repo_name
stringlengths
6
130
hexsha
sequence
file_path
sequence
code
sequence
apis
sequence
possible_versions
list
goncaloasimoes/net-pro-sim
[ "77f766661229327df16bef1e6813152e02350459" ]
[ "src/DataProcessing/VisualizeCommunities.py" ]
[ "from . import Visualize #pylint: disable=relative-beyond-top-level\nimport networkx as nx\nfrom matplotlib import lines\nfrom scipy.spatial import Voronoi, voronoi_plot_2d\nimport numpy as np\n\n# TODO: Needs to be retested and fixed.\n''' Visualize or save images of the network with its various communities represented. '''\nclass VisualizeCommunities(Visualize.Visualize):\n\n def process(self, data = {}):\n ''' Do nothing. Override saving of state for every step.'''\n pass\n\n def end_step_processing(self, data = {}):\n self.show_legend = False\n # color_map, states, color_order = self._get_color_map(data['network'], data['model'])\n graph = data['network'].get_graph()\n if self.graph_layout is None:\n self.graph_layout = nx.spring_layout(graph, scale=1, seed=100)\n communities = {frozenset(graph.nodes[v]['community']) for v in graph}\n centers = []\n for community in communities:\n center_x = 0\n center_y = 0\n for node in community:\n center_x += self.graph_layout[node][0]\n center_y += self.graph_layout[node][1]\n center = [\n center_x/len(community),\n center_y/len(community),\n ]\n centers.append(center)\n print(centers)\n centers = np.array(centers)\n print(centers)\n vor = Voronoi(centers)\n self.points = centers\n self.vor = vor\n # for region in vor.regions:\n # if not -1 in region:\n # polygon = [vor.vertices[i] for i in region]\n # plt.fill(*zip(*polygon))\n self.draw( data, draw_before=self.voronoi )\n self.save_number += 1\n self.step += 1\n self.graph_layout = None # Reset layout\n \n def voronoi(self, ax):\n color = 'crimson'\n alpha = 0.7\n #ax.plot(self.points[:,0], self.points[:,1], 'o')\n #ax.plot(self.vor.vertices[:,0], self.vor.vertices[:,1], '*')\n \n lim_x = [0,0]\n lim_y = [0,0]\n for node in self.graph_layout:\n x = self.graph_layout[node][0]\n y = self.graph_layout[node][1]\n if x < lim_x[0]:\n lim_x[0] = x\n if x > lim_x[1]:\n lim_x[1] = x\n if y < lim_y[0]:\n lim_y[0] = y\n if y > lim_y[1]:\n lim_y[1] = y\n padding = 0.1\n ax.set_xlim(lim_x[0] - padding, lim_x[1] + padding); ax.set_ylim(lim_y[0] - padding, lim_y[1] + padding)\n\n for simplex in self.vor.ridge_vertices:\n simplex = np.asarray(simplex) \n if np.all(simplex >= 0):\n line = lines.Line2D(self.vor.vertices[simplex,0], self.vor.vertices[simplex,1], lw=2., color=color, linestyle='--', alpha=alpha)\n ax.add_line(line)\n # ax.plot(self.vor.vertices[simplex,0], self.vor.vertices[simplex,1], 'r-', linewidth=1)\n\n center = self.points.mean(axis=0)\n for pointidx, simplex in zip(self.vor.ridge_points, self.vor.ridge_vertices):\n simplex = np.asarray(simplex)\n if np.any(simplex < 0):\n i = simplex[simplex >= 0][0] # finite end self.Voronoi vertex\n t = self.points[pointidx[1]] - self.points[pointidx[0]] # tangent\n t /= np.linalg.norm(t)\n n = np.array([-t[1], t[0]]) # normal\n midpoint = self.points[pointidx].mean(axis=0)\n far_point = self.vor.vertices[i] + np.sign(np.dot(midpoint - center, n)) * n * 100\n line = lines.Line2D([self.vor.vertices[i,0], far_point[0]], [self.vor.vertices[i,1], far_point[1]], lw=2., color=color, linestyle='--', alpha=alpha)\n line.set_clip_on(False)\n ax.add_line( line)\n # ax.plot([self.vor.vertices[i,0], far_point[0]], [self.vor.vertices[i,1], far_point[1]], 'r--', linewidth=1)\n # voronoi_plot_2d(self.vor,ax=ax, show_vertices = False, show_points=False, line_colors='red')\n" ]
[ [ "numpy.dot", "scipy.spatial.Voronoi", "numpy.asarray", "matplotlib.lines.Line2D", "numpy.linalg.norm", "numpy.all", "numpy.any", "numpy.array" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
janvonrickenbach/Chaco_wxPhoenix_py3
[ "21a10cfd81100f28e3fbc273357ac45642519f33", "21a10cfd81100f28e3fbc273357ac45642519f33", "21a10cfd81100f28e3fbc273357ac45642519f33", "21a10cfd81100f28e3fbc273357ac45642519f33", "21a10cfd81100f28e3fbc273357ac45642519f33", "21a10cfd81100f28e3fbc273357ac45642519f33", "21a10cfd81100f28e3fbc273357ac45642519f33" ]
[ "chaco/ticks.py", "examples/tutorials/scipy2008/custom_tool_click.py", "examples/demo/basic/scatter_toggle.py", "chaco/log_mapper.py", "examples/demo/simple_line.py", "chaco/lasso_overlay.py", "chaco/overlays/simple_inspector_overlay.py" ]
[ "#-------------------------------------------------------------------------------\r\n#\r\n#\r\n# Written by: David C. Morrill (based on similar routines written by Eric Jones)\r\n#\r\n# Date: 2007-05-01\r\n#\r\n# (c) Copyright 2002-7 by Enthought, Inc.\r\n#\r\n#-------------------------------------------------------------------------------\r\n\"\"\" Tick generator classes and helper functions for calculating axis\r\ntick-related values (i.e., bounds and intervals).\r\n\r\n\"\"\"\r\n# Major library imports\r\nfrom numpy import arange, argsort, array, ceil, concatenate, equal, finfo, \\\r\n float64, floor, linspace, log10, minimum, ndarray, newaxis, \\\r\n putmask, shape\r\n\r\n# Enthought library imports\r\nfrom traits.api import HasTraits, Any\r\n\r\n\r\nclass AbstractTickGenerator(HasTraits):\r\n \"\"\" Abstract class for tick generators.\r\n \"\"\"\r\n\r\n def get_ticks(self,\r\n data_low,\r\n data_high,\r\n bounds_low,\r\n bounds_high,\r\n interval,\r\n use_endpoints=False,\r\n scale='linear'):\r\n \"\"\" Returns a list of ticks points in data space.\r\n\r\n Parameters\r\n ----------\r\n data_low, data_high : float\r\n The actual minimum and maximum of index values of the entire\r\n dataset.\r\n bounds_low, bounds_high : \"auto\", \"fit\", float\r\n The range for which ticks should be generated.\r\n interval : \"auto\", float\r\n If the value is a positive number, it specifies the length\r\n of the tick interval; a negative integer specifies the\r\n number of tick intervals; 'auto' specifies that the number and\r\n length of the tick intervals are automatically calculated, based\r\n on the range of the axis.\r\n use_endpoints : Boolean\r\n If True, the lower and upper bounds of the data are used as the\r\n lower and upper end points of the axis. If False, the end points\r\n might not fall exactly on the bounds.\r\n scale : 'linear' or 'log'\r\n The type of scale the ticks are for.\r\n\r\n Returns\r\n -------\r\n tick_list : array of floats\r\n Where ticks are to be placed.\r\n\r\n\r\n Example\r\n -------\r\n If the range of x-values in a line plot span from -15.0 to +15.0, but\r\n the plot is currently displaying only the region from 3.1 to 6.83, and\r\n the user wants the interval to be automatically computed to be some\r\n nice value, then call get_ticks() thusly::\r\n\r\n get_ticks(-15.0, 15.0, 3.1, 6.83, \"auto\")\r\n\r\n A reasonable return value in this case would be::\r\n\r\n [3.5, 4.0, 4.5, 5.0, 5.5, 6.0, 6.5]\r\n \"\"\"\r\n\r\n raise NotImplementedError\r\n\r\n\r\nclass DefaultTickGenerator(AbstractTickGenerator):\r\n \"\"\" An implementation of AbstractTickGenerator that simply uses the\r\n auto_ticks() and log_auto_ticks() functions.\r\n \"\"\"\r\n\r\n def get_ticks(self,\r\n data_low,\r\n data_high,\r\n bounds_low,\r\n bounds_high,\r\n interval,\r\n use_endpoints=False,\r\n scale='linear'):\r\n if scale == 'linear':\r\n return array(\r\n auto_ticks(\r\n data_low,\r\n data_high,\r\n bounds_low,\r\n bounds_high,\r\n interval,\r\n use_endpoints=False),\r\n float64)\r\n elif scale == 'log':\r\n return array(\r\n log_auto_ticks(\r\n data_low,\r\n data_high,\r\n bounds_low,\r\n bounds_high,\r\n interval,\r\n use_endpoints=False),\r\n float64)\r\n\r\n\r\nclass ShowAllTickGenerator(AbstractTickGenerator):\r\n \"\"\" Uses the abstract interface, but returns all \"positions\" instead\r\n of decimating the ticks.\r\n\r\n You must provide a sequence of values as a *positions* keyword argument\r\n to the constructor.\r\n \"\"\"\r\n # A sequence of positions for ticks.\r\n positions = Any\r\n\r\n def get_ticks(self,\r\n data_low,\r\n data_high,\r\n bounds_low,\r\n bounds_high,\r\n interval,\r\n use_endpoints=False,\r\n scale='linear'):\r\n \"\"\" Returns an array based on **positions**.\r\n \"\"\"\r\n # ignore all the high, low, etc. data and just return every position\r\n return array(self.positions, float64)\r\n\r\n\r\nclass MinorTickGenerator(DefaultTickGenerator):\r\n \"\"\" An implementation of AbstractTickGenerator that extends DefaultTickGenerator,\r\n but sets the tick interval to a smaller length.\r\n \"\"\"\r\n\r\n def get_ticks(self,\r\n data_low,\r\n data_high,\r\n bounds_low,\r\n bounds_high,\r\n interval,\r\n use_endpoints=False,\r\n scale='linear'):\r\n if interval == 'auto':\r\n # for the default interval, generate a smaller tick interval\r\n interval = auto_interval(\r\n 0, auto_interval(data_low, data_high), max_ticks=5)\r\n\r\n return super(MinorTickGenerator, self).get_ticks(\r\n data_low, data_high, bounds_low, bounds_high, interval,\r\n use_endpoints, scale)\r\n\r\n\r\n#-------------------------------------------------------------------------------\r\n# Code imported from plt/plot_utility.py:\r\n#-------------------------------------------------------------------------------\r\n\r\n\r\ndef auto_ticks(data_low,\r\n data_high,\r\n bound_low,\r\n bound_high,\r\n tick_interval,\r\n use_endpoints=True):\r\n \"\"\" Finds locations for axis tick marks.\r\n\r\n Calculates the locations for tick marks on an axis. The *bound_low*,\r\n *bound_high*, and *tick_interval* parameters specify how the axis end\r\n points and tick interval are calculated.\r\n\r\n Parameters\r\n ----------\r\n\r\n data_low, data_high : number\r\n The minimum and maximum values of the data along this axis.\r\n If any of the bound settings are 'auto' or 'fit', the axis\r\n traits are calculated automatically from these values.\r\n bound_low, bound_high : 'auto', 'fit', or a number.\r\n The lower and upper bounds of the axis. If the value is a number,\r\n that value is used for the corresponding end point. If the value is\r\n 'auto', then the end point is calculated automatically. If the\r\n value is 'fit', then the axis bound is set to the corresponding\r\n *data_low* or *data_high* value.\r\n tick_interval : can be 'auto' or a number\r\n If the value is a positive number, it specifies the length\r\n of the tick interval; a negative integer specifies the\r\n number of tick intervals; 'auto' specifies that the number and\r\n length of the tick intervals are automatically calculated, based\r\n on the range of the axis.\r\n use_endpoints : Boolean\r\n If True, the lower and upper bounds of the data are used as the\r\n lower and upper end points of the axis. If False, the end points\r\n might not fall exactly on the bounds.\r\n\r\n Returns\r\n -------\r\n An array of tick mark locations. The first and last tick entries are the\r\n axis end points.\r\n \"\"\"\r\n\r\n is_auto_low = (bound_low == 'auto')\r\n is_auto_high = (bound_high == 'auto')\r\n\r\n if isinstance(bound_low, str):\r\n lower = data_low\r\n else:\r\n lower = float(bound_low)\r\n\r\n if isinstance(bound_high, str):\r\n upper = data_high\r\n else:\r\n upper = float(bound_high)\r\n\r\n if (tick_interval == 'auto') or (tick_interval == 0.0):\r\n rng = abs(upper - lower)\r\n\r\n if rng == 0.0:\r\n tick_interval = 0.5\r\n lower = data_low - 0.5\r\n upper = data_high + 0.5\r\n else:\r\n tick_interval = auto_interval(lower, upper)\r\n elif tick_interval < 0:\r\n intervals = -tick_interval\r\n tick_interval = tick_intervals(lower, upper, intervals)\r\n if is_auto_low and is_auto_high:\r\n is_auto_low = is_auto_high = False\r\n lower = tick_interval * floor(lower / tick_interval)\r\n while ((abs(lower) >= tick_interval) and (\r\n (lower + tick_interval * (intervals - 1)) >= upper)):\r\n lower -= tick_interval\r\n upper = lower + tick_interval * intervals\r\n\r\n # If the lower or upper bound are set to 'auto',\r\n # calculate them based on the newly chosen tick_interval:\r\n if is_auto_low or is_auto_high:\r\n delta = 0.01 * tick_interval * (data_low == data_high)\r\n auto_lower, auto_upper = auto_bounds(data_low - delta,\r\n data_high + delta, tick_interval)\r\n if is_auto_low:\r\n lower = auto_lower\r\n if is_auto_high:\r\n upper = auto_upper\r\n\r\n # Compute the range of ticks values:\r\n start = floor(lower / tick_interval) * tick_interval\r\n end = floor(upper / tick_interval) * tick_interval\r\n # If we return the same value for the upper bound and lower bound, the\r\n # layout code will not be able to lay out the tick marks (divide by zero).\r\n if start == end:\r\n lower = start = start - tick_interval\r\n upper = end = start - tick_interval\r\n\r\n if upper > end:\r\n end += tick_interval\r\n ticks = arange(start, end + (tick_interval / 2.0), tick_interval)\r\n\r\n if len(ticks) < 2:\r\n ticks = array(((lower - lower * 1.0e-7), lower))\r\n if (not is_auto_low) and use_endpoints:\r\n ticks[0] = lower\r\n if (not is_auto_high) and use_endpoints:\r\n ticks[-1] = upper\r\n\r\n return [tick for tick in ticks if tick >= bound_low and tick <= bound_high]\r\n\r\n\r\n#--------------------------------------------------------------------------------\r\n# Compute the best tick interval for a specified data range:\r\n#--------------------------------------------------------------------------------\r\n\r\n\r\ndef heckbert_interval(data_low, data_high, numticks=8):\r\n \"\"\"\r\n Returns a \"nice\" range and interval for a given data range and a preferred\r\n number of ticks. From Paul Heckbert's algorithm in Graphics Gems.\r\n \"\"\"\r\n range = _nice(data_high - data_low)\r\n d = _nice(range / (numticks - 1), round=True)\r\n graphmin = floor(data_low / d) * d\r\n graphmax = ceil(data_high / d) * d\r\n #nfrac = max(-floor(log10(d)), 0)\r\n return graphmin, graphmax, d\r\n\r\n\r\ndef _nice(x, round=False):\r\n \"\"\" if round is False, then use ceil(range) \"\"\"\r\n expv = floor(log10(x))\r\n f = x / pow(10, expv)\r\n if round:\r\n if f < 1.5:\r\n nf = 1.0\r\n elif f < 3.0:\r\n nf = 2.0\r\n elif f < 7.0:\r\n nf = 5.0\r\n else:\r\n nf = 10.0\r\n else:\r\n if f <= 1.0:\r\n nf = 1.0\r\n elif f <= 2.0:\r\n nf = 2.0\r\n elif f <= 5.0:\r\n nf = 5.0\r\n else:\r\n nf = 10.0\r\n return nf * pow(10, expv)\r\n\r\n\r\ndef auto_interval(data_low, data_high, max_ticks=9):\r\n \"\"\" Calculates the tick interval for a range.\r\n\r\n The boundaries for the data to be plotted on the axis are::\r\n\r\n data_bounds = (data_low,data_high)\r\n\r\n The function chooses the number of tick marks, which can be between\r\n 3 and max_ticks marks (including end points), and chooses tick intervals at\r\n 1, 2, 2.5, 5, 10, 20, ...\r\n\r\n Returns\r\n -------\r\n interval : float\r\n tick mark interval for axis\r\n \"\"\"\r\n #if data_high<data_low:\r\n #hold=data_high\r\n #data_high=data_low\r\n #data_low=hold\r\n range = float(data_high) - float(data_low)\r\n # We'll choose from between 2 and 8 tick marks.\r\n # Preference is given to more ticks:\r\n # Note reverse order and see kludge below...\r\n divisions = arange(max_ticks - 1, 2.0,\r\n -1.0) # for max_ticks=9, ( 7, 6, ..., 3 )\r\n\r\n # Calculate the intervals for the divisions:\r\n candidate_intervals = range / divisions\r\n\r\n # Get magnitudes and mantissas for each candidate:\r\n magnitudes = 10.0**floor(log10(candidate_intervals))\r\n mantissas = candidate_intervals / magnitudes\r\n\r\n # List of \"pleasing\" intervals between ticks on graph.\r\n # Only the first magnitude are listed, higher mags others are inferred:\r\n magic_intervals = array((1.0, 2.0, 2.5, 5.0, 10.0))\r\n\r\n # Calculate the absolute differences between the candidates\r\n # (with magnitude removed) and the magic intervals:\r\n differences = abs(magic_intervals[:, newaxis] - mantissas)\r\n\r\n # Find the division and magic interval combo that produce the\r\n # smallest differences:\r\n\r\n # KLUDGE: 'argsort' doesn't preserve the order of equal values,\r\n # so we subtract a small, index dependent amount from each difference\r\n # to force correct ordering.\r\n sh = shape(differences)\r\n small = 2.2e-16 * arange(sh[1]) * arange(sh[0])[:, newaxis]\r\n small = small[::-1, ::-1] #reverse the order\r\n differences = differences - small\r\n\r\n # ? Numeric should allow keyword \"axis\" ? comment out for now\r\n #best_mantissa = minimum.reduce(differences,axis=0)\r\n #best_magic = minimum.reduce(differences,axis=-1)\r\n best_mantissa = minimum.reduce(differences, 0)\r\n best_magic = minimum.reduce(differences, -1)\r\n magic_index = argsort(best_magic)[0]\r\n mantissa_index = argsort(best_mantissa)[0]\r\n\r\n # The best interval is the magic_interval multiplied by the magnitude\r\n # of the best mantissa:\r\n interval = magic_intervals[magic_index]\r\n magnitude = magnitudes[mantissa_index]\r\n result = interval * magnitude\r\n if result == 0.0:\r\n result = finfo(float).eps\r\n return result\r\n\r\n\r\n#--------------------------------------------------------------------------------\r\n# Compute the best tick interval length to achieve a specified number of tick\r\n# intervals:\r\n#--------------------------------------------------------------------------------\r\n\r\n\r\ndef tick_intervals(data_low, data_high, intervals):\r\n \"\"\" Computes the best tick interval length to achieve a specified number of\r\n tick intervals.\r\n\r\n Parameters\r\n ----------\r\n data_low, data_high : number\r\n The minimum and maximum values of the data along this axis.\r\n If any of the bound settings are 'auto' or 'fit', the axis\r\n traits are calculated automatically from these values.\r\n intervals : number\r\n The desired number of intervals\r\n\r\n Returns\r\n -------\r\n Returns a float indicating the tick interval length.\r\n \"\"\"\r\n range = float(data_high - data_low)\r\n if range == 0.0:\r\n range = 1.0\r\n interval = range / intervals\r\n factor = 10.0**floor(log10(interval))\r\n interval /= factor\r\n\r\n if interval < 2.0:\r\n interval = 2.0\r\n index = 0\r\n elif interval < 2.5:\r\n interval = 2.5\r\n index = 1\r\n elif interval < 5.0:\r\n interval = 5.0\r\n index = 2\r\n else:\r\n interval = 10.0\r\n index = 3\r\n\r\n while True:\r\n result = interval * factor\r\n if ((floor(data_low / result) * result) +\r\n (intervals * result) >= data_high):\r\n return result\r\n index = (index + 1) % 4\r\n interval *= (2.0, 1.25, 2.0, 2.0)[index]\r\n\r\n\r\ndef log_auto_ticks(data_low,\r\n data_high,\r\n bound_low,\r\n bound_high,\r\n tick_interval,\r\n use_endpoints=True):\r\n \"\"\"Like auto_ticks(), but for log scales.\"\"\"\r\n tick_goal = 15\r\n magic_numbers = [1, 2, 5]\r\n explicit_ticks = False\r\n\r\n if data_low <= 0.0:\r\n return []\r\n\r\n if tick_interval != 'auto':\r\n if tick_interval < 0:\r\n tick_goal = -tick_interval\r\n else:\r\n magic_numbers = [tick_interval]\r\n explicit_ticks = True\r\n\r\n if data_low > data_high:\r\n data_low, data_high = data_high, data_low\r\n\r\n log_low = log10(data_low)\r\n log_high = log10(data_high)\r\n log_interval = log_high - log_low\r\n\r\n if log_interval < 1.0:\r\n # If less than a factor of 10 separates the data, just use the normal\r\n # linear approach\r\n return auto_ticks(\r\n data_low,\r\n data_high,\r\n bound_low,\r\n bound_high,\r\n tick_interval,\r\n use_endpoints=False)\r\n\r\n elif log_interval < (tick_goal + 1) / 2 or explicit_ticks:\r\n # If there's enough space, try to put lines at the magic number multipliers\r\n # inside each power of ten\r\n\r\n # Try each interval to see how many ticks we get\r\n for interval in magic_numbers:\r\n ticklist = []\r\n for exp in range(int(floor(log_low)), int(ceil(log_high))):\r\n for multiplier in linspace(\r\n interval, 10.0, round(10.0 / interval), endpoint=1):\r\n tick = 10**exp * multiplier\r\n if tick >= data_low and tick <= data_high:\r\n ticklist.append(tick)\r\n if len(ticklist) < tick_goal + 3 or explicit_ticks:\r\n return ticklist\r\n else:\r\n # We put lines at every power of ten or less\r\n startlog = ceil(log_low)\r\n endlog = floor(log_high)\r\n interval = ceil((endlog - startlog) / 9.0)\r\n expticks = arange(startlog, endlog, interval)\r\n # There's no function that is like arange but inclusive, so\r\n # we have to check whether the endpoint should be included.\r\n if (endlog - startlog) % interval == 0.0:\r\n expticks = concatenate([expticks, [endlog]])\r\n return 10**expticks\r\n\r\n\r\n#-------------------------------------------------------------------------------\r\n# Compute the best lower and upper axis bounds for a range of data:\r\n#-------------------------------------------------------------------------------\r\n\r\n\r\ndef auto_bounds(data_low, data_high, tick_interval):\r\n \"\"\" Calculates appropriate upper and lower bounds for the axis from\r\n the data bounds and the given axis interval.\r\n\r\n The boundaries hit either exactly on the lower and upper values\r\n or on the tick mark just beyond the lower and upper values.\r\n \"\"\"\r\n return (calc_bound(data_low, tick_interval, False),\r\n calc_bound(data_high, tick_interval, True))\r\n\r\n\r\n#-------------------------------------------------------------------------------\r\n# Compute the best axis endpoint for a specified data value:\r\n#-------------------------------------------------------------------------------\r\n\r\n\r\ndef calc_bound(end_point, tick_interval, is_upper):\r\n \"\"\" Finds an axis end point that includes the value *end_point*.\r\n\r\n If the tick mark interval results in a tick mark hitting directly on the\r\n end point, *end_point* is returned. Otherwise, the location of the tick\r\n mark just past *end_point* is returned. The *is_upper* parameter\r\n specifies whether *end_point* is at the upper (True) or lower (False)\r\n end of the axis.\r\n \"\"\"\r\n quotient, remainder = divmod(end_point, tick_interval)\r\n if ((remainder == 0.0) or ((\r\n (tick_interval - remainder) / tick_interval) < 0.00001)):\r\n return end_point\r\n\r\n c1 = (quotient + 1.0) * tick_interval\r\n c2 = quotient * tick_interval\r\n if is_upper:\r\n return max(c1, c2)\r\n return min(c1, c2)\r\n", "from __future__ import print_function\n\nfrom numpy import linspace, sin\n\nfrom chaco.api import ArrayPlotData, Plot\nfrom enable.api import BaseTool\nfrom enable.component_editor import ComponentEditor\nfrom traits.api import Enum, HasTraits, Instance\nfrom traitsui.api import Item, View\n\n\nclass CustomTool(BaseTool):\n def normal_mouse_move(self, event):\n print(\"Screen point:\", event.x, event.y)\n\n def normal_left_down(self, event):\n print(\"Mouse went down at\", event.x, event.y)\n\n def normal_left_up(self, event):\n print(\"Mouse went up at:\", event.x, event.y)\n\n\nclass ScatterPlot(HasTraits):\n\n plot = Instance(Plot)\n\n traits_view = View(\n Item(\n 'plot', editor=ComponentEditor(), show_label=False),\n width=800,\n height=600,\n resizable=True,\n title=\"Custom Tool\")\n\n def _plot_default(self):\n # Create the data and the PlotData object\n x = linspace(-14, 14, 100)\n y = sin(x) * x**3\n plotdata = ArrayPlotData(x=x, y=y)\n # Create a Plot and associate it with the PlotData\n plot = Plot(plotdata)\n # Create a scatter plot in the Plot\n plot.plot((\"x\", \"y\"), type=\"scatter\", color=\"blue\")\n # Add our custom tool to the plot\n plot.tools.append(CustomTool(plot))\n return plot\n\n\n#===============================================================================\n# demo object that is used by the demo.py application.\n#===============================================================================\ndemo = ScatterPlot()\nif __name__ == \"__main__\":\n demo.edit_traits(kind=\"livemodal\")\n", "#!/usr/bin/env python\n\"\"\"\nScatter plot with point selection\n\nDraws a simple scatter plot of random data. The user can click on points to\nselect or unselect them.\n\n - Left-click on a point to select or unselect it.\n - Left-drag to pan.\n - Mouse wheel to zoom\n\n\"\"\"\nfrom __future__ import print_function\n\n# FIXME: the 'z' zoom interaction is ill-behaved.\n\n# Major library imports\nfrom numpy import sort\nfrom numpy.random import random\n\n# Enthought library imports\nfrom enable.api import Component, ComponentEditor\nfrom traits.api import HasTraits, Instance\nfrom traitsui.api import Item, VGroup, View, Label, HGroup, spring\n\n# Chaco imports\nfrom chaco.api import AbstractDataSource, ArrayPlotData, Plot, \\\n ScatterInspectorOverlay\nfrom chaco.tools.api import ScatterInspector, PanTool, ZoomTool\n\n\n#===============================================================================\n# # Create the Chaco plot.\n#===============================================================================\ndef _create_plot_component():\n\n # Create some data\n npts = 100\n x = sort(random(npts))\n y = random(npts)\n\n # Create a plot data obect and give it this data\n pd = ArrayPlotData()\n pd.set_data(\"index\", x)\n pd.set_data(\"value\", y)\n\n # Create the plot\n plot = Plot(pd)\n plot.plot(\n (\"index\", \"value\"),\n type=\"scatter\",\n name=\"my_plot\",\n marker=\"circle\",\n index_sort=\"ascending\",\n color=\"slategray\",\n marker_size=6,\n bgcolor=\"white\")\n\n # Tweak some of the plot properties\n plot.title = \"Scatter Plot With Selection\"\n plot.line_width = 1\n plot.padding = 50\n\n # Right now, some of the tools are a little invasive, and we need the\n # actual ScatterPlot object to give to them\n my_plot = plot.plots[\"my_plot\"][0]\n\n # Attach some tools to the plot\n my_plot.tools.append(\n ScatterInspector(\n my_plot, selection_mode=\"toggle\", persistent_hover=False))\n my_plot.overlays.append(\n ScatterInspectorOverlay(\n my_plot,\n hover_color=\"transparent\",\n hover_marker_size=10,\n hover_outline_color=\"purple\",\n hover_line_width=2,\n selection_marker_size=8,\n selection_color=\"lawngreen\"))\n\n my_plot.tools.append(PanTool(my_plot))\n my_plot.overlays.append(ZoomTool(my_plot, drag_button=\"right\"))\n\n return plot\n\n\n#===============================================================================\n# Attributes to use for the plot view.\nsize = (650, 650)\ntitle = \"Scatter plot with selection\"\nbg_color = \"lightgray\"\n\n\n#===============================================================================\n# # Demo class that is used by the demo.py application.\n#===============================================================================\nclass Demo(HasTraits):\n plot = Instance(Component)\n\n traits_view = View(\n VGroup(\n HGroup(spring, Label('Click point to select/unselect'), spring),\n Item(\n 'plot',\n editor=ComponentEditor(\n size=size, bgcolor=bg_color),\n show_label=False),\n orientation=\"vertical\"),\n resizable=True,\n title=title)\n\n def _metadata_handler(self):\n sel_indices = self.index_datasource.metadata.get('selections', [])\n print(\"Selection indices:\", sel_indices)\n\n hover_indices = self.index_datasource.metadata.get('hover', [])\n print(\"Hover indices:\", hover_indices)\n\n def _plot_default(self):\n plot = _create_plot_component()\n\n # Retrieve the plot hooked to the tool.\n my_plot = plot.plots[\"my_plot\"][0]\n\n # Set up the trait handler for the selection\n self.index_datasource = my_plot.index\n self.index_datasource.on_trait_change(self._metadata_handler,\n \"metadata_changed\")\n\n return plot\n\n\ndemo = Demo()\n\nif __name__ == \"__main__\":\n demo.configure_traits()\n\n# EOF\n", "\"\"\" Defines the LogMapper and InvalidDataRangeException classes.\r\n\"\"\"\r\n# Major library imports\r\nfrom numpy import array, isnan, log, log10, exp, zeros, sometrue,\\\r\n floor, ceil, ndarray\r\n\r\n# Enthought library imports\r\nfrom traits.api import Bool, Float\r\n\r\n#Local relative imports\r\nfrom .base_1d_mapper import Base1DMapper\r\n\r\nLOG_MINIMUM = 0.0\r\n\r\n\r\nclass InvalidDataRangeException(Exception):\r\n pass\r\n\r\n\r\nclass LogMapper(Base1DMapper):\r\n \"\"\" Defines a 1-D logarithmic scale mapping from a 1-D region in input\r\n space to a 1-D region in output space.\r\n \"\"\"\r\n\r\n # The value to map when asked to map values <= LOG_MINIMUM to screen space.\r\n fill_value = Float(1.0)\r\n\r\n #------------------------------------------------------------------------\r\n # Private traits\r\n #------------------------------------------------------------------------\r\n\r\n _inter_scale = Float(0.0)\r\n _inter_offset = Float(0.0)\r\n _screen_scale = Float(0.0)\r\n _screen_offset = Float(0.0)\r\n _null_screen_range = Bool(False)\r\n _null_data_range = Bool(False)\r\n\r\n #------------------------------------------------------------------------\r\n # Public methods\r\n #------------------------------------------------------------------------\r\n\r\n def map_screen(self, data_array):\r\n \"\"\" map_screen(data_array) -> screen_array\r\n\r\n Overrides AbstractMapper. Maps values from data space to screen space.\r\n \"\"\"\r\n # Ensure that data_array is actually an array.\r\n if not isinstance(data_array, ndarray):\r\n data_array = array(data_array, ndmin=1)\r\n # First convert to a [0,1] space, then to the screen space.\r\n if not self._cache_valid:\r\n self._compute_scale()\r\n if self._inter_scale == 0.0:\r\n intermediate = data_array * 0.0\r\n else:\r\n try:\r\n mask = (data_array <= LOG_MINIMUM) | isnan(data_array)\r\n if sometrue(mask):\r\n data_array = array(data_array, copy=True, ndmin=1)\r\n data_array[mask] = self.fill_value\r\n intermediate = (\r\n log(data_array) - self._inter_offset) / self._inter_scale\r\n except ValueError:\r\n intermediate = zeros(len(data_array))\r\n\r\n result = intermediate * self._screen_scale + self._screen_offset\r\n return result\r\n\r\n def map_data(self, screen_val):\r\n \"\"\" map_data(screen_val) -> data_val\r\n\r\n Overrides Abstract Mapper. Maps values from screen space into data space.\r\n \"\"\"\r\n if not self._cache_valid:\r\n self._compute_scale()\r\n if self._null_screen_range or self._null_data_range:\r\n return array([self.range.low])\r\n #First convert to a [0,1] space, then to the data space\r\n intermediate = (screen_val - self._screen_offset) / self._screen_scale\r\n return exp(self._inter_scale * intermediate + self._inter_offset)\r\n\r\n def map_data_array(self, screen_vals):\r\n return self.map_data(screen_vals)\r\n\r\n #------------------------------------------------------------------------\r\n # Private methods\r\n #------------------------------------------------------------------------\r\n\r\n def _get_safe_scale(self, range):\r\n orig_low = range.low\r\n orig_high = range.high\r\n if orig_low < LOG_MINIMUM:\r\n low = LOG_MINIMUM\r\n else:\r\n low = orig_low\r\n\r\n if orig_high < LOG_MINIMUM:\r\n high = LOG_MINIMUM\r\n else:\r\n high = orig_high\r\n\r\n if low == high:\r\n if low == LOG_MINIMUM:\r\n low = 1.0\r\n high = 10.0\r\n else:\r\n log_val = log10(low)\r\n low = pow(10, floor(log_val))\r\n if ceil(log_val) != floor(log_val):\r\n high = pow(10, ceil(log_val))\r\n else:\r\n high = pow(10, ceil(log_val) + 1)\r\n\r\n return (low, high)\r\n\r\n def _compute_scale(self):\r\n if self._cache_valid:\r\n return\r\n\r\n if self.range is None:\r\n self._cache_valid = False\r\n return\r\n\r\n screen_range = self.high_pos - self.low_pos\r\n if screen_range == 0.0:\r\n self._null_screen_range = True\r\n\r\n # Get dataspace low and high from the range that are \"safe\" for a\r\n # logarithmic mapper, i.e. constrained to be between LOG_MINIMUM and inf.\r\n low, high = self._get_safe_scale(self.range)\r\n if high - low == 0:\r\n self._null_data_range = True\r\n else:\r\n if low == LOG_MINIMUM:\r\n self._inter_scale = log(high)\r\n self._inter_offset = 0.0\r\n else:\r\n self._inter_scale = log(high) - log(low)\r\n self._inter_offset = log(low)\r\n self._screen_scale = screen_range\r\n self._screen_offset = self.low_pos\r\n\r\n self._cache_valid = True\r\n return\r\n\r\n\r\n# EOF\r\n", "\"\"\"\nDraw overlapping line plots (Bessel functions)\n\nDraws overlapping line plots with legends. Some are drawn as lines, \nsome as points only.\n\nLeft-drag pans the plot.\n\nRight-drag (in the Y direction) zooms the plot in and out.\n\nMousewheel up and down zooms the plot in and out.\n\nPressing \"z\" brings up the Zoom Box, and you can click-drag a rectangular\nregion to zoom. \n\nRight-drag on the legend allows you to reposition it.\n\"\"\"\n\n# Major library imports\nfrom numpy import arange\nfrom scipy.special import jn\n\n# Enthought library imports\nfrom enable.api import Component, ComponentEditor\nfrom traits.api import Float, HasTraits, Int, Instance\nfrom traitsui.api import Item, Group, View\n\n# Chaco imports\nfrom chaco.api import create_line_plot, add_default_axes, add_default_grids, \\\n OverlayPlotContainer, PlotLabel, create_scatter_plot, Legend\nfrom chaco.tools.api import PanTool, ZoomTool, LegendTool, TraitsTool, DragZoom\nfrom chaco.example_support import COLOR_PALETTE\n\n\nclass OverlappingPlotContainer(OverlayPlotContainer):\n \"\"\"Simple container for creating a series of plots\"\"\"\n\n numpoints = Int(100)\n low = Float(-5.0)\n high = Float(15.0)\n num_funs = Int(10)\n\n def __init__(self, *args, **kws):\n super(OverlayPlotContainer, self).__init__(*args, **kws)\n self._setup_plots()\n\n def _setup_plots(self):\n \"\"\"Creates series of Bessel function plots\"\"\"\n plots = {}\n x = arange(self.low, self.high + 0.001,\n (self.high - self.low) / self.numpoints)\n\n for i in range(self.num_funs):\n y = jn(i, x)\n if i % 2 == 1:\n plot = create_line_plot(\n (x, y), color=tuple(COLOR_PALETTE[i]), width=2.0)\n else:\n plot = create_scatter_plot(\n (x, y), color=tuple(COLOR_PALETTE[i]))\n\n if i == 0:\n value_mapper, index_mapper, legend = \\\n self._setup_plot_tools(plot)\n else:\n self._setup_mapper(plot, value_mapper, index_mapper)\n\n self.add(plot)\n plots[\"Bessel j_%d\" % i] = plot\n\n # Set the list of plots on the legend\n legend.plots = plots\n\n # Add the title at the top\n self.overlays.append(\n PlotLabel(\n \"Bessel functions\",\n component=self,\n font=\"swiss 16\",\n overlay_position=\"top\"))\n\n # Add the traits inspector tool to the container\n self.tools.append(TraitsTool(self))\n\n def _setup_plot_tools(self, plot):\n \"\"\"Sets up the background, and several tools on a plot\"\"\"\n # Make a white background with grids and axes\n plot.bgcolor = \"white\"\n add_default_grids(plot)\n add_default_axes(plot)\n\n # Allow white space around plot\n plot.index_range.tight_bounds = False\n plot.index_range.refresh()\n plot.value_range.tight_bounds = False\n plot.value_range.refresh()\n\n # The PanTool allows panning around the plot\n plot.tools.append(PanTool(plot))\n\n # The ZoomTool tool is stateful and allows drawing a zoom\n # box to select a zoom region.\n zoom = ZoomTool(plot, tool_mode=\"box\", always_on=False)\n plot.overlays.append(zoom)\n\n # The DragZoom tool just zooms in and out as the user drags\n # the mouse vertically.\n dragzoom = DragZoom(plot, drag_button=\"right\")\n plot.tools.append(dragzoom)\n\n # Add a legend in the upper right corner, and make it relocatable\n legend = Legend(component=plot, padding=10, align=\"ur\")\n legend.tools.append(LegendTool(legend, drag_button=\"right\"))\n plot.overlays.append(legend)\n\n return plot.value_mapper, plot.index_mapper, legend\n\n def _setup_mapper(self, plot, value_mapper, index_mapper):\n \"\"\"Sets up a mapper for given plot\"\"\"\n plot.value_mapper = value_mapper\n value_mapper.range.add(plot.value)\n plot.index_mapper = index_mapper\n index_mapper.range.add(plot.index)\n\n\nsize = (800, 700)\ntitle = \"Simple Line Plot\"\n\n\nclass PlotExample(HasTraits):\n plot = Instance(Component)\n\n traits_view = View(\n Group(\n Item(\n 'plot', editor=ComponentEditor(size=size), show_label=False),\n orientation=\"vertical\"),\n resizable=True,\n title=title,\n width=size[0],\n height=size[1])\n\n def _plot_default(self):\n return OverlappingPlotContainer(\n padding=50,\n fill_padding=True,\n bgcolor=\"lightgray\",\n use_backbuffer=True)\n\n\ndemo = PlotExample()\n\nif __name__ == \"__main__\":\n demo.configure_traits()\n", "\"\"\" Defines the LassoOverlay class.\r\n\"\"\"\r\n\r\nfrom numpy import concatenate, newaxis\r\n\r\n# Enthought library imports\r\nfrom enable.api import ColorTrait, LineStyle\r\nfrom traits.api import Float, Instance, Bool\r\n\r\n# Local imports\r\nfrom .abstract_overlay import AbstractOverlay\r\n\r\n\r\nclass LassoOverlay(AbstractOverlay):\r\n \"\"\" Draws a lasso selection region on top of a plot.\r\n\r\n LassoOverlay gets its data from a LassoSelection.\r\n \"\"\"\r\n\r\n # The LassoSelection that provides the data for this overlay.\r\n lasso_selection = Instance('chaco.tools.lasso_selection.LassoSelection')\r\n # The fill color for the selection region.\r\n selection_fill_color = ColorTrait('lightskyblue')\r\n # The border color for the selection region.\r\n selection_border_color = ColorTrait('dodgerblue')\r\n # The transparency level for the selection fill color.\r\n selection_alpha = Float(0.8)\r\n # The width of the selection border.\r\n selection_border_width = Float(2.0)\r\n # The line style of the selection border.\r\n selection_border_dash = LineStyle\r\n\r\n # The background color (overrides AbstractOverlay).\r\n bgcolor = 'clear'\r\n\r\n # Whether to draw the lasso\r\n # depends on the state of the lasso tool\r\n _draw_selection = Bool(False)\r\n\r\n def overlay(self, other_component, gc, view_bounds=None, mode=\"normal\"):\r\n \"\"\" Draws this component overlaid on another component.\r\n\r\n Implements AbstractOverlay.\r\n \"\"\"\r\n if not self._draw_selection:\r\n return\r\n with gc:\r\n c = other_component\r\n gc.clip_to_rect(c.x, c.y, c.width, c.height)\r\n self._draw_component(gc, view_bounds, mode)\r\n return\r\n\r\n def _updated_changed_for_lasso_selection(self):\r\n self.component.invalidate_draw()\r\n self.component.request_redraw()\r\n\r\n def _event_state_fired_for_lasso_selection(self, val):\r\n self._draw_selection = val == 'selecting'\r\n self.component.invalidate_draw()\r\n self.component.request_redraw()\r\n\r\n def _draw_component(self, gc, view_bounds=None, mode='normal'):\r\n \"\"\" Draws the component.\r\n\r\n This method is preserved for backwards compatibility with _old_draw().\r\n Overrides PlotComponent.\r\n \"\"\"\r\n with gc:\r\n # We may need to make map_screen more flexible in the number of dimensions\r\n # it accepts for ths to work well.\r\n for selection in self.lasso_selection.disjoint_selections:\r\n points = self.component.map_screen(selection)\r\n if len(points) == 0:\r\n return\r\n points = concatenate((points, points[0, newaxis]), axis=0)\r\n gc.set_line_width(self.selection_border_width)\r\n gc.set_line_dash(self.selection_border_dash_)\r\n gc.set_fill_color(self.selection_fill_color_)\r\n gc.set_stroke_color(self.selection_border_color_)\r\n gc.set_alpha(self.selection_alpha)\r\n gc.lines(points)\r\n gc.draw_path()\r\n", "\"\"\"A simple inspector overlay for plots\r\n\r\nThis module provides the SimpleInspectorOverlay for displaying\r\ninformation gathered from an inspector tool in a TextGrid. By default\r\nit is configured to work with a SimpleInspectorTool.\r\n\r\nThe module also provides some helper factory functions for creating text\r\nformatters for dictionary values.\r\n\"\"\"\r\n\r\nfrom numpy import array\r\n\r\nfrom traits.api import Any, List, Callable, Enum, Bool\r\n\r\nfrom .text_grid_overlay import TextGridOverlay\r\n\r\n\r\ndef basic_formatter(key, decimals):\r\n \"\"\"Create a basic '<key>: <value>' formatting function\r\n\r\n This factory creates a function that formats a specified key and with a\r\n numerical value from a dictionary into a string.\r\n\r\n Parameters\r\n ----------\r\n\r\n key\r\n The dictionary key to format.\r\n decimals\r\n The number of decimal places to show.\r\n\r\n Returns\r\n -------\r\n\r\n format\r\n A factory function that takes a dictionary and returns a string.\r\n \"\"\"\r\n format_string = '%s: %%(%s).%df' % (key, key, decimals)\r\n\r\n def format(**kwargs):\r\n return format_string % kwargs\r\n\r\n return format\r\n\r\n\r\ndef datetime_formatter(key, time_format='%Y/%m/%d %H:%M:%S'):\r\n \"\"\"Create a datetime formatting function\r\n\r\n This factory creates a function that formats a specified key and with a\r\n timestamp value from a dictionary into a string.\r\n\r\n Parameters\r\n ----------\r\n\r\n key\r\n The dictionary key to format. The corresponding value should be a\r\n timestamp.\r\n time_format\r\n A format string suitable for strftime().\r\n\r\n Returns\r\n -------\r\n\r\n format\r\n A factory function that takes a dictionary and returns a string.\r\n \"\"\"\r\n import datetime\r\n\r\n def format(**kwargs):\r\n dt = datetime.datetime.fromtimestamp(kwargs[key])\r\n return key + ': ' + dt.strftime(time_format)\r\n\r\n return format\r\n\r\n\r\ndef time_formatter(key):\r\n \"\"\"Create a time formatting function\r\n\r\n This factory creates a function that formats a specified key and with a\r\n timestamp value from a dictionary into a 'HH:MM:SS' format string.\r\n\r\n Parameters\r\n ----------\r\n\r\n key\r\n The dictionary key to format. The corresponding value should be a\r\n timestamp.\r\n\r\n Returns\r\n -------\r\n\r\n format\r\n A factory function that takes a dictionary and returns a string.\r\n \"\"\"\r\n return datetime_formatter(key, time_format='%H:%M:%S')\r\n\r\n\r\ndef date_formatter(key):\r\n \"\"\"Create a date formatting function\r\n\r\n This factory creates a function that formats a specified key and with a\r\n timestamp value from a dictionary into a 'yyyy/mm/dd' format string.\r\n\r\n Parameters\r\n ----------\r\n\r\n key\r\n The dictionary key to format. The corresponding value should be a\r\n timestamp.\r\n\r\n Returns\r\n -------\r\n\r\n format\r\n A factory function that takes a dictionary and returns a string.\r\n \"\"\"\r\n return datetime_formatter(key, time_format='%Y/%m/%d')\r\n\r\n\r\nclass SimpleInspectorOverlay(TextGridOverlay):\r\n \"\"\" Simple inspector overlay for plots\r\n\r\n This is a simple overlay that listens for new_value events on a\r\n SimpleInspectorTool and displays formatted values in a grid.\r\n\r\n By default this displays the 'x' and 'y' values provided by the\r\n SimpleInspectorTool, but instances can provide a field_formatters\r\n trait which is a list of lists of callables which extract values\r\n from a dictionary and formats them. Each callable corresponds to a\r\n cell in the underlying TextGrid component.\r\n\r\n Although by default this works with the SimpleInspectorTool, with\r\n appropriate field_formatters this class can be used with any inspector\r\n tool that follows the same API.\r\n \"\"\"\r\n # XXX We should probably refactor this into a BaseInspectorOverlay\r\n # which handles the visibility and basic event handling, and smaller\r\n # version of this class which handles inserting values into a text grid\r\n\r\n # the inspector that I am listening to. This should have a new_value\r\n # event and a visible trait for me to listen to.\r\n inspector = Any\r\n\r\n # fields to display\r\n field_formatters = List(List(Callable))\r\n\r\n # Anchor the text to the mouse? (If False, then the text is in one of the\r\n # corners.) Use the **align** trait to determine which corner.\r\n tooltip_mode = Bool(False)\r\n\r\n # The default state of the overlay is visible.\r\n visible = True\r\n\r\n # Whether the overlay should auto-hide and auto-show based on the\r\n # tool's location, or whether it should be forced to be hidden or visible.\r\n visibility = Enum(\"auto\", True, False)\r\n\r\n #########################################################################\r\n # Traits Handlers\r\n #########################################################################\r\n\r\n def _field_formatters_default(self):\r\n return [[basic_formatter('x', 2)], [basic_formatter('y', 2)]]\r\n\r\n def _new_value_updated(self, event):\r\n if event is None:\r\n self.text_grid = array()\r\n if self.visibility == \"auto\":\r\n self.visibility = False\r\n elif self.visibility == \"auto\":\r\n self.visible = True\r\n\r\n if self.tooltip_mode:\r\n self.alternate_position = self.inspector.last_mouse_position\r\n\r\n d = event\r\n text = []\r\n self.text_grid.string_array = array(\r\n [[formatter(**d) for formatter in row]\r\n for row in self.field_formatters])\r\n\r\n self.text_grid.request_redraw()\r\n\r\n def _visible_changed(self):\r\n if self.component:\r\n self.request_redraw()\r\n\r\n def _inspector_changed(self, old, new):\r\n if old:\r\n old.on_trait_event(\r\n self._new_value_updated, 'new_value', remove=True)\r\n old.on_trait_change(\r\n self._tool_visible_changed, \"visible\", remove=True)\r\n if new:\r\n new.on_trait_event(self._new_value_updated, 'new_value')\r\n new.on_trait_change(self._tool_visible_changed, \"visible\")\r\n self._tool_visible_changed()\r\n\r\n def _tool_visible_changed(self):\r\n self.visibility = self.inspector.visible\r\n if self.visibility != \"auto\":\r\n self.visible = self.visibility\r\n" ]
[ [ "numpy.arange", "numpy.finfo", "numpy.concatenate", "numpy.ceil", "numpy.minimum.reduce", "numpy.shape", "numpy.log10", "numpy.floor", "numpy.argsort", "numpy.array" ], [ "numpy.linspace", "numpy.sin" ], [ "numpy.random.random" ], [ "numpy.log", "numpy.isnan", "numpy.ceil", "numpy.log10", "numpy.floor", "numpy.exp", "numpy.array", "numpy.sometrue" ], [ "numpy.arange", "scipy.special.jn" ], [ "numpy.concatenate" ], [ "numpy.array" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
slowy07/keras
[ "d3688b72924a4235598f0f80038de8c897f44799", "d3688b72924a4235598f0f80038de8c897f44799", "d3688b72924a4235598f0f80038de8c897f44799", "d3688b72924a4235598f0f80038de8c897f44799", "d3688b72924a4235598f0f80038de8c897f44799" ]
[ "keras/saving/saved_model/serialized_attributes.py", "keras/optimizer_v2/optimizer_v2.py", "keras/distribute/sidecar_evaluator.py", "keras/engine/data_adapter.py", "keras/engine/compile_utils_test.py" ]
[ "# Copyright 2018 The TensorFlow Authors. All Rights Reserved.\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n# ==============================================================================\n\"\"\"Helper classes that list&validate all attributes to serialize to SavedModel.\n\"\"\"\n\nfrom keras.saving.saved_model import constants\nfrom keras.saving.saved_model import order_preserving_set as ops\nfrom keras.saving.saved_model import save_impl\nfrom keras.utils.generic_utils import LazyLoader\nimport tensorflow.compat.v2 as tf\n\n# TODO(b/134426265): Switch back to single-quotes to match the rest of the file\n# once the issue with copybara is fixed.\n# pylint:disable=g-inconsistent-quotes\nbase_layer = LazyLoader(\n \"base_layer\", globals(),\n \"keras.engine.base_layer\")\ntraining_lib = LazyLoader(\n \"training_lib\", globals(),\n \"keras.engine.training\")\nmetrics = LazyLoader(\"metrics\", globals(),\n \"keras.metrics\")\nrecurrent = LazyLoader(\n \"recurrent\", globals(),\n \"keras.layers.recurrent\")\n# pylint:enable=g-inconsistent-quotes\n\n\nclass SerializedAttributes(object):\n \"\"\"Class that tracks and validates all serialization attributes.\n\n Keras models contain many Python-defined components. For example, the\n trainable_variable property lists the model's trainable variables by\n recursively retrieving the trainable variables from each of the child layers.\n Another example is model.call, a python function that calls child layers and\n adds ops to the backend graph.\n\n Only Tensorflow checkpointable objects and functions can be serialized to\n SavedModel. Serializing a Keras model as-is results in a checkpointable object\n that does not resemble a Keras model at all. Thus, extra checkpointable\n objects and functions must be created during serialization.\n\n **Defining new serialized attributes**\n Child classes should be defined using:\n SerializedAttributes.with_attributes(\n 'name', checkpointable_objects=[...], functions=[...], copy_from=[...])\n This class is used to cache generated checkpointable objects and functions,\n ensuring that new objects and functions are generated a single time.\n\n **Usage during serialization**\n Each Layer/Model object should have a corresponding instance of\n SerializedAttributes. Create a new instance by calling\n `SerializedAttributes.new(obj)`. Objects and functions may be saved using\n `.set_and_validate_checkpointable_objects`/`.set_and_and_validate_functions`.\n The properties `.checkpointable_objects` and `.functions` returns the cached\n values.\n\n **Adding/changing attributes to save to SavedModel**\n 1. Change the call to `SerializedAttributes.with_attributes` in the correct\n class:\n - CommonEndpoints: Base attributes to be added during serialization. If\n these attributes are present in a Trackable object, it can be\n deserialized to a Keras Model.\n - LayerAttributes: Attributes to serialize for Layer objects.\n - ModelAttributes: Attributes to serialize for Model objects.\n 2. Update class docstring\n 3. Update arguments to any calls to `set_and_validate_*`. For example, if\n `call_raw_tensors` is added to the ModelAttributes function list, then\n a `call_raw_tensors` function should be passed to\n `set_and_validate_functions`.\n\n **Common endpoints vs other attributes**\n Only common endpoints are attached directly to the root object. Keras-specific\n attributes are saved to a separate trackable object with the name \"keras_api\".\n The number of objects attached to the root is limited because any naming\n conflicts will cause user code to break.\n\n Another reason is that this will only affect users who call\n `tf.saved_model.load` instead of `tf.keras.models.load_model`. These are\n advanced users who are likely to have defined their own tf.functions and\n trackable objects. The added Keras-specific attributes are kept out of the way\n in the \"keras_api\" namespace.\n\n Properties defined in this class may be used to filter out keras-specific\n attributes:\n - `functions_to_serialize`: Returns dict of functions to attach to the root\n object.\n - `checkpointable_objects_to_serialize`: Returns dict of objects to attach to\n the root object (including separate trackable object containing\n keras-specific attributes)\n\n All changes to the serialized attributes must be backwards-compatible, so\n attributes should not be removed or modified without sufficient justification.\n \"\"\"\n\n @staticmethod\n def with_attributes(\n name, checkpointable_objects=None, functions=None, copy_from=None):\n \"\"\"Creates a subclass with all attributes as specified in the arguments.\n\n Args:\n name: Name of subclass\n checkpointable_objects: List of checkpointable objects to be serialized\n in the SavedModel.\n functions: List of functions to be serialized in the SavedModel.\n copy_from: List of other SerializedAttributes subclasses. The returned\n class will copy checkpoint objects/functions from each subclass.\n\n Returns:\n Child class with attributes as defined in the `checkpointable_objects`\n and `functions` lists.\n \"\"\"\n checkpointable_objects = checkpointable_objects or []\n functions = functions or []\n\n if copy_from is not None:\n for cls in copy_from:\n checkpointable_objects.extend(cls.all_checkpointable_objects)\n functions.extend(cls.all_functions)\n\n # OrderPreservingSets are used here to guarantee serialization determinism\n # of Keras objects.\n classdict = {\n 'all_checkpointable_objects':\n ops.OrderPreservingSet(checkpointable_objects),\n 'all_functions':\n ops.OrderPreservingSet(functions),\n }\n return type(name, (SerializedAttributes,), classdict)\n\n @staticmethod\n def new(obj):\n \"\"\"Returns a new SerializedAttribute object.\"\"\"\n if isinstance(obj, training_lib.Model):\n return ModelAttributes()\n elif isinstance(obj, metrics.Metric):\n return MetricAttributes()\n elif isinstance(obj, recurrent.RNN):\n return RNNAttributes()\n elif isinstance(obj, base_layer.Layer):\n return LayerAttributes()\n else:\n raise TypeError('Internal error during serialization: Expected Keras '\n 'Layer object, got {} of type {}'.format(obj, type(obj)))\n\n def __init__(self):\n self._object_dict = {}\n self._function_dict = {}\n self._keras_trackable = tf.__internal__.tracking.AutoTrackable()\n\n @property\n def functions(self):\n \"\"\"Returns dictionary of all functions.\"\"\"\n return {key: value for key, value in self._function_dict.items()\n if value is not None}\n\n @property\n def checkpointable_objects(self):\n \"\"\"Returns dictionary of all checkpointable objects.\"\"\"\n return {key: value for key, value in self._object_dict.items()\n if value is not None}\n\n @property\n def functions_to_serialize(self):\n \"\"\"Returns functions to attach to the root object during serialization.\"\"\"\n functions = {}\n for key, v in self.functions.items():\n if key in CommonEndpoints.all_functions:\n functions[key] = (v.wrapped_call if isinstance(v, save_impl.LayerCall)\n else v)\n return functions\n\n @property\n def objects_to_serialize(self):\n \"\"\"Returns objects to attach to the root object during serialization.\"\"\"\n objects = {key: value for key, value in self.checkpointable_objects.items()\n if key in CommonEndpoints.all_checkpointable_objects}\n objects[constants.KERAS_ATTR] = self._keras_trackable\n return objects\n\n def set_and_validate_functions(self, function_dict):\n \"\"\"Saves function dictionary, and validates dictionary values.\"\"\"\n for key in self.all_functions:\n if key in function_dict:\n if (function_dict[key] is not None and # Not all functions are required\n not isinstance(function_dict[key],\n (tf.__internal__.function.Function,\n tf.types.experimental.ConcreteFunction,\n save_impl.LayerCall))):\n raise ValueError(\n 'Function dictionary contained a non-function object: {} (for key'\n ' {})'.format(function_dict[key], key))\n fn = function_dict[key]\n self._function_dict[key] = fn\n\n # Extract TensorFlow `Function` from LayerCall.\n tf_fn = fn.wrapped_call if isinstance(fn, save_impl.LayerCall) else fn\n setattr(self._keras_trackable, key, tf_fn)\n else:\n raise ValueError('Function {} missing from serialized function dict.'\n .format(key))\n return self.functions\n\n def set_and_validate_objects(self, object_dict):\n \"\"\"Saves objects to a dictionary, and validates the values.\"\"\"\n for key in self.all_checkpointable_objects:\n if key in object_dict:\n if not isinstance(object_dict[key], tf.__internal__.tracking.Trackable):\n raise ValueError(\n 'Object dictionary contained a non-trackable object: {} (for key'\n ' {})'.format(object_dict[key], key))\n self._object_dict[key] = object_dict[key]\n setattr(self._keras_trackable, key, object_dict[key])\n else:\n raise ValueError(\n 'Object {} missing from serialized object dict.'.format(key))\n return self.checkpointable_objects\n\n\nclass CommonEndpoints(SerializedAttributes.with_attributes(\n 'CommonEndpoints',\n checkpointable_objects=['variables', 'trainable_variables',\n 'regularization_losses'],\n functions=['__call__', 'call_and_return_all_conditional_losses',\n '_default_save_signature'])):\n \"\"\"Common endpoints shared by all models loadable by Keras.\n\n List of all attributes:\n variables: List of all variables in the model and its sublayers.\n trainable_variables: List of all trainable variables in the model and its\n sublayers.\n regularization_losses: List of all unconditional losses (losses not\n dependent on the inputs) in the model and its sublayers.\n __call__: Function that takes inputs and returns the outputs of the model\n call function.\n call_and_return_all_conditional_losses: Function that returns a tuple of\n (call function outputs, list of all losses that depend on the inputs).\n _default_save_signature: Traced model call function. This is only included\n if the top level exported object is a Keras model.\n \"\"\"\n\n\nclass LayerAttributes(SerializedAttributes.with_attributes(\n 'LayerAttributes',\n checkpointable_objects=['non_trainable_variables', 'layers', 'metrics',\n 'layer_regularization_losses', 'layer_metrics'],\n functions=['call_and_return_conditional_losses', 'activity_regularizer_fn'],\n copy_from=[CommonEndpoints]\n )):\n \"\"\"Layer checkpointable objects + functions that are saved to the SavedModel.\n\n List of all attributes:\n All attributes from CommonEndpoints\n non_trainable_variables: List of non-trainable variables in the layer and\n its sublayers.\n layers: List of all sublayers.\n metrics: List of all metrics in the layer and its sublayers.\n call_and_return_conditional_losses: Function that takes inputs and returns a\n tuple of (outputs of the call function, list of input-dependent losses).\n The list of losses excludes the activity regularizer function, which is\n separate to allow the deserialized Layer object to define a different\n activity regularizer.\n activity_regularizer_fn: Callable that returns the activity regularizer loss\n layer_regularization_losses: List of losses owned only by this layer.\n layer_metrics: List of metrics owned by this layer.\n \"\"\"\n\n\nclass ModelAttributes(SerializedAttributes.with_attributes(\n 'ModelAttributes',\n copy_from=[LayerAttributes])):\n \"\"\"Model checkpointable objects + functions that are saved to the SavedModel.\n\n List of all attributes:\n All attributes from LayerAttributes (including CommonEndpoints)\n \"\"\"\n # TODO(kathywu): Add attributes `compile_losses` and `compile_metrics`, which\n # list all losses and metrics defined by `model.compile`.\n\n\nclass MetricAttributes(\n SerializedAttributes.with_attributes(\n 'MetricAttributes',\n checkpointable_objects=['variables'],\n functions=[],\n )):\n \"\"\"Attributes that are added to Metric objects when saved to SavedModel.\n\n List of all attributes:\n variables: list of all variables\n \"\"\"\n pass\n\n\nclass RNNAttributes(SerializedAttributes.with_attributes(\n 'RNNAttributes',\n checkpointable_objects=['states'],\n copy_from=[LayerAttributes])):\n \"\"\"RNN checkpointable objects + functions that are saved to the SavedModel.\n\n List of all attributes:\n All attributes from LayerAttributes (including CommonEndpoints)\n states: List of state variables\n \"\"\"\n", "# Copyright 2018 The TensorFlow Authors. All Rights Reserved.\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n# ==============================================================================\n\"\"\"Version 2 of class Optimizer.\"\"\"\n\nimport tensorflow.compat.v2 as tf\n# pylint: disable=g-bad-name\n\nimport abc\nimport contextlib\nimport functools\nimport warnings\nfrom keras import backend\nfrom keras import initializers\nfrom keras.engine import base_layer_utils\nfrom keras.optimizer_v2 import learning_rate_schedule\nfrom keras.optimizer_v2 import utils as optimizer_utils\nfrom keras.utils import generic_utils\nfrom keras.utils import layer_utils\nfrom keras.utils import tf_inspect\nfrom keras.utils import tf_utils\nfrom tensorflow.python.util.tf_export import keras_export\n\n\nkeras_optimizers_gauge = tf.__internal__.monitoring.BoolGauge(\n \"/tensorflow/api/keras/optimizers\", \"keras optimizer usage\", \"method\")\n\n_DEFAULT_VALID_DTYPES = frozenset([\n tf.float16, tf.bfloat16, tf.float32, tf.float64,\n tf.complex64, tf.complex128\n])\n\n\ndef _deduplicate_indexed_slices(values, indices):\n \"\"\"Sums `values` associated with any non-unique `indices`.\n\n Args:\n values: A `Tensor` with rank >= 1.\n indices: A one-dimensional integer `Tensor`, indexing into the first\n dimension of `values` (as in an IndexedSlices object).\n\n Returns:\n A tuple of (`summed_values`, `unique_indices`) where `unique_indices` is a\n de-duplicated version of `indices` and `summed_values` contains the sum of\n `values` slices associated with each unique index.\n \"\"\"\n unique_indices, new_index_positions = tf.unique(indices)\n summed_values = tf.math.unsorted_segment_sum(\n values, new_index_positions,\n tf.shape(unique_indices)[0])\n return (summed_values, unique_indices)\n\n\nclass NullContextmanager(object):\n\n def __init__(self, *args, **kwargs):\n pass\n\n def __enter__(self):\n pass\n\n def __exit__(self, type_arg, value_arg, traceback_arg):\n return False # False values do not suppress exceptions\n\n\ndef name_scope_only_in_function_or_graph(name):\n \"\"\"Internal-only entry point for `name_scope*`.\n\n Enters a compat.v1.name_scope only when in a function or graph,\n not when running fully eagerly.\n\n Args:\n name: The name argument that is passed to the op function.\n\n Returns:\n `name_scope*` context manager.\n \"\"\"\n if not tf.executing_eagerly():\n return tf.name_scope(name)\n else:\n return NullContextmanager()\n\n\n@keras_export(\"keras.optimizers.Optimizer\", metaclass=abc.ABCMeta)\nclass OptimizerV2(tf.__internal__.tracking.Trackable):\n \"\"\"Base class for Keras optimizers.\n\n You should not use this class directly, but instead instantiate one of its\n subclasses such as `tf.keras.optimizers.SGD`, `tf.keras.optimizers.Adam`, etc.\n\n ### Usage\n\n ```python\n # Create an optimizer with the desired parameters.\n opt = tf.keras.optimizers.SGD(learning_rate=0.1)\n # `loss` is a callable that takes no argument and returns the value\n # to minimize.\n loss = lambda: 3 * var1 * var1 + 2 * var2 * var2\n # In graph mode, returns op that minimizes the loss by updating the listed\n # variables.\n opt_op = opt.minimize(loss, var_list=[var1, var2])\n opt_op.run()\n # In eager mode, simply call minimize to update the list of variables.\n opt.minimize(loss, var_list=[var1, var2])\n ```\n\n ### Usage in custom training loops\n\n In Keras models, sometimes variables are created when the model is first\n called, instead of construction time. Examples include 1) sequential models\n without input shape pre-defined, or 2) subclassed models. Pass var_list as\n callable in these cases.\n\n Example:\n\n ```python\n opt = tf.keras.optimizers.SGD(learning_rate=0.1)\n model = tf.keras.Sequential()\n model.add(tf.keras.layers.Dense(num_hidden, activation='relu'))\n model.add(tf.keras.layers.Dense(num_classes, activation='sigmoid'))\n loss_fn = lambda: tf.keras.losses.mse(model(input), output)\n var_list_fn = lambda: model.trainable_weights\n for input, output in data:\n opt.minimize(loss_fn, var_list_fn)\n ```\n\n ### Processing gradients before applying them\n\n Calling `minimize()` takes care of both computing the gradients and\n applying them to the variables. If you want to process the gradients\n before applying them you can instead use the optimizer in three steps:\n\n 1. Compute the gradients with `tf.GradientTape`.\n 2. Process the gradients as you wish.\n 3. Apply the processed gradients with `apply_gradients()`.\n\n Example:\n\n ```python\n # Create an optimizer.\n opt = tf.keras.optimizers.SGD(learning_rate=0.1)\n\n # Compute the gradients for a list of variables.\n with tf.GradientTape() as tape:\n loss = <call_loss_function>\n vars = <list_of_variables>\n grads = tape.gradient(loss, vars)\n\n # Process the gradients, for example cap them, etc.\n # capped_grads = [MyCapper(g) for g in grads]\n processed_grads = [process_gradient(g) for g in grads]\n\n # Ask the optimizer to apply the processed gradients.\n opt.apply_gradients(zip(processed_grads, var_list))\n ```\n\n ### Use with `tf.distribute.Strategy`\n\n This optimizer class is `tf.distribute.Strategy` aware, which means it\n automatically sums gradients across all replicas. To average gradients,\n you divide your loss by the global batch size, which is done\n automatically if you use `tf.keras` built-in training or evaluation loops.\n See the `reduction` argument of your loss which should be set to\n `tf.keras.losses.Reduction.SUM_OVER_BATCH_SIZE` for averaging or\n `tf.keras.losses.Reduction.SUM` for not.\n\n To aggregate gradients yourself, call `apply_gradients` with\n `experimental_aggregate_gradients` set to False. This is useful if you need to\n process aggregated gradients.\n\n If you are not using these and you want to average gradients, you should use\n `tf.math.reduce_sum` to add up your per-example losses and then divide by the\n global batch size. Note that when using `tf.distribute.Strategy`, the first\n component of a tensor's shape is the *replica-local* batch size, which is off\n by a factor equal to the number of replicas being used to compute a single\n step. As a result, using `tf.math.reduce_mean` will give the wrong answer,\n resulting in gradients that can be many times too big.\n\n ### Variable Constraints\n\n All Keras optimizers respect variable constraints. If constraint function is\n passed to any variable, the constraint will be applied to the variable after\n the gradient has been applied to the variable.\n Important: If gradient is sparse tensor, variable constraint is not supported.\n\n ### Thread Compatibility\n\n The entire optimizer is currently thread compatible, not thread-safe. The user\n needs to perform synchronization if necessary.\n\n ### Slots\n\n Many optimizer subclasses, such as `Adam` and `Adagrad` allocate and manage\n additional variables associated with the variables to train. These are called\n <i>Slots</i>. Slots have names and you can ask the optimizer for the names of\n the slots that it uses. Once you have a slot name you can ask the optimizer\n for the variable it created to hold the slot value.\n\n This can be useful if you want to log debug a training algorithm, report stats\n about the slots, etc.\n\n ### Hyperparameters\n\n These are arguments passed to the optimizer subclass constructor\n (the `__init__` method), and then passed to `self._set_hyper()`.\n They can be either regular Python values (like 1.0), tensors, or\n callables. If they are callable, the callable will be called during\n `apply_gradients()` to get the value for the hyper parameter.\n\n Hyperparameters can be overwritten through user code:\n\n Example:\n\n ```python\n # Create an optimizer with the desired parameters.\n opt = tf.keras.optimizers.SGD(learning_rate=0.1)\n # `loss` is a callable that takes no argument and returns the value\n # to minimize.\n loss = lambda: 3 * var1 + 2 * var2\n # In eager mode, simply call minimize to update the list of variables.\n opt.minimize(loss, var_list=[var1, var2])\n # update learning rate\n opt.learning_rate = 0.05\n opt.minimize(loss, var_list=[var1, var2])\n ```\n\n ### Callable learning rate\n\n Optimizer accepts a callable learning rate in two ways. The first way is\n through built-in or customized\n `tf.keras.optimizers.schedules.LearningRateSchedule`. The schedule will be\n called on each iteration with `schedule(iteration)`, a `tf.Variable`\n owned by the optimizer.\n\n Example:\n\n >>> var = tf.Variable(np.random.random(size=(1,)))\n >>> learning_rate = tf.keras.optimizers.schedules.ExponentialDecay(\n ... initial_learning_rate=.01, decay_steps=20, decay_rate=.1)\n >>> opt = tf.keras.optimizers.SGD(learning_rate=learning_rate)\n >>> loss = lambda: 3 * var\n >>> opt.minimize(loss, var_list=[var])\n <tf.Variable...\n\n The second way is through a callable function that\n does not accept any arguments.\n\n Example:\n\n >>> var = tf.Variable(np.random.random(size=(1,)))\n >>> def lr_callable():\n ... return .1\n >>> opt = tf.keras.optimizers.SGD(learning_rate=lr_callable)\n >>> loss = lambda: 3 * var\n >>> opt.minimize(loss, var_list=[var])\n <tf.Variable...\n\n ### Creating a custom optimizer\n\n If you intend to create your own optimization algorithm, simply inherit from\n this class and override the following methods:\n\n - `_resource_apply_dense` (update variable given gradient tensor is a dense\n `tf.Tensor`)\n - `_resource_apply_sparse` (update variable given gradient tensor is a\n sparse `tf.IndexedSlices`. The most common way for this to happen\n is if you are taking the gradient through a `tf.gather`.)\n - `_create_slots`\n (if your optimizer algorithm requires additional variables)\n - `get_config`\n (serialization of the optimizer, include all hyper parameters)\n \"\"\"\n\n # Subclasses should set this to True unless they override `apply_gradients`\n # with a version that does not have the `experimental_aggregate_gradients`\n # argument. Older versions of Keras did not have this argument so custom\n # optimizers may have overridden `apply_gradients` without the\n # `experimental_aggregate_gradients` argument. Keras only passes\n # `experimental_aggregate_gradients` if this attribute is True.\n # Note: This attribute will likely be removed in an upcoming release.\n _HAS_AGGREGATE_GRAD = False\n\n def __init__(self,\n name,\n gradient_aggregator=None,\n gradient_transformers=None,\n **kwargs):\n \"\"\"Create a new Optimizer.\n\n This must be called by the constructors of subclasses.\n Note that Optimizer instances should not bind to a single graph,\n and so shouldn't keep Tensors as member variables. Generally\n you should be able to use the _set_hyper()/state.get_hyper()\n facility instead.\n\n This class is stateful and thread-compatible.\n\n Example of custom gradient transformations:\n\n ```python\n def my_gradient_transformer(grads_and_vars):\n # Simple example, double the gradients.\n return [(2. * g, v) for g, v in grads_and_vars]\n\n optimizer = tf.keras.optimizers.SGD(\n 1e-3, gradient_transformers=[my_gradient_transformer])\n ```\n\n Args:\n name: String. The name to use for momentum accumulator weights created\n by the optimizer.\n gradient_aggregator: The function to use to aggregate gradients across\n devices (when using `tf.distribute.Strategy`). If `None`, defaults to\n summing the gradients across devices. The function should accept and\n return a list of `(gradient, variable)` tuples.\n gradient_transformers: Optional. List of functions to use to transform\n gradients before applying updates to Variables. The functions are\n applied after `gradient_aggregator`. The functions should accept and\n return a list of `(gradient, variable)` tuples.\n **kwargs: keyword arguments. Allowed arguments are `clipvalue`,\n `clipnorm`, `global_clipnorm`.\n If `clipvalue` (float) is set, the gradient of each weight\n is clipped to be no higher than this value.\n If `clipnorm` (float) is set, the gradient of each weight\n is individually clipped so that its norm is no higher than this value.\n If `global_clipnorm` (float) is set the gradient of all weights is\n clipped so that their global norm is no higher than this value.\n\n Raises:\n ValueError: in case of any invalid argument.\n \"\"\"\n # Instrument optimizer usages\n keras_optimizers_gauge.get_cell(self.__class__.__name__).set(True)\n\n allowed_kwargs = {\"clipnorm\", \"clipvalue\", \"lr\", \"decay\", \"global_clipnorm\"}\n for k in kwargs:\n if k not in allowed_kwargs:\n raise TypeError(\"Unexpected keyword argument \"\n \"passed to optimizer: \" + str(k))\n # checks that all keyword arguments are non-negative.\n if kwargs[k] is not None and kwargs[k] < 0:\n raise ValueError(\"Expected {} >= 0, received: {}\".format(k, kwargs[k]))\n if k == \"lr\":\n warnings.warn(\n \"The `lr` argument is deprecated, use `learning_rate` instead.\")\n\n self._use_locking = True\n self._init_set_name(name)\n self._hyper = {}\n # dict: {variable name : {slot name : variable}}\n self._slots = {}\n self._slot_names = []\n self._weights = []\n self._iterations = None\n\n # For implementing Trackable. Stores information about how to restore\n # slot variables which have not yet been created\n # (trackable._CheckpointPosition objects).\n # {slot_name :\n # {_var_key(variable_to_train): [checkpoint_position, ... ], ... },\n # ... }\n self._deferred_slot_restorations = {}\n\n decay = kwargs.pop(\"decay\", 0.0)\n if decay < 0.:\n raise ValueError(\"decay cannot be less than 0: {}\".format(decay))\n self._initial_decay = decay\n\n self._hypers_created = False\n # Store the distribution strategy object if the optimizer is created inside\n # strategy scope, so it could be used to create variables later.\n if tf.distribute.has_strategy():\n self._distribution_strategy = tf.distribute.get_strategy()\n else:\n self._distribution_strategy = None\n\n # Configure gradient transformations.\n if gradient_aggregator is None:\n gradient_aggregator = optimizer_utils.all_reduce_sum_gradients\n self.gradient_aggregator = gradient_aggregator\n if gradient_transformers is None:\n gradient_transformers = []\n self.gradient_transformers = gradient_transformers\n self.clipnorm = kwargs.pop(\"clipnorm\", None)\n self.global_clipnorm = kwargs.pop(\"global_clipnorm\", None)\n if self.clipnorm is not None and self.global_clipnorm is not None:\n raise ValueError(\"Cannot accept both `clipnorm` and `global_clipnorm`, \"\n \"passed `clipnorm` {}, `global_clipnorm` {}\".format(\n self.clipnorm, self.global_clipnorm))\n self.clipvalue = kwargs.pop(\"clipvalue\", None)\n\n @property\n def clipnorm(self):\n \"\"\"`float` or `None`. If set, clips gradients to a maximum norm.\"\"\"\n return self._clipnorm\n\n @property\n def global_clipnorm(self):\n \"\"\"`float` or `None`. If set, clips gradients to a maximum norm.\"\"\"\n return self._global_clipnorm\n\n @clipnorm.setter\n def clipnorm(self, val):\n if val is not None and self.gradient_transformers:\n raise ValueError(\"`clipnorm` cannot be set when `gradient_transformers` \"\n \"is set. Instead, use the `gradient_transformers` to \"\n \"specify clipping and other transformations.\")\n self._clipnorm = val\n self._clipnorm_fn = optimizer_utils.make_gradient_clipnorm_fn(\n self._clipnorm)\n\n @global_clipnorm.setter\n def global_clipnorm(self, val):\n if val is not None and self.gradient_transformers:\n raise ValueError(\"`clipnorm` cannot be set when `gradient_transformers` \"\n \"is set. Instead, use the `gradient_transformers` to \"\n \"specify clipping and other transformations.\")\n self._global_clipnorm = val\n self._global_clipnorm_fn = optimizer_utils.make_global_gradient_clipnorm_fn(\n self._global_clipnorm)\n\n @property\n def clipvalue(self):\n \"\"\"`float` or `None`. If set, clips gradients to a maximum value.\"\"\"\n return self._clipvalue\n\n @clipvalue.setter\n def clipvalue(self, val):\n if val is not None and self.gradient_transformers:\n raise ValueError(\"`clipvalue` cannot be set when `gradient_transformers` \"\n \"is set. Instead, use the `gradient_transformers` to \"\n \"specify clipping and other transformations.\")\n self._clipvalue = val\n self._clipvalue_fn = optimizer_utils.make_gradient_clipvalue_fn(\n self._clipvalue)\n\n def _transform_loss(self, loss):\n \"\"\"Called in `.minimize` to transform loss before computing gradients.\"\"\"\n return loss\n\n def _get_gradients(self, tape, loss, var_list, grad_loss=None):\n \"\"\"Called in `minimize` to compute gradients from loss.\"\"\"\n grads = tape.gradient(loss, var_list, grad_loss)\n return list(zip(grads, var_list))\n\n def _transform_unaggregated_gradients(self, grads_and_vars):\n \"\"\"Called in `apply_gradients` before gradient aggregation.\"\"\"\n return grads_and_vars\n\n def _aggregate_gradients(self, grads_and_vars):\n \"\"\"Called in `apply_gradients` to aggregate gradients across devices.\n\n Note that user subclasses may override this, so the interface should not be\n changed.\n\n Args:\n grads_and_vars: List of (gradient, variable) pairs.\n\n Returns:\n A list of (aggregrated_gradient, variable) pairs. By default, this calls\n `self.gradient_aggregator`.\n \"\"\"\n return self.gradient_aggregator(grads_and_vars)\n\n def _transform_gradients(self, grads_and_vars):\n \"\"\"Called in `apply_gradients` after aggregation.\"\"\"\n if self._clipvalue is not None:\n grads_and_vars = self._clipvalue_fn(grads_and_vars)\n if self._clipnorm is not None:\n grads_and_vars = self._clipnorm_fn(grads_and_vars)\n if self._global_clipnorm is not None:\n grads_and_vars = self._global_clipnorm_fn(grads_and_vars)\n\n for fn in self.gradient_transformers:\n grads_and_vars = fn(grads_and_vars)\n return grads_and_vars\n\n def minimize(self, loss, var_list, grad_loss=None, name=None, tape=None):\n \"\"\"Minimize `loss` by updating `var_list`.\n\n This method simply computes gradient using `tf.GradientTape` and calls\n `apply_gradients()`. If you want to process the gradient before applying\n then call `tf.GradientTape` and `apply_gradients()` explicitly instead\n of using this function.\n\n Args:\n loss: `Tensor` or callable. If a callable, `loss` should take no arguments\n and return the value to minimize. If a `Tensor`, the `tape` argument\n must be passed.\n var_list: list or tuple of `Variable` objects to update to minimize\n `loss`, or a callable returning the list or tuple of `Variable` objects.\n Use callable when the variable list would otherwise be incomplete before\n `minimize` since the variables are created at the first time `loss` is\n called.\n grad_loss: (Optional). A `Tensor` holding the gradient computed for\n `loss`.\n name: (Optional) str. Name for the returned operation.\n tape: (Optional) `tf.GradientTape`. If `loss` is provided as a `Tensor`,\n the tape that computed the `loss` must be provided.\n\n Returns:\n An `Operation` that updates the variables in `var_list`. The `iterations`\n will be automatically increased by 1.\n\n Raises:\n ValueError: If some of the variables are not `Variable` objects.\n\n \"\"\"\n grads_and_vars = self._compute_gradients(\n loss, var_list=var_list, grad_loss=grad_loss, tape=tape)\n return self.apply_gradients(grads_and_vars, name=name)\n\n def _compute_gradients(self, loss, var_list, grad_loss=None, tape=None):\n \"\"\"Compute gradients of `loss` for the variables in `var_list`.\n\n This is the first part of `minimize()`. It returns a list\n of (gradient, variable) pairs where \"gradient\" is the gradient\n for \"variable\". Note that \"gradient\" can be a `Tensor`, an\n `IndexedSlices`, or `None` if there is no gradient for the\n given variable.\n\n Args:\n loss: `Tensor` or callable. If a callable, `loss` should take no\n arguments and return the value to minimize. If a `Tensor`, the `tape`\n argument must be passed.\n var_list: list or tuple of `Variable` objects to update to minimize\n `loss`, or a callable returning the list or tuple of `Variable` objects.\n Use callable when the variable list would otherwise be incomplete before\n `minimize` and the variables are created at the first time when `loss`\n is called.\n grad_loss: Optional. A `Tensor` holding the gradient computed for `loss`.\n tape: (Optional) `tf.GradientTape`. If `loss` is provided as a `Tensor`,\n the tape that computed the `loss` must be provided.\n\n Returns:\n A list of (gradient, variable) pairs. Variable is always present, but\n gradient can be `None`.\n\n Raises:\n TypeError: If `var_list` contains anything else than `Variable` objects.\n ValueError: If some arguments are invalid, or var_list is None.\n \"\"\"\n # TODO(joshl): Test that we handle weight decay in a reasonable way.\n if not callable(loss) and tape is None:\n raise ValueError(\"`tape` is required when a `Tensor` loss is passed.\")\n tape = tape if tape is not None else tf.GradientTape()\n\n if callable(loss):\n with tape:\n if not callable(var_list):\n tape.watch(var_list)\n loss = loss()\n if callable(var_list):\n var_list = var_list()\n\n with tape:\n loss = self._transform_loss(loss)\n\n var_list = tf.nest.flatten(var_list)\n with tf.name_scope(self._name + \"/gradients\"):\n grads_and_vars = self._get_gradients(tape, loss, var_list, grad_loss)\n\n self._assert_valid_dtypes([\n v for g, v in grads_and_vars\n if g is not None and v.dtype != tf.resource\n ])\n\n return grads_and_vars\n\n def apply_gradients(self,\n grads_and_vars,\n name=None,\n experimental_aggregate_gradients=True):\n \"\"\"Apply gradients to variables.\n\n This is the second part of `minimize()`. It returns an `Operation` that\n applies gradients.\n\n The method sums gradients from all replicas in the presence of\n `tf.distribute.Strategy` by default. You can aggregate gradients yourself by\n passing `experimental_aggregate_gradients=False`.\n\n Example:\n\n ```python\n grads = tape.gradient(loss, vars)\n grads = tf.distribute.get_replica_context().all_reduce('sum', grads)\n # Processing aggregated gradients.\n optimizer.apply_gradients(zip(grads, vars),\n experimental_aggregate_gradients=False)\n\n ```\n\n Args:\n grads_and_vars: List of (gradient, variable) pairs.\n name: Optional name for the returned operation. Default to the name passed\n to the `Optimizer` constructor.\n experimental_aggregate_gradients: Whether to sum gradients from different\n replicas in the presense of `tf.distribute.Strategy`. If False, it's\n user responsibility to aggregate the gradients. Default to True.\n\n Returns:\n An `Operation` that applies the specified gradients. The `iterations`\n will be automatically increased by 1.\n\n Raises:\n TypeError: If `grads_and_vars` is malformed.\n ValueError: If none of the variables have gradients.\n RuntimeError: If called in a cross-replica context.\n \"\"\"\n grads_and_vars = optimizer_utils.filter_empty_gradients(grads_and_vars)\n var_list = [v for (_, v) in grads_and_vars]\n\n with tf.name_scope(self._name):\n # Create iteration if necessary.\n with tf.init_scope():\n self._create_all_weights(var_list)\n\n if not grads_and_vars:\n # Distribution strategy does not support reducing an empty list of\n # gradients\n return tf.no_op()\n\n if tf.distribute.in_cross_replica_context():\n raise RuntimeError(\n \"`apply_gradients() cannot be called in cross-replica context. \"\n \"Use `tf.distribute.Strategy.run` to enter replica \"\n \"context.\")\n\n strategy = tf.distribute.get_strategy()\n if (not experimental_aggregate_gradients and strategy and\n isinstance(strategy,\n (tf.compat.v1.distribute.experimental.ParameterServerStrategy,\n tf.distribute.experimental.ParameterServerStrategy,\n tf.distribute.experimental.CentralStorageStrategy,\n tf.compat.v1.distribute.experimental.CentralStorageStrategy))):\n raise NotImplementedError(\n \"`experimental_aggregate_gradients=False is not supported for \"\n \"ParameterServerStrategy and CentralStorageStrategy\")\n\n apply_state = self._prepare(var_list)\n if experimental_aggregate_gradients:\n grads_and_vars = self._transform_unaggregated_gradients(grads_and_vars)\n grads_and_vars = self._aggregate_gradients(grads_and_vars)\n grads_and_vars = self._transform_gradients(grads_and_vars)\n\n if optimizer_utils.strategy_supports_no_merge_call():\n return self._distributed_apply(strategy, grads_and_vars, name,\n apply_state)\n else:\n return tf.distribute.get_replica_context().merge_call(\n functools.partial(self._distributed_apply, apply_state=apply_state),\n args=(grads_and_vars,),\n kwargs={\n \"name\": name,\n })\n\n def _distributed_apply(self, distribution, grads_and_vars, name, apply_state):\n \"\"\"`apply_gradients` using a `DistributionStrategy`.\"\"\"\n\n def apply_grad_to_update_var(var, grad):\n \"\"\"Apply gradient to variable.\"\"\"\n if isinstance(var, tf.Tensor):\n raise NotImplementedError(\"Trying to update a Tensor \", var)\n\n apply_kwargs = {}\n if isinstance(grad, tf.IndexedSlices):\n if var.constraint is not None:\n raise RuntimeError(\n \"Cannot use a constraint function on a sparse variable.\")\n if \"apply_state\" in self._sparse_apply_args:\n apply_kwargs[\"apply_state\"] = apply_state\n return self._resource_apply_sparse_duplicate_indices(\n grad.values, var, grad.indices, **apply_kwargs)\n\n if \"apply_state\" in self._dense_apply_args:\n apply_kwargs[\"apply_state\"] = apply_state\n update_op = self._resource_apply_dense(grad, var, **apply_kwargs)\n if var.constraint is not None:\n with tf.control_dependencies([update_op]):\n return var.assign(var.constraint(var))\n else:\n return update_op\n\n eagerly_outside_functions = tf.compat.v1.executing_eagerly_outside_functions()\n update_ops = []\n with name_scope_only_in_function_or_graph(name or self._name):\n for grad, var in grads_and_vars:\n # Colocate the update with variables to avoid unnecessary communication\n # delays. See b/136304694.\n with distribution.extended.colocate_vars_with(var):\n with name_scope_only_in_function_or_graph(\n \"update\" if eagerly_outside_functions else \"update_\" +\n var.op.name):\n update_op = distribution.extended.update(\n var, apply_grad_to_update_var, args=(grad,), group=False)\n if tf.distribute.in_cross_replica_context():\n # In cross-replica context, extended.update returns a list of\n # update ops from all replicas (group=False).\n update_ops.extend(update_op)\n else:\n # In replica context, extended.update return the single update op\n # of current replica.\n update_ops.append(update_op)\n\n any_symbolic = any(isinstance(i, tf.Operation) or\n tf_utils.is_symbolic_tensor(i) for i in update_ops)\n if not tf.executing_eagerly() or any_symbolic:\n # If the current context is graph mode or any of the update ops are\n # symbolic then the step update should be carried out under a graph\n # context. (eager updates execute immediately)\n with backend._current_graph(update_ops).as_default(): # pylint: disable=protected-access\n with tf.control_dependencies([tf.group(update_ops)]):\n return self.iterations.assign_add(1, read_value=False)\n\n return self.iterations.assign_add(1)\n\n def get_gradients(self, loss, params):\n \"\"\"Returns gradients of `loss` with respect to `params`.\n\n Should be used only in legacy v1 graph mode.\n\n Args:\n loss: Loss tensor.\n params: List of variables.\n\n Returns:\n List of gradient tensors.\n\n Raises:\n ValueError: In case any gradient cannot be computed (e.g. if gradient\n function not implemented).\n \"\"\"\n params = tf.nest.flatten(params)\n with backend.get_graph().as_default(), backend.name_scope(self._name +\n \"/gradients\"):\n grads = tf.compat.v1.gradients(loss, params)\n for grad, param in zip(grads, params):\n if grad is None:\n raise ValueError(\"Variable {} has `None` for gradient. \"\n \"Please make sure that all of your ops have a \"\n \"gradient defined (i.e. are differentiable). \"\n \"Common ops without gradient: \"\n \"K.argmax, K.round, K.eval.\".format(param))\n return grads\n\n def get_updates(self, loss, params):\n grads = self.get_gradients(loss, params)\n grads_and_vars = list(zip(grads, params))\n self._assert_valid_dtypes([\n v for g, v in grads_and_vars\n if g is not None and v.dtype != tf.resource\n ])\n return [self.apply_gradients(grads_and_vars)]\n\n def _set_hyper(self, name, value):\n \"\"\"set hyper `name` to value. value can be callable, tensor, numeric.\"\"\"\n if isinstance(value, tf.__internal__.tracking.Trackable):\n self._track_trackable(value, name, overwrite=True)\n if name not in self._hyper:\n self._hyper[name] = value\n else:\n prev_value = self._hyper[name]\n if (callable(prev_value)\n or isinstance(prev_value,\n (tf.Tensor, int, float,\n learning_rate_schedule.LearningRateSchedule))\n or isinstance(value, learning_rate_schedule.LearningRateSchedule)):\n self._hyper[name] = value\n else:\n backend.set_value(self._hyper[name], value)\n\n def _get_hyper(self, name, dtype=None):\n if not self._hypers_created:\n self._create_hypers()\n value = self._hyper[name]\n if isinstance(value, learning_rate_schedule.LearningRateSchedule):\n return value\n if callable(value):\n value = value()\n if dtype:\n return tf.cast(value, dtype)\n else:\n return value\n\n def _create_slots(self, var_list):\n pass\n\n def _create_all_weights(self, var_list):\n \"\"\"Creates all weights, including iterations, hyperparameters and slot vars.\n\n This will add newly created variables to `optimizer.weights`.\n\n New variables are only created when this method is called the first time, or\n when called with different variables in the var_list.\n\n Args:\n var_list: list or tuple of `Variable` objects that will be minimized\n using this optimizer.\n \"\"\"\n\n _ = self.iterations\n self._create_hypers()\n self._create_slots(var_list)\n\n def __getattribute__(self, name):\n \"\"\"Overridden to support hyperparameter access.\"\"\"\n try:\n return super(OptimizerV2, self).__getattribute__(name)\n except AttributeError as e:\n # Needed to avoid infinite recursion with __setattr__.\n if name == \"_hyper\":\n raise e\n # Backwards compatibility with Keras optimizers.\n if name == \"lr\":\n name = \"learning_rate\"\n if name in self._hyper:\n return self._get_hyper(name)\n raise e\n\n def __dir__(self):\n result = set(super(OptimizerV2, self).__dir__())\n if \"_hyper\" in result:\n result |= self._hyper.keys()\n if \"learning_rate\" in self._hyper.keys():\n result.add(\"lr\")\n return list(result)\n\n def __setattr__(self, name, value):\n \"\"\"Override setattr to support dynamic hyperparameter setting.\"\"\"\n # Backwards compatibility with Keras optimizers.\n if name == \"lr\":\n name = \"learning_rate\"\n if hasattr(self, \"_hyper\") and name in self._hyper:\n self._set_hyper(name, value)\n else:\n super(OptimizerV2, self).__setattr__(name, value)\n\n def get_slot_names(self):\n \"\"\"A list of names for this optimizer's slots.\"\"\"\n return self._slot_names\n\n def add_slot(self, var, slot_name, initializer=\"zeros\", shape=None):\n \"\"\"Add a new slot variable for `var`.\n\n A slot variable is an additional variable associated with `var` to train.\n It is allocated and managed by optimizers, e.g. `Adam`.\n\n Args:\n var: a `Variable` object.\n slot_name: name of the slot variable.\n initializer: initializer of the slot variable\n shape: (Optional) shape of the slot variable. If not set, it will default\n to the shape of `var`.\n\n Returns:\n A slot variable.\n \"\"\"\n if slot_name not in self._slot_names:\n self._slot_names.append(slot_name)\n var_key = _var_key(var)\n slot_dict = self._slots.setdefault(var_key, {})\n weight = slot_dict.get(slot_name, None)\n if weight is None:\n if isinstance(initializer, str) or callable(initializer):\n initializer = initializers.get(initializer)\n if isinstance(\n initializer,\n tf.__internal__.tracking.CheckpointInitialValueCallable) or (shape is not None):\n slot_shape = shape\n else:\n slot_shape = var.shape\n initial_value = functools.partial(\n initializer, shape=slot_shape, dtype=var.dtype)\n else:\n initial_value = initializer\n\n with self._distribution_strategy_scope():\n strategy = tf.distribute.get_strategy()\n if not strategy.extended.variable_created_in_scope(var):\n raise ValueError(\n \"Trying to create optimizer slot variable under the scope for \"\n \"tf.distribute.Strategy ({}), which is different from the scope \"\n \"used for the original variable ({}). Make sure the slot \"\n \"variables are created under the same strategy scope. This may \"\n \"happen if you're restoring from a checkpoint outside the scope\"\n .format(strategy, var))\n\n with strategy.extended.colocate_vars_with(var):\n weight = tf.Variable(\n name=\"%s/%s\" % (var._shared_name, slot_name), # pylint: disable=protected-access\n dtype=var.dtype,\n trainable=False,\n initial_value=initial_value)\n backend.track_variable(weight)\n slot_dict[slot_name] = weight\n self._restore_slot_variable(\n slot_name=slot_name, variable=var,\n slot_variable=weight)\n self._weights.append(weight)\n return weight\n\n def get_slot(self, var, slot_name):\n var_key = _var_key(var)\n slot_dict = self._slots[var_key]\n return slot_dict[slot_name]\n\n def _prepare(self, var_list):\n keys = set()\n for var in var_list:\n if isinstance(var, tf.distribute.DistributedValues):\n var_devices = var._devices # pylint: disable=protected-access\n else:\n var_devices = [var.device]\n var_dtype = var.dtype.base_dtype\n for var_device in var_devices:\n keys.add((var_device, var_dtype))\n\n apply_state = {}\n for var_device, var_dtype in keys:\n apply_state[(var_device, var_dtype)] = {}\n with tf.device(var_device):\n self._prepare_local(var_device, var_dtype, apply_state)\n\n return apply_state\n\n def _prepare_local(self, var_device, var_dtype, apply_state):\n if \"learning_rate\" in self._hyper:\n lr_t = tf.identity(self._decayed_lr(var_dtype))\n apply_state[(var_device, var_dtype)][\"lr_t\"] = lr_t\n\n def _fallback_apply_state(self, var_device, var_dtype):\n \"\"\"Compatibility for subclasses that don't pass apply_state through.\"\"\"\n apply_state = {(var_device, var_dtype): {}}\n self._prepare_local(var_device, var_dtype, apply_state)\n return apply_state[(var_device, var_dtype)]\n\n def _create_hypers(self):\n if self._hypers_created:\n return\n with self._distribution_strategy_scope():\n # Iterate hyper values deterministically.\n for name, value in sorted(self._hyper.items()):\n if isinstance(value,\n (tf.Tensor, tf.Variable)) or callable(value):\n # The check for `callable` covers the usage when `value` is a\n # `LearningRateSchedule`, in which case it does not need to create a\n # variable.\n continue\n else:\n self._hyper[name] = self.add_weight(\n name,\n shape=[],\n trainable=False,\n initializer=value,\n aggregation=tf.VariableAggregation.ONLY_FIRST_REPLICA)\n self._hypers_created = True\n\n @property\n def iterations(self):\n \"\"\"Variable. The number of training steps this Optimizer has run.\"\"\"\n if self._iterations is None:\n with self._distribution_strategy_scope():\n self._iterations = self.add_weight(\n \"iter\",\n shape=[],\n dtype=tf.int64,\n trainable=False,\n aggregation=tf.VariableAggregation.ONLY_FIRST_REPLICA)\n self._weights.append(self._iterations)\n return self._iterations\n\n @iterations.setter\n def iterations(self, variable):\n if self._iterations is not None:\n raise RuntimeError(\"Cannot set `iterations` to a new Variable after \"\n \"the Optimizer weights have been created\")\n self._iterations = variable\n self._weights.append(self._iterations)\n\n def _decayed_lr(self, var_dtype):\n \"\"\"Get decayed learning rate as a Tensor with dtype=var_dtype.\"\"\"\n lr_t = self._get_hyper(\"learning_rate\", var_dtype)\n if isinstance(lr_t, learning_rate_schedule.LearningRateSchedule):\n local_step = tf.cast(self.iterations, var_dtype)\n lr_t = tf.cast(lr_t(local_step), var_dtype)\n if self._initial_decay > 0.:\n local_step = tf.cast(self.iterations, var_dtype)\n decay_t = tf.cast(self._initial_decay, var_dtype)\n lr_t = lr_t / (1. + decay_t * local_step)\n return lr_t\n\n @abc.abstractmethod\n def get_config(self):\n \"\"\"Returns the config of the optimizer.\n\n An optimizer config is a Python dictionary (serializable)\n containing the configuration of an optimizer.\n The same optimizer can be reinstantiated later\n (without any saved state) from this configuration.\n\n Returns:\n Python dictionary.\n \"\"\"\n config = {\"name\": self._name}\n if self.clipnorm is not None:\n config[\"clipnorm\"] = self.clipnorm\n if self.clipvalue is not None:\n config[\"clipvalue\"] = self.clipvalue\n if self.global_clipnorm is not None:\n config[\"global_clipnorm\"] = self.global_clipnorm\n return config\n\n @classmethod\n def from_config(cls, config, custom_objects=None):\n \"\"\"Creates an optimizer from its config.\n\n This method is the reverse of `get_config`,\n capable of instantiating the same optimizer from the config\n dictionary.\n\n Args:\n config: A Python dictionary, typically the output of get_config.\n custom_objects: A Python dictionary mapping names to additional Python\n objects used to create this optimizer, such as a function used for a\n hyperparameter.\n\n Returns:\n An optimizer instance.\n \"\"\"\n if \"lr\" in config:\n config[\"learning_rate\"] = config.pop(\"lr\")\n if \"learning_rate\" in config:\n if isinstance(config[\"learning_rate\"], dict):\n config[\"learning_rate\"] = learning_rate_schedule.deserialize(\n config[\"learning_rate\"], custom_objects=custom_objects)\n return cls(**config)\n\n def _serialize_hyperparameter(self, hyperparameter_name):\n \"\"\"Serialize a hyperparameter that can be a float, callable, or Tensor.\"\"\"\n value = self._hyper[hyperparameter_name]\n if isinstance(value, learning_rate_schedule.LearningRateSchedule):\n return learning_rate_schedule.serialize(value)\n if callable(value):\n return value()\n if tf.is_tensor(value):\n return backend.get_value(value)\n return value\n\n def variables(self):\n \"\"\"Returns variables of this Optimizer based on the order created.\"\"\"\n return self._weights\n\n @property\n def weights(self):\n \"\"\"Returns variables of this Optimizer based on the order created.\"\"\"\n return self._weights\n\n def get_weights(self):\n \"\"\"Returns the current weights of the optimizer.\n\n The weights of an optimizer are its state (ie, variables).\n This function returns the weight values associated with this\n optimizer as a list of Numpy arrays. The first value is always the\n iterations count of the optimizer, followed by the optimizer's state\n variables in the order they were created. The returned list can in turn\n be used to load state into similarly parameterized optimizers.\n\n For example, the RMSprop optimizer for this simple model returns a list of\n three values-- the iteration count, followed by the root-mean-square value\n of the kernel and bias of the single Dense layer:\n\n >>> opt = tf.keras.optimizers.RMSprop()\n >>> m = tf.keras.models.Sequential([tf.keras.layers.Dense(10)])\n >>> m.compile(opt, loss='mse')\n >>> data = np.arange(100).reshape(5, 20)\n >>> labels = np.zeros(5)\n >>> print('Training'); results = m.fit(data, labels)\n Training ...\n >>> len(opt.get_weights())\n 3\n\n Returns:\n Weights values as a list of numpy arrays.\n \"\"\"\n params = self.weights\n return backend.batch_get_value(params)\n\n # TODO(tanzheny): Maybe share this logic with base_layer.\n def set_weights(self, weights):\n \"\"\"Set the weights of the optimizer.\n\n The weights of an optimizer are its state (ie, variables).\n This function takes the weight values associated with this\n optimizer as a list of Numpy arrays. The first value is always the\n iterations count of the optimizer, followed by the optimizer's state\n variables in the order they are created. The passed values are used to set\n the new state of the optimizer.\n\n For example, the RMSprop optimizer for this simple model takes a list of\n three values-- the iteration count, followed by the root-mean-square value\n of the kernel and bias of the single Dense layer:\n\n >>> opt = tf.keras.optimizers.RMSprop()\n >>> m = tf.keras.models.Sequential([tf.keras.layers.Dense(10)])\n >>> m.compile(opt, loss='mse')\n >>> data = np.arange(100).reshape(5, 20)\n >>> labels = np.zeros(5)\n >>> print('Training'); results = m.fit(data, labels)\n Training ...\n >>> new_weights = [np.array(10), np.ones([20, 10]), np.zeros([10])]\n >>> opt.set_weights(new_weights)\n >>> opt.iterations\n <tf.Variable 'RMSprop/iter:0' shape=() dtype=int64, numpy=10>\n\n Args:\n weights: weight values as a list of numpy arrays.\n \"\"\"\n params = self.weights\n if len(params) != len(weights):\n raise ValueError(\n \"You called `set_weights(weights)` on optimizer \" + self._name +\n \" with a weight list of length \" + str(len(weights)) +\n \", but the optimizer was expecting \" + str(len(params)) +\n \" weights. Provided weights: \" + str(weights)[:50] + \"...\")\n if not params:\n return\n weight_value_tuples = []\n param_values = backend.batch_get_value(params)\n for pv, p, w in zip(param_values, params, weights):\n if pv.shape != w.shape:\n raise ValueError(\"Optimizer weight shape \" + str(pv.shape) +\n \" not compatible with \"\n \"provided weight shape \" + str(w.shape))\n weight_value_tuples.append((p, w))\n backend.batch_set_value(weight_value_tuples)\n\n def add_weight(self,\n name,\n shape,\n dtype=None,\n initializer=\"zeros\",\n trainable=None,\n synchronization=tf.VariableSynchronization.AUTO,\n aggregation=tf.VariableAggregation.NONE):\n\n if dtype is None:\n dtype = tf.float32\n if isinstance(initializer, str) or callable(initializer):\n initializer = initializers.get(initializer)\n\n if synchronization == tf.VariableSynchronization.ON_READ:\n if trainable:\n raise ValueError(\n \"Synchronization value can be set to \"\n \"VariableSynchronization.ON_READ only for non-trainable variables. \"\n \"You have specified trainable=True and \"\n \"synchronization=VariableSynchronization.ON_READ.\")\n else:\n # Set trainable to be false when variable is to be synced on read.\n trainable = False\n elif trainable is None:\n trainable = True\n\n variable = self._add_variable_with_custom_getter(\n name=name,\n shape=shape,\n getter=base_layer_utils.make_variable,\n overwrite=True,\n initializer=initializer,\n dtype=dtype,\n trainable=trainable,\n use_resource=True,\n synchronization=synchronization,\n aggregation=aggregation)\n backend.track_variable(variable)\n\n return variable\n\n def _init_set_name(self, name, zero_based=True):\n if not name:\n self._name = backend.unique_object_name(\n generic_utils.to_snake_case(self.__class__.__name__),\n zero_based=zero_based)\n else:\n self._name = name\n\n def _assert_valid_dtypes(self, tensors):\n \"\"\"Asserts tensors are all valid types (see `_valid_dtypes`).\n\n Args:\n tensors: Tensors to check.\n\n Raises:\n ValueError: If any tensor is not a valid type.\n \"\"\"\n valid_dtypes = self._valid_dtypes()\n for t in tensors:\n dtype = t.dtype.base_dtype\n if dtype not in valid_dtypes:\n raise ValueError(\"Invalid type %r for %s, expected: %s.\" %\n (dtype, t.name, [v for v in valid_dtypes]))\n\n def _valid_dtypes(self):\n \"\"\"Valid types for loss, variables and gradients.\n\n Subclasses should override to allow other float types.\n\n Returns:\n Valid types for loss, variables and gradients.\n \"\"\"\n return _DEFAULT_VALID_DTYPES\n\n def _call_if_callable(self, param):\n \"\"\"Call the function if param is callable.\"\"\"\n return param() if callable(param) else param\n\n def _resource_apply_dense(self, grad, handle, apply_state):\n \"\"\"Add ops to apply dense gradients to the variable `handle`.\n\n Args:\n grad: a `Tensor` representing the gradient.\n handle: a `Tensor` of dtype `resource` which points to the variable to be\n updated.\n apply_state: A dict which is used across multiple apply calls.\n\n Returns:\n An `Operation` which updates the value of the variable.\n \"\"\"\n raise NotImplementedError(\"Must be implemented in subclasses.\")\n\n def _resource_apply_sparse_duplicate_indices(self, grad, handle, indices,\n **kwargs):\n \"\"\"Add ops to apply sparse gradients to `handle`, with repeated indices.\n\n Optimizers which override this method must deal with repeated indices. See\n the docstring of `_apply_sparse_duplicate_indices` for details. By default\n the correct behavior, to sum non-unique indices and their associated\n gradients, is enforced by first pre-processing `grad` and `indices` and\n passing them on to `_resource_apply_sparse`. Optimizers which deal correctly\n with duplicate indices may instead override this method to avoid the\n overhead of summing.\n\n Args:\n grad: a `Tensor` representing the gradient for the affected indices.\n handle: a `Tensor` of dtype `resource` which points to the variable to be\n updated.\n indices: a `Tensor` of integral type representing the indices for which\n the gradient is nonzero. Indices may be repeated.\n **kwargs: May optionally contain `apply_state`\n\n Returns:\n An `Operation` which updates the value of the variable.\n \"\"\"\n summed_grad, unique_indices = _deduplicate_indexed_slices(\n values=grad, indices=indices)\n return self._resource_apply_sparse(summed_grad, handle, unique_indices,\n **kwargs)\n\n def _resource_apply_sparse(self, grad, handle, indices, apply_state):\n \"\"\"Add ops to apply sparse gradients to the variable `handle`.\n\n Similar to `_apply_sparse`, the `indices` argument to this method has been\n de-duplicated. Optimizers which deal correctly with non-unique indices may\n instead override `_resource_apply_sparse_duplicate_indices` to avoid this\n overhead.\n\n Args:\n grad: a `Tensor` representing the gradient for the affected indices.\n handle: a `Tensor` of dtype `resource` which points to the variable to be\n updated.\n indices: a `Tensor` of integral type representing the indices for which\n the gradient is nonzero. Indices are unique.\n apply_state: A dict which is used across multiple apply calls.\n\n Returns:\n An `Operation` which updates the value of the variable.\n \"\"\"\n raise NotImplementedError(\"Must be implemented in subclasses.\")\n\n def _resource_scatter_add(self, x, i, v):\n with tf.control_dependencies([\n tf.raw_ops.ResourceScatterAdd(\n resource=x.handle, indices=i, updates=v)\n ]):\n return x.value()\n\n def _resource_scatter_update(self, x, i, v):\n with tf.control_dependencies(\n [tf.raw_ops.ResourceScatterUpdate(\n resource=x.handle, indices=i, updates=v)]):\n return x.value()\n\n @property\n @layer_utils.cached_per_instance\n def _dense_apply_args(self):\n return tf_inspect.getfullargspec(self._resource_apply_dense).args\n\n @property\n @layer_utils.cached_per_instance\n def _sparse_apply_args(self):\n return tf_inspect.getfullargspec(self._resource_apply_sparse).args\n\n # ---------------\n # For implementing the trackable interface\n # ---------------\n\n def _restore_slot_variable(self, slot_name, variable, slot_variable):\n \"\"\"Restore a newly created slot variable's value.\"\"\"\n variable_key = _var_key(variable)\n deferred_restorations = self._deferred_slot_restorations.get(\n slot_name, {}).pop(variable_key, [])\n # Iterate over restores, highest restore UID first to minimize the number\n # of assignments.\n deferred_restorations.sort(key=lambda position: position.restore_uid,\n reverse=True)\n for checkpoint_position in deferred_restorations:\n checkpoint_position.restore(slot_variable)\n\n def _create_or_restore_slot_variable(\n self, slot_variable_position, slot_name, variable):\n \"\"\"Restore a slot variable's value, possibly creating it.\n\n Called when a variable which has an associated slot variable is created or\n restored. When executing eagerly, we create the slot variable with a\n restoring initializer.\n\n No new variables are created when graph building. Instead,\n _restore_slot_variable catches these after normal creation and adds restore\n ops to the graph. This method is nonetheless important when graph building\n for the case when a slot variable has already been created but `variable`\n has just been added to a dependency graph (causing us to realize that the\n slot variable needs to be restored).\n\n Args:\n slot_variable_position: A `trackable._CheckpointPosition` object\n indicating the slot variable `Trackable` object to be restored.\n slot_name: The name of this `Optimizer`'s slot to restore into.\n variable: The variable object this slot is being created for.\n \"\"\"\n variable_key = _var_key(variable)\n slot_dict = self._slots.get(variable_key, {})\n slot_variable = slot_dict.get(slot_name, None)\n if (slot_variable is None and tf.executing_eagerly() and\n slot_variable_position.is_simple_variable()\n # Defer slot variable creation if there is an active variable creator\n # scope. Generally we'd like to eagerly create/restore slot variables\n # when possible, but this may mean that scopes intended to catch\n # `variable` also catch its eagerly created slot variable\n # unintentionally (specifically make_template would add a dependency on\n # a slot variable if not for this case). Deferring is mostly harmless\n # (aside from double initialization), and makes variable creator scopes\n # behave the same way they do when graph building.\n #\n # One notable case is with distribution strategy, which uses variable\n # creator scope but always desires the `variable` and the slot to use\n # the same scope, thus we can safely eagerly create/restore slot\n # variables.\n and (not tf.compat.v1.get_default_graph()._variable_creator_stack or # pylint: disable=protected-access\n self._distribution_strategy)):\n initializer = tf.__internal__.tracking.CheckpointInitialValueCallable(\n checkpoint_position=slot_variable_position)\n slot_variable = self.add_slot(\n var=variable,\n initializer=initializer,\n slot_name=slot_name,\n shape=slot_variable_position.value_shape())\n # Slot variables are not owned by any one object (because we don't want to\n # save the slot variable if the optimizer is saved without the non-slot\n # variable, or if the non-slot variable is saved without the optimizer;\n # it's a dependency hypergraph with edges of the form (optimizer, non-slot\n # variable, variable)). So we don't _track_ slot variables anywhere, and\n # instead special-case this dependency and otherwise pretend it's a normal\n # graph.\n if slot_variable is not None:\n # If we've either made this slot variable, or if we've pulled out an\n # existing slot variable, we should restore it.\n slot_variable_position.restore(slot_variable)\n else:\n # We didn't make the slot variable. Defer restoring until it gets created\n # normally. We keep a list rather than the one with the highest restore\n # UID in case slot variables have their own dependencies, in which case\n # those could differ between restores.\n self._deferred_slot_restorations.setdefault(\n slot_name, {}).setdefault(variable_key, []).append(\n slot_variable_position)\n\n @contextlib.contextmanager\n def _distribution_strategy_scope(self):\n \"\"\"Returns the `tf.distribute.Strategy` this optimizer was created under.\"\"\"\n if self._distribution_strategy and not tf.distribute.has_strategy():\n with self._distribution_strategy.scope():\n yield self._distribution_strategy.scope()\n else:\n yield\n\n\ndef _var_key(var):\n \"\"\"Key for representing a primary variable, for looking up slots.\n\n In graph mode the name is derived from the var shared name.\n In eager mode the name is derived from the var unique id.\n If distribution strategy exists, get the primary variable first.\n\n Args:\n var: the variable.\n\n Returns:\n the unique name of the variable.\n \"\"\"\n\n # pylint: disable=protected-access\n # Get the distributed variable if it exists.\n if hasattr(var, \"_distributed_container\"):\n var = var._distributed_container()\n if var._in_graph_mode:\n return var._shared_name\n return var._unique_id\n\n\ndef _get_slot_key_from_var(var, slot_name):\n \"\"\"Get the slot key for the variable: var_name/slot_name.\"\"\"\n\n name = _var_key(var)\n return name + \"/\" + slot_name\n\n\nclass RestoredOptimizer(OptimizerV2):\n \"\"\"A non-functional Optimizer implementation for checkpoint compatibility.\n\n Holds slot variables and hyperparameters when an optimizer is restored from a\n SavedModel. These variables may be referenced in functions along with ops\n created by the original optimizer, but currently we do not support using the\n optimizer object iself (e.g. through `apply_gradients`).\n \"\"\"\n # TODO(allenl): Make the restored optimizer functional by tracing its apply\n # methods.\n\n def __init__(self):\n super(RestoredOptimizer, self).__init__(\"RestoredOptimizer\")\n self._hypers_created = True\n\n def get_config(self):\n # TODO(allenl): Save and restore the Optimizer's config\n raise NotImplementedError(\n \"Restoring functional Optimizers from SavedModels is not currently \"\n \"supported. Please file a feature request if this limitation bothers \"\n \"you.\")\n\ntf.__internal__.saved_model.load.register_revived_type(\n \"optimizer\",\n lambda obj: isinstance(obj, OptimizerV2),\n versions=[tf.__internal__.saved_model.load.VersionedTypeRegistration(\n object_factory=lambda proto: RestoredOptimizer(),\n version=2,\n min_producer_version=1,\n min_consumer_version=1,\n setter=RestoredOptimizer._set_hyper # pylint: disable=protected-access\n )])\n", "# Lint as: python3\n# Copyright 2020 The TensorFlow Authors. All Rights Reserved.\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n# ==============================================================================\n\"\"\"Python module for evaluation loop.\"\"\"\n\nimport tensorflow.compat.v2 as tf\nfrom tensorflow.python.platform import tf_logging as logging\nfrom tensorflow.python.util.tf_export import keras_export # pylint: disable=g-direct-tensorflow-import\n\n_PRINT_EVAL_STEP_EVERY_SEC = 60.0\n_ITERATIONS_UNINITIALIZED = -1\n\n\ndef list_checkpoint_attributes(ckpt_dir_or_file):\n \"\"\"Lists all the attributes in a checkpoint.\n\n Checkpoint keys are paths in a checkpoint graph, and attribute is the first\n element in the path. e.g. with a checkpoint key\n \"optimizer/iter/.ATTRIBUTES/VARIABLE_VALUE\", optimizer is the attribute. The\n attribute is also used to save/restore a variable in a checkpoint,\n e.g. tf.train.Checkpoint(optimizer=optimizer, model=model).\n\n Args:\n ckpt_dir_or_file: Directory with checkpoints file or path to checkpoint.\n\n Returns:\n Set of attributes in a checkpoint.\n \"\"\"\n reader = tf.train.load_checkpoint(ckpt_dir_or_file)\n variable_map = reader.get_variable_to_shape_map()\n return {name.split('/')[0] for name in variable_map.keys()}\n\n\n@keras_export('keras.experimental.SidecarEvaluator', v1=[])\nclass SidecarEvaluator(object):\n \"\"\"A class designed for a dedicated evaluator task.\n\n `SidecarEvaluator` is expected to be run in a process on a separate machine\n from the training cluster. It is meant for the purpose of a dedicated\n evaluator, evaluating the metric results of a training cluster which has one\n or more workers performing the training, and saving checkpoints.\n\n The `SidecarEvaluator` API is compatible with both Custom Training Loop (CTL),\n and Keras `Model.fit` to be used in the training cluster. Using the model\n (with compiled metrics) provided at `__init__`, `SidecarEvaluator` repeatedly\n performs evaluation \"epochs\" when it finds a checkpoint that has not yet been\n used. Depending on the `steps` argument, an eval epoch is evaluation over all\n eval data, or up to certain number of steps (batches). See examples below for\n how the training program should save the checkpoints in order to be recognized\n by `SidecarEvaluator`.\n\n Since under the hood, `SidecarEvaluator` uses `model.evaluate` for evaluation,\n it also supports arbitrary Keras callbacks. That is, if one or more callbacks\n are provided, their `on_test_batch_begin` and `on_test_batch_end` methods are\n called at the start and end of a batch, and their `on_test_begin` and\n `on_test_end` are called at the start and end of an evaluation epoch. Note\n that `SidecarEvaluator` may skip some checkpoints because it always picks up\n the latest checkpoint available, and during an evaluation epoch, multiple\n checkpoints can be produced from the training side.\n\n Example:\n ```python\n model = tf.keras.models.Sequential(...)\n model.compile(metrics=tf.keras.metrics.SparseCategoricalAccuracy(\n name=\"eval_metrics\"))\n data = tf.data.Dataset.from_tensor_slices(...)\n\n tf.keras.experimental.SidecarEvaluator(\n model=model,\n data=data,\n checkpoint_dir='/tmp/checkpoint_dir', # dir for training-saved checkpoint\n steps=None, # Eval until dataset is exhausted\n max_evaluations=None, # The evaluation needs to be stopped manually\n callbacks=[tf.keras.callbacks.TensorBoard(log_dir='/tmp/log_dir')]\n ).start()\n ```\n\n `SidecarEvaluator.start` writes a series of summary\n files which can be visualized by tensorboard (which provides a webpage link):\n\n ```bash\n $ tensorboard --logdir=/tmp/log_dir/validation\n ...\n TensorBoard 2.4.0a0 at http://host:port (Press CTRL+C to quit)\n ```\n\n If the training cluster uses a CTL, the `checkpoint_dir` should contain\n checkpoints that track both `model` and `optimizer`, to fulfill\n `SidecarEvaluator`'s expectation. This can be done by a\n `tf.train.Checkpoint` and a `tf.train.CheckpointManager`:\n\n ```python\n checkpoint_dir = ... # Same `checkpoint_dir` supplied to `SidecarEvaluator`.\n checkpoint = tf.train.Checkpoint(model=model, optimizer=optimizer)\n checkpoint_manager = tf.train.CheckpointManager(\n checkpoint, checkpoint_dir=..., max_to_keep=...)\n checkpoint_manager.save()\n ```\n\n If the training cluster uses Keras `Model.fit` API, a\n `tf.keras.callbacks.ModelCheckpoint` should be used, with\n `save_weights_only=True`, and the `filepath` should have 'ckpt-{epoch}'\n appended:\n\n ```python\n checkpoint_dir = ... # Same `checkpoint_dir` supplied to `SidecarEvaluator`.\n model_checkpoint = tf.keras.callbacks.ModelCheckpoint(\n filepath=os.path.join(checkpoint_dir, 'ckpt-{epoch}'),\n save_weights_only=True)\n model.fit(dataset, epochs, callbacks=[model_checkpoint])\n ```\n \"\"\"\n\n def __init__(self,\n model,\n data,\n checkpoint_dir,\n steps=None,\n max_evaluations=None,\n callbacks=None):\n \"\"\"Initializes an `SidecarEvaluator` object.\n\n Args:\n model: Model to use for evaluation. The model object used here should be a\n `tf.keras.Model`, and should be the same as the one that is used in\n training, where `tf.keras.Model`s are checkpointed. The model should\n have one or more metrics compiled before using `SidecarEvaluator`.\n data: The input data for evaluation. `SidecarEvaluator` supports all data\n types that Keras `model.evaluate` supports as the input data `x`, such\n as a `tf.data.Dataset`.\n checkpoint_dir: Directory where checkpoint files are saved.\n steps: Number of steps to perform evaluation for, when evaluating a single\n checkpoint file. If `None`, evaluation continues until the dataset is\n exhausted. For repeated evaluation dataset, user must specify `steps` to\n avoid infinite evaluation loop.\n max_evaluations: Maximum number of the checkpoint file to be evaluated,\n for `SidecarEvaluator` to know when to stop. The evaluator will stop\n after it evaluates a checkpoint filepath ending with\n '<ckpt_name>-<max_evaluations>'. If using\n `tf.train.CheckpointManager.save` for saving checkpoints, the kth saved\n checkpoint has the filepath suffix '<ckpt_name>-<k>' (k=1 for the first\n saved), and if checkpoints are saved every epoch after training, the\n filepath saved at the kth epoch would end with '<ckpt_name>-<k>. Thus,\n if training runs for n epochs, and the evaluator should end after the\n training finishes, use n for this parameter. Note that this is not\n necessarily equal to the number of total evaluations, since some\n checkpoints may be skipped if evaluation is slower than checkpoint\n creation. If `None`, `SidecarEvaluator` will evaluate indefinitely, and\n the user must terminate evaluator program themselves.\n callbacks: List of `keras.callbacks.Callback` instances to apply during\n evaluation. See [callbacks](/api_docs/python/tf/keras/callbacks).\n \"\"\"\n self.model = model\n self.data = data\n self.checkpoint_dir = checkpoint_dir\n self._iterations = tf.Variable(\n name='iterations',\n initial_value=_ITERATIONS_UNINITIALIZED,\n dtype=tf.int64)\n self.max_evaluations = max_evaluations\n self.steps = steps\n self.callbacks = callbacks or []\n\n def start(self):\n \"\"\"Starts the evaluation loop.\"\"\"\n optimizer_checkpoint = tf.train.Checkpoint(iter=self._iterations)\n checkpoint = tf.train.Checkpoint(\n model=self.model, optimizer=optimizer_checkpoint)\n\n for latest_checkpoint in tf.train.checkpoints_iterator(self.checkpoint_dir):\n try:\n # `expect_partial` because the checkpoint can have other `Trackable`s\n # such as `optimizer`.\n checkpoint.restore(latest_checkpoint).expect_partial()\n checkpoint_attributes = list_checkpoint_attributes(latest_checkpoint)\n # The checkpoint should contain model and optimizer for SidecarEvaluator\n # to work. But the model weights saved by ModelCheckpoint callback does\n # not contain model as an attribute. To make SidecarEvaluator compatibly\n # work in this case, use model.load_weights to load the model's weights,\n # while self._iterations is still restored by checkpoint variable.\n if 'model' not in checkpoint_attributes:\n self.model.load_weights(latest_checkpoint)\n # The model checkpoint might not include optimizer in cases, e.g.\n # using a custom training loop. Directly assign the iterations\n # property to be used in callbacks.\n if self.model.optimizer:\n self.model.optimizer.iterations.assign(self._iterations)\n except (tf.errors.OpError,) as e:\n # A couple errors can happen here with the coordinator racing to write\n # checkpoint:\n # 1) OpError: open failed for <file path>: No such file or directory\n # 2) NotFoundError (subclass of OpError): Unsuccessful\n # TensorSliceReader constructor.\n # TODO(rchao): Remove this except block once b/150954027 is resolved.\n logging.info(\n 'SidecarEvaluator has an error loading '\n 'checkpoint: %s. Retrying. Error: %s: %s', latest_checkpoint,\n e.__class__.__name__, e)\n continue\n\n if self._iterations.numpy() == _ITERATIONS_UNINITIALIZED:\n raise RuntimeError(\n '`iterations` cannot be loaded from the '\n 'checkpoint file. Please ensure `iterations` is '\n 'tracked in the `checkpoint` saved by the coordinator.')\n\n logging.info(\n 'Evaluation starts: Model weights loaded from latest '\n 'checkpoint file: %s.', latest_checkpoint)\n\n self.model.evaluate(\n self.data, steps=self.steps, callbacks=self.callbacks, verbose=2)\n\n return_metrics = {}\n for metric in self.model.metrics:\n result = metric.result()\n if isinstance(result, dict):\n return_metrics.update(result)\n else:\n return_metrics[metric.name] = result\n\n logging.info(\n 'End of evaluation. Metrics: %s', ' '.join([\n '{}={}'.format(name, value.numpy())\n for name, value in return_metrics.items()\n ]))\n\n if (self.max_evaluations and\n (self.max_evaluations == int(latest_checkpoint.split('-')[-1]))):\n # Exit the loop because we have evaluated the final checkpoint file.\n logging.info('Last checkpoint evaluated. SidecarEvaluator stops.')\n return\n", "# Copyright 2019 The TensorFlow Authors. All Rights Reserved.\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n# ==============================================================================\n\"\"\"Adapter module that convert different input data objects into tf.dataset.\"\"\"\n\nimport tensorflow.compat.v2 as tf\n\nimport abc\nimport contextlib\nimport functools\nimport itertools\nimport math\nimport random\n\nimport numpy as np\nfrom tensorflow.python.eager import context\nfrom keras import backend\nfrom keras.engine import training_utils\nfrom keras.utils import data_utils\nfrom keras.utils import dataset_creator\nfrom keras.utils import tf_utils\nfrom tensorflow.python.platform import tf_logging as logging\nfrom tensorflow.python.util.tf_export import keras_export\n\ntry:\n import pandas as pd # pylint: disable=g-import-not-at-top\nexcept ImportError:\n pd = None\n\nkeras_data_adapter_gauge = tf.__internal__.monitoring.BoolGauge(\n \"/tensorflow/api/keras/data_adapters\", \"keras data adapter usage\", \"method\")\n\n\nclass DataAdapter(object, metaclass=abc.ABCMeta):\n \"\"\"Base class for input data adapter.\n\n In TF 2.0, tf.data is the preferred API for user to feed in data. In order\n to simplify the training code path, all the input data object will be\n converted to `tf.data.Dataset` if possible.\n\n Note that since this class is mainly targeted for TF 2.0, it might have a lot\n of assumptions under the hood, eg eager context by default, distribution\n strategy, etc. In the meantime, some legacy feature support might be dropped,\n eg, Iterator from dataset API in v1, etc.\n\n The sample usage of this class is like:\n\n ```\n x = tf.data.Dataset.range(100)\n adapter_cls = [NumpyArrayDataAdapter, ..., DatasetAdapter]\n applicable_adapters = [cls for cls in adapter_cls if cls.can_handle(x)]\n if len(applicable_adapters) != 1:\n raise ValueError(\"Expect only one adapter class to handle the input\")\n\n dataset = applicable_adapters[0](x).get_dataset()\n for data in dataset:\n # training\n ```\n \"\"\"\n\n @staticmethod\n def can_handle(x, y=None):\n \"\"\"Whether the current DataAdapter could handle the input x and y.\n\n Structure wise, x and y can be single object, or list of objects if there\n multiple input/output, or dictionary of objects when the intput/output are\n named.\n\n Args:\n x: input features.\n y: target labels. Note that y could be None in the case of prediction.\n\n Returns:\n boolean\n \"\"\"\n raise NotImplementedError\n\n @abc.abstractmethod\n def __init__(self, x, y=None, **kwargs):\n \"\"\"Create a DataAdapter based on data inputs.\n\n The caller must make sure to call `can_handle()` first before invoking this\n method. Provide unsupported data type will result into unexpected behavior.\n\n Args:\n x: input features.\n y: target labels. Note that y could be None in the case of prediction.\n **kwargs: Other keyword arguments for DataAdapter during the construction\n of the tf.dataset.Dataset. For example:\n - Numpy data might have `sample_weights` which will be used for\n weighting the loss function during training.\n - Numpy data might need to have `batch_size` parameter when constructing\n the dataset and iterator.\n - Certain input might need to be distribution strategy aware. When\n `distribution_strategy` is passed, the created dataset need to respect\n the strategy.\n DataAdapter might choose to ignore any keyword argument if it doesn't\n use it, or raise exception if any required argument is not provide.\n \"\"\"\n if not self.can_handle(x, y):\n raise ValueError(\"{} Cannot handle input {}, {}\".format(\n self.__class__, x, y))\n\n @abc.abstractmethod\n def get_dataset(self):\n \"\"\"Get a dataset instance for the current DataAdapter.\n\n Note that the dataset returned does not repeat for epoch, so caller might\n need to create new iterator for the same dataset at the beginning of the\n epoch. This behavior might change in future.\n\n Returns:\n An tf.dataset.Dataset. Caller might use the dataset in different\n context, eg iter(dataset) in eager to get the value directly, or in graph\n mode, provide the iterator tensor to Keras model function.\n \"\"\"\n raise NotImplementedError\n\n @abc.abstractmethod\n def get_size(self):\n \"\"\"Return the size (number of batches) for the dataset created.\n\n For certain type of the data input, the number of batches is known, eg for\n Numpy data, the size is same as (number_of_element / batch_size). Whereas\n for dataset or python generator, the size is unknown since it may or may not\n have a end state.\n\n Returns:\n int, the number of batches for the dataset, or None if it is unknown. The\n caller could use this to control the loop of training, show progress bar,\n or handle unexpected StopIteration error.\n \"\"\"\n raise NotImplementedError\n\n @abc.abstractmethod\n def batch_size(self):\n \"\"\"Return the batch size of the dataset created.\n\n For certain type of the data input, the batch size is known, and even\n required, like numpy array. Where as for dataset, the batch is unknown\n unless we take a peek.\n\n Returns:\n int, the batch size of the dataset, or None if it is unknown.\n \"\"\"\n raise NotImplementedError\n\n def representative_batch_size(self):\n \"\"\"Return a representative size for batches in the dataset.\n\n This is not guaranteed to be the batch size for all batches in the\n dataset. It just needs to be a rough approximation for batch sizes in\n the dataset.\n\n Returns:\n int, a representative size for batches found in the dataset,\n or None if it is unknown.\n \"\"\"\n return self.batch_size()\n\n @abc.abstractmethod\n def has_partial_batch(self):\n \"\"\"Whether the dataset has partial batch at the end.\"\"\"\n raise NotImplementedError\n\n @abc.abstractmethod\n def partial_batch_size(self):\n \"\"\"The size of the final partial batch for dataset.\n\n Will return None if has_partial_batch is False or batch_size is None.\n \"\"\"\n raise NotImplementedError\n\n @abc.abstractmethod\n def should_recreate_iterator(self):\n \"\"\"Returns whether a new iterator should be created every epoch.\"\"\"\n raise NotImplementedError\n\n def get_samples(self):\n \"\"\"Returns number of samples in the data, or `None`.\"\"\"\n if not self.get_size() or not self.batch_size():\n return None\n total_sample = self.get_size() * self.batch_size()\n if self.has_partial_batch():\n total_sample -= (self.batch_size() - self.partial_batch_size())\n return total_sample\n\n def on_epoch_end(self):\n \"\"\"A hook called after each epoch.\"\"\"\n pass\n\n\nclass TensorLikeDataAdapter(DataAdapter):\n \"\"\"Adapter that handles Tensor-like objects, e.g. EagerTensor and NumPy.\"\"\"\n\n @staticmethod\n def can_handle(x, y=None):\n # TODO(kaftan): Check performance implications of using a flatten\n # here for other types of inputs.\n flat_inputs = tf.nest.flatten(x)\n if y is not None:\n flat_inputs += tf.nest.flatten(y)\n\n tensor_types = _get_tensor_types()\n\n def _is_tensor(v):\n if isinstance(v, tensor_types):\n return True\n return False\n\n return all(_is_tensor(v) for v in flat_inputs)\n\n def __init__(self,\n x,\n y=None,\n sample_weights=None,\n sample_weight_modes=None,\n batch_size=None,\n epochs=1,\n steps=None,\n shuffle=False,\n **kwargs):\n super(TensorLikeDataAdapter, self).__init__(x, y, **kwargs)\n x, y, sample_weights = _process_tensorlike((x, y, sample_weights))\n sample_weight_modes = broadcast_sample_weight_modes(\n sample_weights, sample_weight_modes)\n\n # If sample_weights are not specified for an output use 1.0 as weights.\n (sample_weights, _, _) = training_utils.handle_partial_sample_weights(\n y, sample_weights, sample_weight_modes, check_all_flat=True)\n\n inputs = pack_x_y_sample_weight(x, y, sample_weights)\n\n num_samples = set(int(i.shape[0]) for i in tf.nest.flatten(inputs)).pop()\n _check_data_cardinality(inputs)\n\n # If batch_size is not passed but steps is, calculate from the input data.\n # Default to 32 for backwards compat.\n if not batch_size:\n batch_size = int(math.ceil(num_samples / steps)) if steps else 32\n\n self._size = int(math.ceil(num_samples / batch_size))\n self._batch_size = batch_size\n\n num_full_batches = int(num_samples // batch_size)\n self._partial_batch_size = num_samples % batch_size\n\n if isinstance(shuffle, str):\n shuffle = shuffle.lower()\n\n self._shuffle = shuffle\n # Vectorized version of shuffle.\n # This is a performance improvement over using `from_tensor_slices`.\n # The indices of the data are shuffled and batched, and these indices\n # are then zipped with the data and used to extract a batch of the data\n # at each step. The performance improvements here come from:\n # 1. vectorized batch using gather\n # 2. parallelized map\n # 3. pipelined permutation generation\n # 4. optimized permutation batching\n # 5. disabled static optimizations\n\n indices_dataset = tf.data.Dataset.range(1)\n if shuffle != \"batch\":\n indices_dataset = indices_dataset.repeat(epochs)\n\n def permutation(_):\n # It turns out to be more performant to make a new set of indices rather\n # than reusing the same range Tensor. (presumably because of buffer\n # forwarding.)\n indices = tf.range(num_samples, dtype=tf.int64)\n if shuffle and shuffle != \"batch\":\n indices = tf.random.shuffle(indices)\n return indices\n\n # We prefetch a single element. Computing large permutations can take quite\n # a while so we don't want to wait for prefetching over an epoch boundary to\n # trigger the next permutation. On the other hand, too many simultaneous\n # shuffles can contend on a hardware level and degrade all performance.\n indices_dataset = indices_dataset.map(permutation).prefetch(1)\n\n def slice_batch_indices(indices):\n \"\"\"Convert a Tensor of indices into a dataset of batched indices.\n\n This step can be accomplished in several ways. The most natural is to\n slice the Tensor in a Dataset map. (With a condition on the upper index to\n handle the partial batch.) However it turns out that coercing the Tensor\n into a shape which is divisible by the batch size (and handling the last\n partial batch separately) allows for a much more favorable memory access\n pattern and improved performance.\n\n Args:\n indices: Tensor which determines the data order for an entire epoch.\n\n Returns:\n A Dataset of batched indices.\n \"\"\"\n num_in_full_batch = num_full_batches * batch_size\n first_k_indices = tf.slice(indices, [0], [num_in_full_batch])\n first_k_indices = tf.reshape(\n first_k_indices, [num_full_batches, batch_size])\n\n flat_dataset = tf.data.Dataset.from_tensor_slices(first_k_indices)\n if self._partial_batch_size:\n index_remainder = tf.data.Dataset.from_tensors(tf.slice(\n indices, [num_in_full_batch], [self._partial_batch_size]))\n flat_dataset = flat_dataset.concatenate(index_remainder)\n\n if shuffle == \"batch\":\n # 1024 is a magic constant that has not been properly evaluated\n flat_dataset = flat_dataset.shuffle(1024).repeat(epochs)\n return flat_dataset\n\n indices_dataset = indices_dataset.flat_map(slice_batch_indices)\n\n dataset = self.slice_inputs(indices_dataset, inputs)\n\n if shuffle == \"batch\":\n def shuffle_batch(*batch):\n return tf.nest.map_structure(tf.random.shuffle, batch)\n dataset = dataset.map(shuffle_batch)\n\n self._dataset = dataset\n\n def slice_inputs(self, indices_dataset, inputs):\n \"\"\"Slice inputs into a Dataset of batches.\n\n Given a Dataset of batch indices and the unsliced inputs,\n this step slices the inputs in a parallelized fashion\n and produces a dataset of input batches.\n\n Args:\n indices_dataset: A Dataset of batched indices\n inputs: A python data structure that contains the inputs, targets,\n and possibly sample weights.\n\n Returns:\n A Dataset of input batches matching the batch indices.\n \"\"\"\n dataset = tf.data.Dataset.zip((\n indices_dataset,\n tf.data.Dataset.from_tensors(inputs).repeat()\n ))\n\n def grab_batch(i, data):\n return tf.nest.map_structure(lambda d: tf.gather(d, i, axis=0), data)\n\n dataset = dataset.map(\n grab_batch, num_parallel_calls=tf.data.AUTOTUNE)\n\n # Default optimizations are disabled to avoid the overhead of (unnecessary)\n # input pipeline graph serialization and deserialization\n options = tf.data.Options()\n options.experimental_optimization.apply_default_optimizations = False\n if self._shuffle:\n # See b/141490660 for more details.\n options.experimental_external_state_policy = (\n tf.data.experimental.ExternalStatePolicy.IGNORE)\n dataset = dataset.with_options(options)\n return dataset\n\n def get_dataset(self):\n return self._dataset\n\n def get_size(self):\n return self._size\n\n def batch_size(self):\n return self._batch_size\n\n def has_partial_batch(self):\n return self._partial_batch_size > 0\n\n def partial_batch_size(self):\n return self._partial_batch_size or None\n\n def should_recreate_iterator(self):\n # An infinite dataset is always created here.\n return False\n\n\nclass GenericArrayLikeDataAdapter(TensorLikeDataAdapter):\n \"\"\"Adapter that handles array-like data without forcing it into memory.\n\n This adapter handles array-like datasets that may be too big to fully\n fit into memory.\n\n Specifically, this adapter handles any Python class which implements:\n `__get_item__`, `__len__`, `shape`, and `dtype` with the same meanings\n as Numpy, but it ignores any case where all the inputs are Tensors or Numpy\n arrays (because that case is handled by the base TensorLikeDataAdapter).\n\n It ignores scipy sparse matrices and Composite Tensors because those are\n handled by the CompositeTensorDataAdapter.\n\n It also does not handle lists/tuples of scalars, because those are handled\n by the ListsOfScalarsDataAdapter.\n \"\"\"\n\n @staticmethod\n def can_handle(x, y=None):\n flat_inputs = tf.nest.flatten(x)\n if y is not None:\n flat_inputs += tf.nest.flatten(y)\n\n def _is_array_like(v):\n \"\"\"Return True if v is a Tensor, array, or is array-like.\"\"\"\n return (\n hasattr(v, \"__getitem__\") and\n hasattr(v, \"shape\") and\n hasattr(v, \"dtype\") and\n hasattr(v, \"__len__\")\n )\n\n if (not TensorLikeDataAdapter.can_handle(x, y) and\n not CompositeTensorDataAdapter.can_handle(x, y)):\n return all(_is_array_like(v) for v in flat_inputs)\n else:\n return False\n\n def __init__(self, *args, **kwargs):\n logging.warning(\n \"Keras is training/fitting/evaluating on array-like data. Keras may \"\n \"not be optimized for this format, so if your input data format is \"\n \"supported by TensorFlow I/O (https://github.com/tensorflow/io) we \"\n \"recommend using that to load a Dataset instead.\")\n\n super(GenericArrayLikeDataAdapter, self).__init__(*args, **kwargs)\n\n def slice_inputs(self, indices_dataset, inputs):\n \"\"\"Slice inputs into a Dataset of batches.\n\n Given a Dataset of batch indices and the unsliced inputs,\n this step slices the inputs in a parallelized fashion\n and produces a dataset of input batches.\n\n Args:\n indices_dataset: A Dataset of batched indices\n inputs: A python data structure that contains the inputs, targets,\n and possibly sample weights.\n\n Returns:\n A Dataset of input batches matching the batch indices.\n \"\"\"\n flat_inputs = tf.nest.flatten(inputs)\n def dynamic_shape_like(t):\n shape = list(t.shape)\n shape[0] = None\n return tuple(shape)\n\n flat_dtypes = [inp.dtype for inp in flat_inputs]\n contiguous = True\n if self._shuffle and self._shuffle != \"batch\":\n contiguous = False\n\n def grab_batch(indices):\n \"\"\"Grab a batch of data from the inputs.\"\"\"\n # This uses a py_function to avoid converting the array-like\n # into a Tensor before slicing it, because converting the array-like\n # to a Tensor may force it into memory..\n def py_method(ind):\n def slice_array(data):\n return training_utils.slice_arrays(data, ind.numpy(),\n contiguous=contiguous)\n return [slice_array(inp) for inp in flat_inputs]\n\n flat_out = tf.py_function(py_method, [indices], flat_dtypes)\n for v, original_inp in zip(flat_out, flat_inputs):\n v.set_shape(dynamic_shape_like(original_inp))\n return tf.nest.pack_sequence_as(inputs, flat_out)\n\n dataset = indices_dataset.map(\n grab_batch, num_parallel_calls=tf.data.AUTOTUNE)\n\n return dataset\n\n\nclass DatasetCreatorAdapter(DataAdapter):\n \"\"\"Adapter that handles dataset functions.\"\"\"\n\n def __init__(self, x, y, steps=None, distribution_strategy=None, **kwargs):\n super(DatasetCreatorAdapter, self).__init__(x, **kwargs)\n\n if not isinstance(x, dataset_creator.DatasetCreator):\n raise TypeError(\"The input of a `DatasetCreatorAdapter` should be a \"\n \"`DatasetCreator` but it received type {}.\".format(\n type(x)))\n if steps is None:\n raise ValueError(\"When using a \"\n \"`tf.keras.utils.experimental.DatasetCreator`, \"\n \"`steps_per_epoch`, `validation_steps` or `steps` \"\n \"argument must be provided in `Model.fit`, \"\n \"`Model.evaluate`, or `Model.predict`.\")\n self.dataset_creator = x\n self.steps = steps\n self.strategy = distribution_strategy\n\n @staticmethod\n def can_handle(x, y=None):\n if isinstance(x, dataset_creator.DatasetCreator):\n assert y is None\n return True\n\n def should_recreate_iterator(self):\n # We expect users to shuffle the dataset in their `dataset_fn` supplied to\n # `DatasetCreator`. Since that is a buffered shuffle, we intend to not reset\n # the dataset so the batches that are not shuffled can still be pulled.\n return False\n\n def get_size(self):\n return None # To be inferred by `DataHandler`.\n\n def get_dataset(self):\n return self.strategy.distribute_datasets_from_function(\n self.dataset_creator, options=self.dataset_creator.input_options)\n\n def batch_size(self):\n raise NotImplementedError()\n\n def has_partial_batch(self):\n raise NotImplementedError()\n\n def partial_batch_size(self):\n raise NotImplementedError()\n\n\nclass CompositeTensorDataAdapter(DataAdapter):\n \"\"\"Adapter that handles composite tensor.\"\"\"\n\n @staticmethod\n def can_handle(x, y=None):\n flat_inputs = tf.nest.flatten(x)\n if y is not None:\n flat_inputs += tf.nest.flatten(y)\n\n def _is_composite(v):\n # Dataset/iterator/DistributedDataset inherits from CompositeTensor but\n # should be handled by DatasetAdapter and GeneratorAdapter.\n if (tf_utils.is_extension_type(v) and\n not isinstance(v,\n (tf.data.Dataset, tf.data.Iterator)) and\n not _is_distributed_dataset(v)):\n return True\n # Support Scipy sparse tensors if scipy is installed\n return _is_scipy_sparse(v)\n\n def _is_tensor_or_composite(v):\n if isinstance(v, (tf.Tensor, np.ndarray)):\n return True\n return _is_composite(v)\n\n return (any(_is_composite(v) for v in flat_inputs) and\n all(_is_tensor_or_composite(v) for v in flat_inputs))\n\n def __init__(self,\n x,\n y=None,\n sample_weights=None,\n sample_weight_modes=None,\n batch_size=None,\n steps=None,\n shuffle=False,\n **kwargs):\n super(CompositeTensorDataAdapter, self).__init__(x, y, **kwargs)\n x, y, sample_weights = _process_tensorlike((x, y, sample_weights))\n sample_weight_modes = broadcast_sample_weight_modes(\n sample_weights, sample_weight_modes)\n\n # If sample_weights are not specified for an output use 1.0 as weights.\n (sample_weights, _, _) = training_utils.handle_partial_sample_weights(\n y, sample_weights, sample_weight_modes, check_all_flat=True)\n\n inputs = pack_x_y_sample_weight(x, y, sample_weights)\n\n dataset = tf.data.Dataset.from_tensor_slices(inputs)\n num_samples = int(tf.nest.flatten(x)[0].shape[0])\n if shuffle:\n dataset = dataset.shuffle(num_samples)\n\n # If batch_size is not passed but steps is, calculate from the input data.\n # Default to 32 for backwards compat.\n if not batch_size:\n batch_size = int(math.ceil(num_samples / steps)) if steps else 32\n\n dataset = dataset.batch(batch_size)\n self._size = int(math.ceil(num_samples / batch_size))\n self._batch_size = batch_size\n self._has_partial_batch = (self._size != (num_samples // batch_size))\n\n self._partial_batch_size = None\n if self._has_partial_batch:\n self._partial_batch_size = (\n num_samples - (self._size - 1) * self._batch_size)\n\n self._dataset = dataset\n\n def get_dataset(self):\n return self._dataset\n\n def get_size(self):\n return self._size\n\n def batch_size(self):\n return self._batch_size\n\n def has_partial_batch(self):\n return self._has_partial_batch\n\n def partial_batch_size(self):\n return self._partial_batch_size\n\n def should_recreate_iterator(self):\n return True\n\n\nclass ListsOfScalarsDataAdapter(DataAdapter):\n \"\"\"Adapter that handles lists of scalars and lists of lists of scalars.\"\"\"\n\n @staticmethod\n def can_handle(x, y=None):\n handles_x = ListsOfScalarsDataAdapter._is_list_of_scalars(x)\n handles_y = True\n if y is not None:\n handles_y = ListsOfScalarsDataAdapter._is_list_of_scalars(y)\n return handles_x and handles_y\n\n @staticmethod\n def _is_list_of_scalars(inp):\n if isinstance(inp, (float, int, str, bytes, bytearray)):\n return True\n if isinstance(inp, (list, tuple)) and inp:\n return ListsOfScalarsDataAdapter._is_list_of_scalars(inp[0])\n return False\n\n def __init__(self,\n x,\n y=None,\n sample_weights=None,\n sample_weight_modes=None,\n batch_size=None,\n shuffle=False,\n **kwargs):\n super(ListsOfScalarsDataAdapter, self).__init__(x, y, **kwargs)\n x = np.asarray(x)\n if y is not None:\n y = np.asarray(y)\n if sample_weights is not None:\n sample_weights = np.asarray(sample_weights)\n sample_weight_modes = broadcast_sample_weight_modes(\n sample_weights, sample_weight_modes)\n\n self._internal_adapter = TensorLikeDataAdapter(\n x,\n y=y,\n sample_weights=sample_weights,\n sample_weight_modes=sample_weight_modes,\n batch_size=batch_size,\n shuffle=shuffle,\n **kwargs)\n\n def get_dataset(self):\n return self._internal_adapter.get_dataset()\n\n def get_size(self):\n return self._internal_adapter.get_size()\n\n def batch_size(self):\n return self._internal_adapter.batch_size()\n\n def has_partial_batch(self):\n return self._internal_adapter.has_partial_batch()\n\n def partial_batch_size(self):\n return self._internal_adapter.partial_batch_size()\n\n def should_recreate_iterator(self):\n return True\n\n\nclass DatasetAdapter(DataAdapter):\n \"\"\"Adapter that handles `tf.data.Dataset`.\"\"\"\n\n @staticmethod\n def can_handle(x, y=None):\n return (isinstance(x, (tf.compat.v1.data.Dataset, tf.data.Dataset)) or\n _is_distributed_dataset(x))\n\n def __init__(self,\n x,\n y=None,\n sample_weights=None,\n steps=None,\n **kwargs):\n super(DatasetAdapter, self).__init__(x, y, **kwargs)\n # Note that the dataset instance is immutable, its fine to reuse the user\n # provided dataset.\n self._dataset = x\n\n # The user-provided steps.\n self._user_steps = steps\n\n self._validate_args(y, sample_weights, steps)\n\n def get_dataset(self):\n return self._dataset\n\n def get_size(self):\n return # Inferred in `DataHandler`.\n\n def batch_size(self):\n return None\n\n def has_partial_batch(self):\n return False\n\n def partial_batch_size(self):\n return None\n\n def should_recreate_iterator(self):\n # Since DistributedDatasets have no cardinality, the user must provide\n # all steps that need to be run, calling `.repeat()` as needed.\n if _is_distributed_dataset(self._dataset):\n return False\n\n # If user doesn't supply `steps`, or if they supply `steps` that\n # exactly equals the size of the `Dataset`, create a new iterator\n # each epoch.\n return (self._user_steps is None or\n tf.data.experimental.cardinality(self._dataset).numpy() == self._user_steps)\n\n def _validate_args(self, y, sample_weights, steps):\n \"\"\"Validates `__init__` arguments.\"\"\"\n # Arguments that shouldn't be passed.\n if not is_none_or_empty(y):\n raise ValueError(\"`y` argument is not supported when using \"\n \"dataset as input.\")\n if not is_none_or_empty(sample_weights):\n raise ValueError(\"`sample_weight` argument is not supported when using \"\n \"dataset as input.\")\n\n if steps is None:\n if _is_distributed_dataset(self._dataset):\n raise ValueError(\"When providing a distributed dataset, you must \"\n \"specify the number of steps to run.\")\n\n size = tf.data.experimental.cardinality(self._dataset).numpy()\n if size == tf.data.experimental.INFINITE_CARDINALITY and steps is None:\n raise ValueError(\n \"When providing an infinite dataset, you must specify \"\n \"the number of steps to run (if you did not intend to \"\n \"create an infinite dataset, make sure to not call \"\n \"`repeat()` on the dataset).\")\n\n\nclass GeneratorDataAdapter(DataAdapter):\n \"\"\"Adapter that handles python generators and iterators.\"\"\"\n\n @staticmethod\n def can_handle(x, y=None):\n return ((hasattr(x, \"__next__\") or hasattr(x, \"next\"))\n and hasattr(x, \"__iter__\")\n and not isinstance(x, data_utils.Sequence))\n\n def __init__(self,\n x,\n y=None,\n sample_weights=None,\n workers=1,\n use_multiprocessing=False,\n max_queue_size=10,\n model=None,\n **kwargs):\n # Generators should never shuffle as exhausting the generator in order to\n # shuffle the batches is inefficient.\n kwargs.pop(\"shuffle\", None)\n\n if not is_none_or_empty(y):\n raise ValueError(\"`y` argument is not supported when using \"\n \"python generator as input.\")\n if not is_none_or_empty(sample_weights):\n raise ValueError(\"`sample_weight` argument is not supported when using \"\n \"python generator as input.\")\n\n super(GeneratorDataAdapter, self).__init__(x, y, **kwargs)\n\n # Since we have to know the dtype of the python generator when we build the\n # dataset, we have to look at a batch to infer the structure.\n peek, x = self._peek_and_restore(x)\n peek = self._standardize_batch(peek)\n peek = _process_tensorlike(peek)\n\n # Need to build the Model on concrete input shapes.\n if model is not None and not model.built:\n concrete_x, _, _ = unpack_x_y_sample_weight(peek)\n model.distribute_strategy.run(\n lambda x: model(x, training=False), args=(concrete_x,))\n\n self._first_batch_size = int(tf.nest.flatten(peek)[0].shape[0])\n\n def _get_dynamic_shape(t):\n shape = t.shape\n # Unknown number of dimensions, `as_list` cannot be called.\n if shape.rank is None:\n return shape\n return tf.TensorShape([None for _ in shape.as_list()])\n\n output_shapes = tf.nest.map_structure(_get_dynamic_shape, peek)\n output_types = tf.nest.map_structure(lambda t: t.dtype, peek)\n\n # Note that dataset API takes a callable that creates a generator object,\n # rather than generator itself, which is why we define a function here.\n generator_fn = self._handle_multiprocessing(x, workers, use_multiprocessing,\n max_queue_size)\n\n def wrapped_generator():\n for data in generator_fn():\n yield self._standardize_batch(data)\n\n dataset = tf.data.Dataset.from_generator(\n wrapped_generator, output_types, output_shapes=output_shapes)\n\n if workers == 1 and not use_multiprocessing:\n dataset = dataset.prefetch(1)\n\n self._dataset = dataset\n\n def _standardize_batch(self, data):\n \"\"\"Standardizes a batch output by a generator.\"\"\"\n # Removes `None`s.\n x, y, sample_weight = unpack_x_y_sample_weight(data)\n data = pack_x_y_sample_weight(x, y, sample_weight)\n\n data = tf.__internal__.nest.list_to_tuple(data)\n\n def _convert_dtype(t):\n if (isinstance(t, np.ndarray) and issubclass(t.dtype.type, np.floating)):\n return np.array(t, dtype=backend.floatx())\n return t\n\n data = tf.nest.map_structure(_convert_dtype, data)\n return data\n\n @staticmethod\n def _peek_and_restore(x):\n peek = next(x)\n return peek, itertools.chain([peek], x)\n\n def _handle_multiprocessing(self, x, workers, use_multiprocessing,\n max_queue_size):\n \"\"\"Create a callable, possibly including an Enqueuer.\"\"\"\n if workers > 1 or (workers > 0 and use_multiprocessing):\n def generator_fn():\n enqueuer = data_utils.GeneratorEnqueuer(\n x, use_multiprocessing=use_multiprocessing)\n enqueuer.start(workers=workers, max_queue_size=max_queue_size)\n return enqueuer.get()\n else:\n generator_fn = lambda: x\n return generator_fn\n\n def get_dataset(self):\n return self._dataset\n\n def get_size(self):\n return None\n\n def batch_size(self):\n return None\n\n def representative_batch_size(self):\n return self._first_batch_size\n\n def has_partial_batch(self):\n return False\n\n def partial_batch_size(self):\n return\n\n def should_recreate_iterator(self):\n return False\n\n\nclass KerasSequenceAdapter(GeneratorDataAdapter):\n \"\"\"Adapter that handles `keras.utils.Sequence`.\"\"\"\n\n @staticmethod\n def can_handle(x, y=None):\n return isinstance(x, data_utils.Sequence)\n\n def __init__(self,\n x,\n y=None,\n sample_weights=None,\n shuffle=False,\n workers=1,\n use_multiprocessing=False,\n max_queue_size=10,\n model=None,\n **kwargs):\n if not is_none_or_empty(y):\n raise ValueError(\"`y` argument is not supported when using \"\n \"`keras.utils.Sequence` as input.\")\n if not is_none_or_empty(sample_weights):\n raise ValueError(\"`sample_weight` argument is not supported when using \"\n \"`keras.utils.Sequence` as input.\")\n\n self._size = len(x)\n self._shuffle_sequence = shuffle\n self._keras_sequence = x\n self._enqueuer = None\n super(KerasSequenceAdapter, self).__init__(\n x,\n shuffle=False, # Shuffle is handed in the _make_callable override.\n workers=workers,\n use_multiprocessing=use_multiprocessing,\n max_queue_size=max_queue_size,\n model=model,\n **kwargs)\n\n @staticmethod\n def _peek_and_restore(x):\n return x[0], x\n\n def _handle_multiprocessing(self, x, workers, use_multiprocessing,\n max_queue_size):\n if workers > 1 or (workers > 0 and use_multiprocessing):\n def generator_fn():\n self._enqueuer = data_utils.OrderedEnqueuer(\n x, use_multiprocessing=use_multiprocessing,\n shuffle=self._shuffle_sequence)\n self._enqueuer.start(workers=workers, max_queue_size=max_queue_size)\n return self._enqueuer.get()\n else:\n def generator_fn():\n order = range(len(x))\n if self._shuffle_sequence:\n # Match the shuffle convention in OrderedEnqueuer.\n order = list(order)\n random.shuffle(order)\n\n for i in order:\n yield x[i]\n\n return generator_fn\n\n def get_size(self):\n return self._size\n\n def should_recreate_iterator(self):\n return True\n\n def on_epoch_end(self):\n if self._enqueuer:\n self._enqueuer.stop()\n self._keras_sequence.on_epoch_end()\n\n\nALL_ADAPTER_CLS = [\n ListsOfScalarsDataAdapter, TensorLikeDataAdapter,\n GenericArrayLikeDataAdapter, DatasetAdapter, GeneratorDataAdapter,\n KerasSequenceAdapter, CompositeTensorDataAdapter, DatasetCreatorAdapter\n]\n\n\ndef select_data_adapter(x, y):\n \"\"\"Selects a data adapter than can handle a given x and y.\"\"\"\n adapter_cls = [cls for cls in ALL_ADAPTER_CLS if cls.can_handle(x, y)]\n if not adapter_cls:\n # TODO(scottzhu): This should be a less implementation-specific error.\n raise ValueError(\n \"Failed to find data adapter that can handle \"\n \"input: {}, {}\".format(\n _type_name(x), _type_name(y)))\n elif len(adapter_cls) > 1:\n raise RuntimeError(\n \"Data adapters should be mutually exclusive for \"\n \"handling inputs. Found multiple adapters {} to handle \"\n \"input: {}, {}\".format(\n adapter_cls, _type_name(x), _type_name(y)))\n # Instrument the data adapter usage before returning it\n keras_data_adapter_gauge.get_cell(adapter_cls[0].__name__).set(True)\n return adapter_cls[0]\n\n\ndef _type_name(x):\n \"\"\"Generates a description of the type of an object.\"\"\"\n if isinstance(x, dict):\n key_types = set(_type_name(key) for key in x.keys())\n val_types = set(_type_name(key) for key in x.values())\n return \"({} containing {} keys and {} values)\".format(\n type(x), key_types, val_types)\n if isinstance(x, (list, tuple)):\n types = set(_type_name(val) for val in x)\n return \"({} containing values of types {})\".format(\n type(x), types)\n return str(type(x))\n\n\ndef _process_tensorlike(inputs):\n \"\"\"Process tensor-like inputs.\n\n This function:\n\n (1) Converts `Numpy` arrays to `Tensor`s.\n (2) Converts `Scipy` sparse matrices to `SparseTensor`s.\n (3) Converts `pandas.Series` to `Tensor`s\n (4) Converts `list`s to `tuple`s (for `tf.data` support).\n\n Args:\n inputs: Structure of `Tensor`s, `NumPy` arrays, or tensor-like.\n\n Returns:\n Structure of `Tensor`s or tensor-like.\n \"\"\"\n\n def _convert_single_tensor(x):\n if _is_pandas_series(x):\n x = np.expand_dims(x.to_numpy(), axis=-1)\n\n if isinstance(x, np.ndarray):\n dtype = None\n if issubclass(x.dtype.type, np.floating):\n dtype = backend.floatx()\n return tf.convert_to_tensor(x, dtype=dtype)\n elif _is_scipy_sparse(x):\n return _scipy_sparse_to_sparse_tensor(x)\n return x\n\n inputs = tf.nest.map_structure(_convert_single_tensor, inputs)\n return tf.__internal__.nest.list_to_tuple(inputs)\n\n\ndef is_none_or_empty(inputs):\n # util method to check if the input is a None or a empty list.\n # the python \"not\" check will raise an error like below if the input is a\n # numpy array\n # \"The truth value of an array with more than one element is ambiguous.\n # Use a.any() or a.all()\"\n return inputs is None or not tf.nest.flatten(inputs)\n\n\ndef broadcast_sample_weight_modes(target_structure, sample_weight_modes):\n \"\"\"Match sample_weight_modes structure with output structure.\"\"\"\n if target_structure is None or not tf.nest.flatten(target_structure):\n return sample_weight_modes\n\n if isinstance(sample_weight_modes, str):\n if isinstance(target_structure, dict):\n return {key: sample_weight_modes for key in target_structure.keys()}\n return [sample_weight_modes for _ in target_structure]\n\n if sample_weight_modes:\n try:\n tf.nest.assert_same_structure(\n training_utils.list_to_tuple(target_structure),\n training_utils.list_to_tuple(sample_weight_modes))\n except (ValueError, TypeError):\n target_str = str(tf.nest.map_structure(lambda _: \"...\", target_structure))\n mode_str = str(tf.nest.map_structure(lambda _: \"...\", sample_weight_modes))\n\n # Attempt to coerce sample_weight_modes to the target structure. This\n # implicitly depends on the fact that Model flattens outputs for its\n # internal representation.\n try:\n sample_weight_modes = tf.nest.pack_sequence_as(\n target_structure, tf.nest.flatten(sample_weight_modes))\n logging.warning(\n \"sample_weight modes were coerced from\\n {}\\n to \\n {}\"\n .format(target_str, mode_str))\n except (ValueError, TypeError):\n raise ValueError(\n \"Unable to match target structure and sample_weight_modes \"\n \"structure:\\n {}\\n to \\n {}\".format(target_str, mode_str))\n\n return sample_weight_modes\n\n\nclass DataHandler(object):\n \"\"\"Handles iterating over epoch-level `tf.data.Iterator` objects.\"\"\"\n\n def __init__(self,\n x,\n y=None,\n sample_weight=None,\n batch_size=None,\n steps_per_epoch=None,\n initial_epoch=0,\n epochs=1,\n shuffle=False,\n class_weight=None,\n max_queue_size=10,\n workers=1,\n use_multiprocessing=False,\n model=None,\n steps_per_execution=None,\n distribute=True):\n \"\"\"Initializes a `DataHandler`.\n\n Arguments:\n x: See `Model.fit`.\n y: See `Model.fit`.\n sample_weight: See `Model.fit`.\n batch_size: See `Model.fit`.\n steps_per_epoch: See `Model.fit`.\n initial_epoch: See `Model.fit`.\n epochs: See `Model.fit`.\n shuffle: See `Model.fit`.\n class_weight: See `Model.fit`.\n max_queue_size: See `Model.fit`.\n workers: See `Model.fit`.\n use_multiprocessing: See `Model.fit`.\n model: The `Model` instance. Needed in order to correctly `build` the\n `Model` using generator-like inputs (see `GeneratorDataAdapter`).\n steps_per_execution: See `Model.compile`.\n distribute: Whether to distribute the `tf.dataset`.\n `PreprocessingLayer.adapt` does not support distributed datasets,\n `Model` should always set this to `True`.\n \"\"\"\n\n self._initial_epoch = initial_epoch\n self._epochs = epochs\n self._insufficient_data = False\n self._model = model\n\n # `steps_per_execution_value` is the cached initial value.\n # `steps_per_execution` is mutable and may be changed by the DataAdapter\n # to handle partial executions.\n if steps_per_execution is None:\n self._steps_per_execution = 1\n self._steps_per_execution_value = 1\n else:\n self._steps_per_execution = steps_per_execution\n self._steps_per_execution_value = steps_per_execution.numpy().item()\n\n adapter_cls = select_data_adapter(x, y)\n self._adapter = adapter_cls(\n x,\n y,\n batch_size=batch_size,\n steps=steps_per_epoch,\n epochs=epochs - initial_epoch,\n sample_weights=sample_weight,\n shuffle=shuffle,\n max_queue_size=max_queue_size,\n workers=workers,\n use_multiprocessing=use_multiprocessing,\n distribution_strategy=tf.distribute.get_strategy(),\n model=model)\n\n strategy = tf.distribute.get_strategy()\n\n self._current_step = 0\n self._step_increment = self._steps_per_execution_value - 1\n self._insufficient_data = False\n\n self._configure_dataset_and_inferred_steps(strategy, x, steps_per_epoch,\n class_weight, distribute)\n\n def _configure_dataset_and_inferred_steps(self, strategy, x, steps_per_epoch,\n class_weight, distribute):\n \"\"\"Configure the `_dataset` and `_inferred_steps` attributes.\"\"\"\n del x\n dataset = self._adapter.get_dataset()\n if class_weight:\n dataset = dataset.map(_make_class_weight_map_fn(class_weight))\n self._inferred_steps = self._infer_steps(steps_per_epoch, dataset)\n\n # `PreprocessingLayer.adapt` does not currently support distributed\n # datasets, so we pass `distribute=False` there.\n if distribute and not _is_distributed_dataset(dataset):\n dataset = strategy.experimental_distribute_dataset(dataset)\n self._dataset = dataset\n self._validate_data_handler()\n\n def enumerate_epochs(self):\n \"\"\"Yields `(epoch, tf.data.Iterator)`.\"\"\"\n with self._truncate_execution_to_epoch():\n data_iterator = iter(self._dataset)\n for epoch in range(self._initial_epoch, self._epochs):\n if self._insufficient_data: # Set by `catch_stop_iteration`.\n break\n if self._adapter.should_recreate_iterator():\n data_iterator = iter(self._dataset)\n yield epoch, data_iterator\n self._adapter.on_epoch_end()\n\n @contextlib.contextmanager\n def _truncate_execution_to_epoch(self):\n \"\"\"Truncates steps per execution to at most one epoch.\"\"\"\n should_truncate = (\n self._inferred_steps is not None and\n self._steps_per_execution_value > self._inferred_steps)\n original_value = self._steps_per_execution_value\n try:\n if should_truncate:\n self._steps_per_execution.assign(self._inferred_steps)\n self._steps_per_execution_value = self._inferred_steps\n yield\n finally:\n if should_truncate:\n self._steps_per_execution.assign(original_value)\n self._steps_per_execution_value = original_value\n\n def sync(self):\n context.async_wait()\n\n @contextlib.contextmanager\n def catch_stop_iteration(self):\n \"\"\"Catches errors when an iterator runs out of data.\"\"\"\n try:\n yield\n self.sync()\n except (StopIteration, tf.errors.OutOfRangeError):\n if self._inferred_steps is None:\n self._inferred_steps = self._current_step\n else:\n self._insufficient_data = True\n total_epochs = self._epochs - self._initial_epoch\n logging.warning(\n \"Your input ran out of data; interrupting training. \"\n \"Make sure that your dataset or generator can generate at \"\n \"least `steps_per_epoch * epochs` batches (in this case, \"\n \"{} batches). You may need to use the repeat() function \"\n \"when building your dataset.\".format(total_epochs *\n self._inferred_steps))\n\n def steps(self):\n \"\"\"Yields steps for the current epoch.\"\"\"\n self._current_step = 0\n # `self._inferred_steps` can be changed by `catch_stop_iteration`.\n while (self._inferred_steps is None or\n self._current_step < self._inferred_steps):\n if self._insufficient_data: # Set by `catch_stop_iteration`.\n break\n\n can_run_full_execution = (\n self._steps_per_execution_value == 1 or\n self._inferred_steps is None or\n self._inferred_steps - self._current_step >=\n self._steps_per_execution_value)\n\n if can_run_full_execution:\n self._step_increment = self._steps_per_execution_value - 1\n yield self._current_step\n self._current_step += self._steps_per_execution_value\n else:\n # Last partial execution.\n steps_remaining = self._inferred_steps - self._current_step\n self._steps_per_execution.assign(steps_remaining)\n self._step_increment = steps_remaining - 1\n yield self._current_step\n self._current_step += steps_remaining\n self._steps_per_execution.assign(self._steps_per_execution_value)\n\n @property\n def step_increment(self):\n \"\"\"The number to increment the step for `on_batch_end` methods.\"\"\"\n return self._step_increment\n\n @property\n def inferred_steps(self):\n \"\"\"The inferred steps per epoch of the created `Dataset`.\n\n This will be `None` in the case where:\n\n (1) A `Dataset` of unknown cardinality was passed to the `DataHandler`, and\n (2) `steps_per_epoch` was not provided, and\n (3) The first epoch of iteration has not yet completed.\n\n Returns:\n The inferred steps per epoch of the created `Dataset`.\n \"\"\"\n return self._inferred_steps\n\n @property\n def should_sync(self):\n # Catch OutOfRangeError for Datasets of unknown size.\n # This blocks until the batch has finished executing.\n # TODO(b/150292341): Allow multiple async steps here.\n return self._inferred_steps is None\n\n def _log_indefinite_training_warning(self):\n logging.warning(\"The training loop will run indefinitely since you have \"\n \"set `steps_per_epoch=-1`. Please use batch-level \"\n \"callbacks to save checkpoints or log training progress, \"\n \"etc\")\n\n def _infer_steps(self, steps, dataset):\n \"\"\"Infers steps_per_epoch needed to loop through a dataset.\"\"\"\n if steps == -1:\n self._log_indefinite_training_warning()\n return None\n\n if steps is not None:\n return steps\n\n adapter_steps = self._adapter.get_size()\n if adapter_steps is not None:\n return adapter_steps\n\n size = tf.data.experimental.cardinality(dataset)\n if size == tf.data.experimental.INFINITE_CARDINALITY and steps is None:\n raise ValueError(\n \"When passing an infinitely repeating dataset, please specify a \"\n \"`steps_per_epoch` value so that epoch level \"\n \"callbacks continue to work. The value can be arbitrary, or a number \"\n \"that you think correctly defines the size of an epoch. \"\n \"Epoch-level callbacks will then be called at this interval.\")\n if size >= 0:\n return size.numpy().item()\n return None\n\n @property\n def _samples(self):\n return self._adapter.get_samples()\n\n def _validate_data_handler(self):\n # TODO(b/152094471): Support this with DistIter.get_next_as_optional.\n if self._steps_per_execution_value > 1 and self._inferred_steps is None:\n raise ValueError(\n \"Could not infer the size of the data. With \"\n \"`steps_per_execution > 1`, you must specify the number of steps \"\n \"to run.\")\n\n\nclass _ClusterCoordinatorDataHandler(DataHandler):\n \"\"\"A `DataHandler` that is compatible with `ClusterCoordinator`.\"\"\"\n\n def __init__(self, x, y=None, **kwargs):\n if (not _is_distributed_dataset(x) and\n not isinstance(x, (dataset_creator.DatasetCreator, tf.data.Dataset))):\n x = self._convert_to_dataset_creator(x, y, **kwargs)\n\n super().__init__(x=x, **kwargs)\n\n def _convert_to_dataset_creator(self, x, y, **kwargs):\n \"\"\"Converts non-tf.data.Dataset to `DatasetCreator` instances.\"\"\"\n\n def _dataset_fn(input_context):\n del input_context\n data_adapter_cls = select_data_adapter(x, y)\n return data_adapter_cls(x=x, y=y, **kwargs).get_dataset()\n\n # This check is needed because types like `tf.data.Dataset` don't work with\n # PSS yet. So only apply this logic to the types we can support.\n if (isinstance(x, _get_tensor_types()) and\n isinstance(y, _get_tensor_types())):\n return dataset_creator.DatasetCreator(_dataset_fn)\n else:\n raise NotImplementedError(\n \"Only `tf.keras.utils.experimental.DatasetCreator`, `tf.Tensor`, \"\n \"numpy arrays and pandas dataframes are supported types at this \"\n \"time.\")\n\n def _configure_dataset_and_inferred_steps(self, strategy, x, steps_per_epoch,\n class_weight, distribute):\n if isinstance(x, dataset_creator.DatasetCreator):\n\n def per_worker_dataset_fn():\n\n return strategy.distribute_datasets_from_function(\n x, options=x.input_options)\n\n self._dataset = self._model._cluster_coordinator.create_per_worker_dataset( # pylint: disable=protected-access\n per_worker_dataset_fn)\n else:\n assert distribute\n if not _is_distributed_dataset(x):\n x = strategy.experimental_distribute_dataset(x)\n\n self._dataset = self._model._cluster_coordinator.create_per_worker_dataset( # pylint: disable=protected-access\n x)\n\n if steps_per_epoch == -1:\n self._inferred_steps = None\n self._log_indefinite_training_warning()\n else:\n self._inferred_steps = steps_per_epoch\n\n def sync(self):\n self._model._cluster_coordinator.join() # pylint: disable=protected-access\n\n\ndef get_data_handler(*args, **kwargs):\n if getattr(kwargs[\"model\"], \"_cluster_coordinator\", None):\n return _ClusterCoordinatorDataHandler(*args, **kwargs)\n return DataHandler(*args, **kwargs)\n\n\ndef _make_class_weight_map_fn(class_weight):\n \"\"\"Applies class weighting to a `Dataset`.\n\n The `Dataset` is assumed to be in format `(x, y)` or `(x, y, sw)`, where\n `y` must be a single `Tensor`.\n\n Args:\n class_weight: A map where the keys are integer class ids and values are\n the class weights, e.g. `{0: 0.2, 1: 0.6, 2: 0.3}`\n\n Returns:\n A function that can be used with `tf.data.Dataset.map` to apply class\n weighting.\n \"\"\"\n class_ids = list(sorted(class_weight.keys()))\n expected_class_ids = list(range(len(class_ids)))\n if class_ids != expected_class_ids:\n error_msg = (\n \"Expected `class_weight` to be a dict with keys from 0 to one less \"\n \"than the number of classes, found {}\").format(class_weight)\n raise ValueError(error_msg)\n\n class_weight_tensor = tf.convert_to_tensor(\n [class_weight[int(c)] for c in class_ids])\n\n def _class_weights_map_fn(*data):\n \"\"\"Convert `class_weight` to `sample_weight`.\"\"\"\n x, y, sw = unpack_x_y_sample_weight(data)\n\n if tf.nest.is_nested(y):\n raise ValueError(\n \"`class_weight` is only supported for Models with a single output.\")\n\n if y.shape.rank > 2:\n raise ValueError(\"`class_weight` not supported for \"\n \"3+ dimensional targets.\")\n\n y_classes = tf.__internal__.smart_cond.smart_cond(\n y.shape.rank == 2 and backend.shape(y)[1] > 1,\n lambda: backend.argmax(y, axis=1),\n lambda: tf.cast(backend.reshape(y, (-1,)), tf.int64))\n\n cw = tf.gather(class_weight_tensor, y_classes)\n if sw is not None:\n cw = tf.cast(cw, sw.dtype)\n sw, cw = expand_1d((sw, cw))\n # `class_weight` and `sample_weight` are multiplicative.\n sw = sw * cw\n else:\n sw = cw\n\n return x, y, sw\n\n return _class_weights_map_fn\n\n\ndef expand_1d(data):\n \"\"\"Expands 1-dimensional `Tensor`s into 2-dimensional `Tensor`s.\"\"\"\n\n def _expand_single_1d_tensor(t):\n # Leaves `CompositeTensor`s as-is.\n if (isinstance(t, tf.Tensor) and\n isinstance(t.shape, tf.TensorShape) and t.shape.rank == 1):\n return tf.expand_dims(t, axis=-1)\n return t\n\n return tf.nest.map_structure(_expand_single_1d_tensor, data)\n\n\ndef train_validation_split(arrays, validation_split):\n \"\"\"Split arrays into train and validation subsets in deterministic order.\n\n The last part of data will become validation data.\n\n Args:\n arrays: Tensors to split. Allowed inputs are arbitrarily nested structures\n of Tensors and NumPy arrays.\n validation_split: Float between 0 and 1. The proportion of the dataset to\n include in the validation split. The rest of the dataset will be included\n in the training split.\n Returns:\n `(train_arrays, validation_arrays)`\n \"\"\"\n\n def _can_split(t):\n tensor_types = _get_tensor_types()\n return isinstance(t, tensor_types) or t is None\n\n flat_arrays = tf.nest.flatten(arrays)\n unsplitable = [type(t) for t in flat_arrays if not _can_split(t)]\n if unsplitable:\n raise ValueError(\n \"`validation_split` is only supported for Tensors or NumPy \"\n \"arrays, found following types in the input: {}\".format(unsplitable))\n\n if all(t is None for t in flat_arrays):\n return arrays, arrays\n\n first_non_none = None\n for t in flat_arrays:\n if t is not None:\n first_non_none = t\n break\n\n # Assumes all arrays have the same batch shape or are `None`.\n batch_dim = int(first_non_none.shape[0])\n split_at = int(math.floor(batch_dim * (1. - validation_split)))\n\n if split_at == 0 or split_at == batch_dim:\n raise ValueError(\n \"Training data contains {batch_dim} samples, which is not sufficient \"\n \"to split it into a validation and training set as specified by \"\n \"`validation_split={validation_split}`. Either provide more data, or a \"\n \"different value for the `validation_split` argument.\" .format(\n batch_dim=batch_dim, validation_split=validation_split))\n\n def _split(t, start, end):\n if t is None:\n return t\n return t[start:end]\n\n train_arrays = tf.nest.map_structure(\n functools.partial(_split, start=0, end=split_at), arrays)\n val_arrays = tf.nest.map_structure(\n functools.partial(_split, start=split_at, end=batch_dim), arrays)\n\n return train_arrays, val_arrays\n\n\n@keras_export(\"keras.utils.unpack_x_y_sample_weight\", v1=[])\ndef unpack_x_y_sample_weight(data):\n \"\"\"Unpacks user-provided data tuple.\n\n This is a convenience utility to be used when overriding\n `Model.train_step`, `Model.test_step`, or `Model.predict_step`.\n This utility makes it easy to support data of the form `(x,)`,\n `(x, y)`, or `(x, y, sample_weight)`.\n\n Standalone usage:\n\n >>> features_batch = tf.ones((10, 5))\n >>> labels_batch = tf.zeros((10, 5))\n >>> data = (features_batch, labels_batch)\n >>> # `y` and `sample_weight` will default to `None` if not provided.\n >>> x, y, sample_weight = tf.keras.utils.unpack_x_y_sample_weight(data)\n >>> sample_weight is None\n True\n\n Example in overridden `Model.train_step`:\n\n ```python\n class MyModel(tf.keras.Model):\n\n def train_step(self, data):\n # If `sample_weight` is not provided, all samples will be weighted\n # equally.\n x, y, sample_weight = tf.keras.utils.unpack_x_y_sample_weight(data)\n\n with tf.GradientTape() as tape:\n y_pred = self(x, training=True)\n loss = self.compiled_loss(\n y, y_pred, sample_weight, regularization_losses=self.losses)\n trainable_variables = self.trainable_variables\n gradients = tape.gradient(loss, trainable_variables)\n self.optimizer.apply_gradients(zip(gradients, trainable_variables))\n\n self.compiled_metrics.update_state(y, y_pred, sample_weight)\n return {m.name: m.result() for m in self.metrics}\n ```\n\n Args:\n data: A tuple of the form `(x,)`, `(x, y)`, or `(x, y, sample_weight)`.\n\n Returns:\n The unpacked tuple, with `None`s for `y` and `sample_weight` if they are not\n provided.\n \"\"\"\n if not isinstance(data, tuple):\n return (data, None, None)\n elif len(data) == 1:\n return (data[0], None, None)\n elif len(data) == 2:\n return (data[0], data[1], None)\n elif len(data) == 3:\n return (data[0], data[1], data[2])\n else:\n error_msg = (\"Data is expected to be in format `x`, `(x,)`, `(x, y)`, \"\n \"or `(x, y, sample_weight)`, found: {}\").format(data)\n raise ValueError(error_msg)\n\n\n@keras_export(\"keras.utils.pack_x_y_sample_weight\", v1=[])\ndef pack_x_y_sample_weight(x, y=None, sample_weight=None):\n \"\"\"Packs user-provided data into a tuple.\n\n This is a convenience utility for packing data into the tuple formats\n that `Model.fit` uses.\n\n Standalone usage:\n\n >>> x = tf.ones((10, 1))\n >>> data = tf.keras.utils.pack_x_y_sample_weight(x)\n >>> isinstance(data, tf.Tensor)\n True\n >>> y = tf.ones((10, 1))\n >>> data = tf.keras.utils.pack_x_y_sample_weight(x, y)\n >>> isinstance(data, tuple)\n True\n >>> x, y = data\n\n Args:\n x: Features to pass to `Model`.\n y: Ground-truth targets to pass to `Model`.\n sample_weight: Sample weight for each element.\n\n Returns:\n Tuple in the format used in `Model.fit`.\n \"\"\"\n if y is None:\n # For single x-input, we do no tuple wrapping since in this case\n # there is no ambiguity. This also makes NumPy and Dataset\n # consistent in that the user does not have to wrap their Dataset\n # data in an unecessary tuple\n if not tf.nest.is_nested(x):\n return x\n else:\n return (x,)\n elif sample_weight is None:\n return (x, y)\n else:\n return (x, y, sample_weight)\n\n\ndef single_batch_iterator(strategy,\n x,\n y=None,\n sample_weight=None,\n class_weight=None):\n \"\"\"Creates a single-batch dataset.\"\"\"\n x, y, sample_weight = _process_tensorlike((x, y, sample_weight))\n if y is None:\n data = (x,)\n elif sample_weight is None:\n data = (x, y)\n else:\n data = (x, y, sample_weight)\n\n _check_data_cardinality(data)\n dataset = tf.data.Dataset.from_tensors(data)\n if class_weight:\n dataset = dataset.map(_make_class_weight_map_fn(class_weight))\n dataset = strategy.experimental_distribute_dataset(dataset)\n return iter(dataset)\n\n\ndef _check_data_cardinality(data):\n num_samples = set(int(i.shape[0]) for i in tf.nest.flatten(data))\n if len(num_samples) > 1:\n msg = \"Data cardinality is ambiguous:\\n\"\n for label, single_data in zip([\"x\", \"y\", \"sample_weight\"], data):\n msg += \" {} sizes: {}\\n\".format(\n label, \", \".join(str(i.shape[0]) for i in tf.nest.flatten(single_data)))\n msg += \"Make sure all arrays contain the same number of samples.\"\n raise ValueError(msg)\n\n\ndef _get_tensor_types():\n if pd is None:\n return (tf.Tensor, np.ndarray)\n else:\n return (tf.Tensor, np.ndarray, pd.Series, pd.DataFrame)\n\n\ndef _is_scipy_sparse(x):\n try:\n from scipy.sparse import issparse # pylint: disable=g-import-not-at-top\n\n return issparse(x)\n except ImportError:\n return False\n\n\ndef _is_pandas_series(x):\n if pd is None:\n return False\n else:\n return isinstance(x, pd.Series)\n\n\ndef _scipy_sparse_to_sparse_tensor(t):\n \"\"\"Converts a SciPy sparse matrix to a SparseTensor.\"\"\"\n sparse_coo = t.tocoo()\n row, col = sparse_coo.row, sparse_coo.col\n data, shape = sparse_coo.data, sparse_coo.shape\n if issubclass(data.dtype.type, np.floating):\n data = data.astype(backend.floatx())\n indices = np.concatenate(\n (np.expand_dims(row, axis=1), np.expand_dims(col, axis=1)), axis=1)\n return tf.SparseTensor(indices, data, shape)\n\n\ndef _is_distributed_dataset(ds):\n return isinstance(ds, tf.distribute.DistributedDataset)\n", "# Copyright 2019 The TensorFlow Authors. All Rights Reserved.\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n# ==============================================================================\n\"\"\"Tests for compile utitilies.\"\"\"\n\nimport tensorflow.compat.v2 as tf\nfrom keras import backend\nfrom keras import keras_parameterized\nfrom keras import losses as losses_mod\nfrom keras import metrics as metrics_mod\nfrom keras.engine import compile_utils\n\n\nclass LossesContainerTest(keras_parameterized.TestCase):\n\n def test_single_loss(self):\n loss_container = compile_utils.LossesContainer('mse')\n y_t, y_p = tf.ones((10, 5)), tf.zeros((10, 5))\n total_loss = loss_container(y_t, y_p)\n\n self.assertTrue(loss_container._built)\n self.assertLen(loss_container._losses, 1)\n self.assertEqual(total_loss.numpy(), 1.)\n self.assertLen(loss_container.metrics, 1)\n\n loss_metric = loss_container.metrics[0]\n self.assertEqual(loss_metric.name, 'loss')\n self.assertEqual(loss_metric.result().numpy(), 1.)\n\n loss_container.reset_state()\n self.assertEqual(loss_metric.result().numpy(), 0.)\n\n def test_loss_list(self):\n loss_container = compile_utils.LossesContainer(['mse', 'mae'], [1, 0.5])\n\n y_t = [tf.ones((10, 1)), tf.zeros((10, 1))]\n y_p = [tf.ones((10, 1)), tf.ones((10, 1))]\n sw = tf.convert_to_tensor([0, 0, 0, 0, 0, 1, 1, 1, 1, 1])\n\n total_loss = loss_container(y_t, y_p, sample_weight=sw)\n\n self.assertEqual(loss_container._output_names, ['output_1', 'output_2'])\n\n self.assertLen(loss_container._losses, 2)\n self.assertEqual(total_loss.numpy(), 0.25)\n\n loss_metric = loss_container.metrics[0]\n self.assertEqual(loss_metric.name, 'loss')\n self.assertEqual(loss_metric.result().numpy(), 0.25)\n\n output_1_metric = loss_container.metrics[1]\n self.assertEqual(output_1_metric.name, 'output_1_loss')\n self.assertEqual(output_1_metric.result().numpy(), 0)\n\n output_2_metric = loss_container.metrics[2]\n self.assertEqual(output_2_metric.name, 'output_2_loss')\n self.assertEqual(output_2_metric.result().numpy(), 0.5)\n\n loss_container.reset_state()\n self.assertEqual(loss_metric.result().numpy(), 0)\n self.assertEqual(output_1_metric.result().numpy(), 0)\n self.assertEqual(output_2_metric.result().numpy(), 0)\n\n def test_loss_dict(self):\n loss_container = compile_utils.LossesContainer(\n {\n 'out1': 'mse',\n 'out2': 'mae'\n }, {\n 'out1': 1,\n 'out2': 0.5\n })\n\n y_t = {'out1': tf.ones((10, 1)), 'out2': tf.zeros((10, 1))}\n y_p = {'out1': tf.ones((10, 1)), 'out2': tf.ones((10, 1))}\n sw = tf.convert_to_tensor([0, 0, 0, 0, 0, 1, 1, 1, 1, 1])\n\n total_loss = loss_container(y_t, y_p, sample_weight=sw)\n\n self.assertLen(loss_container._losses, 2)\n self.assertEqual(total_loss.numpy(), 0.25)\n self.assertLen(loss_container.metrics, 3)\n\n loss_metric = loss_container.metrics[0]\n self.assertEqual(loss_metric.name, 'loss')\n self.assertEqual(loss_metric.result().numpy(), 0.25)\n\n out1_metric = loss_container.metrics[1]\n self.assertEqual(out1_metric.name, 'out1_loss')\n self.assertEqual(out1_metric.result().numpy(), 0)\n\n out2_metric = loss_container.metrics[2]\n self.assertEqual(out2_metric.name, 'out2_loss')\n self.assertEqual(out2_metric.result().numpy(), 0.5)\n\n loss_container.reset_state()\n self.assertEqual(loss_metric.result().numpy(), 0)\n self.assertEqual(out1_metric.result().numpy(), 0)\n self.assertEqual(out2_metric.result().numpy(), 0)\n\n def test_loss_partial_dict_with_output_names(self):\n loss_container = compile_utils.LossesContainer(\n {'out2': 'mae'}, {'out2': 1.}, output_names=['out1', 'out2'])\n\n y_t = [tf.ones((10, 1)), tf.zeros((10, 1))]\n y_p = [tf.ones((10, 1)), tf.ones((10, 1))]\n sw = tf.convert_to_tensor([0, 0, 0, 0, 0, 1, 1, 1, 1, 1])\n\n total_loss = loss_container(y_t, y_p, sample_weight=sw)\n\n self.assertEqual(total_loss.numpy(), 0.5)\n self.assertLen(loss_container.metrics, 2)\n\n loss_metric = loss_container.metrics[0]\n self.assertEqual(loss_metric.name, 'loss')\n self.assertEqual(loss_metric.result().numpy(), 0.5)\n\n out2_metric = loss_container.metrics[1]\n self.assertEqual(out2_metric.name, 'out2_loss')\n self.assertEqual(out2_metric.result().numpy(), 0.5)\n\n def test_loss_dict_with_nones(self):\n loss_container = compile_utils.LossesContainer({\n 'out1': None,\n 'out2': 'mae'\n })\n\n y_t = {'out1': tf.ones((10, 1)), 'out2': tf.zeros((10, 1))}\n y_p = {'out1': tf.ones((10, 1)), 'out2': tf.ones((10, 1))}\n sw = tf.convert_to_tensor([0, 0, 0, 0, 0, 1, 1, 1, 1, 1])\n\n total_loss = loss_container(y_t, y_p, sample_weight=sw)\n\n self.assertEqual(total_loss.numpy(), 0.5)\n self.assertLen(loss_container.metrics, 2)\n\n loss_metric = loss_container.metrics[0]\n self.assertEqual(loss_metric.name, 'loss')\n self.assertEqual(loss_metric.result().numpy(), 0.5)\n\n out2_metric = loss_container.metrics[1]\n self.assertEqual(out2_metric.name, 'out2_loss')\n self.assertEqual(out2_metric.result().numpy(), 0.5)\n\n def test_nested_structure(self):\n loss_container = compile_utils.LossesContainer(\n {\n 'b': ['mse', None],\n 'a': 'mae'\n }, loss_weights={\n 'b': [0.5, 0],\n 'a': 1\n })\n\n y_t = {\n 'b': [tf.ones((10, 1)),\n tf.zeros((10, 1))],\n 'a': tf.zeros((10, 1))\n }\n y_p = {\n 'b': [tf.zeros((10, 1)),\n tf.zeros((10, 1))],\n 'a': tf.ones((10, 1))\n }\n sw = tf.convert_to_tensor([0, 0, 0, 0, 0, 1, 1, 1, 1, 1])\n\n total_loss = loss_container(y_t, y_p, sample_weight=sw)\n self.assertEqual(total_loss.numpy(), 0.75)\n self.assertLen(loss_container.metrics, 3)\n\n loss_metric = loss_container.metrics[0]\n self.assertEqual(loss_metric.name, 'loss')\n self.assertEqual(loss_metric.result().numpy(), 0.75)\n\n a_metric = loss_container.metrics[1]\n self.assertEqual(a_metric.name, 'a_loss')\n self.assertEqual(a_metric.result().numpy(), 0.5)\n\n b_1_metric = loss_container.metrics[2]\n self.assertEqual(b_1_metric.name, 'b_1_loss')\n self.assertEqual(b_1_metric.result().numpy(), 0.5)\n\n def test_broadcast_single_loss(self):\n loss_container = compile_utils.LossesContainer('mse')\n\n y_t = [tf.ones((10, 1)), tf.zeros((10, 1))]\n y_p = [tf.ones((10, 1)), tf.ones((10, 1))]\n sw = tf.convert_to_tensor([0, 0, 0, 0, 0, 1, 1, 1, 1, 1])\n\n total_loss = loss_container(y_t, y_p, sample_weight=sw)\n self.assertEqual(total_loss.numpy(), 0.5)\n self.assertLen(loss_container.metrics, 3)\n\n loss_metric = loss_container.metrics[0]\n self.assertEqual(loss_metric.name, 'loss')\n self.assertEqual(loss_metric.result().numpy(), 0.5)\n\n output_1_metric = loss_container.metrics[1]\n self.assertEqual(output_1_metric.name, 'output_1_loss')\n self.assertEqual(output_1_metric.result().numpy(), 0.)\n\n output_2_metric = loss_container.metrics[2]\n self.assertEqual(output_2_metric.name, 'output_2_loss')\n self.assertEqual(output_2_metric.result().numpy(), 0.5)\n\n def test_missing_label_with_no_loss(self):\n # It's ok to exclude a label if that label has no\n # losses or metrics associated with it.\n loss_container = compile_utils.LossesContainer({\n 'output1': 'mse',\n 'output3': 'mae'\n })\n\n y_p = {\n 'output1': tf.convert_to_tensor([[0], [1], [2]]),\n 'output2': tf.convert_to_tensor([[3], [4], [5]]),\n 'output3': tf.convert_to_tensor([[6], [7], [8]])\n }\n y_t = {\n 'output1': tf.convert_to_tensor([[1], [2], [3]]),\n 'output3': tf.convert_to_tensor([[4], [5], [6]])\n }\n\n total_loss = loss_container(y_t, y_p)\n self.assertEqual(total_loss.numpy(), 3.)\n self.assertLen(loss_container.metrics, 3)\n\n loss_metric = loss_container.metrics[0]\n self.assertEqual(loss_metric.name, 'loss')\n self.assertEqual(loss_metric.result().numpy(), 3.)\n\n output_1_metric = loss_container.metrics[1]\n self.assertEqual(output_1_metric.name, 'output1_loss')\n self.assertEqual(output_1_metric.result().numpy(), 1.)\n\n output_3_metric = loss_container.metrics[2]\n self.assertEqual(output_3_metric.name, 'output3_loss')\n self.assertEqual(output_3_metric.result().numpy(), 2.)\n\n def test_mismatched_dtypes(self):\n y_t = tf.constant([1, 9, 2, -5], shape=(2, 2))\n y_p = tf.constant([4, 8, 12, 8],\n shape=(2, 2),\n dtype=tf.float32)\n\n def my_mae(labels, preds):\n self.assertEqual(labels.dtype, tf.int32)\n self.assertEqual(preds.dtype, tf.float32)\n labels = tf.cast(labels, preds.dtype)\n return backend.mean(tf.abs(preds - labels), axis=-1)\n\n loss_container = compile_utils.LossesContainer(my_mae)\n total_loss = loss_container(y_t, y_p)\n self.assertEqual(total_loss.dtype, tf.float32)\n\n def test_integer_dtypes(self):\n y_t = tf.constant([1, 9, 2, -5], shape=(2, 2))\n y_p = tf.constant([4, 8, 12, 8], shape=(2, 2), dtype=tf.int64)\n\n def my_mae(labels, preds):\n self.assertEqual(labels.dtype, tf.int64)\n self.assertEqual(preds.dtype, tf.int64)\n return backend.mean(tf.abs(preds - labels), axis=-1)\n\n loss_container = compile_utils.LossesContainer(my_mae)\n total_loss = loss_container(y_t, y_p)\n self.assertEqual(total_loss.dtype, tf.int64)\n\n def test_float_dtypes(self):\n y_t = tf.constant([1, 9, 2, -5],\n shape=(2, 2),\n dtype=tf.float32)\n y_p = tf.constant([4, 8, 12, 8],\n shape=(2, 2),\n dtype=tf.float64)\n\n def my_mae(labels, preds):\n self.assertEqual(labels.dtype, tf.float64)\n self.assertEqual(preds.dtype, tf.float64)\n return backend.mean(tf.abs(preds - labels), axis=-1)\n\n loss_container = compile_utils.LossesContainer(my_mae)\n total_loss = loss_container(y_t, y_p)\n self.assertEqual(total_loss.dtype, tf.float64)\n\n def test_loss_masking(self):\n loss_container = compile_utils.LossesContainer('mae')\n y_p = tf.constant([[[1], [1]], [[0], [0]]], dtype=tf.float32)\n y_t = tf.constant([[[1], [1]], [[1], [1]]], dtype=tf.float32)\n y_p._keras_mask = tf.constant([[1, 0], [1, 0]],\n dtype=tf.float32)\n\n total_loss = loss_container(y_t, y_p)\n self.assertAlmostEqual(total_loss.numpy(), .25) # sum over batch size\n\n self.assertLen(loss_container.metrics, 1)\n loss_metric = loss_container.metrics[0]\n self.assertEqual(loss_metric.name, 'loss')\n self.assertAlmostEqual(loss_metric.result().numpy(), .25)\n\n def test_loss_sample_weight(self):\n loss_container = compile_utils.LossesContainer('mae')\n y_p = tf.constant([[[1], [1]], [[0], [0]]], dtype=tf.float32)\n y_t = tf.constant([[[1], [1]], [[1], [1]]], dtype=tf.float32)\n sw = tf.constant([[.2, .3], [.5, 0]], dtype=tf.float32)\n\n total_loss = loss_container(y_t, y_p, sample_weight=sw)\n # (0 * .2 + 0 * .3 + 1 * .5 + 1 * 0) / 4\n self.assertAlmostEqual(total_loss.numpy(), .125)\n\n self.assertLen(loss_container.metrics, 1)\n loss_metric = loss_container.metrics[0]\n self.assertEqual(loss_metric.name, 'loss')\n self.assertAlmostEqual(loss_metric.result().numpy(), .125)\n\n def test_loss_masking_sample_weight(self):\n loss_container = compile_utils.LossesContainer('mae')\n y_p = tf.constant([[[1], [1]], [[0], [0]]], dtype=tf.float32)\n y_t = tf.constant([[[1], [1]], [[1], [1]]], dtype=tf.float32)\n sw = tf.constant([[.2, .3], [.5, 0]], dtype=tf.float32)\n y_p._keras_mask = tf.constant([[1, 0], [1, 0]],\n dtype=tf.float32)\n\n total_loss = loss_container(y_t, y_p, sample_weight=sw)\n # (0 * .2 + 1 * .5) / 4\n self.assertAlmostEqual(total_loss.numpy(), .125) # sum over batch size\n\n self.assertLen(loss_container.metrics, 1)\n loss_metric = loss_container.metrics[0]\n self.assertEqual(loss_metric.name, 'loss')\n self.assertAlmostEqual(loss_metric.result().numpy(), .125)\n\n def test_custom_loss_callables(self):\n\n def custom_loss_fn(y_true, y_pred):\n return tf.reduce_sum(y_true - y_pred)\n\n class CustomLossClass(object):\n\n def __call__(self, y_true, y_pred):\n return tf.reduce_sum(y_true - y_pred)\n\n loss_container = compile_utils.LossesContainer(\n [custom_loss_fn, CustomLossClass()])\n y_t, y_p = tf.ones((10, 5)), tf.zeros((10, 5))\n loss_container(y_t, y_p)\n\n self.assertEqual(loss_container._losses[0].name, 'custom_loss_fn')\n self.assertEqual(loss_container._losses[1].name, 'custom_loss_class')\n\n def test_ragged_tensor_output(self):\n \"\"\"Ensure that ragged tensors can be passed as targets and predictions.\"\"\"\n\n def custom_loss_fn(y_true, y_pred):\n \"\"\"MSE supports RaggedTensors directly.\"\"\"\n return losses_mod.mse(y_true, y_pred)\n\n class CustomLossClass(losses_mod.Loss):\n \"\"\"User defined loss function must implement RaggedTensor support.\"\"\"\n\n def call(self, y_true, y_pred):\n losses = tf.ragged.map_flat_values(\n tf.math.squared_difference, y_true, y_pred)\n return tf.reduce_mean(losses)\n\n loss_container = compile_utils.LossesContainer(\n [custom_loss_fn, CustomLossClass()])\n\n v_t = tf.constant([[3., 4.], [1., 2.], [3., 5.]])\n v_p = tf.constant([[3.1, 4.], [1., 2.], [3., 5.]])\n\n y_t = tf.expand_dims(\n tf.RaggedTensor.from_row_splits(v_t, [0, 2, 3]), 0)\n y_p = tf.expand_dims(\n tf.RaggedTensor.from_row_splits(v_p, [0, 2, 3]), 0)\n loss_container(y_t, y_p)\n\n self.assertEqual(loss_container._losses[0].name, 'custom_loss_fn')\n\n\nclass MetricsContainerTest(keras_parameterized.TestCase):\n\n def test_single_metric(self):\n metric_container = compile_utils.MetricsContainer('mse')\n y_t, y_p = tf.ones((10, 5)), tf.zeros((10, 5))\n metric_container.update_state(y_t, y_p)\n\n self.assertLen(metric_container.metrics, 1)\n metric = metric_container.metrics[0]\n self.assertEqual(metric.name, 'mse')\n self.assertEqual(metric.result().numpy(), 1.)\n\n metric_container.reset_state()\n self.assertEqual(metric.result().numpy(), 0.)\n\n def test_list_of_metrics_one_output(self):\n metric_container = compile_utils.MetricsContainer(['mse', 'mae'])\n y_t, y_p = 2 * tf.ones((10, 5)), tf.zeros((10, 5))\n metric_container.update_state(y_t, y_p)\n self.assertLen(metric_container.metrics, 2)\n\n mse_metric = metric_container.metrics[0]\n self.assertEqual(mse_metric.name, 'mse')\n self.assertEqual(mse_metric.result().numpy(), 4.)\n\n mae_metric = metric_container.metrics[1]\n self.assertEqual(mae_metric.name, 'mae')\n self.assertEqual(mae_metric.result().numpy(), 2.)\n\n metric_container.reset_state()\n self.assertEqual(mse_metric.result().numpy(), 0.)\n self.assertEqual(mae_metric.result().numpy(), 0.)\n\n def test_list_of_metrics_list_of_outputs(self):\n metric_container = compile_utils.MetricsContainer(\n metrics=['mse', 'mae'], # Should broadcast to both outputs.\n weighted_metrics=['accuracy']) # Should broadcast to both outputs.\n\n y_t = [tf.ones((10, 1)), tf.zeros((10, 1))]\n y_p = [tf.ones((10, 1)), 2 * tf.ones((10, 1))]\n sw = tf.convert_to_tensor([0, 0, 0, 0, 0, 1, 1, 1, 1, 1])\n metric_container.update_state(y_t, y_p, sample_weight=sw)\n self.assertLen(metric_container.metrics, 6)\n\n mse_metric = metric_container.metrics[0]\n self.assertEqual(mse_metric.name, 'output_1_mse')\n self.assertEqual(mse_metric.result().numpy(), 0.)\n\n mse_metric = metric_container.metrics[1]\n self.assertEqual(mse_metric.name, 'output_1_mae')\n self.assertEqual(mse_metric.result().numpy(), 0.)\n\n acc_metric_1 = metric_container.metrics[2]\n self.assertEqual(acc_metric_1.name, 'output_1_accuracy')\n self.assertEqual(acc_metric_1.result().numpy(), 1.)\n self.assertEqual(acc_metric_1._fn, metrics_mod.binary_accuracy)\n\n mae_metric = metric_container.metrics[3]\n self.assertEqual(mae_metric.name, 'output_2_mse')\n self.assertEqual(mae_metric.result().numpy(), 4.)\n\n mae_metric = metric_container.metrics[4]\n self.assertEqual(mae_metric.name, 'output_2_mae')\n self.assertEqual(mae_metric.result().numpy(), 2.)\n\n acc_metric_2 = metric_container.metrics[5]\n self.assertEqual(acc_metric_2.name, 'output_2_accuracy')\n self.assertEqual(acc_metric_2.result().numpy(), 0.)\n self.assertEqual(acc_metric_2._fn, metrics_mod.binary_accuracy)\n\n weighted_metrics = metric_container.weighted_metrics\n self.assertLen(weighted_metrics, 2)\n self.assertEqual(weighted_metrics[0].name, 'output_1_accuracy')\n self.assertEqual(weighted_metrics[1].name, 'output_2_accuracy')\n\n unweighted_metrics = metric_container.unweighted_metrics\n self.assertLen(unweighted_metrics, 4)\n self.assertEqual(unweighted_metrics[0].name, 'output_1_mse')\n self.assertEqual(unweighted_metrics[1].name, 'output_1_mae')\n self.assertEqual(unweighted_metrics[2].name, 'output_2_mse')\n self.assertEqual(unweighted_metrics[3].name, 'output_2_mae')\n\n def test_metric_dict(self):\n metric_container = compile_utils.MetricsContainer(\n metrics={\n 'out1': 'mse',\n 'out2': 'mae'\n },\n weighted_metrics={\n 'out1': 'mse',\n 'out2': 'mae'\n })\n\n y_t = {'out1': tf.ones((10, 1)), 'out2': tf.zeros((10, 1))}\n y_p = {'out1': tf.ones((10, 1)), 'out2': 2 * tf.ones((10, 1))}\n sw = tf.convert_to_tensor([0, 0, 0, 0, 0, 1, 1, 1, 1, 1])\n metric_container.update_state(y_t, y_p, sample_weight=sw)\n\n mse_metric = metric_container.metrics[0]\n self.assertEqual(mse_metric.name, 'out1_mse')\n self.assertEqual(mse_metric.result().numpy(), 0.)\n\n weighted_mse_metric = metric_container.metrics[1]\n self.assertEqual(weighted_mse_metric.name, 'out1_weighted_mse')\n self.assertEqual(weighted_mse_metric.result().numpy(), 0.)\n\n mae_metric = metric_container.metrics[2]\n self.assertEqual(mae_metric.name, 'out2_mae')\n self.assertEqual(mae_metric.result().numpy(), 2.)\n\n weighted_mae_metric = metric_container.metrics[3]\n self.assertEqual(weighted_mae_metric.name, 'out2_weighted_mae')\n self.assertEqual(weighted_mae_metric.result().numpy(), 2.)\n\n metric_container.reset_state()\n self.assertEqual(mse_metric.result().numpy(), 0.)\n self.assertEqual(weighted_mse_metric.result().numpy(), 0.)\n self.assertEqual(mae_metric.result().numpy(), 0.)\n self.assertEqual(weighted_mae_metric.result().numpy(), 0.)\n\n def test_metric_partial_dict_with_output_names(self):\n metric_container = compile_utils.MetricsContainer(\n {'out2': 'mae'}, output_names=['out1', 'out2'])\n\n y_t = [tf.ones((10, 1)), tf.zeros((10, 1))]\n y_p = [tf.ones((10, 1)), tf.ones((10, 1))]\n sw = tf.convert_to_tensor([0, 0, 0, 0, 0, 1, 1, 1, 1, 1])\n\n metric_container.update_state(y_t, y_p, sample_weight=sw)\n self.assertLen(metric_container.metrics, 1)\n\n mae_metric = metric_container.metrics[0]\n self.assertEqual(mae_metric.name, 'out2_mae')\n self.assertEqual(mae_metric.result().numpy(), 1.)\n\n def test_metric_partial_dict_with_nones(self):\n metric_container = compile_utils.MetricsContainer({\n 'out1': None,\n 'out2': 'mae'\n })\n\n y_t = {'out1': tf.ones((10, 1)), 'out2': tf.zeros((10, 1))}\n y_p = {'out1': tf.ones((10, 1)), 'out2': tf.ones((10, 1))}\n sw = tf.convert_to_tensor([0, 0, 0, 0, 0, 1, 1, 1, 1, 1])\n\n metric_container.update_state(y_t, y_p, sample_weight=sw)\n self.assertLen(metric_container.metrics, 1)\n\n mae_metric = metric_container.metrics[0]\n self.assertEqual(mae_metric.name, 'out2_mae')\n self.assertEqual(mae_metric.result().numpy(), 1.)\n\n def test_nested_structure(self):\n metric_container = compile_utils.MetricsContainer(\n metrics={\n 'b': ['mse', None],\n 'a': 'mae'\n },\n weighted_metrics={\n 'b': [None, None],\n 'a': 'mse'\n })\n\n y_t = {\n 'b': [2 * tf.ones((10, 1)),\n tf.zeros((10, 1))],\n 'a': tf.zeros((10, 1))\n }\n y_p = {\n 'b': [tf.zeros((10, 1)),\n tf.zeros((10, 1))],\n 'a': tf.ones((10, 1))\n }\n sw = tf.convert_to_tensor([0, 0, 0, 0, 0, 1, 1, 1, 1, 1])\n\n metric_container.update_state(y_t, y_p, sample_weight=sw)\n self.assertLen(metric_container.metrics, 3)\n\n a_mae_metric = metric_container.metrics[0]\n self.assertEqual(a_mae_metric.name, 'a_mae')\n self.assertEqual(a_mae_metric.result().numpy(), 1.)\n\n weighted_a_mae_metric = metric_container.metrics[1]\n self.assertEqual(weighted_a_mae_metric.name, 'a_mse')\n self.assertEqual(weighted_a_mae_metric.result().numpy(), 1.)\n\n b_1_mse_metric = metric_container.metrics[2]\n self.assertEqual(b_1_mse_metric.name, 'b_1_mse')\n self.assertEqual(b_1_mse_metric.result().numpy(), 4.)\n\n def test_crossentropy(self):\n metric_container = compile_utils.MetricsContainer('crossentropy')\n y_t, y_p = tf.ones((10, 1)), tf.ones((10, 1))\n metric_container.update_state(y_t, y_p)\n self.assertEqual(metric_container.metrics[0]._fn,\n metrics_mod.binary_crossentropy)\n\n metric_container = compile_utils.MetricsContainer('crossentropy')\n y_t, y_p = tf.ones((10, 1)), tf.ones((10, 20))\n self.assertEqual(y_p.shape.as_list()[-1], 20)\n metric_container.update_state(y_t, y_p)\n self.assertEqual(metric_container.metrics[0]._fn,\n metrics_mod.sparse_categorical_crossentropy)\n\n metric_container = compile_utils.MetricsContainer('crossentropy')\n y_t, y_p = tf.ones((10, 20)), tf.ones((10, 20))\n metric_container.update_state(y_t, y_p)\n self.assertEqual(metric_container.metrics[0]._fn,\n metrics_mod.categorical_crossentropy)\n\n def test_accuracy(self):\n metric_container = compile_utils.MetricsContainer('accuracy')\n y_t, y_p = tf.ones((10, 1)), tf.ones((10, 1))\n metric_container.update_state(y_t, y_p)\n self.assertEqual(metric_container.metrics[0]._fn,\n metrics_mod.binary_accuracy)\n\n metric_container = compile_utils.MetricsContainer('Accuracy')\n y_t, y_p = tf.ones((10, 1)), tf.ones((10, 1))\n metric_container.update_state(y_t, y_p)\n self.assertEqual(metric_container.metrics[0]._fn,\n metrics_mod.binary_accuracy)\n\n metric_container = compile_utils.MetricsContainer('accuracy')\n y_t, y_p = tf.ones((10, 1)), tf.ones((10, 20))\n self.assertEqual(y_p.shape.as_list()[-1], 20)\n metric_container.update_state(y_t, y_p)\n self.assertEqual(metric_container.metrics[0]._fn,\n metrics_mod.sparse_categorical_accuracy)\n\n metric_container = compile_utils.MetricsContainer('accuracy')\n y_t, y_p = tf.ones((10, 20)), tf.ones((10, 20))\n metric_container.update_state(y_t, y_p)\n self.assertEqual(metric_container.metrics[0]._fn,\n metrics_mod.categorical_accuracy)\n\n def test_metric_weighting(self):\n metric_container = compile_utils.MetricsContainer(\n metrics=['mae'], weighted_metrics=['mae'])\n\n y_t = tf.convert_to_tensor([[0], [3], [0]])\n y_p = tf.convert_to_tensor([[0], [0], [0]])\n sw = tf.convert_to_tensor([[1], [0], [1]])\n\n metric_container.update_state(y_t, y_p, sample_weight=sw)\n self.assertLen(metric_container.metrics, 2)\n\n mae_metric = metric_container.metrics[0]\n self.assertEqual(mae_metric.name, 'mae')\n self.assertEqual(mae_metric.result().numpy(), 1.)\n\n weighted_mae_metric = metric_container.metrics[1]\n self.assertEqual(weighted_mae_metric.name, 'weighted_mae')\n self.assertEqual(weighted_mae_metric.result().numpy(), 0.)\n\n def test_broadcast_metrics_to_dict(self):\n metric_container = compile_utils.MetricsContainer(metrics=['mae'])\n\n y_p = {'output': tf.convert_to_tensor([[0], [1], [2]])}\n y_t = {'output': tf.convert_to_tensor([[1], [2], [3]])}\n metric_container.update_state(y_t, y_p)\n\n mae_metric = metric_container.metrics[0]\n self.assertEqual(mae_metric.name, 'mae')\n self.assertEqual(mae_metric.result().numpy(), 1.)\n\n def test_broadcast_metrics_to_dict_with_output_names(self):\n metric_container = compile_utils.MetricsContainer(\n metrics=['mae'], output_names=['output'])\n\n y_p = tf.convert_to_tensor([[0], [1], [2]])\n y_t = {'output': tf.convert_to_tensor([[1], [2], [3]])}\n metric_container.update_state(y_t, y_p)\n\n mae_metric = metric_container.metrics[0]\n self.assertEqual(mae_metric.name, 'mae')\n self.assertEqual(mae_metric.result().numpy(), 1.)\n\n def test_missing_label_with_no_metrics(self):\n # It's ok to exclude a label if that label has no\n # losses or metrics associated with it.\n metric_container = compile_utils.MetricsContainer(metrics={\n 'output1': 'mae',\n 'output3': 'mse'\n })\n\n y_p = {\n 'output1': tf.convert_to_tensor([[0], [1], [2]]),\n 'output2': tf.convert_to_tensor([[3], [4], [5]]),\n 'output3': tf.convert_to_tensor([[6], [7], [8]])\n }\n y_t = {\n 'output1': tf.convert_to_tensor([[1], [2], [3]]),\n 'output3': tf.convert_to_tensor([[4], [5], [6]])\n }\n\n metric_container.update_state(y_t, y_p)\n self.assertLen(metric_container.metrics, 2)\n\n mae_metric = metric_container.metrics[0]\n self.assertEqual(mae_metric.name, 'output1_mae')\n self.assertEqual(mae_metric.result().numpy(), 1.)\n\n mse_metric = metric_container.metrics[1]\n self.assertEqual(mse_metric.name, 'output3_mse')\n self.assertEqual(mse_metric.result().numpy(), 4.)\n\n def test_metrics_masking(self):\n metrics_container = compile_utils.MetricsContainer(\n metrics=['mae'], weighted_metrics=['mse'])\n y_p = tf.constant([[[1], [1]], [[0], [0]]], dtype=tf.float32)\n y_t = tf.constant([[[1], [1]], [[1], [1]]], dtype=tf.float32)\n y_p._keras_mask = tf.constant([[1, 1], [0, 0]],\n dtype=tf.float32)\n\n metrics_container.update_state(y_t, y_p)\n self.assertLen(metrics_container.metrics, 2)\n\n mae_metric = metrics_container.metrics[0]\n self.assertEqual(mae_metric.name, 'mae')\n self.assertAlmostEqual(mae_metric.result().numpy(), 0)\n\n weighted_mae_metric = metrics_container.metrics[1]\n self.assertEqual(weighted_mae_metric.name, 'mse')\n self.assertAlmostEqual(weighted_mae_metric.result().numpy(), 0)\n\n def test_metrics_sample_weight(self):\n metrics_container = compile_utils.MetricsContainer(\n metrics=['mae'], weighted_metrics=['mse'])\n y_p = tf.constant([[[1], [1]], [[0], [1]]], dtype=tf.float32)\n y_t = tf.constant([[[1], [1]], [[1], [1]]], dtype=tf.float32)\n sw = tf.constant([[.2, .3], [.5, 0]], dtype=tf.float32)\n\n metrics_container.update_state(y_t, y_p, sample_weight=sw)\n self.assertLen(metrics_container.metrics, 2)\n\n mae_metric = metrics_container.metrics[0]\n self.assertEqual(mae_metric.name, 'mae')\n self.assertAlmostEqual(mae_metric.result().numpy(), .25) # 1 / 4\n\n weighted_mae_metric = metrics_container.metrics[1]\n self.assertEqual(weighted_mae_metric.name, 'mse')\n self.assertAlmostEqual(weighted_mae_metric.result().numpy(), .5) # .5 / 1\n\n def test_metrics_masking_sample_weight(self):\n metrics_container = compile_utils.MetricsContainer(\n metrics=['mae'], weighted_metrics=['mse'])\n y_p = tf.constant([[[1], [1]], [[0], [1]]], dtype=tf.float32)\n y_t = tf.constant([[[1], [1]], [[1], [1]]], dtype=tf.float32)\n sw = tf.constant([[.3, .2], [.2, .3]], dtype=tf.float32)\n y_p._keras_mask = tf.constant([[1, 0], [1, 0]],\n dtype=tf.float32)\n\n metrics_container.update_state(y_t, y_p, sample_weight=sw)\n self.assertLen(metrics_container.metrics, 2)\n\n mae_metric = metrics_container.metrics[0]\n self.assertEqual(mae_metric.name, 'mae')\n self.assertAlmostEqual(mae_metric.result().numpy(), .5) # 1 / .5\n\n weighted_mae_metric = metrics_container.metrics[1]\n self.assertEqual(weighted_mae_metric.name, 'mse')\n self.assertAlmostEqual(weighted_mae_metric.result().numpy(), .2 / .5)\n\n def test_loss_class_as_metric_with_distribution(self):\n distribution = tf.distribute.OneDeviceStrategy('/device:CPU:0')\n with distribution.scope():\n metric_container = compile_utils.MetricsContainer(\n losses_mod.MeanSquaredError())\n y_t, y_p = tf.ones((10, 5)), tf.zeros((10, 5))\n metric_container.update_state(y_t, y_p)\n\n self.assertLen(metric_container.metrics, 1)\n metric = metric_container.metrics[0]\n self.assertEqual(metric.name, 'mean_squared_error')\n self.assertEqual(metric.result().numpy(), 1.)\n\n def test_custom_metric_callables(self):\n\n def custom_metric_fn(y_true, y_pred):\n return tf.reduce_sum(y_true - y_pred)\n\n class CustomMetricClass(object):\n\n def __call__(self, y_true, y_pred):\n return tf.reduce_sum(y_true - y_pred)\n\n metric_container = compile_utils.MetricsContainer(\n [custom_metric_fn, CustomMetricClass()])\n y_t, y_p = tf.ones((10, 5)), tf.zeros((10, 5))\n metric_container.update_state(y_t, y_p)\n\n self.assertEqual(metric_container.metrics[0].name, 'custom_metric_fn')\n self.assertEqual(metric_container.metrics[1].name, 'custom_metric_class')\n\n def test_reset_state_existing_metric_before_built(self):\n metric = metrics_mod.Mean()\n metric.update_state([2.0, 4.0])\n self.assertEqual(metric.result().numpy(), 3.0)\n\n metric_container = compile_utils.MetricsContainer(metric)\n metric_container.reset_state()\n self.assertEqual(metric.result().numpy(), 0.0)\n\n\nif __name__ == '__main__':\n tf.compat.v1.enable_eager_execution()\n tf.test.main()\n" ]
