messages
listlengths 3
3
|
---|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: It has an effect on lightening. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCCCC[n+]1ccn(CCCCCC)c1Cc1ccccc1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis that impacts barth syndrome and aging. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a nutrient and a emulsifier, as well as herbal and fruity. The molecule is a membrane stabilizer, energy source, energy storage, surfactant, and spicy.",
"role": "user"
},
{
"content": "CCCC=CCOC(=O)CCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing cytochrome oxidase, a proton trap for oxidative phosphorylation, a apoptosis, and smooth. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, energy storage that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a emulsifier and a food additive, impacting both barth syndrome and tangier disease. The molecule is a nutritional supplement, surfactant, membrane stabilizer, energy source that impacts aging.",
"role": "user"
},
{
"content": "CC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a nutrient that impacts pancreatitis, atherosclerosis, thyroxine treatment, metabolic syndrome, and cardiovascular disease. The molecule is a fat storage and inflammatory, and it impacts obesity. The molecule is a membrane stabilizer, energy source, energy storage with an effect on cancer.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): It belongs to the anti bacterial class of molecules.",
"role": "user"
},
{
"content": "COc1c(N2CCC(N(C)C)CC2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12.Cl",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a energy source, inflammatory, nutrient that impacts atherosclerosis, obesity, and metabolic syndrome. The molecule is a fat storage that affects cancer by impacting cardiovascular disease. The molecule is a energy storage and membrane stabilizer, belonging to the thyroxine treatment class of molecules, and impacts pancreatitis.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a nutrient, a inflammatory, and a energy source, which has an effect on cancer and impacts atherosclerosis, and is thyroxine treatment. The molecule is a membrane stabilizer and fat storage, and it impacts pancreatitis. The molecule is a energy storage that impacts metabolic syndrome, cardiovascular disease, and obesity.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a tyk2 inhibitor.",
"role": "user"
},
{
"content": "Cc1cnc(Nc2cnn(C)c2)nc1-c1cc(F)cc(F)c1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a cholesterol translocation that impacts tangier disease, diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts aging. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts aging and tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a hcv protease inhibitor and belongs to the anti viral class of molecules, impacting hepatitis c treatment.",
"role": "user"
},
{
"content": "CC(C)C(CN1CCOC1=O)NC(=O)OC(C)(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a protein tyrosine kinase inhibitor. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "Cc1ccc(-c2ccc(N(C(N)=O)c3cccc(C(F)(F)F)c3)cc2)c2c(N)noc12",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts diabetic heart disease, aging, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts barth syndrome and tangier disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts aging and tangier disease. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts barth syndrome and tangier disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCC=CC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: Decomposes violently @ 400 °f (204 °c) The molecule has Characteristic, disagreeable odor. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "IC(I)I",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts barth syndrome and aging. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a nutrient.",
"role": "user"
},
{
"content": "CC1OC(OC2C(O)C(OC3C(O)CC4(C)C(CCC5(C)C4CC=C4C6CC(C)(C)CCC6(C(=O)OC6OC(CO)C(O)C(O)C6O)CCC45C)C3(C)CO)OC(C(=O)O)C2O)C(O)C(O)C1O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is anti biotic.",
"role": "user"
},
{
"content": "O=C(Cc1ccccc1)NCC(=O)NC(Cc1cnc[nH]1)C(=O)O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a anti inflammatory.",
"role": "user"
},
{
"content": "CC(c1ccc(-c2ccccc2)c(F)c1)c1cc(N=C(N)N2CCN(C)CC2)no1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a inflammatory, membrane stabilizer, energy source, energy storage that has an effect on lipotoxicity and impacts metabolic syndrome.",
"role": "user"
},
{
"content": "CCC(C)CCCCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts tangier disease and aging. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a nutrient.",
"role": "user"
},
{
"content": "CCCCC#CC(=O)c1ccc(C=CC(=O)O)o1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a pain treatment.",
"role": "user"
},
{
"content": "Clc1cc(C2=CC3NCC3CC2)cnc1Cl",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts barth syndrome and diabetic heart disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a thrombin inhibitor and a anti thrombotic, belonging to the anti coagulant class of molecules.",
"role": "user"
},
{
"content": "COc1cc(Cc2ccc(O)cc2-c2ccc(NCC(N)C(=O)O)cc2)ccc1CN1CCCC1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts aging and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts diabetic heart disease, tangier disease, and barth syndrome. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a organic electronic device.",
"role": "user"
},
{
