blob_id
stringlengths 40
40
| directory_id
stringlengths 40
40
| path
stringlengths 3
616
| content_id
stringlengths 40
40
| detected_licenses
sequencelengths 0
112
| license_type
stringclasses 2
values | repo_name
stringlengths 5
115
| snapshot_id
stringlengths 40
40
| revision_id
stringlengths 40
40
| branch_name
stringclasses 777
values | visit_date
timestamp[us]date 2015-08-06 10:31:46
2023-09-06 10:44:38
| revision_date
timestamp[us]date 1970-01-01 02:38:32
2037-05-03 13:00:00
| committer_date
timestamp[us]date 1970-01-01 02:38:32
2023-09-06 01:08:06
| github_id
int64 4.92k
681M
⌀ | star_events_count
int64 0
209k
| fork_events_count
int64 0
110k
| gha_license_id
stringclasses 22
values | gha_event_created_at
timestamp[us]date 2012-06-04 01:52:49
2023-09-14 21:59:50
⌀ | gha_created_at
timestamp[us]date 2008-05-22 07:58:19
2023-08-21 12:35:19
⌀ | gha_language
stringclasses 149
values | src_encoding
stringclasses 26
values | language
stringclasses 1
value | is_vendor
bool 2
classes | is_generated
bool 2
classes | length_bytes
int64 3
10.2M
| extension
stringclasses 188
values | content
stringlengths 3
10.2M
| authors
sequencelengths 1
1
| author_id
stringlengths 1
132
|
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
c7bb1673981cf1ed24dc3268493e926dbed7325e | 2455062787d67535da8be051ac5e361a097cf66f | /Producers/BSUB/TrigProd_amumu_a5_dR5/trigger_amumu_producer_cfg_TrigProd_amumu_a5_dR5_738.py | 9e8620b81cb1403077f96d97129d6c9a48873c8f | [] | no_license | kmtos/BBA-RecoLevel | 6e153c08d5ef579a42800f6c11995ee55eb54846 | 367adaa745fbdb43e875e5ce837c613d288738ab | refs/heads/master | 2021-01-10T08:33:45.509687 | 2015-12-04T09:20:14 | 2015-12-04T09:20:14 | 43,355,189 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 3,360 | py | import FWCore.ParameterSet.Config as cms
process = cms.Process("PAT")
#process.load("BBA/Analyzer/bbaanalyzer_cfi")
process.load("FWCore.MessageLogger.MessageLogger_cfi")
process.load('Configuration.EventContent.EventContent_cff')
process.load("Configuration.Geometry.GeometryRecoDB_cff")
process.load("Configuration.StandardSequences.FrontierConditions_GlobalTag_cff")
process.load("PhysicsTools.PatAlgos.producersLayer1.patCandidates_cff")
process.load("PhysicsTools.PatAlgos.selectionLayer1.selectedPatCandidates_cff")
from Configuration.AlCa.GlobalTag import GlobalTag
process.GlobalTag = GlobalTag(process.GlobalTag, 'MCRUN2_71_V1::All', '')
process.load("Configuration.StandardSequences.MagneticField_cff")
####################
# Message Logger
####################
process.MessageLogger.cerr.FwkReport.reportEvery = cms.untracked.int32(100)
process.options = cms.untracked.PSet( wantSummary = cms.untracked.bool(True) )
process.maxEvents = cms.untracked.PSet( input = cms.untracked.int32(-1) )
## switch to uncheduled mode
process.options.allowUnscheduled = cms.untracked.bool(True)
process.maxEvents = cms.untracked.PSet(
input = cms.untracked.int32(500)
)
####################
# Input File List
####################
# Input source
process.source = cms.Source("PoolSource",
fileNames = cms.untracked.vstring('root://eoscms//eos/cms/store/user/ktos/RECO_Step3_amumu_a5/RECO_Step3_amumu_a5_738.root'),
secondaryFileNames = cms.untracked.vstring()
)
############################################################
# Defining matching in DeltaR, sorting by best DeltaR
############################################################
process.mOniaTrigMatch = cms.EDProducer("PATTriggerMatcherDRLessByR",
src = cms.InputTag( 'slimmedMuons' ),
matched = cms.InputTag( 'patTrigger' ), # selections of trigger objects
matchedCuts = cms.string( 'type( "TriggerMuon" ) && path( "HLT_Mu16_TkMu0_dEta18_Onia*")' ), # input does not yet have the 'saveTags' parameter in HLT
maxDPtRel = cms.double( 0.5 ), # no effect here
maxDeltaR = cms.double( 0.3 ), #### selection of matches
maxDeltaEta = cms.double( 0.2 ), # no effect here
resolveAmbiguities = cms.bool( True ),# definition of matcher output
resolveByMatchQuality = cms.bool( True )# definition of matcher output
)
# talk to output module
process.out = cms.OutputModule("PoolOutputModule",
fileName = cms.untracked.string("file:RECO_Step3_amumu_a5_TrigProd_738.root"),
outputCommands = process.MINIAODSIMEventContent.outputCommands
)
process.out.outputCommands += [ 'drop *_*_*_*',
'keep *_*slimmed*_*_*',
'keep *_pfTausEI_*_*',
'keep *_hpsPFTauProducer_*_*',
'keep *_hltTriggerSummaryAOD_*_*',
'keep *_TriggerResults_*_HLT',
'keep *_patTrigger*_*_*',
'keep *_prunedGenParticles_*_*',
'keep *_mOniaTrigMatch_*_*'
]
################################################################################
# Running the matching and setting the the trigger on
################################################################################
from PhysicsTools.PatAlgos.tools.trigTools import *
switchOnTrigger( process ) # This is optional and can be omitted.
switchOnTriggerMatching( process, triggerMatchers = [ 'mOniaTrigMatch'
])
process.outpath = cms.EndPath(process.out)
| [
"[email protected]"
] | |
5196d1e64b5fb81e24e750fef2df4b21bee75646 | 479696ed99f10e449308bf3379e8b3d167365ebe | /spa/migrations/0006_auto__chg_field_mix_title.py | dfb4bf030f46410d19c07ad244be39c232dd2b12 | [
"BSD-2-Clause"
] | permissive | fergalmoran/dss | 7c690ba0b858c3d7d115af54655954ecee64407e | 684fb4030e33212c3ecde774ca86cb74a1ffc8ac | refs/heads/master | 2021-07-06T02:46:49.064282 | 2015-01-04T22:19:31 | 2015-01-04T22:19:31 | 5,353,985 | 0 | 0 | BSD-2-Clause | 2021-06-10T17:35:38 | 2012-08-09T10:03:17 | JavaScript | UTF-8 | Python | false | false | 16,256 | py | # -*- coding: utf-8 -*-
import datetime
from south.db import db
from south.v2 import SchemaMigration
from django.db import models
class Migration(SchemaMigration):
def forwards(self, orm):
# Changing field 'Mix.title'
db.alter_column(u'spa_mix', 'title', self.gf('django.db.models.fields.CharField')(max_length=150))
def backwards(self, orm):
# Changing field 'Mix.title'
db.alter_column(u'spa_mix', 'title', self.gf('django.db.models.fields.CharField')(max_length=50))
models = {
u'auth.group': {
'Meta': {'object_name': 'Group'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'name': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '80'}),
'permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': u"orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'})
},
u'auth.permission': {
'Meta': {'ordering': "(u'content_type__app_label', u'content_type__model', u'codename')", 'unique_together': "((u'content_type', u'codename'),)", 'object_name': 'Permission'},
'codename': ('django.db.models.fields.CharField', [], {'max_length': '100'}),
'content_type': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['contenttypes.ContentType']"}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'name': ('django.db.models.fields.CharField', [], {'max_length': '50'})
},
u'auth.user': {
'Meta': {'object_name': 'User'},
'date_joined': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}),
'email': ('django.db.models.fields.EmailField', [], {'max_length': '75', 'blank': 'True'}),
'first_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}),
'groups': ('django.db.models.fields.related.ManyToManyField', [], {'to': u"orm['auth.Group']", 'symmetrical': 'False', 'blank': 'True'}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'is_active': ('django.db.models.fields.BooleanField', [], {'default': 'True'}),
'is_staff': ('django.db.models.fields.BooleanField', [], {'default': 'False'}),
'is_superuser': ('django.db.models.fields.BooleanField', [], {'default': 'False'}),
'last_login': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}),
'last_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}),
'password': ('django.db.models.fields.CharField', [], {'max_length': '128'}),
'user_permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': u"orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'}),
'username': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '30'})
},
u'contenttypes.contenttype': {
'Meta': {'ordering': "('name',)", 'unique_together': "(('app_label', 'model'),)", 'object_name': 'ContentType', 'db_table': "'django_content_type'"},
'app_label': ('django.db.models.fields.CharField', [], {'max_length': '100'}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'model': ('django.db.models.fields.CharField', [], {'max_length': '100'}),
'name': ('django.db.models.fields.CharField', [], {'max_length': '100'})
},
'spa._activity': {
'Meta': {'object_name': '_Activity'},
'date': ('django.db.models.fields.DateTimeField', [], {'auto_now': 'True', 'blank': 'True'}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'uid': ('django.db.models.fields.CharField', [], {'max_length': '50', 'null': 'True', 'blank': 'True'}),
'user': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['auth.User']", 'null': 'True'})
},
'spa._lookup': {
'Meta': {'object_name': '_Lookup'},
'description': ('django.db.models.fields.CharField', [], {'max_length': '100'}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'})
},
'spa.chatmessage': {
'Meta': {'object_name': 'ChatMessage'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'message': ('django.db.models.fields.TextField', [], {}),
'timestamp': ('django.db.models.fields.DateTimeField', [], {'auto_now_add': 'True', 'blank': 'True'}),
'user': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'chat_messages'", 'null': 'True', 'to': "orm['spa.UserProfile']"})
},
'spa.comment': {
'Meta': {'object_name': 'Comment'},
'comment': ('django.db.models.fields.CharField', [], {'max_length': '1024'}),
'date_created': ('django.db.models.fields.DateTimeField', [], {'auto_now': 'True', 'blank': 'True'}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'mix': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'comments'", 'null': 'True', 'to': "orm['spa.Mix']"}),
'time_index': ('django.db.models.fields.IntegerField', [], {}),
'user': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['auth.User']"})
},
'spa.event': {
'Meta': {'object_name': 'Event'},
'attendees': ('django.db.models.fields.related.ManyToManyField', [], {'related_name': "'attendees'", 'symmetrical': 'False', 'to': u"orm['auth.User']"}),
'date_created': ('django.db.models.fields.DateField', [], {'default': 'datetime.datetime(2013, 4, 24, 0, 0)'}),
'event_date': ('django.db.models.fields.DateField', [], {'default': 'datetime.datetime(2013, 4, 24, 0, 0)'}),
'event_description': ('tinymce.views.HTMLField', [], {}),
'event_recurrence': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['spa.Recurrence']"}),
'event_time': ('django.db.models.fields.TimeField', [], {'default': 'datetime.datetime(2013, 4, 24, 0, 0)'}),
'event_title': ('django.db.models.fields.CharField', [], {'max_length': '250'}),
'event_venue': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['spa.Venue']"}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'})
},
'spa.genre': {
'Meta': {'object_name': 'Genre'},
'description': ('django.db.models.fields.CharField', [], {'max_length': '100'}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'slug': ('django.db.models.fields.CharField', [], {'max_length': '100', 'null': 'True'})
},
'spa.label': {
'Meta': {'object_name': 'Label'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'name': ('django.db.models.fields.CharField', [], {'max_length': '100'})
},
'spa.mix': {
'Meta': {'object_name': 'Mix'},
'description': ('django.db.models.fields.TextField', [], {}),
'download_allowed': ('django.db.models.fields.BooleanField', [], {'default': 'False'}),
'download_url': ('django.db.models.fields.CharField', [], {'max_length': '255'}),
'duration': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}),
'genres': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['spa.Genre']", 'symmetrical': 'False'}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'is_active': ('django.db.models.fields.BooleanField', [], {'default': 'True'}),
'is_featured': ('django.db.models.fields.BooleanField', [], {'default': 'True'}),
'local_file': ('django.db.models.fields.files.FileField', [], {'max_length': '100', 'blank': 'True'}),
'mix_image': ('django.db.models.fields.files.ImageField', [], {'max_length': '100', 'blank': 'True'}),
'slug': ('django.db.models.fields.SlugField', [], {'max_length': '50'}),
'stream_url': ('django.db.models.fields.CharField', [], {'max_length': '255'}),
'title': ('django.db.models.fields.CharField', [], {'max_length': '150'}),
'uid': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '38', 'blank': 'True'}),
'upload_date': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime(2013, 4, 24, 0, 0)'}),
'user': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['spa.UserProfile']"}),
'waveform_generated': ('django.db.models.fields.BooleanField', [], {'default': 'False'})
},
'spa.mixdownload': {
'Meta': {'object_name': 'MixDownload', '_ormbases': ['spa._Activity']},
u'_activity_ptr': ('django.db.models.fields.related.OneToOneField', [], {'to': "orm['spa._Activity']", 'unique': 'True', 'primary_key': 'True'}),
'mix': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'downloads'", 'to': "orm['spa.Mix']"})
},
'spa.mixfavourite': {
'Meta': {'object_name': 'MixFavourite', '_ormbases': ['spa._Activity']},
u'_activity_ptr': ('django.db.models.fields.related.OneToOneField', [], {'to': "orm['spa._Activity']", 'unique': 'True', 'primary_key': 'True'}),
'mix': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'favourites'", 'to': "orm['spa.Mix']"})
},
'spa.mixlike': {
'Meta': {'object_name': 'MixLike', '_ormbases': ['spa._Activity']},
u'_activity_ptr': ('django.db.models.fields.related.OneToOneField', [], {'to': "orm['spa._Activity']", 'unique': 'True', 'primary_key': 'True'}),
'mix': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'likes'", 'to': "orm['spa.Mix']"})
},
'spa.mixplay': {
'Meta': {'object_name': 'MixPlay', '_ormbases': ['spa._Activity']},
u'_activity_ptr': ('django.db.models.fields.related.OneToOneField', [], {'to': "orm['spa._Activity']", 'unique': 'True', 'primary_key': 'True'}),
'mix': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'plays'", 'to': "orm['spa.Mix']"})
},
'spa.purchaselink': {
'Meta': {'object_name': 'PurchaseLink'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'provider': ('django.db.models.fields.CharField', [], {'max_length': '255'}),
'track': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'purchase_link'", 'to': "orm['spa.Tracklist']"}),
'url': ('django.db.models.fields.URLField', [], {'max_length': '200'})
},
'spa.recurrence': {
'Meta': {'object_name': 'Recurrence', '_ormbases': ['spa._Lookup']},
u'_lookup_ptr': ('django.db.models.fields.related.OneToOneField', [], {'to': "orm['spa._Lookup']", 'unique': 'True', 'primary_key': 'True'})
},
'spa.release': {
'Meta': {'object_name': 'Release'},
'embed_code': ('django.db.models.fields.TextField', [], {'blank': 'True'}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'is_active': ('django.db.models.fields.BooleanField', [], {'default': 'True'}),
'release_artist': ('django.db.models.fields.CharField', [], {'max_length': '100'}),
'release_date': ('django.db.models.fields.DateField', [], {'default': 'datetime.datetime(2013, 4, 24, 0, 0)'}),
'release_description': ('django.db.models.fields.TextField', [], {}),
'release_image': ('django.db.models.fields.files.ImageField', [], {'max_length': '100', 'blank': 'True'}),
'release_label': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['spa.Label']"}),
'release_title': ('django.db.models.fields.CharField', [], {'max_length': '100'}),
'user': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['spa.UserProfile']"})
},
'spa.releaseaudio': {
'Meta': {'object_name': 'ReleaseAudio'},
'description': ('django.db.models.fields.TextField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'local_file': ('django.db.models.fields.files.FileField', [], {'max_length': '100'}),
'release': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'release_audio'", 'null': 'True', 'to': "orm['spa.Release']"})
},
'spa.tracklist': {
'Meta': {'object_name': 'Tracklist'},
'artist': ('django.db.models.fields.CharField', [], {'max_length': '255'}),
'description': ('django.db.models.fields.CharField', [], {'max_length': '255'}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'index': ('django.db.models.fields.SmallIntegerField', [], {}),
'label': ('django.db.models.fields.CharField', [], {'max_length': '255'}),
'mix': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'tracklist'", 'to': "orm['spa.Mix']"}),
'remixer': ('django.db.models.fields.CharField', [], {'max_length': '255'}),
'timeindex': ('django.db.models.fields.TimeField', [], {'null': 'True'}),
'title': ('django.db.models.fields.CharField', [], {'max_length': '255'})
},
'spa.userfollows': {
'Meta': {'object_name': 'UserFollows'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'user_from': ('django.db.models.fields.related.OneToOneField', [], {'related_name': "'followers'", 'unique': 'True', 'to': "orm['spa.UserProfile']"}),
'user_to': ('django.db.models.fields.related.OneToOneField', [], {'related_name': "'following'", 'unique': 'True', 'to': "orm['spa.UserProfile']"})
},
'spa.userprofile': {
'Meta': {'object_name': 'UserProfile'},
'activity_sharing': ('django.db.models.fields.IntegerField', [], {'default': '0'}),
'activity_sharing_networks': ('django.db.models.fields.IntegerField', [], {'default': '0'}),
'avatar_image': ('django.db.models.fields.files.ImageField', [], {'max_length': '100', 'blank': 'True'}),
'avatar_type': ('django.db.models.fields.CharField', [], {'default': "'social'", 'max_length': '15'}),
'description': ('django.db.models.fields.CharField', [], {'max_length': '2048', 'blank': 'True'}),
'display_name': ('django.db.models.fields.CharField', [], {'max_length': '35', 'blank': 'True'}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'slug': ('django.db.models.fields.SlugField', [], {'default': 'None', 'max_length': '50', 'null': 'True', 'blank': 'True'}),
'user': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['auth.User']", 'unique': 'True'})
},
'spa.venue': {
'Meta': {'object_name': 'Venue'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'user': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['auth.User']"}),
'venue_address': ('django.db.models.fields.CharField', [], {'max_length': '1024'}),
'venue_image': ('django.db.models.fields.files.ImageField', [], {'max_length': '100', 'blank': 'True'}),
'venue_name': ('django.db.models.fields.CharField', [], {'max_length': '250'})
}
}
complete_apps = ['spa'] | [
"[email protected]"
] | |
66ac2692352f0a5f791832e0e94b339c0114130d | 578bdcf2720805c1075ba348764983d99031911f | /Udacity/Hackerrank/Python Generators/prime_number.py | 0cd0ae59c44eb3425187659a67b59dfde8620d90 | [] | no_license | mrudula-pb/Python_Code | 994de4720289ded0a55017407d27b1d0f0b08c65 | 0dcdc6589d3c614bd1e6a03aa5c2b55664b9e6b2 | refs/heads/master | 2023-03-25T16:52:27.420925 | 2021-03-22T21:40:37 | 2021-03-22T21:40:37 | 350,476,487 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 195 | py |
def check_prime(number):
for divisor in range(2, int(number ** 0.5) + 1):
if number % divisor == 0:
return False
return True
value = check_prime(2)
print(value)
| [
"[email protected]"
] | |
6ab7cf510d5d31d1893060487705a171360b9037 | fab14fae2b494068aa793901d76464afb965df7e | /benchmarks/f3_wrong_hints/scaling_ltl_infinite_state/18-extending_bound_36.py | e8c0d69e04efe42fc7f242700e8ef7a444fd8601 | [
"MIT"
] | permissive | teodorov/F3 | 673f6f9ccc25acdfdecbfc180f439253474ba250 | c863215c318d7d5f258eb9be38c6962cf6863b52 | refs/heads/master | 2023-08-04T17:37:38.771863 | 2021-09-16T07:38:28 | 2021-09-16T07:38:28 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 10,424 | py | from typing import Tuple, FrozenSet
from collections import Iterable
from mathsat import msat_term, msat_env
from mathsat import msat_make_constant, msat_declare_function
from mathsat import msat_get_integer_type, msat_get_rational_type, msat_get_bool_type
from mathsat import msat_make_and, msat_make_not, msat_make_or
from mathsat import msat_make_leq, msat_make_equal
from mathsat import msat_make_number, msat_make_plus
from pysmt.environment import Environment as PysmtEnv
import pysmt.typing as types
from ltl.ltl import TermMap, LTLEncoder
from utils import name_next, symb_to_next
from hint import Hint, Location
def msat_make_lt(menv: msat_env, arg0: msat_term, arg1: msat_term):
geq = msat_make_geq(menv, arg0, arg1)
return msat_make_not(menv, geq)
def msat_make_geq(menv: msat_env, arg0: msat_term, arg1: msat_term):
return msat_make_leq(menv, arg1, arg0)
def msat_make_gt(menv: msat_env, arg0: msat_term, arg1: msat_term):
leq = msat_make_leq(menv, arg0, arg1)
return msat_make_not(menv, leq)
def msat_make_impl(menv: msat_env, arg0: msat_term, arg1: msat_term):
n_arg0 = msat_make_not(menv, arg0)
return msat_make_or(menv, n_arg0, arg1)
def check_ltl(menv: msat_env, enc: LTLEncoder) -> Tuple[Iterable, msat_term,
msat_term, msat_term]:
assert menv
assert isinstance(menv, msat_env)
assert enc
assert isinstance(enc, LTLEncoder)
bool_type = msat_get_bool_type(menv)
real_type = msat_get_rational_type(menv)
i = msat_declare_function(menv, "i", real_type)
i = msat_make_constant(menv, i)
r = msat_declare_function(menv, "r", real_type)
r = msat_make_constant(menv, r)
l = msat_declare_function(menv, "l", real_type)
l = msat_make_constant(menv, l)
inc_i = msat_declare_function(menv, "inc_i", bool_type)
inc_i = msat_make_constant(menv, inc_i)
x_i = msat_declare_function(menv, name_next("i"), real_type)
x_i = msat_make_constant(menv, x_i)
x_r = msat_declare_function(menv, name_next("r"), real_type)
x_r = msat_make_constant(menv, x_r)
x_l = msat_declare_function(menv, name_next("l"), real_type)
x_l = msat_make_constant(menv, x_l)
x_inc_i = msat_declare_function(menv, name_next("inc_i"), bool_type)
x_inc_i = msat_make_constant(menv, x_inc_i)
curr2next = {i: x_i, r: x_r, l: x_l, inc_i: x_inc_i}
zero = msat_make_number(menv, "0")
one = msat_make_number(menv, "1")
r_gt_0 = msat_make_gt(menv, r, zero)
r_lt_l = msat_make_lt(menv, r, l)
i_geq_0 = msat_make_geq(menv, i, zero)
init = msat_make_and(menv, r_gt_0, r_lt_l)
init = msat_make_and(menv, init,
msat_make_and(menv, i_geq_0,
msat_make_not(menv, inc_i)))
init = msat_make_and(menv, init, msat_make_gt(menv, l, zero))
# r' = r
trans = msat_make_equal(menv, x_r, r)
# i < l -> ((inc_i' & i' = i + 1) | (!inc_i' & i' = i)) & l' = l
i_lt_l = msat_make_lt(menv, i, l)
x_i_eq_i_p_1 = msat_make_and(menv, x_inc_i,
msat_make_equal(menv, x_i,
msat_make_plus(menv, i, one)))
x_i_eq_i = msat_make_and(menv, msat_make_not(menv, x_inc_i),
msat_make_equal(menv, x_i, i))
x_i_eq_i_p_1_or_i = msat_make_or(menv, x_i_eq_i_p_1, x_i_eq_i)
x_l_eq_l = msat_make_equal(menv, x_l, l)
x_i_eq_i_p_1_or_i_and_x_l_eq_l = msat_make_and(menv, x_i_eq_i_p_1_or_i,
x_l_eq_l)
trans = msat_make_and(menv, trans,
msat_make_impl(menv, i_lt_l,
x_i_eq_i_p_1_or_i_and_x_l_eq_l))
# i >= l -> i' = 0 & l' = l + 1 & !inc_i'
i_geq_l = msat_make_geq(menv, i, l)
x_i_eq_0 = msat_make_equal(menv, x_i, zero)
x_l_eq_l_p_1 = msat_make_equal(menv, x_l, msat_make_plus(menv, l, one))
x_i_eq_0_and_x_l_eq_l_p_1 = msat_make_and(menv,
msat_make_and(menv, x_i_eq_0,
x_l_eq_l_p_1),
msat_make_not(menv, x_inc_i))
trans = msat_make_and(menv, trans,
msat_make_impl(menv, i_geq_l,
x_i_eq_0_and_x_l_eq_l_p_1))
# (G F inc_i) -> ! G F r > i
G_F_x_i_gt_i = enc.make_G(enc.make_F(inc_i))
r_gt_i = msat_make_gt(menv, r, i)
n_G_F_r_gt_i = msat_make_not(menv, enc.make_G(enc.make_F(r_gt_i)))
ltl = msat_make_impl(menv, G_F_x_i_gt_i, n_G_F_r_gt_i)
return TermMap(curr2next), init, trans, ltl
def hints(env: PysmtEnv) -> FrozenSet[Hint]:
assert isinstance(env, PysmtEnv)
mgr = env.formula_manager
i = mgr.Symbol("i", types.REAL)
r = mgr.Symbol("r", types.REAL)
l = mgr.Symbol("l", types.REAL)
inc_i = mgr.Symbol("inc_i", types.BOOL)
symbs = frozenset([i, r, l, inc_i])
x_i = symb_to_next(mgr, i)
x_r = symb_to_next(mgr, r)
x_l = symb_to_next(mgr, l)
x_inc_i = symb_to_next(mgr, inc_i)
res = []
n0 = mgr.Real(0)
n1 = mgr.Real(1)
stutter = mgr.Equals(x_i, i)
loc = Location(env, mgr.GE(i, n0), stutterT=stutter)
loc.set_progress(0, mgr.Equals(x_i, mgr.Plus(i, n1)))
h_i = Hint("h_i0", env, frozenset([i]), symbs)
h_i.set_locs([loc])
res.append(h_i)
loc = Location(env, mgr.GE(r, n0))
loc.set_progress(0, mgr.Equals(x_r, mgr.Plus(r, n1)))
h_r = Hint("h_r0", env, frozenset([r]), symbs)
h_r.set_locs([loc])
res.append(h_r)
loc = Location(env, inc_i)
loc.set_progress(0, x_inc_i)
h_inc = Hint("h_inc0", env, frozenset([inc_i]), symbs)
h_inc.set_locs([loc])
res.append(h_inc)
stutter = mgr.Equals(x_i, i)
loc = Location(env, mgr.LE(i, n0), stutterT=stutter)
loc.set_progress(0, mgr.Equals(x_i, mgr.Minus(i, n1)))
h_i = Hint("h_i1", env, frozenset([i]), symbs)
h_i.set_locs([loc])
res.append(h_i)
loc = Location(env, mgr.LE(r, n0))
loc.set_progress(0, mgr.Equals(x_r, mgr.Minus(r, n1)))
h_r = Hint("h_r1", env, frozenset([r]), symbs)
h_r.set_locs([loc])
res.append(h_r)
loc = Location(env, mgr.LE(l, n0))
loc.set_progress(0, mgr.Equals(x_l, mgr.Minus(l, n1)))
h_l = Hint("h_l1", env, frozenset([l]), symbs)
h_l.set_locs([loc])
res.append(h_l)
loc = Location(env, mgr.Not(inc_i))
loc.set_progress(0, mgr.Not(x_inc_i))
h_inc = Hint("h_inc1", env, frozenset([inc_i]), symbs)
h_inc.set_locs([loc])
res.append(h_inc)
loc0 = Location(env, mgr.GE(i, n0))
loc0.set_progress(1, mgr.Equals(x_i, mgr.Plus(i, n1)))
loc1 = Location(env, mgr.GE(i, n0))
loc1.set_progress(0, mgr.Equals(x_i, i))
h_i = Hint("h_i2", env, frozenset([i]), symbs)
h_i.set_locs([loc0, loc1])
res.append(h_i)
loc0 = Location(env, mgr.GE(r, n0))
loc0.set_progress(1, mgr.Equals(x_r, r))
loc1 = Location(env, mgr.GE(r, n0))
loc1.set_progress(0, mgr.Equals(x_r, mgr.Plus(r, n1)))
h_r = Hint("h_r2", env, frozenset([r]), symbs)
h_r.set_locs([loc0, loc1])
res.append(h_r)
loc0 = Location(env, mgr.GE(l, n0))
loc0.set_progress(1, mgr.Equals(x_l, mgr.Plus(l, n1)))
loc1 = Location(env, mgr.GE(l, n0))
loc1.set_progress(0, mgr.Equals(x_l, l))
h_l = Hint("h_l2", env, frozenset([l]), symbs)
h_l.set_locs([loc0, loc1])
res.append(h_l)
loc0 = Location(env, mgr.Not(inc_i))
loc0.set_progress(1, x_inc_i)
loc1 = Location(env, inc_i)
loc1.set_progress(0, mgr.Not(x_inc_i))
h_inc = Hint("h_inc2", env, frozenset([inc_i]), symbs)
h_inc.set_locs([loc0, loc1])
res.append(h_inc)
loc0 = Location(env, mgr.GE(i, n0), mgr.GE(l, n0),
stutterT=mgr.Equals(x_i, mgr.Plus(i, l)))
loc0.set_progress(1, mgr.Equals(x_i, mgr.Plus(i, n1)))
loc1 = Location(env, mgr.GE(i, n0))
loc1.set_progress(0, mgr.Equals(x_i, i))
h_i = Hint("h_i3", env, frozenset([i]), symbs)
h_i.set_locs([loc0, loc1])
res.append(h_i)
loc0 = Location(env, mgr.GE(r, n0), mgr.GE(i, n0),
stutterT=mgr.Equals(x_r, mgr.Plus(r, i)))
loc0.set_progress(1, mgr.Equals(x_r, r))
loc1 = Location(env, mgr.GE(r, n0))
loc1.set_progress(0, mgr.Equals(x_r, mgr.Plus(r, n1)))
h_r = Hint("h_r3", env, frozenset([r]), symbs)
h_r.set_locs([loc0, loc1])
res.append(h_r)
loc0 = Location(env, mgr.GE(l, n0), mgr.GE(r, n0),
stutterT=mgr.Equals(x_l, mgr.Plus(l, r)))
loc0.set_progress(1, mgr.Equals(x_l, mgr.Plus(l, n1)))
loc1 = Location(env, mgr.GE(l, n0))
loc1.set_progress(0, mgr.Equals(x_l, l))
h_l = Hint("h_l3", env, frozenset([l]), symbs)
h_l.set_locs([loc0, loc1])
res.append(h_l)
loc0 = Location(env, mgr.GE(i, n0))
loc0.set_progress(1, mgr.Equals(x_i, mgr.Plus(i, n1)))
loc1 = Location(env, mgr.GE(i, n0))
loc1.set_progress(2, mgr.Equals(x_i, i))
loc2 = Location(env, mgr.GE(i, n0))
loc2.set_progress(0, mgr.Equals(x_i, i))
h_i = Hint("h_i4", env, frozenset([i]), symbs)
h_i.set_locs([loc0, loc1, loc2])
res.append(h_i)
loc0 = Location(env, mgr.GE(r, n0))
loc0.set_progress(1, mgr.Equals(x_r, r))
loc1 = Location(env, mgr.GE(r, n0))
loc1.set_progress(2, mgr.Equals(x_r, mgr.Plus(r, n1)))
loc2 = Location(env, mgr.GE(r, n0))
loc2.set_progress(0, mgr.Equals(x_r, r))
h_r = Hint("h_r4", env, frozenset([r]), symbs)
h_r.set_locs([loc0, loc1, loc2])
res.append(h_r)
loc0 = Location(env, mgr.GE(l, n0))
loc0.set_progress(1, mgr.Equals(x_l, mgr.Plus(l, n1)))
loc1 = Location(env, mgr.GE(l, n0))
loc1.set_progress(2, mgr.Equals(x_l, l))
loc2 = Location(env, mgr.GE(l, n0))
loc2.set_progress(0, mgr.Equals(x_l, l))
h_l = Hint("h_l4", env, frozenset([l]), symbs)
h_l.set_locs([loc0, loc1, loc2])
res.append(h_l)
loc0 = Location(env, mgr.Not(inc_i))
loc0.set_progress(1, x_inc_i)
loc1 = Location(env, inc_i, stutterT=x_inc_i)
loc1.set_progress(2, mgr.Not(x_inc_i))
loc2 = Location(env, mgr.Not(inc_i))
loc2.set_progress(0, mgr.Not(x_inc_i))
h_inc = Hint("h_inc4", env, frozenset([inc_i]), symbs)
h_inc.set_locs([loc0, loc1, loc2])
res.append(h_inc)
return frozenset(res)
| [
"[email protected]"
] | |
f8357c5fbc9d1cc8439c6f4dcde1207b8d795b57 | 29f6b4804f06b8aabccd56fd122b54e4d556c59a | /CodeAnalysis/SourceMeter_Interface/SourceMeter-8.2.0-x64-linux/Python/Tools/python/astroid/tests/resources.py | 03d45623fecda846c17a7b4088d054413c44c475 | [
"Apache-2.0"
] | permissive | obahy/Susereum | 6ef6ae331c7c8f91d64177db97e0c344f62783fa | 56e20c1777e0c938ac42bd8056f84af9e0b76e46 | refs/heads/master | 2020-03-27T11:52:28.424277 | 2018-12-12T02:53:47 | 2018-12-12T02:53:47 | 146,511,286 | 3 | 2 | Apache-2.0 | 2018-12-05T01:34:17 | 2018-08-28T21:57:59 | HTML | UTF-8 | Python | false | false | 2,373 | py | # Copyright 2014 Google, Inc. All rights reserved.
# contact http://www.logilab.fr/ -- mailto:[email protected]
#
# This file is part of astroid.
#
# astroid is free software: you can redistribute it and/or modify it
# under the terms of the GNU Lesser General Public License as published by the
# Free Software Foundation, either version 2.1 of the License, or (at your
# option) any later version.
#
# astroid is distributed in the hope that it will be useful, but
# WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
# FITNESS FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License
# for more details.
#
# You should have received a copy of the GNU Lesser General Public License along
# with astroid. If not, see <http://www.gnu.org/licenses/>.
import os
import sys
import pkg_resources
from astroid import builder
from astroid import MANAGER
from astroid.bases import BUILTINS
DATA_DIR = 'testdata/python{}/'.format(sys.version_info[0])
def find(name):
return pkg_resources.resource_filename(
'astroid.tests', os.path.normpath(os.path.join(DATA_DIR, name)))
def build_file(path, modname=None):
return builder.AstroidBuilder().file_build(find(path), modname)
class SysPathSetup(object):
def setUp(self):
sys.path.insert(0, find(''))
def tearDown(self):
del sys.path[0]
datadir = find('')
for key in list(sys.path_importer_cache):
if key.startswith(datadir):
del sys.path_importer_cache[key]
class AstroidCacheSetupMixin(object):
"""Mixin for handling the astroid cache problems.
When clearing the astroid cache, some tests fails due to
cache inconsistencies, where some objects had a different
builtins object referenced.
This saves the builtins module and makes sure to add it
back to the astroid_cache after the tests finishes.
The builtins module is special, since some of the
transforms for a couple of its objects (str, bytes etc)
are executed only once, so astroid_bootstrapping will be
useless for retrieving the original builtins module.
"""
@classmethod
def setUpClass(cls):
cls._builtins = MANAGER.astroid_cache.get(BUILTINS)
@classmethod
def tearDownClass(cls):
if cls._builtins:
MANAGER.astroid_cache[BUILTINS] = cls._builtins
| [
"[email protected]"
] | |
10312512ec5bb50d42a17331847c87905d872535 | 163bbb4e0920dedd5941e3edfb2d8706ba75627d | /Code/CodeRecords/2129/60792/251992.py | bb252099bb4818ca24690d96fb3c2ca68175212b | [] | no_license | AdamZhouSE/pythonHomework | a25c120b03a158d60aaa9fdc5fb203b1bb377a19 | ffc5606817a666aa6241cfab27364326f5c066ff | refs/heads/master | 2022-11-24T08:05:22.122011 | 2020-07-28T16:21:24 | 2020-07-28T16:21:24 | 259,576,640 | 2 | 1 | null | null | null | null | UTF-8 | Python | false | false | 123 | py | n=int(input())
count=0
while n!=1:
if n%2==0:
n=n//2
else:
n=n-1
count+=1
print(count)
| [
"[email protected]"
] | |
2b8be2aeed918c270e1676da965fe5fdcb587c62 | 368c66467b78adf62da04cb0b8cedd2ef37bb127 | /BOJ/Python/5430_AC.py | 99d3c6a86c437339ec939eb8199c2b0eed1a0f4d | [] | no_license | DJHyun/Algorithm | c8786ddcd8b5693fc9b3b4721fdf1eeda21611c5 | fd6ae800886dac4ec5ff6cf2618bc2c839a76e7a | refs/heads/master | 2020-07-30T16:32:49.344329 | 2020-02-25T07:59:34 | 2020-02-25T07:59:34 | 210,289,983 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,504 | py | # baekjoon source = "https://www.acmicpc.net/problem/5430"
import sys
T = int(sys.stdin.readline())
for test_case in range(T):
meto = sys.stdin.readline().strip()
count = int(sys.stdin.readline())
len_meto = len(meto)
first = -1
c = sys.stdin.readline()
len_c = len(c)
c = c[1:len_c - 2].split(',')
rear = count - 1
if count == 0:
if 'D' in meto:
print('error')
else:
print('[]')
else:
flag = True
for i in range(len_meto):
if meto[i] == 'D':
if first == rear:
print('error')
break
if flag:
first += 1
c[first] = 0
else:
c[rear] = 0
rear -= 1
else:
if flag:
flag = False
else:
flag = True
else:
print('[', end='')
if flag:
for j in range(first + 1, rear + 1):
if j != rear:
print(c[j] + ',', end='')
else:
print(c[j], end='')
print(']')
else:
for j in range(rear, first, -1):
if j != first+1:
print(c[j] + ',', end='')
else:
print(c[j], end='')
print(']')
| [
"[email protected]"
] | |
30e1c976566bb28599db9f3287b764540219faef | 30a37ab89a4a8101fb53308301628e8a7458d1fe | /test/functional/mempool_limit.py | cec38f48e5de886c44c4177d801a91ffd1a9f984 | [
"MIT"
] | permissive | BFBCOIN/bfbcoin-core | 1001e55f54a073ac645443c40fd5c7e6d117c07c | 7c3b6dcc8e63f8041331846e0d8230c8db059e23 | refs/heads/master | 2020-04-03T15:31:05.749852 | 2018-10-30T11:36:00 | 2018-10-30T11:36:00 | 155,365,385 | 2 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,016 | py | #!/usr/bin/env python3
# Copyright (c) 2014-2016 The Bitcoin Core developers
# Copyright (c) 2017 The bfb Core developers
# Distributed under the MIT software license, see the accompanying
# file COPYING or http://www.opensource.org/licenses/mit-license.php.
"""Test mempool limiting together/eviction with the wallet."""
from test_framework.test_framework import bfbTestFramework
from test_framework.util import *
class MempoolLimitTest(bfbTestFramework):
def set_test_params(self):
self.setup_clean_chain = True
self.num_nodes = 1
self.extra_args = [["-maxmempool=5", "-spendzeroconfchange=0"]]
def run_test(self):
txouts = gen_return_txouts()
relayfee = self.nodes[0].getnetworkinfo()['relayfee']
txids = []
utxos = create_confirmed_utxos(relayfee, self.nodes[0], 91)
#create a mempool tx that will be evicted
us0 = utxos.pop()
inputs = [{ "txid" : us0["txid"], "vout" : us0["vout"]}]
outputs = {self.nodes[0].getnewaddress() : 0.0001}
tx = self.nodes[0].createrawtransaction(inputs, outputs)
self.nodes[0].settxfee(relayfee) # specifically fund this tx with low fee
txF = self.nodes[0].fundrawtransaction(tx)
self.nodes[0].settxfee(0) # return to automatic fee selection
txFS = self.nodes[0].signrawtransaction(txF['hex'])
txid = self.nodes[0].sendrawtransaction(txFS['hex'])
relayfee = self.nodes[0].getnetworkinfo()['relayfee']
base_fee = relayfee*100
for i in range (3):
txids.append([])
txids[i] = create_lots_of_big_transactions(self.nodes[0], txouts, utxos[30*i:30*i+30], 30, (i+1)*base_fee)
# by now, the tx should be evicted, check confirmation state
assert(txid not in self.nodes[0].getrawmempool())
txdata = self.nodes[0].gettransaction(txid)
assert(txdata['confirmations'] == 0) #confirmation should still be 0
if __name__ == '__main__':
MempoolLimitTest().main()
| [
"[email protected]"
] | |
1e7107daf91ac3e6cc7dc2170334bdc94649cb89 | 6b2a8dd202fdce77c971c412717e305e1caaac51 | /solutions_5706278382862336_0/Python/AlonH/2014C1A.py | c5e1e86cdaf0c09e44104a4a883bdd4b1e7750b8 | [] | no_license | alexandraback/datacollection | 0bc67a9ace00abbc843f4912562f3a064992e0e9 | 076a7bc7693f3abf07bfdbdac838cb4ef65ccfcf | refs/heads/master | 2021-01-24T18:27:24.417992 | 2017-05-23T09:23:38 | 2017-05-23T09:23:38 | 84,313,442 | 2 | 4 | null | null | null | null | UTF-8 | Python | false | false | 571 | py | import math
f = open("A-small-attempt0.in","r")
o = open("A-small-answers.txt","w")
T = int(f.readline())
for t in range(1,T+1):
inp = [float(a) for a in f.readline().split("/")]
p = inp[0]
q = inp[1]
print(p,"/",q)
b = int(math.log(q,2))
print(b)
p = p/(q/(2**b))
print(p)
a = int(math.log(p,2))
if p%1 != 0:
o.write("Case #"+str(t)+": impossible"+"\n")
else:
o.write("Case #"+str(t)+": "+str(b-a)+"\n")
o.close()
#o.write("Case #"+str(t)+": NOT POSSIBLE"+"\n")
#A-small-attempt0.in
| [
"[email protected]"
] | |
916921a156a5df7facf6056f5dbcab774da038e9 | 0e0cf67455424e68705c428fc2a5cd71e74879f6 | /practico_03/ejercicio_04.py | 378e079e9a55c528232d49537c3db72bfe3d1fce | [] | no_license | JoacoDiPerna/frro-soporte-2019-12 | cf43a3a6f722350891051816aac9d7e50a91add4 | f918c094346ba350c0672596fe316c60ae8fdc7c | refs/heads/master | 2020-04-29T00:29:57.757014 | 2019-08-09T19:39:30 | 2019-08-09T19:39:30 | 175,695,790 | 1 | 0 | null | 2019-08-09T19:39:32 | 2019-03-14T20:38:41 | Python | UTF-8 | Python | false | false | 1,118 | py | # Implementar la funcion buscar_persona, que devuelve el registro de una persona basado en su id.
# El return es una tupla que contiene sus campos: id, nombre, nacimiento, dni y altura.
# Si no encuentra ningun registro, devuelve False.
import datetime
from practico_03.ejercicio_01 import create_connection
from practico_03.ejercicio_01 import reset_tabla
from practico_03.ejercicio_02 import agregar_persona
from getpass import getuser
def buscar_persona(id_persona):
conn = create_connection(
'C:\\Users\\' + getuser() + '\\Desktop\\tps_python.db')
sql = "SELECT * FROM personas WHERE id_persona=? ORDER BY id_persona ASC"
cur = conn.cursor()
cur.execute(sql, (id_persona,))
rows = cur.fetchall()
cur.close()
conn.commit()
conn.close()
return False if not rows else rows[0]
@reset_tabla
def pruebas():
juan = buscar_persona(agregar_persona(
'juan perez', datetime.datetime(1988, 5, 15), 32165498, 180))
assert juan == (1, 'juan perez', '1988-05-15', 32165498, 180)
assert buscar_persona(12345) is False
if __name__ == '__main__':
pruebas()
| [
"[email protected]"
] | |
b67611e1022940616dfa02c1031329d904b7f33e | 426742533fc90d9240d01f0d0347a1648cc91430 | /freeways/migrations/0002_auto_20150621_0106.py | ddf17e24c9e4270ee812a4c5a5b93968f01785a1 | [] | no_license | kdechant/freeways | 5093a67ad917cf02fab4706ea21b81b05d41e84a | 8a9b73304db06c2423b2729bbe8f72aaa1bff53d | refs/heads/master | 2021-09-29T05:39:48.687864 | 2020-01-08T04:32:42 | 2020-01-08T04:33:46 | 37,783,501 | 0 | 0 | null | 2021-06-10T17:35:47 | 2015-06-20T19:45:57 | Python | UTF-8 | Python | false | false | 1,164 | py | # -*- coding: utf-8 -*-
from __future__ import unicode_literals
from django.db import models, migrations
class Migration(migrations.Migration):
dependencies = [
('freeways', '0001_initial'),
]
operations = [
migrations.RemoveField(
model_name='routesegment',
name='ring',
),
migrations.AddField(
model_name='routesegment',
name='distance_from_origin',
field=models.DecimalField(editable=False, default=0, max_digits=6, decimal_places=3),
),
migrations.AlterField(
model_name='routesegment',
name='geojson',
field=models.TextField(editable=False, null=True, blank=True),
),
migrations.AlterField(
model_name='routesegment',
name='lane_miles',
field=models.DecimalField(editable=False, default=0, max_digits=5, decimal_places=2),
),
migrations.AlterField(
model_name='routesegment',
name='length',
field=models.DecimalField(editable=False, default=0, max_digits=5, decimal_places=2),
),
]
| [
"[email protected]"
] | |
b12fd17fff74d25b03c124c311932fb6787afc78 | b34808a8571340dcb3d70bd29d59930a6a3e4463 | /catalogueapp/views.py | eb6bf54a399a469eece4d25c8cec86c633a415a4 | [] | permissive | OpenDataServices/iCAN-Scot-Catalogue | 110ee5030b258555a45e9061feb97a5ce031cc48 | 205cf3e6e8ef984f3f4e3d89537c21bdafb805a1 | refs/heads/master | 2021-08-04T08:31:15.411708 | 2020-06-25T09:24:32 | 2020-06-25T09:34:27 | 191,113,427 | 1 | 1 | BSD-3-Clause | 2020-06-05T21:15:14 | 2019-06-10T06:52:06 | Python | UTF-8 | Python | false | false | 6,626 | py | from django.shortcuts import render, redirect
from django.http import Http404, JsonResponse
from django.contrib.auth.decorators import permission_required, login_required
from catalogueapp.forms import AddForm, EditOrganisationForm
from catalogueapp.tools import ALISS_URL, ALISS_Importer
from catalogueapp.models import Service, Organisation
def index(request):
context = {
'search': request.GET.get('search', ''),
}
if context['search']:
context['organisations'] = Organisation.objects.raw(
"""
SELECT * FROM (
SELECT catalogueapp_organisation.*,
to_tsvector(
catalogueapp_organisation.name || ' ' ||
catalogueapp_organisation.description || ' ' ||
catalogueapp_organisation.our_description_markdown || ' ' ||
array_agg(catalogueapp_service.name)::text || ' ' ||
array_agg(catalogueapp_service.description)::text
) AS search_vector
FROM catalogueapp_organisation
JOIN catalogueapp_service ON catalogueapp_service.organisation_id = catalogueapp_organisation.id
WHERE catalogueapp_service.active = '1'
GROUP BY catalogueapp_organisation.id
ORDER BY catalogueapp_organisation.name ASC
) AS data
WHERE search_vector @@ to_tsquery(%s)
""",
[context['search']]
)
else:
context['organisations'] = Organisation.objects.raw(
"""SELECT catalogueapp_organisation.* FROM catalogueapp_organisation
JOIN catalogueapp_service ON catalogueapp_service.organisation_id = catalogueapp_organisation.id
WHERE catalogueapp_service.active = '1'
GROUP BY catalogueapp_organisation.id
ORDER BY catalogueapp_organisation.name ASC """,
)
return render(request, 'catalogueapp/index.html', context)
def organisation_index(request, aliss_id):
context = {
'organisation': Organisation.objects.get(aliss_id=aliss_id),
}
context['services'] = Service.objects.filter(organisation=context['organisation'], active=True)
if not context['services']:
raise Http404
return render(request, 'catalogueapp/organisation/index.html', context)
@permission_required('catalogueapp.catalogueadmin', login_url='/accounts/login/')
def adminindex(request):
context = {}
return render(request, 'catalogueapp/admin/index.html', context)
@permission_required('catalogueapp.catalogueadmin', login_url='/accounts/login/')
def admin_add(request):
context = {}
if request.method == 'POST':
context['form'] = AddForm(request.POST)
if context['form'].is_valid():
url = ALISS_URL(context['form'].cleaned_data['url'])
if url.is_service():
importer = ALISS_Importer()
service = importer.import_from_service_URL(url)
importer.update_organisation(service.organisation)
return redirect('admin_service_index', aliss_id=service.aliss_id)
else:
context['form'].add_error('url', "That does not look like a service URL?")
else:
context['form'] = AddForm()
return render(request, 'catalogueapp/admin/add.html', context)
@permission_required('catalogueapp.catalogueadmin', login_url='/accounts/login/')
def admin_service_list(request):
context = {
'services': Service.objects.all(),
}
return render(request, 'catalogueapp/admin/services.html', context)
@permission_required('catalogueapp.catalogueadmin', login_url='/accounts/login/')
def admin_service_index(request, aliss_id):
context = {
'service': Service.objects.get(aliss_id=aliss_id),
}
if request.method == 'POST':
if request.POST['action'] == 'update':
importer = ALISS_Importer()
importer.update_service(context['service'])
elif request.POST['action'] == 'inactive':
context['service'].active = False
context['service'].save()
elif request.POST['action'] == 'active':
context['service'].active = True
context['service'].save()
return render(request, 'catalogueapp/admin/service/index.html', context)
@permission_required('catalogueapp.catalogueadmin', login_url='/accounts/login/')
def admin_organisation_list(request):
context = {
'organisations': Organisation.objects.all(),
}
return render(request, 'catalogueapp/admin/organisations.html', context)
@permission_required('catalogueapp.catalogueadmin', login_url='/accounts/login/')
def admin_organisation_index(request, aliss_id):
context = {
'organisation': Organisation.objects.get(aliss_id=aliss_id),
}
context['services'] = Service.objects.filter(organisation=context['organisation'])
if request.method == 'POST' and request.POST['action'] == 'update':
importer = ALISS_Importer()
importer.update_organisation(context['organisation'])
return render(request, 'catalogueapp/admin/organisation/index.html', context)
@permission_required('catalogueapp.catalogueadmin', login_url='/accounts/login/')
def admin_organisation_edit(request, aliss_id):
context = {
'organisation': Organisation.objects.get(aliss_id=aliss_id),
}
if request.method == 'POST':
context['form'] = EditOrganisationForm(request.POST, instance=context['organisation'])
if context['form'].is_valid():
context['organisation'].our_description_markdown = context['form'].cleaned_data['our_description_markdown']
context['organisation'].save()
return redirect('admin_organisation_index', aliss_id=context['organisation'].aliss_id)
else:
context['form'] = EditOrganisationForm(instance=context['organisation'])
return render(request, 'catalogueapp/admin/organisation/edit.html', context)
@permission_required('catalogueapp.catalogueadmin', login_url='/accounts/login/')
def admin_organisation_edit_preview(request, aliss_id):
context = {
'organisation': Organisation.objects.get(aliss_id=aliss_id),
}
context['organisation'].our_description_markdown = request.POST.get('description_markdown', '')
return JsonResponse(
{'description_markdown_html': context['organisation'].get_our_description_markdown_html()}
)
@login_required()
def user_profile(request):
context = {}
return render(request, 'registration/profile.html', context)
| [
"[email protected]"
] | |
551154a56e6dfddcdd8af08b2bb59c3cdd0641ae | e7c03b71f26c463b2670c52cd2fddbc198e3c8cb | /apps/djing2/apps.py | 5b7f6f1a79897f208bfb04a3f0217bad381fe9a7 | [] | no_license | nerosketch/djing2 | 71cc96f4829fc047d788dd7d8a94f1035e9740f9 | 1fbb0941f26389cbfdc8015527ab0d426c2e2c01 | refs/heads/master | 2023-01-13T15:12:50.492646 | 2022-11-18T11:24:21 | 2022-11-18T11:24:21 | 196,469,351 | 7 | 3 | null | 2020-02-29T19:38:37 | 2019-07-11T21:50:34 | Python | UTF-8 | Python | false | false | 87 | py | from django.apps import AppConfig
class Djing2Config(AppConfig):
name = "djing2"
| [
"[email protected]"
] | |
b7e62fcc6d1d6be43665ce941a5acff73bb88b22 | 92207eb2c2d8014da01831c3273efc581929f5c7 | /step1/app.py | 95d48d2908cb9ca1917bf5984e015f3806c89131 | [] | no_license | garetroy/createyourownserver | 8de61511a96f65330056f06c23a5a5d880193248 | 768c587fb14a047ba838caca28f8ff519f10cb4b | refs/heads/master | 2020-03-26T04:18:21.643119 | 2018-08-12T20:37:55 | 2018-08-12T20:37:55 | 144,496,869 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 364 | py | import flask, os
from flask import render_template, Flask
app = flask.Flask(__name__)
@app.route('/')
def home():
return flask.render_template('home.html')
@app.route('/page2')
def page2():
return flask.render_template('secondpage.html')
if __name__ == '__main__':
port = int(os.environ.get('PORT', 5000))
app.run(debug=True, host='0.0.0.0', port=port)
| [
"[email protected]"
] | |
564417eb8bcf4a0b26bad12b6b03cb0d0390b708 | ce6538b5b7da162c1c690a346e7ec9ae0a6291f3 | /glass_mine.py | 6247053e40d8deebcb40be09594181b1019c11c7 | [] | no_license | DaniTodorowa/Softuni | 391f13dd61a6d16cd48ee06e9b35b2fd931375df | f7c875fda4e13ec63152671509aaa6eca29d7f50 | refs/heads/master | 2022-11-25T23:34:49.744315 | 2020-08-02T08:23:44 | 2020-08-02T08:23:44 | 278,938,559 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 435 | py | class Glass:
capacity = 250
def __init__(self):
self.content = 0
def fill(self, ml):
if (self.capacity - self.content) >= ml:
self.content += ml
return f"Glass filled with {ml} ml"
return f"Cannot add {ml} ml"
def empty(self):
self.content = 0
return "Glass is now empty"
def info(self):
return f"{Glass.capacity - self.content} ml left"
| [
"[email protected]"
] | |
072e921e8d2f60228a301e318a11571a82146dd8 | c2e49d32b2613d702dd06067bd0ec7846a319fd5 | /arelle/DialogArcroleGroup.py | cc9e7e8f45295a1a9ffd5633177bd3217e776755 | [
"Apache-2.0"
] | permissive | hamscher/Arelle | c9a020a5955a313c14a4db3a4e7122ec9599714c | 64c1beddcc7163e571011faf07a03d8ffe18bb78 | refs/heads/master | 2023-08-24T14:12:49.055954 | 2021-10-17T16:55:56 | 2021-10-17T16:55:56 | 284,703,106 | 0 | 0 | Apache-2.0 | 2020-08-10T15:48:15 | 2020-08-03T13:08:08 | Python | UTF-8 | Python | false | false | 7,702 | py | '''
Created on Jun 15, 2012
@author: Mark V Systems Limited
(c) Copyright 2012 Mark V Systems Limited, All rights reserved.
'''
from tkinter import Toplevel, N, S, E, W, PhotoImage
try:
from tkinter.ttk import Frame, Button
except ImportError:
from ttk import Frame, Button
import os, re
from arelle.UiUtil import gridHdr, gridCell, gridCombobox, label, checkbox
from arelle.CntlrWinTooltip import ToolTip
from arelle import XbrlConst
'''
caller checks accepted, if True, caller retrieves url
'''
def getArcroleGroup(mainWin, modelXbrl):
dialog = DialogArcroleGroup(mainWin, modelXbrl)
return dialog.selectedGroup
class DialogArcroleGroup(Toplevel):
def __init__(self, mainWin, modelXbrl):
parent = mainWin.parent
super(DialogArcroleGroup, self).__init__(parent)
self.mainWin = mainWin
self.parent = parent
self.modelXbrl = modelXbrl
parentGeometry = re.match("(\d+)x(\d+)[+]?([-]?\d+)[+]?([-]?\d+)", parent.geometry())
dialogX = int(parentGeometry.group(3))
dialogY = int(parentGeometry.group(4))
self.selectedGroup = None
self.transient(self.parent)
self.title(_("Select Arcrole Group"))
frame = Frame(self)
'''
dialogFrame = Frame(frame, width=500)
dialogFrame.columnconfigure(0, weight=1)
dialogFrame.rowconfigure(0, weight=1)
dialogFrame.grid(row=0, column=0, columnspan=4, sticky=(N, S, E, W), padx=3, pady=3)
'''
# mainWin.showStatus(_("loading formula options and parameters"))
# load grid
groupLabel = label(frame, 1, 0, _("Group:"))
self.arcroleGroups = mainWin.config.get("arcroleGroups", {})
arcroleGroupSelected = self.mainWin.config.get("arcroleGroupSelected")
if arcroleGroupSelected in self.arcroleGroups:
arcroleGroup = self.arcroleGroups[arcroleGroupSelected]
else:
arcroleGroup = []
arcroleGroupSelected = None
self.groupName = gridCombobox(frame, 2, 0,
value=arcroleGroupSelected,
values=sorted(self.arcroleGroups.keys()),
comboboxselected=self.comboBoxSelected)
groupToolTipMessage = _("Select an existing arcrole group, or enter a name for a new arcrole group. "
"If selecting an existing group, it can be edited, and changes will be saved in the config file. "
"If nothing is changed for an existing group, the saved setting is not disturbed. "
"Arcroles with checkboxes below are shown only for arcroles that have relationships in the loaded DTS, "
"but if an existing group is selected with more arcroles (that were not in the current DTS) then "
"the prior setting with not-present arcroles is preserved. ")
ToolTip(self.groupName, text=groupToolTipMessage, wraplength=360)
ToolTip(groupLabel, text=groupToolTipMessage, wraplength=360)
clearImage = PhotoImage(file=os.path.join(mainWin.imagesDir, "toolbarDelete.gif"))
clearGroupNameButton = Button(frame, image=clearImage, width=12, command=self.clearGroupName)
clearGroupNameButton.grid(row=0, column=3, sticky=W)
ToolTip(clearGroupNameButton, text=_("Remove the currently selected arcrole group from the config file. "
"After removing, you may select another arcrole, but must select 'OK' for the "
"removal to be saved. "),
wraplength=240)
arcrolesLabel = label(frame, 1, 1, _("Arcroles:"))
ToolTip(arcrolesLabel, text=_("Shows all the arcroles that are present in this DTS. "),
wraplength=240)
from arelle.ModelRelationshipSet import baseSetArcroles
self.options = {}
self.checkboxes = []
y = 1
for name, arcrole in baseSetArcroles(self.modelXbrl):
if arcrole.startswith("http://"):
self.options[arcrole] = arcrole in arcroleGroup
self.checkboxes.append(
checkbox(frame, 2, y,
name[1:],
arcrole,
columnspan=2)
)
y += 1
mainWin.showStatus(None)
self.options[XbrlConst.arcroleGroupDetect] = XbrlConst.arcroleGroupDetect in arcroleGroup
self.autoOpen = checkbox(frame, 1, y, _("detect"), XbrlConst.arcroleGroupDetect)
self.autoOpen.grid(sticky=W, columnspan=2)
self.checkboxes.append(self.autoOpen)
ToolTip(self.autoOpen, text=_("If checked, this arcrole group will be detected if any arcrole of the group is present in a DTS, for example to open a treeview pane. "),
wraplength=240)
okButton = Button(frame, text=_("OK"), width=8, command=self.ok)
cancelButton = Button(frame, text=_("Cancel"), width=8, command=self.close)
cancelButton.grid(row=y, column=1, sticky=E, columnspan=3, pady=3, padx=3)
okButton.grid(row=y, column=1, sticky=E, columnspan=3, pady=3, padx=64)
ToolTip(okButton, text=_("Open a treeview with named arcrole group and selected arcroles. "
"If any changes were made to checkboxes or name, save in the config. "),
wraplength=240)
ToolTip(cancelButton, text=_("Close this dialog, without saving arcrole group changes or opening a view pane. "),
wraplength=240)
frame.grid(row=0, column=0, sticky=(N,S,E,W))
frame.columnconfigure(1, weight=3)
frame.columnconfigure(2, weight=1)
frame.columnconfigure(3, weight=3)
window = self.winfo_toplevel()
window.columnconfigure(0, weight=1)
self.geometry("+{0}+{1}".format(dialogX+50,dialogY+100))
#self.bind("<Return>", self.ok)
#self.bind("<Escape>", self.close)
self.protocol("WM_DELETE_WINDOW", self.close)
self.grab_set()
self.wait_window(self)
def ok(self, event=None):
groupName = self.groupName.value
arcrolesSelected = [checkbox.attr for checkbox in self.checkboxes if checkbox.value]
if groupName:
self.mainWin.config["arcroleGroupSelected"] = groupName
if groupName not in self.arcroleGroups or any(checkbox.isChanged for checkbox in self.checkboxes):
self.arcroleGroups[groupName] = arcrolesSelected
self.mainWin.config["arcroleGroups"] = self.arcroleGroups
self.mainWin.saveConfig()
self.selectedGroup = (groupName, arcrolesSelected)
self.close()
def close(self, event=None):
self.parent.focus_set()
self.destroy()
def comboBoxSelected(self, *args):
arcroles = self.arcroleGroups.get(self.groupName.value, [])
for checkbox in self.checkboxes:
checkbox.valueVar.set( checkbox.attr in arcroles )
checkbox.isChanged = False
def clearGroupName(self):
groupName = self.groupName.value
if groupName and groupName in self.arcroleGroups:
del self.arcroleGroups[groupName]
self.groupName.valueVar.set('')
self.groupName["values"] = sorted(self.arcroleGroups.keys())
for checkbox in self.checkboxes:
checkbox.valueVar.set( False )
checkbox.isChanged = False
| [
"[email protected]"
] | |
8ddae95edc4c8a92a22c923d4aa6fc4611593209 | 23f59ad45ac6b889f40b029a506fcc310c06aadb | /web/tests/test_request_context.py | 99450ac6e3553a206fe50cc8847514944f406b5b | [] | no_license | ForeverDreamer/im | bac08b9b28fbdd7cc0ced9c4c1f152f318ecb670 | 962c512226422b00d12dbb31de3d448eca4cbbdc | refs/heads/main | 2023-07-17T17:19:34.400825 | 2021-08-12T10:07:11 | 2021-08-12T10:07:11 | 369,503,904 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 214 | py | from flask import request
from web.app import app
def test_request_context():
with app.test_request_context('/?name=Peter'):
assert request.path == '/'
assert request.args['name'] == 'Peter'
| [
"[email protected]"
] | |
f0b14cf2d440998ba5c2e88973e4f5352225f39b | 9a44d81e02b02aaf2c27433b4b8ebd15aa1f6279 | /multiples.py | c6058a39363ac9aa463bd9b727bf54a481ba5b51 | [] | no_license | sabareesh123/guvi-2 | 91ce0fba591c7565dd377b038b014988daddd68e | 98c2e22746a8c2c2942b42c256b88e23dafcda39 | refs/heads/master | 2020-06-20T13:43:05.536627 | 2019-07-16T06:42:33 | 2019-07-16T06:42:33 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 78 | py | n = int(input())
for i in range(1,6):
s = n*i
print(s,end=" ")
| [
"[email protected]"
] | |
e44f26b7a18c8d4a5582ff84ed15f48867d9be49 | 2eb779146daa0ba6b71344ecfeaeaec56200e890 | /python/oneflow/test/modules/test_adaptive_pool.py | d8b2c08d0e1713a48de811b2e58505d8ab5d9f1a | [
"Apache-2.0"
] | permissive | hxfxjun/oneflow | ee226676cb86f3d36710c79cb66c2b049c46589b | 2427c20f05543543026ac9a4020e479b9ec0aeb8 | refs/heads/master | 2023-08-17T19:30:59.791766 | 2021-10-09T06:58:33 | 2021-10-09T06:58:33 | 414,906,649 | 0 | 0 | Apache-2.0 | 2021-10-09T06:15:30 | 2021-10-08T08:29:45 | C++ | UTF-8 | Python | false | false | 3,468 | py | """
Copyright 2020 The OneFlow Authors. All rights reserved.
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.
"""
import unittest
import oneflow as flow
import oneflow.unittest
from oneflow.nn.common_types import _size_1_t
from packaging import version
import torch as torch_original
from typing import Union, Tuple
from oneflow.test_utils.automated_test_util import *
NoneType = type(None)
# Not the same as those in PyTorch because 'output_size' cannot be NoneType (even in 'torch.nn.AdaptiveAvgPoolXd')
_size_2_opt_t_not_none = Union[int, Tuple[Union[int, NoneType], Union[int, NoneType]]]
_size_3_opt_t_not_none = Union[
int, Tuple[Union[int, NoneType], Union[int, NoneType], Union[int, NoneType]]
]
@flow.unittest.skip_unless_1n1d()
class TestAdaptiveAvgPool(flow.unittest.TestCase):
@autotest()
def test_adaptive_avgpool1d(test_case):
m = torch.nn.AdaptiveAvgPool1d(output_size=random().to(_size_1_t))
m.train(random())
device = random_device()
m.to(device)
x = random_pytorch_tensor(ndim=3).to(device)
y = m(x)
return y
@autotest()
def test_adaptive_avgpool2d(test_case):
m = torch.nn.AdaptiveAvgPool2d(output_size=random().to(_size_2_opt_t_not_none))
m.train(random())
device = random_device()
m.to(device)
x = random_pytorch_tensor(ndim=4).to(device)
y = m(x)
return y
@unittest.skipIf(
version.parse(torch_original.__version__) < version.parse("1.10.0"),
"GPU version 'nn.AdaptiveAvgPool3d' has a bug in PyTorch before '1.10.0'",
)
@autotest()
def test_adaptive_avgpool3d(test_case):
m = torch.nn.AdaptiveAvgPool3d(output_size=random().to(_size_3_opt_t_not_none))
m.train(random())
device = random_device()
m.to(device)
x = random_pytorch_tensor(ndim=5).to(device)
y = m(x)
return y
@flow.unittest.skip_unless_1n1d()
class TestAdaptiveAvgPoolFunctional(flow.unittest.TestCase):
@autotest()
def test_adaptive_avgpool1d_functional(test_case):
device = random_device()
x = random_pytorch_tensor(ndim=3).to(device)
return torch.nn.functional.adaptive_avg_pool1d(x, output_size=random().to(int))
@autotest()
def test_adaptive_avgpool2d_functional(test_case):
device = random_device()
x = random_pytorch_tensor(ndim=4).to(device)
return torch.nn.functional.adaptive_avg_pool2d(x, output_size=random().to(int))
@unittest.skipIf(
version.parse(torch_original.__version__) < version.parse("1.10.0"),
"GPU version 'nn.AdaptiveAvgPool3d' has a bug in PyTorch before '1.10.0'",
)
@autotest()
def test_adaptive_avgpool3d_functional(test_case):
device = random_device()
x = random_pytorch_tensor(ndim=5).to(device)
return torch.nn.functional.adaptive_avg_pool2d(x, output_size=random().to(int))
if __name__ == "__main__":
unittest.main()
| [
"[email protected]"
] | |
79d739837ad0c7eb49a3da4aa3773672688ce62f | 4b3c4878b48b618608d42de1a7b476a37b46b9b8 | /atcoder/abc100c.py | 065fe6541fd2bf67959f14a90eec4756d9e3005f | [] | no_license | zfhrp6/competitive-programming | 3efd2a35717974c5ed9af364181a81144b6c8f19 | 459e7106ac4ba281217ce80cdc014023ce794bc3 | refs/heads/master | 2021-01-10T01:42:20.496027 | 2019-08-03T12:10:43 | 2019-08-03T12:10:43 | 51,929,931 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 198 | py | N = int(input())
a = list(map(int, input().split()))
def div2count(num):
ret = 0
while num % 2 == 0:
ret += 1
num = num // 2
return ret
print(sum(map(div2count, a)))
| [
"[email protected]"
] | |
870a6ee86f3d3892ed79a10bc1bd26231e441502 | fb8792f0a62f3b3658197a7aabd6aeecf8e311c9 | /news/views.py | 6ea24217bedd4ceae946a571f306a01414e25d96 | [] | no_license | munisisazade/matrix_tutorial | 5ddb3af6ba958e663465356de24ae1e3112f5559 | 22718e2b937bc8856ac024059b9ba2780af38f7e | refs/heads/master | 2020-03-22T06:11:36.399412 | 2018-07-11T17:59:43 | 2018-07-11T18:00:14 | 139,616,989 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,290 | py | from django.shortcuts import render
from django.http import HttpResponse
from news.models import Article
from news.forms import ArticleForm
from django.contrib import messages
from django.core.paginator import Paginator
# Create your views here.
def index(request):
if request.method == 'GET':
obj = {}
obj["form"] = ArticleForm()
news = Article.objects.all()
news_list = Paginator(news, 2)
page = request.GET.get('page')
if page:
obj["news_list"] = news_list.page(page)
else:
obj["news_list"] = news_list.page(1)
return render(request, "index.html", obj)
else:
context = {}
form = ArticleForm(request.POST)
if form.is_valid():
# Article.objects.create(
# title=form.cleaned_data['title'],
# description=form.cleaned_data['description']
# )
article = form.save()
context["news_list"] = Article.objects.all()
context["form"] = form
messages.success(request, "Form ugurla dolduruldu")
return render(request, "index.html", context)
def detail(request, name):
obj = {}
obj["object"] = Article.objects.get(id=name)
return render(request, "detail.html", obj)
| [
"[email protected]"
] | |
8ef6aae5ce529d7db5c1522ac34dfb38391949bd | 7bc0075367290ff06565991e19033b13f0604f96 | /Mundo 3/aula16/desafio073.py | 74b06bdc97ec15c23b8957a536d52baf2183d0f8 | [] | no_license | iamtheluiz/curso_em_video_python | 298acd90e36473fbf797ba7bf85d729d0ca28407 | aa4247b7d206771f9c9b08ad5d8585c3813ddaff | refs/heads/master | 2020-04-12T16:17:51.672662 | 2019-01-22T00:10:41 | 2019-01-22T00:10:41 | 162,608,169 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 827 | py | # imports
print("""
|******************|
| Desafio073 |
|******************|
""")
print("Tabela do Brasileirão!")
# Variáveis
tabela = ('Palmeiras', 'Flamengo', 'Internacional', 'Grêmio', 'São Paulo', 'Atlético-MG', 'Athletico-PR', 'Cruzeiro', 'Botafogo', 'Santos', 'Bahia', 'Fluminense', 'Corinthians', 'Chapecoense', 'Ceará', 'Vasco', 'Sport', 'América-MG', 'Vitória', 'Paraná')
print("==== 5 Primeiros ====")
for pos, time in enumerate(tabela[:5]):
print(f'{pos + 1}º => {time}')
print("==== 4 Últimos ====")
for pos in range(len(tabela) - 4, len(tabela)):
print(f'{pos + 1}º => {tabela[pos]}')
print("==== Times em Ordem Alfabética ====")
for time in sorted(tabela):
print(time)
print("==== Onde tá a Chapecoense?? ====")
print(f'Ela está em {tabela.index("Chapecoense") + 1}º lugar!')
| [
"[email protected]"
] | |
dff03e0fa17d53d82ad062bc2d6e9dd9b6101a86 | 24a13b07623ce41e57ea4df1fcce0befb14d3406 | /model/densenet201/model4_val5.py | 55e955e927b2209bb720ad20719f51cf1d10ecd0 | [
"MIT"
] | permissive | shorxp/jd-fashion | 5f37e6c2235200944869e9a0da4d741c89d63b9e | 817f693672f418745e3a4c89a0417a3165b08130 | refs/heads/master | 2021-09-22T18:40:13.030601 | 2018-09-13T13:50:05 | 2018-09-13T13:50:05 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 7,032 | py | """
以model1为原型，新增real crop
"""
import math
import os
import queue
import time
import keras
from keras.layers import Dense, BatchNormalization, Activation
import config
from util import data_loader
from util import keras_util
from util.keras_util import KerasModelConfig
model_config = KerasModelConfig(k_fold_file="1.txt",
model_path=os.path.abspath(__file__),
image_resolution=224,
data_type=[config.DATA_TYPE_ORIGINAL],
label_position=[0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12],
train_batch_size=[16, 16, 16],
val_batch_size=256,
predict_batch_size=256,
initial_epoch=2,
epoch=[1, 4, 10],
lr=[0.0005, 0.00005, 0.000005],
freeze_layers=[-1, 0.6, 5])
def get_model(freeze_layers=-1, lr=0.01, output_dim=1, weights="imagenet"):
base_model = keras.applications.DenseNet201(include_top=False, weights=weights,
input_shape=model_config.image_shape, pooling="avg")
x = base_model.output
x = Dense(256, use_bias=False)(x)
x = BatchNormalization()(x)
x = Activation("relu")(x)
predictions = Dense(units=output_dim, activation='sigmoid')(x)
model = keras.Model(inputs=base_model.input, outputs=predictions)
if freeze_layers == -1:
print("freeze all basic layers, lr=%f" % lr)
for layer in base_model.layers:
layer.trainable = False
else:
if freeze_layers < 1:
freeze_layers = math.floor(len(base_model.layers) * freeze_layers)
for layer in range(freeze_layers):
base_model.layers[layer].train_layer = False
print("freeze %d basic layers, lr=%f" % (freeze_layers, lr))
model.compile(loss="binary_crossentropy",
optimizer=keras.optimizers.Adam(lr=lr))
# model.summary()
print("basic model have %d layers" % len(base_model.layers))
return model
def train():
evaluate_queue = queue.Queue()
evaluate_task = keras_util.EvaluateTask(evaluate_queue)
evaluate_task.setDaemon(True)
evaluate_task.start()
checkpoint = keras_util.EvaluateCallback(model_config, evaluate_queue)
start = time.time()
model_config.save_log("####### start train model")
init_stage = model_config.get_init_stage()
model_config.save_log("####### init stage is %d" % init_stage)
for i in range(init_stage, len(model_config.epoch)):
model_config.save_log("####### lr=%f, freeze layers=%2f epoch=%d" % (
model_config.lr[i], model_config.freeze_layers[i], model_config.epoch[i]))
clr = keras_util.CyclicLrCallback(base_lr=model_config.lr[i], max_lr=model_config.lr[i] * 5,
step_size=model_config.get_steps_per_epoch(i) / 2)
train_flow = data_loader.KerasGenerator(model_config=model_config,
featurewise_center=True,
featurewise_std_normalization=True,
width_shift_range=0.15,
height_shift_range=0.1,
horizontal_flip=True,
real_transform=True,
rescale=1. / 256).flow_from_files(model_config.train_files, mode="fit",
target_size=model_config.image_size,
batch_size=
model_config.train_batch_size[i],
shuffle=True,
label_position=model_config.label_position)
if i == 0:
model_config.save_log("####### initial epoch is 0, end epoch is %d" % model_config.epoch[i])
model = get_model(freeze_layers=model_config.freeze_layers[i], lr=model_config.lr[i],
output_dim=len(model_config.label_position))
model.fit_generator(generator=train_flow,
steps_per_epoch=model_config.get_steps_per_epoch(i),
epochs=model_config.epoch[i],
workers=16,
verbose=1,
callbacks=[checkpoint, clr])
else:
model = get_model(freeze_layers=model_config.freeze_layers[i], output_dim=len(model_config.label_position),
lr=model_config.lr[i], weights=None)
if i == init_stage:
model_config.save_log("####### load weight file: %s" % model_config.get_weights_path(model_config.initial_epoch))
model.load_weights(model_config.get_weights_path(model_config.initial_epoch))
model_config.save_log("####### initial epoch is %d, end epoch is %d" % (
model_config.initial_epoch, model_config.epoch[i]))
model.fit_generator(generator=train_flow,
steps_per_epoch=model_config.get_steps_per_epoch(i),
epochs=model_config.epoch[i],
initial_epoch=model_config.initial_epoch,
workers=16,
verbose=1,
callbacks=[checkpoint, clr])
else:
model_config.save_log("####### load weight file: %s" % model_config.get_weights_path(model_config.epoch[i - 1]))
model.load_weights(model_config.get_weights_path(model_config.epoch[i - 1]))
model_config.save_log(
"####### initial epoch is %d, end epoch is %d" % (model_config.epoch[i - 1], model_config.epoch[i]))
model.fit_generator(generator=train_flow,
steps_per_epoch=model_config.get_steps_per_epoch(i),
epochs=model_config.epoch[i],
initial_epoch=model_config.epoch[i - 1],
workers=16,
verbose=1,
callbacks=[checkpoint, clr])
model_config.save_log("####### train model spend %d seconds" % (time.time() - start))
model_config.save_log("####### train model spend %d seconds average" % ((time.time() - start) / model_config.epoch[-1]))
| [
"[email protected]"
] | |
dd8785c0296e0a16b4aa8fe1670176cd02aefe7c | 2324dea2cb3003c8ab7e8fd80588d44973eb8c77 | /Euler_8_390c.py | 35f9f192188dc8a48a12c80b619a504e65823cbe | [] | no_license | MikeOcc/MyProjectEulerFiles | 5f51bc516cb6584732dc67bb2f9c7fd9e6d51e56 | 4d066d52380aade215636953589bf56d6b88f745 | refs/heads/master | 2021-01-16T18:45:44.133229 | 2015-05-27T18:28:43 | 2015-05-27T18:28:43 | 5,876,116 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,153 | py | #
#
# Euler 278
#
#
from time import time
from Functions import primes,RetFact
from collections import defaultdict
from math import sqrt
def FactorSieve(n):
n += 1
f = defaultdict(list)
for p in xrange(2, n):
if p not in f:
for i in xrange(p + p, n, p):
j, k = i, 1
while j % p == 0:
j //= p
k *= p
f[i].append(p)
if f[p]==[]:f[p]=[p]
return f
st=time()
#v(1+b2), v(1+c2) and v(b2+c2)
#F=FactorSieve(1250002)
F=FactorSieve(1250)
def T(b,c):
a2 = b*b +1
b2 = c*c +1
#c2 = b*b + c*c
#return (((4*a2*b2) - (a2 + b2 - c2)**2)**.5)/4.