[ [ "tensorflow.compat.v2.__internal__.tracking.AutoTrackable" ], [ "tensorflow.compat.v2.compat.v1.executing_eagerly_outside_functions", "tensorflow.compat.v2.executing_eagerly", "tensorflow.compat.v2.shape", "tensorflow.compat.v2.is_tensor", "tensorflow.python.util.tf_export.keras_export", "tensorflow.compat.v2.name_scope", "tensorflow.compat.v2.__internal__.monitoring.BoolGauge", "tensorflow.compat.v2.group", "tensorflow.compat.v2.distribute.get_replica_context", "tensorflow.compat.v2.Variable", "tensorflow.compat.v2.raw_ops.ResourceScatterUpdate", "tensorflow.compat.v2.control_dependencies", "tensorflow.compat.v2.unique", "tensorflow.compat.v2.distribute.in_cross_replica_context", "tensorflow.compat.v2.__internal__.tracking.CheckpointInitialValueCallable", "tensorflow.compat.v2.raw_ops.ResourceScatterAdd", "tensorflow.compat.v2.nest.flatten", "tensorflow.compat.v2.compat.v1.get_default_graph", "tensorflow.compat.v2.init_scope", "tensorflow.compat.v2.GradientTape", "tensorflow.compat.v2.device", "tensorflow.compat.v2.cast", "tensorflow.compat.v2.distribute.get_strategy", "tensorflow.compat.v2.compat.v1.gradients", "tensorflow.compat.v2.distribute.has_strategy", "tensorflow.compat.v2.no_op" ], [ "tensorflow.compat.v2.Variable", "tensorflow.python.util.tf_export.keras_export", "tensorflow.compat.v2.train.checkpoints_iterator", "tensorflow.python.platform.tf_logging.info", "tensorflow.compat.v2.train.load_checkpoint", "tensorflow.compat.v2.train.Checkpoint" ], [ "tensorflow.compat.v2.nest.map_structure", "numpy.expand_dims", "tensorflow.compat.v2.nest.is_nested", "tensorflow.compat.v2.data.experimental.cardinality", "numpy.asarray", "tensorflow.compat.v2.__internal__.nest.list_to_tuple", "tensorflow.python.eager.context.async_wait", "tensorflow.compat.v2.range", "tensorflow.compat.v2.convert_to_tensor", "tensorflow.compat.v2.data.Dataset.from_tensor_slices", "tensorflow.compat.v2.py_function", "scipy.sparse.issparse", "tensorflow.python.util.tf_export.keras_export", "tensorflow.compat.v2.__internal__.monitoring.BoolGauge", "tensorflow.compat.v2.reshape", "tensorflow.compat.v2.expand_dims", "tensorflow.compat.v2.gather", "tensorflow.compat.v2.data.Dataset.range", "tensorflow.compat.v2.data.Dataset.from_tensors", "tensorflow.compat.v2.random.shuffle", "tensorflow.python.platform.tf_logging.warning", "tensorflow.compat.v2.data.Options", "tensorflow.compat.v2.nest.pack_sequence_as", "tensorflow.compat.v2.nest.flatten", "tensorflow.compat.v2.slice", "tensorflow.compat.v2.data.Dataset.from_generator", "tensorflow.compat.v2.cast", "tensorflow.compat.v2.SparseTensor", "tensorflow.compat.v2.distribute.get_strategy" ], [ "tensorflow.compat.v2.test.main", "tensorflow.compat.v2.compat.v1.enable_eager_execution", "tensorflow.compat.v2.abs", "tensorflow.compat.v2.reduce_mean", "tensorflow.compat.v2.distribute.OneDeviceStrategy", "tensorflow.compat.v2.cast", "tensorflow.compat.v2.ragged.map_flat_values", "tensorflow.compat.v2.convert_to_tensor", "tensorflow.compat.v2.ones", "tensorflow.compat.v2.zeros", "tensorflow.compat.v2.reduce_sum", "tensorflow.compat.v2.RaggedTensor.from_row_splits", "tensorflow.compat.v2.constant" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [ "1.7", "1.0", "0.10", "1.2", "0.14", "0.19", "1.5", "0.12", "0.17", "0.13", "1.6", "1.4", "1.9", "1.3", "1.10", "0.15", "0.18", "0.16", "1.8" ], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
jackromo/GSOCMcgillApplication
[ "769fdb2529008f7812a90ce7aba306e2bc630203" ]
[ "mcgill_app/graphs.py" ]
[ "\"\"\"\n.. module:: graphs\n :synopsis: All graph plotting and creation facilities.\n\n.. moduleauthor:: Jack Romo <[email protected]>\n\n\"\"\"\n\nfrom __future__ import division\nimport matplotlib.pyplot as plt\n\n\nclass FunctionsGraph(object):\n \"\"\"\n A graph that wraps around matplotlib.pyplot for plotting PlottableFunctions.\n \"\"\"\n\n def __init__(self, x_label=\"\", y_label=\"\", title=\"\"):\n \"\"\"\n :type x_label: str\n :param x_label: Label of x axis.\n :type y_label: str\n :param y_label: Label of y axis.\n :type title: str\n :param title: Title of graph displayed directly above.\n \"\"\"\n self.x_label = x_label\n self.y_label = y_label\n self.title = title\n self.functions = []\n\n def add_plotted_function(self, func, style=\"g-\", label=\"\"):\n \"\"\"\n Append a PlottedFunction to the graph, which will be drawn on the graph when plotted.\n\n :type func: PlottedFunction\n :param func: The function to be added to the graph.\n :type style: str\n :param style: The styling of the function's line on the graph. Must be in matplotlib style.\n :type label: str\n :param label: Name of function that will be put in legend of graph.\n :returns: Nothing.\n \"\"\"\n self.functions.append({\"function\": func,\n \"style\": style,\n \"label\": label})\n\n def plot(self, x_range=(0, 10), point_spacing=1.0, unit_factor_x=1.0, unit_factor_y=1.0):\n \"\"\"\n Plots graph of all functions across a specified interval.\n\n :type x_range: tuple\n :param x_range: A 2-tuple specifying lowest and highest x values on x-axis.\n :type point_spacing: float\n :param point_spacing: The space between x values of each plotted point on the graph.\n :type unit_factor_x: float\n :param unit_factor_x: Factor to multiply x values by to get into correct units on graph.\n :type unit_factor_y: float\n :param unit_factor_y: Factor to multiply x values by to get into correct units on graph.\n :returns: Nothing.\n \"\"\"\n for func_map in self.functions:\n function = func_map[\"function\"]\n xs, ys = function.get_xy_vals(x_range=x_range, point_spacing=point_spacing)\n plt.plot([x * unit_factor_x for x in xs],\n [y * unit_factor_y for y in ys], func_map[\"style\"], label=func_map[\"label\"])\n plt.legend()\n plt.xlabel(self.x_label)\n plt.ylabel(self.y_label)\n plt.suptitle(self.title, fontsize=12)\n plt.show()\n" ]
[ [ "matplotlib.pyplot.legend", "matplotlib.pyplot.plot", "matplotlib.pyplot.xlabel", "matplotlib.pyplot.suptitle", "matplotlib.pyplot.show", "matplotlib.pyplot.ylabel" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
jshi31/NAFAE
[ "3421070d966877bbeb33d2d9b26a9d755a178589" ]
[ "lib/model/transformer/Modules.py" ]
[ "import torch\nimport torch.nn as nn\nimport torch.nn.init as init\nimport numpy as np\nimport pdb\n\n__author__ = \"Yu-Hsiang Huang\"\n\nclass Linear(nn.Module):\n ''' Simple Linear layer with xavier init '''\n def __init__(self, d_in, d_out, bias=True):\n super(Linear, self).__init__()\n self.linear = nn.Linear(d_in, d_out, bias=bias)\n init.xavier_normal(self.linear.weight)\n\n def forward(self, x):\n return self.linear(x)\n\nclass Bottle(nn.Module):\n ''' Perform the reshape routine before and after an operation '''\n\n def forward(self, input):\n if len(input.size()) <= 2:\n return super(Bottle, self).forward(input)\n size = input.size()[:2]\n out = super(Bottle, self).forward(input.view(size[0]*size[1], -1))\n return out.view(size[0], size[1], -1)\n\nclass BottleLinear(Bottle, Linear):\n ''' Perform the reshape routine before and after a linear projection '''\n pass\n\nclass BottleSoftmax(Bottle, nn.Softmax):\n ''' Perform the reshape routine before and after a softmax operation'''\n pass\n\nclass LayerNormalization(nn.Module):\n ''' Layer normalization module '''\n\n def __init__(self, d_hid, eps=1e-3):\n super(LayerNormalization, self).__init__()\n\n self.eps = eps\n self.a_2 = nn.Parameter(torch.ones(d_hid), requires_grad=True)\n self.b_2 = nn.Parameter(torch.zeros(d_hid), requires_grad=True)\n\n def forward(self, z):\n if z.size(1) == 1:\n return z\n\n mu = torch.mean(z, keepdim=True, dim=-1)\n sigma = torch.std(z, keepdim=True, dim=-1)\n ln_out = (z - mu.expand_as(z)) / (sigma.expand_as(z) + self.eps)\n ln_out = ln_out * self.a_2.expand_as(ln_out) + self.b_2.expand_as(ln_out)\n\n return ln_out\n\nclass BatchBottle(nn.Module):\n ''' Perform the reshape routine before and after an operation '''\n\n def forward(self, input):\n if len(input.size()) <= 2:\n return super(BatchBottle, self).forward(input)\n size = input.size()[1:]\n out = super(BatchBottle, self).forward(input.view(-1, size[0]*size[1]))\n return out.view(-1, size[0], size[1])\n\nclass BottleLayerNormalization(BatchBottle, LayerNormalization):\n ''' Perform the reshape routine before and after a layer normalization'''\n pass\n\nclass ScaledDotProductAttention(nn.Module):\n ''' Scaled Dot-Product Attention '''\n\n def __init__(self, d_model, attn_dropout=0.1):\n super(ScaledDotProductAttention, self).__init__()\n self.temper = np.power(d_model, 0.5)\n self.dropout = nn.Dropout(attn_dropout)\n self.softmax = BottleSoftmax()\n\n def forward(self, q, k, v, attn_mask=None):\n\n attn = torch.bmm(q, k.transpose(1, 2)) / self.temper\n if attn_mask is not None:\n\n assert attn_mask.size() == attn.size(), \\\n 'Attention mask shape {} mismatch ' \\\n 'with Attention logit tensor shape ' \\\n '{}.'.format(attn_mask.size(), attn.size())\n\n attn.data.masked_fill_(attn_mask, -float('inf'))\n\n attn = self.softmax(attn)\n attn = self.dropout(attn)\n output = torch.bmm(attn, v)\n\n return output, attn\n" ]
[ [ "torch.mean", "torch.nn.Dropout", "torch.ones", "numpy.power", "torch.zeros", "torch.nn.Linear", "torch.std", "torch.bmm", "torch.nn.init.xavier_normal" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
jgollub1/tennis_match_prediction
[ "1ccf0ecd5ddb5d98da2d3610e4890fcab844dfcc" ]
[ "src/data_functions.py" ]
[ "import os\nimport sys\n\nsys.path.insert(0, './sackmann')\n\nimport re\nimport datetime\nimport numpy as np\nimport pandas as pd\nimport elo_538 as elo\nfrom tennisMatchProbability import matchProb\nfrom processing_util import normalize_name\nfrom data_classes import stats_52, adj_stats_52, tny_52, commop_stats\nfrom collections import defaultdict\nfrom globals import COMMOP_START_YEAR, EPSILON\n\npd.options.mode.chained_assignment = None\n\n'''\nconcatenate original match dataframes from years\n(start_y, end_y)\n'''\ndef concat_data(start_y, end_y, tour):\n match_year_list = []\n for i in range(start_y, end_y+1):\n f_name = \"../match_data_formatted/{}_matches_{}.csv\".format(tour, i)\n try:\n match_year_list.append(pd.read_csv(f_name))\n except:\n print('could not find file for year: ', i)\n full_match_df = pd.concat(match_year_list, ignore_index = True)\n return full_match_df.sort_values(by=['tny_date','tny_name','match_num'], ascending=True).reset_index(drop=True)\n\n'''\nmatch data preprocessing\n'''\ndef format_match_df(df,tour,ret_strings=[],abd_strings=[]):\n cols = [u'tourney_id', u'tourney_name', u'surface', u'draw_size', u'tourney_date',\n u'match_num', u'winner_name', u'loser_name', u'score', u'best_of', u'w_svpt',\n u'w_1stWon', u'w_2ndWon', u'l_svpt', u'l_1stWon', u'l_2ndWon']\n df = df[cols]\n df = df.rename(columns={'winner_name':'w_name','loser_name':'l_name','tourney_id':'tny_id',\\\n 'tourney_name':'tny_name','tourney_date':'tny_date'})\n\n df['w_name'] = [normalize_name(x,tour) for x in df['w_name']]\n df['l_name'] = [normalize_name(x,tour) for x in df['l_name']]\n df['tny_name'] = ['Davis Cup' if 'Davis Cup' in s else s for s in df['tny_name']]\n df['tny_name'] = [s.replace('Australian Chps.','Australian Open').replace('Australian Open-2',\\\n 'Australian Open').replace('U.S. National Chps.','US Open') for s in df['tny_name']]\n df['is_gs'] = (df['tny_name'] == 'Australian Open') | (df['tny_name'] == 'Roland Garros') |\\\n (df['tny_name'] == 'Wimbledon') | (df['tny_name'] == 'US Open')\n\n # format dates\n df['tny_date'] = [datetime.datetime.strptime(str(x), \"%Y%m%d\").date() for x in df['tny_date']]\n df['match_year'] = [x.year for x in df['tny_date']]\n df['match_month'] = [x.month for x in df['tny_date']]\n df['match_year'] = df['match_year'] + (df['match_month'] == 12) # correct december start dates\n df['match_month'] = [1 if month==12 else month for month in df['match_month']] # to following year\n df['score'] = [re.sub(r\"[\\(\\[].*?[\\)\\]]\", \"\", str(s)) for s in df['score']] # str(s) fixes any nans\n df['score'] = ['RET' if 'RET' in s else s for s in df['score']]\n df['w_swon'], df['l_swon'] = df['w_1stWon']+df['w_2ndWon'], df['l_1stWon']+df['l_2ndWon']\n df['w_rwon'], df['l_rwon'] = df['l_svpt']-df['l_swon'], df['w_svpt']-df['w_swon']\n df['w_rpt'], df['l_rpt'] = df['l_svpt'], df['w_svpt']\n df.drop(['w_1stWon','w_2ndWon','l_1stWon','l_2ndWon'], axis=1, inplace=True)\n\n # remove matches involving a retirement\n abd_d, ret_d = set(abd_strings), set(ret_strings)\n df['score'] = ['ABN' if score.split(' ')[-1] in abd_d else score for score in df['score']]\n df['score'] = ['RET' if score in ret_d else score for score in df['score']]\n return df.loc[(df['score'] != 'ABN') & (df['score'] != 'RET')].reset_index(drop=True)\n\n'''\noriginal dataset labels columns by 'w_'/'l_'\nchange 'w'/'l' to 'p0','p1' (where p0 is the higher ranked player, according to Elo ratings)\n'''\n# TODO: refactor this into two functions\ndef change_labels(df, cols):\n # change w,l TO p0,p1\n for col in cols:\n df['p0'+col] = [df['l'+col][i] if df['winner'][i] else df['w'+col][i] for i in range(len(df))]\n df['p1'+col] = [df['w'+col][i] if df['winner'][i] else df['l'+col][i] for i in range(len(df))]\n\n # add s/r pct columns\n p_hat = np.sum([df['p0_52_swon'],df['p1_52_swon']])/np.sum([df['p0_52_svpt'],df['p1_52_svpt']])\n for label in ['p0','p1']:\n df[label+'_s_pct'] = [p_hat if x==0 else x for x in np.nan_to_num(df[label+'_52_swon']/df[label+'_52_svpt'])]\n df[label+'_r_pct'] = [1-p_hat if x==0 else x for x in np.nan_to_num(df[label+'_52_rwon']/df[label+'_52_rpt'])]\n df[label+'_sf_s_pct'] = [p_hat if x==0 else x for x in np.nan_to_num(df[label+'_sf_52_swon']/df[label+'_sf_52_svpt'])]\n df[label+'_sf_r_pct'] = [1-p_hat if x==0 else x for x in np.nan_to_num(df[label+'_sf_52_rwon']/df[label+'_sf_52_rpt'])]\n\n for label in ['w', 'l']:\n df.drop([label + col for col in cols], axis=1, inplace=True)\n\n df['tny_name'] = [s if s==s else 'Davis Cup' for s in df['tny_name']]\n return df\n\n'''\noriginal dataset labels columns by 'w_'/'l_'\nchange 'w'/'l' to 'p0','p1' (where p0 is the higher ranked player, according to Elo ratings)\n(without extra formatting)\n'''\ndef change_labels_v2(df, cols):\n # change w,l TO p0,p1\n for col in cols:\n df['p0'+col] = [df['l'+col][i] if df['winner'][i] else df['w'+col][i] for i in range(len(df))]\n df['p1'+col] = [df['w'+col][i] if df['winner'][i] else df['l'+col][i] for i in range(len(df))]\n\n for label in ['w', 'l']:\n df.drop([label + col for col in cols], axis=1, inplace=True)\n\n return df\n\n'''\nconfirm that match serve/return stats are not null\n'''\ndef validate(row, label):\n return row[label+'_swon']==row[label+'_swon'] and row[label+'_svpt']==row[label+'_svpt'] \\\n and row[label+'_rwon']==row[label+'_rwon'] and row[label+'_rpt']==row[label+'_rpt']\n\n'''\nfrom start_ind (a year before start_year), collect cumulative\n12-month s/r stats prior to each match\n'''\ndef get_current_52_stats(df, start_ind):\n players_stats = {}\n active_players = {}\n w_l = ['p0', 'p1']\n start_date = (df['match_year'][start_ind],df['match_month'][start_ind])\n avg_stats = stats_52(start_date)\n avg_stats.update(start_date,(6.4,10,3.6,10)) # set as prior so first row is not nan\n\n for i, row in df[start_ind:].iterrows():\n date = row['match_year'],row['match_month']\n avg_stats.set_month(date)\n for k,label in enumerate(w_l):\n if row[label+'_name'] not in players_stats:\n players_stats[row[label+'_name']] = stats_52(date)\n # store serving stats prior to match, update current month\n players_stats[row[label+'_name']].set_month(date)\n if validate(row, label):\n match_stats = (row[label+'_swon'],row[label+'_svpt'],row[w_l[1-k]+'_svpt']-\\\n row[w_l[1-k]+'_swon'],row[w_l[1-k]+'_svpt'])\n players_stats[row[label+'_name']].update(date,match_stats)\n avg_stats.update(date,match_stats)\n\n active_players[row[label+'_name']] = 1 # log active player\n\n # update every player to current month\n for player in active_players.keys():\n players_stats[player].set_month(date)\n\n players = active_players.keys()\n current_52_stats = [[player] + list(np.sum(players_stats[player].last_year,axis=0)) \\\n for player in players]\n # avg_52_stats = np.sum(avg_stats.last_year,axis=0)\n cols = ['player','52_swon','52_svpt','52_rwon','52_rpt']\n current_stats_df = pd.DataFrame(current_52_stats, columns=cols)\n current_stats_df['52_s_pct'] = current_stats_df['52_swon']/current_stats_df['52_svpt']\n current_stats_df['52_r_pct'] = current_stats_df['52_rwon']/current_stats_df['52_rpt']\n return current_stats_df[current_stats_df['52_svpt']>0] # return players active in past 12 months\n\n'''\ngenerate 12-month stats for Barnett-Clarke model\nas well as variations (adjusted, EM-normalized)\n'''\ndef generate_stats(df, start_ind):\n df = generate_52_stats(df,start_ind)\n print('generated 52 stats...')\n\n df = generate_52_adj_stats(df,start_ind)\n print('generated 52 adj stats...')\n\n df = generate_tny_stats(df,start_ind)\n print('generated tny stats...')\n\n df = generate_commop_stats(df, start_ind)\n print('generated commop stats...')\n\n cols = ['_name','_elo_538','_sf_elo_538', #'_elo','_sf_elo'\n '_swon', '_svpt', '_rwon', '_rpt',\n '_52_swon', '_52_svpt','_52_rwon','_52_rpt',\n '_sf_52_swon','_sf_52_svpt','_sf_52_rwon','_sf_52_rpt',\n '_52_s_adj','_52_r_adj']\n\n # of players p0, p1, p0 will always be the player with the first name alphabetically (since this is deterministic)\n # the 'winner' will be 1 when p0's name comes alphabetically last and 0 otherwise\n df['winner'] = df['w_name'] > df['l_name']\n df = change_labels(df, cols)\n df = change_labels_v2(df, ['_commop_s_pct', '_commop_r_pct'])\n\n df['elo_diff'] = df['p0_elo_538'] - df['p1_elo_538']\n df['sf_elo_diff'] = df['p0_sf_elo_538'] - df['p1_sf_elo_538']\n\n # # dataframe with only official matches\n # df = df[df['winner']!='None']\n # df = df.reset_index(drop=True)\n # cols = ['52_s_adj','52_r_adj']\n\n em_cols = ['s_pct', 'r_pct', 'sf_s_pct', 'sf_r_pct', '52_s_adj', '52_r_adj']\n df = generate_sr_pct(df)\n\n # FIX for correct em stat sample sizes\n df = df.loc[start_ind:].reset_index(drop=True)\n df = generate_em_stats(df, em_cols)\n return df\n\n'''\nadd s/r pct columns, replacing nan with overall avg\n'''\ndef generate_sr_pct(df):\n p_hat = np.sum([df['p0_52_swon'],df['p1_52_swon']])\n p_hat = p_hat/np.sum([df['p0_52_svpt'],df['p1_52_svpt']])\n for label in ['p0','p1']:\n # divide with np.nan_to_num and use p_hat as a placeholder when n=0\n df[label+'_s_pct'] = np.nan_to_num(df[label+'_52_swon']/df[label+'_52_svpt'])\n df[label+'_s_pct'] = df[label+'_s_pct'] + (p_hat) * (df[label+'_s_pct'] == 0)\n df[label+'_r_pct'] = np.nan_to_num(df[label+'_52_rwon']/df[label+'_52_rpt'])\n df[label+'_r_pct'] = df[label+'_r_pct'] + (1-p_hat)*(df[label+'_r_pct'] == 0)\n\n df[label+'_sf_s_pct'] = np.nan_to_num(df[label+'_sf_52_swon']/df[label+'_sf_52_svpt'])\n df[label+'_sf_s_pct'] = df[label+'_sf_s_pct'] + (p_hat) * (df[label+'_sf_s_pct'] == 0)\n df[label+'_sf_r_pct'] = np.nan_to_num(df[label+'_sf_52_rwon']/df[label+'_sf_52_rpt'])\n df[label+'_sf_r_pct'] = df[label+'_sf_r_pct'] + (1-p_hat)*(df[label+'_sf_r_pct'] == 0)\n\n # finally, generate the observed service percentages in each match\n df[label+'_s_pct_obsv'] = np.nan_to_num(df[label+'_swon']/df[label+'_svpt'])\n return df\n\ndef finalize_df(df):\n # generate serving probabilities for Barnett-Clarke model\n df['match_id'] = range(len(df))\n df['tny_stats'] = [df['avg_52_s'][i] if df['tny_stats'][i]==0 else df['tny_stats'][i] for i in range(len(df))]\n df['p0_s_kls'] = df['tny_stats']+(df['p0_s_pct']-df['avg_52_s']) - (df['p1_r_pct']-df['avg_52_r'])\n df['p1_s_kls'] = df['tny_stats']+(df['p1_s_pct']-df['avg_52_s']) - (df['p0_r_pct']-df['avg_52_r'])\n df['p0_s_kls_EM'] = df['tny_stats']+(df['p0_s_pct_EM']-df['avg_52_s']) - (df['p1_r_pct_EM']-df['avg_52_r'])\n df['p1_s_kls_EM'] = df['tny_stats']+(df['p1_s_pct_EM']-df['avg_52_s']) - (df['p0_r_pct_EM']-df['avg_52_r'])\n\n df['p0_s_sf_kls'] = df['tny_stats']+(df['p0_sf_s_pct']-df['sf_avg_52_s']) - (df['p1_sf_r_pct']-df['sf_avg_52_r'])\n df['p1_s_sf_kls'] = df['tny_stats']+(df['p1_sf_s_pct']-df['sf_avg_52_s']) - (df['p0_sf_r_pct']-df['sf_avg_52_r'])\n df['p0_s_sf_kls_EM'] = df['tny_stats']+(df['p0_sf_s_pct_EM']-df['sf_avg_52_s']) - (df['p1_sf_r_pct_EM']-df['sf_avg_52_r'])\n df['p1_s_sf_kls_EM'] = df['tny_stats']+(df['p1_sf_s_pct_EM']-df['sf_avg_52_s']) - (df['p0_sf_r_pct_EM']-df['sf_avg_52_r'])\n\n df['p0_s_adj_kls'] = df['tny_stats']+(df['p0_52_s_adj']) - (df['p1_52_r_adj'])\n df['p1_s_adj_kls'] = df['tny_stats']+(df['p1_52_s_adj']) - (df['p0_52_r_adj'])\n df['p0_s_adj_kls_EM'] = df['tny_stats']+(df['p0_52_s_adj_EM']) - (df['p1_52_r_adj_EM'])\n df['p1_s_adj_kls_EM'] = df['tny_stats']+(df['p1_52_s_adj_EM']) - (df['p0_52_r_adj_EM'])\n\n df['p0_s_commop_kls'] = df['tny_stats']+(df['p0_commop_s_pct'] - df['avg_52_s']) - (df['p1_commop_r_pct'] - df['avg_52_r'])\n df['p1_s_commop_kls'] = df['tny_stats']+(df['p1_commop_s_pct'] - df['avg_52_s']) - (df['p0_commop_r_pct'] - df['avg_52_r'])\n\n p_hat = np.sum([df['p0_52_swon'],df['p1_52_swon']])/np.sum([df['p0_52_svpt'],df['p1_52_svpt']])\n df['p0_s_baseline'] = p_hat\n df['p1_s_baseline'] = p_hat\n\n # generate match probabilities for Barnett-Clarke method, with or w/o EM estimators\n df['match_prob_kls'] = [matchProb(row['p0_s_kls'],1-row['p1_s_kls']) for i,row in df.iterrows()]\n df['match_prob_kls_EM'] = [matchProb(row['p0_s_kls_EM'],1-row['p1_s_kls_EM']) for i,row in df.iterrows()]\n df['match_prob_sf_kls'] = [matchProb(row['p0_s_sf_kls'],1-row['p1_s_sf_kls']) for i,row in df.iterrows()]\n df['match_prob_sf_kls_EM'] = [matchProb(row['p0_s_sf_kls_EM'],1-row['p1_s_sf_kls_EM']) for i,row in df.iterrows()]\n df['match_prob_adj_kls'] = [matchProb(row['p0_s_adj_kls'],1-row['p1_s_adj_kls']) for i,row in df.iterrows()]\n df['match_prob_adj_kls_EM'] = [matchProb(row['p0_s_adj_kls_EM'],1-row['p1_s_adj_kls_EM']) for i,row in df.iterrows()]\n df['match_prob_commop_kls'] = [matchProb(row['p0_s_commop_kls'],1-row['p1_s_commop_kls']) for i,row in df.iterrows()]\n df['match_prob_commop'] = [1 - df['w_commop_match_prob'][i] if df['winner'][i] else df['w_commop_match_prob'][i] for i in range(len(df))]\n\n # generate win probabilities from elo differences\n df['elo_prob'] = (1+10**(df['elo_diff']/-400.))**-1\n df['sf_elo_prob'] = [(1+10**(diff/-400.))**-1 for diff in df['sf_elo_diff']]\n\n # elo-induced serve percentages\n df = generate_bc_stats_elo_induced(df, 'elo',start_ind=0)\n return df\n\ndef get_start_ind(match_df, start_year):\n return match_df[match_df['match_year']>=start_year-1].index[0]\n\n'''\nreturns dataframe with up-to-date player stats through date of most recent match\n'''\ndef generate_df(tour, start_year, end_year, ret_strings, abd_strings, counts_538):\n print('start_year: ', start_year)\n print('end_year: ', end_year)\n match_df = concat_data(start_year, end_year, tour)\n print('match_df.shape before: ', match_df.shape)\n start_ind = match_df[match_df['match_year']>=start_year-1].index[0]\n print('match_df.shape: ', match_df.shape)\n match_df = generate_elo(match_df, counts_538)\n print('generated elo on match dataset...')\n\n match_df = generate_stats(match_df, start_ind) # 52, adj, tny, etc.\n match_df = finalize_df(match_df)\n match_df = match_df.reset_index(drop=True)\n print('finalized df...')\n return match_df\n\n'''\nreturns two dataframes\n1) contains up-to-date player stats through date of most recent match\n2) contains every match with elo/serve/return/etc stats\n'''\ndef generate_test_dfs(tour, start_year, end_year, ret_strings, abd_strings, counts_538):\n match_df = concat_data(start_year, end_year, tour)\n start_ind = match_df[match_df['match_year']>=start_year-1].index[0]\n match_df = generate_elo(match_df, counts_538)\n\n match_df = generate_52_stats(match_df, start_ind)\n match_df = generate_52_adj_stats(match_df, start_ind)\n match_df = generate_tny_stats(match_df, start_ind)\n match_df = generate_commop_stats(match_df, start_ind)\n # TODO: add generate_em_stats() right here\n\n return match_df\n\n'''\nreceives n x 2 array with columns 'w_name', 'l_name', 'is_gs'\n'''\ndef generate_elo_columns(arr, counts_538):\n # print('arr[0]: ', arr[0])\n # print('arr[1]: ', arr[1])\n # print('arr[0].dtype', arr[:, 0].dtype)\n # print('arr[1].dtype', arr[:, 1].dtype)\n # print('arr[:, :2]', arr[:, :2])\n # for s in arr:\n # if isinstance(s[1], bool):\n # print('s: ', s)\n # print('is: ', [s for s in arr if isinstance(s[0], bool))\n # players_set = np.unique(arr[:, :2].astype(str))\n player_names = arr[:, :2].flatten()\n players_set = np.where(player_names!=player_names, '', player_names).tolist()\n # players_set = list(set(list(np.concatenate(arr[:, 0], arr[:, 1]))))\n # player_count = len(players_set)\n # print('player_count: ', player_count)\n # initial_ratings = [elo.Rating() for _ in range(player_count)]\n # zipped = zip(\n # players_set,\n # [elo.Rating() for _ in range(player_count)]\n # )\n # # print('zipped: ', zipped)\n # players_elo = dict(zip(\n # players_set,\n # [elo.Rating() for _ in range(player_count)]\n # )) # can use default dict here?\n players_elo = {}\n for player in players_set:\n # print('player: ', player)\n players_elo[player] = elo.Rating()\n\n match_elos = np.zeros([arr.shape[0], 2])\n elo_obj = elo.Elo_Rater()\n\n # update player elo from every recorded match\n for i in range(arr.shape[0]):\n w_name, l_name = arr[i][:2]\n\n if w_name != w_name or l_name != l_name:\n match_elos[i] = np.nan, np.nan\n continue\n\n match_elos[i] = players_elo[w_name].value, players_elo[l_name].value\n elo_obj.rate_1vs1(players_elo[w_name], players_elo[l_name], arr[i][2], counts_538)\n\n return match_elos[:,0], match_elos[:,1]\n\ndef generate_surface_elo_columns(df, surfaces, counts_538):\n df['w_sf_elo_538'], df['l_sf_elo_538'] = df['w_elo_538'], df['l_elo_538']\n for surface in surfaces:\n surface_df = df[(df['surface'] == surface) & (df['w_name'] == df['w_name']) & (df['l_name'] == df['l_name'])]\n w_elo_columns, l_elo_columns = generate_elo_columns(np.array(surface_df[['w_name', 'l_name', 'is_gs']]), True)\n df.loc[df['surface'] == surface, 'w_sf_elo_538'] = w_elo_columns\n df.loc[df['surface'] == surface, 'l_sf_elo_538'] = l_elo_columns\n\n return df['w_sf_elo_538'], df['l_sf_elo_538']\n\n'''\nreceives n x 4 array with columns 'w_name', 'l_name', 'is_gs', 'Date'\n'''\ndef generateEloColumnsWithHistory(arr, counts_538):\n playerEloHistory = defaultdict(list)\n players_set = np.unique(arr[:, :2])\n players_elo = dict(zip(\n players_set,\n [elo.Rating() for __ in range(len(players_set))]\n )) # can use default dict here?\n\n match_elos = np.zeros([arr.shape[0], 2])\n elo_obj = elo.Elo_Rater()\n\n # update player elo from every recorded match\n for i in range(arr.shape[0]):\n w_name, l_name = arr[i][:2]\n isGrandSlam = arr[i][2]\n date = datetime.datetime.strptime(arr[i][3], '%Y-%m-%d')\n\n match_elos[i] = players_elo[w_name].value, players_elo[l_name].value\n elo_obj.rate_1vs1(players_elo[w_name], players_elo[l_name], 0, counts_538)\n\n playerEloHistory[w_name].append({ 'date': date, 'newElo': players_elo[w_name].value, 'won': 1 })\n playerEloHistory[l_name].append({ 'date': date, 'newElo': players_elo[l_name].value, 'won': 0 })\n\n return match_elos[:,0], match_elos[:,1], playerEloHistory, players_elo\n\n'''\nreturn match dataframe with each player's pre-match elo ratings\n'''\ndef generate_elo(df, counts_538=True):\n df['w_elo_538'], df['l_elo_538'] = generate_elo_columns(np.array(df[['w_name', 'l_name', 'is_gs']]), True)\n df['w_sf_elo_538'], df['l_sf_elo_538'] = generate_surface_elo_columns(df, ['Hard', 'Clay', 'Grass'], counts_538)\n return df\n\n # df['w_sf_elo_538'], df['l_sf_elo_538'] = df['w_elo_538'], df['l_elo_538']\n # for surface in ['Hard', 'Clay', 'Grass']:\n # surface_df = df[df['surface'] == surface]\n # w_elo_columns, l_elo_columns = generate_elo_columns(np.array(surface_df[['w_name', 'l_name', 'is_gs']]), True)\n # df.loc[df['surface'] == surface, 'w_sf_elo_538'] = w_elo_columns\n # df.loc[df['surface'] == surface, 'l_sf_elo_538'] = l_elo_columns\n\n # return df\n\n'''\nreplace nan values with overall average array value\n'''\ndef fill_nan_with_mean(arr):\n mean = np.nanmean(arr)\n arr[np.isnan(arr)] = mean\n return arr\n\n'''\ncollect 12-month s/r average performance by player\n'''\ndef generate_52_stats(df,start_ind):\n players_stats = {}\n start_date = (df['match_year'][start_ind],df['match_month'][start_ind])\n avg_stats = stats_52(start_date)\n # set as prior so first row is not nan\n avg_stats.update(start_date,(6.4,10,3.6,10))\n # array w/ 2x1 arrays for each player's 12-month serve/return performance\n match_52_stats = np.zeros([2,len(df),4])\n avg_52_stats = np.zeros([len(df),4]) # avg tour-wide stats for serve, return\n\n s_players_stats = {}\n s_avg_stats = {}\n for surface in ('Hard','Clay','Grass'):\n s_players_stats[surface] = {}\n s_avg_stats[surface] = stats_52((df['match_year'][0],df['match_month'][0]))\n s_avg_stats[surface].update(start_date,(6.4,10,3.6,10))\n s_match_52_stats = np.zeros([2,len(df),4])\n s_avg_52_stats = np.zeros([len(df),4])\n\n w_l = ['w','l']\n for i, row in df.loc[start_ind:].iterrows():\n surface = row['surface']\n date = row['match_year'],row['match_month']\n\n avg_stats.set_month(date)\n avg_52_stats[i] = np.sum(avg_stats.last_year,axis=0)\n for k,label in enumerate(w_l):\n if row[label+'_name'] not in players_stats:\n players_stats[row[label+'_name']] = stats_52(date)\n # store serving stats prior to match, update current month\n players_stats[row[label+'_name']].set_month(date)\n match_52_stats[k][i] = np.sum(players_stats[row[label+'_name']].last_year,axis=0) # all four stats per player\n # update serving stats if not null\n if validate(row, label):\n match_stats = (row[label+'_swon'],row[label+'_svpt'],row[w_l[1-k]+'_svpt']-\\\n row[w_l[1-k]+'_swon'],row[w_l[1-k]+'_svpt'])\n players_stats[row[label+'_name']].update(date,match_stats)\n avg_stats.update(date,match_stats)\n\n # repeat above process for surface-specific stats\n if surface not in ('Hard','Clay','Grass'):\n continue\n s_avg_stats[surface].set_month(date)\n s_avg_52_stats[i] = np.sum(s_avg_stats[surface].last_year,axis=0)\n for k,label in enumerate(w_l):\n if row[label+'_name'] not in s_players_stats[surface]:\n s_players_stats[surface][row[label+'_name']] = stats_52(date)\n\n # store serving stats prior to match, from current month\n s_players_stats[surface][row[label+'_name']].set_month(date)\n s_match_52_stats[k][i] = np.sum(s_players_stats[surface][row[label+'_name']].last_year,axis=0)\n # update serving stats if not null\n if validate(row, label):\n match_stats = (row[label+'_swon'],row[label+'_svpt'],row[w_l[1-k]+'_svpt']-\\\n row[w_l[1-k]+'_swon'],row[w_l[1-k]+'_svpt'])\n s_players_stats[surface][row[label+'_name']].update(date,match_stats)\n s_avg_stats[surface].update(date,match_stats)\n\n for k,label in enumerate(w_l):\n df[label+'_52_swon'] = match_52_stats[k][:,0]\n df[label+'_52_svpt'] = match_52_stats[k][:,1]\n df[label+'_52_rwon'] = match_52_stats[k][:,2]\n df[label+'_52_rpt'] = match_52_stats[k][:,3]\n df[label+'_sf_52_swon'] = s_match_52_stats[k][:,0]\n df[label+'_sf_52_svpt'] = s_match_52_stats[k][:,1]\n df[label+'_sf_52_rwon'] = s_match_52_stats[k][:,2]\n df[label+'_sf_52_rpt'] = s_match_52_stats[k][:,3]\n\n with np.errstate(divide='ignore', invalid='ignore'):\n df['avg_52_s'] = fill_nan_with_mean(np.divide(avg_52_stats[:,0],avg_52_stats[:,1]))\n df['avg_52_r'] = fill_nan_with_mean(np.divide(avg_52_stats[:,2],avg_52_stats[:,3]))\n df['sf_avg_52_s'] = fill_nan_with_mean(np.divide(s_avg_52_stats[:,0],s_avg_52_stats[:,1]))\n df['sf_avg_52_r'] = fill_nan_with_mean(np.divide(s_avg_52_stats[:,2],s_avg_52_stats[:,3]))\n return df\n\n'''\nEfron-Morris estimators for 52-week serve and return percentages\nCalculates B_i coefficients in terms of service points\nFeed any existing col where ['p0_'+col, 'p1_'+col] within df.columns\n# TODO: you should be passing in the full column suffix after 'p0_'/'p1_'\n'''\ndef generate_em_stats(df,cols):\n for col in cols:\n stat_history = np.concatenate([df['p0_'+col],df['p1_'+col]],axis=0)\n n = int(len(stat_history)/2)\n prefix = 'sf_52_' if 'sf' in col else '52_'\n suffix = 'svpt' if '_s_' in col else 'rpt'\n num_points = np.concatenate([df['p0_'+prefix+suffix],df['p1_'+prefix+suffix]])\n p_hat = np.mean(stat_history)\n sigma2_i = fill_nan_with_mean(np.divide(p_hat*(1-p_hat),num_points,where=num_points>0))\n tau2_hat = np.nanvar(stat_history)\n B_i = sigma2_i/(tau2_hat+sigma2_i)\n\n stat_history[stat_history!=stat_history] = p_hat\n df['p0_' + col + '_EM'] = df['p0_' + col]+B_i[:n] * (p_hat - df['p0_' + col])\n df['p1_' + col + '_EM'] = df['p1_' + col]+B_i[n:] * (p_hat - df['p1_' + col])\n print(col, p_hat)\n return df # ok if p_hats don't add up because they're avg of averages\n\n'''\nEfron-Morris estimators for 52-week serve and return percentages\nCalculates B_i coefficients in terms of service points\nFeed any existing col within df.columns\n'''\ndef generate_em_stats_current(df,cols):\n for col in cols:\n stat_history = df[col]\n num_points = df['52_svpt'] if col=='52_swon' else df['52_rpt']\n p_hat = np.mean(stat_history)\n sigma2_i = fill_nan_with_mean(np.divide(p_hat*(1-p_hat),num_points,where=num_points>0))\n tau2_hat = np.nanvar(stat_history)\n B_i = sigma2_i/(tau2_hat+sigma2_i)\n\n stat_history[stat_history!=stat_history] = p_hat\n df[col+'_EM'] = df[col]+B_i*(p_hat-df[col])\n print(col, p_hat)\n return df # ok if p_hats don't add up because they're avg of averages\n\n\n'''\nuse validate stats before calling statsClass.update() method\n'''\ndef is_valid(arr):\n return not np.isnan(arr).any()\n\n'''\ncollects 12-month s/r stats relative to historical opponents\ncolumns '52_s_adj','52_r_adj' represent how well a player\nperforms above average\n'''\ndef generate_52_adj_stats(df,start_ind=0):\n players_stats = {}\n match_52_stats = np.zeros([2,len(df),2]) # 2x1 arrays for x_i, x_j's 12-month s/r performance\n\n w_l = ['w','l']\n for i, row in df.loc[start_ind:].iterrows():\n surface = row['surface']\n date = row['match_year'],row['match_month']\n avg_52_s, avg_52_r = row['avg_52_s'],row['avg_52_r']\n match_stats = [[],[]]\n\n # add new players to the dictionary\n for k,label in enumerate(w_l):\n if row[label+'_name'] not in players_stats:\n players_stats[row[label+'_name']] = adj_stats_52(date)\n\n # store pre-match adj stats\n for k,label in enumerate(w_l):\n players_stats[row[label+'_name']].set_month(date)\n\n # fill in player's adjusted stats prior to start of match\n match_52_stats[k][i] = players_stats[row[label+'_name']].adj_sr\n # update serving stats if not null\n if validate(row, label):\n sv_stats = (row[label+'_swon'],row[label+'_svpt'],row[label+'_rwon'],row[label+'_rpt'])\n\n\n # TODO: this is the troublesome line... could be extracting nan value from opponent\n # TODO: also rewrite this so it's readable (plus with arrays not obvious at)\n opp_r_ablty = players_stats[row[w_l[1-k]+'_name']].adj_sr[1] + avg_52_r\n opp_s_ablty = players_stats[row[w_l[1-k]+'_name']].adj_sr[0] + avg_52_s\n opp_stats = (opp_r_ablty * row[label + '_svpt'], opp_s_ablty * row[label + '_rpt'])\n match_stats[k] = sv_stats + opp_stats\n\n # update players' adjusted scores based on pre-match adjusted ratings\n for k,label in enumerate(w_l):\n # if is_valid(match_stats):\n if validate(row, label) and is_valid(match_stats):\n players_stats[row[label+'_name']].update(date,match_stats[k])\n\n for k,label in enumerate(w_l):\n df[label+'_52_s_adj'] = match_52_stats[k][:,0]\n df[label+'_52_r_adj'] = match_52_stats[k][:,1]\n return df\n\n\n'''\ngenerate delta between two players relative to shared opponent\ndelta_i^AB = (spw(A, C_i) - (1 - rpw(A, C_i))) - (spw(B, C_i) - (1 - rpw(B, C_i)))\n'''\ndef generate_delta(p1_stats, p2_stats):\n p1_s_pct, p1_r_pct = p1_stats[0]/float(p1_stats[1]), p1_stats[2]/float(p1_stats[3])\n p2_s_pct, p2_r_pct = p2_stats[0]/float(p2_stats[1]), p2_stats[2]/float(p2_stats[3])\n return (p1_s_pct - (1 - p1_r_pct)) - (p2_s_pct - (1 - p2_r_pct))\n\n'''\nreturn true if total service/return points both greater than zero\n'''\ndef has_stats(last_year_stats):\n return last_year_stats[1] > 0 and last_year_stats[3] > 0\n\n'''\nget opponents who have played a match in the past 12 months (more than 0 points)\n'''\ndef get_opponents(player_d, player_name):\n historical_opponents = player_d[player_name].history.keys()\n return [opp for opp in historical_opponents if has_stats(player_d[player_name].history[opp])]\n\n'''\ncompute serve/return parameters, given their common opponent history\n'''\ndef generate_commop_params(player_d, player1, player2):\n p1_opponents, p2_opponents = get_opponents(player_d, player1), get_opponents(player_d, player2)\n common_opponents = np.intersect1d(p1_opponents, p2_opponents)\n if len(common_opponents) == 0:\n return [0]\n\n match_deltas = np.zeros(len(common_opponents))\n for i, comm_op in enumerate(common_opponents):\n p1_match_stats = player_d[player1].history[comm_op]\n p2_match_stats = player_d[player2].history[comm_op]\n comm_op_delta = generate_delta(p1_match_stats, p2_match_stats)\n match_deltas[i] = comm_op_delta\n if np.isnan(comm_op_delta):\n print('nan here: ', p1_match_stats, p2_match_stats, comm_op)\n\n overall_delta = np.mean(match_deltas)\n if np.isnan(overall_delta):\n print('nan, match_deltas: ', match_deltas)\n return match_deltas\n\n'''\ncollect historical s/r common-opponent performance by player\n'''\ndef generate_commop_stats(df, start_ind):\n player_d = {}\n match_52_stats = np.zeros([2,len(df), 2])\n match_probs = np.zeros([len(df)])\n\n w_l = ['w','l']\n for i, row in df.loc[start_ind:].iterrows():\n for k, label in enumerate(w_l):\n opponent_name = row[w_l[1-k]+'_name']\n if row[label+'_name'] not in player_d:\n player_d[row[label+'_name']] = commop_stats()\n\n if validate(row, label):\n match_stats = (row[label+'_swon'],row[label+'_svpt'],row[w_l[1-k]+'_svpt']-\\\n row[w_l[1-k]+'_swon'],row[w_l[1-k]+'_svpt'])\n player_d[row[label+'_name']].update(match_stats, opponent_name)\n\n # can compute common-opponent stats after current match stats inputted\n if row['match_year'] >= COMMOP_START_YEAR: # start at COMMOP_START_YEAR, computationally intensive\n match_deltas = generate_commop_params(player_d, row['w_name'], row['l_name'])\n overall_delta = np.mean(match_deltas)\n w_s_pct, w_r_pct = (.6 + overall_delta/2), (.4 + overall_delta/2)\n\n match_52_stats[0][i] = [w_s_pct, w_r_pct]\n match_52_stats[1][i] = [1 - w_r_pct, 1 - w_s_pct]\n\n iterated_match_probs = [\n np.mean([\n matchProb(.6 + match_delta, .4),\n matchProb(.6, .4 + match_delta)\n ])\n for match_delta in match_deltas\n ]\n match_probs[i] = np.mean(iterated_match_probs)\n\n for k,label in enumerate(w_l):\n df[label+'_commop_s_pct'] = match_52_stats[k][:,0]\n df[label+'_commop_r_pct'] = match_52_stats[k][:,1]\n\n df['w_commop_match_prob'] = match_probs\n return df\n\n\n'''\ncollect yearly tournament serve averages for 'f_av'\nin Barnette-Clark equation\n'''\ndef generate_tny_stats(df,start_ind=0):\n tny_stats = {}\n tny_52_stats = np.zeros(len(df))\n for i, row in df.loc[start_ind:].iterrows():\n if row['tny_name']=='Davis Cup':\n continue\n\n year,t_id = row['tny_id'].split('-')\n year = int(year)\n match_stats = (row['w_swon']+row['l_swon'],row['w_svpt']+row['l_svpt'])\n # handle nan cases, provide tny_stats if possible\n if row['w_swon']!=row['w_swon']:\n if t_id in tny_stats:\n if year-1 in tny_stats[t_id].historical_avgs:\n swon,svpt = tny_stats[t_id].historical_avgs[year-1]\n tny_52_stats[i] = swon/float(svpt)\n continue\n # create new object if needed, then update\n elif t_id not in tny_stats:\n tny_stats[t_id] = tny_52(year)\n tny_52_stats[i] = tny_stats[t_id].update(year,match_stats)\n\n df['tny_stats'] = tny_52_stats\n return df\n\n'''\napproximate inverse elo-->s_pct calculator\n'''\ndef elo_induced_s(prob, s_total):\n s0 = s_total/2\n diff = s_total/4\n current_prob = .5\n\n while abs(current_prob-prob) > EPSILON:\n if current_prob < prob:\n s0 += diff\n else:\n s0 -= diff\n diff /= 2\n current_prob = matchProb(s0,1-(s_total-s0))\n return s0, s_total-s0\n\n\n'''\nimport to set s_total with EM-normalized percentages\n'''\ndef generate_bc_stats_elo_induced(df,col,start_ind=0):\n df['s_total'] = df['p0_s_kls_EM'] + df['p1_s_kls_EM']\n induced_s = np.zeros([len(df),2])\n for i, row in df.loc[start_ind:].iterrows():\n induced_s[i] = elo_induced_s(row[col+'_prob'],row['s_total'])\n df['p0_s_kls_' + col] = induced_s[:,0]\n df['p1_s_kls_' + col] = induced_s[:,1]\n\n del df['s_total']\n return df\n\ndef format_pbp_df(df,tour='atp'):\n df['w_name'] = np.where(df['winner'] == 0, df['server1'], df['server2'])\n df['l_name'] = np.where(df['winner'] == 0, df['server2'], df['server1'])\n df['w_name'] = [normalize_name(x,tour=tour) for x in df['w_name']]\n df['l_name'] = [normalize_name(x,tour=tour) for x in df['l_name']]\n df['date'] = pd.to_datetime(df['date'])\n df['match_year'] = [x.year for x in df['date']]\n df['match_month'] = [x.month for x in df['date']]\n df['date'] = [x.date() for x in df['date']]\n df['score'] = [re.sub(r\"[\\(\\[].*?[\\)\\]]\", \"\", s) for s in df['score']]\n return df\n\ndef connect_match_and_pbp_dfs(match_df,pbp_df,col_d,player_cols,start_year=2009):\n pbp_dict = {}; winner_dict = {}\n for i in xrange(len(pbp_df)):\n key = pbp_df['w_name'][i] +' ' + pbp_df['l_name'][i] + ' ' \\\n + str(pbp_df['match_year'][i]) + ' ' + pbp_df['score'][i]\n key = key+' '+str(pbp_df['match_month'][i]) if key in col_d else key\n if key in pbp_dict:\n continue\n pbp_dict[key] = pbp_df['pbp'][i]\n winner_dict[key] = pbp_df['winner'][i]\n\n # in case of a collision (about 10 cases), I only take the first match with that key\n c = 0\n pbps,winners = [],[]\n info = {}\n\n match_df = match_df[match_df['match_year']>=start_year]\n for i in match_df.index:\n key = match_df['w_name'][i] +' ' + match_df['l_name'][i] + ' ' \\\n +str(match_df['match_year'][i])+' '+match_df['score'][i]\n key = key+' '+str(match_df['match_month'][i]) if key in col_d else key\n if key in pbp_dict:\n c += 1\n pbps.append(pbp_dict[key])\n winners.append(winner_dict[key])\n if key in info:\n pbps[-1] = 'None'; winners[-1] = 'None'\n print('collision');\n print(key + ' ' + str(match_df['match_month'][i]))\n info[key] = 1\n else:\n pbps.append('None')\n # we'll just make 'winner' a random 0 or 1 for now\n winners.append(np.random.choice([0,1]))\n print(c)\n match_df['pbp'] = pbps\n match_df['winner'] = winners\n\n #df = match_df[match_df['pbp']!='NA']\n #cols = df.columns.drop(['loser_id','winner_id'])\n df = match_df[match_df.columns.drop(['loser_id','winner_id'])]\n df = df.reset_index(drop=True)\n\n # # change w,l TO p0,p1\n # for col in player_cols:\n # df['p0'+col] = [df['l'+col][i] if df['winner'][i] else df['w'+col][i] for i in xrange(len(df))]\n # df['p1'+col] = [df['w'+col][i] if df['winner'][i] else df['l'+col][i] for i in xrange(len(df))]\n\n # # add s/r pct columns\n # p_hat = np.sum([df['p0_52_swon'],df['p1_52_swon']])/np.sum([df['p0_52_svpt'],df['p1_52_svpt']])\n # for label in ['p0','p1']:\n # df[label+'_s_pct'] = [p_hat if x==0 else x for x in np.nan_to_num(df[label+'_52_swon']/df[label+'_52_svpt'])]\n # df[label+'_r_pct'] = [1-p_hat if x==0 else x for x in np.nan_to_num(df[label+'_52_rwon']/df[label+'_52_rpt'])]\n # df[label+'_sf_s_pct'] = [p_hat if x==0 else x for x in np.nan_to_num(df[label+'_sf_52_swon']/df[label+'_sf_52_svpt'])]\n # df[label+'_sf_r_pct'] = [1-p_hat if x==0 else x for x in np.nan_to_num(df[label+'_sf_52_rwon']/df[label+'_sf_52_rpt'])]\n\n # df['elo_diff'] = [df['p0_elo'][i] - df['p1_elo'][i] for i in xrange(len(df))]\n # df['sf_elo_diff'] = [df['p0_sf_elo'][i] - df['p1_sf_elo'][i] for i in xrange(len(df))]\n # df['tny_name'] = [s if s==s else 'Davis Cup' for s in df['tny_name']]\n return df\n" ]
[ [ "pandas.to_datetime", "numpy.nan_to_num", "pandas.DataFrame", "numpy.concatenate", "numpy.mean", "numpy.nanmean", "numpy.where", "numpy.divide", "pandas.read_csv", "numpy.unique", "numpy.nanvar", "numpy.intersect1d", "numpy.zeros", "pandas.concat", "numpy.random.choice", "numpy.isnan", "numpy.errstate", "numpy.array", "numpy.sum" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "2.0", "1.4", "1.1", "1.5", "1.2", "1.3" ], "scipy": [], "tensorflow": [] } ]
microsoft/aaai21-copy-that
[ "7dfb2ebabbbf1165a33c2430ef2f2571e487b4fd", "7dfb2ebabbbf1165a33c2430ef2f2571e487b4fd" ]
[ "model/tests/copyspan_seq2seq_synth_edits.py", "mlcomponents/embeddings/tokensequenceembedder.py" ]
[ "import logging\r\nimport random\r\n\r\nimport numpy as np\r\n\r\nfrom dpu_utils.utils import run_and_debug, RichPath\r\n\r\nfrom data.representationviz import RepresentationsVisualizer\r\nfrom data.synthetic.charedits import get_dataset\r\nfrom editrepcomponents.alignededitencoder import AlignedEditTokensEmbedding\r\nfrom dpu_utils.ptutils import BaseComponent, ComponentTrainer\r\nfrom mlcomponents.seqdecoding.spancopydecoder import GruSpanCopyingDecoder\r\nfrom mlcomponents.seqencoder import BiGruSequenceEncoder\r\nfrom editrepcomponents.copyeditor import CopyEditor\r\nfrom mlcomponents.embeddings import TokenSequenceEmbedder\r\nfrom mlcomponents.seqdecoding import LuongAttention\r\n\r\nlogging.basicConfig(level=logging.INFO,\r\n format='%(asctime)-15s %(name)-5s %(levelname)-8s %(message)s')\r\n\r\n\r\ndef run():\r\n greedy_decoding = False\r\n\r\n np.random.seed(1)\r\n random.seed(1)\r\n dataset = get_dataset()\r\n logging.info('Generated %s synthetic datapoints.', len(dataset))\r\n\r\n training_set, validation_set = dataset[:int(.8 * len(dataset))], dataset[int(.8 * len(dataset)):]\r\n\r\n seq_embeddings = TokenSequenceEmbedder('SeqTokenEmbedder', hyperparameters={'max_seq_length': 12, 'dropout_rate':0, 'min_word_count_threshold': 1})\r\n input_sequence_encoder = BiGruSequenceEncoder('BiGruEncoder',\r\n token_embedder=seq_embeddings,\r\n hyperparameters={\r\n 'num_layers':2,\r\n 'hidden_size': 61,\r\n })\r\n\r\n attention = LuongAttention('StandardAttention',\r\n hyperparameters={'memories_hidden_dimension': input_sequence_encoder.output_states_size})\r\n copy_attention = LuongAttention('StandardAttention',\r\n hyperparameters={'memories_hidden_dimension': input_sequence_encoder.output_states_size})\r\n\r\n edit_token_embeddings = AlignedEditTokensEmbedding('EditEncoder', token_encoder=seq_embeddings)\r\n edit_encoder = BiGruSequenceEncoder('BiGruEditEncoder',\r\n token_embedder=edit_token_embeddings,\r\n hyperparameters={\r\n 'num_layers':3,\r\n })\r\n decoder = GruSpanCopyingDecoder('GruSpanCopyingDecoder',\r\n token_encoder=seq_embeddings,\r\n standard_attention=attention,\r\n copy_attention=copy_attention,\r\n hyperparameters={'initial_state_size': 244+192,\r\n 'memories_hidden_dimension': 122,\r\n 'dropout_rate':0,\r\n 'additional_inputs_size':64*3,\r\n 'max_memories_length': 12})\r\n\r\n model = CopyEditor('CopyEditor',\r\n input_sequence_encoder=input_sequence_encoder,\r\n edit_encoder=edit_encoder,\r\n output_sequence_decoder=decoder,\r\n learn_bidirectional_edits=True\r\n )\r\n\r\n save_path = RichPath.create('./testmodel-copyspan.pkl.gz')\r\n trainer = ComponentTrainer(model, save_path, max_num_epochs=50, minibatch_size=500)\r\n trainer.train(training_set, validation_set, patience=10)\r\n\r\n ## Try greedy decoding\r\n model = None\r\n model = BaseComponent.restore_model(save_path) # type: CopyEditor\r\n model.eval()\r\n all_data = [model.load_data_from_sample(d) for d in validation_set]\r\n ground_input_sequences = [d.input_sequence for d in validation_set]\r\n data_iter = iter(all_data)\r\n predictions = []\r\n representations = []\r\n is_full = True\r\n start_idx = 0\r\n while is_full:\r\n mb_data, is_full, num_elements = model.create_minibatch(data_iter, max_num_items=100)\r\n if num_elements > 0:\r\n if greedy_decoding:\r\n mb_predictions = [s for s in model.greedy_decode(input_sequences=mb_data['input_sequences'],\r\n aligned_edits=mb_data['aligned_edits'],\r\n ground_input_sequences=ground_input_sequences[\r\n start_idx:start_idx + num_elements])]\r\n else:\r\n mb_predictions = [s for s in model.beam_decode(input_sequences=mb_data['input_sequences'], aligned_edits=mb_data['aligned_edits'],\r\n ground_input_sequences=ground_input_sequences[start_idx:start_idx+num_elements])]\r\n predictions.extend(mb_predictions)\r\n start_idx += num_elements\r\n representations.extend(model.edit_encoder.get_summary(input_sequence_data=mb_data['aligned_edits']))\r\n if not is_full:\r\n break\r\n\r\n assert len(all_data) == len(predictions)\r\n\r\n num_errors_at_1 = 0\r\n num_errors_at_5 = 0\r\n for i, (datasample, predictions) in enumerate(zip(validation_set, predictions)):\r\n if predictions[0][0] != datasample.output_sequence:\r\n print(datasample, predictions)\r\n num_errors_at_1 += 1\r\n if not any(predictions[i][0] == datasample.output_sequence for i in range(len(predictions))):\r\n num_errors_at_5 += 1\r\n\r\n print(f'Matched @1 {100 * (1 - num_errors_at_1/len(validation_set))}% samples.')\r\n print(f'Matched @5 {100 * (1 - num_errors_at_5/len(validation_set))}% samples.')\r\n\r\n representations = np.array(representations)\r\n viz = RepresentationsVisualizer(labeler=lambda d:d.edit_type)\r\n viz.print_nearest_neighbors(validation_set, representations, num_items=20)\r\n # viz.plot_tsne(validation_set, representations, save_file='out.pdf')\r\n\r\n\r\nrun_and_debug(run, True)\r\n", "import logging\r\nfrom collections import Counter\r\nimport typing\r\nfrom typing import Optional, Dict, Any, List, NamedTuple\r\n\r\nimport numpy as np\r\nimport torch\r\nfrom dpu_utils.mlutils import Vocabulary\r\nfrom torch import nn\r\n\r\nfrom mlcomponents.embeddings.sequenceembedder import SequenceEmbedder\r\n\r\n\r\nclass TokenSequenceEmbedder(SequenceEmbedder):\r\n \"\"\"\r\n Component that converts a list of tokens into a fixed-size matrix of embeddings.\r\n \"\"\"\r\n\r\n LOGGER = logging.getLogger('TokenSequenceEmbedder')\r\n\r\n def __init__(self, name: str, hyperparameters: Optional[Dict[str, Any]]=None) -> None:\r\n super(TokenSequenceEmbedder, self).__init__(name, hyperparameters)\r\n self.__metadata_token_counter = None # type: Optional[typing.Counter[str]]\r\n self.__vocabulary = None # type: Optional[Vocabulary]\r\n self.__embedding_layer = None # type: Optional[nn.Embedding]\r\n self.__dropout_layer = None # type: Optional[nn.Dropout]\r\n\r\n @classmethod\r\n def default_hyperparameters(cls) -> Dict[str, Any]:\r\n return {'embedding_size': 64,\r\n 'max_vocabulary_size': 10000,\r\n 'min_word_count_threshold': 7,\r\n 'max_seq_length': 30,\r\n 'dropout_rate': 0.2,\r\n }\r\n\r\n @property\r\n def embedding_size(self) -> int:\r\n return self.get_hyperparameter('embedding_size')\r\n\r\n @property\r\n def embedding_matrix(self) -> torch.Tensor:\r\n assert self.__embedding_layer is not None, 'Embeddings have not been initialized.'\r\n return self.__embedding_layer.weight\r\n\r\n @property\r\n def vocabulary(self) -> Vocabulary:\r\n return self.__vocabulary\r\n\r\n # region Metadata Loading\r\n def _init_component_metadata(self) -> None:\r\n if self.__metadata_token_counter is None:\r\n self.__metadata_token_counter = Counter()\r\n\r\n def _load_metadata_from_sample(self, data_to_load: List[str]) -> None:\r\n self.__metadata_token_counter.update(data_to_load[:self.get_hyperparameter('max_seq_length')])\r\n\r\n def _finalize_component_metadata_and_model(self) -> None:\r\n if self.__metadata_token_counter is None or self.__vocabulary is not None:\r\n return # This module has already been finalized\r\n token_counter = self.__metadata_token_counter\r\n self.__metadata_token_counter = None\r\n\r\n self.__vocabulary = Vocabulary.create_vocabulary(tokens=token_counter,\r\n max_size=self.get_hyperparameter('max_vocabulary_size'),\r\n count_threshold=self.get_hyperparameter('min_word_count_threshold'),\r\n add_pad=True)\r\n self.LOGGER.info('Vocabulary Size of %s is %s', self.name, len(self.__vocabulary))\r\n self.__embedding_layer = nn.Embedding(num_embeddings=len(self.__vocabulary),\r\n embedding_dim=self.get_hyperparameter('embedding_size'),\r\n padding_idx=self.__vocabulary.get_id_or_unk(Vocabulary.get_pad()))\r\n self.__dropout_layer = nn.Dropout(p=self.get_hyperparameter('dropout_rate'))\r\n\r\n # endregion\r\n\r\n TensorizedData = NamedTuple('EmbeddingTensorizedData', [\r\n ('token_ids', np.ndarray),\r\n ('length', int)\r\n ])\r\n\r\n def load_data_from_sample(self, data_to_load: List[str]) -> Optional['TokenSequenceEmbedder.TensorizedData']:\r\n return self.TensorizedData(\r\n token_ids=np.array(self.convert_sequence_to_tensor(data_to_load), dtype=np.int32),\r\n length=min(len(data_to_load), self.get_hyperparameter('max_seq_length'))\r\n )\r\n\r\n def convert_sequence_to_tensor(self, token_sequence: List[str]):\r\n return self.__vocabulary.get_id_or_unk_multiple(\r\n tokens=[Vocabulary.get_pad() if t is None else t for t in token_sequence[:self.get_hyperparameter('max_seq_length')]]\r\n )\r\n\r\n # region Minibatching\r\n def initialize_minibatch(self) -> Dict[str, Any]:\r\n return {'token_sequence_ids': [], 'lengths': []}\r\n\r\n def extend_minibatch_by_sample(self, datapoint: 'TokenSequenceEmbedder.TensorizedData', accumulated_minibatch_data: Dict[str, Any]) -> bool:\r\n accumulated_minibatch_data['token_sequence_ids'].append(datapoint.token_ids)\r\n accumulated_minibatch_data['lengths'].append(datapoint.length)\r\n return True\r\n\r\n def finalize_minibatch(self, accumulated_minibatch_data: Dict[str, Any]) -> Dict[str, Any]:\r\n accumulated_token_ids = accumulated_minibatch_data['token_sequence_ids']\r\n max_size = np.max(accumulated_minibatch_data['lengths'])\r\n\r\n token_ids = np.zeros((len(accumulated_token_ids), max_size), dtype=np.int32)\r\n for i in range(len(accumulated_token_ids)):\r\n token_ids[i, :len(accumulated_token_ids[i])] = accumulated_token_ids[i]\r\n return {\r\n 'token_ids': torch.tensor(token_ids, dtype=torch.int64, device=self.device),\r\n 'lengths': torch.tensor(accumulated_minibatch_data['lengths'], dtype=torch.int64, device=self.device)\r\n }\r\n # endregion\r\n\r\n def _compute_embeddings(self, token_ids: torch.Tensor, lengths: torch.Tensor, add_sequence_related_annotations: bool):\r\n embedded = self.__embedding_layer(token_ids) # B x max_len x D\r\n return self.__dropout_layer(embedded)\r\n" ]
[ [ "numpy.array", "numpy.random.seed" ], [ "numpy.max", "torch.tensor" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
kvenkman/hummingbird
[ "b8ec670b3c90ec7e87d3ae4a2b268075bd5eae65" ]
[ "tests/test_sklearn_linear_converter.py" ]
[ "\"\"\"\nTests sklearn linear classifiers (LinearRegression, LogisticRegression, SGDClassifier, LogisticRegressionCV) converters.\n\"\"\"\nimport unittest\nimport warnings\n\nimport numpy as np\nimport torch\nfrom sklearn.linear_model import LinearRegression, LogisticRegression, SGDClassifier, LogisticRegressionCV\nfrom sklearn import datasets\n\nimport hummingbird.ml\nfrom hummingbird.ml._utils import tvm_installed\nfrom hummingbird.ml import constants\n\n\nclass TestSklearnLinearClassifiers(unittest.TestCase):\n\n # LogisticRegression test function to be parameterized\n def _test_logistic_regression(self, num_classes, solver=\"liblinear\", multi_class=\"auto\", labels_shift=0):\n if num_classes > 2:\n model = LogisticRegression(solver=solver, multi_class=multi_class, fit_intercept=True)\n else:\n model = LogisticRegression(solver=\"liblinear\", fit_intercept=True)\n\n np.random.seed(0)\n X = np.random.rand(100, 200)\n X = np.array(X, dtype=np.float32)\n y = np.random.randint(num_classes, size=100) + labels_shift\n\n model.fit(X, y)\n\n torch_model = hummingbird.ml.convert(model, \"torch\")\n\n self.assertTrue(torch_model is not None)\n np.testing.assert_allclose(model.predict_proba(X), torch_model.predict_proba(X), rtol=1e-6, atol=1e-6)\n\n # LogisticRegression binary\n def test_logistic_regression_bi(self):\n self._test_logistic_regression(2)\n\n # LogisticRegression multiclass with auto\n def test_logistic_regression_multi_auto(self):\n self._test_logistic_regression(3)\n\n # LogisticRegression with class labels shifted\n def test_logistic_regression_shifted_classes(self):\n self._test_logistic_regression(3, labels_shift=2)\n\n # LogisticRegression with multi+ovr\n def test_logistic_regression_multi_ovr(self):\n self._test_logistic_regression(3, multi_class=\"ovr\")\n\n # LogisticRegression with multi+multinomial+sag\n def test_logistic_regression_multi_multin_sag(self):\n warnings.filterwarnings(\"ignore\")\n # this will not converge due to small test size\n self._test_logistic_regression(3, multi_class=\"multinomial\", solver=\"sag\")\n\n # LogisticRegression binary lbfgs\n def test_logistic_regression_bi_lbfgs(self):\n warnings.filterwarnings(\"ignore\")\n # this will not converge due to small test size\n self._test_logistic_regression(2, solver=\"lbfgs\")\n\n # LogisticRegression with multi+lbfgs\n def test_logistic_regression_multi_lbfgs(self):\n warnings.filterwarnings(\"ignore\")\n # this will not converge due to small test size\n self._test_logistic_regression(3, solver=\"lbfgs\")\n\n # LogisticRegression with multi+multinomial+lbfgs\n def test_logistic_regression_multi_multin_lbfgs(self):\n warnings.filterwarnings(\"ignore\")\n # this will not converge due to small test size\n self._test_logistic_regression(3, multi_class=\"multinomial\", solver=\"lbfgs\")\n\n # LogisticRegression with multi+ovr+lbfgs\n def test_logistic_regression_multi_ovr_lbfgs(self):\n warnings.filterwarnings(\"ignore\")\n # this will not converge due to small test size\n self._test_logistic_regression(3, multi_class=\"ovr\", solver=\"lbfgs\")\n\n # LinearRegression test function to be parameterized\n def _test_linear_regression(self, y_input):\n model = LinearRegression()\n\n np.random.seed(0)\n X = np.random.rand(100, 200)\n X = np.array(X, dtype=np.float32)\n y = y_input\n\n model.fit(X, y)\n\n torch_model = hummingbird.ml.convert(model, \"torch\")\n\n self.assertTrue(torch_model is not None)\n np.testing.assert_allclose(model.predict(X), torch_model.predict(X), rtol=1e-6, atol=1e-6)\n\n # LinearRegression with ints\n def test_linear_regression_int(self):\n np.random.seed(0)\n self._test_linear_regression(np.random.randint(2, size=100))\n\n # LinearRegression with floats\n def test_linear_regression_float(self):\n np.random.seed(0)\n self._test_linear_regression(np.random.rand(100))\n\n # LogisticRegressionCV test function to be parameterized\n def _test_logistic_regression_cv(self, num_classes, solver=\"liblinear\", multi_class=\"auto\", labels_shift=0):\n if num_classes > 2:\n model = LogisticRegressionCV(solver=solver, multi_class=multi_class, fit_intercept=True)\n else:\n model = LogisticRegressionCV(solver=\"liblinear\", fit_intercept=True)\n\n np.random.seed(0)\n X = np.random.rand(100, 200)\n X = np.array(X, dtype=np.float32)\n y = np.random.randint(num_classes, size=100) + labels_shift\n\n model.fit(X, y)\n torch_model = hummingbird.ml.convert(model, \"torch\")\n self.assertTrue(torch_model is not None)\n np.testing.assert_allclose(model.predict_proba(X), torch_model.predict_proba(X), rtol=1e-6, atol=1e-6)\n\n # LogisticRegressionCV with 2 classes\n def test_logistic_regression_cv_bi(self):\n self._test_logistic_regression_cv(2)\n\n # LogisticRegressionCV with 3 classes\n def test_logistic_regression_cv_multi(self):\n self._test_logistic_regression_cv(3)\n\n # LogisticRegressionCV with shifted classes\n def test_logistic_regression_cv_shifted_classes(self):\n self._test_logistic_regression_cv(3, labels_shift=2)\n\n # LogisticRegressionCV with multi+ovr\n def test_logistic_regression_cv_multi_ovr(self):\n self._test_logistic_regression_cv(3, multi_class=\"ovr\")\n\n # LogisticRegressionCV with multi+multinomial\n def test_logistic_regression_cv_multi_multin(self):\n warnings.filterwarnings(\"ignore\")\n # this will not converge due to small test size\n self._test_logistic_regression_cv(3, multi_class=\"multinomial\", solver=\"sag\")\n\n # SGDClassifier test function to be parameterized\n def _test_sgd_classifier(self, num_classes):\n\n model = SGDClassifier(loss=\"log\")\n\n np.random.seed(0)\n X = np.random.rand(100, 200)\n X = np.array(X, dtype=np.float32)\n y = np.random.randint(num_classes, size=100)\n\n model.fit(X, y)\n\n torch_model = hummingbird.ml.convert(model, \"torch\")\n self.assertTrue(torch_model is not None)\n np.testing.assert_allclose(model.predict(X), torch_model.predict(X), rtol=1e-6, atol=1e-6)\n\n # SGDClassifier with 2 classes\n def test_sgd_classifier_bi(self):\n self._test_sgd_classifier(2)\n\n # SGDClassifier with 3 classes\n def test_sgd_classifier_multi(self):\n self._test_sgd_classifier(3)\n\n # Failure Cases\n def test_sklearn_linear_model_raises_wrong_type(self):\n warnings.filterwarnings(\"ignore\")\n np.random.seed(0)\n X = np.random.rand(100, 200)\n X = np.array(X, dtype=np.float32)\n y = np.random.randint(3, size=100).astype(np.float32) # y must be int, not float, should error\n model = SGDClassifier().fit(X, y)\n self.assertRaises(RuntimeError, hummingbird.ml.convert, model, \"torch\")\n\n # Float 64 data tests\n def test_float64_linear_regression(self):\n model = LinearRegression()\n\n np.random.seed(0)\n X = np.random.rand(100, 200)\n y = np.random.randint(2, size=100)\n\n model.fit(X, y)\n\n torch_model = hummingbird.ml.convert(model, \"torch\")\n\n self.assertTrue(torch_model is not None)\n np.testing.assert_allclose(model.predict(X), torch_model.predict(X), rtol=1e-6, atol=1e-6)\n\n def test_float64_sgd_classifier(self):\n\n model = SGDClassifier(loss=\"log\")\n\n np.random.seed(0)\n num_classes = 3\n X = np.random.rand(100, 200)\n y = np.random.randint(num_classes, size=100)\n\n model.fit(X, y)\n\n torch_model = hummingbird.ml.convert(model, \"torch\")\n self.assertTrue(torch_model is not None)\n np.testing.assert_allclose(model.predict(X), torch_model.predict(X), rtol=1e-6, atol=1e-6)\n\n # Test Torschscript backend.\n def test_logistic_regression_ts(self):\n\n model = LogisticRegression(solver=\"liblinear\")\n\n data = datasets.load_iris()\n X, y = data.data, data.target\n X = X.astype(np.float32)\n\n model.fit(X, y)\n\n ts_model = hummingbird.ml.convert(model, \"torch.jit\", X)\n self.assertTrue(ts_model is not None)\n np.testing.assert_allclose(model.predict(X), ts_model.predict(X), rtol=1e-6, atol=1e-6)\n np.testing.assert_allclose(model.predict_proba(X), ts_model.predict_proba(X), rtol=1e-6, atol=1e-6)\n\n # Test TVM backends.\n @unittest.skipIf(not (tvm_installed()), reason=\"TVM tests require TVM\")\n def test_sgd_classifier_tvm(self):\n\n model = SGDClassifier(loss=\"log\")\n\n np.random.seed(0)\n num_classes = 3\n X = np.random.rand(100, 200)\n X = np.array(X, dtype=np.float32)\n y = np.random.randint(num_classes, size=100)\n\n model.fit(X, y)\n\n tvm_model = hummingbird.ml.convert(model, \"tvm\", X)\n self.assertTrue(tvm_model is not None)\n np.testing.assert_allclose(model.predict(X), tvm_model.predict(X), rtol=1e-6, atol=1e-6)\n np.testing.assert_allclose(model.predict_proba(X), tvm_model.predict_proba(X), rtol=1e-6, atol=1e-6)\n\n @unittest.skipIf(not (tvm_installed()), reason=\"TVM tests require TVM\")\n def test_lr_tvm(self):\n\n model = LinearRegression()\n\n np.random.seed(0)\n num_classes = 1000\n X = np.random.rand(100, 200)\n X = np.array(X, dtype=np.float32)\n y = np.random.randint(num_classes, size=100)\n\n model.fit(X, y)\n\n tvm_model = hummingbird.ml.convert(model, \"tvm\", X, extra_config={constants.TVM_MAX_FUSE_DEPTH: 30})\n self.assertTrue(tvm_model is not None)\n\n np.testing.assert_allclose(model.predict(X), tvm_model.predict(X), rtol=1e-6, atol=1e-3)\n\n\nif __name__ == \"__main__\":\n unittest.main()\n" ]
[ [ "sklearn.linear_model.LogisticRegression", "numpy.random.seed", "sklearn.linear_model.LogisticRegressionCV", "sklearn.datasets.load_iris", "sklearn.linear_model.LinearRegression", "numpy.random.rand", "numpy.array", "sklearn.linear_model.SGDClassifier", "numpy.random.randint" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
paminco/paminco
[ "2b8da7cc83adde3c72af5150cf6d7294ff6fd29e", "2b8da7cc83adde3c72af5150cf6d7294ff6fd29e" ]
[ "paminco/net/tests/test_cost.py", "paminco/tests/test_base.py" ]
[ "import pytest\nimport numpy as np\n\nfrom itertools import zip_longest\n\nfrom paminco.net import load_sioux\nfrom paminco.net._data_gas import temporary_gas_files\nfrom paminco.net._data_examples import (NET_SIMPLE_POLYNOMIAL,\n NET_ELECTRICAL_PIECEWISE)\nfrom paminco.net.network import Network\nfrom paminco.net.cost import EquidistantInterpolationRule, PiecewiseQuadraticCost, SymbolicCost, SimplePolynomial, BreakpointsInterpolationRule, EdgeCostInterpolation\nfrom paminco.algo.mca import MCAInterpolationRule\n\n\ndef test_costfunc_traffic():\n net = load_sioux()\n fft = net.cost.coefficients[:, 0]\n a = net.cost.coefficients[:, 4]\n coeffs = {\"a\": a, \"fft\": fft}\n F = \"x*fft + a/5 * x**5\"\n f = \"fft + a*x**4\"\n f1 = \"4*a*x**3\"\n f2 = \"12*a*x**2\"\n sc = SymbolicCost(coeffs, F, f, f1, f2, shared=net.shared)\n net.integrate_cost()\n for d in range(4):\n for i in range(5):\n x = np.random.random(net.m) * 100\n polyval = net.cost(x, d=d)\n symval = sc(x, d=d)\n assert np.allclose(polyval, symval)\n for i in range(5):\n x = np.random.random(net.m) * 1000\n polyval = net.cost(x, d=d)\n symval = sc(x, d=d)\n assert np.allclose(polyval, symval)\n for i in range(5):\n x = np.random.random(net.m) * 10000\n polyval = net.cost(x, d=d)\n symval = sc(x, d=d)\n assert np.allclose(polyval, symval)\n\n\ndef test_costfunc_gas():\n # Open Gas40 network\n with temporary_gas_files(\"gas40\") as tmpfiles:\n gas40 = Network.from_gaslib(*tmpfiles)\n F = \"beta * x * abs(x)\"\n f = \"2 * beta * abs(x)\"\n f1 = \"2 * beta * x / abs(x)\"\n f2 = \"0\"\n beta = gas40.cost.coefficients[:, 2]\n sc = SymbolicCost({\"beta\": beta}, F, f, f1, f2, shared=gas40.shared)\n for d in range(4):\n for _ in range(5):\n x = np.random.random(gas40.m) * 100\n polyval = gas40.cost(x, d=d)\n symval = sc(x, d=d)\n assert np.allclose(polyval, symval)\n for _ in range(5):\n x = np.random.random(gas40.m) * 1000\n polyval = gas40.cost(x, d=d)\n symval = sc(x, d=d)\n assert np.allclose(polyval, symval)\n for _ in range(5):\n x = np.random.random(gas40.m) * 10000\n polyval = gas40.cost(x, d=d)\n symval = sc(x, d=d)\n assert np.allclose(polyval, symval)\n\n\[email protected](\"d\", [1, 2, 3])\ndef test_derivation_integration(d):\n net = load_sioux()\n c2 = net.cost.integrate(d=d)\n c3 = c2.differentiate(d=d)\n f = np.random.random(net.m) * 10000\n assert np.allclose(c3(f), net.cost(f))\n assert np.allclose(c3(f, d=1), net.cost(f, d=1))\n \n # TODO-PW: gas networks\n\n\ndef test_polycost_exact():\n \"\"\"\n Tests the SimplePolynomial and PolynomialCost classes against\n precalculated values of the polynomials (1+x)^i, i = 1, ..., 10\n for x = -5, ..., 5\n \"\"\"\n target_vals = np.array([[-4, -3, -2, -1, 0, 1, 2, 3, 4, 5, 6],\n [16, 9, 4, 1, 0, 1, 4, 9, 16, 25, 36],\n [-64, -27, -8, -1, 0, 1, 8, 27, 64, 125, 216],\n [256, 81, 16, 1, 0, 1, 16, 81, 256, 625, 1296],\n [-1024, -243, -32, -1, 0, 1, 32, 243, 1024, 3125, 7776],\n [4096, 729, 64, 1, 0, 1, 64, 729, 4096, 15625, 46656],\n [-16384, -2187, -128, -1, 0, 1, 128, 2187, 16384, 78125, 279936],\n [65536, 6561, 256, 1, 0, 1, 256, 6561, 65536, 390625, 1679616],\n [-262144, -19683, -512, -1, 0, 1, 512, 19683, 262144, 1953125, 10077696],\n [1048576, 59049, 1024, 1, 0, 1, 1024, 59049, 1048576, 9765625, 60466176]]).T\n\n coeff_raw_data = [[1, 1],\n [1, 2, 1],\n [1, 3, 3, 1],\n [1, 4, 6, 4, 1],\n [1, 5, 10, 10, 5, 1],\n [1, 6, 15, 20, 15, 6, 1],\n [1, 7, 21, 35, 35, 21, 7, 1],\n [1, 8, 28, 56, 70, 56, 28, 8, 1],\n [1, 9, 36, 84, 126, 126, 84, 36, 9, 1],\n [1, 10, 45, 120, 210, 252, 210, 120, 45, 10, 1]]\n\n coefficients = np.array(list(zip_longest(*coeff_raw_data, fillvalue=0))).T\n signed = [False for _ in range(len(coefficients))]\n\n m = len(coefficients)\n m_edges = [[str(e), str(e + 1)] for e in range(m)]\n\n dummy_net = Network(m_edges, cost_data=(coefficients, signed))\n polynomials = [SimplePolynomial(coefficients[i], signed[i]) for i in range(len(coefficients))]\n\n for i, x in enumerate(range(-5, 6)):\n poly_result = np.array([p(x) for p in polynomials])\n assert np.array_equal(poly_result, dummy_net.cost(x))\n assert np.array_equal(poly_result, target_vals[i])\n\n\ndef test_signed_polycost():\n \"\"\"Test signed polycost/simple polynomials against precalculated values.\"\"\"\n target_vals = np.array([[335, 169, 71, 23, 7, 5, 11, 39, 107, 233, 435],\n [315, 156, 63, 18, 3, 0, 9, 42, 117, 252, 465],\n [-315, -156, -63, -18, -3, 0, 9, 42, 117, 252, 465]]).T\n\n coefficients = np.array([[5, 1, 2, 3], [0, 3, 3, 3], [0, 3, 3, 3]])\n signed = [True, True, False]\n\n m = len(coefficients)\n m_edges = [[str(e), str(e + 1)] for e in range(m)]\n\n dummy_net = Network(m_edges, cost_data=(coefficients, signed))\n polynomials = [SimplePolynomial(coefficients[i], signed[i]) for i in range(len(coefficients))]\n\n for i, x in enumerate(range(-5, 6)):\n poly_result = np.array([p(x) for p in polynomials])\n assert np.array_equal(poly_result, dummy_net.cost(x))\n assert np.array_equal(poly_result, target_vals[i])\n\n\ndef numerical_function_compare(f1, f2, a, b, k, exact=False, x_shape=None):\n \"\"\"Compare two functions f1 and f2 by checking values numerically.\n \n Inserts ``k`` values between ``a`` and ``b`` (including both) into the\n functions ``f1`` and ``f2``.\n If ``exact`` is set to True, the values must match exacly, otherwise\n numpy.isclose is used. If ``x_shape`` is set to something else than\n None, instead of a real value x from [a, b] a numpy array of shape\n ``x_shape`` with constant value x is inserted into f1 and f2.\n \"\"\"\n step = (b - a) / (k - 1)\n xs = np.arange(a, b + step, step)\n for x in xs:\n if x_shape is not None:\n x = np.full(x_shape, x)\n if exact:\n if not np.array_equal(f1(x), f2(x)):\n return False\n else:\n if not np.allclose(f1(x), f2(x)):\n return False\n else:\n if exact:\n if not f1(x) == f2(x):\n return False\n else:\n if not np.isclose(f1(x), f2(x)):\n return False\n return True\n\n\ndef test_piecewise_quadratic_cost():\n net = Network.from_xml(NET_ELECTRICAL_PIECEWISE)\n\n F = [lambda x: 0.5 * x * x if x < 3 else 2.5 * x * x - 12 * x + 18,\n lambda x: 0.5 * x * x if x < 2 else 1.5 * x * x - 4 * x + 4,\n lambda x: 0.5 * x * x if x < 1 else 2 * x * x - 3 * x + 1.5]\n\n f = [lambda x: x if x < 3 else 5 * x - 12,\n lambda x: x if x < 2 else 3 * x - 4,\n lambda x: x if x < 1 else 4 * x - 3]\n\n def target_cost(x): return np.array([F[i](x[i]) for i in range(net.m)])\n def target_der(x): return np.array([f[i](x[i]) for i in range(net.m)])\n\n for i in range(net.m):\n assert numerical_function_compare(F[i], net.cost[i], 0, 10, 1000)\n def der(x): return net.cost[i](x, d=1)\n assert numerical_function_compare(f[i], der, 0, 10, 1000)\n\n assert numerical_function_compare(target_cost, net.cost, 0, 10, 1000, x_shape=net.m)\n def der(x): return net.cost(x, d=1)\n assert numerical_function_compare(target_der, der, 0, 10, 1000, x_shape=net.m)\n\n\[email protected](\n \"coefficients, smoothness\",\n [\n (\n np.array([[-np.inf, -np.inf, np.inf, np.inf],\n [4, 3, 1, 0],\n [2, 7, -1, 1],\n [np.inf, np.inf, np.inf, 42]]),\n [True, True, False]\n ),\n (\n np.array([[4, 3, 1, 0],\n [2, 7, -1, 1]]),\n [True, True, False]\n ),\n (\n np.array([[4, 3, 1, 0],\n [2, 7, -1, 1],\n [3, 1, 7, 2]]),\n [True, False, False]\n ),\n (\n np.array([[4, 3, 1, 0],\n [2, 7, -1, 1],\n [3, 1, 42, 2]]),\n [False, False, False]\n ),\n (\n np.array([[-np.inf, -np.inf, np.inf, -np.inf],\n [2, 2, 2, -1],\n [2, 2, 2, 1],\n [np.inf, np.inf, np.inf, 8]]),\n [True, True, True]\n )\n ]\n)\ndef test_piecewise_quadratic_single_edge_smoothness(coefficients, smoothness, margin=0):\n ei = np.full(len(coefficients), 0)\n pwq = PiecewiseQuadraticCost((coefficients, ei))\n for k, s in enumerate(smoothness):\n assert pwq.is_smooth(k=k, margin=margin) == s\n\n\ndef test_breakpoints_interpolation():\n net = Network.from_xml(NET_SIMPLE_POLYNOMIAL)\n\n x_max = 5000\n bps = np.unique(np.random.randint(-x_max + 1, x_max, 100))\n\n bp_targets = []\n\n # Create target breakpoints for all edges\n # By selecting the appropriate breakpoints from bp\n # and adding possible artificial breakpoints\n for e in range(net.m):\n l, u = net.edges.lb[e], net.edges.ub[e]\n pre = np.array([-np.inf, max(l, -x_max)])\n selected_bps = bps[(bps > l) & (bps < u)]\n post = np.array([]) if u == np.inf else np.array([u])\n bp_targets.append(np.concatenate([pre, selected_bps, post]))\n \n irule = BreakpointsInterpolationRule(bps)\n pwqc = net.cost.interpolate(irule, x_max=x_max)\n\n # Get the breakpoints from the interpolated cost\n df = pwqc._ec.to_df()\n for i in range(len(bp_targets)):\n bp = np.array((df[df[\"edge\"] == i][\"tau\"]))\n assert len(bp) == len(bp_targets[i])\n assert np.array_equal(bp, np.array(bp_targets[i]))\n\n\ndef test_equidistant_interpolation():\n net = Network.from_xml(NET_SIMPLE_POLYNOMIAL)\n\n x_max = 5000\n delta = 10\n\n irule = EquidistantInterpolationRule(delta)\n pwqc = net.cost.interpolate(irule, x_max=x_max)\n df = pwqc._ec.to_df()\n\n # Check breakpoints by testing if they equal arange\n for i in range(net.m):\n bp = np.array((df[df[\"edge\"] == i][\"tau\"]))\n lo, up = net.edges.lb[i], net.edges.ub[i]\n lo = max(lo, -x_max)\n up = min(up, x_max)\n tbp = np.arange(lo, up + 1, delta)\n tbp = np.concatenate([np.array([-np.inf]), tbp])\n assert np.array_equal(bp, tbp)\n\n\ndef test_mca_interpolation_rule():\n net = Network.from_xml(NET_SIMPLE_POLYNOMIAL)\n\n bp_targets = [[-np.inf, 0, 2, 8, 26, 80, 242, 728, 2186, 6560, 19682,\n 59048, 177146, 531440, 1594322, 4782968, 14348906],\n [-np.inf, 0, 2, 6.47213578e+00,\n 1.95700045e+01, 5.87610787e+01, 1.76300253e+02, 5.28906430e+02,\n 1.58672118e+03, 4.76016418e+03, 1.42804927e+04, 4.28414783e+04,\n 1.28524435e+05, 3.85573305e+05, 1.15671991e+06, 3.47015974e+06,\n 1.04104792e+07, 3.12314377e+07],\n [-np.inf, -1.43489060e+07, -4.78296867e+06, -1.59432289e+06,\n -5.31440963e+05, -1.77146988e+05, -5.90489959e+04, -1.96829986e+04,\n -6.56099949e+03, -2.18699968e+03, -7.28999435e+02, -2.42998440e+02,\n -8.09953646e+01, -2.69861071e+01, -8.95827470e+00, -2.87339972e+00,\n -5.70660096e-01, 0.00000000e+00, 2.00000000e+00, 6.47213578e+00,\n 1.95700045e+01, 5.87610787e+01, 1.76300253e+02, 5.28906430e+02,\n 1.58672118e+03, 4.76016418e+03, 1.42804927e+04, 4.28414783e+04,\n 1.28524435e+05, 3.85573305e+05, 1.15671991e+06, 3.47015974e+06,\n 1.04104792e+07, 3.12314377e+07],\n [-np.inf, -1000, -3.33332333e+02, -1.11107778e+02,\n -3.70269251e+01, -1.23152862e+01, -4.02349000e+00, -1.07989912e+00,\n 0.00000000e+00, 2.00000000e+00, 6.47213578e+00, 1.95700045e+01,\n 5.87610787e+01, 1.76300253e+02, 5.28906430e+02, 1.58672118e+03,\n 4.76016418e+03, 1.42804927e+04, 4.28414783e+04, 1.28524435e+05,\n 3.85573305e+05, 1.15671991e+06, 3.47015974e+06, 1.04104792e+07,\n 3.12314377e+07],\n [-np.inf, -1.43489060e+07, -4.78296867e+06, -1.59432289e+06,\n -5.31440963e+05, -1.77146988e+05, -5.90489959e+04, -1.96829986e+04,\n -6.56099949e+03, -2.18699968e+03, -7.28999435e+02, -2.42998440e+02,\n -8.09953646e+01, -2.69861071e+01, -8.95827470e+00, -2.87339972e+00,\n -5.70660096e-01, 0.00000000e+00, 2.00000000e+00, 6.47213578e+00,\n 1.95700045e+01, 5.87610787e+01, 1.76300253e+02, 5.28906430e+02,\n 1000],\n [-np.inf, -1000, -3.33332333e+02, -1.11107778e+02,\n -3.70269251e+01, -1.23152862e+01, -4.02349000e+00, -1.07989912e+00,\n 0.00000000e+00, 2.00000000e+00, 6.47213578e+00,\n 1.95700045e+01, 5.87610787e+01, 1.76300253e+02, 5.28906430e+02,\n 1000]]\n exact = [0]\n\n x_max = 14348906\n\n rule = MCAInterpolationRule(2, 3 * net.m * x_max, net.m, x_max)\n pwqc = net.cost.interpolate(rule)\n # Get the breakpoints from the interpolated cost\n df = pwqc._ec.to_df()\n for i in range(len(bp_targets)):\n bp = np.array((df[df[\"edge\"] == i][\"tau\"]))\n assert len(bp) == len(bp_targets[i])\n if i in exact:\n assert np.array_equal(bp, np.array(bp_targets[i]))\n else:\n assert np.allclose(bp, np.array(bp_targets[i]))\n\n\[email protected](\"rng\", [42, 4242, 424242, 0, 123])\ndef test_edge_interpolation(rng):\n \"\"\"Test the computation of the computation of piecewise quadratic pieces.\n \n Creates random polynomials and interpolates them with equidistant steps.\n Checks consistency by testing that\n a) the derivative of the cost function coincides with the linear interpolation\n 2 * a * x + b at the breakpoints\n b) the linear interpolation is continuous\n\n Does not check the actual function but only the interpolation of\n the derivative. In particuar no test of the offsets.\n \"\"\"\n rng = np.random.default_rng(rng)\n degree = rng.integers(3, 6)\n coeffs = rng.integers(-10, 10, degree + 1)\n ec = SimplePolynomial(coeffs)\n step = 10\n irule = EquidistantInterpolationRule(step)\n eci = EdgeCostInterpolation(0, ec, irule, 1000 + step, 0, 1000 + step)\n coeff = eci.interpolate()\n a = 2 * coeff[1:-1, 0]\n b = coeff[1:-1, 1]\n tau = coeff[1:-1, 3]\n for i, t in enumerate(tau):\n assert ec.ddx(t) == a[i] * t + b[i]\n if i > 0:\n assert a[i] * t + b[i] == a[i - 1] * t + b[i - 1]\n", "import tempfile\n\nimport pytest\nimport numpy as np\n\nfrom paminco import load_sioux, Network\nfrom paminco._base import ParametricSolution\nfrom paminco.algo.mca import MCA\n\n\ndef sioux():\n sioux = load_sioux()\n sioux.set_demand((\"20\", \"3\", 100000))\n sioux.cost.integrate(inplace=True)\n mca_ue = MCA(sioux)\n mca_ue.run()\n return mca_ue.param_solution\n\n\ndef simple_electrical():\n edge_data = np.array([[ \"s\", \"v1\"],\n [ \"s\", \"v2\"],\n [\"v1\", \"v2\"],\n [\"v1\", \"t\"],\n [\"v2\", \"t\"]])\n poly_cost = np.array([[0, 0, 1], # F_0(x) = 0 * x^0 + 0 * x^1 + 1 * x^2\n [0, 3, 0.5], # F_0(x) = 0 * x^0 + 3 * x^1 + 0.5 * x^2\n [0, 0, 0.5],\n [0, 3, 0.5],\n [0, 0, 1]])\n demand_data = ((\"s\", \"t\", 1))\n d = {\"s\": 0, \"v1\": 1, \"v2\": 2, \"t\": 3} # determines how labels are mapped to indices\n net = Network(edge_data,\n cost_data=poly_cost,\n demand_data=demand_data,\n kw_edge={\"map_labels_to_indices\": d})\n \n mca = MCA(net, lambda_max=8)\n mca.run()\n return mca.param_solution\n\n\ndef compare_param_sols(sol1, sol2):\n def equal(arr1, arr2, exact: bool = True):\n if exact is True:\n comp_func = np.array_equal\n else:\n comp_func = np.allclose\n \n if arr1 is None and arr2 is None:\n return True\n if (isinstance(arr1, np.ndarray)\n and isinstance(arr2, np.ndarray)\n and comp_func(arr1, arr2)):\n return True\n return False\n \n assert len(sol1) == len(sol2)\n \n idx = np.random.randint(low=0, high=len(sol1), size=30)\n for i in idx:\n assert sol1[i].param == sol2[i].param, f\"Param not equal: {sol1[i].param} != {sol2[i].param}\"\n assert equal(sol1[i].flow, sol2[i].flow, False), f\"Flow not equal: {sol1[i].flow} != {sol2[i].flow}\"\n assert equal(sol1[i].potential, sol2[i].potential, False), f\"Potential not equal: {sol1[i].potential} != {sol2[i].potential}\"\n assert sol1[i].cost == sol2[i].cost, f\"Cost not equal: {sol1[i].cost} != {sol2[i].cost}\"\n \n assert equal(sol1.dflow, sol2.dflow, exact=False)\n assert equal(sol1.dpi, sol2.dpi, exact=False)\n\n\[email protected](\"sol1\", [sioux(), simple_electrical()])\ndef test_csv(sol1):\n f = tempfile.mkstemp(suffix=\".csv\")[1]\n sol1.to_csv(f)\n sol2 = ParametricSolution.from_csv(f)\n compare_param_sols(sol1, sol2)\n\n\[email protected](\"sol1\", [sioux(), simple_electrical()])\ndef test_npz(sol1):\n f = tempfile.mkstemp(suffix=\".npz\")[1]\n sol1.save_to_numpy(f)\n sol2 = ParametricSolution.from_npz(f)\n compare_param_sols(sol1, sol2)\n" ]
[ [ "numpy.random.random", "numpy.allclose", "numpy.array_equal", "numpy.arange", "numpy.full", "numpy.concatenate", "numpy.array", "numpy.random.default_rng", "numpy.random.randint" ], [ "numpy.array" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
duboviy/misc
[ "4cd8cbcf12fc29dd2f12699fbd2f3dd738b5e4b5", "4cd8cbcf12fc29dd2f12699fbd2f3dd738b5e4b5" ]
[ "hist.py", "quantum.py" ]
[ "\"\"\" Horizontal histogram plotting function. \"\"\"\n\nfrom __future__ import absolute_import\nimport matplotlib.pyplot as plt\nimport numpy as np\n\n\ndef horizontal_hist(items, title=None, axis_label=None, color=None, height=10, width=20, reverse=False):\n \"\"\"\n Plots a histogram of values and frequencies.\n\n Arguments:\n items (iterable[any]) => Example, [1, 2, 3, 1, 2]\n title (Optional[str]) => Example, \"Resulting histogram\".\n axis_label (Optional[str]) => Example, \"y-axis\".\n color (Optional[str]) => Default: matplotlib's default plot color, a royal blue\n height (Optional[int]) => Default: 10\n width (Optional[int]) => Default: 20\n reverse (Optional[bool]) => From top to bottom in order of decreasing frequency or not.\n\n Returns:\n None, however a matplotlib figure should be produced.\n \"\"\"\n\n unique_items, item_counts = np.unique(items, return_counts=True)\n item_counts, unique_items = zip(*sorted(zip(item_counts, unique_items), reverse=reverse))\n\n pos = np.arange(len(unique_items)) + 0.5\n plt.figure(figsize=(width, height))\n plt.barh(pos, item_counts, align='center', color=color)\n plt.yticks(pos, unique_items)\n plt.xlabel('Frequency')\n plt.ylabel(axis_label) if axis_label else None\n plt.title(title) if title else None\n\n plt.show()\n\n\nif __name__ == '__main__':\n items = range(1, 10) * 100 + range(11, 20) * 50 + range(21, 30) * 25\n horizontal_hist(items, title=\"Resulting histogram\")\n", "\"\"\"Simple quantum computations simulation.\"\"\"\n\nimport numpy as np\n\n\ndef I():\n \"\"\"Identity operator.\"\"\"\n return np.identity(2)\n\ndef X():\n \"\"\"X-rotation, negation operator.\"\"\"\n return np.identity(2)[..., ::-1]\n\ndef H():\n \"\"\"Adamara operator, superposition.\"\"\"\n return np.array([[1, 1], [1, -1]]) / np.sqrt(2)\n\ndef SWAP():\n \"\"\"Swap 2 qubits\"\"\"\n m = np.identity(4)\n m[[1, 2]] = m[[2, 1]]\n return m\n\ndef CX():\n \"\"\"Controlled negation.\"\"\"\n m = np.identity(4)\n m[[3, 2]] = m[[2, 3]]\n return m\n\n\ndef apply(v, *gates):\n m = gates[0]\n gates = gates[1:]\n for gate in gates:\n m = np.kron(gate, m)\n return m.dot(v)\n\ndef observe(v):\n v2 = np.absolute(v) ** 2\n c = np.random.choice(v.size, 1, p=v2)\n return c[0]\n\n\n# Usage example\n# create 3 qubits in state 000, array size 2 ^ n\na = np.array([1, 0, 0, 0, 0, 0, 0, 0])\n\n# transform the 2nd qubit into a superposition of 0 and 1\na = apply(a, I(), H(), I())\n\n# entangle the 1st and 2nd qubit\na = apply(a, CX(), I())\n\n# swap the 2nd and 3rd qubit\na = apply(a, I(), SWAP())\n\n# observe the state\nobserve(a)\n" ]
[ [ "matplotlib.pyplot.title", "numpy.unique", "matplotlib.pyplot.barh", "matplotlib.pyplot.ylabel", "matplotlib.pyplot.xlabel", "matplotlib.pyplot.yticks", "matplotlib.pyplot.show", "matplotlib.pyplot.figure" ], [ "numpy.absolute", "numpy.sqrt", "numpy.random.choice", "numpy.kron", "numpy.identity", "numpy.array" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
takaratruong/emergent-generalization
[ "20de15ee6514dba48b48c76d8cd9289d62966932", "20de15ee6514dba48b48c76d8cd9289d62966932" ]
[ "code/train.py", "code/emergence.py" ]
[ "\"\"\"\nTrain an RNN decoder to make binary predictions;\nthen train an RNN language model to generate sequences\n\"\"\"\n\n\nimport contextlib\nfrom collections import defaultdict\n\nimport numpy as np\nimport torch\nimport torch.nn as nn\nimport torch.optim as optim\n\nimport models\nimport util\nimport data\nimport os\nimport vis\nimport emergence\n\nimport pandas as pd\nimport io_util\n\n# Logging\nimport logging\n\nlogging.basicConfig(\n format=\"%(asctime)s %(levelname)-8s %(message)s\",\n level=logging.INFO,\n datefmt=\"%Y-%m-%d %H:%M:%S\",\n)\n\n\ndef convert_lang_to_numeric(lang, lang_length, pad_val=-1, skip_sos_eos=True):\n \"\"\"\n Convert lang to numeric, with custom padding, for later language analysis\n \"\"\"\n lang_i = lang.argmax(2)\n for i, length in enumerate(lang_length):\n\n if skip_sos_eos:\n # zero out EOS\n lang_i[i, length - 1 :] = pad_val\n else:\n lang_i[i, length:] = pad_val\n\n # shave off SOS, ending EOS if present\n if skip_sos_eos:\n lang_i = lang_i[:, 1:-1]\n\n return lang_i\n\n\ndef get_true_lang(batch, dataset, args, join=True):\n spk_inp, spk_y, lis_inp, lis_y, true_lang, md, idx = batch\n true_lang_text = dataset.to_text(true_lang, join=join)\n return true_lang_text\n\n\ndef get_positive_examples(inp, y):\n \"\"\"\n inp -> batch_size x n_examples x feat_size\n y -> batch_size x y\n\n output\n \"\"\"\n where_zero = np.where(y.sum(1) == 0)[0]\n y[where_zero] = 1\n occur_rows, occur_cols = np.where(y)\n row_indices, occur_col_indices = np.unique(occur_rows, return_index=True)\n assert (row_indices == np.arange(len(row_indices))).all()\n assert len(occur_col_indices) == len(y)\n col_indices = occur_cols[occur_col_indices]\n sel = inp[row_indices, col_indices]\n return sel\n\n\ndef subsample(items, idx):\n return [items[i] for i in idx]\n\n\ndef compute_lang_metrics(\n all_lang,\n dataset,\n args,\n attrs=None,\n reprs=None,\n attrs_numeric=None,\n toks=None,\n max_analysis_length=1000,\n):\n lang_metrics = {}\n if all_lang.shape[0] > max_analysis_length:\n idx = np.random.choice(\n all_lang.shape[0], size=max_analysis_length, replace=False\n )\n\n all_lang = all_lang.iloc[idx].reset_index()\n\n if attrs is not None:\n attrs = subsample(attrs, idx)\n if toks is not None:\n toks = subsample(toks, idx)\n if reprs is not None:\n reprs = subsample(reprs, idx)\n\n # topographic similarity between ground truth language and tokens\n # only do it if the ground truth language is meaningful\n if dataset.name == \"shapeworld\":\n langts = emergence.topsim(\n all_lang[\"true_lang\"], toks, meaning_distance_fn=\"edit\"\n )\n lang_metrics[\"langts\"] = langts\n\n if dataset.name == \"shapeworld\":\n\n def compute_hd(tl1, tl2):\n # Remove SOS, EOS\n tl1 = \" \".join(tl1[1:-1])\n tl2 = \" \".join(tl2[1:-1])\n return dataset.concept_distance(tl1, tl2)\n\n elif dataset.name == \"cub\":\n\n def compute_hd(tl1, tl2):\n tl1 = int(tl1[1])\n tl2 = int(tl2[1])\n return dataset.concept_distance(tl1, tl2)\n\n if dataset.concept_distances is not None:\n hd = emergence.topsim(\n all_lang[\"true_lang\"], toks, meaning_distance_fn=compute_hd\n )\n lang_metrics[\"hausdorff\"] = hd\n\n if attrs is not None:\n # topographic similarity between meanings and tokens\n ts = emergence.topsim(\n attrs, toks, meaning_distance_fn=dataset.meaning_distance_fn\n )\n lang_metrics[\"ts\"] = ts\n\n # topographic similarity between reprs and attributes\n # For random sets later, worth disentangling prototype repr from\n # individual inputs repr\n reprts = emergence.topsim(\n attrs,\n reprs,\n meaning_distance_fn=dataset.meaning_distance_fn,\n message_distance_fn=\"euclidean\",\n )\n lang_metrics[\"reprts\"] = reprts\n\n return lang_metrics\n\n\ndef compute_metrics_by_md(all_lang, md_vocab=None):\n metrics_by_md = {}\n per_md_acc = all_lang[[\"md\", \"acc\"]].groupby(\"md\").mean()\n for i, md_row in per_md_acc.iterrows():\n if md_vocab is None:\n md_name = str(md_row.name)\n else:\n md_name = md_vocab[\"i2w\"][md_row.name]\n md_key = f\"acc_md_{md_name}\"\n metrics_by_md[md_key] = md_row[\"acc\"]\n return metrics_by_md\n\n\ndef log_epoch_summary(epoch, split, metrics):\n logging.info(\n \"Epoch {}\\t{} {}\".format(\n epoch,\n split.upper(),\n \" \".join(\"{}: {:.4f}\".format(m, v) for m, v in metrics.items()),\n )\n )\n\n\ndef log_epoch_progress(epoch, batch_i, batch_size, dataloader, stats):\n meter_str = \" \".join(f\"{k}: {v.avg:.3f}\" for k, v in stats.meters.items())\n data_i = batch_i * batch_size\n data_total = len(dataloader.dataset)\n pct = round(100 * batch_i / len(dataloader))\n logging.info(f\"Epoch {epoch} [{data_i}/{data_total} ({pct}%)] {meter_str}\")\n\n\ndef init_metrics():\n \"\"\"\n Initialize the metrics for this training run. This is a defaultdict, so\n metrics not specified here can just be appended to/assigned to during\n training.\n Returns\n -------\n metrics : `collections.defaultdict`\n All training metrics\n \"\"\"\n metrics = {}\n metrics[\"best_acc\"] = 0.0\n metrics[\"best_val_acc\"] = 0.0\n metrics[\"best_val_same_acc\"] = 0.0\n metrics[\"best_loss\"] = float(\"inf\")\n metrics[\"best_epoch\"] = 0\n return metrics\n\n\ndef run(\n split,\n epoch,\n pair,\n optimizer,\n dataloaders,\n args,\n random_state=None,\n force_no_train=False,\n):\n \"\"\"\n Run the model for a single epoch.\n\n Parameters\n ----------\n split : ``str``\n The dataloader split to use. Also determines model behavior if e.g.\n ``split == 'train'`` then model will be in train mode/optimizer will be\n run.\n epoch : ``int``\n current epoch\n model : ``torch.nn.Module``\n the model you are training/evaling\n optimizer : ``torch.nn.optim.Optimizer``\n the optimizer\n criterion : ``torch.nn.loss``\n the loss function\n dataloaders : ``dict[str, torch.utils.data.DataLoader]``\n Dictionary of dataloaders whose keys are the names of the ``split``s\n and whose values are the corresponding dataloaders\n args : ``argparse.Namespace``\n Arguments for this experiment run\n random_state : ``np.random.RandomState``\n The numpy random state in case anything stochastic happens during the\n run\n\n Returns\n -------\n metrics : ``dict[str, float]``\n Metrics from this run; keys are statistics and values are their average\n values across the batches\n \"\"\"\n training = (split == \"train\") and not force_no_train\n dataloader = dataloaders[split]\n torch.set_grad_enabled(training)\n pair.train(mode=training)\n\n stats = util.Statistics()\n\n all_lang = []\n all_toks = [] # language, unjoined text form, ragged\n # FIXME - make this one class\n if dataloader.dataset.name == \"cub\":\n all_attrs = []\n all_reprs = [] # representations\n else:\n all_attrs = None\n all_reprs = None\n\n if training:\n optimizer.zero_grad()\n this_epoch_eps = max(0.0, args.eps - (epoch * args.eps_anneal))\n this_epoch_uniform_weight = max(\n 0.0, args.uniform_weight - (epoch * args.uniform_weight_anneal)\n )\n this_epoch_softmax_temp = max(\n 1.0, args.softmax_temp - (epoch * args.softmax_temp_anneal)\n )\n else:\n this_epoch_eps = 0.0\n this_epoch_uniform_weight = 0.0\n this_epoch_softmax_temp = 1.0\n\n for batch_i, batch in enumerate(dataloader):\n spk_inp, spk_y, lis_inp, lis_y, true_lang, md, idx = batch\n batch_size = spk_inp.shape[0]\n\n # Determine what's input\n if dataloader.dataset.name == \"shapeworld\":\n spk_inp = spk_inp.float() / 255\n lis_inp = lis_inp.float() / 255\n else:\n spk_inp = spk_inp.float()\n lis_inp = lis_inp.float()\n\n spk_y = spk_y.float()\n lis_y = lis_y.float()\n\n if args.cuda:\n spk_inp = spk_inp.cuda()\n spk_y = spk_y.cuda()\n lis_inp = lis_inp.cuda()\n lis_y = lis_y.cuda()\n\n if args.listener_only:\n lis_scores = pair.listener(lis_inp, None)\n elif args.copy_listener:\n speaker_emb = pair.speaker(spk_inp, spk_y)\n lis_scores = pair.listener(lis_inp, speaker_emb)\n else:\n (lang, lang_length), states = pair.speaker(\n spk_inp,\n spk_y,\n max_len=args.max_lang_length,\n eps=this_epoch_eps,\n softmax_temp=this_epoch_softmax_temp,\n uniform_weight=this_epoch_uniform_weight,\n )\n lis_scores = pair.listener(lis_inp, lang, lang_length)\n\n # Evaluate loss and accuracy\n if args.reference_game_xent:\n # Take only 0th listener score + after midpoint. Then do cross\n # entropy\n assert lis_scores.shape[1] % 2 == 0\n midp = lis_scores.shape[1] // 2\n lis_scores_xent = torch.cat((lis_scores[:, :1], lis_scores[:, midp:]), 1)\n zeros = torch.zeros(batch_size, dtype=torch.int64, device=lis_scores.device)\n this_loss = pair.xent_criterion(lis_scores_xent, zeros)\n lis_pred = lis_scores_xent.argmax(1)\n per_game_acc = (lis_pred == 0).float().cpu().numpy()\n this_acc = per_game_acc.mean()\n else:\n this_loss = pair.bce_criterion(lis_scores, lis_y)\n lis_pred = (lis_scores > 0).float()\n per_game_acc = (lis_pred == lis_y).float().mean(1).cpu().numpy()\n this_acc = per_game_acc.mean()\n\n # Save language\n if args.use_lang:\n lang_i = lang.argmax(2)\n lang_text_unjoined = util.to_emergent_text(lang_i)\n lang_text = [\" \".join(toks) for toks in lang_text_unjoined]\n else:\n lang_text_unjoined = [[\"N/A\"] for _ in range(batch_size)]\n lang_text = [\"N/A\" for _ in range(batch_size)]\n true_lang_text = get_true_lang(batch, dataloader.dataset, args, join=False)\n true_lang_text_joined = [\" \".join(t) for t in true_lang_text]\n\n # Game difficulty/other metadata indicator\n all_lang.extend(zip(lang_text, true_lang_text, per_game_acc, md.numpy()))\n\n # Get attributes\n all_toks.extend(lang_text_unjoined)\n if dataloader.dataset.name == \"cub\":\n attrs = md.numpy()[:, 1:]\n all_attrs.extend(attrs)\n all_reprs.extend(states.detach().cpu().numpy())\n\n if args.joint_training:\n # Also train speaker on classification task\n spk_scores = pair.speaker.classify_from_states(states, lis_inp)\n spk_loss = pair.bce_criterion(spk_scores, lis_y)\n spk_pred = (spk_scores > 0).float()\n spk_per_game_acc = (spk_pred == lis_y).float().mean(1).cpu().numpy()\n spk_acc = spk_per_game_acc.mean()\n stats.update(spk_loss=spk_loss, spk_acc=spk_acc)\n comb_loss = this_loss + args.joint_training_lambda * spk_loss\n else:\n comb_loss = this_loss\n\n if training:\n comb_loss.backward()\n\n if (batch_i + 1) % args.accum_steps == 0:\n torch.nn.utils.clip_grad_norm_(pair.parameters(), args.clip)\n optimizer.step()\n optimizer.zero_grad()\n backpropped = True\n else:\n backpropped = False\n\n if batch_i % args.log_interval == 0:\n log_epoch_progress(epoch, batch_i, batch_size, dataloader, stats)\n\n stats.update(\n loss=this_loss, acc=this_acc, batch_size=batch_size, combined_loss=comb_loss\n )\n\n if training and not backpropped:\n torch.nn.utils.clip_grad_norm_(pair.parameters(), args.clip)\n optimizer.step()\n optimizer.zero_grad()\n\n # Compute metrics + collect generation language\n metrics = stats.averages()\n all_lang = pd.DataFrame.from_records(\n all_lang,\n columns=[\"lang\", \"true_lang\", \"acc\", \"md\"],\n )\n\n if args.use_lang:\n # Compute emergent communication statistics\n # TODO - this should generally be a \"meaning preprocess\" function\n if dataloader.dataset.name == \"cub\":\n attrs_numeric = dataloader.dataset.attr_to_numeric(all_attrs)\n else:\n attrs_numeric = None\n\n lang_metrics = compute_lang_metrics(\n all_lang,\n dataloader.dataset,\n args,\n attrs=all_attrs,\n reprs=all_reprs,\n attrs_numeric=attrs_numeric,\n toks=all_toks,\n )\n metrics.update(lang_metrics)\n\n if dataloader.dataset.name == \"shapeworld\":\n by_md_metrics = compute_metrics_by_md(\n all_lang, md_vocab=dataloader.dataset.metadata_vocab\n )\n metrics.update(by_md_metrics)\n\n log_epoch_summary(epoch, split, metrics)\n\n if args.vis:\n vis.report(\n spk_inp.cpu(),\n spk_y.cpu(),\n lis_inp.cpu(),\n lis_y.cpu(),\n dataloader.dataset,\n epoch,\n split,\n {\"speaker\": lang_text},\n true_lang_text_joined,\n {\"speaker\": lis_pred},\n exp_dir=os.path.join(\"exp\", args.name),\n )\n\n clean_language(all_lang)\n return metrics, all_lang\n\n\ndef clean_language(all_lang_df):\n def clean_lang(lang):\n # Startswith/endswith\n if lang.startswith(\"<s>\"):\n lang = lang[3:]\n if lang.endswith(\"</s>\"):\n lang = lang[:-4]\n return lang\n\n def clean_true_lang(true_lang):\n return \" \".join(true_lang[1:-1])\n\n all_lang_df[\"lang\"] = all_lang_df[\"lang\"].apply(clean_lang)\n all_lang_df[\"true_lang\"] = all_lang_df[\"true_lang\"].apply(clean_true_lang)\n\n\nif __name__ == \"__main__\":\n args = io_util.parse_args()\n\n exp_dir = os.path.join(\"exp\", args.name)\n os.makedirs(exp_dir, exist_ok=True)\n util.save_args(args, exp_dir)\n\n dataloaders = data.loader.load_dataloaders(args)\n model_config = models.builder.build_models(dataloaders, args)\n this_game_type = data.util.get_game_type(args)\n\n run_args = (model_config[\"pair\"], model_config[\"optimizer\"], dataloaders, args)\n\n all_metrics = []\n metrics = init_metrics()\n for epoch in range(args.epochs):\n # No reset on epoch 0, but reset after epoch 2, epoch 4, etc\n if (\n args.listener_reset_interval > 0\n and (epoch % args.listener_reset_interval) == 0\n ):\n logging.info(f\"Resetting listener at epoch {epoch}\")\n model_config[\"pair\"].listener.reset_parameters()\n\n metrics[\"epoch\"] = epoch\n\n # Train\n train_metrics, lang = run(\"train\", epoch, *run_args)\n util.update_with_prefix(metrics, train_metrics, \"train\")\n\n # Eval across seen/unseen splits, and all game configurations\n for game_type in [\"ref\", \"setref\", \"concept\"]:\n if args.no_cross_eval and game_type != this_game_type:\n continue\n for split in [\"val\", \"test\"]:\n split_metrics = defaultdict(list)\n\n for split_type in [\"\", \"_same\"]:\n sname = f\"{split}{split_type}_{game_type}\"\n if sname in dataloaders:\n eval_metrics, eval_lang = run(sname, epoch, *run_args)\n util.update_with_prefix(metrics, eval_metrics, sname)\n if this_game_type == game_type:\n # Default\n util.update_with_prefix(\n metrics, eval_metrics, f\"{split}{split_type}\"\n )\n\n for metric, value in eval_metrics.items():\n split_metrics[metric].append(value)\n\n if sname == f\"test_{this_game_type}\":\n # Store + concatenate test language\n lang = pd.concat((lang, eval_lang), axis=0)\n\n # Average across seen and novel\n split_metrics = {k: np.mean(v) for k, v in split_metrics.items()}\n util.update_with_prefix(\n metrics, split_metrics, f\"{split}_avg_{game_type}\"\n )\n if this_game_type == game_type:\n # Default\n util.update_with_prefix(metrics, split_metrics, f\"{split}_avg\")\n\n # model_config['scheduler'].step(metrics[\"val_avg_loss\"])\n\n # Use validation accuracy to choose the best model.\n is_best = metrics[\"val_avg_acc\"] > metrics[\"best_acc\"]\n if is_best:\n metrics[\"best_acc\"] = metrics[\"val_avg_acc\"]\n metrics[\"best_loss\"] = metrics[\"val_avg_loss\"]\n metrics[\"best_epoch\"] = epoch\n if args.use_lang:\n lang.to_csv(os.path.join(exp_dir, \"best_lang.csv\"), index=False)\n # Save the model\n model_fname = os.path.join(exp_dir, \"best_model.pt\")\n torch.save(model_config[\"pair\"].state_dict(), model_fname)\n\n if epoch % args.save_interval == 0:\n model_fname = os.path.join(exp_dir, f\"{epoch}_model.pt\")\n torch.save(model_config[\"pair\"].state_dict(), model_fname)\n if args.use_lang:\n lang.to_csv(os.path.join(exp_dir, f\"{epoch}_lang.csv\"), index=False)\n\n # Additionally track best for splits separately\n metrics[\"best_val_acc\"] = max(metrics[\"best_val_acc\"], metrics[\"val_acc\"])\n if \"val_same_acc\" in metrics:\n metrics[\"best_val_same_acc\"] = max(\n metrics[\"best_val_same_acc\"], metrics[\"val_same_acc\"]\n )\n\n all_metrics.append(metrics.copy())\n\n if args.wandb:\n import wandb\n\n wandb.log(metrics)\n\n pd.DataFrame(all_metrics).to_csv(\n os.path.join(exp_dir, \"metrics.csv\"), index=False\n )\n", "\"\"\"\nTools for measuring emergence of communication\n\"\"\"\n\n\nfrom typing import Callable, Union\nfrom scipy.spatial import distance\nfrom scipy.stats import spearmanr\nimport editdistance\n\nfrom collections import Counter, defaultdict\nimport numpy as np\nfrom sklearn.metrics import normalized_mutual_info_score\nimport torch\n\n\ndef python_pdist(X, metric, **kwargs):\n \"\"\"\n From https://github.com/scipy/scipy/blob/v1.6.0/scipy/spatial/distance.py#L2057-L2069\n \"\"\"\n m = len(X)\n k = 0\n dm = np.empty((m * (m - 1)) // 2, dtype=np.double)\n for i in range(0, m - 1):\n for j in range(i + 1, m):\n dm[k] = metric(X[i], X[j], **kwargs)\n k = k + 1\n return dm\n\n\ndef edit_distance(x, y):\n return editdistance.eval(x, y) / ((len(x) + len(y)) / 2)\n\n\ndef topsim(\n meanings: torch.Tensor,\n messages: torch.Tensor,\n meaning_distance_fn: Union[str, Callable] = \"hamming\",\n message_distance_fn: Union[str, Callable] = \"edit\",\n) -> float:\n \"\"\"\n This function taken from EGG\n https://github.com/facebookresearch/EGG/blob/ace483e30c99a5bc480d84141bcc6f4416e5ec2b/egg/core/language_analysis.py#L164-L199\n but modified to allow pure python pdist with lists when a distance fn is\n callable (rather than scipy coercing to 2d arrays)\n \"\"\"\n\n distances = {\n \"cosine\": distance.cosine,\n \"hamming\": distance.hamming,\n \"jaccard\": distance.jaccard,\n \"euclidean\": distance.euclidean,\n }\n\n slow_meaning_fn = True\n if meaning_distance_fn in distances:\n meaning_distance_fn_callable = distances[meaning_distance_fn]\n slow_meaning_fn = False\n elif meaning_distance_fn == \"edit\":\n meaning_distance_fn_callable = edit_distance\n else:\n meaning_distance_fn_callable = meaning_distance_fn\n\n slow_message_fn = True\n if message_distance_fn in distances:\n message_distance_fn_callable = distances[message_distance_fn]\n slow_message_fn = False\n elif message_distance_fn == \"edit\":\n message_distance_fn_callable = edit_distance\n else:\n message_distance_fn_callable = message_distance_fn\n\n assert (\n meaning_distance_fn_callable and message_distance_fn_callable\n ), f\"Cannot recognize {meaning_distance_fn} \\\n or {message_distance_fn} distances\"\n\n # If meaning distance fn is not a scipy func\n if slow_meaning_fn:\n meaning_dist = python_pdist(meanings, meaning_distance_fn_callable)\n else:\n meaning_dist = distance.pdist(meanings, meaning_distance_fn_callable)\n\n if slow_message_fn:\n message_dist = python_pdist(messages, message_distance_fn_callable)\n else:\n message_dist = distance.pdist(messages, message_distance_fn_callable)\n\n topsim = spearmanr(meaning_dist, message_dist, nan_policy=\"raise\").correlation\n\n return topsim\n\n\ndef normalize(ctr):\n total = sum(ctr.values())\n return Counter({k: v / total for k, v in ctr.items()})\n\n\ndef context_independence(concepts, messages):\n r\"\"\"\n Measure context independence between concepts c and messages m.\n\n Let p_cm(c | m) be the conditional probability of context c given message m and\n p_mc(m | c) be the condiational probability of message m given context c\n (we can estimate these by simply enumerating).\n\n Then for any concept c, we define the \"ideal\" message m^c as argmax_m\n p_cm(c | m) (i.e., whichever message has the highest conditional\n probability that we are referring to concept c).\n\n Then,\n\n CI(concepts, messages) = 1 / len(concepts) \\sum_c p_mc(m^c | c) * p_cm(c | m^c).\n \"\"\"\n p_cm = defaultdict(Counter)\n p_mc = defaultdict(Counter)\n\n for c, m in zip(concepts, messages):\n # I.e., given message m, conditional probability of c.\n p_cm[m][c] += 1\n p_mc[c][m] += 1\n\n p_cm = {k: normalize(v) for k, v in p_cm.items()}\n p_mc = {k: normalize(v) for k, v in p_mc.items()}\n\n # Find ideal messages\n unique_concepts = list(set(concepts))\n unique_messages = list(set(messages))\n cis = []\n\n for c in unique_concepts:\n mc = None\n best_p_cm = 0.0\n for m in unique_messages:\n this_p_cm = p_cm[m][c]\n if this_p_cm > best_p_cm:\n mc = m\n best_p_cm = this_p_cm\n if mc is None:\n raise RuntimeError(f\"Couldn't find ideal concept for {c}\")\n\n ci = p_mc[c][mc] * p_cm[mc][c]\n\n cis.append(ci)\n\n return np.mean(cis)\n\n\ndef mutual_information(concepts, messages):\n r\"\"\"\n Measure mutual information between concepts c and messages m (assuming\n enumerability)\n \"\"\"\n # Assign int values\n c2i = {}\n m2i = {}\n\n for c, m in zip(concepts, messages):\n if c not in c2i:\n c2i[c] = len(c2i)\n if m not in m2i:\n m2i[m] = len(m2i)\n\n cis = [c2i[c] for c in concepts]\n mis = [m2i[m] for m in messages]\n\n return normalized_mutual_info_score(cis, mis)\n" ]
[ [ "pandas.concat", "numpy.random.choice", "numpy.unique", "torch.cat", "torch.zeros", "pandas.DataFrame", "torch.set_grad_enabled", "numpy.mean", "pandas.DataFrame.from_records", "numpy.where" ], [ "scipy.spatial.distance.pdist", "numpy.mean", "scipy.stats.spearmanr", "sklearn.metrics.normalized_mutual_info_score", "numpy.empty" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "0.23", "0.21", "2.0", "1.4", "1.3", "0.19", "1.1", "1.5", "0.24", "0.20", "1.0", "0.25", "1.2" ], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [ "0.13", "1.6", "0.14", "1.10", "0.15", "1.4", "1.3", "1.9", "0.19", "1.5", "0.18", "1.2", "1.7", "0.12", "1.0", "0.17", "0.16", "1.8" ], "tensorflow": [] } ]
NEISSproject/tf_neiss
[ "50df6153d0d1f5d471dd9ec0bc52617805001f79" ]
[ "model_fn/model_fn_nlp/util_nlp/graphs_pos.py" ]
[ "import tensorflow as tf\nimport numpy as np\n\nfrom model_fn.graph_base import GraphBase\nfrom model_fn.model_fn_nlp.util_nlp.attention import Selfattention, MultiHeadAttention\nfrom model_fn.model_fn_nlp.util_nlp.transformer import EncoderLayer, Encoder, Decoder\nimport model_fn.model_fn_nlp.util_nlp.graphs_bert_lm as bert_graphs\nimport model_fn.util_model_fn.optimizer as optimizers\n\n\ndef create_padding_mask(seq):\n seq_mask = tf.cast(tf.sequence_mask(seq), tf.int32)\n masked = tf.cast(tf.math.equal(seq_mask, 0), tf.float32)\n\n # add extra dimensions to add the padding\n # to the attention logits.\n return masked[:, tf.newaxis, tf.newaxis, :]\n\n\ndef get_angles(pos, i, d_model):\n angle_rates = 1 / np.power(10000, (2 * (i // 2)) / np.float32(d_model))\n return pos * angle_rates\n\n\ndef positional_encoding(position, d_model):\n angle_rads = get_angles(np.arange(position)[:, np.newaxis],\n np.arange(d_model)[np.newaxis, :],\n d_model)\n\n # apply sin to even indices in the array; 2i\n angle_rads[:, 0::2] = np.sin(angle_rads[:, 0::2])\n\n # apply cos to odd indices in the array; 2i+1\n angle_rads[:, 1::2] = np.cos(angle_rads[:, 1::2])\n\n pos_encoding = angle_rads[np.newaxis, ...]\n\n return tf.cast(pos_encoding, dtype=tf.float32)\n\n\nclass KerasGraphFF3(GraphBase):\n def __init__(self, params):\n super(KerasGraphFF3, self).__init__(params)\n self._flags = params['flags']\n self.vocab_tag_size = params['num_tags']\n # declare graph_params and update from dict --graph_params\n self.graph_params[\"ff_hidden_1\"] = 128\n self.graph_params[\"ff_hidden_2\"] = 128\n self.graph_params[\"ff_hidden_3\"] = 128\n # initilize keras layer\n self._tracked_layers[\"ff_layer_1\"] = tf.keras.layers.Dense(self.graph_params[\"ff_hidden_1\"],\n activation=tf.nn.leaky_relu, name=\"ff_layer_1\")\n self._tracked_layers[\"ff_layer_2\"] = tf.keras.layers.Dense(self.graph_params[\"ff_hidden_2\"],\n activation=tf.nn.leaky_relu, name=\"ff_layer_2\")\n self._tracked_layers[\"ff_layer_3\"] = tf.keras.layers.Dense(self.graph_params[\"ff_hidden_3\"],\n activation=tf.nn.leaky_relu, name=\"ff_layer_3\")\n self._tracked_layers[\"last_layer\"] = tf.keras.layers.Dense(self.vocab_tag_size, activation=None,\n name=\"last_layer\")\n self._tracked_layers[\"softmax\"] = tf.keras.layers.Softmax()\n\n @tf.function\n def call(self, inputs, training=None, mask=None):\n sentence = inputs[\"sentence\"]\n sentencelength = inputs[\"sentencelength\"]\n # connect keras layers\n ff_layer_1_out = self._tracked_layers[\"ff_layer_1\"](sentence)\n ff_layer_2_out = self._tracked_layers[\"ff_layer_2\"](ff_layer_1_out)\n ff_layer_3_out = self._tracked_layers[\"ff_layer_3\"](ff_layer_2_out)\n logits = self._tracked_layers[\"last_layer\"](ff_layer_3_out)\n pred_ids = tf.argmax(input=logits, axis=2, output_type=tf.int32)\n probabilities = self._tracked_layers[\"softmax\"](logits)\n self._graph_out = {\"pred_ids\": pred_ids, 'probabilities': probabilities, 'logits': logits,\n \"sentencelength\": sentencelength}\n return self._graph_out\n\n\nclass SelfAtt(GraphBase):\n def __init__(self, params):\n super(SelfAtt, self).__init__(params)\n self._flags = params['flags']\n self.vocab_tag_size = params['num_tags']\n # declare graph_params and update from dict --graph_params\n self.graph_params[\"self_att_num_dims\"] = 128\n # initilize keras layer\n self._tracked_layers[\"self_attention\"] = Selfattention(params, 300, self.graph_params[\"self_att_num_dims\"], 0.5)\n self._tracked_layers[\"last_layer\"] = tf.keras.layers.Dense(self.vocab_tag_size, activation=None,\n name=\"last_layer\")\n self._tracked_layers[\"softmax\"] = tf.keras.layers.Softmax()\n\n @tf.function\n def call(self, inputs, training=None, mask=None):\n sentence = inputs[\"sentence\"]\n sentencelength = inputs[\"sentencelength\"]\n # connect keras layers\n self_att_out = self._tracked_layers[\"self_attention\"](inputs=sentence, training=training)\n logits = self._tracked_layers[\"last_layer\"](self_att_out)\n pred_ids = tf.argmax(input=logits, axis=2, output_type=tf.int32)\n probabilities = self._tracked_layers[\"softmax\"](logits)\n self._graph_out = {\"pred_ids\": pred_ids, 'probabilities': probabilities, 'logits': logits,\n \"sentencelength\": sentencelength}\n return self._graph_out\n\n\nclass MultiheadAtt(GraphBase):\n def __init__(self, params):\n super(MultiheadAtt, self).__init__(params)\n self._flags = params['flags']\n self.vocab_tag_size = params['num_tags']\n self.embed_dim = 300\n self.num_heads = 10\n self.max_seq_len = 200\n self.pos_encoding = positional_encoding(self.max_seq_len,\n self.embed_dim)\n\n # initilize keras layer\n self._tracked_layers[\"multihead_attention\"] = MultiHeadAttention(self.embed_dim, self.num_heads)\n self._tracked_layers[\"last_layer\"] = tf.keras.layers.Dense(self.vocab_tag_size, activation=None,\n name=\"last_layer\")\n self._tracked_layers[\"softmax\"] = tf.keras.layers.Softmax()\n\n def call(self, inputs, training=None, mask=None):\n sentence = inputs[\"sentence\"]\n sentencelength = inputs[\"sentencelength\"]\n sentencelength = sentencelength[:, 0]\n # add pos encoding\n # max_batch_seq_len = tf.shape(sentence)[1]\n # sentence += self.pos_encoding[:, :max_batch_seq_len, :]\n\n # connect keras layers\n mask = create_padding_mask(sentencelength)\n multihead_att_out, attention_weights = self._tracked_layers[\"multihead_attention\"](\n {'q': sentence, 'k': sentence, 'v': sentence, 'mask': mask})\n logits = self._tracked_layers[\"last_layer\"](multihead_att_out)\n pred_ids = tf.argmax(input=logits, axis=2, output_type=tf.int32)\n probabilities = self._tracked_layers[\"softmax\"](logits)\n self._graph_out = {\"pred_ids\": pred_ids, 'probabilities': probabilities, 'logits': logits,\n \"sentencelength\": sentencelength}\n return self._graph_out\n\n\nclass EncoderLayerAlone(GraphBase):\n def __init__(self, params):\n super(EncoderLayerAlone, self).__init__(params)\n self._flags = params['flags']\n self.vocab_tag_size = params['num_tags']\n self.embed_dim = 300\n self.num_heads = 10\n self.max_seq_len = 200\n self.pos_encoding = positional_encoding(self.max_seq_len,\n self.embed_dim)\n\n # initilize keras layer\n self._tracked_layers[\"encoder_layer\"] = EncoderLayer(self.embed_dim, self.num_heads, self.embed_dim)\n self._tracked_layers[\"last_layer\"] = tf.keras.layers.Dense(self.vocab_tag_size, activation=None,\n name=\"last_layer\")\n self._tracked_layers[\"softmax\"] = tf.keras.layers.Softmax()\n\n def call(self, inputs, training=None, mask=None):\n sentence = inputs[\"sentence\"]\n sentencelength = inputs[\"sentencelength\"]\n sentencelength = sentencelength[:, 0]\n # add pos encoding\n # max_batch_seq_len = tf.shape(sentence)[1]\n # sentence += self.pos_encoding[:, :max_batch_seq_len, :]\n\n # connect keras layers\n mask = create_padding_mask(sentencelength)\n enc_lay_out = self._tracked_layers[\"encoder_layer\"]({'x': sentence, 'mask': mask}, training)\n logits = self._tracked_layers[\"last_layer\"](enc_lay_out)\n pred_ids = tf.argmax(input=logits, axis=2, output_type=tf.int32)\n probabilities = self._tracked_layers[\"softmax\"](logits)\n self._graph_out = {\"pred_ids\": pred_ids, 'probabilities': probabilities, 'logits': logits,\n \"sentencelength\": sentencelength}\n return self._graph_out\n\n\nclass EncoderFull(GraphBase):\n def __init__(self, params):\n super(EncoderFull, self).__init__(params)\n self._flags = params['flags']\n self._num_layers = 8\n self._d_model = 128\n self._num_heads = 8\n self._dff = 512\n self._input_vocab_size = params['tok_size'] + 2\n self._target_vocab_size = params['num_tags'] + 2\n self._pe_input = 300\n self._rate = 0.1\n\n # initilize keras layer\n self._tracked_layers[\"encoder\"] = Encoder(self._num_layers, self._d_model, self._num_heads, self._dff,\n self._input_vocab_size, self._pe_input, self._rate)\n self._tracked_layers[\"last_layer\"] = tf.keras.layers.Dense(self._target_vocab_size, activation=None,\n name=\"last_layer\")\n self._tracked_layers[\"softmax\"] = tf.keras.layers.Softmax()\n\n def call(self, inputs, training=None, mask=None):\n sentence = inputs[\"sentence\"]\n sentencelength = inputs[\"sentencelength\"]\n sentencelength = sentencelength[:, 0]\n # add pos encoding\n #max_batch_seq_len = tf.shape(sentence)[1]\n #sentence += self.pos_encoding[:, :max_batch_seq_len, :]\n\n # connect keras layers\n mask = self.create_padding_mask_trans(sentence)\n enc_lay_out = self._tracked_layers[\"encoder\"]({'x': sentence, 'mask': mask}, training)\n logits = self._tracked_layers[\"last_layer\"](enc_lay_out)\n max=tf.reduce_max(sentencelength)\n logits=logits[:,:max]\n pred_ids = tf.argmax(input=logits, axis=2, output_type=tf.int32)\n probabilities = self._tracked_layers[\"softmax\"](logits)\n self._graph_out = {\"pred_ids\": pred_ids, 'probabilities': probabilities, 'logits': logits,\n \"sentencelength\": sentencelength}\n\n return self._graph_out\n\n def create_padding_mask_trans(self, seq):\n seq = tf.cast(tf.math.equal(seq, 0), tf.float32)\n\n # add extra dimensions to add the padding\n # to the attention logits.\n return seq[:, tf.newaxis, tf.newaxis, :]\n\n\nclass Transformer(GraphBase):\n def __init__(self, params):\n super(Transformer, self).__init__(params)\n self._flags = params['flags']\n self._num_layers = 4\n self._d_model = 128\n self._num_heads = 8\n self._dff = 512\n self._input_vocab_size = params['tok_size'] + 2\n self._target_vocab_size = params['num_tags'] + 2\n self._pe_input = 300\n self._pe_target = 300\n self._rate = 0.1\n\n self._tracked_layers[\"encoder\"] = Encoder(self._num_layers, self._d_model, self._num_heads, self._dff,\n self._input_vocab_size, self._pe_input, self._rate)\n\n self._tracked_layers[\"decoder\"] = Decoder(self._num_layers, self._d_model, self._num_heads, self._dff,\n self._target_vocab_size, self._pe_target, self._rate)\n\n self._tracked_layers[\"last_layer\"] = tf.keras.layers.Dense(self._target_vocab_size)\n self._tracked_layers[\"softmax\"] = tf.keras.layers.Softmax()\n\n def call(self, inputs, training=None, mask=None):\n inp = inputs[\"sentence\"]\n sentencelength = inputs[\"sentencelength\"]\n sentencelength = sentencelength[:, 0]\n tar = inputs[\"tar_inp\"]\n\n enc_padding_mask, look_ahead_mask, dec_padding_mask = self.create_masks(inp, tar)\n\n enc_output = self._tracked_layers[\"encoder\"]({'x': inp, 'mask': enc_padding_mask},\n training) # (batch_size, inp_seq_len, d_model)\n\n # dec_output.shape == (batch_size, tar_seq_len, d_model)\n dec_output, attention_weights = self._tracked_layers[\"decoder\"]({\n 'tar': tar, 'enc_output': enc_output, 'look_ahead_mask': look_ahead_mask, 'padding_mask': dec_padding_mask},\n training)\n\n final_output = self._tracked_layers[\"last_layer\"](dec_output) # (batch_size, tar_seq_len, target_vocab_size)\n pred_ids = tf.argmax(input=final_output, axis=2, output_type=tf.int32)\n probabilities = self._tracked_layers[\"softmax\"](final_output)\n self._graph_out = {\"pred_ids\": pred_ids, 'probabilities': probabilities, 'logits': final_output,\n \"sentencelength\": sentencelength, \"attention_weights\": attention_weights}\n return self._graph_out\n\n def create_masks(self, inp, tar):\n # Encoder padding mask\n enc_padding_mask = self.create_padding_mask_trans(inp)\n\n # Used in the 2nd attention block in the decoder.\n # This padding mask is used to mask the encoder outputs.\n dec_padding_mask = self.create_padding_mask_trans(inp)\n\n # Used in the 1st attention block in the decoder.\n # It is used to pad and mask future tokens in the input received by\n # the decoder.\n look_ahead_mask = self.create_look_ahead_mask(tf.shape(tar)[1])\n dec_target_padding_mask = self.create_padding_mask_trans(tar)\n combined_mask = tf.maximum(dec_target_padding_mask, look_ahead_mask)\n\n return enc_padding_mask, combined_mask, dec_padding_mask\n\n def create_look_ahead_mask(self, size):\n mask = 1 - tf.linalg.band_part(tf.ones((size, size)), -1, 0)\n return mask # (seq_len, seq_len)\n\n def create_padding_mask_trans(self, seq):\n seq = tf.cast(tf.math.equal(seq, 0), tf.float32)\n\n # add extra dimensions to add the padding\n # to the attention logits.\n return seq[:, tf.newaxis, tf.newaxis, :]\n\nclass POSwithMiniBERT(GraphBase):\n def set_optimizer(self,params):\n \"\"\"set a custom optimizer using --optimizer, --optimizer_params,\n - overwrite if you need something different; set self.optimizer = tf.keras.optimizer._class_object\"\"\"\n\n get_optimizer = getattr(optimizers, params['flags'].optimizer)\n self.custom_optimizer = get_optimizer(params)\n self.bert_optimizer = self.custom_optimizer.get_keras_optimizer()\n #self.custom_optimizer.print_params()\n\n def __init__(self, params):\n super(POSwithMiniBERT, self).__init__(params)\n self._flags = params['flags']\n self._target_vocab_size = params['num_tags'] + 2\n self._pretrained_bert = getattr(bert_graphs, params['flags'].bert_graph)(params)\n self.set_optimizer(params)\n #self._pretrained_bert.load_weights(tf.train.latest_checkpoint(self._flags.bert_dir))\n checkpoint_obj = tf.train.Checkpoint(step=self._pretrained_bert.global_step, optimizer=self.bert_optimizer,\n model=self._pretrained_bert)\n\n if tf.train.get_checkpoint_state(self._flags.bert_dir):\n print(\"restore bert_model from bert checkpoint: {}\".format(self._flags.bert_dir))\n checkpoint_obj.restore(tf.train.latest_checkpoint(self._flags.bert_dir)).expect_partial()\n\n self._tracked_layers[\"last_layer\"] = tf.keras.layers.Dense(self._target_vocab_size, activation=None,\n name=\"last_layer\")\n self._tracked_layers[\"softmax\"] = tf.keras.layers.Softmax()\n\n def call(self, inputs, training=None, mask=None):\n sentencelength = inputs[\"sentencelength\"]\n sentencelength = sentencelength[:, 0]\n inputs[\"masked_index\"]=None\n bert_graph_out=self._pretrained_bert(inputs)\n del inputs[\"masked_index\"]\n\n final_output = self._tracked_layers[\"last_layer\"](bert_graph_out[\"enc_output\"]) # (batch_size, tar_seq_len, target_vocab_size)\n pred_ids = tf.argmax(input=final_output, axis=2, output_type=tf.int32)\n probabilities = self._tracked_layers[\"softmax\"](final_output)\n self._graph_out = {\"pred_ids\": pred_ids, 'probabilities': probabilities, 'logits': final_output,\n \"sentencelength\": sentencelength}\n return self._graph_out\n" ]
[ [ "tensorflow.train.get_checkpoint_state", "tensorflow.reduce_max", "tensorflow.train.latest_checkpoint", "tensorflow.shape", "tensorflow.keras.layers.Dense", "tensorflow.maximum", "tensorflow.cast", "tensorflow.train.Checkpoint", "numpy.cos", "numpy.arange", "numpy.sin", "tensorflow.ones", "tensorflow.math.equal", "numpy.float32", "tensorflow.argmax", "tensorflow.sequence_mask", "tensorflow.keras.layers.Softmax" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [ "1.10" ] } ]
Twizwei/maskrcnn_detector
[ "095584f813acb40c937672ff5b63603d40095a2a" ]
[ "build/lib.linux-x86_64-3.6/maskrcnn_benchmark/engine/inference.py" ]
[ "# Copyright (c) Facebook, Inc. and its affiliates. All Rights Reserved.\nimport datetime\nimport logging\nimport tempfile\nimport time\nimport os\nimport json\nfrom collections import OrderedDict\n\nimport torch\n\nfrom tqdm import tqdm\n\nfrom ..utils.comm import is_main_process\nfrom ..utils.comm import scatter_gather\nfrom ..utils.comm import synchronize\n\n\ndef compute_on_dataset(model, data_loader, device):\n model.eval()\n results_dict = {}\n cpu_device = torch.device(\"cpu\")\n for i, batch in tqdm(enumerate(data_loader)):\n images, targets, image_ids = batch\n images = images.to(device)\n with torch.no_grad():\n output = model(images)\n output = [o.to(cpu_device) for o in output]\n results_dict.update(\n {img_id: result for img_id, result in zip(image_ids, output)}\n )\n return results_dict\n\n\ndef _accumulate_predictions_from_multiple_gpus(predictions_per_gpu):\n all_predictions = scatter_gather(predictions_per_gpu)\n if not is_main_process():\n return\n # merge the list of dicts\n predictions = {}\n for p in all_predictions:\n predictions.update(p)\n # convert a dict where the key is the index in a list\n image_ids = list(sorted(predictions.keys()))\n if len(image_ids) != image_ids[-1] + 1:\n logger = logging.getLogger(\"maskrcnn_benchmark.inference\")\n logger.warning(\n \"Number of images that were gathered from multiple processes is not \"\n \"a contiguous set. Some images might be missing from the evaluation\"\n )\n\n # convert to a list\n predictions = [predictions[i] for i in image_ids]\n return predictions\n\n\ndef save_as_bdd_format(preds, path, name, img_names, return_pred=False):\n preds_bdd = [] \n for j in range(len(preds)):\n pred = preds[j]\n pred_bdd = {\n 'name': img_names[j],\n 'labels': []\n }\n boxes = pred.bbox.numpy().tolist()\n labels = pred.get_field('labels').numpy().tolist()\n scores = pred.get_field('scores').numpy().tolist()\n for i in range(len(boxes)):\n pred_bdd['labels'] += [{\n 'category': labels[i],\n 'box2d': {\n 'x1': boxes[i][0],\n 'y1': boxes[i][1],\n 'x2': boxes[i][2],\n 'y2': boxes[i][3]\n },\n 'score': scores[i]\n }]\n preds_bdd += [pred_bdd]\n path = os.path.join(path, '{}.json'.format(name))\n with open(path, 'w') as f:\n json.dump(preds_bdd, f)\n if return_pred:\n return pred_bdd\n\n\ndef inference(\n model,\n data_loader,\n iou_types=(\"bbox\",),\n box_only=False,\n device=\"cuda\",\n expected_results=(),\n expected_results_sigma_tol=4,\n output_folder=None,\n name=\"predictions\",\n return_pred=False\n):\n\n # convert to a torch.device for efficiency\n device = torch.device(device)\n num_devices = (\n torch.distributed.deprecated.get_world_size()\n if torch.distributed.deprecated.is_initialized()\n else 1\n )\n logger = logging.getLogger(\"maskrcnn_benchmark.inference\")\n dataset = data_loader.dataset\n logger.info(\"Start evaluation on {} images\".format(len(dataset)))\n start_time = time.time()\n predictions = compute_on_dataset(model, data_loader, device)\n # wait for all processes to complete before measuring the time\n synchronize()\n total_time = time.time() - start_time\n total_time_str = str(datetime.timedelta(seconds=total_time))\n logger.info(\n \"Total inference time: {} ({} s / img per device, on {} devices)\".format(\n total_time_str, total_time * num_devices / len(dataset), num_devices\n )\n )\n\n predictions = _accumulate_predictions_from_multiple_gpus(predictions)\n if not is_main_process():\n return\n\n if output_folder:\n det_path = os.path.join(output_folder, \"detections\")\n if not os.path.exists(det_path):\n os.makedirs(det_path)\n save_as_bdd_format(predictions, det_path, name, dataset.image_paths, return_pred)\n \n return\n" ]
[ [ "torch.device", "torch.distributed.deprecated.is_initialized", "torch.no_grad", "torch.distributed.deprecated.get_world_size" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
pyrooka/pathfinder
[ "c6226e1f02ef8471ddc42e1c19afde39dbb8c4ec" ]
[ "path_finder.py" ]
[ "# -*- coding: utf-8 -*-\n\"\"\"\n/***************************************************************************\n PathFinder\n A QGIS plugin\n Find the shortest path between two points in a raster image.\n -------------------\n begin : 2017-09-20\n git sha : $Format:%H$\n copyright : (C) 2017 by BN\n email : [email protected]\n ***************************************************************************/\n\n/***************************************************************************\n * *\n * This program is free software; you can redistribute it and/or modify *\n * it under the terms of the GNU General Public License as published by *\n * the Free Software Foundation; either version 2 of the License, or *\n * (at your option) any later version. *\n * *\n ***************************************************************************/\n\"\"\"\n# Default Python packages\nimport os.path\nfrom time import time\nfrom random import randint\n\n# PyQt packages\nfrom PyQt4.QtCore import *\nfrom PyQt4.QtGui import QAction, QIcon, QColor\n\n# Initialize Qt resources from file resources.py\nimport resources\n\n# Import the code for the dialog\nfrom path_finder_dialog import PathFinderDialog\n\n# Packages by QGIS\nimport numpy as np\nfrom osgeo import gdal\nfrom qgis.core import *\nfrom qgis.utils import iface\nfrom qgis.gui import QgsMapTool\n\n# My packages\nimport pyastar\n\n\nclass PathFinder:\n \"\"\"QGIS Plugin Implementation.\"\"\"\n\n def __init__(self, iface):\n \"\"\"Constructor.\n\n :param iface: An interface instance that will be passed to this class\n which provides the hook by which you can manipulate the QGIS\n application at run time.\n :type iface: QgsInterface\n \"\"\"\n # Save reference to the QGIS interface\n self.iface = iface\n # initialize plugin directory\n self.plugin_dir = os.path.dirname(__file__)\n # initialize locale\n locale = QSettings().value('locale/userLocale')[0:2]\n locale_path = os.path.join(\n self.plugin_dir,\n 'i18n',\n 'PathFinder_{}.qm'.format(locale))\n\n if os.path.exists(locale_path):\n self.translator = QTranslator()\n self.translator.load(locale_path)\n\n if qVersion() > '4.3.3':\n QCoreApplication.installTranslator(self.translator)\n\n\n # Declare instance attributes\n self.actions = []\n self.menu = self.tr(u'&Path finder')\n # TODO: We are going to let the user set this up in a future iteration\n self.toolbar = self.iface.addToolBar(u'PathFinder')\n self.toolbar.setObjectName(u'PathFinder')\n\n # noinspection PyMethodMayBeStatic\n def tr(self, message):\n \"\"\"Get the translation for a string using Qt translation API.\n\n We implement this ourselves since we do not inherit QObject.\n\n :param message: String for translation.\n :type message: str, QString\n\n :returns: Translated version of message.\n :rtype: QString\n \"\"\"\n # noinspection PyTypeChecker,PyArgumentList,PyCallByClass\n return QCoreApplication.translate('PathFinder', message)\n\n\n def add_action(\n self,\n icon_path,\n text,\n callback,\n enabled_flag=True,\n add_to_menu=True,\n add_to_toolbar=True,\n status_tip=None,\n whats_this=None,\n parent=None):\n \"\"\"Add a toolbar icon to the toolbar.\n\n :param icon_path: Path to the icon for this action. Can be a resource\n path (e.g. ':/plugins/foo/bar.png') or a normal file system path.\n :type icon_path: str\n\n :param text: Text that should be shown in menu items for this action.\n :type text: str\n\n :param callback: Function to be called when the action is triggered.\n :type callback: function\n\n :param enabled_flag: A flag indicating if the action should be enabled\n by default. Defaults to True.\n :type enabled_flag: bool\n\n :param add_to_menu: Flag indicating whether the action should also\n be added to the menu. Defaults to True.\n :type add_to_menu: bool\n\n :param add_to_toolbar: Flag indicating whether the action should also\n be added to the toolbar. Defaults to True.\n :type add_to_toolbar: bool\n\n :param status_tip: Optional text to show in a popup when mouse pointer\n hovers over the action.\n :type status_tip: str\n\n :param parent: Parent widget for the new action. Defaults None.\n :type parent: QWidget\n\n :param whats_this: Optional text to show in the status bar when the\n mouse pointer hovers over the action.\n\n :returns: The action that was created. Note that the action is also\n added to self.actions list.\n :rtype: QAction\n \"\"\"\n\n # Create the dialog (after translation) and keep reference\n self.dlg = PathFinderDialog()\n\n icon = QIcon(icon_path)\n action = QAction(icon, text, parent)\n action.triggered.connect(callback)\n action.setEnabled(enabled_flag)\n\n if status_tip is not None:\n action.setStatusTip(status_tip)\n\n if whats_this is not None:\n action.setWhatsThis(whats_this)\n\n if add_to_toolbar:\n self.toolbar.addAction(action)\n\n if add_to_menu:\n self.iface.addPluginToRasterMenu(\n self.menu,\n action)\n\n self.actions.append(action)\n\n return action\n\n def initGui(self):\n \"\"\"Create the menu entries and toolbar icons inside the QGIS GUI.\"\"\"\n\n icon_path = ':/plugins/PathFinder/icon.png'\n self.add_action(\n icon_path,\n text=self.tr(u'Find path'),\n callback=self.run,\n parent=self.iface.mainWindow())\n\n\n def unload(self):\n \"\"\"Removes the plugin menu item and icon from QGIS GUI.\"\"\"\n for action in self.actions:\n self.iface.removePluginRasterMenu(\n self.tr(u'&Path finder'),\n action)\n self.iface.removeToolBarIcon(action)\n # remove the toolbar\n del self.toolbar\n\n\n def run(self):\n \"\"\"Run method that performs all the real work\"\"\"\n\n # Init the gui.\n self.init_combobox()\n self.canvas = self.iface.mapCanvas()\n self.mouse_click = MySelectorTool(self.canvas, self.click_callback)\n iface.mapCanvas().setMapTool(self.mouse_click)\n # Try to disconnect the previous connection.\n try:\n self.dlg.pushButton_2.clicked.disconnect()\n self.dlg.pushButton.clicked.disconnect()\n self.dlg.checkBox.stateChanged.disconnect()\n self.dlg.comboBox.currentIndexChanged.disconnect()\n except:\n # In case of error don't do anything yet.\n pass\n\n self.dlg.pushButton_2.clicked.connect(self.clear_coordinates)\n self.dlg.pushButton.clicked.connect(self.find_path)\n self.dlg.checkBox.stateChanged.connect(self.checkbox_state_change_callback)\n self.dlg.comboBox.currentIndexChanged.connect(self.combobox_index_change_callback)\n\n\n # Show the dialog.\n self.dlg.show()\n # Run the dialog event loop.\n result = self.dlg.exec_()\n # See if OK was pressed.\n if result:\n # Do something useful here - delete the line containing pass and\n # substitute with your code.\n pass\n\n\n def init_combobox(self):\n \"\"\"\n Initialize the comobobox with the layer of the project.\n \"\"\"\n\n # Get all the layers from the interface.\n all_layers = self.iface.legendInterface().layers()\n self.layers = []\n layers_list = []\n\n for layer in all_layers:\n # If the layer is a raster layer,\n if layer.type() == QgsMapLayer.RasterLayer:\n # add it to the lists.\n self.layers.append(layer)\n layers_list.append(layer.name())\n # Clear all previous layer.\n self.dlg.comboBox.clear()\n # Add the layer names to the combobox.\n self.dlg.comboBox.addItems(layers_list)\n\n # Trigger the combobox index change event to refres the bands in their combobox.\n if len(self.layers) > 0:\n self.dlg.comboBox.setCurrentIndex(0)\n self.combobox_index_change_callback(0)\n\n\n def combobox_index_change_callback(self, index):\n \"\"\"\n Callback to handle index change in the combobox.\n \"\"\"\n\n layer = self.layers[index]\n band_count = layer.bandCount()\n\n # Clear all previous item\n self.dlg.comboBox_2.clear()\n # Add the number as string to the combobox.\n self.dlg.comboBox_2.addItems([str(i) for i in range(1, band_count + 1)])\n\n\n def checkbox_state_change_callback(self, state):\n \"\"\"\n Callback function to handle checkbox checkstate changes.\n \"\"\"\n\n # Unchecked.\n if state == 0:\n self.dlg.comboBox_2.show()\n self.dlg.lineEdit_6.hide()\n # Checked.\n else:\n self.dlg.comboBox_2.hide()\n self.dlg.lineEdit_6.show()\n\n\n def click_callback(self, coordinates):\n \"\"\"\n Callback function to handle mouse clicks.\n coordinates (QgsPoint): point with the coordinates\n \"\"\"\n\n # If both of the START lineEdit fields are empty put the coordinates into them.\n if not self.dlg.lineEdit_2.text() and not self.dlg.lineEdit_3.text():\n self.dlg.lineEdit_2.setText(str(coordinates.x()))\n self.dlg.lineEdit_3.setText(str(coordinates.y()))\n # If both of the END lineEdit fields are empty put the coordinates into them.\n elif not self.dlg.lineEdit_4.text() and not self.dlg.lineEdit_5.text():\n self.dlg.lineEdit_4.setText(str(coordinates.x()))\n self.dlg.lineEdit_5.setText(str(coordinates.y()))\n\n\n def validation(self):\n \"\"\"\n Before call the find path method, validate the given inputs.\n return (tuple): (true | false, message)\n \"\"\"\n\n current_index = self.dlg.comboBox.currentIndex()\n\n # Check the layer first. Is valid raster layer?\n if current_index < 0:\n return (False, 'No layer selected.')\n\n # Check the layer type. Now I only load raster layers, but I left this here.\n if self.layers[current_index].type() != QgsMapLayer.RasterLayer:\n return (False, 'The selected layer is not raster.')\n\n if self.dlg.checkBox.isChecked():\n # Check the band number.\n if self.dlg.lineEdit_6.text() == '':\n return (False, 'No band number provided.')\n\n try:\n int(self.dlg.lineEdit_6.text())\n except:\n return (False, 'Invalid band number.')\n\n # Check the value limit.\n if self.dlg.lineEdit.text() == '':\n return (False, 'No value provided.')\n\n try:\n float(self.dlg.lineEdit.text())\n except:\n return (False, 'Invalid value.')\n\n # Now the coordinates.\n if self.dlg.lineEdit_2.text() == '' or self.dlg.lineEdit_3.text() == '':\n return (False, 'No start coordinates.')\n\n try:\n float(self.dlg.lineEdit_2.text())\n float(self.dlg.lineEdit_3.text())\n except:\n return (False, 'Invalid start coordinates.')\n\n if self.dlg.lineEdit_4.text() == '' or self.dlg.lineEdit_5.text() == '':\n return (False, 'No end coordinates.')\n\n try:\n float(self.dlg.lineEdit_4.text())\n float(self.dlg.lineEdit_5.text())\n except:\n return (False, 'Invalid end coordinates.')\n\n return (True,)\n\n\n def find_path(self):\n # First validate all the datas.\n validation_result = self.validation()\n if not validation_result[0]:\n QgsMessageLog.logMessage(validation_result[1])\n return\n\n # Index of the currently selected layer.\n selected_layer_index = self.dlg.comboBox.currentIndex()\n # Current layer object.\n layer = self.layers[selected_layer_index]\n # Data provider object of the layer.\n provider = layer.dataProvider()\n # Open the layer from its uri (basically it's a path for the file) with update acces.\n raster = gdal.Open(str(provider.dataSourceUri()), gdal.GA_Update)\n\n # Set the transform matrix for this instance from the opened raster layer.\n self.geo_transform_matrix = raster.GetGeoTransform()\n\n # Set the pixel size in the CRS of the raster.\n self.raster_size_x = layer.rasterUnitsPerPixelX()\n self.raster_size_y = layer.rasterUnitsPerPixelY()\n\n # Set the CRS from our raster.\n self.crs = layer.crs()\n\n # Get the band number.\n if self.dlg.checkBox.isChecked():\n band_number = int(self.dlg.lineEdit_6.text())\n else:\n band_number = self.dlg.comboBox_2.currentIndex() + 1\n\n # The band which contains the information.\n band = raster.GetRasterBand(band_number)\n\n # The max value.\n max_value = float(self.dlg.lineEdit.text())\n\n # Try to read the given band.\n try:\n band_array = band.ReadAsArray()\n except:\n QgsMessageLog.logMessage('Invalid band number.')\n return\n\n # Get the starting and ending coordinates. Numpy is working (default) with row ordered arrays,\n # while QGIS the opposite.\n start_coordinates = self.get_pixel_coordinates(float(self.dlg.lineEdit_2.text()), float(self.dlg.lineEdit_3.text()))\n start_coordinates_np = start_coordinates[::-1]\n end_coordinates = self.get_pixel_coordinates(float(self.dlg.lineEdit_4.text()), float(self.dlg.lineEdit_5.text()))\n end_coordinates_np = end_coordinates[::-1]\n\n # Check the coordinates aren't \"wall\" pixels.\n if band_array[start_coordinates_np[0], start_coordinates_np[1]] >= max_value:\n QgsMessageLog.logMessage('The starting coordinates are above the maximum value.')\n return\n if band_array[end_coordinates_np[0], end_coordinates_np[1]] >= max_value:\n QgsMessageLog.logMessage('The ending coordinates are above the maximum value.')\n return\n\n # Create copy from the band. To secure our raster and don't overwrite accidentally.\n grid = np.copy(band_array)\n\n # Process the grid for the algorithm.\n # Inf = wall\n # 1 = free area\n grid[band_array >= max_value] = np.inf\n grid[band_array < max_value] = 1\n\n # Get the time for measure the algorithm.\n t0 = time()\n\n # Get the path finally!\n path = pyastar.astar_path(grid, start_coordinates_np, end_coordinates_np)\n\n # Duration of the algorithm running time.\n duration = time() - t0\n\n # If no path found.\n if not len(path):\n QgsMessageLog.logMessage('No path found!')\n return\n\n QgsMessageLog.logMessage('Path found in %.6fs.' % duration)\n QgsMessageLog.logMessage('Steps: ' + str(len(path)))\n\n # Create the vector layer from the path and get the length of the created line.\n path_length = self.create_vector_layer(path)\n\n # Type of the CRS map unit.\n unit_type = QgsUnitTypes.encodeUnit(self.crs.mapUnits())\n\n self.dlg.label_10.setText('Path length: %.1f %s' % (path_length, unit_type))\n\n # Reload the layers into the comobox.\n self.init_combobox()\n\n return\n\n\n def create_vector_layer(self, path):\n \"\"\"\n Create vector layer from the given path.\n path (list): list of the coordinates\n return (float): length of the created line\n \"\"\"\n\n # New QGIS Vector layer with the base (raster) layer's CRS.\n vector_layer = QgsVectorLayer('LineString?crs=' + self.crs.toWkt(), 'Path', 'memory')\n # Get the layer renderer and the feature symbol.\n symbol = vector_layer.rendererV2().symbols2(QgsRenderContext())[0]\n # Set the feature (line) width.\n symbol.setWidth(1.0)\n # Now set the color of the feature (line) random.\n symbol.setColor(QColor.fromRgb(randint(0,255), randint(0,255), randint(0,255)))\n\n # Get the layer provider.\n provider = vector_layer.dataProvider()\n\n # Enable layer edit.\n vector_layer.startEditing()\n\n # Line features created from the path (list of QGIS points).\n points = []\n\n # Iterates over the points in a path.\n for point in path:\n # Get the CRS coordinates of the point,\n crs_coordinate = self.get_crs_coordinates(point[1], point[0])\n # then create a QGIS point from it.\n points.append(QgsPoint(crs_coordinate[0], crs_coordinate[1]))\n\n # New QGIS feature.\n line = QgsFeature()\n\n # Set feature (line) geometry from the points.\n line.setGeometry(QgsGeometry.fromPolyline(points))\n\n # Add the features to the vector (provider).\n provider.addFeatures([line])\n\n # Commit (\"save\") changes to the vector layer.\n vector_layer.commitChanges()\n\n # Then add it to the project.\n QgsMapLayerRegistry.instance().addMapLayer(vector_layer)\n\n return line.geometry().length()\n\n\n def get_pixel_coordinates(self, x, y):\n \"\"\"\n This method calculates the image pixel coordinate for a real location.\n x (double): x coordinate\n y (double): y coordinate\n return (list): [x, y]\n \"\"\"\n\n\n if (not self.geo_transform_matrix):\n QgsMessageLog.logMessage('No geo transform matrix.')\n return [0, 0]\n\n # Honestly I just copied this block from the QGIS Python Programming Cookbook. I didn't dig into deeper,\n # but more or less it's trivial. It uses parameters from the georeferencing information of the raster.\n ul_x = self.geo_transform_matrix[0]\n ul_y = self.geo_transform_matrix[3]\n x_dist = self.geo_transform_matrix[1]\n y_dist = self.geo_transform_matrix[5]\n rtn_x = self.geo_transform_matrix[2]\n rtn_y = self.geo_transform_matrix[4]\n # Calculate the pixel X,Y.\n pixel_x = int((x - ul_x) / x_dist)\n pixel_y = int((y - ul_y) / y_dist)\n\n return [pixel_x, pixel_y]\n\n\n def get_crs_coordinates(self, x, y):\n \"\"\"\n This method calculates the CRS coordinate for a pixel location.\n x (int): x coordinate\n y (int): y coordinate\n return (list): [x, y]\n \"\"\"\n\n if (not self.geo_transform_matrix):\n QgsMessageLog.logMessage('No geo transform matrix.')\n return [0, 0]\n\n # Get parameters from georeferencing.\n ul_x = self.geo_transform_matrix[0]\n ul_y = self.geo_transform_matrix[3]\n x_dist = self.geo_transform_matrix[1]\n y_dist = self.geo_transform_matrix[5]\n rtn_x = self.geo_transform_matrix[2]\n rtn_y = self.geo_transform_matrix[4]\n # Calculate the CRS X,Y.\n crs_x = (x * x_dist) + ul_x\n crs_y = (y * y_dist) + ul_y\n\n # Now the coordinates are in the topleft (?) corner if the pixels so I move them to the center.\n # May not work for your raster and CRS. In this case please contact me! (:\n crs_x += self.raster_size_x / 2\n crs_y -= self.raster_size_y / 2\n\n return [crs_x, crs_y]\n\n\n def clear_coordinates(self):\n \"\"\"\n Clear all coordinates field (START(X,Y) END(X,Y)) on the GUI.\n \"\"\"\n\n self.dlg.lineEdit_2.setText('')\n self.dlg.lineEdit_3.setText('')\n self.dlg.lineEdit_4.setText('')\n self.dlg.lineEdit_5.setText('')\n\n\n def get_eucl_dist(self, point_1, point_2):\n \"\"\"\n Calculate the distance between two points.\n point_1 (list/tuple): first point coordinates (x, y)\n point_2 (list/tuple): second point coordinates (x, y)\n return (float): the calculated distance\n \"\"\"\n\n return ((point_1[0] - point_2[0])**2 + (point_1[1] - point_2[1])**2)**0.5\n\n\nclass MySelectorTool(QgsMapTool):\n \"\"\"\n Inherits the QGIS identify tool (tool is deactivated once another tool takes focus)\n \"\"\"\n def __init__(self, canvas, callback):\n QgsMapTool.__init__(self, canvas)\n self.canvas = canvas\n self.click_event = pyqtSignal()\n self.callback = callback\n\n\n def canvasReleaseEvent(self, mouseEvent):\n \"\"\"\n Mouse click events.\n \"\"\"\n\n # Coordinates.\n x = mouseEvent.pos().x()\n y = mouseEvent.pos().y()\n # Transform the coordinates into map coordinates (CRS).\n point = self.canvas.getCoordinateTransform().toMapCoordinates(x, y)\n # Call the callback function.\n self.callback(point)\n" ]
[ [ "numpy.copy" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
llbxg/NIST-SP-800-22
[ "7e82243643b62fdc07cbe5f40d540b0a16a4372a" ]
[ "tests/t_05_binary_matrix_rank_test.py" ]
[ "import math\n\nimport numpy as np\nimport scipy.special as sc\n\nfrom tests.src.utils import split_list, __print\nfrom tests.src.rakn import rank\n\n# .5 Binary Matrix Rank Test\ndef binary_matrix_rank_test(key, n, M=32, Q=32, b_print=True):\n if n < 38912:\n __print(b_print, '{:40} : Error. Need at least 38,912 bits. Got {}.' .format('binary matrix rank test', n))\n return [0], False\n\n N=n//(M*Q)\n split_key=list(split_list(key,M*Q))\n\n if len(split_key[-1]) != len(split_key[0]):\n split_key=split_key[0:-1]\n\n f_split_key= list(map(lambda x : np.reshape(np.array(x),[M,Q]), split_key))\n\n ranks = list(map(lambda x: rank(list(x)),f_split_key))\n\n full_rank = M\n\n FM =ranks.count(full_rank)\n FM1=ranks.count(full_rank-1)\n NFMM1=N - FM -FM1\n\n chi_squared_obs = (FM-0.2888*N)**2/(0.2888*N) + (FM1-0.5776*N)**2/(0.5776*N)+(NFMM1-0.1336*N)**2/(0.1336*N)\n p=math.e**(-chi_squared_obs/2)\n\n b = (p >= 0.01)\n\n __print(b_print, '{:40} : {:.3f} -> {}'.format('binary matrix rank test',p,b))\n\n return [p],b" ]
[ [ "numpy.array" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
usamaahsan93/Perceptron
[ "27dbcefe39f5bd61f30a66887abd810bb59c9b2c" ]
[ "myPerceptron.py" ]
[ "import numpy as np\nfrom numpy.random import randn\n\n#This function is taken from Dr Fayyaz ul Amir Afsar Minhas (Github User: foxtrotmike)\ndef getExamples(n=100,d=2):\n \"\"\"\n Generates n d-dimensional normally distributed examples of each class \n The mean of the positive class is [1] and for the negative class it is [-1]\n DO NOT CHANGE THIS FUNCTION\n \"\"\"\n Xp = randn(n,d)+1 #generate n examples of the positive class\n #Xp[:,0]=Xp[:,0]+1\n Xn = randn(n,d)-1 #generate n examples of the negative class\n #Xn[:,0]=Xn[:,0]-1\n X = np.vstack((Xp,Xn)) #Stack the examples together to a single matrix\n Y = np.array([+1]*n+[-1]*n) #Associate Labels\n return (X,Y) \n\n\n\nw=getExamples()\n\ndata=w[0]\nlabel=w[1]\nlr=0.01\n\n#Checking the loop execution\ncount=0\nok=False\nmaxRun=0\n\n#Seperating data into weights and bias\nw=np.random.random(data.shape[1])\nb=np.random.random()\n\n#Perceptron Loop\nwhile not ok and maxRun<=1000:\n maxRun+=1\n count=0\n for i in range(len(data)):\n \n #Counting on all the example if satisfied by y*f(x) >=1 is all true then we have found the weights of perceptron\n #The code then breaks\n if label[i]*(w.T.dot(data[i])+b) >=1:\n count+=1\n \n #Else weights are updated\n else:\n w=w+lr*label[i]*data[i]\n b=b+lr*label[i]\n \n if count==len(data):\n ok=True\n \n#Printing weights and bias \nprint(w,b)\n\n\n#############################################################\nprint('NOW TESTING')\nl=[]\nfor i in range(len(data)):\n l.append(np.sign(w.T.dot(data[i])+b)==np.sign(label[i]))\n\nprint('ACCURACY : ',l.count(True)/len(l)) \n" ]
[ [ "numpy.random.random", "numpy.sign", "numpy.random.randn", "numpy.array", "numpy.vstack" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
barbagroup/pygbe_validation_paper
[ "ef826a8e956a817f919c4357a08aa8f675a910a4" ]
[ "repro_packs/rockstuhl/repro_exec_files/scripts/cext_wave_prism_34K_SE.py" ]
[ "import numpy\nimport time\nimport sys\nimport os\nfrom argparse import ArgumentParser\n\nimport pygbe\nfrom pygbe.util.read_data import read_fields\nfrom pygbe.main import main\n\nfrom cext_wavelength_scanning import create_diel_list, Cext_wave_scan, Cext_analytical\n\n\ndef read_inputs(args):\n \"\"\"\n Parse command-line arguments to read arguments in main.\n \"\"\"\n\n parser = ArgumentParser(description='Read path where input files are located')\n parser.add_argument('-if',\n '--infiles',\n type=str,\n help=\"Absolute path where input files are located (downloaded from zenodo)\")\n \n return parser.parse_args(args)\n \n\n\ndef main(argv=sys.argv):\n\n argv=sys.argv\n args = read_inputs(argv[1:])\n\n in_files_path = args.infiles\n\n #Import surface data\n wave_s, diel_rs, diel_is = numpy.loadtxt('../dielectric_data/4H-SIC_permittivity_10-12_microns.csv', skiprows=1, unpack=True)\n\n air_diel = [1. + 1j*0.] * len(wave_s)\n #Creating dielectric list first dielectric outside, then inside\n diel_list = [list(eps) for eps in zip(air_diel, diel_rs + 1j*diel_is)]\n\n #Set enviornment variable for PyGBe\n folder_path = in_files_path + 'prism6720x26880x3280_SE'\n full_path = os.path.abspath(folder_path)+'/'\n os.environ['PYGBE_PROBLEM_FOLDER'] = full_path\n\n #Creating dictionary field. We will modify the 'E' key in the for loop.\n field_dict_pillars = read_fields(full_path + 'prism_34K.config')\n\n\n #Calculate Cext(lambda) for pillars' surface\n tic_ss = time.time()\n e_field = -1.\n wave, Cext_pillars = Cext_wave_scan(e_field, wave_s, diel_list, field_dict_pillars, full_path) \n toc_ss = time.time()\n\n\n\n numpy.savetxt('../results_data/prism_SE_LE_res/'+'prism_34K_short_edge'+'10-20microns.txt', \n list(zip(wave, Cext_pillars)),\n fmt = '%.9f %.9f', \n header = 'lambda [Ang], Cext [nm^2]') \n\n time_simulation = (toc_ss - tic_ss) \n\n with open('../results_data/prism_SE_LE_res/Time_'+'prism_34K_short_edge'+'.txt', 'w') as f:\n print('time_total: {} s'.format(time_simulation), file=f)\n\nif __name__ == \"__main__\":\n main(sys.argv)\n" ]
[ [ "numpy.loadtxt" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
khdlr/PyQtImageViewer
[ "0f41c10684915bd6ed8db6ce5fb5a783d7bc5889" ]
[ "ViewGeoTIFF.py" ]
[ "#!/usr/bin/env python\n\"\"\" ViewGeoTIFF.py: PyQt image viewer widget for a QPixmap in a QGraphicsView scene with mouse zooming and panning.\n\n\"\"\"\n\nimport os.path\ntry:\n from PyQt5.QtCore import Qt, QRectF, pyqtSignal, QT_VERSION_STR\n from PyQt5.QtGui import QImage, QPixmap, QPainterPath\n from PyQt5.QtWidgets import QGraphicsView, QGraphicsScene, QFileDialog\nexcept ImportError:\n try:\n from PyQt4.QtCore import Qt, QRectF, pyqtSignal, QT_VERSION_STR\n from PyQt4.QtGui import QGraphicsView, QGraphicsScene, QImage, QPixmap, QPainterPath, QFileDialog\n except ImportError:\n raise ImportError(\"ViewGeoTIFF: Requires PyQt5 or PyQt4.\")\nimport rasterio\nimport numpy as np\nfrom pathlib import Path\n\n__author__ = \"Konrad Heidler <[email protected]>, Marcel Goldschen-Ohm <[email protected]>\"\n__version__ = '0.1.0'\n\n\nclass ViewGeoTIFF(QGraphicsView):\n \"\"\" PyQt image viewer widget for a QPixmap in a QGraphicsView scene with mouse zooming and panning.\n\n Displays a QImage or QPixmap (QImage is internally converted to a QPixmap).\n To display any other image format, you must first convert it to a QImage or QPixmap.\n\n Some useful image format conversion utilities:\n qimage2ndarray: NumPy ndarray <==> QImage (https://github.com/hmeine/qimage2ndarray)\n ImageQt: PIL Image <==> QImage (https://github.com/python-pillow/Pillow/blob/master/PIL/ImageQt.py)\n\n Mouse interaction:\n Left mouse button drag: Pan image.\n Right mouse button drag: Zoom box.\n Right mouse button doubleclick: Zoom to show entire image.\n \"\"\"\n\n # Mouse button signals emit image scene (x, y) coordinates.\n # !!! For image (row, column) matrix indexing, row = y and column = x.\n leftMouseButtonPressed = pyqtSignal(float, float)\n rightMouseButtonPressed = pyqtSignal(float, float)\n leftMouseButtonReleased = pyqtSignal(float, float)\n rightMouseButtonReleased = pyqtSignal(float, float)\n leftMouseButtonDoubleClicked = pyqtSignal(float, float)\n rightMouseButtonDoubleClicked = pyqtSignal(float, float)\n\n def __init__(self, app):\n QGraphicsView.__init__(self)\n self.app = app\n\n # Image is displayed as a QPixmap in a QGraphicsScene attached to this QGraphicsView.\n self.scene = QGraphicsScene()\n self.setScene(self.scene)\n\n # Store a local handle to the scene's current image pixmap.\n self._pixmapHandle = None\n\n # Image aspect ratio mode.\n # !!! ONLY applies to full image. Aspect ratio is always ignored when zooming.\n # Qt.IgnoreAspectRatio: Scale image to fit viewport.\n # Qt.KeepAspectRatio: Scale image to fit inside viewport, preserving aspect ratio.\n # Qt.KeepAspectRatioByExpanding: Scale image to fill the viewport, preserving aspect ratio.\n self.aspectRatioMode = Qt.KeepAspectRatio\n\n # Scroll bar behaviour.\n # Qt.ScrollBarAlwaysOff: Never shows a scroll bar.\n # Qt.ScrollBarAlwaysOn: Always shows a scroll bar.\n # Qt.ScrollBarAsNeeded: Shows a scroll bar only when zoomed.\n self.setHorizontalScrollBarPolicy(Qt.ScrollBarAsNeeded)\n self.setVerticalScrollBarPolicy(Qt.ScrollBarAsNeeded)\n\n # Stack of QRectF zoom boxes in scene coordinates.\n self.zoomStack = []\n\n # Flags for enabling/disabling mouse interaction.\n self.canZoom = True\n self.canPan = True\n\n # Path of current file\n self.currentFile = None\n\n\n def hasImage(self):\n \"\"\" Returns whether or not the scene contains an image pixmap.\n \"\"\"\n return self._pixmapHandle is not None\n\n def clearImage(self):\n \"\"\" Removes the current image pixmap from the scene if it exists.\n \"\"\"\n if self.hasImage():\n self.scene.removeItem(self._pixmapHandle)\n self._pixmapHandle = None\n\n def pixmap(self):\n \"\"\" Returns the scene's current image pixmap as a QPixmap, or else None if no image exists.\n :rtype: QPixmap | None\n \"\"\"\n if self.hasImage():\n return self._pixmapHandle.pixmap()\n return None\n\n def image(self):\n \"\"\" Returns the scene's current image pixmap as a QImage, or else None if no image exists.\n :rtype: QImage | None\n \"\"\"\n if self.hasImage():\n return self._pixmapHandle.pixmap().toImage()\n return None\n\n def setImage(self, image):\n \"\"\" Set the scene's current image pixmap to the input QImage or QPixmap.\n Raises a RuntimeError if the input image has type other than QImage or QPixmap.\n :type image: QImage | QPixmap\n \"\"\"\n if type(image) is QPixmap:\n pixmap = image\n elif type(image) is QImage:\n pixmap = QPixmap.fromImage(image)\n else:\n raise RuntimeError(\"ImageViewer.setImage: Argument must be a QImage or QPixmap.\")\n if self.hasImage():\n self._pixmapHandle.setPixmap(pixmap)\n else:\n self._pixmapHandle = self.scene.addPixmap(pixmap)\n self.setSceneRect(QRectF(pixmap.rect())) # Set scene size to image size.\n self.updateViewer()\n\n def loadImageFromFile(self, fileName=None):\n \"\"\" Load an image from file.\n Without any arguments, loadImageFromFile() will popup a file dialog to choose the image file.\n With a fileName argument, loadImageFromFile(fileName) will attempt to load the specified image file directly.\n \"\"\"\n if fileName is None:\n if QT_VERSION_STR[0] == '4':\n fileName = QFileDialog.getOpenFileName(self, \"Open image file.\")\n elif QT_VERSION_STR[0] == '5':\n fileName, _ = QFileDialog.getOpenFileName(self, \"Open image file.\")\n self.currentFile = Path(fileName)\n self.updateFolderListing()\n self.loadImage()\n\n def loadImage(self):\n if self.currentFile.exists():\n with rasterio.open(self.currentFile) as raster:\n r = raster.read(4)\n g = raster.read(3)\n b = raster.read(2)\n\n img = np.stack([r, g, b], axis=-1)\n img = (255 * np.clip(img / 3000, 0, 1)).astype(np.uint8)\n\n height, width = img.shape[:2]\n image = QImage(img, width, height, 3*width, QImage.Format_RGB888)\n\n self.setImage(image)\n self.setWindowTitle(f'{self.currentFile.name} ({self.folderIndex+1} / {len(self.folderListing)})')\n else:\n print(f\"Trying to load Image at {self.currentFile}, which doesn't exist!\")\n\n\n def updateFolderListing(self):\n self.folderListing = list(sorted(self.currentFile.parent.glob('*.tif')))\n self.folderIndex = self.folderListing.index(self.currentFile)\n\n def updateViewer(self):\n \"\"\" Show current zoom (if showing entire image, apply current aspect ratio mode).\n \"\"\"\n if not self.hasImage():\n return\n if len(self.zoomStack) and self.sceneRect().contains(self.zoomStack[-1]):\n self.fitInView(self.zoomStack[-1], Qt.IgnoreAspectRatio) # Show zoomed rect (ignore aspect ratio).\n else:\n self.zoomStack = [] # Clear the zoom stack (in case we got here because of an invalid zoom).\n self.fitInView(self.sceneRect(), self.aspectRatioMode) # Show entire image (use current aspect ratio mode).\n\n def resizeEvent(self, event):\n \"\"\" Maintain current zoom on resize.\n \"\"\"\n self.updateViewer()\n\n def mousePressEvent(self, event):\n \"\"\" Start mouse pan or zoom mode.\n \"\"\"\n scenePos = self.mapToScene(event.pos())\n if event.button() == Qt.LeftButton:\n if self.canPan:\n self.setDragMode(QGraphicsView.ScrollHandDrag)\n self.leftMouseButtonPressed.emit(scenePos.x(), scenePos.y())\n elif event.button() == Qt.RightButton:\n if self.canZoom:\n self.setDragMode(QGraphicsView.RubberBandDrag)\n self.rightMouseButtonPressed.emit(scenePos.x(), scenePos.y())\n QGraphicsView.mousePressEvent(self, event)\n\n def mouseReleaseEvent(self, event):\n \"\"\" Stop mouse pan or zoom mode (apply zoom if valid).\n \"\"\"\n QGraphicsView.mouseReleaseEvent(self, event)\n scenePos = self.mapToScene(event.pos())\n if event.button() == Qt.LeftButton:\n self.setDragMode(QGraphicsView.NoDrag)\n self.leftMouseButtonReleased.emit(scenePos.x(), scenePos.y())\n elif event.button() == Qt.RightButton:\n if self.canZoom:\n viewBBox = self.zoomStack[-1] if len(self.zoomStack) else self.sceneRect()\n selectionBBox = self.scene.selectionArea().boundingRect().intersected(viewBBox)\n self.scene.setSelectionArea(QPainterPath()) # Clear current selection area.\n if selectionBBox.isValid() and (selectionBBox != viewBBox):\n self.zoomStack.append(selectionBBox)\n self.updateViewer()\n self.setDragMode(QGraphicsView.NoDrag)\n self.rightMouseButtonReleased.emit(scenePos.x(), scenePos.y())\n\n def mouseDoubleClickEvent(self, event):\n \"\"\" Show entire image.\n \"\"\"\n scenePos = self.mapToScene(event.pos())\n if event.button() == Qt.LeftButton:\n self.leftMouseButtonDoubleClicked.emit(scenePos.x(), scenePos.y())\n elif event.button() == Qt.RightButton:\n if self.canZoom:\n self.zoomStack = [] # Clear zoom stack.\n self.updateViewer()\n self.rightMouseButtonDoubleClicked.emit(scenePos.x(), scenePos.y())\n QGraphicsView.mouseDoubleClickEvent(self, event)\n\n def closeEvent(self, event):\n self.app.quit()\n\n def nextImage(self):\n self.folderIndex = (self.folderIndex + 1) % len(self.folderListing)\n self.currentFile = self.folderListing[self.folderIndex]\n self.loadImage()\n\n def previousImage(self):\n self.folderIndex -= 1\n if self.folderIndex < 0:\n self.folderIndex += len(self.folderListing)\n self.currentFile = self.folderListing[self.folderIndex]\n self.loadImage()\n\n def keyPressEvent(self, event):\n if event.key() == Qt.Key_Right:\n self.nextImage()\n elif event.key() == Qt.Key_Left:\n self.previousImage()\n event.accept()\n\n\nif __name__ == '__main__':\n import sys\n try:\n from PyQt5.QtWidgets import QApplication\n except ImportError:\n\n try:\n from PyQt4.QtGui import QApplication\n except ImportError:\n raise ImportError(\"ViewGeoTIFF: Requires PyQt5 or PyQt4.\")\n print('Using Qt ' + QT_VERSION_STR)\n\n def handleLeftClick(x, y):\n row = int(y)\n column = int(x)\n print(\"Clicked on image pixel (row=\"+str(row)+\", column=\"+str(column)+\")\")\n\n # Create the application.\n app = QApplication(sys.argv)\n\n # Create image viewer and load an image file to display.\n viewer = ViewGeoTIFF(app)\n\n filename = None\n if len(sys.argv) > 1:\n filename = sys.argv[1]\n\n viewer.loadImageFromFile(filename)\n # Handle left mouse clicks with custom slot.\n viewer.leftMouseButtonPressed.connect(handleLeftClick)\n\n # Show viewer and run application.\n viewer.show()\n sys.exit(app.exec_())\n" ]
[ [ "numpy.stack", "numpy.clip" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
tongni1975/stackup-workshops
[ "d83f1d5adcc0b133b10e22d1db295020af967bac" ]
[ "pi-pytorch/tutorials/rnn/data.py" ]
[ "import numpy as np\nimport math, random\n\n# Generate a noisy multi-sin wave \ndef sine_2(X, signal_freq=60.):\n return (np.sin(2 * np.pi * (X) / signal_freq) + np.sin(4 * np.pi * (X) / signal_freq)) / 2.0\n\ndef noisy(Y, noise_range=(-0.05, 0.05)):\n noise = np.random.uniform(noise_range[0], noise_range[1], size=Y.shape)\n return Y + noise\n\ndef sample(sample_size):\n random_offset = random.randint(0, sample_size)\n X = np.arange(sample_size)\n Y = noisy(sine_2(X + random_offset))\n return Y" ]
[ [ "numpy.random.uniform", "numpy.arange", "numpy.sin" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
victorfariassb/ministros_mencao_estado
[ "cf490a09aef646d68a399700a9a7b6cdfef18f54" ]
[ "contagem_palavras_especificas.py" ]
[ "import pandas as pd\r\n\r\nestados = ['acre|ac', 'alagoas|al', 'amapá|ap', 'amazonas|am', 'bahia|ba', 'ceará|ce', 'espírito santo|es', 'goiás|go', 'maranhão|ma', 'mato grosso|mt', 'mato grosso do sul|ms', 'goiás|go',\r\n 'maranhão|ma', 'minas gerais|mg', 'pará|pa', 'paraíba|pb', 'paraná|pr', 'pernambuco|pe', 'piauí|pi', 'rio de janeiro|rj', 'rio grande do norte|rn', 'rio grande do sul|rs',\r\n 'rondônia|ro', 'roraima|rr', 'santa catarina|sc', 'são paulo|sp', 'sergipe|se', 'tocantins|to', 'distrito federal|df']\r\n\r\ndef contagem_palavras_especificas(arquivo, palavras):\r\n \"\"\"Conta como mais de um caso os termos tenham sido mencionados no mesmo tweet. Além disso, Mato Grosso conta os dados de MS\"\"\"\r\n dados = {}\r\n df = pd.read_csv(arquivo)\r\n df = df[['date', 'tweet']]\r\n df['count'] = 1\r\n df['tweet'] = df['tweet'].str.lower()\r\n for palavra in palavras:\r\n termo = df.loc[df['tweet'].str.contains(fr\"\\b({palavra})\\b\")].sum()\r\n termo['estado'] = palavra\r\n dados[f'{termo[\"estado\"]}'] = termo['count']\r\n for i in sorted(dados, key= dados.get, reverse=True):\r\n print(i, dados[i])\r\n #contagem.to_csv(novo_doc)\r\n\r\nprint('Tarcisio')\r\ncontagem_palavras_especificas('tarcisio.csv', estados)\r\nprint('\\n')\r\nprint('onyx')\r\ncontagem_palavras_especificas('onyx.csv', estados)\r\nprint('\\n')\r\n\r\nprint('marinho')\r\ncontagem_palavras_especificas('marinho.csv', estados)\r\nprint('\\n')\r\n\r\nprint('TerezaCrisMS')\r\ncontagem_palavras_especificas('tereza.csv', estados)\r\nprint('\\n')\r\nprint('andersongtorres')\r\ncontagem_palavras_especificas('torres.csv', estados)\r\nprint('\\n')\r\nprint('João Roma')\r\ncontagem_palavras_especificas('joao_roma.csv', estados)\r\nprint('\\n')\r\nprint('fabiofaria')\r\ncontagem_palavras_especificas('fabiofaria.csv', estados)\r\n" ]
[ [ "pandas.read_csv" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "2.0", "1.4", "1.1", "1.5", "1.2", "1.3" ], "scipy": [], "tensorflow": [] } ]
tkf/matplotlib
[ "5b90a27aeda308a7dcbf70d5cc7a0612b3bb41e5", "5b90a27aeda308a7dcbf70d5cc7a0612b3bb41e5", "5b90a27aeda308a7dcbf70d5cc7a0612b3bb41e5" ]
[ "lib/matplotlib/tests/test_transforms.py", "lib/matplotlib/cm.py", "lib/matplotlib/backends/backend_qt4.py" ]
[ "from __future__ import print_function\nfrom nose.tools import assert_equal\nfrom numpy.testing import assert_almost_equal\nfrom matplotlib.transforms import Affine2D, BlendedGenericTransform\nfrom matplotlib.path import Path\nfrom matplotlib.scale import LogScale\nfrom matplotlib.testing.decorators import cleanup\nimport numpy as np\n\nimport matplotlib.transforms as mtrans\nimport matplotlib.pyplot as plt\n\n\n\n@cleanup\ndef test_non_affine_caching():\n class AssertingNonAffineTransform(mtrans.Transform):\n \"\"\"\n This transform raises an assertion error when called when it\n shouldn't be and self.raise_on_transform is True.\n\n \"\"\"\n input_dims = output_dims = 2\n is_affine = False\n def __init__(self, *args, **kwargs):\n mtrans.Transform.__init__(self, *args, **kwargs)\n self.raise_on_transform = False\n self.underlying_transform = mtrans.Affine2D().scale(10, 10)\n\n def transform_path_non_affine(self, path):\n if self.raise_on_transform:\n assert False, ('Invalidated affine part of transform '\n 'unnecessarily.')\n return self.underlying_transform.transform_path(path)\n transform_path = transform_path_non_affine\n\n def transform_non_affine(self, path):\n if self.raise_on_transform:\n assert False, ('Invalidated affine part of transform '\n 'unnecessarily.')\n return self.underlying_transform.transform(path)\n transform = transform_non_affine\n\n my_trans = AssertingNonAffineTransform()\n ax = plt.axes()\n plt.plot(range(10), transform=my_trans + ax.transData)\n plt.draw()\n # enable the transform to raise an exception if it's non-affine transform\n # method is triggered again.\n my_trans.raise_on_transform = True\n ax.transAxes.invalidate()\n plt.draw()\n\n\ndef test_Affine2D_from_values():\n points = [ [0,0],\n [10,20],\n [-1,0],\n ]\n\n t = Affine2D.from_values(1,0,0,0,0,0)\n actual = t.transform(points)\n expected = np.array( [[0,0],[10,0],[-1,0]] )\n assert_almost_equal(actual,expected)\n\n t = Affine2D.from_values(0,2,0,0,0,0)\n actual = t.transform(points)\n expected = np.array( [[0,0],[0,20],[0,-2]] )\n assert_almost_equal(actual,expected)\n\n t = Affine2D.from_values(0,0,3,0,0,0)\n actual = t.transform(points)\n expected = np.array( [[0,0],[60,0],[0,0]] )\n assert_almost_equal(actual,expected)\n\n t = Affine2D.from_values(0,0,0,4,0,0)\n actual = t.transform(points)\n expected = np.array( [[0,0],[0,80],[0,0]] )\n assert_almost_equal(actual,expected)\n\n t = Affine2D.from_values(0,0,0,0,5,0)\n actual = t.transform(points)\n expected = np.array( [[5,0],[5,0],[5,0]] )\n assert_almost_equal(actual,expected)\n\n t = Affine2D.from_values(0,0,0,0,0,6)\n actual = t.transform(points)\n expected = np.array( [[0,6],[0,6],[0,6]] )\n assert_almost_equal(actual,expected)\n\ndef test_clipping_of_log():\n # issue 804\n M,L,C = Path.MOVETO, Path.LINETO, Path.CLOSEPOLY\n points = [ (0.2, -99), (0.4, -99), (0.4, 20), (0.2, 20), (0.2, -99) ]\n codes = [ M, L, L, L, C ]\n path = Path(points, codes)\n\n # something like this happens in plotting logarithmic histograms\n trans = BlendedGenericTransform(Affine2D(),\n LogScale.Log10Transform('clip'))\n tpath = trans.transform_path_non_affine(path)\n result = tpath.iter_segments(trans.get_affine(),\n clip=(0, 0, 100, 100),\n simplify=False)\n\n tpoints, tcodes = zip(*result)\n # Because y coordinate -99 is outside the clip zone, the first\n # line segment is effectively removed. That means that the closepoly\n # operation must be replaced by a move to the first point.\n assert np.allclose(tcodes, [ M, M, L, L, L ])\n assert np.allclose(tpoints[-1], tpoints[0])\n", "\"\"\"\nThis module provides a large set of colormaps, functions for\nregistering new colormaps and for getting a colormap by name,\nand a mixin class for adding color mapping functionality.\n\n\"\"\"\nfrom __future__ import print_function\n\nimport os\n\nimport numpy as np\nfrom numpy import ma\nimport matplotlib as mpl\nimport matplotlib.colors as colors\nimport matplotlib.cbook as cbook\nfrom matplotlib._cm import datad\nfrom matplotlib._cm import cubehelix\n\ncmap_d = dict()\n\n# reverse all the colormaps.\n# reversed colormaps have '_r' appended to the name.\n\ndef _reverser(f):\n def freversed(x):\n return f(1-x)\n return freversed\n\ndef revcmap(data):\n \"\"\"Can only handle specification *data* in dictionary format.\"\"\"\n data_r = {}\n for key, val in data.iteritems():\n if callable(val):\n valnew = _reverser(val)\n # This doesn't work: lambda x: val(1-x)\n # The same \"val\" (the first one) is used\n # each time, so the colors are identical\n # and the result is shades of gray.\n else:\n # Flip x and exchange the y values facing x = 0 and x = 1.\n valnew = [(1.0 - x, y1, y0) for x, y0, y1 in reversed(val)]\n data_r[key] = valnew\n return data_r\n\ndef _reverse_cmap_spec(spec):\n \"\"\"Reverses cmap specification *spec*, can handle both dict and tuple\n type specs.\"\"\"\n\n if 'red' in spec:\n return revcmap(spec)\n else:\n revspec = list(reversed(spec))\n if len(revspec[0]) == 2: # e.g., (1, (1.0, 0.0, 1.0))\n revspec = [(1.0 - a, b) for a, b in revspec]\n return revspec\n\ndef _generate_cmap(name, lutsize):\n \"\"\"Generates the requested cmap from it's name *name*. The lut size is\n *lutsize*.\"\"\"\n\n spec = datad[name]\n\n # Generate the colormap object.\n if 'red' in spec:\n return colors.LinearSegmentedColormap(name, spec, lutsize)\n else:\n return colors.LinearSegmentedColormap.from_list(name, spec, lutsize)\n\nLUTSIZE = mpl.rcParams['image.lut']\n\n_cmapnames = datad.keys() # need this list because datad is changed in loop\n\n# Generate the reversed specifications ...\n\nfor cmapname in _cmapnames:\n spec = datad[cmapname]\n spec_reversed = _reverse_cmap_spec(spec)\n datad[cmapname + '_r'] = spec_reversed\n\n# Precache the cmaps with ``lutsize = LUTSIZE`` ...\n\n# Use datad.keys() to also add the reversed ones added in the section above:\nfor cmapname in datad.iterkeys():\n cmap_d[cmapname] = _generate_cmap(cmapname, LUTSIZE)\n\nlocals().update(cmap_d)\n\n# Continue with definitions ...\n\ndef register_cmap(name=None, cmap=None, data=None, lut=None):\n \"\"\"\n Add a colormap to the set recognized by :func:`get_cmap`.\n\n It can be used in two ways::\n\n register_cmap(name='swirly', cmap=swirly_cmap)\n\n register_cmap(name='choppy', data=choppydata, lut=128)\n\n In the first case, *cmap* must be a :class:`colors.Colormap`\n instance. The *name* is optional; if absent, the name will\n be the :attr:`name` attribute of the *cmap*.\n\n In the second case, the three arguments are passed to\n the :class:`colors.LinearSegmentedColormap` initializer,\n and the resulting colormap is registered.\n\n \"\"\"\n if name is None:\n try:\n name = cmap.name\n except AttributeError:\n raise ValueError(\"Arguments must include a name or a Colormap\")\n\n if not cbook.is_string_like(name):\n raise ValueError(\"Colormap name must be a string\")\n\n if isinstance(cmap, colors.Colormap):\n cmap_d[name] = cmap\n return\n\n # For the remainder, let exceptions propagate.\n if lut is None:\n lut = mpl.rcParams['image.lut']\n cmap = colors.LinearSegmentedColormap(name, data, lut)\n cmap_d[name] = cmap\n\ndef get_cmap(name=None, lut=None):\n \"\"\"\n Get a colormap instance, defaulting to rc values if *name* is None.\n\n Colormaps added with :func:`register_cmap` take precedence over\n builtin colormaps.\n\n If *name* is a :class:`colors.Colormap` instance, it will be\n returned.\n\n If *lut* is not None it must be an integer giving the number of\n entries desired in the lookup table, and *name* must be a\n standard mpl colormap name with a corresponding data dictionary\n in *datad*.\n \"\"\"\n if name is None:\n name = mpl.rcParams['image.cmap']\n\n if isinstance(name, colors.Colormap):\n return name\n\n if name in cmap_d:\n if lut is None:\n return cmap_d[name]\n elif name in datad:\n return _generate_cmap(name, lut)\n\n raise ValueError(\"Colormap %s is not recognized\" % name)\n\nclass ScalarMappable:\n \"\"\"\n This is a mixin class to support scalar -> RGBA mapping. Handles\n normalization and colormapping\n \"\"\"\n\n def __init__(self, norm=None, cmap=None):\n \"\"\"\n *norm* is an instance of :class:`colors.Normalize` or one of\n its subclasses, used to map luminance to 0-1. *cmap* is a\n :mod:`cm` colormap instance, for example :data:`cm.jet`\n \"\"\"\n\n self.callbacksSM = cbook.CallbackRegistry()\n\n if cmap is None: cmap = get_cmap()\n if norm is None: norm = colors.Normalize()\n\n self._A = None\n self.norm = norm\n self.cmap = get_cmap(cmap)\n self.colorbar = None\n self.update_dict = {'array':False}\n\n def set_colorbar(self, im, ax):\n 'set the colorbar image and axes associated with mappable'\n self.colorbar = im, ax\n\n def to_rgba(self, x, alpha=None, bytes=False):\n \"\"\"\n Return a normalized rgba array corresponding to *x*.\n\n In the normal case, *x* is a 1-D or 2-D sequence of scalars, and\n the corresponding ndarray of rgba values will be returned,\n based on the norm and colormap set for this ScalarMappable.\n\n There is one special case, for handling images that are already\n rgb or rgba, such as might have been read from an image file.\n If *x* is an ndarray with 3 dimensions,\n and the last dimension is either 3 or 4, then it will be\n treated as an rgb or rgba array, and no mapping will be done.\n If the last dimension is 3, the *alpha* kwarg (defaulting to 1)\n will be used to fill in the transparency. If the last dimension\n is 4, the *alpha* kwarg is ignored; it does not\n replace the pre-existing alpha. A ValueError will be raised\n if the third dimension is other than 3 or 4.\n\n In either case, if *bytes* is *False* (default), the rgba\n array will be floats in the 0-1 range; if it is *True*,\n the returned rgba array will be uint8 in the 0 to 255 range.\n\n Note: this method assumes the input is well-behaved; it does\n not check for anomalies such as *x* being a masked rgba\n array, or being an integer type other than uint8, or being\n a floating point rgba array with values outside the 0-1 range.\n \"\"\"\n # First check for special case, image input:\n try:\n if x.ndim == 3:\n if x.shape[2] == 3:\n if alpha is None:\n alpha = 1\n if x.dtype == np.uint8:\n alpha = np.uint8(alpha * 255)\n m, n = x.shape[:2]\n xx = np.empty(shape=(m,n,4), dtype = x.dtype)\n xx[:,:,:3] = x\n xx[:,:,3] = alpha\n elif x.shape[2] == 4:\n xx = x\n else:\n raise ValueError(\"third dimension must be 3 or 4\")\n if bytes and xx.dtype != np.uint8:\n xx = (xx * 255).astype(np.uint8)\n if not bytes and xx.dtype == np.uint8:\n xx = xx.astype(float) / 255\n return xx\n except AttributeError:\n # e.g., x is not an ndarray; so try mapping it\n pass\n\n # This is the normal case, mapping a scalar array:\n x = ma.asarray(x)\n x = self.norm(x)\n x = self.cmap(x, alpha=alpha, bytes=bytes)\n return x\n\n def set_array(self, A):\n 'Set the image array from numpy array *A*'\n self._A = A\n self.update_dict['array'] = True\n\n def get_array(self):\n 'Return the array'\n return self._A\n\n def get_cmap(self):\n 'return the colormap'\n return self.cmap\n\n def get_clim(self):\n 'return the min, max of the color limits for image scaling'\n return self.norm.vmin, self.norm.vmax\n\n def set_clim(self, vmin=None, vmax=None):\n \"\"\"\n set the norm limits for image scaling; if *vmin* is a length2\n sequence, interpret it as ``(vmin, vmax)`` which is used to\n support setp\n\n ACCEPTS: a length 2 sequence of floats\n \"\"\"\n if (vmin is not None and vmax is None and\n cbook.iterable(vmin) and len(vmin)==2):\n vmin, vmax = vmin\n\n if vmin is not None: self.norm.vmin = vmin\n if vmax is not None: self.norm.vmax = vmax\n self.changed()\n\n def set_cmap(self, cmap):\n \"\"\"\n set the colormap for luminance data\n\n ACCEPTS: a colormap or registered colormap name\n \"\"\"\n cmap = get_cmap(cmap)\n self.cmap = cmap\n self.changed()\n\n def set_norm(self, norm):\n 'set the normalization instance'\n if norm is None: norm = colors.Normalize()\n self.norm = norm\n self.changed()\n\n def autoscale(self):\n \"\"\"\n Autoscale the scalar limits on the norm instance using the\n current array\n \"\"\"\n if self._A is None:\n raise TypeError('You must first set_array for mappable')\n self.norm.autoscale(self._A)\n self.changed()\n\n def autoscale_None(self):\n \"\"\"\n Autoscale the scalar limits on the norm instance using the\n current array, changing only limits that are None\n \"\"\"\n if self._A is None:\n raise TypeError('You must first set_array for mappable')\n self.norm.autoscale_None(self._A)\n self.changed()\n\n\n def add_checker(self, checker):\n \"\"\"\n Add an entry to a dictionary of boolean flags\n that are set to True when the mappable is changed.\n \"\"\"\n self.update_dict[checker] = False\n\n def check_update(self, checker):\n \"\"\"\n If mappable has changed since the last check,\n return True; else return False\n \"\"\"\n if self.update_dict[checker]:\n self.update_dict[checker] = False\n return True\n return False\n\n def changed(self):\n \"\"\"\n Call this whenever the mappable is changed to notify all the\n callbackSM listeners to the 'changed' signal\n \"\"\"\n self.callbacksSM.process('changed', self)\n\n for key in self.update_dict:\n self.update_dict[key] = True\n", "from __future__ import division, print_function\nimport math\nimport os\nimport signal\nimport sys\n\nimport matplotlib\nfrom matplotlib import verbose\nfrom matplotlib.cbook import is_string_like, onetrue\nfrom matplotlib.backend_bases import RendererBase, GraphicsContextBase, \\\n FigureManagerBase, FigureCanvasBase, NavigationToolbar2, IdleEvent, \\\n cursors, TimerBase\nfrom matplotlib.backend_bases import ShowBase\n\nfrom matplotlib._pylab_helpers import Gcf\nfrom matplotlib.figure import Figure\nfrom matplotlib.mathtext import MathTextParser\nfrom matplotlib.widgets import SubplotTool\ntry:\n import matplotlib.backends.qt4_editor.figureoptions as figureoptions\nexcept ImportError:\n figureoptions = None\n\nfrom qt4_compat import QtCore, QtGui, _getSaveFileName, __version__\n\nbackend_version = __version__\ndef fn_name(): return sys._getframe(1).f_code.co_name\n\nDEBUG = False\n\ncursord = {\n cursors.MOVE : QtCore.Qt.SizeAllCursor,\n cursors.HAND : QtCore.Qt.PointingHandCursor,\n cursors.POINTER : QtCore.Qt.ArrowCursor,\n cursors.SELECT_REGION : QtCore.Qt.CrossCursor,\n }\n\ndef draw_if_interactive():\n \"\"\"\n Is called after every pylab drawing command\n \"\"\"\n if matplotlib.is_interactive():\n figManager = Gcf.get_active()\n if figManager != None:\n figManager.canvas.draw_idle()\n\ndef _create_qApp():\n \"\"\"\n Only one qApp can exist at a time, so check before creating one.\n \"\"\"\n if QtGui.QApplication.startingUp():\n if DEBUG: print(\"Starting up QApplication\")\n global qApp\n app = QtGui.QApplication.instance()\n if app is None:\n qApp = QtGui.QApplication( [\" \"] )\n QtCore.QObject.connect( qApp, QtCore.SIGNAL( \"lastWindowClosed()\" ),\n qApp, QtCore.SLOT( \"quit()\" ) )\n else:\n qApp = app\n\nclass Show(ShowBase):\n def mainloop(self):\n # allow KeyboardInterrupt exceptions to close the plot window.\n signal.signal(signal.SIGINT, signal.SIG_DFL)\n\n QtGui.qApp.exec_()\nshow = Show()\n\n\ndef new_figure_manager( num, *args, **kwargs ):\n \"\"\"\n Create a new figure manager instance\n \"\"\"\n thisFig = Figure( *args, **kwargs )\n canvas = FigureCanvasQT( thisFig )\n manager = FigureManagerQT( canvas, num )\n return manager\n\n\nclass TimerQT(TimerBase):\n '''\n Subclass of :class:`backend_bases.TimerBase` that uses Qt4 timer events.\n\n Attributes:\n * interval: The time between timer events in milliseconds. Default\n is 1000 ms.\n * single_shot: Boolean flag indicating whether this timer should\n operate as single shot (run once and then stop). Defaults to False.\n * callbacks: Stores list of (func, args) tuples that will be called\n upon timer events. This list can be manipulated directly, or the\n functions add_callback and remove_callback can be used.\n '''\n def __init__(self, *args, **kwargs):\n TimerBase.__init__(self, *args, **kwargs)\n\n # Create a new timer and connect the timeout() signal to the\n # _on_timer method.\n self._timer = QtCore.QTimer()\n QtCore.QObject.connect(self._timer, QtCore.SIGNAL('timeout()'),\n self._on_timer)\n\n def __del__(self):\n # Probably not necessary in practice, but is good behavior to disconnect\n TimerBase.__del__(self)\n QtCore.QObject.disconnect(self._timer , QtCore.SIGNAL('timeout()'),\n self._on_timer)\n\n def _timer_set_single_shot(self):\n self._timer.setSingleShot(self._single)\n\n def _timer_set_interval(self):\n self._timer.setInterval(self._interval)\n\n def _timer_start(self):\n self._timer.start()\n\n def _timer_stop(self):\n self._timer.stop()\n\n\nclass FigureCanvasQT( QtGui.QWidget, FigureCanvasBase ):\n keyvald = { QtCore.Qt.Key_Control : 'control',\n QtCore.Qt.Key_Shift : 'shift',\n QtCore.Qt.Key_Alt : 'alt',\n QtCore.Qt.Key_Meta : 'super',\n QtCore.Qt.Key_Return : 'enter',\n QtCore.Qt.Key_Left : 'left',\n QtCore.Qt.Key_Up : 'up',\n QtCore.Qt.Key_Right : 'right',\n QtCore.Qt.Key_Down : 'down',\n QtCore.Qt.Key_Escape : 'escape',\n QtCore.Qt.Key_F1 : 'f1',\n QtCore.Qt.Key_F2 : 'f2',\n QtCore.Qt.Key_F3 : 'f3',\n QtCore.Qt.Key_F4 : 'f4',\n QtCore.Qt.Key_F5 : 'f5',\n QtCore.Qt.Key_F6 : 'f6',\n QtCore.Qt.Key_F7 : 'f7',\n QtCore.Qt.Key_F8 : 'f8',\n QtCore.Qt.Key_F9 : 'f9',\n QtCore.Qt.Key_F10 : 'f10',\n QtCore.Qt.Key_F11 : 'f11',\n QtCore.Qt.Key_F12 : 'f12',\n QtCore.Qt.Key_Home : 'home',\n QtCore.Qt.Key_End : 'end',\n QtCore.Qt.Key_PageUp : 'pageup',\n QtCore.Qt.Key_PageDown : 'pagedown',\n }\n\n # define the modifier keys which are to be collected on keyboard events.\n # format is: [(modifier_flag, modifier_name, equivalent_key)\n _modifier_keys = [\n (QtCore.Qt.MetaModifier, 'super', QtCore.Qt.Key_Meta),\n (QtCore.Qt.AltModifier, 'alt', QtCore.Qt.Key_Alt),\n (QtCore.Qt.ControlModifier, 'ctrl', QtCore.Qt.Key_Control) \n ]\n \n _ctrl_modifier = QtCore.Qt.ControlModifier\n \n if sys.platform == 'darwin':\n # in OSX, the control and super (aka cmd/apple) keys are switched, so \n # switch them back.\n keyvald.update({\n QtCore.Qt.Key_Control : 'super', # cmd/apple key\n QtCore.Qt.Key_Meta : 'control',\n })\n \n _modifier_keys = [\n (QtCore.Qt.ControlModifier, 'super', QtCore.Qt.Key_Control),\n (QtCore.Qt.AltModifier, 'alt', QtCore.Qt.Key_Alt),\n (QtCore.Qt.MetaModifier, 'ctrl', QtCore.Qt.Key_Meta),\n ]\n \n _ctrl_modifier = QtCore.Qt.MetaModifier\n\n # map Qt button codes to MouseEvent's ones:\n buttond = {QtCore.Qt.LeftButton : 1,\n QtCore.Qt.MidButton : 2,\n QtCore.Qt.RightButton : 3,\n # QtCore.Qt.XButton1 : None,\n # QtCore.Qt.XButton2 : None,\n }\n\n def __init__( self, figure ):\n if DEBUG: print('FigureCanvasQt: ', figure)\n _create_qApp()\n\n QtGui.QWidget.__init__( self )\n FigureCanvasBase.__init__( self, figure )\n self.figure = figure\n self.setMouseTracking( True )\n self._idle = True\n # hide until we can test and fix\n #self.startTimer(backend_IdleEvent.milliseconds)\n w,h = self.get_width_height()\n self.resize( w, h )\n\n # JDH: Note the commented out code below does not work as\n # expected, because according to Pierre Raybaut, The reason is\n # that PyQt fails (silently) to call a method of this object\n # just before detroying it. Using a lambda function will work,\n # exactly the same as using a function (which is not bound to\n # the object to be destroyed).\n #\n #QtCore.QObject.connect(self, QtCore.SIGNAL('destroyed()'),\n # self.close_event)\n QtCore.QObject.connect(self, QtCore.SIGNAL('destroyed()'),\n lambda: self.close_event())\n\n def __timerEvent(self, event):\n # hide until we can test and fix\n self.mpl_idle_event(event)\n\n def enterEvent(self, event):\n FigureCanvasBase.enter_notify_event(self, event)\n\n def leaveEvent(self, event):\n QtGui.QApplication.restoreOverrideCursor()\n FigureCanvasBase.leave_notify_event(self, event)\n\n def mousePressEvent( self, event ):\n x = event.pos().x()\n # flipy so y=0 is bottom of canvas\n y = self.figure.bbox.height - event.pos().y()\n button = self.buttond.get(event.button())\n if button is not None:\n FigureCanvasBase.button_press_event( self, x, y, button )\n if DEBUG: print('button pressed:', event.button())\n\n def mouseDoubleClickEvent(self, event):\n x = event.pos().x()\n # flipy so y=0 is bottom of canvas\n y = self.figure.bbox.height - event.pos().y()\n button = self.buttond.get(event.button())\n if button is not None:\n FigureCanvasBase.button_press_event( self, x, y, button, dblclick=True )\n if DEBUG: print ('button doubleclicked:', event.button())\n\n def mouseMoveEvent( self, event ):\n x = event.x()\n # flipy so y=0 is bottom of canvas\n y = self.figure.bbox.height - event.y()\n FigureCanvasBase.motion_notify_event( self, x, y )\n #if DEBUG: print 'mouse move'\n\n def mouseReleaseEvent( self, event ):\n x = event.x()\n # flipy so y=0 is bottom of canvas\n y = self.figure.bbox.height - event.y()\n button = self.buttond.get(event.button())\n if button is not None:\n FigureCanvasBase.button_release_event( self, x, y, button )\n if DEBUG: print('button released')\n\n def wheelEvent( self, event ):\n x = event.x()\n # flipy so y=0 is bottom of canvas\n y = self.figure.bbox.height - event.y()\n # from QWheelEvent::delta doc\n steps = event.delta()/120\n if (event.orientation() == QtCore.Qt.Vertical):\n FigureCanvasBase.scroll_event( self, x, y, steps)\n if DEBUG: print('scroll event : delta = %i, steps = %i ' % (event.delta(),steps))\n\n def keyPressEvent( self, event ):\n key = self._get_key( event )\n if key is None:\n return\n FigureCanvasBase.key_press_event( self, key )\n if DEBUG: print('key press', key)\n\n def keyReleaseEvent( self, event ):\n key = self._get_key(event)\n if key is None:\n return\n FigureCanvasBase.key_release_event( self, key )\n if DEBUG: print('key release', key)\n\n def resizeEvent( self, event ):\n if DEBUG: print('resize (%d x %d)' % (event.size().width(), event.size().height()))\n w = event.size().width()\n h = event.size().height()\n if DEBUG: print(\"FigureCanvasQtAgg.resizeEvent(\", w, \",\", h, \")\")\n dpival = self.figure.dpi\n winch = w/dpival\n hinch = h/dpival\n self.figure.set_size_inches( winch, hinch )\n self.draw()\n self.update()\n QtGui.QWidget.resizeEvent(self, event)\n\n def sizeHint( self ):\n w, h = self.get_width_height()\n return QtCore.QSize( w, h )\n\n def minumumSizeHint( self ):\n return QtCore.QSize( 10, 10 )\n\n def _get_key( self, event ):\n if event.isAutoRepeat():\n return None\n\n if event.key() < 256:\n key = unicode(event.text())\n # if the control key is being pressed, we don't get the correct\n # characters, so interpret them directly from the event.key(). \n # Unfortunately, this means that we cannot handle key's case \n # since event.key() is not case sensitive, whereas event.text() is,\n # Finally, since it is not possible to get the CapsLock state\n # we cannot accurately compute the case of a pressed key when \n # ctrl+shift+p is pressed.\n if int(event.modifiers()) & self._ctrl_modifier:\n # we always get an uppercase character\n key = chr(event.key())\n # if shift is not being pressed, lowercase it (as mentioned, \n # this does not take into account the CapsLock state)\n if not int(event.modifiers()) & QtCore.Qt.ShiftModifier:\n key = key.lower()\n\n else:\n key = self.keyvald.get(event.key())\n\n if key is not None:\n # prepend the ctrl, alt, super keys if appropriate (sorted in that order) \n for modifier, prefix, Qt_key in self._modifier_keys:\n if event.key() != Qt_key and int(event.modifiers()) & modifier == modifier: \n key = u'{}+{}'.format(prefix, key)\n\n return key\n\n def new_timer(self, *args, **kwargs):\n \"\"\"\n Creates a new backend-specific subclass of :class:`backend_bases.Timer`.\n This is useful for getting periodic events through the backend's native\n event loop. Implemented only for backends with GUIs.\n\n optional arguments:\n\n *interval*\n Timer interval in milliseconds\n *callbacks*\n Sequence of (func, args, kwargs) where func(*args, **kwargs) will\n be executed by the timer every *interval*.\n \"\"\"\n return TimerQT(*args, **kwargs)\n\n def flush_events(self):\n QtGui.qApp.processEvents()\n\n def start_event_loop(self,timeout):\n FigureCanvasBase.start_event_loop_default(self,timeout)\n start_event_loop.__doc__=FigureCanvasBase.start_event_loop_default.__doc__\n\n def stop_event_loop(self):\n FigureCanvasBase.stop_event_loop_default(self)\n stop_event_loop.__doc__=FigureCanvasBase.stop_event_loop_default.__doc__\n\n def draw_idle(self):\n 'update drawing area only if idle'\n d = self._idle\n self._idle = False\n def idle_draw(*args):\n self.draw()\n self._idle = True\n if d: QtCore.QTimer.singleShot(0, idle_draw)\n\nclass FigureManagerQT( FigureManagerBase ):\n \"\"\"\n Public attributes\n\n canvas : The FigureCanvas instance\n num : The Figure number\n toolbar : The qt.QToolBar\n window : The qt.QMainWindow\n \"\"\"\n\n def __init__( self, canvas, num ):\n if DEBUG: print('FigureManagerQT.%s' % fn_name())\n FigureManagerBase.__init__( self, canvas, num )\n self.canvas = canvas\n self.window = QtGui.QMainWindow()\n self.window.setAttribute(QtCore.Qt.WA_DeleteOnClose)\n\n self.window.setWindowTitle(\"Figure %d\" % num)\n image = os.path.join( matplotlib.rcParams['datapath'],'images','matplotlib.png' )\n self.window.setWindowIcon(QtGui.QIcon( image ))\n\n # Give the keyboard focus to the figure instead of the\n # manager; StrongFocus accepts both tab and click to focus and\n # will enable the canvas to process event w/o clicking.\n # ClickFocus only takes the focus is the window has been\n # clicked\n # on. http://developer.qt.nokia.com/doc/qt-4.8/qt.html#FocusPolicy-enum\n self.canvas.setFocusPolicy( QtCore.Qt.StrongFocus )\n self.canvas.setFocus()\n\n QtCore.QObject.connect( self.window, QtCore.SIGNAL( 'destroyed()' ),\n self._widgetclosed )\n self.window._destroying = False\n\n self.toolbar = self._get_toolbar(self.canvas, self.window)\n if self.toolbar is not None:\n self.window.addToolBar(self.toolbar)\n QtCore.QObject.connect(self.toolbar, QtCore.SIGNAL(\"message\"),\n self._show_message)\n tbs_height = self.toolbar.sizeHint().height()\n else:\n tbs_height = 0\n\n # resize the main window so it will display the canvas with the\n # requested size:\n cs = canvas.sizeHint()\n sbs = self.window.statusBar().sizeHint()\n self._status_and_tool_height = tbs_height+sbs.height()\n height = cs.height() + self._status_and_tool_height\n self.window.resize(cs.width(), height)\n\n self.window.setCentralWidget(self.canvas)\n\n if matplotlib.is_interactive():\n self.window.show()\n\n # attach a show method to the figure for pylab ease of use\n self.canvas.figure.show = lambda *args: self.window.show()\n\n def notify_axes_change( fig ):\n # This will be called whenever the current axes is changed\n if self.toolbar is not None:\n self.toolbar.update()\n self.canvas.figure.add_axobserver( notify_axes_change )\n\n @QtCore.Slot()\n def _show_message(self,s):\n # Fixes a PySide segfault.\n self.window.statusBar().showMessage(s)\n\n def full_screen_toggle(self):\n if self.window.isFullScreen():\n self.window.showNormal() \n else:\n self.window.showFullScreen()\n\n def _widgetclosed( self ):\n if self.window._destroying: return\n self.window._destroying = True\n try:\n Gcf.destroy(self.num)\n except AttributeError:\n pass\n # It seems that when the python session is killed,\n # Gcf can get destroyed before the Gcf.destroy\n # line is run, leading to a useless AttributeError.\n\n def _get_toolbar(self, canvas, parent):\n # must be inited after the window, drawingArea and figure\n # attrs are set\n if matplotlib.rcParams['toolbar'] == 'classic':\n print(\"Classic toolbar is not supported\")\n elif matplotlib.rcParams['toolbar'] == 'toolbar2':\n toolbar = NavigationToolbar2QT(canvas, parent, False)\n else:\n toolbar = None\n return toolbar\n\n def resize(self, width, height):\n 'set the canvas size in pixels'\n self.window.resize(width, height + self._status_and_tool_height)\n\n def show(self):\n self.window.show()\n\n def destroy( self, *args ):\n # check for qApp first, as PySide deletes it in its atexit handler\n if QtGui.QApplication.instance() is None: return\n if self.window._destroying: return\n self.window._destroying = True\n QtCore.QObject.disconnect( self.window, QtCore.SIGNAL( 'destroyed()' ),\n self._widgetclosed )\n if self.toolbar: self.toolbar.destroy()\n if DEBUG: print(\"destroy figure manager\")\n self.window.close()\n\n def set_window_title(self, title):\n self.window.setWindowTitle(title)\n\nclass NavigationToolbar2QT( NavigationToolbar2, QtGui.QToolBar ):\n def __init__(self, canvas, parent, coordinates=True):\n \"\"\" coordinates: should we show the coordinates on the right? \"\"\"\n self.canvas = canvas\n self.coordinates = coordinates\n QtGui.QToolBar.__init__( self, parent )\n NavigationToolbar2.__init__( self, canvas )\n\n def _icon(self, name):\n return QtGui.QIcon(os.path.join(self.basedir, name))\n\n def _init_toolbar(self):\n self.basedir = os.path.join(matplotlib.rcParams[ 'datapath' ],'images')\n\n for text, tooltip_text, image_file, callback in self.toolitems:\n if text is None:\n self.addSeparator()\n else:\n a = self.addAction(self._icon(image_file + '.png'), text, getattr(self, callback))\n if tooltip_text is not None:\n a.setToolTip(tooltip_text)\n \n if figureoptions is not None:\n a = self.addAction(self._icon(\"qt4_editor_options.png\"),\n 'Customize', self.edit_parameters)\n a.setToolTip('Edit curves line and axes parameters')\n\n a = self.addAction(self._icon('filesave.png'), 'Save',\n self.save_figure)\n a.setToolTip('Save the figure')\n\n\n self.buttons = {}\n\n # Add the x,y location widget at the right side of the toolbar\n # The stretch factor is 1 which means any resizing of the toolbar\n # will resize this label instead of the buttons.\n if self.coordinates:\n self.locLabel = QtGui.QLabel( \"\", self )\n self.locLabel.setAlignment(\n QtCore.Qt.AlignRight | QtCore.Qt.AlignTop )\n self.locLabel.setSizePolicy(\n QtGui.QSizePolicy(QtGui.QSizePolicy.Expanding,\n QtGui.QSizePolicy.Ignored))\n labelAction = self.addWidget(self.locLabel)\n labelAction.setVisible(True)\n\n # reference holder for subplots_adjust window\n self.adj_window = None\n\n if figureoptions is not None:\n def edit_parameters(self):\n allaxes = self.canvas.figure.get_axes()\n if len(allaxes) == 1:\n axes = allaxes[0]\n else:\n titles = []\n for axes in allaxes:\n title = axes.get_title()\n ylabel = axes.get_ylabel()\n if title:\n fmt = \"%(title)s\"\n if ylabel:\n fmt += \": %(ylabel)s\"\n fmt += \" (%(axes_repr)s)\"\n elif ylabel:\n fmt = \"%(axes_repr)s (%(ylabel)s)\"\n else:\n fmt = \"%(axes_repr)s\"\n titles.append(fmt % dict(title = title,\n ylabel = ylabel,\n axes_repr = repr(axes)))\n item, ok = QtGui.QInputDialog.getItem(self, 'Customize',\n 'Select axes:', titles,\n 0, False)\n if ok:\n axes = allaxes[titles.index(unicode(item))]\n else:\n return\n\n figureoptions.figure_edit(axes, self)\n\n\n def dynamic_update( self ):\n self.canvas.draw()\n\n def set_message( self, s ):\n self.emit(QtCore.SIGNAL(\"message\"), s)\n if self.coordinates:\n self.locLabel.setText(s.replace(', ', '\\n'))\n\n def set_cursor( self, cursor ):\n if DEBUG: print('Set cursor' , cursor)\n QtGui.QApplication.restoreOverrideCursor()\n QtGui.QApplication.setOverrideCursor( QtGui.QCursor( cursord[cursor] ) )\n\n def draw_rubberband( self, event, x0, y0, x1, y1 ):\n height = self.canvas.figure.bbox.height\n y1 = height - y1\n y0 = height - y0\n\n w = abs(x1 - x0)\n h = abs(y1 - y0)\n\n rect = [ int(val)for val in (min(x0,x1), min(y0, y1), w, h) ]\n self.canvas.drawRectangle( rect )\n\n def configure_subplots(self):\n self.adj_window = QtGui.QMainWindow()\n win = self.adj_window\n win.setAttribute(QtCore.Qt.WA_DeleteOnClose)\n\n win.setWindowTitle(\"Subplot Configuration Tool\")\n image = os.path.join( matplotlib.rcParams['datapath'],'images','matplotlib.png' )\n win.setWindowIcon(QtGui.QIcon( image ))\n\n tool = SubplotToolQt(self.canvas.figure, win)\n win.setCentralWidget(tool)\n win.setSizePolicy(QtGui.QSizePolicy.Preferred, QtGui.QSizePolicy.Preferred)\n\n win.show()\n\n def _get_canvas(self, fig):\n return FigureCanvasQT(fig)\n\n def save_figure(self, *args):\n filetypes = self.canvas.get_supported_filetypes_grouped()\n sorted_filetypes = filetypes.items()\n sorted_filetypes.sort()\n default_filetype = self.canvas.get_default_filetype()\n\n start = \"image.\" + default_filetype\n filters = []\n selectedFilter = None\n for name, exts in sorted_filetypes:\n exts_list = \" \".join(['*.%s' % ext for ext in exts])\n filter = '%s (%s)' % (name, exts_list)\n if default_filetype in exts:\n selectedFilter = filter\n filters.append(filter)\n filters = ';;'.join(filters)\n\n fname = _getSaveFileName(self, \"Choose a filename to save to\",\n start, filters, selectedFilter)\n if fname:\n try:\n self.canvas.print_figure( unicode(fname) )\n except Exception as e:\n QtGui.QMessageBox.critical(\n self, \"Error saving file\", str(e),\n QtGui.QMessageBox.Ok, QtGui.QMessageBox.NoButton)\n\n\n\nclass SubplotToolQt( SubplotTool, QtGui.QWidget ):\n def __init__(self, targetfig, parent):\n QtGui.QWidget.__init__(self, None)\n\n self.targetfig = targetfig\n self.parent = parent\n\n self.sliderleft = QtGui.QSlider(QtCore.Qt.Horizontal)\n self.sliderbottom = QtGui.QSlider(QtCore.Qt.Vertical)\n self.sliderright = QtGui.QSlider(QtCore.Qt.Horizontal)\n self.slidertop = QtGui.QSlider(QtCore.Qt.Vertical)\n self.sliderwspace = QtGui.QSlider(QtCore.Qt.Horizontal)\n self.sliderhspace = QtGui.QSlider(QtCore.Qt.Vertical)\n\n # constraints\n QtCore.QObject.connect( self.sliderleft,\n QtCore.SIGNAL( \"valueChanged(int)\" ),\n self.sliderright.setMinimum )\n QtCore.QObject.connect( self.sliderright,\n QtCore.SIGNAL( \"valueChanged(int)\" ),\n self.sliderleft.setMaximum )\n QtCore.QObject.connect( self.sliderbottom,\n QtCore.SIGNAL( \"valueChanged(int)\" ),\n self.slidertop.setMinimum )\n QtCore.QObject.connect( self.slidertop,\n QtCore.SIGNAL( \"valueChanged(int)\" ),\n self.sliderbottom.setMaximum )\n\n sliders = (self.sliderleft, self.sliderbottom, self.sliderright,\n self.slidertop, self.sliderwspace, self.sliderhspace, )\n adjustments = ('left:', 'bottom:', 'right:', 'top:', 'wspace:', 'hspace:')\n\n for slider, adjustment in zip(sliders, adjustments):\n slider.setMinimum(0)\n slider.setMaximum(1000)\n slider.setSingleStep(5)\n\n layout = QtGui.QGridLayout()\n\n leftlabel = QtGui.QLabel('left')\n layout.addWidget(leftlabel, 2, 0)\n layout.addWidget(self.sliderleft, 2, 1)\n\n toplabel = QtGui.QLabel('top')\n layout.addWidget(toplabel, 0, 2)\n layout.addWidget(self.slidertop, 1, 2)\n layout.setAlignment(self.slidertop, QtCore.Qt.AlignHCenter)\n\n bottomlabel = QtGui.QLabel('bottom')\n layout.addWidget(QtGui.QLabel('bottom'), 4, 2)\n layout.addWidget(self.sliderbottom, 3, 2)\n layout.setAlignment(self.sliderbottom, QtCore.Qt.AlignHCenter)\n\n rightlabel = QtGui.QLabel('right')\n layout.addWidget(rightlabel, 2, 4)\n layout.addWidget(self.sliderright, 2, 3)\n\n hspacelabel = QtGui.QLabel('hspace')\n layout.addWidget(hspacelabel, 0, 6)\n layout.setAlignment(hspacelabel, QtCore.Qt.AlignHCenter)\n layout.addWidget(self.sliderhspace, 1, 6)\n layout.setAlignment(self.sliderhspace, QtCore.Qt.AlignHCenter)\n\n wspacelabel = QtGui.QLabel('wspace')\n layout.addWidget(wspacelabel, 4, 6)\n layout.setAlignment(wspacelabel, QtCore.Qt.AlignHCenter)\n layout.addWidget(self.sliderwspace, 3, 6)\n layout.setAlignment(self.sliderwspace, QtCore.Qt.AlignBottom)\n\n layout.setRowStretch(1,1)\n layout.setRowStretch(3,1)\n layout.setColumnStretch(1,1)\n layout.setColumnStretch(3,1)\n layout.setColumnStretch(6,1)\n\n self.setLayout(layout)\n\n self.sliderleft.setSliderPosition(int(targetfig.subplotpars.left*1000))\n self.sliderbottom.setSliderPosition(\\\n int(targetfig.subplotpars.bottom*1000))\n self.sliderright.setSliderPosition(\\\n int(targetfig.subplotpars.right*1000))\n self.slidertop.setSliderPosition(int(targetfig.subplotpars.top*1000))\n self.sliderwspace.setSliderPosition(\\\n int(targetfig.subplotpars.wspace*1000))\n self.sliderhspace.setSliderPosition(\\\n int(targetfig.subplotpars.hspace*1000))\n\n QtCore.QObject.connect( self.sliderleft,\n QtCore.SIGNAL( \"valueChanged(int)\" ),\n self.funcleft )\n QtCore.QObject.connect( self.sliderbottom,\n QtCore.SIGNAL( \"valueChanged(int)\" ),\n self.funcbottom )\n QtCore.QObject.connect( self.sliderright,\n QtCore.SIGNAL( \"valueChanged(int)\" ),\n self.funcright )\n QtCore.QObject.connect( self.slidertop,\n QtCore.SIGNAL( \"valueChanged(int)\" ),\n self.functop )\n QtCore.QObject.connect( self.sliderwspace,\n QtCore.SIGNAL( \"valueChanged(int)\" ),\n self.funcwspace )\n QtCore.QObject.connect( self.sliderhspace,\n QtCore.SIGNAL( \"valueChanged(int)\" ),\n self.funchspace )\n\n def funcleft(self, val):\n if val == self.sliderright.value():\n val -= 1\n self.targetfig.subplots_adjust(left=val/1000.)\n if self.drawon: self.targetfig.canvas.draw()\n\n def funcright(self, val):\n if val == self.sliderleft.value():\n val += 1\n self.targetfig.subplots_adjust(right=val/1000.)\n if self.drawon: self.targetfig.canvas.draw()\n\n def funcbottom(self, val):\n if val == self.slidertop.value():\n val -= 1\n self.targetfig.subplots_adjust(bottom=val/1000.)\n if self.drawon: self.targetfig.canvas.draw()\n\n def functop(self, val):\n if val == self.sliderbottom.value():\n val += 1\n self.targetfig.subplots_adjust(top=val/1000.)\n if self.drawon: self.targetfig.canvas.draw()\n\n def funcwspace(self, val):\n self.targetfig.subplots_adjust(wspace=val/1000.)\n if self.drawon: self.targetfig.canvas.draw()\n\n def funchspace(self, val):\n self.targetfig.subplots_adjust(hspace=val/1000.)\n if self.drawon: self.targetfig.canvas.draw()\n\n\ndef error_msg_qt( msg, parent=None ):\n if not is_string_like( msg ):\n msg = ','.join( map( str,msg ) )\n\n QtGui.QMessageBox.warning( None, \"Matplotlib\", msg, QtGui.QMessageBox.Ok )\n\ndef exception_handler( type, value, tb ):\n \"\"\"Handle uncaught exceptions\n It does not catch SystemExit\n \"\"\"\n msg = ''\n # get the filename attribute if available (for IOError)\n if hasattr(value, 'filename') and value.filename != None:\n msg = value.filename + ': '\n if hasattr(value, 'strerror') and value.strerror != None:\n msg += value.strerror\n else:\n msg += str(value)\n\n if len( msg ) : error_msg_qt( msg )\n\n\nFigureManager = FigureManagerQT\n" ]
