content
stringlengths 7
1.05M
| fixed_cases
stringlengths 1
1.28M
|
|---|---|
def hypotenuse_triangle(side1, side2):
hypotenuse = side1 ** 2 + side2 ** 2
return hypotenuse
print(hypotenuse_triangle(2, 4))
| def hypotenuse_triangle(side1, side2):
hypotenuse = side1 ** 2 + side2 ** 2
return hypotenuse
print(hypotenuse_triangle(2, 4)) |
# Tuplas sao imutaveis, nao se pode substituir um valor enquanto o programa estiver rodando
# oq foi definido no inicio permanece ate o final
lanche = ('hamburguer', 'pizza', 'suco', 'refri')
print(lanche[1])
print(lanche[-1]) #-1 mostra o ultimo elemento
print(sorted(lanche)) #para organizar a lista em ordem alfabetica porem nao vai mudar os iten
for comida in lanche:
print(f'comi bastante {comida}') # A variavel comida vai percorrer cada valor na lista lanche, vai pegar os nomes
print('estou gordo')
for cont in range(0, len(lanche)):
print(cont) # vai pegar o endereco da lista (0,1,2...) por causa das ()
print('fim')
for food in range(0, len(lanche)):
print(lanche[food], f'na posicao {food}') # vai pegar na lista lanche o endereco food 0,1,2,3...
print('end')
| lanche = ('hamburguer', 'pizza', 'suco', 'refri')
print(lanche[1])
print(lanche[-1])
print(sorted(lanche))
for comida in lanche:
print(f'comi bastante {comida}')
print('estou gordo')
for cont in range(0, len(lanche)):
print(cont)
print('fim')
for food in range(0, len(lanche)):
print(lanche[food], f'na posicao {food}')
print('end') |
FULL_ACCESS_GMAIL_SCOPE = "https://mail.google.com/"
LABELS_GMAIL_SCOPE = "https://www.googleapis.com/auth/gmail.labels"
SEND_GMAIL_SCOPE = "https://www.googleapis.com/auth/gmail.send"
READ_ONLY_GMAIL_SCOPE = "https://www.googleapis.com/auth/gmail.readonly"
COMPOSE_GMAIL_SCOPE = "https://www.googleapis.com/auth/gmail.compose"
INSERT_GMAIL_SCOPE = "https://www.googleapis.com/auth/gmail.insert"
MODIFY_GMAIL_SCOPE = "https://www.googleapis.com/auth/gmail.modify"
METADATA_GMAIL_SCOPE = "https://www.googleapis.com/auth/gmail.metadata"
SETTINGS_BASIC_GMAIL_SCOPE = "https://www.googleapis.com/auth/gmail.settings.basic"
SETTINGS_SHARING_GMAIL_SCOPE = "https://www.googleapis.com/auth/gmail.settings.sharing"
| full_access_gmail_scope = 'https://mail.google.com/'
labels_gmail_scope = 'https://www.googleapis.com/auth/gmail.labels'
send_gmail_scope = 'https://www.googleapis.com/auth/gmail.send'
read_only_gmail_scope = 'https://www.googleapis.com/auth/gmail.readonly'
compose_gmail_scope = 'https://www.googleapis.com/auth/gmail.compose'
insert_gmail_scope = 'https://www.googleapis.com/auth/gmail.insert'
modify_gmail_scope = 'https://www.googleapis.com/auth/gmail.modify'
metadata_gmail_scope = 'https://www.googleapis.com/auth/gmail.metadata'
settings_basic_gmail_scope = 'https://www.googleapis.com/auth/gmail.settings.basic'
settings_sharing_gmail_scope = 'https://www.googleapis.com/auth/gmail.settings.sharing' |
def read():
x = int(input())
return x
a = read()
b = read()
c = read()
d = read()
if b == c and b + c == d and b + c + d == a:
print("S")
else:
print("N")
| def read():
x = int(input())
return x
a = read()
b = read()
c = read()
d = read()
if b == c and b + c == d and (b + c + d == a):
print('S')
else:
print('N') |
def test_home(client):
response = client.get('/')
#import pdb;pdb.set_trace()
assert response.status_code == 200
assert response.template_name == ['home.html']
| def test_home(client):
response = client.get('/')
assert response.status_code == 200
assert response.template_name == ['home.html'] |
# MIT licensed
# Copyright (c) 2013-2020 lilydjwg <[email protected]>, et al.
HACKAGE_URL = 'https://hackage.haskell.org/package/%s/preferred.json'
async def get_version(name, conf, *, cache, **kwargs):
key = conf.get('hackage', name)
data = await cache.get_json(HACKAGE_URL % key)
return data['normal-version'][0]
| hackage_url = 'https://hackage.haskell.org/package/%s/preferred.json'
async def get_version(name, conf, *, cache, **kwargs):
key = conf.get('hackage', name)
data = await cache.get_json(HACKAGE_URL % key)
return data['normal-version'][0] |
load(
"//scala:advanced_usage/providers.bzl",
_ScalaRulePhase = "ScalaRulePhase",
)
load(
"//scala/private:phases/phases.bzl",
_phase_bloop = "phase_bloop",
)
ext_add_phase_bloop = {
"attrs": {
# "bloopDir": attr.label(
# allow_single_file = True,
# doc = "Bloop output folder",
# ),
"_bloop": attr.label(
cfg = "host",
default = "//scala/bloop",
executable = True,
),
# "_runner": attr.label(
# allow_single_file = True,
# default = "//scala/bloop:runner",
# ),
# "_testrunner": attr.label(
# allow_single_file = True,
# default = "//scala/bloop:testrunner",
# ),
# "format": attr.bool(
# default = False,
# ),
},
"phase_providers": [
"//scala/bloop:add_phase_bloop",
],
}
def _add_phase_bloop_singleton_implementation(ctx):
return [
_ScalaRulePhase(
custom_phases = [
#TODO plan is to make it a phase at the end then replace it later. Use phases before compile.
("=", "compile", "compile", _phase_bloop),
# ("$", "", "bloop", _phase_bloop)
# ("after", "compile", "bloop", _phase_bloop)
],
),
]
add_phase_bloop_singleton = rule(
implementation = _add_phase_bloop_singleton_implementation,
)
| load('//scala:advanced_usage/providers.bzl', _ScalaRulePhase='ScalaRulePhase')
load('//scala/private:phases/phases.bzl', _phase_bloop='phase_bloop')
ext_add_phase_bloop = {'attrs': {'_bloop': attr.label(cfg='host', default='//scala/bloop', executable=True)}, 'phase_providers': ['//scala/bloop:add_phase_bloop']}
def _add_phase_bloop_singleton_implementation(ctx):
return [__scala_rule_phase(custom_phases=[('=', 'compile', 'compile', _phase_bloop)])]
add_phase_bloop_singleton = rule(implementation=_add_phase_bloop_singleton_implementation) |
angka = {
0: 'tepat',
1: 'satu',
2: 'dua',
3: 'tiga',
4: 'empat',
5: 'lima',
6: 'enam',
7: 'tujuh',
8: 'delapan',
9: 'sembilan',
10: 'sepuluh',
11: 'sebelas',
12: 'dua belas',
}
def eja(n):
lut1 = ['nol', 'satu', 'dua', 'tiga', 'empat',
'lima', 'enam', 'tujuh', 'delapan', 'sembilan',
'sepuluh', 'sebelas', 'dua belas', 'tiga belas',
'empat belas', 'lima belas', 'enam belas',
'tujuh belas', 'delapan belas', 'sembilan belas']
lut20 = ['x', 'x', 'dua puluh', 'tiga puluh', 'empat puluh',
'lima puluh', 'enam puluh', 'tujuh puluh', 'delapan puluh',
'sembilan puluh']
triples = ['x', 'ribu', 'juta', 'miliar',
'biliar', 'quadrillion', 'quintillion',
'sextillion', 'septillion', 'octillion',
'nonillion', 'decillion']
words = []
shift = 0
hasNumber = False
insertpos = -1
while n > 0:
ones = n % 10
shiftmod = shift % 3
shiftdiv = shift / 3
if shiftdiv > 0 and shiftmod == 0:
insertpos = len(words)
hasNumber = False
if shiftmod == 2 and ones > 0:
words.append('ratus')
words.append(lut1[ones])
hasNumber = True
if shiftmod == 1 and ones > 0:
words.append(lut20[ones])
hasNumber = True
if shiftmod == 0:
tens = n % 100
if 0 < tens < 20:
words.append(lut1[tens])
shift += 1
n = n / 10
hasNumber = True
elif ones > 0:
words.append(lut1[ones])
hasNumber = True
if hasNumber and insertpos >= 0:
words.insert(insertpos, triples[shiftdiv])
insertpos = -1
hasNumber = False
n = n / 10
shift += 1
# oldones = ones
words.reverse()
text = ' '.join(words)
result = text.split(' ')
return result
# return words if words else ['nol']
def mid(n):
"around `n` +/- 1"
return [n-1, n, n+1]
def ucapkan(h, m):
# jam = angka.get(h)
# menit = angka.get(m)
jam = eja(h)
menit = eja(m)
waktu = []
if m in mid(0) + [59]:
waktu = [jam, 'tepat']
elif m in mid(15):
waktu = [jam, 'seperempat']
elif m in mid(30):
jam = eja(h+1)
waktu = ['setengah', jam]
elif m in mid(45):
jam = eja(h+1)
waktu = [jam, 'kurang', 'seperempat']
elif m < 30:
waktu = [jam, 'lebih', menit]
else:
# waktu = [jam, menit]
jam = eja(h+1)
menit = eja(abs(60-m))
waktu = [jam, 'kurang', menit]
return flattened(waktu)
def flattened(arr):
words = []
for r in arr:
if isinstance(r, list):
words += r
else:
words.append(r)
text = ' '.join(words)
result = text.split(' ')
return result
| angka = {0: 'tepat', 1: 'satu', 2: 'dua', 3: 'tiga', 4: 'empat', 5: 'lima', 6: 'enam', 7: 'tujuh', 8: 'delapan', 9: 'sembilan', 10: 'sepuluh', 11: 'sebelas', 12: 'dua belas'}
def eja(n):
lut1 = ['nol', 'satu', 'dua', 'tiga', 'empat', 'lima', 'enam', 'tujuh', 'delapan', 'sembilan', 'sepuluh', 'sebelas', 'dua belas', 'tiga belas', 'empat belas', 'lima belas', 'enam belas', 'tujuh belas', 'delapan belas', 'sembilan belas']
lut20 = ['x', 'x', 'dua puluh', 'tiga puluh', 'empat puluh', 'lima puluh', 'enam puluh', 'tujuh puluh', 'delapan puluh', 'sembilan puluh']
triples = ['x', 'ribu', 'juta', 'miliar', 'biliar', 'quadrillion', 'quintillion', 'sextillion', 'septillion', 'octillion', 'nonillion', 'decillion']
words = []
shift = 0
has_number = False
insertpos = -1
while n > 0:
ones = n % 10
shiftmod = shift % 3
shiftdiv = shift / 3
if shiftdiv > 0 and shiftmod == 0:
insertpos = len(words)
has_number = False
if shiftmod == 2 and ones > 0:
words.append('ratus')
words.append(lut1[ones])
has_number = True
if shiftmod == 1 and ones > 0:
words.append(lut20[ones])
has_number = True
if shiftmod == 0:
tens = n % 100
if 0 < tens < 20:
words.append(lut1[tens])
shift += 1
n = n / 10
has_number = True
elif ones > 0:
words.append(lut1[ones])
has_number = True
if hasNumber and insertpos >= 0:
words.insert(insertpos, triples[shiftdiv])
insertpos = -1
has_number = False
n = n / 10
shift += 1
words.reverse()
text = ' '.join(words)
result = text.split(' ')
return result
def mid(n):
"""around `n` +/- 1"""
return [n - 1, n, n + 1]
def ucapkan(h, m):
jam = eja(h)
menit = eja(m)
waktu = []
if m in mid(0) + [59]:
waktu = [jam, 'tepat']
elif m in mid(15):
waktu = [jam, 'seperempat']
elif m in mid(30):
jam = eja(h + 1)
waktu = ['setengah', jam]
elif m in mid(45):
jam = eja(h + 1)
waktu = [jam, 'kurang', 'seperempat']
elif m < 30:
waktu = [jam, 'lebih', menit]
else:
jam = eja(h + 1)
menit = eja(abs(60 - m))
waktu = [jam, 'kurang', menit]
return flattened(waktu)
def flattened(arr):
words = []
for r in arr:
if isinstance(r, list):
words += r
else:
words.append(r)
text = ' '.join(words)
result = text.split(' ')
return result |
#!/usr/bin/env python
# coding: utf-8
# In[99]:
class TreeNode:
def __init__(self, val = None, par = None):
self.left = None
self.right = None
self.value = val
self.parent = par
def left_child(self):
return self.left
def right_child(self):
return self.right
def set_value(self, val):
self.value = val
def get_value(self):
return self.value
def set_left(self, node):
self.left = node
node.parent = self
return node
def set_right(self, node):
self.right = node
node.parent = self
return node
def get_parent(self):
return self.parent
def level(self):
result = 0
temp = self
while temp.parent is not None:
temp = temp.parent
result += 1
return result
def add(self, item):
if item < self.get_value() :
if self.left_child() is None:
self.set_left(TreeNode(item))
else:
self.left_child().add(item)
else:
if self.right_child() is None:
self.set_right(TreeNode(item))
else:
self.right_child().add(item)
def preOrder(self, resultList):
resultList.append(self.value)
if self.left_child() is not None:
self.left_child().preOrder(resultList)
if self.right_child() is not None:
self.right_child().preOrder(resultList)
def inOrder(self, resultList):
if self.left_child() is not None:
self.left_child().inOrder(resultList)
resultList.append(self.value)
if self.right_child() is not None:
self.right_child().inOrder(resultList)
def postOrder(self, resultList):
if self.left_child() is not None:
self.left_child().postOrder(resultList)
if self.right_child() is not None:
self.right_child().postOrder(resultList)
resultList.append(self.value)
def find(self, item):
if self.value == item:
return self.value
elif item < self.value:
if self.left_child() is not None:
return self.left_child().find(item)
else:
raise ValueError()
else:
if self.right_child() is not None:
return self.right_child().find(item)
else:
raise ValueError()
def preOrderStr(self):
if self.left_child() is not None:
self.left_child().preOrderStr()
if self.right_child() is not None:
self.right_child().preOrderStr()
print("".ljust(self.level()*2), str(self.value))
def __str__(self):
return str(self.value)
# In[107]:
class Pair:
''' Encapsulate letter,count pair as a single entity.
Realtional methods make this object comparable
using built-in operators.
'''
def __init__(self, letter, count = 1):
self.letter = letter
self.count = count
def __eq__(self, other):
return self.letter == other.letter
def __hash__(self):
return hash(self.letter)
def __ne__(self, other):
return self.letter != other.letter
def __lt__(self, other):
return self.letter < other.letter
def __le__(self, other):
return self.letter <= other.letter
def __gt__(self, other):
return self.letter > other.letter
def __ge__(self, other):
return self.letter >= other.letter
def __repr__(self):
return f'({self.letter}, {self.count})'
def __str__(self):
return f'({self.letter}, {self.count})'
class BinarySearchTree:
def __init__(self):
self.root = None
def is_empty(self):
return self.root is None
def size(self):
return self.__size(self.root)
def __size(self, node):
if node is None:
return 0
result = 1
result += self.__size(node.left)
result += self.__size(node.right)
return result
def add(self, item):
if self.root is None:
self.root = TreeNode(item)
else:
self.root.add(item)
return self.root
def find(self, item):
if self.root is not None:
return self.root.find(item)
raise ValueError()
def remove(self, item):
return self.__remove(self.root, item)
def __remove(self, node, item):
if node is None:
return node
if item < node.get_value():
node.set_left(self.__remove(node.left_child(), item))
elif item > node.get_value():
node.set_right(self.__remove(node.right_child(), item))
else:
if node.left_child() is None:
temp = node.right_child()
if temp is not None:
temp.parent = node.parent
node = None
return temp
elif node.right_child() is None:
temp = node.left_child()
if temp is not None:
temp.parent = node.parent
node = None
return temp
else:
minNode = self.__minValueNode(node.right_child())
node.set_value(minNode.get_value())
node.set_right(self.__remove(node.right_child(), minNode.get_value()))
return node
def __minValueNode(self, node):
current = node
while (current.left_child() is not None):
current = current.left_child()
return current
def inOrder(self):
result = []
if self.root is not None:
self.root.inOrder(result)
return result
def preOrder(self):
result = []
if self.root is not None:
self.root.preOrder(result)
return result
def postOrder(self):
result = []
if self.root is not None:
self.root.postOrder(result)
return result
def rebalance(self):
orderedList = self.inOrder()
self.root = None
self.__rebalance(orderedList, 0, len(orderedList) - 1)
def __rebalance(self, orderedList, low, high):
if (low <= high):
mid = (high - low) // 2 + low
self.add(orderedList[mid])
self.__rebalance(orderedList, low, mid - 1)
self.__rebalance(orderedList, mid + 1, high)
def height(self):
return self.__recursiveHeight(self.root, 0)
def __recursiveHeight(self, node, current):
leftValue = current
rightValue = current
if node.left_child() is not None:
leftValue = self.__recursiveHeight(node.left, current + 1)
if node.right_child() is not None:
rightValue = self.__recursiveHeight(node.right, current + 1)
return max(leftValue, rightValue)
def __strInsert(self, value, position, char):
return str(value[:position] + char + value[position + 1:])
def __str__(self):
# if self.root is not None:
# self.root.preOrderStr()
# return ""
totalLayers = self.height() + 1
totalWidth = (2 ** totalLayers) * 2
nodePosition = [None] * (totalLayers)
for i in range(totalLayers):
nodePosition[i] = [None] * (2 ** i)
for j in range(2 ** i):
nodePosition[i][j] = [0] * 3
lastLayer = nodePosition[totalLayers - 1]
gap = totalWidth // len(lastLayer)
for i in range(len(lastLayer)):
lastLayer[i][0] = i * gap
lastLayer[i][1] = lastLayer[i][0]
lastLayer[i][2] = lastLayer[i][0]
for i in reversed(range(totalLayers - 1)):
for j in range(len(nodePosition[i])):
first = nodePosition[i + 1][j * 2][0]
second = nodePosition[i + 1][j * 2 + 1][0]
nodePosition[i][j][1] = first + 1
nodePosition[i][j][2] = second - 1
nodePosition[i][j][0] = ((second - first) // 2) + first
result = [""] * (totalLayers * 2)
for i in range(1, len(result), 2):
for j in range(totalWidth):
result[i] += " "
self.__nodePrettyPrint(result, self.root, [0] * (totalLayers), nodePosition, ' ')
return "\n".join(result)
def __nodePrettyPrint(self, result, node, nodeList, nodePosition, char):
level = node.level()
startLine = nodePosition[level][nodeList[level]][1]
endLine = nodePosition[level][nodeList[level]][2]
position = nodePosition[level][nodeList[level]][0]
resultLevel = level * 2
nodeList[level] += 1
currentLen = len(result[resultLevel])
for i in range(currentLen - 1, startLine):
result[resultLevel] += " "
for i in range(startLine, position):
result[resultLevel] += "_"
result[resultLevel] += str(node.get_value())
for i in range(position + len(str(node.get_value())), endLine):
result[resultLevel] += "_"
result[resultLevel + 1] = self.__strInsert(result[resultLevel + 1], startLine, '/')
if (endLine == startLine):
endLine += len(str(node.get_value()))
result[resultLevel + 1] = self.__strInsert(result[resultLevel + 1], endLine + 1, '\\')
if (node.left_child() is not None):
self.__nodePrettyPrint(result, node.left_child(), nodeList, nodePosition, '/')
elif (level + 1) < len(nodeList):
nextLevel = level + 1
capacity = 1
while nextLevel < len(nodeList):
nodeList[nextLevel] += capacity
capacity *= 2
nextLevel += 1
if (node.right_child() is not None):
self.__nodePrettyPrint(result, node.right_child(), nodeList, nodePosition, '\\')
elif (level + 1) < len(nodeList):
nextLevel = level + 1
capacity = 1
while nextLevel < len(nodeList):
nodeList[nextLevel] += capacity
capacity *= 2
nextLevel += 1
# In[109]:
myTree = BinarySearchTree()
myTree.add(12)
myTree.add(7)
myTree.add(20)
myTree.add(99)
myTree.add(32)
myTree.add(46)
print(myTree)
myTree.rebalance()
print(myTree)
myTree.remove(46)
print()
print(myTree)
myTree.remove(20)
print()
print(myTree)
# "C:\\Users\\Tavish\\Documents\\School\\Teaching\\CS_2420\\Project5\\around-the-world-in-80-days-3.txt"
myTree = BinarySearchTree()
with open("D:\\UVU\\Code\\Fall2020\\Child-Stuff\\CS2420\\Mod5\\P5\\around-the-world-in-80-days-3.txt", "r") as f:
while True:
c = f.read(1)
if not c:
break
if c.isalnum():
try:
found = myTree.find(Pair(c))
found.count += 1
except ValueError:
myTree.add(Pair(c))
# myTree.rebalance()
# print(myTree)
# In[ ]:
# In[ ]:
| class Treenode:
def __init__(self, val=None, par=None):
self.left = None
self.right = None
self.value = val
self.parent = par
def left_child(self):
return self.left
def right_child(self):
return self.right
def set_value(self, val):
self.value = val
def get_value(self):
return self.value
def set_left(self, node):
self.left = node
node.parent = self
return node
def set_right(self, node):
self.right = node
node.parent = self
return node
def get_parent(self):
return self.parent
def level(self):
result = 0
temp = self
while temp.parent is not None:
temp = temp.parent
result += 1
return result
def add(self, item):
if item < self.get_value():
if self.left_child() is None:
self.set_left(tree_node(item))
else:
self.left_child().add(item)
elif self.right_child() is None:
self.set_right(tree_node(item))
else:
self.right_child().add(item)
def pre_order(self, resultList):
resultList.append(self.value)
if self.left_child() is not None:
self.left_child().preOrder(resultList)
if self.right_child() is not None:
self.right_child().preOrder(resultList)
def in_order(self, resultList):
if self.left_child() is not None:
self.left_child().inOrder(resultList)
resultList.append(self.value)
if self.right_child() is not None:
self.right_child().inOrder(resultList)
def post_order(self, resultList):
if self.left_child() is not None:
self.left_child().postOrder(resultList)
if self.right_child() is not None:
self.right_child().postOrder(resultList)
resultList.append(self.value)
def find(self, item):
if self.value == item:
return self.value
elif item < self.value:
if self.left_child() is not None:
return self.left_child().find(item)
else:
raise value_error()
elif self.right_child() is not None:
return self.right_child().find(item)
else:
raise value_error()
def pre_order_str(self):
if self.left_child() is not None:
self.left_child().preOrderStr()
if self.right_child() is not None:
self.right_child().preOrderStr()
print(''.ljust(self.level() * 2), str(self.value))
def __str__(self):
return str(self.value)
class Pair:
""" Encapsulate letter,count pair as a single entity.
Realtional methods make this object comparable
using built-in operators.