#A4=(((4*a2*b2) - 4)**.5)
A42 = (a2*b2) - 1
#A = pow(A42,.5)/2
#A = (A42**.5)/2
A = sqrt(A42)/2
return A
n=10**8
summ = 0
for i in xrange(2,22872,2):
for j in xrange(i,50000000,2):
A = T(i,j)
if int(A)==A and A<=n:
summ += int(A)
# if j in F:
#print i,j,int(A) #,F[i],F[j]
# else:
# print "! ",i,j,int(A) #,F[i],RetFact(j) #,RetFact(A)
if A>n:
#print "overflow at", i,j
break
print "sum of funky triangles is ",summ
print "time elapsed ", time()-st
| [
"[email protected]"
] | |
771a4a4a6e322e596debdfb4b5735e6d2913aaa3 | b92adbd59161b701be466b3dbeab34e2b2aaf488 | /.c9/metadata/environment/git_practice/ib_miniprojects_backend/essentials_kit_management/interactors/get_admin_account_details_interactor.py | 99a60864937770d8a0707a63b1ffb2bb5aabc2ca | [] | no_license | R151865/cloud_9_files | 7486fede7af4db4572f1b8033990a0f07f8749e8 | a468c44e9aee4a37dea3c8c9188c6c06e91cc0c4 | refs/heads/master | 2022-11-22T10:45:39.439033 | 2020-07-23T09:31:52 | 2020-07-23T09:31:52 | 281,904,416 | 0 | 1 | null | 2022-11-20T00:47:10 | 2020-07-23T09:08:48 | Python | UTF-8 | Python | false | false | 548 | py | {"filter":false,"title":"get_admin_account_details_interactor.py","tooltip":"/git_practice/ib_miniprojects_backend/essentials_kit_management/interactors/get_admin_account_details_interactor.py","undoManager":{"mark":-1,"position":-1,"stack":[]},"ace":{"folds":[],"scrolltop":0,"scrollleft":0,"selection":{"start":{"row":0,"column":0},"end":{"row":0,"column":0},"isBackwards":false},"options":{"guessTabSize":true,"useWrapMode":false,"wrapToView":true},"firstLineState":0},"timestamp":1594287027811,"hash":"65e039a7a53b00a782bc458c2b43aa4ed442474b"} | [
"[email protected]"
] | |
6c3bcd0588462a4e5f7f60dd06b5f197d341edf8 | 19049316bb6d769bffcb61d2dfb2b241b65fdb65 | /server/app/ai/mmfashion/mmfashion/models/registry.py | 8cbc143707cb4ee919a9e5b735f1957dcb75e9fe | [
"Apache-2.0"
] | permissive | alveloper/fashion-scanner-v1 | 7e43b515ad329d19982e5dd5fe92dfbab0bad948 | 067d73cbe3417c2ef337e64ca251c4f883713974 | refs/heads/master | 2023-08-12T03:21:32.169558 | 2021-09-07T15:38:58 | 2021-09-07T15:38:58 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 377 | py | from ..utils import Registry
BACKBONES = Registry('backbone')
GLOBALPOOLING = Registry('global_pool') # global pooling
ATTRPREDICTOR = Registry('attr_predictor') # predict attributes
CATEPREDICTOR = Registry('cate_predictor') # predict category
LOSSES = Registry('loss') # loss function
PREDICTOR = Registry('predictor')
GEOMETRICMATCHING = Registry('geometric_matching')
| [
"[email protected]"
] | |
14c48c22b1e687c04b46200c8bfa69ee603b2a11 | e47bc9571c59b1c6e8aeb4231a286ab8577802d4 | /easy/888-fair-candy-swap.py | 8aee86dc55f4d02630c6b484960f1a8054bca360 | [
"MIT"
] | permissive | changmeng72/leecode_python3 | d0176502dfaf3c8b455ec491c72979dd25b66b3e | 8384f52f0dd74b06b1b6aefa277dde6a228ff5f3 | refs/heads/main | 2023-05-27T10:35:43.465283 | 2021-06-09T00:20:59 | 2021-06-09T00:20:59 | 375,127,027 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 542 | py | class Solution:
def fairCandySwap(self, aliceSizes: List[int], bobSizes: List[int]) -> List[int]:
aliceSum = sum(aliceSizes)
bobSum = sum(bobSizes)
diff = (aliceSum - bobSum)/2
bob_dict = {}
for i in range(len(bobSizes)):
bob_dict[bobSizes[i]] = i
for i in range(len(aliceSizes)):
k = bob_dict.get(aliceSizes[i]-diff,-1)
if k!=-1:
return [aliceSizes[i],bobSizes[k]]
return [0,0]
| [
"[email protected]"
] | |
99393122c191269914bababfb52fe894d63c4585 | f889bc01147869459c0a516382e7b95221295a7b | /swagger_client/models/bundle_data_bundle_option_extension_interface.py | 186314a8a23389437f249b99836d42fcf7756f20 | [] | no_license | wildatheart/magento2-api-client | 249a86f5c0289743f8df5b0324ccabd76f326512 | e6a707f85b37c6c3e4ef3ff78507a7deb8f71427 | refs/heads/master | 2021-07-14T16:01:17.644472 | 2017-10-18T13:33:08 | 2017-10-18T13:33:08 | 107,412,121 | 1 | 1 | null | null | null | null | UTF-8 | Python | false | false | 2,468 | py | # coding: utf-8
"""
Magento Community
No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
OpenAPI spec version: 2.2
Generated by: https://github.com/swagger-api/swagger-codegen.git
"""
from pprint import pformat
from six import iteritems
import re
class BundleDataBundleOptionExtensionInterface(object):
"""
NOTE: This class is auto generated by the swagger code generator program.
Do not edit the class manually.
"""
"""
Attributes:
swagger_types (dict): The key is attribute name
and the value is attribute type.
attribute_map (dict): The key is attribute name
and the value is json key in definition.
"""
swagger_types = {
}
attribute_map = {
}
def __init__(self):
"""
BundleDataBundleOptionExtensionInterface - a model defined in Swagger
"""
def to_dict(self):
"""
Returns the model properties as a dict
"""
result = {}
for attr, _ in iteritems(self.swagger_types):
value = getattr(self, attr)
if isinstance(value, list):
result[attr] = list(map(
lambda x: x.to_dict() if hasattr(x, "to_dict") else x,
value
))
elif hasattr(value, "to_dict"):
result[attr] = value.to_dict()
elif isinstance(value, dict):
result[attr] = dict(map(
lambda item: (item[0], item[1].to_dict())
if hasattr(item[1], "to_dict") else item,
value.items()
))
else:
result[attr] = value
return result
def to_str(self):
"""
Returns the string representation of the model
"""
return pformat(self.to_dict())
def __repr__(self):
"""
For `print` and `pprint`
"""
return self.to_str()
def __eq__(self, other):
"""
Returns true if both objects are equal
"""
if not isinstance(other, BundleDataBundleOptionExtensionInterface):
return False
return self.__dict__ == other.__dict__
def __ne__(self, other):
"""
Returns true if both objects are not equal
"""
return not self == other
| [
"[email protected]"
] | |
0a3864ab0e1a31b27abb83ceb06746239bded135 | ca7aa979e7059467e158830b76673f5b77a0f5a3 | /Python_codes/p03600/s387875234.py | e5d97020c3d1d82fca4cb72b6c976aa6b076e6c5 | [] | no_license | Aasthaengg/IBMdataset | 7abb6cbcc4fb03ef5ca68ac64ba460c4a64f8901 | f33f1c5c3b16d0ea8d1f5a7d479ad288bb3f48d8 | refs/heads/main | 2023-04-22T10:22:44.763102 | 2021-05-13T17:27:22 | 2021-05-13T17:27:22 | 367,112,348 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,629 | py | import heapq
from collections import deque
N = int(input())
A = [[int(a) for a in input().split()] for _ in range(N)]
def dijkstra_heap(s, edge, n):
#始点sから各頂点への最短距離
d = [10**9+1] * n
used = [True] * n #True:未確定
d[s] = 0
used[s] = False
edgelist = []
for a,b in edge[s]:
heapq.heappush(edgelist,a*(10**6)+b)
while len(edgelist):
minedge = heapq.heappop(edgelist)
#まだ使われてない頂点の中から最小の距離のものを探す
if not used[minedge%(10**6)]:
continue
v = minedge%(10**6)
d[v] = minedge//(10**6)
used[v] = False
for e in edge[v]:
if used[e[1]]:
heapq.heappush(edgelist,(e[0]+d[v])*(10**6)+e[1])
return d
Road = [[] for _ in range(N)]
h = []
for i in range(N):
for j in range(i+1, N):
heapq.heappush(h, (A[i][j], i, j))
m = h[0][0]
D = [[10**9+1]*N for _ in range(N)]
ans = 0
while h:
t = heapq.heappop(h)
cost = t[0]
i = t[1]
j = t[2]
if cost < 2*m:
Road[i].append((cost, j))
Road[j].append((cost, i))
D[i][j] = cost
D[j][i] = cost
elif D[i][j] > cost:
D[i] = dijkstra_heap(i, Road, N)
if D[i][j] > cost:
Road[i].append((cost, j))
Road[j].append((cost, i))
D[i][j] = cost
D[j][i] = cost
if D[i][j] < cost:
ans = -1
break
if ans == 0:
for i in range(N):
for t in Road[i]:
ans += t[0]
ans //= 2
print(ans) | [
"[email protected]"
] | |
6a7f5db06b119930e8b4142194d3392943046c09 | 3d50cdc1fd01717dbcc43007d96a390631725ab4 | /models/api/backtest/analysis.py | 588e064d6eec6a3962b2eb0095390f9a30caab1e | [] | no_license | danielwangxh/golden_eye | 22540fc9b60e710263d348de2ecce13928b795fc | 1f6c9dc6b5cb806398024e5b678f150c074a689a | refs/heads/master | 2021-06-12T06:02:15.028910 | 2017-02-05T04:31:16 | 2017-02-05T04:31:16 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 5,485 | py | # -*- coding: utf8 -*-
import os
from simplejson import loads
import pandas as pd
from models.api.backtest.calculator import FittingDataCalculator
from sell_signals.base import SellSignal
from consts import ema_file_dir, init_point, init_time, init_offset
from libs.utils import ifcode_day_map
def read_df(path):
df_list = loads(open(path).read())
return pd.DataFrame(df_list, columns=['time_index', 'price', 'volume',
'ema_short', 'ema_long'])
class DataAnalyzer(object):
@classmethod
def ema(cls, date, ifcode, period_short, period_long):
_file = '%s/%s_%s_%s_%s' % (ema_file_dir, date, ifcode, period_short, period_long)
if os.path.isfile(_file):
df = read_df(_file)
else:
df = FittingDataCalculator.ema_df(date, ifcode, period_short, period_long)
if df.empty:
return []
sig_infos = SellSignal.compare_ema(df, limit_period=60)
profit_infos = SellSignal.profit_infos(sig_infos)
return profit_infos
#**************************************************************
#macd
@classmethod
def macd(cls, date, ifcode, period_short=12, period_long=26, period_dif=9, \
pre_point=init_point, pre_time=init_time, offset=init_offset):
#date : 'yyyy-mm-dd'
df = FittingDataCalculator.macd_df(date, ifcode, period_short, period_long, \
period_dif, pre_point, pre_time)
if df.empty:
return []
sig_infos = SellSignal.compare_macd(df, 3, offset)
profit_infos = SellSignal.profit_infos(sig_infos)
flags = SellSignal.out_flags(sig_infos)
return profit_infos
@classmethod
def macd_chart(cls, date, ifcode, period_short=12, period_long=26, period_dif=9, \
pre_point=init_point, pre_time=init_time, offset=init_offset):
df = FittingDataCalculator.macd_df(date, ifcode, period_short, period_long, \
period_dif, pre_point, pre_time)
price = df[['time_index', 'price']].values.tolist()
macd_dif = df[['time_index', 'macd_dif']].values.tolist()
macd_dem = df[['time_index', 'macd_dem']].values.tolist()
# flag
sig_infos = SellSignal.compare_macd(df, 3, offset)
flags = SellSignal.out_flags(sig_infos)
return [price, macd_dif, macd_dem, flags]
#*********************************************************
#analysis
#*********************************************************
@classmethod
def macd_analysis(cls, date, ifcode, period_short, period_long, \
period_dif, pre_point, pre_time, pre_offset):
#date : 'yyyy-mm-dd'
df = FittingDataCalculator.macd_df(date, ifcode, period_short, period_long, \
period_dif, pre_point, pre_time)
if df.empty:
return []
sig_infos = SellSignal.compare_macd(df, 3, pre_offset)
profit_infos = SellSignal.profit_infos(sig_infos)
return profit_infos
@classmethod
def macd_if_analysis(cls, ifcode, pre_point, pre_time, pre_offset, \
period_short=12, period_long=26, period_dif=9, trans_amount=1):
rs = []
total = 0
pos_num = 0
nag_num = 0
trans_total_num = 0
date_list = ifcode_day_map(ifcode)
for day in date_list:
profit_infos = cls.macd_analysis(day, ifcode, period_short, period_long, \
period_dif, pre_point, pre_time, pre_offset)
profit_all = 0
trans_num = (len(profit_infos) - 1) / 2
trans_total_num += trans_num
for item in profit_infos:
if item['gain'] != '-':
profit_all += int(item['gain']) * trans_amount
rs.append({'date': day, 'profit': profit_all, 'trans_num': trans_num})
total += profit_all
if profit_all >= 0:
pos_num += 1
elif profit_all < 0 :
nag_num += 1
if nag_num == 0:
profit_rate = pos_num
else:
profit_rate = pos_num*1.0/nag_num
fees = trans_total_num * 2300
real_profit = total - fees
return {'profit': total, 'real_profit': real_profit,
'profit_rate': profit_rate, 'trans_total_num': trans_total_num,
'fees': fees, 'trans_amount': trans_amount}
#*************************************************************
#boll
@classmethod
def boll_chart(cls, date, ifcode, period_short=50, period_long=80, pre_point=10):
df = FittingDataCalculator.boll_df(date, ifcode, period_short, period_long, pre_point)
price = df[['time_index', 'price']].values.tolist()
boll_up = df[['time_index', 'boll_up']].values.tolist()
boll_dn = df[['time_index', 'boll_dn']].values.tolist()
boll_mb = df[['time_index', 'boll_mb']].values.tolist()
return price, boll_up, boll_dn, boll_mb
@classmethod
def boll(cls, date, ifcode, period_short=50, period_long=80, pre_point=10):
df = FittingDataCalculator.boll_df(date, ifcode, period_short, period_long, pre_point)
sig_infos = SellSignal.compare_boll_b_percent(df)
profit_infos = SellSignal.profit_infos(sig_infos)
return profit_infos
| [
"[email protected]"
] | |
62ff16334955a6f7413d9d5e053b966753d69de4 | e47bd43968732b55907aa1b8d3530b9ec12bc0e1 | /pipeline/pipeline_stack.py | 91dd67f89f5ee450816f3521282190c65eac6b36 | [
"Apache-2.0"
] | permissive | damshenas/enechobot | 523763c8bb3d54e86fb6586c4883ca3008704014 | 9e346a87433abc1d95c60c3b9ee9401becf7a88f | refs/heads/main | 2023-06-28T16:21:08.637064 | 2021-08-09T10:19:08 | 2021-08-09T10:19:08 | 394,225,747 | 0 | 0 | Apache-2.0 | 2021-08-09T10:19:09 | 2021-08-09T09:15:21 | null | UTF-8 | Python | false | false | 4,368 | py |
import json
from aws_cdk import (core, aws_codebuild as codebuild,
aws_codecommit as codecommit,
aws_codepipeline as codepipeline,
aws_codepipeline_actions as codepipeline_actions,
aws_s3 as s3,
aws_lambda as lambda_)
class PipelineStack(core.Stack):
def __init__(self, scope: core.Construct, id: str, *, repo_name: str=None,
application_code: lambda_.CfnParametersCode=None, **kwargs) -> None:
super().__init__(scope, id, **kwargs)
# In this stack we create the pipeline using CDK
# We have one pipeline, 2 builds and 1 deployment
# The pipeline has multiple stages (in this example we have 3 stages: Source, Build, and Deploy)
# 1 builds is for creating the artifact used for lambda function
# another build is for creating the cloudformation template and the whole infra
# reading the buildspecs JSON from file but should also be possible to write it in Python
with open('./pipeline/buildspecs.json') as f:
buildspecs = json.load(f)
### S3 bucket
# for build output
build_output_S3_bucket = s3.Bucket(self, "BUILD_OUTCOME")
# Important Note. It is better not to create the repo in the stack as destroying the stack can delete the repo!!
code = codecommit.Repository.from_repository_name(self, "ImportedRepo", repo_name)
# buildspec phase name: built. Possible phases: build,install,post_build,pre_build
cdk_build_spec = codebuild.BuildSpec.from_object(buildspecs["cdk_build_spec"])
telegram_build_spec = codebuild.BuildSpec.from_object(buildspecs["telegram_build_spec"])
cdk_build = codebuild.PipelineProject(self, "CdkBuild", build_spec=cdk_build_spec)
telegram_build = codebuild.PipelineProject(self, 'telegram', build_spec=telegram_build_spec)
source_output = codepipeline.Artifact()
cdk_build_output = codepipeline.Artifact("CdkBuildOutput")
telegram_build_output = codepipeline.Artifact("TelegramBuildOutput")
telegram_lambda_location = telegram_build_output.s3_location
pipeline_source_stage = codepipeline.StageProps(stage_name="Source",
actions=[
codepipeline_actions.CodeCommitSourceAction(
action_name="CodeCommit_Source",
repository=code,
branch="develop",
output=source_output)])
pipeline_build_stage = codepipeline.StageProps(stage_name="Build",
actions=[
codepipeline_actions.CodeBuildAction(
action_name="telegram_build",
project=telegram_build,
input=source_output,
outputs=[telegram_build_output]),
codepipeline_actions.CodeBuildAction(
action_name="CDK_Build",
project=cdk_build,
input=source_output,
outputs=[cdk_build_output])
])
pipeline_deploy_stage_action1 = codepipeline_actions.CloudFormationCreateUpdateStackAction(
action_name="Lambda_CFN_Deploy",
template_path=cdk_build_output.at_path("EnEchoBot.template.json"),
stack_name="TelegramDeploymentStack",
admin_permissions=True,
parameter_overrides=dict(
application_code.assign(
bucket_name=telegram_lambda_location.bucket_name,
object_key=telegram_lambda_location.object_key,
object_version=telegram_lambda_location.object_version)),
extra_inputs=[telegram_build_output])
pipeline_deploy_stage = codepipeline.StageProps(stage_name="Deploy", actions=[pipeline_deploy_stage_action1])
codepipeline.Pipeline(self, "Pipeline", stages=[pipeline_source_stage, pipeline_build_stage, pipeline_deploy_stage], artifact_bucket=build_output_S3_bucket) | [
"[email protected]"
] | |
effe5703e8df5737683f1cdd5c1f32c9ba9485c3 | 292437b85108504a7ca91571f26a639a313501b6 | /venv2/lib/python2.7/site-packages/monasca_setup/main.py | aa428c7d23431698843c27bc087991f9cd920fb1 | [] | no_license | heekof/monitoring-agent | c86bebcf77091490df7a6b8c881b85fdb2b9e4eb | b1c079efdf2dabe854f2aa3d96f36d2ec7021070 | refs/heads/master | 2021-01-15T15:39:01.512801 | 2016-08-31T20:53:38 | 2016-08-31T20:53:38 | 58,620,098 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 15,290 | py | #!/usr/bin/env python
# (C) Copyright 2015-2016 Hewlett Packard Enterprise Development Company LP
""" Detect running daemons then configure and start the agent.
"""
import argparse
from glob import glob
import logging
import os
import pwd
import socket
import subprocess
import sys
import agent_config
import monasca_setup.utils as utils
from monasca_setup.utils import write_template
from service.detection import detect_init
log = logging.getLogger(__name__)
CUSTOM_PLUGIN_PATH = '/usr/lib/monasca/agent/custom_detect.d'
# dirname is called twice to get the dir 1 above the location of the script
PREFIX_DIR = os.path.dirname(os.path.dirname(os.path.realpath(sys.argv[0])))
def main(argv=None):
parser = argparse.ArgumentParser(description='Configure and setup the agent. In a full run it will detect running' +
' daemons then configure and start the agent.',
formatter_class=argparse.ArgumentDefaultsHelpFormatter)
args = parse_arguments(parser)
if args.verbose:
logging.basicConfig(level=logging.DEBUG, format="%(levelname)s: %(message)s")
else:
logging.basicConfig(level=logging.INFO, format="%(levelname)s: %(message)s")
if args.dry_run:
log.info("Running in dry run mode, no changes will be made only reported")
# Detect and if possibly enable the agent service
agent_service = detect_init(PREFIX_DIR, args.config_dir, args.log_dir, args.template_dir, username=args.user)
# Skip base setup if only installing plugins or running specific detection
# plugins
if not args.install_plugins_only and args.detection_plugins is None:
if not args.skip_enable:
agent_service.enable()
# Verify required options
if args.username is None or args.password is None or args.keystone_url is None:
log.error('Username, password and keystone_url are required when running full configuration.')
parser.print_help()
sys.exit(1)
base_configuration(args)
# Collect the set of detection plugins to run
detected_plugins = utils.discover_plugins(CUSTOM_PLUGIN_PATH)
if args.system_only:
from detection.plugins.system import System
plugins = [System]
elif args.detection_plugins is not None:
plugins = utils.select_plugins(args.detection_plugins, detected_plugins)
else:
plugins = detected_plugins
plugin_names = [p.__name__ for p in plugins]
if args.remove: # Remove entries for each plugin from the various plugin config files
changes = remove_config(args, plugin_names)
else:
# Run detection for all the plugins, halting on any failures if plugins were specified in the arguments
detected_config = plugin_detection(plugins, args.template_dir, args.detection_args,
skip_failed=(args.detection_plugins is None))
if detected_config is None:
return 1 # Indicates detection problem, skip remaining steps and give non-zero exit code
changes = modify_config(args, detected_config)
# Don't restart if only doing detection plugins and no changes found
if args.detection_plugins is not None and not changes:
log.info('No changes found for plugins {0}, skipping restart of Monasca Agent'.format(plugin_names))
return 0
elif args.dry_run:
log.info('Running in dry mode, skipping changes and restart of Monasca Agent')
return 0
# Now that the config is built, start the service
if args.install_plugins_only:
log.info('Command line option install_plugins_only set, skipping '
'service (re)start.')
else:
try:
agent_service.start(restart=True)
except subprocess.CalledProcessError:
log.error('The service did not startup correctly see %s' % args.log_dir)
def base_configuration(args):
"""Write out the primary Agent configuration and setup the service.
:param args: Arguments from the command line
:return: None
"""
gid = pwd.getpwnam(args.user).pw_gid
# Write the main agent.yaml - Note this is always overwritten
log.info('Configuring base Agent settings.')
dimensions = {}
# Join service in with the dimensions
if args.service:
dimensions.update({'service': args.service})
if args.dimensions:
dimensions.update(dict(item.strip().split(":") for item in args.dimensions.split(",")))
args.dimensions = dict((name, value) for (name, value) in dimensions.iteritems())
write_template(os.path.join(args.template_dir, 'agent.yaml.template'),
os.path.join(args.config_dir, 'agent.yaml'),
{'args': args, 'hostname': socket.getfqdn()},
gid,
is_yaml=True)
# Write the supervisor.conf
write_template(os.path.join(args.template_dir, 'supervisor.conf.template'),
os.path.join(args.config_dir, 'supervisor.conf'),
{'prefix': PREFIX_DIR, 'log_dir': args.log_dir, 'monasca_user': args.user},
gid)
def modify_config(args, detected_config):
changes = False
# Compare existing and detected config for each check plugin and write out the plugin config if changes
for key, value in detected_config.iteritems():
if args.overwrite:
changes = True
if args.dry_run:
continue
else:
agent_config.save_plugin_config(args.config_dir, key, args.user, value)
else:
old_config = agent_config.read_plugin_config_from_disk(args.config_dir, key)
# merge old and new config, new has precedence
if old_config is not None:
if key == "http_check":
old_config_urls = [i['url'] for i in old_config['instances'] if 'url' in i]
value, old_config = agent_config.check_endpoint_changes(value, old_config)
agent_config.merge_by_name(value['instances'], old_config['instances'])
# Sort before compare, if instances have no name the sort will fail making order changes significant
try:
value['instances'].sort(key=lambda k: k['name'])
old_config['instances'].sort(key=lambda k: k['name'])
except Exception:
pass
value_urls = [i['url'] for i in value['instances'] if 'url' in i]
if key == "http_check":
if value_urls == old_config_urls: # Don't write config if no change
continue
else:
if value == old_config:
continue
changes = True
if args.dry_run:
log.info("Changes would be made to the config file for the {0} check plugin".format(key))
else:
agent_config.save_plugin_config(args.config_dir, key, args.user, value)
return changes
def parse_arguments(parser):
parser.add_argument(
'-u', '--username', help="Username used for keystone authentication. Required for basic configuration.")
parser.add_argument(
'-p', '--password', help="Password used for keystone authentication. Required for basic configuration.")
parser.add_argument('--user_domain_id', help="User domain id for keystone authentication", default='')
parser.add_argument('--user_domain_name', help="User domain name for keystone authentication", default='')
parser.add_argument('--keystone_url', help="Keystone url. Required for basic configuration.")
parser.add_argument('--project_name', help="Project name for keystone authentication", default='')
parser.add_argument('--project_domain_id', help="Project domain id for keystone authentication", default='')
parser.add_argument('--project_domain_name', help="Project domain name for keystone authentication", default='')
parser.add_argument('--project_id', help="Keystone project id for keystone authentication", default='')
parser.add_argument('--monasca_url', help="Monasca API url, if not defined the url is pulled from keystone",
default='')
parser.add_argument('--system_only', help="Setup the service but only configure the base config and system " +
"metrics (cpu, disk, load, memory, network).",
action="store_true", default=False)
parser.add_argument('-d', '--detection_plugins', nargs='*',
help="Skip base config and service setup and only configure this space separated list. " +
"This assumes the base config has already run.")
parser.add_argument('-a', '--detection_args', help="A string of arguments that will be passed to detection " +
"plugins. Only certain detection plugins use arguments.")
parser.add_argument('--check_frequency', help="How often to run metric collection in seconds", type=int, default=30)
parser.add_argument('--dimensions', help="Additional dimensions to set for all metrics. A comma separated list " +
"of name/value pairs, 'name:value,name2:value2'")
parser.add_argument('--ca_file', help="Sets the path to the ca certs file if using certificates. " +
"Required only if insecure is set to False", default='')
parser.add_argument('--insecure', help="Set whether certificates are used for Keystone authentication",
default=False)
parser.add_argument('--config_dir', help="Configuration directory", default='/etc/monasca/agent')
parser.add_argument('--log_dir', help="monasca-agent log directory", default='/var/log/monasca/agent')
parser.add_argument('--log_level', help="monasca-agent logging level (ERROR, WARNING, INFO, DEBUG)", required=False,
default='WARN')
parser.add_argument('--template_dir', help="Alternative template directory",
default=os.path.join(PREFIX_DIR, 'share/monasca/agent'))
parser.add_argument('--overwrite',
help="Overwrite existing plugin configuration. " +
"The default is to merge. agent.yaml is always overwritten.",
action="store_true")
parser.add_argument('-r', '--remove', help="Rather than add the detected configuration remove it.",
action="store_true", default=False)
parser.add_argument('--skip_enable', help="By default the service is enabled, " +
"which requires the script run as root. Set this to skip that step.",
action="store_true")
parser.add_argument('--install_plugins_only', help="Only update plugin "
"configuration, do not configure services, users, etc."
" or restart services",
action="store_true")
parser.add_argument('--user', help="User name to run monasca-agent as", default='mon-agent')
parser.add_argument('-s', '--service', help="Service this node is associated with, added as a dimension.")
parser.add_argument('--amplifier', help="Integer for the number of additional measurements to create. " +
"Additional measurements contain the 'amplifier' dimension. " +
"Useful for load testing; not for production use.", default=0)
parser.add_argument('-v', '--verbose', help="Verbose Output", action="store_true")
parser.add_argument('--dry_run', help="Make no changes just report on changes", action="store_true")
return parser.parse_args()
def plugin_detection(plugins, template_dir, detection_args, skip_failed=True, remove=False):
"""Runs the detection step for each plugin in the list and returns the complete detected agent config.
:param plugins: A list of detection plugin classes
:param template_dir: Location of plugin configuration templates
:param detection_args: Arguments passed to each detection plugin
:param skip_failed: When False any detection failure causes the run to halt and return None
:return: An agent_config instance representing the total configuration from all detection plugins run.
"""
plugin_config = agent_config.Plugins()
for detect_class in plugins:
# todo add option to install dependencies
detect = detect_class(template_dir, False, detection_args)
if detect.available:
new_config = detect.build_config_with_name()
if not remove:
log.info('Configuring {0}'.format(detect.name))
if new_config is not None:
plugin_config.merge(new_config)
elif not skip_failed:
log.warn('Failed detection of plugin {0}.'.format(detect.name) +
"\n\tPossible causes: Service not found or missing arguments.")
return None
return plugin_config
def remove_config(args, plugin_names):
"""Parse all configuration removing any configuration built by plugins in plugin_names
Note there is no concept of overwrite for removal.
:param args: specified arguments
:param plugin_names: A list of the plugin names to remove from the config
:return: True if changes, false otherwise
"""
changes = False
existing_config_files = glob(os.path.join(args.config_dir, 'conf.d', '*.yaml'))
detected_plugins = utils.discover_plugins(CUSTOM_PLUGIN_PATH)
plugins = utils.select_plugins(args.detection_plugins, detected_plugins)
if args.detection_args is not None:
detected_config = plugin_detection(
plugins, args.template_dir, args.detection_args,
skip_failed=(args.detection_plugins is None), remove=True)
for file_path in existing_config_files:
deletes = False
plugin_name = os.path.splitext(os.path.basename(file_path))[0]
config = agent_config.read_plugin_config_from_disk(args.config_dir, plugin_name)
new_instances = [] # To avoid odd issues from iterating over a list you delete from, build a new instead
if args.detection_args is None:
for inst in config['instances']:
if 'built_by' in inst and inst['built_by'] in plugin_names:
changes = True
deletes = True
continue
new_instances.append(inst)
config['instances'] = new_instances
else:
for detected_key in detected_config.keys():
for inst in detected_config[detected_key]['instances']:
if inst in config['instances']:
changes = True
deletes = True
config['instances'].remove(inst)
if deletes:
agent_config.delete_from_config(args, config, file_path, plugin_name)
return changes
if __name__ == "__main__":
sys.exit(main())
| [
"[email protected]"
] | |
e96ceb65864385e40bf500f14c613be2609612c7 | ec1059f4ccea10deb2cb8fd7f9458700a5e6ca4c | /venv/Lib/site-packages/qiskit/chemistry/algorithms/ground_state_solvers/minimum_eigensolver_factories/vqe_uvccsd_factory.py | b6420e3857c9e732031dfb81131ff2bd2a339632 | [
"MIT",
"Apache-2.0"
] | permissive | shivam675/Quantum-CERN | b60c697a3a7ad836b3653ee9ce3875a6eafae3ba | ce02d9198d9f5a1aa828482fea9b213a725b56bb | refs/heads/main | 2023-01-06T20:07:15.994294 | 2020-11-13T10:01:38 | 2020-11-13T10:01:38 | 330,435,191 | 1 | 0 | MIT | 2021-01-17T16:29:26 | 2021-01-17T16:29:25 | null | UTF-8 | Python | false | false | 6,073 | py | # This code is part of Qiskit.
#
# (C) Copyright IBM 2020.
#
# This code is licensed under the Apache License, Version 2.0. You may
# obtain a copy of this license in the LICENSE.txt file in the root directory
# of this source tree or at http://www.apache.org/licenses/LICENSE-2.0.
#
# Any modifications or derivative works of this code must retain this
# copyright notice, and modified files need to carry a notice indicating
# that they have been altered from the originals.
"""The minimum eigensolver factory for ground state calculation algorithms."""
from typing import Optional
import numpy as np
from qiskit.aqua import QuantumInstance
from qiskit.aqua.algorithms import MinimumEigensolver, VQE
from qiskit.aqua.operators import ExpectationBase
from qiskit.aqua.components.optimizers import Optimizer
from qiskit.chemistry.components.initial_states import VSCF
from qiskit.chemistry.components.variational_forms import UVCC
from qiskit.chemistry.transformations import BosonicTransformation
from .minimum_eigensolver_factory import MinimumEigensolverFactory
class VQEUVCCSDFactory(MinimumEigensolverFactory):
"""A factory to construct a VQE minimum eigensolver with UVCCSD ansatz wavefunction."""
def __init__(self,
quantum_instance: QuantumInstance,
optimizer: Optional[Optimizer] = None,
initial_point: Optional[np.ndarray] = None,
expectation: Optional[ExpectationBase] = None,
include_custom: bool = False) -> None:
"""
Args:
quantum_instance: The quantum instance used in the minimum eigensolver.
optimizer: A classical optimizer.
initial_point: An optional initial point (i.e. initial parameter values)
for the optimizer. If ``None`` then VQE will look to the variational form for a
preferred point and if not will simply compute a random one.
expectation: The Expectation converter for taking the average value of the
Observable over the var_form state function. When ``None`` (the default) an
:class:`~qiskit.aqua.operators.expectations.ExpectationFactory` is used to select
an appropriate expectation based on the operator and backend. When using Aer
qasm_simulator backend, with paulis, it is however much faster to leverage custom
Aer function for the computation but, although VQE performs much faster
with it, the outcome is ideal, with no shot noise, like using a state vector
simulator. If you are just looking for the quickest performance when choosing Aer
qasm_simulator and the lack of shot noise is not an issue then set `include_custom`
parameter here to ``True`` (defaults to ``False``).
include_custom: When `expectation` parameter here is None setting this to ``True`` will
allow the factory to include the custom Aer pauli expectation.
"""
self._quantum_instance = quantum_instance
self._optimizer = optimizer
self._initial_point = initial_point
self._expectation = expectation
self._include_custom = include_custom
@property
def quantum_instance(self) -> QuantumInstance:
"""Getter of the quantum instance."""
return self._quantum_instance
@quantum_instance.setter
def quantum_instance(self, q_instance: QuantumInstance) -> None:
"""Setter of the quantum instance."""
self._quantum_instance = q_instance
@property
def optimizer(self) -> Optimizer:
"""Getter of the optimizer."""
return self._optimizer
@optimizer.setter
def optimizer(self, optimizer: Optimizer) -> None:
"""Setter of the optimizer."""
self._optimizer = optimizer
@property
def initial_point(self) -> np.ndarray:
"""Getter of the initial point."""
return self._initial_point
@initial_point.setter
def initial_point(self, initial_point: np.ndarray) -> None:
"""Setter of the initial point."""
self._initial_point = initial_point
@property
def expectation(self) -> ExpectationBase:
"""Getter of the expectation."""
return self._expectation
@expectation.setter
def expectation(self, expectation: ExpectationBase) -> None:
"""Setter of the expectation."""
self._expectation = expectation
@property
def include_custom(self) -> bool:
"""Getter of the ``include_custom`` setting for the ``expectation`` setting."""
return self._include_custom
@include_custom.setter
def include_custom(self, include_custom: bool) -> None:
"""Setter of the ``include_custom`` setting for the ``expectation`` setting."""
self._include_custom = include_custom
def get_solver(self, transformation: BosonicTransformation) -> MinimumEigensolver:
"""Returns a VQE with a UVCCSD wavefunction ansatz, based on ``transformation``.
This works only with a ``BosonicTransformation``.
Args:
transformation: a bosonic qubit operator transformation.
Returns:
A VQE suitable to compute the ground state of the molecule transformed
by ``transformation``.
"""
basis = transformation.basis
num_modes = transformation.num_modes
if isinstance(basis, int):
basis = [basis] * num_modes
num_qubits = sum(basis)
initial_state = VSCF(basis)
var_form = UVCC(num_qubits, basis, [0, 1], initial_state=initial_state)
vqe = VQE(var_form=var_form,
quantum_instance=self._quantum_instance,
optimizer=self._optimizer,
initial_point=self._initial_point,
expectation=self._expectation,
include_custom=self._include_custom)
return vqe
def supports_aux_operators(self):
return VQE.supports_aux_operators()
| [
"[email protected]"
] | |
a1b924f5f49eed987ae00f6718ac5bb748d24885 | c9ddbdb5678ba6e1c5c7e64adf2802ca16df778c | /cases/synthetic/sieve-big-2962.py | 7ac76ceb1003da851367d979a20444b8c1c279b0 | [] | no_license | Virtlink/ccbench-chocopy | c3f7f6af6349aff6503196f727ef89f210a1eac8 | c7efae43bf32696ee2b2ee781bdfe4f7730dec3f | refs/heads/main | 2023-04-07T15:07:12.464038 | 2022-02-03T15:42:39 | 2022-02-03T15:42:39 | 451,969,776 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 31,740 | py | # A resizable list of integers
class Vector(object):
items: [int] = None
size: int = 0
def __init__(self:"Vector"):
self.items = [0]
# Returns current capacity
def capacity(self:"Vector") -> int:
return len(self.items)
# Increases capacity of vector by one element
def increase_capacity(self:"Vector") -> int:
self.items = self.items + [0]
return self.capacity()
# Appends one item to end of vector
def append(self:"Vector", item: int) -> object:
if self.size == self.capacity():
self.increase_capacity()
self.items[self.size] = item
self.size = self.size + 1
# Appends many items to end of vector
def append_all(self:"Vector", new_items: [int]) -> object:
item:int = 0
for item in new_items:
self.append(item)
# Removes an item from the middle of vector
def remove_at(self:"Vector", idx: int) -> object:
if idx < 0:
return
while idx < self.size - 1:
self.items[idx] = self.items[idx + 1]
idx = idx + 1
self.size = self.size - 1
# Retrieves an item at a given index
def get(self:"Vector", idx: int) -> int:
return self.items[idx]
# Retrieves the current size of the vector
def length(self:"Vector") -> int:
return self.size
# A resizable list of integers
class Vector2(object):
items: [int] = None
items2: [int] = None
size: int = 0
size2: int = 0
def __init__(self:"Vector2"):
self.items = [0]
# Returns current capacity
def capacity(self:"Vector2") -> int:
return len(self.items)
# Returns current capacity
def capacity2(self:"Vector2") -> int:
return len(self.items)
# Increases capacity of vector by one element
def increase_capacity(self:"Vector2") -> int:
self.items = self.items + [0]
return self.capacity()
# Increases capacity of vector by one element
def increase_capacity2(self:"Vector2") -> int:
self.items = self.items + [0]
return self.capacity()
# Appends one item to end of vector
def append(self:"Vector2", item: int) -> object:
if self.size == self.capacity():
self.increase_capacity()
self.items[self.size] = item
self.size = self.size + 1
# Appends one item to end of vector
def append2(self:"Vector2", item: int, item2: int) -> object:
if self.size == self.capacity():
self.increase_capacity()
self.items[self.size] = item
self.size = self.size + 1
# Appends many items to end of vector
def append_all(self:"Vector2", new_items: [int]) -> object:
item:int = 0
for item in new_items:
self.append(item)
# Appends many items to end of vector
def append_all2(self:"Vector2", new_items: [int], new_items2: [int]) -> object:
item:int = 0
item2:int = 0
for item in new_items:
self.append(item)
# Removes an item from the middle of vector
def remove_at(self:"Vector2", idx: int) -> object:
if idx < 0:
return
while idx < self.size - 1:
self.items[idx] = self.items[idx + 1]
idx = idx + 1
self.size = self.size - 1
# Removes an item from the middle of vector
def remove_at2(self:"Vector2", idx: int, idx2: int) -> object:
if idx < 0:
return
while idx < self.size - 1:
self.items[idx] = self.items[idx + 1]
idx = idx + 1
self.size = self.size - 1
# Retrieves an item at a given index
def get(self:"Vector2", idx: int) -> int:
return self.items[idx]
# Retrieves an item at a given index
def get2(self:"Vector2", idx: int, idx2: int) -> int:
return self.items[idx]
# Retrieves the current size of the vector
def length(self:"Vector2") -> int:
return self.size
# Retrieves the current size of the vector
def length2(self:"Vector2") -> int:
return self.size
# A resizable list of integers
class Vector3(object):
items: [int] = None
items2: [int] = None
items3: [int] = None
size: int = 0
size2: int = 0
size3: int = 0
def __init__(self:"Vector3"):
self.items = [0]
# Returns current capacity
def capacity(self:"Vector3") -> int:
return len(self.items)
# Returns current capacity
def capacity2(self:"Vector3") -> int:
return len(self.items)
# Returns current capacity
def capacity3(self:"Vector3") -> int:
return len(self.items)
# Increases capacity of vector by one element
def increase_capacity(self:"Vector3") -> int:
self.items = self.items + [0]
return self.capacity()
# Increases capacity of vector by one element
def increase_capacity2(self:"Vector3") -> int:
self.items = self.items + [0]
return self.capacity()
# Increases capacity of vector by one element
def increase_capacity3(self:"Vector3") -> int:
self.items = self.items + [0]
return self.capacity()
# Appends one item to end of vector
def append(self:"Vector3", item: int) -> object:
if self.size == self.capacity():
self.increase_capacity()
self.items[self.size] = item
self.size = self.size + 1
# Appends one item to end of vector
def append2(self:"Vector3", item: int, item2: int) -> object:
if self.size == self.capacity():
self.increase_capacity()
self.items[self.size] = item
self.size = self.size + 1
# Appends one item to end of vector
def append3(self:"Vector3", item: int, item2: int, item3: int) -> object:
if self.size == self.capacity():
self.increase_capacity()
self.items[self.size] = item
self.size = self.size + 1
# Appends many items to end of vector
def append_all(self:"Vector3", new_items: [int]) -> object:
item:int = 0
for item in new_items:
self.append(item)
# Appends many items to end of vector
def append_all2(self:"Vector3", new_items: [int], new_items2: [int]) -> object:
item:int = 0
item2:int = 0
for item in new_items:
self.append(item)
# Appends many items to end of vector
def append_all3(self:"Vector3", new_items: [int], new_items2: [int], new_items3: [int]) -> object:
item:int = 0
item2:int = 0
item3:int = 0
for item in new_items:
self.append(item)
# Removes an item from the middle of vector
def remove_at(self:"Vector3", idx: int) -> object:
if idx < 0:
return
while idx < self.size - 1:
self.items[idx] = self.items[idx + 1]
idx = idx + 1
self.size = self.size - 1
# Removes an item from the middle of vector
def remove_at2(self:"Vector3", idx: int, idx2: int) -> object:
if idx < 0:
return
while idx < self.size - 1:
self.items[idx] = self.items[idx + 1]
idx = idx + 1
self.size = self.size - 1
# Removes an item from the middle of vector
def remove_at3(self:"Vector3", idx: int, idx2: int, idx3: int) -> object:
if idx < 0:
return
while idx < self.size - 1:
self.items[idx] = self.items[idx + 1]
idx = idx + 1
self.size = self.size - 1
# Retrieves an item at a given index
def get(self:"Vector3", idx: int) -> int:
return self.items[idx]
# Retrieves an item at a given index
def get2(self:"Vector3", idx: int, idx2: int) -> int:
return self.items[idx]
# Retrieves an item at a given index
def get3(self:"Vector3", idx: int, idx2: int, idx3: int) -> int:
return self.items[idx]
# Retrieves the current size of the vector
def length(self:"Vector3") -> int:
return self.size
# Retrieves the current size of the vector
def length2(self:"Vector3") -> int:
return self.size
# Retrieves the current size of the vector
def length3(self:"Vector3") -> int:
return self.size
# A resizable list of integers
class Vector4(object):
items: [int] = None
items2: [int] = None
items3: [int] = None
items4: [int] = None
size: int = 0
size2: int = 0
size3: int = 0
size4: int = 0
def __init__(self:"Vector4"):
self.items = [0]
# Returns current capacity
def capacity(self:"Vector4") -> int:
return len(self.items)
# Returns current capacity
def capacity2(self:"Vector4") -> int:
return len(self.items)
# Returns current capacity
def capacity3(self:"Vector4") -> int:
return len(self.items)
# Returns current capacity
def capacity4(self:"Vector4") -> int:
return len(self.items)
# Increases capacity of vector by one element
def increase_capacity(self:"Vector4") -> int:
self.items = self.items + [0]
return self.capacity()
# Increases capacity of vector by one element
def increase_capacity2(self:"Vector4") -> int:
self.items = self.items + [0]
return self.capacity()
# Increases capacity of vector by one element
def increase_capacity3(self:"Vector4") -> int:
self.items = self.items + [0]
return self.capacity()
# Increases capacity of vector by one element
def increase_capacity4(self:"Vector4") -> int:
self.items = self.items + [0]
return self.capacity()
# Appends one item to end of vector
def append(self:"Vector4", item: int) -> object:
if self.size == self.capacity():
self.increase_capacity()
$Index = item
self.size = self.size + 1
# Appends one item to end of vector
def append2(self:"Vector4", item: int, item2: int) -> object:
if self.size == self.capacity():
self.increase_capacity()
self.items[self.size] = item
self.size = self.size + 1
# Appends one item to end of vector
def append3(self:"Vector4", item: int, item2: int, item3: int) -> object:
if self.size == self.capacity():
self.increase_capacity()
self.items[self.size] = item
self.size = self.size + 1
# Appends one item to end of vector
def append4(self:"Vector4", item: int, item2: int, item3: int, item4: int) -> object:
if self.size == self.capacity():
self.increase_capacity()
self.items[self.size] = item
self.size = self.size + 1
# Appends many items to end of vector
def append_all(self:"Vector4", new_items: [int]) -> object:
item:int = 0
for item in new_items:
self.append(item)
# Appends many items to end of vector
def append_all2(self:"Vector4", new_items: [int], new_items2: [int]) -> object:
item:int = 0
item2:int = 0
for item in new_items:
self.append(item)
# Appends many items to end of vector
def append_all3(self:"Vector4", new_items: [int], new_items2: [int], new_items3: [int]) -> object:
item:int = 0
item2:int = 0
item3:int = 0
for item in new_items:
self.append(item)
# Appends many items to end of vector
def append_all4(self:"Vector4", new_items: [int], new_items2: [int], new_items3: [int], new_items4: [int]) -> object:
item:int = 0
item2:int = 0
item3:int = 0
item4:int = 0
for item in new_items:
self.append(item)
# Removes an item from the middle of vector
def remove_at(self:"Vector4", idx: int) -> object:
if idx < 0:
return
while idx < self.size - 1:
self.items[idx] = self.items[idx + 1]
idx = idx + 1
self.size = self.size - 1
# Removes an item from the middle of vector
def remove_at2(self:"Vector4", idx: int, idx2: int) -> object:
if idx < 0:
return
while idx < self.size - 1:
self.items[idx] = self.items[idx + 1]
idx = idx + 1
self.size = self.size - 1
# Removes an item from the middle of vector
def remove_at3(self:"Vector4", idx: int, idx2: int, idx3: int) -> object:
if idx < 0:
return
while idx < self.size - 1:
self.items[idx] = self.items[idx + 1]
idx = idx + 1
self.size = self.size - 1
# Removes an item from the middle of vector
def remove_at4(self:"Vector4", idx: int, idx2: int, idx3: int, idx4: int) -> object:
if idx < 0:
return
while idx < self.size - 1:
self.items[idx] = self.items[idx + 1]
idx = idx + 1
self.size = self.size - 1
# Retrieves an item at a given index
def get(self:"Vector4", idx: int) -> int:
return self.items[idx]
# Retrieves an item at a given index
def get2(self:"Vector4", idx: int, idx2: int) -> int:
return self.items[idx]
# Retrieves an item at a given index
def get3(self:"Vector4", idx: int, idx2: int, idx3: int) -> int:
return self.items[idx]
# Retrieves an item at a given index
def get4(self:"Vector4", idx: int, idx2: int, idx3: int, idx4: int) -> int:
return self.items[idx]
# Retrieves the current size of the vector
def length(self:"Vector4") -> int:
return self.size
# Retrieves the current size of the vector
def length2(self:"Vector4") -> int:
return self.size
# Retrieves the current size of the vector
def length3(self:"Vector4") -> int:
return self.size
# Retrieves the current size of the vector
def length4(self:"Vector4") -> int:
return self.size
# A resizable list of integers
class Vector5(object):
items: [int] = None
items2: [int] = None
items3: [int] = None
items4: [int] = None
items5: [int] = None
size: int = 0
size2: int = 0
size3: int = 0
size4: int = 0
size5: int = 0
def __init__(self:"Vector5"):
self.items = [0]
# Returns current capacity
def capacity(self:"Vector5") -> int:
return len(self.items)
# Returns current capacity
def capacity2(self:"Vector5") -> int:
return len(self.items)
# Returns current capacity
def capacity3(self:"Vector5") -> int:
return len(self.items)
# Returns current capacity
def capacity4(self:"Vector5") -> int:
return len(self.items)
# Returns current capacity
def capacity5(self:"Vector5") -> int:
return len(self.items)
# Increases capacity of vector by one element
def increase_capacity(self:"Vector5") -> int:
self.items = self.items + [0]
return self.capacity()
# Increases capacity of vector by one element
def increase_capacity2(self:"Vector5") -> int:
self.items = self.items + [0]
return self.capacity()
# Increases capacity of vector by one element
def increase_capacity3(self:"Vector5") -> int:
self.items = self.items + [0]
return self.capacity()
# Increases capacity of vector by one element
def increase_capacity4(self:"Vector5") -> int:
self.items = self.items + [0]
return self.capacity()
# Increases capacity of vector by one element
def increase_capacity5(self:"Vector5") -> int:
self.items = self.items + [0]
return self.capacity()
# Appends one item to end of vector
def append(self:"Vector5", item: int) -> object:
if self.size == self.capacity():
self.increase_capacity()
self.items[self.size] = item
self.size = self.size + 1
# Appends one item to end of vector
def append2(self:"Vector5", item: int, item2: int) -> object:
if self.size == self.capacity():
self.increase_capacity()
self.items[self.size] = item
self.size = self.size + 1
# Appends one item to end of vector
def append3(self:"Vector5", item: int, item2: int, item3: int) -> object:
if self.size == self.capacity():
self.increase_capacity()
self.items[self.size] = item
self.size = self.size + 1
# Appends one item to end of vector
def append4(self:"Vector5", item: int, item2: int, item3: int, item4: int) -> object:
if self.size == self.capacity():
self.increase_capacity()
self.items[self.size] = item
self.size = self.size + 1
# Appends one item to end of vector
def append5(self:"Vector5", item: int, item2: int, item3: int, item4: int, item5: int) -> object:
if self.size == self.capacity():
self.increase_capacity()
self.items[self.size] = item
self.size = self.size + 1
# Appends many items to end of vector
def append_all(self:"Vector5", new_items: [int]) -> object:
item:int = 0
for item in new_items:
self.append(item)
# Appends many items to end of vector
def append_all2(self:"Vector5", new_items: [int], new_items2: [int]) -> object:
item:int = 0
item2:int = 0
for item in new_items:
self.append(item)
# Appends many items to end of vector
def append_all3(self:"Vector5", new_items: [int], new_items2: [int], new_items3: [int]) -> object:
item:int = 0
item2:int = 0
item3:int = 0
for item in new_items:
self.append(item)
# Appends many items to end of vector
def append_all4(self:"Vector5", new_items: [int], new_items2: [int], new_items3: [int], new_items4: [int]) -> object:
item:int = 0
item2:int = 0
item3:int = 0
item4:int = 0
for item in new_items:
self.append(item)
# Appends many items to end of vector
def append_all5(self:"Vector5", new_items: [int], new_items2: [int], new_items3: [int], new_items4: [int], new_items5: [int]) -> object:
item:int = 0
item2:int = 0
item3:int = 0
item4:int = 0
item5:int = 0
for item in new_items:
self.append(item)
# Removes an item from the middle of vector
def remove_at(self:"Vector5", idx: int) -> object:
if idx < 0:
return
while idx < self.size - 1:
self.items[idx] = self.items[idx + 1]
idx = idx + 1
self.size = self.size - 1
# Removes an item from the middle of vector
def remove_at2(self:"Vector5", idx: int, idx2: int) -> object:
if idx < 0:
return
while idx < self.size - 1:
self.items[idx] = self.items[idx + 1]
idx = idx + 1
self.size = self.size - 1
# Removes an item from the middle of vector
def remove_at3(self:"Vector5", idx: int, idx2: int, idx3: int) -> object:
if idx < 0:
return
while idx < self.size - 1:
self.items[idx] = self.items[idx + 1]
idx = idx + 1
self.size = self.size - 1
# Removes an item from the middle of vector
def remove_at4(self:"Vector5", idx: int, idx2: int, idx3: int, idx4: int) -> object:
if idx < 0:
return
while idx < self.size - 1:
self.items[idx] = self.items[idx + 1]
idx = idx + 1
self.size = self.size - 1
# Removes an item from the middle of vector
def remove_at5(self:"Vector5", idx: int, idx2: int, idx3: int, idx4: int, idx5: int) -> object:
if idx < 0:
return
while idx < self.size - 1:
self.items[idx] = self.items[idx + 1]
idx = idx + 1
self.size = self.size - 1
# Retrieves an item at a given index
def get(self:"Vector5", idx: int) -> int:
return self.items[idx]
# Retrieves an item at a given index
def get2(self:"Vector5", idx: int, idx2: int) -> int:
return self.items[idx]
# Retrieves an item at a given index
def get3(self:"Vector5", idx: int, idx2: int, idx3: int) -> int:
return self.items[idx]
# Retrieves an item at a given index
def get4(self:"Vector5", idx: int, idx2: int, idx3: int, idx4: int) -> int:
return self.items[idx]
# Retrieves an item at a given index
def get5(self:"Vector5", idx: int, idx2: int, idx3: int, idx4: int, idx5: int) -> int:
return self.items[idx]
# Retrieves the current size of the vector
def length(self:"Vector5") -> int:
return self.size
# Retrieves the current size of the vector
def length2(self:"Vector5") -> int:
return self.size
# Retrieves the current size of the vector
def length3(self:"Vector5") -> int:
return self.size
# Retrieves the current size of the vector
def length4(self:"Vector5") -> int:
return self.size
# Retrieves the current size of the vector
def length5(self:"Vector5") -> int:
return self.size
# A faster (but more memory-consuming) implementation of vector
class DoublingVector(Vector):
doubling_limit:int = 1000
# Overriding to do fewer resizes
def increase_capacity(self:"DoublingVector") -> int:
if (self.capacity() <= self.doubling_limit // 2):
self.items = self.items + self.items
else:
# If doubling limit has been reached, fall back to
# standard capacity increases
self.items = self.items + [0]
return self.capacity()
# A faster (but more memory-consuming) implementation of vector
class DoublingVector2(Vector):
doubling_limit:int = 1000
doubling_limit2:int = 1000
# Overriding to do fewer resizes
def increase_capacity(self:"DoublingVector2") -> int:
if (self.capacity() <= self.doubling_limit // 2):
self.items = self.items + self.items
else:
# If doubling limit has been reached, fall back to
# standard capacity increases
self.items = self.items + [0]
return self.capacity()
# Overriding to do fewer resizes
def increase_capacity2(self:"DoublingVector2") -> int:
if (self.capacity() <= self.doubling_limit // 2):
self.items = self.items + self.items
else:
# If doubling limit has been reached, fall back to
# standard capacity increases
self.items = self.items + [0]
return self.capacity()
# A faster (but more memory-consuming) implementation of vector
class DoublingVector3(Vector):
doubling_limit:int = 1000
doubling_limit2:int = 1000
doubling_limit3:int = 1000
# Overriding to do fewer resizes
def increase_capacity(self:"DoublingVector3") -> int:
if (self.capacity() <= self.doubling_limit // 2):
self.items = self.items + self.items
else:
# If doubling limit has been reached, fall back to
# standard capacity increases
self.items = self.items + [0]
return self.capacity()
# Overriding to do fewer resizes
def increase_capacity2(self:"DoublingVector3") -> int:
if (self.capacity() <= self.doubling_limit // 2):
self.items = self.items + self.items
else:
# If doubling limit has been reached, fall back to
# standard capacity increases
self.items = self.items + [0]
return self.capacity()
# Overriding to do fewer resizes
def increase_capacity3(self:"DoublingVector3") -> int:
if (self.capacity() <= self.doubling_limit // 2):
self.items = self.items + self.items
else:
# If doubling limit has been reached, fall back to
# standard capacity increases
self.items = self.items + [0]
return self.capacity()
# A faster (but more memory-consuming) implementation of vector
class DoublingVector4(Vector):
doubling_limit:int = 1000
doubling_limit2:int = 1000
doubling_limit3:int = 1000
doubling_limit4:int = 1000
# Overriding to do fewer resizes
def increase_capacity(self:"DoublingVector4") -> int:
if (self.capacity() <= self.doubling_limit // 2):
self.items = self.items + self.items
else:
# If doubling limit has been reached, fall back to
# standard capacity increases
self.items = self.items + [0]
return self.capacity()
# Overriding to do fewer resizes
def increase_capacity2(self:"DoublingVector4") -> int:
if (self.capacity() <= self.doubling_limit // 2):
self.items = self.items + self.items
else:
# If doubling limit has been reached, fall back to
# standard capacity increases
self.items = self.items + [0]
return self.capacity()
# Overriding to do fewer resizes
def increase_capacity3(self:"DoublingVector4") -> int:
if (self.capacity() <= self.doubling_limit // 2):
self.items = self.items + self.items
else:
# If doubling limit has been reached, fall back to
# standard capacity increases
self.items = self.items + [0]
return self.capacity()
# Overriding to do fewer resizes
def increase_capacity4(self:"DoublingVector4") -> int:
if (self.capacity() <= self.doubling_limit // 2):
self.items = self.items + self.items
else:
# If doubling limit has been reached, fall back to
# standard capacity increases
self.items = self.items + [0]
return self.capacity()
# A faster (but more memory-consuming) implementation of vector
class DoublingVector5(Vector):
doubling_limit:int = 1000
doubling_limit2:int = 1000
doubling_limit3:int = 1000
doubling_limit4:int = 1000
doubling_limit5:int = 1000
# Overriding to do fewer resizes
def increase_capacity(self:"DoublingVector5") -> int:
if (self.capacity() <= self.doubling_limit // 2):
self.items = self.items + self.items
else:
# If doubling limit has been reached, fall back to
# standard capacity increases
self.items = self.items + [0]
return self.capacity()
# Overriding to do fewer resizes
def increase_capacity2(self:"DoublingVector5") -> int:
if (self.capacity() <= self.doubling_limit // 2):
self.items = self.items + self.items
else:
# If doubling limit has been reached, fall back to
# standard capacity increases
self.items = self.items + [0]
return self.capacity()
# Overriding to do fewer resizes
def increase_capacity3(self:"DoublingVector5") -> int:
if (self.capacity() <= self.doubling_limit // 2):
self.items = self.items + self.items
else:
# If doubling limit has been reached, fall back to
# standard capacity increases
self.items = self.items + [0]
return self.capacity()
# Overriding to do fewer resizes
def increase_capacity4(self:"DoublingVector5") -> int:
if (self.capacity() <= self.doubling_limit // 2):
self.items = self.items + self.items
else:
# If doubling limit has been reached, fall back to
# standard capacity increases
self.items = self.items + [0]
return self.capacity()
# Overriding to do fewer resizes
def increase_capacity5(self:"DoublingVector5") -> int:
if (self.capacity() <= self.doubling_limit // 2):
self.items = self.items + self.items
else:
# If doubling limit has been reached, fall back to
# standard capacity increases
self.items = self.items + [0]
return self.capacity()
# Makes a vector in the range [i, j)
def vrange(i:int, j:int) -> Vector:
v:Vector = None
v = DoublingVector()
while i < j:
v.append(i)
i = i + 1
return v
def vrange2(i:int, j:int, i2:int, j2:int) -> Vector:
v:Vector = None
v2:Vector = None
v = DoublingVector()
while i < j:
v.append(i)
i = i + 1
return v
def vrange3(i:int, j:int, i2:int, j2:int, i3:int, j3:int) -> Vector:
v:Vector = None
v2:Vector = None
v3:Vector = None
v = DoublingVector()
while i < j:
v.append(i)
i = i + 1
return v
def vrange4(i:int, j:int, i2:int, j2:int, i3:int, j3:int, i4:int, j4:int) -> Vector:
v:Vector = None
v2:Vector = None
v3:Vector = None
v4:Vector = None
v = DoublingVector()
while i < j:
v.append(i)
i = i + 1
return v
def vrange5(i:int, j:int, i2:int, j2:int, i3:int, j3:int, i4:int, j4:int, i5:int, j5:int) -> Vector:
v:Vector = None
v2:Vector = None
v3:Vector = None
v4:Vector = None
v5:Vector = None
v = DoublingVector()
while i < j:
v.append(i)
i = i + 1
return v
# Sieve of Eratosthenes (not really)
def sieve(v:Vector) -> object:
i:int = 0
j:int = 0
k:int = 0
while i < v.length():
k = v.get(i)
j = i + 1
while j < v.length():
if v.get(j) % k == 0:
v.remove_at(j)
else:
j = j + 1
i = i + 1
def sieve2(v:Vector, v2:Vector) -> object:
i:int = 0
i2:int = 0
j:int = 0
j2:int = 0
k:int = 0
k2:int = 0
while i < v.length():
k = v.get(i)
j = i + 1
while j < v.length():
if v.get(j) % k == 0:
v.remove_at(j)
else:
j = j + 1
i = i + 1
def sieve3(v:Vector, v2:Vector, v3:Vector) -> object:
i:int = 0
i2:int = 0
i3:int = 0
j:int = 0
j2:int = 0
j3:int = 0
k:int = 0
k2:int = 0
k3:int = 0
while i < v.length():
k = v.get(i)
j = i + 1
while j < v.length():
if v.get(j) % k == 0:
v.remove_at(j)
else:
j = j + 1
i = i + 1
def sieve4(v:Vector, v2:Vector, v3:Vector, v4:Vector) -> object:
i:int = 0
i2:int = 0
i3:int = 0
i4:int = 0
j:int = 0
j2:int = 0
j3:int = 0
j4:int = 0
k:int = 0
k2:int = 0
k3:int = 0
k4:int = 0
while i < v.length():
k = v.get(i)
j = i + 1
while j < v.length():
if v.get(j) % k == 0:
v.remove_at(j)
else:
j = j + 1
i = i + 1
def sieve5(v:Vector, v2:Vector, v3:Vector, v4:Vector, v5:Vector) -> object:
i:int = 0
i2:int = 0
i3:int = 0
i4:int = 0
i5:int = 0
j:int = 0
j2:int = 0
j3:int = 0
j4:int = 0
j5:int = 0
k:int = 0
k2:int = 0
k3:int = 0
k4:int = 0
k5:int = 0
while i < v.length():
k = v.get(i)
j = i + 1
while j < v.length():
if v.get(j) % k == 0:
v.remove_at(j)
else:
j = j + 1
i = i + 1
# Input parameter
n:int = 50
n2:int = 50
n3:int = 50
n4:int = 50
n5:int = 50
# Data
v:Vector = None
v2:Vector = None
v3:Vector = None
v4:Vector = None
v5:Vector = None
i:int = 0
i2:int = 0
i3:int = 0
i4:int = 0
i5:int = 0
# Crunch
v = vrange(2, n)
v2 = vrange(2, n)
v3 = vrange(2, n)
v4 = vrange(2, n)
v5 = vrange(2, n)
sieve(v)
# Print
while i < v.length():
print(v.get(i))
i = i + 1
| [
"[email protected]"
] | |
4bc43308877b9e7be2dfda43ed082c330f7aad38 | 16e69196886254bc0fe9d8dc919ebcfa844f326a | /edc/dashboard/search/tests/__init__.py | 18d1d4cedf76dc10af1643019f786e7ccc20952b | [] | no_license | botswana-harvard/edc | b54edc305e7f4f6b193b4498c59080a902a6aeee | 4f75336ff572babd39d431185677a65bece9e524 | refs/heads/master | 2021-01-23T19:15:08.070350 | 2015-12-07T09:36:41 | 2015-12-07T09:36:41 | 35,820,838 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 53 | py | from .search_methods_tests import SearchMethodsTests
| [
"[email protected]"
] | |
f69e4d4f4288a29c8508e0ac794a2eaa0995a2b8 | 353def93fa77384ee3a5e3de98cfed318c480634 | /.history/week02/1/proxy/proxy/spiders/maoyan_20200705155728.py | f4c680398e9df42ea33eb12d51a8bd6097744c5a | [] | no_license | ydbB/Python001-class01 | d680abc3ea1ccaeb610751e3488421417d381156 | ad80037ccfc68d39125fa94d2747ab7394ac1be8 | refs/heads/master | 2022-11-25T11:27:45.077139 | 2020-07-19T12:35:12 | 2020-07-19T12:35:12 | 272,783,233 | 0 | 0 | null | 2020-06-16T18:28:15 | 2020-06-16T18:28:15 | null | UTF-8 | Python | false | false | 2,559 | py | import scrapy
from proxy.items import ProxyItem
import lxml.etree
class MaoyanSpider(scrapy.Spider):
name = 'maoyan'
allowed_domains = ['maoyan.com']
start_urls = ['http://maoyan.com/']
header = {
'Content-Type': 'text/plain; charset=UTF-8',
'Cookie' : '__mta=251934006.1593072991075.1593315374931.1593349407197.45; uuid_n_v=v1; uuid=2395D3F0B6BC11EA9F28E30FF5FFF73C9A16AE2FA53A448DA75AEAA9D715CB59; _csrf=8557626db9b655cf9050ae7e5b2aab69278c8061c21eca95e1c3cf2130b0b64c; _lxsdk_cuid=172ea8cb247c8-0a73066b1c0a8b-4353760-100200-172ea8cb248c8; _lxsdk=2395D3F0B6BC11EA9F28E30FF5FFF73C9A16AE2FA53A448DA75AEAA9D715CB59; mojo-uuid=c457eacb7c1eb59d3d2f6c1f8d75b9c9; Hm_lvt_703e94591e87be68cc8da0da7cbd0be2=1593072989,1593073002; _lx_utm=utm_source%3Dgoogle%26utm_medium%3Dorganic; __mta=251934006.1593072991075.1593140975947.1593145813576.21; mojo-session-id={"id":"afe2ef89c10d6e1c8fc94e26d831b20e","time":1593349078441}; mojo-trace-id=4; Hm_lpvt_703e94591e87be68cc8da0da7cbd0be2=1593349407; _lxsdk_s=172fb017d51-4c4-303-783%7C%7C8',
# 'Host' : 'http://www.baidu.com',
'Origin': 'https://maoyan.com',
'Referer': 'https://maoyan.com/board/4',
'User-Agent': 'Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/83.0.4103.116 Safari/537.36',
}
# def parse(self, response):
# pass
def start_requests(self):
url = f'https://maoyan.com/board/4'
yield scrapy.Request(url=url,headers=self.header,callback=self.parse)
def parse(self, response):
selector = lxml.etree.HTML(response.text)
item =ProxyItem()
for i in range(0,10):
link = selector.xpath('//*[@id="app"]/div/div/div[1]/dl/dd['+i'+']/div/div/div[1]/p[1]/a').get('href')
name = selector.xpath('//*[@id="app"]/div/div/div[1]/dl/dd['i]/div/div/div[1]/p[1]/a').get('title')
time = selector.xpath('//*[@id="app"]/div/div/div[1]/dl/dd[i]/div/div/div[1]/p[3]').text
item['films_name'] = name
item['release_time'] = time
print(link)
yield scrapy.Request(url=link, headers = self.header, meta={'item':item},callback=self.parse1)
def parse1(self, response):
item = response.meta['item']
selector = lxml.etree.HTML(response.text)
type = selector.xpath('/html/body/div[3]/div/div[2]/div[1]/ul/li[1]').text.replace('\n',' ')
print(type)
item['films_type'] = type
print(item)
yield item
| [
"[email protected]"
] | |
fe29ddbba5045df30a1934eb9bcd7574cdc67eb7 | 71c9bf59320d5a67d1395c02ee7d68805f820db7 | /solutions/A_h_djikshtra's_algorithm.py | 28868dd91a4a652195450a6db4e23dc99f6283b9 | [] | no_license | AnjalBam/iw-assignment-python-iii | 34609eef05f4b57a3cc17166603c121c1635b2a9 | c1a05c1a0091de3b718fcb476bbc906817492294 | refs/heads/master | 2022-11-13T20:23:39.642580 | 2020-07-13T09:45:00 | 2020-07-13T09:45:00 | 279,208,648 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 3,349 | py | """
A. Make pythonic solutions for each of the following data structure
and algorithm problems.
e) Dijkshtra's Algorithm
"""
from collections import deque, namedtuple
# we'll use infinity as a default distance to nodes.
inf = float('inf')
Edge = namedtuple('Edge', 'start, end, cost')
def make_edge(start, end, cost=1):
return Edge(start, end, cost)
class Graph:
def __init__(self, edges):
# check if the data is right
wrong_edges = [i for i in edges if len(i) not in [2, 3]]
if wrong_edges:
raise ValueError('Wrong edges data: {}'.format(wrong_edges))
self.edges = [make_edge(*edge) for edge in edges]
@property
def vertices(self):
return set(
sum(
([edge.start, edge.end] for edge in self.edges), []
)
)
def get_node_pairs(self, n1, n2, both_ends=True):
if both_ends:
node_pairs = [[n1, n2], [n2, n1]]
else:
node_pairs = [[n1, n2]]
return node_pairs
def remove_edge(self, n1, n2, both_ends=True):
node_pairs = self.get_node_pairs(n1, n2, both_ends)
edges = self.edges[:]
for edge in edges:
if [edge.start, edge.end] in node_pairs:
self.edges.remove(edge)
def add_edge(self, n1, n2, cost=1, both_ends=True):
node_pairs = self.get_node_pairs(n1, n2, both_ends)
for edge in self.edges:
if [edge.start, edge.end] in node_pairs:
return ValueError('Edge {} {} already exists'.format(n1, n2))
self.edges.append(Edge(start=n1, end=n2, cost=cost))
if both_ends:
self.edges.append(Edge(start=n2, end=n1, cost=cost))
@property
def neighbours(self):
neighbours = {vertex: set() for vertex in self.vertices}
for edge in self.edges:
neighbours[edge.start].add((edge.end, edge.cost))
return neighbours
def dijkstra(self, source, dest):
assert source in self.vertices, 'Such source node doesn\'t exist'
distances = {vertex: inf for vertex in self.vertices}
previous_vertices = {
vertex: None for vertex in self.vertices
}
distances[source] = 0
vertices = self.vertices.copy()
while vertices:
current_vertex = min(
vertices, key=lambda vertex: distances[vertex])
vertices.remove(current_vertex)
if distances[current_vertex] == inf:
break
for neighbour, cost in self.neighbours[current_vertex]:
alternative_route = distances[current_vertex] + cost
if alternative_route < distances[neighbour]:
distances[neighbour] = alternative_route
previous_vertices[neighbour] = current_vertex
path, current_vertex = deque(), dest
while previous_vertices[current_vertex] is not None:
path.appendleft(current_vertex)
current_vertex = previous_vertices[current_vertex]
if path:
path.appendleft(current_vertex)
return path
graph = Graph([
("a", "b", 7), ("a", "c", 9), ("a", "f", 14), ("b", "c", 10),
("b", "d", 15), ("c", "d", 11), ("c", "f", 2), ("d", "e", 6),
("e", "f", 9)])
print(graph.dijkstra("a", "e"))
| [
"[email protected]"
] | |
9299880d2374060c24d9a6fd117a920d11784c44 | ea2cf796332879d86561f80882da93b672966448 | /configs/rotated_retinanet/ssdd/rotated_retinanet_hbb_r50_adamw_fpn_6x_ssdd_oc.py | 6b6e85da78c1deeca585141b1fa61f5de0d0f2e7 | [
"Apache-2.0"
] | permissive | yangxue0827/h2rbox-mmrotate | 968c34adf22eca073ab147b670226884ea80ac61 | cfd7f1fef6ae4d4e17cb891d1ec144ece8b5d7f5 | refs/heads/main | 2023-05-23T10:02:58.344148 | 2023-02-14T05:28:38 | 2023-02-14T05:28:38 | 501,580,810 | 68 | 8 | null | null | null | null | UTF-8 | Python | false | false | 394 | py | _base_ = ['./rotated_retinanet_hbb_r50_fpn_6x_ssdd_oc.py']
optimizer = dict(
_delete_=True,
type='AdamW',
lr=0.0001,
betas=(0.9, 0.999),
weight_decay=0.05,
paramwise_cfg=dict(
custom_keys={
'absolute_pos_embed': dict(decay_mult=0.),
'relative_position_bias_table': dict(decay_mult=0.),
'norm': dict(decay_mult=0.)
})) | [
"[email protected]"
] | |
bfa0210d76e2501a11b68119104d1f8ddab47ced | e76ea38dbe5774fccaf14e1a0090d9275cdaee08 | /src/xwalk/tools/build/win/FILES.cfg | 446675943eaebc95282133c60583a38067c11deb | [
"BSD-3-Clause"
] | permissive | eurogiciel-oss/Tizen_Crosswalk | efc424807a5434df1d5c9e8ed51364974643707d | a68aed6e29bd157c95564e7af2e3a26191813e51 | refs/heads/master | 2021-01-18T19:19:04.527505 | 2014-02-06T13:43:21 | 2014-02-06T13:43:21 | 16,070,101 | 1 | 3 | null | null | null | null | UTF-8 | Python | false | false | 3,094 | cfg | # -*- python -*-
# ex: set syntax=python:
# Copyright (c) 2012 The Chromium Authors. All rights reserved.
# Use of this source code is governed by a BSD-style license that can be
# found in the LICENSE file.
# This is a buildbot configuration file containing a tagged list of files
# processed by the stage/archive scripts. The known tags are:
#
# filename: Name of the file in the build output directory.
# arch: List of CPU architectures for which this file should be processed
# Leave this unspecified to prcoess for all architectures.
# Acceptable values are 64bit, 32bit and arm.
# buildtype: List of build types for which this file should be processed.
# archive: The name of the archive file to store filename in. If not specified,
# filename is added to the default archive (e.g. platform.zip). If
# archive == filename, filename is archived directly, not zipped.
# direct_archive: Force a file to be archived as-is, bypassing zip creation.
# NOTE: This flag will not apply if more than one file has the
# same 'archive' name, which will create a zip of all the
# files instead.
# filegroup: List of named groups to which this file belongs.
# default: Legacy "default archive". TODO(mmoss): These should
# be updated to specify an 'archive' name and then this
# filegroup and the related archive_utils.ParseLegacyList()
# should go away.
# symsrc: Files to upload to the symbol server.
# optional: List of buildtypes for which the file might not exist, and it's not
# considered an error.
FILES = [
{
'filename': 'xwalk.exe',
'buildtype': ['dev', 'official'],
},
{
'filename': 'xwalk.pak',
'buildtype': ['dev', 'official'],
},
{
'filename': 'ffmpegsumo.dll',
'buildtype': ['dev'],
},
{
'filename': 'icudt.dll',
'buildtype': ['dev', 'official'],
},
{
'filename': 'D3DCompiler_46.dll',
'buildtype': ['dev'],
},
{
'filename': 'libEGL.dll',
'buildtype': ['dev', 'official'],
},
{
'filename': 'libGLESv2.dll',
'buildtype': ['dev', 'official'],
},
# installer creation scripts
{
'filename': 'create_windows_installer.bat',
'buildtype': ['dev', 'official'],
},
{
'filename': 'app.wxs.templ',
'buildtype': ['dev', 'official'],
},
{
'filename': 'guid.vbs',
'buildtype': ['dev', 'official'],
},
# syms files
{
'filename': 'xwalk.exe.pdb',
'buildtype': ['dev', 'official'],
'archive': 'xwalk-win32-syms.zip',
},
{
'filename': 'ffmpegsumo.dll.pdb',
'buildtype': ['dev'],
'archive': 'xwalk-win32-syms.zip',
},
{
'filename': 'libEGL.dll.pdb',
'buildtype': ['dev', 'official'],
'archive': 'xwalk-win32-syms.zip',
},
{
'filename': 'libGLESv2.dll.pdb',
'buildtype': ['dev', 'official'],
'archive': 'xwalk-win32-syms.zip',
},
# XPK package generator
{
'filename': 'tools/make_xpk.py',
'buildtype': ['dev', 'official'],
},
]
| [
"[email protected]"
] | |
7ff073702298c100dd9cd88ef17679ad6ee1850e | 412b699e0f497ac03d6618fe349f4469646c6f2d | /env/lib/python3.8/site-packages/Crypto/Util/Padding.py | da69e55987227357a55f8e1b57fae5f7eb8cac74 | [
"MIT"
] | permissive | EtienneBrJ/Portfolio | 7c70573f02a5779f9070d6d9df58d460828176e3 | 6b8d8cf9622eadef47bd10690c1bf1e7fd892bfd | refs/heads/main | 2023-09-03T15:03:43.698518 | 2021-11-04T01:02:33 | 2021-11-04T01:02:33 | 411,076,325 | 1 | 0 | MIT | 2021-10-31T13:43:09 | 2021-09-27T23:48:59 | HTML | UTF-8 | Python | false | false | 4,313 | py | #
# Util/Padding.py : Functions to manage padding
#
# ===================================================================
#
# Copyright (c) 2014, Legrandin <[email protected]>
# All rights reserved.
#
# Redistribution and use in source and binary forms, with or without
# modification, are permitted provided that the following conditions
# are met:
#
# 1. Redistributions of source code must retain the above copyright
# notice, this list of conditions and the following disclaimer.
# 2. Redistributions in binary form must reproduce the above copyright
# notice, this list of conditions and the following disclaimer in
# the documentation and/or other materials provided with the
# distribution.
#
# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS
# FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
# COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT,
# INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING,
# BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
# LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
# CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT
# LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN
# ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
# POSSIBILITY OF SUCH DAMAGE.
# ===================================================================
__all__ = [ 'pad', 'unpad' ]
from Crypto.Util.py3compat import *
def pad(data_to_pad, block_size, style='pkcs7'):
"""Apply standard padding.
Args:
data_to_pad (byte string):
The data that needs to be padded.
block_size (integer):
The block boundary to use for padding. The output length is guaranteed
to be a multiple of :data:`block_size`.
style (string):
Padding algorithm. It can be *'pkcs7'* (default), *'iso7816'* or *'x923'*.
Return:
byte string : the original data with the appropriate padding added at the end.
"""
padding_len = block_size-len(data_to_pad)%block_size
if style == 'pkcs7':
padding = bchr(padding_len)*padding_len
elif style == 'x923':
padding = bchr(0)*(padding_len-1) + bchr(padding_len)
elif style == 'iso7816':
padding = bchr(128) + bchr(0)*(padding_len-1)
else:
raise ValueError("Unknown padding style")
return data_to_pad + padding
def unpad(padded_data, block_size, style='pkcs7'):
"""Remove standard padding.