[ [ "matplotlib.transforms.Affine2D.from_values", "numpy.allclose", "matplotlib.scale.LogScale.Log10Transform", "matplotlib.transforms.Affine2D", "matplotlib.path.Path", "matplotlib.pyplot.draw", "matplotlib.pyplot.axes", "numpy.testing.assert_almost_equal", "matplotlib.transforms.Transform.__init__", "numpy.array" ], [ "matplotlib._cm.datad.keys", "matplotlib.cbook.iterable", "numpy.ma.asarray", "matplotlib.colors.LinearSegmentedColormap", "numpy.uint8", "matplotlib.cbook.CallbackRegistry", "matplotlib.colors.Normalize", "numpy.empty", "matplotlib._cm.datad.iterkeys", "matplotlib.colors.LinearSegmentedColormap.from_list", "matplotlib.cbook.is_string_like" ], [ "matplotlib.backend_bases.FigureCanvasBase.enter_notify_event", "matplotlib.backend_bases.NavigationToolbar2.__init__", "matplotlib.backend_bases.FigureCanvasBase.scroll_event", "matplotlib._pylab_helpers.Gcf.get_active", "matplotlib.backends.qt4_editor.figureoptions.figure_edit", "matplotlib.backend_bases.TimerBase.__del__", "matplotlib._pylab_helpers.Gcf.destroy", "matplotlib.backend_bases.FigureCanvasBase.button_release_event", "matplotlib.backend_bases.TimerBase.__init__", "matplotlib.is_interactive", "matplotlib.backend_bases.FigureCanvasBase.start_event_loop_default", "matplotlib.backend_bases.FigureCanvasBase.key_press_event", "matplotlib.backend_bases.FigureCanvasBase.stop_event_loop_default", "matplotlib.backend_bases.FigureCanvasBase.leave_notify_event", "matplotlib.backend_bases.FigureCanvasBase.__init__", "matplotlib.figure.Figure", "matplotlib.backend_bases.FigureCanvasBase.motion_notify_event", "matplotlib.backend_bases.FigureManagerBase.__init__", "matplotlib.backend_bases.FigureCanvasBase.key_release_event", "matplotlib.backend_bases.FigureCanvasBase.button_press_event", "matplotlib.cbook.is_string_like" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
PartumSomnia/bns_ppr_tools
[ "b02bab870bb54171bc0d0cd7e07bfb50e978e7dd" ]
[ "module_ejecta/ejecta_formulas.py" ]
[ "\nimport numpy as np\n\nclass FORMULAS:\n\n @staticmethod\n def vinf(eninf):\n return np.sqrt(2. * eninf)\n\n @staticmethod\n def vinf_bern(eninf, enthalpy):\n return np.sqrt(2.*(enthalpy*(eninf + 1.) - 1.))\n\n @staticmethod\n def vel(w_lorentz):\n return np.sqrt(1. - 1. / (w_lorentz**2))\n\n @staticmethod\n def get_tau(rho, vel, radius, lrho_b):\n\n rho_b = 10 ** lrho_b\n tau_0 = 0.5 * 2.71828182845904523536 * (radius / vel) * (0.004925794970773136) # in ms\n tau_b = tau_0 * ((rho/rho_b) ** (1.0 / 3.0))\n return tau_b # ms\n\n @staticmethod\n def enthalpy(eps, press, rho):\n return 1 + eps + (press / rho)\n" ]
[ [ "numpy.sqrt" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
mjirik/wsicolorfilter
[ "85f8f3705d21065781d49d0b700ab162e9063870" ]
[ "wsicolorfilter/svm_filter.py" ]
[ "import pickle as plk\n\nfrom sklearn import svm\n\nfrom wsicolorfilter.filter import Filter\n\n\nclass SvmFilter(Filter):\n \"\"\"Filter which assign each pixel to the nearest centroid of the model.\"\"\"\n\n def create_model(self):\n return svm.LinearSVC()\n\n def train_model(self, x, y):\n # train model\n self.model.fit(x, y)\n\n def predict(self, img):\n orig_shape = img.shape\n\n # bitmap to string of pixels\n img = img.reshape((orig_shape[0] * orig_shape[1], orig_shape[2]))\n\n filter_mask = self.model.predict(img)\n filter_mask = filter_mask.reshape(orig_shape[0], orig_shape[1])\n filter_mask -= 1 # normalize output\n\n return filter_mask\n\n def load_model(self, file_name='svm_filter.npy'):\n with open(file_name, 'rb') as file:\n self.model = plk.load(file)\n\n def save_model(self, file_name='svm_filter.npy'):\n with open(file_name, 'wb') as file:\n plk.dump(self.model, file)\n" ]
[ [ "sklearn.svm.LinearSVC" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
idzol/battlesnake
[ "3d94e70143d4d5f1cffd79fe6b84b59e1cb4864b" ]
[ "_tests/test_interrupt.py" ]
[ "from typing import List, Dict\n\nimport math\nimport operator\nfrom operator import add\n\nimport random as rand\nimport numpy as np\n# import pandas as pd\n# import random as rand\nimport copy as copy\n\nimport time as time\nfrom logClass import log\n\nimport constants as CONST\nimport functions as fn\n\nfrom snakeClass import snake\nfrom boardClass import board\n\nclass snakeTest(snake):\n pass \n\n\nclass boardTest(board):\n\n def isRoutePointv2(self, start, turn, eating={}, path=[], enemy=False):\n # Start - check route points from start location\n # Turn - adjust for future turn state \n # Eating - adjust for past / future eating \n # Path - check past path points for collision\n # Enemy - ignore markov threat when predicting enemy moves\n\n w = self.width\n h = self.height\n\n step = copy.copy(start)\n # Get step\n dy = step[0]\n dx = step[1]\n\n # Get markov \n \n t = min(turn, CONST.lookAheadEnemy - 1)\n markov = copy.copy(self.markovs[t])\n\n # Get tails \n trails = copy.copy(self.trailsSnake)\n board = np.zeros([w, h], np.intc)\n\n for sid in trails:\n # Adjust trails for each snake based on eating\n if sid in eating.keys(): \n board += np.where(trails[sid], trails[sid] + eating[sid], trails[sid]) \n\n else: \n board += trails[sid]\n \n # print(\"DEBUG\", dx, dy, t, step, path)\n # Route logic \n if (self.inBounds(step)):\n if ( # Our prediction logic \n (((markov[dy, dx] < CONST.pointThreshold) or \n (t >= board[dy, dx] and \n markov[dy, dx] >= CONST.routeThreshold)) and \n not (step in path)) or \n # Enemy prediction logic \n (enemy and \n t >= board[dy, dx] and \n not (step in path)) \n ):\n\n return (True, copy.copy(markov[dy, dx]))\n \n return (False, CONST.pointThreshold)\n\n\n def getEnemyFuture(self, snakes, turns=2):\n\n sid_us = self.getIdentity()\n for sid in snakes:\n \n snake = snakes[sid]\n head = snake.getHead()\n paths = [] \n\n enemy = False \n if sid_us != snake.getId():\n enemy = True \n \n for dirn in CONST.directions:\n # initial step in each direction \n step = list(map(add, head, CONST.directionMap[dirn]))\n found, point = self.isRoutePointv2(step, 0, {}, [], enemy)\n if (found): \n paths.append(copy.copy([step]))\n\n # print(\"FUTURE\", head, paths)\n\n for turn in range(0, turns - 1):\n # for N-1 turns look in each direction for each path\n paths_new = []\n for path in paths: \n for dirn in CONST.directions:\n \n head_n = path[-1] \n step = list(map(add, head_n, CONST.directionMap[dirn]))\n found, point = self.isRoutePointv2(step, turn)\n route = path + [step]\n if (found): \n # New path found \n paths_new.append(copy.copy(route))\n\n # Concatenate new paths \n paths = paths + paths_new\n\n # print(\"SNAKE\", snake.getId(), paths)\n snake.setNextSteps(paths)\n\n\n # def isRoutePoint_simulate(step, turn, us, them):\n # if (them):\n # simulate = np.zeros([h, w], np.intc) \n # for t in them: \n # simulate[t[1],t[0]] = CONST.routeThreshold\n\n\n def simulateBoard_basic(snakes):\n # Set enemy step (outside fxn) \n # Simulate step \n pass \n\n # check if enemy head / our head on same square \n # if we are larger, win \n\n\ndef enemyStrategy(bo, snakes): \n # (1) select possible paths for enemy\n future = 2 \n dirn_avoid = []\n \n paths = bo.getEnemyFuture(snakes, future)\n # O(dirs * future * snakes)\n\n oursteps = us.getNextSteps()\n \n sid_us = bo.getIdentity()\n length_us = snakes[sid_us].getLength()\n steps_us = snakes[sid_us].getNextSteps()\n \n for sid in snakes:\n if sid != sid_us: \n snake = snakes[sid]\n length = snake.getLength()\n steps = snake.getNextSteps()\n\n \n for ourstep in steps_us:\n # Iterate through our steps \n for step in steps:\n # Check against enemy steps \n safe = True\n reason = \"\"\n \n if len(step) == len(ourstep):\n # Look for same turn (same length)\n\n # print(\"STEPS us:%s them:%s\" % (ourstep, step)) \n \n if step == ourstep:\n if length > length_us:\n # Check for collision (we are same / smaller) \n safe = False \n reason = \"head on collision\"\n\n else: \n\n # Check moves available \n turn = len(step)\n start = ourstep[-1]\n future = ourstep + step \n future.remove(start)\n\n found = bo.findEmptySpace(start, future, turn)\n \n # print(\"FOUND start:%s turn:%s future%s found %s\" % (start, turn, future, found)) \n \n # No paths\n if (not found):\n safe = False \n reason = \"no path for us\"\n \n \n if (not safe):\n # One of the enemy steps is not safe for our step. Abandon all paths in that direction (overcautious)\n # TODO: less agressive if we see a path out\n\n print (\"STEP sid:%s us:%s them:%s reason:%s\" % (sid, ourstep, step, reason))\n for s in steps_us:\n if ourstep[0] in s: \n steps_us.remove(s)\n dirn_avoid.append(ourstep[0])\n # dy = ourstep[0][0]\n # dx = ourstep[0][1]\n # self.markov[dy,dx] = CONST.routeThreshold\n\n snakes[sid_us].setNextSteps(steps_us)\n # print(\"FINAL PATHS\", dirn_avoid, steps_us)\n # return directions to avoid (mark as not reachable)\n return dirn_avoid\n\n\n# def enemyStrategy_chance(self):\n # (2) if our path = 100% (ie. single path)\n # and enemy head < us head distance\n # (stay off wall -- leave space for retreat / exit)\n\n # (3) logic that says they are 1x square from wall \n # if each point in probability cloud \n # then enclosed drops to zero .. \n # or intersects wtih our path @ 100% \n\n\ndata = {'game': {'id': '609d47ca-e773-49f9-b3f4-2c52afa4a05c', 'ruleset': {'name': 'solo', 'version': 'v1.0.22', 'settings': {'foodSpawnChance': 15, 'minimumFood': 1, 'hazardDamagePerTurn': 0, 'royale': {'shrinkEveryNTurns': 0}, 'squad': {'allowBodyCollisions': False, 'sharedElimination': False, 'sharedHealth': False, 'sharedLength': False}}}, 'timeout': 500, 'source': ''}, 'turn': 4, 'board': {'height': 11, 'width': 11, 'snakes': [], 'food': [], 'hazards': []}, 'you': {'id': 'gs_VYFDmY6qCM6MH6KJ7jKKybg3', 'name': 'idzol-dev', 'latency': '326', 'health': 96, 'body': [{'x': 1, 'y': 9}, {'x': 1, 'y': 8}, {'x': 1, 'y': 7}], 'head': {'x': 1, 'y': 9}, 'length': 3, 'shout': '', 'squad': ''}}\n\nlogger = log()\n\nus = snakeTest()\nus2 = snakeTest()\nthem = snakeTest()\n\nus.setHead([0,6])\nus.setBody([[0,7], [0,8], [0,9], [0,10], [1,10]])\nus.setBody(us.getBody())\n\nus2.setHead([1, 4])\nus2.setBody([[1, 5], [2, 5], [3, 5], [3, 4]])\nus2.setHistory(us2.getBody())\n\nthem.setHead([7,7])\nthem.setBody([[7,6],[7,5],[6,5],[6,4],[7,4],[7,3]])\nthem.setHistory(them.getBody())\n\nsn_body = us.getBody()\nenemy_body = them.getBody()\n\nus.setType('us')\nus.setId('ourSnek')\nus2.setId('enemySnek1')\nthem.setId('enemySnek2')\n\nallSnakes = {\n us.getId():us,\n us2.getId():us2,\n them.getId():them\n}\n\n# foods = [[6,6]]\nfoods = [[2,2], [4,4], [6,6]]\n\nbo = boardTest()\nbo.setIdentity(us.getId())\n\nCONST.minProbability = 1\n\nlogger.timer('== Update Boards ==')\nbo.updateBoards(data, us, allSnakes, foods) \nbo.updateChance(allSnakes, foods)\nbo.updateMarkov(us, allSnakes, foods)\nbo.updateDijkstra(us)\nlogger.timer('== Finish Boards ==')\n\n\n#bo.getEnemyFuture(allSnakes, 2)\n# print(\"US\", us.getNextSteps())\n# print(\"US2\", us2.getNextSteps())\n# print(\"ENEMY\", them.getNextSteps())\n\nroute = enemyStrategy(bo, allSnakes)\nprint (\"ROUTE\", route)\n\n\nlogger.timer('== Finish Strategy ==')\n\n# print(bo.markovs[0])\nprint(bo.combine)\n\ntargets = [[0,0], [2,0], [3,9], [9,1]]\n\nlogger.timer('== Finish Paths ==')\n\n" ]
[ [ "numpy.zeros", "numpy.where" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
travers-rhodes/deepmind-research
[ "59bace8e09b31686f1a4d4bd642c47388bc230fb" ]
[ "iodine/main.py" ]
[ "# Lint as: python3\n# Copyright 2019 Deepmind Technologies Limited.\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n# pylint: disable=g-importing-member, g-multiple-import, g-import-not-at-top\n# pylint: disable=protected-access, g-bad-import-order, missing-docstring\n# pylint: disable=unused-variable, invalid-name, no-value-for-parameter\n\nfrom copy import deepcopy\nimport os.path\nimport warnings\nfrom absl import logging\nimport numpy as np\nfrom sacred import Experiment, SETTINGS\n\n# Ignore all tensorflow deprecation warnings\nlogging._warn_preinit_stderr = 0\nwarnings.filterwarnings(\"ignore\", module=\".*tensorflow.*\")\nimport tensorflow.compat.v1 as tf\n\ntf.logging.set_verbosity(tf.logging.ERROR)\nimport sonnet as snt\nfrom sacred.stflow import LogFileWriter\nfrom iodine.modules import utils\nfrom iodine import configurations\n\nSETTINGS.CONFIG.READ_ONLY_CONFIG = False\n\nex = Experiment(\"iodine\")\n\n\[email protected]\ndef default_config():\n continue_run = False # set to continue experiment from an existing checkpoint\n checkpoint_dir = (\"checkpoints/iodine\"\n ) # if continue_run is False, \"_{run_id}\" will be appended\n save_summaries_steps = 10\n save_checkpoint_steps = 1000\n\n n_z = 64 # number of latent dimensions\n num_components = 7 # number of components (K)\n num_iters = 5\n\n learn_rate = 0.001\n batch_size = 4\n stop_after_steps = int(1e6)\n\n # Details for the dataset, model and optimizer are left empty here.\n # They can be found in the configurations for individual datasets,\n # which are provided in configurations.py and added as named configs.\n data = {} # Dataset details will go here\n model = {} # Model details will go here\n optimizer = {} # Optimizer details will go here\n\n\nex.named_config(configurations.clevr6)\nex.named_config(configurations.multi_dsprites)\nex.named_config(configurations.tetrominoes)\nex.named_config(configurations.dots)\n\n\[email protected]\ndef build(identifier, _config):\n config_copy = deepcopy(_config[identifier])\n return utils.build(config_copy, identifier=identifier)\n\n\ndef get_train_step(model, dataset, optimizer):\n loss, scalars, _ = model(dataset(\"train\"))\n global_step = tf.train.get_or_create_global_step()\n grads = optimizer.compute_gradients(loss)\n gradients, variables = zip(*grads)\n global_norm = tf.global_norm(gradients)\n gradients, global_norm = tf.clip_by_global_norm(\n gradients, 5.0, use_norm=global_norm)\n grads = zip(gradients, variables)\n train_op = optimizer.apply_gradients(grads, global_step=global_step)\n\n with tf.control_dependencies([train_op]):\n overview = model.get_overview_images(dataset(\"summary\"))\n scalars[\"debug/global_grad_norm\"] = global_norm\n\n summaries = {\n k: tf.summary.scalar(k, v) for k, v in scalars.items()\n }\n summaries.update(\n {k: tf.summary.image(k, v) for k, v in overview.items()})\n\n return tf.identity(global_step), scalars, train_op\n\n\[email protected]\ndef get_checkpoint_dir(continue_run, checkpoint_dir, _run, _log):\n if continue_run:\n assert os.path.exists(checkpoint_dir)\n _log.info(\"Continuing run from checkpoint at {}\".format(checkpoint_dir))\n return checkpoint_dir\n\n run_id = _run._id\n if run_id is None: # then no observer was added that provided an _id\n if not _run.unobserved:\n _log.warning(\n \"No run_id given or provided by an Observer. (Re-)using run_id=1.\")\n run_id = 1\n checkpoint_dir = checkpoint_dir + \"_{run_id}\".format(run_id=run_id)\n _log.info(\n \"Starting a new run using checkpoint dir: '{}'\".format(checkpoint_dir))\n return checkpoint_dir\n\n\[email protected]\ndef get_session(chkp_dir, loss, stop_after_steps, save_summaries_steps,\n save_checkpoint_steps):\n config = tf.ConfigProto()\n config.gpu_options.allow_growth = True\n\n hooks = [\n tf.train.StopAtStepHook(last_step=stop_after_steps),\n tf.train.NanTensorHook(loss),\n ]\n\n return tf.train.MonitoredTrainingSession(\n hooks=hooks,\n config=config,\n checkpoint_dir=chkp_dir,\n save_summaries_steps=save_summaries_steps,\n save_checkpoint_steps=save_checkpoint_steps,\n )\n\n\[email protected](unobserved=True)\ndef load_checkpoint(use_placeholder=False, session=None):\n dataset = build(\"data\")\n model = build(\"model\")\n if use_placeholder:\n inputs = dataset.get_placeholders()\n else:\n inputs = dataset()\n\n info = model.eval(inputs)\n if session is None:\n session = tf.Session()\n saver = tf.train.Saver()\n checkpoint_dir = get_checkpoint_dir()\n checkpoint_file = tf.train.latest_checkpoint(checkpoint_dir)\n saver.restore(session, checkpoint_file)\n\n print('Successfully restored Checkpoint \"{}\"'.format(checkpoint_file))\n # print variables\n variables = tf.global_variables() + tf.local_variables()\n for row in snt.format_variables(variables, join_lines=False):\n print(row)\n\n return {\n \"session\": session,\n \"model\": model,\n \"info\": info,\n \"inputs\": inputs,\n \"dataset\": dataset,\n }\n\n\[email protected]\n@LogFileWriter(ex)\ndef main(save_summaries_steps):\n checkpoint_dir = get_checkpoint_dir()\n\n dataset = build(\"data\")\n model = build(\"model\")\n optimizer = build(\"optimizer\")\n gstep, train_step_exports, train_op = get_train_step(model, dataset,\n optimizer)\n\n loss = []\n with get_session(checkpoint_dir, train_step_exports[\"loss/total\"]) as sess:\n while not sess.should_stop():\n out = sess.run({\n \"step\": gstep,\n \"loss\": train_step_exports[\"loss/total\"],\n \"train\": train_op,\n })\n loss.append(out[\"loss\"])\n step = out[\"step\"]\n if step % save_summaries_steps == 0:\n mean_loss = np.mean(loss)\n ex.log_scalar(\"loss\", mean_loss, step)\n print(\"{step:>6d} Loss: {loss: >12.2f}\".format(\n step=step, loss=mean_loss))\n loss = []\n" ]
[ [ "tensorflow.compat.v1.train.NanTensorHook", "tensorflow.compat.v1.ConfigProto", "tensorflow.compat.v1.local_variables", "tensorflow.compat.v1.train.MonitoredTrainingSession", "tensorflow.compat.v1.global_norm", "tensorflow.compat.v1.global_variables", "tensorflow.compat.v1.train.latest_checkpoint", "tensorflow.compat.v1.summary.image", "tensorflow.compat.v1.control_dependencies", "tensorflow.compat.v1.logging.set_verbosity", "tensorflow.compat.v1.train.get_or_create_global_step", "tensorflow.compat.v1.Session", "numpy.mean", "tensorflow.compat.v1.summary.scalar", "tensorflow.compat.v1.train.StopAtStepHook", "tensorflow.compat.v1.train.Saver", "tensorflow.compat.v1.clip_by_global_norm", "tensorflow.compat.v1.identity" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
ypark234/openmc
[ "571ed3b6ab449e555fc9c8452106425d26b19bd3" ]
[ "openmc/volume.py" ]
[ "from collections import OrderedDict\nfrom collections.abc import Iterable, Mapping\nfrom numbers import Real, Integral\nfrom xml.etree import ElementTree as ET\nimport warnings\n\nimport numpy as np\nimport pandas as pd\nimport h5py\nfrom uncertainties import ufloat\n\nimport openmc\nimport openmc.checkvalue as cv\n\n_VERSION_VOLUME = 1\n\n\nclass VolumeCalculation:\n \"\"\"Stochastic volume calculation specifications and results.\n\n Parameters\n ----------\n domains : Iterable of openmc.Cell, openmc.Material, or openmc.Universe\n Domains to find volumes of\n samples : int\n Number of samples used to generate volume estimates\n lower_left : Iterable of float\n Lower-left coordinates of bounding box used to sample points. If this\n argument is not supplied, an attempt is made to automatically determine\n a bounding box.\n upper_right : Iterable of float\n Upper-right coordinates of bounding box used to sample points. If this\n argument is not supplied, an attempt is made to automatically determine\n a bounding box.\n\n Attributes\n ----------\n ids : Iterable of int\n IDs of domains to find volumes of\n domain_type : {'cell', 'material', 'universe'}\n Type of each domain\n samples : int\n Number of samples used to generate volume estimates\n lower_left : Iterable of float\n Lower-left coordinates of bounding box used to sample points\n upper_right : Iterable of float\n Upper-right coordinates of bounding box used to sample points\n threshold : float\n Threshold for the maximum standard deviation of volume in the calculation\n atoms : dict\n Dictionary mapping unique IDs of domains to a mapping of nuclides to\n total number of atoms for each nuclide present in the domain. For\n example, {10: {'U235': 1.0e22, 'U238': 5.0e22, ...}}.\n atoms_dataframe : pandas.DataFrame\n DataFrame showing the estimated number of atoms for each nuclide present\n in each domain specified.\n volumes : dict\n Dictionary mapping unique IDs of domains to estimated volumes in cm^3.\n threshold : float\n Threshold for the maxmimum standard deviation of volumes.\n trigger_type : {'variance', 'std_dev', 'rel_err'}\n Value type used to halt volume calculation\n iterations : int\n Number of iterations over samples (for calculations with a trigger).\n\n \"\"\"\n def __init__(self, domains, samples, lower_left=None, upper_right=None):\n self._atoms = {}\n self._volumes = {}\n self._threshold = None\n self._trigger_type = None\n self._iterations = None\n\n cv.check_type('domains', domains, Iterable,\n (openmc.Cell, openmc.Material, openmc.Universe))\n if isinstance(domains[0], openmc.Cell):\n self._domain_type = 'cell'\n elif isinstance(domains[0], openmc.Material):\n self._domain_type = 'material'\n elif isinstance(domains[0], openmc.Universe):\n self._domain_type = 'universe'\n self.ids = [d.id for d in domains]\n\n self.samples = samples\n\n if lower_left is not None:\n if upper_right is None:\n raise ValueError('Both lower-left and upper-right coordinates '\n 'should be specified')\n\n # For cell domains, try to compute bounding box and make sure\n # user-specified one is valid\n if self.domain_type == 'cell':\n for c in domains:\n ll, ur = c.bounding_box\n if np.any(np.isinf(ll)) or np.any(np.isinf(ur)):\n continue\n if (np.any(np.asarray(lower_left) > ll) or\n np.any(np.asarray(upper_right) < ur)):\n warnings.warn(\n \"Specified bounding box is smaller than computed \"\n \"bounding box for cell {}. Volume calculation may \"\n \"be incorrect!\".format(c.id))\n\n self.lower_left = lower_left\n self.upper_right = upper_right\n else:\n if self.domain_type == 'cell':\n ll, ur = openmc.Union(c.region for c in domains).bounding_box\n if np.any(np.isinf(ll)) or np.any(np.isinf(ur)):\n raise ValueError('Could not automatically determine bounding '\n 'box for stochastic volume calculation.')\n else:\n self.lower_left = ll\n self.upper_right = ur\n else:\n raise ValueError('Could not automatically determine bounding box '\n 'for stochastic volume calculation.')\n\n @property\n def ids(self):\n return self._ids\n\n @property\n def samples(self):\n return self._samples\n\n @property\n def lower_left(self):\n return self._lower_left\n\n @property\n def upper_right(self):\n return self._upper_right\n\n @property\n def threshold(self):\n return self._threshold\n\n @property\n def trigger_type(self):\n return self._trigger_type\n\n @property\n def iterations(self):\n return self._iterations\n\n @property\n def domain_type(self):\n return self._domain_type\n\n @property\n def atoms(self):\n return self._atoms\n\n @property\n def volumes(self):\n return self._volumes\n\n @property\n def atoms_dataframe(self):\n items = []\n columns = [self.domain_type.capitalize(), 'Nuclide', 'Atoms']\n for uid, atoms_dict in self.atoms.items():\n for name, atoms in atoms_dict.items():\n items.append((uid, name, atoms))\n\n return pd.DataFrame.from_records(items, columns=columns)\n\n @ids.setter\n def ids(self, ids):\n cv.check_type('domain IDs', ids, Iterable, Real)\n self._ids = ids\n\n @samples.setter\n def samples(self, samples):\n cv.check_type('number of samples', samples, Integral)\n cv.check_greater_than('number of samples', samples, 0)\n self._samples = samples\n\n @lower_left.setter\n def lower_left(self, lower_left):\n name = 'lower-left bounding box coordinates',\n cv.check_type(name, lower_left, Iterable, Real)\n cv.check_length(name, lower_left, 3)\n self._lower_left = lower_left\n\n @upper_right.setter\n def upper_right(self, upper_right):\n name = 'upper-right bounding box coordinates'\n cv.check_type(name, upper_right, Iterable, Real)\n cv.check_length(name, upper_right, 3)\n self._upper_right = upper_right\n\n @threshold.setter\n def threshold(self, threshold):\n name = 'volume std. dev. threshold'\n cv.check_type(name, threshold, Real)\n cv.check_greater_than(name, threshold, 0.0)\n self._threshold = threshold\n\n @trigger_type.setter\n def trigger_type(self, trigger_type):\n cv.check_value('tally trigger type', trigger_type,\n ('variance', 'std_dev', 'rel_err'))\n self._trigger_type = trigger_type\n\n @iterations.setter\n def iterations(self, iterations):\n name = 'volume calculation iterations'\n cv.check_type(name, iterations, Integral)\n cv.check_greater_than(name, iterations, 0)\n self._iterations = iterations\n\n @volumes.setter\n def volumes(self, volumes):\n cv.check_type('volumes', volumes, Mapping)\n self._volumes = volumes\n\n @atoms.setter\n def atoms(self, atoms):\n cv.check_type('atoms', atoms, Mapping)\n self._atoms = atoms\n\n def set_trigger(self, threshold, trigger_type):\n \"\"\"Set a trigger on the voulme calculation\n\n Parameters\n ----------\n threshold : float\n Threshold for the maxmimum standard deviation of volumes\n trigger_type : {'variance', 'std_dev', 'rel_err'}\n Value type used to halt volume calculation\n \"\"\"\n self.trigger_type = trigger_type\n self.threshold = threshold\n\n @classmethod\n def from_hdf5(cls, filename):\n \"\"\"Load stochastic volume calculation results from HDF5 file.\n\n Parameters\n ----------\n filename : str\n Path to volume.h5 file\n\n Returns\n -------\n openmc.VolumeCalculation\n Results of the stochastic volume calculation\n\n \"\"\"\n with h5py.File(filename, 'r') as f:\n cv.check_filetype_version(f, \"volume\", _VERSION_VOLUME)\n\n domain_type = f.attrs['domain_type'].decode()\n samples = f.attrs['samples']\n lower_left = f.attrs['lower_left']\n upper_right = f.attrs['upper_right']\n\n threshold = f.attrs.get('threshold')\n trigger_type = f.attrs.get('trigger_type')\n iterations = f.attrs.get('iterations', 1)\n\n volumes = {}\n atoms = {}\n ids = []\n for obj_name in f:\n if obj_name.startswith('domain_'):\n domain_id = int(obj_name[7:])\n ids.append(domain_id)\n group = f[obj_name]\n volume = ufloat(*group['volume'][()])\n volumes[domain_id] = volume\n nucnames = group['nuclides'][()]\n atoms_ = group['atoms'][()]\n atom_dict = OrderedDict()\n for name_i, atoms_i in zip(nucnames, atoms_):\n atom_dict[name_i.decode()] = ufloat(*atoms_i)\n atoms[domain_id] = atom_dict\n\n # Instantiate some throw-away domains that are used by the constructor\n # to assign IDs\n with warnings.catch_warnings():\n warnings.simplefilter('ignore', openmc.IDWarning)\n if domain_type == 'cell':\n domains = [openmc.Cell(uid) for uid in ids]\n elif domain_type == 'material':\n domains = [openmc.Material(uid) for uid in ids]\n elif domain_type == 'universe':\n domains = [openmc.Universe(uid) for uid in ids]\n\n # Instantiate the class and assign results\n vol = cls(domains, samples, lower_left, upper_right)\n\n if trigger_type is not None:\n vol.set_trigger(threshold, trigger_type.decode())\n\n vol.iterations = iterations\n vol.volumes = volumes\n vol.atoms = atoms\n return vol\n\n def load_results(self, filename):\n \"\"\"Load stochastic volume calculation results from an HDF5 file.\n\n Parameters\n ----------\n filename : str\n Path to volume.h5 file\n\n \"\"\"\n results = type(self).from_hdf5(filename)\n\n # Make sure properties match\n assert self.ids == results.ids\n assert np.all(self.lower_left == results.lower_left)\n assert np.all(self.upper_right == results.upper_right)\n\n # Copy results\n self.volumes = results.volumes\n self.atoms = results.atoms\n\n def to_xml_element(self):\n \"\"\"Return XML representation of the volume calculation\n\n Returns\n -------\n element : xml.etree.ElementTree.Element\n XML element containing volume calculation data\n\n \"\"\"\n element = ET.Element(\"volume_calc\")\n dt_elem = ET.SubElement(element, \"domain_type\")\n dt_elem.text = self.domain_type\n id_elem = ET.SubElement(element, \"domain_ids\")\n id_elem.text = ' '.join(str(uid) for uid in self.ids)\n samples_elem = ET.SubElement(element, \"samples\")\n samples_elem.text = str(self.samples)\n ll_elem = ET.SubElement(element, \"lower_left\")\n ll_elem.text = ' '.join(str(x) for x in self.lower_left)\n ur_elem = ET.SubElement(element, \"upper_right\")\n ur_elem.text = ' '.join(str(x) for x in self.upper_right)\n if self.threshold:\n trigger_elem = ET.SubElement(element, \"threshold\")\n trigger_elem.set(\"type\", self.trigger_type)\n trigger_elem.set(\"threshold\", str(self.threshold))\n return element\n" ]
[ [ "pandas.DataFrame.from_records", "numpy.all", "numpy.isinf", "numpy.asarray" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "0.23", "0.21", "2.0", "1.4", "0.19", "1.1", "1.5", "1.2", "0.24", "0.20", "1.0", "0.25", "1.3" ], "scipy": [], "tensorflow": [] } ]
neevparikh/lwm
[ "ec8d27f6c011a732aa58ae04cba66a5bac68f8f8" ]
[ "atari/dqn/prepare_obs.py" ]
[ "import torch\n\n\ndef prepare_obs(obs, done, fstack):\n assert obs.dtype == torch.uint8\n assert obs.shape[2] == 1\n\n if fstack > 1:\n obs = stack_frames(obs, fstack)\n done_stacked = stack_frames(done, fstack)\n obs = obs * obs_mask(done_stacked)\n return obs.float() / 128 - 1\n\n\ndef stack_frames(x, stack=4):\n \"\"\"\n Args:\n x: [steps + stack - 1, batch, 1, ...] - flat trajectory with prefix = stack - 1\n Returns:\n [steps, batch, stack, ...] - each step (dim 0) includes stack of frames (dim 2)\n \"\"\"\n shape = (x.shape[0] - stack + 1, x.shape[1], stack, *x.shape[3:])\n y = torch.empty(shape, dtype=x.dtype, device=x.device)\n for i in range(stack):\n y[:, :, i] = x[i : shape[0] + i, :, 0]\n return y\n\n\ndef obs_mask(done):\n \"\"\"\n mask to zero out observations in 4-frame stack when done = 1\n \"\"\"\n mask = 1 - done[:, :, 1:]\n for i in reversed(range(mask.shape[2] - 1)):\n mask[:, :, i] *= mask[:, :, i + 1]\n mask = torch.cat([mask, torch.ones_like(mask[:, :, -1:])], 2)\n mask = mask[..., None, None]\n return mask\n" ]
[ [ "torch.ones_like", "torch.empty" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
ssense-ai/gitpod-heroku-python-ai-1
[ "9d33cf2d8bcced448affcf39f86abde291e7e0b3" ]
[ "build_model.py" ]
[ "import numpy as np\nimport pandas as pd\n\n#データ分割用\nfrom sklearn.model_selection import train_test_split\n\n#LightGBM\nimport lightgbm as lgb\n\n#pickle\nimport pickle\n\n#データ読み込み\ndf_train = pd.read_csv(\"train.csv\")\ndf_test = pd.read_csv(\"test.csv\")\n\n#データ結合\ndf_train[\"TrainFlag\"] = True\ndf_test[\"TrainFlag\"] = False\n\ndf_all = df_train.append(df_test)\ndf_all.index = df_all[\"Id\"]\ndf_all.drop(\"Id\", axis = 1, inplace = True)\n\n#ダミー変数化\ndf_all = pd.get_dummies(df_all, drop_first=True)\n\n#df_allを訓練データとテストデータに再度分ける\ndf_train = df_all[df_all[\"TrainFlag\"] == True]\ndf_train = df_train.drop([\"TrainFlag\"], axis = 1)\n\ndf_test = df_all[df_all[\"TrainFlag\"] == False]\ndf_test = df_test.drop([\"TrainFlag\"], axis = 1)\ndf_test = df_test.drop([\"SalePrice\"], axis = 1)\n\n#データ分割\ny = df_train[\"SalePrice\"].values\nX = df_train.drop(\"SalePrice\", axis=1).values\nX_train, X_test, y_train, y_test = train_test_split(X, y, test_size=0.3, random_state=1234)\n\n#LGBMのデータ作成\nlgb_train = lgb.Dataset(X_train, y_train)\nlgb_eval = lgb.Dataset(X_test, y_test)\n\n#パラメータ設定\nparams = {\n # 回帰問題\n 'random_state':1234, 'verbose':0,\n # 学習用の指標 (RMSE)\n 'metrics': 'rmse',\n }\nnum_round = 100\n\n#モデル訓練\nmodel = lgb.train(params, lgb_train, num_boost_round = num_round)\n\n#モデルを保存\nwith open('lgb_model.pickle', mode='wb') as fp:\n pickle.dump(model, fp)\n" ]
[ [ "pandas.read_csv", "sklearn.model_selection.train_test_split", "pandas.get_dummies" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "2.0", "1.4", "1.3", "1.1", "1.5", "1.2" ], "scipy": [], "tensorflow": [] } ]
Aletechdev/mutil
[ "30339f409723a2288c0e3575d466529555961305" ]
[ "test_gene.py" ]
[ "import pandas as pd\nfrom gene import get_gene_bnum\n\ndf = pd.DataFrame.from_dict(\n {'OBJECT_ID': ['ECK120000001'],\n 'OBJECT_SYNONYM_NAME': ['b4053'],\n 'OS_INTERNAL_COMMENT': [None],\n 'KEY_ID_ORG': ['ECK12']}, orient=\"columns\")\n\nassert(get_gene_bnum(\"ECK120000001\", df) == \"b4053\")\n\nprint(\"DONE\")" ]
[ [ "pandas.DataFrame.from_dict" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "0.23", "0.21", "2.0", "1.4", "0.19", "1.1", "1.5", "1.2", "0.24", "0.20", "1.0", "0.25", "1.3" ], "scipy": [], "tensorflow": [] } ]
amolmore3171/flaskoythonheatmapapp
[ "f80e62d8bed0e352b8a6bd5241839f0695573752" ]
[ "GDO_events.py" ]
[ "from __future__ import print_function\nimport matplotlib.pyplot as plt\nimport matplotlib.dates as mdates\nimport pandas as pd\nimport io\nfrom flask import Flask, make_response\nfrom matplotlib.backends.backend_agg import FigureCanvasAgg as FigureCanvas\n\n\napp = Flask(__name__)\n\n\[email protected]('/plot.png')\ndef home_page():\n chicagoland_agg_datafile='data/Chicagoland_agg.csv'\n Chicagoland_agg = pd.read_csv(chicagoland_agg_datafile, names=['county', 'date_str', 'num_events_by_county', 'num_devices_by_county','avg_events_by_county'], skiprows=1)\n\n\n fig, ax = plt.subplots(figsize=(22,8))\n for c in list(Chicagoland_agg.county.unique()):\n ax.plot(Chicagoland_agg[Chicagoland_agg['county']==c]['avg_events_by_county'], marker='.', linestyle='-', linewidth=0.5, label=c)\n\n ax.set_ylabel('Avg. # Events')\n ax.set_title('GDO Open and Close Events: Chicagoland, Jan - Apr 2020')\n plt.legend()\n #-------------------------------------------\n # Set x-axis major ticks to weekly interval, on Mondays\n ax.xaxis.set_major_locator(mdates.WeekdayLocator(byweekday=mdates.MONDAY))\n # Format x-tick labels as 3-letter month name and day number\n ax.xaxis.set_major_formatter(mdates.DateFormatter('%b %d'))\n #--------------------------------------------\n\n ax.set_ylim((3,14))\n ax.set_yticks(range(3,14))\n\n ax.grid('x', ls=':')\n\n\n plt.axvline(\"2020-03-16\", color=\"blue\", linestyle='--', linewidth=0.5)\n plt.axvline(\"2020-03-21\", color=\"red\", linestyle='--', linewidth=0.5)\n\n\n canvas = FigureCanvas(fig)\n output = io.BytesIO()\n canvas.print_png(output)\n response = make_response(output.getvalue())\n response.mimetype = 'image/png'\n return response\n\n\nif __name__ == '__main__':\n print(__doc__)\n app.run()\n" ]
[ [ "matplotlib.pyplot.legend", "matplotlib.dates.DateFormatter", "pandas.read_csv", "matplotlib.pyplot.axvline", "matplotlib.dates.WeekdayLocator", "matplotlib.backends.backend_agg.FigureCanvasAgg", "matplotlib.pyplot.subplots" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "2.0", "1.4", "1.1", "1.5", "1.2", "1.3" ], "scipy": [], "tensorflow": [] } ]
dekelmeirom/pathologylab
[ "262b0bd9cb9233bc960671c2d674cf895b228f39" ]
[ "algo/PDL1Net/cell_count.py" ]
[ "import cv2\nimport numpy as np\nimport copy\nimport algo.mrcnn.visualize_pdl1 as vis_pdl1\n\nclass_names = {\"INFLAMMATION\": 1, \"NEGATIVE\": 2, \"POSITIVE\": 3, \"OTHER\": 4}\n\n\ndef gamma_correction(img, gammas):\n \"\"\"\n apply gamma correction on the given image.\n allow different gamma for each color channel\n :param img: image in BGR color format\n :param gammas: array of gamma to use for each channel (in RGB order)\n :return: corrected image\n \"\"\"\n # assume the format of the image is BGR, but the gammas are in RGB\n img[:, :, 0] = (((img[:, :, 0] / 255) ** gammas[2]) * 255)\n img[:, :, 1] = (((img[:, :, 1] / 255) ** gammas[1]) * 255)\n img[:, :, 2] = (((img[:, :, 2] / 255) ** gammas[0]) * 255)\n return img\n\n\ndef hue_nuclei_masking(img, min_hue, max_hue):\n \"\"\"\n mask the image's nuclei by hue limits\n :param img: the image to apply thr masking to\n :param min_hue: the minimum hue to consider as nuclei\n :param max_hue: the maximum hue to consider as nuclei\n :return: mask of the filtered image\n \"\"\"\n hsv_img = cv2.cvtColor(img, cv2.COLOR_BGR2RGB)\n hsv_img = cv2.cvtColor(hsv_img, cv2.COLOR_RGB2HSV)\n\n hue_mask = np.logical_and(min_hue < hsv_img[:, :, 0], hsv_img[:, :, 0] < max_hue)\n return hue_mask\n\n\ndef morphological_correction(mask, kernel_size=4):\n # create the negative of the mask\n negative_mask = np.ones(mask.shape)\n negative_mask = negative_mask - mask\n # close operation\n kernel_close = np.ones((kernel_size, kernel_size), np.uint8)\n negative_mask = cv2.morphologyEx(negative_mask.astype('uint8'), cv2.MORPH_CLOSE, kernel_close)\n # return to the non-negative mask\n mask = np.ones(negative_mask.shape)\n mask = mask - negative_mask\n return mask\n\n\ndef morphological_correction_big(mask, kernel_size=5):\n # close operation\n kernel_close = np.ones((kernel_size, kernel_size), np.uint8)\n mask = cv2.morphologyEx(mask.astype('uint8'), cv2.MORPH_CLOSE, kernel_close)\n\n return mask\n\n\ndef find_contours(mask):\n # uncomment this line and comment the line after if using later version of openCV\n #_, cnts, _ = cv2.findContours(mask.astype('uint8'), cv2.RETR_TREE, cv2.CHAIN_APPROX_SIMPLE)\n cnts, _ = cv2.findContours(mask.astype('uint8'), cv2.RETR_TREE, cv2.CHAIN_APPROX_SIMPLE)\n single_pixel = []\n for cnt in cnts:\n if cnt.shape[0] <= 1:\n single_pixel.append(cnt)\n return cnts, single_pixel\n\n\ndef count_nucleus(img, img_class, img_masks, img_class_ids):\n working_img = copy.deepcopy(img)\n gammas = []\n if img_class == class_names[\"POSITIVE\"]:\n gammas = [2, 1.6, 1.3] # RGB\n mask = vis_pdl1.get_class_mask(3, img_masks, img_class_ids)\n elif img_class == class_names[\"NEGATIVE\"]:\n gammas = [2.2, 1.6, 1.3] # RGB\n mask = vis_pdl1.get_class_mask(2, img_masks, img_class_ids)\n else:\n mask = np.zeros((1024, 1024))\n # create the 3d mask\n temp_mask = np.broadcast_to(mask, (3, mask.shape[0], mask.shape[1]))\n mask_3d = np.zeros((mask.shape[0], mask.shape[1], 3))\n for i in range(3):\n mask_3d[:, :, i] = temp_mask[i, :, :]\n # apply the mask\n working_img = working_img * mask_3d\n working_img = working_img.astype('uint8')\n\n working_img = gamma_correction(working_img, gammas)\n\n if img_class == class_names[\"POSITIVE\"]:\n hue_min = 70\n hue_max = 175\n elif img_class == class_names[\"NEGATIVE\"]:\n hue_min = 50\n hue_max = 175\n else:\n hue_min = 70\n hue_max = 175\n mask = hue_nuclei_masking(working_img, hue_min, hue_max)\n\n if img_class == class_names[\"POSITIVE\"]:\n kernel_size = 4\n elif img_class == class_names[\"NEGATIVE\"]:\n kernel_size = 4\n mask_after_morph = morphological_correction(mask, kernel_size)\n cnts, single_pixel = find_contours(mask_after_morph)\n if len(cnts) > 40: # on high number of cells - do not use morphological operation\n if img_class == class_names[\"POSITIVE\"]:\n kernel_size = 5\n elif img_class == class_names[\"NEGATIVE\"]:\n kernel_size = 5\n mask_after_morph = morphological_correction_big(mask, kernel_size)\n cnts, single_pixel = find_contours(mask_after_morph)\n return len(cnts) - len(single_pixel), mask_after_morph\n" ]
[ [ "numpy.logical_and", "numpy.zeros", "numpy.broadcast_to", "numpy.ones" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
eulerlab/QDSpy
[ "29f0fd118cca7b86925f3a0187f64f0f2560aedc" ]
[ "QDSpy_core_presenter.py" ]
[ "#!/usr/bin/env python\n# -*- coding: utf-8 -*-\n\"\"\"\nQDSpy module - interprets and presents compiled stimuli\n\n'Presenter' \n Presents a compiled stimulus. \n This class is a graphics API independent.\n \nCopyright (c) 2013-2016 Thomas Euler\nDistributed under the terms of the GNU General Public License (GPL)\n\"\"\"\n# ---------------------------------------------------------------------\n__author__ \t= \"[email protected]\"\n\nimport numpy as np\nimport QDSpy_global as glo\nimport QDSpy_stim as stm\nimport QDSpy_stim_movie as mov\nimport QDSpy_stim_video as vid\nimport QDSpy_stim_draw as drw\nimport QDSpy_stim_support as ssp\nimport QDSpy_core_support as csp\nimport QDSpy_core_shader as csh\nimport QDSpy_config as cfg\nimport QDSpy_multiprocessing as mpr\nimport Devices.digital_io as dio\n\nglobal Clock\nClock = csp.defaultClock\n\n# ---------------------------------------------------------------------\n# Adjust global parameters depending on command line arguments\n#\nargs = cfg.getParsedArgv()\n\nglobal QDSpy_verbose\nQDSpy_verbose = args.verbose\nif QDSpy_verbose:\n import pylab\n \n# =====================================================================\n#\n# ---------------------------------------------------------------------\nclass Presenter:\n \"\"\" Presenter class\n \"\"\"\n def __init__(self, _Stage, _IO, _Conf, _View, _View2=None, _LCr=[]):\n # Initializing\n #\n self.Stage = _Stage\n self.IO = _IO\n self.Conf = _Conf\n self.View = _View\n self.LCr = _LCr\n self.ShManager = csh.ShaderManager(self.Conf)\n self.reset()\n\n self.dtFr_meas_s = self.Stage.dtFr_s\n self.dtFr_thres_s = self.dtFr_meas_s +self.Conf.maxDtTr_ms /1000.0\n\n # Prepare recording of stimulus presentation, if requested\n # \n if self.Conf.recordStim:\n self.View.prepareGrabStim()\n \n # Define event handler(s)\n #\n self.View.setOnKeyboardHandler(self.onKeyboard)\n self.View.setOnDrawHandler(self.onDraw)\n\n # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n def reset(self):\n # Reset presenter\n #\n self.Stim = None\n self.isReady = False\n self.nFr = 0\n self.is1FrOfSce = False\n self.iSc = 0\n self.isNextSce = True\n self.isFirstSce = True\n\n self.isEnd = False\n self.isIdle = True\n self.isUserAbort = False\n\n self.isRunFromGUI = False\n self.Sync = None\n \n self.IO_portOut = dio.devConst.NONE\n self.IO_maskMark = 0\n self.IO_isMarkSet = False\n\n self.nFrTotal = 0\n self.tFrRel_s = 0.0\n self.tFrRelOff_s = 0.0\n self.avFrDur_s = 0.0\n self.nRendTotal = 0\n self.avPresDur_s = 0.0\n self.avRendDur_s = 0.0\n self.rendDur_s = 0.0\n self.tFr = 0.0\n self.tStart = 0.0\n\n if glo.QDSpy_frRateStatsBufferLen > 0:\n self.dataDtFr = np.zeros(glo.QDSpy_frRateStatsBufferLen, dtype=float)\n else:\n self.dataDtFr = []\n self.dataDtFrLen = 0\n self.dataDtFrOver = False\n self.nDroppedFr = 0\n\n self.isInLoop = False\n self.nLoopRepeats = 0\n self.iFirstLoopSc = -1\n\n self.vertTr = np.array([], dtype=np.int) # temporary vertex arrays\n self.iVertTr = np.array([], dtype=np.int) # temporary index arrays\n self.vRGBTr = np.array([], dtype=np.uint8) # temporary RGBA arrays\n self.vRGBTr2 = np.array([], dtype=np.uint8) \n\n self.currShObjIDs = [] # list, IDs of current shader-enabled objects\n self.prevShObjIDs = [] # list, IDs of previously shown shader-enabled\n # objects\n self.prevObjIDs = [] # list, previously shown objects (all)\n self.ShProgList = [] # list, available shader programs\n # (ready to bind)\n self.MovieList = [] # list, movie class objects\n self.MovieCtrlList= [] # list, movie control class objects\n self.VideoList = [] # list, video class objects\n self.VideoCtrlList= [] # list, video control class objects\n \n self.markerVert, self.antiMarkerVert = drw.marker2vert(self.Stage, self.Conf)\n\n # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n def onKeyboard(self, _key, _x, _y):\n if not(self.isRunFromGUI) and _key in glo.QDSpy_KEY_KillPresent:\n self.isUserAbort = True\n self.stop()\n\n # --------------------------------------------------------------------\n # Scene rendering function\n # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n def renderSce(self, _iSc, _nSc):\n # Renders the indexed scene\n #\n if self.Conf.isTrackTime:\n t0 = Clock.getTime_s()\n sc = self.Stim.SceList[_iSc]\n drawn = True\n\n # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n if sc[stm.SC_field_type] == stm.StimSceType.beginLoop:\n # Begin of a loop\n #\n self.isInLoop = True\n self.nLoopRepeats = sc[stm.SC_field_nLoopTrials] -1\n self.iFirstLoopSc = _iSc +1\n\n # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n elif sc[stm.SC_field_type] == stm.StimSceType.endLoop:\n # End of a loop\n #\n if (not(self.isInLoop) or (self.nLoopRepeats < 0)):\n pass\n if self.nLoopRepeats > 0:\n self.iSc = self.iFirstLoopSc -1\n self.nLoopRepeats -= 1\n else:\n self.isInLoop = False\n\n # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n elif sc[stm.SC_field_type] == stm.StimSceType.clearSce:\n # Clear scene\n #\n self.View.clear()\n if self.Stage.useScrOvl:\n drawn = False\n\n # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n elif sc[stm.SC_field_type] == stm.StimSceType.changeBkgCol:\n # Change background color\n #\n self.View.clear(sc[stm.SC_field_BkgRGB])\n \n # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n elif sc[stm.SC_field_type] == stm.StimSceType.sendCommandToLCr:\n # Change LED currents\n #\n _params = sc[stm.SC_field_LCrParams]\n if ((_params[0] == stm.StimLCrCmd.setLEDCurrents) and\n (_params[1] >= 0) and (_params[1] < len(self.LCr))):\n self.LCr[_params[1]].setLEDCurrents(_params[2])\n \n # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n elif sc[stm.SC_field_type] == stm.StimSceType.logUserParams:\n # Write user parameters to the log file\n #\n _userParams = sc[stm.SC_field_userParams]\n _userParams.update(stimFileName=self.Stim.fileName)\n # **************************************\n # **************************************\n # TODO: Copy also external stimulus files (containing large \n # lists or data structures) to the log directory\n # **************************************\n # **************************************\n ssp.Log.write(\"DATA\", _userParams.__str__())\n\n # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n elif sc[stm.SC_field_type] == stm.StimSceType.changeShParams:\n # Change shader parameters\n #\n _ShID = sc[stm.SC_field_ShID][0]\n _iSh = self.Stim.ShDict[_ShID]\n self.Stim.ShList[_iSh][stm.SH_field_Params] = sc[stm.SC_field_ShParams]\n\n # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n elif sc[stm.SC_field_type] == stm.StimSceType.changeObjShader:\n # Change object shader\n #\n for i in range(len(sc[stm.SC_field_IDs])):\n _ObID = sc[stm.SC_field_IDs][i]\n _iObj = self.Stim.ObjDict[_ObID]\n _ShID = sc[stm.SC_field_ShIDs][i]\n if _ShID < 0:\n _iSh = -1\n else:\n _iSh = self.Stim.ShDict[_ShID]\n self.Stim.ObjList[_iObj][stm.SO_field_shProgIndex] = _iSh\n \"\"\"\n SO_field_shProgIndex\n\n newSce = [StimSceType.changeObjShader, -1, self.nSce, False,\n _IDs, _shIDs]\n SC_field_IDs = 4\n SC_field_ShIDs = 5\n\n #self.currIVShObjGr[0] = shd.ShaderBindGroup(shd.getStandardShader(), 0)\n #self.currIVShObjGr[2] = shd.ShaderBindGroup(shd.getStandardShader(), 2)\n\n newShader = [StimObjType.shader, _shID,\n _shType, csh.SH_defaultParams[_shType], _shCode]\n self.ShDict[_shID] = len(self.ShList)\n self.ShList.append(newShader)\n self.ShProgList\n\n SH_field_type = 0\n SH_field_ID = 1\n SH_field_shaderType = 2\n SH_field_Params = 3\n SH_field_shaderCode = 4\n\n newBox = [StimObjType.box, _ID,\n (float(_dx_um), float(_dy_um)),\n\t \t\t SO_defaultFgRGB, SO_defaultAlpha, SO_default_RGBAByVert,\n _enShader, -1]\n \"\"\"\n # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n elif sc[stm.SC_field_type] == stm.StimSceType.startMovie:\n # Start running movie ...\n #\n # Get movie object via movie ID\n #\n _MovID = sc[stm.SC_field_IDs][0]\n _iMov = self.Stim.MovDict[_MovID]\n movOb = self.MovieList[_iMov]\n\n # Create a new movie control object; this internally creates a\n # pyglet sprite, with the requested presentation properties\n #\n mCtOb = mov.MovieCtrl(sc[stm.SC_field_MovSeq], _MovID, _Movie=movOb)\n mCtOb.iScr = sc[stm.SC_field_MovScreen]\n mCtOb.setSpriteProperties(sc[stm.SC_field_posXY], \n sc[stm.SC_field_magXY],\n sc[stm.SC_field_rot], \n sc[stm.SC_field_MovTrans])\n\n # Add the move control object to the list of active movies; remove\n # previous one, if still present\n #\n iMC = 0\n while iMC < len(self.MovieCtrlList):\n if self.MovieCtrlList[iMC][3] == _MovID:\n temp = self.MovieCtrlList.pop(iMC)\n temp[0].kill()\n else:\n iMC += 1\n\n self.MovieCtrlList.append([mCtOb, _iSc, self.nFrTotal, _MovID])\n\n # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n elif sc[stm.SC_field_type] == stm.StimSceType.startVideo:\n # Start running video ...\n #\n # Get video object via video ID\n #\n _VidID = sc[stm.SC_field_IDs][0]\n _iVid = self.Stim.VidDict[_VidID]\n vidOb = self.VideoList[_iVid]\n\n # Create a new movie control object; this internally creates a\n # pyglet sprite, with the requested presentation properties\n #\n vCtOb = vid.VideoCtrl(_Video=vidOb)\n vCtOb.iScr = sc[stm.SC_field_VidScreen]\n vCtOb.setSpriteProperties(sc[stm.SC_field_posXY], \n sc[stm.SC_field_magXY],\n sc[stm.SC_field_rot], \n sc[stm.SC_field_VidTrans])\n\n # Add the video control object to the list of active videos; remove\n # previous one, if still present\n #\n iVC = 0\n while iVC < len(self.VideoCtrlList):\n if self.VideoCtrlList[iVC][3] == _VidID:\n temp = self.VideoCtrlList.pop(iVC)\n temp[0].kill()\n else:\n iVC += 1\n \n self.VideoCtrlList.append([vCtOb, _iSc, self.nFrTotal, _VidID])\n\n # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n elif sc[stm.SC_field_type] == stm.StimSceType.renderSce:\n # Render objects in scene\n #\n self.View.clear()\n \n if self.Stim.cScOList[_iSc][0] >= 0:\n \n if self.is1FrOfSce: # _________________________________________\n # First frame of a new scene: Get index of object drawing list of\n # this scene and then get vertex data (or reuse previous data, if\n # nothing has changed)\n #\n iODr, ObjNewMask, ObjIDs, ObjPosXY, ObjRot = self.Stim.cScOList[_iSc]\n nObjs = len(self.Stim.cODr_tr_iVert[iODr])\n ObjNewMask = np.array(ObjNewMask)\n\n # Generate pyglet Groups to bind shaders to objects, if required\n #\n self.Batch.delete_shader_handles()\n\n for iObj, ObjID in enumerate(ObjIDs):\n if ObjID < 0:\n continue\n iObjList = self.Stim.ObjDict[ObjID]\n iSh = self.Stim.ObjList[iObjList][stm.SO_field_shProgIndex]\n if iSh >= 0:\n # Create Group object referencing to requested shader and set\n # shader parameters (uniforms)\n #\n shPar = self.Stim.ShList[iSh][stm.SH_field_Params]\n shType = self.Stim.ShList[iSh][stm.SH_field_shaderType]\n self.Batch.add_shader_handle(ObjID, self.ShProgList[iSh], shType)\n x = ObjPosXY[iObj][0] +self.Stage.dxScr\n y = ObjPosXY[iObj][1] +self.Stage.dyScr\n a_rad = (ObjRot[iObj]+90.0)*np.pi/180.0\n self.tFrRelOff_s = self.tFrRel_s\n self.Batch.set_shader_time(ObjID, 0.0)\n self.Batch.set_shader_parameters(ObjID, [x,y], a_rad, shPar)\n \n else:\n # No shader\n #\n self.Batch.add_shader_handle(ObjID)\n\n # Check if vertex list(s) need(s) to be updated or re-created\n #\n # self.Stim.cODr_tr_xxx[iODr][iObj][0] := SC_vertDataChanged or not\n # self.Stim.cODr_tr_xxx[iODr][iObj][1] := Object ID or -1\n # self.Stim.cODr_tr_xxx[iODr][iObj][2] := numpy array with data\n #\n # Kill vertex data of previous shader-enabled objects\n #\n self.currShObjIDs = []\n self.Batch.delete_shader_object_data()\n\n for iObj in range(nObjs):\n self.iVertTr = self.Stim.cODr_tr_iVert[iODr][iObj][2]\n self.vertTr = self.Stim.cODr_tr_vertCoord[iODr][iObj][2]\n self.vRGBATr = self.Stim.cODr_tr_vertRGBA[iODr][iObj][2]\n self.vRGBATr2 = self.Stim.cODr_tr_vertRGBA2[iODr][iObj][2]\n\n if iObj == 0:\n # Not shader-enabled objects ...\n #\n if ObjNewMask[iObj] == stm.SC_ObjNewAll:\n self.Batch.replace_object_data(self.iVertTr, self.vertTr, \n self.vRGBATr, self.vRGBATr2)\n else:\n if (ObjNewMask[iObj] & stm.SC_ObjNewiVer) > 0:\n self.Batch.replace_object_data_indices(self.iVertTr)\n if (ObjNewMask[iObj] & stm.SC_ObjNewVer) > 0:\n self.Batch.replace_object_data_vertices(self.vertTr)\n if (ObjNewMask[iObj] & stm.SC_ObjNewRGBA) > 0:\n self.Batch.replace_object_data_colors(self.vRGBATr, \n self.vRGBATr2)\n\n else:\n # For each shader-enabled object ...\n #\n self.currShObjIDs.append(ObjIDs[iObj])\n self.Batch.add_shader_object_data(ObjIDs[iObj], self.iVertTr, \n self.vertTr, self.vRGBATr,\n self.vRGBATr2)\n\n self.prevShObjIDs = self.currShObjIDs\n self.prevObjIDs = ObjIDs\n\n else: # ______________________________________________________\n # Not first frame of a new scene, just update the shader\n # parameters, if any, ...\n #\n self.Batch.set_shader_time_all(self.tFrRel_s -self.tFrRelOff_s)\n\n # Indicate that the batch needs to be drawn\n #\n drawn = False\n\n\n if (_nSc > 0) and (not drawn\\\n or (len(self.MovieCtrlList) > 0) or (len(self.VideoCtrlList) > 0)):\n # Keep movie control objects updated: Advance or kill, if finished\n #\n iMC = 0\n while iMC < len(self.MovieCtrlList):\n mCtOb, iScWhenStarted, iFrWhenStarted, ID = self.MovieCtrlList[iMC]\n if iScWhenStarted == _iSc:\n # Don't start playing the movie if we are still in the no-duration\n # scene that started the movie\n #\n '''\n ssp.Log.write(\"DEBUG\", \"Movie #{0} ID{1} ready, _iSc={2} iFr={3}\"\n .format(iMC, mCtOb.ID, _iSc, self.nFrTotal))\n '''\n iMC += 1\n continue\n\n res = mCtOb.getNextFrIndex()\n if res < 0:\n '''\n ssp.Log.write(\"DEBUG\", \"Movie #{0} ID{1} last, _iSc={1} nFr={2}\"\n .format(iMC, mCtOb.ID, _iSc, self.nFrTotal -iFrWhenStarted))\n '''\n mCtOb, iScWhenStarted, iFrWhenStarted, ID = self.MovieCtrlList.pop(iMC)\n mCtOb.kill()\n\n else:\n mCtOb.setSpriteBatch(self.Batch)\n iMC += 1\n \n # Keep video control objects updated: Advance or kill, if finished\n #\n iVC = 0\n while iVC < len(self.VideoCtrlList):\n vCtOb, iScWhenStarted, iFrWhenStarted, ID = self.VideoCtrlList[iVC]\n if iScWhenStarted == _iSc:\n # Don't start playing the video if we are still in the no-duration\n # scene that started the video\n #\n iVC += 1\n continue\n\n res = vCtOb.getNextFrIndex()\n if res < 0:\n vCtOb, iScWhenStarted, iFrWhenStarted, ID = self.VideoCtrlList.pop(iVC)\n vCtOb.kill()\n\n else:\n vCtOb.setSpriteBatch(self.Batch)\n iVC += 1\n \n # Draw current triangle vertices, acknowledging the scaling and\n # rotation of the current display (stage settings)\n #\n self.Batch.draw(self.Stage, self.View, \n sc[stm.SC_field_type] == stm.StimSceType.clearSce)\n \n # Show marker, if requested and present in the current scene\n #\n if self.Conf.markShowOnScr:\n if sc[stm.SC_field_marker]: \n self.Batch.add_rect_data(self.markerVert)\n else:\n self.Batch.add_rect_data(self.antiMarkerVert)\n \n # Track rendering timing, if requested\n #\n if self.Conf.isTrackTime:\n self.rendDur_s = Clock.getTime_s() -t0\n self.avRendDur_s += self.rendDur_s\n self.nRendTotal += 1\n\n\n # --------------------------------------------------------------------\n # Frame refresh handler\n # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n def onDraw(self):\n # Check if stimulus is defined\n #\n if self.Stim == None:\n self.View.clear()\n self.isEnd = True\n\n if self.isIdle:\n # Stimulus has already ended; nothing to do ...\n #\n ssp.Log.write(\"DEBUG\", \"Presenter.onDraw(), isIdle=True\")\n self.finish()\n return\n\n # If run from GUI (as server) ...\n #\n if self.isRunFromGUI:\n # Check if GUI requests abort ...\n #\n if self.Sync.Request.value in [mpr.CANCELING, mpr.TERMINATING]:\n self.Sync.setStateSafe(mpr.CANCELING)\n self.isUserAbort = True\n self.stop()\n \n if self.Sync.pipeSrv.poll():\n data = self.Sync.pipeSrv.recv()\n if data[0] == mpr.PipeValType.toSrv_changedStage:\n # Stage properties were adjusted by the user, reflect immediately\n # in the stimulus presentation\n #\n self.Stage.scalX_umPerPix = data[1][\"scalX_umPerPix\"]\n self.Stage.scalY_umPerPix = data[1][\"scalY_umPerPix\"]\n self.Stage.centOffX_pix = data[1][\"centOffX_pix\"]\n self.Stage.centOffY_pix = data[1][\"centOffY_pix\"]\n self.Stage.rot_angle = data[1][\"rot_angle\"]\n self.Stage.dxScr12 = data[1][\"dxScr12\"]\n self.Stage.dyScr12 = data[1][\"dyScr12\"]\n self.Stage.offXScr1_pix = data[1][\"offXScr1_pix\"]\n self.Stage.offYScr1_pix = data[1][\"offYScr1_pix\"]\n self.Stage.offXScr2_pix = data[1][\"offXScr2_pix\"]\n self.Stage.offYScr2_pix = data[1][\"offYScr2_pix\"]\n \n if data[0] == mpr.PipeValType.toSrv_changedLEDs:\n # User changed LED currents and/or toggled LEDs, notify \n # lightcrafter immediately\n #\n self.Stage.LEDs = data[1][0] \n self.Stage.isLEDSeqEnabled = data[1][1]\n self.Stage.sendLEDChangesToLCr(self.Conf)\n\n if data[0] == mpr.PipeValType.toSrv_setIODevPins:\n # User pressed a user button, change IO device pins accordingly\n # \n csp.setIODevicePin(self.IO, data[1][0], data[1][1], data[1][2])\n\n # Render scene\n #\n while self.isNextSce and not self.isEnd:\n # Load next scene ...\n #\n if not self.isFirstSce:\n # Increase scene index and check for end of stimulus ...\n #\n self.iSc += 1\n self.isEnd = self.iSc >= len(self.Stim.SceList)\n if self.isEnd:\n break\n\n else:\n #\t... except it is the first scene\n #\n self.isFirstSce = False\n self.tStart = Clock.getTime_s()\n\n self.nFr = self.Stim.cScDurList[self.iSc]\n self.is1FrOfSce = True\n if self.nFr <= 0:\n # Scene w/o duration, handle immediately\n #\n self.renderSce(self.iSc, self.nFr)\n self.isNextSce = True\n\n else:\n # Scene has a duration, handle it below\n #\n self.isNextSce = False\n\n if self.isEnd:\n # No more scenes to display or aborted by used,\n # in any case, end presentation\n #\n isDone = (self.iSc >= len(self.Stim.SceList))\n ssp.Log.write(\"ok\", \"Done\" if isDone else \"Aborted by user\")\n ssp.Log.write(\"DATA\", {\"stimFileName\": self.Stim.fileName, \n \"stimState\": \"FINISHED\" if isDone else \"ABORTED\"}\n .__str__())\n \n self.Stim = None\n self.isIdle = True\n return\n\n if self.nFr > 0:\n # Scene has a duration, handle it ...\n #\n self.renderSce(self.iSc, self.nFr)\n self.nFr -= 1\n self.is1FrOfSce = False\n self.isNextSce = (self.nFr == 0)\n\n # Determine if marker should be shown ...\n # ************\n # TODO: first read port to be able to set/clear only the needed pin\n # ************\n isMaskChanged = False\n if self.IO is not None:\n if self.Stim.cScMarkList[self.iSc] > 0:\n # ...\n maskMark = self.IO_maskMark\n isMaskChanged = True\n self.IO_isMarkSet = True\n else:\n if self.IO_isMarkSet:\n # ...\n maskMark = 0\n isMaskChanged = True \n self.IO_isMarkSet = False\n\n # Flip display buffer ...\n #\n t1 = Clock.getTime_s()\n self.View.present()\n self.avPresDur_s += Clock.getTime_s() -t1\n \n # ****************************\n # ****************************\n # ****************************\n # ****************************\n # ****************************\n '''\n if self.isRunFromGUI and not(self.View.Renderer.pil_img_data is None):\n print(\"******************\", len(self.View.Renderer.pil_img_data))\n #self.Sync.Frame.value = self.View.Renderer.pil_img_data\n ''' \n # **************************** \n # ****************************\n # ****************************\n # ****************************\n \n # Send marker signal, if needed\n #\n if isMaskChanged:\n self.IO.writeDPort(self.IO_portOut, maskMark)\n\n # Record stimulus presentation, if requested\n #\n if self.Conf.recordStim:\n self.View.grabStimFrame()\n \n # Keep track of refresh duration\n #\n if self.Conf.isTrackTime:\n if self.nFrTotal == 0:\n self.tFr = Clock.getTime_s()\n else:\n t0 = Clock.getTime_s()\n dt = t0 -self.tFr\n self.avFrDur_s += dt\n self.tFr = t0\n self.dataDtFr[self.dataDtFrLen] = dt\n self.dataDtFrLen += 1\n if self.dataDtFrLen >= self.dataDtFr.size:\n self.dataDtFrOver = True\n self.dataDtFrLen = 0\n \"\"\"\n if (self.Conf.isWarnFrDrop and\n (abs(dt -self.dtFr_meas_s) > self.Conf.maxDtTr_ms/1000.0)):\n \"\"\" \n if self.Conf.isWarnFrDrop and (dt > self.dtFr_thres_s):\n self.nDroppedFr += 1\n ssp.Log.write(\"WARNING\", \"dt of frame #{0} was {1:.3f} ms\"\n .format(self.nFrTotal, dt *1000.0))\n\n self.nFrTotal += 1\n self.tFrRel_s = self.nFrTotal*self.Stage.dtFr_s\n\n\n # --------------------------------------------------------------------\n def run(self):\n # Runs the OpenGL/pyglet event loop, thereby any loaded stimulus\n #\n if not self.isReady:\n return\n \n if self.Stim is None:\n ssp.Log.write(\"ok\", \"Ready.\")\n return\n\n # Start stimulus ...\n #\n self.isEnd = False\n ssp.Log.write(\"ok\", \"Running...\")\n ssp.Log.write(\"DATA\", {\"stimFileName\": self.Stim.fileName, \n \"stimState\": \"STARTED\",\n \"stimMD5\": self.Stim.md5Str}.__str__()) \n self.Stage.logData()\n self.View.startRenderingLoop(self) \n\n # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n def stop(self):\n # Signals event loop to stop\n #\n self.isEnd = True\n ssp.Log.write(\"DEBUG\", \"Presenter.stop()\")\n\n # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n def finish(self):\n # Finish presentation\n #\n if not self.isReady:\n return\n \n if self.isUserAbort:\n # Clear screen\n #\n self.View.clear()\n self.View.present()\n ssp.Log.write(\"ABORT\", \"User aborted program\")\n \n else:\n ssp.Log.write(\"ok\", \"Program finished\")\n\n # Log timing information\n #\n if self.Conf.isTrackTime:\n self.avRendDur_s = self.avRendDur_s /self.nRendTotal\n self.avPresDur_s = self.avPresDur_s /self.nRendTotal\n self.avFrDur_s = self.avFrDur_s /self.nFrTotal\n ssp.Log.write(\"INFO\", \"{0:.3f} ms/frame ({1:.3f} Hz), rendering: \"\n \"{2:.3f} ms/frame ({3} frames in total)\"\n .format(self.avFrDur_s*1000.0, 1/self.avFrDur_s,\n self.avRendDur_s*1000.0, self.nFrTotal))\n ssp.Log.write(\"INFO\", \"presenting: {0:.3f} ms/frame\"\n .format(self.avPresDur_s*1000.0))\n\n if glo.QDSpy_frRateStatsBufferLen > 0:\n if not self.dataDtFrOver:\n data = self.dataDtFr[:self.dataDtFrLen]\n else:\n data = self.dataDtFr\n else:\n data = np.array(self.dataDtFr)\n av = data.mean() *1000.0\n std = data.std() *1000.0\n ssp.Log.write(\"INFO\", \"{0:.3f} +/- {1:.3f} ms/frame (over the last {2}\"\n \" frames) = {3:.3} Hz\"\n .format(av, std, len(data), 1000.0/av))\n if self.nDroppedFr > 0:\n pcDrFr = 100.0*self.nDroppedFr/self.nFrTotal\n ssp.Log.write(\"WARNING\", \"{0} frames dropped (={1:.3f} %)\"\n .format(self.nDroppedFr, pcDrFr))\n\n ssp.Log.write(\"DATA\", {\"avgFreq_Hz\": 1/self.avFrDur_s, \n \"nFrames\": self.nFrTotal,\n \"nDroppedFrames\": self.nDroppedFr}\n .__str__())\n\n if QDSpy_verbose:\n # Generate a plot ...\n #\n pylab.title(\"Timing\")\n pylab.subplot(2,1,1)\n pylab.plot(list(range(len(data))), data*1000, \"-\")\n xArr = [0, len(data)-1]\n dtFr_ms = self.dtFr_meas_s*1000\n yMin = dtFr_ms +self.Conf.maxDtTr_ms\n yMax = dtFr_ms -self.Conf.maxDtTr_ms\n pylab.plot(xArr, [yMin, yMin], \"k--\")\n pylab.plot(xArr, [yMax, yMax], \"k--\")\n pylab.ylabel(\"frame duration [ms]\")\n pylab.xlabel(\"frame #\")\n pylab.xlim([10,len(data)])\n pylab.ylim([dtFr_ms-10,dtFr_ms+10])\n pylab.subplot(2,1,2)\n n, bins, pat = pylab.hist(data*1000, 100, histtype=\"bar\", rwidth=0.9)\n pylab.setp(pat, 'facecolor', 'b', 'alpha', 0.75)\n #pylab.xlim([dtFr_ms-5,dtFr_ms+5])\n pylab.ylabel(\"# frames\")\n pylab.xlabel(\"frame duration [ms]\")\n pylab.tight_layout()\n pylab.show()\n\n\n # - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n def prepare(self, _Stim, _Sync=None):\n # Prepare a stimulus, to be started with the run() function\n #\n self.reset()\n self.Stim = _Stim\n self.isReady = True\n\n if _Sync is not None:\n self.isRunFromGUI = True\n self.Sync = _Sync\n\n if self.Stim is None:\n self.isReady = False\n \n else: \n # Setup digital I/O, if used\n # \n if self.IO is not None:\n self.IO_portOut = self.IO.getPortFromStr(self.Conf.DIOportOut)\n self.IO_maskMark = 0x01 << self.Conf.DIOpinMarker\n \n # Load and generate shader(s), if any\n #\n self.ShProgList = []\n if not glo.QDSpy_loadShadersOnce:\n self.ShManager = csh.ShaderManager(self.Conf)\n \n if len(self.Stim.ShList) > 0:\n for iSh, Sh in enumerate(self.Stim.ShList):\n shType = Sh[stm.SH_field_shaderType]\n if shType in self.ShManager.getShaderTypes():\n # Create shader program\n #\n shader = self.ShManager.createShader(shType)\n if shader is not None:\n self.ShProgList.append(shader)\n else: \n self.isReady = False\n ssp.Log.write(\"ERROR\", \"Stimulus '{0}' uses shader '{1}' that \"\n \"could not be compiled\"\n .format(_Stim.nameStr, shType))\n else:\n # A shaders that is not in the shader folder is required\n #\n self.isReady = False \n ssp.Log.write(\"ERROR\", \"Stimulus '{0}' uses shader '{1}' that \"\n \"cannot be found\".format(_Stim.nameStr, shType))\n\n # Load movie files, if any\n #\n self.MovieList = []\n if len(self.Stim.MovList) > 0:\n for Mov in self.Stim.MovList:\n movOb = mov.Movie(self.Conf)\n res = movOb.load(self.Conf.pathStim +Mov[stm.SM_field_movieFName])\n if res == stm.StimErrC.ok:\n # Add movie class object to list\n #\n self.MovieList.append(movOb)\n\n else:\n # The movie file(s) could not be loaded\n #\n self.isReady = False\n ssp.Log.write(\"ERROR\", \"Stimulus '{0}' uses movie '{1}' that \"\n \"cannot be found\".format(\n _Stim.nameStr,Mov[stm.SM_field_movieFName]))\n\n # Load videos, if any\n #\n self.VideoList = []\n if len(self.Stim.VidList) > 0:\n for Vid in self.Stim.VidList:\n vidOb = vid.Video(self.Conf)\n res = vidOb.load(self.Conf.pathStim +Vid[stm.SV_field_videoFName])\n if res == stm.StimErrC.ok:\n # Add video class object to list\n #\n self.VideoList.append(vidOb)\n\n else:\n # The video file(s) could not be loaded\n #\n self.isReady = False\n ssp.Log.write(\"ERROR\", \"Stimulus '{0}' uses video '{1}' that \"\n \"cannot be found\".format(\n _Stim.nameStr, Vid[stm.SV_field_videoFName]))\n \n # Create batch object for rendering objects\n #\n self.Batch = self.View.createBatch(_isScrOvl=self.Stage.useScrOvl)\n self.Batch.set_shader_manager(self.ShManager)\n \n if self.isReady:\n ssp.Log.write(\"ok\", \"Stimulus '{0}' prepared\".format(_Stim.nameStr))\n\n# ---------------------------------------------------------------------\n" ]
[ [ "numpy.array", "numpy.zeros" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
yihui-lai/coffea
[ "351cc727845ab83a8e31a193dc06e534bedb97fe" ]
[ "coffea/jetmet_tools/CorrectedMETFactory.py" ]
[ "from coffea.jetmet_tools.JECStack import JECStack\nimport awkward\nimport numpy\nimport warnings\nfrom copy import copy\n\n\nclass CorrectedMETFactory(object):\n\n def __init__(self, name_map):\n if 'xMETRaw' not in name_map or name_map['xMETRaw'] is None:\n warnings.warn('There is no name mapping for ptRaw,'\n ' CorrectedJets will assume that <object>.x is raw pt!')\n name_map['xMETRaw'] = name_map['METx'] + '_raw'\n self.treat_pt_as_raw = 'ptRaw' not in name_map\n\n if 'yMETRaw' not in name_map or name_map['yMETRaw'] is None:\n warnings.warn('There is no name mapping for massRaw,'\n ' CorrectedJets will assume that <object>.x is raw pt!')\n name_map['yMETRaw'] = name_map['METy'] + '_raw'\n\n self.name_map = name_map\n\n def build(self, MET, corrected_jets, lazy_cache):\n if lazy_cache is None:\n raise Exception('CorrectedMETFactory requires a awkward-array cache to function correctly.')\n if (not isinstance(MET, awkward.highlevel.Array) or\n not isinstance(corrected_jets, awkward.highlevel.Array)):\n raise Exception(\"'MET' and 'corrected_jets' must be an awkward array of some kind!\")\n\n out = copy(MET)\n\n form = out[self.name_map['METpt']].layout.form\n length = len(out)\n\n orig_jets = copy(corrected_jets)\n orig_jets[self.name_map['JetPt']] = orig_jets[self.name_map['ptRaw']]\n orig_jets[self.name_map['JetMass']] = orig_jets[self.name_map['massRaw']]\n\n out['x_orig'] = getattr(out, self.name_map['METx'])\n out['y_orig'] = getattr(out, self.name_map['METy'])\n\n out[self.name_map['METpt'] + '_orig'] = out[self.name_map['METpt']]\n out[self.name_map['METphi'] + '_orig'] = out[self.name_map['METphi']]\n\n def corrected_met_cartesian(met, rawJets, corrJets, dim):\n return met[f'{dim}_orig'] - awkward.sum(getattr(rawJets, dim) - getattr(corrJets, dim), axis=-1)\n\n def corrected_met_cartesian_unc(met, rawJets, corrJets, dimMET, dimJets):\n return getattr(met, dimMET) - awkward.sum(getattr(rawJets, dimJets) - getattr(corrJets, dimJets), axis=-1)\n\n out['corrected_met_x'] = awkward.virtual(\n corrected_met_cartesian,\n args=(out, orig_jets, corrected_jets, self.name_map['JETx']),\n length=length, form=form, cache=lazy_cache\n )\n out['corrected_met_y'] = awkward.virtual(\n corrected_met_cartesian,\n args=(out, orig_jets, corrected_jets, self.name_map['JETy']),\n length=length, form=form, cache=lazy_cache\n )\n\n out[self.name_map['METpt']] = awkward.virtual(\n lambda met: numpy.hypot(met['corrected_met_x'], met['corrected_met_y']),\n args=(out, ),\n length=length,\n form=form,\n cache=lazy_cache\n )\n out[self.name_map['METphi']] = awkward.virtual(\n lambda met: numpy.arctan2(met['corrected_met_y'], met['corrected_met_x']),\n args=(out, ),\n length=length,\n form=form,\n cache=lazy_cache\n )\n\n def make_unclustered_variant(themet, op, deltaX, deltaY):\n variant = copy(themet)\n variant['corrected_met_x'] = awkward.virtual(\n lambda met: op(out['corrected_met_x'], out[f'{deltaX}']),\n args=(out, ),\n length=length,\n form=form,\n cache=lazy_cache\n )\n variant['corrected_met_y'] = awkward.virtual(\n lambda met: op(out['corrected_met_y'], out[f'{deltaY}']),\n args=(out, ),\n length=length,\n form=form,\n cache=lazy_cache\n )\n variant[self.name_map['METpt']] = awkward.virtual(\n lambda met: numpy.hypot(out['corrected_met_x'], out['corrected_met_y']),\n args=(variant, ),\n length=length,\n form=form,\n cache=lazy_cache\n )\n variant[self.name_map['METphi']] = awkward.virtual(\n lambda met: numpy.arctan2(out['corrected_met_y'], out['corrected_met_x']),\n args=(variant, ),\n length=length,\n form=form,\n cache=lazy_cache\n )\n return variant\n\n unclus_up = make_unclustered_variant(MET, lambda x, y: x + y,\n self.name_map['UnClusteredEnergyDeltaX'],\n self.name_map['UnClusteredEnergyDeltaY'])\n unclus_down = make_unclustered_variant(MET, lambda x, y: x - y,\n self.name_map['UnClusteredEnergyDeltaX'],\n self.name_map['UnClusteredEnergyDeltaY'])\n out['MET_UnclusteredEnergy'] = awkward.zip({'up': unclus_up, 'down': unclus_down},\n depth_limit=1,\n with_name='METSystematic')\n\n def make_variant(name, variation):\n variant = copy(MET)\n variant['corrected_met_x'] = awkward.virtual(\n corrected_met_cartesian_unc,\n args=(out, orig_jets, variation, self.name_map['METx'], self.name_map['JETx']),\n length=length, form=form, cache=lazy_cache\n )\n variant['corrected_met_y'] = awkward.virtual(\n corrected_met_cartesian_unc,\n args=(out, orig_jets, variation, self.name_map['METy'], self.name_map['JETy']),\n length=length, form=form, cache=lazy_cache\n )\n variant[self.name_map['METpt']] = awkward.virtual(\n lambda met: numpy.hypot(met['corrected_met_x'], met['corrected_met_y']),\n args=(variant, ),\n length=length,\n form=form,\n cache=lazy_cache\n )\n variant[self.name_map['METphi']] = awkward.virtual(\n lambda met: numpy.arctan2(met['corrected_met_y'], met['corrected_met_x']),\n args=(variant, ),\n length=length,\n form=form,\n cache=lazy_cache\n )\n return variant\n\n for unc in filter(lambda x: x.startswith(('JER', 'JES')), awkward.fields(corrected_jets)):\n up = make_variant(unc, corrected_jets[unc].up)\n down = make_variant(unc, corrected_jets[unc].down)\n out[unc] = awkward.zip({'up': up, 'down': down},\n depth_limit=1,\n with_name='METSystematic')\n return out\n\n def uncertainties(self):\n return ['MET_UnclusteredEnergy']\n" ]
[ [ "numpy.arctan2", "numpy.hypot" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
vishalbelsare/classifications
[ "e16dbc9b625ff7e233be30bfb3d432f7b026facd" ]
[ "product/HS/IntlAtlas/clean.py" ]
[ "import pandas as pd\nimport sys\n\nsys.path.append(\"../../..\")\nfrom classification import (\n Hierarchy,\n repeated_table_to_parent_id_table,\n parent_code_table_to_parent_id_table,\n spread_out_entries,\n sort_by_code_and_level,\n Classification,\n)\n\n\ndef get_hs_services(file=\"./in/Services_Hierarchy.csv\"):\n services = pd.read_csv(file, encoding=\"utf-8\", dtype=\"str\")\n # Spread out services similarly to each set of exports but buffered further\n service_starts = {\"section\": 10, \"2digit\": 400, \"4digit\": 4000, \"6digit\": 11000}\n return spread_out_entries(services, service_starts, h)\n\n\nif __name__ == \"__main__\":\n names = pd.read_table(\n \"./in/HS92_Atlas_Names.tsv\", encoding=\"utf-8\", dtype={\"code\": str}\n )\n\n hierarchy = pd.read_table(\n \"./in/HS92_Atlas_Hierarchy.tsv\", encoding=\"utf-8\", dtype=\"str\"\n )\n\n fields = {\"section\": [], \"2digit\": [], \"4digit\": [], \"6digit\": []}\n\n h = Hierarchy([\"section\", \"2digit\", \"4digit\", \"6digit\"])\n parent_code_table = repeated_table_to_parent_id_table(hierarchy, h, fields)\n parent_code_table = parent_code_table.merge(names, on=[\"code\", \"level\"])\n\n # Sort by level order (not necessarily alphabetical)\n parent_code_table = sort_by_code_and_level(parent_code_table, h)\n\n parent_id_table = parent_code_table_to_parent_id_table(parent_code_table, h)\n parent_id_table[\"name\"] = parent_id_table.name_en\n\n parent_id_table = parent_id_table[\n [\n \"code\",\n \"name\",\n \"level\",\n \"name_en\",\n \"name_es\",\n \"name_short_en\",\n \"name_short_es\",\n \"parent_id\",\n ]\n ]\n\n # Decide what id each level should start from\n # Put ample space between each range of ids\n level_starts = {\"section\": 0, \"2digit\": 100, \"4digit\": 650, \"6digit\": 5000}\n parent_id_table = spread_out_entries(parent_id_table, level_starts, h)\n\n # Append services to table\n services = get_hs_services()\n\n # Append to main table and sort on combined spread out indices\n parent_id_table = parent_id_table.append(services).sort_index()\n\n # Hidden products (e.g., garbage, scrap metal)\n hidden = pd.read_csv(\"./in/hidden_products.csv\", dtype={\"code\": str})\n ## Is shown == Not hidden\n parent_id_table[\"is_shown\"] = (~parent_id_table.code.isin(hidden.code)).astype(int)\n\n # Natural Resources\n nat_resources = pd.read_csv(\"./in/natural_resources.csv\", dtype={\"code\": str})\n parent_id_table[\"natural_resource\"] = (\n parent_id_table.code.isin(nat_resources.code)\n ).astype(int)\n\n c = Classification(parent_id_table, h)\n\n c.to_csv(\"out/hs92_atlas.csv\")\n c.to_stata(\"out/hs92_atlas.dta\")\n" ]
[ [ "pandas.read_table", "pandas.read_csv" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "2.0", "1.4", "1.3", "1.1", "1.5", "1.2" ], "scipy": [], "tensorflow": [] } ]
zhouzach/spark
[ "ad77b400da4089a2de74394e2b8aed813633025a", "ad77b400da4089a2de74394e2b8aed813633025a" ]
[ "python/pyspark/ml/clustering.py", "python/pyspark/sql/session.py" ]
[ "#\n# Licensed to the Apache Software Foundation (ASF) under one or more\n# contributor license agreements. See the NOTICE file distributed with\n# this work for additional information regarding copyright ownership.\n# The ASF licenses this file to You under the Apache License, Version 2.0\n# (the \"License\"); you may not use this file except in compliance with\n# the License. You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n#\n\nimport sys\nimport warnings\n\nfrom pyspark import since, keyword_only\nfrom pyspark.ml.util import *\nfrom pyspark.ml.wrapper import JavaEstimator, JavaModel, JavaParams, JavaWrapper\nfrom pyspark.ml.param.shared import *\nfrom pyspark.ml.common import inherit_doc\nfrom pyspark.sql import DataFrame\n\n__all__ = ['BisectingKMeans', 'BisectingKMeansModel', 'BisectingKMeansSummary',\n 'KMeans', 'KMeansModel',\n 'GaussianMixture', 'GaussianMixtureModel', 'GaussianMixtureSummary',\n 'LDA', 'LDAModel', 'LocalLDAModel', 'DistributedLDAModel', 'PowerIterationClustering']\n\n\nclass ClusteringSummary(JavaWrapper):\n \"\"\"\n Clustering results for a given model.\n\n .. versionadded:: 2.1.0\n \"\"\"\n\n @property\n @since(\"2.1.0\")\n def predictionCol(self):\n \"\"\"\n Name for column of predicted clusters in `predictions`.\n \"\"\"\n return self._call_java(\"predictionCol\")\n\n @property\n @since(\"2.1.0\")\n def predictions(self):\n \"\"\"\n DataFrame produced by the model's `transform` method.\n \"\"\"\n return self._call_java(\"predictions\")\n\n @property\n @since(\"2.1.0\")\n def featuresCol(self):\n \"\"\"\n Name for column of features in `predictions`.\n \"\"\"\n return self._call_java(\"featuresCol\")\n\n @property\n @since(\"2.1.0\")\n def k(self):\n \"\"\"\n The number of clusters the model was trained with.\n \"\"\"\n return self._call_java(\"k\")\n\n @property\n @since(\"2.1.0\")\n def cluster(self):\n \"\"\"\n DataFrame of predicted cluster centers for each training data point.\n \"\"\"\n return self._call_java(\"cluster\")\n\n @property\n @since(\"2.1.0\")\n def clusterSizes(self):\n \"\"\"\n Size of (number of data points in) each cluster.\n \"\"\"\n return self._call_java(\"clusterSizes\")\n\n @property\n @since(\"2.4.0\")\n def numIter(self):\n \"\"\"\n Number of iterations.\n \"\"\"\n return self._call_java(\"numIter\")\n\n\n@inherit_doc\nclass _GaussianMixtureParams(HasMaxIter, HasFeaturesCol, HasSeed, HasPredictionCol,\n HasProbabilityCol, HasTol, HasAggregationDepth):\n \"\"\"\n Params for :py:class:`GaussianMixture` and :py:class:`GaussianMixtureModel`.\n\n .. versionadded:: 3.0.0\n \"\"\"\n\n k = Param(Params._dummy(), \"k\", \"Number of independent Gaussians in the mixture model. \" +\n \"Must be > 1.\", typeConverter=TypeConverters.toInt)\n\n @since(\"2.0.0\")\n def getK(self):\n \"\"\"\n Gets the value of `k`\n \"\"\"\n return self.getOrDefault(self.k)\n\n\nclass GaussianMixtureModel(JavaModel, _GaussianMixtureParams, JavaMLWritable, JavaMLReadable,\n HasTrainingSummary):\n \"\"\"\n Model fitted by GaussianMixture.\n\n .. versionadded:: 2.0.0\n \"\"\"\n\n @since(\"3.0.0\")\n def setFeaturesCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`featuresCol`.\n \"\"\"\n return self._set(featuresCol=value)\n\n @since(\"3.0.0\")\n def setPredictionCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`predictionCol`.\n \"\"\"\n return self._set(predictionCol=value)\n\n @since(\"3.0.0\")\n def setProbabilityCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`probabilityCol`.\n \"\"\"\n return self._set(probabilityCol=value)\n\n @property\n @since(\"2.0.0\")\n def weights(self):\n \"\"\"\n Weight for each Gaussian distribution in the mixture.\n This is a multinomial probability distribution over the k Gaussians,\n where weights[i] is the weight for Gaussian i, and weights sum to 1.\n \"\"\"\n return self._call_java(\"weights\")\n\n @property\n @since(\"3.0.0\")\n def gaussians(self):\n \"\"\"\n Array of :py:class:`MultivariateGaussian` where gaussians[i] represents\n the Multivariate Gaussian (Normal) Distribution for Gaussian i\n \"\"\"\n return self._call_java(\"gaussians\")\n\n @property\n @since(\"2.0.0\")\n def gaussiansDF(self):\n \"\"\"\n Retrieve Gaussian distributions as a DataFrame.\n Each row represents a Gaussian Distribution.\n The DataFrame has two columns: mean (Vector) and cov (Matrix).\n \"\"\"\n return self._call_java(\"gaussiansDF\")\n\n @property\n @since(\"2.1.0\")\n def summary(self):\n \"\"\"\n Gets summary (e.g. cluster assignments, cluster sizes) of the model trained on the\n training set. An exception is thrown if no summary exists.\n \"\"\"\n if self.hasSummary:\n return GaussianMixtureSummary(super(GaussianMixtureModel, self).summary)\n else:\n raise RuntimeError(\"No training summary available for this %s\" %\n self.__class__.__name__)\n\n @since(\"3.0.0\")\n def predict(self, value):\n \"\"\"\n Predict label for the given features.\n \"\"\"\n return self._call_java(\"predict\", value)\n\n @since(\"3.0.0\")\n def predictProbability(self, value):\n \"\"\"\n Predict probability for the given features.\n \"\"\"\n return self._call_java(\"predictProbability\", value)\n\n\n@inherit_doc\nclass GaussianMixture(JavaEstimator, _GaussianMixtureParams, JavaMLWritable, JavaMLReadable):\n \"\"\"\n GaussianMixture clustering.\n This class performs expectation maximization for multivariate Gaussian\n Mixture Models (GMMs). A GMM represents a composite distribution of\n independent Gaussian distributions with associated \"mixing\" weights\n specifying each's contribution to the composite.\n\n Given a set of sample points, this class will maximize the log-likelihood\n for a mixture of k Gaussians, iterating until the log-likelihood changes by\n less than convergenceTol, or until it has reached the max number of iterations.\n While this process is generally guaranteed to converge, it is not guaranteed\n to find a global optimum.\n\n .. note:: For high-dimensional data (with many features), this algorithm may perform poorly.\n This is due to high-dimensional data (a) making it difficult to cluster at all\n (based on statistical/theoretical arguments) and (b) numerical issues with\n Gaussian distributions.\n\n >>> from pyspark.ml.linalg import Vectors\n\n >>> data = [(Vectors.dense([-0.1, -0.05 ]),),\n ... (Vectors.dense([-0.01, -0.1]),),\n ... (Vectors.dense([0.9, 0.8]),),\n ... (Vectors.dense([0.75, 0.935]),),\n ... (Vectors.dense([-0.83, -0.68]),),\n ... (Vectors.dense([-0.91, -0.76]),)]\n >>> df = spark.createDataFrame(data, [\"features\"])\n >>> gm = GaussianMixture(k=3, tol=0.0001, seed=10)\n >>> gm.getMaxIter()\n 100\n >>> gm.setMaxIter(10)\n GaussianMixture...\n >>> gm.getMaxIter()\n 10\n >>> model = gm.fit(df)\n >>> model.getAggregationDepth()\n 2\n >>> model.getFeaturesCol()\n 'features'\n >>> model.setPredictionCol(\"newPrediction\")\n GaussianMixtureModel...\n >>> model.predict(df.head().features)\n 2\n >>> model.predictProbability(df.head().features)\n DenseVector([0.0, 0.4736, 0.5264])\n >>> model.hasSummary\n True\n >>> summary = model.summary\n >>> summary.k\n 3\n >>> summary.clusterSizes\n [2, 2, 2]\n >>> summary.logLikelihood\n 8.14636...\n >>> weights = model.weights\n >>> len(weights)\n 3\n >>> gaussians = model.gaussians\n >>> len(gaussians)\n 3\n >>> model.gaussiansDF.select(\"mean\").head()\n Row(mean=DenseVector([0.825, 0.8675]))\n >>> model.gaussiansDF.select(\"cov\").head()\n Row(cov=DenseMatrix(2, 2, [0.0056, -0.0051, -0.0051, 0.0046], False))\n >>> transformed = model.transform(df).select(\"features\", \"newPrediction\")\n >>> rows = transformed.collect()\n >>> rows[4].newPrediction == rows[5].newPrediction\n True\n >>> rows[2].newPrediction == rows[3].newPrediction\n True\n >>> gmm_path = temp_path + \"/gmm\"\n >>> gm.save(gmm_path)\n >>> gm2 = GaussianMixture.load(gmm_path)\n >>> gm2.getK()\n 3\n >>> model_path = temp_path + \"/gmm_model\"\n >>> model.save(model_path)\n >>> model2 = GaussianMixtureModel.load(model_path)\n >>> model2.hasSummary\n False\n >>> model2.weights == model.weights\n True\n >>> model2.gaussians == model.gaussians\n True\n >>> model2.gaussiansDF.select(\"mean\").head()\n Row(mean=DenseVector([0.825, 0.8675]))\n >>> model2.gaussiansDF.select(\"cov\").head()\n Row(cov=DenseMatrix(2, 2, [0.0056, -0.0051, -0.0051, 0.0046], False))\n\n .. versionadded:: 2.0.0\n \"\"\"\n\n @keyword_only\n def __init__(self, featuresCol=\"features\", predictionCol=\"prediction\", k=2,\n probabilityCol=\"probability\", tol=0.01, maxIter=100, seed=None,\n aggregationDepth=2):\n \"\"\"\n __init__(self, featuresCol=\"features\", predictionCol=\"prediction\", k=2, \\\n probabilityCol=\"probability\", tol=0.01, maxIter=100, seed=None, \\\n aggregationDepth=2)\n \"\"\"\n super(GaussianMixture, self).__init__()\n self._java_obj = self._new_java_obj(\"org.apache.spark.ml.clustering.GaussianMixture\",\n self.uid)\n self._setDefault(k=2, tol=0.01, maxIter=100, aggregationDepth=2)\n kwargs = self._input_kwargs\n self.setParams(**kwargs)\n\n def _create_model(self, java_model):\n return GaussianMixtureModel(java_model)\n\n @keyword_only\n @since(\"2.0.0\")\n def setParams(self, featuresCol=\"features\", predictionCol=\"prediction\", k=2,\n probabilityCol=\"probability\", tol=0.01, maxIter=100, seed=None,\n aggregationDepth=2):\n \"\"\"\n setParams(self, featuresCol=\"features\", predictionCol=\"prediction\", k=2, \\\n probabilityCol=\"probability\", tol=0.01, maxIter=100, seed=None, \\\n aggregationDepth=2)\n\n Sets params for GaussianMixture.\n \"\"\"\n kwargs = self._input_kwargs\n return self._set(**kwargs)\n\n @since(\"2.0.0\")\n def setK(self, value):\n \"\"\"\n Sets the value of :py:attr:`k`.\n \"\"\"\n return self._set(k=value)\n\n @since(\"2.0.0\")\n def setMaxIter(self, value):\n \"\"\"\n Sets the value of :py:attr:`maxIter`.\n \"\"\"\n return self._set(maxIter=value)\n\n @since(\"2.0.0\")\n def setFeaturesCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`featuresCol`.\n \"\"\"\n return self._set(featuresCol=value)\n\n @since(\"2.0.0\")\n def setPredictionCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`predictionCol`.\n \"\"\"\n return self._set(predictionCol=value)\n\n @since(\"2.0.0\")\n def setProbabilityCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`probabilityCol`.\n \"\"\"\n return self._set(probabilityCol=value)\n\n @since(\"2.0.0\")\n def setSeed(self, value):\n \"\"\"\n Sets the value of :py:attr:`seed`.\n \"\"\"\n return self._set(seed=value)\n\n @since(\"2.0.0\")\n def setTol(self, value):\n \"\"\"\n Sets the value of :py:attr:`tol`.\n \"\"\"\n return self._set(tol=value)\n\n @since(\"3.0.0\")\n def setAggregationDepth(self, value):\n \"\"\"\n Sets the value of :py:attr:`aggregationDepth`.\n \"\"\"\n return self._set(aggregationDepth=value)\n\n\nclass GaussianMixtureSummary(ClusteringSummary):\n \"\"\"\n Gaussian mixture clustering results for a given model.\n\n .. versionadded:: 2.1.0\n \"\"\"\n\n @property\n @since(\"2.1.0\")\n def probabilityCol(self):\n \"\"\"\n Name for column of predicted probability of each cluster in `predictions`.\n \"\"\"\n return self._call_java(\"probabilityCol\")\n\n @property\n @since(\"2.1.0\")\n def probability(self):\n \"\"\"\n DataFrame of probabilities of each cluster for each training data point.\n \"\"\"\n return self._call_java(\"probability\")\n\n @property\n @since(\"2.2.0\")\n def logLikelihood(self):\n \"\"\"\n Total log-likelihood for this model on the given data.\n \"\"\"\n return self._call_java(\"logLikelihood\")\n\n\nclass KMeansSummary(ClusteringSummary):\n \"\"\"\n Summary of KMeans.\n\n .. versionadded:: 2.1.0\n \"\"\"\n\n @property\n @since(\"2.4.0\")\n def trainingCost(self):\n \"\"\"\n K-means cost (sum of squared distances to the nearest centroid for all points in the\n training dataset). This is equivalent to sklearn's inertia.\n \"\"\"\n return self._call_java(\"trainingCost\")\n\n\n@inherit_doc\nclass _KMeansParams(HasMaxIter, HasFeaturesCol, HasSeed, HasPredictionCol, HasTol,\n HasDistanceMeasure, HasWeightCol):\n \"\"\"\n Params for :py:class:`KMeans` and :py:class:`KMeansModel`.\n\n .. versionadded:: 3.0.0\n \"\"\"\n\n k = Param(Params._dummy(), \"k\", \"The number of clusters to create. Must be > 1.\",\n typeConverter=TypeConverters.toInt)\n initMode = Param(Params._dummy(), \"initMode\",\n \"The initialization algorithm. This can be either \\\"random\\\" to \" +\n \"choose random points as initial cluster centers, or \\\"k-means||\\\" \" +\n \"to use a parallel variant of k-means++\",\n typeConverter=TypeConverters.toString)\n initSteps = Param(Params._dummy(), \"initSteps\", \"The number of steps for k-means|| \" +\n \"initialization mode. Must be > 0.\", typeConverter=TypeConverters.toInt)\n\n @since(\"1.5.0\")\n def getK(self):\n \"\"\"\n Gets the value of `k`\n \"\"\"\n return self.getOrDefault(self.k)\n\n @since(\"1.5.0\")\n def getInitMode(self):\n \"\"\"\n Gets the value of `initMode`\n \"\"\"\n return self.getOrDefault(self.initMode)\n\n @since(\"1.5.0\")\n def getInitSteps(self):\n \"\"\"\n Gets the value of `initSteps`\n \"\"\"\n return self.getOrDefault(self.initSteps)\n\n\nclass KMeansModel(JavaModel, _KMeansParams, GeneralJavaMLWritable, JavaMLReadable,\n HasTrainingSummary):\n \"\"\"\n Model fitted by KMeans.\n\n .. versionadded:: 1.5.0\n \"\"\"\n\n @since(\"3.0.0\")\n def setFeaturesCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`featuresCol`.\n \"\"\"\n return self._set(featuresCol=value)\n\n @since(\"3.0.0\")\n def setPredictionCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`predictionCol`.\n \"\"\"\n return self._set(predictionCol=value)\n\n @since(\"1.5.0\")\n def clusterCenters(self):\n \"\"\"Get the cluster centers, represented as a list of NumPy arrays.\"\"\"\n return [c.toArray() for c in self._call_java(\"clusterCenters\")]\n\n @property\n @since(\"2.1.0\")\n def summary(self):\n \"\"\"\n Gets summary (e.g. cluster assignments, cluster sizes) of the model trained on the\n training set. An exception is thrown if no summary exists.\n \"\"\"\n if self.hasSummary:\n return KMeansSummary(super(KMeansModel, self).summary)\n else:\n raise RuntimeError(\"No training summary available for this %s\" %\n self.__class__.__name__)\n\n @since(\"3.0.0\")\n def predict(self, value):\n \"\"\"\n Predict label for the given features.\n \"\"\"\n return self._call_java(\"predict\", value)\n\n\n@inherit_doc\nclass KMeans(JavaEstimator, _KMeansParams, JavaMLWritable, JavaMLReadable):\n \"\"\"\n K-means clustering with a k-means++ like initialization mode\n (the k-means|| algorithm by Bahmani et al).\n\n >>> from pyspark.ml.linalg import Vectors\n >>> data = [(Vectors.dense([0.0, 0.0]), 2.0), (Vectors.dense([1.0, 1.0]), 2.0),\n ... (Vectors.dense([9.0, 8.0]), 2.0), (Vectors.dense([8.0, 9.0]), 2.0)]\n >>> df = spark.createDataFrame(data, [\"features\", \"weighCol\"])\n >>> kmeans = KMeans(k=2)\n >>> kmeans.setSeed(1)\n KMeans...\n >>> kmeans.setWeightCol(\"weighCol\")\n KMeans...\n >>> kmeans.setMaxIter(10)\n KMeans...\n >>> kmeans.getMaxIter()\n 10\n >>> kmeans.clear(kmeans.maxIter)\n >>> model = kmeans.fit(df)\n >>> model.getDistanceMeasure()\n 'euclidean'\n >>> model.setPredictionCol(\"newPrediction\")\n KMeansModel...\n >>> model.predict(df.head().features)\n 0\n >>> centers = model.clusterCenters()\n >>> len(centers)\n 2\n >>> transformed = model.transform(df).select(\"features\", \"newPrediction\")\n >>> rows = transformed.collect()\n >>> rows[0].newPrediction == rows[1].newPrediction\n True\n >>> rows[2].newPrediction == rows[3].newPrediction\n True\n >>> model.hasSummary\n True\n >>> summary = model.summary\n >>> summary.k\n 2\n >>> summary.clusterSizes\n [2, 2]\n >>> summary.trainingCost\n 4.0\n >>> kmeans_path = temp_path + \"/kmeans\"\n >>> kmeans.save(kmeans_path)\n >>> kmeans2 = KMeans.load(kmeans_path)\n >>> kmeans2.getK()\n 2\n >>> model_path = temp_path + \"/kmeans_model\"\n >>> model.save(model_path)\n >>> model2 = KMeansModel.load(model_path)\n >>> model2.hasSummary\n False\n >>> model.clusterCenters()[0] == model2.clusterCenters()[0]\n array([ True, True], dtype=bool)\n >>> model.clusterCenters()[1] == model2.clusterCenters()[1]\n array([ True, True], dtype=bool)\n\n .. versionadded:: 1.5.0\n \"\"\"\n\n @keyword_only\n def __init__(self, featuresCol=\"features\", predictionCol=\"prediction\", k=2,\n initMode=\"k-means||\", initSteps=2, tol=1e-4, maxIter=20, seed=None,\n distanceMeasure=\"euclidean\", weightCol=None):\n \"\"\"\n __init__(self, featuresCol=\"features\", predictionCol=\"prediction\", k=2, \\\n initMode=\"k-means||\", initSteps=2, tol=1e-4, maxIter=20, seed=None, \\\n distanceMeasure=\"euclidean\", weightCol=None)\n \"\"\"\n super(KMeans, self).__init__()\n self._java_obj = self._new_java_obj(\"org.apache.spark.ml.clustering.KMeans\", self.uid)\n self._setDefault(k=2, initMode=\"k-means||\", initSteps=2, tol=1e-4, maxIter=20,\n distanceMeasure=\"euclidean\")\n kwargs = self._input_kwargs\n self.setParams(**kwargs)\n\n def _create_model(self, java_model):\n return KMeansModel(java_model)\n\n @keyword_only\n @since(\"1.5.0\")\n def setParams(self, featuresCol=\"features\", predictionCol=\"prediction\", k=2,\n initMode=\"k-means||\", initSteps=2, tol=1e-4, maxIter=20, seed=None,\n distanceMeasure=\"euclidean\", weightCol=None):\n \"\"\"\n setParams(self, featuresCol=\"features\", predictionCol=\"prediction\", k=2, \\\n initMode=\"k-means||\", initSteps=2, tol=1e-4, maxIter=20, seed=None, \\\n distanceMeasure=\"euclidean\", weightCol=None)\n\n Sets params for KMeans.\n \"\"\"\n kwargs = self._input_kwargs\n return self._set(**kwargs)\n\n @since(\"1.5.0\")\n def setK(self, value):\n \"\"\"\n Sets the value of :py:attr:`k`.\n \"\"\"\n return self._set(k=value)\n\n @since(\"1.5.0\")\n def setInitMode(self, value):\n \"\"\"\n Sets the value of :py:attr:`initMode`.\n \"\"\"\n return self._set(initMode=value)\n\n @since(\"1.5.0\")\n def setInitSteps(self, value):\n \"\"\"\n Sets the value of :py:attr:`initSteps`.\n \"\"\"\n return self._set(initSteps=value)\n\n @since(\"2.4.0\")\n def setDistanceMeasure(self, value):\n \"\"\"\n Sets the value of :py:attr:`distanceMeasure`.\n \"\"\"\n return self._set(distanceMeasure=value)\n\n @since(\"1.5.0\")\n def setMaxIter(self, value):\n \"\"\"\n Sets the value of :py:attr:`maxIter`.\n \"\"\"\n return self._set(maxIter=value)\n\n @since(\"1.5.0\")\n def setFeaturesCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`featuresCol`.\n \"\"\"\n return self._set(featuresCol=value)\n\n @since(\"1.5.0\")\n def setPredictionCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`predictionCol`.\n \"\"\"\n return self._set(predictionCol=value)\n\n @since(\"1.5.0\")\n def setSeed(self, value):\n \"\"\"\n Sets the value of :py:attr:`seed`.\n \"\"\"\n return self._set(seed=value)\n\n @since(\"1.5.0\")\n def setTol(self, value):\n \"\"\"\n Sets the value of :py:attr:`tol`.\n \"\"\"\n return self._set(tol=value)\n\n @since(\"3.0.0\")\n def setWeightCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`weightCol`.\n \"\"\"\n return self._set(weightCol=value)\n\n\n@inherit_doc\nclass _BisectingKMeansParams(HasMaxIter, HasFeaturesCol, HasSeed, HasPredictionCol,\n HasDistanceMeasure):\n \"\"\"\n Params for :py:class:`BisectingKMeans` and :py:class:`BisectingKMeansModel`.\n\n .. versionadded:: 3.0.0\n \"\"\"\n\n k = Param(Params._dummy(), \"k\", \"The desired number of leaf clusters. Must be > 1.\",\n typeConverter=TypeConverters.toInt)\n minDivisibleClusterSize = Param(Params._dummy(), \"minDivisibleClusterSize\",\n \"The minimum number of points (if >= 1.0) or the minimum \" +\n \"proportion of points (if < 1.0) of a divisible cluster.\",\n typeConverter=TypeConverters.toFloat)\n\n @since(\"2.0.0\")\n def getK(self):\n \"\"\"\n Gets the value of `k` or its default value.\n \"\"\"\n return self.getOrDefault(self.k)\n\n @since(\"2.0.0\")\n def getMinDivisibleClusterSize(self):\n \"\"\"\n Gets the value of `minDivisibleClusterSize` or its default value.\n \"\"\"\n return self.getOrDefault(self.minDivisibleClusterSize)\n\n\nclass BisectingKMeansModel(JavaModel, _BisectingKMeansParams, JavaMLWritable, JavaMLReadable,\n HasTrainingSummary):\n \"\"\"\n Model fitted by BisectingKMeans.\n\n .. versionadded:: 2.0.0\n \"\"\"\n\n @since(\"3.0.0\")\n def setFeaturesCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`featuresCol`.\n \"\"\"\n return self._set(featuresCol=value)\n\n @since(\"3.0.0\")\n def setPredictionCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`predictionCol`.\n \"\"\"\n return self._set(predictionCol=value)\n\n @since(\"2.0.0\")\n def clusterCenters(self):\n \"\"\"Get the cluster centers, represented as a list of NumPy arrays.\"\"\"\n return [c.toArray() for c in self._call_java(\"clusterCenters\")]\n\n @since(\"2.0.0\")\n def computeCost(self, dataset):\n \"\"\"\n Computes the sum of squared distances between the input points\n and their corresponding cluster centers.\n\n ..note:: Deprecated in 3.0.0. It will be removed in future versions. Use\n ClusteringEvaluator instead. You can also get the cost on the training dataset in the\n summary.\n \"\"\"\n warnings.warn(\"Deprecated in 3.0.0. It will be removed in future versions. Use \"\n \"ClusteringEvaluator instead. You can also get the cost on the training \"\n \"dataset in the summary.\", DeprecationWarning)\n return self._call_java(\"computeCost\", dataset)\n\n @property\n @since(\"2.1.0\")\n def summary(self):\n \"\"\"\n Gets summary (e.g. cluster assignments, cluster sizes) of the model trained on the\n training set. An exception is thrown if no summary exists.\n \"\"\"\n if self.hasSummary:\n return BisectingKMeansSummary(super(BisectingKMeansModel, self).summary)\n else:\n raise RuntimeError(\"No training summary available for this %s\" %\n self.__class__.__name__)\n\n @since(\"3.0.0\")\n def predict(self, value):\n \"\"\"\n Predict label for the given features.\n \"\"\"\n return self._call_java(\"predict\", value)\n\n\n@inherit_doc\nclass BisectingKMeans(JavaEstimator, _BisectingKMeansParams, JavaMLWritable, JavaMLReadable):\n \"\"\"\n A bisecting k-means algorithm based on the paper \"A comparison of document clustering\n techniques\" by Steinbach, Karypis, and Kumar, with modification to fit Spark.\n The algorithm starts from a single cluster that contains all points.\n Iteratively it finds divisible clusters on the bottom level and bisects each of them using\n k-means, until there are `k` leaf clusters in total or no leaf clusters are divisible.\n The bisecting steps of clusters on the same level are grouped together to increase parallelism.\n If bisecting all divisible clusters on the bottom level would result more than `k` leaf\n clusters, larger clusters get higher priority.\n\n >>> from pyspark.ml.linalg import Vectors\n >>> data = [(Vectors.dense([0.0, 0.0]),), (Vectors.dense([1.0, 1.0]),),\n ... (Vectors.dense([9.0, 8.0]),), (Vectors.dense([8.0, 9.0]),)]\n >>> df = spark.createDataFrame(data, [\"features\"])\n >>> bkm = BisectingKMeans(k=2, minDivisibleClusterSize=1.0)\n >>> bkm.setMaxIter(10)\n BisectingKMeans...\n >>> bkm.getMaxIter()\n 10\n >>> bkm.clear(bkm.maxIter)\n >>> bkm.setSeed(1)\n BisectingKMeans...\n >>> bkm.getSeed()\n 1\n >>> bkm.clear(bkm.seed)\n >>> model = bkm.fit(df)\n >>> model.getMaxIter()\n 20\n >>> model.setPredictionCol(\"newPrediction\")\n BisectingKMeansModel...\n >>> model.predict(df.head().features)\n 0\n >>> centers = model.clusterCenters()\n >>> len(centers)\n 2\n >>> model.computeCost(df)\n 2.0\n >>> model.hasSummary\n True\n >>> summary = model.summary\n >>> summary.k\n 2\n >>> summary.clusterSizes\n [2, 2]\n >>> summary.trainingCost\n 2.000...\n >>> transformed = model.transform(df).select(\"features\", \"newPrediction\")\n >>> rows = transformed.collect()\n >>> rows[0].newPrediction == rows[1].newPrediction\n True\n >>> rows[2].newPrediction == rows[3].newPrediction\n True\n >>> bkm_path = temp_path + \"/bkm\"\n >>> bkm.save(bkm_path)\n >>> bkm2 = BisectingKMeans.load(bkm_path)\n >>> bkm2.getK()\n 2\n >>> bkm2.getDistanceMeasure()\n 'euclidean'\n >>> model_path = temp_path + \"/bkm_model\"\n >>> model.save(model_path)\n >>> model2 = BisectingKMeansModel.load(model_path)\n >>> model2.hasSummary\n False\n >>> model.clusterCenters()[0] == model2.clusterCenters()[0]\n array([ True, True], dtype=bool)\n >>> model.clusterCenters()[1] == model2.clusterCenters()[1]\n array([ True, True], dtype=bool)\n\n .. versionadded:: 2.0.0\n \"\"\"\n\n @keyword_only\n def __init__(self, featuresCol=\"features\", predictionCol=\"prediction\", maxIter=20,\n seed=None, k=4, minDivisibleClusterSize=1.0, distanceMeasure=\"euclidean\"):\n \"\"\"\n __init__(self, featuresCol=\"features\", predictionCol=\"prediction\", maxIter=20, \\\n seed=None, k=4, minDivisibleClusterSize=1.0, distanceMeasure=\"euclidean\")\n \"\"\"\n super(BisectingKMeans, self).__init__()\n self._java_obj = self._new_java_obj(\"org.apache.spark.ml.clustering.BisectingKMeans\",\n self.uid)\n self._setDefault(maxIter=20, k=4, minDivisibleClusterSize=1.0)\n kwargs = self._input_kwargs\n self.setParams(**kwargs)\n\n @keyword_only\n @since(\"2.0.0\")\n def setParams(self, featuresCol=\"features\", predictionCol=\"prediction\", maxIter=20,\n seed=None, k=4, minDivisibleClusterSize=1.0, distanceMeasure=\"euclidean\"):\n \"\"\"\n setParams(self, featuresCol=\"features\", predictionCol=\"prediction\", maxIter=20, \\\n seed=None, k=4, minDivisibleClusterSize=1.0, distanceMeasure=\"euclidean\")\n Sets params for BisectingKMeans.\n \"\"\"\n kwargs = self._input_kwargs\n return self._set(**kwargs)\n\n @since(\"2.0.0\")\n def setK(self, value):\n \"\"\"\n Sets the value of :py:attr:`k`.\n \"\"\"\n return self._set(k=value)\n\n @since(\"2.0.0\")\n def setMinDivisibleClusterSize(self, value):\n \"\"\"\n Sets the value of :py:attr:`minDivisibleClusterSize`.\n \"\"\"\n return self._set(minDivisibleClusterSize=value)\n\n @since(\"2.4.0\")\n def setDistanceMeasure(self, value):\n \"\"\"\n Sets the value of :py:attr:`distanceMeasure`.\n \"\"\"\n return self._set(distanceMeasure=value)\n\n @since(\"2.0.0\")\n def setMaxIter(self, value):\n \"\"\"\n Sets the value of :py:attr:`maxIter`.\n \"\"\"\n return self._set(maxIter=value)\n\n @since(\"2.0.0\")\n def setFeaturesCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`featuresCol`.\n \"\"\"\n return self._set(featuresCol=value)\n\n @since(\"2.0.0\")\n def setPredictionCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`predictionCol`.\n \"\"\"\n return self._set(predictionCol=value)\n\n @since(\"2.0.0\")\n def setSeed(self, value):\n \"\"\"\n Sets the value of :py:attr:`seed`.\n \"\"\"\n return self._set(seed=value)\n\n def _create_model(self, java_model):\n return BisectingKMeansModel(java_model)\n\n\nclass BisectingKMeansSummary(ClusteringSummary):\n \"\"\"\n Bisecting KMeans clustering results for a given model.\n\n .. versionadded:: 2.1.0\n \"\"\"\n\n @property\n @since(\"3.0.0\")\n def trainingCost(self):\n \"\"\"\n Sum of squared distances to the nearest centroid for all points in the training dataset.\n This is equivalent to sklearn's inertia.\n \"\"\"\n return self._call_java(\"trainingCost\")\n\n\n@inherit_doc\nclass _LDAParams(HasMaxIter, HasFeaturesCol, HasSeed, HasCheckpointInterval):\n \"\"\"\n Params for :py:class:`LDA` and :py:class:`LDAModel`.\n\n .. versionadded:: 3.0.0\n \"\"\"\n\n k = Param(Params._dummy(), \"k\", \"The number of topics (clusters) to infer. Must be > 1.\",\n typeConverter=TypeConverters.toInt)\n optimizer = Param(Params._dummy(), \"optimizer\",\n \"Optimizer or inference algorithm used to estimate the LDA model. \"\n \"Supported: online, em\", typeConverter=TypeConverters.toString)\n learningOffset = Param(Params._dummy(), \"learningOffset\",\n \"A (positive) learning parameter that downweights early iterations.\"\n \" Larger values make early iterations count less\",\n typeConverter=TypeConverters.toFloat)\n learningDecay = Param(Params._dummy(), \"learningDecay\", \"Learning rate, set as an\"\n \"exponential decay rate. This should be between (0.5, 1.0] to \"\n \"guarantee asymptotic convergence.\", typeConverter=TypeConverters.toFloat)\n subsamplingRate = Param(Params._dummy(), \"subsamplingRate\",\n \"Fraction of the corpus to be sampled and used in each iteration \"\n \"of mini-batch gradient descent, in range (0, 1].\",\n typeConverter=TypeConverters.toFloat)\n optimizeDocConcentration = Param(Params._dummy(), \"optimizeDocConcentration\",\n \"Indicates whether the docConcentration (Dirichlet parameter \"\n \"for document-topic distribution) will be optimized during \"\n \"training.\", typeConverter=TypeConverters.toBoolean)\n docConcentration = Param(Params._dummy(), \"docConcentration\",\n \"Concentration parameter (commonly named \\\"alpha\\\") for the \"\n \"prior placed on documents' distributions over topics (\\\"theta\\\").\",\n typeConverter=TypeConverters.toListFloat)\n topicConcentration = Param(Params._dummy(), \"topicConcentration\",\n \"Concentration parameter (commonly named \\\"beta\\\" or \\\"eta\\\") for \"\n \"the prior placed on topic' distributions over terms.\",\n typeConverter=TypeConverters.toFloat)\n topicDistributionCol = Param(Params._dummy(), \"topicDistributionCol\",\n \"Output column with estimates of the topic mixture distribution \"\n \"for each document (often called \\\"theta\\\" in the literature). \"\n \"Returns a vector of zeros for an empty document.\",\n typeConverter=TypeConverters.toString)\n keepLastCheckpoint = Param(Params._dummy(), \"keepLastCheckpoint\",\n \"(For EM optimizer) If using checkpointing, this indicates whether\"\n \" to keep the last checkpoint. If false, then the checkpoint will be\"\n \" deleted. Deleting the checkpoint can cause failures if a data\"\n \" partition is lost, so set this bit with care.\",\n TypeConverters.toBoolean)\n\n @since(\"2.0.0\")\n def getK(self):\n \"\"\"\n Gets the value of :py:attr:`k` or its default value.\n \"\"\"\n return self.getOrDefault(self.k)\n\n @since(\"2.0.0\")\n def getOptimizer(self):\n \"\"\"\n Gets the value of :py:attr:`optimizer` or its default value.\n \"\"\"\n return self.getOrDefault(self.optimizer)\n\n @since(\"2.0.0\")\n def getLearningOffset(self):\n \"\"\"\n Gets the value of :py:attr:`learningOffset` or its default value.\n \"\"\"\n return self.getOrDefault(self.learningOffset)\n\n @since(\"2.0.0\")\n def getLearningDecay(self):\n \"\"\"\n Gets the value of :py:attr:`learningDecay` or its default value.\n \"\"\"\n return self.getOrDefault(self.learningDecay)\n\n @since(\"2.0.0\")\n def getSubsamplingRate(self):\n \"\"\"\n Gets the value of :py:attr:`subsamplingRate` or its default value.\n \"\"\"\n return self.getOrDefault(self.subsamplingRate)\n\n @since(\"2.0.0\")\n def getOptimizeDocConcentration(self):\n \"\"\"\n Gets the value of :py:attr:`optimizeDocConcentration` or its default value.\n \"\"\"\n return self.getOrDefault(self.optimizeDocConcentration)\n\n @since(\"2.0.0\")\n def getDocConcentration(self):\n \"\"\"\n Gets the value of :py:attr:`docConcentration` or its default value.\n \"\"\"\n return self.getOrDefault(self.docConcentration)\n\n @since(\"2.0.0\")\n def getTopicConcentration(self):\n \"\"\"\n Gets the value of :py:attr:`topicConcentration` or its default value.\n \"\"\"\n return self.getOrDefault(self.topicConcentration)\n\n @since(\"2.0.0\")\n def getTopicDistributionCol(self):\n \"\"\"\n Gets the value of :py:attr:`topicDistributionCol` or its default value.\n \"\"\"\n return self.getOrDefault(self.topicDistributionCol)\n\n @since(\"2.0.0\")\n def getKeepLastCheckpoint(self):\n \"\"\"\n Gets the value of :py:attr:`keepLastCheckpoint` or its default value.\n \"\"\"\n return self.getOrDefault(self.keepLastCheckpoint)\n\n\n@inherit_doc\nclass LDAModel(JavaModel, _LDAParams):\n \"\"\"\n Latent Dirichlet Allocation (LDA) model.\n This abstraction permits for different underlying representations,\n including local and distributed data structures.\n\n .. versionadded:: 2.0.0\n \"\"\"\n\n @since(\"3.0.0\")\n def setFeaturesCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`featuresCol`.\n \"\"\"\n return self._set(featuresCol=value)\n\n @since(\"3.0.0\")\n def setSeed(self, value):\n \"\"\"\n Sets the value of :py:attr:`seed`.\n \"\"\"\n return self._set(seed=value)\n\n @since(\"3.0.0\")\n def setTopicDistributionCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`topicDistributionCol`.\n\n >>> algo = LDA().setTopicDistributionCol(\"topicDistributionCol\")\n >>> algo.getTopicDistributionCol()\n 'topicDistributionCol'\n \"\"\"\n return self._set(topicDistributionCol=value)\n\n @since(\"2.0.0\")\n def isDistributed(self):\n \"\"\"\n Indicates whether this instance is of type DistributedLDAModel\n \"\"\"\n return self._call_java(\"isDistributed\")\n\n @since(\"2.0.0\")\n def vocabSize(self):\n \"\"\"Vocabulary size (number of terms or words in the vocabulary)\"\"\"\n return self._call_java(\"vocabSize\")\n\n @since(\"2.0.0\")\n def topicsMatrix(self):\n \"\"\"\n Inferred topics, where each topic is represented by a distribution over terms.\n This is a matrix of size vocabSize x k, where each column is a topic.\n No guarantees are given about the ordering of the topics.\n\n WARNING: If this model is actually a :py:class:`DistributedLDAModel` instance produced by\n the Expectation-Maximization (\"em\") `optimizer`, then this method could involve\n collecting a large amount of data to the driver (on the order of vocabSize x k).\n \"\"\"\n return self._call_java(\"topicsMatrix\")\n\n @since(\"2.0.0\")\n def logLikelihood(self, dataset):\n \"\"\"\n Calculates a lower bound on the log likelihood of the entire corpus.\n See Equation (16) in the Online LDA paper (Hoffman et al., 2010).\n\n WARNING: If this model is an instance of :py:class:`DistributedLDAModel` (produced when\n :py:attr:`optimizer` is set to \"em\"), this involves collecting a large\n :py:func:`topicsMatrix` to the driver. This implementation may be changed in the future.\n \"\"\"\n return self._call_java(\"logLikelihood\", dataset)\n\n @since(\"2.0.0\")\n def logPerplexity(self, dataset):\n \"\"\"\n Calculate an upper bound on perplexity. (Lower is better.)\n See Equation (16) in the Online LDA paper (Hoffman et al., 2010).\n\n WARNING: If this model is an instance of :py:class:`DistributedLDAModel` (produced when\n :py:attr:`optimizer` is set to \"em\"), this involves collecting a large\n :py:func:`topicsMatrix` to the driver. This implementation may be changed in the future.\n \"\"\"\n return self._call_java(\"logPerplexity\", dataset)\n\n @since(\"2.0.0\")\n def describeTopics(self, maxTermsPerTopic=10):\n \"\"\"\n Return the topics described by their top-weighted terms.\n \"\"\"\n return self._call_java(\"describeTopics\", maxTermsPerTopic)\n\n @since(\"2.0.0\")\n def estimatedDocConcentration(self):\n \"\"\"\n Value for :py:attr:`LDA.docConcentration` estimated from data.\n If Online LDA was used and :py:attr:`LDA.optimizeDocConcentration` was set to false,\n then this returns the fixed (given) value for the :py:attr:`LDA.docConcentration` parameter.\n \"\"\"\n return self._call_java(\"estimatedDocConcentration\")\n\n\n@inherit_doc\nclass DistributedLDAModel(LDAModel, JavaMLReadable, JavaMLWritable):\n \"\"\"\n Distributed model fitted by :py:class:`LDA`.\n This type of model is currently only produced by Expectation-Maximization (EM).\n\n This model stores the inferred topics, the full training dataset, and the topic distribution\n for each training document.\n\n .. versionadded:: 2.0.0\n \"\"\"\n\n @since(\"2.0.0\")\n def toLocal(self):\n \"\"\"\n Convert this distributed model to a local representation. This discards info about the\n training dataset.\n\n WARNING: This involves collecting a large :py:func:`topicsMatrix` to the driver.\n \"\"\"\n model = LocalLDAModel(self._call_java(\"toLocal\"))\n\n # SPARK-10931: Temporary fix to be removed once LDAModel defines Params\n model._create_params_from_java()\n model._transfer_params_from_java()\n\n return model\n\n @since(\"2.0.0\")\n def trainingLogLikelihood(self):\n \"\"\"\n Log likelihood of the observed tokens in the training set,\n given the current parameter estimates:\n log P(docs | topics, topic distributions for docs, Dirichlet hyperparameters)\n\n Notes:\n - This excludes the prior; for that, use :py:func:`logPrior`.\n - Even with :py:func:`logPrior`, this is NOT the same as the data log likelihood given\n the hyperparameters.\n - This is computed from the topic distributions computed during training. If you call\n :py:func:`logLikelihood` on the same training dataset, the topic distributions\n will be computed again, possibly giving different results.\n \"\"\"\n return self._call_java(\"trainingLogLikelihood\")\n\n @since(\"2.0.0\")\n def logPrior(self):\n \"\"\"\n Log probability of the current parameter estimate:\n log P(topics, topic distributions for docs | alpha, eta)\n \"\"\"\n return self._call_java(\"logPrior\")\n\n @since(\"2.0.0\")\n def getCheckpointFiles(self):\n \"\"\"\n If using checkpointing and :py:attr:`LDA.keepLastCheckpoint` is set to true, then there may\n be saved checkpoint files. This method is provided so that users can manage those files.\n\n .. note:: Removing the checkpoints can cause failures if a partition is lost and is needed\n by certain :py:class:`DistributedLDAModel` methods. Reference counting will clean up\n the checkpoints when this model and derivative data go out of scope.\n\n :return List of checkpoint files from training\n \"\"\"\n return self._call_java(\"getCheckpointFiles\")\n\n\n@inherit_doc\nclass LocalLDAModel(LDAModel, JavaMLReadable, JavaMLWritable):\n \"\"\"\n Local (non-distributed) model fitted by :py:class:`LDA`.\n This model stores the inferred topics only; it does not store info about the training dataset.\n\n .. versionadded:: 2.0.0\n \"\"\"\n pass\n\n\n@inherit_doc\nclass LDA(JavaEstimator, _LDAParams, JavaMLReadable, JavaMLWritable):\n \"\"\"\n Latent Dirichlet Allocation (LDA), a topic model designed for text documents.\n\n Terminology:\n\n - \"term\" = \"word\": an element of the vocabulary\n - \"token\": instance of a term appearing in a document\n - \"topic\": multinomial distribution over terms representing some concept\n - \"document\": one piece of text, corresponding to one row in the input data\n\n Original LDA paper (journal version):\n Blei, Ng, and Jordan. \"Latent Dirichlet Allocation.\" JMLR, 2003.\n\n Input data (featuresCol):\n LDA is given a collection of documents as input data, via the featuresCol parameter.\n Each document is specified as a :py:class:`Vector` of length vocabSize, where each entry is the\n count for the corresponding term (word) in the document. Feature transformers such as\n :py:class:`pyspark.ml.feature.Tokenizer` and :py:class:`pyspark.ml.feature.CountVectorizer`\n can be useful for converting text to word count vectors.\n\n >>> from pyspark.ml.linalg import Vectors, SparseVector\n >>> from pyspark.ml.clustering import LDA\n >>> df = spark.createDataFrame([[1, Vectors.dense([0.0, 1.0])],\n ... [2, SparseVector(2, {0: 1.0})],], [\"id\", \"features\"])\n >>> lda = LDA(k=2, seed=1, optimizer=\"em\")\n >>> lda.setMaxIter(10)\n LDA...\n >>> lda.getMaxIter()\n 10\n >>> lda.clear(lda.maxIter)\n >>> model = lda.fit(df)\n >>> model.setSeed(1)\n DistributedLDAModel...\n >>> model.getTopicDistributionCol()\n 'topicDistribution'\n >>> model.isDistributed()\n True\n >>> localModel = model.toLocal()\n >>> localModel.isDistributed()\n False\n >>> model.vocabSize()\n 2\n >>> model.describeTopics().show()\n +-----+-----------+--------------------+\n |topic|termIndices| termWeights|\n +-----+-----------+--------------------+\n | 0| [1, 0]|[0.50401530077160...|\n | 1| [0, 1]|[0.50401530077160...|\n +-----+-----------+--------------------+\n ...\n >>> model.topicsMatrix()\n DenseMatrix(2, 2, [0.496, 0.504, 0.504, 0.496], 0)\n >>> lda_path = temp_path + \"/lda\"\n >>> lda.save(lda_path)\n >>> sameLDA = LDA.load(lda_path)\n >>> distributed_model_path = temp_path + \"/lda_distributed_model\"\n >>> model.save(distributed_model_path)\n >>> sameModel = DistributedLDAModel.load(distributed_model_path)\n >>> local_model_path = temp_path + \"/lda_local_model\"\n >>> localModel.save(local_model_path)\n >>> sameLocalModel = LocalLDAModel.load(local_model_path)\n\n .. versionadded:: 2.0.0\n \"\"\"\n\n @keyword_only\n def __init__(self, featuresCol=\"features\", maxIter=20, seed=None, checkpointInterval=10,\n k=10, optimizer=\"online\", learningOffset=1024.0, learningDecay=0.51,\n subsamplingRate=0.05, optimizeDocConcentration=True,\n docConcentration=None, topicConcentration=None,\n topicDistributionCol=\"topicDistribution\", keepLastCheckpoint=True):\n \"\"\"\n __init__(self, featuresCol=\"features\", maxIter=20, seed=None, checkpointInterval=10,\\\n k=10, optimizer=\"online\", learningOffset=1024.0, learningDecay=0.51,\\\n subsamplingRate=0.05, optimizeDocConcentration=True,\\\n docConcentration=None, topicConcentration=None,\\\n topicDistributionCol=\"topicDistribution\", keepLastCheckpoint=True)\n \"\"\"\n super(LDA, self).__init__()\n self._java_obj = self._new_java_obj(\"org.apache.spark.ml.clustering.LDA\", self.uid)\n self._setDefault(maxIter=20, checkpointInterval=10,\n k=10, optimizer=\"online\", learningOffset=1024.0, learningDecay=0.51,\n subsamplingRate=0.05, optimizeDocConcentration=True,\n topicDistributionCol=\"topicDistribution\", keepLastCheckpoint=True)\n kwargs = self._input_kwargs\n self.setParams(**kwargs)\n\n def _create_model(self, java_model):\n if self.getOptimizer() == \"em\":\n return DistributedLDAModel(java_model)\n else:\n return LocalLDAModel(java_model)\n\n @keyword_only\n @since(\"2.0.0\")\n def setParams(self, featuresCol=\"features\", maxIter=20, seed=None, checkpointInterval=10,\n k=10, optimizer=\"online\", learningOffset=1024.0, learningDecay=0.51,\n subsamplingRate=0.05, optimizeDocConcentration=True,\n docConcentration=None, topicConcentration=None,\n topicDistributionCol=\"topicDistribution\", keepLastCheckpoint=True):\n \"\"\"\n setParams(self, featuresCol=\"features\", maxIter=20, seed=None, checkpointInterval=10,\\\n k=10, optimizer=\"online\", learningOffset=1024.0, learningDecay=0.51,\\\n subsamplingRate=0.05, optimizeDocConcentration=True,\\\n docConcentration=None, topicConcentration=None,\\\n topicDistributionCol=\"topicDistribution\", keepLastCheckpoint=True)\n\n Sets params for LDA.\n \"\"\"\n kwargs = self._input_kwargs\n return self._set(**kwargs)\n\n @since(\"2.0.0\")\n def setCheckpointInterval(self, value):\n \"\"\"\n Sets the value of :py:attr:`checkpointInterval`.\n \"\"\"\n return self._set(checkpointInterval=value)\n\n @since(\"2.0.0\")\n def setSeed(self, value):\n \"\"\"\n Sets the value of :py:attr:`seed`.\n \"\"\"\n return self._set(seed=value)\n\n @since(\"2.0.0\")\n def setK(self, value):\n \"\"\"\n Sets the value of :py:attr:`k`.\n\n >>> algo = LDA().setK(10)\n >>> algo.getK()\n 10\n \"\"\"\n return self._set(k=value)\n\n @since(\"2.0.0\")\n def setOptimizer(self, value):\n \"\"\"\n Sets the value of :py:attr:`optimizer`.\n Currently only support 'em' and 'online'.\n\n >>> algo = LDA().setOptimizer(\"em\")\n >>> algo.getOptimizer()\n 'em'\n \"\"\"\n return self._set(optimizer=value)\n\n @since(\"2.0.0\")\n def setLearningOffset(self, value):\n \"\"\"\n Sets the value of :py:attr:`learningOffset`.\n\n >>> algo = LDA().setLearningOffset(100)\n >>> algo.getLearningOffset()\n 100.0\n \"\"\"\n return self._set(learningOffset=value)\n\n @since(\"2.0.0\")\n def setLearningDecay(self, value):\n \"\"\"\n Sets the value of :py:attr:`learningDecay`.\n\n >>> algo = LDA().setLearningDecay(0.1)\n >>> algo.getLearningDecay()\n 0.1...\n \"\"\"\n return self._set(learningDecay=value)\n\n @since(\"2.0.0\")\n def setSubsamplingRate(self, value):\n \"\"\"\n Sets the value of :py:attr:`subsamplingRate`.\n\n >>> algo = LDA().setSubsamplingRate(0.1)\n >>> algo.getSubsamplingRate()\n 0.1...\n \"\"\"\n return self._set(subsamplingRate=value)\n\n @since(\"2.0.0\")\n def setOptimizeDocConcentration(self, value):\n \"\"\"\n Sets the value of :py:attr:`optimizeDocConcentration`.\n\n >>> algo = LDA().setOptimizeDocConcentration(True)\n >>> algo.getOptimizeDocConcentration()\n True\n \"\"\"\n return self._set(optimizeDocConcentration=value)\n\n @since(\"2.0.0\")\n def setDocConcentration(self, value):\n \"\"\"\n Sets the value of :py:attr:`docConcentration`.\n\n >>> algo = LDA().setDocConcentration([0.1, 0.2])\n >>> algo.getDocConcentration()\n [0.1..., 0.2...]\n \"\"\"\n return self._set(docConcentration=value)\n\n @since(\"2.0.0\")\n def setTopicConcentration(self, value):\n \"\"\"\n Sets the value of :py:attr:`topicConcentration`.\n\n >>> algo = LDA().setTopicConcentration(0.5)\n >>> algo.getTopicConcentration()\n 0.5...\n \"\"\"\n return self._set(topicConcentration=value)\n\n @since(\"2.0.0\")\n def setTopicDistributionCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`topicDistributionCol`.\n\n >>> algo = LDA().setTopicDistributionCol(\"topicDistributionCol\")\n >>> algo.getTopicDistributionCol()\n 'topicDistributionCol'\n \"\"\"\n return self._set(topicDistributionCol=value)\n\n @since(\"2.0.0\")\n def setKeepLastCheckpoint(self, value):\n \"\"\"\n Sets the value of :py:attr:`keepLastCheckpoint`.\n\n >>> algo = LDA().setKeepLastCheckpoint(False)\n >>> algo.getKeepLastCheckpoint()\n False\n \"\"\"\n return self._set(keepLastCheckpoint=value)\n\n @since(\"2.0.0\")\n def setMaxIter(self, value):\n \"\"\"\n Sets the value of :py:attr:`maxIter`.\n \"\"\"\n return self._set(maxIter=value)\n\n @since(\"2.0.0\")\n def setFeaturesCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`featuresCol`.\n \"\"\"\n return self._set(featuresCol=value)\n\n\n@inherit_doc\nclass _PowerIterationClusteringParams(HasMaxIter, HasWeightCol):\n \"\"\"\n Params for :py:class:`PowerIterationClustering`.\n\n .. versionadded:: 3.0.0\n \"\"\"\n\n k = Param(Params._dummy(), \"k\",\n \"The number of clusters to create. Must be > 1.\",\n typeConverter=TypeConverters.toInt)\n initMode = Param(Params._dummy(), \"initMode\",\n \"The initialization algorithm. This can be either \" +\n \"'random' to use a random vector as vertex properties, or 'degree' to use \" +\n \"a normalized sum of similarities with other vertices. Supported options: \" +\n \"'random' and 'degree'.\",\n typeConverter=TypeConverters.toString)\n srcCol = Param(Params._dummy(), \"srcCol\",\n \"Name of the input column for source vertex IDs.\",\n typeConverter=TypeConverters.toString)\n dstCol = Param(Params._dummy(), \"dstCol\",\n \"Name of the input column for destination vertex IDs.\",\n typeConverter=TypeConverters.toString)\n\n @since(\"2.4.0\")\n def getK(self):\n \"\"\"\n Gets the value of :py:attr:`k` or its default value.\n \"\"\"\n return self.getOrDefault(self.k)\n\n @since(\"2.4.0\")\n def getInitMode(self):\n \"\"\"\n Gets the value of :py:attr:`initMode` or its default value.\n \"\"\"\n return self.getOrDefault(self.initMode)\n\n @since(\"2.4.0\")\n def getSrcCol(self):\n \"\"\"\n Gets the value of :py:attr:`srcCol` or its default value.\n \"\"\"\n return self.getOrDefault(self.srcCol)\n\n @since(\"2.4.0\")\n def getDstCol(self):\n \"\"\"\n Gets the value of :py:attr:`dstCol` or its default value.\n \"\"\"\n return self.getOrDefault(self.dstCol)\n\n\n@inherit_doc\nclass PowerIterationClustering(_PowerIterationClusteringParams, JavaParams, JavaMLReadable,\n JavaMLWritable):\n \"\"\"\n Power Iteration Clustering (PIC), a scalable graph clustering algorithm developed by\n `Lin and Cohen <http://www.cs.cmu.edu/~frank/papers/icml2010-pic-final.pdf>`_. From the\n abstract: PIC finds a very low-dimensional embedding of a dataset using truncated power\n iteration on a normalized pair-wise similarity matrix of the data.\n\n This class is not yet an Estimator/Transformer, use :py:func:`assignClusters` method\n to run the PowerIterationClustering algorithm.\n\n .. seealso:: `Wikipedia on Spectral clustering\n <http://en.wikipedia.org/wiki/Spectral_clustering>`_\n\n >>> data = [(1, 0, 0.5),\n ... (2, 0, 0.5), (2, 1, 0.7),\n ... (3, 0, 0.5), (3, 1, 0.7), (3, 2, 0.9),\n ... (4, 0, 0.5), (4, 1, 0.7), (4, 2, 0.9), (4, 3, 1.1),\n ... (5, 0, 0.5), (5, 1, 0.7), (5, 2, 0.9), (5, 3, 1.1), (5, 4, 1.3)]\n >>> df = spark.createDataFrame(data).toDF(\"src\", \"dst\", \"weight\").repartition(1)\n >>> pic = PowerIterationClustering(k=2, weightCol=\"weight\")\n >>> pic.setMaxIter(40)\n PowerIterationClustering...\n >>> assignments = pic.assignClusters(df)\n >>> assignments.sort(assignments.id).show(truncate=False)\n +---+-------+\n |id |cluster|\n +---+-------+\n |0 |0 |\n |1 |0 |\n |2 |0 |\n |3 |0 |\n |4 |0 |\n |5 |1 |\n +---+-------+\n ...\n >>> pic_path = temp_path + \"/pic\"\n >>> pic.save(pic_path)\n >>> pic2 = PowerIterationClustering.load(pic_path)\n >>> pic2.getK()\n 2\n >>> pic2.getMaxIter()\n 40\n\n .. versionadded:: 2.4.0\n \"\"\"\n\n @keyword_only\n def __init__(self, k=2, maxIter=20, initMode=\"random\", srcCol=\"src\", dstCol=\"dst\",\n weightCol=None):\n \"\"\"\n __init__(self, k=2, maxIter=20, initMode=\"random\", srcCol=\"src\", dstCol=\"dst\",\\\n weightCol=None)\n \"\"\"\n super(PowerIterationClustering, self).__init__()\n self._java_obj = self._new_java_obj(\n \"org.apache.spark.ml.clustering.PowerIterationClustering\", self.uid)\n self._setDefault(k=2, maxIter=20, initMode=\"random\", srcCol=\"src\", dstCol=\"dst\")\n kwargs = self._input_kwargs\n self.setParams(**kwargs)\n\n @keyword_only\n @since(\"2.4.0\")\n def setParams(self, k=2, maxIter=20, initMode=\"random\", srcCol=\"src\", dstCol=\"dst\",\n weightCol=None):\n \"\"\"\n setParams(self, k=2, maxIter=20, initMode=\"random\", srcCol=\"src\", dstCol=\"dst\",\\\n weightCol=None)\n Sets params for PowerIterationClustering.\n \"\"\"\n kwargs = self._input_kwargs\n return self._set(**kwargs)\n\n @since(\"2.4.0\")\n def setK(self, value):\n \"\"\"\n Sets the value of :py:attr:`k`.\n \"\"\"\n return self._set(k=value)\n\n @since(\"2.4.0\")\n def setInitMode(self, value):\n \"\"\"\n Sets the value of :py:attr:`initMode`.\n \"\"\"\n return self._set(initMode=value)\n\n @since(\"2.4.0\")\n def setSrcCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`srcCol`.\n \"\"\"\n return self._set(srcCol=value)\n\n @since(\"2.4.0\")\n def setDstCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`dstCol`.\n \"\"\"\n return self._set(dstCol=value)\n\n @since(\"2.4.0\")\n def setMaxIter(self, value):\n \"\"\"\n Sets the value of :py:attr:`maxIter`.\n \"\"\"\n return self._set(maxIter=value)\n\n @since(\"2.4.0\")\n def setWeightCol(self, value):\n \"\"\"\n Sets the value of :py:attr:`weightCol`.\n \"\"\"\n return self._set(weightCol=value)\n\n @since(\"2.4.0\")\n def assignClusters(self, dataset):\n \"\"\"\n Run the PIC algorithm and returns a cluster assignment for each input vertex.\n\n :param dataset:\n A dataset with columns src, dst, weight representing the affinity matrix,\n which is the matrix A in the PIC paper. Suppose the src column value is i,\n the dst column value is j, the weight column value is similarity s,,ij,,\n which must be nonnegative. This is a symmetric matrix and hence\n s,,ij,, = s,,ji,,. For any (i, j) with nonzero similarity, there should be\n either (i, j, s,,ij,,) or (j, i, s,,ji,,) in the input. Rows with i = j are\n ignored, because we assume s,,ij,, = 0.0.\n\n :return:\n A dataset that contains columns of vertex id and the corresponding cluster for\n the id. The schema of it will be:\n - id: Long\n - cluster: Int\n\n .. versionadded:: 2.4.0\n \"\"\"\n self._transfer_params_to_java()\n jdf = self._java_obj.assignClusters(dataset._jdf)\n return DataFrame(jdf, dataset.sql_ctx)\n\n\nif __name__ == \"__main__\":\n import doctest\n import numpy\n import pyspark.ml.clustering\n from pyspark.sql import SparkSession\n try:\n # Numpy 1.14+ changed it's string format.\n numpy.set_printoptions(legacy='1.13')\n except TypeError:\n pass\n globs = pyspark.ml.clustering.__dict__.copy()\n # The small batch size here ensures that we see multiple batches,\n # even in these small test examples:\n spark = SparkSession.builder\\\n .master(\"local[2]\")\\\n .appName(\"ml.clustering tests\")\\\n .getOrCreate()\n sc = spark.sparkContext\n globs['sc'] = sc\n globs['spark'] = spark\n import tempfile\n temp_path = tempfile.mkdtemp()\n globs['temp_path'] = temp_path\n try:\n (failure_count, test_count) = doctest.testmod(globs=globs, optionflags=doctest.ELLIPSIS)\n spark.stop()\n finally:\n from shutil import rmtree\n try:\n rmtree(temp_path)\n except OSError:\n pass\n if failure_count:\n sys.exit(-1)\n", "#\n# Licensed to the Apache Software Foundation (ASF) under one or more\n# contributor license agreements. See the NOTICE file distributed with\n# this work for additional information regarding copyright ownership.\n# The ASF licenses this file to You under the Apache License, Version 2.0\n# (the \"License\"); you may not use this file except in compliance with\n# the License. You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n#\n\nfrom __future__ import print_function\nimport sys\nimport warnings\nfrom functools import reduce\nfrom threading import RLock\n\nif sys.version >= '3':\n basestring = unicode = str\n xrange = range\nelse:\n from itertools import izip as zip, imap as map\n\nfrom pyspark import since\nfrom pyspark.rdd import RDD, ignore_unicode_prefix\nfrom pyspark.sql.conf import RuntimeConfig\nfrom pyspark.sql.dataframe import DataFrame\nfrom pyspark.sql.readwriter import DataFrameReader\nfrom pyspark.sql.streaming import DataStreamReader\nfrom pyspark.sql.types import Row, DataType, StringType, StructType, TimestampType, \\\n _make_type_verifier, _infer_schema, _has_nulltype, _merge_type, _create_converter, \\\n _parse_datatype_string\nfrom pyspark.sql.utils import install_exception_handler\n\n__all__ = [\"SparkSession\"]\n\n\ndef _monkey_patch_RDD(sparkSession):\n def toDF(self, schema=None, sampleRatio=None):\n \"\"\"\n Converts current :class:`RDD` into a :class:`DataFrame`\n\n This is a shorthand for ``spark.createDataFrame(rdd, schema, sampleRatio)``\n\n :param schema: a :class:`pyspark.sql.types.StructType` or list of names of columns\n :param samplingRatio: the sample ratio of rows used for inferring\n :return: a DataFrame\n\n >>> rdd.toDF().collect()\n [Row(name=u'Alice', age=1)]\n \"\"\"\n return sparkSession.createDataFrame(self, schema, sampleRatio)\n\n RDD.toDF = toDF\n\n\nclass SparkSession(object):\n \"\"\"The entry point to programming Spark with the Dataset and DataFrame API.\n\n A SparkSession can be used create :class:`DataFrame`, register :class:`DataFrame` as\n tables, execute SQL over tables, cache tables, and read parquet files.\n To create a SparkSession, use the following builder pattern:\n\n >>> spark = SparkSession.builder \\\\\n ... .master(\"local\") \\\\\n ... .appName(\"Word Count\") \\\\\n ... .config(\"spark.some.config.option\", \"some-value\") \\\\\n ... .getOrCreate()\n\n .. autoattribute:: builder\n :annotation:\n \"\"\"\n\n class Builder(object):\n \"\"\"Builder for :class:`SparkSession`.\n \"\"\"\n\n _lock = RLock()\n _options = {}\n _sc = None\n\n @since(2.0)\n def config(self, key=None, value=None, conf=None):\n \"\"\"Sets a config option. Options set using this method are automatically propagated to\n both :class:`SparkConf` and :class:`SparkSession`'s own configuration.\n\n For an existing SparkConf, use `conf` parameter.\n\n >>> from pyspark.conf import SparkConf\n >>> SparkSession.builder.config(conf=SparkConf())\n <pyspark.sql.session...\n\n For a (key, value) pair, you can omit parameter names.\n\n >>> SparkSession.builder.config(\"spark.some.config.option\", \"some-value\")\n <pyspark.sql.session...\n\n :param key: a key name string for configuration property\n :param value: a value for configuration property\n :param conf: an instance of :class:`SparkConf`\n \"\"\"\n with self._lock:\n if conf is None:\n self._options[key] = str(value)\n else:\n for (k, v) in conf.getAll():\n self._options[k] = v\n return self\n\n @since(2.0)\n def master(self, master):\n \"\"\"Sets the Spark master URL to connect to, such as \"local\" to run locally, \"local[4]\"\n to run locally with 4 cores, or \"spark://master:7077\" to run on a Spark standalone\n cluster.\n\n :param master: a url for spark master\n \"\"\"\n return self.config(\"spark.master\", master)\n\n @since(2.0)\n def appName(self, name):\n \"\"\"Sets a name for the application, which will be shown in the Spark web UI.\n\n If no application name is set, a randomly generated name will be used.\n\n :param name: an application name\n \"\"\"\n return self.config(\"spark.app.name\", name)\n\n @since(2.0)\n def enableHiveSupport(self):\n \"\"\"Enables Hive support, including connectivity to a persistent Hive metastore, support\n for Hive SerDes, and Hive user-defined functions.\n \"\"\"\n return self.config(\"spark.sql.catalogImplementation\", \"hive\")\n\n def _sparkContext(self, sc):\n with self._lock:\n self._sc = sc\n return self\n\n @since(2.0)\n def getOrCreate(self):\n \"\"\"Gets an existing :class:`SparkSession` or, if there is no existing one, creates a\n new one based on the options set in this builder.\n\n This method first checks whether there is a valid global default SparkSession, and if\n yes, return that one. If no valid global default SparkSession exists, the method\n creates a new SparkSession and assigns the newly created SparkSession as the global\n default.\n\n >>> s1 = SparkSession.builder.config(\"k1\", \"v1\").getOrCreate()\n >>> s1.conf.get(\"k1\") == \"v1\"\n True\n\n In case an existing SparkSession is returned, the config options specified\n in this builder will be applied to the existing SparkSession.\n\n >>> s2 = SparkSession.builder.config(\"k2\", \"v2\").getOrCreate()\n >>> s1.conf.get(\"k1\") == s2.conf.get(\"k1\")\n True\n >>> s1.conf.get(\"k2\") == s2.conf.get(\"k2\")\n True\n \"\"\"\n with self._lock:\n from pyspark.context import SparkContext\n from pyspark.conf import SparkConf\n session = SparkSession._instantiatedSession\n if session is None or session._sc._jsc is None:\n if self._sc is not None:\n sc = self._sc\n else:\n sparkConf = SparkConf()\n for key, value in self._options.items():\n sparkConf.set(key, value)\n # This SparkContext may be an existing one.\n sc = SparkContext.getOrCreate(sparkConf)\n # Do not update `SparkConf` for existing `SparkContext`, as it's shared\n # by all sessions.\n session = SparkSession(sc)\n for key, value in self._options.items():\n session._jsparkSession.sessionState().conf().setConfString(key, value)\n return session\n\n builder = Builder()\n \"\"\"A class attribute having a :class:`Builder` to construct :class:`SparkSession` instances.\"\"\"\n\n _instantiatedSession = None\n _activeSession = None\n\n @ignore_unicode_prefix\n def __init__(self, sparkContext, jsparkSession=None):\n \"\"\"Creates a new SparkSession.\n\n >>> from datetime import datetime\n >>> spark = SparkSession(sc)\n >>> allTypes = sc.parallelize([Row(i=1, s=\"string\", d=1.0, l=1,\n ... b=True, list=[1, 2, 3], dict={\"s\": 0}, row=Row(a=1),\n ... time=datetime(2014, 8, 1, 14, 1, 5))])\n >>> df = allTypes.toDF()\n >>> df.createOrReplaceTempView(\"allTypes\")\n >>> spark.sql('select i+1, d+1, not b, list[1], dict[\"s\"], time, row.a '\n ... 'from allTypes where b and i > 0').collect()\n [Row((i + CAST(1 AS BIGINT))=2, (d + CAST(1 AS DOUBLE))=2.0, (NOT b)=False, list[1]=2, \\\n dict[s]=0, time=datetime.datetime(2014, 8, 1, 14, 1, 5), a=1)]\n >>> df.rdd.map(lambda x: (x.i, x.s, x.d, x.l, x.b, x.time, x.row.a, x.list)).collect()\n [(1, u'string', 1.0, 1, True, datetime.datetime(2014, 8, 1, 14, 1, 5), 1, [1, 2, 3])]\n \"\"\"\n from pyspark.sql.context import SQLContext\n self._sc = sparkContext\n self._jsc = self._sc._jsc\n self._jvm = self._sc._jvm\n if jsparkSession is None:\n if self._jvm.SparkSession.getDefaultSession().isDefined() \\\n and not self._jvm.SparkSession.getDefaultSession().get() \\\n .sparkContext().isStopped():\n jsparkSession = self._jvm.SparkSession.getDefaultSession().get()\n else:\n jsparkSession = self._jvm.SparkSession(self._jsc.sc())\n self._jsparkSession = jsparkSession\n self._jwrapped = self._jsparkSession.sqlContext()\n self._wrapped = SQLContext(self._sc, self, self._jwrapped)\n _monkey_patch_RDD(self)\n install_exception_handler()\n # If we had an instantiated SparkSession attached with a SparkContext\n # which is stopped now, we need to renew the instantiated SparkSession.\n # Otherwise, we will use invalid SparkSession when we call Builder.getOrCreate.\n if SparkSession._instantiatedSession is None \\\n or SparkSession._instantiatedSession._sc._jsc is None:\n SparkSession._instantiatedSession = self\n SparkSession._activeSession = self\n self._jvm.SparkSession.setDefaultSession(self._jsparkSession)\n self._jvm.SparkSession.setActiveSession(self._jsparkSession)\n\n def _repr_html_(self):\n return \"\"\"\n <div>\n <p><b>SparkSession - {catalogImplementation}</b></p>\n {sc_HTML}\n </div>\n \"\"\".format(\n catalogImplementation=self.conf.get(\"spark.sql.catalogImplementation\"),\n sc_HTML=self.sparkContext._repr_html_()\n )\n\n @since(2.0)\n def newSession(self):\n \"\"\"\n Returns a new SparkSession as new session, that has separate SQLConf,\n registered temporary views and UDFs, but shared SparkContext and\n table cache.\n \"\"\"\n return self.__class__(self._sc, self._jsparkSession.newSession())\n\n @classmethod\n @since(3.0)\n def getActiveSession(cls):\n \"\"\"\n Returns the active SparkSession for the current thread, returned by the builder.\n >>> s = SparkSession.getActiveSession()\n >>> l = [('Alice', 1)]\n >>> rdd = s.sparkContext.parallelize(l)\n >>> df = s.createDataFrame(rdd, ['name', 'age'])\n >>> df.select(\"age\").collect()\n [Row(age=1)]\n \"\"\"\n from pyspark import SparkContext\n sc = SparkContext._active_spark_context\n if sc is None:\n return None\n else:\n if sc._jvm.SparkSession.getActiveSession().isDefined():\n SparkSession(sc, sc._jvm.SparkSession.getActiveSession().get())\n return SparkSession._activeSession\n else:\n return None\n\n @property\n @since(2.0)\n def sparkContext(self):\n \"\"\"Returns the underlying :class:`SparkContext`.\"\"\"\n return self._sc\n\n @property\n @since(2.0)\n def version(self):\n \"\"\"The version of Spark on which this application is running.\"\"\"\n return self._jsparkSession.version()\n\n @property\n @since(2.0)\n def conf(self):\n \"\"\"Runtime configuration interface for Spark.\n\n This is the interface through which the user can get and set all Spark and Hadoop\n configurations that are relevant to Spark SQL. When getting the value of a config,\n this defaults to the value set in the underlying :class:`SparkContext`, if any.\n \"\"\"\n if not hasattr(self, \"_conf\"):\n self._conf = RuntimeConfig(self._jsparkSession.conf())\n return self._conf\n\n @property\n @since(2.0)\n def catalog(self):\n \"\"\"Interface through which the user may create, drop, alter or query underlying\n databases, tables, functions, etc.\n\n :return: :class:`Catalog`\n \"\"\"\n from pyspark.sql.catalog import Catalog\n if not hasattr(self, \"_catalog\"):\n self._catalog = Catalog(self)\n return self._catalog\n\n @property\n @since(2.0)\n def udf(self):\n \"\"\"Returns a :class:`UDFRegistration` for UDF registration.\n\n :return: :class:`UDFRegistration`\n \"\"\"\n from pyspark.sql.udf import UDFRegistration\n return UDFRegistration(self)\n\n @since(2.0)\n def range(self, start, end=None, step=1, numPartitions=None):\n \"\"\"\n Create a :class:`DataFrame` with single :class:`pyspark.sql.types.LongType` column named\n ``id``, containing elements in a range from ``start`` to ``end`` (exclusive) with\n step value ``step``.\n\n :param start: the start value\n :param end: the end value (exclusive)\n :param step: the incremental step (default: 1)\n :param numPartitions: the number of partitions of the DataFrame\n :return: :class:`DataFrame`\n\n >>> spark.range(1, 7, 2).collect()\n [Row(id=1), Row(id=3), Row(id=5)]\n\n If only one argument is specified, it will be used as the end value.\n\n >>> spark.range(3).collect()\n [Row(id=0), Row(id=1), Row(id=2)]\n \"\"\"\n if numPartitions is None:\n numPartitions = self._sc.defaultParallelism\n\n if end is None:\n jdf = self._jsparkSession.range(0, int(start), int(step), int(numPartitions))\n else:\n jdf = self._jsparkSession.range(int(start), int(end), int(step), int(numPartitions))\n\n return DataFrame(jdf, self._wrapped)\n\n def _inferSchemaFromList(self, data, names=None):\n \"\"\"\n Infer schema from list of Row or tuple.\n\n :param data: list of Row or tuple\n :param names: list of column names\n :return: :class:`pyspark.sql.types.StructType`\n \"\"\"\n if not data:\n raise ValueError(\"can not infer schema from empty dataset\")\n first = data[0]\n if type(first) is dict:\n warnings.warn(\"inferring schema from dict is deprecated,\"\n \"please use pyspark.sql.Row instead\")\n schema = reduce(_merge_type, (_infer_schema(row, names) for row in data))\n if _has_nulltype(schema):\n raise ValueError(\"Some of types cannot be determined after inferring\")\n return schema\n\n def _inferSchema(self, rdd, samplingRatio=None, names=None):\n \"\"\"\n Infer schema from an RDD of Row or tuple.\n\n :param rdd: an RDD of Row or tuple\n :param samplingRatio: sampling ratio, or no sampling (default)\n :return: :class:`pyspark.sql.types.StructType`\n \"\"\"\n first = rdd.first()\n if not first:\n raise ValueError(\"The first row in RDD is empty, \"\n \"can not infer schema\")\n if type(first) is dict:\n warnings.warn(\"Using RDD of dict to inferSchema is deprecated. \"\n \"Use pyspark.sql.Row instead\")\n\n if samplingRatio is None:\n schema = _infer_schema(first, names=names)\n if _has_nulltype(schema):\n for row in rdd.take(100)[1:]:\n schema = _merge_type(schema, _infer_schema(row, names=names))\n if not _has_nulltype(schema):\n break\n else:\n raise ValueError(\"Some of types cannot be determined by the \"\n \"first 100 rows, please try again with sampling\")\n else:\n if samplingRatio < 0.99:\n rdd = rdd.sample(False, float(samplingRatio))\n schema = rdd.map(lambda row: _infer_schema(row, names)).reduce(_merge_type)\n return schema\n\n def _createFromRDD(self, rdd, schema, samplingRatio):\n \"\"\"\n Create an RDD for DataFrame from an existing RDD, returns the RDD and schema.\n \"\"\"\n if schema is None or isinstance(schema, (list, tuple)):\n struct = self._inferSchema(rdd, samplingRatio, names=schema)\n converter = _create_converter(struct)\n rdd = rdd.map(converter)\n if isinstance(schema, (list, tuple)):\n for i, name in enumerate(schema):\n struct.fields[i].name = name\n struct.names[i] = name\n schema = struct\n\n elif not isinstance(schema, StructType):\n raise TypeError(\"schema should be StructType or list or None, but got: %s\" % schema)\n\n # convert python objects to sql data\n rdd = rdd.map(schema.toInternal)\n return rdd, schema\n\n def _createFromLocal(self, data, schema):\n \"\"\"\n Create an RDD for DataFrame from a list or pandas.DataFrame, returns\n the RDD and schema.\n \"\"\"\n # make sure data could consumed multiple times\n if not isinstance(data, list):\n data = list(data)\n\n if schema is None or isinstance(schema, (list, tuple)):\n struct = self._inferSchemaFromList(data, names=schema)\n converter = _create_converter(struct)\n data = map(converter, data)\n if isinstance(schema, (list, tuple)):\n for i, name in enumerate(schema):\n struct.fields[i].name = name\n struct.names[i] = name\n schema = struct\n\n elif not isinstance(schema, StructType):\n raise TypeError(\"schema should be StructType or list or None, but got: %s\" % schema)\n\n # convert python objects to sql data\n data = [schema.toInternal(row) for row in data]\n return self._sc.parallelize(data), schema\n\n def _get_numpy_record_dtype(self, rec):\n \"\"\"\n Used when converting a pandas.DataFrame to Spark using to_records(), this will correct\n the dtypes of fields in a record so they can be properly loaded into Spark.\n :param rec: a numpy record to check field dtypes\n :return corrected dtype for a numpy.record or None if no correction needed\n \"\"\"\n import numpy as np\n cur_dtypes = rec.dtype\n col_names = cur_dtypes.names\n record_type_list = []\n has_rec_fix = False\n for i in xrange(len(cur_dtypes)):\n curr_type = cur_dtypes[i]\n # If type is a datetime64 timestamp, convert to microseconds\n # NOTE: if dtype is datetime[ns] then np.record.tolist() will output values as longs,\n # conversion from [us] or lower will lead to py datetime objects, see SPARK-22417\n if curr_type == np.dtype('datetime64[ns]'):\n curr_type = 'datetime64[us]'\n has_rec_fix = True\n record_type_list.append((str(col_names[i]), curr_type))\n return np.dtype(record_type_list) if has_rec_fix else None\n\n def _convert_from_pandas(self, pdf, schema, timezone):\n \"\"\"\n Convert a pandas.DataFrame to list of records that can be used to make a DataFrame\n :return list of records\n \"\"\"\n if timezone is not None:\n from pyspark.sql.types import _check_series_convert_timestamps_tz_local\n copied = False\n if isinstance(schema, StructType):\n for field in schema:\n # TODO: handle nested timestamps, such as ArrayType(TimestampType())?\n if isinstance(field.dataType, TimestampType):\n s = _check_series_convert_timestamps_tz_local(pdf[field.name], timezone)\n if s is not pdf[field.name]:\n if not copied:\n # Copy once if the series is modified to prevent the original\n # Pandas DataFrame from being updated\n pdf = pdf.copy()\n copied = True\n pdf[field.name] = s\n else:\n for column, series in pdf.iteritems():\n s = _check_series_convert_timestamps_tz_local(series, timezone)\n if s is not series:\n if not copied:\n # Copy once if the series is modified to prevent the original\n # Pandas DataFrame from being updated\n pdf = pdf.copy()\n copied = True\n pdf[column] = s\n\n # Convert pandas.DataFrame to list of numpy records\n np_records = pdf.to_records(index=False)\n\n # Check if any columns need to be fixed for Spark to infer properly\n if len(np_records) > 0:\n record_dtype = self._get_numpy_record_dtype(np_records[0])\n if record_dtype is not None:\n return [r.astype(record_dtype).tolist() for r in np_records]\n\n # Convert list of numpy records to python lists\n return [r.tolist() for r in np_records]\n\n def _create_from_pandas_with_arrow(self, pdf, schema, timezone):\n \"\"\"\n Create a DataFrame from a given pandas.DataFrame by slicing it into partitions, converting\n to Arrow data, then sending to the JVM to parallelize. If a schema is passed in, the\n data types will be used to coerce the data in Pandas to Arrow conversion.\n \"\"\"\n from pyspark.serializers import ArrowStreamPandasSerializer\n from pyspark.sql.types import from_arrow_type, to_arrow_type, TimestampType\n from pyspark.sql.utils import require_minimum_pandas_version, \\\n require_minimum_pyarrow_version\n\n require_minimum_pandas_version()\n require_minimum_pyarrow_version()\n\n from pandas.api.types import is_datetime64_dtype, is_datetime64tz_dtype\n import pyarrow as pa\n\n # Create the Spark schema from list of names passed in with Arrow types\n if isinstance(schema, (list, tuple)):\n arrow_schema = pa.Schema.from_pandas(pdf, preserve_index=False)\n struct = StructType()\n for name, field in zip(schema, arrow_schema):\n struct.add(name, from_arrow_type(field.type), nullable=field.nullable)\n schema = struct\n\n # Determine arrow types to coerce data when creating batches\n if isinstance(schema, StructType):\n arrow_types = [to_arrow_type(f.dataType) for f in schema.fields]\n elif isinstance(schema, DataType):\n raise ValueError(\"Single data type %s is not supported with Arrow\" % str(schema))\n else:\n # Any timestamps must be coerced to be compatible with Spark\n arrow_types = [to_arrow_type(TimestampType())\n if is_datetime64_dtype(t) or is_datetime64tz_dtype(t) else None\n for t in pdf.dtypes]\n\n # Slice the DataFrame to be batched\n step = -(-len(pdf) // self.sparkContext.defaultParallelism) # round int up\n pdf_slices = (pdf[start:start + step] for start in xrange(0, len(pdf), step))\n\n # Create list of Arrow (columns, type) for serializer dump_stream\n arrow_data = [[(c, t) for (_, c), t in zip(pdf_slice.iteritems(), arrow_types)]\n for pdf_slice in pdf_slices]\n\n jsqlContext = self._wrapped._jsqlContext\n\n safecheck = self._wrapped._conf.arrowSafeTypeConversion()\n col_by_name = True # col by name only applies to StructType columns, can't happen here\n ser = ArrowStreamPandasSerializer(timezone, safecheck, col_by_name)\n\n def reader_func(temp_filename):\n return self._jvm.PythonSQLUtils.readArrowStreamFromFile(jsqlContext, temp_filename)\n\n def create_RDD_server():\n return self._jvm.ArrowRDDServer(jsqlContext)\n\n # Create Spark DataFrame from Arrow stream file, using one batch per partition\n jrdd = self._sc._serialize_to_jvm(arrow_data, ser, reader_func, create_RDD_server)\n jdf = self._jvm.PythonSQLUtils.toDataFrame(jrdd, schema.json(), jsqlContext)\n df = DataFrame(jdf, self._wrapped)\n df._schema = schema\n return df\n\n @staticmethod\n def _create_shell_session():\n \"\"\"\n Initialize a SparkSession for a pyspark shell session. This is called from shell.py\n to make error handling simpler without needing to declare local variables in that\n script, which would expose those to users.\n \"\"\"\n import py4j\n from pyspark.conf import SparkConf\n from pyspark.context import SparkContext\n try:\n # Try to access HiveConf, it will raise exception if Hive is not added\n conf = SparkConf()\n if conf.get('spark.sql.catalogImplementation', 'hive').lower() == 'hive':\n SparkContext._jvm.org.apache.hadoop.hive.conf.HiveConf()\n return SparkSession.builder\\\n .enableHiveSupport()\\\n .getOrCreate()\n else:\n return SparkSession.builder.getOrCreate()\n except (py4j.protocol.Py4JError, TypeError):\n if conf.get('spark.sql.catalogImplementation', '').lower() == 'hive':\n warnings.warn(\"Fall back to non-hive support because failing to access HiveConf, \"\n \"please make sure you build spark with hive\")\n\n return SparkSession.builder.getOrCreate()\n\n @since(2.0)\n @ignore_unicode_prefix\n def createDataFrame(self, data, schema=None, samplingRatio=None, verifySchema=True):\n \"\"\"\n Creates a :class:`DataFrame` from an :class:`RDD`, a list or a :class:`pandas.DataFrame`.\n\n When ``schema`` is a list of column names, the type of each column\n will be inferred from ``data``.\n\n When ``schema`` is ``None``, it will try to infer the schema (column names and types)\n from ``data``, which should be an RDD of either :class:`Row`,\n :class:`namedtuple`, or :class:`dict`.\n\n When ``schema`` is :class:`pyspark.sql.types.DataType` or a datatype string, it must match\n the real data, or an exception will be thrown at runtime. If the given schema is not\n :class:`pyspark.sql.types.StructType`, it will be wrapped into a\n :class:`pyspark.sql.types.StructType` as its only field, and the field name will be \"value\".\n Each record will also be wrapped into a tuple, which can be converted to row later.\n\n If schema inference is needed, ``samplingRatio`` is used to determined the ratio of\n rows used for schema inference. The first row will be used if ``samplingRatio`` is ``None``.\n\n :param data: an RDD of any kind of SQL data representation (e.g. row, tuple, int, boolean,\n etc.), :class:`list`, or :class:`pandas.DataFrame`.\n :param schema: a :class:`pyspark.sql.types.DataType` or a datatype string or a list of\n column names, default is ``None``. The data type string format equals to\n :class:`pyspark.sql.types.DataType.simpleString`, except that top level struct type can\n omit the ``struct<>`` and atomic types use ``typeName()`` as their format, e.g. use\n ``byte`` instead of ``tinyint`` for :class:`pyspark.sql.types.ByteType`. We can also use\n ``int`` as a short name for ``IntegerType``.\n :param samplingRatio: the sample ratio of rows used for inferring\n :param verifySchema: verify data types of every row against schema.\n :return: :class:`DataFrame`\n\n .. versionchanged:: 2.1\n Added verifySchema.\n\n .. note:: Usage with spark.sql.execution.arrow.pyspark.enabled=True is experimental.\n\n .. note:: When Arrow optimization is enabled, strings inside Pandas DataFrame in Python\n 2 are converted into bytes as they are bytes in Python 2 whereas regular strings are\n left as strings. When using strings in Python 2, use unicode `u\"\"` as Python standard\n practice.\n\n >>> l = [('Alice', 1)]\n >>> spark.createDataFrame(l).collect()\n [Row(_1=u'Alice', _2=1)]\n >>> spark.createDataFrame(l, ['name', 'age']).collect()\n [Row(name=u'Alice', age=1)]\n\n >>> d = [{'name': 'Alice', 'age': 1}]\n >>> spark.createDataFrame(d).collect()\n [Row(age=1, name=u'Alice')]\n\n >>> rdd = sc.parallelize(l)\n >>> spark.createDataFrame(rdd).collect()\n [Row(_1=u'Alice', _2=1)]\n >>> df = spark.createDataFrame(rdd, ['name', 'age'])\n >>> df.collect()\n [Row(name=u'Alice', age=1)]\n\n >>> from pyspark.sql import Row\n >>> Person = Row('name', 'age')\n >>> person = rdd.map(lambda r: Person(*r))\n >>> df2 = spark.createDataFrame(person)\n >>> df2.collect()\n [Row(name=u'Alice', age=1)]\n\n >>> from pyspark.sql.types import *\n >>> schema = StructType([\n ... StructField(\"name\", StringType(), True),\n ... StructField(\"age\", IntegerType(), True)])\n >>> df3 = spark.createDataFrame(rdd, schema)\n >>> df3.collect()\n [Row(name=u'Alice', age=1)]\n\n >>> spark.createDataFrame(df.toPandas()).collect() # doctest: +SKIP\n [Row(name=u'Alice', age=1)]\n >>> spark.createDataFrame(pandas.DataFrame([[1, 2]])).collect() # doctest: +SKIP\n [Row(0=1, 1=2)]\n\n >>> spark.createDataFrame(rdd, \"a: string, b: int\").collect()\n [Row(a=u'Alice', b=1)]\n >>> rdd = rdd.map(lambda row: row[1])\n >>> spark.createDataFrame(rdd, \"int\").collect()\n [Row(value=1)]\n >>> spark.createDataFrame(rdd, \"boolean\").collect() # doctest: +IGNORE_EXCEPTION_DETAIL\n Traceback (most recent call last):\n ...\n Py4JJavaError: ...\n \"\"\"\n SparkSession._activeSession = self\n self._jvm.SparkSession.setActiveSession(self._jsparkSession)\n if isinstance(data, DataFrame):\n raise TypeError(\"data is already a DataFrame\")\n\n if isinstance(schema, basestring):\n schema = _parse_datatype_string(schema)\n elif isinstance(schema, (list, tuple)):\n # Must re-encode any unicode strings to be consistent with StructField names\n schema = [x.encode('utf-8') if not isinstance(x, str) else x for x in schema]\n\n try:\n import pandas\n has_pandas = True\n except Exception:\n has_pandas = False\n if has_pandas and isinstance(data, pandas.DataFrame):\n from pyspark.sql.utils import require_minimum_pandas_version\n require_minimum_pandas_version()\n\n if self._wrapped._conf.pandasRespectSessionTimeZone():\n timezone = self._wrapped._conf.sessionLocalTimeZone()\n else:\n timezone = None\n\n # If no schema supplied by user then get the names of columns only\n if schema is None:\n schema = [str(x) if not isinstance(x, basestring) else\n (x.encode('utf-8') if not isinstance(x, str) else x)\n for x in data.columns]\n\n if self._wrapped._conf.arrowPySparkEnabled() and len(data) > 0:\n try:\n return self._create_from_pandas_with_arrow(data, schema, timezone)\n except Exception as e:\n from pyspark.util import _exception_message\n\n if self._wrapped._conf.arrowPySparkFallbackEnabled():\n msg = (\n \"createDataFrame attempted Arrow optimization because \"\n \"'spark.sql.execution.arrow.pyspark.enabled' is set to true; however, \"\n \"failed by the reason below:\\n %s\\n\"\n \"Attempting non-optimization as \"\n \"'spark.sql.execution.arrow.pyspark.fallback.enabled' is set to \"\n \"true.\" % _exception_message(e))\n warnings.warn(msg)\n else:\n msg = (\n \"createDataFrame attempted Arrow optimization because \"\n \"'spark.sql.execution.arrow.pyspark.enabled' is set to true, but has \"\n \"reached the error below and will not continue because automatic \"\n \"fallback with 'spark.sql.execution.arrow.pyspark.fallback.enabled' \"\n \"has been set to false.\\n %s\" % _exception_message(e))\n warnings.warn(msg)\n raise\n data = self._convert_from_pandas(data, schema, timezone)\n\n if isinstance(schema, StructType):\n verify_func = _make_type_verifier(schema) if verifySchema else lambda _: True\n\n def prepare(obj):\n verify_func(obj)\n return obj\n elif isinstance(schema, DataType):\n dataType = schema\n schema = StructType().add(\"value\", schema)\n\n verify_func = _make_type_verifier(\n dataType, name=\"field value\") if verifySchema else lambda _: True\n\n def prepare(obj):\n verify_func(obj)\n return obj,\n else:\n prepare = lambda obj: obj\n\n if isinstance(data, RDD):\n rdd, schema = self._createFromRDD(data.map(prepare), schema, samplingRatio)\n else:\n rdd, schema = self._createFromLocal(map(prepare, data), schema)\n jrdd = self._jvm.SerDeUtil.toJavaArray(rdd._to_java_object_rdd())\n jdf = self._jsparkSession.applySchemaToPythonRDD(jrdd.rdd(), schema.json())\n df = DataFrame(jdf, self._wrapped)\n df._schema = schema\n return df\n\n @ignore_unicode_prefix\n @since(2.0)\n def sql(self, sqlQuery):\n \"\"\"Returns a :class:`DataFrame` representing the result of the given query.\n\n :return: :class:`DataFrame`\n\n >>> df.createOrReplaceTempView(\"table1\")\n >>> df2 = spark.sql(\"SELECT field1 AS f1, field2 as f2 from table1\")\n >>> df2.collect()\n [Row(f1=1, f2=u'row1'), Row(f1=2, f2=u'row2'), Row(f1=3, f2=u'row3')]\n \"\"\"\n return DataFrame(self._jsparkSession.sql(sqlQuery), self._wrapped)\n\n @since(2.0)\n def table(self, tableName):\n \"\"\"Returns the specified table as a :class:`DataFrame`.\n\n :return: :class:`DataFrame`\n\n >>> df.createOrReplaceTempView(\"table1\")\n >>> df2 = spark.table(\"table1\")\n >>> sorted(df.collect()) == sorted(df2.collect())\n True\n \"\"\"\n return DataFrame(self._jsparkSession.table(tableName), self._wrapped)\n\n @property\n @since(2.0)\n def read(self):\n \"\"\"\n Returns a :class:`DataFrameReader` that can be used to read data\n in as a :class:`DataFrame`.\n\n :return: :class:`DataFrameReader`\n \"\"\"\n return DataFrameReader(self._wrapped)\n\n @property\n @since(2.0)\n def readStream(self):\n \"\"\"\n Returns a :class:`DataStreamReader` that can be used to read data streams\n as a streaming :class:`DataFrame`.\n\n .. note:: Evolving.\n\n :return: :class:`DataStreamReader`\n \"\"\"\n return DataStreamReader(self._wrapped)\n\n @property\n @since(2.0)\n def streams(self):\n \"\"\"Returns a :class:`StreamingQueryManager` that allows managing all the\n :class:`StreamingQuery` instances active on `this` context.\n\n .. note:: Evolving.\n\n :return: :class:`StreamingQueryManager`\n \"\"\"\n from pyspark.sql.streaming import StreamingQueryManager\n return StreamingQueryManager(self._jsparkSession.streams())\n\n @since(2.0)\n def stop(self):\n \"\"\"Stop the underlying :class:`SparkContext`.\n \"\"\"\n self._sc.stop()\n # We should clean the default session up. See SPARK-23228.\n self._jvm.SparkSession.clearDefaultSession()\n self._jvm.SparkSession.clearActiveSession()\n SparkSession._instantiatedSession = None\n SparkSession._activeSession = None\n\n @since(2.0)\n def __enter__(self):\n \"\"\"\n Enable 'with SparkSession.builder.(...).getOrCreate() as session: app' syntax.\n \"\"\"\n return self\n\n @since(2.0)\n def __exit__(self, exc_type, exc_val, exc_tb):\n \"\"\"\n Enable 'with SparkSession.builder.(...).getOrCreate() as session: app' syntax.\n\n Specifically stop the SparkSession on exit of the with block.\n \"\"\"\n self.stop()\n\n\ndef _test():\n import os\n import doctest\n from pyspark.context import SparkContext\n from pyspark.sql import Row\n import pyspark.sql.session\n\n os.chdir(os.environ[\"SPARK_HOME\"])\n\n globs = pyspark.sql.session.__dict__.copy()\n sc = SparkContext('local[4]', 'PythonTest')\n globs['sc'] = sc\n globs['spark'] = SparkSession(sc)\n globs['rdd'] = rdd = sc.parallelize(\n [Row(field1=1, field2=\"row1\"),\n Row(field1=2, field2=\"row2\"),\n Row(field1=3, field2=\"row3\")])\n globs['df'] = rdd.toDF()\n (failure_count, test_count) = doctest.testmod(\n pyspark.sql.session, globs=globs,\n optionflags=doctest.ELLIPSIS | doctest.NORMALIZE_WHITESPACE)\n globs['sc'].stop()\n if failure_count:\n sys.exit(-1)\n\nif __name__ == \"__main__\":\n _test()\n" ]
[ [ "numpy.set_printoptions" ], [ "pandas.api.types.is_datetime64tz_dtype", "pandas.api.types.is_datetime64_dtype", "numpy.dtype" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [ "0.23", "0.21", "2.0", "1.4", "1.3", "0.19", "1.1", "1.5", "0.24", "0.20", "1.0", "0.25", "1.2" ], "scipy": [], "tensorflow": [] } ]
atomicoo/EnhanceIMG
[ "8c009fbb6c5461ff6d7f30bdacec72232639c7f2", "8c009fbb6c5461ff6d7f30bdacec72232639c7f2" ]
[ "awegan/options/base_options.py", "edges/canny.py" ]
[ "import argparse\nimport os, sys\nfrom abc import ABC, abstractmethod\n\nimport torch\nimport models\nimport datasets\n\n\nclass BaseOptions(ABC):\n \"\"\"This class is an abstract base class (ABC) for options.\n To create a subclass, you need to implement the following five functions:\n -- <__init__>: initialize the class; first call BaseOptions.__init__(self, opt).\n -- <initialize>: initialize the option's arguments.\n -- <parse>: parse the option's arguments.\n \"\"\"\n def __init__(self):\n pass\n\n @abstractmethod\n def initialize(self, parser):\n pass\n\n @abstractmethod\n def parse(self):\n pass\n\n\nclass BasicOptions(BaseOptions):\n \"\"\"This class defines options used during both training and test time.\n\n It also implements several helper functions such as parsing, printing, and saving the options.\n It also gathers additional options defined in <modify_commandline_options> functions in both dataset class and model class.\n \"\"\"\n\n def __init__(self):\n \"\"\"Reset the class; indicates the class hasn't been initailized\"\"\"\n self.initialized = False\n\n def initialize(self, parser):\n \"\"\"Define the common options that are used in both training and test.\"\"\"\n # basic parameters\n parser.add_argument('--data_root', required=True, help='path to images (should have subfolders trainA, trainB, valA, valB, etc)')\n parser.add_argument('--name', type=str, default='experiment_name', help='name of the experiment. It decides where to store samples and models')\n parser.add_argument('--gpu_ids', type=str, default='0', help='gpu ids: e.g. 0 0,1,2, 0,2. use -1 for CPU')\n parser.add_argument('--checkpoints_dir', type=str, default='./checkpoints', help='models are saved here')\n # model parameters\n parser.add_argument('--model', type=str, default='cycle_gan', help='chooses which model to use. [cycle_gan | pix2pix | recyc_gan]')\n parser.add_argument('--input_nc', type=int, default=3, help='# of input image channels: 3 for RGB and 1 for grayscale')\n parser.add_argument('--output_nc', type=int, default=3, help='# of output image channels: 3 for RGB and 1 for grayscale')\n parser.add_argument('--ngf', type=int, default=64, help='# of gen filters in the last conv layer')\n parser.add_argument('--ndf', type=int, default=64, help='# of discrim filters in the first conv layer')\n parser.add_argument('--netD', type=str, default='basic', help='specify discriminator architecture [basic | n_layers | pixel]. The basic model is a 70x70 PatchGAN. n_layers allows you to specify the layers in the discriminator')\n parser.add_argument('--netG', type=str, default='resnet_9bs', help='specify generator architecture [resnet_9bs | resnet_6bs | unet_256 | unet_128]')\n parser.add_argument('--n_layers_D', type=int, default=3, help='only used if netD==n_layers')\n parser.add_argument('--norm', type=str, default='instance', help='instance normalization or batch normalization [instance | batch | none]')\n parser.add_argument('--init_type', type=str, default='normal', help='network initialization [normal | xavier | kaiming | orthogonal]')\n parser.add_argument('--init_gain', type=float, default=0.02, help='scaling factor for normal, xavier and orthogonal.')\n parser.add_argument('--no_dropout', action='store_true', help='no dropout for the generator')\n # vgg parameters for perceptrual loss\n parser.add_argument('--vgg', type=float, default=0, help='use perceptrual loss')\n parser.add_argument('--vgg_mean', action='store_true', help='substract mean in vgg loss')\n parser.add_argument('--vgg_choose', type=str, default='relu5_3', help='choose layer for vgg')\n parser.add_argument('--no_vgg_instance', action='store_true', help='vgg instance normalization')\n parser.add_argument('--vgg_maxpooling', action='store_true', help='normalize attention map')\n # dataset parameters\n parser.add_argument('--dataset_mode', type=str, default='unaligned', help='chooses how datasets are loaded. [unaligned | aligned | single | degraded]')\n parser.add_argument('--degraded_mode', type=str, default='colorization', help='chooses how datasets are loaded. [colorization | super_resolution | denoising | restoration]')\n parser.add_argument('--direction', type=str, default='AtoB', help='AtoB or BtoA')\n parser.add_argument('--serial_batches', action='store_true', help='if true, takes images in order to make batches, otherwise takes them randomly')\n parser.add_argument('--num_threads', default=0 if sys.platform.startswith('win') else 4, type=int, help='# threads for loading data')\n parser.add_argument('--batch_size', type=int, default=1, help='input batch size')\n parser.add_argument('--load_size', type=int, default=286, help='scale images to this size')\n parser.add_argument('--crop_size', type=int, default=256, help='then crop to this size')\n parser.add_argument('--max_dataset_size', type=int, default=float(\"inf\"), help='Maximum number of samples allowed per dataset. If the dataset directory contains more than max_dataset_size, only a subset is loaded.')\n parser.add_argument('--preprocess', type=str, default='resize_and_crop', help='scaling and cropping of images at load time [resize_and_crop | crop | scale_width | scale_width_and_crop | none]')\n parser.add_argument('--no_flip', action='store_true', help='if specified, do not flip the images for data augmentation')\n parser.add_argument('--display_winsize', type=int, default=256, help='display window size for both visdom and HTML')\n # additional parameters\n parser.add_argument('--epoch', type=str, default='latest', help='which epoch to load? set to latest to use latest cached model')\n parser.add_argument('--load_iter', type=int, default='0', help='which iteration to load? if load_iter > 0, the code will load models by iter_[load_iter]; otherwise, the code will load models by [epoch]')\n parser.add_argument('--verbose', action='store_true', help='if specified, print more debugging information')\n parser.add_argument('--suffix', default='', type=str, help='customized suffix: opt.name = opt.name + suffix: e.g., {model}_{netG}_size{load_size}')\n\n self.initialized = True\n return parser\n\n def gather_options(self):\n \"\"\"Initialize our parser with basic options(only once).\n \"\"\"\n if not self.initialized: # check if it has been initialized\n parser = argparse.ArgumentParser(formatter_class=argparse.ArgumentDefaultsHelpFormatter)\n parser = self.initialize(parser)\n\n # get the basic options\n opt, _ = parser.parse_known_args()\n\n # modify model-related parser options\n model_name = opt.model\n model_option_setter = models.get_option_setter(model_name)\n parser = model_option_setter(parser, self.is_train)\n opt, _ = parser.parse_known_args() # parse again with new defaults\n\n # modify dataset-related parser options\n dataset_name = opt.dataset_mode\n dataset_option_setter = datasets.get_option_setter(dataset_name)\n parser = dataset_option_setter(parser, self.is_train)\n opt, _ = parser.parse_known_args() # parse again with new defaults\n\n # save and return the parser\n self.parser = parser\n return parser.parse_args()\n\n def print_options(self, opt):\n \"\"\"Print and save options\n\n It will print both current options and default values(if different).\n It will save options into a text file / [checkpoints_dir] / opt.txt\n \"\"\"\n message = ''\n message += '----------------- Options ---------------\\n'\n for k, v in sorted(vars(opt).items()):\n comment = ''\n default = self.parser.get_default(k)\n if v != default:\n comment = '\\t[default: %s]' % str(default)\n message += '{:>25}: {:<30}{}\\n'.format(str(k), str(v), comment)\n message += '----------------- End -------------------'\n print(message)\n\n # save to the disk\n expr_dir = os.path.join(opt.checkpoints_dir, opt.name)\n os.makedirs(expr_dir, exist_ok=True)\n file_name = os.path.join(expr_dir, '{}_opt.txt'.format(opt.phase))\n with open(file_name, 'wt') as opt_file:\n opt_file.write(message)\n opt_file.write('\\n')\n\n def parse(self):\n \"\"\"Parse our options, create checkpoints directory suffix, and set up gpu device.\"\"\"\n opt = self.gather_options()\n opt.is_train = self.is_train # train or test\n\n # process opt.suffix\n if opt.suffix:\n suffix = ('_' + opt.suffix.format(**vars(opt))) if opt.suffix != '' else ''\n opt.name = opt.name + suffix\n\n self.print_options(opt)\n\n # set gpu ids\n str_ids = opt.gpu_ids.split(',')\n opt.gpu_ids = []\n for str_id in str_ids:\n id = int(str_id)\n if id >= 0:\n opt.gpu_ids.append(id)\n if len(opt.gpu_ids) > 0:\n torch.cuda.set_device(opt.gpu_ids[0])\n\n self.opt = opt\n return self.opt\n", "import cv2\ntry: \n from .derivatives import get_derivatives\n from .nms import non_max_suppression\n from .elink import edge_link\nexcept ImportError:\n from derivatives import get_derivatives\n from nms import non_max_suppression\n from elink import edge_link\n\n\ndef canny_edge(img, sigma=0.4, threshold=0):\n gray = cv2.cvtColor(img, cv2.COLOR_BGR2GRAY)\n mag, *_, ori = get_derivatives(gray, sigma=sigma)\n edge = non_max_suppression(mag, ori, threshold=threshold)\n linked_edge = edge_link(edge, mag, ori)\n return linked_edge, edge\n\nif __name__ == '__main__':\n import numpy as np\n img = cv2.imread(\"../Madison.png\")\n linked_edge, edge = canny_edge(img, 1.0, 3)\n cat_img = np.concatenate([edge, linked_edge], axis=1)\n cv2.imshow(\"Edge\", cat_img)\n cv2.waitKey(0)\n" ]
[ [ "torch.cuda.set_device" ], [ "numpy.concatenate" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
zhunzhong/audio-sync-kit
[ "abe826334ef4cf0a3e6809877584b6aa243140d7" ]
[ "audio_sync/cli.py" ]
[ "# Copyright 2016 Google Inc. All rights reserved.\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n\n\"\"\"CLI to measure latencies between two audio signals.\"\"\"\nfrom __future__ import division\nfrom __future__ import print_function\n\nimport argparse\nimport datetime\nimport json\nimport logging\nimport math\nimport sys\nimport wave\n\nimport audio_sync\nfrom audio_sync import analyzer\nfrom audio_sync import plot\nimport numpy\n\n\nEXIT_CODE_UNKNOWN_ERROR = 255\nEXIT_CODE_ARGS_PARSE_ERROR = 127\nEXIT_CODE_SUCCESS = 0\nEXIT_CODE_LATENCIES_ABOVE_THRESHOLD = 1\nEXIT_CODE_DROPOUTS_DETECTED = 2\n\nVERY_LARGE_LATENCY_USEC = 10000\n\nSECS_IN_MSEC = 1000\nSECS_IN_USEC = 1000000\n\n\ndef ParseArgs(args):\n \"\"\"Helper function for command line parameter parsing.\n\n Args:\n args: (list of str) arguments passed to CLI.\n\n Returns:\n The parsed parameters.\n \"\"\"\n parser = argparse.ArgumentParser(description='Measure latency.')\n parser.add_argument('--debug', default=False, action='store_true',\n help='Enable debug output.')\n parser.add_argument('ref_wav_path',\n help='Path to the reference .wav file.')\n parser.add_argument('act_wav_path',\n help='Path to the actual .wav file.')\n parser.add_argument('--period', type=float, default=0.1,\n help='Fundamental period of audio files (secs).')\n parser.add_argument('--pulse_length', type=float, default=0.002,\n help='Duration of pulse in audio files (secs).')\n parser.add_argument('--dropout_threshold', type=float, default=0.3,\n help=('Dropout threshold, every peak below will be '\n 'interpreted as dropout. Range: [0.0, 1.0]'))\n parser.add_argument('--silence_threshold', type=float, default=0.05,\n help=('Silence threshold, every value below will be '\n 'interpreted as silence. Range: [0.0, 1.0]'))\n parser.add_argument('--min_silence_length', type=float, default=0.005,\n help=('Minimum length of silence (secs). Silences '\n 'below this duration will be ignored.'))\n parser.add_argument('--parsable_output', default=False, action='store_true',\n help='Print latencies and dropouts as a JSON string.')\n parser.add_argument('--print_stats', default=False, action='store_true',\n help='Print latencies stats (max, min, and average).')\n parser.add_argument('--print_percentiles', default=False, action='store_true',\n help='Print latency percentiles.')\n parser.add_argument('--plot_timeline', default=False, action='store_true',\n help=('Plot the conditions in a timeline.'))\n parser.add_argument('--latency_threshold', type=float, default=0.001,\n help=('Latencies equal or greater than this threshold '\n '(secs) are considered excessive.'))\n parser.add_argument('--plot_ascii_graph', default=False, action='store_true',\n help=('Plots all latencies as ASCII art.'))\n parser.add_argument('--start_time', default='00:00:00',\n help=('hh:mm:ss of when playback started.'))\n parser.add_argument('--dots_per_msec', type=int, default='10',\n help=('How many ASCII dots are used per msec of '\n 'latency.'))\n return parser.parse_args(args)\n\n\ndef GetStats(latencies):\n \"\"\"Gets latency stats.\n\n Args:\n latencies: (list) list of 2-tuples (<time>, <latency>).\n\n Returns:\n A 3-tuple:\n Element 1: (float) max latency in seconds.\n Element 2: (float) min latency in seconds.\n Element 3: (float) mean latency in seconds.\n \"\"\"\n values = [d for _, d in latencies if not math.isnan(d)]\n if values:\n # The max, min, and avg should be based on absolute values (otherwise,\n # we could report that -0.1 is greater than -0.2, which is misleading),\n # but we still need to show the signed value so users can tell if the\n # signal was ahead or behind.\n return (max(values, key=abs),\n min(values, key=abs),\n numpy.mean(values))\n else:\n return float('NaN'), float('NaN'), float('NaN')\n\n\ndef CalculatePercentiles(latencies, percentiles=(0, 50, 75, 90, 95, 99, 100)):\n \"\"\"Calculates the latency percentiles.\n\n Args:\n latencies: (list) list of 2-tuples (<time>, <latency>).\n percentiles: (tuple) tuple containing the percentiles to calculate.\n\n Returns:\n A list of the form [(<percentile>, abs(<value>)), ...] for each of\n the percentiles requested.\n \"\"\"\n values = [d for _, d in latencies if not math.isnan(d)]\n if values:\n vals = numpy.percentile(sorted([abs(v) for v in values]),\n percentiles).tolist()\n return zip(percentiles, vals)\n else:\n return zip(percentiles, (float('NaN'),) * 7)\n\n\ndef _Print(message):\n \"\"\"Prints |message| to standard output.\"\"\"\n print(message)\n\n\ndef _PlotResults(\n duration_secs, latencies, dropouts, num_ticks=5, num_dots=70,\n latency_threshold_secs=0.001):\n \"\"\"Plots the results in a text timeline.\"\"\"\n duration_secs = float(duration_secs)\n\n conditions_timeline = plot.GetConditionsInTimeframe(\n latencies, dropouts, duration_secs, num_dots, latency_threshold_secs)\n\n output = (\n 'Timeline:\\n'\n '%s\\n\\n'\n '< = Act more than %.3f secs behind ref\\n'\n '> = Act more than %.3f secs ahead of ref\\n'\n 'o = Dropout\\n'\n '. = %.3f secs\\n') % (\n plot.GetPlotString(conditions_timeline, duration_secs, num_ticks),\n latency_threshold_secs,\n latency_threshold_secs,\n duration_secs / num_dots\n )\n print(output)\n\n\ndef _PlotAsciiGraph(\n latencies, start_time, dots_per_msec=10, latency_threshold_secs=0.001):\n \"\"\"Plots all latencies with timestamp in an ASCII timeline.\n\n Args:\n latencies: (list) list of 2-tuples (<time>, <latency>).\n start_time: (datetime) time the capture of the .wav files started.\n dots_per_msec: (int) How many ASCII dots to use per msec of latency.\n latency_threshold_secs: (float) latencies equal or greater than this\n threshold are considered excessive and are marked with a '*'.\n \"\"\"\n if dots_per_msec < 0:\n raise ValueError('Invalid dots_per_msec %d.' % dots_per_msec)\n\n if latency_threshold_secs < 0:\n raise ValueError('Invalid latency_threshold_secs %d.' % (\n latency_threshold_secs))\n\n threshold_in_dots = int(latency_threshold_secs * SECS_IN_MSEC * dots_per_msec)\n for latency in latencies:\n if math.isnan(latency[1]):\n usecs = VERY_LARGE_LATENCY_USEC\n else:\n usecs = SECS_IN_USEC * latency[1]\n msecs = usecs / 1000\n dots_total = int(abs(msecs) * dots_per_msec)\n dots_below_threshold = min(dots_total, threshold_in_dots)\n filler_spaces_until_thresh = threshold_in_dots - dots_below_threshold\n out_str = '.'*dots_below_threshold + ' '*filler_spaces_until_thresh + '|'\n if dots_total > threshold_in_dots:\n dots_above_thresh = dots_total - threshold_in_dots\n out_str += '*' * dots_above_thresh\n total_secs = int(latency[0])\n time_h = (int)(total_secs / 60)\n time_m = (int)(total_secs % 60)\n t = datetime.timedelta(seconds=total_secs)\n print((start_time + t).strftime('%H:%M:%S'),\n '%2.2d:%2.2d > %+4.4d %s' % (time_h, time_m, usecs, out_str))\n\n values = [d for _, d in latencies if not math.isnan(d)]\n if values:\n avg = numpy.mean(values)\n print(\"\\navg[%d]=%.6f\\n\" % (len(values), avg))\n\n\ndef _PrintPercentiles(percentiles):\n \"\"\"Prints the percentiles to standard output.\"\"\"\n output = '\\n'.join([\n '%d%%: %.6f' % p for p in percentiles])\n _Print('Percentiles (secs):\\n' + output)\n\n\ndef _GetWaveDurationSecs(wav_path):\n \"\"\"Gets the duration in secs of the WAV file.\"\"\"\n wav = wave.open(wav_path)\n try:\n return wav.getnframes() / (wav.getnchannels() * wav.getframerate())\n finally:\n wav.close()\n\n\ndef _Main(args):\n \"\"\"Parses options and shows results.\"\"\"\n try:\n args = ParseArgs(args)\n except SystemExit:\n sys.exit(EXIT_CODE_ARGS_PARSE_ERROR)\n\n if args.debug:\n logging.basicConfig(level=logging.DEBUG)\n\n try:\n settings = analyzer.AnalysisSettings(\n args.period, args.pulse_length, args.dropout_threshold,\n args.silence_threshold, args.min_silence_length)\n latencies, dropouts = audio_sync.AnalyzeAudios(\n args.ref_wav_path, args.act_wav_path, settings)\n print(latencies)\n max_latency, min_latency, avg_latency = GetStats(latencies)\n\n if args.parsable_output:\n _Print(json.dumps({'latencies': latencies, 'dropouts': dropouts}))\n else:\n if args.plot_ascii_graph:\n try:\n start_time = datetime.datetime.strptime(args.start_time, \"%H:%M:%S\")\n except ValueError:\n sys.exit(EXIT_CODE_ARGS_PARSE_ERROR)\n _PlotAsciiGraph(latencies, start_time, dots_per_msec=args.dots_per_msec,\n latency_threshold_secs=args.latency_threshold)\n duration_secs = _GetWaveDurationSecs(args.ref_wav_path)\n if args.plot_timeline:\n _PlotResults(duration_secs, latencies, dropouts,\n latency_threshold_secs=args.latency_threshold)\n if args.print_stats:\n _Print('Max latency: %f secs' % max_latency)\n _Print('Min latency: %f secs' % min_latency)\n _Print('Mean latency: %f secs\\n' % avg_latency)\n if args.print_percentiles:\n percentiles = CalculatePercentiles(latencies)\n _PrintPercentiles(percentiles)\n\n if abs(max_latency) >= args.latency_threshold:\n sys.exit(EXIT_CODE_LATENCIES_ABOVE_THRESHOLD)\n elif dropouts:\n sys.exit(EXIT_CODE_DROPOUTS_DETECTED)\n else:\n sys.exit(EXIT_CODE_SUCCESS)\n except Exception: # pylint: disable=broad-except\n logging.exception('')\n sys.exit(EXIT_CODE_UNKNOWN_ERROR)\n\n\ndef main():\n _Main(sys.argv[1:])\n\n\nif __name__ == '__main__':\n main()\n" ]
[ [ "numpy.mean" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
dhill2522/OPTIONS
[ "f5058e39bef204a53991b275d79f2d7223ff2d61" ]
[ "Class1_Eq.py" ]
