messages
listlengths
3
3
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is anti viral. Use the above information to create a molecule.", "role": "user" }, { "content": "CC(C)(C)C=CC1C=COC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a energy source, a nutritional supplement, a membrane stabilizer, and smooth. The molecule is a apoptosis, surfactant, cholesterol translocation, stabilizing mitochondrial structure that impacts barth syndrome. It impacts non-alcoholic fatty liver disease, diabetic heart disease, tangier disease, and aging. The molecule is a food additive, energy storage, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, emulsifier.", "role": "user" }, { "content": "CCC(C)CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: It belongs to the anti oxidant class of molecules.", "role": "user" }, { "content": "O=S(=O)(O)c1ccc(N=Nc2c(O)ccc3cc(S(=O)(=O)O)ccc23)cc1.[Na+].[Na+]", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: It impacts cancer treatment.", "role": "user" }, { "content": "CC=CCN(C)C(CC(=O)O)C(C)=O", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts barth syndrome and aging. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a fat storage and membrane stabilizer, belonging to the thyroxine treatment class of molecules, and impacts obesity, atherosclerosis, and metabolic syndrome. The molecule is a energy source that impacts both cancer and cardiovascular disease. The molecule is a energy storage, a inflammatory, and a nutrient, and it impacts pancreatitis.", "role": "user" }, { "content": "CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): It belongs to both the tachykinin receptor antagonist and tachykinin antagonist classes of molecules.", "role": "user" }, { "content": "O=C(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCCC(CCN2CCN(C3CCCCC3)CC2)(c2cccc(Cl)c2)C1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a thyroxine treatment, energy source, fat storage that impacts pancreatitis, metabolic syndrome, and cardiovascular disease. The molecule is a membrane stabilizer and energy storage, and it impacts obesity. The molecule is a inflammatory and a nutrient, impacting both cancer and atherosclerosis.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a hiv inhibitor.", "role": "user" }, { "content": "CC(C)(C)OC(=O)N1CCN(c2ccccc2C(=O)N2CC=C3C(C)(CCC(c4ccc(C(=O)O)cc4)C3(C)C)C2)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a nutrient that impacts both atherosclerosis and cardiovascular disease. The molecule is a fat storage and thyroxine treatment, impacting both pancreatitis and metabolic syndrome.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a monoamine reuptake inhibitor.", "role": "user" }, { "content": "O=C(O)C(F)(F)F.O=S1(=O)C(CCCN2CCCC2)Cc2ccccc2N1c1ccccc1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts tangier disease, aging, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts diabetic heart disease and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis that impacts tangier disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, aging, and diabetic heart disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): It impacts cardiovascular disease, pancreatitis, and metabolic syndrome. The molecule is a nutrient and a fat storage, impacting both thyroxine treatment and atherosclerosis.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC(COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis that impacts aging and barth syndrome.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: When heated to decomposition it emits toxic fumes of oxides of sulfur, oxides of phosphorus and oxides of nitrogen.", "role": "user" }, { "content": "CCOP(=S)(OCC)SC(CCl)N1C(=O)c2ccccc2C1=O", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a nutrient.", "role": "user" }, { "content": "O=c1c2ccccc2oc2c(O)cccc12", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis, stabilizing cytochrome oxidase that impacts barth syndrome. The molecule is a stabilizing mitochondrial structure that impacts tangier disease, aging, non-alcoholic fatty liver disease, and diabetic heart disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a nutrient.", "role": "user" }, { "content": "O=C(OCC1OC(Oc2cc(O)c3c(=O)c(O)c(-c4ccc(O)c(O)c4)oc3c2)C(O)C(O)C1O)c1cc(O)c(O)c(O)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: It belongs to the anti viral class of molecules. Please write the SMILES representation of it.", "role": "user" }, { "content": "CCCCCC(NC)C(=O)O", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a nutrient that impacts cervical cancer, atherosclerosis, breast cancer, and ulcerative colitis.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC=CCCCCCCCCC=CCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a cholesterol translocation and a apoptosis that impacts barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts tangier disease and aging.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is anti viral.", "role": "user" }, { "content": "COC(=O)NC(C(=O)N1C(c2nc3c(ccc4cc(-c5ccc6c(ccc7[nH]c(C8C9CCC(C9)N8C(=O)C(NC(C)OC)C(C)C)nc76)c5)ccc43)[nH]2)CC2CC21)c1ccccc1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is chemiluminescent.", "role": "user" }, { "content": "CC1(C)CC(C)(C)C1COC(=O)c1c(Cl)c(Cl)cc(Cl)c1OC(=O)C(=O)Oc1c(Cl)cc(Cl)c(Cl)c1C(=O)OCC1C(C)(C)CC1(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a nutrient that affects breast cancer by impacting atherosclerosis, cervical cancer, and ulcerative colitis.", "role": "user" }, { "content": "CCCCCCCCC=CCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCC1C(O)CC(=O)C1C=CC(O)CCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a nutrient that affects cervical cancer by impacting atherosclerosis, breast cancer, and ulcerative