"""
def __init__(self, letter, count=1):
self.letter = letter
self.count = count
def __eq__(self, other):
return self.letter == other.letter
def __hash__(self):
return hash(self.letter)
def __ne__(self, other):
return self.letter != other.letter
def __lt__(self, other):
return self.letter < other.letter
def __le__(self, other):
return self.letter <= other.letter
def __gt__(self, other):
return self.letter > other.letter
def __ge__(self, other):
return self.letter >= other.letter
def __repr__(self):
return f'({self.letter}, {self.count})'
def __str__(self):
return f'({self.letter}, {self.count})'
class Binarysearchtree:
def __init__(self):
self.root = None
def is_empty(self):
return self.root is None
def size(self):
return self.__size(self.root)
def __size(self, node):
if node is None:
return 0
result = 1
result += self.__size(node.left)
result += self.__size(node.right)
return result
def add(self, item):
if self.root is None:
self.root = tree_node(item)
else:
self.root.add(item)
return self.root
def find(self, item):
if self.root is not None:
return self.root.find(item)
raise value_error()
def remove(self, item):
return self.__remove(self.root, item)
def __remove(self, node, item):
if node is None:
return node
if item < node.get_value():
node.set_left(self.__remove(node.left_child(), item))
elif item > node.get_value():
node.set_right(self.__remove(node.right_child(), item))
elif node.left_child() is None:
temp = node.right_child()
if temp is not None:
temp.parent = node.parent
node = None
return temp
elif node.right_child() is None:
temp = node.left_child()
if temp is not None:
temp.parent = node.parent
node = None
return temp
else:
min_node = self.__minValueNode(node.right_child())
node.set_value(minNode.get_value())
node.set_right(self.__remove(node.right_child(), minNode.get_value()))
return node
def __min_value_node(self, node):
current = node
while current.left_child() is not None:
current = current.left_child()
return current
def in_order(self):
result = []
if self.root is not None:
self.root.inOrder(result)
return result
def pre_order(self):
result = []
if self.root is not None:
self.root.preOrder(result)
return result
def post_order(self):
result = []
if self.root is not None:
self.root.postOrder(result)
return result
def rebalance(self):
ordered_list = self.inOrder()
self.root = None
self.__rebalance(orderedList, 0, len(orderedList) - 1)
def __rebalance(self, orderedList, low, high):
if low <= high:
mid = (high - low) // 2 + low
self.add(orderedList[mid])
self.__rebalance(orderedList, low, mid - 1)
self.__rebalance(orderedList, mid + 1, high)
def height(self):
return self.__recursiveHeight(self.root, 0)
def __recursive_height(self, node, current):
left_value = current
right_value = current
if node.left_child() is not None:
left_value = self.__recursiveHeight(node.left, current + 1)
if node.right_child() is not None:
right_value = self.__recursiveHeight(node.right, current + 1)
return max(leftValue, rightValue)
def __str_insert(self, value, position, char):
return str(value[:position] + char + value[position + 1:])
def __str__(self):
total_layers = self.height() + 1
total_width = 2 ** totalLayers * 2
node_position = [None] * totalLayers
for i in range(totalLayers):
nodePosition[i] = [None] * 2 ** i
for j in range(2 ** i):
nodePosition[i][j] = [0] * 3
last_layer = nodePosition[totalLayers - 1]
gap = totalWidth // len(lastLayer)
for i in range(len(lastLayer)):
lastLayer[i][0] = i * gap
lastLayer[i][1] = lastLayer[i][0]
lastLayer[i][2] = lastLayer[i][0]
for i in reversed(range(totalLayers - 1)):
for j in range(len(nodePosition[i])):
first = nodePosition[i + 1][j * 2][0]
second = nodePosition[i + 1][j * 2 + 1][0]
nodePosition[i][j][1] = first + 1
nodePosition[i][j][2] = second - 1
nodePosition[i][j][0] = (second - first) // 2 + first
result = [''] * (totalLayers * 2)
for i in range(1, len(result), 2):
for j in range(totalWidth):
result[i] += ' '
self.__nodePrettyPrint(result, self.root, [0] * totalLayers, nodePosition, ' ')
return '\n'.join(result)
def __node_pretty_print(self, result, node, nodeList, nodePosition, char):
level = node.level()
start_line = nodePosition[level][nodeList[level]][1]
end_line = nodePosition[level][nodeList[level]][2]
position = nodePosition[level][nodeList[level]][0]
result_level = level * 2
nodeList[level] += 1
current_len = len(result[resultLevel])
for i in range(currentLen - 1, startLine):
result[resultLevel] += ' '
for i in range(startLine, position):
result[resultLevel] += '_'
result[resultLevel] += str(node.get_value())
for i in range(position + len(str(node.get_value())), endLine):
result[resultLevel] += '_'
result[resultLevel + 1] = self.__strInsert(result[resultLevel + 1], startLine, '/')
if endLine == startLine:
end_line += len(str(node.get_value()))
result[resultLevel + 1] = self.__strInsert(result[resultLevel + 1], endLine + 1, '\\')
if node.left_child() is not None:
self.__nodePrettyPrint(result, node.left_child(), nodeList, nodePosition, '/')
elif level + 1 < len(nodeList):
next_level = level + 1
capacity = 1
while nextLevel < len(nodeList):
nodeList[nextLevel] += capacity
capacity *= 2
next_level += 1
if node.right_child() is not None:
self.__nodePrettyPrint(result, node.right_child(), nodeList, nodePosition, '\\')
elif level + 1 < len(nodeList):
next_level = level + 1
capacity = 1
while nextLevel < len(nodeList):
nodeList[nextLevel] += capacity
capacity *= 2
next_level += 1
my_tree = binary_search_tree()
myTree.add(12)
myTree.add(7)
myTree.add(20)
myTree.add(99)
myTree.add(32)
myTree.add(46)
print(myTree)
myTree.rebalance()
print(myTree)
myTree.remove(46)
print()
print(myTree)
myTree.remove(20)
print()
print(myTree)
my_tree = binary_search_tree()
with open('D:\\UVU\\Code\\Fall2020\\Child-Stuff\\CS2420\\Mod5\\P5\\around-the-world-in-80-days-3.txt', 'r') as f:
while True:
c = f.read(1)
if not c:
break
if c.isalnum():
try:
found = myTree.find(pair(c))
found.count += 1
except ValueError:
myTree.add(pair(c)) |
ColorNames = \
{ u'aliceblue': (240, 248, 255),
u'antiquewhite': (250, 235, 215),
u'aqua': (0, 255, 255),
u'aquamarine': (127, 255, 212),
u'azure': (240, 255, 255),
u'beige': (245, 245, 220),
u'bisque': (255, 228, 196),
u'black': (0, 0, 0),
u'blanchedalmond': (255, 235, 205),
u'blue': (0, 0, 255),
u'blueviolet': (138, 43, 226),
u'brown': (165, 42, 42),
u'burlywood': (222, 184, 135),
u'cadetblue': (95, 158, 160),
u'chartreuse': (127, 255, 0),
u'chocolate': (210, 105, 30),
u'coral': (255, 127, 80),
u'cornflowerblue': (100, 149, 237),
u'cornsilk': (255, 248, 220),
u'crimson': (220, 20, 60),
u'cyan': (0, 255, 255),
u'darkblue': (0, 0, 139),
u'darkcyan': (0, 139, 139),
u'darkgoldenrod': (184, 134, 11),
u'darkgray': (169, 169, 169),
u'darkgreen': (0, 100, 0),
u'darkgrey': (169, 169, 169),
u'darkkhaki': (189, 183, 107),
u'darkmagenta': (139, 0, 139),
u'darkolivegreen': (85, 107, 47),
u'darkorange': (255, 140, 0),
u'darkorchid': (153, 50, 204),
u'darkred': (139, 0, 0),
u'darksalmon': (233, 150, 122),
u'darkseagreen': (143, 188, 143),
u'darkslateblue': (72, 61, 139),
u'darkslategray': (47, 79, 79),
u'darkslategrey': (47, 79, 79),
u'darkturquoise': (0, 206, 209),
u'darkviolet': (148, 0, 211),
u'deeppink': (255, 20, 147),
u'deepskyblue': (0, 191, 255),
u'dimgray': (105, 105, 105),
u'dimgrey': (105, 105, 105),
u'dodgerblue': (30, 144, 255),
u'firebrick': (178, 34, 34),
u'floralwhite': (255, 250, 240),
u'forestgreen': (34, 139, 34),
u'fuchsia': (255, 0, 255),
u'gainsboro': (220, 220, 220),
u'ghostwhite': (248, 248, 255),
u'gold': (255, 215, 0),
u'goldenrod': (218, 165, 32),
u'gray': (128, 128, 128),
u'green': (0, 128, 0),
u'greenyellow': (173, 255, 47),
u'grey': (128, 128, 128),
u'honeydew': (240, 255, 240),
u'hotpink': (255, 105, 180),
u'indianred': (205, 92, 92),
u'indigo': (75, 0, 130),
u'ivory': (255, 255, 240),
u'khaki': (240, 230, 140),
u'lavender': (230, 230, 250),
u'lavenderblush': (255, 240, 245),
u'lawngreen': (124, 252, 0),
u'lemonchiffon': (255, 250, 205),
u'lightblue': (173, 216, 230),
u'lightcoral': (240, 128, 128),
u'lightcyan': (224, 255, 255),
u'lightgoldenrodyellow': (250, 250, 210),
u'lightgray': (211, 211, 211),
u'lightgreen': (144, 238, 144),
u'lightgrey': (211, 211, 211),
u'lightpink': (255, 182, 193),
u'lightsalmon': (255, 160, 122),
u'lightseagreen': (32, 178, 170),
u'lightskyblue': (135, 206, 250),
u'lightslategray': (119, 136, 153),
u'lightslategrey': (119, 136, 153),
u'lightsteelblue': (176, 196, 222),
u'lightyellow': (255, 255, 224),
u'lime': (0, 255, 0),
u'limegreen': (50, 205, 50),
u'linen': (250, 240, 230),
u'magenta': (255, 0, 255),
u'maroon': (128, 0, 0),
u'mediumaquamarine': (102, 205, 170),
u'mediumblue': (0, 0, 205),
u'mediumorchid': (186, 85, 211),
u'mediumpurple': (147, 112, 219),
u'mediumseagreen': (60, 179, 113),
u'mediumslateblue': (123, 104, 238),
u'mediumspringgreen': (0, 250, 154),
u'mediumturquoise': (72, 209, 204),
u'mediumvioletred': (199, 21, 133),
u'midnightblue': (25, 25, 112),
u'mintcream': (245, 255, 250),
u'mistyrose': (255, 228, 225),
u'moccasin': (255, 228, 181),
u'navajowhite': (255, 222, 173),
u'navy': (0, 0, 128),
u'oldlace': (253, 245, 230),
u'olive': (128, 128, 0),
u'olivedrab': (107, 142, 35),
u'orange': (255, 165, 0),
u'orangered': (255, 69, 0),
u'orchid': (218, 112, 214),
u'palegoldenrod': (238, 232, 170),
u'palegreen': (152, 251, 152),
u'paleturquoise': (175, 238, 238),
u'palevioletred': (219, 112, 147),
u'papayawhip': (255, 239, 213),
u'peachpuff': (255, 218, 185),
u'peru': (205, 133, 63),
u'pink': (255, 192, 203),
u'plum': (221, 160, 221),
u'powderblue': (176, 224, 230),
u'purple': (128, 0, 128),
u'red': (255, 0, 0),
u'rosybrown': (188, 143, 143),
u'royalblue': (65, 105, 225),
u'saddlebrown': (139, 69, 19),
u'salmon': (250, 128, 114),
u'sandybrown': (244, 164, 96),
u'seagreen': (46, 139, 87),
u'seashell': (255, 245, 238),
u'sienna': (160, 82, 45),
u'silver': (192, 192, 192),
u'skyblue': (135, 206, 235),
u'slateblue': (106, 90, 205),
u'slategray': (112, 128, 144),
u'slategrey': (112, 128, 144),
u'snow': (255, 250, 250),
u'springgreen': (0, 255, 127),
u'steelblue': (70, 130, 180),
u'tan': (210, 180, 140),
u'teal': (0, 128, 128),
u'thistle': (216, 191, 216),
u'tomato': (255, 99, 71),
u'turquoise': (64, 224, 208),
u'violet': (238, 130, 238),
u'wheat': (245, 222, 179),
u'white': (255, 255, 255),
u'whitesmoke': (245, 245, 245),
u'yellow': (255, 255, 0),
u'yellowgreen': (154, 205, 50)}
| color_names = {u'aliceblue': (240, 248, 255), u'antiquewhite': (250, 235, 215), u'aqua': (0, 255, 255), u'aquamarine': (127, 255, 212), u'azure': (240, 255, 255), u'beige': (245, 245, 220), u'bisque': (255, 228, 196), u'black': (0, 0, 0), u'blanchedalmond': (255, 235, 205), u'blue': (0, 0, 255), u'blueviolet': (138, 43, 226), u'brown': (165, 42, 42), u'burlywood': (222, 184, 135), u'cadetblue': (95, 158, 160), u'chartreuse': (127, 255, 0), u'chocolate': (210, 105, 30), u'coral': (255, 127, 80), u'cornflowerblue': (100, 149, 237), u'cornsilk': (255, 248, 220), u'crimson': (220, 20, 60), u'cyan': (0, 255, 255), u'darkblue': (0, 0, 139), u'darkcyan': (0, 139, 139), u'darkgoldenrod': (184, 134, 11), u'darkgray': (169, 169, 169), u'darkgreen': (0, 100, 0), u'darkgrey': (169, 169, 169), u'darkkhaki': (189, 183, 107), u'darkmagenta': (139, 0, 139), u'darkolivegreen': (85, 107, 47), u'darkorange': (255, 140, 0), u'darkorchid': (153, 50, 204), u'darkred': (139, 0, 0), u'darksalmon': (233, 150, 122), u'darkseagreen': (143, 188, 143), u'darkslateblue': (72, 61, 139), u'darkslategray': (47, 79, 79), u'darkslategrey': (47, 79, 79), u'darkturquoise': (0, 206, 209), u'darkviolet': (148, 0, 211), u'deeppink': (255, 20, 147), u'deepskyblue': (0, 191, 255), u'dimgray': (105, 105, 105), u'dimgrey': (105, 105, 105), u'dodgerblue': (30, 144, 255), u'firebrick': (178, 34, 34), u'floralwhite': (255, 250, 240), u'forestgreen': (34, 139, 34), u'fuchsia': (255, 0, 255), u'gainsboro': (220, 220, 220), u'ghostwhite': (248, 248, 255), u'gold': (255, 215, 0), u'goldenrod': (218, 165, 32), u'gray': (128, 128, 128), u'green': (0, 128, 0), u'greenyellow': (173, 255, 47), u'grey': (128, 128, 128), u'honeydew': (240, 255, 240), u'hotpink': (255, 105, 180), u'indianred': (205, 92, 92), u'indigo': (75, 0, 130), u'ivory': (255, 255, 240), u'khaki': (240, 230, 140), u'lavender': (230, 230, 250), u'lavenderblush': (255, 240, 245), u'lawngreen': (124, 252, 0), u'lemonchiffon': (255, 250, 205), u'lightblue': (173, 216, 230), u'lightcoral': (240, 128, 128), u'lightcyan': (224, 255, 255), u'lightgoldenrodyellow': (250, 250, 210), u'lightgray': (211, 211, 211), u'lightgreen': (144, 238, 144), u'lightgrey': (211, 211, 211), u'lightpink': (255, 182, 193), u'lightsalmon': (255, 160, 122), u'lightseagreen': (32, 178, 170), u'lightskyblue': (135, 206, 250), u'lightslategray': (119, 136, 153), u'lightslategrey': (119, 136, 153), u'lightsteelblue': (176, 196, 222), u'lightyellow': (255, 255, 224), u'lime': (0, 255, 0), u'limegreen': (50, 205, 50), u'linen': (250, 240, 230), u'magenta': (255, 0, 255), u'maroon': (128, 0, 0), u'mediumaquamarine': (102, 205, 170), u'mediumblue': (0, 0, 205), u'mediumorchid': (186, 85, 211), u'mediumpurple': (147, 112, 219), u'mediumseagreen': (60, 179, 113), u'mediumslateblue': (123, 104, 238), u'mediumspringgreen': (0, 250, 154), u'mediumturquoise': (72, 209, 204), u'mediumvioletred': (199, 21, 133), u'midnightblue': (25, 25, 112), u'mintcream': (245, 255, 250), u'mistyrose': (255, 228, 225), u'moccasin': (255, 228, 181), u'navajowhite': (255, 222, 173), u'navy': (0, 0, 128), u'oldlace': (253, 245, 230), u'olive': (128, 128, 0), u'olivedrab': (107, 142, 35), u'orange': (255, 165, 0), u'orangered': (255, 69, 0), u'orchid': (218, 112, 214), u'palegoldenrod': (238, 232, 170), u'palegreen': (152, 251, 152), u'paleturquoise': (175, 238, 238), u'palevioletred': (219, 112, 147), u'papayawhip': (255, 239, 213), u'peachpuff': (255, 218, 185), u'peru': (205, 133, 63), u'pink': (255, 192, 203), u'plum': (221, 160, 221), u'powderblue': (176, 224, 230), u'purple': (128, 0, 128), u'red': (255, 0, 0), u'rosybrown': (188, 143, 143), u'royalblue': (65, 105, 225), u'saddlebrown': (139, 69, 19), u'salmon': (250, 128, 114), u'sandybrown': (244, 164, 96), u'seagreen': (46, 139, 87), u'seashell': (255, 245, 238), u'sienna': (160, 82, 45), u'silver': (192, 192, 192), u'skyblue': (135, 206, 235), u'slateblue': (106, 90, 205), u'slategray': (112, 128, 144), u'slategrey': (112, 128, 144), u'snow': (255, 250, 250), u'springgreen': (0, 255, 127), u'steelblue': (70, 130, 180), u'tan': (210, 180, 140), u'teal': (0, 128, 128), u'thistle': (216, 191, 216), u'tomato': (255, 99, 71), u'turquoise': (64, 224, 208), u'violet': (238, 130, 238), u'wheat': (245, 222, 179), u'white': (255, 255, 255), u'whitesmoke': (245, 245, 245), u'yellow': (255, 255, 0), u'yellowgreen': (154, 205, 50)} |
# https://stackoverflow.com/questions/63626389/how-to-sort-points-along-a-hilbert-curve-without-using-hilbert-indices
N=9 # 9 points
n=2 # 2 dimension
m=3 # order of Hilbert curve
def BitTest(x,od):
result = x & (1 << od)
return int(bool(result))
def BitFlip(b,pos):
b ^= 1 << pos
return b
def partition(idx,A,st,en,od,ax,di):
i = st
j = en
while True:
while i < j and BitTest(A[i][ax],od) == di:
i = i + 1
while i < j and BitTest(A[j][ax],od) != di:
j = j - 1
if j <= i:
return i
A[i], A[j] = A[j], A[i]
idx[i], idx[j] = idx[j], idx[i]
def HSort(idx,A,st,en,od,c,e,d,di,cnt):
if en<=st:
return
p = partition(idx,A,st,en,od,(d+c)%n,BitTest(e,(d+c)%n))
if c==n-1:
if od==0:
return
d2= (d+n+n-(2 if di else cnt + 2)) % n
e=BitFlip(e,d2)
e=BitFlip(e,(d+c)%n)
HSort(idx,A,st,p-1,od-1,0,e,d2,False,0)
e=BitFlip(e,(d+c)%n)
e=BitFlip(e,d2)
d2= (d+n+n-(cnt + 2 if di else 2))%n
HSort(idx,A,p,en,od-1,0,e,d2,False,0)
else:
HSort(idx,A,st,p-1,od,c+1,e,d,False,(1 if di else cnt+1))
e=BitFlip(e,(d+c)%n)
e=BitFlip(e,(d+c+1)%n)
HSort(idx,A,p,en,od,c+1,e,d,True,(cnt+1 if di else 1))
e=BitFlip(e,(d+c+1)%n)
e=BitFlip(e,(d+c)%n)
# array = [[2,2],[2,4],[3,4],[2,5],[3,5],[1,6],[3,6],[5,6],[3,7]]
# HSort(array,st=0,en=N-1,od=m-1,c=0,e=0,d=0,di=False,cnt=0)
# print(array)
# if False:
# idx = self.recursive_sort(pca_X, n_components)
# pca_X = pca_X[idx]
# pca_X = np.array(pca_X) * 100000000
# pca_X = pca_X.astype(int)
# N=len(pca_X) # 9 points
# n=2 # 2 dimension
# m=10 # order of Hilbert curve
# idx = list(range(N))
# HSort(idx, pca_X,st=0,en=N-1,od=m-1,c=0,e=0,d=0,di=False,cnt=0)
# else: | n = 9
n = 2
m = 3
def bit_test(x, od):
result = x & 1 << od
return int(bool(result))
def bit_flip(b, pos):
b ^= 1 << pos
return b
def partition(idx, A, st, en, od, ax, di):
i = st
j = en
while True:
while i < j and bit_test(A[i][ax], od) == di:
i = i + 1
while i < j and bit_test(A[j][ax], od) != di:
j = j - 1
if j <= i:
return i
(A[i], A[j]) = (A[j], A[i])
(idx[i], idx[j]) = (idx[j], idx[i])
def h_sort(idx, A, st, en, od, c, e, d, di, cnt):
if en <= st:
return
p = partition(idx, A, st, en, od, (d + c) % n, bit_test(e, (d + c) % n))
if c == n - 1:
if od == 0:
return
d2 = (d + n + n - (2 if di else cnt + 2)) % n
e = bit_flip(e, d2)
e = bit_flip(e, (d + c) % n)
h_sort(idx, A, st, p - 1, od - 1, 0, e, d2, False, 0)
e = bit_flip(e, (d + c) % n)
e = bit_flip(e, d2)
d2 = (d + n + n - (cnt + 2 if di else 2)) % n
h_sort(idx, A, p, en, od - 1, 0, e, d2, False, 0)
else:
h_sort(idx, A, st, p - 1, od, c + 1, e, d, False, 1 if di else cnt + 1)
e = bit_flip(e, (d + c) % n)
e = bit_flip(e, (d + c + 1) % n)
h_sort(idx, A, p, en, od, c + 1, e, d, True, cnt + 1 if di else 1)
e = bit_flip(e, (d + c + 1) % n)
e = bit_flip(e, (d + c) % n) |
# Authorization data
host = '*****'
user = '*****'
passwd = '*****'
db = 'hr'
| host = '*****'
user = '*****'
passwd = '*****'
db = 'hr' |
#
# PySNMP MIB module ENTERASYS-VLAN-AUTHORIZATION-MIB (http://snmplabs.com/pysmi)
# ASN.1 source file:///Users/davwang4/Dev/mibs.snmplabs.com/asn1/ENTERASYS-VLAN-AUTHORIZATION-MIB
# Produced by pysmi-0.3.4 at Wed May 1 13:04:50 2019
# On host DAVWANG4-M-1475 platform Darwin version 18.5.0 by user davwang4
# Using Python version 3.7.3 (default, Mar 27 2019, 09:23:15)
#
OctetString, Integer, ObjectIdentifier = mibBuilder.importSymbols("ASN1", "OctetString", "Integer", "ObjectIdentifier")
NamedValues, = mibBuilder.importSymbols("ASN1-ENUMERATION", "NamedValues")
ConstraintsIntersection, ValueSizeConstraint, ConstraintsUnion, ValueRangeConstraint, SingleValueConstraint = mibBuilder.importSymbols("ASN1-REFINEMENT", "ConstraintsIntersection", "ValueSizeConstraint", "ConstraintsUnion", "ValueRangeConstraint", "SingleValueConstraint")
dot1dBasePortEntry, = mibBuilder.importSymbols("BRIDGE-MIB", "dot1dBasePortEntry")
etsysModules, = mibBuilder.importSymbols("ENTERASYS-MIB-NAMES", "etsysModules")
EnabledStatus, = mibBuilder.importSymbols("P-BRIDGE-MIB", "EnabledStatus")
NotificationGroup, ModuleCompliance, ObjectGroup = mibBuilder.importSymbols("SNMPv2-CONF", "NotificationGroup", "ModuleCompliance", "ObjectGroup")
MibIdentifier, Bits, NotificationType, IpAddress, TimeTicks, Counter64, iso, Integer32, Counter32, ObjectIdentity, Unsigned32, Gauge32, MibScalar, MibTable, MibTableRow, MibTableColumn, ModuleIdentity = mibBuilder.importSymbols("SNMPv2-SMI", "MibIdentifier", "Bits", "NotificationType", "IpAddress", "TimeTicks", "Counter64", "iso", "Integer32", "Counter32", "ObjectIdentity", "Unsigned32", "Gauge32", "MibScalar", "MibTable", "MibTableRow", "MibTableColumn", "ModuleIdentity")
DisplayString, TextualConvention = mibBuilder.importSymbols("SNMPv2-TC", "DisplayString", "TextualConvention")
etsysVlanAuthorizationMIB = ModuleIdentity((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48))
etsysVlanAuthorizationMIB.setRevisions(('2004-06-02 19:22',))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
if mibBuilder.loadTexts: etsysVlanAuthorizationMIB.setRevisionsDescriptions(('The initial version of this MIB module',))
if mibBuilder.loadTexts: etsysVlanAuthorizationMIB.setLastUpdated('200406021922Z')
if mibBuilder.loadTexts: etsysVlanAuthorizationMIB.setOrganization('Enterasys Networks, Inc')
if mibBuilder.loadTexts: etsysVlanAuthorizationMIB.setContactInfo('Postal: Enterasys Networks, Inc. 50 Minuteman Rd. Andover, MA 01810-1008 USA Phone: +1 978 684 1000 E-mail: [email protected] WWW: http://www.enterasys.com')
if mibBuilder.loadTexts: etsysVlanAuthorizationMIB.setDescription("This MIB module defines a portion of the SNMP MIB under Enterasys Networks' enterprise OID pertaining to proprietary extensions to the IETF Q-BRIDGE-MIB, as specified in RFC2674, pertaining to VLAN authorization, as specified in RFC3580. Specifically, the enabling and disabling of support for the VLAN Tunnel-Type attribute returned from a RADIUS authentication, and how that attribute is applied to the port which initiated the authentication.")
class VlanAuthEgressStatus(TextualConvention, Integer32):
description = 'The possible egress configurations which may be applied in response to a successful authentication. none(1) No egress manipulation will be made. tagged(2) The authenticating port will be added to the current egress for the VLAN-ID returned. untagged(3) The authenticating port will be added to the current untagged egress for the VLAN-ID returned. dynamic(4) The authenticating port will use information returned in the authentication response to modify the current egress lists.'
status = 'current'
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4))
namedValues = NamedValues(("none", 1), ("tagged", 2), ("untagged", 3), ("dynamic", 4))
etsysVlanAuthorizationObjects = MibIdentifier((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1))
etsysVlanAuthorizationSystem = MibIdentifier((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1, 1))
etsysVlanAuthorizationPorts = MibIdentifier((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1, 2))
etsysVlanAuthorizationEnable = MibScalar((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1, 1, 1), EnabledStatus().clone('disabled')).setMaxAccess("readwrite")
if mibBuilder.loadTexts: etsysVlanAuthorizationEnable.setStatus('current')
if mibBuilder.loadTexts: etsysVlanAuthorizationEnable.setDescription('The enable/disable state for the VLAN authorization feature. When disabled, no modifications to the VLAN attributes related to packet switching should be enforced.')
etsysVlanAuthorizationTable = MibTable((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1, 2, 1), )
if mibBuilder.loadTexts: etsysVlanAuthorizationTable.setStatus('current')
if mibBuilder.loadTexts: etsysVlanAuthorizationTable.setDescription('Extensions to the table that contains information about every port that is associated with this transparent bridge.')
etsysVlanAuthorizationEntry = MibTableRow((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1, 2, 1, 1), )
dot1dBasePortEntry.registerAugmentions(("ENTERASYS-VLAN-AUTHORIZATION-MIB", "etsysVlanAuthorizationEntry"))
etsysVlanAuthorizationEntry.setIndexNames(*dot1dBasePortEntry.getIndexNames())
if mibBuilder.loadTexts: etsysVlanAuthorizationEntry.setStatus('current')
if mibBuilder.loadTexts: etsysVlanAuthorizationEntry.setDescription('A list of extensions that support the management of proprietary features for each port of a transparent bridge. This is indexed by dot1dBasePort.')
etsysVlanAuthorizationStatus = MibTableColumn((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1, 2, 1, 1, 1), EnabledStatus().clone('enabled')).setMaxAccess("readwrite")
if mibBuilder.loadTexts: etsysVlanAuthorizationStatus.setStatus('current')
if mibBuilder.loadTexts: etsysVlanAuthorizationStatus.setDescription('The enabled/disabled status for the application of VLAN authorization on this port, if disabled, the information returned in the VLAN-Tunnel-Type from the authentication will not be applied to the port (although it should be represented in this table). If enabled, those results will be applied to the port.')