[ "\"\"\"\r\nCreated on Mon Nov 05 03:52:36 2018\r\n@author: Paul\r\n\"\"\"\r\n\r\n### Boiler-Plate ###\r\nfrom threading import Thread\r\nimport matplotlib.pylab as plt\r\nimport numpy as np\r\nimport scipy as sp\r\nfrom numpy import random\r\nimport time\r\n\r\nfrom Func import *\r\nfrom iapws97 import _PSat_T\r\n\r\n\r\n###############################################################################\r\n\"\"\"\"\"\"\"\"\" All PERCS Equipment Classes \"\"\"\"\"\"\"\"\" ###########################\r\n###############################################################################\r\n\r\nclass Pipe: # Pipes 716 & 717\r\n def __init__(self,len_):\r\n self.Di = 0.5 # ft\r\n self.len = len_ # ft\r\n self.cost = 0.0 # $\r\n def calc_Pipe(self):\r\n self.cost = 50.0*self.len # $\r\n\r\nclass Support: # PERCS Tank Support Structure\r\n def __init__(self,R_tank,H_tank,elev_tank):\r\n self.R = R_tank # ft\r\n self.H = H_tank # ft\r\n self.elev = elev_tank # ft\r\n self.cost = 0.0 # $\r\n def calc_Support(self):\r\n profile = np.pi*self.R**2.0 # ft^2\r\n cost_per_sqft = 30 # $/ft^2\r\n elev_factor = 0.0628*self.elev + 1.0\r\n self.cost = elev_factor * profile * cost_per_sqft\r\n\r\nclass HX: # Fake Heat Exchanger\r\n def __init__(self):\r\n self.P = 155.132 # bar (hot leg pressure)\r\n self.n = 0 # (number of tubes)\r\n self.A = 0.0 # m^2 (heat transfer SA)\r\n self.cost = 0.0 # $\r\n def calc_HX(self):\r\n # Calculate Cost\r\n K = np.array([4.1884,-0.2503,0.1974])\r\n if self.A <= 1000:\r\n # Purchase Cost\r\n C_p0 = 10.0**(K[0]+K[1]*np.log10(self.A)+K[2]*np.log10(self.A)**2.0)\r\n else:\r\n C_p0 = 11665.8957777+152.0393955*self.A\r\n P_g = self.P-1.0 # barg\r\n if P_g < 5.0: \r\n C = np.array([0.0,0.0,0.0])\r\n else:\r\n C = np.array([0.03881,-0.11272,0.08183])\r\n # Pressure Factor\r\n F_P = 10.0**(C[0]+C[1]*np.log10(P_g)+C[2]*np.log10(P_g)**2.0)\r\n F_M = 2.75 # Material Factor (Stainless Steel)\r\n B_1 = 1.63\r\n B_2 = 1.66\r\n self.cost = (553.9/397.0)*C_p0*(B_1 + B_2*F_M*F_P)\r\n\r\nclass Tank: # PERCS Tank\r\n def __init__(self,R_,H_):\r\n self.P = 1.703 # bar\r\n self.R = R_ # ft\r\n self.D = self.R*2/3.28084 # m\r\n self.H = H_ # ft\r\n self.A = np.pi * (self.R**2.0) * self.H # ft^3\r\n self.A = self.A / 35.3147 # m^3\r\n self.cost = 0.0\r\n def calc_Tank(self):\r\n # Calcuate Cost\r\n K = np.array([3.4974,0.4485,0.1074])\r\n if self.A <= 520:\r\n C_p0 = 10.0**(K[0]+K[1]*np.log10(self.A)+K[2]*np.log10(self.A)**2.0) # Purchase Cost\r\n else:\r\n C_p0 = 637.3687*self.A-9491.036783\r\n P_g = self.P-1.0 # barg\r\n F_P = ((P_g+1.0)*self.D/(2.0*(850.0-0.6*(P_g+1.0)))+0.00315)/0.0063 # Pressure Factor\r\n F_M = 3.12 # Material Factor (SS)\r\n B_1 = 2.25\r\n B_2 = 1.82\r\n self.cost = (553.9/397.0)*C_p0*(B_1 + B_2*F_M*F_P)\r\n\r\nclass Chemical: # MgCO3 within PERCS Tank\r\n def __init__(self,ID):\r\n self.mass = 0.0 # kg\r\n self.ID = ID\r\n self.chem_costs = np.array((24.0,0.0)) # $/kg\r\n self.cost = 0.0\r\n def calc_Chemical(self):\r\n self.cost = self.mass * self.chem_costs[self.ID]\r\n\r\n\r\n###############################################################################\r\n\"\"\"\"\"\"\"\"\" All PCS Equipment Classes \"\"\"\"\"\"\"\"\" #############################\r\n###############################################################################\r\n\r\nclass Stream:\r\n def __init__(self,P,T,mdot,x):\r\n self.y = 1\r\n self.P = P\r\n self.T = T\r\n self.mdot = mdot\r\n self.x = x\r\n\r\nclass Turbine:\r\n def __init__(self,Pin,Tin,mdot,x_in,Pout):\r\n self.y = 1\r\n self.Pin = Pin\r\n self.Tin = Tin\r\n self.mdot = mdot\r\n self.x_in = x_in\r\n self.Pout = Pout\r\n self.Tout = 0.0\r\n self.x_out = 0.0\r\n self.W = 0.0\r\n self.eff = 0.915\r\n self.cost = 0.0\r\n def calc_Turb(self):\r\n # If turbine does exist\r\n if self.y == 1:\r\n # If the incoming steam is saturated or superheated\r\n if self.x_in >= 1.0:\r\n Hin = h_pT(self.Pin,self.Tin)\r\n # If the incoming stream is two-phase\r\n else:\r\n Hin = h_Tx(self.Tin,self.x_in)\r\n # Calculate the Power Generated (W)\r\n Sin = S_ph(self.Pin,Hin)\r\n S_out_id = Sin\r\n H_out_id = h_pS(self.Pout,S_out_id)\r\n DH_id = Hin - H_out_id\r\n DH_real = self.eff*DH_id\r\n self.W = self.mdot*DH_real/1000 # MW\r\n # Calculate the outlet properties\r\n H_out = Hin - DH_real\r\n self.Tout = T_ph(self.Pout,H_out)\r\n self.x_out = x_ph(self.Pout,H_out)\r\n # Calcuate Cost\r\n A = self.W * 1000 # kW\r\n K = np.array([2.7051,1.4398,-0.1776])\r\n if A <= 9800:\r\n # Purchase Cost\r\n C_p0 = 10.0**(K[0]+K[1]*np.log10(A)+K[2]*np.log10(A)**2.0)\r\n else:\r\n C_p0 = 410763.708588+0.87078286*A\r\n F_P = 0.0 # Pressure Factor\r\n F_M = 0.0 # Material Factor (Stainless Steel)\r\n B_1 = 1.0\r\n B_2 = 0.0\r\n self.cost = (553.9/397.0)*C_p0*(B_1 + B_2*F_M*F_P)\r\n # If turbine does not exist\r\n else:\r\n self.cost = 0.0\r\n self.W = 0.0\r\n\r\nclass Pump:\r\n def __init__(self,Pin,Tin,mdot,Pout):\r\n self.y = 1\r\n self.Pin = Pin\r\n self.Tin = Tin\r\n self.mdot = mdot\r\n self.Pout = Pout\r\n self.Tout = 0.0\r\n self.W = 0.0\r\n self.eff = 0.85\r\n self.cost = 0.0\r\n def calc_Pump(self):\r\n # If pump does exist\r\n if self.y == 1:\r\n if self.Pin > _PSat_T(self.Tin+273.15)*10.0:\r\n Hin = h_pT(self.Pin,self.Tin)\r\n else:\r\n Hin = h_Tx(self.Tin,0.0)\r\n # Calculate the work requirement (W)\r\n Sin = S_ph(self.Pin,Hin)\r\n S_out_id = Sin\r\n H_out_id = h_pS(self.Pout,S_out_id)\r\n DH_id = H_out_id - Hin\r\n DH_real = DH_id / self.eff\r\n self.W = self.mdot*DH_real/1000 # MW\r\n # Calculate the outlet properties\r\n H_out = Hin + DH_real\r\n self.Tout = T_ph(self.Pout,H_out)\r\n # Calcuate Cost\r\n A = self.W * 1000 # kW\r\n K = np.array([3.3892,0.0536,0.1538])\r\n if A <= 300:\r\n # Purchase Cost\r\n C_p0 = 10.0**(K[0]+K[1]*np.log10(A)+K[2]*np.log10(A)**2.0)\r\n else:\r\n C_p0 = 5371.29236+79.50315*A\r\n P_g = self.Pout - 1.0 # barg\r\n C = np.zeros(3)\r\n if P_g >= 10.0:\r\n C = np.array([-0.3935,0.3957,-0.00226])\r\n # Pressure Factor\r\n F_P = 10.0**(C[0]+C[1]*np.log10(P_g)+C[2]*np.log10(P_g)**2.0)\r\n F_M = 2.28 # Material Factor (Stainless Steel)\r\n B_1 = 1.89\r\n B_2 = 1.35\r\n self.cost = (553.9/397.0)*C_p0*(B_1 + B_2*F_M*F_P)\r\n # If pump does not exist\r\n else:\r\n self.cost = 0.0\r\n self.W = 0.0\r\n\r\nclass PHX: # Primary Heat Exchanger (Steam Generator)\r\n def __init__(self,Tout):\r\n self.y = 1\r\n # Hot stream vars (Default)\r\n self.P_hot = 160.71 # bar\r\n self.Tin_hot = 328.56 # deg C\r\n self.Tout_hot = 296.51 # deg C\r\n self.Q_th = 750.0e3 # Thermal power transferred, in kW\r\n # Cold stream vars\r\n self.Pin = 64. # bar\r\n self.Tin = 0.0\r\n self.Pout = self.Pin # Zero pressure drop\r\n self.Tout = Tout # Optimized param\r\n self.xout = 0.0\r\n # Overall vars\r\n self.mdot = 0.0\r\n self.cost = 0.0\r\n def calc_PHX(self):\r\n # Calculate Tcold_in\r\n Hout = h_pT(self.Pout,self.Tout)\r\n Hin = Hout - self.Q_th/self.mdot\r\n self.Tin = T_ph(self.Pin,Hin)\r\n # Calculate xout (quality leaving phx)\r\n self.xout = x_ph(self.Pout,Hout)\r\n # Find required heat-transfer Area, A\r\n # Log mean temperature difference\r\n DT_1 = self.Tin_hot-self.Tout\r\n DT_2 = self.Tout_hot-self.Tin\r\n self.DT_lm = (DT_2-DT_1)/np.log(DT_2/DT_1)\r\n # HX calculations\r\n self.F = 1. # for phase change\r\n U = 5 #kW/m^2*K, back-calculated from B&W params\r\n self.A = self.Q_th / (self.F*U*self.DT_lm) # m^2\r\n # Calculate Cost\r\n K = np.array([4.1884,-0.2503,0.1974])\r\n if self.A <= 1000:\r\n # Purchase Cost\r\n C_p0 = 10.0**(K[0]+K[1]*np.log10(self.A)+K[2]*np.log10(self.A)**2.0)\r\n else:\r\n C_p0 = 11665.8957777+152.0393955*self.A\r\n P_g = self.P_hot-1.0 # barg\r\n if P_g < 5.0: \r\n C = np.array([0.0,0.0,0.0])\r\n else:\r\n C = np.array([0.03881,-0.11272,0.08183])\r\n # Pressure Factor\r\n F_P = 10.0**(C[0]+C[1]*np.log10(P_g)+C[2]*np.log10(P_g)**2.0)\r\n F_M = 2.75 # Material Factor (Stainless Steel)\r\n B_1 = 1.63\r\n B_2 = 1.66\r\n self.cost = (553.9/397.0)*C_p0*(B_1 + B_2*F_M*F_P)\r\n\r\nclass Reheater:\r\n \"\"\"\r\n 1 = Reheat Stream (Hot side)\r\n 2 = Residual Steam (Cold side)\r\n \"\"\"\r\n def __init__(self,ID,Pin1,Tin1,mdot1,x_in1,Pin2,Tin2,mdot2,Satd_in2):\r\n self.y = 1\r\n # Hot stream vars\r\n self.ID = ID\r\n self.Pin1 = Pin1\r\n self.Tin1 = Tin1\r\n self.mdot1 = mdot1\r\n self.x_in1 = x_in1\r\n self.Satd_in1 = False\r\n self.Tout1 = 0.0\r\n self.Pout1 = 0.0\r\n self.x_out1 = 0.0\r\n # Cold stream vars\r\n self.Pin2 = Pin2\r\n self.Tin2 = Tin2\r\n self.mdot2 = mdot2\r\n self.Satd_in2 = Satd_in2\r\n self.s_lim = 0 # Fake ID\r\n self.Tout2 = 0.0\r\n self.Pout2 = 0.0\r\n # Overall vars\r\n self.DT_lm = 0.0\r\n self.F = 0.0\r\n self.A = 0.0\r\n self.q = 0.0 # kW\r\n self.pinch = False\r\n self.cost = 0.0\r\n def calc_RH(self):\r\n self.pinch = False\r\n # If reheater does exist\r\n if self.y == 1:\r\n # Check for a pinch point\r\n if (self.Tin1 - self.Tin2) <= 10.0:\r\n self.pinch = True\r\n self.A = 0.0\r\n self.q = 0.0\r\n self.Pout1 = self.Pin1\r\n self.Tout1 = self.Tin1\r\n self.x_out1 = self.x_in1\r\n self.Pout2 = self.Pin2\r\n self.Tout2 = self.Tin2\r\n # Proceed with calcs if no pinch point\r\n else:\r\n # For now, ignore pressure drops in the RHs\r\n self.Pout1 = self.Pin1\r\n self.Pout2 = self.Pin2\r\n # Calcs if limiting stream is 1\r\n To1 = self.Tin2 + 10.0\r\n Hin1 = 0.0 # Fake value\r\n if self.Satd_in1 == False and self.x_in1 == 0.0:\r\n Hin1 = h_pT(self.Pin1,self.Tin1)\r\n elif self.Satd_in1 == True:\r\n Hin1 = h_Tx(self.Tin1,self.x_in1)\r\n elif 0.0 < self.x_in1 < 1.0:\r\n Hin1 = h_Tx(self.Tin1, self.x_in1)\r\n elif self.Satd_in1 == False and self.x_in1 == 1.0:\r\n Hin1 = h_pT(self.Pin1,self.Tin1)\r\n Ho1 = h_pT(self.Pout1,To1)\r\n q1 = self.mdot1*(Hin1-Ho1)\r\n # Calcs if limiting stream is 2\r\n To2 = self.Tin1 - 10.0\r\n if self.Satd_in2 == True:\r\n Hin2 = h_Tx(self.Tin2,1.0)\r\n else:\r\n Hin2 = h_pT(self.Pin2,self.Tin2)\r\n Ho2 = h_pT(self.Pout2,To2)\r\n q2 = self.mdot2*(Ho2-Hin2)\r\n # Determine which stream is actually limiting\r\n if q1 < q2:\r\n self.s_lim = 1\r\n else:\r\n self.s_lim = 2\r\n # If limiting stream is 1:\r\n if self.s_lim == 1:\r\n self.Tout1 = To1\r\n self.q = q1\r\n # Apply q to Turbine stream, find the new Tout2\r\n DH_2 = self.q / self.mdot2\r\n Hout2 = Hin2 + DH_2\r\n self.Tout2 = T_ph(self.Pout2,Hout2)\r\n # If limiting stream is 2:\r\n if self.s_lim == 2:\r\n self.Tout2 = To2\r\n self.q = q2\r\n # Apply q to Reheat stream, find the new Tout1 and x_out1\r\n DH_1 = self.q / self.mdot1\r\n Hout1 = Hin1 - DH_1\r\n self.Tout1 = T_ph(self.Pout1,Hout1)\r\n self.x_out1 = x_ph(self.Pout1,Hout1)\r\n # If no pinch point, Calc the Cost\r\n if self.pinch == False:\r\n # Find required heat-transfer Area, A\r\n DT_1 = self.Tin1-self.Tout2\r\n DT_2 = self.Tout1-self.Tin2\r\n self.DT_lm = (DT_2-DT_1)/np.log(DT_2/DT_1)\r\n if self.x_in1 > 0.0:\r\n self.F = 1.0\r\n else:\r\n R = (self.Tin1-self.Tout1)/(self.Tout2-self.Tin2)\r\n P = (self.Tout2-self.Tin2)/(self.Tin1-self.Tin2)\r\n inside = (2.0-P*(R+1.0-np.sqrt(R**2.0+1.0)))/(2.0-P*(R+1.0+np.sqrt(R**2.0+1.0)))\r\n self.F = np.sqrt(R**2.0+1.0)/(R-1.0)*np.log((1.0-P)/(1.0-P*R))/np.log(inside)\r\n \"\"\" U = 1 kW/m^2*K until changed on 2.17.17 \"\"\"\r\n U = 3 # kW/m^2*K\r\n self.A = self.q / (self.F*U*self.DT_lm) # m^2\r\n # Calcuate Cost\r\n K = np.array([4.1884,-0.2503,0.1974])\r\n if self.A <= 1000:\r\n # Purchase Cost\r\n C_p0 = 10.0**(K[0]+K[1]*np.log10(self.A)+K[2]*np.log10(self.A)**2.0)\r\n else:\r\n C_p0 = 11665.8957777+152.0393955*self.A\r\n P_g = self.Pin1-1.0 # barg\r\n if P_g < 5.0: \r\n C = np.array([0.0,0.0,0.0])\r\n else:\r\n C = np.array([0.03881,-0.11272,0.08183])\r\n # Pressure Factor\r\n F_P = 10.0**(C[0]+C[1]*np.log10(P_g)+C[2]*np.log10(P_g)**2.0)\r\n F_M = 2.75 # Material Factor (Stainless Steel)\r\n B_1 = 1.63\r\n B_2 = 1.66\r\n self.cost = (553.9/397.0)*C_p0*(B_1 + B_2*F_M*F_P)\r\n # If there was a pinch point, enact a penalty in the cost\r\n elif self.pinch == True:\r\n self.cost = 15.0e9 / 5.0\r\n # If reheater does not exist\r\n else:\r\n self.cost = 0.0\r\n\r\nclass MS: # Moisture Separator\r\n \"\"\"\r\n V = vapor outlet\r\n L = liquid outlet\r\n \"\"\"\r\n def __init__(self,Pin,Tin,mdot,x_in):\r\n self.y = 1\r\n self.P = Pin\r\n self.T = Tin\r\n self.mdot = mdot\r\n self.x_in = x_in\r\n self.mdot_V = 0.0\r\n self.mdot_L = 0.0\r\n self.D = 0.0 # m\r\n self.V = 0.0 # m^3\r\n self.cost = 0.0\r\n def calc_MS(self):\r\n self.mdot_V = self.mdot * self.x_in\r\n self.mdot_L = self.mdot * (1-self.x_in)\r\n # If MS does exist\r\n if self.y == 1:\r\n # Find the volume required, A\r\n rho_steam = rhoV_P(self.P) # kg/m^3\r\n rho_water = rhoL_P(self.P) # kg/m^3\r\n res_time = 60.0 # sec\r\n A = res_time*(self.mdot_V/rho_steam+self.mdot_L/rho_water) # m^3\r\n self.V = A\r\n # Calcuate Cost\r\n K = np.array([3.4974,0.4485,0.1074])\r\n if A <= 520:\r\n # Purchase Cost\r\n C_p0 = 10.0**(K[0]+K[1]*np.log10(A)+K[2]*np.log10(A)**2.0)\r\n else:\r\n C_p0 = 637.3687*A-9491.036783\r\n P_g = self.P-1 # barg\r\n self.D = A/100.0 # m\r\n # Pressure Factor\r\n F_P = ((P_g+1.0)*self.D/(2.0*(850.0-0.6*(P_g+1.0)))+0.00315)/0.0063\r\n F_M = 3.12 # Material Factor (Stainless Steel)\r\n B_1 = 2.25\r\n B_2 = 1.82\r\n self.cost = C_p0*(B_1 + B_2*F_M*F_P)\r\n # If MS does not exist\r\n else:\r\n self.cost = 0.0\r\n\r\nclass Condenser:\r\n def __init__(self,Pin,Tin,mdot,x_in):\r\n # Initialize vars\r\n self.y = 1\r\n self.Pin = Pin\r\n self.Tin = Tin\r\n self.mdot = mdot\r\n self.x_in = x_in\r\n self.q = 0.0\r\n self.Pout = 0.0\r\n self.Tout = 0.0\r\n self.x_out = 0.0\r\n self.A = 0.0\r\n self.cost = 0.0\r\n def calc_Condenser(self):\r\n # Calculate Q across HX\r\n Hin = h_Tx(self.Tin,self.x_in)\r\n self.Pout = self.Pin\r\n self.Tout = self.Tin\r\n Hout = h_Tx(self.Tout,self.x_out)\r\n DH = Hin - Hout\r\n self.q = self.mdot * DH / 1000 # MW\r\n # Find required heat-transfer Area, A\r\n DT_1 = self.Tin-30.0\r\n DT_2 = self.Tout-25.0\r\n DT_lm = (DT_2-DT_1)/np.log(DT_2/DT_1)\r\n R = (self.Tin-self.Tout)/(30.0-25.0)\r\n P = (30.0-25.0)/(self.Tin-25.0)\r\n inside = (2.0-P*(R+1.0-np.sqrt(R**2.0+1.0)))/(2.0-P*(R+1.0+np.sqrt(R**2.0+1.0)))\r\n F = np.sqrt(R**2.0+1.0)/(R-1.0)*np.log((1.0-P)/(1.0-P*R))/np.log(inside)\r\n U = 1 # kW/m^2*K\r\n self.A = self.q / (F*U*DT_lm) # m^2\r\n # Calcuate Cost\r\n K = np.array([4.8306,-0.8509,0.3187])\r\n if self.A <= 1000:\r\n # Purchase Cost\r\n C_p0 = 10.0**(K[0]+K[1]*np.log10(self.A)+K[2]*np.log10(self.A)**2.0)\r\n else:\r\n C_p0 = 146.21105*self.A-6225.7924\r\n P_g = self.Pin-1.0 # barg\r\n F_P = 0.0\r\n # Pressure Factor\r\n if P_g < 5.0: \r\n C = np.array([0.0,0.0,0.0])\r\n F_P = 1.0\r\n else:\r\n C = np.array([0.03881,-0.11272,0.08183])\r\n F_P = 10.0**(C[0]+C[1]*np.log10(P_g)+C[2]*np.log10(P_g)**2.0)\r\n F_M = 2.75 # Material Factor (Stainless Steel)\r\n B_1 = 1.63\r\n B_2 = 1.66\r\n # If condenser does exist, which it should...\r\n if self.y == 1:\r\n self.cost = (553.9/397.0)*C_p0*(B_1 + B_2*F_M*F_P)\r\n else:\r\n self.cost = 0.0\r\n\r\nclass FWH: # Feedwater Heater\r\n def __init__(self,Pin1,Tin1,mdot1,x_in1,Pin2,Tin2,mdot2):\r\n # Initialize vars\r\n self.y = 1\r\n self.Pin1 = Pin1\r\n self.Tin1 = Tin1\r\n self.mdot1 = mdot1\r\n self.x_in1 = x_in1\r\n self.Pin2 = Pin2\r\n self.Tin2 = Tin2\r\n self.mdot2 = mdot2\r\n self.Pout = 0.0\r\n self.Tout = 0.0\r\n self.mdot = 0.0\r\n self.x_out = 0.0\r\n self.D = 0.0 # m\r\n self.V = 0.0 # m^3\r\n self.cost = 0.0\r\n def calc_FWH(self):\r\n # If FWH does exist\r\n if self.y == 1:\r\n # Calculate the outlet Enthalpy\r\n self.Pout = self.Pin2\r\n self.mdot = self.mdot1 + self.mdot2\r\n #''' Added 0.005 degC to Tin1, b/c of a once-occuring issue with IAPWS97 '''\r\n Hin1 = h_Tx(self.Tin1,self.x_in1)\r\n x1 = self.mdot1 / self.mdot\r\n Hin2 = h_pT(self.Pin2,self.Tin2)\r\n x2 = self.mdot2 / self.mdot\r\n Hout = x1*Hin1 + x2*Hin2\r\n self.Tout = T_ph(self.Pout,Hout)\r\n self.x_out = x_ph(self.Pout,Hout)\r\n # Find the volume required, A\r\n rho_water = 10**3.0 # kg/m^3\r\n res_time = 60.0 # sec\r\n self.V = res_time*(self.mdot/rho_water) # m^3\r\n A = self.V\r\n # Calcuate Cost\r\n K = np.array([3.4974,0.4485,0.1074])\r\n if A <= 520:\r\n # Purchase Cost\r\n C_p0 = 10.0**(K[0]+K[1]*np.log10(A)+K[2]*np.log10(A)**2.0)\r\n else:\r\n C_p0 = 637.3687*A-9491.036783\r\n P_g = self.Pout-1 # barg\r\n self.D = A/100.0 # m\r\n # Pressure Factor\r\n F_P = ((P_g+1.0)*self.D/(2.0*(850.0-0.6*(P_g+1.0)))+0.00315)/0.0063\r\n F_M = 3.12 # Material Factor (Stainless Steel)\r\n B_1 = 2.25\r\n B_2 = 1.82\r\n self.cost = (553.9/397.0)*C_p0*(B_1 + B_2*F_M*F_P)\r\n # If FWH does not exist\r\n else:\r\n self.cost = 0.0\r\n\r\n\r\n###############################################################################\r\n\"\"\"\"\"\"\"\"\" All Core Loop Equipment Classes \"\"\"\"\"\"\"\"\" #######################\r\n###############################################################################\r\n\r\nclass Pump_rcp:\r\n def __init__(self,W,P_out):\r\n self.Pout = P_out # bar\r\n self.W_th = W # MW\r\n self.eff = 0.85\r\n self.cost = 0.0\r\n def calc_Pump(self):\r\n # Calcuate Cost\r\n A = self.W_th * 1000 # kW\r\n K = np.array([3.3892,0.0536,0.1538])\r\n if A <= 300:\r\n # Purchase Cost\r\n C_p0 = 10.0**(K[0]+K[1]*np.log10(A)+K[2]*np.log10(A)**2.0)\r\n else:\r\n C_p0 = 5371.29236+79.50315*A\r\n P_g = self.Pout - 1.0 # barg\r\n C = np.zeros(3)\r\n if P_g >= 10.0:\r\n C = np.array([-0.3935,0.3957,-0.00226])\r\n # Pressure Factor\r\n F_P = 10.0**(C[0]+C[1]*np.log10(P_g)+C[2]*np.log10(P_g)**2.0)\r\n F_M = 2.28 # Material Factor (Stainless Steel)\r\n B_1 = 1.89\r\n B_2 = 1.35\r\n self.cost = (553.9/397.0)*C_p0*(B_1 + B_2*F_M*F_P)" ]
[ [ "numpy.log", "numpy.sqrt", "numpy.log10", "numpy.array", "numpy.zeros" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
inessus/ai-skills
[ "527f32d49887f06eee357c83bb6a9a21edc69bc5", "527f32d49887f06eee357c83bb6a9a21edc69bc5", "527f32d49887f06eee357c83bb6a9a21edc69bc5", "527f32d49887f06eee357c83bb6a9a21edc69bc5", "527f32d49887f06eee357c83bb6a9a21edc69bc5", "527f32d49887f06eee357c83bb6a9a21edc69bc5" ]
[ "src/model/pytorch/21-RL/DeepRL-Tutorials/agents/Quantile_Rainbow.py", "src/model/pytorch/18-Chatbot/model/trainer.py", "src/model/pytorch/18-Chatbot/data/prepare.py", "src/model/pytorch/32-WaveNet/PytorchWaveNetVocoder/src/bin/noise_shaping.py", "src/model/boosting.py", "src/library/text/modules/rl.py" ]
[ "import numpy as np\n\nimport torch\n\nfrom agents.DQN import Model as DQN_Agent\nfrom networks.network_bodies import SimpleBody, AtariBody\nfrom networks.networks import DuelingQRDQN\nfrom utils.ReplayMemory import PrioritizedReplayMemory\n\nclass Model(DQN_Agent):\n def __init__(self, static_policy=False, env=None, config=None):\n self.num_quantiles = config.QUANTILES\n self.cumulative_density = torch.tensor((2 * np.arange(self.num_quantiles) + 1) / (2.0 * self.num_quantiles), device=config.device, dtype=torch.float) \n self.quantile_weight = 1.0 / self.num_quantiles\n\n super(Model, self).__init__(static_policy, env, config)\n\n self.nsteps=max(self.nsteps, 3)\n \n \n def declare_networks(self):\n self.model = DuelingQRDQN(self.env.observation_space.shape, self.env.action_space.n, noisy=True, sigma_init=self.sigma_init, quantiles=self.num_quantiles)\n self.target_model = DuelingQRDQN(self.env.observation_space.shape, self.env.action_space.n, noisy=True, sigma_init=self.sigma_init, quantiles=self.num_quantiles)\n\n def declare_memory(self):\n self.memory = PrioritizedReplayMemory(self.experience_replay_size, self.priority_alpha, self.priority_beta_start, self.priority_beta_frames)\n\n def next_distribution(self, batch_vars):\n batch_state, batch_action, batch_reward, non_final_next_states, non_final_mask, empty_next_state_values, indices, weights = batch_vars\n\n with torch.no_grad():\n quantiles_next = torch.zeros((self.batch_size, self.num_quantiles), device=self.device, dtype=torch.float)\n if not empty_next_state_values:\n self.target_model.sample_noise()\n max_next_action = self.get_max_next_state_action(non_final_next_states)\n quantiles_next[non_final_mask] = self.target_model(non_final_next_states).gather(1, max_next_action).squeeze(dim=1)\n\n quantiles_next = batch_reward + ((self.gamma**self.nsteps)*quantiles_next)\n\n return quantiles_next\n \n def compute_loss(self, batch_vars):\n batch_state, batch_action, batch_reward, non_final_next_states, non_final_mask, empty_next_state_values, indices, weights = batch_vars\n\n batch_action = batch_action.unsqueeze(dim=-1).expand(-1, -1, self.num_quantiles)\n\n self.model.sample_noise()\n quantiles = self.model(batch_state)\n quantiles = quantiles.gather(1, batch_action).squeeze(1)\n\n quantiles_next = self.next_distribution(batch_vars)\n \n diff = quantiles_next.t().unsqueeze(-1) - quantiles.unsqueeze(0)\n\n loss = self.huber(diff) * torch.abs(self.cumulative_density.view(1, -1) - (diff < 0).to(torch.float))\n loss = loss.transpose(0,1)\n self.memory.update_priorities(indices, loss.detach().mean(1).sum(-1).abs().cpu().numpy().tolist())\n loss = loss * weights.view(self.batch_size, 1, 1)\n loss = loss.mean(1).sum(-1).mean()\n\n return loss\n\n def get_action(self, s, eps):\n with torch.no_grad():\n X = torch.tensor([s], device=self.device, dtype=torch.float) \n self.model.sample_noise()\n a = (self.model(X) * self.quantile_weight).sum(dim=2).max(dim=1)[1]\n return a.item()\n\n def get_max_next_state_action(self, next_states):\n next_dist = self.model(next_states) * self.quantile_weight\n return next_dist.sum(dim=2).max(1)[1].view(next_states.size(0), 1, 1).expand(-1, -1, self.num_quantiles)", "import os\nimport sys\nimport torch\nimport random\n\nsys.path.append('..')\n\nfrom data.dictionary import MAX_LENGTH, EOS_token, SOS_token\nfrom data.prepare import batch2TrainData, indexesFromSentence, normalizeString\n\n\ncuda = torch.cuda.is_available()\ndevice = torch.device('cuda' if cuda else 'cpu')\n\n# Configure training/optimization\nclip = 50.0\nteacher_forcing_ratio = 1.0\nlearning_rate = 0.0001\ndecoder_learning_ratio = 5.0\nn_iteration = 4000\nprint_every = 1\nsave_every = 500\n# Set checkpoint to load from; set to None if starting from scratch\nloadFilename = None\ncheckpoint_iter = 4000\ncheckpoint = None\n\n\ndef maskNLLLoss(inp, target, mask): # (B, O),(B),(B) =>(64, 7826) (64) (64)\n \"\"\"\n target指示秋香的位置,gather是点秋香\n :param inp:\n :param target:\n :param mask:\n :return:\n \"\"\"\n nTotal = mask.sum()\n crossEntropy = -torch.log(torch.gather(inp, 1, target.view(-1, 1)))\n loss = crossEntropy.masked_select(mask).mean()\n loss = loss.to(device)\n return loss, nTotal.item()\n\n\ndef train(input_variable, lengths, target_variable, mask, max_target_len, encoder, decoder, embedding,\n encoder_optimizer, decoder_optimizer, batch_size, clip, max_length=MAX_LENGTH):\n \"\"\"\n\n :param input_variable:\n :param lengths:\n :param target_variable:\n :param mask:\n :param max_target_len:\n :param encoder:\n :param decoder:\n :param embedding:\n :param encoder_optimizer:\n :param decoder_optimizer:\n :param batch_size:\n :param clip:\n :param max_length:\n :return:\n \"\"\"\n # Zero gradients\n encoder_optimizer.zero_grad()\n decoder_optimizer.zero_grad()\n\n # Set device options\n input_variable = input_variable.to(device) # T, B = 10, 64\n lengths = lengths.to(device) # B = 64\n target_variable = target_variable.to(device) # T, B = 10, 64\n mask = mask.to(device)\n\n # Initialize variables\n loss = 0\n print_losses = []\n n_totals = 0\n\n # Forward pass through encoder\n encoder_outputs, encoder_hidden = encoder(input_variable, lengths) # (T, B, N) (2*L, B, N)(10, 64, 500)\n\n # Create initial decoder input (start with SOS tokens for each sentence)\n decoder_input = torch.LongTensor([[SOS_token for _ in range(batch_size)]]) #(1, B) (1,54)\n decoder_input = decoder_input.to(device) # 1, B\n\n # Set initial decoder hidden state to the encoder's final hidden state\n decoder_hidden = encoder_hidden[:decoder.n_layers] # (L, B, N)\n\n # Determine if we are using teacher forcing this iteration\n use_teacher_forcing = True if random.random() < teacher_forcing_ratio else False\n\n # Forward batch of sequences through decoder one time step at a time\n if use_teacher_forcing:\n for t in range(max_target_len): # T\n decoder_output, decoder_hidden = decoder(\n decoder_input, decoder_hidden, encoder_outputs\n ) # (B, 7826) (L, B, N) (64, 7826)(2, 64, 500)\n # Teacher forcing: next input is current target\n decoder_input = target_variable[t].view(1, -1) # 1, B (1, 64)\n # Calculate and accumulate loss\n mask_loss, nTotal = maskNLLLoss(decoder_output, target_variable[t], mask[t]) # (B, 7826) (B)\n loss += mask_loss\n print_losses.append(mask_loss.item() * nTotal)\n n_totals += nTotal\n else:\n for t in range(max_target_len):\n decoder_output, decoder_hidden = decoder(\n decoder_input, decoder_hidden, encoder_outputs\n )\n # No teacher forcing: next input is decoder's own current output\n _, topi = decoder_output.topk(1)\n decoder_input = torch.LongTensor([[topi[i][0] for i in range(batch_size)]])\n decoder_input = decoder_input.to(device)\n # Calculate and accumulate loss\n mask_loss, nTotal = maskNLLLoss(decoder_output, target_variable[t], mask[t])\n loss += mask_loss\n print_losses.append(mask_loss.item() * nTotal)\n n_totals += nTotal\n\n # Perform backpropatation\n loss.backward()\n\n # Clip gradients: gradients are modified in place\n _ = torch.nn.utils.clip_grad_norm_(encoder.parameters(), clip)\n _ = torch.nn.utils.clip_grad_norm_(decoder.parameters(), clip)\n\n # Adjust model weights\n encoder_optimizer.step()\n decoder_optimizer.step()\n\n return sum(print_losses) / n_totals\n\n\ndef trainIters(model_name, voc, pairs, encoder, decoder, encoder_optimizer, decoder_optimizer, embedding,\n encoder_n_layers, decoder_n_layers, save_dir, n_iteration, batch_size, print_every, save_every, clip,\n corpus_name, loadFilename):\n \"\"\"\n\n :param model_name:\n :param voc:\n :param pairs:\n :param encoder:\n :param decoder:\n :param encoder_optimizer:\n :param decoder_optimizer:\n :param embedding:\n :param encoder_n_layers:\n :param decoder_n_layers:\n :param save_dir:\n :param n_iteration:\n :param batch_size:\n :param print_every:\n :param save_every:\n :param clip:\n :param corpus_name:\n :param loadFilename:\n :return:\n \"\"\"\n hidden_size = 500\n # Load batches for each iteration\n training_batches = [batch2TrainData(voc, [random.choice(pairs) for _ in range(batch_size)])\n for _ in range(n_iteration)] # longest, batch_size = 10, 64\n\n # Initializations\n print('Initializing ...')\n start_iteration = 1\n print_loss = 0\n if loadFilename:\n start_iteration = checkpoint['iteration'] + 1\n\n # Training loop\n print(\"Training...\")\n for iteration in range(start_iteration, n_iteration + 1):\n training_batch = training_batches[iteration - 1]\n # Extract fields from batch\n input_variable, lengths, target_variable, mask, max_target_len = training_batch\n\n # Run a training iteration with batch\n loss = train(input_variable, lengths, target_variable, mask, max_target_len, encoder,\n decoder, embedding, encoder_optimizer, decoder_optimizer, batch_size, clip)\n print_loss += loss\n\n # Print progress\n if iteration % print_every == 0:\n print_loss_avg = print_loss / print_every\n print(\"Iteration: {}; Percent complete: {:.1f}%; Average loss: {:.4f}\".format(iteration,\n iteration / n_iteration * 100,\n print_loss_avg))\n print_loss = 0\n\n # Save checkpoint\n if iteration % save_every == 0:\n directory = os.path.join(save_dir, model_name, corpus_name,\n '{}-{}_{}'.format(encoder_n_layers, decoder_n_layers, hidden_size))\n if not os.path.exists(directory):\n os.makedirs(directory)\n torch.save({\n 'iteration': iteration,\n 'en': encoder.state_dict(),\n 'de': decoder.state_dict(),\n 'en_opt': encoder_optimizer.state_dict(),\n 'de_opt': decoder_optimizer.state_dict(),\n 'loss': loss,\n 'voc_dict': voc.__dict__,\n 'embedding': embedding.state_dict()\n }, os.path.join(directory, '{}_{}.tar'.format(iteration, 'checkpoint')))\n\n\ndef evaluate(encoder, decoder, searcher, voc, sentence, max_length=MAX_LENGTH):\n \"\"\"\n\n :param encoder:\n :param decoder:\n :param searcher:\n :param voc:\n :param sentence:\n :param max_length:\n :return:\n \"\"\"\n # Format input sentence as a batch\n # words -> indexes\n indexes_batch = [indexesFromSentence(voc, sentence)]\n # Create lengths tensor\n lengths = torch.tensor([len(indexes) for indexes in indexes_batch])\n # Transpose dimensions of batch to match models' expectations\n input_batch = torch.LongTensor(indexes_batch).transpose(0, 1)\n # Use appropriate device\n input_batch = input_batch.to(device)\n lengths = lengths.to(device)\n # Decode sentence with searcher\n tokens, scores = searcher(input_batch, lengths, max_length)\n # indexes -> words\n decoded_words = [voc.index2word[token.item()] for token in tokens]\n return decoded_words\n\n\ndef evaluateInput(encoder, decoder, searcher, voc):\n \"\"\"\n\n :param encoder:\n :param decoder:\n :param searcher:\n :param voc:\n :return:\n \"\"\"\n input_sentence = ''\n while (1):\n try:\n # Get input sentence\n input_sentence = input('> ')\n # Check if it is quit case\n if input_sentence == 'q' or input_sentence == 'quit': break\n # Normalize sentence\n input_sentence = normalizeString(input_sentence)\n # Evaluate sentence\n output_words = evaluate(encoder, decoder, searcher, voc, input_sentence)\n # Format and print response sentence\n output_words[:] = [x for x in output_words if not (x == 'EOS' or x == 'PAD')]\n print('Bot:', ' '.join(output_words))\n\n except KeyError:\n print(\"Error: Encountered unknown word.\")\n\n", "import re\nimport torch\nimport itertools\nimport unicodedata\nfrom cytoolz import take\n\nfrom .dictionary import Voc, MAX_LENGTH, PAD_token, EOS_token, SOS_token\n\n\ndef printLines(file, n=10):\n \"\"\"\n 打印文件的函数。相当于head命令\n :param file: 要读入的文件\n :param n: 打印的最大长度\n :return:\n \"\"\"\n with open(file, 'rb') as datafile:\n lines = datafile.readlines()\n for line in lines[:n]:\n print(line)\n\n\ndef fileFilter(file, n=10):\n with open(file, 'rb') as datafile:\n lines = datafile.readlines()\n return list(take(n, lines))\n\n\n# Splits each line of the file into a dictionary of fields\ndef loadLines(fileName, fields):\n \"\"\"\n 把文件按照关键字,组成二级字典\n :param fileName: 要处理的文件\n :param fields: 文件中的字典关键字\n :return:\n \"\"\"\n lines = {}\n with open(fileName, 'r', encoding='iso-8859-1') as f:\n for line in f:\n value = line.split(\" +++$+++\")\n # Extract fields\n lineObj = {}\n for i, field in enumerate(fields):\n lineObj[field] = value[i]\n\n lines[lineObj['lineID']] = lineObj\n return lines\n\n\n# Groups fields of lines form readLines into conversations based on movie_conversations.txt\ndef loadConversations(fileName, lines, fields):\n conversations = []\n with open(fileName, 'r', encoding='iso-8859-1') as f:\n for line in f:\n values = line.split(\" +++$+++ \")\n # Extract fields\n convObj = {}\n for i, field in enumerate(fields):\n convObj[field] = values[i]\n lineIds = eval(convObj['utteranceIDs'])\n # Reassemble lines\n convObj[\"lines\"] = []\n for lineId in lineIds:\n convObj[\"lines\"].append(lines[lineId])\n conversations.append(convObj)\n return conversations\n\n\n# Extracts pairs of sentences from conversations\ndef extractSentencePairs(conversations):\n \"\"\"\n 从谈话数据集中提取对话数据列表\n :param conversations: 谈话数据集,\n :return:[(q0,a0),(q1,a1),....,(qn, an)]\n \"\"\"\n qa_pairs = []\n for conversation in conversations:\n # Iterate over all the line of the conversation\n for i in range(len(conversation[\"lines\"]) - 1): #\n inputLine = conversation[\"lines\"][i][\"text\"].strip()\n targetLine = conversation[\"lines\"][i + 1][\"text\"].strip()\n if inputLine and targetLine:\n qa_pairs.append([inputLine, targetLine])\n return qa_pairs\n\n\ndef shave_marks(txt):\n \"\"\"去掉全部变音符号\"\"\"\n norm_txt = unicodedata.normalize('NFD', txt) # 把所有字符分解成基字符和组合记号\n shaved = ''.join(c for c in norm_txt if not unicodedata.combining(c)) # 过滤掉所有组合记号。\n return unicodedata.normalize('NFC', shaved) # 重组所有字符\n\n\n# Turn a Unicode string to plain ASCII, thanks to\n# http://stackoverflow.com/a/518232/2809427\ndef unicodeToAscii(s):\n return ''.join(\n c for c in unicodedata.normalize('NFD', s)\n if unicodedata.category(c) != 'Mn' # Nonspacing_Mark 非间距组合字符\n )\n\n\n# Lowercase, trim, and remove non-letter characters\ndef normalizeString(s):\n \"\"\"\n 标准化字符串, 小写、修剪、字符转换、去非字母\n :param s:\n :return:\n \"\"\"\n s = unicodeToAscii(s.lower().strip())\n s = re.sub(r\"([.!?])\", r\" \\1\", s)\n s = re.sub(r\"[^a-zA-Z.!?]+\", r\" \", s)\n s = re.sub(r\"\\s+\", r\" \", s).strip()\n return s\n\n\n# Read query/response pairs and return a voc object\ndef readVocs(datafile, corpus_name):\n \"\"\"\n 读取datafile的文件,unicode标准化后加入字典\n :param datafile:\n :param corpus_name:\n :return:\n \"\"\"\n print(\"Reading lines...\")\n # Read the file and split into lines\n lines = open(datafile, encoding='utf-8').read().strip().split('\\n')\n # Split every line into pairs and normalize\n pairs = [[normalizeString(s) for s in l.split('\\t')] for l in lines]\n voc = Voc(corpus_name)\n return voc, pairs\n\n\n# Returns True iff both sentences in a pair 'p' are under the MAX_LENGTH threshold\ndef filterPair(p):\n \"\"\"\n 给出一对句子,判断长度小于预定阈值\n :param p:\n :return:\n \"\"\"\n # Input sequences need to preserve the last word for EOS token\n return len(p[0].split(' ')) < MAX_LENGTH and len(p[1].split(' ')) < MAX_LENGTH\n\n\n# Filter pairs using filterPair condition\ndef filterPairs(pairs):\n \"\"\"\n 过滤一篇文章\n :param pairs:\n :return:\n \"\"\"\n return [pair for pair in pairs if filterPair(pair)]\n\n\n# Using the functions defined above, return a populated voc object and pairs list\ndef loadPrepareData(corpus, corpus_name, datafile, save_dir):\n \"\"\"\n\n :param corpus: 语料库目录\n :param corpus_name: 语料库名称\n :param datafile: 整理的文件格式\n :param save_dir:\n :return:\n \"\"\"\n print(\"Start preparing training data ...\")\n voc, pairs = readVocs(datafile, corpus_name)\n print(\"Read {!s} sentence pairs\".format(len(pairs)))\n pairs = filterPairs(pairs)\n print(\"Trimmed to {!s} sentence pairs\".format(len(pairs)))\n print(\"Counting words...\")\n for pair in pairs:\n voc.addSentence(pair[0]) # 源句子\n voc.addSentence(pair[1]) # 目标句子\n print(\"Counted words:\", voc.num_words)\n return voc, pairs\n\n\ndef trimRareWords(voc, pairs, MIN_COUNT):\n \"\"\"\n\n :param voc: 字典\n :param pairs: 整理的token\n :param MIN_COUNT: 裁剪的最小阈值\n :return:\n \"\"\"\n # Trim words used under the MIN_COUNT from the voc\n voc.trim(MIN_COUNT)\n # Filter out pairs with trimmed words\n keep_pairs = []\n for pair in pairs:\n input_sentence = pair[0]\n output_sentence = pair[1]\n keep_input = True\n keep_output = True\n # Check input sentence 单词在不在字典中\n for word in input_sentence.split(' '):\n if word not in voc.word2index:\n keep_input = False\n break\n # Check output sentence\n for word in output_sentence.split(' '):\n if word not in voc.word2index:\n keep_output = False\n break\n\n # Only keep pairs that do not contain trimmed word(s) in their input or output sentence\n if keep_input and keep_output:\n keep_pairs.append(pair)\n\n print(\"Trimmed from {} pairs to {}, {:.4f} of total\".format(len(pairs), len(keep_pairs),\n len(keep_pairs) / len(pairs)))\n return keep_pairs\n\n\ndef indexesFromSentence(voc, sentence):\n \"\"\"\n 将每句话,通过字典,转换成ID\n :param voc: 映射字典\n :param sentence: 句子\n :return:\n \"\"\"\n return [voc.word2index[word] for word in sentence.split(' ')] + [EOS_token]\n\n\ndef zeroPadding(l, fillvalue=PAD_token):\n return list(itertools.zip_longest(*l, fillvalue=fillvalue))\n\n\ndef binaryMatrix(l, value=PAD_token):\n \"\"\"\n 求掩码矩阵\n :param l:\n :param value:\n :return:\n \"\"\"\n m = []\n for i, seq in enumerate(l):\n m.append([])\n for token in seq:\n if token == PAD_token:\n m[i].append(0)\n else:\n m[i].append(1)\n return m\n\n\n# Returns padded input sequence tensor and lengths\ndef inputVar(l, voc):\n \"\"\"\n 5条拍好序的语句,向量化,补齐,求每条语句长度,Tensor\n :param l: 输入语句\n :param voc: 字典\n :return:\n \"\"\"\n indexes_batch = [indexesFromSentence(voc, sentence) for sentence in l]\n lengths = torch.tensor([len(indexes) for indexes in indexes_batch])\n padList = zeroPadding(indexes_batch)\n padVar = torch.LongTensor(padList)\n return padVar, lengths\n\n\n# Returns padded target sequence tensor, padding mask, and max target length\ndef outputVar(l, voc):\n \"\"\"\n 5条排好序的语句,向量化,求最大长度,补齐,求掩码矩阵\n :param l:\n :param voc:\n :return:\n \"\"\"\n indexes_batch = [indexesFromSentence(voc, sentence) for sentence in l]\n max_target_len = max([len(indexes) for indexes in indexes_batch])\n padList = zeroPadding(indexes_batch)\n mask = binaryMatrix(padList)\n mask = torch.ByteTensor(mask)\n padVar = torch.LongTensor(padList)\n return padVar, mask, max_target_len\n\n\n# Returns all items for a given batch of pairs\ndef batch2TrainData(voc, pair_batch):\n \"\"\"\n 批量语句,本题5句, 按照长度排序,分类input和output\n\n :param voc: 修正的字典\n :param pair_batch: 批处理对\n :return:\n \"\"\"\n pair_batch.sort(key=lambda x: len(x[0].split(\" \")), reverse=True)\n input_batch, output_batch = [], []\n for pair in pair_batch:\n input_batch.append(pair[0])\n output_batch.append(pair[1])\n inp, lengths = inputVar(input_batch, voc)\n output, mask, max_target_len = outputVar(output_batch, voc)\n return inp, lengths, output, mask, max_target_len\n", "#!/usr/bin/env python\n# -*- coding: utf-8 -*-\n\n# Copyright 2017 Tomoki Hayashi (Nagoya University)\n# Apache 2.0 (http://www.apache.org/licenses/LICENSE-2.0)\n\nfrom __future__ import division\n\nimport argparse\nimport logging\nimport multiprocessing as mp\nimport os\nimport sys\n\nfrom distutils.util import strtobool\n\nimport numpy as np\n\nfrom scipy.io import wavfile\nfrom sprocket.speech.synthesizer import Synthesizer\n\nfrom feature_extract import low_cut_filter\nfrom utils import find_files\nfrom utils import read_hdf5\nfrom utils import read_txt\n\n\ndef world_noise_shaping(wav_list, args):\n \"\"\"APPLY NOISE SHAPING USING WORLD MCEP\"\"\"\n # define synthesizer\n synthesizer = Synthesizer(\n fs=args.fs,\n shiftms=args.shiftms,\n fftl=args.fftl)\n\n for i, wav_name in enumerate(wav_list):\n logging.info(\"now processing %s (%d/%d)\" % (wav_name, i + 1, len(wav_list)))\n\n # load wavfile and apply low cut filter\n fs, x = wavfile.read(wav_name)\n if x.dtype != np.int16:\n logging.warn(\"wav file format is not 16 bit PCM.\")\n x = np.float64(x)\n\n # check sampling frequency\n if not fs == args.fs:\n logging.error(\"sampling frequency is not matched.\")\n sys.exit(1)\n\n # get frame number\n num_frames = int(1000 * len(x) / fs / args.shiftms) + 1\n\n # load average mcep\n mlsa_coef = read_hdf5(args.stats, \"/world/mean\")\n mlsa_coef = mlsa_coef[args.mcep_dim_start:args.mcep_dim_end] * args.mag\n mlsa_coef[0] = 0.0\n if args.inv:\n mlsa_coef[1:] = -1.0 * mlsa_coef[1:]\n mlsa_coef = np.float64(np.tile(mlsa_coef, [num_frames, 1]))\n\n # synthesis and write\n x_ns = synthesizer.synthesis_diff(\n x, mlsa_coef, alpha=args.mcep_alpha)\n x_ns = low_cut_filter(x_ns, args.fs, cutoff=70)\n write_name = args.writedir + \"/\" + os.path.basename(wav_name)\n wavfile.write(write_name, args.fs, np.int16(x_ns))\n\n\ndef melcepstrum_noise_shaping(wav_list, args):\n \"\"\"APPLY NOISE SHAPING USING STFT-BASED MCEP\"\"\"\n # define synthesizer\n synthesizer = Synthesizer(\n fs=args.fs,\n shiftms=args.shiftms,\n fftl=args.fftl)\n\n for i, wav_name in enumerate(wav_list):\n logging.info(\"now processing %s (%d/%d)\" % (wav_name, i + 1, len(wav_list)))\n\n # load wavfile and apply low cut filter\n fs, x = wavfile.read(wav_name)\n if x.dtype != np.int16:\n logging.warn(\"wav file format is not 16 bit PCM.\")\n x = np.float64(x)\n\n # check sampling frequency\n if not fs == args.fs:\n logging.error(\"sampling frequency is not matched.\")\n sys.exit(1)\n\n # get frame number\n num_frames = int(1000 * len(x) / fs / args.shiftms) + 1\n\n # load average mcep\n mlsa_coef = read_hdf5(args.stats, \"/mcep/mean\") * args.mag\n mlsa_coef[0] = 0.0\n if args.inv:\n mlsa_coef[1:] = -1.0 * mlsa_coef[1:]\n mlsa_coef = np.float64(np.tile(mlsa_coef, [num_frames, 1]))\n\n # synthesis and write\n x_ns = synthesizer.synthesis_diff(\n x, mlsa_coef, alpha=args.mcep_alpha)\n x_ns = low_cut_filter(x_ns, args.fs, cutoff=70)\n write_name = args.writedir + \"/\" + os.path.basename(wav_name)\n wavfile.write(write_name, args.fs, np.int16(x_ns))\n\n\ndef main():\n parser = argparse.ArgumentParser(\n description=\"making feature file argsurations.\")\n\n parser.add_argument(\n \"--waveforms\", default=None,\n help=\"directory or list of filename of input wavfile\")\n parser.add_argument(\n \"--stats\", default=None,\n help=\"filename of hdf5 format\")\n parser.add_argument(\n \"--writedir\", default=None,\n help=\"directory to save preprocessed wav file\")\n parser.add_argument(\n \"--fs\", default=16000,\n type=int, help=\"Sampling frequency\")\n parser.add_argument(\n \"--shiftms\", default=5,\n type=float, help=\"Frame shift in msec\")\n parser.add_argument(\n \"--fftl\", default=1024,\n type=int, help=\"FFT length\")\n parser.add_argument(\n \"--feature_type\", default=\"world\", choices=[\"world\", \"mcep\", \"melspc\"],\n type=str, help=\"feature type\")\n parser.add_argument(\n \"--mcep_dim_start\", default=2,\n type=int, help=\"Start index of mel cepstrum\")\n parser.add_argument(\n \"--mcep_dim_end\", default=27,\n type=int, help=\"End index of mel cepstrum\")\n parser.add_argument(\n \"--mcep_alpha\", default=0.41,\n type=float, help=\"Alpha of mel cepstrum\")\n parser.add_argument(\n \"--mag\", default=0.5,\n type=float, help=\"magnification of noise shaping\")\n parser.add_argument(\n \"--verbose\", default=1,\n type=int, help=\"log message level\")\n parser.add_argument(\n '--n_jobs', default=10,\n type=int, help=\"number of parallel jobs\")\n parser.add_argument(\n '--inv', default=False, type=strtobool,\n help=\"if True, inverse filtering will be performed\")\n\n args = parser.parse_args()\n\n # set log level\n if args.verbose == 1:\n logging.basicConfig(level=logging.INFO,\n format='%(asctime)s (%(module)s:%(lineno)d) %(levelname)s: %(message)s',\n datefmt='%m/%d/%Y %I:%M:%S')\n elif args.verbose > 1:\n logging.basicConfig(level=logging.DEBUG,\n format='%(asctime)s (%(module)s:%(lineno)d) %(levelname)s: %(message)s',\n datefmt='%m/%d/%Y %I:%M:%S')\n else:\n logging.basicConfig(level=logging.WARN,\n format='%(asctime)s (%(module)s:%(lineno)d) %(levelname)s: %(message)s',\n datefmt='%m/%d/%Y %I:%M:%S')\n logging.warn(\"logging is disabled.\")\n\n # show argmument\n for key, value in vars(args).items():\n logging.info(\"%s = %s\" % (key, str(value)))\n\n # read list\n if os.path.isdir(args.waveforms):\n file_list = sorted(find_files(args.waveforms, \"*.wav\"))\n else:\n file_list = read_txt(args.waveforms)\n logging.info(\"number of utterances = %d\" % len(file_list))\n\n # check directory existence\n if not os.path.exists(args.writedir):\n os.makedirs(args.writedir)\n\n # divie list\n file_lists = np.array_split(file_list, args.n_jobs)\n file_lists = [f_list.tolist() for f_list in file_lists]\n\n # multi processing\n processes = []\n if args.feature_type == \"world\":\n target_fn = world_noise_shaping\n elif args.feature_type == \"mcep\":\n target_fn = melcepstrum_noise_shaping\n else:\n # TODO(kan-bayashi): implement noise shaping using melspectrogram\n NotImplementedError(\"currently, support only world and mcep.\")\n for f in file_lists:\n p = mp.Process(target=target_fn, args=(f, args,))\n p.start()\n processes.append(p)\n\n # wait for all process\n for p in processes:\n p.join()\n\n\nif __name__ == \"__main__\":\n main()\n", "import xgboost as xgb\nfrom sklearn import naive_bayes\n\n\ndef runXGB(train_X, train_y, test_X, test_y=None, test_X2=None, seed_val=0, child=1, colsample=0.3):\n param = {}\n param['objective'] = 'multi:softprob'\n param['eta'] = 0.1\n param['max_depth'] = 3\n param['silent'] = 1\n param['num_class'] = 3\n param['eval_metric'] = \"mlogloss\"\n param['min_child_weight'] = child\n param['subsample'] = 0.8\n param['colsample_bytree'] = colsample\n param['seed'] = seed_val\n num_rounds = 2000\n\n plst = list(param.items())\n xgtrain = xgb.DMatrix(train_X, label=train_y)\n\n if test_y is not None:\n xgtest = xgb.DMatrix(test_X, label=test_y)\n watchlist = [ (xgtrain,'trainer'), (xgtest, 'test') ]\n model = xgb.train(plst, xgtrain, num_rounds, watchlist, early_stopping_rounds=50, verbose_eval=20)\n else:\n xgtest = xgb.DMatrix(test_X)\n model = xgb.train(plst, xgtrain, num_rounds)\n\n pred_test_y = model.predict(xgtest, ntree_limit = model.best_ntree_limit)\n if test_X2 is not None:\n xgtest2 = xgb.DMatrix(test_X2)\n pred_test_y2 = model.predict(xgtest2, ntree_limit = model.best_ntree_limit)\n return pred_test_y, pred_test_y2, model\n\n\ndef runXGB(train_X, train_y, test_X, test_y=None, feature_names=None, seed_val=0, num_rounds=1000):\n param = {}\n param['objective'] = 'multi:softprob'\n param['eta'] = 0.1\n param['max_depth'] = 6\n param['silent'] = 1\n param['num_class'] = 3\n param['eval_metric'] = \"mlogloss\"\n param['min_child_weight'] = 1\n param['subsample'] = 0.7\n param['colsample_bytree'] = 0.7\n param['seed'] = seed_val\n num_rounds = num_rounds\n\n plst = list(param.items())\n xgtrain = xgb.DMatrix(train_X, label=train_y)\n\n if test_y is not None:\n xgtest = xgb.DMatrix(test_X, label=test_y)\n watchlist = [ (xgtrain,'trainer'), (xgtest, 'test') ]\n model = xgb.train(plst, xgtrain, num_rounds, watchlist, early_stopping_rounds=20)\n else:\n xgtest = xgb.DMatrix(test_X)\n model = xgb.train(plst, xgtrain, num_rounds)\n\n pred_test_y = model.predict(xgtest)\n return pred_test_y, model\n\n\ndef runMNB(train_X, train_y, test_X, test_y, test_X2):\n model = naive_bayes.MultinomialNB()\n model.fit(train_X, train_y)\n pred_test_y = model.predict_proba(test_X)\n pred_test_y2 = model.predict_proba(test_X2)\n return pred_test_y, pred_test_y2, model", "import torch\nfrom torch import nn\nfrom torch.nn import init\nfrom torch.nn import functional as F\n\nimport sys\nsys.path.append(\"../../..\")\nfrom library.text.modules.base.rnn import MultiLayerLSTMCells\nfrom library.text.modules.base.extract import LSTMPointerNet\n\n\nINI = 1e-2\n\n\n# FIXME eccessing 'private members' of pointer net module is bad\nclass PtrExtractorRL(nn.Module):\n \"\"\" works only on single sample in RL setting\"\"\"\n def __init__(self, ptr_net):\n \"\"\"\n\n :param ptr_net:\n \"\"\"\n super().__init__()\n assert isinstance(ptr_net, LSTMPointerNet)\n self._init_h = nn.Parameter(ptr_net._init_h.clone())\n self._init_c = nn.Parameter(ptr_net._init_c.clone())\n self._init_i = nn.Parameter(ptr_net._init_i.clone())\n self._lstm_cell = MultiLayerLSTMCells.convert(ptr_net._lstm)\n\n # attention parameters\n self._attn_wm = nn.Parameter(ptr_net._attn_wm.clone())\n self._attn_wq = nn.Parameter(ptr_net._attn_wq.clone())\n self._attn_v = nn.Parameter(ptr_net._attn_v.clone())\n\n # hop parameters\n self._hop_wm = nn.Parameter(ptr_net._hop_wm.clone())\n self._hop_wq = nn.Parameter(ptr_net._hop_wq.clone())\n self._hop_v = nn.Parameter(ptr_net._hop_v.clone())\n self._n_hop = ptr_net._n_hop\n\n def forward(self, attn_mem, n_step):\n \"\"\"\n\n :param attn_mem:\n :param n_step:\n :return:\n \"\"\"\n \"\"\"atten_mem: Tensor of size [num_sents, input_dim]\"\"\"\n attn_feat = torch.mm(attn_mem, self._attn_wm)\n hop_feat = torch.mm(attn_mem, self._hop_wm)\n outputs = []\n lstm_in = self._init_i.unsqueeze(0)\n lstm_states = (self._init_h.unsqueeze(1), self._init_c.unsqueeze(1))\n for _ in range(n_step):\n h, c = self._lstm_cell(lstm_in, lstm_states)\n query = h[:, -1, :]\n for _ in range(self._n_hop):\n query = PtrExtractorRL.attention(hop_feat, query,\n self._hop_v, self._hop_wq)\n score = PtrExtractorRL.attention_score(\n attn_feat, query, self._attn_v, self._attn_wq)\n if self.training:\n prob = F.softmax(score, dim=-1)\n out = torch.distributions.Categorical(prob)\n else:\n for o in outputs:\n score[0, o[0, 0].item()][0] = -1e18\n out = score.max(dim=1, keepdim=True)[1]\n outputs.append(out)\n lstm_in = attn_mem[out[0, 0].item()].unsqueeze(0)\n lstm_states = (h, c)\n return outputs\n\n @staticmethod\n def attention_score(attention, query, v, w):\n \"\"\" unnormalized attention score\"\"\"\n sum_ = attention + torch.mm(query, w)\n score = torch.mm(torch.tanh(sum_), v.unsqueeze(1)).t()\n return score\n\n @staticmethod\n def attention(attention, query, v, w):\n \"\"\" attention context vector\"\"\"\n score = F.softmax(\n PtrExtractorRL.attention_score(attention, query, v, w), dim=-1)\n output = torch.mm(score, attention)\n return output\n\n\nclass PtrExtractorRLStop(PtrExtractorRL):\n def __init__(self, *args, **kwargs):\n \"\"\"\n\n :param args:\n :param kwargs:\n \"\"\"\n super().__init__(*args, **kwargs)\n if args:\n ptr_net = args[0]\n else:\n ptr_net = kwargs['ptr_net']\n assert isinstance(ptr_net, LSTMPointerNet)\n self._stop = nn.Parameter(\n torch.Tensor(self._lstm_cell.input_size))\n init.uniform_(self._stop, -INI, INI)\n\n def forward(self, attn_mem, n_ext=None):\n \"\"\"atten_mem: Tensor of size [num_sents, input_dim]\"\"\"\n if n_ext is not None:\n return super().forward(attn_mem, n_ext)\n max_step = attn_mem.size(0)\n attn_mem = torch.cat([attn_mem, self._stop.unsqueeze(0)], dim=0)\n attn_feat = torch.mm(attn_mem, self._attn_wm)\n hop_feat = torch.mm(attn_mem, self._hop_wm)\n outputs = []\n dists = []\n lstm_in = self._init_i.unsqueeze(0)\n lstm_states = (self._init_h.unsqueeze(1), self._init_c.unsqueeze(1))\n while True:\n h, c = self._lstm_cell(lstm_in, lstm_states)\n query = h[:, -1, :]\n for _ in range(self._n_hop):\n query = PtrExtractorRL.attention(hop_feat, query,\n self._hop_v, self._hop_wq)\n score = PtrExtractorRL.attention_score(\n attn_feat, query, self._attn_v, self._attn_wq)\n for o in outputs:\n score[0, o.item()] = -1e18\n if self.training:\n prob = F.softmax(score, dim=-1)\n m = torch.distributions.Categorical(prob)\n dists.append(m)\n out = m.sample()\n else:\n out = score.max(dim=1, keepdim=True)[1]\n outputs.append(out)\n if out.item() == max_step:\n break\n lstm_in = attn_mem[out.item()].unsqueeze(0)\n lstm_states = (h, c)\n if dists:\n # return distributions only when not empty (trining)\n return outputs, dists\n else:\n return outputs\n\n\nclass PtrScorer(nn.Module):\n \"\"\" to be used as critic (predicts a scalar baseline reward)\"\"\"\n def __init__(self, ptr_net):\n \"\"\"\n\n :param ptr_net:\n \"\"\"\n super().__init__()\n assert isinstance(ptr_net, LSTMPointerNet)\n self._init_h = nn.Parameter(ptr_net._init_h.clone())\n self._init_c = nn.Parameter(ptr_net._init_c.clone())\n self._init_i = nn.Parameter(ptr_net._init_i.clone())\n self._lstm_cell = MultiLayerLSTMCells.convert(ptr_net._lstm)\n\n # attention parameters\n self._attn_wm = nn.Parameter(ptr_net._attn_wm.clone())\n self._attn_wq = nn.Parameter(ptr_net._attn_wq.clone())\n self._attn_v = nn.Parameter(ptr_net._attn_v.clone())\n\n # hop parameters\n self._hop_wm = nn.Parameter(ptr_net._hop_wm.clone())\n self._hop_wq = nn.Parameter(ptr_net._hop_wq.clone())\n self._hop_v = nn.Parameter(ptr_net._hop_v.clone())\n self._n_hop = ptr_net._n_hop\n\n # regression layer\n self._score_linear = nn.Linear(self._lstm_cell.input_size, 1)\n\n def forward(self, attn_mem, n_step):\n \"\"\"atten_mem: Tensor of size [num_sents, input_dim]\"\"\"\n attn_feat = torch.mm(attn_mem, self._attn_wm)\n hop_feat = torch.mm(attn_mem, self._hop_wm)\n scores = []\n lstm_in = self._init_i.unsqueeze(0)\n lstm_states = (self._init_h.unsqueeze(1), self._init_c.unsqueeze(1))\n for _ in range(n_step):\n h, c = self._lstm_cell(lstm_in, lstm_states)\n query = h[:, -1, :]\n for _ in range(self._n_hop):\n query = PtrScorer.attention(hop_feat, hop_feat, query,\n self._hop_v, self._hop_wq)\n output = PtrScorer.attention(\n attn_mem, attn_feat, query, self._attn_v, self._attn_wq)\n score = self._score_linear(output)\n scores.append(score)\n lstm_in = output\n return scores\n\n @staticmethod\n def attention(attention, attention_feat, query, v, w):\n \"\"\" attention context vector\"\"\"\n sum_ = attention_feat + torch.mm(query, w)\n score = F.softmax(torch.mm(torch.tanh(sum_), v.unsqueeze(1)).t(), dim=-1)\n output = torch.mm(score, attention)\n return output\n\n\nclass ActorCritic(nn.Module):\n \"\"\" shared encoder between actor/critic\"\"\"\n def __init__(self, sent_encoder, art_encoder,\n extractor, art_batcher):\n \"\"\"\n\n :param sent_encoder:\n :param art_encoder:\n :param extractor:\n :param art_batcher:\n \"\"\"\n super().__init__()\n self._sent_enc = sent_encoder\n self._art_enc = art_encoder\n self._ext = PtrExtractorRLStop(extractor)\n self._scr = PtrScorer(extractor)\n self._batcher = art_batcher\n\n def forward(self, raw_article_sents, n_abs=None):\n article_sent = self._batcher(raw_article_sents)\n enc_sent = self._sent_enc(article_sent).unsqueeze(0)\n enc_art = self._art_enc(enc_sent).squeeze(0)\n if n_abs is not None and not self.training:\n n_abs = min(len(raw_article_sents), n_abs)\n if n_abs is None:\n outputs = self._ext(enc_art)\n else:\n outputs = self._ext(enc_art, n_abs)\n if self.training:\n if n_abs is None:\n n_abs = len(outputs[0])\n scores = self._scr(enc_art, n_abs)\n return outputs, scores\n else:\n return outputs\n" ]
[ [ "torch.tensor", "numpy.arange", "torch.no_grad", "torch.zeros" ], [ "torch.device", "torch.LongTensor", "torch.cuda.is_available" ], [ "torch.ByteTensor", "torch.LongTensor" ], [ "numpy.tile", "numpy.int16", "numpy.float64", "numpy.array_split", "scipy.io.wavfile.read" ], [ "sklearn.naive_bayes.MultinomialNB" ], [ "torch.nn.init.uniform_", "torch.mm", "torch.nn.functional.softmax", "torch.Tensor", "torch.tanh", "torch.nn.Linear", "torch.distributions.Categorical" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [ "1.7", "1.0", "0.10", "1.2", "0.14", "0.19", "1.5", "0.12", "0.17", "0.13", "1.6", "1.4", "1.9", "1.3", "1.10", "0.15", "0.18", "0.16", "1.8" ], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
pedronarloch/jMetalPy_phD
[ "c16a31a65c23a203d439f33a4d99668982e7c25b", "c16a31a65c23a203d439f33a4d99668982e7c25b" ]
[ "jmetal/problem/singleobjective/CEC2013LSGO.py", "jmetal/algorithm/singleobjective/shade.py" ]
[ "from cec2013lsgo.cec2013 import Benchmark\nimport numpy as np\nfrom jmetal.core.problem import FloatProblem, S\n\n\nclass CEC2013LSGO(FloatProblem):\n\n def __init__(self, function_type: int = 0, number_of_variables: int = 1000):\n\n super(CEC2013LSGO, self).__init__()\n self.number_of_objectives = 1\n self.number_of_constraints = 0\n self.number_of_variables = number_of_variables\n\n self.obj_directions = [self.MINIMIZE]\n self.obj_labels = ['Fitness']\n\n self.function_type = function_type\n\n self.benchmark = Benchmark()\n\n info = self.benchmark.get_info(self.function_type)\n self.lower_bound = [info['lower'] for _ in range(self.number_of_variables)]\n self.upper_bound = [info['upper'] for _ in range(self.number_of_variables)]\n self.evaluator = self.benchmark.get_function(self.function_type)\n\n def evaluate(self, solution: S) -> S:\n sol = np.array(solution.variables)\n solution.objectives[0] = self.evaluator(sol)\n\n return solution\n\n def get_name(self) -> str:\n return \"CEC_2013LSGO_F\"+str(self.function_type)\n", "import copy\nimport time\nfrom typing import TypeVar, List\n\nimport numpy as np\nfrom jmetal.algorithm.adaptive.adaptive import DiversityBasedMechanismAdaptation\nfrom jmetal.algorithm.singleobjective.differential_evolution import DifferentialEvolution\nfrom jmetal.config import store\nfrom jmetal.core.problem import Problem\nfrom jmetal.operator.boundary_correction import JadeCorrection\nfrom jmetal.operator.crossover import DifferentialEvolutionCurrentCrossover\nfrom jmetal.operator.selection import PBestSelectionWithoutArchive, PBestSelectionWithArchive\nfrom jmetal.util.solutions.evaluator import Evaluator, GenericNoveltyEvaluator\nfrom jmetal.util.solutions.generator import Generator\nfrom jmetal.util.termination_criterion import TerminationCriterion\nfrom jmetal.algorithm.local_search import hooke_jeeves\nfrom jmetal.util.problem_wrapper import FloatProblemWrapper\n\nimport random\n\nS = TypeVar('S')\nR = TypeVar('R')\n\n\nclass SHADE(DifferentialEvolution):\n\n def __init__(self, problem: Problem[S], population_size: int,\n termination_criterion: TerminationCriterion = store.default_termination_criteria,\n population_generator: Generator = store.default_generator,\n population_evaluator: Evaluator = store.default_evaluator,\n H: int = 100,\n use_archive: bool = False):\n\n super().__init__(problem, population_size, termination_criterion,\n population_generator, population_evaluator)\n\n self.use_archive = use_archive\n if self.use_archive:\n self.selection_operator = PBestSelectionWithArchive()\n else:\n self.selection_operator = PBestSelectionWithoutArchive()\n self.crossover_operator = DifferentialEvolutionCurrentCrossover(0.9, 0.5, 0.5)\n self.crossover_operator.boundary_correction = JadeCorrection()\n\n self.H = H\n self.MemF = np.ones(self.H) * .5\n self.MemCR = np.ones(self.H) * .5\n self.CR = np.zeros(self.population_size)\n self.F = np.zeros(self.population_size)\n self.K = 0\n self.solution_archive = []\n\n def init_progress(self) -> None:\n super().init_progress()\n\n self.MemF = np.ones(self.H) * .5\n self.MemCR = np.ones(self.H) * .5\n self.CR = np.zeros(self.population_size)\n self.F = np.zeros(self.population_size)\n self.K = 0\n self.solution_archive = []\n\n def update_parameters(self, SCR, SF, improvements: List):\n total = np.sum(improvements)\n assert total > 0\n weights = improvements / total\n\n new_F = np.sum(weights * SF * SF) / np.sum(weights * SF)\n new_F = np.clip(new_F, 0, 1)\n new_CR = np.sum(weights * SCR)\n new_CR = np.clip(new_CR, 0, 1)\n\n self.MemF[self.K] = new_F\n self.MemCR[self.K] = new_CR\n\n self.K = (self.K + 1) % self.H\n\n def selection(self, population: List[S]) -> np.ndarray:\n mating_pool = np.empty(len(population), dtype=np.ndarray)\n\n for i in range(self.population_size):\n if self.use_archive:\n self.selection_operator.set_index_to_exclude(i)\n selected_solutions = self.selection_operator.execute([self.solutions, self.solution_archive])\n else:\n self.selection_operator.set_index_to_exclude(i)\n selected_solutions = self.selection_operator.execute([self.solutions, []])\n\n mating_pool[i] = selected_solutions\n\n return mating_pool\n\n def reproduction(self, mating_pool: np.ndarray) -> List[S]:\n offspring_population = []\n\n for i, solution in enumerate(self.solutions):\n index_H = np.random.randint(0, self.H)\n meanF = self.MemF[index_H]\n meanCR = self.MemCR[index_H]\n\n Fi = np.random.normal(meanF, 0.1)\n CRi = np.random.normal(meanCR, 0.1)\n\n self.crossover_operator.current_individual = solution\n self.crossover_operator.CR = CRi\n self.crossover_operator.F = Fi\n\n self.CR[i] = self.crossover_operator.CR\n self.F[i] = self.crossover_operator.F\n\n parents = mating_pool[i]\n trial = self.crossover_operator.execute(parents)\n trial.attributes['CR'] = self.crossover_operator.CR\n trial.attributes['F'] = self.crossover_operator.F\n trial.attributes['parent_idx'] = i\n offspring_population.append(trial)\n\n return offspring_population\n\n def replacement(self, population: List[S], offspring_population: List[S]) -> List[S]:\n final_offspring = []\n SCR = []\n SF = []\n parameter_weights = []\n\n for i, (parent, trial) in enumerate(zip(self.solutions, offspring_population)):\n if trial.objectives[0] < parent.objectives[0]:\n final_offspring.append(trial)\n SCR.append(self.CR[i])\n SF.append(self.F[i])\n parameter_weights.append(parent.objectives[0] - trial.objectives[0])\n\n if self.use_archive:\n self.update_archive(parent)\n else:\n final_offspring.append(parent)\n\n if len(SCR) > 0 and len(SF) > 0:\n self.update_parameters(SCR=SCR, SF=SF, improvements=parameter_weights)\n\n return final_offspring\n\n def update_archive(self, solution: S):\n\n if len(self.solution_archive) < self.population_size:\n self.solution_archive.append(copy.deepcopy(solution))\n else:\n random_replacement = np.random.randint(0, self.population_size)\n self.solution_archive[random_replacement] = copy.deepcopy(solution)\n\n def get_name(self) -> str:\n return 'SHADE'\n\n def get_observable_data(self) -> dict:\n return {'PROBLEM': self.problem,\n 'EVALUATIONS': self.evaluations,\n 'SOLUTIONS': self.solutions,\n 'COMPUTING_TIME': time.time() - self.start_computing_time}\n\n\nclass DiversitySHADE(SHADE, DiversityBasedMechanismAdaptation):\n\n def __init__(self, problem: Problem[S], population_size: int,\n termination_criterion: TerminationCriterion = store.default_termination_criteria,\n population_generator: Generator = store.default_generator,\n population_evaluator: Evaluator = store.default_evaluator,\n H: int = 100,\n use_archive: bool = False):\n super(DiversitySHADE, self).__init__(problem=problem, population_size=population_size,\n termination_criterion=termination_criterion,\n population_generator=population_generator,\n population_evaluator=population_evaluator,\n H=H,\n use_archive=use_archive)\n\n DiversityBasedMechanismAdaptation.__init__(self, termination_criterion.get_criterion())\n\n # Criar diversidade populacional através da probabilidade. No caso do PSP essa diversidade deve ser gerada através\n # da classe de problema usando fragmentos.\n def diversification_step(self):\n self.diversification_count += 1\n # self.problem.generate_diversity(None)\n\n amount_ind = int((25 / 100) * self.population_size)\n\n worst_solutions = np.argsort([_.objectives[0] for _ in self.solutions])[-amount_ind:]\n\n for replacement_idx in worst_solutions:\n self.solutions[replacement_idx] = self.problem.generate_diversity(self.solutions[replacement_idx])\n\n self.evaluate(np.take(self.solutions, worst_solutions))\n\n # Do Nothing\n def intensification_step(self):\n pass\n\n def init_progress(self) -> None:\n super().init_progress()\n super().init_adaptation_progress()\n super().update(self.evaluations, self.solutions, self.problem.number_of_variables)\n self.diversification_count = 0\n\n def update_progress(self) -> None:\n super().update_progress()\n self.update(self.evaluations, self.solutions, self.problem.number_of_variables)\n\n probabilities = [self.diversification_prob, self.intensification_prob, self.do_nothing_prob]\n result = np.random.choice(3, p=probabilities)\n # _r = random.random()\n\n # if _r <= self.diversification_prob:\n if result == 0:\n # if result == 0:\n self.diversification_step()\n observable_data = self.get_observable_data()\n self.observable.notify_all(**observable_data)\n self.update(self.evaluations, self.solutions, self.problem.number_of_variables)\n # elif self.diversification_prob < _r <= self.intensification_prob:\n elif result == 1:\n self.intensification_step()\n\n\nclass MemeticSHADE(DiversitySHADE):\n\n def __init__(self, problem: Problem[S], population_size: int,\n termination_criterion: TerminationCriterion = store.default_termination_criteria,\n population_generator: Generator = store.default_generator,\n population_evaluator: Evaluator = store.default_evaluator,\n H: int = 100,\n use_archive: bool = False):\n super(DiversitySHADE, self).__init__(problem=problem, population_size=population_size,\n termination_criterion=termination_criterion,\n population_generator=population_generator,\n population_evaluator=population_evaluator,\n H=H,\n use_archive=use_archive)\n\n DiversityBasedMechanismAdaptation.__init__(self, termination_criterion.get_criterion())\n\n def diversification_step(self):\n pass\n\n def intensification_step(self):\n wrapper = FloatProblemWrapper(self.problem)\n\n rho = 0.5\n eps = 1.0E-06\n nvars = self.problem.number_of_variables\n\n #best_idx = np.argsort([_.objectives[0] for _ in self.solutions])[0]\n\n pmin = 2.0 / len(self.solutions)\n p = np.random.rand() * (0.2 - pmin) + pmin\n max_best = int(p * len(self.solutions))\n best_solutions = np.argsort([_.objectives[0] for _ in self.solutions])[:max_best]\n\n pbest = np.random.choice(best_solutions)\n\n xbest = self.solutions[pbest]\n\n iters, endpt, fbefore, funevals = hooke_jeeves.hooke(nvars,\n xbest.variables,\n rho, eps, 500, wrapper.evaluate)\n print('')\n print(' Number of iterations taken = %d' % iters)\n value = wrapper.evaluate(endpt, nvars)\n\n self.solutions[pbest].variables = endpt\n self.solutions[pbest].objectives[0] = value\n\n print('')\n print(' F(X*) = %g' % value)\n self.evaluations += funevals\n self.intensification_count += 1\n\n\nclass NoveltySHADE(SHADE):\n\n def __init__(self, problem: Problem[S], population_size: int,\n termination_criterion: TerminationCriterion = store.default_termination_criteria,\n population_generator: Generator = store.default_generator,\n population_evaluator: Evaluator = store.default_evaluator,\n H: int = 100, use_archive: bool = False,\n novelty_evaluator: GenericNoveltyEvaluator = store.default_novelty):\n super().__init__(problem, population_size, termination_criterion, population_generator, population_evaluator, H,\n use_archive)\n\n self.novelty_evaluator = novelty_evaluator\n self.novelty_threshold = 50\n self.k = 0\n\n def evaluate(self, solution_list: List[S]) -> List[S]:\n super().evaluate(solution_list)\n\n self.novelty_evaluator.k = self.k\n self.novelty_evaluator.evaluate(solution_list, self.solutions + self.solution_archive)\n\n return solution_list\n\n def replacement(self, population: List[S], offspring_population: List[S]) -> List[S]:\n final_offspring = []\n SCR = []\n SF = []\n parameter_weights = []\n\n for i, (parent, trial) in enumerate(zip(self.solutions, offspring_population)):\n if trial.objectives[0] < parent.objectives[0]:\n final_offspring.append(trial)\n SCR.append(self.CR[i])\n SF.append(self.F[i])\n parameter_weights.append(parent.objectives[0] - trial.objectives[0])\n\n if trial.objectives[1] >= self.novelty_threshold:\n self.update_archive(parent)\n else:\n final_offspring.append(parent)\n if trial.objectives[1] >= self.novelty_threshold:\n self.update_archive(trial)\n\n if len(SCR) > 0 and len(SF) > 0:\n self.update_parameters(SCR=SCR, SF=SF, improvements=parameter_weights)\n\n return final_offspring\n\n def get_name(self) -> str:\n return 'N-SHADE'\n\n\nclass NoveltySHADE_v2(NoveltySHADE):\n\n def __init__(self, problem: Problem[S], population_size: int,\n termination_criterion: TerminationCriterion = store.default_termination_criteria,\n population_generator: Generator = store.default_generator,\n population_evaluator: Evaluator = store.default_evaluator, H: int = 100, use_archive: bool = False,\n novelty_pool_size: int = 25, novelty_evaluator: GenericNoveltyEvaluator = store.default_novelty):\n\n super().__init__(problem, population_size,\n termination_criterion,\n population_generator,\n population_evaluator, H,\n use_archive, novelty_evaluator)\n\n self.novelty_pool_size = novelty_pool_size\n\n def replacement(self, population: List[S], offspring_population: List[S]) -> List[S]:\n final_offspring = []\n novelty_pool = []\n SCR = []\n SF = []\n parameter_weights = []\n\n for i, (parent, trial) in enumerate(zip(self.solutions, offspring_population)):\n if trial.objectives[0] < parent.objectives[0]:\n final_offspring.append(trial)\n SCR.append(self.CR[i])\n SF.append(self.F[i])\n parameter_weights.append(parent.objectives[0] - trial.objectives[0])\n self.update_archive(parent)\n else:\n final_offspring.append(parent)\n if trial.objectives[1] >= self.novelty_threshold:\n novelty_pool.append(trial)\n\n if len(SCR) > 0 and len(SF) > 0:\n self.update_parameters(SCR=SCR, SF=SF, improvements=parameter_weights)\n\n additional = 0\n\n if self.novelty_pool_size > len(novelty_pool):\n additional = self.novelty_pool_size - len(novelty_pool)\n\n i_fitness_solutions = self.population_size - self.novelty_pool_size + additional\n\n fitness_solutions_idx = np.argsort([_.objectives[0] for _ in final_offspring])[:i_fitness_solutions]\n novelty_solutions_idx = np.argsort([-_.objectives[1] for _ in novelty_pool])[:self.novelty_pool_size]\n\n fitness_solutions = np.take(final_offspring, fitness_solutions_idx)\n novelty_solutions = np.take(novelty_pool, novelty_solutions_idx)\n\n fitness_novel_solutions = np.concatenate((fitness_solutions, novelty_solutions))\n\n return fitness_novel_solutions.tolist()\n\n def get_name(self) -> str:\n return 'N-SHADE-v2'\n\n\nclass NoveltySHADEv3(NoveltySHADE_v2):\n\n def __init__(self, problem: Problem[S], population_size: int,\n termination_criterion: TerminationCriterion = store.default_termination_criteria,\n population_generator: Generator = store.default_generator,\n population_evaluator: Evaluator = store.default_evaluator, H: int = 100, use_archive: bool = False,\n novelty_pool_size: int = 25, novelty_evaluator: GenericNoveltyEvaluator = store.default_novelty):\n super().__init__(problem, population_size, termination_criterion, population_generator, population_evaluator, H,\n use_archive, novelty_pool_size, novelty_evaluator)\n\n self.inital_novelty_treshold = self.novelty_threshold\n self.min_novelty = 5\n\n def replacement(self, population: List[S], offspring_population: List[S]) -> List[S]:\n fitness_novel_solutions = super().replacement(population, offspring_population)\n self.update_novelty_value()\n\n return fitness_novel_solutions\n\n def update_novelty_value(self):\n new_threshold = ((self.min_novelty - self.inital_novelty_treshold) / self.termination_criterion.get_criterion())\n new_threshold = (new_threshold * self.evaluations) + self.inital_novelty_treshold\n\n self.novelty_threshold = new_threshold\n\n def get_name(self) -> str:\n return \"N-SHADE-v3\"\n" ]
[ [ "numpy.array" ], [ "numpy.take", "numpy.random.choice", "numpy.clip", "numpy.ones", "numpy.concatenate", "numpy.random.normal", "numpy.random.rand", "numpy.argsort", "numpy.zeros", "numpy.sum", "numpy.random.randint" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
ahmedshahin9/melanoma.1.0
[ "db6e458ae7376993c0d3fccfe56b7e88b6f936f0" ]
[ "batches.py" ]
[ "import os\nfrom scipy import misc\nimport numpy as np\nimport matplotlib.pyplot as plt\nfrom skimage.util import img_as_bool\n\n# this script creates batches from the dataset\n# batch size: 224 * 224 * 3\n# we save the batch and its ground truth in two separate folders \"batches\" , \"batches_ground\n\n\npath = \"/home/ahmed/melanoma/ISBI2016_ISIC_Part1_Training_Data\"\nlisting = sorted(os.listdir(path))\nk = 0\nj = 0\ny = []\nwhile (k < 900):\n cur_img_id = np.random.randint(0,900 - k)\n cur_img = listing[cur_img_id]\n x_img = misc.imread(path + \"/\" + cur_img)\n y_img = img_as_bool(misc.imread(path.replace(\"ISBI2016_ISIC_Part1_Training_Data\",\"ISBI2016_ISIC_Part1_Training_GroundTruth\") + \"/\" + cur_img.replace(\".jpg\",\"_Segmentation.png\")))\n # now we have chosen an image\n # get fore and back vectors for the image\n\n fore_idx = np.where(y_img == True)\n back_idx = np.where(y_img == False)\n # in the fore, pick 55 random elements\n i_f = 0\n i_b = 0\n a0 = fore_idx[0]\n a1 = fore_idx[1]\n b0 = back_idx[0]\n b1 = back_idx[1]\n \n while ((i_f < 55) and (len(a0) > 0)):\n k_fore = np.random.randint(0,len(a0))\n x_f = a0[k_fore]\n y_f = a1[k_fore]\n if (x_f >= 112) and (y_f >= 112) and (x_f+112 < y_img.shape[0]) and (y_f+112 < y_img.shape[1]):\n misc.imsave('/home/ahmed/melanoma/batches/{2}_fore_{0}_batch_{1}.jpg'.format(cur_img.replace(\".jpg\",\"\").replace(\"ISIC_\",\"\"),i_f, j),x_img[x_f-112: x_f+112, y_f-112:y_f+112,:])\n misc.imsave('/home/ahmed/melanoma/batches_ground/{2}_fore_{0}_batch_{1}_mask.jpg'.format(cur_img.replace(\".jpg\",\"\").replace(\"ISIC_\",\"\"),i_f,j),y_img[x_f-112: x_f+112, y_f-112:y_f+112])\n u = x_img[x_f-112: x_f+112, y_f-112:y_f+112,:]\n if (u.shape[0] != 224) or (u.shape[1] != 224):\n print(\"ERROR\")\n i_f += 1\n j += 1\n y.append(1)\n\n a0 = np.delete(a0,k_fore)\n a1 = np.delete(a1,k_fore)\n# print(len(a0))\n\n # the same thing with the back\n while ((i_b < 55) and (len(b0) > 0)):\n k_back = np.random.randint(0,len(b0))\n x_b = b0[k_back]\n y_b = b1[k_back]\n if (x_b >= 112) and (y_b >= 112) and (x_b+112 < y_img.shape[0]) and (y_b+112 < y_img.shape[1]):\n misc.imsave('/home/ahmed/melanoma/batches/{2}_back_{0}_batch_{1}.jpg'.format(cur_img.replace(\".jpg\",\"\").replace(\"ISIC_\",\"\"),i_b,j),x_img[x_b-112: x_b+112, y_b-112:y_b+112,:])\n misc.imsave('/home/ahmed/melanoma/batches_ground/{2}_back_{0}_batch_{1}_mask.jpg'.format(cur_img.replace(\".jpg\",\"\").replace(\"ISIC_\",\"\"),i_b,j),y_img[x_b-112: x_b+112, y_b-112:y_b+112])\n n = x_img[x_b-112: x_b+112, y_b-112:y_b+112,:]\n if (n.shape[0] != 224) or (n.shape[1] != 224):\n print(\"ERROR\")\n i_b += 1\n j += 1\n y.append(0)\n b0 = np.delete(b0,k_back)\n b1 = np.delete(b1,k_back)\n# print(len(b0))\n print(k)\n k += 1\n" ]
[ [ "numpy.delete", "numpy.where", "scipy.misc.imread", "numpy.random.randint" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [ "0.13", "0.14", "0.15", "1.0", "0.19", "0.18", "1.2", "0.12", "0.10", "0.17", "0.16" ], "tensorflow": [] } ]
jacobboney/featuretools
[ "679aa0c9a3985942ce5278f56353b44c41958907", "679aa0c9a3985942ce5278f56353b44c41958907" ]
[ "featuretools/demo/weather.py", "featuretools/tests/primitive_tests/test_latlong_primitives.py" ]
[ "import pandas as pd\n\nimport featuretools as ft\n\n\ndef load_weather(nrows=None,\n return_single_table=False):\n '''\n Load the Australian daily-min-temperatures weather dataset.\n\n Args:\n\n nrows (int): Passed to nrows in ``pd.read_csv``.\n return_single_table (bool): Exit the function early and return a dataframe.\n\n '''\n filename = \"daily-min-temperatures.csv\"\n print('Downloading data ...')\n url = \"https://api.featurelabs.com/datasets/{}?library=featuretools&version={}\".format(filename, ft.__version__)\n data = pd.read_csv(url, index_col=None, nrows=nrows)\n if return_single_table:\n return data\n es = make_es(data)\n return es\n\n\ndef make_es(data):\n es = ft.EntitySet('Weather Data')\n\n es.add_dataframe(data,\n dataframe_name='temperatures',\n index='id',\n make_index=True,\n time_index='Date')\n return es\n", "import numpy as np\nimport pandas as pd\nimport pytest\n\nfrom featuretools.primitives import CityblockDistance, GeoMidpoint, IsInGeoBox\n\n\ndef test_cityblock():\n primitive_instance = CityblockDistance()\n latlong_1 = pd.Series([(i, i) for i in range(3)])\n latlong_2 = pd.Series([(i, i) for i in range(3, 6)])\n primitive_func = primitive_instance.get_function()\n answer = pd.Series([414.56051391, 414.52893691, 414.43421555])\n given_answer = primitive_func(latlong_1, latlong_2)\n np.testing.assert_allclose(given_answer, answer, rtol=1e-09)\n\n primitive_instance = CityblockDistance(unit='kilometers')\n primitive_func = primitive_instance.get_function()\n answer = primitive_func(latlong_1, latlong_2)\n given_answer = pd.Series([667.1704814, 667.11966315, 666.96722389])\n np.testing.assert_allclose(given_answer, answer, rtol=1e-09)\n\n\ndef test_cityblock_nans():\n primitive_instance = CityblockDistance()\n lats_longs_1 = [(i, i) for i in range(2)]\n lats_longs_2 = [(i, i) for i in range(2, 4)]\n lats_longs_1 += [(1, 1), (np.nan, 3), (4, np.nan), (np.nan, np.nan)]\n lats_longs_2 += [(np.nan, np.nan), (np.nan, 5), (6, np.nan), (np.nan,\n np.nan)]\n primitive_func = primitive_instance.get_function()\n given_answer = pd.Series(list([276.37367594, 276.35262728] +\n [np.nan] * 4))\n answer = primitive_func(lats_longs_1, lats_longs_2)\n np.testing.assert_allclose(given_answer, answer, rtol=1e-09)\n\n\ndef test_cityblock_error():\n error_text = 'Invalid unit given'\n with pytest.raises(ValueError, match=error_text):\n CityblockDistance(unit='invalid')\n\n\ndef test_midpoint():\n latlong1 = pd.Series([(-90, -180), (90, 180)])\n latlong2 = pd.Series([(+90, +180), (-90, -180)])\n function = GeoMidpoint().get_function()\n answer = function(latlong1, latlong2)\n for lat, longi in answer:\n assert lat == 0.0\n assert longi == 0.0\n\n\ndef test_midpoint_floating():\n latlong1 = pd.Series([(-45.5, -100.5), (45.5, 100.5)])\n latlong2 = pd.Series([(+45.5, +100.5), (-45.5, -100.5)])\n function = GeoMidpoint().get_function()\n answer = function(latlong1, latlong2)\n for lat, longi in answer:\n assert lat == 0.0\n assert longi == 0.0\n\n\ndef test_midpoint_zeros():\n latlong1 = pd.Series([(0, 0), (0, 0)])\n latlong2 = pd.Series([(0, 0), (0, 0)])\n function = GeoMidpoint().get_function()\n answer = function(latlong1, latlong2)\n for lat, longi in answer:\n assert lat == 0.0\n assert longi == 0.0\n\n\ndef test_midpoint_nan():\n all_nan = pd.Series([(np.nan, np.nan), (np.nan, np.nan)])\n latlong1 = pd.Series([(0, 0), (0, 0)])\n function = GeoMidpoint().get_function()\n answer = function(all_nan, latlong1)\n for lat, longi in answer:\n assert np.isnan(lat)\n assert np.isnan(longi)\n\n\ndef test_isingeobox():\n latlong = pd.Series([(1, 2), (5, 7), (-5, 4), (2, 3), (0, 0),\n (np.nan, np.nan), (-2, np.nan), (np.nan, 1)])\n bottomleft = (-5, -5)\n topright = (5, 5)\n primitive = IsInGeoBox(bottomleft, topright)\n function = primitive.get_function()\n primitive_answer = function(latlong)\n answer = pd.Series([True, False, True, True, True, False, False, False])\n assert np.array_equal(primitive_answer, answer)\n\n\ndef test_boston():\n NYC = (40.7128, -74.0060)\n SF = (37.7749, -122.4194)\n Somerville = (42.3876, -71.0995)\n Bejing = (39.9042, 116.4074)\n CapeTown = (-33.9249, 18.4241)\n latlong = pd.Series([NYC, SF, Somerville, Bejing, CapeTown])\n LynnMA = (42.4668, -70.9495)\n DedhamMA = (42.2436, -71.1677)\n primitive = IsInGeoBox(LynnMA, DedhamMA)\n function = primitive.get_function()\n primitive_answer = function(latlong)\n answer = pd.Series([False, False, True, False, False])\n assert np.array_equal(primitive_answer, answer)\n" ]
[ [ "pandas.read_csv" ], [ "numpy.isnan", "pandas.Series", "numpy.array_equal", "numpy.testing.assert_allclose" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "2.0", "1.4", "1.1", "1.5", "1.2", "1.3" ], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [ "0.23", "0.21", "2.0", "1.4", "0.19", "1.1", "1.5", "1.2", "0.24", "0.20", "1.0", "0.25", "1.3" ], "scipy": [], "tensorflow": [] } ]
kbschliep/pycroscopy
[ "4f18e7b453aca496e611603616112c1a1a524beb" ]
[ "pycroscopy/io/translators/time_series.py" ]
[ "\"\"\"\nCreated on Feb 9, 2016\n\n@author: Chris Smith\n\"\"\"\n\nfrom __future__ import division, print_function, absolute_import, unicode_literals\n\nimport os\n\nimport numpy as np\nfrom skimage.measure import block_reduce\nimport h5py\n\nfrom .df_utils.dm_utils import read_dm3\nfrom pyUSID.io.image import read_image\nfrom pyUSID.io.translator import Translator, generate_dummy_main_parms\nfrom pyUSID.io.write_utils import Dimension, calc_chunks\nfrom pyUSID.io.hdf_utils import get_h5_obj_refs, link_as_main, write_main_dataset, \\\n write_simple_attrs, create_indexed_group\n\n\nclass MovieTranslator(Translator):\n \"\"\"\n Translate Pytchography data from a set of images to an HDF5 file\n \"\"\"\n\n def __init__(self, *args, **kwargs):\n super(MovieTranslator, self).__init__(*args, **kwargs)\n\n self.rebin = False\n self.bin_factor = 1\n self.h5_file = None\n self.binning_func = self.__no_bin\n self.bin_func = None\n self.image_ext = None\n\n def translate(self, h5_path, image_path, bin_factor=None, bin_func=np.mean, start_image=0, image_type='.tif'):\n \"\"\"\n Basic method that adds Movie data to existing hdf5 file\n\n Parameters\n ----------------\n h5_path : str\n Absolute path to where the HDF5 file should be located\n image_path : str\n Absolute path to folder holding the image files\n bin_factor : array_like of uint, optional\n Downsampling factor for each dimension. Default is None.\n bin_func : callable, optional\n Function which will be called to calculate the return value\n of each block. Function must implement an axis parameter,\n i.e. numpy.mean. Ignored if bin_factor is None. Default is\n numpy.mean.\n start_image : int, optional\n Integer denoting which image in the file path should be considered the starting\n point. Default is 0, start with the first image on the list.\n image_type : str, optional\n File extension of images to load. Used to filter out other files in the same\n directory. Default .tif\n\n Returns\n ----------\n h5_main : h5py.Dataset\n HDF5 Dataset object that contains the flattened images\n\n \"\"\"\n self.image_ext = image_type\n\n image_path = os.path.abspath(image_path)\n h5_path = os.path.abspath(h5_path)\n \n if os.path.exists(h5_path):\n os.remove(h5_path)\n\n self.h5_file = h5py.File(h5_path, 'w')\n \n '''\n Get the list of all files with the provided extension and the number of files in the list\n '''\n if os.path.isfile(image_path):\n file_list, image_parms = read_dm3(image_path)\n usize = image_parms['SuperScan-Height']\n vsize = image_parms['SuperScan-Width']\n data_type = file_list.dtype.type\n num_images = file_list.shape[0] - start_image\n\n else:\n file_list = self._parse_file_path(image_path, image_type)\n\n # Set up the basic parameters associated with this set of images\n (usize, vsize), data_type, image_parms = self._getimagesize(os.path.join(image_path, file_list[0]))\n\n num_images = len(file_list) - start_image\n\n '''\n Check if a bin_factor is given. Set up binning objects if it is.\n '''\n if bin_factor is not None:\n self.rebin = True\n if isinstance(bin_factor, int):\n self.bin_factor = (bin_factor, bin_factor)\n elif len(bin_factor) == 2:\n self.bin_factor = tuple(bin_factor)\n else:\n raise ValueError('Input parameter `bin_factor` must be a length 2 array_like or an integer.\\n' +\n '{} was given.'.format(bin_factor))\n usize = int(usize / self.bin_factor[0])\n vsize = int(vsize / self.bin_factor[1])\n self.binning_func = block_reduce\n self.bin_func = bin_func\n data_type = np.float32\n\n h5_main, h5_mean_spec, h5_ronch = self._setupH5(usize, vsize, np.float32, num_images, image_parms)\n\n self._read_data(file_list[start_image:],\n h5_main, h5_mean_spec, h5_ronch, image_path)\n\n return h5_main\n\n def _read_data(self, image_stack, h5_main, h5_mean_spec, h5_ronch, image_path):\n \"\"\"\n Iterates over the images in `file_list`, reading each image and downsampling if\n reqeusted, and writes the flattened image to file. Also builds the Mean_Ronchigram\n and the Spectroscopic_Mean datasets at the same time.\n\n Parameters\n ----------\n image_stack : list of str\n List of all files in `image_path` that will be read\n h5_main : h5py.Dataset\n Dataset which will hold the Ronchigrams\n h5_mean_spec : h5py.Dataset\n Dataset which will hold the Spectroscopic Mean\n h5_ronch : h5py.Dataset\n Dataset which will hold the Mean Ronchigram\n image_path : str\n Absolute file path to the directory which hold the images\n\n Returns\n -------\n None\n \"\"\"\n\n mean_ronch = np.zeros(h5_ronch.shape, dtype=np.float32)\n\n num_files = len(image_stack)\n\n if os.path.isfile(image_path):\n self.__save_dm3_frames(image_stack, h5_main, h5_mean_spec, h5_ronch, mean_ronch, num_files)\n else:\n self.__read_image_files(image_stack, h5_main, h5_mean_spec, h5_ronch, image_path, mean_ronch, num_files)\n\n def __save_dm3_frames(self, image_stack, h5_main, h5_mean_spec, h5_ronch, mean_ronch, num_frames):\n \"\"\"\n\n :param image_stack:\n :param h5_main:\n :param h5_mean_spec:\n :param h5_ronch:\n :param mean_ronch:\n :param num_frames:\n :return:\n \"\"\"\n for iframe, thisframe in enumerate(image_stack):\n selected = (iframe + 1) % round(num_frames / 16) == 0\n if selected:\n print('Processing file...{}% - reading: {}'.format(round(100 * iframe / num_frames), iframe))\n image = self.binning_func(thisframe, self.bin_factor, self.bin_func).flatten()\n h5_main[:, iframe] = image\n\n h5_mean_spec[iframe] = np.mean(image)\n\n mean_ronch += image\n\n self.h5_file.flush()\n\n h5_ronch[:] = mean_ronch / num_frames\n self.h5_file.flush()\n\n def __read_image_files(self, image_stack, h5_main, h5_mean_spec, h5_ronch, image_path, mean_ronch, num_files):\n \"\"\"\n Read each image from `file_list` and save it in `h5_main`.\n\n Parameters\n ----------\n image_stack:\n :param h5_main:\n :param h5_mean_spec:\n :param h5_ronch:\n :param image_path:\n :param mean_ronch:\n :param num_files:\n :return:\n \"\"\"\n for ifile, thisfile in enumerate(image_stack):\n\n selected = (ifile + 1) % round(num_files / 16) == 0\n if selected:\n print('Processing file...{}% - reading: {}'.format(round(100 * ifile / num_files), thisfile))\n\n image = read_image(os.path.join(image_path, thisfile), greyscale=True)\n image = self.binning_func(image, self.bin_factor, self.bin_func)\n image = image.flatten()\n h5_main[:, ifile] = image\n\n h5_mean_spec[ifile] = np.mean(image)\n\n mean_ronch += image\n\n self.h5_file.flush()\n h5_ronch[:] = mean_ronch / num_files\n self.h5_file.flush()\n\n @staticmethod\n def downSampRoncVec(ronch_vec, binning_factor):\n \"\"\"\n Downsample the image by taking the mean over nearby values\n\n Parameters\n ----------\n ronch_vec : ndarray\n Image data\n binning_factor : int\n factor to reduce the size of the image by\n\n Returns\n -------\n ronc_mat3_mean : ndarray\n Flattened downsampled image\n \"\"\"\n ccd_pix = int(np.sqrt(ronch_vec.size))\n ronc_mat = ronch_vec.reshape(ccd_pix, ccd_pix)\n ronc_mat2 = ronc_mat.reshape(ccd_pix, ccd_pix / binning_factor, binning_factor)\n ronc_mat2_mean = ronc_mat2.mean(2) # take the mean along the 3rd dimension\n ronc_mat3 = ronc_mat2_mean.reshape(ccd_pix / binning_factor, binning_factor, -1)\n ronc_mat3_mean = ronc_mat3.mean(1)\n\n return ronc_mat3_mean.reshape(-1)\n\n @staticmethod\n def _parse_file_path(path, ftype='all'):\n \"\"\"\n Returns a list of all files in the directory given by path\n \n Parameters\n ---------------\n path : string / unicode\n absolute path to directory containing files\n ftype : this file types to return in file_list. (optional. Default is all) \n \n Returns\n ----------\n file_list : list of strings\n names of all files in directory located at path\n numfiles : unsigned int\n number of files in file_list\n \"\"\"\n\n # Get all files in directory\n file_list = os.listdir(path)\n\n # If no file type specified, return full list\n if ftype == 'all':\n return file_list\n\n # Remove files of type other than the request ftype from the list\n new_file_list = []\n for this_thing in file_list:\n # Make sure it's really a file\n if not os.path.isfile(os.path.join(path, this_thing)):\n continue\n\n split = os.path.splitext(this_thing)\n ext = split[1]\n if ext == ftype:\n new_file_list.append(os.path.join(path, this_thing))\n\n return new_file_list\n\n @staticmethod\n def _getimagesize(image):\n \"\"\"\n Returns the x and y size of the image in pixels\n \n Parameters\n ------------\n image : string / unicode\n absolute path to the image file\n \n Returns\n -----------\n (size, tmp.dtype) : Tuple \n \n size : unsigned integer\n x and y dimenstions of image\n dtype : data type\n Datatype of the image\n \"\"\"\n tmp, parms = read_image(image, get_parms=True)\n size = tmp.shape\n\n return size, tmp.dtype.type, parms\n\n def _setupH5(self, usize, vsize, data_type, num_images, main_parms):\n \"\"\"\n Setup the HDF5 file in which to store the data including creating\n the Position and Spectroscopic datasets\n\n Parameters\n ----------\n usize : int\n Number of pixel columns in the images\n vsize : int\n Number of pixel rows in the images\n data_type : type\n Data type to save image as\n num_images : int\n Number of images in the movie\n main_parms : dict\n\n\n Returns\n -------\n h5_main : h5py.Dataset\n HDF5 Dataset that the images will be written into\n h5_mean_spec : h5py.Dataset\n HDF5 Dataset that the mean over all positions will be written\n into\n h5_ronch : h5py.Dataset\n HDF5 Dateset that the mean over all Spectroscopic steps will be\n written into\n \"\"\"\n num_pixels = usize * vsize\n\n root_parms = generate_dummy_main_parms()\n root_parms['data_type'] = 'PtychographyData'\n\n main_parms['num_images'] = num_images\n main_parms['image_size_u'] = usize\n main_parms['image_size_v'] = vsize\n main_parms['num_pixels'] = num_pixels\n main_parms['translator'] = 'Movie'\n\n # Create the hdf5 data Group\n write_simple_attrs(self.h5_file, root_parms)\n meas_grp = create_indexed_group(self.h5_file, 'Measurement')\n write_simple_attrs(meas_grp, main_parms)\n chan_grp = create_indexed_group(meas_grp, 'Channel')\n\n # Build the Position and Spectroscopic Datasets\n spec_dim = Dimension('Time', 's', np.arange(num_images))\n pos_dims = [Dimension('X', 'a.u.', np.arange(usize)), Dimension('Y', 'a.u.', np.arange(vsize))]\n\n ds_chunking = calc_chunks([num_pixels, num_images],\n data_type(0).itemsize,\n unit_chunks=(num_pixels, 1))\n\n # Allocate space for Main_Data and Pixel averaged Data\n h5_main = write_main_dataset(chan_grp, (num_pixels, num_images), 'Raw_Data',\n 'Intensity', 'a.u.',\n pos_dims, spec_dim,\n chunks=ds_chunking, dtype=data_type)\n h5_ronch = meas_grp.create_dataset('Mean_Ronchigram',\n data=np.zeros(num_pixels, dtype=np.float32),\n dtype=np.float32)\n h5_mean_spec = meas_grp.create_dataset('Spectroscopic_Mean',\n data=np.zeros(num_images, dtype=np.float32),\n dtype=np.float32)\n\n self.h5_file.flush()\n\n return h5_main, h5_mean_spec, h5_ronch\n\n @staticmethod\n def __no_bin(image, *args, **kwargs):\n \"\"\"\n Does absolutely nothing to the image. Exists so that we can have\n a bin function to call whether we actually rebin the image or not.\n\n Parameters\n ----------\n image : ndarray\n Image\n args:\n Argument list\n kwargs:\n Keyword argument list\n\n Returns\n -------\n image : ndarray\n The input image\n \"\"\"\n return image\n" ]
[ [ "numpy.arange", "numpy.sqrt", "numpy.zeros", "numpy.mean" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
UKPLab/conll2019-snopes-experiments
[ "102f4a05cfba781036bd3a7b06022246e53765ad", "102f4a05cfba781036bd3a7b06022246e53765ad" ]
[ "src/rte_pac/feature_extaction/average_word_embedding.py", "src/rte_pac/deep_models/ESIM_fasttext.py" ]
[ "from gensim.models import KeyedVectors\nimport numpy as np\nimport nltk\n\n\n# model = KeyedVectors.load_word2vec_format('data/GoogleNews-vectors-negative300.bin',binary=True)\n#\n# vecab = model.vocab.keys()\n# print(len(vecab))\n# vector = model.get_vector('This')\n# print(type(vector))\n# print(vector.shape)\n\n\ndef load_model(filepath):\n return KeyedVectors.load_word2vec_format(filepath, binary=True)\n\n\ndef average_word_embedding(model, vocab, tokens):\n vectors = []\n count = 0\n\n for word in tokens:\n if word in vocab:\n count += 1\n vectors.append(model.get_vector(word))\n else:\n continue\n numpy_vectors = np.reshape(np.array(vectors), newshape=(count, 300))\n\n return np.sum(numpy_vectors, axis=0) / count if count != 0 else np.zeros((1, 300))\n\n\ndef get_word_embedding_features(texts):\n model = load_model('data/GoogleNews-vectors-negative300.bin')\n vocab = model.vocab.keys()\n embedding_features = np.zeros(shape=(len(texts), 300))\n\n for idx, text in enumerate(texts):\n tokens = nltk.word_tokenize(text, language='english')\n embedding_features[idx] = average_word_embedding(model, vocab, tokens)\n\n return embedding_features\n\n\ntexts = ['I love somebody!']\n", "from datetime import datetime\nfrom math import ceil\n\nimport numpy as np\nimport tensorflow as tf\nfrom deep_models.LSTM import LSTM\nfrom sklearn.exceptions import NotFittedError\nfrom tqdm import tqdm\n\nfrom common.util.log_helper import LogHelper\n\nhe_init = tf.contrib.layers.variance_scaling_initializer()\ndim_fasttext = 300\n\n\nclass ESIM(LSTM):\n\n def __init__(self, h_max_length=20, b_max_length=200, trainable=False, lstm_layers=2, mlp_layers=1,\n num_neurons=[128, 128, 32], share_parameters=True, average_pooling=False,\n optimizer=tf.train.AdamOptimizer, learning_rate=0.001, batch_size=128, activation=tf.nn.relu,\n initializer=he_init, num_epoch=100, batch_norm_momentum=None, dropout_rate=None,\n max_check_without_progress=10, show_progress=10, tensorboard_logdir=None, random_state=None,\n embedding=None, l2_lambda=0.01, vocab_size=None, n_outputs=3, pos_weight=None):\n LSTM.__init__(self, h_max_length, b_max_length, trainable, lstm_layers, mlp_layers, num_neurons,\n share_parameters, average_pooling, optimizer, learning_rate, batch_size, activation, initializer,\n num_epoch, batch_norm_momentum, dropout_rate, max_check_without_progress, show_progress,\n tensorboard_logdir, random_state, embedding, l2_lambda, vocab_size)\n\n self.vocab_size = vocab_size\n self.embedding_size = dim_fasttext\n self.n_outputs = n_outputs\n self.pos_weight = pos_weight\n self._graph = None\n self._classes = None\n self._session = None\n self.logger = LogHelper.get_logger(self.__class__.__name__)\n if self.embedding is None and self.vocab_size is None:\n raise Exception(\"Either embedding or vocab_size must be setted!\")\n\n def gru_cell(self, num_neuron):\n\n gru = tf.contrib.rnn.GRUCell(num_neuron)\n if self.dropout_rate:\n gru = tf.contrib.rnn.DropoutWrapper(gru, input_keep_prob=self.keep_prob, output_keep_prob=self.keep_prob)\n return gru\n\n def _bidirectional_rnn(self, inputs, inputs_length, num_units, scope=None):\n\n with tf.variable_scope(scope or 'birnn'):\n\n if self.lstm_layers == 1:\n rnn_cells = self.gru_cell(num_units)\n else:\n # rnn_cells = tf.nn.rnn_cell.MultiRNNCell([self.gru_cell(i) for i in self.num_neurons[:self.lstm_layers]])\n rnn_cells = tf.nn.rnn_cell.MultiRNNCell(num_units)\n\n ((fw_outputs, bw_outputs), (fw_states, bw_states)) = tf.nn.bidirectional_dynamic_rnn(rnn_cells, rnn_cells,\n inputs, inputs_length,\n dtype=tf.float32)\n outputs = tf.concat([fw_outputs, bw_outputs], axis=2)\n\n if self.lstm_layers > 1:\n fw_states = fw_states[self.lstm_layers - 1]\n bw_states = bw_states[self.lstm_layers - 1]\n self.logger.debug(\"BiRNN: outputs.shape: {}\".format(str(outputs.shape)))\n return outputs, fw_states, bw_states\n\n def _esim(self, head_output_steps, body_output_steps, head_sent_sizes, body_sent_sizes):\n \"\"\"\n Perform ESIM for each sentence pair\n :param head_output_steps: Output time steps of BiLSTM for one claim sentence but with batch size. batch_size * sents * words * embeddings\n :param body_output_steps: Output time steps of BiLSTM for one evidence sentence but with batch size. batch_size * sents * words * embeddings\n :param head_sent_sizes: Sentence sizes of the claim sentence but with batch size. batch_size * sents\n :param body_sent_sizes: Sentence sizes of the evidence sentence but with batch size. batch_size * sents\n :return:\n \"\"\"\n self.logger.debug(\"head_output_steps.shape: {}\".format(str(head_output_steps.shape)))\n self.logger.debug(\"body_output_steps.shape: {}\".format(str(body_output_steps.shape)))\n self.logger.debug(\"head_sent_sizes.shape: {}\".format(str(head_sent_sizes.shape)))\n self.logger.debug(\"body_sent_sizes.shape: {}\".format(str(body_sent_sizes.shape)))\n with tf.variable_scope(\"ESIM_single_sentence_pair\", reuse=True):\n # head_sent_sizes = tf.Print(head_sent_sizes, [head_sent_sizes, tf.shape(head_sent_sizes)],\n # \"head_sent_sizes:\\n\", summarize=32)\n # body_sent_sizes = tf.Print(body_sent_sizes, [body_sent_sizes, tf.shape(body_sent_sizes)],\n # \"body_sent_sizes:\\n\", summarize=32)\n # batch_size * sents * head_words * body_words\n attention_matrix = tf.matmul(head_output_steps, body_output_steps, transpose_b=True)\n # batch_size * sents * head_words * body_words\n soft_attention_matrix_for_head = tf.nn.softmax(attention_matrix, 3)\n # batch_size * sents * body_words * head_words\n soft_attention_matrix_for_body = tf.nn.softmax(tf.transpose(attention_matrix, [0, 1, 3, 2]), 3)\n\n # batch_size * sents * head_words * embed\n head_attended = tf.matmul(soft_attention_matrix_for_head, body_output_steps, name=\"attend_head\")\n # head_attended = tf.Print(head_attended, [head_attended, tf.shape(head_attended)], \"head_attended:\\n\",\n # summarize=15000)\n\n # batch_size * sents * body_words * embed\n body_attended = tf.matmul(soft_attention_matrix_for_body, head_output_steps, name=\"attend_body\")\n # body_attended = tf.Print(body_attended, [body_attended, tf.shape(body_attended)], \"body_attended:\\n\",\n # summarize=15000)\n\n batch_size, num_sents, max_head_words, embed_size = tf.unstack(tf.shape(head_attended))\n flat_head_sent_sizes = tf.reshape(head_sent_sizes, [batch_size * num_sents])\n flat_head_seq_masks = tf.sequence_mask(flat_head_sent_sizes, max_head_words)\n head_seq_masks = tf.reshape(flat_head_seq_masks, [batch_size, num_sents, max_head_words])\n # batch_size * sents * head_words\n head_masks_per_word = tf.where(head_seq_masks, tf.ones_like(head_seq_masks, dtype=tf.float32),\n tf.zeros_like(head_seq_masks, dtype=tf.float32))\n # now batch_size * sents * head_words * embed\n head_masks = tf.tile(tf.expand_dims(head_masks_per_word, 3), [1, 1, 1, 150])\n masked_head_attended = head_attended * head_masks\n\n _, _, max_body_words, _ = tf.unstack(tf.shape(body_attended))\n flat_body_sent_sizes = tf.reshape(body_sent_sizes, [batch_size * num_sents])\n flat_body_seq_masks = tf.sequence_mask(flat_body_sent_sizes, max_body_words)\n body_seq_masks = tf.reshape(flat_body_seq_masks, [batch_size, num_sents, max_body_words])\n # batch_size * sents * body_words\n body_masks_per_word = tf.where(body_seq_masks, tf.ones_like(body_seq_masks, dtype=tf.float32),\n tf.zeros_like(body_seq_masks, dtype=tf.float32))\n # now batch_size * sents * body_words * embed\n body_masks = tf.tile(tf.expand_dims(body_masks_per_word, 3), [1, 1, 1, 150])\n masked_body_attended = body_attended * body_masks\n\n # batch_size * sents * head_words * (4 * embed)\n head_concat = tf.concat(\n [head_output_steps, masked_head_attended, tf.abs(tf.subtract(masked_head_attended, head_output_steps)),\n tf.multiply(head_output_steps, masked_head_attended)], 3, name=\"concat_head_attended\")\n # batch_size * sents * body_words * (4 * embed)\n body_concat = tf.concat(\n [body_output_steps, masked_body_attended, tf.abs(tf.subtract(masked_body_attended, body_output_steps)),\n tf.multiply(body_output_steps, masked_body_attended)], 3, name=\"concat_body_attended\")\n return head_concat, body_concat, head_masks_per_word, body_masks_per_word\n\n def _esim_rnn(self, heads_embeddings, bodies_embeddings, h_sent_sizes, b_sent_sizes, scope=None, epsilon=0.0001):\n \"\"\"\n :param heads_embeddings: batch_size * 1 * h_words * embed\n :param bodies_embeddings: batch_size * sents * b_words * embed\n :param h_sent_sizes: batch_size * 1\n :param b_sent_sizes: batch_size * sents\n :param scope:\n :param epsilon: avoid dividing zero\n :return:\n \"\"\"\n self.logger.debug(\"heads_embeddings.shape: {}\".format(str(heads_embeddings.shape)))\n self.logger.debug(\"bodies_embeddings.shape: {}\".format(str(bodies_embeddings.shape)))\n self.logger.debug(\"h_sent_sizes.shape: {}\".format(str(h_sent_sizes.shape)))\n self.logger.debug(\"b_sent_sizes.shape: {}\".format(str(b_sent_sizes.shape)))\n with tf.variable_scope(scope or \"ESIM_rnn\"):\n with tf.variable_scope(\"local_inference_modelling\") as scope:\n (batch_size, body_sent_size, body_word_size, embed_size) = tf.unstack(tf.shape(bodies_embeddings))\n flat_bodies_embeddings = tf.reshape(bodies_embeddings,\n [batch_size * body_sent_size, body_word_size, self.embedding_size])\n # flat_bodies_embeddings = tf.Print(flat_bodies_embeddings,\n # [flat_bodies_embeddings, tf.shape(flat_bodies_embeddings)],\n # \"flat_bodies_embeddings:\\n\", summarize=15000)\n flat_b_sent_sizes = tf.reshape(b_sent_sizes, [batch_size * body_sent_size], name=\"flat_b_sent_sizes\")\n # flat_b_sent_sizes = tf.Print(flat_b_sent_sizes, [flat_b_sent_sizes, tf.shape(flat_b_sent_sizes)],\n # \"flat_b_sent_sizes:\\n\", summarize=160)\n flat_bodies_encoded, _, _ = self._bidirectional_rnn(flat_bodies_embeddings, flat_b_sent_sizes,\n self.num_neurons[0])\n encode_size = 2 * self.num_neurons[0]\n bodies_encoded = tf.reshape(flat_bodies_encoded,\n (batch_size, body_sent_size, body_word_size, encode_size),\n name=\"bodies_encoded\")\n # now batch_size * h_words * embed\n flat_heads_embeddings = tf.squeeze(heads_embeddings, 1, name=\"flat_heads_embeddings\")\n # now batch_size\n flat_h_sent_sizes = tf.squeeze(h_sent_sizes, 1, name=\"flat_h_sent_sizes\")\n scope.reuse_variables()\n # batch_size * h_words * encode_size\n heads_encoded, _, _ = self._bidirectional_rnn(flat_heads_embeddings, flat_h_sent_sizes,\n self.num_neurons[0])\n # batch_size * sents * h_words * encode_size\n tiled_heads_encoded = tf.tile(tf.expand_dims(heads_encoded, 1), [1, body_sent_size, 1, 1])\n # batch_size * sents\n tiled_h_sent_sizes = tf.tile(h_sent_sizes, [1, body_sent_size])\n\n heads_attended, bodies_attended, head_masks_per_word, body_masks_per_word = self._esim(\n tiled_heads_encoded, bodies_encoded, tiled_h_sent_sizes, b_sent_sizes)\n\n with tf.variable_scope(\"inference_composition\") as scope:\n attended_size = 4 * encode_size\n (batch_size, b_sent_size, h_word_size, _) = tf.unstack(tf.shape(heads_attended))\n (_, _, b_word_size, _) = tf.unstack(tf.shape(bodies_attended))\n reshape_expand_h_sent_sizes = tf.reshape(tf.tile(h_sent_sizes, [1, b_sent_size]),\n [batch_size * b_sent_size], name=\"reshape_expand_h_sent_sizes\")\n self.logger.debug(\n \"reshape_expand_h_sent_sizes.shape: {}\".format(str(reshape_expand_h_sent_sizes.shape)))\n reshape_b_sent_sizes = tf.reshape(b_sent_sizes, [batch_size * b_sent_size], name=\"reshape_b_sent_sizes\")\n self.logger.debug(\"reshape_b_sent_sizes.shape: {}\".format(str(reshape_b_sent_sizes.shape)))\n flat_heads_attended = tf.reshape(heads_attended,\n [batch_size * body_sent_size, h_word_size, attended_size],\n name=\"flat_heads_attended\")\n flat_bodies_attended = tf.reshape(bodies_attended,\n [batch_size * body_sent_size, b_word_size, attended_size],\n name=\"flat_bodies_attended\")\n output_dim = 2 * self.num_neurons[1]\n # (batch_size * sents) * h_words * output_dim\n flat_heads_outputs, flat_heads_fw, flat_heads_bw = self._bidirectional_rnn(flat_heads_attended,\n reshape_expand_h_sent_sizes,\n self.num_neurons[1])\n # # (batch_size * sents) * output_dim\n # flat_heads_final_step = tf.concat([flat_heads_fw, flat_heads_bw], 1)\n scope.reuse_variables()\n # (batch_size * sents) * b_words * output_dim\n flat_bodies_outputs, flat_bodies_fw, flat_bodies_bw = self._bidirectional_rnn(flat_bodies_attended,\n reshape_b_sent_sizes,\n self.num_neurons[1])\n # all (batch_size * sents) * output_dim\n flat_heads_mean = tf.reduce_sum(flat_heads_outputs, 1) / (\n tf.reshape(tf.cast(tiled_h_sent_sizes, tf.float32),\n [batch_size * b_sent_size, 1]) + epsilon)\n # flat_heads_mean = tf.Print(flat_heads_mean, [flat_heads_mean, tf.shape(flat_heads_mean)],\n # \"flat_heads_mean:\\n\", summarize=80000)\n flat_heads_max = tf.reduce_max(flat_heads_outputs, 1)\n # flat_heads_max = tf.Print(flat_heads_max, [flat_heads_max, tf.shape(flat_heads_max)],\n # \"flat_heads_max:\\n\", summarize=80000)\n flat_bodies_mean = tf.reduce_sum(flat_bodies_outputs, 1) / (\n tf.reshape(tf.cast(b_sent_sizes, tf.float32), [batch_size * b_sent_size, 1]) + epsilon)\n # flat_bodies_mean = tf.Print(flat_bodies_mean, [flat_bodies_mean, tf.shape(flat_bodies_mean)],\n # \"flat_bodies_mean:\\n\", summarize=80000)\n flat_bodies_max = tf.reduce_max(flat_bodies_outputs, 1)\n # flat_bodies_max = tf.Print(flat_bodies_max, [flat_bodies_max, tf.shape(flat_bodies_max)],\n # \"flat_bodies_max:\\n\", summarize=80000)\n\n # (batch_size * sents) * (4 * output_dim)\n flat_output_concat = tf.concat([flat_heads_mean, flat_heads_max, flat_bodies_mean, flat_bodies_max], 1)\n # batch_size * sents * (4 * output_dim)\n output_concat = tf.reshape(flat_output_concat, [batch_size, b_sent_size, 4 * output_dim])\n # both batch_size * (4 * output_dim)\n output_mean = tf.reduce_mean(output_concat, 1)\n output_max = tf.reduce_max(output_concat, 1)\n # batch_size * (8 * output_dim)\n output_4_classifier_concat = tf.concat([output_mean, output_max], 1, name=\"output_4_classifier_concat\")\n return output_4_classifier_concat\n\n def _ann(self, h_sent_sizes, b_sent_sizes, head_fasttext, body_fasttext):\n\n # with tf.variable_scope(\"embedding_lookup\") as scope:\n # heads_embeddings = self._add_embedding(head_inputs, scope)\n # scope.reuse_variables()\n # body_embeddings = self._add_embedding(body_inputs, scope)\n #\n # heads_embeddings = tf.concat([heads_embeddings, head_fasttext], 3)\n # body_embeddings = tf.concat([body_embeddings, body_fasttext], 3)\n heads_embeddings = head_fasttext\n body_embeddings = body_fasttext\n output = self._esim_rnn(heads_embeddings, body_embeddings, h_sent_sizes, b_sent_sizes)\n\n for layer in range(self.mlp_layers):\n\n if self.dropout_rate:\n output = tf.layers.dropout(output, rate=self.dropout_rate, training=self._training)\n output = tf.layers.dense(output, self.num_neurons[self.lstm_layers + layer], activation=self.activation,\n kernel_initializer=self.initializer, name=\"hidden{}\".format(layer + 1))\n\n # output = self.activation(output, name=\"hidden{}_out\".format(layer + 1))\n\n return output\n\n def _construct_graph(self):\n\n if self.randome_state:\n tf.set_random_seed(self.randome_state)\n np.random.seed(self.randome_state)\n # X_heads = tf.placeholder(dtype=tf.int32, shape=[None, None, None], name=\"X_heads\")\n # X_bodies = tf.placeholder(dtype=tf.int32, shape=[None, None, None], name=\"X_bodies\")\n X_heads_fasttext = tf.placeholder(dtype=tf.float32, shape=[None, None, None, dim_fasttext],\n name=\"X_heads_fasttext\")\n X_bodies_fasttext = tf.placeholder(dtype=tf.float32, shape=[None, None, None, dim_fasttext],\n name=\"X_bodies_fasttext\")\n X_head_sizes = tf.placeholder(dtype=tf.int32, shape=[None], name=\"head_sizes\")\n X_body_sizes = tf.placeholder(dtype=tf.int32, shape=[None], name=\"body_sizes\")\n X_head_sent_sizes = tf.placeholder(dtype=tf.int32, shape=[None, None], name=\"head_sent_sizes\")\n X_body_sent_sizes = tf.placeholder(dtype=tf.int32, shape=[None, None], name=\"body_sent_sizes\")\n\n # X_addtional = tf.placeholder(tf.float32,shape=[None,features_length],name=\"additonal_features\")\n y_ = tf.placeholder(tf.int32, shape=[None], name=\"y\")\n y_one_hot = tf.one_hot(y_, self.n_outputs, on_value=1.0, off_value=0.0, axis=-1, dtype=tf.float32)\n\n if self.dropout_rate:\n self._training = tf.placeholder_with_default(False, shape=[], name=\"training\")\n self.keep_prob = tf.cond(self._training, lambda: tf.constant(1 - self.dropout_rate),\n lambda: tf.constant(1.0))\n else:\n self._training = None\n\n pre_output = self._ann(X_head_sent_sizes, X_body_sent_sizes, X_heads_fasttext, X_bodies_fasttext)\n logits = tf.layers.dense(\n pre_output, self.n_outputs, kernel_initializer=he_init, name=\"logits\")\n probabilities = tf.nn.softmax(logits, name=\"probabilities\")\n\n if self.pos_weight is None:\n xentropy = tf.nn.sparse_softmax_cross_entropy_with_logits(labels=y_, logits=logits)\n else:\n self.logger.debug(\"weighted xentropy\")\n xentropy = tf.nn.weighted_cross_entropy_with_logits(y_one_hot, logits, self.pos_weight)\n loss = tf.reduce_mean(xentropy, name=\"loss\")\n variables = tf.trainable_variables()\n for v in variables:\n self.logger.debug(v.name)\n # l2_loss = tf.add_n(\n # [tf.nn.l2_loss(v) for v in variables if 'bias' not in v.name and 'Variable' not in v.name]) * self.l2_lambda\n # loss += l2_loss\n\n optimizer = self.optimizer(learning_rate=self.learning_rate)\n update_ops = tf.get_collection(tf.GraphKeys.UPDATE_OPS)\n with tf.control_dependencies(update_ops):\n training_op = optimizer.minimize(loss)\n\n correct = tf.nn.in_top_k(logits, y_, 1)\n accuracy = tf.reduce_mean(tf.cast(correct, tf.float32), name=\"accuracy\")\n _, predicts = tf.nn.top_k(logits, k=1, sorted=False)\n confusion_matrix = tf.confusion_matrix(y_, predicts, num_classes=self.n_outputs, name=\"confusion_matrix\")\n\n init = tf.global_variables_initializer()\n saver = tf.train.Saver()\n\n if self.tensorboard_logdir:\n now = datetime.utcnow().strftime('%Y%m%d-%H%M%S')\n tb_logdir = self.tensorboard_logdir + \"/run{}\".format(now)\n cost_summary = tf.summary.scalar(\"validation_loss\", loss)\n acc_summary = tf.summary.scalar(\"validation_accuracy\", accuracy)\n merged_summary = tf.summary.merge_all()\n file_writer = tf.summary.FileWriter(\n tb_logdir, tf.get_default_graph())\n\n self._merged_summary = merged_summary\n self._file_writer = file_writer\n\n self._X_h_sizes, self._X_b_sizes, self._X_h_sent_sizes, self._X_b_sent_sizes, self.y = X_head_sizes, X_body_sizes, X_head_sent_sizes, X_body_sent_sizes, y_\n self._X_head_fasttext, self._X_body_fasttext = X_heads_fasttext, X_bodies_fasttext\n self._logits = logits\n self._probabilities = probabilities\n self._loss = loss\n self._training_op = training_op\n self._accuracy = accuracy\n self._confusion_matrix = confusion_matrix\n self._init, self._saver = init, saver\n # self._X_additional = X_addtional\n\n def get_batch_attention(self, h_sizes, b_sizes, h_sent_sizes, b_sent_sizes, h_ft_np, b_ft_np, y=None):\n\n num_batches = ceil(h_sizes.shape[0] / self.batch_size)\n batches = []\n\n for i in range(num_batches):\n if (i + 1) * self.batch_size > h_sizes.shape[0]:\n batch_h_ft_np = h_ft_np[i * self.batch_size:h_sizes.shape[0], :]\n batch_b_ft_np = b_ft_np[i * self.batch_size:h_sizes.shape[0], :]\n batch_h_sizes = h_sizes[i * self.batch_size:h_sizes.shape[0]]\n batch_b_sizes = b_sizes[i * self.batch_size:h_sizes.shape[0]]\n batch_h_sent_sizes = h_sent_sizes[i * self.batch_size:h_sizes.shape[0], :]\n batch_b_sent_sizes = b_sent_sizes[i * self.batch_size:h_sizes.shape[0], :]\n if y is not None:\n batch_y = y[i * self.batch_size:h_sizes.shape[0]]\n # batch_additional = additional_features[i*self.batch_size:h_np.shape[0]-1]\n else:\n batch_h_ft_np = h_ft_np[i * self.batch_size:(i + 1) * self.batch_size, :]\n batch_b_ft_np = b_ft_np[i * self.batch_size:(i + 1) * self.batch_size, :]\n batch_h_sizes = h_sizes[i * self.batch_size:(i + 1) * self.batch_size]\n batch_b_sizes = b_sizes[i * self.batch_size:(i + 1) * self.batch_size]\n batch_h_sent_sizes = h_sent_sizes[i * self.batch_size:(i + 1) * self.batch_size, :]\n batch_b_sent_sizes = b_sent_sizes[i * self.batch_size:(i + 1) * self.batch_size, :]\n if y is not None:\n batch_y = y[i * self.batch_size:(i + 1) * self.batch_size]\n # batch_additional = additional_features[i*self.batch_size:(i+1)*self.batch_size]\n if y is not None:\n batches.append((batch_h_sizes, batch_b_sizes, batch_h_sent_sizes, batch_b_sent_sizes, batch_h_ft_np,\n batch_b_ft_np, batch_y))\n else:\n batches.append((batch_h_sizes, batch_b_sizes, batch_h_sent_sizes, batch_b_sent_sizes, batch_h_ft_np,\n batch_b_ft_np))\n return batches\n\n def sort_base_bodies(self, h_v, b_v, y):\n\n assert len(h_v) == len(b_v) == len(y)\n b_lengths = [len(b_vector) for b_vector in b_v]\n\n sorted_h = []\n sorted_b = []\n sorted_y = []\n for length in range(min(b_lengths), max(b_lengths)):\n for idx, vectors in enumerate(b_v):\n if len(vectors) == length:\n sorted_h.append(h_v[idx])\n sorted_b.append(b_v[idx])\n sorted_y.append(y[idx])\n\n return sorted_h, sorted_b, sorted_y\n\n def cal_f1_macro(self, confusion_matrix):\n \"\"\"\n calculate f1 macro\n :param confusion_matrix:\n :return: f1 macro score\n \"\"\"\n\n self.logger.info(confusion_matrix)\n diag = np.diag(confusion_matrix).astype(np.float32)\n num_golds = np.sum(confusion_matrix, axis=0).astype(np.float32)\n num_predicts = np.sum(confusion_matrix, axis=1).astype(np.float32)\n precisions = np.divide(diag, num_golds, out=np.zeros_like(diag), where=num_golds != 0)\n recalls = np.divide(diag, num_predicts, out=np.zeros_like(diag), where=num_predicts != 0)\n\n average_precision = np.mean(precisions)\n average_recall = np.mean(recalls)\n f1_macro = 2 * average_precision * average_recall / (average_recall + average_precision)\n\n return f1_macro\n\n def fit(self, X, y, valid_X=None, y_valid=None):\n self.close_session()\n y = np.array(y)\n\n if len(y.shape) == 2:\n y = np.argmax(y, axis=1)\n\n self._classes, _ = np.unique(y, return_counts=True)\n\n self._graph = tf.Graph()\n h_sizes, b_sizes, h_sent_sizes, b_sent_sizes = X['h_sizes'], X['b_sizes'], X['h_sent_sizes'], X['b_sent_sizes']\n h_ft_np, b_ft_np = X['h_ft_np'], X['b_ft_np']\n\n with self._graph.as_default():\n self._construct_graph()\n\n checks_without_progress = 0\n # best_acc = np.inf\n best_f1_macro = 0\n best_parameters = None\n gpu_options = tf.GPUOptions(per_process_gpu_memory_fraction=0.333)\n self._session = tf.Session(\n # graph=self._graph, config=tf.ConfigProto(gpu_options=gpu_options, log_device_placement=True))\n graph=self._graph, config=tf.ConfigProto(gpu_options=gpu_options))\n\n with self._session.as_default() as sess:\n # options = tf.RunOptions(trace_level=tf.RunOptions.FULL_TRACE)\n # run_metadata = tf.RunMetadata()\n self._init.run()\n num_instances = h_sizes.shape[0]\n for epoch in range(self.num_epoch):\n losses = []\n accs = []\n rnd_idx = np.random.permutation(num_instances)\n # batch_num = 0\n for rnd_indices in tqdm(np.array_split(rnd_idx, num_instances // self.batch_size)):\n\n X_h_sizes_batch, X_b_sizes_batch, X_h_sent_sizes_batch, X_b_sent_sizes_batch, y_batch = \\\n h_sizes[rnd_indices], b_sizes[rnd_indices], \\\n h_sent_sizes[rnd_indices], b_sent_sizes[rnd_indices], \\\n y[rnd_indices]\n X_head_ft_batch, X_body_ft_batch = h_ft_np[rnd_indices], b_ft_np[rnd_indices]\n y_batch = np.asarray(y_batch)\n feed_dict = {self._X_h_sizes: X_h_sizes_batch, self._X_b_sizes: X_b_sizes_batch,\n self._X_h_sent_sizes: X_h_sent_sizes_batch, self._X_b_sent_sizes: X_b_sent_sizes_batch,\n self._X_head_fasttext: X_head_ft_batch, self._X_body_fasttext: X_body_ft_batch,\n self.y: y_batch}\n if self._training is not None:\n feed_dict[self._training] = True\n\n # train_acc, _, loss = sess.run([self._accuracy, self._training_op, self._loss], feed_dict=feed_dict,\n # options=options, run_metadata=run_metadata)\n train_acc, _, loss = sess.run([self._accuracy, self._training_op, self._loss], feed_dict=feed_dict)\n losses.append(loss)\n accs.append(train_acc)\n\n # fetched_timeline = timeline.Timeline(run_metadata.step_stats)\n # chrome_trace = fetched_timeline.generate_chrome_trace_format()\n # with open('timeline_train_step_%d.json' % batch_num, 'w') as f:\n # f.write(chrome_trace)\n # batch_num += 1\n average_loss = sum(losses) / len(losses)\n average_acc = sum(accs) / len(accs)\n\n if valid_X is not None and y_valid is not None:\n\n self.logger.debug(\"validation phase\")\n # valid_h_np, valid_b_np, valid_h_lenseq, valid_b_lenseq, valid_additional = valid_X['h_np'], valid_X['b_np'], valid_X['h_seqlen'], valid_X['b_seqlen'],valid_X['additional']\n valid_h_sizes, valid_b_sizes, valid_h_sent_sizes, valid_b_sent_sizes = \\\n valid_X['h_sizes'], valid_X['b_sizes'], valid_X['h_sent_sizes'], valid_X['b_sent_sizes']\n valid_h_ft_np, valid_b_ft_np = valid_X['h_ft_np'], valid_X['b_ft_np']\n\n # self.logger.debug(\"h_sent_sizes:{} b_sent_sizes:{}\".format(\n # str(valid_h_sent_sizes.shape), str(valid_b_sent_sizes.shape)))\n\n batches = self.get_batch_attention(valid_h_sizes, valid_b_sizes, valid_h_sent_sizes,\n valid_b_sent_sizes, valid_h_ft_np, valid_b_ft_np, y_valid)\n\n batch_losses = []\n batch_accuracies = []\n valid_cm = np.zeros(shape=(self.n_outputs, self.n_outputs), dtype=np.int32)\n for valid_h_sizes_batch, valid_b_sizes_batch, valid_h_sent_sizes_batch, valid_b_sent_sizes_batch, valid_h_ft_batch, valid_b_ft_batch, valid_y_batch in tqdm(\n batches):\n # self.logger.debug(\"h_sent_sizes:{} b_sent_sizes:{}\".format(\n # str(valid_h_sent_sizes_batch.shape), str(valid_b_sent_sizes_batch.shape)))\n\n feed_dict_valid = {self._X_h_sizes: valid_h_sizes_batch, self._X_b_sizes: valid_b_sizes_batch,\n self._X_h_sent_sizes: valid_h_sent_sizes_batch,\n self._X_b_sent_sizes: valid_b_sent_sizes_batch,\n self._X_head_fasttext: valid_h_ft_batch,\n self._X_body_fasttext: valid_b_ft_batch, self.y: valid_y_batch}\n if self.tensorboard_logdir:\n # val_acc_batch, val_loss_batch, cm, summary = sess.run(\n # [self._accuracy, self._loss, self._confusion_matrix, self._merged_summary],\n # feed_dict=feed_dict_valid, options=options, run_metadata=run_metadata)\n val_acc_batch, val_loss_batch, cm, summary = sess.run(\n [self._accuracy, self._loss, self._confusion_matrix, self._merged_summary],\n feed_dict=feed_dict_valid)\n self._file_writer.add_summary(summary, epoch)\n else:\n val_acc_batch, val_loss_batch = sess.run([self._accuracy, self._loss],\n feed_dict=feed_dict_valid)\n\n batch_losses.append(val_loss_batch)\n batch_accuracies.append(val_acc_batch)\n valid_cm = np.add(valid_cm, cm)\n\n val_f1_macro = self.cal_f1_macro(valid_cm)\n val_loss = sum(batch_losses) / len(batch_losses)\n val_acc = sum(batch_accuracies) / len(batch_accuracies)\n\n if self.show_progress:\n if epoch % self.show_progress == 0:\n self.logger.info(\n \"Epoch: {} Current training accuracy: {:.4f} ,Current training loss: {:.6f} Validation Accuracy: {:.4f} Validation Loss{:.6f}\".format(\n epoch + 1, average_acc, average_loss, val_acc, val_loss))\n\n # if val_loss < best_acc:\n # best_acc = val_loss\n # checks_without_progress = 0\n # self.logger.info(\"accuracy has been improved!\")\n # best_parameters = self._get_model_parameters()\n if val_f1_macro > best_f1_macro:\n best_f1_macro = val_f1_macro\n checks_without_progress = 0\n self.logger.info(\"f1_macro has been improved!\")\n best_parameters = self._get_model_parameters()\n else:\n checks_without_progress += 1\n\n if checks_without_progress > self.max_checks_without_progress:\n self.logger.info(\"Stopping Early! Loss has not improved in {} epoches\".format(\n self.max_checks_without_progress))\n break\n else:\n if self.show_progress:\n if epoch % self.show_progress == 0:\n self.logger.info(\"Epoch: {} Current training accuracy: {:.4f}\".format(\n epoch + 1, train_acc))\n\n if best_parameters:\n self._restore_model_parameters(best_parameters)\n return self\n\n def predict_probabilites(self, X):\n\n if not self._session:\n raise NotFittedError(\n \"This %s instance is not fitted yet\" % self.__class__.__name__)\n\n h_sizes, b_sizes, h_sent_sizes, b_sent_sizes = X['h_sizes'], X['b_sizes'], X['h_sent_sizes'], X['b_sent_sizes']\n h_ft_np, b_ft_np = X['h_ft_np'], X['b_ft_np']\n # self.logger.debug(\"length of claims: {}, length of evidences: {}\".format(str(len(h_np)), str(len(b_np))))\n\n batches = self.get_batch_attention(h_sizes, b_sizes, h_sent_sizes, b_sent_sizes, h_ft_np, b_ft_np)\n # self.logger.debug(\"num of batches: {}\".format(str(len(batches))))\n probabilities = []\n with self._session.as_default():\n for pred_h_sizes_batch, pred_b_sizes_batch, pred_h_sent_sizes_batch, pred_b_sent_sizes_batch, pred_h_ft_batch, pred_b_ft_batch in tqdm(\n batches):\n # self.logger.debug(\"current batch: length of claims: {}, length of evidences: {}\".format(\n # str(len(pred_h_batch)), str(len(pred_b_batch))))\n predictions_batch = self._probabilities.eval(\n feed_dict={self._X_h_sizes: pred_h_sizes_batch, self._X_b_sizes: pred_b_sizes_batch,\n self._X_h_sent_sizes: pred_h_sent_sizes_batch,\n self._X_b_sent_sizes: pred_b_sent_sizes_batch, self._X_head_fasttext: pred_h_ft_batch,\n self._X_body_fasttext: pred_b_ft_batch})\n # self.logger.debug(\"current batch: length of predictions: {}\".format(str(len(predictions_batch))))\n for prediction in predictions_batch:\n probabilities.append(prediction)\n self.logger.debug(\n \"total length of probabilities: {}\".format(str(len(probabilities))))\n return np.asarray(probabilities)\n\n def restore_model(self, path):\n self._construct_graph()\n sess = tf.Session()\n sess.run(tf.tables_initializer())\n self._saver.restore(sess, path)\n self._session = sess\n return self\n" ]
[ [ "numpy.array", "numpy.zeros", "numpy.sum" ], [ "numpy.diag", "tensorflow.concat", "tensorflow.contrib.rnn.GRUCell", "tensorflow.control_dependencies", "numpy.asarray", "tensorflow.layers.dropout", "tensorflow.reduce_sum", "tensorflow.cast", "sklearn.exceptions.NotFittedError", "tensorflow.nn.bidirectional_dynamic_rnn", "numpy.mean", "tensorflow.GPUOptions", "numpy.zeros_like", "tensorflow.get_default_graph", "tensorflow.summary.scalar", "tensorflow.confusion_matrix", "tensorflow.Graph", "tensorflow.contrib.layers.variance_scaling_initializer", "numpy.unique", "tensorflow.get_collection", "tensorflow.placeholder_with_default", "tensorflow.layers.dense", "tensorflow.squeeze", "tensorflow.subtract", "tensorflow.ConfigProto", "tensorflow.nn.top_k", "numpy.argmax", "tensorflow.nn.rnn_cell.MultiRNNCell", "tensorflow.Session", "tensorflow.trainable_variables", "tensorflow.nn.in_top_k", "tensorflow.train.Saver", "numpy.zeros", "tensorflow.tile", "tensorflow.matmul", "tensorflow.shape", "tensorflow.placeholder", "tensorflow.global_variables_initializer", "tensorflow.zeros_like", "tensorflow.nn.sparse_softmax_cross_entropy_with_logits", "tensorflow.one_hot", "tensorflow.summary.merge_all", "tensorflow.set_random_seed", "numpy.array", "tensorflow.sequence_mask", "numpy.sum", "tensorflow.reduce_max", "tensorflow.nn.softmax", "tensorflow.transpose", "tensorflow.multiply", "numpy.random.seed", "tensorflow.reduce_mean", "tensorflow.contrib.rnn.DropoutWrapper", "tensorflow.constant", "tensorflow.reshape", "tensorflow.ones_like", "tensorflow.expand_dims", "numpy.random.permutation", "tensorflow.variable_scope", "numpy.add", "numpy.array_split", "tensorflow.tables_initializer", "tensorflow.nn.weighted_cross_entropy_with_logits" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [ "1.10" ] } ]
RimeT/p3_radio
[ "3d522a4356c62255cd93c6d74eb388a2e474dd00", "3d522a4356c62255cd93c6d74eb388a2e474dd00" ]
[ "radiomics/get_test_features.py", "radiomics/radiomics_ria/base.py" ]
[ "import argparse\n\nimport pandas as pd\n\nif __name__ == '__main__':\n parser = argparse.ArgumentParser()\n # debug\n parser.add_argument('feature_csv', help='feature csv file')\n parser.add_argument('tags_csv', help='tags csv. extract dataset=1 samples')\n parser.add_argument('out_csv', help='feature csv file')\n\n args = parser.parse_args()\n\n feat_df = pd.read_csv(args.feature_csv)\n tags = pd.read_csv(args.tags_csv)\n feat_cols = list(feat_df.columns)\n merged = pd.merge(feat_df, tags, on=['mask'])\n merged = merged[merged['dataset'] == 1]\n merged.to_csv(args.out_csv, columns=feat_cols, index=None)\n", "import inspect\nimport logging\nimport traceback\n\nimport numpy\nimport SimpleITK as sitk\nimport six\n\nfrom radiomics_ria import deprecated, getProgressReporter, imageoperations\n\n\nclass RadiomicsFeaturesBase(object):\n \"\"\"\n This is the abstract class, which defines the common interface for the feature classes. All feature classes inherit\n (directly of indirectly) from this class.\n\n At initialization, image and labelmap are passed as SimpleITK image objects (``inputImage`` and ``inputMask``,\n respectively.) The motivation for using SimpleITK images as input is to keep the possibility of reusing the\n optimized feature calculators implemented in SimpleITK in the future. If either the image or the mask is None,\n initialization fails and a warning is logged (does not raise an error).\n\n Logging is set up using a child logger from the parent 'radiomics_ria' logger. This retains the toolbox structure in\n the generated log. The child logger is named after the module containing the feature class (e.g. 'radiomics_ria.glcm').\n\n Any pre calculations needed before the feature functions are called can be added by overriding the\n ``_initSegmentBasedCalculation`` function, which prepares the input for feature extraction. If image discretization is\n needed, this can be implemented by adding a call to ``_applyBinning`` to this initialization function, which also\n instantiates coefficients holding the maximum ('Ng') and unique ('GrayLevels') that can be found inside the ROI after\n binning. This function also instantiates the `matrix` variable, which holds the discretized image (the `imageArray`\n variable will hold only original gray levels).\n\n The following variables are instantiated at initialization:\n\n - kwargs: dictionary holding all customized settings passed to this feature class.\n - label: label value of Region of Interest (ROI) in labelmap. If key is not present, a default value of 1 is used.\n - featureNames: list containing the names of features defined in the feature class. See :py:func:`getFeatureNames`\n - inputImage: SimpleITK image object of the input image (dimensions x, y, z)\n\n The following variables are instantiated by the ``_initSegmentBasedCalculation`` function:\n\n - inputMask: SimpleITK image object of the input labelmap (dimensions x, y, z)\n - imageArray: numpy array of the gray values in the input image (dimensions z, y, x)\n - maskArray: numpy boolean array with elements set to ``True`` where labelmap = label, ``False`` otherwise,\n (dimensions z, y, x).\n - labelledVoxelCoordinates: tuple of 3 numpy arrays containing the z, x and y coordinates of the voxels included in\n the ROI, respectively. Length of each array is equal to total number of voxels inside ROI.\n - matrix: copy of the imageArray variable, with gray values inside ROI discretized using the specified binWidth.\n This variable is only instantiated if a call to ``_applyBinning`` is added to an override of\n ``_initSegmentBasedCalculation`` in the feature class.\n\n .. note::\n Although some variables listed here have similar names to customization settings, they do *not* represent all the\n possible settings on the feature class level. These variables are listed here to help developers develop new feature\n classes, which make use of these variables. For more information on customization, see\n :ref:`radiomics_ria-customization-label`, which includes a comprehensive list of all possible settings, including\n default values and explanation of usage.\n \"\"\"\n\n def __init__(self, inputImage, inputMask, **kwargs):\n self.logger = logging.getLogger(self.__module__)\n self.logger.debug('Initializing feature class')\n\n if inputImage is None or inputMask is None:\n raise ValueError('Missing input image or mask')\n\n self.progressReporter = getProgressReporter\n\n self.settings = kwargs\n\n self.label = kwargs.get('label', 1)\n self.voxelBased = kwargs.get('voxelBased', False)\n\n self.coefficients = {}\n self.coefficients_2 = {}\n self.coefficients_en = {}\n\n # all features are disabled by default\n self.enabledFeatures = {}\n self.featureValues = {}\n\n self.featureNames = self.getFeatureNames()\n\n self.inputImage = inputImage\n self.inputMask = inputMask\n\n self.imageArray = sitk.GetArrayFromImage(self.inputImage)\n\n if self.voxelBased:\n self._initVoxelBasedCalculation()\n else:\n self._initSegmentBasedCalculation()\n\n def _initSegmentBasedCalculation(self):\n self.maskArray = (sitk.GetArrayFromImage(self.inputMask) == self.label) # boolean array\n\n def _initVoxelBasedCalculation(self):\n self.masked = self.settings.get('maskedKernel', True)\n\n maskArray = sitk.GetArrayFromImage(self.inputMask) == self.label # boolean array\n self.labelledVoxelCoordinates = numpy.array(numpy.where(maskArray))\n\n # Set up the mask array for the gray value discretization\n if self.masked:\n self.maskArray = maskArray\n else:\n # This will cause the discretization to use the entire image\n self.maskArray = numpy.ones(self.imageArray.shape, dtype='bool')\n\n def _initCalculation(self, voxelCoordinates=None):\n \"\"\"\n Last steps to prepare the class for extraction. This function calculates the texture matrices and coefficients in\n the respective feature classes\n \"\"\"\n pass\n\n # def _applyBinning(self, matrix):\n # matrix, _ = imageoperations.binImage(matrix, self.maskArray, **self.settings)\n # self.coefficients['grayLevels'] = numpy.unique(matrix[self.maskArray])\n # self.coefficients['Ng'] = int(numpy.max(self.coefficients['grayLevels'])) # max gray level in the ROI\n # return matrix\n\n def _applyBinning(self, matrix):\n matrix, _ = imageoperations.binImage(matrix, self.maskArray, **self.settings)\n self.coefficients['grayLevels'] = numpy.unique(matrix[self.maskArray])\n self.coefficients['Ng'] = int(numpy.max(self.coefficients['grayLevels'])) # max gray level in the ROI\n return matrix\n\n def enableFeatureByName(self, featureName, enable=True):\n \"\"\"\n Enables or disables feature specified by ``featureName``. If feature is not present in this class, a lookup error is\n raised. ``enable`` specifies whether to enable or disable the feature.\n \"\"\"\n if featureName not in self.featureNames:\n raise LookupError('Feature not found: ' + featureName)\n if self.featureNames[featureName]:\n self.logger.warning('Feature %s is deprecated, use with caution!', featureName)\n self.enabledFeatures[featureName] = enable\n\n def enableAllFeatures(self):\n \"\"\"\n Enables all features found in this class for calculation.\n\n .. note::\n Features that have been marked \"deprecated\" are not enabled by this function. They can still be enabled manually by\n a call to :py:func:`~radiomics_ria.base.RadiomicsBase.enableFeatureByName()`,\n :py:func:`~radiomics_ria.featureextractor.RadiomicsFeaturesExtractor.enableFeaturesByName()`\n or in the parameter file (by specifying the feature by name, not when enabling all features).\n However, in most cases this will still result only in a deprecation warning.\n \"\"\"\n for featureName, is_deprecated in six.iteritems(self.featureNames):\n # only enable non-deprecated features here\n if not is_deprecated:\n self.enableFeatureByName(featureName, True)\n\n def disableAllFeatures(self):\n \"\"\"\n Disables all features. Additionally resets any calculated features.\n \"\"\"\n self.enabledFeatures = {}\n self.featureValues = {}\n\n @classmethod\n def getFeatureNames(cls):\n \"\"\"\n Dynamically enumerates features defined in the feature class. Features are identified by the\n ``get<Feature>FeatureValue`` signature, where <Feature> is the name of the feature (unique on the class level).\n\n Found features are returned as a dictionary of the feature names, where the value ``True`` if the\n feature is deprecated, ``False`` otherwise (``{<Feature1>:<deprecated>, <Feature2>:<deprecated>, ...}``).\n\n This function is called at initialization, found features are stored in the ``featureNames`` variable.\n \"\"\"\n attributes = inspect.getmembers(cls)\n features = {a[0][3:-12]: getattr(a[1], '_is_deprecated', False) for a in attributes\n if a[0].startswith('get') and a[0].endswith('FeatureValue')}\n return features\n\n def execute(self):\n \"\"\"\n Calculates all features enabled in ``enabledFeatures``. A feature is enabled if it's key is present in this\n dictionary and it's value is True.\n\n Calculated values are stored in the ``featureValues`` dictionary, with feature name as key and the calculated\n feature value as value. If an exception is thrown during calculation, the error is logged, and the value is set to\n NaN.\n \"\"\"\n if self.voxelBased:\n self._calculateVoxels()\n else:\n self._calculateSegment()\n\n return self.featureValues\n\n @deprecated\n def calculateFeatures(self):\n self.logger.warning('calculateFeatures() is deprecated, use execute() instead.')\n self.execute()\n\n def _calculateVoxels(self):\n initValue = self.settings.get('initValue', 0)\n voxelBatch = self.settings.get('voxelBatch', -1)\n\n # Initialize the output with empty numpy arrays\n for feature, enabled in six.iteritems(self.enabledFeatures):\n if enabled:\n self.featureValues[feature] = numpy.full(list(self.inputImage.GetSize())[::-1], initValue, dtype='float')\n\n # Calculate the feature values for all enabled features\n voxel_count = self.labelledVoxelCoordinates.shape[1]\n voxel_batch_idx = 0\n if voxelBatch < 0:\n voxelBatch = voxel_count\n n_batches = numpy.ceil(float(voxel_count) / voxelBatch)\n while voxel_batch_idx < voxel_count:\n self.logger.debug('Calculating voxel batch no. %i/%i', int(voxel_batch_idx / voxelBatch) + 1, n_batches)\n voxelCoords = self.labelledVoxelCoordinates[:, voxel_batch_idx:voxel_batch_idx + voxelBatch]\n # Calculate the feature values for the current kernel\n for success, featureName, featureValue in self._calculateFeatures(voxelCoords):\n if success:\n self.featureValues[featureName][tuple(voxelCoords)] = featureValue\n\n voxel_batch_idx += voxelBatch\n\n # Convert the output to simple ITK image objects\n for feature, enabled in six.iteritems(self.enabledFeatures):\n if enabled:\n self.featureValues[feature] = sitk.GetImageFromArray(self.featureValues[feature])\n self.featureValues[feature].CopyInformation(self.inputImage)\n\n def _calculateSegment(self):\n # Get the feature values using the current segment.\n for success, featureName, featureValue in self._calculateFeatures():\n # Always store the result. In case of an error, featureValue will be NaN\n self.featureValues[featureName] = numpy.squeeze(featureValue)\n\n def _calculateFeatures(self, voxelCoordinates=None):\n # Initialize the calculation\n # This function serves to calculate the texture matrices where applicable\n self._initCalculation(voxelCoordinates)\n self.logger.debug('Calculating features')\n for feature, enabled in six.iteritems(self.enabledFeatures):\n if enabled:\n try:\n # Use getattr to get the feature calculation methods, then use '()' to evaluate those methods\n yield True, feature, getattr(self, 'get%sFeatureValue' % feature)()\n except DeprecationWarning as deprecatedFeature:\n # Add a debug log message, as a warning is usually shown and would entail a too verbose output\n self.logger.debug('Feature %s is deprecated: %s', feature, deprecatedFeature.message)\n except Exception:\n self.logger.error('FAILED: %s', traceback.format_exc())\n yield False, feature, numpy.nan\n" ]
[ [ "pandas.merge", "pandas.read_csv" ], [ "numpy.unique", "numpy.squeeze", "numpy.ones", "numpy.max", "numpy.where" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "2.0", "1.4", "1.3", "1.1", "1.5", "1.2" ], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
eldarbaykiev/magtess-inversion-python
[ "e775fb0393c00eff9871cfa3e40c5784a89f3e5e" ]
[ "gmi_create_design_matrix.py" ]
[ "def main(dr):\n\n #**************** TESTING PARAMS (WOULD BE REMOVED)*******#\n TRUNCATE = True\n #**************** ---------------------------------*******#\n\n\n\n import gmi_misc\n #**************** PRINT HEADER ***************************#\n gmi_misc.print_header()\n print (\"Script no. 3: Creation of design matrices\")\n #**************** ------------ ***************************#\n\n\n #**************** GET WORKING DIRECTORY ******************#\n import os\n old_cwd = os.getcwd()\n gmi_misc.info('Current directory: '+ old_cwd)\n\n try:\n os.chdir(dr)\n except:\n gmi_misc.error('CAN NOT OPEN WORKING DIRECTORY '+ dr + ', ABORTING...')\n\n gmi_misc.info('WORKING DIRECTORY: '+ os.getcwd())\n #**************** --------------------- ******************#\n\n\n\n #**************** read parameters from file **************#\n import gmi_config\n gmi_config.read_config()\n #**************** ------------------------- **************#\n\n\n\n #************ check if previous stages were launched *****#\n import gmi_hash\n stages = [0,0,0]\n stages, dictionary = gmi_hash.read_dict('checksums.npy')\n\n if __name__ == '__main__':\n err = 0\n if stages[0] == -1:\n err += 1\n gmi_misc.warning('model.magtess was changed after the run of Script 1, restart Script no. 1 first! ABORTING...')\n elif stages[0] == 0:\n err += 1\n gmi_misc.warning('model.magtess was changed after the run of Script 1, restart Script no. 1 first! ABORTING...')\n else:\n pass\n\n if stages[1] == -1:\n err += 1\n gmi_misc.warning('Folder model was changed after the run of Script 2, restart Script no. 2 first! ABORTING...')\n elif stages[1] == 0:\n err += 1\n gmi_misc.warning('Folder model was changed after the run of Script 2, restart Script no. 2 first! ABORTING...')\n else:\n pass\n\n if err > 0:\n gmi_misc.error('CHECKSUM FAILED, ABORTING!')\n\n #**************** --------------------- ******************#\n\n\n\n #**************** CREATE DESIGN MATRICES *****************#\n import os\n import glob\n\n os.chdir('model')\n coefflist = glob.glob(\"*.coeff\")\n os.chdir('..')\n\n n_tess = len(coefflist)\n if n_tess == 0:\n gmi_misc.error(\"NO CALCULATED SH MODELS OF EACH TESSEROID'S MAGNETIC FIELD\")\n exit(-1)\n\n if gmi_config.MULTIPLICATOR != 1.0:\n gmi_misc.warning(\"NOTE: SUSCEPTIBILITY OF EACH TESSEROID IS MULTIPLIED BY \"+ str(gmi_config.MULTIPLICATOR))\n\n import pyshtools\n import numpy as np\n\n coeff_filename = 'model/tess_n' + str(0) + '.coeff'\n\n b = gmi_misc.read_coeffs_from_text_file(coeff_filename, gmi_config.N_MIN_CUTOFF)\n n_vals = len(b)\n\n gmi_misc.message('Assemblying design matrices...')\n from tqdm import tqdm\n A = np.zeros((n_tess, n_vals))\n A_ufilt = np.zeros((n_tess, n_vals))\n\n\n\n\n\n #if __name__ == '__main__':\n for i in tqdm(range(n_tess)):\n coeff_filename = 'model/tess_n' + str(i) + '.coeff'\n\n b = gmi_misc.read_coeffs_from_text_file(coeff_filename, gmi_config.N_MIN_CUTOFF)\n b_ufilt = gmi_misc.read_coeffs_from_text_file(coeff_filename, 0)\n A[i, :] = b[:]\n A_ufilt[i, :] = b_ufilt[:]\n '''\n else:\n from PyQt5 import QtWidgets\n\n app = QtWidgets.QApplication.instance()\n if app is None:\n # if it does not exist then a QApplication is created\n app = QtWidgets.QApplication([])\n\n from progress_bar import ProgressBar\n pb = ProgressBar()\n\n for i in range(n_tess):\n coeff_filename = 'model/tess_n' + str(i) + '.coeff'\n\n b = gmi_misc.read_coeffs_from_text_file(coeff_filename, gmi_config.N_MIN_CUTOFF)\n b_ufilt = gmi_misc.read_coeffs_from_text_file(coeff_filename, 0)\n A[i, :] = b[:]\n A_ufilt[i, :] = b_ufilt[:]\n\n pb.setValue(((i + 1) / n_tess) * 100)\n app.processEvents()\n\n pb.close()\n '''\n\n gmi_misc.ok('...done')\n\n #**************** SAVE MATRICES *****************#\n\n np.save('design_matrix_shcoeff', A)\n np.save('design_matrix_ufilt_shcoeff', A_ufilt)\n\n #**************** ------------- *****************#\n\n\n\n #**************** WRITE MD5 PARAMS **************#\n import hashlib\n SHAhash = hashlib.md5()\n\n f1 = open('design_matrix_shcoeff.npy', 'rb')\n while 1:\n # Read file in as little chunks\n buf = f1.read(4096)\n if not buf : break\n SHAhash.update(hashlib.md5(buf).hexdigest().encode('utf-8'))\n f1.close()\n\n\n f2 = open('design_matrix_ufilt_shcoeff.npy', 'rb')\n while 1:\n # Read file in as little chunks\n buf = f2.read(4096)\n if not buf : break\n SHAhash.update(hashlib.md5(buf).hexdigest().encode('utf-8'))\n f2.close()\n\n dictionary['stage3'] = SHAhash.hexdigest()\n dictionary['stage4'] = ''\n np.save('checksums.npy', dictionary)\n #**************** ---------------- **************#\n\n\n\n\n #**************** RETURN BACK TO INITIAL PATH ***#\n os.chdir(old_cwd)\n\n #**************** --------------------------- ***#\n\n\nif __name__ == '__main__':\n #**************** GET WORKING DIRECTORY ******************#\n\n WORKING_DIR = ''\n import sys\n if len(sys.argv) == 1:\n WORKING_DIR = ''\n\n WORKING_DIR = sys.argv[1]\n\n #**************** --------------------- ******************#\n main(WORKING_DIR)\n" ]
[ [ "numpy.zeros", "numpy.save" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
Unbabel/caption
[ "90725dbf5bc3809e0364d20d0837c58968ceb2b1" ]
[ "caption/models/utils.py" ]
[ "# -*- coding: utf-8 -*-\nimport torch\nfrom caption.tokenizers import TextEncoderBase\n\n\ndef mask_fill(\n fill_value: float,\n tokens: torch.tensor,\n embeddings: torch.tensor,\n padding_index: int,\n) -> torch.tensor:\n \"\"\"\n Function that masks embeddings representing padded elements.\n :param fill_value: the value to fill the embeddings belonging to padded tokens.\n :param tokens: The input sequences [bsz x seq_len].\n :param embeddings: word embeddings [bsz x seq_len x hiddens].\n :param padding_index: Index of the padding token.\n \"\"\"\n padding_mask = tokens.eq(padding_index).unsqueeze(-1)\n return embeddings.float().masked_fill_(padding_mask, fill_value).type_as(embeddings)\n\n\ndef mask_tokens(\n inputs: torch.tensor,\n tokenizer: TextEncoderBase,\n mlm_probability: float = 0.15,\n ignore_index: int = -100,\n):\n \"\"\" Mask tokens function from Hugging Face that prepares masked tokens inputs/labels for \n masked language modeling.\n\n :param inputs: Input tensor to be masked.\n :param tokenizer: COMET text encoder.\n :param mlm_probability: Probability of masking a token (default: 15%).\n :param ignore_index: Specifies a target value that is ignored and does not contribute to \n the input gradient (default: -100).\n\n Returns:\n - Tuple with input to the model and the target.\n \"\"\"\n if tokenizer.mask_index is None:\n raise ValueError(\n \"This tokenizer does not have a mask token which is necessary for masked language\"\n \"modeling. Remove the --mlm flag if you want to use this tokenizer.\"\n )\n\n labels = inputs.clone()\n probability_matrix = torch.full(labels.shape, mlm_probability)\n special_tokens_mask = [\n tokenizer.get_special_tokens_mask(val) for val in labels.tolist()\n ]\n probability_matrix.masked_fill_(\n torch.tensor(special_tokens_mask, dtype=torch.bool), value=0.0\n )\n padding_mask = labels.eq(tokenizer.padding_index)\n probability_matrix.masked_fill_(padding_mask, value=0.0)\n\n masked_indices = torch.bernoulli(probability_matrix).bool()\n labels[~masked_indices] = ignore_index # We only compute loss on masked tokens\n\n # 80% of the time, we replace masked input tokens with ([MASK])\n indices_replaced = (\n torch.bernoulli(torch.full(labels.shape, 0.8)).bool() & masked_indices\n )\n\n inputs[indices_replaced] = tokenizer.mask_index\n\n # 10% of the time, we replace masked input tokens with random word\n indices_random = (\n torch.bernoulli(torch.full(labels.shape, 0.5)).bool()\n & masked_indices\n & ~indices_replaced\n )\n random_words = torch.randint(tokenizer.vocab_size, labels.shape, dtype=torch.long)\n inputs[indices_random] = random_words[indices_random]\n\n # The rest of the time (10% of the time) we keep the masked input tokens unchanged\n return inputs, labels\n" ]
[ [ "torch.randint", "torch.bernoulli", "torch.full", "torch.tensor" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
leidian977/bert
[ "d7a54fce83a5678777a02bc50176e7fa527d7f9f" ]
[ "tokenization_test.py" ]
[ "# coding=utf-8\r\n# Copyright 2018 The Google AI Language Team Authors.\r\n#\r\n# Licensed under the Apache License, Version 2.0 (the \"License\");\r\n# you may not use this file except in compliance with the License.\r\n# You may obtain a copy of the License at\r\n#\r\n# http://www.apache.org/licenses/LICENSE-2.0\r\n#\r\n# Unless required by applicable law or agreed to in writing, software\r\n# distributed under the License is distributed on an \"AS IS\" BASIS,\r\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\r\n# See the License for the specific language governing permissions and\r\n# limitations under the License.\r\nfrom __future__ import absolute_import\r\nfrom __future__ import division\r\nfrom __future__ import print_function\r\n\r\nimport os\r\nimport tempfile\r\n\r\nimport tokenization\r\nimport tensorflow as tf\r\n\r\n\r\nclass TokenizationTest(tf.test.TestCase):\r\n\r\n def test_full_tokenizer(self):\r\n vocab_tokens = [\r\n \"[UNK]\", \"[CLS]\", \"[SEP]\", \"want\", \"##want\", \"##ed\", \"wa\", \"un\", \"runn\",\r\n \"##ing\", \",\"\r\n ]\r\n with tempfile.NamedTemporaryFile(delete=False) as vocab_writer:\r\n vocab_writer.write(\"\".join([x + \"\\n\" for x in vocab_tokens]))\r\n\r\n vocab_file = vocab_writer.name\r\n\r\n tokenizer = tokenization.FullTokenizer(vocab_file)\r\n os.unlink(vocab_file)\r\n\r\n tokens = tokenizer.tokenize(u\"UNwant\\u00E9d,running\")\r\n self.assertAllEqual(tokens, [\"un\", \"##want\", \"##ed\", \",\", \"runn\", \"##ing\"])\r\n\r\n self.assertAllEqual(\r\n tokenizer.convert_tokens_to_ids(tokens), [7, 4, 5, 10, 8, 9])\r\n\r\n def test_chinese(self):\r\n tokenizer = tokenization.BasicTokenizer()\r\n\r\n self.assertAllEqual(\r\n tokenizer.tokenize(u\"ah\\u535A\\u63A8zz\"),\r\n [u\"ah\", u\"\\u535A\", u\"\\u63A8\", u\"zz\"])\r\n\r\n def test_basic_tokenizer_lower(self):\r\n tokenizer = tokenization.BasicTokenizer(do_lower_case=True)\r\n\r\n self.assertAllEqual(\r\n tokenizer.tokenize(u\" \\tHeLLo!how \\n Are yoU? \"),\r\n [\"hello\", \"!\", \"how\", \"are\", \"you\", \"?\"])\r\n self.assertAllEqual(tokenizer.tokenize(u\"H\\u00E9llo\"), [\"hello\"])\r\n\r\n def test_basic_tokenizer_no_lower(self):\r\n tokenizer = tokenization.BasicTokenizer(do_lower_case=False)\r\n\r\n self.assertAllEqual(\r\n tokenizer.tokenize(u\" \\tHeLLo!how \\n Are yoU? \"),\r\n [\"HeLLo\", \"!\", \"how\", \"Are\", \"yoU\", \"?\"])\r\n\r\n def test_wordpiece_tokenizer(self):\r\n vocab_tokens = [\r\n \"[UNK]\", \"[CLS]\", \"[SEP]\", \"want\", \"##want\", \"##ed\", \"wa\", \"un\", \"runn\",\r\n \"##ing\"\r\n ]\r\n\r\n vocab = {}\r\n for (i, token) in enumerate(vocab_tokens):\r\n vocab[token] = i\r\n tokenizer = tokenization.WordpieceTokenizer(vocab=vocab)\r\n\r\n self.assertAllEqual(tokenizer.tokenize(\"\"), [])\r\n\r\n self.assertAllEqual(\r\n tokenizer.tokenize(\"unwanted running\"),\r\n [\"un\", \"##want\", \"##ed\", \"runn\", \"##ing\"])\r\n\r\n self.assertAllEqual(\r\n tokenizer.tokenize(\"unwantedX running\"), [\"[UNK]\", \"runn\", \"##ing\"])\r\n\r\n def test_convert_tokens_to_ids(self):\r\n vocab_tokens = [\r\n \"[UNK]\", \"[CLS]\", \"[SEP]\", \"want\", \"##want\", \"##ed\", \"wa\", \"un\", \"runn\",\r\n \"##ing\"\r\n ]\r\n\r\n vocab = {}\r\n for (i, token) in enumerate(vocab_tokens):\r\n vocab[token] = i\r\n\r\n self.assertAllEqual(\r\n tokenization.convert_tokens_to_ids(\r\n vocab, [\"un\", \"##want\", \"##ed\", \"runn\", \"##ing\"]), [7, 4, 5, 8, 9])\r\n\r\n def test_is_whitespace(self):\r\n self.assertTrue(tokenization._is_whitespace(u\" \"))\r\n self.assertTrue(tokenization._is_whitespace(u\"\\t\"))\r\n self.assertTrue(tokenization._is_whitespace(u\"\\r\"))\r\n self.assertTrue(tokenization._is_whitespace(u\"\\n\"))\r\n self.assertTrue(tokenization._is_whitespace(u\"\\u00A0\"))\r\n\r\n self.assertFalse(tokenization._is_whitespace(u\"A\"))\r\n self.assertFalse(tokenization._is_whitespace(u\"-\"))\r\n\r\n def test_is_control(self):\r\n self.assertTrue(tokenization._is_control(u\"\\u0005\"))\r\n\r\n self.assertFalse(tokenization._is_control(u\"A\"))\r\n self.assertFalse(tokenization._is_control(u\" \"))\r\n self.assertFalse(tokenization._is_control(u\"\\t\"))\r\n self.assertFalse(tokenization._is_control(u\"\\r\"))\r\n\r\n def test_is_punctuation(self):\r\n self.assertTrue(tokenization._is_punctuation(u\"-\"))\r\n self.assertTrue(tokenization._is_punctuation(u\"$\"))\r\n self.assertTrue(tokenization._is_punctuation(u\"`\"))\r\n self.assertTrue(tokenization._is_punctuation(u\".\"))\r\n\r\n self.assertFalse(tokenization._is_punctuation(u\"A\"))\r\n self.assertFalse(tokenization._is_punctuation(u\" \"))\r\n\r\n\r\nif __name__ == \"__main__\":\r\n tf.test.main()\r\n" ]
[ [ "tensorflow.test.main" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
GeoscienceAustralia/uncoverml
[ "672914377afa4ad1c069fcd4845bc45f80132e36", "672914377afa4ad1c069fcd4845bc45f80132e36" ]
[ "tests/test_cubist.py", "uncoverml/models.py" ]
[ "\nimport numpy as np\nfrom sklearn.metrics import r2_score\n\nfrom uncoverml.cubist import Cubist, MultiCubist\n\n# Declare some test data taken from the boston houses dataset\nx = np.array([\n [0.006, 18.00, 2.310, 0.5380, 6.5750, 65.20, 4.0900, 1, 296.0, 15.30],\n [0.027, 0.00, 7.070, 0.4690, 6.4210, 78.90, 4.9671, 2, 242.0, 17.80],\n [0.027, 0.00, 7.070, 0.4690, 7.1850, 61.10, 4.9671, 2, 242.0, 17.80],\n [0.032, 0.00, 2.180, 0.4580, 6.9980, 45.80, 6.0622, 3, 222.0, 18.70],\n [0.069, 0.00, 2.180, 0.4580, 7.1470, 54.20, 6.0622, 3, 222.0, 18.70],\n [0.029, 0.00, 2.180, 0.4580, 6.4300, 58.70, 6.0622, 3, 222.0, 18.70],\n [0.088, 12.50, 7.870, 0.5240, 6.0120, 66.60, 5.5605, 5, 311.0, 15.20],\n [0.144, 12.50, 7.870, 0.5240, 6.1720, 96.10, 5.9505, 5, 311.0, 15.20],\n [0.211, 12.50, 7.870, 0.5240, 5.6310, 100.00, 6.0821, 5, 311.0, 15.20],\n [0.170, 12.50, 7.870, 0.5240, 6.0040, 85.90, 6.5921, 5, 311.0, 15.20],\n [0.224, 12.50, 7.870, 0.5240, 6.3770, 94.30, 6.3467, 5, 311.0, 15.20],\n [0.117, 12.50, 7.870, 0.5240, 6.0090, 82.90, 6.2267, 5, 311.0, 15.20],\n [0.093, 12.50, 7.870, 0.5240, 5.8890, 39.00, 5.4509, 5, 311.0, 15.20],\n [0.629, 0.00, 8.140, 0.5380, 5.9490, 61.80, 4.7075, 4, 307.0, 21.00],\n [0.637, 0.00, 8.140, 0.5380, 6.0960, 84.50, 4.4619, 4, 307.0, 21.00]])\n\ny = np.array([24.00, 21.60, 34.70, 33.40, 36.20, 28.70, 22.90, 27.10,\n 16.50, 18.90, 15.00, 18.90, 21.70, 20.40, 18.2])\n\n\ndef test_correct_range():\n\n # Fit the data\n predictor = Cubist(print_output=False,\n sampling=90, seed=0, committee_members=2)\n predictor.fit(x, y)\n\n # Predict the output\n y_pred = predictor.predict(x)\n\n # Assert that the true y is similar to the prediction\n score = r2_score(y, y_pred)\n assert 0.68 < score < 0.8\n\n\ndef test_correct_range_with_sampling():\n\n # Fit the data\n predictor = Cubist(print_output=False,\n sampling=90, seed=10, committee_members=2)\n predictor.fit(x, y)\n\n # Predict the output\n y_pred = predictor.predict(x)\n\n # Assert that the true y is similar to the prediction\n score = r2_score(y, y_pred)\n assert 0.68 < score < 0.73\n\n\ndef test_multicubist():\n predictor = MultiCubist(print_output=False,\n trees=5,\n sampling=90,\n seed=1,\n neighbors=1)\n predictor.fit(x, y)\n\n # Predict the output\n y_pred = predictor.predict(x)\n\n # Assert that the true y is similar to the prediction\n score = r2_score(y, y_pred)\n assert 0.5 < score < 0.8\n\n\ndef test_multicibist_mpi(mpisync):\n \"\"\"\n run this with something like:\n \"mpirun -np 4 py.test ../tests/test_cubist.py::test_multicubist_mpi\"\n\n \"\"\"\n\n predictor = MultiCubist(trees=10,\n sampling=60,\n seed=1,\n neighbors=1,\n committee_members=5,\n parallel=True)\n predictor.fit(x, y)\n\n # Predict the output\n y_pred_p = predictor.predict(x)\n\n score = r2_score(y, y_pred_p)\n\n assert 0.5 < score < 0.8\n", "\"\"\"\nModel Objects and ML algorithm serialisation.\n\nThis module makes many of the models in `scikit learn\n<http://scikit-learn.org/>`_ and \n`revrand <https://github.com/NICTA/revrand>`_ available to our \npipeline, as well as augmenting their functionality with, for examples, \ntarget transformations.\n\nThis table is a quick breakdown of the advantages and disadvantages of \nthe various algorithms we can use in this pipeline.\n\n========================== ==================== ================== ================ =============\nAlgorithm Learning Scalability Modelling Capacity Prediction Speed Probabilistic\n========================== ==================== ================== ================ =============\nBayesian linear regression \\+ \\+ \\+ \\+ \\+ \\+ \\+ \\+ Yes\nApprox. Gaussian process \\+ \\+ \\+ \\+ \\+ \\+ \\+ \\+ \\+ \\+ Yes\nSGD linear regression \\+ \\+ \\+ \\+ \\+ \\+ \\+ \\+ Yes\nSGD Gaussian process \\+ \\+ \\+ \\+ \\+ \\+ \\+ \\+ \\+ \\+ \\+ Yes\nSupport Vector Regression \\+ \\+ \\+ \\+ \\+ \\+ No\nRandom Forest Regression \\+ \\+ \\+ \\+ \\+ \\+ \\+ \\+ \\+ Pseudo\nCubist Regression \\+ \\+ \\+ \\+ \\+ \\+ \\+ \\+ \\+ Pseudo\nARD Regression \\+ \\+ \\+ \\+ \\+ \\+ \\+ No\nExtremely Randomized Reg. \\+ \\+ \\+ \\+ \\+ \\+ \\+ \\+ \\+ No\nDecision Tree Regression \\+ \\+ \\+ \\+ \\+ \\+ \\+ \\+ \\+ \\+ No\n========================== ==================== ================== ================ =============\n\"\"\"\nimport inspect\nimport os\nimport pickle\nimport warnings\nimport logging\nfrom itertools import chain\nfrom os.path import join, isdir, abspath\nimport numpy as np\nfrom revrand import StandardLinearModel, GeneralisedLinearModel\nfrom revrand.basis_functions import LinearBasis, RandomRBF, \\\n RandomLaplace, RandomCauchy, RandomMatern32, RandomMatern52\nfrom revrand.btypes import Parameter, Positive\nfrom revrand.likelihoods import Gaussian\nfrom revrand.optimize import Adam\nfrom revrand.utils import atleast_list\nfrom scipy.integrate import fixed_quad\nfrom scipy.stats import norm\n\nfrom sklearn.svm import SVR, SVC\nfrom sklearn.ensemble import (RandomForestRegressor as RFR,\n RandomForestClassifier as RFC,\n GradientBoostingClassifier)\nfrom sklearn.linear_model import ARDRegression, LogisticRegression\nfrom sklearn.tree import DecisionTreeRegressor, ExtraTreeRegressor\nfrom sklearn.neighbors import KNeighborsRegressor\nfrom sklearn.preprocessing import LabelEncoder\nfrom sklearn.kernel_approximation import RBFSampler\n\nfrom uncoverml import mpiops\nfrom uncoverml.resampling import bootstrap_data_indicies\nfrom uncoverml.interpolate import SKLearnNearestNDInterpolator, \\\n SKLearnLinearNDInterpolator, SKLearnRbf, SKLearnCT\nfrom uncoverml.cubist import Cubist\nfrom uncoverml.cubist import MultiCubist\nfrom uncoverml.transforms import target as transforms\nwarnings.filterwarnings(\"ignore\", category=DeprecationWarning)\n#\n# Module constants\n#\n\n_logger = logging.getLogger(__name__)\nQUADORDER = 5 # Order of quadrature used for transforming probabilistic vals\n\n\n#\n# Mixin classes for providing pipeline compatibility to revrand\n#\n\nclass BasisMakerMixin():\n \"\"\"\n Mixin class for easily creating approximate kernel functions for revrand.\n\n This is primarily used for the approximate Gaussian process algorithms.\n \"\"\"\n\n def fit(self, X, y, *args, **kwargs):\n\n self._make_basis(X)\n return super().fit(X, y, *args, **kwargs) # args for GLMs\n\n def _store_params(self, kernel, regulariser, nbases, lenscale, ard):\n\n self.kernel = kernel\n self.nbases = nbases\n self.ard = ard\n self.lenscale = lenscale if np.isscalar(lenscale) \\\n else np.asarray(lenscale)\n self.regulariser = Parameter(regulariser, Positive())\n\n def _make_basis(self, X):\n\n D = X.shape[1]\n lenscale = self.lenscale\n if self.ard and D > 1:\n lenscale = np.ones(D) * lenscale\n lenscale_init = Parameter(lenscale, Positive())\n gpbasis = basismap[self.kernel](Xdim=X.shape[1], nbases=self.nbases,\n lenscale=lenscale_init,\n regularizer=self.regulariser)\n\n self.basis = gpbasis + LinearBasis()\n\n\nclass PredictDistMixin():\n \"\"\"\n Mixin class for providing a ``predict_dist`` method to the\n StandardLinearModel class in revrand.\n \"\"\"\n\n def predict_dist(self, X, interval=0.95, *args, **kwargs):\n \"\"\"\n Predictive mean and variance for a probabilistic regressor.\n\n Parameters\n ----------\n X: ndarray\n (Ns, d) array query dataset (Ns samples, d dimensions).\n interval: float, optional\n The percentile confidence interval (e.g. 95%) to return.\n fields: dict, optional\n dictionary of fields parsed from the shape file.\n ``indicator_field`` should be a key in this dictionary. If this is\n not present, then a Gaussian likelihood will be used for all\n predictions. The only time this may be input if for cross\n validation.\n\n Returns\n -------\n Ey: ndarray\n The expected value of ys for the query inputs, X of shape (Ns,).\n Vy: ndarray\n The expected variance of ys (excluding likelihood noise terms) for\n the query inputs, X of shape (Ns,).\n ql: ndarray\n The lower end point of the interval with shape (Ns,)\n qu: ndarray\n The upper end point of the interval with shape (Ns,)\n \"\"\"\n\n Ey, Vy = self.predict_moments(X, *args, **kwargs)\n ql, qu = norm.interval(interval, loc=Ey, scale=np.sqrt(Vy))\n\n return Ey, Vy, ql, qu\n\n\nclass GLMPredictDistMixin():\n \"\"\"\n Mixin class for providing a ``predict_dist`` method to the\n GeneralisedLinearModel class in revrand.\n\n This is especially for use with Gaussian likelihood models.\n \"\"\"\n\n def predict_dist(self, X, interval=0.95, *args, **kwargs):\n \"\"\"\n Predictive mean and variance for a probabilistic regressor.\n\n Parameters\n ----------\n X: ndarray\n (Ns, d) array query dataset (Ns samples, d dimensions).\n interval: float, optional\n The percentile confidence interval (e.g. 95%) to return.\n fields: dict, optional\n dictionary of fields parsed from the shape file.\n ``indicator_field`` should be a key in this dictionary. If this is\n not present, then a Gaussian likelihood will be used for all\n predictions. The only time this may be input if for cross\n validation.\n\n Returns\n -------\n Ey: ndarray\n The expected value of ys for the query inputs, X of shape (Ns,).\n Vy: ndarray\n The expected variance of ys (excluding likelihood noise terms) for\n the query inputs, X of shape (Ns,).\n ql: ndarray\n The lower end point of the interval with shape (Ns,)\n qu: ndarray\n The upper end point of the interval with shape (Ns,)\n \"\"\"\n\n Ey, Vy = self.predict_moments(X, *args, **kwargs)\n Vy += self.like_hypers_\n ql, qu = norm.interval(interval, loc=Ey, scale=np.sqrt(Vy))\n\n return Ey, Vy, ql, qu\n\n\nclass MutualInfoMixin():\n \"\"\"\n Mixin class for providing predictive entropy reduction functionality to the\n StandardLinearModel class (only).\n \"\"\"\n\n def entropy_reduction(self, X):\n \"\"\"\n Predictice entropy reduction (a.k.a mutual information).\n\n Estimate the reduction in the posterior distribution's entropy (i.e.\n model uncertainty reduction) as a result of including a particular\n observation.\n\n Parameters\n ----------\n X: ndarray\n (Ns, d) array query dataset (Ns samples, d dimensions).\n\n Returns\n -------\n MI: ndarray\n Prediction of mutual information (expected reduiction in posterior\n entrpy) assocated with each query input. The units are 'nats', and\n the shape of the returned array is (Ns,).\n \"\"\"\n Phi = self.basis.transform(X, *atleast_list(self.hypers_))\n pCp = [p.dot(self.covariance_).dot(p.T) for p in Phi]\n MI = 0.5 * (np.log(self.var_ + np.array(pCp)) - np.log(self.var_))\n return MI\n\n\nclass TagsMixin():\n \"\"\"\n Mixin class to aid a pipeline in establishing the types of predictive\n outputs to be expected from the ML algorithms in this module.\n \"\"\"\n\n def get_predict_tags(self):\n \"\"\"\n Get the types of prediction outputs from this algorithm.\n\n Returns\n -------\n list:\n of strings with the types of outputs that can be returned by this\n algorithm. This depends on the prediction methods implemented (e.g.\n ``predict``, `predict_dist``, ``entropy_reduction``).\n \"\"\"\n\n # Classification\n if hasattr(self, 'predict_proba'):\n tags = self.get_classes()\n return tags\n\n # Regression\n tags = ['Prediction']\n if hasattr(self, 'predict_dist'):\n tags.extend(['Variance', 'Lower quantile', 'Upper quantile'])\n\n if hasattr(self, 'entropy_reduction'):\n tags.append('Expected reduction in entropy')\n\n if hasattr(self, 'krige_residual'):\n tags.append('Kriged correction')\n\n if hasattr(self, 'ml_prediction'):\n tags.append('ml prediction')\n\n return tags\n\n\n#\n# Specialisation of revrand's interface to work from the command line with a\n# few curated algorithms\n#\n\nclass LinearReg(StandardLinearModel, PredictDistMixin, MutualInfoMixin):\n \"\"\"\n Bayesian standard linear model.\n\n Parameters\n ----------\n onescol: bool, optional\n If true, prepend a column of ones onto X (i.e. a bias term)\n var: Parameter, optional\n observation variance initial value.\n regulariser: Parameter, optional\n weight regulariser (variance) initial value.\n tol: float, optional\n optimiser function tolerance convergence criterion.\n maxiter: int, optional\n maximum number of iterations for the optimiser.\n nstarts : int, optional\n if there are any parameters with distributions as initial values, this\n determines how many random candidate starts shoulds be evaluated before\n commencing optimisation at the best candidate.\n \"\"\"\n\n def __init__(self, onescol=True, var=1., regulariser=1., tol=1e-8,\n maxiter=1000, nstarts=100):\n\n basis = LinearBasis(onescol=onescol,\n regularizer=Parameter(regulariser, Positive()))\n super().__init__(basis=basis,\n var=Parameter(var, Positive()),\n tol=tol,\n maxiter=maxiter,\n nstarts=nstarts\n )\n\n\nclass ApproxGP(BasisMakerMixin, StandardLinearModel, PredictDistMixin,\n MutualInfoMixin):\n \"\"\"\n An approximate Gaussian process for medium scale data.\n\n Parameters\n ----------\n kernel: str, optional\n the (approximate) kernel to use with this Gaussian process. Have a look\n at :code:`basismap` dictionary for appropriate kernel approximations.\n nbases: int\n how many unique random bases to create (twice this number will be\n actually created, i.e. real and imaginary components for each base).\n The higher this number, the more accurate the kernel approximation, but\n the longer the runtime of the algorithm. Usually if X is high\n dimensional, this will have to also be high dimensional.\n lenscale: float, optional\n the initial value for the kernel length scale to be learned.\n ard: bool, optional\n Whether to use a different length scale for each dimension of X or a\n single length scale. This will result in a longer run time, but\n potentially better results.\n var: Parameter, optional\n observation variance initial value.\n regulariser: Parameter, optional\n weight regulariser (variance) initial value.\n tol: float, optional\n optimiser function tolerance convergence criterion.\n maxiter: int, optional\n maximum number of iterations for the optimiser.\n nstarts : int, optional\n if there are any parameters with distributions as initial values, this\n determines how many random candidate starts shoulds be evaluated before\n commencing optimisation at the best candidate.\n \"\"\"\n\n def __init__(self, kernel='rbf', nbases=50, lenscale=1., var=1.,\n regulariser=1., ard=True, tol=1e-8, maxiter=1000,\n nstarts=100):\n\n super().__init__(basis=None,\n var=Parameter(var, Positive()),\n tol=tol,\n maxiter=maxiter,\n nstarts=nstarts\n )\n\n self._store_params(kernel, regulariser, nbases, lenscale, ard)\n\n\nclass SGDLinearReg(GeneralisedLinearModel, GLMPredictDistMixin):\n \"\"\"\n Bayesian standard linear model, using stochastic gradients.\n\n This uses the Adam stochastic gradients algorithm;\n http://arxiv.org/pdf/1412.6980\n\n Parameters\n ----------\n onescol: bool, optional\n If true, prepend a column of ones onto X (i.e. a bias term)\n var: Parameter, optional\n observation variance initial value.\n regulariser: Parameter, optional\n weight regulariser (variance) initial value.\n maxiter: int, optional\n Number of iterations to run for the stochastic gradients algorithm.\n batch_size: int, optional\n number of observations to use per SGD batch.\n alpha: float, optional\n stepsize to give the stochastic gradient optimisation update.\n beta1: float, optional\n smoothing/decay rate parameter for the stochastic gradient, must be\n [0, 1].\n beta2: float, optional\n smoothing/decay rate parameter for the squared stochastic gradient,\n must be [0, 1].\n epsilon: float, optional\n \"jitter\" term to ensure continued learning in stochastic gradients\n (should be small).\n random_state: int or RandomState, optional\n random seed\n nstarts : int, optional\n if there are any parameters with distributions as initial values, this\n determines how many random candidate starts shoulds be evaluated before\n commencing optimisation at the best candidate.\n Note\n ----\n Setting the ``random_state`` may be important for getting consistent\n looking predictions when many chunks/subchunks are used. This is because\n the predictive distribution is sampled for these algorithms!\n \"\"\"\n\n def __init__(self, onescol=True, var=1., regulariser=1., maxiter=3000,\n batch_size=10, alpha=0.01, beta1=0.9, beta2=0.99,\n epsilon=1e-8, random_state=None, nstarts=500):\n basis = LinearBasis(onescol=onescol,\n regularizer=Parameter(regulariser, Positive()))\n super().__init__(likelihood=Gaussian(Parameter(var, Positive())),\n basis=basis,\n maxiter=maxiter,\n batch_size=batch_size,\n updater=Adam(alpha, beta1, beta2, epsilon),\n random_state=random_state,\n nstarts=nstarts\n )\n\n\nclass SGDApproxGP(BasisMakerMixin, GeneralisedLinearModel,\n GLMPredictDistMixin):\n \"\"\"\n An approximate Gaussian process for large scale data using stochastic\n gradients.\n\n This uses the Adam stochastic gradients algorithm;\n http://arxiv.org/pdf/1412.6980\n\n Parameters\n ----------\n kern: str, optional\n the (approximate) kernel to use with this Gaussian process. Have a look\n at :code:`basismap` dictionary for appropriate kernel approximations.\n nbases: int\n how many unique random bases to create (twice this number will be\n actually created, i.e. real and imaginary components for each base).\n The higher this number, the more accurate the kernel approximation, but\n the longer the runtime of the algorithm. Usually if X is high\n dimensional, this will have to also be high dimensional.\n lenscale: float, optional\n the initial value for the kernel length scale to be learned.\n ard: bool, optional\n Whether to use a different length scale for each dimension of X or a\n single length scale. This will result in a longer run time, but\n potentially better results.\n var: float, optional\n observation variance initial value.\n regulariser: float, optional\n weight regulariser (variance) initial value.\n maxiter: int, optional\n Number of iterations to run for the stochastic gradients algorithm.\n batch_size: int, optional\n number of observations to use per SGD batch.\n alpha: float, optional\n stepsize to give the stochastic gradient optimisation update.\n beta1: float, optional\n smoothing/decay rate parameter for the stochastic gradient, must be\n [0, 1].\n beta2: float, optional\n smoothing/decay rate parameter for the squared stochastic gradient,\n must be [0, 1].\n epsilon: float, optional\n \"jitter\" term to ensure continued learning in stochastic gradients\n (should be small).\n random_state: int or RandomState, optional\n random seed\n nstarts : int, optional\n if there are any parameters with distributions as initial values, this\n determines how many random candidate starts shoulds be evaluated before\n commencing optimisation at the best candidate.\n Note\n ----\n Setting the ``random_state`` may be important for getting consistent\n looking predictions when many chunks/subchunks are used. This is because\n the predictive distribution is sampled for these algorithms!\n \"\"\"\n\n def __init__(self, kernel='rbf', nbases=50, lenscale=1., var=1.,\n regulariser=1., ard=True, maxiter=3000, batch_size=10,\n alpha=0.01, beta1=0.9, beta2=0.99, epsilon=1e-8,\n random_state=1, nstarts=500):\n\n super().__init__(likelihood=Gaussian(Parameter(var, Positive())),\n basis=None,\n maxiter=maxiter,\n batch_size=batch_size,\n updater=Adam(alpha, beta1, beta2, epsilon),\n random_state=random_state,\n nstarts=nstarts\n )\n self._store_params(kernel, regulariser, nbases, lenscale, ard)\n\n#\n# Approximate probabilistic output for Random Forest\n#\n\n\nclass RandomForestRegressor(RFR):\n \"\"\"\n Implements a \"probabilistic\" output by looking at the variance of the\n decision tree estimator ouputs.\n \"\"\"\n\n def predict_dist(self, X, interval=0.95):\n if hasattr(self, \"_notransform_predict\"):\n Ey = self._notransform_predict(X)\n else:\n Ey = self.predict(X)\n\n Vy = np.zeros_like(Ey)\n for dt in self.estimators_:\n Vy += (dt.predict(X) - Ey)**2\n\n Vy /= len(self.estimators_)\n\n # FIXME what if elements of Vy are zero?\n\n ql, qu = norm.interval(interval, loc=Ey, scale=np.sqrt(Vy))\n\n return Ey, Vy, ql, qu\n\n\nclass RandomForestRegressorMulti():\n\n def __init__(self,\n outdir='.',\n forests=10,\n parallel=True,\n n_estimators=10,\n random_state=1,\n **kwargs):\n self.forests = forests\n self.n_estimators = n_estimators\n self.parallel = parallel\n self.kwargs = kwargs\n self.random_state = random_state\n self._trained = False\n self._randomforests = {}\n\n def fit(self, x, y, *args, **kwargs):\n if self.parallel:\n process_rfs = np.array_split(range(self.forests),\n mpiops.chunks)[mpiops.chunk_index]\n else:\n process_rfs = range(self.forests)\n\n for t in process_rfs:\n _logger.info(':mpi:training forest {} using process {}'.format(t, mpiops.chunk_index))\n\n np.random.seed(self.random_state + t)\n\n # change random state in each forest\n self.kwargs['random_state'] = np.random.randint(0, 10000)\n rf = RandomForestTransformed(\n n_estimators=self.n_estimators, **self.kwargs)\n rf.fit(x, y)\n if self.parallel: # used in training\n self._randomforests['rf_model_{}'.format(t)] = rf\n else: # used when parallel is false, i.e., during x-val\n self._randomforests['rf_model_{}_{}'.format(t, mpiops.chunk_index)] = rf\n if self.parallel:\n mpiops.comm.barrier()\n # Mark that we are now trained\n self._trained = True\n\n def predict_dist(self, x, interval=0.95, *args, **kwargs):\n # We can't make predictions until we have trained the model\n if not self._trained:\n _logger.warning(':mpi:Train first')\n return\n\n y_pred = np.zeros((x.shape[0], self.forests * self.n_estimators))\n\n for t in range(self.forests):\n if self.parallel: # used in training\n f = self._randomforests['rf_model_{}'.format(t)]\n else: # used when parallel is false, i.e., during x-val\n f = self._randomforests['rf_model_{}_{}'.format(t, mpiops.chunk_index)]\n for m, dt in enumerate(f.estimators_):\n y_pred[:, t * self.n_estimators + m] = dt.predict(x)\n\n y_mean = np.mean(y_pred, axis=1)\n y_var = np.var(y_pred, axis=1)\n\n # Determine quantiles\n ql, qu = norm.interval(interval, loc=y_mean, scale=np.sqrt(y_var))\n\n return y_mean, y_var, ql, qu\n\n def predict(self, x):\n return self.predict_dist(x)[0]\n\n#\n# Approximate large scale kernel classifier factory\n#\n\n\ndef kernelize(classifier):\n\n class ClassifierRBF:\n\n def __init__(self, gamma='auto', n_components=100, random_state=None,\n **kwargs):\n self.gamma = gamma\n self.n_components = n_components\n self.random_state = random_state\n self.clf = classifier(**kwargs)\n\n def fit(self, X, y):\n if self.gamma == 'auto':\n D = X.shape[1]\n self.gamma = 1 / D\n self.rbf = RBFSampler(\n gamma=self.gamma,\n n_components=self.n_components,\n random_state=self.random_state\n )\n\n self.clf.fit(self.rbf.fit_transform(X), y)\n return self\n\n def predict(self, X):\n p = self.clf.predict(self.rbf.transform(X))\n return p\n\n def predict_proba(self, X):\n p = self.clf.predict_proba(self.rbf.transform(X))\n return p\n\n return ClassifierRBF\n\n#\n# Bootstrap Model Factory\n#\n\ndef bootstrap_model(model):\n class BootstrappedModel():\n def __init__(self, n_models=100, parallel=True, *args, **kwargs):\n # 'bootstrap' attr is dinky workaround for checking if a \n # model is a bootstrap model (can't get at BootstrappedModel\n # class as it's in scope of factory function).\n self.__bootstrapped_model__ = 'bootstrap'\n self.n_models = n_models\n self.models = [model(*args, **kwargs) for i in range(self.n_models)]\n self.parallel = parallel\n\n def fit(self, X, y, lon_lat, *args, **kwargs):\n _logger.info('Training %s bootstrapped models', self.n_models)\n\n if self.parallel:\n models = np.array_split(self.models, mpiops.chunks)[mpiops.chunk_index]\n else:\n models = self.models\n\n for i, m in enumerate(models):\n inds = bootstrap_data_indicies(len(y), random_state=mpiops.chunk_index + 1 + i)\n bsx = X[inds]\n bsy = y[inds]\n m.fit(bsx, bsy)\n _logger.info(':mpi:Trained model %s of %s', i + 1, len(models))\n\n if self.parallel:\n models = mpiops.comm.gather(models, root=0)\n if mpiops.chunk_index == 0:\n self.models = list(chain.from_iterable(models))\n\n\n def predict_dist(self, X, interval=0.95, bootstrap_predictions=None, *args, **kwargs):\n n_predictions = bootstrap_predictions if bootstrap_predictions is not None \\\n else len(self.models)\n model_chunks = self.models[:n_predictions]\n predictions = []\n for i, m in enumerate(model_chunks):\n _logger.info(f\":mpi:Predicting bootstrapped model %s of %s\", \n i + 1, len(model_chunks))\n predictions.append(m.predict(X, *args, **kwargs))\n\n predictions = np.array(predictions)\n y_mean = np.ma.mean(predictions, axis=0)\n y_var = np.ma.var(predictions, axis=0)\n ql, qu = norm.interval(interval, loc=y_mean, scale=np.sqrt(y_var))\n return y_mean, y_var, ql, qu\n\n def predict(self, X, bootstrap_predictions=None):\n return self.predict_dist(X, bootstrap_predictions=bootstrap_predictions)[0]\n\n return BootstrappedModel\n\n#\n# Target Transformer factory\n#\n\n\ndef transform_targets(Regressor):\n \"\"\"\n Factory function that add's target transformation capabiltiy to compatible\n scikit learn objects.\n\n Look at the ``transformers.py`` module for more information on valid target\n transformers.\n\n Example\n -------\n >>> svr = transform_targets(SVR)(target_transform='Standardise', gamma=0.1)\n\n \"\"\"\n class TransformedRegressor(Regressor):\n # NOTE: All of these explicitly ignore **kwargs on purpose. All generic\n # revrand and scikit learn algorithms don't need them. Custom models\n # probably shouldn't be using this factory\n\n def __init__(self, target_transform='identity', *args, **kwargs):\n\n super().__init__(*args, **kwargs)\n self.target_transform = transforms.transforms[target_transform]()\n\n def fit(self, X, y, *args, **kwargs):\n\n self.target_transform.fit(y)\n y_t = self.target_transform.transform(y)\n # Hack to check if we can apply sample weights\n if 'sample_weight' in inspect.signature(super().fit).parameters.keys() \\\n and 'sample_weight' in kwargs.keys():\n return super().fit(X, y_t, sample_weight=kwargs['sample_weight'])\n else:\n return super().fit(X, y_t)\n\n def _notransform_predict(self, X, *args, **kwargs):\n Ey = super().predict(X)\n return Ey\n\n def predict(self, X, *args, **kwargs):\n\n Ey_t = self._notransform_predict(X, *args, **kwargs)\n Ey = self.target_transform.itransform(Ey_t)\n return Ey\n\n if hasattr(Regressor, 'predict_dist'):\n def predict_dist(self, X, interval=0.95, *args, **kwargs):\n\n # Expectation and variance in latent space\n Ey_t, Vy_t, ql, qu = super().predict_dist(X, interval)\n\n # Save computation if identity transform\n if type(self.target_transform) is transforms.Identity:\n return Ey_t, Vy_t, ql, qu\n\n # Save computation if standardise transform\n elif type(self.target_transform) is transforms.Standardise:\n Ey = self.target_transform.itransform(Ey_t)\n Vy = Vy_t * self.target_transform.ystd ** 2\n ql, qu = norm.interval(interval, loc=Ey, scale=np.sqrt(Vy))\n return Ey, Vy, ql, qu\n\n # All other transforms require quadrature\n Ey = np.empty_like(Ey_t)\n Vy = np.empty_like(Vy_t)\n\n # Used fixed order quadrature to transform prob. estimates\n for i, (Eyi, Vyi) in enumerate(zip(Ey_t, Vy_t)):\n\n # Establish bounds\n Syi = np.sqrt(Vyi)\n a, b = Eyi - 3 * Syi, Eyi + 3 * Syi # approx 99% bounds\n\n # Quadrature\n Ey[i], _ = fixed_quad(self.__expec_int, a, b, n=QUADORDER,\n args=(Eyi, Syi))\n Vy[i], _ = fixed_quad(self.__var_int, a, b, n=QUADORDER,\n args=(Ey[i], Eyi, Syi))\n\n ql, qu = norm.interval(interval, loc=Ey, scale=np.sqrt(Vy))\n\n return Ey, Vy, ql, qu\n\n def __expec_int(self, x, mu, std):\n px = _normpdf(x, mu, std)\n Ex = self.target_transform.itransform(x) * px\n return Ex\n\n def __var_int(self, x, Ex, mu, std):\n px = _normpdf(x, mu, std)\n Vx = (self.target_transform.itransform(x) - Ex) ** 2 * px\n return Vx\n\n return TransformedRegressor\n\n\n#\n# Label Encoder Factory\n#\n\ndef encode_targets(Classifier):\n\n class EncodedClassifier(Classifier):\n\n def __init__(self, *args, **kwargs):\n super().__init__(*args, **kwargs)\n self.le = LabelEncoder()\n\n def fit(self, X, y, **kwargs):\n y_t = self.le.fit_transform(y)\n return super().fit(X, y_t)\n\n def predict_proba(self, X, **kwargs):\n p = super().predict_proba(X)\n y = np.argmax(p, axis=1) # Also return hard labels\n return y, p\n\n def get_classes(self):\n tags = [\"most_likely\"]\n tags += [\"{}_{}\".format(c, i)\n for i, c in enumerate(self.le.classes_)]\n return tags\n\n return EncodedClassifier\n\n#\n# Construct compatible classes for the pipeline, these need to be module level\n# for pickling...\n#\n\n\nclass CustomKNeighborsRegressor(KNeighborsRegressor):\n\n def __init__(self, n_neighbors=10, # min_weight_fraction,\n weights='distance',\n algorithm='auto',\n leaf_size=30,\n metric='minkowski', p=2,\n metric_params=None, n_jobs=1,\n min_distance=0.0):\n\n self.min_distance = min_distance\n\n weights_ = weights\n\n if weights == 'distance':\n weights_ = self._get_weights\n\n super().__init__(\n n_neighbors=n_neighbors,\n algorithm=algorithm,\n weights=weights_,\n leaf_size=leaf_size, metric=metric, p=p,\n metric_params=metric_params, n_jobs=n_jobs\n )\n\n def _get_weights(self, dist):\n # if user attempts to classify a point that was zero distance from one\n # or more training points, those training points are weighted as 1.0\n # and the other points as 0.0\n if dist.dtype is np.dtype(object):\n for point_dist_i, point_dist in enumerate(dist):\n # check if point_dist is iterable\n # (ex: RadiusNeighborClassifier.predict may set an element of\n # dist to 1e-6 to represent an 'outlier')\n if hasattr(point_dist, '__contains__') and 0. in point_dist:\n dist[point_dist_i] = point_dist == 0. + self.min_distance\n else:\n dist[point_dist_i] = 1. / (point_dist + self.min_distance)\n else:\n dist = 1. / (dist + self.min_distance)\n\n return dist\n\n\n# Define transformed models\n\nclass KNearestNeighborTransformed(transform_targets(CustomKNeighborsRegressor),\n TagsMixin):\n \"\"\"\n K Nearest Neighbour Regression\n\n https://scikit-learn.org/stable/modules/generated/sklearn.neighbors.KNeighborsRegressor.html\n \"\"\"\n\n pass\n\n\nclass SVRTransformed(transform_targets(SVR), TagsMixin):\n \"\"\"\n Support vector machine.\n\n http://scikit-learn.org/dev/modules/svm.html#svm\n \"\"\"\n pass\n\n\nclass LinearRegTransformed(transform_targets(LinearReg), TagsMixin):\n \"\"\"\n Bayesian linear regression.\n\n http://nicta.github.io/revrand/slm.html\n \"\"\"\n pass\n\n\nclass RandomForestTransformed(transform_targets(RandomForestRegressor),\n TagsMixin):\n \"\"\"\n Random forest regression.\n\n http://scikit-learn.org/dev/modules/generated/sklearn.ensemble.RandomForestRegressor.html#sklearn.ensemble.RandomForestRegressor\n \"\"\"\n pass\n\n\nclass MultiRandomForestTransformed(\n transform_targets(RandomForestRegressorMulti), TagsMixin):\n \"\"\"\n MPI implementation of Random forest regression with forest grown on\n many CPUS.\n\n http://scikit-learn.org/dev/modules/generated/sklearn.ensemble.RandomForestRegressor.html#sklearn.ensemble.RandomForestRegressor\n \"\"\"\n pass\n\n\nclass ApproxGPTransformed(transform_targets(ApproxGP), TagsMixin):\n \"\"\"\n Approximate Gaussian process.\n\n http://nicta.github.io/revrand/slm.html\n \"\"\"\n pass\n\n\nclass ARDRegressionTransformed(transform_targets(ARDRegression), TagsMixin):\n \"\"\"\n ARD regression.\n\n http://scikit-learn.org/dev/modules/generated/sklearn.linear_model.ARDRegression.html#sklearn.linear_model.ARDRegression\n \"\"\"\n pass\n\n\nclass DecisionTreeTransformed(transform_targets(DecisionTreeRegressor),\n TagsMixin):\n \"\"\"\n Decision tree regression.\n\n http://scikit-learn.org/dev/modules/generated/sklearn.tree.DecisionTreeRegressor.html#sklearn.tree.DecisionTreeRegressor\n \"\"\"\n pass\n\n\nclass ExtraTreeTransformed(transform_targets(ExtraTreeRegressor), TagsMixin):\n \"\"\"\n Extremely randomised tree regressor.\n\n http://scikit-learn.org/dev/modules/generated/sklearn.tree.ExtraTreeRegressor.html#sklearn.tree.ExtraTreeRegressor\n \"\"\"\n pass\n\n\nclass SGDLinearRegTransformed(transform_targets(SGDLinearReg), TagsMixin):\n \"\"\"\n Baysian linear regression with stochastic gradients.\n\n http://nicta.github.io/revrand/glm.html\n \"\"\"\n pass\n\n\nclass SGDApproxGPTransformed(transform_targets(SGDApproxGP), TagsMixin):\n \"\"\"\n Approximate Gaussian processes with stochastic gradients.\n\n http://nicta.github.io/revrand/glm.html\n \"\"\"\n pass\n\n\nclass CubistTransformed(transform_targets(Cubist), TagsMixin):\n \"\"\"\n Cubist regression (wrapper).\n\n https://www.rulequest.com/cubist-info.html\n \"\"\"\n pass\n\n\nclass CubistMultiTransformed(transform_targets(MultiCubist), TagsMixin):\n \"\"\"\n Parallel Cubist regression (wrapper).\n\n https://www.rulequest.com/cubist-info.html\n \"\"\"\n pass\n\n\nclass LogisticClassifier(encode_targets(LogisticRegression), TagsMixin):\n \"\"\"\n Logistic Regression for muli-class classification.\n\n http://scikit-learn.org/stable/modules/generated/sklearn.linear_model.LogisticRegression.html\n \"\"\"\n pass\n\n\nclass RandomForestClassifier(encode_targets(RFC), TagsMixin):\n \"\"\"\n Random Forest for muli-class classification.\n\n https://scikit-learn.org/stable/modules/generated/sklearn.ensemble.RandomForestClassifier.html\n \"\"\"\n pass\n\n\nclass SupportVectorClassifier(encode_targets(SVC), TagsMixin):\n \"\"\"\n Support Vector Machine multi-class classification.\n\n http://scikit-learn.org/stable/modules/generated/sklearn.svm.SVC.html\n \"\"\"\n pass\n\n\nclass GradBoostedTrees(encode_targets(GradientBoostingClassifier), TagsMixin):\n \"\"\"\n Gradient Boosted Trees multi-class classification.\n\n http://scikit-learn.org/stable/modules/generated/sklearn.ensemble.GradientBoostingClassifier.html\n \"\"\"\n pass\n\n\nclass LogisticRBF(encode_targets(kernelize(LogisticRegression)), TagsMixin):\n \"\"\"Approximate large scale kernel logistic regression.\"\"\"\n pass\n\n\nclass TransformedLinearNDInterpolator(\n transform_targets(SKLearnLinearNDInterpolator), TagsMixin):\n pass\n\n\nclass TransformedNearestNDInterpolator(\n transform_targets(SKLearnNearestNDInterpolator), TagsMixin):\n pass\n\n\nclass TransformedRbfInterpolator(transform_targets(SKLearnRbf), TagsMixin):\n pass\n\n\nclass TransformedCTInterpolator(transform_targets(SKLearnCT), TagsMixin):\n pass\n\nclass BootstrappedSVR(bootstrap_model(SVRTransformed), TagsMixin):\n pass\n\n\nclass MaskRows:\n\n def __init__(self, *Xs):\n self.okrows = self.get_complete_rows(Xs[0])\n if len(Xs) > 1:\n for c in chain(Xs[1:]):\n self.okrows = np.logical_and(\n self.okrows, self.get_complete_rows(c))\n\n def trim_mask(self, X):\n if np.ma.isMaskedArray(X):\n predict_data = X.data[self.okrows]\n\n if predict_data.shape[0] == 0: # if all of this chunk is masked\n # to get dimension of the func return, we create a dummpy res\n predict_data = np.ones((1, X.data.shape[1]))\n\n return predict_data\n else:\n return X[self.okrows]\n\n def trim_masks(self, *Xs):\n return [self.trim_mask(x) for x in Xs]\n\n def apply_mask(self, X):\n N = len(self.okrows)\n if X.ndim == 2:\n D = X.shape[1]\n Xdat = np.zeros((N, D))\n Xmask = np.zeros((N, D), dtype=bool)\n elif X.ndim == 1:\n Xdat = np.zeros(N)\n Xmask = np.zeros(N, dtype=bool)\n else:\n raise ValueError(\"Can only mask/unmask 2D arrays\")\n Xmask[~self.okrows] = True\n Xdat[self.okrows] = X\n return np.ma.masked_array(data=Xdat, mask=Xmask)\n\n def apply_masks(self, *Xs):\n return [self.apply_mask(x) for x in Xs]\n\n @staticmethod\n def get_complete_rows(X):\n N = len(X)\n if np.ma.isMaskedArray(X):\n if np.isscalar(X.mask):\n okrows = ~X.mask * np.ones(N, dtype=bool)\n else:\n okrows = np.all(~X.mask, axis=1) if X.ndim == 2 else ~X.mask\n else:\n okrows = np.ones(N, dtype=bool)\n return okrows\n\n\ndef apply_masked(func, data, *args, **kwargs):\n # Data is just a matrix (i.e. X for prediction)\n mr = MaskRows(data)\n res = func(mr.trim_mask(data), *args, **kwargs)\n\n # For training/fitting that returns nothing\n if not isinstance(res, np.ndarray):\n return res\n else:\n return mr.apply_mask(res)\n\n\ndef apply_multiple_masked(func, data, *args, **kwargs):\n # Data is a sequence of arrays (i.e. X, y pairs for training)\n mr = MaskRows(*data)\n res = func(*chain(mr.trim_masks(*data), args), **kwargs)\n\n # For training/fitting that returns nothing\n if not isinstance(res, np.ndarray):\n return res\n else:\n return mr.apply_mask(res)\n#\n# Static module properties\n#\n\n# Add all models available to the learning pipeline here!\nbootstrapped = {\n 'bootstrapsvr': BootstrappedSVR\n}\n\nregressors = {\n 'randomforest': RandomForestTransformed,\n 'multirandomforest': MultiRandomForestTransformed,\n 'bayesreg': LinearRegTransformed,\n 'sgdbayesreg': SGDLinearRegTransformed,\n 'approxgp': ApproxGPTransformed,\n 'sgdapproxgp': SGDApproxGPTransformed,\n 'svr': SVRTransformed,\n 'ardregression': ARDRegressionTransformed,\n 'decisiontree': DecisionTreeTransformed,\n 'extratree': ExtraTreeTransformed,\n 'cubist': CubistTransformed,\n 'multicubist': CubistMultiTransformed,\n 'nnr': KNearestNeighborTransformed,\n}\n\n\ninterpolators = {\n 'linear': TransformedLinearNDInterpolator,\n 'nn': TransformedNearestNDInterpolator,\n 'rbf': TransformedRbfInterpolator,\n 'cubic2d': TransformedCTInterpolator,\n}\n\n\nclassifiers = {\n 'logistic': LogisticClassifier,\n 'logisticrbf': LogisticRBF,\n 'forestclassifier': RandomForestClassifier,\n 'svc': SupportVectorClassifier,\n 'boostedtrees': GradBoostedTrees\n}\n\nmodelmaps = {**classifiers, **regressors, **interpolators, **bootstrapped}\n\n# Add all kernels for the approximate Gaussian processes here!\nbasismap = {\n 'rbf': RandomRBF,\n 'laplace': RandomLaplace,\n 'cauchy': RandomCauchy,\n 'matern32': RandomMatern32,\n 'matern52': RandomMatern52\n}\n\n#\n# Private functions and constants\n#\n\n\n_SQRT2PI = np.sqrt(2 * np.pi)\n\n\n# Faster than calling scipy's norm.pdf for quadrature. This is called with HIGH\n# frequency!\ndef _normpdf(x, mu, std):\n if std == 0:\n _logger.warning(\"STD of 0 in _normpdf, stabilising with very small value\")\n std += np.nextafter(np.float32(0), np.float32(1))\n return 1. / (_SQRT2PI * std) * np.exp(-0.5 * ((x - mu) / std)**2)\n" ]
[ [ "numpy.array", "sklearn.metrics.r2_score" ], [ "numpy.sqrt", "numpy.asarray", "numpy.dtype", "numpy.all", "numpy.mean", "numpy.zeros_like", "numpy.var", "sklearn.preprocessing.LabelEncoder", "numpy.exp", "numpy.random.randint", "numpy.empty_like", "numpy.argmax", "numpy.float32", "numpy.zeros", "numpy.log", "numpy.ma.isMaskedArray", "numpy.ma.var", "sklearn.kernel_approximation.RBFSampler", "numpy.ma.mean", "numpy.array", "numpy.random.seed", "numpy.ones", "scipy.integrate.fixed_quad", "numpy.isscalar", "numpy.ma.masked_array", "numpy.array_split" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [ "0.13", "1.6", "0.14", "1.10", "0.15", "1.4", "0.16", "1.9", "0.19", "1.5", "0.18", "1.2", "1.7", "0.12", "1.0", "0.17", "1.3", "1.8" ], "tensorflow": [] } ]
Edinburgh-Genome-Foundry/Taskpacker
[ "151b581e3b64c6f462e177a5b8b2ff3457529ad0" ]
[ "tests/test_basics.py" ]
[ "\"\"\"Basic tests.\n\nAnd I mean reeeaaaally basic, I'm just making sure the main example runs here.\nThat's because the project is still experimental and \"expected behavior\" is\na very fluid concept at this time.\n\"\"\"\nimport os\nimport matplotlib\nmatplotlib.use('Agg')\nfrom taskpacker import (tasks_from_spreadsheet,\n resources_from_spreadsheet,\n schedule_processes_series,\n plot_tasks_dependency_graph,\n plot_schedule, Task, Resource,\n numberjack_scheduler)\n\nimport matplotlib.cm as cm\n\n\ndef test_dna_assembly_example(tmpdir):\n\n spreadsheet_path = os.path.join('examples', 'examples_data',\n \"dna_assembly.xls\")\n\n colors = (cm.Paired(0.21 * i % 1.0) for i in range(30))\n\n resources = resources_from_spreadsheet(\n spreadsheet_path=spreadsheet_path, sheetname=\"resources\")\n\n processes = [\n tasks_from_spreadsheet(spreadsheet_path=spreadsheet_path,\n sheetname=\"process\",\n resources_dict=resources,\n tasks_color=next(colors),\n task_name_prefix=\"WU%d_\" % (i + 1))\n for i in range(5)\n ]\n\n print(\"NOW OPTIMIZING THE SCHEDULE, BE PATIENT...\")\n new_processes = schedule_processes_series(\n processes, est_process_duration=5000, time_limit=6)\n\n # PLOT THE TASKS DEPENDENCY TREE\n ax = plot_tasks_dependency_graph(processes[0])\n ax.set_title(\"PLAN OF A WORK UNIT\")\n ax.figure.savefig(\"basic_example_work_unit.pdf\", bbox_inches=\"tight\")\n\n # PLOT THE OPTIMIZED SCHEDULE\n ax = plot_schedule([t for process in new_processes for t in process])\n ax.figure.set_size_inches((8, 5))\n ax.set_xlabel(\"time (min)\")\n ax.figure.savefig(os.path.join(str(tmpdir),\n \"basic_example_schedule.png\"),\n bbox_inches=\"tight\")\n\n\ndef test_alice_and_bob():\n\n alice = Resource(\"Alice\", capacity=2)\n bob = Resource(\"Bob\", capacity=1)\n\n clean_scalpels = Task(\"Clean the scalpels\", resources=[bob], duration=20,\n color=\"white\")\n visit_plants = Task(\"Visit the plants\", resources=[alice], duration=60,\n color=\"yellow\")\n cook_hamsters = Task(\"Cook the hamsters\", resources=[alice], duration=30,\n color=\"red\")\n dice_hamsters = Task(\"Dice the hamsters\", resources=[bob], duration=40,\n color=\"blue\", follows=[cook_hamsters, clean_scalpels])\n feed_gremlins = Task(\"Feed the gremlins\", resources=[alice, bob],\n duration=50,\n color=\"orange\", follows=[dice_hamsters])\n\n all_tasks = [clean_scalpels, visit_plants, cook_hamsters, dice_hamsters,\n feed_gremlins]\n scheduled_tasks = numberjack_scheduler(all_tasks)\n" ]
[ [ "matplotlib.cm.Paired", "matplotlib.use" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
sand-ci/AlarmsAndAlerts
[ "37b783cbb22bb7d01532e3e1427fd18098717095" ]
[ "ps-throughput.py" ]
[ "import threading\nimport time\nimport datetime\nimport pandas as pd\nfrom functools import reduce, wraps\nfrom datetime import datetime, timedelta\nimport numpy as np\nfrom scipy.stats import zscore\n\nimport utils.queries as qrs\nimport utils.helpers as hp\nfrom data_objects.NodesMetaData import NodesMetaData\n\nfrom alarms import alarms\n\n\n\ndef fixMissingMetadata(rowDf, idx):\n metadf = NodesMetaData(idx, dateFrom, dateTo).df\n df1 = pd.merge(metadf[['host', 'ip', 'site']], rowDf[[\n 'src', 'hash']], left_on='ip', right_on='src', how='right')\n df2 = pd.merge(metadf[['host', 'ip', 'site']], rowDf[[\n 'dest', 'hash']], left_on='ip', right_on='dest', how='right')\n df = pd.merge(df1, df2, on=['hash'], suffixes=(\n '_src', '_dest'), how='inner')\n df = df[df.duplicated(subset=['hash']) == False]\n\n df = df.drop(columns=['ip_src', 'ip_dest'])\n df = pd.merge(rowDf, df, on=['hash', 'src', 'dest'], how='left')\n \n return df.rename(columns={'site_src': 'src_site', 'site_dest': 'dest_site'})\n\n\ndef queryData(idx, dateFrom, dateTo):\n data = []\n # query in portions since ES does not allow aggregations with more than 10000 bins\n intv = int(hp.CalcMinutes4Period(dateFrom, dateTo)/60)\n time_list = hp.GetTimeRanges(dateFrom, dateTo, intv)\n for i in range(len(time_list)-1):\n data.extend(qrs.query4Avg(idx, time_list[i], time_list[i+1]))\n\n return data\n\n\ndef getStats(df, threshold):\n# metaDf = fixMissingMetadata(df, 'ps_throughput')\n metaDf = df.copy()\n # convert to MB\n metaDf['value'] = round(metaDf['value']*1e-6)\n \n # split the data in 3 days\n sitesDf = metaDf.groupby(['src_site', 'dest_site',pd.Grouper(key='dt', freq='4d')])['value'].mean().to_frame().reset_index()\n \n # get the statistics\n sitesDf['z'] = sitesDf.groupby(['src_site','dest_site'])['value'].apply(lambda x: round((x - x.mean())/x.std(),2))\n stdDf = sitesDf.groupby(['src_site','dest_site'])['value'].apply(lambda x: x.std()).to_frame().reset_index().rename(columns={'value':'std'})\n stdDf['mean'] = sitesDf.groupby(['src_site','dest_site'])['value'].apply(lambda x: x.mean()).values\n\n sitesDf = pd.merge(sitesDf, stdDf, left_on=['src_site','dest_site'], right_on=['src_site','dest_site'], how='left')\n\n # get the % change with respect to the average for the period\n sitesDf['%change'] = round(((sitesDf['value'] - sitesDf['mean'])/sitesDf['mean'])*100)\n\n # grap the last 3 days period\n last3days = pd.to_datetime(max(sitesDf.dt.unique())).strftime(\"%Y-%m-%d\")\n\n # return only sites having significant drop in values in the most recent period\n return sitesDf[((sitesDf['z']<=-threshold)|(sitesDf['z']>=threshold))&(sitesDf['dt']==last3days)].rename(columns={'value':'last3days_avg'}).round(2)\n\n\ndef createAlarms(alarmsDf, alarmType, minCount=5):\n # we aim for exposing a single site which shows significant change in throughput from/to 5 (default value) other sites in total\n # below we find the total count of unique sites related to a single site name\n src_cnt = alarmsDf[['src_site']].value_counts().to_frame().reset_index().rename(columns={0:'cnt', 'src_site': 'site'})\n dest_cnt = alarmsDf[['dest_site']].value_counts().to_frame().reset_index().rename(columns={0:'cnt', 'dest_site': 'site'})\n cntDf = pd.concat([src_cnt, dest_cnt]).groupby(['site']).sum().reset_index()\n\n # create the alarm objects\n alarmOnPair = alarms('Networking', 'Perfsonar', alarmType)\n alarmOnMulty = alarms('Networking', 'Perfsonar', f'{alarmType} from/to multiple sites')\n\n rows2Delete = []\n\n for site in cntDf[cntDf['cnt']>=minCount]['site'].values:\n\n subset = alarmsDf[(alarmsDf['src_site']==site)|(alarmsDf['dest_site']==site)]\n \n # build the lists of values\n src_sites, dest_sites, src_change, dest_change = [],[],[],[]\n for idx, row in subset.iterrows():\n if row['src_site'] != site:\n src_sites.append(row['src_site'])\n src_change.append(row['%change'])\n if row['dest_site'] != site:\n dest_sites.append(row['dest_site'])\n dest_change.append(row['%change'])\n \n # create the alarm source content\n doc = {'dest_sites':dest_sites, 'dest_change':dest_change, 'src_sites':src_sites, 'src_change':src_change}\n doc['site'] = site\n\n # send the alarm with the proper message\n alarmOnMulty.addAlarm(body=f'{alarmType} from/to multiple sites', tags=[site], source=doc)\n rows2Delete.extend(subset.index.values)\n\n # delete the rows for which alarms were created\n alarmsDf = alarmsDf.drop(rows2Delete)\n\n # The rest will be send as 'regular' src-dest alarms\n for doc in alarmsDf[(alarmsDf['%change']<=-50)|(alarmsDf['%change']>=50)][['src_site', 'dest_site', 'last3days_avg', '%change']].to_dict('records'):\n alarmOnPair.addAlarm(body=alarmType, tags=[doc['src_site'], doc['dest_site']], source=doc)\n\n\nnow = datetime.utcnow()\ndateTo = datetime.strftime(now, '%Y-%m-%d %H:%M')\ndateFrom = datetime.strftime(now - timedelta(days=21), '%Y-%m-%d %H:%M')\n\n# get the data\nrowDf = pd.DataFrame(queryData('ps_throughput', dateFrom, dateTo))\nrowDf['dt'] = pd.to_datetime(rowDf['from'], unit='ms')\n\n# calculate the statistics\nstatsDf = getStats(rowDf, 1.9)\n\n# Bandwidth decreased\ncreateAlarms(statsDf[(statsDf['z']<=-1.9)&(statsDf['%change']!=100)], 'Bandwidth decreased')\n# Bandwidth recovery\ncreateAlarms(statsDf[(statsDf['z']>=1.9)], 'Bandwidth increased')" ]
[ [ "pandas.merge", "pandas.to_datetime", "pandas.Grouper", "pandas.concat" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "0.23", "0.21", "2.0", "1.4", "1.3", "0.19", "1.1", "1.5", "0.24", "0.20", "1.0", "0.25", "1.2" ], "scipy": [], "tensorflow": [] } ]
davtoh/RRTools
[ "6dde2d4622719d9031bf21ffbf7723231a0e2003", "6dde2d4622719d9031bf21ffbf7723231a0e2003", "6dde2d4622719d9031bf21ffbf7723231a0e2003" ]
[ "tests/GUI_tests/Ex_pyplot2.py", "tests/deprecated/common.py", "tests/hypothesis2_3_mask_circle_closure.py" ]