colitis.", "role": "user" }, { "content": "CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC(O)C=CC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is cancer treatment.", "role": "user" }, { "content": "CC(S)(CS)c1cnc2c(NC3CCN(CC4CNCCO4)CC3)cc(C(F)(F)F)cn12", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a energy source, a emulsifier, a proton trap for oxidative phosphorylation, and smooth. The molecule is a food additive, membrane stabilizer, surfactant that impacts aging and tangier disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both non-alcoholic fatty liver disease and barth syndrome. The molecule is a stabilizing mitochondrial structure, energy storage, cholesterol translocation, nutritional supplement that impacts diabetic heart disease. Please write the SMILES representation of it.", "role": "user" }, { "content": "CCC(C)CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: It belongs to the liquid crystal class of molecules.", "role": "user" }, { "content": "CCCCCCCCc1ccc(C#Cc2cc(F)c(C#Cc3ccc(CCCCCC)cc3)cc2F)cc1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is electroluminescent. Use the above information to create a molecule.", "role": "user" }, { "content": "N#Cc1cc(-n2c3ccccc3c3cc(-c4ccc5c6c7ccccc7ccc6n(-c6ccccc6)c5c4)ccc32)nc2ccccc12", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure that impacts aging. The molecule is a cholesterol translocation that impacts barth syndrome, diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: It impacts pancreatitis, atherosclerosis, and metabolic syndrome. The molecule is a fat storage and nutrient, belonging to the thyroxine treatment class of molecules, and impacts cardiovascular disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a kinase inhibitor.", "role": "user" }, { "content": "Cc1cccc(-c2ccc(C(C)(C)C)s2)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts tangier disease. The molecule is a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, diabetic heart disease, aging, and barth syndrome.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts diabetic heart disease, tangier disease, and barth syndrome. The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and aging.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts aging, barth syndrome, and diabetic heart disease. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: It belongs to the pain treatment class of molecules.", "role": "user" }, { "content": "CC(C)(C)OC(=O)N1CC(F)CC1C(=O)NCc1cc(-c2ccc(C(F)(F)F)cn2)cc(F)n1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase that impacts aging and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, tangier disease, and barth syndrome. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a fat storage and nutrient, and it impacts atherosclerosis. The molecule is a member of the thyroxine treatment class and affects metabolic syndrome, pancreatitis, and cardiovascular disease.", "role": "user" }, { "content": "CCCCCC=CCC=CCC=CCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: When heated to decomposition it emits toxic fumes of oxides of nitrogen. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCC1(O)CC2CN(CCc3c([nH]c4ccccc34)C(C(=O)OC)(c3cc4c(cc3OC)N(C)C3C(O)(C(=O)OC)C(OC(C)=O)C5(CC)C=CCN6CCC43C65)C2)C1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a emulsifier, a food additive, and a nutritional supplement, and it impacts barth syndrome. The molecule is a surfactant, cholesterol translocation, membrane stabilizer that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a energy source, a apoptosis, a proton trap for oxidative phosphorylation, and smooth. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, energy storage that impacts aging and tangier disease.", "role": "user" }, { "content": "CC(C)CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: It belongs to the diabetes treatment class of molecules. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCOC(=O)CCCNc1nc(-c2ccc(-c3ccccc3OCC)cc2)nc2ccc(F)cc12", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a cancer treatment. Please represent the molecule in SMILES.", "role": "user" }, { "content": "O=C1CCC(NC(=O)c2ccc3nc(-c4ccccc4)oc3c2)C(=O)N1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts tangier disease and aging. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a p2x3 antagonist.", "role": "user" }, { "content": "COCC(C)NC(=O)Oc1cc(-c2ccc(C)cc2)cc(-n2nncc2C(C)C)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, apoptosis that impacts tangier disease and aging. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: It impacts hyperproliferative disease treatment.", "role": "user" }, { "content": "CCCCNC(=O)Nc1ccc(N(C)c2ccnc(Nc3cccc(CS(C)(=O)=O)c3)n2)cc1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts aging. The molecule is a apoptosis that impacts diabetic heart disease, barth syndrome, tangier disease, and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is anti tumor agent.", "role": "user" }, { "content": "CC(c1cc(N)cc(C(F)(F)F)c1)N1CCN(C(=O)O)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is a fat storage that impacts both atherosclerosis and cardiovascular disease. The molecule is a thyroxine treatment and a nutrient, impacting both pancreatitis and metabolic syndrome. Use the above information to create a molecule.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts aging, diabetic heart disease, and tangier disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts barth syndrome and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, barth syndrome, and aging. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts tangier disease and diabetic heart disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a cancer treatment and a egfr inhibitor, it impacts alzheimer's disease treatment, and is gamma secretase modulator.", "role": "user" }, { "content": "CC1(C)CNc2cc(F)c(F)cc21", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a fat storage and a energy source that impacts cancer, atherosclerosis, obesity, and pancreatitis. The molecule is a membrane stabilizer, a energy storage, and a nutrient. The molecule is a inflammatory that impacts thyroxine treatment, metabolic syndrome, and cardiovascular disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a ccr2 antagonist and is inflammatory disease treatment.", "role": "user" }, { "content": "CC(C)(C)NC(=O)n1nc(C(F)(F)F)c2ccccc21", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is modulate.", "role": "user" }, { "content": "CCOC1CCN(c2cc(C)cc(Nc3ncn(-c4cc(F)cc(F)c4)n3)c2)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a anti fungal and belongs to the anti bacterial class of molecules.", "role": "user" }, { "content": "CCOCC1COC(Cn2ccnc2)(c2ccc(Cl)cc2Cl)O1.O=[N+]([O-])O", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts aging, tangier disease, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure that impacts barth syndrome and diabetic heart disease. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts aging and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts barth syndrome. The molecule is a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, aging, and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is autoimmune disease treatment.", "role": "user" }, { "content": "CCN1CCN(CCCn2cnc3c(N4CCN(CC)CC4)nc(NC(C)=O)nc32)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts barth syndrome. The molecule is a cholesterol translocation that impacts non-alcoholic fatty liver disease, diabetic heart disease, aging, and tangier disease. Use the above information to create a molecule.", "role": "user" }, { "content": "CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a apoptosis, a emulsifier, a stabilizing cytochrome oxidase, and smooth. The molecule is a energy source, proton trap for oxidative phosphorylation, nutritional supplement that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a food additive and a energy storage, impacting both aging and diabetic heart disease. The molecule is a surfactant, stabilizing mitochondrial structure, cholesterol translocation, membrane stabilizer that impacts barth syndrome.", "role": "user" }, { "content": "CCC(C)CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts aging and tangier disease. Please write the SMILES representation of it.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts tangier disease and diabetic heart disease. The molecule is a cholesterol translocation and a apoptosis that impacts non-alcoholic fatty liver disease, barth syndrome, and aging.", "role": "user" }, { "content": "CCCCCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts aging, tangier disease, and diabetic heart disease.", "role": "user" }, { "content": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is pain treatment. Please write the SMILES representation of it.", "role": "user" }, { "content": "CCOC(=O)C1(N(C)C(=O)c2c(-c3ccc(Cl)cc3)c(C)c(CF)n2C2CC2)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a proton trap for oxidative phosphorylation, apoptosis, cholesterol translocation that impacts aging and tangier disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts barth syndrome and aging. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts aging, tangier disease, and diabetic heart disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a energy source and a membrane stabilizer that impacts cardiovascular disease, metabolic syndrome, thyroxine treatment, and pancreatitis. The molecule is a fat storage that impacts both obesity and cancer. The molecule is a nutrient, a energy storage, and a inflammatory, and it impacts atherosclerosis.", "role": "user" }, { "content": "CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: It impacts diabetes mellitus type 2, atherosclerosis, and cardiovascular disease. The molecule is a nutrient that impacts insulin resistance, pick's disease, and diabetes mellitus type 1.", "role": "user" }, { "content": "CCCCCCCCCCCC=CC(O)C(COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CCCCCCCC=CC=CC(=O)CCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts aging and tangier disease. The molecule is a cholesterol translocation and a apoptosis that impacts barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is thyroxine treatment and it impacts both cardiovascular disease and pancreatitis. The molecule is a fat storage and a nutrient, impacting both atherosclerosis and metabolic syndrome.", "role": "user" }, { "content": "CCC=CCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a kinase inhibitor.", "role": "user" }, { "content": "CC#Cc1nc([N+](=O)[O-])c(C[N+](C)(C)CC=CC(=O)Nc2cc3c(Nc4ccc5c(cnn5Cc5cccc(F)c5)c4)ncnc3cn2)n1C.[Br-]", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: It belongs to the anti depressant class of molecules.", "role": "user" }, { "content": "COc1ccc2c(c1)OC(=O)C1CN(Cc3ccccc3)CC21", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a energy source, nutritional supplement, emulsifier, stabilizing cytochrome oxidase. The molecule is a membrane stabilizer, apoptosis, proton trap for oxidative phosphorylation, food additive that impacts non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a surfactant, impacting both tangier disease and aging. The molecule is a stabilizing mitochondrial structure and a energy storage, which impacts both diabetic heart disease and barth syndrome, and is characterized as smooth.