etsysVlanAuthorizationAdminEgress = MibTableColumn((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1, 2, 1, 1, 2), VlanAuthEgressStatus().clone('untagged')).setMaxAccess("readwrite")
if mibBuilder.loadTexts: etsysVlanAuthorizationAdminEgress.setStatus('current')
if mibBuilder.loadTexts: etsysVlanAuthorizationAdminEgress.setDescription('Controls the modification of the current vlan egress list (of the vlan returned in the VLAN-Tunnel-Type, and reported by etsysVlanAuthorizationVlanID) upon successful authentication in the following manner: none(1) No egress manipulation will be made. tagged(2) The authenticating port will be added to the current egress for the VLAN-ID returned. untagged(3) The authenticating port will be added to the current untagged egress for the VLAN-ID returned. dynamic(4) The authenticating port will use information returned in the authentication response to modify the current egress lists. This value is supported only if the device supports a mechanism through which the egress status may be returned through the RADIUS response. Should etsysVlanAuthorizationEnable become disabled, etsysVlanAuthorizationStatus become disabled for a port, or should etsysVlanAuthorizationVlanID become 0 or 4095, all effect on the port egress MUST be removed.')
etsysVlanAuthorizationOperEgress = MibTableColumn((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1, 2, 1, 1, 3), VlanAuthEgressStatus().clone('none')).setMaxAccess("readonly")
if mibBuilder.loadTexts: etsysVlanAuthorizationOperEgress.setStatus('current')
if mibBuilder.loadTexts: etsysVlanAuthorizationOperEgress.setDescription('Reports the current state of modification to the current vlan egress list (of the vlan returned in the VLAN-Tunnel-Type) upon successful authentication, if etsysVlanAuthorizationStatus is enabled, in the following manner: none(1) No egress manipulation will be made. tagged(2) The authenticating port will be added to the current egress for the VLAN-ID returned. untagged(3) The authenticating port will be added to the current untagged egress for the VLAN-ID returned. The purpose of this leaf is to report, specifically when etsysVlanAuthorizationAdminEgress has been set to dynamic(4), the currently enforced egress modification. If the port is unauthenticated, or no VLAN-ID has been applied, this leaf should return none(1).')
etsysVlanAuthorizationVlanID = MibTableColumn((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1, 2, 1, 1, 4), Integer32().subtype(subtypeSpec=ConstraintsUnion(ValueRangeConstraint(0, 0), ValueRangeConstraint(1, 4094), ValueRangeConstraint(4095, 4095), ))).setMaxAccess("readonly")
if mibBuilder.loadTexts: etsysVlanAuthorizationVlanID.setStatus('current')
if mibBuilder.loadTexts: etsysVlanAuthorizationVlanID.setDescription('The 12 bit VLAN identifier for a given port, used to override the PVID of the given port, obtained as a result of an authentication. A value of zero indicates that there is no authenticated VLAN ID for the given port. Should a port become unauthenticated this value MUST be returned to zero. A value of 4095 indicates that a the port has been authenticated, but that the VLAN returned could not be applied to the port (possibly because of resource constraints or misconfiguration). In this instance, the original PVID should still be applied. Should the feature become disabled or the session terminate, all effect on the Port VLAN ID MUST be removed.')
etsysVlanAuthorizationConformance = MibIdentifier((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 2))
etsysVlanAuthorizationGroups = MibIdentifier((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 2, 1))
etsysVlanAuthorizationCompliances = MibIdentifier((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 2, 2))
etsysVlanAuthorizationGroup = ObjectGroup((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 2, 1, 1)).setObjects(("ENTERASYS-VLAN-AUTHORIZATION-MIB", "etsysVlanAuthorizationEnable"), ("ENTERASYS-VLAN-AUTHORIZATION-MIB", "etsysVlanAuthorizationStatus"), ("ENTERASYS-VLAN-AUTHORIZATION-MIB", "etsysVlanAuthorizationAdminEgress"), ("ENTERASYS-VLAN-AUTHORIZATION-MIB", "etsysVlanAuthorizationOperEgress"), ("ENTERASYS-VLAN-AUTHORIZATION-MIB", "etsysVlanAuthorizationVlanID"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
etsysVlanAuthorizationGroup = etsysVlanAuthorizationGroup.setStatus('current')
if mibBuilder.loadTexts: etsysVlanAuthorizationGroup.setDescription('A collection of objects relating to VLAN Authorization.')
etsysVlanAuthorizationCompliance = ModuleCompliance((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 2, 2, 1)).setObjects(("ENTERASYS-VLAN-AUTHORIZATION-MIB", "etsysVlanAuthorizationGroup"))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
etsysVlanAuthorizationCompliance = etsysVlanAuthorizationCompliance.setStatus('current')
if mibBuilder.loadTexts: etsysVlanAuthorizationCompliance.setDescription('The compliance statement for devices that support the Enterasys VLAN Authorization MIB.')
mibBuilder.exportSymbols("ENTERASYS-VLAN-AUTHORIZATION-MIB", etsysVlanAuthorizationVlanID=etsysVlanAuthorizationVlanID, etsysVlanAuthorizationGroup=etsysVlanAuthorizationGroup, etsysVlanAuthorizationEnable=etsysVlanAuthorizationEnable, etsysVlanAuthorizationOperEgress=etsysVlanAuthorizationOperEgress, etsysVlanAuthorizationAdminEgress=etsysVlanAuthorizationAdminEgress, etsysVlanAuthorizationConformance=etsysVlanAuthorizationConformance, VlanAuthEgressStatus=VlanAuthEgressStatus, etsysVlanAuthorizationPorts=etsysVlanAuthorizationPorts, etsysVlanAuthorizationStatus=etsysVlanAuthorizationStatus, etsysVlanAuthorizationCompliance=etsysVlanAuthorizationCompliance, etsysVlanAuthorizationMIB=etsysVlanAuthorizationMIB, etsysVlanAuthorizationGroups=etsysVlanAuthorizationGroups, etsysVlanAuthorizationObjects=etsysVlanAuthorizationObjects, etsysVlanAuthorizationTable=etsysVlanAuthorizationTable, etsysVlanAuthorizationSystem=etsysVlanAuthorizationSystem, etsysVlanAuthorizationEntry=etsysVlanAuthorizationEntry, etsysVlanAuthorizationCompliances=etsysVlanAuthorizationCompliances, PYSNMP_MODULE_ID=etsysVlanAuthorizationMIB)
| (octet_string, integer, object_identifier) = mibBuilder.importSymbols('ASN1', 'OctetString', 'Integer', 'ObjectIdentifier')
(named_values,) = mibBuilder.importSymbols('ASN1-ENUMERATION', 'NamedValues')
(constraints_intersection, value_size_constraint, constraints_union, value_range_constraint, single_value_constraint) = mibBuilder.importSymbols('ASN1-REFINEMENT', 'ConstraintsIntersection', 'ValueSizeConstraint', 'ConstraintsUnion', 'ValueRangeConstraint', 'SingleValueConstraint')
(dot1d_base_port_entry,) = mibBuilder.importSymbols('BRIDGE-MIB', 'dot1dBasePortEntry')
(etsys_modules,) = mibBuilder.importSymbols('ENTERASYS-MIB-NAMES', 'etsysModules')
(enabled_status,) = mibBuilder.importSymbols('P-BRIDGE-MIB', 'EnabledStatus')
(notification_group, module_compliance, object_group) = mibBuilder.importSymbols('SNMPv2-CONF', 'NotificationGroup', 'ModuleCompliance', 'ObjectGroup')
(mib_identifier, bits, notification_type, ip_address, time_ticks, counter64, iso, integer32, counter32, object_identity, unsigned32, gauge32, mib_scalar, mib_table, mib_table_row, mib_table_column, module_identity) = mibBuilder.importSymbols('SNMPv2-SMI', 'MibIdentifier', 'Bits', 'NotificationType', 'IpAddress', 'TimeTicks', 'Counter64', 'iso', 'Integer32', 'Counter32', 'ObjectIdentity', 'Unsigned32', 'Gauge32', 'MibScalar', 'MibTable', 'MibTableRow', 'MibTableColumn', 'ModuleIdentity')
(display_string, textual_convention) = mibBuilder.importSymbols('SNMPv2-TC', 'DisplayString', 'TextualConvention')
etsys_vlan_authorization_mib = module_identity((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48))
etsysVlanAuthorizationMIB.setRevisions(('2004-06-02 19:22',))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
if mibBuilder.loadTexts:
etsysVlanAuthorizationMIB.setRevisionsDescriptions(('The initial version of this MIB module',))
if mibBuilder.loadTexts:
etsysVlanAuthorizationMIB.setLastUpdated('200406021922Z')
if mibBuilder.loadTexts:
etsysVlanAuthorizationMIB.setOrganization('Enterasys Networks, Inc')
if mibBuilder.loadTexts:
etsysVlanAuthorizationMIB.setContactInfo('Postal: Enterasys Networks, Inc. 50 Minuteman Rd. Andover, MA 01810-1008 USA Phone: +1 978 684 1000 E-mail: [email protected] WWW: http://www.enterasys.com')
if mibBuilder.loadTexts:
etsysVlanAuthorizationMIB.setDescription("This MIB module defines a portion of the SNMP MIB under Enterasys Networks' enterprise OID pertaining to proprietary extensions to the IETF Q-BRIDGE-MIB, as specified in RFC2674, pertaining to VLAN authorization, as specified in RFC3580. Specifically, the enabling and disabling of support for the VLAN Tunnel-Type attribute returned from a RADIUS authentication, and how that attribute is applied to the port which initiated the authentication.")
class Vlanauthegressstatus(TextualConvention, Integer32):
description = 'The possible egress configurations which may be applied in response to a successful authentication. none(1) No egress manipulation will be made. tagged(2) The authenticating port will be added to the current egress for the VLAN-ID returned. untagged(3) The authenticating port will be added to the current untagged egress for the VLAN-ID returned. dynamic(4) The authenticating port will use information returned in the authentication response to modify the current egress lists.'
status = 'current'
subtype_spec = Integer32.subtypeSpec + constraints_union(single_value_constraint(1, 2, 3, 4))
named_values = named_values(('none', 1), ('tagged', 2), ('untagged', 3), ('dynamic', 4))
etsys_vlan_authorization_objects = mib_identifier((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1))
etsys_vlan_authorization_system = mib_identifier((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1, 1))
etsys_vlan_authorization_ports = mib_identifier((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1, 2))
etsys_vlan_authorization_enable = mib_scalar((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1, 1, 1), enabled_status().clone('disabled')).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
etsysVlanAuthorizationEnable.setStatus('current')
if mibBuilder.loadTexts:
etsysVlanAuthorizationEnable.setDescription('The enable/disable state for the VLAN authorization feature. When disabled, no modifications to the VLAN attributes related to packet switching should be enforced.')
etsys_vlan_authorization_table = mib_table((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1, 2, 1))
if mibBuilder.loadTexts:
etsysVlanAuthorizationTable.setStatus('current')
if mibBuilder.loadTexts:
etsysVlanAuthorizationTable.setDescription('Extensions to the table that contains information about every port that is associated with this transparent bridge.')
etsys_vlan_authorization_entry = mib_table_row((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1, 2, 1, 1))
dot1dBasePortEntry.registerAugmentions(('ENTERASYS-VLAN-AUTHORIZATION-MIB', 'etsysVlanAuthorizationEntry'))
etsysVlanAuthorizationEntry.setIndexNames(*dot1dBasePortEntry.getIndexNames())
if mibBuilder.loadTexts:
etsysVlanAuthorizationEntry.setStatus('current')
if mibBuilder.loadTexts:
etsysVlanAuthorizationEntry.setDescription('A list of extensions that support the management of proprietary features for each port of a transparent bridge. This is indexed by dot1dBasePort.')
etsys_vlan_authorization_status = mib_table_column((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1, 2, 1, 1, 1), enabled_status().clone('enabled')).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
etsysVlanAuthorizationStatus.setStatus('current')
if mibBuilder.loadTexts:
etsysVlanAuthorizationStatus.setDescription('The enabled/disabled status for the application of VLAN authorization on this port, if disabled, the information returned in the VLAN-Tunnel-Type from the authentication will not be applied to the port (although it should be represented in this table). If enabled, those results will be applied to the port.')
etsys_vlan_authorization_admin_egress = mib_table_column((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1, 2, 1, 1, 2), vlan_auth_egress_status().clone('untagged')).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
etsysVlanAuthorizationAdminEgress.setStatus('current')
if mibBuilder.loadTexts:
etsysVlanAuthorizationAdminEgress.setDescription('Controls the modification of the current vlan egress list (of the vlan returned in the VLAN-Tunnel-Type, and reported by etsysVlanAuthorizationVlanID) upon successful authentication in the following manner: none(1) No egress manipulation will be made. tagged(2) The authenticating port will be added to the current egress for the VLAN-ID returned. untagged(3) The authenticating port will be added to the current untagged egress for the VLAN-ID returned. dynamic(4) The authenticating port will use information returned in the authentication response to modify the current egress lists. This value is supported only if the device supports a mechanism through which the egress status may be returned through the RADIUS response. Should etsysVlanAuthorizationEnable become disabled, etsysVlanAuthorizationStatus become disabled for a port, or should etsysVlanAuthorizationVlanID become 0 or 4095, all effect on the port egress MUST be removed.')
etsys_vlan_authorization_oper_egress = mib_table_column((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1, 2, 1, 1, 3), vlan_auth_egress_status().clone('none')).setMaxAccess('readonly')
if mibBuilder.loadTexts:
etsysVlanAuthorizationOperEgress.setStatus('current')
if mibBuilder.loadTexts:
etsysVlanAuthorizationOperEgress.setDescription('Reports the current state of modification to the current vlan egress list (of the vlan returned in the VLAN-Tunnel-Type) upon successful authentication, if etsysVlanAuthorizationStatus is enabled, in the following manner: none(1) No egress manipulation will be made. tagged(2) The authenticating port will be added to the current egress for the VLAN-ID returned. untagged(3) The authenticating port will be added to the current untagged egress for the VLAN-ID returned. The purpose of this leaf is to report, specifically when etsysVlanAuthorizationAdminEgress has been set to dynamic(4), the currently enforced egress modification. If the port is unauthenticated, or no VLAN-ID has been applied, this leaf should return none(1).')
etsys_vlan_authorization_vlan_id = mib_table_column((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 1, 2, 1, 1, 4), integer32().subtype(subtypeSpec=constraints_union(value_range_constraint(0, 0), value_range_constraint(1, 4094), value_range_constraint(4095, 4095)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
etsysVlanAuthorizationVlanID.setStatus('current')
if mibBuilder.loadTexts:
etsysVlanAuthorizationVlanID.setDescription('The 12 bit VLAN identifier for a given port, used to override the PVID of the given port, obtained as a result of an authentication. A value of zero indicates that there is no authenticated VLAN ID for the given port. Should a port become unauthenticated this value MUST be returned to zero. A value of 4095 indicates that a the port has been authenticated, but that the VLAN returned could not be applied to the port (possibly because of resource constraints or misconfiguration). In this instance, the original PVID should still be applied. Should the feature become disabled or the session terminate, all effect on the Port VLAN ID MUST be removed.')
etsys_vlan_authorization_conformance = mib_identifier((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 2))
etsys_vlan_authorization_groups = mib_identifier((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 2, 1))
etsys_vlan_authorization_compliances = mib_identifier((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 2, 2))
etsys_vlan_authorization_group = object_group((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 2, 1, 1)).setObjects(('ENTERASYS-VLAN-AUTHORIZATION-MIB', 'etsysVlanAuthorizationEnable'), ('ENTERASYS-VLAN-AUTHORIZATION-MIB', 'etsysVlanAuthorizationStatus'), ('ENTERASYS-VLAN-AUTHORIZATION-MIB', 'etsysVlanAuthorizationAdminEgress'), ('ENTERASYS-VLAN-AUTHORIZATION-MIB', 'etsysVlanAuthorizationOperEgress'), ('ENTERASYS-VLAN-AUTHORIZATION-MIB', 'etsysVlanAuthorizationVlanID'))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
etsys_vlan_authorization_group = etsysVlanAuthorizationGroup.setStatus('current')
if mibBuilder.loadTexts:
etsysVlanAuthorizationGroup.setDescription('A collection of objects relating to VLAN Authorization.')
etsys_vlan_authorization_compliance = module_compliance((1, 3, 6, 1, 4, 1, 5624, 1, 2, 48, 2, 2, 1)).setObjects(('ENTERASYS-VLAN-AUTHORIZATION-MIB', 'etsysVlanAuthorizationGroup'))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
etsys_vlan_authorization_compliance = etsysVlanAuthorizationCompliance.setStatus('current')
if mibBuilder.loadTexts:
etsysVlanAuthorizationCompliance.setDescription('The compliance statement for devices that support the Enterasys VLAN Authorization MIB.')
mibBuilder.exportSymbols('ENTERASYS-VLAN-AUTHORIZATION-MIB', etsysVlanAuthorizationVlanID=etsysVlanAuthorizationVlanID, etsysVlanAuthorizationGroup=etsysVlanAuthorizationGroup, etsysVlanAuthorizationEnable=etsysVlanAuthorizationEnable, etsysVlanAuthorizationOperEgress=etsysVlanAuthorizationOperEgress, etsysVlanAuthorizationAdminEgress=etsysVlanAuthorizationAdminEgress, etsysVlanAuthorizationConformance=etsysVlanAuthorizationConformance, VlanAuthEgressStatus=VlanAuthEgressStatus, etsysVlanAuthorizationPorts=etsysVlanAuthorizationPorts, etsysVlanAuthorizationStatus=etsysVlanAuthorizationStatus, etsysVlanAuthorizationCompliance=etsysVlanAuthorizationCompliance, etsysVlanAuthorizationMIB=etsysVlanAuthorizationMIB, etsysVlanAuthorizationGroups=etsysVlanAuthorizationGroups, etsysVlanAuthorizationObjects=etsysVlanAuthorizationObjects, etsysVlanAuthorizationTable=etsysVlanAuthorizationTable, etsysVlanAuthorizationSystem=etsysVlanAuthorizationSystem, etsysVlanAuthorizationEntry=etsysVlanAuthorizationEntry, etsysVlanAuthorizationCompliances=etsysVlanAuthorizationCompliances, PYSNMP_MODULE_ID=etsysVlanAuthorizationMIB) |
class BookStore:
def __init__(self, book):
self.booklst = book
class Book:
def __init__(self, title, author, chapter, price):
self.title = title
self.author = author
self.chapter = list(chapter)
self.price = int(price)
book1 = Book("han kubrat", "Tangra", ['1', '3', '4', '2'], 1)
book2 = Book("han Asparuh", "Vitosha", ['12', '123', '55', '22'], 2)
book3 = Book("han Tervel", "StaraPlanina", ['155', '33', '41', '245'], 3)
lst_book = [book1, book2, book3]
bookstor = BookStore(lst_book)
| class Bookstore:
def __init__(self, book):
self.booklst = book
class Book:
def __init__(self, title, author, chapter, price):
self.title = title
self.author = author
self.chapter = list(chapter)
self.price = int(price)
book1 = book('han kubrat', 'Tangra', ['1', '3', '4', '2'], 1)
book2 = book('han Asparuh', 'Vitosha', ['12', '123', '55', '22'], 2)
book3 = book('han Tervel', 'StaraPlanina', ['155', '33', '41', '245'], 3)
lst_book = [book1, book2, book3]
bookstor = book_store(lst_book) |
# Contains the objects found on our user greetings page.
# Imports --------------------------------------------------------------------------------
# Page Objects ---------------------------------------------------------------------------
class PatientGreetingPageObject(object):
bio = 'This is a test bio.'
def get_current_feeling_buttons(self):
feeling1element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-0"]')
feeling2element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-1"]')
feeling3element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-2"]')
feeling4element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-3"]')
feeling5element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-4"]')
feeling6element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-5"]')
feeling7element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-6"]')
feeling8element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-7"]')
feeling9element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-8"]')
feeling10element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-9"]')
attributes = {
'feeling1 element': feeling1element,
'feeling2 element': feeling2element,
'feeling3 element': feeling3element,
'feeling4 element': feeling4element,
'feeling5 element': feeling5element,
'feeling6 element': feeling6element,
'feeling7 element': feeling7element,
'feeling8 element': feeling8element,
'feeling9 element': feeling9element,
'feeling10 element': feeling10element
}
return attributes
def click_feeling1_button(self):
self.get_current_feeling_buttons(self)['feeling1 element'].click()
def click_feeling2_button(self):
self.get_current_feeling_buttons(self)['feeling2 element'].click()
def click_feeling3_button(self):
self.get_current_feeling_buttons(self)['feeling3 element'].click()
def click_feeling4_button(self):
self.get_current_feeling_buttons(self)['feeling4 element'].click()
def click_feeling5_button(self):
self.get_current_feeling_buttons(self)['feeling5 element'].click()
def click_feeling6_button(self):
self.get_current_feeling_buttons(self)['feeling6 element'].click()
def click_feeling7_button(self):
self.get_current_feeling_buttons(self)['feeling7 element'].click()
def click_feeling8_button(self):
self.get_current_feeling_buttons(self)['feeling8 element'].click()
def click_feeling9_button(self):
self.get_current_feeling_buttons(self)['feeling9 element'].click()
def click_feeling10_button(self):
self.get_current_feeling_buttons(self)['feeling10 element'].click()
def get_feeling_comparison_buttons(self):
attributes = {
'worse element': self.client.find_element_by_xpath('//*[@id="feeling_comparison-0"]'),
'same element': self.client.find_element_by_xpath('//*[@id="feeling_comparison-1"]'),
'better element': self.client.find_element_by_xpath('//*[@id="feeling_comparison-2"]'),
}
return attributes
def click_worse_button(self):
self.get_feeling_comparison_buttons(self)['worse element'].click()
def click_same_button(self):
self.get_feeling_comparison_buttons(self)['same element'].click()
def click_better_button(self):
self.get_feeling_comparison_buttons(self)['better element'].click()
def get_behaviour_buttons(self):
attributes = {
'happy element': self.client.find_element_by_xpath('//*[@id="behaviours-0"]'),
'angry element': self.client.find_element_by_xpath('//*[@id="behaviours-1"]'),
'disappointed element': self.client.find_element_by_xpath('//*[@id="behaviours-2"]'),
'done with today element': self.client.find_element_by_xpath('//*[@id="behaviours-3"]'),
'persevering element': self.client.find_element_by_xpath('//*[@id="behaviours-4"]'),
'anxious element': self.client.find_element_by_xpath('//*[@id="behaviours-5"]'),
'confused element': self.client.find_element_by_xpath('//*[@id="behaviours-6"]'),
'worried element': self.client.find_element_by_xpath('//*[@id="behaviours-7"]'),
'ill element': self.client.find_element_by_xpath('//*[@id="behaviours-8"]'),
'exhausted element': self.client.find_element_by_xpath('//*[@id="behaviours-9"]'),
'accomplished element': self.client.find_element_by_xpath('//*[@id="behaviours-10"]'),
'star struck element': self.client.find_element_by_xpath('//*[@id="behaviours-11"]'),
'frightened element': self.client.find_element_by_xpath('//*[@id="behaviours-12"]'),
}
return attributes
def click_happy_element(self):
self.get_behaviour_buttons(self)['happy element'].click()
def click_angry_element(self):
self.get_behaviour_buttons(self)['angry element'].click()
def click_disappointed_element(self):
self.get_behaviour_buttons(self)['disappointed element'].click()
def click_done_with_today_element(self):
self.get_behaviour_buttons(self)['done with today element'].click()
def click_persevering_element(self):
self.get_behaviour_buttons(self)['persevering element'].click()
def click_anxious_element(self):
self.get_behaviour_buttons(self)['anxious element'].click()
def click_confused_element(self):
self.get_behaviour_buttons(self)['confused element'].click()
def click_worried_element(self):
self.get_behaviour_buttons(self)['worried element'].click()
def click_ill_element(self):
self.get_behaviour_buttons(self)['ill element'].click()
def click_exhausted_element(self):
self.get_behaviour_buttons(self)['exhausted element'].click()
def click_accomplished_element(self):
self.get_behaviour_buttons(self)['accomplished element'].click()
def click_star_struck_element(self):
self.get_behaviour_buttons(self)['star struck element'].click()
def click_frightened_element(self):
self.get_behaviour_buttons(self)['frightened element'].click()
def get_bio_element(self):
return self.client.find_element_by_xpath('//*[@id="patient_comment"]')
def type_in_bio_form(self, input_to_type=bio): # A function to type text into our bio form box.
# Retrieve our form attributes.
get_field_element = self.get_bio_element()
# After retrieving the field element, simulate typing into a form box.
get_field_element.send_keys(input_to_type)
print(f"Running Simulation: Currently typing '{input_to_type}' in the bio field.")
def clear_password_form(self): # A function to clear the text from within our password form box.