Args:
padded_data (byte string):
A piece of data with padding that needs to be stripped.
block_size (integer):
The block boundary to use for padding. The input length
must be a multiple of :data:`block_size`.
style (string):
Padding algorithm. It can be *'pkcs7'* (default), *'iso7816'* or *'x923'*.
Return:
byte string : data without padding.
Raises:
ValueError: if the padding is incorrect.
"""
pdata_len = len(padded_data)
if pdata_len == 0:
raise ValueError("Zero-length input cannot be unpadded")
if pdata_len % block_size:
raise ValueError("Input data is not padded")
if style in ('pkcs7', 'x923'):
padding_len = bord(padded_data[-1])
if padding_len<1 or padding_len>min(block_size, pdata_len):
raise ValueError("Padding is incorrect.")
if style == 'pkcs7':
if padded_data[-padding_len:]!=bchr(padding_len)*padding_len:
raise ValueError("PKCS#7 padding is incorrect.")
else:
if padded_data[-padding_len:-1]!=bchr(0)*(padding_len-1):
raise ValueError("ANSI X.923 padding is incorrect.")
elif style == 'iso7816':
padding_len = pdata_len - padded_data.rfind(bchr(128))
if padding_len<1 or padding_len>min(block_size, pdata_len):
raise ValueError("Padding is incorrect.")
if padding_len>1 and padded_data[1-padding_len:]!=bchr(0)*(padding_len-1):
raise ValueError("ISO 7816-4 padding is incorrect.")
else:
raise ValueError("Unknown padding style")
return padded_data[:-padding_len]
| [
"[email protected]"
] | |
fd7b4afd97e2ab6d8426692b6eb6f7be4be4d1e6 | 6b1fd67270b150ec3a4983945f6374c532e0c3b5 | /pymesh/examples/md5/main.py | 6ab99a96b6f2a2fccd3c3a7466c0a19d02bdf929 | [
"BSD-2-Clause-Views",
"BSD-2-Clause"
] | permissive | adamlwgriffiths/PyMesh | 8078e2ff4cc93e9def368b4fbbbf52b9f8b3292e | dbed5c7a226b820fc3adb33e30f750ab1ffbd892 | refs/heads/master | 2016-09-05T09:42:43.068368 | 2013-02-03T14:52:11 | 2013-02-03T14:52:11 | 5,817,565 | 5 | 1 | null | null | null | null | UTF-8 | Python | false | false | 3,099 | py | import os
from pymesh.md5 import MD5_Mesh, MD5_Anim
def load_mesh( filename ):
print 'Loading', filename
md5 = MD5_Mesh()
md5.load( filename )
# print the data out for verification
print 'version', md5.md5_version
print 'num_joints', md5.num_joints
print 'num_meshes', md5.num_meshes
print 'joints'
for joint in md5.joints:
print '\tname', joint.name
print '\tparent', joint.parent
print '\tposition', joint.position
print '\torientation', joint.orientation
print 'meshes'
for mesh in md5.meshes:
print '\tshader', mesh.shader
print '\tnumverts', mesh.num_verts
for vert in mesh.vertices:
print '\t\ttcs', vert.tcs
print '\t\tstart_weight', vert.start_weight
print '\t\tweight_count', vert.weight_count
print '\tnumtris', mesh.num_tris
for tri in mesh.tris:
print '\t\ttri', tri
print '\tnumweights', mesh.num_weights
for weight in mesh.weights:
print '\t\tjoint', weight.joint
print '\t\tbias', weight.bias
print '\t\tposition', weight.position
def load_anim( filename ):
print 'Loading', filename
md5 = MD5_Anim()
md5.load( filename )
print 'version', md5.md5_version
print 'frame_rate', md5.frame_rate
print 'hierarchy'
print 'num_joints', md5.hierarchy.num_joints
for joint in md5.hierarchy:
print '\tname', joint.name
print '\tparent', joint.parent
print '\tnum_components', joint.num_components
print '\tframe', joint.frame
print 'bounds'
print 'num_bounds', md5.bounds.num_bounds
for bounds in md5.bounds:
print '\tminimum', bounds[ 0 ]
print '\tmaximum', bounds[ 1 ]
print 'base frame'
print 'num_bones', md5.base_frame.num_bones
for bone in md5.base_frame:
print '\tposition', bone.position
print '\torientation', bone.orientation
print 'frames'
print 'num_frames', md5.num_frames
for frame in md5.frames:
print '\tjoints'
print '\tnum_joints', frame.num_joints
for joint in frame:
print '\t\tposition', joint.position
print '\t\torientation', joint.orientation
def main():
# load all md5 files in our data directory
# get the path relative to our examples file
path = os.path.join(
os.path.dirname( __file__ ),
'../data/md5'
)
# get the directory contents
contents = os.listdir(path)
# iterate through the contents and load
# each file that is a .md5mesh or .md5anim file
for filename in contents:
name, extension = os.path.splitext( filename )
# reattach our current directory
path = os.path.join(
os.path.dirname( __file__ ),
'../data/md5',
filename
)
if extension.lower() == '.md5mesh':
load_mesh( path )
if extension.lower() == '.md5anim':
load_anim( path )
if __name__ == '__main__':
main()
| [
"[email protected]"
] | |
1e121291a3990554553ee44c813bbf62b7e065e9 | 8cdbd5986a40eeb0a14099acb0674cfd4ebe5524 | /venv/lib/python2.7/site-packages/textblob/blob.py | d4e53698d0d188b176c256aa2b025a1223ecabb9 | [
"MIT"
] | permissive | saiflakhani/twitter-stock-recommendation | 23a24d330ab15dc1d2c960836e4b68d0f5e66c0d | 50e7177375560895b31371593d03e88b07d24afd | refs/heads/master | 2023-04-22T02:45:53.739377 | 2021-05-05T14:36:25 | 2021-05-05T14:36:25 | 362,073,163 | 0 | 0 | MIT | 2021-04-27T10:33:02 | 2021-04-27T10:33:01 | null | UTF-8 | Python | false | false | 29,309 | py | # -*- coding: utf-8 -*-
"""Wrappers for various units of text, including the main
:class:`TextBlob <textblob.blob.TextBlob>`, :class:`Word <textblob.blob.Word>`,
and :class:`WordList <textblob.blob.WordList>` classes.
Example usage: ::
>>> from textblob import TextBlob
>>> b = TextBlob("Simple is better than complex.")
>>> b.tags
[(u'Simple', u'NN'), (u'is', u'VBZ'), (u'better', u'JJR'), (u'than', u'IN'), (u'complex', u'NN')]
>>> b.noun_phrases
WordList([u'simple'])
>>> b.words
WordList([u'Simple', u'is', u'better', u'than', u'complex'])
>>> b.sentiment
(0.06666666666666667, 0.41904761904761906)
>>> b.words[0].synsets()[0]
Synset('simple.n.01')
.. versionchanged:: 0.8.0
These classes are now imported from ``textblob`` rather than ``text.blob``.
"""
from __future__ import unicode_literals, absolute_import
import sys
import json
from collections import defaultdict
import nltk
from textblob.decorators import cached_property, requires_nltk_corpus
from textblob.utils import lowerstrip, PUNCTUATION_REGEX
from textblob.inflect import singularize as _singularize, pluralize as _pluralize
from textblob.mixins import BlobComparableMixin, StringlikeMixin
from textblob.compat import unicode, basestring
from textblob.base import (BaseNPExtractor, BaseTagger, BaseTokenizer,
BaseSentimentAnalyzer, BaseParser)
from textblob.np_extractors import FastNPExtractor
from textblob.taggers import NLTKTagger
from textblob.tokenizers import WordTokenizer, sent_tokenize, word_tokenize
from textblob.sentiments import PatternAnalyzer
from textblob.parsers import PatternParser
from textblob.translate import Translator
from textblob.en import suggest
# Wordnet interface
# NOTE: textblob.wordnet is not imported so that the wordnet corpus can be lazy-loaded
_wordnet = nltk.corpus.wordnet
def _penn_to_wordnet(tag):
"""Converts a Penn corpus tag into a Wordnet tag."""
if tag in ("NN", "NNS", "NNP", "NNPS"):
return _wordnet.NOUN
if tag in ("JJ", "JJR", "JJS"):
return _wordnet.ADJ
if tag in ("VB", "VBD", "VBG", "VBN", "VBP", "VBZ"):
return _wordnet.VERB
if tag in ("RB", "RBR", "RBS"):
return _wordnet.ADV
return None
class Word(unicode):
"""A simple word representation. Includes methods for inflection,
translation, and WordNet integration.
"""
translator = Translator()
def __new__(cls, string, pos_tag=None):
"""Return a new instance of the class. It is necessary to override
this method in order to handle the extra pos_tag argument in the
constructor.
"""
return super(Word, cls).__new__(cls, string)
def __init__(self, string, pos_tag=None):
self.string = string
self.pos_tag = pos_tag
def __repr__(self):
return repr(self.string)
def __str__(self):
return self.string
def singularize(self):
"""Return the singular version of the word as a string."""
return Word(_singularize(self.string))
def pluralize(self):
'''Return the plural version of the word as a string.'''
return Word(_pluralize(self.string))
def translate(self, from_lang='auto', to="en"):
'''Translate the word to another language using Google's
Translate API.
.. versionadded:: 0.5.0
'''
return self.translator.translate(self.string,
from_lang=from_lang, to_lang=to)
def detect_language(self):
'''Detect the word's language using Google's Translate API.
.. versionadded:: 0.5.0
'''
return self.translator.detect(self.string)
def spellcheck(self):
'''Return a list of (word, confidence) tuples of spelling corrections.
Based on: Peter Norvig, "How to Write a Spelling Corrector"
(http://norvig.com/spell-correct.html) as implemented in the pattern
library.
.. versionadded:: 0.6.0
'''
return suggest(self.string)
def correct(self):
'''Correct the spelling of the word. Returns the word with the highest
confidence using the spelling corrector.
.. versionadded:: 0.6.0
'''
return Word(self.spellcheck()[0][0])
@cached_property
@requires_nltk_corpus
def lemma(self):
"""Return the lemma of this word using Wordnet's morphy function.
"""
return self.lemmatize(pos=self.pos_tag)
@requires_nltk_corpus
def lemmatize(self, pos=None):
"""Return the lemma for a word using WordNet's morphy function.
:param pos: Part of speech to filter upon. If `None`, defaults to
``_wordnet.NOUN``.
.. versionadded:: 0.8.1
"""
if pos is None:
tag = _wordnet.NOUN
elif pos in _wordnet._FILEMAP.keys():
tag = pos
else:
tag = _penn_to_wordnet(pos)
lemmatizer = nltk.stem.WordNetLemmatizer()
return lemmatizer.lemmatize(self.string, tag)
PorterStemmer = nltk.stem.porter.PorterStemmer()
LancasterStemmer = nltk.stem.lancaster.LancasterStemmer()
SnowballStemmer = nltk.stem.snowball.SnowballStemmer("english")
#added 'stemmer' on lines of lemmatizer
#based on nltk
def stem(self, stemmer=PorterStemmer):
"""Stem a word using various NLTK stemmers. (Default: Porter Stemmer)
.. versionadded:: 0.12.0
"""
return stemmer.stem(self.string)
@cached_property
def synsets(self):
"""The list of Synset objects for this Word.
:rtype: list of Synsets
.. versionadded:: 0.7.0
"""
return self.get_synsets(pos=None)
@cached_property
def definitions(self):
"""The list of definitions for this word. Each definition corresponds
to a synset.
.. versionadded:: 0.7.0
"""
return self.define(pos=None)
def get_synsets(self, pos=None):
"""Return a list of Synset objects for this word.
:param pos: A part-of-speech tag to filter upon. If ``None``, all
synsets for all parts of speech will be loaded.
:rtype: list of Synsets
.. versionadded:: 0.7.0
"""
return _wordnet.synsets(self.string, pos)
def define(self, pos=None):
"""Return a list of definitions for this word. Each definition
corresponds to a synset for this word.
:param pos: A part-of-speech tag to filter upon. If ``None``, definitions
for all parts of speech will be loaded.
:rtype: List of strings
.. versionadded:: 0.7.0
"""
return [syn.definition() for syn in self.get_synsets(pos=pos)]
class WordList(list):
"""A list-like collection of words."""
def __init__(self, collection):
"""Initialize a WordList. Takes a collection of strings as
its only argument.
"""
self._collection = [Word(w) for w in collection]
super(WordList, self).__init__(self._collection)
def __str__(self):
return str(self._collection)
def __repr__(self):
"""Returns a string representation for debugging."""
class_name = self.__class__.__name__
return '{cls}({lst})'.format(cls=class_name, lst=repr(self._collection))
def __getitem__(self, key):
"""Returns a string at the given index."""
if isinstance(key, slice):
return self.__class__(self._collection[key])
else:
return self._collection[key]
def __getslice__(self, i, j):
# This is included for Python 2.* compatibility
return self.__class__(self._collection[i:j])
def __iter__(self):
return iter(self._collection)
def count(self, strg, case_sensitive=False, *args, **kwargs):
"""Get the count of a word or phrase `s` within this WordList.
:param strg: The string to count.
:param case_sensitive: A boolean, whether or not the search is case-sensitive.
"""
if not case_sensitive:
return [word.lower() for word in self].count(strg.lower(), *args,
**kwargs)
return self._collection.count(strg, *args, **kwargs)
def append(self, obj):
"""Append an object to end. If the object is a string, appends a
:class:`Word <Word>` object.
"""
if isinstance(obj, basestring):
return self._collection.append(Word(obj))
else:
return self._collection.append(obj)
def extend(self, iterable):
"""Extend WordList by appending elements from ``iterable``. If an element
is a string, appends a :class:`Word <Word>` object.
"""
[self._collection.append(Word(e) if isinstance(e, basestring) else e)
for e in iterable]
return self
def upper(self):
"""Return a new WordList with each word upper-cased."""
return self.__class__([word.upper() for word in self])
def lower(self):
"""Return a new WordList with each word lower-cased."""
return self.__class__([word.lower() for word in self])
def singularize(self):
"""Return the single version of each word in this WordList."""
return self.__class__([word.singularize() for word in self])
def pluralize(self):
"""Return the plural version of each word in this WordList."""
return self.__class__([word.pluralize() for word in self])
def lemmatize(self):
"""Return the lemma of each word in this WordList."""
return self.__class__([word.lemmatize() for word in self])
def stem(self, *args, **kwargs):
"""Return the stem for each word in this WordList."""
return self.__class__([word.stem(*args, **kwargs) for word in self])
def _validated_param(obj, name, base_class, default, base_class_name=None):
"""Validates a parameter passed to __init__. Makes sure that obj is
the correct class. Return obj if it's not None or falls back to default
:param obj: The object passed in.
:param name: The name of the parameter.
:param base_class: The class that obj must inherit from.
:param default: The default object to fall back upon if obj is None.
"""
base_class_name = base_class_name if base_class_name else base_class.__name__
if obj is not None and not isinstance(obj, base_class):
raise ValueError('{name} must be an instance of {cls}'
.format(name=name, cls=base_class_name))
return obj or default
def _initialize_models(obj, tokenizer, pos_tagger,
np_extractor, analyzer, parser, classifier):
"""Common initialization between BaseBlob and Blobber classes."""
# tokenizer may be a textblob or an NLTK tokenizer
obj.tokenizer = _validated_param(tokenizer, "tokenizer",
base_class=(BaseTokenizer, nltk.tokenize.api.TokenizerI),
default=BaseBlob.tokenizer,
base_class_name="BaseTokenizer")
obj.np_extractor = _validated_param(np_extractor, "np_extractor",
base_class=BaseNPExtractor,
default=BaseBlob.np_extractor)
obj.pos_tagger = _validated_param(pos_tagger, "pos_tagger",
BaseTagger, BaseBlob.pos_tagger)
obj.analyzer = _validated_param(analyzer, "analyzer",
BaseSentimentAnalyzer, BaseBlob.analyzer)
obj.parser = _validated_param(parser, "parser", BaseParser, BaseBlob.parser)
obj.classifier = classifier
class BaseBlob(StringlikeMixin, BlobComparableMixin):
"""An abstract base class that all textblob classes will inherit from.
Includes words, POS tag, NP, and word count properties. Also includes
basic dunder and string methods for making objects like Python strings.
:param text: A string.
:param tokenizer: (optional) A tokenizer instance. If ``None``,
defaults to :class:`WordTokenizer() <textblob.tokenizers.WordTokenizer>`.
:param np_extractor: (optional) An NPExtractor instance. If ``None``,
defaults to :class:`FastNPExtractor() <textblob.en.np_extractors.FastNPExtractor>`.
:param pos_tagger: (optional) A Tagger instance. If ``None``,
defaults to :class:`NLTKTagger <textblob.en.taggers.NLTKTagger>`.
:param analyzer: (optional) A sentiment analyzer. If ``None``,
defaults to :class:`PatternAnalyzer <textblob.en.sentiments.PatternAnalyzer>`.
:param parser: A parser. If ``None``, defaults to
:class:`PatternParser <textblob.en.parsers.PatternParser>`.
:param classifier: A classifier.
.. versionchanged:: 0.6.0
``clean_html`` parameter deprecated, as it was in NLTK.
"""
np_extractor = FastNPExtractor()
pos_tagger = NLTKTagger()
tokenizer = WordTokenizer()
translator = Translator()
analyzer = PatternAnalyzer()
parser = PatternParser()
def __init__(self, text, tokenizer=None,
pos_tagger=None, np_extractor=None, analyzer=None,
parser=None, classifier=None, clean_html=False):
if not isinstance(text, basestring):
raise TypeError('The `text` argument passed to `__init__(text)` '
'must be a string, not {0}'.format(type(text)))
if clean_html:
raise NotImplementedError("clean_html has been deprecated. "
"To remove HTML markup, use BeautifulSoup's "
"get_text() function")
self.raw = self.string = text
self.stripped = lowerstrip(self.raw, all=True)
_initialize_models(self, tokenizer, pos_tagger, np_extractor, analyzer,
parser, classifier)
@cached_property
def words(self):
"""Return a list of word tokens. This excludes punctuation characters.
If you want to include punctuation characters, access the ``tokens``
property.
:returns: A :class:`WordList <WordList>` of word tokens.
"""
return WordList(word_tokenize(self.raw, include_punc=False))
@cached_property
def tokens(self):
"""Return a list of tokens, using this blob's tokenizer object
(defaults to :class:`WordTokenizer <textblob.tokenizers.WordTokenizer>`).
"""
return WordList(self.tokenizer.tokenize(self.raw))
def tokenize(self, tokenizer=None):
"""Return a list of tokens, using ``tokenizer``.
:param tokenizer: (optional) A tokenizer object. If None, defaults to
this blob's default tokenizer.
"""
t = tokenizer if tokenizer is not None else self.tokenizer
return WordList(t.tokenize(self.raw))
def parse(self, parser=None):
"""Parse the text.
:param parser: (optional) A parser instance. If ``None``, defaults to
this blob's default parser.
.. versionadded:: 0.6.0
"""
p = parser if parser is not None else self.parser
return p.parse(self.raw)
def classify(self):
"""Classify the blob using the blob's ``classifier``."""
if self.classifier is None:
raise NameError("This blob has no classifier. Train one first!")
return self.classifier.classify(self.raw)
@cached_property
def sentiment(self):
"""Return a tuple of form (polarity, subjectivity ) where polarity
is a float within the range [-1.0, 1.0] and subjectivity is a float
within the range [0.0, 1.0] where 0.0 is very objective and 1.0 is
very subjective.
:rtype: namedtuple of the form ``Sentiment(polarity, subjectivity)``
"""
return self.analyzer.analyze(self.raw)
@cached_property
def sentiment_assessments(self):
"""Return a tuple of form (polarity, subjectivity, assessments ) where
polarity is a float within the range [-1.0, 1.0], subjectivity is a
float within the range [0.0, 1.0] where 0.0 is very objective and 1.0
is very subjective, and assessments is a list of polarity and
subjectivity scores for the assessed tokens.
:rtype: namedtuple of the form ``Sentiment(polarity, subjectivity,
assessments)``
"""
return self.analyzer.analyze(self.raw, keep_assessments=True)
@cached_property
def polarity(self):
"""Return the polarity score as a float within the range [-1.0, 1.0]
:rtype: float
"""
return PatternAnalyzer().analyze(self.raw)[0]
@cached_property
def subjectivity(self):
"""Return the subjectivity score as a float within the range [0.0, 1.0]
where 0.0 is very objective and 1.0 is very subjective.
:rtype: float
"""
return PatternAnalyzer().analyze(self.raw)[1]
@cached_property
def noun_phrases(self):
"""Returns a list of noun phrases for this blob."""
return WordList([phrase.strip().lower()
for phrase in self.np_extractor.extract(self.raw)
if len(phrase) > 1])
@cached_property
def pos_tags(self):
"""Returns an list of tuples of the form (word, POS tag).
Example:
::
[('At', 'IN'), ('eight', 'CD'), ("o'clock", 'JJ'), ('on', 'IN'),
('Thursday', 'NNP'), ('morning', 'NN')]
:rtype: list of tuples
"""
if isinstance(self, TextBlob):
return [val for sublist in [s.pos_tags for s in self.sentences] for val in sublist]
else:
return [(Word(word, pos_tag=t), unicode(t))
for word, t in self.pos_tagger.tag(self)
if not PUNCTUATION_REGEX.match(unicode(t))]
tags = pos_tags
@cached_property
def word_counts(self):
"""Dictionary of word frequencies in this text.
"""
counts = defaultdict(int)
stripped_words = [lowerstrip(word) for word in self.words]
for word in stripped_words:
counts[word] += 1
return counts
@cached_property
def np_counts(self):
"""Dictionary of noun phrase frequencies in this text.
"""
counts = defaultdict(int)
for phrase in self.noun_phrases:
counts[phrase] += 1
return counts
def ngrams(self, n=3):
"""Return a list of n-grams (tuples of n successive words) for this
blob.
:rtype: List of :class:`WordLists <WordList>`
"""
if n <= 0:
return []
grams = [WordList(self.words[i:i + n])
for i in range(len(self.words) - n + 1)]
return grams
def translate(self, from_lang="auto", to="en"):
"""Translate the blob to another language.
Uses the Google Translate API. Returns a new TextBlob.
Requires an internet connection.
Usage:
::
>>> b = TextBlob("Simple is better than complex")
>>> b.translate(to="es")
TextBlob('Lo simple es mejor que complejo')
Language code reference:
https://developers.google.com/translate/v2/using_rest#language-params
.. versionadded:: 0.5.0.
:param str from_lang: Language to translate from. If ``None``, will attempt
to detect the language.
:param str to: Language to translate to.
:rtype: :class:`BaseBlob <BaseBlob>`
"""
return self.__class__(self.translator.translate(self.raw,
from_lang=from_lang, to_lang=to))
def detect_language(self):
"""Detect the blob's language using the Google Translate API.
Requires an internet connection.
Usage:
::
>>> b = TextBlob("bonjour")
>>> b.detect_language()
u'fr'
Language code reference:
https://developers.google.com/translate/v2/using_rest#language-params
.. versionadded:: 0.5.0
:rtype: str
"""
return self.translator.detect(self.raw)
def correct(self):
"""Attempt to correct the spelling of a blob.
.. versionadded:: 0.6.0
:rtype: :class:`BaseBlob <BaseBlob>`
"""
# regex matches: word or punctuation or whitespace
tokens = nltk.tokenize.regexp_tokenize(self.raw, "\w+|[^\w\s]|\s")
corrected = (Word(w).correct() for w in tokens)
ret = ''.join(corrected)
return self.__class__(ret)
def _cmpkey(self):
"""Key used by ComparableMixin to implement all rich comparison
operators.
"""
return self.raw
def _strkey(self):
"""Key used by StringlikeMixin to implement string methods."""
return self.raw
def __hash__(self):
return hash(self._cmpkey())
def __add__(self, other):
'''Concatenates two text objects the same way Python strings are
concatenated.
Arguments:
- `other`: a string or a text object
'''
if isinstance(other, basestring):
return self.__class__(self.raw + other)
elif isinstance(other, BaseBlob):
return self.__class__(self.raw + other.raw)
else:
raise TypeError('Operands must be either strings or {0} objects'
.format(self.__class__.__name__))
def split(self, sep=None, maxsplit=sys.maxsize):
"""Behaves like the built-in str.split() except returns a
WordList.
:rtype: :class:`WordList <WordList>`
"""
return WordList(self._strkey().split(sep, maxsplit))
class TextBlob(BaseBlob):
"""A general text block, meant for larger bodies of text (esp. those
containing sentences). Inherits from :class:`BaseBlob <BaseBlob>`.
:param str text: A string.
:param tokenizer: (optional) A tokenizer instance. If ``None``, defaults to
:class:`WordTokenizer() <textblob.tokenizers.WordTokenizer>`.
:param np_extractor: (optional) An NPExtractor instance. If ``None``,
defaults to :class:`FastNPExtractor() <textblob.en.np_extractors.FastNPExtractor>`.
:param pos_tagger: (optional) A Tagger instance. If ``None``, defaults to
:class:`NLTKTagger <textblob.en.taggers.NLTKTagger>`.
:param analyzer: (optional) A sentiment analyzer. If ``None``, defaults to
:class:`PatternAnalyzer <textblob.en.sentiments.PatternAnalyzer>`.
:param classifier: (optional) A classifier.
"""
@cached_property
def sentences(self):
"""Return list of :class:`Sentence <Sentence>` objects."""
return self._create_sentence_objects()
@cached_property
def words(self):
"""Return a list of word tokens. This excludes punctuation characters.
If you want to include punctuation characters, access the ``tokens``
property.
:returns: A :class:`WordList <WordList>` of word tokens.
"""
return WordList(word_tokenize(self.raw, include_punc=False))
@property
def raw_sentences(self):
"""List of strings, the raw sentences in the blob."""
return [sentence.raw for sentence in self.sentences]
@property
def serialized(self):
"""Returns a list of each sentence's dict representation."""
return [sentence.dict for sentence in self.sentences]
def to_json(self, *args, **kwargs):
'''Return a json representation (str) of this blob.
Takes the same arguments as json.dumps.
.. versionadded:: 0.5.1
'''
return json.dumps(self.serialized, *args, **kwargs)
@property
def json(self):
'''The json representation of this blob.
.. versionchanged:: 0.5.1
Made ``json`` a property instead of a method to restore backwards
compatibility that was broken after version 0.4.0.
'''
return self.to_json()
def _create_sentence_objects(self):
'''Returns a list of Sentence objects from the raw text.
'''
sentence_objects = []
sentences = sent_tokenize(self.raw)
char_index = 0 # Keeps track of character index within the blob
for sent in sentences:
# Compute the start and end indices of the sentence
# within the blob
start_index = self.raw.index(sent, char_index)
char_index += len(sent)
end_index = start_index + len(sent)
# Sentences share the same models as their parent blob
s = Sentence(sent, start_index=start_index, end_index=end_index,
tokenizer=self.tokenizer, np_extractor=self.np_extractor,
pos_tagger=self.pos_tagger, analyzer=self.analyzer,
parser=self.parser, classifier=self.classifier)
sentence_objects.append(s)
return sentence_objects
class Sentence(BaseBlob):
"""A sentence within a TextBlob. Inherits from :class:`BaseBlob <BaseBlob>`.
:param sentence: A string, the raw sentence.
:param start_index: An int, the index where this sentence begins
in a TextBlob. If not given, defaults to 0.
:param end_index: An int, the index where this sentence ends in
a TextBlob. If not given, defaults to the
length of the sentence - 1.
"""
def __init__(self, sentence, start_index=0, end_index=None, *args, **kwargs):
super(Sentence, self).__init__(sentence, *args, **kwargs)
#: The start index within a TextBlob
self.start = self.start_index = start_index
#: The end index within a textBlob
self.end = self.end_index = end_index or len(sentence) - 1
@property
def dict(self):
'''The dict representation of this sentence.'''
return {
'raw': self.raw,
'start_index': self.start_index,
'end_index': self.end_index,
'stripped': self.stripped,
'noun_phrases': self.noun_phrases,
'polarity': self.polarity,
'subjectivity': self.subjectivity,
}
class Blobber(object):
"""A factory for TextBlobs that all share the same tagger,
tokenizer, parser, classifier, and np_extractor.
Usage:
>>> from textblob import Blobber
>>> from textblob.taggers import NLTKTagger
>>> from textblob.tokenizers import SentenceTokenizer
>>> tb = Blobber(pos_tagger=NLTKTagger(), tokenizer=SentenceTokenizer())
>>> blob1 = tb("This is one blob.")
>>> blob2 = tb("This blob has the same tagger and tokenizer.")
>>> blob1.pos_tagger is blob2.pos_tagger
True
:param tokenizer: (optional) A tokenizer instance. If ``None``,
defaults to :class:`WordTokenizer() <textblob.tokenizers.WordTokenizer>`.
:param np_extractor: (optional) An NPExtractor instance. If ``None``,
defaults to :class:`FastNPExtractor() <textblob.en.np_extractors.FastNPExtractor>`.
:param pos_tagger: (optional) A Tagger instance. If ``None``,
defaults to :class:`NLTKTagger <textblob.en.taggers.NLTKTagger>`.
:param analyzer: (optional) A sentiment analyzer. If ``None``,
defaults to :class:`PatternAnalyzer <textblob.en.sentiments.PatternAnalyzer>`.
:param parser: A parser. If ``None``, defaults to
:class:`PatternParser <textblob.en.parsers.PatternParser>`.
:param classifier: A classifier.
.. versionadded:: 0.4.0
"""
np_extractor = FastNPExtractor()
pos_tagger = NLTKTagger()
tokenizer = WordTokenizer()
analyzer = PatternAnalyzer()
parser = PatternParser()
def __init__(self, tokenizer=None, pos_tagger=None, np_extractor=None,
analyzer=None, parser=None, classifier=None):
_initialize_models(self, tokenizer, pos_tagger, np_extractor, analyzer,
parser, classifier)
def __call__(self, text):
"""Return a new TextBlob object with this Blobber's ``np_extractor``,
``pos_tagger``, ``tokenizer``, ``analyzer``, and ``classifier``.
:returns: A new :class:`TextBlob <TextBlob>`.
"""
return TextBlob(text, tokenizer=self.tokenizer, pos_tagger=self.pos_tagger,
np_extractor=self.np_extractor, analyzer=self.analyzer,
parser=self.parser,
classifier=self.classifier)
def __repr__(self):
classifier_name = self.classifier.__class__.__name__ + "()" if self.classifier else "None"
return ("Blobber(tokenizer={0}(), pos_tagger={1}(), "
"np_extractor={2}(), analyzer={3}(), parser={4}(), classifier={5})")\
.format(self.tokenizer.__class__.__name__,
self.pos_tagger.__class__.__name__,
self.np_extractor.__class__.__name__,
self.analyzer.__class__.__name__,
self.parser.__class__.__name__,
classifier_name)
__str__ = __repr__
| [
"[email protected]"
] | |
bdc878fa3955dd1fde5a6902a51dd5a0b6813972 | 4804802271994dc54b8524ab6b22e0ef1dd68dec | /demo/__init__.py | ebc62bbce25fdbfe61be14e55801f8e954806625 | [] | no_license | addron/Django_study | 3393185dd7d6c65445670553e63fe600a36fdfa6 | 885f6e49b4c068090ab443b61723bf9f3e65040c | refs/heads/master | 2020-04-16T09:15:25.774771 | 2019-01-15T12:50:42 | 2019-01-15T12:50:42 | 165,454,869 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 116 | py | # 让Django的ORM能以mysqldb的方式来调用PyMySQL
from pymysql import install_as_MySQLdb
install_as_MySQLdb() | [
"[email protected]"
] | |
516e94a8bd08fc5bf28a46f5f4ec6ff8a5dce10d | e7164d44058a06331c034cc17eefe1521d6c95a2 | /tools/tieba/urate/python-wrapper/melt_predict.py | 3805c92f412dc70ce42b65f942925d6170288160 | [] | no_license | chenghuige/gezi | fbc1e655396fbc365fffacc10409d35d20e3952c | 4fc8f9a3c5837e8add720bf6954a4f52abfff8b5 | refs/heads/master | 2021-01-20T01:57:18.362413 | 2016-11-08T15:34:07 | 2016-11-08T15:34:07 | 101,304,774 | 0 | 3 | null | null | null | null | UTF-8 | Python | false | false | 2,988 | py | import os
import sys
import glob
from pyplusplus import module_builder
root = '/home/users/chenghuige/rsc/'
name = 'melt_predict'
#define_symbols = ['GCCXML','PYTHON_WRAPPER','NO_BAIDU_DEP']
define_symbols = ['GCCXML','PYTHON_WRAPPER']
files = [
'./gezi.include.python/common_util.h',
'./include.python/MLCore/Predictor.h',
'./include.python/MLCore/TextPredictor.h',
'./gezi.include.python/Identifer.h',
'./include.python/MLCore/PredictorFactory.h',
'./gezi.include.python/Numeric/Vector/Vector.h',
'./gezi.include.python/Numeric/Vector/WeightVector.h',
'./gezi.include.python/Numeric/Vector/vector_util.h',
'./gezi.include.python/feature/FeatureVector.h',
'./gezi.include.python/feature/features_util.h',
'./gezi.include.python/feature/FeatureExtractor.h',
'./gezi.include.python/feature/FeaturesExtractorMgr.h',
]
paths = [
#'./gezi.include.python/Numeric/Vector/',
#'./include.python/MLCore/',
#'./include.python/Prediction/Instances/',
]
#import gezi
#for path in paths:
# files += [f for f in gezi.get_filepaths(path) if f.endswith('.h')]
include_paths=[
'third-64/glog',
'third-64/gflags',
'third-64/gtest',
'third-64/boost.1.53',
'lib2-64/bsl',
'lib2-64/postag',
'lib2-64/dict',
'lib2-64/libcrf',
'lib2-64/others-ex',
'lib2-64/ullib',
'lib2-64/ccode',
'public/odict/output',
'public/uconv/output',
'public/configure/output',
'app/search/sep/anti-spam/gezi/third/rabit',
]
include_paths_python = [
'app/search/sep/anti-spam/melt/python-wrapper',
]
include_paths_obsolute = [
'app/search/sep/anti-spam/melt/python-wrapper/gezi.include.python',
'lib2-64/wordseg',
'public/comlog-plugin',
'app/search/sep/anti-spam/gezi/third',
]
mb = module_builder.module_builder_t(
gccxml_path = '~/.jumbo/bin/gccxml',
define_symbols = define_symbols,
files = files,
include_paths = [root + f + '/include' for f in include_paths]
+ [root + f + '/include.python' for f in include_paths_python]
+ [root + f for f in include_paths_obsolute]
)
mb.build_code_creator( module_name='lib%s'%name )
mb.code_creator.user_defined_directories.append( os.path.abspath('.') )
mb.write_module( os.path.join( os.path.abspath('./'), '%s_py.cc'%name) )
| [
"[email protected]"
] | |
483e5aadac9f2d40958e1167b76c220a451edcaf | ca7aa979e7059467e158830b76673f5b77a0f5a3 | /Python_codes/p02403/s798093890.py | f1e8cb17072b4b550e16ce6c68a1df20760dc0e6 | [] | no_license | Aasthaengg/IBMdataset | 7abb6cbcc4fb03ef5ca68ac64ba460c4a64f8901 | f33f1c5c3b16d0ea8d1f5a7d479ad288bb3f48d8 | refs/heads/main | 2023-04-22T10:22:44.763102 | 2021-05-13T17:27:22 | 2021-05-13T17:27:22 | 367,112,348 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 173 | py | import sys
x=y=1
while True:
x,y=map(int,input().split())
if x==0: break
for i in range (1,x+1):
for j in range (1,y+1):
sys.stdout.write('#')
print('')
print('') | [
"[email protected]"
] | |
38f127795cd68bfa908c221ad7402f05e9488ba3 | bcdb7d8ca25854eaa7f1177504b2f9531872daef | /mvpenv/bin/gunicorn | 0a06c55ea79d0ecb76a532945306cb06a92244bb | [] | no_license | rajinder-esfera/fashion-circle | ba9d8d1612821d9076958a9699a9f9d794ac4f67 | e7876589a19f7f92f95bdb5cb20f07a2b272c2cd | refs/heads/master | 2022-12-12T02:42:59.714131 | 2018-01-29T12:23:05 | 2018-01-29T12:23:05 | 117,091,007 | 0 | 2 | null | 2022-11-18T10:15:01 | 2018-01-11T11:25:06 | Python | UTF-8 | Python | false | false | 241 | #!/var/www/html/mvp/mvpenv/bin/python3
# -*- coding: utf-8 -*-
import re
import sys
from gunicorn.app.wsgiapp import run
if __name__ == '__main__':
sys.argv[0] = re.sub(r'(-script\.pyw?|\.exe)?$', '', sys.argv[0])
sys.exit(run())
| [
"[email protected]"
] | ||
acaa717cc2fa9068d3df78207efae985e278cb90 | ab3d5ea4bf0e48914ed14fcf16e5b1d752f199ba | /pcg_libraries/src/pcg_gazebo/parsers/sdf/type.py | cb1a1eed44a58d4c93e52ce2c604b9f40f8ec665 | [
"Apache-2.0",
"LicenseRef-scancode-unknown-license-reference",
"CC0-1.0",
"MIT",
"BSD-3-Clause",
"LicenseRef-scancode-public-domain"
] | permissive | boschresearch/pcg_gazebo_pkgs | 5f1004d0de874d4d1abc4eb695777013027158b2 | 1c112d01847ca4f8da61ce9b273e13d13bc7eb73 | refs/heads/master | 2020-06-11T06:28:36.228431 | 2020-02-07T13:05:28 | 2020-02-07T13:05:28 | 193,876,180 | 44 | 3 | NOASSERTION | 2020-02-07T12:00:55 | 2019-06-26T09:45:05 | Python | UTF-8 | Python | false | false | 862 | py | # Copyright (c) 2019 - The Procedural Generation for Gazebo authors
# For information on the respective copyright owner see the NOTICE file
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
from ..types import XMLString
class Type(XMLString):
_NAME = 'type'
_TYPE = 'sdf'
def __init__(self, default=''):
XMLString.__init__(self, default)
| [
"[email protected]"
] | |
0e29b7eea6f44cbedda24a54fc2477b33a4ff5fb | 62166473c5b237bbe97c7abcafd2623a1bfc3a77 | /linked_list_queue.py | e2b18155e138b3ebc3ba7bd14cca4538c8bf0f96 | [] | no_license | ananyajana/practice_problems | bc70bd55b9012fa7fafc2037ea606bc34bd63cad | 0071a8a3753c8a9135c21fecf6b175ee3774c177 | refs/heads/master | 2023-05-15T01:23:35.146811 | 2021-06-11T21:27:40 | 2021-06-11T21:27:40 | 109,902,077 | 1 | 1 | null | null | null | null | UTF-8 | Python | false | false | 975 | py | # problems from geeksforgeeks must do coding questions
T = int(input())
st_list =[]
N_list = []
for t in range(T):
N_list.append(int(input()))
st_list.append(input())
class Node:
# fn to initialize the node object
def __init__(self, data):
self.data = data
self.next = None
class MyQueue:
def __init__(self):
self.front = None
# method to add an item to the queue
def push(self, item):
node = Node(item)
if self.front is None:
self.front = node
else:
temp = self.front
while temp.next is not None:
temp = temp.next
temp.next = node
# method to remove an item from the queue
def pop(self):
if self.front is None:
return -1
else:
temp = self.front
self.front = self.front.next
return temp.data
for t in range(T):
s1 = st_list[t]
n = N_list[t]
| [
"[email protected]"
] | |
280d995579a3904e0a74306a09310df360636dd4 | 163bbb4e0920dedd5941e3edfb2d8706ba75627d | /Code/CodeRecords/2182/61406/303898.py | 0fcb1dffc2380878a68d6135d58d8e3a3cb4ebba | [] | no_license | AdamZhouSE/pythonHomework | a25c120b03a158d60aaa9fdc5fb203b1bb377a19 | ffc5606817a666aa6241cfab27364326f5c066ff | refs/heads/master | 2022-11-24T08:05:22.122011 | 2020-07-28T16:21:24 | 2020-07-28T16:21:24 | 259,576,640 | 2 | 1 | null | null | null | null | UTF-8 | Python | false | false | 569 | py | T = int(input())
for a in range(0,T):
nk = input().split(' ')
n = int(nk[0])
k = int(nk[1])
circle = []
for b in range(0,n):
circle.append(1)
ptr = 0
count = 0
m=0
while count<n-1:
if ptr>n-1:
ptr = ptr-n
while circle[ptr]==-1:
ptr+=1
if ptr > n - 1:
ptr = ptr - n
if circle[ptr]==1:
m += 1
if m==k:
circle[ptr]=-1
count+=1
m=0
ptr+=1
print(circle.index(1)+1)
| [
"[email protected]"
] | |
9eacff23f758535c87a7687002c988a9cad9bb7d | db575f3401a5e25494e30d98ec915158dd7e529b | /BIO_Stocks/RZLT.py | 79c2560d453f46f7fd8351357550d6986f2de632 | [] | no_license | andisc/StockWebScraping | b10453295b4b16f065064db6a1e3bbcba0d62bad | 41db75e941cfccaa7043a53b0e23ba6e5daa958a | refs/heads/main | 2023-08-08T01:33:33.495541 | 2023-07-22T21:41:08 | 2023-07-22T21:41:08 | 355,332,230 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,097 | py | import requests
from lxml import html
from bs4 import BeautifulSoup
import os
from datetime import date, datetime
from ValidationTools import validateday
from Database_Connections import InsertData, Insert_Logging
def main(id_control):
try:
url = 'https://www.rezolutebio.com/news/press-releases'
headers = {'User-Agent': 'Mozilla/5.0 (Macintosh; Intel Mac OS X 10_11_5) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/50.0.2661.102 Safari/537.36'}
result = requests.get(url, headers=headers)
#print(result.content.decode())
html_content = result.content.decode()
soup = BeautifulSoup(html_content, 'html.parser')
#print(soup)
articles_panel = soup.find('ul', attrs={'class':'news'})
articles = articles_panel.findAll('li')
# get first article
FIRST_ARTICLE = articles[0]
article_date = FIRST_ARTICLE.find('time')
article_desc = FIRST_ARTICLE.find('a')
v_article_date = article_date.text.lstrip().rstrip()
#if the process find any article with the today date
istoday, v_art_date = validateday(v_article_date)
if (istoday == True):
v_ticker = os.path.basename(__file__).replace(".py", "")
v_url = article_desc.get('href')
v_description = article_desc.text.lstrip().rstrip()
now = datetime.now()
print("URL: " + v_url)
print("DESCRIPTION: " + v_description)
print("ARTICLE_DATE: " + str(now))
# Insert articles
if "https://" in v_url:
InsertData(v_ticker, v_description, v_url, v_art_date)
else:
InsertData(v_ticker, v_description, url, v_art_date)
except Exception:
error_message = "Entrou na excepção ao tratar " + os.path.basename(__file__) + "..."
print(error_message)
Insert_Logging(id_control, 'Detail', error_message)
pass
#InsertData()
if __name__ == "__main__":
main()
| [
"[email protected]"
] | |
75ad1cf37bc5ac16b62c19cd737a317a998c3347 | f47ac8d59fe1c0f807d699fe5b5991ed3662bfdb | /binary23.py | 6f1107467849f636bfca3fa944aa05d18d2fb699 | [] | no_license | YanglanWang/jianzhi_offer | 5561d8a29881d8504b23446353e9f969c01ed0c5 | 1c568f399ed6ac1017671c40c765e609c1b6d178 | refs/heads/master | 2020-06-16T10:41:44.979558 | 2019-08-03T09:07:37 | 2019-08-03T09:07:37 | 195,543,754 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,290 | py | class Solution:
def VerifySquenceOfBST(self, sequence):
# write code here
if len(sequence) == 0:
return False
if len(sequence) == 1:
return True
root = sequence[-1]
for i in range(len(sequence)):
if sequence[i] > sequence[-1]:
break
k = i
for j in range(i,len(sequence)-1):
if sequence[j]<sequence[-1]:
return False
# if k==len(sequence)-1:
# if sequence[k - 1] > sequence[-1]:
# return False
# else:
# return self.VerifySquenceOfBST(sequence[:k])
# elif k==0:
# if sequence[-2] < sequence[-1]:
# return False
# else:
# return self.VerifySquenceOfBST(sequence[:-1])
# else:
# if sequence[k - 1] > sequence[-1] or sequence[-2] < sequence[-1]:
# return False
left=True
right=True
if k>0:
left=self.VerifySquenceOfBST(sequence[:k])
if k<len(sequence)-1:
right=self.VerifySquenceOfBST(sequence[k:-1])
return left and right
a=Solution()
# b=a.VerifySquenceOfBST([4,6,7,5])
b=a.VerifySquenceOfBST([4,3,5,8,10,9,7])
print(b) | [
"[email protected]"
] | |
f288784a0437bf94488c1a422eb9e0f0ca36f3e1 | b5a9d42f7ea5e26cd82b3be2b26c324d5da79ba1 | /tensorflow/python/data/kernel_tests/repeat_test.py | 88e83da5bc27a9aeaa9b63ef9e314e6f97cb074f | [
"Apache-2.0"
] | permissive | uve/tensorflow | e48cb29f39ed24ee27e81afd1687960682e1fbef | e08079463bf43e5963acc41da1f57e95603f8080 | refs/heads/master | 2020-11-29T11:30:40.391232 | 2020-01-11T13:43:10 | 2020-01-11T13:43:10 | 230,088,347 | 0 | 0 | Apache-2.0 | 2019-12-25T10:49:15 | 2019-12-25T10:49:14 | null | UTF-8 | Python | false | false | 3,445 | py | # Copyright 2017 The TensorFlow Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
# ==============================================================================
"""Tests for `tf.data.Dataset.repeat()`."""
from __future__ import absolute_import
from __future__ import division
from __future__ import print_function
import numpy as np
from tensorflow.python.data.kernel_tests import test_base
from tensorflow.python.data.ops import dataset_ops
from tensorflow.python.framework import test_util
from tensorflow.python.platform import test
@test_util.run_all_in_graph_and_eager_modes
class RepeatTest(test_base.DatasetTestBase):
def testRepeatTensorDataset(self):
"""Test a dataset that repeats its input multiple times."""
components = (np.array(1), np.array([1, 2, 3]), np.array(37.0))
# This placeholder can be fed when dataset-definition subgraph
# runs (i.e. `init_op` below) to configure the number of
# repetitions used in a particular iterator.
def do_test(count):
dataset = dataset_ops.Dataset.from_tensors(components).repeat(count)
self.assertEqual(
[c.shape for c in components],
[shape for shape in dataset_ops.get_legacy_output_shapes(dataset)])
self.assertDatasetProduces(dataset, [components] * count)
# Test a finite repetition.
do_test(3)
# test a different finite repetition.
do_test(7)
# Test an empty repetition.
do_test(0)
# Test an infinite repetition.
# NOTE(mrry): There's not a good way to test that the sequence
# actually is infinite.
dataset = dataset_ops.Dataset.from_tensors(components).repeat(-1)
self.assertEqual(
[c.shape for c in components],
[shape for shape in dataset_ops.get_legacy_output_shapes(dataset)])
get_next = self.getNext(dataset)
for _ in range(17):
results = self.evaluate(get_next())
for component, result_component in zip(components, results):
self.assertAllEqual(component, result_component)
def testRepeatRepeatTensorDataset(self):
"""Test the composition of repeat datasets."""
components = (np.array(1), np.array([1, 2, 3]), np.array(37.0))
inner_count, outer_count = 7, 14
dataset = dataset_ops.Dataset.from_tensors(components).repeat(
inner_count).repeat(outer_count)
self.assertEqual(
[c.shape for c in components],
[shape for shape in dataset_ops.get_legacy_output_shapes(dataset)])
self.assertDatasetProduces(dataset,
[components] * (inner_count * outer_count))
def testRepeatEmptyDataset(self):
"""Test that repeating an empty dataset does not hang."""
dataset = dataset_ops.Dataset.from_tensors(0).repeat(10).skip(10).repeat(-1)
self.assertDatasetProduces(dataset, [])
if __name__ == "__main__":
test.main()
| [
"[email protected]"
] | |
b3e56b32c4b8350754af374e43a7c8207d17fd73 | f0f56524d54b924eda0bc1abcc386589ccf2a026 | /dittodemo/settings/defaults.py | 40f9289fd1b893ec30d6ee20799ba3c67e0154ac | [
"MIT"
] | permissive | vanderwal/django-ditto-demo | 052d116419b8f67db40cd7a71b793bd702672c0f | abb251d44de48191b32ef54768f638920d39d081 | refs/heads/master | 2022-02-03T21:07:14.860800 | 2017-02-09T13:50:36 | 2017-02-09T13:50:36 | 66,157,322 | 0 | 0 | null | 2016-08-20T16:43:14 | 2016-08-20T16:43:13 | null | UTF-8 | Python | false | false | 5,235 | py | """
Django settings for dittodemo project.
Generated by 'django-admin startproject' using Django 1.9.7.
For more information on this file, see
https://docs.djangoproject.com/en/1.9/topics/settings/
For the full list of settings and their values, see
https://docs.djangoproject.com/en/1.9/ref/settings/
"""
import os
from os import environ
# Build paths inside the project like this: os.path.join(BASE_DIR, ...)
BASE_DIR = os.path.dirname(os.path.dirname(os.path.abspath(__file__)))
# Make this unique, and don't share it with anybody.
# http://www.miniwebtool.com/django-secret-key-generator/
SECRET_KEY = environ.get('SECRET_KEY', '')
# SECURITY WARNING: don't run with debug turned on in production!
DEBUG = False
ADMINS = [
('Phil Gyford', '[email protected]'),
]
MANAGERS = ADMINS
# Application definition
INSTALLED_APPS = [
'django.contrib.admin',
'django.contrib.auth',
'django.contrib.contenttypes',
'django.contrib.sessions',
'django.contrib.messages',
'django.contrib.staticfiles',
# Our Django app.
'demo',
# For Django Ditto.
'imagekit',
'sortedm2m',
'taggit',
'ditto.core',
'ditto.flickr',
'ditto.lastfm',
'ditto.pinboard',
'ditto.twitter',
]
MIDDLEWARE_CLASSES = [
'django.middleware.security.SecurityMiddleware',
'django.contrib.sessions.middleware.SessionMiddleware',
'django.middleware.common.CommonMiddleware',
'django.middleware.csrf.CsrfViewMiddleware',
'django.contrib.auth.middleware.AuthenticationMiddleware',
'django.contrib.messages.middleware.MessageMiddleware',
'django.middleware.clickjacking.XFrameOptionsMiddleware',
]
ROOT_URLCONF = 'dittodemo.urls'
TEMPLATES = [
{
'BACKEND': 'django.template.backends.django.DjangoTemplates',
'DIRS': [],
'APP_DIRS': True,
'OPTIONS': {
'context_processors': [
'django.template.context_processors.debug',
'django.template.context_processors.request',
'django.contrib.auth.context_processors.auth',
'django.contrib.messages.context_processors.messages',
'ditto.core.context_processors.ditto',
],
},
},
]
WSGI_APPLICATION = 'dittodemo.wsgi.application'
# Database
# https://docs.djangoproject.com/en/1.9/ref/settings/#databases
DATABASES = {
'default': {
'ENGINE': 'django.db.backends.postgresql',
'NAME': environ.get('DB_NAME'),
'USER': environ.get('DB_USERNAME'),
'PASSWORD': environ.get('DB_PASSWORD'),
'HOST': environ.get('DB_HOST'),
'PORT': '',
}
}
# Password validation
# https://docs.djangoproject.com/en/1.9/ref/settings/#auth-password-validators
AUTH_PASSWORD_VALIDATORS = [
{
'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator',
},
{
'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator',
},
{
'NAME': 'django.contrib.auth.password_validation.CommonPasswordValidator',
},
{
'NAME': 'django.contrib.auth.password_validation.NumericPasswordValidator',
},
]
# Internationalization
# https://docs.djangoproject.com/en/1.9/topics/i18n/
LANGUAGE_CODE = 'en-gb'
TIME_ZONE = 'UTC'
USE_I18N = True
USE_L10N = True
USE_TZ = True
USE_THOUSAND_SEPARATOR = True
# Static files (CSS, JavaScript, Images)
# https://docs.djangoproject.com/en/1.9/howto/static-files/
STATIC_URL = '/static/'
STATIC_ROOT = os.path.join(BASE_DIR, 'static_collected/')
# URL that handles the media served from MEDIA_ROOT. Make sure to use a
# trailing slash.
# Examples: "http://media.lawrence.com/media/", "http://example.com/media/"
MEDIA_URL = '/media/'
# Absolute filesystem path to the directory that will hold user-uploaded files.
# Example: "/home/media/media.lawrence.com/media/"
MEDIA_ROOT = os.path.join(BASE_DIR, 'media/')
ALLOWED_HOSTS = environ.get('ALLOWED_HOSTS', '*').split(',')
CACHES = {
'default': {
'BACKEND': 'django.core.cache.backends.memcached.PyLibMCCache',
'LOCATION': '127.0.0.1:11211',
'TIMEOUT': 500, # milliseconds
}
}
# A sample logging configuration. The only tangible logging
# performed by this configuration is to send an email to
# the site admins on every HTTP 500 error when DEBUG=False.
# See http://docs.djangoproject.com/en/dev/topics/logging for
# more details on how to customize your logging configuration.
LOGGING = {
'version': 1,
'disable_existing_loggers': False,
'filters': {
'require_debug_false': {
'()': 'django.utils.log.RequireDebugFalse'
}
},
'handlers': {
'mail_admins': {
'level': 'ERROR',
'filters': ['require_debug_false'],
'class': 'django.utils.log.AdminEmailHandler'
}
},
'loggers': {
'django.request': {
'handlers': ['mail_admins'],
'level': 'ERROR',
'propagate': True,
},
}
}
# DJANGO DITTO SETTINGS
DITTO_FLICKR_DIR_BASE = 'flickr'
DITTO_FLICKR_DIR_PHOTOS_FORMAT = '%Y/%m/%d'
DITTO_FLICKR_USE_LOCAL_MEDIA = False
DITTO_TWITTER_DIR_BASE = 'twitter'
DITTO_TWITTER_USE_LOCAL_MEDIA = False
| [
"[email protected]"
] | |
916e183c70b1243b4a91f925cfb582f468642add | c8cd63041471e7a20bf3a15c3ca96b7573f5f727 | /load_test_parser.py | 2aa9ecfacbaac77a83ac5488be6c85d639cefd4b | [] | no_license | ansonmiu0214/airbus_prototype | a992b9a04ba35da54088ff399975aac4efc7046a | 0647ec3cee330e4c58a40e10a946e57478e316ad | refs/heads/master | 2020-04-26T09:24:12.565650 | 2019-03-09T11:42:39 | 2019-03-09T11:42:39 | 173,453,998 | 0 | 1 | null | null | null | null | UTF-8 | Python | false | false | 541 | py | #!/bin/python3
if __name__ == "__main__":
with open('output_2.txt', 'r') as f:
lines = f.readlines()
relevant = [line.strip().split('Current latency')[1] for line in lines if line.startswith('Current latency')]
relevant = list(map(float, map(lambda x: x.strip(), relevant)))
max_latency = max(relevant)
min_latency = min(relevant)
avg_latency = sum(relevant) / len(relevant)
print("Max latency (ms):", max_latency)
print("Min latency (ms):", min_latency)
print("Avg latency (ms):", avg_latency)
| [
"[email protected]"
] | |
56d0e51585b52f3fa20e1d49f5c8d541621a07ec | 85a9ffeccb64f6159adbd164ff98edf4ac315e33 | /pysnmp-with-texts/HUAWEI-PWE3-MIB.py | 3e123a0d7702a64554c396c962cbbcdad8e83ff7 | [
"Apache-2.0",
"LicenseRef-scancode-warranty-disclaimer",
"LicenseRef-scancode-proprietary-license",
"LicenseRef-scancode-unknown-license-reference"
] | permissive | agustinhenze/mibs.snmplabs.com | 5d7d5d4da84424c5f5a1ed2752f5043ae00019fb | 1fc5c07860542b89212f4c8ab807057d9a9206c7 | refs/heads/master | 2020-12-26T12:41:41.132395 | 2019-08-16T15:51:41 | 2019-08-16T15:53:57 | 237,512,469 | 0 | 0 | Apache-2.0 | 2020-01-31T20:41:36 | 2020-01-31T20:41:35 | null | UTF-8 | Python | false | false | 126,657 | py | #
# PySNMP MIB module HUAWEI-PWE3-MIB (http://snmplabs.com/pysmi)
# ASN.1 source file:///Users/davwang4/Dev/mibs.snmplabs.com/asn1/HUAWEI-PWE3-MIB
# Produced by pysmi-0.3.4 at Wed May 1 13:45:54 2019
# On host DAVWANG4-M-1475 platform Darwin version 18.5.0 by user davwang4
# Using Python version 3.7.3 (default, Mar 27 2019, 09:23:15)
#
OctetString, Integer, ObjectIdentifier = mibBuilder.importSymbols("ASN1", "OctetString", "Integer", "ObjectIdentifier")
NamedValues, = mibBuilder.importSymbols("ASN1-ENUMERATION", "NamedValues")
SingleValueConstraint, ConstraintsIntersection, ConstraintsUnion, ValueSizeConstraint, ValueRangeConstraint = mibBuilder.importSymbols("ASN1-REFINEMENT", "SingleValueConstraint", "ConstraintsIntersection", "ConstraintsUnion", "ValueSizeConstraint", "ValueRangeConstraint")
hwDatacomm, = mibBuilder.importSymbols("HUAWEI-MIB", "hwDatacomm")
HWL2VpnVcEncapsType, HWEnableValue, HWL2VpnStateChangeReason = mibBuilder.importSymbols("HUAWEI-VPLS-EXT-MIB", "HWL2VpnVcEncapsType", "HWEnableValue", "HWL2VpnStateChangeReason")
InterfaceIndexOrZero, ifName = mibBuilder.importSymbols("IF-MIB", "InterfaceIndexOrZero", "ifName")
InetAddressType, = mibBuilder.importSymbols("INET-ADDRESS-MIB", "InetAddressType")
EnabledStatus, = mibBuilder.importSymbols("P-BRIDGE-MIB", "EnabledStatus")
NotificationGroup, ObjectGroup, ModuleCompliance = mibBuilder.importSymbols("SNMPv2-CONF", "NotificationGroup", "ObjectGroup", "ModuleCompliance")
sysUpTime, = mibBuilder.importSymbols("SNMPv2-MIB", "sysUpTime")
iso, NotificationType, Integer32, MibScalar, MibTable, MibTableRow, MibTableColumn, IpAddress, ModuleIdentity, Counter64, Bits, TimeTicks, Gauge32, Bits, ObjectIdentity, MibIdentifier, Unsigned32, Counter32 = mibBuilder.importSymbols("SNMPv2-SMI", "iso", "NotificationType", "Integer32", "MibScalar", "MibTable", "MibTableRow", "MibTableColumn", "IpAddress", "ModuleIdentity", "Counter64", "Bits", "TimeTicks", "Gauge32", "Bits", "ObjectIdentity", "MibIdentifier", "Unsigned32", "Counter32")
DisplayString, TextualConvention, RowStatus, TruthValue = mibBuilder.importSymbols("SNMPv2-TC", "DisplayString", "TextualConvention", "RowStatus", "TruthValue")
hwL2VpnPwe3 = ModuleIdentity((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4))
if mibBuilder.loadTexts: hwL2VpnPwe3.setLastUpdated('200704120900Z')
if mibBuilder.loadTexts: hwL2VpnPwe3.setOrganization('Huawei Technologies Co., Ltd.')
if mibBuilder.loadTexts: hwL2VpnPwe3.setContactInfo('R&D BeiJing, Huawei Technologies co.,Ltd. Huawei Bld.,NO.3 Xinxi Rd., Shang-Di Information Industry Base, Hai-Dian District Beijing P.R. China Zip:100085 Http://www.huawei.com E-mail:[email protected]')
if mibBuilder.loadTexts: hwL2VpnPwe3.setDescription('The HUAWEI-PWE3-MIB contains objects to manage PWE3.')
class HWLdpPwStateChangeReason(TextualConvention, Integer32):
description = "The type indicates the reason of LDP PW VC's status change: LDP session down (1) AC interface down (2) PSN tunnel state down (3) Mapping message not received (4) PW interface parameter not match (5) Notification not forwarding (6) "
status = 'current'
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5, 6))
namedValues = NamedValues(("ldpSessionDown", 1), ("interfaceDown", 2), ("tunnelDown", 3), ("receivedNoMapping", 4), ("paraUnMatched", 5), ("notifiNotForward", 6))
hwL2Vpn = MibIdentifier((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119))
hwPwe3MIBObjects = MibIdentifier((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1))
hwPwe3Objects = MibIdentifier((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1))
hwPWVcTable = MibTable((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1), )
if mibBuilder.loadTexts: hwPWVcTable.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTable.setDescription('This table is the VC configuration table. Users can create or delete a VC by it.')
hwPWVcEntry = MibTableRow((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1), ).setIndexNames((0, "HUAWEI-PWE3-MIB", "hwPWVcID"), (0, "HUAWEI-PWE3-MIB", "hwPWVcType"))
if mibBuilder.loadTexts: hwPWVcEntry.setStatus('current')
if mibBuilder.loadTexts: hwPWVcEntry.setDescription('Provides the information of a VC entry.')
hwPWVcID = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 1), Unsigned32())
if mibBuilder.loadTexts: hwPWVcID.setStatus('current')
if mibBuilder.loadTexts: hwPWVcID.setDescription("Index for the conceptual row identifying a PW within this PW Emulation table.Used in the outgoing PW ID field within the 'Virtual Circuit FEC Element'.")
hwPWVcType = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 2), HWL2VpnVcEncapsType())
if mibBuilder.loadTexts: hwPWVcType.setStatus('current')
if mibBuilder.loadTexts: hwPWVcType.setDescription('The type of the Virtual Circuit.This value indicate the service to be carried over this PW.')
hwPWVcPeerAddrType = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 3), InetAddressType().clone('ipv4')).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcPeerAddrType.setStatus('current')
if mibBuilder.loadTexts: hwPWVcPeerAddrType.setDescription("Denotes the address type of the peer node. It should be set to 'unknown' if PE/PW maintenance protocol is not used and the address is unknown. Currently, support 'ipv4' only.")
hwPWVcPeerAddr = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 4), IpAddress()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcPeerAddr.setStatus('current')
if mibBuilder.loadTexts: hwPWVcPeerAddr.setDescription("This object contain the value of the peer node address of the PW/PE maintenance protocol entity. This object SHOULD contain a value of all zeroes if not applicable (hwPWVcPeerAddrType is 'unknown').")
hwPWVcStatus = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 5), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4))).clone(namedValues=NamedValues(("up", 1), ("down", 2), ("plugout", 3), ("backup", 4)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcStatus.setStatus('current')
if mibBuilder.loadTexts: hwPWVcStatus.setDescription("Indicates the status of the PW in the local node. Currently, can't support 'plugout'.")
hwPWVcInboundLabel = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 6), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcInboundLabel.setStatus('current')
if mibBuilder.loadTexts: hwPWVcInboundLabel.setDescription('For ldp vc, the value will be created by system automatically.')
hwPWVcOutboundLabel = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 7), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcOutboundLabel.setStatus('current')
if mibBuilder.loadTexts: hwPWVcOutboundLabel.setDescription('For ldp vc, the value will be created by system automatically.')
hwPWVcSwitchSign = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 8), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4))).clone(namedValues=NamedValues(("staticTostatic", 1), ("ldpTostatic", 2), ("ldpToldp", 3), ("upe", 4)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcSwitchSign.setStatus('current')
if mibBuilder.loadTexts: hwPWVcSwitchSign.setDescription('The sign of switch.')
hwPWVcSwitchID = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 9), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcSwitchID.setStatus('current')
if mibBuilder.loadTexts: hwPWVcSwitchID.setDescription("Used in the outgoing PW ID field within the 'Virtual Circuit FEC Element' of the switch PW.")
hwPWVcSwitchPeerAddrType = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 10), InetAddressType().clone('ipv4')).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcSwitchPeerAddrType.setStatus('current')
if mibBuilder.loadTexts: hwPWVcSwitchPeerAddrType.setDescription("Denotes the address type of the peer node of the switch PW. It should be set to 'unknown' if PE/PW maintenance protocol is not used and the address is unknown. Currently, support 'ipv4' only.")
hwPWVcSwitchPeerAddr = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 11), IpAddress()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcSwitchPeerAddr.setStatus('current')
if mibBuilder.loadTexts: hwPWVcSwitchPeerAddr.setDescription("This object contain the value of the peer node address of the switch PW of the PW/PE maintenance protocol entity. This object SHOULD contain a value of all zeroes if not applicable (hwPWVcSwitchPeerAddrType is 'unknown').")
hwPWVcSwitchInboundLabel = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 12), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcSwitchInboundLabel.setStatus('current')
if mibBuilder.loadTexts: hwPWVcSwitchInboundLabel.setDescription('For ldp vc, the value will be created by system automatically.')
hwPWVcSwitchOutboundLabel = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 13), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcSwitchOutboundLabel.setStatus('current')
if mibBuilder.loadTexts: hwPWVcSwitchOutboundLabel.setDescription('For ldp vc, the value will be created by system automatically.')
hwPWVcGroupID = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 14), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcGroupID.setStatus('current')
if mibBuilder.loadTexts: hwPWVcGroupID.setDescription("Used in the Group ID field sent to the peer PWES within the maintenance protocol used for PW setup. Applicable if pwVcOwner equal 'pwIdFecSignaling' or 'l2tpControlProtocol', should be set to zero otherwise. Currently, this value always be zero.")
hwPWVcIfIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 15), InterfaceIndexOrZero()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcIfIndex.setStatus('current')
if mibBuilder.loadTexts: hwPWVcIfIndex.setDescription('Index of the interface (or the virtual interface) associated with the PW.')
hwPWVcAcStatus = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 16), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5, 6))).clone(namedValues=NamedValues(("up", 1), ("down", 2), ("plugout", 3), ("notify", 4), ("notifyDown", 5), ("downNotify", 6)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcAcStatus.setStatus('current')
if mibBuilder.loadTexts: hwPWVcAcStatus.setDescription("Local AC status. Currently, can't support 'plugout'.")
hwPWVcACOAMStatus = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 17), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2))).clone(namedValues=NamedValues(("up", 1), ("down", 2)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcACOAMStatus.setStatus('current')
if mibBuilder.loadTexts: hwPWVcACOAMStatus.setDescription("Denotes the AC's protocol is operational or not.")
hwPWVcMtu = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 18), Integer32().subtype(subtypeSpec=ConstraintsUnion(ValueRangeConstraint(0, 0), ValueRangeConstraint(46, 9600), ))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcMtu.setStatus('current')
if mibBuilder.loadTexts: hwPWVcMtu.setDescription('If not equal zero, the optional Mtu object in the signaling protocol will be sent with this value, representing the locally supported MTU size over the interface (or the virtual interface) associated with the PW.')
hwPWVcCtrlWord = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 19), HWEnableValue()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcCtrlWord.setStatus('current')
if mibBuilder.loadTexts: hwPWVcCtrlWord.setDescription('If signaling is used for PW establishment, this object indicates the status of the control word negotiation, and in both signaling or manual configuration indicates if CW is to be present or not for this PW.')
hwPWVcVCCV = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 20), Bits().clone(namedValues=NamedValues(("ccCw", 0), ("ccAlert", 1), ("ccLabel", 2), ("cvIcmpping", 3), ("cvLspping", 4), ("cvBfd", 5), ("ccTtl", 6)))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcVCCV.setStatus('current')
if mibBuilder.loadTexts: hwPWVcVCCV.setDescription('Indicates the optional VCCV capabilities of the PW. According to whether the control word is enabled, the value can be ccCw(0)|ccAlert(1)|ccTtl(6)|cvLspping(4)|cvBfd(5) or ccAlert(1)|ccTtl(6)|cvLspping(4)|cvBfd(5). The default value is ccAlert(1)|ccTtl(6)|cvLspping(4)|cvBfd(5).')
hwPWVcBandWidth = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 21), Unsigned32().subtype(subtypeSpec=ValueRangeConstraint(0, 32000000))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcBandWidth.setStatus('current')
if mibBuilder.loadTexts: hwPWVcBandWidth.setDescription("This object indicates the bandwidth. '0' is the default value.")
hwPWVcMaxAtmCells = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 22), Unsigned32().subtype(subtypeSpec=ValueRangeConstraint(0, 28))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcMaxAtmCells.setStatus('current')
if mibBuilder.loadTexts: hwPWVcMaxAtmCells.setDescription('Indicates the max cell supported when vc type is atm.')
hwPWVcTnlPolicyName = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 23), OctetString().subtype(subtypeSpec=ValueSizeConstraint(0, 39))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcTnlPolicyName.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTnlPolicyName.setDescription('Indicates the tunnel policy name used.')
hwPWVcQoSBehaviorIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 24), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcQoSBehaviorIndex.setStatus('current')
if mibBuilder.loadTexts: hwPWVcQoSBehaviorIndex.setDescription("Indicates the traffic behavior Index when QOS is implemented. Currently,can't support.Return the default value is '0'.")
hwPWVcExplicitPathName = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 25), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 31))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcExplicitPathName.setStatus('current')
if mibBuilder.loadTexts: hwPWVcExplicitPathName.setDescription("Indicates the explicit path name set by the operator.Currently, can't support.")
hwPWVcTemplateName = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 26), OctetString().subtype(subtypeSpec=ValueSizeConstraint(0, 19))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcTemplateName.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTemplateName.setDescription('Indicates the PW template index referenced.')
hwPWVcSecondary = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 27), TruthValue()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcSecondary.setStatus('current')
if mibBuilder.loadTexts: hwPWVcSecondary.setDescription('Indicates whether or not the secondary PW is used.')
hwPWVcUpTime = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 28), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcUpTime.setStatus('current')
if mibBuilder.loadTexts: hwPWVcUpTime.setDescription('Indicates the duration when the PW keeps Up for the last time, in seconds.')
hwPWOAMSync = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 29), TruthValue()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWOAMSync.setStatus('current')
if mibBuilder.loadTexts: hwPWOAMSync.setDescription('Denotes the AC and PSN are enable or not.')
hwPWVCForBfdIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 30), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVCForBfdIndex.setStatus('current')
if mibBuilder.loadTexts: hwPWVCForBfdIndex.setDescription('The index of PW for BFD.')
hwPWVcDelayTime = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 31), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcDelayTime.setStatus('current')
if mibBuilder.loadTexts: hwPWVcDelayTime.setDescription('The reroute delay time.')
hwPWVcReroutePolicy = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 32), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5, 6, 7))).clone(namedValues=NamedValues(("delay", 1), ("immediately", 2), ("never", 3), ("none", 4), ("err", 5), ("invalid", 6), ("immediatelySwitch", 7)))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcReroutePolicy.setStatus('current')
if mibBuilder.loadTexts: hwPWVcReroutePolicy.setDescription('Reroute policy.')
hwPWVcResumeTime = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 33), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcResumeTime.setStatus('current')
if mibBuilder.loadTexts: hwPWVcResumeTime.setDescription('The reroute resume time.')
hwPWVcRerouteReason = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 34), HWL2VpnStateChangeReason()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcRerouteReason.setStatus('current')
if mibBuilder.loadTexts: hwPWVcRerouteReason.setDescription('Last reroute reason.')
hwPWVcLastRerouteTime = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 35), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcLastRerouteTime.setStatus('current')
if mibBuilder.loadTexts: hwPWVcLastRerouteTime.setDescription('Last reroute time.')
hwPWVcManualSetFault = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 36), TruthValue()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcManualSetFault.setStatus('current')
if mibBuilder.loadTexts: hwPWVcManualSetFault.setDescription('Denotes the manual has been set fault or not.')
hwPWVcActive = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 37), TruthValue()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcActive.setStatus('current')
if mibBuilder.loadTexts: hwPWVcActive.setDescription('Denotes the current vc is active or not.')
hwPWVcVrIfIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 38), InterfaceIndexOrZero()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcVrIfIndex.setStatus('current')
if mibBuilder.loadTexts: hwPWVcVrIfIndex.setDescription('Denotes the VRRP interface this PW binding to.')
hwPWVcVrID = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 39), Unsigned32().subtype(subtypeSpec=ValueRangeConstraint(0, 255))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcVrID.setStatus('current')
if mibBuilder.loadTexts: hwPWVcVrID.setDescription('Denotes the VrID this PW binding to.')
hwPWBFDDetectMultiplier = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 40), Unsigned32().subtype(subtypeSpec=ConstraintsUnion(ValueRangeConstraint(0, 0), ValueRangeConstraint(3, 50), ))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWBFDDetectMultiplier.setStatus('current')
if mibBuilder.loadTexts: hwPWBFDDetectMultiplier.setDescription('The multiple of detection time.')
hwPWBFDMinReceiveInterval = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 41), Unsigned32().subtype(subtypeSpec=ConstraintsUnion(ValueRangeConstraint(0, 0), ValueRangeConstraint(3, 1000), ))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWBFDMinReceiveInterval.setStatus('current')
if mibBuilder.loadTexts: hwPWBFDMinReceiveInterval.setDescription('The interval of bfd messages to be received.')
hwPWBFDMinTransmitInterval = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 42), Unsigned32().subtype(subtypeSpec=ConstraintsUnion(ValueRangeConstraint(0, 0), ValueRangeConstraint(3, 1000), ))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWBFDMinTransmitInterval.setStatus('current')
if mibBuilder.loadTexts: hwPWBFDMinTransmitInterval.setDescription('The interval of bfd messages to be sent.')
hwPWDynamicBFDDetect = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 43), TruthValue()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWDynamicBFDDetect.setStatus('current')
if mibBuilder.loadTexts: hwPWDynamicBFDDetect.setDescription('This value indicates the capacitability to support dynamic BFD detect.')
hwPWBFDRemoteVcID = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 44), Unsigned32().subtype(subtypeSpec=ValueRangeConstraint(0, 4294967295))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWBFDRemoteVcID.setStatus('current')
if mibBuilder.loadTexts: hwPWBFDRemoteVcID.setDescription('In the multiple-hop model, the value of remote VC id.')
hwPWEthOamType = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 45), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("ethOam1ag", 1), ("ethOam3ah", 2), ("noEthOamCfg", 3)))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWEthOamType.setStatus('current')
if mibBuilder.loadTexts: hwPWEthOamType.setDescription('This value indicates the type of ETH OAM.')
hwPWCfmMaIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 46), Unsigned32().subtype(subtypeSpec=ConstraintsUnion(ValueRangeConstraint(0, 4095), ValueRangeConstraint(4294967295, 4294967295), ))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWCfmMaIndex.setStatus('current')
if mibBuilder.loadTexts: hwPWCfmMaIndex.setDescription('This value indicates the current CFM MA index.')
hwPWVcUpStartTime = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 47), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 63))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcUpStartTime.setStatus('current')
if mibBuilder.loadTexts: hwPWVcUpStartTime.setDescription('Specifies the time this PW status was Up(1).')
hwPWVcUpSumTime = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 48), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcUpSumTime.setStatus('current')
if mibBuilder.loadTexts: hwPWVcUpSumTime.setDescription('Indicates the accumulated time when the VC is Up, in seconds.')
hwPWVcIfName = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 49), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 63))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcIfName.setStatus('current')
if mibBuilder.loadTexts: hwPWVcIfName.setDescription('Name of the interface (or the virtual interface) associated with the PW.')
hwPWVcRowStatus = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 51), RowStatus()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcRowStatus.setStatus('current')
if mibBuilder.loadTexts: hwPWVcRowStatus.setDescription("RowStatus for this Table. Restriction: The row must be created by 'createAndGo' handle only. Handle 'createAndWait' is forbidden. Not support modifying configuration.")
hwPWVcAtmPackOvertime = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 52), Unsigned32().subtype(subtypeSpec=ConstraintsUnion(ValueRangeConstraint(0, 0), ValueRangeConstraint(100, 50000), ))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcAtmPackOvertime.setStatus('current')
if mibBuilder.loadTexts: hwPWVcAtmPackOvertime.setDescription('Specifies the AtmPackOvertime.')
hwPWVcPwJitterBufferDepth = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 53), Unsigned32().subtype(subtypeSpec=ValueRangeConstraint(0, 64))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcPwJitterBufferDepth.setStatus('current')
if mibBuilder.loadTexts: hwPWVcPwJitterBufferDepth.setDescription('Specifies the PwJitterBufferDepth.')
hwPWVcPwTdmEncapsulationNum = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 54), Unsigned32().subtype(subtypeSpec=ValueRangeConstraint(0, 40))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcPwTdmEncapsulationNum.setStatus('current')
if mibBuilder.loadTexts: hwPWVcPwTdmEncapsulationNum.setDescription('Specifies the PwTdmEncapsulationNum.')
hwPWVcPwIdleCode = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 55), Unsigned32().subtype(subtypeSpec=ConstraintsUnion(ValueRangeConstraint(0, 255), ValueRangeConstraint(65535, 65535), ))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcPwIdleCode.setStatus('current')
if mibBuilder.loadTexts: hwPWVcPwIdleCode.setDescription('Specifies the PwIdleCode.')
hwPWVcPwRtpHeader = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 56), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcPwRtpHeader.setStatus('current')
if mibBuilder.loadTexts: hwPWVcPwRtpHeader.setDescription('Specifies the PwRtpHeader.')
hwPWVcSwitchTnlPolicyName = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 57), OctetString().subtype(subtypeSpec=ValueSizeConstraint(0, 39))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcSwitchTnlPolicyName.setStatus('current')
if mibBuilder.loadTexts: hwPWVcSwitchTnlPolicyName.setDescription('Indicates the switch tunnel policy name used.')
hwPWVcCfmMdIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 58), Unsigned32().subtype(subtypeSpec=ConstraintsUnion(ValueRangeConstraint(0, 4095), ValueRangeConstraint(4294967295, 4294967295), ))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcCfmMdIndex.setStatus('current')
if mibBuilder.loadTexts: hwPWVcCfmMdIndex.setDescription('This value indicates the current CFM MD index.')
hwPWVcCfmMaName = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 59), OctetString().subtype(subtypeSpec=ValueSizeConstraint(0, 43))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcCfmMaName.setStatus('current')
if mibBuilder.loadTexts: hwPWVcCfmMaName.setDescription('This value indicates the current CFM MA name used.')
