5, -2, -1 in decreasing order. 5, -1, -2, -5 Sort -4, -5.9, -5 in increasing order. -5.9, -5, -4 Sort 5, -5, -34, -1 in decreasing order. 5, -1, -5, -34 Sort 5, -4, 0, 3, 4 in ascending order. -4, 0, 3, 4, 5 Put -0.02, 5, 71 in increasing order. -0.02, 5, 71 Sort -5, -0.4, -64/13, -0.3, -1/2 in increasing order. -5, -64/13, -1/2, -0.4, -0.3 Sort -2, 20, -1, 5, 7 in increasing order. -2, -1, 5, 7, 20 Sort 0, -198, 5, 1. -198, 0, 1, 5 Put 0.2, 2.13, 0 in ascending order. 0, 0.2, 2.13 Put 0, -1, 15, -226 in ascending order. -226, -1, 0, 15 Put 4/5, 0.1, -0.3, -177 in ascending order. -177, -0.3, 0.1, 4/5 Sort 0.4, 6, 3/4, 137, -2/13 in decreasing order. 137, 6, 3/4, 0.4, -2/13 Sort -3, -10, -72, -5. -72, -10, -5, -3 Put 2, 0, 4, -7, 8 in decreasing order. 8, 4, 2, 0, -7 Put 42, 5, 4 in ascending order. 4, 5, 42 Sort 2, -41, -16 in decreasing order. 2, -16, -41 Put -153, -2, 4, -3 in decreasing order. 4, -2, -3, -153 Put 3/4, 0.101, 0, 4, -2/15 in decreasing order. 4, 3/4, 0.101, 0, -2/15 Sort -0.1, -311, -1, 2 in increasing order. -311, -1, -0.1, 2 Put 74, 0, -5 in descending order. 74, 0, -5 Put -5, -1, 2, 4, -2 in ascending order. -5, -2, -1, 2, 4 Sort -22, 2/7, -43, -2. -43, -22, -2, 2/7 Sort -1/12, 0.3, -1026, 4. -1026, -1/12, 0.3, 4 Sort -5/3, 2/3, -0.02, 1/2 in decreasing order. 2/3, 1/2, -0.02, -5/3 Sort -8, -5, 3, -1, 4. -8, -5, -1, 3, 4 Put 5, 3, -12/11, 6/11 in descending order. 5, 3, 6/11, -12/11 Put -4, 5, 1, 17 in descending order. 17, 5, 1, -4 Put -0.05, 4, -1/5, 0, -0.17 in ascending order. -1/5, -0.17, -0.05, 0, 4 Sort -3, -4, -13, -6, -2 in decreasing order. -2, -3, -4, -6, -13 Sort -1/2, 860, 0.5, 0.3 in increasing order. -1/2, 0.3, 0.5, 860 Sort -8, 2/9, -2/7, -0.07 in increasing order. -8, -2/7, -0.07, 2/9 Sort -49, 2, 0.4, 3/5 in descending order. 2, 3/5, 0.4, -49 Put -1/4, -37, -5, -3 in increasing order. -37, -5, -3, -1/4 Put 7, -4, 3, -10 in increasing order. -10, -4, 3, 7 Put -1, 3, 0, -3 in descending order. 3, 0, -1, -3 Sort 5, 0.5, 0, -4 in descending order. 5, 0.5, 0, -4 Sort -2/5, 82, 5 in ascending order. -2/5, 5, 82 Put -2, -2/5, -2/69, 5, -3 in increasing order. -3, -2, -2/5, -2/69, 5 Sort -604, -1/3, 3/4, 0 in increasing order. -604, -1/3, 0, 3/4 Sort 73, -19, 0.2. -19, 0.2, 73 Sort -1, 1/7, 26, 0.3, 0.5 in ascending order. -1, 1/7, 0.3, 0.5, 26 Sort 0, -4, -3, -76. -76, -4, -3, 0 Sort -10, 1, -98 in increasing order. -98, -10, 1 Put 2/7, 5, 22, 51 in decreasing order. 51, 22, 5, 2/7 Sort -0.5, 4/7, -9/5, 23/3, -3/8 in descending order. 23/3, 4/7, -3/8, -0.5, -9/5 Put 2, -1, -71 in ascending order. -71, -1, 2 Sort 3/4, -2/103, 1 in descending order. 1, 3/4, -2/103 Put -27, -2/9, 1/3, -9 in descending order. 1/3, -2/9, -9, -27 Sort 1/8, -7, -6/31, 1/3 in descending order. 1/3, 1/8, -6/31, -7 Sort -3, 3, -33 in descending order. 3, -3, -33 Put 0, 7, -2, -5 in decreasing order. 7, 0, -2, -5 Sort 3/5, 2/11, 3 in ascending order. 2/11, 3/5, 3 Sort -3, 39, -12 in decreasing order. 39, -3, -12 Sort -1/4, -0.5, 5, -4 in increasing order. -4, -0.5, -1/4, 5 Put 2, 160, 3, 1 in ascending order. 1, 2, 3, 160 Sort 3/7, 13, 4, -4, 0.3 in increasing order. -4, 0.3, 3/7, 4, 13 Sort 3/22, -5, 4, -1.7 in decreasing order. 