[ "\"\"\"Demo of how to pop up plots asynchronously using separate processes.\"\"\"\nfrom __future__ import print_function\n# https://gist.github.com/dwf/1222883\nfrom multiprocessing import Process\nimport time\nimport sys\nimport matplotlib.pyplot as plt\nimport numpy as np\n\ndef demo():\n i = 0\n processes = []\n while True:\n i += 1\n s = time.time()\n while time.time() - s < 5:\n print('HA', end=' ')\n sys.stdout.flush()\n def do_something():\n figno = i\n f = plt.figure()\n # Normally this will always be \"Figure 1\" since it's the first\n # figure created by this process. So do something about it.\n f.canvas.set_window_title('My stupid plot number %d' % i)\n arr = np.random.uniform(size=(50, 50))\n plt.imshow(arr)\n plt.show()\n p = Process(None, do_something)\n processes.append(p) # May want to do other things with objects\n p.start()\n\nif __name__ == \"__main__\":\n demo()", "#!/usr/bin/env python\n\n'''\nThis module contais some common routines used by other samples.\n'''\nfrom __future__ import division\nfrom __future__ import print_function\n\nfrom builtins import zip\nfrom builtins import map\nfrom past.utils import old_div\nfrom builtins import object\nimport numpy as np\nimport cv2\nimport os\nfrom contextlib import contextmanager\nimport itertools as it\nfrom functools import reduce\n\nimage_extensions = ['.bmp', '.jpg', '.jpeg', '.png', '.tif', '.tiff', '.pbm', '.pgm', '.ppm']\n\nclass Bunch(object):\n def __init__(self, **kw):\n self.__dict__.update(kw)\n def __str__(self):\n return str(self.__dict__)\n\ndef splitfn(fn):\n path, fn = os.path.split(fn)\n name, ext = os.path.splitext(fn)\n return path, name, ext\n\ndef anorm2(a):\n return (a*a).sum(-1)\ndef anorm(a):\n return np.sqrt( anorm2(a) )\n\ndef homotrans(H, x, y):\n xs = H[0, 0]*x + H[0, 1]*y + H[0, 2]\n ys = H[1, 0]*x + H[1, 1]*y + H[1, 2]\n s = H[2, 0]*x + H[2, 1]*y + H[2, 2]\n return old_div(xs,s), old_div(ys,s)\n\ndef to_rect(a):\n a = np.ravel(a)\n if len(a) == 2:\n a = (0, 0, a[0], a[1])\n return np.array(a, np.float64).reshape(2, 2)\n\ndef rect2rect_mtx(src, dst):\n src, dst = to_rect(src), to_rect(dst)\n cx, cy = old_div((dst[1] - dst[0]), (src[1] - src[0]))\n tx, ty = dst[0] - src[0] * (cx, cy)\n M = np.float64([[ cx, 0, tx],\n [ 0, cy, ty],\n [ 0, 0, 1]])\n return M\n\n\ndef lookat(eye, target, up = (0, 0, 1)):\n fwd = np.asarray(target, np.float64) - eye\n fwd /= anorm(fwd)\n right = np.cross(fwd, up)\n right /= anorm(right)\n down = np.cross(fwd, right)\n R = np.float64([right, down, fwd])\n tvec = -np.dot(R, eye)\n return R, tvec\n\ndef mtx2rvec(R):\n w, u, vt = cv2.SVDecomp(R - np.eye(3))\n p = vt[0] + u[:,0]*w[0] # same as np.dot(R, vt[0])\n c = np.dot(vt[0], p)\n s = np.dot(vt[1], p)\n axis = np.cross(vt[0], vt[1])\n return axis * np.arctan2(s, c)\n\ndef draw_str(dst, xxx_todo_changeme, s):\n (x, y) = xxx_todo_changeme\n cv2.putText(dst, s, (x+1, y+1), cv2.FONT_HERSHEY_PLAIN, 1.0, (0, 0, 0), thickness = 2, lineType=cv2.CV_AA)\n cv2.putText(dst, s, (x, y), cv2.FONT_HERSHEY_PLAIN, 1.0, (255, 255, 255), lineType=cv2.CV_AA)\n\nclass Sketcher(object):\n def __init__(self, windowname, dests, colors_func):\n self.prev_pt = None\n self.windowname = windowname\n self.dests = dests\n self.colors_func = colors_func\n self.dirty = False\n self.show()\n cv2.setMouseCallback(self.windowname, self.on_mouse)\n\n def show(self):\n cv2.imshow(self.windowname, self.dests[0])\n\n def on_mouse(self, event, x, y, flags, param):\n pt = (x, y)\n if event == cv2.EVENT_LBUTTONDOWN:\n self.prev_pt = pt\n if self.prev_pt and flags & cv2.EVENT_FLAG_LBUTTON:\n for dst, color in zip(self.dests, self.colors_func()):\n cv2.line(dst, self.prev_pt, pt, color, 5)\n self.dirty = True\n self.prev_pt = pt\n self.show()\n else:\n self.prev_pt = None\n\n\n# palette data from matplotlib/_cm.py\n_jet_data = {'red': ((0., 0, 0), (0.35, 0, 0), (0.66, 1, 1), (0.89,1, 1),\n (1, 0.5, 0.5)),\n 'green': ((0., 0, 0), (0.125,0, 0), (0.375,1, 1), (0.64,1, 1),\n (0.91,0,0), (1, 0, 0)),\n 'blue': ((0., 0.5, 0.5), (0.11, 1, 1), (0.34, 1, 1), (0.65,0, 0),\n (1, 0, 0))}\n\ncmap_data = { 'jet' : _jet_data }\n\ndef make_cmap(name, n=256):\n data = cmap_data[name]\n xs = np.linspace(0.0, 1.0, n)\n channels = []\n eps = 1e-6\n for ch_name in ['blue', 'green', 'red']:\n ch_data = data[ch_name]\n xp, yp = [], []\n for x, y1, y2 in ch_data:\n xp += [x, x+eps]\n yp += [y1, y2]\n ch = np.interp(xs, xp, yp)\n channels.append(ch)\n return np.uint8(np.array(channels).T*255)\n\ndef nothing(*arg, **kw):\n pass\n\ndef clock():\n return old_div(cv2.getTickCount(), cv2.getTickFrequency())\n\n@contextmanager\ndef Timer(msg):\n print(msg, '...', end=' ')\n start = clock()\n try:\n yield\n finally:\n print(\"%.2f ms\" % ((clock()-start)*1000))\n\nclass StatValue(object):\n def __init__(self, smooth_coef = 0.5):\n self.value = None\n self.smooth_coef = smooth_coef\n def update(self, v):\n if self.value is None:\n self.value = v\n else:\n c = self.smooth_coef\n self.value = c * self.value + (1.0-c) * v\n\nclass RectSelector(object):\n def __init__(self, win, callback):\n self.win = win\n self.callback = callback\n cv2.setMouseCallback(win, self.onmouse)\n self.drag_start = None\n self.drag_rect = None\n def onmouse(self, event, x, y, flags, param):\n x, y = np.int16([x, y]) # BUG\n if event == cv2.EVENT_LBUTTONDOWN:\n self.drag_start = (x, y)\n if self.drag_start:\n if flags & cv2.EVENT_FLAG_LBUTTON:\n xo, yo = self.drag_start\n x0, y0 = np.minimum([xo, yo], [x, y])\n x1, y1 = np.maximum([xo, yo], [x, y])\n self.drag_rect = None\n if x1-x0 > 0 and y1-y0 > 0:\n self.drag_rect = (x0, y0, x1, y1)\n else:\n rect = self.drag_rect\n self.drag_start = None\n self.drag_rect = None\n if rect:\n self.callback(rect)\n def draw(self, vis):\n if not self.drag_rect:\n return False\n x0, y0, x1, y1 = self.drag_rect\n cv2.rectangle(vis, (x0, y0), (x1, y1), (0, 255, 0), 2)\n return True\n @property\n def dragging(self):\n return self.drag_rect is not None\n\n\ndef grouper(n, iterable, fillvalue=None):\n '''grouper(3, 'ABCDEFG', 'x') --> ABC DEF Gxx'''\n args = [iter(iterable)] * n\n return it.izip_longest(fillvalue=fillvalue, *args)\n\ndef mosaic(w, imgs):\n '''Make a grid from images.\n\n w -- number of grid columns\n imgs -- images (must have same size and format)\n '''\n imgs = iter(imgs)\n img0 = next(imgs)\n pad = np.zeros_like(img0)\n imgs = it.chain([img0], imgs)\n rows = grouper(w, imgs, pad)\n return np.vstack(list(map(np.hstack, rows)))\n\ndef getsize(img):\n h, w = img.shape[:2]\n return w, h\n\ndef mdot(*args):\n return reduce(np.dot, args)\n\ndef draw_keypoints(vis, keypoints, color = (0, 255, 255)):\n for kp in keypoints:\n x, y = kp.pt\n cv2.circle(vis, (int(x), int(y)), 2, color)\n", "from __future__ import print_function\nfrom __future__ import absolute_import\nfrom builtins import range\n\n\nfrom .tesisfunctions import Plotim,overlay\nimport cv2\nimport numpy as np\nfrom .tesisfunctions import brightness, IMAGEPATH,graphpolygontest,thresh_biggestCnt,\\\n CircleClosure,twoMaxTest,graphDeffects,extendedSeparatingLine\n\n\nfn1 = r'im1_2.jpg'\n#fn1 = IMAGEPATH+r\"cellphone_retinal/ALCATEL ONE TOUCH IDOL X/left_DAVID/IMG_20150730_115534_1.jpg\"\nname = fn1.split('\\\\')[-1].split(\".\")[0]\n\nfore = cv2.imread(fn1)\nfore = cv2.resize(fore,(300,300))\n\nP = brightness(fore)\nthresh,lastthresh = cv2.threshold(P,0,1,cv2.THRESH_BINARY+cv2.THRESH_OTSU)\nPlotim(name + \" overlayed lastthresh\", overlay(fore.copy(), lastthresh * 255, alpha=lastthresh * 0.2)).show()\n\nfor i in range(2): # test multiple applications to results\n # SIMULATE polygon test\n dist_transform = cv2.distanceTransform(lastthresh,cv2.DIST_LABEL_PIXEL,5)\n dist_transform[lastthresh==0] = -1 # simulate outside points\n graph = graphpolygontest(dist_transform,name+\" dist_transform\")\n center = graph.center\n cx,cy = center\n centerVal = dist_transform[cy,cx]\n\n print(\"center: \", center, \" Value: \", centerVal)\n graph.show()\n overcircle = np.zeros_like(lastthresh,np.uint8)\n cv2.circle(overcircle,center,centerVal,1,-1)\n overcircle[lastthresh==0]=0\n Plotim(name + \" overlayed circle\", overcircle).show()\n\n #DEFECTS\n pallet = [[0,0,0],[255,255,255]]\n pallet = np.array(pallet,np.uint8)\n imdefects = pallet[overcircle]\n imdefects = overlay(fore.copy(), imdefects, alpha=brightness(imdefects))\n\n cnt = thresh_biggestCnt(overcircle)\n hull = cv2.convexHull(cnt,returnPoints = False)\n defects = cv2.convexityDefects(cnt,hull)\n if twoMaxTest(defects,epsilon=0.5):\n graphDeffects(imdefects,cnt,defects)\n #SEPARATING LINE\n start,end = extendedSeparatingLine(imdefects.shape, cnt, defects)\n cv2.line(imdefects,start,end,[0,0,100],2)\n Plotim(name + \" and circle defects\", imdefects).show()\n\n cv2.line(lastthresh,start,end,0,2)\n cnt = thresh_biggestCnt(lastthresh)\n else:\n cnt = CircleClosure(lastthresh)\n\n ellipse = cv2.fitEllipse(cnt)\n mask = np.ones(P.shape,dtype=np.uint8)\n cv2.ellipse(mask,ellipse,0,-1)\n fore[mask>0]=0\n Plotim(name + \" result\", fore).show()\n #cv2.imwrite(\"mask_\"+name+\".png\",fore)" ]
[ [ "numpy.random.uniform", "matplotlib.pyplot.imshow", "matplotlib.pyplot.show", "matplotlib.pyplot.figure" ], [ "numpy.dot", "numpy.minimum", "numpy.maximum", "numpy.linspace", "numpy.asarray", "numpy.eye", "numpy.int16", "numpy.arctan2", "numpy.zeros_like", "numpy.float64", "numpy.interp", "numpy.cross", "numpy.ravel", "numpy.array" ], [ "numpy.array", "numpy.zeros_like", "numpy.ones" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
OsbornHu/tensorflow-ml
[ "56c3051e7085a919a603481709b63e4a6614192a", "56c3051e7085a919a603481709b63e4a6614192a", "56c3051e7085a919a603481709b63e4a6614192a" ]
[ "chapter02/demo_2.8.py", "chapter03/demo_3.3.py", "chapter10/demo_10.3.py" ]
[ "#!/usr/bin/python2.7\n# -*- coding:utf-8 -*-\n\n# Author: NetworkRanger\n# Date: 2018/11/4 下午12:04\n\n# 2.8 TensorFlow 实现创建张量\n\n# 1. 导入相应的工具库,初始化计算图\nimport matplotlib.pyplot as plt\nimport numpy as np\nfrom sklearn import datasets\nimport tensorflow as tf\nsess = tf.Session()\n\n# 2. 导入iris数据集,根据目标数据是否为山鸢尾将其转换成1或者0。由于iris数据集将山鸢尾标记为0,我们将其从0置为1,同时把其他物种标记为0\niris = datasets.load_iris()\nbinary_target = np.array([1. if x==0 else 0. for x in iris.target])\niris_2d = np.array([[x[2], x[3]] for x in iris.data])\n\n# 3. 声明变量训练大小,数据占位符和模型变量\nbatch_size = 20\nx1_data = tf.placeholder(shape=[None, 1], dtype=tf.float32)\nx2_data = tf.placeholder(shape=[None, 1], dtype=tf.float32)\ny_target = tf.placeholder(shape=[None, 1], dtype=tf.float32)\nA = tf.Variable(tf.random_normal(shape=[1, 1]))\nb = tf.Variable(tf.random_normal(shape=[1, 1]))\n\n# 4. 定义线性模型\nmy_mult = tf.matmul(x2_data, A)\nmy_add = tf.add(my_mult, b)\nmy_output = tf.subtract(x1_data, my_add)\n\n# 5. 增加TensorFlow 的 sigmoid 交叉熵损失函数 sigmoid_cross_entropy_with_logits()\nxentropy = tf.nn.sigmoid_cross_entropy_with_logits(logits=my_output, labels=y_target)\n\n# 6. 声明优化器方法,最小化交叉熵损失\nmy_opt = tf.train.GradientDescentOptimizer(0.05)\ntrain_step = my_opt.minimize(xentropy)\n\n# 7. 创建一个变量初始化操作,然后让TensorFlow执行它\ninit = tf.initialize_all_variables()\nsess.run(init)\n\n# 8. 现在迭代100次训练线性模型\nfor i in range(1000):\n rand_index = np.random.choice(len(iris_2d), size=batch_size)\n rand_x = iris_2d[rand_index]\n rand_x1 = np.array([[x[0]] for x in rand_x])\n rand_x2 = np.array([[x[1]] for x in rand_x])\n rand_y = np.array([[y] for y in binary_target[rand_index]])\n sess.run(train_step, feed_dict={x1_data: rand_x1, x2_data: rand_x2, y_target: rand_y})\n if (i+1)%200 == 0:\n print('Step #' + str(i+1) + ' A = ' + str(sess.run(A)) + ', b = ' + str(sess.run(b)))\n\n \"\"\"\n Step #200 A = [[8.574331]], b = [[-3.5213127]]\n Step #400 A = [[10.120312]], b = [[-4.6367807]]\n Step #600 A = [[11.085849]], b = [[-5.303544]]\n Step #800 A = [[11.831396]], b = [[-5.835288]]\n Step #1000 A = [[12.395876]], b = [[-6.260936]]\n \"\"\"\n\n# 9. 下面的命令抽取模型变量并绘图\n[[slope]] = sess.run(A)\n[[intercept]] = sess.run(b)\nx = np.linspace(0, 3, num=50)\nablineValues = []\nfor i in x:\n ablineValues.append(slope+intercept)\n\nsetosa_x = [a[1] for i,a in enumerate(iris_2d) if binary_target[i] == 1]\nsetosa_y = [a[0] for i,a in enumerate(iris_2d) if binary_target[i] == 1]\nnon_setosa_x = [a[1] for i,a in enumerate(iris_2d) if binary_target[i] == 0]\nnon_setosa_y = [a[0] for i,a in enumerate(iris_2d) if binary_target[i] == 0]\nplt.plot(setosa_x, setosa_y, 'rx', ms=10, mew=2, label='setosa')\nplt.plot(non_setosa_x, non_setosa_y, 'ro', label='Non-setosa')\nplt.plot(x, ablineValues, 'b-')\nplt.xlim([0.0, 2.7])\nplt.ylim([0.0, 2.7])\nplt.suptitle('Linear Separator For I.setosa', fontsize=20)\nplt.xlabel('Petal Length')\nplt.ylabel('Petal Width')\nplt.legend(loc='lower right')\nplt.show()", "#!/usr/bin/python2.7\n# -*- coding:utf-8 -*-\n\n# Author: NetworkRanger\n# Date: 2018/11/4 下午2:00\n\n# 3.3 用TensorFlow 实现矩阵分解\n\n# 1. 导入编程库,初始化计算图,生成数据集\nimport matplotlib.pyplot as plt\nimport numpy as np\nimport tensorflow as tf\nfrom tensorflow.python.framework import ops\nops.reset_default_graph()\nsess = tf.Session()\nx_vals = np.linspace(0, 10, 100)\ny_vals = x_vals + np.random.normal(0, 1, 100)\nx_vals_column = np.transpose(np.matrix(x_vals))\nones_column = np.transpose(np.matrix(np.repeat(1, 100)))\nA = np.column_stack((x_vals_column, ones_column))\nb = np.transpose(np.matrix(y_vals))\nA_tensor = tf.constant(A)\nb_tensor = tf.constant(b)\n\n# 2. 找到方阵的Cholesky矩阵分解,A.T*A\n\"\"\"\n注意:TensorFlow 的cholesky()函数仅仅返回矩阵分解的下三角矩阵,因为上三角矩阵是下三角矩阵的转置矩阵。\n\"\"\"\ntA_A = tf.matmul(tf.transpose(A_tensor), A_tensor)\nL = tf.cholesky(tA_A)\ntA_b = tf.matmul(tf.transpose(A_tensor), b)\nsol1 = tf.matrix_solve(L, tA_b)\nsol2 = tf.matrix_solve(tf.transpose(L), sol1)\n\n# 3. 抽取系数\nsolution_eval = sess.run(sol2)\nslope = solution_eval[0][0]\ny_intercept = solution_eval[1][0]\nprint('slope: ' + str(slope))\nprint('y_intercept: '+ str(y_intercept))\n\n\"\"\"\nslope: 0.9593805254436375\ny_intercept: 0.06843132207087535\n\"\"\"\n\nbest_fit = []\nfor i in x_vals:\n best_fit.append(slope*i+y_intercept)\n\nplt.plot(x_vals, y_vals, 'o', label='Data')\nplt.plot(x_vals, best_fit, 'r-', label='Best fit lien', linewidth=3)\nplt.legend(loc='upper left')\nplt.show()\n", "#!/usr/bin/python2.7\n# -*- coding:utf-8 -*-\n\n# Author: NetworkRanger\n# Date: 2018/12/22 下午4:06\n\n# 10.3 TensorFlow的并发执行\n\n# 1. 为了能够找到TensorFlow的什么操作正在使用什么设备,我们在计算图会话中传入一个config参数,将log_device_placement设为True。当我们在命令行运行脚本时,会看到指定设备输出\nimport tensorflow as tf\nsess = tf.Session(config=tf.ConfigProto(log_device_placement=True))\na = tf.constant_initializer([1.0, 2.0, 3.0, 4.0, 5.0, 6.0], shape=[2, 3], name='a')\nb = tf.constant([1.0, 2.0, 3.0, 4.0, 5.0, 6.0], shape=[3, 2], name='b')\nc = tf.matmul(a, b)\n# Runs the op.\nprint(sess.run(c))\n\n# 2. 从控制台运行下面的命令\n\"\"\"\n$ python3 using_multpile_devices.py\nDevice mapping: no known devices.\nI tensorflow/core/common_runtime/direct_session.cc:175] Device mapping:\nMatMul: /job:localhost/replica:0/task:0/cpu:0\nb: /job:localhost/replica:0/task:0/cpu:0\nI tensorflow/core/common_runtime/simple_placer.cc:818] b: /job:localhost/replica:0/task:0/cpu:0\nI tensorflow/core/common_runtime/simple_placer.cc:818] a: /job:localhost/replica:0/task:0/cpu:0\n[[22. 28.]\n [49. 64.]\n\"\"\"\n\n# 3. 有时,我们希望搞清楚TensorFlow正在使用的设备。当加载先前保存过的模型,并且该模型在计算图中已分配固定设备时,服务器可提供不同的设备给计算图使用。实现该功能只需在config设置软设备\nconfig = tf.ConfigProto()\nconfig.allow_soft_placement = True\nsess_soft = tf.Session(config=config)\n\n# 4. 当使用CPU时,TensorFlow默认占据大部分CPU内存。虽然这也是时常期望的,但是我们能谨慎分配GPU内存。当TensorFlow一直不释放GPU内存时,如有必要,我们可以设置GPU内存增长选项让GPU内存分配缓慢增大到最大限制\nconfig.gpu_options.allow_growth = True\nsess_grow = tf.Session(config=config)\n\n# 5. 如果希望限制死TensorFlow使用GPU内存的百分比,可以使用config设置per_process_gpu_memory_fraction\nconfig.gpu_options.per_process_gpu_memory_fraction = 0.4\nsess_limited = tf.Session(config=config)\n\n# 6. 有时,我们希望代码健壮到可以决定运行多少GPU合适。TensorFlow有内建函数可以探测到。如果我们期望代码在GPU内存合适时利用GPU计算能力,并分配指定操作给GPU,那么该功能是有益的\nif tf.test.is_built_with_cuda(): pass\n\n# 7. 我们希望分配指定操作给GPU。下面是一个示例代码,做了一些简单的计算,并将它们分配给主CPU和两个副GPU\nwith tf.device('/cpu:0'):\n a = tf.constant([1.0, 3.0, 5.0], shape=[1,3])\n b = tf.constant([2.0, 4.0, 6.0], shape=[3, 1])\n\n with tf.device('/gpu:0'):\n c = tf.matmul(a,b)\n c = tf.reshape(c, [-1])\n\n with tf.device('/gpu:1'):\n d = tf.matmul(b, a)\n flat_d = tf.reshape(d, [-1])\n\n combined = tf.multiply(c, flat_d)\nprint(sess.run(combined))\n\n" ]
[ [ "matplotlib.pyplot.legend", "numpy.linspace", "tensorflow.nn.sigmoid_cross_entropy_with_logits", "matplotlib.pyplot.plot", "tensorflow.subtract", "tensorflow.initialize_all_variables", "tensorflow.add", "tensorflow.Session", "tensorflow.matmul", "matplotlib.pyplot.ylim", "sklearn.datasets.load_iris", "tensorflow.placeholder", "tensorflow.train.GradientDescentOptimizer", "matplotlib.pyplot.suptitle", "numpy.array", "matplotlib.pyplot.show", "matplotlib.pyplot.ylabel", "matplotlib.pyplot.xlim", "matplotlib.pyplot.xlabel", "tensorflow.random_normal" ], [ "tensorflow.cholesky", "matplotlib.pyplot.legend", "numpy.matrix", "tensorflow.constant", "tensorflow.transpose", "numpy.linspace", "tensorflow.matrix_solve", "matplotlib.pyplot.plot", "numpy.random.normal", "tensorflow.Session", "numpy.column_stack", "numpy.repeat", "matplotlib.pyplot.show", "tensorflow.python.framework.ops.reset_default_graph" ], [ "tensorflow.matmul", "tensorflow.device", "tensorflow.constant", "tensorflow.multiply", "tensorflow.test.is_built_with_cuda", "tensorflow.reshape", "tensorflow.constant_initializer", "tensorflow.ConfigProto", "tensorflow.Session" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [ "1.10" ] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [ "1.10", "1.12", "1.4", "1.5", "1.7", "0.12", "1.0", "1.2" ] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [ "1.10", "1.12", "1.4", "1.13", "1.5", "1.7", "0.12", "1.0", "1.2" ] } ]
goan15910/ConvDet
[ "6404622cc9d0c8e8b756260c4979b6842b2d0cb0", "6404622cc9d0c8e8b756260c4979b6842b2d0cb0" ]
[ "src/dataset/imdb.py", "src/nets/yolo_v2.py" ]
[ "# Author: Bichen Wu ([email protected]) 08/25/2016\n\n\"\"\"The data base wrapper class\"\"\"\n\nimport os\nimport random\nimport shutil\n\nfrom PIL import Image, ImageFont, ImageDraw\nimport cv2\nimport numpy as np\nfrom utils.util import iou, batch_iou, drift_dist, recolor, scale_trans, rand_flip\n\nclass imdb(object):\n \"\"\"Image database.\"\"\"\n\n def __init__(self, name, mc):\n self._name = name\n self._classes = []\n self._image_set = []\n self._image_idx = []\n self._data_root_path = []\n self._rois = {}\n self.mc = mc\n\n # batch reader\n self._perm_idx = None\n self._cur_idx = 0\n\n @property\n def name(self):\n return self._name\n\n @property\n def classes(self):\n return self._classes\n\n @property\n def num_classes(self):\n return len(self._classes)\n\n @property\n def image_idx(self):\n return self._image_idx\n\n @property\n def image_set(self):\n return self._image_set\n\n @property\n def data_root_path(self):\n return self._data_root_path\n\n @property\n def year(self):\n return self._year\n\n def _shuffle_image_idx(self):\n self._perm_idx = [self._image_idx[i] for i in\n np.random.permutation(np.arange(len(self._image_idx)))]\n self._cur_idx = 0\n\n def read_image_batch(self, shuffle=True):\n \"\"\"Only Read a batch of images\n Args:\n shuffle: whether or not to shuffle the dataset\n Returns:\n images: length batch_size list of arrays [height, width, 3]\n \"\"\"\n mc = self.mc\n if shuffle:\n if self._cur_idx + mc.BATCH_SIZE >= len(self._image_idx):\n self._shuffle_image_idx()\n batch_idx = self._perm_idx[self._cur_idx:self._cur_idx+mc.BATCH_SIZE]\n self._cur_idx += mc.BATCH_SIZE\n else:\n if self._cur_idx + mc.BATCH_SIZE >= len(self._image_idx):\n batch_idx = self._image_idx[self._cur_idx:] \\\n + self._image_idx[:self._cur_idx + mc.BATCH_SIZE-len(self._image_idx)]\n self._cur_idx += mc.BATCH_SIZE - len(self._image_idx)\n else:\n batch_idx = self._image_idx[self._cur_idx:self._cur_idx+mc.BATCH_SIZE]\n self._cur_idx += mc.BATCH_SIZE\n\n images, scales = [], []\n for i in batch_idx:\n im = cv2.imread(self._image_path_at(i))\n if mc.SUB_BGR_MEANS:\n im = im.astype(np.float32, copy=False)\n im -= mc.BGR_MEANS\n orig_h, orig_w, _ = [float(v) for v in im.shape]\n im = cv2.resize(im, (mc.IMAGE_WIDTH, mc.IMAGE_HEIGHT))\n x_scale = mc.IMAGE_WIDTH/orig_w\n y_scale = mc.IMAGE_HEIGHT/orig_h\n images.append(im)\n scales.append((x_scale, y_scale))\n\n return images, scales\n\n def read_batch(self, shuffle=True):\n \"\"\"Read a batch of image and bounding box annotations.\n Args:\n shuffle: whether or not to shuffle the dataset\n Returns:\n image_per_batch: images. Shape: batch_size x width x height x [b, g, r]\n label_per_batch: labels. Shape: batch_size x object_num\n delta_per_batch: bounding box deltas. Shape: batch_size x object_num x \n [dx ,dy, dw, dh]\n aidx_per_batch: index of anchors that are responsible for prediction.\n Shape: batch_size x object_num\n bbox_per_batch: scaled bounding boxes. Shape: batch_size x object_num x \n [cx, cy, w, h]\n \"\"\"\n mc = self.mc\n\n if shuffle:\n if self._cur_idx + mc.BATCH_SIZE >= len(self._image_idx):\n self._shuffle_image_idx()\n batch_idx = self._perm_idx[self._cur_idx:self._cur_idx+mc.BATCH_SIZE]\n self._cur_idx += mc.BATCH_SIZE\n else:\n if self._cur_idx + mc.BATCH_SIZE >= len(self._image_idx):\n batch_idx = self._image_idx[self._cur_idx:] \\\n + self._image_idx[:self._cur_idx + mc.BATCH_SIZE-len(self._image_idx)]\n self._cur_idx += mc.BATCH_SIZE - len(self._image_idx)\n else:\n batch_idx = self._image_idx[self._cur_idx:self._cur_idx+mc.BATCH_SIZE]\n self._cur_idx += mc.BATCH_SIZE\n\n image_per_batch = []\n label_per_batch = []\n bbox_per_batch = []\n delta_per_batch = []\n aidx_per_batch = []\n if mc.DEBUG_MODE:\n avg_ious = 0.\n num_objects = 0.\n max_iou = 0.0\n min_iou = 1.0\n num_zero_iou_obj = 0\n\n for idx in batch_idx:\n # load the image\n im = cv2.imread(self._image_path_at(idx))\n orig_h, orig_w, _ = [float(v) for v in im.shape]\n\n # load annotations\n label_this_batch = np.array([b[4] for b in self._rois[idx][:]])\n gt_bbox = np.array([[b[0], b[1], b[2], b[3]] for b in self._rois[idx][:]])\n\n if mc.DATA_AUGMENTATION:\n assert mc.DATA_AUG_TYPE in ['SQT', 'YOLO'], \\\n 'Invalid augmentation type: {}'.format(mc.DATA_AUG_TYPE)\n if mc.DATA_AUG_TYPE == 'SQT':\n im, gt_bbox = drift_dist(im, gt_bbox, mc, orig_h, orig_w)\n elif mc.DATA_AUG_TYPE == 'YOLO':\n if np.random.randint(2) > 0.5:\n im, gt_bbox, label_this_batch = scale_trans(im, gt_bbox, label_this_batch)\n im = recolor(im)\n im, gt_bbox = rand_flip(im, gt_bbox, orig_w)\n\n # Remove BGR bias\n if mc.SUB_BGR_MEANS:\n im = im.astype(np.float32, copy=False)\n im -= mc.BGR_MEANS\n #im = im.astype(np.uint8, copy=False)\n\n label_per_batch.append(label_this_batch.tolist())\n\n # scale image\n im = cv2.resize(im, (mc.IMAGE_WIDTH, mc.IMAGE_HEIGHT))\n image_per_batch.append(im)\n\n # scale annotation\n x_scale = mc.IMAGE_WIDTH/orig_w\n y_scale = mc.IMAGE_HEIGHT/orig_h\n gt_bbox[:, 0::2] = gt_bbox[:, 0::2]*x_scale\n gt_bbox[:, 1::2] = gt_bbox[:, 1::2]*y_scale\n bbox_per_batch.append(gt_bbox)\n\n aidx_per_image, delta_per_image = [], []\n aidx_set = set()\n for i in range(len(gt_bbox)):\n overlaps = batch_iou(mc.ANCHOR_BOX, gt_bbox[i])\n\n aidx = len(mc.ANCHOR_BOX)\n for ov_idx in np.argsort(overlaps)[::-1]:\n if overlaps[ov_idx] <= 0:\n if mc.DEBUG_MODE:\n min_iou = min(overlaps[ov_idx], min_iou)\n num_objects += 1\n num_zero_iou_obj += 1\n break\n if ov_idx not in aidx_set:\n aidx_set.add(ov_idx)\n aidx = ov_idx\n if mc.DEBUG_MODE:\n max_iou = max(overlaps[ov_idx], max_iou)\n min_iou = min(overlaps[ov_idx], min_iou)\n avg_ious += overlaps[ov_idx]\n num_objects += 1\n break\n\n if aidx == len(mc.ANCHOR_BOX): \n # even the largeset available overlap is 0, thus, choose one with the\n # smallest square distance\n dist = np.sum(np.square(gt_bbox[i] - mc.ANCHOR_BOX), axis=1)\n for dist_idx in np.argsort(dist):\n if dist_idx not in aidx_set:\n aidx_set.add(dist_idx)\n aidx = dist_idx\n break\n \n box_cx, box_cy, box_w, box_h = gt_bbox[i]\n delta = [0]*4\n delta[0] = (box_cx - mc.ANCHOR_BOX[aidx][0])/box_w\n delta[1] = (box_cy - mc.ANCHOR_BOX[aidx][1])/box_h\n delta[2] = np.log(box_w/mc.ANCHOR_BOX[aidx][2])\n delta[3] = np.log(box_h/mc.ANCHOR_BOX[aidx][3])\n\n aidx_per_image.append(aidx)\n delta_per_image.append(delta)\n\n delta_per_batch.append(delta_per_image)\n aidx_per_batch.append(aidx_per_image)\n\n if mc.DEBUG_MODE:\n print ('max iou: {}'.format(max_iou))\n print ('min iou: {}'.format(min_iou))\n print ('avg iou: {}'.format(avg_ious/num_objects))\n print ('number of objects: {}'.format(num_objects))\n print ('number of objects with 0 iou: {}'.format(num_zero_iou_obj))\n\n return image_per_batch, label_per_batch, delta_per_batch, \\\n aidx_per_batch, bbox_per_batch\n\n def evaluate_detections(self):\n raise NotImplementedError\n\n def visualize_detections(\n self, image_dir, image_format, det_error_file, output_image_dir,\n num_det_per_type=10):\n\n # load detections\n with open(det_error_file) as f:\n lines = f.readlines()\n random.shuffle(lines)\n f.close()\n\n dets_per_type = {}\n for line in lines:\n obj = line.strip().split(' ')\n error_type = obj[1]\n if error_type not in dets_per_type:\n dets_per_type[error_type] = [{\n 'im_idx':obj[0], \n 'bbox':[float(obj[2]), float(obj[3]), float(obj[4]), float(obj[5])],\n 'class':obj[6],\n 'score': float(obj[7])\n }]\n else:\n dets_per_type[error_type].append({\n 'im_idx':obj[0], \n 'bbox':[float(obj[2]), float(obj[3]), float(obj[4]), float(obj[5])],\n 'class':obj[6],\n 'score': float(obj[7])\n })\n\n out_ims = []\n # Randomly select some detections and plot them\n COLOR = (200, 200, 0)\n for error_type, dets in dets_per_type.iteritems():\n det_im_dir = os.path.join(output_image_dir, error_type)\n if os.path.exists(det_im_dir):\n shutil.rmtree(det_im_dir)\n os.makedirs(det_im_dir)\n\n for i in range(min(num_det_per_type, len(dets))):\n det = dets[i]\n im = Image.open(\n os.path.join(image_dir, det['im_idx']+image_format))\n draw = ImageDraw.Draw(im)\n draw.rectangle(det['bbox'], outline=COLOR)\n draw.text((det['bbox'][0], det['bbox'][1]), \n '{:s} ({:.2f})'.format(det['class'], det['score']),\n fill=COLOR)\n out_im_path = os.path.join(det_im_dir, str(i)+image_format)\n im.save(out_im_path)\n im = np.array(im)\n out_ims.append(im[:,:,::-1]) # RGB to BGR\n return out_ims\n\n", "\n\"\"\"YOLO-v2 model.\"\"\"\n\nfrom __future__ import absolute_import\nfrom __future__ import division\nfrom __future__ import print_function\n\nimport os\nimport sys\n\nimport joblib\nfrom utils import util\nfrom easydict import EasyDict as edict\nimport numpy as np\nimport tensorflow as tf\nfrom nn_skeleton import ModelSkeleton\n\n\nclass YOLO_V2(ModelSkeleton):\n def __init__(self, mc, gpu_id):\n with tf.device('/gpu:{}'.format(gpu_id)):\n ModelSkeleton.__init__(self, mc)\n\n self.BN = mc.BN\n self._add_forward_graph()\n self._add_yolo_interpret_graph()\n #self._add_yolo_loss_graph()\n #self._add_train_graph()\n #self._add_viz_graph()\n\n def _add_forward_graph(self):\n \"\"\"Build the VGG-16 model.\"\"\"\n\n if self.mc.LOAD_PRETRAINED_MODEL:\n assert tf.gfile.Exists(self.mc.PRETRAINED_MODEL_PATH), \\\n 'Cannot find pretrained model at the given path:' \\\n ' {}'.format(self.mc.PRETRAINED_MODEL_PATH)\n self.caffemodel_weight = joblib.load(self.mc.PRETRAINED_MODEL_PATH)\n\n with tf.variable_scope('darknet19') as scope:\n conv1 = self._conv_layer(\n 'conv1', self.image_input, filters=32, size=3, stride=1, bn=self.BN, act='lrelu', freeze=True)\n pool1 = self._pooling_layer(\n 'pool1', conv1, size=2, stride=2)\n conv2 = self._conv_layer(\n 'conv2', pool1, filters=64, size=3, stride=1, bn=self.BN, act='lrelu', freeze=True)\n pool2 = self._pooling_layer(\n 'pool2', conv2, size=2, stride=2)\n conv3 = self._conv_layer(\n 'conv3', pool2, filters=128, size=3, stride=1, bn=self.BN, act='lrelu')\n conv4 = self._conv_layer(\n 'conv4', conv3, filters=64, size=1, stride=1, bn=self.BN, act='lrelu')\n conv5 = self._conv_layer(\n 'conv5', conv4, filters=128, size=3, stride=1, bn=self.BN, act='lrelu')\n pool3 = self._pooling_layer(\n 'pool3', conv5, size=2, stride=2)\n conv6 = self._conv_layer(\n 'conv6', pool3, filters=256, size=3, stride=1, bn=self.BN, act='lrelu')\n conv7 = self._conv_layer(\n 'conv7', conv6, filters=128, size=1, stride=1, bn=self.BN, act='lrelu')\n conv8 = self._conv_layer(\n 'conv8', conv7, filters=256, size=3, stride=1, bn=self.BN, act='lrelu')\n pool4 = self._pooling_layer(\n 'pool4', conv8, size=2, stride=2)\n conv9 = self._conv_layer(\n 'conv9', pool4, filters=512, size=3, stride=1, bn=self.BN, act='lrelu')\n conv10 = self._conv_layer(\n 'conv10', conv9, filters=256, size=1, stride=1, bn=self.BN, act='lrelu')\n conv11 = self._conv_layer(\n 'conv11', conv10, filters=512, size=3, stride=1, bn=self.BN, act='lrelu')\n conv12 = self._conv_layer(\n 'conv12', conv11, filters=256, size=1, stride=1, bn=self.BN, act='lrelu')\n conv13 = self._conv_layer(\n 'conv13', conv12, filters=512, size=3, stride=1, bn=self.BN, act='lrelu')\n pool5 = self._pooling_layer(\n 'pool5', conv13, size=2, stride=2)\n conv14 = self._conv_layer(\n 'conv14', pool5, filters=1024, size=3, stride=1, bn=self.BN, act='lrelu')\n conv15 = self._conv_layer(\n 'conv15', conv14, filters=512, size=1, stride=1, bn=self.BN, act='lrelu')\n conv16 = self._conv_layer(\n 'conv16', conv15, filters=1024, size=3, stride=1, bn=self.BN, act='lrelu')\n conv17 = self._conv_layer(\n 'conv17', conv16, filters=512, size=1, stride=1, bn=self.BN, act='lrelu')\n conv18 = self._conv_layer(\n 'conv18', conv17, filters=1024, size=3, stride=1, bn=self.BN, act='lrelu')\n\n with tf.variable_scope('detector') as scope:\n conv19 = self._conv_layer(\n 'conv19', conv18, filters=1024, size=3, stride=1, bn=self.BN, act='lrelu')\n conv20 = self._conv_layer(\n 'conv20', conv19, filters=1024, size=3, stride=1, bn=self.BN, act='lrelu')\n reorg20 = self._reorg_layer('reorg20', conv13, stride=2)\n concat20 = self._concat_layer('concat20', conv20, reorg20)\n conv21 = self._conv_layer(\n 'conv21', concat20, filters=1024, size=3, stride=1, bn=self.BN, act='lrelu')\n num_output = self.mc.ANCHOR_PER_GRID * (self.mc.CLASSES + 1 + 4)\n self.preds = self._conv_layer(\n 'conv22', conv21, filters=num_output, size=1, stride=1,\n padding='SAME', xavier=False, act=None, stddev=0.0001)\n self.conv13 = conv13\n self.conv20 = conv20\n self.reorg20 = reorg20\n self.concat20 = concat20\n" ]
[ [ "numpy.square", "numpy.log", "numpy.argsort", "numpy.array", "numpy.random.randint" ], [ "tensorflow.gfile.Exists", "tensorflow.variable_scope" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [ "1.10", "1.12", "1.4", "1.13", "1.5", "1.7", "0.12", "1.0", "1.2" ] } ]
MaajidKhan/ONNX-1.6.0-OP-Library
[ "df26621fa225485849853f5e11180600be71d11d", "df26621fa225485849853f5e11180600be71d11d" ]
[ "operators/sign.py", "operators/sinh.py" ]
[ "#sign\n\nimport onnx\nfrom onnx import helper\nfrom onnx import numpy_helper\nfrom onnx import AttributeProto, TensorProto, GraphProto\nimport numpy as np\nfrom Compare_output import compare\n\n# Create the inputs (ValueInfoProto)\nx = helper.make_tensor_value_info('x', TensorProto.FLOAT, [11,])\n\n\n# Create one output (ValueInfoProto)\ny = helper.make_tensor_value_info('y', TensorProto.FLOAT, [11,])\n\n# Create a node (NodeProto)\nnode_def = helper.make_node(\n 'Sign',\n inputs=['x'],\n outputs=['y'],\n)\n\n# Create the graph (GraphProto)\ngraph_def = helper.make_graph(\n [node_def],\n 'test-model',\n [x],\n [y],\n)\n\n# Create the model (ModelProto)\nmodel_def = helper.make_model(graph_def, producer_name='onnx-sign')\nprint('The model is:\\n{}'.format(model_def))\nonnx.checker.check_model(model_def)\nprint('The model is checked!')\n\n# Save the ONNX model\nimport os\npath = os.getcwd()\nnew_model_path = os.path.join(path, '../onnx_generated_models/sign.onnx')\nonnx.save(model_def, new_model_path)\nprint('The model is saved.')\n\n\n# Preprocessing: load the ONNX model (Loading an already exisisting model)\nmodel_path1 = os.path.join(path, '../onnx_generated_models/sign.onnx')\nonnx_model1 = onnx.load(model_path1)\nprint('The model is:\\n{}'.format(onnx_model1))\n\n\nx = np.array(range(-5, 6)).astype(np.float32)\ny_actual = np.sign(x)\n\n#Running the model using ONNX Runtime\nimport onnxruntime as rt\nimport numpy\nsess = rt.InferenceSession(\"../onnx_generated_models/sign.onnx\")\ninput_name = sess.get_inputs()[0].name\nlabel_name = sess.get_outputs()[0].name\n\ny_pred = sess.run(\n [label_name], {input_name: x.astype(numpy.float32),\n })\n\nprint(\"The predicted output for the operation: sign\")\nprint(y_pred)\n\ny_pred = np.asarray(y_pred) #converting list into an array\nprint(y_pred.shape)\n\ny_pred = np.squeeze(y_pred, axis=0)\nprint(y_pred.shape)\n\ncompare(y_actual, y_pred)", "#sinh\n\nimport onnx\nfrom onnx import helper\nfrom onnx import numpy_helper\nfrom onnx import AttributeProto, TensorProto, GraphProto\nimport numpy as np\nfrom Compare_output import compare\n\n# Create the inputs (ValueInfoProto)\nx = helper.make_tensor_value_info('x', TensorProto.FLOAT, [3,])\n\n\n# Create one output (ValueInfoProto)\ny = helper.make_tensor_value_info('y', TensorProto.FLOAT, [3,])\n\n# Create a node (NodeProto)\nnode_def = helper.make_node(\n 'Sinh',\n inputs=['x'],\n outputs=['y'],\n)\n\n# Create the graph (GraphProto)\ngraph_def = helper.make_graph(\n [node_def],\n 'test-model',\n [x],\n [y],\n)\n\n# Create the model (ModelProto)\nmodel_def = helper.make_model(graph_def, producer_name='onnx-sinh')\nprint('The model is:\\n{}'.format(model_def))\nonnx.checker.check_model(model_def)\nprint('The model is checked!')\n\n# Save the ONNX model\nimport os\npath = os.getcwd()\nnew_model_path = os.path.join(path, '../onnx_generated_models/sinh.onnx')\nonnx.save(model_def, new_model_path)\nprint('The model is saved.')\n\n\n# Preprocessing: load the ONNX model (Loading an already exisisting model)\nmodel_path1 = os.path.join(path, '../onnx_generated_models/sinh.onnx')\nonnx_model1 = onnx.load(model_path1)\nprint('The model is:\\n{}'.format(onnx_model1))\n\n\nx = np.array([-1, 0, 1]).astype(np.float32)\ny_actual = np.sinh(x) # expected output [-1.17520118, 0., 1.17520118]\n\n#Running the model using ONNX Runtime\nimport onnxruntime as rt\nimport numpy\nsess = rt.InferenceSession(\"../onnx_generated_models/sinh.onnx\")\ninput_name = sess.get_inputs()[0].name\nlabel_name = sess.get_outputs()[0].name\n\ny_pred = sess.run(\n [label_name], {input_name: x.astype(numpy.float32),\n })\n\nprint(\"The predicted output for the operation: sinh\")\nprint(y_pred)\n\ny_pred = np.asarray(y_pred) #converting list into an array\nprint(y_pred.shape)\n\ny_pred = np.squeeze(y_pred, axis=0)\nprint(y_pred.shape)\n\ncompare(y_actual, y_pred)" ]
[ [ "numpy.sign", "numpy.squeeze", "numpy.asarray" ], [ "numpy.asarray", "numpy.squeeze", "numpy.array", "numpy.sinh" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
OniOniOn-/maplestory_dpm_calc
[ "fbe824f01ab8e8210b174dd9db8295da80c267cd" ]
[ "statistics/optimization_hint.py" ]
[ "import argparse\n\nimport pandas as pd\nfrom dpmModule.character.characterKernel import JobGenerator\nfrom dpmModule.character.characterTemplate import TemplateGenerator\nfrom dpmModule.jobs import jobMap\nfrom dpmModule.kernel import core\nfrom dpmModule.status.ability import Ability_grade\n\nfrom .loader import load_data\nfrom .preset import get_preset\nfrom .saver import save_data\n\n\ndef get_args():\n parser = argparse.ArgumentParser(\"Optimization hint argument\")\n parser.add_argument(\n \"--id\", type=str, help=\"Target preset id to calculate statistics\"\n )\n parser.add_argument(\"--ulevel\", type=int, default=8000)\n parser.add_argument(\"--cdr\", type=int, default=0)\n parser.add_argument(\"--time\", type=int, default=1800)\n parser.add_argument(\"--task\", default=\"dpm\")\n parser.add_argument(\"--calc\", action=\"store_true\")\n\n return parser.parse_args()\n\n\ndef armor_percent_to_float(num: float):\n return (100 - num) / 100\n\n\ndef armor_float_to_percent(num: float):\n return 100 - num * 100\n\n\ndef get_modifier(args) -> core.CharacterModifier:\n preset = get_preset(args.id)\n gen: JobGenerator = jobMap[preset.job].JobGenerator()\n target, weapon_stat = TemplateGenerator().get_template_and_weapon_stat(gen, str(args.ulevel), args.cdr)\n v_builder = core.AlwaysMaximumVBuilder()\n graph = gen.package(\n target,\n v_builder,\n options=preset.options,\n ulevel=args.ulevel,\n weaponstat=weapon_stat,\n ability_grade=Ability_grade(4, 1),\n )\n return graph.get_default_buff_modifier()\n\n\ndef optimization_hint(args, df: pd.DataFrame):\n buff_modifier = get_modifier(args)\n\n df = df[[\"name\", \"deal\", \"mdf\"]]\n df = df.loc[df[\"deal\"] > 0]\n deal_total = df[\"deal\"].sum()\n\n df[\"crit_damage\"] = df[\"mdf\"].apply(lambda x: x[\"crit_damage\"])\n df[\"pdamage\"] = df[\"mdf\"].apply(lambda x: x[\"pdamage\"])\n df[\"boss_pdamage\"] = df[\"mdf\"].apply(lambda x: x[\"boss_pdamage\"])\n df[\"armor_ignore\"] = df[\"mdf\"].apply(lambda x: x[\"armor_ignore\"])\n df[\"patt\"] = df[\"mdf\"].apply(lambda x: x[\"patt\"])\n grouped = df.groupby([\"name\"])\n\n df = pd.DataFrame()\n df[\"share\"] = grouped[\"deal\"].sum() / deal_total\n df[\"crit_damage\"] = grouped[\"crit_damage\"].mean()\n df[\"pdamage\"] = grouped[\"pdamage\"].mean()\n df[\"boss_pdamage\"] = grouped[\"boss_pdamage\"].mean()\n df[\"armor_ignore\"] = grouped[\"armor_ignore\"].mean()\n df[\"patt\"] = grouped[\"patt\"].mean()\n\n print(df)\n\n crit_damage = (df[\"crit_damage\"] * df[\"share\"]).sum()\n pdamage = (df[\"pdamage\"] * df[\"share\"]).sum()\n boss_pdamage = (df[\"boss_pdamage\"] * df[\"share\"]).sum()\n armor_ignore = (df[\"armor_ignore\"] * df[\"share\"]).sum()\n patt = (df[\"patt\"] * df[\"share\"]).sum()\n\n print(\n {\n \"crit_damage\": crit_damage - buff_modifier.crit_damage,\n \"pdamage\": pdamage - buff_modifier.pdamage,\n \"boss_pdamage\": boss_pdamage - buff_modifier.boss_pdamage,\n \"armor_ignore\": armor_float_to_percent(\n armor_percent_to_float(armor_ignore)\n / armor_percent_to_float(buff_modifier.armor_ignore)\n / armor_percent_to_float(20)\n ),\n \"patt\": patt - buff_modifier.patt,\n }\n )\n\n\nif __name__ == \"__main__\":\n args = get_args()\n if args.calc:\n data = save_data(args)\n else:\n data = load_data(args)\n optimization_hint(args, data)\n" ]
[ [ "pandas.DataFrame" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "0.23", "0.21", "2.0", "1.4", "0.19", "1.1", "1.5", "1.2", "0.24", "0.20", "1.0", "0.25", "1.3" ], "scipy": [], "tensorflow": [] } ]
zeroized/DeepRec-torch
[ "2957f65501243107284f3a43735b77b3e89ce684", "2957f65501243107284f3a43735b77b3e89ce684" ]
[ "model/wrapper/base.py", "model/ctr/nfm.py" ]
[ "import torch\nfrom torch.utils.data import DataLoader\n\nfrom util.log_util import create_file_console_logger\nfrom util.train import config_path, split_dataset, train_model\nfrom torch.utils.tensorboard import SummaryWriter\n\n\nclass BaseModel:\n def __init__(self):\n self.loader_args = None\n self.model = None\n self.job_name = ''\n self.device = torch.device('cpu')\n self.logger = None,\n self.tb_writer = None,\n self.ckpt_dir = None\n self.log_path = None,\n self.model_path = None\n self.ckpt_interval = -1\n\n def config_training(self, write_log_file=True, log_path=None,\n save_ckpt=True, ckpt_dir=None, ckpt_interval=None,\n save_model=True, model_path=None,\n write_tb=True, tb_dir=None):\n self.logger, self.tb_writer, self.ckpt_dir, self.log_path, self.model_path = \\\n config_path(self.job_name, self.device, write_log_file, log_path, save_ckpt, ckpt_dir, save_model,\n model_path, write_tb, tb_dir)\n if save_ckpt:\n self.ckpt_interval = ckpt_interval\n\n def config_tensorboard(self, write_tb=False, tb_dir=None):\n if write_tb:\n self.tb_writer = SummaryWriter(log_dir=tb_dir)\n\n def config_logger(self, write_log_file=False, log_path=None):\n if write_log_file:\n self.logger = create_file_console_logger(log_path, name=self.job_name)\n\n def config_ckpt(self, save_ckpt=False, ckpt_dir=None, ckpt_interval=None):\n if save_ckpt:\n self.ckpt_dir = ckpt_dir\n self.ckpt_interval = ckpt_interval\n\n def config_model_saving(self, save_model=False, model_path=None):\n if save_model:\n self.model_path = model_path\n\n def config_loader_meta(self, **kwargs):\n self.loader_args = kwargs\n\n def _train(self, dataset, loss_func, optimizer=None, epochs=2, val_size=0):\n if not optimizer:\n optimizer = torch.optim.SGD(params=self.model.parameters(), lr=1e-3)\n if val_size <= 0:\n train_loader = DataLoader(dataset, **self.loader_args)\n val_loader = None\n else:\n train_set, val_set = split_dataset(dataset, val_size)\n train_loader = DataLoader(train_set, **self.loader_args)\n val_loader = DataLoader(val_set, batch_size=self.loader_args['batch_size'])\n self.model.train()\n train_model(self.model, train_loader, loss_func, optimizer, val_loader, epochs,\n self.logger, self.tb_writer, self.ckpt_dir, self.ckpt_interval, self.model_path)\n\n def train(self, **kwargs):\n raise NotImplementedError\n\n def eval(self, **kwargs):\n raise NotImplementedError\n", "import torch\nimport torch.nn as nn\nfrom model.basic.mlp import MLP\nfrom model.basic.output_layer import OutputLayer\nfrom model.basic.functional import bi_interaction\n\n\"\"\"\nModel: NFM: Neural Factorization Machines\nVersion: \nReference: Xiangnan He and Tat-Seng Chua. 2017. \n Neural Factorization Machines for Sparse Predictive Analytics. \n In Proceedings of the 40th International ACM SIGIR Conference on Research and Development in Information \n Retrieval (SIGIR ’17). \n Association for Computing Machinery, New York, NY, USA, 355–364. \n DOI:https://doi.org/10.1145/3077136.3080777\n\"\"\"\n\n\nclass NFM(nn.Module):\n def __init__(self, emb_dim, num_feats, num_fields, fc_dims=None, dropout=None, batch_norm=None, out_type='binary'):\n super(NFM, self).__init__()\n self.emb_dim = emb_dim\n self.num_feats = num_feats\n self.num_fields = num_fields\n\n self.first_order_weights = nn.Embedding(num_embeddings=num_feats, embedding_dim=1)\n nn.init.xavier_uniform_(self.first_order_weights.weight)\n self.first_order_bias = nn.Parameter(torch.randn(1))\n\n self.emb_layer = nn.Embedding(num_embeddings=num_feats, embedding_dim=emb_dim)\n nn.init.xavier_uniform_(self.emb_layer.weight)\n\n self.bi_intaraction_layer = BiInteractionLayer()\n if not fc_dims:\n fc_dims = [32, 32]\n self.fc_dims = fc_dims\n self.fc_layers = MLP(emb_dim, fc_dims, dropout, batch_norm)\n\n self.h = nn.Parameter(torch.zeros(1, fc_dims[-1])) # 1 * fc_dims[-1]\n nn.init.xavier_uniform_(self.h.data)\n self.output_layer = OutputLayer(in_dim=1, out_type=out_type)\n\n def forward(self, feat_index, feat_value):\n # feat_index, feat_value: N * num_fields\n first_order_weights = self.first_order_weights(feat_index) # N * num_fields * 1\n first_order_weights = first_order_weights.squeeze()\n first_order = torch.mul(feat_value, first_order_weights) # N * num_fields\n first_order = torch.sum(first_order, dim=1) # N\n\n feat_emb = self.emb_layer(feat_index) # N * num_fields * emb_dim\n feat_value = feat_value.unsqueeze(dim=2) # N * num_fields * 1\n feat_emb_value = torch.mul(feat_emb, feat_value) # N * num_fields * emb_dim\n bi = self.bi_intaraction_layer(feat_emb_value) # N * emb_dim\n\n fc_out = self.fc_layers(bi) # N * fc_dims[-1]\n out = torch.mul(fc_out, self.h) # N * fc_dims[-1]\n out = torch.sum(out, dim=1) # N\n out = out + first_order + self.first_order_bias # N\n out = out.unsqueeze(dim=1) # N * 1\n out = self.output_layer(out)\n return out\n\n\nclass BiInteractionLayer(nn.Module):\n def __init__(self):\n super(BiInteractionLayer, self).__init__()\n\n def forward(self, feat_emb_value):\n # square_of_sum = torch.sum(feat_emb_value, dim=1) # N * emb_dim\n # square_of_sum = torch.mul(square_of_sum, square_of_sum) # N * emb_dim\n\n # sum_of_square = torch.mul(feat_emb_value, feat_emb_value) # N * num_fields * emb_dim\n # sum_of_square = torch.sum(sum_of_square, dim=1) # N * emb_dim\n\n # bi_out = square_of_sum - sum_of_square\n\n bi_out = bi_interaction(feat_emb_value)\n return bi_out\n" ]
[ [ "torch.device", "torch.utils.data.DataLoader", "torch.utils.tensorboard.SummaryWriter" ], [ "torch.zeros", "torch.randn", "torch.sum", "torch.nn.Embedding", "torch.mul", "torch.nn.init.xavier_uniform_" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
Manza12/kornia
[ "580bbbffc771470445de27a7957d970b5a606172", "580bbbffc771470445de27a7957d970b5a606172" ]
[ "kornia/augmentation/functional/functional3d.py", "kornia/color/hls.py" ]
[ "from typing import Tuple, List, Union, Dict, cast, Optional\n\nimport torch\n\nimport kornia as K\nfrom kornia.constants import Resample, BorderType, pi\nfrom kornia.geometry.transform.affwarp import _compute_rotation_matrix3d, _compute_tensor_center3d\nfrom kornia.geometry.transform.projwarp import warp_affine3d\nfrom kornia.geometry import (\n crop_by_boxes3d,\n warp_perspective3d,\n get_perspective_transform3d,\n rotate3d,\n get_affine_matrix3d,\n deg2rad,\n)\nfrom kornia.enhance import equalize3d\n\nfrom .. import random_generator as rg\nfrom ..utils import _validate_input3d\nfrom kornia.filters import motion_blur3d\n\nfrom .__temp__ import __deprecation_warning, _deprecation_wrapper\n\n\n@_deprecation_wrapper\n@_validate_input3d\ndef apply_hflip3d(input: torch.Tensor) -> torch.Tensor:\n r\"\"\"Apply horizontal flip on a 3D tensor volume or a batch of tensors volumes with given random parameters.\n\n Args:\n input (torch.Tensor): Tensor to be transformed with shape :math:`(*, C, D, H, W)`.\n\n Returns:\n torch.Tensor: Horizontal flipped input with shape :math:`(*, C, D, H, W)`.\n \"\"\"\n\n return torch.flip(input, [-1])\n\n\n@_deprecation_wrapper\n@_validate_input3d\ndef compute_hflip_transformation3d(input: torch.Tensor) -> torch.Tensor:\n r\"\"\"Compute the horizontal flip transformation matrix :math: `(*, 4, 4)`.\n\n Args:\n input (torch.Tensor): Tensor to be transformed with shape :math:`(*, C, D, H, W)`.\n\n Returns:\n torch.Tensor: Horizontal flip transformation matrix :math: `(*, 4, 4)`.\n \"\"\"\n\n w: int = input.shape[-1]\n flip_mat: torch.Tensor = torch.tensor([[-1, 0, 0, w - 1], [0, 1, 0, 0], [0, 0, 1, 0], [0, 0, 0, 1]])\n\n return flip_mat.repeat(input.size(0), 1, 1).to(input)\n\n\n@_deprecation_wrapper\n@_validate_input3d\ndef apply_vflip3d(input: torch.Tensor) -> torch.Tensor:\n r\"\"\"Apply vertical flip on a 3D tensor volume or a batch of tensors volumes with given random parameters.\n\n Args:\n input (torch.Tensor): Tensor to be transformed with shape :math:`(*, C, D, H, W)`.\n\n Returns:\n torch.Tensor: Vertical flipped input with shape :math:`(*, C, D, H, W)`.\n \"\"\"\n\n return torch.flip(input, [-2])\n\n\n@_deprecation_wrapper\n@_validate_input3d\ndef compute_vflip_transformation3d(input: torch.Tensor) -> torch.Tensor:\n r\"\"\"Compute the veritical flip transformation matrix :math: `(*, 4, 4)`.\n\n Args:\n input (torch.Tensor): Tensor to be transformed with shape :math:`(*, C, D, H, W)`.\n\n Returns:\n torch.Tensor: The vertical flip transformation matrix :math: `(*, 4, 4)`.\n \"\"\"\n\n h: int = input.shape[-2]\n flip_mat: torch.Tensor = torch.tensor([[1, 0, 0, 0], [0, -1, 0, h - 1], [0, 0, 1, 0], [0, 0, 0, 1]])\n\n return flip_mat.repeat(input.size(0), 1, 1).to(input)\n\n\n@_deprecation_wrapper\n@_validate_input3d\ndef apply_dflip3d(input: torch.Tensor) -> torch.Tensor:\n r\"\"\"Apply depthical flip on a 3D tensor volume or a batch of tensors volumes with given random parameters.\n\n Args:\n input (torch.Tensor): Tensor to be transformed with shape :math:`(*, C, D, H, W)`.\n\n Returns:\n torch.Tensor: Depthical flipped input with shape :math:`(*, C, D, H, W)`.\n \"\"\"\n\n return torch.flip(input, [-3])\n\n\n@_deprecation_wrapper\n@_validate_input3d\ndef compute_intensity_transformation3d(input: torch.Tensor):\n r\"\"\"Compute the identity matrix :math: `(*, 4, 4)`.\n\n Args:\n input (torch.Tensor): Tensor to be transformed with shape :math:`(*, C, D, H, W)`.\n\n Returns:\n torch.Tensor: Identity matrix :math: `(*, 4, 4)`.\n \"\"\"\n identity: torch.Tensor = torch.eye(4, device=input.device, dtype=input.dtype).repeat(input.shape[0], 1, 1)\n return identity\n\n\n@_deprecation_wrapper\n@_validate_input3d\ndef compute_dflip_transformation3d(input: torch.Tensor) -> torch.Tensor:\n r\"\"\"Compute the depthical flip transformation matrix :math: `(*, 4, 4)`.\n\n Args:\n input (torch.Tensor): Tensor to be transformed with shape :math:`(*, C, D, H, W)`.\n\n Returns:\n torch.Tensor: Depthical flip transformation matrix :math: `(*, 4, 4)`.\n \"\"\"\n\n d: int = input.shape[-3]\n flip_mat: torch.Tensor = torch.tensor([[1, 0, 0, 0], [0, 1, 0, 0], [0, 0, -1, d - 1], [0, 0, 0, 1]])\n\n return flip_mat.repeat(input.size(0), 1, 1).to(input)\n\n\n@_deprecation_wrapper\n@_validate_input3d\ndef apply_affine3d(\n input: torch.Tensor, params: Dict[str, torch.Tensor], flags: Dict[str, torch.Tensor]\n) -> torch.Tensor:\n r\"\"\"Random affine transformation of the image keeping center invariant.\n\n Args:\n input (torch.Tensor): Tensor to be transformed with shape :math:`(*, C, D, H, W)`.\n params (Dict[str, torch.Tensor]):\n - params['angles']: Degrees of rotation with the shape of :math: `(*, 3)` for yaw, pitch, roll.\n - params['translations']: Horizontal, vertical and depthical translations (dx,dy,dz).\n - params['center']: Rotation center (x,y,z).\n - params['scale']: Isotropic scaling params.\n - params['sxy']: Shear param toward x-y-axis.\n - params['sxz']: Shear param toward x-z-axis.\n - params['syx']: Shear param toward y-x-axis.\n - params['syz']: Shear param toward y-z-axis.\n - params['szx']: Shear param toward z-x-axis.\n - params['szy']: Shear param toward z-y-axis.\n flags (Dict[str, torch.Tensor]):\n - params['resample']: Integer tensor. NEAREST = 0, BILINEAR = 1.\n - params['align_corners']: Boolean tensor.\n\n Returns:\n torch.Tensor: Affine transfromed input with shape :math:`(*, C, D, H, W)`.\n \"\"\"\n\n # arrange input data\n x_data: torch.Tensor = input.view(-1, *input.shape[-4:])\n\n depth, height, width = x_data.shape[-3:]\n\n # concatenate transforms\n transform: torch.Tensor = compute_affine_transformation3d(input, params)\n\n resample_name: str = Resample(flags['resample'].item()).name.lower()\n align_corners: bool = cast(bool, flags['align_corners'].item())\n\n out_data: torch.Tensor = warp_affine3d(\n x_data, transform[:, :3, :], (depth, height, width), resample_name, align_corners=align_corners\n )\n return out_data.view_as(input)\n\n\n@_deprecation_wrapper\n@_validate_input3d\ndef compute_affine_transformation3d(input: torch.Tensor, params: Dict[str, torch.Tensor]) -> torch.Tensor:\n r\"\"\"Compute the affine transformation matrix :math: `(*, 4, 4)`.\n\n Args:\n input (torch.Tensor): Tensor to be transformed with shape :math:`(*, C, D, H, W)`.\n params (Dict[str, torch.Tensor]):\n - params['angles']: Degrees of rotation with the shape of :math: `(*, 3)` for yaw, pitch, roll.\n - params['translations']: Horizontal, vertical and depthical translations (dx,dy,dz).\n - params['center']: Rotation center (x,y,z).\n - params['scale']: Isotropic scaling params.\n - params['sxy']: Shear param toward x-y-axis.\n - params['sxz']: Shear param toward x-z-axis.\n - params['syx']: Shear param toward y-x-axis.\n - params['syz']: Shear param toward y-z-axis.\n - params['szx']: Shear param toward z-x-axis.\n - params['szy']: Shear param toward z-y-axis.\n\n Returns:\n torch.Tensor: The affine transformation matrix :math: `(*, 4, 4)`.\n \"\"\"\n transform = get_affine_matrix3d(\n params['translations'],\n params['center'],\n params['scale'],\n params['angles'],\n deg2rad(params['sxy']),\n deg2rad(params['sxz']),\n deg2rad(params['syx']),\n deg2rad(params['syz']),\n deg2rad(params['szx']),\n deg2rad(params['szy']),\n ).to(input)\n return transform\n\n\n@_deprecation_wrapper\n@_validate_input3d\ndef apply_rotation3d(\n input: torch.Tensor, params: Dict[str, torch.Tensor], flags: Dict[str, torch.Tensor]\n) -> torch.Tensor:\n r\"\"\"Rotate a tensor image or a batch of tensor images a random amount of degrees.\n\n Args:\n input (torch.Tensor): Tensor to be transformed with shape :math:`(*, C, D, H, W)`.\n params (Dict[str, torch.Tensor]):\n - params['degrees']: degree to be applied.\n flags (Dict[str, torch.Tensor]):\n - params['resample']: Integer tensor. NEAREST = 0, BILINEAR = 1.\n - params['align_corners']: Boolean tensor.\n\n Returns:\n torch.Tensor: The cropped input.\n \"\"\"\n yaw: torch.Tensor = params[\"yaw\"].to(input)\n pitch: torch.Tensor = params[\"pitch\"].to(input)\n roll: torch.Tensor = params[\"roll\"].to(input)\n\n resample_mode: str = Resample(flags['resample'].item()).name.lower()\n align_corners: bool = cast(bool, flags['align_corners'].item())\n\n transformed: torch.Tensor = rotate3d(input, yaw, pitch, roll, mode=resample_mode, align_corners=align_corners)\n\n return transformed\n\n\n@_deprecation_wrapper\n@_validate_input3d\ndef compute_rotate_tranformation3d(input: torch.Tensor, params: Dict[str, torch.Tensor]):\n r\"\"\"Compute the rotation transformation matrix :math: `(*, 4, 4)`.\n\n Args:\n input (torch.Tensor): Tensor to be transformed with shape :math:`(*, C, D, H, W)`.\n params (Dict[str, torch.Tensor]):\n - params['yaw']: degree to be applied.\n - params['pitch']: degree to be applied.\n - params['roll']: degree to be applied.\n\n Returns:\n torch.Tensor: The rotation transformation matrix :math: `(*, 4, 4)`.\n \"\"\"\n yaw: torch.Tensor = params[\"yaw\"].to(input)\n pitch: torch.Tensor = params[\"pitch\"].to(input)\n roll: torch.Tensor = params[\"roll\"].to(input)\n\n center: torch.Tensor = _compute_tensor_center3d(input)\n rotation_mat: torch.Tensor = _compute_rotation_matrix3d(yaw, pitch, roll, center.expand(yaw.shape[0], -1))\n\n # rotation_mat is B x 3 x 4 and we need a B x 4 x 4 matrix\n trans_mat: torch.Tensor = torch.eye(4, device=input.device, dtype=input.dtype).repeat(input.shape[0], 1, 1)\n trans_mat[:, 0] = rotation_mat[:, 0]\n trans_mat[:, 1] = rotation_mat[:, 1]\n trans_mat[:, 2] = rotation_mat[:, 2]\n\n return trans_mat\n\n\n@_deprecation_wrapper\n@_validate_input3d\ndef apply_motion_blur3d(\n input: torch.Tensor, params: Dict[str, torch.Tensor], flags: Dict[str, torch.Tensor]\n) -> torch.Tensor:\n r\"\"\"Perform motion blur on an image.\n\n Args:\n input (torch.Tensor): Tensor to be transformed with shape :math:`(*, C, D, H, W)`.\n params (Dict[str, torch.Tensor]):\n - params['ksize_factor']: motion kernel width and height (odd and positive).\n - params['angle_factor']: yaw, pitch and roll range of the motion blur in degrees :math:`(B, 3)`.\n - params['direction_factor']: forward/backward direction of the motion blur.\n Lower values towards -1.0 will point the motion blur towards the back (with\n angle provided via angle), while higher values towards 1.0 will point the motion\n blur forward. A value of 0.0 leads to a uniformly (but still angled) motion blur.\n flags (Dict[str, torch.Tensor]):\n - flags['border_type']: the padding mode to be applied before convolving.\n CONSTANT = 0, REFLECT = 1, REPLICATE = 2, CIRCULAR = 3. Default: BorderType.CONSTANT.\n\n Returns:\n torch.Tensor: adjusted image tensor with shape :math:`(*, C, D, H, W)`.\n \"\"\"\n\n kernel_size: int = cast(int, params['ksize_factor'].unique().item())\n angle = params['angle_factor']\n direction = params['direction_factor']\n border_type: str = cast(str, BorderType(flags['border_type'].item()).name.lower())\n mode: str = cast(str, Resample(flags['interpolation'].item()).name.lower())\n\n return motion_blur3d(input, kernel_size, angle, direction, border_type, mode)\n\n\n@_deprecation_wrapper\n@_validate_input3d\ndef apply_crop3d(input: torch.Tensor, params: Dict[str, torch.Tensor], flags: Dict[str, torch.Tensor]) -> torch.Tensor:\n r\"\"\"Apply cropping by src bounding box and dst bounding box.\n\n Args:\n input (torch.Tensor): Tensor to be transformed with shape :math:`(*, C, D, H, W)`.\n params (Dict[str, torch.Tensor]):\n - params['src']: The applied cropping src matrix :math: `(*, 8, 3)`.\n - params['dst']: The applied cropping dst matrix :math: `(*, 8, 3)`.\n flags (Dict[str, torch.Tensor]):\n - params['interpolation']: Integer tensor. NEAREST = 0, BILINEAR = 1.\n - params['align_corners']: Boolean tensor.\n\n Returns:\n torch.Tensor: The cropped input.\n\n Note:\n BBox order: front-top-left, front-top-right, front-bottom-right, front-bottom-left, back-top-left,\n back-top-right, back-bottom-right, back-bottom-left. The coordinates must be in x, y, z order.\n \"\"\"\n\n resample_mode: str = Resample.get(flags['interpolation'].item()).name.lower() # type: ignore\n align_corners: bool = cast(bool, flags['align_corners'].item())\n\n return crop_by_boxes3d(input, params['src'], params['dst'], resample_mode, align_corners=align_corners)\n\n\n@_deprecation_wrapper\n@_validate_input3d\ndef compute_crop_transformation3d(\n input: torch.Tensor, params: Dict[str, torch.Tensor], flags: Dict[str, torch.Tensor]\n) -> torch.Tensor:\n r\"\"\"Compute the cropping transformation matrix :math: `(*, 4, 4)`.\n\n Args:\n input (torch.Tensor): Tensor to be transformed with shape :math:`(*, C, D, H, W)`.\n params (Dict[str, torch.Tensor]):\n - params['src']: The applied cropping src matrix :math: `(*, 8, 3)`.\n - params['dst']: The applied cropping dst matrix :math: `(*, 8, 3)`.\n\n Returns:\n torch.Tensor: The cropping transformation matrix :math: `(*, 4, 4)`.\n \"\"\"\n transform: torch.Tensor = get_perspective_transform3d(params['src'].to(input.dtype), params['dst'].to(input.dtype))\n transform = transform.expand(input.shape[0], -1, -1).to(input)\n return transform\n\n\n@_deprecation_wrapper\n@_validate_input3d\ndef apply_perspective3d(\n input: torch.Tensor, params: Dict[str, torch.Tensor], flags: Dict[str, torch.Tensor]\n) -> torch.Tensor:\n r\"\"\"Perform perspective transform of the given torch.Tensor or batch of tensors.\n\n Args:\n input (torch.Tensor): Tensor to be transformed with shape :math:`(*, C, D, H, W)`.\n params (Dict[str, torch.Tensor]):\n - params['start_points']: Tensor containing [top-left, top-right, bottom-right,\n bottom-left] of the original image with shape Bx8x3.\n - params['end_points']: Tensor containing [top-left, top-right, bottom-right,\n bottom-left] of the transformed image with shape Bx8x3.\n flags (Dict[str, torch.Tensor]):\n - params['interpolation']: Integer tensor. NEAREST = 0, BILINEAR = 1.\n - params['align_corners']: Boolean tensor.\n\n Returns:\n torch.Tensor: Perspectively transformed tensor with shape :math:`(*, C, D, H, W)`.\n \"\"\"\n\n _, _, depth, height, width = input.shape\n\n # compute the homography between the input points\n transform: torch.Tensor = compute_perspective_transformation3d(input, params)\n\n out_data: torch.Tensor = input.clone()\n\n # apply the computed transform\n depth, height, width = input.shape[-3:]\n resample_name: str = Resample(flags['interpolation'].item()).name.lower()\n align_corners: bool = cast(bool, flags['align_corners'].item())\n\n out_data = warp_perspective3d(\n input, transform, (depth, height, width), flags=resample_name, align_corners=align_corners\n )\n\n return out_data.view_as(input)\n\n\n@_deprecation_wrapper\n@_validate_input3d\ndef compute_perspective_transformation3d(input: torch.Tensor, params: Dict[str, torch.Tensor]) -> torch.Tensor:\n r\"\"\"Compute the perspective transformation matrix :math: `(*, 4, 4)`.\n\n Args:\n input (torch.Tensor): Tensor to be transformed with shape :math:`(*, C, D, H, W)`.\n params (Dict[str, torch.Tensor]):\n - params['start_points']: Tensor containing [top-left, top-right, bottom-right,\n bottom-left] of the orignal image with shape Bx8x3.\n - params['end_points']: Tensor containing [top-left, top-right, bottom-right,\n bottom-left] of the transformed image with shape Bx8x3.\n\n Returns:\n torch.Tensor: The perspective transformation matrix :math: `(*, 4, 4)`\n \"\"\"\n perspective_transform: torch.Tensor = get_perspective_transform3d(params['start_points'], params['end_points']).to(\n input\n )\n\n transform: torch.Tensor = K.eye_like(4, input)\n\n transform = perspective_transform\n\n return transform\n\n\n@_deprecation_wrapper\n@_validate_input3d\ndef apply_equalize3d(input: torch.Tensor, params: Dict[str, torch.Tensor]) -> torch.Tensor:\n r\"\"\"Equalize a tensor volume or a batch of tensors volumes with given random parameters.\n\n Args:\n input (torch.Tensor): Tensor to be transformed with shape :math:`(*, C, D, H, W)`.\n params (Dict[str, torch.Tensor]): shall be empty.\n\n Returns:\n torch.Tensor: Equalized input with shape :math:`(*, C, D, H, W)`.\n \"\"\"\n\n return equalize3d(input)\n", "import math\n\nimport torch\nimport torch.nn as nn\n\n\ndef rgb_to_hls(image: torch.Tensor) -> torch.Tensor:\n r\"\"\"Convert a RGB image to HLS.\n\n The image data is assumed to be in the range of (0, 1).\n\n Args:\n image (torch.Tensor): RGB image to be converted to HLS with shape :math:`(*, 3, H, W)`.\n\n Returns:\n torch.Tensor: HLS version of the image with shape :math:`(*, 3, H, W)`.\n\n Example:\n >>> input = torch.rand(2, 3, 4, 5)\n >>> output = rgb_to_hls(input) # 2x3x4x5\n \"\"\"\n if not isinstance(image, torch.Tensor):\n raise TypeError(\"Input type is not a torch.Tensor. Got {}\".format(type(image)))\n\n if len(image.shape) < 3 or image.shape[-3] != 3:\n raise ValueError(\"Input size must have a shape of (*, 3, H, W). Got {}\".format(image.shape))\n\n r: torch.Tensor = image[..., 0, :, :]\n g: torch.Tensor = image[..., 1, :, :]\n b: torch.Tensor = image[..., 2, :, :]\n\n maxc: torch.Tensor = image.max(-3)[0]\n minc: torch.Tensor = image.min(-3)[0]\n\n imax: torch.Tensor = image.max(-3)[1]\n\n l: torch.Tensor = (maxc + minc) / 2 # luminance\n\n deltac: torch.Tensor = maxc - minc\n\n s: torch.Tensor = torch.where(\n l < 0.5, deltac / (maxc + minc), deltac / (torch.tensor(2.0) - (maxc + minc))\n ) # saturation\n\n hi: torch.Tensor = torch.zeros_like(deltac)\n\n hi[imax == 0] = (((g - b) / deltac) % 6)[imax == 0]\n hi[imax == 1] = (((b - r) / deltac) + 2)[imax == 1]\n hi[imax == 2] = (((r - g) / deltac) + 4)[imax == 2]\n\n h: torch.Tensor = 2.0 * math.pi * (60.0 * hi) / 360.0 # hue [0, 2*pi]\n\n image_hls: torch.Tensor = torch.stack([h, l, s], dim=-3)\n\n # JIT indexing is not supported before 1.6.0 https://github.com/pytorch/pytorch/issues/38962\n # image_hls[torch.isnan(image_hls)] = 0.\n image_hls = torch.where(\n torch.isnan(image_hls), torch.tensor(0.0, device=image_hls.device, dtype=image_hls.dtype), image_hls\n )\n\n return image_hls\n\n\ndef hls_to_rgb(image: torch.Tensor) -> torch.Tensor:\n r\"\"\"Convert a HLS image to RGB.\n\n The image data is assumed to be in the range of (0, 1).\n\n Args:\n image (torch.Tensor): HLS image to be converted to RGB with shape :math:`(*, 3, H, W)`.\n\n Returns:\n torch.Tensor: RGB version of the image with shape :math:`(*, 3, H, W)`.\n\n Example:\n >>> input = torch.rand(2, 3, 4, 5)\n >>> output = hls_to_rgb(input) # 2x3x4x5\n \"\"\"\n if not isinstance(image, torch.Tensor):\n raise TypeError(\"Input type is not a torch.Tensor. Got {}\".format(type(image)))\n\n if len(image.shape) < 3 or image.shape[-3] != 3:\n raise ValueError(\"Input size must have a shape of (*, 3, H, W). Got {}\".format(image.shape))\n\n h: torch.Tensor = image[..., 0, :, :] * 360 / (2 * math.pi)\n l: torch.Tensor = image[..., 1, :, :]\n s: torch.Tensor = image[..., 2, :, :]\n\n kr = (0 + h / 30) % 12\n kg = (8 + h / 30) % 12\n kb = (4 + h / 30) % 12\n a = s * torch.min(l, torch.tensor(1.0) - l)\n\n ones_k = torch.ones_like(kr)\n\n fr: torch.Tensor = l - a * torch.max(\n torch.min(torch.min(kr - torch.tensor(3.0), torch.tensor(9.0) - kr), ones_k), -1 * ones_k\n )\n fg: torch.Tensor = l - a * torch.max(\n torch.min(torch.min(kg - torch.tensor(3.0), torch.tensor(9.0) - kg), ones_k), -1 * ones_k\n )\n fb: torch.Tensor = l - a * torch.max(\n torch.min(torch.min(kb - torch.tensor(3.0), torch.tensor(9.0) - kb), ones_k), -1 * ones_k\n )\n\n out: torch.Tensor = torch.stack([fr, fg, fb], dim=-3)\n\n return out\n\n\nclass RgbToHls(nn.Module):\n r\"\"\"Convert an image from RGB to HLS.\n\n The image data is assumed to be in the range of (0, 1).\n\n Returns:\n torch.Tensor: HLS version of the image.\n\n Shape:\n - image: :math:`(*, 3, H, W)`\n - output: :math:`(*, 3, H, W)`\n\n Examples:\n >>> input = torch.rand(2, 3, 4, 5)\n >>> hls = RgbToHls()\n >>> output = hls(input) # 2x3x4x5\n \"\"\"\n\n def forward(self, image: torch.Tensor) -> torch.Tensor:\n return rgb_to_hls(image)\n\n\nclass HlsToRgb(nn.Module):\n r\"\"\"Convert an image from HLS to RGB.\n\n The image data is assumed to be in the range of (0, 1).\n\n Returns:\n torch.Tensor: RGB version of the image.\n\n Shape:\n - input: :math:`(*, 3, H, W)`\n - output: :math:`(*, 3, H, W)`\n\n Reference:\n https://en.wikipedia.org/wiki/HSL_and_HSV\n\n Examples:\n >>> input = torch.rand(2, 3, 4, 5)\n >>> rgb = HlsToRgb()\n >>> output = rgb(input) # 2x3x4x5\n \"\"\"\n\n def forward(self, image: torch.Tensor) -> torch.Tensor:\n return hls_to_rgb(image)\n" ]
[ [ "torch.flip", "torch.eye", "torch.tensor" ], [ "torch.isnan", "torch.zeros_like", "torch.tensor", "torch.stack", "torch.ones_like" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
christophcc/xarray
[ "132733a917171fcb1f269406eb9e6668cbb7e376" ]
[ "xarray/coding/variables.py" ]
[ "\"\"\"Coders for individual Variable objects.\"\"\"\nimport warnings\nfrom functools import partial\nfrom typing import Any, Hashable\n\nimport numpy as np\nimport pandas as pd\n\nfrom ..core import dtypes, duck_array_ops, indexing\nfrom ..core.pycompat import dask_array_type\nfrom ..core.utils import equivalent\nfrom ..core.variable import Variable\n\n\nclass SerializationWarning(RuntimeWarning):\n \"\"\"Warnings about encoding/decoding issues in serialization.\"\"\"\n\n\nclass VariableCoder:\n \"\"\"Base class for encoding and decoding transformations on variables.\n\n We use coders for transforming variables between xarray's data model and\n a format suitable for serialization. For example, coders apply CF\n conventions for how data should be represented in netCDF files.\n\n Subclasses should implement encode() and decode(), which should satisfy\n the identity ``coder.decode(coder.encode(variable)) == variable``. If any\n options are necessary, they should be implemented as arguments to the\n __init__ method.\n\n The optional name argument to encode() and decode() exists solely for the\n sake of better error messages, and should correspond to the name of\n variables in the underlying store.\n \"\"\"\n\n def encode(\n self, variable: Variable, name: Hashable = None\n ) -> Variable: # pragma: no cover\n \"\"\"Convert an encoded variable to a decoded variable\n \"\"\"\n raise NotImplementedError()\n\n def decode(\n self, variable: Variable, name: Hashable = None\n ) -> Variable: # pragma: no cover\n \"\"\"Convert an decoded variable to a encoded variable\n \"\"\"\n raise NotImplementedError()\n\n\nclass _ElementwiseFunctionArray(indexing.ExplicitlyIndexedNDArrayMixin):\n \"\"\"Lazily computed array holding values of elemwise-function.\n\n Do not construct this object directly: call lazy_elemwise_func instead.\n\n Values are computed upon indexing or coercion to a NumPy array.\n \"\"\"\n\n def __init__(self, array, func, dtype):\n assert not isinstance(array, dask_array_type)\n self.array = indexing.as_indexable(array)\n self.func = func\n self._dtype = dtype\n\n @property\n def dtype(self):\n return np.dtype(self._dtype)\n\n def __getitem__(self, key):\n return type(self)(self.array[key], self.func, self.dtype)\n\n def __array__(self, dtype=None):\n return self.func(self.array)\n\n def __repr__(self):\n return \"%s(%r, func=%r, dtype=%r)\" % (\n type(self).__name__,\n self.array,\n self.func,\n self.dtype,\n )\n\n\ndef lazy_elemwise_func(array, func, dtype):\n \"\"\"Lazily apply an element-wise function to an array.\n\n Parameters\n ----------\n array : any valid value of Variable._data\n func : callable\n Function to apply to indexed slices of an array. For use with dask,\n this should be a pickle-able object.\n dtype : coercible to np.dtype\n Dtype for the result of this function.\n\n Returns\n -------\n Either a dask.array.Array or _ElementwiseFunctionArray.\n \"\"\"\n if isinstance(array, dask_array_type):\n return array.map_blocks(func, dtype=dtype)\n else:\n return _ElementwiseFunctionArray(array, func, dtype)\n\n\ndef unpack_for_encoding(var):\n return var.dims, var.data, var.attrs.copy(), var.encoding.copy()\n\n\ndef unpack_for_decoding(var):\n return var.dims, var._data, var.attrs.copy(), var.encoding.copy()\n\n\ndef safe_setitem(dest, key, value, name=None):\n if key in dest:\n var_str = \" on variable {!r}\".format(name) if name else \"\"\n raise ValueError(\n \"failed to prevent overwriting existing key {} in attrs{}. \"\n \"This is probably an encoding field used by xarray to describe \"\n \"how a variable is serialized. To proceed, remove this key from \"\n \"the variable's attributes manually.\".format(key, var_str)\n )\n dest[key] = value\n\n\ndef pop_to(source, dest, key, name=None):\n \"\"\"\n A convenience function which pops a key k from source to dest.\n None values are not passed on. If k already exists in dest an\n error is raised.\n \"\"\"\n value = source.pop(key, None)\n if value is not None:\n safe_setitem(dest, key, value, name=name)\n return value\n\n\ndef _apply_mask(\n data: np.ndarray, encoded_fill_values: list, decoded_fill_value: Any, dtype: Any\n) -> np.ndarray:\n \"\"\"Mask all matching values in a NumPy arrays.\"\"\"\n data = np.asarray(data, dtype=dtype)\n condition = False\n for fv in encoded_fill_values:\n condition |= data == fv\n return np.where(condition, decoded_fill_value, data)\n\n\nclass CFMaskCoder(VariableCoder):\n \"\"\"Mask or unmask fill values according to CF conventions.\"\"\"\n\n def encode(self, variable, name=None):\n dims, data, attrs, encoding = unpack_for_encoding(variable)\n\n fv = encoding.get(\"_FillValue\")\n mv = encoding.get(\"missing_value\")\n\n if fv is not None and mv is not None and not equivalent(fv, mv):\n raise ValueError(\n \"Variable {!r} has multiple fill values {}. \"\n \"Cannot encode data. \".format(name, [fv, mv])\n )\n\n if fv is not None:\n fill_value = pop_to(encoding, attrs, \"_FillValue\", name=name)\n if not pd.isnull(fill_value):\n data = duck_array_ops.fillna(data, fill_value)\n\n if mv is not None:\n fill_value = pop_to(encoding, attrs, \"missing_value\", name=name)\n if not pd.isnull(fill_value) and fv is None:\n data = duck_array_ops.fillna(data, fill_value)\n\n return Variable(dims, data, attrs, encoding)\n\n def decode(self, variable, name=None):\n dims, data, attrs, encoding = unpack_for_decoding(variable)\n\n raw_fill_values = [\n pop_to(attrs, encoding, attr, name=name)\n for attr in (\"missing_value\", \"_FillValue\")\n ]\n if raw_fill_values:\n encoded_fill_values = {\n fv\n for option in raw_fill_values\n for fv in np.ravel(option)\n if not pd.isnull(fv)\n }\n\n if len(encoded_fill_values) > 1:\n warnings.warn(\n \"variable {!r} has multiple fill values {}, \"\n \"decoding all values to NaN.\".format(name, encoded_fill_values),\n SerializationWarning,\n stacklevel=3,\n )\n\n dtype, decoded_fill_value = dtypes.maybe_promote(data.dtype)\n\n if encoded_fill_values:\n transform = partial(\n _apply_mask,\n encoded_fill_values=encoded_fill_values,\n decoded_fill_value=decoded_fill_value,\n dtype=dtype,\n )\n data = lazy_elemwise_func(data, transform, dtype)\n\n return Variable(dims, data, attrs, encoding)\n\n\ndef _scale_offset_decoding(data, scale_factor, add_offset, dtype):\n data = np.array(data, dtype=dtype, copy=True)\n if scale_factor is not None:\n data *= scale_factor\n if add_offset is not None:\n data += add_offset\n return data\n\n\ndef _choose_float_dtype(dtype, has_offset):\n \"\"\"Return a float dtype that can losslessly represent `dtype` values.\"\"\"\n # Keep float32 as-is. Upcast half-precision to single-precision,\n # because float16 is \"intended for storage but not computation\"\n if dtype.itemsize <= 4 and np.issubdtype(dtype, np.floating):\n return np.float32\n # float32 can exactly represent all integers up to 24 bits\n if dtype.itemsize <= 2 and np.issubdtype(dtype, np.integer):\n # A scale factor is entirely safe (vanishing into the mantissa),\n # but a large integer offset could lead to loss of precision.\n # Sensitivity analysis can be tricky, so we just use a float64\n # if there's any offset at all - better unoptimised than wrong!\n if not has_offset:\n return np.float32\n # For all other types and circumstances, we just use float64.\n # (safe because eg. complex numbers are not supported in NetCDF)\n return np.float64\n\n\nclass CFScaleOffsetCoder(VariableCoder):\n \"\"\"Scale and offset variables according to CF conventions.\n\n Follows the formula:\n decode_values = encoded_values * scale_factor + add_offset\n \"\"\"\n\n def encode(self, variable, name=None):\n dims, data, attrs, encoding = unpack_for_encoding(variable)\n\n if \"scale_factor\" in encoding or \"add_offset\" in encoding:\n dtype = _choose_float_dtype(data.dtype, \"add_offset\" in encoding)\n data = data.astype(dtype=dtype, copy=True)\n if \"add_offset\" in encoding:\n data -= pop_to(encoding, attrs, \"add_offset\", name=name)\n if \"scale_factor\" in encoding:\n data /= pop_to(encoding, attrs, \"scale_factor\", name=name)\n\n return Variable(dims, data, attrs, encoding)\n\n def decode(self, variable, name=None):\n dims, data, attrs, encoding = unpack_for_decoding(variable)\n\n if \"scale_factor\" in attrs or \"add_offset\" in attrs:\n scale_factor = pop_to(attrs, encoding, \"scale_factor\", name=name)\n add_offset = pop_to(attrs, encoding, \"add_offset\", name=name)\n dtype = _choose_float_dtype(data.dtype, \"add_offset\" in attrs)\n transform = partial(\n _scale_offset_decoding,\n scale_factor=scale_factor,\n add_offset=add_offset,\n dtype=dtype,\n )\n data = lazy_elemwise_func(data, transform, dtype)\n\n return Variable(dims, data, attrs, encoding)\n\n\nclass UnsignedIntegerCoder(VariableCoder):\n def encode(self, variable, name=None):\n dims, data, attrs, encoding = unpack_for_encoding(variable)\n\n # from netCDF best practices\n # https://www.unidata.ucar.edu/software/netcdf/docs/BestPractices.html\n # \"_Unsigned = \"true\" to indicate that\n # integer data should be treated as unsigned\"\n if encoding.get(\"_Unsigned\", \"false\") == \"true\":\n pop_to(encoding, attrs, \"_Unsigned\")\n signed_dtype = np.dtype(\"i%s\" % data.dtype.itemsize)\n if \"_FillValue\" in attrs:\n new_fill = signed_dtype.type(attrs[\"_FillValue\"])\n attrs[\"_FillValue\"] = new_fill\n data = duck_array_ops.around(data).astype(signed_dtype)\n\n return Variable(dims, data, attrs, encoding)\n\n def decode(self, variable, name=None):\n dims, data, attrs, encoding = unpack_for_decoding(variable)\n\n if \"_Unsigned\" in attrs:\n unsigned = pop_to(attrs, encoding, \"_Unsigned\")\n\n if data.dtype.kind == \"i\":\n if unsigned == \"true\":\n unsigned_dtype = np.dtype(\"u%s\" % data.dtype.itemsize)\n transform = partial(np.asarray, dtype=unsigned_dtype)\n data = lazy_elemwise_func(data, transform, unsigned_dtype)\n if \"_FillValue\" in attrs:\n new_fill = unsigned_dtype.type(attrs[\"_FillValue\"])\n attrs[\"_FillValue\"] = new_fill\n else:\n warnings.warn(\n \"variable %r has _Unsigned attribute but is not \"\n \"of integer type. Ignoring attribute.\" % name,\n SerializationWarning,\n stacklevel=3,\n )\n\n return Variable(dims, data, attrs, encoding)\n" ]
[ [ "pandas.isnull", "numpy.asarray", "numpy.issubdtype", "numpy.dtype", "numpy.ravel", "numpy.array", "numpy.where" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "0.23", "0.21", "2.0", "1.4", "0.19", "1.1", "1.5", "1.2", "0.24", "0.20", "1.0", "0.25", "1.3" ], "scipy": [], "tensorflow": [] } ]
dixit-dude7/LDAM-DRW
[ "6366f4756d3ac0c6b6db784b7f20e16066967ed4" ]
[ "utils.py" ]
[ "import torch\r\nimport shutil\r\nimport os\r\nimport numpy as np\r\nimport matplotlib\r\nmatplotlib.use('Agg')\r\nimport matplotlib.pyplot as plt\r\nfrom sklearn.metrics import confusion_matrix\r\nfrom sklearn.utils.multiclass import unique_labels\r\n\r\nclass ImbalancedDatasetSampler(torch.utils.data.sampler.Sampler):\r\n\r\n def __init__(self, dataset, indices=None, num_samples=None):\r\n \r\n # if indices is not provided, \r\n # all elements in the dataset will be considered\r\n self.indices = list(range(len(dataset))) \\\r\n if indices is None else indices\r\n \r\n # if num_samples is not provided, \r\n # draw `len(indices)` samples in each iteration\r\n self.num_samples = len(self.indices) \\\r\n if num_samples is None else num_samples\r\n \r\n # distribution of classes in the dataset \r\n label_to_count = [0] * len(np.unique(dataset.targets))\r\n for idx in self.indices:\r\n label = self._get_label(dataset, idx)\r\n label_to_count[label] += 1\r\n \r\n beta = 0.9999\r\n effective_num = 1.0 - np.power(beta, label_to_count)\r\n per_cls_weights = (1.0 - beta) / np.array(effective_num)\r\n\r\n # weight for each sample\r\n weights = [per_cls_weights[self._get_label(dataset, idx)]\r\n for idx in self.indices]\r\n self.weights = torch.DoubleTensor(weights)\r\n \r\n def _get_label(self, dataset, idx):\r\n return dataset.targets[idx]\r\n \r\n def __iter__(self):\r\n return iter(torch.multinomial(self.weights, self.num_samples, replacement=True).tolist())\r\n\r\n def __len__(self):\r\n return self.num_samples\r\n\r\ndef calc_confusion_mat(val_loader, model, args):\r\n \r\n model.eval()\r\n all_preds = []\r\n all_targets = []\r\n with torch.no_grad():\r\n for i, (input, target) in enumerate(val_loader):\r\n if args.gpu is not None:\r\n input = input.cuda(args.gpu, non_blocking=True)\r\n target = target.cuda(args.gpu, non_blocking=True)\r\n\r\n # compute output\r\n output = model(input)\r\n _, pred = torch.max(output, 1)\r\n all_preds.extend(pred.cpu().numpy())\r\n all_targets.extend(target.cpu().numpy())\r\n cf = confusion_matrix(all_targets, all_preds).astype(float)\r\n\r\n cls_cnt = cf.sum(axis=1)\r\n cls_hit = np.diag(cf)\r\n\r\n cls_acc = cls_hit / cls_cnt\r\n\r\n print('Class Accuracy : ')\r\n print(cls_acc)\r\n classes = [str(x) for x in args.cls_num_list]\r\n plot_confusion_matrix(all_targets, all_preds, classes)\r\n plt.savefig(os.path.join(args.root_log, args.store_name, 'confusion_matrix.png'))\r\n\r\ndef plot_confusion_matrix(y_true, y_pred, classes,\r\n normalize=False,\r\n title=None,\r\n cmap=plt.cm.Blues):\r\n \r\n if not title:\r\n if normalize:\r\n title = 'Normalized confusion matrix'\r\n else:\r\n title = 'Confusion matrix, without normalization'\r\n\r\n # Compute confusion matrix\r\n cm = confusion_matrix(y_true, y_pred)\r\n \r\n fig, ax = plt.subplots()\r\n im = ax.imshow(cm, interpolation='nearest', cmap=cmap)\r\n ax.figure.colorbar(im, ax=ax)\r\n # We want to show all ticks...\r\n ax.set(xticks=np.arange(cm.shape[1]),\r\n yticks=np.arange(cm.shape[0]),\r\n # ... and label them with the respective list entries\r\n xticklabels=classes, yticklabels=classes,\r\n title=title,\r\n ylabel='True label',\r\n xlabel='Predicted label')\r\n\r\n # Rotate the tick labels and set their alignment.\r\n plt.setp(ax.get_xticklabels(), rotation=45, ha=\"right\",\r\n rotation_mode=\"anchor\")\r\n\r\n # Loop over data dimensions and create text annotations.\r\n fmt = '.2f' if normalize else 'd'\r\n thresh = cm.max() / 2.\r\n for i in range(cm.shape[0]):\r\n for j in range(cm.shape[1]):\r\n ax.text(j, i, format(cm[i, j], fmt),\r\n ha=\"center\", va=\"center\",\r\n color=\"white\" if cm[i, j] > thresh else \"black\")\r\n fig.tight_layout()\r\n return ax\r\n\r\ndef prepare_folders(args):\r\n \r\n folders_util = [args.root_log, args.root_model,\r\n os.path.join(args.root_log, args.store_name),\r\n os.path.join(args.root_model, args.store_name)]\r\n for folder in folders_util:\r\n if not os.path.exists(folder):\r\n print('creating folder ' + folder)\r\n os.mkdir(folder)\r\n\r\ndef save_checkpoint(args, state, is_best):\r\n \r\n filename = '%s/%s/ckpt.pth.tar' % (args.root_model, args.store_name)\r\n torch.save(state, filename)\r\n if is_best:\r\n shutil.copyfile(filename, filename.replace('pth.tar', 'best.pth.tar'))\r\n\r\n\r\nclass AverageMeter(object):\r\n \r\n def __init__(self, name, fmt=':f'):\r\n self.name = name\r\n self.fmt = fmt\r\n self.reset()\r\n\r\n def reset(self):\r\n self.val = 0\r\n self.avg = 0\r\n self.sum = 0\r\n self.count = 0\r\n\r\n def update(self, val, n=1):\r\n self.val = val\r\n self.sum += val * n\r\n self.count += n\r\n self.avg = self.sum / self.count\r\n\r\n def __str__(self):\r\n fmtstr = '{name} {val' + self.fmt + '} ({avg' + self.fmt + '})'\r\n return fmtstr.format(**self.__dict__)\r\n\r\n\r\ndef accuracy(output, target, topk=(1,)):\r\n \r\n with torch.no_grad():\r\n maxk = max(topk)\r\n batch_size = target.size(0)\r\n\r\n _, pred = output.topk(maxk, 1, True, True)\r\n pred = pred.t()\r\n correct = pred.eq(target.view(1, -1).expand_as(pred))\r\n\r\n res = []\r\n for k in topk:\r\n correct_k = correct[:k].reshape(-1).float().sum(0, keepdim=True)\r\n res.append(correct_k.mul_(100.0 / batch_size))\r\n return res" ]
[ [ "numpy.diag", "torch.max", "numpy.power", "numpy.unique", "matplotlib.use", "numpy.arange", "sklearn.metrics.confusion_matrix", "matplotlib.pyplot.subplots", "torch.multinomial", "torch.no_grad", "numpy.array", "torch.DoubleTensor", "torch.save" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
mzhaoshuai/RMI
[ "10a40cdbeb58bdd1bd7125fde73b48b12f9452c7" ]
[ "losses/normal_loss.py" ]
[ "#coding=utf-8\n\n\"\"\"\nImplementation of some commonly used losses.\n\"\"\"\n\n# python 2.X, 3.X compatibility\nfrom __future__ import print_function\nfrom __future__ import division\nfrom __future__ import absolute_import\n\n#import os\n#import numpy as np\n\nimport torch\nimport torch.nn as nn\nimport torch.nn.functional as F\n\n\nclass BCECrossEntropyLoss(nn.Module):\n\t\"\"\"\n\tsigmoid with binary cross entropy loss.\n\tconsider the multiclass task as multi binary classification problem.\n\tone-vs-rest way.\n\tSUM over the channel.\n\t\"\"\"\n\tdef __init__(self,\n\t\t\t\t\tnum_classes=21,\n\t\t\t\t\tignore_index=255):\n\t\tsuper(BCECrossEntropyLoss, self).__init__()\n\t\tself.num_classes = num_classes\n\t\tself.ignore_index = ignore_index\n\n\tdef forward(self, logits_4D, labels_4D):\n\t\t\"\"\"\n\t\tArgs:\n\t\t\tlogits_4D \t:\t[N, C, H, W], dtype=float32\n\t\t\tlabels_4D \t:\t[N, H, W], dtype=long\n\t\t\"\"\"\n\t\tlabel_flat = labels_4D.view(-1).requires_grad_(False)\n\t\tlabel_mask_flat = label_flat < self.num_classes\n\t\tonehot_label_flat = F.one_hot(label_flat * label_mask_flat.long(), num_classes=self.num_classes).float()\n\t\tonehot_label_flat = onehot_label_flat.requires_grad_(False)\n\t\tlogits_flat = logits_4D.permute(0, 2, 3, 1).contiguous().view([-1, self.num_classes])\n\n\t\t# binary loss, multiplied by the not_ignore_mask\n\t\tlabel_mask_flat = label_mask_flat.float()\n\t\tvalid_pixels = torch.sum(label_mask_flat)\n\t\tbinary_loss = F.binary_cross_entropy_with_logits(logits_flat,\n\t\t\t\t\t\t\t\t\t\t\t\t\t\t\ttarget=onehot_label_flat,\n\t\t\t\t\t\t\t\t\t\t\t\t\t\t\tweight=label_mask_flat.unsqueeze(dim=1),\n\t\t\t\t\t\t\t\t\t\t\t\t\t\t\treduction='sum')\n\t\tbce_loss = torch.div(binary_loss, valid_pixels + 1.0)\n\t\treturn bce_loss\n" ]
[ [ "torch.div", "torch.sum" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
Learning-and-Intelligent-Systems/predicators
[ "0b2e71cacf86ba2bfdc1d9059c3a78016d0a4d7e" ]
[ "src/envs/painting.py" ]
[ "\"\"\"Painting domain, which allows for two different grasps on an object (side or\ntop).\n\nSide grasping allows for placing into the shelf, and top grasping allows\nfor placing into the box. The box has a lid which may need to be opened;\nthis lid is NOT modeled by any of the given predicates.\n\"\"\"\n\nfrom typing import Any, ClassVar, Dict, List, Optional, Sequence, Set, Tuple, \\\n Union\n\nimport matplotlib\nimport matplotlib.pyplot as plt\nimport numpy as np\nfrom gym.spaces import Box\nfrom matplotlib import patches\n\nfrom predicators.src import utils\nfrom predicators.src.envs import BaseEnv\nfrom predicators.src.settings import CFG\nfrom predicators.src.structs import Action, Array, GroundAtom, Object, \\\n ParameterizedOption, Predicate, State, Task, Type\n\n\nclass PaintingEnv(BaseEnv):\n \"\"\"Painting domain.\"\"\"\n # Parameters that aren't important enough to need to clog up settings.py\n table_lb: ClassVar[float] = -10.1\n table_ub: ClassVar[float] = -1.0\n table_height: ClassVar[float] = 0.2\n table_x: ClassVar[float] = 1.65\n shelf_l: ClassVar[float] = 2.0 # shelf length\n shelf_lb: ClassVar[float] = 1.\n shelf_ub: ClassVar[float] = shelf_lb + shelf_l - 0.05\n shelf_x: ClassVar[float] = 1.65\n shelf_y: ClassVar[float] = (shelf_lb + shelf_ub) / 2.0\n box_s: ClassVar[float] = 0.8 # side length\n box_y: ClassVar[float] = 0.5 # y coordinate\n box_lb: ClassVar[float] = box_y - box_s / 10\n box_ub: ClassVar[float] = box_y + box_s / 10\n box_x: ClassVar[float] = 1.65\n env_lb: ClassVar[float] = min(table_lb, shelf_lb, box_lb)\n env_ub: ClassVar[float] = max(table_ub, shelf_ub, box_ub)\n obj_height: ClassVar[float] = 0.13\n obj_radius: ClassVar[float] = 0.03\n obj_x: ClassVar[float] = 1.65\n obj_z: ClassVar[float] = table_height + obj_height / 2\n pick_tol: ClassVar[float] = 1e-2\n color_tol: ClassVar[float] = 1e-2\n wetness_tol: ClassVar[float] = 0.5\n dirtiness_tol: ClassVar[float] = 0.5\n open_fingers: ClassVar[float] = 0.8\n top_grasp_thresh: ClassVar[float] = 0.5 + 1e-2\n side_grasp_thresh: ClassVar[float] = 0.5 - 1e-2\n robot_x: ClassVar[float] = table_x - 0.5\n nextto_thresh: ClassVar[float] = 1.0\n on_table_height_tol: ClassVar[float] = 5e-02\n\n def __init__(self) -> None:\n super().__init__()\n # Types\n self._obj_type = Type(\"obj\", [\n \"pose_x\", \"pose_y\", \"pose_z\", \"dirtiness\", \"wetness\", \"color\",\n \"grasp\", \"held\"\n ])\n self._box_type = Type(\"box\", [\"pose_x\", \"pose_y\", \"color\"])\n self._lid_type = Type(\"lid\", [\"is_open\"])\n self._shelf_type = Type(\"shelf\", [\"pose_x\", \"pose_y\", \"color\"])\n self._robot_type = Type(\"robot\", [\"pose_x\", \"pose_y\", \"fingers\"])\n # Predicates\n self._InBox = Predicate(\"InBox\", [self._obj_type, self._box_type],\n self._InBox_holds)\n self._InShelf = Predicate(\"InShelf\",\n [self._obj_type, self._shelf_type],\n self._InShelf_holds)\n self._IsBoxColor = Predicate(\"IsBoxColor\",\n [self._obj_type, self._box_type],\n self._IsBoxColor_holds)\n self._IsShelfColor = Predicate(\"IsShelfColor\",\n [self._obj_type, self._shelf_type],\n self._IsShelfColor_holds)\n self._GripperOpen = Predicate(\"GripperOpen\", [self._robot_type],\n self._GripperOpen_holds)\n self._OnTable = Predicate(\"OnTable\", [self._obj_type],\n self._OnTable_holds)\n self._NotOnTable = Predicate(\"NotOnTable\", [self._obj_type],\n self._NotOnTable_holds)\n self._HoldingTop = Predicate(\"HoldingTop\", [self._obj_type],\n self._HoldingTop_holds)\n self._HoldingSide = Predicate(\"HoldingSide\", [self._obj_type],\n self._HoldingSide_holds)\n self._Holding = Predicate(\"Holding\", [self._obj_type],\n self._Holding_holds)\n self._IsWet = Predicate(\"IsWet\", [self._obj_type], self._IsWet_holds)\n self._IsDry = Predicate(\"IsDry\", [self._obj_type], self._IsDry_holds)\n self._IsDirty = Predicate(\"IsDirty\", [self._obj_type],\n self._IsDirty_holds)\n self._IsClean = Predicate(\"IsClean\", [self._obj_type],\n self._IsClean_holds)\n # Options\n self._Pick = utils.SingletonParameterizedOption(\n # variables: [robot, object to pick]\n # params: [grasp]\n \"Pick\",\n self._Pick_policy,\n types=[self._robot_type, self._obj_type],\n params_space=Box(np.array([-0.01], dtype=np.float32),\n np.array([1.01], dtype=np.float32)))\n self._Wash = utils.SingletonParameterizedOption(\n # variables: [robot]\n # params: []\n \"Wash\",\n self._Wash_policy,\n types=[self._robot_type])\n self._Dry = utils.SingletonParameterizedOption(\n # variables: [robot]\n # params: []\n \"Dry\",\n self._Dry_policy,\n types=[self._robot_type])\n self._Paint = utils.SingletonParameterizedOption(\n # variables: [robot]\n # params: [new color]\n \"Paint\",\n self._Paint_policy,\n types=[self._robot_type],\n params_space=Box(-0.01, 1.01, (1, )))\n self._Place = utils.SingletonParameterizedOption(\n # variables: [robot]\n # params: [absolute x, absolute y, absolute z]\n \"Place\",\n self._Place_policy,\n types=[self._robot_type],\n params_space=Box(\n np.array([self.obj_x - 1e-2, self.env_lb, self.obj_z - 1e-2],\n dtype=np.float32),\n np.array([self.obj_x + 1e-2, self.env_ub, self.obj_z + 1e-2],\n dtype=np.float32)))\n self._OpenLid = utils.SingletonParameterizedOption(\n # variables: [robot, lid]\n # params: []\n \"OpenLid\",\n self._OpenLid_policy,\n types=[self._robot_type, self._lid_type])\n # Static objects (always exist no matter the settings).\n self._box = Object(\"receptacle_box\", self._box_type)\n self._lid = Object(\"box_lid\", self._lid_type)\n self._shelf = Object(\"receptacle_shelf\", self._shelf_type)\n self._robot = Object(\"robby\", self._robot_type)\n\n @classmethod\n def get_name(cls) -> str:\n return \"painting\"\n\n def simulate(self, state: State, action: Action) -> State:\n assert self.action_space.contains(action.arr)\n arr = action.arr\n # Infer which transition function to follow\n wash_affinity = 0 if arr[5] > 0.5 else abs(arr[5] - 0.5)\n dry_affinity = 0 if arr[6] > 0.5 else abs(arr[6] - 0.5)\n paint_affinity = min(abs(arr[7] - state.get(self._box, \"color\")),\n abs(arr[7] - state.get(self._shelf, \"color\")))\n affinities = [\n (abs(1 - arr[4]), self._transition_pick_or_openlid),\n (wash_affinity, self._transition_wash),\n (dry_affinity, self._transition_dry),\n (paint_affinity, self._transition_paint),\n (abs(-1 - arr[4]), self._transition_place),\n ]\n _, transition_fn = min(affinities, key=lambda item: item[0])\n return transition_fn(state, action)\n\n def _transition_pick_or_openlid(self, state: State,\n action: Action) -> State:\n x, y, z, grasp = action.arr[:4]\n next_state = state.copy()\n # Open lid\n if self.box_lb < y < self.box_ub:\n next_state.set(self._lid, \"is_open\", 1.0)\n return next_state\n held_obj = self._get_held_object(state)\n # Cannot pick if already holding something\n if held_obj is not None:\n return next_state\n # Cannot pick if object pose not on table\n if not self.table_lb < y < self.table_ub:\n return next_state\n # Cannot pick if grasp is invalid\n if self.side_grasp_thresh < grasp < self.top_grasp_thresh:\n return next_state\n # Check if some object is close enough to (x, y, z)\n target_obj = self._get_object_at_xyz(state, x, y, z)\n if target_obj is None:\n return next_state\n # Execute pick\n next_state.set(self._robot, \"fingers\", 0.0)\n next_state.set(target_obj, \"grasp\", grasp)\n next_state.set(target_obj, \"held\", 1.0)\n return next_state\n\n def _transition_wash(self, state: State, action: Action) -> State:\n target_wetness = action.arr[5]\n next_state = state.copy()\n held_obj = self._get_held_object(state)\n # Can only wash if holding obj\n if held_obj is None:\n return next_state\n # Execute wash\n cur_dirtiness = state.get(held_obj, \"dirtiness\")\n next_dirtiness = max(cur_dirtiness - target_wetness, 0.0)\n next_state.set(held_obj, \"wetness\", target_wetness)\n next_state.set(held_obj, \"dirtiness\", next_dirtiness)\n return next_state\n\n def _transition_dry(self, state: State, action: Action) -> State:\n target_wetness = max(1.0 - action.arr[6], 0.0)\n next_state = state.copy()\n held_obj = self._get_held_object(state)\n # Can only dry if holding obj\n if held_obj is None:\n return next_state\n # Execute dry\n next_state.set(held_obj, \"wetness\", target_wetness)\n return next_state\n\n def _transition_paint(self, state: State, action: Action) -> State:\n color = action.arr[7]\n next_state = state.copy()\n # Can only paint if holding obj\n held_obj = self._get_held_object(state)\n if held_obj is None:\n return next_state\n # Can only paint if dry and clean\n if state.get(held_obj, \"dirtiness\") > self.dirtiness_tol or \\\n state.get(held_obj, \"wetness\") > self.wetness_tol:\n return next_state\n # Execute paint\n next_state.set(held_obj, \"color\", color)\n return next_state\n\n def _transition_place(self, state: State, action: Action) -> State:\n # Action args are target pose for held obj\n x, y, z = action.arr[:3]\n next_state = state.copy()\n # Can only place if holding obj\n held_obj = self._get_held_object(state)\n if held_obj is None:\n return next_state\n # Detect table vs shelf vs box place\n if self.table_lb < y < self.table_ub:\n receptacle = \"table\"\n elif self.shelf_lb < y < self.shelf_ub:\n receptacle = \"shelf\"\n elif self.box_lb < y < self.box_ub:\n receptacle = \"box\"\n else:\n # Cannot place outside of table, shelf, or box\n return next_state\n if receptacle == \"box\" and state.get(self._lid, \"is_open\") < 0.5:\n # Cannot place in box if lid is not open\n raise utils.EnvironmentFailure(\"Box lid is closed.\",\n {\"offending_objects\": {self._lid}})\n # Detect top grasp vs side grasp\n grasp = state.get(held_obj, \"grasp\")\n if grasp > self.top_grasp_thresh:\n top_or_side = \"top\"\n elif grasp < self.side_grasp_thresh:\n top_or_side = \"side\"\n # Can only place in shelf if side grasping, box if top grasping. If the\n # receptacle is table, we don't care what kind of grasp it is.\n if receptacle == \"shelf\" and top_or_side != \"side\":\n return next_state\n if receptacle == \"box\" and top_or_side != \"top\":\n return next_state\n # Detect collisions\n collider = self._get_object_at_xyz(state, x, y, z)\n if receptacle == \"table\" and \\\n collider is not None and \\\n collider != held_obj:\n return next_state\n # Execute place\n next_state.set(self._robot, \"fingers\", 1.0)\n next_state.set(held_obj, \"pose_x\", x)\n next_state.set(held_obj, \"pose_y\", y)\n if self._update_z_poses:\n if receptacle == \"table\" and np.allclose(\n z,\n self.table_height + self.obj_height / 2,\n rtol=self.on_table_height_tol):\n # If placing on table, snap the object to the correct z\n # position as long as the place location is close enough\n # (measured by rtol) to the correct table height. This\n # is necessary for learned samplers to have any hope of\n # placing objects on the table.\n next_state.set(held_obj, \"pose_z\",\n self.table_height + self.obj_height / 2)\n else:\n next_state.set(held_obj, \"pose_z\", z)\n next_state.set(held_obj, \"grasp\", 0.5)\n next_state.set(held_obj, \"held\", 0.0)\n return next_state\n\n @property\n def _num_objects_train(self) -> List[int]:\n return CFG.painting_num_objs_train\n\n @property\n def _num_objects_test(self) -> List[int]:\n return CFG.painting_num_objs_test\n\n def _generate_train_tasks(self) -> List[Task]:\n return self._get_tasks(num_tasks=CFG.num_train_tasks,\n num_objs_lst=self._num_objects_train,\n rng=self._train_rng)\n\n def _generate_test_tasks(self) -> List[Task]:\n return self._get_tasks(num_tasks=CFG.num_test_tasks,\n num_objs_lst=self._num_objects_test,\n rng=self._test_rng)\n\n @property\n def predicates(self) -> Set[Predicate]:\n return {\n self._InBox, self._InShelf, self._IsBoxColor, self._IsShelfColor,\n self._GripperOpen, self._OnTable, self._NotOnTable,\n self._HoldingTop, self._HoldingSide, self._Holding, self._IsWet,\n self._IsDry, self._IsDirty, self._IsClean\n }\n\n @property\n def goal_predicates(self) -> Set[Predicate]:\n return {\n self._InBox, self._InShelf, self._IsBoxColor, self._IsShelfColor\n }\n\n @property\n def types(self) -> Set[Type]:\n return {\n self._obj_type, self._box_type, self._lid_type, self._shelf_type,\n self._robot_type\n }\n\n @property\n def options(self) -> Set[ParameterizedOption]:\n return {\n self._Pick, self._Wash, self._Dry, self._Paint, self._Place,\n self._OpenLid\n }\n\n @property\n def action_space(self) -> Box:\n # Actions are 8-dimensional vectors:\n # [x, y, z, grasp, pickplace, water level, heat level, color]\n # Note that pickplace is 1 for pick, -1 for place, and 0 otherwise,\n # while grasp, water level, heat level, and color are in [0, 1].\n # We set the lower bound for z to 0.0, rather than self.obj_z - 1e-2,\n # because in RepeatedNextToPainting, we use this dimension to check\n # affinity of the move action\n lowers = np.array(\n [self.obj_x - 1e-2, self.env_lb, 0.0, 0.0, -1.0, 0.0, 0.0, 0.0],\n dtype=np.float32)\n uppers = np.array([\n self.obj_x + 1e-2, self.env_ub, self.obj_z + 1e-2, 1.0, 1.0, 1.0,\n 1.0, 1.0\n ],\n dtype=np.float32)\n return Box(lowers, uppers)\n\n def render_state_plt(\n self,\n state: State,\n task: Task,\n action: Optional[Action] = None,\n caption: Optional[str] = None) -> matplotlib.figure.Figure:\n fig, ax = plt.subplots(1, 1)\n objs = [o for o in state if o.is_instance(self._obj_type)]\n denom = (self.env_ub - self.env_lb)\n # The factor of \"2\" here should actually be 0.5, but this\n # makes the objects too small, so we'll let it be bigger.\n # Don't be alarmed if objects seem to be intersecting in\n # the resulting videos.\n r = 2 * self.obj_radius / denom\n h = 2 * self.obj_height / denom\n z = (self.obj_z - self.env_lb) / denom\n # Draw box\n box_color = state.get(self._box, \"color\")\n box_lower = (self.box_lb - self.obj_radius - self.env_lb) / denom\n box_upper = (self.box_ub + self.obj_radius - self.env_lb) / denom\n rect = plt.Rectangle((box_lower, z - h),\n box_upper - box_lower,\n 2 * h,\n facecolor=[box_color, 0, 0],\n alpha=0.25)\n ax.add_patch(rect)\n # Draw box lid\n if state.get(self._lid, \"is_open\") < 0.5:\n plt.plot([box_lower, box_upper], [z + h, z + h],\n color=[box_color, 0, 0])\n # Draw shelf\n shelf_color = state.get(self._shelf, \"color\")\n shelf_lower = (self.shelf_lb - self.obj_radius - self.env_lb) / denom\n shelf_upper = (self.shelf_ub + self.obj_radius - self.env_lb) / denom\n rect = plt.Rectangle((shelf_lower, z - h),\n shelf_upper - shelf_lower,\n 2 * h,\n facecolor=[shelf_color, 0, 0],\n alpha=0.25)\n ax.add_patch(rect)\n # Draw objects\n held_obj = self._get_held_object(state)\n for obj in sorted(objs):\n x = state.get(obj, \"pose_x\")\n y = state.get(obj, \"pose_y\")\n z = state.get(obj, \"pose_z\")\n facecolor: Union[None, str, List[Any]] = None\n if state.get(obj, \"wetness\") > self.wetness_tol and \\\n state.get(obj, \"dirtiness\") < self.dirtiness_tol:\n # wet and clean\n facecolor = \"blue\"\n elif state.get(obj, \"wetness\") < self.wetness_tol and \\\n state.get(obj, \"dirtiness\") > self.dirtiness_tol:\n # dry and dirty\n facecolor = \"green\"\n elif state.get(obj, \"wetness\") < self.wetness_tol and \\\n state.get(obj, \"dirtiness\") < self.dirtiness_tol:\n # dry and clean\n facecolor = \"cyan\"\n obj_color = state.get(obj, \"color\")\n if obj_color > 0:\n facecolor = [obj_color, 0, 0]\n if held_obj == obj:\n assert state.get(self._robot, \"fingers\") < self.open_fingers\n grasp = state.get(held_obj, \"grasp\")\n assert grasp < self.side_grasp_thresh or \\\n grasp > self.top_grasp_thresh\n edgecolor = (\"yellow\"\n if grasp < self.side_grasp_thresh else \"orange\")\n else:\n edgecolor = \"gray\"\n # Normalize poses to [0, 1]\n x = (x - self.env_lb) / denom\n y = (y - self.env_lb) / denom\n z = (z - self.env_lb) / denom\n # Plot as rectangle\n rect = patches.Rectangle((y - r, z - h),\n 2 * r,\n 2 * h,\n zorder=-x,\n linewidth=1,\n edgecolor=edgecolor,\n facecolor=facecolor)\n ax.add_patch(rect)\n ax.set_xlim(-0.1, 1.1)\n ax.set_ylim(0.6, 1.0)\n title = (\"blue = wet+clean, green = dry+dirty, cyan = dry+clean;\\n\"\n \"yellow border = side grasp, orange border = top grasp\")\n if caption is not None:\n title += f\";\\n{caption}\"\n plt.suptitle(title, fontsize=12, wrap=True)\n plt.tight_layout()\n return fig\n\n @property\n def _max_objs_in_goal(self) -> int:\n return CFG.painting_max_objs_in_goal\n\n @property\n def _update_z_poses(self) -> bool:\n return False\n\n def _get_tasks(self, num_tasks: int, num_objs_lst: List[int],\n rng: np.random.Generator) -> List[Task]:\n tasks = []\n for i in range(num_tasks):\n num_objs = num_objs_lst[i % len(num_objs_lst)]\n data = {}\n # Initialize robot pos with open fingers\n robot_init_y = rng.uniform(self.table_lb, self.table_ub)\n data[self._robot] = np.array([self.robot_x, robot_init_y, 1.0],\n dtype=np.float32)\n # Sample distinct colors for shelf and box\n color1 = rng.uniform(0.2, 0.4)\n color2 = rng.uniform(0.6, 1.0)\n if rng.choice(2):\n box_color, shelf_color = color1, color2\n else:\n shelf_color, box_color = color1, color2\n # Create box, lid, and shelf objects\n lid_is_open = int(rng.uniform() < CFG.painting_lid_open_prob)\n data[self._box] = np.array([self.box_x, self.box_y, box_color],\n dtype=np.float32)\n data[self._lid] = np.array([lid_is_open], dtype=np.float32)\n data[self._shelf] = np.array(\n [self.shelf_x, self.shelf_y, shelf_color], dtype=np.float32)\n # Create moveable objects and goal\n objs = []\n obj_poses: List[Tuple[float, float, float]] = []\n goal = set()\n assert CFG.painting_goal_receptacles in (\"box_and_shelf\", \"box\",\n \"shelf\")\n if CFG.painting_goal_receptacles == \"shelf\":\n # No box; all max_objs_in_goal objects must go in the shelf\n num_objs_in_shelf = self._max_objs_in_goal\n else:\n # The last object is destined for the box, so the remaining\n # (max_objs_in_goal - 1) objects must go in the shelf\n num_objs_in_shelf = self._max_objs_in_goal - 1\n for j in range(num_objs):\n obj = Object(f\"obj{j}\", self._obj_type)\n objs.append(obj)\n pose = self._sample_initial_object_pose(obj_poses, rng)\n obj_poses.append(pose)\n # Start out wet and clean, dry and dirty, or dry and clean\n choice = rng.choice(3)\n if choice == 0:\n wetness = 0.0\n dirtiness = rng.uniform(0.5, 1.)\n elif choice == 1:\n wetness = rng.uniform(0.5, 1.)\n dirtiness = 0.0\n else:\n wetness = 0.0\n dirtiness = 0.0\n color = 0.0\n grasp = 0.5\n held = 0.0\n data[obj] = np.array([\n pose[0], pose[1], pose[2], dirtiness, wetness, color,\n grasp, held\n ],\n dtype=np.float32)\n if CFG.painting_goal_receptacles in (\n \"box_and_shelf\", \"box\") and j == num_objs - 1:\n # This object must go in the box\n # NOTE: the box can only fit one object\n goal.add(GroundAtom(self._InBox, [obj, self._box]))\n goal.add(GroundAtom(self._IsBoxColor, [obj, self._box]))\n elif CFG.painting_goal_receptacles in (\n \"box_and_shelf\", \"shelf\") and j < num_objs_in_shelf:\n # This object must go in the shelf\n # NOTE: any number of objects can fit in the shelf\n goal.add(GroundAtom(self._InShelf, [obj, self._shelf]))\n goal.add(GroundAtom(self._IsShelfColor,\n [obj, self._shelf]))\n assert len(goal) <= 2 * self._max_objs_in_goal\n state = State(data)\n # Sometimes start out holding an object, possibly with the wrong\n # grip, so that we'll have to put it on the table and regrasp\n if rng.uniform() < CFG.painting_initial_holding_prob:\n grasp = rng.choice([0.0, 1.0])\n target_obj = objs[rng.choice(len(objs))]\n state.set(self._robot, \"fingers\", 0.0)\n state.set(target_obj, \"grasp\", grasp)\n state.set(target_obj, \"held\", 1.0)\n state.set(target_obj, \"pose_y\",\n state.get(self._robot, \"pose_y\"))\n if self._update_z_poses:\n state.set(target_obj, \"pose_z\",\n state.get(target_obj, \"pose_z\") + 1.0)\n tasks.append(Task(state, goal))\n return tasks\n\n def _sample_initial_object_pose(\n self, existing_poses: List[Tuple[float, float, float]],\n rng: np.random.Generator) -> Tuple[float, float, float]:\n existing_ys = [p[1] for p in existing_poses]\n while True:\n this_y = rng.uniform(self.table_lb, self.table_ub)\n if all(\n abs(this_y - other_y) > 3.5 * self.obj_radius\n for other_y in existing_ys):\n return (self.obj_x, this_y,\n self.table_height + self.obj_height / 2)\n\n def _Pick_policy(self, state: State, memory: Dict,\n objects: Sequence[Object], params: Array) -> Action:\n del memory # unused\n _, obj = objects\n obj_x = state.get(obj, \"pose_x\")\n obj_y = state.get(obj, \"pose_y\")\n obj_z = state.get(obj, \"pose_z\")\n grasp, = params\n arr = np.array([obj_x, obj_y, obj_z, grasp, 1.0, 0.0, 0.0, 0.0],\n dtype=np.float32)\n # The grasp could cause the action to go out of bounds, so we clip\n # it back into the bounds for safety.\n arr = np.clip(arr, self.action_space.low, self.action_space.high)\n return Action(arr)\n\n def _Wash_policy(self, state: State, memory: Dict,\n objects: Sequence[Object], params: Array) -> Action:\n del state, memory, objects, params # unused\n arr = np.array(\n [self.obj_x, self.table_lb, self.obj_z, 0.0, 0.0, 1.0, 0.0, 0.0],\n dtype=np.float32)\n return Action(arr)\n\n def _Dry_policy(self, state: State, memory: Dict,\n objects: Sequence[Object], params: Array) -> Action:\n del state, memory, objects, params # unused\n arr = np.array(\n [self.obj_x, self.table_lb, self.obj_z, 0.0, 0.0, 0.0, 1.0, 0.0],\n dtype=np.float32)\n return Action(arr)\n\n def _Paint_policy(self, state: State, memory: Dict,\n objects: Sequence[Object], params: Array) -> Action:\n del state, memory, objects # unused\n new_color, = params\n new_color = min(max(new_color, 0.0), 1.0)\n arr = np.array([\n self.obj_x, self.table_lb, self.obj_z, 0.0, 0.0, 0.0, 0.0,\n new_color\n ],\n dtype=np.float32)\n return Action(arr)\n\n @staticmethod\n def _Place_policy(state: State, memory: Dict, objects: Sequence[Object],\n params: Array) -> Action:\n del state, memory, objects # unused\n x, y, z = params\n arr = np.array([x, y, z, 0.5, -1.0, 0.0, 0.0, 0.0], dtype=np.float32)\n return Action(arr)\n\n def _OpenLid_policy(self, state: State, memory: Dict,\n objects: Sequence[Object], params: Array) -> Action:\n del state, memory, objects, params # unused\n arr = np.array([\n self.obj_x, (self.box_lb + self.box_ub) / 2, self.obj_z, 0.0, 1.0,\n 0.0, 0.0, 0.0\n ],\n dtype=np.float32)\n return Action(arr)\n\n def _InBox_holds(self, state: State, objects: Sequence[Object]) -> bool:\n obj, _ = objects\n # If the object is held, not yet in box\n if self._obj_is_held(state, obj):\n return False\n # Check pose of object\n obj_y = state.get(obj, \"pose_y\")\n return self.box_lb < obj_y < self.box_ub\n\n def _InShelf_holds(self, state: State, objects: Sequence[Object]) -> bool:\n obj, _ = objects\n # If the object is held, not yet in shelf\n if self._obj_is_held(state, obj):\n return False\n # Check pose of object\n obj_y = state.get(obj, \"pose_y\")\n return self.shelf_lb < obj_y < self.shelf_ub\n\n def _IsBoxColor_holds(self, state: State,\n objects: Sequence[Object]) -> bool:\n obj, box = objects\n return abs(state.get(obj, \"color\") -\n state.get(box, \"color\")) < self.color_tol\n\n def _IsShelfColor_holds(self, state: State,\n objects: Sequence[Object]) -> bool:\n obj, shelf = objects\n return abs(state.get(obj, \"color\") -\n state.get(shelf, \"color\")) < self.color_tol\n\n def _GripperOpen_holds(self, state: State,\n objects: Sequence[Object]) -> bool:\n robot, = objects\n fingers = state.get(robot, \"fingers\")\n return fingers >= self.open_fingers\n\n def _OnTable_holds(self, state: State, objects: Sequence[Object]) -> bool:\n obj, = objects\n obj_y = state.get(obj, \"pose_y\")\n if not self.table_lb < obj_y < self.table_ub:\n return False\n # Note that obj_z is not updated in this class, but it may be updated\n # by subclasses by overriding self._update_z_poses.\n obj_z = state.get(obj, \"pose_z\")\n if not np.allclose(obj_z, self.table_height + self.obj_height / 2):\n assert self._update_z_poses\n return False\n return True\n\n def _NotOnTable_holds(self, state: State,\n objects: Sequence[Object]) -> bool:\n return not self._OnTable_holds(state, objects)\n\n def _HoldingTop_holds(self, state: State,\n objects: Sequence[Object]) -> bool:\n obj, = objects\n grasp = state.get(obj, \"grasp\")\n return grasp > self.top_grasp_thresh\n\n def _HoldingSide_holds(self, state: State,\n objects: Sequence[Object]) -> bool:\n obj, = objects\n grasp = state.get(obj, \"grasp\")\n return grasp < self.side_grasp_thresh\n\n def _Holding_holds(self, state: State, objects: Sequence[Object]) -> bool:\n obj, = objects\n return self._obj_is_held(state, obj)\n\n def _IsWet_holds(self, state: State, objects: Sequence[Object]) -> bool:\n obj, = objects\n return state.get(obj, \"wetness\") > self.wetness_tol\n\n def _IsDry_holds(self, state: State, objects: Sequence[Object]) -> bool:\n obj, = objects\n return not self._IsWet_holds(state, [obj])\n\n def _IsDirty_holds(self, state: State, objects: Sequence[Object]) -> bool:\n obj, = objects\n return state.get(obj, \"dirtiness\") > self.dirtiness_tol\n\n def _IsClean_holds(self, state: State, objects: Sequence[Object]) -> bool:\n obj, = objects\n return not self._IsDirty_holds(state, [obj])\n\n def _get_held_object(self, state: State) -> Optional[Object]:\n for obj in state:\n if obj.type != self._obj_type:\n continue\n if self._obj_is_held(state, obj):\n return obj\n return None\n\n def _obj_is_held(self, state: State, obj: Object) -> bool:\n # These two pieces of information are redundant. We include\n # the \"held\" feature only because it allows the Holding\n # predicate to be expressed with a single inequality.\n # Either feature can be used to implement this method.\n grasp = state.get(obj, \"grasp\")\n held_feat = state.get(obj, \"held\")\n is_held = (grasp > self.top_grasp_thresh\n or grasp < self.side_grasp_thresh)\n assert is_held == (held_feat > 0.5) # ensure redundancy\n return is_held\n\n def _get_object_at_xyz(self, state: State, x: float, y: float,\n z: float) -> Optional[Object]:\n target_obj = None\n for obj in state:\n if obj.type != self._obj_type:\n continue\n if np.allclose([x, y, z], [\n state.get(obj, \"pose_x\"),\n state.get(obj, \"pose_y\"),\n state.get(obj, \"pose_z\")\n ],\n atol=self.pick_tol):\n target_obj = obj\n return target_obj\n" ]
[ [ "matplotlib.pyplot.Rectangle", "matplotlib.pyplot.tight_layout", "numpy.allclose", "numpy.clip", "matplotlib.patches.Rectangle", "matplotlib.pyplot.subplots", "matplotlib.pyplot.plot", "numpy.array", "matplotlib.pyplot.suptitle" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
leggitta/mne-python
[ "11fb55c41b7c2cc800eb3406d9e44cabf00fc027" ]
[ "mne/fixes.py" ]
[ "\"\"\"Compatibility fixes for older version of python, numpy and scipy\n\nIf you add content to this file, please give the version of the package\nat which the fixe is no longer needed.\n\n# XXX : copied from scikit-learn\n\n\"\"\"\n# Authors: Emmanuelle Gouillart <[email protected]>\n# Gael Varoquaux <[email protected]>\n# Fabian Pedregosa <[email protected]>\n# Lars Buitinck <[email protected]>\n# License: BSD\n\nfrom __future__ import division\nimport collections\nfrom operator import itemgetter\nimport inspect\n\nimport warnings\nimport numpy as np\nimport scipy\nfrom scipy import linalg, sparse\nfrom math import ceil, log\nfrom numpy.fft import irfft\nfrom distutils.version import LooseVersion\nfrom functools import partial\nfrom .externals import six\nfrom .externals.six.moves import copyreg\nfrom gzip import GzipFile\n\n\n###############################################################################\n# Misc\n\nclass gzip_open(GzipFile): # python2.6 doesn't have context managing\n\n def __enter__(self):\n if hasattr(GzipFile, '__enter__'):\n return GzipFile.__enter__(self)\n else:\n return self\n\n def __exit__(self, exc_type, exc_value, traceback):\n if hasattr(GzipFile, '__exit__'):\n return GzipFile.__exit__(self, exc_type, exc_value, traceback)\n else:\n return self.close()\n\n\nclass _Counter(collections.defaultdict):\n \"\"\"Partial replacement for Python 2.7 collections.Counter.\"\"\"\n def __init__(self, iterable=(), **kwargs):\n super(_Counter, self).__init__(int, **kwargs)\n self.update(iterable)\n\n def most_common(self):\n return sorted(six.iteritems(self), key=itemgetter(1), reverse=True)\n\n def update(self, other):\n \"\"\"Adds counts for elements in other\"\"\"\n if isinstance(other, self.__class__):\n for x, n in six.iteritems(other):\n self[x] += n\n else:\n for x in other:\n self[x] += 1\n\ntry:\n Counter = collections.Counter\nexcept AttributeError:\n Counter = _Counter\n\n\ndef _unique(ar, return_index=False, return_inverse=False):\n \"\"\"A replacement for the np.unique that appeared in numpy 1.4.\n\n While np.unique existed long before, keyword return_inverse was\n only added in 1.4.\n \"\"\"\n try:\n ar = ar.flatten()\n except AttributeError:\n if not return_inverse and not return_index:\n items = sorted(set(ar))\n return np.asarray(items)\n else:\n ar = np.asarray(ar).flatten()\n\n if ar.size == 0:\n if return_inverse and return_index:\n return ar, np.empty(0, np.bool), np.empty(0, np.bool)\n elif return_inverse or return_index:\n return ar, np.empty(0, np.bool)\n else:\n return ar\n\n if return_inverse or return_index:\n perm = ar.argsort()\n aux = ar[perm]\n flag = np.concatenate(([True], aux[1:] != aux[:-1]))\n if return_inverse:\n iflag = np.cumsum(flag) - 1\n iperm = perm.argsort()\n if return_index:\n return aux[flag], perm[flag], iflag[iperm]\n else:\n return aux[flag], iflag[iperm]\n else:\n return aux[flag], perm[flag]\n\n else:\n ar.sort()\n flag = np.concatenate(([True], ar[1:] != ar[:-1]))\n return ar[flag]\n\nif LooseVersion(np.__version__) < LooseVersion('1.5'):\n unique = _unique\nelse:\n unique = np.unique\n\n\ndef _bincount(X, weights=None, minlength=None):\n \"\"\"Replacing np.bincount in numpy < 1.6 to provide minlength.\"\"\"\n result = np.bincount(X, weights)\n if minlength is None or len(result) >= minlength:\n return result\n out = np.zeros(minlength, np.int)\n out[:len(result)] = result\n return out\n\nif LooseVersion(np.__version__) < LooseVersion('1.6'):\n bincount = _bincount\nelse:\n bincount = np.bincount\n\n\ndef _copysign(x1, x2):\n \"\"\"Slow replacement for np.copysign, which was introduced in numpy 1.4\"\"\"\n return np.abs(x1) * np.sign(x2)\n\nif not hasattr(np, 'copysign'):\n copysign = _copysign\nelse:\n copysign = np.copysign\n\n\ndef _in1d(ar1, ar2, assume_unique=False, invert=False):\n \"\"\"Replacement for in1d that is provided for numpy >= 1.4\"\"\"\n # Ravel both arrays, behavior for the first array could be different\n ar1 = np.asarray(ar1).ravel()\n ar2 = np.asarray(ar2).ravel()\n\n # This code is significantly faster when the condition is satisfied.\n if len(ar2) < 10 * len(ar1) ** 0.145:\n if invert:\n mask = np.ones(len(ar1), dtype=np.bool)\n for a in ar2:\n mask &= (ar1 != a)\n else:\n mask = np.zeros(len(ar1), dtype=np.bool)\n for a in ar2:\n mask |= (ar1 == a)\n return mask\n\n # Otherwise use sorting\n if not assume_unique:\n ar1, rev_idx = unique(ar1, return_inverse=True)\n ar2 = np.unique(ar2)\n\n ar = np.concatenate((ar1, ar2))\n # We need this to be a stable sort, so always use 'mergesort'\n # here. The values from the first array should always come before\n # the values from the second array.\n order = ar.argsort(kind='mergesort')\n sar = ar[order]\n if invert:\n bool_ar = (sar[1:] != sar[:-1])\n else:\n bool_ar = (sar[1:] == sar[:-1])\n flag = np.concatenate((bool_ar, [invert]))\n indx = order.argsort(kind='mergesort')[:len(ar1)]\n\n if assume_unique:\n return flag[indx]\n else:\n return flag[indx][rev_idx]\n\n\nif not hasattr(np, 'in1d') or LooseVersion(np.__version__) < '1.8':\n in1d = _in1d\nelse:\n in1d = np.in1d\n\n\ndef _digitize(x, bins, right=False):\n \"\"\"Replacement for digitize with right kwarg (numpy < 1.7).\n\n Notes\n -----\n This fix is only meant for integer arrays. If ``right==True`` but either\n ``x`` or ``bins`` are of a different type, a NotImplementedError will be\n raised.\n \"\"\"\n if right:\n x = np.asarray(x)\n bins = np.asarray(bins)\n if (x.dtype.kind not in 'ui') or (bins.dtype.kind not in 'ui'):\n raise NotImplementedError(\"Only implemented for integer input\")\n return np.digitize(x - 1e-5, bins)\n else:\n return np.digitize(x, bins)\n\nif LooseVersion(np.__version__) < LooseVersion('1.7'):\n digitize = _digitize\nelse:\n digitize = np.digitize\n\n\ndef _tril_indices(n, k=0):\n \"\"\"Replacement for tril_indices that is provided for numpy >= 1.4\"\"\"\n mask = np.greater_equal(np.subtract.outer(np.arange(n), np.arange(n)), -k)\n indices = np.where(mask)\n\n return indices\n\nif not hasattr(np, 'tril_indices'):\n tril_indices = _tril_indices\nelse:\n tril_indices = np.tril_indices\n\n\ndef _unravel_index(indices, dims):\n \"\"\"Add support for multiple indices in unravel_index that is provided\n for numpy >= 1.4\"\"\"\n indices_arr = np.asarray(indices)\n if indices_arr.size == 1:\n return np.unravel_index(indices, dims)\n else:\n if indices_arr.ndim != 1:\n raise ValueError('indices should be one dimensional')\n\n ndims = len(dims)\n unraveled_coords = np.empty((indices_arr.size, ndims), dtype=np.int)\n for coord, idx in zip(unraveled_coords, indices_arr):\n coord[:] = np.unravel_index(idx, dims)\n return tuple(unraveled_coords.T)\n\n\nif LooseVersion(np.__version__) < LooseVersion('1.4'):\n unravel_index = _unravel_index\nelse:\n unravel_index = np.unravel_index\n\n\ndef _qr_economic_old(A, **kwargs):\n \"\"\"\n Compat function for the QR-decomposition in economic mode\n Scipy 0.9 changed the keyword econ=True to mode='economic'\n \"\"\"\n with warnings.catch_warnings(record=True):\n return linalg.qr(A, econ=True, **kwargs)\n\n\ndef _qr_economic_new(A, **kwargs):\n return linalg.qr(A, mode='economic', **kwargs)\n\n\nif LooseVersion(scipy.__version__) < LooseVersion('0.9'):\n qr_economic = _qr_economic_old\nelse:\n qr_economic = _qr_economic_new\n\n\ndef savemat(file_name, mdict, oned_as=\"column\", **kwargs):\n \"\"\"MATLAB-format output routine that is compatible with SciPy 0.7's.\n\n 0.7.2 (or .1?) added the oned_as keyword arg with 'column' as the default\n value. It issues a warning if this is not provided, stating that \"This will\n change to 'row' in future versions.\"\n \"\"\"\n import scipy.io\n try:\n return scipy.io.savemat(file_name, mdict, oned_as=oned_as, **kwargs)\n except TypeError:\n return scipy.io.savemat(file_name, mdict, **kwargs)\n\nif hasattr(np, 'count_nonzero'):\n from numpy import count_nonzero\nelse:\n def count_nonzero(X):\n return len(np.flatnonzero(X))\n\n# little dance to see if np.copy has an 'order' keyword argument\nif 'order' in inspect.getargspec(np.copy)[0]:\n def safe_copy(X):\n # Copy, but keep the order\n return np.copy(X, order='K')\nelse:\n # Before an 'order' argument was introduced, numpy wouldn't muck with\n # the ordering\n safe_copy = np.copy\n\n\ndef _meshgrid(*xi, **kwargs):\n \"\"\"\n Return coordinate matrices from coordinate vectors.\n Make N-D coordinate arrays for vectorized evaluations of\n N-D scalar/vector fields over N-D grids, given\n one-dimensional coordinate arrays x1, x2,..., xn.\n .. versionchanged:: 1.9\n 1-D and 0-D cases are allowed.\n Parameters\n ----------\n x1, x2,..., xn : array_like\n 1-D arrays representing the coordinates of a grid.\n indexing : {'xy', 'ij'}, optional\n Cartesian ('xy', default) or matrix ('ij') indexing of output.\n See Notes for more details.\n .. versionadded:: 1.7.0\n sparse : bool, optional\n If True a sparse grid is returned in order to conserve memory.\n Default is False.\n .. versionadded:: 1.7.0\n copy : bool, optional\n If False, a view into the original arrays are returned in order to\n conserve memory. Default is True. Please note that\n ``sparse=False, copy=False`` will likely return non-contiguous\n arrays. Furthermore, more than one element of a broadcast array\n may refer to a single memory location. If you need to write to the\n arrays, make copies first.\n .. versionadded:: 1.7.0\n Returns\n -------\n X1, X2,..., XN : ndarray\n For vectors `x1`, `x2`,..., 'xn' with lengths ``Ni=len(xi)`` ,\n return ``(N1, N2, N3,...Nn)`` shaped arrays if indexing='ij'\n or ``(N2, N1, N3,...Nn)`` shaped arrays if indexing='xy'\n with the elements of `xi` repeated to fill the matrix along\n the first dimension for `x1`, the second for `x2` and so on.\n \"\"\"\n ndim = len(xi)\n\n copy_ = kwargs.pop('copy', True)\n sparse = kwargs.pop('sparse', False)\n indexing = kwargs.pop('indexing', 'xy')\n\n if kwargs:\n raise TypeError(\"meshgrid() got an unexpected keyword argument '%s'\"\n % (list(kwargs)[0],))\n\n if indexing not in ['xy', 'ij']:\n raise ValueError(\n \"Valid values for `indexing` are 'xy' and 'ij'.\")\n\n s0 = (1,) * ndim\n output = [np.asanyarray(x).reshape(s0[:i] + (-1,) + s0[i + 1::])\n for i, x in enumerate(xi)]\n\n shape = [x.size for x in output]\n\n if indexing == 'xy' and ndim > 1:\n # switch first and second axis\n output[0].shape = (1, -1) + (1,) * (ndim - 2)\n output[1].shape = (-1, 1) + (1,) * (ndim - 2)\n shape[0], shape[1] = shape[1], shape[0]\n\n if sparse:\n if copy_:\n return [x.copy() for x in output]\n else:\n return output\n else:\n # Return the full N-D matrix (not only the 1-D vector)\n if copy_:\n mult_fact = np.ones(shape, dtype=int)\n return [x * mult_fact for x in output]\n else:\n return np.broadcast_arrays(*output)\n\nif LooseVersion(np.__version__) < LooseVersion('1.7'):\n meshgrid = _meshgrid\nelse:\n meshgrid = np.meshgrid\n\n\n###############################################################################\n# Back porting firwin2 for older scipy\n\n# Original version of firwin2 from scipy ticket #457, submitted by \"tash\".\n#\n# Rewritten by Warren Weckesser, 2010.\n\n\ndef _firwin2(numtaps, freq, gain, nfreqs=None, window='hamming', nyq=1.0):\n \"\"\"FIR filter design using the window method.\n\n From the given frequencies `freq` and corresponding gains `gain`,\n this function constructs an FIR filter with linear phase and\n (approximately) the given frequency response.\n\n Parameters\n ----------\n numtaps : int\n The number of taps in the FIR filter. `numtaps` must be less than\n `nfreqs`. If the gain at the Nyquist rate, `gain[-1]`, is not 0,\n then `numtaps` must be odd.\n\n freq : array-like, 1D\n The frequency sampling points. Typically 0.0 to 1.0 with 1.0 being\n Nyquist. The Nyquist frequency can be redefined with the argument\n `nyq`.\n\n The values in `freq` must be nondecreasing. A value can be repeated\n once to implement a discontinuity. The first value in `freq` must\n be 0, and the last value must be `nyq`.\n\n gain : array-like\n The filter gains at the frequency sampling points.\n\n nfreqs : int, optional\n The size of the interpolation mesh used to construct the filter.\n For most efficient behavior, this should be a power of 2 plus 1\n (e.g, 129, 257, etc). The default is one more than the smallest\n power of 2 that is not less than `numtaps`. `nfreqs` must be greater\n than `numtaps`.\n\n window : string or (string, float) or float, or None, optional\n Window function to use. Default is \"hamming\". See\n `scipy.signal.get_window` for the complete list of possible values.\n If None, no window function is applied.\n\n nyq : float\n Nyquist frequency. Each frequency in `freq` must be between 0 and\n `nyq` (inclusive).\n\n Returns\n -------\n taps : numpy 1D array of length `numtaps`\n The filter coefficients of the FIR filter.\n\n Examples\n --------\n A lowpass FIR filter with a response that is 1 on [0.0, 0.5], and\n that decreases linearly on [0.5, 1.0] from 1 to 0:\n\n >>> taps = firwin2(150, [0.0, 0.5, 1.0], [1.0, 1.0, 0.0]) # doctest: +SKIP\n >>> print(taps[72:78]) # doctest: +SKIP\n [-0.02286961 -0.06362756 0.57310236 0.57310236 -0.06362756 -0.02286961]\n\n See also\n --------\n scipy.signal.firwin\n\n Notes\n -----\n\n From the given set of frequencies and gains, the desired response is\n constructed in the frequency domain. The inverse FFT is applied to the\n desired response to create the associated convolution kernel, and the\n first `numtaps` coefficients of this kernel, scaled by `window`, are\n returned.\n\n The FIR filter will have linear phase. The filter is Type I if `numtaps`\n is odd and Type II if `numtaps` is even. Because Type II filters always\n have a zero at the Nyquist frequency, `numtaps` must be odd if `gain[-1]`\n is not zero.\n\n .. versionadded:: 0.9.0\n\n References\n ----------\n .. [1] Oppenheim, A. V. and Schafer, R. W., \"Discrete-Time Signal\n Processing\", Prentice-Hall, Englewood Cliffs, New Jersey (1989).\n (See, for example, Section 7.4.)\n\n .. [2] Smith, Steven W., \"The Scientist and Engineer's Guide to Digital\n Signal Processing\", Ch. 17. http://www.dspguide.com/ch17/1.htm\n\n \"\"\"\n\n if len(freq) != len(gain):\n raise ValueError('freq and gain must be of same length.')\n\n if nfreqs is not None and numtaps >= nfreqs:\n raise ValueError('ntaps must be less than nfreqs, but firwin2 was '\n 'called with ntaps=%d and nfreqs=%s'\n % (numtaps, nfreqs))\n\n if freq[0] != 0 or freq[-1] != nyq:\n raise ValueError('freq must start with 0 and end with `nyq`.')\n d = np.diff(freq)\n if (d < 0).any():\n raise ValueError('The values in freq must be nondecreasing.')\n d2 = d[:-1] + d[1:]\n if (d2 == 0).any():\n raise ValueError('A value in freq must not occur more than twice.')\n\n if numtaps % 2 == 0 and gain[-1] != 0.0:\n raise ValueError(\"A filter with an even number of coefficients must \"\n \"have zero gain at the Nyquist rate.\")\n\n if nfreqs is None:\n nfreqs = 1 + 2 ** int(ceil(log(numtaps, 2)))\n\n # Tweak any repeated values in freq so that interp works.\n eps = np.finfo(float).eps\n for k in range(len(freq)):\n if k < len(freq) - 1 and freq[k] == freq[k + 1]:\n freq[k] = freq[k] - eps\n freq[k + 1] = freq[k + 1] + eps\n\n # Linearly interpolate the desired response on a uniform mesh `x`.\n x = np.linspace(0.0, nyq, nfreqs)\n fx = np.interp(x, freq, gain)\n\n # Adjust the phases of the coefficients so that the first `ntaps` of the\n # inverse FFT are the desired filter coefficients.\n shift = np.exp(-(numtaps - 1) / 2. * 1.j * np.pi * x / nyq)\n fx2 = fx * shift\n\n # Use irfft to compute the inverse FFT.\n out_full = irfft(fx2)\n\n if window is not None:\n # Create the window to apply to the filter coefficients.\n from scipy.signal.signaltools import get_window\n wind = get_window(window, numtaps, fftbins=False)\n else:\n wind = 1\n\n # Keep only the first `numtaps` coefficients in `out`, and multiply by\n # the window.\n out = out_full[:numtaps] * wind\n\n return out\n\n\ndef get_firwin2():\n \"\"\"Helper to get firwin2\"\"\"\n try:\n from scipy.signal import firwin2\n except ImportError:\n firwin2 = _firwin2\n return firwin2\n\n\ndef _filtfilt(*args, **kwargs):\n \"\"\"wrap filtfilt, excluding padding arguments\"\"\"\n from scipy.signal import filtfilt\n # cut out filter args\n if len(args) > 4:\n args = args[:4]\n if 'padlen' in kwargs:\n del kwargs['padlen']\n return filtfilt(*args, **kwargs)\n\n\ndef get_filtfilt():\n \"\"\"Helper to get filtfilt from scipy\"\"\"\n from scipy.signal import filtfilt\n\n if 'padlen' in inspect.getargspec(filtfilt)[0]:\n return filtfilt\n\n return _filtfilt\n\n\n###############################################################################\n# Back porting matrix_rank for numpy < 1.7\n\n\ndef _matrix_rank(M, tol=None):\n \"\"\" Return matrix rank of array using SVD method\n\n Rank of the array is the number of SVD singular values of the array that\n are greater than `tol`.\n\n Parameters\n ----------\n M : {(M,), (M, N)} array_like\n array of <=2 dimensions\n tol : {None, float}, optional\n threshold below which SVD values are considered zero. If `tol` is\n None, and ``S`` is an array with singular values for `M`, and\n ``eps`` is the epsilon value for datatype of ``S``, then `tol` is\n set to ``S.max() * max(M.shape) * eps``.\n\n Notes\n -----\n The default threshold to detect rank deficiency is a test on the magnitude\n of the singular values of `M`. By default, we identify singular values less\n than ``S.max() * max(M.shape) * eps`` as indicating rank deficiency (with\n the symbols defined above). This is the algorithm MATLAB uses [1]. It also\n appears in *Numerical recipes* in the discussion of SVD solutions for\n linear least squares [2].\n\n This default threshold is designed to detect rank deficiency accounting\n for the numerical errors of the SVD computation. Imagine that there is a\n column in `M` that is an exact (in floating point) linear combination of\n other columns in `M`. Computing the SVD on `M` will not produce a\n singular value exactly equal to 0 in general: any difference of the\n smallest SVD value from 0 will be caused by numerical imprecision in the\n calculation of the SVD. Our threshold for small SVD values takes this\n numerical imprecision into account, and the default threshold will detect\n such numerical rank deficiency. The threshold may declare a matrix `M`\n rank deficient even if the linear combination of some columns of `M` is\n not exactly equal to another column of `M` but only numerically very\n close to another column of `M`.\n\n We chose our default threshold because it is in wide use. Other\n thresholds are possible. For example, elsewhere in the 2007 edition of\n *Numerical recipes* there is an alternative threshold of ``S.max() *\n np.finfo(M.dtype).eps / 2. * np.sqrt(m + n + 1.)``. The authors describe\n this threshold as being based on \"expected roundoff error\" (p 71).\n\n The thresholds above deal with floating point roundoff error in the\n calculation of the SVD. However, you may have more information about the\n sources of error in `M` that would make you consider other tolerance\n values to detect *effective* rank deficiency. The most useful measure of\n the tolerance depends on the operations you intend to use on your matrix.\n For example, if your data come from uncertain measurements with\n uncertainties greater than floating point epsilon, choosing a tolerance\n near that uncertainty may be preferable. The tolerance may be absolute if\n the uncertainties are absolute rather than relative.\n\n References\n ----------\n .. [1] MATLAB reference documention, \"Rank\"\n http://www.mathworks.com/help/techdoc/ref/rank.html\n .. [2] W. H. Press, S. A. Teukolsky, W. T. Vetterling and B. P. Flannery,\n \"Numerical Recipes (3rd edition)\", Cambridge University Press, 2007,\n page 795.\n\n Examples\n --------\n >>> from numpy.linalg import matrix_rank\n >>> matrix_rank(np.eye(4)) # Full rank matrix\n 4\n >>> I=np.eye(4); I[-1,-1] = 0. # rank deficient matrix\n >>> matrix_rank(I)\n 3\n >>> matrix_rank(np.ones((4,))) # 1 dimension - rank 1 unless all 0\n 1\n >>> matrix_rank(np.zeros((4,)))\n 0\n \"\"\"\n M = np.asarray(M)\n if M.ndim > 2:\n raise TypeError('array should have 2 or fewer dimensions')\n if M.ndim < 2:\n return np.int(not all(M == 0))\n S = np.linalg.svd(M, compute_uv=False)\n if tol is None:\n tol = S.max() * np.max(M.shape) * np.finfo(S.dtype).eps\n return np.sum(S > tol)\n\nif LooseVersion(np.__version__) > '1.7.1':\n from numpy.linalg import matrix_rank\nelse:\n matrix_rank = _matrix_rank\n\n\ndef _reconstruct_partial(func, args, kwargs):\n \"\"\"Helper to pickle partial functions\"\"\"\n return partial(func, *args, **(kwargs or {}))\n\n\ndef _reduce_partial(p):\n \"\"\"Helper to pickle partial functions\"\"\"\n return _reconstruct_partial, (p.func, p.args, p.keywords)\n\n# This adds pickling functionality to older Python 2.6\n# Please always import partial from here.\ncopyreg.pickle(partial, _reduce_partial)\n\n\ndef normalize_colors(vmin, vmax, clip=False):\n \"\"\"Helper to handle matplotlib API\"\"\"\n import matplotlib.pyplot as plt\n try:\n return plt.Normalize(vmin, vmax, clip=clip)\n except AttributeError:\n return plt.normalize(vmin, vmax, clip=clip)\n\n\ndef assert_true(expr, msg='False is not True'):\n \"\"\"Fake assert_true without message\"\"\"\n if not expr:\n raise AssertionError(msg)\n\n\ndef assert_is(expr1, expr2, msg=None):\n \"\"\"Fake assert_is without message\"\"\"\n assert_true(expr2 is expr2, msg)\n\n\ndef assert_is_not(expr1, expr2, msg=None):\n \"\"\"Fake assert_is_not without message\"\"\"\n assert_true(expr1 is not expr2, msg)\n\n\ndef _sparse_block_diag(mats, format=None, dtype=None):\n \"\"\"An implementation of scipy.sparse.block_diag since old versions of\n scipy don't have it. Forms a sparse matrix by stacking matrices in block\n diagonal form.\n\n Parameters\n ----------\n mats : list of matrices\n Input matrices.\n format : str, optional\n The sparse format of the result (e.g. \"csr\"). If not given, the\n matrix is returned in \"coo\" format.\n dtype : dtype specifier, optional\n The data-type of the output matrix. If not given, the dtype is\n determined from that of blocks.\n\n Returns\n -------\n res : sparse matrix\n \"\"\"\n nmat = len(mats)\n rows = []\n for ia, a in enumerate(mats):\n row = [None] * nmat\n row[ia] = a\n rows.append(row)\n return sparse.bmat(rows, format=format, dtype=dtype)\n\ntry:\n from scipy.sparse import block_diag as sparse_block_diag\nexcept Exception:\n sparse_block_diag = _sparse_block_diag\n\n\ndef _isclose(a, b, rtol=1.e-5, atol=1.e-8, equal_nan=False):\n \"\"\"\n Returns a boolean array where two arrays are element-wise equal within a\n tolerance.\n\n The tolerance values are positive, typically very small numbers. The\n relative difference (`rtol` * abs(`b`)) and the absolute difference\n `atol` are added together to compare against the absolute difference\n between `a` and `b`.\n\n Parameters\n ----------\n a, b : array_like\n Input arrays to compare.\n rtol : float\n The relative tolerance parameter (see Notes).\n atol : float\n The absolute tolerance parameter (see Notes).\n equal_nan : bool\n Whether to compare NaN's as equal. If True, NaN's in `a` will be\n considered equal to NaN's in `b` in the output array.\n\n Returns\n -------\n y : array_like\n Returns a boolean array of where `a` and `b` are equal within the\n given tolerance. If both `a` and `b` are scalars, returns a single\n boolean value.\n\n See Also\n --------\n allclose\n\n Notes\n -----\n .. versionadded:: 1.7.0\n\n For finite values, isclose uses the following equation to test whether\n two floating point values are equivalent.\n\n absolute(`a` - `b`) <= (`atol` + `rtol` * absolute(`b`))\n\n The above equation is not symmetric in `a` and `b`, so that\n `isclose(a, b)` might be different from `isclose(b, a)` in\n some rare cases.\n\n Examples\n --------\n >>> isclose([1e10,1e-7], [1.00001e10,1e-8])\n array([ True, False], dtype=bool)\n >>> isclose([1e10,1e-8], [1.00001e10,1e-9])\n array([ True, True], dtype=bool)\n >>> isclose([1e10,1e-8], [1.0001e10,1e-9])\n array([False, True], dtype=bool)\n >>> isclose([1.0, np.nan], [1.0, np.nan])\n array([ True, False], dtype=bool)\n >>> isclose([1.0, np.nan], [1.0, np.nan], equal_nan=True)\n array([ True, True], dtype=bool)\n \"\"\"\n def within_tol(x, y, atol, rtol):\n with np.errstate(invalid='ignore'):\n result = np.less_equal(abs(x - y), atol + rtol * abs(y))\n if np.isscalar(a) and np.isscalar(b):\n result = bool(result)\n return result\n\n x = np.array(a, copy=False, subok=True, ndmin=1)\n y = np.array(b, copy=False, subok=True, ndmin=1)\n\n # Make sure y is an inexact type to avoid bad behavior on abs(MIN_INT).\n # This will cause casting of x later. Also, make sure to allow subclasses\n # (e.g., for numpy.ma).\n dt = np.core.multiarray.result_type(y, 1.)\n y = np.array(y, dtype=dt, copy=False, subok=True)\n\n xfin = np.isfinite(x)\n yfin = np.isfinite(y)\n if all(xfin) and all(yfin):\n return within_tol(x, y, atol, rtol)\n else:\n finite = xfin & yfin\n cond = np.zeros_like(finite, subok=True)\n # Because we're using boolean indexing, x & y must be the same shape.\n # Ideally, we'd just do x, y = broadcast_arrays(x, y). It's in\n # lib.stride_tricks, though, so we can't import it here.\n x = x * np.ones_like(cond)\n y = y * np.ones_like(cond)\n # Avoid subtraction with infinite/nan values...\n cond[finite] = within_tol(x[finite], y[finite], atol, rtol)\n # Check for equality of infinite values...\n cond[~finite] = (x[~finite] == y[~finite])\n if equal_nan:\n # Make NaN == NaN\n both_nan = np.isnan(x) & np.isnan(y)\n cond[both_nan] = both_nan[both_nan]\n return cond\n\n\nif LooseVersion(np.__version__) < LooseVersion('1.7'):\n isclose = _isclose\nelse:\n isclose = np.isclose\n" ]
[ [ "numpy.linspace", "numpy.asarray", "numpy.cumsum", "numpy.concatenate", "numpy.max", "numpy.zeros_like", "numpy.digitize", "numpy.exp", "numpy.where", "matplotlib.pyplot.normalize", "numpy.linalg.svd", "numpy.ones_like", "numpy.core.multiarray.result_type", "numpy.unique", "numpy.arange", "numpy.finfo", "numpy.flatnonzero", "numpy.copy", "numpy.asanyarray", "numpy.diff", "numpy.interp", "numpy.zeros", "numpy.unravel_index", "numpy.fft.irfft", "numpy.isnan", "matplotlib.pyplot.Normalize", "scipy.io.savemat", "numpy.broadcast_arrays", "numpy.errstate", "numpy.array", "numpy.sum", "scipy.linalg.qr", "scipy.signal.filtfilt", "numpy.isfinite", "numpy.abs", "scipy.signal.signaltools.get_window", "numpy.ones", "numpy.sign", "numpy.bincount", "numpy.isscalar", "numpy.empty" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [ "0.13", "0.14", "0.15", "0.12", "0.10" ], "tensorflow": [] } ]
minhhn2910/conga2022
[ "81ad2fb9c0055c332f8f305b2ea409b6577003f4", "81ad2fb9c0055c332f8f305b2ea409b6577003f4" ]
[ "train-cifar10/models/resnet_posit.py", "imagenet/.ipynb_checkpoints/main-checkpoint.py" ]
[ "'''ResNet in PyTorch.\n\nFor Pre-activation ResNet, see 'preact_resnet.py'.\n\nReference:\n[1] Kaiming He, Xiangyu Zhang, Shaoqing Ren, Jian Sun\n Deep Residual Learning for Image Recognition. arXiv:1512.03385\n'''\nimport torch\nimport torch.nn as nn\nimport torch.nn.functional as F\n\n\nclass BasicBlock(nn.Module):\n expansion = 1\n\n def __init__(self, in_planes, planes, quant, stride=1):\n super(BasicBlock, self).__init__()\n self.conv1 = nn.Conv2d(\n in_planes, planes, kernel_size=3, stride=stride, padding=1, bias=False)\n self.bn1 = nn.BatchNorm2d(planes)\n self.conv2 = nn.Conv2d(planes, planes, kernel_size=3,\n stride=1, padding=1, bias=False)\n self.bn2 = nn.BatchNorm2d(planes)\n self.quant=quant()\n self.shortcut = nn.Sequential()\n if stride != 1 or in_planes != self.expansion*planes:\n self.shortcut = nn.Sequential(\n nn.Conv2d(in_planes, self.expansion*planes,\n kernel_size=1, stride=stride, bias=False),\n quant(),\n nn.BatchNorm2d(self.expansion*planes)\n )\n\n def forward(self, x):\n \n out = F.relu(self.bn1(self.conv1(x)))\n out = self.quant(out)\n out = self.bn2(self.conv2(out))\n out = self.quant(out)\n out += self.shortcut(x)\n out = F.relu(out)\n return out\n\n\nclass Bottleneck(nn.Module):\n expansion = 4\n\n def __init__(self, in_planes, planes, stride=1):\n super(Bottleneck, self).__init__()\n self.conv1 = nn.Conv2d(in_planes, planes, kernel_size=1, bias=False)\n self.bn1 = nn.BatchNorm2d(planes)\n self.conv2 = nn.Conv2d(planes, planes, kernel_size=3,\n stride=stride, padding=1, bias=False)\n self.bn2 = nn.BatchNorm2d(planes)\n self.conv3 = nn.Conv2d(planes, self.expansion *\n planes, kernel_size=1, bias=False)\n self.bn3 = nn.BatchNorm2d(self.expansion*planes)\n\n self.shortcut = nn.Sequential()\n if stride != 1 or in_planes != self.expansion*planes:\n self.shortcut = nn.Sequential(\n nn.Conv2d(in_planes, self.expansion*planes,\n kernel_size=1, stride=stride, bias=False),\n nn.BatchNorm2d(self.expansion*planes)\n )\n\n def forward(self, x):\n out = F.relu(self.bn1(self.conv1(x)))\n out = F.relu(self.bn2(self.conv2(out)))\n out = self.bn3(self.conv3(out))\n out += self.shortcut(x)\n out = F.relu(out)\n return out\n\n\nclass ResNet(nn.Module):\n def __init__(self, block, num_blocks, quant, num_classes=10):\n super(ResNet, self).__init__()\n self.in_planes = 64\n self.quant = quant()\n self.conv1 = nn.Conv2d(3, 64, kernel_size=3,\n stride=1, padding=1, bias=False)\n self.bn1 = nn.BatchNorm2d(64)\n self.layer1 = self._make_layer(block, 64, quant, num_blocks[0], stride=1)\n self.layer2 = self._make_layer(block, 128, quant, num_blocks[1], stride=2)\n self.layer3 = self._make_layer(block, 256, quant, num_blocks[2], stride=2)\n self.layer4 = self._make_layer(block, 512, quant, num_blocks[3], stride=2)\n self.linear = nn.Linear(512*block.expansion, num_classes)\n\n def _make_layer(self, block, planes, quant, num_blocks, stride):\n strides = [stride] + [1]*(num_blocks-1)\n layers = []\n for stride in strides:\n layers.append(block(self.in_planes, planes, quant, stride))\n self.in_planes = planes * block.expansion\n return nn.Sequential(*layers)\n\n def forward(self, x):\n out = F.relu(self.bn1(self.conv1(x)))\n out = self.quant(out)\n out = self.layer1(out)\n out = self.quant(out)\n out = self.layer2(out)\n out = self.quant(out)\n out = self.layer3(out)\n out = self.quant(out)\n out = self.layer4(out)\n out = self.quant(out)\n out = F.avg_pool2d(out, 4)\n out = out.view(out.size(0), -1)\n \n out = self.linear(out)\n return out\n\n\ndef ResNet18Posit(quant):\n return ResNet(BasicBlock, [2, 2, 2, 2], quant)\n\n\n\n# def ResNet34():\n# return ResNet(BasicBlock, [3, 4, 6, 3])\n\n\n# def ResNet50():\n# return ResNet(Bottleneck, [3, 4, 6, 3])\n\n\n# def ResNet101():\n# return ResNet(Bottleneck, [3, 4, 23, 3])\n\n\n# def ResNet152():\n# return ResNet(Bottleneck, [3, 8, 36, 3])\n\n\ndef test():\n net = ResNet18()\n y = net(torch.randn(1, 3, 32, 32))\n print(y.size())\n\n# test()\n", "import argparse\nimport os\nimport random\nimport shutil\nimport time\nimport warnings\nfrom enum import Enum\n\nimport torch\nimport torch.nn as nn\nimport torch.nn.parallel\nimport torch.backends.cudnn as cudnn\nimport torch.distributed as dist\nimport torch.optim\nimport torch.multiprocessing as mp\nimport torch.utils.data\nimport torch.utils.data.distributed\nimport torchvision.transforms as transforms\nimport torchvision.datasets as datasets\nimport torchvision.models as models\n\nmodel_names = sorted(name for name in models.__dict__\n if name.islower() and not name.startswith(\"__\")\n and callable(models.__dict__[name]))\n\nparser = argparse.ArgumentParser(description='PyTorch ImageNet Training')\nparser.add_argument('data', metavar='DIR',\n help='path to dataset')\nparser.add_argument('-a', '--arch', metavar='ARCH', default='resnet18',\n choices=model_names,\n help='model architecture: ' +\n ' | '.join(model_names) +\n ' (default: resnet18)')\nparser.add_argument('-j', '--workers', default=4, type=int, metavar='N',\n help='number of data loading workers (default: 4)')\nparser.add_argument('--epochs', default=90, type=int, metavar='N',\n help='number of total epochs to run')\nparser.add_argument('--start-epoch', default=0, type=int, metavar='N',\n help='manual epoch number (useful on restarts)')\nparser.add_argument('-b', '--batch-size', default=256, type=int,\n metavar='N',\n help='mini-batch size (default: 256), this is the total '\n 'batch size of all GPUs on the current node when '\n 'using Data Parallel or Distributed Data Parallel')\nparser.add_argument('--lr', '--learning-rate', default=0.1, type=float,\n metavar='LR', help='initial learning rate', dest='lr')\nparser.add_argument('--momentum', default=0.9, type=float, metavar='M',\n help='momentum')\nparser.add_argument('--wd', '--weight-decay', default=1e-4, type=float,\n metavar='W', help='weight decay (default: 1e-4)',\n dest='weight_decay')\nparser.add_argument('-p', '--print-freq', default=10, type=int,\n metavar='N', help='print frequency (default: 10)')\nparser.add_argument('--resume', default='', type=str, metavar='PATH',\n help='path to latest checkpoint (default: none)')\nparser.add_argument('-e', '--evaluate', dest='evaluate', action='store_true',\n help='evaluate model on validation set')\nparser.add_argument('--pretrained', dest='pretrained', action='store_true',\n help='use pre-trained model')\nparser.add_argument('--world-size', default=-1, type=int,\n help='number of nodes for distributed training')\nparser.add_argument('--rank', default=-1, type=int,\n help='node rank for distributed training')\nparser.add_argument('--dist-url', default='tcp://224.66.41.62:23456', type=str,\n help='url used to set up distributed training')\nparser.add_argument('--dist-backend', default='nccl', type=str,\n help='distributed backend')\nparser.add_argument('--seed', default=None, type=int,\n help='seed for initializing training. ')\nparser.add_argument('--gpu', default=None, type=int,\n help='GPU id to use.')\nparser.add_argument('--multiprocessing-distributed', action='store_true',\n help='Use multi-processing distributed training to launch '\n 'N processes per node, which has N GPUs. This is the '\n 'fastest way to use PyTorch for either single node or '\n 'multi node data parallel training')\n\nbest_acc1 = 0\n\n\ndef main():\n args = parser.parse_args()\n\n if args.seed is not None:\n random.seed(args.seed)\n torch.manual_seed(args.seed)\n cudnn.deterministic = True\n warnings.warn('You have chosen to seed training. '\n 'This will turn on the CUDNN deterministic setting, '\n 'which can slow down your training considerably! '\n 'You may see unexpected behavior when restarting '\n 'from checkpoints.')\n\n if args.gpu is not None:\n warnings.warn('You have chosen a specific GPU. This will completely '\n 'disable data parallelism.')\n\n if args.dist_url == \"env://\" and args.world_size == -1:\n args.world_size = int(os.environ[\"WORLD_SIZE\"])\n\n args.distributed = args.world_size > 1 or args.multiprocessing_distributed\n\n ngpus_per_node = torch.cuda.device_count()\n if args.multiprocessing_distributed:\n # Since we have ngpus_per_node processes per node, the total world_size\n # needs to be adjusted accordingly\n args.world_size = ngpus_per_node * args.world_size\n # Use torch.multiprocessing.spawn to launch distributed processes: the\n # main_worker process function\n mp.spawn(main_worker, nprocs=ngpus_per_node, args=(ngpus_per_node, args))\n else:\n # Simply call main_worker function\n main_worker(args.gpu, ngpus_per_node, args)\n\n\ndef main_worker(gpu, ngpus_per_node, args):\n global best_acc1\n args.gpu = gpu\n\n if args.gpu is not None:\n print(\"Use GPU: {} for training\".format(args.gpu))\n\n if args.distributed:\n if args.dist_url == \"env://\" and args.rank == -1:\n args.rank = int(os.environ[\"RANK\"])\n if args.multiprocessing_distributed:\n # For multiprocessing distributed training, rank needs to be the\n # global rank among all the processes\n args.rank = args.rank * ngpus_per_node + gpu\n dist.init_process_group(backend=args.dist_backend, init_method=args.dist_url,\n world_size=args.world_size, rank=args.rank)\n # create model\n if args.pretrained:\n print(\"=> using pre-trained model '{}'\".format(args.arch))\n model = models.__dict__[args.arch](pretrained=True)\n else:\n print(\"=> creating model '{}'\".format(args.arch))\n model = models.__dict__[args.arch]()\n\n if not torch.cuda.is_available():\n print('using CPU, this will be slow')\n elif args.distributed:\n # For multiprocessing distributed, DistributedDataParallel constructor\n # should always set the single device scope, otherwise,\n # DistributedDataParallel will use all available devices.\n if args.gpu is not None:\n torch.cuda.set_device(args.gpu)\n model.cuda(args.gpu)\n # When using a single GPU per process and per\n # DistributedDataParallel, we need to divide the batch size\n # ourselves based on the total number of GPUs we have\n args.batch_size = int(args.batch_size / ngpus_per_node)\n args.workers = int((args.workers + ngpus_per_node - 1) / ngpus_per_node)\n model = torch.nn.parallel.DistributedDataParallel(model, device_ids=[args.gpu])\n else:\n model.cuda()\n # DistributedDataParallel will divide and allocate batch_size to all\n # available GPUs if device_ids are not set\n model = torch.nn.parallel.DistributedDataParallel(model)\n elif args.gpu is not None:\n torch.cuda.set_device(args.gpu)\n model = model.cuda(args.gpu)\n else:\n # DataParallel will divide and allocate batch_size to all available GPUs\n if args.arch.startswith('alexnet') or args.arch.startswith('vgg'):\n model.features = torch.nn.DataParallel(model.features)\n model.cuda()\n else:\n model = torch.nn.DataParallel(model).cuda()\n\n # define loss function (criterion) and optimizer\n criterion = nn.CrossEntropyLoss().cuda(args.gpu)\n\n optimizer = torch.optim.SGD(model.parameters(), args.lr,\n momentum=args.momentum,\n weight_decay=args.weight_decay)\n\n # optionally resume from a checkpoint\n if args.resume:\n if os.path.isfile(args.resume):\n print(\"=> loading checkpoint '{}'\".format(args.resume))\n if args.gpu is None:\n checkpoint = torch.load(args.resume)\n else:\n # Map model to be loaded to specified single gpu.\n loc = 'cuda:{}'.format(args.gpu)\n checkpoint = torch.load(args.resume, map_location=loc)\n args.start_epoch = checkpoint['epoch']\n best_acc1 = checkpoint['best_acc1']\n if args.gpu is not None:\n # best_acc1 may be from a checkpoint from a different GPU\n best_acc1 = best_acc1.to(args.gpu)\n model.load_state_dict(checkpoint['state_dict'])\n optimizer.load_state_dict(checkpoint['optimizer'])\n print(\"=> loaded checkpoint '{}' (epoch {})\"\n .format(args.resume, checkpoint['epoch']))\n else:\n print(\"=> no checkpoint found at '{}'\".format(args.resume))\n\n cudnn.benchmark = True\n\n # Data loading code\n# traindir = os.path.join(args.data, 'train')\n valdir = os.path.join(args.data, 'val')\n normalize = transforms.Normalize(mean=[0.485, 0.456, 0.406],\n std=[0.229, 0.224, 0.225])\n\n# train_dataset = datasets.ImageFolder(\n# traindir,\n# transforms.Compose([\n# transforms.RandomResizedCrop(224),\n# transforms.RandomHorizontalFlip(),\n# transforms.ToTensor(),\n# normalize,\n# ]))\n\n if args.distributed:\n train_sampler = torch.utils.data.distributed.DistributedSampler(train_dataset)\n else:\n train_sampler = None\n\n# train_loader = torch.utils.data.DataLoader(\n# train_dataset, batch_size=args.batch_size, shuffle=(train_sampler is None),\n# num_workers=args.workers, pin_memory=True, sampler=train_sampler)\n\n val_loader = torch.utils.data.DataLoader(\n datasets.ImageFolder(valdir, transforms.Compose([\n transforms.Resize(256),\n transforms.CenterCrop(224),\n transforms.ToTensor(),\n normalize,\n ])),\n batch_size=args.batch_size, shuffle=False,\n num_workers=args.workers, pin_memory=True)\n\n if args.evaluate:\n validate(val_loader, model, criterion, args)\n return\n\n for epoch in range(args.start_epoch, args.epochs):\n if args.distributed:\n train_sampler.set_epoch(epoch)\n adjust_learning_rate(optimizer, epoch, args)\n\n # train for one epoch\n train(train_loader, model, criterion, optimizer, epoch, args)\n\n # evaluate on validation set\n acc1 = validate(val_loader, model, criterion, args)\n\n # remember best acc@1 and save checkpoint\n is_best = acc1 > best_acc1\n best_acc1 = max(acc1, best_acc1)\n\n if not args.multiprocessing_distributed or (args.multiprocessing_distributed\n and args.rank % ngpus_per_node == 0):\n save_checkpoint({\n 'epoch': epoch + 1,\n 'arch': args.arch,\n 'state_dict': model.state_dict(),\n 'best_acc1': best_acc1,\n 'optimizer' : optimizer.state_dict(),\n }, is_best)\n\n\ndef train(train_loader, model, criterion, optimizer, epoch, args):\n batch_time = AverageMeter('Time', ':6.3f')\n data_time = AverageMeter('Data', ':6.3f')\n losses = AverageMeter('Loss', ':.4e')\n top1 = AverageMeter('Acc@1', ':6.2f')\n top5 = AverageMeter('Acc@5', ':6.2f')\n progress = ProgressMeter(\n len(train_loader),\n [batch_time, data_time, losses, top1, top5],\n prefix=\"Epoch: [{}]\".format(epoch))\n\n # switch to train mode\n model.train()\n\n end = time.time()\n for i, (images, target) in enumerate(train_loader):\n # measure data loading time\n data_time.update(time.time() - end)\n\n if args.gpu is not None:\n images = images.cuda(args.gpu, non_blocking=True)\n if torch.cuda.is_available():\n target = target.cuda(args.gpu, non_blocking=True)\n\n # compute output\n output = model(images)\n loss = criterion(output, target)\n\n # measure accuracy and record loss\n acc1, acc5 = accuracy(output, target, topk=(1, 5))\n losses.update(loss.item(), images.size(0))\n top1.update(acc1[0], images.size(0))\n top5.update(acc5[0], images.size(0))\n\n # compute gradient and do SGD step\n optimizer.zero_grad()\n loss.backward()\n optimizer.step()\n\n # measure elapsed time\n batch_time.update(time.time() - end)\n end = time.time()\n\n if i % args.print_freq == 0:\n progress.display(i)\n\n\ndef validate(val_loader, model, criterion, args):\n batch_time = AverageMeter('Time', ':6.3f', Summary.NONE)\n losses = AverageMeter('Loss', ':.4e', Summary.NONE)\n top1 = AverageMeter('Acc@1', ':6.2f', Summary.AVERAGE)\n top5 = AverageMeter('Acc@5', ':6.2f', Summary.AVERAGE)\n progress = ProgressMeter(\n len(val_loader),\n [batch_time, losses, top1, top5],\n prefix='Test: ')\n\n # switch to evaluate mode\n model.eval()\n\n with torch.no_grad():\n end = time.time()\n for i, (images, target) in enumerate(val_loader):\n if args.gpu is not None:\n images = images.cuda(args.gpu, non_blocking=True)\n if torch.cuda.is_available():\n target = target.cuda(args.gpu, non_blocking=True)\n\n # compute output\n output = model(images)\n loss = criterion(output, target)\n\n # measure accuracy and record loss\n acc1, acc5 = accuracy(output, target, topk=(1, 5))\n losses.update(loss.item(), images.size(0))\n top1.update(acc1[0], images.size(0))\n top5.update(acc5[0], images.size(0))\n\n # measure elapsed time\n batch_time.update(time.time() - end)\n end = time.time()\n\n if i % args.print_freq == 0:\n progress.display(i)\n\n progress.display_summary()\n\n return top1.avg\n\n\ndef save_checkpoint(state, is_best, filename='checkpoint.pth.tar'):\n torch.save(state, filename)\n if is_best:\n shutil.copyfile(filename, 'model_best.pth.tar')\n\nclass Summary(Enum):\n NONE = 0\n AVERAGE = 1\n SUM = 2\n COUNT = 3\n\nclass AverageMeter(object):\n \"\"\"Computes and stores the average and current value\"\"\"\n def __init__(self, name, fmt=':f', summary_type=Summary.AVERAGE):\n self.name = name\n self.fmt = fmt\n self.summary_type = summary_type\n self.reset()\n\n def reset(self):\n self.val = 0\n self.avg = 0\n self.sum = 0\n self.count = 0\n\n def update(self, val, n=1):\n self.val = val\n self.sum += val * n\n self.count += n\n self.avg = self.sum / self.count\n\n def __str__(self):\n fmtstr = '{name} {val' + self.fmt + '} ({avg' + self.fmt + '})'\n return fmtstr.format(**self.__dict__)\n \n def summary(self):\n fmtstr = ''\n if self.summary_type is Summary.NONE:\n fmtstr = ''\n elif self.summary_type is Summary.AVERAGE:\n fmtstr = '{name} {avg:.3f}'\n elif self.summary_type is Summary.SUM:\n fmtstr = '{name} {sum:.3f}'\n elif self.summary_type is Summary.COUNT:\n fmtstr = '{name} {count:.3f}'\n else:\n raise ValueError('invalid summary type %r' % self.summary_type)\n \n return fmtstr.format(**self.__dict__)\n\n\nclass ProgressMeter(object):\n def __init__(self, num_batches, meters, prefix=\"\"):\n self.batch_fmtstr = self._get_batch_fmtstr(num_batches)\n self.meters = meters\n self.prefix = prefix\n\n def display(self, batch):\n entries = [self.prefix + self.batch_fmtstr.format(batch)]\n entries += [str(meter) for meter in self.meters]\n print('\\t'.join(entries))\n \n def display_summary(self):\n entries = [\" *\"]\n entries += [meter.summary() for meter in self.meters]\n print(' '.join(entries))\n\n def _get_batch_fmtstr(self, num_batches):\n num_digits = len(str(num_batches // 1))\n fmt = '{:' + str(num_digits) + 'd}'\n return '[' + fmt + '/' + fmt.format(num_batches) + ']'\n\n\ndef adjust_learning_rate(optimizer, epoch, args):\n \"\"\"Sets the learning rate to the initial LR decayed by 10 every 30 epochs\"\"\"\n lr = args.lr * (0.1 ** (epoch // 30))\n for param_group in optimizer.param_groups:\n param_group['lr'] = lr\n\n\ndef accuracy(output, target, topk=(1,)):\n \"\"\"Computes the accuracy over the k top predictions for the specified values of k\"\"\"\n with torch.no_grad():\n maxk = max(topk)\n batch_size = target.size(0)\n\n _, pred = output.topk(maxk, 1, True, True)\n pred = pred.t()\n correct = pred.eq(target.view(1, -1).expand_as(pred))\n\n res = []\n for k in topk:\n correct_k = correct[:k].reshape(-1).float().sum(0, keepdim=True)\n res.append(correct_k.mul_(100.0 / batch_size))\n return res\n\n\nif __name__ == '__main__':\n main()\n" ]
[ [ "torch.nn.Sequential", "torch.randn", "torch.nn.functional.avg_pool2d", "torch.nn.Conv2d", "torch.nn.Linear", "torch.nn.functional.relu", "torch.nn.BatchNorm2d" ], [ "torch.nn.CrossEntropyLoss", "torch.distributed.init_process_group", "torch.multiprocessing.spawn", "torch.utils.data.distributed.DistributedSampler", "torch.cuda.set_device", "torch.manual_seed", "torch.load", "torch.nn.DataParallel", "torch.no_grad", "torch.cuda.is_available", "torch.cuda.device_count", "torch.nn.parallel.DistributedDataParallel", "torch.save" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
laiguokun/fairseq
[ "6c01c91aac81eb2e3173add4463dfa45c404ffa5", "6c01c91aac81eb2e3173add4463dfa45c404ffa5" ]
[ "models/protected_multihead_attention.py", "get_hidden.py" ]
[ "# Copyright (c) 2017-present, Facebook, Inc.\n# All rights reserved.\n#\n# This source code is licensed under the license found in the LICENSE file in\n# the root directory of this source tree. An additional grant of patent rights\n# can be found in the PATENTS file in the same directory.\n\nimport math\n\nimport torch\nfrom torch import nn\nfrom torch.nn import Parameter\nimport torch.nn.functional as F\n\nfrom fairseq import utils\nfrom fairseq.modules.learned_positional_embedding import LearnedPositionalEmbedding\n\n# Adapted from faiserq/modules/multihead_attention to deal with local attention\n# Local attetion masking in combination with padding masking can lead to\n# all -Inf attention rows. This version detects and corrects this situation\nclass ProtectedMultiheadAttention(nn.Module):\n \"\"\"Multi-headed attention.\n\n See \"Attention Is All You Need\" for more details.\n \"\"\"\n\n def __init__(self, embed_dim, num_heads, dropout=0., bias=True, add_bias_kv=False, add_zero_attn=False):\n super().__init__()\n self.embed_dim = embed_dim\n self.num_heads = num_heads\n self.dropout = dropout\n self.head_dim = embed_dim // num_heads\n assert self.head_dim * num_heads == self.embed_dim, \"embed_dim must be divisible by num_heads\"\n self.scaling = self.head_dim ** -0.5\n\n self.in_proj_weight = Parameter(torch.Tensor(3 * embed_dim, embed_dim))\n if bias:\n self.in_proj_bias = Parameter(torch.Tensor(3 * embed_dim))\n else:\n self.register_parameter('in_proj_bias', None)\n self.out_proj = nn.Linear(embed_dim, embed_dim, bias=bias)\n\n if add_bias_kv:\n self.bias_k = Parameter(torch.Tensor(1, 1, embed_dim))\n self.bias_v = Parameter(torch.Tensor(1, 1, embed_dim))\n else:\n self.bias_k = self.bias_v = None\n\n self.add_zero_attn = add_zero_attn\n\n self.reset_parameters()\n\n self.onnx_trace = False\n\n def prepare_for_onnx_export_(self):\n self.onnx_trace = True\n\n def reset_parameters(self):\n nn.init.xavier_uniform_(self.in_proj_weight)\n nn.init.xavier_uniform_(self.out_proj.weight)\n if self.in_proj_bias is not None:\n nn.init.constant_(self.in_proj_bias, 0.)\n nn.init.constant_(self.out_proj.bias, 0.)\n if self.bias_k is not None:\n nn.init.xavier_normal_(self.bias_k)\n if self.bias_v is not None:\n nn.init.xavier_normal_(self.bias_v)\n\n def forward(self, query, key, value, key_padding_mask=None, incremental_state=None,\n need_weights=True, static_kv=False, attn_mask=None):\n \"\"\"Input shape: Time x Batch x Channel\n\n Self-attention can be implemented by passing in the same arguments for\n query, key and value. Timesteps can be masked by supplying a T x T mask in the\n `attn_mask` argument. Padding elements can be excluded from\n the key by passing a binary ByteTensor (`key_padding_mask`) with shape:\n batch x src_len, where padding elements are indicated by 1s.\n \"\"\"\n\n qkv_same = query.data_ptr() == key.data_ptr() == value.data_ptr()\n kv_same = key.data_ptr() == value.data_ptr()\n\n tgt_len, bsz, embed_dim = query.size()\n assert embed_dim == self.embed_dim\n assert list(query.size()) == [tgt_len, bsz, embed_dim]\n assert key.size() == value.size()\n\n if incremental_state is not None:\n saved_state = self._get_input_buffer(incremental_state)\n if 'prev_key' in saved_state:\n # previous time steps are cached - no need to recompute\n # key and value if they are static\n if static_kv:\n assert kv_same and not qkv_same\n key = value = None\n else:\n saved_state = None\n\n if qkv_same:\n # self-attention\n q, k, v = self.in_proj_qkv(query)\n elif kv_same:\n # encoder-decoder attention\n q = self.in_proj_q(query)\n if key is None:\n assert value is None\n k = v = None\n else:\n k, v = self.in_proj_kv(key)\n else:\n q = self.in_proj_q(query)\n k = self.in_proj_k(key)\n v = self.in_proj_v(value)\n\n q *= self.scaling\n\n if self.bias_k is not None:\n assert self.bias_v is not None\n k = torch.cat([k, self.bias_k.repeat(1, bsz, 1)])\n v = torch.cat([v, self.bias_v.repeat(1, bsz, 1)])\n if attn_mask is not None:\n attn_mask = torch.cat([attn_mask, attn_mask.new_zeros(attn_mask.size(0), 1)], dim=1)\n if key_padding_mask is not None:\n key_padding_mask = torch.cat(\n [key_padding_mask, key_padding_mask.new_zeros(key_padding_mask.size(0), 1)], dim=1)\n\n q = q.contiguous().view(tgt_len, bsz * self.num_heads, self.head_dim).transpose(0, 1)\n if k is not None:\n k = k.contiguous().view(-1, bsz * self.num_heads, self.head_dim).transpose(0, 1)\n if v is not None:\n v = v.contiguous().view(-1, bsz * self.num_heads, self.head_dim).transpose(0, 1)\n\n if saved_state is not None:\n # saved states are stored with shape (bsz, num_heads, seq_len, head_dim)\n if 'prev_key' in saved_state:\n prev_key = saved_state['prev_key'].view(bsz * self.num_heads, -1, self.head_dim)\n if static_kv:\n k = prev_key\n else:\n k = torch.cat((prev_key, k), dim=1)\n if 'prev_value' in saved_state:\n prev_value = saved_state['prev_value'].view(bsz * self.num_heads, -1, self.head_dim)\n if static_kv:\n v = prev_value\n else:\n v = torch.cat((prev_value, v), dim=1)\n saved_state['prev_key'] = k.view(bsz, self.num_heads, -1, self.head_dim)\n saved_state['prev_value'] = v.view(bsz, self.num_heads, -1, self.head_dim)\n\n self._set_input_buffer(incremental_state, saved_state)\n\n src_len = k.size(1)\n\n if key_padding_mask is not None:\n assert key_padding_mask.size(0) == bsz\n assert key_padding_mask.size(1) == src_len\n\n if self.add_zero_attn:\n src_len += 1\n k = torch.cat([k, k.new_zeros((k.size(0), 1) + k.size()[2:])], dim=1)\n v = torch.cat([v, v.new_zeros((v.size(0), 1) + v.size()[2:])], dim=1)\n if attn_mask is not None:\n attn_mask = torch.cat([attn_mask, attn_mask.new_zeros(attn_mask.size(0), 1)], dim=1)\n if key_padding_mask is not None:\n key_padding_mask = torch.cat(\n [key_padding_mask, torch.zeros(key_padding_mask.size(0), 1).type_as(key_padding_mask)], dim=1)\n\n attn_weights = torch.bmm(q, k.transpose(1, 2))\n assert list(attn_weights.size()) == [bsz * self.num_heads, tgt_len, src_len]\n\n if attn_mask is not None:\n attn_mask = attn_mask.unsqueeze(0)\n if self.onnx_trace:\n attn_mask = attn_mask.repeat(attn_weights.size(0), 1, 1)\n attn_weights += attn_mask\n\n if key_padding_mask is not None:\n # don't attend to padding symbols\n attn_weights = attn_weights.view(bsz, self.num_heads, tgt_len, src_len)\n if self.onnx_trace:\n attn_weights = torch.where(\n key_padding_mask.unsqueeze(1).unsqueeze(2),\n torch.Tensor([float(\"-Inf\")]),\n attn_weights.float()\n ).type_as(attn_weights)\n else:\n attn_weights = attn_weights.float().masked_fill(\n key_padding_mask.unsqueeze(1).unsqueeze(2),\n float('-inf'),\n ).type_as(attn_weights) # FP16 support: cast to float and back\n attn_weights = attn_weights.view(bsz * self.num_heads, tgt_len, src_len)\n all_inf = torch.isinf(attn_weights).all(dim=-1)\n if all_inf.any():\n attn_weights = attn_weights.float().masked_fill(\n all_inf.unsqueeze(-1),\n 0,\n ).type_as(attn_weights) # FP16 support: cast to float and back\n\n\n attn_weights = F.softmax(attn_weights.float(), dim=-1).type_as(attn_weights)\n attn_weights = F.dropout(attn_weights, p=self.dropout, training=self.training)\n\n attn = torch.bmm(attn_weights, v)\n assert list(attn.size()) == [bsz * self.num_heads, tgt_len, self.head_dim]\n if (self.onnx_trace and attn.size(1) == 1):\n # when ONNX tracing a single decoder step (sequence length == 1)\n # the transpose is a no-op copy before view, thus unnecessary\n attn = attn.contiguous().view(tgt_len, bsz, embed_dim)\n else:\n attn = attn.transpose(0, 1).contiguous().view(tgt_len, bsz, embed_dim)\n attn = self.out_proj(attn)\n if need_weights:\n # average attention weights over heads\n attn_weights = attn_weights.view(bsz, self.num_heads, tgt_len, src_len)\n attn_weights = attn_weights.sum(dim=1) / self.num_heads\n else:\n attn_weights = None\n\n return attn, attn_weights\n\n def in_proj_qkv(self, query):\n return self._in_proj(query).chunk(3, dim=-1)\n\n def in_proj_kv(self, key):\n return self._in_proj(key, start=self.embed_dim).chunk(2, dim=-1)\n\n def in_proj_q(self, query):\n return self._in_proj(query, end=self.embed_dim)\n\n def in_proj_k(self, key):\n return self._in_proj(key, start=self.embed_dim, end=2 * self.embed_dim)\n\n def in_proj_v(self, value):\n return self._in_proj(value, start=2 * self.embed_dim)\n\n def _in_proj(self, input, start=0, end=None):\n weight = self.in_proj_weight\n bias = self.in_proj_bias\n weight = weight[start:end, :]\n if bias is not None:\n bias = bias[start:end]\n return F.linear(input, weight, bias)\n\n def reorder_incremental_state(self, incremental_state, new_order):\n \"\"\"Reorder buffered internal state (for incremental generation).\"\"\"\n input_buffer = self._get_input_buffer(incremental_state)\n if input_buffer is not None:\n for k in input_buffer.keys():\n input_buffer[k] = input_buffer[k].index_select(0, new_order)\n self._set_input_buffer(incremental_state, input_buffer)\n\n def _get_input_buffer(self, incremental_state):\n return utils.get_incremental_state(\n self,\n incremental_state,\n 'attn_state',\n ) or {}\n\n def _set_input_buffer(self, incremental_state, buffer):\n utils.set_incremental_state(\n self,\n incremental_state,\n 'attn_state',\n buffer,\n )\n\ndef ProtectedPositionalEmbedding(\n num_embeddings: int,\n embedding_dim: int,\n padding_idx: int,\n learned: bool = False,\n):\n if learned:\n # if padding_idx is specified then offset the embedding ids by\n # this index and adjust num_embeddings appropriately\n # TODO: The right place for this offset would be inside\n # LearnedPositionalEmbedding. Move this there for a cleaner implementation.\n if padding_idx is not None:\n num_embeddings = num_embeddings + padding_idx + 1\n m = LearnedPositionalEmbedding(num_embeddings, embedding_dim, padding_idx)\n nn.init.normal_(m.weight, mean=0, std=embedding_dim ** -0.5)\n if padding_idx is not None:\n nn.init.constant_(m.weight[padding_idx], 0)\n else:\n m = SinusoidalPositionalEmbedding(\n embedding_dim, padding_idx, init_size=num_embeddings + padding_idx + 1,\n )\n return m\n\n\n# class SinusoidalPositionalEmbedding(nn.Module):\n# \"\"\"This module produces sinusoidal positional embeddings of any length.\n#\n# Padding symbols are ignored.\n# \"\"\"\n#\n# def __init__(self, embedding_dim, padding_idx, init_size=1024):\n# super().__init__()\n# self.embedding_dim = embedding_dim\n# self.padding_idx = padding_idx\n# self.weights = SinusoidalPositionalEmbedding.get_embedding(\n# init_size,\n# embedding_dim,\n# )\n# self.onnx_trace = False\n# self.register_buffer('_float_tensor', torch.FloatTensor(1))\n#\n# def prepare_for_onnx_export_(self):\n# self.onnx_trace = True\n#\n# @staticmethod\n# def get_embedding(num_embeddings, embedding_dim):\n# \"\"\"Build sinusoidal embeddings.\n#\n# This matches the implementation in tensor2tensor, but differs slightly\n# from the description in Section 3.5 of \"Attention Is All You Need\".\n# \"\"\"\n# assert embedding_dim % 2 == 0\n# pos_seq = torch.arange(0, num_embeddings, 1.0, dtype=torch.float)\n# freq_seq = torch.arange(0, embedding_dim, 2.0, dtype=torch.float)\n# inv_freq = 1. / (10000 ** (freq_seq / embedding_dim))\n# sinusoidal_inp = torch.einsum(\"i, d-> id\", pos_seq, inv_freq)\n# emb = torch.cat([torch.sin(sinusoidal_inp), torch.cos(sinusoidal_inp)], -1)\n# return emb\n#\n# def forward(self, input_, incremental_state=None, timestep=None, **kwargs):\n# \"\"\"Input is expected to be of size [bsz x seqlen].\"\"\"\n# bsz, seq_len = torch.onnx.operators.shape_as_tensor(input_)\n# if (seq_len > self.weights.size(0)):\n# self.weights = SinusoidalPositionalEmbedding.get_embedding(\n# seq_len,\n# embedding_dim,\n# )\n# self.weights = self.weights.to(self._float_tensor)\n# if incremental_state is not None:\n# # positions is the same for every token when decoding a single step\n# pos = timestep.view(-1)[0] + 1 if timestep is not None else seq_len\n# if self.onnx_trace:\n# return self.weights.index_select(index=pos, dim=0).unsqueeze(1).repeat(bsz, 1, 1)\n# return self.weights[pos, :].expand(bsz, 1, -1)\n#\n# weights = self.weights\n# #get positions\n# mask = input_.ne(self.padding_idx)\n# positions = mask.cumsum(-1) - 1\n# positions = positions * mask.long()\n# positions = positions.view(-1, )\n# weights = torch.index_select(weights, 0, positions)\n# weights = weights.view(bsz, seq_len, -1)\n# weights = weights * mask.unsqueeze(-1).type_as(weights)\n# return weights\n#\n# def max_positions(self):\n# \"\"\"Maximum number of supported positions.\"\"\"\n# return int(1e5) # an arbitrary large number\n\n\nclass SinusoidalPositionalEmbedding(nn.Module):\n \"\"\"This module produces sinusoidal positional embeddings of any length.\n\n Padding symbols are ignored.\n \"\"\"\n\n def __init__(self, embedding_dim, padding_idx, init_size=1024):\n super().__init__()\n self.embedding_dim = embedding_dim\n self.padding_idx = padding_idx\n self.weights = SinusoidalPositionalEmbedding.get_embedding(\n init_size,\n embedding_dim,\n )\n self.onnx_trace = False\n self.register_buffer('_float_tensor', torch.FloatTensor(1))\n\n def prepare_for_onnx_export_(self):\n self.onnx_trace = True\n\n @staticmethod\n def get_embedding(num_embeddings, embedding_dim):\n \"\"\"Build sinusoidal embeddings.\n\n This matches the implementation in tensor2tensor, but differs slightly\n from the description in Section 3.5 of \"Attention Is All You Need\".\n \"\"\"\n half_dim = embedding_dim // 2\n # emb = math.log(10000) / (half_dim - 1)\n emb = math.log(10000) / half_dim\n emb = torch.exp(torch.arange(half_dim, dtype=torch.float) * -emb)\n emb = torch.arange(num_embeddings, dtype=torch.float).unsqueeze(1) * emb.unsqueeze(0)\n emb = torch.cat([torch.sin(emb), torch.cos(emb)], dim=1).view(num_embeddings, -1)\n if embedding_dim % 2 == 1:\n # zero pad\n emb = torch.cat([emb, torch.zeros(num_embeddings, 1)], dim=1)\n return emb\n\n def forward(self, input, incremental_state=None, timestep=None, **kwargs):\n \"\"\"Input is expected to be of size [bsz x seqlen].\"\"\"\n bsz, seq_len = torch.onnx.operators.shape_as_tensor(input)\n max_pos = seq_len\n if self.weights is None or max_pos > self.weights.size(0):\n # recompute/expand embeddings if needed\n self.weights = SinusoidalPositionalEmbedding.get_embedding(\n max_pos,\n self.embedding_dim,\n )\n self.weights = self.weights.to(self._float_tensor)\n\n if incremental_state is not None:\n # positions is the same for every token when decoding a single step\n pos = timestep.view(-1)[0] + 1 if timestep is not None else seq_len\n if self.onnx_trace:\n return self.weights.index_select(index=-1 + pos, dim=0).unsqueeze(1).repeat(bsz, 1, 1)\n return self.weights[-1 + pos, :].expand(bsz, 1, -1)\n\n positions = make_positions(input, self.padding_idx, onnx_trace=self.onnx_trace)\n if self.onnx_trace:\n flat_embeddings = self.weights.detach().index_select(0, positions.view(-1))\n embedding_shape = torch.cat((bsz.view(1), seq_len.view(1), torch.LongTensor([-1])))\n embeddings = torch.onnx.operators.reshape_from_tensor_shape(flat_embeddings, embedding_shape)\n return embeddings\n return self.weights.index_select(0, positions.view(-1)).view(bsz, seq_len, -1).detach()\n\n def max_positions(self):\n \"\"\"Maximum number of supported positions.\"\"\"\n return int(1e5) # an arbitrary large number\n\n\ndef make_positions(tensor, padding_idx, onnx_trace=False):\n \"\"\"Replace non-padding symbols with their position numbers.\n\n Position numbers begin at padding_idx+1. Padding symbols are ignored.\n \"\"\"\n # The series of casts and type-conversions here are carefully\n # balanced to both work with ONNX export and XLA. In particular XLA\n # prefers ints, cumsum defaults to output longs, and ONNX doesn't know\n # how to handle the dtype kwarg in cumsum.\n mask = tensor.ne(padding_idx).int()\n return (\n (torch.cumsum(mask, dim=1) - 1).type_as(mask) * mask\n ).long()\n\n\n", "#!/usr/bin/env python3 -u\n# Copyright (c) Facebook, Inc. and its affiliates.\n#\n# This source code is licensed under the MIT license found in the\n# LICENSE file in the root directory of this source tree.\n\"\"\"\nTrain a new model on one or across multiple GPUs.\n\"\"\"\n\nimport collections\nfrom collections import OrderedDict\nimport math\nimport random\n\nimport numpy as np\nimport torch\nimport tables\n\nfrom fairseq import checkpoint_utils, distributed_utils, options, progress_bar, tasks, utils, models\nfrom fairseq.data import iterators\nfrom fairseq.trainer import Trainer\nfrom fairseq.meters import AverageMeter, StopwatchMeter, TimeMeter\n\nclass validator(object):\n def __init__(self, args, task, model, criterion):\n self.args = args\n self.task = task\n self._dummy_batch = None\n self._criterion = criterion\n self._model = model\n self.cuda = torch.cuda.is_available() and not args.cpu\n if args.fp16:\n self._criterion = self._criterion.half()\n self._model = self._model.half()\n if self.cuda:\n self._criterion = self._criterion.cuda()\n self._model = self._model.cuda()\n\n self._wrapped_criterion = None\n self._wrapped_model = None\n self.init_meters(args)\n \n @property\n def criterion(self):\n if self._wrapped_criterion is None:\n if (\n utils.has_parameters(self._criterion)\n and self.args.distributed_world_size > 1\n ):\n self._wrapped_criterion = models.DistributedFairseqModel(\n self.args, self._criterion\n )\n else:\n self._wrapped_criterion = self._criterion\n return self._wrapped_criterion\n\n @property\n def model(self):\n if self._wrapped_model is None:\n if self.args.distributed_world_size > 1:\n self._wrapped_model = models.DistributedFairseqModel(\n self.args, self._model,\n )\n else:\n self._wrapped_model = self._model\n return self._wrapped_model\n\n def init_meters(self, args):\n self.meters = OrderedDict()\n self.meters['train_loss'] = AverageMeter()\n self.meters['train_nll_loss'] = AverageMeter()\n self.meters['valid_loss'] = AverageMeter()\n self.meters['valid_nll_loss'] = AverageMeter()\n self.meters['wps'] = TimeMeter() # words per second\n self.meters['ups'] = TimeMeter() # updates per second\n self.meters['wpb'] = AverageMeter() # words per batch\n self.meters['bsz'] = AverageMeter() # sentences per batch\n self.meters['gnorm'] = AverageMeter() # gradient norm\n self.meters['clip'] = AverageMeter() # % of updates clipped\n self.meters['oom'] = AverageMeter() # out of memory\n if args.fp16:\n self.meters['loss_scale'] = AverageMeter() # dynamic loss scale\n self.meters['wall'] = TimeMeter() # wall time in seconds\n self.meters['train_wall'] = StopwatchMeter() # train wall time in seconds\n\n def _prepare_sample(self, sample):\n if sample is None or len(sample) == 0:\n return None\n\n if self.cuda:\n sample = utils.move_to_cuda(sample)\n\n def apply_half(t):\n if t.dtype is torch.float32:\n return t.half()\n return t\n\n if self.args.fp16:\n sample = utils.apply_to_sample(apply_half, sample)\n\n return sample\n \n def get_model(self):\n \"\"\"Get the (non-wrapped) model instance.\"\"\"\n return self._model\n\n def get_meter(self, name):\n \"\"\"Get a specific meter by name.\"\"\"\n if name not in self.meters:\n return None\n return self.meters[name]\n\n def get_criterion(self):\n \"\"\"Get the (non-wrapped) criterion instance.\"\"\"\n return self._criterion\n\n def get_num_updates(self):\n \"\"\"Get the number of parameters updates.\"\"\"\n return 0\n\n def valid_step(self, sample, raise_oom=False):\n \"\"\"Do forward pass in evaluation mode.\"\"\"\n if self._dummy_batch is None:\n self._dummy_batch = sample\n with torch.no_grad():\n self.model.eval()\n self.criterion.eval()\n\n sample = self._prepare_sample(sample)\n if sample is None:\n sample = self._prepare_sample(self._dummy_batch)\n ignore_results = True\n else:\n ignore_results = False\n\n try:\n record, sample_size, logging_output = self.task.get_hidden_step(\n sample, self.model, self.criterion\n )\n except RuntimeError as e:\n if 'out of memory' in str(e) and not raise_oom:\n print('| WARNING: ran out of memory, retrying batch')\n for p in self.model.parameters():\n if p.grad is not None:\n p.grad = None # free some memory\n if self.cuda:\n torch.cuda.empty_cache()\n return self.valid_step(sample, raise_oom=True)\n else:\n raise e\n\n if ignore_results:\n logging_output, sample_size = {}, 0\n\n # gather logging outputs from all replicas\n if self.args.distributed_world_size > 1:\n logging_output, sample_size = zip(*distributed_utils.all_gather_list(\n [logging_output, sample_size],\n ))\n logging_output = list(logging_output)\n sample_size = list(sample_size)\n else:\n logging_output = [logging_output]\n sample_size = [sample_size]\n\n # aggregate logging outputs and sample sizes\n logging_output = self.task.aggregate_logging_outputs(\n logging_output, self.get_criterion()\n )\n sample_size = self.task.grad_denom(\n sample_size, self.get_criterion()\n )\n\n # update meters for validation\n ntokens = logging_output.get('ntokens', 0)\n self.meters['valid_loss'].update(logging_output.get('loss', 0), sample_size)\n if 'valid_acc' in self.meters:\n self.meters['valid_acc'].update(\n logging_output.get('acc', 0), sample_size)\n\n if 'nll_loss' in logging_output:\n self.meters['valid_nll_loss'].update(logging_output.get('nll_loss', 0), ntokens)\n\n return record, logging_output\n\ndef main(args, override_args, init_distributed=False):\n utils.import_user_module(args)\n\n assert args.max_tokens is not None or args.max_sentences is not None, \\\n 'Must specify batch size either with --max-tokens or --max-sentences'\n\n # Initialize CUDA and distributed training\n if torch.cuda.is_available() and not args.cpu:\n torch.cuda.set_device(args.device_id)\n np.random.seed(args.seed)\n torch.manual_seed(args.seed)\n if init_distributed:\n args.distributed_rank = distributed_utils.distributed_init(args)\n\n # Print args\n print(args)\n use_fp16 = args.fp16\n use_cuda = torch.cuda.is_available() and not args.cpu\n\n if override_args is not None:\n overrides = vars(override_args)\n overrides.update(eval(getattr(override_args, 'model_overrides', '{}')))\n else:\n overrides = None\n\n # Load ensemble\n print('| loading model(s) from {}'.format(args.path))\n models, model_args, task = checkpoint_utils.load_model_ensemble_and_task(\n [args.path],\n arg_overrides=overrides,\n )\n model = models[0]\n\n # Move models to GPU\n for model in models:\n if use_fp16:\n model.half()\n if use_cuda:\n model.cuda()\n\n # Print args\n print(model_args)\n\n # Build criterion\n criterion = task.build_criterion(model_args)\n criterion.eval()\n\n # Load valid dataset (we load training data below, based on the latest checkpoint)\n for valid_sub_split in args.valid_subset.split(','):\n task.load_dataset(valid_sub_split, combine=False, epoch=0)\n\n # Build trainer\n trainer = validator(args, task, model, criterion)\n print('| training on {} GPUs'.format(args.distributed_world_size))\n print('| max tokens per GPU = {} and max sentences per GPU = {}'.format(\n args.max_tokens,\n args.max_sentences,\n ))\n\n # Load the latest checkpoint if one is available and restore the\n # corresponding train iterator\n\n valid_subsets = args.valid_subset.split(',')\n\n valid_losses = validate(args, trainer, task, valid_subsets)\n\n\ndef open_h5(f, hid_size):\n f = tables.open_file(f, mode='w')\n atom = tables.Float16Atom()\n array = f.create_earray(f.root, 'data', atom, (0, hid_size))\n return f, array\n\ndef validate(args, trainer, task, subsets):\n \"\"\"Evaluate the model on the validation set(s) and return the losses.\"\"\"\n\n if args.fixed_validation_seed is not None:\n # set fixed seed for every validation\n utils.set_torch_seed(args.fixed_validation_seed)\n\n valid_losses = []\n for subset in subsets:\n # Initialize data iterator\n itr = task.get_batch_iterator(\n dataset=task.dataset(subset),\n max_tokens=args.max_tokens_valid,\n max_sentences=args.max_sentences_valid,\n max_positions=utils.resolve_max_positions(\n task.max_positions(),\n trainer.get_model().max_positions(),\n ),\n ignore_invalid_inputs=args.skip_invalid_size_inputs_valid_test,\n required_batch_size_multiple=args.required_batch_size_multiple,\n seed=args.seed,\n num_shards=args.distributed_world_size,\n shard_id=args.distributed_rank,\n num_workers=args.num_workers,\n ).next_epoch_itr(shuffle=False)\n progress = progress_bar.build_progress_bar(\n args, itr,\n prefix='valid on \\'{}\\' subset'.format(subset),\n no_progress_bar='simple'\n )\n\n # reset validation loss meters\n for k in ['valid_loss', 'valid_nll_loss']:\n meter = trainer.get_meter(k)\n if meter is not None:\n meter.reset()\n extra_meters = collections.defaultdict(lambda: AverageMeter())\n cnt = 0\n if args.distributed_world_size > 1:\n fout_hidden = './tmp/hidden_{}.h5'.format(args.distributed_rank)\n fout_target = './tmp/target_{}.h5'.format(args.distributed_rank) \n else:\n fout_hidden = './tmp/hidden.h5'\n fout_target = './tmp/target.h5'\n fout_hidden, hidden_list = open_h5(fout_hidden, 1024)\n fout_target, target_list = open_h5(fout_target, 1)\n for sample in progress:\n record, log_output = trainer.valid_step(sample)\n hidden_list.append(record[0].cpu().numpy().astype('float16'))\n target_list.append(record[1].cpu().numpy().astype('float16'))\n for k, v in log_output.items():\n if k in ['loss', 'nll_loss', 'ntokens', 'nsentences', 'sample_size']:\n continue\n extra_meters[k].update(v)\n cnt += 1\n if (cnt > 10):\n break\n # log validation stats\n fout_hidden.close()\n fout_target.close()\n\n stats = get_valid_stats(trainer, args, extra_meters)\n for k, meter in extra_meters.items():\n stats[k] = meter.avg\n progress.print(stats, tag=subset, step=trainer.get_num_updates())\n\n return valid_losses\n\n\ndef get_valid_stats(trainer, args, extra_meters=None):\n stats = collections.OrderedDict()\n stats['loss'] = trainer.get_meter('valid_loss')\n if trainer.get_meter('valid_nll_loss').count > 0:\n nll_loss = trainer.get_meter('valid_nll_loss')\n stats['nll_loss'] = nll_loss\n else:\n nll_loss = stats['loss']\n stats['ppl'] = utils.get_perplexity(nll_loss.avg)\n stats['num_updates'] = trainer.get_num_updates()\n return stats\n\n\ndef distributed_main(i, args, override_args, start_rank=0):\n args.device_id = i\n if args.distributed_rank is None: # torch.multiprocessing.spawn\n args.distributed_rank = start_rank + i\n main(args, override_args, init_distributed=True)\n\n\ndef cli_main():\n parser = options.get_validation_mul_parser()\n args = options.parse_args_and_arch(parser)\n override_parser = options.get_validation_parser()\n override_args = options.parse_args_and_arch(override_parser, suppress_defaults=True)\n\n if args.distributed_init_method is None:\n distributed_utils.infer_init_method(args)\n\n if args.distributed_init_method is not None:\n # distributed training\n if torch.cuda.device_count() > 1 and not args.distributed_no_spawn:\n start_rank = args.distributed_rank\n args.distributed_rank = None # assign automatically\n torch.multiprocessing.spawn(\n fn=distributed_main,\n args=(args, start_rank),\n nprocs=torch.cuda.device_count(),\n )\n else:\n distributed_main(args.device_id, args)\n elif args.distributed_world_size > 1:\n # fallback for single node with multiple GPUs\n assert args.distributed_world_size <= torch.cuda.device_count()\n port = random.randint(10000, 20000)\n args.distributed_init_method = 'tcp://localhost:{port}'.format(port=port)\n args.distributed_rank = None # set based on device id\n #if max(args.update_freq) > 1 and args.ddp_backend != 'no_c10d':\n # print('| NOTE: you may get better performance with: --ddp-backend=no_c10d')\n torch.multiprocessing.spawn(\n fn=distributed_main,\n args=(args, override_args),\n nprocs=args.distributed_world_size,\n )\n else:\n # single GPU training\n main(args, override_args)\n\n\nif __name__ == '__main__':\n cli_main()\n" ]
[ [ "torch.nn.functional.dropout", "torch.cat", "torch.onnx.operators.shape_as_tensor", "torch.zeros", "torch.sin", "torch.FloatTensor", "torch.bmm", "torch.arange", "torch.nn.functional.linear", "torch.cos", "torch.onnx.operators.reshape_from_tensor_shape", "torch.LongTensor", "torch.isinf", "torch.nn.init.constant_", "torch.nn.init.xavier_normal_", "torch.nn.Linear", "torch.nn.init.normal_", "torch.Tensor", "torch.nn.init.xavier_uniform_", "torch.cumsum" ], [ "torch.cuda.set_device", "numpy.random.seed", "torch.multiprocessing.spawn", "torch.manual_seed", "torch.cuda.empty_cache", "torch.no_grad", "torch.cuda.is_available", "torch.cuda.device_count" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
Tiamat-Tech/npms
[ "2d1bce8c98b0f24aa69273975c52b2fbdb101c29" ]
[ "npms/datasets/sdf_dataset.py" ]
[ "from __future__ import division\nimport sys\nfrom torch.utils.data import Dataset\nimport os\nimport numpy as np\nimport pickle\nimport imp\nimport trimesh\nimport torch\nimport json\nfrom tqdm import tqdm\nfrom timeit import default_timer as timer\n\nfrom utils.gaps_utils import read_pts_file\n\n\nclass SDFDataset(Dataset):\n\n def __init__(\n self, \n data_dir='data', \n labels_json='labels.json',\n batch_size=64, \n num_workers=12, \n sample_info={}, \n cache_data=True,\n **kwargs\n ):\n\n ###################################################################################################\n # SDF\n ###################################################################################################\n sdf_samples_info = sample_info['sdf']\n self.sdf_samples_types = sdf_samples_info['types']\n self.num_points_sdf = sdf_samples_info['num_points']\n percentages = [p for p in self.sdf_samples_types.values()]\n\n assert sum(percentages) > 0.999 and sum(percentages) <= 1.0, sum(percentages)\n \n if self.num_points_sdf > 0:\n self.sdf_samples_types = {k: int(v * self.num_points_sdf) for k, v in self.sdf_samples_types.items()}\n assert sum(self.sdf_samples_types.values()) == self.num_points_sdf\n\n print()\n print(\"num sdf samples\", self.num_points_sdf)\n print()\n \n ###################################################################################################\n # Flow\n ###################################################################################################\n sample_flow_info = sample_info['flow']\n self.num_points_flow = np.array(sample_flow_info['num_points'])\n\n self.num_flow_samples_list = []\n if self.num_points_flow > 0:\n self.sample_flow_dist = np.array(sample_flow_info['dist']) / len(sample_flow_info['dist'])\n self.sample_flow_sigmas = np.array(sample_flow_info['sigmas'])\n \n assert np.sum(self.sample_flow_dist) == 1\n assert np.any(self.sample_flow_dist < 0) == False\n assert len(self.sample_flow_dist) == len(self.sample_flow_sigmas)\n\n self.num_flow_samples_list = np.rint(self.sample_flow_dist * self.num_points_flow).astype(np.uint32)\n assert np.all(self.num_flow_samples_list == self.num_flow_samples_list[0]), f\"num_samples: {self.num_flow_samples_list}\"\n self.num_flow_samples_per_sigma = self.num_flow_samples_list[0]\n\n print()\n print(\"num_samples\", self.num_flow_samples_list)\n print(\"num_samples per sigma\", self.num_flow_samples_per_sigma)\n print()\n\n self.max_samples_per_sigma = 100000\n\n self.num_samples_per_shape = {\n 'sdf': self.num_points_sdf,\n 'flow': self.num_points_flow,\n }\n \n self.data_dir = data_dir\n self.labels_json = labels_json\n self.labels_tpose_json = os.path.join(os.path.dirname(labels_json), \"labels_tpose.json\")\n\n self.cache_data = cache_data\n self.cache = []\n self.cache_tpose = []\n\n # Load labels\n self._load()\n\n self.batch_size = batch_size\n self.num_workers = num_workers\n\n # Preload data\n if self.cache_data:\n print(\"Preloading cached data ...\")\n\n for index in tqdm(range(len(self.labels))):\n data = self.labels[index]\n data_dict = self._load_sample(data, is_tpose=False)\n self.cache.append(data_dict)\n\n # T-Poses\n for index in range(len(self.labels_tpose)):\n data = self.labels_tpose[index]\n data_dict = self._load_sample(data, is_tpose=True)\n self.cache_tpose.append(data_dict)\n\n print(\"Loaded cached data ...\")\n\n def _load(self):\n with open(self.labels_json) as f:\n self.labels = json.loads(f.read())\n\n with open(self.labels_tpose_json) as f:\n self.labels_tpose = json.loads(f.read())\n \n self.num_identities = len(self.labels_tpose)\n\n def __len__(self):\n return len(self.labels)\n\n def get_num_identities(self):\n return self.num_identities\n\n def get_num_samples_per_shape(self):\n return self.num_samples_per_shape\n\n def _load_sample(self, data, is_tpose):\n if 'dataset' in data:\n shape_path = os.path.join(self.data_dir, data['dataset'], data['identity_name'], data['animation_name'], data['sample_id'])\n else:\n shape_path = os.path.join(self.data_dir, data['identity_name'], data['animation_name'], data['sample_id'])\n\n # BOUNDARY\n points_sdf_dict = {}\n\n if is_tpose and self.num_points_sdf > 0:\n for i, sdf_samples_type in enumerate(self.sdf_samples_types):\n ext = 'pts' if sdf_samples_type == \"surface\" else 'sdf' \n sdf_samples_path = shape_path + f'/samples_{sdf_samples_type}.{ext}'\n\n # Load data from disk\n sdf_points = read_pts_file(sdf_samples_path)\n\n if ext == 'pts':\n sdf_points = sdf_points[:, :3]\n \n points_sdf_dict[sdf_samples_type] = sdf_points\n\n # FLOW\n points_flow = None\n\n for i in range(len(self.num_flow_samples_list)):\n # points\n flow_samples_path = shape_path + '/flow_samples_{}.npz'.format(self.sample_flow_sigmas[i])\n flow_samples_npz = np.load(flow_samples_path)\n flow_sample_points = flow_samples_npz['points'][None, ...]\n\n if points_flow is None:\n points_flow = flow_sample_points\n else:\n points_flow = np.concatenate((points_flow, flow_sample_points), axis=0) # factor, 100k, 3\n\n return {\n 'points_sdf_dict': points_sdf_dict,\n 'points_flow': np.array(points_flow, dtype=np.float32), \n 'path': shape_path,\n 'identity_id': data['identity_id']\n }\n\n def _subsample(self, data_dict, subsample_indices_list, is_tpose):\n points_sdf = []\n points_flow = []\n\n # SDF samples\n if is_tpose and self.num_points_sdf > 0:\n points_sdf_dict = data_dict['points_sdf_dict']\n\n points_sdf = prepare_samples(points_sdf_dict, self.sdf_samples_types)\n \n assert points_sdf.shape[0] == self.num_points_sdf, f\"{points_sdf.shape[0]} vs {self.num_points_sdf}\"\n\n # Flow samples\n for i in range(len(self.num_flow_samples_list)): # sample type\n\n flow_sample_points = data_dict['points_flow'][i]\n\n subsample_indices = subsample_indices_list[i]\n\n points_flow.extend(flow_sample_points[subsample_indices])\n\n assert len(points_flow) == self.num_points_flow, f\"{len(points_flow)} vs {self.num_points_flow}\"\n\n return {\n 'points_sdf': np.array(points_sdf, dtype=np.float32),\n 'points_flow': np.array(points_flow, dtype=np.float32),\n 'path': data_dict['path'],\n 'identity_id': data_dict['identity_id']\n }\n\n def _get_identity_id(self, d):\n identity_id = d['identity_id']\n assert identity_id < self.num_identities, f\"Identity {identity_id} is not defined in labels_tpose.json\"\n return identity_id\n\n def __getitem__(self, idx):\n\n if self.cache_data:\n data_dict = self.cache[idx]\n data_ref_dict = self.cache_tpose[self._get_identity_id(data_dict)] \n\n else:\n data = self.labels[idx]\n data_ref = self.labels_tpose[self._get_identity_id(data)]\n\n # Load samples\n data_dict = self._load_sample(data, is_tpose=False)\n data_ref_dict = self._load_sample(data_ref, is_tpose=True)\n \n # Sample random indices for each sample type\n subsample_flow_indices_list = []\n for i, num in enumerate(self.num_flow_samples_list): # sample type\n subsample_indices = np.random.randint(0, self.max_samples_per_sigma, num)\n subsample_flow_indices_list.append(subsample_indices)\n\n # Subsample\n data_ref_dict = self._subsample(data_ref_dict, subsample_flow_indices_list, is_tpose=True)\n data_dict = self._subsample(data_dict, subsample_flow_indices_list, is_tpose=False)\n\n return {\n 'ref': data_ref_dict,\n 'cur': data_dict,\n 'idx': idx,\n 'identity_id': data_dict['identity_id'],\n }\n\n def get_loader(self, shuffle=True):\n\n assert self.batch_size <= len(self), f\"batch size ({self.batch_size}) > len dataset ({len(self)})\" \n\n return torch.utils.data.DataLoader(\n self, \n batch_size=self.batch_size, \n num_workers=self.num_workers, \n shuffle=shuffle,\n worker_init_fn=self.worker_init_fn,\n pin_memory=True,\n drop_last=True\n )\n\n def get_batch_size(self):\n return self.batch_size\n\n def worker_init_fn(self, worker_id):\n random_data = os.urandom(4)\n base_seed = int.from_bytes(random_data, byteorder=\"big\")\n np.random.seed(base_seed + worker_id)\n\n\ndef prepare_samples(sample_data, N_target_dict):\n\n ##################################################################################################\n # Surface\n ##################################################################################################\n surface_sdf_samples = np.empty((0, 4))\n\n # Subsample\n if N_target_dict['surface'] > 0:\n surface_sdf_samples = sample_data['surface']\n N = N_target_dict['surface']\n assert surface_sdf_samples.shape[0] > N\n surface_idxs = np.random.permutation(surface_sdf_samples.shape[0])[:N]\n surface_sdf_samples = surface_sdf_samples[surface_idxs, :]\n assert surface_sdf_samples.shape[1] == 3\n \n # Generate gt sdf for surface points (all have 0 sdf values)\n surface_sdf = np.zeros((surface_sdf_samples.shape[0], 1), dtype=np.float32)\n surface_sdf_samples = np.concatenate((surface_sdf_samples, surface_sdf), axis=1)\n\n ##################################################################################################\n # Near Surface Sampled\n ##################################################################################################\n nss_sdf_samples = np.empty((0, 4))\n \n # Subsample\n if N_target_dict['near'] > 0:\n nss_sdf_samples = sample_data['near']\n N = N_target_dict['near']\n assert nss_sdf_samples.shape[0] > N\n nss_idxs = np.random.permutation(nss_sdf_samples.shape[0])[:N]\n nss_sdf_samples = nss_sdf_samples[nss_idxs, :]\n assert nss_sdf_samples.shape[1] == 4\n\n # If you want to visualize:\n # print(nss_sdf_samples.shape)\n # import open3d as o3d\n # pcd = o3d.geometry.PointCloud(o3d.utility.Vector3dVector(nss_sdf_samples[:, :3]))\n # pcd.paint_uniform_color([1, 0, 0])\n # o3d.visualization.draw_geometries([pcd])\n\n ##################################################################################################\n # Uniform\n ##################################################################################################\n uniform_sdf_samples = np.empty((0, 4))\n \n # Subsample\n if N_target_dict['uniform'] > 0:\n uniform_sdf_samples = sample_data['uniform']\n N = N_target_dict['uniform']\n assert uniform_sdf_samples.shape[0] > N\n uniform_idxs = np.random.permutation(uniform_sdf_samples.shape[0])[:N]\n uniform_sdf_samples = uniform_sdf_samples[uniform_idxs, :]\n assert uniform_sdf_samples.shape[1] == 4\n\n # If you want to visualize:\n # print(uniform_sdf_samples.shape)\n # pcd2 = o3d.geometry.PointCloud(o3d.utility.Vector3dVector(uniform_sdf_samples[:, :3]))\n # pcd2.paint_uniform_color([0, 1, 0])\n # o3d.visualization.draw_geometries([pcd, pcd2])\n\n ##################################################################################################\n ##################################################################################################\n # Concatenate\n ##################################################################################################\n ##################################################################################################\n all_sdf_samples = np.concatenate((nss_sdf_samples, surface_sdf_samples, uniform_sdf_samples), axis=0)\n\n return all_sdf_samples" ]