# Retrieve our form attributes.
get_field_element = self.get_bio_element()
get_field_element.clear() # Clears our form.
print(f"Running Simulation: Currently clearing the bio field.")
def get_submit_button(self):
return self.client.find_element_by_xpath('//*[@id="submit"]')
def click_submit_button(self):
self.get_submit_button(self).click()
def get_skip_evaluation_button(self):
return self.client.find_element_by_xpath('/html/body/p/a')
def click_skip_evaluation_button(self):
return self.get_skip_evaluation_button(self).click()
| class Patientgreetingpageobject(object):
bio = 'This is a test bio.'
def get_current_feeling_buttons(self):
feeling1element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-0"]')
feeling2element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-1"]')
feeling3element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-2"]')
feeling4element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-3"]')
feeling5element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-4"]')
feeling6element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-5"]')
feeling7element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-6"]')
feeling8element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-7"]')
feeling9element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-8"]')
feeling10element = self.client.find_element_by_xpath('// *[ @ id = "current_feeling-9"]')
attributes = {'feeling1 element': feeling1element, 'feeling2 element': feeling2element, 'feeling3 element': feeling3element, 'feeling4 element': feeling4element, 'feeling5 element': feeling5element, 'feeling6 element': feeling6element, 'feeling7 element': feeling7element, 'feeling8 element': feeling8element, 'feeling9 element': feeling9element, 'feeling10 element': feeling10element}
return attributes
def click_feeling1_button(self):
self.get_current_feeling_buttons(self)['feeling1 element'].click()
def click_feeling2_button(self):
self.get_current_feeling_buttons(self)['feeling2 element'].click()
def click_feeling3_button(self):
self.get_current_feeling_buttons(self)['feeling3 element'].click()
def click_feeling4_button(self):
self.get_current_feeling_buttons(self)['feeling4 element'].click()
def click_feeling5_button(self):
self.get_current_feeling_buttons(self)['feeling5 element'].click()
def click_feeling6_button(self):
self.get_current_feeling_buttons(self)['feeling6 element'].click()
def click_feeling7_button(self):
self.get_current_feeling_buttons(self)['feeling7 element'].click()
def click_feeling8_button(self):
self.get_current_feeling_buttons(self)['feeling8 element'].click()
def click_feeling9_button(self):
self.get_current_feeling_buttons(self)['feeling9 element'].click()
def click_feeling10_button(self):
self.get_current_feeling_buttons(self)['feeling10 element'].click()
def get_feeling_comparison_buttons(self):
attributes = {'worse element': self.client.find_element_by_xpath('//*[@id="feeling_comparison-0"]'), 'same element': self.client.find_element_by_xpath('//*[@id="feeling_comparison-1"]'), 'better element': self.client.find_element_by_xpath('//*[@id="feeling_comparison-2"]')}
return attributes
def click_worse_button(self):
self.get_feeling_comparison_buttons(self)['worse element'].click()
def click_same_button(self):
self.get_feeling_comparison_buttons(self)['same element'].click()
def click_better_button(self):
self.get_feeling_comparison_buttons(self)['better element'].click()
def get_behaviour_buttons(self):
attributes = {'happy element': self.client.find_element_by_xpath('//*[@id="behaviours-0"]'), 'angry element': self.client.find_element_by_xpath('//*[@id="behaviours-1"]'), 'disappointed element': self.client.find_element_by_xpath('//*[@id="behaviours-2"]'), 'done with today element': self.client.find_element_by_xpath('//*[@id="behaviours-3"]'), 'persevering element': self.client.find_element_by_xpath('//*[@id="behaviours-4"]'), 'anxious element': self.client.find_element_by_xpath('//*[@id="behaviours-5"]'), 'confused element': self.client.find_element_by_xpath('//*[@id="behaviours-6"]'), 'worried element': self.client.find_element_by_xpath('//*[@id="behaviours-7"]'), 'ill element': self.client.find_element_by_xpath('//*[@id="behaviours-8"]'), 'exhausted element': self.client.find_element_by_xpath('//*[@id="behaviours-9"]'), 'accomplished element': self.client.find_element_by_xpath('//*[@id="behaviours-10"]'), 'star struck element': self.client.find_element_by_xpath('//*[@id="behaviours-11"]'), 'frightened element': self.client.find_element_by_xpath('//*[@id="behaviours-12"]')}
return attributes
def click_happy_element(self):
self.get_behaviour_buttons(self)['happy element'].click()
def click_angry_element(self):
self.get_behaviour_buttons(self)['angry element'].click()
def click_disappointed_element(self):
self.get_behaviour_buttons(self)['disappointed element'].click()
def click_done_with_today_element(self):
self.get_behaviour_buttons(self)['done with today element'].click()
def click_persevering_element(self):
self.get_behaviour_buttons(self)['persevering element'].click()
def click_anxious_element(self):
self.get_behaviour_buttons(self)['anxious element'].click()
def click_confused_element(self):
self.get_behaviour_buttons(self)['confused element'].click()
def click_worried_element(self):
self.get_behaviour_buttons(self)['worried element'].click()
def click_ill_element(self):
self.get_behaviour_buttons(self)['ill element'].click()
def click_exhausted_element(self):
self.get_behaviour_buttons(self)['exhausted element'].click()
def click_accomplished_element(self):
self.get_behaviour_buttons(self)['accomplished element'].click()
def click_star_struck_element(self):
self.get_behaviour_buttons(self)['star struck element'].click()
def click_frightened_element(self):
self.get_behaviour_buttons(self)['frightened element'].click()
def get_bio_element(self):
return self.client.find_element_by_xpath('//*[@id="patient_comment"]')
def type_in_bio_form(self, input_to_type=bio):
get_field_element = self.get_bio_element()
get_field_element.send_keys(input_to_type)
print(f"Running Simulation: Currently typing '{input_to_type}' in the bio field.")
def clear_password_form(self):
get_field_element = self.get_bio_element()
get_field_element.clear()
print(f'Running Simulation: Currently clearing the bio field.')
def get_submit_button(self):
return self.client.find_element_by_xpath('//*[@id="submit"]')
def click_submit_button(self):
self.get_submit_button(self).click()
def get_skip_evaluation_button(self):
return self.client.find_element_by_xpath('/html/body/p/a')
def click_skip_evaluation_button(self):
return self.get_skip_evaluation_button(self).click() |
Dict = {'Tim': 18,'Charlie':12,'Tiffany':22,'Robert':25}
Boys = {'Tim': 18,'Charlie':12,'Robert':25}
Girls = {'Tiffany':22}
studentX=Boys.copy()
studentY=Girls.copy()
print(studentX)
print(studentY)
students = list(Dict.keys())
students.sort()
for s in students:
print(":".join((s,str(Dict[s]))))
| dict = {'Tim': 18, 'Charlie': 12, 'Tiffany': 22, 'Robert': 25}
boys = {'Tim': 18, 'Charlie': 12, 'Robert': 25}
girls = {'Tiffany': 22}
student_x = Boys.copy()
student_y = Girls.copy()
print(studentX)
print(studentY)
students = list(Dict.keys())
students.sort()
for s in students:
print(':'.join((s, str(Dict[s])))) |
class RaiseException:
def __init__(self, exception: Exception):
self.exception = exception
| class Raiseexception:
def __init__(self, exception: Exception):
self.exception = exception |
EVENT_ALGO_LOG = "eAlgoLog"
EVENT_ALGO_SETTING = "eAlgoSetting"
EVENT_ALGO_VARIABLES = "eAlgoVariables"
EVENT_ALGO_PARAMETERS = "eAlgoParameters"
APP_NAME = "AlgoTrading"
| event_algo_log = 'eAlgoLog'
event_algo_setting = 'eAlgoSetting'
event_algo_variables = 'eAlgoVariables'
event_algo_parameters = 'eAlgoParameters'
app_name = 'AlgoTrading' |
class AminoAcid:
def __init__(self,name='AA'):
self.name = name
self.name3L = ''
self.Hydrophobic = 0 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 0
self.polar = 0
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.SpecialRes = {0:0} # Special characteristic of residue
self.ResWeight = 0 # residue weight (weight - 56) backbone weight is 56
self.ResVol = 0 # Residue volume from http://prowl.rockefeller.edu/aainfo/volume.htm
self.SideChainVol = 0 # Side Chain volume is evaluated as ResVol - 0.9 Gly.ResVol
self.Hydropathy = 0 # Hydropathy index
self.n1 = 0
self.n2 = 0
# n values
# -1 when the amino acid (AA) residue has an N donor, short residue.
# -2 when the AA residue has an O acceptor, short residue.
# -3 when the AA residue has an N donor, long residue that able to bond across two turns.
# -5 when the AA residue has an O acceptor, long residue that able to bond across two turns.
# -7 when it is a Cystine(C)
# 0 when bond is not possible.
# 1 when this N or O participating in a bond.
# A residu can only participate in one side-chain bond. So when a bond is created
# for example with n1, n1 get the bond value and n2 will be assigned 0
def __mul__ (self,other):
# Evaluating side chain interaction
Prod = self.donor * other.acceptor
return Prod
# ############ Non Polar, HydroPhobic ###########
class Ala(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'A')
# Alanine
# ###
# CH3-CH(NH2)-COOH
#
#
# Molecular weight 89.09 Da
# Non ploar
# Acidity - Natural
# Hydrophobicity 0.616 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index 1.8 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point (when protonation accure) pH 6.01
# pKa( alpha-COOH) 2.35
# pKa( alpha-NH2) 9.87
# CAS # 56-41-7
# PubChem ID 5950
#
self.name3L = 'ALA'
self.Hydrophobic = 1 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 0
self.polar = 0
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.SpecialRes = {0:0} # Special characteristic of residue
self.n1 = 0
self.n2 = 0
self.Hydropathy = 1.8
self.ResWeight = 33
self.ResVol = 88.6
self.SideChainVol = 88.6-54.1
class Val(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'V')
# Valine
# #########
# (CH3)2-CH-CH(NH2)-COOH
#
#
# Essential AA (cannot be synthesized by humans)
# Molecular weight 117.15 Da
# Non ploar
# Acidity - Natural
# Hydrophobicity 0.825 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index 4.2 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point 6.00
# pKa( alpha-COOH) 2.39
# pKa( alpha-NH2) 9.74
# CAS # 72-18-4
# PubChem ID 1182
#
self.name3L = 'VAL'
self.Hydrophobic = 1 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 0
self.polar = 0
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.SpecialRes = {0:0} # Special characteristic of residue
self.n1 = 0
self.n2 = 0
self.Hydropathy = 4.2
self.ResWeight = 61
self.ResVol = 140.0
self.SideChainVol = 140-54.1
class Leu(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'L')
# Leucine
# #############
# (CH3)2-CH-CH2-CH(NH2)-COOH
#
#
# Essential AA
# Molecular weight 131.18 Da
# Non ploar
# Acidity - Natural
# Hydrophobicity 0.943 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index 3.8 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point 6.01
# pKa( alpha-COOH) 2.33
# pKa( alpha-NH2) 9.74
# CAS # 61-90-5
# PubChem ID 6106
#
self.name3L = 'LEU'
self.Hydrophobic = 1 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 0
self.polar = 0
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.SpecialRes = {0:0} # Special characteristic of residue
self.n1 = 0
self.n2 = 0
self.Hydropathy = 3.8
self.ResWeight = 75
self.ResVol = 166.7
self.SideChainVol = 166.7-54.1
class Ile(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'I')
# Isoleucine
# ###############
# CH3-CH2-CH(CH3)-CH(NH2)-COOH
#
#
# Essential AA
# Molecular weight 131.18 Da
# Non ploar
# Acidity - Natural
# Hydrophobicity 0.943 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index 4.5 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point 6.05
# pKa( alpha-COOH) 2.33
# pKa( alpha-NH2) 9.74
# CAS # 61-90-5
# PubChem ID 6106
#
self.Hydropathy = 4.5
self.ResWeight = 75
self.name3L = 'ILE'
self.Hydrophobic = 1 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 0
self.polar = 0
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.SpecialRes = {0:0} # Special characteristic of residue
self.n1 = 0
self.n2 = 0
self.ResVol = 166.7
self.SideChainVol = 166.7-54.1
class Phe(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'F')
# Phenylalanine
# ######
# Ph-CH2-CH(NH2)-COOH
# The residue Ph-CH2 : C6H5-CH2 benzyl
#
# Essential AA
# Molecular weight 165.19 Da
# Non ploar
# Acidity - Natural
# Hydrophobicity 1 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index 2.8 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point 5.49
# pKa( alpha-COOH) 2.20
# pKa( alpha-NH2) 9.31
# CAS # 63-91-2
# PubChem ID 994
#
self.Hydropathy = 2.8
self.ResWeight = 109
self.name3L = 'PHE'
self.Hydrophobic = 1 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 0
self.polar = 0
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.SpecialRes = {0:0} # Special characteristic of residue
self.n1 = 0
self.n2 = 0
self.ResVol = 189.9
self.SideChainVol = 189.9-54.1
class Trp(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'W')
# Tryptophan
# ##############
# Ph-NH-CH=C-CH2-CH(NH2)-COOH
# |________|
#
# contains an indole functional group.
# aromatic heterocyclic organic compound
# It has a bicyclic structure, consisting of a six-membered benzene ring fused to
# a five-membered nitrogen-containing pyrrole ring
#
# Essential AA
# Molecular weight 204.23 Da
# Non ploar
# Acidity - Natural
# Hydrophobicity 0.878 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index -0.9 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point 5.89
# pKa( alpha-COOH) 2.46
# pKa( alpha-NH2) 9.41
# CAS # 73-22-3
# PubChem ID 6305
#
self.Hydropathy = -0.9
self.ResWeight = 148
self.name3L = 'TRP'
self.Hydrophobic = 1 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 0
self.polar = 0
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.SpecialRes = {0:0} # Special characteristic of residue
self.n1 = 0
self.n2 = 0
self.ResVol = 227.8
self.SideChainVol = 227.8-54.1
class Met(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'M')
# Methionine
# ############
# CH3-S-(CH2)2-CH(NH2)-COOH
# sulfur-containing residue
# methyl donor R-CH3
# methionine is incorporated into the N-terminal position of all proteins
# in eukaryotes and archaea during translation, although it is usually removed
# by post-translational modification
#
# Essential AA
# Molecular weight 149.21 Da
# Non ploar
# Acidity - Natural
# Hydrophobicity 0.738 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index 1.9 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point 5.74
# pKa( alpha-COOH) 2.13
# pKa( alpha-NH2) 9.28
# CAS # 63-68-3
# PubChem ID 876
#
self.Hydropathy = 1.9
self.ResWeight = 93
self.name3L = 'MET'
self.Hydrophobic = 1 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 0
self.polar = 0
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.SpecialRes = {0:0} # Special characteristic of residue
self.n1 = 0
self.n2 = 0
self.ResVol = 162.9
self.SideChainVol = 162.9-54.1
class Pro(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'P')
# Proline
# **********
# NH-(CH2)3-CH-COOH
# |_________|
# Side chain bond to C alpha
# exceptional conformational rigidity
# usually solvent-exposed.
# lacks a hydrogen on the amide group, it cannot act as a hydrogen bond donor,
# only as a hydrogen bond acceptor.
#
# Molecular weight 115.13 Da
# Non ploar
# Acidity - Natural
# Hydrophobicity 0.711 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index -1.6 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point 6.30
# pKa( alpha-COOH) 1.95
# pKa( alpha-NH2) 10.64
# CAS # 147-85-3
# PubChem ID 614
#
self.Hydropathy = -1.6
self.ResWeight = 59
self.name3L = 'PRO'
self.Hydrophobic = 1 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 0
self.polar = 0
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.SpecialRes = {0:0,3:-3,4:-3,5:-3,6:-2} # special value scores
self.n1 = 0
self.n2 = 0
self.ResVol = 112.7
self.SideChainVol = 112.7-54.1
# ############ Non Polar Uncharged ###########
class Gly(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'G')
#
# NH2-CH2-COOH
#
# Molecular weight 75.07 Da
# Non ploar
# Acidity - Natural
# Hydrophobicity 0.501 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index -0.4 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point 6.06
# pKa( alpha-COOH) 2.35
# pKa( alpha-NH2) 9.78
# CAS # 56-40-6
# PubChem ID 750
self.Hydrophobic = 0 # 1: Hydrophobic, 0: Hydrophilic
self.Hydropathy = -0.4
self.ResWeight = 19
self.name3L = 'GLY'
self.SpecialRes = {0:0,3:-3,5:-3} # special value scores
self.ResVol = 60.1
self.SideChainVol = 60.1-54.1
# ############ Polar Uncharged ###########
class Ser(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'S')
# Serine
# ######
# HO-CH2-CH(NH2)-COOH
#
# Molecular weight 105.09 Da
# Ploar
# Acidity - Natural
# Hydrophobicity 0.359 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index -0.8 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point 5.68
# pKa( alpha-COOH) 2.19
# pKa( alpha-NH2) 9.21
# CAS # 56-45-1
# PubChem ID 617
#
self.Hydropathy = -0.8
self.ResWeight = 49
self.name3L = 'SER'
self.Hydrophobic = 0 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 0
self.polar = 1
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.SpecialRes = {0:0} # Special characteristic of residue
self.n1 = 0
self.n2 = 0
self.ResVol = 89.0
self.SideChainVol = 89-54.1
class Thr(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'T')
# Threonine
# ##########
# CH3-CH(OH)-CH(NH2)-COOH
# bearing an alcohol group
#
# Essential AA
# Molecular weight 119.12 Da
# Ploar
# Acidity - Natural
# Hydrophobicity 0.450 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index -0.7 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point 5.60
# pKa( alpha-COOH) 2.09
# pKa( alpha-NH2) 9.10
# CAS # 72-19-5
# PubChem ID 6288
#
self.Hydropathy = -0.7
self.ResWeight = 63
self.name3L = 'THR'
self.Hydrophobic = 0 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 0
self.polar = 1
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.SpecialRes = {0:0} # Special characteristic of residue
self.n1 = 0
self.n2 = 0
self.ResVol = 116.1
self.SideChainVol = 116.1-54.1
class Cys(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'C')
# Cysteine
# ######
# HS-CH2-CH(NH2)-COOH
# thiol (R-S-H) side chain
# Has Sulfur in side chain
#
# Molecular weight 121.16 Da
# Ploar
# Acidity - Natural
# Hydrophobicity 0.680 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index 2.5 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point 5.05
# pKa( alpha-COOH) 1.92
# pKa( alpha-NH2) 10.70
# CAS # 59-90-4
# PubChem ID 5862
#
self.Hydropathy = 2.5
self.ResWeight = 65
self.name3L = 'CYS'
self.Hydrophobic = 0 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 0
self.polar = 1
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.n1 = -7
self.n2 = 0
self.SpecialRes = {0:0} # special value scores
self.ResVol = 108.5
self.SideChainVol = 108.5-54.1
class Tyr(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'Y')
# Tyrosine
# ###########
# HO-p-Ph-CH2-CH(NH2)-COOH
#
# Molecular weight 181.19 Da
# Non ploar
# Acidity - Natural
# Hydrophobicity 0.880 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index -1.3 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point 5.64
# pKa( alpha-COOH) 2.20
# pKa( alpha-NH2) 9.21
# CAS # 60-18-4
# PubChem ID 1153
#
self.Hydropathy = -1.3
self.ResWeight = 125
self.name3L = 'TYR'
self.Hydrophobic = 0 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 0
self.polar = 1
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.SpecialRes = {0:0} # Special characteristic of residue
self.n1 = 0
self.n2 = 0
self.ResVol = 193.6
self.SideChainVol = 193.6-54.1
class Asn(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'N')