4, 3/22, -1.7, -5 Sort 1, 0, -6, 4 in ascending order. -6, 0, 1, 4 Put 0, -2, -3, 17 in ascending order. -3, -2, 0, 17 Sort -91, 4, -11, 1, -1 in decreasing order. 4, 1, -1, -11, -91 Sort 2/15, 42/17, -1 in decreasing order. 42/17, 2/15, -1 Put -4/9, 2, 0.02, -3 in increasing order. -3, -4/9, 0.02, 2 Sort -3, -45, 2/9 in ascending order. -45, -3, 2/9 Sort -5, 10, 4, -1, 2 in decreasing order. 10, 4, 2, -1, -5 Sort 42, 7, -4, 2, -5. -5, -4, 2, 7, 42 Put -0.2, -0.4, 2, -7, -8 in decreasing order. 2, -0.2, -0.4, -7, -8 Sort -9, 9, -1/4. -9, -1/4, 9 Sort -1/6, -5, 0.2, 0.5. -5, -1/6, 0.2, 0.5 Sort 0, -2/29, -3/112 in increasing order. -2/29, -3/112, 0 Put 7, 4, -4, 0 in descending order. 7, 4, 0, -4 Sort 3, -1, 0, 377, 2. -1, 0, 2, 3, 377 Sort -2, 16, 8, 1 in decreasing order. 16, 8, 1, -2 Put 0.1, -2, 0.4, 0.2, -224 in descending order. 0.4, 0.2, 0.1, -2, -224 Put -4, 2, 308/3 in increasing order. -4, 2, 308/3 Put -1/2, -58, -2, -1/3 in descending order. -1/3, -1/2, -2, -58 Sort 2, -2, -11/4 in ascending order. -11/4, -2, 2 Put -248, 1, 6 in increasing order. -248, 1, 6 Sort -72, -2, -3, 3, 1. -72, -3, -2, 1, 3 Sort -4, 71, 4 in descending order. 71, 4, -4 Sort 2, 7/20, 4 in increasing order. 7/20, 2, 4 Put 848, 3, -1 in increasing order. -1, 3, 848 Put -1, -28, 3, 7 in decreasing order. 7, 3, -1, -28 Put -2, 197, 0, 5 in ascending order. -2, 0, 5, 197 Sort -1, -5, 51 in descending order. 51, -1, -5 Put 2, -1, -5, -59 in increasing order. -59, -5, -1, 2 Put -4, -3, 28, 1 in descending order. 28, 1, -3, -4 Sort 2, 0.4, -0.2, -29/5 in descending order. 2, 0.4, -0.2, -29/5 Put -51, -11, 15 in descending order. 15, -11, -51 Put 2, 12, 194 in descending order. 194, 12, 2 Sort -14, -2, -3 in increasing order. -14, -3, -2 Sort 18, 5, 0.5, 2/3 in descending order. 18, 5, 2/3, 0.5 Sort 76, -4, 0 in descending order. 76, 0, -4 Put -1, -1/4, 15, -2/5 in decreasing order. 15, -1/4, -2/5, -1 Sort -0.2, -126, -4, 1 in ascending order. -126, -4, -0.2, 1 Put -0.4, -11, 0 in descending order. 0, -0.4, -11 Sort 1, 0, -81. -81, 0, 1 Sort 1, 2, -4, 1882, -4/3 in decreasing order. 1882, 2, 1, -4/3, -4 Sort 1.78, -0.2, -0.1 in decreasing order. 1.78, -0.1, -0.2 Sort -5, 32/29, 2/9 in decreasing order. 32/29, 2/9, -5 Sort -4, -22, -3, -5, -7 in decreasing order. -3, -4, -5, -7, -22 Sort -2, -11, 62 in decreasing order. 62, -2, -11 Put 3, 1, 0 in increasing order. 0, 1, 3 Put 22, 4/9, -0.1 in ascending order. -0.1, 4/9, 22 Put -2, 2, 4, 6 in ascending order. -2, 2, 4, 6 Sort 2, -16, -5 in increasing order. -16, -5, 2 Sort 5, -1, -76 in descending order. 5, -1, -76 Sort 0, 3, -3, 6. -3, 0, 3, 6 Put 4/7, -0.34, 1/6 in decreasing order. 4/7, 1/6, -0.34 Sort 5, 1, -8, 4 in decreasing order. 5, 4, 1, -8 Put -1/3, -0.17, 0, -6 in ascending order. -6, -1/3, -0.17, 0 Put 3, -4, 478 in decreasing order. 478, 3, -4 Sort 8, 2, 0, -19, 3 in ascending order. -19, 0, 2, 3, 8 Sort 3, 7, 5 in increasing order. 3, 5, 7 Put 39, 5, -1/11, 1/3 in decreasing order. 39, 5, 1/3, -1/11 Put -16, -2, -4, 2, -1 in descending order. 2, -1, -2, -4, -16 Sort -2, 0, 5, 12. -2, 0, 5, 12 Put -3/7, 2, -28 in decreasing order. 