hwPWVcCfmMdName = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 60), OctetString().subtype(subtypeSpec=ValueSizeConstraint(0, 43))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcCfmMdName.setStatus('current')
if mibBuilder.loadTexts: hwPWVcCfmMdName.setDescription('This value indicates the current CFM MD name used.')
hwPWVcRawOrTagged = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 61), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("raw", 1), ("tagged", 2), ("rawTagNotConfiged", 3)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcRawOrTagged.setStatus('current')
if mibBuilder.loadTexts: hwPWVcRawOrTagged.setDescription('Specifies whether the raw or tagged is configured.')
hwPWVcInterworkingType = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 62), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("ipInterWorking", 1), ("ipLayer2", 2), ("ipUnknown", 3)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcInterworkingType.setStatus('current')
if mibBuilder.loadTexts: hwPWVcInterworkingType.setDescription('Specifies the interworking type of the VC entry.')
hwPWVcCir = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 63), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcCir.setStatus('current')
if mibBuilder.loadTexts: hwPWVcCir.setDescription('Specifies the committed information rate, based on the VC entry.')
hwPWVcPir = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 64), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcPir.setStatus('current')
if mibBuilder.loadTexts: hwPWVcPir.setDescription('Specifies the peak information rate, based on the VC entry.')
hwPWVcQosProfile = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 65), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 31))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcQosProfile.setStatus('current')
if mibBuilder.loadTexts: hwPWVcQosProfile.setDescription("Specifies the QoS profile's name, based on the VC entry.")
hwPWVcSwitchCir = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 66), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcSwitchCir.setStatus('current')
if mibBuilder.loadTexts: hwPWVcSwitchCir.setDescription('Specifies the committed information rate, based on the switch VC entry.')
hwPWVcSwitchPir = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 67), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcSwitchPir.setStatus('current')
if mibBuilder.loadTexts: hwPWVcSwitchPir.setDescription('Specifies the peak information rate, based on the switch VC entry.')
hwPWVcSwitchQosProfile = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 68), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 31))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcSwitchQosProfile.setStatus('current')
if mibBuilder.loadTexts: hwPWVcSwitchQosProfile.setDescription("Specifies the QoS profile's name, based on the switch VC entry.")
hwPWVcTrigger = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 69), TruthValue()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcTrigger.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTrigger.setDescription('Specifies whether the PW remote interface shutdown or not.')
hwPWVcEnableACOAM = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 70), EnabledStatus()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcEnableACOAM.setStatus('current')
if mibBuilder.loadTexts: hwPWVcEnableACOAM.setDescription('Specifies whether ACOAM detection and notification are all enabled or not.')
hwPWVcSwitchVrIfIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 71), InterfaceIndexOrZero()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcSwitchVrIfIndex.setStatus('current')
if mibBuilder.loadTexts: hwPWVcSwitchVrIfIndex.setDescription('Denotes the VRRP interface the switch PW binding to.')
hwPWVcSwitchVrID = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 72), Unsigned32().subtype(subtypeSpec=ValueRangeConstraint(0, 255))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWVcSwitchVrID.setStatus('current')
if mibBuilder.loadTexts: hwPWVcSwitchVrID.setDescription('Denotes the VrID the switch PW binding to.')
hwPWVcQosParaFromPWT = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 73), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("cliOrMib", 1), ("pwTemplate", 2), ("unknown", 3)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcQosParaFromPWT.setStatus('current')
if mibBuilder.loadTexts: hwPWVcQosParaFromPWT.setDescription('This object indicates the configuration of the Qos parameters managed through command line or PW template.')
hwPWVcBfdParaFromPWT = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 74), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("cliOrMib", 1), ("pwTemplate", 2), ("unknown", 3)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcBfdParaFromPWT.setStatus('current')
if mibBuilder.loadTexts: hwPWVcBfdParaFromPWT.setDescription('This object indicates the configuration of the Bfd parameters managed through command line or PW template.')
hwPwVcNegotiateMode = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 75), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4))).clone(namedValues=NamedValues(("slaveOrMaster", 1), ("independent", 2), ("unknown", 3), ("frr", 4)))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPwVcNegotiateMode.setStatus('current')
if mibBuilder.loadTexts: hwPwVcNegotiateMode.setDescription('This object indicates the negotiation mode of the PW on the local node.')
hwPwVcIsBypass = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 76), TruthValue()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPwVcIsBypass.setStatus('current')
if mibBuilder.loadTexts: hwPwVcIsBypass.setDescription('This object indicates whether the PW is the bypass PW.')
hwPwVcIsAdmin = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 77), TruthValue()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPwVcIsAdmin.setStatus('current')
if mibBuilder.loadTexts: hwPwVcIsAdmin.setDescription('This object indicates whether the PW is the administrator PW.')
hwPwVcAdminPwIfIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 78), InterfaceIndexOrZero()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPwVcAdminPwIfIndex.setStatus('current')
if mibBuilder.loadTexts: hwPwVcAdminPwIfIndex.setDescription('This object indicates the index of the interface on which the administrator PW resides after it is being tracked by the service PW.')
hwPwVcAdminPwLinkStatus = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 79), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("up", 1), ("down", 2), ("unknown", 3)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPwVcAdminPwLinkStatus.setStatus('current')
if mibBuilder.loadTexts: hwPwVcAdminPwLinkStatus.setDescription('This object indicates the status of the administrator PW after it is being tracked by the service PW.')
hwPwVcSwitchAdminPwIfIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 80), InterfaceIndexOrZero()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPwVcSwitchAdminPwIfIndex.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchAdminPwIfIndex.setDescription('This object indicates the index of the interface on which the administrator PW resides after it is being tracked by the switch PW.')
hwPwVcSwitchAdminPwLinkStatus = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 81), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("up", 1), ("down", 2), ("unknown", 3)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPwVcSwitchAdminPwLinkStatus.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchAdminPwLinkStatus.setDescription('This object indicates the status of the administrator PW after it is being tracked by the switch PW.')
hwPwVcSwitchBackupAdminPwIfIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 82), InterfaceIndexOrZero()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPwVcSwitchBackupAdminPwIfIndex.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchBackupAdminPwIfIndex.setDescription('This object indicates the index of the interface on which the administrator PW resides after it is being tracked by the switch backup PW.')
hwPwVcSwitchBackupAdminPwLinkStatus = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 83), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("up", 1), ("down", 2), ("unknown", 3)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPwVcSwitchBackupAdminPwLinkStatus.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchBackupAdminPwLinkStatus.setDescription('This object indicates the status of the administrator PW after it is being tracked by the switch backup PW.')
hwPwVcSwitchBackupVcId = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 84), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcId.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcId.setDescription('This object indicates the VC ID of the switch backup PW.')
hwPwVcSwitchBackupVcPeerAddrType = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 85), InetAddressType()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcPeerAddrType.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcPeerAddrType.setDescription('This object indicates type of the IP address of the peer on the switch backup PW. Currently, only IPv4 addresss are supported.')
hwPwVcSwitchBackupVcPeerAddr = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 86), IpAddress()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcPeerAddr.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcPeerAddr.setDescription('This object indicates the IP address of the peer on the switch backup PW.')
hwPwVcSwitchBackupVcReceiveLabel = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 87), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcReceiveLabel.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcReceiveLabel.setDescription('This object indicates the inbound label of the switch backup VC. For a static VC, the value of the inbound label ranges from 16 to 1023. For a dynamic VC, the inbound label is automatically generated by the system.')
hwPwVcSwitchBackupVcSendLabel = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 88), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcSendLabel.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcSendLabel.setDescription('This object indicates the outbound label of the switch backup VC. For a static VC, the value of the outbound label ranges from 0 to 1048575. For a dynamic VC, the outbound label is automatically generated by the system.')
hwPwVcSwitchBackupVcTnlPolicyName = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 89), OctetString().subtype(subtypeSpec=ValueSizeConstraint(0, 19))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcTnlPolicyName.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcTnlPolicyName.setDescription('This object indicates the name of the tunnel policy of the switch backup VC.')
hwPwVcSwitchBackupVcCir = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 90), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcCir.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcCir.setDescription('This object indicates the CIR of the switch backup VC.')
hwPwVcSwitchBackupVcPir = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 91), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcPir.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcPir.setDescription('This object indicates the PIR of the switch backup VC.')
hwPwVcSwitchBackupVcQosProfile = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 92), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 31))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcQosProfile.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcQosProfile.setDescription('This object indicates the name of the QoS profile of the switch backup VC.')
hwPwVcSlaveMasterMode = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 93), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4))).clone(namedValues=NamedValues(("slave", 1), ("master", 2), ("unknown", 3), ("bypass", 4)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPwVcSlaveMasterMode.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSlaveMasterMode.setDescription('This object indicates whether the status of the VC is master or slave.')
hwPwVcSwitchVcSlaveMasterMode = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 94), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("slave", 1), ("master", 2), ("unknown", 3)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPwVcSwitchVcSlaveMasterMode.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchVcSlaveMasterMode.setDescription('This object indicates whether the status of the switch VC is master or slave.')
hwPwVcSwitchBackupVcSlaveMasterMode = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 95), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("slave", 1), ("master", 2), ("unknown", 3)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcSlaveMasterMode.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcSlaveMasterMode.setDescription('This object indicates whether the status of the switch backup VC is master or slave.')
hwPwVcSwitchVcActive = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 96), TruthValue()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPwVcSwitchVcActive.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchVcActive.setDescription('This object indicates whether the status of the switch VC is active or not.')
hwPwVcSwitchBackupVcActive = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 97), TruthValue()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcActive.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcActive.setDescription('This object indicates whether the status of the switch backup VC is active or not.')
hwPwVcSwitchCwTrans = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 98), TruthValue()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPwVcSwitchCwTrans.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchCwTrans.setDescription('This object indicates whether the SPE support Control Word Transparent or not,default is false.')
hwPwVcSwitchVcServiceName = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 99), OctetString().subtype(subtypeSpec=ValueSizeConstraint(0, 100))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPwVcSwitchVcServiceName.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchVcServiceName.setDescription('This object indicates the service name of the switch VC.')
hwPwVcSwitchBackupVcServiceName = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 1, 1, 100), OctetString().subtype(subtypeSpec=ValueSizeConstraint(0, 100))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcServiceName.setStatus('current')
if mibBuilder.loadTexts: hwPwVcSwitchBackupVcServiceName.setDescription('This object indicates the service name of the switch backup VC.')
hwPWVcTnlTable = MibTable((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 2), )
if mibBuilder.loadTexts: hwPWVcTnlTable.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTnlTable.setDescription('This table is used to search the tunnel index of a VC.')
hwPWVcTnlEntry = MibTableRow((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 2, 1), ).setIndexNames((0, "HUAWEI-PWE3-MIB", "hwPWVcID"), (0, "HUAWEI-PWE3-MIB", "hwPWVcType"), (0, "HUAWEI-PWE3-MIB", "hwPWVcTnlIndex"))
if mibBuilder.loadTexts: hwPWVcTnlEntry.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTnlEntry.setDescription('Provides the information of a VC tunnel entry.')
hwPWVcTnlIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 2, 1, 1), Unsigned32())
if mibBuilder.loadTexts: hwPWVcTnlIndex.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTnlIndex.setDescription('This object indicates the tunnel index of the VC.')
hwPWVcTnlType = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 2, 1, 2), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4))).clone(namedValues=NamedValues(("lsp", 1), ("gre", 2), ("ipsec", 3), ("crLsp", 4)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcTnlType.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTnlType.setDescription('This object indicates the tunnel type.')
hwPWTnlForBfdIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 2, 1, 3), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWTnlForBfdIndex.setStatus('current')
if mibBuilder.loadTexts: hwPWTnlForBfdIndex.setDescription('This object indicates the index of LSP for BFD.')
hwPWVcStatisticsTable = MibTable((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 3), )
if mibBuilder.loadTexts: hwPWVcStatisticsTable.setStatus('current')
if mibBuilder.loadTexts: hwPWVcStatisticsTable.setDescription("This table contains the Pwe3's VC packets statistics.")
hwPWVcStatisticsEntry = MibTableRow((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 3, 1), ).setIndexNames((0, "HUAWEI-PWE3-MIB", "hwPWVcID"), (0, "HUAWEI-PWE3-MIB", "hwPWVcType"))
if mibBuilder.loadTexts: hwPWVcStatisticsEntry.setStatus('current')
if mibBuilder.loadTexts: hwPWVcStatisticsEntry.setDescription("Provides the information of the Pwe3's VC packets statistics.")
hwPWVcStatisticsRcvPkts = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 3, 1, 1), Counter64()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcStatisticsRcvPkts.setStatus('current')
if mibBuilder.loadTexts: hwPWVcStatisticsRcvPkts.setDescription('The total number of packets received on this VC.')
hwPWVcStatisticsRcvBytes = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 3, 1, 2), Counter64()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcStatisticsRcvBytes.setStatus('current')
if mibBuilder.loadTexts: hwPWVcStatisticsRcvBytes.setDescription('The total number of bytes received on this VC.')
hwPWVcStatisticsSndPkts = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 3, 1, 3), Counter64()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcStatisticsSndPkts.setStatus('current')
if mibBuilder.loadTexts: hwPWVcStatisticsSndPkts.setDescription('The total number of packets sent on this VC.')
hwPWVcStatisticsSndBytes = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 3, 1, 4), Counter64()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcStatisticsSndBytes.setStatus('current')
if mibBuilder.loadTexts: hwPWVcStatisticsSndBytes.setDescription('The total number of bytes sent on the VC.')
hwPWRemoteVcTable = MibTable((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 4), )
if mibBuilder.loadTexts: hwPWRemoteVcTable.setStatus('current')
if mibBuilder.loadTexts: hwPWRemoteVcTable.setDescription('This table provides remote PW information for each local PW.')
hwPWRemoteVcEntry = MibTableRow((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 4, 1), ).setIndexNames((0, "HUAWEI-PWE3-MIB", "hwPWVcID"), (0, "HUAWEI-PWE3-MIB", "hwPWVcType"))
if mibBuilder.loadTexts: hwPWRemoteVcEntry.setStatus('current')
if mibBuilder.loadTexts: hwPWRemoteVcEntry.setDescription('An entry in this table is created by the agent for every PW.')
hwPWRemoteVcID = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 4, 1, 1), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWRemoteVcID.setStatus('current')
if mibBuilder.loadTexts: hwPWRemoteVcID.setDescription("Used in the outgoing PW ID field within the 'Virtual Circuit FEC Element' of the remote PW.")
hwPWRemoteVcType = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 4, 1, 2), HWL2VpnVcEncapsType()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWRemoteVcType.setStatus('current')
if mibBuilder.loadTexts: hwPWRemoteVcType.setDescription('This value indicate the service to be carried over the remote PW.')
hwPWRemoteVcStatus = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 4, 1, 3), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("up", 1), ("down", 2), ("plugout", 3)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWRemoteVcStatus.setStatus('current')
if mibBuilder.loadTexts: hwPWRemoteVcStatus.setDescription('Indicates the forwarding status of the remote VC.')
hwPWRemoteVcGroupID = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 4, 1, 4), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWRemoteVcGroupID.setStatus('current')
if mibBuilder.loadTexts: hwPWRemoteVcGroupID.setDescription('Indicates the Group ID field of the remote PW. Currently, this value always be zero.')
hwPWRemoteVcMtu = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 4, 1, 5), Unsigned32().subtype(subtypeSpec=ConstraintsUnion(ValueRangeConstraint(0, 0), ValueRangeConstraint(46, 9600), ))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWRemoteVcMtu.setStatus('current')
if mibBuilder.loadTexts: hwPWRemoteVcMtu.setDescription('Indicates the supported MTU size of the remote PW.')
hwPWRemoteVcCtrlword = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 4, 1, 6), HWEnableValue()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWRemoteVcCtrlword.setStatus('current')
if mibBuilder.loadTexts: hwPWRemoteVcCtrlword.setDescription('Indicates the control word capability of the remote PW.')
hwPWRemoteVcMaxAtmCells = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 4, 1, 7), Unsigned32().subtype(subtypeSpec=ValueRangeConstraint(0, 65535))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWRemoteVcMaxAtmCells.setStatus('current')
if mibBuilder.loadTexts: hwPWRemoteVcMaxAtmCells.setDescription('Indicates the max cell supported of the remote PW when vctype is atm.')
hwPWRemoteVcNotif = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 4, 1, 8), TruthValue()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWRemoteVcNotif.setStatus('current')
if mibBuilder.loadTexts: hwPWRemoteVcNotif.setDescription('Indicates notification is supported by the remote PW.')
hwPWVcSwitchNotifEnable = MibScalar((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 5), HWEnableValue()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: hwPWVcSwitchNotifEnable.setStatus('current')
if mibBuilder.loadTexts: hwPWVcSwitchNotifEnable.setDescription('If this object is set to enable(1), then it enables the emission of hwPWVcSwitchWtoP and hwPWVcSwitchPtoW notifications; otherwise these notifications are not emitted. The default value is disable (2).')
hwPWVcUpDownNotifEnable = MibScalar((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 6), HWEnableValue()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: hwPWVcUpDownNotifEnable.setStatus('current')
if mibBuilder.loadTexts: hwPWVcUpDownNotifEnable.setDescription('This object indicates the enable sign of PW VC state change notification. The default value is disable (2).')
hwPWVcDeletedNotifEnable = MibScalar((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 7), HWEnableValue()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: hwPWVcDeletedNotifEnable.setStatus('current')
if mibBuilder.loadTexts: hwPWVcDeletedNotifEnable.setDescription('This object indicates the enable sign of PW VC deletion notification. The default value is disable (2).')
hwPWVcStateChangeReason = MibScalar((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 8), HWL2VpnStateChangeReason()).setMaxAccess("accessiblefornotify")
if mibBuilder.loadTexts: hwPWVcStateChangeReason.setStatus('current')
if mibBuilder.loadTexts: hwPWVcStateChangeReason.setDescription('This object indicates the reason of PE VC state change.')
hwPWVcSwitchRmtID = MibScalar((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 9), Unsigned32()).setMaxAccess("accessiblefornotify")
if mibBuilder.loadTexts: hwPWVcSwitchRmtID.setStatus('current')
if mibBuilder.loadTexts: hwPWVcSwitchRmtID.setDescription('This object indicates the VC ID of PW switch between working PW and protect PW .')
hwLdpPWStateChangeReason = MibScalar((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 10), HWLdpPwStateChangeReason()).setMaxAccess("accessiblefornotify")
if mibBuilder.loadTexts: hwLdpPWStateChangeReason.setStatus('current')
if mibBuilder.loadTexts: hwLdpPWStateChangeReason.setDescription("This object indicates the reason of LDP PW VC's state change.")
hwPWVcTDMPerfCurrentTable = MibTable((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 11), )
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentTable.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentTable.setDescription('This table provides per TDM PW performance information. The contents of this table entry are reset to zero and gotten new information every 15 minutes.')
hwPWVcTDMPerfCurrentEntry = MibTableRow((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 11, 1), ).setIndexNames((0, "HUAWEI-PWE3-MIB", "hwPWVcID"), (0, "HUAWEI-PWE3-MIB", "hwPWVcType"))
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentEntry.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentEntry.setDescription('An entry in this table is created by the agent for every TDM PW entry.')
hwPWVcTDMPerfCurrentMissingPkts = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 11, 1, 1), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentMissingPkts.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentMissingPkts.setDescription('Number of missing packets (as detected via control word sequence number gaps).')
hwPWVcTDMPerfCurrentJtrBfrOverruns = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 11, 1, 2), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentJtrBfrOverruns.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentJtrBfrOverruns.setDescription('Number of times the jitter buffer was overrun.')
hwPWVcTDMPerfCurrentJtrBfrUnderruns = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 11, 1, 3), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentJtrBfrUnderruns.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentJtrBfrUnderruns.setDescription('Number of times a packet needed to be played out and the jitter buffer was empty.')
hwPWVcTDMPerfCurrentMisOrderDropped = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 11, 1, 4), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentMisOrderDropped.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentMisOrderDropped.setDescription('Number of packets detected out of order (via control word sequence numbers) that could not be re-ordered or could not fit in the jitter buffer.')
hwPWVcTDMPerfCurrentMalformedPkt = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 11, 1, 5), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentMalformedPkt.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentMalformedPkt.setDescription("Number of packets detected with unexpected size or bad headers' stack.")
hwPWVcTDMPerfCurrentESs = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 11, 1, 6), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentESs.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentESs.setDescription('The counter associated with the number of Error Seconds encountered. Any malformed packet, sequence error, LOPS, and the like are considered as Error Seconds.')
hwPWVcTDMPerfCurrentSESs = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 11, 1, 7), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentSESs.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentSESs.setDescription('The counter associated with the number of Severely Error Seconds encountered.')
hwPWVcTDMPerfCurrentUASs = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 1, 11, 1, 8), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentUASs.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentUASs.setDescription('The counter associated with the number of Unavailable Seconds encountered. Any consecutive ten seconds of SES are counted as one Unavailable Seconds (UAS).')
hwPwe3MIBTraps = MibIdentifier((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 2))
hwPWVcSwitchWtoP = NotificationType((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 2, 1)).setObjects(("HUAWEI-PWE3-MIB", "hwPWVcCtrlWord"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchRmtID"), ("HUAWEI-PWE3-MIB", "hwPWVcStateChangeReason"), ("HUAWEI-PWE3-MIB", "hwPWVcIfName"))
if mibBuilder.loadTexts: hwPWVcSwitchWtoP.setStatus('current')
if mibBuilder.loadTexts: hwPWVcSwitchWtoP.setDescription('This notification is generated when switch from working PW to protect PW happens.')
hwPWVcSwitchPtoW = NotificationType((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 2, 2)).setObjects(("HUAWEI-PWE3-MIB", "hwPWVcCtrlWord"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchRmtID"), ("HUAWEI-PWE3-MIB", "hwPWVcStateChangeReason"), ("HUAWEI-PWE3-MIB", "hwPWVcIfName"))
if mibBuilder.loadTexts: hwPWVcSwitchPtoW.setStatus('current')
if mibBuilder.loadTexts: hwPWVcSwitchPtoW.setDescription('This notification is generated when switch from protect PW to working PW happens.')
hwPWVcDown = NotificationType((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 2, 3)).setObjects(("HUAWEI-PWE3-MIB", "hwPWVcPeerAddr"), ("HUAWEI-PWE3-MIB", "hwPWVcIfIndex"), ("HUAWEI-PWE3-MIB", "hwPWVcInboundLabel"), ("HUAWEI-PWE3-MIB", "hwPWVcOutboundLabel"), ("HUAWEI-PWE3-MIB", "hwPWVcSecondary"), ("HUAWEI-PWE3-MIB", "hwPWVcStateChangeReason"), ("SNMPv2-MIB", "sysUpTime"), ("HUAWEI-PWE3-MIB", "hwPWVcIfName"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchID"), ("HUAWEI-PWE3-MIB", "hwPWVcTnlPolicyName"))
if mibBuilder.loadTexts: hwPWVcDown.setStatus('current')
if mibBuilder.loadTexts: hwPWVcDown.setDescription("This notification indicates the VC's state changes to down.")
hwPWVcUp = NotificationType((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 2, 4)).setObjects(("HUAWEI-PWE3-MIB", "hwPWVcPeerAddr"), ("HUAWEI-PWE3-MIB", "hwPWVcIfIndex"), ("HUAWEI-PWE3-MIB", "hwPWVcInboundLabel"), ("HUAWEI-PWE3-MIB", "hwPWVcOutboundLabel"), ("HUAWEI-PWE3-MIB", "hwPWVcSecondary"), ("HUAWEI-PWE3-MIB", "hwPWVcStateChangeReason"), ("SNMPv2-MIB", "sysUpTime"), ("HUAWEI-PWE3-MIB", "hwPWVcIfName"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchID"), ("HUAWEI-PWE3-MIB", "hwPWVcTnlPolicyName"))
if mibBuilder.loadTexts: hwPWVcUp.setStatus('current')
if mibBuilder.loadTexts: hwPWVcUp.setDescription("This notification indicates the VC's state changes to up.")
hwPWVcDeleted = NotificationType((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 2, 5)).setObjects(("HUAWEI-PWE3-MIB", "hwPWVcPeerAddr"), ("HUAWEI-PWE3-MIB", "hwPWVcIfIndex"), ("HUAWEI-PWE3-MIB", "hwPWVcInboundLabel"), ("HUAWEI-PWE3-MIB", "hwPWVcOutboundLabel"), ("HUAWEI-PWE3-MIB", "hwPWVcSecondary"), ("HUAWEI-PWE3-MIB", "hwPWVcIfName"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchID"))
if mibBuilder.loadTexts: hwPWVcDeleted.setStatus('current')
if mibBuilder.loadTexts: hwPWVcDeleted.setDescription('This notification indicates the VC is deleted.')
hwPWVcBackup = NotificationType((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 2, 6)).setObjects(("HUAWEI-PWE3-MIB", "hwPWVcPeerAddr"), ("HUAWEI-PWE3-MIB", "hwPWVcIfIndex"), ("HUAWEI-PWE3-MIB", "hwPWVcInboundLabel"), ("HUAWEI-PWE3-MIB", "hwPWVcOutboundLabel"), ("HUAWEI-PWE3-MIB", "hwPWVcSecondary"), ("HUAWEI-PWE3-MIB", "hwPWVcStateChangeReason"), ("SNMPv2-MIB", "sysUpTime"), ("HUAWEI-PWE3-MIB", "hwPWVcIfName"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchID"))
if mibBuilder.loadTexts: hwPWVcBackup.setStatus('current')
if mibBuilder.loadTexts: hwPWVcBackup.setDescription("This notification indicates the VC's state changes to backup.")
hwLdpPWVcDown = NotificationType((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 2, 7)).setObjects(("HUAWEI-PWE3-MIB", "hwPWVcPeerAddr"), ("HUAWEI-PWE3-MIB", "hwLdpPWStateChangeReason"))
if mibBuilder.loadTexts: hwLdpPWVcDown.setStatus('current')
if mibBuilder.loadTexts: hwLdpPWVcDown.setDescription("This notification indicates the LDP PW VC's state changes to down.")
hwLdpPWVcUp = NotificationType((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 2, 8)).setObjects(("HUAWEI-PWE3-MIB", "hwPWVcPeerAddr"), ("HUAWEI-PWE3-MIB", "hwLdpPWStateChangeReason"))
if mibBuilder.loadTexts: hwLdpPWVcUp.setStatus('current')
if mibBuilder.loadTexts: hwLdpPWVcUp.setDescription("This notification indicates the Ldp PW VC's state changes to up.")
hwSvcObjects = MibIdentifier((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3))
hwSvcTable = MibTable((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1), )
if mibBuilder.loadTexts: hwSvcTable.setStatus('current')
if mibBuilder.loadTexts: hwSvcTable.setDescription('This table is the SVC configuration table. Users can create or delete a SVC by it.')
hwSvcEntry = MibTableRow((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1), ).setIndexNames((0, "HUAWEI-PWE3-MIB", "hwSvcIfIndex"))
if mibBuilder.loadTexts: hwSvcEntry.setStatus('current')
if mibBuilder.loadTexts: hwSvcEntry.setDescription('Provides the information of a SVC entry.')
hwSvcIfIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 1), InterfaceIndexOrZero())
if mibBuilder.loadTexts: hwSvcIfIndex.setStatus('current')
if mibBuilder.loadTexts: hwSvcIfIndex.setDescription('Index of the interface (or the virtual interface) associated with the PW.')
hwSvcID = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 2), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcID.setStatus('current')
if mibBuilder.loadTexts: hwSvcID.setDescription("Index for the conceptual row identifying a PW within this PW Emulation table.Used in the outgoing PW ID field within the 'Virtual Circuit FEC Element'.")
hwSvcType = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 3), HWL2VpnVcEncapsType()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcType.setStatus('current')
if mibBuilder.loadTexts: hwSvcType.setDescription('Index for the conceptual row identifying a PW within this PW Emulation table.This value indicate the service to be carried over this PW.')
hwSvcPeerAddrType = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 4), InetAddressType().clone('ipv4')).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcPeerAddrType.setStatus('current')
if mibBuilder.loadTexts: hwSvcPeerAddrType.setDescription("Denotes the address type of the peer node. It should be set to 'unknown' if PE/PW maintenance protocol is not used and the address is unknown. Currently, support 'ipv4' only.")
hwSvcPeerAddr = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 5), IpAddress()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcPeerAddr.setStatus('current')
if mibBuilder.loadTexts: hwSvcPeerAddr.setDescription("This object contain the value of the peer node address of the PW/PE maintenance protocol entity. This object SHOULD contain a value of all zeroes if not applicable (hwSvcPeerAddrType is 'unknown').")
hwSvcStatus = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 6), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("up", 1), ("down", 2), ("plugout", 3)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcStatus.setStatus('current')
if mibBuilder.loadTexts: hwSvcStatus.setDescription("Indicates the status of the PW in the local node. Currently, can't support 'plugout'.")
hwSvcInboundLabel = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 7), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcInboundLabel.setStatus('current')
if mibBuilder.loadTexts: hwSvcInboundLabel.setDescription('This object indicates the inbound label.')
hwSvcOutboundLabel = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 8), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcOutboundLabel.setStatus('current')
if mibBuilder.loadTexts: hwSvcOutboundLabel.setDescription('This object indicates the outbound label.')
hwSvcGroupID = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 9), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcGroupID.setStatus('current')
if mibBuilder.loadTexts: hwSvcGroupID.setDescription("Used in the Group ID field sent to the peer PWES within the maintenance protocol used for PW setup. Applicable if SvcOwner equal 'pwIdFecSignaling' or 'l2tpControlProtocol', should be set to zero otherwise. Currently, this value always be zero.")
hwSvcAcStatus = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 10), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("up", 1), ("down", 2), ("plugout", 3)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcAcStatus.setStatus('current')
if mibBuilder.loadTexts: hwSvcAcStatus.setDescription("Local AC status. Currently, can't support 'plugout'.")
hwSvcACOAMStatus = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 11), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2))).clone(namedValues=NamedValues(("up", 1), ("down", 2)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcACOAMStatus.setStatus('current')
if mibBuilder.loadTexts: hwSvcACOAMStatus.setDescription("Denotes the AC's protocol is operational or not.")
hwSvcMtu = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 12), Integer32().subtype(subtypeSpec=ConstraintsUnion(ValueRangeConstraint(0, 0), ValueRangeConstraint(46, 9600), ))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcMtu.setStatus('current')
if mibBuilder.loadTexts: hwSvcMtu.setDescription("If not equal zero, the optional Mtu object in the signaling protocol will be sent with this value, representing the locally supported MTU size over the interface (or the virtual interface) associated with the PW.Currently, can't support.'0' is the default value.")
hwSvcCtrlWord = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 13), HWEnableValue()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcCtrlWord.setStatus('current')
if mibBuilder.loadTexts: hwSvcCtrlWord.setDescription('If signaling is used for PW establishment, this object indicates the status of the control word negotiation, and in both signaling or manual configuration indicates if CW is to be present or not for this PW.')
hwSvcVCCV = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 14), Bits().clone(namedValues=NamedValues(("ccCw", 0), ("ccAlert", 1), ("ccLabel", 2), ("cvIcmpping", 3), ("cvLspping", 4), ("cvBfd", 5)))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcVCCV.setStatus('current')
if mibBuilder.loadTexts: hwSvcVCCV.setDescription('Indicates the optional VCCV capabilities of the SVC. According to whether the control word is enabled, the value can be ccCw(0)|ccAlert(1)|cvLspping(4)|cvBfd(5) or ccAlert(1)|cvLspping(4)|cvBfd(5). The default value is ccAlert(1)|cvLspping(4)|cvBfd(5).')
hwSvcBandWidth = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 15), Unsigned32().subtype(subtypeSpec=ValueRangeConstraint(0, 32000000))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcBandWidth.setStatus('current')
if mibBuilder.loadTexts: hwSvcBandWidth.setDescription("This object indicates the bandwidth.Currently, can't support.'0' is the default value.")
hwSvcMaxAtmCells = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 16), Unsigned32().subtype(subtypeSpec=ValueRangeConstraint(0, 28))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcMaxAtmCells.setStatus('current')
if mibBuilder.loadTexts: hwSvcMaxAtmCells.setDescription('Indicates the max cell supported when vc type is atm.')
hwSvcTnlPolicyName = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 17), OctetString().subtype(subtypeSpec=ValueSizeConstraint(0, 39))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcTnlPolicyName.setStatus('current')
if mibBuilder.loadTexts: hwSvcTnlPolicyName.setDescription('Indicates the tunnel policy name used.')
hwSvcQoSBehaviorIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 18), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcQoSBehaviorIndex.setStatus('current')
if mibBuilder.loadTexts: hwSvcQoSBehaviorIndex.setDescription("Indicates the traffic behavior Index when QOS is implemented. Currently, can't support.'0' is the default value.")
hwSvcPWTemplateName = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 19), OctetString().subtype(subtypeSpec=ValueSizeConstraint(0, 19))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcPWTemplateName.setStatus('current')
if mibBuilder.loadTexts: hwSvcPWTemplateName.setDescription('Indicates the PW template index referenced.')
hwSvcUpTime = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 20), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcUpTime.setStatus('current')
if mibBuilder.loadTexts: hwSvcUpTime.setDescription('Indicates the duration when the SVC keeps Up for the last time, in seconds.')
hwSvcOAMSync = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 21), TruthValue()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcOAMSync.setStatus('current')
if mibBuilder.loadTexts: hwSvcOAMSync.setDescription('Denotes the AC and PSN are enable or not.')
hwSvcForBfdIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 22), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcForBfdIndex.setStatus('current')
if mibBuilder.loadTexts: hwSvcForBfdIndex.setDescription("The index of PW for BFD.Currently, can't support.Return the default value is '0'.")
hwSvcSecondary = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 23), TruthValue()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcSecondary.setStatus('current')
if mibBuilder.loadTexts: hwSvcSecondary.setDescription("Indicates whether or not the secondary PW is used.Currently, can't support.Return the default value is 'false'.")
hwSvcDelayTime = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 24), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcDelayTime.setStatus('current')
if mibBuilder.loadTexts: hwSvcDelayTime.setDescription("The reroute delay time.Currently, can't support.Return the default value is '0'.")
hwSvcReroutePolicy = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 25), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5, 6))).clone(namedValues=NamedValues(("delay", 1), ("immediately", 2), ("never", 3), ("none", 4), ("err", 5), ("invalid", 6)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcReroutePolicy.setStatus('current')
if mibBuilder.loadTexts: hwSvcReroutePolicy.setDescription("Reroute policy.Currently, can't support.Return the default value is 'invalid(6)'.")
hwSvcResumeTime = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 26), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcResumeTime.setStatus('current')
if mibBuilder.loadTexts: hwSvcResumeTime.setDescription("The reroute resume time.Currently, can't support.Return the default value is '0'.")
hwSvcRerouteReason = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 27), HWL2VpnStateChangeReason()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcRerouteReason.setStatus('current')
if mibBuilder.loadTexts: hwSvcRerouteReason.setDescription("Last reroute reason.Currently, can't support.Return the default value is 'invalidReason(1)'.")
hwSvcLastRerouteTime = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 28), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcLastRerouteTime.setStatus('current')
if mibBuilder.loadTexts: hwSvcLastRerouteTime.setDescription("Last reroute time.Currently, can't support.Return the default value is '0'.")
hwSvcManualSetFault = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 29), TruthValue()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcManualSetFault.setStatus('current')
if mibBuilder.loadTexts: hwSvcManualSetFault.setDescription("Denotes the manual has been set fault or not.Currently, can't support.Return the default value is 'false'.")
hwSvcActive = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 30), TruthValue()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcActive.setStatus('current')
if mibBuilder.loadTexts: hwSvcActive.setDescription("Denotes the current vc is active or not.Currently, can't support.Return the default value is 'false'.")
hwSvcUpStartTime = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 31), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 63))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcUpStartTime.setStatus('current')
if mibBuilder.loadTexts: hwSvcUpStartTime.setDescription('Specifies the time this PW status was Up(1).')
hwSvcUpSumTime = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 32), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcUpSumTime.setStatus('current')
if mibBuilder.loadTexts: hwSvcUpSumTime.setDescription('Indicates the accumulated time when the SVC is Up, in seconds.')
hwSvcAtmPackOvertime = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 33), Unsigned32().subtype(subtypeSpec=ConstraintsUnion(ValueRangeConstraint(0, 0), ValueRangeConstraint(100, 50000), ))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcAtmPackOvertime.setStatus('current')
if mibBuilder.loadTexts: hwSvcAtmPackOvertime.setDescription('Specifies the AtmPackOvertime.')
hwSvcPwJitterBufferDepth = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 34), Unsigned32().subtype(subtypeSpec=ValueRangeConstraint(0, 64))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcPwJitterBufferDepth.setStatus('current')
if mibBuilder.loadTexts: hwSvcPwJitterBufferDepth.setDescription('Specifies the PwJitterBufferDepth.')
hwSvcPwTdmEncapsulationNum = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 35), Unsigned32().subtype(subtypeSpec=ValueRangeConstraint(0, 40))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcPwTdmEncapsulationNum.setStatus('current')
if mibBuilder.loadTexts: hwSvcPwTdmEncapsulationNum.setDescription('Specifies the PwTdmEncapsulationNum.')
hwSvcPwIdleCode = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 36), Unsigned32().subtype(subtypeSpec=ConstraintsUnion(ValueRangeConstraint(0, 255), ValueRangeConstraint(65535, 65535), ))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcPwIdleCode.setStatus('current')
if mibBuilder.loadTexts: hwSvcPwIdleCode.setDescription('Specifies the PwIdleCode.')
hwSvcPwRtpHeader = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 37), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcPwRtpHeader.setStatus('current')
if mibBuilder.loadTexts: hwSvcPwRtpHeader.setDescription('Specifies the PwRtpHeader.')
hwSvcRawOrTagged = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 38), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("raw", 1), ("tagged", 2), ("rawTagNotConfiged", 3)))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcRawOrTagged.setStatus('current')
if mibBuilder.loadTexts: hwSvcRawOrTagged.setDescription('Specifies whether the VLAN tag of the SVC entry is attached or stripped.')
hwSvcInterworkingType = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 39), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("ipInterWorking", 1), ("ipLayer2", 2), ("ipUnknown", 3)))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcInterworkingType.setStatus('current')
if mibBuilder.loadTexts: hwSvcInterworkingType.setDescription('Specifies the interworking type of the SVC entry.')
hwSvcCir = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 40), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcCir.setStatus('current')
if mibBuilder.loadTexts: hwSvcCir.setDescription('Specifies the committed information rate, based on the SVC entry.')
hwSvcPir = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 41), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcPir.setStatus('current')
if mibBuilder.loadTexts: hwSvcPir.setDescription('Specifies the peak information rate, based on the SVC entry.')
hwSvcQosProfile = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 42), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 31))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcQosProfile.setStatus('current')
if mibBuilder.loadTexts: hwSvcQosProfile.setDescription("Specifies the QoS profile's name, based on the SVC entry.")
hwSvcRowStatus = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 1, 1, 51), RowStatus()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwSvcRowStatus.setStatus('current')
if mibBuilder.loadTexts: hwSvcRowStatus.setDescription("RowStatus for this Table. Restriction: The row must be created by 'createAndGo' handle only. Handle 'createAndWait' is forbidden. Not support modifying configuration.")
hwSvcTnlTable = MibTable((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 2), )
if mibBuilder.loadTexts: hwSvcTnlTable.setStatus('current')
if mibBuilder.loadTexts: hwSvcTnlTable.setDescription('This table is used to search the tunnel index of a SVC.')
hwSvcTnlEntry = MibTableRow((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 2, 1), ).setIndexNames((0, "HUAWEI-PWE3-MIB", "hwSvcIfIndex"), (0, "HUAWEI-PWE3-MIB", "hwSvcTnlIndex"))
if mibBuilder.loadTexts: hwSvcTnlEntry.setStatus('current')
if mibBuilder.loadTexts: hwSvcTnlEntry.setDescription('Provides the information of a SVC tunnel entry.')
hwSvcTnlIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 2, 1, 1), Unsigned32())
if mibBuilder.loadTexts: hwSvcTnlIndex.setStatus('current')
if mibBuilder.loadTexts: hwSvcTnlIndex.setDescription('This object indicates the tunnel index of the SVC.')
hwSvcTnlType = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 2, 1, 2), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4))).clone(namedValues=NamedValues(("lsp", 1), ("gre", 2), ("ipsec", 3), ("crLsp", 4)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcTnlType.setStatus('current')
if mibBuilder.loadTexts: hwSvcTnlType.setDescription('This object indicates the tunnel type.')
hwSvcTnlForBfdIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 2, 1, 3), Unsigned32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcTnlForBfdIndex.setStatus('current')
if mibBuilder.loadTexts: hwSvcTnlForBfdIndex.setDescription("This object indicates the index of LSP for BFD. Currently, can't support.Return the default value is '0'.")
hwSvcStatisticsTable = MibTable((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 3), )
if mibBuilder.loadTexts: hwSvcStatisticsTable.setStatus('current')
if mibBuilder.loadTexts: hwSvcStatisticsTable.setDescription("This table contains the L2vpn's SVC packets statistics.")
hwSvcStatisticsEntry = MibTableRow((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 3, 1), ).setIndexNames((0, "HUAWEI-PWE3-MIB", "hwSvcIfIndex"))
if mibBuilder.loadTexts: hwSvcStatisticsEntry.setStatus('current')
if mibBuilder.loadTexts: hwSvcStatisticsEntry.setDescription("Provides the information of the L2VPN's SVC packets Statistics.")
hwSvcStatisticsRcvPkts = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 3, 1, 1), Counter64()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcStatisticsRcvPkts.setStatus('current')
if mibBuilder.loadTexts: hwSvcStatisticsRcvPkts.setDescription('The total number of packets received on this SVC.')
hwSvcStatisticsRcvBytes = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 3, 1, 2), Counter64()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcStatisticsRcvBytes.setStatus('current')
if mibBuilder.loadTexts: hwSvcStatisticsRcvBytes.setDescription('The total number of bytes received on this SVC.')
hwSvcStatisticsSndPkts = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 3, 1, 3), Counter64()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcStatisticsSndPkts.setStatus('current')
if mibBuilder.loadTexts: hwSvcStatisticsSndPkts.setDescription('The total number of packets sent on this SVC.')
hwSvcStatisticsSndBytes = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 3, 1, 4), Counter64()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwSvcStatisticsSndBytes.setStatus('current')
if mibBuilder.loadTexts: hwSvcStatisticsSndBytes.setDescription('The total number of bytes sent on the SVC.')
hwSvcSwitchNotifEnable = MibScalar((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 4), HWEnableValue()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: hwSvcSwitchNotifEnable.setStatus('current')
if mibBuilder.loadTexts: hwSvcSwitchNotifEnable.setDescription("If this object is set to enable(1), then it enables the emission of hwSvcSwitchWtoP and hwSvcSwitchPtoW notifications; otherwise these notifications are not emitted.Currently, can't support. The default value is disable (2).")
hwSvcUpDownNotifEnable = MibScalar((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 5), HWEnableValue()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: hwSvcUpDownNotifEnable.setStatus('current')
if mibBuilder.loadTexts: hwSvcUpDownNotifEnable.setDescription('This object indicates the enable sign of PW VC state change notification. The default value is disable (2).')
hwSvcDeletedNotifEnable = MibScalar((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 6), HWEnableValue()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: hwSvcDeletedNotifEnable.setStatus('current')
if mibBuilder.loadTexts: hwSvcDeletedNotifEnable.setDescription('This object indicates the enable sign of PW VC deletion notification. The default value is disable (2).')
hwSvcStateChangeReason = MibScalar((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 3, 7), HWL2VpnStateChangeReason()).setMaxAccess("accessiblefornotify")
if mibBuilder.loadTexts: hwSvcStateChangeReason.setStatus('current')
if mibBuilder.loadTexts: hwSvcStateChangeReason.setDescription('This object indicates the reason of PE VC state change.')
hwL2vpnSvcMIBTraps = MibIdentifier((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 4))
hwSvcSwitchWtoP = NotificationType((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 4, 1)).setObjects(("HUAWEI-PWE3-MIB", "hwSvcID"), ("HUAWEI-PWE3-MIB", "hwSvcType"), ("HUAWEI-PWE3-MIB", "hwSvcCtrlWord"), ("HUAWEI-PWE3-MIB", "hwSvcStateChangeReason"), ("IF-MIB", "ifName"))
if mibBuilder.loadTexts: hwSvcSwitchWtoP.setStatus('current')
if mibBuilder.loadTexts: hwSvcSwitchWtoP.setDescription("This notification is generated when switch from working PW to protect PW happens.Currently, can't support.")
hwSvcSwitchPtoW = NotificationType((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 4, 2)).setObjects(("HUAWEI-PWE3-MIB", "hwSvcID"), ("HUAWEI-PWE3-MIB", "hwSvcType"), ("HUAWEI-PWE3-MIB", "hwSvcCtrlWord"), ("HUAWEI-PWE3-MIB", "hwSvcStateChangeReason"), ("IF-MIB", "ifName"))
if mibBuilder.loadTexts: hwSvcSwitchPtoW.setStatus('current')
if mibBuilder.loadTexts: hwSvcSwitchPtoW.setDescription("This notification is generated when switch from protect PW to working PW happens.Currently, can't support.")
hwSvcDown = NotificationType((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 4, 3)).setObjects(("HUAWEI-PWE3-MIB", "hwSvcID"), ("HUAWEI-PWE3-MIB", "hwSvcType"), ("HUAWEI-PWE3-MIB", "hwSvcPeerAddr"), ("HUAWEI-PWE3-MIB", "hwSvcInboundLabel"), ("HUAWEI-PWE3-MIB", "hwSvcOutboundLabel"), ("HUAWEI-PWE3-MIB", "hwSvcStateChangeReason"), ("IF-MIB", "ifName"), ("HUAWEI-PWE3-MIB", "hwSvcTnlPolicyName"))
if mibBuilder.loadTexts: hwSvcDown.setStatus('current')
if mibBuilder.loadTexts: hwSvcDown.setDescription("This notification indicates the SVC's state changes to down.")
hwSvcUp = NotificationType((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 4, 4)).setObjects(("HUAWEI-PWE3-MIB", "hwSvcID"), ("HUAWEI-PWE3-MIB", "hwSvcType"), ("HUAWEI-PWE3-MIB", "hwSvcPeerAddr"), ("HUAWEI-PWE3-MIB", "hwSvcInboundLabel"), ("HUAWEI-PWE3-MIB", "hwSvcOutboundLabel"), ("HUAWEI-PWE3-MIB", "hwSvcStateChangeReason"), ("IF-MIB", "ifName"), ("HUAWEI-PWE3-MIB", "hwSvcTnlPolicyName"))
if mibBuilder.loadTexts: hwSvcUp.setStatus('current')
if mibBuilder.loadTexts: hwSvcUp.setDescription("This notification indicates the SVC's state changes to up.")
hwSvcDeleted = NotificationType((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 4, 5)).setObjects(("HUAWEI-PWE3-MIB", "hwSvcID"), ("HUAWEI-PWE3-MIB", "hwSvcType"), ("HUAWEI-PWE3-MIB", "hwSvcPeerAddr"), ("HUAWEI-PWE3-MIB", "hwSvcInboundLabel"), ("HUAWEI-PWE3-MIB", "hwSvcOutboundLabel"))
if mibBuilder.loadTexts: hwSvcDeleted.setStatus('current')
if mibBuilder.loadTexts: hwSvcDeleted.setDescription('This notification indicates the SVC is deleted.')
hwPWTemplateTable = MibTable((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5), )
if mibBuilder.loadTexts: hwPWTemplateTable.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateTable.setDescription('This table specifies information for configuring and status monitoring to PW tempalte.')
hwPWTemplateEntry = MibTableRow((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1), ).setIndexNames((0, "HUAWEI-PWE3-MIB", "hwPWTemplateName"))
if mibBuilder.loadTexts: hwPWTemplateEntry.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateEntry.setDescription('A row in this table represents a pseudo wire (PW) template. It is indexed by hwPWCmdTemplateIndex, which uniquely identifying a singular tempalte.')
hwPWTemplateName = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 1), OctetString().subtype(subtypeSpec=ValueSizeConstraint(0, 19)))
if mibBuilder.loadTexts: hwPWTemplateName.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateName.setDescription("The name of the PW template. Set by the operator to indicate the protocol responsible for establishing this PW. The value 'static' is used in all cases where no maintenance protocol (PW signaling) is used to set-up the PW, i.e. require configuration of entries in the PW tables including PW labels, etc. The value 'ldp' is used in case of signaling with the PWid FEC element with LDP signaling. The value 'rsvp' indicate the use of rsvp control protocol.")
hwPWTemplatePeerAddrType = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 2), InetAddressType().clone('ipv4')).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplatePeerAddrType.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplatePeerAddrType.setDescription("Denotes the address type of the peer node. It should be set to 'unknown' if PE/PW maintenance protocol is not used and the address is unknown. Currently, support 'ipv4' only.")
hwPWTemplatePeerAddr = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 3), IpAddress()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplatePeerAddr.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplatePeerAddr.setDescription('This object contain the value of the peer node address of the PW/PE maintenance protocol entity. ')
hwPWTemplateCtrlword = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 4), HWEnableValue()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplateCtrlword.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateCtrlword.setDescription('Indicates the control word capability of the switch PW.')
hwPWTemplateVCCV = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 5), Bits().clone(namedValues=NamedValues(("ccCw", 0), ("ccAlert", 1), ("ccLabel", 2), ("cvIcmpping", 3), ("cvLspping", 4), ("cvBfd", 5), ("ccTtl", 6)))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplateVCCV.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateVCCV.setDescription('Indicates the optional VCCV capabilities of the PW template. According to whether the control word is enabled, the value can be ccCw(0)|ccAlert(1)|ccTtl(6)|cvLspping(4)|cvBfd(5) or ccAlert(1)|ccTtl(6)|cvLspping(4)|cvBfd(5). The default value is ccAlert(1)|ccTtl(6)|cvLspping(4)|cvBfd(5).')
hwPWTemplateFrag = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 6), TruthValue()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplateFrag.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateFrag.setDescription('Indicates whether or not fragmentaion is supported.')
hwPWTemplateBandwidth = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 7), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 32000000))).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWTemplateBandwidth.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateBandwidth.setDescription("Indicates the bandwitdh when signaling protocol is rsvp. Currently, can't support.'0' is the default value.")
hwPWTemplateTnlPolicyName = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 8), OctetString().subtype(subtypeSpec=ValueSizeConstraint(0, 39))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplateTnlPolicyName.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateTnlPolicyName.setDescription('Indicates the tunnel policy name used.')
hwPWTemplateQoSBehaviorIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 9), Integer32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplateQoSBehaviorIndex.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateQoSBehaviorIndex.setDescription("Indicates the traffic behavior Index when QOS is implemented.Currently, can't support.'0' is the default value.")
hwPWTemplateExplicitPathName = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 10), OctetString().subtype(subtypeSpec=ValueSizeConstraint(0, 31))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplateExplicitPathName.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateExplicitPathName.setDescription("Indicates the explicit path name set by the operator.Currently, can't support.")
hwPWTemplateBFDDetectMultiplier = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 11), Unsigned32().subtype(subtypeSpec=ConstraintsUnion(ValueRangeConstraint(0, 0), ValueRangeConstraint(3, 50), ))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplateBFDDetectMultiplier.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateBFDDetectMultiplier.setDescription('The multiple of detection time.')
hwPWTemplateBFDMinReceiveInterval = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 12), Unsigned32().subtype(subtypeSpec=ConstraintsUnion(ValueRangeConstraint(0, 0), ValueRangeConstraint(3, 1000), ))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplateBFDMinReceiveInterval.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateBFDMinReceiveInterval.setDescription('The interval of bfd messages to be received.')
hwPWTemplateBFDMinTransmitInterval = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 13), Unsigned32().subtype(subtypeSpec=ConstraintsUnion(ValueRangeConstraint(0, 0), ValueRangeConstraint(3, 1000), ))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplateBFDMinTransmitInterval.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateBFDMinTransmitInterval.setDescription('The interval of bfd messages to be sent.')
hwPWTemplateDynamicBFDDetect = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 14), TruthValue()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplateDynamicBFDDetect.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateDynamicBFDDetect.setDescription('This value indicates the capacitability to support dynamic BFD detect.')
hwPWTemplateMaxAtmCells = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 15), Unsigned32().subtype(subtypeSpec=ValueRangeConstraint(0, 28))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplateMaxAtmCells.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateMaxAtmCells.setDescription('Specifies the MaxAtmCells.')
hwPWTemplateAtmPackOvertime = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 16), Unsigned32().subtype(subtypeSpec=ConstraintsUnion(ValueRangeConstraint(0, 0), ValueRangeConstraint(100, 50000), ))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplateAtmPackOvertime.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateAtmPackOvertime.setDescription('Specifies the AtmPackOvertime.')
hwPWTemplatePwJitterBufferDepth = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 17), Unsigned32().subtype(subtypeSpec=ValueRangeConstraint(0, 64))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplatePwJitterBufferDepth.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplatePwJitterBufferDepth.setDescription('Specifies the PwJitterBufferDepth.')
hwPWTemplatePwTdmEncapsulationNum = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 18), Unsigned32().subtype(subtypeSpec=ValueRangeConstraint(0, 40))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplatePwTdmEncapsulationNum.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplatePwTdmEncapsulationNum.setDescription('Specifies the PwTdmEncapsulationNum.')
hwPWTemplatePwIdleCode = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 19), Unsigned32().subtype(subtypeSpec=ConstraintsUnion(ValueRangeConstraint(0, 255), ValueRangeConstraint(65535, 65535), ))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplatePwIdleCode.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplatePwIdleCode.setDescription('Specifies the PwIdleCode.')
hwPWTemplatePwRtpHeader = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 20), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplatePwRtpHeader.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplatePwRtpHeader.setDescription('Specifies the PwRtpHeader.')
hwPWTemplatePwCCSeqEnable = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 21), HWEnableValue()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplatePwCCSeqEnable.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplatePwCCSeqEnable.setDescription('Specifies the CC Sequence is enable or not.')
hwPWTemplateCir = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 22), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplateCir.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateCir.setDescription('Specifies the committed information rate, based on the PW template entry.')
hwPWTemplatePir = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 23), Unsigned32()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplatePir.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplatePir.setDescription('Specifies the peak information rate, based on the PW template entry.')
hwPWTemplateQosProfile = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 24), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 31))).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplateQosProfile.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateQosProfile.setDescription("Specifies the QoS profile's name, based on the PW template entry.")
hwPWTemplateFlowLabel = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 25), EnabledStatus()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplateFlowLabel.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateFlowLabel.setDescription('The value of this object identifies whether the PW FlowLabel is enabled.')
hwPWTemplateRowStatus = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 5, 1, 51), RowStatus()).setMaxAccess("readcreate")
if mibBuilder.loadTexts: hwPWTemplateRowStatus.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateRowStatus.setDescription("RowStatus for this Table. Restriction: The row must be created by 'createAndGo' handle only. Handle 'createAndWait' is forbidden.")
hwPWTemplateMIBTraps = MibIdentifier((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 6))
hwPWTemplateCannotDeleted = NotificationType((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 6, 1)).setObjects(("HUAWEI-PWE3-MIB", "hwPWTemplateName"))
if mibBuilder.loadTexts: hwPWTemplateCannotDeleted.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateCannotDeleted.setDescription('This notification indicates the PWTemplate cannot be deleted.')
hwPWTableObjects = MibIdentifier((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 7))
hwPWTable = MibTable((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 7, 1), )
if mibBuilder.loadTexts: hwPWTable.setStatus('current')
if mibBuilder.loadTexts: hwPWTable.setDescription('This table indicates a PW, that is Static PW or LDP PW')
hwPWEntry = MibTableRow((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 7, 1, 1), ).setIndexNames((0, "HUAWEI-PWE3-MIB", "hwPWId"), (0, "HUAWEI-PWE3-MIB", "hwPWType"), (0, "HUAWEI-PWE3-MIB", "hwPWPeerIp"))
if mibBuilder.loadTexts: hwPWEntry.setStatus('current')
if mibBuilder.loadTexts: hwPWEntry.setDescription('Provides the information of a VC key entry.')
hwPWId = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 7, 1, 1, 1), Unsigned32())
if mibBuilder.loadTexts: hwPWId.setStatus('current')
if mibBuilder.loadTexts: hwPWId.setDescription("Index for the conceptual row identifying a PW within this PW Emulation table.Used in the outgoing PW ID field within the 'Virtual Circuit FEC Element'.")
hwPWType = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 7, 1, 1, 2), HWL2VpnVcEncapsType())
if mibBuilder.loadTexts: hwPWType.setStatus('current')
if mibBuilder.loadTexts: hwPWType.setDescription('Index for the conceptual row identifying a PW within this PW Emulation table.This value indicate the service to be carried over this PW.')
hwPWPeerIp = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 7, 1, 1, 3), IpAddress())
if mibBuilder.loadTexts: hwPWPeerIp.setStatus('current')
if mibBuilder.loadTexts: hwPWPeerIp.setDescription('This object contain the value of the peer node address of the PW/PE maintenance protocol entity. This object SHOULD contain a value of all zeroes if not applicable.')
hwPWInterfaceIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 1, 7, 1, 1, 4), InterfaceIndexOrZero()).setMaxAccess("readonly")
if mibBuilder.loadTexts: hwPWInterfaceIndex.setStatus('current')
if mibBuilder.loadTexts: hwPWInterfaceIndex.setDescription('Index of the interface (or the virtual interface) associated with the PW.')
hwPwe3MIBConformance = MibIdentifier((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3))
hwPwe3MIBCompliances = MibIdentifier((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 1))
hwPwe3MIBCompliance = ModuleCompliance((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 1, 1)).setObjects(("HUAWEI-PWE3-MIB", "hwPWVcGroup"), ("HUAWEI-PWE3-MIB", "hwPWVcTnlGroup"), ("HUAWEI-PWE3-MIB", "hwPWVcStatisticsGroup"), ("HUAWEI-PWE3-MIB", "hwPWRemoteVcGroup"), ("HUAWEI-PWE3-MIB", "hwPWTemplateGroup"), ("HUAWEI-PWE3-MIB", "hwPWNotificationControlGroup"), ("HUAWEI-PWE3-MIB", "hwPWVcStateChangeReasonGroup"), ("HUAWEI-PWE3-MIB", "hwPWVcNotificationGroup"), ("HUAWEI-PWE3-MIB", "hwPWTableGroup"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
hwPwe3MIBCompliance = hwPwe3MIBCompliance.setStatus('current')
if mibBuilder.loadTexts: hwPwe3MIBCompliance.setDescription('The compliance statement for systems supporting the HUAWEI-PWE3-MIB.')
hwPwe3MIBGroups = MibIdentifier((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 2))
hwPWVcGroup = ObjectGroup((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 2, 1)).setObjects(("HUAWEI-PWE3-MIB", "hwPWVcPeerAddrType"), ("HUAWEI-PWE3-MIB", "hwPWVcPeerAddr"), ("HUAWEI-PWE3-MIB", "hwPWVcStatus"), ("HUAWEI-PWE3-MIB", "hwPWVcInboundLabel"), ("HUAWEI-PWE3-MIB", "hwPWVcOutboundLabel"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchSign"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchID"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchPeerAddrType"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchPeerAddr"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchInboundLabel"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchOutboundLabel"), ("HUAWEI-PWE3-MIB", "hwPWVcGroupID"), ("HUAWEI-PWE3-MIB", "hwPWVcIfIndex"), ("HUAWEI-PWE3-MIB", "hwPWVcAcStatus"), ("HUAWEI-PWE3-MIB", "hwPWVcACOAMStatus"), ("HUAWEI-PWE3-MIB", "hwPWVcMtu"), ("HUAWEI-PWE3-MIB", "hwPWVcCtrlWord"), ("HUAWEI-PWE3-MIB", "hwPWVcVCCV"), ("HUAWEI-PWE3-MIB", "hwPWVcBandWidth"), ("HUAWEI-PWE3-MIB", "hwPWVcMaxAtmCells"), ("HUAWEI-PWE3-MIB", "hwPWVcTnlPolicyName"), ("HUAWEI-PWE3-MIB", "hwPWVcQoSBehaviorIndex"), ("HUAWEI-PWE3-MIB", "hwPWVcExplicitPathName"), ("HUAWEI-PWE3-MIB", "hwPWVcTemplateName"), ("HUAWEI-PWE3-MIB", "hwPWVcSecondary"), ("HUAWEI-PWE3-MIB", "hwPWVcUpTime"), ("HUAWEI-PWE3-MIB", "hwPWOAMSync"), ("HUAWEI-PWE3-MIB", "hwPWVCForBfdIndex"), ("HUAWEI-PWE3-MIB", "hwPWVcDelayTime"), ("HUAWEI-PWE3-MIB", "hwPWVcReroutePolicy"), ("HUAWEI-PWE3-MIB", "hwPWVcResumeTime"), ("HUAWEI-PWE3-MIB", "hwPWVcRerouteReason"), ("HUAWEI-PWE3-MIB", "hwPWVcLastRerouteTime"), ("HUAWEI-PWE3-MIB", "hwPWVcManualSetFault"), ("HUAWEI-PWE3-MIB", "hwPWVcActive"), ("HUAWEI-PWE3-MIB", "hwPWVcVrIfIndex"), ("HUAWEI-PWE3-MIB", "hwPWVcVrID"), ("HUAWEI-PWE3-MIB", "hwPWBFDDetectMultiplier"), ("HUAWEI-PWE3-MIB", "hwPWBFDMinReceiveInterval"), ("HUAWEI-PWE3-MIB", "hwPWBFDMinTransmitInterval"), ("HUAWEI-PWE3-MIB", "hwPWDynamicBFDDetect"), ("HUAWEI-PWE3-MIB", "hwPWBFDRemoteVcID"), ("HUAWEI-PWE3-MIB", "hwPWEthOamType"), ("HUAWEI-PWE3-MIB", "hwPWCfmMaIndex"), ("HUAWEI-PWE3-MIB", "hwPWVcUpStartTime"), ("HUAWEI-PWE3-MIB", "hwPWVcUpSumTime"), ("HUAWEI-PWE3-MIB", "hwPWVcIfName"), ("HUAWEI-PWE3-MIB", "hwPWVcRowStatus"), ("HUAWEI-PWE3-MIB", "hwPWVcAtmPackOvertime"), ("HUAWEI-PWE3-MIB", "hwPWVcPwJitterBufferDepth"), ("HUAWEI-PWE3-MIB", "hwPWVcPwTdmEncapsulationNum"), ("HUAWEI-PWE3-MIB", "hwPWVcPwIdleCode"), ("HUAWEI-PWE3-MIB", "hwPWVcPwRtpHeader"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchTnlPolicyName"), ("HUAWEI-PWE3-MIB", "hwPWVcCfmMdIndex"), ("HUAWEI-PWE3-MIB", "hwPWVcCfmMaName"), ("HUAWEI-PWE3-MIB", "hwPWVcCfmMdName"), ("HUAWEI-PWE3-MIB", "hwPWVcRawOrTagged"), ("HUAWEI-PWE3-MIB", "hwPWVcInterworkingType"), ("HUAWEI-PWE3-MIB", "hwPWVcCir"), ("HUAWEI-PWE3-MIB", "hwPWVcPir"), ("HUAWEI-PWE3-MIB", "hwPWVcQosProfile"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchCir"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchPir"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchQosProfile"), ("HUAWEI-PWE3-MIB", "hwPWVcTrigger"), ("HUAWEI-PWE3-MIB", "hwPWVcEnableACOAM"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchVrIfIndex"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchVrID"), ("HUAWEI-PWE3-MIB", "hwPWVcQosParaFromPWT"), ("HUAWEI-PWE3-MIB", "hwPWVcBfdParaFromPWT"), ("HUAWEI-PWE3-MIB", "hwPwVcNegotiateMode"), ("HUAWEI-PWE3-MIB", "hwPwVcIsBypass"), ("HUAWEI-PWE3-MIB", "hwPwVcIsAdmin"), ("HUAWEI-PWE3-MIB", "hwPwVcAdminPwIfIndex"), ("HUAWEI-PWE3-MIB", "hwPwVcAdminPwLinkStatus"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchAdminPwIfIndex"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchAdminPwLinkStatus"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchBackupAdminPwIfIndex"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchBackupAdminPwLinkStatus"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchBackupVcId"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchBackupVcPeerAddrType"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchBackupVcPeerAddr"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchBackupVcReceiveLabel"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchBackupVcSendLabel"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchBackupVcTnlPolicyName"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchBackupVcCir"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchBackupVcPir"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchBackupVcQosProfile"), ("HUAWEI-PWE3-MIB", "hwPwVcSlaveMasterMode"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchVcSlaveMasterMode"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchBackupVcSlaveMasterMode"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchVcActive"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchBackupVcActive"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchCwTrans"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchVcServiceName"), ("HUAWEI-PWE3-MIB", "hwPwVcSwitchBackupVcServiceName"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
hwPWVcGroup = hwPWVcGroup.setStatus('current')
if mibBuilder.loadTexts: hwPWVcGroup.setDescription("The Pwe3's VC group.")
hwPWVcTnlGroup = ObjectGroup((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 2, 2)).setObjects(("HUAWEI-PWE3-MIB", "hwPWVcTnlType"), ("HUAWEI-PWE3-MIB", "hwPWTnlForBfdIndex"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
hwPWVcTnlGroup = hwPWVcTnlGroup.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTnlGroup.setDescription("The PWE3's VC Tunnel group.")
hwPWVcStatisticsGroup = ObjectGroup((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 2, 3)).setObjects(("HUAWEI-PWE3-MIB", "hwPWVcStatisticsRcvPkts"), ("HUAWEI-PWE3-MIB", "hwPWVcStatisticsRcvBytes"), ("HUAWEI-PWE3-MIB", "hwPWVcStatisticsSndPkts"), ("HUAWEI-PWE3-MIB", "hwPWVcStatisticsSndBytes"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
hwPWVcStatisticsGroup = hwPWVcStatisticsGroup.setStatus('current')
if mibBuilder.loadTexts: hwPWVcStatisticsGroup.setDescription("The PWE3's VC Statistics group.")
hwPWRemoteVcGroup = ObjectGroup((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 2, 4)).setObjects(("HUAWEI-PWE3-MIB", "hwPWRemoteVcID"), ("HUAWEI-PWE3-MIB", "hwPWRemoteVcType"), ("HUAWEI-PWE3-MIB", "hwPWRemoteVcStatus"), ("HUAWEI-PWE3-MIB", "hwPWRemoteVcGroupID"), ("HUAWEI-PWE3-MIB", "hwPWRemoteVcMtu"), ("HUAWEI-PWE3-MIB", "hwPWRemoteVcCtrlword"), ("HUAWEI-PWE3-MIB", "hwPWRemoteVcMaxAtmCells"), ("HUAWEI-PWE3-MIB", "hwPWRemoteVcNotif"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
hwPWRemoteVcGroup = hwPWRemoteVcGroup.setStatus('current')
if mibBuilder.loadTexts: hwPWRemoteVcGroup.setDescription("The PWE3's Remote VC group.")
hwPWTemplateGroup = ObjectGroup((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 2, 5)).setObjects(("HUAWEI-PWE3-MIB", "hwPWTemplatePeerAddrType"), ("HUAWEI-PWE3-MIB", "hwPWTemplatePeerAddr"), ("HUAWEI-PWE3-MIB", "hwPWTemplateCtrlword"), ("HUAWEI-PWE3-MIB", "hwPWTemplateVCCV"), ("HUAWEI-PWE3-MIB", "hwPWTemplateFrag"), ("HUAWEI-PWE3-MIB", "hwPWTemplateBandwidth"), ("HUAWEI-PWE3-MIB", "hwPWTemplateTnlPolicyName"), ("HUAWEI-PWE3-MIB", "hwPWTemplateQoSBehaviorIndex"), ("HUAWEI-PWE3-MIB", "hwPWTemplateExplicitPathName"), ("HUAWEI-PWE3-MIB", "hwPWTemplateBFDDetectMultiplier"), ("HUAWEI-PWE3-MIB", "hwPWTemplateBFDMinReceiveInterval"), ("HUAWEI-PWE3-MIB", "hwPWTemplateBFDMinTransmitInterval"), ("HUAWEI-PWE3-MIB", "hwPWTemplateDynamicBFDDetect"), ("HUAWEI-PWE3-MIB", "hwPWTemplateMaxAtmCells"), ("HUAWEI-PWE3-MIB", "hwPWTemplateAtmPackOvertime"), ("HUAWEI-PWE3-MIB", "hwPWTemplatePwJitterBufferDepth"), ("HUAWEI-PWE3-MIB", "hwPWTemplatePwTdmEncapsulationNum"), ("HUAWEI-PWE3-MIB", "hwPWTemplatePwIdleCode"), ("HUAWEI-PWE3-MIB", "hwPWTemplatePwRtpHeader"), ("HUAWEI-PWE3-MIB", "hwPWTemplatePwCCSeqEnable"), ("HUAWEI-PWE3-MIB", "hwPWTemplateCir"), ("HUAWEI-PWE3-MIB", "hwPWTemplatePir"), ("HUAWEI-PWE3-MIB", "hwPWTemplateQosProfile"), ("HUAWEI-PWE3-MIB", "hwPWTemplateFlowLabel"), ("HUAWEI-PWE3-MIB", "hwPWTemplateRowStatus"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
hwPWTemplateGroup = hwPWTemplateGroup.setStatus('current')
if mibBuilder.loadTexts: hwPWTemplateGroup.setDescription("The PWE3's Template group.")
hwPWNotificationControlGroup = ObjectGroup((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 2, 6)).setObjects(("HUAWEI-PWE3-MIB", "hwPWVcSwitchNotifEnable"), ("HUAWEI-PWE3-MIB", "hwPWVcUpDownNotifEnable"), ("HUAWEI-PWE3-MIB", "hwPWVcDeletedNotifEnable"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
hwPWNotificationControlGroup = hwPWNotificationControlGroup.setStatus('current')
if mibBuilder.loadTexts: hwPWNotificationControlGroup.setDescription("The PWE3's Notification Control group.")
hwPWVcStateChangeReasonGroup = ObjectGroup((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 2, 7)).setObjects(("HUAWEI-PWE3-MIB", "hwPWVcStateChangeReason"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchRmtID"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
hwPWVcStateChangeReasonGroup = hwPWVcStateChangeReasonGroup.setStatus('current')
if mibBuilder.loadTexts: hwPWVcStateChangeReasonGroup.setDescription("The PWE3's Vc State Reason group.")
hwPWVcNotificationGroup = NotificationGroup((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 2, 8)).setObjects(("HUAWEI-PWE3-MIB", "hwPWVcSwitchWtoP"), ("HUAWEI-PWE3-MIB", "hwPWVcSwitchPtoW"), ("HUAWEI-PWE3-MIB", "hwPWVcDown"), ("HUAWEI-PWE3-MIB", "hwPWVcUp"), ("HUAWEI-PWE3-MIB", "hwPWVcDeleted"), ("HUAWEI-PWE3-MIB", "hwPWVcBackup"), ("HUAWEI-PWE3-MIB", "hwLdpPWVcDown"), ("HUAWEI-PWE3-MIB", "hwLdpPWVcUp"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
hwPWVcNotificationGroup = hwPWVcNotificationGroup.setStatus('current')
if mibBuilder.loadTexts: hwPWVcNotificationGroup.setDescription("The PWE3's VC Notification group.")
hwLdpPWStateChangeReasonGroup = ObjectGroup((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 2, 9)).setObjects(("HUAWEI-PWE3-MIB", "hwLdpPWStateChangeReason"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
hwLdpPWStateChangeReasonGroup = hwLdpPWStateChangeReasonGroup.setStatus('current')
if mibBuilder.loadTexts: hwLdpPWStateChangeReasonGroup.setDescription('The LDP PW VC State Reason group.')
hwPWVcTDMPerfCurrentGroup = ObjectGroup((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 2, 10)).setObjects(("HUAWEI-PWE3-MIB", "hwPWVcTDMPerfCurrentMissingPkts"), ("HUAWEI-PWE3-MIB", "hwPWVcTDMPerfCurrentJtrBfrOverruns"), ("HUAWEI-PWE3-MIB", "hwPWVcTDMPerfCurrentJtrBfrUnderruns"), ("HUAWEI-PWE3-MIB", "hwPWVcTDMPerfCurrentMisOrderDropped"), ("HUAWEI-PWE3-MIB", "hwPWVcTDMPerfCurrentMalformedPkt"), ("HUAWEI-PWE3-MIB", "hwPWVcTDMPerfCurrentESs"), ("HUAWEI-PWE3-MIB", "hwPWVcTDMPerfCurrentSESs"), ("HUAWEI-PWE3-MIB", "hwPWVcTDMPerfCurrentUASs"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
hwPWVcTDMPerfCurrentGroup = hwPWVcTDMPerfCurrentGroup.setStatus('current')
if mibBuilder.loadTexts: hwPWVcTDMPerfCurrentGroup.setDescription("The PWE3's VC TDM performance information group.")
hwL2vpnSvcMIBGroups = MibIdentifier((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 3))
hwSvcGroup = ObjectGroup((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 3, 1)).setObjects(("HUAWEI-PWE3-MIB", "hwSvcID"), ("HUAWEI-PWE3-MIB", "hwSvcType"), ("HUAWEI-PWE3-MIB", "hwSvcPeerAddrType"), ("HUAWEI-PWE3-MIB", "hwSvcPeerAddr"), ("HUAWEI-PWE3-MIB", "hwSvcStatus"), ("HUAWEI-PWE3-MIB", "hwSvcInboundLabel"), ("HUAWEI-PWE3-MIB", "hwSvcOutboundLabel"), ("HUAWEI-PWE3-MIB", "hwSvcGroupID"), ("HUAWEI-PWE3-MIB", "hwSvcAcStatus"), ("HUAWEI-PWE3-MIB", "hwSvcACOAMStatus"), ("HUAWEI-PWE3-MIB", "hwSvcMtu"), ("HUAWEI-PWE3-MIB", "hwSvcCtrlWord"), ("HUAWEI-PWE3-MIB", "hwSvcVCCV"), ("HUAWEI-PWE3-MIB", "hwSvcBandWidth"), ("HUAWEI-PWE3-MIB", "hwSvcMaxAtmCells"), ("HUAWEI-PWE3-MIB", "hwSvcTnlPolicyName"), ("HUAWEI-PWE3-MIB", "hwSvcQoSBehaviorIndex"), ("HUAWEI-PWE3-MIB", "hwSvcPWTemplateName"), ("HUAWEI-PWE3-MIB", "hwSvcUpTime"), ("HUAWEI-PWE3-MIB", "hwSvcOAMSync"), ("HUAWEI-PWE3-MIB", "hwSvcForBfdIndex"), ("HUAWEI-PWE3-MIB", "hwSvcSecondary"), ("HUAWEI-PWE3-MIB", "hwSvcDelayTime"), ("HUAWEI-PWE3-MIB", "hwSvcReroutePolicy"), ("HUAWEI-PWE3-MIB", "hwSvcResumeTime"), ("HUAWEI-PWE3-MIB", "hwSvcRerouteReason"), ("HUAWEI-PWE3-MIB", "hwSvcLastRerouteTime"), ("HUAWEI-PWE3-MIB", "hwSvcManualSetFault"), ("HUAWEI-PWE3-MIB", "hwSvcActive"), ("HUAWEI-PWE3-MIB", "hwSvcUpStartTime"), ("HUAWEI-PWE3-MIB", "hwSvcUpSumTime"), ("HUAWEI-PWE3-MIB", "hwSvcAtmPackOvertime"), ("HUAWEI-PWE3-MIB", "hwSvcPwJitterBufferDepth"), ("HUAWEI-PWE3-MIB", "hwSvcPwTdmEncapsulationNum"), ("HUAWEI-PWE3-MIB", "hwSvcPwIdleCode"), ("HUAWEI-PWE3-MIB", "hwSvcPwRtpHeader"), ("HUAWEI-PWE3-MIB", "hwSvcRawOrTagged"), ("HUAWEI-PWE3-MIB", "hwSvcInterworkingType"), ("HUAWEI-PWE3-MIB", "hwSvcCir"), ("HUAWEI-PWE3-MIB", "hwSvcPir"), ("HUAWEI-PWE3-MIB", "hwSvcQosProfile"), ("HUAWEI-PWE3-MIB", "hwSvcRowStatus"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
hwSvcGroup = hwSvcGroup.setStatus('current')
if mibBuilder.loadTexts: hwSvcGroup.setDescription("The L2vpn's SVC group.")
hwSvcTnlGroup = ObjectGroup((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 3, 2)).setObjects(("HUAWEI-PWE3-MIB", "hwSvcTnlType"), ("HUAWEI-PWE3-MIB", "hwSvcTnlForBfdIndex"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
hwSvcTnlGroup = hwSvcTnlGroup.setStatus('current')
if mibBuilder.loadTexts: hwSvcTnlGroup.setDescription("The L2vpn's SVC Tunnel group.")
hwSvcStatisticsGroup = ObjectGroup((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 3, 3)).setObjects(("HUAWEI-PWE3-MIB", "hwSvcStatisticsRcvPkts"), ("HUAWEI-PWE3-MIB", "hwSvcStatisticsRcvBytes"), ("HUAWEI-PWE3-MIB", "hwSvcStatisticsSndPkts"), ("HUAWEI-PWE3-MIB", "hwSvcStatisticsSndBytes"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
hwSvcStatisticsGroup = hwSvcStatisticsGroup.setStatus('current')
if mibBuilder.loadTexts: hwSvcStatisticsGroup.setDescription("The L2vpn's SVC Statistics group.")
hwSvcNotificationControlGroup = ObjectGroup((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 3, 4)).setObjects(("HUAWEI-PWE3-MIB", "hwSvcSwitchNotifEnable"), ("HUAWEI-PWE3-MIB", "hwSvcUpDownNotifEnable"), ("HUAWEI-PWE3-MIB", "hwSvcDeletedNotifEnable"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
hwSvcNotificationControlGroup = hwSvcNotificationControlGroup.setStatus('current')
if mibBuilder.loadTexts: hwSvcNotificationControlGroup.setDescription("The L2vpn SVC's Notification Control group.")
hwSvcStateChangeReasonGroup = ObjectGroup((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 3, 5)).setObjects(("HUAWEI-PWE3-MIB", "hwSvcStateChangeReason"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
hwSvcStateChangeReasonGroup = hwSvcStateChangeReasonGroup.setStatus('current')
if mibBuilder.loadTexts: hwSvcStateChangeReasonGroup.setDescription("The L2vpn's SVc State Reason group.")