"content": "Cc1cc(-n2c3c(-c4ccc5c(c4)c4ccc6ccccc6c4n5C(C)C)cccc3c3ccc4ccccc4c32)c(C)cc1C(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, tangier disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, apoptosis, cholesterol translocation that impacts aging and diabetic heart disease. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCC(C)CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts diabetic heart disease, barth syndrome, and aging. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a nutrient, inflammatory, fat storage that impacts metabolic syndrome, atherosclerosis, and cardiovascular disease. The molecule is a membrane stabilizer, a energy storage, and a energy source. It has an effect on cancer, impacts both obesity and pancreatitis, and the molecule is thyroxine treatment.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts tangier disease, barth syndrome, and aging. The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and diabetic heart disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a parp inhibitor. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CC1CNCc2nnc(-c3ccc(F)cn3)n21",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts aging, tangier disease, and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: It belongs to the cancer treatment class of molecules.",
"role": "user"
},
{
"content": "CNCc1cnn(-c2cc(Nc3nc(C)cc(NC)n3)cnc2OC)c1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, apoptosis that impacts aging and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a apoptosis that impacts diabetic heart disease, aging, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase that impacts tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule has Odorless. When heated to decomposition it emits toxic fumes of inorganic lead/",
"role": "user"
},
{
"content": "O=[Cr](=O)([O-])[O-].[Pb+2]",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a food additive, a nutritional supplement, a membrane stabilizer, and smooth. The molecule is a proton trap for oxidative phosphorylation, emulsifier, surfactant, stabilizing cytochrome oxidase, energy storage. The molecule is a cholesterol translocation and a apoptosis, impacting both non-alcoholic fatty liver disease and tangier disease. The molecule is a stabilizing mitochondrial structure and a energy source that impacts barth syndrome, diabetic heart disease, and aging.",
"role": "user"
},
{
"content": "CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: When heated to decomposition it emits very toxic fumes of nitrogen oxides.",
"role": "user"
},
{
"content": "C=CCN1CCC23c4c5ccc(O)c4OC2C(O)C=CC3C1C5",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a fat storage that impacts both cardiovascular disease and metabolic syndrome. The molecule is a nutrient that impacts atherosclerosis, pancreatitis, and thyroxine treatment.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: It impacts insulin resistance.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OC(CO)COC(=O)CCCCCCCC=CCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts aging, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts tangier disease and barth syndrome. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is thyroxine treatment and it impacts both metabolic syndrome and pancreatitis. The molecule is a fat storage and a nutrient, impacting both atherosclerosis and cardiovascular disease. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a nutrient that impacts diabetes mellitus type 2, non-alcoholic fatty liver disease, alzheimer's disease, and parkinson's disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCC1C(O)CC(=O)C1C=CC(O)CCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a nutrient that impacts both metabolic syndrome and atherosclerosis. The molecule is a fat storage that impacts pancreatitis, cardiovascular disease, and thyroxine treatment.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a energy source that impacts breast cancer, cardiovascular disease, and renal cell carcinoma. It impacts inflammatory bowel disease, diabetes mellitus type 2, heart failure, and celiac disease.",
"role": "user"
},
{
"content": "CCCCCCCCC(O)CCCCCCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a pi3k inhibitor. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "Nc1cc(-c2nn(Cc3nn4ccc(Sc5ccc(O)cc5)c4c(=O)n3-c3ccccc3)c3ncnc(N)c23)ccn1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is organic light-emitting.",
"role": "user"
},
{
"content": "Cn1c2ccccc2c2c(-c3cccc4c(-c5ccc6c(-c7ccccc7)cccc6c5)c5cccc(-c6cccc7c6c6ccccc6n7C)c5cc34)cccc21",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase, it impacts diabetic heart disease, and is smooth. The molecule is a stabilizing mitochondrial structure, apoptosis, energy source that impacts aging and tangier disease. The molecule is a energy storage and a food additive, impacting both non-alcoholic fatty liver disease and barth syndrome. The molecule is a membrane stabilizer, nutritional supplement, surfactant, proton trap for oxidative phosphorylation, emulsifier. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCC(C)CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a bitter.",
"role": "user"
},
{
"content": "CC(CCC(=O)O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CCC12C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure that impacts aging and diabetic heart disease. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts tangier disease, non-alcoholic fatty liver disease, and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts diabetic heart disease, aging, and non-alcoholic fatty liver disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts barth syndrome and tangier disease. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a thyroxine treatment and fat storage, and it impacts atherosclerosis. The molecule is a nutrient that impacts metabolic syndrome, cardiovascular disease, and pancreatitis. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, aging, and barth syndrome. The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a nutrient, energy storage, emulsifier, surfactant, energy source, membrane stabilizer.",