2, -3/7, -28 Put -14, 3, 2 in decreasing order. 3, 2, -14 Put -4, -29, 17, -3 in ascending order. -29, -4, -3, 17 Sort -1, 3, -7, 2. -7, -1, 2, 3 Sort 5, 1, 734 in descending order. 734, 5, 1 Sort -10587, 2, -2 in ascending order. -10587, -2, 2 Put 3, 10/3, 0.1, -2/29 in increasing order. -2/29, 0.1, 3, 10/3 Sort 4, 4/3, 46, -2 in increasing order. -2, 4/3, 4, 46 Sort -11, 5, -35, -2 in descending order. 5, -2, -11, -35 Sort 144, 5, 1, 7 in ascending order. 1, 5, 7, 144 Sort -38, 12, -1, 2 in decreasing order. 12, 2, -1, -38 Put -4, 2, 0, -110 in increasing order. -110, -4, 0, 2 Put -6, -4, -5, 5, -251 in decreasing order. 5, -4, -5, -6, -251 Put -2/3, -6, 0.082 in descending order. 0.082, -2/3, -6 Put -8, 4, 2, -4 in decreasing order. 4, 2, -4, -8 Put 2, -3, -10, -4 in decreasing order. 2, -3, -4, -10 Sort 2, 15, -14 in decreasing order. 15, 2, -14 Put -2, -106, -3, 1 in descending order. 1, -2, -3, -106 Sort -3, -2.6, -4 in decreasing order. -2.6, -3, -4 Sort -1/3, 0.5, 2, 33, -0.8 in increasing order. -0.8, -1/3, 0.5, 2, 33 Put -3, -0.4, 33, -4 in ascending order. -4, -3, -0.4, 33 Put 2, 1, -12, 3 in decreasing order. 3, 2, 1, -12	{ "pile_set_name": "DM Mathematics" }
7, 13, 271, 883 List the prime factors of 679063544. 2, 223, 380641 List the prime factors of 70013707. 59, 1186673 List the prime factors of 138418710. 2, 3, 5, 4613957 What are the prime factors of 281562981? 3, 7, 89, 150649 What are the prime factors of 101007999? 3, 17, 337, 653 List the prime factors of 294951314. 2, 7, 21067951 What are the prime factors of 76403614? 2, 7, 1181, 4621 List the prime factors of 19917133. 71, 163, 1721 List the prime factors of 550021184. 2, 8594081 List the prime factors of 3263784464. 2, 2339, 87211 List the prime factors of 194288471. 13, 19, 113, 6961 What are the prime factors of 13486860? 2, 3, 5, 31, 2417 What are the prime factors of 81884059? 81884059 What are the prime factors of 6951188? 2, 19, 91463 List the prime factors of 396857115. 3, 5, 107, 82421 What are the prime factors of 415741419? 3, 29, 1592879 List the prime factors of 7390613336. 2, 227, 4069721 List the prime factors of 153314321. 153314321 What are the prime factors of 785474463? 3, 261824821 What are the prime factors of 299121895? 5, 157, 381047 What are the prime factors of 613039729? 29, 21139301 List the prime factors of 17837906. 2, 8918953 List the prime factors of 44808203. 11, 41, 73, 1361 List the prime factors of 1186177377. 3, 7, 11, 227, 22621 List the prime factors of 1999425945. 3, 5, 11, 12117733 What are the prime factors of 147527201? 89, 1657609 What are the prime factors of 17327868? 2, 3, 1443989 List the prime factors of 22605631. 17, 37, 83, 433 What are the prime factors of 26213937? 3, 8737979 What are the prime factors of 43392309? 3, 41, 131, 2693 What are the prime factors of 88802024? 2, 11100253 List the prime factors of 733507319. 71, 10331089 List the prime factors of 256850709. 3, 29, 2952307 List the prime factors of 439723316. 2, 109930829 List the prime factors of 267358427. 7, 38194061 List the prime factors of 91459558. 2, 17, 59, 127, 359 What are the prime factors of 38952049? 