hwSvcNotificationGroup = NotificationGroup((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 3, 6)).setObjects(("HUAWEI-PWE3-MIB", "hwSvcSwitchWtoP"), ("HUAWEI-PWE3-MIB", "hwSvcSwitchPtoW"), ("HUAWEI-PWE3-MIB", "hwSvcDown"), ("HUAWEI-PWE3-MIB", "hwSvcUp"), ("HUAWEI-PWE3-MIB", "hwSvcDeleted"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
hwSvcNotificationGroup = hwSvcNotificationGroup.setStatus('current')
if mibBuilder.loadTexts: hwSvcNotificationGroup.setDescription("The L2vpn's SVC Notification group.")
hwL2vpnPWTableMIBGroups = MibIdentifier((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 4))
hwPWTableGroup = ObjectGroup((1, 3, 6, 1, 4, 1, 2011, 5, 25, 119, 4, 3, 4, 1)).setObjects(("HUAWEI-PWE3-MIB", "hwPWInterfaceIndex"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
hwPWTableGroup = hwPWTableGroup.setStatus('current')
if mibBuilder.loadTexts: hwPWTableGroup.setDescription('The PW Table Group.')
mibBuilder.exportSymbols("HUAWEI-PWE3-MIB", hwPWTemplateVCCV=hwPWTemplateVCCV, hwPWVcVCCV=hwPWVcVCCV, hwPWVcUp=hwPWVcUp, hwL2VpnPwe3=hwL2VpnPwe3, hwSvcInboundLabel=hwSvcInboundLabel, hwPwVcSwitchAdminPwIfIndex=hwPwVcSwitchAdminPwIfIndex, hwPWVcQosProfile=hwPWVcQosProfile, hwSvcInterworkingType=hwSvcInterworkingType, hwSvcTnlEntry=hwSvcTnlEntry, hwPWEntry=hwPWEntry, HWLdpPwStateChangeReason=HWLdpPwStateChangeReason, hwPWVcTDMPerfCurrentMissingPkts=hwPWVcTDMPerfCurrentMissingPkts, hwPWVcBackup=hwPWVcBackup, hwSvcStateChangeReason=hwSvcStateChangeReason, hwPWTemplatePwTdmEncapsulationNum=hwPWTemplatePwTdmEncapsulationNum, hwPWVcActive=hwPWVcActive, hwPWVcExplicitPathName=hwPWVcExplicitPathName, hwPWVcIfName=hwPWVcIfName, hwPWTemplateAtmPackOvertime=hwPWTemplateAtmPackOvertime, hwPWTemplatePwCCSeqEnable=hwPWTemplatePwCCSeqEnable, hwSvcEntry=hwSvcEntry, hwPWTemplateTnlPolicyName=hwPWTemplateTnlPolicyName, hwPWVCForBfdIndex=hwPWVCForBfdIndex, hwPWVcTnlEntry=hwPWVcTnlEntry, hwSvcStatisticsTable=hwSvcStatisticsTable, hwPWTemplateBFDDetectMultiplier=hwPWTemplateBFDDetectMultiplier, hwSvcStatisticsRcvBytes=hwSvcStatisticsRcvBytes, hwPWVcRerouteReason=hwPWVcRerouteReason, hwSvcSwitchWtoP=hwSvcSwitchWtoP, hwPWVcQoSBehaviorIndex=hwPWVcQoSBehaviorIndex, hwSvcTnlType=hwSvcTnlType, hwL2vpnSvcMIBTraps=hwL2vpnSvcMIBTraps, hwPWVcUpStartTime=hwPWVcUpStartTime, hwPwVcSwitchVcActive=hwPwVcSwitchVcActive, hwSvcOAMSync=hwSvcOAMSync, hwSvcLastRerouteTime=hwSvcLastRerouteTime, hwPWVcCfmMdIndex=hwPWVcCfmMdIndex, hwPWVcPwIdleCode=hwPWVcPwIdleCode, hwPWVcSwitchVrID=hwPWVcSwitchVrID, hwPWTemplatePwJitterBufferDepth=hwPWTemplatePwJitterBufferDepth, hwPWVcPwTdmEncapsulationNum=hwPWVcPwTdmEncapsulationNum, hwLdpPWVcUp=hwLdpPWVcUp, hwPWVcGroup=hwPWVcGroup, hwPWRemoteVcMtu=hwPWRemoteVcMtu, hwSvcStatisticsSndBytes=hwSvcStatisticsSndBytes, hwSvcTnlIndex=hwSvcTnlIndex, hwPwVcSwitchBackupVcActive=hwPwVcSwitchBackupVcActive, hwPWRemoteVcGroup=hwPWRemoteVcGroup, hwSvcGroup=hwSvcGroup, hwPWVcAcStatus=hwPWVcAcStatus, hwPWRemoteVcCtrlword=hwPWRemoteVcCtrlword, hwPWVcUpDownNotifEnable=hwPWVcUpDownNotifEnable, hwSvcNotificationGroup=hwSvcNotificationGroup, hwPWVcType=hwPWVcType, hwPWVcSwitchInboundLabel=hwPWVcSwitchInboundLabel, hwPWVcStatisticsRcvPkts=hwPWVcStatisticsRcvPkts, hwSvcStatus=hwSvcStatus, hwSvcDeletedNotifEnable=hwSvcDeletedNotifEnable, hwSvcStatisticsSndPkts=hwSvcStatisticsSndPkts, hwPWBFDDetectMultiplier=hwPWBFDDetectMultiplier, hwPWVcCfmMdName=hwPWVcCfmMdName, hwPWVcManualSetFault=hwPWVcManualSetFault, hwPwVcSlaveMasterMode=hwPwVcSlaveMasterMode, hwPWTemplateFrag=hwPWTemplateFrag, hwPWVcTDMPerfCurrentMalformedPkt=hwPWVcTDMPerfCurrentMalformedPkt, hwSvcRowStatus=hwSvcRowStatus, hwSvcNotificationControlGroup=hwSvcNotificationControlGroup, hwPwVcSwitchBackupVcCir=hwPwVcSwitchBackupVcCir, hwPWRemoteVcTable=hwPWRemoteVcTable, hwSvcAcStatus=hwSvcAcStatus, hwPWVcTDMPerfCurrentUASs=hwPWVcTDMPerfCurrentUASs, PYSNMP_MODULE_ID=hwL2VpnPwe3, hwSvcStatisticsEntry=hwSvcStatisticsEntry, hwPWVcSwitchID=hwPWVcSwitchID, hwSvcPWTemplateName=hwSvcPWTemplateName, hwPWVcSwitchPir=hwPWVcSwitchPir, hwPwVcSwitchCwTrans=hwPwVcSwitchCwTrans, hwPWBFDMinReceiveInterval=hwPWBFDMinReceiveInterval, hwPWVcSwitchPeerAddrType=hwPWVcSwitchPeerAddrType, hwPWVcSwitchTnlPolicyName=hwPWVcSwitchTnlPolicyName, hwPWVcPir=hwPWVcPir, hwPwVcAdminPwIfIndex=hwPwVcAdminPwIfIndex, hwSvcQoSBehaviorIndex=hwSvcQoSBehaviorIndex, hwPWVcEntry=hwPWVcEntry, hwPwVcIsBypass=hwPwVcIsBypass, hwPWVcStatus=hwPWVcStatus, hwPWVcReroutePolicy=hwPWVcReroutePolicy, hwPWVcMtu=hwPWVcMtu, hwPWVcLastRerouteTime=hwPWVcLastRerouteTime, hwPwVcSwitchBackupVcPeerAddrType=hwPwVcSwitchBackupVcPeerAddrType, hwSvcCtrlWord=hwSvcCtrlWord, hwSvcUpSumTime=hwSvcUpSumTime, hwSvcPwTdmEncapsulationNum=hwSvcPwTdmEncapsulationNum, hwSvcRawOrTagged=hwSvcRawOrTagged, hwPWTemplateExplicitPathName=hwPWTemplateExplicitPathName, hwPWVcNotificationGroup=hwPWVcNotificationGroup, hwPWTemplatePir=hwPWTemplatePir, hwPWTemplateMaxAtmCells=hwPWTemplateMaxAtmCells, hwPWRemoteVcMaxAtmCells=hwPWRemoteVcMaxAtmCells, hwPwVcAdminPwLinkStatus=hwPwVcAdminPwLinkStatus, hwPWTemplatePeerAddrType=hwPWTemplatePeerAddrType, hwPWInterfaceIndex=hwPWInterfaceIndex, hwPWVcPeerAddrType=hwPWVcPeerAddrType, hwPWVcVrIfIndex=hwPWVcVrIfIndex, hwPWTemplateDynamicBFDDetect=hwPWTemplateDynamicBFDDetect, hwPWVcEnableACOAM=hwPWVcEnableACOAM, hwPwVcSwitchBackupVcReceiveLabel=hwPwVcSwitchBackupVcReceiveLabel, hwPWTemplateBandwidth=hwPWTemplateBandwidth, hwPWVcUpTime=hwPWVcUpTime, hwPwVcSwitchBackupAdminPwLinkStatus=hwPwVcSwitchBackupAdminPwLinkStatus, hwPWVcStatisticsTable=hwPWVcStatisticsTable, hwPWVcTnlIndex=hwPWVcTnlIndex, hwPWVcStatisticsSndPkts=hwPWVcStatisticsSndPkts, hwPWVcCtrlWord=hwPWVcCtrlWord, hwLdpPWStateChangeReasonGroup=hwLdpPWStateChangeReasonGroup, hwPWTemplateQosProfile=hwPWTemplateQosProfile, hwPwVcSwitchBackupVcId=hwPwVcSwitchBackupVcId, hwSvcActive=hwSvcActive, hwPWVcTDMPerfCurrentEntry=hwPWVcTDMPerfCurrentEntry, hwSvcPwRtpHeader=hwSvcPwRtpHeader, hwPwe3MIBObjects=hwPwe3MIBObjects, hwSvcUpDownNotifEnable=hwSvcUpDownNotifEnable, hwPWTemplateGroup=hwPWTemplateGroup, hwSvcReroutePolicy=hwSvcReroutePolicy, hwSvcPwJitterBufferDepth=hwSvcPwJitterBufferDepth, hwLdpPWStateChangeReason=hwLdpPWStateChangeReason, hwPWTemplatePwIdleCode=hwPWTemplatePwIdleCode, hwPWVcID=hwPWVcID, hwPWVcTnlPolicyName=hwPWVcTnlPolicyName, hwPWVcTDMPerfCurrentESs=hwPWVcTDMPerfCurrentESs, hwPWTemplateBFDMinTransmitInterval=hwPWTemplateBFDMinTransmitInterval, hwSvcStateChangeReasonGroup=hwSvcStateChangeReasonGroup, hwPwVcSwitchBackupVcSendLabel=hwPwVcSwitchBackupVcSendLabel, hwPWTnlForBfdIndex=hwPWTnlForBfdIndex, hwSvcBandWidth=hwSvcBandWidth, hwPWVcTDMPerfCurrentMisOrderDropped=hwPWVcTDMPerfCurrentMisOrderDropped, hwPWTemplateName=hwPWTemplateName, hwPWVcCir=hwPWVcCir, hwPWTableGroup=hwPWTableGroup, hwSvcTnlTable=hwSvcTnlTable, hwPWVcOutboundLabel=hwPWVcOutboundLabel, hwPWTableObjects=hwPWTableObjects, hwPWRemoteVcGroupID=hwPWRemoteVcGroupID, hwPWVcStateChangeReason=hwPWVcStateChangeReason, hwSvcQosProfile=hwSvcQosProfile, hwSvcUpTime=hwSvcUpTime, hwSvcPwIdleCode=hwSvcPwIdleCode, hwPWVcSwitchRmtID=hwPWVcSwitchRmtID, hwPWVcInboundLabel=hwPWVcInboundLabel, hwPWVcBfdParaFromPWT=hwPWVcBfdParaFromPWT, hwPWVcSwitchNotifEnable=hwPWVcSwitchNotifEnable, hwSvcDeleted=hwSvcDeleted, hwSvcRerouteReason=hwSvcRerouteReason, hwPWVcQosParaFromPWT=hwPWVcQosParaFromPWT, hwPWRemoteVcType=hwPWRemoteVcType, hwPWVcRowStatus=hwPWVcRowStatus, hwPWVcRawOrTagged=hwPWVcRawOrTagged, hwPWTemplateMIBTraps=hwPWTemplateMIBTraps, hwPWVcACOAMStatus=hwPWVcACOAMStatus, hwPWBFDMinTransmitInterval=hwPWBFDMinTransmitInterval, hwPWVcSwitchQosProfile=hwPWVcSwitchQosProfile, hwPWVcSwitchVrIfIndex=hwPWVcSwitchVrIfIndex, hwPWType=hwPWType, hwPwVcSwitchBackupVcPir=hwPwVcSwitchBackupVcPir, hwPWVcSwitchSign=hwPWVcSwitchSign, hwPwVcSwitchBackupVcQosProfile=hwPwVcSwitchBackupVcQosProfile, hwPWTemplateFlowLabel=hwPWTemplateFlowLabel, hwPWVcTDMPerfCurrentJtrBfrOverruns=hwPWVcTDMPerfCurrentJtrBfrOverruns, hwPWVcGroupID=hwPWVcGroupID, hwPWVcUpSumTime=hwPWVcUpSumTime, hwPwe3MIBTraps=hwPwe3MIBTraps, hwPWVcTDMPerfCurrentTable=hwPWVcTDMPerfCurrentTable, hwSvcResumeTime=hwSvcResumeTime, hwPwVcSwitchBackupAdminPwIfIndex=hwPwVcSwitchBackupAdminPwIfIndex, hwPWTemplateRowStatus=hwPWTemplateRowStatus, hwPwe3MIBGroups=hwPwe3MIBGroups, hwSvcType=hwSvcType, hwSvcVCCV=hwSvcVCCV, hwPWVcStatisticsSndBytes=hwPWVcStatisticsSndBytes, hwSvcDelayTime=hwSvcDelayTime, hwSvcPir=hwSvcPir, hwPWVcPwRtpHeader=hwPWVcPwRtpHeader, hwPWRemoteVcNotif=hwPWRemoteVcNotif, hwPWTemplateQoSBehaviorIndex=hwPWTemplateQoSBehaviorIndex, hwL2vpnPWTableMIBGroups=hwL2vpnPWTableMIBGroups, hwPWVcTable=hwPWVcTable, hwPwVcSwitchAdminPwLinkStatus=hwPwVcSwitchAdminPwLinkStatus, hwPWRemoteVcEntry=hwPWRemoteVcEntry, hwLdpPWVcDown=hwLdpPWVcDown, hwSvcAtmPackOvertime=hwSvcAtmPackOvertime, hwPwe3MIBCompliance=hwPwe3MIBCompliance, hwPWVcPwJitterBufferDepth=hwPWVcPwJitterBufferDepth, hwPWVcSwitchCir=hwPWVcSwitchCir, hwPwVcSwitchVcServiceName=hwPwVcSwitchVcServiceName, hwPWTemplateBFDMinReceiveInterval=hwPWTemplateBFDMinReceiveInterval, hwPWVcDelayTime=hwPWVcDelayTime, hwSvcStatisticsGroup=hwSvcStatisticsGroup, hwPWVcTnlGroup=hwPWVcTnlGroup, hwSvcUp=hwSvcUp, hwSvcPeerAddrType=hwSvcPeerAddrType, hwPWVcStatisticsGroup=hwPWVcStatisticsGroup, hwPwe3MIBCompliances=hwPwe3MIBCompliances, hwL2Vpn=hwL2Vpn, hwPWVcInterworkingType=hwPWVcInterworkingType, hwPwe3Objects=hwPwe3Objects, hwPWVcSwitchPeerAddr=hwPWVcSwitchPeerAddr, hwPwVcIsAdmin=hwPwVcIsAdmin, hwPWOAMSync=hwPWOAMSync, hwPWVcTnlTable=hwPWVcTnlTable, hwSvcOutboundLabel=hwSvcOutboundLabel, hwPWTemplatePeerAddr=hwPWTemplatePeerAddr, hwPWVcMaxAtmCells=hwPWVcMaxAtmCells, hwPWVcCfmMaName=hwPWVcCfmMaName, hwPwVcSwitchBackupVcServiceName=hwPwVcSwitchBackupVcServiceName, hwPWVcStatisticsRcvBytes=hwPWVcStatisticsRcvBytes, hwSvcMtu=hwSvcMtu, hwSvcTnlForBfdIndex=hwSvcTnlForBfdIndex, hwPWVcTDMPerfCurrentGroup=hwPWVcTDMPerfCurrentGroup, hwPWBFDRemoteVcID=hwPWBFDRemoteVcID, hwPWVcTrigger=hwPWVcTrigger, hwSvcSwitchPtoW=hwSvcSwitchPtoW, hwPwVcSwitchBackupVcSlaveMasterMode=hwPwVcSwitchBackupVcSlaveMasterMode, hwPwe3MIBConformance=hwPwe3MIBConformance, hwSvcID=hwSvcID, hwPWTemplatePwRtpHeader=hwPWTemplatePwRtpHeader, hwSvcMaxAtmCells=hwSvcMaxAtmCells, hwSvcIfIndex=hwSvcIfIndex, hwPWEthOamType=hwPWEthOamType, hwPWVcIfIndex=hwPWVcIfIndex, hwSvcTnlPolicyName=hwSvcTnlPolicyName, hwPWTemplateCir=hwPWTemplateCir, hwPWVcStatisticsEntry=hwPWVcStatisticsEntry, hwPWVcDeleted=hwPWVcDeleted, hwPWRemoteVcStatus=hwPWRemoteVcStatus, hwPWVcTnlType=hwPWVcTnlType, hwSvcTnlGroup=hwSvcTnlGroup, hwPWVcResumeTime=hwPWVcResumeTime, hwPWVcTemplateName=hwPWVcTemplateName, hwPWVcSwitchOutboundLabel=hwPWVcSwitchOutboundLabel, hwSvcPeerAddr=hwSvcPeerAddr, hwPWId=hwPWId, hwPwVcSwitchVcSlaveMasterMode=hwPwVcSwitchVcSlaveMasterMode, hwPWCfmMaIndex=hwPWCfmMaIndex, hwPWTemplateCannotDeleted=hwPWTemplateCannotDeleted, hwPWVcSwitchPtoW=hwPWVcSwitchPtoW, hwPWVcAtmPackOvertime=hwPWVcAtmPackOvertime, hwPWVcSwitchWtoP=hwPWVcSwitchWtoP, hwPWTemplateCtrlword=hwPWTemplateCtrlword, hwPWVcTDMPerfCurrentJtrBfrUnderruns=hwPWVcTDMPerfCurrentJtrBfrUnderruns, hwSvcGroupID=hwSvcGroupID, hwPWRemoteVcID=hwPWRemoteVcID, hwPWVcDeletedNotifEnable=hwPWVcDeletedNotifEnable, hwPWVcBandWidth=hwPWVcBandWidth, hwPwVcNegotiateMode=hwPwVcNegotiateMode)
mibBuilder.exportSymbols("HUAWEI-PWE3-MIB", hwSvcSwitchNotifEnable=hwSvcSwitchNotifEnable, hwSvcStatisticsRcvPkts=hwSvcStatisticsRcvPkts, hwPWVcDown=hwPWVcDown, hwPWVcTDMPerfCurrentSESs=hwPWVcTDMPerfCurrentSESs, hwPWVcStateChangeReasonGroup=hwPWVcStateChangeReasonGroup, hwPWVcPeerAddr=hwPWVcPeerAddr, hwPWVcVrID=hwPWVcVrID, hwPWVcSecondary=hwPWVcSecondary, hwPwVcSwitchBackupVcPeerAddr=hwPwVcSwitchBackupVcPeerAddr, hwPWNotificationControlGroup=hwPWNotificationControlGroup, hwSvcManualSetFault=hwSvcManualSetFault, hwSvcObjects=hwSvcObjects, hwSvcACOAMStatus=hwSvcACOAMStatus, hwSvcUpStartTime=hwSvcUpStartTime, hwPwVcSwitchBackupVcTnlPolicyName=hwPwVcSwitchBackupVcTnlPolicyName, hwPWTable=hwPWTable, hwSvcTable=hwSvcTable, hwPWTemplateTable=hwPWTemplateTable, hwSvcSecondary=hwSvcSecondary, hwPWPeerIp=hwPWPeerIp, hwL2vpnSvcMIBGroups=hwL2vpnSvcMIBGroups, hwSvcForBfdIndex=hwSvcForBfdIndex, hwSvcCir=hwSvcCir, hwPWDynamicBFDDetect=hwPWDynamicBFDDetect, hwSvcDown=hwSvcDown, hwPWTemplateEntry=hwPWTemplateEntry)
| [
"[email protected]"
] | |
31e9cd4c46e9ca7dcf3f0bccfa1cf4e7f7aa7945 | 27aaadf435779c29012233cb1dacf27bd9dd0d0f | /imagesearch-20201214/setup.py | 158893f64912b1bb6ea8f0b27a99576256e3835a | [
"Apache-2.0"
] | permissive | aliyun/alibabacloud-python-sdk | afadedb09db5ba6c2bc6b046732b2a6dc215f004 | e02f34e07a7f05e898a492c212598a348d903739 | refs/heads/master | 2023-08-22T20:26:44.695288 | 2023-08-22T12:27:39 | 2023-08-22T12:27:39 | 288,972,087 | 43 | 29 | null | 2022-09-26T09:21:19 | 2020-08-20T10:08:11 | Python | UTF-8 | Python | false | false | 2,842 | py | # -*- coding: utf-8 -*-
"""
Licensed to the Apache Software Foundation (ASF) under one
or more contributor license agreements. See the NOTICE file
distributed with this work for additional information
regarding copyright ownership. The ASF licenses this file
to you under the Apache License, Version 2.0 (the
"License"); you may not use this file except in compliance
with the License. You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing,
software distributed under the License is distributed on an
"AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
KIND, either express or implied. See the License for the
specific language governing permissions and limitations
under the License.
"""
import os
from setuptools import setup, find_packages
"""
setup module for alibabacloud_imagesearch20201214.
Created on 16/12/2022
@author: Alibaba Cloud SDK
"""
PACKAGE = "alibabacloud_imagesearch20201214"
NAME = "alibabacloud_imagesearch20201214" or "alibabacloud-package"
DESCRIPTION = "Alibaba Cloud image search (20201214) SDK Library for Python"
AUTHOR = "Alibaba Cloud SDK"
AUTHOR_EMAIL = "[email protected]"
URL = "https://github.com/aliyun/alibabacloud-python-sdk"
VERSION = __import__(PACKAGE).__version__
REQUIRES = [
"alibabacloud_tea_util>=0.3.8, <1.0.0",
"alibabacloud_oss_sdk>=0.1.0, <1.0.0",
"alibabacloud_openplatform20191219>=2.0.0, <3.0.0",
"alibabacloud_oss_util>=0.0.5, <1.0.0",
"alibabacloud_tea_fileform>=0.0.3, <1.0.0",
"alibabacloud_tea_openapi>=0.3.6, <1.0.0",
"alibabacloud_openapi_util>=0.2.0, <1.0.0",
"alibabacloud_endpoint_util>=0.0.3, <1.0.0"
]
LONG_DESCRIPTION = ''
if os.path.exists('./README.md'):
with open("README.md", encoding='utf-8') as fp:
LONG_DESCRIPTION = fp.read()
setup(
name=NAME,
version=VERSION,
description=DESCRIPTION,
long_description=LONG_DESCRIPTION,
long_description_content_type='text/markdown',
author=AUTHOR,
author_email=AUTHOR_EMAIL,
license="Apache License 2.0",
url=URL,
keywords=["alibabacloud","imagesearch20201214"],
packages=find_packages(exclude=["tests*"]),
include_package_data=True,
platforms="any",
install_requires=REQUIRES,
python_requires=">=3.6",
classifiers=(
"Development Status :: 4 - Beta",
"Intended Audience :: Developers",
"License :: OSI Approved :: Apache Software License",
"Programming Language :: Python",
"Programming Language :: Python :: 3",
"Programming Language :: Python :: 3.6",
'Programming Language :: Python :: 3.7',
'Programming Language :: Python :: 3.8',
'Programming Language :: Python :: 3.9',
"Topic :: Software Development"
)
)
| [
"[email protected]"
] | |
2cd72276ffa96c0292769e9e855768fde32ae8b2 | f28b2ec517ac93526ac66b0b4a4fccc8614739d0 | /HRC_arlac_monitor/Save/zinfo.py | 7b806e9f132141ae3ab8e3b52d11d788f490533d | [] | no_license | tisobe/HRC | 8b8f7137e0804d7478da17d0796c0f25c19c04e6 | aaba4e5512b14c92b8d413dd173e9e944041fa4d | refs/heads/master | 2020-03-17T14:43:00.972966 | 2018-05-16T15:28:29 | 2018-05-16T15:28:29 | 133,683,862 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 6,944 | py | #!/usr/bin/env /proj/sot/ska/bin/python
#############################################################################################################
# #
# hrc_gain_find_ar_lac.py: find new AL Lac observations and put in a list #
# #
# author: t. isobe ([email protected]) #
# #
# Last Update: Sep 24, 2014 #
# #
#############################################################################################################
import os
import sys
import re
import string
import random
import operator
import numpy
import unittest
from astropy.table import Table
from Ska.DBI import DBI
#
#--- reading directory list
#
path = '/data/mta/Script/HRC/Gain/house_keeping/dir_list_py'
f = open(path, 'r')
data = [line.strip() for line in f.readlines()]
f.close()
for ent in data:
atemp = re.split(':', ent)
var = atemp[1].strip()
line = atemp[0].strip()
exec "%s = %s" %(var, line)
#
#--- append a path to a private folder to python directory
#
sys.path.append(bin_dir)
sys.path.append(mta_dir)
#
#--- converTimeFormat contains MTA time conversion routines
#
import convertTimeFormat as tcnv
import mta_common_functions as mcf
#
#--- sql realated settings
#
db_user = 'browser'
db_server = 'ocatsqlsrv'
file = bdata_dir + '/.targpass'
db_passwd = mcf.get_val(file)
#---------------------------------------------------------------------------------------------------
#-- hrc_gain_find_ar_lac: find new AL Lac observations and put in a list --
#---------------------------------------------------------------------------------------------------
def hrc_gain_find_ar_lac():
"""
find new AL Lac observations and put in a list
Input: none, but the data will be read from mp_reports and also hrc_obsid_list in <house_keeping>
Output: "./candidate_list" which lists obsids of new AR Lac observations
candidate_list it also returns the same list
"""
hrc_list = hrc_gain_find_hrc_obs()
candidate_list = hrc_gain_test_obs(hrc_list)
return candidate_list
#---------------------------------------------------------------------------------------------------
#-- hrc_gain_find_ar_lac: find new AL Lac observations and put in a list --
#---------------------------------------------------------------------------------------------------
def hrc_gain_find_hrc_obs():
"""
select out the current hrc observations and create test candidate list
Input: none, but the data will be read from mp_reports and also hrc_obsid_list in <house_keeping>
Output: new_obs --- recently observed HRC obsid list
"""
#
#--- read obsid list of AR Lac we already checked
#
file = house_keeping + '/hrc_obsid_list'
f = open(file, 'r')
obsid_list = [line.strip() for line in f.readlines()]
f.close()
#
#--- find HRC events from a recent mp_reports
#
page = '/data/mta_www/mp_reports/events/mta_events.html'
f = open(page, 'r')
data = [line.strip() for line in f.readlines()]
f.close()
data_list = []
for ent in data:
m1 = re.search('HRC', ent)
m2 = re.search('Obsid', ent)
if (m1 is not None) and (m2 is not None):
atemp = re.split('\/', ent)
data_list.append(atemp[1])
#
#--- select out obsids which we have not checked before
#
new_obs = []
for ent in data_list:
chk = 0
for comp in obsid_list:
if ent == comp:
chk = 1
continue
if chk > 0:
continue
new_obs.append(ent)
return new_obs
#---------------------------------------------------------------------------------------------------
#-- hrc_gain_test_obs: find new AL Lac observations from a hrc obsid list ----
#---------------------------------------------------------------------------------------------------
def hrc_gain_test_obs(new_obs, test=''):
"""
find new AL Lac observations from a hrc obsid list
Input: new_obs --- a list of hrc obsids
test --- a test indicator. if it is other than "", test will run
Output: "./candidate_list" which lists obsids of new AR Lac observations
candidate_list it also returns the same list
"""
if test == "":
f1 = open('./candidate_list', 'w')
file = house_keeping + 'hrc_obsid_list'
file2 = house_keeping + 'hrc_obsid_list~'
cmd = 'cp -f ' + file + ' ' + file2
os.system(cmd)
f2 = open(file, 'a')
candidate_list = []
for obsid in new_obs:
#
#--- open sql database and extract data we need
#
db = DBI(dbi='sybase', server=db_server, user=db_user, passwd=db_passwd, database='axafocat')
cmd = 'select obsid,targid,seq_nbr,targname,grating,instrument from target where obsid=' + obsid
query_results = db.fetchall(cmd)
if len(query_results):
query_results = Table(query_results)
line = query_results['targname'].data
targname = line[0]
#
#--- if the observation is AR Lac, write it down in candidate_list
#
m1 = re.search('arlac', targname.lower())
if m1 is not None:
line = obsid + '\n'
candidate_list.append(obsid)
if test == '':
f1.write(line)
f2.write(line)
if test == '':
f1.close()
f2.close()
return candidate_list
#-----------------------------------------------------------------------------------------
#-- TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST ---
#-----------------------------------------------------------------------------------------
class TestFunctions(unittest.TestCase):
"""
testing functions
"""
def test_hrc_gain_test_obs(self):
page = house_keeping + '/Test_prep/candidate'
f = open(page, 'r')
data_list = [line.strip() for line in f.readlines()]
f.close()
test_candidates = ['14313', '14314', '14315', '14316']
candidates = hrc_gain_test_obs(data_list, test='test')
self.assertEquals(candidates, test_candidates)
#--------------------------------------------------------------------
if __name__ == '__main__':
unittest.main()
| [
"[email protected]"
] | |
a5df9c3956ce741cb2eb6a9c0155d07349363a1d | 7cb626363bbce2f66c09e509e562ff3d371c10c6 | /multimodel_inference/py3_v1/olds/sc3emlsm.py | dd484cd9338ae7f71742e4f7d8a632754eab4a2b | [
"LicenseRef-scancode-warranty-disclaimer"
] | no_license | z0on/AFS-analysis-with-moments | 76bfd6b0361ab7e9173144dbd21b6fa2c7bf1795 | eea4735b3b6fbe31c4e396da3d798387884a1500 | refs/heads/master | 2023-07-31T20:49:20.865161 | 2023-07-19T06:57:32 | 2023-07-19T06:57:32 | 96,915,117 | 4 | 5 | null | 2020-09-02T17:39:08 | 2017-07-11T16:38:03 | Python | UTF-8 | Python | false | false | 3,249 | py | #!/usr/bin/env python
# split, three epochs in each pop, asymmetric migration at same rates in all epochs
# n(para): 11
import matplotlib
matplotlib.use('PDF')
import moments
import pylab
import random
import matplotlib.pyplot as plt
import numpy as np
from numpy import array
from moments import Misc,Spectrum,Numerics,Manips,Integration,Demographics1D,Demographics2D
import sys
infile=sys.argv[1]
pop_ids=[sys.argv[2],sys.argv[3]]
projections=[int(sys.argv[4]),int(sys.argv[5])]
if len(sys.argv)==9:
params = np.loadtxt(sys.argv[8], delimiter=" ", unpack=False)
else:
params=[1,1,1,1,1,1,1,1,1,1,0.01]
# mutation rate per sequenced portion of genome per generation: for A.millepora, 0.02
mu=float(sys.argv[6])
# generation time, in thousand years: 0.005 (5 years)
gtime=float(sys.argv[7])
# set Polarized=False below for folded AFS analysis
fs = moments.Spectrum.from_file(infile)
data=fs.project(projections)
ns=data.sample_sizes
np.set_printoptions(precision=3)
#-------------------
# split into unequal pop sizes with asymmetrical migration
def sc3ei(params , ns):
# p_misid: proportion of misidentified ancestral states
nu1_1, nu2_1, nu1_2,nu2_2,nu1_3,nu2_3,T1, T2, T3,m, p_misid = params
sts = moments.LinearSystem_1D.steady_state_1D(ns[0] + ns[1])
fs = moments.Spectrum(sts)
fs = moments.Manips.split_1D_to_2D(fs, ns[0], ns[1])
fs.integrate([nu1_1, nu2_1], T1, m = np.array([[0, m], [m, 0]]))
fs.integrate([nu1_2, nu2_2], T2, m = np.array([[0, m], [m, 0]]))
fs.integrate([nu1_3, nu2_3], T3, m = np.array([[0, m], [m, 0]]))
return (1-p_misid)*fs + p_misid*moments.Numerics.reverse_array(fs)
func=sc3ei
upper_bound = [100, 100, 100,100,100, 100, 100, 100,100, 200,0.25]
lower_bound = [1e-3,1e-3, 1e-3,1e-3,1e-3,1e-3,1e-3,1e-3,1e-3,1e-5,1e-5]
params = moments.Misc.perturb_params(params, fold=2, upper_bound=upper_bound,
lower_bound=lower_bound)
poptg = moments.Inference.optimize_log(params, data, func,
lower_bound=lower_bound,
upper_bound=upper_bound,
verbose=False, maxiter=30)
# extracting model predictions, likelihood and theta
model = func(poptg, ns)
ll_model = moments.Inference.ll_multinom(model, data)
theta = moments.Inference.optimal_sfs_scaling(model, data)
# random index for this replicate
ind=str(random.randint(0,999999))
# plotting demographic model
plot_mod = moments.ModelPlot.generate_model(func, poptg, ns)
moments.ModelPlot.plot_model(plot_mod, save_file="sc3emlsm_"+ind+".png", pop_labels=pop_ids, nref=theta/(4*mu), draw_scale=False, gen_time=gtime, gen_time_units="KY", reverse_timeline=True)
# bootstrapping for SDs of params and theta
# printing parameters and their SDs
print( "RESULT","sc3emlsm",ind,len(params),ll_model,sys.argv[1],sys.argv[2],sys.argv[3],poptg,theta)
# plotting quad-panel figure witt AFS, model, residuals:
moments.Plotting.plot_2d_comp_multinom(model, data, vmin=0.1, resid_range=3,
pop_ids =pop_ids)
plt.savefig("sc3emlsm_"+ind+"_"+sys.argv[1]+"_"+sys.argv[2]+"_"+sys.argv[3]+"_"+sys.argv[4]+"_"+sys.argv[5]+'.pdf')
| [
"[email protected]"
] | |
e8d46842c93e593d1abf393ca6aab62c76269e13 | 9f35bea3c50668a4205c04373da95195e20e5427 | /third_party/blink/renderer/bindings/scripts/bind_gen/path_manager.py | 84b01c38d33b1cf2e4c6f677ce0cd1442c1f52c8 | [
"LGPL-2.0-or-later",
"LicenseRef-scancode-warranty-disclaimer",
"LGPL-2.1-only",
"GPL-1.0-or-later",
"GPL-2.0-only",
"LGPL-2.0-only",
"BSD-2-Clause",
"LicenseRef-scancode-other-copyleft",
"MIT",
"Apache-2.0",
"BSD-3-Clause"
] | permissive | foolcodemonkey/chromium | 5958fb37df91f92235fa8cf2a6e4a834c88f44aa | c155654fdaeda578cebc218d47f036debd4d634f | refs/heads/master | 2023-02-21T00:56:13.446660 | 2020-01-07T05:12:51 | 2020-01-07T05:12:51 | 232,250,603 | 1 | 0 | BSD-3-Clause | 2020-01-07T05:38:18 | 2020-01-07T05:38:18 | null | UTF-8 | Python | false | false | 5,524 | py | # Copyright 2019 The Chromium Authors. All rights reserved.
# Use of this source code is governed by a BSD-style license that can be
# found in the LICENSE file.
import posixpath
import web_idl
from . import name_style
from .blink_v8_bridge import blink_class_name
class PathManager(object):
"""
Provides a variety of paths such as Blink headers and output files. Unless
explicitly specified, returned paths are relative to the project's root
directory or the root directory of generated files.
e.g. "third_party/blink/renderer/..."
About output files, there are two cases.
- cross-components case:
APIs are generated in 'core' and implementations are generated in
'modules'.
- single component case:
Everything is generated in a single component.
"""
_REQUIRE_INIT_MESSAGE = ("PathManager.init must be called in advance.")
_is_initialized = False
@classmethod
def init(cls, root_src_dir, root_gen_dir, component_reldirs):
"""
Args:
root_src_dir: Project's root directory, which corresponds to "//"
in GN.
root_gen_dir: Root directory of generated files, which corresponds
to "//out/Default/gen" in GN.
component_reldirs: Pairs of component and output directory relative
to |root_gen_dir|.
"""
assert not cls._is_initialized
assert isinstance(root_src_dir, str)
assert isinstance(root_gen_dir, str)
assert isinstance(component_reldirs, dict)
cls._blink_path_prefix = posixpath.sep + posixpath.join(
"third_party", "blink", "renderer", "")
cls._root_src_dir = posixpath.abspath(root_src_dir)
cls._root_gen_dir = posixpath.abspath(root_gen_dir)
cls._component_reldirs = {
component: posixpath.normpath(rel_dir)
for component, rel_dir in component_reldirs.iteritems()
}
cls._is_initialized = True
@staticmethod
def gen_path_to(path):
"""
Returns the absolute path of |path| that must be relative to the root
directory of generated files.
"""
assert PathManager._is_initialized, PathManager._REQUIRE_INIT_MESSAGE
return posixpath.abspath(
posixpath.join(PathManager._root_gen_dir, path))
@classmethod
def relpath_to_project_root(cls, path):
index = path.find(cls._blink_path_prefix)
if index < 0:
assert path.startswith(cls._blink_path_prefix[1:])
return path
return path[index + 1:]
def __init__(self, idl_definition):
assert self._is_initialized, self._REQUIRE_INIT_MESSAGE
idl_path = PathManager.relpath_to_project_root(
posixpath.normpath(idl_definition.debug_info.location.filepath))
idl_basepath, _ = posixpath.splitext(idl_path)
self._idl_dir, self._idl_basename = posixpath.split(idl_basepath)
components = sorted(idl_definition.components) # "core" < "modules"
if len(components) == 1:
component = components[0]
self._is_cross_components = False
self._api_component = component
self._impl_component = component
elif len(components) == 2:
assert components[0] == "core"
assert components[1] == "modules"
self._is_cross_components = True
self._api_component = components[0]
self._impl_component = components[1]
else:
assert False
self._api_dir = self._component_reldirs[self._api_component]
self._impl_dir = self._component_reldirs[self._impl_component]
self._v8_bind_basename = name_style.file("v8",
idl_definition.identifier)
self._blink_dir = self._idl_dir
self._blink_basename = name_style.file(
blink_class_name(idl_definition))
@property
def idl_dir(self):
return self._idl_dir
def blink_path(self, filename=None, ext=None):
"""
Returns a path to a Blink implementation file relative to the project
root directory, e.g. "third_party/blink/renderer/..."
"""
return self._join(
dirpath=self._blink_dir,
filename=(filename or self._blink_basename),
ext=ext)
@property
def is_cross_components(self):
return self._is_cross_components
@property
def api_component(self):
return self._api_component
@property
def api_dir(self):
return self._api_dir
def api_path(self, filename=None, ext=None):
return self._join(
dirpath=self.api_dir,
filename=(filename or self._v8_bind_basename),
ext=ext)
@property
def impl_component(self):
return self._impl_component
@property
def impl_dir(self):
return self._impl_dir
def impl_path(self, filename=None, ext=None):
return self._join(
dirpath=self.impl_dir,
filename=(filename or self._v8_bind_basename),
ext=ext)
# TODO(crbug.com/1034398): Remove this API
def dict_path(self, filename=None, ext=None):
return self.blink_path(filename, ext)
@staticmethod
def _join(dirpath, filename, ext=None):
if ext is not None:
filename = posixpath.extsep.join([filename, ext])
return posixpath.join(dirpath, filename)
| [
"[email protected]"
] | |
002fe2c73ab39e05e6d94dade6da1b7d05d694a9 | f38db79439185ab6062294e1d82f6e909d2be81e | /avazacli/models/currency.py | 1afe7f4f49b83f587263b664dcf5fb614d8f72a3 | [] | no_license | ContainerSolutions/avazacli | 3a37f8500ad1f1843acbdbb413d4949e00ec6f91 | 49618314f15d8cb2bda36e6019670fdfbed1524f | refs/heads/master | 2020-06-18T18:44:58.594385 | 2019-07-11T14:23:10 | 2019-07-11T14:23:10 | 196,406,206 | 3 | 2 | null | null | null | null | UTF-8 | Python | false | false | 5,344 | py | # coding: utf-8
"""
Avaza API Documentation
Welcome to the autogenerated documentation & test tool for Avaza's API. <br/><br/><strong>API Security & Authentication</strong><br/>Authentication options include OAuth2 Implicit and Authorization Code flows, and Personal Access Token. All connections should be encrypted over SSL/TLS <br/><br/>You can set up and manage your api authentication credentials from within your Avaza account. (requires Administrator permissions on your Avaza account).<br/><br/> OAuth2 Authorization endpoint: https://any.avaza.com/oauth2/authorize <br/>OAuth2 Token endpoint: https://any.avaza.com/oauth2/token<br/>Base URL for subsequent API Requests: https://api.avaza.com/ <br/><br/>Blogpost about authenticating with Avaza's API: https://www.avaza.com/avaza-api-oauth2-authentication/ <br/>Blogpost on using Avaza's webhooks: https://www.avaza.com/avaza-api-webhook-notifications/<br/>The OAuth flow currently issues Access Tokens that last 1 day, and Refresh tokens that last 180 days<br/>The Api respects the security Roles assigned to the authenticating Avaza user and filters the data return appropriately. <br/><br><strong>Support</strong><br/>For API Support, and to request access please contact Avaza Support Team via our support chat. <br/><br/><strong>User Contributed Libraries:</strong><br/>Graciously contributed by 3rd party users like you. <br/>Note these are not tested or endorsesd by Avaza. We encourage you to review before use, and use at own risk.<br/> <ul><li> - <a target='blank' href='https://packagist.org/packages/debiprasad/oauth2-avaza'>PHP OAuth Client Package for Azava API (by Debiprasad Sahoo)</a></li></ul> # noqa: E501
OpenAPI spec version: v1
Generated by: https://github.com/swagger-api/swagger-codegen.git
"""
import pprint
import re # noqa: F401
import six
class Currency(object):
"""NOTE: This class is auto generated by the swagger code generator program.
Do not edit the class manually.
"""
"""
Attributes:
swagger_types (dict): The key is attribute name
and the value is attribute type.
attribute_map (dict): The key is attribute name
and the value is json key in definition.
"""
swagger_types = {
'currency_code': 'str',
'decimal_places': 'int'
}
attribute_map = {
'currency_code': 'CurrencyCode',
'decimal_places': 'DecimalPlaces'
}
def __init__(self, currency_code=None, decimal_places=None): # noqa: E501
"""Currency - a model defined in Swagger""" # noqa: E501
self._currency_code = None
self._decimal_places = None
self.discriminator = None
if currency_code is not None:
self.currency_code = currency_code
if decimal_places is not None:
self.decimal_places = decimal_places
@property
def currency_code(self):
"""Gets the currency_code of this Currency. # noqa: E501
:return: The currency_code of this Currency. # noqa: E501
:rtype: str
"""
return self._currency_code
@currency_code.setter
def currency_code(self, currency_code):
"""Sets the currency_code of this Currency.
:param currency_code: The currency_code of this Currency. # noqa: E501
:type: str
"""
self._currency_code = currency_code
@property
def decimal_places(self):
"""Gets the decimal_places of this Currency. # noqa: E501
:return: The decimal_places of this Currency. # noqa: E501
:rtype: int
"""
return self._decimal_places
@decimal_places.setter
def decimal_places(self, decimal_places):
"""Sets the decimal_places of this Currency.
:param decimal_places: The decimal_places of this Currency. # noqa: E501
:type: int
"""
self._decimal_places = decimal_places
def to_dict(self):
"""Returns the model properties as a dict"""
result = {}
for attr, _ in six.iteritems(self.swagger_types):
value = getattr(self, attr)
if isinstance(value, list):
result[attr] = list(map(
lambda x: x.to_dict() if hasattr(x, "to_dict") else x,
value
))
elif hasattr(value, "to_dict"):
result[attr] = value.to_dict()
elif isinstance(value, dict):
result[attr] = dict(map(
lambda item: (item[0], item[1].to_dict())
if hasattr(item[1], "to_dict") else item,
value.items()
))
else:
result[attr] = value
return result
def to_str(self):
"""Returns the string representation of the model"""
return pprint.pformat(self.to_dict())
def __repr__(self):
"""For `print` and `pprint`"""
return self.to_str()
def __eq__(self, other):
"""Returns true if both objects are equal"""
if not isinstance(other, Currency):
return False
return self.__dict__ == other.__dict__
def __ne__(self, other):
"""Returns true if both objects are not equal"""
return not self == other
| [
"[email protected]"
] | |
aadcbf0b94233b17dbea12ad397b0590f1241baf | bb33e6be8316f35decbb2b81badf2b6dcf7df515 | /source/res/scripts/client/helpers/edgedetectcolorcontroller.py | 65c2877cf2f2b4814e0f3a4c532a57a905ba4be7 | [] | no_license | StranikS-Scan/WorldOfTanks-Decompiled | 999c9567de38c32c760ab72c21c00ea7bc20990c | d2fe9c195825ececc728e87a02983908b7ea9199 | refs/heads/1.18 | 2023-08-25T17:39:27.718097 | 2022-09-22T06:49:44 | 2022-09-22T06:49:44 | 148,696,315 | 103 | 39 | null | 2022-09-14T17:50:03 | 2018-09-13T20:49:11 | Python | UTF-8 | Python | false | false | 3,793 | py | # Python bytecode 2.7 (decompiled from Python 2.7)
# Embedded file name: scripts/client/helpers/EdgeDetectColorController.py
import BigWorld
import Math
from PlayerEvents import g_playerEvents
from Account import PlayerAccount
from helpers import dependency
from skeletons.account_helpers.settings_core import ISettingsCore
_DEFAULT_OVERLAY_COLOR = Math.Vector4(1, 1, 1, 1)
_OVERLAY_SOLID_KEYS = ('overlay', 'destructible')
_OVERLAY_PATTERN_KEYS = ('overlayForeground', 'overlay', 'destructibleForeground', 'destructible')
_OVERLAY_TARGET_INDEXES = {'enemy': 1,
'friend': 2}
g_instance = None
class EdgeDetectColorController(object):
settingsCore = dependency.descriptor(ISettingsCore)
def __init__(self, dataSec):
self.__colors = {'common': dict(),
'colorBlind': dict()}
self.__readColors(self.__colors, 'common', dataSec)
self.__readColors(self.__colors, 'colorBlind', dataSec)
def updateColors(self):
self.__changeColor({'isColorBlind': self.settingsCore.getSetting('isColorBlind')})
def create(self):
self.settingsCore.onSettingsChanged += self.__changeColor
g_playerEvents.onAccountShowGUI += self.__onAccountShowGUI
def destroy(self):
self.settingsCore.onSettingsChanged -= self.__changeColor
g_playerEvents.onAccountShowGUI -= self.__onAccountShowGUI
def __readColors(self, colors, cType, section):
cName = '{}/'.format(cType)
out, common = colors[cType], colors['common']
out['self'] = section.readVector4(cName + 'self', common.get('self', Math.Vector4(0.2, 0.2, 0.2, 0.5)))
out['enemy'] = section.readVector4(cName + 'enemy', common.get('enemy', Math.Vector4(1, 0, 0, 0.5)))
out['friend'] = section.readVector4(cName + 'friend', common.get('friend', Math.Vector4(0, 1, 0, 0.5)))
out['flag'] = section.readVector4(cName + 'flag', common.get('flag', Math.Vector4(1, 1, 1, 1)))
out['hangar'] = section.readVector4(cName + 'hangar', common.get('hangar', Math.Vector4(1, 1, 0, 1)))
self.__readOverlayColors(out, common, cType, 'overlaySolidColors', _OVERLAY_SOLID_KEYS, section)
self.__readOverlayColors(out, common, cType, 'overlayPatternColors', _OVERLAY_PATTERN_KEYS, section)
def __readOverlayColors(self, out, common, cType, overlayType, keys, section):
targets = ['enemy', 'friend']
common, out[overlayType] = common.get(overlayType) or {}, {}
for target in targets:
commonTarget, out[overlayType][target] = common.get(target) or {}, {}
targetPath = '/'.join([cType, overlayType, target]) + '/'
for key in keys:
color = section.readVector4(targetPath + key, commonTarget.get(key, _DEFAULT_OVERLAY_COLOR))
out[overlayType][target][key] = color
out[overlayType][target]['packed'] = [ out[overlayType][target][key] for key in keys ]
def __onAccountShowGUI(self, ctx):
self.updateColors()
def __changeColor(self, diff):
if 'isColorBlind' not in diff:
return
isHangar = isinstance(BigWorld.player(), PlayerAccount)
cType = 'colorBlind' if diff['isColorBlind'] else 'common'
colors = self.__colors[cType]
colorsSet = (colors['hangar'] if isHangar else colors['self'],
colors['enemy'],
colors['friend'],
colors['flag'])
i = 0
for c in colorsSet:
BigWorld.wgSetEdgeDetectEdgeColor(i, c)
i += 1
for target, idx in _OVERLAY_TARGET_INDEXES.iteritems():
BigWorld.wgSetEdgeDetectSolidColors(idx, *colors['overlaySolidColors'][target]['packed'])
BigWorld.wgSetEdgeDetectPatternColors(idx, *colors['overlayPatternColors'][target]['packed'])
| [
"[email protected]"
] | |
f9ce519233fd2afe6e44f4421dd950aae83bb057 | 9c718b8964d476db4728fc0cf18e24292dd8cf60 | /mxshop/MxShop/apps/goods/migrations/0003_auto_20180623_1326.py | 8a898faf7e1b7893e241d7d7688d7cf50c63bdd5 | [] | no_license | 1400720231/Django-Projects | 960f9226e0f5c01628afd65b9a78e810fdeb1b83 | 72f96788163f7ffe76e7599966ddbfa1d2199926 | refs/heads/master | 2021-06-25T17:41:14.147011 | 2019-04-03T02:24:38 | 2019-04-03T02:24:38 | 114,955,012 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 471 | py | # -*- coding: utf-8 -*-
# Generated by Django 1.10 on 2018-06-23 13:26
from __future__ import unicode_literals
from django.db import migrations
class Migration(migrations.Migration):
dependencies = [
('goods', '0002_goodscategorybrand_category'),
]
operations = [
migrations.AlterModelOptions(
name='goodscategory',
options={'verbose_name': '商品类目', 'verbose_name_plural': '商品类目'},
),
]
| [
"[email protected]"
] | |
40903430884cb63c47a7d28f94fa27d31ac66245 | 92adce9ebf87fc374f6cc093f68d14b7dc7a697f | /read.py | 2a08a459948865f3bdc2e5d27e913a2e6bdb6128 | [
"MIT"
] | permissive | nicolay-r/RuSentRel | 1f4f5678fdcbe342bda82834d6192a70b5c8b94c | 4fc0df1580d3da21f0be1e832e403652f73caed1 | refs/heads/master | 2021-08-27T16:49:34.342494 | 2021-08-03T06:48:39 | 2021-08-03T06:48:39 | 128,990,497 | 6 | 2 | MIT | 2021-08-03T06:48:39 | 2018-04-10T20:22:16 | Python | UTF-8 | Python | false | false | 3,153 | py | #!/usr/bin/python
from reader.common.bound import Bound
from reader.common.entities.collection import EntityCollection
from reader.common.lemmatization.mystem import MystemWrapper
from reader.entities.collection import RuSentRelDocumentEntityCollection
from reader.entities.entity import RuSentRelEntity
from reader.news import RuSentRelNews
from reader.opinions.collection import RuSentRelOpinionCollection
from reader.opinions.opinion import RuSentRelOpinion
from reader.sentence import RuSentRelSentence
from reader.synonyms import RuSentRelSynonymsCollection
import utils
# Initializing stemmer
stemmer = MystemWrapper()
# Reading synonyms collection.
synonyms = RuSentRelSynonymsCollection.from_file('synonyms.txt', stemmer=stemmer)
# Reading 'train' subfolder of collection.
train_root = 'test'
for news_id in utils.get_rusentrel_test_indices():
print("NewsID: {}".format(news_id))
# Init filepaths
entities_filepath = utils.get_rusentrel_entity_filepath(news_id, root=train_root)
news_filepath = utils.get_rusentrel_news_filepath(news_id, root=train_root)
opinion_filepath = utils.get_rusentrel_format_sentiment_opin_filepath(news_id, root=train_root, is_etalon=True)
# Read collections
entities = RuSentRelDocumentEntityCollection.from_file(entities_filepath, stemmer=stemmer, synonyms=synonyms)
news = RuSentRelNews.from_file(news_filepath, entities)
opininons = RuSentRelOpinionCollection.from_file(opinion_filepath, synonyms=synonyms)
#############
# Application
#############
# Example: Access to the read OPINIONS collection.
for opinion in opininons:
assert(isinstance(opinion, RuSentRelOpinion))
print("\t{}->{} ({}) [synonym groups opinion: {}->{}]".format(
opinion.SourceValue,
opinion.TargetValue,
opinion.Sentiment.to_str(),
# Considering synonyms.
synonyms.get_synonym_group_index(opinion.SourceValue),
synonyms.get_synonym_group_index(opinion.TargetValue)))
# Example: Access to the read NEWS collection.
for sentence in news.iter_sentences():
assert(isinstance(sentence, RuSentRelSentence))
# Access to text.
print("\tSentence: '{}'".format(sentence.Text.strip()))
# Access to inner entities.
for entity, bound in sentence.iter_entity_with_local_bounds():
assert(isinstance(entity, RuSentRelEntity))
assert(isinstance(bound, Bound))
print("\tEntity: {}, text position: ({}-{}), IdInDocument: {}".format(
entity.Value,
bound.Position,
bound.Position + bound.Length,
entity.IdInDocument))
# Example: Access to the read ENTITIES collection.
example_entity = entities.get_entity_by_index(10)
entities_list = entities.try_get_entities(example_entity.Value,
group_key=EntityCollection.KeyType.BY_SYNONYMS)
print("\tText synonymous to: '{}'".format(example_entity.Value))
print("\t[{}]".format(", ".join([str((e.Value, str(e.IdInDocument))) for e in entities_list])))
| [
"[email protected]"
] | |
c7d4ab5c5775b06d53e956773414cb4210cd5023 | c4a3eeabe660e5d6b42f704d0325a755331ab3c5 | /hyperion/hyperion_sedcom.py | 93f0c5a6dcaec34cae9ebd884d6942b366f84b70 | [] | no_license | yaolun/misc | dfcfde2ac4a6429201644e1354912d3a064f9524 | 049b68ce826ddf638cec9a3b995d9ee84bf6075a | refs/heads/master | 2021-01-21T23:54:08.953071 | 2018-06-02T19:46:18 | 2018-06-02T19:46:18 | 26,666,071 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 4,970 | py | def hyperion_sedcom(modellist, outdir, plotname, obs_data=None, labellist=None, lbol=False, legend=True, mag=1.5,\
obs_preset='sh', dstar=1, aper=[3.6, 4.5, 5.8, 8.0, 10, 20, 24, 70, 160, 250, 350, 500, 850]):
"""
obs_data: dictionary which obs_data['spec'] is spectrum and obs_data['phot'] is photometry
obs_data['label'] = (wave, Fv, err) in um and Jy by default
"""
import numpy as np
import os
import matplotlib.pyplot as plt
import astropy.constants as const
from hyperion.model import ModelOutput
from scipy.interpolate import interp1d
from l_bol import l_bol
import seaborn as sb
# from seaborn import color_palette
# from seaborn_color import seaborn_color
# constant setup
c = const.c.cgs.value
pc = const.pc.cgs.value
if labellist == None:
if legend == True:
print 'Model labels are not provided. Use their filename instead.'
labellist = []
for i in range(0, len(modellist)):
labellist.append(r'$\mathrm{'+os.path.splitext(os.path.basename(modellist[i]))[0]+'}$')
# cm = seaborn_color('colorblind',len(modellist))
sb.set(style="white")
cm = sb.color_palette('husl', len(modellist))
# create figure object
fig = plt.figure(figsize=(8*mag,6*mag))
ax = fig.add_subplot(111)
# sb.set_style('ticks')
print 'plotting with aperture at ', aper, 'um'
# if the obs_data is provided than plot the observation first. In this way, models won't be blocked by data
if obs_data != None:
if 'spec' in obs_data.keys():
(wave, fv, err) = obs_data['spec']
vfv = c/(wave*1e-4)*fv*1e-23
l_bol_obs = l_bol(wave, fv, dstar)
if legend == True:
ax.text(0.75,0.9,r'$\mathrm{L_{bol}= %5.2f L_{\odot}}$' % l_bol_obs,fontsize=mag*16,transform=ax.transAxes)
# general plotting scheme
if obs_preset == None:
spec, = ax.plot(np.log10(wave),np.log10(vfv),'-',color='k',linewidth=1.5*mag, label=r'$\mathrm{observations}$')
# plot spitzer, Herschel pacs and spire in different colors
elif obs_preset == 'sh':
# spitzer
spitz, = ax.plot(np.log10(wave[wave < 50]),np.log10(vfv[wave < 50]),'-',color='b',linewidth=1*mag,\
label=r'$\mathrm{\it Spitzer}$')
# herschel
pacs, = ax.plot(np.log10(wave[(wave < 190.31) & (wave > 50)]),np.log10(vfv[(wave < 190.31) & (wave > 50)]),'-',\
color='Green',linewidth=1*mag, label=r'$\mathrm{{\it Herschel}-PACS}$')
spire, = ax.plot(np.log10(wave[wave >= 190.31]),np.log10(vfv[wave >= 190.31]),'-',color='k',linewidth=1*mag,\
label=r'$\mathrm{{\it Herschel}-SPIRE}$')
spec = [spitz, pacs, spire]
if 'phot' in obs_data.keys():
(wave_p, fv_p, err_p) = obs_data['phot']
vfv_p = c/(wave_p*1e-4)*fv_p*1e-23
vfv_p_err = c/(wave_p*1e-4)*err_p*1e-23
phot, = ax.plot(np.log10(wave_p),np.log10(vfv_p),'s',mfc='DimGray',mec='k',markersize=8)
ax.errorbar(np.log10(wave_p),np.log10(vfv_p),yerr=[np.log10(vfv_p)-np.log10(vfv_p-vfv_p_err), np.log10(vfv_p+vfv_p_err)-np.log10(vfv_p)],\
fmt='s',mfc='DimGray',mec='k',markersize=8)
modplot = dict()
for imod in range(0, len(modellist)):
m = ModelOutput(modellist[imod])
# if not specified, distance of the star will be taken as 1 pc.
if aper == None:
sed_dum = m.get_sed(group=0, inclination=0, aperture=-1, distance=dstar * pc)
modplot['mod'+str(imod+1)], = ax_sed.plot(np.log10(sed_dum.wav), np.log10(sed_dum.val), '-', color='GoldenRod', linewidth=1.5*mag)
else:
vfv_aper = np.empty_like(aper)
for i in range(0, len(aper)):
sed_dum = m.get_sed(group=i+1, inclination=0, aperture=-1, distance=dstar * pc)
f = interp1d(sed_dum.wav, sed_dum.val)
vfv_aper[i] = f(aper[i])
modplot['mod'+str(imod+1)], = ax.plot(np.log10(aper),np.log10(vfv_aper),'o',mfc='None',mec=cm[imod],markersize=12,\
markeredgewidth=3, label=labellist[imod], linestyle='-',color=cm[imod],linewidth=1.5*mag)
# plot fine tune
ax.set_xlabel(r'$\mathrm{log~\lambda~({\mu}m)}$',fontsize=mag*20)
ax.set_ylabel(r'$\mathrm{log~\nu S_{\nu}~(erg/cm^{2}/s)}$',fontsize=mag*20)
[ax.spines[axis].set_linewidth(1.5*mag) for axis in ['top','bottom','left','right']]
ax.minorticks_on()
ax.tick_params('both',labelsize=mag*18,width=1.5*mag,which='major',pad=15,length=5*mag)
ax.tick_params('both',labelsize=mag*18,width=1.5*mag,which='minor',pad=15,length=2.5*mag)
if obs_preset == 'sh':
ax.set_ylim([-14,-7])
ax.set_xlim([0,3])
if legend == True:
lg = ax.legend(loc='best',fontsize=14*mag,numpoints=1,framealpha=0.3)
# Write out the plot
fig.savefig(outdir+plotname+'.pdf',format='pdf',dpi=300,bbox_inches='tight')
fig.clf()
# import numpy as np
# from get_bhr71_obs import get_bhr71_obs
# obs_data = get_bhr71_obs('/Users/yaolun/bhr71/obs_for_radmc/')
# mod_num = [32,56]
# modellist = []
# modir = '/Users/yaolun/test/model'
# for mod in mod_num:
# modellist.append(modir+str(mod)+'/model'+str(mod)+'.rtout')
# outdir = '/Users/yaolun/test/'
# hyperion_sedcom(modellist, outdir, 'test', obs_data=obs_data, lbol=True, dstar=178)
| [
"[email protected]"
] | |
6eed42b73bb347a25e6a01089fb43ea62d05b786 | 282d0a84b45b12359b96bbf0b1d7ca9ee0cb5d19 | /Malware1/venv/Lib/site-packages/pandas/tests/scalar/timedelta/test_arithmetic.py | 9fd1780c8ab77d3e11c59fa5cff81d29267a95f1 | [] | no_license | sameerakhtar/CyberSecurity | 9cfe58df98495eac6e4e2708e34e70b7e4c055d3 | 594973df27b4e1a43f8faba0140ce7d6c6618f93 | refs/heads/master | 2022-12-11T11:53:40.875462 | 2020-09-07T23:13:22 | 2020-09-07T23:13:22 | 293,598,094 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 130 | py | version https://git-lfs.github.com/spec/v1
oid sha256:fa4d666d9e29f8945376652f7fb7084c3be064a66d0592c045742bd872cd8934
size 22242
| [
"[email protected]"
] | |
5744415b18511a257ef945bcfa2df6f5ae1b04d1 | ca7aa979e7059467e158830b76673f5b77a0f5a3 | /Python_codes/p02954/s798759253.py | 36a83144ddfc3b7f136a3c3568e3fead3056d7a7 | [] | no_license | Aasthaengg/IBMdataset | 7abb6cbcc4fb03ef5ca68ac64ba460c4a64f8901 | f33f1c5c3b16d0ea8d1f5a7d479ad288bb3f48d8 | refs/heads/main | 2023-04-22T10:22:44.763102 | 2021-05-13T17:27:22 | 2021-05-13T17:27:22 | 367,112,348 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 709 | py | S = input() + 'R'
numbers = [0] * (len(S) - 1)
offset = 0
length = 0
right = 0
left = 0
for index, (s0, s1) in enumerate(zip(S, S[1:])):
length += 1
if s0 == 'R' and s1 == 'L':
right = length - 1
left = length
elif s0 == 'L' and s1 == 'R':
if length % 2 == 0:
numbers[offset + right] = length // 2
numbers[offset + left] = length // 2
elif right % 2 == 0:
numbers[offset + right] = length // 2 + 1
numbers[offset + left] = length // 2
else:
numbers[offset + right] = length // 2
numbers[offset + left] = length // 2 + 1
length = 0
offset = index + 1
print(*numbers)
| [
"[email protected]"
] | |
30331b3f91ed037754998e3d702452ca29ec74bf | fca1edf135c49edf08a51d6758a18b0bffe69309 | /todobackend/todobackend/views.py | 47d0a4f5fcc9bf4b254736902e56b77beafda449 | [] | no_license | BakdauletBolatE/myfirstTodo | 9d1daa8ac08806524dff1cc975d165dca8fb1b1f | c8e9f29afca06ce2198847770c777f96c09eefbb | refs/heads/master | 2023-04-18T04:07:27.684527 | 2021-04-30T20:04:15 | 2021-04-30T20:04:15 | 363,240,056 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 106 | py | from django.shortcuts import render
def index(request):
return render(request,'todoapp/index.html') | [
"[email protected]"
] | |
c7c6601ede207fab5b186671af8d6270d38078ca | 75dcb56e318688499bdab789262839e7f58bd4f6 | /_algorithms_challenges/leetcode/LeetcodePythonProject/leetcode_0451_0500/LeetCode460_LFUCache.py | b209a542f7836f153654b987fa1ac33c01e19f6d | [] | no_license | syurskyi/Algorithms_and_Data_Structure | 9a1f358577e51e89c862d0f93f373b7f20ddd261 | 929dde1723fb2f54870c8a9badc80fc23e8400d3 | refs/heads/master | 2023-02-22T17:55:55.453535 | 2022-12-23T03:15:00 | 2022-12-23T03:15:00 | 226,243,987 | 4 | 1 | null | 2023-02-07T21:01:45 | 2019-12-06T04:14:10 | Jupyter Notebook | UTF-8 | Python | false | false | 4,277 | py | '''
Created on Apr 23, 2017
@author: MT
'''
class Node(object):
def __init__(self, key, val):
self.val = val
self.next = None
self.prev = None
self.freq = 1
self.key = key
class LFUCache(object):
def __init__(self, capacity):
"""
:type capacity: int
"""
self.capacity = capacity
self.hashmap = {}
self.freqMap = {}
self.length = 0
self.head = Node(-1, -1)
self.tail = Node(-1, -1)
self.head.next = self.tail
self.head.freq = float('-inf')
self.tail.freq = float('inf')
def get(self, key):
"""
:type key: int
:rtype: int
"""
if key not in self.hashmap:
return -1
else:
value = self.hashmap[key].val
self.updateNode(self.hashmap[key])
return value
def put(self, key, value):
"""
:type key: int
:type value: int
:rtype: void
"""
if self.capacity == 0:
return
if key in self.hashmap:
self.hashmap[key].val = value
self.updateNode(self.hashmap[key])
else:
if self.capacity > self.length:
self.length += 1
node = Node(key, value)
self.hashmap[key] = node
node.freq = 1
if 1 in self.freqMap:
tmp = self.freqMap[1][1] # tail of freq
nextNode = tmp.next
tmp.next = node
node.prev = tmp
node.next = nextNode
node.next.prev = node
self.freqMap[1][1] = node
else:
nextNode = self.head.next
node.next = nextNode
node.prev = self.head
nextNode.prev = node
self.head.next = node
self.freqMap[1] = [node, node]
else:
node = Node(key, value)
self.hashmap[key] = node
firstNode = self.head.next
freq = firstNode.freq
if self.freqMap[freq][0] == self.freqMap[freq][1]:
self.head.next = firstNode.next
firstNode.next.prev = self.head
del self.freqMap[freq]
else:
self.freqMap[freq][0] = self.freqMap[freq][0].next
self.head.next = firstNode.next
firstNode.next.prev = self.head
del self.hashmap[firstNode.key]
if 1 in self.freqMap:
tmp = self.freqMap[1][1] # tail of freq
nextNode = tmp.next
tmp.next = node
node.prev = tmp
node.next = nextNode
node.next.prev = node
self.freqMap[1][1] = node
else:
nextNode = self.head.next
nextNode.prev = node
node.next = nextNode
self.head.next = node
node.prev = self.head
self.freqMap[1] = [node, node]
def updateNode(self, node):
freq = node.freq
nextNode = self.freqMap[freq][1].next
node.prev.next = node.next
node.next.prev = node.prev
if self.freqMap[freq][0] == self.freqMap[freq][1]:
del self.freqMap[freq]
else:
if self.freqMap[freq][0] == node:
self.freqMap[freq][0] = node.next
if self.freqMap[freq][1] == node:
self.freqMap[freq][1] = node.prev
node.freq += 1
freq += 1
if freq in self.freqMap:
tail = self.freqMap[freq][1]
node.next = tail.next
tail.next = node
node.next.prev = node
node.prev = tail
self.freqMap[freq][1] = node
else:
prevNode = nextNode.prev
prevNode.next = node
node.next = nextNode
nextNode.prev = node
node.prev = prevNode
self.freqMap[freq] = [node, node]
| [
"[email protected]"
] | |
8b634a88c02b8398beec70c04cb11898abd76653 | bb150497a05203a718fb3630941231be9e3b6a32 | /models/PaddleHub/hub_all_func/test_ID_Photo_GEN.py | f43c8cd99596b00e1f7cb91e1e66c9e5fca71e42 | [] | no_license | PaddlePaddle/PaddleTest | 4fb3dec677f0f13f7f1003fd30df748bf0b5940d | bd3790ce72a2a26611b5eda3901651b5a809348f | refs/heads/develop | 2023-09-06T04:23:39.181903 | 2023-09-04T11:17:50 | 2023-09-04T11:17:50 | 383,138,186 | 42 | 312 | null | 2023-09-13T11:13:35 | 2021-07-05T12:44:59 | Python | UTF-8 | Python | false | false | 642 | py | """ID_Photo_GEN"""
import os
import cv2
import paddle
import paddlehub as hub
if paddle.is_compiled_with_cuda():
paddle.set_device("gpu")
use_gpu = True
else:
paddle.set_device("cpu")
use_gpu = False
def test_ID_Photo_GEN_predict():
"""ID_Photo_GEN"""
os.system("hub install ID_Photo_GEN")
model = hub.Module(name="ID_Photo_GEN")
result = model.Photo_GEN(
images=[cv2.imread("face_01.jpeg")],
paths=None,
batch_size=1,
output_dir="output_ID_Photo_GEN",
visualization=True,
use_gpu=use_gpu,
)
print(result)
os.system("hub uninstall ID_Photo_GEN")
| [
"[email protected]"
] | |
e0993846926170ccec472592ba4c25eadd8b01b5 | 0fa98dbc4d6256121b9f478a13ff2254047fb543 | /12_01_typical_interview_tasks/K. One in a binary number.py | b5aaa9111c3f0e1f571ed9c30e528b3a2e6a41b5 | [] | no_license | vamotest/yandex_algorithms | 48d5b29cb6e2789ea8f7e8024c798851058f1d4c | a588da3d21ff95e2437818493769719600f3eaf7 | refs/heads/master | 2023-03-19T20:44:59.373046 | 2021-01-20T19:06:28 | 2021-01-20T19:06:28 | 330,421,669 | 3 | 1 | null | null | null | null | UTF-8 | Python | false | false | 358 | py |
def binary_convert(number):
binary_number = ''
while number > 0:
binary_number = str(number % 2) + binary_number
number = number // 2
return binary_number
def find_amount(binary_number):
return binary_number.count('1')
if __name__ == '__main__':
count = find_amount(binary_convert(int(input())))
print(count)
| [
"[email protected]"
] | |
de6b02deb9e80be2b82f5b65928b23b1d4744a49 | d554b1aa8b70fddf81da8988b4aaa43788fede88 | /5 - Notebooks e Data/1 - Análises numéricas/Arquivos David/Atualizados/logDicas-master/data/2019-1/222/users/4029/codes/1643_1054.py | 8a3c8ff612464a89b4701c45ea86a8670cc77b5b | [] | no_license | JosephLevinthal/Research-projects | a3bc3ca3b09faad16f5cce5949a2279cf14742ba | 60d5fd6eb864a5181f4321e7a992812f3c2139f9 | refs/heads/master | 2022-07-31T06:43:02.686109 | 2020-05-23T00:24:26 | 2020-05-23T00:24:26 | 266,199,309 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 176 | py | x= float(input("Coordenada x: "))
y= float(input("Coordenada y: "))
if (((2 * x) + y == 3)):
print ("ponto pertence a reta")
else:
print ("ponto nao pertence a reta")
| [
"[email protected]"
] | |
37591cad599ca130ba2cdf6a22dc5e86d13f686f | ae0f37ebb76bce44c5e366d62424b5ef411f94b3 | /3. OOP/Tutorial/Rational.py | f83ae514fef27d48b4fc04bc06c6667e5dfeaacd | [] | no_license | khangsk/PPL | a30b656a8a70b8f6dd96ce39f57d3540495a5a26 | b8e3a04210796e03ff257c05cd1e60923f016d2f | refs/heads/master | 2023-02-21T09:28:25.216162 | 2021-01-18T09:35:15 | 2021-01-18T09:35:15 | 306,542,959 | 0 | 1 | null | null | null | null | UTF-8 | Python | false | false | 804 | py | import math
class Rational:
def __init__(self, n = 0, d = 1):
assert(d != 0)
g = math.gcd(abs(n), abs(d))
self.numer = int(n / g)
self.denom = int(d / g)
def __str__(self):
return str(self.numer) + "/" + str(self.denom)
def __add__(self, another):
targetType = type(another).__name__
if targetType == 'int':
return self.addRational(Rational(another))
elif targetType == 'Rational':
return self.addRational(another)
raise Exception('Rational not support operator + with type ' + targetType)
def addRational(self, r):
assert(type(r).__name__ == 'Rational')
return Rational(
self.numer * r.denom + self.denom * r.numer,
self.denom * r.denom
) | [
"[email protected]"
] | |
061aebdb29e7c6907a3a9ac112f56e81483271f8 | 15f321878face2af9317363c5f6de1e5ddd9b749 | /solutions_python/Problem_156/832.py | 6c50802fc3b768a580b91d24aaf771150f9157d8 | [] | no_license | dr-dos-ok/Code_Jam_Webscraper | c06fd59870842664cd79c41eb460a09553e1c80a | 26a35bf114a3aa30fc4c677ef069d95f41665cc0 | refs/heads/master | 2020-04-06T08:17:40.938460 | 2018-10-14T10:12:47 | 2018-10-14T10:12:47 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,650 | py | #!/usr/bin/env python
import sys
from math import ceil, floor
def solve_naive_test(pancakes_per_plate, minute=0):
if not any(pancakes_per_plate):
return minute
else:
splits = xrange(len(pancakes_per_plate))
eaten_one = [(x - 1) if x > 0 else 0 for x in pancakes_per_plate]
solutions = [solve_naive_test(eaten_one, minute + 1)]
for split in splits:
if pancakes_per_plate[split] > 2:
split_one = pancakes_per_plate[:split]
split_one.append(int(floor(pancakes_per_plate[split] / 2.0)))
split_one.append(int(ceil(pancakes_per_plate[split] / 2.0)))
split_one.extend(pancakes_per_plate[split + 1:])
solutions.append(solve_naive_test(split_one, minute + 1))
return min(solutions)
def one_eaten(plates):
return [(x - 1) if x > 0 else 0 for x in plates]
def mean(l):
return float(sum(l)) / len(l)
def max_split(slope, max_slope, max_count):
for p in xrange(1, int(max_slope / 2.0) + 1):
s = list(slope)
for x in xrange(max_count):
s[x] -= p
s.extend([p] * max_count)
#print '\t', s
yield s
def solve(pancakes_per_plate, minute=0, log=[]):
if not any(pancakes_per_plate):
return (minute, log)
else:
slope = list(sorted(pancakes_per_plate, reverse=True))
max_slope = max(slope)
max_count = sum(1 for p in slope if p == max_slope)
#print slope, max_slope, max_count
solutions = [solve(one_eaten(slope), minute + 1, log + ['eat'])]
if max_slope > 2:
for split in max_split(slope, max_slope, max_count):
solutions.append(
solve(
split,
minute + max_count,
log + ['split {x}'.format(x=max_count)],
))
return min(solutions, key=lambda k: k[0])
if __name__ == '__main__':
input_file_name = sys.argv[1]
input_file = open(input_file_name)
number_of_cases = int(input_file.readline().strip())
first_case_number = 1
for x in xrange(number_of_cases):
sys.stderr.write("{x}\n".format(x=x))
nonempty_plate_count = int(input_file.readline().strip())
pancakes_per_plate = [int(d) for d in input_file.readline().strip().split()]
#print "Input", pancakes_per_plate
solution, log = solve(pancakes_per_plate)
print "Case #{case_number}: {minutes_needed}".format(
case_number=(first_case_number + x),
minutes_needed=solution
)
#print log
| [
"[email protected]"
] | |
7f635137feec443809b1f3a31a83d1c7aeda4e2d | ba694353a3cb1cfd02a6773b40f693386d0dba39 | /sdk/python/pulumi_google_native/compute/v1/get_node_group.py | 9d5b2f685d300d8534f4e615881b009826f37060 | [
"BSD-3-Clause",
"Apache-2.0"
] | permissive | pulumi/pulumi-google-native | cc57af8bd3d1d6b76f1f48333ed1f1b31d56f92b | 124d255e5b7f5440d1ef63c9a71e4cc1d661cd10 | refs/heads/master | 2023-08-25T00:18:00.300230 | 2023-07-20T04:25:48 | 2023-07-20T04:25:48 | 323,680,373 | 69 | 16 | Apache-2.0 | 2023-09-13T00:28:04 | 2020-12-22T16:39:01 | Python | UTF-8 | Python | false | false | 10,612 | py | # coding=utf-8
# *** WARNING: this file was generated by the Pulumi SDK Generator. ***
# *** Do not edit by hand unless you're certain you know what you are doing! ***
import copy
import warnings
import pulumi
import pulumi.runtime
from typing import Any, Mapping, Optional, Sequence, Union, overload
from ... import _utilities
from . import outputs
__all__ = [
'GetNodeGroupResult',
'AwaitableGetNodeGroupResult',
'get_node_group',
'get_node_group_output',
]
@pulumi.output_type
class GetNodeGroupResult:
def __init__(__self__, autoscaling_policy=None, creation_timestamp=None, description=None, fingerprint=None, kind=None, location_hint=None, maintenance_policy=None, maintenance_window=None, name=None, node_template=None, self_link=None, share_settings=None, size=None, status=None, zone=None):
if autoscaling_policy and not isinstance(autoscaling_policy, dict):
raise TypeError("Expected argument 'autoscaling_policy' to be a dict")
pulumi.set(__self__, "autoscaling_policy", autoscaling_policy)
if creation_timestamp and not isinstance(creation_timestamp, str):
raise TypeError("Expected argument 'creation_timestamp' to be a str")
pulumi.set(__self__, "creation_timestamp", creation_timestamp)
if description and not isinstance(description, str):
raise TypeError("Expected argument 'description' to be a str")
pulumi.set(__self__, "description", description)
if fingerprint and not isinstance(fingerprint, str):
raise TypeError("Expected argument 'fingerprint' to be a str")
pulumi.set(__self__, "fingerprint", fingerprint)
if kind and not isinstance(kind, str):
raise TypeError("Expected argument 'kind' to be a str")
pulumi.set(__self__, "kind", kind)
if location_hint and not isinstance(location_hint, str):
raise TypeError("Expected argument 'location_hint' to be a str")
pulumi.set(__self__, "location_hint", location_hint)
if maintenance_policy and not isinstance(maintenance_policy, str):
raise TypeError("Expected argument 'maintenance_policy' to be a str")
pulumi.set(__self__, "maintenance_policy", maintenance_policy)
if maintenance_window and not isinstance(maintenance_window, dict):
raise TypeError("Expected argument 'maintenance_window' to be a dict")
pulumi.set(__self__, "maintenance_window", maintenance_window)
if name and not isinstance(name, str):
raise TypeError("Expected argument 'name' to be a str")
pulumi.set(__self__, "name", name)
if node_template and not isinstance(node_template, str):
raise TypeError("Expected argument 'node_template' to be a str")
pulumi.set(__self__, "node_template", node_template)
if self_link and not isinstance(self_link, str):
raise TypeError("Expected argument 'self_link' to be a str")
pulumi.set(__self__, "self_link", self_link)
if share_settings and not isinstance(share_settings, dict):
raise TypeError("Expected argument 'share_settings' to be a dict")
pulumi.set(__self__, "share_settings", share_settings)
if size and not isinstance(size, int):
raise TypeError("Expected argument 'size' to be a int")
pulumi.set(__self__, "size", size)
if status and not isinstance(status, str):
raise TypeError("Expected argument 'status' to be a str")
pulumi.set(__self__, "status", status)
if zone and not isinstance(zone, str):
raise TypeError("Expected argument 'zone' to be a str")
pulumi.set(__self__, "zone", zone)
@property
@pulumi.getter(name="autoscalingPolicy")
def autoscaling_policy(self) -> 'outputs.NodeGroupAutoscalingPolicyResponse':
"""
Specifies how autoscaling should behave.