[ [ "numpy.random.seed", "numpy.rint", "torch.utils.data.DataLoader", "numpy.concatenate", "numpy.all", "numpy.random.permutation", "numpy.any", "numpy.load", "numpy.array", "numpy.zeros", "numpy.sum", "numpy.empty", "numpy.random.randint" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
enricorotundo/alibi
[ "190d7960630221813f704817ee48cc5af46a9e07" ]
[ "alibi/explainers/anchor_base.py" ]
[ "import copy\nimport logging\nimport numpy as np\nfrom collections import defaultdict, namedtuple\nfrom functools import partial\nfrom typing import Callable, Tuple, Set, Dict, List\n\nfrom alibi.utils.distributed import ActorPool, RAY_INSTALLED\nfrom alibi.utils.distributions import kl_bernoulli\n\n\nlogger = logging.getLogger(__name__)\n\n\n# TODO: Discuss logging strategy\n\nclass AnchorBaseBeam:\n\n def __init__(self, samplers: List[Callable], **kwargs) -> None:\n \"\"\"\n Parameters\n ---------\n samplers\n Objects that can be called with args (result, n_samples) tuple to draw samples.\n \"\"\"\n\n self.sample_fcn = samplers[0]\n self.samplers = None # type: List[Callable]\n # Initial size (in batches) of data/raw data samples cache.\n self.sample_cache_size = kwargs.get('sample_cache_size', 10000)\n # when only the max of self.margin or batch size remain emptpy, the cache is\n # extended to accommodate an additional sample_cache_size batches.\n self.margin = kwargs.get('cache_margin', 1000)\n\n def _init_state(self, batch_size: int, coverage_data: np.ndarray) -> None:\n \"\"\"\n Initialises the object state, which is used to compute result precisions & precision bounds\n and provide metadata for explanation objects.\n\n Parameters\n ----------\n batch_size\n See anchor_beam method.\n coverage_data\n See _get_coverage_samples method.\n sample_cache_size\n See anchor_beam method.\n \"\"\"\n\n prealloc_size = batch_size * self.sample_cache_size\n # t_ indicates that the attribute is a dictionary with entries for each anchor\n self.state = {\n 't_coverage': defaultdict(lambda: 0.), # anchors' coverage\n 't_coverage_idx': defaultdict(set), # index of anchors in coverage set\n 't_covered_true': defaultdict(None), # samples with same pred as instance where t_ applies\n 't_covered_false': defaultdict(None), # samples with dif pred to instance where t_ applies\n 't_idx': defaultdict(set), # row idx in sample cache where the anchors apply\n 't_nsamples': defaultdict(lambda: 0.), # total number of samples drawn for the anchors\n 't_order': defaultdict(list), # anchors are sorted to avoid exploring permutations\n # this is the order in which anchors were found\n 't_positives': defaultdict(lambda: 0.), # nb of samples where result pred = pred on instance\n 'prealloc_size': prealloc_size, # samples caches size\n 'data': np.zeros((prealloc_size, coverage_data.shape[1]), coverage_data.dtype), # samples caches\n 'labels': np.zeros(prealloc_size, ), # clf pred labels on raw_data\n 'current_idx': 0,\n 'n_features': coverage_data.shape[1], # data set dim after encoding\n 'coverage_data': coverage_data, # coverage data\n } # type: dict\n self.state['t_order'][()] = () # Trivial order for the empty result\n\n @staticmethod\n def _sort(x: tuple, allow_duplicates=False) -> tuple:\n \"\"\"\n Sorts a tuple, optionally removing duplicates.\n\n Parameters\n ----------\n x:\n Tuple to be sorted.\n allow_duplicates:\n If True, duplicate entries are kept\n\n Returns\n -------\n A sorted tuple.\n \"\"\"\n\n if allow_duplicates:\n return tuple(sorted(x))\n\n return tuple(sorted(set(x)))\n\n @staticmethod\n def dup_bernoulli(p: np.ndarray, level: np.ndarray, n_iter: int = 17) -> np.ndarray:\n \"\"\"\n Update upper precision bound for a candidate anchors dependent on the KL-divergence.\n\n Parameters\n ----------\n p\n Precision of candidate anchors.\n level\n beta / nb of samples for each result.\n n_iter\n Number of iterations during lower bound update.\n\n Returns\n -------\n Updated upper precision bounds array.\n \"\"\"\n # TODO: where does 17x sampling come from?\n lm = p.copy()\n um = np.minimum(np.minimum(p + np.sqrt(level / 2.), 1.0), 1.0)\n\n # Perform bisection algorithm to find the largest qm s.t. kl divergence is > level\n for j in range(1, n_iter):\n qm = (um + lm) / 2.\n kl_gt_idx = kl_bernoulli(p, qm) > level\n kl_lt_idx = np.logical_not(kl_gt_idx)\n um[kl_gt_idx] = qm[kl_gt_idx]\n lm[kl_lt_idx] = qm[kl_lt_idx]\n\n return um\n\n @staticmethod\n def dlow_bernoulli(p: np.ndarray, level: np.ndarray, n_iter: int = 17) -> np.ndarray:\n \"\"\"\n Update lower precision bound for a candidate anchors dependent on the KL-divergence.\n\n Parameters\n ----------\n p\n Precision of candidate anchors.\n level\n beta / nb of samples for each result.\n n_iter\n Number of iterations during lower bound update.\n\n Returns\n -------\n Updated lower precision bounds array.\n \"\"\"\n\n um = p.copy()\n lm = np.clip(p - np.sqrt(level / 2.), 0.0, 1.0) # lower bound\n\n # Perform bisection algorithm to find the smallest qm s.t. kl divergence is > level\n for _ in range(1, n_iter):\n qm = (um + lm) / 2.\n kl_gt_idx = kl_bernoulli(p, qm) > level\n kl_lt_idx = np.logical_not(kl_gt_idx)\n lm[kl_gt_idx] = qm[kl_gt_idx]\n um[kl_lt_idx] = qm[kl_lt_idx]\n\n return lm\n\n @staticmethod\n def compute_beta(n_features: int, t: int, delta: float) -> float:\n \"\"\"\n Parameters\n ----------\n n_features\n Number of candidate anchors.\n t\n Iteration number.\n delta\n\n Returns\n -------\n Level used to update upper and lower precision bounds.\n \"\"\"\n # TODO: where do magic numbers come from?\n alpha = 1.1\n k = 405.5\n temp = np.log(k * n_features * (t ** alpha) / delta)\n\n return temp + np.log(temp)\n\n def _get_coverage_samples(self, coverage_samples: int, samplers: List[Callable] = None) -> np.ndarray:\n \"\"\"\n Draws samples uniformly at random from the training set.\n\n Parameters\n ---------\n coverage_samples\n See anchor_beam method.\n samplers\n See __init__ method.\n\n Returns\n -------\n coverage_data\n binarised samples, where 1 indicates the feature has same value/is in same beam as\n instance to be explained. Used to determine, e.g., which samples an result applies to.\n \"\"\"\n\n [coverage_data] = self.sample_fcn((0, ()), coverage_samples, compute_labels=False)\n\n return coverage_data\n\n def select_critical_arms(self, means: np.ndarray, ub: np.ndarray, lb: np.ndarray, n_samples: np.ndarray,\n delta: float, top_n: int, t: int): # type: ignore\n \"\"\"\n Determines a set of two anchors by updating the upper bound for low emprical precision anchors and\n the lower bound for anchors with high empirical precision.\n\n Parameters\n ----------\n means\n Empirical mean result precisions.\n ub\n Upper bound on result precisions.\n lb\n Lower bound on result precisions.\n n_samples\n The number of samples drawn for each candidate result.\n delta\n Confidence budget, candidate anchors have close to optimal precisions with prob. 1 - delta.\n top_n\n Number of arms to be selected.\n t\n Iteration number.\n\n Returns\n -------\n Upper and lower precision bound indices.\n \"\"\"\n\n crit_arms = namedtuple('crit_arms', ['ut', 'lt'])\n\n sorted_means = np.argsort(means) # ascending sort of result candidates by precision\n beta = self.compute_beta(len(means), t, delta)\n\n # J = the beam width top result candidates with highest precision\n # not_J = the rest\n J = sorted_means[-top_n:]\n not_J = sorted_means[:-top_n]\n\n # update upper bound for lowest precision result candidates\n ub[not_J] = self.dup_bernoulli(means[not_J], beta / n_samples[not_J])\n # update lower bound for highest precision result candidates\n lb[J] = self.dlow_bernoulli(means[J], beta / n_samples[J])\n\n # for the low precision result candidates, compute the upper precision bound and keep the index ...\n # ... of the result candidate with the highest upper precision value -> ut\n # for the high precision result candidates, compute the lower precision bound and keep the index ...\n # ... of the result candidate with the lowest lower precision value -> lt\n ut = not_J[np.argmax(ub[not_J])]\n lt = J[np.argmin(lb[J])]\n\n return crit_arms._make((ut, lt))\n\n def kllucb(self, anchors: list, init_stats: dict, epsilon: float, delta: float, batch_size: int, top_n: int,\n verbose: bool = False, verbose_every: int = 1) -> np.ndarray:\n \"\"\"\n Implements the KL-LUCB algorithm (Kaufmann and Kalyanakrishnan, 2013).\n\n Parameters\n ----------\n anchors:\n A list of anchors from which two critical anchors are selected (see Kaufmann and Kalyanakrishnan, 2013).\n init_stats\n Dictionary with lists containing nb of samples used and where sample predictions equal the desired label.\n epsilon\n Precision bound tolerance for convergence.\n delta\n Used to compute beta.\n batch_size\n Number of samples.\n top_n\n Min of beam width size or number of candidate anchors.\n verbose\n Whether to print intermediate output.\n verbose_every\n Whether to print intermediate output every verbose_every steps.\n\n Returns\n -------\n Indices of best result options. Number of indices equals min of beam width or nb of candidate anchors.\n \"\"\"\n\n # n_features equals to the nb of candidate anchors\n n_features = len(anchors)\n\n # arrays for total number of samples & positives (# samples where prediction equals desired label)\n n_samples, positives = init_stats['n_samples'], init_stats['positives']\n anchors_to_sample, anchors_idx = [], []\n for f in np.where(n_samples == 0)[0]:\n anchors_to_sample.append(anchors[f])\n anchors_idx.append(f)\n\n if anchors_idx:\n pos, total = self.draw_samples(anchors_to_sample, 1)\n positives[anchors_idx] += pos\n n_samples[anchors_idx] += total\n\n if n_features == top_n: # return all options b/c of beam search width\n return np.arange(n_features)\n\n # update the upper and lower precision bounds until the difference between the best upper ...\n # ... precision bound of the low precision anchors and the worst lower precision bound of the high ...\n # ... precision anchors is smaller than eps\n means = positives / n_samples # fraction sample predictions equal to desired label\n ub, lb = np.zeros(n_samples.shape), np.zeros(n_samples.shape)\n t = 1\n crit_a_idx = self.select_critical_arms(means, ub, lb, n_samples, delta, top_n, t)\n B = ub[crit_a_idx.ut] - lb[crit_a_idx.lt]\n verbose_count = 0\n\n while B > epsilon:\n\n verbose_count += 1\n if verbose and verbose_count % verbose_every == 0:\n ut, lt = crit_a_idx\n print('Best: %d (mean:%.10f, n: %d, lb:%.4f)' %\n (lt, means[lt], n_samples[lt], lb[lt]), end=' ')\n print('Worst: %d (mean:%.4f, n: %d, ub:%.4f)' %\n (ut, means[ut], n_samples[ut], ub[ut]), end=' ')\n print('B = %.2f' % B)\n\n # draw samples for each critical result, update anchors' mean, upper and lower\n # bound precision estimate\n selected_anchors = [anchors[idx] for idx in crit_a_idx]\n pos, total = self.draw_samples(selected_anchors, batch_size)\n idx = list(crit_a_idx)\n positives[idx] += pos\n n_samples[idx] += total\n means = positives / n_samples\n t += 1\n crit_a_idx = self.select_critical_arms(means, ub, lb, n_samples, delta, top_n, t)\n B = ub[crit_a_idx.ut] - lb[crit_a_idx.lt]\n sorted_means = np.argsort(means)\n\n return sorted_means[-top_n:]\n\n def draw_samples(self, anchors: list, batch_size: int) -> Tuple[tuple, tuple]:\n \"\"\"\n Parameters\n ----------\n anchors\n Anchors on which samples are conditioned.\n batch_size\n The number of samples drawn for each result.\n\n Returns\n -------\n A tuple of positive samples (for which prediction matches desired label)\n and a tuple of total number of samples drawn.\n \"\"\"\n\n for anchor in anchors:\n if anchor not in self.state['t_order']:\n self.state['t_order'][anchor] = list(anchor)\n\n sample_stats, pos, total = [], (), () # type: List, Tuple, Tuple\n samples_iter = [self.sample_fcn((i, tuple(self.state['t_order'][anchor])), num_samples=batch_size)\n for i, anchor in enumerate(anchors)]\n for samples, anchor in zip(samples_iter, anchors):\n covered_true, covered_false, labels, *additionals, _ = samples\n sample_stats.append(self.update_state(covered_true, covered_false, labels, additionals, anchor))\n pos, total = list(zip(*sample_stats))\n\n return pos, total\n\n def propose_anchors(self, previous_best: list) -> list:\n \"\"\"\n Parameters\n ----------\n previous_best\n List with tuples of result candidates.\n\n\n Returns\n -------\n List with tuples of candidate anchors with additional metadata.\n \"\"\"\n\n # compute some variables used later on\n state = self.state\n all_features = range(state['n_features'])\n coverage_data = state['coverage_data']\n current_idx = state['current_idx']\n data = state['data'][:current_idx]\n labels = state['labels'][:current_idx]\n\n # initially, every feature separately is an result\n if len(previous_best) == 0:\n tuples = [(x,) for x in all_features]\n for x in tuples:\n pres = data[:, x[0]].nonzero()[0] # Select samples whose feat value is = to the result value\n state['t_idx'][x] = set(pres)\n state['t_nsamples'][x] = float(len(pres))\n state['t_positives'][x] = float(labels[pres].sum())\n state['t_order'][x].append(x[0])\n state['t_coverage_idx'][x] = set(coverage_data[:, x[0]].nonzero()[0])\n state['t_coverage'][x] = (float(len(state['t_coverage_idx'][x])) / coverage_data.shape[0])\n return tuples\n\n # create new anchors: add a feature to every result in current best\n new_tuples = set() # type: Set[tuple]\n for f in all_features:\n for t in previous_best:\n new_t = self._sort(t + (f,), allow_duplicates=False)\n if len(new_t) != len(t) + 1: # Avoid repeating the same feature ...\n continue\n if new_t not in new_tuples:\n new_tuples.add(new_t)\n state['t_order'][new_t] = copy.deepcopy(state['t_order'][t])\n state['t_order'][new_t].append(f)\n state['t_coverage_idx'][new_t] = (state['t_coverage_idx'][t].intersection(\n state['t_coverage_idx'][(f,)])\n )\n state['t_coverage'][new_t] = (float(len(state['t_coverage_idx'][new_t])) / coverage_data.shape[0])\n t_idx = np.array(list(state['t_idx'][t])) # indices of samples where the len-1 result applies\n t_data = state['data'][t_idx]\n present = np.where(t_data[:, f] == 1)[0]\n state['t_idx'][new_t] = set(t_idx[present]) # indices of samples where the proposed result applies\n idx_list = list(state['t_idx'][new_t])\n state['t_nsamples'][new_t] = float(len(idx_list))\n state['t_positives'][new_t] = np.sum(state['labels'][idx_list])\n\n return list(new_tuples)\n\n def update_state(self, covered_true: np.ndarray, covered_false: np.ndarray, labels: np.ndarray,\n samples: tuple, anchor: tuple) -> Tuple[int, int]:\n \"\"\"\n Updates the explainer state (see __init__ for full state definition).\n\n Parameters\n ----------\n\n covered_true\n Examples where the result applies and the prediction is the same as on\n the instance to be explained.\n covered_false\n Examples where the result applies and the prediction is the different to\n the instance to be explained.\n samples\n A tuple containing discretized data, coverage and the result sampled.\n labels\n An array indicating whether the prediction on the sample matches the label\n of the instance to be explained.\n anchor\n The result to be updated.\n\n Returns\n -------\n A tuple containing the number of instances equals desired label of observation\n to be explained the total number of instances sampled, and the result that was sampled\n \"\"\"\n\n # data = binary matrix where 1 means a feature has the same value as the feature in the result\n data, coverage = samples\n n_samples = data.shape[0]\n\n current_idx = self.state['current_idx']\n idxs = range(current_idx, current_idx + n_samples)\n self.state['t_idx'][anchor].update(idxs)\n self.state['t_nsamples'][anchor] += n_samples\n self.state['t_positives'][anchor] += labels.sum()\n if coverage > -1:\n self.state['t_coverage'][anchor] = coverage\n self.state['t_covered_true'][anchor] = covered_true\n self.state['t_covered_false'][anchor] = covered_false\n self.state['data'][idxs] = data\n self.state['labels'][idxs] = labels\n self.state['current_idx'] += n_samples\n\n if self.state['current_idx'] >= self.state['data'].shape[0] - max(self.margin, n_samples):\n prealloc_size = self.state['prealloc_size']\n self.state['data'] = np.vstack(\n (self.state['data'], np.zeros((prealloc_size, data.shape[1]), data.dtype))\n )\n self.state['labels'] = np.hstack(\n (self.state['labels'], np.zeros(prealloc_size, labels.dtype))\n )\n\n return labels.sum(), data.shape[0]\n\n def get_init_stats(self, anchors: list, coverages=False) -> dict:\n \"\"\"\n Finds the number of samples already drawn for each result in anchors, their\n comparisons with the instance to be explained and, optionally, coverage.\n\n Parameters\n ----------\n anchors\n Candidate anchors.\n coverages\n If True, the statistics returned contain the coverage of the specified anchors.\n\n Returns\n -------\n Dictionary with lists containing nb of samples used and where sample predictions equal\n the desired label.\n \"\"\"\n\n def array_factory(size: tuple):\n return lambda: np.zeros(size)\n\n state = self.state\n stats = defaultdict(array_factory((len(anchors),))) # type: Dict[str, np.ndarray]\n for i, anchor in enumerate(anchors):\n stats['n_samples'][i] = state['t_nsamples'][anchor]\n stats['positives'][i] = state['t_positives'][anchor]\n if coverages:\n stats['coverages'][i] = state['t_coverage'][anchor]\n\n return stats\n\n def get_anchor_metadata(self, features: tuple, success, batch_size: int = 100) -> dict:\n \"\"\"\n Given the features contained in a result, it retrieves metadata such as the precision and\n coverage of the result and partial anchors and examples where the result/partial anchors\n apply and yield the same prediction as on the instance to be explained (covered_true)\n or a different prediction (covered_false).\n\n Parameters\n ----------\n features\n Sorted indices of features in result.\n success\n Indicates whether an anchor satisfying precision threshold was met or not.\n batch_size\n Number of samples among which positive and negative examples for partial anchors are\n selected if partial anchors have not already been explicitly sampled.\n\n Returns\n -------\n Anchor dictionary with result features and additional metadata.\n :param success:\n \"\"\"\n\n state = self.state\n anchor = {'feature': [], 'mean': [], 'precision': [], 'coverage': [], 'examples': [],\n 'all_precision': 0, 'num_preds': state['data'].shape[0], 'success': success} # type: dict\n current_t = tuple() # type: tuple\n # draw pos and negative example where partial result applies if not sampled during search\n to_resample, to_resample_idx = [], []\n for f in state['t_order'][features]:\n current_t = self._sort(current_t + (f,), allow_duplicates=False)\n mean = (state['t_positives'][current_t] / state['t_nsamples'][current_t])\n anchor['feature'].append(f)\n anchor['mean'].append(mean)\n anchor['precision'].append(mean)\n anchor['coverage'].append(state['t_coverage'][current_t])\n\n # add examples where result does or does not hold\n if current_t in state['t_covered_true']:\n exs = {\n 'covered_true': state['t_covered_true'][current_t],\n 'covered_false': state['t_covered_false'][current_t],\n 'uncovered_true': np.array([]),\n 'uncovered_false': np.array([]),\n }\n anchor['examples'].append(exs)\n else:\n to_resample.append(current_t)\n # sampling process relies on ordering\n state['t_order'][current_t] = list(current_t)\n to_resample_idx.append(len(anchor['examples']))\n anchor['examples'].append('placeholder')\n # if the anchor was not sampled, the coverage is not estimated\n anchor['coverage'][-1] = 'placeholder'\n\n # If partial anchors have not been sampled, resample to find examples\n if to_resample:\n\n _, _ = self.draw_samples(to_resample, batch_size)\n\n while to_resample:\n feats, example_idx = to_resample.pop(), to_resample_idx.pop()\n anchor['examples'][example_idx] = {\n 'covered_true': state['t_covered_true'][feats],\n 'covered_false': state['t_covered_false'][feats],\n 'uncovered_true': np.array([]),\n 'uncovered_false': np.array([]),\n }\n # update result with true coverage\n anchor['coverage'][example_idx] = state['t_coverage'][feats]\n\n return anchor\n\n @staticmethod\n def to_sample(means: np.ndarray, ubs: np.ndarray, lbs: np.ndarray, desired_confidence: float, epsilon_stop: float):\n \"\"\"\n Given an array of mean result precisions and their upper and lower bounds, determines for which anchors\n more samples need to be drawn in order to estimate the anchors precision with desired_confidence and error\n tolerance.\n\n Parameters\n ----------\n means:\n Mean precisions (each element represents a different result).\n ubs:\n Precisions' upper bounds (each element represents a different result).\n lbs:\n Precisions' lower bounds (each element represents a different result).\n desired_confidence:\n Desired level of confidence for precision estimation.\n epsilon_stop:\n Tolerance around desired precision.\n\n Returns\n -------\n Boolean array indicating whether more samples are to be drawn for that particular result.\n \"\"\"\n\n return ((means >= desired_confidence) & (lbs < desired_confidence - epsilon_stop)) | \\\n ((means < desired_confidence) & (ubs >= desired_confidence + epsilon_stop))\n\n def anchor_beam(self, delta: float = 0.05, epsilon: float = 0.1, desired_confidence: float = 1.,\n beam_size: int = 1, epsilon_stop: float = 0.05, min_samples_start: int = 100,\n max_anchor_size: int = None, stop_on_first: bool = False, batch_size: int = 100,\n coverage_samples: int = 10000, verbose: bool = False, verbose_every: int = 1,\n **kwargs) -> dict:\n\n \"\"\"\n Uses the KL-LUCB algorithm (Kaufmann and Kalyanakrishnan, 2013) together with additional sampling to search\n feature sets (anchors) that guarantee the prediction made by a classifier model. The search is greedy if\n beam_size=1. Otherwise, at each of the max_anchor_size steps, beam_size solutions are explored. By construction,\n solutions found have high precision (defined as the expected of number of times the classifier makes the same\n prediction when queried with the feature subset combined with arbitrary samples drawn from a noise distribution)\n The algorithm maximises the coverage of the solution found - the frequency of occurrence of records containing\n the feature subset in set of samples.\n\n Parameters\n ----------\n delta\n Used to compute beta.\n epsilon\n Precision bound tolerance for convergence.\n desired_confidence\n Desired level of precision (tau in paper).\n beam_size\n Beam width.\n epsilon_stop\n Confidence bound margin around desired precision.\n min_samples_start\n Min number of initial samples.\n max_anchor_size\n Max number of features in result.\n stop_on_first\n Stop on first valid result found.\n coverage_samples\n Number of samples from which to build a coverage set.\n batch_size\n Number of samples used for an arm evaluation.\n verbose\n Whether to print intermediate LUCB & anchor selection output.\n verbose_every\n Print intermediate output every verbose_every steps.\n\n Returns\n -------\n Explanation dictionary containing anchors with metadata like coverage and precision\n and examples.\n \"\"\"\n\n # Select coverage set and initialise object state\n coverage_data = self._get_coverage_samples(\n coverage_samples,\n samplers=self.samplers,\n )\n self._init_state(batch_size, coverage_data)\n\n # sample by default 1 or min_samples_start more random value(s)\n (pos,), (total,) = self.draw_samples([()], min_samples_start)\n\n # mean = fraction of labels sampled data that equals the label of the instance to be explained, ...\n # ... equivalent to prec(A) in paper (eq.2)\n mean = np.array([pos / total])\n beta = np.log(1. / delta)\n # lower bound on mean precision\n lb = self.dlow_bernoulli(mean, np.array([beta / total]))\n\n # if lower precision bound below tau with margin eps, keep sampling data until lb is high enough ...\n # or mean falls below precision threshold\n while mean > desired_confidence and lb < desired_confidence - epsilon:\n (n_pos,), (n_total,) = self.draw_samples([()], batch_size)\n pos += n_pos\n total += n_total\n mean = np.array([pos / total])\n lb = self.dlow_bernoulli(mean, np.array([beta / total]))\n\n # if prec_lb(A) > tau for A=() then the empty result satisfies the constraints ...\n if lb > desired_confidence:\n return {\n 'feature': [],\n 'mean': [],\n 'num_preds': total,\n 'precision': [],\n 'coverage': [],\n 'examples': [],\n 'all_precision': mean,\n 'success': True,\n }\n\n current_size, best_coverage = 1, -1\n best_of_size = {0: []} # type: Dict[int, list]\n best_anchor = ()\n\n if max_anchor_size is None:\n max_anchor_size = self.state['n_features']\n\n # find best result using beam search\n while current_size <= max_anchor_size:\n\n # create new candidate anchors by adding features to current best anchors\n anchors = self.propose_anchors(best_of_size[current_size - 1])\n # goal is to max coverage given precision constraint P(prec(A) > tau) > 1 - delta (eq.4)\n # so keep tuples with higher coverage than current best coverage\n anchors = [anchor for anchor in anchors if self.state['t_coverage'][anchor] > best_coverage]\n\n # if no better coverage found with added features -> break\n if len(anchors) == 0:\n break\n\n # for each result, get initial nb of samples used and prec(A)\n stats = self.get_init_stats(anchors)\n\n # apply KL-LUCB and return result options (nb of options = beam width) in the form of indices\n candidate_anchors = self.kllucb(\n anchors,\n stats,\n epsilon,\n delta,\n batch_size,\n min(beam_size, len(anchors)),\n verbose=verbose,\n verbose_every=verbose_every,\n )\n # store best anchors for the given result size (nb of features in the result)\n best_of_size[current_size] = [anchors[index] for index in candidate_anchors]\n # for each candidate result:\n # update precision, lower and upper bounds until precision constraints are met\n # update best result if coverage is larger than current best coverage\n stats = self.get_init_stats(best_of_size[current_size], coverages=True)\n positives, n_samples = stats['positives'], stats['n_samples']\n beta = np.log(1. / (delta / (1 + (beam_size - 1) * self.state['n_features'])))\n kl_constraints = beta / n_samples\n means = stats['positives'] / stats['n_samples']\n lbs = self.dlow_bernoulli(means, kl_constraints)\n ubs = self.dup_bernoulli(means, kl_constraints)\n\n if verbose:\n print('Best of size ', current_size, ':')\n for i, mean, lb, ub in zip(candidate_anchors, means, lbs, ubs):\n print(i, mean, lb, ub)\n\n # draw samples to ensure result meets precision criteria\n continue_sampling = self.to_sample(means, ubs, lbs, desired_confidence, epsilon_stop)\n while continue_sampling.any():\n selected_anchors = [anchors[idx] for idx in candidate_anchors[continue_sampling]]\n pos, total = self.draw_samples(selected_anchors, batch_size)\n positives[continue_sampling] += pos\n n_samples[continue_sampling] += total\n means[continue_sampling] = positives[continue_sampling]/n_samples[continue_sampling]\n kl_constraints[continue_sampling] = beta / n_samples[continue_sampling]\n lbs[continue_sampling] = self.dlow_bernoulli(\n means[continue_sampling],\n kl_constraints[continue_sampling],\n )\n ubs[continue_sampling] = self.dup_bernoulli(\n means[continue_sampling],\n kl_constraints[continue_sampling],\n )\n continue_sampling = self.to_sample(means, ubs, lbs, desired_confidence, epsilon_stop)\n\n # anchors who meet the precision setting and have better coverage than the best anchors so far\n coverages = stats['coverages']\n valid_anchors = (means >= desired_confidence) & (lbs > desired_confidence - epsilon_stop)\n better_anchors = (valid_anchors & (coverages > best_coverage)).nonzero()[0]\n\n if verbose:\n for i, valid, mean, lb, ub, coverage in \\\n zip(candidate_anchors, valid_anchors, means, lbs, ubs, coverages):\n t = anchors[i]\n print(\n '%s mean = %.2f lb = %.2f ub = %.2f coverage: %.2f n: %d' %\n (t, mean, lb, ub, coverage, self.state['t_nsamples'][t]))\n if valid:\n print(\n 'Found eligible result ', t,\n 'Coverage:', coverage,\n 'Is best?', coverage > best_coverage,\n )\n\n if better_anchors.size > 0:\n best_anchor_idx = better_anchors[np.argmax(coverages[better_anchors])]\n best_coverage = coverages[best_anchor_idx]\n best_anchor = anchors[candidate_anchors[best_anchor_idx]]\n if best_coverage == 1. or stop_on_first:\n break\n\n current_size += 1\n\n # if no result is found, choose highest precision of best result candidate from every round\n if not best_anchor:\n success = False # indicates the method has not found an anchor\n logger.warning('Could not find an result satisfying the {} precision constraint. Now returning '\n 'the best non-eligible result.'.format(desired_confidence))\n anchors = []\n for i in range(0, current_size):\n anchors.extend(best_of_size[i])\n stats = self.get_init_stats(anchors)\n candidate_anchors = self.kllucb(\n anchors,\n stats,\n epsilon,\n delta,\n batch_size,\n 1, # beam size\n verbose=verbose,\n )\n best_anchor = anchors[candidate_anchors[0]]\n else:\n success = True\n\n return self.get_anchor_metadata(best_anchor, success, batch_size=batch_size)\n\n\nclass DistributedAnchorBaseBeam(AnchorBaseBeam):\n\n if RAY_INSTALLED:\n import ray\n ray = ray\n\n def __init__(self, samplers: List[Callable], **kwargs) -> None:\n\n super().__init__(samplers)\n self.chunksize = kwargs.get('chunksize', 1)\n self.sample_fcn = lambda actor, anchor, n_samples, compute_labels=True:\\\n actor.__call__.remote(anchor,\n n_samples,\n compute_labels=compute_labels)\n self.pool = ActorPool(samplers)\n self.samplers = samplers\n\n def _get_coverage_samples(self, coverage_samples: int, samplers: List[Callable] = None) -> np.ndarray:\n \"\"\"\n Sends a request for a coverage set to process running sampling tasks.\n\n Parameters\n ----------\n See superclass implementation.\n\n Returns\n -------\n See superclass implementation.\n \"\"\"\n\n [coverage_data] = DistributedAnchorBaseBeam.ray.get(\n self.sample_fcn(samplers[0], (0, ()), coverage_samples, compute_labels=False)\n )\n\n return coverage_data\n\n def draw_samples(self, anchors: list, batch_size: int) -> Tuple[np.ndarray, np.ndarray]:\n \"\"\"\n Distributes sampling requests among processes running sampling tasks.\n\n Parameters\n ----------\n See superclass implementation.\n\n Returns\n -------\n Same outputs as superclass but of different types.\n \"\"\"\n\n # partial anchors not generated by propose_anchors are not in the order dictionary\n for anchor in anchors:\n if anchor not in self.state['t_order']:\n self.state['t_order'][anchor] = list(anchor)\n\n pos, total = np.zeros((len(anchors),)), np.zeros((len(anchors),))\n order_map = [(i, tuple(self.state['t_order'][anchor])) for i, anchor in enumerate(anchors)]\n samples_iter = self.pool.map_unordered(\n partial(self.sample_fcn, n_samples=batch_size),\n order_map,\n self.chunksize,\n )\n for samples_batch in samples_iter:\n for samples in samples_batch:\n covered_true, covered_false, labels, *additionals, anchor_idx = samples\n positives, n_samples = self.update_state(\n covered_true,\n covered_false,\n labels,\n additionals,\n anchors[anchor_idx],\n )\n # return statistics in the same order as the requests\n pos[anchor_idx], total[anchor_idx] = positives, n_samples\n\n return pos, total\n" ]
[ [ "numpy.logical_not", "numpy.log", "numpy.sum", "numpy.sqrt", "numpy.arange", "numpy.argmax", "numpy.argmin", "numpy.argsort", "numpy.array", "numpy.zeros", "numpy.where" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
peteseibel/retention-data-pipeline
[ "9839d2b900f77722fffb762772697e422e7ec8fb" ]
[ "retention_data_pipeline/dao/edw.py" ]
[ "import os\nimport pyodbc\nimport pandas\nfrom django.conf import settings\n\nDB = \"UWSDBDataStore\"\n\n\ndef get_day1_enrollments(year, quarter):\n \"\"\"\n Returns a list of student system_keys enrolled on day one and EOP status\n \"\"\"\n campus = 0\n db_query = \"\"\"\n SELECT *\n FROM (\n SELECT\n CASE WHEN mm_spcl_program IN(1, 2, 13, 14, 16, 17, 31, 32, 33)\n THEN CAST(1 AS BIT)\n ELSE CAST(0 AS BIT)\n END AS eop_student,\n (mm.mm_year*10 + mm.mm_qtr) as yrq,\n ROW_NUMBER() OVER\n (PARTITION BY mm.mm_system_key ORDER BY mm.mm_system_key) AS rn,\n mm_system_key, mm.mm_year, mm.mm_qtr, mm_deg_level, mm_major_abbr\n FROM\n sec.sr_mini_master mm\n INNER JOIN sec.sr_mini_master_deg_program deg\n ON deg.mm_student_no = mm.mm_student_no\n AND deg.mm_year = mm.mm_year\n AND deg.mm_qtr = mm.mm_qtr\n WHERE\n mm.mm_year = {}\n AND mm.mm_qtr = {}\n AND mm.mm_proc_ind = 2\n AND deg.mm_branch = {}) as a\n WHERE a.rn = 1\n \"\"\".format(\n year, quarter, campus\n )\n results = _run_query(DB, db_query)\n return results\n\n\ndef get_ts_courses(year, quarter):\n db_query = \"\"\"\n SELECT\n ts_year,\n ts_quarter,\n course_no,\n dept_abbrev,\n section_id,\n sln\n FROM\n sec.time_schedule\n WHERE\n ts_year = {}\n AND ts_quarter = {}\n \"\"\".format(\n year, quarter\n )\n results = _run_query(DB, db_query)\n return results\n\n\ndef get_registrations(year, quarter):\n db_query = \"\"\"\n SELECT\n system_key,\n regis_yr,\n regis_qtr,\n sln\n FROM\n sec.registration_courses\n WHERE\n regis_yr = {}\n AND regis_qtr = {}\n AND request_status in ('A', 'C', 'R')\n \"\"\".format(\n year, quarter\n )\n results = _run_query(DB, db_query)\n return results\n\n\ndef get_student_metadata():\n db_query = \"\"\"\n SELECT\n system_key,\n uw_netid,\n student_no,\n student_name_lowc\n FROM\n sec.student_1\n \"\"\"\n results = _run_query(DB, db_query)\n return results\n\n\ndef get_international_students():\n db_query = \"\"\"\n SELECT\n SDBSrcSystemKey,\n InternationalStudentInd\n FROM EDWPresentation.sec.dimStudent\n WHERE\n InternationalStudentInd = 'Y'\n \"\"\"\n results = _run_query(DB, db_query)\n return results\n\n\ndef get_majors(year, quarter):\n\n db_query = \"\"\"\n #TODO: Determine relationship w/ mini_maser and write query\n \"\"\".format(\n year, quarter\n )\n results = _run_query(DB, db_query)\n return results\n\n\ndef _run_query(database, query):\n os.environ[\"FREETDSCONF\"] = \"db_config/freetds.conf\"\n os.environ[\"ODBCSYSINI\"] = \"db_config\"\n\n password = getattr(settings, \"EDW_PASSWORD\")\n user = getattr(settings, \"EDW_USER\")\n server = getattr(settings, \"EDW_SERVER\")\n constring = (\n \"Driver={FreeTDS};\"\n f\"SERVERNAME={server};\"\n f\"Database={database};\"\n \"Port=1433;\"\n \"TDS_Version=7.2;\"\n f\"UID={user};\"\n f\"PWD={password}\"\n )\n con = pyodbc.connect(constring)\n df = pandas.read_sql(query, con)\n return df\n" ]
[ [ "pandas.read_sql" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "0.23", "0.21", "2.0", "1.4", "0.19", "1.1", "1.5", "1.2", "0.24", "0.20", "1.0", "0.25", "1.3" ], "scipy": [], "tensorflow": [] } ]
patelajaychh/Hierarchical-Localization
[ "d3f155d0587376a6fd0395ea36125016160fa448" ]
[ "hloc/localize_inloc.py" ]
[ "import argparse\nfrom pathlib import Path\nimport numpy as np\nimport h5py\nfrom scipy.io import loadmat\nimport torch\nfrom tqdm import tqdm\nimport logging\nimport pickle\nimport cv2\nimport pycolmap\n\nfrom .utils.parsers import parse_retrieval, names_to_pair\n\n\ndef interpolate_scan(scan, kp):\n h, w, c = scan.shape\n kp = kp / np.array([[w-1, h-1]]) * 2 - 1\n assert np.all(kp > -1) and np.all(kp < 1)\n scan = torch.from_numpy(scan).permute(2, 0, 1)[None]\n kp = torch.from_numpy(kp)[None, None]\n grid_sample = torch.nn.functional.grid_sample\n\n # To maximize the number of points that have depth:\n # do bilinear interpolation first and then nearest for the remaining points\n interp_lin = grid_sample(\n scan, kp, align_corners=True, mode='bilinear')[0, :, 0]\n interp_nn = torch.nn.functional.grid_sample(\n scan, kp, align_corners=True, mode='nearest')[0, :, 0]\n interp = torch.where(torch.isnan(interp_lin), interp_nn, interp_lin)\n valid = ~torch.any(torch.isnan(interp), 0)\n\n kp3d = interp.T.numpy()\n valid = valid.numpy()\n return kp3d, valid\n\n\ndef get_scan_pose(dataset_dir, rpath):\n split_image_rpath = rpath.split('/')\n floor_name = split_image_rpath[-3]\n scan_id = split_image_rpath[-2]\n image_name = split_image_rpath[-1]\n building_name = image_name[:3]\n\n path = Path(\n dataset_dir, 'database/alignments', floor_name,\n f'transformations/{building_name}_trans_{scan_id}.txt')\n with open(path) as f:\n raw_lines = f.readlines()\n\n P_after_GICP = np.array([\n np.fromstring(raw_lines[7], sep=' '),\n np.fromstring(raw_lines[8], sep=' '),\n np.fromstring(raw_lines[9], sep=' '),\n np.fromstring(raw_lines[10], sep=' ')\n ])\n\n return P_after_GICP\n\n\ndef pose_from_cluster(dataset_dir, q, retrieved, feature_file, match_file,\n skip=None):\n height, width = cv2.imread(str(dataset_dir / q)).shape[:2]\n cx = .5 * width\n cy = .5 * height\n focal_length = 4032. * 28. / 36.\n\n all_mkpq = []\n all_mkpr = []\n all_mkp3d = []\n all_indices = []\n kpq = feature_file[q]['keypoints'].__array__()\n num_matches = 0\n\n for i, r in enumerate(retrieved):\n kpr = feature_file[r]['keypoints'].__array__()\n pair = names_to_pair(q, r)\n m = match_file[pair]['matches0'].__array__()\n v = (m > -1)\n\n if skip and (np.count_nonzero(v) < skip):\n continue\n\n mkpq, mkpr = kpq[v], kpr[m[v]]\n num_matches += len(mkpq)\n\n scan_r = loadmat(Path(dataset_dir, r + '.mat'))[\"XYZcut\"]\n mkp3d, valid = interpolate_scan(scan_r, mkpr)\n Tr = get_scan_pose(dataset_dir, r)\n mkp3d = (Tr[:3, :3] @ mkp3d.T + Tr[:3, -1:]).T\n\n all_mkpq.append(mkpq[valid])\n all_mkpr.append(mkpr[valid])\n all_mkp3d.append(mkp3d[valid])\n all_indices.append(np.full(np.count_nonzero(valid), i))\n\n all_mkpq = np.concatenate(all_mkpq, 0)\n all_mkpr = np.concatenate(all_mkpr, 0)\n all_mkp3d = np.concatenate(all_mkp3d, 0)\n all_indices = np.concatenate(all_indices, 0)\n\n cfg = {\n 'model': 'SIMPLE_PINHOLE',\n 'width': width,\n 'height': height,\n 'params': [focal_length, cx, cy]\n }\n ret = pycolmap.absolute_pose_estimation(\n all_mkpq, all_mkp3d, cfg, 48.00)\n ret['cfg'] = cfg\n return ret, all_mkpq, all_mkpr, all_mkp3d, all_indices, num_matches\n\n\ndef main(dataset_dir, retrieval, features, matches, results,\n skip_matches=None):\n\n assert retrieval.exists(), retrieval\n assert features.exists(), features\n assert matches.exists(), matches\n\n retrieval_dict = parse_retrieval(retrieval)\n queries = list(retrieval_dict.keys())\n\n feature_file = h5py.File(features, 'r')\n match_file = h5py.File(matches, 'r')\n\n poses = {}\n logs = {\n 'features': features,\n 'matches': matches,\n 'retrieval': retrieval,\n 'loc': {},\n }\n logging.info('Starting localization...')\n for q in tqdm(queries):\n db = retrieval_dict[q]\n ret, mkpq, mkpr, mkp3d, indices, num_matches = pose_from_cluster(\n dataset_dir, q, db, feature_file, match_file, skip_matches)\n\n poses[q] = (ret['qvec'], ret['tvec'])\n logs['loc'][q] = {\n 'db': db,\n 'PnP_ret': ret,\n 'keypoints_query': mkpq,\n 'keypoints_db': mkpr,\n '3d_points': mkp3d,\n 'indices_db': indices,\n 'num_matches': num_matches,\n }\n\n logging.info(f'Writing poses to {results}...')\n with open(results, 'w') as f:\n for q in queries:\n qvec, tvec = poses[q]\n qvec = ' '.join(map(str, qvec))\n tvec = ' '.join(map(str, tvec))\n name = q.split(\"/\")[-1]\n f.write(f'{name} {qvec} {tvec}\\n')\n\n logs_path = f'{results}_logs.pkl'\n logging.info(f'Writing logs to {logs_path}...')\n with open(logs_path, 'wb') as f:\n pickle.dump(logs, f)\n logging.info('Done!')\n\n\nif __name__ == '__main__':\n parser = argparse.ArgumentParser()\n parser.add_argument('--dataset_dir', type=Path, required=True)\n parser.add_argument('--retrieval', type=Path, required=True)\n parser.add_argument('--features', type=Path, required=True)\n parser.add_argument('--matches', type=Path, required=True)\n parser.add_argument('--results', type=Path, required=True)\n parser.add_argument('--skip_matches', type=int)\n args = parser.parse_args()\n main(**args.__dict__)\n" ]
[ [ "torch.isnan", "torch.from_numpy", "numpy.concatenate", "numpy.all", "numpy.fromstring", "torch.nn.functional.grid_sample", "numpy.count_nonzero", "numpy.array" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
czhao39/xacc-vqe
[ "4ad1d9308794e28c37772b7ea29cd3923388168a" ]
[ "examples/general/scipy_minimization_with_xacc.py" ]
[ "import numpy as np\nimport pyxacc as xacc\nfrom pyxacc import InstructionParameter\nimport pyxaccvqe as vqe\nfrom pyxaccvqe import PauliOperator\nfrom scipy.optimize import minimize\n\nxacc.Initialize()\n\n# Construct the First Quantized 2x2 and 3x3 Hamiltonians\nhamiltonian3x3 = PauliOperator(7.7658547225) + PauliOperator({0:'X'}, -2.143303525) + \\\n PauliOperator({0:'X', 1:'X'}, -3.91311896) + PauliOperator({0:'X', 1:'Z'}, -2.143303525) + \\\n PauliOperator({0:'Y',1:'Y'}, -3.91311896) + PauliOperator({0:'Z'}, 1.6408547224999999) + \\\n PauliOperator({0:'Z',1:'Z'}, -7.9841452775) + PauliOperator({1:'Z'}, -1.8591452775000001)\n \nprint('\\nH_{3x3} = ', hamiltonian3x3)\n\n# Create the 3x3 Ansatz\nansatz3x3 = xacc.gate.GateFunction('statePrep', ['theta0','theta1'])\nansatz3x3.add(xacc.gate.create('Ry',[0],['theta0']))\nansatz3x3.add(xacc.gate.create('Ry',[1],['theta1']))\nprint('3x3 Ansatz = \\n', ansatz3x3.toString('q'))\n\nqpu = xacc.getAccelerator('tnqvm')\n\ndef energy(params):\n ir = hamiltonian3x3.toXACCIR()\n kernels = ir.getKernels()\n qubits = qpu.createBuffer('q',2)\n energy = 0.0\n for k in kernels:\n val = 0\n coeff = k.getParameter(0)\n if k.nInstructions() > 0:\n evaledAnsatz = vqe.AnsatzEvaluator.evaluate(ansatz3x3, 2, np.asarray(params))\n k.insertInstruction(0, evaledAnsatz)\n qpu.execute(qubits, k)\n exp = qubits.getExpectationValueZ()\n qubits.resetBuffer()\n val = coeff * exp\n else:\n val = coeff\n energy += val\n return energy.real\n\nprint('XACC Diagonalize: ', vqe.execute(hamiltonian3x3, **{}).energy) #'task':'vqe', 'ansatz':ansatz3x3}).energy)\nprint('XACC Nelder-Mead: ', vqe.execute(hamiltonian3x3, **{'task':'vqe', 'vqe-params':'.7,.2', 'ansatz':ansatz3x3}).energy)\nprint('XACC SciPy Minimze:\\n', minimize(energy, [0,0]))\n\n\n\nfrom bayes_opt import BayesianOptimization\n\ndef neg_energy(x, y):\n return -1*energy([x,y])\n\nbo = BayesianOptimization(neg_energy,\n {'x': (0, 1), 'y': (0, 1)})\n\nbo.maximize(init_points=10, n_iter=10, kappa=2)\n\n#{'max': {'max_val': 2.035286440109728, 'max_params': {'x': 0.6745710475274774, 'y': 0.2651970328890534}},\n#print(bo.res)\n\nprint('\\nMin Energy = ', -1.0*bo.res['max']['max_val'], ' at ', bo.res['max']['max_params'])\n" ]
[ [ "numpy.asarray", "scipy.optimize.minimize" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [ "0.13", "1.6", "0.14", "1.10", "0.15", "1.4", "0.16", "1.9", "0.19", "1.5", "0.18", "1.2", "1.7", "0.12", "1.0", "0.17", "1.3", "1.8" ], "tensorflow": [] } ]
t-kaichi/hyperspoof
[ "6effdf03be8489ba74154a12416c69948681aa51" ]
[ "train.components.py" ]
[ "import os\r\nimport time\r\nfrom tensorflow.keras.callbacks import EarlyStopping, ModelCheckpoint\r\nfrom absl import app\r\nfrom absl import flags\r\nfrom albumentations import (\r\n Compose, HorizontalFlip, RandomBrightness,RandomContrast,\r\n ShiftScaleRotate, ToFloat, VerticalFlip)\r\n\r\nfrom models import build_seg_model, build_pixel_mlp_class_model\r\nfrom utils import reset_tf, set_seed\r\nfrom VegetableSequence import VegetableDataset, VegetableSequence\r\nimport myFlags\r\n\r\nos.environ['TF_CPP_MIN_LOG_LEVEL'] = '2'\r\nFLAGS = flags.FLAGS\r\n\r\ndef main(argv):\r\n reset_tf(FLAGS.device)\r\n set_seed()\r\n\r\n isSeg = FLAGS.isSeg # train segmentation model\r\n\r\n # data structure\r\n ds_info = VegetableDataset(FLAGS.data_path)\r\n dim = ds_info.hsi_dims\r\n input_shape = (224, 224, dim) if isSeg else (FLAGS.nb_pixels, dim)\r\n\r\n # Experiment name\r\n experiment_title = \"HSSD\" \r\n experiment_title += '-seg' if isSeg else '-pix_class'\r\n experiment_title += '-%d' % time.time()\r\n logdir = os.path.join(FLAGS.log_root, experiment_title)\r\n os.makedirs(logdir)\r\n print(\"logdir: \", logdir)\r\n\r\n # augmentation\r\n if isSeg:\r\n AUGMENTATIONS_TRAIN = Compose([\r\n HorizontalFlip(p=0.5),\r\n VerticalFlip(p=0.2),\r\n RandomContrast(limit=0.001, p=0.5),\r\n RandomBrightness(limit=0.001, p=0.5),\r\n ShiftScaleRotate(\r\n shift_limit=0.3, scale_limit=0.9,\r\n rotate_limit=30, border_mode=4, p=0.8),# cv2.BORDER_REFLECT_101\r\n ToFloat(max_value=1024)\r\n ])\r\n else:\r\n AUGMENTATIONS_TRAIN = Compose([\r\n RandomContrast(limit=0.001, p=0.5),\r\n RandomBrightness(limit=0.001, p=0.5),\r\n ToFloat(max_value=1024)\r\n ])\r\n AUGMENTATIONS_TEST = AUGMENTATIONS_TRAIN\r\n\r\n # loading dataset\r\n train_gen = VegetableSequence(FLAGS.batch_size, instance_ids=[1, 2, 3],\r\n sample_ids=[1,2], dataset=ds_info, isSeg=isSeg,\r\n nb_pixels=FLAGS.nb_pixels,augmentations=AUGMENTATIONS_TRAIN)\r\n valid_gen = VegetableSequence(FLAGS.batch_size, instance_ids=[4],\r\n sample_ids=[1,2], dataset=ds_info, isSeg=isSeg,\r\n nb_pixels=FLAGS.nb_pixels,augmentations=AUGMENTATIONS_TEST,\r\n random_state=2021)\r\n\r\n # building a model\r\n if isSeg:\r\n model = build_seg_model(input_shape=input_shape)\r\n else:\r\n model = build_pixel_mlp_class_model(\r\n nb_classes=ds_info.object_categories, input_shape=input_shape,\r\n loss_weight=FLAGS.loss_weight)\r\n\r\n # callbacks\r\n checkpoint = ModelCheckpoint(logdir + \"/best.weights.hdf5\", monitor='val_loss',\r\n save_best_only=True, save_weights_only=True,\r\n mode='auto', save_freq=\"epoch\")\r\n early_stopping = EarlyStopping(monitor=\"val_loss\", patience=FLAGS.patience)\r\n callbacks = [checkpoint, early_stopping]\r\n \r\n model.fit(train_gen, epochs=FLAGS.epochs,validation_data=valid_gen,\r\n validation_steps=len(valid_gen), callbacks=callbacks)\r\n\r\nif __name__ == \"__main__\":\r\n app.run(main)\r\n" ]
[ [ "tensorflow.keras.callbacks.ModelCheckpoint", "tensorflow.keras.callbacks.EarlyStopping" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [ "1.10", "2.7", "2.6", "2.4", "2.3", "2.5", "2.2" ] } ]
Gael-de-Sailly/flopy
[ "4104cf5e6a35e2a1fd6183442962ae5cb258fa7a", "4104cf5e6a35e2a1fd6183442962ae5cb258fa7a", "4104cf5e6a35e2a1fd6183442962ae5cb258fa7a" ]
[ "autotest/t016_test.py", "examples/scripts/flopy_lake_example.py", "flopy/mf6/data/mfdatalist.py" ]
[ "import os\nimport flopy\nimport numpy as np\n\n\ntpth = os.path.abspath(os.path.join('temp', 't016'))\nif not os.path.isdir(tpth):\n os.makedirs(tpth)\n\n\nexe_name = 'mfusg'\nv = flopy.which(exe_name)\n\nrun = True\nif v is None:\n run = False\n\n\ndef test_usg_disu_load():\n\n pthusgtest = os.path.join('..', 'examples', 'data', 'mfusg_test',\n '01A_nestedgrid_nognc')\n fname = os.path.join(pthusgtest, 'flow.disu')\n assert os.path.isfile(fname), 'disu file not found {}'.format(fname)\n\n # Create the model\n m = flopy.modflow.Modflow(modelname='usgload', verbose=True)\n\n # Load the disu file\n disu = flopy.modflow.ModflowDisU.load(fname, m)\n assert isinstance(disu, flopy.modflow.ModflowDisU)\n\n # Change where model files are written\n model_ws = tpth\n m.model_ws = model_ws\n\n # Write the disu file\n disu.write_file()\n assert os.path.isfile(os.path.join(model_ws,\n '{}.{}'.format(m.name,\n m.disu.extension[0])))\n\n # Load disu file\n disu2 = flopy.modflow.ModflowDisU.load(fname, m)\n for (key1, value1), (key2, value2) in zip(disu2.__dict__.items(),\n disu.__dict__.items()):\n if isinstance(value1, flopy.utils.Util2d) or isinstance(value1, flopy.utils.Util3d):\n assert np.array_equal(value1.array, value2.array)\n else:\n assert value1 == value2\n\n return\n\n\ndef test_usg_sms_load():\n\n pthusgtest = os.path.join('..', 'examples', 'data', 'mfusg_test',\n '01A_nestedgrid_nognc')\n fname = os.path.join(pthusgtest, 'flow.sms')\n assert os.path.isfile(fname), 'sms file not found {}'.format(fname)\n\n # Create the model\n m = flopy.modflow.Modflow(modelname='usgload', verbose=True)\n\n # Load the sms file\n sms = flopy.modflow.ModflowSms.load(fname, m)\n assert isinstance(sms, flopy.modflow.ModflowSms)\n\n # Change where model files are written\n model_ws = tpth\n m.model_ws = model_ws\n\n # Write the sms file\n sms.write_file()\n assert os.path.isfile(os.path.join(model_ws,\n '{}.{}'.format(m.name,\n m.sms.extension[0])))\n\n # Load sms file\n sms2 = flopy.modflow.ModflowSms.load(fname, m)\n for (key1, value1), (key2, value2) in zip(sms2.__dict__.items(),\n sms.__dict__.items()):\n assert value1 == value2, 'key1 {}, value 1 {} != key2 {} value 2 {}'.format(key1, value1, key2, value2)\n\n return\n\n\ndef test_usg_model():\n mf = flopy.modflow.Modflow(version='mfusg', structured=True,\n model_ws=tpth, modelname='simple',\n exe_name=v)\n dis = flopy.modflow.ModflowDis(mf, nlay=1, nrow=11, ncol=11)\n bas = flopy.modflow.ModflowBas(mf)\n lpf = flopy.modflow.ModflowLpf(mf)\n wel = flopy.modflow.ModflowWel(mf, stress_period_data={0: [[0, 5, 5, -1.]]})\n ghb = flopy.modflow.ModflowGhb(mf,\n stress_period_data={\n 0: [[0, 0, 0, 1.0, 1000.],\n [0, 9, 9, 0.0, 1000.], ]})\n oc = flopy.modflow.ModflowOc(mf)\n sms = flopy.modflow.ModflowSms(mf, options='complex')\n\n # run with defaults\n mf.write_input()\n if run:\n success, buff = mf.run_model()\n assert success\n\n # try different complexity options; all should run successfully\n for complexity in ['simple', 'moderate', 'complex']:\n print('testing MFUSG with sms complexity: ' + complexity)\n sms = flopy.modflow.ModflowSms(mf, options=complexity)\n sms.write_file()\n if run:\n success, buff = mf.run_model()\n assert success\n\n\nif __name__ == '__main__':\n test_usg_disu_load()\n test_usg_sms_load()\n test_usg_model()\n", "import os\nimport sys\nimport numpy as np\nimport matplotlib.pyplot as plt\n\nimport flopy\n\n\ndef run():\n workspace = os.path.join(\"lake\")\n # make sure workspace directory exists\n if not os.path.exists(workspace):\n os.makedirs(workspace)\n\n fext = \"png\"\n narg = len(sys.argv)\n iarg = 0\n if narg > 1:\n while iarg < narg - 1:\n iarg += 1\n basearg = sys.argv[iarg].lower()\n if basearg == \"--pdf\":\n fext = \"pdf\"\n\n # save the starting path\n cwdpth = os.getcwd()\n\n # change to the working directory\n os.chdir(workspace)\n\n # We are creating a square model with a specified head equal to `h1` along all boundaries.\n # The head at the cell in the center in the top layer is fixed to `h2`. First, set the name\n # of the model and the parameters of the model: the number of layers `Nlay`, the number of rows\n # and columns `N`, lengths of the sides of the model `L`, aquifer thickness `H`, hydraulic\n # conductivity `Kh`\n name = \"lake_example\"\n h1 = 100\n h2 = 90\n Nlay = 10\n N = 101\n L = 400.0\n H = 50.0\n Kh = 1.0\n\n # Create a MODFLOW model and store it (in this case in the variable `ml`, but you can call it\n # whatever you want). The modelname will be the name given to all MODFLOW files (input and output).\n # The exe_name should be the full path to your MODFLOW executable. The version is either 'mf2k'\n # for MODFLOW2000 or 'mf2005'for MODFLOW2005.\n ml = flopy.modflow.Modflow(\n modelname=name, exe_name=\"mf2005\", version=\"mf2005\"\n )\n\n # Define the discretization of the model. All layers are given equal thickness. The `bot` array\n # is build from the `Hlay` values to indicate top and bottom of each layer, and `delrow` and\n # `delcol` are computed from model size `L` and number of cells `N`. Once these are all computed,\n # the Discretization file is built.\n bot = np.linspace(-H / Nlay, -H, Nlay)\n delrow = delcol = L / (N - 1)\n dis = flopy.modflow.ModflowDis(\n ml,\n nlay=Nlay,\n nrow=N,\n ncol=N,\n delr=delrow,\n delc=delcol,\n top=0.0,\n botm=bot,\n laycbd=0,\n )\n\n # Next we specify the boundary conditions and starting heads with the Basic package. The `ibound`\n # array will be `1` in all cells in all layers, except for along the boundary and in the cell at\n # the center in the top layer where it is set to `-1` to indicate fixed heads. The starting heads\n # are used to define the heads in the fixed head cells (this is a steady simulation, so none of\n # the other starting values matter). So we set the starting heads to `h1` everywhere, except for\n # the head at the center of the model in the top layer.\n Nhalf = int((N - 1) / 2)\n ibound = np.ones((Nlay, N, N), dtype=int)\n ibound[:, 0, :] = -1\n ibound[:, -1, :] = -1\n ibound[:, :, 0] = -1\n ibound[:, :, -1] = -1\n ibound[0, Nhalf, Nhalf] = -1\n\n start = h1 * np.ones((N, N))\n start[Nhalf, Nhalf] = h2\n\n # create external ibound array and starting head files\n files = []\n hfile = \"{}_strt.ref\".format(name)\n np.savetxt(hfile, start)\n hfiles = []\n for kdx in range(Nlay):\n file = \"{}_ib{:02d}.ref\".format(name, kdx + 1)\n files.append(file)\n hfiles.append(hfile)\n np.savetxt(file, ibound[kdx, :, :], fmt=\"%5d\")\n\n bas = flopy.modflow.ModflowBas(ml, ibound=files, strt=hfiles)\n\n # The aquifer properties (really only the hydraulic conductivity) are defined with the\n # LPF package.\n lpf = flopy.modflow.ModflowLpf(ml, hk=Kh)\n\n # Finally, we need to specify the solver we want to use (PCG with default values), and the\n # output control (using the default values). Then we are ready to write all MODFLOW input\n # files and run MODFLOW.\n pcg = flopy.modflow.ModflowPcg(ml)\n oc = flopy.modflow.ModflowOc(ml)\n ml.write_input()\n ml.run_model()\n\n # change back to the starting directory\n os.chdir(cwdpth)\n\n # Once the model has terminated normally, we can read the heads file. First, a link to the heads\n # file is created with `HeadFile`. The link can then be accessed with the `get_data` function, by\n # specifying, in this case, the step number and period number for which we want to retrieve data.\n # A three-dimensional array is returned of size `nlay, nrow, ncol`. Matplotlib contouring functions\n # are used to make contours of the layers or a cross-section.\n hds = flopy.utils.HeadFile(os.path.join(workspace, name + \".hds\"))\n h = hds.get_data(kstpkper=(0, 0))\n x = y = np.linspace(0, L, N)\n c = plt.contour(x, y, h[0], np.arange(90, 100.1, 0.2))\n plt.clabel(c, fmt=\"%2.1f\")\n plt.axis(\"scaled\")\n\n outfig = os.path.join(workspace, \"lake1.{0}\".format(fext))\n fig = plt.gcf()\n fig.savefig(outfig, dpi=300)\n print(\"created...\", outfig)\n\n x = y = np.linspace(0, L, N)\n c = plt.contour(x, y, h[-1], np.arange(90, 100.1, 0.2))\n plt.clabel(c, fmt=\"%1.1f\")\n plt.axis(\"scaled\")\n\n outfig = os.path.join(workspace, \"lake2.{0}\".format(fext))\n fig = plt.gcf()\n fig.savefig(outfig, dpi=300)\n print(\"created...\", outfig)\n\n z = np.linspace(-H / Nlay / 2, -H + H / Nlay / 2, Nlay)\n c = plt.contour(x, z, h[:, 50, :], np.arange(90, 100.1, 0.2))\n plt.axis(\"scaled\")\n\n outfig = os.path.join(workspace, \"lake3.{0}\".format(fext))\n fig = plt.gcf()\n fig.savefig(outfig, dpi=300)\n print(\"created...\", outfig)\n\n return 0\n\n\nif __name__ == \"__main__\":\n success = run()\n", "from collections import OrderedDict\nimport math\nimport sys\nimport os\nimport inspect\nimport numpy as np\nfrom ..utils.mfenums import DiscretizationType\nfrom ..data import mfstructure, mfdata\nfrom ..mfbase import MFDataException, ExtFileAction, VerbosityLevel\nfrom .mfstructure import DatumType\nfrom ...utils import datautil\nfrom ...datbase import DataListInterface, DataType\nfrom ...mbase import ModelInterface\nfrom .mffileaccess import MFFileAccessList\nfrom .mfdatastorage import DataStorage, DataStorageType, DataStructureType\nfrom .mfdatautil import to_string, iterable\n\n\nclass MFList(mfdata.MFMultiDimVar, DataListInterface):\n \"\"\"\n Provides an interface for the user to access and update MODFLOW\n scalar data.\n\n Parameters\n ----------\n sim_data : MFSimulationData\n data contained in the simulation\n structure : MFDataStructure\n describes the structure of the data\n data : list or ndarray\n actual data\n enable : bool\n enable/disable the array\n path : tuple\n path in the data dictionary to this MFArray\n dimensions : MFDataDimensions\n dimension information related to the model, package, and array\n\n Attributes\n ----------\n data_type : DataType\n type of data stored in the scalar\n plottable : bool\n if the scalar is plottable\n dtype : numpy.dtype\n the scalar's numpy data type\n data : variable\n calls get_data with default parameters\n\n Methods\n -------\n new_simulation : (sim_data : MFSimulationData)\n initialize MFArray object for a new simulation\n has_data : (layer_num : int) : bool\n Returns whether layer \"layer_num\" has any data associated with it.\n For unlayered data do not pass in \"layer\".\n get_data : (layer_num : int) : ndarray\n Returns the data associated with layer \"layer_num\". If \"layer_num\" is\n None, returns all data.\n set_data : (data : ndarray/list/dict, multiplier : float, layer_num : int)\n Sets the contents of the data at layer \"layer_num\" to \"data\" with\n multiplier \"multiplier\". For unlayered data do not pass in\n \"layer_num\". data can have the following formats:\n 1) ndarray - ndarray containing the datalist\n 2) [(line_one), (line_two), ...] - list where each like of the\n datalist is a tuple within the list\n 3) {'filename':filename, factor=fct, iprn=print_code, data=data}\n - dictionary defining the external file containing the datalist.\n If the data is transient, a dictionary can be used to specify each\n stress period where the dictionary key is <stress period> - 1 and\n the dictionary value is the datalist data defined above:\n {0:ndarray, 1:[(line_one), (line_two), ...], 2:{'filename':filename})\n append_data : (data : list(tuple))\n Appends \"data\" to the end of this list. Assumes data is in a format\n that can be appended directly to a numpy recarray.\n append_list_as_record : (data : list)\n Appends the list \"data\" as a single record in this list's recarray.\n Assumes \"data\" has the correct dimensions.\n update_record : (record : list, key_index : int)\n Updates a record at index \"key_index\" with the contents of \"record\".\n If the index does not exist update_record appends the contents of\n \"record\" to this list's recarray.\n search_data : (search_term : string, col : int)\n Searches the list data at column \"col\" for \"search_term\". If col is\n None search_data searches the entire list.\n load : (first_line : string, file_handle : file descriptor,\n block_header : MFBlockHeader, pre_data_comments : MFComment) :\n tuple (bool, string)\n Loads data from first_line (the first line of data) and open file\n file_handle which is pointing to the second line of data. Returns a\n tuple with the first item indicating whether all data was read\n and the second item being the last line of text read from the file.\n get_file_entry : (layer : int) : string\n Returns a string containing the data in layer \"layer\". For unlayered\n data do not pass in \"layer\".\n store_as_external_file : (external_file_path : str, binary : bool)\n store all data externally in file external_file_path. the binary\n allows storage in a binary file. If replace_existing_external is set\n to False, this method will not do anything if the data is already in\n an external file.\n\n See Also\n --------\n\n Notes\n -----\n\n Examples\n --------\n\n\n \"\"\"\n\n def __init__(\n self,\n sim_data,\n model_or_sim,\n structure,\n data=None,\n enable=True,\n path=None,\n dimensions=None,\n package=None,\n ):\n super().__init__(\n sim_data, model_or_sim, structure, enable, path, dimensions\n )\n try:\n self._data_storage = self._new_storage()\n except Exception as ex:\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n structure.get_model(),\n structure.get_package(),\n path,\n \"creating storage\",\n structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n None,\n sim_data.debug,\n ex,\n )\n self._package = package\n self._last_line_info = []\n self._data_line = None\n self._temp_dict = {}\n self._crnt_line_num = 1\n if data is not None:\n try:\n self.set_data(data, True)\n except Exception as ex:\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n structure.get_model(),\n structure.get_package(),\n path,\n \"setting data\",\n structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n None,\n sim_data.debug,\n ex,\n )\n\n @property\n def data_type(self):\n return DataType.list\n\n @property\n def package(self):\n return self._package\n\n @property\n def dtype(self):\n return self.get_data().dtype\n\n @property\n def plottable(self):\n if self.model is None:\n return False\n else:\n return True\n\n def to_array(self, kper=0, mask=False):\n i0 = 1\n sarr = self.get_data(key=kper)\n if not isinstance(sarr, list):\n sarr = [sarr]\n if len(sarr) == 0 or sarr[0] is None:\n return None\n if \"inode\" in sarr[0].dtype.names:\n raise NotImplementedError()\n arrays = {}\n model_grid = self._data_dimensions.get_model_grid()\n\n if model_grid._grid_type.value == 1:\n shape = (\n model_grid.num_layers(),\n model_grid.num_rows(),\n model_grid.num_columns(),\n )\n elif model_grid._grid_type.value == 2:\n shape = (\n model_grid.num_layers(),\n model_grid.num_cells_per_layer(),\n )\n else:\n shape = (model_grid.num_cells_per_layer(),)\n\n for name in sarr[0].dtype.names[i0:]:\n if not sarr[0].dtype.fields[name][0] == object:\n arr = np.zeros(shape)\n arrays[name] = arr.copy()\n\n if np.isscalar(sarr[0]):\n # if there are no entries for this kper\n if sarr[0] == 0:\n if mask:\n for name, arr in arrays.items():\n arrays[name][:] = np.NaN\n return arrays\n else:\n raise Exception(\"MfList: something bad happened\")\n\n for name, arr in arrays.items():\n cnt = np.zeros(shape, dtype=np.float64)\n for sp_rec in sarr:\n if sp_rec is not None:\n for rec in sp_rec:\n arr[rec[\"cellid\"]] += rec[name]\n cnt[rec[\"cellid\"]] += 1.0\n # average keys that should not be added\n if name != \"cond\" and name != \"flux\":\n idx = cnt > 0.0\n arr[idx] /= cnt[idx]\n if mask:\n arr = np.ma.masked_where(cnt == 0.0, arr)\n arr[cnt == 0.0] = np.NaN\n\n arrays[name] = arr.copy()\n # elif mask:\n # for name, arr in arrays.items():\n # arrays[name][:] = np.NaN\n return arrays\n\n def new_simulation(self, sim_data):\n try:\n super().new_simulation(sim_data)\n self._data_storage = self._new_storage()\n except Exception as ex:\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self._path,\n \"reinitializing\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n None,\n self._simulation_data.debug,\n ex,\n )\n\n self._data_line = None\n\n def store_as_external_file(\n self,\n external_file_path,\n binary=False,\n replace_existing_external=True,\n check_data=True,\n ):\n # only store data externally (do not subpackage info)\n if self.structure.construct_package is None:\n storage = self._get_storage_obj()\n # check if data is already stored external\n if (\n replace_existing_external\n or storage is None\n or storage.layer_storage.first_item().data_storage_type\n == DataStorageType.internal_array\n or storage.layer_storage.first_item().data_storage_type\n == DataStorageType.internal_constant\n ):\n data = self._get_data()\n # if not empty dataset\n if data is not None:\n if (\n self._simulation_data.verbosity_level.value\n >= VerbosityLevel.verbose.value\n ):\n print(\n \"Storing {} to external file {}..\"\n \".\".format(self.structure.name, external_file_path)\n )\n external_data = {\n \"filename\": external_file_path,\n \"data\": data,\n \"binary\": binary,\n }\n self._set_data(external_data, check_data=check_data)\n\n def has_data(self):\n try:\n if self._get_storage_obj() is None:\n return False\n return self._get_storage_obj().has_data()\n except Exception as ex:\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self._path,\n \"checking for data\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n None,\n self._simulation_data.debug,\n ex,\n )\n\n def _get_data(self, apply_mult=False, **kwargs):\n try:\n if self._get_storage_obj() is None:\n return None\n return self._get_storage_obj().get_data()\n except Exception as ex:\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self._path,\n \"getting data\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n None,\n self._simulation_data.debug,\n ex,\n )\n\n def get_data(self, apply_mult=False, **kwargs):\n return self._get_data(apply_mult, **kwargs)\n\n def _get_min_record_entries(self, data=None):\n try:\n if isinstance(data, dict) and \"data\" in data:\n data = data[\"data\"]\n type_list = self._get_storage_obj().build_type_list(\n data=data, min_size=True\n )\n except Exception as ex:\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self._path,\n \"getting min record entries\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n None,\n self._simulation_data.debug,\n ex,\n )\n return len(type_list)\n\n def _set_data(self, data, autofill=False, check_data=True):\n if isinstance(data, dict):\n if \"data\" in data:\n data_check = data[\"data\"]\n else:\n data_check = None\n else:\n data_check = data\n if (\n data_check is None\n or not self._simulation_data.verify_data\n or (isinstance(data_check, list) and len(data_check) == 0)\n ):\n check_data = False\n if iterable(data_check) and check_data:\n # verify data length\n min_line_size = self._get_min_record_entries(data)\n if isinstance(data_check[0], np.record) or (\n iterable(data_check[0]) and not isinstance(data_check[0], str)\n ):\n # data contains multiple records\n for data_line in data_check:\n self._check_line_size(data_line, min_line_size)\n else:\n # data is a single record\n self._check_line_size(data_check, min_line_size)\n # set data\n self._resync()\n try:\n if self._get_storage_obj() is None:\n self._data_storage = self._new_storage()\n # store data\n self._get_storage_obj().set_data(data, autofill=autofill)\n except Exception as ex:\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self._path,\n \"setting data\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n None,\n self._simulation_data.debug,\n ex,\n )\n if check_data and self._simulation_data.verify_data:\n # verify cellids\n self._check_valid_cellids()\n\n def _check_valid_cellids(self):\n # only check packages that are a part of a model\n if isinstance(self._model_or_sim, ModelInterface) and hasattr(\n self._model_or_sim, \"modelgrid\"\n ):\n # get model grid info\n mg = self._get_model_grid()\n if not mg.is_complete:\n return\n idomain = mg.idomain\n model_shape = idomain.shape\n\n # check to see if there are any cellids\n storage_obj = self._get_storage_obj()\n if True in storage_obj.recarray_cellid_list:\n # get data\n data = storage_obj.get_data()\n # check data for invalid cellids\n for index, is_cellid in enumerate(\n storage_obj.resolve_cellidlist(data)\n ):\n if is_cellid:\n for record in data:\n if not isinstance(record[index], tuple):\n # cellids are not always a tuple of integers,\n # like sfr. nothing to check in this case\n break\n idomain_val = idomain\n # cellid should be within the model grid\n for idx, cellid_part in enumerate(record[index]):\n if (\n model_shape[idx] <= cellid_part\n or cellid_part < 0\n ):\n message = (\n \"Cellid {} is outside of the \"\n \"model grid \"\n \"{}\".format(record[index], model_shape)\n )\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self.structure.path,\n \"storing data\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n message,\n self._simulation_data.debug,\n )\n idomain_val = idomain_val[cellid_part]\n # cellid should be at an active cell\n if idomain_val < 1:\n message = (\n \"Cellid {} is outside of the \"\n \"active model grid\"\n \".\".format(record[index])\n )\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self.structure.path,\n \"storing data\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n message,\n self._simulation_data.debug,\n )\n\n def _check_line_size(self, data_line, min_line_size):\n if 0 < len(data_line) < min_line_size:\n message = (\n \"Data line {} only has {} entries, \"\n \"minimum number of entries is \"\n \"{}.\".format(data_line, len(data_line), min_line_size)\n )\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self.structure.path,\n \"storing data\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n message,\n self._simulation_data.debug,\n )\n\n def set_data(self, data, autofill=False, check_data=True):\n self._set_data(data, autofill, check_data=check_data)\n\n def append_data(self, data):\n try:\n self._resync()\n if self._get_storage_obj() is None:\n self._data_storage = self._new_storage()\n # store data\n self._get_storage_obj().append_data(data)\n except Exception as ex:\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self._path,\n \"appending data\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n None,\n self._simulation_data.debug,\n ex,\n )\n\n def append_list_as_record(self, record):\n self._resync()\n try:\n # convert to tuple\n tuple_record = ()\n for item in record:\n tuple_record += (item,)\n # store\n self._get_storage_obj().append_data([tuple_record])\n except Exception as ex:\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self._path,\n \"appending data\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n None,\n self._simulation_data.debug,\n ex,\n )\n\n def update_record(self, record, key_index):\n self.append_list_as_record(record)\n\n def search_data(self, search_term, col=None):\n try:\n data = self._get_storage_obj().get_data()\n if data is not None:\n search_term = search_term.lower()\n for row in data:\n col_num = 0\n for val in row:\n if (\n val is not None\n and val.lower() == search_term\n and (col == None or col == col_num)\n ):\n return (row, col)\n col_num += 1\n return None\n except Exception as ex:\n type_, value_, traceback_ = sys.exc_info()\n if col is None:\n col = \"\"\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self._path,\n \"searching for data\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n \"search_term={}\\ncol={}\".format(search_term, col),\n self._simulation_data.debug,\n ex,\n )\n\n def get_file_entry(\n self,\n values_only=False,\n ext_file_action=ExtFileAction.copy_relative_paths,\n ):\n return self._get_file_entry(values_only, ext_file_action)\n\n def _get_file_entry(\n self,\n values_only=False,\n ext_file_action=ExtFileAction.copy_relative_paths,\n ):\n try:\n # freeze model grid to boost performance\n self._data_dimensions.lock()\n # init\n indent = self._simulation_data.indent_string\n file_entry = []\n storage = self._get_storage_obj()\n if storage is None or not storage.has_data():\n return \"\"\n\n # write out initial comments\n if storage.pre_data_comments:\n file_entry.append(storage.pre_data_comments.get_file_entry())\n except Exception as ex:\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self._path,\n \"get file entry initialization\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n None,\n self._simulation_data.debug,\n ex,\n )\n\n if (\n storage.layer_storage.first_item().data_storage_type\n == DataStorageType.external_file\n ):\n try:\n ext_string = self._get_external_formatting_string(\n 0, ext_file_action\n )\n file_entry.append(\"{}{}{}\".format(indent, indent, ext_string))\n # write file\n\n except Exception as ex:\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self._path,\n \"formatting external file string\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n None,\n self._simulation_data.debug,\n ex,\n )\n else:\n try:\n data_complete = storage.get_data()\n if (\n storage.layer_storage.first_item().data_storage_type\n == DataStorageType.internal_constant\n ):\n data_lines = 1\n else:\n data_lines = len(data_complete)\n except Exception as ex:\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self._path,\n \"getting data from storage\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n None,\n self._simulation_data.debug,\n ex,\n )\n\n # loop through list line by line - assumes first data_item size\n # is representative\n self._crnt_line_num = 1\n for mflist_line in range(0, data_lines):\n text_line = []\n index = 0\n self._get_file_entry_record(\n data_complete,\n mflist_line,\n text_line,\n index,\n self.structure,\n storage,\n indent,\n )\n\n # include comments\n if (\n mflist_line in storage.comments\n and storage.comments[mflist_line].text\n ):\n text_line.append(storage.comments[mflist_line].text)\n\n file_entry.append(\n \"{}{}\\n\".format(indent, indent.join(text_line))\n )\n self._crnt_line_num += 1\n\n # unfreeze model grid\n self._data_dimensions.unlock()\n return \"\".join(file_entry)\n\n def _get_file_entry_record(\n self,\n data_complete,\n mflist_line,\n text_line,\n index,\n data_set,\n storage,\n indent,\n ):\n if (\n storage.layer_storage.first_item().data_storage_type\n == DataStorageType.internal_constant\n ):\n try:\n # constant data\n data_type = self.structure.data_item_structures[1].type\n const_str = self._get_constant_formatting_string(\n storage.get_const_val(0), 0, data_type, \"\"\n )\n text_line.append(\n \"{}{}{}\".format(indent, indent, const_str.upper())\n )\n except Exception as ex:\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self._path,\n \"getting constant data\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n None,\n self._simulation_data.debug,\n ex,\n )\n else:\n data_dim = self._data_dimensions\n data_line = data_complete[mflist_line]\n for data_item in data_set.data_item_structures:\n if data_item.is_aux:\n try:\n aux_var_names = (\n data_dim.package_dim.get_aux_variables()\n )\n if aux_var_names is not None:\n for aux_var_name in aux_var_names[0]:\n if aux_var_name.lower() != \"auxiliary\":\n data_val = data_line[index]\n if data_val is not None:\n text_line.append(\n to_string(\n data_val,\n data_item.type,\n self._simulation_data,\n self._data_dimensions,\n data_item.is_cellid,\n data_item.possible_cellid,\n data_item,\n self._simulation_data.verify_data,\n )\n )\n index += 1\n except Exception as ex:\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self._path,\n \"processing auxiliary \" \"variables\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n None,\n self._simulation_data.debug,\n ex,\n )\n elif data_item.type == DatumType.record:\n # record within a record, recurse\n self._get_file_entry_record(\n data_complete,\n mflist_line,\n text_line,\n index,\n data_item,\n storage,\n indent,\n )\n elif (\n not data_item.is_boundname\n or data_dim.package_dim.boundnames()\n ) and (\n not data_item.optional\n or data_item.name_length < 5\n or not data_item.is_mname\n or not storage.in_model\n ):\n data_complete_len = len(data_line)\n if data_complete_len <= index:\n if data_item.optional == False:\n message = (\n \"Not enough data provided \"\n \"for {}. Data for required data \"\n 'item \"{}\" not '\n \"found (data path: {})\"\n \".\".format(\n self.structure.name,\n data_item.name,\n self._path,\n )\n )\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self._path,\n \"building file entry record\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n message,\n self._simulation_data.debug,\n )\n else:\n break\n try:\n # resolve size of data\n resolved_shape, shape_rule = data_dim.get_data_shape(\n data_item,\n self.structure,\n [data_line],\n repeating_key=self._current_key,\n )\n data_val = data_line[index]\n if data_item.is_cellid or (\n data_item.possible_cellid\n and storage._validate_cellid([data_val], 0)\n ):\n if (\n data_item.shape is not None\n and len(data_item.shape) > 0\n and data_item.shape[0] == \"ncelldim\"\n ):\n model_grid = data_dim.get_model_grid()\n cellid_size = (\n model_grid.get_num_spatial_coordinates()\n )\n data_item.remove_cellid(\n resolved_shape, cellid_size\n )\n data_size = 1\n if len(\n resolved_shape\n ) == 1 and datautil.DatumUtil.is_int(\n resolved_shape[0]\n ):\n data_size = int(resolved_shape[0])\n if data_size < 0:\n # unable to resolve data size based on shape, use\n # the data heading names to resolve data size\n data_size = storage.resolve_data_size(index)\n except Exception as ex:\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self._path,\n \"resolving data shape\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n \"Verify that your data is the \" \"correct shape\",\n self._simulation_data.debug,\n ex,\n )\n for data_index in range(0, data_size):\n if data_complete_len > index:\n data_val = data_line[index]\n if data_item.type == DatumType.keyword:\n if data_val is not None:\n text_line.append(data_item.display_name)\n if self.structure.block_variable:\n # block variables behave differently for\n # now. this needs to be resolved\n # more consistently at some point\n index += 1\n elif data_item.type == DatumType.keystring:\n if data_val is not None:\n text_line.append(data_val)\n index += 1\n\n # keystring must be at the end of the line so\n # everything else is part of the keystring data\n data_key = data_val.lower()\n if data_key not in data_item.keystring_dict:\n keystr_struct = data_item.keystring_dict[\n \"{}record\".format(data_key)\n ]\n else:\n keystr_struct = data_item.keystring_dict[\n data_key\n ]\n if isinstance(\n keystr_struct, mfstructure.MFDataStructure\n ):\n # data items following keystring\n ks_structs = (\n keystr_struct.data_item_structures[1:]\n )\n else:\n # key string stands alone\n ks_structs = [keystr_struct]\n ks_struct_index = 0\n max_index = len(ks_structs) - 1\n for data_index in range(\n index, data_complete_len\n ):\n if data_line[data_index] is not None:\n try:\n k_data_item = ks_structs[\n ks_struct_index\n ]\n text_line.append(\n to_string(\n data_line[data_index],\n k_data_item.type,\n self._simulation_data,\n self._data_dimensions,\n k_data_item.is_cellid,\n k_data_item.possible_cellid,\n k_data_item,\n self._simulation_data.verify_data,\n )\n )\n except Exception as ex:\n message = (\n \"An error occurred \"\n \"while converting data \"\n \"to a string. This \"\n \"error occurred while \"\n 'processing \"{}\" line '\n '{} data item \"{}\".'\n \"(data path: {})\"\n \".\".format(\n self.structure.name,\n data_item.name,\n self._crnt_line_num,\n self._path,\n )\n )\n (\n type_,\n value_,\n traceback_,\n ) = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self._path,\n \"converting data \"\n \"to a string\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n message,\n self._simulation_data.debug,\n ex,\n )\n if ks_struct_index < max_index:\n # increment until last record\n # entry then repeat last entry\n ks_struct_index += 1\n index = data_index\n elif data_val is not None and (\n not isinstance(data_val, float)\n or not math.isnan(data_val)\n ):\n try:\n if data_item.tagged and data_index == 0:\n # data item tagged, include data item name\n # as a keyword\n text_line.append(\n to_string(\n data_val,\n DatumType.string,\n self._simulation_data,\n self._data_dimensions,\n False,\n data_item=data_item,\n verify_data=self._simulation_data.verify_data,\n )\n )\n index += 1\n data_val = data_line[index]\n text_line.append(\n to_string(\n data_val,\n data_item.type,\n self._simulation_data,\n self._data_dimensions,\n data_item.is_cellid,\n data_item.possible_cellid,\n data_item,\n self._simulation_data.verify_data,\n )\n )\n except Exception as ex:\n message = (\n \"An error occurred while \"\n \"converting data to a \"\n \"string. \"\n \"This error occurred while \"\n 'processing \"{}\" line {} data '\n 'item \"{}\".(data path: {})'\n \".\".format(\n self.structure.name,\n data_item.name,\n self._crnt_line_num,\n self._path,\n )\n )\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self._path,\n \"converting data \" \"to a string\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n message,\n self._simulation_data.debug,\n ex,\n )\n index += 1\n elif not data_item.optional and shape_rule is None:\n message = (\n \"Not enough data provided \"\n \"for {}. Data for required data \"\n 'item \"{}\" not '\n \"found (data path: {})\"\n \".\".format(\n self.structure.name,\n data_item.name,\n self._path,\n )\n )\n type_, value_, traceback_ = sys.exc_info()\n raise MFDataException(\n self.structure.get_model(),\n self.structure.get_package(),\n self._path,\n \"building data line\",\n self.structure.name,\n inspect.stack()[0][3],\n type_,\n value_,\n traceback_,\n message,\n self._simulation_data.debug,\n )\n\n def load(\n self,\n first_line,\n file_handle,\n block_header,\n pre_data_comments=None,\n external_file_info=None,\n ):\n super().load(\n first_line, file_handle, block_header, pre_data_comments=None\n )\n self._resync()\n file_access = MFFileAccessList(\n self.structure,\n self._data_dimensions,\n self._simulation_data,\n self._path,\n self._current_key,\n )\n storage = self._get_storage_obj()\n result = file_access.load_from_package(\n first_line, file_handle, storage, pre_data_comments\n )\n if external_file_info is not None:\n storage.point_to_existing_external_file(external_file_info, 0)\n return result\n\n def _new_storage(self, stress_period=0):\n return DataStorage(\n self._simulation_data,\n self._model_or_sim,\n self._data_dimensions,\n self._get_file_entry,\n DataStorageType.internal_array,\n DataStructureType.recarray,\n stress_period=stress_period,\n data_path=self._path,\n )\n\n def _get_storage_obj(self):\n return self._data_storage\n\n def plot(\n self,\n key=None,\n names=None,\n filename_base=None,\n file_extension=None,\n mflay=None,\n **kwargs\n ):\n \"\"\"\n Plot boundary condition (MfList) data\n\n Parameters\n ----------\n key : str\n MfList dictionary key. (default is None)\n names : list\n List of names for figure titles. (default is None)\n filename_base : str\n Base file name that will be used to automatically generate file\n names for output image files. Plots will be exported as image\n files if file_name_base is not None. (default is None)\n file_extension : str\n Valid matplotlib.pyplot file extension for savefig(). Only used\n if filename_base is not None. (default is 'png')\n mflay : int\n MODFLOW zero-based layer number to return. If None, then all\n all layers will be included. (default is None)\n **kwargs : dict\n axes : list of matplotlib.pyplot.axis\n List of matplotlib.pyplot.axis that will be used to plot\n data for each layer. If axes=None axes will be generated.\n (default is None)\n pcolor : bool\n Boolean used to determine if matplotlib.pyplot.pcolormesh\n plot will be plotted. (default is True)\n colorbar : bool\n Boolean used to determine if a color bar will be added to\n the matplotlib.pyplot.pcolormesh. Only used if pcolor=True.\n (default is False)\n inactive : bool\n Boolean used to determine if a black overlay in inactive\n cells in a layer will be displayed. (default is True)\n contour : bool\n Boolean used to determine if matplotlib.pyplot.contour\n plot will be plotted. (default is False)\n clabel : bool\n Boolean used to determine if matplotlib.pyplot.clabel\n will be plotted. Only used if contour=True. (default is False)\n grid : bool\n Boolean used to determine if the model grid will be plotted\n on the figure. (default is False)\n masked_values : list\n List of unique values to be excluded from the plot.\n\n Returns\n ----------\n out : list\n Empty list is returned if filename_base is not None. Otherwise\n a list of matplotlib.pyplot.axis is returned.\n \"\"\"\n from flopy.plot import PlotUtilities\n\n if not self.plottable:\n raise TypeError(\"Simulation level packages are not plottable\")\n\n if \"cellid\" not in self.dtype.names:\n return\n\n PlotUtilities._plot_mflist_helper(\n mflist=self,\n key=key,\n kper=None,\n names=names,\n filename_base=None,\n file_extension=None,\n mflay=None,\n **kwargs\n )\n\n\nclass MFTransientList(MFList, mfdata.MFTransient, DataListInterface):\n \"\"\"\n Provides an interface for the user to access and update MODFLOW transient\n list data.\n\n Parameters\n ----------\n sim_data : MFSimulationData\n data contained in the simulation\n structure : MFDataStructure\n describes the structure of the data\n data : list or ndarray\n actual data\n enable : bool\n enable/disable the array\n path : tuple\n path in the data dictionary to this MFArray\n dimensions : MFDataDimensions\n dimension information related to the model, package, and array\n\n Methods\n -------\n add_transient_key : (transient_key : int)\n Adds a new transient time allowing data for that time to be stored and\n retrieved using the key \"transient_key\"\n add_one :(transient_key : int)\n Adds one to the data stored at key \"transient_key\"\n get_data : (key : int) : ndarray\n Returns the data during time \"key\".\n set_data : (data : ndarray/list, multiplier : float, key : int)\n Sets the contents of the data at time \"key\" to \"data\" with\n multiplier \"multiplier\".\n load : (first_line : string, file_handle : file descriptor,\n block_header : MFBlockHeader, pre_data_comments : MFComment) :\n tuple (bool, string)\n Loads data from first_line (the first line of data) and open file\n file_handle which is pointing to the second line of data. Returns a\n tuple with the first item indicating whether all data was read\n and the second item being the last line of text read from the file.\n get_file_entry : (key : int) : string\n Returns a string containing the data at time \"key\".\n append_list_as_record : (data : list, key : int)\n Appends the list \"data\" as a single record in this list's recarray at\n time \"key\". Assumes \"data\" has the correct dimensions.\n update_record : (record : list, key_index : int, key : int)\n Updates a record at index \"key_index\" and time \"key\" with the contents\n of \"record\". If the index does not exist update_record appends the\n contents of \"record\" to this list's recarray.\n See Also\n --------\n\n Notes\n -----\n\n Examples\n --------\n\n\n \"\"\"\n\n def __init__(\n self,\n sim_data,\n model_or_sim,\n structure,\n enable=True,\n path=None,\n dimensions=None,\n package=None,\n ):\n super().__init__(\n sim_data=sim_data,\n model_or_sim=model_or_sim,\n structure=structure,\n data=None,\n enable=enable,\n path=path,\n dimensions=dimensions,\n package=package,\n )\n self._transient_setup(self._data_storage)\n self.repeating = True\n self.empty_keys = {}\n\n @property\n def data_type(self):\n return DataType.transientlist\n\n @property\n def dtype(self):\n data = self.get_data()\n if len(data) > 0:\n return data[0].dtype\n else:\n return None\n\n @property\n def masked_4D_arrays(self):\n model_grid = self._data_dimensions.get_model_grid()\n nper = self._data_dimensions.package_dim.model_dim[\n 0\n ].simulation_time.get_num_stress_periods()\n # get the first kper\n arrays = self.to_array(kper=0, mask=True)\n\n if arrays is not None:\n # initialize these big arrays\n if model_grid.grid_type() == DiscretizationType.DIS:\n m4ds = {}\n for name, array in arrays.items():\n m4d = np.zeros(\n (\n nper,\n model_grid.num_layers,\n model_grid.num_rows,\n model_grid.num_columns,\n )\n )\n m4d[0, :, :, :] = array\n m4ds[name] = m4d\n for kper in range(1, nper):\n arrays = self.to_array(kper=kper, mask=True)\n for name, array in arrays.items():\n m4ds[name][kper, :, :, :] = array\n return m4ds\n else:\n m3ds = {}\n for name, array in arrays.items():\n m3d = np.zeros(\n (\n nper,\n model_grid.num_layers,\n model_grid.num_cells_per_layer(),\n )\n )\n m3d[0, :, :] = array\n m3ds[name] = m3d\n for kper in range(1, nper):\n arrays = self.to_array(kper=kper, mask=True)\n for name, array in arrays.items():\n m3ds[name][kper, :, :] = array\n return m3ds\n\n def masked_4D_arrays_itr(self):\n model_grid = self._data_dimensions.get_model_grid()\n nper = self._data_dimensions.package_dim.model_dim[\n 0\n ].simulation_time.get_num_stress_periods()\n # get the first kper\n arrays = self.to_array(kper=0, mask=True)\n\n if arrays is not None:\n # initialize these big arrays\n for name, array in arrays.items():\n if model_grid.grid_type() == DiscretizationType.DIS:\n m4d = np.zeros(\n (\n nper,\n model_grid.num_layers(),\n model_grid.num_rows(),\n model_grid.num_columns(),\n )\n )\n m4d[0, :, :, :] = array\n for kper in range(1, nper):\n arrays = self.to_array(kper=kper, mask=True)\n for tname, array in arrays.items():\n if tname == name:\n m4d[kper, :, :, :] = array\n yield name, m4d\n else:\n m3d = np.zeros(\n (\n nper,\n model_grid.num_layers(),\n model_grid.num_cells_per_layer(),\n )\n )\n m3d[0, :, :] = array\n for kper in range(1, nper):\n arrays = self.to_array(kper=kper, mask=True)\n for tname, array in arrays.items():\n if tname == name:\n m3d[kper, :, :] = array\n yield name, m3d\n\n def to_array(self, kper=0, mask=False):\n return super().to_array(kper, mask)\n\n def remove_transient_key(self, transient_key):\n if transient_key in self._data_storage:\n del self._data_storage[transient_key]\n\n def add_transient_key(self, transient_key):\n super().add_transient_key(transient_key)\n if isinstance(transient_key, int):\n stress_period = transient_key\n else:\n stress_period = 1\n self._data_storage[transient_key] = super()._new_storage(stress_period)\n\n @property\n def data(self):\n return self.get_data()\n\n def store_as_external_file(\n self,\n external_file_path,\n binary=False,\n replace_existing_external=True,\n check_data=True,\n ):\n self._cache_model_grid = True\n sim_time = self._data_dimensions.package_dim.model_dim[\n 0\n ].simulation_time\n num_sp = sim_time.get_num_stress_periods()\n for sp in range(0, num_sp):\n if sp in self._data_storage:\n self._current_key = sp\n layer_storage = self._get_storage_obj().layer_storage\n if (\n layer_storage.get_total_size() > 0\n and self._get_storage_obj()\n .layer_storage[0]\n .layer_storage_type\n != DataStorageType.external_file\n ):\n fname, ext = os.path.splitext(external_file_path)\n full_name = \"{}_{}{}\".format(fname, sp + 1, ext)\n super().store_as_external_file(\n full_name,\n binary,\n replace_existing_external,\n check_data,\n )\n self._cache_model_grid = False\n\n def get_data(self, key=None, apply_mult=False, **kwargs):\n if self._data_storage is not None and len(self._data_storage) > 0:\n if key is None:\n if \"array\" in kwargs:\n output = []\n sim_time = self._data_dimensions.package_dim.model_dim[\n 0\n ].simulation_time\n num_sp = sim_time.get_num_stress_periods()\n for sp in range(0, num_sp):\n if sp in self._data_storage:\n self.get_data_prep(sp)\n output.append(\n super().get_data(apply_mult=apply_mult)\n )\n else:\n output.append(None)\n return output\n else:\n output = {}\n for key in self._data_storage.keys():\n self.get_data_prep(key)\n output[key] = super().get_data(apply_mult=apply_mult)\n return output\n self.get_data_prep(key)\n return super().get_data(apply_mult=apply_mult)\n else:\n return None\n\n def set_data(self, data, key=None, autofill=False):\n self._cache_model_grid = True\n if isinstance(data, dict) or isinstance(data, OrderedDict):\n if \"filename\" not in data:\n # each item in the dictionary is a list for one stress period\n # the dictionary key is the stress period the list is for\n del_keys = []\n for key, list_item in data.items():\n if list_item is None:\n self.remove_transient_key(key)\n del_keys.append(key)\n self.empty_keys[key] = False\n elif isinstance(list_item, list) and len(list_item) == 0:\n self.empty_keys[key] = True\n else:\n self.empty_keys[key] = False\n if \"check\" in list_item:\n check = list_item[\"check\"]\n else:\n check = True\n self._set_data_prep(list_item, key)\n super().set_data(\n list_item, autofill=autofill, check_data=check\n )\n for key in del_keys:\n del data[key]\n else:\n self.empty_keys[key] = False\n self._set_data_prep(data[\"data\"], key)\n super().set_data(data, autofill)\n else:\n if key is None:\n # search for a key\n new_key_index = self.structure.first_non_keyword_index()\n if new_key_index is not None and len(data) > new_key_index:\n key = data[new_key_index]\n else:\n key = 0\n if isinstance(data, list) and len(data) == 0:\n self.empty_keys[key] = True\n else:\n self.empty_keys[key] = False\n if data is None:\n self.remove_transient_key(key)\n else:\n self._set_data_prep(data, key)\n super().set_data(data, autofill)\n self._cache_model_grid = False\n\n def get_file_entry(\n self, key=0, ext_file_action=ExtFileAction.copy_relative_paths\n ):\n if key in self.empty_keys and self.empty_keys[key] == True:\n return \"\"\n else:\n self._get_file_entry_prep(key)\n return super().get_file_entry(ext_file_action=ext_file_action)\n\n def load(\n self,\n first_line,\n file_handle,\n block_header,\n pre_data_comments=None,\n external_file_info=None,\n ):\n self._load_prep(block_header)\n return super().load(\n first_line,\n file_handle,\n block_header,\n pre_data_comments,\n external_file_info,\n )\n\n def append_list_as_record(self, record, key=0):\n self._append_list_as_record_prep(record, key)\n super().append_list_as_record(record)\n\n def update_record(self, record, key_index, key=0):\n self._update_record_prep(key)\n super().update_record(record, key_index)\n\n def _new_storage(self, stress_period=0):\n return OrderedDict()\n\n def _get_storage_obj(self):\n if (\n self._current_key is None\n or self._current_key not in self._data_storage\n ):\n return None\n return self._data_storage[self._current_key]\n\n def plot(\n self,\n key=None,\n names=None,\n kper=0,\n filename_base=None,\n file_extension=None,\n mflay=None,\n **kwargs\n ):\n \"\"\"\n Plot stress period boundary condition (MfList) data for a specified\n stress period\n\n Parameters\n ----------\n key : str\n MfList dictionary key. (default is None)\n names : list\n List of names for figure titles. (default is None)\n kper : int\n MODFLOW zero-based stress period number to return. (default is zero)\n filename_base : str\n Base file name that will be used to automatically generate file\n names for output image files. Plots will be exported as image\n files if file_name_base is not None. (default is None)\n file_extension : str\n Valid matplotlib.pyplot file extension for savefig(). Only used\n if filename_base is not None. (default is 'png')\n mflay : int\n MODFLOW zero-based layer number to return. If None, then all\n all layers will be included. (default is None)\n **kwargs : dict\n axes : list of matplotlib.pyplot.axis\n List of matplotlib.pyplot.axis that will be used to plot\n data for each layer. If axes=None axes will be generated.\n (default is None)\n pcolor : bool\n Boolean used to determine if matplotlib.pyplot.pcolormesh\n plot will be plotted. (default is True)\n colorbar : bool\n Boolean used to determine if a color bar will be added to\n the matplotlib.pyplot.pcolormesh. Only used if pcolor=True.\n (default is False)\n inactive : bool\n Boolean used to determine if a black overlay in inactive\n cells in a layer will be displayed. (default is True)\n contour : bool\n Boolean used to determine if matplotlib.pyplot.contour\n plot will be plotted. (default is False)\n clabel : bool\n Boolean used to determine if matplotlib.pyplot.clabel\n will be plotted. Only used if contour=True. (default is False)\n grid : bool\n Boolean used to determine if the model grid will be plotted\n on the figure. (default is False)\n masked_values : list\n List of unique values to be excluded from the plot.\n\n Returns\n ----------\n out : list\n Empty list is returned if filename_base is not None. Otherwise\n a list of matplotlib.pyplot.axis is returned.\n \"\"\"\n from flopy.plot import PlotUtilities\n\n if not self.plottable:\n raise TypeError(\"Simulation level packages are not plottable\")\n\n # model.plot() will not work for a mf6 model oc package unless\n # this check is here\n if self.get_data() is None:\n return\n\n if \"cellid\" not in self.dtype.names:\n return\n\n axes = PlotUtilities._plot_mflist_helper(\n self,\n key=key,\n names=names,\n kper=kper,\n filename_base=filename_base,\n file_extension=file_extension,\n mflay=mflay,\n **kwargs\n )\n return axes\n\n\nclass MFMultipleList(MFTransientList):\n \"\"\"\n Provides an interface for the user to access and update MODFLOW multiple\n list data. This is list data that is in the same format as the\n MFTransientList, but is not time based.\n\n Parameters\n ----------\n sim_data : MFSimulationData\n data contained in the simulation\n structure : MFDataStructure\n describes the structure of the data\n data : list or ndarray\n actual data\n enable : bool\n enable/disable the array\n path : tuple\n path in the data dictionary to this MFArray\n dimensions : MFDataDimensions\n dimension information related to the model, package, and array\n\n See Also\n --------\n\n Notes\n -----\n\n Examples\n --------\n\n\n \"\"\"\n\n def __init__(\n self,\n sim_data,\n model_or_sim,\n structure,\n enable=True,\n path=None,\n dimensions=None,\n package=None,\n ):\n super().__init__(\n sim_data=sim_data,\n model_or_sim=model_or_sim,\n structure=structure,\n enable=enable,\n path=path,\n dimensions=dimensions,\n package=package,\n )\n\n def get_data(self, key=None, apply_mult=False, **kwargs):\n return super().get_data(key=key, apply_mult=apply_mult, **kwargs)\n" ]
[ [ "numpy.array_equal" ], [ "matplotlib.pyplot.clabel", "numpy.linspace", "numpy.arange", "numpy.ones", "matplotlib.pyplot.gcf", "matplotlib.pyplot.axis", "numpy.savetxt" ], [ "numpy.ma.masked_where", "numpy.zeros", "numpy.isscalar" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
iliasprc/CVPR21Chal-SLR
[ "9d0c9a593d2c4bbfd69eff040b84e9f0538740fb" ]
[ "Conv3D/Sign_Isolated_Conv3D_hha_clip_mask.py" ]
[ "import os\nimport sys\nfrom datetime import datetime\nimport logging\nimport torch\nimport torch.nn as nn\nimport torch.nn.functional as F\nimport torch.optim as optim\nfrom torch.utils.data import DataLoader, random_split\nfrom torch.utils.tensorboard import SummaryWriter\nimport torchvision.transforms as transforms\nfrom models.Conv3D import r2plus1d_18\nfrom dataset_sign_clip import Sign_Isolated\nfrom train import train_epoch\nfrom validation_clip import val_epoch\nfrom collections import OrderedDict\n\nclass LabelSmoothingCrossEntropy(nn.Module):\n def __init__(self):\n super(LabelSmoothingCrossEntropy, self).__init__()\n def forward(self, x, target, smoothing=0.1):\n confidence = 1. - smoothing\n logprobs = F.log_softmax(x, dim=-1)\n nll_loss = -logprobs.gather(dim=-1, index=target.unsqueeze(1))\n nll_loss = nll_loss.squeeze(1)\n smooth_loss = -logprobs.mean(dim=-1)\n loss = confidence * nll_loss + smoothing * smooth_loss\n return loss.mean()\n\n# Path setting\nexp_name = 'hha_final'\ndata_path = \"../data/train_hha_2_mask\"\ndata_path2 = \"../data/val_hha_2_mask\"\nlabel_train_path = \"data/train_labels.csv\"\nlabel_val_path = \"data/val_gt.csv\"\nmodel_path = \"checkpoint/{}\".format(exp_name)\nif not os.path.exists(model_path):\n os.mkdir(model_path)\nif not os.path.exists(os.path.join('results', exp_name)):\n os.mkdir(os.path.join('results', exp_name))\nlog_path = \"log/sign_resnet2d+1_{}_{:%Y-%m-%d_%H-%M-%S}.log\".format(exp_name, datetime.now())\nsum_path = \"runs/sign_resnet2d+1_{}_{:%Y-%m-%d_%H-%M-%S}\".format(exp_name, datetime.now())\nphase = 'Train'\n# Log to file & tensorboard writer\nlogging.basicConfig(level=logging.INFO, format='%(message)s', handlers=[logging.FileHandler(log_path), logging.StreamHandler()])\nlogger = logging.getLogger('SLR')\nlogger.info('Logging to file...')\nwriter = SummaryWriter(sum_path)\n\n# Use specific gpus\n# os.environ[\"CUDA_VISIBLE_DEVICES\"]=\"0,1,2,3,4,5,6,7\"\nos.environ[\"CUDA_VISIBLE_DEVICES\"]=\"0,1,2,3\"\n# Device setting\ndevice = torch.device(\"cuda\" if torch.cuda.is_available() else \"cpu\")\n\n# Hyperparams\nnum_classes = 226 #100\nepochs = 100\n# batch_size = 16\nbatch_size = 48\nlearning_rate = 1e-3 #1e-3 Train 1e-4 Finetune\nweight_decay = 1e-4\nlog_interval = 80\nsample_size = 128\nsample_duration = 32\nattention = False\ndrop_p = 0.0\nhidden1, hidden2 = 512, 256\n\ndef get_lr(optimizer):\n for param_group in optimizer.param_groups:\n return param_group['lr']\n\n# Train with 3DCNN\nif __name__ == '__main__':\n # Load data\n transform = transforms.Compose([transforms.Resize([sample_size, sample_size]),\n transforms.ToTensor(),\n transforms.Normalize(mean=[0.5], std=[0.5])])\n train_set = Sign_Isolated(data_path=data_path, label_path=label_train_path, frames=sample_duration,\n num_classes=num_classes, train=True, transform=transform)\n val_set = Sign_Isolated(data_path=data_path2, label_path=label_val_path, frames=sample_duration,\n num_classes=num_classes, train=False, transform=transform)\n logger.info(\"Dataset samples: {}\".format(len(train_set)+len(val_set)))\n train_loader = DataLoader(train_set, batch_size=batch_size, shuffle=True, num_workers=48, pin_memory=True)\n val_loader = DataLoader(val_set, batch_size=batch_size, shuffle=False, num_workers=48, pin_memory=True)\n # Create model\n model = r2plus1d_18(pretrained=True, num_classes=226)\n # load pretrained\n # checkpoint = torch.load('pretrained/slr_resnet2d+1_epoch016.pth')\n # new_state_dict = OrderedDict()\n # for k, v in checkpoint.items():\n # name = k[7:] # remove 'module.'\n # new_state_dict[name]=v\n # model.load_state_dict(new_state_dict)\n # if phase == 'Train':\n # model.fc1 = nn.Linear(model.fc1.in_features, num_classes)\n print(model)\n \n model = model.to(device)\n # Run the model parallelly\n if torch.cuda.device_count() > 1:\n logger.info(\"Using {} GPUs\".format(torch.cuda.device_count()))\n model = nn.DataParallel(model)\n # Create loss criterion & optimizer\n # criterion = nn.CrossEntropyLoss()\n criterion = LabelSmoothingCrossEntropy()\n optimizer = optim.Adam(model.parameters(), lr=learning_rate, weight_decay=weight_decay)\n scheduler = torch.optim.lr_scheduler.ReduceLROnPlateau(optimizer, mode='min', factor=0.1, patience=10, threshold=0.0001)\n\n # Start training\n \n if phase == 'Train':\n logger.info(\"Training Started\".center(60, '#'))\n for epoch in range(epochs):\n print('lr: ', get_lr(optimizer))\n # Train the model\n train_epoch(model, criterion, optimizer, train_loader, device, epoch, logger, log_interval, writer)\n\n # Validate the model\n val_loss = val_epoch(model, criterion, val_loader, device, epoch, logger, writer)\n scheduler.step(val_loss)\n \n # Save model\n torch.save(model.state_dict(), os.path.join(model_path, \"sign_resnet2d+1_epoch{:03d}.pth\".format(epoch+1)))\n logger.info(\"Epoch {} Model Saved\".format(epoch+1).center(60, '#'))\n elif phase == 'Test':\n logger.info(\"Testing Started\".center(60, '#'))\n val_loss = val_epoch(model, criterion, val_loader, device, 0, logger, writer, phase=phase, exp_name=exp_name)\n\n logger.info(\"Finished\".center(60, '#'))\n" ]
[ [ "torch.optim.lr_scheduler.ReduceLROnPlateau", "torch.nn.functional.log_softmax", "torch.utils.data.DataLoader", "torch.nn.DataParallel", "torch.utils.tensorboard.SummaryWriter", "torch.cuda.is_available", "torch.cuda.device_count" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
MouseHu/emdqn
[ "ba907e959f21dd0b5a17117accccae9c82a79a3b", "ba907e959f21dd0b5a17117accccae9c82a79a3b" ]
[ "baselines/deepq/experiments/atari/train_modelbased.py", "baselines/deepq/experiments/atari/train_mfmc.py" ]
[ "import argparse\nimport gym\nimport numpy as np\nimport os\nimport tensorflow as tf\nimport tempfile\nimport time\n\nimport sys\n\ncwd = os.getcwd()\ncwd = '/'.join(cwd.split('/')[:-4])\ntemp = sys.path\ntemp.append('')\ntemp[1:] = temp[0:-1]\ntemp[0] = cwd\nprint(sys.path)\n\nfrom baselines.deepq.dqn_utils import *\nimport baselines.common.tf_util as U\nimport datetime\nfrom baselines import logger\nfrom baselines import deepq\nfrom baselines.deepq.replay_buffer import ReplayBufferContra, PrioritizedReplayBuffer\nfrom baselines.common.misc_util import (\n boolean_flag,\n pickle_load,\n pretty_eta,\n relatively_safe_pickle_dump,\n set_global_seeds,\n RunningAvg,\n SimpleMonitor\n)\nfrom baselines.common.schedules import LinearSchedule, PiecewiseSchedule\n# when updating this to non-deperecated ones, it is important to\n# copy over LazyFrames\nfrom baselines.common.atari_wrappers_deprecated import wrap_dqn\nfrom baselines.common.azure_utils import Container\nfrom baselines.deepq.experiments.atari.model import contrastive_model, rp_model, modelbased_model\n# from baselines.deepq.experiments.atari.lru_knn_ucb import LRU_KNN_UCB\nfrom baselines.deepq.experiments.atari.lru_knn_ucb import LRU_KNN_UCB\nfrom baselines.common.atari_lib import create_atari_environment\n\n\n# from gym.wrappers.monitoring.video_recorder import VideoRecorder\n\n\ndef parse_args():\n parser = argparse.ArgumentParser(\"DQN experiments for Atari games\")\n # Environment test deployment\n parser.add_argument(\"--env\", type=str, default=\"Pong\", help=\"name of the game\")\n parser.add_argument(\"--seed\", type=int, default=int(time.time()), help=\"which seed to use\")\n parser.add_argument(\"--gamma\", type=int, default=0.99, help=\"which seed to use\")\n # Core DQN parameters\n parser.add_argument(\"--mode\", type=str, default=\"max\", help=\"mode of episodic memory\")\n parser.add_argument(\"--replay-buffer-size\", type=int, default=int(1e5), help=\"replay buffer size\")\n parser.add_argument(\"--lr\", type=float, default=1e-4, help=\"learning rate for Adam optimizer\")\n parser.add_argument(\"--num-steps\", type=int, default=int(5e6),\n help=\"total number of steps to run the environment for\")\n parser.add_argument(\"--negative-samples\", type=int, default=10, help=\"numbers for negative samples\")\n parser.add_argument(\"--batch-size\", type=int, default=16,\n help=\"number of transitions to optimize at the same time\")\n parser.add_argument(\"--learning-freq\", type=int, default=16,\n help=\"number of iterations between every optimization step\")\n parser.add_argument(\"--target-update-freq\", type=int, default=10000,\n help=\"number of iterations between every target network update\")\n parser.add_argument(\"--knn\", type=int, default=11, help=\"number of k nearest neighbours\")\n parser.add_argument(\"--end_training\", type=int, default=2e5, help=\"number of pretrain steps\")\n parser.add_argument('--map_config', type=str,\n help='The map and config you want to run in MonsterKong.',\n default='../../../ple/configs/config_ppo_mk_large.py')\n # Bells and whistles\n # Checkpointing\n parser.add_argument(\"--save-dir\", type=str, default=None,\n help=\"directory in which training state and model should be saved.\")\n parser.add_argument(\"--save-azure-container\", type=str, default=None,\n help=\"It present data will saved/loaded from Azure. Should be in format ACCOUNT_NAME:ACCOUNT_KEY:CONTAINER\")\n parser.add_argument(\"--save-freq\", type=int, default=1e6,\n help=\"save model once every time this many iterations are completed\")\n parser.add_argument(\"--latent_dim\", type=int, default=32,\n help=\"latent_dim\")\n parser.add_argument(\"--video_path\", type=str, default=\"./videos\",\n help=\"video path\")\n parser.add_argument(\"--comment\", type=str, default=datetime.datetime.now().strftime(\"%I-%M_%B-%d-%Y\"),\n help=\"discription for this experiment\")\n parser.add_argument(\"--log_dir\", type=str, default=\"./tflogs\",\n help=\"directory in which training state and model should be saved.\")\n boolean_flag(parser, \"load-on-start\", default=True,\n help=\"if true and model was previously saved then training will be resumed\")\n\n boolean_flag(parser, \"learning\", default=False,\n help=\"if true and model was continued learned\")\n\n boolean_flag(parser, \"exploration\", default=False,\n help=\"if true and model was continued learned\")\n\n boolean_flag(parser, \"ucb\", default=False, help=\"whether or not to use ucb exploration\")\n boolean_flag(parser, \"rp\", default=False, help=\"whether or not to use random projection\")\n # EMDQN\n boolean_flag(parser, \"train-latent\", default=False, help=\"whether or not to further train latent\")\n return parser.parse_args()\n\n\ndef make_env(game_name):\n env = gym.make(game_name + \"NoFrameskip-v4\")\n monitored_env = SimpleMonitor(env) # puts rewards and number of steps in info, before environment is wrapped\n env = wrap_dqn(\n monitored_env) # applies a bunch of modification to simplify the observation space (downsample, make b/w)\n return env, monitored_env\n\n\ndef maybe_save_model(savedir, container, state):\n \"\"\"This function checkpoints the model and state of the training algorithm.\"\"\"\n if savedir is None:\n return\n start_time = time.time()\n model_dir = \"model-{}\".format(state[\"num_iters\"])\n U.save_state(os.path.join(savedir, model_dir, \"saved\"))\n if container is not None:\n container.put(os.path.join(savedir, model_dir), model_dir)\n relatively_safe_pickle_dump(state, os.path.join(savedir, 'training_state.pkl.zip'), compression=True)\n if container is not None:\n container.put(os.path.join(savedir, 'training_state.pkl.zip'), 'training_state.pkl.zip')\n relatively_safe_pickle_dump(state[\"monitor_state\"], os.path.join(savedir, 'monitor_state.pkl'))\n if container is not None:\n container.put(os.path.join(savedir, 'monitor_state.pkl'), 'monitor_state.pkl')\n logger.log(\"Saved model in {} seconds\\n\".format(time.time() - start_time))\n\n\ndef maybe_load_model(savedir, container):\n \"\"\"Load model if present at the specified path.\"\"\"\n if savedir is None:\n return\n\n state_path = os.path.join(os.path.join(savedir, 'training_state.pkl.zip'))\n if container is not None:\n logger.log(\"Attempting to download model from Azure\")\n found_model = container.get(savedir, 'training_state.pkl.zip')\n else:\n found_model = os.path.exists(state_path)\n if found_model:\n state = pickle_load(state_path, compression=True)\n model_dir = \"model-{}\".format(state[\"num_iters\"])\n if container is not None:\n container.get(savedir, model_dir)\n U.load_state(os.path.join(savedir, model_dir, \"saved\"))\n logger.log(\"Loaded models checkpoint at {} iterations\".format(state[\"num_iters\"]))\n return state\n\n\nif __name__ == '__main__':\n args = parse_args()\n if args.train_latent:\n print(\"Training latent\")\n # Parse savedir and azure container.\n savedir = args.save_dir\n if args.save_azure_container is not None:\n account_name, account_key, container_name = args.save_azure_container.split(\":\")\n container = Container(account_name=account_name,\n account_key=account_key,\n container_name=container_name,\n maybe_create=True)\n if savedir is None:\n # Careful! This will not get cleaned up. Docker spoils the developers.\n savedir = tempfile.TemporaryDirectory().name\n else:\n container = None\n # Create and seed the env.\n # env, monitored_env = make_env(args.env)\n if args.env == \"MK\":\n\n import imp\n\n try:\n map_config_file = args.map_config\n map_config = imp.load_source('map_config', map_config_file).map_config\n except Exception as e:\n sys.exit(str(e) + '\\n'\n + 'map_config import error. File not exist or map_config not specified')\n from gym.envs.registration import register\n\n register(\n id='MonsterKong-v0',\n entry_point='baselines.ple.gym_env.monsterkong:MonsterKongEnv',\n kwargs={'map_config': map_config},\n )\n\n env = gym.make('MonsterKong-v0')\n env = ProcessFrame(env)\n else:\n env = create_atari_environment(args.env, sticky_actions=False)\n if args.seed > 0:\n set_global_seeds(args.seed)\n env.unwrapped.seed(args.seed)\n print(\"obs shape\", env.observation_space.shape)\n # env = GIFRecorder(video_path=args.video_path + \"/{}/\".format(args.comment), record_video=True, env=env)\n subdir = (datetime.datetime.now()).strftime(\"%m-%d-%Y-%H:%M:%S\") + \" \" + args.comment\n tf_writer = tf.summary.FileWriter(os.path.join(args.log_dir, subdir), tf.get_default_graph())\n value_summary = tf.Summary()\n qec_summary = tf.Summary()\n value_summary.value.add(tag='discount_reward_mean')\n value_summary.value.add(tag='non_discount_reward_mean')\n # value_summary.value.add(tag='episode')\n\n qec_summary.value.add(tag='qec_mean')\n qec_summary.value.add(tag='qec_fount')\n value_summary.value.add(tag='steps')\n value_summary.value.add(tag='episodes')\n\n with U.make_session(4) as sess:\n # EMDQN\n buffer_size = 1000000\n ec_buffer = LRU_KNN_UCB(buffer_size, args.latent_dim, 'game', mode=args.mode)\n\n # rng = np.random.RandomState(123456) # deterministic, erase 123456 for stochastic\n # rp = rng.normal(loc=0, scale=1. / np.sqrt(latent_dim), size=(latent_dim, input_dim))\n qecwatch = []\n update_counter = 0\n qec_found = 0\n sequence = []\n\n tfout = open(\n './results/result_%s_contrast_%s' % (args.env, args.comment), 'w+')\n\n\n def act(ob, stochastic=0, update_eps=-1):\n global eps, qecwatch, qec_found, num_iters\n # print(ob.shape)\n\n z = z_func(ob)\n # next_z, rs = model_func(np.tile(ob, [env.action_space.n, 1, 1, 1]), actions)\n z = np.array(z).reshape((args.latent_dim))\n if update_eps >= 0:\n eps = update_eps\n if np.random.random() < max(stochastic, eps):\n action = np.random.randint(0, env.action_space.n)\n # print(eps,env.action_space.n,action)\n return action, z\n else:\n # print(eps,stochastic,np.random.rand(0, 1))\n # qs = np.zeros(env.action_space.n)\n actions = np.arange(env.action_space.n)\n next_zs, rs = model_func(np.tile(z, [env.action_space.n, 1]), actions)\n vs = ec_buffer.knn_value(next_zs[0], args.knn)\n qs = args.gamma * np.array(vs) + np.array(rs)\n optimistic_q = qs\n q_max = np.max(optimistic_q)\n # print(\"optimistic q\", optimistic_q.shape, np.where(optimistic_q == q_max))\n max_action = np.where(optimistic_q == q_max)[0]\n # print(max_action)\n action_selected = np.random.randint(0, len(max_action))\n # print(\"ec\",eps,np.argmax(q),q)\n return max_action[action_selected], z\n\n\n def update_kdtree():\n ec_buffer.update_kdtree()\n\n\n def update_ec(sequence):\n _, _, acts, _ = list(zip(*sequence))\n # print(np.bincount(acts))\n Rtd = 0.\n Rtds = [0]\n for seq in reversed(sequence):\n s, z, a, r = seq\n # z = s.flatten()\n # z = np.dot(rp, s.flatten())\n Rtd = r + args.gamma * Rtd\n Rtds.append(Rtd)\n z = np.array(z).reshape((args.latent_dim))\n v, _ = ec_buffer.peek(z, Rtd, True)\n if v == None: # new action\n ec_buffer.add(z, Rtd)\n return Rtds\n\n\n # Create training graph and replay buffer\n z_func, model_func, train = deepq.build_train_modelbased(\n make_obs_ph=lambda name: U.Uint8Input(env.observation_space.shape, name=name),\n net_func=rp_model if args.rp else contrastive_model,\n model_func=modelbased_model,\n num_actions=env.action_space.n,\n optimizer=tf.train.AdamOptimizer(learning_rate=args.lr, epsilon=1e-4),\n gamma=args.gamma,\n grad_norm_clipping=10,\n )\n\n approximate_num_iters = args.num_steps\n if args.ucb:\n exploration = PiecewiseSchedule([\n (0, 1),\n (2e4, 1),\n ], outside_value=0.01)\n else:\n exploration = PiecewiseSchedule([\n (0, 1.0),\n (args.end_training, 1.0),\n # (args.end_training+1, 1.0),\n # (args.end_training+1, 0.005),\n (args.end_training + 100000, 0.01),\n # (approximate_num_iters / 5, 0.1),\n # (approximate_num_iters / 3, 0.01)\n ], outside_value=0.01)\n\n replay_buffer = ReplayBufferContra(args.replay_buffer_size, K=args.negative_samples)\n\n U.initialize()\n num_iters = 0\n num_episodes = 0\n non_discount_return = [0.0]\n discount_return = [0.0]\n # Load the model\n state = maybe_load_model(savedir, container)\n # if state is not None:\n # num_iters, replay_buffer = state[\"num_iters\"], state[\"replay_buffer\"],\n # monitored_env.set_state(state[\"monitor_state\"])\n\n start_time, start_steps = time.time(), 0\n steps_per_iter = RunningAvg(0.999)\n iteration_time_est = RunningAvg(0.999)\n obs = env.reset()\n print_flag = True\n # Main trianing loop\n train_time = 0\n act_time = 0\n env_time = 0\n update_time = 0\n cur_time = time.time()\n while True:\n num_iters += 1\n # Take action and store transition in the replay buffer.\n action, z = \\\n act(np.array(obs)[None], update_eps=exploration.value(num_iters))\n act_time += time.time() - cur_time\n cur_time = time.time()\n new_obs, rew, done, info = env.step(action)\n env_time += time.time() - cur_time\n cur_time = time.time()\n # if num_episodes % 40 == 39:\n # env.record = True\n non_discount_return[-1] += rew\n discount_return[-1] += rew * args.gamma ** (num_iters - start_steps)\n # EMDQN\n sequence.append([obs, z, action, np.clip(rew, -1, 1)])\n replay_buffer.add(obs, action, rew, new_obs, float(done))\n obs = new_obs\n if done:\n # print((num_iters - start_steps), args.gamma ** (num_iters - start_steps))\n num_episodes += 1\n # EMDQN\n if num_iters >= args.end_training:\n update_ec(sequence)\n update_time += time.time() - cur_time\n cur_time = time.time()\n\n if print_flag:\n print(info)\n print_flag = False\n\n obs = env.reset()\n non_discount_return.append(0.0)\n discount_return.append(0.0)\n\n if num_iters % args.learning_freq == 0 and len(replay_buffer) > args.batch_size * (\n args.negative_samples + 1) and (\n num_iters < args.end_training or args.learning):\n # train vae\n obses_t, actions, rewards, obses_tp1, dones, obses_neg = replay_buffer.sample(args.batch_size, False)\n obses_t_c, actions_c, rewards_c, obses_tp1_c, dones_c, obses_neg_c = replay_buffer.sample(args.batch_size)\n inputs = [[1],obses_t_c,obses_tp1_c,obses_neg_c,obses_t, obses_tp1, rewards,actions]\n # inputs = [obses_t, obses_tp1, rewards, actions]\n total_errors, summary = train(*inputs)\n tf_writer.add_summary(summary, global_step=num_iters)\n # tf_writer.add_summary(summary,global_step=info[\"steps\"])\n # Update target network.\n train_time += time.time() - cur_time\n cur_time = time.time()\n if num_iters % args.target_update_freq == 0 and num_iters > args.end_training: # NOTE: why not 10000?\n update_kdtree()\n if start_time is not None:\n steps_per_iter.update(1)\n iteration_time_est.update(time.time() - start_time)\n start_time = time.time()\n value_summary.value[2].simple_value = num_iters\n\n # Save the model and training state.\n '''\n if num_iters > 0 and (num_iters % args.save_freq == 0 or info[\"steps\"] > args.num_steps):\n maybe_save_model(savedir, container, {\n 'replay_buffer': replay_buffer,\n 'num_iters': num_iters,\n 'monitor_state': monitored_env.get_state()\n })\n '''\n\n if num_iters > args.num_steps:\n break\n\n if done:\n return_len = min(len(non_discount_return) - 1, 100)\n sequence = []\n steps_left = args.num_steps - num_iters\n completion = np.round(num_iters / args.num_steps, 2)\n\n logger.record_tabular(\"% completion\", completion)\n # logger.record_tabular(\"steps\", info[\"steps\"])\n logger.record_tabular(\"iters\", num_iters)\n # logger.record_tabular(\"episodes\", info[0][\"episode\"])\n logger.record_tabular(\"reward\", np.mean(non_discount_return[-return_len - 1:-1]))\n logger.record_tabular(\"discount reward\", np.mean(discount_return[-return_len - 1:-1]))\n logger.record_tabular(\"num episode\", num_episodes)\n # logger.record_tabular(\"qec_mean\", np.mean(qecwatch))\n # logger.record_tabular(\"qec_proportion\", qec_found / (num_iters - start_steps))\n logger.record_tabular(\"update time\", update_time)\n logger.record_tabular(\"train time\", train_time)\n logger.record_tabular(\"act_time\", act_time)\n logger.record_tabular(\"env_time\", env_time)\n value_summary.value[0].simple_value = np.mean(discount_return[-return_len - 1:-1])\n value_summary.value[1].simple_value = np.mean(non_discount_return[-return_len - 1:-1])\n value_summary.value[3].simple_value = num_episodes\n # qec_summary.value[0].simple_value = np.mean(qecwatch)\n # qec_summary.value[1].simple_value = qec_found / (num_iters - start_steps)\n\n # if return_len > 1:\n # # np.mean(np.mean(episodic_return[-return_mean + 1:-1]))\n # tfout.write(\"%d, %.2f\\n\" % (num_iters, int(np.mean(discount_return[-return_len - 1:-1]))))\n # tfout.flush()\n logger.record_tabular(\"exploration\", exploration.value(num_iters))\n fps_estimate = (float(steps_per_iter) / (float(iteration_time_est) + 1e-6)\n if steps_per_iter._value is not None else 1 / (float(iteration_time_est) + 1e-6))\n logger.dump_tabular()\n logger.log()\n logger.log(\"ETA: \" + pretty_eta(int(steps_left / fps_estimate)))\n logger.log()\n\n start_steps = num_iters\n # qecwatch = []\n # qec_found = 0\n total_steps = num_iters - args.end_training\n tf_writer.add_summary(value_summary, global_step=total_steps)\n # tf_writer.add_summary(qec_summary, global_step=total_steps)\n cur_time = time.time()\n", "import argparse\nimport gym\nimport numpy as np\nimport os\nimport tensorflow as tf\nimport tempfile\nimport time\nimport cv2\nimport sys\n\ncwd = os.getcwd()\ncwd = '/'.join(cwd.split('/')[:-4])\ntemp = sys.path\ntemp.append('')\ntemp[1:] = temp[0:-1]\ntemp[0] = cwd\nprint(sys.path)\n\nfrom baselines.deepq.dqn_utils import *\nimport baselines.common.tf_util as U\nimport datetime\nfrom baselines import logger\nfrom baselines import deepq\nfrom baselines.common.atari_lib import create_atari_environment\nfrom baselines.deepq.replay_buffer import ReplayBufferHash, PrioritizedReplayBuffer\nfrom baselines.common.misc_util import (\n boolean_flag,\n pickle_load,\n pretty_eta,\n relatively_safe_pickle_dump,\n set_global_seeds,\n RunningAvg,\n SimpleMonitor\n)\nfrom baselines.common.schedules import LinearSchedule, PiecewiseSchedule\n# when updating this to non-deperecated ones, it is important to\n# copy over LazyFrames\nfrom baselines.common.atari_wrappers_deprecated import wrap_dqn\nfrom baselines.common.azure_utils import Container\nfrom baselines.deepq.experiments.atari.model import contrastive_model, contrastive_model_general\nfrom baselines.deepq.experiments.atari.lru_knn_combine import LRU_KNN_COMBINE\n\n\ndef parse_args():\n parser = argparse.ArgumentParser(\"DQN experiments for Atari games\")\n # Environment\n parser.add_argument(\"--env\", type=str, default=\"Pong\", help=\"name of the game\")\n parser.add_argument(\"--seed\", type=int, default=int(time.time()), help=\"which seed to use\")\n # Core DQN parameters\n parser.add_argument(\"--replay-buffer-size\", type=int, default=int(1e6), help=\"replay buffer size\")\n parser.add_argument(\"--lr\", type=float, default=1e-3, help=\"learning rate for Adam optimizer\")\n parser.add_argument(\"--momentum\", type=float, default=0.999, help=\"momentum for momentum contrastive encoder\")\n parser.add_argument(\"--negative-samples\", type=int, default=1, help=\"numbers for negative samples\")\n parser.add_argument(\"--knn\", type=int, default=4, help=\"number of k nearest neighbours\")\n parser.add_argument(\"--gamma\", type=int, default=0.99, help=\"which seed to use\")\n parser.add_argument(\"--num-steps\", type=int, default=int(5e6),\n help=\"total number of steps to run the environment for\")\n parser.add_argument(\"--batch-size\", type=int, default=64,\n help=\"number of stransitions to optimize at the same time\")\n parser.add_argument(\"--learning-freq\", type=int, default=4,\n help=\"number of iterations between every optimization step\")\n parser.add_argument(\"--encoder-update-freq\", type=int, default=1000,\n help=\"number of iterations between every target network update\")\n parser.add_argument(\"--tree-update-freq\", type=int, default=10000,\n help=\"number of iterations between every target network update\")\n # Bells and whistles\n boolean_flag(parser, \"prioritized\", default=False, help=\"whether or not to use prioritized replay buffer\")\n parser.add_argument(\"--prioritized-alpha\", type=float, default=0.6,\n help=\"alpha parameter for prioritized replay buffer\")\n parser.add_argument(\"--prioritized-beta\", type=float, default=0.4,\n help=\"initial value of beta parameters for prioritized replay\")\n parser.add_argument(\"--prioritized-eps\", type=float, default=1e-6,\n help=\"eps parameter for prioritized replay buffer\")\n # Checkpointing\n parser.add_argument('--map_config', type=str,\n help='The map and config you want to run in MonsterKong.',\n default='../../../ple/configs/config_ppo_mk_large.py')\n parser.add_argument(\"--save-dir\", type=str, default=None,\n help=\"directory in which training state and model should be saved.\")\n parser.add_argument(\"--save-azure-container\", type=str, default=None,\n help=\"It present data will saved/loaded from Azure. Should be in format ACCOUNT_NAME:ACCOUNT_KEY:CONTAINER\")\n parser.add_argument(\"--save-freq\", type=int, default=1e6,\n help=\"save model once every time this many iterations are completed\")\n parser.add_argument(\"--latent_dim\", type=int, default=32,\n help=\"latent_dim\")\n parser.add_argument(\"--comment\", type=str, default=datetime.datetime.now().strftime(\"%I-%M_%B-%d-%Y\"),\n help=\"discription for this experiment\")\n parser.add_argument(\"--log_dir\", type=str, default=\"./tflogs\",\n help=\"directory in which training state and model should be saved.\")\n boolean_flag(parser, \"load-on-start\", default=True,\n help=\"if true and model was previously saved then training will be resumed\")\n\n # EMDQN\n\n boolean_flag(parser, \"predict\", default=False, help=\"whether or not to use prediction\")\n boolean_flag(parser, \"learning\", default=True, help=\"whether or not to learn encoder\")\n\n return parser.parse_args()\n\n\ndef make_env(game_name):\n env = gym.make(game_name + \"NoFrameskip-v4\")\n monitored_env = SimpleMonitor(env) # puts rewards and number of steps in info, before environment is wrapped\n env = wrap_dqn(\n monitored_env) # applies a bunch of modification to simplify the observation space (downsample, make b/w)\n return env, monitored_env\n\n\ndef maybe_save_model(savedir, container, state):\n \"\"\"This function checkpoints the model and state of the training algorithm.\"\"\"\n if savedir is None:\n return\n start_time = time.time()\n model_dir = \"model-{}\".format(state[\"num_iters\"])\n U.save_state(os.path.join(savedir, model_dir, \"saved\"))\n if container is not None:\n container.put(os.path.join(savedir, model_dir), model_dir)\n relatively_safe_pickle_dump(state, os.path.join(savedir, 'training_state.pkl.zip'), compression=True)\n if container is not None:\n container.put(os.path.join(savedir, 'training_state.pkl.zip'), 'training_state.pkl.zip')\n relatively_safe_pickle_dump(state[\"monitor_state\"], os.path.join(savedir, 'monitor_state.pkl'))\n if container is not None:\n container.put(os.path.join(savedir, 'monitor_state.pkl'), 'monitor_state.pkl')\n logger.log(\"Saved model in {} seconds\\n\".format(time.time() - start_time))\n\n\ndef maybe_load_model(savedir, container):\n \"\"\"Load model if present at the specified path.\"\"\"\n if savedir is None:\n return\n\n state_path = os.path.join(os.path.join(savedir, 'training_state.pkl.zip'))\n if container is not None:\n logger.log(\"Attempting to download model from Azure\")\n found_model = container.get(savedir, 'training_state.pkl.zip')\n else:\n found_model = os.path.exists(state_path)\n if found_model:\n state = pickle_load(state_path, compression=True)\n model_dir = \"model-{}\".format(state[\"num_iters\"])\n if container is not None:\n container.get(savedir, model_dir)\n U.load_state(os.path.join(savedir, model_dir, \"saved\"))\n logger.log(\"Loaded models checkpoint at {} iterations\".format(state[\"num_iters\"]))\n return state\n\n\ndef switch_first_half(obs, obs_next, batch_size):\n half_size = int(batch_size / 2)\n tmp = obs[:half_size, ...]\n obs[:half_size, ...] = obs_next[:half_size, ...]\n obs_next[:half_size, ...] = tmp\n return obs, obs_next\n\n\nif __name__ == '__main__':\n\n args = parse_args()\n print(\"predict value:{} learning:{}\".format(args.predict, args.learning))\n tf.random.set_random_seed(args.seed)\n # Parse savedir and azure container.\n savedir = args.save_dir\n if args.save_azure_container is not None:\n account_name, account_key, container_name = args.save_azure_container.split(\":\")\n container = Container(account_name=account_name,\n account_key=account_key,\n container_name=container_name,\n maybe_create=True)\n if savedir is None:\n # Careful! This will not get cleaned up. Docker spoils the developers.\n savedir = tempfile.TemporaryDirectory().name\n else:\n container = None\n # Create and seed the env.\n if args.env == \"MK\":\n\n import imp\n\n try:\n map_config_file = args.map_config\n map_config = imp.load_source('map_config', map_config_file).map_config\n except Exception as e:\n sys.exit(str(e) + '\\n'\n + 'map_config import error. File not exist or map_config not specified')\n from gym.envs.registration import register\n\n register(\n id='MonsterKong-v0',\n entry_point='baselines.ple.gym_env.monsterkong:MonsterKongEnv',\n kwargs={'map_config': map_config},\n )\n\n env = gym.make('MonsterKong-v0')\n env = ProcessFrame(env)\n else:\n env = create_atari_environment(args.env, sticky_actions=False)\n if args.seed > 0:\n set_global_seeds(args.seed)\n env.unwrapped.seed(args.seed)\n env = SimpleMonitor(env)\n subdir = (datetime.datetime.now()).strftime(\"%m-%d-%Y-%H:%M:%S\") + \" \" + args.comment\n tf_writer = tf.summary.FileWriter(os.path.join(args.log_dir, subdir), tf.get_default_graph())\n value_summary = tf.Summary()\n qec_summary = tf.Summary()\n value_summary.value.add(tag='reward_mean')\n value_summary.value.add(tag='discount_reward_mean')\n value_summary.value.add(tag='non_discount_reward_mean')\n qec_summary.value.add(tag='qec_mean')\n qec_summary.value.add(tag='qec_fount')\n value_summary.value.add(tag='steps')\n\n with U.make_session(4) as sess:\n # EMDQN\n\n buffer_size = 50000\n latent_dim = args.latent_dim\n input_dim = 220 * 220 * 1 if args.env == \"MK\" else 84 * 84 * 4\n input_dims = (220, 220, 1) if args.env == \"MK\" else (84, 84, 4)\n # rng = np.random.RandomState(123456) # deterministic, erase 123456 for stochastic\n # rp = rng.normal(loc=0, scale=1. / np.sqrt(latent_dim), size=(latent_dim, input_dim))\n ec_buffer = LRU_KNN_COMBINE(env.action_space.n, buffer_size, latent_dim, latent_dim, input_dims, 'game')\n # rng = np.random.RandomState(123456) # deterministic, erase 123456 for stochastic\n # rp = rng.normal(loc=0, scale=1. / np.sqrt(latent_dim), size=(latent_dim, input_dim))\n qec_watch = []\n update_counter = 0\n qec_found = 0\n sequence = []\n tfout = open(\n './results/result_%s_mfmc_predict%s_%s' % (args.env, str(args.predict), args.comment), 'w+')\n visualout = './visual/'\n\n\n def act(ob, stochastic=0, update_eps=-1):\n global eps, qec_found, qec_watch\n z = z_func(np.array(ob))\n h = hash_func(np.array(ob))\n # print(z[0].shape,h[0].shape)\n if update_eps >= 0:\n eps = update_eps\n if np.random.random() < max(stochastic, eps):\n action = np.random.randint(0, env.action_space.n)\n # for a in range(env.action_space.n):\n # print(np.array(z).shape)\n # q, count = ec_buffer[a].peek(None,h[0][0], 0, modify=False)\n # print(\"random q\", q)\n # if q is not None:\n # qec_watch.append(q)\n # qec_found += 1\n # print(eps,env.action_space.n,action)\n return action, z, h\n else:\n # print(eps,stochastic,np.random.rand(0, 1))\n q = []\n for a in range(env.action_space.n):\n q_value = ec_buffer.knn_value(a, z[0][0], args.knn)\n q.append(q_value)\n\n q_max = np.max(q)\n # print(\"optimistic q\", optimistic_q.shape, np.where(optimistic_q == q_max))\n max_action = np.where(q == q_max)[0]\n # print(max_action)\n action_selected = np.random.randint(0, len(max_action))\n # print(\"ec\",eps,np.argmax(q),q)\n return max_action[action_selected], z, h\n # return np.argmax(q), z, h\n\n\n def update_kdtree():\n ec_buffer.update_kdtree()\n\n\n def update_ec(sequence):\n obses, acts, zs, hs, rs = list(zip(*sequence))\n Rtds = []\n Rtd = 0\n for r in reversed(rs):\n Rtd = r + 0.99 * Rtd\n Rtds.append(Rtd)\n Rtds = Rtds[::-1]\n obses = np.array([np.array(ob) for ob in obses])\n # hashes = hash_func(obses)\n # zs = z_func(obses)\n # print(obses.shape,len(hashes[0]),len(zs[0]),len(Rtds))\n prev_id, prev_action = -1, -1\n for a, obs, z, h, Rtd in zip(acts, obses, zs, hs, Rtds):\n # z = z_func([obs])[0]\n # h = hash_func([obs])[0][0]\n # print(np.array(h).shape)\n qd, prev_id_tmp = ec_buffer.peek(a, z[0][0], h[0][0], Rtd, True, False, prev_id, prev_action)\n if qd == None: # new action\n # print(\"add\",z,h)\n prev_id = ec_buffer.add(a, z[0][0], h[0][0], Rtd, prev_id, prev_action, obs)\n else:\n prev_id = prev_id_tmp\n prev_action = a\n\n\n # Create training graph and replay buffer\n hash_func, z_func, train = deepq.build_train_mfmc(\n make_obs_ph=lambda name: U.Uint8Input(env.observation_space.shape, name=name),\n model_func=contrastive_model_general,\n num_actions=env.action_space.n,\n optimizer=tf.train.AdamOptimizer(learning_rate=args.lr, epsilon=1e-4),\n # optimizer=tf.train.AdamOptimizer(learning_rate=args.lr, epsilon=1e-4),\n gamma=0.99,\n grad_norm_clipping=10,\n input_dim=input_dim,\n batch_size=args.batch_size,\n K=args.negative_samples,\n predict=args.predict\n )\n\n tf_writer.add_graph(sess.graph)\n\n approximate_num_iters = args.num_steps\n exploration = PiecewiseSchedule([\n (0, 1.0),\n (400000, 0.05),\n (800000, 0.01)\n ], outside_value=0.01)\n\n # if args.prioritized:\n # replay_buffer = PrioritizedReplayBuffer(args.replay_buffer_size, args.prioritized_alpha)\n # beta_schedule = LinearSchedule(approximate_num_iters, initial_p=args.prioritized_beta0, final_p=1.0)\n # else:\n # replay_buffer = ReplayBufferHash(args.replay_buffer_size)\n\n U.initialize()\n # update_encoder([0])\n num_iters = 0\n\n # Load the model\n state = maybe_load_model(savedir, container)\n # if state is not None:\n # num_iters, replay_buffer = state[\"num_iters\"], state[\"replay_buffer\"],\n # # monitored_env.set_state(state[\"monitor_state\"])\n\n start_time, start_steps = time.time(), 0\n steps_per_iter = RunningAvg(0.999)\n iteration_time_est = RunningAvg(0.999)\n obs = env.reset()\n non_discount_return = [0.0]\n discount_return = [0.0]\n train_time = 0\n act_time = 0\n env_time = 0\n update_time = 0\n cur_time = time.time()\n update_lr = 1e-3\n # Main trianing loop\n while True:\n num_iters += 1\n # Take action and store transition in the replay buffer.\n action, z, h = act(np.array(obs)[None], update_eps=exploration.value(num_iters))\n act_time += time.time() - cur_time\n cur_time = time.time()\n new_obs, rew, done, info = env.step(action)\n env_time += time.time() - cur_time\n cur_time = time.time()\n new_h = hash_func(np.array(new_obs)[None, :])\n # EMDQN\n non_discount_return[-1] += rew\n discount_return[-1] += rew * args.gamma ** (num_iters - start_steps)\n sequence.append([obs, action, z, h, np.clip(rew, -1, 1)])\n # if args.learning:\n # replay_buffer.add(obs, h, action, rew, new_obs, new_h, float(done))\n obs = new_obs\n if done:\n # EMDQN\n\n update_ec(sequence)\n update_time += time.time() - cur_time\n cur_time = time.time()\n sequence = []\n obs = env.reset()\n non_discount_return.append(0.0)\n discount_return.append(0.0)\n\n if (num_iters > 500 * args.batch_size) and (num_iters % args.learning_freq == 0) and args.learning:\n place_anchor, place_pos, place_neg, obs_anchor, key_anchor, key_pos, key_neg = ec_buffer.sample(\n args.batch_size,\n args.negative_samples)\n\n # print(np.array(key_neg).shape)\n # print(\"training\")\n inputs = [[1], obs_anchor, key_pos, key_neg, key_anchor]\n total_loss, summary, z_anchor, z_pos, z_neg = train(*inputs)\n # update dictionary\n ec_buffer.update(place_anchor, z_anchor)\n z_pos = np.nan_to_num(z_pos, copy=False)\n z_neg = np.nan_to_num(z_neg, copy=False)\n z_pos = np.array(z_pos[0]) * update_lr + np.array(key_pos)\n z_neg = np.array(z_neg[0]) * update_lr + np.array(key_neg)\n\n ec_buffer.update(place_pos, z_pos)\n for j in range(args.batch_size):\n ec_buffer.update(place_neg[j], z_neg[j])\n tf_writer.add_summary(summary, global_step=info[\"steps\"])\n\n # tf_writer.add_summary(summary,global_step=info[\"steps\"])\n # Update target network.\n # if num_iters % args.target_update_freq == 0: # NOTE: why not 10000?\n train_time += time.time() - cur_time\n cur_time = time.time()\n if num_iters % args.tree_update_freq == 0:\n update_kdtree()\n\n if start_time is not None:\n steps_per_iter.update(1)\n iteration_time_est.update(time.time() - start_time)\n start_time = time.time()\n value_summary.value[3].simple_value = num_iters\n\n # Save the model and training state.\n '''\n if num_iters > 0 and (num_iters % args.save_freq == 0 or info[\"steps\"] > args.num_steps):\n maybe_save_model(savedir, container, {\n 'replay_buffer': replay_buffer,\n 'num_iters': num_iters,\n 'monitor_state': monitored_env.get_state()\n })\n '''\n\n if info[\"steps\"] > args.num_steps:\n break\n\n if done:\n return_len = min(len(non_discount_return) - 1, 100)\n steps_left = args.num_steps - info[\"steps\"]\n completion = np.round(info[\"steps\"] / args.num_steps, 2)\n\n logger.record_tabular(\"% completion\", completion)\n logger.record_tabular(\"steps\", info[\"steps\"])\n logger.record_tabular(\"iters\", num_iters)\n logger.record_tabular(\"episodes\", len(info[\"rewards\"]))\n logger.record_tabular(\"qec_mean\", np.mean(qec_watch))\n logger.record_tabular(\"qec_proportion\", qec_found / (num_iters - start_steps + 1))\n logger.record_tabular(\"reward (100 epi mean)\", np.mean(info[\"rewards\"][-100:]))\n logger.record_tabular(\"update time\", update_time)\n logger.record_tabular(\"train time\", train_time)\n logger.record_tabular(\"act_time\", act_time)\n logger.record_tabular(\"env_time\", env_time)\n # value_summary.value[0].simple_value = np.mean(info[\"rewards\"][-100:])\n value_summary.value[1].simple_value = np.mean(discount_return[-return_len - 1:-1])\n value_summary.value[2].simple_value = np.mean(non_discount_return[-return_len - 1:-1])\n value_summary.value[0].simple_value = np.mean(np.mean(info[\"rewards\"][-100:]))\n qec_summary.value[0].simple_value = np.mean(qec_watch)\n qec_summary.value[1].simple_value = qec_found / (num_iters - start_steps + 1)\n # if len(info[\"rewards\"]) > 1:\n # # np.mean(info[\"rewards\"][-100:])\n # # tfout.write(\"%d, %.2f\\n\" % (info[\"steps\"], np.mean(info[\"rewards\"][-100:])))\n # # tfout.flush()\n logger.record_tabular(\"exploration\", exploration.value(num_iters))\n # if args.prioritized:\n # logger.record_tabular(\"max priority\", replay_buffer._max_priority)\n fps_estimate = (float(steps_per_iter) / (float(iteration_time_est) + 1e-6)\n if steps_per_iter._value is not None else \"calculating...\")\n logger.dump_tabular()\n logger.log()\n logger.log(\"ETA: \" + pretty_eta(int(steps_left / fps_estimate)))\n logger.log()\n qec_watch = []\n qec_found = 0\n start_steps = num_iters\n tf_writer.add_summary(value_summary, global_step=info[\"steps\"])\n cur_time = time.time()\n # if num_iters % 1000000 == 1:\n # avg_score = test_agent()\n # tfout.write(\"test:%.2f\\n\" % avg_score)\n # tfout.flush()\n" ]
[ [ "tensorflow.get_default_graph", "numpy.random.random", "numpy.clip", "numpy.arange", "numpy.tile", "numpy.round", "numpy.max", "numpy.mean", "tensorflow.train.AdamOptimizer", "tensorflow.Summary", "numpy.array", "numpy.where", "numpy.random.randint" ], [ "tensorflow.get_default_graph", "numpy.random.random", "numpy.clip", "numpy.nan_to_num", "numpy.round", "numpy.max", "numpy.mean", "tensorflow.train.AdamOptimizer", "tensorflow.Summary", "numpy.array", "numpy.where", "tensorflow.random.set_random_seed", "numpy.random.randint" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
inspire-group/ml_defense
[ "e7e8944d617885389a013061c320fa3553e779f0" ]
[ "lib/utils/DCA.py" ]
[ "\"\"\"\nDCA class performs Discriminant Correlation Analysis (DCA). It can be used as\na dimensionality reduction algorithm. Usage is similar to sklearn's\npreprocessing classes such as PCA.\n(Code from Thee Chanyaswad ([email protected]))\n\"\"\"\n\nimport numpy as np\nimport scipy\nfrom sklearn.metrics import pairwise\nfrom sklearn import preprocessing\n\n#------------------------------------------------------------------------------#\n\n\nclass DCA:\n\n def __init__(self, rho=None, rho_p=None, n_components=None):\n\n self.n_components = n_components\n self.rho = rho\n self.rho_p = rho_p\n\n def fit(self, X, y):\n\n (self._Sw, self._Sb) = self._get_Smatrices(X, y)\n\n if self.rho == None:\n s0 = np.linalg.eigvalsh(self._Sw)\n self.rho = 0.02 * np.max(s0)\n if self.rho_p == None:\n self.rho_p = 0.1 * self.rho\n\n pSw = self._Sw + self.rho * np.eye(self._Sw.shape[0])\n pSbar = self._Sb + self._Sw + \\\n (self.rho_p + self.rho) * np.eye(self._Sw.shape[0])\n (s1, vr) = scipy.linalg.eigh(\n pSbar, pSw, overwrite_a=True, overwrite_b=True)\n s1 = s1[::-1] # re-order from large to small\n Wdca = vr.T[::-1]\n self.eigVal = s1\n self.allComponents = Wdca\n if self.n_components:\n self.components = Wdca[0:self.n_components]\n else:\n self.components = Wdca\n\n def transform(self, X, dim=None):\n\n if dim == None:\n X_trans = np.inner(self.components, X)\n else:\n X_trans = np.inner(self.allComponents[0:dim], X)\n return X_trans.T\n\n def inverse_transform(self, Xreduced, projMatrix=None, dim=None):\n\n if projMatrix is None:\n if dim is None:\n W = self.components\n else:\n W = self.allComponents[0:dim]\n else:\n W = projMatrix\n # W = PxM where P<M\n foo = np.inner(W, W)\n bar = np.linalg.solve(foo.T, W)\n Xhat = np.inner(Xreduced, bar.T)\n return Xhat\n\n def _get_Smatrices(self, X, y):\n\n Sb = np.zeros((X.shape[1], X.shape[1]))\n\n S = np.inner(X.T, X.T)\n N = len(X)\n mu = np.mean(X, axis=0)\n classLabels = np.unique(y)\n for label in classLabels:\n classIdx = np.argwhere(y == label).T[0]\n Nl = len(classIdx)\n xL = X[classIdx]\n muL = np.mean(xL, axis=0)\n muLbar = muL - mu\n Sb = Sb + Nl * np.outer(muLbar, muLbar)\n\n Sbar = S - N * np.outer(mu, mu)\n Sw = Sbar - Sb\n self.mean_ = mu\n\n return (Sw, Sb)\n" ]
[ [ "numpy.linalg.solve", "numpy.inner", "numpy.unique", "numpy.eye", "numpy.argwhere", "scipy.linalg.eigh", "numpy.max", "numpy.mean", "numpy.outer", "numpy.linalg.eigvalsh", "numpy.zeros" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [ "0.13", "0.14", "0.15", "0.12", "0.10" ], "tensorflow": [] } ]
jairideout/scikit-bio
[ "81a1ce5acb434603c537f832caee64a76db19190", "81a1ce5acb434603c537f832caee64a76db19190" ]
[ "skbio/diversity/alpha/_ace.py", "skbio/stats/tests/test_spatial.py" ]
[ "# ----------------------------------------------------------------------------\n# Copyright (c) 2013--, scikit-bio development team.\n#\n# Distributed under the terms of the Modified BSD License.\n#\n# The full license is in the file COPYING.txt, distributed with this software.\n# ----------------------------------------------------------------------------\n\nfrom __future__ import absolute_import, division, print_function\n\nimport numpy as np\n\nfrom skbio.diversity.alpha._base import _validate_counts_vector\nfrom skbio.util._decorator import experimental\n\n\n@experimental(as_of=\"0.4.0\")\ndef ace(counts, rare_threshold=10):\n r\"\"\"Calculate the ACE metric (Abundance-based Coverage Estimator).\n\n The ACE metric is defined as:\n\n .. math::\n\n S_{ace}=S_{abund}+\\frac{S_{rare}}{C_{ace}}+\n \\frac{F_1}{C_{ace}}\\gamma^2_{ace}\n\n where :math:`S_{abund}` is the number of abundant OTUs (with more than\n `rare_threshold` individuals) when all samples are pooled,\n :math:`S_{rare}` is the number of rare OTUs (with less than or equal to\n `rare_threshold` individuals) when all samples are pooled, :math:`C_{ace}`\n is the sample abundance coverage estimator, :math:`F_1` is the frequency of\n singletons, and :math:`\\gamma^2_{ace}` is the estimated coefficient of\n variation for rare OTUs.\n\n The estimated coefficient of variation is defined as (assuming\n `rare_threshold` is 10, the default):\n\n .. math::\n\n \\gamma^2_{ace}=max\\left[\\frac{S_{rare}}{C_{ace}}\n \\frac{\\sum^{10}_{i=1}{{i\\left(i-1\\right)}}F_i}\n {\\left(N_{rare}\\right)\\left(N_{rare}-1\\right)} -1,0\\right]\n\n Parameters\n ----------\n counts : 1-D array_like, int\n Vector of counts.\n rare_threshold : int, optional\n Threshold at which an OTU containing as many or fewer individuals will\n be considered rare.\n\n Returns\n -------\n double\n Computed ACE metric.\n\n Raises\n ------\n ValueError\n If every rare OTU is a singleton.\n\n Notes\n -----\n ACE was first introduced in [1]_ and [2]_. The implementation here is based\n on the description given in the EstimateS manual [3]_.\n\n If no rare OTUs exist, returns the number of abundant OTUs. The default\n value of 10 for `rare_threshold` is based on [4]_.\n\n If `counts` contains zeros, indicating OTUs which are known to exist in the\n environment but did not appear in the sample, they will be ignored for the\n purpose of calculating the number of rare OTUs.\n\n References\n ----------\n .. [1] Chao, A. & S.-M Lee. 1992 Estimating the number of classes via\n sample coverage. Journal of the American Statistical Association 87,\n 210-217.\n .. [2] Chao, A., M.-C. Ma, & M. C. K. Yang. 1993. Stopping rules and\n estimation for recapture debugging with unequal failure rates.\n Biometrika 80, 193-201.\n .. [3] http://viceroy.eeb.uconn.edu/estimates/\n .. [4] Chao, A., W.-H. Hwang, Y.-C. Chen, and C.-Y. Kuo. 2000. Estimating\n the number of shared species in two communities. Statistica Sinica\n 10:227-246.\n\n \"\"\"\n counts = _validate_counts_vector(counts)\n freq_counts = np.bincount(counts)\n s_rare = _otus_rare(freq_counts, rare_threshold)\n singles = freq_counts[1]\n\n if singles > 0 and singles == s_rare:\n raise ValueError(\"The only rare OTUs are singletons, so the ACE \"\n \"metric is undefined. EstimateS suggests using \"\n \"bias-corrected Chao1 instead.\")\n\n s_abun = _otus_abundant(freq_counts, rare_threshold)\n if s_rare == 0:\n return s_abun\n\n n_rare = _number_rare(freq_counts, rare_threshold)\n c_ace = 1 - singles / n_rare\n\n top = s_rare * _number_rare(freq_counts, rare_threshold, gamma=True)\n bottom = c_ace * n_rare * (n_rare - 1)\n gamma_ace = (top / bottom) - 1\n\n if gamma_ace < 0:\n gamma_ace = 0\n\n return s_abun + (s_rare / c_ace) + ((singles / c_ace) * gamma_ace)\n\n\ndef _otus_rare(freq_counts, rare_threshold):\n \"\"\"Count number of rare OTUs.\"\"\"\n return freq_counts[1:rare_threshold + 1].sum()\n\n\ndef _otus_abundant(freq_counts, rare_threshold):\n \"\"\"Count number of abundant OTUs.\"\"\"\n return freq_counts[rare_threshold + 1:].sum()\n\n\ndef _number_rare(freq_counts, rare_threshold, gamma=False):\n \"\"\"Return number of individuals in rare OTUs.\n\n ``gamma=True`` generates the ``n_rare`` used for the variation coefficient.\n\n \"\"\"\n n_rare = 0\n\n if gamma:\n for i, j in enumerate(freq_counts[:rare_threshold + 1]):\n n_rare = n_rare + (i * j) * (i - 1)\n else:\n for i, j in enumerate(freq_counts[:rare_threshold + 1]):\n n_rare = n_rare + (i * j)\n\n return n_rare\n", "# ----------------------------------------------------------------------------\n# Copyright (c) 2013--, scikit-bio development team.\n#\n# Distributed under the terms of the Modified BSD License.\n#\n# The full license is in the file COPYING.txt, distributed with this software.\n# ----------------------------------------------------------------------------\n\nfrom __future__ import absolute_import, division, print_function\n\nfrom unittest import TestCase, main\n\nimport numpy as np\n\nfrom skbio.stats.spatial import (procrustes, _get_disparity, _center,\n _normalize)\n\n\nclass ProcrustesTests(TestCase):\n\n \"\"\"test the procrustes module, using floating point numpy arrays\n \"\"\"\n\n def setUp(self):\n \"\"\"creates inputs\"\"\"\n # an L\n self.data1 = np.array([[1, 3], [1, 2], [1, 1], [2, 1]], 'd')\n\n # a larger, shifted, mirrored L\n self.data2 = np.array([[4, -2], [4, -4], [4, -6], [2, -6]], 'd')\n\n # an L shifted up 1, right 1, and with point 4 shifted an extra .5\n # to the right\n # pointwise distance disparity with data1: 3*(2) + (1 + 1.5^2)\n self.data3 = np.array([[2, 4], [2, 3], [2, 2], [3, 2.5]], 'd')\n\n # data4, data5 are standardized (trace(A*A') = 1).\n # procrustes should return an identical copy if they are used\n # as the first matrix argument.\n shiftangle = np.pi / 8\n self.data4 = np.array([[1, 0], [0, 1], [-1, 0],\n [0, -1]], 'd') / np.sqrt(4)\n self.data5 = np.array([[np.cos(shiftangle), np.sin(shiftangle)],\n [np.cos(np.pi / 2 - shiftangle),\n np.sin(np.pi / 2 - shiftangle)],\n [-np.cos(shiftangle),\n -np.sin(shiftangle)],\n [-np.cos(np.pi / 2 - shiftangle),\n -np.sin(np.pi / 2 - shiftangle)]],\n 'd') / np.sqrt(4)\n\n def test_procrustes(self):\n \"\"\"tests procrustes' ability to match two matrices.\n\n the second matrix is a rotated, shifted, scaled, and mirrored version\n of the first, in two dimensions only\n \"\"\"\n # can shift, mirror, and scale an 'L'?\n a, b, disparity = procrustes(self.data1, self.data2)\n np.testing.assert_allclose(b, a)\n np.testing.assert_almost_equal(disparity, 0.)\n\n # if first mtx is standardized, leaves first mtx unchanged?\n m4, m5, disp45 = procrustes(self.data4, self.data5)\n np.testing.assert_equal(m4, self.data4)\n\n # at worst, data3 is an 'L' with one point off by .5\n m1, m3, disp13 = procrustes(self.data1, self.data3)\n self.assertTrue(disp13 < 0.5 ** 2)\n\n def test_procrustes2(self):\n \"\"\"procrustes disparity should not depend on order of matrices\"\"\"\n m1, m3, disp13 = procrustes(self.data1, self.data3)\n m3_2, m1_2, disp31 = procrustes(self.data3, self.data1)\n np.testing.assert_almost_equal(disp13, disp31)\n\n # try with 3d, 8 pts per\n rand1 = np.array([[2.61955202, 0.30522265, 0.55515826],\n [0.41124708, -0.03966978, -0.31854548],\n [0.91910318, 1.39451809, -0.15295084],\n [2.00452023, 0.50150048, 0.29485268],\n [0.09453595, 0.67528885, 0.03283872],\n [0.07015232, 2.18892599, -1.67266852],\n [0.65029688, 1.60551637, 0.80013549],\n [-0.6607528, 0.53644208, 0.17033891]])\n\n rand3 = np.array([[0.0809969, 0.09731461, -0.173442],\n [-1.84888465, -0.92589646, -1.29335743],\n [0.67031855, -1.35957463, 0.41938621],\n [0.73967209, -0.20230757, 0.52418027],\n [0.17752796, 0.09065607, 0.29827466],\n [0.47999368, -0.88455717, -0.57547934],\n [-0.11486344, -0.12608506, -0.3395779],\n [-0.86106154, -0.28687488, 0.9644429]])\n res1, res3, disp13 = procrustes(rand1, rand3)\n res3_2, res1_2, disp31 = procrustes(rand3, rand1)\n np.testing.assert_almost_equal(disp13, disp31)\n\n def test_procrustes_shape_mismatch(self):\n with self.assertRaises(ValueError):\n procrustes(np.array([[1, 2], [3, 4]]),\n np.array([[5, 6, 7], [8, 9, 10]]))\n\n def test_procrustes_empty_rows_or_cols(self):\n empty = np.array([[]])\n with self.assertRaises(ValueError):\n procrustes(empty, empty)\n\n def test_procrustes_no_variation(self):\n with self.assertRaises(ValueError):\n procrustes(np.array([[42, 42], [42, 42]]),\n np.array([[45, 45], [45, 45]]))\n\n def test_get_disparity(self):\n \"\"\"tests get_disparity\"\"\"\n disp = _get_disparity(self.data1, self.data3)\n disp2 = _get_disparity(self.data3, self.data1)\n np.testing.assert_equal(disp, disp2)\n np.testing.assert_equal(disp, (3. * 2. + (1. + 1.5 ** 2)))\n\n d1 = np.append(self.data1, self.data1, 0)\n d3 = np.append(self.data3, self.data3, 0)\n\n disp3 = _get_disparity(d1, d3)\n disp4 = _get_disparity(d3, d1)\n np.testing.assert_equal(disp3, disp4)\n # 2x points in same configuration should give 2x disparity\n np.testing.assert_equal(disp3, 2. * disp)\n\n def test_center(self):\n centered_mtx = _center(self.data1)\n column_means = centered_mtx.mean(0)\n for col_mean in column_means:\n np.testing.assert_equal(col_mean, 0.)\n\n def test_normalize(self):\n norm_mtx = _normalize(self.data1)\n np.testing.assert_equal(np.trace(np.dot(norm_mtx,\n np.transpose(norm_mtx))), 1.)\n\n # match_points isn't yet tested, as it's almost a private function\n # and test_procrustes() tests it implicitly.\n\n\nif __name__ == '__main__':\n main()\n" ]
[ [ "numpy.bincount" ], [ "numpy.testing.assert_equal", "numpy.sqrt", "numpy.cos", "numpy.transpose", "numpy.sin", "numpy.testing.assert_almost_equal", "numpy.append", "numpy.testing.assert_allclose", "numpy.array" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
ccharp/dplyPY
[ "681af27b6ca595bec88e1a9b98ea90c9ac848f1b", "681af27b6ca595bec88e1a9b98ea90c9ac848f1b" ]
[ "dplypy/test/test_arrange.py", "dplypy/test/test_integration.py" ]
[ "import pandas as pd\nimport numpy as np\n\nfrom dplypy.dplyframe import DplyFrame\nfrom dplypy.pipeline import arrange\n\n\ndef test_arrange():\n pandas_df = pd.DataFrame(\n data=[[5, 1, 0], [20, 2, 2], [0, 8, 8], [np.nan, 7, 9], [10, 7, 5], [15, 4, 3]],\n columns=[\"col1\", \"col2\", \"col3\"],\n index=[1, 3, 5, 7, 9, 11],\n )\n df = DplyFrame(pandas_df)\n\n output1 = df + arrange(by=\"col1\")\n expected1 = pandas_df.sort_values(by=\"col1\")\n pd.testing.assert_frame_equal(output1.pandas_df, expected1)\n\n try:\n df + arrange(by=1)\n except KeyError:\n pass\n else:\n raise AssertionError(\"KeyError was not raised\")\n\n output2 = df + arrange(by=[\"col1\", \"col2\"], ascending=False)\n expected2 = pandas_df.sort_values(by=[\"col1\", \"col2\"], ascending=False)\n pd.testing.assert_frame_equal(output2.pandas_df, expected2)\n\n try:\n df + arrange(by=[\"col1\", \"col4\"])\n except KeyError:\n pass\n else:\n raise AssertionError(\"KeyError was not raised\")\n\n output3 = df + arrange(by=[\"col1\"], ascending=False)\n expected3 = pandas_df.sort_values(by=[\"col1\"], ascending=False)\n pd.testing.assert_frame_equal(output3.pandas_df, expected3)\n\n output4 = df + arrange(by=\"col1\", axis=\"index\")\n expected4 = pandas_df.sort_values(by=\"col1\", axis=\"index\")\n pd.testing.assert_frame_equal(output4.pandas_df, expected4)\n\n output5 = df + arrange(by=1, axis=1)\n expected5 = pandas_df.sort_values(by=1, axis=1)\n pd.testing.assert_frame_equal(output5.pandas_df, expected5)\n\n output6 = df + arrange(by=[1, 3], axis=\"columns\", ascending=[True, False])\n expected6 = pandas_df.sort_values(\n by=[1, 3], axis=\"columns\", ascending=[True, False]\n )\n pd.testing.assert_frame_equal(output6.pandas_df, expected6)\n", "import os\n\nimport seaborn as sns\nimport pandas as pd\n\nfrom dplypy.dplyframe import *\nfrom dplypy.pipeline import *\n\n\ndef test_pipeline():\n df = DplyFrame(sns.load_dataset(\"titanic\"))\n\n test_df_1 = df + head(5)\n test_df_2 = df + tail(5)\n test_df_3 = DplyFrame(\n test_df_1.pandas_df.loc[:, [\"survived\", \"pclass\", \"age\", \"sibsp\"]]\n )\n test_df_4 = DplyFrame(\n test_df_2.pandas_df.loc[:, [\"survived\", \"pclass\", \"age\", \"sibsp\"]]\n )\n\n # melt + pivot_table\n output_1 = (\n test_df_1\n + gather(id_vars=[\"who\"], value_vars=[\"fare\"])\n + pivot_table(index=[\"who\"], values=[\"value\"], aggfunc=min)\n )\n expected_1 = test_df_1.pandas_df.melt(\n id_vars=[\"who\"], value_vars=[\"fare\"]\n ).pivot_table(index=[\"who\"], values=[\"value\"], aggfunc=min)\n pd.testing.assert_frame_equal(output_1.pandas_df, expected_1)\n\n # One_hot + write_file\n output_2 = test_df_1 + \\\n one_hot(columns=[\"embarked\"]) + write_file(\"one_hot.csv\")\n expected_2 = pd.get_dummies(test_df_1.pandas_df, columns=[\"embarked\"])\n pd.testing.assert_frame_equal(output_2.pandas_df, expected_2)\n\n assert os.path.exists(\"one_hot.csv\")\n os.remove(\"one_hot.csv\")\n\n # drop + fill_na + count_null\n output_3 = (\n test_df_1\n + drop(labels=[\"survived\", \"pclass\"], axis=1)\n + fill_na(value={\"deck\": \"A\"})\n + count_null(\"deck\")\n )\n expected_3 = 0\n assert output_3 == expected_3\n\n # query + apply\n output_4 = test_df_3 + select(\"age > 25\") + mutate(lambda b: b + 100)\n expected_4 = test_df_3.pandas_df.query(\"age > 25\").apply(lambda b: b + 100)\n pd.testing.assert_frame_equal(output_4.pandas_df, expected_4)\n\n # merge + drop_na\n output_5 = test_df_3 + \\\n join(test_df_4, on=\"pclass\", how=\"outer\") + drop_na()\n expected_5 = test_df_3.pandas_df.merge(\n test_df_4.pandas_df, on=\"pclass\", how=\"outer\"\n ).dropna()\n pd.testing.assert_frame_equal(output_5.pandas_df, expected_5)\n\n # merge + fill_na + drop\n output_6 = (\n test_df_3\n + join(test_df_4, on=\"pclass\", how=\"inner\")\n + fill_na(value=0)\n + drop(columns=\"sibsp_y\")\n )\n expected_6 = (\n test_df_3.pandas_df.merge(\n test_df_4.pandas_df, on=\"pclass\", how=\"inner\")\n .fillna(value=0)\n .drop(columns=\"sibsp_y\")\n )\n pd.testing.assert_frame_equal(output_6.pandas_df, expected_6)\n\n # one_hot + select + melt\n output_7 = (\n test_df_1\n + one_hot(columns=[\"class\"])\n + select(\"sex == 'female'\")\n + gather(id_vars=\"embark_town\", value_vars=\"alive\")\n )\n expected_7 = (\n pd.get_dummies(test_df_1.pandas_df, columns=[\"class\"])\n .query(\"sex == 'female'\")\n .melt(id_vars=\"embark_town\", value_vars=\"alive\")\n )\n pd.testing.assert_frame_equal(output_7.pandas_df, expected_7)\n\n # drop + side_effect + drop\n output_8 = (\n test_df_1\n + drop(columns=[\"parch\", \"adult_male\"])\n + side_effect(lambda df: print(df[\"who\"][0]))\n + write_file(\"drop.csv\")\n )\n expected_8 = test_df_1.pandas_df.drop(columns=[\"parch\", \"adult_male\"])\n pd.testing.assert_frame_equal(output_8.pandas_df, expected_8)\n\n assert os.path.exists(\"drop.csv\")\n os.remove(\"drop.csv\")\n" ]
[ [ "pandas.testing.assert_frame_equal", "pandas.DataFrame" ], [ "pandas.testing.assert_frame_equal", "pandas.get_dummies" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "0.23", "0.21", "2.0", "1.4", "1.3", "1.1", "1.5", "0.24", "0.20", "1.0", "0.25", "1.2" ], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [ "0.23", "0.21", "2.0", "1.4", "1.3", "1.1", "1.5", "0.24", "0.20", "1.0", "0.25", "1.2" ], "scipy": [], "tensorflow": [] } ]
padma-g/data
[ "b65e4e04a759ecc5b0b4df67e8cc290b0ddcadff" ]
[ "scripts/fbi/crime/preprocess.py" ]
[ "# Copyright 2021 Google LLC\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# https://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n\nimport csv\nimport io\nimport ssl\nimport urllib.request\nimport sys\nimport requests\nimport re\nimport os\nimport common_util as cu\n\nimport pandas as pd\nimport logging\nimport geocode_cities\n\n# Years that FBI doesn't public arson data.\n# 2019, 2018, 2017\n# The FBI does not publish arson data unless it receives data from either the agency or the state for all 12 months of the calendar year.\n\n_FIELDS_IN_CRIME_FILE = 15\n_POPULATION_INDEX = 3\n_YEAR_INDEX = 0\n_STATE_INDEX = 1\n_CITY_INDEX = 2\n_DUMMY_RAPE_INDEX = 7\n\n_CRIME_FIELDS = [\n 'Year',\n 'State',\n 'City',\n 'Population',\n # Violent Crimes\n 'Violent',\n 'ViolentMurderAndNonNegligentManslaughter',\n 'ViolentRape',\n 'Rape2',\n 'ViolentRobbery',\n 'ViolentAggravatedAssault',\n # Property Crimes\n 'Property',\n 'PropertyBurglary',\n 'PropertyLarcenyTheft',\n 'PropertyMotorVehicleTheft',\n # Arson\n 'PropertyArson',\n]\n\nGEO_CODE = 'Geocode'\nTOTAL = 'Total'\n\nOUTPUT_COLUMNS = [\n 'Year', 'GeoId', 'Count_CriminalActivities_ViolentCrime',\n 'Count_CriminalActivities_MurderAndNonNegligentManslaughter',\n 'Count_CriminalActivities_ForcibleRape', 'Count_CriminalActivities_Robbery',\n 'Count_CriminalActivities_AggravatedAssault',\n 'Count_CriminalActivities_PropertyCrime',\n 'Count_CriminalActivities_Burglary',\n 'Count_CriminalActivities_LarcenyTheft',\n 'Count_CriminalActivities_MotorVehicleTheft',\n 'Count_CriminalActivities_Arson', 'Count_CriminalActivities_CombinedCrime'\n]\n\n# From 2013-2016, the FBI reported statistics for two different definitions of rape before fully transitioning to the current definition in 2017.\n# We add a dummy column after it (so allyears have two Rape columns).\nYEARS_WITH_TWO_RAPE_COLUMNS = {'2013', '2014', '2015', '2016'}\n\nYEAR_TO_URL = {\n '2019':\n 'https://ucr.fbi.gov/crime-in-the-u.s/2019/crime-in-the-u.s.-2019/tables/table-8/table-8.xls',\n '2018':\n 'https://ucr.fbi.gov/crime-in-the-u.s/2018/crime-in-the-u.s.-2018/tables/table-8/table-8.xls',\n '2017':\n 'https://ucr.fbi.gov/crime-in-the-u.s/2017/crime-in-the-u.s.-2017/tables/table-8/table-8.xls',\n '2016':\n 'https://ucr.fbi.gov/crime-in-the-u.s/2016/crime-in-the-u.s.-2016/tables/table-6/table-6.xls',\n '2015':\n 'https://ucr.fbi.gov/crime-in-the-u.s/2015/crime-in-the-u.s.-2015/tables/table-8/table_8_offenses_known_to_law_enforcement_by_state_by_city_2015.xls',\n '2014':\n 'https://ucr.fbi.gov/crime-in-the-u.s/2014/crime-in-the-u.s.-2014/tables/table-8/Table_8_Offenses_Known_to_Law_Enforcement_by_State_by_City_2014.xls',\n '2013':\n 'https://ucr.fbi.gov/crime-in-the-u.s/2013/crime-in-the-u.s.-2013/tables/table-8/table_8_offenses_known_to_law_enforcement_by_state_by_city_2013.xls',\n '2012':\n 'https://ucr.fbi.gov/crime-in-the-u.s/2012/crime-in-the-u.s.-2012/tables/8tabledatadecpdf/table_8_offenses_known_to_law_enforcement_by_state_by_city_2012.xls',\n '2011':\n 'https://ucr.fbi.gov/crime-in-the-u.s/2011/crime-in-the-u.s.-2011/tables/table_8_offenses_known_to_law_enforcement_by_state_by_city_2011.xls',\n # Sanity check 2008-2010 don't have duplicate city state.\n '2010':\n 'https://ucr.fbi.gov/crime-in-the-u.s/2010/crime-in-the-u.s.-2010/tables/10tbl08.xls',\n '2009':\n 'https://www2.fbi.gov/ucr/cius2009/data/documents/09tbl08.xls',\n '2008':\n 'https://www2.fbi.gov/ucr/cius2008/data/documents/08tbl08.xls',\n}\n\n\ndef calculate_crimes(r):\n # Return the violent, property, arson crimes & total\n # If a field is empty, it is treated as 0\n\n # Category 1: Violent Crimes\n violent = cu.int_from_field(r['Violent'])\n\n murder = cu.int_from_field(r['ViolentMurderAndNonNegligentManslaughter'])\n rape = cu.int_from_field(r['ViolentRape'])\n rape2 = cu.int_from_field(r['Rape2'])\n robbery = cu.int_from_field(r['ViolentRobbery'])\n assault = cu.int_from_field(r['ViolentAggravatedAssault'])\n # Fix rape value\n rape += rape2\n\n # Add the values back as ints\n r['ViolentMurderAndNonNegligentManslaughter'] = murder\n r['ViolentRape'] = rape\n r['Rape2'] = rape2\n r['ViolentRobbery'] = robbery\n r['ViolentAggravatedAssault'] = assault\n\n violent_computed = murder + rape + robbery + assault\n if violent_computed != violent:\n print('{} {} {} violent mismatch {} {}'.format(r['Year'], r['City'],\n r['State'], violent,\n violent_computed))\n\n # Category 2: Property Crime\n property = cu.int_from_field(r['Property'])\n\n burglary = cu.int_from_field(r['PropertyBurglary'])\n theft = cu.int_from_field(r['PropertyLarcenyTheft'])\n motor = cu.int_from_field(r['PropertyMotorVehicleTheft'])\n\n # Add the property crime values as ints.\n r['PropertyBurglary'] = burglary\n r['PropertyLarcenyTheft'] = theft\n r['PropertyMotorVehicleTheft'] = motor\n\n # Compute totals\n property_computed = burglary + theft + motor\n\n if property_computed != property:\n print('{} {} {} property mismatch {} {}'.format(r['Year'], r['City'],\n r['State'], property,\n property_computed))\n\n # Category 3: Arson\n arson = cu.int_from_field(r['PropertyArson'])\n r['PropertyArson'] = arson\n\n total = violent_computed + property_computed + arson\n # Write back the totals\n r[TOTAL] = total\n r['Violent'] = violent_computed\n r['Property'] = property_computed\n\n\ndef _clean_crime_file(f_input, f_output):\n \"\"\"Clean a tsv file of crime statistics.\n\n The input contains crime statistics, one for every city.\n\n Remove header and footer lines, and append state column to every line.\n Skip lines that do not contain data.\n Args:\n f_input: file object with crime statistics, one per city.\n f_output: outputstream for writing the cleaned statistics.\n \"\"\"\n state = ''\n count_line = 0\n count_city = 0\n count_state = 0\n count_header_footer = 0\n count_incomplete_lines = 0\n count_comments = 0\n for line in f_input:\n count_line += 1\n if line.startswith('#'):\n count_comments += 1\n continue\n # Split by comma and exclude comma from quotes in split\n # For case like PENNSYLVANIA,\"Abington Township, Montgomery County\",55476.0,53.0,0.0,6.0,0,15.0,32.0,934.0,32.0,883.0,19.0,2.0\n field = [\n '\"{}\"'.format(x)\n for x in list(csv.reader([line], delimiter=',', quotechar='\"'))[0]\n ]\n\n # Skip incomplete lines\n if len(field) < _FIELDS_IN_CRIME_FILE:\n count_incomplete_lines += 1\n logging.info('%s %s', line, len(field))\n continue\n\n # Replace commas and quotes in fields e.g. \"1,234\" -> 1234\n # Remove any other leading or trailing whitespace\n for i in range(_FIELDS_IN_CRIME_FILE):\n field[i] = cu.remove_extra_chars(field[i])\n\n # Skip if the line does not contain data or if population is empty.\n if (not field[_POPULATION_INDEX] or\n not cu.is_digit(field[_POPULATION_INDEX]) or\n field[_POPULATION_INDEX] == '0'):\n count_header_footer += 1\n continue\n\n # If field[_STATE_INDEX] is present, use it as the State.\n if field[_STATE_INDEX]:\n # Remove numeric values from state names (comes from footnotes)\n state = cu.remove_digits(field[_STATE_INDEX])\n count_state += 1\n field[_STATE_INDEX] = state\n # Remove any numeric characters from city names.\n field[_CITY_INDEX] = cu.remove_digits(field[_CITY_INDEX])\n count_city += 1\n\n output_line = '{}\\n'.format(','.join(field[:_FIELDS_IN_CRIME_FILE]))\n f_output.write(output_line)\n\n logging.info('lines: %d, comments: %d, incomplete: %d, header_footer:%d',\n count_line, count_comments, count_incomplete_lines,\n count_header_footer)\n logging.info('%d cities', count_city)\n logging.info('%d states', count_state)\n\n\ndef _update_and_calculate_crime_csv(geo_codes, crime_csv, writer):\n with open(crime_csv, \"r\") as crime_f:\n crimes = csv.DictReader(crime_f, fieldnames=_CRIME_FIELDS)\n\n found_set = set()\n cities_not_found_set = set()\n for crime in crimes:\n if geocode_cities.update_crime_geocode(crime, geo_codes, found_set,\n cities_not_found_set):\n calculate_crimes(crime)\n\n processed_dict = {\n 'Year':\n crime['Year'],\n 'GeoId':\n \"dcid:geoId/{}\".format(crime[GEO_CODE]),\n 'Count_CriminalActivities_ViolentCrime':\n crime['Violent'],\n 'Count_CriminalActivities_MurderAndNonNegligentManslaughter':\n crime['ViolentMurderAndNonNegligentManslaughter'],\n 'Count_CriminalActivities_ForcibleRape':\n crime['ViolentRape'],\n 'Count_CriminalActivities_Robbery':\n crime['ViolentRobbery'],\n 'Count_CriminalActivities_AggravatedAssault':\n crime['ViolentAggravatedAssault'],\n 'Count_CriminalActivities_PropertyCrime':\n crime['Property'],\n 'Count_CriminalActivities_Burglary':\n crime['PropertyBurglary'],\n 'Count_CriminalActivities_LarcenyTheft':\n crime['PropertyLarcenyTheft'],\n 'Count_CriminalActivities_MotorVehicleTheft':\n crime['PropertyMotorVehicleTheft'],\n 'Count_CriminalActivities_Arson':\n crime['PropertyArson'],\n 'Count_CriminalActivities_CombinedCrime':\n crime[TOTAL],\n }\n writer.writerow(processed_dict)\n\n # Output the cities not_found\n with open('city_not_found.txt', 'w') as cities_not_found_f:\n for s in cities_not_found_set:\n cities_not_found_f.write('{}\\n'.format(s))\n\n print('US src_cities = {}, cities_not_found = {}'.format(\n len(found_set), len(cities_not_found_set)))\n\n\ndef create_tmcf_file(tmcf_file_path):\n stat_vars = OUTPUT_COLUMNS[2:]\n with open(tmcf_file_path, 'w', newline='') as f_out:\n for i in range(len(stat_vars)):\n f_out.write(\n cu.TEMPLATE_MCF_TEMPLATE.format_map({\n 'index': i,\n 'stat_var': stat_vars[i]\n }))\n\n\ndef create_formatted_csv_file(csv_files, city_output):\n geo_codes = geocode_cities.read_geocodes()\n\n with open(city_output, 'w') as csv_output_f:\n writer = csv.DictWriter(csv_output_f, fieldnames=OUTPUT_COLUMNS)\n writer.writeheader()\n\n for csv_file in csv_files:\n with open(csv_file, \"r\") as f_input:\n cleaned_csv_file = 'cleaned_file.csv'\n with open(cleaned_csv_file, \"w\") as f_output:\n logging.info('clean crime file for csv file %s', csv_file)\n _clean_crime_file(f_input, f_output)\n\n _update_and_calculate_crime_csv(geo_codes, cleaned_csv_file,\n writer)\n\n # Remove intermediate files.\n os.remove(cleaned_csv_file)\n\n\nif __name__ == '__main__':\n logging.getLogger().setLevel(logging.INFO)\n\n # Script XLS and convert to CSV.\n # Add year as the first column and second rape column is not there.\n csv_files = []\n for year, url in YEAR_TO_URL.items():\n response = requests.get(url)\n xls_file = year + '.xls'\n csv_file = year + '.csv'\n with open(xls_file, 'wb') as file:\n file.write(response.content)\n read_file = pd.read_excel(xls_file, skiprows=[0, 1, 2])\n read_file.insert(_YEAR_INDEX, 'Year', year)\n if year not in YEARS_WITH_TWO_RAPE_COLUMNS:\n read_file.insert(_DUMMY_RAPE_INDEX, 'Dummy', 0)\n read_file.to_csv(csv_file, index=None, header=True)\n csv_files.append(csv_file)\n # os.remove(xls_file)\n\n create_formatted_csv_file(csv_files, 'city_crime.csv')\n\n create_tmcf_file(\"FBI_crime.tmcf\")\n\n # Remove intermediate files.\n for csv_file in csv_files:\n os.remove(csv_file)\n" ]
[ [ "pandas.read_excel" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "0.23", "0.21", "2.0", "1.4", "0.19", "1.1", "1.5", "1.2", "0.24", "0.20", "1.0", "0.25", "1.3" ], "scipy": [], "tensorflow": [] } ]
preetham7897/Estimation-of-Rainfall-Quantity-using-Hybrid-Ensemble-Regression
[ "659fa450e28eeea262295e86c5ebe04a50a8a88b" ]
[ "codes/simple average.py" ]
[ "import pandas as pd\r\nfrom sklearn.linear_model import LinearRegression\r\nfrom sklearn.tree import DecisionTreeRegressor\r\nfrom sklearn.svm import SVR\r\nfrom sklearn.preprocessing import PolynomialFeatures\r\nfrom sklearn.metrics import mean_squared_error as mse\r\nfrom sklearn.metrics import mean_absolute_error as mae\r\nfrom sklearn.metrics import median_absolute_error as mdae\r\nfrom sklearn.metrics import explained_variance_score as evs\r\nfrom sklearn.metrics import r2_score as r2\r\nfrom sklearn.model_selection import RepeatedKFold\r\nimport numpy as np\r\nfrom itertools import combinations\r\n\r\ndef rmse(y_t, y_p):\r\n return (mse(y_t, y_p))**0.5\r\n\r\nrkf = RepeatedKFold(n_splits=10, n_repeats=10)\r\ndata = pd.read_csv('C:\\\\Users\\\\Preetham G\\\\Documents\\\\Research Projects\\\\Forecast of Rainfall Quantity and its variation using Envrionmental Features\\\\Data\\\\Normalized & Combined Data\\\\All Districts.csv')\r\nmodels = [LinearRegression(), DecisionTreeRegressor(max_depth=6), LinearRegression(), SVR(kernel='linear')]\r\nnames = ['MLR', 'DTR(6)', 'PR(4)', 'SVR(L)']\r\ncomb_models = []\r\ncomb_names = []\r\nfor i in range(1, len(models)+1):\r\n l = combinations(models, i)\r\n m = combinations(names, i)\r\n for j in l:\r\n comb_models.append(list(j))\r\n for j in m:\r\n comb_names.append(list(j))\r\ndata = data.drop(columns=['Index', 'District'])\r\nmse_f = []\r\nrmse_f = []\r\nmae_f = []\r\nmdae_f = []\r\nevs_f = []\r\nr2_f = []\r\npoly = PolynomialFeatures(degree=4)\r\nfor i, j in zip(comb_models, comb_names):\r\n c = 0\r\n mse_t = []\r\n rmse_t = []\r\n mae_t = []\r\n mdae_t = []\r\n evs_t = []\r\n r2_t = []\r\n for tr_i, ts_i in rkf.split(data):\r\n train, test = data.iloc[tr_i], data.iloc[ts_i]\r\n train_x = train.drop(columns=['Rainfall'])\r\n train_y = train['Rainfall']\r\n test_x = test.drop(columns=['Rainfall'])\r\n test_y = test['Rainfall']\r\n d = {}\r\n for k, l in zip(i, j):\r\n print(j, l, c)\r\n model = k\r\n if l == 'PR(4)':\r\n train_x = poly.fit_transform(train_x)\r\n test_x = poly.fit_transform(test_x)\r\n model.fit(train_x, train_y)\r\n ts_p = model.predict(test_x)\r\n d[l] = list(ts_p)\r\n c += 1\r\n df = pd.DataFrame(d, columns=names)\r\n ts_p_m = df.mean(axis=1)\r\n mse_t.append(mse(test_y, ts_p_m))\r\n rmse_t.append(rmse(test_y, ts_p_m))\r\n mae_t.append(mae(test_y, ts_p_m))\r\n mdae_t.append(mdae(test_y, ts_p_m))\r\n evs_t.append(evs(test_y, ts_p_m))\r\n r2_t.append(r2(test_y, ts_p_m))\r\n mse_f.append(np.mean(mse_t))\r\n rmse_f.append(np.mean(rmse_t))\r\n mae_f.append(np.mean(mae_t))\r\n mdae_f.append(np.mean(mdae_t))\r\n evs_f.append(np.mean(evs_t))\r\n r2_f.append(np.mean(r2_t))\r\nd = {}\r\nd['Combinations'] = comb_names\r\nd['MSE'] = mse_f\r\nd['RMSE'] = rmse_f\r\nd['MAE'] = mae_f\r\nd['MDAE'] = mdae_f\r\nd['EVS'] = evs_f\r\nd['R2'] = r2_f\r\ndf = pd.DataFrame(d, columns=['Combinations', 'MSE', 'RMSE', 'MAE', 'MDAE', 'EVS', 'R2'])\r\ndf.to_csv('C:\\\\Users\\\\Preetham G\\\\Documents\\\\Research Projects\\\\Ensemble Rainfall\\\\Results\\\\Simple Average.csv', index=False)" ]
[ [ "sklearn.metrics.explained_variance_score", "sklearn.model_selection.RepeatedKFold", "pandas.read_csv", "sklearn.tree.DecisionTreeRegressor", "sklearn.metrics.r2_score", "sklearn.metrics.median_absolute_error", "sklearn.metrics.mean_absolute_error", "sklearn.preprocessing.PolynomialFeatures", "pandas.DataFrame", "sklearn.metrics.mean_squared_error", "sklearn.svm.SVR", "numpy.mean", "sklearn.linear_model.LinearRegression" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "2.0", "1.4", "1.3", "1.1", "1.5", "1.2" ], "scipy": [], "tensorflow": [] } ]
Sidbenake/ga-learner-dsmp-repo
[ "273af724ddea5c4eb957065def51e17ff9ad1279" ]
[ "Decision-Tree/code.py" ]
[ "# --------------\nimport pandas as pd\nfrom sklearn.model_selection import train_test_split\ndata = pd.read_csv(path)\nX = data.drop(['customer.id','paid.back.loan'],axis=1)\ny = data['paid.back.loan']\nX_train,X_test,y_train,y_test = train_test_split(X,y,test_size=0.3,random_state=0)\n\n\n# --------------\n#Importing header files\nimport matplotlib.pyplot as plt\n\n# Code starts here\nfully_paid = y_train.value_counts()\nplt.bar(fully_paid.index,fully_paid.values)\n\n# Code ends here\n\n\n# --------------\n#Importing header files\nimport numpy as np\nfrom sklearn.preprocessing import LabelEncoder\n\n\n# Code starts here\nX_train['int.rate'] = X_train['int.rate'].apply(lambda x: float(x[:-1]))\nX_train['int.rate'] = X_train['int.rate']/100\n\nX_test['int.rate'] = X_test['int.rate'].apply(lambda x: float(x[:-1]))\nX_test['int.rate'] = X_test['int.rate']/100\n\nnum_df = X_train.select_dtypes('number')\ncat_df = X_train.select_dtypes('object')\n# Code ends here\n\n\n\n# --------------\n#Importing header files\nimport seaborn as sns\n\n\n# Code starts here\ncols = num_df.columns\nfig, axes = plt.subplots(9,1)\nfor i in range(9):\n sns.boxplot(x=y_train, y=num_df[cols[i]],ax=axes[i])\n# Code ends here\n\n\n# --------------\n# Code starts here\ncols = cat_df.columns\nfig, axes = plt.subplots(2,2)\nfor i in range(2):\n for j in range(2):\n sns.countplot(x=X_train[cols[i*2+j]], hue=y_train,ax = axes[i,j])\n\n\n# Code ends here\n\n\n# --------------\n#Importing header files\nfrom sklearn.tree import DecisionTreeClassifier\nfrom sklearn.preprocessing import LabelEncoder\nimport numpy as np\n# Code starts here\nX_train.fillna(np.nan)\nX_test.fillna(np.nan)\n\nle = LabelEncoder()\nfor i in cat_df.columns:\n X_train[i] = le.fit_transform(X_train[i])\n X_test[i] = le.fit_transform(X_test[i])\n\ny_train[y_train=='Yes']=1\ny_train[y_train=='No']=0\n\ny_test[y_test=='Yes']=1\ny_test[y_test=='No']=0\n\ny_train = y_train.astype('int')\ny_test = y_test.astype('int')\n\nmodel = DecisionTreeClassifier(random_state=0)\n\nmodel.fit(X_train,y_train)\n\nacc = model.score(X_test,y_test)\n\nprint(acc)\n# Code ends here\n\n\n# --------------\n#Importing header files\nfrom sklearn.model_selection import GridSearchCV\n\n#Parameter grid\nparameter_grid = {'max_depth': np.arange(3,10), 'min_samples_leaf': range(10,50,10)}\n\n# Code starts here\nmodel_2 = DecisionTreeClassifier(random_state=0)\np_tree = GridSearchCV(estimator=model_2,param_grid=parameter_grid,cv=5)\n\np_tree.fit(X_train,y_train)\n\nacc_2 = p_tree.score(X_test,y_test)\n\nprint(acc_2)\n# Code ends here\n\n\n# --------------\n#Importing header files\n\nfrom io import StringIO\nfrom sklearn.tree import export_graphviz\nfrom sklearn import tree\nfrom sklearn import metrics\nfrom IPython.display import Image\nimport pydotplus\n\n# Code starts here\ndot_data = tree.export_graphviz(decision_tree=p_tree.best_estimator_, out_file=None,\n feature_names=X.columns, filled = True, \n class_names=['loan_paid_back_yes','loan_paid_back_no'])\n\ngraph_big = pydotplus.graph_from_dot_data(dot_data)\n\n\n# show graph - do not delete/modify the code below this line\nimg_path = user_data_dir+'/file.png'\ngraph_big.write_png(img_path)\n\nplt.figure(figsize=(20,15))\nplt.imshow(plt.imread(img_path))\nplt.axis('off')\nplt.show() \n\n# Code ends here\n\n\n" ]
[ [ "sklearn.model_selection.GridSearchCV", "pandas.read_csv", "sklearn.tree.export_graphviz", "numpy.arange", "matplotlib.pyplot.imread", "matplotlib.pyplot.subplots", "sklearn.model_selection.train_test_split", "sklearn.tree.DecisionTreeClassifier", "matplotlib.pyplot.bar", "matplotlib.pyplot.axis", "sklearn.preprocessing.LabelEncoder", "matplotlib.pyplot.show", "matplotlib.pyplot.figure" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "2.0", "1.4", "1.1", "1.5", "1.2", "1.3" ], "scipy": [], "tensorflow": [] } ]
jbohnslav/kornia
[ "74cc0cfd6406179570b06ca4ef8423142e7eaa0b", "74cc0cfd6406179570b06ca4ef8423142e7eaa0b", "74cc0cfd6406179570b06ca4ef8423142e7eaa0b" ]
[ "kornia/utils/image.py", "test/geometry/epipolar/test_fundamental.py", "test/augmentation/test_augmentation_mix.py" ]
[ "from typing import Optional\n\nimport numpy as np\nimport torch\n\n\ndef image_to_tensor(image: np.ndarray, keepdim: bool = True) -> torch.Tensor:\n \"\"\"Converts a numpy image to a PyTorch 4d tensor image.\n\n Args:\n image (numpy.ndarray): image of the form :math:`(H, W, C)`, :math:`(H, W)` or\n :math:`(B, H, W, C)`.\n keepdim (bool): If ``False`` unsqueeze the input image to match the shape\n :math:`(B, H, W, C)`. Default: ``True``\n\n Returns:\n torch.Tensor: tensor of the form :math:`(B, C, H, W)` if keepdim is ``False``,\n :math:`(C, H, W)` otherwise.\n \"\"\"\n if not isinstance(image, (np.ndarray,)):\n raise TypeError(\"Input type must be a numpy.ndarray. Got {}\".format(\n type(image)))\n\n if len(image.shape) > 4 or len(image.shape) < 2:\n raise ValueError(\n \"Input size must be a two, three or four dimensional array\")\n\n input_shape = image.shape\n tensor: torch.Tensor = torch.from_numpy(image)\n\n if len(input_shape) == 2:\n # (H, W) -> (1, H, W)\n tensor = tensor.unsqueeze(0)\n elif len(input_shape) == 3:\n # (H, W, C) -> (C, H, W)\n tensor = tensor.permute(2, 0, 1)\n elif len(input_shape) == 4:\n # (B, H, W, C) -> (B, C, H, W)\n tensor = tensor.permute(0, 3, 1, 2)\n keepdim = True # no need to unsqueeze\n else:\n raise ValueError(\n \"Cannot process image with shape {}\".format(input_shape))\n\n return tensor.unsqueeze(0) if not keepdim else tensor\n\n\ndef _to_bchw(tensor: torch.Tensor, color_channel_num: Optional[int] = None) -> torch.Tensor:\n \"\"\"Converts a PyTorch tensor image to BCHW format.\n\n Args:\n tensor (torch.Tensor): image of the form :math:`(H, W)`, :math:`(C, H, W)`, :math:`(H, W, C)` or\n :math:`(B, C, H, W)`.\n color_channel_num (Optional[int]): Color channel of the input tensor.\n If None, it will not alter the input channel.\n\n Returns:\n torch.Tensor: input tensor of the form :math:`(B, H, W, C)`.\n \"\"\"\n if not isinstance(tensor, torch.Tensor):\n raise TypeError(f\"Input type is not a torch.Tensor. Got {type(tensor)}\")\n\n if len(tensor.shape) > 4 or len(tensor.shape) < 2:\n raise ValueError(f\"Input size must be a two, three or four dimensional tensor. Got {tensor.shape}\")\n\n if len(tensor.shape) == 2:\n tensor = tensor.unsqueeze(0)\n\n if len(tensor.shape) == 3:\n tensor = tensor.unsqueeze(0)\n\n # TODO(jian): this function is never used. Besides is not feasible for torchscript.\n # In addition, the docs must be updated. I don't understand what is doing.\n # if color_channel_num is not None and color_channel_num != 1:\n # channel_list = [0, 1, 2, 3]\n # channel_list.insert(1, channel_list.pop(color_channel_num))\n # tensor = tensor.permute(*channel_list)\n return tensor\n\n\ndef _to_bcdhw(tensor: torch.Tensor, color_channel_num: Optional[int] = None) -> torch.Tensor:\n \"\"\"Converts a PyTorch tensor image to BCHW format.\n Args:\n tensor (torch.Tensor): image of the form :math:`(D, H, W)`, :math:`(C, D, H, W)`, :math:`(D, H, W, C)` or\n :math:`(B, C, D, H, W)`.\n color_channel_num (Optional[int]): Color channel of the input tensor.\n If None, it will not alter the input channel.\n\n Returns:\n torch.Tensor: input tensor of the form :math:`(B, C, D, H, W)`.\n \"\"\"\n if not isinstance(tensor, torch.Tensor):\n raise TypeError(f\"Input type is not a torch.Tensor. Got {type(tensor)}\")\n\n if len(tensor.shape) > 5 or len(tensor.shape) < 3:\n raise ValueError(f\"Input size must be a three, four or five dimensional tensor. Got {tensor.shape}\")\n\n if len(tensor.shape) == 3:\n tensor = tensor.unsqueeze(0)\n\n if len(tensor.shape) == 4:\n tensor = tensor.unsqueeze(0)\n\n # TODO(jian): this function is never used. Besides is not feasible for torchscript.\n # In addition, the docs must be updated. I don't understand what is doing.\n # if color_channel_num is not None and color_channel_num != 1:\n # channel_list = [0, 1, 2, 3, 4]\n # channel_list.insert(1, channel_list.pop(color_channel_num))\n # tensor = tensor.permute(*channel_list)\n return tensor\n\n\ndef tensor_to_image(tensor: torch.Tensor) -> np.array:\n \"\"\"Converts a PyTorch tensor image to a numpy image.\n\n In case the tensor is in the GPU, it will be copied back to CPU.\n\n Args:\n tensor (torch.Tensor): image of the form :math:`(H, W)`, :math:`(C, H, W)` or\n :math:`(B, C, H, W)`.\n\n Returns:\n numpy.ndarray: image of the form :math:`(H, W)`, :math:`(H, W, C)` or :math:`(B, H, W, C)`.\n\n \"\"\"\n if not isinstance(tensor, torch.Tensor):\n raise TypeError(\"Input type is not a torch.Tensor. Got {}\".format(\n type(tensor)))\n\n if len(tensor.shape) > 4 or len(tensor.shape) < 2:\n raise ValueError(\n \"Input size must be a two, three or four dimensional tensor\")\n\n input_shape = tensor.shape\n image: np.array = tensor.cpu().detach().numpy()\n\n if len(input_shape) == 2:\n # (H, W) -> (H, W)\n image = image\n elif len(input_shape) == 3:\n # (C, H, W) -> (H, W, C)\n if input_shape[0] == 1:\n # Grayscale for proper plt.imshow needs to be (H,W)\n image = image.squeeze()\n else:\n image = image.transpose(1, 2, 0)\n elif len(input_shape) == 4:\n # (B, C, H, W) -> (B, H, W, C)\n image = image.transpose(0, 2, 3, 1)\n if input_shape[0] == 1:\n image = image.squeeze(0)\n if input_shape[1] == 1:\n image = image.squeeze(-1)\n else:\n raise ValueError(\n \"Cannot process tensor with shape {}\".format(input_shape))\n\n return image\n", "import pytest\n\nimport torch\nfrom torch.autograd import gradcheck\nfrom torch.testing import assert_allclose\n\nimport kornia.geometry.epipolar as epi\n\nimport test_common as utils\n\n\nclass TestNormalizePoints:\n def test_smoke(self, device, dtype):\n points = torch.rand(1, 1, 2, device=device, dtype=dtype)\n output = epi.normalize_points(points)\n assert len(output) == 2\n assert output[0].shape == (1, 1, 2)\n assert output[1].shape == (1, 3, 3)\n\n @pytest.mark.parametrize(\n \"batch_size, num_points\", [(1, 2), (2, 3), (3, 2)],\n )\n def test_shape(self, batch_size, num_points, device, dtype):\n B, N = batch_size, num_points\n points = torch.rand(B, N, 2, device=device, dtype=dtype)\n output = epi.normalize_points(points)\n assert output[0].shape == (B, N, 2)\n assert output[1].shape == (B, 3, 3)\n\n def test_mean_std(self, device, dtype):\n points = torch.tensor([[\n [0., 0.], [0., 2.], [1., 1.], [1., 3.]\n ]], device=device, dtype=dtype)\n\n points_norm, trans = epi.normalize_points(points)\n points_std, points_mean = torch.std_mean(points_norm, dim=1)\n\n assert_allclose(points_mean, torch.zeros_like(points_mean))\n assert (points_std < 2.).all()\n\n def test_gradcheck(self, device):\n points = torch.rand(2, 3, 2,\n device=device, requires_grad=True, dtype=torch.float64)\n assert gradcheck(epi.normalize_points, (points,), raise_exception=True)\n\n\nclass TestNormalizeTransformation:\n def test_smoke(self, device, dtype):\n trans = torch.rand(2, 2, device=device, dtype=dtype)\n trans_norm = epi.normalize_transformation(trans)\n assert trans_norm.shape == (2, 2)\n\n @pytest.mark.parametrize(\n \"batch_size, rows, cols\", [(1, 2, 2), (2, 3, 3), (3, 4, 4), (2, 1, 2)],\n )\n def test_shape(self, batch_size, rows, cols, device, dtype):\n B, N, M = batch_size, rows, cols\n trans = torch.rand(B, N, M, device=device, dtype=dtype)\n trans_norm = epi.normalize_transformation(trans)\n assert trans_norm.shape == (B, N, M)\n\n def test_check_last_val(self, device, dtype):\n trans = torch.tensor([[\n [0.0, 0.0, 1.0],\n [0.0, 2.0, 0.0],\n [0.5, 0.0, 0.5]\n ]], device=device, dtype=dtype)\n\n trans_expected = torch.tensor([[\n [0.0, 0.0, 2.0],\n [0.0, 4.0, 0.0],\n [1.0, 0.0, 1.0]\n ]], device=device, dtype=dtype)\n\n trans_norm = epi.normalize_transformation(trans)\n assert_allclose(trans_norm, trans_expected)\n\n def test_check_corner_case(self, device, dtype):\n trans = torch.tensor([[\n [0.0, 0.0, 1.0],\n [0.0, 2.0, 0.0],\n [0.5, 0.0, 0.0]\n ]], device=device, dtype=dtype)\n\n trans_expected = trans.clone()\n\n trans_norm = epi.normalize_transformation(trans)\n assert_allclose(trans_norm, trans_expected)\n\n def test_gradcheck(self, device):\n trans = torch.rand(2, 3, 3,\n device=device, requires_grad=True, dtype=torch.float64)\n assert gradcheck(epi.normalize_transformation, (trans,), raise_exception=True)\n\n\nclass TestFindFundamental:\n def test_smoke(self, device, dtype):\n points1 = torch.rand(1, 1, 2, device=device, dtype=dtype)\n points2 = torch.rand(1, 1, 2, device=device, dtype=dtype)\n weights = torch.ones(1, 1, device=device, dtype=dtype)\n F_mat = epi.find_fundamental(points1, points2, weights)\n assert F_mat.shape == (1, 3, 3)\n\n @pytest.mark.parametrize(\n \"batch_size, num_points\", [(1, 2), (2, 3), (3, 2)],\n )\n def test_shape(self, batch_size, num_points, device, dtype):\n B, N = batch_size, num_points\n points1 = torch.rand(B, N, 2, device=device, dtype=dtype)\n points2 = torch.rand(B, N, 2, device=device, dtype=dtype)\n weights = torch.ones(B, N, device=device, dtype=dtype)\n F_mat = epi.find_fundamental(points1, points2, weights)\n assert F_mat.shape == (B, 3, 3)\n\n def test_opencv(self, device, dtype):\n points1 = torch.tensor([[\n [0.8569, 0.5982],\n [0.0059, 0.9649],\n [0.1968, 0.8846],\n [0.6084, 0.3467],\n [0.9633, 0.5274],\n [0.8941, 0.8939],\n [0.0863, 0.5133],\n [0.2645, 0.8882],\n [0.2411, 0.3045],\n [0.8199, 0.4107]]], device=device, dtype=dtype)\n\n points2 = torch.tensor([[\n [0.0928, 0.3013],\n [0.0989, 0.9649],\n [0.0341, 0.4827],\n [0.8294, 0.4469],\n [0.2230, 0.2998],\n [0.1722, 0.8182],\n [0.5264, 0.8869],\n [0.8908, 0.1233],\n [0.2338, 0.7663],\n [0.4466, 0.5696]]], device=device, dtype=dtype)\n\n weights = torch.ones(1, 10, device=device, dtype=dtype)\n\n # generated with OpenCV using above points\n # import cv2\n # Fm_expected, _ = cv2.findFundamentalMat(\n # points1.detach().numpy().reshape(-1, 1, 2),\n # points2.detach().numpy().reshape(-1, 1, 2), cv2.FM_8POINT)\n\n Fm_expected = torch.tensor([[\n [-0.47408533, 0.22033807, -0.00346677],\n [0.54935973, 1.31080955, -1.25028275],\n [-0.36690215, -1.08143769, 1.]]], device=device, dtype=dtype)\n\n F_mat = epi.find_fundamental(points1, points2, weights)\n assert_allclose(F_mat, Fm_expected, rtol=1e-4, atol=1e-4)\n\n @pytest.mark.xfail(reason=\"TODO: fix #685\")\n def test_synthetic_sampson(self, device, dtype):\n\n scene: Dict[str, torch.Tensor] = utils.generate_two_view_random_scene(device, dtype)\n\n x1 = scene['x1']\n x2 = scene['x2']\n\n weights = torch.ones_like(x1)[..., 0]\n F_est = epi.find_fundamental(x1, x2, weights)\n\n error = epi.sampson_epipolar_distance(x1, x2, F_est)\n assert_allclose(error, torch.tensor(0., device=device, dtype=dtype), atol=1e-4, rtol=1e-4)\n\n def test_gradcheck(self, device):\n points1 = torch.rand(1, 10, 2, device=device, dtype=torch.float64, requires_grad=True)\n points2 = torch.rand(1, 10, 2, device=device, dtype=torch.float64)\n weights = torch.ones(1, 10, device=device, dtype=torch.float64)\n assert gradcheck(epi.find_fundamental,\n (points1, points2, weights,), raise_exception=True)\n\n\nclass TestComputeCorrespondEpilimes:\n def test_smoke(self, device, dtype):\n point = torch.rand(1, 1, 2, device=device, dtype=dtype)\n F_mat = torch.rand(1, 3, 3, device=device, dtype=dtype)\n lines = epi.compute_correspond_epilines(point, F_mat)\n assert lines.shape == (1, 1, 3)\n\n @pytest.mark.parametrize(\n \"batch_size, num_points\", [(1, 2), (2, 3), (3, 2)],\n )\n def test_shape(self, batch_size, num_points, device, dtype):\n B, N = batch_size, num_points\n point = torch.rand(B, N, 2, device=device, dtype=dtype)\n F_mat = torch.rand(B, 3, 3, device=device, dtype=dtype)\n lines = epi.compute_correspond_epilines(point, F_mat)\n assert lines.shape == (B, N, 3)\n\n def test_opencv(self, device, dtype):\n point = torch.rand(1, 2, 2, device=device, dtype=dtype)\n F_mat = torch.rand(1, 3, 3, device=device, dtype=dtype)\n\n point = torch.tensor([[\n [0.9794, 0.7994],\n [0.8163, 0.8500],\n ]], device=device, dtype=dtype)\n\n F_mat = torch.tensor([[\n [0.1185, 0.4438, 0.9869],\n [0.5670, 0.9447, 0.4100],\n [0.1546, 0.2554, 0.4485],\n ]], device=device, dtype=dtype)\n\n # generated with OpenCV using above points\n # import cv2\n # lines_expected = cv2.computeCorrespondEpilines(\n # point.detach().numpy().reshape(-1, 1, 2), 0,\n # F_mat.detach().numpy()[0]).transpose(1, 0, 2)\n\n lines_expected = torch.tensor([[\n [0.64643687, 0.7629675, 0.35658622],\n [0.65710586, 0.7537983, 0.35616538],\n ]], device=device, dtype=dtype)\n\n lines_est = epi.compute_correspond_epilines(point, F_mat)\n assert_allclose(lines_est, lines_expected, rtol=1e-4, atol=1e-4)\n\n def test_gradcheck(self, device):\n point = torch.rand(1, 4, 2, device=device, dtype=torch.float64, requires_grad=True)\n F_mat = torch.rand(1, 3, 3, device=device, dtype=torch.float64)\n assert gradcheck(epi.compute_correspond_epilines,\n (point, F_mat,), raise_exception=True)\n\n\nclass TestFundamentlFromEssential:\n def test_smoke(self, device, dtype):\n E_mat = torch.rand(1, 3, 3, device=device, dtype=dtype)\n K1 = torch.rand(1, 3, 3, device=device, dtype=dtype)\n K2 = torch.rand(1, 3, 3, device=device, dtype=dtype)\n F_mat = epi.fundamental_from_essential(E_mat, K1, K2)\n assert F_mat.shape == (1, 3, 3)\n\n @pytest.mark.parametrize(\"batch_size\", [1, 2, 4, 7])\n def test_shape(self, batch_size, device, dtype):\n B: int = batch_size\n E_mat = torch.rand(B, 3, 3, device=device, dtype=dtype)\n K1 = torch.rand(B, 3, 3, device=device, dtype=dtype)\n K2 = torch.rand(1, 3, 3, device=device, dtype=dtype) # check broadcasting\n F_mat = epi.fundamental_from_essential(E_mat, K1, K2)\n assert F_mat.shape == (B, 3, 3)\n\n def test_shape_large(self, device, dtype):\n E_mat = torch.rand(1, 2, 3, 3, device=device, dtype=dtype)\n K1 = torch.rand(1, 2, 3, 3, device=device, dtype=dtype)\n K2 = torch.rand(1, 1, 3, 3, device=device, dtype=dtype) # check broadcasting\n F_mat = epi.fundamental_from_essential(E_mat, K1, K2)\n assert F_mat.shape == (1, 2, 3, 3)\n\n def test_from_to_essential(self, device, dtype):\n scene = utils.generate_two_view_random_scene(device, dtype)\n\n F_mat = scene['F']\n E_mat = epi.essential_from_fundamental(F_mat, scene['K1'], scene['K2'])\n F_hat = epi.fundamental_from_essential(E_mat, scene['K1'], scene['K2'])\n\n F_mat_norm = epi.normalize_transformation(F_mat)\n F_hat_norm = epi.normalize_transformation(F_hat)\n assert_allclose(F_mat_norm, F_hat_norm)\n\n def test_gradcheck(self, device):\n E_mat = torch.rand(1, 3, 3, device=device, dtype=torch.float64, requires_grad=True)\n K1 = torch.rand(1, 3, 3, device=device, dtype=torch.float64)\n K2 = torch.rand(1, 3, 3, device=device, dtype=torch.float64)\n assert gradcheck(epi.fundamental_from_essential,\n (E_mat, K1, K2,), raise_exception=True)\n\n\nclass TestFundamentalFromProjections:\n def test_smoke(self, device, dtype):\n P1 = torch.rand(1, 3, 4, device=device, dtype=dtype)\n P2 = torch.rand(1, 3, 4, device=device, dtype=dtype)\n F_mat = epi.fundamental_from_projections(P1, P2)\n assert F_mat.shape == (1, 3, 3)\n\n @pytest.mark.parametrize(\"batch_size\", [1, 2, 4, 7])\n def test_shape(self, batch_size, device, dtype):\n B: int = batch_size\n P1 = torch.rand(B, 3, 4, device=device, dtype=dtype)\n P2 = torch.rand(B, 3, 4, device=device, dtype=dtype)\n F_mat = epi.fundamental_from_projections(P1, P2)\n assert F_mat.shape == (B, 3, 3)\n\n def test_shape_large(self, device, dtype):\n P1 = torch.rand(1, 2, 3, 4, device=device, dtype=dtype)\n P2 = torch.rand(1, 2, 3, 4, device=device, dtype=dtype)\n F_mat = epi.fundamental_from_projections(P1, P2)\n assert F_mat.shape == (1, 2, 3, 3)\n\n def test_from_to_projections(self, device, dtype):\n P1 = torch.tensor([[\n [1., 0., 0., 0.],\n [0., 1., 0., 0.],\n [1., 0., 1., 0.],\n ]], device=device, dtype=dtype)\n\n P2 = torch.tensor([[\n [1., 1., 1., 3.],\n [0., 2., 0., 3.],\n [0., 1., 1., 0.],\n ]], device=device, dtype=dtype)\n\n F_mat = epi.fundamental_from_projections(P1, P2)\n P_mat = epi.projections_from_fundamental(F_mat)\n F_hat = epi.fundamental_from_projections(P_mat[..., 0], P_mat[..., 1])\n\n F_mat_norm = epi.normalize_transformation(F_mat)\n F_hat_norm = epi.normalize_transformation(F_hat)\n assert_allclose(F_mat_norm, F_hat_norm)\n\n def test_gradcheck(self, device):\n P1 = torch.rand(1, 3, 4, device=device, dtype=torch.float64, requires_grad=True)\n P2 = torch.rand(1, 3, 4, device=device, dtype=torch.float64)\n assert gradcheck(epi.fundamental_from_projections,\n (P1, P2,), raise_exception=True)\n", "from typing import Union, Tuple\n\nimport torch\nfrom torch.testing import assert_allclose\nfrom torch.autograd import gradcheck\n\nimport kornia\nimport kornia.testing as utils # test utils\nfrom kornia.augmentation import (\n RandomMixUp,\n RandomCutMix\n)\n\n\nclass TestRandomMixUp:\n\n def test_smoke(self, device, dtype):\n f = RandomMixUp()\n repr = \"RandomMixUp(lambda_val=tensor([0., 1.]), p=1.0, p_batch=1.0, same_on_batch=False)\"\n assert str(f) == repr\n\n def test_random_mixup_p1(self, device, dtype):\n torch.manual_seed(0)\n f = RandomMixUp(p=1.)\n\n input = torch.stack([\n torch.ones(1, 3, 4, device=device, dtype=dtype),\n torch.zeros(1, 3, 4, device=device, dtype=dtype)\n ])\n label = torch.tensor([1, 0], device=device)\n lam = torch.tensor([0.1320, 0.3074], device=device, dtype=dtype)\n\n expected = torch.stack([\n torch.ones(1, 3, 4, device=device, dtype=dtype) * (1 - lam[0]),\n torch.ones(1, 3, 4, device=device, dtype=dtype) * lam[1]]\n )\n\n out_image, out_label = f(input, label)\n\n assert_allclose(out_image, expected, rtol=1e-4, atol=1e-4)\n assert (out_label[:, 0] == label).all()\n assert (out_label[:, 1] == torch.tensor([0, 1], device=device, dtype=dtype)).all()\n assert_allclose(out_label[:, 2], lam, rtol=1e-4, atol=1e-4)\n\n def test_random_mixup_p0(self, device, dtype):\n torch.manual_seed(0)\n f = RandomMixUp(p=0.)\n\n input = torch.stack([\n torch.ones(1, 3, 4, device=device, dtype=dtype),\n torch.zeros(1, 3, 4, device=device, dtype=dtype)\n ])\n label = torch.tensor([1, 0], device=device)\n lam = torch.tensor([0., 0.], device=device, dtype=dtype)\n\n expected = input.clone()\n\n out_image, out_label = f(input, label)\n\n assert_allclose(out_image, expected, rtol=1e-4, atol=1e-4)\n assert (out_label == label).all()\n\n def test_random_mixup_lam0(self, device, dtype):\n torch.manual_seed(0)\n f = RandomMixUp(lambda_val=(0., 0.), p=1.)\n\n input = torch.stack([\n torch.ones(1, 3, 4, device=device, dtype=dtype),\n torch.zeros(1, 3, 4, device=device, dtype=dtype)\n ])\n label = torch.tensor([1, 0], device=device)\n lam = torch.tensor([0., 0.], device=device, dtype=dtype)\n\n expected = input.clone()\n\n out_image, out_label = f(input, label)\n\n assert_allclose(out_image, expected, rtol=1e-4, atol=1e-4)\n assert (out_label[:, 0] == label).all()\n assert (out_label[:, 1] == torch.tensor([0, 1], device=device)).all()\n assert_allclose(out_label[:, 2], lam, rtol=1e-4, atol=1e-4)\n\n def test_random_mixup_same_on_batch(self, device, dtype):\n torch.manual_seed(0)\n f = RandomMixUp(same_on_batch=True, p=1.)\n\n input = torch.stack([\n torch.ones(1, 3, 4, device=device, dtype=dtype),\n torch.zeros(1, 3, 4, device=device, dtype=dtype)\n ])\n label = torch.tensor([1, 0], device=device)\n lam = torch.tensor([0.0885, 0.0885], device=device, dtype=dtype)\n\n expected = torch.stack([\n torch.ones(1, 3, 4, device=device, dtype=dtype) * (1 - lam[0]),\n torch.ones(1, 3, 4, device=device, dtype=dtype) * lam[1]\n ])\n\n out_image, out_label = f(input, label)\n assert_allclose(out_image, expected, rtol=1e-4, atol=1e-4)\n assert (out_label[:, 0] == label).all()\n assert (out_label[:, 1] == torch.tensor([0, 1], device=device, dtype=dtype)).all()\n assert_allclose(out_label[:, 2], lam, rtol=1e-4, atol=1e-4)\n\n\nclass TestRandomCutMix:\n\n def test_smoke(self, device, dtype):\n f = RandomCutMix(width=3, height=3)\n repr = \"RandomCutMix(num_mix=1, beta=1.0, cut_size=tensor([0., 1.]), , p=1.0, p_batch=1.0, same_on_batch=False)\"\n assert str(f) == repr\n\n def test_random_mixup_p1(self, device, dtype):\n torch.manual_seed(76)\n f = RandomCutMix(width=4, height=3, p=1.)\n\n input = torch.stack([\n torch.ones(1, 3, 4, device=device, dtype=dtype),\n torch.zeros(1, 3, 4, device=device, dtype=dtype)\n ])\n label = torch.tensor([1, 0], device=device)\n lam = torch.tensor([0.1320, 0.3074], device=device, dtype=dtype)\n\n expected = torch.tensor([[[[0., 0., 0., 1.],\n [0., 0., 0., 1.],\n [1., 1., 1., 1.]]],\n [[[1., 1., 1., 0.],\n [1., 1., 1., 0.],\n [0., 0., 0., 0.]]]], device=device, dtype=dtype)\n\n out_image, out_label = f(input, label)\n\n assert_allclose(out_image, expected, rtol=1e-4, atol=1e-4)\n assert (out_label[0, :, 0] == label).all()\n assert (out_label[0, :, 1] == torch.tensor([0, 1], device=device, dtype=dtype)).all()\n assert (out_label[0, :, 2] == torch.tensor([0.5, 0.5], device=device, dtype=dtype)).all()\n\n def test_random_mixup_p0(self, device, dtype):\n torch.manual_seed(76)\n f = RandomCutMix(p=0., width=4, height=3)\n\n input = torch.stack([\n torch.ones(1, 3, 4, device=device, dtype=dtype),\n torch.zeros(1, 3, 4, device=device, dtype=dtype)\n ])\n label = torch.tensor([1, 0], device=device)\n\n expected = input.clone()\n\n out_image, out_label = f(input, label)\n\n assert_allclose(out_image, expected, rtol=1e-4, atol=1e-4)\n assert (out_label == label).all()\n\n def test_random_mixup_beta0(self, device, dtype):\n torch.manual_seed(76)\n # beta 0 => resample 0.5 area\n f = RandomCutMix(beta=0., width=4, height=3, p=1.)\n\n input = torch.stack([\n torch.ones(1, 3, 4, device=device, dtype=dtype),\n torch.zeros(1, 3, 4, device=device, dtype=dtype)\n ])\n label = torch.tensor([1, 0], device=device)\n\n expected = torch.tensor([[[[0., 0., 1., 1.],\n [0., 0., 1., 1.],\n [1., 1., 1., 1.]]],\n [[[1., 1., 0., 0.],\n [1., 1., 0., 0.],\n [0., 0., 0., 0.]]]], device=device, dtype=dtype)\n\n out_image, out_label = f(input, label)\n\n assert_allclose(out_image, expected, rtol=1e-4, atol=1e-4)\n assert (out_label[0, :, 0] == label).all()\n assert (out_label[0, :, 1] == torch.tensor([0, 1], device=device, dtype=dtype)).all()\n # cut area = 4 / 12\n assert_allclose(out_label[0, :, 2], torch.tensor([0.33333, 0.33333], device=device, dtype=dtype))\n\n def test_random_mixup_num2(self, device, dtype):\n torch.manual_seed(76)\n f = RandomCutMix(width=4, height=3, num_mix=5, p=1.)\n\n input = torch.stack([\n torch.ones(1, 3, 4, device=device, dtype=dtype),\n torch.zeros(1, 3, 4, device=device, dtype=dtype)\n ])\n label = torch.tensor([1, 0], device=device)\n\n expected = torch.tensor([[[[0., 0., 0., 1.],\n [0., 0., 0., 1.],\n [1., 1., 1., 1.]]],\n [[[1., 1., 0., 0.],\n [1., 1., 0., 0.],\n [0., 0., 0., 0.]]]], device=device, dtype=dtype)\n\n out_image, out_label = f(input, label)\n\n assert_allclose(out_image, expected, rtol=1e-4, atol=1e-4)\n assert (out_label[:, :, 0] == label).all()\n assert (out_label[:, :, 1] == torch.tensor(\n [[1, 0], [1, 0], [1, 0], [1, 0], [0, 1]], device=device)).all()\n assert_allclose(out_label[:, :, 2], torch.tensor(\n [[0.0833, 0.3333], [0., 0.1667], [0.5, 0.0833], [0.0833, 0.], [0.5, 0.3333]],\n device=device, dtype=dtype), rtol=1e-4, atol=1e-4)\n\n def test_random_mixup_same_on_batch(self, device, dtype):\n torch.manual_seed(42)\n f = RandomCutMix(same_on_batch=True, width=4, height=3, p=1.)\n\n input = torch.stack([\n torch.ones(1, 3, 4, device=device, dtype=dtype),\n torch.zeros(1, 3, 4, device=device, dtype=dtype)\n ])\n label = torch.tensor([1, 0], device=device)\n lam = torch.tensor([0.0885, 0.0885], device=device, dtype=dtype)\n\n expected = torch.tensor([[[[0., 0., 0., 1.],\n [0., 0., 0., 1.],\n [1., 1., 1., 1.]]],\n [[[1., 1., 1., 0.],\n [1., 1., 1., 0.],\n [0., 0., 0., 0.]]]], device=device, dtype=dtype)\n\n out_image, out_label = f(input, label)\n\n assert_allclose(out_image, expected, rtol=1e-4, atol=1e-4)\n assert (out_label[0, :, 0] == label).all()\n assert (out_label[0, :, 1] == torch.tensor([0, 1], device=device, dtype=dtype)).all()\n assert_allclose(out_label[0, :, 2],\n torch.tensor([0.5000, 0.5000], device=device, dtype=dtype), rtol=1e-4, atol=1e-4)\n" ]