"role": "user"
},
{
"content": "CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CCC(OC6OC(C(=O)O)C(OC7OC(CO)C(O)C(O)C7O)C(O)C6O)C(C)(C)C5CCC43C)C2C1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts tangier disease, aging, and diabetic heart disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts barth syndrome and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is thyroxine treatment and it impacts both pancreatitis and metabolic syndrome. The molecule is a nutrient and a fat storage, impacting both atherosclerosis and cardiovascular disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase that impacts barth syndrome and aging. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a cholesterol translocation that impacts barth syndrome, diabetic heart disease, aging, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts tangier disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a nutrient.",
"role": "user"
},
{
"content": "CC1=CC(=O)CC(C)(C)C1C=CC(C)OC1OC(COC2OCC(O)(CO)C2O)C(O)C(O)C1O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a energy source, nutrient, thyroxine treatment, membrane stabilizer that impacts cancer and pancreatitis. The molecule is a energy storage that impacts both obesity and cardiovascular disease. The molecule is a inflammatory and a fat storage, impacting both atherosclerosis and metabolic syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a energy source, energy storage, membrane stabilizer that impacts thyroxine treatment, pancreatitis, and cancer. The molecule is a inflammatory that impacts both obesity and cardiovascular disease. The molecule is a nutrient and a fat storage, impacting both metabolic syndrome and atherosclerosis.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a member of the thyroxine treatment class and affects both pancreatitis and atherosclerosis. The molecule is a fat storage and a nutrient, impacting both metabolic syndrome and cardiovascular disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCC=CCC=CCC=CCC=CCC)COC(=O)CCCCCCCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a apoptosis that impacts tangier disease, aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation that impacts diabetic heart disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a nutrient, membrane stabilizer, energy storage, energy source.",
"role": "user"
},
{
"content": "CCCC#CCCCCCCCCCCCCO",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is anti tumor activity, anti tumor, and anti cancer, and it impacts cancer treatment. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCC(CC)N1CCCCC1C(=O)NC(C(=O)N(C)C(C=C(C)C(=O)O)C(C)C)C(C)(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a cholesterol translocation and a apoptosis that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts barth syndrome and tangier disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts tangier disease, barth syndrome, and diabetic heart disease. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts non-alcoholic fatty liver disease and aging.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is both a jak inhibitor and a janus kinase inhibitor. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CC(C)(O)C1CN(C2CCC(n3cc(C(N)=O)c(Nc4ccc(Cl)cc4)n3)C(=N)C2)C1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is anti body and cancer treatment.",
"role": "user"
},
{
"content": "COc1cc(CC(Nc2cccc(-c3ccccc3)c2)C(=O)NC(CNC(CC(C)C)B(O)O)C(C)C)cc(OC)c1OC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a membrane stabilizer and a proton trap for oxidative phosphorylation, impacting both tangier disease and barth syndrome. The molecule is a stabilizing mitochondrial structure, food additive, nutritional supplement, apoptosis that impacts diabetic heart disease. The molecule is a surfactant, a energy source, and a energy storage, and it impacts non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, a cholesterol translocation, and a emulsifier, it impacts aging and is smooth.",
"role": "user"
},
{
"content": "CCC(C)CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a p38 inhibitor.",
"role": "user"
},
{
"content": "CC(=O)c1cc(C(=O)NCc2ccc(-c3nc(-c4ccc(Cl)c(O)c4)c(-c4ccncc4)[nH]3)cc2)ccc1C1=C2C=CC(I)C=C2Oc2cc(N)cc(C)c21",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a inflammatory, fat storage, nutrient, thyroxine treatment that impacts pancreatitis and metabolic syndrome. The molecule is a membrane stabilizer that impacts both cardiovascular disease and atherosclerosis. The molecule is a energy source and a energy storage, with effects on cancer and impacts on obesity.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a fat storage, inflammatory, nutrient, membrane stabilizer that impacts obesity and atherosclerosis. The molecule is a energy source and thyroxine treatment, and it impacts metabolic syndrome. The molecule is a energy storage that impacts cardiovascular disease, pancreatitis, and cancer.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a nutrient. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CC(=O)C(=O)c1ccc(C)o1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(N)C(=O)O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a pde4 inhibitor.",
"role": "user"
},
{
"content": "CC(Cc1cc(-c2cccc(C(=O)Nc3nc(-c4ccccc4)cs3)c2)c2ncccc2c1)S(C)(=O)=O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing mitochondrial structure, nutritional supplement, surfactant, apoptosis. The molecule is a energy source, stabilizing cytochrome oxidase, cholesterol translocation that impacts barth syndrome and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a membrane stabilizer, it impacts tangier disease, and is smooth. The molecule is a food additive, emulsifier, energy storage that impacts non-alcoholic fatty liver disease and aging.",