"""
return pulumi.get(self, "autoscaling_policy")
@property
@pulumi.getter(name="creationTimestamp")
def creation_timestamp(self) -> str:
"""
Creation timestamp in RFC3339 text format.
"""
return pulumi.get(self, "creation_timestamp")
@property
@pulumi.getter
def description(self) -> str:
"""
An optional description of this resource. Provide this property when you create the resource.
"""
return pulumi.get(self, "description")
@property
@pulumi.getter
def fingerprint(self) -> str:
return pulumi.get(self, "fingerprint")
@property
@pulumi.getter
def kind(self) -> str:
"""
The type of the resource. Always compute#nodeGroup for node group.
"""
return pulumi.get(self, "kind")
@property
@pulumi.getter(name="locationHint")
def location_hint(self) -> str:
"""
An opaque location hint used to place the Node close to other resources. This field is for use by internal tools that use the public API. The location hint here on the NodeGroup overrides any location_hint present in the NodeTemplate.
"""
return pulumi.get(self, "location_hint")
@property
@pulumi.getter(name="maintenancePolicy")
def maintenance_policy(self) -> str:
"""
Specifies how to handle instances when a node in the group undergoes maintenance. Set to one of: DEFAULT, RESTART_IN_PLACE, or MIGRATE_WITHIN_NODE_GROUP. The default value is DEFAULT. For more information, see Maintenance policies.
"""
return pulumi.get(self, "maintenance_policy")
@property
@pulumi.getter(name="maintenanceWindow")
def maintenance_window(self) -> 'outputs.NodeGroupMaintenanceWindowResponse':
return pulumi.get(self, "maintenance_window")
@property
@pulumi.getter
def name(self) -> str:
"""
The name of the resource, provided by the client when initially creating the resource. The resource name must be 1-63 characters long, and comply with RFC1035. Specifically, the name must be 1-63 characters long and match the regular expression `[a-z]([-a-z0-9]*[a-z0-9])?` which means the first character must be a lowercase letter, and all following characters must be a dash, lowercase letter, or digit, except the last character, which cannot be a dash.
"""
return pulumi.get(self, "name")
@property
@pulumi.getter(name="nodeTemplate")
def node_template(self) -> str:
"""
URL of the node template to create the node group from.
"""
return pulumi.get(self, "node_template")
@property
@pulumi.getter(name="selfLink")
def self_link(self) -> str:
"""
Server-defined URL for the resource.
"""
return pulumi.get(self, "self_link")
@property
@pulumi.getter(name="shareSettings")
def share_settings(self) -> 'outputs.ShareSettingsResponse':
"""
Share-settings for the node group
"""
return pulumi.get(self, "share_settings")
@property
@pulumi.getter
def size(self) -> int:
"""
The total number of nodes in the node group.
"""
return pulumi.get(self, "size")
@property
@pulumi.getter
def status(self) -> str:
return pulumi.get(self, "status")
@property
@pulumi.getter
def zone(self) -> str:
"""
The name of the zone where the node group resides, such as us-central1-a.
"""
return pulumi.get(self, "zone")
class AwaitableGetNodeGroupResult(GetNodeGroupResult):
# pylint: disable=using-constant-test
def __await__(self):
if False:
yield self
return GetNodeGroupResult(
autoscaling_policy=self.autoscaling_policy,
creation_timestamp=self.creation_timestamp,
description=self.description,
fingerprint=self.fingerprint,
kind=self.kind,
location_hint=self.location_hint,
maintenance_policy=self.maintenance_policy,
maintenance_window=self.maintenance_window,
name=self.name,
node_template=self.node_template,
self_link=self.self_link,
share_settings=self.share_settings,
size=self.size,
status=self.status,
zone=self.zone)
def get_node_group(node_group: Optional[str] = None,
project: Optional[str] = None,
zone: Optional[str] = None,
opts: Optional[pulumi.InvokeOptions] = None) -> AwaitableGetNodeGroupResult:
"""
Returns the specified NodeGroup. Get a list of available NodeGroups by making a list() request. Note: the "nodes" field should not be used. Use nodeGroups.listNodes instead.
"""
__args__ = dict()
__args__['nodeGroup'] = node_group
__args__['project'] = project
__args__['zone'] = zone
opts = pulumi.InvokeOptions.merge(_utilities.get_invoke_opts_defaults(), opts)
__ret__ = pulumi.runtime.invoke('google-native:compute/v1:getNodeGroup', __args__, opts=opts, typ=GetNodeGroupResult).value
return AwaitableGetNodeGroupResult(
autoscaling_policy=pulumi.get(__ret__, 'autoscaling_policy'),
creation_timestamp=pulumi.get(__ret__, 'creation_timestamp'),
description=pulumi.get(__ret__, 'description'),
fingerprint=pulumi.get(__ret__, 'fingerprint'),
kind=pulumi.get(__ret__, 'kind'),
location_hint=pulumi.get(__ret__, 'location_hint'),
maintenance_policy=pulumi.get(__ret__, 'maintenance_policy'),
maintenance_window=pulumi.get(__ret__, 'maintenance_window'),
name=pulumi.get(__ret__, 'name'),
node_template=pulumi.get(__ret__, 'node_template'),
self_link=pulumi.get(__ret__, 'self_link'),
share_settings=pulumi.get(__ret__, 'share_settings'),
size=pulumi.get(__ret__, 'size'),
status=pulumi.get(__ret__, 'status'),
zone=pulumi.get(__ret__, 'zone'))
@_utilities.lift_output_func(get_node_group)
def get_node_group_output(node_group: Optional[pulumi.Input[str]] = None,
project: Optional[pulumi.Input[Optional[str]]] = None,
zone: Optional[pulumi.Input[str]] = None,
opts: Optional[pulumi.InvokeOptions] = None) -> pulumi.Output[GetNodeGroupResult]:
"""
Returns the specified NodeGroup. Get a list of available NodeGroups by making a list() request. Note: the "nodes" field should not be used. Use nodeGroups.listNodes instead.
"""
...
| [
"[email protected]"
] | |
db6b50f1fb9d0dd10bd09ef05b6d826b4e4dc87e | 91d1a6968b90d9d461e9a2ece12b465486e3ccc2 | /elbv2_read/ssl-policy_list_custom.py | 03504aaa68bf723809ae33af5c520e79b7bfbca0 | [] | no_license | lxtxl/aws_cli | c31fc994c9a4296d6bac851e680d5adbf7e93481 | aaf35df1b7509abf5601d3f09ff1fece482facda | refs/heads/master | 2023-02-06T09:00:33.088379 | 2020-12-27T13:38:45 | 2020-12-27T13:38:45 | 318,686,394 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,992 | py | #!/usr/bin/python
# -*- codding: utf-8 -*-
import os
import sys
sys.path.append(os.path.dirname(os.path.abspath(os.path.dirname(__file__))))
from common.execute_command import read_no_parameter_custom
# url : https://awscli.amazonaws.com/v2/documentation/api/latest/reference/elbv2/describe-ssl-policies.html
if __name__ == '__main__':
"""
"""
parameter_num = len(sys.argv)
if parameter_num != 3:
print("config value is not exist")
print("Usage: python {} <config> <template>".format(sys.argv[0]))
print("Support template : base, uid")
sys.exit(1)
profile_name = sys.argv[1]
template_name = sys.argv[2]
if template_name == "base":
output_name = "table"
query_name = """\"
SslPolicies[*].[
Name
,SslProtocols[] | join(',',@)
,Ciphers[].Name | join(',',@)
]
\""""
elif template_name == "uid":
output_name = "text"
query_name = """\"
\""""
else:
print("Usage : {} template name is not exist".format(template_name))
print("Support template : base, uid")
sys.exit(1)
change_query_name = query_name.replace("\n", "")
change_query_name = change_query_name.replace(" ", "")
add_option_dict = {}
#######################################################################
# setting option use
# ex: add_option_dict["setting_matching_parameter"] = "--owners"
# ex: add_option_dict["setting_key"] = "owner_id"
#######################################################################
# single parameter
# ex: add_option_dict["no_value_parameter_list"] = "--single-parameter"
#######################################################################
# custom parameter
add_option_dict["output"] = output_name
add_option_dict["query"] = change_query_name
read_no_parameter_custom("elbv2", "describe-ssl-policies", add_option_dict)
| [
"[email protected]"
] | |
c7a70ffaa62499a456c09c3f1f3ef7cd0b05a611 | 09e57dd1374713f06b70d7b37a580130d9bbab0d | /data/p2DJ/New/program/pyquil/startPyquil387.py | 06eb003d185853b93d56f5429d08368942bce8d7 | [
"BSD-3-Clause"
] | permissive | UCLA-SEAL/QDiff | ad53650034897abb5941e74539e3aee8edb600ab | d968cbc47fe926b7f88b4adf10490f1edd6f8819 | refs/heads/main | 2023-08-05T04:52:24.961998 | 2021-09-19T02:56:16 | 2021-09-19T02:56:16 | 405,159,939 | 2 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,341 | py | # qubit number=2
# total number=20
import pyquil
from pyquil.api import local_forest_runtime, QVMConnection
from pyquil import Program, get_qc
from pyquil.gates import *
import numpy as np
conn = QVMConnection()
def make_circuit()-> Program:
prog = Program() # circuit begin
prog += H(0) # number=1
prog += H(1) # number=8
prog += CZ(0,1) # number=9
prog += H(1) # number=10
prog += H(1) # number=11
prog += CZ(0,1) # number=12
prog += H(1) # number=13
prog += H(1) # number=17
prog += CZ(0,1) # number=18
prog += H(1) # number=19
prog += CNOT(1,0) # number=14
prog += X(0) # number=15
prog += CNOT(1,0) # number=16
prog += Y(1) # number=6
prog += X(0) # number=4
# circuit end
return prog
def summrise_results(bitstrings) -> dict:
d = {}
for l in bitstrings:
if d.get(l) is None:
d[l] = 1
else:
d[l] = d[l] + 1
return d
if __name__ == '__main__':
prog = make_circuit()
qvm = get_qc('1q-qvm')
results = qvm.run_and_measure(prog,1024)
bitstrings = np.vstack([results[i] for i in qvm.qubits()]).T
bitstrings = [''.join(map(str, l)) for l in bitstrings]
writefile = open("../data/startPyquil387.csv","w")
print(summrise_results(bitstrings),file=writefile)
writefile.close()
| [
"[email protected]"
] | |
1c84b99c1dbcc510063d63711b2450fd162f9f19 | 4f408d65db60911f56110c351cb3b64835e0c5fb | /caffe2/python/predictor/predictor_exporter_test.py | 61e3fb0a5ad87ad8bfa994bb3bffe2727df0a74f | [
"Apache-2.0",
"MIT",
"BSD-3-Clause",
"LicenseRef-scancode-generic-cla",
"BSD-2-Clause"
] | permissive | KeyKy/caffe2_SSD | a02c065aef2dbcfd00faae8be0440d7a4ff0fb76 | 7235688ea5e212dbe8609d780dd94c8c7d9fef54 | refs/heads/master | 2021-09-18T14:36:11.247427 | 2018-07-10T09:59:35 | 2018-07-10T09:59:35 | 89,928,918 | 8 | 5 | null | 2018-07-27T02:14:38 | 2017-05-01T14:04:20 | Jupyter Notebook | UTF-8 | Python | false | false | 4,555 | py | from __future__ import absolute_import
from __future__ import division
from __future__ import print_function
from __future__ import unicode_literals
import tempfile
import unittest
import numpy as np
from caffe2.python import cnn, workspace, core
from caffe2.python.predictor_constants import predictor_constants as pc
import caffe2.python.predictor.predictor_exporter as pe
import caffe2.python.predictor.predictor_py_utils as pred_utils
class PredictorExporterTest(unittest.TestCase):
def _create_model(self):
m = cnn.CNNModelHelper()
m.FC("data", "y",
dim_in=5, dim_out=10,
weight_init=m.XavierInit,
bias_init=m.XavierInit)
return m
def setUp(self):
np.random.seed(1)
m = self._create_model()
self.predictor_export_meta = pe.PredictorExportMeta(
predict_net=m.net.Proto(),
parameters=[str(b) for b in m.params],
inputs=["data"],
outputs=["y"],
shapes={"y": (1, 10), "data": (1, 5)},
)
workspace.RunNetOnce(m.param_init_net)
self.params = {
param: workspace.FetchBlob(param)
for param in self.predictor_export_meta.parameters}
# Reset the workspace, to ensure net creation proceeds as expected.
workspace.ResetWorkspace()
def test_meta_constructor(self):
'''
Test that passing net itself instead of proto works
'''
m = self._create_model()
pe.PredictorExportMeta(
predict_net=m.net,
parameters=m.params,
inputs=["data"],
outputs=["y"],
shapes={"y": (1, 10), "data": (1, 5)},
)
def test_meta_net_def_net_runs(self):
for param, value in self.params.items():
workspace.FeedBlob(param, value)
extra_init_net = core.Net('extra_init')
extra_init_net.ConstantFill('data', 'data', value=1.0)
pem = pe.PredictorExportMeta(
predict_net=self.predictor_export_meta.predict_net,
parameters=self.predictor_export_meta.parameters,
inputs=self.predictor_export_meta.inputs,
outputs=self.predictor_export_meta.outputs,
shapes=self.predictor_export_meta.shapes,
extra_init_net=extra_init_net,
)
db_type = 'minidb'
db_file = tempfile.NamedTemporaryFile(
delete=False, suffix=".{}".format(db_type))
pe.save_to_db(
db_type=db_type,
db_destination=db_file.name,
predictor_export_meta=pem)
workspace.ResetWorkspace()
meta_net_def = pe.load_from_db(
db_type=db_type,
filename=db_file.name,
)
self.assertTrue("data" not in workspace.Blobs())
self.assertTrue("y" not in workspace.Blobs())
init_net = pred_utils.GetNet(meta_net_def, pc.PREDICT_INIT_NET_TYPE)
# 0-fills externalblobs blobs and runs extra_init_net
workspace.RunNetOnce(init_net)
self.assertTrue("data" in workspace.Blobs())
self.assertTrue("y" in workspace.Blobs())
print(workspace.FetchBlob("data"))
np.testing.assert_array_equal(
workspace.FetchBlob("data"), np.ones(shape=(1, 5)))
np.testing.assert_array_equal(
workspace.FetchBlob("y"), np.zeros(shape=(1, 10)))
# Load parameters from DB
global_init_net = pred_utils.GetNet(meta_net_def,
pc.GLOBAL_INIT_NET_TYPE)
workspace.RunNetOnce(global_init_net)
# Run the net with a reshaped input and verify we are
# producing good numbers (with our custom implementation)
workspace.FeedBlob("data", np.random.randn(2, 5).astype(np.float32))
predict_net = pred_utils.GetNet(meta_net_def, pc.PREDICT_NET_TYPE)
workspace.RunNetOnce(predict_net)
np.testing.assert_array_almost_equal(
workspace.FetchBlob("y"),
workspace.FetchBlob("data").dot(self.params["y_w"].T) +
self.params["y_b"])
def test_db_fails_without_params(self):
with self.assertRaises(Exception):
for db_type in ["minidb"]:
db_file = tempfile.NamedTemporaryFile(
delete=False, suffix=".{}".format(db_type))
pe.save_to_db(
db_type=db_type,
db_destination=db_file.name,
predictor_export_meta=self.predictor_export_meta)
| [
"[email protected]"
] | |
e79c9f4bec7946370a9fb9d8c7ec083d5df103b7 | f02485de5a101f3b69a45b2c4e71bd950ee55eba | /Z_other/del/ncPreprocessNew.py | f15f0e79cda38afbbe7ca272efe385042833c0f5 | [] | no_license | newjokker/PyUtil | ef4266b0ca32157f9de6e2cac1b1a10647190d99 | 32e64be10a6cd2856850f6720d70b4c6e7033f4e | refs/heads/master | 2020-11-28T00:19:02.073391 | 2019-12-23T02:07:40 | 2019-12-23T02:07:40 | 229,654,616 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 8,221 | py | # -*-coding:utf-8 -*-
import os
import sys
import datetime
import xml.dom.minidom
from xml.dom.minidom import Document
import datetime
# from Decorator.time_it import time_this
class NcFileToTiff(object):
"""传入 nc 文件，输出 tiff 文件"""
def __init__(self):
# 需要处理的文件
self.files_to_transform = []
# 保存的路径
self.save_dir = None
# 转换用到的 exe
self.gdal_translate_exe_path = None
@staticmethod
def get_file_time(file_path):
"""获取文件的时间，世界时转为北京时"""
file_base_name = os.path.basename(file_path) # 文件名
if 'ASI' in file_base_name:
UTC_str = file_base_name[-13:-3]
UTC_time = datetime.datetime.strptime(UTC_str, '%Y%m%d%H')
CHN_time = UTC_time + datetime.timedelta(hours=-8)
CHN_str = datetime.datetime.strftime(CHN_time, '%Y%m%d%H')
return CHN_str
elif 'CHN' in file_base_name:
return file_base_name[-13:-3]
else:
return
def get_save_path(self, file_path):
"""根据文件名，得到输出路径"""
CHN_time_str = self.get_file_time(file_path) # 获取北京时间
# 取到文件产品时间之前，
file_basename = os.path.basename(file_path)
# 输出文件夹
out_reladir = os.path.join(CHN_time_str[:6], CHN_time_str[:8])
out_reladir += r'\NRT' if '_NRT_' in file_basename else r'\RT'
out_reladir += r'\HOR' if '_HOR-' in file_basename else r'\DAY'
out_path = os.path.join(self.save_dir, out_reladir)
# 新建文件夹
if not os.path.exists(out_path):
os.makedirs(out_path)
#
geotif_name = file_basename[:-13] + CHN_time_str + '.tif' # 把 basename 的时间统一改为北京时间
out_geotif = os.path.join(out_path, geotif_name)
return out_geotif
def nc_to_tiff(self, nc_file, out_geotif):
"""调用cmd ， nc 文件转为 tiff 文件"""
cmd_str = self.gdal_translate_exe_path + ' -a_srs WGS84 -of GTiff -sds ' + nc_file + ' ' + out_geotif
os.system(cmd_str)
# @time_this
def do_process(self):
"""主流程"""
for each_file in self.files_to_transform:
if not each_file.endswith('.nc'): # 过滤非 nc 文件
continue
# 得到返回值
save_path = self.get_save_path(each_file)
# 转换
self.nc_to_tiff(each_file, save_path)
class Xml_Util(object):
# ------------------------------ 写 xml ----------------------------------------------------------------------------
@staticmethod
def get_document(head_time_str):
"""返回 document, 用于写 xml 文件"""
document = Document()
document.appendChild(document.createComment(head_time_str))
return document
@staticmethod
def add_sub_node(document, curNode, nodeKey, nodeValue, nodeAtt=None):
"""在节点下添加子节点信息"""
if nodeAtt is None:
nodeAtt = {}
try:
child = document.createElement(nodeKey)
# 写属性
for attKey in nodeAtt:
child.setAttribute(attKey, nodeAtt[attKey])
# 写值
if nodeValue:
child_text = document.createTextNode(nodeValue)
child.appendChild(child_text)
# 添加节点
curNode.appendChild(child)
return child
except:
print("* error in add node")
return None
@staticmethod
def save_xml(document, xml_path):
"""将 xml 保存为本地文件"""
with open(xml_path, 'w') as f:
f.write(document.toprettyxml(indent='\t', encoding='utf-8'))
# ------------------------------ 读 xml ----------------------------------------------------------------------------
@staticmethod
def get_root_node(xml_path):
"""返回用于读 xml 的 collection"""
DOMTree = xml.dom.minidom.parse(xml_path)
root_node = DOMTree.documentElement
return root_node
@staticmethod
def get_info_from_node(eachNode, assign_attr=None):
"""现在只支持 Element"""
# -----------------------------------------------------------------
if eachNode.nodeType != 1:
return
# -----------------------------------------------------------------
element_info = {}
# -----------------------------------------------------------------
# 获得所有的属性
attr_dict = {}
if assign_attr:
assign_attr = set(assign_attr)
for each_attr in assign_attr:
attr_dict[each_attr] = eachNode.getAttribute(each_attr)
else:
for each_attr in eachNode.attributes.values():
attr_dict[each_attr.name] = each_attr.value
element_info['attr'] = attr_dict
# -----------------------------------------------------------------
# 得到值,有子节点就没有值，这一点要注意
node_value = None
if len(eachNode.childNodes) == 1:
if eachNode.childNodes[0].nodeType == 3:
node_value = eachNode.childNodes[0].nodeValue
element_info['value'] = node_value
# -----------------------------------------------------------------
# 得到子节点
# child_nodes = eachNode.childNodes
# -----------------------------------------------------------------
return element_info
# ------------------------------ 常用 ------------------------------------------------------------------------------
@staticmethod
def xml_parser(xml_path, need_tages, attr="identify"):
"""
读取xml文件（一个级别），保存为字典
:param xml_path: xml 文件路径
:param need_tages: 需要的标签名
:param attr: 需要的属性名
:return: {'attr':value}
"""
def get_key_value(oneNode, attr_temp):
"""读取标签"""
key = oneNode.getAttribute(attr_temp)
value = oneNode.childNodes[0].data
return key, value
xml_info = {}
DOMTree = xml.dom.minidom.parse(xml_path)
collection = DOMTree.documentElement
# 遍历节点
for each_tag in need_tages:
for eachNode in collection.getElementsByTagName(each_tag):
(info_key, info_value) = get_key_value(eachNode, attr)
xml_info[info_key] = info_value
return xml_info
if __name__ == '__main__':
a = NcFileToTiff()
# ------------------ 读取 issue 等，解析为需要的文件夹 ------------------------------------
# xml_path = r'Y:\inputXML\nc\inputXml\201908011259\201908011259.xml'
xml_path = r'D:\BaiduNetdiskDownload\Algo\201908011239.xml'
# xml_path = sys.argv[1]
xml_dict = Xml_Util.xml_parser(xml_path, ['input'])
save_path_xml = xml_dict['outXMLPath']
a.save_dir = xml_dict['outFolder']
a.gdal_translate_exe_path = xml_dict['gdal_translate']
# a.gdal_translate_exe_path = r'C:\ProgramData\Anaconda2\envs\QingHai\Library\bin\gdal_translate.exe'
a.files_to_transform = xml_dict['inputFile'].split(',')
a.do_process()
try:
a.do_process()
status = 'success'
except:
status = 'error'
# ---------------------------------------------------------------------------------
# 写 output xml 文件
if status == 'error':
status, info = '0', 'error'
else:
status, info = '1', 'success'
# 初始化
document = Xml_Util.get_document('ProcessTime:' + str(datetime.datetime.now()))
# 添加根节点
XML = Xml_Util.add_sub_node(document, document, 'XML', '', None)
# info 信息
log = Xml_Util.add_sub_node(document, XML, 'log', '', None)
Xml_Util.add_sub_node(document, log, 'status', status, None)
Xml_Util.add_sub_node(document, log, 'info', info, None)
Xml_Util.save_xml(document, save_path_xml)
print('ok')
| [
"[email protected]"
] | |
a3b82adff7f91cff3f104899144e29691bc4658b | cd40b7cc395f36740000ed4a4144b1c0666ab0fd | /tests/test_hstrat/test_auxiliary_lib/test_parse_from_numeral_system.py | 16155f656f410b5cdd20c314308e9e350596ab27 | [
"MIT"
] | permissive | mmore500/hstrat | 94fd22c86a87a5707590b9398ef679444ed82d6d | b2d2caded1db5e2dc681d9f171d7c74b322c55c3 | refs/heads/master | 2023-08-31T03:36:44.457576 | 2023-08-25T14:39:29 | 2023-08-25T14:39:29 | 464,531,144 | 5 | 2 | NOASSERTION | 2023-08-25T13:07:52 | 2022-02-28T15:11:45 | Python | UTF-8 | Python | false | false | 2,824 | py | import random
import string
import pytest
from hstrat._auxiliary_lib import (
parse_from_numeral_system,
render_to_numeral_system,
)
@pytest.fixture
def alphabet():
return string.digits + string.ascii_lowercase
def test_parse_from_numeral_system(alphabet):
assert parse_from_numeral_system("0", alphabet) == 0
assert parse_from_numeral_system("1", alphabet) == 1
assert parse_from_numeral_system("a", alphabet) == 10
assert parse_from_numeral_system("z", alphabet) == 35
assert parse_from_numeral_system("10", alphabet) == 36
assert parse_from_numeral_system("2s", alphabet) == 100
assert parse_from_numeral_system("2n9c", alphabet) == 123456
def test_render_and_parse_numeral_system_consistency(alphabet):
for __ in range(100):
num = random.randint(0, 1000000)
base_num = render_to_numeral_system(num, alphabet)
assert parse_from_numeral_system(base_num, alphabet) == num
for __ in range(100):
test_digits = "".join([random.choice(alphabet) for j in range(10)])
base_num = parse_from_numeral_system(test_digits, alphabet)
assert render_to_numeral_system(
base_num, alphabet
) == test_digits.lstrip("0")
def test_hex_parsing():
assert parse_from_numeral_system("0", "0123456789abcdef") == int("0", 16)
assert parse_from_numeral_system("1", "0123456789abcdef") == int("1", 16)
assert parse_from_numeral_system("0a3", "0123456789abcdef") == int(
"0a3", 16
)
assert parse_from_numeral_system("a3", "0123456789abcdef") == int("a3", 16)
assert parse_from_numeral_system("ff", "0123456789abcdef") == int("ff", 16)
def test_octal_parsing():
assert parse_from_numeral_system("0", "01234567") == int("0", 8)
assert parse_from_numeral_system("1", "01234567") == int("1", 8)
assert parse_from_numeral_system("052", "01234567") == int("052", 8)
assert parse_from_numeral_system("52", "01234567") == int("52", 8)
assert parse_from_numeral_system("777", "01234567") == int("777", 8)
def test_binary_parsing():
assert parse_from_numeral_system("0", "01") == int("0", 2)
assert parse_from_numeral_system("1", "01") == int("1", 2)
assert parse_from_numeral_system("0101101", "01") == int("0101101", 2)
assert parse_from_numeral_system("101101", "01") == int("101101", 2)
assert parse_from_numeral_system("111", "01") == int("111", 2)
def test_decimal_parsing():
assert parse_from_numeral_system("0", "0123456789") == int("0", 10)
assert parse_from_numeral_system("1", "0123456789") == int("1", 10)
assert parse_from_numeral_system("0123", "0123456789") == int("0123", 10)
assert parse_from_numeral_system("123", "0123456789") == int("123", 10)
assert parse_from_numeral_system("456", "0123456789") == int("456", 10)
| [
"[email protected]"
] | |
04d2d4b1fd96ad5507c4890234ccd8f5a3e0cd22 | 4d2a007fb3810d0b1de676d0193eb24cb0134180 | /site.py | 3d10e3e877d02cd1ca4193ab1643d66aed39797e | [] | no_license | Rossonero/qlin | 241a822402beb4b05fe69f024978148a5758a765 | 02cc017daf3e540cfd9b5bfe7e021c176d5e90e1 | refs/heads/master | 2021-01-18T00:26:45.747983 | 2012-02-13T01:43:12 | 2012-02-13T01:43:12 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 446 | py | # -*- coding: utf-8 -*-
def Site_infor(request):
'''
站点信息展示前台
将所有信息展示开来
'''
t = get_template('site_infor.html')
#从数据库中将信息进行展示
cx = sq.connect('store/site.sqlite')
cu = self.cx.cursor()
#开始查找信息
strr = "select * from site"
cu.execute(strr)
print cu.fetchone()
html = t.render(Context({}))
return HttpResponse(html)
| [
"[email protected]"
] | |
8308e473e1a26f517a95db64f71ad6b5fee0cbe0 | faca8866b3c8aca30a915d8cb2748766557ed808 | /object_detection_updata/builders/box_predictor_builder.py | 7fe88e08bc63c355e4f03b45417646d6635acdbc | [] | no_license | yongqis/proposal_joint_retireval | 6899d80f8fb94569c7b60764f6e7de74bcfa9cc8 | 97b086c62473ab1a5baf45743535fce70c3f8c20 | refs/heads/master | 2020-05-25T19:07:22.946008 | 2019-06-03T07:09:04 | 2019-06-03T07:09:09 | 187,943,867 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 48,966 | py | # Copyright 2017 The TensorFlow Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
# ==============================================================================
"""Function to build box predictor from configuration."""
import collections
import tensorflow as tf
from object_detection_updata.predictors import convolutional_box_predictor
from object_detection_updata.predictors import convolutional_keras_box_predictor
from object_detection_updata.predictors import mask_rcnn_box_predictor
from object_detection_updata.predictors import mask_rcnn_keras_box_predictor
from object_detection_updata.predictors import rfcn_box_predictor
from object_detection_updata.predictors import rfcn_keras_box_predictor
from object_detection_updata.predictors.heads import box_head
from object_detection_updata.predictors.heads import class_head
from object_detection_updata.predictors.heads import keras_box_head
from object_detection_updata.predictors.heads import keras_class_head
from object_detection_updata.predictors.heads import keras_mask_head
from object_detection_updata.predictors.heads import mask_head
from object_detection_updata.protos import box_predictor_pb2
def build_convolutional_box_predictor(is_training,
num_classes,
conv_hyperparams_fn,
min_depth,
max_depth,
num_layers_before_predictor,
use_dropout,
dropout_keep_prob,
kernel_size,
box_code_size,
apply_sigmoid_to_scores=False,
add_background_class=True,
class_prediction_bias_init=0.0,
use_depthwise=False,
box_encodings_clip_range=None):
"""Builds the ConvolutionalBoxPredictor from the arguments.
Args:
is_training: Indicates whether the BoxPredictor is in training mode.
num_classes: number of classes. Note that num_classes *does not*
include the background category, so if groundtruth labels take values
in {0, 1, .., K-1}, num_classes=K (and not K+1, even though the
assigned classification targets can range from {0,... K}).
conv_hyperparams_fn: A function to generate tf-slim arg_scope with
hyperparameters for convolution ops.
min_depth: Minimum feature depth prior to predicting box encodings
and class predictions.
max_depth: Maximum feature depth prior to predicting box encodings
and class predictions. If max_depth is set to 0, no additional
feature map will be inserted before location and class predictions.
num_layers_before_predictor: Number of the additional conv layers before
the predictor.
use_dropout: Option to use dropout or not. Note that a single dropout
op is applied here prior to both box and class predictions, which stands
in contrast to the ConvolutionalBoxPredictor below.
dropout_keep_prob: Keep probability for dropout.
This is only used if use_dropout is True.
kernel_size: Size of final convolution kernel. If the
spatial resolution of the feature map is smaller than the kernel size,
then the kernel size is automatically set to be
min(feature_width, feature_height).
box_code_size: Size of encoding for each box.
apply_sigmoid_to_scores: If True, apply the sigmoid on the output
class_predictions.
add_background_class: Whether to add an implicit background class.
class_prediction_bias_init: Constant value to initialize bias of the last
conv2d layer before class prediction.
use_depthwise: Whether to use depthwise convolutions for prediction
steps. Default is False.
box_encodings_clip_range: Min and max values for clipping the box_encodings.
Returns:
A ConvolutionalBoxPredictor class.
"""
box_prediction_head = box_head.ConvolutionalBoxHead(
is_training=is_training,
box_code_size=box_code_size,
kernel_size=kernel_size,
use_depthwise=use_depthwise,
box_encodings_clip_range=box_encodings_clip_range)
class_prediction_head = class_head.ConvolutionalClassHead(
is_training=is_training,
num_class_slots=num_classes + 1 if add_background_class else num_classes,
use_dropout=use_dropout,
dropout_keep_prob=dropout_keep_prob,
kernel_size=kernel_size,
apply_sigmoid_to_scores=apply_sigmoid_to_scores,
class_prediction_bias_init=class_prediction_bias_init,
use_depthwise=use_depthwise)
other_heads = {}
return convolutional_box_predictor.ConvolutionalBoxPredictor(
is_training=is_training,
num_classes=num_classes,
box_prediction_head=box_prediction_head,
class_prediction_head=class_prediction_head,
other_heads=other_heads,
conv_hyperparams_fn=conv_hyperparams_fn,
num_layers_before_predictor=num_layers_before_predictor,
min_depth=min_depth,
max_depth=max_depth)
def build_convolutional_keras_box_predictor(is_training,
num_classes,
conv_hyperparams,
freeze_batchnorm,
inplace_batchnorm_update,
num_predictions_per_location_list,
min_depth,
max_depth,
num_layers_before_predictor,
use_dropout,
dropout_keep_prob,
kernel_size,
box_code_size,
add_background_class=True,
class_prediction_bias_init=0.0,
use_depthwise=False,
box_encodings_clip_range=None,
name='BoxPredictor'):
"""Builds the Keras ConvolutionalBoxPredictor from the arguments.
Args:
is_training: Indicates whether the BoxPredictor is in training mode.
num_classes: number of classes. Note that num_classes *does not*
include the background category, so if groundtruth labels take values
in {0, 1, .., K-1}, num_classes=K (and not K+1, even though the
assigned classification targets can range from {0,... K}).
conv_hyperparams: A `hyperparams_builder.KerasLayerHyperparams` object
containing hyperparameters for convolution ops.
freeze_batchnorm: Whether to freeze batch norm parameters during
training or not. When training with a small batch size (e.g. 1), it is
desirable to freeze batch norm update and use pretrained batch norm
params.
inplace_batchnorm_update: Whether to update batch norm moving average
values inplace. When this is false train op must add a control
dependency on tf.graphkeys.UPDATE_OPS collection in order to update
batch norm statistics.
num_predictions_per_location_list: A list of integers representing the
number of box predictions to be made per spatial location for each
feature map.
min_depth: Minimum feature depth prior to predicting box encodings
and class predictions.
max_depth: Maximum feature depth prior to predicting box encodings
and class predictions. If max_depth is set to 0, no additional
feature map will be inserted before location and class predictions.
num_layers_before_predictor: Number of the additional conv layers before
the predictor.
use_dropout: Option to use dropout or not. Note that a single dropout
op is applied here prior to both box and class predictions, which stands
in contrast to the ConvolutionalBoxPredictor below.
dropout_keep_prob: Keep probability for dropout.
This is only used if use_dropout is True.
kernel_size: Size of final convolution kernel. If the
spatial resolution of the feature map is smaller than the kernel size,
then the kernel size is automatically set to be
min(feature_width, feature_height).
box_code_size: Size of encoding for each box.
add_background_class: Whether to add an implicit background class.
class_prediction_bias_init: constant value to initialize bias of the last
conv2d layer before class prediction.
use_depthwise: Whether to use depthwise convolutions for prediction
steps. Default is False.
box_encodings_clip_range: Min and max values for clipping the box_encodings.
name: A string name scope to assign to the box predictor. If `None`, Keras
will auto-generate one from the class name.
Returns:
A Keras ConvolutionalBoxPredictor class.
"""
box_prediction_heads = []
class_prediction_heads = []
other_heads = {}
for stack_index, num_predictions_per_location in enumerate(
num_predictions_per_location_list):
box_prediction_heads.append(
keras_box_head.ConvolutionalBoxHead(
is_training=is_training,
box_code_size=box_code_size,
kernel_size=kernel_size,
conv_hyperparams=conv_hyperparams,
freeze_batchnorm=freeze_batchnorm,
num_predictions_per_location=num_predictions_per_location,
use_depthwise=use_depthwise,
box_encodings_clip_range=box_encodings_clip_range,
name='ConvolutionalBoxHead_%d' % stack_index))
class_prediction_heads.append(
keras_class_head.ConvolutionalClassHead(
is_training=is_training,
num_class_slots=(
num_classes + 1 if add_background_class else num_classes),
use_dropout=use_dropout,
dropout_keep_prob=dropout_keep_prob,
kernel_size=kernel_size,
conv_hyperparams=conv_hyperparams,
freeze_batchnorm=freeze_batchnorm,
num_predictions_per_location=num_predictions_per_location,
class_prediction_bias_init=class_prediction_bias_init,
use_depthwise=use_depthwise,
name='ConvolutionalClassHead_%d' % stack_index))
return convolutional_keras_box_predictor.ConvolutionalBoxPredictor(
is_training=is_training,
num_classes=num_classes,
box_prediction_heads=box_prediction_heads,
class_prediction_heads=class_prediction_heads,
other_heads=other_heads,
conv_hyperparams=conv_hyperparams,
num_layers_before_predictor=num_layers_before_predictor,
min_depth=min_depth,
max_depth=max_depth,
freeze_batchnorm=freeze_batchnorm,
inplace_batchnorm_update=inplace_batchnorm_update,
name=name)
def build_weight_shared_convolutional_box_predictor(
is_training,
num_classes,
conv_hyperparams_fn,
depth,
num_layers_before_predictor,
box_code_size,
kernel_size=3,
add_background_class=True,
class_prediction_bias_init=0.0,
use_dropout=False,
dropout_keep_prob=0.8,
share_prediction_tower=False,
apply_batch_norm=True,
use_depthwise=False,
score_converter_fn=tf.identity,
box_encodings_clip_range=None):
"""Builds and returns a WeightSharedConvolutionalBoxPredictor class.
Args:
is_training: Indicates whether the BoxPredictor is in training mode.
num_classes: number of classes. Note that num_classes *does not*
include the background category, so if groundtruth labels take values
in {0, 1, .., K-1}, num_classes=K (and not K+1, even though the
assigned classification targets can range from {0,... K}).
conv_hyperparams_fn: A function to generate tf-slim arg_scope with
hyperparameters for convolution ops.
depth: depth of conv layers.
num_layers_before_predictor: Number of the additional conv layers before
the predictor.
box_code_size: Size of encoding for each box.
kernel_size: Size of final convolution kernel.
add_background_class: Whether to add an implicit background class.
class_prediction_bias_init: constant value to initialize bias of the last
conv2d layer before class prediction.
use_dropout: Whether to apply dropout to class prediction head.
dropout_keep_prob: Probability of keeping activiations.
share_prediction_tower: Whether to share the multi-layer tower between box
prediction and class prediction heads.
apply_batch_norm: Whether to apply batch normalization to conv layers in
this predictor.
use_depthwise: Whether to use depthwise separable conv2d instead of conv2d.
score_converter_fn: Callable score converter to perform elementwise op on
class scores.
box_encodings_clip_range: Min and max values for clipping the box_encodings.
Returns:
A WeightSharedConvolutionalBoxPredictor class.
"""
box_prediction_head = box_head.WeightSharedConvolutionalBoxHead(
box_code_size=box_code_size,
kernel_size=kernel_size,
use_depthwise=use_depthwise,
box_encodings_clip_range=box_encodings_clip_range)
class_prediction_head = (
class_head.WeightSharedConvolutionalClassHead(
num_class_slots=(
num_classes + 1 if add_background_class else num_classes),
kernel_size=kernel_size,
class_prediction_bias_init=class_prediction_bias_init,
use_dropout=use_dropout,
dropout_keep_prob=dropout_keep_prob,
use_depthwise=use_depthwise,
score_converter_fn=score_converter_fn))
other_heads = {}
return convolutional_box_predictor.WeightSharedConvolutionalBoxPredictor(
is_training=is_training,
num_classes=num_classes,
box_prediction_head=box_prediction_head,
class_prediction_head=class_prediction_head,
other_heads=other_heads,
conv_hyperparams_fn=conv_hyperparams_fn,
depth=depth,
num_layers_before_predictor=num_layers_before_predictor,
kernel_size=kernel_size,
apply_batch_norm=apply_batch_norm,
share_prediction_tower=share_prediction_tower,
use_depthwise=use_depthwise)
def build_weight_shared_convolutional_keras_box_predictor(
is_training,
num_classes,
conv_hyperparams,
freeze_batchnorm,
inplace_batchnorm_update,
num_predictions_per_location_list,
depth,
num_layers_before_predictor,
box_code_size,
kernel_size=3,
add_background_class=True,
class_prediction_bias_init=0.0,
use_dropout=False,
dropout_keep_prob=0.8,
share_prediction_tower=False,
apply_batch_norm=True,
use_depthwise=False,
score_converter_fn=tf.identity,
box_encodings_clip_range=None,
name='WeightSharedConvolutionalBoxPredictor'):
"""Builds the Keras WeightSharedConvolutionalBoxPredictor from the arguments.
Args:
is_training: Indicates whether the BoxPredictor is in training mode.
num_classes: number of classes. Note that num_classes *does not*
include the background category, so if groundtruth labels take values
in {0, 1, .., K-1}, num_classes=K (and not K+1, even though the
assigned classification targets can range from {0,... K}).
conv_hyperparams: A `hyperparams_builder.KerasLayerHyperparams` object
containing hyperparameters for convolution ops.
freeze_batchnorm: Whether to freeze batch norm parameters during
training or not. When training with a small batch size (e.g. 1), it is
desirable to freeze batch norm update and use pretrained batch norm
params.
inplace_batchnorm_update: Whether to update batch norm moving average
values inplace. When this is false train op must add a control
dependency on tf.graphkeys.UPDATE_OPS collection in order to update
batch norm statistics.
num_predictions_per_location_list: A list of integers representing the
number of box predictions to be made per spatial location for each
feature map.
depth: depth of conv layers.
num_layers_before_predictor: Number of the additional conv layers before
the predictor.
box_code_size: Size of encoding for each box.
kernel_size: Size of final convolution kernel.
add_background_class: Whether to add an implicit background class.
class_prediction_bias_init: constant value to initialize bias of the last
conv2d layer before class prediction.
use_dropout: Whether to apply dropout to class prediction head.
dropout_keep_prob: Probability of keeping activiations.
share_prediction_tower: Whether to share the multi-layer tower between box
prediction and class prediction heads.
apply_batch_norm: Whether to apply batch normalization to conv layers in
this predictor.
use_depthwise: Whether to use depthwise separable conv2d instead of conv2d.
score_converter_fn: Callable score converter to perform elementwise op on
class scores.
box_encodings_clip_range: Min and max values for clipping the box_encodings.
name: A string name scope to assign to the box predictor. If `None`, Keras
will auto-generate one from the class name.
Returns:
A Keras WeightSharedConvolutionalBoxPredictor class.
"""
if len(set(num_predictions_per_location_list)) > 1:
raise ValueError('num predictions per location must be same for all'
'feature maps, found: {}'.format(
num_predictions_per_location_list))
num_predictions_per_location = num_predictions_per_location_list[0]
box_prediction_head = keras_box_head.WeightSharedConvolutionalBoxHead(
box_code_size=box_code_size,
kernel_size=kernel_size,
conv_hyperparams=conv_hyperparams,
num_predictions_per_location=num_predictions_per_location,
use_depthwise=use_depthwise,
box_encodings_clip_range=box_encodings_clip_range,
name='WeightSharedConvolutionalBoxHead')
class_prediction_head = keras_class_head.WeightSharedConvolutionalClassHead(
num_class_slots=(
num_classes + 1 if add_background_class else num_classes),
use_dropout=use_dropout,
dropout_keep_prob=dropout_keep_prob,
kernel_size=kernel_size,
conv_hyperparams=conv_hyperparams,
num_predictions_per_location=num_predictions_per_location,
class_prediction_bias_init=class_prediction_bias_init,
use_depthwise=use_depthwise,
score_converter_fn=score_converter_fn,
name='WeightSharedConvolutionalClassHead')
other_heads = {}
return (
convolutional_keras_box_predictor.WeightSharedConvolutionalBoxPredictor(
is_training=is_training,
num_classes=num_classes,
box_prediction_head=box_prediction_head,
class_prediction_head=class_prediction_head,
other_heads=other_heads,
conv_hyperparams=conv_hyperparams,
depth=depth,
num_layers_before_predictor=num_layers_before_predictor,
freeze_batchnorm=freeze_batchnorm,
inplace_batchnorm_update=inplace_batchnorm_update,
kernel_size=kernel_size,
apply_batch_norm=apply_batch_norm,
share_prediction_tower=share_prediction_tower,
use_depthwise=use_depthwise,
name=name))
def build_mask_rcnn_keras_box_predictor(is_training,
num_classes,
fc_hyperparams,
freeze_batchnorm,
use_dropout,
dropout_keep_prob,
box_code_size,
add_background_class=True,
share_box_across_classes=False,
predict_instance_masks=False,
conv_hyperparams=None,
mask_height=14,
mask_width=14,
mask_prediction_num_conv_layers=2,
mask_prediction_conv_depth=256,
masks_are_class_agnostic=False,
convolve_then_upsample_masks=False):
"""Builds and returns a MaskRCNNKerasBoxPredictor class.
Args:
is_training: Indicates whether the BoxPredictor is in training mode.
num_classes: number of classes. Note that num_classes *does not*
include the background category, so if groundtruth labels take values
in {0, 1, .., K-1}, num_classes=K (and not K+1, even though the
assigned classification targets can range from {0,... K}).
fc_hyperparams: A `hyperparams_builder.KerasLayerHyperparams` object
containing hyperparameters for fully connected dense ops.
freeze_batchnorm: Whether to freeze batch norm parameters during
training or not. When training with a small batch size (e.g. 1), it is
desirable to freeze batch norm update and use pretrained batch norm
params.
use_dropout: Option to use dropout or not. Note that a single dropout
op is applied here prior to both box and class predictions, which stands
in contrast to the ConvolutionalBoxPredictor below.
dropout_keep_prob: Keep probability for dropout.
This is only used if use_dropout is True.
box_code_size: Size of encoding for each box.
add_background_class: Whether to add an implicit background class.
share_box_across_classes: Whether to share boxes across classes rather
than use a different box for each class.
predict_instance_masks: If True, will add a third stage mask prediction
to the returned class.
conv_hyperparams: A `hyperparams_builder.KerasLayerHyperparams` object
containing hyperparameters for convolution ops.
mask_height: Desired output mask height. The default value is 14.
mask_width: Desired output mask width. The default value is 14.
mask_prediction_num_conv_layers: Number of convolution layers applied to
the image_features in mask prediction branch.
mask_prediction_conv_depth: The depth for the first conv2d_transpose op
applied to the image_features in the mask prediction branch. If set
to 0, the depth of the convolution layers will be automatically chosen
based on the number of object classes and the number of channels in the
image features.
masks_are_class_agnostic: Boolean determining if the mask-head is
class-agnostic or not.
convolve_then_upsample_masks: Whether to apply convolutions on mask
features before upsampling using nearest neighbor resizing. Otherwise,
mask features are resized to [`mask_height`, `mask_width`] using
bilinear resizing before applying convolutions.
Returns:
A MaskRCNNKerasBoxPredictor class.
"""
box_prediction_head = keras_box_head.MaskRCNNBoxHead(
is_training=is_training,
num_classes=num_classes,
fc_hyperparams=fc_hyperparams,
freeze_batchnorm=freeze_batchnorm,
use_dropout=use_dropout,
dropout_keep_prob=dropout_keep_prob,
box_code_size=box_code_size,
share_box_across_classes=share_box_across_classes)
class_prediction_head = keras_class_head.MaskRCNNClassHead(
is_training=is_training,
num_class_slots=num_classes + 1 if add_background_class else num_classes,
fc_hyperparams=fc_hyperparams,
freeze_batchnorm=freeze_batchnorm,
use_dropout=use_dropout,
dropout_keep_prob=dropout_keep_prob)
third_stage_heads = {}
if predict_instance_masks:
third_stage_heads[
mask_rcnn_box_predictor.
MASK_PREDICTIONS] = keras_mask_head.MaskRCNNMaskHead(
is_training=is_training,
num_classes=num_classes,
conv_hyperparams=conv_hyperparams,
freeze_batchnorm=freeze_batchnorm,
mask_height=mask_height,
mask_width=mask_width,
mask_prediction_num_conv_layers=mask_prediction_num_conv_layers,
mask_prediction_conv_depth=mask_prediction_conv_depth,
masks_are_class_agnostic=masks_are_class_agnostic,
convolve_then_upsample=convolve_then_upsample_masks)
return mask_rcnn_keras_box_predictor.MaskRCNNKerasBoxPredictor(
is_training=is_training,
num_classes=num_classes,
freeze_batchnorm=freeze_batchnorm,
box_prediction_head=box_prediction_head,
class_prediction_head=class_prediction_head,
third_stage_heads=third_stage_heads)
def build_mask_rcnn_box_predictor(is_training,
num_classes,
fc_hyperparams_fn,
use_dropout,
dropout_keep_prob,
box_code_size,
add_background_class=True,
share_box_across_classes=False,
predict_instance_masks=False,
conv_hyperparams_fn=None,
mask_height=14,
mask_width=14,
mask_prediction_num_conv_layers=2,
mask_prediction_conv_depth=256,
masks_are_class_agnostic=False,
convolve_then_upsample_masks=False):
"""Builds and returns a MaskRCNNBoxPredictor class.
Args:
is_training: Indicates whether the BoxPredictor is in training mode.
num_classes: number of classes. Note that num_classes *does not*
include the background category, so if groundtruth labels take values
in {0, 1, .., K-1}, num_classes=K (and not K+1, even though the
assigned classification targets can range from {0,... K}).
fc_hyperparams_fn: A function to generate tf-slim arg_scope with
hyperparameters for fully connected ops.
use_dropout: Option to use dropout or not. Note that a single dropout
op is applied here prior to both box and class predictions, which stands
in contrast to the ConvolutionalBoxPredictor below.
dropout_keep_prob: Keep probability for dropout.
This is only used if use_dropout is True.
box_code_size: Size of encoding for each box.
add_background_class: Whether to add an implicit background class.
share_box_across_classes: Whether to share boxes across classes rather
than use a different box for each class.
predict_instance_masks: If True, will add a third stage mask prediction
to the returned class.
conv_hyperparams_fn: A function to generate tf-slim arg_scope with
hyperparameters for convolution ops.
mask_height: Desired output mask height. The default value is 14.
mask_width: Desired output mask width. The default value is 14.
mask_prediction_num_conv_layers: Number of convolution layers applied to
the image_features in mask prediction branch.
mask_prediction_conv_depth: The depth for the first conv2d_transpose op
applied to the image_features in the mask prediction branch. If set
to 0, the depth of the convolution layers will be automatically chosen
based on the number of object classes and the number of channels in the
image features.
masks_are_class_agnostic: Boolean determining if the mask-head is
class-agnostic or not.
convolve_then_upsample_masks: Whether to apply convolutions on mask
features before upsampling using nearest neighbor resizing. Otherwise,
mask features are resized to [`mask_height`, `mask_width`] using
bilinear resizing before applying convolutions.
Returns:
A MaskRCNNBoxPredictor class.
"""
box_prediction_head = box_head.MaskRCNNBoxHead(
is_training=is_training,
num_classes=num_classes,
fc_hyperparams_fn=fc_hyperparams_fn,
use_dropout=use_dropout,
dropout_keep_prob=dropout_keep_prob,
box_code_size=box_code_size,
share_box_across_classes=share_box_across_classes)
class_prediction_head = class_head.MaskRCNNClassHead(
is_training=is_training,
num_class_slots=num_classes + 1 if add_background_class else num_classes,
fc_hyperparams_fn=fc_hyperparams_fn,
use_dropout=use_dropout,
dropout_keep_prob=dropout_keep_prob)
third_stage_heads = {}
if predict_instance_masks:
third_stage_heads[
mask_rcnn_box_predictor.
MASK_PREDICTIONS] = mask_head.MaskRCNNMaskHead(
num_classes=num_classes,
conv_hyperparams_fn=conv_hyperparams_fn,
mask_height=mask_height,
mask_width=mask_width,
mask_prediction_num_conv_layers=mask_prediction_num_conv_layers,
mask_prediction_conv_depth=mask_prediction_conv_depth,
masks_are_class_agnostic=masks_are_class_agnostic,
convolve_then_upsample=convolve_then_upsample_masks)
return mask_rcnn_box_predictor.MaskRCNNBoxPredictor(
is_training=is_training,
num_classes=num_classes,
box_prediction_head=box_prediction_head,
class_prediction_head=class_prediction_head,
third_stage_heads=third_stage_heads)
def build_score_converter(score_converter_config, is_training):
"""Builds score converter based on the config.
Builds one of [tf.identity, tf.sigmoid] score converters based on the config
and whether the BoxPredictor is for training or inference.
Args:
score_converter_config:
box_predictor_pb2.WeightSharedConvolutionalBoxPredictor.score_converter.
is_training: Indicates whether the BoxPredictor is in training mode.
Returns:
Callable score converter op.
Raises:
ValueError: On unknown score converter.
"""
if score_converter_config == (
box_predictor_pb2.WeightSharedConvolutionalBoxPredictor.IDENTITY):
return tf.identity
if score_converter_config == (
box_predictor_pb2.WeightSharedConvolutionalBoxPredictor.SIGMOID):
return tf.identity if is_training else tf.sigmoid
raise ValueError('Unknown score converter.')
BoxEncodingsClipRange = collections.namedtuple('BoxEncodingsClipRange',
['min', 'max'])
def build(argscope_fn, box_predictor_config, is_training, num_classes,
add_background_class=True):
"""Builds box predictor based on the configuration.
Builds box predictor based on the configuration. See box_predictor.proto for
configurable options. Also, see box_predictor.py for more details.
Args:
argscope_fn: A function that takes the following inputs:
* hyperparams_pb2.Hyperparams proto
* a boolean indicating if the model is in training mode.
and returns a tf slim argscope for Conv and FC hyperparameters.
box_predictor_config: box_predictor_pb2.BoxPredictor proto containing
configuration.
is_training: Whether the models is in training mode.
num_classes: Number of classes to predict.
add_background_class: Whether to add an implicit background class.
Returns:
box_predictor: box_predictor.BoxPredictor object.
Raises:
ValueError: On unknown box predictor.
"""
if not isinstance(box_predictor_config, box_predictor_pb2.BoxPredictor):
raise ValueError('box_predictor_config not of type '
'box_predictor_pb2.BoxPredictor.')
box_predictor_oneof = box_predictor_config.WhichOneof('box_predictor_oneof')
if box_predictor_oneof == 'convolutional_box_predictor':
config_box_predictor = box_predictor_config.convolutional_box_predictor
conv_hyperparams_fn = argscope_fn(config_box_predictor.conv_hyperparams,
is_training)
# Optionally apply clipping to box encodings, when box_encodings_clip_range
# is set.
box_encodings_clip_range = None
if config_box_predictor.HasField('box_encodings_clip_range'):
box_encodings_clip_range = BoxEncodingsClipRange(
min=config_box_predictor.box_encodings_clip_range.min,
max=config_box_predictor.box_encodings_clip_range.max)
return build_convolutional_box_predictor(
is_training=is_training,
num_classes=num_classes,
add_background_class=add_background_class,
conv_hyperparams_fn=conv_hyperparams_fn,
use_dropout=config_box_predictor.use_dropout,
dropout_keep_prob=config_box_predictor.dropout_keep_probability,
box_code_size=config_box_predictor.box_code_size,
kernel_size=config_box_predictor.kernel_size,
num_layers_before_predictor=(
config_box_predictor.num_layers_before_predictor),
min_depth=config_box_predictor.min_depth,
max_depth=config_box_predictor.max_depth,
apply_sigmoid_to_scores=config_box_predictor.apply_sigmoid_to_scores,
class_prediction_bias_init=(
config_box_predictor.class_prediction_bias_init),
use_depthwise=config_box_predictor.use_depthwise,
box_encodings_clip_range=box_encodings_clip_range)
if box_predictor_oneof == 'weight_shared_convolutional_box_predictor':
config_box_predictor = (
box_predictor_config.weight_shared_convolutional_box_predictor)
conv_hyperparams_fn = argscope_fn(config_box_predictor.conv_hyperparams,
is_training)
apply_batch_norm = config_box_predictor.conv_hyperparams.HasField(
'batch_norm')
# During training phase, logits are used to compute the loss. Only apply
# sigmoid at inference to make the inference graph TPU friendly.
score_converter_fn = build_score_converter(
config_box_predictor.score_converter, is_training)
# Optionally apply clipping to box encodings, when box_encodings_clip_range
# is set.
box_encodings_clip_range = None
if config_box_predictor.HasField('box_encodings_clip_range'):
box_encodings_clip_range = BoxEncodingsClipRange(
min=config_box_predictor.box_encodings_clip_range.min,
max=config_box_predictor.box_encodings_clip_range.max)
return build_weight_shared_convolutional_box_predictor(
is_training=is_training,
num_classes=num_classes,
add_background_class=add_background_class,
conv_hyperparams_fn=conv_hyperparams_fn,
depth=config_box_predictor.depth,
num_layers_before_predictor=(
config_box_predictor.num_layers_before_predictor),
box_code_size=config_box_predictor.box_code_size,
kernel_size=config_box_predictor.kernel_size,
class_prediction_bias_init=(
config_box_predictor.class_prediction_bias_init),
use_dropout=config_box_predictor.use_dropout,
dropout_keep_prob=config_box_predictor.dropout_keep_probability,
share_prediction_tower=config_box_predictor.share_prediction_tower,
apply_batch_norm=apply_batch_norm,
use_depthwise=config_box_predictor.use_depthwise,
score_converter_fn=score_converter_fn,
box_encodings_clip_range=box_encodings_clip_range)
if box_predictor_oneof == 'mask_rcnn_box_predictor':
config_box_predictor = box_predictor_config.mask_rcnn_box_predictor
fc_hyperparams_fn = argscope_fn(config_box_predictor.fc_hyperparams,
is_training)
conv_hyperparams_fn = None
if config_box_predictor.HasField('conv_hyperparams'):
conv_hyperparams_fn = argscope_fn(
config_box_predictor.conv_hyperparams, is_training)
return build_mask_rcnn_box_predictor(
is_training=is_training,
num_classes=num_classes,
add_background_class=add_background_class,
fc_hyperparams_fn=fc_hyperparams_fn,
use_dropout=config_box_predictor.use_dropout,
dropout_keep_prob=config_box_predictor.dropout_keep_probability,
box_code_size=config_box_predictor.box_code_size,
share_box_across_classes=(
config_box_predictor.share_box_across_classes),
predict_instance_masks=config_box_predictor.predict_instance_masks,
conv_hyperparams_fn=conv_hyperparams_fn,
mask_height=config_box_predictor.mask_height,
mask_width=config_box_predictor.mask_width,
mask_prediction_num_conv_layers=(
config_box_predictor.mask_prediction_num_conv_layers),
mask_prediction_conv_depth=(
config_box_predictor.mask_prediction_conv_depth),
masks_are_class_agnostic=(
config_box_predictor.masks_are_class_agnostic),
convolve_then_upsample_masks=(
config_box_predictor.convolve_then_upsample_masks))
if box_predictor_oneof == 'rfcn_box_predictor':
config_box_predictor = box_predictor_config.rfcn_box_predictor
conv_hyperparams_fn = argscope_fn(config_box_predictor.conv_hyperparams,
is_training)
box_predictor_object = rfcn_box_predictor.RfcnBoxPredictor(
is_training=is_training,
num_classes=num_classes,
conv_hyperparams_fn=conv_hyperparams_fn,
crop_size=[config_box_predictor.crop_height,
config_box_predictor.crop_width],
num_spatial_bins=[config_box_predictor.num_spatial_bins_height,
config_box_predictor.num_spatial_bins_width],
depth=config_box_predictor.depth,
box_code_size=config_box_predictor.box_code_size)
return box_predictor_object
raise ValueError('Unknown box predictor: {}'.format(box_predictor_oneof))
def build_keras(hyperparams_fn, freeze_batchnorm, inplace_batchnorm_update,
num_predictions_per_location_list, box_predictor_config,
is_training, num_classes, add_background_class=True):
"""Builds a Keras-based box predictor based on the configuration.
Builds Keras-based box predictor based on the configuration.
See box_predictor.proto for configurable options. Also, see box_predictor.py
for more details.
Args:
hyperparams_fn: A function that takes a hyperparams_pb2.Hyperparams
proto and returns a `hyperparams_builder.KerasLayerHyperparams`
for Conv or FC hyperparameters.
freeze_batchnorm: Whether to freeze batch norm parameters during
training or not. When training with a small batch size (e.g. 1), it is
desirable to freeze batch norm update and use pretrained batch norm
params.
inplace_batchnorm_update: Whether to update batch norm moving average
values inplace. When this is false train op must add a control
dependency on tf.graphkeys.UPDATE_OPS collection in order to update
batch norm statistics.
num_predictions_per_location_list: A list of integers representing the
number of box predictions to be made per spatial location for each
feature map.
box_predictor_config: box_predictor_pb2.BoxPredictor proto containing
configuration.
is_training: Whether the models is in training mode.
num_classes: Number of classes to predict.
add_background_class: Whether to add an implicit background class.
Returns:
box_predictor: box_predictor.KerasBoxPredictor object.
Raises:
ValueError: On unknown box predictor, or one with no Keras box predictor.
"""
if not isinstance(box_predictor_config, box_predictor_pb2.BoxPredictor):
raise ValueError('box_predictor_config not of type '
'box_predictor_pb2.BoxPredictor.')
box_predictor_oneof = box_predictor_config.WhichOneof('box_predictor_oneof')
if box_predictor_oneof == 'convolutional_box_predictor':
config_box_predictor = box_predictor_config.convolutional_box_predictor
conv_hyperparams = hyperparams_fn(
config_box_predictor.conv_hyperparams)
# Optionally apply clipping to box encodings, when box_encodings_clip_range
# is set.
box_encodings_clip_range = None
if config_box_predictor.HasField('box_encodings_clip_range'):
box_encodings_clip_range = BoxEncodingsClipRange(
min=config_box_predictor.box_encodings_clip_range.min,
max=config_box_predictor.box_encodings_clip_range.max)
return build_convolutional_keras_box_predictor(
is_training=is_training,
num_classes=num_classes,
add_background_class=add_background_class,
conv_hyperparams=conv_hyperparams,
freeze_batchnorm=freeze_batchnorm,
inplace_batchnorm_update=inplace_batchnorm_update,
num_predictions_per_location_list=num_predictions_per_location_list,
use_dropout=config_box_predictor.use_dropout,
dropout_keep_prob=config_box_predictor.dropout_keep_probability,
box_code_size=config_box_predictor.box_code_size,
kernel_size=config_box_predictor.kernel_size,
num_layers_before_predictor=(
config_box_predictor.num_layers_before_predictor),
min_depth=config_box_predictor.min_depth,
max_depth=config_box_predictor.max_depth,
class_prediction_bias_init=(
config_box_predictor.class_prediction_bias_init),
use_depthwise=config_box_predictor.use_depthwise,
box_encodings_clip_range=box_encodings_clip_range)
if box_predictor_oneof == 'weight_shared_convolutional_box_predictor':
config_box_predictor = (
box_predictor_config.weight_shared_convolutional_box_predictor)
conv_hyperparams = hyperparams_fn(config_box_predictor.conv_hyperparams)
apply_batch_norm = config_box_predictor.conv_hyperparams.HasField(
'batch_norm')
# During training phase, logits are used to compute the loss. Only apply
# sigmoid at inference to make the inference graph TPU friendly. This is
# required because during TPU inference, model.postprocess is not called.
score_converter_fn = build_score_converter(
config_box_predictor.score_converter, is_training)
# Optionally apply clipping to box encodings, when box_encodings_clip_range
# is set.
box_encodings_clip_range = None
if config_box_predictor.HasField('box_encodings_clip_range'):
box_encodings_clip_range = BoxEncodingsClipRange(
min=config_box_predictor.box_encodings_clip_range.min,
max=config_box_predictor.box_encodings_clip_range.max)
return build_weight_shared_convolutional_keras_box_predictor(
is_training=is_training,
num_classes=num_classes,
conv_hyperparams=conv_hyperparams,
freeze_batchnorm=freeze_batchnorm,
inplace_batchnorm_update=inplace_batchnorm_update,
num_predictions_per_location_list=num_predictions_per_location_list,
depth=config_box_predictor.depth,
num_layers_before_predictor=(
config_box_predictor.num_layers_before_predictor),
box_code_size=config_box_predictor.box_code_size,
kernel_size=config_box_predictor.kernel_size,
add_background_class=add_background_class,
class_prediction_bias_init=(
config_box_predictor.class_prediction_bias_init),
use_dropout=config_box_predictor.use_dropout,
dropout_keep_prob=config_box_predictor.dropout_keep_probability,
share_prediction_tower=config_box_predictor.share_prediction_tower,
apply_batch_norm=apply_batch_norm,
use_depthwise=config_box_predictor.use_depthwise,
score_converter_fn=score_converter_fn,
box_encodings_clip_range=box_encodings_clip_range)
if box_predictor_oneof == 'mask_rcnn_box_predictor':
config_box_predictor = box_predictor_config.mask_rcnn_box_predictor
fc_hyperparams = hyperparams_fn(config_box_predictor.fc_hyperparams)
conv_hyperparams = None
if config_box_predictor.HasField('conv_hyperparams'):
conv_hyperparams = hyperparams_fn(
config_box_predictor.conv_hyperparams)
return build_mask_rcnn_keras_box_predictor(
is_training=is_training,
num_classes=num_classes,
add_background_class=add_background_class,
fc_hyperparams=fc_hyperparams,
freeze_batchnorm=freeze_batchnorm,
use_dropout=config_box_predictor.use_dropout,
dropout_keep_prob=config_box_predictor.dropout_keep_probability,
box_code_size=config_box_predictor.box_code_size,
share_box_across_classes=(
config_box_predictor.share_box_across_classes),
predict_instance_masks=config_box_predictor.predict_instance_masks,
conv_hyperparams=conv_hyperparams,
mask_height=config_box_predictor.mask_height,
mask_width=config_box_predictor.mask_width,
mask_prediction_num_conv_layers=(
config_box_predictor.mask_prediction_num_conv_layers),
mask_prediction_conv_depth=(
config_box_predictor.mask_prediction_conv_depth),
masks_are_class_agnostic=(
config_box_predictor.masks_are_class_agnostic),
convolve_then_upsample_masks=(
config_box_predictor.convolve_then_upsample_masks))
if box_predictor_oneof == 'rfcn_box_predictor':
config_box_predictor = box_predictor_config.rfcn_box_predictor
conv_hyperparams = hyperparams_fn(config_box_predictor.conv_hyperparams)
box_predictor_object = rfcn_keras_box_predictor.RfcnKerasBoxPredictor(
is_training=is_training,
num_classes=num_classes,
conv_hyperparams=conv_hyperparams,
freeze_batchnorm=freeze_batchnorm,
crop_size=[config_box_predictor.crop_height,
config_box_predictor.crop_width],
num_spatial_bins=[config_box_predictor.num_spatial_bins_height,
config_box_predictor.num_spatial_bins_width],
depth=config_box_predictor.depth,
box_code_size=config_box_predictor.box_code_size)
return box_predictor_object
raise ValueError(
'Unknown box predictor for Keras: {}'.format(box_predictor_oneof))
| [
"[email protected]"
] | |
aa3b3557c2779676f7b441397483f7569c7d4901 | 9ca6885d197aaf6869e2080901b361b034e4cc37 | /ElectroWeakAnalysis/ZReco/python/zToTauTau_ETau_EventContent_AODSIM_cff.py | ff21d1bbfb2a6f565db5f6386bf52e4f0df33be0 | [] | no_license | ktf/cmssw-migration | 153ff14346b20086f908a370029aa96575a2c51a | 583340dd03481dff673a52a2075c8bb46fa22ac6 | refs/heads/master | 2020-07-25T15:37:45.528173 | 2013-07-11T04:54:56 | 2013-07-11T04:54:56 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 449 | py | import FWCore.ParameterSet.Config as cms
from Configuration.EventContent.EventContent_cff import *
from ElectroWeakAnalysis.ZReco.zToTauTau_ETau_EventContent_cff import *
AODSIMZToTauTauETauEventContent = cms.PSet(
outputCommands = cms.untracked.vstring()
)
AODSIMZToTauTauETauEventContent.outputCommands.extend(AODSIMEventContent.outputCommands)
AODSIMZToTauTauETauEventContent.outputCommands.extend(zToTauTauETauEventContent.outputCommands)
| [
"[email protected]"
] | |
9b9b87f2ae5c5a6e2cebe144fce70e4c548ef29b | 66ab8fac9fb19e5ff470be0fa7b2b73600231f16 | /pyble/const/service/link_loss.py | 069e803e4cc77d7d9397e6abc7ba441d3108fc97 | [
"MIT"
] | permissive | bgromov/PyBLEWrapper | e97bbc2299f880838d246a8c6fdb27b05cb72af1 | 8a5d016e65b3c259391ddc97c371ab4b1b5c61b5 | refs/heads/master | 2020-03-25T21:41:43.702666 | 2018-08-12T23:38:16 | 2018-08-12T23:38:16 | 144,185,816 | 0 | 0 | MIT | 2018-08-09T17:50:12 | 2018-08-09T17:50:12 | null | UTF-8 | Python | false | false | 29 | py | NAME="Link Loss"
UUID=0x1803
| [
"[email protected]"
] | |
3a2079455f632c92b4b8d209389e7bd7bd73ee00 | b4a4fa30ae3f857e209356d1a28273b3cbbdc3e3 | /api_basic/views.py | 3b09cd7401a291568f6dc1dda8cbc8a97862ad2f | [] | no_license | sahin88/Django_Rest_Framework_Account_Article_RestAPI | c0fd4b97eb5629c3b65781663dd82edc6f0de384 | f5d7d12c04852392583f881f1e334d71c4582c4d | refs/heads/master | 2023-03-25T19:02:17.427294 | 2020-04-21T09:26:51 | 2020-04-21T09:26:51 | 257,544,520 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 4,326 | py | from django.shortcuts import render
from django.views.decorators.csrf import csrf_exempt
from django.http import HttpResponse ,JsonResponse
from rest_framework.parsers import JSONParser
from .models import Article
from .serializers import ArticleSerializer
from rest_framework.decorators import api_view
from rest_framework.response import Response
from rest_framework import status
from rest_framework.views import APIView
from rest_framework import mixins
from rest_framework import generics
from rest_framework.authentication import SessionAuthentication, BasicAuthentication,TokenAuthentication
from rest_framework.permissions import IsAuthenticated
class GenericAPIViews(generics.GenericAPIView, mixins.ListModelMixin, mixins.CreateModelMixin, mixins.UpdateModelMixin,mixins.RetrieveModelMixin, mixins.DestroyModelMixin):
serializer_class=ArticleSerializer
queryset=Article.objects.all()
lookup_field='id'
authentication_classes=[SessionAuthentication, BasicAuthentication]
authentication_classes=[TokenAuthentication]
permission_classes=[IsAuthenticated]
def get(self, request, id=None):
if id:
return self.retrieve(request,id)
else:
return self.list(request)
def post(self, request):
return self.create(request)
def put(self, request, id=None):
return self.update(request, id)
def delete(self, request, id=None):
return self.destroy(request, id)
class ArticleView(APIView):
def get(self, request):
articles=Article.objects.all()
serializer=ArticleSerializer(articles, many=True)
return Response(serializer.data)
def post(self,request):
serializer=ArticleSerializer(data=request.data)
#request.POST # Only handles form data. Only works for 'POST' method.