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is anti cancer.", "role": "user" }, { "content": "CCC(NS(=O)(=O)c1ccc(C#N)cc1)C(=O)NC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is a stabilizing mitochondrial structure, a emulsifier, and a energy source, and it impacts tangier disease. The molecule is a proton trap for oxidative phosphorylation, food additive, surfactant, stabilizing cytochrome oxidase, nutritional supplement. The molecule is a membrane stabilizer and a energy storage, it impacts aging, and is smooth. The molecule is a apoptosis and a cholesterol translocation that impacts non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease. Use the above information to create a molecule.", "role": "user" }, { "content": "CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis, stabilizing cytochrome oxidase that impacts tangier disease. The molecule is a stabilizing mitochondrial structure that impacts barth syndrome, non-alcoholic fatty liver disease, aging, and diabetic heart disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure that impacts aging. The molecule is a stabilizing cytochrome oxidase that impacts diabetic heart disease, barth syndrome, tangier disease, and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts diabetic heart disease, barth syndrome, and tangier disease. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts aging and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts aging and tangier disease. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a anti bacterial.", "role": "user" }, { "content": "CC(C)=CCc1c(OCC(C)CN=C(N)N)cc2oc3cc(OCC(O)CN=C(N)N)c(C)c(CC=C(C)C)c3c(=O)c2c1O", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is a trpm8 antagonist. Use the above information to create a molecule.", "role": "user" }, { "content": "O=C(NC(=O)Oc1ccccc1)NC(c1ccc(CF)cc1)c1ncccc1C(F)(F)F", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a energy storage, a membrane stabilizer, and a emulsifier, and it impacts tangier disease. The molecule is a apoptosis, surfactant, food additive, cholesterol translocation that impacts barth syndrome. The molecule is a nutritional supplement, a energy source, and a proton trap for oxidative phosphorylation, and it impacts non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure, which impacts both aging and diabetic heart disease, and is characterized as smooth.", "role": "user" }, { "content": "CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: It has an effect on breast cancer, and impacts colorectal cancer, alzheimer's disease, and parkinson's disease. It has an effect on stomach cancer, and impacts seizure, diabetes mellitus, and cardiovascular disease.", "role": "user" }, { "content": "CCCCCC=CCC=CCC=CCCCCC(=O)OCC1COP(=O)(O)OC2C(O)C(O)C(O)C(C=CC(=O)C(C=CC(O)CCCCC)C(O)C2OP(=O)(O)O)CC=CCCCC(=O)O1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts diabetic heart disease, tangier disease, and aging. Use the above information to create a molecule.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a apoptosis and a cholesterol translocation that impacts diabetic heart disease, tangier disease, and aging.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a nutrient.", "role": "user" }, { "content": "CCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCCCCCC=CCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is a nutrient that impacts ulcerative colitis, breast cancer, atherosclerosis, and cervical cancer. Use the above information to create a molecule.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCC1C(=O)CC(O)C1C=CC(O)CCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: It belongs to the chemiluminescent class of molecules. Please represent the molecule in SMILES.", "role": "user" }, { "content": "Fc1ccc2c(-c3c(F)c(F)cc(F)c3F)c3ccccc3c(-c3cc(F)c(F)c(F)c3)c2c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts tangier disease, non-alcoholic fatty liver disease, and aging. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts barth syndrome and diabetic heart disease. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a apoptosis that impacts barth syndrome, tangier disease, aging, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase that impacts diabetic heart disease. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis that impacts diabetic heart disease and aging. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, and barth syndrome. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a nutrient that affects cervical cancer by impacting ulcerative colitis, breast cancer, and atherosclerosis.", "role": "user" }, { "content": "CCCCCCCCC=CCC=CC=CC(O)CCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is both a nutrient and a flavoring agent.", "role": "user" }, { "content": "CC=C1C2=CC(=O)OCC3C(C)C(CC3C(C)CO)OC(=O)C2=COC1OC1OC(CO)C(O)C(O)C1O", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a cholesterol translocation, a apoptosis, and a nutritional supplement, and it impacts tangier disease. The molecule is a proton trap for oxidative phosphorylation and a surfactant, which impacts both diabetic heart disease and non-alcoholic fatty liver disease, and is characterized as smooth. The molecule is a emulsifier, a stabilizing cytochrome oxidase, and a energy source, and it impacts barth syndrome. The molecule is a stabilizing mitochondrial structure, energy storage, membrane stabilizer, food additive that impacts aging.", "role": "user" }, { "content": "CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts tangier disease, aging, and barth syndrome. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts diabetic heart disease and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts aging and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts barth syndrome, diabetic heart disease, and tangier disease. Use the above information to create a molecule.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]