[ [ "torch.from_numpy" ], [ "torch.ones", "torch.testing.assert_allclose", "torch.std_mean", "torch.zeros_like", "torch.tensor", "torch.rand", "torch.autograd.gradcheck", "torch.ones_like" ], [ "torch.ones", "torch.testing.assert_allclose", "torch.zeros", "torch.manual_seed", "torch.tensor" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
ai4er-cdt/gtc-exposure
[ "f0504d8c40c3553ba1466faef3d802ced09bd984" ]
[ "settlement_segmentation/data/sentinel_time_series/gen_train_data.py" ]
[ "import numpy as np\nimport descarteslabs as dl\nfrom shapely.geometry import Polygon, MultiPolygon\nfrom PIL import Image\n\ndef generate_sentinel_training_images(geometry,\n area, #eg. 'Jamaca'\n tile_size= 512,\n start_datetime=\"2014-01-01\",\n end_datetime=\"2020-01-01\",\n cloud_fraction=0.01\n ):\n \n #use descartes API to get Sentinel image\n scenes, geoctx = dl.scenes.search(geometry,\n products=[\"sentinel-2:L1C\"],\n start_datetime= start_datetime,\n end_datetime = end_datetime,\n cloud_fraction = cloud_fraction)\n \n #creates image stack using RGB Bands\n ndarray_stack = scenes.stack(\"red green blue\", geoctx.assign())\n \n #for each of the images\n image_stack = []\n for img in ndarray_stack:\n tiles= []\n #slice the image into tiles \n for y in range(tile_size, img.shape[2], tile_size):\n for x in range(tile_size, img.shape[1], tile_size):\n tile = (img[:,x:x+tile_size, y:y+tile_size])\n #this filters edge images that are not the correct shape\n if tile.shape == (3, tile_size, tile_size):\n tiles.append(tile) \n image_stack.append(tiles)\n \n #convert nested list to array\n no_scenes = len(image_stack)\n no_tiles_per_scene = len(image_stack[0])\n image_array = np.zeros([no_scenes, no_tiles_per_scene, 3, tile_size, tile_size])\n for i in range(no_scenes):\n for j in range(no_tiles_per_scene):\n image_array[i, j] = image_stack[i][j]\n \n #take compoite image as average of scenes\n composite_images = np.zeros(image_array[0].shape)\n for i in range(image_array.shape[1]):\n composite_image = np.ma.median(image_array[:,i], axis=0)\n composite_images[i] = composite_image\n \n # reshape from (3, x, y) to (x, y, 3)\n reshape_image = np.zeros((tile_size,tile_size,3))\n reshape_image[:,:,0] = composite_image[0]\n reshape_image[:,:,1] = composite_image[1]\n reshape_image[:,:,2] = composite_image[2]\n #scale values to [0, 255]\n #avoid divide by 0 error:\n if np.max(reshape_image)!=0:\n reshape_image = (reshape_image/np.max(reshape_image)*255).astype(np.uint8)\n #save images as jpeg\n Image.fromarray(reshape_image).save(\"train_{}_{}.jpeg\".format(area, i))\n \n return composite_images" ]
[ [ "numpy.max", "numpy.zeros", "numpy.ma.median" ] ]
[ { "matplotlib": [], "numpy": [ "1.10", "1.12", "1.11", "1.19", "1.13", "1.16", "1.9", "1.18", "1.20", "1.7", "1.15", "1.14", "1.17", "1.8" ], "pandas": [], "scipy": [], "tensorflow": [] } ]
ozcell/pytorch-auto-drive
[ "f1c2fd223cf7d307a3968fe671d0271b03ced39c" ]
[ "transforms/transforms.py" ]
[ "# Mostly copied and modified from torch/vision/references/segmentation to support unlabeled data\n# Copied functions from fmassa/vision-1 to support multi-dimensional masks loaded from numpy ndarray\n# Update: The current torchvision github repo now supports tensor operation for all common transformations,\n# you are encouraged to check it out\n# Processing in (w, h), while providing public functions in (h, w)\n#######################\n# For transforms with multiple targets (masks, keypoints), target is formed as `dict{'padding_mask', 'keypoints', etc.}`\nimport numpy as np\nfrom PIL import Image\nfrom collections.abc import Sequence\nimport numbers\nimport random\nimport torch\nimport math\nfrom . import functional as F\n\n\ndef _check_sequence_input(x, name, req_sizes):\n msg = req_sizes[0] if len(req_sizes) < 2 else \" or \".join([str(s) for s in req_sizes])\n if not isinstance(x, Sequence):\n raise TypeError(\"{} should be a sequence of length {}.\".format(name, msg))\n if len(x) not in req_sizes:\n raise ValueError(\"{} should be sequence of length {}.\".format(name, msg))\n\n\ndef _setup_angle(x, name, req_sizes=(2, )):\n if isinstance(x, numbers.Number):\n if x < 0:\n raise ValueError(\"If {} is a single number, it must be positive.\".format(name))\n x = [-x, x]\n else:\n _check_sequence_input(x, name, req_sizes)\n\n return [float(d) for d in x]\n\n\nclass Compose(object):\n def __init__(self, transforms):\n self.transforms = transforms\n\n def __call__(self, image, target):\n for t in self.transforms:\n image, target = t(image, target)\n\n return image, target\n\n\nclass Resize(object):\n def __init__(self, size_image, size_label):\n self.size_image = size_image\n self.size_label = size_label\n\n @staticmethod\n def transform_points(points, in_size, out_size, ignore_x=-2):\n # Resize a np.array (L x N x 2) of points (x, y), original axis start from top-left corner\n # x <-> w, y <-> h\n ignore_filter = (points[:, :, 0] == ignore_x)\n in_h, in_w = in_size\n out_h, out_w = out_size\n scale = np.array([out_w / in_w, out_h / in_h], dtype=np.float32)\n points = points * scale\n points[:, :, 0] = points[:, :, 0] * ~ignore_filter + (-2) * ignore_filter\n\n return points\n\n def __call__(self, image, target):\n w_ori, h_ori = F._get_image_size(image)\n image = F.resize(image, self.size_image, interpolation=Image.LINEAR)\n if isinstance(target, str):\n return image, target\n elif isinstance(target, dict): # To keep BC\n if 'keypoints' in target:\n target['keypoints'] = self.transform_points(target['keypoints'], (h_ori, w_ori), self.size_label)\n if 'padding_mask' in target:\n target['padding_mask'] = F.resize(target['padding_mask'], self.size_label, interpolation=Image.NEAREST)\n else:\n target = F.resize(target, self.size_label, interpolation=Image.NEAREST)\n\n return image, target\n\n\n# Crop from up-left corner\nclass Crop(object):\n def __init__(self, size):\n self.h, self.w = size\n\n def __call__(self, image, target):\n image = F.crop(image, 0, 0, self.h, self.w)\n target = F.crop(target, 0, 0, self.h, self.w)\n\n return image, target\n\n\n# Pad image with zeros, yet pad target with 255 (ignore label) on bottom & right if\n# given a bigger desired size (or else nothing is done at all)\nclass ZeroPad(object):\n def __init__(self, size):\n self.h, self.w = size\n\n @staticmethod\n def zero_pad(image, target, h, w):\n ow, oh = F._get_image_size(target)\n pad_h = h - oh if oh < h else 0\n pad_w = w - ow if ow < w else 0\n image = F.pad(image, [0, 0, pad_w, pad_h], fill=0)\n target = F.pad(target, [0, 0, pad_w, pad_h], fill=255)\n\n return image, target\n\n def __call__(self, image, target):\n return self.zero_pad(image, target, self.h, self.w)\n\n\n# Random translation in pixels\n# Random translation = Zero pad + Random crop\nclass RandomTranslation(object):\n def __init__(self, trans_h, trans_w):\n self.trans_h = trans_h\n self.trans_w = trans_w\n\n def __call__(self, image, target):\n tw, th = F._get_image_size(image)\n image = F.pad(image, [self.trans_w, self.trans_h, self.trans_w, self.trans_h], fill=0)\n target = F.pad(target, [self.trans_w, self.trans_h, self.trans_w, self.trans_h], fill=255)\n i, j, h, w = RandomCrop.get_params(image, (th, tw))\n image = F.crop(image, i, j, h, w)\n target = F.crop(target, i, j, h, w)\n\n return image, target\n\n\nclass RandomZeroPad(object):\n def __init__(self, pad_h, pad_w):\n self.pad_h = pad_h\n self.pad_w = pad_w\n\n def __call__(self, image, target):\n r = random.randint(-self.pad_w, self.pad_w)\n b = random.randint(-self.pad_h, self.pad_h)\n l = 0\n t = 0\n if r < 0:\n l = -r\n r = 0\n if b < 0:\n t = -b\n b = 0\n\n image = F.pad(image, [l, t, r, b], fill=0)\n target = F.pad(target, [l, t, r, b], fill=255)\n\n return image, target\n\n\nclass RandomResize(object):\n def __init__(self, min_size, max_size=None):\n self.min_size = min_size\n if max_size is None:\n max_size = min_size\n self.max_size = max_size\n\n def __call__(self, image, target):\n min_h, min_w = self.min_size\n max_h, max_w = self.max_size\n h = random.randint(min_h, max_h)\n w = random.randint(min_w, max_w)\n image = F.resize(image, [h, w], interpolation=Image.LINEAR)\n if isinstance(target, str):\n return image, target\n elif isinstance(target, dict): # To keep BC\n if 'keypoints' in target:\n w_ori, h_ori = F._get_image_size(image)\n target['keypoints'] = Resize.transform_points(target['keypoints'], (h_ori, w_ori), (h, w))\n if 'padding_mask' in target:\n target['padding_mask'] = F.resize(target['padding_mask'], [h, w], interpolation=Image.NEAREST)\n else:\n target = F.resize(target, [h, w], interpolation=Image.NEAREST)\n\n return image, target\n\n\nclass RandomScale(object):\n def __init__(self, min_scale, max_scale=None):\n self.min_scale = min_scale\n if max_scale is None:\n max_scale = min_scale\n self.max_scale = max_scale\n\n def __call__(self, image, target):\n scale = random.uniform(self.min_scale, self.max_scale)\n w, h = F._get_image_size(image)\n h = int(scale * h)\n w = int(scale * w)\n image = F.resize(image, [h, w], interpolation=Image.LINEAR)\n target = F.resize(target, [h, w], interpolation=Image.NEAREST)\n\n return image, target\n\n\nclass RandomCrop(object):\n def __init__(self, size):\n self.size = size\n\n @staticmethod\n def get_params(img, output_size):\n w, h = F._get_image_size(img)\n th, tw = output_size\n if w <= tw and h <= th:\n return 0, 0, h, w\n\n i = random.randint(0, h - th)\n j = random.randint(0, w - tw)\n return i, j, th, tw\n\n def __call__(self, image, target):\n # Pad if needed\n iw, ih = F._get_image_size(image)\n if ih < self.size[0] or iw < self.size[1]:\n # print(image.size())\n # print(self.size)\n image, target = ZeroPad.zero_pad(image, target,\n max(self.size[0], ih),\n max(self.size[1], iw))\n i, j, h, w = self.get_params(image, self.size)\n image = F.crop(image, i, j, h, w)\n target = F.crop(target, i, j, h, w)\n\n return image, target\n\n\nclass RandomHorizontalFlip(object):\n def __init__(self, flip_prob):\n self.flip_prob = flip_prob\n\n def __call__(self, image, target):\n t = random.random()\n if t < self.flip_prob:\n image = F.hflip(image)\n target = target if (isinstance(target, str) or t >= self.flip_prob) else F.hflip(target)\n\n return image, target\n\n\nclass ToTensor(object):\n def __init__(self, keep_scale=False, reverse_channels=False):\n # keep_scale = True => Images or whatever are not divided by 255\n # reverse_channels = True => RGB images are changed to BGR (the default behavior of openCV & Caffe,\n # let's wish them all go to heaven,\n # for they wasted me days!)\n self.keep_scale = keep_scale\n self.reverse_channels = reverse_channels\n\n def __call__(self, image, target):\n image = self._pil_to_tensor(image)\n target = self.label_to_tensor(target)\n\n return image, target\n\n @staticmethod\n def label_to_tensor(pic): # segmentation masks or keypoint arrays\n if isinstance(pic, str):\n return pic\n elif isinstance(pic, dict):\n if 'keypoints' in pic:\n pic['keypoints'] = torch.as_tensor(pic['keypoints'], dtype=torch.float32)\n if 'padding_mask' in pic:\n pic['padding_mask'] = torch.as_tensor(np.asarray(pic['padding_mask']).copy(), dtype=torch.float32)\n return pic\n else:\n return torch.as_tensor(np.asarray(pic).copy(), dtype=torch.int64)\n\n def _pil_to_tensor(self, pic):\n # Convert a PIL Image to tensor (a direct copy)\n if pic.mode == 'I':\n img = torch.from_numpy(np.array(pic, np.int32, copy=False))\n elif pic.mode == 'I;16':\n img = torch.from_numpy(np.array(pic, np.int16, copy=False))\n elif pic.mode == 'F':\n img = torch.from_numpy(np.array(pic, np.float32, copy=False))\n elif pic.mode == '1':\n img = 255 * torch.from_numpy(np.array(pic, np.uint8, copy=False))\n else:\n img = torch.ByteTensor(torch.ByteStorage.from_buffer(pic.tobytes()))\n # PIL image mode: L, LA, P, I, F, RGB, YCbCr, RGBA, CMYK\n if pic.mode == 'YCbCr':\n nchannel = 3\n elif pic.mode == 'I;16':\n nchannel = 1\n else:\n nchannel = len(pic.mode)\n img = img.view(pic.size[1], pic.size[0], nchannel)\n if self.reverse_channels: # Beware this only works with 3 channels(can't use -1 with tensors)\n img = img[:, :, [2, 1, 0]]\n # put it from HWC to CHW format\n # yikes, this transpose takes 80% of the loading time/CPU\n img = img.transpose(0, 1).transpose(0, 2).contiguous()\n if isinstance(img, torch.ByteTensor):\n if self.keep_scale:\n return img.float()\n else:\n return img.float().div(255)\n else:\n return img\n\n\nclass Normalize(object):\n def __init__(self, mean, std, normalize_target=False):\n self.mean = mean\n self.std = std\n self.normalize_target = normalize_target\n\n @staticmethod\n def transform_points(points, h, w, ignore_x=-2):\n # Divide keypoints by h & w to 0~1\n # A special case of resize\n points = points / torch.tensor([w, h], device=points.device, dtype=points.dtype)\n points[points[:, :, 0] < 0][:, 0] = ignore_x\n\n return points\n\n def __call__(self, image, target):\n image = F.normalize(image, mean=self.mean, std=self.std)\n if self.normalize_target and not isinstance(target, str):\n w, h = F._get_image_size(image)\n if isinstance(target, dict):\n target['keypoints'] = self.transform_points(target['keypoints'], h, w, ignore_x=-2)\n else:\n target = self.transform_points(target, h, w, ignore_x=-2)\n\n return image, target\n\n\n# Init with a python list as the map (mainly for cityscapes's id -> train_id)\nclass LabelMap(object):\n def __init__(self, label_id_map, outlier=False):\n self.label_id_map = torch.tensor(label_id_map)\n self.outlier = outlier\n\n def __call__(self, image, target):\n if self.outlier:\n target[target >= self.label_id_map.shape[0]] = 0 # Label 0 is usually ignored\n target = self.label_id_map[target]\n\n return image, target\n\n\n# Match label and image size\nclass MatchSize(object):\n def __init__(self, l2i=True):\n self.l2i = l2i # Match (l)abel to (i)mage\n\n def __call__(self, image, target):\n wi, hi = F._get_image_size(image)\n wl, hl = F._get_image_size(target)\n if hi == hl and wi == wl:\n return image, target\n\n if self.l2i:\n target = F.resize(target, [hi, wi], interpolation=Image.NEAREST)\n else:\n image = F.resize(image, [hl, wl], interpolation=Image.LINEAR)\n\n return image, target\n\n\n# TODO: Support fill color 255 for tensor inputs (supported in torchvision >= 0.9.0)\n# Now fill color is fixed to 0 (background for lane detection label)\nclass RandomRotation(object):\n def __init__(self, degrees, expand=False, center=None, fill=None):\n self.degrees = _setup_angle(degrees, name=\"degrees\", req_sizes=(2, ))\n\n if center is not None:\n _check_sequence_input(center, \"center\", req_sizes=(2, ))\n\n self.center = center\n self.expand = expand\n self.fill = fill\n\n @staticmethod\n def get_params(degrees):\n\n return random.uniform(degrees[0], degrees[1])\n\n @staticmethod\n def transform_points(points, angle, h, w, ignore_x=-2):\n # Rotate a np.array (L x N x 2) of points (x, y) anti-clockwise, original axis start from top-left corner\n ignore_filter = (points[:, :, 0] == ignore_x)\n offset = np.array([w / 2, h / 2], dtype=np.float32)\n matrix = np.array([[math.cos(angle / 180.0 * math.pi), math.sin(-angle / 180.0 * math.pi)],\n [math.sin(angle / 180.0 * math.pi), math.cos(angle / 180.0 * math.pi)]], dtype=np.float32)\n points = np.matmul((points - offset), matrix) + offset\n # exceed border\n ignore_filter += ((points[:, :, 0] > w) + (points[:, :, 1] > h) + ((points > 0).sum(axis=-1) < 2))\n points[:, :, 0] = points[:, :, 0] * ~ignore_filter + (-2) * ignore_filter\n\n return points\n\n def __call__(self, image, target):\n angle = self.get_params(self.degrees)\n image = F.rotate(image, angle, resample=Image.LINEAR, expand=self.expand, center=self.center, fill=0)\n if isinstance(target, dict): # To keep BC\n if 'keypoints' in target:\n w, h = F._get_image_size(image)\n target['keypoints'] = self.transform_points(target['keypoints'], angle, h, w)\n if 'padding_mask' in target:\n target['padding_mask'] = F.rotate(target['padding_mask'], angle, resample=Image.NEAREST,\n expand=self.expand, center=self.center, fill=1)\n else:\n target = F.rotate(target, angle, resample=Image.NEAREST, expand=self.expand, center=self.center, fill=255)\n\n return image, target\n" ]
[ [ "numpy.asarray", "numpy.matmul", "torch.tensor", "numpy.array", "torch.as_tensor" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
jacobkimmel/GSEA.py
[ "8084e96dcd4f57ea99a8c18fa7f96db25d6f1f0d" ]
[ "tests/test_gsea.py" ]
[ "# Dummy test\nimport numpy as np\nfrom gsea import *\nfrom numpy.testing import assert_almost_equal\n\ndef test_rank_genes():\n D = np.array([[-1,1],[1,-1]])\n C = [0,1]\n L,r = rank_genes(D,C)\n assert_almost_equal(L, [0,1])\n assert_almost_equal(r, [1,-1])\n\ndef test_enrichment_score():\n L = [1,0]\n r = [-1,1]\n S = [0,1]\n ES = enrichment_score(L,r,S)\n assert_almost_equal(ES,1)\n\n L = [0,1,2]\n r = [-1,0,1]\n assert_almost_equal(enrichment_score(L,r,[0]),1)\n assert_almost_equal(enrichment_score(L,r,[1]),-1)\n" ]
[ [ "numpy.testing.assert_almost_equal", "numpy.array" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
jackieleng/pandas
[ "ccec504e31ce74f8016952ac75add1cc4bec7080", "ccec504e31ce74f8016952ac75add1cc4bec7080" ]
[ "pandas/tseries/index.py", "pandas/tests/series/test_operators.py" ]
[ "# pylint: disable=E1101\nfrom __future__ import division\nimport operator\nimport warnings\nfrom datetime import time, datetime\nfrom datetime import timedelta\nimport numpy as np\nfrom pandas.core.base import _shared_docs\n\nfrom pandas.types.common import (_NS_DTYPE, _INT64_DTYPE,\n is_object_dtype, is_datetime64_dtype,\n is_datetimetz, is_dtype_equal,\n is_integer, is_float,\n is_integer_dtype,\n is_datetime64_ns_dtype,\n is_period_dtype,\n is_bool_dtype,\n is_string_dtype,\n is_list_like,\n is_scalar,\n pandas_dtype,\n _ensure_int64)\nfrom pandas.types.generic import ABCSeries\nfrom pandas.types.dtypes import DatetimeTZDtype\nfrom pandas.types.missing import isnull\n\nimport pandas.types.concat as _concat\nfrom pandas.core.common import (_values_from_object, _maybe_box,\n PerformanceWarning)\n\nfrom pandas.core.index import Index, Int64Index, Float64Index\nfrom pandas.indexes.base import _index_shared_docs\nimport pandas.compat as compat\nfrom pandas.tseries.frequencies import (\n to_offset, get_period_alias,\n Resolution)\nfrom pandas.tseries.base import DatelikeOps, TimelikeOps, DatetimeIndexOpsMixin\nfrom pandas.tseries.offsets import DateOffset, generate_range, Tick, CDay\nfrom pandas.tseries.tools import parse_time_string, normalize_date, to_time\nfrom pandas.tseries.timedeltas import to_timedelta\nfrom pandas.util.decorators import (Appender, cache_readonly,\n deprecate_kwarg, Substitution)\nimport pandas.core.common as com\nimport pandas.tseries.offsets as offsets\nimport pandas.tseries.tools as tools\n\nfrom pandas.lib import Timestamp\nimport pandas.lib as lib\nimport pandas.tslib as tslib\nimport pandas._period as period\nimport pandas._join as _join\nimport pandas.algos as _algos\nimport pandas.index as _index\n\n\ndef _utc():\n import pytz\n return pytz.utc\n\n# -------- some conversion wrapper functions\n\n\ndef _field_accessor(name, field, docstring=None):\n def f(self):\n values = self.asi8\n if self.tz is not None:\n utc = _utc()\n if self.tz is not utc:\n values = self._local_timestamps()\n\n if field in ['is_month_start', 'is_month_end',\n 'is_quarter_start', 'is_quarter_end',\n 'is_year_start', 'is_year_end']:\n month_kw = (self.freq.kwds.get('startingMonth',\n self.freq.kwds.get('month', 12))\n if self.freq else 12)\n\n result = tslib.get_start_end_field(values, field, self.freqstr,\n month_kw)\n elif field in ['weekday_name']:\n result = tslib.get_date_name_field(values, field)\n return self._maybe_mask_results(result)\n elif field in ['is_leap_year']:\n # no need to mask NaT\n return tslib.get_date_field(values, field)\n else:\n result = tslib.get_date_field(values, field)\n\n return self._maybe_mask_results(result, convert='float64')\n\n f.__name__ = name\n f.__doc__ = docstring\n return property(f)\n\n\ndef _dt_index_cmp(opname, nat_result=False):\n \"\"\"\n Wrap comparison operations to convert datetime-like to datetime64\n \"\"\"\n\n def wrapper(self, other):\n func = getattr(super(DatetimeIndex, self), opname)\n if (isinstance(other, datetime) or\n isinstance(other, compat.string_types)):\n other = _to_m8(other, tz=self.tz)\n result = func(other)\n if isnull(other):\n result.fill(nat_result)\n else:\n if isinstance(other, list):\n other = DatetimeIndex(other)\n elif not isinstance(other, (np.ndarray, Index, ABCSeries)):\n other = _ensure_datetime64(other)\n result = func(np.asarray(other))\n result = _values_from_object(result)\n\n if isinstance(other, Index):\n o_mask = other.values.view('i8') == tslib.iNaT\n else:\n o_mask = other.view('i8') == tslib.iNaT\n\n if o_mask.any():\n result[o_mask] = nat_result\n\n if self.hasnans:\n result[self._isnan] = nat_result\n\n # support of bool dtype indexers\n if is_bool_dtype(result):\n return result\n return Index(result)\n\n return wrapper\n\n\ndef _ensure_datetime64(other):\n if isinstance(other, np.datetime64):\n return other\n raise TypeError('%s type object %s' % (type(other), str(other)))\n\n_midnight = time(0, 0)\n\n\ndef _new_DatetimeIndex(cls, d):\n \"\"\" This is called upon unpickling, rather than the default which doesn't\n have arguments and breaks __new__ \"\"\"\n\n # data are already in UTC\n # so need to localize\n tz = d.pop('tz', None)\n\n result = cls.__new__(cls, verify_integrity=False, **d)\n if tz is not None:\n result = result.tz_localize('UTC').tz_convert(tz)\n return result\n\n\nclass DatetimeIndex(DatelikeOps, TimelikeOps, DatetimeIndexOpsMixin,\n Int64Index):\n \"\"\"\n Immutable ndarray of datetime64 data, represented internally as int64, and\n which can be boxed to Timestamp objects that are subclasses of datetime and\n carry metadata such as frequency information.\n\n Parameters\n ----------\n data : array-like (1-dimensional), optional\n Optional datetime-like data to construct index with\n copy : bool\n Make a copy of input ndarray\n freq : string or pandas offset object, optional\n One of pandas date offset strings or corresponding objects\n start : starting value, datetime-like, optional\n If data is None, start is used as the start point in generating regular\n timestamp data.\n periods : int, optional, > 0\n Number of periods to generate, if generating index. Takes precedence\n over end argument\n end : end time, datetime-like, optional\n If periods is none, generated index will extend to first conforming\n time on or just past end argument\n closed : string or None, default None\n Make the interval closed with respect to the given frequency to\n the 'left', 'right', or both sides (None)\n tz : pytz.timezone or dateutil.tz.tzfile\n ambiguous : 'infer', bool-ndarray, 'NaT', default 'raise'\n - 'infer' will attempt to infer fall dst-transition hours based on\n order\n - bool-ndarray where True signifies a DST time, False signifies a\n non-DST time (note that this flag is only applicable for ambiguous\n times)\n - 'NaT' will return NaT where there are ambiguous times\n - 'raise' will raise an AmbiguousTimeError if there are ambiguous times\n infer_dst : boolean, default False (DEPRECATED)\n Attempt to infer fall dst-transition hours based on order\n name : object\n Name to be stored in the index\n\n To learn more about the frequency strings, please see `this link\n <http://pandas.pydata.org/pandas-docs/stable/timeseries.html#offset-aliases>`__.\n \"\"\"\n\n _typ = 'datetimeindex'\n _join_precedence = 10\n\n def _join_i8_wrapper(joinf, **kwargs):\n return DatetimeIndexOpsMixin._join_i8_wrapper(joinf, dtype='M8[ns]',\n **kwargs)\n\n _inner_indexer = _join_i8_wrapper(_join.inner_join_indexer_int64)\n _outer_indexer = _join_i8_wrapper(_join.outer_join_indexer_int64)\n _left_indexer = _join_i8_wrapper(_join.left_join_indexer_int64)\n _left_indexer_unique = _join_i8_wrapper(\n _join.left_join_indexer_unique_int64, with_indexers=False)\n _arrmap = None\n\n __eq__ = _dt_index_cmp('__eq__')\n __ne__ = _dt_index_cmp('__ne__', nat_result=True)\n __lt__ = _dt_index_cmp('__lt__')\n __gt__ = _dt_index_cmp('__gt__')\n __le__ = _dt_index_cmp('__le__')\n __ge__ = _dt_index_cmp('__ge__')\n\n _engine_type = _index.DatetimeEngine\n\n tz = None\n offset = None\n _comparables = ['name', 'freqstr', 'tz']\n _attributes = ['name', 'freq', 'tz']\n _datetimelike_ops = ['year', 'month', 'day', 'hour', 'minute', 'second',\n 'weekofyear', 'week', 'dayofweek', 'weekday',\n 'dayofyear', 'quarter', 'days_in_month',\n 'daysinmonth', 'date', 'time', 'microsecond',\n 'nanosecond', 'is_month_start', 'is_month_end',\n 'is_quarter_start', 'is_quarter_end', 'is_year_start',\n 'is_year_end', 'tz', 'freq', 'weekday_name',\n 'is_leap_year']\n _is_numeric_dtype = False\n _infer_as_myclass = True\n\n @deprecate_kwarg(old_arg_name='infer_dst', new_arg_name='ambiguous',\n mapping={True: 'infer', False: 'raise'})\n def __new__(cls, data=None,\n freq=None, start=None, end=None, periods=None,\n copy=False, name=None, tz=None,\n verify_integrity=True, normalize=False,\n closed=None, ambiguous='raise', dtype=None, **kwargs):\n\n # This allows to later ensure that the 'copy' parameter is honored:\n if isinstance(data, Index):\n ref_to_data = data._data\n else:\n ref_to_data = data\n\n if name is None and hasattr(data, 'name'):\n name = data.name\n\n dayfirst = kwargs.pop('dayfirst', None)\n yearfirst = kwargs.pop('yearfirst', None)\n\n freq_infer = False\n if not isinstance(freq, DateOffset):\n\n # if a passed freq is None, don't infer automatically\n if freq != 'infer':\n freq = to_offset(freq)\n else:\n freq_infer = True\n freq = None\n\n if periods is not None:\n if is_float(periods):\n periods = int(periods)\n elif not is_integer(periods):\n raise ValueError('Periods must be a number, got %s' %\n str(periods))\n\n if data is None and freq is None:\n raise ValueError(\"Must provide freq argument if no data is \"\n \"supplied\")\n\n # if dtype has an embeded tz, capture it\n if dtype is not None:\n try:\n dtype = DatetimeTZDtype.construct_from_string(dtype)\n dtz = getattr(dtype, 'tz', None)\n if dtz is not None:\n if tz is not None and str(tz) != str(dtz):\n raise ValueError(\"cannot supply both a tz and a dtype\"\n \" with a tz\")\n tz = dtz\n except TypeError:\n pass\n\n if data is None:\n return cls._generate(start, end, periods, name, freq,\n tz=tz, normalize=normalize, closed=closed,\n ambiguous=ambiguous)\n\n if not isinstance(data, (np.ndarray, Index, ABCSeries)):\n if is_scalar(data):\n raise ValueError('DatetimeIndex() must be called with a '\n 'collection of some kind, %s was passed'\n % repr(data))\n # other iterable of some kind\n if not isinstance(data, (list, tuple)):\n data = list(data)\n data = np.asarray(data, dtype='O')\n elif isinstance(data, ABCSeries):\n data = data._values\n\n # data must be Index or np.ndarray here\n if not (is_datetime64_dtype(data) or is_datetimetz(data) or\n is_integer_dtype(data)):\n data = tools.to_datetime(data, dayfirst=dayfirst,\n yearfirst=yearfirst)\n\n if issubclass(data.dtype.type, np.datetime64) or is_datetimetz(data):\n\n if isinstance(data, DatetimeIndex):\n if tz is None:\n tz = data.tz\n elif data.tz is None:\n data = data.tz_localize(tz, ambiguous=ambiguous)\n else:\n # the tz's must match\n if str(tz) != str(data.tz):\n msg = ('data is already tz-aware {0}, unable to '\n 'set specified tz: {1}')\n raise TypeError(msg.format(data.tz, tz))\n\n subarr = data.values\n\n if freq is None:\n freq = data.offset\n verify_integrity = False\n else:\n if data.dtype != _NS_DTYPE:\n subarr = tslib.cast_to_nanoseconds(data)\n else:\n subarr = data\n else:\n # must be integer dtype otherwise\n if isinstance(data, Int64Index):\n raise TypeError('cannot convert Int64Index->DatetimeIndex')\n if data.dtype != _INT64_DTYPE:\n data = data.astype(np.int64)\n subarr = data.view(_NS_DTYPE)\n\n if isinstance(subarr, DatetimeIndex):\n if tz is None:\n tz = subarr.tz\n else:\n if tz is not None:\n tz = tslib.maybe_get_tz(tz)\n\n if (not isinstance(data, DatetimeIndex) or\n getattr(data, 'tz', None) is None):\n # Convert tz-naive to UTC\n ints = subarr.view('i8')\n subarr = tslib.tz_localize_to_utc(ints, tz,\n ambiguous=ambiguous)\n subarr = subarr.view(_NS_DTYPE)\n\n subarr = cls._simple_new(subarr, name=name, freq=freq, tz=tz)\n if dtype is not None:\n if not is_dtype_equal(subarr.dtype, dtype):\n # dtype must be coerced to DatetimeTZDtype above\n if subarr.tz is not None:\n raise ValueError(\"cannot localize from non-UTC data\")\n\n if verify_integrity and len(subarr) > 0:\n if freq is not None and not freq_infer:\n inferred = subarr.inferred_freq\n if inferred != freq.freqstr:\n on_freq = cls._generate(subarr[0], None, len(subarr), None,\n freq, tz=tz, ambiguous=ambiguous)\n if not np.array_equal(subarr.asi8, on_freq.asi8):\n raise ValueError('Inferred frequency {0} from passed '\n 'dates does not conform to passed '\n 'frequency {1}'\n .format(inferred, freq.freqstr))\n\n if freq_infer:\n inferred = subarr.inferred_freq\n if inferred:\n subarr.offset = to_offset(inferred)\n\n return subarr._deepcopy_if_needed(ref_to_data, copy)\n\n @classmethod\n def _generate(cls, start, end, periods, name, offset,\n tz=None, normalize=False, ambiguous='raise', closed=None):\n if com._count_not_none(start, end, periods) != 2:\n raise ValueError('Must specify two of start, end, or periods')\n\n _normalized = True\n\n if start is not None:\n start = Timestamp(start)\n\n if end is not None:\n end = Timestamp(end)\n\n left_closed = False\n right_closed = False\n\n if start is None and end is None:\n if closed is not None:\n raise ValueError(\"Closed has to be None if not both of start\"\n \"and end are defined\")\n\n if closed is None:\n left_closed = True\n right_closed = True\n elif closed == \"left\":\n left_closed = True\n elif closed == \"right\":\n right_closed = True\n else:\n raise ValueError(\"Closed has to be either 'left', 'right' or None\")\n\n try:\n inferred_tz = tools._infer_tzinfo(start, end)\n except:\n raise TypeError('Start and end cannot both be tz-aware with '\n 'different timezones')\n\n inferred_tz = tslib.maybe_get_tz(inferred_tz)\n\n # these may need to be localized\n tz = tslib.maybe_get_tz(tz)\n if tz is not None:\n date = start or end\n if date.tzinfo is not None and hasattr(tz, 'localize'):\n tz = tz.localize(date.replace(tzinfo=None)).tzinfo\n\n if tz is not None and inferred_tz is not None:\n if not inferred_tz == tz:\n raise AssertionError(\"Inferred time zone not equal to passed \"\n \"time zone\")\n\n elif inferred_tz is not None:\n tz = inferred_tz\n\n if start is not None:\n if normalize:\n start = normalize_date(start)\n _normalized = True\n else:\n _normalized = _normalized and start.time() == _midnight\n\n if end is not None:\n if normalize:\n end = normalize_date(end)\n _normalized = True\n else:\n _normalized = _normalized and end.time() == _midnight\n\n if hasattr(offset, 'delta') and offset != offsets.Day():\n if inferred_tz is None and tz is not None:\n # naive dates\n if start is not None and start.tz is None:\n start = start.tz_localize(tz, ambiguous=False)\n\n if end is not None and end.tz is None:\n end = end.tz_localize(tz, ambiguous=False)\n\n if start and end:\n if start.tz is None and end.tz is not None:\n start = start.tz_localize(end.tz, ambiguous=False)\n\n if end.tz is None and start.tz is not None:\n end = end.tz_localize(start.tz, ambiguous=False)\n\n if _use_cached_range(offset, _normalized, start, end):\n index = cls._cached_range(start, end, periods=periods,\n offset=offset, name=name)\n else:\n index = _generate_regular_range(start, end, periods, offset)\n\n else:\n\n if tz is not None:\n # naive dates\n if start is not None and start.tz is not None:\n start = start.replace(tzinfo=None)\n\n if end is not None and end.tz is not None:\n end = end.replace(tzinfo=None)\n\n if start and end:\n if start.tz is None and end.tz is not None:\n end = end.replace(tzinfo=None)\n\n if end.tz is None and start.tz is not None:\n start = start.replace(tzinfo=None)\n\n if _use_cached_range(offset, _normalized, start, end):\n index = cls._cached_range(start, end, periods=periods,\n offset=offset, name=name)\n else:\n index = _generate_regular_range(start, end, periods, offset)\n\n if tz is not None and getattr(index, 'tz', None) is None:\n index = tslib.tz_localize_to_utc(_ensure_int64(index), tz,\n ambiguous=ambiguous)\n index = index.view(_NS_DTYPE)\n\n # index is localized datetime64 array -> have to convert\n # start/end as well to compare\n if start is not None:\n start = start.tz_localize(tz).asm8\n if end is not None:\n end = end.tz_localize(tz).asm8\n\n if not left_closed and len(index) and index[0] == start:\n index = index[1:]\n if not right_closed and len(index) and index[-1] == end:\n index = index[:-1]\n index = cls._simple_new(index, name=name, freq=offset, tz=tz)\n return index\n\n @property\n def _box_func(self):\n return lambda x: Timestamp(x, freq=self.offset, tz=self.tz)\n\n def _convert_for_op(self, value):\n \"\"\" Convert value to be insertable to ndarray \"\"\"\n if self._has_same_tz(value):\n return _to_m8(value)\n raise ValueError('Passed item and index have different timezone')\n\n def _local_timestamps(self):\n utc = _utc()\n\n if self.is_monotonic:\n return tslib.tz_convert(self.asi8, utc, self.tz)\n else:\n values = self.asi8\n indexer = values.argsort()\n result = tslib.tz_convert(values.take(indexer), utc, self.tz)\n\n n = len(indexer)\n reverse = np.empty(n, dtype=np.int_)\n reverse.put(indexer, np.arange(n))\n return result.take(reverse)\n\n @classmethod\n def _simple_new(cls, values, name=None, freq=None, tz=None,\n dtype=None, **kwargs):\n \"\"\"\n we require the we have a dtype compat for the values\n if we are passed a non-dtype compat, then coerce using the constructor\n \"\"\"\n\n if not getattr(values, 'dtype', None):\n # empty, but with dtype compat\n if values is None:\n values = np.empty(0, dtype=_NS_DTYPE)\n return cls(values, name=name, freq=freq, tz=tz,\n dtype=dtype, **kwargs)\n values = np.array(values, copy=False)\n\n if is_object_dtype(values):\n return cls(values, name=name, freq=freq, tz=tz,\n dtype=dtype, **kwargs).values\n elif not is_datetime64_dtype(values):\n values = _ensure_int64(values).view(_NS_DTYPE)\n\n result = object.__new__(cls)\n result._data = values\n result.name = name\n result.offset = freq\n result.tz = tslib.maybe_get_tz(tz)\n result._reset_identity()\n return result\n\n @property\n def tzinfo(self):\n \"\"\"\n Alias for tz attribute\n \"\"\"\n return self.tz\n\n @cache_readonly\n def _timezone(self):\n \"\"\" Comparable timezone both for pytz / dateutil\"\"\"\n return tslib.get_timezone(self.tzinfo)\n\n def _has_same_tz(self, other):\n zzone = self._timezone\n\n # vzone sholdn't be None if value is non-datetime like\n if isinstance(other, np.datetime64):\n # convert to Timestamp as np.datetime64 doesn't have tz attr\n other = Timestamp(other)\n vzone = tslib.get_timezone(getattr(other, 'tzinfo', '__no_tz__'))\n return zzone == vzone\n\n @classmethod\n def _cached_range(cls, start=None, end=None, periods=None, offset=None,\n name=None):\n if start is None and end is None:\n # I somewhat believe this should never be raised externally and\n # therefore should be a `PandasError` but whatever...\n raise TypeError('Must specify either start or end.')\n if start is not None:\n start = Timestamp(start)\n if end is not None:\n end = Timestamp(end)\n if (start is None or end is None) and periods is None:\n raise TypeError(\n 'Must either specify period or provide both start and end.')\n\n if offset is None:\n # This can't happen with external-facing code, therefore\n # PandasError\n raise TypeError('Must provide offset.')\n\n drc = _daterange_cache\n if offset not in _daterange_cache:\n xdr = generate_range(offset=offset, start=_CACHE_START,\n end=_CACHE_END)\n\n arr = tools.to_datetime(list(xdr), box=False)\n\n cachedRange = DatetimeIndex._simple_new(arr)\n cachedRange.offset = offset\n cachedRange.tz = None\n cachedRange.name = None\n drc[offset] = cachedRange\n else:\n cachedRange = drc[offset]\n\n if start is None:\n if not isinstance(end, Timestamp):\n raise AssertionError('end must be an instance of Timestamp')\n\n end = offset.rollback(end)\n\n endLoc = cachedRange.get_loc(end) + 1\n startLoc = endLoc - periods\n elif end is None:\n if not isinstance(start, Timestamp):\n raise AssertionError('start must be an instance of Timestamp')\n\n start = offset.rollforward(start)\n\n startLoc = cachedRange.get_loc(start)\n endLoc = startLoc + periods\n else:\n if not offset.onOffset(start):\n start = offset.rollforward(start)\n\n if not offset.onOffset(end):\n end = offset.rollback(end)\n\n startLoc = cachedRange.get_loc(start)\n endLoc = cachedRange.get_loc(end) + 1\n\n indexSlice = cachedRange[startLoc:endLoc]\n indexSlice.name = name\n indexSlice.offset = offset\n\n return indexSlice\n\n def _mpl_repr(self):\n # how to represent ourselves to matplotlib\n return tslib.ints_to_pydatetime(self.asi8, self.tz)\n\n @cache_readonly\n def _is_dates_only(self):\n from pandas.formats.format import _is_dates_only\n return _is_dates_only(self.values)\n\n @property\n def _formatter_func(self):\n from pandas.formats.format import _get_format_datetime64\n formatter = _get_format_datetime64(is_dates_only=self._is_dates_only)\n return lambda x: \"'%s'\" % formatter(x, tz=self.tz)\n\n def __reduce__(self):\n\n # we use a special reudce here because we need\n # to simply set the .tz (and not reinterpret it)\n\n d = dict(data=self._data)\n d.update(self._get_attributes_dict())\n return _new_DatetimeIndex, (self.__class__, d), None\n\n def __setstate__(self, state):\n \"\"\"Necessary for making this object picklable\"\"\"\n if isinstance(state, dict):\n super(DatetimeIndex, self).__setstate__(state)\n\n elif isinstance(state, tuple):\n\n # < 0.15 compat\n if len(state) == 2:\n nd_state, own_state = state\n data = np.empty(nd_state[1], dtype=nd_state[2])\n np.ndarray.__setstate__(data, nd_state)\n\n self.name = own_state[0]\n self.offset = own_state[1]\n self.tz = own_state[2]\n\n # provide numpy < 1.7 compat\n if nd_state[2] == 'M8[us]':\n new_state = np.ndarray.__reduce__(data.astype('M8[ns]'))\n np.ndarray.__setstate__(data, new_state[2])\n\n else: # pragma: no cover\n data = np.empty(state)\n np.ndarray.__setstate__(data, state)\n\n self._data = data\n self._reset_identity()\n\n else:\n raise Exception(\"invalid pickle state\")\n _unpickle_compat = __setstate__\n\n def _add_datelike(self, other):\n # adding a timedeltaindex to a datetimelike\n if other is tslib.NaT:\n return self._nat_new(box=True)\n raise TypeError(\"cannot add a datelike to a DatetimeIndex\")\n\n def _sub_datelike(self, other):\n # subtract a datetime from myself, yielding a TimedeltaIndex\n from pandas import TimedeltaIndex\n other = Timestamp(other)\n if other is tslib.NaT:\n result = self._nat_new(box=False)\n # require tz compat\n elif not self._has_same_tz(other):\n raise TypeError(\"Timestamp subtraction must have the same \"\n \"timezones or no timezones\")\n else:\n i8 = self.asi8\n result = i8 - other.value\n result = self._maybe_mask_results(result, fill_value=tslib.iNaT)\n return TimedeltaIndex(result, name=self.name, copy=False)\n\n def _maybe_update_attributes(self, attrs):\n \"\"\" Update Index attributes (e.g. freq) depending on op \"\"\"\n freq = attrs.get('freq', None)\n if freq is not None:\n # no need to infer if freq is None\n attrs['freq'] = 'infer'\n return attrs\n\n def _add_delta(self, delta):\n from pandas import TimedeltaIndex\n name = self.name\n\n if isinstance(delta, (Tick, timedelta, np.timedelta64)):\n new_values = self._add_delta_td(delta)\n elif isinstance(delta, TimedeltaIndex):\n new_values = self._add_delta_tdi(delta)\n # update name when delta is Index\n name = com._maybe_match_name(self, delta)\n elif isinstance(delta, DateOffset):\n new_values = self._add_offset(delta).asi8\n else:\n new_values = self.astype('O') + delta\n\n tz = 'UTC' if self.tz is not None else None\n result = DatetimeIndex(new_values, tz=tz, name=name, freq='infer')\n utc = _utc()\n if self.tz is not None and self.tz is not utc:\n result = result.tz_convert(self.tz)\n return result\n\n def _add_offset(self, offset):\n try:\n if self.tz is not None:\n values = self.tz_localize(None)\n else:\n values = self\n result = offset.apply_index(values)\n if self.tz is not None:\n result = result.tz_localize(self.tz)\n return result\n\n except NotImplementedError:\n warnings.warn(\"Non-vectorized DateOffset being applied to Series \"\n \"or DatetimeIndex\", PerformanceWarning)\n return self.astype('O') + offset\n\n def _format_native_types(self, na_rep='NaT', date_format=None, **kwargs):\n from pandas.formats.format import _get_format_datetime64_from_values\n format = _get_format_datetime64_from_values(self, date_format)\n\n return tslib.format_array_from_datetime(self.asi8,\n tz=self.tz,\n format=format,\n na_rep=na_rep)\n\n def to_datetime(self, dayfirst=False):\n return self.copy()\n\n @Appender(_index_shared_docs['astype'])\n def astype(self, dtype, copy=True):\n dtype = pandas_dtype(dtype)\n if is_object_dtype(dtype):\n return self.asobject\n elif is_integer_dtype(dtype):\n return Index(self.values.astype('i8', copy=copy), name=self.name,\n dtype='i8')\n elif is_datetime64_ns_dtype(dtype):\n if self.tz is not None:\n return self.tz_convert('UTC').tz_localize(None)\n elif copy is True:\n return self.copy()\n return self\n elif is_string_dtype(dtype):\n return Index(self.format(), name=self.name, dtype=object)\n elif is_period_dtype(dtype):\n return self.to_period(freq=dtype.freq)\n raise ValueError('Cannot cast DatetimeIndex to dtype %s' % dtype)\n\n def _get_time_micros(self):\n utc = _utc()\n values = self.asi8\n if self.tz is not None and self.tz is not utc:\n values = self._local_timestamps()\n return tslib.get_time_micros(values)\n\n def to_series(self, keep_tz=False):\n \"\"\"\n Create a Series with both index and values equal to the index keys\n useful with map for returning an indexer based on an index\n\n Parameters\n ----------\n keep_tz : optional, defaults False.\n return the data keeping the timezone.\n\n If keep_tz is True:\n\n If the timezone is not set, the resulting\n Series will have a datetime64[ns] dtype.\n\n Otherwise the Series will have an datetime64[ns, tz] dtype; the\n tz will be preserved.\n\n If keep_tz is False:\n\n Series will have a datetime64[ns] dtype. TZ aware\n objects will have the tz removed.\n\n Returns\n -------\n Series\n \"\"\"\n from pandas import Series\n return Series(self._to_embed(keep_tz), index=self, name=self.name)\n\n def _to_embed(self, keep_tz=False):\n \"\"\"\n return an array repr of this object, potentially casting to object\n\n This is for internal compat\n \"\"\"\n if keep_tz and self.tz is not None:\n\n # preserve the tz & copy\n return self.copy(deep=True)\n\n return self.values.copy()\n\n def to_pydatetime(self):\n \"\"\"\n Return DatetimeIndex as object ndarray of datetime.datetime objects\n\n Returns\n -------\n datetimes : ndarray\n \"\"\"\n return tslib.ints_to_pydatetime(self.asi8, tz=self.tz)\n\n def to_period(self, freq=None):\n \"\"\"\n Cast to PeriodIndex at a particular frequency\n \"\"\"\n from pandas.tseries.period import PeriodIndex\n\n if freq is None:\n freq = self.freqstr or self.inferred_freq\n\n if freq is None:\n msg = (\"You must pass a freq argument as \"\n \"current index has none.\")\n raise ValueError(msg)\n\n freq = get_period_alias(freq)\n\n return PeriodIndex(self.values, name=self.name, freq=freq, tz=self.tz)\n\n def snap(self, freq='S'):\n \"\"\"\n Snap time stamps to nearest occurring frequency\n\n \"\"\"\n # Superdumb, punting on any optimizing\n freq = to_offset(freq)\n\n snapped = np.empty(len(self), dtype=_NS_DTYPE)\n\n for i, v in enumerate(self):\n s = v\n if not freq.onOffset(s):\n t0 = freq.rollback(s)\n t1 = freq.rollforward(s)\n if abs(s - t0) < abs(t1 - s):\n s = t0\n else:\n s = t1\n snapped[i] = s\n\n # we know it conforms; skip check\n return DatetimeIndex(snapped, freq=freq, verify_integrity=False)\n\n def union(self, other):\n \"\"\"\n Specialized union for DatetimeIndex objects. If combine\n overlapping ranges with the same DateOffset, will be much\n faster than Index.union\n\n Parameters\n ----------\n other : DatetimeIndex or array-like\n\n Returns\n -------\n y : Index or DatetimeIndex\n \"\"\"\n self._assert_can_do_setop(other)\n if not isinstance(other, DatetimeIndex):\n try:\n other = DatetimeIndex(other)\n except TypeError:\n pass\n\n this, other = self._maybe_utc_convert(other)\n\n if this._can_fast_union(other):\n return this._fast_union(other)\n else:\n result = Index.union(this, other)\n if isinstance(result, DatetimeIndex):\n result.tz = this.tz\n if (result.freq is None and\n (this.freq is not None or other.freq is not None)):\n result.offset = to_offset(result.inferred_freq)\n return result\n\n def to_perioddelta(self, freq):\n \"\"\"\n Calcuates TimedeltaIndex of difference between index\n values and index converted to PeriodIndex at specified\n freq. Used for vectorized offsets\n\n .. versionadded:: 0.17.0\n\n Parameters\n ----------\n freq : Period frequency\n\n Returns\n -------\n y : TimedeltaIndex\n \"\"\"\n return to_timedelta(self.asi8 - self.to_period(freq)\n .to_timestamp().asi8)\n\n def union_many(self, others):\n \"\"\"\n A bit of a hack to accelerate unioning a collection of indexes\n \"\"\"\n this = self\n\n for other in others:\n if not isinstance(this, DatetimeIndex):\n this = Index.union(this, other)\n continue\n\n if not isinstance(other, DatetimeIndex):\n try:\n other = DatetimeIndex(other)\n except TypeError:\n pass\n\n this, other = this._maybe_utc_convert(other)\n\n if this._can_fast_union(other):\n this = this._fast_union(other)\n else:\n tz = this.tz\n this = Index.union(this, other)\n if isinstance(this, DatetimeIndex):\n this.tz = tz\n\n if this.freq is None:\n this.offset = to_offset(this.inferred_freq)\n return this\n\n def append(self, other):\n \"\"\"\n Append a collection of Index options together\n\n Parameters\n ----------\n other : Index or list/tuple of indices\n\n Returns\n -------\n appended : Index\n \"\"\"\n name = self.name\n to_concat = [self]\n\n if isinstance(other, (list, tuple)):\n to_concat = to_concat + list(other)\n else:\n to_concat.append(other)\n\n for obj in to_concat:\n if isinstance(obj, Index) and obj.name != name:\n name = None\n break\n\n to_concat = self._ensure_compat_concat(to_concat)\n to_concat, factory = _process_concat_data(to_concat, name)\n\n return factory(to_concat)\n\n def join(self, other, how='left', level=None, return_indexers=False):\n \"\"\"\n See Index.join\n \"\"\"\n if (not isinstance(other, DatetimeIndex) and len(other) > 0 and\n other.inferred_type not in ('floating', 'mixed-integer',\n 'mixed-integer-float', 'mixed')):\n try:\n other = DatetimeIndex(other)\n except (TypeError, ValueError):\n pass\n\n this, other = self._maybe_utc_convert(other)\n return Index.join(this, other, how=how, level=level,\n return_indexers=return_indexers)\n\n def _maybe_utc_convert(self, other):\n this = self\n if isinstance(other, DatetimeIndex):\n if self.tz is not None:\n if other.tz is None:\n raise TypeError('Cannot join tz-naive with tz-aware '\n 'DatetimeIndex')\n elif other.tz is not None:\n raise TypeError('Cannot join tz-naive with tz-aware '\n 'DatetimeIndex')\n\n if self.tz != other.tz:\n this = self.tz_convert('UTC')\n other = other.tz_convert('UTC')\n return this, other\n\n def _wrap_joined_index(self, joined, other):\n name = self.name if self.name == other.name else None\n if (isinstance(other, DatetimeIndex) and\n self.offset == other.offset and\n self._can_fast_union(other)):\n joined = self._shallow_copy(joined)\n joined.name = name\n return joined\n else:\n tz = getattr(other, 'tz', None)\n return self._simple_new(joined, name, tz=tz)\n\n def _can_fast_union(self, other):\n if not isinstance(other, DatetimeIndex):\n return False\n\n offset = self.offset\n\n if offset is None or offset != other.offset:\n return False\n\n if not self.is_monotonic or not other.is_monotonic:\n return False\n\n if len(self) == 0 or len(other) == 0:\n return True\n\n # to make our life easier, \"sort\" the two ranges\n if self[0] <= other[0]:\n left, right = self, other\n else:\n left, right = other, self\n\n right_start = right[0]\n left_end = left[-1]\n\n # Only need to \"adjoin\", not overlap\n try:\n return (right_start == left_end + offset) or right_start in left\n except (ValueError):\n\n # if we are comparing an offset that does not propagate timezones\n # this will raise\n return False\n\n def _fast_union(self, other):\n if len(other) == 0:\n return self.view(type(self))\n\n if len(self) == 0:\n return other.view(type(self))\n\n # to make our life easier, \"sort\" the two ranges\n if self[0] <= other[0]:\n left, right = self, other\n else:\n left, right = other, self\n\n left_start, left_end = left[0], left[-1]\n right_end = right[-1]\n\n if not self.offset._should_cache():\n # concatenate dates\n if left_end < right_end:\n loc = right.searchsorted(left_end, side='right')\n right_chunk = right.values[loc:]\n dates = _concat._concat_compat((left.values, right_chunk))\n return self._shallow_copy(dates)\n else:\n return left\n else:\n return type(self)(start=left_start,\n end=max(left_end, right_end),\n freq=left.offset)\n\n def __iter__(self):\n \"\"\"\n Return an iterator over the boxed values\n\n Returns\n -------\n Timestamps : ndarray\n \"\"\"\n\n # convert in chunks of 10k for efficiency\n data = self.asi8\n l = len(self)\n chunksize = 10000\n chunks = int(l / chunksize) + 1\n for i in range(chunks):\n start_i = i * chunksize\n end_i = min((i + 1) * chunksize, l)\n converted = tslib.ints_to_pydatetime(data[start_i:end_i],\n tz=self.tz, freq=self.freq,\n box=True)\n for v in converted:\n yield v\n\n def _wrap_union_result(self, other, result):\n name = self.name if self.name == other.name else None\n if self.tz != other.tz:\n raise ValueError('Passed item and index have different timezone')\n return self._simple_new(result, name=name, freq=None, tz=self.tz)\n\n def intersection(self, other):\n \"\"\"\n Specialized intersection for DatetimeIndex objects. May be much faster\n than Index.intersection\n\n Parameters\n ----------\n other : DatetimeIndex or array-like\n\n Returns\n -------\n y : Index or DatetimeIndex\n \"\"\"\n self._assert_can_do_setop(other)\n if not isinstance(other, DatetimeIndex):\n try:\n other = DatetimeIndex(other)\n except (TypeError, ValueError):\n pass\n result = Index.intersection(self, other)\n if isinstance(result, DatetimeIndex):\n if result.freq is None:\n result.offset = to_offset(result.inferred_freq)\n return result\n\n elif (other.offset is None or self.offset is None or\n other.offset != self.offset or\n not other.offset.isAnchored() or\n (not self.is_monotonic or not other.is_monotonic)):\n result = Index.intersection(self, other)\n if isinstance(result, DatetimeIndex):\n if result.freq is None:\n result.offset = to_offset(result.inferred_freq)\n return result\n\n if len(self) == 0:\n return self\n if len(other) == 0:\n return other\n # to make our life easier, \"sort\" the two ranges\n if self[0] <= other[0]:\n left, right = self, other\n else:\n left, right = other, self\n\n end = min(left[-1], right[-1])\n start = right[0]\n\n if end < start:\n return type(self)(data=[])\n else:\n lslice = slice(*left.slice_locs(start, end))\n left_chunk = left.values[lslice]\n return self._shallow_copy(left_chunk)\n\n def _parsed_string_to_bounds(self, reso, parsed):\n \"\"\"\n Calculate datetime bounds for parsed time string and its resolution.\n\n Parameters\n ----------\n reso : Resolution\n Resolution provided by parsed string.\n parsed : datetime\n Datetime from parsed string.\n\n Returns\n -------\n lower, upper: pd.Timestamp\n\n \"\"\"\n if reso == 'year':\n return (Timestamp(datetime(parsed.year, 1, 1), tz=self.tz),\n Timestamp(datetime(parsed.year, 12, 31, 23,\n 59, 59, 999999), tz=self.tz))\n elif reso == 'month':\n d = tslib.monthrange(parsed.year, parsed.month)[1]\n return (Timestamp(datetime(parsed.year, parsed.month, 1),\n tz=self.tz),\n Timestamp(datetime(parsed.year, parsed.month, d, 23,\n 59, 59, 999999), tz=self.tz))\n elif reso == 'quarter':\n qe = (((parsed.month - 1) + 2) % 12) + 1 # two months ahead\n d = tslib.monthrange(parsed.year, qe)[1] # at end of month\n return (Timestamp(datetime(parsed.year, parsed.month, 1),\n tz=self.tz),\n Timestamp(datetime(parsed.year, qe, d, 23, 59,\n 59, 999999), tz=self.tz))\n elif reso == 'day':\n st = datetime(parsed.year, parsed.month, parsed.day)\n return (Timestamp(st, tz=self.tz),\n Timestamp(Timestamp(st + offsets.Day(),\n tz=self.tz).value - 1))\n elif reso == 'hour':\n st = datetime(parsed.year, parsed.month, parsed.day,\n hour=parsed.hour)\n return (Timestamp(st, tz=self.tz),\n Timestamp(Timestamp(st + offsets.Hour(),\n tz=self.tz).value - 1))\n elif reso == 'minute':\n st = datetime(parsed.year, parsed.month, parsed.day,\n hour=parsed.hour, minute=parsed.minute)\n return (Timestamp(st, tz=self.tz),\n Timestamp(Timestamp(st + offsets.Minute(),\n tz=self.tz).value - 1))\n elif reso == 'second':\n st = datetime(parsed.year, parsed.month, parsed.day,\n hour=parsed.hour, minute=parsed.minute,\n second=parsed.second)\n return (Timestamp(st, tz=self.tz),\n Timestamp(Timestamp(st + offsets.Second(),\n tz=self.tz).value - 1))\n elif reso == 'microsecond':\n st = datetime(parsed.year, parsed.month, parsed.day,\n parsed.hour, parsed.minute, parsed.second,\n parsed.microsecond)\n return (Timestamp(st, tz=self.tz), Timestamp(st, tz=self.tz))\n else:\n raise KeyError\n\n def _partial_date_slice(self, reso, parsed, use_lhs=True, use_rhs=True):\n is_monotonic = self.is_monotonic\n if ((reso in ['day', 'hour', 'minute'] and\n not (self._resolution < Resolution.get_reso(reso) or\n not is_monotonic)) or\n (reso == 'second' and\n not (self._resolution <= Resolution.RESO_SEC or\n not is_monotonic))):\n # These resolution/monotonicity validations came from GH3931,\n # GH3452 and GH2369.\n raise KeyError\n\n if reso == 'microsecond':\n # _partial_date_slice doesn't allow microsecond resolution, but\n # _parsed_string_to_bounds allows it.\n raise KeyError\n\n t1, t2 = self._parsed_string_to_bounds(reso, parsed)\n stamps = self.asi8\n\n if is_monotonic:\n\n # we are out of range\n if (len(stamps) and ((use_lhs and t1.value < stamps[0] and\n t2.value < stamps[0]) or\n ((use_rhs and t1.value > stamps[-1] and\n t2.value > stamps[-1])))):\n raise KeyError\n\n # a monotonic (sorted) series can be sliced\n left = stamps.searchsorted(\n t1.value, side='left') if use_lhs else None\n right = stamps.searchsorted(\n t2.value, side='right') if use_rhs else None\n\n return slice(left, right)\n\n lhs_mask = (stamps >= t1.value) if use_lhs else True\n rhs_mask = (stamps <= t2.value) if use_rhs else True\n\n # try to find a the dates\n return (lhs_mask & rhs_mask).nonzero()[0]\n\n def _possibly_promote(self, other):\n if other.inferred_type == 'date':\n other = DatetimeIndex(other)\n return self, other\n\n def get_value(self, series, key):\n \"\"\"\n Fast lookup of value from 1-dimensional ndarray. Only use this if you\n know what you're doing\n \"\"\"\n\n if isinstance(key, datetime):\n\n # needed to localize naive datetimes\n if self.tz is not None:\n key = Timestamp(key, tz=self.tz)\n\n return self.get_value_maybe_box(series, key)\n\n if isinstance(key, time):\n locs = self.indexer_at_time(key)\n return series.take(locs)\n\n try:\n return _maybe_box(self, Index.get_value(self, series, key),\n series, key)\n except KeyError:\n try:\n loc = self._get_string_slice(key)\n return series[loc]\n except (TypeError, ValueError, KeyError):\n pass\n\n try:\n return self.get_value_maybe_box(series, key)\n except (TypeError, ValueError, KeyError):\n raise KeyError(key)\n\n def get_value_maybe_box(self, series, key):\n # needed to localize naive datetimes\n if self.tz is not None:\n key = Timestamp(key, tz=self.tz)\n elif not isinstance(key, Timestamp):\n key = Timestamp(key)\n values = self._engine.get_value(_values_from_object(series),\n key, tz=self.tz)\n return _maybe_box(self, values, series, key)\n\n def get_loc(self, key, method=None, tolerance=None):\n \"\"\"\n Get integer location for requested label\n\n Returns\n -------\n loc : int\n \"\"\"\n if tolerance is not None:\n # try converting tolerance now, so errors don't get swallowed by\n # the try/except clauses below\n tolerance = self._convert_tolerance(tolerance)\n\n if isinstance(key, datetime):\n # needed to localize naive datetimes\n key = Timestamp(key, tz=self.tz)\n return Index.get_loc(self, key, method, tolerance)\n\n if isinstance(key, time):\n if method is not None:\n raise NotImplementedError('cannot yet lookup inexact labels '\n 'when key is a time object')\n return self.indexer_at_time(key)\n\n try:\n return Index.get_loc(self, key, method, tolerance)\n except (KeyError, ValueError, TypeError):\n try:\n return self._get_string_slice(key)\n except (TypeError, KeyError, ValueError):\n pass\n\n try:\n stamp = Timestamp(key, tz=self.tz)\n return Index.get_loc(self, stamp, method, tolerance)\n except (KeyError, ValueError):\n raise KeyError(key)\n\n def _maybe_cast_slice_bound(self, label, side, kind):\n \"\"\"\n If label is a string, cast it to datetime according to resolution.\n\n Parameters\n ----------\n label : object\n side : {'left', 'right'}\n kind : {'ix', 'loc', 'getitem'}\n\n Returns\n -------\n label : object\n\n Notes\n -----\n Value of `side` parameter should be validated in caller.\n\n \"\"\"\n assert kind in ['ix', 'loc', 'getitem', None]\n\n if is_float(label) or isinstance(label, time) or is_integer(label):\n self._invalid_indexer('slice', label)\n\n if isinstance(label, compat.string_types):\n freq = getattr(self, 'freqstr',\n getattr(self, 'inferred_freq', None))\n _, parsed, reso = parse_time_string(label, freq)\n bounds = self._parsed_string_to_bounds(reso, parsed)\n return bounds[0 if side == 'left' else 1]\n else:\n return label\n\n def _get_string_slice(self, key, use_lhs=True, use_rhs=True):\n freq = getattr(self, 'freqstr',\n getattr(self, 'inferred_freq', None))\n _, parsed, reso = parse_time_string(key, freq)\n loc = self._partial_date_slice(reso, parsed, use_lhs=use_lhs,\n use_rhs=use_rhs)\n return loc\n\n def slice_indexer(self, start=None, end=None, step=None, kind=None):\n \"\"\"\n Return indexer for specified label slice.\n Index.slice_indexer, customized to handle time slicing.\n\n In addition to functionality provided by Index.slice_indexer, does the\n following:\n\n - if both `start` and `end` are instances of `datetime.time`, it\n invokes `indexer_between_time`\n - if `start` and `end` are both either string or None perform\n value-based selection in non-monotonic cases.\n\n \"\"\"\n # For historical reasons DatetimeIndex supports slices between two\n # instances of datetime.time as if it were applying a slice mask to\n # an array of (self.hour, self.minute, self.seconds, self.microsecond).\n if isinstance(start, time) and isinstance(end, time):\n if step is not None and step != 1:\n raise ValueError('Must have step size of 1 with time slices')\n return self.indexer_between_time(start, end)\n\n if isinstance(start, time) or isinstance(end, time):\n raise KeyError('Cannot mix time and non-time slice keys')\n\n try:\n return Index.slice_indexer(self, start, end, step, kind=kind)\n except KeyError:\n # For historical reasons DatetimeIndex by default supports\n # value-based partial (aka string) slices on non-monotonic arrays,\n # let's try that.\n if ((start is None or isinstance(start, compat.string_types)) and\n (end is None or isinstance(end, compat.string_types))):\n mask = True\n if start is not None:\n start_casted = self._maybe_cast_slice_bound(\n start, 'left', kind)\n mask = start_casted <= self\n\n if end is not None:\n end_casted = self._maybe_cast_slice_bound(\n end, 'right', kind)\n mask = (self <= end_casted) & mask\n\n indexer = mask.nonzero()[0][::step]\n if len(indexer) == len(self):\n return slice(None)\n else:\n return indexer\n else:\n raise\n\n # alias to offset\n def _get_freq(self):\n return self.offset\n\n def _set_freq(self, value):\n self.offset = value\n freq = property(fget=_get_freq, fset=_set_freq,\n doc=\"get/set the frequncy of the Index\")\n\n year = _field_accessor('year', 'Y', \"The year of the datetime\")\n month = _field_accessor('month', 'M',\n \"The month as January=1, December=12\")\n day = _field_accessor('day', 'D', \"The days of the datetime\")\n hour = _field_accessor('hour', 'h', \"The hours of the datetime\")\n minute = _field_accessor('minute', 'm', \"The minutes of the datetime\")\n second = _field_accessor('second', 's', \"The seconds of the datetime\")\n microsecond = _field_accessor('microsecond', 'us',\n \"The microseconds of the datetime\")\n nanosecond = _field_accessor('nanosecond', 'ns',\n \"The nanoseconds of the datetime\")\n weekofyear = _field_accessor('weekofyear', 'woy',\n \"The week ordinal of the year\")\n week = weekofyear\n dayofweek = _field_accessor('dayofweek', 'dow',\n \"The day of the week with Monday=0, Sunday=6\")\n weekday = dayofweek\n\n weekday_name = _field_accessor(\n 'weekday_name',\n 'weekday_name',\n \"The name of day in a week (ex: Friday)\\n\\n.. versionadded:: 0.18.1\")\n\n dayofyear = _field_accessor('dayofyear', 'doy',\n \"The ordinal day of the year\")\n quarter = _field_accessor('quarter', 'q', \"The quarter of the date\")\n days_in_month = _field_accessor(\n 'days_in_month',\n 'dim',\n \"The number of days in the month\\n\\n.. versionadded:: 0.16.0\")\n daysinmonth = days_in_month\n is_month_start = _field_accessor(\n 'is_month_start',\n 'is_month_start',\n \"Logical indicating if first day of month (defined by frequency)\")\n is_month_end = _field_accessor(\n 'is_month_end',\n 'is_month_end',\n \"Logical indicating if last day of month (defined by frequency)\")\n is_quarter_start = _field_accessor(\n 'is_quarter_start',\n 'is_quarter_start',\n \"Logical indicating if first day of quarter (defined by frequency)\")\n is_quarter_end = _field_accessor(\n 'is_quarter_end',\n 'is_quarter_end',\n \"Logical indicating if last day of quarter (defined by frequency)\")\n is_year_start = _field_accessor(\n 'is_year_start',\n 'is_year_start',\n \"Logical indicating if first day of year (defined by frequency)\")\n is_year_end = _field_accessor(\n 'is_year_end',\n 'is_year_end',\n \"Logical indicating if last day of year (defined by frequency)\")\n is_leap_year = _field_accessor(\n 'is_leap_year',\n 'is_leap_year',\n \"Logical indicating if the date belongs to a leap year\")\n\n @property\n def time(self):\n \"\"\"\n Returns numpy array of datetime.time. The time part of the Timestamps.\n \"\"\"\n return self._maybe_mask_results(_algos.arrmap_object(\n self.asobject.values,\n lambda x: np.nan if x is tslib.NaT else x.time()))\n\n @property\n def date(self):\n \"\"\"\n Returns numpy array of python datetime.date objects (namely, the date\n part of Timestamps without timezone information).\n \"\"\"\n return self._maybe_mask_results(_algos.arrmap_object(\n self.asobject.values, lambda x: x.date()))\n\n def normalize(self):\n \"\"\"\n Return DatetimeIndex with times to midnight. Length is unaltered\n\n Returns\n -------\n normalized : DatetimeIndex\n \"\"\"\n new_values = tslib.date_normalize(self.asi8, self.tz)\n return DatetimeIndex(new_values, freq='infer', name=self.name,\n tz=self.tz)\n\n @Substitution(klass='DatetimeIndex', value='key')\n @Appender(_shared_docs['searchsorted'])\n def searchsorted(self, key, side='left', sorter=None):\n if isinstance(key, (np.ndarray, Index)):\n key = np.array(key, dtype=_NS_DTYPE, copy=False)\n else:\n key = _to_m8(key, tz=self.tz)\n\n return self.values.searchsorted(key, side=side)\n\n def is_type_compatible(self, typ):\n return typ == self.inferred_type or typ == 'datetime'\n\n @property\n def inferred_type(self):\n # b/c datetime is represented as microseconds since the epoch, make\n # sure we can't have ambiguous indexing\n return 'datetime64'\n\n @cache_readonly\n def dtype(self):\n if self.tz is None:\n return _NS_DTYPE\n return DatetimeTZDtype('ns', self.tz)\n\n @property\n def is_all_dates(self):\n return True\n\n @cache_readonly\n def is_normalized(self):\n \"\"\"\n Returns True if all of the dates are at midnight (\"no time\")\n \"\"\"\n return tslib.dates_normalized(self.asi8, self.tz)\n\n @cache_readonly\n def _resolution(self):\n return period.resolution(self.asi8, self.tz)\n\n def equals(self, other):\n \"\"\"\n Determines if two Index objects contain the same elements.\n \"\"\"\n if self.is_(other):\n return True\n\n if (not hasattr(other, 'inferred_type') or\n other.inferred_type != 'datetime64'):\n if self.offset is not None:\n return False\n try:\n other = DatetimeIndex(other)\n except:\n return False\n\n if self._has_same_tz(other):\n return np.array_equal(self.asi8, other.asi8)\n return False\n\n def insert(self, loc, item):\n \"\"\"\n Make new Index inserting new item at location\n\n Parameters\n ----------\n loc : int\n item : object\n if not either a Python datetime or a numpy integer-like, returned\n Index dtype will be object rather than datetime.\n\n Returns\n -------\n new_index : Index\n \"\"\"\n\n freq = None\n\n if isinstance(item, (datetime, np.datetime64)):\n self._assert_can_do_op(item)\n if not self._has_same_tz(item):\n raise ValueError(\n 'Passed item and index have different timezone')\n # check freq can be preserved on edge cases\n if self.size and self.freq is not None:\n if ((loc == 0 or loc == -len(self)) and\n item + self.freq == self[0]):\n freq = self.freq\n elif (loc == len(self)) and item - self.freq == self[-1]:\n freq = self.freq\n item = _to_m8(item, tz=self.tz)\n try:\n new_dates = np.concatenate((self[:loc].asi8, [item.view(np.int64)],\n self[loc:].asi8))\n if self.tz is not None:\n new_dates = tslib.tz_convert(new_dates, 'UTC', self.tz)\n return DatetimeIndex(new_dates, name=self.name, freq=freq,\n tz=self.tz)\n\n except (AttributeError, TypeError):\n\n # fall back to object index\n if isinstance(item, compat.string_types):\n return self.asobject.insert(loc, item)\n raise TypeError(\n \"cannot insert DatetimeIndex with incompatible label\")\n\n def delete(self, loc):\n \"\"\"\n Make a new DatetimeIndex with passed location(s) deleted.\n\n Parameters\n ----------\n loc: int, slice or array of ints\n Indicate which sub-arrays to remove.\n\n Returns\n -------\n new_index : DatetimeIndex\n \"\"\"\n new_dates = np.delete(self.asi8, loc)\n\n freq = None\n if is_integer(loc):\n if loc in (0, -len(self), -1, len(self) - 1):\n freq = self.freq\n else:\n if is_list_like(loc):\n loc = lib.maybe_indices_to_slice(\n _ensure_int64(np.array(loc)), len(self))\n if isinstance(loc, slice) and loc.step in (1, None):\n if (loc.start in (0, None) or loc.stop in (len(self), None)):\n freq = self.freq\n\n if self.tz is not None:\n new_dates = tslib.tz_convert(new_dates, 'UTC', self.tz)\n return DatetimeIndex(new_dates, name=self.name, freq=freq, tz=self.tz)\n\n def tz_convert(self, tz):\n \"\"\"\n Convert tz-aware DatetimeIndex from one time zone to another (using\n pytz/dateutil)\n\n Parameters\n ----------\n tz : string, pytz.timezone, dateutil.tz.tzfile or None\n Time zone for time. Corresponding timestamps would be converted to\n time zone of the TimeSeries.\n None will remove timezone holding UTC time.\n\n Returns\n -------\n normalized : DatetimeIndex\n\n Raises\n ------\n TypeError\n If DatetimeIndex is tz-naive.\n \"\"\"\n tz = tslib.maybe_get_tz(tz)\n\n if self.tz is None:\n # tz naive, use tz_localize\n raise TypeError('Cannot convert tz-naive timestamps, use '\n 'tz_localize to localize')\n\n # No conversion since timestamps are all UTC to begin with\n return self._shallow_copy(tz=tz)\n\n @deprecate_kwarg(old_arg_name='infer_dst', new_arg_name='ambiguous',\n mapping={True: 'infer', False: 'raise'})\n def tz_localize(self, tz, ambiguous='raise', errors='raise'):\n \"\"\"\n Localize tz-naive DatetimeIndex to given time zone (using\n pytz/dateutil), or remove timezone from tz-aware DatetimeIndex\n\n Parameters\n ----------\n tz : string, pytz.timezone, dateutil.tz.tzfile or None\n Time zone for time. Corresponding timestamps would be converted to\n time zone of the TimeSeries.\n None will remove timezone holding local time.\n ambiguous : 'infer', bool-ndarray, 'NaT', default 'raise'\n - 'infer' will attempt to infer fall dst-transition hours based on\n order\n - bool-ndarray where True signifies a DST time, False signifies a\n non-DST time (note that this flag is only applicable for\n ambiguous times)\n - 'NaT' will return NaT where there are ambiguous times\n - 'raise' will raise an AmbiguousTimeError if there are ambiguous\n times\n errors : 'raise', 'coerce', default 'raise'\n - 'raise' will raise a NonExistentTimeError if a timestamp is not\n valid in the specified timezone (e.g. due to a transition from\n or to DST time)\n - 'coerce' will return NaT if the timestamp can not be converted\n into the specified timezone\n\n .. versionadded:: 0.19.0\n\n infer_dst : boolean, default False (DEPRECATED)\n Attempt to infer fall dst-transition hours based on order\n\n Returns\n -------\n localized : DatetimeIndex\n\n Raises\n ------\n TypeError\n If the DatetimeIndex is tz-aware and tz is not None.\n \"\"\"\n if self.tz is not None:\n if tz is None:\n new_dates = tslib.tz_convert(self.asi8, 'UTC', self.tz)\n else:\n raise TypeError(\"Already tz-aware, use tz_convert to convert.\")\n else:\n tz = tslib.maybe_get_tz(tz)\n # Convert to UTC\n\n new_dates = tslib.tz_localize_to_utc(self.asi8, tz,\n ambiguous=ambiguous,\n errors=errors)\n new_dates = new_dates.view(_NS_DTYPE)\n return self._shallow_copy(new_dates, tz=tz)\n\n def indexer_at_time(self, time, asof=False):\n \"\"\"\n Select values at particular time of day (e.g. 9:30AM)\n\n Parameters\n ----------\n time : datetime.time or string\n\n Returns\n -------\n values_at_time : TimeSeries\n \"\"\"\n from dateutil.parser import parse\n\n if asof:\n raise NotImplementedError(\"'asof' argument is not supported\")\n\n if isinstance(time, compat.string_types):\n time = parse(time).time()\n\n if time.tzinfo:\n # TODO\n raise NotImplementedError(\"argument 'time' with timezone info is \"\n \"not supported\")\n\n time_micros = self._get_time_micros()\n micros = _time_to_micros(time)\n return (micros == time_micros).nonzero()[0]\n\n def indexer_between_time(self, start_time, end_time, include_start=True,\n include_end=True):\n \"\"\"\n Select values between particular times of day (e.g., 9:00-9:30AM).\n\n Return values of the index between two times. If start_time or\n end_time are strings then tseres.tools.to_time is used to convert to\n a time object.\n\n Parameters\n ----------\n start_time, end_time : datetime.time, str\n datetime.time or string in appropriate format (\"%H:%M\", \"%H%M\",\n \"%I:%M%p\", \"%I%M%p\", \"%H:%M:%S\", \"%H%M%S\", \"%I:%M:%S%p\",\n \"%I%M%S%p\")\n include_start : boolean, default True\n include_end : boolean, default True\n\n Returns\n -------\n values_between_time : TimeSeries\n \"\"\"\n start_time = to_time(start_time)\n end_time = to_time(end_time)\n time_micros = self._get_time_micros()\n start_micros = _time_to_micros(start_time)\n end_micros = _time_to_micros(end_time)\n\n if include_start and include_end:\n lop = rop = operator.le\n elif include_start:\n lop = operator.le\n rop = operator.lt\n elif include_end:\n lop = operator.lt\n rop = operator.le\n else:\n lop = rop = operator.lt\n\n if start_time <= end_time:\n join_op = operator.and_\n else:\n join_op = operator.or_\n\n mask = join_op(lop(start_micros, time_micros),\n rop(time_micros, end_micros))\n\n return mask.nonzero()[0]\n\n def to_julian_date(self):\n \"\"\"\n Convert DatetimeIndex to Float64Index of Julian Dates.\n 0 Julian date is noon January 1, 4713 BC.\n http://en.wikipedia.org/wiki/Julian_day\n \"\"\"\n\n # http://mysite.verizon.net/aesir_research/date/jdalg2.htm\n year = self.year\n month = self.month\n day = self.day\n testarr = month < 3\n year[testarr] -= 1\n month[testarr] += 12\n return Float64Index(day +\n np.fix((153 * month - 457) / 5) +\n 365 * year +\n np.floor(year / 4) -\n np.floor(year / 100) +\n np.floor(year / 400) +\n 1721118.5 +\n (self.hour +\n self.minute / 60.0 +\n self.second / 3600.0 +\n self.microsecond / 3600.0 / 1e+6 +\n self.nanosecond / 3600.0 / 1e+9\n ) / 24.0)\n\n\nDatetimeIndex._add_numeric_methods_disabled()\nDatetimeIndex._add_logical_methods_disabled()\nDatetimeIndex._add_datetimelike_methods()\n\n\ndef _generate_regular_range(start, end, periods, offset):\n if isinstance(offset, Tick):\n stride = offset.nanos\n if periods is None:\n b = Timestamp(start).value\n # cannot just use e = Timestamp(end) + 1 because arange breaks when\n # stride is too large, see GH10887\n e = (b + (Timestamp(end).value - b) // stride * stride +\n stride // 2 + 1)\n # end.tz == start.tz by this point due to _generate implementation\n tz = start.tz\n elif start is not None:\n b = Timestamp(start).value\n e = b + np.int64(periods) * stride\n tz = start.tz\n elif end is not None:\n e = Timestamp(end).value + stride\n b = e - np.int64(periods) * stride\n tz = end.tz\n else:\n raise ValueError(\"at least 'start' or 'end' should be specified \"\n \"if a 'period' is given.\")\n\n data = np.arange(b, e, stride, dtype=np.int64)\n data = DatetimeIndex._simple_new(data, None, tz=tz)\n else:\n if isinstance(start, Timestamp):\n start = start.to_pydatetime()\n\n if isinstance(end, Timestamp):\n end = end.to_pydatetime()\n\n xdr = generate_range(start=start, end=end,\n periods=periods, offset=offset)\n\n dates = list(xdr)\n # utc = len(dates) > 0 and dates[0].tzinfo is not None\n data = tools.to_datetime(dates)\n\n return data\n\n\ndef date_range(start=None, end=None, periods=None, freq='D', tz=None,\n normalize=False, name=None, closed=None, **kwargs):\n \"\"\"\n Return a fixed frequency datetime index, with day (calendar) as the default\n frequency\n\n Parameters\n ----------\n start : string or datetime-like, default None\n Left bound for generating dates\n end : string or datetime-like, default None\n Right bound for generating dates\n periods : integer or None, default None\n If None, must specify start and end\n freq : string or DateOffset, default 'D' (calendar daily)\n Frequency strings can have multiples, e.g. '5H'\n tz : string or None\n Time zone name for returning localized DatetimeIndex, for example\n Asia/Hong_Kong\n normalize : bool, default False\n Normalize start/end dates to midnight before generating date range\n name : str, default None\n Name of the resulting index\n closed : string or None, default None\n Make the interval closed with respect to the given frequency to\n the 'left', 'right', or both sides (None)\n\n Notes\n -----\n 2 of start, end, or periods must be specified\n\n To learn more about the frequency strings, please see `this link\n <http://pandas.pydata.org/pandas-docs/stable/timeseries.html#offset-aliases>`__.\n\n Returns\n -------\n rng : DatetimeIndex\n \"\"\"\n return DatetimeIndex(start=start, end=end, periods=periods,\n freq=freq, tz=tz, normalize=normalize, name=name,\n closed=closed, **kwargs)\n\n\ndef bdate_range(start=None, end=None, periods=None, freq='B', tz=None,\n normalize=True, name=None, closed=None, **kwargs):\n \"\"\"\n Return a fixed frequency datetime index, with business day as the default\n frequency\n\n Parameters\n ----------\n start : string or datetime-like, default None\n Left bound for generating dates\n end : string or datetime-like, default None\n Right bound for generating dates\n periods : integer or None, default None\n If None, must specify start and end\n freq : string or DateOffset, default 'B' (business daily)\n Frequency strings can have multiples, e.g. '5H'\n tz : string or None\n Time zone name for returning localized DatetimeIndex, for example\n Asia/Beijing\n normalize : bool, default False\n Normalize start/end dates to midnight before generating date range\n name : str, default None\n Name for the resulting index\n closed : string or None, default None\n Make the interval closed with respect to the given frequency to\n the 'left', 'right', or both sides (None)\n\n Notes\n -----\n 2 of start, end, or periods must be specified\n\n To learn more about the frequency strings, please see `this link\n <http://pandas.pydata.org/pandas-docs/stable/timeseries.html#offset-aliases>`__.\n\n Returns\n -------\n rng : DatetimeIndex\n \"\"\"\n\n return DatetimeIndex(start=start, end=end, periods=periods,\n freq=freq, tz=tz, normalize=normalize, name=name,\n closed=closed, **kwargs)\n\n\ndef cdate_range(start=None, end=None, periods=None, freq='C', tz=None,\n normalize=True, name=None, closed=None, **kwargs):\n \"\"\"\n **EXPERIMENTAL** Return a fixed frequency datetime index, with\n CustomBusinessDay as the default frequency\n\n .. warning:: EXPERIMENTAL\n\n The CustomBusinessDay class is not officially supported and the API is\n likely to change in future versions. Use this at your own risk.\n\n Parameters\n ----------\n start : string or datetime-like, default None\n Left bound for generating dates\n end : string or datetime-like, default None\n Right bound for generating dates\n periods : integer or None, default None\n If None, must specify start and end\n freq : string or DateOffset, default 'C' (CustomBusinessDay)\n Frequency strings can have multiples, e.g. '5H'\n tz : string or None\n Time zone name for returning localized DatetimeIndex, for example\n Asia/Beijing\n normalize : bool, default False\n Normalize start/end dates to midnight before generating date range\n name : str, default None\n Name for the resulting index\n weekmask : str, Default 'Mon Tue Wed Thu Fri'\n weekmask of valid business days, passed to ``numpy.busdaycalendar``\n holidays : list\n list/array of dates to exclude from the set of valid business days,\n passed to ``numpy.busdaycalendar``\n closed : string or None, default None\n Make the interval closed with respect to the given frequency to\n the 'left', 'right', or both sides (None)\n\n Notes\n -----\n 2 of start, end, or periods must be specified\n\n To learn more about the frequency strings, please see `this link\n <http://pandas.pydata.org/pandas-docs/stable/timeseries.html#offset-aliases>`__.\n\n Returns\n -------\n rng : DatetimeIndex\n \"\"\"\n\n if freq == 'C':\n holidays = kwargs.pop('holidays', [])\n weekmask = kwargs.pop('weekmask', 'Mon Tue Wed Thu Fri')\n freq = CDay(holidays=holidays, weekmask=weekmask)\n return DatetimeIndex(start=start, end=end, periods=periods, freq=freq,\n tz=tz, normalize=normalize, name=name,\n closed=closed, **kwargs)\n\n\ndef _to_m8(key, tz=None):\n \"\"\"\n Timestamp-like => dt64\n \"\"\"\n if not isinstance(key, Timestamp):\n # this also converts strings\n key = Timestamp(key, tz=tz)\n\n return np.int64(tslib.pydt_to_i8(key)).view(_NS_DTYPE)\n\n\n_CACHE_START = Timestamp(datetime(1950, 1, 1))\n_CACHE_END = Timestamp(datetime(2030, 1, 1))\n\n_daterange_cache = {}\n\n\ndef _naive_in_cache_range(start, end):\n if start is None or end is None:\n return False\n else:\n if start.tzinfo is not None or end.tzinfo is not None:\n return False\n return _in_range(start, end, _CACHE_START, _CACHE_END)\n\n\ndef _in_range(start, end, rng_start, rng_end):\n return start > rng_start and end < rng_end\n\n\ndef _use_cached_range(offset, _normalized, start, end):\n return (offset._should_cache() and\n not (offset._normalize_cache and not _normalized) and\n _naive_in_cache_range(start, end))\n\n\ndef _time_to_micros(time):\n seconds = time.hour * 60 * 60 + 60 * time.minute + time.second\n return 1000000 * seconds + time.microsecond\n\n\ndef _process_concat_data(to_concat, name):\n klass = Index\n kwargs = {}\n concat = np.concatenate\n\n all_dti = True\n need_utc_convert = False\n has_naive = False\n tz = None\n\n for x in to_concat:\n if not isinstance(x, DatetimeIndex):\n all_dti = False\n else:\n if tz is None:\n tz = x.tz\n\n if x.tz is None:\n has_naive = True\n\n if x.tz != tz:\n need_utc_convert = True\n tz = 'UTC'\n\n if all_dti:\n need_obj_convert = False\n if has_naive and tz is not None:\n need_obj_convert = True\n\n if need_obj_convert:\n to_concat = [x.asobject.values for x in to_concat]\n\n else:\n if need_utc_convert:\n to_concat = [x.tz_convert('UTC').values for x in to_concat]\n else:\n to_concat = [x.values for x in to_concat]\n\n # well, technically not a \"class\" anymore...oh well\n klass = DatetimeIndex._simple_new\n kwargs = {'tz': tz}\n concat = _concat._concat_compat\n else:\n for i, x in enumerate(to_concat):\n if isinstance(x, DatetimeIndex):\n to_concat[i] = x.asobject.values\n elif isinstance(x, Index):\n to_concat[i] = x.values\n\n factory_func = lambda x: klass(concat(x), name=name, **kwargs)\n return to_concat, factory_func\n", "# coding=utf-8\n# pylint: disable-msg=E1101,W0612\n\nfrom datetime import datetime, timedelta\nimport operator\nfrom itertools import product, starmap\n\nfrom numpy import nan, inf\nimport numpy as np\nimport pandas as pd\n\nfrom pandas import (Index, Series, DataFrame, isnull, bdate_range,\n NaT, date_range, timedelta_range,\n _np_version_under1p8)\nfrom pandas.tseries.index import Timestamp\nfrom pandas.tseries.tdi import Timedelta\nimport pandas.core.nanops as nanops\n\nfrom pandas.compat import range, zip\nfrom pandas import compat\nfrom pandas.util.testing import assert_series_equal, assert_almost_equal\nimport pandas.util.testing as tm\n\nfrom .common import TestData\n\n\nclass TestSeriesOperators(TestData, tm.TestCase):\n\n _multiprocess_can_split_ = True\n\n def test_comparisons(self):\n left = np.random.randn(10)\n right = np.random.randn(10)\n left[:3] = np.nan\n\n result = nanops.nangt(left, right)\n with np.errstate(invalid='ignore'):\n expected = (left > right).astype('O')\n expected[:3] = np.nan\n\n assert_almost_equal(result, expected)\n\n s = Series(['a', 'b', 'c'])\n s2 = Series([False, True, False])\n\n # it works!\n exp = Series([False, False, False])\n tm.assert_series_equal(s == s2, exp)\n tm.assert_series_equal(s2 == s, exp)\n\n def test_op_method(self):\n def check(series, other, check_reverse=False):\n simple_ops = ['add', 'sub', 'mul', 'floordiv', 'truediv', 'pow']\n if not compat.PY3:\n simple_ops.append('div')\n\n for opname in simple_ops:\n op = getattr(Series, opname)\n\n if op == 'div':\n alt = operator.truediv\n else:\n alt = getattr(operator, opname)\n\n result = op(series, other)\n expected = alt(series, other)\n tm.assert_almost_equal(result, expected)\n if check_reverse:\n rop = getattr(Series, \"r\" + opname)\n result = rop(series, other)\n expected = alt(other, series)\n tm.assert_almost_equal(result, expected)\n\n check(self.ts, self.ts * 2)\n check(self.ts, self.ts[::2])\n check(self.ts, 5, check_reverse=True)\n check(tm.makeFloatSeries(), tm.makeFloatSeries(), check_reverse=True)\n\n def test_neg(self):\n assert_series_equal(-self.series, -1 * self.series)\n\n def test_invert(self):\n assert_series_equal(-(self.series < 0), ~(self.series < 0))\n\n def test_div(self):\n with np.errstate(all='ignore'):\n # no longer do integer div for any ops, but deal with the 0's\n p = DataFrame({'first': [3, 4, 5, 8], 'second': [0, 0, 0, 3]})\n result = p['first'] / p['second']\n expected = Series(\n p['first'].values.astype(float) / p['second'].values,\n dtype='float64')\n expected.iloc[0:3] = np.inf\n assert_series_equal(result, expected)\n\n result = p['first'] / 0\n expected = Series(np.inf, index=p.index, name='first')\n assert_series_equal(result, expected)\n\n p = p.astype('float64')\n result = p['first'] / p['second']\n expected = Series(p['first'].values / p['second'].values)\n assert_series_equal(result, expected)\n\n p = DataFrame({'first': [3, 4, 5, 8], 'second': [1, 1, 1, 1]})\n result = p['first'] / p['second']\n assert_series_equal(result, p['first'].astype('float64'),\n check_names=False)\n self.assertTrue(result.name is None)\n self.assertFalse(np.array_equal(result, p['second'] / p['first']))\n\n # inf signing\n s = Series([np.nan, 1., -1.])\n result = s / 0\n expected = Series([np.nan, np.inf, -np.inf])\n assert_series_equal(result, expected)\n\n # float/integer issue\n # GH 7785\n p = DataFrame({'first': (1, 0), 'second': (-0.01, -0.02)})\n expected = Series([-0.01, -np.inf])\n\n result = p['second'].div(p['first'])\n assert_series_equal(result, expected, check_names=False)\n\n result = p['second'] / p['first']\n assert_series_equal(result, expected)\n\n # GH 9144\n s = Series([-1, 0, 1])\n\n result = 0 / s\n expected = Series([0.0, nan, 0.0])\n assert_series_equal(result, expected)\n\n result = s / 0\n expected = Series([-inf, nan, inf])\n assert_series_equal(result, expected)\n\n result = s // 0\n expected = Series([-inf, nan, inf])\n assert_series_equal(result, expected)\n\n def test_operators(self):\n def _check_op(series, other, op, pos_only=False,\n check_dtype=True):\n left = np.abs(series) if pos_only else series\n right = np.abs(other) if pos_only else other\n\n cython_or_numpy = op(left, right)\n python = left.combine(right, op)\n tm.assert_series_equal(cython_or_numpy, python,\n check_dtype=check_dtype)\n\n def check(series, other):\n simple_ops = ['add', 'sub', 'mul', 'truediv', 'floordiv', 'mod']\n\n for opname in simple_ops:\n _check_op(series, other, getattr(operator, opname))\n\n _check_op(series, other, operator.pow, pos_only=True)\n\n _check_op(series, other, lambda x, y: operator.add(y, x))\n _check_op(series, other, lambda x, y: operator.sub(y, x))\n _check_op(series, other, lambda x, y: operator.truediv(y, x))\n _check_op(series, other, lambda x, y: operator.floordiv(y, x))\n _check_op(series, other, lambda x, y: operator.mul(y, x))\n _check_op(series, other, lambda x, y: operator.pow(y, x),\n pos_only=True)\n _check_op(series, other, lambda x, y: operator.mod(y, x))\n\n check(self.ts, self.ts * 2)\n check(self.ts, self.ts * 0)\n check(self.ts, self.ts[::2])\n check(self.ts, 5)\n\n def check_comparators(series, other, check_dtype=True):\n _check_op(series, other, operator.gt, check_dtype=check_dtype)\n _check_op(series, other, operator.ge, check_dtype=check_dtype)\n _check_op(series, other, operator.eq, check_dtype=check_dtype)\n _check_op(series, other, operator.lt, check_dtype=check_dtype)\n _check_op(series, other, operator.le, check_dtype=check_dtype)\n\n check_comparators(self.ts, 5)\n check_comparators(self.ts, self.ts + 1, check_dtype=False)\n\n def test_operators_empty_int_corner(self):\n s1 = Series([], [], dtype=np.int32)\n s2 = Series({'x': 0.})\n tm.assert_series_equal(s1 * s2, Series([np.nan], index=['x']))\n\n def test_operators_timedelta64(self):\n\n # invalid ops\n self.assertRaises(Exception, self.objSeries.__add__, 1)\n self.assertRaises(Exception, self.objSeries.__add__,\n np.array(1, dtype=np.int64))\n self.assertRaises(Exception, self.objSeries.__sub__, 1)\n self.assertRaises(Exception, self.objSeries.__sub__,\n np.array(1, dtype=np.int64))\n\n # seriese ops\n v1 = date_range('2012-1-1', periods=3, freq='D')\n v2 = date_range('2012-1-2', periods=3, freq='D')\n rs = Series(v2) - Series(v1)\n xp = Series(1e9 * 3600 * 24,\n rs.index).astype('int64').astype('timedelta64[ns]')\n assert_series_equal(rs, xp)\n self.assertEqual(rs.dtype, 'timedelta64[ns]')\n\n df = DataFrame(dict(A=v1))\n td = Series([timedelta(days=i) for i in range(3)])\n self.assertEqual(td.dtype, 'timedelta64[ns]')\n\n # series on the rhs\n result = df['A'] - df['A'].shift()\n self.assertEqual(result.dtype, 'timedelta64[ns]')\n\n result = df['A'] + td\n self.assertEqual(result.dtype, 'M8[ns]')\n\n # scalar Timestamp on rhs\n maxa = df['A'].max()\n tm.assertIsInstance(maxa, Timestamp)\n\n resultb = df['A'] - df['A'].max()\n self.assertEqual(resultb.dtype, 'timedelta64[ns]')\n\n # timestamp on lhs\n result = resultb + df['A']\n values = [Timestamp('20111230'), Timestamp('20120101'),\n Timestamp('20120103')]\n expected = Series(values, name='A')\n assert_series_equal(result, expected)\n\n # datetimes on rhs\n result = df['A'] - datetime(2001, 1, 1)\n expected = Series(\n [timedelta(days=4017 + i) for i in range(3)], name='A')\n assert_series_equal(result, expected)\n self.assertEqual(result.dtype, 'm8[ns]')\n\n d = datetime(2001, 1, 1, 3, 4)\n resulta = df['A'] - d\n self.assertEqual(resulta.dtype, 'm8[ns]')\n\n # roundtrip\n resultb = resulta + d\n assert_series_equal(df['A'], resultb)\n\n # timedeltas on rhs\n td = timedelta(days=1)\n resulta = df['A'] + td\n resultb = resulta - td\n assert_series_equal(resultb, df['A'])\n self.assertEqual(resultb.dtype, 'M8[ns]')\n\n # roundtrip\n td = timedelta(minutes=5, seconds=3)\n resulta = df['A'] + td\n resultb = resulta - td\n assert_series_equal(df['A'], resultb)\n self.assertEqual(resultb.dtype, 'M8[ns]')\n\n # inplace\n value = rs[2] + np.timedelta64(timedelta(minutes=5, seconds=1))\n rs[2] += np.timedelta64(timedelta(minutes=5, seconds=1))\n self.assertEqual(rs[2], value)\n\n def test_operator_series_comparison_zerorank(self):\n # GH 13006\n result = np.float64(0) > pd.Series([1, 2, 3])\n expected = 0.0 > pd.Series([1, 2, 3])\n self.assert_series_equal(result, expected)\n result = pd.Series([1, 2, 3]) < np.float64(0)\n expected = pd.Series([1, 2, 3]) < 0.0\n self.assert_series_equal(result, expected)\n result = np.array([0, 1, 2])[0] > pd.Series([0, 1, 2])\n expected = 0.0 > pd.Series([1, 2, 3])\n self.assert_series_equal(result, expected)\n\n def test_timedeltas_with_DateOffset(self):\n\n # GH 4532\n # operate with pd.offsets\n s = Series([Timestamp('20130101 9:01'), Timestamp('20130101 9:02')])\n\n result = s + pd.offsets.Second(5)\n result2 = pd.offsets.Second(5) + s\n expected = Series([Timestamp('20130101 9:01:05'), Timestamp(\n '20130101 9:02:05')])\n assert_series_equal(result, expected)\n assert_series_equal(result2, expected)\n\n result = s - pd.offsets.Second(5)\n result2 = -pd.offsets.Second(5) + s\n expected = Series([Timestamp('20130101 9:00:55'), Timestamp(\n '20130101 9:01:55')])\n assert_series_equal(result, expected)\n assert_series_equal(result2, expected)\n\n result = s + pd.offsets.Milli(5)\n result2 = pd.offsets.Milli(5) + s\n expected = Series([Timestamp('20130101 9:01:00.005'), Timestamp(\n '20130101 9:02:00.005')])\n assert_series_equal(result, expected)\n assert_series_equal(result2, expected)\n\n result = s + pd.offsets.Minute(5) + pd.offsets.Milli(5)\n expected = Series([Timestamp('20130101 9:06:00.005'), Timestamp(\n '20130101 9:07:00.005')])\n assert_series_equal(result, expected)\n\n # operate with np.timedelta64 correctly\n result = s + np.timedelta64(1, 's')\n result2 = np.timedelta64(1, 's') + s\n expected = Series([Timestamp('20130101 9:01:01'), Timestamp(\n '20130101 9:02:01')])\n assert_series_equal(result, expected)\n assert_series_equal(result2, expected)\n\n result = s + np.timedelta64(5, 'ms')\n result2 = np.timedelta64(5, 'ms') + s\n expected = Series([Timestamp('20130101 9:01:00.005'), Timestamp(\n '20130101 9:02:00.005')])\n assert_series_equal(result, expected)\n assert_series_equal(result2, expected)\n\n # valid DateOffsets\n for do in ['Hour', 'Minute', 'Second', 'Day', 'Micro', 'Milli',\n 'Nano']:\n op = getattr(pd.offsets, do)\n s + op(5)\n op(5) + s\n\n def test_timedelta_series_ops(self):\n # GH11925\n\n s = Series(timedelta_range('1 day', periods=3))\n ts = Timestamp('2012-01-01')\n expected = Series(date_range('2012-01-02', periods=3))\n assert_series_equal(ts + s, expected)\n assert_series_equal(s + ts, expected)\n\n expected2 = Series(date_range('2011-12-31', periods=3, freq='-1D'))\n assert_series_equal(ts - s, expected2)\n assert_series_equal(ts + (-s), expected2)\n\n def test_timedelta64_operations_with_DateOffset(self):\n # GH 10699\n td = Series([timedelta(minutes=5, seconds=3)] * 3)\n result = td + pd.offsets.Minute(1)\n expected = Series([timedelta(minutes=6, seconds=3)] * 3)\n assert_series_equal(result, expected)\n\n result = td - pd.offsets.Minute(1)\n expected = Series([timedelta(minutes=4, seconds=3)] * 3)\n assert_series_equal(result, expected)\n\n result = td + Series([pd.offsets.Minute(1), pd.offsets.Second(3),\n pd.offsets.Hour(2)])\n expected = Series([timedelta(minutes=6, seconds=3), timedelta(\n minutes=5, seconds=6), timedelta(hours=2, minutes=5, seconds=3)])\n assert_series_equal(result, expected)\n\n result = td + pd.offsets.Minute(1) + pd.offsets.Second(12)\n expected = Series([timedelta(minutes=6, seconds=15)] * 3)\n assert_series_equal(result, expected)\n\n # valid DateOffsets\n for do in ['Hour', 'Minute', 'Second', 'Day', 'Micro', 'Milli',\n 'Nano']:\n op = getattr(pd.offsets, do)\n td + op(5)\n op(5) + td\n td - op(5)\n op(5) - td\n\n def test_timedelta64_operations_with_timedeltas(self):\n\n # td operate with td\n td1 = Series([timedelta(minutes=5, seconds=3)] * 3)\n td2 = timedelta(minutes=5, seconds=4)\n result = td1 - td2\n expected = Series([timedelta(seconds=0)] * 3) - Series([timedelta(\n seconds=1)] * 3)\n self.assertEqual(result.dtype, 'm8[ns]')\n assert_series_equal(result, expected)\n\n result2 = td2 - td1\n expected = (Series([timedelta(seconds=1)] * 3) - Series([timedelta(\n seconds=0)] * 3))\n assert_series_equal(result2, expected)\n\n # roundtrip\n assert_series_equal(result + td2, td1)\n\n # Now again, using pd.to_timedelta, which should build\n # a Series or a scalar, depending on input.\n td1 = Series(pd.to_timedelta(['00:05:03'] * 3))\n td2 = pd.to_timedelta('00:05:04')\n result = td1 - td2\n expected = Series([timedelta(seconds=0)] * 3) - Series([timedelta(\n seconds=1)] * 3)\n self.assertEqual(result.dtype, 'm8[ns]')\n assert_series_equal(result, expected)\n\n result2 = td2 - td1\n expected = (Series([timedelta(seconds=1)] * 3) - Series([timedelta(\n seconds=0)] * 3))\n assert_series_equal(result2, expected)\n\n # roundtrip\n assert_series_equal(result + td2, td1)\n\n def test_timedelta64_operations_with_integers(self):\n\n # GH 4521\n # divide/multiply by integers\n startdate = Series(date_range('2013-01-01', '2013-01-03'))\n enddate = Series(date_range('2013-03-01', '2013-03-03'))\n\n s1 = enddate - startdate\n s1[2] = np.nan\n s2 = Series([2, 3, 4])\n expected = Series(s1.values.astype(np.int64) / s2, dtype='m8[ns]')\n expected[2] = np.nan\n result = s1 / s2\n assert_series_equal(result, expected)\n\n s2 = Series([20, 30, 40])\n expected = Series(s1.values.astype(np.int64) / s2, dtype='m8[ns]')\n expected[2] = np.nan\n result = s1 / s2\n assert_series_equal(result, expected)\n\n result = s1 / 2\n expected = Series(s1.values.astype(np.int64) / 2, dtype='m8[ns]')\n expected[2] = np.nan\n assert_series_equal(result, expected)\n\n s2 = Series([20, 30, 40])\n expected = Series(s1.values.astype(np.int64) * s2, dtype='m8[ns]')\n expected[2] = np.nan\n result = s1 * s2\n assert_series_equal(result, expected)\n\n for dtype in ['int32', 'int16', 'uint32', 'uint64', 'uint32', 'uint16',\n 'uint8']:\n s2 = Series([20, 30, 40], dtype=dtype)\n expected = Series(\n s1.values.astype(np.int64) * s2.astype(np.int64),\n dtype='m8[ns]')\n expected[2] = np.nan\n result = s1 * s2\n assert_series_equal(result, expected)\n\n result = s1 * 2\n expected = Series(s1.values.astype(np.int64) * 2, dtype='m8[ns]')\n expected[2] = np.nan\n assert_series_equal(result, expected)\n\n result = s1 * -1\n expected = Series(s1.values.astype(np.int64) * -1, dtype='m8[ns]')\n expected[2] = np.nan\n assert_series_equal(result, expected)\n\n # invalid ops\n assert_series_equal(s1 / s2.astype(float),\n Series([Timedelta('2 days 22:48:00'), Timedelta(\n '1 days 23:12:00'), Timedelta('NaT')]))\n assert_series_equal(s1 / 2.0,\n Series([Timedelta('29 days 12:00:00'), Timedelta(\n '29 days 12:00:00'), Timedelta('NaT')]))\n\n for op in ['__add__', '__sub__']:\n sop = getattr(s1, op, None)\n if sop is not None:\n self.assertRaises(TypeError, sop, 1)\n self.assertRaises(TypeError, sop, s2.values)\n\n def test_timedelta64_conversions(self):\n startdate = Series(date_range('2013-01-01', '2013-01-03'))\n enddate = Series(date_range('2013-03-01', '2013-03-03'))\n\n s1 = enddate - startdate\n s1[2] = np.nan\n\n for m in [1, 3, 10]:\n for unit in ['D', 'h', 'm', 's', 'ms', 'us', 'ns']:\n\n # op\n expected = s1.apply(lambda x: x / np.timedelta64(m, unit))\n result = s1 / np.timedelta64(m, unit)\n assert_series_equal(result, expected)\n\n if m == 1 and unit != 'ns':\n\n # astype\n result = s1.astype(\"timedelta64[{0}]\".format(unit))\n assert_series_equal(result, expected)\n\n # reverse op\n expected = s1.apply(\n lambda x: Timedelta(np.timedelta64(m, unit)) / x)\n result = np.timedelta64(m, unit) / s1\n\n # astype\n s = Series(date_range('20130101', periods=3))\n result = s.astype(object)\n self.assertIsInstance(result.iloc[0], datetime)\n self.assertTrue(result.dtype == np.object_)\n\n result = s1.astype(object)\n self.assertIsInstance(result.iloc[0], timedelta)\n self.assertTrue(result.dtype == np.object_)\n\n def test_timedelta64_equal_timedelta_supported_ops(self):\n ser = Series([Timestamp('20130301'), Timestamp('20130228 23:00:00'),\n Timestamp('20130228 22:00:00'), Timestamp(\n '20130228 21:00:00')])\n\n intervals = 'D', 'h', 'm', 's', 'us'\n\n # TODO: unused\n # npy16_mappings = {'D': 24 * 60 * 60 * 1000000,\n # 'h': 60 * 60 * 1000000,\n # 'm': 60 * 1000000,\n # 's': 1000000,\n # 'us': 1}\n\n def timedelta64(*args):\n return sum(starmap(np.timedelta64, zip(args, intervals)))\n\n for op, d, h, m, s, us in product([operator.add, operator.sub],\n *([range(2)] * 5)):\n nptd = timedelta64(d, h, m, s, us)\n pytd = timedelta(days=d, hours=h, minutes=m, seconds=s,\n microseconds=us)\n lhs = op(ser, nptd)\n rhs = op(ser, pytd)\n\n try:\n assert_series_equal(lhs, rhs)\n except:\n raise AssertionError(\n \"invalid comparsion [op->{0},d->{1},h->{2},m->{3},\"\n \"s->{4},us->{5}]\\n{6}\\n{7}\\n\".format(op, d, h, m, s,\n us, lhs, rhs))\n\n def test_operators_datetimelike(self):\n def run_ops(ops, get_ser, test_ser):\n\n # check that we are getting a TypeError\n # with 'operate' (from core/ops.py) for the ops that are not\n # defined\n for op_str in ops:\n op = getattr(get_ser, op_str, None)\n with tm.assertRaisesRegexp(TypeError, 'operate'):\n op(test_ser)\n\n # ## timedelta64 ###\n td1 = Series([timedelta(minutes=5, seconds=3)] * 3)\n td1.iloc[2] = np.nan\n td2 = timedelta(minutes=5, seconds=4)\n ops = ['__mul__', '__floordiv__', '__pow__', '__rmul__',\n '__rfloordiv__', '__rpow__']\n run_ops(ops, td1, td2)\n td1 + td2\n td2 + td1\n td1 - td2\n td2 - td1\n td1 / td2\n td2 / td1\n\n # ## datetime64 ###\n dt1 = Series([Timestamp('20111230'), Timestamp('20120101'),\n Timestamp('20120103')])\n dt1.iloc[2] = np.nan\n dt2 = Series([Timestamp('20111231'), Timestamp('20120102'),\n Timestamp('20120104')])\n ops = ['__add__', '__mul__', '__floordiv__', '__truediv__', '__div__',\n '__pow__', '__radd__', '__rmul__', '__rfloordiv__',\n '__rtruediv__', '__rdiv__', '__rpow__']\n run_ops(ops, dt1, dt2)\n dt1 - dt2\n dt2 - dt1\n\n # ## datetime64 with timetimedelta ###\n ops = ['__mul__', '__floordiv__', '__truediv__', '__div__', '__pow__',\n '__rmul__', '__rfloordiv__', '__rtruediv__', '__rdiv__',\n '__rpow__']\n run_ops(ops, dt1, td1)\n dt1 + td1\n td1 + dt1\n dt1 - td1\n # TODO: Decide if this ought to work.\n # td1 - dt1\n\n # ## timetimedelta with datetime64 ###\n ops = ['__sub__', '__mul__', '__floordiv__', '__truediv__', '__div__',\n '__pow__', '__rmul__', '__rfloordiv__', '__rtruediv__',\n '__rdiv__', '__rpow__']\n run_ops(ops, td1, dt1)\n td1 + dt1\n dt1 + td1\n\n # 8260, 10763\n # datetime64 with tz\n ops = ['__mul__', '__floordiv__', '__truediv__', '__div__', '__pow__',\n '__rmul__', '__rfloordiv__', '__rtruediv__', '__rdiv__',\n '__rpow__']\n\n tz = 'US/Eastern'\n dt1 = Series(date_range('2000-01-01 09:00:00', periods=5,\n tz=tz), name='foo')\n dt2 = dt1.copy()\n dt2.iloc[2] = np.nan\n td1 = Series(timedelta_range('1 days 1 min', periods=5, freq='H'))\n td2 = td1.copy()\n td2.iloc[1] = np.nan\n run_ops(ops, dt1, td1)\n\n result = dt1 + td1[0]\n exp = (dt1.dt.tz_localize(None) + td1[0]).dt.tz_localize(tz)\n assert_series_equal(result, exp)\n\n result = dt2 + td2[0]\n exp = (dt2.dt.tz_localize(None) + td2[0]).dt.tz_localize(tz)\n assert_series_equal(result, exp)\n\n # odd numpy behavior with scalar timedeltas\n if not _np_version_under1p8:\n result = td1[0] + dt1\n exp = (dt1.dt.tz_localize(None) + td1[0]).dt.tz_localize(tz)\n assert_series_equal(result, exp)\n\n result = td2[0] + dt2\n exp = (dt2.dt.tz_localize(None) + td2[0]).dt.tz_localize(tz)\n assert_series_equal(result, exp)\n\n result = dt1 - td1[0]\n exp = (dt1.dt.tz_localize(None) - td1[0]).dt.tz_localize(tz)\n assert_series_equal(result, exp)\n self.assertRaises(TypeError, lambda: td1[0] - dt1)\n\n result = dt2 - td2[0]\n exp = (dt2.dt.tz_localize(None) - td2[0]).dt.tz_localize(tz)\n assert_series_equal(result, exp)\n self.assertRaises(TypeError, lambda: td2[0] - dt2)\n\n result = dt1 + td1\n exp = (dt1.dt.tz_localize(None) + td1).dt.tz_localize(tz)\n assert_series_equal(result, exp)\n\n result = dt2 + td2\n exp = (dt2.dt.tz_localize(None) + td2).dt.tz_localize(tz)\n assert_series_equal(result, exp)\n\n result = dt1 - td1\n exp = (dt1.dt.tz_localize(None) - td1).dt.tz_localize(tz)\n assert_series_equal(result, exp)\n\n result = dt2 - td2\n exp = (dt2.dt.tz_localize(None) - td2).dt.tz_localize(tz)\n assert_series_equal(result, exp)\n\n self.assertRaises(TypeError, lambda: td1 - dt1)\n self.assertRaises(TypeError, lambda: td2 - dt2)\n\n def test_sub_single_tz(self):\n # GH12290\n s1 = Series([pd.Timestamp('2016-02-10', tz='America/Sao_Paulo')])\n s2 = Series([pd.Timestamp('2016-02-08', tz='America/Sao_Paulo')])\n result = s1 - s2\n expected = Series([Timedelta('2days')])\n assert_series_equal(result, expected)\n result = s2 - s1\n expected = Series([Timedelta('-2days')])\n assert_series_equal(result, expected)\n\n def test_ops_nat(self):\n # GH 11349\n timedelta_series = Series([NaT, Timedelta('1s')])\n datetime_series = Series([NaT, Timestamp('19900315')])\n nat_series_dtype_timedelta = Series(\n [NaT, NaT], dtype='timedelta64[ns]')\n nat_series_dtype_timestamp = Series([NaT, NaT], dtype='datetime64[ns]')\n single_nat_dtype_datetime = Series([NaT], dtype='datetime64[ns]')\n single_nat_dtype_timedelta = Series([NaT], dtype='timedelta64[ns]')\n\n # subtraction\n assert_series_equal(timedelta_series - NaT, nat_series_dtype_timedelta)\n assert_series_equal(-NaT + timedelta_series,\n nat_series_dtype_timedelta)\n\n assert_series_equal(timedelta_series - single_nat_dtype_timedelta,\n nat_series_dtype_timedelta)\n assert_series_equal(-single_nat_dtype_timedelta + timedelta_series,\n nat_series_dtype_timedelta)\n\n assert_series_equal(datetime_series - NaT, nat_series_dtype_timestamp)\n assert_series_equal(-NaT + datetime_series, nat_series_dtype_timestamp)\n\n assert_series_equal(datetime_series - single_nat_dtype_datetime,\n nat_series_dtype_timedelta)\n with tm.assertRaises(TypeError):\n -single_nat_dtype_datetime + datetime_series\n\n assert_series_equal(datetime_series - single_nat_dtype_timedelta,\n nat_series_dtype_timestamp)\n assert_series_equal(-single_nat_dtype_timedelta + datetime_series,\n nat_series_dtype_timestamp)\n\n # without a Series wrapping the NaT, it is ambiguous\n # whether it is a datetime64 or timedelta64\n # defaults to interpreting it as timedelta64\n assert_series_equal(nat_series_dtype_timestamp - NaT,\n nat_series_dtype_timestamp)\n assert_series_equal(-NaT + nat_series_dtype_timestamp,\n nat_series_dtype_timestamp)\n\n assert_series_equal(nat_series_dtype_timestamp -\n single_nat_dtype_datetime,\n nat_series_dtype_timedelta)\n with tm.assertRaises(TypeError):\n -single_nat_dtype_datetime + nat_series_dtype_timestamp\n\n assert_series_equal(nat_series_dtype_timestamp -\n single_nat_dtype_timedelta,\n nat_series_dtype_timestamp)\n assert_series_equal(-single_nat_dtype_timedelta +\n nat_series_dtype_timestamp,\n nat_series_dtype_timestamp)\n\n with tm.assertRaises(TypeError):\n timedelta_series - single_nat_dtype_datetime\n\n # addition\n assert_series_equal(nat_series_dtype_timestamp + NaT,\n nat_series_dtype_timestamp)\n assert_series_equal(NaT + nat_series_dtype_timestamp,\n nat_series_dtype_timestamp)\n\n assert_series_equal(nat_series_dtype_timestamp +\n single_nat_dtype_timedelta,\n nat_series_dtype_timestamp)\n assert_series_equal(single_nat_dtype_timedelta +\n nat_series_dtype_timestamp,\n nat_series_dtype_timestamp)\n\n assert_series_equal(nat_series_dtype_timedelta + NaT,\n nat_series_dtype_timedelta)\n assert_series_equal(NaT + nat_series_dtype_timedelta,\n nat_series_dtype_timedelta)\n\n assert_series_equal(nat_series_dtype_timedelta +\n single_nat_dtype_timedelta,\n nat_series_dtype_timedelta)\n assert_series_equal(single_nat_dtype_timedelta +\n nat_series_dtype_timedelta,\n nat_series_dtype_timedelta)\n\n assert_series_equal(timedelta_series + NaT, nat_series_dtype_timedelta)\n assert_series_equal(NaT + timedelta_series, nat_series_dtype_timedelta)\n\n assert_series_equal(timedelta_series + single_nat_dtype_timedelta,\n nat_series_dtype_timedelta)\n assert_series_equal(single_nat_dtype_timedelta + timedelta_series,\n nat_series_dtype_timedelta)\n\n assert_series_equal(nat_series_dtype_timestamp + NaT,\n nat_series_dtype_timestamp)\n assert_series_equal(NaT + nat_series_dtype_timestamp,\n nat_series_dtype_timestamp)\n\n assert_series_equal(nat_series_dtype_timestamp +\n single_nat_dtype_timedelta,\n nat_series_dtype_timestamp)\n assert_series_equal(single_nat_dtype_timedelta +\n nat_series_dtype_timestamp,\n nat_series_dtype_timestamp)\n\n assert_series_equal(nat_series_dtype_timedelta + NaT,\n nat_series_dtype_timedelta)\n assert_series_equal(NaT + nat_series_dtype_timedelta,\n nat_series_dtype_timedelta)\n\n assert_series_equal(nat_series_dtype_timedelta +\n single_nat_dtype_timedelta,\n nat_series_dtype_timedelta)\n assert_series_equal(single_nat_dtype_timedelta +\n nat_series_dtype_timedelta,\n nat_series_dtype_timedelta)\n\n assert_series_equal(nat_series_dtype_timedelta +\n single_nat_dtype_datetime,\n nat_series_dtype_timestamp)\n assert_series_equal(single_nat_dtype_datetime +\n nat_series_dtype_timedelta,\n nat_series_dtype_timestamp)\n\n # multiplication\n assert_series_equal(nat_series_dtype_timedelta * 1.0,\n nat_series_dtype_timedelta)\n assert_series_equal(1.0 * nat_series_dtype_timedelta,\n nat_series_dtype_timedelta)\n\n assert_series_equal(timedelta_series * 1, timedelta_series)\n assert_series_equal(1 * timedelta_series, timedelta_series)\n\n assert_series_equal(timedelta_series * 1.5,\n Series([NaT, Timedelta('1.5s')]))\n assert_series_equal(1.5 * timedelta_series,\n Series([NaT, Timedelta('1.5s')]))\n\n assert_series_equal(timedelta_series * nan, nat_series_dtype_timedelta)\n assert_series_equal(nan * timedelta_series, nat_series_dtype_timedelta)\n\n with tm.assertRaises(TypeError):\n datetime_series * 1\n with tm.assertRaises(TypeError):\n nat_series_dtype_timestamp * 1\n with tm.assertRaises(TypeError):\n datetime_series * 1.0\n with tm.assertRaises(TypeError):\n nat_series_dtype_timestamp * 1.0\n\n # division\n assert_series_equal(timedelta_series / 2,\n Series([NaT, Timedelta('0.5s')]))\n assert_series_equal(timedelta_series / 2.0,\n Series([NaT, Timedelta('0.5s')]))\n assert_series_equal(timedelta_series / nan, nat_series_dtype_timedelta)\n with tm.assertRaises(TypeError):\n nat_series_dtype_timestamp / 1.0\n with tm.assertRaises(TypeError):\n nat_series_dtype_timestamp / 1\n\n def test_ops_datetimelike_align(self):\n # GH 7500\n # datetimelike ops need to align\n dt = Series(date_range('2012-1-1', periods=3, freq='D'))\n dt.iloc[2] = np.nan\n dt2 = dt[::-1]\n\n expected = Series([timedelta(0), timedelta(0), pd.NaT])\n # name is reset\n result = dt2 - dt\n assert_series_equal(result, expected)\n\n expected = Series(expected, name=0)\n result = (dt2.to_frame() - dt.to_frame())[0]\n assert_series_equal(result, expected)\n\n def test_object_comparisons(self):\n s = Series(['a', 'b', np.nan, 'c', 'a'])\n\n result = s == 'a'\n expected = Series([True, False, False, False, True])\n assert_series_equal(result, expected)\n\n result = s < 'a'\n expected = Series([False, False, False, False, False])\n assert_series_equal(result, expected)\n\n result = s != 'a'\n expected = -(s == 'a')\n assert_series_equal(result, expected)\n\n def test_comparison_tuples(self):\n # GH11339\n # comparisons vs tuple\n s = Series([(1, 1), (1, 2)])\n\n result = s == (1, 2)\n expected = Series([False, True])\n assert_series_equal(result, expected)\n\n result = s != (1, 2)\n expected = Series([True, False])\n assert_series_equal(result, expected)\n\n result = s == (0, 0)\n expected = Series([False, False])\n assert_series_equal(result, expected)\n\n result = s != (0, 0)\n expected = Series([True, True])\n assert_series_equal(result, expected)\n\n s = Series([(1, 1), (1, 1)])\n\n result = s == (1, 1)\n expected = Series([True, True])\n assert_series_equal(result, expected)\n\n result = s != (1, 1)\n expected = Series([False, False])\n assert_series_equal(result, expected)\n\n s = Series([frozenset([1]), frozenset([1, 2])])\n\n result = s == frozenset([1])\n expected = Series([True, False])\n assert_series_equal(result, expected)\n\n def test_comparison_operators_with_nas(self):\n s = Series(bdate_range('1/1/2000', periods=10), dtype=object)\n s[::2] = np.nan\n\n # test that comparisons work\n ops = ['lt', 'le', 'gt', 'ge', 'eq', 'ne']\n for op in ops:\n val = s[5]\n\n f = getattr(operator, op)\n result = f(s, val)\n\n expected = f(s.dropna(), val).reindex(s.index)\n\n if op == 'ne':\n expected = expected.fillna(True).astype(bool)\n else:\n expected = expected.fillna(False).astype(bool)\n\n assert_series_equal(result, expected)\n\n # fffffffuuuuuuuuuuuu\n # result = f(val, s)\n # expected = f(val, s.dropna()).reindex(s.index)\n # assert_series_equal(result, expected)\n\n # boolean &, |, ^ should work with object arrays and propagate NAs\n\n ops = ['and_', 'or_', 'xor']\n mask = s.isnull()\n for bool_op in ops:\n f = getattr(operator, bool_op)\n\n filled = s.fillna(s[0])\n\n result = f(s < s[9], s > s[3])\n\n expected = f(filled < filled[9], filled > filled[3])\n expected[mask] = False\n assert_series_equal(result, expected)\n\n def test_comparison_object_numeric_nas(self):\n s = Series(np.random.randn(10), dtype=object)\n shifted = s.shift(2)\n\n ops = ['lt', 'le', 'gt', 'ge', 'eq', 'ne']\n for op in ops:\n f = getattr(operator, op)\n\n result = f(s, shifted)\n expected = f(s.astype(float), shifted.astype(float))\n assert_series_equal(result, expected)\n\n def test_comparison_invalid(self):\n\n # GH4968\n # invalid date/int comparisons\n s = Series(range(5))\n s2 = Series(date_range('20010101', periods=5))\n\n for (x, y) in [(s, s2), (s2, s)]:\n self.assertRaises(TypeError, lambda: x == y)\n self.assertRaises(TypeError, lambda: x != y)\n self.assertRaises(TypeError, lambda: x >= y)\n self.assertRaises(TypeError, lambda: x > y)\n self.assertRaises(TypeError, lambda: x < y)\n self.assertRaises(TypeError, lambda: x <= y)\n\n def test_more_na_comparisons(self):\n for dtype in [None, object]:\n left = Series(['a', np.nan, 'c'], dtype=dtype)\n right = Series(['a', np.nan, 'd'], dtype=dtype)\n\n result = left == right\n expected = Series([True, False, False])\n assert_series_equal(result, expected)\n\n result = left != right\n expected = Series([False, True, True])\n assert_series_equal(result, expected)\n\n result = left == np.nan\n expected = Series([False, False, False])\n assert_series_equal(result, expected)\n\n result = left != np.nan\n expected = Series([True, True, True])\n assert_series_equal(result, expected)\n\n def test_nat_comparisons(self):\n data = [([pd.Timestamp('2011-01-01'), pd.NaT,\n pd.Timestamp('2011-01-03')],\n [pd.NaT, pd.NaT, pd.Timestamp('2011-01-03')]),\n\n ([pd.Timedelta('1 days'), pd.NaT,\n pd.Timedelta('3 days')],\n [pd.NaT, pd.NaT, pd.Timedelta('3 days')]),\n\n ([pd.Period('2011-01', freq='M'), pd.NaT,\n pd.Period('2011-03', freq='M')],\n [pd.NaT, pd.NaT, pd.Period('2011-03', freq='M')])]\n\n # add lhs / rhs switched data\n data = data + [(r, l) for l, r in data]\n\n for l, r in data:\n for dtype in [None, object]:\n left = Series(l, dtype=dtype)\n\n # Series, Index\n for right in [Series(r, dtype=dtype), Index(r, dtype=dtype)]:\n expected = Series([False, False, True])\n assert_series_equal(left == right, expected)\n\n expected = Series([True, True, False])\n assert_series_equal(left != right, expected)\n\n expected = Series([False, False, False])\n assert_series_equal(left < right, expected)\n\n expected = Series([False, False, False])\n assert_series_equal(left > right, expected)\n\n expected = Series([False, False, True])\n assert_series_equal(left >= right, expected)\n\n expected = Series([False, False, True])\n assert_series_equal(left <= right, expected)\n\n def test_nat_comparisons_scalar(self):\n data = [[pd.Timestamp('2011-01-01'), pd.NaT,\n pd.Timestamp('2011-01-03')],\n\n [pd.Timedelta('1 days'), pd.NaT, pd.Timedelta('3 days')],\n\n [pd.Period('2011-01', freq='M'), pd.NaT,\n pd.Period('2011-03', freq='M')]]\n\n for l in data:\n for dtype in [None, object]:\n left = Series(l, dtype=dtype)\n\n expected = Series([False, False, False])\n assert_series_equal(left == pd.NaT, expected)\n assert_series_equal(pd.NaT == left, expected)\n\n expected = Series([True, True, True])\n assert_series_equal(left != pd.NaT, expected)\n assert_series_equal(pd.NaT != left, expected)\n\n expected = Series([False, False, False])\n assert_series_equal(left < pd.NaT, expected)\n assert_series_equal(pd.NaT > left, expected)\n assert_series_equal(left <= pd.NaT, expected)\n assert_series_equal(pd.NaT >= left, expected)\n\n assert_series_equal(left > pd.NaT, expected)\n assert_series_equal(pd.NaT < left, expected)\n assert_series_equal(left >= pd.NaT, expected)\n assert_series_equal(pd.NaT <= left, expected)\n\n def test_comparison_different_length(self):\n a = Series(['a', 'b', 'c'])\n b = Series(['b', 'a'])\n self.assertRaises(ValueError, a.__lt__, b)\n\n a = Series([1, 2])\n b = Series([2, 3, 4])\n self.assertRaises(ValueError, a.__eq__, b)\n\n def test_comparison_label_based(self):\n\n # GH 4947\n # comparisons should be label based\n\n a = Series([True, False, True], list('bca'))\n b = Series([False, True, False], list('abc'))\n\n expected = Series([False, True, False], list('abc'))\n result = a & b\n assert_series_equal(result, expected)\n\n expected = Series([True, True, False], list('abc'))\n result = a | b\n assert_series_equal(result, expected)\n\n expected = Series([True, False, False], list('abc'))\n result = a ^ b\n assert_series_equal(result, expected)\n\n # rhs is bigger\n a = Series([True, False, True], list('bca'))\n b = Series([False, True, False, True], list('abcd'))\n\n expected = Series([False, True, False, False], list('abcd'))\n result = a & b\n assert_series_equal(result, expected)\n\n expected = Series([True, True, False, False], list('abcd'))\n result = a | b\n assert_series_equal(result, expected)\n\n # filling\n\n # vs empty\n result = a & Series([])\n expected = Series([False, False, False], list('bca'))\n assert_series_equal(result, expected)\n\n result = a | Series([])\n expected = Series([True, False, True], list('bca'))\n assert_series_equal(result, expected)\n\n # vs non-matching\n result = a & Series([1], ['z'])\n expected = Series([False, False, False, False], list('abcz'))\n assert_series_equal(result, expected)\n\n result = a | Series([1], ['z'])\n expected = Series([True, True, False, False], list('abcz'))\n assert_series_equal(result, expected)\n\n # identity\n # we would like s[s|e] == s to hold for any e, whether empty or not\n for e in [Series([]), Series([1], ['z']),\n Series(np.nan, b.index), Series(np.nan, a.index)]:\n result = a[a | e]\n assert_series_equal(result, a[a])\n\n for e in [Series(['z'])]:\n if compat.PY3:\n with tm.assert_produces_warning(RuntimeWarning):\n result = a[a | e]\n else:\n result = a[a | e]\n assert_series_equal(result, a[a])\n\n # vs scalars\n index = list('bca')\n t = Series([True, False, True])\n\n for v in [True, 1, 2]:\n result = Series([True, False, True], index=index) | v\n expected = Series([True, True, True], index=index)\n assert_series_equal(result, expected)\n\n for v in [np.nan, 'foo']:\n self.assertRaises(TypeError, lambda: t | v)\n\n for v in [False, 0]:\n result = Series([True, False, True], index=index) | v\n expected = Series([True, False, True], index=index)\n assert_series_equal(result, expected)\n\n for v in [True, 1]:\n result = Series([True, False, True], index=index) & v\n expected = Series([True, False, True], index=index)\n assert_series_equal(result, expected)\n\n for v in [False, 0]:\n result = Series([True, False, True], index=index) & v\n expected = Series([False, False, False], index=index)\n assert_series_equal(result, expected)\n for v in [np.nan]:\n self.assertRaises(TypeError, lambda: t & v)\n\n def test_comparison_flex_basic(self):\n left = pd.Series(np.random.randn(10))\n right = pd.Series(np.random.randn(10))\n\n tm.assert_series_equal(left.eq(right), left == right)\n tm.assert_series_equal(left.ne(right), left != right)\n tm.assert_series_equal(left.le(right), left < right)\n tm.assert_series_equal(left.lt(right), left <= right)\n tm.assert_series_equal(left.gt(right), left > right)\n tm.assert_series_equal(left.ge(right), left >= right)\n\n # axis\n for axis in [0, None, 'index']:\n tm.assert_series_equal(left.eq(right, axis=axis), left == right)\n tm.assert_series_equal(left.ne(right, axis=axis), left != right)\n tm.assert_series_equal(left.le(right, axis=axis), left < right)\n tm.assert_series_equal(left.lt(right, axis=axis), left <= right)\n tm.assert_series_equal(left.gt(right, axis=axis), left > right)\n tm.assert_series_equal(left.ge(right, axis=axis), left >= right)\n\n #\n msg = 'No axis named 1 for object type'\n for op in ['eq', 'ne', 'le', 'le', 'gt', 'ge']:\n with tm.assertRaisesRegexp(ValueError, msg):\n getattr(left, op)(right, axis=1)\n\n def test_comparison_flex_alignment(self):\n left = Series([1, 3, 2], index=list('abc'))\n right = Series([2, 2, 2], index=list('bcd'))\n\n exp = pd.Series([False, False, True, False], index=list('abcd'))\n tm.assert_series_equal(left.eq(right), exp)\n\n exp = pd.Series([True, True, False, True], index=list('abcd'))\n tm.assert_series_equal(left.ne(right), exp)\n\n exp = pd.Series([False, False, True, False], index=list('abcd'))\n tm.assert_series_equal(left.le(right), exp)\n\n exp = pd.Series([False, False, False, False], index=list('abcd'))\n tm.assert_series_equal(left.lt(right), exp)\n\n exp = pd.Series([False, True, True, False], index=list('abcd'))\n tm.assert_series_equal(left.ge(right), exp)\n\n exp = pd.Series([False, True, False, False], index=list('abcd'))\n tm.assert_series_equal(left.gt(right), exp)\n\n def test_comparison_flex_alignment_fill(self):\n left = Series([1, 3, 2], index=list('abc'))\n right = Series([2, 2, 2], index=list('bcd'))\n\n exp = pd.Series([False, False, True, True], index=list('abcd'))\n tm.assert_series_equal(left.eq(right, fill_value=2), exp)\n\n exp = pd.Series([True, True, False, False], index=list('abcd'))\n tm.assert_series_equal(left.ne(right, fill_value=2), exp)\n\n exp = pd.Series([False, False, True, True], index=list('abcd'))\n tm.assert_series_equal(left.le(right, fill_value=0), exp)\n\n exp = pd.Series([False, False, False, True], index=list('abcd'))\n tm.assert_series_equal(left.lt(right, fill_value=0), exp)\n\n exp = pd.Series([True, True, True, False], index=list('abcd'))\n tm.assert_series_equal(left.ge(right, fill_value=0), exp)\n\n exp = pd.Series([True, True, False, False], index=list('abcd'))\n tm.assert_series_equal(left.gt(right, fill_value=0), exp)\n\n def test_operators_bitwise(self):\n # GH 9016: support bitwise op for integer types\n index = list('bca')\n\n s_tft = Series([True, False, True], index=index)\n s_fff = Series([False, False, False], index=index)\n s_tff = Series([True, False, False], index=index)\n s_empty = Series([])\n\n # TODO: unused\n # s_0101 = Series([0, 1, 0, 1])\n\n s_0123 = Series(range(4), dtype='int64')\n s_3333 = Series([3] * 4)\n s_4444 = Series([4] * 4)\n\n res = s_tft & s_empty\n expected = s_fff\n assert_series_equal(res, expected)\n\n res = s_tft | s_empty\n expected = s_tft\n assert_series_equal(res, expected)\n\n res = s_0123 & s_3333\n expected = Series(range(4), dtype='int64')\n assert_series_equal(res, expected)\n\n res = s_0123 | s_4444\n expected = Series(range(4, 8), dtype='int64')\n assert_series_equal(res, expected)\n\n s_a0b1c0 = Series([1], list('b'))\n\n res = s_tft & s_a0b1c0\n expected = s_tff.reindex(list('abc'))\n assert_series_equal(res, expected)\n\n res = s_tft | s_a0b1c0\n expected = s_tft.reindex(list('abc'))\n assert_series_equal(res, expected)\n\n n0 = 0\n res = s_tft & n0\n expected = s_fff\n assert_series_equal(res, expected)\n\n res = s_0123 & n0\n expected = Series([0] * 4)\n assert_series_equal(res, expected)\n\n n1 = 1\n res = s_tft & n1\n expected = s_tft\n assert_series_equal(res, expected)\n\n res = s_0123 & n1\n expected = Series([0, 1, 0, 1])\n assert_series_equal(res, expected)\n\n s_1111 = Series([1] * 4, dtype='int8')\n res = s_0123 & s_1111\n expected = Series([0, 1, 0, 1], dtype='int64')\n assert_series_equal(res, expected)\n\n res = s_0123.astype(np.int16) | s_1111.astype(np.int32)\n expected = Series([1, 1, 3, 3], dtype='int32')\n assert_series_equal(res, expected)\n\n self.assertRaises(TypeError, lambda: s_1111 & 'a')\n self.assertRaises(TypeError, lambda: s_1111 & ['a', 'b', 'c', 'd'])\n self.assertRaises(TypeError, lambda: s_0123 & np.NaN)\n self.assertRaises(TypeError, lambda: s_0123 & 3.14)\n self.assertRaises(TypeError, lambda: s_0123 & [0.1, 4, 3.14, 2])\n\n # s_0123 will be all false now because of reindexing like s_tft\n if compat.PY3:\n # unable to sort incompatible object via .union.\n exp = Series([False] * 7, index=['b', 'c', 'a', 0, 1, 2, 3])\n with tm.assert_produces_warning(RuntimeWarning):\n assert_series_equal(s_tft & s_0123, exp)\n else:\n exp = Series([False] * 7, index=[0, 1, 2, 3, 'a', 'b', 'c'])\n assert_series_equal(s_tft & s_0123, exp)\n\n # s_tft will be all false now because of reindexing like s_0123\n if compat.PY3:\n # unable to sort incompatible object via .union.\n exp = Series([False] * 7, index=[0, 1, 2, 3, 'b', 'c', 'a'])\n with tm.assert_produces_warning(RuntimeWarning):\n assert_series_equal(s_0123 & s_tft, exp)\n else:\n exp = Series([False] * 7, index=[0, 1, 2, 3, 'a', 'b', 'c'])\n assert_series_equal(s_0123 & s_tft, exp)\n\n assert_series_equal(s_0123 & False, Series([False] * 4))\n assert_series_equal(s_0123 ^ False, Series([False, True, True, True]))\n assert_series_equal(s_0123 & [False], Series([False] * 4))\n assert_series_equal(s_0123 & (False), Series([False] * 4))\n assert_series_equal(s_0123 & Series([False, np.NaN, False, False]),\n Series([False] * 4))\n\n s_ftft = Series([False, True, False, True])\n assert_series_equal(s_0123 & Series([0.1, 4, -3.14, 2]), s_ftft)\n\n s_abNd = Series(['a', 'b', np.NaN, 'd'])\n res = s_0123 & s_abNd\n expected = s_ftft\n assert_series_equal(res, expected)\n\n def test_scalar_na_cmp_corners(self):\n s = Series([2, 3, 4, 5, 6, 7, 8, 9, 10])\n\n def tester(a, b):\n return a & b\n\n self.assertRaises(TypeError, tester, s, datetime(2005, 1, 1))\n\n s = Series([2, 3, 4, 5, 6, 7, 8, 9, datetime(2005, 1, 1)])\n s[::2] = np.nan\n\n expected = Series(True, index=s.index)\n expected[::2] = False\n assert_series_equal(tester(s, list(s)), expected)\n\n d = DataFrame({'A': s})\n # TODO: Fix this exception - needs to be fixed! (see GH5035)\n # (previously this was a TypeError because series returned\n # NotImplemented\n\n # this is an alignment issue; these are equivalent\n # https://github.com/pydata/pandas/issues/5284\n\n self.assertRaises(ValueError, lambda: d.__and__(s, axis='columns'))\n self.assertRaises(ValueError, tester, s, d)\n\n # this is wrong as its not a boolean result\n # result = d.__and__(s,axis='index')\n\n def test_operators_corner(self):\n series = self.ts\n\n empty = Series([], index=Index([]))\n\n result = series + empty\n self.assertTrue(np.isnan(result).all())\n\n result = empty + Series([], index=Index([]))\n self.assertEqual(len(result), 0)\n\n # TODO: this returned NotImplemented earlier, what to do?\n # deltas = Series([timedelta(1)] * 5, index=np.arange(5))\n # sub_deltas = deltas[::2]\n # deltas5 = deltas * 5\n # deltas = deltas + sub_deltas\n\n # float + int\n int_ts = self.ts.astype(int)[:-5]\n added = self.ts + int_ts\n expected = Series(self.ts.values[:-5] + int_ts.values,\n index=self.ts.index[:-5], name='ts')\n self.assert_series_equal(added[:-5], expected)\n\n def test_operators_reverse_object(self):\n # GH 56\n arr = Series(np.random.randn(10), index=np.arange(10), dtype=object)\n\n def _check_op(arr, op):\n result = op(1., arr)\n expected = op(1., arr.astype(float))\n assert_series_equal(result.astype(float), expected)\n\n _check_op(arr, operator.add)\n _check_op(arr, operator.sub)\n _check_op(arr, operator.mul)\n _check_op(arr, operator.truediv)\n _check_op(arr, operator.floordiv)\n\n def test_arith_ops_df_compat(self):\n # GH 1134\n s1 = pd.Series([1, 2, 3], index=list('ABC'), name='x')\n s2 = pd.Series([2, 2, 2], index=list('ABD'), name='x')\n\n exp = pd.Series([3.0, 4.0, np.nan, np.nan],\n index=list('ABCD'), name='x')\n tm.assert_series_equal(s1 + s2, exp)\n tm.assert_series_equal(s2 + s1, exp)\n\n exp = pd.DataFrame({'x': [3.0, 4.0, np.nan, np.nan]},\n index=list('ABCD'))\n tm.assert_frame_equal(s1.to_frame() + s2.to_frame(), exp)\n tm.assert_frame_equal(s2.to_frame() + s1.to_frame(), exp)\n\n # different length\n s3 = pd.Series([1, 2, 3], index=list('ABC'), name='x')\n s4 = pd.Series([2, 2, 2, 2], index=list('ABCD'), name='x')\n\n exp = pd.Series([3, 4, 5, np.nan],\n index=list('ABCD'), name='x')\n tm.assert_series_equal(s3 + s4, exp)\n tm.assert_series_equal(s4 + s3, exp)\n\n exp = pd.DataFrame({'x': [3, 4, 5, np.nan]},\n index=list('ABCD'))\n tm.assert_frame_equal(s3.to_frame() + s4.to_frame(), exp)\n tm.assert_frame_equal(s4.to_frame() + s3.to_frame(), exp)\n\n def test_comp_ops_df_compat(self):\n # GH 1134\n s1 = pd.Series([1, 2, 3], index=list('ABC'), name='x')\n s2 = pd.Series([2, 2, 2], index=list('ABD'), name='x')\n\n s3 = pd.Series([1, 2, 3], index=list('ABC'), name='x')\n s4 = pd.Series([2, 2, 2, 2], index=list('ABCD'), name='x')\n\n for l, r in [(s1, s2), (s2, s1), (s3, s4), (s4, s3)]:\n\n msg = \"Can only compare identically-labeled Series objects\"\n with tm.assertRaisesRegexp(ValueError, msg):\n l == r\n\n with tm.assertRaisesRegexp(ValueError, msg):\n l != r\n\n with tm.assertRaisesRegexp(ValueError, msg):\n l < r\n\n msg = \"Can only compare identically-labeled DataFrame objects\"\n with tm.assertRaisesRegexp(ValueError, msg):\n l.to_frame() == r.to_frame()\n\n with tm.assertRaisesRegexp(ValueError, msg):\n l.to_frame() != r.to_frame()\n\n with tm.assertRaisesRegexp(ValueError, msg):\n l.to_frame() < r.to_frame()\n\n def test_bool_ops_df_compat(self):\n # GH 1134\n s1 = pd.Series([True, False, True], index=list('ABC'), name='x')\n s2 = pd.Series([True, True, False], index=list('ABD'), name='x')\n\n exp = pd.Series([True, False, False, False],\n index=list('ABCD'), name='x')\n tm.assert_series_equal(s1 & s2, exp)\n tm.assert_series_equal(s2 & s1, exp)\n\n # True | np.nan => True\n exp = pd.Series([True, True, True, False],\n index=list('ABCD'), name='x')\n tm.assert_series_equal(s1 | s2, exp)\n # np.nan | True => np.nan, filled with False\n exp = pd.Series([True, True, False, False],\n index=list('ABCD'), name='x')\n tm.assert_series_equal(s2 | s1, exp)\n\n # DataFrame doesn't fill nan with False\n exp = pd.DataFrame({'x': [True, False, np.nan, np.nan]},\n index=list('ABCD'))\n tm.assert_frame_equal(s1.to_frame() & s2.to_frame(), exp)\n tm.assert_frame_equal(s2.to_frame() & s1.to_frame(), exp)\n\n exp = pd.DataFrame({'x': [True, True, np.nan, np.nan]},\n index=list('ABCD'))\n tm.assert_frame_equal(s1.to_frame() | s2.to_frame(), exp)\n tm.assert_frame_equal(s2.to_frame() | s1.to_frame(), exp)\n\n # different length\n s3 = pd.Series([True, False, True], index=list('ABC'), name='x')\n s4 = pd.Series([True, True, True, True], index=list('ABCD'), name='x')\n\n exp = pd.Series([True, False, True, False],\n index=list('ABCD'), name='x')\n tm.assert_series_equal(s3 & s4, exp)\n tm.assert_series_equal(s4 & s3, exp)\n\n # np.nan | True => np.nan, filled with False\n exp = pd.Series([True, True, True, False],\n index=list('ABCD'), name='x')\n tm.assert_series_equal(s3 | s4, exp)\n # True | np.nan => True\n exp = pd.Series([True, True, True, True],\n index=list('ABCD'), name='x')\n tm.assert_series_equal(s4 | s3, exp)\n\n exp = pd.DataFrame({'x': [True, False, True, np.nan]},\n index=list('ABCD'))\n tm.assert_frame_equal(s3.to_frame() & s4.to_frame(), exp)\n tm.assert_frame_equal(s4.to_frame() & s3.to_frame(), exp)\n\n exp = pd.DataFrame({'x': [True, True, True, np.nan]},\n index=list('ABCD'))\n tm.assert_frame_equal(s3.to_frame() | s4.to_frame(), exp)\n tm.assert_frame_equal(s4.to_frame() | s3.to_frame(), exp)\n\n def test_series_frame_radd_bug(self):\n # GH 353\n vals = Series(tm.rands_array(5, 10))\n result = 'foo_' + vals\n expected = vals.map(lambda x: 'foo_' + x)\n assert_series_equal(result, expected)\n\n frame = DataFrame({'vals': vals})\n result = 'foo_' + frame\n expected = DataFrame({'vals': vals.map(lambda x: 'foo_' + x)})\n tm.assert_frame_equal(result, expected)\n\n # really raise this time\n with tm.assertRaises(TypeError):\n datetime.now() + self.ts\n\n with tm.assertRaises(TypeError):\n self.ts + datetime.now()\n\n def test_series_radd_more(self):\n data = [[1, 2, 3],\n [1.1, 2.2, 3.3],\n [pd.Timestamp('2011-01-01'), pd.Timestamp('2011-01-02'),\n pd.NaT],\n ['x', 'y', 1]]\n\n for d in data:\n for dtype in [None, object]:\n s = Series(d, dtype=dtype)\n with tm.assertRaises(TypeError):\n 'foo_' + s\n\n for dtype in [None, object]:\n res = 1 + pd.Series([1, 2, 3], dtype=dtype)\n exp = pd.Series([2, 3, 4], dtype=dtype)\n tm.assert_series_equal(res, exp)\n res = pd.Series([1, 2, 3], dtype=dtype) + 1\n tm.assert_series_equal(res, exp)\n\n res = np.nan + pd.Series([1, 2, 3], dtype=dtype)\n exp = pd.Series([np.nan, np.nan, np.nan], dtype=dtype)\n tm.assert_series_equal(res, exp)\n res = pd.Series([1, 2, 3], dtype=dtype) + np.nan\n tm.assert_series_equal(res, exp)\n\n s = pd.Series([pd.Timedelta('1 days'), pd.Timedelta('2 days'),\n pd.Timedelta('3 days')], dtype=dtype)\n exp = pd.Series([pd.Timedelta('4 days'), pd.Timedelta('5 days'),\n pd.Timedelta('6 days')])\n tm.assert_series_equal(pd.Timedelta('3 days') + s, exp)\n tm.assert_series_equal(s + pd.Timedelta('3 days'), exp)\n\n s = pd.Series(['x', np.nan, 'x'])\n tm.assert_series_equal('a' + s, pd.Series(['ax', np.nan, 'ax']))\n tm.assert_series_equal(s + 'a', pd.Series(['xa', np.nan, 'xa']))\n\n def test_frame_radd_more(self):\n data = [[1, 2, 3],\n [1.1, 2.2, 3.3],\n [pd.Timestamp('2011-01-01'), pd.Timestamp('2011-01-02'),\n pd.NaT],\n ['x', 'y', 1]]\n\n for d in data:\n for dtype in [None, object]:\n s = DataFrame(d, dtype=dtype)\n with tm.assertRaises(TypeError):\n 'foo_' + s\n\n for dtype in [None, object]:\n res = 1 + pd.DataFrame([1, 2, 3], dtype=dtype)\n exp = pd.DataFrame([2, 3, 4], dtype=dtype)\n tm.assert_frame_equal(res, exp)\n res = pd.DataFrame([1, 2, 3], dtype=dtype) + 1\n tm.assert_frame_equal(res, exp)\n\n res = np.nan + pd.DataFrame([1, 2, 3], dtype=dtype)\n exp = pd.DataFrame([np.nan, np.nan, np.nan], dtype=dtype)\n tm.assert_frame_equal(res, exp)\n res = pd.DataFrame([1, 2, 3], dtype=dtype) + np.nan\n tm.assert_frame_equal(res, exp)\n\n df = pd.DataFrame(['x', np.nan, 'x'])\n tm.assert_frame_equal('a' + df, pd.DataFrame(['ax', np.nan, 'ax']))\n tm.assert_frame_equal(df + 'a', pd.DataFrame(['xa', np.nan, 'xa']))\n\n def test_operators_frame(self):\n # rpow does not work with DataFrame\n df = DataFrame({'A': self.ts})\n\n tm.assert_series_equal(self.ts + self.ts, self.ts + df['A'],\n check_names=False)\n tm.assert_series_equal(self.ts ** self.ts, self.ts ** df['A'],\n check_names=False)\n tm.assert_series_equal(self.ts < self.ts, self.ts < df['A'],\n check_names=False)\n tm.assert_series_equal(self.ts / self.ts, self.ts / df['A'],\n check_names=False)\n\n def test_operators_combine(self):\n def _check_fill(meth, op, a, b, fill_value=0):\n exp_index = a.index.union(b.index)\n a = a.reindex(exp_index)\n b = b.reindex(exp_index)\n\n amask = isnull(a)\n bmask = isnull(b)\n\n exp_values = []\n for i in range(len(exp_index)):\n with np.errstate(all='ignore'):\n if amask[i]:\n if bmask[i]:\n exp_values.append(nan)\n continue\n exp_values.append(op(fill_value, b[i]))\n elif bmask[i]:\n if amask[i]:\n exp_values.append(nan)\n continue\n exp_values.append(op(a[i], fill_value))\n else:\n exp_values.append(op(a[i], b[i]))\n\n result = meth(a, b, fill_value=fill_value)\n expected = Series(exp_values, exp_index)\n assert_series_equal(result, expected)\n\n a = Series([nan, 1., 2., 3., nan], index=np.arange(5))\n b = Series([nan, 1, nan, 3, nan, 4.], index=np.arange(6))\n\n pairings = []\n for op in ['add', 'sub', 'mul', 'pow', 'truediv', 'floordiv']:\n fv = 0\n lop = getattr(Series, op)\n lequiv = getattr(operator, op)\n rop = getattr(Series, 'r' + op)\n # bind op at definition time...\n requiv = lambda x, y, op=op: getattr(operator, op)(y, x)\n pairings.append((lop, lequiv, fv))\n pairings.append((rop, requiv, fv))\n\n if compat.PY3:\n pairings.append((Series.div, operator.truediv, 1))\n pairings.append((Series.rdiv, lambda x, y: operator.truediv(y, x),\n 1))\n else:\n pairings.append((Series.div, operator.div, 1))\n pairings.append((Series.rdiv, lambda x, y: operator.div(y, x), 1))\n\n for op, equiv_op, fv in pairings:\n result = op(a, b)\n exp = equiv_op(a, b)\n assert_series_equal(result, exp)\n _check_fill(op, equiv_op, a, b, fill_value=fv)\n # should accept axis=0 or axis='rows'\n op(a, b, axis=0)\n\n def test_ne(self):\n ts = Series([3, 4, 5, 6, 7], [3, 4, 5, 6, 7], dtype=float)\n expected = [True, True, False, True, True]\n self.assertTrue(tm.equalContents(ts.index != 5, expected))\n self.assertTrue(tm.equalContents(~(ts.index == 5), expected))\n\n def test_operators_na_handling(self):\n from decimal import Decimal\n from datetime import date\n s = Series([Decimal('1.3'), Decimal('2.3')],\n index=[date(2012, 1, 1), date(2012, 1, 2)])\n\n result = s + s.shift(1)\n result2 = s.shift(1) + s\n self.assertTrue(isnull(result[0]))\n self.assertTrue(isnull(result2[0]))\n\n s = Series(['foo', 'bar', 'baz', np.nan])\n result = 'prefix_' + s\n expected = Series(['prefix_foo', 'prefix_bar', 'prefix_baz', np.nan])\n assert_series_equal(result, expected)\n\n result = s + '_suffix'\n expected = Series(['foo_suffix', 'bar_suffix', 'baz_suffix', np.nan])\n assert_series_equal(result, expected)\n\n def test_divide_decimal(self):\n \"\"\" resolves issue #9787 \"\"\"\n from decimal import Decimal\n\n expected = Series([Decimal(5)])\n\n s = Series([Decimal(10)])\n s = s / Decimal(2)\n\n tm.assert_series_equal(expected, s)\n\n s = Series([Decimal(10)])\n s = s // Decimal(2)\n\n tm.assert_series_equal(expected, s)\n\n def test_datetime64_with_index(self):\n\n # arithmetic integer ops with an index\n s = Series(np.random.randn(5))\n expected = s - s.index.to_series()\n result = s - s.index\n assert_series_equal(result, expected)\n\n # GH 4629\n # arithmetic datetime64 ops with an index\n s = Series(date_range('20130101', periods=5),\n index=date_range('20130101', periods=5))\n expected = s - s.index.to_series()\n result = s - s.index\n assert_series_equal(result, expected)\n\n result = s - s.index.to_period()\n assert_series_equal(result, expected)\n\n df = DataFrame(np.random.randn(5, 2),\n index=date_range('20130101', periods=5))\n df['date'] = Timestamp('20130102')\n df['expected'] = df['date'] - df.index.to_series()\n df['result'] = df['date'] - df.index\n assert_series_equal(df['result'], df['expected'], check_names=False)\n\n def test_dti_tz_convert_to_utc(self):\n base = pd.DatetimeIndex(['2011-01-01', '2011-01-02', '2011-01-03'],\n tz='UTC')\n idx1 = base.tz_convert('Asia/Tokyo')[:2]\n idx2 = base.tz_convert('US/Eastern')[1:]\n\n res = Series([1, 2], index=idx1) + Series([1, 1], index=idx2)\n assert_series_equal(res, Series([np.nan, 3, np.nan], index=base))\n" ]
[ [ "pandas.tseries.offsets.Hour", "pandas.types.common.is_datetimetz", "pandas.tseries.frequencies.to_offset", "pandas.types.missing.isnull", "pandas.formats.format._get_format_datetime64", "pandas.types.common.is_bool_dtype", "pandas.types.common.pandas_dtype", "pandas.tslib.tz_convert", "pandas.types.common.is_integer", "pandas.tseries.tools.to_datetime", "pandas.util.decorators.Appender", "pandas.types.common.is_scalar", "numpy.delete", "numpy.floor", "numpy.array", "pandas.TimedeltaIndex", "pandas.lib.Timestamp", "pandas.types.common.is_string_dtype", "pandas.core.index.Index.slice_indexer", "pandas._period.resolution", "numpy.asarray", "pandas.core.index.Index.union", "pandas.types.common.is_integer_dtype", "pandas.tseries.frequencies.get_period_alias", "pandas.types.dtypes.DatetimeTZDtype.construct_from_string", "pandas.tslib.pydt_to_i8", "numpy.int64", "pandas.tseries.tools.normalize_date", "pandas.types.common.is_object_dtype", "numpy.array_equal", "pandas.tseries.frequencies.Resolution.get_reso", "pandas.tseries.tools.to_time", "pandas.core.index.Index.intersection", "pandas.tslib.format_array_from_datetime", "pandas.tseries.offsets.Minute", "numpy.ndarray.__setstate__", "numpy.empty", "pandas.core.index.Index", "pandas.tseries.offsets.Day", "pandas.util.decorators.deprecate_kwarg", "pandas.tseries.base.DatetimeIndexOpsMixin._join_i8_wrapper", "pandas.tslib.dates_normalized", "pandas.tseries.offsets.Second", "pandas.types.concat._concat_compat", "pandas.core.index.Index.get_value", "pandas.tslib.maybe_get_tz", "pandas.tslib.get_start_end_field", "pandas.core.common._maybe_match_name", "pandas.types.common.is_dtype_equal", "pandas.tslib.tz_localize_to_utc", "pandas.tseries.offsets.generate_range", "pandas.core.index.Index.join", "pandas.tseries.offsets.CDay", "pandas.tslib.get_time_micros", "pandas.tslib.cast_to_nanoseconds", "pandas.types.common.is_datetime64_dtype", "pandas.types.common.is_float", "pandas.types.common.is_period_dtype", "pandas.types.dtypes.DatetimeTZDtype", "numpy.fix", "pandas.core.common._maybe_box", "pandas.tslib.ints_to_pydatetime", "numpy.arange", "pandas.types.common._ensure_int64", "pandas.tseries.period.PeriodIndex", "pandas.types.common.is_list_like", "pandas.tslib.date_normalize", "pandas.types.common.is_datetime64_ns_dtype", "pandas.tslib.get_timezone", "pandas.core.common._count_not_none", "pandas.formats.format._is_dates_only", "pandas.tseries.tools.parse_time_string", "pandas.core.index.Index.get_loc", "pandas.tslib.get_date_field", "pandas.tslib.get_date_name_field", "pandas.util.decorators.Substitution", "pandas.tseries.tools._infer_tzinfo", "pandas.formats.format._get_format_datetime64_from_values", "pandas.core.common._values_from_object", "pandas.tslib.monthrange" ], [ "pandas.util.testing.assertIsInstance", "pandas.Series", "pandas.util.testing.assert_produces_warning", "pandas.DataFrame", "pandas.util.testing.assert_frame_equal", "numpy.random.randn", "pandas.offsets.Hour", "numpy.arange", "pandas.util.testing.assert_series_equal", "pandas.DatetimeIndex", "pandas.Index", "pandas.util.testing.equalContents", "pandas.util.testing.rands_array", "pandas.tseries.index.Timestamp", "pandas.bdate_range", "numpy.isnan", "pandas.util.testing.assert_almost_equal", "pandas.offsets.Milli", "pandas.core.nanops.nangt", "numpy.timedelta64", "pandas.Timedelta", "pandas.date_range", "numpy.errstate", "pandas.offsets.Second", "pandas.tseries.tdi.Timedelta", "numpy.array", "pandas.timedelta_range", "numpy.abs", "pandas.isnull", "numpy.array_equal", "pandas.util.testing.makeFloatSeries", "pandas.util.testing.assertRaisesRegexp", "pandas.util.testing.assertRaises", "pandas.offsets.Minute", "numpy.float64", "pandas.Period", "pandas.compat.zip", "pandas.to_timedelta", "pandas.Timestamp", "pandas.compat.range" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
aryankhatana01/Currency-Denomination-Prediction
[ "1cc80817af7a126a9f752c634db121408bcb56ab" ]
[ "VideoCap.py" ]
[ "# import the necessary packages\nfrom keras.preprocessing.image import img_to_array\nfrom keras.models import load_model\nimport tensorflow as tf\nimport numpy as np\nimport imutils\nimport time\nimport cv2\nimport os\nimport pyttsx3\n\nframeWidth= 640 # CAMERA RESOLUTION\nframeHeight = 480\nbrightness = 180\nthreshold = 0.90 # PROBABLITY THRESHOLD\nfont = cv2.FONT_HERSHEY_SIMPLEX\n\n# FOR SPEAKING OUT LOUD\nengine = pyttsx3.init('sapi5')\nvoices= engine.getProperty('voices') #getting details of current voice\nengine.setProperty('voice', voices[0].id)\n\ncap = cv2.VideoCapture(0)\ncap.set(3, frameWidth)\ncap.set(4, frameHeight)\ncap.set(10, brightness)\n\n\nmodel = tf.keras.models.load_model('keras_model11.h5')\n\ndef grayscale(img):\n img = cv2.cvtColor(img,cv2.COLOR_BGR2RGB)\n return img\n\ndef preprocessing(img):\n img = grayscale(img)\n img = (img.astype(np.float32) / 127.0) - 1 #NORMALIZATION\n return img\n\ndef speak(message):\n engine.say(message)\n engine.runAndWait()\n\nclasses = [\"10\", \"20\", \"50\", \"100\", \"200\", \"500\", \"2000\"]\n\nwhile True:\n\n # READ IMAGE\n _, imgOrignal = cap.read()\n\n # PROCESS IMAGE\n img = np.asarray(imgOrignal)\n img = cv2.resize(img, (224, 224))\n img = preprocessing(img)\n cv2.imshow(\"Processed Image\", img)\n img = img.reshape(1, 224, 224, 3)\n cv2.putText(imgOrignal, \"CLASS: \" , (20, 35), font, 0.75, (0, 0, 255), 2, cv2.LINE_AA)\n cv2.putText(imgOrignal, \"PROBABILITY: \", (20, 75), font, 0.75, (0, 0, 255), 2, cv2.LINE_AA)\n # PREDICT IMAGE\n predictions = model.predict(img)\n result = np.argmax(predictions)\n classIndex = classes[result]\n probabilityValue = np.amax(predictions)\n if probabilityValue > threshold:\n #print(getCalssName(classIndex))\n cv2.putText(imgOrignal,classIndex, (120, 35), font, 0.75, (0, 0, 255), 2, cv2.LINE_AA)\n cv2.putText(imgOrignal, str(round(probabilityValue*100,2) )+\"%\", (180, 75), font, 0.75, (0, 0, 255), 2, cv2.LINE_AA)\n speak(classIndex + 'rupees')\n cv2.imshow(\"Result\", imgOrignal)\n\n if cv2.waitKey(1) and 0xFF == ord('q'):\n break\n" ]
[ [ "numpy.asarray", "tensorflow.keras.models.load_model", "numpy.amax", "numpy.argmax" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [ "1.10", "2.7", "2.2", "2.3", "2.4", "2.5", "2.6" ] } ]
kangyifei/CloudSimPy
[ "45912e7ea35086b67941624102e400cb22e549ab", "45912e7ea35086b67941624102e400cb22e549ab", "45912e7ea35086b67941624102e400cb22e549ab" ]
[ "playground/Non_DAG_with_Energy_rllib/algorithm/DeepJS/DRL.py", "core/prediction_model/train_model.py", "playground/Non_DAG_with_Energy_rllib/algorithm/DQN_train_on_epoch/DQN_algorithm.py" ]
[ "import tensorflow as tf\nimport numpy as np\n\ntf.enable_eager_execution()\n\nclass Node(object):\n def __init__(self, observation, action, reward, clock):\n self.observation = observation\n self.action = action\n self.reward = reward\n self.clock = clock\n\n\nclass RLAlgorithm(object):\n def __init__(self, agent, reward_giver, features_normalize_func, features_extract_func):\n self.agent = agent\n self.reward_giver = reward_giver\n self.features_normalize_func = features_normalize_func\n self.features_extract_func = features_extract_func\n self.current_trajectory = []\n\n def extract_features(self, valid_pairs):\n features = []\n for machine, task in valid_pairs:\n features.append([machine.cpu, machine.memory] + self.features_extract_func(task))\n features = self.features_normalize_func(features)\n return features\n\n def __call__(self, cluster, clock):\n machines = cluster.machines\n tasks = cluster.tasks_which_has_waiting_instance\n all_candidates = []\n\n for machine in machines:\n for task in tasks:\n if machine.accommodate(task):\n all_candidates.append((machine, task))\n if len(all_candidates) == 0:\n self.current_trajectory.append(Node(None, None, self.reward_giver.get_reward(), clock))\n return None, None\n else:\n features = self.extract_features(all_candidates)\n features = tf.convert_to_tensor(features, dtype=np.float32)\n logits = self.agent.brain(features)\n pair_index = tf.squeeze(tf.multinomial(logits, num_samples=1), axis=1).numpy()[0]\n\n node = Node(features, pair_index, 0, clock)\n self.current_trajectory.append(node)\n\n return all_candidates[pair_index]", "import numpy as np\nfrom keras.models import Sequential,Model\nfrom keras.layers import Dense, Flatten, Reshape, Input\nfrom keras.layers import LSTM\nfrom keras.initializers import RandomNormal\nfrom keras.callbacks import ModelCheckpoint, EarlyStopping\nimport json\nimport csv\nimport os\nos.environ[\"CUDA_VISIBLE_DEVICES\"]=\"1\"\nfile_path = \"D:\\\\邢老师数据集\\\\singlerack_all.csv\"\nserver_list = []\nconditioner_outlet_temp = []\nconditioner_inlet_temp = []\n\n\nclass Server(object):\n def __init__(self, i):\n self.id = i\n self.inlet_temp = []\n self.outlet_temp = []\n self.cpu = []\n self.memory = []\n\n\ndef strided_app(a, L, S): # Window len = L, Stride len/stepsize = S\n nrows = ((a.size - L) // S) + 1\n n = a.strides[0]\n return np.lib.stride_tricks.as_strided(a, shape=(nrows, L), strides=(S * n, n), writeable=False)\n\n\ndef process_data():\n for i in range(15):\n server_list.append(Server(i))\n with open(file_path, \"r\", encoding='utf-8') as datacsv:\n csvr = csv.reader(datacsv)\n for row in csvr:\n i = 1\n for server in server_list:\n server.outlet_temp.append(float(row[i]))\n i = i + 1\n for server in server_list:\n server.inlet_temp.append(float(row[46 - i]))\n i = i + 1\n conditioner_outlet_temp.append(float(row[i]))\n i = i + 1\n conditioner_inlet_temp.append(float(row[i]))\n i = i + 6\n for server in server_list:\n # if(server.id<10):\n # server.cpu.append(float(row[i])/10)\n # else:\n # server.cpu.append(float(row[i]))\n server.cpu.append(float(row[i]) /100)\n i = i + 6\n\n\ndef format_dataset():\n predict_server_inlet_model_x = []\n predict_server_inlet_model_y = []\n predict_conditioner_inlet_model_x = []\n predict_conditioner_inlet_model_y = conditioner_inlet_temp\n for i in range(len(conditioner_outlet_temp)):\n x_row = []\n y_row = []\n x_row.append(conditioner_outlet_temp[i])\n for server in server_list:\n x_row.append(server.cpu[i])\n y_row.append(server.inlet_temp[i])\n predict_server_inlet_model_x.append(x_row)\n predict_server_inlet_model_y.append(y_row)\n predict_conditioner_inlet_model_x.append(y_row)\n return np.array(predict_server_inlet_model_x), np.array(predict_server_inlet_model_y), np.array(\n predict_conditioner_inlet_model_x), np.array(predict_conditioner_inlet_model_y)\n\n\ndef train_server_model(predict_server_inlet_model_x, predict_server_inlet_model_y):\n server_model = Sequential()\n # server_model.add(LSTM(10, activation=\"relu\", input_shape=(train_x.shape[1], train_x.shape[2]), return_sequences=True,\n # kernel_initializer=RandomNormal()))\n # server_model.add(Flatten())\n server_model.add(Dense(16, activation=\"relu\"))\n server_model.add(Dense(100, activation=\"relu\"))\n # server_model.add(Dense(500, activation=\"relu\"))\n # server_model.add(Dense(100, activation=\"relu\"))\n server_model.add(Dense(15))\n server_model.compile(loss='mean_absolute_error', optimizer='Adadelta')\n checkpoint1 = ModelCheckpoint(\n \"./model/predict_server_inlet_1ConditionerOutletTemp+15ServerCpuUsage_15out_{val_loss:.2f}.hdf5\",\n monitor='val_loss', verbose=1, save_best_only=True,\n mode='min')\n callbacks_list1 = [checkpoint1]\n history1 = server_model.fit(predict_server_inlet_model_x, predict_server_inlet_model_y, epochs=10000,\n batch_size=256,\n validation_split=0.2, verbose=2, callbacks=callbacks_list1)\n\n\ndef train_cpu_usage_model():\n timestep = 60\n predict_horizon=60\n train_x = []\n train_y = []\n for server in server_list:\n cpu = np.array(server.cpu)\n data = strided_app(cpu, timestep + +predict_horizon+1, 1)\n x = data[:, :-1-predict_horizon]\n y = data[:, -1]\n if isinstance(train_x,list):\n train_x = x\n train_y = y\n else:\n train_x = np.concatenate((train_x, x), axis=0)\n train_y = np.concatenate((train_y, y), axis=0)\n input=Input(shape=(timestep,))\n re=Reshape(target_shape=(timestep, 1))(input)\n lstm=LSTM(120, return_sequences=True)(re)\n lstm1 = LSTM(120)(lstm)\n flatten=lstm1\n dense=Dense(10,activation='relu')(flatten)\n output=Dense(1)(dense)\n model=Model(inputs=[input],outputs=[output])\n model.summary()\n model.compile(loss='mean_absolute_error', optimizer='Adam')\n checkpoint = ModelCheckpoint(\"./model/predict_cpu_usage_ts60_ph60_{val_loss:.2f}.hdf5\",\n monitor='val_loss',\n verbose=1,\n save_best_only=True,\n mode='min')\n early_stopping = EarlyStopping(monitor='val_loss', mode='min', min_delta=0.002, patience=3, verbose=1)\n callbacks_list = [checkpoint, early_stopping]\n history = model.fit(train_x, train_y, epochs=10000,\n batch_size=128,\n validation_split=0.02, verbose=1, callbacks=callbacks_list)\n\n\ndef train_conditioner_model(predict_conditioner_inlet_model_x, predict_conditioner_inlet_model_y):\n conditioner_model = Sequential()\n conditioner_model.add(Dense(15, activation=\"relu\"))\n conditioner_model.add(Dense(100, activation=\"relu\"))\n conditioner_model.add(Dense(1))\n conditioner_model.compile(loss='mse', optimizer='Adadelta')\n checkpoint2 = ModelCheckpoint(\"./model/predict_condition_inlet_15ServerInletTempin_1out_{val_loss:.2f}.hdf5\",\n monitor='val_loss',\n verbose=1,\n save_best_only=True,\n mode='min')\n early_stopping = EarlyStopping(monitor='val_loss', mode='min', min_delta=0.002, patience=10, verbose=1)\n callbacks_list2 = [checkpoint2]\n history2 = conditioner_model.fit(predict_conditioner_inlet_model_x, predict_conditioner_inlet_model_y, epochs=10000,\n batch_size=256,\n validation_split=0.2, verbose=2, callbacks=callbacks_list2)\n\n\nif __name__ == \"__main__\":\n process_data()\n # predict_server_inlet_model_x,\\\n # predict_server_inlet_model_y, \\\n # predict_conditioner_inlet_model_x,\\\n # predict_conditioner_inlet_model_y = format_dataset()\n #\n # train_server_model(predict_server_inlet_model_x, predict_server_inlet_model_y)\n\n # train_conditioner_model(predict_conditioner_inlet_model_x,predict_conditioner_inlet_model_y)\n # res_y=server_model.predict(predict_server_inlet_model_x)\n # while(True):\n # pass\n\n train_cpu_usage_model()\n", "from core.algorithm import Algorithm\nfrom core.config import MachineConfig\nfrom core.machine import Machine\nfrom core.cluster import Cluster\nfrom typing import List\nfrom .RL_brain import DeepQNetwork\nimport numpy as np\n\n\nclass DQNAlgorithm(Algorithm):\n def __init__(self, machine_configs: List[MachineConfig]):\n self.machine_configs = machine_configs\n self.dqn = DeepQNetwork(n_actions=len(machine_configs),\n n_features=len(machine_configs) * 2 + 2,\n learning_rate=0.01, e_greedy=0.9,\n replace_target_iter=100, memory_size=20000,\n e_greedy_increment=0.001, )\n self.steps = 0\n self.last_observation = []\n for machine_config in self.machine_configs:\n self.last_observation.append(machine_config.cpu)\n self.last_observation.append(machine_config.memory)\n self.last_observation.append(0)\n self.last_observation.append(0)\n self.last_action = 0\n self.last_reward = 0\n\n self.last_clock = 0\n self.last_power = 0\n self.total_energy_consume = 0\n self.total_called_num = 0\n self.total_reward_of_ep = 0\n\n def __call__(self, cluster, clock, cooling_equip=None):\n self.total_called_num += 1\n machines = cluster.machines\n tasks = cluster.tasks_which_has_waiting_instance\n if not len(tasks) == 0:\n observation = []\n for machine in machines:\n observation.append(machine.cpu)\n observation.append(machine.memory)\n observation.append(tasks[0].task_config.cpu)\n observation.append(tasks[0].task_config.memory)\n observation = np.array(observation)\n action = self.dqn.choose_action(observation)\n if not machines[action].accommodate(tasks[0]):\n reward = -100\n self.total_reward_of_ep += reward\n self.dqn.store_transition(self.last_observation, self.last_action, self.last_reward, observation)\n self.last_observation = observation\n self.last_action = action\n self.last_reward = reward\n self.steps += 1\n return None, None, None\n else:\n reward = self.reward_giver(cluster, clock)\n self.total_reward_of_ep += reward\n self.dqn.store_transition(self.last_observation, self.last_action, self.last_reward, observation)\n self.last_observation = observation\n self.last_action = action\n self.last_reward = reward\n self.steps += 1\n return machines[action], tasks[0], None\n return None, None, None\n\n def cal_machine_power(self, machine: Machine):\n cpu_usage = machine.state[\"cpu_usage_percent\"]\n memory_usage = machine.state['memory_usage_percent']\n return 100 * cpu_usage ** 1.9 + 5 * memory_usage\n\n def reward_giver(self, cluster: Cluster, clock):\n # newpower = 0\n # for machine in cluster.machines:\n # newpower += self.cal_machine_power(machine)\n # energy_consume = self.last_power * (clock - self.last_clock)\n # self.last_clock = clock\n # self.last_power = newpower\n # self.total_energy_consume += energy_consume\n energy_consume = cluster.monitor.total_energy_consume\n self.total_energy_consume += energy_consume\n if energy_consume == 0:\n return 0\n else:\n return -energy_consume\n\n def reset(self):\n self.last_observation = []\n for machine_config in self.machine_configs:\n self.last_observation.append(machine_config.cpu)\n self.last_observation.append(machine_config.memory)\n self.last_observation.append(0)\n self.last_observation.append(0)\n self.last_clock = 0\n self.last_power = 0\n self.total_energy_consume = 0\n self.total_called_num = 0\n self.total_reward_of_ep = 0\n" ]
[ [ "tensorflow.convert_to_tensor", "tensorflow.enable_eager_execution", "tensorflow.multinomial" ], [ "numpy.lib.stride_tricks.as_strided", "numpy.array", "numpy.concatenate" ], [ "numpy.array" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [ "1.13", "1.7", "1.10", "1.12" ] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
xiaonanzzz/easy-deep-learning-pytorch
[ "a3b6566ce0e73f2cbea1007e8883d2ffa2282829" ]
[ "easydl/datasets/cub.py" ]
[ "import torchvision\nimport os\nimport pandas as pd\nfrom easydl.datasets import ImageLoader\nimport numpy as np\nfrom torchvision.transforms import ToTensor, Resize, Normalize\n\n\n_default_image_transformer = torchvision.transforms.Compose([\n Resize((224, 224)),\n ToTensor(),\n Normalize(0.45, 0.22), # simple version from https://pytorch.org/vision/stable/models.html\n])\n\nclass CUBirdsHelper(object):\n def __init__(self, root, *args, **kwargs):\n super(CUBirdsHelper, self).__init__(*args, **kwargs)\n self.root = root\n self.image_folder = os.path.join(self.root, 'CUB_200_2011', 'images')\n image_list = os.path.join(self.root, 'CUB_200_2011', 'images.txt')\n meta_df = pd.read_csv(image_list, sep=' ', names=['image_id', 'image_path'], header=None)\n\n image_class_labels = pd.read_csv(os.path.join(self.root, 'CUB_200_2011', 'image_class_labels.txt'),\n sep=' ', names=['image_id', 'label'])\n meta_df = meta_df.merge(image_class_labels, on='image_id')\n train_test_split = pd.read_csv(os.path.join(self.root, 'CUB_200_2011', 'train_test_split.txt'),\n sep=' ', names=['image_id', 'is_training_img'])\n meta_df = meta_df.merge(train_test_split, on='image_id')\n self.meta_df = meta_df\n\n\nclass Cub2011MetricLearningDS(CUBirdsHelper, ImageLoader):\n\n def __init__(self, root, *args, split='train', image_transform=_default_image_transformer, **kwargs):\n super(Cub2011MetricLearningDS, self).__init__(root, *args, image_transform=image_transform, **kwargs)\n self.split = split\n\n if self.split == 'train':\n self.data = self.meta_df[self.meta_df['label'].isin(np.arange(1, 100 + 1))]\n elif self.split == 'test':\n self.data = self.meta_df[self.meta_df['label'].isin(np.arange(100+1, 200 + 1))]\n else:\n raise ValueError('wrong split mode, only accept train/test')\n self.data.reset_index()\n print('cub 2011 metric learning dataset data size', self.data.shape)\n\n def __len__(self):\n return len(self.data)\n\n def __getitem__(self, idx):\n sample = self.data.iloc[idx]\n path = os.path.join(self.image_folder, sample['image_path'])\n target = sample['label'] - 1\n\n return self.load_image(path), target\n\nif __name__ == '__main__':\n ds = Cub2011MetricLearningDS('/Users/xiaonzha/data/CUB_200_2011', split='test')\n print(ds[0])" ]
[ [ "numpy.arange", "pandas.read_csv" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [ "2.0", "1.4", "1.1", "1.5", "1.2", "1.3" ], "scipy": [], "tensorflow": [] } ]
PhilJd/addons
[ "758d8838090c24914ee74b88bd24ee02f7e68850", "b59f0e89ca09837808331be1eee8ae8df8eb9355", "758d8838090c24914ee74b88bd24ee02f7e68850", "af6866a2e6d9ddbc79d612d7cb04a8a5befe4a47" ]
[ "tensorflow_addons/activations/sparsemax_test.py", "tensorflow_addons/image/translate_ops.py", "tensorflow_addons/optimizers/yogi_test.py", "tensorflow_addons/layers/polynomial_test.py" ]
[ "# Copyright 2016 The TensorFlow Authors. All Rights Reserved.\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n# ==============================================================================\n\nimport pytest\nimport numpy as np\nimport tensorflow as tf\n\nfrom tensorflow_addons.activations import sparsemax\nfrom tensorflow_addons.utils import test_utils\n\ntest_obs = 17\n\n\ndef _np_sparsemax(z):\n z = z - np.mean(z, axis=1)[:, np.newaxis]\n\n # sort z\n z_sorted = np.sort(z, axis=1)[:, ::-1]\n\n # calculate k(z)\n z_cumsum = np.cumsum(z_sorted, axis=1)\n k = np.arange(1, z.shape[1] + 1)\n z_check = 1 + k * z_sorted > z_cumsum\n # use argmax to get the index by row as .nonzero() doesn't\n # take an axis argument. np.argmax return the first index, but the last\n # index is required here, use np.flip to get the last index and\n # `z.shape[axis]` to compensate for np.flip afterwards.\n k_z = z.shape[1] - np.argmax(z_check[:, ::-1], axis=1)\n\n # calculate tau(z)\n tau_sum = z_cumsum[np.arange(0, z.shape[0]), k_z - 1]\n tau_z = ((tau_sum - 1) / k_z).reshape(-1, 1)\n\n # calculate p\n return np.maximum(0, z - tau_z)\n\n\[email protected](\"dtype\", [\"float32\", \"float64\"])\ndef test_sparsemax_against_numpy_axis(dtype):\n \"\"\"check sparsemax kernel against numpy.\"\"\"\n random = np.random.RandomState(1)\n\n z = random.uniform(low=-3, high=3, size=(test_obs, 10))\n\n tf_sparsemax_out = sparsemax(z.astype(dtype), axis=0).numpy()\n np_sparsemax = np.transpose(_np_sparsemax(np.transpose(z))).astype(dtype)\n\n test_utils.assert_allclose_according_to_type(\n np_sparsemax, tf_sparsemax_out, half_atol=5e-3\n )\n assert np_sparsemax.shape == tf_sparsemax_out.shape\n\n\[email protected](\"dtype\", [\"float32\", \"float64\"])\ndef test_sparsemax_against_numpy_low_rank(dtype):\n \"\"\"check sparsemax kernel against numpy.\"\"\"\n random = np.random.RandomState(1)\n\n z = random.uniform(low=-3, high=3, size=(10))\n\n tf_sparsemax_out = sparsemax(z.astype(dtype)).numpy()\n np_sparsemax = np.reshape(_np_sparsemax(np.reshape(z, [1, 10])), [10]).astype(dtype)\n\n test_utils.assert_allclose_according_to_type(\n np_sparsemax, tf_sparsemax_out, half_atol=5e-3\n )\n assert np_sparsemax.shape == tf_sparsemax_out.shape\n\n\n@test_utils.run_all_with_types([\"float32\", \"float64\"])\n@test_utils.run_all_in_graph_and_eager_modes\nclass SparsemaxTest(tf.test.TestCase):\n def _tf_sparsemax(self, z, dtype, **kwargs):\n tf_sparsemax_op = sparsemax(z.astype(dtype), **kwargs)\n tf_sparsemax_out = self.evaluate(tf_sparsemax_op)\n\n return tf_sparsemax_op, tf_sparsemax_out\n\n def test_sparsemax_against_numpy(self, dtype=None):\n \"\"\"check sparsemax kernel against numpy.\"\"\"\n random = np.random.RandomState(1)\n\n z = random.uniform(low=-3, high=3, size=(test_obs, 10))\n\n tf_sparsemax_op, tf_sparsemax_out = self._tf_sparsemax(z, dtype)\n np_sparsemax = _np_sparsemax(z).astype(dtype)\n\n self.assertAllCloseAccordingToType(np_sparsemax, tf_sparsemax_out)\n self.assertShapeEqual(np_sparsemax, tf_sparsemax_op)\n\n def test_sparsemax_against_numpy_high_rank(self, dtype=None):\n \"\"\"check sparsemax kernel against numpy.\"\"\"\n random = np.random.RandomState(1)\n\n z = random.uniform(low=-3, high=3, size=(test_obs, test_obs, 10))\n\n tf_sparsemax_op, tf_sparsemax_out = self._tf_sparsemax(z, dtype)\n np_sparsemax = np.reshape(\n _np_sparsemax(np.reshape(z, [test_obs * test_obs, 10])),\n [test_obs, test_obs, 10],\n ).astype(dtype)\n\n self.assertAllCloseAccordingToType(np_sparsemax, tf_sparsemax_out)\n self.assertShapeEqual(np_sparsemax, tf_sparsemax_op)\n\n def test_sparsemax_of_nan(self, dtype=None):\n \"\"\"check sparsemax transfers nan.\"\"\"\n z_nan = np.asarray(\n [[0, np.nan, 0], [0, np.nan, np.nan], [np.nan, np.nan, np.nan],]\n ).astype(dtype)\n\n _, tf_sparsemax_nan = self._tf_sparsemax(z_nan, dtype)\n self.assertAllEqual(\n [\n [np.nan, np.nan, np.nan],\n [np.nan, np.nan, np.nan],\n [np.nan, np.nan, np.nan],\n ],\n tf_sparsemax_nan,\n )\n\n def test_sparsemax_of_inf(self, dtype=None):\n \"\"\"check sparsemax is infinity safe.\"\"\"\n z_neg = np.asarray(\n [[0, -np.inf, 0], [0, -np.inf, -np.inf], [-np.inf, -np.inf, -np.inf],]\n ).astype(dtype)\n z_pos = np.asarray(\n [[0, np.inf, 0], [0, np.inf, np.inf], [np.inf, np.inf, np.inf]]\n ).astype(dtype)\n z_mix = np.asarray(\n [[0, np.inf, 0], [0, np.inf, -np.inf], [-np.inf, np.inf, -np.inf]]\n ).astype(dtype)\n\n _, tf_sparsemax_neg = self._tf_sparsemax(z_neg, dtype)\n self.assertAllEqual(\n [[0.5, 0, 0.5], [1, 0, 0], [np.nan, np.nan, np.nan]], tf_sparsemax_neg\n )\n\n _, tf_sparsemax_pos = self._tf_sparsemax(z_pos, dtype)\n self.assertAllEqual(\n [\n [np.nan, np.nan, np.nan],\n [np.nan, np.nan, np.nan],\n [np.nan, np.nan, np.nan],\n ],\n tf_sparsemax_pos,\n )\n\n _, tf_sparsemax_mix = self._tf_sparsemax(z_mix, dtype)\n self.assertAllEqual(\n [\n [np.nan, np.nan, np.nan],\n [np.nan, np.nan, np.nan],\n [np.nan, np.nan, np.nan],\n ],\n tf_sparsemax_mix,\n )\n\n def test_sparsemax_of_zero(self, dtype=None):\n \"\"\"check sparsemax proposition 1, part 1.\"\"\"\n z = np.zeros((1, 10))\n\n tf_sparsemax_op, tf_sparsemax_out = self._tf_sparsemax(z, dtype)\n np_sparsemax = np.ones_like(z, dtype=dtype) / z.size\n\n self.assertAllCloseAccordingToType(np_sparsemax, tf_sparsemax_out)\n self.assertShapeEqual(np_sparsemax, tf_sparsemax_op)\n\n def test_sparsemax_of_to_inf(self, dtype=None):\n \"\"\"check sparsemax proposition 1, part 2.\"\"\"\n random = np.random.RandomState(4)\n\n z = random.uniform(low=-3, high=3, size=(test_obs, 10))\n\n # assume |A(z)| = 1, as z is continues random\n z_sort_arg = np.argsort(z, axis=1)[:, ::-1]\n z_sort = np.sort(z, axis=-1)[:, ::-1]\n gamma_z = z_sort[:, 0] - z_sort[:, 1]\n epsilon = (0.99 * gamma_z * 1).reshape(-1, 1)\n\n # construct the expected 1_A(z) array\n p_expected = np.zeros((test_obs, 10), dtype=dtype)\n p_expected[np.arange(0, test_obs), z_sort_arg[:, 0]] = 1\n\n tf_sparsemax_op, tf_sparsemax_out = self._tf_sparsemax((1 / epsilon) * z, dtype)\n\n self.assertAllCloseAccordingToType(p_expected, tf_sparsemax_out)\n self.assertShapeEqual(p_expected, tf_sparsemax_op)\n\n def test_constant_add(self, dtype=None):\n \"\"\"check sparsemax proposition 2.\"\"\"\n random = np.random.RandomState(5)\n\n z = random.uniform(low=-3, high=3, size=(test_obs, 10)).astype(dtype)\n c = random.uniform(low=-3, high=3, size=(test_obs, 1)).astype(dtype)\n\n _, tf_sparsemax_zpc = self._tf_sparsemax(z + c, dtype)\n\n _, tf_sparsemax_z = self._tf_sparsemax(z, dtype)\n\n self.assertAllCloseAccordingToType(\n tf_sparsemax_zpc, tf_sparsemax_z, half_atol=5e-3\n )\n\n\[email protected](\"dtype\", [\"float32\", \"float64\"])\ndef test_two_dimentional(dtype):\n \"\"\"check two dimentation sparsemax case.\"\"\"\n t = np.linspace(-2, 2, test_obs, dtype=dtype)\n z = np.vstack([t, np.zeros(test_obs, dtype=dtype)]).T\n\n tf_sparsemax_out = sparsemax(z.astype(dtype)).numpy()\n\n p0_expected = np.select([t < -1, t <= 1, t > 1], [0, (t + 1) / 2, 1])\n\n test_utils.assert_allclose_according_to_type(p0_expected, tf_sparsemax_out[:, 0])\n test_utils.assert_allclose_according_to_type(\n 1 - p0_expected, tf_sparsemax_out[:, 1]\n )\n assert z.shape == tf_sparsemax_out.shape\n\n\[email protected](\"dtype\", [np.float32, np.float64])\ndef test_diffrence(dtype):\n \"\"\"check sparsemax proposition 4.\"\"\"\n random = np.random.RandomState(7)\n\n z = random.uniform(low=-3, high=3, size=(test_obs, 10))\n p = sparsemax(z.astype(dtype)).numpy()\n\n etol = {np.float32: 1e-6, np.float64: 1e-9}[dtype]\n\n for val in range(0, test_obs):\n for i in range(0, 10):\n for j in range(0, 10):\n # check condition, the obesite pair will be checked anyway\n if z[val, i] > z[val, j]:\n continue\n\n assert 0 <= p[val, j] - p[val, i] <= z[val, j] - z[val, i] + etol\n\n\[email protected](\"dtype\", [\"float32\", \"float64\"])\ndef test_permutation(dtype):\n \"\"\"check sparsemax proposition 3.\"\"\"\n random = np.random.RandomState(6)\n\n z = random.uniform(low=-3, high=3, size=(test_obs, 10))\n p = sparsemax(z.astype(dtype)).numpy()\n\n for i in range(test_obs):\n per = random.permutation(10)\n\n tf_sparsemax_out = sparsemax(z[i, per].reshape(1, -1).astype(dtype))\n p_expected = p[i, per].reshape(1, -1)\n\n test_utils.assert_allclose_according_to_type(\n p_expected, tf_sparsemax_out, half_atol=5e-3\n )\n assert p_expected.shape == tf_sparsemax_out.shape\n\n\[email protected](\"dtype\", [\"float32\", \"float64\"])\ndef test_gradient_against_estimate(dtype):\n \"\"\"check sparsemax Rop, against estimated Rop.\"\"\"\n random = np.random.RandomState(9)\n\n # sparsemax is not a smooth function so gradient estimation is only\n # possible for float64.\n if dtype != \"float64\":\n return\n\n z = random.uniform(low=-1, high=1, size=(test_obs, 10)).astype(dtype)\n\n (jacob_sym,), (jacob_num,) = tf.test.compute_gradient(\n lambda logits: sparsemax(logits), [z], delta=1e-6\n )\n np.testing.assert_allclose(jacob_sym, jacob_num)\n", "# Copyright 2019 The TensorFlow Authors. All Rights Reserved.\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n# ==============================================================================\n\"\"\"Image translate ops.\"\"\"\n\nimport tensorflow as tf\nfrom tensorflow_addons.image.transform_ops import transform\nfrom tensorflow_addons.image.utils import wrap, unwrap\nfrom tensorflow_addons.utils.types import TensorLike\n\nfrom typing import Optional\n\n\ndef translations_to_projective_transforms(\n translations: TensorLike, name: Optional[str] = None\n) -> tf.Tensor:\n \"\"\"Returns projective transform(s) for the given translation(s).\n\n Args:\n translations: A 2-element list representing [dx, dy] or a matrix of\n 2-element lists representing [dx, dy] to translate for each image\n (for a batch of images). The rank must be statically known\n (the shape is not `TensorShape(None)`).\n name: The name of the op.\n Returns:\n A tensor of shape (num_images, 8) projective transforms which can be\n given to `tfa.image.transform`.\n \"\"\"\n with tf.name_scope(name or \"translations_to_projective_transforms\"):\n translation_or_translations = tf.convert_to_tensor(\n translations, name=\"translations\", dtype=tf.dtypes.float32\n )\n if translation_or_translations.get_shape().ndims is None:\n raise TypeError(\"translation_or_translations rank must be statically known\")\n elif len(translation_or_translations.get_shape()) == 1:\n translations = translation_or_translations[None]\n elif len(translation_or_translations.get_shape()) == 2:\n translations = translation_or_translations\n else:\n raise TypeError(\"Translations should have rank 1 or 2.\")\n num_translations = tf.shape(translations)[0]\n # The translation matrix looks like:\n # [[1 0 -dx]\n # [0 1 -dy]\n # [0 0 1]]\n # where the last entry is implicit.\n # Translation matrices are always float32.\n return tf.concat(\n values=[\n tf.ones((num_translations, 1), tf.dtypes.float32),\n tf.zeros((num_translations, 1), tf.dtypes.float32),\n -translations[:, 0, None],\n tf.zeros((num_translations, 1), tf.dtypes.float32),\n tf.ones((num_translations, 1), tf.dtypes.float32),\n -translations[:, 1, None],\n tf.zeros((num_translations, 2), tf.dtypes.float32),\n ],\n axis=1,\n )\n\n\[email protected]\ndef translate(\n images: TensorLike,\n translations: TensorLike,\n interpolation: str = \"NEAREST\",\n name: Optional[str] = None,\n) -> tf.Tensor:\n \"\"\"Translate image(s) by the passed vectors(s).\n\n Args:\n images: A tensor of shape\n (num_images, num_rows, num_columns, num_channels) (NHWC),\n (num_rows, num_columns, num_channels) (HWC), or\n (num_rows, num_columns) (HW). The rank must be statically known (the\n shape is not `TensorShape(None)`).\n translations: A vector representing [dx, dy] or (if images has rank 4)\n a matrix of length num_images, with a [dx, dy] vector for each image\n in the batch.\n interpolation: Interpolation mode. Supported values: \"NEAREST\",\n \"BILINEAR\".\n name: The name of the op.\n Returns:\n Image(s) with the same type and shape as `images`, translated by the\n given vector(s). Empty space due to the translation will be filled with\n zeros.\n Raises:\n TypeError: If `images` is an invalid type.\n \"\"\"\n with tf.name_scope(name or \"translate\"):\n return transform(\n images,\n translations_to_projective_transforms(translations),\n interpolation=interpolation,\n )\n\n\ndef translate_xy(\n image: TensorLike, translate_to: TensorLike, replace: int\n) -> TensorLike:\n \"\"\"Translates image in X or Y dimension.\n Args:\n image: A 3D image Tensor.\n translate_to: A 1D tensor to translate [x, y]\n replace: A one or three value 1D tensor to fill empty pixels.\n Returns:\n Translated image along X or Y axis, with space outside image\n filled with replace.\n Raises:\n ValueError: if axis is neither 0 nor 1.\"\"\"\n image = wrap(image)\n trans = tf.convert_to_tensor(translate_to)\n image = translate(image, [trans.numpy()[0], 0])\n image = translate(image, [0, trans.numpy()[1]])\n return unwrap(image, replace)\n", "# Copyright 2019 The TensorFlow Authors. All Rights Reserved.\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n# ==============================================================================\n\"\"\"Tests for Yogi optimizer.\"\"\"\n\n\nimport numpy as np\nimport tensorflow as tf\n\nfrom tensorflow_addons.optimizers import yogi\nfrom tensorflow_addons.utils import test_utils\n\n\ndef yogi_update_numpy(\n param,\n g_t,\n t,\n m,\n v,\n alpha=0.01,\n beta1=0.9,\n beta2=0.999,\n epsilon=1e-3,\n l1reg=0.0,\n l2reg=0.0,\n):\n \"\"\"Performs Yogi parameter update using numpy.\n\n Args:\n param: An numpy ndarray of the current parameter.\n g_t: An numpy ndarray of the current gradients.\n t: An numpy ndarray of the current time step.\n m: An numpy ndarray of the 1st moment estimates.\n v: An numpy ndarray of the 2nd moment estimates.\n alpha: A float value of the learning rate.\n beta1: A float value of the exponential decay rate for the 1st moment\n estimates.\n beta2: A float value of the exponential decay rate for the 2nd moment\n estimates.\n epsilon: A float of a small constant for numerical stability.\n l1reg: A float value of L1 regularization\n l2reg: A float value of L2 regularization\n Returns:\n A tuple of numpy ndarrays (param_t, m_t, v_t) representing the\n updated parameters for `param`, `m`, and `v` respectively.\n \"\"\"\n beta1 = np.array(beta1, dtype=param.dtype)\n beta2 = np.array(beta2, dtype=param.dtype)\n\n alpha_t = alpha * np.sqrt(1 - beta2 ** t) / (1 - beta1 ** t)\n\n m_t = beta1 * m + (1 - beta1) * g_t\n g2_t = g_t * g_t\n v_t = v - (1 - beta2) * np.sign(v - g2_t) * g2_t\n\n per_coord_lr = alpha_t / (np.sqrt(v_t) + epsilon)\n param_t = param - per_coord_lr * m_t\n\n if l1reg > 0:\n param_t = (param_t - l1reg * per_coord_lr * np.sign(param_t)) / (\n 1 + l2reg * per_coord_lr\n )\n print(param_t.dtype)\n param_t[np.abs(param_t) < l1reg * per_coord_lr] = 0.0\n elif l2reg > 0:\n param_t = param_t / (1 + l2reg * per_coord_lr)\n return param_t, m_t, v_t\n\n\ndef get_beta_accumulators(opt, dtype):\n local_step = tf.cast(opt.iterations + 1, dtype)\n beta_1_t = tf.cast(opt._get_hyper(\"beta_1\"), dtype)\n beta_1_power = tf.math.pow(beta_1_t, local_step)\n beta_2_t = tf.cast(opt._get_hyper(\"beta_2\"), dtype)\n beta_2_power = tf.math.pow(beta_2_t, local_step)\n return (beta_1_power, beta_2_power)\n\n\n@test_utils.run_all_in_graph_and_eager_modes\nclass YogiOptimizerTest(tf.test.TestCase):\n def _DtypesToTest(self, use_gpu):\n if use_gpu:\n return [tf.dtypes.float32, tf.dtypes.float64]\n else:\n return [tf.dtypes.half, tf.dtypes.float32, tf.dtypes.float64]\n\n def doTestSparse(self, beta1=0.0, l1reg=0.0, l2reg=0.0):\n for dtype in self._DtypesToTest(use_gpu=tf.test.is_gpu_available()):\n # Initialize variables for numpy implementation.\n m0, v0, m1, v1 = 0.0, 1.0, 0.0, 1.0\n var0_np = np.array([1.0, 2.0], dtype=dtype.as_numpy_dtype)\n grads0_np = np.array([0.1, 0.1], dtype=dtype.as_numpy_dtype)\n var1_np = np.array([3.0, 4.0], dtype=dtype.as_numpy_dtype)\n grads1_np = np.array([0.01, 0.01], dtype=dtype.as_numpy_dtype)\n\n var0 = tf.Variable(var0_np)\n var1 = tf.Variable(var1_np)\n grads0_np_indices = np.array([0, 1], dtype=np.int32)\n grads0 = tf.IndexedSlices(\n tf.constant(grads0_np), tf.constant(grads0_np_indices), tf.constant([2])\n )\n grads1_np_indices = np.array([0, 1], dtype=np.int32)\n grads1 = tf.IndexedSlices(\n tf.constant(grads1_np), tf.constant(grads1_np_indices), tf.constant([2])\n )\n opt = yogi.Yogi(\n beta1=beta1,\n l1_regularization_strength=l1reg,\n l2_regularization_strength=l2reg,\n initial_accumulator_value=1.0,\n )\n if not tf.executing_eagerly():\n update = opt.apply_gradients(zip([grads0, grads1], [var0, var1]))\n self.evaluate(tf.compat.v1.global_variables_initializer())\n\n # Fetch params to validate initial values.\n self.assertAllClose([1.0, 2.0], self.evaluate(var0))\n self.assertAllClose([3.0, 4.0], self.evaluate(var1))\n\n # Run 3 steps of Yogi.\n for t in range(1, 4):\n beta1_power, beta2_power = get_beta_accumulators(opt, dtype)\n self.assertAllCloseAccordingToType(\n beta1 ** t, self.evaluate(beta1_power)\n )\n self.assertAllCloseAccordingToType(\n 0.999 ** t, self.evaluate(beta2_power)\n )\n if not tf.executing_eagerly():\n self.evaluate(update)\n else:\n opt.apply_gradients(zip([grads0, grads1], [var0, var1]))\n\n var0_np, m0, v0 = yogi_update_numpy(\n var0_np, grads0_np, t, m0, v0, beta1=beta1, l1reg=l1reg, l2reg=l2reg\n )\n var1_np, m1, v1 = yogi_update_numpy(\n var1_np, grads1_np, t, m1, v1, beta1=beta1, l1reg=l1reg, l2reg=l2reg\n )\n\n # Validate updated params.\n self.assertAllCloseAccordingToType(\n var0_np,\n self.evaluate(var0),\n msg=\"Updated params 0 do not match in NP and TF\",\n )\n self.assertAllCloseAccordingToType(\n var1_np,\n self.evaluate(var1),\n msg=\"Updated params 1 do not match in NP and TF\",\n )\n\n def testSparse(self):\n self.doTestSparse()\n\n def testSparseRegularization(self):\n self.doTestSparse(l1reg=0.1, l2reg=0.2)\n\n def testSparseMomentum(self):\n self.doTestSparse(beta1=0.9)\n\n def testSparseMomentumRegularization(self):\n self.doTestSparse(beta1=0.9, l1reg=0.1, l2reg=0.2)\n\n def testSparseRepeatedIndices(self):\n for dtype in self._DtypesToTest(use_gpu=tf.test.is_gpu_available()):\n repeated_index_update_var = tf.Variable([[1.0], [2.0]], dtype=dtype)\n aggregated_update_var = tf.Variable([[1.0], [2.0]], dtype=dtype)\n grad_repeated_index = tf.IndexedSlices(\n tf.constant([0.1, 0.1], shape=[2, 1], dtype=dtype),\n tf.constant([1, 1]),\n tf.constant([2, 1]),\n )\n grad_aggregated = tf.IndexedSlices(\n tf.constant([0.2], shape=[1, 1], dtype=dtype),\n tf.constant([1]),\n tf.constant([2, 1]),\n )\n opt1 = yogi.Yogi()\n opt2 = yogi.Yogi()\n\n if not tf.executing_eagerly():\n repeated_update = opt1.apply_gradients(\n [(grad_repeated_index, repeated_index_update_var)]\n )\n aggregated_update = opt2.apply_gradients(\n [(grad_aggregated, aggregated_update_var)]\n )\n self.evaluate(tf.compat.v1.global_variables_initializer())\n\n self.assertAllClose(\n self.evaluate(aggregated_update_var),\n self.evaluate(repeated_index_update_var),\n )\n\n for _ in range(3):\n if not tf.executing_eagerly():\n self.evaluate(repeated_update)\n self.evaluate(aggregated_update)\n else:\n opt1.apply_gradients(\n [(grad_repeated_index, repeated_index_update_var)]\n )\n opt2.apply_gradients([(grad_aggregated, aggregated_update_var)])\n\n self.assertAllClose(\n self.evaluate(aggregated_update_var),\n self.evaluate(repeated_index_update_var),\n )\n\n def doTestBasic(self, beta1=0.0, l1reg=0.0, l2reg=0.0):\n for dtype in self._DtypesToTest(use_gpu=tf.test.is_gpu_available()):\n # Initialize variables for numpy implementation.\n m0, v0, m1, v1 = 0.0, 1.0, 0.0, 1.0\n var0_np = np.array([1.0, 2.0], dtype=dtype.as_numpy_dtype)\n grads0_np = np.array([0.1, 0.1], dtype=dtype.as_numpy_dtype)\n var1_np = np.array([3.0, 4.0], dtype=dtype.as_numpy_dtype)\n grads1_np = np.array([0.01, 0.01], dtype=dtype.as_numpy_dtype)\n\n var0 = tf.Variable(var0_np)\n var1 = tf.Variable(var1_np)\n grads0 = tf.constant(grads0_np)\n grads1 = tf.constant(grads1_np)\n\n opt = yogi.Yogi(\n beta1=beta1,\n l1_regularization_strength=l1reg,\n l2_regularization_strength=l2reg,\n initial_accumulator_value=1.0,\n )\n\n if not tf.executing_eagerly():\n update = opt.apply_gradients(zip([grads0, grads1], [var0, var1]))\n self.evaluate(tf.compat.v1.global_variables_initializer())\n\n # Fetch params to validate initial values.\n self.assertAllClose([1.0, 2.0], self.evaluate(var0))\n self.assertAllClose([3.0, 4.0], self.evaluate(var1))\n\n # Run 3 steps of Yogi.\n for t in range(1, 4):\n beta1_power, beta2_power = get_beta_accumulators(opt, dtype)\n self.assertAllCloseAccordingToType(\n beta1 ** t, self.evaluate(beta1_power)\n )\n self.assertAllCloseAccordingToType(\n 0.999 ** t, self.evaluate(beta2_power)\n )\n\n if not tf.executing_eagerly():\n self.evaluate(update)\n else:\n opt.apply_gradients(zip([grads0, grads1], [var0, var1]))\n\n var0_np, m0, v0 = yogi_update_numpy(\n var0_np, grads0_np, t, m0, v0, beta1=beta1, l1reg=l1reg, l2reg=l2reg\n )\n var1_np, m1, v1 = yogi_update_numpy(\n var1_np, grads1_np, t, m1, v1, beta1=beta1, l1reg=l1reg, l2reg=l2reg\n )\n\n # Validate updated params.\n self.assertAllCloseAccordingToType(var0_np, self.evaluate(var0))\n self.assertAllCloseAccordingToType(var1_np, self.evaluate(var1))\n\n def testBasic(self):\n self.doTestBasic()\n\n def testBasicRegularization(self):\n self.doTestBasic(l1reg=0.1, l2reg=0.2)\n\n def testBasicMomentum(self):\n self.doTestBasic(beta1=0.9)\n\n def testBasicMomentumRegularization(self):\n self.doTestBasic(beta1=0.9, l1reg=0.1, l2reg=0.2)\n\n def testTensorLearningRate(self):\n for dtype in self._DtypesToTest(use_gpu=tf.test.is_gpu_available()):\n # Initialize variables for numpy implementation.\n m0, v0, m1, v1 = 0.0, 1.0, 0.0, 1.0\n var0_np = np.array([1.0, 2.0], dtype=dtype.as_numpy_dtype)\n grads0_np = np.array([0.1, 0.1], dtype=dtype.as_numpy_dtype)\n var1_np = np.array([3.0, 4.0], dtype=dtype.as_numpy_dtype)\n grads1_np = np.array([0.01, 0.01], dtype=dtype.as_numpy_dtype)\n\n var0 = tf.Variable(var0_np)\n var1 = tf.Variable(var1_np)\n grads0 = tf.constant(grads0_np)\n grads1 = tf.constant(grads1_np)\n opt = yogi.Yogi(tf.constant(0.01), initial_accumulator_value=1.0)\n\n if not tf.executing_eagerly():\n update = opt.apply_gradients(zip([grads0, grads1], [var0, var1]))\n self.evaluate(tf.compat.v1.global_variables_initializer())\n\n # Fetch params to validate initial values.\n self.assertAllClose([1.0, 2.0], self.evaluate(var0))\n self.assertAllClose([3.0, 4.0], self.evaluate(var1))\n\n # Run 3 steps of Yogi.\n for t in range(1, 4):\n beta1_power, beta2_power = get_beta_accumulators(opt, dtype)\n self.assertAllCloseAccordingToType(0.9 ** t, self.evaluate(beta1_power))\n self.assertAllCloseAccordingToType(\n 0.999 ** t, self.evaluate(beta2_power)\n )\n\n if not tf.executing_eagerly():\n self.evaluate(update)\n else:\n opt.apply_gradients(zip([grads0, grads1], [var0, var1]))\n\n var0_np, m0, v0 = yogi_update_numpy(var0_np, grads0_np, t, m0, v0)\n var1_np, m1, v1 = yogi_update_numpy(var1_np, grads1_np, t, m1, v1)\n\n # Validate updated params.\n self.assertAllCloseAccordingToType(var0_np, self.evaluate(var0))\n self.assertAllCloseAccordingToType(var1_np, self.evaluate(var1))\n\n def testSharing(self):\n for dtype in self._DtypesToTest(use_gpu=tf.test.is_gpu_available()):\n # Initialize variables for numpy implementation.\n m0, v0, m1, v1 = 0.0, 1.0, 0.0, 1.0\n var0_np = np.array([1.0, 2.0], dtype=dtype.as_numpy_dtype)\n grads0_np = np.array([0.1, 0.1], dtype=dtype.as_numpy_dtype)\n var1_np = np.array([3.0, 4.0], dtype=dtype.as_numpy_dtype)\n grads1_np = np.array([0.01, 0.01], dtype=dtype.as_numpy_dtype)\n\n var0 = tf.Variable(var0_np)\n var1 = tf.Variable(var1_np)\n grads0 = tf.constant(grads0_np)\n grads1 = tf.constant(grads1_np)\n opt = yogi.Yogi(initial_accumulator_value=1.0)\n\n if not tf.executing_eagerly():\n update1 = opt.apply_gradients(zip([grads0, grads1], [var0, var1]))\n update2 = opt.apply_gradients(zip([grads0, grads1], [var0, var1]))\n self.evaluate(tf.compat.v1.global_variables_initializer())\n\n # Fetch params to validate initial values.\n self.assertAllClose([1.0, 2.0], self.evaluate(var0))\n self.assertAllClose([3.0, 4.0], self.evaluate(var1))\n\n # Run 3 steps of intertwined Yogi1 and Yogi2.\n for t in range(1, 4):\n beta1_power, beta2_power = get_beta_accumulators(opt, dtype)\n self.assertAllCloseAccordingToType(0.9 ** t, self.evaluate(beta1_power))\n self.assertAllCloseAccordingToType(\n 0.999 ** t, self.evaluate(beta2_power)\n )\n if not tf.executing_eagerly():\n if t % 2 == 0:\n self.evaluate(update1)\n else:\n self.evaluate(update2)\n else:\n opt.apply_gradients(zip([grads0, grads1], [var0, var1]))\n\n var0_np, m0, v0 = yogi_update_numpy(var0_np, grads0_np, t, m0, v0)\n var1_np, m1, v1 = yogi_update_numpy(var1_np, grads1_np, t, m1, v1)\n\n # Validate updated params.\n self.assertAllCloseAccordingToType(var0_np, self.evaluate(var0))\n self.assertAllCloseAccordingToType(var1_np, self.evaluate(var1))\n\n def test_get_config(self):\n opt = yogi.Yogi(1e-4)\n config = opt.get_config()\n self.assertEqual(config[\"learning_rate\"], 1e-4)\n", "# Copyright 2020 The TensorFlow Authors. All Rights Reserved.\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n# ==============================================================================\n\"\"\"Tests for PolynomialCrossing layer.\"\"\"\n\n\nimport pytest\nimport numpy as np\nimport tensorflow as tf\n\nfrom tensorflow_addons.layers.polynomial import PolynomialCrossing\n\n\[email protected](\"maybe_run_functions_eagerly\")\ndef test_full_matrix():\n x0 = np.asarray([[0.1, 0.2, 0.3]]).astype(np.float32)\n x = np.asarray([[0.4, 0.5, 0.6]]).astype(np.float32)\n layer = PolynomialCrossing(projection_dim=None, kernel_initializer=\"ones\")\n output = layer([x0, x])\n np.testing.assert_allclose([[0.55, 0.8, 1.05]], output)\n\n\[email protected](\"maybe_run_functions_eagerly\")\ndef test_invalid_proj_dim():\n with pytest.raises(ValueError) as exception_info:\n x0 = np.random.random((12, 5))\n x = np.random.random((12, 5))\n layer = PolynomialCrossing(projection_dim=6)\n layer([x0, x])\n assert \"is not supported yet\" in str(exception_info.value)\n\n\[email protected](\"maybe_run_functions_eagerly\")\ndef test_invalid_inputs():\n with pytest.raises(ValueError) as exception_info:\n x0 = np.random.random((12, 5))\n x = np.random.random((12, 5))\n x1 = np.random.random((12, 5))\n layer = PolynomialCrossing(projection_dim=6)\n layer([x0, x, x1])\n assert \"must be a tuple or list of size 2\" in str(exception_info.value)\n\n\ndef test_serialization():\n layer = PolynomialCrossing(projection_dim=None)\n serialized_layer = tf.keras.layers.serialize(layer)\n new_layer = tf.keras.layers.deserialize(serialized_layer)\n assert layer.get_config() == new_layer.get_config()\n" ]
[ [ "numpy.maximum", "numpy.ones_like", "numpy.linspace", "numpy.asarray", "numpy.arange", "numpy.reshape", "numpy.cumsum", "numpy.sort", "numpy.transpose", "numpy.argmax", "numpy.mean", "numpy.select", "numpy.testing.assert_allclose", "numpy.argsort", "numpy.random.RandomState", "numpy.zeros" ], [ "tensorflow.convert_to_tensor", "tensorflow.zeros", "tensorflow.shape", "tensorflow.ones", "tensorflow.name_scope" ], [ "tensorflow.constant", "numpy.sqrt", "tensorflow.Variable", "tensorflow.executing_eagerly", "numpy.abs", "tensorflow.cast", "tensorflow.compat.v1.global_variables_initializer", "numpy.sign", "tensorflow.test.is_gpu_available", "tensorflow.math.pow", "numpy.array" ], [ "tensorflow.keras.layers.deserialize", "numpy.random.random", "numpy.asarray", "tensorflow.keras.layers.serialize", "numpy.testing.assert_allclose" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [ "1.10", "1.12", "1.4", "1.13", "1.5", "1.7", "0.12", "1.0", "1.2" ] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [ "2.7", "2.6", "2.4", "2.3", "2.5", "2.2" ] } ]