#request.data # Handles arbitrary data. Works for 'POST', 'PUT' and 'PATCH' methods.
if serializer.is_valid():
serializer.save()
return Response(serializer.data)
return Response(serializer.error, status.HTTP_400_BAD_REQUEST)
class ArticleDetailView(APIView):
def get(self, request, pk):
try:
article= Article.objects.get(pk=pk)
except:
return HttpResponse(status.HTTP_404_NOT_FOUND)
serializer= ArticleSerializer(article)
return Response(serializer.data)
def put(self, request, pk):
article=Article.objects.get(pk=pk)
serializer=ArticleSerializer(article, data=request.data)
if serializer.is_valid():
serializer.save()
return Response(serializer.data)
return Response(serializer.errors, status=status.HTTP_400_BAD_REQUEST)
def delete(self,request, pk):
article=Article.objects.get(pk=pk)
article.delete()
return Response(status=status.HTTP_204_NO_CONTENT)
# Create your views here.
# @api_view(['GET', 'POST'])
# def article_list(request):
# if request.method=='GET':
# articles=Article.objects.all()
# serializer=ArticleSerializer(articles, many=True)
# return Response(serializer.data)
# elif request.method=='POST':
# serializer=ArticleSerializer(data=request.data)
# if serializer.is_valid():
# serializer.save()
# return Response(serializer.data, status=status.HTTP_201_CREATED)
# return Response(serializer.errors, status=status.HTTP_400_BAD_REQUEST)
# @api_view(['GET','PUT', 'DELETE'])
# @csrf_exempt
# def article_detail(request,pk):
# try:
# article=Article.objects.get(pk=pk)
# except:
# return HttpResponse(status.HTTP_404_NOT_FOUND)
# if request.method=='GET':
# serializer=ArticleSerializer(article)
# return Response(serializer.data)
# elif request.method=='PUT':
# #data=JSONParser().parse(request)
# serializer=ArticleSerializer(article, data=request.data)
# if serializer.is_valid():
# serializer.save()
# return Response(serializer.data)
# return Response(serializer.errors, status=status.HTTP_400_BAD_REQUEST)
# elif request.method=='DELETE':
# article.delete()
# return Response(serializer.errors, status=status.HTTP_204_NO_CONTENT)
| [
"[email protected]"
] | |
141fb7da59e137862d2a34b048d6dee9113a4465 | 6e601105760f09d3c9f5306e18e4cf085f0bb4a2 | /10000-99999/10868.py | f86c7f9e367022589178de78365c22587a18d80c | [] | no_license | WSJI0/BOJ | 6412f69fddd46c4bcc96377e2b6e013f3bb1b524 | 160d8c13f72d7da835d938686f433e7b245be682 | refs/heads/master | 2023-07-06T15:35:50.815021 | 2023-07-04T01:39:48 | 2023-07-04T01:39:48 | 199,650,520 | 2 | 0 | null | 2020-04-20T09:03:03 | 2019-07-30T12:48:37 | Python | UTF-8 | Python | false | false | 768 | py | '''
10868번
최솟값
'''
import sys
input=sys.stdin.readline
def init(start, end, node):
if start==end:
tree[node]=a[start]
return tree[node]
mid=(start+end)//2
tree[node]=min(init(start, mid, node*2),init(mid+1, end, node*2+1))
return tree[node]
def findMin(start, end, node, left, right):
if left>end or right<start: return 9999999999
if left<=start and end<=right: return tree[node]
mid=(start+end)//2
return min(findMin(start, mid, node*2, left, right), findMin(mid+1, end, node*2+1, left, right))
n, m=map(int, input().split())
a=[]
tree=[9999999999]*(4*n)
for _ in range(n): a.append(int(input()))
init(0, n-1, 1)
for _ in range(m):
s, e=map(int, input().split())
print(findMin(0, n-1, 1, s-1, e-1)) | [
"[email protected]"
] | |
2d89215d3f25c0013d427f43c8a31bbfa0744d4c | 4d332c45578246847ef2cdcdeb827ca29ab06090 | /modules/Bio/PopGen/GenePop/Controller.py | e9866838933b8ef22e36ba20611c8b64317f340e | [
"MIT"
] | permissive | prateekgupta3991/justforlearn | 616cc297a2a6119fa959b9337a5e91c77a11ebf7 | 3984c64063b356cf89003e17a914272983b6cf48 | refs/heads/master | 2021-03-12T22:09:12.184638 | 2014-01-28T10:37:07 | 2014-01-28T10:37:07 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 52 | py | /usr/share/pyshared/Bio/PopGen/GenePop/Controller.py | [
"[email protected]"
] | |
451f6e60c661a8a37b1823007d8f99a173a8ec2a | 60139399c13b87c150573808d23c8f00542672a2 | /admux/mixins/websites.py | 4d3b238caf36bfa27f567f0d7fc5337f55b466db | [] | no_license | adverserve/admux_client | d4781501b5e8486a072eb3dc6c19580292c517f8 | 1c633072e75d2f3be660565825a5f77c9699e68c | refs/heads/master | 2021-01-10T20:29:45.695490 | 2013-10-24T14:52:21 | 2013-10-24T14:52:21 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 955 | py | # coding: utf-8
from admux import helpers
class WebsitesClientMixin(object):
def websites(self, links=None, expand=None):
"""
http://admux-demo.trust-box.at/developer/api/v1/get/websites/
links: Boolean
expand: array of strings
"""
url = '/websites'
params = {
'links': helpers._bool(links),
'expand': helpers._list(expand),
}
return self._request('GET', url, params=params)
def website(self, uuid, links=None, expand=None):
"""
http://admux-demo.trust-box.at/developer/api/v1/get/websites/uuid/
uuid: website identifier
links: Boolean
expand: array of strings
"""
url = '/websites/%(uuid)s' % { 'uuid': uuid, }
params = {
'links': helpers._bool(links),
'expand': helpers._list(expand),
}
return self._request('GET', url, params=params)
| [
"[email protected]"
] | |
f6f2e5c22f89a074e87d518b68687ad9227a830c | de24f83a5e3768a2638ebcf13cbe717e75740168 | /moodledata/vpl_data/380/usersdata/344/68278/submittedfiles/testes.py | e1878449ad74b2fb2bf5ad590a3c0f974f6d628b | [] | no_license | rafaelperazzo/programacao-web | 95643423a35c44613b0f64bed05bd34780fe2436 | 170dd5440afb9ee68a973f3de13a99aa4c735d79 | refs/heads/master | 2021-01-12T14:06:25.773146 | 2017-12-22T16:05:45 | 2017-12-22T16:05:45 | 69,566,344 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 82 | py | # -*- coding: utf-8 -*-
#COMECE AQUI ABAIXO
idade = int(input('digite sua idade')) | [
"[email protected]"
] | |
d3a372d9cda192f974f6edac19afaf207d458e26 | ca7aa979e7059467e158830b76673f5b77a0f5a3 | /Python_codes/p02785/s474912270.py | 3746381a7a22f2e9f041861db8ba3b5bb71bc13a | [] | no_license | Aasthaengg/IBMdataset | 7abb6cbcc4fb03ef5ca68ac64ba460c4a64f8901 | f33f1c5c3b16d0ea8d1f5a7d479ad288bb3f48d8 | refs/heads/main | 2023-04-22T10:22:44.763102 | 2021-05-13T17:27:22 | 2021-05-13T17:27:22 | 367,112,348 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 378 | py | import sys
input = sys.stdin.readline
def I(): return int(input())
def MI(): return map(int, input().split())
def LI(): return list(map(int, input().split()))
def main():
mod=10**9+7
N,K=MI()
h=LI()
h.sort()
if K>=N:
print(0)
exit()
for i in range(K):
h[-1-i]=0
ans=sum(h)
print(ans)
main()
| [
"[email protected]"
] | |
34e433c211df58f96eb9e335278588ea0f8e6417 | 5ddb3d3095ae782671d4592549e1fec38b73eb84 | /spacy/tests/pipeline/test_functions.py | fbb88ade26a6127552ab9bcb9f6ab40c4e39d3ef | [
"MIT"
] | permissive | Ali-Tahir/spaCy | c1ea9c5389044bc1e1f0e30f176b9b6e60a10690 | 9e210fa7fdb8e376655e7a7ab7debd3ffd718a63 | refs/heads/master | 2020-08-30T02:27:16.538275 | 2019-10-28T22:59:03 | 2019-10-28T22:59:03 | 218,234,283 | 0 | 0 | MIT | 2020-02-09T06:47:46 | 2019-10-29T08:05:03 | null | UTF-8 | Python | false | false | 882 | py | # coding: utf-8
from __future__ import unicode_literals
import pytest
from spacy.pipeline.functions import merge_subtokens
from ..util import get_doc
@pytest.fixture
def doc(en_tokenizer):
# fmt: off
text = "This is a sentence. This is another sentence. And a third."
heads = [1, 0, 1, -2, -3, 1, 0, 1, -2, -3, 1, 1, 1, 0]
deps = ["nsubj", "ROOT", "subtok", "attr", "punct", "nsubj", "ROOT",
"subtok", "attr", "punct", "subtok", "subtok", "subtok", "ROOT"]
# fmt: on
tokens = en_tokenizer(text)
return get_doc(tokens.vocab, words=[t.text for t in tokens], heads=heads, deps=deps)
def test_merge_subtokens(doc):
doc = merge_subtokens(doc)
# get_doc() doesn't set spaces, so the result is "And a third ."
assert [t.text for t in doc] == ["This", "is", "a sentence", ".", "This", "is", "another sentence", ".", "And a third ."]
| [
"[email protected]"
] | |
eff19506d086bf10caf3a7ff7cc64b66606e87dd | 888899f0cb3e6e7b28a9de39001a1fd1c177cd35 | /COMPLETE PYTHON-3 COURSE/Chapter-19-READ_WRITE_CSV_FILES/read_write_csv_simultanously.py | 4d67f080dfecfeb586057bc4ec3209854e177e35 | [] | no_license | VivakaNand/COMPLETE_PYTHON_3 | ef162d71d3a44bf661fcc1a8aacce31e7953cd7c | b3b835afe7671fdc3d29d912650fd4ccd3bc83f6 | refs/heads/master | 2023-02-04T10:13:41.881939 | 2020-12-23T08:30:51 | 2020-12-23T08:30:51 | 323,839,528 | 0 | 1 | null | null | null | null | UTF-8 | Python | false | false | 583 | py | # reader, DictReader
# writer, DictWriter
from csv import DictWriter, DictReader
with open('final.csv', 'r') as rf:
with open('file2.csv', 'w',newline='') as wf:
csv_reader = DictReader(rf)
csv_writer = DictWriter(wf, fieldnames=['first_name','last_name','age'])
csv_writer.writeheader()
for row in csv_reader:
fname,lname,age = row['firstname'],row['lastname'],row['age']
csv_writer.writerow({
'first_name': fname.upper(),
'last_name':lname.upper(),
'age':age
}) | [
"[email protected]"
] | |
15cada83ac6b82129e73f14015c85f9399b59db6 | 974c5a4f101d0e6f4dfa5fc2f7c641c9d2bd8184 | /sdk/compute/azure-mgmt-compute/azure/mgmt/compute/v2019_12_01/operations/_virtual_machines_operations.py | 86e37d500f8e3ac1ecdf9bcedfff149562445ccb | [
"LicenseRef-scancode-generic-cla",
"MIT",
"LGPL-2.1-or-later"
] | permissive | gaoyp830/azure-sdk-for-python | 4816f04c554dcffb7510a6b7044b0c86a2dd32e1 | 1c66defa502b754abcc9e5afa444ca03c609342f | refs/heads/master | 2022-10-20T21:33:44.281041 | 2022-09-29T17:03:13 | 2022-09-29T17:03:13 | 250,355,505 | 0 | 0 | MIT | 2020-03-26T19:42:13 | 2020-03-26T19:42:12 | null | UTF-8 | Python | false | false | 155,767 | py | # pylint: disable=too-many-lines
# coding=utf-8
# --------------------------------------------------------------------------
# Copyright (c) Microsoft Corporation. All rights reserved.
# Licensed under the MIT License. See License.txt in the project root for license information.
# Code generated by Microsoft (R) AutoRest Code Generator.
# Changes may cause incorrect behavior and will be lost if the code is regenerated.
# --------------------------------------------------------------------------
from typing import Any, Callable, Dict, IO, Iterable, Optional, TypeVar, Union, cast, overload
from urllib.parse import parse_qs, urljoin, urlparse
from azure.core.exceptions import (
ClientAuthenticationError,
HttpResponseError,
ResourceExistsError,
ResourceNotFoundError,
ResourceNotModifiedError,
map_error,
)
from azure.core.paging import ItemPaged
from azure.core.pipeline import PipelineResponse
from azure.core.pipeline.transport import HttpResponse
from azure.core.polling import LROPoller, NoPolling, PollingMethod
from azure.core.rest import HttpRequest
from azure.core.tracing.decorator import distributed_trace
from azure.core.utils import case_insensitive_dict
from azure.mgmt.core.exceptions import ARMErrorFormat
from azure.mgmt.core.polling.arm_polling import ARMPolling
from .. import models as _models
from ..._serialization import Serializer
from .._vendor import _convert_request, _format_url_section
T = TypeVar("T")
ClsType = Optional[Callable[[PipelineResponse[HttpRequest, HttpResponse], T, Dict[str, Any]], Any]]
_SERIALIZER = Serializer()
_SERIALIZER.client_side_validation = False
def build_list_by_location_request(location: str, subscription_id: str, **kwargs: Any) -> HttpRequest:
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
accept = _headers.pop("Accept", "application/json")
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/providers/Microsoft.Compute/locations/{location}/virtualMachines",
) # pylint: disable=line-too-long
path_format_arguments = {
"location": _SERIALIZER.url("location", location, "str", pattern=r"^[-\w\._]+$"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
# Construct headers
_headers["Accept"] = _SERIALIZER.header("accept", accept, "str")
return HttpRequest(method="GET", url=_url, params=_params, headers=_headers, **kwargs)
def build_capture_request(resource_group_name: str, vm_name: str, subscription_id: str, **kwargs: Any) -> HttpRequest:
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
content_type = kwargs.pop("content_type", _headers.pop("Content-Type", None)) # type: Optional[str]
accept = _headers.pop("Accept", "application/json")
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/capture",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
# Construct headers
if content_type is not None:
_headers["Content-Type"] = _SERIALIZER.header("content_type", content_type, "str")
_headers["Accept"] = _SERIALIZER.header("accept", accept, "str")
return HttpRequest(method="POST", url=_url, params=_params, headers=_headers, **kwargs)
def build_create_or_update_request(
resource_group_name: str, vm_name: str, subscription_id: str, **kwargs: Any
) -> HttpRequest:
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
content_type = kwargs.pop("content_type", _headers.pop("Content-Type", None)) # type: Optional[str]
accept = _headers.pop("Accept", "application/json")
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
# Construct headers
if content_type is not None:
_headers["Content-Type"] = _SERIALIZER.header("content_type", content_type, "str")
_headers["Accept"] = _SERIALIZER.header("accept", accept, "str")
return HttpRequest(method="PUT", url=_url, params=_params, headers=_headers, **kwargs)
def build_update_request(resource_group_name: str, vm_name: str, subscription_id: str, **kwargs: Any) -> HttpRequest:
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
content_type = kwargs.pop("content_type", _headers.pop("Content-Type", None)) # type: Optional[str]
accept = _headers.pop("Accept", "application/json")
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
# Construct headers
if content_type is not None:
_headers["Content-Type"] = _SERIALIZER.header("content_type", content_type, "str")
_headers["Accept"] = _SERIALIZER.header("accept", accept, "str")
return HttpRequest(method="PATCH", url=_url, params=_params, headers=_headers, **kwargs)
def build_delete_request(resource_group_name: str, vm_name: str, subscription_id: str, **kwargs: Any) -> HttpRequest:
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
return HttpRequest(method="DELETE", url=_url, params=_params, **kwargs)
def build_get_request(
resource_group_name: str, vm_name: str, subscription_id: str, *, expand: str = "instanceView", **kwargs: Any
) -> HttpRequest:
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
accept = _headers.pop("Accept", "application/json")
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
if expand is not None:
_params["$expand"] = _SERIALIZER.query("expand", expand, "str")
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
# Construct headers
_headers["Accept"] = _SERIALIZER.header("accept", accept, "str")
return HttpRequest(method="GET", url=_url, params=_params, headers=_headers, **kwargs)
def build_instance_view_request(
resource_group_name: str, vm_name: str, subscription_id: str, **kwargs: Any
) -> HttpRequest:
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
accept = _headers.pop("Accept", "application/json")
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/instanceView",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
# Construct headers
_headers["Accept"] = _SERIALIZER.header("accept", accept, "str")
return HttpRequest(method="GET", url=_url, params=_params, headers=_headers, **kwargs)
def build_convert_to_managed_disks_request(
resource_group_name: str, vm_name: str, subscription_id: str, **kwargs: Any
) -> HttpRequest:
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/convertToManagedDisks",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
return HttpRequest(method="POST", url=_url, params=_params, **kwargs)
def build_deallocate_request(
resource_group_name: str, vm_name: str, subscription_id: str, **kwargs: Any
) -> HttpRequest:
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/deallocate",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
return HttpRequest(method="POST", url=_url, params=_params, **kwargs)
def build_generalize_request(
resource_group_name: str, vm_name: str, subscription_id: str, **kwargs: Any
) -> HttpRequest:
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/generalize",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
return HttpRequest(method="POST", url=_url, params=_params, **kwargs)
def build_list_request(resource_group_name: str, subscription_id: str, **kwargs: Any) -> HttpRequest:
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
accept = _headers.pop("Accept", "application/json")
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
# Construct headers
_headers["Accept"] = _SERIALIZER.header("accept", accept, "str")
return HttpRequest(method="GET", url=_url, params=_params, headers=_headers, **kwargs)
def build_list_all_request(subscription_id: str, *, status_only: Optional[str] = None, **kwargs: Any) -> HttpRequest:
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
accept = _headers.pop("Accept", "application/json")
# Construct URL
_url = kwargs.pop("template_url", "/subscriptions/{subscriptionId}/providers/Microsoft.Compute/virtualMachines")
path_format_arguments = {
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
if status_only is not None:
_params["statusOnly"] = _SERIALIZER.query("status_only", status_only, "str")
# Construct headers
_headers["Accept"] = _SERIALIZER.header("accept", accept, "str")
return HttpRequest(method="GET", url=_url, params=_params, headers=_headers, **kwargs)
def build_list_available_sizes_request(
resource_group_name: str, vm_name: str, subscription_id: str, **kwargs: Any
) -> HttpRequest:
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
accept = _headers.pop("Accept", "application/json")
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/vmSizes",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
# Construct headers
_headers["Accept"] = _SERIALIZER.header("accept", accept, "str")
return HttpRequest(method="GET", url=_url, params=_params, headers=_headers, **kwargs)
def build_power_off_request(
resource_group_name: str, vm_name: str, subscription_id: str, *, skip_shutdown: bool = False, **kwargs: Any
) -> HttpRequest:
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/powerOff",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
if skip_shutdown is not None:
_params["skipShutdown"] = _SERIALIZER.query("skip_shutdown", skip_shutdown, "bool")
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
return HttpRequest(method="POST", url=_url, params=_params, **kwargs)
def build_reapply_request(resource_group_name: str, vm_name: str, subscription_id: str, **kwargs: Any) -> HttpRequest:
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
accept = _headers.pop("Accept", "application/json")
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/reapply",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
# Construct headers
_headers["Accept"] = _SERIALIZER.header("accept", accept, "str")
return HttpRequest(method="POST", url=_url, params=_params, headers=_headers, **kwargs)
def build_restart_request(resource_group_name: str, vm_name: str, subscription_id: str, **kwargs: Any) -> HttpRequest:
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/restart",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
return HttpRequest(method="POST", url=_url, params=_params, **kwargs)
def build_start_request(resource_group_name: str, vm_name: str, subscription_id: str, **kwargs: Any) -> HttpRequest:
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/start",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
return HttpRequest(method="POST", url=_url, params=_params, **kwargs)
def build_redeploy_request(resource_group_name: str, vm_name: str, subscription_id: str, **kwargs: Any) -> HttpRequest:
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/redeploy",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
return HttpRequest(method="POST", url=_url, params=_params, **kwargs)
def build_reimage_request(resource_group_name: str, vm_name: str, subscription_id: str, **kwargs: Any) -> HttpRequest:
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
content_type = kwargs.pop("content_type", _headers.pop("Content-Type", None)) # type: Optional[str]
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/reimage",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
# Construct headers
if content_type is not None:
_headers["Content-Type"] = _SERIALIZER.header("content_type", content_type, "str")
return HttpRequest(method="POST", url=_url, params=_params, headers=_headers, **kwargs)
def build_perform_maintenance_request(
resource_group_name: str, vm_name: str, subscription_id: str, **kwargs: Any
) -> HttpRequest:
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/performMaintenance",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
return HttpRequest(method="POST", url=_url, params=_params, **kwargs)
def build_simulate_eviction_request(
resource_group_name: str, vm_name: str, subscription_id: str, **kwargs: Any
) -> HttpRequest:
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/simulateEviction",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
return HttpRequest(method="POST", url=_url, params=_params, **kwargs)
def build_run_command_request(
resource_group_name: str, vm_name: str, subscription_id: str, **kwargs: Any
) -> HttpRequest:
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
content_type = kwargs.pop("content_type", _headers.pop("Content-Type", None)) # type: Optional[str]
accept = _headers.pop("Accept", "application/json, text/json")
# Construct URL
_url = kwargs.pop(
"template_url",
"/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/runCommand",
) # pylint: disable=line-too-long
path_format_arguments = {
"resourceGroupName": _SERIALIZER.url("resource_group_name", resource_group_name, "str"),
"vmName": _SERIALIZER.url("vm_name", vm_name, "str"),
"subscriptionId": _SERIALIZER.url("subscription_id", subscription_id, "str"),
}
_url = _format_url_section(_url, **path_format_arguments)
# Construct parameters
_params["api-version"] = _SERIALIZER.query("api_version", api_version, "str")
# Construct headers
if content_type is not None:
_headers["Content-Type"] = _SERIALIZER.header("content_type", content_type, "str")
_headers["Accept"] = _SERIALIZER.header("accept", accept, "str")
return HttpRequest(method="POST", url=_url, params=_params, headers=_headers, **kwargs)
class VirtualMachinesOperations: # pylint: disable=too-many-public-methods
"""
.. warning::
**DO NOT** instantiate this class directly.
Instead, you should access the following operations through
:class:`~azure.mgmt.compute.v2019_12_01.ComputeManagementClient`'s
:attr:`virtual_machines` attribute.
"""
models = _models
def __init__(self, *args, **kwargs):
input_args = list(args)
self._client = input_args.pop(0) if input_args else kwargs.pop("client")
self._config = input_args.pop(0) if input_args else kwargs.pop("config")
self._serialize = input_args.pop(0) if input_args else kwargs.pop("serializer")
self._deserialize = input_args.pop(0) if input_args else kwargs.pop("deserializer")
@distributed_trace
def list_by_location(self, location: str, **kwargs: Any) -> Iterable["_models.VirtualMachine"]:
"""Gets all the virtual machines under the specified subscription for the specified location.
:param location: The location for which virtual machines under the subscription are queried.
Required.
:type location: str
:keyword callable cls: A custom type or function that will be passed the direct response
:return: An iterator like instance of either VirtualMachine or the result of cls(response)
:rtype: ~azure.core.paging.ItemPaged[~azure.mgmt.compute.v2019_12_01.models.VirtualMachine]
:raises ~azure.core.exceptions.HttpResponseError:
"""
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[_models.VirtualMachineListResult]
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
def prepare_request(next_link=None):
if not next_link:
request = build_list_by_location_request(
location=location,
subscription_id=self._config.subscription_id,
api_version=api_version,
template_url=self.list_by_location.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
else:
# make call to next link with the client's api-version
_parsed_next_link = urlparse(next_link)
_next_request_params = case_insensitive_dict(parse_qs(_parsed_next_link.query))
_next_request_params["api-version"] = self._config.api_version
request = HttpRequest("GET", urljoin(next_link, _parsed_next_link.path), params=_next_request_params)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
request.method = "GET"
return request
def extract_data(pipeline_response):
deserialized = self._deserialize("VirtualMachineListResult", pipeline_response)
list_of_elem = deserialized.value
if cls:
list_of_elem = cls(list_of_elem)
return deserialized.next_link or None, iter(list_of_elem)
def get_next(next_link=None):
request = prepare_request(next_link)
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
return pipeline_response
return ItemPaged(get_next, extract_data)
list_by_location.metadata = {"url": "/subscriptions/{subscriptionId}/providers/Microsoft.Compute/locations/{location}/virtualMachines"} # type: ignore
def _capture_initial(
self,
resource_group_name: str,
vm_name: str,
parameters: Union[_models.VirtualMachineCaptureParameters, IO],
**kwargs: Any
) -> Optional[_models.VirtualMachineCaptureResult]:
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
content_type = kwargs.pop("content_type", _headers.pop("Content-Type", None)) # type: Optional[str]
cls = kwargs.pop("cls", None) # type: ClsType[Optional[_models.VirtualMachineCaptureResult]]
content_type = content_type or "application/json"
_json = None
_content = None
if isinstance(parameters, (IO, bytes)):
_content = parameters
else:
_json = self._serialize.body(parameters, "VirtualMachineCaptureParameters")
request = build_capture_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
api_version=api_version,
content_type=content_type,
json=_json,
content=_content,
template_url=self._capture_initial.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200, 202]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
deserialized = None
if response.status_code == 200:
deserialized = self._deserialize("VirtualMachineCaptureResult", pipeline_response)
if cls:
return cls(pipeline_response, deserialized, {})
return deserialized
_capture_initial.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/capture"} # type: ignore
@overload
def begin_capture(
self,
resource_group_name: str,
vm_name: str,
parameters: _models.VirtualMachineCaptureParameters,
*,
content_type: str = "application/json",
**kwargs: Any
) -> LROPoller[_models.VirtualMachineCaptureResult]:
"""Captures the VM by copying virtual hard disks of the VM and outputs a template that can be used
to create similar VMs.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:param parameters: Parameters supplied to the Capture Virtual Machine operation. Required.
:type parameters: ~azure.mgmt.compute.v2019_12_01.models.VirtualMachineCaptureParameters
:keyword content_type: Body Parameter content-type. Content type parameter for JSON body.
Default value is "application/json".
:paramtype content_type: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either VirtualMachineCaptureResult or the result
of cls(response)
:rtype:
~azure.core.polling.LROPoller[~azure.mgmt.compute.v2019_12_01.models.VirtualMachineCaptureResult]
:raises ~azure.core.exceptions.HttpResponseError:
"""
@overload
def begin_capture(
self,
resource_group_name: str,
vm_name: str,
parameters: IO,
*,
content_type: str = "application/json",
**kwargs: Any
) -> LROPoller[_models.VirtualMachineCaptureResult]:
"""Captures the VM by copying virtual hard disks of the VM and outputs a template that can be used
to create similar VMs.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:param parameters: Parameters supplied to the Capture Virtual Machine operation. Required.
:type parameters: IO
:keyword content_type: Body Parameter content-type. Content type parameter for binary body.
Default value is "application/json".
:paramtype content_type: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either VirtualMachineCaptureResult or the result
of cls(response)
:rtype:
~azure.core.polling.LROPoller[~azure.mgmt.compute.v2019_12_01.models.VirtualMachineCaptureResult]
:raises ~azure.core.exceptions.HttpResponseError:
"""
@distributed_trace
def begin_capture(
self,
resource_group_name: str,
vm_name: str,
parameters: Union[_models.VirtualMachineCaptureParameters, IO],
**kwargs: Any
) -> LROPoller[_models.VirtualMachineCaptureResult]:
"""Captures the VM by copying virtual hard disks of the VM and outputs a template that can be used
to create similar VMs.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:param parameters: Parameters supplied to the Capture Virtual Machine operation. Is either a
model type or a IO type. Required.
:type parameters: ~azure.mgmt.compute.v2019_12_01.models.VirtualMachineCaptureParameters or IO
:keyword content_type: Body Parameter content-type. Known values are: 'application/json'.
Default value is None.
:paramtype content_type: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either VirtualMachineCaptureResult or the result
of cls(response)
:rtype:
~azure.core.polling.LROPoller[~azure.mgmt.compute.v2019_12_01.models.VirtualMachineCaptureResult]
:raises ~azure.core.exceptions.HttpResponseError:
"""
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
content_type = kwargs.pop("content_type", _headers.pop("Content-Type", None)) # type: Optional[str]
cls = kwargs.pop("cls", None) # type: ClsType[_models.VirtualMachineCaptureResult]
polling = kwargs.pop("polling", True) # type: Union[bool, PollingMethod]
lro_delay = kwargs.pop("polling_interval", self._config.polling_interval)
cont_token = kwargs.pop("continuation_token", None) # type: Optional[str]
if cont_token is None:
raw_result = self._capture_initial( # type: ignore
resource_group_name=resource_group_name,
vm_name=vm_name,
parameters=parameters,
api_version=api_version,
content_type=content_type,
cls=lambda x, y, z: x,
headers=_headers,
params=_params,
**kwargs
)
kwargs.pop("error_map", None)
def get_long_running_output(pipeline_response):
deserialized = self._deserialize("VirtualMachineCaptureResult", pipeline_response)
if cls:
return cls(pipeline_response, deserialized, {})
return deserialized
if polling is True:
polling_method = cast(
PollingMethod, ARMPolling(lro_delay, lro_options={"final-state-via": "location"}, **kwargs)
) # type: PollingMethod
elif polling is False:
polling_method = cast(PollingMethod, NoPolling())
else:
polling_method = polling
if cont_token:
return LROPoller.from_continuation_token(
polling_method=polling_method,
continuation_token=cont_token,
client=self._client,
deserialization_callback=get_long_running_output,
)
return LROPoller(self._client, raw_result, get_long_running_output, polling_method)
begin_capture.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/capture"} # type: ignore
def _create_or_update_initial(
self, resource_group_name: str, vm_name: str, parameters: Union[_models.VirtualMachine, IO], **kwargs: Any
) -> _models.VirtualMachine:
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
content_type = kwargs.pop("content_type", _headers.pop("Content-Type", None)) # type: Optional[str]
cls = kwargs.pop("cls", None) # type: ClsType[_models.VirtualMachine]
content_type = content_type or "application/json"
_json = None
_content = None
if isinstance(parameters, (IO, bytes)):
_content = parameters
else:
_json = self._serialize.body(parameters, "VirtualMachine")
request = build_create_or_update_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
api_version=api_version,
content_type=content_type,
json=_json,
content=_content,
template_url=self._create_or_update_initial.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200, 201]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
if response.status_code == 200:
deserialized = self._deserialize("VirtualMachine", pipeline_response)
if response.status_code == 201:
deserialized = self._deserialize("VirtualMachine", pipeline_response)
if cls:
return cls(pipeline_response, deserialized, {})
return deserialized
_create_or_update_initial.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}"} # type: ignore
@overload
def begin_create_or_update(
self,
resource_group_name: str,
vm_name: str,
parameters: _models.VirtualMachine,
*,
content_type: str = "application/json",
**kwargs: Any
) -> LROPoller[_models.VirtualMachine]:
"""The operation to create or update a virtual machine. Please note some properties can be set
only during virtual machine creation.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:param parameters: Parameters supplied to the Create Virtual Machine operation. Required.
:type parameters: ~azure.mgmt.compute.v2019_12_01.models.VirtualMachine
:keyword content_type: Body Parameter content-type. Content type parameter for JSON body.
Default value is "application/json".
:paramtype content_type: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either VirtualMachine or the result of
cls(response)
:rtype: ~azure.core.polling.LROPoller[~azure.mgmt.compute.v2019_12_01.models.VirtualMachine]
:raises ~azure.core.exceptions.HttpResponseError:
"""
@overload
def begin_create_or_update(
self,
resource_group_name: str,
vm_name: str,
parameters: IO,
*,
content_type: str = "application/json",
**kwargs: Any
) -> LROPoller[_models.VirtualMachine]:
"""The operation to create or update a virtual machine. Please note some properties can be set
only during virtual machine creation.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:param parameters: Parameters supplied to the Create Virtual Machine operation. Required.
:type parameters: IO
:keyword content_type: Body Parameter content-type. Content type parameter for binary body.
Default value is "application/json".
:paramtype content_type: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either VirtualMachine or the result of
cls(response)
:rtype: ~azure.core.polling.LROPoller[~azure.mgmt.compute.v2019_12_01.models.VirtualMachine]
:raises ~azure.core.exceptions.HttpResponseError:
"""
@distributed_trace
def begin_create_or_update(
self, resource_group_name: str, vm_name: str, parameters: Union[_models.VirtualMachine, IO], **kwargs: Any
) -> LROPoller[_models.VirtualMachine]:
"""The operation to create or update a virtual machine. Please note some properties can be set
only during virtual machine creation.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:param parameters: Parameters supplied to the Create Virtual Machine operation. Is either a
model type or a IO type. Required.
:type parameters: ~azure.mgmt.compute.v2019_12_01.models.VirtualMachine or IO
:keyword content_type: Body Parameter content-type. Known values are: 'application/json'.
Default value is None.
:paramtype content_type: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either VirtualMachine or the result of
cls(response)
:rtype: ~azure.core.polling.LROPoller[~azure.mgmt.compute.v2019_12_01.models.VirtualMachine]
:raises ~azure.core.exceptions.HttpResponseError:
"""
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
content_type = kwargs.pop("content_type", _headers.pop("Content-Type", None)) # type: Optional[str]
cls = kwargs.pop("cls", None) # type: ClsType[_models.VirtualMachine]
polling = kwargs.pop("polling", True) # type: Union[bool, PollingMethod]
lro_delay = kwargs.pop("polling_interval", self._config.polling_interval)
cont_token = kwargs.pop("continuation_token", None) # type: Optional[str]
if cont_token is None:
raw_result = self._create_or_update_initial( # type: ignore
resource_group_name=resource_group_name,
vm_name=vm_name,
parameters=parameters,
api_version=api_version,
content_type=content_type,
cls=lambda x, y, z: x,
headers=_headers,
params=_params,
**kwargs
)
kwargs.pop("error_map", None)
def get_long_running_output(pipeline_response):
deserialized = self._deserialize("VirtualMachine", pipeline_response)
if cls:
return cls(pipeline_response, deserialized, {})
return deserialized
if polling is True:
polling_method = cast(PollingMethod, ARMPolling(lro_delay, **kwargs)) # type: PollingMethod
elif polling is False:
polling_method = cast(PollingMethod, NoPolling())
else:
polling_method = polling
if cont_token:
return LROPoller.from_continuation_token(
polling_method=polling_method,
continuation_token=cont_token,
client=self._client,
deserialization_callback=get_long_running_output,
)
return LROPoller(self._client, raw_result, get_long_running_output, polling_method)
begin_create_or_update.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}"} # type: ignore
def _update_initial(
self, resource_group_name: str, vm_name: str, parameters: Union[_models.VirtualMachineUpdate, IO], **kwargs: Any
) -> _models.VirtualMachine:
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
content_type = kwargs.pop("content_type", _headers.pop("Content-Type", None)) # type: Optional[str]
cls = kwargs.pop("cls", None) # type: ClsType[_models.VirtualMachine]
content_type = content_type or "application/json"
_json = None
_content = None
if isinstance(parameters, (IO, bytes)):
_content = parameters
else:
_json = self._serialize.body(parameters, "VirtualMachineUpdate")
request = build_update_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
api_version=api_version,
content_type=content_type,
json=_json,
content=_content,
template_url=self._update_initial.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200, 201]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
if response.status_code == 200:
deserialized = self._deserialize("VirtualMachine", pipeline_response)
if response.status_code == 201:
deserialized = self._deserialize("VirtualMachine", pipeline_response)
if cls:
return cls(pipeline_response, deserialized, {})
return deserialized
_update_initial.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}"} # type: ignore
@overload
def begin_update(
self,
resource_group_name: str,
vm_name: str,
parameters: _models.VirtualMachineUpdate,
*,
content_type: str = "application/json",
**kwargs: Any
) -> LROPoller[_models.VirtualMachine]:
"""The operation to update a virtual machine.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:param parameters: Parameters supplied to the Update Virtual Machine operation. Required.
:type parameters: ~azure.mgmt.compute.v2019_12_01.models.VirtualMachineUpdate
:keyword content_type: Body Parameter content-type. Content type parameter for JSON body.
Default value is "application/json".
:paramtype content_type: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either VirtualMachine or the result of
cls(response)
:rtype: ~azure.core.polling.LROPoller[~azure.mgmt.compute.v2019_12_01.models.VirtualMachine]
:raises ~azure.core.exceptions.HttpResponseError:
"""
@overload
def begin_update(
self,
resource_group_name: str,
vm_name: str,
parameters: IO,
*,
content_type: str = "application/json",
**kwargs: Any
) -> LROPoller[_models.VirtualMachine]:
"""The operation to update a virtual machine.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:param parameters: Parameters supplied to the Update Virtual Machine operation. Required.
:type parameters: IO
:keyword content_type: Body Parameter content-type. Content type parameter for binary body.
Default value is "application/json".
:paramtype content_type: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either VirtualMachine or the result of
cls(response)
:rtype: ~azure.core.polling.LROPoller[~azure.mgmt.compute.v2019_12_01.models.VirtualMachine]
:raises ~azure.core.exceptions.HttpResponseError:
"""
@distributed_trace
def begin_update(
self, resource_group_name: str, vm_name: str, parameters: Union[_models.VirtualMachineUpdate, IO], **kwargs: Any
) -> LROPoller[_models.VirtualMachine]:
"""The operation to update a virtual machine.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:param parameters: Parameters supplied to the Update Virtual Machine operation. Is either a
model type or a IO type. Required.
:type parameters: ~azure.mgmt.compute.v2019_12_01.models.VirtualMachineUpdate or IO
:keyword content_type: Body Parameter content-type. Known values are: 'application/json'.
Default value is None.
:paramtype content_type: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either VirtualMachine or the result of
cls(response)
:rtype: ~azure.core.polling.LROPoller[~azure.mgmt.compute.v2019_12_01.models.VirtualMachine]
:raises ~azure.core.exceptions.HttpResponseError:
"""
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
content_type = kwargs.pop("content_type", _headers.pop("Content-Type", None)) # type: Optional[str]
cls = kwargs.pop("cls", None) # type: ClsType[_models.VirtualMachine]
polling = kwargs.pop("polling", True) # type: Union[bool, PollingMethod]
lro_delay = kwargs.pop("polling_interval", self._config.polling_interval)
cont_token = kwargs.pop("continuation_token", None) # type: Optional[str]
if cont_token is None:
raw_result = self._update_initial( # type: ignore
resource_group_name=resource_group_name,
vm_name=vm_name,
parameters=parameters,
api_version=api_version,
content_type=content_type,
cls=lambda x, y, z: x,
headers=_headers,
params=_params,
**kwargs
)
kwargs.pop("error_map", None)
def get_long_running_output(pipeline_response):
deserialized = self._deserialize("VirtualMachine", pipeline_response)
if cls:
return cls(pipeline_response, deserialized, {})
return deserialized
if polling is True:
polling_method = cast(PollingMethod, ARMPolling(lro_delay, **kwargs)) # type: PollingMethod
elif polling is False:
polling_method = cast(PollingMethod, NoPolling())
else:
polling_method = polling
if cont_token:
return LROPoller.from_continuation_token(
polling_method=polling_method,
continuation_token=cont_token,
client=self._client,
deserialization_callback=get_long_running_output,
)
return LROPoller(self._client, raw_result, get_long_running_output, polling_method)
begin_update.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}"} # type: ignore
def _delete_initial( # pylint: disable=inconsistent-return-statements
self, resource_group_name: str, vm_name: str, **kwargs: Any
) -> None:
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
request = build_delete_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
api_version=api_version,
template_url=self._delete_initial.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200, 202, 204]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
if cls:
return cls(pipeline_response, None, {})
_delete_initial.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}"} # type: ignore
@distributed_trace
def begin_delete(self, resource_group_name: str, vm_name: str, **kwargs: Any) -> LROPoller[None]:
"""The operation to delete a virtual machine.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either None or the result of cls(response)
:rtype: ~azure.core.polling.LROPoller[None]
:raises ~azure.core.exceptions.HttpResponseError:
"""
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
polling = kwargs.pop("polling", True) # type: Union[bool, PollingMethod]
lro_delay = kwargs.pop("polling_interval", self._config.polling_interval)
cont_token = kwargs.pop("continuation_token", None) # type: Optional[str]
if cont_token is None:
raw_result = self._delete_initial( # type: ignore
resource_group_name=resource_group_name,
vm_name=vm_name,
api_version=api_version,
cls=lambda x, y, z: x,
headers=_headers,
params=_params,
**kwargs
)
kwargs.pop("error_map", None)
def get_long_running_output(pipeline_response): # pylint: disable=inconsistent-return-statements
if cls:
return cls(pipeline_response, None, {})
if polling is True:
polling_method = cast(PollingMethod, ARMPolling(lro_delay, **kwargs)) # type: PollingMethod
elif polling is False:
polling_method = cast(PollingMethod, NoPolling())
else:
polling_method = polling
if cont_token:
return LROPoller.from_continuation_token(
polling_method=polling_method,
continuation_token=cont_token,
client=self._client,
deserialization_callback=get_long_running_output,
)
return LROPoller(self._client, raw_result, get_long_running_output, polling_method)
begin_delete.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}"} # type: ignore
@distributed_trace
def get(
self, resource_group_name: str, vm_name: str, expand: str = "instanceView", **kwargs: Any
) -> _models.VirtualMachine:
"""Retrieves information about the model view or the instance view of a virtual machine.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:param expand: The expand expression to apply on the operation. Known values are "instanceView"
and None. Default value is "instanceView".
:type expand: str
:keyword callable cls: A custom type or function that will be passed the direct response
:return: VirtualMachine or the result of cls(response)
:rtype: ~azure.mgmt.compute.v2019_12_01.models.VirtualMachine
:raises ~azure.core.exceptions.HttpResponseError:
"""
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[_models.VirtualMachine]
request = build_get_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
expand=expand,
api_version=api_version,
template_url=self.get.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
deserialized = self._deserialize("VirtualMachine", pipeline_response)
if cls:
return cls(pipeline_response, deserialized, {})
return deserialized
get.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}"} # type: ignore
@distributed_trace
def instance_view(
self, resource_group_name: str, vm_name: str, **kwargs: Any
) -> _models.VirtualMachineInstanceView:
"""Retrieves information about the run-time state of a virtual machine.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:keyword callable cls: A custom type or function that will be passed the direct response
:return: VirtualMachineInstanceView or the result of cls(response)
:rtype: ~azure.mgmt.compute.v2019_12_01.models.VirtualMachineInstanceView
:raises ~azure.core.exceptions.HttpResponseError:
"""
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[_models.VirtualMachineInstanceView]
request = build_instance_view_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
api_version=api_version,
template_url=self.instance_view.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
deserialized = self._deserialize("VirtualMachineInstanceView", pipeline_response)
if cls:
return cls(pipeline_response, deserialized, {})
return deserialized
instance_view.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/instanceView"} # type: ignore
def _convert_to_managed_disks_initial( # pylint: disable=inconsistent-return-statements
self, resource_group_name: str, vm_name: str, **kwargs: Any
) -> None:
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
request = build_convert_to_managed_disks_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
api_version=api_version,
template_url=self._convert_to_managed_disks_initial.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200, 202]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
if cls:
return cls(pipeline_response, None, {})
_convert_to_managed_disks_initial.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/convertToManagedDisks"} # type: ignore
@distributed_trace
def begin_convert_to_managed_disks(self, resource_group_name: str, vm_name: str, **kwargs: Any) -> LROPoller[None]:
"""Converts virtual machine disks from blob-based to managed disks. Virtual machine must be
stop-deallocated before invoking this operation. :code:`<br>`For Windows, please refer to
`Convert a virtual machine from unmanaged disks to managed disks.
<https://docs.microsoft.com/en-us/azure/virtual-machines/windows/convert-unmanaged-to-managed-disks>`_.:code:`<br>`For
Linux, please refer to `Convert a virtual machine from unmanaged disks to managed disks.
<https://docs.microsoft.com/en-us/azure/virtual-machines/linux/convert-unmanaged-to-managed-disks>`_.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either None or the result of cls(response)
:rtype: ~azure.core.polling.LROPoller[None]
:raises ~azure.core.exceptions.HttpResponseError:
"""
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
polling = kwargs.pop("polling", True) # type: Union[bool, PollingMethod]
lro_delay = kwargs.pop("polling_interval", self._config.polling_interval)
cont_token = kwargs.pop("continuation_token", None) # type: Optional[str]
if cont_token is None:
raw_result = self._convert_to_managed_disks_initial( # type: ignore
resource_group_name=resource_group_name,
vm_name=vm_name,
api_version=api_version,
cls=lambda x, y, z: x,
headers=_headers,
params=_params,
**kwargs
)
kwargs.pop("error_map", None)
def get_long_running_output(pipeline_response): # pylint: disable=inconsistent-return-statements
if cls:
return cls(pipeline_response, None, {})
if polling is True:
polling_method = cast(PollingMethod, ARMPolling(lro_delay, **kwargs)) # type: PollingMethod
elif polling is False:
polling_method = cast(PollingMethod, NoPolling())
else:
polling_method = polling
if cont_token:
return LROPoller.from_continuation_token(
polling_method=polling_method,
continuation_token=cont_token,
client=self._client,
deserialization_callback=get_long_running_output,
)
return LROPoller(self._client, raw_result, get_long_running_output, polling_method)
begin_convert_to_managed_disks.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/convertToManagedDisks"} # type: ignore
def _deallocate_initial( # pylint: disable=inconsistent-return-statements
self, resource_group_name: str, vm_name: str, **kwargs: Any
) -> None:
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
request = build_deallocate_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
api_version=api_version,
template_url=self._deallocate_initial.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200, 202]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
if cls:
return cls(pipeline_response, None, {})
_deallocate_initial.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/deallocate"} # type: ignore
@distributed_trace
def begin_deallocate(self, resource_group_name: str, vm_name: str, **kwargs: Any) -> LROPoller[None]:
"""Shuts down the virtual machine and releases the compute resources. You are not billed for the
compute resources that this virtual machine uses.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either None or the result of cls(response)
:rtype: ~azure.core.polling.LROPoller[None]
:raises ~azure.core.exceptions.HttpResponseError:
"""
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
polling = kwargs.pop("polling", True) # type: Union[bool, PollingMethod]
lro_delay = kwargs.pop("polling_interval", self._config.polling_interval)
cont_token = kwargs.pop("continuation_token", None) # type: Optional[str]
if cont_token is None:
raw_result = self._deallocate_initial( # type: ignore
resource_group_name=resource_group_name,
vm_name=vm_name,
api_version=api_version,
cls=lambda x, y, z: x,
headers=_headers,
params=_params,
**kwargs
)
kwargs.pop("error_map", None)
def get_long_running_output(pipeline_response): # pylint: disable=inconsistent-return-statements
if cls:
return cls(pipeline_response, None, {})
if polling is True:
polling_method = cast(PollingMethod, ARMPolling(lro_delay, **kwargs)) # type: PollingMethod
elif polling is False:
polling_method = cast(PollingMethod, NoPolling())
else:
polling_method = polling
if cont_token:
return LROPoller.from_continuation_token(
polling_method=polling_method,
continuation_token=cont_token,
client=self._client,
deserialization_callback=get_long_running_output,
)
return LROPoller(self._client, raw_result, get_long_running_output, polling_method)
begin_deallocate.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/deallocate"} # type: ignore
@distributed_trace
def generalize( # pylint: disable=inconsistent-return-statements
self, resource_group_name: str, vm_name: str, **kwargs: Any
) -> None:
"""Sets the OS state of the virtual machine to generalized. It is recommended to sysprep the
virtual machine before performing this operation. :code:`<br>`For Windows, please refer to
`Create a managed image of a generalized VM in Azure
<https://docs.microsoft.com/en-us/azure/virtual-machines/windows/capture-image-resource>`_.:code:`<br>`For
Linux, please refer to `How to create an image of a virtual machine or VHD
<https://docs.microsoft.com/en-us/azure/virtual-machines/linux/capture-image>`_.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:keyword callable cls: A custom type or function that will be passed the direct response
:return: None or the result of cls(response)
:rtype: None
:raises ~azure.core.exceptions.HttpResponseError:
"""
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
request = build_generalize_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
api_version=api_version,
template_url=self.generalize.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
if cls:
return cls(pipeline_response, None, {})
generalize.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/generalize"} # type: ignore
@distributed_trace
def list(self, resource_group_name: str, **kwargs: Any) -> Iterable["_models.VirtualMachine"]:
"""Lists all of the virtual machines in the specified resource group. Use the nextLink property in
the response to get the next page of virtual machines.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:keyword callable cls: A custom type or function that will be passed the direct response
:return: An iterator like instance of either VirtualMachine or the result of cls(response)
:rtype: ~azure.core.paging.ItemPaged[~azure.mgmt.compute.v2019_12_01.models.VirtualMachine]
:raises ~azure.core.exceptions.HttpResponseError:
"""
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[_models.VirtualMachineListResult]
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
def prepare_request(next_link=None):
if not next_link:
request = build_list_request(
resource_group_name=resource_group_name,
subscription_id=self._config.subscription_id,
api_version=api_version,
template_url=self.list.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
else:
# make call to next link with the client's api-version
_parsed_next_link = urlparse(next_link)
_next_request_params = case_insensitive_dict(parse_qs(_parsed_next_link.query))
_next_request_params["api-version"] = self._config.api_version
request = HttpRequest("GET", urljoin(next_link, _parsed_next_link.path), params=_next_request_params)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
request.method = "GET"
return request
def extract_data(pipeline_response):
deserialized = self._deserialize("VirtualMachineListResult", pipeline_response)
list_of_elem = deserialized.value
if cls:
list_of_elem = cls(list_of_elem)
return deserialized.next_link or None, iter(list_of_elem)
def get_next(next_link=None):
request = prepare_request(next_link)
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
return pipeline_response
return ItemPaged(get_next, extract_data)
list.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines"} # type: ignore
@distributed_trace
def list_all(self, status_only: Optional[str] = None, **kwargs: Any) -> Iterable["_models.VirtualMachine"]:
"""Lists all of the virtual machines in the specified subscription. Use the nextLink property in
the response to get the next page of virtual machines.
:param status_only: statusOnly=true enables fetching run time status of all Virtual Machines in
the subscription. Default value is None.
:type status_only: str
:keyword callable cls: A custom type or function that will be passed the direct response
:return: An iterator like instance of either VirtualMachine or the result of cls(response)
:rtype: ~azure.core.paging.ItemPaged[~azure.mgmt.compute.v2019_12_01.models.VirtualMachine]
:raises ~azure.core.exceptions.HttpResponseError:
"""
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[_models.VirtualMachineListResult]
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
def prepare_request(next_link=None):
if not next_link:
request = build_list_all_request(
subscription_id=self._config.subscription_id,
status_only=status_only,
api_version=api_version,
template_url=self.list_all.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
else:
# make call to next link with the client's api-version
_parsed_next_link = urlparse(next_link)
_next_request_params = case_insensitive_dict(parse_qs(_parsed_next_link.query))
_next_request_params["api-version"] = self._config.api_version
request = HttpRequest("GET", urljoin(next_link, _parsed_next_link.path), params=_next_request_params)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
request.method = "GET"
return request
def extract_data(pipeline_response):
deserialized = self._deserialize("VirtualMachineListResult", pipeline_response)
list_of_elem = deserialized.value
if cls:
list_of_elem = cls(list_of_elem)
return deserialized.next_link or None, iter(list_of_elem)
def get_next(next_link=None):
request = prepare_request(next_link)
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
return pipeline_response
return ItemPaged(get_next, extract_data)
list_all.metadata = {"url": "/subscriptions/{subscriptionId}/providers/Microsoft.Compute/virtualMachines"} # type: ignore
@distributed_trace
def list_available_sizes(
self, resource_group_name: str, vm_name: str, **kwargs: Any
) -> Iterable["_models.VirtualMachineSize"]:
"""Lists all available virtual machine sizes to which the specified virtual machine can be
resized.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:keyword callable cls: A custom type or function that will be passed the direct response
:return: An iterator like instance of either VirtualMachineSize or the result of cls(response)
:rtype: ~azure.core.paging.ItemPaged[~azure.mgmt.compute.v2019_12_01.models.VirtualMachineSize]
:raises ~azure.core.exceptions.HttpResponseError:
"""
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[_models.VirtualMachineSizeListResult]
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
def prepare_request(next_link=None):
if not next_link:
request = build_list_available_sizes_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
api_version=api_version,
template_url=self.list_available_sizes.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
else:
# make call to next link with the client's api-version
_parsed_next_link = urlparse(next_link)
_next_request_params = case_insensitive_dict(parse_qs(_parsed_next_link.query))
_next_request_params["api-version"] = self._config.api_version
request = HttpRequest("GET", urljoin(next_link, _parsed_next_link.path), params=_next_request_params)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
request.method = "GET"
return request
def extract_data(pipeline_response):
deserialized = self._deserialize("VirtualMachineSizeListResult", pipeline_response)
list_of_elem = deserialized.value
if cls:
list_of_elem = cls(list_of_elem)
return None, iter(list_of_elem)
def get_next(next_link=None):
request = prepare_request(next_link)
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
return pipeline_response
return ItemPaged(get_next, extract_data)
list_available_sizes.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/vmSizes"} # type: ignore
def _power_off_initial( # pylint: disable=inconsistent-return-statements
self, resource_group_name: str, vm_name: str, skip_shutdown: bool = False, **kwargs: Any
) -> None:
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
request = build_power_off_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
skip_shutdown=skip_shutdown,
api_version=api_version,
template_url=self._power_off_initial.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200, 202]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
if cls:
return cls(pipeline_response, None, {})
_power_off_initial.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/powerOff"} # type: ignore
@distributed_trace
def begin_power_off(
self, resource_group_name: str, vm_name: str, skip_shutdown: bool = False, **kwargs: Any
) -> LROPoller[None]:
"""The operation to power off (stop) a virtual machine. The virtual machine can be restarted with
the same provisioned resources. You are still charged for this virtual machine.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:param skip_shutdown: The parameter to request non-graceful VM shutdown. True value for this
flag indicates non-graceful shutdown whereas false indicates otherwise. Default value for this
flag is false if not specified. Default value is False.
:type skip_shutdown: bool
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either None or the result of cls(response)
:rtype: ~azure.core.polling.LROPoller[None]
:raises ~azure.core.exceptions.HttpResponseError:
"""
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
polling = kwargs.pop("polling", True) # type: Union[bool, PollingMethod]
lro_delay = kwargs.pop("polling_interval", self._config.polling_interval)
cont_token = kwargs.pop("continuation_token", None) # type: Optional[str]
if cont_token is None:
raw_result = self._power_off_initial( # type: ignore
resource_group_name=resource_group_name,
vm_name=vm_name,
skip_shutdown=skip_shutdown,
api_version=api_version,
cls=lambda x, y, z: x,
headers=_headers,
params=_params,
**kwargs
)
kwargs.pop("error_map", None)
def get_long_running_output(pipeline_response): # pylint: disable=inconsistent-return-statements
if cls:
return cls(pipeline_response, None, {})
if polling is True:
polling_method = cast(PollingMethod, ARMPolling(lro_delay, **kwargs)) # type: PollingMethod
elif polling is False:
polling_method = cast(PollingMethod, NoPolling())
else:
polling_method = polling
if cont_token:
return LROPoller.from_continuation_token(
polling_method=polling_method,
continuation_token=cont_token,
client=self._client,
deserialization_callback=get_long_running_output,
)
return LROPoller(self._client, raw_result, get_long_running_output, polling_method)
begin_power_off.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/powerOff"} # type: ignore
def _reapply_initial( # pylint: disable=inconsistent-return-statements
self, resource_group_name: str, vm_name: str, **kwargs: Any
) -> None:
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
request = build_reapply_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
api_version=api_version,
template_url=self._reapply_initial.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200, 202]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
if cls:
return cls(pipeline_response, None, {})
_reapply_initial.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/reapply"} # type: ignore
@distributed_trace
def begin_reapply(self, resource_group_name: str, vm_name: str, **kwargs: Any) -> LROPoller[None]:
"""The operation to reapply a virtual machine's state.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either None or the result of cls(response)
:rtype: ~azure.core.polling.LROPoller[None]
:raises ~azure.core.exceptions.HttpResponseError:
"""
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
polling = kwargs.pop("polling", True) # type: Union[bool, PollingMethod]
lro_delay = kwargs.pop("polling_interval", self._config.polling_interval)
cont_token = kwargs.pop("continuation_token", None) # type: Optional[str]
if cont_token is None:
raw_result = self._reapply_initial( # type: ignore
resource_group_name=resource_group_name,
vm_name=vm_name,
api_version=api_version,
cls=lambda x, y, z: x,
headers=_headers,
params=_params,
**kwargs
)
kwargs.pop("error_map", None)
def get_long_running_output(pipeline_response): # pylint: disable=inconsistent-return-statements
if cls:
return cls(pipeline_response, None, {})
if polling is True:
polling_method = cast(PollingMethod, ARMPolling(lro_delay, **kwargs)) # type: PollingMethod
elif polling is False:
polling_method = cast(PollingMethod, NoPolling())
else:
polling_method = polling
if cont_token:
return LROPoller.from_continuation_token(
polling_method=polling_method,
continuation_token=cont_token,
client=self._client,
deserialization_callback=get_long_running_output,
)
return LROPoller(self._client, raw_result, get_long_running_output, polling_method)
begin_reapply.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/reapply"} # type: ignore
def _restart_initial( # pylint: disable=inconsistent-return-statements
self, resource_group_name: str, vm_name: str, **kwargs: Any
) -> None:
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
request = build_restart_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
api_version=api_version,
template_url=self._restart_initial.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200, 202]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
if cls:
return cls(pipeline_response, None, {})
_restart_initial.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/restart"} # type: ignore
@distributed_trace
def begin_restart(self, resource_group_name: str, vm_name: str, **kwargs: Any) -> LROPoller[None]:
"""The operation to restart a virtual machine.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either None or the result of cls(response)
:rtype: ~azure.core.polling.LROPoller[None]
:raises ~azure.core.exceptions.HttpResponseError:
"""
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
polling = kwargs.pop("polling", True) # type: Union[bool, PollingMethod]
lro_delay = kwargs.pop("polling_interval", self._config.polling_interval)
cont_token = kwargs.pop("continuation_token", None) # type: Optional[str]
if cont_token is None:
raw_result = self._restart_initial( # type: ignore
resource_group_name=resource_group_name,
vm_name=vm_name,
api_version=api_version,
cls=lambda x, y, z: x,
headers=_headers,
params=_params,
**kwargs
)
kwargs.pop("error_map", None)
def get_long_running_output(pipeline_response): # pylint: disable=inconsistent-return-statements
if cls:
return cls(pipeline_response, None, {})
if polling is True:
polling_method = cast(PollingMethod, ARMPolling(lro_delay, **kwargs)) # type: PollingMethod
elif polling is False:
polling_method = cast(PollingMethod, NoPolling())
else:
polling_method = polling
if cont_token:
return LROPoller.from_continuation_token(
polling_method=polling_method,
continuation_token=cont_token,
client=self._client,
deserialization_callback=get_long_running_output,
)
return LROPoller(self._client, raw_result, get_long_running_output, polling_method)
begin_restart.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/restart"} # type: ignore
def _start_initial( # pylint: disable=inconsistent-return-statements
self, resource_group_name: str, vm_name: str, **kwargs: Any
) -> None:
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
request = build_start_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
api_version=api_version,
template_url=self._start_initial.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200, 202]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
if cls:
return cls(pipeline_response, None, {})
_start_initial.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/start"} # type: ignore
@distributed_trace
def begin_start(self, resource_group_name: str, vm_name: str, **kwargs: Any) -> LROPoller[None]:
"""The operation to start a virtual machine.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either None or the result of cls(response)
:rtype: ~azure.core.polling.LROPoller[None]
:raises ~azure.core.exceptions.HttpResponseError:
"""
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
polling = kwargs.pop("polling", True) # type: Union[bool, PollingMethod]
lro_delay = kwargs.pop("polling_interval", self._config.polling_interval)
cont_token = kwargs.pop("continuation_token", None) # type: Optional[str]
if cont_token is None:
raw_result = self._start_initial( # type: ignore
resource_group_name=resource_group_name,
vm_name=vm_name,
api_version=api_version,
cls=lambda x, y, z: x,
headers=_headers,
params=_params,
**kwargs
)
kwargs.pop("error_map", None)
def get_long_running_output(pipeline_response): # pylint: disable=inconsistent-return-statements
if cls:
return cls(pipeline_response, None, {})
if polling is True:
polling_method = cast(PollingMethod, ARMPolling(lro_delay, **kwargs)) # type: PollingMethod
elif polling is False:
polling_method = cast(PollingMethod, NoPolling())
else:
polling_method = polling
if cont_token:
return LROPoller.from_continuation_token(
polling_method=polling_method,
continuation_token=cont_token,
client=self._client,
deserialization_callback=get_long_running_output,
)
return LROPoller(self._client, raw_result, get_long_running_output, polling_method)
begin_start.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/start"} # type: ignore
def _redeploy_initial( # pylint: disable=inconsistent-return-statements
self, resource_group_name: str, vm_name: str, **kwargs: Any
) -> None:
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
request = build_redeploy_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
api_version=api_version,
template_url=self._redeploy_initial.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200, 202]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
if cls:
return cls(pipeline_response, None, {})
_redeploy_initial.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/redeploy"} # type: ignore
@distributed_trace
def begin_redeploy(self, resource_group_name: str, vm_name: str, **kwargs: Any) -> LROPoller[None]:
"""Shuts down the virtual machine, moves it to a new node, and powers it back on.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either None or the result of cls(response)
:rtype: ~azure.core.polling.LROPoller[None]
:raises ~azure.core.exceptions.HttpResponseError:
"""
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
polling = kwargs.pop("polling", True) # type: Union[bool, PollingMethod]
lro_delay = kwargs.pop("polling_interval", self._config.polling_interval)
cont_token = kwargs.pop("continuation_token", None) # type: Optional[str]
if cont_token is None:
raw_result = self._redeploy_initial( # type: ignore
resource_group_name=resource_group_name,
vm_name=vm_name,
api_version=api_version,
cls=lambda x, y, z: x,
headers=_headers,
params=_params,
**kwargs
)
kwargs.pop("error_map", None)
def get_long_running_output(pipeline_response): # pylint: disable=inconsistent-return-statements
if cls:
return cls(pipeline_response, None, {})
if polling is True:
polling_method = cast(PollingMethod, ARMPolling(lro_delay, **kwargs)) # type: PollingMethod
elif polling is False:
polling_method = cast(PollingMethod, NoPolling())
else:
polling_method = polling
if cont_token:
return LROPoller.from_continuation_token(
polling_method=polling_method,
continuation_token=cont_token,
client=self._client,
deserialization_callback=get_long_running_output,
)
return LROPoller(self._client, raw_result, get_long_running_output, polling_method)
begin_redeploy.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/redeploy"} # type: ignore
def _reimage_initial( # pylint: disable=inconsistent-return-statements
self,
resource_group_name: str,
vm_name: str,
parameters: Optional[Union[_models.VirtualMachineReimageParameters, IO]] = None,
**kwargs: Any
) -> None:
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
content_type = kwargs.pop("content_type", _headers.pop("Content-Type", None)) # type: Optional[str]
cls = kwargs.pop("cls", None) # type: ClsType[None]
content_type = content_type or "application/json"
_json = None
_content = None
if isinstance(parameters, (IO, bytes)):
_content = parameters
else:
if parameters is not None:
_json = self._serialize.body(parameters, "VirtualMachineReimageParameters")
else:
_json = None
request = build_reimage_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
api_version=api_version,
content_type=content_type,
json=_json,
content=_content,
template_url=self._reimage_initial.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200, 202]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
if cls:
return cls(pipeline_response, None, {})
_reimage_initial.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/reimage"} # type: ignore
@overload
def begin_reimage(
self,
resource_group_name: str,
vm_name: str,
parameters: Optional[_models.VirtualMachineReimageParameters] = None,
*,
content_type: str = "application/json",
**kwargs: Any
) -> LROPoller[None]:
"""Reimages the virtual machine which has an ephemeral OS disk back to its initial state.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:param parameters: Parameters supplied to the Reimage Virtual Machine operation. Default value
is None.
:type parameters: ~azure.mgmt.compute.v2019_12_01.models.VirtualMachineReimageParameters
:keyword content_type: Body Parameter content-type. Content type parameter for JSON body.
Default value is "application/json".
:paramtype content_type: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either None or the result of cls(response)
:rtype: ~azure.core.polling.LROPoller[None]
:raises ~azure.core.exceptions.HttpResponseError:
"""
@overload
def begin_reimage(
self,
resource_group_name: str,
vm_name: str,
parameters: Optional[IO] = None,
*,
content_type: str = "application/json",
**kwargs: Any
) -> LROPoller[None]:
"""Reimages the virtual machine which has an ephemeral OS disk back to its initial state.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:param parameters: Parameters supplied to the Reimage Virtual Machine operation. Default value
is None.
:type parameters: IO
:keyword content_type: Body Parameter content-type. Content type parameter for binary body.
Default value is "application/json".
:paramtype content_type: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either None or the result of cls(response)
:rtype: ~azure.core.polling.LROPoller[None]
:raises ~azure.core.exceptions.HttpResponseError:
"""
@distributed_trace
def begin_reimage(
self,
resource_group_name: str,
vm_name: str,
parameters: Optional[Union[_models.VirtualMachineReimageParameters, IO]] = None,
**kwargs: Any
) -> LROPoller[None]:
"""Reimages the virtual machine which has an ephemeral OS disk back to its initial state.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:param parameters: Parameters supplied to the Reimage Virtual Machine operation. Is either a
model type or a IO type. Default value is None.
:type parameters: ~azure.mgmt.compute.v2019_12_01.models.VirtualMachineReimageParameters or IO
:keyword content_type: Body Parameter content-type. Known values are: 'application/json'.
Default value is None.
:paramtype content_type: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either None or the result of cls(response)
:rtype: ~azure.core.polling.LROPoller[None]
:raises ~azure.core.exceptions.HttpResponseError:
"""
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
content_type = kwargs.pop("content_type", _headers.pop("Content-Type", None)) # type: Optional[str]
cls = kwargs.pop("cls", None) # type: ClsType[None]
polling = kwargs.pop("polling", True) # type: Union[bool, PollingMethod]
lro_delay = kwargs.pop("polling_interval", self._config.polling_interval)
cont_token = kwargs.pop("continuation_token", None) # type: Optional[str]
if cont_token is None:
raw_result = self._reimage_initial( # type: ignore
resource_group_name=resource_group_name,
vm_name=vm_name,
parameters=parameters,
api_version=api_version,
content_type=content_type,
cls=lambda x, y, z: x,
headers=_headers,
params=_params,
**kwargs
)
kwargs.pop("error_map", None)
def get_long_running_output(pipeline_response): # pylint: disable=inconsistent-return-statements
if cls:
return cls(pipeline_response, None, {})
if polling is True:
polling_method = cast(PollingMethod, ARMPolling(lro_delay, **kwargs)) # type: PollingMethod
elif polling is False:
polling_method = cast(PollingMethod, NoPolling())
else:
polling_method = polling
if cont_token:
return LROPoller.from_continuation_token(
polling_method=polling_method,
continuation_token=cont_token,
client=self._client,
deserialization_callback=get_long_running_output,
)
return LROPoller(self._client, raw_result, get_long_running_output, polling_method)
begin_reimage.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/reimage"} # type: ignore
def _perform_maintenance_initial( # pylint: disable=inconsistent-return-statements
self, resource_group_name: str, vm_name: str, **kwargs: Any
) -> None:
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
request = build_perform_maintenance_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
api_version=api_version,
template_url=self._perform_maintenance_initial.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200, 202]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
if cls:
return cls(pipeline_response, None, {})
_perform_maintenance_initial.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/performMaintenance"} # type: ignore
@distributed_trace
def begin_perform_maintenance(self, resource_group_name: str, vm_name: str, **kwargs: Any) -> LROPoller[None]:
"""Shuts down the virtual machine, moves it to an already updated node, and powers it back on
during the self-service phase of planned maintenance.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either None or the result of cls(response)
:rtype: ~azure.core.polling.LROPoller[None]
:raises ~azure.core.exceptions.HttpResponseError:
"""
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
polling = kwargs.pop("polling", True) # type: Union[bool, PollingMethod]
lro_delay = kwargs.pop("polling_interval", self._config.polling_interval)
cont_token = kwargs.pop("continuation_token", None) # type: Optional[str]
if cont_token is None:
raw_result = self._perform_maintenance_initial( # type: ignore
resource_group_name=resource_group_name,
vm_name=vm_name,
api_version=api_version,
cls=lambda x, y, z: x,
headers=_headers,
params=_params,
**kwargs
)
kwargs.pop("error_map", None)
def get_long_running_output(pipeline_response): # pylint: disable=inconsistent-return-statements
if cls:
return cls(pipeline_response, None, {})
if polling is True:
polling_method = cast(PollingMethod, ARMPolling(lro_delay, **kwargs)) # type: PollingMethod
elif polling is False:
polling_method = cast(PollingMethod, NoPolling())
else:
polling_method = polling
if cont_token:
return LROPoller.from_continuation_token(
polling_method=polling_method,
continuation_token=cont_token,
client=self._client,
deserialization_callback=get_long_running_output,
)
return LROPoller(self._client, raw_result, get_long_running_output, polling_method)
begin_perform_maintenance.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/performMaintenance"} # type: ignore
@distributed_trace
def simulate_eviction( # pylint: disable=inconsistent-return-statements
self, resource_group_name: str, vm_name: str, **kwargs: Any
) -> None:
"""The operation to simulate the eviction of spot virtual machine. The eviction will occur within
30 minutes of calling the API.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:keyword callable cls: A custom type or function that will be passed the direct response
:return: None or the result of cls(response)
:rtype: None
:raises ~azure.core.exceptions.HttpResponseError:
"""
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
_headers = kwargs.pop("headers", {}) or {}
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
cls = kwargs.pop("cls", None) # type: ClsType[None]
request = build_simulate_eviction_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
api_version=api_version,
template_url=self.simulate_eviction.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [204]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
if cls:
return cls(pipeline_response, None, {})
simulate_eviction.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/simulateEviction"} # type: ignore
def _run_command_initial(
self, resource_group_name: str, vm_name: str, parameters: Union[_models.RunCommandInput, IO], **kwargs: Any
) -> Optional[_models.RunCommandResult]:
error_map = {
401: ClientAuthenticationError,
404: ResourceNotFoundError,
409: ResourceExistsError,
304: ResourceNotModifiedError,
}
error_map.update(kwargs.pop("error_map", {}) or {})
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
content_type = kwargs.pop("content_type", _headers.pop("Content-Type", None)) # type: Optional[str]
cls = kwargs.pop("cls", None) # type: ClsType[Optional[_models.RunCommandResult]]
content_type = content_type or "application/json"
_json = None
_content = None
if isinstance(parameters, (IO, bytes)):
_content = parameters
else:
_json = self._serialize.body(parameters, "RunCommandInput")
request = build_run_command_request(
resource_group_name=resource_group_name,
vm_name=vm_name,
subscription_id=self._config.subscription_id,
api_version=api_version,
content_type=content_type,
json=_json,
content=_content,
template_url=self._run_command_initial.metadata["url"],
headers=_headers,
params=_params,
)
request = _convert_request(request)
request.url = self._client.format_url(request.url) # type: ignore
pipeline_response = self._client._pipeline.run( # type: ignore # pylint: disable=protected-access
request, stream=False, **kwargs
)
response = pipeline_response.http_response
if response.status_code not in [200, 202]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
deserialized = None
if response.status_code == 200:
deserialized = self._deserialize("RunCommandResult", pipeline_response)
if cls:
return cls(pipeline_response, deserialized, {})
return deserialized
_run_command_initial.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/runCommand"} # type: ignore
@overload
def begin_run_command(
self,
resource_group_name: str,
vm_name: str,
parameters: _models.RunCommandInput,
*,
content_type: str = "application/json",
**kwargs: Any
) -> LROPoller[_models.RunCommandResult]:
"""Run command on the VM.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:param parameters: Parameters supplied to the Run command operation. Required.
:type parameters: ~azure.mgmt.compute.v2019_12_01.models.RunCommandInput
:keyword content_type: Body Parameter content-type. Content type parameter for JSON body.
Default value is "application/json".
:paramtype content_type: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either RunCommandResult or the result of
cls(response)
:rtype: ~azure.core.polling.LROPoller[~azure.mgmt.compute.v2019_12_01.models.RunCommandResult]
:raises ~azure.core.exceptions.HttpResponseError:
"""
@overload
def begin_run_command(
self,
resource_group_name: str,
vm_name: str,
parameters: IO,
*,
content_type: str = "application/json",
**kwargs: Any
) -> LROPoller[_models.RunCommandResult]:
"""Run command on the VM.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:param parameters: Parameters supplied to the Run command operation. Required.
:type parameters: IO
:keyword content_type: Body Parameter content-type. Content type parameter for binary body.
Known values are: 'application/json', 'text/json'. Default value is "application/json".
:paramtype content_type: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either RunCommandResult or the result of
cls(response)
:rtype: ~azure.core.polling.LROPoller[~azure.mgmt.compute.v2019_12_01.models.RunCommandResult]
:raises ~azure.core.exceptions.HttpResponseError:
"""
@distributed_trace
def begin_run_command(
self, resource_group_name: str, vm_name: str, parameters: Union[_models.RunCommandInput, IO], **kwargs: Any
) -> LROPoller[_models.RunCommandResult]:
"""Run command on the VM.
:param resource_group_name: The name of the resource group. Required.
:type resource_group_name: str
:param vm_name: The name of the virtual machine. Required.
:type vm_name: str
:param parameters: Parameters supplied to the Run command operation. Is either a model type or
a IO type. Required.
:type parameters: ~azure.mgmt.compute.v2019_12_01.models.RunCommandInput or IO
:keyword content_type: Body Parameter content-type. Known values are: 'application/json',
'text/json'. Default value is None.
:paramtype content_type: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: By default, your polling method will be ARMPolling. Pass in False for this
operation to not poll, or pass in your own initialized polling object for a personal polling
strategy.
:paramtype polling: bool or ~azure.core.polling.PollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no
Retry-After header is present.
:return: An instance of LROPoller that returns either RunCommandResult or the result of
cls(response)
:rtype: ~azure.core.polling.LROPoller[~azure.mgmt.compute.v2019_12_01.models.RunCommandResult]
:raises ~azure.core.exceptions.HttpResponseError:
"""
_headers = case_insensitive_dict(kwargs.pop("headers", {}) or {})
_params = case_insensitive_dict(kwargs.pop("params", {}) or {})
api_version = kwargs.pop("api_version", _params.pop("api-version", "2019-12-01")) # type: str
content_type = kwargs.pop("content_type", _headers.pop("Content-Type", None)) # type: Optional[str]
cls = kwargs.pop("cls", None) # type: ClsType[_models.RunCommandResult]
polling = kwargs.pop("polling", True) # type: Union[bool, PollingMethod]
lro_delay = kwargs.pop("polling_interval", self._config.polling_interval)
cont_token = kwargs.pop("continuation_token", None) # type: Optional[str]
if cont_token is None:
raw_result = self._run_command_initial( # type: ignore
resource_group_name=resource_group_name,
vm_name=vm_name,
parameters=parameters,
api_version=api_version,
content_type=content_type,
cls=lambda x, y, z: x,
headers=_headers,
params=_params,
**kwargs
)
kwargs.pop("error_map", None)
def get_long_running_output(pipeline_response):
deserialized = self._deserialize("RunCommandResult", pipeline_response)
if cls:
return cls(pipeline_response, deserialized, {})
return deserialized
if polling is True:
polling_method = cast(
PollingMethod, ARMPolling(lro_delay, lro_options={"final-state-via": "location"}, **kwargs)
) # type: PollingMethod
elif polling is False:
polling_method = cast(PollingMethod, NoPolling())
else:
polling_method = polling
if cont_token:
return LROPoller.from_continuation_token(
polling_method=polling_method,
continuation_token=cont_token,
client=self._client,
deserialization_callback=get_long_running_output,
)
return LROPoller(self._client, raw_result, get_long_running_output, polling_method)
begin_run_command.metadata = {"url": "/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Compute/virtualMachines/{vmName}/runCommand"} # type: ignore
| [
"[email protected]"
] | |
6f3462b065e1eb0c051d3a4dd2aa4e0fdd81ec81 | 1a166165ab8287d01cbb377a13efdb5eff5dfef0 | /sdk/network/azure-mgmt-network/azure/mgmt/network/v2019_09_01/aio/operations/_azure_firewalls_operations.py | ce7bf9e6e32d162196e02b3f33bf07cfe339d996 | [
"MIT",
"LicenseRef-scancode-generic-cla",
"LGPL-2.1-or-later"
] | permissive | manoj0806/azure-sdk-for-python | 7a14b202ff80f528abd068bf50334e91001a9686 | aab999792db1132232b2f297c76800590a901142 | refs/heads/master | 2023-04-19T16:11:31.984930 | 2021-04-29T23:19:49 | 2021-04-29T23:19:49 | 363,025,016 | 1 | 0 | MIT | 2021-04-30T04:23:35 | 2021-04-30T04:23:35 | null | UTF-8 | Python | false | false | 29,781 | py | # coding=utf-8
# --------------------------------------------------------------------------
# Copyright (c) Microsoft Corporation. All rights reserved.
# Licensed under the MIT License. See License.txt in the project root for license information.
# Code generated by Microsoft (R) AutoRest Code Generator.
# Changes may cause incorrect behavior and will be lost if the code is regenerated.
# --------------------------------------------------------------------------
from typing import Any, AsyncIterable, Callable, Dict, Generic, Optional, TypeVar, Union
import warnings
from azure.core.async_paging import AsyncItemPaged, AsyncList
from azure.core.exceptions import ClientAuthenticationError, HttpResponseError, ResourceExistsError, ResourceNotFoundError, map_error
from azure.core.pipeline import PipelineResponse
from azure.core.pipeline.transport import AsyncHttpResponse, HttpRequest
from azure.core.polling import AsyncLROPoller, AsyncNoPolling, AsyncPollingMethod
from azure.mgmt.core.exceptions import ARMErrorFormat
from azure.mgmt.core.polling.async_arm_polling import AsyncARMPolling
from ... import models as _models
T = TypeVar('T')
ClsType = Optional[Callable[[PipelineResponse[HttpRequest, AsyncHttpResponse], T, Dict[str, Any]], Any]]
class AzureFirewallsOperations:
"""AzureFirewallsOperations async operations.
You should not instantiate this class directly. Instead, you should create a Client instance that
instantiates it for you and attaches it as an attribute.
:ivar models: Alias to model classes used in this operation group.
:type models: ~azure.mgmt.network.v2019_09_01.models
:param client: Client for service requests.
:param config: Configuration of service client.
:param serializer: An object model serializer.
:param deserializer: An object model deserializer.
"""
models = _models
def __init__(self, client, config, serializer, deserializer) -> None:
self._client = client
self._serialize = serializer
self._deserialize = deserializer
self._config = config
async def _delete_initial(
self,
resource_group_name: str,
azure_firewall_name: str,
**kwargs
) -> None:
cls = kwargs.pop('cls', None) # type: ClsType[None]
error_map = {
401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError
}
error_map.update(kwargs.pop('error_map', {}))
api_version = "2019-09-01"
accept = "application/json"
# Construct URL
url = self._delete_initial.metadata['url'] # type: ignore
path_format_arguments = {
'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'),
'azureFirewallName': self._serialize.url("azure_firewall_name", azure_firewall_name, 'str'),
'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'),
}
url = self._client.format_url(url, **path_format_arguments)
# Construct parameters
query_parameters = {} # type: Dict[str, Any]
query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str')
# Construct headers
header_parameters = {} # type: Dict[str, Any]
header_parameters['Accept'] = self._serialize.header("accept", accept, 'str')
request = self._client.delete(url, query_parameters, header_parameters)
pipeline_response = await self._client._pipeline.run(request, stream=False, **kwargs)
response = pipeline_response.http_response
if response.status_code not in [200, 202, 204]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
if cls:
return cls(pipeline_response, None, {})
_delete_initial.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/azureFirewalls/{azureFirewallName}'} # type: ignore
async def begin_delete(
self,
resource_group_name: str,
azure_firewall_name: str,
**kwargs
) -> AsyncLROPoller[None]:
"""Deletes the specified Azure Firewall.
:param resource_group_name: The name of the resource group.
:type resource_group_name: str
:param azure_firewall_name: The name of the Azure Firewall.
:type azure_firewall_name: str
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: True for ARMPolling, False for no polling, or a
polling object for personal polling strategy
:paramtype polling: bool or ~azure.core.polling.AsyncPollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no Retry-After header is present.
:return: An instance of AsyncLROPoller that returns either None or the result of cls(response)
:rtype: ~azure.core.polling.AsyncLROPoller[None]
:raises ~azure.core.exceptions.HttpResponseError:
"""
polling = kwargs.pop('polling', True) # type: Union[bool, AsyncPollingMethod]
cls = kwargs.pop('cls', None) # type: ClsType[None]
lro_delay = kwargs.pop(
'polling_interval',
self._config.polling_interval
)
cont_token = kwargs.pop('continuation_token', None) # type: Optional[str]
if cont_token is None:
raw_result = await self._delete_initial(
resource_group_name=resource_group_name,
azure_firewall_name=azure_firewall_name,
cls=lambda x,y,z: x,
**kwargs
)
kwargs.pop('error_map', None)
kwargs.pop('content_type', None)
def get_long_running_output(pipeline_response):
if cls:
return cls(pipeline_response, None, {})
path_format_arguments = {
'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'),
'azureFirewallName': self._serialize.url("azure_firewall_name", azure_firewall_name, 'str'),
'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'),
}
if polling is True: polling_method = AsyncARMPolling(lro_delay, lro_options={'final-state-via': 'location'}, path_format_arguments=path_format_arguments, **kwargs)
elif polling is False: polling_method = AsyncNoPolling()
else: polling_method = polling
if cont_token:
return AsyncLROPoller.from_continuation_token(
polling_method=polling_method,
continuation_token=cont_token,
client=self._client,
deserialization_callback=get_long_running_output
)
else:
return AsyncLROPoller(self._client, raw_result, get_long_running_output, polling_method)
begin_delete.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/azureFirewalls/{azureFirewallName}'} # type: ignore
async def get(
self,
resource_group_name: str,
azure_firewall_name: str,
**kwargs
) -> "_models.AzureFirewall":
"""Gets the specified Azure Firewall.
:param resource_group_name: The name of the resource group.
:type resource_group_name: str
:param azure_firewall_name: The name of the Azure Firewall.
:type azure_firewall_name: str
:keyword callable cls: A custom type or function that will be passed the direct response
:return: AzureFirewall, or the result of cls(response)
:rtype: ~azure.mgmt.network.v2019_09_01.models.AzureFirewall
:raises: ~azure.core.exceptions.HttpResponseError
"""
cls = kwargs.pop('cls', None) # type: ClsType["_models.AzureFirewall"]
error_map = {
401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError
}
error_map.update(kwargs.pop('error_map', {}))
api_version = "2019-09-01"
accept = "application/json"
# Construct URL
url = self.get.metadata['url'] # type: ignore
path_format_arguments = {
'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'),
'azureFirewallName': self._serialize.url("azure_firewall_name", azure_firewall_name, 'str'),
'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'),
}
url = self._client.format_url(url, **path_format_arguments)
# Construct parameters
query_parameters = {} # type: Dict[str, Any]
query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str')
# Construct headers
header_parameters = {} # type: Dict[str, Any]
header_parameters['Accept'] = self._serialize.header("accept", accept, 'str')
request = self._client.get(url, query_parameters, header_parameters)
pipeline_response = await self._client._pipeline.run(request, stream=False, **kwargs)
response = pipeline_response.http_response
if response.status_code not in [200]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
deserialized = self._deserialize('AzureFirewall', pipeline_response)
if cls:
return cls(pipeline_response, deserialized, {})
return deserialized
get.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/azureFirewalls/{azureFirewallName}'} # type: ignore
async def _create_or_update_initial(
self,
resource_group_name: str,
azure_firewall_name: str,
parameters: "_models.AzureFirewall",
**kwargs
) -> "_models.AzureFirewall":
cls = kwargs.pop('cls', None) # type: ClsType["_models.AzureFirewall"]
error_map = {
401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError
}
error_map.update(kwargs.pop('error_map', {}))
api_version = "2019-09-01"
content_type = kwargs.pop("content_type", "application/json")
accept = "application/json"
# Construct URL
url = self._create_or_update_initial.metadata['url'] # type: ignore
path_format_arguments = {
'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'),
'azureFirewallName': self._serialize.url("azure_firewall_name", azure_firewall_name, 'str'),
'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'),
}
url = self._client.format_url(url, **path_format_arguments)
# Construct parameters
query_parameters = {} # type: Dict[str, Any]
query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str')
# Construct headers
header_parameters = {} # type: Dict[str, Any]
header_parameters['Content-Type'] = self._serialize.header("content_type", content_type, 'str')
header_parameters['Accept'] = self._serialize.header("accept", accept, 'str')
body_content_kwargs = {} # type: Dict[str, Any]
body_content = self._serialize.body(parameters, 'AzureFirewall')
body_content_kwargs['content'] = body_content
request = self._client.put(url, query_parameters, header_parameters, **body_content_kwargs)
pipeline_response = await self._client._pipeline.run(request, stream=False, **kwargs)
response = pipeline_response.http_response
if response.status_code not in [200, 201]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
if response.status_code == 200:
deserialized = self._deserialize('AzureFirewall', pipeline_response)
if response.status_code == 201:
deserialized = self._deserialize('AzureFirewall', pipeline_response)
if cls:
return cls(pipeline_response, deserialized, {})
return deserialized
_create_or_update_initial.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/azureFirewalls/{azureFirewallName}'} # type: ignore
async def begin_create_or_update(
self,
resource_group_name: str,
azure_firewall_name: str,
parameters: "_models.AzureFirewall",
**kwargs
) -> AsyncLROPoller["_models.AzureFirewall"]:
"""Creates or updates the specified Azure Firewall.