# Asparagine
# ##########
# H2N-CO-CH2-CH(NH2)-COOH
# N Donor - NH2
#
# has carboxamide as the side chain's functional group(R-CO-NH2)
# side chain can form hydrogen bond interactions with the peptide backbone
# often found near the beginning and the end of alpha-helices,
# and in turn motifs in beta sheets.
#
# Molecular weight 132.12 Da
# Ploar
# Acidity - Natural
# Hydrophobicity 0.236 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index -3.5 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point 5.41
# pKa( alpha-COOH) 2.14
# pKa( alpha-NH2) 8.72
# CAS # 70-47-3
# PubChem ID 236
#
self.Hydropathy = -3.5
self.ResWeight = 76
self.name3L = 'ASN'
self.Hydrophobic = 0 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 0
self.polar = 1
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.SpecialRes = {0:0} # Special characteristic of residue
self.n1 = -1
self.n2 = -2
self.ResVol = 114.1
self.SideChainVol = 114.1-54.1
class Gln(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'Q')
# Glutamine
# #############
# H2N-CO-(CH2)2-CH(NH2)-COOH
# N Donor - NH2
#
# Molecular weight 146.14 Da
# Ploar
# Acidity - Natural
# Hydrophobicity 0.251 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index -3.5 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point 5.65
# pKa( alpha-COOH) 2.17
# pKa( alpha-NH2) 9.13
# CAS # 56-85-9
# PubChem ID 5950
#
self.Hydropathy = -3.5
self.ResWeight = 90
self.name3L = 'GLN'
self.Hydrophobic = 0 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 0
self.polar = 1
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.n1 = -1
self.n2 = -2
self.SpecialRes = {0:0} # special value scores
self.ResVol = 143.8
self.SideChainVol = 143.8-54.1
# ########## Polar Acidic ###########
class Asp(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'D')
# Aspartic acid
# ########
# HOOC-CH2-CH(NH2)-COOH
#
# Molecular weight 133.10 Da
# Ploar
# Acidity - Acidic
# Hydrophobicity 0.028 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index -3.5 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point 2.85
# pKa( alpha-COOH) 1.99
# pKa( alpha-NH2) 9.90
# CAS # 56-84-8
# PubChem ID 5960
#
self.Hydropathy = -3.5
self.ResWeight = 77
self.name3L = 'ASP'
self.Hydrophobic = 0 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 1
self.polar = 1
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop self.loop = 0
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.SpecialRes = {0:0} # Special characteristic of residue
self.n1 = -2
self.n2 = 0
self.ResVol = 111.1
self.SideChainVol = 111.1-54.1
class Glu(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'E')
# ###########
# HOOC-(CH2)2-CH(NH2)-COOH
#
# Molecular weight 147.13 Da
# Ploar
# Acidity - Acidic
# Hydrophobicity 0.043 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index -3.5 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point 3.15
# pKa( alpha-COOH) 2.10
# pKa( alpha-NH2) 9.47
# CAS # 56-86-0
# PubChem ID 611
#
self.Hydropathy = -3.5
self.ResWeight = 91
self.name3L = 'GLU'
self.Hydrophobic = 0 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 1
self.polar = 1
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop self.loop = 0
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.SpecialRes = {0:0} # Special characteristic of residue
self.n1 = -2
self.n2 = 0
self.ResVol = 138.4
self.SideChainVol = 138.4-54.1
# ############## Polar Basic #############
class Lys(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'K')
# Lysine
# ##########
# H2N-(CH2)4-CH(NH2)-COOH
# often participates in hydrogen bonding
# N Donor - NH2
#
# Essential AA
# Molecular weight 146.19 Da
# Ploar
# Acidity - Basic
# Hydrophobicity 0.283 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index -3.9 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point 6.90
# pKa( alpha-COOH) 2.16
# pKa( alpha-NH2) 9.06
# CAS # 56-87-1
# PubChem ID 866
#
self.Hydropathy = -3.9
self.ResWeight = 90
self.Hydropathy = -3.9
self.ResWeight = 90
self.name3L = 'LYS'
self.Hydrophobic = 0 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 1
self.polar = 1
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop self.loop = 0
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.SpecialRes = {0:0} # Special characteristic of residue
self.n1 = -1
self.n2 = 0
self.ResVol = 168.6
self.SideChainVol = 168.6-54.1
class Arg(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'R')
# Arginine
# ###################
# HN=C(NH2)-NH-(CH2)3-CH(NH2)-COOH
# N Donor - NH2
#
# Molecular weight 174.20 Da
# Ploar
# Acidity - Basic (strong)
# Hydrophobicity 0.000 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index -4.5 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point (when protonation accure) pH 10.76
# pKa( alpha-COOH) 1.82
# pKa( alpha-NH2) 8.99
# CAS # 74-79-3
# PubChem ID 5950
#
self.Hydropathy = -4.5
self.ResWeight = 118
self.name3L = 'ARG'
self.Hydrophobic = 0 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 1
self.polar = 1
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop self.loop = 1
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.SpecialRes = {0:0} # Special characteristic of residue
self.n1 = -1
self.n2 = -3
self.ResVol = 173.4
self.SideChainVol = 173.4-54.1
class His(AminoAcid):
def __init__(self):
AminoAcid.__init__(self,'H')
# Histidine
# ################
# NH-CH=N-CH=C-CH2-CH(NH2)-COOH
# |__________|
# N Donor - NH
# The imidazole side chain has two nitrogens with different properties
#
# Molecular weight 155.15 Da
# Ploar
# Acidity - Basic (week)
# Hydrophobicity 0.165 (Analytical Bio chemistry 193:11,72-82 Elsevier 1991)
# Hydrophathy index -3.2 (J.Mol.Bio(1982) 157, 105-132)
# Isoelectric point 7.60
# pKa( alpha-COOH) 1.80
# pKa( alpha-NH2) 9.33
# CAS # 71-00-1
# PubChem ID 773
#
self.Hydropathy = -3.2
self.ResWeight = 99
self.name3L = 'HIS'
self.Hydrophobic = 0 # 1: Hydrophobic, 0: Hydrophilic
self.charge = 0.5
self.polar = 1
self.corner = 0 # Would prefer to be at a corner : give positive value
self.loop = 0 # cost/benefit when on a loop
self.size = 0 # Residue size (0:1) 0:ignor size, 1:Large residue
self.SpecialRes = {0:0} # Special characteristic of residue
self.n1 = -1
self.n2 = 0
self.ResVol = 153.2
self.SideChainVol = 153.2-54.1 | class Aminoacid:
def __init__(self, name='AA'):
self.name = name
self.name3L = ''
self.Hydrophobic = 0
self.charge = 0
self.polar = 0
self.corner = 0
self.loop = 0
self.size = 0
self.SpecialRes = {0: 0}
self.ResWeight = 0
self.ResVol = 0
self.SideChainVol = 0
self.Hydropathy = 0
self.n1 = 0
self.n2 = 0
def __mul__(self, other):
prod = self.donor * other.acceptor
return Prod
class Ala(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'A')
self.name3L = 'ALA'
self.Hydrophobic = 1
self.charge = 0
self.polar = 0
self.corner = 0
self.loop = 0
self.size = 0
self.SpecialRes = {0: 0}
self.n1 = 0
self.n2 = 0
self.Hydropathy = 1.8
self.ResWeight = 33
self.ResVol = 88.6
self.SideChainVol = 88.6 - 54.1
class Val(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'V')
self.name3L = 'VAL'
self.Hydrophobic = 1
self.charge = 0
self.polar = 0
self.corner = 0
self.loop = 0
self.size = 0
self.SpecialRes = {0: 0}
self.n1 = 0
self.n2 = 0
self.Hydropathy = 4.2
self.ResWeight = 61
self.ResVol = 140.0
self.SideChainVol = 140 - 54.1
class Leu(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'L')
self.name3L = 'LEU'
self.Hydrophobic = 1
self.charge = 0
self.polar = 0
self.corner = 0
self.loop = 0
self.size = 0
self.SpecialRes = {0: 0}
self.n1 = 0
self.n2 = 0
self.Hydropathy = 3.8
self.ResWeight = 75
self.ResVol = 166.7
self.SideChainVol = 166.7 - 54.1
class Ile(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'I')
self.Hydropathy = 4.5
self.ResWeight = 75
self.name3L = 'ILE'
self.Hydrophobic = 1
self.charge = 0
self.polar = 0
self.corner = 0
self.loop = 0
self.size = 0
self.SpecialRes = {0: 0}
self.n1 = 0
self.n2 = 0
self.ResVol = 166.7
self.SideChainVol = 166.7 - 54.1
class Phe(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'F')
self.Hydropathy = 2.8
self.ResWeight = 109
self.name3L = 'PHE'
self.Hydrophobic = 1
self.charge = 0
self.polar = 0
self.corner = 0
self.loop = 0
self.size = 0
self.SpecialRes = {0: 0}
self.n1 = 0
self.n2 = 0
self.ResVol = 189.9
self.SideChainVol = 189.9 - 54.1
class Trp(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'W')
self.Hydropathy = -0.9
self.ResWeight = 148
self.name3L = 'TRP'
self.Hydrophobic = 1
self.charge = 0
self.polar = 0
self.corner = 0
self.loop = 0
self.size = 0
self.SpecialRes = {0: 0}
self.n1 = 0
self.n2 = 0
self.ResVol = 227.8
self.SideChainVol = 227.8 - 54.1
class Met(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'M')
self.Hydropathy = 1.9
self.ResWeight = 93
self.name3L = 'MET'
self.Hydrophobic = 1
self.charge = 0
self.polar = 0
self.corner = 0
self.loop = 0
self.size = 0
self.SpecialRes = {0: 0}
self.n1 = 0
self.n2 = 0
self.ResVol = 162.9
self.SideChainVol = 162.9 - 54.1
class Pro(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'P')
self.Hydropathy = -1.6
self.ResWeight = 59
self.name3L = 'PRO'
self.Hydrophobic = 1
self.charge = 0
self.polar = 0
self.corner = 0
self.loop = 0
self.size = 0
self.SpecialRes = {0: 0, 3: -3, 4: -3, 5: -3, 6: -2}
self.n1 = 0
self.n2 = 0
self.ResVol = 112.7
self.SideChainVol = 112.7 - 54.1
class Gly(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'G')
self.Hydrophobic = 0
self.Hydropathy = -0.4
self.ResWeight = 19
self.name3L = 'GLY'
self.SpecialRes = {0: 0, 3: -3, 5: -3}
self.ResVol = 60.1
self.SideChainVol = 60.1 - 54.1
class Ser(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'S')
self.Hydropathy = -0.8
self.ResWeight = 49
self.name3L = 'SER'
self.Hydrophobic = 0
self.charge = 0
self.polar = 1
self.corner = 0
self.loop = 0
self.size = 0
self.SpecialRes = {0: 0}
self.n1 = 0
self.n2 = 0
self.ResVol = 89.0
self.SideChainVol = 89 - 54.1
class Thr(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'T')
self.Hydropathy = -0.7
self.ResWeight = 63
self.name3L = 'THR'
self.Hydrophobic = 0
self.charge = 0
self.polar = 1
self.corner = 0
self.loop = 0
self.size = 0
self.SpecialRes = {0: 0}
self.n1 = 0
self.n2 = 0
self.ResVol = 116.1
self.SideChainVol = 116.1 - 54.1
class Cys(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'C')
self.Hydropathy = 2.5
self.ResWeight = 65
self.name3L = 'CYS'
self.Hydrophobic = 0
self.charge = 0
self.polar = 1
self.corner = 0
self.loop = 0
self.size = 0
self.n1 = -7
self.n2 = 0
self.SpecialRes = {0: 0}
self.ResVol = 108.5
self.SideChainVol = 108.5 - 54.1
class Tyr(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'Y')
self.Hydropathy = -1.3
self.ResWeight = 125
self.name3L = 'TYR'
self.Hydrophobic = 0
self.charge = 0
self.polar = 1
self.corner = 0
self.loop = 0
self.size = 0
self.SpecialRes = {0: 0}
self.n1 = 0
self.n2 = 0
self.ResVol = 193.6
self.SideChainVol = 193.6 - 54.1
class Asn(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'N')
self.Hydropathy = -3.5
self.ResWeight = 76
self.name3L = 'ASN'
self.Hydrophobic = 0
self.charge = 0
self.polar = 1
self.corner = 0
self.loop = 0
self.size = 0
self.SpecialRes = {0: 0}
self.n1 = -1
self.n2 = -2
self.ResVol = 114.1
self.SideChainVol = 114.1 - 54.1
class Gln(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'Q')
self.Hydropathy = -3.5
self.ResWeight = 90
self.name3L = 'GLN'
self.Hydrophobic = 0
self.charge = 0
self.polar = 1
self.corner = 0
self.loop = 0
self.size = 0
self.n1 = -1
self.n2 = -2
self.SpecialRes = {0: 0}
self.ResVol = 143.8
self.SideChainVol = 143.8 - 54.1
class Asp(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'D')
self.Hydropathy = -3.5
self.ResWeight = 77
self.name3L = 'ASP'
self.Hydrophobic = 0
self.charge = 1
self.polar = 1
self.corner = 0
self.loop = 0
self.size = 0
self.SpecialRes = {0: 0}
self.n1 = -2
self.n2 = 0
self.ResVol = 111.1
self.SideChainVol = 111.1 - 54.1
class Glu(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'E')
self.Hydropathy = -3.5
self.ResWeight = 91
self.name3L = 'GLU'
self.Hydrophobic = 0
self.charge = 1
self.polar = 1
self.corner = 0
self.loop = 0
self.size = 0
self.SpecialRes = {0: 0}
self.n1 = -2
self.n2 = 0
self.ResVol = 138.4
self.SideChainVol = 138.4 - 54.1
class Lys(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'K')
self.Hydropathy = -3.9
self.ResWeight = 90
self.Hydropathy = -3.9
self.ResWeight = 90
self.name3L = 'LYS'
self.Hydrophobic = 0
self.charge = 1
self.polar = 1
self.corner = 0
self.loop = 0
self.size = 0
self.SpecialRes = {0: 0}
self.n1 = -1
self.n2 = 0
self.ResVol = 168.6
self.SideChainVol = 168.6 - 54.1
class Arg(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'R')
self.Hydropathy = -4.5
self.ResWeight = 118
self.name3L = 'ARG'
self.Hydrophobic = 0
self.charge = 1
self.polar = 1
self.corner = 0
self.loop = 0
self.size = 0
self.SpecialRes = {0: 0}
self.n1 = -1
self.n2 = -3
self.ResVol = 173.4
self.SideChainVol = 173.4 - 54.1
class His(AminoAcid):
def __init__(self):
AminoAcid.__init__(self, 'H')
self.Hydropathy = -3.2
self.ResWeight = 99
self.name3L = 'HIS'
self.Hydrophobic = 0
self.charge = 0.5
self.polar = 1
self.corner = 0
self.loop = 0
self.size = 0
self.SpecialRes = {0: 0}
self.n1 = -1
self.n2 = 0
self.ResVol = 153.2
self.SideChainVol = 153.2 - 54.1 |
'''
A collection of classes corresponding to fixed-income securities, to be fed into (and used with)
other classes and methods available in this repository (eg trees.py, Monte Carlo, etc)
'''
class SelfAmortizingMortgage:
def __init__(self, dates=mats6, early=False, rate=5.5 / 100, T=6, N=100):
''' Inputs:
*** early: whether you can prepay the security when it is more advantageous to do so
*** T: when the mortgage expires (maturity, years)
*** N: the face value (dollars)
*** rate: the interest rate paid yearly
*** dates: numpy nd array with the payment dates of the security '''
self.T = T
self.early = early
self.rate = rate
self.dates = dates
# coupon chosen to have value N at time 0, given the mortgage quoted rate
self.coupon = N / sum([(1 / pow(1 + self.rate, i)) for i in range(1, self.T + 1)])
if early:
self._compute_balance(N)
def get_cf(self, t, r, *args, **kwargs):
''' Inputs:
*** t: the current time
*** r: the current interest rate (at that node in the tree)
Outputs:
*** the cash-flow of the security for that (time, interest rate) '''
return self.coupon
def exercise_early(self, current_value, val_if_exercise_early, t, r):
''' Method to say whether you should exercise early or not
Inputs:
*** current_value: the value of the contract at that node, if you do not exercise early
*** t: the current time
*** r: the current interest rate
Returns: TRUE if should exercise early, FALSE otherwise '''
if not self.early:
print('WARNING: this should not be called when the security does not allow for early exercise')
return False
return current_value > val_if_exercise_early
def _compute_balance(self, N):
''' Makes a list with the amount of principal left at every possible moment,
and a list with the interests paid '''
bal_st = [N]
interest = []
princ = []
for i in range(self.T + 1): # for each payment until maturity
interest.append(bal_st[i] * self.rate)
princ.append(self.coupon - interest[i])
if i < self.T:
bal_st.append(bal_st[i] - self.coupon + interest[i])
self.balances = bal_st
self.interest = interest
self.princ = princ
def cf_early_exercise(self, t, r):
''' Gives the payoff if the security is exercised early, at time t, with rate r '''
# When a borrower prepays a mortgage, the borrower pays back the remaining principal on
# the loan, and does not make any of the remaining scheduled payments
return self.balances[t]
def get_raw_cf_mat(self, interest_rate_tree, *args, **kwargs):
''' Inputs:
*** interest_rate_tree: a 2D numpy array with corresponding interest rates in each cell
Returns:
*** the payoff matrix corresponding to the security, a matrix of the same dimension
'''
payoff_mat = np.zeros((interest_rate_tree.shape[0] + 1, interest_rate_tree.shape[0] + 1))
for time in reversed(range(1, payoff_mat.shape[0])):
for node in range(time + 1):
payoff_mat[node, time] = self.get_cf(time, interest_rate_tree[max(node - 1, 0), time - 1],
*args, **kwargs)
return payoff_mat | """
A collection of classes corresponding to fixed-income securities, to be fed into (and used with)
other classes and methods available in this repository (eg trees.py, Monte Carlo, etc)
"""
class Selfamortizingmortgage:
def __init__(self, dates=mats6, early=False, rate=5.5 / 100, T=6, N=100):
""" Inputs:
*** early: whether you can prepay the security when it is more advantageous to do so
*** T: when the mortgage expires (maturity, years)
*** N: the face value (dollars)
*** rate: the interest rate paid yearly
*** dates: numpy nd array with the payment dates of the security """
self.T = T
self.early = early
self.rate = rate
self.dates = dates
self.coupon = N / sum([1 / pow(1 + self.rate, i) for i in range(1, self.T + 1)])
if early:
self._compute_balance(N)
def get_cf(self, t, r, *args, **kwargs):
""" Inputs:
*** t: the current time
*** r: the current interest rate (at that node in the tree)
Outputs:
*** the cash-flow of the security for that (time, interest rate) """
return self.coupon
def exercise_early(self, current_value, val_if_exercise_early, t, r):
""" Method to say whether you should exercise early or not
Inputs:
*** current_value: the value of the contract at that node, if you do not exercise early
*** t: the current time
*** r: the current interest rate
Returns: TRUE if should exercise early, FALSE otherwise """
if not self.early:
print('WARNING: this should not be called when the security does not allow for early exercise')
return False
return current_value > val_if_exercise_early
def _compute_balance(self, N):
""" Makes a list with the amount of principal left at every possible moment,
and a list with the interests paid """
bal_st = [N]
interest = []
princ = []
for i in range(self.T + 1):
interest.append(bal_st[i] * self.rate)
princ.append(self.coupon - interest[i])
if i < self.T:
bal_st.append(bal_st[i] - self.coupon + interest[i])
self.balances = bal_st
self.interest = interest
self.princ = princ
def cf_early_exercise(self, t, r):
""" Gives the payoff if the security is exercised early, at time t, with rate r """
return self.balances[t]
def get_raw_cf_mat(self, interest_rate_tree, *args, **kwargs):
""" Inputs:
*** interest_rate_tree: a 2D numpy array with corresponding interest rates in each cell
Returns:
*** the payoff matrix corresponding to the security, a matrix of the same dimension
"""
payoff_mat = np.zeros((interest_rate_tree.shape[0] + 1, interest_rate_tree.shape[0] + 1))
for time in reversed(range(1, payoff_mat.shape[0])):
for node in range(time + 1):
payoff_mat[node, time] = self.get_cf(time, interest_rate_tree[max(node - 1, 0), time - 1], *args, **kwargs)
return payoff_mat |
AVG = 70
FUNCTIONS = [
lambda geslacht: 0 if geslacht == 'man' else 4,
lambda rookt: -5 if rookt else 5,
lambda sport: -3 if not sport else sport,
lambda alcohol: 2 if not alcohol else -((alcohol - 7) * 0.5) if alcohol > 7 else 0,
lambda fastfood: 3 if not fastfood else 0,
]
def levensverwachting(geslacht, roker, sport, alcohol, fastfood):
return AVG + sum(func(variable) for (func, variable) in zip(FUNCTIONS, [geslacht, roker, sport, alcohol, fastfood])) | avg = 70
functions = [lambda geslacht: 0 if geslacht == 'man' else 4, lambda rookt: -5 if rookt else 5, lambda sport: -3 if not sport else sport, lambda alcohol: 2 if not alcohol else -((alcohol - 7) * 0.5) if alcohol > 7 else 0, lambda fastfood: 3 if not fastfood else 0]
def levensverwachting(geslacht, roker, sport, alcohol, fastfood):
return AVG + sum((func(variable) for (func, variable) in zip(FUNCTIONS, [geslacht, roker, sport, alcohol, fastfood]))) |
class CommentHandlers(object):
def __init__(self):
self.handlers = []
self.comments = {}
def handler(self):
def wrapped(func):
self.register(func)
return func
return wrapped
def register_handler(self, func):
for handler in self.handlers:
print(handler.__name__)
self.handlers.append(func)
def add(self, addr, key, value):
if (addr, key) in self.comments:
self.comments[(addr, key)].append(value)
else:
self.comments[(addr, key)] = [value]
for handler in self.handlers:
handler(addr, key, value)
| class Commenthandlers(object):
def __init__(self):
self.handlers = []
self.comments = {}
def handler(self):
def wrapped(func):
self.register(func)
return func
return wrapped
def register_handler(self, func):
for handler in self.handlers:
print(handler.__name__)
self.handlers.append(func)
def add(self, addr, key, value):
if (addr, key) in self.comments:
self.comments[addr, key].append(value)
else:
self.comments[addr, key] = [value]
for handler in self.handlers:
handler(addr, key, value) |
def incrementing_time(start=2000, increment=1):
while True:
yield start
start += increment
def monotonic_time(start=2000):
return incrementing_time(start, increment=0.000001)
def static_time(value):
while True:
yield value
| def incrementing_time(start=2000, increment=1):
while True:
yield start
start += increment
def monotonic_time(start=2000):
return incrementing_time(start, increment=1e-06)
def static_time(value):
while True:
yield value |
class Solution:
def reverseBits(self, n: int) -> int:
val = 0
for i in range(32):
val <<= 1
val += n & 1
n >>= 1
return val
| class Solution:
def reverse_bits(self, n: int) -> int:
val = 0
for i in range(32):
val <<= 1
val += n & 1
n >>= 1
return val |
stages = iter(['alpha','beta','gamma'])
try:
next(stages)
next(stages)
next(stages)
next(stages)
except StopIteration as ex:
err_msg = 'Ran out of iterations'
| stages = iter(['alpha', 'beta', 'gamma'])
try:
next(stages)
next(stages)
next(stages)
next(stages)
except StopIteration as ex:
err_msg = 'Ran out of iterations' |
class Payment:
def __init__(self):
pass
def setPayment(self, payment):
Payment.payment = payment
def getPayment(self):
print("Total yang harus dibayarkan Rp. ", Payment.payment)
| class Payment:
def __init__(self):
pass
def set_payment(self, payment):
Payment.payment = payment
def get_payment(self):
print('Total yang harus dibayarkan Rp. ', Payment.payment) |
class Solution:
def hammingDistance(self, x: int, y: int) -> int:
c = x^y
r = 0
while c != 0:
r += (c & 1)
c = c>>1
return r
| class Solution:
def hamming_distance(self, x: int, y: int) -> int:
c = x ^ y
r = 0
while c != 0:
r += c & 1
c = c >> 1
return r |
v = "vvv"
a = [f"aaa{vvv}"
"bbb"]
print(a)
| v = 'vvv'
a = [f'aaa{vvv}bbb']
print(a) |
# worst case O(n^2)
# good case O(n)
def insertion_sort(array):
for i in range(1, len(array)):
key = array[i]
j = i -1
while (j>=0 and array[j]>key):
# scoot
array[j+1] = array[j]
j-=1
array[j+1] = key
return array
arr = [3,-9,5, 100,-2, 294,5,56]
sarr = insertion_sort(arr)
print(sarr, sorted(arr))
assert(sarr == sorted(arr))
| def insertion_sort(array):
for i in range(1, len(array)):
key = array[i]
j = i - 1
while j >= 0 and array[j] > key:
array[j + 1] = array[j]
j -= 1
array[j + 1] = key
return array
arr = [3, -9, 5, 100, -2, 294, 5, 56]
sarr = insertion_sort(arr)
print(sarr, sorted(arr))
assert sarr == sorted(arr) |
x=int(input("Enter first number:\n"))
y=int(input("Enter second number:\n"))
print("Before swapping:\n",x,"\n",y,"\n")
#Inputting two numbers from user
x,y=y,x
#Swapping two variables
print("After swapping:\n",x,"\n",y,"\n") | x = int(input('Enter first number:\n'))
y = int(input('Enter second number:\n'))
print('Before swapping:\n', x, '\n', y, '\n')
(x, y) = (y, x)
print('After swapping:\n', x, '\n', y, '\n') |
n = int(input())
for i in range(1, 10):
if n % i != 0:
continue
for j in range(1, 10):
if n % j != 0:
continue
for k in range(1, 10):
if n % k != 0:
continue
for m in range(1, 10):
if n % m != 0:
continue
for o in range(1, 10):
if n % o != 0:
continue
for p in range(1, 10):
if n % i != 0:
continue
if (i * j * k * m * o * p == n):
print("{0}{1}{2}{3}{4}{5}".format(i, j, k, m, o, p), end=' ') | n = int(input())
for i in range(1, 10):
if n % i != 0:
continue
for j in range(1, 10):
if n % j != 0:
continue
for k in range(1, 10):
if n % k != 0:
continue
for m in range(1, 10):
if n % m != 0:
continue
for o in range(1, 10):
if n % o != 0:
continue
for p in range(1, 10):
if n % i != 0:
continue
if i * j * k * m * o * p == n:
print('{0}{1}{2}{3}{4}{5}'.format(i, j, k, m, o, p), end=' ') |
reserv_list = set()
party_list = set()
command = input()
while command != 'PARTY':
reserv_list.add(command)
command = input()
if command == 'PARTY':
command = input()
while command != 'END':
party_list.add(command)
command = input()
diff = abs(len(reserv_list) - len(party_list))
print(diff)
losers = (reserv_list-party_list)
sort = sorted(losers)
for el in sort:
print(el)
| reserv_list = set()
party_list = set()
command = input()
while command != 'PARTY':
reserv_list.add(command)
command = input()
if command == 'PARTY':
command = input()
while command != 'END':
party_list.add(command)
command = input()
diff = abs(len(reserv_list) - len(party_list))
print(diff)
losers = reserv_list - party_list
sort = sorted(losers)
for el in sort:
print(el) |
class Player(object):
TEAM_GREEN = 0
TEAM_RED = 1
TEAM_BLUE = 2
def __init__(self, id, front_grey, front_red, front_blue, deck_grey, deck_red, deck_blue):
self.id = id
self.front_grey = front_grey
self.front_red = front_red
self.front_blue = front_blue
self.deck_grey = deck_grey
self.deck_red = deck_red
self.deck_blue = deck_blue | class Player(object):
team_green = 0
team_red = 1
team_blue = 2
def __init__(self, id, front_grey, front_red, front_blue, deck_grey, deck_red, deck_blue):
self.id = id
self.front_grey = front_grey
self.front_red = front_red
self.front_blue = front_blue
self.deck_grey = deck_grey
self.deck_red = deck_red
self.deck_blue = deck_blue |
# Advent of code 2021 : Day 1 | Part 2
# Source : https://adventofcode.com/2020/day/1
infile = "aoc/2020/Day 1/input.txt"
inputs = list(map(int, open(infile).read().splitlines()))
print([i*j*_ for i in inputs for j in inputs for _ in inputs if i + j + _ == 2020][0])
# Answer : 165080960
| infile = 'aoc/2020/Day 1/input.txt'
inputs = list(map(int, open(infile).read().splitlines()))
print([i * j * _ for i in inputs for j in inputs for _ in inputs if i + j + _ == 2020][0]) |
#!/usr/bin/python
class JustCounter:
__secret_count = 0
def count(self):
self.__secret_count += 1
print(self.__secret_count)
counter = JustCounter()
counter.count()
counter.count()
# can't access
print(counter.__secret_count) | class Justcounter:
__secret_count = 0
def count(self):
self.__secret_count += 1
print(self.__secret_count)
counter = just_counter()
counter.count()
counter.count()
print(counter.__secret_count) |
N = int(input())
A = [int(n) for n in input().split()]
ans = [0] + [0]*N
for i in range(N-1):
ans[A[i]] += 1
for i in range(1, N+1):
print(ans[i])
| n = int(input())
a = [int(n) for n in input().split()]
ans = [0] + [0] * N
for i in range(N - 1):
ans[A[i]] += 1
for i in range(1, N + 1):
print(ans[i]) |
def count(start, end=None, step=None):
if step == 0:
raise IndexError
if hasattr(step, "__iter__"):
raise TypeError
if (hasattr(start, "__iter__")
or hasattr(end, "__iter__")):
return __iter_count(start, end, step)
else:
return __num_count(start, end, step)
def __iter_count(start,end=None, step=None):
items = None
if hasattr(start, "__iter__"):
if step is not None:
raise IndexError
items = start
count = 0
step = end
if hasattr(end, "__iter__"):
count = start
items = end
if step is None:
step = 1
for item in items:
yield count, item
count += step
def __num_count(start, end=None, step=None):
if end is None:
end = start
start = 0
count = start
if step is None:
step = 1
if start > end:
if step > 0:
step *= -1
while count >= end:
yield count
count += step
else:
if step < 0:
step *= -1
while count <= end:
yield count
count += step
| def count(start, end=None, step=None):
if step == 0:
raise IndexError
if hasattr(step, '__iter__'):
raise TypeError
if hasattr(start, '__iter__') or hasattr(end, '__iter__'):
return __iter_count(start, end, step)
else:
return __num_count(start, end, step)
def __iter_count(start, end=None, step=None):
items = None
if hasattr(start, '__iter__'):
if step is not None:
raise IndexError
items = start
count = 0
step = end
if hasattr(end, '__iter__'):
count = start
items = end
if step is None:
step = 1
for item in items:
yield (count, item)
count += step
def __num_count(start, end=None, step=None):
if end is None:
end = start
start = 0
count = start
if step is None:
step = 1
if start > end:
if step > 0:
step *= -1
while count >= end:
yield count
count += step
else:
if step < 0:
step *= -1
while count <= end:
yield count
count += step |
def prime(n):
i=2
while i<=n//2:
if n%i==0:
return 0
i=i+1
return 1
n=2
sum=0
while n<=2000000:
if prime(n):
sum=sum+n
n=n+1
| def prime(n):
i = 2
while i <= n // 2:
if n % i == 0:
return 0
i = i + 1
return 1
n = 2
sum = 0
while n <= 2000000:
if prime(n):
sum = sum + n
n = n + 1 |
# Given an integer n, generate a square matrix filled with elements from 1 to n^2 in spiral order.
# For example,
# Given n = 3,
# You should return the following matrix:
# [
# [ 1, 2, 3 ],
# [ 8, 9, 4 ],
# [ 7, 6, 5 ]
# ]
class Solution:
# @param {integer} n
# @return {integer[][]}
def generateMatrix(self, n):
matrix = [[0 for x in range(n)] for x in range(n)]
boundaries = [n-1, n-1, 0, 1] #r, d, l, u
bi = 0
directions = [[0, 1], [1, 0], [0, -1], [-1, 0]] #r, d, l, u
di = 0
e = [0, 0]
ei = 1
for i in xrange(n*n):
matrix[e[0]][e[1]] = i+1
if e[ei] == boundaries[bi]:
boundaries[bi] -= directions[di][ei]
bi = (bi+1)%4
di = (di+1)%4
ei = (ei+1)%2
e[0] += directions[di][0]
e[1] += directions[di][1]
return matrix
| class Solution:
def generate_matrix(self, n):
matrix = [[0 for x in range(n)] for x in range(n)]
boundaries = [n - 1, n - 1, 0, 1]
bi = 0
directions = [[0, 1], [1, 0], [0, -1], [-1, 0]]
di = 0
e = [0, 0]
ei = 1
for i in xrange(n * n):
matrix[e[0]][e[1]] = i + 1
if e[ei] == boundaries[bi]:
boundaries[bi] -= directions[di][ei]
bi = (bi + 1) % 4
di = (di + 1) % 4
ei = (ei + 1) % 2
e[0] += directions[di][0]
e[1] += directions[di][1]
return matrix |
#
# This file contains the Python code from Program 4.20 of
# "Data Structures and Algorithms
# with Object-Oriented Design Patterns in Python"
# by Bruno R. Preiss.
#
# Copyright (c) 2003 by Bruno R. Preiss, P.Eng. All rights reserved.
#
# http://www.brpreiss.com/books/opus7/programs/pgm04_20.txt
#
class LinkedList(object):
class Element(object):
def insertAfter(self, item):
self._next = LinkedList.Element(
self._list, item, self._next)
if self._list._tail is self:
self._list._tail = self._next
def insertBefore(self, item):
tmp = LinkedList.Element(self._list, item, self)
if self is self._list._head:
self._list._head = tmp
else:
prevPtr = self._list._head
while prevPtr is not None \
and prevPtr._next is not self:
prevPtr = prevPtr._next
prevPtr._next = tmp
# ...
| class Linkedlist(object):
class Element(object):
def insert_after(self, item):
self._next = LinkedList.Element(self._list, item, self._next)
if self._list._tail is self:
self._list._tail = self._next
def insert_before(self, item):
tmp = LinkedList.Element(self._list, item, self)
if self is self._list._head:
self._list._head = tmp
else:
prev_ptr = self._list._head
while prevPtr is not None and prevPtr._next is not self:
prev_ptr = prevPtr._next
prevPtr._next = tmp |
#file = open("data.csv", "r")
#for line in file:
# print(line)
with open("output.csv", "a") as fileout:
fileout.write("Hello World")
fileout.close() | with open('output.csv', 'a') as fileout:
fileout.write('Hello World')
fileout.close() |
# -*- coding: utf-8 -*-
__title__ = 'atomos'
__version_info__ = ('0', '3', '1')
__version__ = '.'.join(__version_info__)
__author__ = 'Max Countryman'
__license__ = 'BSD'
__copyright__ = 'Copyright 2014 Max Countryman'
| __title__ = 'atomos'
__version_info__ = ('0', '3', '1')
__version__ = '.'.join(__version_info__)
__author__ = 'Max Countryman'
__license__ = 'BSD'
__copyright__ = 'Copyright 2014 Max Countryman' |
# Copyright (C) 2019 Intel Corporation
#
# SPDX-License-Identifier: MIT
class Converter:
def __init__(self, cmdline_args=None):
pass
def __call__(self, extractor, save_dir):
raise NotImplementedError()
def _parse_cmdline(self, cmdline):
parser = self.build_cmdline_parser()
if len(cmdline) != 0 and cmdline[0] == '--':
cmdline = cmdline[1:]
args = parser.parse_args(cmdline)
return vars(args) | class Converter:
def __init__(self, cmdline_args=None):
pass
def __call__(self, extractor, save_dir):
raise not_implemented_error()
def _parse_cmdline(self, cmdline):
parser = self.build_cmdline_parser()
if len(cmdline) != 0 and cmdline[0] == '--':
cmdline = cmdline[1:]
args = parser.parse_args(cmdline)
return vars(args) |
primes = [
2, 3, 5, 7, 11, 13, 17, 19, 23, 29, 31, 37, 41, 43, 47, 53, 59, 61, 67, 71,
73, 79, 83, 89, 97, 101, 103, 107, 109, 113, 127, 131, 137, 139, 149, 151,
157, 163, 167, 173, 179, 181, 191, 193, 197, 199, 211, 223, 227, 229, 233,
239, 241, 251
]
# len(primes) = 54
# symbol_size = 3
# for prime in primes:
# column_size = prime * symbol_size
# if 1048576 % (column_size) == 1 or \
# 1048576 % (column_size) == (column_size - 1):
# print('1048576 % column_size(={}, 3 * prime={}) = {}'.
# format(column_size, prime, 1048576 % column_size))
divisions = (17, 32, 41)
symbol_size = 3
target_size = 1048576
for d in divisions:
column_size = symbol_size * d
remainder = target_size % column_size
if remainder == 0:
padding_size = 0
else:
padding_size = column_size - remainder
rate = (1048576 + padding_size) / d
print('(1048576 + {:3d}) / {} = {}, column_size = {:3d}, division = {}'.