17, 47, 48751 List the prime factors of 798210446. 2, 11, 23, 271, 5821 List the prime factors of 635865011. 635865011 What are the prime factors of 293039416? 2, 1097, 33391 List the prime factors of 152316140. 2, 5, 7615807 List the prime factors of 392216708. 2, 13, 7542629 List the prime factors of 86966851. 86966851 List the prime factors of 265137618. 2, 3, 44189603 What are the prime factors of 889641670? 2, 5, 88964167 List the prime factors of 275134074. 2, 3, 2381, 19259 What are the prime factors of 161243743? 37, 929, 4691 What are the prime factors of 56903071? 103, 113, 4889 List the prime factors of 1532166645. 3, 5, 102144443 List the prime factors of 44755977. 3, 7, 37, 57601 List the prime factors of 3493666044. 2, 3, 11, 71, 137, 907 List the prime factors of 61358773. 7, 8765539 List the prime factors of 376657636. 2, 547, 172147 What are the prime factors of 137933349? 3, 45977783 List the prime factors of 6492412. 2, 139, 11677 What are the prime factors of 310574899? 101, 109, 28211 List the prime factors of 3650020852. 2, 29, 31465697 List the prime factors of 352680133. 13, 4861, 5581 What are the prime factors of 111897672? 2, 3, 17, 274259 What are the prime factors of 614141387? 614141387 List the prime factors of 24809216. 2, 96911 What are the prime factors of 19373388? 2, 3, 19, 31, 2741 What are the prime factors of 65361833? 353, 185161 What are the prime factors of 662803279? 6199, 106921 List the prime factors of 1656447627. 3, 552149209 List the prime factors of 63663644. 2, 11, 1446901 What are the prime factors of 175071399? 3, 58357133 List the prime factors of 106576759. 6163, 17293 What are the prime factors of 100030334? 2, 50015167 List the prime factors of 3751215201. 3, 19, 21936931 List the prime factors of 32531174. 2, 13, 317, 3947 List the prime factors of 50674808. 2, 727, 8713 What are the prime factors of 4324565182? 2, 7, 967, 319439 List the prime factors of 735829816. 2, 263, 349729 List the prime factors of 4669427498. 2, 19, 122879671 What are the prime factors of 1230574969? 13, 94659613 What are the prime factors of 1319026252? 2, 41, 8042843 List the prime factors of 93622602. 2, 3, 1453, 10739 List the prime factors of 1456385291. 17, 8923, 9601 List the prime factors of 3763422. 2, 3, 13, 1787 What are the prime factors of 445372674? 2, 3, 53, 1400543 List the prime factors of 1517842247. 79, 19213193 What are the prime factors of 72272769? 3, 257, 93739 What are the prime factors of 657201889? 883, 744283 What are the prime factors of 61001195? 5, 12200239 List the prime factors of 1902197224. 2, 237774653 List the prime factors of 240619909. 240619909 List the prime factors of 638210302. 2, 23, 2969, 4673 List the prime factors of 133731866. 2, 67, 311, 3209 List the prime factors of 63160112. 2, 3947507 What are the prime factors of 732203718? 2, 3, 122033953 List the prime factors of 524653076. 2, 131163269 What are the prime factors of 1332842008? 2, 181, 277, 3323 List the prime factors of 110998670. 2, 5, 479, 23173 What are the prime factors of 76204910? 2, 5, 7620491 What are the prime factors of 2158755944? 