"role": "user"
},
{
"content": "CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a thyroxine treatment and nutrient, and it impacts pancreatitis. The molecule is a fat storage that impacts cardiovascular disease, atherosclerosis, and metabolic syndrome.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts tangier disease and barth syndrome. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts diabetic heart disease, aging, and tangier disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts non-alcoholic fatty liver disease and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a anti inflammatory member of the pain treatment class. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCCOc1ccc(C(N=C(N)OC)=NC)cc1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a emulsifier and smooth, impacting both aging and non-alcoholic fatty liver disease. The molecule is a energy source, surfactant, nutritional supplement, energy storage, stabilizing cytochrome oxidase. The molecule is a cholesterol translocation, a stabilizing mitochondrial structure, and a proton trap for oxidative phosphorylation, and it impacts barth syndrome. The molecule is a food additive, apoptosis, membrane stabilizer that impacts diabetic heart disease and tangier disease.",
"role": "user"
},
{
"content": "CC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a metalloprotease inhibitor.",
"role": "user"
},
{
"content": "COc1ccc(S(=O)(=O)N2CN(Cc3ccccc3)C(=O)CC2C(N)=O)cc1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase that impacts aging and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts tangier disease, barth syndrome, and diabetic heart disease. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a membrane stabilizer, nutrient, energy storage, inflammatory that impacts metabolic syndrome and cardiovascular disease. The molecule is a energy source and fat storage with an effect on cancer. It impacts pancreatitis, atherosclerosis, obesity, and thyroxine treatment. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is anti viral. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "O=C(NC1CCCC(Nc2nc(-c3c[nH]c4c(F)cc(F)cc34)nc(C(=O)O)c2F)C1)c1cn[nH]n1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts aging and tangier disease. The molecule is a apoptosis and a cholesterol translocation that impacts barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a apoptosis and a membrane stabilizer, impacting both barth syndrome and tangier disease. The molecule is a stabilizing cytochrome oxidase, energy storage, proton trap for oxidative phosphorylation, energy source that impacts aging. The molecule is a nutritional supplement, a stabilizing mitochondrial structure, and a cholesterol translocation, and it impacts diabetic heart disease. The molecule is a food additive, a surfactant, and a emulsifier, it impacts non-alcoholic fatty liver disease and is smooth.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a fat storage and inflammatory, belonging to the thyroxine treatment class of molecules, and impacts atherosclerosis, pancreatitis, and cardiovascular disease. The molecule is a nutrient and energy storage, and it impacts obesity. The molecule is a energy source and a membrane stabilizer, impacting both metabolic syndrome and cancer.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a anti tumor agent and belongs to the anti tumor class of molecules, with the characteristic of being cancer treatment.",
"role": "user"
},
{
"content": "C=Cc1nc[nH]c1C(C)(C)C=C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a organic electroluminescent element and is electroluminescent.",
"role": "user"
},
{
"content": "CC(C)(C)c1cc2cc3c(c4ccc5cccc1c5c24)Oc1ccccc1C3(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a cholesterol translocation that impacts barth syndrome, non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts aging.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, cholesterol translocation that impacts tangier disease and diabetic heart disease. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a energy storage, a nutritional supplement, and a stabilizing mitochondrial structure, and it impacts tangier disease. The molecule is a emulsifier and a cholesterol translocation, which impacts both barth syndrome and aging, and is characterized as smooth. The molecule is a stabilizing cytochrome oxidase, a apoptosis, and a surfactant, and it impacts non-alcoholic fatty liver disease. The molecule is a membrane stabilizer, proton trap for oxidative phosphorylation, food additive, energy source that impacts diabetic heart disease.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a energy storage, energy source, nutrient that impacts obesity, pancreatitis, and cardiovascular disease. The molecule is a inflammatory and fat storage, and it impacts cancer. The molecule is a membrane stabilizer and thyroxine treatment, impacting both atherosclerosis and metabolic syndrome.",
"role": "user"
},
{
"content": "CCC(C)CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is anti inflammatory. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CC(C)Cc1ccc(COc2ccc(CNC3CC(C(=O)O)C3)cc2)cc1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a nutrient that affects breast cancer by impacting cervical cancer, atherosclerosis, and ulcerative colitis.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCC=CCC1C(=O)CC(O)C1C=CC(O)CCCCC)COP(=O)([O-])OCC[N+](C)(C)C",
"role": "assistant"
}
] |
Subsets and Splits