format(padding_size, d, rate, column_size, d))
# (1048576 + 35) / 17 = 61683.0, column_size = 51, division = 17
# (1048576 + 32) / 32 = 32769.0, column_size = 96, division = 32
# (1048576 + 122) / 41 = 25578.0, column_size = 123, division = 41
# 1048576 % prime=17 = 16
# 1048576 % prime=32 = 0
# 1048576 % prime=41 = 1
# (1048576 + 1) / 17 = 61681.0
# (1048576 + 0) / 16 = 65536.0
# (1048576 + 40) / 41 = 25576.0
# 1048576 % column_size(= 15, 3 * prime= 5) = 1
# 1048576 % column_size(= 33, 3 * prime=11) = 1
# 1048576 % column_size(= 93, 3 * prime=31) = 1
# 1048576 % column_size(=123, 3 * prime=41) = 1
| primes = [2, 3, 5, 7, 11, 13, 17, 19, 23, 29, 31, 37, 41, 43, 47, 53, 59, 61, 67, 71, 73, 79, 83, 89, 97, 101, 103, 107, 109, 113, 127, 131, 137, 139, 149, 151, 157, 163, 167, 173, 179, 181, 191, 193, 197, 199, 211, 223, 227, 229, 233, 239, 241, 251]
divisions = (17, 32, 41)
symbol_size = 3
target_size = 1048576
for d in divisions:
column_size = symbol_size * d
remainder = target_size % column_size
if remainder == 0:
padding_size = 0
else:
padding_size = column_size - remainder
rate = (1048576 + padding_size) / d
print('(1048576 + {:3d}) / {} = {}, column_size = {:3d}, division = {}'.format(padding_size, d, rate, column_size, d)) |
# -*- coding: utf-8 -*-
RADIX = 3
BYTE_RADIX = 256
MAX_TRIT_VALUE = (RADIX - 1) // 2
MIN_TRIT_VALUE = -MAX_TRIT_VALUE
NUMBER_OF_TRITS_IN_A_BYTE = 5
NUMBER_OF_TRITS_IN_A_TRYTE = 3
HASH_LENGTH = 243
BYTE_TO_TRITS_MAPPINGS = [[]] * HASH_LENGTH
TRYTE_TO_TRITS_MAPPINGS = [[]] * 27
HIGH_INTEGER_BITS = 0xFFFFFFFF
HIGH_LONG_BITS = 0xFFFFFFFFFFFFFFFF
TRYTE_ALPHABET = '9ABCDEFGHIJKLMNOPQRSTUVWXYZ'
MIN_TRYTE_VALUE = -13
MAX_TRYTE_VALUE = 13
def increment(trits, length):
for i in range(length):
trits[i] += 1
if trits[i] > MAX_TRIT_VALUE:
trits[i] = MIN_TRIT_VALUE
else:
break
def init_converter():
global BYTE_TO_TRITS_MAPPINGS, TRYTE_TO_TRITS_MAPPINGS
trits = [0] * NUMBER_OF_TRITS_IN_A_BYTE
for i in range(HASH_LENGTH):
BYTE_TO_TRITS_MAPPINGS[i] = trits[:NUMBER_OF_TRITS_IN_A_BYTE]
increment(trits, NUMBER_OF_TRITS_IN_A_BYTE)
for i in range(27):
TRYTE_TO_TRITS_MAPPINGS[i] = trits[:NUMBER_OF_TRITS_IN_A_TRYTE]
increment(trits, NUMBER_OF_TRITS_IN_A_TRYTE)
def from_trits_to_binary(trits, offset=0, size=HASH_LENGTH):
b = bytearray(b' ' * int((size + NUMBER_OF_TRITS_IN_A_BYTE - 1) / NUMBER_OF_TRITS_IN_A_BYTE))
for i in range(len(b)):
value = 0
for j in range(size - i * NUMBER_OF_TRITS_IN_A_BYTE - 1 if (size - i * NUMBER_OF_TRITS_IN_A_BYTE) < NUMBER_OF_TRITS_IN_A_BYTE else 4, -1, -1):
value = value * RADIX + trits[offset + i * NUMBER_OF_TRITS_IN_A_BYTE + j]
b[i] = value % 256
return bytes(b)
def from_binary_to_trits(bs, length):
offset = 0
trits = [0] * length
for i in range(min(len(bs), length)):
# We must convert the binary data
# because java using different range with Python
index = bs[i] if bs[i] < 127 else bs[i] - 256 + HASH_LENGTH
copy_len = length - offset if length - offset < NUMBER_OF_TRITS_IN_A_BYTE else NUMBER_OF_TRITS_IN_A_BYTE
trits[offset: offset + copy_len] = BYTE_TO_TRITS_MAPPINGS[index][:copy_len]
offset += NUMBER_OF_TRITS_IN_A_BYTE
return trits
init_converter()
| radix = 3
byte_radix = 256
max_trit_value = (RADIX - 1) // 2
min_trit_value = -MAX_TRIT_VALUE
number_of_trits_in_a_byte = 5
number_of_trits_in_a_tryte = 3
hash_length = 243
byte_to_trits_mappings = [[]] * HASH_LENGTH
tryte_to_trits_mappings = [[]] * 27
high_integer_bits = 4294967295
high_long_bits = 18446744073709551615
tryte_alphabet = '9ABCDEFGHIJKLMNOPQRSTUVWXYZ'
min_tryte_value = -13
max_tryte_value = 13
def increment(trits, length):
for i in range(length):
trits[i] += 1
if trits[i] > MAX_TRIT_VALUE:
trits[i] = MIN_TRIT_VALUE
else:
break
def init_converter():
global BYTE_TO_TRITS_MAPPINGS, TRYTE_TO_TRITS_MAPPINGS
trits = [0] * NUMBER_OF_TRITS_IN_A_BYTE
for i in range(HASH_LENGTH):
BYTE_TO_TRITS_MAPPINGS[i] = trits[:NUMBER_OF_TRITS_IN_A_BYTE]
increment(trits, NUMBER_OF_TRITS_IN_A_BYTE)
for i in range(27):
TRYTE_TO_TRITS_MAPPINGS[i] = trits[:NUMBER_OF_TRITS_IN_A_TRYTE]
increment(trits, NUMBER_OF_TRITS_IN_A_TRYTE)
def from_trits_to_binary(trits, offset=0, size=HASH_LENGTH):
b = bytearray(b' ' * int((size + NUMBER_OF_TRITS_IN_A_BYTE - 1) / NUMBER_OF_TRITS_IN_A_BYTE))
for i in range(len(b)):
value = 0
for j in range(size - i * NUMBER_OF_TRITS_IN_A_BYTE - 1 if size - i * NUMBER_OF_TRITS_IN_A_BYTE < NUMBER_OF_TRITS_IN_A_BYTE else 4, -1, -1):
value = value * RADIX + trits[offset + i * NUMBER_OF_TRITS_IN_A_BYTE + j]
b[i] = value % 256
return bytes(b)
def from_binary_to_trits(bs, length):
offset = 0
trits = [0] * length
for i in range(min(len(bs), length)):
index = bs[i] if bs[i] < 127 else bs[i] - 256 + HASH_LENGTH
copy_len = length - offset if length - offset < NUMBER_OF_TRITS_IN_A_BYTE else NUMBER_OF_TRITS_IN_A_BYTE
trits[offset:offset + copy_len] = BYTE_TO_TRITS_MAPPINGS[index][:copy_len]
offset += NUMBER_OF_TRITS_IN_A_BYTE
return trits
init_converter() |
#encoding:utf-8
subreddit = 'HQDesi'
t_channel = '@r_HqDesi'
def send_post(submission, r2t):
return r2t.send_simple(submission)
| subreddit = 'HQDesi'
t_channel = '@r_HqDesi'
def send_post(submission, r2t):
return r2t.send_simple(submission) |
class OrderElement:
def __init__(self, product, quantity):
self.product = product
self.quantity = quantity
def calculate_price(self):
return self.product.unit_price * self.quantity
def __str__(self):
return f"{self.product} x {self.quantity}"
| class Orderelement:
def __init__(self, product, quantity):
self.product = product
self.quantity = quantity
def calculate_price(self):
return self.product.unit_price * self.quantity
def __str__(self):
return f'{self.product} x {self.quantity}' |
#!/usr/bin/env python3
class Parser:
def __init__(self):
self.token = None
self.remained_token = None
'''from regex string to NFA class'''
def parse(self, regex_str):
if len(regex_str) == 0:
print("The compiled content is empty. Stop parsing.")
return None
regex_str_list = [i for i in regex_str] + [None]
self.token = regex_str_list[0]
self.remained_token = regex_str_list[1:]
result = self.re()
return result
def advance(self):
self.token = self.remained_token[0]
self.remained_token = self.remained_token[1:]
'''<RE> ::= (<simple-RE> "|" RE>) | <simple-RE>'''
def re(self):
result = self.simple_re()
while self.token == "|":
result_head = self.token
self.advance()
rhs = self.simple_re()
result = [result_head, result, rhs]
rhs = result
return result
'''<simple-RE> ::= <basic-RE>+'''
def simple_re(self):
result = self.basic_re()
# self.token != ")" and self.token != "|" is used to fix the bug
while self.token != None and self.token != ")" and self.token != "|":
result_head = "CONC" # concat
rhs = self.basic_re()
result = [result_head, result, rhs]
rhs = result
return result
'''<basic-RE> ::= <elementary-RE> "*" | <elementary-RE> "?" | elementary-RE> "+" | <elementary-RE>'''
def basic_re(self):
result = self.elementary_re()
if self.token == "*":
self.advance()
result = ["STAR", result]
elif self.token == "?":
self.advance()
result = ["QUESTION", result]
elif self.token == "+":
self.advance()
result = ["PLUS", result]
return result
'''<elementary-RE> ::= <group> | <any> | <char> | <char-set>'''
'''<group> ::= "(" <RE> ")"'''
def elementary_re(self):
# <group> ::= "(" <RE> ")"
if self.token == "(":
self.advance()
result = self.re()
if self.token != ")":
raise("Except \")\", found %s", self.token)
self.advance()
result = [result]
elif self.token == ".":
self.advance()
result = "ANY"
elif self.token == "[":
result = self.char_set()
else:
result = self.char()
return result
'''<char> ::= any non metacharacter | "\" metacharacter'''
'''metacharacter = set{ \ * + . \ [ ] ( ) | }'''
def char(self):
meta_char_list = ["*", "+", ".", "\\", "[", "]", "(", ")", "|", "?"]
# \ + metacharacter
if self.token == "\\":
self.advance()
if self.token in meta_char_list:
result = self.token
self.advance()
return result
else:
# exception description
exception_desc = "Expect" + ", ".join(meta_char_list) + " , found \"%s\"" % self.token
raise(exception_desc)
else:
if self.token in meta_char_list:
print("Caution: \"%s\" is not recommended to be singly used." % self.token)
result = self.token
self.advance()
return result
'''<char-set> ::= <positive-set> | <negative-set>'''
def char_set(self):
# token [ is checked in elementary_re. so advance()
self.advance()
'''<negative-set> ::= "[^" <set-items> "]"'''
if self.token == "^":
result_rhs = self.set_items()
result = ["NOT", result_rhs]
else:
result = self.set_items()
return result
def set_items(self):
result = ["SET"]
if self.token != "]":
result.append(self.set_item())
return result
'''<set-item> ::= <range> | <char>
<range> ::= <char> "-" <char>'''
def set_item(self):
result = self.char()
# range = <char> "-" <char>
if self.token == "-":
result_lhs = result
self.advance()
result_rhs = self.char()
result = ["RANGE", result_lhs, result_rhs]
return result
regex_parser = Parser()
print(regex_parser.parse("(abc)"))
print(regex_parser.parse("(a|bc)"))
print(regex_parser.parse("a*bc"))
print(regex_parser.parse("(a*|b)c"))
print(regex_parser.parse("a+bc"))
print(regex_parser.parse("(a+|b)c"))
print(regex_parser.parse("a*+bc"))
print(regex_parser.parse("a*+bc"))
| class Parser:
def __init__(self):
self.token = None
self.remained_token = None
'from regex string to NFA class'
def parse(self, regex_str):
if len(regex_str) == 0:
print('The compiled content is empty. Stop parsing.')
return None
regex_str_list = [i for i in regex_str] + [None]
self.token = regex_str_list[0]
self.remained_token = regex_str_list[1:]
result = self.re()
return result
def advance(self):
self.token = self.remained_token[0]
self.remained_token = self.remained_token[1:]
'<RE> \t::= (<simple-RE> "|" RE>) | <simple-RE>'
def re(self):
result = self.simple_re()
while self.token == '|':
result_head = self.token
self.advance()
rhs = self.simple_re()
result = [result_head, result, rhs]
rhs = result
return result
'<simple-RE> \t::= <basic-RE>+'
def simple_re(self):
result = self.basic_re()
while self.token != None and self.token != ')' and (self.token != '|'):
result_head = 'CONC'
rhs = self.basic_re()
result = [result_head, result, rhs]
rhs = result
return result
'<basic-RE> \t::=\t<elementary-RE> "*" | <elementary-RE> "?" | elementary-RE> "+" | <elementary-RE>'
def basic_re(self):
result = self.elementary_re()
if self.token == '*':
self.advance()
result = ['STAR', result]
elif self.token == '?':
self.advance()
result = ['QUESTION', result]
elif self.token == '+':
self.advance()
result = ['PLUS', result]
return result
'<elementary-RE> \t::=\t<group> | <any> | <char> | <char-set>'
'<group> \t::= \t"(" <RE> ")"'
def elementary_re(self):
if self.token == '(':
self.advance()
result = self.re()
if self.token != ')':
raise ('Except ")", found %s', self.token)
self.advance()
result = [result]
elif self.token == '.':
self.advance()
result = 'ANY'
elif self.token == '[':
result = self.char_set()
else:
result = self.char()
return result
'<char> \t::= \tany non metacharacter | "" metacharacter'
'metacharacter = set{ \\ * + . \\ [ ] ( ) | }'
def char(self):
meta_char_list = ['*', '+', '.', '\\', '[', ']', '(', ')', '|', '?']
if self.token == '\\':
self.advance()
if self.token in meta_char_list:
result = self.token
self.advance()
return result
else:
exception_desc = 'Expect' + ', '.join(meta_char_list) + ' , found "%s"' % self.token
raise exception_desc
else:
if self.token in meta_char_list:
print('Caution: "%s" is not recommended to be singly used.' % self.token)
result = self.token
self.advance()
return result
'<char-set> \t::= \t<positive-set> | <negative-set>'
def char_set(self):
self.advance()
'<negative-set> \t::= \t"[^" <set-items> "]"'
if self.token == '^':
result_rhs = self.set_items()
result = ['NOT', result_rhs]
else:
result = self.set_items()
return result
def set_items(self):
result = ['SET']
if self.token != ']':
result.append(self.set_item())
return result
'<set-item> \t::= \t<range> | <char>\n <range> \t::= \t<char> "-" <char>'
def set_item(self):
result = self.char()
if self.token == '-':
result_lhs = result
self.advance()
result_rhs = self.char()
result = ['RANGE', result_lhs, result_rhs]
return result
regex_parser = parser()
print(regex_parser.parse('(abc)'))
print(regex_parser.parse('(a|bc)'))
print(regex_parser.parse('a*bc'))
print(regex_parser.parse('(a*|b)c'))
print(regex_parser.parse('a+bc'))
print(regex_parser.parse('(a+|b)c'))
print(regex_parser.parse('a*+bc'))
print(regex_parser.parse('a*+bc')) |
def isgreaterthan20(number1,number2):
print(number1)
print(number2)
num=20
num1=10
isgreaterthan20(num,num1) | def isgreaterthan20(number1, number2):
print(number1)
print(number2)
num = 20
num1 = 10
isgreaterthan20(num, num1) |
class InvalidIdError(RuntimeError):
def __init__(self, id_value):
super(InvalidIdError, self).__init__()
self.id = id_value
| class Invalididerror(RuntimeError):
def __init__(self, id_value):
super(InvalidIdError, self).__init__()
self.id = id_value |
sku = [{"name": "id",
"type": "varchar(256)"},
{"name": "object",
"type": "varchar(256)"},
{"name": "active",
"type": "boolean"},
{"name": "attributes",
"type": "varchar(max)"},
{"name": "created",
"type": "timestamp"},
{"name": "currency",
"type": "varchar(256)"},
{"name": "image",
"type": "varchar(256)"},
{"name": "inventory",
"type": "varchar(512)"},
{"name": "livemode",
"type": "boolean"},
{"name": "metadata",
"type": "varchar(max)"},
{"name": "package_dimensions",
"type": "varchar(512)"},
{"name": "price",
"type": "integer"},
{"name": "product",
"type": "varchar(256)"},
{"name": "updated",
"type": "timestamp"}]
| sku = [{'name': 'id', 'type': 'varchar(256)'}, {'name': 'object', 'type': 'varchar(256)'}, {'name': 'active', 'type': 'boolean'}, {'name': 'attributes', 'type': 'varchar(max)'}, {'name': 'created', 'type': 'timestamp'}, {'name': 'currency', 'type': 'varchar(256)'}, {'name': 'image', 'type': 'varchar(256)'}, {'name': 'inventory', 'type': 'varchar(512)'}, {'name': 'livemode', 'type': 'boolean'}, {'name': 'metadata', 'type': 'varchar(max)'}, {'name': 'package_dimensions', 'type': 'varchar(512)'}, {'name': 'price', 'type': 'integer'}, {'name': 'product', 'type': 'varchar(256)'}, {'name': 'updated', 'type': 'timestamp'}] |
#no refactoring
class hash_test:
participant = ["leo","kiki","eden"]
completion = ["leo","kiki"]
p = 31
m = 0xfffff
x = 0
hash_table = list([0 for i in range(m)])
unfinished = list()
# polynomial rolling hash function.
for i in participant:
print(i)
mod_value=0
for j in i:
mod_value = mod_value + ord(j)*pow(p,x)
x+=1
hash_table[mod_value % m] = 1
#hash for completion
for k in completion:
print(k)
mod_value=0
for j in i:
mod_value = mod_value + ord(j)*pow(p,x)
x+=1
if hash_table[mod_value % m] != 1:
unfinished.append(i)
print("unfinished="+i)
| class Hash_Test:
participant = ['leo', 'kiki', 'eden']
completion = ['leo', 'kiki']
p = 31
m = 1048575
x = 0
hash_table = list([0 for i in range(m)])
unfinished = list()
for i in participant:
print(i)
mod_value = 0
for j in i:
mod_value = mod_value + ord(j) * pow(p, x)
x += 1
hash_table[mod_value % m] = 1
for k in completion:
print(k)
mod_value = 0
for j in i:
mod_value = mod_value + ord(j) * pow(p, x)
x += 1
if hash_table[mod_value % m] != 1:
unfinished.append(i)
print('unfinished=' + i) |
# -*- coding: utf-8 -
#
# This file is part of tproxy released under the MIT license.
# See the NOTICE for more information.
version_info = (0, 5, 4)
__version__ = ".".join(map(str, version_info))
| version_info = (0, 5, 4)
__version__ = '.'.join(map(str, version_info)) |
def eh_primo(x):
if (x==3) or (x==2):
return True
if (x<2) or (x%2==0):
return False
for i in range(3, int(x**0.5)+1, 2):
if x%i==0:
return False
return True
def sup_primo(num):
while num >= 10:
sup = num % 10
num = int(num / 10)
if not eh_primo(sup):
return 0
if((num == 2) or (num == 3) or (num == 5) or (num == 7)):
return True
else:
return False
while(True):
try:
# (Entrada)
n = input()
if len(n)==0:
break
else:
n = int(n)
if not eh_primo(n):
print("Nada")
else:
if sup_primo(n):
print("Super")
else:
print("Primo")
except EOFError:
break
| def eh_primo(x):
if x == 3 or x == 2:
return True
if x < 2 or x % 2 == 0:
return False
for i in range(3, int(x ** 0.5) + 1, 2):
if x % i == 0:
return False
return True
def sup_primo(num):
while num >= 10:
sup = num % 10
num = int(num / 10)
if not eh_primo(sup):
return 0
if num == 2 or num == 3 or num == 5 or (num == 7):
return True
else:
return False
while True:
try:
n = input()
if len(n) == 0:
break
else:
n = int(n)
if not eh_primo(n):
print('Nada')
elif sup_primo(n):
print('Super')
else:
print('Primo')
except EOFError:
break |
#listing
#representacion de grafos
a,b,c,d,e,f,g,h = range(8)
N = [{b:2,c:1,d:3,e:9,f:4}, #a
{c:4,e:3}, #b
{d:8}, #c
{e:7}, #d
{f:5}, #e
{c:2,g:2,h:2}, #f
{f:1,h:6}, #g
{f:9,g:8}] #h
print(b in N[a]) #neighborhood membership/es vecino b de a??
print(len(N[f])) #degree of f
print(N[a][b]) #edge weight for (a,b)
input()
#matrix for graphs
#matriz de adyacencia
# a b c d e f g h
M = [[0,1,1,1,1,1,0,0], #a
[0,0,1,0,1,0,0,0], #b
[0,0,0,1,0,0,0,0], #c
[0,0,0,0,1,0,0,0], #d
[0,0,0,0,0,1,0,0], #e
[0,0,0,1,0,0,1,1], #f
[0,0,0,0,0,1,0,1], #g
[0,0,0,0,0,1,1,0]] #h
print(sum(M[a]))
input()
#representacionde nodos con infinito a traves de matrices:
#a weight matrix with infinite weighr for missing edges
print("------------------------------")
a,b,c,d,e,f,g,h = range(8)
_ = float('inf')
# a b c d e f g h
G = [[0,2,1,3,9,4,_,_], #a
[_,0,4,_,3,_,_,_], #b
[_,_,0,8,_,_,_,_], #c
[_,_,_,0,7,_,_,_], #d
[_,_,_,_,0,5,_,_], #e
[_,_,2,_,_,0,2,2], #f
[_,_,_,_,_,1,0,6], #g
[_,_,_,_,_,9,8,0]] #h
print(G[a][b] < _)
print(G[c][e] < _)
print(sum(1 for g in G[a] if g < _)-1) #degree
#note: 1 is substracted from G[a] because we dont want the o from the diagonal
input()
| (a, b, c, d, e, f, g, h) = range(8)
n = [{b: 2, c: 1, d: 3, e: 9, f: 4}, {c: 4, e: 3}, {d: 8}, {e: 7}, {f: 5}, {c: 2, g: 2, h: 2}, {f: 1, h: 6}, {f: 9, g: 8}]
print(b in N[a])
print(len(N[f]))
print(N[a][b])
input()
m = [[0, 1, 1, 1, 1, 1, 0, 0], [0, 0, 1, 0, 1, 0, 0, 0], [0, 0, 0, 1, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1, 0, 0], [0, 0, 0, 1, 0, 0, 1, 1], [0, 0, 0, 0, 0, 1, 0, 1], [0, 0, 0, 0, 0, 1, 1, 0]]
print(sum(M[a]))
input()
print('------------------------------')
(a, b, c, d, e, f, g, h) = range(8)
_ = float('inf')
g = [[0, 2, 1, 3, 9, 4, _, _], [_, 0, 4, _, 3, _, _, _], [_, _, 0, 8, _, _, _, _], [_, _, _, 0, 7, _, _, _], [_, _, _, _, 0, 5, _, _], [_, _, 2, _, _, 0, 2, 2], [_, _, _, _, _, 1, 0, 6], [_, _, _, _, _, 9, 8, 0]]
print(G[a][b] < _)
print(G[c][e] < _)
print(sum((1 for g in G[a] if g < _)) - 1)
input() |
class Config(object):
_instance = None
def __new__(self):
if not self._instance:
self._instance = super(Config, self).__new__(self)
return self._instance
def setConfig(self, config):
self.config = config
def get(self, key):
return self.config[key]
def getAll(self):
return self.config | class Config(object):
_instance = None
def __new__(self):
if not self._instance:
self._instance = super(Config, self).__new__(self)
return self._instance
def set_config(self, config):
self.config = config
def get(self, key):
return self.config[key]
def get_all(self):
return self.config |
# Faca um programa que tenha uma funcao
# chamada area(),
# que receba as dimensoes de um terreno
# retangular(largura e comprimento) e mostre a
# area do terreno
def area(larg, comp):
a = larg * comp
print(f'A area de um terreno {larg} x {comp} eh de {a}m2.')