2, 41, 197, 33409 List the prime factors of 127328030. 2, 5, 12732803 What are the prime factors of 624405717? 3, 13, 5336801 List the prime factors of 142567314. 2, 3, 373, 63703 List the prime factors of 358658282. 2, 17, 31, 340283 What are the prime factors of 74792980? 2, 5, 47, 251, 317 What are the prime factors of 17732034? 2, 3, 23, 4759 List the prime factors of 49138298. 2, 11, 491, 4549 What are the prime factors of 100361662? 2, 50180831 List the prime factors of 79724327. 7717, 10331 List the prime factors of 1080807237. 3, 23, 5221291 What are the prime factors of 911701202? 2, 71, 6420431 List the prime factors of 400453044. 2, 3, 19, 61, 28793 What are the prime factors of 176250041? 11, 1759, 9109 What are the prime factors of 2729537543? 719, 1901, 1997 List the prime factors of 431833576. 2, 53979197 List the prime factors of 1505123375. 5, 7, 311, 5531 What are the prime factors of 20832331? 13, 1602487 List the prime factors of 2344041243. 3, 17, 157, 97583 What are the prime factors of 49129850? 2, 5, 7, 11, 1823 List the prime factors of 260421825. 3, 5, 3472291 What are the prime factors of 38652610? 2, 5, 269, 14369 What are the prime factors of 375219775? 5, 7, 37, 167, 347 List the prime factors of 761071. 47, 16193 List the prime factors of 135593900. 2, 5, 13, 37, 2819 List the prime factors of 3723368864. 2, 116355277 List the prime factors of 960798222. 2, 3, 53377679 What are the prime factors of 56985726? 2, 3, 7, 239, 811 List the prime factors of 4509876935. 5, 233, 3871139 List the prime factors of 111046725. 3, 5, 493541 List the prime factors of 316639653. 3, 11, 2029, 4729 What are the prime factors of 285885848? 2, 35735731 What are the prime factors of 69672674? 2, 29, 607, 1979 What are the prime factors of 3027616666? 2, 17, 523, 170263 What are the prime factors of 5643787637? 37, 41, 3720361 List the prime factors of 65225766. 2, 3, 1231, 8831 List the prime factors of 5686186879. 431, 13193009 List the prime factors of 476582491. 7, 11, 19, 29, 47, 239 What are the prime factors of 390364956? 2, 3, 19, 197, 2897 What are the prime factors of 64671609? 3, 21557203 What are the prime factors of 355651430? 2, 5, 35565143 List the prime factors of 3634743236. 2, 1327, 684767 What are the prime factors of 950689115? 5, 107, 1776989 List the prime factors of 1273125355. 5, 163, 641, 2437 What are the prime factors of 23335689? 3, 13, 46027 List the prime factors of 802975678. 2, 23, 467, 37379 What are the prime factors of 100505608? 2, 7, 811, 2213 What are the prime factors of 11341729? 7, 1620247 What are the prime factors of 3719754974? 2, 13, 79, 1810981 List the prime factors of 52157055. 3, 5, 3477137 What are the prime factors of 500350214? 2, 7, 13, 113, 24329 What are the prime factors of 9212392016? 2, 31, 37, 16193 List the prime factors of 3469826949. 3, 19, 53, 61, 991 What are the prime factors of 1029804367? 1029804367 What are the prime factors of 145999947? 3, 673, 72313 List the prime factors of 4384439880. 2, 3, 5, 197, 185467 List the prime factors of 703576912. 2, 43973557 W	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.