:param resource_group_name: The name of the resource group.
:type resource_group_name: str
:param azure_firewall_name: The name of the Azure Firewall.
:type azure_firewall_name: str
:param parameters: Parameters supplied to the create or update Azure Firewall operation.
:type parameters: ~azure.mgmt.network.v2019_09_01.models.AzureFirewall
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: True for ARMPolling, False for no polling, or a
polling object for personal polling strategy
:paramtype polling: bool or ~azure.core.polling.AsyncPollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no Retry-After header is present.
:return: An instance of AsyncLROPoller that returns either AzureFirewall or the result of cls(response)
:rtype: ~azure.core.polling.AsyncLROPoller[~azure.mgmt.network.v2019_09_01.models.AzureFirewall]
:raises ~azure.core.exceptions.HttpResponseError:
"""
polling = kwargs.pop('polling', True) # type: Union[bool, AsyncPollingMethod]
cls = kwargs.pop('cls', None) # type: ClsType["_models.AzureFirewall"]
lro_delay = kwargs.pop(
'polling_interval',
self._config.polling_interval
)
cont_token = kwargs.pop('continuation_token', None) # type: Optional[str]
if cont_token is None:
raw_result = await self._create_or_update_initial(
resource_group_name=resource_group_name,
azure_firewall_name=azure_firewall_name,
parameters=parameters,
cls=lambda x,y,z: x,
**kwargs
)
kwargs.pop('error_map', None)
kwargs.pop('content_type', None)
def get_long_running_output(pipeline_response):
deserialized = self._deserialize('AzureFirewall', pipeline_response)
if cls:
return cls(pipeline_response, deserialized, {})
return deserialized
path_format_arguments = {
'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'),
'azureFirewallName': self._serialize.url("azure_firewall_name", azure_firewall_name, 'str'),
'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'),
}
if polling is True: polling_method = AsyncARMPolling(lro_delay, lro_options={'final-state-via': 'azure-async-operation'}, path_format_arguments=path_format_arguments, **kwargs)
elif polling is False: polling_method = AsyncNoPolling()
else: polling_method = polling
if cont_token:
return AsyncLROPoller.from_continuation_token(
polling_method=polling_method,
continuation_token=cont_token,
client=self._client,
deserialization_callback=get_long_running_output
)
else:
return AsyncLROPoller(self._client, raw_result, get_long_running_output, polling_method)
begin_create_or_update.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/azureFirewalls/{azureFirewallName}'} # type: ignore
async def _update_tags_initial(
self,
resource_group_name: str,
azure_firewall_name: str,
parameters: "_models.TagsObject",
**kwargs
) -> Optional["_models.AzureFirewall"]:
cls = kwargs.pop('cls', None) # type: ClsType[Optional["_models.AzureFirewall"]]
error_map = {
401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError
}
error_map.update(kwargs.pop('error_map', {}))
api_version = "2019-09-01"
content_type = kwargs.pop("content_type", "application/json")
accept = "application/json"
# Construct URL
url = self._update_tags_initial.metadata['url'] # type: ignore
path_format_arguments = {
'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'),
'azureFirewallName': self._serialize.url("azure_firewall_name", azure_firewall_name, 'str'),
'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'),
}
url = self._client.format_url(url, **path_format_arguments)
# Construct parameters
query_parameters = {} # type: Dict[str, Any]
query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str')
# Construct headers
header_parameters = {} # type: Dict[str, Any]
header_parameters['Content-Type'] = self._serialize.header("content_type", content_type, 'str')
header_parameters['Accept'] = self._serialize.header("accept", accept, 'str')
body_content_kwargs = {} # type: Dict[str, Any]
body_content = self._serialize.body(parameters, 'TagsObject')
body_content_kwargs['content'] = body_content
request = self._client.patch(url, query_parameters, header_parameters, **body_content_kwargs)
pipeline_response = await self._client._pipeline.run(request, stream=False, **kwargs)
response = pipeline_response.http_response
if response.status_code not in [200, 202]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
deserialized = None
if response.status_code == 200:
deserialized = self._deserialize('AzureFirewall', pipeline_response)
if cls:
return cls(pipeline_response, deserialized, {})
return deserialized
_update_tags_initial.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/azureFirewalls/{azureFirewallName}'} # type: ignore
async def begin_update_tags(
self,
resource_group_name: str,
azure_firewall_name: str,
parameters: "_models.TagsObject",
**kwargs
) -> AsyncLROPoller["_models.AzureFirewall"]:
"""Updates tags of an Azure Firewall resource.
:param resource_group_name: The name of the resource group.
:type resource_group_name: str
:param azure_firewall_name: The name of the Azure Firewall.
:type azure_firewall_name: str
:param parameters: Parameters supplied to update azure firewall tags.
:type parameters: ~azure.mgmt.network.v2019_09_01.models.TagsObject
:keyword callable cls: A custom type or function that will be passed the direct response
:keyword str continuation_token: A continuation token to restart a poller from a saved state.
:keyword polling: True for ARMPolling, False for no polling, or a
polling object for personal polling strategy
:paramtype polling: bool or ~azure.core.polling.AsyncPollingMethod
:keyword int polling_interval: Default waiting time between two polls for LRO operations if no Retry-After header is present.
:return: An instance of AsyncLROPoller that returns either AzureFirewall or the result of cls(response)
:rtype: ~azure.core.polling.AsyncLROPoller[~azure.mgmt.network.v2019_09_01.models.AzureFirewall]
:raises ~azure.core.exceptions.HttpResponseError:
"""
polling = kwargs.pop('polling', True) # type: Union[bool, AsyncPollingMethod]
cls = kwargs.pop('cls', None) # type: ClsType["_models.AzureFirewall"]
lro_delay = kwargs.pop(
'polling_interval',
self._config.polling_interval
)
cont_token = kwargs.pop('continuation_token', None) # type: Optional[str]
if cont_token is None:
raw_result = await self._update_tags_initial(
resource_group_name=resource_group_name,
azure_firewall_name=azure_firewall_name,
parameters=parameters,
cls=lambda x,y,z: x,
**kwargs
)
kwargs.pop('error_map', None)
kwargs.pop('content_type', None)
def get_long_running_output(pipeline_response):
deserialized = self._deserialize('AzureFirewall', pipeline_response)
if cls:
return cls(pipeline_response, deserialized, {})
return deserialized
path_format_arguments = {
'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'),
'azureFirewallName': self._serialize.url("azure_firewall_name", azure_firewall_name, 'str'),
'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'),
}
if polling is True: polling_method = AsyncARMPolling(lro_delay, lro_options={'final-state-via': 'azure-async-operation'}, path_format_arguments=path_format_arguments, **kwargs)
elif polling is False: polling_method = AsyncNoPolling()
else: polling_method = polling
if cont_token:
return AsyncLROPoller.from_continuation_token(
polling_method=polling_method,
continuation_token=cont_token,
client=self._client,
deserialization_callback=get_long_running_output
)
else:
return AsyncLROPoller(self._client, raw_result, get_long_running_output, polling_method)
begin_update_tags.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/azureFirewalls/{azureFirewallName}'} # type: ignore
def list(
self,
resource_group_name: str,
**kwargs
) -> AsyncIterable["_models.AzureFirewallListResult"]:
"""Lists all Azure Firewalls in a resource group.
:param resource_group_name: The name of the resource group.
:type resource_group_name: str
:keyword callable cls: A custom type or function that will be passed the direct response
:return: An iterator like instance of either AzureFirewallListResult or the result of cls(response)
:rtype: ~azure.core.async_paging.AsyncItemPaged[~azure.mgmt.network.v2019_09_01.models.AzureFirewallListResult]
:raises: ~azure.core.exceptions.HttpResponseError
"""
cls = kwargs.pop('cls', None) # type: ClsType["_models.AzureFirewallListResult"]
error_map = {
401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError
}
error_map.update(kwargs.pop('error_map', {}))
api_version = "2019-09-01"
accept = "application/json"
def prepare_request(next_link=None):
# Construct headers
header_parameters = {} # type: Dict[str, Any]
header_parameters['Accept'] = self._serialize.header("accept", accept, 'str')
if not next_link:
# Construct URL
url = self.list.metadata['url'] # type: ignore
path_format_arguments = {
'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'),
'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'),
}
url = self._client.format_url(url, **path_format_arguments)
# Construct parameters
query_parameters = {} # type: Dict[str, Any]
query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str')
request = self._client.get(url, query_parameters, header_parameters)
else:
url = next_link
query_parameters = {} # type: Dict[str, Any]
request = self._client.get(url, query_parameters, header_parameters)
return request
async def extract_data(pipeline_response):
deserialized = self._deserialize('AzureFirewallListResult', pipeline_response)
list_of_elem = deserialized.value
if cls:
list_of_elem = cls(list_of_elem)
return deserialized.next_link or None, AsyncList(list_of_elem)
async def get_next(next_link=None):
request = prepare_request(next_link)
pipeline_response = await self._client._pipeline.run(request, stream=False, **kwargs)
response = pipeline_response.http_response
if response.status_code not in [200]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
return pipeline_response
return AsyncItemPaged(
get_next, extract_data
)
list.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/azureFirewalls'} # type: ignore
def list_all(
self,
**kwargs
) -> AsyncIterable["_models.AzureFirewallListResult"]:
"""Gets all the Azure Firewalls in a subscription.
:keyword callable cls: A custom type or function that will be passed the direct response
:return: An iterator like instance of either AzureFirewallListResult or the result of cls(response)
:rtype: ~azure.core.async_paging.AsyncItemPaged[~azure.mgmt.network.v2019_09_01.models.AzureFirewallListResult]
:raises: ~azure.core.exceptions.HttpResponseError
"""
cls = kwargs.pop('cls', None) # type: ClsType["_models.AzureFirewallListResult"]
error_map = {
401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError
}
error_map.update(kwargs.pop('error_map', {}))
api_version = "2019-09-01"
accept = "application/json"
def prepare_request(next_link=None):
# Construct headers
header_parameters = {} # type: Dict[str, Any]
header_parameters['Accept'] = self._serialize.header("accept", accept, 'str')
if not next_link:
# Construct URL
url = self.list_all.metadata['url'] # type: ignore
path_format_arguments = {
'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'),
}
url = self._client.format_url(url, **path_format_arguments)
# Construct parameters
query_parameters = {} # type: Dict[str, Any]
query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str')
request = self._client.get(url, query_parameters, header_parameters)
else:
url = next_link
query_parameters = {} # type: Dict[str, Any]
request = self._client.get(url, query_parameters, header_parameters)
return request
async def extract_data(pipeline_response):
deserialized = self._deserialize('AzureFirewallListResult', pipeline_response)
list_of_elem = deserialized.value
if cls:
list_of_elem = cls(list_of_elem)
return deserialized.next_link or None, AsyncList(list_of_elem)
async def get_next(next_link=None):
request = prepare_request(next_link)
pipeline_response = await self._client._pipeline.run(request, stream=False, **kwargs)
response = pipeline_response.http_response
if response.status_code not in [200]:
map_error(status_code=response.status_code, response=response, error_map=error_map)
raise HttpResponseError(response=response, error_format=ARMErrorFormat)
return pipeline_response
return AsyncItemPaged(
get_next, extract_data
)
list_all.metadata = {'url': '/subscriptions/{subscriptionId}/providers/Microsoft.Network/azureFirewalls'} # type: ignore
| [
"[email protected]"
] | |
1a7330518eff453cd30004ae2fb01e90bfe63fbe | 80616a1bfacc2081d983c3d8ec5b3f55295a323b | /serial_coms_list.py | 2bee4f29591ba132b7218896bc837498d8e321c6 | [] | no_license | choyai/kis-personal-space-bot | 47a681b679b7b6caf2c3b10124603e4475e3b73b | 8dbce0b6cd88a1b326a2e9e4c9b3cf5120a083ee | refs/heads/master | 2020-06-07T11:19:19.921167 | 2019-06-24T07:14:15 | 2019-06-24T07:14:15 | 193,010,563 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 8,085 | py | # from scipy.spatial import distance as dist
# from imutils import perspective
# from imutils import contours
import numpy as np
# import argparse
# import imutils
# import cv2
import serial
import time
import struct
# from InverseKinematics import *
# from Graph import astar
import pickle
from math import pi
from random import randint
countsPerMillimeter = (321 / 300 * 400) / (np.pi * 10)
countsPerMillimeter_z = (12 * 66) / (np.pi * 12)
# Connect to mcu
setPath = {
}
def autoConnect(baud, portName):
while(1):
try:
serialDevice = serial.Serial()
serialDevice.baudrate = baud
# serialDevice.parity = 'E'
serialDevice.port = portName
serialDevice.timeout = 1
serialDevice.rts = 0
serialDevice.dtr = 0
serialDevice.open()
print('connected to mcu')
return serialDevice
except:
print('connection failed')
pass
def sendCommand(command, ser):
ser.write(bytes(command))
# while(1):
# if ser.inWaiting() > 0:
# # data = ser.read(1)
# # print("data =", ord(data))
# response = ser.readline().decode('utf-8')
# print(response)
# # if response != 'received' or 'starting':
# # pass
# if response == 'resend':
# ser.write(bytes(command))
# elif response == 'done':
# return 1
# elif response == 'starting':
# break
# else:
# pass
# # return 0
# # break
# # else:
# # ser.write(bytes(command))
def setHome(ser):
buffer = [255, 255, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0]
checksum = 0
for i in buffer:
checksum += i
checksum = checksum % 256
buffer.append(checksum)
print('sending ')
print(buffer)
sendCommand(buffer, ser)
def setPosXY(x, y, ser):
buffer = [255, 255, 1]
# a = int(np.sqrt(2) / 2 * (y - x))
# b = int(np.sqrt(2) / 2 * (y + x))
print("x = " + str(x / countsPerMillimeter))
print("y = " + str(y / countsPerMillimeter))
# print("a = " + str(a))
# print("b = " + str(b))
x_sign = 0 if x >= 0 else 1
y_sign = 0 if y >= 0 else 1
buffer.append(x_sign)
buffer.extend(split_large_ints(abs(x)))
buffer.append(y_sign)
buffer.extend(split_large_ints(abs(y)))
checksum = 0
for i in buffer:
checksum += i
checksum = checksum % 256
buffer.append(checksum)
print('sending ')
print(buffer)
sendCommand(buffer, ser)
#
#
# def setPosXY_mm(x, y, ser, x_pix, y_pix, countsPerMillimeter=countsPerMillimeter):
# buffer = [255, 255, 1]
# x = x * countsPerMillimeter
# y = y * countsPerMillimeter
#
# a = int(np.sqrt(2) / 2 * (y - x))
# b = int(np.sqrt(2) / 2 * (y + x))
# print("x = " + str(x / countsPerMillimeter))
# print("y = " + str(y / countsPerMillimeter))
# print("a = " + str(a))
# print("b = " + str(b))
# a_sign = 0 if a >= 0 else 1
# b_sign = 0 if b >= 0 else 1
# buffer.extend(split_large_ints(abs(a)))
# buffer.extend(split_large_ints(abs(b)))
# buffer.extend([a_sign, b_sign])
# checksum = 0
# for i in buffer:
# checksum += i
# checksum = checksum % 256
# buffer.append(checksum)
# print('sending ')
# print(buffer)
# sendCommand(buffer, ser)
#
#
# def setPosZ(z, ser):
# buffer = [255, 255, 2]
# buffer.extend(split_large_ints(z))
# buffer.extend([0, 0, 0, 0])
# checksum = 0
# for i in buffer:
# checksum += i
# checksum = checksum % 256
# buffer.append(checksum)
# print('sending ')
# print(buffer)
# sendCommand(buffer, ser)
#
#
# def setPosZ_mm(z, ser, countsPerMillimeter_z):
# buffer = [255, 255, 2]
# z = int(z * countsPerMillimeter_z)
# buffer.extend(split_large_ints(z))
# buffer.extend([0, 0, 0, 0])
# checksum = 0
# for i in buffer:
# checksum += i
# checksum = checksum % 256
# buffer.append(checksum)
# print('sending ')
# print(buffer)
# sendCommand(buffer, ser)
#
#
# def gripClose(ser):
# buffer = [255, 255, 3, 0, 0, 0, 0, 0, 0]
# checksum = 0
# for i in buffer:
# checksum += i
# checksum = checksum % 256
# buffer.append(checksum)
# print('sending ')
# print(buffer)
# sendCommand(buffer, ser)
#
#
# def gripOpen(ser):
# buffer = [255, 255, 4, 0, 0, 0, 0, 0, 0]
# checksum = 0
# for i in buffer:
# checksum += i
# checksum = checksum % 256
# buffer.append(checksum)
# print('sending ')
# print(buffer)
# sendCommand(buffer, ser)
#
#
# def gripHalf(duty, ser):
# buffer = [255, 255, 10, ]
# buffer.extend(split_large_ints(duty))
# buffer.extend([0, 0, 0, 0])
# checksum = 0
# for i in buffer:
# checksum += i
# checksum = checksum % 256
# buffer.append(checksum)
# print('sending ')
# print(buffer)
# sendCommand(buffer, ser)
#
#
# def gripRotate(angle, ser):
# buffer = [255, 255, 5]
# buffer.extend(split_large_ints(angle))
# buffer.extend([0, 0, 0, 0])
# checksum = 0
# for i in buffer:
# checksum += i
# checksum = checksum % 256
# buffer.append(checksum)
# print('sending ')
# print(buffer)
# sendCommand(buffer, ser)
#
#
# def setAGains(K_P, K_I, K_D, ser):
# buffer = [255, 255, 6]
# buffer.extend(split_floats(K_P))
# buffer.extend(split_floats(K_I))
# buffer.extend(split_floats(K_D))
# checksum = 0
# for i in buffer:
# checksum += i
# checksum = checksum % 256
# buffer.append(checksum)
# print('sending ')
# print(buffer)
# sendCommand(buffer, ser)
#
#
# def setBGains(K_P, K_I, K_D, ser):
# buffer = [255, 255, 7]
# buffer.extend(split_floats(K_P))
# buffer.extend(split_floats(K_I))
# buffer.extend(split_floats(K_D))
# checksum = 0
# for i in buffer:
# checksum += i
# checksum = checksum % 256
# buffer.append(checksum)
# print('sending ')
# print(buffer)
# sendCommand(buffer, ser)
#
#
# def setZGains(K_P, K_I, K_D, ser):
# buffer = [255, 255, 8]
# buffer.extend(split_floats(K_P))
# buffer.extend(split_floats(K_I))
# buffer.extend(split_floats(K_D))
# checksum = 0
# for i in buffer:
# checksum += i
# checksum = checksum % 256
# buffer.append(checksum)
# print('sending ')
# print(buffer)
# sendCommand(buffer, ser)
#
#
# def setTolerances(ser):
# buffer = [255, 255, 9]
# tolerances = []
# for al in ['a', 'b', 'z']:
# while(1):
# try:
# tolerance = (int(input("set tolerance_" + al + ": ")))
# buffer.extend(split_large_ints(tolerance))
# break
# except:
# print("try again")
# checksum = 0
# for i in buffer:
# checksum += i
# checksum = checksum % 256
# buffer.append(checksum)
# print('sending ')
# print(buffer)
# sendCommand(buffer, ser)
# splits large ints into msb and lsb. Doesn't support ints larger than 16 bits
def split_large_ints(num):
# numstring = str(hex(num))
# lsB = '0x'
# msB = '0x'
# if len(numstring) < 5:
# msB = '0x00'
# else:
# if len(numstring) == 5:
# msB += numstring[2]
# else:
# msB = msB + numstring[len(numstring) - 4] + \
# numstring[len(numstring) - 3]
# if len(numstring) < 4:
# lsB += numstring[len(numstring) - 1]
# else:
# lsB = lsB + numstring[len(numstring) - 2] + \
# numstring[len(numstring) - 1]
msB = (num // 256) % 256
lsB = num % 256
return [msB, lsB]
# splits floats from their decimals and turns them into ints
def split_floats(num):
a, b = divmod(num, 1.0)
a = int(a) % 256
b = int(b * 256)
return [a, b]
| [
"[email protected]"
] | |
1de6c30ae80ba4c72a4ba8bcee65ddbea304c734 | 747142c31420254647caf85cc8532f4d13b00146 | /django-web/bare-bones-web/adoptions/adoptions/models.py | 96eccf0f66d1489ffac826247486abafdc94a5ca | [] | no_license | jankidepala/machine-learning-IOT | fdf5f9b9c767405a940b1963d5f68b219e437c51 | 125bac2a3a023779e79f89dcf4b7304e6e2601ae | refs/heads/master | 2022-11-19T05:35:50.180173 | 2020-07-25T08:15:28 | 2020-07-25T08:15:28 | 107,033,248 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 506 | py | from django.db import models
# Create your models here.
class Pet(models.Model):
name = models.CharField(max_length=101)
submitter = models.CharField(max_length=101)
species = models.CharField(max_length=30)
breed = models.CharField(max_length=30, blank=True)
name = models.CharField(max_length=101)
submission_date = models.DateTimeField()
vaccinations = models.ManyToManyField('Vaccine', blank=True)
class Vaccine(models.Model):
name = models.CharField(max_length=50)
| [
"[email protected]"
] | |
140216cf494403c143fccbc18bd45cf02c208cdb | 789a540bbb79c334cbeaf3687876bfd939e4290b | /app/handlers/private/admin/message/menu/message_distribution/distribution_options/wait_confirm_activate_schedule.py | d89fe3846c47add5b6d184ed3e7278c4db191b2a | [] | no_license | ExissBrr/TRIGON-GARANT-BOT | 2cc96f5f6f195f4e76c164db4f8acafbfa5b7662 | 812acf060eb92e6fad21568a75e6dba7ce0da4d9 | refs/heads/main | 2023-07-04T18:22:43.507453 | 2021-08-17T14:51:30 | 2021-08-17T14:51:30 | 392,725,437 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 813 | py | from aiogram.dispatcher import FSMContext
from aiogram.types import Message
from app.data import text
from app.loader import dp
from app.states.private.message_distribution import MessageSendingStates
from app.utils.bot import send_main_keyboard
from app.utils.db_api.models.messages_for_sending import MessageForSending
@dp.message_handler(state=MessageSendingStates.wait_confirm_activate_schedule)
async def delete_schedule(message: Message, lang_code, state: FSMContext, user, state_data: dict):
schedule_id = int(state_data.get('message_id'))
schedule_message = await MessageForSending.get(schedule_id)
await schedule_message.update_data(is_active=True)
await message.answer(
text=text[lang_code].admin.message.schedule_was_activated
)
await send_main_keyboard(user, state)
| [
"[email protected]"
] | |
0ce5d4785f5a66c6f189dd549293a858ec245133 | 6a3c2f5d5622ee0e8a58d871efd1cb7344fd5a13 | /extras/scripts/travis_yml_generator.py | e9077b52beeafbee052524ffdeee430a3e52297f | [
"Apache-2.0"
] | permissive | StetHD/fruit | 745e24dbb3d899f56adf3220bb0409470ec853c3 | b9806196a70e9b92ddf90cb255f2d31ea8d6bcae | refs/heads/master | 2020-03-31T01:17:50.610355 | 2018-09-16T08:06:25 | 2018-09-16T08:06:25 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 10,312 | py | #!/usr/bin/env python3
# Copyright 2016 Google Inc. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS-IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
import yaml
# "smoke tests" are run before other build matrix rows.
build_matrix_smoke_test_rows = []
build_matrix_rows = []
def determine_compiler_kind(compiler):
if compiler.startswith('gcc'):
return 'gcc'
elif compiler.startswith('clang'):
return 'clang'
else:
raise Exception('Unexpected compiler: %s' % compiler)
def determine_tests(asan, ubsan, smoke_tests, use_precompiled_headers_in_tests, exclude_tests,
include_only_tests):
tests = []
has_debug_build = False
tests += ['ReleasePlain']
if asan:
has_debug_build = True
if ubsan:
tests += ['DebugAsanUbsan']
else:
tests += ['DebugAsan']
if ubsan and not asan:
raise Exception('Enabling UBSan but not ASan is not currently supported.')
if not has_debug_build:
tests += ['DebugPlain']
for smoke_test in smoke_tests:
if smoke_test not in tests:
tests += [smoke_test]
excessive_excluded_tests = set(exclude_tests) - set(tests)
if excessive_excluded_tests:
raise Exception(
'Some tests were excluded but were not going to run anyway: %s. '
'Tests to run (ignoring the possible NoPch prefix): %s'
% (excessive_excluded_tests, tests))
if include_only_tests is not None:
if exclude_tests != []:
raise Exception('Using exclude_tests and include_only_tests together is not supported.')
tests = include_only_tests
else:
tests = [test for test in tests if test not in exclude_tests]
if not use_precompiled_headers_in_tests:
tests = [test + 'NoPch' for test in tests]
return tests
def generate_export_statements_for_env(env):
return ' '.join(['export %s=\'%s\';' % (var_name, value) for (var_name, value) in sorted(env.items())])
def generate_env_string_for_env(env):
return ' '.join(['%s=%s' % (var_name, value) for (var_name, value) in sorted(env.items())])
def add_ubuntu_tests(ubuntu_version, compiler, os='linux', stl=None, asan=True, ubsan=True,
use_precompiled_headers_in_tests=True, smoke_tests=[], exclude_tests=[], include_only_tests=None):
env = {
'UBUNTU': ubuntu_version,
'COMPILER': compiler
}
if stl is not None:
env['STL'] = stl
compiler_kind = determine_compiler_kind(compiler)
export_statements = 'export OS=' + os + '; ' + generate_export_statements_for_env(env=env)
test_environment_template = {'os': 'linux', 'compiler': compiler_kind,
'install': '%s extras/scripts/travis_ci_install_linux.sh' % export_statements}
tests = determine_tests(asan, ubsan, smoke_tests,
use_precompiled_headers_in_tests=use_precompiled_headers_in_tests,
exclude_tests=exclude_tests,
include_only_tests=include_only_tests)
for test in tests:
test_environment = test_environment_template.copy()
test_environment['script'] = '%s extras/scripts/postsubmit.sh %s' % (export_statements, test)
# The TEST variable has no effect on the test run, but allows to see the test name in the Travis CI dashboard.
test_environment['env'] = generate_env_string_for_env(env) + " TEST=%s" % test
if test in smoke_tests:
build_matrix_smoke_test_rows.append(test_environment)
else:
build_matrix_rows.append(test_environment)
def add_osx_tests(compiler, xcode_version=None, stl=None, asan=True, ubsan=True,
use_precompiled_headers_in_tests=True, smoke_tests=[], exclude_tests=[], include_only_tests=None):
env = {'COMPILER': compiler}
if stl is not None:
env['STL'] = stl
compiler_kind = determine_compiler_kind(compiler)
export_statements = 'export OS=osx; ' + generate_export_statements_for_env(env=env)
test_environment_template = {'os': 'osx', 'compiler': compiler_kind,
'install': '%s extras/scripts/travis_ci_install_osx.sh' % export_statements}
if xcode_version is not None:
test_environment_template['osx_image'] = 'xcode%s' % xcode_version
tests = determine_tests(asan, ubsan, smoke_tests,
use_precompiled_headers_in_tests=use_precompiled_headers_in_tests,
exclude_tests=exclude_tests, include_only_tests=include_only_tests)
for test in tests:
test_environment = test_environment_template.copy()
test_environment['script'] = '%s extras/scripts/postsubmit.sh %s' % (export_statements, test)
# The TEST variable has no effect on the test run, but allows to see the test name in the Travis CI dashboard.
test_environment['env'] = generate_env_string_for_env(env) + " TEST=%s" % test
if test in smoke_tests:
build_matrix_smoke_test_rows.append(test_environment)
else:
build_matrix_rows.append(test_environment)
def add_bazel_tests(ubuntu_version, smoke_tests=[]):
env = {
'UBUNTU': ubuntu_version,
'COMPILER': 'bazel',
}
test = 'DebugPlain'
export_statements = 'export OS=linux; ' + generate_export_statements_for_env(env=env)
test_environment = {'os': 'linux',
'compiler': 'gcc',
'env': generate_env_string_for_env(env),
'install': '%s extras/scripts/travis_ci_install_linux.sh' % export_statements,
'script': '%s extras/scripts/postsubmit.sh %s' % (export_statements, test)}
if test in smoke_tests:
build_matrix_smoke_test_rows.append(test_environment)
else:
build_matrix_rows.append(test_environment)
# TODO: re-enable ASan/UBSan once they work in Travis CI. ATM (as of 18 November 2017) they fail due to https://github.com/google/sanitizers/issues/837
add_ubuntu_tests(ubuntu_version='18.04', compiler='gcc-8', asan=False, ubsan=False, smoke_tests=['DebugPlain', 'ReleasePlain'])
add_ubuntu_tests(ubuntu_version='18.04', compiler='clang-4.0', stl='libstdc++')
add_ubuntu_tests(ubuntu_version='18.04', compiler='clang-5.0', stl='libstdc++')
add_ubuntu_tests(ubuntu_version='18.04', compiler='clang-6.0', stl='libstdc++', smoke_tests=['DebugPlain', 'DebugAsanUbsan', 'ReleasePlain'])
add_bazel_tests(ubuntu_version='16.04', smoke_tests=['DebugPlain'])
# ASan/UBSan are disabled for all these, the analysis on later versions is better anyway.
# Also, in some combinations they wouldn't work.
add_ubuntu_tests(ubuntu_version='14.04', compiler='gcc-5', asan=False, ubsan=False)
add_ubuntu_tests(ubuntu_version='14.04', compiler='clang-3.5', stl='libstdc++', asan=False, ubsan=False)
add_ubuntu_tests(ubuntu_version='14.04', compiler='clang-3.9', stl='libstdc++', asan=False, ubsan=False)
add_ubuntu_tests(ubuntu_version='14.04', compiler='clang-3.5', stl='libc++', asan=False, ubsan=False)
add_ubuntu_tests(ubuntu_version='14.04', compiler='clang-3.9', stl='libc++', asan=False, ubsan=False)
# Asan/Ubsan are disabled because it generates lots of warnings like:
# warning: direct access in [...] to global weak symbol guard variable for [...] means the weak symbol cannot be
# overridden at runtime. This was likely caused by different translation units being compiled with different
# visibility settings.
# and the build eventually fails or times out.
add_osx_tests(compiler='gcc-5', xcode_version='8', asan=False, ubsan=False)
add_osx_tests(compiler='gcc-6', xcode_version='8', asan=False, ubsan=False, smoke_tests=['DebugPlain'])
add_osx_tests(compiler='clang-4.0', xcode_version='8', stl='libc++', smoke_tests=['DebugPlain'])
# UBSan is disabled because AppleClang does not support -fsanitize=undefined.
add_osx_tests(compiler='clang-default', xcode_version='7.3', stl='libc++', ubsan=False)
# UBSan is disabled because AppleClang does not support -fsanitize=undefined.
add_osx_tests(compiler='clang-default', xcode_version='8.2', stl='libc++', ubsan=False)
add_osx_tests(compiler='clang-default', xcode_version='9.4', stl='libc++')
add_osx_tests(compiler='clang-default', xcode_version='10', stl='libc++', smoke_tests=['DebugPlain'])
# ** Disabled combinations **
#
# These fail with "'type_traits' file not found" (the <type_traits> header is missing).
#
# add_osx_tests('gcc-default', stl='libstdc++')
# add_osx_tests('clang-default', stl='libstdc++')
# add_osx_tests('clang-3.5', stl='libstdc++')
# add_osx_tests('clang-3.6', stl='libstdc++')
#
#
# The compiler complains that the 2-argument constructor of std::pair is ambiguous, even after
# adding explicit casts to the exact types of the expected overload.
#
# add_osx_tests('clang-default', stl='libc++')
#
#
# This triggers an assert error in the compiler, with the message:
# "expected to get called on an inlined function!" [...] function isMSExternInline, file Decl.cpp, line 2647.
#
# add_osx_tests('clang-3.5', stl='libc++', asan=False, ubsan=False)
#
#
# This fails with this error:
# /usr/include/c++/v1/string:1938:44: error: 'basic_string<_CharT, _Traits, _Allocator>' is missing
# exception specification 'noexcept(is_nothrow_copy_constructible<allocator_type>::value)'
# TODO: Try again every once in a while (to re-enable these once the bug in libc++ is fixed).
#
# add_ubuntu_tests(ubuntu_version='16.04', compiler='clang-3.8', stl='libc++', asan=False, ubsan=False)
#
yaml_file = {
'sudo': 'required',
'dist': 'trusty',
'services' : ['docker'],
'language': 'cpp',
'branches': {
'only': ['master'],
},
'matrix': {
'fast_finish': True,
'include': build_matrix_smoke_test_rows + build_matrix_rows,
},
}
class CustomDumper(yaml.SafeDumper):
def ignore_aliases(self, _data):
return True
print('#')
print('# This file was auto-generated from extras/scripts/travis_yml_generator.py, DO NOT EDIT')
print('#')
print(yaml.dump(yaml_file, default_flow_style=False, Dumper=CustomDumper))
| [
"[email protected]"
] | |
faded2f996b520e49df380a399e225a2a20919d5 | f34219ce57fbe6b446fb4f1aa966f136a9b3bf42 | /ex26.py | 6dc076019fe108fa44d2e7b17af7da7080d86319 | [] | no_license | DikranHachikyan/python-programming-20200323 | 467f60c07ac47e4146e63967eeb1acb76b8dd21c | e6d6185561969fc478caaedcd0981476d56d5c5b | refs/heads/master | 2021-04-20T09:52:25.151484 | 2020-04-09T07:24:33 | 2020-04-09T07:24:33 | 249,673,012 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 370 | py |
# 1. декларация
def addNumbers(a, b, c = None):
res = 0
if c:
res = a + b + c
else:
res = a + b
return res
if __name__ == '__main__':
# 2. извикване
x, y = 7, 8
r = addNumbers(x,y)
print(f'{x} + {y} = {r}')
z = 10
r = addNumbers(x, y, z)
print(f'{x} + {y} + {z} = {r}')
| [
"[email protected]"
] | |
a635b80d79ea126dcfd89d7fcde391bb6f7f0a2e | 42caf42f20b348c3c87d7d4f9cd59e61bc5e9f4e | /result/views.py | 19d1dd5da5edeb9256feb16f0c0e82e38c6bad15 | [] | no_license | Dihfahsih1/Automated-Result-School-Management | cfe43cc37c64a101447e50688f956190c67032ba | 7c4be1b70d26e89939f38f1df3a3ca04e7e3e96e | refs/heads/master | 2022-11-30T02:57:44.827519 | 2020-08-15T12:46:28 | 2020-08-15T12:46:28 | 287,744,827 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 42,180 | py | from django.shortcuts import get_object_or_404, redirect, render
from django.contrib.auth.decorators import login_required
from .decorators import lecturer_required, student_required
from .forms import *
from .models import User, Student, Course, CourseAllocation, TakenCourse, Session, Semester, CarryOverStudent, RepeatingStudent
from django.views.generic import CreateView, UpdateView, DeleteView
from django.utils.decorators import method_decorator
from django.contrib.auth import update_session_auth_hash, authenticate
from django.contrib.auth.forms import PasswordChangeForm
from django.urls import reverse_lazy
from django.http import HttpResponseRedirect
from django.contrib import messages
#pdf
from django.core.files.storage import FileSystemStorage
from django.http import HttpResponse, JsonResponse
from reportlab.platypus import SimpleDocTemplate, Paragraph, Spacer, Table, TableStyle, Image
from reportlab.lib.styles import getSampleStyleSheet, black, ParagraphStyle
from reportlab.lib.enums import TA_JUSTIFY,TA_LEFT,TA_CENTER,TA_RIGHT
from reportlab.platypus.tables import Table
from reportlab.lib.units import inch
from reportlab.lib import colors
cm = 2.54
from ARMS.settings import MEDIA_ROOT, BASE_DIR, STATIC_URL
import os
@login_required
def home(request):
"""
Shows our dashboard containing number of students, courses, lecturers, repating students,
carry over students and 1st class students in an interactive graph
"""
students = Student.objects.all().count()
staff = User.objects.filter(is_lecturer=True).count()
courses = Course.objects.all().count()
current_semester = Semester.objects.get(is_current_semester=True)
no_of_1st_class_students = Result.objects.filter(cgpa__gte=4.5).count()
no_of_carry_over_students = CarryOverStudent.objects.all().count()
no_of_students_to_repeat = RepeatingStudent.objects.all().count()
context = {
"no_of_students": students,
"no_of_staff":staff,
"no_of_courses": courses,
"no_of_1st_class_students": no_of_1st_class_students,
"no_of_students_to_repeat": no_of_students_to_repeat,
"no_of_carry_over_students": no_of_carry_over_students,
}
return render(request, 'result/home.html', context)
def get_chart(request, *args, **kwargs):
all_query_score = ()
levels = (100, 200, 300, 400, 500) # all the levels in the department
# iterate through the levels above
for i in levels:
# gather all the courses registered by the students of the current level in the loop
all_query_score += (TakenCourse.objects.filter(student__level=i),)
# for level #100
first_level_total = 0
# get the total score for all the courses registered by the students of this level
for i in all_query_score[0]:
first_level_total += i.total
first_level_avg = 0
if not all_query_score[0].count() == 0:
# calculate the average of all the students of this level
first_level_avg = first_level_total / all_query_score[0].count()
# do same as above for # 200 Level students
second_level_total = 0
for i in all_query_score[1]:
second_level_total += i.total
second_level_avg = 0
if not all_query_score[1].count() == 0:
second_level_avg = second_level_total / all_query_score[1].count()
# do same as above for # 300 Level students
third_level_total = 0
for i in all_query_score[2]:
third_level_total += i.total
third_level_avg = 0
if not all_query_score[2].count() == 0:
third_level_avg = third_level_total / all_query_score[2].count()
# do same as above for # 400 Level students
fourth_level_total = 0
for i in all_query_score[3]:
fourth_level_total += i.total
fourth_level_avg = 0
if not all_query_score[3].count() == 0:
fourth_level_avg = fourth_level_total / all_query_score[3].count()
# do same as above for # 500 Level students
fifth_level_total = 0
for i in all_query_score[4]:
fifth_level_total += i.total
fifth_level_avg = 0
if not all_query_score[4].count() == 0:
fifth_level_avg = fifth_level_total / all_query_score[4].count()
labels = ["100 Level", "200 Level", "300 Level", "400 Level", "500 Level"]
default_level_average = [first_level_avg, second_level_avg, third_level_avg, fourth_level_avg, fifth_level_avg]
average_data = {
"labels": labels,
"default_level_average": default_level_average,
}
return JsonResponse(average_data)
@login_required
def profile(request):
""" Show profile of any user that fire out the request """
current_semester = Semester.objects.get(is_current_semester=True)
if request.user.is_lecturer:
courses = Course.objects.filter(allocated_course__lecturer__pk=request.user.id).filter(semester=current_semester)
return render(request, 'account/profile.html', {"courses": courses,})
elif request.user.is_student:
level = Student.objects.get(user__pk=request.user.id)
courses = TakenCourse.objects.filter(student__user__id=request.user.id, course__level=level.level)
context = {
'courses': courses,
'level': level,
}
return render(request, 'account/profile.html', context)
else:
staff = User.objects.filter(is_lecturer=True)
return render(request, 'account/profile.html', { "staff": staff })
@login_required
def user_profile(request, id):
""" Show profile of any selected user """
if request.user.id == id:
return redirect("/profile/")
current_semester = Semester.objects.get(is_current_semester=True)
user = User.objects.get(pk=id)
if user.is_lecturer:
courses = Course.objects.filter(allocated_course__lecturer__pk=id).filter(semester=current_semester)
context = {
"user": user,
"courses": courses,
}
return render(request, 'account/user_profile.html', context)
elif user.is_student:
level = Student.objects.get(user__pk=id)
courses = TakenCourse.objects.filter(student__user__id=id, course__level=level.level)
context = {
"user_type": "student",
'courses': courses,
'level': level,
'user':user,
}
return render(request, 'account/user_profile.html', context)
else:
context = {
"user": user,
"user_type": "superuser"
}
return render(request, 'account/user_profile.html', context)
@login_required
def profile_update(request):
""" Check if the fired request is a POST then grap changes and update the records otherwise we show an empty form """
user = request.user.id
user = User.objects.get(pk=user)
if request.method == 'POST':
form = ProfileForm(request.POST)
if form.is_valid():
user.first_name = form.cleaned_data.get('first_name')
user.last_name = form.cleaned_data.get('last_name')
user.email = form.cleaned_data.get('email')
user.phone = form.cleaned_data.get('phone')
user.address = form.cleaned_data.get('address')
if request.FILES:
user.picture = request.FILES['picture']
user.save()
messages.success(request, 'Your profile was successfully edited.')
return redirect("/profile/")
else:
form = ProfileForm(instance=user, initial={
'firstname': user.first_name,
'lastname': user.last_name,
'email': user.email,
'phone': user.phone,
'picture': user.picture,
})
return render(request, 'account/profile_update.html', {'form': form})
@login_required
@lecturer_required
def course_list(request):
""" Show list of all registered courses in the system """
courses = Course.objects.all()
context = {
"courses":courses,
}
return render(request, 'course/course_list.html', context)
@login_required
@lecturer_required
def student_list(request):
""" Show list of all registered students in the system """
students = Student.objects.all()
user_type = "Student"
context = {
"students": students,
"user_type": user_type,
}
return render(request, 'students/student_list.html', context)
@login_required
@lecturer_required
def staff_list(request):
""" Show list of all registered staff """
staff = User.objects.filter(is_student=False)
user_type = "Staff"
context = {
"staff": staff,
"user_type": user_type,
}
return render(request, 'staff/staff_list.html', context)
@login_required
@lecturer_required
def session_list_view(request):
""" Show list of all sessions """
sessions = Session.objects.all().order_by('-session')
return render(request, 'result/manage_session.html', {"sessions": sessions,})
@login_required
@lecturer_required
def session_add_view(request):
""" check request method, if POST we add session otherwise show empty form """
if request.method == 'POST':
form = SessionForm(request.POST)
if form.is_valid():
form.save()
messages.success(request, 'Session added successfully ! ')
else:
form = SessionForm()
return render(request, 'result/session_update.html', {'form': form})
@login_required
@lecturer_required
def session_update_view(request, pk):
session = Session.objects.get(pk=pk)
if request.method == 'POST':
a = request.POST.get('is_current_session')
if a == '2':
unset = Session.objects.get(is_current_session=True)
unset.is_current_session = False
unset.save()
form = SessionForm(request.POST, instance=session)
if form.is_valid():
form.save()
messages.success(request, 'Session updated successfully ! ')
else:
form = SessionForm(request.POST, instance=session)
if form.is_valid():
form.save()
messages.success(request, 'Session updated successfully ! ')
else:
form = SessionForm(instance=session)
return render(request, 'result/session_update.html', {'form': form})
@login_required
@lecturer_required
def session_delete_view(request, pk):
session = get_object_or_404(Session, pk=pk)
if session.is_current_session == True:
messages.info(request, "You cannot delete current session")
return redirect('manage_session')
else:
session.delete()
messages.success(request, "Session successfully deleted")
return redirect('manage_semester')
@login_required
@lecturer_required
def semester_list_view(request):
semesters = Semester.objects.all().order_by('-semester')
return render(request, 'result/manage_semester.html', {"semesters": semesters,})
@login_required
@lecturer_required
def semester_add_view(request):
if request.method == 'POST':
form = SemesterForm(request.POST)
if form.is_valid():
data = form.data.get('is_current_semester') # returns string of 'True' if the user selected Yes
if data == 'True':
semester = form.data.get('semester')
ss = form.data.get('session')
session = Session.objects.get(pk=ss)
try:
if Semester.objects.get(semester=semester, session=ss):
messages.info(request, semester + " semester in " + session.session +" session already exist")
return redirect('create_new_semester')
except:
semester = Semester.objects.get(is_current_semester=True)
semester.is_current_semester = False
semester.save()
form.save()
form.save()
messages.success(request, 'Semester added successfully ! ')
return redirect('manage_semester')
else:
form = SemesterForm()
return render(request, 'result/semester_update.html', {'form': form})
@login_required
@lecturer_required
def semester_update_view(request, pk):
semester = Semester.objects.get(pk=pk)
if request.method == 'POST':
if request.POST.get('is_current_semester') == 'True': # returns string of 'True' if the user selected yes for 'is current semester'
unset_semester = Semester.objects.get(is_current_semester=True)
unset_semester.is_current_semester = False
unset_semester.save()
unset_session = Session.objects.get(is_current_session=True)
unset_session.is_current_session = False
unset_session.save()
new_session = request.POST.get('session')
form = SemesterForm(request.POST, instance=semester)
if form.is_valid():
set_session = Session.objects.get(pk=new_session)
set_session.is_current_session = True
set_session.save()
form.save()
messages.success(request, 'Semester updated successfully !')
return redirect('manage_semester')
else:
form = SemesterForm(request.POST, instance=semester)
if form.is_valid():
form.save()
return redirect('manage_semester')
else:
form = SemesterForm(instance=semester)
return render(request, 'result/semester_update.html', {'form': form})
@login_required
@lecturer_required
def semester_delete_view(request, pk):
semester = get_object_or_404(Semester, pk=pk)
if semester.is_current_semester == True:
messages.info(request, "You cannot delete current semester")
return redirect('manage_semester')
else:
semester.delete()
messages.success(request, "Semester successfully deleted")
return redirect('manage_semester')
@method_decorator([login_required, lecturer_required], name='dispatch')
class StaffAddView(CreateView):
model = User
form_class = StaffAddForm
template_name = 'registration/add_staff.html'
def get_context_data(self, **kwargs):
kwargs['user_type'] = 'staff'
return super().get_context_data(**kwargs)
def form_valid(self, form):
user = form.save()
return redirect('staff_list')
@login_required
@lecturer_required
def edit_staff(request, pk):
staff = get_object_or_404(User, pk=pk)
if request.method == "POST":
form = StaffAddForm(request.POST, instance=staff)
if form.is_valid():
staff.save()
return redirect('staff_list')
else:
form = StaffAddForm(instance=staff)
return render(request, 'registration/edit_staff.html', {'form': form})
@login_required
@lecturer_required
def delete_staff(request, pk):
staff = get_object_or_404(User, pk=pk)
staff.delete()
return redirect('staff_list')
@method_decorator([login_required, lecturer_required], name='dispatch')
class StudentAddView(CreateView):
model = User
form_class = StudentAddForm
template_name = 'registration/add_student.html'
def get_context_data(self, **kwargs):
kwargs['user_type'] = 'student'
return super().get_context_data(**kwargs)
def form_valid(self, form):
user = form.save()
return redirect('student_list')
@login_required
@lecturer_required
def edit_student(request, pk):
student = get_object_or_404(Student, pk=pk)
if request.method == "POST":
form = StudentAddForm(request.POST, instance=student)
if form.is_valid():
form.save()
return redirect('student_list')
else:
form = StudentAddForm(instance=student)
return render(request, 'registration/edit_student.html', {'form': form})
@login_required
@lecturer_required
def delete_student(request, pk):
student = get_object_or_404(Student, pk=pk)
student.delete()
return redirect('student_list')
@method_decorator([login_required, lecturer_required], name='dispatch')
class CourseAddView(CreateView):
model = Course
form_class = CourseAddForm
template_name = 'course/course_form.html'
def form_valid(self, form):
form.save()
return redirect('course_allocation')
@login_required
@lecturer_required
def course_edit(request, pk):
course = get_object_or_404(Course, pk=pk)
if request.method == "POST":
form = CourseAddForm(request.POST, instance=course)
if form.is_valid():
course.save()
messages.success(request, "Successfully Updated")
return redirect('course_list')
else:
form = CourseAddForm(instance=course)
return render(request, 'course/course_form.html', {'form': form})
@method_decorator([login_required, lecturer_required], name='dispatch')
class CourseAllocationView(CreateView):
form_class = CourseAllocationForm
template_name = 'course/course_allocation.html'
def get_form_kwargs(self):
kwargs = super(CourseAllocationView, self).get_form_kwargs()
kwargs['user'] = self.request.user
return kwargs
def form_valid(self, form):
# if a staff has been allocated a course before update it else create new
lecturer = form.cleaned_data['lecturer']
selected_courses = form.cleaned_data['courses']
courses = ()
for course in selected_courses:
courses += (course.pk,)
print(courses)
try:
a = CourseAllocation.objects.get(lecturer=lecturer)
except:
a = CourseAllocation.objects.create(lecturer=lecturer)
for i in range(0, selected_courses.count()):
a.courses.add(courses[i])
a.save()
return redirect('course_allocation_view')
@login_required
@student_required
def course_registration(request):
if request.method == 'POST':
ids = ()
data = request.POST.copy()
data.pop('csrfmiddlewaretoken', None) # remove csrf_token
for key in data.keys():
ids = ids + (str(key),)
for s in range(0,len(ids)):
student = Student.objects.get(user__pk=request.user.id)
course = Course.objects.get(pk=ids[s])
obj = TakenCourse.objects.create(student=student, course=course)
obj.save()
messages.success(request, 'Courses Registered Successfully!')
return redirect('course_registration')
else:
student = Student.objects.get(user__pk=request.user.id)
taken_courses = TakenCourse.objects.filter(student__user__id=request.user.id)
t = ()
for i in taken_courses:
t += (i.course.pk,)
current_semester = Semester.objects.get(is_current_semester=True)
courses = Course.objects.filter(level=student.level).exclude(id__in=t)
all_courses = Course.objects.filter(level=student.level)
no_course_is_registered = False # Check if no course is registered
all_courses_are_registered = False
registered_courses = Course.objects.filter(level=student.level).filter(id__in=t)
if registered_courses.count() == 0: # Check if number of registered courses is 0
no_course_is_registered = True
if registered_courses.count() == all_courses.count():
all_courses_are_registered = True
total_first_semester_unit = 0
total_sec_semester_unit = 0
total_registered_unit = 0
for i in courses:
if i.semester == "First":
total_first_semester_unit += int(i.courseUnit)
if i.semester == "Second":
total_sec_semester_unit += int(i.courseUnit)
for i in registered_courses:
total_registered_unit += int(i.courseUnit)
context = {
"all_courses_are_registered": all_courses_are_registered,
"no_course_is_registered": no_course_is_registered,
"current_semester":current_semester,
"courses":courses,
"total_first_semester_unit": total_first_semester_unit,
"total_sec_semester_unit": total_sec_semester_unit,
"registered_courses": registered_courses,
"total_registered_unit": total_registered_unit,
"student": student,
}
return render(request, 'course/course_registration.html', context)
@login_required
@student_required
def course_drop(request):
if request.method == 'POST':
ids = ()
data = request.POST.copy()
data.pop('csrfmiddlewaretoken', None) # remove csrf_token
for key in data.keys():
ids = ids + (str(key),)
for s in range(0,len(ids)):
student = Student.objects.get(user__pk=request.user.id)
course = Course.objects.get(pk=ids[s])
obj = TakenCourse.objects.get(student=student, course=course)
obj.delete()
messages.success(request, 'Successfully Dropped!')
return redirect('course_registration')
@login_required
@lecturer_required
def delete_course(request, pk):
course = get_object_or_404(Course, pk=pk)
course.delete()
messages.success(request, 'Deleted successfully!')
return redirect('course_list')
@login_required
@lecturer_required
def add_score(request):
"""
Shows a page where a lecturer will select a course allocated to him for score entry.
in a specific semester and session
"""
current_session = Session.objects.get(is_current_session=True)
current_semester = get_object_or_404(Semester, is_current_semester=True, session=current_session)
semester = Course.objects.filter(allocated_course__lecturer__pk=request.user.id, semester=current_semester)
courses = Course.objects.filter(allocated_course__lecturer__pk=request.user.id).filter(semester=current_semester)
context = {
"courses": courses,
}
return render(request, 'result/add_score.html', context)
@login_required
@lecturer_required
def add_score_for(request, id):
"""
Shows a page where a lecturer will add score for studens that are taking courses allocated to him
in a specific semester and session
"""
current_semester = Semester.objects.get(is_current_semester=True)
if request.method == 'GET':
courses = Course.objects.filter(allocated_course__lecturer__pk=request.user.id).filter(semester=current_semester)
course = Course.objects.get(pk=id)
students = TakenCourse.objects.filter(course__allocated_course__lecturer__pk=request.user.id).filter(course__id=id).filter(course__semester=current_semester)
context = {
"courses":courses,
"course": course,
"students":students,
}
return render(request, 'result/add_score_for.html', context)
if request.method == 'POST':
ids = ()
data = request.POST.copy()
data.pop('csrfmiddlewaretoken', None) # remove csrf_token
for key in data.keys():
ids = ids + (str(key),) # gather all the all students id (i.e the keys) in a tuple
for s in range(0,len(ids)): # iterate over the list of student ids gathered above
student = TakenCourse.objects.get(id=ids[s])
courses = Course.objects.filter(level=student.student.level).filter(semester=current_semester) # all courses of a specific level in current semester
total_unit_in_semester = 0
for i in courses:
if i == courses.count():
break
else:
total_unit_in_semester += int(i.courseUnit)
score = data.getlist(ids[s]) # get list of score for current student in the loop
ca = score[0] # subscript the list to get the fisrt value > ca score
exam = score[1] # do thesame for exam score
obj = TakenCourse.objects.get(pk=ids[s]) # get the current student data
obj.ca = ca # set current student ca score
obj.exam = exam # set current student exam score
obj.total = obj.get_total(ca=ca,exam=exam)
obj.grade = obj.get_grade(ca=ca,exam=exam)
obj.comment = obj.get_comment(obj.grade)
obj.carry_over(obj.grade)
obj.is_repeating()
obj.save()
gpa = obj.calculate_gpa(total_unit_in_semester)
cgpa = obj.calculate_cgpa()
try:
a = Result.objects.get(student=student.student, semester=current_semester, level=student.student.level)
a.gpa = gpa
a.cgpa = cgpa
a.save()
except:
Result.objects.get_or_create(student=student.student, gpa=gpa, semester=current_semester, level=student.student.level)
messages.success(request, 'Successfully Recorded! ')
return HttpResponseRedirect(reverse_lazy('add_score_for', kwargs={'id': id}))
return HttpResponseRedirect(reverse_lazy('add_score_for', kwargs={'id': id}))
@login_required
@student_required
def view_result(request):
student = Student.objects.get(user__pk=request.user.id)
current_semester = Semester.objects.get(is_current_semester=True)
courses = TakenCourse.objects.filter(student__user__pk=request.user.id, course__level=student.level)
result = Result.objects.filter(student__user__pk=request.user.id)
current_semester_grades = {}
previousCGPA = 0
previousLEVEL = 0
for i in result:
if not int(i.level) - 100 == 0: # TODO think n check the logic
previousLEVEL = i.level
try:
a = Result.objects.get(student__user__pk=request.user.id, level=previousLEVEL, semester="Second")
previousCGPA = a.cgpa
break
except:
previousCGPA = 0
else:
break
context = {
"courses": courses,
"result":result,
"student": student,
"previousCGPA": previousCGPA,
}
return render(request, 'students/view_results.html', context)
@login_required
def change_password(request):
if request.method == 'POST':
form = PasswordChangeForm(request.user, request.POST)
if form.is_valid():
user = form.save()
update_session_auth_hash(request, user)
messages.success(request, 'Your password was successfully updated!')
else:
messages.error(request, 'Please correct the errors below. ')
else:
form = PasswordChangeForm(request.user)
return render(request, 'account/change_password.html', {
'form': form,
})
@login_required
@lecturer_required
def course_allocation_view(request):
allocated_courses = CourseAllocation.objects.all()
return render(request, 'course/course_allocation_view.html', {"allocated_courses": allocated_courses})
@login_required
@lecturer_required
def withheld_course(request, pk):
course = CourseAllocation.objects.get(pk=pk)
course.delete()
messages.success(request, 'successfully deallocated!')
return redirect("course_allocation_view")
@login_required
def carry_over(request):
if request.method == "POST":
value = ()
data = request.POST.copy()
data.pop('csrfmiddlewaretoken', None) # remove csrf_token
for val in data.values():
value += (val,)
course = value[0]
session = value[1]
courses = CarryOverStudent.objects.filter(course__courseCode=course, session=session)
all_courses = Course.objects.all()
sessions = Session.objects.all()
signal_template = True
context = {
"all_courses": all_courses,
"courses": courses,
"signal_template": signal_template,
"sessions":sessions
}
return render(request, 'course/carry_over.html', context)
else:
all_courses = Course.objects.all()
sessions = Session.objects.all()
return render(request, 'course/carry_over.html', { "all_courses": all_courses, "sessions":sessions })
@login_required
def repeat_list(request):
students = RepeatingStudent.objects.all()
return render(request, 'students/repeaters.html', {"students": students})
@login_required
def first_class_list(request):
students = Result.objects.filter(cgpa__gte=4.5)
return render(request, 'students/first_class_students.html', {"students": students})
@login_required
@lecturer_required
def result_sheet_pdf_view(request, id):
current_semester = Semester.objects.get(is_current_semester=True)
current_session = Session.objects.get(is_current_session=True)
result = TakenCourse.objects.filter(course__pk=id)
no_of_pass = TakenCourse.objects.filter(course__pk=id, comment="PASS").count()
no_of_fail = TakenCourse.objects.filter(course__pk=id, comment="FAIL").count()
fname = str(current_semester) + '_semester_' + str(current_session) + '_session_' + 'resultSheet.pdf'
fname = fname.replace("/", "-")
flocation = '/tmp/'+fname
doc = SimpleDocTemplate(flocation, rightMargin=0, leftMargin=6.5 * cm, topMargin=0.3 * cm, bottomMargin=0)
styles = getSampleStyleSheet()
styles.add(ParagraphStyle( name="ParagraphTitle", fontSize=11, fontName="FreeSansBold"))
Story = [Spacer(1,.2)]
style = styles["Normal"]
logo = MEDIA_ROOT + "/logo/android-chrome-144x144.png"
print(logo)
im = Image(logo, 1*inch, 1*inch)
im.__setattr__("_offs_x", -280)
im.__setattr__("_offs_y", -45)
Story.append(im)
style = getSampleStyleSheet()
normal = style["Normal"]
normal.alignment = TA_CENTER
normal.fontName = "Helvetica"
normal.fontSize = 12
normal.leading = 15
title = "<b> "+str(current_semester) + " Semester " + str(current_session) + " Result Sheet</b>"
title = Paragraph(title.upper(), normal)
Story.append(title)
Story.append(Spacer(1,0.1*inch))
style = getSampleStyleSheet()
normal = style["Normal"]
normal.alignment = TA_CENTER
normal.fontName = "Helvetica"
normal.fontSize = 10
normal.leading = 15
title = "<b>Course lecturer: " + request.user.get_full_name() + "</b>"
title = Paragraph(title.upper(), normal)
Story.append(title)
Story.append(Spacer(1,0.1*inch))
normal = style["Normal"]
normal.alignment = TA_CENTER
normal.fontName = "Helvetica"
normal.fontSize = 10
normal.leading = 15
level = result.filter(course_id=id).first()
title = "<b>Level: </b>" + str(level.course.level+"L")
title = Paragraph(title.upper(), normal)
Story.append(title)
Story.append(Spacer(1,.6*inch))
elements = []
count = 0
header = [('S/N', 'ID NUMBER', 'CA', 'EXAM', 'GRADE', 'COMMENT')]
table_header=Table(header,1*[1.2*inch], 1*[0.5*inch])
table_header.setStyle(
TableStyle([
('ALIGN',(-2,-2), (-2,-2),'CENTER'),
('TEXTCOLOR',(1,0),(1,0),colors.blue),
('TEXTCOLOR',(-1,0),(-1,0),colors.blue),
('ALIGN',(0,-1),(-1,-1),'CENTER'),
('VALIGN',(0,-1),(-1,-1),'MIDDLE'),
('TEXTCOLOR',(0,-1),(-1,-1),colors.blue),
('INNERGRID', (0,0), (-1,-1), 0.25, colors.black),
('BOX', (0,0), (-1,-1), 0.25, colors.black),
]))
Story.append(table_header)
for student in result:
data = [(count+1, student.student.id_number.upper(), student.ca, student.exam, student.grade, student.comment)]
color = colors.black
if student.grade == 'F':
color = colors.red
count += 1
t=Table(data,1*[1.2*inch], 1*[0.5*inch])
t.setStyle(
TableStyle([
('ALIGN',(-2,-2), (-2,-2),'CENTER'),
('ALIGN',(1,0), (1,0),'CENTER'),
('ALIGN',(-1,0), (-1,0),'CENTER'),
('ALIGN',(-3,0), (-3,0),'CENTER'),
('ALIGN',(-4,0), (-4,0),'CENTER'),
('ALIGN',(-6,0), (-6,0),'CENTER'),
('TEXTCOLOR',(0,-1),(-1,-1),color),
('INNERGRID', (0,0), (-1,-1), 0.25, colors.black),
('BOX', (0,0), (-1,-1), 0.25, colors.black),
]))
Story.append(t)
Story.append(Spacer(1,1*inch))
style_right = ParagraphStyle(name='right', parent=styles['Normal'], alignment=TA_RIGHT)
tbl_data = [
[Paragraph("<b>Date:</b>_______________________________________", styles["Normal"]), Paragraph("<b>No. of PASS:</b> " + str(no_of_pass), style_right)],
[Paragraph("<b>Siganture / Stamp:</b> _____________________________", styles["Normal"]), Paragraph("<b>No. of FAIL: </b>" + str(no_of_fail), style_right)]]
tbl = Table(tbl_data)
Story.append(tbl)
doc.build(Story)
fs = FileSystemStorage("/tmp")
with fs.open(fname) as pdf:
response = HttpResponse(pdf, content_type='application/pdf')
response['Content-Disposition'] = 'inline; filename='+fname+''
return response
return response
@login_required
@student_required
def course_registration_form(request):
current_semester = Semester.objects.get(is_current_semester=True)
current_session = Session.objects.get(is_current_session=True)
courses = TakenCourse.objects.filter(student__user__id=request.user.id)
fname = request.user.username + '.pdf'
fname = fname.replace("/", "-")
flocation = '/tmp/'+fname
doc = SimpleDocTemplate(flocation, rightMargin=15, leftMargin=15, topMargin=0, bottomMargin=0)
styles = getSampleStyleSheet()
Story = [Spacer(1,0.5)]
Story.append(Spacer(1,0.4*inch))
style = styles["Normal"]
style = getSampleStyleSheet()
normal = style["Normal"]
normal.alignment = TA_CENTER
normal.fontName = "Helvetica"
normal.fontSize = 12
normal.leading = 18
title = "<b>MODIBBO ADAMA UNIVERSITY OF TECHNOLOGY, YOLA</b>"
title = Paragraph(title.upper(), normal)
Story.append(title)
style = getSampleStyleSheet()
school = style["Normal"]
school.alignment = TA_CENTER
school.fontName = "Helvetica"
school.fontSize = 10
school.leading = 18
school_title = "<b>SCHOOL OF MANAGEMENT AND INFORMATION TECHNOLOGY</b>"
school_title = Paragraph(school_title.upper(), school)
Story.append(school_title)
style = getSampleStyleSheet()
Story.append(Spacer(1,0.1*inch))
department = style["Normal"]
department.alignment = TA_CENTER
department.fontName = "Helvetica"
department.fontSize = 9
department.leading = 18
department_title = "<b>DEPARTMENT OF INFORMATION MANAGEMENT TECHNOLOGY</b>"
department_title = Paragraph(department_title, department)
Story.append(department_title)
Story.append(Spacer(1,.3*inch))
title = "<b><u>STUDENT REGISTRATION FORM</u></b>"
title = Paragraph(title.upper(), normal)
Story.append(title)
student = Student.objects.get(user__pk=request.user.id)
style_right = ParagraphStyle(name='right', parent=styles['Normal'])
tbl_data = [
[Paragraph("<b>Registration Number : " + request.user.username.upper() + "</b>", styles["Normal"])],
[Paragraph("<b>Name : " + request.user.get_full_name().upper() + "</b>", styles["Normal"])],
[Paragraph("<b>Session : " + current_session.session.upper() + "</b>", styles["Normal"]), Paragraph("<b>Level: " + student.level + "</b>", styles["Normal"])
]]
tbl = Table(tbl_data)
Story.append(tbl)
Story.append(Spacer(1, 0.6*inch))
style = getSampleStyleSheet()
semester = style["Normal"]
semester.alignment = TA_LEFT
semester.fontName = "Helvetica"
semester.fontSize = 9
semester.leading = 18
semester_title = "<b>FIRST SEMESTER</b>"
semester_title = Paragraph(semester_title, semester)
Story.append(semester_title)
elements = []
# FIRST SEMESTER
count = 0
header = [('S/No', 'Course Code', 'Course Title', 'Unit', Paragraph('Name, Siganture of course lecturer & Date', style['Normal']))]
table_header = Table(header,1*[1.4*inch], 1*[0.5*inch])
table_header.setStyle(
TableStyle([
('ALIGN',(-2,-2), (-2,-2),'CENTER'),
('VALIGN',(-2,-2), (-2,-2),'MIDDLE'),
('ALIGN',(1,0), (1,0),'CENTER'),
('VALIGN',(1,0), (1,0),'MIDDLE'),
('ALIGN',(0,0), (0,0),'CENTER'),
('VALIGN',(0,0), (0,0),'MIDDLE'),
('ALIGN',(-4,0), (-4,0),'LEFT'),
('VALIGN',(-4,0), (-4,0),'MIDDLE'),
('ALIGN',(-3,0), (-3,0),'LEFT'),
('VALIGN',(-3,0), (-3,0),'MIDDLE'),
('TEXTCOLOR',(0,-1),(-1,-1),colors.black),
('INNERGRID', (0,0), (-1,-1), 0.25, colors.black),
('BOX', (0,0), (-1,-1), 0.25, colors.black),
]))
Story.append(table_header)
first_semester_unit = 0
for course in courses:
if course.course.semester == FIRST:
first_semester_unit += int(course.course.courseUnit)
data = [(count+1, course.course.courseCode.upper(), course.course.courseTitle, course.course.courseUnit, '')]
color = colors.black
count += 1
table_body=Table(data,1*[1.4*inch], 1*[0.3*inch])
table_body.setStyle(
TableStyle([
('ALIGN',(-2,-2), (-2,-2),'CENTER'),
('ALIGN',(1,0), (1,0),'CENTER'),
('ALIGN',(0,0), (0,0),'CENTER'),
('ALIGN',(-4,0), (-4,0),'LEFT'),
('TEXTCOLOR',(0,-1),(-1,-1),colors.black),
('INNERGRID', (0,0), (-1,-1), 0.25, colors.black),
('BOX', (0,0), (-1,-1), 0.25, colors.black),
]))
Story.append(table_body)
style = getSampleStyleSheet()
semester = style["Normal"]
semester.alignment = TA_LEFT
semester.fontName = "Helvetica"
semester.fontSize = 8
semester.leading = 18
semester_title = "<b>Total Units : " + str(first_semester_unit) + "</b>"
semester_title = Paragraph(semester_title, semester)
Story.append(semester_title)
# FIRST SEMESTER ENDS HERE
Story.append(Spacer(1, 0.6*inch))
style = getSampleStyleSheet()
semester = style["Normal"]
semester.alignment = TA_LEFT
semester.fontName = "Helvetica"
semester.fontSize = 9
semester.leading = 18
semester_title = "<b>SECOND SEMESTER</b>"
semester_title = Paragraph(semester_title, semester)
Story.append(semester_title)
# SECOND SEMESTER
count = 0
header = [('S/No', 'Course Code', 'Course Title', 'Unit', Paragraph('<b>Name, Siganture of course lecturer & Date</b>', style['Normal']))]
table_header = Table(header,1*[1.4*inch], 1*[0.5*inch])
table_header.setStyle(
TableStyle([
('ALIGN',(-2,-2), (-2,-2),'CENTER'),
('VALIGN',(-2,-2), (-2,-2),'MIDDLE'),
('ALIGN',(1,0), (1,0),'CENTER'),
('VALIGN',(1,0), (1,0),'MIDDLE'),
('ALIGN',(0,0), (0,0),'CENTER'),
('VALIGN',(0,0), (0,0),'MIDDLE'),
('ALIGN',(-4,0), (-4,0),'LEFT'),
('VALIGN',(-4,0), (-4,0),'MIDDLE'),
('ALIGN',(-3,0), (-3,0),'LEFT'),
('VALIGN',(-3,0), (-3,0),'MIDDLE'),
('TEXTCOLOR',(0,-1),(-1,-1),colors.black),
('INNERGRID', (0,0), (-1,-1), 0.25, colors.black),
('BOX', (0,0), (-1,-1), 0.25, colors.black),
]))
Story.append(table_header)
second_semester_unit = 0
for course in courses:
if course.course.semester == SECOND:
second_semester_unit += int(course.course.courseUnit)
data = [(count+1, course.course.courseCode.upper(), course.course.courseTitle, course.course.courseUnit, '')]
color = colors.black
count += 1
table_body=Table(data,1*[1.4*inch], 1*[0.3*inch])
table_body.setStyle(
TableStyle([
('ALIGN',(-2,-2), (-2,-2),'CENTER'),
('ALIGN',(1,0), (1,0),'CENTER'),
('ALIGN',(0,0), (0,0),'CENTER'),
('ALIGN',(-4,0), (-4,0),'LEFT'),
('TEXTCOLOR',(0,-1),(-1,-1),colors.black),
('INNERGRID', (0,0), (-1,-1), 0.25, colors.black),
('BOX', (0,0), (-1,-1), 0.25, colors.black),
]))
Story.append(table_body)
style = getSampleStyleSheet()
semester = style["Normal"]
semester.alignment = TA_LEFT
semester.fontName = "Helvetica"
semester.fontSize = 8
semester.leading = 18
semester_title = "<b>Total Units : " + str(second_semester_unit) + "</b>"
semester_title = Paragraph(semester_title, semester)
Story.append(semester_title)
Story.append(Spacer(1, 2))
style = getSampleStyleSheet()
certification = style["Normal"]
certification.alignment = TA_JUSTIFY
certification.fontName = "Helvetica"
certification.fontSize = 8
certification.leading = 18
student = Student.objects.get(user__pk=request.user.id)
certification_text = "CERTIFICATION OF REGISTRATION: I certify that <b>" + str(request.user.get_full_name().upper()) + "</b>\
has been duly registered for the <b>" + student.level + " level </b> of study in the department\
of INFORMATION MANAGEMENT TECHNOLOGY and that the courses and units registered are as approved by the senate of the University"
certification_text = Paragraph(certification_text, certification)
Story.append(certification_text)
# FIRST SEMESTER ENDS HERE
logo = MEDIA_ROOT + "/logo/android-chrome-144x144.png"
im = Image(logo, 1.5*inch, 1.5*inch)
im.__setattr__("_offs_x", -228)
im.__setattr__("_offs_y", 625)
Story.append(im)
picture = BASE_DIR + request.user.get_picture()
im = Image(picture, 1.0*inch, 1.0*inch)
im.__setattr__("_offs_x", 218)
im.__setattr__("_offs_y", 625)
Story.append(im)
doc.build(Story)
fs = FileSystemStorage("/tmp")
with fs.open(fname) as pdf:
response = HttpResponse(pdf, content_type='application/pdf')
response['Content-Disposition'] = 'inline; filename='+fname+''
return response
return response | [
"[email protected]"
] | |
f1c7573bba1a0892112b60e9cdc75fae7385b0fa | e83cfcdf15ddb362b4611488dc4982bf7832464b | /libs/python/test/test_endpoint_indigo_traceroute.py | feff4e323b776909d67c5b7d97dade312242b3e0 | [] | no_license | shivamjaiswal64/api-rest-meetings | ce2b59edb0b588de8a4bd0f6ff6addecc557cca6 | f4750f72ca5f8358c4dc00737abc104a28d62934 | refs/heads/master | 2020-03-22T14:33:39.825474 | 2018-07-07T01:22:40 | 2018-07-07T01:22:40 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 6,785 | py | # coding: utf-8
"""
BlueJeans Meetings REST API
## Video That Works Where You Do. This site provides developers access to APIs from BlueJean's Meetings meeting service. From here you will be able to make actual API calls to manage User Accounts, Meetings, and Recordings. Also, you can pull analytical data and current state information. With these APIs you can quickly integrate **BlueJeans** video administration into your applications. <hr> <h2 class=\"info\"> What is a BlueJeans Meeting?</h2> <img src=\"./img/bjnmeeting.png\" style=\"padding-left:20px; width:50%\"> A BlueJeans meeting is a collaboration session of 2 or more participants joining a virtual meeting-room in the cloud. The first person to join is put into a waiting-room until other participant(s) join. When the meeting starts, all participants will be connected over video & audio. <u>Types of Meeting Rooms</u> There are two types of Meeting Rooms available to a registered user. They are described as: <ul> <li>Scheduled – A room created for a specific date and time. It is assigned a randomized and unique numeric ID by BlueJeans.</li> <li>Personal – Every user is given a personal meeting room with a customized Meeting Identifier. People typically use their mobile phone number as their Meeting ID.</li> </ul> <u>Meeting Room Security</u> A meeting room can <i>optionally</i> be protected by a randomized access code. THe access code ensures security of participants who join. Also the access code can specify a Moderator role whose user(s) have additional capabilities to administer a meeting. <ul> <li>When set, participants would be required to enter the access code in order to join.</li> <li>The scheduler's profile has a user-specified moderator passcode which can be input to allow designated user(s) greater privileges to help organize meetings.</li> </ul> <hr> <h2 id='gs' class=\"info\" onclick=\"hideit('gs')\"><span id=\"gsicon\" class=\"glyphicon glyphicon-chevron-right\"></span> Getting Started</h2> <div id=\"gsbody\" style=\"display:none\"> Before you start using BlueJeans' APIs, you must first have a BlueJeans account enabled for API Access. Contact <a href=\"mailto:[email protected])\">BlueJeans Support</a> for assistance. <br /><br />Once you have an account, you may start writing application code to authenticate and make API calls. *Alternatively*, you can use this developer site to test the BlueJeans' APIs and develop a level of familiarity before you write production code. <br /> ### To Make API Calls from This Site If you want to use this developer site to try various BlueJeans' APIs, here are the steps required to authenticate and enable your Developer Session to place API calls. 1. Choose Method for Authenticating * Click on the desired Authentication method from below. * Click on the **Try It Out** button. 1. Make Authentication request * Follow APIs instructions and input the API parameters. * Click on the blue **Execute** button. * If successful, the API returns with JSON data containing a field called **access_token**. Copy/save this value. 1. Authorize BlueJeans Developer Session. * Click on the green **Authorize button**. * The site will show you a pop-up window for authorization. * Enter your access token in the field named **api_key** * Click on the **Authorize** button Your current BlueJeans developer session is now authenticated and ready to place API calls. The web site will automatically include your access token on any API calls you make. </div> <hr> <h2 id='oauth' class=\"info\" onclick=\"hideit('oauth')\"><span id=\"oauthicon\" class=\"glyphicon glyphicon-chevron-right\"></span> About Meetings Authentication</h2> <div id=\"oauthbody\" style=\"display:none\"> All API transactions (excluding Authentication) require an access token per **OAuth standards**. BlueJeans provides multiple methods for obtaining an access token. Additionally there are diffferent scopes of token access. ### Grant Types Bluejeans provides 4 different methods for users to Authenticate. Successful authentication allows BlueJeans to grant an access token to perform API operations. * Password Credentials Grant – Authenticate with a username and password and receive an access token with user level permission. Known as two-legged OAuth. * Meeting Credentials Grant – Authenticate with a meeting ID and meeting passcode and receive an access token with meeting level permission. Known as two-legged OAuth. * Client Credentials Grant – Authenticate with a client ID and client secret and receive an access token with enterprise level permission. Known as two-legged OAuth. * Authorization Code Grant – Authentication for your developer's application occurs through a redirection to a BlueJeans authentication page. The application receives an authorization code to be submitted, along with other tokens, to receive an access token. Known as three-legged OAuth. For more information please refer to the [OAuth specification](https://oauth.net/). ### Access & Permissions BlueJeans defines 3 levels of API access into the system. When an access token is granted, it carries one of these 3 levels. The scope of system functionality depends upon the token's access level. * Meeting-level – Scope of APIs is limited to individual meetings. * User-level – Scope depends on the requested permissions. * App-level – provisioned either by BlueJeans personnel, or the BlueJeans Enterprise Admin, an app, is issued a client key and secret key. These tokens then are used by the BlueJeans Authentication API to receive the token. The token's scope provides access to the entire enterprise and all of its users. All endpoints in this document that require **Enterprise Admin** access will be marked as such. </div> <hr>
OpenAPI spec version: 1.0.0
Contact: [email protected]
Generated by: https://github.com/swagger-api/swagger-codegen.git
"""
from __future__ import absolute_import
import os
import sys
import unittest
import BlueJeansMeetingsRestApi
from BlueJeansMeetingsRestApi.rest import ApiException
from BlueJeansMeetingsRestApi.models.endpoint_indigo_traceroute import EndpointIndigoTraceroute
class TestEndpointIndigoTraceroute(unittest.TestCase):
""" EndpointIndigoTraceroute unit test stubs """
def setUp(self):
pass
def tearDown(self):
pass
def testEndpointIndigoTraceroute(self):
"""
Test EndpointIndigoTraceroute
"""
# FIXME: construct object with mandatory attributes with example values
#model = BlueJeansMeetingsRestApi.models.endpoint_indigo_traceroute.EndpointIndigoTraceroute()
pass
if __name__ == '__main__':
unittest.main()
| [
"[email protected]"
] |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.