print(' Controle de Terrenos')
print('-' * 20)
l = float(input('Largura (m): '))
c = float(input('Comprimento (m): '))
area(l, c)
| def area(larg, comp):
a = larg * comp
print(f'A area de um terreno {larg} x {comp} eh de {a}m2.')
print(' Controle de Terrenos')
print('-' * 20)
l = float(input('Largura (m): '))
c = float(input('Comprimento (m): '))
area(l, c) |
class Solution:
def findMinFibonacciNumbers(self, k: int) -> int:
fib = []
fib.extend([1, 1])
j = 1
i = 2
# calculate fibonacci number greater than k
while j < k:
x = fib[i - 1] + fib[i - 2]
fib.append(x)
i += 1
j = x
count = 0
for i in range(len(fib) - 1, -1, -1):
print(fib[i], k)
if fib[i] == k:
count += 1
break
elif fib[i] < k:
k = k - fib[i]
count += 1
return count
| class Solution:
def find_min_fibonacci_numbers(self, k: int) -> int:
fib = []
fib.extend([1, 1])
j = 1
i = 2
while j < k:
x = fib[i - 1] + fib[i - 2]
fib.append(x)
i += 1
j = x
count = 0
for i in range(len(fib) - 1, -1, -1):
print(fib[i], k)
if fib[i] == k:
count += 1
break
elif fib[i] < k:
k = k - fib[i]
count += 1
return count |
input()
groups = sorted([ int(i) for i in input().split() ], reverse=True)
cars = 0
i = 0
j = len(groups) - 1
while i <= j:
g = groups[i]
if g == 4:
i += 1
cars += 1
continue
cur_car = g
while groups[j] <= 4 - cur_car and i < j:
cur_car += groups[j]
j -= 1
i += 1
cars += 1
print(cars)
| input()
groups = sorted([int(i) for i in input().split()], reverse=True)
cars = 0
i = 0
j = len(groups) - 1
while i <= j:
g = groups[i]
if g == 4:
i += 1
cars += 1
continue
cur_car = g
while groups[j] <= 4 - cur_car and i < j:
cur_car += groups[j]
j -= 1
i += 1
cars += 1
print(cars) |
def auto_newline(text: str, max_line_length: int):
def wrap_line_helper(line: str):
words = line.split(" ")
wrapped_line = []
current_line = ""
for word in words:
current_line += word
if len(current_line) > max_line_length:
current_line = " ".join(current_line.split(" ")[:-1])
wrapped_line.append(current_line)
current_line = word
current_line += " "
wrapped_line.append(current_line[:-1])
return "\n".join(wrapped_line)
lines = text.split("\n")
wrapped_lines = []
for line1 in lines:
wrapped_lines.append(wrap_line_helper(line1))
return "\n".join(wrapped_lines)
| def auto_newline(text: str, max_line_length: int):
def wrap_line_helper(line: str):
words = line.split(' ')
wrapped_line = []
current_line = ''
for word in words:
current_line += word
if len(current_line) > max_line_length:
current_line = ' '.join(current_line.split(' ')[:-1])
wrapped_line.append(current_line)
current_line = word
current_line += ' '
wrapped_line.append(current_line[:-1])
return '\n'.join(wrapped_line)
lines = text.split('\n')
wrapped_lines = []
for line1 in lines:
wrapped_lines.append(wrap_line_helper(line1))
return '\n'.join(wrapped_lines) |
def explore(lines):
y = 0
x = lines[0].index('|')
dx = 0
dy = 1
answer = ''
steps = 0
while True:
x += dx
y += dy
if lines[y][x] == '+':
if x < (len(lines[y]) - 1) and lines[y][x+1].strip() and dx != -1:
dx = 1
dy = 0
elif y < (len(lines) - 1) and x < len(lines[y+1]) and lines[y+1][x].strip() and dy != -1:
dx = 0
dy = 1
elif y > 0 and x < len(lines[y-1]) and lines[y-1][x].strip() and dy != 1:
dx = 0
dy = -1
elif x > 0 and lines[y][x-1].strip() and dx != 1:
dx = -1
dy = 0
elif lines[y][x] == ' ':
break
elif lines[y][x] not in ('-', '|'):
answer += lines[y][x]
steps += 1
return answer, steps + 1
def test_explore():
assert ('ABCDEF', 38) == explore(open("input/dec19_test").readlines())
if __name__ == "__main__":
print(explore(open("input/dec19").readlines())) | def explore(lines):
y = 0
x = lines[0].index('|')
dx = 0
dy = 1
answer = ''
steps = 0
while True:
x += dx
y += dy
if lines[y][x] == '+':
if x < len(lines[y]) - 1 and lines[y][x + 1].strip() and (dx != -1):
dx = 1
dy = 0
elif y < len(lines) - 1 and x < len(lines[y + 1]) and lines[y + 1][x].strip() and (dy != -1):
dx = 0
dy = 1
elif y > 0 and x < len(lines[y - 1]) and lines[y - 1][x].strip() and (dy != 1):
dx = 0
dy = -1
elif x > 0 and lines[y][x - 1].strip() and (dx != 1):
dx = -1
dy = 0
elif lines[y][x] == ' ':
break
elif lines[y][x] not in ('-', '|'):
answer += lines[y][x]
steps += 1
return (answer, steps + 1)
def test_explore():
assert ('ABCDEF', 38) == explore(open('input/dec19_test').readlines())
if __name__ == '__main__':
print(explore(open('input/dec19').readlines())) |
# Search in Rotated Sorted Array: https://leetcode.com/problems/search-in-rotated-sorted-array/
# There is an integer array nums sorted in ascending order (with distinct values).
# Prior to being passed to your function, nums is rotated at an unknown pivot index k (0 <= k < nums.length) such that the resulting array is [nums[k], nums[k+1], ..., nums[n-1], nums[0], nums[1], ..., nums[k-1]] (0-indexed). For example, [0,1,2,4,5,6,7] might be rotated at pivot index 3 and become [4,5,6,7,0,1,2].
# Given the array nums after the rotation and an integer target, return the index of target if it is in nums, or -1 if it is not in nums.
# You must write an algorithm with O(log n) runtime complexity.
# This is a basic binary search the only difference is that we need to check if the values are sorted from high to mid so that we know wether to follow the traditional patern
# or to traverse the other way as the shift occurs on the other side
class Solution:
def search(self, nums, target: int) -> int:
lo, hi = 0, len(nums) - 1
while lo <= hi:
mid = lo + (hi - lo) // 2
if nums[mid] == target:
return mid
else:
# Is it properly sorted?
if nums[mid] >= nums[lo]:
# Now since we know where it is supposed to be we need to check if it can be here
if target >= nums[lo] and target <= nums[mid]:
hi = mid - 1
else:
lo = mid + 1
else:
if target <= nums[hi] and target > nums[mid]:
lo = mid + 1
else:
hi = mid - 1
return -1
# So this is pretty standard the only weird hiccup is finding whether or not you have a sorted segment or not
# this runs in o(logn) and O(1)
# Score Card
# Did I need hints? N
# Did you finish within 30 min? 10
# Was the solution optimal? This is optimal
# Were there any bugs? No
# 5 5 5 5 = 5
| class Solution:
def search(self, nums, target: int) -> int:
(lo, hi) = (0, len(nums) - 1)
while lo <= hi:
mid = lo + (hi - lo) // 2
if nums[mid] == target:
return mid
elif nums[mid] >= nums[lo]:
if target >= nums[lo] and target <= nums[mid]:
hi = mid - 1
else:
lo = mid + 1
elif target <= nums[hi] and target > nums[mid]:
lo = mid + 1
else:
hi = mid - 1
return -1 |
class Solution:
def rotate(self, nums: List[int], k: int) -> None:
k %= len(nums)
if k > 0:
for i, v in enumerate(nums[-k:] + nums[0:-k]):
nums[i] = v
| class Solution:
def rotate(self, nums: List[int], k: int) -> None:
k %= len(nums)
if k > 0:
for (i, v) in enumerate(nums[-k:] + nums[0:-k]):
nums[i] = v |
# sort given sequence given that the numbers go from 1 to n
def cyclic_sort(seq):
for i in range(len(seq)):
num = seq[i]
if num != seq[num-1]:
# swap
seq[num-1], seq[i] = seq[i], seq[num-1]
def main():
seq = [5,4,1,2,3]
cyclic_sort(seq)
print(f'seq = {seq}')
if __name__ == "__main__":
main()
| def cyclic_sort(seq):
for i in range(len(seq)):
num = seq[i]
if num != seq[num - 1]:
(seq[num - 1], seq[i]) = (seq[i], seq[num - 1])
def main():
seq = [5, 4, 1, 2, 3]
cyclic_sort(seq)
print(f'seq = {seq}')
if __name__ == '__main__':
main() |
class Student:
# Using a global base for all the available courses
numReg = []
# We will initalise the student class
def __init__(self, number, name, family, courses=None):
if courses is None:
courses = []
self.number = number
self.numReg.append(self)
self.name = name
self.family = family
self.courses = courses
# This is used to display the student details
def displayStudent(self):
print('You are logged in as ' + self.name + ' ' + self.family)
# This is used to display the number of courses a student takes up during his term/semester
def displayStudentCourses(self, numStudent):
if self.number == numStudent:
if self.courses:
print(self.courses)
else:
print('You have not selected any courses. Please choose a course.')
# Using this, the selected course will be added to the student's portfolio/data
def studentCourseAdding(self, wantedCourse, numStudent):
if self.number == numStudent:
self.courses.append(wantedCourse)
print('You Added ' + wantedCourse + ' to your schedule, successfully!') | class Student:
num_reg = []
def __init__(self, number, name, family, courses=None):
if courses is None:
courses = []
self.number = number
self.numReg.append(self)
self.name = name
self.family = family
self.courses = courses
def display_student(self):
print('You are logged in as ' + self.name + ' ' + self.family)
def display_student_courses(self, numStudent):
if self.number == numStudent:
if self.courses:
print(self.courses)
else:
print('You have not selected any courses. Please choose a course.')
def student_course_adding(self, wantedCourse, numStudent):
if self.number == numStudent:
self.courses.append(wantedCourse)
print('You Added ' + wantedCourse + ' to your schedule, successfully!') |
###############################################################################
###############################################################################
#Copyright (c) 2016, Andy Schroder
#See the file README.md for licensing information.
###############################################################################
###############################################################################
#################################################################################################
#Input parameters
#################################################################################################
###########################
#cycle input parameters
###########################
CycleInputParameters['MaximumTemperature']=650.0+273.0
CycleInputParameters['StartingProperties']['Temperature']=273.0+47
CycleInputParameters['FluidType']='Carbon Dioxide'
CycleInputParameters['PowerOutput']=1.0*10**6 #1MW
###########################
#common recuperator parameters
DeltaPPerDeltaT=0
###########################
#piston related design assumptions and required pressure ratio
###########################
CycleInputParameters['Piston']['MassFraction']=1.0
CycleInputParameters['Piston']['IsentropicEfficiency']=1.0
###########################
#heater related design assumptions
###########################
CycleInputParameters['SecondPlusThirdHeating']['MaximumTemperature']=CycleInputParameters['MaximumTemperature']
CycleInputParameters['SecondPlusThirdHeating']['MassFraction']=1
CycleInputParameters['SecondPlusThirdHeating']['DeltaPPerDeltaT']=DeltaPPerDeltaT
###########################
#cooler related design assumptions
###########################
CycleInputParameters['TotalFractionCooler']['MinimumTemperature']=CycleInputParameters['StartingProperties']['Temperature']
CycleInputParameters['TotalFractionCooler']['MassFraction']=1
CycleInputParameters['TotalFractionCooler']['DeltaPPerDeltaT']=DeltaPPerDeltaT
###########################
#recuperator related design assumptions
###########################
CycleInputParameters['HTRecuperator']['NumberofTemperatures']=200 #keep in mind that the resolution of the data being interpolated is the real upper limit on the usefulness of this value
CycleInputParameters['HTRecuperator']['LowPressure']['MassFraction']=1
CycleInputParameters['HTRecuperator']['HighPressure']['MassFraction']=1
CycleInputParameters['HTRecuperator']['HighPressure']['ConstantVolume']=True
CycleInputParameters['HTRecuperator']['DeltaPPerDeltaT']=DeltaPPerDeltaT #maybe this should be different for high and low pressure sides?
CycleInputParameters['HTRecuperator']['MinimumDeltaT']=0
#################################################################################################
#end Input parameters
#################################################################################################
| CycleInputParameters['MaximumTemperature'] = 650.0 + 273.0
CycleInputParameters['StartingProperties']['Temperature'] = 273.0 + 47
CycleInputParameters['FluidType'] = 'Carbon Dioxide'
CycleInputParameters['PowerOutput'] = 1.0 * 10 ** 6
delta_p_per_delta_t = 0
CycleInputParameters['Piston']['MassFraction'] = 1.0
CycleInputParameters['Piston']['IsentropicEfficiency'] = 1.0
CycleInputParameters['SecondPlusThirdHeating']['MaximumTemperature'] = CycleInputParameters['MaximumTemperature']
CycleInputParameters['SecondPlusThirdHeating']['MassFraction'] = 1
CycleInputParameters['SecondPlusThirdHeating']['DeltaPPerDeltaT'] = DeltaPPerDeltaT
CycleInputParameters['TotalFractionCooler']['MinimumTemperature'] = CycleInputParameters['StartingProperties']['Temperature']
CycleInputParameters['TotalFractionCooler']['MassFraction'] = 1
CycleInputParameters['TotalFractionCooler']['DeltaPPerDeltaT'] = DeltaPPerDeltaT
CycleInputParameters['HTRecuperator']['NumberofTemperatures'] = 200
CycleInputParameters['HTRecuperator']['LowPressure']['MassFraction'] = 1
CycleInputParameters['HTRecuperator']['HighPressure']['MassFraction'] = 1
CycleInputParameters['HTRecuperator']['HighPressure']['ConstantVolume'] = True
CycleInputParameters['HTRecuperator']['DeltaPPerDeltaT'] = DeltaPPerDeltaT
CycleInputParameters['HTRecuperator']['MinimumDeltaT'] = 0 |
#D
def fibonacci(N :int) -> int:
if N == 1:
return 1
elif N == 2:
return 1
else:
return fibonacci(N-2)+fibonacci(N-1)
def main():
# input
N = int(input())
# compute
# output
print(fibonacci(N))
if __name__ == '__main__':
main()
| def fibonacci(N: int) -> int:
if N == 1:
return 1
elif N == 2:
return 1
else:
return fibonacci(N - 2) + fibonacci(N - 1)
def main():
n = int(input())
print(fibonacci(N))
if __name__ == '__main__':
main() |
class Solution:
def countVowelStrings(self, n: int) -> int:
d = ['a', 'e', 'i', 'o', 'u']
path = []
count = 0
def backtracking(n, start):
nonlocal count
if n == 0:
count += 1
return
for i in range(start, 5):
path.append(d[i])
backtracking(n-1, i)
path.pop()
return
backtracking(n, 0)
return count | class Solution:
def count_vowel_strings(self, n: int) -> int:
d = ['a', 'e', 'i', 'o', 'u']
path = []
count = 0
def backtracking(n, start):
nonlocal count
if n == 0:
count += 1
return
for i in range(start, 5):
path.append(d[i])
backtracking(n - 1, i)
path.pop()
return
backtracking(n, 0)
return count |
class _EventTarget:
'''https://developer.mozilla.org/en-US/docs/Web/API/EventTarget'''
NotImplemented
class _Node(_EventTarget):
'''https://developer.mozilla.org/en-US/docs/Web/API/Node'''
NotImplemented
class _Element(_Node):
'''ref of https://developer.mozilla.org/en-US/docs/Web/API/Element'''
NotImplemented | class _Eventtarget:
"""https://developer.mozilla.org/en-US/docs/Web/API/EventTarget"""
NotImplemented
class _Node(_EventTarget):
"""https://developer.mozilla.org/en-US/docs/Web/API/Node"""
NotImplemented
class _Element(_Node):
"""ref of https://developer.mozilla.org/en-US/docs/Web/API/Element"""
NotImplemented |
# This is function for sorting the array using bubble sort
def bubble_sort(length, array): # It takes two arguments -> Length of the array and the array itself.
for i in range(length):
j = 0
for j in range(0, length-i-1):
if array[j] > array[j+1]:
array[j], array[j+1] = array[j+1], array[j]
return array #Returns sorted array
# This is the main function of the program
def main():
length = int(input('Enter the length of the array to be entered : ')) # Taking the length of array
array = [int(i) for i in input('Enter Array Elements : ').split()] # Taking array elements
sorted_array = bubble_sort(length,array) # Calling the function for sorting the array using bubble sort
print("Sorted Array is : ")
for i in sorted_array: # Printing the sorted array
print(i, end = " ")
# Running the main code of the program
if __name__ == '__main__':
main() | def bubble_sort(length, array):
for i in range(length):
j = 0
for j in range(0, length - i - 1):
if array[j] > array[j + 1]:
(array[j], array[j + 1]) = (array[j + 1], array[j])
return array
def main():
length = int(input('Enter the length of the array to be entered : '))
array = [int(i) for i in input('Enter Array Elements : ').split()]
sorted_array = bubble_sort(length, array)
print('Sorted Array is : ')
for i in sorted_array:
print(i, end=' ')
if __name__ == '__main__':
main() |
print(type(1))
print(type('runnob'))
print(type([2]))
print(type({0:'zero'}))
| print(type(1))
print(type('runnob'))
print(type([2]))
print(type({0: 'zero'})) |
# author: Fei Gao
#
# Count And Say
#
# The count-and-say sequence is the sequence of integers beginning as follows:
# 1, 11, 21, 1211, 111221, ...
# 1 is read off as "one 1" or 11.
# 11 is read off as "two 1s" or 21.
# 21 is read off as "one 2, then one 1" or 1211.
# Given an integer n, generate the nth sequence.
# Note: The sequence of integers will be represented as a string.
class Solution:
# @return a string
def countAndSay(self, n):
def process(s):
l = []
start = 0
for end in range(1, len(s)):
if s[end] != s[end-1]:
l.append(s[start:end])
start = end
l.append(s[start:])
res = ''
for ls in l:
res += str(len(ls)) + ls[0]
return res
seq = ['', '1']
for i in range(1, n):
seq.append(process(seq[i]))
return seq[n]
def main():
solver = Solution()
for n in range(10):
print(n, ': ', solver.countAndSay(n))
pass
if __name__ == '__main__':
main()
pass
| class Solution:
def count_and_say(self, n):
def process(s):
l = []
start = 0
for end in range(1, len(s)):
if s[end] != s[end - 1]:
l.append(s[start:end])
start = end
l.append(s[start:])
res = ''
for ls in l:
res += str(len(ls)) + ls[0]
return res
seq = ['', '1']
for i in range(1, n):
seq.append(process(seq[i]))
return seq[n]
def main():
solver = solution()
for n in range(10):
print(n, ': ', solver.countAndSay(n))
pass
if __name__ == '__main__':
main()
pass |
file = open('file.txt', 'r')
f = file.readlines()
readingList = []
for line in f:
readingList.append(line.strip())
print(readingList)
file.close()
| file = open('file.txt', 'r')
f = file.readlines()
reading_list = []
for line in f:
readingList.append(line.strip())
print(readingList)
file.close() |
#right rotation of array
#it avoids unnecessary no. of recursions for large no. of rotations.
def right_rot(arr,s):# s is the no. of times to rotate
n=len(arr)
s=s%n
#print(s)
for a in range(s):
store=arr[n-1]
for i in range(n-2,-1,-1):
arr[i+1]=arr[i]
arr[0]=store
return(arr)
arr = [11,1,2,3,4]
s = 1
print(right_rot(arr,s))
| def right_rot(arr, s):
n = len(arr)
s = s % n
for a in range(s):
store = arr[n - 1]
for i in range(n - 2, -1, -1):
arr[i + 1] = arr[i]
arr[0] = store
return arr
arr = [11, 1, 2, 3, 4]
s = 1
print(right_rot(arr, s)) |
n = 0
try:
i = 0
while True:
m = input()
if m[0] == '+':
n += 1
elif m[0] == '-':
n -= 1
else:
i += (len(m.split(':')[1]) * n)
except:
pass
print(i)
| n = 0
try:
i = 0
while True:
m = input()
if m[0] == '+':
n += 1
elif m[0] == '-':
n -= 1
else:
i += len(m.split(':')[1]) * n
except:
pass
print(i) |
def box(m):
m = m.lower() # converting lowercase
arr = [0] * len(m) # initializing array with same length as the length
i = 0
for n in m:
if not ('a' <= n <= 'z'): # excluding special characters
continue
arr[i] = ord(n) - ord('a') # subtracting ascii character values by a so we can map it to 0-25
i += 1
arr_f = arr[0:i] # array final - to exclude the special character in the array
return arr_f
def lock(arr_f, y):
a = len(arr_f)
k = box(y)
b = 1
while b < a: # using the loop to make the keys array
k.append(k[b - 1])
b += 1
enc = [0] * len(arr_f) # initializing array
i = 0
for x in arr_f:
enc[i] = (x + k[i]) % 26 # shifting the array to its keys value %26 is for looping from z to a
i += 1
enc_f = enc[0:i]
return enc_f
def unbox(enc_f):
m = ""
for x in enc_f:
m += chr(x + ord('a'))
return m
def encrypt(m, k):
arr = box(m)
enc = lock(arr, k)
c = unbox(enc)
return c
def decrypt(c, y):
cipher = box(c)
a = len(c)
k = box(y)
b = 1
while b < a: # using the loop to make the keys array
k.append(k[b - 1])
b += 1
dec = [0] * len(c) # initializing array
i = 0
for x in cipher:
dec[i] = (x - k[i]) % 26 # shifting the array to its keys value %26 is for looping from z to a
i += 1
dec_f = dec[0:i]
plain = unbox(dec_f)
return plain
def prob(m):
a = box(m)
b = len(a)
arr = [0] * 26
arr1 = [0.082, 0.015, 0.028, 0.043, 0.127, 0.022, 0.020, 0.061, 0.070, 0.002, 0.008, 0.040, 0.024, 0.067, 0.075, 0.019, 0.001, 0.060, 0.063, 0.091, 0.028, 0.010, 0.023, 0.001, 0.020, 0.001]
# arr1 is the probability distribution for general english taken from a study resource (professor's video online)
j = 0
while j < 26: #these loops are counting the number of letters in the message
ctr = 0
i = 0
while i < b:
if a[i] == j:
ctr += 1
arr[j] = ctr
i += 1
j += 1
k = 0
while k < 26:
arr[k] = (arr[k]/b) * (arr1[k])
k += 1
return arr
def prob1(m):
a = box(m)
b = len(a)
arr = [0] * 26
arr1 = [0.082, 0.015, 0.028, 0.043, 0.127, 0.022, 0.020, 0.061, 0.070, 0.002, 0.008, 0.040, 0.024, 0.067, 0.075, 0.019, 0.001, 0.060, 0.063, 0.091, 0.028, 0.010, 0.023, 0.001, 0.020, 0.001]
# arr1 is the probability distribution for general english taken from a study resource (professor's video online)
j = 0
while j < 26: #these loops are counting the number of letters in the message
ctr = 0
i = 0
while i < b:
if a[i] == j:
ctr += 1
arr[j] = ctr
i += 1
j += 1
k = 0
while k < 26:
arr[k] = (arr[k]/b) * (arr[k]/b)
k += 1
return arr
def sum_prob(arr):
s = 0
for i in arr:
s = s + i
return s
def seperate(m, size):
source = box(m) # putting the message in the array
return [source[i::size] for i in range(size)] # (Condensed everything in one line) seperating that array into a nested array of the specified size chunks
| def box(m):
m = m.lower()
arr = [0] * len(m)
i = 0
for n in m:
if not 'a' <= n <= 'z':
continue
arr[i] = ord(n) - ord('a')
i += 1
arr_f = arr[0:i]
return arr_f
def lock(arr_f, y):
a = len(arr_f)
k = box(y)
b = 1
while b < a:
k.append(k[b - 1])
b += 1
enc = [0] * len(arr_f)
i = 0
for x in arr_f:
enc[i] = (x + k[i]) % 26
i += 1
enc_f = enc[0:i]
return enc_f
def unbox(enc_f):
m = ''
for x in enc_f:
m += chr(x + ord('a'))
return m
def encrypt(m, k):
arr = box(m)
enc = lock(arr, k)
c = unbox(enc)
return c
def decrypt(c, y):
cipher = box(c)
a = len(c)
k = box(y)
b = 1
while b < a:
k.append(k[b - 1])
b += 1
dec = [0] * len(c)
i = 0
for x in cipher:
dec[i] = (x - k[i]) % 26
i += 1
dec_f = dec[0:i]
plain = unbox(dec_f)
return plain
def prob(m):
a = box(m)
b = len(a)
arr = [0] * 26
arr1 = [0.082, 0.015, 0.028, 0.043, 0.127, 0.022, 0.02, 0.061, 0.07, 0.002, 0.008, 0.04, 0.024, 0.067, 0.075, 0.019, 0.001, 0.06, 0.063, 0.091, 0.028, 0.01, 0.023, 0.001, 0.02, 0.001]
j = 0
while j < 26:
ctr = 0
i = 0
while i < b:
if a[i] == j:
ctr += 1
arr[j] = ctr
i += 1
j += 1
k = 0
while k < 26:
arr[k] = arr[k] / b * arr1[k]
k += 1
return arr
def prob1(m):
a = box(m)
b = len(a)
arr = [0] * 26
arr1 = [0.082, 0.015, 0.028, 0.043, 0.127, 0.022, 0.02, 0.061, 0.07, 0.002, 0.008, 0.04, 0.024, 0.067, 0.075, 0.019, 0.001, 0.06, 0.063, 0.091, 0.028, 0.01, 0.023, 0.001, 0.02, 0.001]
j = 0
while j < 26:
ctr = 0
i = 0
while i < b:
if a[i] == j:
ctr += 1
arr[j] = ctr
i += 1
j += 1
k = 0
while k < 26:
arr[k] = arr[k] / b * (arr[k] / b)
k += 1
return arr
def sum_prob(arr):
s = 0
for i in arr:
s = s + i
return s
def seperate(m, size):
source = box(m)