gopi231091/mmdetection3d
[ "1b2e64cd75c8d1c238c61a3bc1e3c62a7d403b53", "1b2e64cd75c8d1c238c61a3bc1e3c62a7d403b53", "1b2e64cd75c8d1c238c61a3bc1e3c62a7d403b53", "1b2e64cd75c8d1c238c61a3bc1e3c62a7d403b53" ]
[ "mmdet3d/models/dense_heads/train_mixins.py", "mmdet3d/models/roi_heads/bbox_heads/parta2_bbox_head.py", "mmdet3d/models/dense_heads/shape_aware_head.py", "mmdet3d/core/bbox/structures/base_box3d.py" ]
[ "import numpy as np\nimport torch\n\nfrom mmdet3d.core import limit_period\nfrom mmdet.core import images_to_levels, multi_apply\n\n\nclass AnchorTrainMixin(object):\n \"\"\"Mixin class for target assigning of dense heads.\"\"\"\n\n def anchor_target_3d(self,\n anchor_list,\n gt_bboxes_list,\n input_metas,\n gt_bboxes_ignore_list=None,\n gt_labels_list=None,\n label_channels=1,\n num_classes=1,\n sampling=True):\n \"\"\"Compute regression and classification targets for anchors.\n\n Args:\n anchor_list (list[list]): Multi level anchors of each image.\n gt_bboxes_list (list[:obj:`BaseInstance3DBoxes`]): Ground truth\n bboxes of each image.\n input_metas (list[dict]): Meta info of each image.\n gt_bboxes_ignore_list (None | list): Ignore list of gt bboxes.\n gt_labels_list (list[torch.Tensor]): Gt labels of batches.\n label_channels (int): The channel of labels.\n num_classes (int): The number of classes.\n sampling (bool): Whether to sample anchors.\n\n Returns:\n tuple (list, list, list, list, list, list, int, int):\n Anchor targets, including labels, label weights,\n bbox targets, bbox weights, direction targets,\n direction weights, number of postive anchors and\n number of negative anchors.\n \"\"\"\n num_imgs = len(input_metas)\n assert len(anchor_list) == num_imgs\n\n if isinstance(anchor_list[0][0], list):\n # sizes of anchors are different\n # anchor number of a single level\n num_level_anchors = [\n sum([anchor.size(0) for anchor in anchors])\n for anchors in anchor_list[0]\n ]\n for i in range(num_imgs):\n anchor_list[i] = anchor_list[i][0]\n else:\n # anchor number of multi levels\n num_level_anchors = [\n anchors.view(-1, self.box_code_size).size(0)\n for anchors in anchor_list[0]\n ]\n # concat all level anchors and flags to a single tensor\n for i in range(num_imgs):\n anchor_list[i] = torch.cat(anchor_list[i])\n\n # compute targets for each image\n if gt_bboxes_ignore_list is None:\n gt_bboxes_ignore_list = [None for _ in range(num_imgs)]\n if gt_labels_list is None:\n gt_labels_list = [None for _ in range(num_imgs)]\n\n (all_labels, all_label_weights, all_bbox_targets, all_bbox_weights,\n all_dir_targets, all_dir_weights, pos_inds_list,\n neg_inds_list) = multi_apply(\n self.anchor_target_3d_single,\n anchor_list,\n gt_bboxes_list,\n gt_bboxes_ignore_list,\n gt_labels_list,\n input_metas,\n label_channels=label_channels,\n num_classes=num_classes,\n sampling=sampling)\n\n # no valid anchors\n if any([labels is None for labels in all_labels]):\n return None\n # sampled anchors of all images\n num_total_pos = sum([max(inds.numel(), 1) for inds in pos_inds_list])\n num_total_neg = sum([max(inds.numel(), 1) for inds in neg_inds_list])\n # split targets to a list w.r.t. multiple levels\n labels_list = images_to_levels(all_labels, num_level_anchors)\n label_weights_list = images_to_levels(all_label_weights,\n num_level_anchors)\n bbox_targets_list = images_to_levels(all_bbox_targets,\n num_level_anchors)\n bbox_weights_list = images_to_levels(all_bbox_weights,\n num_level_anchors)\n dir_targets_list = images_to_levels(all_dir_targets, num_level_anchors)\n dir_weights_list = images_to_levels(all_dir_weights, num_level_anchors)\n return (labels_list, label_weights_list, bbox_targets_list,\n bbox_weights_list, dir_targets_list, dir_weights_list,\n num_total_pos, num_total_neg)\n\n def anchor_target_3d_single(self,\n anchors,\n gt_bboxes,\n gt_bboxes_ignore,\n gt_labels,\n input_meta,\n label_channels=1,\n num_classes=1,\n sampling=True):\n \"\"\"Compute targets of anchors in single batch.\n\n Args:\n anchors (torch.Tensor): Concatenated multi-level anchor.\n gt_bboxes (:obj:`BaseInstance3DBoxes`): Gt bboxes.\n gt_bboxes_ignore (torch.Tensor): Ignored gt bboxes.\n gt_labels (torch.Tensor): Gt class labels.\n input_meta (dict): Meta info of each image.\n label_channels (int): The channel of labels.\n num_classes (int): The number of classes.\n sampling (bool): Whether to sample anchors.\n\n Returns:\n tuple[torch.Tensor]: Anchor targets.\n \"\"\"\n if isinstance(self.bbox_assigner,\n list) and (not isinstance(anchors, list)):\n feat_size = anchors.size(0) * anchors.size(1) * anchors.size(2)\n rot_angles = anchors.size(-2)\n assert len(self.bbox_assigner) == anchors.size(-3)\n (total_labels, total_label_weights, total_bbox_targets,\n total_bbox_weights, total_dir_targets, total_dir_weights,\n total_pos_inds, total_neg_inds) = [], [], [], [], [], [], [], []\n current_anchor_num = 0\n for i, assigner in enumerate(self.bbox_assigner):\n current_anchors = anchors[..., i, :, :].reshape(\n -1, self.box_code_size)\n current_anchor_num += current_anchors.size(0)\n if self.assign_per_class:\n gt_per_cls = (gt_labels == i)\n anchor_targets = self.anchor_target_single_assigner(\n assigner, current_anchors, gt_bboxes[gt_per_cls, :],\n gt_bboxes_ignore, gt_labels[gt_per_cls], input_meta,\n num_classes, sampling)\n else:\n anchor_targets = self.anchor_target_single_assigner(\n assigner, current_anchors, gt_bboxes, gt_bboxes_ignore,\n gt_labels, input_meta, num_classes, sampling)\n\n (labels, label_weights, bbox_targets, bbox_weights,\n dir_targets, dir_weights, pos_inds, neg_inds) = anchor_targets\n total_labels.append(labels.reshape(feat_size, 1, rot_angles))\n total_label_weights.append(\n label_weights.reshape(feat_size, 1, rot_angles))\n total_bbox_targets.append(\n bbox_targets.reshape(feat_size, 1, rot_angles,\n anchors.size(-1)))\n total_bbox_weights.append(\n bbox_weights.reshape(feat_size, 1, rot_angles,\n anchors.size(-1)))\n total_dir_targets.append(\n dir_targets.reshape(feat_size, 1, rot_angles))\n total_dir_weights.append(\n dir_weights.reshape(feat_size, 1, rot_angles))\n total_pos_inds.append(pos_inds)\n total_neg_inds.append(neg_inds)\n\n total_labels = torch.cat(total_labels, dim=-2).reshape(-1)\n total_label_weights = torch.cat(\n total_label_weights, dim=-2).reshape(-1)\n total_bbox_targets = torch.cat(\n total_bbox_targets, dim=-3).reshape(-1, anchors.size(-1))\n total_bbox_weights = torch.cat(\n total_bbox_weights, dim=-3).reshape(-1, anchors.size(-1))\n total_dir_targets = torch.cat(\n total_dir_targets, dim=-2).reshape(-1)\n total_dir_weights = torch.cat(\n total_dir_weights, dim=-2).reshape(-1)\n total_pos_inds = torch.cat(total_pos_inds, dim=0).reshape(-1)\n total_neg_inds = torch.cat(total_neg_inds, dim=0).reshape(-1)\n return (total_labels, total_label_weights, total_bbox_targets,\n total_bbox_weights, total_dir_targets, total_dir_weights,\n total_pos_inds, total_neg_inds)\n elif isinstance(self.bbox_assigner, list) and isinstance(\n anchors, list):\n # class-aware anchors with different feature map sizes\n assert len(self.bbox_assigner) == len(anchors), \\\n 'The number of bbox assigners and anchors should be the same.'\n (total_labels, total_label_weights, total_bbox_targets,\n total_bbox_weights, total_dir_targets, total_dir_weights,\n total_pos_inds, total_neg_inds) = [], [], [], [], [], [], [], []\n current_anchor_num = 0\n for i, assigner in enumerate(self.bbox_assigner):\n current_anchors = anchors[i]\n current_anchor_num += current_anchors.size(0)\n if self.assign_per_class:\n gt_per_cls = (gt_labels == i)\n anchor_targets = self.anchor_target_single_assigner(\n assigner, current_anchors, gt_bboxes[gt_per_cls, :],\n gt_bboxes_ignore, gt_labels[gt_per_cls], input_meta,\n num_classes, sampling)\n else:\n anchor_targets = self.anchor_target_single_assigner(\n assigner, current_anchors, gt_bboxes, gt_bboxes_ignore,\n gt_labels, input_meta, num_classes, sampling)\n\n (labels, label_weights, bbox_targets, bbox_weights,\n dir_targets, dir_weights, pos_inds, neg_inds) = anchor_targets\n total_labels.append(labels)\n total_label_weights.append(label_weights)\n total_bbox_targets.append(\n bbox_targets.reshape(-1, anchors[i].size(-1)))\n total_bbox_weights.append(\n bbox_weights.reshape(-1, anchors[i].size(-1)))\n total_dir_targets.append(dir_targets)\n total_dir_weights.append(dir_weights)\n total_pos_inds.append(pos_inds)\n total_neg_inds.append(neg_inds)\n\n total_labels = torch.cat(total_labels, dim=0)\n total_label_weights = torch.cat(total_label_weights, dim=0)\n total_bbox_targets = torch.cat(total_bbox_targets, dim=0)\n total_bbox_weights = torch.cat(total_bbox_weights, dim=0)\n total_dir_targets = torch.cat(total_dir_targets, dim=0)\n total_dir_weights = torch.cat(total_dir_weights, dim=0)\n total_pos_inds = torch.cat(total_pos_inds, dim=0)\n total_neg_inds = torch.cat(total_neg_inds, dim=0)\n return (total_labels, total_label_weights, total_bbox_targets,\n total_bbox_weights, total_dir_targets, total_dir_weights,\n total_pos_inds, total_neg_inds)\n else:\n return self.anchor_target_single_assigner(self.bbox_assigner,\n anchors, gt_bboxes,\n gt_bboxes_ignore,\n gt_labels, input_meta,\n num_classes, sampling)\n\n def anchor_target_single_assigner(self,\n bbox_assigner,\n anchors,\n gt_bboxes,\n gt_bboxes_ignore,\n gt_labels,\n input_meta,\n num_classes=1,\n sampling=True):\n \"\"\"Assign anchors and encode positive anchors.\n\n Args:\n bbox_assigner (BaseAssigner): assign positive and negative boxes.\n anchors (torch.Tensor): Concatenated multi-level anchor.\n gt_bboxes (:obj:`BaseInstance3DBoxes`): Gt bboxes.\n gt_bboxes_ignore (torch.Tensor): Ignored gt bboxes.\n gt_labels (torch.Tensor): Gt class labels.\n input_meta (dict): Meta info of each image.\n num_classes (int): The number of classes.\n sampling (bool): Whether to sample anchors.\n\n Returns:\n tuple[torch.Tensor]: Anchor targets.\n \"\"\"\n anchors = anchors.reshape(-1, anchors.size(-1))\n num_valid_anchors = anchors.shape[0]\n bbox_targets = torch.zeros_like(anchors)\n bbox_weights = torch.zeros_like(anchors)\n dir_targets = anchors.new_zeros((anchors.shape[0]), dtype=torch.long)\n dir_weights = anchors.new_zeros((anchors.shape[0]), dtype=torch.float)\n labels = anchors.new_zeros(num_valid_anchors, dtype=torch.long)\n label_weights = anchors.new_zeros(num_valid_anchors, dtype=torch.float)\n if len(gt_bboxes) > 0:\n if not isinstance(gt_bboxes, torch.Tensor):\n gt_bboxes = gt_bboxes.tensor.to(anchors.device)\n assign_result = bbox_assigner.assign(anchors, gt_bboxes,\n gt_bboxes_ignore, gt_labels)\n sampling_result = self.bbox_sampler.sample(assign_result, anchors,\n gt_bboxes)\n pos_inds = sampling_result.pos_inds\n neg_inds = sampling_result.neg_inds\n else:\n pos_inds = torch.nonzero(\n anchors.new_zeros((anchors.shape[0], ), dtype=torch.bool) > 0,\n as_tuple=False).squeeze(-1).unique()\n neg_inds = torch.nonzero(\n anchors.new_zeros((anchors.shape[0], ), dtype=torch.bool) == 0,\n as_tuple=False).squeeze(-1).unique()\n\n if gt_labels is not None:\n labels += num_classes\n if len(pos_inds) > 0:\n pos_bbox_targets = self.bbox_coder.encode(\n sampling_result.pos_bboxes, sampling_result.pos_gt_bboxes)\n pos_dir_targets = get_direction_target(\n sampling_result.pos_bboxes,\n pos_bbox_targets,\n self.dir_offset,\n one_hot=False)\n bbox_targets[pos_inds, :] = pos_bbox_targets\n bbox_weights[pos_inds, :] = 1.0\n dir_targets[pos_inds] = pos_dir_targets\n dir_weights[pos_inds] = 1.0\n\n if gt_labels is None:\n labels[pos_inds] = 1\n else:\n labels[pos_inds] = gt_labels[\n sampling_result.pos_assigned_gt_inds]\n if self.train_cfg.pos_weight <= 0:\n label_weights[pos_inds] = 1.0\n else:\n label_weights[pos_inds] = self.train_cfg.pos_weight\n\n if len(neg_inds) > 0:\n label_weights[neg_inds] = 1.0\n return (labels, label_weights, bbox_targets, bbox_weights, dir_targets,\n dir_weights, pos_inds, neg_inds)\n\n\ndef get_direction_target(anchors,\n reg_targets,\n dir_offset=0,\n num_bins=2,\n one_hot=True):\n \"\"\"Encode direction to 0 ~ num_bins-1.\n\n Args:\n anchors (torch.Tensor): Concatenated multi-level anchor.\n reg_targets (torch.Tensor): Bbox regression targets.\n dir_offset (int): Direction offset.\n num_bins (int): Number of bins to divide 2*PI.\n one_hot (bool): Whether to encode as one hot.\n\n Returns:\n torch.Tensor: Encoded direction targets.\n \"\"\"\n rot_gt = reg_targets[..., 6] + anchors[..., 6]\n offset_rot = limit_period(rot_gt - dir_offset, 0, 2 * np.pi)\n dir_cls_targets = torch.floor(offset_rot / (2 * np.pi / num_bins)).long()\n dir_cls_targets = torch.clamp(dir_cls_targets, min=0, max=num_bins - 1)\n if one_hot:\n dir_targets = torch.zeros(\n *list(dir_cls_targets.shape),\n num_bins,\n dtype=anchors.dtype,\n device=dir_cls_targets.device)\n dir_targets.scatter_(dir_cls_targets.unsqueeze(dim=-1).long(), 1.0)\n dir_cls_targets = dir_targets\n return dir_cls_targets\n", "import numpy as np\nimport torch\nfrom mmcv.cnn import ConvModule, normal_init\nfrom mmcv.runner import BaseModule\nfrom torch import nn as nn\n\nfrom mmdet3d.core.bbox.structures import (LiDARInstance3DBoxes,\n rotation_3d_in_axis, xywhr2xyxyr)\nfrom mmdet3d.models.builder import build_loss\nfrom mmdet3d.ops import make_sparse_convmodule\nfrom mmdet3d.ops import spconv as spconv\nfrom mmdet3d.ops.iou3d.iou3d_utils import nms_gpu, nms_normal_gpu\nfrom mmdet.core import build_bbox_coder, multi_apply\nfrom mmdet.models import HEADS\n\n\[email protected]_module()\nclass PartA2BboxHead(BaseModule):\n \"\"\"PartA2 RoI head.\n\n Args:\n num_classes (int): The number of classes to prediction.\n seg_in_channels (int): Input channels of segmentation\n convolution layer.\n part_in_channels (int): Input channels of part convolution layer.\n seg_conv_channels (list(int)): Out channels of each\n segmentation convolution layer.\n part_conv_channels (list(int)): Out channels of each\n part convolution layer.\n merge_conv_channels (list(int)): Out channels of each\n feature merged convolution layer.\n down_conv_channels (list(int)): Out channels of each\n downsampled convolution layer.\n shared_fc_channels (list(int)): Out channels of each shared fc layer.\n cls_channels (list(int)): Out channels of each classification layer.\n reg_channels (list(int)): Out channels of each regression layer.\n dropout_ratio (float): Dropout ratio of classification and\n regression layers.\n roi_feat_size (int): The size of pooled roi features.\n with_corner_loss (bool): Whether to use corner loss or not.\n bbox_coder (:obj:`BaseBBoxCoder`): Bbox coder for box head.\n conv_cfg (dict): Config dict of convolutional layers\n norm_cfg (dict): Config dict of normalization layers\n loss_bbox (dict): Config dict of box regression loss.\n loss_cls (dict): Config dict of classifacation loss.\n \"\"\"\n\n def __init__(self,\n num_classes,\n seg_in_channels,\n part_in_channels,\n seg_conv_channels=None,\n part_conv_channels=None,\n merge_conv_channels=None,\n down_conv_channels=None,\n shared_fc_channels=None,\n cls_channels=None,\n reg_channels=None,\n dropout_ratio=0.1,\n roi_feat_size=14,\n with_corner_loss=True,\n bbox_coder=dict(type='DeltaXYZWLHRBBoxCoder'),\n conv_cfg=dict(type='Conv1d'),\n norm_cfg=dict(type='BN1d', eps=1e-3, momentum=0.01),\n loss_bbox=dict(\n type='SmoothL1Loss', beta=1.0 / 9.0, loss_weight=2.0),\n loss_cls=dict(\n type='CrossEntropyLoss',\n use_sigmoid=True,\n reduction='none',\n loss_weight=1.0),\n init_cfg=None):\n super(PartA2BboxHead, self).__init__(init_cfg=init_cfg)\n self.num_classes = num_classes\n self.with_corner_loss = with_corner_loss\n self.bbox_coder = build_bbox_coder(bbox_coder)\n self.loss_bbox = build_loss(loss_bbox)\n self.loss_cls = build_loss(loss_cls)\n self.use_sigmoid_cls = loss_cls.get('use_sigmoid', False)\n\n assert down_conv_channels[-1] == shared_fc_channels[0]\n\n # init layers\n part_channel_last = part_in_channels\n part_conv = []\n for i, channel in enumerate(part_conv_channels):\n part_conv.append(\n make_sparse_convmodule(\n part_channel_last,\n channel,\n 3,\n padding=1,\n norm_cfg=norm_cfg,\n indice_key=f'rcnn_part{i}',\n conv_type='SubMConv3d'))\n part_channel_last = channel\n self.part_conv = spconv.SparseSequential(*part_conv)\n\n seg_channel_last = seg_in_channels\n seg_conv = []\n for i, channel in enumerate(seg_conv_channels):\n seg_conv.append(\n make_sparse_convmodule(\n seg_channel_last,\n channel,\n 3,\n padding=1,\n norm_cfg=norm_cfg,\n indice_key=f'rcnn_seg{i}',\n conv_type='SubMConv3d'))\n seg_channel_last = channel\n self.seg_conv = spconv.SparseSequential(*seg_conv)\n\n self.conv_down = spconv.SparseSequential()\n\n merge_conv_channel_last = part_channel_last + seg_channel_last\n merge_conv = []\n for i, channel in enumerate(merge_conv_channels):\n merge_conv.append(\n make_sparse_convmodule(\n merge_conv_channel_last,\n channel,\n 3,\n padding=1,\n norm_cfg=norm_cfg,\n indice_key='rcnn_down0'))\n merge_conv_channel_last = channel\n\n down_conv_channel_last = merge_conv_channel_last\n conv_down = []\n for i, channel in enumerate(down_conv_channels):\n conv_down.append(\n make_sparse_convmodule(\n down_conv_channel_last,\n channel,\n 3,\n padding=1,\n norm_cfg=norm_cfg,\n indice_key='rcnn_down1'))\n down_conv_channel_last = channel\n\n self.conv_down.add_module('merge_conv',\n spconv.SparseSequential(*merge_conv))\n self.conv_down.add_module(\n 'max_pool3d', spconv.SparseMaxPool3d(kernel_size=2, stride=2))\n self.conv_down.add_module('down_conv',\n spconv.SparseSequential(*conv_down))\n\n shared_fc_list = []\n pool_size = roi_feat_size // 2\n pre_channel = shared_fc_channels[0] * pool_size**3\n for k in range(1, len(shared_fc_channels)):\n shared_fc_list.append(\n ConvModule(\n pre_channel,\n shared_fc_channels[k],\n 1,\n padding=0,\n conv_cfg=conv_cfg,\n norm_cfg=norm_cfg,\n inplace=True))\n pre_channel = shared_fc_channels[k]\n\n if k != len(shared_fc_channels) - 1 and dropout_ratio > 0:\n shared_fc_list.append(nn.Dropout(dropout_ratio))\n\n self.shared_fc = nn.Sequential(*shared_fc_list)\n\n # Classification layer\n channel_in = shared_fc_channels[-1]\n cls_channel = 1\n cls_layers = []\n pre_channel = channel_in\n for k in range(0, len(cls_channels)):\n cls_layers.append(\n ConvModule(\n pre_channel,\n cls_channels[k],\n 1,\n padding=0,\n conv_cfg=conv_cfg,\n norm_cfg=norm_cfg,\n inplace=True))\n pre_channel = cls_channels[k]\n cls_layers.append(\n ConvModule(\n pre_channel,\n cls_channel,\n 1,\n padding=0,\n conv_cfg=conv_cfg,\n act_cfg=None))\n if dropout_ratio >= 0:\n cls_layers.insert(1, nn.Dropout(dropout_ratio))\n\n self.conv_cls = nn.Sequential(*cls_layers)\n\n # Regression layer\n reg_layers = []\n pre_channel = channel_in\n for k in range(0, len(reg_channels)):\n reg_layers.append(\n ConvModule(\n pre_channel,\n reg_channels[k],\n 1,\n padding=0,\n conv_cfg=conv_cfg,\n norm_cfg=norm_cfg,\n inplace=True))\n pre_channel = reg_channels[k]\n reg_layers.append(\n ConvModule(\n pre_channel,\n self.bbox_coder.code_size,\n 1,\n padding=0,\n conv_cfg=conv_cfg,\n act_cfg=None))\n if dropout_ratio >= 0:\n reg_layers.insert(1, nn.Dropout(dropout_ratio))\n\n self.conv_reg = nn.Sequential(*reg_layers)\n\n if init_cfg is None:\n self.init_cfg = dict(\n type='Xavier',\n layer=['Conv2d', 'Conv1d'],\n distribution='uniform')\n\n def init_weights(self):\n super().init_weights()\n normal_init(self.conv_reg[-1].conv, mean=0, std=0.001)\n\n def forward(self, seg_feats, part_feats):\n \"\"\"Forward pass.\n\n Args:\n seg_feats (torch.Tensor): Point-wise semantic features.\n part_feats (torch.Tensor): Point-wise part prediction features.\n\n Returns:\n tuple[torch.Tensor]: Score of class and bbox predictions.\n \"\"\"\n # (B * N, out_x, out_y, out_z, 4)\n rcnn_batch_size = part_feats.shape[0]\n\n # transform to sparse tensors\n sparse_shape = part_feats.shape[1:4]\n # (non_empty_num, 4) ==> [bs_idx, x_idx, y_idx, z_idx]\n sparse_idx = part_feats.sum(dim=-1).nonzero(as_tuple=False)\n\n part_features = part_feats[sparse_idx[:, 0], sparse_idx[:, 1],\n sparse_idx[:, 2], sparse_idx[:, 3]]\n seg_features = seg_feats[sparse_idx[:, 0], sparse_idx[:, 1],\n sparse_idx[:, 2], sparse_idx[:, 3]]\n coords = sparse_idx.int()\n part_features = spconv.SparseConvTensor(part_features, coords,\n sparse_shape, rcnn_batch_size)\n seg_features = spconv.SparseConvTensor(seg_features, coords,\n sparse_shape, rcnn_batch_size)\n\n # forward rcnn network\n x_part = self.part_conv(part_features)\n x_rpn = self.seg_conv(seg_features)\n\n merged_feature = torch.cat((x_rpn.features, x_part.features),\n dim=1) # (N, C)\n shared_feature = spconv.SparseConvTensor(merged_feature, coords,\n sparse_shape, rcnn_batch_size)\n\n x = self.conv_down(shared_feature)\n\n shared_feature = x.dense().view(rcnn_batch_size, -1, 1)\n\n shared_feature = self.shared_fc(shared_feature)\n\n cls_score = self.conv_cls(shared_feature).transpose(\n 1, 2).contiguous().squeeze(dim=1) # (B, 1)\n bbox_pred = self.conv_reg(shared_feature).transpose(\n 1, 2).contiguous().squeeze(dim=1) # (B, C)\n\n return cls_score, bbox_pred\n\n def loss(self, cls_score, bbox_pred, rois, labels, bbox_targets,\n pos_gt_bboxes, reg_mask, label_weights, bbox_weights):\n \"\"\"Coumputing losses.\n\n Args:\n cls_score (torch.Tensor): Scores of each roi.\n bbox_pred (torch.Tensor): Predictions of bboxes.\n rois (torch.Tensor): Roi bboxes.\n labels (torch.Tensor): Labels of class.\n bbox_targets (torch.Tensor): Target of positive bboxes.\n pos_gt_bboxes (torch.Tensor): Ground truths of positive bboxes.\n reg_mask (torch.Tensor): Mask for positive bboxes.\n label_weights (torch.Tensor): Weights of class loss.\n bbox_weights (torch.Tensor): Weights of bbox loss.\n\n Returns:\n dict: Computed losses.\n\n - loss_cls (torch.Tensor): Loss of classes.\n - loss_bbox (torch.Tensor): Loss of bboxes.\n - loss_corner (torch.Tensor): Loss of corners.\n \"\"\"\n losses = dict()\n rcnn_batch_size = cls_score.shape[0]\n\n # calculate class loss\n cls_flat = cls_score.view(-1)\n loss_cls = self.loss_cls(cls_flat, labels, label_weights)\n losses['loss_cls'] = loss_cls\n\n # calculate regression loss\n code_size = self.bbox_coder.code_size\n pos_inds = (reg_mask > 0)\n if pos_inds.any() == 0:\n # fake a part loss\n losses['loss_bbox'] = loss_cls.new_tensor(0)\n if self.with_corner_loss:\n losses['loss_corner'] = loss_cls.new_tensor(0)\n else:\n pos_bbox_pred = bbox_pred.view(rcnn_batch_size, -1)[pos_inds]\n bbox_weights_flat = bbox_weights[pos_inds].view(-1, 1).repeat(\n 1, pos_bbox_pred.shape[-1])\n loss_bbox = self.loss_bbox(\n pos_bbox_pred.unsqueeze(dim=0), bbox_targets.unsqueeze(dim=0),\n bbox_weights_flat.unsqueeze(dim=0))\n losses['loss_bbox'] = loss_bbox\n\n if self.with_corner_loss:\n pos_roi_boxes3d = rois[..., 1:].view(-1, code_size)[pos_inds]\n pos_roi_boxes3d = pos_roi_boxes3d.view(-1, code_size)\n batch_anchors = pos_roi_boxes3d.clone().detach()\n pos_rois_rotation = pos_roi_boxes3d[..., 6].view(-1)\n roi_xyz = pos_roi_boxes3d[..., 0:3].view(-1, 3)\n batch_anchors[..., 0:3] = 0\n # decode boxes\n pred_boxes3d = self.bbox_coder.decode(\n batch_anchors,\n pos_bbox_pred.view(-1, code_size)).view(-1, code_size)\n\n pred_boxes3d[..., 0:3] = rotation_3d_in_axis(\n pred_boxes3d[..., 0:3].unsqueeze(1),\n (pos_rois_rotation + np.pi / 2),\n axis=2).squeeze(1)\n\n pred_boxes3d[:, 0:3] += roi_xyz\n\n # calculate corner loss\n loss_corner = self.get_corner_loss_lidar(\n pred_boxes3d, pos_gt_bboxes)\n losses['loss_corner'] = loss_corner\n\n return losses\n\n def get_targets(self, sampling_results, rcnn_train_cfg, concat=True):\n \"\"\"Generate targets.\n\n Args:\n sampling_results (list[:obj:`SamplingResult`]):\n Sampled results from rois.\n rcnn_train_cfg (:obj:`ConfigDict`): Training config of rcnn.\n concat (bool): Whether to concatenate targets between batches.\n\n Returns:\n tuple[torch.Tensor]: Targets of boxes and class prediction.\n \"\"\"\n pos_bboxes_list = [res.pos_bboxes for res in sampling_results]\n pos_gt_bboxes_list = [res.pos_gt_bboxes for res in sampling_results]\n iou_list = [res.iou for res in sampling_results]\n targets = multi_apply(\n self._get_target_single,\n pos_bboxes_list,\n pos_gt_bboxes_list,\n iou_list,\n cfg=rcnn_train_cfg)\n\n (label, bbox_targets, pos_gt_bboxes, reg_mask, label_weights,\n bbox_weights) = targets\n\n if concat:\n label = torch.cat(label, 0)\n bbox_targets = torch.cat(bbox_targets, 0)\n pos_gt_bboxes = torch.cat(pos_gt_bboxes, 0)\n reg_mask = torch.cat(reg_mask, 0)\n\n label_weights = torch.cat(label_weights, 0)\n label_weights /= torch.clamp(label_weights.sum(), min=1.0)\n\n bbox_weights = torch.cat(bbox_weights, 0)\n bbox_weights /= torch.clamp(bbox_weights.sum(), min=1.0)\n\n return (label, bbox_targets, pos_gt_bboxes, reg_mask, label_weights,\n bbox_weights)\n\n def _get_target_single(self, pos_bboxes, pos_gt_bboxes, ious, cfg):\n \"\"\"Generate training targets for a single sample.\n\n Args:\n pos_bboxes (torch.Tensor): Positive boxes with shape\n (N, 7).\n pos_gt_bboxes (torch.Tensor): Ground truth boxes with shape\n (M, 7).\n ious (torch.Tensor): IoU between `pos_bboxes` and `pos_gt_bboxes`\n in shape (N, M).\n cfg (dict): Training configs.\n\n Returns:\n tuple[torch.Tensor]: Target for positive boxes.\n (label, bbox_targets, pos_gt_bboxes, reg_mask, label_weights,\n bbox_weights)\n \"\"\"\n cls_pos_mask = ious > cfg.cls_pos_thr\n cls_neg_mask = ious < cfg.cls_neg_thr\n interval_mask = (cls_pos_mask == 0) & (cls_neg_mask == 0)\n\n # iou regression target\n label = (cls_pos_mask > 0).float()\n label[interval_mask] = ious[interval_mask] * 2 - 0.5\n # label weights\n label_weights = (label >= 0).float()\n\n # box regression target\n reg_mask = pos_bboxes.new_zeros(ious.size(0)).long()\n reg_mask[0:pos_gt_bboxes.size(0)] = 1\n bbox_weights = (reg_mask > 0).float()\n if reg_mask.bool().any():\n pos_gt_bboxes_ct = pos_gt_bboxes.clone().detach()\n roi_center = pos_bboxes[..., 0:3]\n roi_ry = pos_bboxes[..., 6] % (2 * np.pi)\n\n # canonical transformation\n pos_gt_bboxes_ct[..., 0:3] -= roi_center\n pos_gt_bboxes_ct[..., 6] -= roi_ry\n pos_gt_bboxes_ct[..., 0:3] = rotation_3d_in_axis(\n pos_gt_bboxes_ct[..., 0:3].unsqueeze(1),\n -(roi_ry + np.pi / 2),\n axis=2).squeeze(1)\n\n # flip orientation if rois have opposite orientation\n ry_label = pos_gt_bboxes_ct[..., 6] % (2 * np.pi) # 0 ~ 2pi\n opposite_flag = (ry_label > np.pi * 0.5) & (ry_label < np.pi * 1.5)\n ry_label[opposite_flag] = (ry_label[opposite_flag] + np.pi) % (\n 2 * np.pi) # (0 ~ pi/2, 3pi/2 ~ 2pi)\n flag = ry_label > np.pi\n ry_label[flag] = ry_label[flag] - np.pi * 2 # (-pi/2, pi/2)\n ry_label = torch.clamp(ry_label, min=-np.pi / 2, max=np.pi / 2)\n pos_gt_bboxes_ct[..., 6] = ry_label\n\n rois_anchor = pos_bboxes.clone().detach()\n rois_anchor[:, 0:3] = 0\n rois_anchor[:, 6] = 0\n bbox_targets = self.bbox_coder.encode(rois_anchor,\n pos_gt_bboxes_ct)\n else:\n # no fg bbox\n bbox_targets = pos_gt_bboxes.new_empty((0, 7))\n\n return (label, bbox_targets, pos_gt_bboxes, reg_mask, label_weights,\n bbox_weights)\n\n def get_corner_loss_lidar(self, pred_bbox3d, gt_bbox3d, delta=1):\n \"\"\"Calculate corner loss of given boxes.\n\n Args:\n pred_bbox3d (torch.FloatTensor): Predicted boxes in shape (N, 7).\n gt_bbox3d (torch.FloatTensor): Ground truth boxes in shape (N, 7).\n\n Returns:\n torch.FloatTensor: Calculated corner loss in shape (N).\n \"\"\"\n assert pred_bbox3d.shape[0] == gt_bbox3d.shape[0]\n\n # This is a little bit hack here because we assume the box for\n # Part-A2 is in LiDAR coordinates\n gt_boxes_structure = LiDARInstance3DBoxes(gt_bbox3d)\n pred_box_corners = LiDARInstance3DBoxes(pred_bbox3d).corners\n gt_box_corners = gt_boxes_structure.corners\n\n # This flip only changes the heading direction of GT boxes\n gt_bbox3d_flip = gt_boxes_structure.clone()\n gt_bbox3d_flip.tensor[:, 6] += np.pi\n gt_box_corners_flip = gt_bbox3d_flip.corners\n\n corner_dist = torch.min(\n torch.norm(pred_box_corners - gt_box_corners, dim=2),\n torch.norm(pred_box_corners - gt_box_corners_flip,\n dim=2)) # (N, 8)\n # huber loss\n abs_error = torch.abs(corner_dist)\n quadratic = torch.clamp(abs_error, max=delta)\n linear = (abs_error - quadratic)\n corner_loss = 0.5 * quadratic**2 + delta * linear\n\n return corner_loss.mean(dim=1)\n\n def get_bboxes(self,\n rois,\n cls_score,\n bbox_pred,\n class_labels,\n class_pred,\n img_metas,\n cfg=None):\n \"\"\"Generate bboxes from bbox head predictions.\n\n Args:\n rois (torch.Tensor): Roi bounding boxes.\n cls_score (torch.Tensor): Scores of bounding boxes.\n bbox_pred (torch.Tensor): Bounding boxes predictions\n class_labels (torch.Tensor): Label of classes\n class_pred (torch.Tensor): Score for nms.\n img_metas (list[dict]): Point cloud and image's meta info.\n cfg (:obj:`ConfigDict`): Testing config.\n\n Returns:\n list[tuple]: Decoded bbox, scores and labels after nms.\n \"\"\"\n roi_batch_id = rois[..., 0]\n roi_boxes = rois[..., 1:] # boxes without batch id\n batch_size = int(roi_batch_id.max().item() + 1)\n\n # decode boxes\n roi_ry = roi_boxes[..., 6].view(-1)\n roi_xyz = roi_boxes[..., 0:3].view(-1, 3)\n local_roi_boxes = roi_boxes.clone().detach()\n local_roi_boxes[..., 0:3] = 0\n rcnn_boxes3d = self.bbox_coder.decode(local_roi_boxes, bbox_pred)\n rcnn_boxes3d[..., 0:3] = rotation_3d_in_axis(\n rcnn_boxes3d[..., 0:3].unsqueeze(1), (roi_ry + np.pi / 2),\n axis=2).squeeze(1)\n rcnn_boxes3d[:, 0:3] += roi_xyz\n\n # post processing\n result_list = []\n for batch_id in range(batch_size):\n cur_class_labels = class_labels[batch_id]\n cur_cls_score = cls_score[roi_batch_id == batch_id].view(-1)\n\n cur_box_prob = class_pred[batch_id]\n cur_rcnn_boxes3d = rcnn_boxes3d[roi_batch_id == batch_id]\n selected = self.multi_class_nms(cur_box_prob, cur_rcnn_boxes3d,\n cfg.score_thr, cfg.nms_thr,\n img_metas[batch_id],\n cfg.use_rotate_nms)\n selected_bboxes = cur_rcnn_boxes3d[selected]\n selected_label_preds = cur_class_labels[selected]\n selected_scores = cur_cls_score[selected]\n\n result_list.append(\n (img_metas[batch_id]['box_type_3d'](selected_bboxes,\n self.bbox_coder.code_size),\n selected_scores, selected_label_preds))\n return result_list\n\n def multi_class_nms(self,\n box_probs,\n box_preds,\n score_thr,\n nms_thr,\n input_meta,\n use_rotate_nms=True):\n \"\"\"Multi-class NMS for box head.\n\n Note:\n This function has large overlap with the `box3d_multiclass_nms`\n implemented in `mmdet3d.core.post_processing`. We are considering\n merging these two functions in the future.\n\n Args:\n box_probs (torch.Tensor): Predicted boxes probabitilies in\n shape (N,).\n box_preds (torch.Tensor): Predicted boxes in shape (N, 7+C).\n score_thr (float): Threshold of scores.\n nms_thr (float): Threshold for NMS.\n input_meta (dict): Meta informations of the current sample.\n use_rotate_nms (bool, optional): Whether to use rotated nms.\n Defaults to True.\n\n Returns:\n torch.Tensor: Selected indices.\n \"\"\"\n if use_rotate_nms:\n nms_func = nms_gpu\n else:\n nms_func = nms_normal_gpu\n\n assert box_probs.shape[\n 1] == self.num_classes, f'box_probs shape: {str(box_probs.shape)}'\n selected_list = []\n selected_labels = []\n boxes_for_nms = xywhr2xyxyr(input_meta['box_type_3d'](\n box_preds, self.bbox_coder.code_size).bev)\n\n score_thresh = score_thr if isinstance(\n score_thr, list) else [score_thr for x in range(self.num_classes)]\n nms_thresh = nms_thr if isinstance(\n nms_thr, list) else [nms_thr for x in range(self.num_classes)]\n for k in range(0, self.num_classes):\n class_scores_keep = box_probs[:, k] >= score_thresh[k]\n\n if class_scores_keep.int().sum() > 0:\n original_idxs = class_scores_keep.nonzero(\n as_tuple=False).view(-1)\n cur_boxes_for_nms = boxes_for_nms[class_scores_keep]\n cur_rank_scores = box_probs[class_scores_keep, k]\n\n cur_selected = nms_func(cur_boxes_for_nms, cur_rank_scores,\n nms_thresh[k])\n\n if cur_selected.shape[0] == 0:\n continue\n selected_list.append(original_idxs[cur_selected])\n selected_labels.append(\n torch.full([cur_selected.shape[0]],\n k + 1,\n dtype=torch.int64,\n device=box_preds.device))\n\n selected = torch.cat(\n selected_list, dim=0) if len(selected_list) > 0 else []\n return selected\n", "import numpy as np\nimport torch\nimport warnings\nfrom mmcv.cnn import ConvModule\nfrom mmcv.runner import BaseModule\nfrom torch import nn as nn\n\nfrom mmdet3d.core import box3d_multiclass_nms, limit_period, xywhr2xyxyr\nfrom mmdet.core import multi_apply\nfrom mmdet.models import HEADS\nfrom ..builder import build_head\nfrom .anchor3d_head import Anchor3DHead\n\n\[email protected]_module()\nclass BaseShapeHead(BaseModule):\n \"\"\"Base Shape-aware Head in Shape Signature Network.\n\n Note:\n This base shape-aware grouping head uses default settings for small\n objects. For large and huge objects, it is recommended to use\n heavier heads, like (64, 64, 64) and (128, 128, 64, 64, 64) in\n shared conv channels, (2, 1, 1) and (2, 1, 2, 1, 1) in shared\n conv strides. For tiny objects, we can use smaller heads, like\n (32, 32) channels and (1, 1) strides.\n\n Args:\n num_cls (int): Number of classes.\n num_base_anchors (int): Number of anchors per location.\n box_code_size (int): The dimension of boxes to be encoded.\n in_channels (int): Input channels for convolutional layers.\n shared_conv_channels (tuple): Channels for shared convolutional \\\n layers. Default: (64, 64). \\\n shared_conv_strides (tuple): Strides for shared convolutional \\\n layers. Default: (1, 1).\n use_direction_classifier (bool, optional): Whether to use direction \\\n classifier. Default: True.\n conv_cfg (dict): Config of conv layer. Default: dict(type='Conv2d')\n norm_cfg (dict): Config of norm layer. Default: dict(type='BN2d').\n bias (bool|str, optional): Type of bias. Default: False.\n \"\"\"\n\n def __init__(self,\n num_cls,\n num_base_anchors,\n box_code_size,\n in_channels,\n shared_conv_channels=(64, 64),\n shared_conv_strides=(1, 1),\n use_direction_classifier=True,\n conv_cfg=dict(type='Conv2d'),\n norm_cfg=dict(type='BN2d'),\n bias=False,\n init_cfg=None):\n super().__init__(init_cfg=init_cfg)\n self.num_cls = num_cls\n self.num_base_anchors = num_base_anchors\n self.use_direction_classifier = use_direction_classifier\n self.box_code_size = box_code_size\n\n assert len(shared_conv_channels) == len(shared_conv_strides), \\\n 'Lengths of channels and strides list should be equal.'\n\n self.shared_conv_channels = [in_channels] + list(shared_conv_channels)\n self.shared_conv_strides = list(shared_conv_strides)\n\n shared_conv = []\n for i in range(len(self.shared_conv_strides)):\n shared_conv.append(\n ConvModule(\n self.shared_conv_channels[i],\n self.shared_conv_channels[i + 1],\n kernel_size=3,\n stride=self.shared_conv_strides[i],\n padding=1,\n conv_cfg=conv_cfg,\n bias=bias,\n norm_cfg=norm_cfg))\n\n self.shared_conv = nn.Sequential(*shared_conv)\n\n out_channels = self.shared_conv_channels[-1]\n self.conv_cls = nn.Conv2d(out_channels, num_base_anchors * num_cls, 1)\n self.conv_reg = nn.Conv2d(out_channels,\n num_base_anchors * box_code_size, 1)\n\n if use_direction_classifier:\n self.conv_dir_cls = nn.Conv2d(out_channels, num_base_anchors * 2,\n 1)\n if init_cfg is None:\n if use_direction_classifier:\n self.init_cfg = dict(\n type='Kaiming',\n layer='Conv2d',\n override=[\n dict(type='Normal', name='conv_reg', std=0.01),\n dict(\n type='Normal',\n name='conv_cls',\n std=0.01,\n bias_prob=0.01),\n dict(\n type='Normal',\n name='conv_dir_cls',\n std=0.01,\n bias_prob=0.01)\n ])\n else:\n self.init_cfg = dict(\n type='Kaiming',\n layer='Conv2d',\n override=[\n dict(type='Normal', name='conv_reg', std=0.01),\n dict(\n type='Normal',\n name='conv_cls',\n std=0.01,\n bias_prob=0.01)\n ])\n\n def forward(self, x):\n \"\"\"Forward function for SmallHead.\n\n Args:\n x (torch.Tensor): Input feature map with the shape of\n [B, C, H, W].\n\n Returns:\n dict[torch.Tensor]: Contain score of each class, bbox \\\n regression and direction classification predictions. \\\n Note that all the returned tensors are reshaped as \\\n [bs*num_base_anchors*H*W, num_cls/box_code_size/dir_bins]. \\\n It is more convenient to concat anchors for different \\\n classes even though they have different feature map sizes.\n \"\"\"\n x = self.shared_conv(x)\n cls_score = self.conv_cls(x)\n bbox_pred = self.conv_reg(x)\n featmap_size = bbox_pred.shape[-2:]\n H, W = featmap_size\n B = bbox_pred.shape[0]\n cls_score = cls_score.view(-1, self.num_base_anchors, self.num_cls, H,\n W).permute(0, 1, 3, 4,\n 2).reshape(B, -1, self.num_cls)\n bbox_pred = bbox_pred.view(-1, self.num_base_anchors,\n self.box_code_size, H, W).permute(\n 0, 1, 3, 4,\n 2).reshape(B, -1, self.box_code_size)\n\n dir_cls_preds = None\n if self.use_direction_classifier:\n dir_cls_preds = self.conv_dir_cls(x)\n dir_cls_preds = dir_cls_preds.view(-1, self.num_base_anchors, 2, H,\n W).permute(0, 1, 3, 4,\n 2).reshape(B, -1, 2)\n ret = dict(\n cls_score=cls_score,\n bbox_pred=bbox_pred,\n dir_cls_preds=dir_cls_preds,\n featmap_size=featmap_size)\n return ret\n\n\[email protected]_module()\nclass ShapeAwareHead(Anchor3DHead):\n \"\"\"Shape-aware grouping head for SSN.\n\n Args:\n tasks (dict): Shape-aware groups of multi-class objects.\n assign_per_class (bool, optional): Whether to do assignment for each \\\n class. Default: True.\n kwargs (dict): Other arguments are the same as those in \\\n :class:`Anchor3DHead`.\n \"\"\"\n\n def __init__(self, tasks, assign_per_class=True, init_cfg=None, **kwargs):\n self.tasks = tasks\n self.featmap_sizes = []\n super().__init__(\n assign_per_class=assign_per_class, init_cfg=init_cfg, **kwargs)\n\n def init_weights(self):\n if not self._is_init:\n for m in self.heads:\n if hasattr(m, 'init_weights'):\n m.init_weights()\n self._is_init = True\n else:\n warnings.warn(f'init_weights of {self.__class__.__name__} has '\n f'been called more than once.')\n\n def _init_layers(self):\n \"\"\"Initialize neural network layers of the head.\"\"\"\n self.heads = nn.ModuleList()\n cls_ptr = 0\n for task in self.tasks:\n sizes = self.anchor_generator.sizes[cls_ptr:cls_ptr +\n task['num_class']]\n num_size = torch.tensor(sizes).reshape(-1, 3).size(0)\n num_rot = len(self.anchor_generator.rotations)\n num_base_anchors = num_rot * num_size\n branch = dict(\n type='BaseShapeHead',\n num_cls=self.num_classes,\n num_base_anchors=num_base_anchors,\n box_code_size=self.box_code_size,\n in_channels=self.in_channels,\n shared_conv_channels=task['shared_conv_channels'],\n shared_conv_strides=task['shared_conv_strides'])\n self.heads.append(build_head(branch))\n cls_ptr += task['num_class']\n\n def forward_single(self, x):\n \"\"\"Forward function on a single-scale feature map.\n\n Args:\n x (torch.Tensor): Input features.\n Returns:\n tuple[torch.Tensor]: Contain score of each class, bbox \\\n regression and direction classification predictions.\n \"\"\"\n results = []\n\n for head in self.heads:\n results.append(head(x))\n\n cls_score = torch.cat([result['cls_score'] for result in results],\n dim=1)\n bbox_pred = torch.cat([result['bbox_pred'] for result in results],\n dim=1)\n dir_cls_preds = None\n if self.use_direction_classifier:\n dir_cls_preds = torch.cat(\n [result['dir_cls_preds'] for result in results], dim=1)\n\n self.featmap_sizes = []\n for i, task in enumerate(self.tasks):\n for _ in range(task['num_class']):\n self.featmap_sizes.append(results[i]['featmap_size'])\n assert len(self.featmap_sizes) == len(self.anchor_generator.ranges), \\\n 'Length of feature map sizes must be equal to length of ' + \\\n 'different ranges of anchor generator.'\n\n return cls_score, bbox_pred, dir_cls_preds\n\n def loss_single(self, cls_score, bbox_pred, dir_cls_preds, labels,\n label_weights, bbox_targets, bbox_weights, dir_targets,\n dir_weights, num_total_samples):\n \"\"\"Calculate loss of Single-level results.\n\n Args:\n cls_score (torch.Tensor): Class score in single-level.\n bbox_pred (torch.Tensor): Bbox prediction in single-level.\n dir_cls_preds (torch.Tensor): Predictions of direction class\n in single-level.\n labels (torch.Tensor): Labels of class.\n label_weights (torch.Tensor): Weights of class loss.\n bbox_targets (torch.Tensor): Targets of bbox predictions.\n bbox_weights (torch.Tensor): Weights of bbox loss.\n dir_targets (torch.Tensor): Targets of direction predictions.\n dir_weights (torch.Tensor): Weights of direction loss.\n num_total_samples (int): The number of valid samples.\n\n Returns:\n tuple[torch.Tensor]: Losses of class, bbox \\\n and direction, respectively.\n \"\"\"\n # classification loss\n if num_total_samples is None:\n num_total_samples = int(cls_score.shape[0])\n labels = labels.reshape(-1)\n label_weights = label_weights.reshape(-1)\n cls_score = cls_score.reshape(-1, self.num_classes)\n loss_cls = self.loss_cls(\n cls_score, labels, label_weights, avg_factor=num_total_samples)\n\n # regression loss\n bbox_targets = bbox_targets.reshape(-1, self.box_code_size)\n bbox_weights = bbox_weights.reshape(-1, self.box_code_size)\n code_weight = self.train_cfg.get('code_weight', None)\n\n if code_weight:\n bbox_weights = bbox_weights * bbox_weights.new_tensor(code_weight)\n bbox_pred = bbox_pred.reshape(-1, self.box_code_size)\n if self.diff_rad_by_sin:\n bbox_pred, bbox_targets = self.add_sin_difference(\n bbox_pred, bbox_targets)\n loss_bbox = self.loss_bbox(\n bbox_pred,\n bbox_targets,\n bbox_weights,\n avg_factor=num_total_samples)\n\n # direction classification loss\n loss_dir = None\n if self.use_direction_classifier:\n dir_cls_preds = dir_cls_preds.reshape(-1, 2)\n dir_targets = dir_targets.reshape(-1)\n dir_weights = dir_weights.reshape(-1)\n loss_dir = self.loss_dir(\n dir_cls_preds,\n dir_targets,\n dir_weights,\n avg_factor=num_total_samples)\n\n return loss_cls, loss_bbox, loss_dir\n\n def loss(self,\n cls_scores,\n bbox_preds,\n dir_cls_preds,\n gt_bboxes,\n gt_labels,\n input_metas,\n gt_bboxes_ignore=None):\n \"\"\"Calculate losses.\n\n Args:\n cls_scores (list[torch.Tensor]): Multi-level class scores.\n bbox_preds (list[torch.Tensor]): Multi-level bbox predictions.\n dir_cls_preds (list[torch.Tensor]): Multi-level direction\n class predictions.\n gt_bboxes (list[:obj:`BaseInstance3DBoxes`]): Gt bboxes\n of each sample.\n gt_labels (list[torch.Tensor]): Gt labels of each sample.\n input_metas (list[dict]): Contain pcd and img's meta info.\n gt_bboxes_ignore (None | list[torch.Tensor]): Specify\n which bounding.\n\n Returns:\n dict[str, list[torch.Tensor]]: Classification, bbox, and \\\n direction losses of each level.\n\n - loss_cls (list[torch.Tensor]): Classification losses.\n - loss_bbox (list[torch.Tensor]): Box regression losses.\n - loss_dir (list[torch.Tensor]): Direction classification \\\n losses.\n \"\"\"\n device = cls_scores[0].device\n anchor_list = self.get_anchors(\n self.featmap_sizes, input_metas, device=device)\n cls_reg_targets = self.anchor_target_3d(\n anchor_list,\n gt_bboxes,\n input_metas,\n gt_bboxes_ignore_list=gt_bboxes_ignore,\n gt_labels_list=gt_labels,\n num_classes=self.num_classes,\n sampling=self.sampling)\n\n if cls_reg_targets is None:\n return None\n (labels_list, label_weights_list, bbox_targets_list, bbox_weights_list,\n dir_targets_list, dir_weights_list, num_total_pos,\n num_total_neg) = cls_reg_targets\n num_total_samples = (\n num_total_pos + num_total_neg if self.sampling else num_total_pos)\n\n # num_total_samples = None\n losses_cls, losses_bbox, losses_dir = multi_apply(\n self.loss_single,\n cls_scores,\n bbox_preds,\n dir_cls_preds,\n labels_list,\n label_weights_list,\n bbox_targets_list,\n bbox_weights_list,\n dir_targets_list,\n dir_weights_list,\n num_total_samples=num_total_samples)\n return dict(\n loss_cls=losses_cls, loss_bbox=losses_bbox, loss_dir=losses_dir)\n\n def get_bboxes(self,\n cls_scores,\n bbox_preds,\n dir_cls_preds,\n input_metas,\n cfg=None,\n rescale=False):\n \"\"\"Get bboxes of anchor head.\n\n Args:\n cls_scores (list[torch.Tensor]): Multi-level class scores.\n bbox_preds (list[torch.Tensor]): Multi-level bbox predictions.\n dir_cls_preds (list[torch.Tensor]): Multi-level direction\n class predictions.\n input_metas (list[dict]): Contain pcd and img's meta info.\n cfg (None | :obj:`ConfigDict`): Training or testing config.\n Default: None.\n rescale (list[torch.Tensor], optional): Whether to rescale bbox.\n Default: False.\n\n Returns:\n list[tuple]: Prediction resultes of batches.\n \"\"\"\n assert len(cls_scores) == len(bbox_preds)\n assert len(cls_scores) == len(dir_cls_preds)\n num_levels = len(cls_scores)\n assert num_levels == 1, 'Only support single level inference.'\n device = cls_scores[0].device\n mlvl_anchors = self.anchor_generator.grid_anchors(\n self.featmap_sizes, device=device)\n # `anchor` is a list of anchors for different classes\n mlvl_anchors = [torch.cat(anchor, dim=0) for anchor in mlvl_anchors]\n\n result_list = []\n for img_id in range(len(input_metas)):\n cls_score_list = [\n cls_scores[i][img_id].detach() for i in range(num_levels)\n ]\n bbox_pred_list = [\n bbox_preds[i][img_id].detach() for i in range(num_levels)\n ]\n dir_cls_pred_list = [\n dir_cls_preds[i][img_id].detach() for i in range(num_levels)\n ]\n\n input_meta = input_metas[img_id]\n proposals = self.get_bboxes_single(cls_score_list, bbox_pred_list,\n dir_cls_pred_list, mlvl_anchors,\n input_meta, cfg, rescale)\n result_list.append(proposals)\n return result_list\n\n def get_bboxes_single(self,\n cls_scores,\n bbox_preds,\n dir_cls_preds,\n mlvl_anchors,\n input_meta,\n cfg=None,\n rescale=False):\n \"\"\"Get bboxes of single branch.\n\n Args:\n cls_scores (torch.Tensor): Class score in single batch.\n bbox_preds (torch.Tensor): Bbox prediction in single batch.\n dir_cls_preds (torch.Tensor): Predictions of direction class\n in single batch.\n mlvl_anchors (List[torch.Tensor]): Multi-level anchors\n in single batch.\n input_meta (list[dict]): Contain pcd and img's meta info.\n cfg (None | :obj:`ConfigDict`): Training or testing config.\n rescale (list[torch.Tensor], optional): whether to rescale bbox. \\\n Default: False.\n\n Returns:\n tuple: Contain predictions of single batch.\n\n - bboxes (:obj:`BaseInstance3DBoxes`): Predicted 3d bboxes.\n - scores (torch.Tensor): Class score of each bbox.\n - labels (torch.Tensor): Label of each bbox.\n \"\"\"\n cfg = self.test_cfg if cfg is None else cfg\n assert len(cls_scores) == len(bbox_preds) == len(mlvl_anchors)\n mlvl_bboxes = []\n mlvl_scores = []\n mlvl_dir_scores = []\n for cls_score, bbox_pred, dir_cls_pred, anchors in zip(\n cls_scores, bbox_preds, dir_cls_preds, mlvl_anchors):\n assert cls_score.size()[-2] == bbox_pred.size()[-2]\n assert cls_score.size()[-2] == dir_cls_pred.size()[-2]\n dir_cls_score = torch.max(dir_cls_pred, dim=-1)[1]\n\n if self.use_sigmoid_cls:\n scores = cls_score.sigmoid()\n else:\n scores = cls_score.softmax(-1)\n\n nms_pre = cfg.get('nms_pre', -1)\n if nms_pre > 0 and scores.shape[0] > nms_pre:\n if self.use_sigmoid_cls:\n max_scores, _ = scores.max(dim=1)\n else:\n max_scores, _ = scores[:, :-1].max(dim=1)\n _, topk_inds = max_scores.topk(nms_pre)\n anchors = anchors[topk_inds, :]\n bbox_pred = bbox_pred[topk_inds, :]\n scores = scores[topk_inds, :]\n dir_cls_score = dir_cls_score[topk_inds]\n\n bboxes = self.bbox_coder.decode(anchors, bbox_pred)\n mlvl_bboxes.append(bboxes)\n mlvl_scores.append(scores)\n mlvl_dir_scores.append(dir_cls_score)\n\n mlvl_bboxes = torch.cat(mlvl_bboxes)\n mlvl_bboxes_for_nms = xywhr2xyxyr(input_meta['box_type_3d'](\n mlvl_bboxes, box_dim=self.box_code_size).bev)\n mlvl_scores = torch.cat(mlvl_scores)\n mlvl_dir_scores = torch.cat(mlvl_dir_scores)\n\n if self.use_sigmoid_cls:\n # Add a dummy background class to the front when using sigmoid\n padding = mlvl_scores.new_zeros(mlvl_scores.shape[0], 1)\n mlvl_scores = torch.cat([mlvl_scores, padding], dim=1)\n\n score_thr = cfg.get('score_thr', 0)\n results = box3d_multiclass_nms(mlvl_bboxes, mlvl_bboxes_for_nms,\n mlvl_scores, score_thr, cfg.max_num,\n cfg, mlvl_dir_scores)\n bboxes, scores, labels, dir_scores = results\n if bboxes.shape[0] > 0:\n dir_rot = limit_period(bboxes[..., 6] - self.dir_offset,\n self.dir_limit_offset, np.pi)\n bboxes[..., 6] = (\n dir_rot + self.dir_offset +\n np.pi * dir_scores.to(bboxes.dtype))\n bboxes = input_meta['box_type_3d'](bboxes, box_dim=self.box_code_size)\n return bboxes, scores, labels\n", "import numpy as np\nimport torch\nfrom abc import abstractmethod\n\nfrom mmdet3d.ops.iou3d import iou3d_cuda\nfrom .utils import limit_period, xywhr2xyxyr\n\n\nclass BaseInstance3DBoxes(object):\n \"\"\"Base class for 3D Boxes.\n\n Note:\n The box is bottom centered, i.e. the relative position of origin in\n the box is (0.5, 0.5, 0).\n\n Args:\n tensor (torch.Tensor | np.ndarray | list): a N x box_dim matrix.\n box_dim (int): Number of the dimension of a box.\n Each row is (x, y, z, x_size, y_size, z_size, yaw).\n Default to 7.\n with_yaw (bool): Whether the box is with yaw rotation.\n If False, the value of yaw will be set to 0 as minmax boxes.\n Default to True.\n origin (tuple[float]): The relative position of origin in the box.\n Default to (0.5, 0.5, 0). This will guide the box be converted to\n (0.5, 0.5, 0) mode.\n\n Attributes:\n tensor (torch.Tensor): Float matrix of N x box_dim.\n box_dim (int): Integer indicating the dimension of a box.\n Each row is (x, y, z, x_size, y_size, z_size, yaw, ...).\n with_yaw (bool): If True, the value of yaw will be set to 0 as minmax\n boxes.\n \"\"\"\n\n def __init__(self, tensor, box_dim=7, with_yaw=True, origin=(0.5, 0.5, 0)):\n if isinstance(tensor, torch.Tensor):\n device = tensor.device\n else:\n device = torch.device('cpu')\n tensor = torch.as_tensor(tensor, dtype=torch.float32, device=device)\n if tensor.numel() == 0:\n # Use reshape, so we don't end up creating a new tensor that\n # does not depend on the inputs (and consequently confuses jit)\n tensor = tensor.reshape((0, box_dim)).to(\n dtype=torch.float32, device=device)\n assert tensor.dim() == 2 and tensor.size(-1) == box_dim, tensor.size()\n\n if tensor.shape[-1] == 6:\n # If the dimension of boxes is 6, we expand box_dim by padding\n # 0 as a fake yaw and set with_yaw to False.\n assert box_dim == 6\n fake_rot = tensor.new_zeros(tensor.shape[0], 1)\n tensor = torch.cat((tensor, fake_rot), dim=-1)\n self.box_dim = box_dim + 1\n self.with_yaw = False\n else:\n self.box_dim = box_dim\n self.with_yaw = with_yaw\n self.tensor = tensor.clone()\n\n if origin != (0.5, 0.5, 0):\n dst = self.tensor.new_tensor((0.5, 0.5, 0))\n src = self.tensor.new_tensor(origin)\n self.tensor[:, :3] += self.tensor[:, 3:6] * (dst - src)\n\n @property\n def volume(self):\n \"\"\"torch.Tensor: A vector with volume of each box.\"\"\"\n return self.tensor[:, 3] * self.tensor[:, 4] * self.tensor[:, 5]\n\n @property\n def dims(self):\n \"\"\"torch.Tensor: Corners of each box with size (N, 8, 3).\"\"\"\n return self.tensor[:, 3:6]\n\n @property\n def yaw(self):\n \"\"\"torch.Tensor: A vector with yaw of each box.\"\"\"\n return self.tensor[:, 6]\n\n @property\n def height(self):\n \"\"\"torch.Tensor: A vector with height of each box.\"\"\"\n return self.tensor[:, 5]\n\n @property\n def top_height(self):\n \"\"\"torch.Tensor: A vector with the top height of each box.\"\"\"\n return self.bottom_height + self.height\n\n @property\n def bottom_height(self):\n \"\"\"torch.Tensor: A vector with bottom's height of each box.\"\"\"\n return self.tensor[:, 2]\n\n @property\n def center(self):\n \"\"\"Calculate the center of all the boxes.\n\n Note:\n In the MMDetection3D's convention, the bottom center is\n usually taken as the default center.\n\n The relative position of the centers in different kinds of\n boxes are different, e.g., the relative center of a boxes is\n (0.5, 1.0, 0.5) in camera and (0.5, 0.5, 0) in lidar.\n It is recommended to use ``bottom_center`` or ``gravity_center``\n for more clear usage.\n\n Returns:\n torch.Tensor: A tensor with center of each box.\n \"\"\"\n return self.bottom_center\n\n @property\n def bottom_center(self):\n \"\"\"torch.Tensor: A tensor with center of each box.\"\"\"\n return self.tensor[:, :3]\n\n @property\n def gravity_center(self):\n \"\"\"torch.Tensor: A tensor with center of each box.\"\"\"\n pass\n\n @property\n def corners(self):\n \"\"\"torch.Tensor: a tensor with 8 corners of each box.\"\"\"\n pass\n\n @abstractmethod\n def rotate(self, angle, points=None):\n \"\"\"Rotate boxes with points (optional) with the given angle or \\\n rotation matrix.\n\n Args:\n angle (float | torch.Tensor | np.ndarray):\n Rotation angle or rotation matrix.\n points (torch.Tensor, numpy.ndarray, :obj:`BasePoints`, optional):\n Points to rotate. Defaults to None.\n \"\"\"\n pass\n\n @abstractmethod\n def flip(self, bev_direction='horizontal'):\n \"\"\"Flip the boxes in BEV along given BEV direction.\"\"\"\n pass\n\n def translate(self, trans_vector):\n \"\"\"Translate boxes with the given translation vector.\n\n Args:\n trans_vector (torch.Tensor): Translation vector of size 1x3.\n \"\"\"\n if not isinstance(trans_vector, torch.Tensor):\n trans_vector = self.tensor.new_tensor(trans_vector)\n self.tensor[:, :3] += trans_vector\n\n def in_range_3d(self, box_range):\n \"\"\"Check whether the boxes are in the given range.\n\n Args:\n box_range (list | torch.Tensor): The range of box\n (x_min, y_min, z_min, x_max, y_max, z_max)\n\n Note:\n In the original implementation of SECOND, checking whether\n a box in the range checks whether the points are in a convex\n polygon, we try to reduce the burden for simpler cases.\n\n Returns:\n torch.Tensor: A binary vector indicating whether each box is \\\n inside the reference range.\n \"\"\"\n in_range_flags = ((self.tensor[:, 0] > box_range[0])\n & (self.tensor[:, 1] > box_range[1])\n & (self.tensor[:, 2] > box_range[2])\n & (self.tensor[:, 0] < box_range[3])\n & (self.tensor[:, 1] < box_range[4])\n & (self.tensor[:, 2] < box_range[5]))\n return in_range_flags\n\n @abstractmethod\n def in_range_bev(self, box_range):\n \"\"\"Check whether the boxes are in the given range.\n\n Args:\n box_range (list | torch.Tensor): The range of box\n in order of (x_min, y_min, x_max, y_max).\n\n Returns:\n torch.Tensor: Indicating whether each box is inside \\\n the reference range.\n \"\"\"\n pass\n\n @abstractmethod\n def convert_to(self, dst, rt_mat=None):\n \"\"\"Convert self to ``dst`` mode.\n\n Args:\n dst (:obj:`Box3DMode`): The target Box mode.\n rt_mat (np.ndarray | torch.Tensor): The rotation and translation\n matrix between different coordinates. Defaults to None.\n The conversion from `src` coordinates to `dst` coordinates\n usually comes along the change of sensors, e.g., from camera\n to LiDAR. This requires a transformation matrix.\n\n Returns:\n :obj:`BaseInstance3DBoxes`: The converted box of the same type \\\n in the `dst` mode.\n \"\"\"\n pass\n\n def scale(self, scale_factor):\n \"\"\"Scale the box with horizontal and vertical scaling factors.\n\n Args:\n scale_factors (float): Scale factors to scale the boxes.\n \"\"\"\n self.tensor[:, :6] *= scale_factor\n self.tensor[:, 7:] *= scale_factor\n\n def limit_yaw(self, offset=0.5, period=np.pi):\n \"\"\"Limit the yaw to a given period and offset.\n\n Args:\n offset (float): The offset of the yaw.\n period (float): The expected period.\n \"\"\"\n self.tensor[:, 6] = limit_period(self.tensor[:, 6], offset, period)\n\n def nonempty(self, threshold: float = 0.0):\n \"\"\"Find boxes that are non-empty.\n\n A box is considered empty,\n if either of its side is no larger than threshold.\n\n Args:\n threshold (float): The threshold of minimal sizes.\n\n Returns:\n torch.Tensor: A binary vector which represents whether each \\\n box is empty (False) or non-empty (True).\n \"\"\"\n box = self.tensor\n size_x = box[..., 3]\n size_y = box[..., 4]\n size_z = box[..., 5]\n keep = ((size_x > threshold)\n & (size_y > threshold) & (size_z > threshold))\n return keep\n\n def __getitem__(self, item):\n \"\"\"\n Note:\n The following usage are allowed:\n 1. `new_boxes = boxes[3]`:\n return a `Boxes` that contains only one box.\n 2. `new_boxes = boxes[2:10]`:\n return a slice of boxes.\n 3. `new_boxes = boxes[vector]`:\n where vector is a torch.BoolTensor with `length = len(boxes)`.\n Nonzero elements in the vector will be selected.\n Note that the returned Boxes might share storage with this Boxes,\n subject to Pytorch's indexing semantics.\n\n Returns:\n :obj:`BaseInstance3DBoxes`: A new object of \\\n :class:`BaseInstances3DBoxes` after indexing.\n \"\"\"\n original_type = type(self)\n if isinstance(item, int):\n return original_type(\n self.tensor[item].view(1, -1),\n box_dim=self.box_dim,\n with_yaw=self.with_yaw)\n b = self.tensor[item]\n assert b.dim() == 2, \\\n f'Indexing on Boxes with {item} failed to return a matrix!'\n return original_type(b, box_dim=self.box_dim, with_yaw=self.with_yaw)\n\n def __len__(self):\n \"\"\"int: Number of boxes in the current object.\"\"\"\n return self.tensor.shape[0]\n\n def __repr__(self):\n \"\"\"str: Return a strings that describes the object.\"\"\"\n return self.__class__.__name__ + '(\\n ' + str(self.tensor) + ')'\n\n @classmethod\n def cat(cls, boxes_list):\n \"\"\"Concatenate a list of Boxes into a single Boxes.\n\n Args:\n boxes_list (list[:obj:`BaseInstance3DBoxes`]): List of boxes.\n\n Returns:\n :obj:`BaseInstance3DBoxes`: The concatenated Boxes.\n \"\"\"\n assert isinstance(boxes_list, (list, tuple))\n if len(boxes_list) == 0:\n return cls(torch.empty(0))\n assert all(isinstance(box, cls) for box in boxes_list)\n\n # use torch.cat (v.s. layers.cat)\n # so the returned boxes never share storage with input\n cat_boxes = cls(\n torch.cat([b.tensor for b in boxes_list], dim=0),\n box_dim=boxes_list[0].tensor.shape[1],\n with_yaw=boxes_list[0].with_yaw)\n return cat_boxes\n\n def to(self, device):\n \"\"\"Convert current boxes to a specific device.\n\n Args:\n device (str | :obj:`torch.device`): The name of the device.\n\n Returns:\n :obj:`BaseInstance3DBoxes`: A new boxes object on the \\\n specific device.\n \"\"\"\n original_type = type(self)\n return original_type(\n self.tensor.to(device),\n box_dim=self.box_dim,\n with_yaw=self.with_yaw)\n\n def clone(self):\n \"\"\"Clone the Boxes.\n\n Returns:\n :obj:`BaseInstance3DBoxes`: Box object with the same properties \\\n as self.\n \"\"\"\n original_type = type(self)\n return original_type(\n self.tensor.clone(), box_dim=self.box_dim, with_yaw=self.with_yaw)\n\n @property\n def device(self):\n \"\"\"str: The device of the boxes are on.\"\"\"\n return self.tensor.device\n\n def __iter__(self):\n \"\"\"Yield a box as a Tensor of shape (4,) at a time.\n\n Returns:\n torch.Tensor: A box of shape (4,).\n \"\"\"\n yield from self.tensor\n\n @classmethod\n def height_overlaps(cls, boxes1, boxes2, mode='iou'):\n \"\"\"Calculate height overlaps of two boxes.\n\n Note:\n This function calculates the height overlaps between boxes1 and\n boxes2, boxes1 and boxes2 should be in the same type.\n\n Args:\n boxes1 (:obj:`BaseInstance3DBoxes`): Boxes 1 contain N boxes.\n boxes2 (:obj:`BaseInstance3DBoxes`): Boxes 2 contain M boxes.\n mode (str, optional): Mode of iou calculation. Defaults to 'iou'.\n\n Returns:\n torch.Tensor: Calculated iou of boxes.\n \"\"\"\n assert isinstance(boxes1, BaseInstance3DBoxes)\n assert isinstance(boxes2, BaseInstance3DBoxes)\n assert type(boxes1) == type(boxes2), '\"boxes1\" and \"boxes2\" should' \\\n f'be in the same type, got {type(boxes1)} and {type(boxes2)}.'\n\n boxes1_top_height = boxes1.top_height.view(-1, 1)\n boxes1_bottom_height = boxes1.bottom_height.view(-1, 1)\n boxes2_top_height = boxes2.top_height.view(1, -1)\n boxes2_bottom_height = boxes2.bottom_height.view(1, -1)\n\n heighest_of_bottom = torch.max(boxes1_bottom_height,\n boxes2_bottom_height)\n lowest_of_top = torch.min(boxes1_top_height, boxes2_top_height)\n overlaps_h = torch.clamp(lowest_of_top - heighest_of_bottom, min=0)\n return overlaps_h\n\n @classmethod\n def overlaps(cls, boxes1, boxes2, mode='iou'):\n \"\"\"Calculate 3D overlaps of two boxes.\n\n Note:\n This function calculates the overlaps between ``boxes1`` and\n ``boxes2``, ``boxes1`` and ``boxes2`` should be in the same type.\n\n Args:\n boxes1 (:obj:`BaseInstance3DBoxes`): Boxes 1 contain N boxes.\n boxes2 (:obj:`BaseInstance3DBoxes`): Boxes 2 contain M boxes.\n mode (str, optional): Mode of iou calculation. Defaults to 'iou'.\n\n Returns:\n torch.Tensor: Calculated iou of boxes' heights.\n \"\"\"\n assert isinstance(boxes1, BaseInstance3DBoxes)\n assert isinstance(boxes2, BaseInstance3DBoxes)\n assert type(boxes1) == type(boxes2), '\"boxes1\" and \"boxes2\" should' \\\n f'be in the same type, got {type(boxes1)} and {type(boxes2)}.'\n\n assert mode in ['iou', 'iof']\n\n rows = len(boxes1)\n cols = len(boxes2)\n if rows * cols == 0:\n return boxes1.tensor.new(rows, cols)\n\n # height overlap\n overlaps_h = cls.height_overlaps(boxes1, boxes2)\n\n # obtain BEV boxes in XYXYR format\n boxes1_bev = xywhr2xyxyr(boxes1.bev)\n boxes2_bev = xywhr2xyxyr(boxes2.bev)\n\n # bev overlap\n overlaps_bev = boxes1_bev.new_zeros(\n (boxes1_bev.shape[0], boxes2_bev.shape[0])).cuda() # (N, M)\n iou3d_cuda.boxes_overlap_bev_gpu(boxes1_bev.contiguous().cuda(),\n boxes2_bev.contiguous().cuda(),\n overlaps_bev)\n\n # 3d overlaps\n overlaps_3d = overlaps_bev.to(boxes1.device) * overlaps_h\n\n volume1 = boxes1.volume.view(-1, 1)\n volume2 = boxes2.volume.view(1, -1)\n\n if mode == 'iou':\n # the clamp func is used to avoid division of 0\n iou3d = overlaps_3d / torch.clamp(\n volume1 + volume2 - overlaps_3d, min=1e-8)\n else:\n iou3d = overlaps_3d / torch.clamp(volume1, min=1e-8)\n\n return iou3d\n\n def new_box(self, data):\n \"\"\"Create a new box object with data.\n\n The new box and its tensor has the similar properties \\\n as self and self.tensor, respectively.\n\n Args:\n data (torch.Tensor | numpy.array | list): Data to be copied.\n\n Returns:\n :obj:`BaseInstance3DBoxes`: A new bbox object with ``data``, \\\n the object's other properties are similar to ``self``.\n \"\"\"\n new_tensor = self.tensor.new_tensor(data) \\\n if not isinstance(data, torch.Tensor) else data.to(self.device)\n original_type = type(self)\n return original_type(\n new_tensor, box_dim=self.box_dim, with_yaw=self.with_yaw)\n" ]
[ [ "torch.clamp", "torch.zeros_like", "torch.floor", "torch.cat" ], [ "torch.nn.Sequential", "torch.abs", "torch.norm", "torch.nn.Dropout", "torch.full", "torch.cat", "torch.clamp" ], [ "torch.nn.Sequential", "torch.max", "torch.cat", "torch.nn.ModuleList", "torch.nn.Conv2d", "torch.tensor" ], [ "torch.max", "torch.empty", "torch.cat", "torch.min", "torch.device", "torch.clamp", "torch.as_tensor" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
jaimesouza/devito
[ "aa85166f8ea4924498d3bb143b6d40ff5e97e97a" ]
[ "devito/types/basic.py" ]
[ "import abc\nfrom collections import namedtuple\nfrom ctypes import POINTER, Structure, byref\nfrom functools import reduce\nfrom operator import mul\n\nimport numpy as np\nimport sympy\nfrom sympy.core.assumptions import _assume_rules\nfrom cached_property import cached_property\nfrom cgen import Struct, Value\n\nfrom devito.data import default_allocator\nfrom devito.symbolics import aligned_indices\nfrom devito.tools import (Pickable, ctypes_to_cstr, dtype_to_cstr, dtype_to_ctype,\n frozendict, memoized_meth)\nfrom devito.types.args import ArgProvider\nfrom devito.types.caching import Cached\nfrom devito.types.lazy import Evaluable\nfrom devito.types.utils import DimensionTuple\n\n__all__ = ['Symbol', 'Scalar', 'Indexed', 'Object', 'LocalObject', 'CompositeObject']\n\n\nSize = namedtuple('Size', 'left right')\nOffset = namedtuple('Offset', 'left right')\n\n\nclass Basic(object):\n\n \"\"\"\n Three relevant types inherit from this class:\n\n * AbstractSymbol: represents a scalar; may carry data; may be used\n to build equations.\n * AbstractFunction: represents a discrete R^n -> R function; may\n carry data; may be used to build equations.\n * AbstractTensor: represents a discrete 2nd order tensor or vector:\n R^n -> R^(nd x nd) tensor (nd dimensions),\n R^n -> R^nd vector (nd dimensions),\n may carry data; may be used to build equations.\n * AbstractObject: represents a generic object, for example a (pointer\n to) data structure.\n\n Basic\n |\n --------------------------------------------------------------\n | | | |\n AbstractSymbol AbstractFunction AbstractTensor AbstractObject\n\n All these subtypes must implement a number of methods/properties to enable\n code generation via the Devito compiler. These methods/properties are\n easily recognizable as their name starts with _C_.\n\n Notes\n -----\n The AbstractFunction sub-hierarchy is implemented in :mod:`dense.py`.\n The AbstractTensor sub-hierarchy is implemented in :mod:`tensor.py`.\n \"\"\"\n\n # Top hierarchy\n is_AbstractFunction = False\n is_AbstractSymbol = False\n is_AbstractObject = False\n\n # Symbolic objects created internally by Devito\n is_Symbol = False\n is_ArrayBasic = False\n is_Array = False\n is_PointerArray = False\n is_Object = False\n is_LocalObject = False\n\n # Created by the user\n is_Input = False\n\n # Scalar symbolic objects created by the user\n is_Dimension = False\n is_Constant = False\n\n # Tensor symbolic objects created by the user\n is_DiscreteFunction = False\n is_Function = False\n is_TimeFunction = False\n is_SparseTimeFunction = False\n is_SparseFunction = False\n is_PrecomputedSparseFunction = False\n is_PrecomputedSparseTimeFunction = False\n\n # Time dependence\n is_TimeDependent = False\n\n # Tensor and Vector valued objects\n is_VectorValued = False\n is_TensorValued = False\n\n # Basic symbolic object properties\n is_Scalar = False\n is_Tensor = False\n\n # Some other properties\n is_PerfKnob = False # Does it impact the Operator performance?\n\n @abc.abstractmethod\n def __init__(self, *args, **kwargs):\n return\n\n @abc.abstractproperty\n def _C_name(self):\n \"\"\"\n The C-level name of the object.\n\n Returns\n -------\n str\n \"\"\"\n return\n\n @abc.abstractproperty\n def _C_typename(self):\n \"\"\"\n The C-level type of the object.\n\n Returns\n -------\n str\n \"\"\"\n return\n\n @abc.abstractproperty\n def _C_typedata(self):\n \"\"\"\n The C-level type of the data values.\n\n Returns\n -------\n str\n \"\"\"\n return\n\n @abc.abstractproperty\n def _C_ctype(self):\n \"\"\"\n The C-level type of the object, as a ctypes object, suitable for type\n checking when calling functions via ctypes.\n\n Returns\n -------\n ctypes type\n \"\"\"\n return\n\n @property\n def _C_typedecl(self):\n \"\"\"\n The C-level struct declaration representing the object.\n\n Returns\n -------\n cgen.Struct or None\n None if the object C type can be expressed with a basic C type,\n such as float or int.\n \"\"\"\n return\n\n\nclass AbstractSymbol(sympy.Symbol, Basic, Pickable, Evaluable):\n\n \"\"\"\n Base class for scalar symbols.\n\n The hierarchy is structured as follows\n\n AbstractSymbol\n |\n -------------------------------------\n | |\n DataSymbol Symbol\n | |\n ---------------- -------------------\n | | | |\n Constant DefaultDimension Scalar Dimension\n <:mod:`dimension.py`>\n\n All symbols can be used to build equations. However, while DataSymbol\n carries data, Symbol is a pure symbolic object.\n\n Constant, DefaultDimension, and Dimension (and most of its subclasses) are\n part of the user API; Scalar, instead, is only used internally by Devito.\n\n DefaultDimension and Dimension define a problem dimension (in other words,\n an \"iteration space\"). They can be used to index into Functions. For more\n information, refer to :mod:`dimension.py`.\n \"\"\"\n\n is_AbstractSymbol = True\n is_Symbol = True\n\n # SymPy default assumptions\n is_real = True\n is_imaginary = False\n is_commutative = True\n\n @classmethod\n def _filter_assumptions(cls, **kwargs):\n \"\"\"Extract sympy.Symbol-specific kwargs.\"\"\"\n assumptions = {}\n for i in list(kwargs):\n if i in _assume_rules.defined_facts:\n assumptions[i] = kwargs.pop(i)\n return assumptions, kwargs\n\n def __new__(cls, *args, **kwargs):\n name = kwargs.get('name') or args[0]\n assumptions, kwargs = cls._filter_assumptions(**kwargs)\n\n # Create the new Symbol\n # Note: use __xnew__ to bypass sympy caching\n newobj = sympy.Symbol.__xnew__(cls, name, **assumptions)\n\n # Initialization\n newobj._dtype = cls.__dtype_setup__(**kwargs)\n newobj.__init_finalize__(*args, **kwargs)\n\n return newobj\n\n @classmethod\n def __dtype_setup__(cls, **kwargs):\n \"\"\"Extract the object data type from ``kwargs``.\"\"\"\n return kwargs.get('dtype', np.int32)\n\n def __init__(self, *args, **kwargs):\n # no-op, the true init is performed by __init_finalize__\n pass\n\n def __init_finalize__(self, *args, **kwargs):\n self._is_const = kwargs.get('is_const', False)\n\n @property\n def dtype(self):\n \"\"\"The data type of the object.\"\"\"\n return self._dtype\n\n @property\n def indices(self):\n return ()\n\n @property\n def dimensions(self):\n return self.indices\n\n @property\n def shape(self):\n return ()\n\n @property\n def ndim(self):\n return 0\n\n @property\n def symbolic_shape(self):\n return ()\n\n @property\n def base(self):\n return self\n\n @property\n def function(self):\n return self\n\n @property\n def evaluate(self):\n return self\n\n def indexify(self):\n return self\n\n @property\n def is_const(self):\n \"\"\"\n True if the symbol value cannot be modified within an Operator (and thus\n its value is provided by the user directly from Python-land), False otherwise.\n \"\"\"\n return self._is_const\n\n @property\n def _C_name(self):\n return self.name\n\n @property\n def _C_typename(self):\n return '%s%s' % ('const ' if self.is_const else '',\n dtype_to_cstr(self.dtype))\n\n @property\n def _C_typedata(self):\n return dtype_to_cstr(self.dtype)\n\n @property\n def _C_ctype(self):\n return dtype_to_ctype(self.dtype)\n\n def _subs(self, old, new, **hints):\n \"\"\"\n This stub allows sympy.Basic.subs to operate on an expression\n involving devito Scalars. Ordinarily the comparisons between\n devito subclasses of sympy types are quite strict.\n \"\"\"\n try:\n if old.name == self.name:\n return new\n except AttributeError:\n pass\n\n return self\n\n # Pickling support\n _pickle_args = []\n _pickle_kwargs = ['name', 'dtype', 'is_const']\n __reduce_ex__ = Pickable.__reduce_ex__\n\n\nclass Symbol(AbstractSymbol, Cached):\n\n \"\"\"\n A scalar symbol, cached by both Devito and SymPy, which does not carry\n any data.\n\n Notes\n -----\n A Symbol may not be in the SymPy cache, but still be present in the\n Devito cache. This is because SymPy caches operations, rather than\n actual objects.\n \"\"\"\n\n @classmethod\n def _cache_key(cls, *args, **kwargs):\n args = list(args)\n key = {}\n\n # The base type is necessary, otherwise two objects such as\n # `Scalar(name='s')` and `Dimension(name='s')` would have the same key\n key['cls'] = cls\n\n # The name is always present, and added as if it were an arg\n key['name'] = kwargs.pop('name', None) or args.pop(0)\n\n # From the args\n key['args'] = tuple(args)\n\n # From the kwargs\n key.update(kwargs)\n\n return frozendict(key)\n\n def __new__(cls, *args, **kwargs):\n key = cls._cache_key(*args, **kwargs)\n obj = cls._cache_get(key)\n\n if obj is not None:\n return obj\n\n # Not in cache. Create a new Symbol via sympy.Symbol\n name = kwargs.get('name') or args[0]\n assumptions, kwargs = cls._filter_assumptions(**kwargs)\n\n # Note: use __xnew__ to bypass sympy caching\n newobj = sympy.Symbol.__xnew__(cls, name, **assumptions)\n\n # Initialization\n newobj._dtype = cls.__dtype_setup__(**kwargs)\n newobj.__init_finalize__(*args, **kwargs)\n\n # Store new instance in symbol cache\n Cached.__init__(newobj, key)\n\n return newobj\n\n __hash__ = Cached.__hash__\n\n\nclass DataSymbol(AbstractSymbol, Cached):\n\n \"\"\"\n A scalar symbol, cached by both Devito and SymPy, which carries data.\n \"\"\"\n\n @classmethod\n def _cache_key(cls, *args, **kwargs):\n return cls\n\n def __new__(cls, *args, **kwargs):\n key = cls._cache_key(*args, **kwargs)\n obj = cls._cache_get(key)\n\n if obj is not None:\n return obj\n\n # Not in cache. Create a new Symbol via sympy.Symbol\n name = kwargs.get('name') or args[0]\n assumptions, kwargs = cls._filter_assumptions(**kwargs)\n\n # Create new, unique type instance from cls and the symbol name\n newcls = type(name, (cls,), dict(cls.__dict__))\n\n # Create the new Symbol and invoke __init__\n newobj = sympy.Symbol.__new__(newcls, name, **assumptions)\n\n # Initialization\n newobj._dtype = cls.__dtype_setup__(**kwargs)\n newobj.__init_finalize__(*args, **kwargs)\n\n # Store new instance in symbol cache\n Cached.__init__(newobj, newcls)\n\n return newobj\n\n __hash__ = Cached.__hash__\n\n # Pickling support\n\n @property\n def _pickle_reconstruct(self):\n return self.__class__.__base__\n\n\nclass Scalar(Symbol, ArgProvider):\n\n \"\"\"\n Like a Symbol, but in addition it can pass runtime values to an Operator.\n\n Parameters\n ----------\n name : str\n Name of the symbol.\n dtype : data-type, optional\n Any object that can be interpreted as a numpy data type. Defaults\n to ``np.float32``.\n is_const : bool, optional\n True if the symbol value cannot be modified within an Operator,\n False otherwise. Defaults to False.\n **assumptions\n Any SymPy assumptions, such as ``nonnegative=True``. Refer to the\n SymPy documentation for more information.\n \"\"\"\n\n is_Scalar = True\n\n @classmethod\n def __dtype_setup__(cls, **kwargs):\n return kwargs.get('dtype', np.float32)\n\n\nclass AbstractTensor(sympy.ImmutableDenseMatrix, Basic, Pickable, Evaluable):\n \"\"\"\n Base class for vector and tensor valued functions. It inherits from and\n mimicks the behavior of a sympy.ImmutableDenseMatrix.\n\n\n The sub-hierachy is as follows\n\n AbstractTensor\n |\n TensorFunction\n |\n ---------------------------------\n | |\n VectorFunction TensorTimeFunction\n \\-------\\ |\n \\------- VectorTimeFunction\n\n There are four relevant AbstractTensor sub-types: ::\n\n * TensorFunction: A space-varying tensor valued function.\n * VectorFunction: A space-varying vector valued function.\n * TensorTimeFunction: A time-space-varying tensor valued function.\n * VectorTimeFunction: A time-space-varying vector valued function.\n \"\"\"\n\n # Sympy attributes\n is_MatrixLike = True\n is_Matrix = True\n\n # Devito attributes\n is_AbstractTensor = True\n is_TensorValued = True\n is_VectorValued = False\n\n @classmethod\n def _new(cls, *args, **kwargs):\n if args:\n try:\n # Constructor if input is (rows, cols, lambda)\n newobj = super(AbstractTensor, cls)._new(*args)\n except ValueError:\n # Constructor if input is list of list as (row, cols, list_of_list)\n # doesn't work as it expects a flattened.\n newobj = super(AbstractTensor, cls)._new(args[2])\n\n # Filter grid and dimensions\n grids = {getattr(c, 'grid', None) for c in newobj._mat} - {None}\n dimensions = {d for c in newobj._mat\n for d in getattr(c, 'dimensions', ())} - {None}\n # If none of the components are devito objects, returns a sympy Matrix\n if len(grids) == 0 and len(dimensions) == 0:\n return sympy.ImmutableDenseMatrix(*args)\n elif len(grids) > 0:\n dimensions = None\n assert len(grids) == 1\n grid = grids.pop()\n else:\n grid = None\n dimensions = tuple(dimensions)\n\n # Initialized with constructed object\n newobj.__init_finalize__(newobj.rows, newobj.cols, newobj._mat,\n grid=grid, dimensions=dimensions)\n else:\n # Initialize components and create new Matrix from standard\n # Devito inputs\n comps = cls.__subfunc_setup__(*args, **kwargs)\n newobj = super(AbstractTensor, cls)._new(comps)\n newobj.__init_finalize__(*args, **kwargs)\n\n return newobj\n\n def __init_finalize__(self, *args, **kwargs):\n pass\n\n __hash__ = sympy.ImmutableDenseMatrix.__hash__\n\n def doit(self, **hint):\n return self\n\n def _eval_matrix_mul(self, other):\n \"\"\"\n Copy paste from sympy to avoid explicit call to sympy.Add\n TODO: fix inside sympy\n \"\"\"\n other_len = other.rows*other.cols\n new_len = self.rows*other.cols\n new_mat = [self.zero]*new_len\n\n # If we multiply an n x 0 with a 0 x m, the\n # expected behavior is to produce an n x m matrix of zeros\n if self.cols != 0 and other.rows != 0:\n self_cols = self.cols\n mat = self._mat\n other_mat = other._mat\n for i in range(new_len):\n row, col = i // other.cols, i % other.cols\n row_indices = range(self_cols*row, self_cols*(row+1))\n col_indices = range(col, other_len, other.cols)\n vec = [mat[a]*other_mat[b] for a, b in zip(row_indices, col_indices)]\n new_mat[i] = sum(vec)\n\n # Get new class and return product\n newcls = self.classof_prod(other, new_mat)\n return newcls._new(self.rows, other.cols, new_mat, copy=False)\n\n @classmethod\n def __subfunc_setup__(cls, *args, **kwargs):\n \"\"\"Setup each component of the tensor as a Devito type.\"\"\"\n return []\n\n\nclass AbstractFunction(sympy.Function, Basic, Cached, Pickable, Evaluable):\n \"\"\"\n Base class for tensor symbols, cached by both SymPy and Devito. It inherits\n from and mimicks the behaviour of a sympy.Function.\n\n The hierarchy is structured as follows\n\n AbstractFunction\n |\n ---------------------------------\n | |\n DiscreteFunction Array\n |\n ----------------------------------------\n | |\n | AbstractSparseFunction\n | |\n | -----------------------------------------------------\n | | | |\n Function SparseFunction AbstractSparseTimeFunction PrecomputedSparseFunction\n | | | |\n | | ------------------------------------ --------\n | | | | |\n TimeFunction SparseTimeFunction PrecomputedSparseTimeFunction\n\n There are five relevant AbstractFunction sub-types: ::\n\n * Array: A function that does not carry data.\n * Function: A space-varying discrete function, which carries user data.\n * TimeFunction: A time- and space-varying discrete function, which carries\n user data.\n * SparseFunction: A space-varying discrete function representing \"sparse\"\n points, i.e. points that are not aligned with the\n computational grid.\n * SparseTimeFunction: A time- and space-varying function representing \"sparse\"\n points, i.e. points that are not aligned with the\n computational grid.\n * PrecomputedSparseFunction: A SparseFunction that uses a custom interpolation\n scheme, instead of linear interpolators.\n * PrecomputedSparseTimeFunction: A SparseTimeFunction that uses a custom\n interpolation scheme, instead of linear\n interpolators.\n\n \"\"\"\n # Sympy attributes, explicitly say these are not Matrices\n is_MatrixLike = False\n is_Matrix = False\n\n is_AbstractFunction = True\n\n # SymPy default assumptions\n is_real = True\n is_imaginary = False\n is_commutative = True\n\n @classmethod\n def _cache_key(cls, *args, **kwargs):\n return cls, args\n\n def __new__(cls, *args, **kwargs):\n options = kwargs.get('options', {'evaluate': False})\n\n # Is the object already in cache (e.g., f(x), f(x+1)) ?\n key = cls._cache_key(*args, **kwargs)\n obj = cls._cache_get(key)\n if obj is not None:\n return obj\n\n # Does the base object exist at least (e.g. f(x))?\n obj = cls._cache_get(cls)\n if obj is not None:\n newobj = sympy.Function.__new__(cls, *args, **options)\n newobj.__init_cached__(cls)\n Cached.__init__(newobj, key)\n return newobj\n\n # Preprocess arguments\n args, kwargs = cls.__args_setup__(*args, **kwargs)\n\n # Not in cache. Create a new Function via sympy.Function\n name = kwargs.get('name')\n dimensions, indices = cls.__indices_setup__(**kwargs)\n\n # Create new, unique type instance from cls and the symbol name\n newcls = type(name, (cls,), dict(cls.__dict__))\n\n # Create the new Function object and invoke __init__\n newobj = sympy.Function.__new__(newcls, *indices, **options)\n\n # Initialization. The following attributes must be available\n # when executing __init_finalize__\n newobj._name = name\n newobj._dimensions = dimensions\n newobj._shape = cls.__shape_setup__(**kwargs)\n newobj._dtype = cls.__dtype_setup__(**kwargs)\n newobj.__init_finalize__(*args, **kwargs)\n\n # All objects cached on the AbstractFunction `newobj` keep a reference\n # to `newobj` through the `function` field. Thus, all indexified\n # object will point to `newobj`, the \"actual Function\".\n newobj.function = newobj\n\n # Store new instance in symbol cache\n key = (newcls, indices)\n Cached.__init__(newobj, key, newcls)\n\n return newobj\n\n def __init__(self, *args, **kwargs):\n # no-op, the true init is performed by __init_finalize__\n pass\n\n def __init_finalize__(self, *args, **kwargs):\n # Setup halo and padding regions\n self._is_halo_dirty = False\n self._halo = self.__halo_setup__(**kwargs)\n self._padding = self.__padding_setup__(**kwargs)\n\n __hash__ = Cached.__hash__\n\n @classmethod\n def __args_setup__(cls, *args, **kwargs):\n \"\"\"\n Preprocess *args and **kwargs before object initialization.\n\n Notes\n -----\n This stub is invoked only if a look up in the cache fails.\n \"\"\"\n return args, kwargs\n\n @classmethod\n def __indices_setup__(cls, **kwargs):\n \"\"\"Extract the object indices from ``kwargs``.\"\"\"\n return (), ()\n\n @classmethod\n def __shape_setup__(cls, **kwargs):\n \"\"\"Extract the object shape from ``kwargs``.\"\"\"\n return ()\n\n @classmethod\n def __dtype_setup__(cls, **kwargs):\n \"\"\"Extract the object data type from ``kwargs``.\"\"\"\n return None\n\n def __halo_setup__(self, **kwargs):\n return tuple(kwargs.get('halo', [(0, 0) for i in range(self.ndim)]))\n\n def __padding_setup__(self, **kwargs):\n return tuple(kwargs.get('padding', [(0, 0) for i in range(self.ndim)]))\n\n @cached_property\n def _honors_autopadding(self):\n \"\"\"\n True if the actual padding is greater or equal than whatever autopadding\n would produce, False otherwise.\n \"\"\"\n autopadding = self.__padding_setup__(autopadding=True)\n return all(l0 >= l1 and r0 >= r1\n for (l0, r0), (l1, r1) in zip(self.padding, autopadding))\n\n @property\n def name(self):\n \"\"\"The name of the object.\"\"\"\n return self._name\n\n @property\n def indices(self):\n \"\"\"The indices (aka dimensions) of the object.\"\"\"\n return self.args\n\n @property\n def indices_ref(self):\n \"\"\"The reference indices of the object (indices at first creation).\"\"\"\n return DimensionTuple(*self.function.indices, getters=self.dimensions)\n\n @property\n def origin(self):\n \"\"\"\n Origin of the AbstractFunction in term of Dimension\n f(x) : origin = 0\n f(x + hx/2) : origin = hx/2\n \"\"\"\n return tuple(r - d for d, r in zip(self.dimensions, self.indices_ref))\n\n @property\n def dimensions(self):\n \"\"\"Tuple of Dimensions representing the object indices.\"\"\"\n return self._dimensions\n\n @property\n def _eval_deriv(self):\n return self\n\n @property\n def _is_on_grid(self):\n \"\"\"\n Check whether the object is on the grid and requires averaging.\n For example, if the original non-staggered function is f(x)\n then f(x) is on the grid and f(x + h_x/2) is off the grid.\n \"\"\"\n return self._check_indices(inds=self.indices)\n\n @memoized_meth\n def _check_indices(self, inds=None):\n \"\"\"\n Check if the function indices are aligned with the dimensions.\n \"\"\"\n inds = inds or self.indices\n return all([aligned_indices(i, j, d.spacing) for i, j, d in\n zip(inds, self.indices_ref, self.dimensions)])\n\n @property\n def evaluate(self):\n # Average values if at a location not on the Function's grid\n if self._is_on_grid:\n return self\n weight = 1.0\n avg_list = [self]\n is_averaged = False\n for i, ir, d in zip(self.indices, self.indices_ref, self.dimensions):\n off = (i - ir)/d.spacing\n if not isinstance(off, sympy.Number) or int(off) == off:\n pass\n else:\n weight *= 1/2\n is_averaged = True\n avg_list = [(a.xreplace({i: i - d.spacing/2}) +\n a.xreplace({i: i + d.spacing/2})) for a in avg_list]\n\n if not is_averaged:\n return self\n return weight * sum(avg_list)\n\n @property\n def shape(self):\n \"\"\"The shape of the object.\"\"\"\n return self._shape\n\n @property\n def dtype(self):\n \"\"\"The data type of the object.\"\"\"\n return self._dtype\n\n @property\n def ndim(self):\n \"\"\"The rank of the object.\"\"\"\n return len(self.indices)\n\n @property\n def symbolic_shape(self):\n \"\"\"\n The symbolic shape of the object. This includes the domain, halo, and\n padding regions. While halo and padding are known quantities (integers),\n the domain size is given as a symbol.\n \"\"\"\n halo = [sympy.Add(*i, evaluate=False) for i in self._size_halo]\n padding = [sympy.Add(*i, evaluate=False) for i in self._size_padding]\n domain = [i.symbolic_size for i in self.dimensions]\n ret = tuple(sympy.Add(i, j, k, evaluate=False)\n for i, j, k in zip(domain, halo, padding))\n return DimensionTuple(*ret, getters=self.dimensions)\n\n @cached_property\n def indexed(self):\n \"\"\"The wrapped IndexedData object.\"\"\"\n return IndexedData(self.name, shape=self.shape, function=self.function)\n\n @property\n def _mem_external(self):\n \"\"\"\n True if the associated data was/is/will be allocated directly\n from Python (e.g., via NumPy arrays), False otherwise.\n \"\"\"\n return False\n\n @property\n def _mem_stack(self):\n \"\"\"\n True if the associated data should be allocated on the stack, False otherwise.\n \"\"\"\n return False\n\n @property\n def _mem_heap(self):\n \"\"\"\n True if the associated data was/is/will be allocated on the heap,\n False otherwise.\n \"\"\"\n return False\n\n @property\n def size(self):\n \"\"\"\n The number of elements this object is expected to store in memory.\n Note that this would need to be combined with self.dtype to give the actual\n size in bytes.\n \"\"\"\n return reduce(mul, self.shape)\n\n @property\n def halo(self):\n return self._halo\n\n @property\n def padding(self):\n return self._padding\n\n @property\n def is_const(self):\n return False\n\n @property\n def _C_name(self):\n return \"%s_vec\" % self.name\n\n @property\n def _C_typedata(self):\n return dtype_to_cstr(self.dtype)\n\n @cached_property\n def _size_domain(self):\n \"\"\"Number of points in the domain region.\"\"\"\n return DimensionTuple(*self.shape, getters=self.dimensions)\n\n @cached_property\n def _size_halo(self):\n \"\"\"Number of points in the halo region.\"\"\"\n left = tuple(zip(*self._halo))[0]\n right = tuple(zip(*self._halo))[1]\n\n sizes = tuple(Size(i, j) for i, j in self._halo)\n\n return DimensionTuple(*sizes, getters=self.dimensions, left=left, right=right)\n\n @cached_property\n def _size_owned(self):\n \"\"\"Number of points in the owned region.\"\"\"\n left = tuple(self._size_halo.right)\n right = tuple(self._size_halo.left)\n\n sizes = tuple(Size(i.right, i.left) for i in self._size_halo)\n\n return DimensionTuple(*sizes, getters=self.dimensions, left=left, right=right)\n\n @cached_property\n def _size_padding(self):\n \"\"\"Number of points in the padding region.\"\"\"\n left = tuple(zip(*self._padding))[0]\n right = tuple(zip(*self._padding))[1]\n\n sizes = tuple(Size(i, j) for i, j in self._padding)\n\n return DimensionTuple(*sizes, getters=self.dimensions, left=left, right=right)\n\n @cached_property\n def _size_nopad(self):\n \"\"\"Number of points in the domain+halo region.\"\"\"\n sizes = tuple(i+sum(j) for i, j in zip(self._size_domain, self._size_halo))\n return DimensionTuple(*sizes, getters=self.dimensions)\n\n @cached_property\n def _size_nodomain(self):\n \"\"\"Number of points in the padding+halo region.\"\"\"\n left = tuple(i for i, _ in np.add(self._halo, self._padding))\n right = tuple(i for _, i in np.add(self._halo, self._padding))\n\n sizes = tuple(Size(i, j) for i, j in np.add(self._halo, self._padding))\n\n return DimensionTuple(*sizes, getters=self.dimensions, left=left, right=right)\n\n @cached_property\n def _offset_domain(self):\n \"\"\"Number of points before the first domain element.\"\"\"\n offsets = tuple(np.add(self._size_padding.left, self._size_halo.left))\n return DimensionTuple(*offsets, getters=self.dimensions)\n\n @cached_property\n def _offset_halo(self):\n \"\"\"Number of points before the first and last halo elements.\"\"\"\n left = tuple(self._size_padding.left)\n right = tuple(np.add(np.add(left, self._size_halo.left), self._size_domain))\n\n offsets = tuple(Offset(i, j) for i, j in zip(left, right))\n\n return DimensionTuple(*offsets, getters=self.dimensions, left=left, right=right)\n\n @cached_property\n def _offset_owned(self):\n \"\"\"Number of points before the first and last owned elements.\"\"\"\n left = tuple(self._offset_domain)\n right = tuple(np.add(self._offset_halo.left, self._size_domain))\n\n offsets = tuple(Offset(i, j) for i, j in zip(left, right))\n\n return DimensionTuple(*offsets, getters=self.dimensions, left=left, right=right)\n\n @property\n def _data_alignment(self):\n \"\"\"\n The base virtual address of the data carried by the object is a multiple\n of the alignment.\n \"\"\"\n return default_allocator().guaranteed_alignment\n\n def indexify(self, indices=None, lshift=False, subs=None):\n \"\"\"Create a types.Indexed from the current object.\"\"\"\n if indices is not None:\n return Indexed(self.indexed, *indices)\n\n # Substitution for each index (spacing only used in own dimension)\n subs = subs or {}\n subs = [{**{d.spacing: 1, -d.spacing: -1}, **subs} for d in self.dimensions]\n\n # Add halo shift\n shift = self._size_nodomain.left if lshift else tuple([0]*len(self.dimensions))\n # Indices after substitutions\n indices = [sympy.sympify((a - o + f).xreplace(s)) for a, o, f, s in\n zip(self.args, self.origin, shift, subs)]\n indices = [i.xreplace({k: sympy.Integer(k) for k in i.atoms(sympy.Float)})\n for i in indices]\n return self.indexed[indices]\n\n def __getitem__(self, index):\n \"\"\"Shortcut for ``self.indexed[index]``.\"\"\"\n return self.indexed[index]\n\n # Pickling support\n _pickle_kwargs = ['name', 'dtype', 'halo', 'padding']\n __reduce_ex__ = Pickable.__reduce_ex__\n\n @property\n def _pickle_reconstruct(self):\n return self.__class__.__base__\n\n\n# Objects belonging to the Devito API not involving data, such as data structures\n# that need to be passed to external libraries\n\n\nclass AbstractObject(Basic, sympy.Basic, Pickable):\n\n \"\"\"\n Symbol representing a generic pointer object.\n \"\"\"\n\n is_AbstractObject = True\n\n def __new__(cls, *args, **kwargs):\n obj = sympy.Basic.__new__(cls)\n obj.__init__(*args, **kwargs)\n return obj\n\n def __init__(self, name, dtype):\n self.name = name\n self.dtype = dtype\n\n def __repr__(self):\n return self.name\n\n __str__ = __repr__\n\n def _hashable_content(self):\n return (self.name, self.dtype)\n\n @property\n def free_symbols(self):\n return {self}\n\n @property\n def _C_name(self):\n return self.name\n\n @property\n def _C_typename(self):\n return ctypes_to_cstr(self.dtype)\n\n @property\n def _C_ctype(self):\n return self.dtype\n\n @property\n def function(self):\n return self\n\n # Pickling support\n _pickle_args = ['name', 'dtype']\n __reduce_ex__ = Pickable.__reduce_ex__\n\n\nclass Object(AbstractObject, ArgProvider):\n\n \"\"\"\n Symbol representing a generic pointer object, provided by an outer scope.\n \"\"\"\n\n is_Object = True\n\n def __init__(self, name, dtype, value=None):\n super(Object, self).__init__(name, dtype)\n self.value = value\n\n @property\n def _arg_names(self):\n return (self.name,)\n\n def _arg_defaults(self):\n if callable(self.value):\n return {self.name: self.value()}\n else:\n return {self.name: self.value}\n\n def _arg_values(self, args=None, **kwargs):\n \"\"\"\n Produce runtime values for this Object after evaluating user input.\n\n Parameters\n ----------\n args : dict, optional\n Known argument values.\n **kwargs\n Dictionary of user-provided argument overrides.\n \"\"\"\n if self.name in kwargs:\n return {self.name: kwargs.pop(self.name)}\n else:\n return self._arg_defaults()\n\n\nclass CompositeObject(Object):\n\n \"\"\"\n Symbol representing a pointer to a composite type (e.g., a C struct),\n provided by an outer scope.\n \"\"\"\n\n _dtype_cache = {}\n\n @classmethod\n def _generate_unique_dtype(cls, pname, pfields):\n dtype = POINTER(type(pname, (Structure,), {'_fields_': pfields}))\n key = (pname, tuple(pfields))\n return cls._dtype_cache.setdefault(key, dtype)\n\n def __init__(self, name, pname, pfields, value=None):\n dtype = CompositeObject._generate_unique_dtype(pname, pfields)\n value = self.__value_setup__(dtype, value)\n super(CompositeObject, self).__init__(name, dtype, value)\n\n def __value_setup__(self, dtype, value):\n return value or byref(dtype._type_())\n\n @property\n def pfields(self):\n return tuple(self.dtype._type_._fields_)\n\n @property\n def pname(self):\n return self.dtype._type_.__name__\n\n @property\n def fields(self):\n return [i for i, _ in self.pfields]\n\n def _hashable_content(self):\n return (self.name, self.pfields)\n\n @cached_property\n def _C_typedecl(self):\n return Struct(self.pname, [Value(ctypes_to_cstr(j), i) for i, j in self.pfields])\n\n # Pickling support\n _pickle_args = ['name', 'pname', 'pfields']\n _pickle_kwargs = []\n\n\nclass LocalObject(AbstractObject):\n\n \"\"\"\n Symbol representing a generic pointer object, defined in the local scope.\n \"\"\"\n\n is_LocalObject = True\n\n\n# Extended SymPy hierarchy follows, for essentially two reasons:\n# - To keep track of `function`\n# - To override SymPy caching behaviour\n\n\nclass IndexedData(sympy.IndexedBase, Pickable):\n\n \"\"\"\n Wrapper class that inserts a pointer to the symbolic data object.\n \"\"\"\n\n def __new__(cls, label, shape=None, function=None):\n # Make sure `label` is a devito.Symbol, not a sympy.Symbol\n if isinstance(label, str):\n label = Symbol(name=label, dtype=function.dtype)\n obj = sympy.IndexedBase.__new__(cls, label, shape)\n obj.function = function\n return obj\n\n def func(self, *args):\n obj = super(IndexedData, self).func(*args)\n obj.function = self.function\n return obj\n\n def __getitem__(self, indices, **kwargs):\n \"\"\"Produce a types.Indexed, rather than a sympy.Indexed.\"\"\"\n indexed = super(IndexedData, self).__getitem__(indices, **kwargs)\n return Indexed(*indexed.args)\n\n # Pickling support\n _pickle_kwargs = ['label', 'shape', 'function']\n __reduce_ex__ = Pickable.__reduce_ex__\n\n\nclass Indexed(sympy.Indexed):\n\n # The two type flags have changed in upstream sympy as of version 1.1,\n # but the below interpretation is used throughout the compiler to\n # identify Indexed objects. With the sympy-1.1 changes a new flag\n # obj.is_Indexed was introduced which should be preferred, but the\n # required changes are cumbersome and many...\n is_Symbol = False\n is_Atom = False\n\n is_Dimension = False\n\n @memoized_meth\n def __str__(self):\n return super().__str__()\n\n def _hashable_content(self):\n return super(Indexed, self)._hashable_content() + (self.base.function,)\n\n @property\n def function(self):\n return self.base.function\n\n @property\n def dtype(self):\n return self.function.dtype\n\n @property\n def name(self):\n return self.function.name\n\n @property\n def origin(self):\n return self.function.origin\n\n @cached_property\n def free_symbols(self):\n # Make it cached, since it's relatively expensive and called often\n ret = super(Indexed, self).free_symbols\n # Get rid of the IndexedBase label this Indexed stems from\n # as in Devito we can't have it floating around in Eq's\n ret.discard(self.base.label)\n return ret\n\n def compare(self, other):\n \"\"\"\n Override `sympy.Basic.compare` to honor Devito's canonical ordering\n of arguments.\n In SymPy:\n\n f[x+1] < f[x+2] < ... < f[x+9] < f[x]\n\n While in Devito we pretend\n\n f[x] < f[x+1] < f[x+2] < ... < f[x+9]\n\n That is the arguments need to be ordered monothonically based on the indices\n so that the symbolic trees of two derivative expressions can be compared\n argument-wise.\n \"\"\"\n if (self.__class__ != other.__class__) or (self.function is not other.function):\n return super().compare(other)\n for l, r in zip(self.indices, other.indices):\n try:\n c = int(sympy.sign(l - r))\n except TypeError:\n # E.g., `l=x+1` and `r=y` or `r=sqrt(x)`\n c = l.compare(r)\n if c:\n return c\n return 0\n" ]
[ [ "numpy.add" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
yu-frank/PerspectiveCropLayers
[ "ae0580cb7b3b41c21965cd32e280d2af0e8cf2c3" ]
[ "src/dataset_3dhp.py" ]
[ "import re\nfrom glob import iglob\nfrom os import path\nfrom torchvision import transforms\n\nimport h5py\nimport numpy as np\nimport torch\nfrom PIL import Image, ImageOps\nfrom pose3d_utils.coords import homogeneous_to_cartesian, ensure_homogeneous\nfrom torchvision.transforms import RandomCrop, RandomHorizontalFlip\n\nfrom margipose.data import PoseDataset, collate\nfrom margipose.data.mpi_inf_3dhp.common import Annotations, parse_camera_calibration, Constants, \\\n MpiInf3dhpSkeletonDesc\nfrom margipose.data.skeleton import CanonicalSkeletonDesc, VNect_Common_Skeleton\nfrom margipose.data_specs import DataSpecs, ImageSpecs, JointsSpecs\nfrom margipose.eval import prepare_for_3d_evaluation, gather_3d_metrics\n\nimport utils\nimport pcl\nimport pcl_util\nimport constants\n\n# Load in Constants (Mean and Stds)\nmpi_3d_Mean = constants.mpi_3d_Mean\nmpi_3d_Std = constants.mpi_3d_Std\nmpi_2d_pcl_slant_mean = constants.mpi_2d_pcl_slant_mean\nmpi_2d_pcl_slant_std = constants.mpi_2d_pcl_slant_std\nmpi_2d_pcl_3dscale_mean = constants.mpi_2d_pcl_3dscale_mean\nmpi_2d_pcl_3dscale_std = constants.mpi_2d_pcl_3dscale_std\nmpi_2d_stn_slant_mean = constants.mpi_2d_stn_slant_mean\nmpi_2d_stn_slant_std = constants.mpi_2d_stn_slant_std\nmpi_2d_stn_3dscale_mean = constants.mpi_2d_stn_3dscale_mean\nmpi_2d_stn_3dscale_std = constants.mpi_2d_stn_3dscale_std\n\n\ndef pcl_preprocess(batch_size, num_joints, canon_label_2d_with_hip, orig_img_shape, Ks_px_orig, location, scale, \\\n normalize=True, use_slant_compensation=False):\n\n canon_virt_2d, R_virt2orig, P_virt2orig = pcl.pcl_transforms_2d(canon_label_2d_with_hip, location, scale, Ks_px_orig,\\\n focal_at_image_plane=True, slant_compensation=use_slant_compensation)\n model_input = canon_virt_2d.clone()\n\n if normalize:\n if use_slant_compensation:\n model_input = utils.batch_normalize_canon_pcl_human_joints(model_input, mpi_2d_pcl_slant_mean, mpi_2d_pcl_slant_std)\n else:\n model_input = utils.batch_normalize_canon_pcl_human_joints(model_input, mpi_2d_pcl_3dscale_mean, mpi_2d_pcl_3dscale_std)\n\n model_input = model_input.view(batch_size, -1)\n\n return {'model_input':model_input, 'canon_virt_2d':canon_virt_2d, 'R_virt2orig':R_virt2orig, 'P_virt2orig':P_virt2orig}\n\nclass FrameRef:\n def __init__(self, subject_id, sequence_id, camera_id, frame_index, activity_id=None):\n self.subject_id = subject_id\n self.sequence_id = sequence_id\n self.camera_id = camera_id\n self.frame_index = frame_index\n self.activity_id = activity_id\n\n @property\n def image_file(self):\n return 'S{}/Seq{}/imageSequence/video_{}/img_{:06d}.jpg'.format(\n self.subject_id, self.sequence_id, self.camera_id, self.frame_index + 1\n )\n\n @property\n def bg_mask_file(self):\n return 'S{}/Seq{}/foreground_mask/video_{}/img_{:06d}.png'.format(\n self.subject_id, self.sequence_id, self.camera_id, self.frame_index + 1\n )\n\n @property\n def ub_mask_file(self):\n return 'S{}/Seq{}/up_body_mask/video_{}/img_{:06d}.png'.format(\n self.subject_id, self.sequence_id, self.camera_id, self.frame_index + 1\n )\n\n @property\n def lb_mask_file(self):\n return 'S{}/Seq{}/low_body_mask/video_{}/img_{:06d}.png'.format(\n self.subject_id, self.sequence_id, self.camera_id, self.frame_index + 1\n )\n\n @property\n def annot_file(self):\n return 'S{}/Seq{}/annot.mat'.format(self.subject_id, self.sequence_id)\n\n @property\n def camera_file(self):\n return 'S{}/Seq{}/camera.calibration'.format(self.subject_id, self.sequence_id)\n\n @property\n def metadata_file(self):\n return 'S{}/Seq{}/metadata.h5'.format(self.subject_id, self.sequence_id)\n\n @property\n def bg_augmentable(self):\n seq_path = 'S{}/Seq{}'.format(self.subject_id, self.sequence_id)\n return Constants['seq_info'][seq_path]['bg_augmentable'] == 1\n\n @property\n def ub_augmentable(self):\n seq_path = 'S{}/Seq{}'.format(self.subject_id, self.sequence_id)\n return Constants['seq_info'][seq_path]['ub_augmentable'] == 1\n\n @property\n def lb_augmentable(self):\n seq_path = 'S{}/Seq{}'.format(self.subject_id, self.sequence_id)\n return Constants['seq_info'][seq_path]['lb_augmentable'] == 1\n\n def to_dict(self):\n return {\n 'subject_id': self.subject_id,\n 'sequence_id': self.sequence_id,\n 'camera_id': self.camera_id,\n 'frame_index': self.frame_index,\n 'activity_id': self.activity_id,\n }\n\n\ndef random_texture():\n files = list(iglob('resources/textures/*.png'))\n file = files[np.random.randint(0, len(files))]\n texture = Image.open(file).convert('L')\n texture = ImageOps.colorize(\n texture,\n 'black',\n (np.random.randint(50, 256), np.random.randint(50, 256), np.random.randint(50, 256))\n )\n return texture\n\n\ndef augment_clothing(img, mask, texture):\n a = np.array(img)\n grey = a.mean(axis=-1)\n blackness = (255 - grey).clip(min=0) / 255\n\n texture = np.array(texture, dtype=np.float)\n texture -= blackness[..., np.newaxis] * texture\n texture = Image.fromarray(texture.round().astype(np.uint8))\n\n return Image.composite(texture, img, mask)\n\n\ndef random_background():\n files = list(iglob('resources/backgrounds/*.jpg'))\n file = files[np.random.randint(0, len(files))]\n bg = Image.open(file)\n bg = RandomHorizontalFlip()(RandomCrop(768)(bg))\n return bg\n\n\ndef augment_background(img, mask, bg):\n return Image.composite(img, bg, mask)\n\n\nclass MpiInf3dDataset(PoseDataset):\n preserve_root_joint_at_univ_scale = False\n\n def __init__(self, data_dir, data_specs=None, use_aug=False, disable_mask_aug=False, \\\n without_image=True, human_height=2000, focal_diff=0, use_pcl=True, calculate_scale_from_2d=True, use_slant_compensation=True):\n if data_specs is None:\n data_specs = DataSpecs(\n ImageSpecs(128, mean=ImageSpecs.IMAGENET_MEAN, stddev=ImageSpecs.IMAGENET_STDDEV),\n JointsSpecs(MpiInf3dhpSkeletonDesc, n_dims=3),\n )\n\n super().__init__(data_specs)\n\n \"\"\"NEW\"\"\"\n self.human_height = human_height\n self.focal_diff = focal_diff\n self.use_pcl = use_pcl\n self.calculate_scale_from_2d = calculate_scale_from_2d\n self.use_slant_compensation = use_slant_compensation\n\n if not path.isdir(data_dir):\n raise NotADirectoryError(data_dir)\n\n metadata_files = sorted(iglob(path.join(data_dir, 'S*', 'Seq*', 'metadata.h5')))\n frame_refs = []\n univ_scale_factors = {}\n\n for metadata_file in metadata_files:\n # match = re.match(r'.*S(\\d+)/Seq(\\d+)/metadata.h5', metadata_file)\n match = re.match(r'.*S(\\d+)\\\\Seq(\\d+)\\\\metadata.h5', metadata_file)\n subject_id = int(match.group(1))\n sequence_id = int(match.group(2))\n\n activity_ids = None\n mat_annot_file = path.join(path.dirname(metadata_file), 'annot_data.mat')\n if path.isfile(mat_annot_file):\n with h5py.File(mat_annot_file, 'r') as f:\n activity_ids = f['activity_annotation'][:].flatten().astype(int)\n\n with h5py.File(metadata_file, 'r') as f:\n keys = f['interesting_frames'].keys()\n for key in keys:\n camera_id = int(re.match(r'camera(\\d)', key).group(1))\n for frame_index in f['interesting_frames'][key]:\n activity_id = None\n if activity_ids is not None:\n activity_id = activity_ids[frame_index]\n frame_refs.append(FrameRef(subject_id, sequence_id, camera_id, frame_index, activity_id))\n univ_scale_factors[(subject_id, sequence_id)] = f['scale'][0]\n\n self.data_dir = data_dir\n self.use_aug = use_aug\n self.disable_mask_aug = disable_mask_aug\n self.frame_refs = frame_refs\n self.univ_scale_factors = univ_scale_factors\n self.without_image = without_image\n self.multicrop = False\n\n @staticmethod\n def _mpi_inf_3dhp_to_canonical_skeleton(skel):\n assert skel.size(-2) == MpiInf3dhpSkeletonDesc.n_joints\n\n canonical_joints = [\n MpiInf3dhpSkeletonDesc.joint_names.index(s)\n for s in CanonicalSkeletonDesc.joint_names\n ]\n size = list(skel.size())\n size[-2] = len(canonical_joints)\n canonical_joints_tensor = torch.LongTensor(canonical_joints).unsqueeze(-1).expand(size)\n return skel.gather(-2, canonical_joints_tensor)\n\n def to_canonical_skeleton(self, skel):\n if self.skeleton_desc.canonical:\n return skel\n\n return self._mpi_inf_3dhp_to_canonical_skeleton(skel)\n\n def _get_skeleton_3d(self, index):\n frame_ref = self.frame_refs[index]\n metadata_file = path.join(self.data_dir, frame_ref.metadata_file)\n with h5py.File(metadata_file, 'r') as f:\n # Load the pose joint locations\n original_skel = torch.from_numpy(\n f['joints3d'][frame_ref.camera_id, frame_ref.frame_index]\n )\n\n if original_skel.shape[-2] == MpiInf3dhpSkeletonDesc.n_joints:\n # The training/validation skeletons have 28 joints.\n skel_desc = MpiInf3dhpSkeletonDesc\n elif original_skel.shape[-2] == CanonicalSkeletonDesc.n_joints:\n # The test set skeletons have the 17 canonical joints only.\n skel_desc = CanonicalSkeletonDesc\n else:\n raise Exception('unexpected number of joints: ' + original_skel.shape[-2])\n\n if self.skeleton_desc.canonical:\n if skel_desc == MpiInf3dhpSkeletonDesc:\n original_skel = self._mpi_inf_3dhp_to_canonical_skeleton(original_skel)\n elif skel_desc == CanonicalSkeletonDesc:\n # No conversion necessary.\n pass\n else:\n raise Exception()\n skel_desc = CanonicalSkeletonDesc\n\n return original_skel, skel_desc\n\n def _to_univ_scale(self, skel_3d, skel_desc, univ_scale_factor):\n univ_skel_3d = skel_3d.clone()\n\n # Scale the skeleton to match the universal skeleton size\n if self.preserve_root_joint_at_univ_scale:\n # Scale the skeleton about the root joint position. This should give the same\n # joint position coordinates as the \"univ_annot3\" annotations.\n root = skel_3d[..., skel_desc.root_joint_id:skel_desc.root_joint_id+1, :]\n univ_skel_3d -= root\n univ_skel_3d /= univ_scale_factor\n univ_skel_3d += root\n else:\n # Scale the skeleton about the camera position. Useful for breaking depth/scale\n # ambiguity.\n univ_skel_3d /= univ_scale_factor\n\n return univ_skel_3d\n\n def _evaluate_3d(self, index, original_skel, norm_pred, camera_intrinsics, transform_opts):\n assert self.skeleton_desc.canonical, 'can only evaluate canonical skeletons'\n expected, actual = prepare_for_3d_evaluation(original_skel, norm_pred, self,\n camera_intrinsics, transform_opts,\n known_depth=False)\n included_joints = [\n CanonicalSkeletonDesc.joint_names.index(joint_name)\n for joint_name in VNect_Common_Skeleton\n ]\n return gather_3d_metrics(expected, actual, included_joints)\n\n def __len__(self):\n return len(self.frame_refs)\n\n def _build_sample(self, index, orig_camera, orig_image, orig_skel, transform_opts, transform_opts_big):\n frame_ref = self.frame_refs[index]\n # out_width = self.data_specs.input_specs.width\n # out_height = self.data_specs.input_specs.height\n if orig_skel.shape[0] != 17:\n canonical_original_skel = self._mpi_inf_3dhp_to_canonical_skeleton(ensure_homogeneous(orig_skel, d=3)).float()\n else:\n canonical_original_skel = ensure_homogeneous(orig_skel, d=3).float()\n\n ctx = self.create_transformer_context(transform_opts)\n _, img, _ = ctx.transform(image=orig_image)\n\n big_ctx = self.create_transformer_context(transform_opts_big)\n _, img_big, _ = big_ctx.transform(image=orig_image)\n\n\n sample = {\n 'index': index, # Index in the dataset\n\n 'original_skel': canonical_original_skel, \n\n 'camera_original': orig_camera.matrix[:,:-1].float(),\n 'original_img_shape': torch.FloatTensor(orig_image.size),\n }\n\n img_transform = transforms.Compose([transforms.ToTensor()])\n\n if img:\n sample['input'] = self.input_to_tensor(img)\n\n if img_big:\n sample['input_big'] = self.input_to_tensor(img_big)\n sample['input_big_img'] = img_transform(img_big)\n \n # Generate the GT location and Scale of Crop\n \"\"\"14 is the location of the hip in canonical skeleton!\"\"\"\n pelvis_joint = sample['original_skel'][14,:-1].unsqueeze(0) #because of legacy code in utils that take a list of centers\n all_joints = sample['original_skel'][:,:-1]\n sample['world_coord_skel_mm'] = all_joints\n relative_joints = all_joints - pelvis_joint\n\n sample['non_normalized_3d'] = relative_joints\n\n #Normalize the Joints!\n normalized_joints = utils.batch_normalize_canon_human_joints(relative_joints.unsqueeze(0), mpi_3d_Mean, mpi_3d_Std).squeeze(0)\n\n sample['normalized_skel_mm'] = normalized_joints\n sample['pelvis_location_mm'] = pelvis_joint\n\n Ks_px = sample['camera_original']\n \n K = Ks_px.clone()\n K[0,2] = 0.\n K[1,2] = 0.\n P_px = Ks_px.clone()\n\n pose_2d = utils.world_2_camera_coordinates(P_px, all_joints.float())\n sample['pose2d_original'] = pose_2d\n sample['perspective_matrix'] = P_px\n\n if self.focal_diff != 0:\n Ks_px[0,0] *= self.focal_diff\n Ks_px[1,1] *= self.focal_diff\n sample['camera_original'] = Ks_px\n\n \"\"\"generate_gt_scales_from2d\"\"\"\n if self.calculate_scale_from_2d:\n scale = utils.generate_gt_scales_from2d(pose_2d)\n square_scale = torch.tensor([torch.max(scale), torch.max(scale)])\n else:\n scale = utils.generate_gt_scales(K, self.human_height, pelvis_joint, sample['original_img_shape'][0], sample['original_img_shape'][1]) # 2000 is the height in mm\n square_scale = scale.clone()\n\n square_scale_py = square_scale / sample['original_img_shape']\n sample['stn_square_scale_py'] = square_scale_py\n\n location_2d3d = utils.generate_gt_location(P_px, pelvis_joint, sample['original_img_shape'][0], sample['original_img_shape'][1])\n sample['crop_location_2d3d'] = location_2d3d\n\n # Location that is centered in the middle of the 2D pose (NOTE: not the same as the location calculation in 2D->3D)\n location = torch.FloatTensor([(torch.max(pose_2d[:,0]) + torch.min(pose_2d[:,0]))/2, (torch.max(pose_2d[:,1]) + torch.min(pose_2d[:,1]))/2])\n\n sample['crop_scale'] = torch.FloatTensor(scale)\n sample['crop_location'] = torch.FloatTensor(location)\n\n return sample\n \n\n def _build_sample_without_image(self, index, orig_skel, orig_camera, img_wh):\n frame_ref = self.frame_refs[index]\n if orig_skel.shape[0] != 17:\n canonical_original_skel = self._mpi_inf_3dhp_to_canonical_skeleton(ensure_homogeneous(orig_skel, d=3)).float()\n else:\n canonical_original_skel = ensure_homogeneous(orig_skel, d=3).float()\n Ks_px_video_cam = orig_camera.matrix[:,:-1].float().unsqueeze(0) #originally was 2048 x 2048, need to resize to 768 x 768\n img_w_h_orig = torch.FloatTensor([2048, 2048]).unsqueeze(0)\n img_w_h_small = torch.FloatTensor([img_wh[0], img_wh[1]])\n Ks_px_image_cam = pcl_util.K_new_resolution_px(Ks_px_video_cam, img_w_h_orig, img_w_h_small).squeeze(0)\n sample = {\n 'index': index, # Index in the dataset\n\n 'original_skel': canonical_original_skel, \n\n # Transformed data\n 'camera_original': Ks_px_image_cam,\n 'original_img_shape': torch.FloatTensor(img_wh)\n\n }\n\n # Generate the GT location and Scale of Crop\n \"\"\"HIP IS Position 14 in \"\"\"\n pelvis_joint = sample['original_skel'][14,:-1].unsqueeze(0) #because of legacy code in utils that take a list of centers\n all_joints = sample['original_skel'][:,:-1]\n sample['world_coord_skel_mm'] = all_joints\n relative_joints = all_joints - pelvis_joint\n\n sample['non_normalized_3d'] = relative_joints\n\n #Normalize the Joints!\n normalized_joints = utils.batch_normalize_canon_human_joints(relative_joints.unsqueeze(0), mpi_3d_Mean, mpi_3d_Std).squeeze(0)\n\n sample['normalized_skel_mm'] = normalized_joints\n sample['pelvis_location_mm'] = pelvis_joint\n\n Ks_px = sample['camera_original']\n \n K = Ks_px.clone()\n K[0,2] = 0.\n K[1,2] = 0.\n P_px = Ks_px.clone()\n\n pose_2d = utils.world_2_camera_coordinates(P_px, all_joints.float())\n sample['pose2d_original'] = pose_2d\n sample['perspective_matrix'] = P_px\n\n if self.focal_diff != 0:\n Ks_px[0,0] *= self.focal_diff\n Ks_px[1,1] *= self.focal_diff\n sample['camera_original'] = Ks_px\n\n \"\"\"generate_gt_scales_from2d\"\"\"\n if self.calculate_scale_from_2d:\n scale = utils.generate_gt_scales_from2d(pose_2d)\n square_scale = torch.tensor([torch.max(scale), torch.max(scale)])\n else:\n scale = utils.generate_gt_scales(K, self.human_height, pelvis_joint, sample['original_img_shape'][0], sample['original_img_shape'][1]) # 2000 is the height in mm\n square_scale = scale.clone()\n\n square_scale_py = square_scale / sample['original_img_shape']\n sample['stn_square_scale_py'] = square_scale_py\n\n location = utils.generate_gt_location(P_px, pelvis_joint, sample['original_img_shape'][0], sample['original_img_shape'][1])\n\n sample['crop_scale'] = torch.FloatTensor(scale)\n sample['crop_location'] = torch.FloatTensor(location)\n\n if self.use_pcl:\n canon_label_2d_with_hip = pose_2d.unsqueeze(0)\n preprocess = pcl_preprocess(1, canon_label_2d_with_hip.shape[1], canon_label_2d_with_hip, sample['original_img_shape'].unsqueeze(0), \\\n sample['camera_original'].unsqueeze(0), location.unsqueeze(0), scale.unsqueeze(0),\\\n normalize=True, use_slant_compensation=self.use_slant_compensation)\n \n sample['preprocess-model_input'] = preprocess['model_input'].squeeze(0)\n sample['preprocess-canon_virt_2d'] = preprocess['canon_virt_2d'].squeeze(0)\n sample['preprocess-R_virt2orig'] = preprocess['R_virt2orig'].squeeze(0)\n\n return sample\n\n def __getitem__(self, index):\n if not self.without_image:\n frame_ref = self.frame_refs[index]\n\n skel_3d, skel_desc = self._get_skeleton_3d(index)\n univ_scale_factor = self.univ_scale_factors[(frame_ref.subject_id, frame_ref.sequence_id)]\n orig_skel = self._to_univ_scale(skel_3d, skel_desc, univ_scale_factor)\n\n if self.without_image:\n orig_image = None\n img_w = img_h = 768\n else:\n orig_image = Image.open(path.join(self.data_dir, frame_ref.image_file))\n img_w, img_h = orig_image.size\n\n with open(path.join(self.data_dir, frame_ref.camera_file), 'r') as f:\n cam_cal = parse_camera_calibration(f)[frame_ref.camera_id]\n\n # Correct the camera to account for the fact that video frames were\n # stored at a lower resolution.\n orig_camera = cam_cal['intrinsics'].clone()\n old_w = cam_cal['image_width']\n old_h = cam_cal['image_height']\n orig_camera.scale_image(img_w / old_w, img_h / old_h)\n\n extrinsics = cam_cal['extrinsics']\n\n # Bounding box details\n skel_2d = orig_camera.project_cartesian(skel_3d)\n min_x = skel_2d[:, 0].min().item()\n max_x = skel_2d[:, 0].max().item()\n min_y = skel_2d[:, 1].min().item()\n max_y = skel_2d[:, 1].max().item()\n bb_cx = (min_x + max_x) / 2\n bb_cy = (min_y + max_y) / 2\n bb_size = 1.5 * max(max_x - min_x, max_y - min_y)\n\n img_short_side = min(img_h, img_w)\n out_width = self.data_specs.input_specs.width\n out_height = self.data_specs.input_specs.height\n\n if self.multicrop:\n samples = []\n for aug_hflip in [False, True]:\n for offset in [(0, 0), (-1, 0), (0, -1), (1, 0), (0, 1)]:\n aug_x = offset[0] * 8\n aug_y = offset[1] * 8\n\n transform_opts = {\n 'in_camera': orig_camera,\n 'in_width': img_w,\n 'in_height': img_h,\n 'centre_x': bb_cx + aug_x,\n 'centre_y': bb_cy + aug_y,\n 'rotation': 0,\n 'scale': bb_size / img_short_side,\n 'hflip_indices': self.skeleton_desc.hflip_indices,\n 'hflip': aug_hflip,\n 'out_width': out_width,\n 'out_height': out_height,\n 'brightness': 1,\n 'contrast': 1,\n 'saturation': 1,\n 'hue': 0,\n }\n\n samples.append(self._build_sample(index, orig_camera, orig_image, orig_skel,\n transform_opts, extrinsics))\n\n return collate(samples)\n else:\n aug_bg = aug_ub = aug_lb = False\n aug_hflip = False\n aug_brightness = aug_contrast = aug_saturation = 1.0\n aug_hue = 0.0\n aug_x = aug_y = 0.0\n aug_scale = 1.0\n aug_rot = 0\n\n if self.use_aug:\n if not self.disable_mask_aug:\n aug_bg = frame_ref.bg_augmentable and np.random.uniform() < 0.6\n aug_ub = frame_ref.ub_augmentable and np.random.uniform() < 0.2\n aug_lb = frame_ref.lb_augmentable and np.random.uniform() < 0.5\n aug_hflip = np.random.uniform() < 0.5\n if np.random.uniform() < 0.3:\n aug_brightness = np.random.uniform(0.8, 1.2)\n if np.random.uniform() < 0.3:\n aug_contrast = np.random.uniform(0.8, 1.2)\n if np.random.uniform() < 0.3:\n aug_saturation = np.random.uniform(0.8, 1.2)\n if np.random.uniform() < 0.3:\n aug_hue = np.random.uniform(-0.1, 0.1)\n aug_x = np.random.uniform(-16, 16)\n aug_y = np.random.uniform(-16, 16)\n aug_scale = np.random.uniform(0.9, 1.1)\n if np.random.uniform() < 0.4:\n aug_rot = np.clip(np.random.normal(0, 30), -30, 30)\n\n if orig_image:\n if aug_bg:\n orig_image = augment_background(\n orig_image,\n Image.open(path.join(self.data_dir, frame_ref.bg_mask_file)),\n random_background()\n )\n if aug_ub:\n orig_image = augment_clothing(\n orig_image,\n Image.open(path.join(self.data_dir, frame_ref.ub_mask_file)),\n random_texture()\n )\n if aug_lb:\n orig_image = augment_clothing(\n orig_image,\n Image.open(path.join(self.data_dir, frame_ref.lb_mask_file)),\n random_texture()\n )\n\n transform_opts = {\n 'in_camera': orig_camera,\n 'in_width': img_w,\n 'in_height': img_h,\n 'centre_x': bb_cx + aug_x,\n 'centre_y': bb_cy + aug_y,\n 'rotation': aug_rot,\n 'scale': bb_size * aug_scale / img_short_side,\n 'hflip_indices': self.skeleton_desc.hflip_indices,\n 'hflip': aug_hflip,\n 'out_width': out_width,\n 'out_height': out_height,\n 'brightness': aug_brightness,\n 'contrast': aug_contrast,\n 'saturation': aug_saturation,\n 'hue': aug_hue,\n }\n\n transform_opts_big = {\n 'in_camera': orig_camera,\n 'in_width': img_w,\n 'in_height': img_h,\n 'centre_x': bb_cx + aug_x,\n 'centre_y': bb_cy + aug_y,\n 'rotation': aug_rot,\n 'scale': bb_size * aug_scale / img_short_side,\n 'hflip_indices': self.skeleton_desc.hflip_indices,\n 'hflip': aug_hflip,\n 'out_width': 256,\n 'out_height': 256,\n 'brightness': aug_brightness,\n 'contrast': aug_contrast,\n 'saturation': aug_saturation,\n 'hue': aug_hue,\n }\n\n return self._build_sample(index, orig_camera, orig_image, orig_skel, transform_opts, transform_opts_big)\n\n else:\n # dataloader when no image is required\n frame_ref = self.frame_refs[index]\n skel_3d, skel_desc = self._get_skeleton_3d(index)\n univ_scale_factor = self.univ_scale_factors[(frame_ref.subject_id, frame_ref.sequence_id)]\n img_w = img_h = 768\n\n with open(path.join(self.data_dir, frame_ref.camera_file), 'r') as f:\n cam_cal = parse_camera_calibration(f)[frame_ref.camera_id]\n\n # Correct the camera to account for the fact that video frames were\n # stored at a lower resolution.\n orig_camera = cam_cal['intrinsics'].clone()\n orig_skel = self._to_univ_scale(skel_3d, skel_desc, univ_scale_factor)\n return self._build_sample_without_image(index, orig_skel, orig_camera, [img_w, img_h])" ]
[ [ "torch.LongTensor", "torch.max", "torch.min", "torch.from_numpy", "numpy.random.normal", "torch.FloatTensor", "numpy.random.uniform", "numpy.array", "numpy.random.randint" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
vnshanmukh/pvoutput
[ "9773c60445b38b7b67f8d5e10316379f47090549" ]
[ "pvoutput/pvoutput.py" ]
[ "import logging\nimport os\nimport time\nimport warnings\nfrom datetime import date, datetime, timedelta\nfrom io import StringIO\nfrom typing import Dict, Iterable, List, Optional, Union\nfrom urllib.parse import urljoin\n\nimport numpy as np\nimport pandas as pd\nimport requests\nimport tables\n\nfrom pvoutput.consts import (\n BASE_URL,\n CONFIG_FILENAME,\n ONE_DAY,\n PV_OUTPUT_DATE_FORMAT,\n RATE_LIMIT_PARAMS_TO_API_HEADERS,\n)\nfrom pvoutput.daterange import DateRange, merge_date_ranges_to_years\nfrom pvoutput.exceptions import NoStatusFound, RateLimitExceeded\nfrom pvoutput.utils import (\n _get_param_from_config_file,\n _get_response,\n _print_and_log,\n get_date_ranges_to_download,\n sort_and_de_dupe_pv_system,\n system_id_to_hdf_key,\n)\n\n_LOG = logging.getLogger(\"pvoutput\")\n\n\nclass PVOutput:\n \"\"\"\n Attributes:\n api_key\n system_id\n rate_limit_remaining\n rate_limit_total\n rate_limit_reset_time\n data_service_url\n \"\"\"\n\n def __init__(\n self,\n api_key: str = None,\n system_id: str = None,\n config_filename: Optional[str] = CONFIG_FILENAME,\n data_service_url: Optional[str] = None,\n ):\n \"\"\"\n Args:\n api_key: Your API key from PVOutput.org.\n system_id: Your system ID from PVOutput.org. If you don't have a\n PV system then you can register with PVOutput.org and select\n the 'energy consumption only' box.\n config_filename: Optional, the filename of the .yml config file.\n data_service_url: Optional. If you have subscribed to\n PVOutput.org's data service then add the data service URL here.\n This string must end in '.org'.\n \"\"\"\n\n self.api_key = api_key\n self.system_id = system_id\n self.rate_limit_remaining = None\n self.rate_limit_total = None\n self.rate_limit_reset_time = None\n self.data_service_url = data_service_url\n\n # Set from config file if None\n for param_name in [\"api_key\", \"system_id\"]:\n if getattr(self, param_name) is None:\n try:\n param_value_from_config = _get_param_from_config_file(\n param_name, config_filename\n )\n except Exception as e:\n msg = (\n \"Error loading configuration parameter {param_name}\"\n \" from config file {filename}. Either pass\"\n \" {param_name} into PVOutput constructor, or create\"\n \" config file {filename}. {exception}\".format(\n param_name=param_name, filename=CONFIG_FILENAME, exception=e\n )\n )\n print(msg)\n _LOG.exception(msg)\n raise\n setattr(self, param_name, param_value_from_config)\n # Convert to strings\n setattr(self, param_name, str(getattr(self, param_name)))\n\n # Check for data_service_url\n if self.data_service_url is None:\n try:\n self.data_service_url = _get_param_from_config_file(\n \"data_service_url\", config_filename\n )\n except KeyError:\n pass\n except FileNotFoundError:\n pass\n\n if self.data_service_url is not None:\n if not self.data_service_url.strip(\"/\").endswith(\".org\"):\n raise ValueError(\"data_service_url must end in '.org'\")\n\n def search(\n self,\n query: str,\n lat: Optional[float] = None,\n lon: Optional[float] = None,\n include_country: bool = True,\n **kwargs\n ) -> pd.DataFrame:\n \"\"\"Search for PV systems.\n\n Some quirks of the PVOutput.org API:\n - The maximum number of results returned by PVOutput.org is 30.\n If the number of returned results is 30, then there is no\n indication of whether there are exactly 30 search results,\n or if there are more than 30. Also, there is no way to\n request additional 'pages' of search results.\n - The maximum search radius is 25km\n\n Args:\n query: string, see https://pvoutput.org/help.html#search\n e.g. '5km'.\n lat: float, e.g. 52.0668589\n lon: float, e.g. -1.3484038\n include_country: bool, whether or not to include the country name\n with the returned postcode.\n\n Returns:\n pd.DataFrame, one row per search results. Index is PV system ID.\n Columns:\n name,\n system_DC_capacity_W,\n address, # If `include_country` is True then address is\n # 'country> <postcode>',\n # else address is '<postcode>'.\n orientation,\n num_outputs,\n last_output,\n panel,\n inverter,\n distance_km,\n latitude,\n longitude\n \"\"\"\n api_params = {\"q\": query, \"country\": int(include_country)}\n\n if lat is not None and lon is not None:\n api_params[\"ll\"] = \"{:f},{:f}\".format(lat, lon)\n\n pv_systems_text = self._api_query(service=\"search\", api_params=api_params, **kwargs)\n\n pv_systems = pd.read_csv(\n StringIO(pv_systems_text),\n names=[\n \"name\",\n \"system_DC_capacity_W\",\n \"address\",\n \"orientation\",\n \"num_outputs\",\n \"last_output\",\n \"system_id\",\n \"panel\",\n \"inverter\",\n \"distance_km\",\n \"latitude\",\n \"longitude\",\n ],\n index_col=\"system_id\",\n )\n\n return pv_systems\n\n def get_status(\n self, pv_system_id: int, date: Union[str, datetime], historic: bool = True, **kwargs\n ) -> pd.DataFrame:\n \"\"\"Get PV system status (e.g. power generation) for one day.\n\n The returned DataFrame will be empty if the PVOutput API\n returns 'status 400: No status found'.\n\n Args:\n pv_system_id: int\n date: str in format YYYYMMDD; or datetime\n (localtime of the PV system)\n\n Returns:\n pd.DataFrame:\n index: datetime (DatetimeIndex, localtime of the PV system)\n columns: (all np.float64):\n cumulative_energy_gen_Wh,\n energy_efficiency_kWh_per_kW,\n instantaneous_power_gen_W,\n average_power_gen_W,\n power_gen_normalised,\n energy_consumption_Wh,\n power_demand_W,\n temperature_C,\n voltage\n \"\"\"\n _LOG.info(\"system_id %d: Requesting system status for %s\", pv_system_id, date)\n date = date_to_pvoutput_str(date)\n _check_date(date)\n\n api_params = {\n \"d\": date, # date, YYYYMMDD, localtime of the PV system\n \"h\": int(historic == True), # We want historical data.\n \"limit\": 288, # API limit is 288 (num of 5-min periods per day).\n \"ext\": 0, # Extended data; we don't want extended data.\n \"sid1\": pv_system_id, # SystemID.\n }\n\n try:\n pv_system_status_text = self._api_query(\n service=\"getstatus\", api_params=api_params, **kwargs\n )\n except NoStatusFound:\n _LOG.info(\"system_id %d: No status found for date %s\", pv_system_id, date)\n pv_system_status_text = \"\"\n\n # See https://pvoutput.org/help.html#api-getstatus but make sure\n # you read the 'History Query' subsection, as a historical query\n # has slightly different return columns compared to a non-historical\n # query!\n columns = (\n [\n \"cumulative_energy_gen_Wh\",\n \"energy_efficiency_kWh_per_kW\",\n \"instantaneous_power_gen_W\",\n \"average_power_gen_W\",\n \"power_gen_normalised\",\n \"energy_consumption_Wh\",\n \"power_demand_W\",\n \"temperature_C\",\n \"voltage\",\n ]\n if historic\n else [\n \"cumulative_energy_gen_Wh\",\n \"instantaneous_power_gen_W\",\n \"energy_consumption_Wh\",\n \"power_demand_W\",\n \"power_gen_normalised\",\n \"temperature_C\",\n \"voltage\",\n ]\n )\n\n pv_system_status = pd.read_csv(\n StringIO(pv_system_status_text),\n lineterminator=\";\",\n names=[\"date\", \"time\"] + columns,\n parse_dates={\"datetime\": [\"date\", \"time\"]},\n index_col=[\"datetime\"],\n dtype={col: np.float64 for col in columns},\n ).sort_index()\n\n return pv_system_status\n\n def get_batch_status(\n self,\n pv_system_id: int,\n date_to: Optional[Union[str, datetime]] = None,\n max_retries: Optional[int] = 1000,\n **kwargs\n ) -> Union[None, pd.DataFrame]:\n \"\"\"Get batch PV system status (e.g. power generation).\n\n The returned DataFrame will be empty if the PVOutput API\n returns 'status 400: No status found'.\n\n Data returned is limited to the last 366 days per request.\n To retrieve older data, use the date_to parameter.\n\n The PVOutput getbatchstatus API is asynchronous. When it's first\n called, it replies to say 'accepted'. This function will then\n wait a minute and call the API again to see if the data is ready.\n Set `max_retries` to 1 if you want to return immediately, even\n if data isn't ready yet (and hence this function will return None)\n\n https://pvoutput.org/help.html#dataservice-getbatchstatus\n\n Args:\n pv_system_id: int\n date_to: str in format YYYYMMDD; or datetime\n (localtime of the PV system). The returned timeseries will\n include 366 days of data: from YYYY-1MMDD to YYYYMMDD inclusive\n max_retries: int, number of times to retry after receiving\n a '202 Accepted' request. Set `max_retries` to 1 if you want\n to return immediately, even if data isn't ready yet (and hence\n this function will return None).\n\n Returns:\n None (if data isn't ready after retrying max_retries times) or\n pd.DataFrame:\n index: datetime (DatetimeIndex, localtime of the PV system)\n columns: (all np.float64):\n cumulative_energy_gen_Wh,\n instantaneous_power_gen_W,\n temperature_C,\n voltage\n \"\"\"\n api_params = {\"sid1\": pv_system_id}\n\n _set_date_param(date_to, api_params, \"dt\")\n\n for retry in range(max_retries):\n try:\n pv_system_status_text = self._api_query(\n service=\"getbatchstatus\", api_params=api_params, use_data_service=True, **kwargs\n )\n except NoStatusFound:\n _LOG.info(\"system_id %d: No status found for date_to %s\", pv_system_id, date_to)\n pv_system_status_text = \"\"\n break\n\n if \"Accepted 202\" in pv_system_status_text:\n if retry == 0:\n _print_and_log(\"Request accepted.\")\n if retry < max_retries - 1:\n _print_and_log(\"Sleeping for 1 minute.\")\n time.sleep(60)\n else:\n _print_and_log(\n \"Call get_batch_status again in a minute to see if\" \" results are ready.\"\n )\n else:\n break\n else:\n return\n\n return _process_batch_status(pv_system_status_text)\n\n def get_metadata(self, pv_system_id: int, **kwargs) -> pd.Series:\n \"\"\"Get metadata for a single PV system.\n\n Args:\n pv_system_id: int\n\n Returns:\n pd.Series. Index is:\n name,\n system_DC_capacity_W,\n address,\n num_panels,\n panel_capacity_W_each,\n panel_brand,\n num_inverters,\n inverter_capacity_W,\n inverter_brand,\n orientation,\n array_tilt_degrees,\n shade,\n install_date,\n latitude,\n longitude,\n status_interval_minutes,\n secondary_num_panels,\n secondary_panel_capacity_W_each,\n secondary_orientation,\n secondary_array_tilt_degrees\n \"\"\"\n pv_metadata_text = self._api_query(\n service=\"getsystem\",\n api_params={\n \"array2\": 1, # Provide data about secondary array, if present.\n \"tariffs\": 0,\n \"teams\": 0,\n \"est\": 0,\n \"donations\": 0,\n \"sid1\": pv_system_id, # SystemID\n \"ext\": 0, # Include extended data?\n },\n **kwargs\n )\n\n pv_metadata = pd.read_csv(\n StringIO(pv_metadata_text),\n lineterminator=\";\",\n names=[\n \"name\",\n \"system_DC_capacity_W\",\n \"address\",\n \"num_panels\",\n \"panel_capacity_W_each\",\n \"panel_brand\",\n \"num_inverters\",\n \"inverter_capacity_W\",\n \"inverter_brand\",\n \"orientation\",\n \"array_tilt_degrees\",\n \"shade\",\n \"install_date\",\n \"latitude\",\n \"longitude\",\n \"status_interval_minutes\",\n \"secondary_num_panels\",\n \"secondary_panel_capacity_W_each\",\n \"secondary_orientation\",\n \"secondary_array_tilt_degrees\",\n ],\n parse_dates=[\"install_date\"],\n nrows=1,\n ).squeeze()\n pv_metadata[\"system_id\"] = pv_system_id\n pv_metadata.name = pv_system_id\n return pv_metadata\n\n def get_statistic(\n self,\n pv_system_id: int,\n date_from: Optional[Union[str, date]] = None,\n date_to: Optional[Union[str, date]] = None,\n **kwargs\n ) -> pd.DataFrame:\n \"\"\"Get summary stats for a single PV system.\n\n Args:\n pv_system_id: int\n date_from\n date_to\n\n Returns:\n pd.DataFrame:\n total_energy_gen_Wh,\n energy_exported_Wh,\n average_daily_energy_gen_Wh,\n minimum_daily_energy_gen_Wh,\n maximum_daily_energy_gen_Wh,\n average_efficiency_kWh_per_kW,\n num_outputs, # The number of days for which there's >= 1 val.\n actual_date_from,\n actual_date_to,\n record_efficiency_kWh_per_kW,\n record_efficiency_date,\n query_date_from,\n query_date_to\n \"\"\"\n if date_from and not date_to:\n date_to = pd.Timestamp.now().date()\n if date_to and not date_from:\n date_from = pd.Timestamp(\"1900-01-01\").date()\n\n api_params = {\n \"c\": 0, # consumption and import\n \"crdr\": 0, # credits / debits\n \"sid1\": pv_system_id, # SystemID\n }\n\n _set_date_param(date_from, api_params, \"df\")\n _set_date_param(date_to, api_params, \"dt\")\n\n try:\n pv_metadata_text = self._api_query(\n service=\"getstatistic\", api_params=api_params, **kwargs\n )\n except NoStatusFound:\n pv_metadata_text = \"\"\n\n columns = [\n \"total_energy_gen_Wh\",\n \"energy_exported_Wh\",\n \"average_daily_energy_gen_Wh\",\n \"minimum_daily_energy_gen_Wh\",\n \"maximum_daily_energy_gen_Wh\",\n \"average_efficiency_kWh_per_kW\",\n \"num_outputs\",\n \"actual_date_from\",\n \"actual_date_to\",\n \"record_efficiency_kWh_per_kW\",\n \"record_efficiency_date\",\n ]\n date_cols = [\"actual_date_from\", \"actual_date_to\", \"record_efficiency_date\"]\n numeric_cols = set(columns) - set(date_cols)\n pv_metadata = pd.read_csv(\n StringIO(pv_metadata_text),\n names=columns,\n dtype={col: np.float32 for col in numeric_cols},\n parse_dates=date_cols,\n )\n if pv_metadata.empty:\n data = {col: np.float32(np.NaN) for col in numeric_cols}\n data.update({col: pd.NaT for col in date_cols})\n pv_metadata = pd.DataFrame(data, index=[pv_system_id])\n else:\n pv_metadata.index = [pv_system_id]\n\n pv_metadata[\"query_date_from\"] = pd.Timestamp(date_from) if date_from else pd.NaT\n pv_metadata[\"query_date_to\"] = pd.Timestamp(date_to) if date_to else pd.Timestamp.now()\n return pv_metadata\n\n def _get_statistic_with_cache(\n self,\n store_filename: str,\n pv_system_id: int,\n date_from: Optional[Union[str, date]] = None,\n date_to: Optional[Union[str, date]] = None,\n **kwargs\n ) -> pd.Series:\n \"\"\"Will try to get stats from store_filename['statistics']. If this\n fails, or if date_to > query_date_to, or if\n date_from < query_date_from, then will call the API. Note that the aim\n of this function is just to find the relevant actual_date_from and\n actual_date_to, so this function does not respect the other params.\n \"\"\"\n\n if date_from:\n date_from = pd.Timestamp(date_from).date()\n if date_to:\n date_to = pd.Timestamp(date_to).date()\n\n def _get_fresh_statistic():\n _LOG.info(\"pv_system %d: Getting fresh statistic.\", pv_system_id)\n stats = self.get_statistic(pv_system_id, **kwargs)\n with pd.HDFStore(store_filename, mode=\"a\") as store:\n try:\n store.remove(key=\"statistics\", where=\"index=pv_system_id\")\n except KeyError:\n pass\n store.append(key=\"statistics\", value=stats)\n return stats\n\n try:\n stats = pd.read_hdf(store_filename, key=\"statistics\", where=\"index=pv_system_id\")\n except (FileNotFoundError, KeyError):\n return _get_fresh_statistic()\n\n if stats.empty:\n return _get_fresh_statistic()\n\n query_date_from = stats.iloc[0][\"query_date_from\"]\n query_date_to = stats.iloc[0][\"query_date_to\"]\n\n if (\n not pd.isnull(date_from)\n and not pd.isnull(query_date_from)\n and date_from < query_date_from.date()\n ):\n return _get_fresh_statistic()\n\n if not pd.isnull(date_to) and date_to > query_date_to.date():\n return _get_fresh_statistic()\n\n return stats\n\n def download_multiple_systems_to_disk(\n self,\n system_ids: Iterable[int],\n start_date: datetime,\n end_date: datetime,\n output_filename: str,\n timezone: Optional[str] = None,\n min_data_availability: Optional[float] = 0.5,\n use_get_batch_status_if_available: Optional[bool] = True,\n ):\n \"\"\"Download multiple PV system IDs to disk.\n\n Data is saved to `output_filename` in HDF5 format. The exact data\n format is documented in\n https://github.com/openclimatefix/pvoutput/blob/master/docs/dataset.md\n\n This function is designed to be run for days (!) downloading\n gigabytes of PV data :) As such, this function can be safely\n interrupted and re-started. All the state required to re-start\n is stored in the HDF5 file.\n\n Add appropriate handlers the Python logger `pvoutput` to see progress.\n\n Args:\n system_ids: List of PV system IDs to download.\n start_date: Start of date range to download.\n end_date: End of date range to download.\n output_filename: HDF5 filename to write data to.\n timezone: String representation of timezone of timeseries data.\n e.g. 'Europe/London'.\n min_data_availability: A float in the range [0, 1]. 1 means only\n accept PV systems which have no days of missing data. 0 means\n accept all PV systems, no matter if they have missing data.\n Note that the data availability is measured against the date\n range for which the PV system has data available, not from\n the date range passed into this function.\n use_get_batch_status_if_available: Bool. If true then will use\n PVOutput's getbatchstatus API (which must be paid for, and\n `data_service_url` must be set in `~/.pvoutput.yml` or when\n initialising the PVOutput object).\n \"\"\"\n n = len(system_ids)\n for i, pv_system_id in enumerate(system_ids):\n _LOG.info(\"**********************\")\n msg = \"system_id {:d}: {:d} of {:d} ({:%})\".format(pv_system_id, i + 1, n, (i + 1) / n)\n _LOG.info(msg)\n print(\"\\r\", msg, end=\"\", flush=True)\n\n # Sorted list of DateRange objects. For each DateRange,\n # we need to download from start_date to end_date inclusive.\n date_ranges_to_download = get_date_ranges_to_download(\n output_filename, pv_system_id, start_date, end_date\n )\n\n # How much data is actually available?\n date_ranges_to_download = self._filter_date_range(\n output_filename, pv_system_id, date_ranges_to_download, min_data_availability\n )\n\n if not date_ranges_to_download:\n _LOG.info(\"system_id %d: No data left to download :)\", pv_system_id)\n continue\n\n _LOG.info(\n \"system_id %d: Will download these date ranges: %s\",\n pv_system_id,\n date_ranges_to_download,\n )\n\n if use_get_batch_status_if_available:\n if self.data_service_url:\n self._download_multiple_using_get_batch_status(\n output_filename, pv_system_id, date_ranges_to_download, timezone\n )\n else:\n raise ValueError(\"data_service_url is not set!\")\n else:\n self._download_multiple_using_get_status(\n output_filename, pv_system_id, date_ranges_to_download, timezone\n )\n\n def get_insolation_forecast(\n self,\n date: Union[str, datetime],\n pv_system_id: Optional[int] = None,\n timezone: Optional[str] = None,\n lat: Optional[float] = None,\n lon: Optional[float] = None,\n **kwargs\n ):\n \"\"\"Get Insolation data for a given site, or a given location defined by\n longitude and latitude. This is the estimated output for the site\n based on ideal weather conditions. Also factors in site age, reducing\n ouput by 1% each year, shade and orientation. Need donation mode enabled.\n See https://pvoutput.org/help.html#api-getinsolation\n\n Args:\n date: str in format YYYYMMDD; or datetime\n (localtime of the PV system)\n pv_system_id: int\n timezone: str\n lat: float e.g. -27.4676\n lon: float e.g. 153.0279\n **kwargs:\n\n\n Returns:\n\n \"\"\"\n date = date_to_pvoutput_str(date)\n _check_date(date, prediction=True)\n api_params = {\n \"d\": date, # date, YYYYMMDD, localtime of the PV system\n \"sid1\": pv_system_id, # SystemID.\n \"tz\": timezone, # defaults to configured timezone of system otherwise GMT\n }\n if lat is not None and lon is not None:\n api_params[\"ll\"] = \"{:f},{:f}\".format(lat, lon)\n\n try:\n pv_insolation_text = self._api_query(\n service=\"getinsolation\", api_params=api_params, **kwargs\n )\n except NoStatusFound:\n _LOG.info(\"system_id %d: No status found for date %s\", pv_system_id, date)\n pv_insolation_text = \"\"\n\n columns = [\"predicted_power_gen_W\", \"predicted_cumulative_energy_gen_Wh\"]\n pv_insolation = pd.read_csv(\n StringIO(pv_insolation_text),\n lineterminator=\";\",\n names=[\"time\"] + columns,\n dtype={col: np.float64 for col in columns},\n ).sort_index()\n pv_insolation.index = pd.to_datetime(\n date + \" \" + pv_insolation.time, format=\"%Y-%m-%d %H:%M\"\n )\n pv_insolation.drop(\"time\", axis=1, inplace=True)\n return pv_insolation\n\n def _filter_date_range(\n self,\n store_filename: str,\n system_id: int,\n date_ranges: Iterable[DateRange],\n min_data_availability: Optional[float] = 0.5,\n ) -> List[DateRange]:\n \"\"\"Check getstatistic to see if system_id has data for all date ranges.\n\n Args:\n system_id: PV system ID.\n store_filename: HDF5 filename to cache statistics to / from.\n date_ranges: List of DateRange objects.\n min_data_availability: A float in the range [0, 1]. 1 means only\n accept PV systems which have no days of missing data. 0 means\n accept all PV systems, no matter if they have missing data.\n \"\"\"\n if not date_ranges:\n return date_ranges\n\n stats = self._get_statistic_with_cache(\n store_filename,\n system_id,\n date_to=date_ranges[-1].end_date,\n wait_if_rate_limit_exceeded=True,\n ).squeeze()\n\n if pd.isnull(stats[\"actual_date_from\"]) or pd.isnull(stats[\"actual_date_to\"]):\n _LOG.info(\"system_id %d: Stats say there is no data!\", system_id)\n return []\n\n timeseries_date_range = DateRange(stats[\"actual_date_from\"], stats[\"actual_date_to\"])\n\n data_availability = stats[\"num_outputs\"] / (timeseries_date_range.total_days() + 1)\n\n if data_availability < min_data_availability:\n _LOG.info(\n \"system_id %d: Data availability too low! Only %.0f %%.\",\n system_id,\n data_availability * 100,\n )\n return []\n\n new_date_ranges = []\n for date_range in date_ranges:\n new_date_range = date_range.intersection(timeseries_date_range)\n if new_date_range:\n new_date_ranges.append(new_date_range)\n return new_date_ranges\n\n def _download_multiple_using_get_batch_status(\n self, output_filename, pv_system_id, date_ranges_to_download, timezone: Optional[str] = None\n ):\n years = merge_date_ranges_to_years(date_ranges_to_download)\n dates_to = [year.end_date for year in years]\n total_rows = self._download_multiple_worker(\n output_filename, pv_system_id, dates_to, timezone, use_get_status=False\n )\n\n # Re-load data, sort, remove duplicate indicies, append back\n if total_rows:\n with pd.HDFStore(output_filename, mode=\"a\", complevel=9) as store:\n sort_and_de_dupe_pv_system(store, pv_system_id)\n\n def _download_multiple_using_get_status(\n self, output_filename, pv_system_id, date_ranges_to_download, timezone: Optional[str] = None\n ):\n for date_range in date_ranges_to_download:\n dates = date_range.date_range()\n self._download_multiple_worker(\n output_filename, pv_system_id, dates, timezone, use_get_status=True\n )\n\n def _download_multiple_worker(\n self, output_filename, pv_system_id, dates, timezone, use_get_status\n ) -> int:\n \"\"\"\n Returns:\n total number of rows downloaded\n \"\"\"\n total_rows = 0\n for date_to_load in dates:\n _LOG.info(\"system_id %d: Requesting date: %s\", pv_system_id, date_to_load)\n datetime_of_api_request = pd.Timestamp.utcnow()\n if use_get_status:\n timeseries = self.get_status(\n pv_system_id, date_to_load, wait_if_rate_limit_exceeded=True\n )\n else:\n timeseries = self.get_batch_status(pv_system_id, date_to=date_to_load)\n if timeseries.empty:\n _LOG.info(\n \"system_id %d: Got empty timeseries back for %s\", pv_system_id, date_to_load\n )\n if use_get_status:\n _append_missing_date_range(\n output_filename,\n pv_system_id,\n date_to_load,\n date_to_load,\n datetime_of_api_request,\n )\n else:\n _append_missing_date_range(\n output_filename,\n pv_system_id,\n date_to_load - timedelta(days=365),\n date_to_load,\n datetime_of_api_request,\n )\n else:\n total_rows += len(timeseries)\n timeseries = timeseries.tz_localize(timezone)\n _LOG.info(\n \"system_id: %d: %d rows retrieved: %s to %s\",\n pv_system_id,\n len(timeseries),\n timeseries.index[0],\n timeseries.index[-1],\n )\n if use_get_status:\n check_pv_system_status(timeseries, date_to_load)\n else:\n _record_gaps(\n output_filename,\n pv_system_id,\n date_to_load,\n timeseries,\n datetime_of_api_request,\n )\n timeseries[\"datetime_of_API_request\"] = datetime_of_api_request\n timeseries[\"query_date\"] = pd.Timestamp(date_to_load)\n key = system_id_to_hdf_key(pv_system_id)\n with pd.HDFStore(output_filename, mode=\"a\", complevel=9) as store:\n with warnings.catch_warnings():\n warnings.simplefilter(\"ignore\", tables.NaturalNameWarning)\n store.append(key=key, value=timeseries, data_columns=True)\n\n _LOG.info(\"system_id %d: %d total rows downloaded\", pv_system_id, total_rows)\n return total_rows\n\n def _api_query(\n self,\n service: str,\n api_params: Dict,\n wait_if_rate_limit_exceeded: bool = False,\n use_data_service: bool = False,\n ) -> str:\n \"\"\"Send API request to PVOutput.org and return content text.\n\n Args:\n service: string, e.g. 'search' or 'getstatus'\n api_params: dict\n wait_if_rate_limit_exceeded: bool\n use_data_service: bool\n\n Raises:\n NoStatusFound\n RateLimitExceeded\n \"\"\"\n get_response_func = (\n self._get_data_service_response if use_data_service else self._get_api_response\n )\n\n try:\n response = get_response_func(service, api_params)\n except Exception as e:\n _LOG.exception(e)\n raise\n\n try:\n return self._process_api_response(response)\n except RateLimitExceeded:\n msg = \"PVOutput.org API rate limit exceeded!\" \" Rate limit will be reset at {}\".format(\n self.rate_limit_reset_time\n )\n _print_and_log(msg)\n if wait_if_rate_limit_exceeded:\n self.wait_for_rate_limit_reset()\n return self._api_query(service, api_params, wait_if_rate_limit_exceeded=False)\n\n raise RateLimitExceeded(response, msg)\n\n def _get_api_response(self, service: str, api_params: Dict) -> requests.Response:\n \"\"\"\n Args:\n service: string, e.g. 'search', 'getstatus'\n api_params: dict\n \"\"\"\n self._check_api_params()\n # Create request headers\n headers = {\n \"X-Rate-Limit\": \"1\",\n \"X-Pvoutput-Apikey\": self.api_key,\n \"X-Pvoutput-SystemId\": self.system_id,\n }\n\n api_url = urljoin(BASE_URL, \"service/r2/{}.jsp\".format(service))\n\n return _get_response(api_url, api_params, headers)\n\n def _get_data_service_response(self, service: str, api_params: Dict) -> requests.Response:\n \"\"\"\n Args:\n service: string, e.g. 'getbatchstatus'\n api_params: dict\n \"\"\"\n self._check_api_params()\n if self.data_service_url is None:\n raise ValueError(\"data_service_url must be set to use the data service!\")\n\n headers = {\"X-Rate-Limit\": \"1\"}\n api_params = api_params.copy()\n api_params[\"key\"] = self.api_key\n api_params[\"sid\"] = self.system_id\n\n api_url = urljoin(self.data_service_url, \"service/r2/{}.jsp\".format(service))\n\n return _get_response(api_url, api_params, headers)\n\n def _check_api_params(self):\n # Check we have relevant login details:\n for param_name in [\"api_key\", \"system_id\"]:\n if getattr(self, param_name) is None:\n raise ValueError(\"Please set the {} parameter.\".format(param_name))\n\n def _set_rate_limit_params(self, headers):\n for param_name, header_key in RATE_LIMIT_PARAMS_TO_API_HEADERS.items():\n header_value = int(headers[header_key])\n setattr(self, param_name, header_value)\n\n self.rate_limit_reset_time = pd.Timestamp.utcfromtimestamp(self.rate_limit_reset_time)\n self.rate_limit_reset_time = self.rate_limit_reset_time.tz_localize(\"utc\")\n\n _LOG.debug(\"%s\", self.rate_limit_info())\n\n def rate_limit_info(self) -> Dict:\n info = {}\n for param_name in RATE_LIMIT_PARAMS_TO_API_HEADERS:\n info[param_name] = getattr(self, param_name)\n return info\n\n def _process_api_response(self, response: requests.Response) -> str:\n \"\"\"Turns an API response into text.\n\n Args:\n response: from _get_api_response()\n\n Returns:\n content of the response.\n\n Raises:\n UnicodeDecodeError\n NoStatusFound\n RateLimitExceeded\n \"\"\"\n if response.status_code == 400:\n raise NoStatusFound(response=response)\n\n if response.status_code != 403:\n try:\n response.raise_for_status()\n except Exception as e:\n msg = \"Bad status code! Response content = {}. Exception = {}\".format(\n response.content, e\n )\n _LOG.exception(msg)\n raise e.__class__(msg)\n\n self._set_rate_limit_params(response.headers)\n\n # Did we overshoot our quota?\n if response.status_code == 403 and self.rate_limit_remaining <= 0:\n raise RateLimitExceeded(response=response)\n\n try:\n content = response.content.decode(\"latin1\").strip()\n except Exception as e:\n msg = \"Error decoding this string: {}\\n{}\".format(response.content, e)\n _LOG.exception(msg)\n raise\n\n # If we get to here then the content is valid :)\n return content\n\n def wait_for_rate_limit_reset(self):\n utc_now = pd.Timestamp.utcnow()\n timedelta_to_wait = self.rate_limit_reset_time - utc_now\n timedelta_to_wait += timedelta(minutes=3) # Just for safety\n secs_to_wait = timedelta_to_wait.total_seconds()\n retry_time_utc = utc_now + timedelta_to_wait\n _print_and_log(\n \"Waiting {:.0f} seconds. Will retry at {}\".format(secs_to_wait, retry_time_utc)\n )\n time.sleep(secs_to_wait)\n\n\ndef date_to_pvoutput_str(date: Union[str, datetime]) -> str:\n \"\"\"Convert datetime to date string for PVOutput.org in YYYYMMDD format.\"\"\"\n if isinstance(date, str):\n try:\n datetime.strptime(date, PV_OUTPUT_DATE_FORMAT)\n except ValueError:\n return pd.Timestamp(date).strftime(PV_OUTPUT_DATE_FORMAT)\n else:\n return date\n return date.strftime(PV_OUTPUT_DATE_FORMAT)\n\n\ndef _check_date(date: str, prediction=False):\n \"\"\"Check that date string conforms to YYYYMMDD format,\n and that the date isn't in the future.\n\n Raises:\n ValueError if the date is 'bad'.\n \"\"\"\n dt = datetime.strptime(date, PV_OUTPUT_DATE_FORMAT)\n if dt > datetime.now() and not prediction:\n raise ValueError(\n \"\"\n \"date should not be in the future. Got {}. Current date is {}.\".format(\n date, datetime.now()\n )\n )\n\n\ndef _set_date_param(dt, api_params, key):\n if dt is not None:\n dt = date_to_pvoutput_str(dt)\n _check_date(dt)\n api_params[key] = dt\n\n\ndef check_pv_system_status(pv_system_status: pd.DataFrame, requested_date: date):\n \"\"\"Checks the DataFrame returned by get_pv_system_status.\n\n Args:\n pv_system_status: DataFrame returned by get_pv_system_status\n requested_date: date.\n\n Raises:\n ValueError if the DataFrame is incorrect.\n \"\"\"\n if not isinstance(pv_system_status, pd.DataFrame):\n raise ValueError(\"pv_system_status must be a dataframe\")\n if not pv_system_status.empty:\n index = pv_system_status.index\n for d in [index[0], index[-1]]:\n if not requested_date <= d.date() <= requested_date + ONE_DAY:\n raise ValueError(\n \"A date in the index is outside the expected range.\"\n \" Date from index={}, requested_date={}\".format(d, requested_date)\n )\n\n\ndef _process_batch_status(pv_system_status_text):\n # See https://pvoutput.org/help.html#dataservice-getbatchstatus\n\n # PVOutput uses a non-standard format for the data. The text\n # needs some processing before it can be read as a CSV.\n processed_lines = []\n for line in pv_system_status_text.split(\"\\n\"):\n line_sections = line.split(\";\")\n date = line_sections[0]\n time_and_data = line_sections[1:]\n processed_line = [\n \"{date},{payload}\".format(date=date, payload=payload) for payload in time_and_data\n ]\n processed_lines.extend(processed_line)\n\n if processed_lines:\n first_line = processed_lines[0]\n num_cols = len(first_line.split(\",\"))\n if num_cols >= 8:\n raise NotImplementedError(\"Handling of consumption data is not implemented!\")\n\n processed_text = \"\\n\".join(processed_lines)\n del processed_lines\n\n columns = [\"cumulative_energy_gen_Wh\", \"instantaneous_power_gen_W\", \"temperature_C\", \"voltage\"]\n\n pv_system_status = pd.read_csv(\n StringIO(processed_text),\n names=[\"date\", \"time\"] + columns,\n parse_dates={\"datetime\": [\"date\", \"time\"]},\n index_col=[\"datetime\"],\n dtype={col: np.float64 for col in columns},\n ).sort_index()\n\n return pv_system_status\n\n\ndef _append_missing_date_range(\n output_filename, pv_system_id, missing_start_date, missing_end_date, datetime_of_api_request\n):\n\n data = {\n \"missing_start_date_PV_localtime\": pd.Timestamp(missing_start_date),\n \"missing_end_date_PV_localtime\": pd.Timestamp(missing_end_date),\n \"datetime_of_API_request\": datetime_of_api_request,\n }\n new_missing_date_range = pd.DataFrame(data, index=[pv_system_id])\n new_missing_date_range.index.name = \"pv_system_id\"\n _LOG.info(\n \"system_id %d: Recording missing date range from %s to %s\",\n pv_system_id,\n missing_start_date,\n missing_end_date,\n )\n with pd.HDFStore(output_filename, mode=\"a\", complevel=9) as store:\n store.append(key=\"missing_dates\", value=new_missing_date_range, data_columns=True)\n\n\ndef _record_gaps(output_filename, pv_system_id, date_to, timeseries, datetime_of_api_request):\n dates_of_data = (\n timeseries[\"instantaneous_power_gen_W\"].dropna().resample(\"D\").mean().dropna().index.date\n )\n dates_requested = pd.date_range(date_to - timedelta(days=365), date_to, freq=\"D\").date\n missing_dates = set(dates_requested) - set(dates_of_data)\n missing_date_ranges = _convert_consecutive_dates_to_date_ranges(list(missing_dates))\n _LOG.info(\n \"system_id %d: %d missing date ranges found: \\n%s\",\n pv_system_id,\n len(missing_date_ranges),\n missing_date_ranges,\n )\n if len(missing_date_ranges) == 0:\n return\n # Convert to from date objects to pd.Timestamp objects, because HDF5\n # doesn't like to store date objects.\n missing_date_ranges = missing_date_ranges.astype(\"datetime64\")\n missing_date_ranges[\"pv_system_id\"] = pv_system_id\n missing_date_ranges[\"datetime_of_API_request\"] = datetime_of_api_request\n missing_date_ranges.set_index(\"pv_system_id\", inplace=True)\n with pd.HDFStore(output_filename, mode=\"a\", complevel=9) as store:\n store.append(key=\"missing_dates\", value=missing_date_ranges, data_columns=True)\n\n\ndef _convert_consecutive_dates_to_date_ranges(missing_dates):\n new_missing = []\n missing_dates = np.sort(np.unique(missing_dates))\n if len(missing_dates) == 0:\n return pd.DataFrame(new_missing)\n\n gaps = np.diff(missing_dates).astype(\"timedelta64[D]\").astype(int) > 1\n gaps = np.where(gaps)[0]\n\n start_date = missing_dates[0]\n for gap_i in gaps:\n end_date = missing_dates[gap_i]\n new_missing.append(\n {\n \"missing_start_date_PV_localtime\": start_date,\n \"missing_end_date_PV_localtime\": end_date,\n }\n )\n start_date = missing_dates[gap_i + 1]\n\n end_date = missing_dates[-1]\n new_missing.append(\n {\"missing_start_date_PV_localtime\": start_date, \"missing_end_date_PV_localtime\": end_date}\n )\n\n return pd.DataFrame(new_missing)\n" ]
[ [ "pandas.Timestamp.utcfromtimestamp", "pandas.read_hdf", "pandas.to_datetime", "pandas.isnull", "numpy.unique", "pandas.DataFrame", "pandas.Timestamp.now", "numpy.diff", "pandas.HDFStore", "numpy.float32", "pandas.Timestamp", "numpy.where", "pandas.Timestamp.utcnow" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
CalciferZh/KinectRecorder
[ "cab45c35264feb4bfcde32172e2492711788b3bd" ]
[ "visualizer.py" ]
[ "import numpy as np\nimport pygame\nimport cv2\n\nfrom utils import pickle_load\nfrom utils import pickle_save\n\n\nclass RawVisualizer:\n def __init__(self, load_prefix):\n \"\"\"\n Display raw stream recorded by `KinectRecorder`.\n\n Parameter\n ---------\n load_prefix: Path to load data. Will load color stream from\n `load_prefix`_color.avi, depth stream from `load_prefix`_depth.pkl, and body\n stream from `load_prefix`_body.pkl.\n\n \"\"\"\n self.color_path = load_prefix + '_color.avi'\n self.color_src = cv2.VideoCapture(self.color_path)\n self.color_height = int(self.color_src.get(cv2.CAP_PROP_FRAME_HEIGHT))\n self.color_width = int(self.color_src.get(cv2.CAP_PROP_FRAME_WIDTH))\n\n self.depth_path = load_prefix + '_depth.pkl'\n self.depth_frames = pickle_load(self.depth_path)\n self.depth_height = self.depth_frames[0].shape[0]\n self.depth_width = self.depth_frames[0].shape[1]\n\n self.body_path = load_prefix + '_body.pkl'\n self.body_frames = pickle_load(self.body_path)\n\n self.fps = 30\n self.playing = True\n self.frame_idx = 0\n\n pygame.init()\n self.surface = pygame.Surface(\n (self.color_width + self.depth_width, self.color_height), 0, 24\n )\n self.hw_ratio = self.surface.get_height() / self.surface.get_width()\n\n # screen layout: # is color stream, * is depth, & is body index\n # ----------------------\n # |################# *****|\n # |################# *****|\n # |################# *****|\n # |################# &&&&&|\n # |################# &&&&&|\n # |################# &&&&&|\n # ----------------------\n scale = 0.6\n self.screen = pygame.display.set_mode(\n (\n int(self.surface.get_width() * scale),\n int(self.surface.get_height() * scale)\n ),\n pygame.HWSURFACE | pygame.DOUBLEBUF | pygame.RESIZABLE,\n 24\n )\n self.done = False\n self.clock = pygame.time.Clock()\n pygame.display.set_caption('Playing')\n\n self.frame = np.ones([\n self.surface.get_height(),\n self.surface.get_width(),\n 3\n ])\n\n def run(self):\n \"\"\"\n Main loop.\n\n \"\"\"\n while not self.done:\n for event in pygame.event.get():\n if event.type == pygame.QUIT:\n self.done = True\n elif event.type == pygame.VIDEORESIZE:\n self.screen = pygame.display.set_mode(\n event.dict['size'],\n pygame.HWSURFACE | pygame.DOUBLEBUF | pygame.RESIZABLE,\n 24\n )\n elif event.type == pygame.KEYDOWN:\n if self.playing:\n self.playing = False\n pygame.display.set_caption('Paused')\n else:\n self.playing = True\n pygame.display.set_caption('Playing')\n\n if self.playing:\n ret, color = self.color_src.read()\n depth = self.depth_frames[self.frame_idx]\n body = self.body_frames[self.frame_idx]\n self.frame_idx += 1\n\n if self.frame_idx == len(self.depth_frames):\n self.frame_idx = 0\n self.color_src.set(cv2.CAP_PROP_POS_FRAMES, 1)\n\n self.frame[:, :self.color_width] = np.flip(\n color, axis=-1\n ).astype(np.uint8)\n self.frame[:self.depth_height, -self.depth_width:] = np.repeat(\n depth[:, :, np.newaxis] / 4500 * 255, 3, axis=2\n ).astype(np.uint8)\n self.frame[-self.depth_height:, -self.depth_width:] = np.repeat(\n 255 - body[:, :, np.newaxis], 3, axis=2\n ).astype(np.uint8)\n pygame.surfarray.blit_array(\n self.surface, np.transpose(self.frame, axes=[1, 0, 2])\n )\n target_height = int(self.hw_ratio * self.screen.get_width())\n surface_to_draw = pygame.transform.scale(\n self.surface, (self.screen.get_width(), target_height)\n )\n self.screen.blit(surface_to_draw, (0, 0))\n surface_to_draw = None\n pygame.display.update()\n pygame.display.flip()\n\n print(self.clock.get_fps())\n self.clock.tick(self.fps)\n\n pygame.quit()\n\n\nclass AlignedVisualizer:\n def __init__(self, load_path):\n \"\"\"\n Visualize stream after alignment.\n\n Parameter\n ---------\n load_path: Path to load data.\n\n \"\"\"\n data = pickle_load(load_path)\n self.color_frames = data['colors']\n self.depth_frames = data['depths']\n self.body_frames = data['bodies']\n\n self.height = self.color_frames[0].shape[0]\n self.width = self.color_frames[0].shape[1]\n\n self.fps = 30\n self.playing = True\n self.frame_idx = 0\n\n pygame.init()\n self.surface = pygame.Surface(\n (self.width * 3, self.height), 0, 24\n )\n self.hw_ratio = self.surface.get_height() / self.surface.get_width()\n\n scale = 0.6\n self.screen = pygame.display.set_mode(\n (\n int(self.surface.get_width() * scale),\n int(self.surface.get_height() * scale)\n ),\n pygame.HWSURFACE | pygame.DOUBLEBUF | pygame.RESIZABLE,\n 24\n )\n self.done = False\n self.clock = pygame.time.Clock()\n pygame.display.set_caption('Playing')\n\n self.frame = np.ones([\n self.surface.get_height(),\n self.surface.get_width(),\n 3\n ])\n\n def run(self):\n \"\"\"\n Main loop.\n\n \"\"\"\n while not self.done:\n for event in pygame.event.get():\n if event.type == pygame.QUIT:\n self.done = True\n elif event.type == pygame.VIDEORESIZE:\n self.screen = pygame.display.set_mode(\n event.dict['size'],\n pygame.HWSURFACE | pygame.DOUBLEBUF | pygame.RESIZABLE,\n 24\n )\n elif event.type == pygame.KEYDOWN:\n if self.playing:\n self.playing = False\n pygame.display.set_caption('Paused')\n else:\n self.playing = True\n pygame.display.set_caption('Playing')\n\n if self.playing:\n color = self.color_frames[self.frame_idx]\n depth = self.depth_frames[self.frame_idx]\n body = self.body_frames[self.frame_idx]\n self.frame_idx += 1\n\n if self.frame_idx == len(self.depth_frames):\n self.frame_idx = 0\n\n self.frame[:, :self.width] = np.flip(\n color, axis=-1\n ).astype(np.uint8)\n self.frame[:, self.width:-self.width] = np.repeat(\n depth[:, :, np.newaxis] / 4500 * 255, 3, axis=2\n ).astype(np.uint8)\n self.frame[:, -self.width:] = np.repeat(\n 255 - body[:, :, np.newaxis], 3, axis=2\n ).astype(np.uint8)\n pygame.surfarray.blit_array(\n self.surface, np.transpose(self.frame, axes=[1, 0, 2])\n )\n target_height = int(self.hw_ratio * self.screen.get_width())\n surface_to_draw = pygame.transform.scale(\n self.surface, (self.screen.get_width(), target_height)\n )\n self.screen.blit(surface_to_draw, (0, 0))\n surface_to_draw = None\n pygame.display.update()\n pygame.display.flip()\n\n self.clock.tick(self.fps)\n\n pygame.quit()\n\n\nif __name__ == '__main__':\n # v = RawVisualizer('test')\n v = AlignedVisualizer('./data/yellow_top.pkl')\n v.run()\n" ]
[ [ "numpy.repeat", "numpy.flip", "numpy.transpose" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
panwalas/SDC-P5
[ "818a2de532c37f16761e2913ca3ff18d2de9f828", "818a2de532c37f16761e2913ca3ff18d2de9f828" ]
[ "vehicleLab/chogtrainingRGB2.py", "vehicleLab/chogtestRGB3.py" ]
[ "import matplotlib.image as mpimg\nimport matplotlib.pyplot as plt\nimport matplotlib.gridspec as gridspec\nimport numpy as np\nimport cv2\nimport glob\nimport time\nfrom tqdm import tqdm\nfrom sklearn.svm import LinearSVC\nfrom sklearn.preprocessing import StandardScaler\nfrom skimage.feature import hog\nfrom sklearn.externals import joblib\n# NOTE: the next import is only valid for scikit-learn version >= 0.18\n# for scikit-learn <= 0.17 use:\n# from sklearn.cross_validation import train_test_split\nfrom sklearn.model_selection import train_test_split\n\n# Define a function to compute binned color features \ndef bin_spatial(img, size=(32, 32)):\n # Use cv2.resize().ravel() to create the feature vector\n features = cv2.resize(img, size).ravel() \n # Return the feature vector\n return features\n\n# Define a function to compute color histogram features \ndef color_hist(img, nbins=32, bins_range=(0, 256)):\n # Compute the histogram of the color channels separately\n channel1_hist = np.histogram(img[:,:,0], bins=nbins, range=bins_range)\n channel2_hist = np.histogram(img[:,:,1], bins=nbins, range=bins_range)\n channel3_hist = np.histogram(img[:,:,2], bins=nbins, range=bins_range)\n # Concatenate the histograms into a single feature vector\n hist_features = np.concatenate((channel1_hist[0], channel2_hist[0], channel3_hist[0]))\n # Return the individual histograms, bin_centers and feature vector\n return hist_features\n\n# Define a function to return HOG features and visualization\ndef get_hog_features(img, orient, pix_per_cell, cell_per_block, \n vis=False, feature_vec=True):\n # Call with two outputs if vis==True\n if vis == True:\n features, hog_image = hog(img, orientations=orient, pixels_per_cell=(pix_per_cell, pix_per_cell),\n cells_per_block=(cell_per_block, cell_per_block), transform_sqrt=True, \n visualise=vis, feature_vector=feature_vec)\n return features, hog_image\n # Otherwise call with one output\n else: \n features = hog(img, orientations=orient, pixels_per_cell=(pix_per_cell, pix_per_cell),\n cells_per_block=(cell_per_block, cell_per_block), transform_sqrt=True, \n visualise=vis, feature_vector=feature_vec)\n return features\n\n# Define a function to extract features from a list of images\n# Have this function call bin_spatial() and color_hist()\ndef extract_features(imgs, cspace='RGB', spatial_size=(32, 32),\n hist_bins=32, hist_range=(0, 256), orient=9, \n pix_per_cell=8, cell_per_block=2, hog_channel=0, datatype='', visualize=False):\n # Create a list to append feature vectors to\n features = []\n # Iterate through the list of images\n images_pbar = tqdm(range(len(imgs)), desc='Loading '+datatype+' Dataset', unit=' features')\n for i in images_pbar:\n file = imgs[i]\n # Read in each one by one\n image = cv2.cvtColor(cv2.imread(file), cv2.COLOR_BGR2RGB)\n # apply color conversion if other than 'RGB'\n if cspace != 'RGB':\n if cspace == 'HSV':\n feature_image = cv2.cvtColor(image, cv2.COLOR_RGB2HSV)\n elif cspace == 'LUV':\n feature_image = cv2.cvtColor(image, cv2.COLOR_RGB2LUV)\n elif cspace == 'HLS':\n feature_image = cv2.cvtColor(image, cv2.COLOR_RGB2HLS)\n elif cspace == 'YUV':\n feature_image = cv2.cvtColor(image, cv2.COLOR_RGB2YUV)\n else: feature_image = np.copy(image) \n # Apply bin_spatial() to get spatial color features\n spatial_features = bin_spatial(feature_image, size=spatial_size)\n # Apply color_hist() also with a color space option now\n hist_features = color_hist(feature_image, nbins=hist_bins, bins_range=hist_range)\n # Call get_hog_features() with vis=False, feature_vec=True\n if visualize:\n hog_features, hog_image = get_hog_features(feature_image[:,:,hog_channel], orient, \n pix_per_cell, cell_per_block, vis=visualize, feature_vec=True)\n # print(\"hog_image: \", hog_image.shape, type(hog_image[0][0]), np.min(hog_image), np.max(hog_image))\n # print(\"image: \", image.shape, type(image[0][0][0]), np.min(image), np.max(image))\n minhog = np.min(hog_image)\n hog_image = hog_image - minhog\n maxhog = np.max(hog_image)\n hog_image = ((hog_image/maxhog)*255).astype(np.uint8)\n return image, hog_image\n else:\n hog_features = get_hog_features(feature_image[:,:,hog_channel], orient, \n pix_per_cell, cell_per_block, vis=False, feature_vec=True)\n # Append the new feature vector to the features list\n features.append(np.concatenate((spatial_features, hist_features, hog_features)))\n # Return list of feature vectors\n return features\n\n# Define a way for us to write out a sample of the HOG\ndef drawPlots(imagefile, sampleTitle, orient, pix_per_cell, cell_per_block, trainScore, testScore, carimage, carhog, notcarimage, notcarhog, deltaTime):\n print(\"saving sample image and hogs to \", imagefile)\n # Setup plot\n fig = plt.figure(figsize=(10, 3))\n w_ratios = [1 for n in range(5)]\n h_ratios = [1 for n in range(1)]\n grid = gridspec.GridSpec(1, 5, wspace=0.0, hspace=0.0, width_ratios=w_ratios, height_ratios=h_ratios)\n i = 0\n\n # draw the images\n # next image\n sampleTitleWScores = '%s\\n Orientation: %d\\n Pix_per_cell: %d\\n Cell_per_block: %d\\n Train Accuracy:\\n %10.9f\\n Test Accuracy:\\n %10.9f\\n Decision Time:\\n %10.9f'%(sampleTitle, orient, pix_per_cell, cell_per_block, trainScore, testScore, deltaTime)\n ax = plt.Subplot(fig, grid[i])\n ax.text(0.1,0.4, sampleTitleWScores, fontsize=8)\n ax.set_xticks([])\n ax.set_yticks([])\n for sp in ax.spines.values():\n sp.set_visible(False)\n fig.add_subplot(ax)\n i += 1\n\n ax = plt.Subplot(fig, grid[i])\n ax.imshow(carimage)\n if i==1:\n ax.set_title('Sample Car Image', size=8)\n ax.set_xticks([])\n ax.set_yticks([])\n fig.add_subplot(ax)\n i += 1\n\n ax = plt.Subplot(fig, grid[i])\n ax.imshow(carhog, cmap='gray')\n if i==2:\n ax.set_title('Sample Car HOG', size=8)\n ax.set_xticks([])\n ax.set_yticks([])\n fig.add_subplot(ax)\n i += 1\n\n ax = plt.Subplot(fig, grid[i])\n ax.imshow(notcarimage)\n if i==3:\n ax.set_title('Sample Noncar Image', size=8)\n ax.set_xticks([])\n ax.set_yticks([])\n fig.add_subplot(ax)\n i += 1\n\n ax = plt.Subplot(fig, grid[i])\n ax.imshow(notcarhog, cmap='gray')\n if i==4:\n ax.set_title('Sample Noncar HOG', size=8)\n\n ax.set_xticks([])\n ax.set_yticks([])\n fig.add_subplot(ax)\n i += 1\n\n plt.savefig(imagefile)\n\n# Divide up into cars and notcars\n# NOTE: Using our own collected data from 'birds-eye' view\ncars = glob.glob('../vehicles/*/*/*.jpg')\nnotcars = glob.glob('../non-vehicles/*/*/*.jpg')\n\nprint(\"number of original car samples: \", len(cars))\nprint(\"number of original non-car samples: \", len(notcars))\norient = 8\npix_per_cell = 4\ncell_per_block = 2\n\nt=time.time()\ncar_features = extract_features(cars, cspace='RGB', spatial_size=(32, 32),\n orient=orient, pix_per_cell=pix_per_cell, cell_per_block=cell_per_block,\n hist_bins=32, hist_range=(0, 256), datatype='Car')\nnotcar_features = extract_features(notcars, cspace='RGB', spatial_size=(32, 32),\n orient=orient, pix_per_cell=pix_per_cell, cell_per_block=cell_per_block,\n hist_bins=32, hist_range=(0, 256), datatype='Noncar')\nt2 = time.time()\nprint(t2-t, 'Seconds to load dataset...')\n\nt=time.time()\nprint(\"Data loaded, now scaling and splitting dataset...\")\n\n# Create an array stack of feature vectors\nX = np.vstack((car_features, notcar_features)).astype(np.float64) \n# Fit a per-column scaler\nX_scaler = StandardScaler().fit(X)\n# Apply the scaler to X\nscaled_X = X_scaler.transform(X)\n\n# Define the labels vector\ny = np.hstack((np.ones(len(car_features)), np.zeros(len(notcar_features))))\n\n# Split up data into randomized training and test sets\nrand_state = np.random.randint(0, 100)\nX_train, X_test, y_train, y_test = train_test_split(\n scaled_X, y, test_size=0.2, random_state=rand_state)\n\nt2 = time.time()\nprint(t2-t, 'Seconds to scale and split dataset...')\n\nprint(\"training set size:\", len(X_train))\nprint(\"testing set size:\", len(X_test))\n\n# Use a linear SVC \nsvc = LinearSVC()\n# Check the training time for the SVC\nt=time.time()\nsvc.fit(X_train, y_train)\nt2 = time.time()\nprint(t2-t, 'Seconds to train SVC...')\n# Check the score of the SVC\ntrainingScore = svc.score(X_train, y_train)\ntestingScore = svc.score(X_test, y_test)\nprint('Train Accuracy of SVC = ', trainingScore)\nprint('Test Accuracy of SVC = ', testingScore)\n# Check the prediction time for a single sample\nt=time.time()\nconfidence = svc.decision_function(X_test[0].reshape(1, -1))\nt2 = time.time()\ndeltatime = t2-t\nprint(deltatime, 'Seconds to run decision_function with SVC')\n\n# versionName for this version\nversionName = 'CHOGRGB2'\n\n# saving trained SVC model:\ntrained_model = './trained/'+versionName+'.pkl'\ntrained_scalar = './trained/scaler'+versionName+'.pkl'\nvisualfile = './visualized/'+versionName+'.jpg'\n\nprint('saving trained model to', trained_model) \njoblib.dump(svc, trained_model)\nprint('saving trained scalar to', trained_scalar)\njoblib.dump(X_scaler, trained_scalar)\n\ncarimage, carhog = extract_features([cars[0]], cspace='RGB', spatial_size=(32, 32),\n orient=orient, pix_per_cell=pix_per_cell, cell_per_block=cell_per_block,\n hist_bins=32, hist_range=(0, 256), datatype='Car', visualize=True)\nnotcarimage, notcarhog = extract_features([notcars[0]], cspace='RGB', spatial_size=(32, 32),\n orient=orient, pix_per_cell=pix_per_cell, cell_per_block=cell_per_block,\n hist_bins=32, hist_range=(0, 256), datatype='Noncar', visualize=True)\ndrawPlots(visualfile, versionName, orient, pix_per_cell, cell_per_block, trainingScore, testingScore, carimage, carhog, notcarimage, notcarhog, deltatime)\n\n", "import matplotlib.image as mpimg\nimport matplotlib.pyplot as plt\nimport matplotlib.gridspec as gridspec\nimport numpy as np\nimport cv2\nimport glob\nimport time\nfrom sklearn.svm import LinearSVC\nfrom sklearn.preprocessing import StandardScaler\nfrom skimage.feature import hog\nfrom sklearn.externals import joblib\nfrom testlib.slidingWindows import SlidingWindows\nfrom testlib.CHOG import CHOG\n\nversionName = 'CHOGRGB3'\ntrained_model = './trained/'+versionName+'.pkl'\ntrained_scalar = './trained/scaler'+versionName+'.pkl'\nvisualfile = './visualized/'+versionName+'-augmented.jpg'\n\norient = 9\npix_per_cell = 8\ncell_per_block = 2\n\n# try to make thresholds LOWER!\n# remove more false positives\n# going down from 13.0\n# going down from 12.0\n# going down from 10.0\n# going down from 8.0\n# going up from 5.0\n# going down from 6.0\n# going up from 5.5\n# locked\nhthreshold = 5.75\n\n# remove more false negatives\n# going down from 2.0\n# going down from 1.5\n# going down from 1.0 <-- can see edge car and car 2 3 in test 22\n# going down from 0.8 <-- can see edge car and car 1 2 3 in test 22\n# going down from 0.7 <-- can see edge car and car 1 2 3 in test 22\n# going down from 0.5 <-- can see edge car and car 1 2 3 in test 22 but still no 4\n# going down from 0.0 <-- can see edge car and car 1 2 3 in test 22 but still no 4\n# going down from -1.0 <-- can see edge car and car 1 2 3 and 4 test 22 but still no (5)\n# going down from -2.0 <-- can see edge car and car 1 2 3 4 and (5) test 22\n# going down from -1.5 <-- can see edge car and car 1 2 3 4 test 22\nlthreshold = -1.75\n\nsvc = joblib.load(trained_model) \nslide_window = SlidingWindows()\nchog = CHOG(trained_scalar=trained_scalar)\n\noutimages = []\nimages = glob.glob('./test_images/test*proj.jpg')\nfor file in images: \n print(\"processing: \", file)\n image = cv2.cvtColor(cv2.imread(file), cv2.COLOR_BGR2RGB)\n\n print(\"initializing...\")\n windows = slide_window.completeScan(file)\n\n foundwindows = []\n print(\"Processing\",len(windows),\"windows high...\")\n for window in windows:\n wimage = image[window[0][1]:window[1][1], window[0][0]:window[1][0]]\n wfeatures = chog.extract_features(wimage, cspace='RGB', spatial_size=(32, 32),\n orient=orient, pix_per_cell=pix_per_cell, cell_per_block=cell_per_block,\n hist_bins=32, hist_range=(0, 256))\n if wfeatures is not None:\n confidence = svc.decision_function(wfeatures.reshape(1, -1))\n if confidence[0] > hthreshold:\n foundwindows.append(window)\n window_img1 = chog.draw_boxes(image, foundwindows, color=(0, 0, 255), thick=2)\n\n foundwindows = []\n print(\"Processing\",len(windows),\"windows low...\")\n for window in windows:\n wimage = image[window[0][1]:window[1][1], window[0][0]:window[1][0]]\n wfeatures = chog.extract_features(wimage, cspace='RGB', spatial_size=(32, 32),\n orient=orient, pix_per_cell=pix_per_cell, cell_per_block=cell_per_block,\n hist_bins=32, hist_range=(0, 256))\n if wfeatures is not None:\n confidence = svc.decision_function(wfeatures.reshape(1, -1))\n if confidence[0] > lthreshold:\n foundwindows.append(window)\n window_img2 = chog.draw_boxes(image, foundwindows, color=(0, 0, 255), thick=2)\n\n outimages.append((file, orient, pix_per_cell, cell_per_block, window_img1, window_img2))\n\nchog.drawPlots(visualfile, versionName, outimages, hthreshold, lthreshold)\n\n" ]
[ [ "matplotlib.pyplot.Subplot", "sklearn.externals.joblib.dump", "numpy.min", "matplotlib.pyplot.figure", "sklearn.model_selection.train_test_split", "matplotlib.pyplot.savefig", "numpy.concatenate", "numpy.max", "numpy.copy", "matplotlib.gridspec.GridSpec", "sklearn.svm.LinearSVC", "sklearn.preprocessing.StandardScaler", "numpy.histogram", "numpy.vstack", "numpy.random.randint" ], [ "sklearn.externals.joblib.load" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] }, { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
prefrontalvortex/SigFlux
[ "aa1cb1d4fe66b37ac6f659068678853756117060" ]
[ "sigflux/logscale.py" ]
[ "import numpy as np\nfrom scipy import fftpack, interpolate, signal\n\nfrom sigflux import clip\n\n\ndef freq_logscale(data, ndim=1024, fs=400, down=30, smoothing_cutoff=1, hard_cutoff=200, log_low_cut=-2.32,\n prenormalize=True, useEnvelope=True):\n \"\"\"\n This function returns a distorted version (x-axis log-transformed) of the fourier transform of the signal, related\n to the Mel scale (equal distance is equal temperment (pitch) not frequency)\n :param data: input data, [n,t] array-like\n :param ndim: dimension of output vector\n :param fs: input data sampling frequency\n :param smoothing_cutoff: 'Frequency' of smoothing the spectrum\n :param hard_cutoff: Chop off the frequency spectrum above this frequency\n :param log_low_cut: Sets how much to include very low frequency components\n :return:\n \"\"\"\n if prenormalize:\n data = clip.norm_softclip(data)\n\n if useEnvelope:\n data = clip.envelope(data)\n\n # FFT and magnitude\n ftsig = fftpack.fft(data, axis=0)\n ftsig_a = np.abs(ftsig[:len(ftsig)*hard_cutoff//fs])\n # Smooth it with low pass and downsample. Low pass may not be necessary since resample does appropriate\n # pre-filtering\n ftsig_r = signal.resample_poly(ftsig_a, 1, down, axis=0)\n\n # Ok, now the weird bit. Take the existing x-domain and create an interpolation image of it\n t_rs = np.linspace(0.0001, hard_cutoff, len(ftsig_r))\n fn_ftsig_rs = interpolate.Akima1DInterpolator(t_rs, ftsig_r)\n # And now map an exponential domain, thereby creating a higher density of points around the main freq\n x_basis = np.linspace(log_low_cut, np.log2(hard_cutoff), ndim)\n log_ftsig = fn_ftsig_rs(np.power(2, x_basis))\n return log_ftsig" ]
[ [ "numpy.log2", "scipy.signal.resample_poly", "numpy.power", "scipy.interpolate.Akima1DInterpolator", "scipy.fftpack.fft" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [ "1.6", "1.10", "1.4", "1.9", "0.19", "1.5", "0.18", "1.2", "1.7", "1.0", "1.3", "1.8" ], "tensorflow": [] } ]
niab/dip
[ "b83d6d10762adb28c29b116565d17538b6129a2a" ]
[ "common.py" ]
[ "import csv\nimport pymongo\nimport numpy as np\nimport math\nfrom collections import OrderedDict\nfrom decimal import Decimal\nfrom scipy.stats import fisher_exact\n\n#################\n### CONSTANTS ###\n#################\n\nDB_HOST = 'localhost'\nDB_PORT = 27017\nDB_NAME_GR = 'gr' \nDB_NAME_EXAC = 'exac'\n\t\t\t\n\t\t\t\nclass MongoDB():\n\t\"\"\"Database Client.\"\"\"\n\tdef __init__(self):\n\t\tclient = pymongo.MongoClient(host=DB_HOST, port=DB_PORT, document_class=OrderedDict)\n\t\tself.main = client[DB_NAME_GR]\n\t\tself.exac = client[DB_NAME_EXAC]\n\n\n\ndef file_len(fname):\n\t\"\"\"Calculate length of a file.\"\"\"\n\twith open(fname) as f:\n\t\tfor i, l in enumerate(f):\n\t\t\tpass\n\treturn i + 1\n\n\ndef is_float(x):\n\t\"\"\"Check if value (e.g. string) can be converted to float.\"\"\"\n\ttry:\n\t\ta = float(x)\n\texcept ValueError:\n\t\treturn False\n\telse:\n\t\treturn True\n\n\ndef is_int(x):\n\t\"\"\"Check if value (e.g. string) can be converted to integer.\"\"\"\n\ttry:\n\t\ta = float(x)\n\t\tb = int(a)\n\texcept ValueError:\n\t\treturn False\n\telse:\n\t\treturn a == b\n\n\ndef calculate_percentiles(ranked_list, reverse=False):\n\t\"\"\"Return list of percetiles based on number of elements in input list.\"\"\"\n\tpercentiles = OrderedDict()\n\tmax_num = len(ranked_list)\n\n\tpercentile = 0.0\n\tfor x in range(0, max_num):\n\t\tif reverse:\n\t\t\tpercentile = (1 - float(x + 1) / max_num) * 100\n\t\telse:\n\t\t\tpercentile = float(x + 1) / max_num * 100\n\t\tpercentiles[ranked_list[x]] = percentile\n\n\treturn percentiles\n\n\ndef write_table_to_csv(table, output_csv, delimiter=','):\n\t\"\"\"Write table (list of lists) to csv.\"\"\"\n\toutput_file = open(output_csv,'w+')\n\twriter = csv.writer(output_file, delimiter=delimiter)\n\n\tfor row in table:\n\t\twriter.writerow(row)\n\n\toutput_file.close()\n\n\ndef sort_dict_by_values(dictionary, reverse=False):\n\t\"\"\"Return dictionary sorted by values.\"\"\"\n\tsorted_tuples = sorted(dictionary.items(), key=lambda x: x[1], reverse=reverse)\n\tresult = OrderedDict()\n\tfor x in range(0, len(sorted_tuples)):\n\t\tresult[sorted_tuples[x][0]] = sorted_tuples[x][1]\n\treturn result\n\n\ndef float_to_sci_str(num):\n\treturn \"{:.2E}\".format(Decimal(num))\n\n\ndef proportion_to_percents_str(proportion):\n\treturn \"{0:.1f}\".format(proportion*100)\n\n\ndef get_sorted_gene_list(db, collection_name, score_field, reverse=False, ignored_genes=set(), filters={}):\n\tgene_scores = {}\n\tgenes = db.drt[collection_name].find(filters)\n\tfor gene in genes:\n\t\tgene_id = gene['hgnc_id']\n\t\tif gene_id not in ignored_genes:\n\t\t\tgene_scores[gene['hgnc_id']] = gene[score_field]\n\n\tgene_scores = sort_dict_by_values(gene_scores, reverse=reverse)\n\treturn gene_scores\n\n\ndef remove_non_valid_keys_from_dict(dictionary, valid_keys):\n\tupdated_dict = OrderedDict()\n\tfor key, value in dictionary.iteritems():\n\t\tif key in valid_keys:\n\t\t\tupdated_dict[key] = value\n\treturn updated_dict\n\n\ndef get_str_ratio(n, total, only_ratio=False):\n\tratio = float(n * 100 / total)\n\tif only_ratio:\n\t\tstr_ratio = \"{:.2f}\".format(ratio)\n\telse:\n\t\tstr_ratio = \"{} ({:.2f}%)\".format(n, ratio)\n\treturn str_ratio\n\n\ndef report_gene_group_enrichment_in_the_subset(group_name, gene_subset_ids, all_gene_ids, gene_group_ids):\n\tgene_subset_ids = set(gene_subset_ids)\n\tall_gene_ids = set(all_gene_ids)\n\tgene_group_ids = set(gene_group_ids)\n\n\tsubset = len(gene_subset_ids)\n\ttotal = len(all_gene_ids)\n\tgroup_and_all = len(gene_group_ids & all_gene_ids)\n\tgroup_and_subset = len(gene_group_ids & gene_subset_ids)\n\n\tfe, p = fisher_exact([[group_and_subset, subset],\n\t\t\t\t\t\t [group_and_all, total]])\n\tprint([[group_and_subset, subset],\n\t\t\t\t\t\t [group_and_all, total]])\n\tprint('### {} ###'.format(group_name, group_and_all))\n\tprint('Examined subset {}/{}, {:.2f}%'.format(subset, total, subset*100/total))\n\tprint('{} in the subset {}/{}, {:.2f}%'.format(group_name, group_and_subset,\n\t\t\t\t\t\t\t\t\t\t group_and_all, group_and_subset*100/group_and_all))\n\tprint('FE: {:.3f}, P-value: {}'.format(fe, p))\n\n\ndef get_metric_ranked_gene_scores(db, collection_name, score_field, reverse=False, valid_gene_ids=set()):\n\tmetric_scores = OrderedDict()\n\tmetric_genes = db.main[collection_name].find({})\n\tfor metric_gene in metric_genes:\n\t\tgene_id = metric_gene['hgnc_gene_id']\n\t\tif valid_gene_ids and gene_id not in valid_gene_ids:\n\t\t\tcontinue\t\t\n\t\tmetric_scores[gene_id] = metric_gene[score_field]\n\tmetric_scores = sort_dict_by_values(metric_scores, reverse=reverse)\n\treturn metric_scores\n\t\n\n# Modified J.Vo answer from here:\n# https://stackoverflow.com/questions/30098263/inserting-a-document-with-pymongo-invaliddocument-cannot-encode-object\ndef correct_encoding(obj):\n\t\"\"\"Correct the encoding of python dictionaries so they can be encoded to mongodb\n\tinputs\n\t-------\n\tdictionary : dictionary instance to add as document\n\toutput\n\t-------\n\tnew : new dictionary with (hopefully) corrected encodings\"\"\"\n\n\tif isinstance(obj, dict):\n\t\tnew_dict = {}\n\t\tfor key, val in obj.items():\n\t\t\tval = correct_encoding(val)\n\t\t\tnew_dict[key] = val\n\t\treturn new_dict\n\telif isinstance(obj, list):\n\t\tnew_list = []\n\t\tfor val in obj:\n\t\t\tval = correct_encoding(val)\n\t\t\tnew_list.append(val)\n\t\treturn new_list\n\telse:\n\t\tif isinstance(obj, np.bool_):\n\t\t\tobj = bool(obj)\n\n\t\tif isinstance(obj, np.int64):\n\t\t\tobj = int(obj)\n\n\t\tif isinstance(obj, np.float64):\n\t\t\tobj = float(obj)\n\t\treturn obj\n\n\ndef get_keys_from_dict_based_on_value_threshold(dictionary, threshold, comparison_mode):\n\tkeys = []\n\tfor key, value in dictionary.items():\n\t\tif comparison_mode == '>=' and value >= threshold:\n\t\t\tkeys.append(key)\n\t\telif comparison_mode == '<=' and value <= threshold:\n\t\t\tkeys.append(key)\n\t\telif comparison_mode == '>' and value > threshold:\n\t\t\tkeys.append(key)\n\t\telif comparison_mode == '<' and value < threshold:\n\t\t\tkeys.append(key)\n\t\telif comparison_mode == '==' and value == threshold:\n\t\t\tkeys.append(key)\n\treturn keys\n\n\ndef calculate_clf_performance(tp, fp, p_all):\n\tprec = tp / (tp + fp)\n\trec = tp / p_all\n\tf1 = 2 * (prec * rec) / (prec + rec)\n\n\tmetrics = OrderedDict()\n\tmetrics['Precision'] = '{:.2f}%'.format(prec * 100)\n\tmetrics['Recall'] = '{:.2f}%'.format(rec * 100)\n\tmetrics['F1'] = '{:.2f}%'.format(f1 * 100)\n\treturn metrics" ]
[ [ "scipy.stats.fisher_exact" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [ "0.13", "1.6", "0.14", "1.10", "0.15", "1.4", "0.16", "1.9", "0.19", "1.5", "0.18", "1.2", "1.7", "0.12", "1.0", "0.17", "1.3", "1.8" ], "tensorflow": [] } ]
gy29289957/deep-anpr
[ "e4e1bc8f1f560f0f01b4c39d6302d8d8edde89fd" ]
[ "common.py" ]
[ "# Copyright (c) 2016 Matthew Earl\n# \n# Permission is hereby granted, free of charge, to any person obtaining a copy\n# of this software and associated documentation files (the \"Software\"), to deal\n# in the Software without restriction, including without limitation the rights\n# to use, copy, modify, merge, publish, distribute, sublicense, and/or sell\n# copies of the Software, and to permit persons to whom the Software is\n# furnished to do so, subject to the following conditions:\n# \n# The above copyright notice and this permission notice shall be included\n# in all copies or substantial portions of the Software.\n# \n# THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS\n# OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF\n# MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN\n# NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,\n# DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR\n# OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE\n# USE OR OTHER DEALINGS IN THE SOFTWARE.\n\n\"\"\"\nDefinitions that don't fit elsewhere.\n\n\"\"\"\n\n__all__ = (\n 'DIGITS',\n 'LETTERS',\n 'CHARS',\n 'sigmoid',\n 'softmax',\n)\n\nimport numpy\n\n\nDIGITS = \"0123456789\"\nLETTERS = \"ABCDEFGHJKLMNPQRSTUVWXYZ\"\nDASH = \"-\"\nCHARS = LETTERS + DASH + DIGITS\n\ndef softmax(a):\n exps = numpy.exp(a.astype(numpy.float64))\n return exps / numpy.sum(exps, axis=-1)[:, numpy.newaxis]\n\ndef sigmoid(a):\n return 1. / (1. + numpy.exp(-a))\n\n" ]
[ [ "numpy.exp", "numpy.sum" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
Tjorriemorrie/trading
[ "aafa15a6c564bfa86948ab30e33d554172b38a3e" ]
[ "19_rf_kelly/main.py" ]
[ "import logging as log\nimport pandas as pd\nimport numpy as np\nfrom sklearn.preprocessing import scale\nfrom sklearn.cross_validation import train_test_split\nfrom indicators import ewma, rsi\n\n\nDATA = [\n {'currency': 'AUDUSDe', 'timeframe': 1440},\n {'currency': 'EURGBPe', 'timeframe': 1440},\n {'currency': 'EURJPYe', 'timeframe': 1440},\n {'currency': 'EURUSDe', 'timeframe': 1440},\n {'currency': 'GBPJPYe', 'timeframe': 1440},\n {'currency': 'GBPUSDe', 'timeframe': 1440},\n {'currency': 'NZDUSDe', 'timeframe': 1440},\n {'currency': 'USDCADe', 'timeframe': 1440},\n {'currency': 'USDCHFe', 'timeframe': 1440},\n {'currency': 'USDJPYe', 'timeframe': 1440},\n]\n\n\ndef loadData(currency, timeframe):\n log.info('Data: loading...')\n df = pd.read_csv(\n r'../data/{0}{1}.csv'.format(currency, timeframe),\n names=['date', 'time', 'open', 'high', 'low', 'close', 'volume'],\n parse_dates=[['date', 'time']],\n index_col=0,\n )\n # print df\n log.info('Data: {0} loaded'.format(len(df)))\n return df\n\n\ndef getLabels(df):\n log.info('Getting labels...')\n tmp = df.copy()\n tmp['label'] = tmp['close'].shift(-1)\n tmp['label'] = tmp.apply(lambda x: 'long' if x['label'] - x['close'] >= 0 else 'short', axis=1)\n log.info('Labels set')\n return tmp['label']\n\n\ndef splitAndScale(df, labels):\n log.info('Scaling features')\n features = df.copy()\n\n # drop\n features.drop(['open', 'high', 'low', 'close', 'volume'], axis=1, inplace=True)\n\n # split\n X_train, X_test, y_train, y_test = train_test_split(features, labels)\n\n # scale\n X_train = scale(X_train, axis=0, copy=False)\n X_test = scale(X_test, axis=0, copy=False)\n\n log.info('Scaled features')\n return X_train, X_test, y_train, y_test\n\n\ndef addEwma(df, fibos):\n log.info('Adding EWMA {0}'.format(fibos))\n ewmas = {}\n for n in fibos:\n ewmas[n] = ewma(df, 'close', n)\n for i, n in enumerate(fibos):\n for m in fibos[i+1:]:\n df['ewma_{0}_{1}'.format(n, m)] = ewmas[n] / ewmas[m]\n log.info('Added EWMA {0}'.format(fibos))\n\n\ndef addRsi(df, fibos):\n log.info('Adding RSI {0}'.format(fibos))\n rsis = {}\n for n in fibos:\n rsis[n] = rsi(df, n)\n for i, n in enumerate(fibos):\n for m in fibos[i+1:]:\n df['rsi_{0}_{1}'.format(n, m)] = rsis[n] / rsis[m]\n\n df.replace(to_replace=[np.inf, -np.inf], value=0, method='ffil', inplace=True)\n df.fillna(0, inplace=True)\n\n log.info('Added RSI {0}'.format(fibos))\n\n\n" ]
[ [ "sklearn.preprocessing.scale", "sklearn.cross_validation.train_test_split" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [] } ]
RyanRizzo96/RL_baselines
[ "4f7c217095c6b02093386ed4e527c44c79b42007" ]
[ "custom/aggregator.py" ]
[ "# MIT License\n# Copyright (c) 2019 Sebastian Penhouet\n# GitHub project: https://github.com/Spenhouet/tensorboard-aggregator\n# ==============================================================================\n\"\"\"Aggregates multiple tensorbaord runs\"\"\"\n\nimport ast\nimport argparse\nimport os\nimport re\nfrom pathlib import Path\n\nimport pandas as pd\nimport numpy as np\nimport tensorflow as tf\nfrom tensorboard.backend.event_processing.event_accumulator import EventAccumulator\nfrom tensorflow.core.util.event_pb2 import Event\n\nFOLDER_NAME = 'aggregates'\n\n\ndef extract(dpath, subpath):\n scalar_accumulators = [EventAccumulator(str(dpath / dname / subpath)).Reload(\n ).scalars for dname in os.listdir(dpath) if dname != FOLDER_NAME]\n\n # Filter non event files\n scalar_accumulators = [scalar_accumulator for scalar_accumulator in scalar_accumulators if scalar_accumulator.Keys()]\n\n # Get and validate all scalar keys\n all_keys = [tuple(scalar_accumulator.Keys()) for scalar_accumulator in scalar_accumulators]\n assert len(set(all_keys)) == 1, \"All runs need to have the same scalar keys. There are mismatches in {}\".format(all_keys)\n keys = all_keys[0]\n\n all_scalar_events_per_key = [[scalar_accumulator.Items(key) for scalar_accumulator in scalar_accumulators] for key in keys]\n\n # Get and validate all steps per key\n all_steps_per_key = [[tuple(scalar_event.step for scalar_event in scalar_events) for scalar_events in all_scalar_events]\n for all_scalar_events in all_scalar_events_per_key]\n\n for i, all_steps in enumerate(all_steps_per_key):\n assert len(set(all_steps)) == 1, \"For scalar {} the step numbering or count doesn't match. Step count for all runs: {}\".format(\n keys[i], [len(steps) for steps in all_steps])\n\n steps_per_key = [all_steps[0] for all_steps in all_steps_per_key]\n\n # Get and average wall times per step per key\n wall_times_per_key = [np.mean([tuple(scalar_event.wall_time for scalar_event in scalar_events) for scalar_events in all_scalar_events], axis=0)\n for all_scalar_events in all_scalar_events_per_key]\n\n # Get values per step per key\n values_per_key = [[[scalar_event.value for scalar_event in scalar_events] for scalar_events in all_scalar_events]\n for all_scalar_events in all_scalar_events_per_key]\n\n all_per_key = dict(zip(keys, zip(steps_per_key, wall_times_per_key, values_per_key)))\n\n return all_per_key\n\n\ndef aggregate_to_summary(dpath, aggregation_ops, extracts_per_subpath):\n for op in aggregation_ops:\n for subpath, all_per_key in extracts_per_subpath.items():\n path = dpath / FOLDER_NAME / op.__name__ / dpath.name / subpath\n aggregations_per_key = {key: (steps, wall_times, op(values, axis=0)) for key, (steps, wall_times, values) in all_per_key.items()}\n write_summary(path, aggregations_per_key)\n\n\ndef write_summary(dpath, aggregations_per_key):\n writer = tf.summary.FileWriter(dpath)\n\n for key, (steps, wall_times, aggregations) in aggregations_per_key.items():\n for step, wall_time, aggregation in zip(steps, wall_times, aggregations):\n summary = tf.Summary(value=[tf.Summary.Value(tag=key, simple_value=aggregation)])\n scalar_event = Event(wall_time=wall_time, step=step, summary=summary)\n writer.add_event(scalar_event)\n\n writer.flush()\n\n\ndef aggregate_to_csv(dpath, aggregation_ops, extracts_per_subpath):\n for subpath, all_per_key in extracts_per_subpath.items():\n for key, (steps, wall_times, values) in all_per_key.items():\n aggregations = [op(values, axis=0) for op in aggregation_ops]\n write_csv(dpath, subpath, key, dpath.name, aggregations, steps, aggregation_ops)\n\n\ndef get_valid_filename(s):\n s = str(s).strip().replace(' ', '_')\n return re.sub(r'(?u)[^-\\w.]', '', s)\n\n\ndef write_csv(dpath, subpath, key, fname, aggregations, steps, aggregation_ops):\n path = dpath / FOLDER_NAME\n\n if not path.exists():\n os.makedirs(path)\n\n file_name = get_valid_filename(key) + '-' + get_valid_filename(subpath) + '-' + fname + '.csv'\n aggregation_ops_names = [aggregation_op.__name__ for aggregation_op in aggregation_ops]\n df = pd.DataFrame(np.transpose(aggregations), index=steps, columns=aggregation_ops_names)\n df.to_csv(path / file_name, sep=',')\n\n\ndef aggregate(dpath, output, subpaths):\n name = dpath.name\n\n aggregation_ops = [np.mean, np.min, np.max, np.median, np.std, np.var]\n\n ops = {\n 'summary': aggregate_to_summary,\n 'csv': aggregate_to_csv\n }\n\n print(\"Started aggregation {}\".format(name))\n\n extracts_per_subpath = {subpath: extract(dpath, subpath) for subpath in subpaths}\n\n ops.get(output)(dpath, aggregation_ops, extracts_per_subpath)\n\n print(\"Ended aggregation {}\".format(name))\n\n\nif __name__ == '__main__':\n def param_list(param):\n p_list = ast.literal_eval(param)\n if type(p_list) is not list:\n raise argparse.ArgumentTypeError(\"Parameter {} is not a list\".format(param))\n return p_list\n\n parser = argparse.ArgumentParser()\n parser.add_argument(\"--path\", type=str, help=\"main path for tensorboard files\", default=os.getcwd())\n parser.add_argument(\"--subpaths\", type=param_list, help=\"subpath sturctures\", default=['tb'])\n parser.add_argument(\"--output\", type=str, help=\"aggregation can be saves as tensorboard file (summary) or as table (csv)\", default='summary')\n\n args = parser.parse_args()\n print(args.path)\n\n path = Path(args.path)\n print(path)\n\n if not path.exists():\n raise argparse.ArgumentTypeError(\"Parameter {} is not a valid path\".format(path))\n\n subpaths = [path / dname / subpath for subpath in args.subpaths for dname in os.listdir(path) if dname != FOLDER_NAME]\n\n for subpath in subpaths:\n if not os.path.exists(subpath):\n raise argparse.ArgumentTypeError(\"Parameter {} is not a valid path\".format(subpath))\n\n if args.output not in ['summary', 'csv']:\n raise argparse.ArgumentTypeError(\"Parameter {} is not summary or csv\".format(args.output))\n\n aggregate(path, args.output, args.subpaths)\n" ]
[ [ "tensorflow.Summary.Value", "tensorflow.core.util.event_pb2.Event", "tensorflow.summary.FileWriter", "numpy.transpose" ] ]
[ { "matplotlib": [], "numpy": [], "pandas": [], "scipy": [], "tensorflow": [ "1.10" ] } ]