return [source[i::size] for i in range(size)] |
# coding=utf-8
# --------------------------------------------------------------------------------------------
# Copyright (c) Microsoft Corporation. All rights reserved.
# Licensed under the MIT License. See License.txt in the project root for license information.
# --------------------------------------------------------------------------------------------
class Job:
def __init__(self, job: dict):
self.display_name = job.get("displayName")
self.id = job.get("id")
self.group = job.get("group")
self.status = job.get("status")
self.data = job.get("data")
self.description = job.get("description")
self.batch = job.get("batch")
self.cancellation_threshold = job.get("cancellationThreshold")
| class Job:
def __init__(self, job: dict):
self.display_name = job.get('displayName')
self.id = job.get('id')
self.group = job.get('group')
self.status = job.get('status')
self.data = job.get('data')
self.description = job.get('description')
self.batch = job.get('batch')
self.cancellation_threshold = job.get('cancellationThreshold') |
load("@bazel_tools//tools/build_defs/repo:http.bzl", "http_archive")
def grpc_rules_repository():
http_archive(
name = "rules_proto_grpc",
urls = ["https://github.com/rules-proto-grpc/rules_proto_grpc/archive/2.0.0.tar.gz"],
sha256 = "d771584bbff98698e7cb3cb31c132ee206a972569f4dc8b65acbdd934d156b33",
strip_prefix = "rules_proto_grpc-2.0.0",
)
| load('@bazel_tools//tools/build_defs/repo:http.bzl', 'http_archive')
def grpc_rules_repository():
http_archive(name='rules_proto_grpc', urls=['https://github.com/rules-proto-grpc/rules_proto_grpc/archive/2.0.0.tar.gz'], sha256='d771584bbff98698e7cb3cb31c132ee206a972569f4dc8b65acbdd934d156b33', strip_prefix='rules_proto_grpc-2.0.0') |
class Embed:
def __init__(self, **kwargs):
allowed_args = ("title", "description", "color")
for key, value in kwargs.items():
if key in allowed_args:
setattr(self, key, value)
def set_image(self, *, url: str):
self.image = {"url": url}
def set_thumbnail(self, *, url: str):
self.thumbnail = {"url": url}
def set_footer(self, *, text: str, icon_url: str = None):
self.footer = {"text": text}
if icon_url:
self.footer["icon_url"] = icon_url
def set_author(self, *, name: str, icon_url: str = None):
self.author = {"name": name}
if icon_url:
self.author["icon_url"] = icon_url
def add_field(self, *, name: str, value: str, inline: bool = False):
if not hasattr(self, "fields"):
self.fields = []
self.fields.append({
"name": name,
"value": value,
"inline": inline
}) | class Embed:
def __init__(self, **kwargs):
allowed_args = ('title', 'description', 'color')
for (key, value) in kwargs.items():
if key in allowed_args:
setattr(self, key, value)
def set_image(self, *, url: str):
self.image = {'url': url}
def set_thumbnail(self, *, url: str):
self.thumbnail = {'url': url}
def set_footer(self, *, text: str, icon_url: str=None):
self.footer = {'text': text}
if icon_url:
self.footer['icon_url'] = icon_url
def set_author(self, *, name: str, icon_url: str=None):
self.author = {'name': name}
if icon_url:
self.author['icon_url'] = icon_url
def add_field(self, *, name: str, value: str, inline: bool=False):
if not hasattr(self, 'fields'):
self.fields = []
self.fields.append({'name': name, 'value': value, 'inline': inline}) |
a = 7
b = 3
def func1(c,d):
e = c + d
e += c
e *= d
return e
f = func1(a,b)
print (f) | a = 7
b = 3
def func1(c, d):
e = c + d
e += c
e *= d
return e
f = func1(a, b)
print(f) |
a: str
a: bool = True
my_long_var_aaaaaaaaaaaaaaaaaaaaaaaaaa: MyLongTypeAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA
my_long_var_aaaaaaaaaaaaaaaaaaaaaaaaaa: MyLongTypeAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA = 1
| a: str
a: bool = True
my_long_var_aaaaaaaaaaaaaaaaaaaaaaaaaa: MyLongTypeAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA
my_long_var_aaaaaaaaaaaaaaaaaaaaaaaaaa: MyLongTypeAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA = 1 |
class Edge(object):
def __init__(self, u, v, w):
self.__orig = u
self.__dest = v
self.__w = w
def getOrig(self):
return self.__orig
def getDest(self):
return self.__dest
def getW(self):
return self.__w
| class Edge(object):
def __init__(self, u, v, w):
self.__orig = u
self.__dest = v
self.__w = w
def get_orig(self):
return self.__orig
def get_dest(self):
return self.__dest
def get_w(self):
return self.__w |
class UltrasonicSensor:
def __init__(self, megapi, slot):
self._megapi = megapi
self._slot = slot
self._last_val = 400
def read(self):
self._megapi.ultrasonicSensorRead(self._slot, self._on_forward_ultrasonic_read)
def get_value(self):
return self._last_val
def _on_forward_ultrasonic_read(self, val):
self._last_val = val
| class Ultrasonicsensor:
def __init__(self, megapi, slot):
self._megapi = megapi
self._slot = slot
self._last_val = 400
def read(self):
self._megapi.ultrasonicSensorRead(self._slot, self._on_forward_ultrasonic_read)
def get_value(self):
return self._last_val
def _on_forward_ultrasonic_read(self, val):
self._last_val = val |
def f(t):
# relation between f and t
return value
def rxn1(C,t):
return np.array([f(t)*C0/v-f(t)*C[0]/v-k*C[0], f(t)*C[0]/v-f(t)*C[1]/v-k*C[1]])
| def f(t):
return value
def rxn1(C, t):
return np.array([f(t) * C0 / v - f(t) * C[0] / v - k * C[0], f(t) * C[0] / v - f(t) * C[1] / v - k * C[1]]) |
name = input("what is your name? ")
age = int(input("how old are you {0}? ".format(name)))
if (18 <= age < 31):
print("welcome to holiday")
else:
print("you are not 18-30") | name = input('what is your name? ')
age = int(input('how old are you {0}? '.format(name)))
if 18 <= age < 31:
print('welcome to holiday')
else:
print('you are not 18-30') |
a,b = map(int,input().split())
def multiply(a,b):
return a*b
print(multiply(a,b)) | (a, b) = map(int, input().split())
def multiply(a, b):
return a * b
print(multiply(a, b)) |
class CoordLinkedList:
# a linked list object
def __init__ (self,node=None,y=None,x=None,up=None,down=None,left=None,right=None):
self.up = up
self.down = down
self.left = left
self.right = right
if isinstance(node,(list,set,tuple)) and len(node) == 2:
self.node = tuple(node)
elif x and y:
self.node = (y,x)
def receive (self,nodes):
if not isinstance(nodes,(list,set,tuple)):
nodes = {nodes}
for n in nodes:
if isinstance(n,(tuple)) and len(n) == 2:
if n == (self.node[0]-1,self.node[1]):
self.up = n
elif n == (self.node[0]+1,self.node[1]):
self.down = n
elif n == (self.node[0],self.node[1]+1):
self.right = n
elif n == (self.node[0],self.node[1]-1):
self.left = n
def send(self,nodes=None):
if not nodes:
nodes = []
returnlist = []
if self.down:
returnlist.append(self.down)
if self.up:
returnlist.append(self.up)
if self.left:
returnlist.append(self.left)
if self.right:
returnlist.append(self.right)
return [x for x in returnlist if x not in nodes]
| class Coordlinkedlist:
def __init__(self, node=None, y=None, x=None, up=None, down=None, left=None, right=None):
self.up = up
self.down = down
self.left = left
self.right = right
if isinstance(node, (list, set, tuple)) and len(node) == 2:
self.node = tuple(node)
elif x and y:
self.node = (y, x)
def receive(self, nodes):
if not isinstance(nodes, (list, set, tuple)):
nodes = {nodes}
for n in nodes:
if isinstance(n, tuple) and len(n) == 2:
if n == (self.node[0] - 1, self.node[1]):
self.up = n
elif n == (self.node[0] + 1, self.node[1]):
self.down = n
elif n == (self.node[0], self.node[1] + 1):
self.right = n
elif n == (self.node[0], self.node[1] - 1):
self.left = n
def send(self, nodes=None):
if not nodes:
nodes = []
returnlist = []
if self.down:
returnlist.append(self.down)
if self.up:
returnlist.append(self.up)
if self.left:
returnlist.append(self.left)
if self.right:
returnlist.append(self.right)
return [x for x in returnlist if x not in nodes] |
# Definition for a binary tree node.
# class TreeNode:
# def __init__(self, x):
# self.val = x
# self.left = None
# self.right = None
class Solution:
def kthSmallest(self, root: TreeNode, k: int) -> int:
data = []
def traverse(node):
if node.left:
traverse(node.left)
data.append(node.val)
if node.right:
traverse(node.right)
traverse(root)
return data[k - 1] | class Solution:
def kth_smallest(self, root: TreeNode, k: int) -> int:
data = []
def traverse(node):
if node.left:
traverse(node.left)
data.append(node.val)
if node.right:
traverse(node.right)
traverse(root)
return data[k - 1] |
# List custom images
def list_custom_images_subparser(subparser):
list_images = subparser.add_parser(
'list-custom-images',
description=('***List custom'
' saved images of'
' producers/consumers'
' account'),
help=('List custom'
' saved images of'
' producers/consumers'
' account'))
group_key = list_images.add_mutually_exclusive_group(required=True)
group_key.add_argument('-pn',
'--producer-username',
help="Producer\'s(source account) username")
group_key.add_argument('-cn',
'--consumer-username',
dest='producer_username',
metavar='CONSUMER_USERNAME',
help="Consumer\'s(destination account) username")
group_apikey = list_images.add_mutually_exclusive_group(required=True)
group_apikey.add_argument('-pa',
'--producer-apikey',
help="Producer\'s(source account) apikey")
group_apikey.add_argument('-ca',
'--consumer-apikey',
dest='producer_apikey',
metavar='CONSUMER_APIKEY',
help="Consumer\'s(destination account) apikey")
list_images.add_argument('-u',
'--uuid',
help="Image ID number")
| def list_custom_images_subparser(subparser):
list_images = subparser.add_parser('list-custom-images', description='***List custom saved images of producers/consumers account', help='List custom saved images of producers/consumers account')
group_key = list_images.add_mutually_exclusive_group(required=True)
group_key.add_argument('-pn', '--producer-username', help="Producer's(source account) username")
group_key.add_argument('-cn', '--consumer-username', dest='producer_username', metavar='CONSUMER_USERNAME', help="Consumer's(destination account) username")
group_apikey = list_images.add_mutually_exclusive_group(required=True)
group_apikey.add_argument('-pa', '--producer-apikey', help="Producer's(source account) apikey")
group_apikey.add_argument('-ca', '--consumer-apikey', dest='producer_apikey', metavar='CONSUMER_APIKEY', help="Consumer's(destination account) apikey")
list_images.add_argument('-u', '--uuid', help='Image ID number') |
#
# @lc app=leetcode id=543 lang=python3
#
# [543] Diameter of Binary Tree
#
# @lc code=start
# Definition for a binary tree node.
# class TreeNode:
# def __init__(self, x):
# self.val = x
# self.left = None
# self.right = None
class Solution:
def diameterOfBinaryTree(self, root):
self.ans = 0
self.pathfinder(root)
return self.ans
def pathfinder(self, root):
if root is None:
return 0
lh = self.pathfinder(root.left)
rh = self.pathfinder(root.right)
self.ans = max(self.ans, lh + rh)
return max(lh, rh) + 1
# @lc code=end
| class Solution:
def diameter_of_binary_tree(self, root):
self.ans = 0
self.pathfinder(root)
return self.ans
def pathfinder(self, root):
if root is None:
return 0
lh = self.pathfinder(root.left)
rh = self.pathfinder(root.right)
self.ans = max(self.ans, lh + rh)
return max(lh, rh) + 1 |
VISUALIZATION_CONFIG = {
'requirements': ['d3', 'datagramas', 'topojson', 'cartogram'],
'visualization_name': 'datagramas.cartogram',
'figure_id': None,
'container_type': 'svg',
'data': {
'geometry': None,
'area_dataframe': None,
},
'options': {
},
'variables': {
'width': 960,
'height': 500,
'padding': {'left': 0, 'top': 0, 'right': 0, 'bottom': 0},
'feature_id': 'id',
'label': True,
'path_opacity': 1.0,
'path_stroke': 'gray',
'path_stroke_width': 1.0,
'fill_color': 'none',
'area_value': 'value',
'area_feature_name': 'id',
'area_opacity': 0.75,
'area_transition_delay': 0,
'feature_name': None,
'label_font_size': 10,
'label_color': 'black',
'bounding_box': None,
'na_value': 0.000001
},
'colorables': {
'area_color': {'value': None, 'palette': None, 'scale': None, 'n_colors': None, 'legend': False},
},
'auxiliary': {
'path',
'projection',
'original_geometry',
'area_colors',
'area_carto_values'
}
} | visualization_config = {'requirements': ['d3', 'datagramas', 'topojson', 'cartogram'], 'visualization_name': 'datagramas.cartogram', 'figure_id': None, 'container_type': 'svg', 'data': {'geometry': None, 'area_dataframe': None}, 'options': {}, 'variables': {'width': 960, 'height': 500, 'padding': {'left': 0, 'top': 0, 'right': 0, 'bottom': 0}, 'feature_id': 'id', 'label': True, 'path_opacity': 1.0, 'path_stroke': 'gray', 'path_stroke_width': 1.0, 'fill_color': 'none', 'area_value': 'value', 'area_feature_name': 'id', 'area_opacity': 0.75, 'area_transition_delay': 0, 'feature_name': None, 'label_font_size': 10, 'label_color': 'black', 'bounding_box': None, 'na_value': 1e-06}, 'colorables': {'area_color': {'value': None, 'palette': None, 'scale': None, 'n_colors': None, 'legend': False}}, 'auxiliary': {'path', 'projection', 'original_geometry', 'area_colors', 'area_carto_values'}} |
class Solution(object):
def reconstructQueue(self, people):
people.sort(key=lambda x: (-x[0], x[1]))
output = []
for p in people:
output.insert(p[1], p)
return output
m = int(input())
k = Solution()
array_input = []
for x in range(m):
array_input.append([int(y) for y in input().split()])
gh =k.reconstructQueue(array_input)
for s in gh:
print(*s)
| class Solution(object):
def reconstruct_queue(self, people):
people.sort(key=lambda x: (-x[0], x[1]))
output = []
for p in people:
output.insert(p[1], p)
return output
m = int(input())
k = solution()
array_input = []
for x in range(m):
array_input.append([int(y) for y in input().split()])
gh = k.reconstructQueue(array_input)
for s in gh:
print(*s) |
def pent_d(n=1, pents=set()):
while True:
p_n = n*(3*n - 1)//2
for p in pents:
if p_n - p in pents and 2*p - p_n in pents:
return 2*p - p_n
pents.add(p_n)
n += 1
print(pent_d())
# Copyright Junipyr. All rights reserved.
# https://github.com/Junipyr | def pent_d(n=1, pents=set()):
while True:
p_n = n * (3 * n - 1) // 2
for p in pents:
if p_n - p in pents and 2 * p - p_n in pents:
return 2 * p - p_n
pents.add(p_n)
n += 1
print(pent_d()) |
n = int(input())
for i in range(n):
vet = list(map(int, input().split()))
partida = vet[0]
qtd = vet[1]
if partida % 2 == 0:
partida += 1
soma = 0
for j in range(qtd):
soma += partida
partida += 2
print(soma)
| n = int(input())
for i in range(n):
vet = list(map(int, input().split()))
partida = vet[0]
qtd = vet[1]
if partida % 2 == 0:
partida += 1
soma = 0
for j in range(qtd):
soma += partida
partida += 2
print(soma) |
# Scrapy settings for Scrapy project
#
# For simplicity, this file contains only settings considered important or
# commonly used. You can find more settings consulting the documentation:
#
# https://docs.scrapy.org/en/latest/topics/settings.html
# https://docs.scrapy.org/en/latest/topics/downloader-middleware.html
# https://docs.scrapy.org/en/latest/topics/spider-middleware.html
BOT_NAME = 'scrapy_demo'
SPIDER_MODULES = ['Scrapy.spiders'] # look for spiders here
NEWSPIDER_MODULE = 'Scrapy.spiders' # create new spiders here
LOG_LEVEL='INFO'
# enable following lines for testing ---
CLOSESPIDER_PAGECOUNT = 20 # test a few pages
# ---
# Crawl responsibly by identifying yourself (and your website) on the user-agent
USER_AGENT = 'Scrapy Demo'
# Obey robots.txt rules
ROBOTSTXT_OBEY = False
# Image pipelin settings
IMAGES_EXPIRES = 1 # 1 days of delay for images expiration
IMAGES_STORE = './images'
# Configure item pipelines
# See https://docs.scrapy.org/en/latest/topics/item-pipeline.html
ITEM_PIPELINES = {
'scrapy.pipelines.images.ImagesPipeline': 1,
'Scrapy.pipelines.BookPipeline': 300
}
| bot_name = 'scrapy_demo'
spider_modules = ['Scrapy.spiders']
newspider_module = 'Scrapy.spiders'
log_level = 'INFO'
closespider_pagecount = 20
user_agent = 'Scrapy Demo'
robotstxt_obey = False
images_expires = 1
images_store = './images'
item_pipelines = {'scrapy.pipelines.images.ImagesPipeline': 1, 'Scrapy.pipelines.BookPipeline': 300} |
# Copyright 2020 Adobe. All rights reserved.
# This file is licensed to you under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License. You may obtain a copy
# of the License at http://www.apache.org/licenses/LICENSE-2.0
# Unless required by applicable law or agreed to in writing, software distributed under
# the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR REPRESENTATIONS
# OF ANY KIND, either express or implied. See the License for the specific language
# governing permissions and limitations under the License.
load("@io_bazel_rules_docker//container:providers.bzl", "PushInfo")
load(
"@io_bazel_rules_docker//skylib:path.bzl",
_get_runfile_path = "runfile",
)
load("//skylib:providers.bzl", "ImagePushesInfo")
load("//skylib/workspace:aspect.bzl", "pushable_aspect")
def _file_to_runfile(ctx, file):
return file.owner.workspace_root or ctx.workspace_name + "/" + file.short_path
def _workspace_impl(ctx):
transitive_executables = []
transitive_runfiles = []
transitive_data = []
for t in ctx.attr.data:
transitive_data.append(t[DefaultInfo].files)
# flatten & 'uniquify' our list of asset files
data = depset(transitive = transitive_data).to_list()
runfiles = depset(transitive = transitive_runfiles).to_list()
files = []
tars = []
for src in ctx.attr.srcs:
tar = src.files.to_list()[0]
tars.append(tar)
rf = ctx.runfiles(files = runfiles + data + tars + ctx.files._bash_runfiles)
trans_img_pushes = []
if ctx.attr.push:
trans_img_pushes = depset(transitive = [
obj[ImagePushesInfo].image_pushes
for obj in ctx.attr.srcs
if ImagePushesInfo in obj
]).to_list()
files += [obj.files_to_run.executable for obj in trans_img_pushes]
for obj in trans_img_pushes:
rf = rf.merge(obj[DefaultInfo].default_runfiles)
ctx.actions.expand_template(
template = ctx.file._template,
substitutions = {
"%{workspace_tar_targets}": " ".join([json.encode(_file_to_runfile(ctx, t)) for t in tars]),
"%{push_targets}": " ".join([json.encode(_file_to_runfile(ctx, exe.files_to_run.executable)) for exe in trans_img_pushes]),
# "async $(rlocation metered/%s)" % exe.files_to_run.executable.short_path
},
output = ctx.outputs.executable,
)
return [
DefaultInfo(
files = depset(files),
runfiles = rf,
),
ImagePushesInfo(
image_pushes = depset(
transitive = [
obj[ImagePushesInfo].image_pushes
for obj in ctx.attr.srcs
if ImagePushesInfo in obj
],
),
),
]
workspace = rule(
implementation = _workspace_impl,
attrs = {
"srcs": attr.label_list(
# cfg = "host",
# allow_files = True,
aspects = [pushable_aspect],
),
"push": attr.bool(default = True),
"data": attr.label_list(
# cfg = "host",
allow_files = True,
),
"_template": attr.label(
default = Label("//skylib/workspace:workspace.sh.tpl"),
allow_single_file = True,
),
"_bash_runfiles": attr.label(
allow_files = True,
default = "@bazel_tools//tools/bash/runfiles",
),
},
executable = True,
)
| load('@io_bazel_rules_docker//container:providers.bzl', 'PushInfo')
load('@io_bazel_rules_docker//skylib:path.bzl', _get_runfile_path='runfile')
load('//skylib:providers.bzl', 'ImagePushesInfo')
load('//skylib/workspace:aspect.bzl', 'pushable_aspect')
def _file_to_runfile(ctx, file):
return file.owner.workspace_root or ctx.workspace_name + '/' + file.short_path
def _workspace_impl(ctx):
transitive_executables = []
transitive_runfiles = []
transitive_data = []
for t in ctx.attr.data:
transitive_data.append(t[DefaultInfo].files)
data = depset(transitive=transitive_data).to_list()
runfiles = depset(transitive=transitive_runfiles).to_list()
files = []
tars = []
for src in ctx.attr.srcs:
tar = src.files.to_list()[0]
tars.append(tar)
rf = ctx.runfiles(files=runfiles + data + tars + ctx.files._bash_runfiles)
trans_img_pushes = []
if ctx.attr.push:
trans_img_pushes = depset(transitive=[obj[ImagePushesInfo].image_pushes for obj in ctx.attr.srcs if ImagePushesInfo in obj]).to_list()
files += [obj.files_to_run.executable for obj in trans_img_pushes]
for obj in trans_img_pushes:
rf = rf.merge(obj[DefaultInfo].default_runfiles)
ctx.actions.expand_template(template=ctx.file._template, substitutions={'%{workspace_tar_targets}': ' '.join([json.encode(_file_to_runfile(ctx, t)) for t in tars]), '%{push_targets}': ' '.join([json.encode(_file_to_runfile(ctx, exe.files_to_run.executable)) for exe in trans_img_pushes])}, output=ctx.outputs.executable)
return [default_info(files=depset(files), runfiles=rf), image_pushes_info(image_pushes=depset(transitive=[obj[ImagePushesInfo].image_pushes for obj in ctx.attr.srcs if ImagePushesInfo in obj]))]
workspace = rule(implementation=_workspace_impl, attrs={'srcs': attr.label_list(aspects=[pushable_aspect]), 'push': attr.bool(default=True), 'data': attr.label_list(allow_files=True), '_template': attr.label(default=label('//skylib/workspace:workspace.sh.tpl'), allow_single_file=True), '_bash_runfiles': attr.label(allow_files=True, default='@bazel_tools//tools/bash/runfiles')}, executable=True) |
def changecode():
file1=input("Enter your file name1")
file2=input("Enter your file name2")
with open(file1,"r") as a:
data_a = a.read()
with open(file2,"r") as b:
data_b = b.read()
with open(file1,"w") as a:
a.write(data_b)
with open(file2,"w") as b:
b.write(data_a)
changecode()
| def changecode():
file1 = input('Enter your file name1')
file2 = input('Enter your file name2')
with open(file1, 'r') as a:
data_a = a.read()
with open(file2, 'r') as b:
data_b = b.read()
with open(file1, 'w') as a:
a.write(data_b)
with open(file2, 'w') as b:
b.write(data_a)
changecode() |
ll=range(5, 20, 5)
for i in ll:
print(i)
print (ll)
x = 'Python'
for i in range(len(x)) :
print(x[i]) | ll = range(5, 20, 5)
for i in ll:
print(i)
print(ll)
x = 'Python'
for i in range(len(x)):
print(x[i]) |
# Function returns nth element of Padovan sequence
def padovan(n):
p = 0
if n > 2:
p = padovan(n-2) + padovan(n-3)
return p
else:
p = 1
return p
def main():
while True:
n = int(input("Enter a number: "))
if n >= 0:
break
print("Invalid number,try again")
print(f"P({n}) = {padovan(n)}")
main()
| def padovan(n):
p = 0
if n > 2:
p = padovan(n - 2) + padovan(n - 3)
return p
else:
p = 1
return p
def main():
while True:
n = int(input('Enter a number: '))
if n >= 0:
break
print('Invalid number,try again')
print(f'P({n}) = {padovan(n)}')
main() |
li = []
for x in range (21):
li.append(x)
print(li)
del(li[4])
print(li)
| li = []
for x in range(21):
li.append(x)
print(li)
del li[4]
print(li) |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.